code
stringlengths
3
1.05M
repo_name
stringlengths
4
116
path
stringlengths
4
991
language
stringclasses
9 values
license
stringclasses
15 values
size
int32
3
1.05M
<?php /** Spanish (español) * * See MessagesQqq.php for message documentation incl. usage of parameters * To improve a translation please visit http://translatewiki.net * * @ingroup Language * @file * * @author -jem- * @author Aleator * @author Alhen * @author Alpertron * @author Alvaro qc * @author Amire80 * @author Armando-Martin * @author Ascánder * @author Baiji * @author Bea.miau * @author Benfutbol10 * @author Bengoa * @author Bernardom * @author Better * @author BicScope * @author Boivie * @author Candalua * @author Capmo * @author Carlitosag * @author Cerealito * @author Ciencia Al Poder * @author Clerc * @author Crazymadlover * @author Cvmontuy * @author Dalton2 * @author Danke7 * @author David0811 * @author Dferg * @author Diego Grez * @author Dmcdevit * @author Drini * @author Dvortygirl * @author Fibonacci * @author Fitoschido * @author Fluence * @author Fortega * @author Geitost * @author Gustronico * @author Gwickwire * @author Hahc21 * @author Hazard-SJ * @author Hercule * @author Icvav * @author Ihojose * @author Imre * @author Invadinado * @author Jatrobat * @author Jens Liebenau * @author Jewbask * @author Jurock * @author Kaganer * @author Larjona * @author Lin linao * @author Linterweb * @author Locos epraix * @author Luckas * @author Luis Felipe Schenone * @author Mahadeva * @author Manuelt15 * @author Maor X * @author MarcoAurelio * @author McDutchie * @author Miguel2706 * @author Muro de Aguas * @author Omnipaedista * @author Orgullomoore * @author Ovruni * @author Paucabot * @author Penarc * @author PerroVerd * @author Pertile * @author Peter Bowman * @author Pginer * @author Piolinfax * @author Platonides * @author PoLuX124 * @author QuimGil * @author Ralgis * @author Remember the dot * @author Remux * @author Richard Wolf VI * @author Salvador alc * @author Sanbec * @author Savh * @author Sethladan * @author Shirayuki * @author Spacebirdy * @author Stephensuleeman * @author Technorum * @author The Evil IP address * @author TheBITLINK * @author Titoxd * @author Toniher * @author Translationista * @author Urhixidur * @author VegaDark * @author Vivaelcelta * @author Waldir * @author Wilfredor * @author XalD * @author XanaG * @author לערי ריינהארט */ $namespaceNames = array( NS_MEDIA => 'Medio', NS_SPECIAL => 'Especial', NS_TALK => 'Discusión', NS_USER => 'Usuario', NS_USER_TALK => 'Usuario_discusión', NS_PROJECT_TALK => '$1_discusión', NS_FILE => 'Archivo', NS_FILE_TALK => 'Archivo_discusión', NS_MEDIAWIKI => 'MediaWiki', NS_MEDIAWIKI_TALK => 'MediaWiki_discusión', NS_TEMPLATE => 'Plantilla', NS_TEMPLATE_TALK => 'Plantilla_discusión', NS_HELP => 'Ayuda', NS_HELP_TALK => 'Ayuda_discusión', NS_CATEGORY => 'Categoría', NS_CATEGORY_TALK => 'Categoría_discusión', ); $namespaceAliases = array( 'Imagen' => NS_FILE, 'Imagen_Discusión' => NS_FILE_TALK, ); $namespaceGenderAliases = array( NS_USER => array( 'male' => 'Usuario', 'female' => 'Usuaria' ), NS_USER_TALK => array( 'male' => 'Usuario_Discusión', 'female' => 'Usuaria_Discusión' ), ); $specialPageAliases = array( 'Activeusers' => array( 'UsuariosActivos' ), 'Allmessages' => array( 'TodosLosMensajes' ), 'AllMyUploads' => array( 'TodasMisSubidas', 'TodosMisArchivos' ), 'Allpages' => array( 'Todas', 'Todas_las_páginas' ), 'Ancientpages' => array( 'PáginasAntiguas', 'Páginas_antiguas' ), 'Badtitle' => array( 'Título_incorrecto' ), 'Blankpage' => array( 'PáginaEnBlanco', 'BlanquearPágina', 'Blanquear_página', 'Página_en_blanco' ), 'Block' => array( 'Bloquear' ), 'Booksources' => array( 'FuentesDeLibros', 'Fuentes_de_libros' ), 'BrokenRedirects' => array( 'RedireccionesRotas', 'Redirecciones_rotas' ), 'Categories' => array( 'Categorías' ), 'ChangeEmail' => array( 'Cambiar_correo_electrónico', 'CambiarEmail', 'CambiarCorreo' ), 'ChangePassword' => array( 'Cambiar_contraseña', 'CambiarContraseña', 'ResetearContraseña', 'Resetear_contraseña' ), 'ComparePages' => array( 'Comparar_páginas', 'CompararPáginas' ), 'Confirmemail' => array( 'Confirmar_correo_electrónico', 'ConfirmarEmail' ), 'Contributions' => array( 'Contribuciones' ), 'CreateAccount' => array( 'Crear_una_cuenta', 'CrearCuenta' ), 'Deadendpages' => array( 'PáginasSinSalida', 'Páginas_sin_salida' ), 'DeletedContributions' => array( 'ContribucionesBorradas', 'Contribuciones_Borradas' ), 'DoubleRedirects' => array( 'RedireccionesDobles', 'Redirecciones_dobles' ), 'EditWatchlist' => array( 'EditarSeguimiento' ), 'Emailuser' => array( 'Enviar_correo_electrónico', 'MandarEmailUsuario' ), 'ExpandTemplates' => array( 'Sustituir_plantillas', 'Sustituidor_de_plantillas', 'Expandir_plantillas' ), 'Export' => array( 'Exportar' ), 'Fewestrevisions' => array( 'MenosEdiciones', 'Menos_ediciones' ), 'FileDuplicateSearch' => array( 'BuscarArchivosDuplicados', 'Buscar_archivos_duplicados' ), 'Filepath' => array( 'RutaDeArchivo', 'Ruta_de_archivo' ), 'Import' => array( 'Importar' ), 'Invalidateemail' => array( 'InvalidarEmail', 'Invalidar_correo_electrónico' ), 'BlockList' => array( 'UsuariosBloqueados', 'Lista_de_usuarios_bloqueados' ), 'LinkSearch' => array( 'BúsquedaDeEnlaces', 'Búsqueda_de_enlaces' ), 'Listadmins' => array( 'ListaDeAdministradores', 'Lista_de_administradores' ), 'Listbots' => array( 'ListaDeBots', 'Lista_de_bots' ), 'Listfiles' => array( 'ListaImágenes', 'Lista_de_imágenes' ), 'Listgrouprights' => array( 'ListaDerechosGrupos', 'Derechos_de_grupos_de_usuarios' ), 'Listredirects' => array( 'TodasLasRedirecciones', 'Todas_las_redirecciones' ), 'Listusers' => array( 'ListaUsuarios', 'Lista_de_usuarios' ), 'Lockdb' => array( 'BloquearBasedeDatos', 'Bloquear_base_de_datos' ), 'Log' => array( 'Registro' ), 'Lonelypages' => array( 'PáginasHuérfanas', 'Páginas_huérfanas' ), 'Longpages' => array( 'PáginasLargas', 'Páginas_largas' ), 'MergeHistory' => array( 'FusionarHistorial', 'Fusionar_historial' ), 'MIMEsearch' => array( 'BuscarPorMIME', 'Buscar_por_MIME' ), 'Mostcategories' => array( 'MásCategorizadas', 'Más_categorizadas' ), 'Mostimages' => array( 'MásImágenes', 'Con_más_imágenes' ), 'Mostlinked' => array( 'MásEnlazados', 'Más_enlazados', 'MásEnlazadas' ), 'Mostlinkedcategories' => array( 'CategoríasMásUsadas', 'Categorías_más_usadas' ), 'Mostlinkedtemplates' => array( 'PlantillasMásUsadas', 'Plantillas_más_usadas' ), 'Mostrevisions' => array( 'MásEdiciones', 'Más_ediciones' ), 'Movepage' => array( 'MoverPágina', 'Mover_página' ), 'Mycontributions' => array( 'MisContribuciones', 'Mis_contribuciones' ), 'Mypage' => array( 'MiPágina', 'Mi_página' ), 'Mytalk' => array( 'MiDiscusión', 'Mi_discusión' ), 'Myuploads' => array( 'MisArchivosSubidos' ), 'Newimages' => array( 'NuevasImágenes', 'Nuevas_imágenes' ), 'Newpages' => array( 'PáginasNuevas', 'Páginas_nuevas' ), 'PasswordReset' => array( 'RestablecerContraseña' ), 'PermanentLink' => array( 'EnlacePermanente' ), 'Popularpages' => array( 'PáginasMásVisitadas', 'PáginasPopulares', 'Páginas_más_visitadas' ), 'Preferences' => array( 'Preferencias' ), 'Prefixindex' => array( 'PáginasPorPrefijo', 'Páginas_por_prefijo' ), 'Protectedpages' => array( 'PáginasProtegidas', 'Páginas_protegidas' ), 'Protectedtitles' => array( 'TítulosProtegidos', 'Títulos_protegidos' ), 'Randompage' => array( 'Aleatoria', 'Aleatorio', 'Página_aleatoria' ), 'RandomInCategory' => array( 'Aleatorio_en_categoría' ), 'Randomredirect' => array( 'RedirecciónAleatoria', 'Redirección_aleatoria' ), 'Recentchanges' => array( 'CambiosRecientes', 'Cambios_recientes' ), 'Recentchangeslinked' => array( 'CambiosEnEnlazadas', 'Cambios_en_enlazadas' ), 'Redirect' => array( 'Redirigir' ), 'ResetTokens' => array( 'ReestablecerClaves' ), 'Revisiondelete' => array( 'BorrarRevisión', 'Borrar_revisión' ), 'Search' => array( 'Buscar' ), 'Shortpages' => array( 'PáginasCortas', 'Páginas_cortas' ), 'Specialpages' => array( 'PáginasEspeciales', 'Páginas_especiales' ), 'Statistics' => array( 'Estadísticas' ), 'Tags' => array( 'Etiquetas' ), 'Unblock' => array( 'Desbloquear' ), 'Uncategorizedcategories' => array( 'CategoríasSinCategorizar', 'Categorías_sin_categorizar' ), 'Uncategorizedimages' => array( 'ImágenesSinCategorizar', 'Imágenes_sin_categorizar' ), 'Uncategorizedpages' => array( 'PáginasSinCategorizar', 'Páginas_sin_categorizar' ), 'Uncategorizedtemplates' => array( 'PlantillasSinCategorizar', 'Plantillas_sin_categorizar' ), 'Undelete' => array( 'Restaurar' ), 'Unlockdb' => array( 'DesbloquearBasedeDatos', 'Desbloquear_base_de_datos' ), 'Unusedcategories' => array( 'CategoríasSinUso', 'Categorías_sin_uso' ), 'Unusedimages' => array( 'ImágenesSinUso', 'Imágenes_sin_uso' ), 'Unusedtemplates' => array( 'PlantillasSinUso', 'Plantillas_sin_uso' ), 'Unwatchedpages' => array( 'PáginasSinVigilar', 'Páginas_sin_vigilar' ), 'Upload' => array( 'SubirArchivo', 'Subir_archivo' ), 'UploadStash' => array( 'ArchivosEscondidos', 'FicherosEscondidos' ), 'Userlogin' => array( 'Entrar', 'Entrada_del_usuario' ), 'Userlogout' => array( 'Salida_del_usuario', 'Salir' ), 'Userrights' => array( 'PermisosUsuarios', 'Permisos_de_usuarios' ), 'Version' => array( 'Versión' ), 'Wantedcategories' => array( 'CategoríasRequeridas', 'Categorías_requeridas' ), 'Wantedfiles' => array( 'ArchivosRequeridos', 'Archivos_requeridos' ), 'Wantedpages' => array( 'PáginasRequeridas', 'Páginas_requeridas' ), 'Wantedtemplates' => array( 'PlantillasRequeridas', 'Plantillas_requeridas' ), 'Watchlist' => array( 'Seguimiento', 'Lista_de_seguimiento' ), 'Whatlinkshere' => array( 'LoQueEnlazaAquí', 'Lo_que_enlaza_aquí' ), 'Withoutinterwiki' => array( 'SinInterwikis', 'Sin_interwikis' ), ); $magicWords = array( 'redirect' => array( '0', '#REDIRECCIÓN', '#REDIRECCION', '#REDIRECT' ), 'notoc' => array( '0', '__SIN_TDC__', '__NOTDC__', '__NOTOC__' ), 'nogallery' => array( '0', '__SIN_GALERÍA__', '__NOGALERÍA__', '__NOGALERIA__', '__NOGALLERY__' ), 'forcetoc' => array( '0', '__FORZAR_TDC__', '__FORZARTDC__', '__FORZARTOC__', '__FORCETOC__' ), 'toc' => array( '0', '__TDC__', '__TOC__' ), 'noeditsection' => array( '0', '__NO_EDITAR_SECCIÓN__', '__NOEDITARSECCIÓN__', '__NOEDITARSECCION__', '__NOEDITSECTION__' ), 'currentmonth' => array( '1', 'MESACTUAL', 'MESACTUAL2', 'CURRENTMONTH', 'CURRENTMONTH2' ), 'currentmonth1' => array( '1', 'MESACTUAL1', 'CURRENTMONTH1' ), 'currentmonthname' => array( '1', 'MESACTUALCOMPLETO', 'NOMBREMESACTUAL', 'CURRENTMONTHNAME' ), 'currentmonthnamegen' => array( '1', 'MESACTUALGENITIVO', 'CURRENTMONTHNAMEGEN' ), 'currentmonthabbrev' => array( '1', 'MESACTUALABREVIADO', 'CURRENTMONTHABBREV' ), 'currentday' => array( '1', 'DÍAACTUAL', 'DIAACTUAL', 'DÍA_ACTUAL', 'DIA_ACTUAL', 'CURRENTDAY' ), 'currentday2' => array( '1', 'DÍAACTUAL2', 'DIAACTUAL2', 'DÍA_ACTUAL2', 'DIA_ACTUAL2', 'CURRENTDAY2' ), 'currentdayname' => array( '1', 'NOMBREDÍAACTUAL', 'NOMBREDIAACTUAL', 'CURRENTDAYNAME' ), 'currentyear' => array( '1', 'AÑOACTUAL', 'AÑO_ACTUAL', 'CURRENTYEAR' ), 'currenttime' => array( '1', 'HORA_MINUTOS_ACTUAL', 'HORAMINUTOSACTUAL', 'TIEMPOACTUAL', 'CURRENTTIME' ), 'currenthour' => array( '1', 'HORAACTUAL', 'HORA_ACTUAL', 'CURRENTHOUR' ), 'localmonth' => array( '1', 'MESLOCAL', 'MESLOCAL2', 'LOCALMONTH', 'LOCALMONTH2' ), 'localmonth1' => array( '1', 'MESLOCAL1', 'LOCALMONTH1' ), 'localmonthname' => array( '1', 'MESLOCALCOMPLETO', 'NOMBREMESLOCAL', 'LOCALMONTHNAME' ), 'localmonthnamegen' => array( '1', 'MESLOCALGENITIVO', 'LOCALMONTHNAMEGEN' ), 'localmonthabbrev' => array( '1', 'MESLOCALABREVIADO', 'LOCALMONTHABBREV' ), 'localday' => array( '1', 'DÍALOCAL', 'DIALOCAL', 'LOCALDAY' ), 'localday2' => array( '1', 'DIALOCAL2', 'DÍALOCAL2', 'LOCALDAY2' ), 'localdayname' => array( '1', 'NOMBREDIALOCAL', 'NOMBREDÍALOCAL', 'LOCALDAYNAME' ), 'localyear' => array( '1', 'AÑOLOCAL', 'LOCALYEAR' ), 'localtime' => array( '1', 'HORAMINUTOSLOCAL', 'TIEMPOLOCAL', 'LOCALTIME' ), 'localhour' => array( '1', 'HORALOCAL', 'LOCALHOUR' ), 'numberofpages' => array( '1', 'NÚMERODEPÁGINAS', 'NUMERODEPAGINAS', 'NUMBEROFPAGES' ), 'numberofarticles' => array( '1', 'NÚMERODEARTÍCULOS', 'NUMERODEARTICULOS', 'NUMBEROFARTICLES' ), 'numberoffiles' => array( '1', 'NÚMERODEARCHIVOS', 'NUMERODEARCHIVOS', 'NUMBEROFFILES' ), 'numberofusers' => array( '1', 'NÚMERODEUSUARIOS', 'NUMERODEUSUARIOS', 'NUMBEROFUSERS' ), 'numberofactiveusers' => array( '1', 'NÚMERODEUSUARIOSACTIVOS', 'NUMERODEUSUARIOSACTIVOS', 'NUMBEROFACTIVEUSERS' ), 'numberofedits' => array( '1', 'NÚMERODEEDICIONES', 'NUMERODEEDICIONES', 'NUMBEROFEDITS' ), 'numberofviews' => array( '1', 'NÚMERODEVISTAS', 'NUMERODEVISTAS', 'NUMBEROFVIEWS' ), 'pagename' => array( '1', 'NOMBREDEPAGINA', 'NOMBREDEPÁGINA', 'PAGENAME' ), 'pagenamee' => array( '1', 'NOMBREDEPAGINAC', 'NOMBREDEPÁGINAC', 'PAGENAMEE' ), 'namespace' => array( '1', 'ESPACIODENOMBRE', 'NAMESPACE' ), 'namespacee' => array( '1', 'ESPACIODENOMBREC', 'NAMESPACEE' ), 'namespacenumber' => array( '1', 'NÚMERODELESPACIO', 'NAMESPACENUMBER' ), 'talkspace' => array( '1', 'ESPACIODEDISCUSION', 'ESPACIODEDISCUSIÓN', 'TALKSPACE' ), 'talkspacee' => array( '1', 'ESPACIODEDISCUSIONC', 'TALKSPACEE' ), 'subjectspace' => array( '1', 'ESPACIODEASUNTO', 'ESPACIODETEMA', 'ESPACIODEARTÍCULO', 'ESPACIODEARTICULO', 'SUBJECTSPACE', 'ARTICLESPACE' ), 'subjectspacee' => array( '1', 'ESPACIODETEMAC', 'ESPACIODEASUNTOC', 'ESPACIODEARTICULOC', 'ESPACIODEARTÍCULOC', 'SUBJECTSPACEE', 'ARTICLESPACEE' ), 'fullpagename' => array( '1', 'NOMBRECOMPLETODEPÁGINA', 'NOMBRECOMPLETODEPAGINA', 'FULLPAGENAME' ), 'fullpagenamee' => array( '1', 'NOMBRECOMPLETODEPAGINAC', 'NOMBRECOMPLETODEPÁGINAC', 'FULLPAGENAMEE' ), 'subpagename' => array( '1', 'NOMBREDESUBPAGINA', 'NOMBREDESUBPÁGINA', 'SUBPAGENAME' ), 'subpagenamee' => array( '1', 'NOMBREDESUBPAGINAC', 'NOMBREDESUBPÁGINAC', 'SUBPAGENAMEE' ), 'rootpagename' => array( '1', 'NOMBREDEPAGINARAIZ', 'NOMBREDEPÁGINARAÍZ', 'ROOTPAGENAME' ), 'rootpagenamee' => array( '1', 'NOMBREDEPAGINARAIZC', 'NOMBREDEPÁGINARAÍZC', 'ROOTPAGENAMEE' ), 'basepagename' => array( '1', 'NOMBREDEPAGINABASE', 'NOMBREDEPÁGINABASE', 'BASEPAGENAME' ), 'basepagenamee' => array( '1', 'NOMBREDEPAGINABASEC', 'NOMBREDEPÁGINABASEC', 'BASEPAGENAMEE' ), 'talkpagename' => array( '1', 'NOMBREDEPÁGINADEDISCUSIÓN', 'NOMBREDEPAGINADEDISCUSION', 'NOMBREDEPAGINADISCUSION', 'NOMBREDEPÁGINADISCUSIÓN', 'TALKPAGENAME' ), 'talkpagenamee' => array( '1', 'NOMBREDEPÁGINADEDISCUSIÓNC', 'NOMBREDEPAGINADEDISCUSIONC', 'NOMBREDEPAGINADISCUSIONC', 'NOMBREDEPÁGINADISCUSIÓNC', 'TALKPAGENAMEE' ), 'subjectpagename' => array( '1', 'NOMBREDEPAGINADETEMA', 'NOMBREDEPÁGINADETEMA', 'NOMBREDEPÁGINADEASUNTO', 'NOMBREDEPAGINADEASUNTO', 'NOMBREDEPAGINADEARTICULO', 'NOMBREDEPÁGINADEARTÍCULO', 'SUBJECTPAGENAME', 'ARTICLEPAGENAME' ), 'subjectpagenamee' => array( '1', 'NOMBREDEPAGINADETEMAC', 'NOMBREDEPÁGINADETEMAC', 'NOMBREDEPÁGINADEASUNTOC', 'NOMBREDEPAGINADEASUNTOC', 'NOMBREDEPAGINADEARTICULOC', 'NOMBREDEPÁGINADEARTÍCULOC', 'SUBJECTPAGENAMEE', 'ARTICLEPAGENAMEE' ), 'msg' => array( '0', 'MSJ:', 'MSG:' ), 'subst' => array( '0', 'SUST:', 'FIJAR:', 'SUBST:' ), 'img_thumbnail' => array( '1', 'miniaturadeimagen', 'miniatura', 'mini', 'thumbnail', 'thumb' ), 'img_manualthumb' => array( '1', 'miniaturadeimagen=$1', 'miniatura=$1', 'thumbnail=$1', 'thumb=$1' ), 'img_right' => array( '1', 'derecha', 'dcha', 'der', 'right' ), 'img_left' => array( '1', 'izquierda', 'izda', 'izq', 'left' ), 'img_none' => array( '1', 'ninguna', 'nada', 'no', 'ninguno', 'none' ), 'img_center' => array( '1', 'centro', 'centrado', 'centrada', 'centrar', 'center', 'centre' ), 'img_framed' => array( '1', 'marco', 'enmarcado', 'enmarcada', 'framed', 'enframed', 'frame' ), 'img_frameless' => array( '1', 'sinmarco', 'sin_enmarcar', 'sinenmarcar', 'frameless' ), 'img_page' => array( '1', 'pagina=$1', 'página=$1', 'pagina_$1', 'página_$1', 'page=$1', 'page $1' ), 'img_border' => array( '1', 'borde', 'border' ), 'img_link' => array( '1', 'vínculo=$1', 'vinculo=$1', 'enlace=$1', 'link=$1' ), 'sitename' => array( '1', 'NOMBREDELSITIO', 'SITENAME' ), 'ns' => array( '0', 'EN:', 'NS:' ), 'localurl' => array( '0', 'URLLOCAL', 'LOCALURL:' ), 'localurle' => array( '0', 'URLLOCALC:', 'LOCALURLE:' ), 'server' => array( '0', 'SERVIDOR', 'SERVER' ), 'servername' => array( '0', 'NOMBRESERVIDOR', 'SERVERNAME' ), 'scriptpath' => array( '0', 'RUTASCRIPT', 'RUTADESCRIPT', 'SCRIPTPATH' ), 'stylepath' => array( '0', 'RUTAESTILO', 'RUTADEESTILO', 'STYLEPATH' ), 'grammar' => array( '0', 'GRAMATICA:', 'GRAMÁTICA:', 'GRAMMAR:' ), 'gender' => array( '0', 'GÉNERO:', 'GENERO:', 'GENDER:' ), 'notitleconvert' => array( '0', '__NOCONVERTIRTITULO__', '__NOCONVERTIRTÍTULO__', '__NOCT___', '__NOTITLECONVERT__', '__NOTC__' ), 'nocontentconvert' => array( '0', '__NOCONVERTIRCONTENIDO__', '__NOCC___', '__NOCONTENTCONVERT__', '__NOCC__' ), 'currentweek' => array( '1', 'SEMANAACTUAL', 'CURRENTWEEK' ), 'currentdow' => array( '1', 'DDSACTUAL', 'DIADESEMANAACTUAL', 'DÍADESEMANAACTUAL', 'CURRENTDOW' ), 'localweek' => array( '1', 'SEMANALOCAL', 'LOCALWEEK' ), 'localdow' => array( '1', 'DDSLOCAL', 'DIADESEMANALOCAL', 'DÍADESEMANALOCAL', 'LOCALDOW' ), 'revisionid' => array( '1', 'IDDEREVISION', 'IDREVISION', 'IDDEREVISIÓN', 'IDREVISIÓN', 'REVISIONID' ), 'revisionday' => array( '1', 'DIADEREVISION', 'DIAREVISION', 'DÍADEREVISIÓN', 'DÍAREVISIÓN', 'REVISIONDAY' ), 'revisionday2' => array( '1', 'DIADEREVISION2', 'DIAREVISION2', 'DÍADEREVISIÓN2', 'DÍAREVISIÓN2', 'REVISIONDAY2' ), 'revisionmonth' => array( '1', 'MESDEREVISION', 'MESDEREVISIÓN', 'MESREVISION', 'MESREVISIÓN', 'REVISIONMONTH' ), 'revisionyear' => array( '1', 'AÑODEREVISION', 'AÑODEREVISIÓN', 'AÑOREVISION', 'AÑOREVISIÓN', 'REVISIONYEAR' ), 'revisiontimestamp' => array( '1', 'MARCADEHORADEREVISION', 'MARCADEHORADEREVISIÓN', 'REVISIONTIMESTAMP' ), 'revisionuser' => array( '1', 'USUARIODEREVISION', 'USUARIODEREVISIÓN', 'REVISIONUSER' ), 'fullurl' => array( '0', 'URLCOMPLETA:', 'FULLURL:' ), 'fullurle' => array( '0', 'URLCOMPLETAC:', 'FULLURLE:' ), 'canonicalurl' => array( '0', 'URLCANONICA:', 'CANONICALURL:' ), 'canonicalurle' => array( '0', 'URLCANONICAC:', 'CANONICALURLE:' ), 'lcfirst' => array( '0', 'PRIMEROMINUS;', 'PRIMEROMINÚS:', 'LCFIRST:' ), 'ucfirst' => array( '0', 'PRIMEROMAYUS;', 'PRIMEROMAYÚS:', 'UCFIRST:' ), 'lc' => array( '0', 'MINUS:', 'MINÚS:', 'LC:' ), 'uc' => array( '0', 'MAYUS:', 'MAYÚS:', 'UC:' ), 'raw' => array( '0', 'SINFORMATO', 'SINPUNTOS', 'RAW:' ), 'displaytitle' => array( '1', 'MOSTRARTÍTULO', 'MOSTRARTITULO', 'DISPLAYTITLE' ), 'rawsuffix' => array( '1', 'SF', 'R' ), 'newsectionlink' => array( '1', '__VINCULARANUEVASECCION__', '__ENLACECREARSECCIÓN__', '__NEWSECTIONLINK__' ), 'nonewsectionlink' => array( '1', '__NOVINCULARANUEVASECCION__', '__SINENLACECREARSECCIÓN__', '__NONEWSECTIONLINK__' ), 'currentversion' => array( '1', 'VERSIONACTUAL', 'VERSIÓNACTUAL', 'CURRENTVERSION' ), 'urlencode' => array( '0', 'CODIFICARURL:', 'URLENCODE:' ), 'currenttimestamp' => array( '1', 'MARCADEHORAACTUAL', 'CURRENTTIMESTAMP' ), 'localtimestamp' => array( '1', 'MARCADEHORALOCAL', 'LOCALTIMESTAMP' ), 'language' => array( '0', '#IDIOMA:', '#LANGUAGE:' ), 'contentlanguage' => array( '1', 'IDIOMADELCONTENIDO', 'IDIOMADELCONT', 'CONTENTLANGUAGE', 'CONTENTLANG' ), 'pagesinnamespace' => array( '1', 'PÁGINASENESPACIO', 'PAGESINNAMESPACE:', 'PAGESINNS:' ), 'numberofadmins' => array( '1', 'NÚMEROADMINIISTRADORES', 'NÚMEROADMINS', 'NUMEROADMINS', 'NUMEROADMINISTRADORES', 'NUMERODEADMINISTRADORES', 'NUMERODEADMINS', 'NÚMERODEADMINISTRADORES', 'NÚMERODEADMINS', 'NUMBEROFADMINS' ), 'formatnum' => array( '0', 'FORMATONÚMERO', 'FORMATONUMERO', 'FORMATNUM' ), 'special' => array( '0', 'especial', 'special' ), 'defaultsort' => array( '1', 'ORDENAR:', 'CLAVEDEORDENPREDETERMINADO:', 'ORDENDECATEGORIAPREDETERMINADO:', 'ORDENDECATEGORÍAPREDETERMINADO:', 'DEFAULTSORT:', 'DEFAULTSORTKEY:', 'DEFAULTCATEGORYSORT:' ), 'filepath' => array( '0', 'RUTAARCHIVO:', 'RUTARCHIVO:', 'RUTADEARCHIVO:', 'FILEPATH:' ), 'tag' => array( '0', 'etiqueta', 'tag' ), 'hiddencat' => array( '1', '__CATEGORÍAOCULTA__', '__HIDDENCAT__' ), 'pagesincategory' => array( '1', 'PÁGINASENCATEGORÍA', 'PÁGINASENCAT', 'PAGSENCAT', 'PAGINASENCATEGORIA', 'PAGINASENCAT', 'PAGESINCATEGORY', 'PAGESINCAT' ), 'pagesize' => array( '1', 'TAMAÑOPÁGINA', 'TAMAÑODEPÁGINA', 'TAMAÑOPAGINA', 'TAMAÑODEPAGINA', 'PAGESIZE' ), 'index' => array( '1', '__INDEXAR__', '__INDEX__' ), 'noindex' => array( '1', '__NOINDEXAR__', '__NOINDEX__' ), 'numberingroup' => array( '1', 'NÚMEROENGRUPO', 'NUMEROENGRUPO', 'NUMENGRUPO', 'NÚMENGRUPO', 'NUMBERINGROUP', 'NUMINGROUP' ), 'staticredirect' => array( '1', '__REDIRECCIONESTATICA__', '__REDIRECCIÓNESTÁTICA__', '__STATICREDIRECT__' ), 'protectionlevel' => array( '1', 'NIVELDEPROTECCIÓN', 'PROTECTIONLEVEL' ), 'formatdate' => array( '0', 'formatodefecha', 'formatearfecha', 'formatdate', 'dateformat' ), ); $datePreferences = false; $defaultDateFormat = 'dmy'; $dateFormats = array( 'dmy time' => 'H:i', 'dmy date' => 'j M Y', 'dmy both' => 'H:i j M Y', ); $separatorTransformTable = array( ',' => "\xc2\xa0", '.' => ',' ); $linkTrail = '/^([a-záéíóúñ]+)(.*)$/sDu'; $messages = array( # User preference toggles 'tog-underline' => 'Subrayar los enlaces:', 'tog-hideminor' => 'Ocultar las ediciones menores en los cambios recientes', 'tog-hidepatrolled' => 'Ocultar las ediciones patrulladas en los cambios recientes', 'tog-newpageshidepatrolled' => 'Ocultar las páginas patrulladas de la lista de páginas nuevas', 'tog-extendwatchlist' => 'Expandir la lista de seguimiento a todos los cambios, no sólo a los más recientes', 'tog-usenewrc' => 'Agrupar los cambios por página en los cambios recientes y en la lista de seguimiento (requiere JavaScript)', 'tog-numberheadings' => 'Numerar automáticamente los encabezados', 'tog-showtoolbar' => 'Mostrar la barra de edición', 'tog-editondblclick' => 'Editar las páginas al pulsar dos veces en ellos con el ratón', 'tog-editsectiononrightclick' => 'Activar la edición de secciones pulsando el botón derecho en los títulos de secciones', 'tog-rememberpassword' => 'Recordar mi nombre de usuario y contraseña entre sesiones en este navegador (por un máximo de $1 {{PLURAL:$1|día|días}})', 'tog-watchcreations' => 'Añadir las páginas que cree y los archivos que suba a mi lista de seguimento', 'tog-watchdefault' => 'Añadir las páginas y archivos que edite a mi lista de seguimiento', 'tog-watchmoves' => 'Añadir las páginas y archivos que mueva a mi lista de seguimiento', 'tog-watchdeletion' => 'Añadir las páginas y archivos que borre a mi lista de seguimiento', 'tog-minordefault' => 'Marcar todas las ediciones como menores de manera predeterminada', 'tog-previewontop' => 'Mostrar previsualización antes del cuadro de edición', 'tog-previewonfirst' => 'Mostrar previsualización en la primera edición', 'tog-enotifwatchlistpages' => 'Enviarme un correo electrónico cuando se modifique una página o un archivo de mi lista de seguimiento', 'tog-enotifusertalkpages' => 'Enviarme un correo electrónico cuando se modifique mi página de discusión', 'tog-enotifminoredits' => 'Notificarme también por correo electrónico los cambios menores de las páginas y archivos', 'tog-enotifrevealaddr' => 'Revelar mi dirección de correo electrónico en los correos de notificación', 'tog-shownumberswatching' => 'Mostrar el número de usuarios que la vigilan', 'tog-oldsig' => 'Firma actual:', 'tog-fancysig' => 'Tratar la firma como wikitexto (sin un enlace automático)', 'tog-uselivepreview' => 'Usar previsualización dinámica (experimental)', 'tog-forceeditsummary' => 'Avisarme cuando grabe la página sin introducir un resumen de edición', 'tog-watchlisthideown' => 'Ocultar mis ediciones en la lista de seguimiento', 'tog-watchlisthidebots' => 'Ocultar las ediciones de bots en la lista de seguimiento', 'tog-watchlisthideminor' => 'Ocultar las ediciones menores en la lista de seguimiento', 'tog-watchlisthideliu' => 'Ocultar las ediciones de los usuarios registrados en la lista de seguimiento', 'tog-watchlisthideanons' => 'Ocultar las ediciones de los usuarios anónimos en la lista de seguimiento', 'tog-watchlisthidepatrolled' => 'Ocultar las ediciones patrulladas en la lista de seguimiento', 'tog-ccmeonemails' => 'Recibir copias de los correos que envío a otros usuarios', 'tog-diffonly' => "No mostrar bajo las ''diferencias'' el contenido de la página", 'tog-showhiddencats' => 'Mostrar las categorías escondidas', 'tog-noconvertlink' => 'Desactivar la conversión de título de enlace', 'tog-norollbackdiff' => 'Omitir la diferencia después de revertir', 'tog-useeditwarning' => 'Advertirme cuando abandone una página editada con cambios sin grabar', 'tog-prefershttps' => 'Utiliza una conexión segura siempre que haya iniciado una sesión', 'underline-always' => 'Siempre', 'underline-never' => 'Nunca', 'underline-default' => 'Aspecto (skin) o valor predeterminado del navegador', # Font style option in Special:Preferences 'editfont-style' => 'Estilo de tipografía del área de edición:', 'editfont-default' => 'Predeterminado del navegador', 'editfont-monospace' => 'Tipo de letra monoespaciado', 'editfont-sansserif' => 'Tipo de letra de palo seco', 'editfont-serif' => 'Tipo de letra con serifas', # Dates 'sunday' => 'domingo', 'monday' => 'lunes', 'tuesday' => 'martes', 'wednesday' => 'miércoles', 'thursday' => 'jueves', 'friday' => 'viernes', 'saturday' => 'sábado', 'sun' => 'dom', 'mon' => 'lun', 'tue' => 'mar', 'wed' => 'mié', 'thu' => 'jue', 'fri' => 'vie', 'sat' => 'sáb', 'january' => 'enero', 'february' => 'febrero', 'march' => 'marzo', 'april' => 'abril', 'may_long' => 'mayo', 'june' => 'junio', 'july' => 'julio', 'august' => 'agosto', 'september' => 'septiembre', 'october' => 'octubre', 'november' => 'noviembre', 'december' => 'diciembre', 'january-gen' => 'enero', 'february-gen' => 'febrero', 'march-gen' => 'marzo', 'april-gen' => 'abril', 'may-gen' => 'mayo', 'june-gen' => 'junio', 'july-gen' => 'julio', 'august-gen' => 'agosto', 'september-gen' => 'septiembre', 'october-gen' => 'octubre', 'november-gen' => 'noviembre', 'december-gen' => 'diciembre', 'jan' => 'ene', 'feb' => 'feb', 'mar' => 'mar', 'apr' => 'abr', 'may' => 'may', 'jun' => 'jun', 'jul' => 'jul', 'aug' => 'ago', 'sep' => 'sep', 'oct' => 'oct', 'nov' => 'nov', 'dec' => 'dic', 'january-date' => '$1 de enero', 'february-date' => '$1 de febrero', 'march-date' => '$1 de marzo', 'april-date' => '$1 de abril', 'may-date' => '$1 de mayo', 'june-date' => '$1 de junio', 'july-date' => '$1 de julio', 'august-date' => '$1 de agosto', 'september-date' => '$1 de septiembre', 'october-date' => '$1 de octubre', 'november-date' => '$1 de noviembre', 'december-date' => '$1 de diciembre', # Categories related messages 'pagecategories' => '{{PLURAL:$1|Categoría|Categorías}}', 'category_header' => 'Páginas en la categoría «$1»', 'subcategories' => 'Subcategorías', 'category-media-header' => 'Archivos multimedia en la categoría «$1»', 'category-empty' => "''La categoría no contiene ninguna página o archivo.''", 'hidden-categories' => '{{PLURAL:$1|Categoría escondida|Categorías escondidas}}', 'hidden-category-category' => 'Categorías ocultas', 'category-subcat-count' => '{{PLURAL:$2|Esta categoría solo contiene la siguiente subcategoría.|Esta categoría contiene {{PLURAL:$1|la siguiente subcategoría|las siguientes $1 subcategorías}}, de un total de $2.}}', 'category-subcat-count-limited' => 'Esta categoría contiene {{PLURAL:$1|la siguiente subcategoría|las siguientes $1 subcategorías}}.', 'category-article-count' => '{{PLURAL:$2|Esta categoría incluye solamente la siguiente página.|{{PLURAL:$1|La siguiente página página pertenece|Las siguientes $1 páginas pertenecen}} a esta categoría, de un total de $2.}}', 'category-article-count-limited' => '{{PLURAL:$1|La siguiente página pertenece|Las siguientes $1 páginas pertenecen}} a esta categoría.', 'category-file-count' => '{{PLURAL:$2|Esta categoría contiene solamente el siguiente archivo.|{{PLURAL:$1|El siguiente archivo pertenece|Los siguientes $1 archivos pertenecen}} a esta categoría, de un total de $2.}}', 'category-file-count-limited' => '{{PLURAL:$1|El siguiente fichero pertenece|Los siguientes $1 ficheros pertenecen}} a esta categoría.', 'listingcontinuesabbrev' => 'cont.', 'index-category' => 'Páginas indizadas', 'noindex-category' => 'Páginas no indizadas', 'broken-file-category' => 'Páginas con enlaces rotos a archivos', 'about' => 'Acerca de', 'article' => 'Artículo', 'newwindow' => '(se abre en una ventana nueva)', 'cancel' => 'Cancelar', 'moredotdotdot' => 'Más...', 'morenotlisted' => 'Esta lista no está completa.', 'mypage' => 'Página', 'mytalk' => 'Discusión', 'anontalk' => 'Discusión para esta IP', 'navigation' => 'Navegación', 'and' => '&#32;y', # Cologne Blue skin 'qbfind' => 'Buscar', 'qbbrowse' => 'Navegar', 'qbedit' => 'Editar', 'qbpageoptions' => 'Opciones de página', 'qbmyoptions' => 'Mis páginas', 'faq' => 'Preguntas más frecuentes', 'faqpage' => 'Project:P+F', # Vector skin 'vector-action-addsection' => 'Nueva sección', 'vector-action-delete' => 'Borrar', 'vector-action-move' => 'Trasladar', 'vector-action-protect' => 'Proteger', 'vector-action-undelete' => 'Restaurar', 'vector-action-unprotect' => 'Cambiar protección', 'vector-view-create' => 'Crear', 'vector-view-edit' => 'Editar', 'vector-view-history' => 'Ver historial', 'vector-view-view' => 'Leer', 'vector-view-viewsource' => 'Ver código', 'actions' => 'Acciones', 'namespaces' => 'Espacios de nombres', 'variants' => 'Variantes', 'navigation-heading' => 'Menú de navegación', 'errorpagetitle' => 'Error', 'returnto' => 'Volver a $1.', 'tagline' => 'De {{SITENAME}}', 'help' => 'Ayuda', 'search' => 'Buscar', 'searchbutton' => 'Buscar', 'go' => 'Ir', 'searcharticle' => 'Ir', 'history' => 'Historial', 'history_short' => 'Historial', 'updatedmarker' => 'actualizado desde mi última visita', 'printableversion' => 'Versión para imprimir', 'permalink' => 'Enlace permanente', 'print' => 'Imprimir', 'view' => 'Ver', 'edit' => 'Editar', 'create' => 'Crear', 'editthispage' => 'Editar esta página', 'create-this-page' => 'Crear esta página', 'delete' => 'Borrar', 'deletethispage' => 'Borrar esta página', 'undeletethispage' => 'Restaurar esta página', 'undelete_short' => 'Restaurar {{PLURAL:$1|una edición|$1 ediciones}}', 'viewdeleted_short' => 'Ver {{PLURAL:$1|una edición borrada|$1 ediciones borradas}}', 'protect' => 'Proteger', 'protect_change' => 'cambiar', 'protectthispage' => 'Proteger esta página', 'unprotect' => 'Cambiar protección', 'unprotectthispage' => 'Cambiar la protección de esta página', 'newpage' => 'Página nueva', 'talkpage' => 'Discutir esta página', 'talkpagelinktext' => 'Discusión', 'specialpage' => 'Página especial', 'personaltools' => 'Herramientas personales', 'postcomment' => 'Sección nueva', 'articlepage' => 'Ver artículo', 'talk' => 'Discusión', 'views' => 'Vistas', 'toolbox' => 'Herramientas', 'userpage' => 'Ver página de usuario', 'projectpage' => 'Ver página de proyecto', 'imagepage' => 'Ver página del archivo', 'mediawikipage' => 'Ver página de mensaje', 'templatepage' => 'Ver página de plantilla', 'viewhelppage' => 'Ver página de ayuda', 'categorypage' => 'Ver página de categoría', 'viewtalkpage' => 'Ver discusión', 'otherlanguages' => 'Otros idiomas', 'redirectedfrom' => '(Redirigido desde «$1»)', 'redirectpagesub' => 'Página de redirección', 'lastmodifiedat' => 'Esta página fue modificada por última vez el $1, a las $2.', 'viewcount' => 'Esta página se ha visitado {{PLURAL:$1|una vez|$1 veces}}.', 'protectedpage' => 'Página protegida', 'jumpto' => 'Saltar a:', 'jumptonavigation' => 'navegación', 'jumptosearch' => 'buscar', 'view-pool-error' => 'Lo sentimos, los servidores están sobrecargados en este momento. Hay demasiados usuarios que están tratando de ver esta página. Espera un momento antes de tratar de acceder nuevamente a esta página. $1', 'pool-timeout' => 'Tiempo limite agotado para el bloqueo', 'pool-queuefull' => 'La cola de trabajo está llena', 'pool-errorunknown' => 'Error desconocido', # All link text and link target definitions of links into project namespace that get used by other message strings, with the exception of user group pages (see grouppage). 'aboutsite' => 'Acerca de {{SITENAME}}', 'aboutpage' => 'Project:Acerca de', 'copyright' => 'El contenido está disponible bajo $1 a menos que se indique lo contrario.', 'copyrightpage' => '{{ns:project}}:Derechos de autor', 'currentevents' => 'Actualidad', 'currentevents-url' => 'Project:Actualidad', 'disclaimers' => 'Aviso legal', 'disclaimerpage' => 'Project:Limitación general de responsabilidad', 'edithelp' => 'Ayuda de edición', 'helppage' => 'Help:Contenido', 'mainpage' => 'Página principal', 'mainpage-description' => 'Página principal', 'policy-url' => 'Project:Políticas', 'portal' => 'Portal de la comunidad', 'portal-url' => 'Project:Portal de la comunidad', 'privacy' => 'Política de protección de datos', 'privacypage' => 'Project:Política de protección de datos', 'badaccess' => 'Error de permisos', 'badaccess-group0' => 'No estás autorizado a ejecutar la acción solicitada.', 'badaccess-groups' => 'La acción que has solicitado está restringida a los usuarios {{PLURAL:$2|del grupo|de uno de estos $2 grupos}}: $1.', 'versionrequired' => 'Se requiere la versión $1 de MediaWiki.', 'versionrequiredtext' => 'Se necesita la versión $1 de MediaWiki para utilizar esta página. Para más información, consultar [[Special:Version|la página de versión]]', 'ok' => 'Aceptar', 'retrievedfrom' => 'Obtenido de «$1»', 'youhavenewmessages' => 'Tienes $1 ($2).', 'youhavenewmessagesfromusers' => 'Tienes $1 de {{PLURAL:$3|otro usuario|$3 usuarios}} ($2).', 'youhavenewmessagesmanyusers' => 'Tienes $1 de muchos usuarios ($2).', 'newmessageslinkplural' => '{{PLURAL:$1|un mensaje nuevo|999=mensajes nuevos}}', 'newmessagesdifflinkplural' => '{{PLURAL:$1|último cambio|999=últimos cambios}}', 'youhavenewmessagesmulti' => 'Tienes mensajes nuevos en $1', 'editsection' => 'editar', 'editold' => 'editar', 'viewsourceold' => 'ver código', 'editlink' => 'modificar', 'viewsourcelink' => 'ver código', 'editsectionhint' => 'Editar sección: $1', 'toc' => 'Contenido', 'showtoc' => 'mostrar', 'hidetoc' => 'ocultar', 'collapsible-collapse' => 'Contraer', 'collapsible-expand' => 'Expandir', 'thisisdeleted' => '¿Ver o restaurar $1?', 'viewdeleted' => '¿Quieres ver $1?', 'restorelink' => '{{PLURAL:$1|una edición borrada|$1 ediciones borradas}}', 'feedlinks' => 'Canal:', 'feed-invalid' => 'El tipo de canal de suscripción no es válido.', 'feed-unavailable' => 'Los canales de sindicación no están disponibles', 'site-rss-feed' => 'Canal RSS de $1', 'site-atom-feed' => 'Canal Atom de $1', 'page-rss-feed' => 'Canal RSS «$1»', 'page-atom-feed' => 'Canal Atom «$1»', 'red-link-title' => '$1 (la página no existe)', 'sort-descending' => 'Orden descendente', 'sort-ascending' => 'Orden ascendente', # Short words for each namespace, by default used in the namespace tab in monobook 'nstab-main' => 'Página', 'nstab-user' => 'Página {{GENDER:{{ROOTPAGENAME}}|del usuario|de la usuaria}}', 'nstab-media' => 'Multimedia', 'nstab-special' => 'Página especial', 'nstab-project' => 'Página del proyecto', 'nstab-image' => 'Archivo', 'nstab-mediawiki' => 'Mensaje', 'nstab-template' => 'Plantilla', 'nstab-help' => 'Ayuda', 'nstab-category' => 'Categoría', # Main script and global functions 'nosuchaction' => 'No existe esa acción', 'nosuchactiontext' => 'La acción especificada en la dirección no es válida. Es posible que hayas escrito mal la URL o que hayas seguido un enlace incorrecto. Esto también podría indicar un error en el software utilizado en {{SITENAME}}.', 'nosuchspecialpage' => 'No existe esa página especial', 'nospecialpagetext' => '<strong>Ha solicitado una página especial inexistente.</strong> Puedes ver una lista de las páginas especiales en [[Special:SpecialPages|{{int:specialpages}}]].', # General errors 'error' => 'Error', 'databaseerror' => 'Error de la base de datos', 'databaseerror-text' => 'Se ha producido un error en la base de datos. Esto puede indicar un bug en el software.', 'databaseerror-textcl' => 'Se ha producido un error en la base de datos.', 'databaseerror-query' => 'Consulta: $1', 'databaseerror-function' => 'Función: $1', 'databaseerror-error' => 'Error: $1', 'laggedslavemode' => "'''Aviso:''' puede que falten las actualizaciones más recientes en esta página.", 'readonly' => 'Base de datos bloqueada', 'enterlockreason' => 'Explique el motivo del bloqueo, incluyendo una estimación de cuándo se producirá el desbloqueo', 'readonlytext' => 'La base de datos no permite nuevas entradas u otras modificaciones de forma temporal, probablemente por mantenimiento rutinario, tras lo cual volverá a la normalidad. La explicación dada por el administrador que la bloqueó fue: $1', 'missing-article' => "La base de datos no encuentra el texto de una página que debería hallarse, llamada «$1» $2. La causa de esto suele deberse a un ''diff'' anacrónico o un enlace al historial de una página que ha sido borrada. Si no fuera el caso, puedes haber encontrado un fallo en el software. Por favor, avisa a un [[Special:ListUsers/sysop|administrador]], tomando nota de la URL.", 'missingarticle-rev' => '(n.º de revisión: $1)', 'missingarticle-diff' => '(Dif.: $1, $2)', 'readonly_lag' => 'La base de datos se ha bloqueado temporalmente mientras los servidores se sincronizan.', 'internalerror' => 'Error interno', 'internalerror_info' => 'Error interno: $1', 'fileappenderrorread' => 'No se ha podido leer «$1» durante la anexión.', 'fileappenderror' => 'No se ha podido añadir «$1» a «$2».', 'filecopyerror' => 'No se pudo copiar el archivo «$1» a «$2».', 'filerenameerror' => 'No se pudo renombrar el archivo «$1» a «$2».', 'filedeleteerror' => 'No se pudo borrar el archivo «$1».', 'directorycreateerror' => 'No se pudo crear el directorio «$1».', 'filenotfound' => 'No se pudo encontrar el archivo «$1».', 'fileexistserror' => 'No se pudo escribir en el archivo «$1»: el archivo existe.', 'unexpected' => 'Valor inesperado: «$1»=«$2».', 'formerror' => 'Error: no se pudo enviar el formulario', 'badarticleerror' => 'Esta acción no se puede llevar a cabo en esta página.', 'cannotdelete' => 'La página o archivo «$1» no se pudo borrar. Puede que ya haya sido borrado por alguien más.', 'cannotdelete-title' => 'No se puede borrar la página «$1»', 'delete-hook-aborted' => 'La modificación que intentaste hacer fue cancelada por un gancho de extensión. No hay explicación disponible.', 'no-null-revision' => 'No se pudo crear la revisión nula para la página «$1»', 'badtitle' => 'Título incorrecto', 'badtitletext' => 'El título de la página solicitada está vacío, no es válido, o es un enlace interidioma o interwiki incorrecto. Puede que contenga uno o más caracteres que no se pueden usar en los títulos.', 'perfcached' => 'Los siguientes datos provienen de la caché y pueden no estar actualizados. La caché puede contener {{PLURAL:$1|un resultado|$1 resultados}} como máximo.', 'perfcachedts' => 'Los siguientes datos provienen de la caché y su última fecha y hora de actualización es: $1. La caché puede contener {{PLURAL:$4|un resultado|$4 resultados}} como máximo.', 'querypage-no-updates' => 'Actualmente las actualizaciones de esta página están desactivadas. Estos datos no serán actualizados a corto plazo.', 'viewsource' => 'Ver código', 'viewsource-title' => 'Ver el código de «$1»', 'actionthrottled' => 'Acción limitada', 'actionthrottledtext' => "Como medida contra el ''spam'', la acción que estás realizando está limitada a un número determinado de veces en un periodo corto de tiempo, y has excedido ese límite. Por favor inténtalo de nuevo en unos minutos.", 'protectedpagetext' => 'Esta página ha sido protegida para evitar su edición u otras acciones.', 'viewsourcetext' => 'Puedes ver y copiar el código fuente de esta página:', 'viewyourtext' => "Puedes ver y copiar el código de '''tus ediciones''' a esta página:", 'protectedinterface' => 'Esta página proporciona el texto de la interfaz del software en este wiki, y está protegida para prevenir el abuso. Para agregar o cambiar las traducciones para todos los wikis, por favor, usa [//translatewiki.net/ translatewiki.net], el proyecto de localización de MediaWiki.', 'editinginterface' => "'''Aviso:''' Estás editando una página usada para proporcionar el texto de la interfaz para el software. Los cambios en esta página afectarán a la apariencia de la interfaz para los demás usuarios de este wiki. Para añadir o cambiar las traducciones, por favor considera usar [//translatewiki.net/ translatewiki.net], el proyecto de localización de MediaWiki.", 'cascadeprotected' => 'Esta página ha sido protegida para su edición, porque está incluida en {{PLURAL:$1|la siguiente página|las siguientes páginas}}, que están protegidas con la opción de «cascada»: $2', 'namespaceprotected' => "No tienes permiso para editar las páginas del espacio de nombres '''$1'''.", 'customcssprotected' => 'No tienes permiso para editar esta página CSS, porque contiene configuraciones personales de otro usuario.', 'customjsprotected' => 'No tienes permiso para editar esta página JavaScript, porque contiene configuraciones personales de otro usuario.', 'mycustomcssprotected' => 'No tienes permiso para editar esta página CSS.', 'mycustomjsprotected' => 'No tienes permiso para editar esta página JavaScript.', 'myprivateinfoprotected' => 'No tienes permiso para editar tu información privada.', 'mypreferencesprotected' => 'No tienes permiso para editar tus preferencias.', 'ns-specialprotected' => 'Las páginas especiales no se pueden editar', 'titleprotected' => 'Esta página ha sido protegida contra creación por [[User:$1|$1]]. El motivo dado fue: "\'\'$2\'\'".', 'filereadonlyerror' => 'No se puede modificar el archivo "$1" porque el repositorio de archivos "$2" está en modo de sólo lectura. El administrador que lo ha bloqueado ofrece esta explicación: "$3".', 'invalidtitle-knownnamespace' => 'Título no válido con el espacio de nombres "$2" y el texto "$3"', 'invalidtitle-unknownnamespace' => 'Título no válido con número de espacio de nombres desconocido $1 y el texto "$2"', 'exception-nologin' => 'No has iniciado sesión', 'exception-nologin-text' => '[[Special:Userlogin|Inicia sesión]] para acceder a esta página o acción.', 'exception-nologin-text-manual' => 'Necesitas $1 para acceder a esta página o acción.', # Virus scanner 'virus-badscanner' => "Error de configuración: Antivirus desconocido: ''$1''", 'virus-scanfailed' => 'falló el análisis (código $1)', 'virus-unknownscanner' => 'antivirus desconocido:', # Login and logout pages 'logouttext' => '"\'Usted está ahora desconectado."\' Tenga en cuenta que algunas páginas pueden continuar mostrándose como si todavía estuviera conectado, hasta que borres la caché de tu navegador.', 'welcomeuser' => '¡Te damos la bienvenida, $1!', 'welcomecreation-msg' => 'Se ha creado tu cuenta. No olvides personalizar tus [[Special:Preferences|preferencias de {{SITENAME}}]].', 'yourname' => 'Nombre de usuario:', 'userlogin-yourname' => 'Usuario', 'userlogin-yourname-ph' => 'Escribe tu nombre de usuario', 'createacct-another-username-ph' => 'Escribe el nombre de usuario', 'yourpassword' => 'Contraseña:', 'userlogin-yourpassword' => 'Contraseña', 'userlogin-yourpassword-ph' => 'Escribe tu contraseña', 'createacct-yourpassword-ph' => 'Escribe una contraseña', 'yourpasswordagain' => 'Confirma la contraseña:', 'createacct-yourpasswordagain' => 'Confirma la contraseña', 'createacct-yourpasswordagain-ph' => 'Repite la contraseña', 'remembermypassword' => 'Mantenerme conectado en este navegador (hasta $1 {{PLURAL:$1|día|días}})', 'userlogin-remembermypassword' => 'Mantener mi sesión iniciada', 'userlogin-signwithsecure' => 'Usar conexión segura', 'yourdomainname' => 'Dominio', 'password-change-forbidden' => 'No puedes cambiar las contraseñas de este wiki.', 'externaldberror' => 'Hubo un error de autenticación externa de la base de datos o bien no tienes autorización para actualizar tu cuenta externa.', 'login' => 'Iniciar sesión', 'nav-login-createaccount' => 'Iniciar sesión / crear cuenta', 'loginprompt' => "Necesita activar las ''cookies'' en el navegador para iniciar sesión en {{SITENAME}}.", 'userlogin' => 'Iniciar sesión / crear cuenta', 'userloginnocreate' => 'Iniciar sesión', 'logout' => 'Cerrar sesión', 'userlogout' => 'Cerrar sesión', 'notloggedin' => 'No has iniciado sesión', 'userlogin-noaccount' => '¿No tienes una cuenta?', 'userlogin-joinproject' => 'Únete a {{SITENAME}}', 'nologin' => '¿No tienes una cuenta? $1.', 'nologinlink' => 'Crear una cuenta', 'createaccount' => 'Crear una cuenta', 'gotaccount' => '¿Ya tienes una cuenta? $1.', 'gotaccountlink' => 'Iniciar sesión', 'userlogin-resetlink' => '¿Olvidaste tus datos de acceso?', 'userlogin-resetpassword-link' => '¿Has olvidado tu contraseña?', 'helplogin-url' => 'Help:Inicio de sesión', 'userlogin-helplink' => '[[{{MediaWiki:helplogin-url}}|Ayuda]]', 'userlogin-loggedin' => 'Ya estás conectado como {{GENDER:$1|$1}}. Usa el formulario de abajo para iniciar sesión como otro usuario.', 'userlogin-createanother' => 'Crear otra cuenta', 'createacct-join' => 'Introduce tus datos debajo.', 'createacct-another-join' => 'Escribe la información de la cuenta nueva a continuación.', 'createacct-emailrequired' => 'Dirección de correo electrónico', 'createacct-emailoptional' => 'Dirección de correo electrónico (opcional)', 'createacct-email-ph' => 'Escribe tu dirección de correo electrónico', 'createacct-another-email-ph' => 'Introduzca la dirección de correo electrónico', 'createaccountmail' => 'Utilizar una contraseña aleatoria temporal y enviarla a la dirección de correo electrónico especificada', 'createacct-realname' => 'Nombre real (opcional)', 'createaccountreason' => 'Motivo:', 'createacct-reason' => 'Motivo', 'createacct-reason-ph' => 'Por qué estás creando otra cuenta', 'createacct-captcha' => 'Comprobación de seguridad', 'createacct-imgcaptcha-ph' => 'Escribe el texto de arriba', 'createacct-submit' => 'Crea tu cuenta', 'createacct-another-submit' => 'Crear otra cuenta', 'createacct-benefit-heading' => '{{SITENAME}} es hecha por gente como tú.', 'createacct-benefit-body1' => '{{PLURAL:$1|edición|ediciones}}', 'createacct-benefit-body2' => '{{PLURAL:$1|página|páginas}}', 'createacct-benefit-body3' => '{{PLURAL:$1|colaborador reciente|colaboradores recientes}}', 'badretype' => 'Las contraseñas no coinciden.', 'userexists' => 'El nombre de usuario indicado ya está en uso. Elige un nombre diferente.', 'loginerror' => 'Error de inicio de sesión', 'createacct-error' => 'Error al crear la cuenta', 'createaccounterror' => 'No se pudo crear la cuenta: $1', 'nocookiesnew' => 'La cuenta de usuario ha sido creada, pero no has iniciado sesión. {{SITENAME}} usa <em>cookies</em> para identificar a los usuarios registrados. Tu navegador tiene desactivadas las cookies. Por favor, actívalas e inicia sesión con tu nuevo nombre de usuario y contraseña.', 'nocookieslogin' => '{{SITENAME}} utiliza <em>cookies</em> para la autenticación de usuarios. Las <em>cookies</em> están desactivadas en tu navegador. Por favor, actívalas e inténtalo de nuevo.', 'nocookiesfornew' => 'No se pudo crear la cuenta de usuario, porque no pudimos confirmar su origen. Asegúrate de que tienes las cookies activadas, luego recarga esta página e inténtalo de nuevo.', 'noname' => 'No se ha especificado un nombre de usuario válido.', 'loginsuccesstitle' => 'Inicio de sesión exitoso', 'loginsuccess' => "'''Has iniciado sesión en {{SITENAME}} como «$1».'''", 'nosuchuser' => 'No existe ningún usuario llamado «$1». Los nombres de usuario son sensibles a las mayúsculas. Revisa la ortografía, o [[Special:UserLogin/signup|crea una cuenta nueva]].', 'nosuchusershort' => 'No hay un usuario con el nombre «$1». Comprueba que lo has escrito correctamente.', 'nouserspecified' => 'Debes especificar un nombre de usuario.', 'login-userblocked' => 'Este usuario está bloqueado. Inicio de sesión no permitido.', 'wrongpassword' => 'La contraseña indicada es incorrecta. Inténtalo de nuevo.', 'wrongpasswordempty' => 'No has escrito una contraseña. Inténtalo de nuevo.', 'passwordtooshort' => 'Las contraseñas deben tener al menos {{PLURAL:$1|1 caracter|$1 caracteres}}.', 'password-name-match' => 'Tu contraseña debe ser diferente de tu nombre de usuario.', 'password-login-forbidden' => 'El uso de este nombre de usuario y contraseña han sido prohibidos.', 'mailmypassword' => 'Restablecer la contraseña', 'passwordremindertitle' => 'Recordatorio de contraseña de {{SITENAME}}', 'passwordremindertext' => 'Alguien (probablemente tú, desde la dirección IP $1) solicitó que te enviáramos una nueva contraseña para tu cuenta en {{SITENAME}} ($4). Se ha creado la siguiente contraseña temporal para el usuario «$2»: «$3» Ahora deberías iniciar sesión y cambiar tu contraseña. Tu contraseña temporal expirará en {{PLURAL:$5|un día|$5 días}}. Si fue otro quien solicitó este mensaje o has recordado tu contraseña y ya no deseas cambiarla, puedes ignorar este mensaje y seguir usando tu contraseña original.', 'noemail' => 'No hay una dirección de correo electrónico registrada para «$1».', 'noemailcreate' => 'Necesitas proveer una dirección de correo electrónico válida', 'passwordsent' => 'Se ha enviado una nueva contraseña al correo electrónico de «$1». Por favor, identifícate de nuevo tras recibirla.', 'blocked-mailpassword' => 'Tu dirección IP está bloqueada, y no se te permite el uso de la función de recuperación de contraseñas para prevenir abusos.', 'eauthentsent' => 'Se ha enviado un correo electrónico de confirmación a la dirección especificada. Antes de que se envíe cualquier otro correo a la cuenta tienes que seguir las instrucciones enviadas en el mensaje para así confirmar que la dirección te pertenece.', 'throttled-mailpassword' => 'Ya se ha enviado un recordatorio de contraseña en {{PLURAL:$1|la última hora|las últimas $1 horas}}. Para evitar los abusos, solo se enviará un recordatorio de contraseña cada {{PLURAL:$1|hora|$1 horas}}.', 'mailerror' => 'Error al enviar correo: $1', 'acct_creation_throttle_hit' => 'Los visitantes a este wiki usando tu dirección IP han creado {{PLURAL:$1|una cuenta|$1 cuentas}} en el último día, lo cual es lo máximo permitido en este periodo de tiempo. Como resultado, los visitantes usando esta dirección IP no pueden crear más cuentas en este momento.', 'emailauthenticated' => 'Tu dirección de correo electrónico fue confirmada el $2 a las $3.', 'emailnotauthenticated' => 'Aún no has confirmado tu dirección de correo electrónico. Hasta que lo hagas, las siguientes funciones no estarán disponibles.', 'noemailprefs' => 'Especifica una dirección electrónica para habilitar estas características.', 'emailconfirmlink' => 'Confirmar dirección de correo electrónico', 'invalidemailaddress' => 'La dirección electrónica no puede ser aceptada, pues parece que tiene un formato no válido. Por favor, escribe una dirección en el formato adecuado o deja el campo en blanco.', 'cannotchangeemail' => 'Las direcciones de la correo electrónico de las cuentas de usuario no puedes cambiarse en esta wiki.', 'emaildisabled' => 'Este sitio no puede enviar mensajes de correo electrónico.', 'accountcreated' => 'Se ha creado la cuenta', 'accountcreatedtext' => 'La cuenta de usuario de [[{{ns:User}}:$1|$1]] ([[{{ns:User talk}}:$1|talk]]) ha sido creada.', 'createaccount-title' => 'Creación de cuenta para {{SITENAME}}', 'createaccount-text' => 'Alguien creó en {{SITENAME}} ($4) una cuenta asociada a este correo electrónico con el nombre «$2». La contraseña asignada automáticamente es «$3». Por favor entra ahora y cambia tu contraseña. Puedes ignorar este mensaje si esta cuenta fue creada por error.', 'usernamehasherror' => 'El nombre de usuario no puede contener símbolos de almohadilla/numeral', 'login-throttled' => 'Has intentado demasiadas veces iniciar sesión. Por favor espera $1 antes de intentarlo nuevamente.', 'login-abort-generic' => 'Tu inicio de sesión no fue exitoso - Cancelado', 'loginlanguagelabel' => 'Idioma: $1', 'suspicious-userlogout' => 'Tu solicitud de desconexión ha sido denegada, pues parece haber sido enviada desde un navegador defectuoso o un proxy caché.', 'createacct-another-realname-tip' => 'El nombre real es opcional. Si se proporciona, se usará para dar al usuario la atribución de su trabajo.', # Email sending 'php-mail-error-unknown' => 'Error desconocido en la función mail() de PHP.', 'user-mail-no-addy' => 'Se ha intentado enviar correo electrónico sin una dirección de correo electrónico.', 'user-mail-no-body' => 'Trató de enviar un correo electrónico con un cuerpo vacío o excesivamente corto.', # Change password dialog 'changepassword' => 'Cambiar contraseña', 'resetpass_announce' => 'Has iniciado sesión con una contraseña temporal que fue enviada por correo electrónico. Establece una contraseña nueva aquí:', 'resetpass_text' => '<!-- Añada texto aquí -->', 'resetpass_header' => 'Cambiar la contraseña de la cuenta', 'oldpassword' => 'Contraseña antigua:', 'newpassword' => 'Contraseña nueva:', 'retypenew' => 'Confirmar la contraseña nueva:', 'resetpass_submit' => 'Establecer contraseña e iniciar sesión', 'changepassword-success' => 'La contraseña ha sido cambiada con éxito.', 'changepassword-throttled' => 'Has intentado acceder demasiadas veces. Espera $1 antes de intentarlo de nuevo.', 'resetpass_forbidden' => 'No se pueden cambiar las contraseñas', 'resetpass-no-info' => 'Debes iniciar sesión para acceder directamente a esta página.', 'resetpass-submit-loggedin' => 'Cambiar contraseña', 'resetpass-submit-cancel' => 'Cancelar', 'resetpass-wrong-oldpass' => 'La contraseña antigua no es correcta. Puede que ya hayas cambiado la contraseña o que hayas pedido una temporal.', 'resetpass-temp-password' => 'Contraseña temporal:', 'resetpass-abort-generic' => 'Una extensión ha cancelado el cambio de la contraseña.', # Special:PasswordReset 'passwordreset' => 'Restablecimiento de contraseña', 'passwordreset-text-one' => 'Completa este formulario para restablecer tu contraseña.', 'passwordreset-text-many' => '{{PLURAL:$1|Rellena uno de los campos para restablecer la contraseña.}}', 'passwordreset-legend' => 'Restablecer contraseña', 'passwordreset-disabled' => 'Se ha desactivado el restablecimiento de contraseñas en este wiki.', 'passwordreset-emaildisabled' => 'Las funciones de correo electrónico han sido desactivadas en esta wiki.', 'passwordreset-username' => 'Nombre de usuario:', 'passwordreset-domain' => 'Dominio:', 'passwordreset-capture' => '¿Ver el mensaje resultante?', 'passwordreset-capture-help' => 'Si marcas esta casilla, se te mostrará el correo electrónico (con la contraseña temporal) además de enviarse al usuario.', 'passwordreset-email' => 'Dirección de correo electrónico:', 'passwordreset-emailtitle' => 'Detalles de la cuenta en {{SITENAME}}', 'passwordreset-emailtext-ip' => 'Alguien (probablemente tú, desde la dirección IP $1) ha solicitado la renovación de tu clave para {{SITENAME}} ($4). {{PLURAL:$3|La siguiente cuenta está asociada|Las siguientes cuentas están asociadas}} con esta dirección de correo electrónico: $2 {{PLURAL:$3|Esta contraseña temporal|Estas contraseñas temporales}} caducarán en {{PLURAL:$5|un día|$5 días}}. Deberías iniciar sesión y establecer una contraseña nueva ahora. Si otra persona ha realizado este solicitud o si recuerdas tu contraseña original y no deseas cambiarla, puedes ignorar este mensaje y continuar usando tu contraseña anterior.', 'passwordreset-emailtext-user' => 'El usuario $1 en {{SITENAME}} pidió un recordatorio de tus datos de cuenta para {{SITENAME}} ($4). {{PLURAL:$3|La siguiente cuenta está asociada|Las siguientes cuentas están asociadas}} con esta dirección de correo electrónico: $2 {{PLURAL:$3|Esta contraseña temporal|Estas contraseñas temporales}} expirarán en {{PLURAL:$5|un día|$5 días}}. Deberías iniciar sesión y establecer una contraseña nueva ahora. Si alguien más hizo este pedido, o recuerdas tu contraseña original, y no deseas cambiarla, puedes ignorar este mensaje y continuar usando tu contraseña anterior.', 'passwordreset-emailelement' => 'Nombre de usuario: $1 Contraseña temporal: $2', 'passwordreset-emailsent' => 'Se ha enviado un correo electrónico para el restablecimiento de tu contraseña.', 'passwordreset-emailsent-capture' => 'Se ha enviado un correo para el restablecimiento de la contraseña, el cual se muestra a continuación.', 'passwordreset-emailerror-capture' => 'Se generó un correo electrónico de restablecimiento de contraseña, que se muestra a continuación, pero el envío {{GENDER:$2|al usuario|a la usuaria}} falló. $1', # Special:ChangeEmail 'changeemail' => 'Cambiar la dirección de correo electrónico', 'changeemail-header' => 'Cambiar la dirección de correo de la cuenta', 'changeemail-text' => 'Rellena este formulario para cambiar tu dirección de correo electrónico. Debes introducir la contraseña para confirmar este cambio.', 'changeemail-no-info' => 'Debes iniciar sesión para acceder directamente a esta página.', 'changeemail-oldemail' => 'Dirección electrónica actual:', 'changeemail-newemail' => 'Dirección electrónica nueva:', 'changeemail-none' => '(ninguna)', 'changeemail-password' => 'Tu contraseña en {{SITENAME}}:', 'changeemail-submit' => 'Cambiar correo electrónico', 'changeemail-cancel' => 'Cancelar', 'changeemail-throttled' => 'Has intentado acceder demasiadas veces. Espera $1 antes de intentarlo de nuevo.', # Special:ResetTokens 'resettokens' => 'Restablecer claves', 'resettokens-text' => 'Puede restablecer las claves que permiten el acceso a ciertos datos privados asociados a tu cuenta aquí. Deberías hacerlo si accidentalmente la has compartido con alguien o si su cuenta ha sido comprometida.', 'resettokens-no-tokens' => 'No hay claves para restablecer.', 'resettokens-legend' => 'Restablecer claves', 'resettokens-tokens' => 'Claves:', 'resettokens-token-label' => '$1 (valor actual: $2)', 'resettokens-watchlist-token' => 'Clave para la lista de seguimiento (RSS/Atom) de los [[Special:Watchlist|cambios a las páginas en tu lista de seguimiento]]', 'resettokens-done' => 'Restablecimiento de claves.', 'resettokens-resetbutton' => 'Restablecer las claves', # Edit page toolbar 'bold_sample' => 'Texto en negrita', 'bold_tip' => 'Texto en negrita', 'italic_sample' => 'Texto en cursiva', 'italic_tip' => 'Texto en cursiva', 'link_sample' => 'Título del enlace', 'link_tip' => 'Enlace interno', 'extlink_sample' => 'http://www.ejemplo.com Título del enlace', 'extlink_tip' => 'Enlace externo (recuerda añadir el prefijo http://)', 'headline_sample' => 'Texto de encabezado', 'headline_tip' => 'Encabezado de nivel 2', 'nowiki_sample' => 'Insertar aquí texto sin formato', 'nowiki_tip' => 'Ignorar el formato wiki', 'image_sample' => 'Ejemplo.jpg', 'image_tip' => 'Archivo incrustado', 'media_sample' => 'Ejemplo.ogg', 'media_tip' => 'Enlace a archivo', 'sig_tip' => 'Tu firma con fecha y hora', 'hr_tip' => 'Línea horizontal (utilizar con moderación)', # Edit pages 'summary' => 'Resumen:', 'subject' => 'Asunto/encabezado:', 'minoredit' => 'Esta es una edición menor', 'watchthis' => 'Vigilar esta página', 'savearticle' => 'Guardar la página', 'preview' => 'Previsualizar', 'showpreview' => 'Mostrar previsualización', 'showlivepreview' => 'Previsualización dinámica', 'showdiff' => 'Mostrar los cambios', 'anoneditwarning' => "'''Aviso:''' No has iniciado sesión con una cuenta de usuario. Tu dirección IP se almacenará en el historial de ediciones de la página.", 'anonpreviewwarning' => "''No has iniciado sesión con una cuenta de usuario. Al guardar los cambios se almacenará tu dirección IP en el historial de edición de la página.''", 'missingsummary' => "'''Atención:''' No has escrito un resumen de edición. Si haces clic nuevamente en «{{int:savearticle}}» tu edición se grabará sin él.", 'missingcommenttext' => 'Escribe un comentario a continuación.', 'missingcommentheader' => "'''Recordatorio:''' No has escrito un título para este comentario. Si haces clic nuevamente en \"{{int:savearticle}}\" tu edición se grabará sin él.", 'summary-preview' => 'Previsualización del resumen:', 'subject-preview' => 'Previsualización del tema/título:', 'blockedtitle' => 'El usuario está bloqueado', 'blockedtext' => "'''Tu nombre de usuario o dirección IP ha sido bloqueada.''' El bloqueo fue hecho por $1. La razón dada es ''$2''. * Inicio del bloqueo: $8 * Caducidad del bloqueo: $6 * Bloqueo destinado a: $7 Puedes contactar con $1 u otro [[{{MediaWiki:Grouppage-sysop}}|administrador]] para discutir el bloqueo. No puedes utilizar la función «enviar correo electrónico a este usuario» a menos que tengas una dirección de correo electrónico válida registrada en tus [[Special:Preferences|preferencias de usuario]] y que el bloqueo no haya inhabilitado esta función. Tu dirección IP actual es $3, y el identificador del bloqueo es #$5. Por favor incluye todos los datos aquí mostrados en cualquier consulta que hagas.", 'autoblockedtext' => "Tu dirección IP ha sido bloqueada automáticamente porque fue utilizada por otro usuario que fue bloqueado por $1. La razón dada es esta: :''$2'' * Inicio del bloqueo: $8 * Caducidad del bloqueo: $6 * Bloqueo destinado a: $7 Puedes contactar con $1 o con otro de los [[{{MediaWiki:Grouppage-sysop}}|administradores]] para discutir el bloqueo. Ten en cuenta que no podrás utilizar la herramienta de «enviar correo electrónico a este usuario» a menos que tengas una dirección de correo electrónico válida registrada en tus [[Special:Preferences|preferencias de usuario]] y que el bloqueo no haya inhabilitado esta función. Tu actual dirección IP es $3, y el identificador del bloqueo es #$5. Por favor, incluye todos los datos mostrados aquí en cualquier consulta que hagas.", 'blockednoreason' => 'no se ha especificado el motivo', 'whitelistedittext' => 'Tienes que $1 para editar artículos.', 'confirmedittext' => 'Debes confirmar tu dirección electrónica antes de editar páginas. Por favor, establece y valida una dirección electrónica a través de tus [[Special:Preferences|preferencias de usuario]].', 'nosuchsectiontitle' => 'Sección no encontrada', 'nosuchsectiontext' => 'Has intentado editar una sección que no existe. Quizá ha sido movida o borrada mientras visitabas la página.', 'loginreqtitle' => 'Es necesario iniciar sesión', 'loginreqlink' => 'iniciar sesión', 'loginreqpagetext' => 'Debes $1 para ver otras páginas.', 'accmailtitle' => 'Se ha enviado la contraseña', 'accmailtext' => 'Se ha enviado a $2 una contraseña generada aleatoriamente para [[User talk:$1|$1]]. La contraseña para esta nueva cuenta puede cambiarse en [[Special:ChangePassword|la página destinada para ello]] después de haber iniciado sesión.', 'newarticle' => '(Nuevo)', 'newarticletext' => 'Has seguido un enlace a una página que aún no existe. Para crear esta página, escribe en el campo a continuación. Para más información, consulta la [[{{MediaWiki:Helppage}}|página de ayuda]]. Si llegaste aquí por error, vuelve a la página anterior.', 'anontalkpagetext' => "---- ''Esta es la página de discusión de un usuario anónimo que aún no ha creado una cuenta, o no la usa. Por lo tanto, tenemos que usar su dirección IP para identificarlo. Una dirección IP puede ser compartida por varios usuarios. Si eres un usuario anónimo y crees que se han dirigido a ti con comentarios improcedentes, por favor [[Special:UserLogin/signup|crea una cuenta]] o si ya la tienes [[Special:UserLogin|identifícate]] para evitar confusiones futuras con otros usuarios anónimos.''", 'noarticletext' => 'En este momento no hay texto en esta página. Puedes [[Special:Search/{{PAGENAME}}|buscar el título de esta página]] en otras páginas, <span class="plainlinks">[{{fullurl:{{#Special:Log}}|page={{FULLPAGENAMEE}}}} buscar en los registros], o [{{fullurl:{{FULLPAGENAME}}|action=edit}} editar esta página]</span>.', 'noarticletext-nopermission' => 'Actualmente no hay texto en esta página. Puedes [[Special:Search/{{PAGENAME}}|buscar este título de página]] en otras páginas, o <span class="plainlinks">[{{fullurl:{{#Special:Log}}|page={{FULLPAGENAMEE}}}} buscar en los registros relacionados]</span>, pero no tienes permiso para crear esta página.', 'missing-revision' => 'La revisión n.º $1 de la página llamada «{{PAGENAME}}» no existe. Normalmente esto ocurre cuando se sigue un enlace de historial obsoleto que apunta a una página ya borrada. Puedes encontrar detalles en el [{{fullurl:{{#Special:Log}}/delete|page={{FULLPAGENAMEE}}}} registro de borrados].', 'userpage-userdoesnotexist' => 'La cuenta de usuario «<nowiki>$1</nowiki>» no está registrada. Por favor comprueba si quieres crear o editar esta página.', 'userpage-userdoesnotexist-view' => 'La cuenta de usuario «$1» no está registrada.', 'blocked-notice-logextract' => 'Este usuario está actualmente bloqueado. La última entrada del registro de bloqueos se proporciona debajo para mayor referencia:', 'clearyourcache' => "'''Nota:''' después de guardar, quizás necesites refrescar la caché de tu navegador para ver los cambios. * '''Firefox / Safari:''' Mantén presionada ''Mayús'' mientras pulsas el botón ''Actualizar'', o presiona ''Ctrl+F5'' o ''Ctrl+R'' (''⌘+R'' en Mac) * '''Google Chrome:''' presiona ''Ctrl+Shift+R'' (''⌘+Mayús+R'' en Mac) * '''Internet Explorer:''' mantén presionada ''Ctrl'' mientras pulsas ''Actualizar'', o presiona ''Ctrl+F5'' * '''Opera:''' vacía la caché en ''Herramientas → Preferencias''", 'usercssyoucanpreview' => "'''Consejo:''' Usa el botón «{{int:showpreview}}» para probar el nuevo CSS antes de guardarlo.", 'userjsyoucanpreview' => "'''Consejo:''' Usa el botón «{{int:showpreview}}» para probar el nuevo JS antes de guardarlo.", 'usercsspreview' => "'''Recuerda que sólo estás previsualizando tu CSS de usuario.''' '''¡Aún no se ha guardado!'''", 'userjspreview' => "'''¡Recuerda que solo estás previsualizando tu JavaScript de usuario.''' '''¡Aún no se ha guardado!'''", 'sitecsspreview' => "'''Recuerda que sólo estás previsualizando este CSS''' '''¡Aún no se ha guardado!'''", 'sitejspreview' => "'''Recuerda que sólo estás previsualizando este código JavaScript.''' '''¡Aún no se ha guardado!'''", 'userinvalidcssjstitle' => "'''Aviso:''' No existe la apariencia «$1». Recuerda que las páginas personalizadas ''.css'' y ''.js'' tienen un título en minúsculas. Por ejemplo, {{ns:user}}:Ejemplo/vector.css en vez de {{ns:user}}:Ejemplo/Vector.css.", 'updated' => '(Actualizado)', 'note' => "'''Nota:'''", 'previewnote' => "'''Recuerda que esto es solo una previsualización.''' ¡Tus cambios aún no se han guardado!", 'continue-editing' => 'Ir al área de edición', 'previewconflict' => 'Esta previsualización refleja el texto en el área de edición superior como aparecerá una vez guardados los cambios.', 'session_fail_preview' => "'''No se pudo procesar la edición debido a una pérdida de los datos de sesión.''' Inténtalo de nuevo. Si el problema persiste, [[Special:UserLogout|cierra la sesión]] y vuelve a identificarte.", 'session_fail_preview_html' => "'''Lo sentimos, no hemos podido procesar tu cambio debido a una pérdida de datos de sesión.''' ''Puesto que este wiki tiene el HTML puro habilitado, la visión preliminar está oculta para prevenirse contra ataques en JavaScript.'' '''Si éste es un intento legítimo de modificación, por favor, inténtalo de nuevo. Si aún así no funcionase, [[Special:UserLogout|cierra la sesión]] e ingresa de nuevo.'''", 'token_suffix_mismatch' => "'''Tu edición ha sido rechazada porque tu cliente ha mezclado los signos de puntuación en el token de edición. Se rechazó la edición para evitar que el texto de la página se corrompa. Esto sucede en ocasiones cuando se usa un servicio de proxy anónimo defectuoso.'''", 'edit_form_incomplete' => "'''Algunas partes del formulario de edición no llegaron al servidor, comprueba que tus ediciones están intactas e inténtalo de nuevo'''.", 'editing' => 'Editar $1', 'creating' => 'Crear la página $1', 'editingsection' => 'Editar $1 (sección)', 'editingcomment' => 'Editar $1 (sección nueva)', 'editconflict' => 'Conflicto de edición: $1', 'explainconflict' => "Alguien más ha cambiado esta página desde que empezaste a editarla. El área de texto superior contiene el texto de la página como existe actualmente. Tus cambios se muestran en el área de texto inferior. Si quieres grabar tus cambios, has de trasladarlos al área superior. '''Sólo''' el texto en el área de texto superior será grabado cuando pulses «{{int:savearticle}}».", 'yourtext' => 'Tu texto', 'storedversion' => 'Versión almacenada', 'nonunicodebrowser' => "'''Atención: Tu navegador no cumple la norma Unicode.''' Se ha activado un sistema de edición alternativo que te permitirá editar artículos con seguridad: los caracteres no ASCII aparecerán en la caja de edición como códigos hexadecimales.", 'editingold' => "'''Aviso: Estás editando una versión antigua de esta página.''' Si la guardas, se perderán los cambios realizados desde esta revisión.", 'yourdiff' => 'Diferencias', 'copyrightwarning' => "Por favor observa que todas las contribuciones a {{SITENAME}} se consideran hechas públicas bajo la $2 (véase $1 para más detalles). Si no deseas la modificación y distribución libre de tu obra, entonces no la pongas aquí.<br />También nos aseguras que tú escribiste esto y te pertenecen de los derechos de autor, o lo copiaste desde el dominio público u otra fuente libre. '''¡No uses escritos con copyright sin permiso!'''", 'copyrightwarning2' => "Por favor, ten en cuenta que todas las contribuciones a {{SITENAME}} pueden ser editadas, modificadas o eliminadas por otros colaboradores. Si no deseas que las modifiquen sin limitaciones y las distribuyan libremente, entonces no las pongas aquí.<br />También nos aseguras que tú escribiste esto y te pertenecen de los derechos de autor, o lo copiaste desde el dominio público u otra fuente libre. (véase $1 para más detalles). '''¡No uses escritos con copyright sin permiso!'''", 'longpageerror' => "'''Error: El texto que has enviado ocupa {{PLURAL:$1|un kilobyte|$1 kilobytes}}, que excede el máximo de {{PLURAL:$2|un kilobyte|$2 kilobytes}}.''' No se lo puede guardar.", 'readonlywarning' => "'''Advertencia: La base de datos ha sido bloqueada para mantenimiento, así que no podrás guardar tus ediciones en este momento.''' Quizás quieras copiar y pegar tu texto en un archivo de texto y guardarlo para después. El administrador que lo bloqueó ofreció esta explicación: $1", 'protectedpagewarning' => "'''Aviso: Esta página ha sido protegida de manera que solo usuarios con permisos de administrador puedan editarla.''' A continuación se muestra la última entrada de registro para referencia:", 'semiprotectedpagewarning' => "'''Nota:''' Esta página ha sido protegida para que solo usuarios registrados puedan editarla. A continuación se provee la última entrada de registro para referencia:", 'cascadeprotectedwarning' => "'''Aviso:''' Esta página está protegida, solo los administradores pueden editarla porque está incluida en {{PLURAL:$1|la siguiente página protegida|las siguientes páginas protegidas}} en cascada:", 'titleprotectedwarning' => "'''Aviso: Esta página está protegida de modo que se necesitan [[Special:ListGroupRights|derechos especificos]] para crearla.''' A continuación se muestra la última entrada de registro para referencia:", 'templatesused' => '{{PLURAL:$1|Plantilla usada|Plantillas usadas}} en esta página:', 'templatesusedpreview' => '{{PLURAL:$1|Plantilla usada|Plantillas usadas}} en esta previsualización:', 'templatesusedsection' => '{{PLURAL:$1|Plantilla usada|Plantillas usadas}} en esta sección:', 'template-protected' => '(protegida)', 'template-semiprotected' => '(semiprotegida)', 'hiddencategories' => 'Esta página es un miembro de {{PLURAL:$1|1 categoría oculta|$1 categorías ocultas}}:', 'edittools' => '<!-- Este texto aparecerá bajo los formularios de edición y subida. -->', 'nocreatetext' => '{{SITENAME}} ha restringido la posibilidad de crear nuevas páginas. Puede volver atrás y editar una página existente, [[Special:UserLogin|identificarte o crear una cuenta]].', 'nocreate-loggedin' => 'No tienes permiso para crear páginas nuevas.', 'sectioneditnotsupported-title' => 'Edición de sección no compatible', 'sectioneditnotsupported-text' => 'La edición de sección no es compatible con esta página.', 'permissionserrors' => 'Error de permiso', 'permissionserrorstext' => 'No tienes permiso para hacer eso, por {{PLURAL:$1|el siguiente motivo|los siguientes motivos}}:', 'permissionserrorstext-withaction' => 'No tienes permiso para $2, por {{PLURAL:$1|el siguiente motivo|los siguientes motivos}}:', 'recreate-moveddeleted-warn' => "'''Atención: estás volviendo a crear una página que ha sido borrada anteriormente.''' Deberías considerar si es apropiado continuar editando esta página. El registro de borrado y traslados para esta página están provistos aquí por conveniencia:", 'moveddeleted-notice' => 'Esta página ha sido borrada. El registro de borrados y traslados para la página están provistos debajo como referencia.', 'log-fulllog' => 'Ver el registro completo', 'edit-hook-aborted' => 'Edición cancelada por la extensión. No se aportaron explicaciones.', 'edit-gone-missing' => 'No se pudo actualizar la página. Parece que ha sido borrada.', 'edit-conflict' => 'Conflicto de edición.', 'edit-no-change' => 'Se ignoró tu revisión, porque no se hizo ningún cambio al texto.', 'postedit-confirmation' => 'Se ha guardado tu edición.', 'edit-already-exists' => 'No se pudo crear una página nueva. Ya existe.', 'defaultmessagetext' => 'Texto de mensaje predeterminado', 'content-failed-to-parse' => 'No se pudo analizar el contenido $2 del modelo $1: $3', 'invalid-content-data' => 'Datos de contenido inválidos', 'content-not-allowed-here' => 'El contenido "$1" no está permitido en la página [[$2]]', 'editwarning-warning' => 'Se perderán los cambios si se cierra esta página. Si has iniciado sesión, puedes desactivar este aviso en la sección «{{int:prefs-editing}}» de las preferencias.', 'editpage-notsupportedcontentformat-title' => 'Formato de contenido no admitido', 'editpage-notsupportedcontentformat-text' => 'El formato de contenido $1 no es compatible con el modelo de contenido $2.', # Content models 'content-model-wikitext' => 'texto wiki', 'content-model-text' => 'Texto sin formato', 'content-model-javascript' => 'JavaScript', 'content-model-css' => 'CSS', # Parser/template warnings 'expensive-parserfunction-warning' => 'Aviso: Esta página contiene demasiadas llamadas a funciones sintácticas costosas (#ifexist: y similares) Tiene {{PLURAL:$1|una llamada|$1 llamadas}}, pero debería tener menos de $2.', 'expensive-parserfunction-category' => 'Páginas con llamadas a funciones sintácticas demasiado costosas', 'post-expand-template-inclusion-warning' => 'Aviso: El tamaño de las plantillas incluidas es muy grande. Algunas plantillas no serán incluidas.', 'post-expand-template-inclusion-category' => 'Páginas con sobrecarga de plantillas', 'post-expand-template-argument-warning' => 'Aviso: Esta página contiene al menos un parámetro de plantilla que tiene un tamaño de expansión demasiado grande. Ese o esos parámetros han sido omitidos.', 'post-expand-template-argument-category' => 'Páginas que contienen plantillas con parámetros descartados', 'parser-template-loop-warning' => 'Detectado bucle de plantilla: [[$1]]', 'parser-template-recursion-depth-warning' => 'Se ha excedido el límite de recursión de plantillas ($1)', 'language-converter-depth-warning' => 'El límite de profundidad del convertidor de idioma ha excedido ($1)', 'node-count-exceeded-category' => 'Páginas donde se supera el número de nodos', 'node-count-exceeded-warning' => 'Página que ha superado el número de nodos', 'expansion-depth-exceeded-category' => 'Páginas donde se supera la profundidad de expansión', 'expansion-depth-exceeded-warning' => 'Página que ha superado la profundidad de expansión', 'parser-unstrip-loop-warning' => 'Se ha detectado un bucle "unstrip"', 'parser-unstrip-recursion-limit' => 'Se ha superado el límite de recursión de "unstrip" ($1)', 'converter-manual-rule-error' => 'Error detectado en la regla de conversión manual del lenguaje', # "Undo" feature 'undo-success' => 'La edición puede deshacerse. Antes de deshacer la edición, comprueba la siguiente comparación para verificar que realmente es lo que quieres hacer, y entonces guarda los cambios para así deshacer la edición.', 'undo-failure' => 'No se puede deshacer la edición ya que otro usuario ha realizado una edición intermedia.', 'undo-norev' => 'La edición no puede ser deshecha porque no existe o ha sido borrada.', 'undo-nochange' => 'Parece que ya se ha deshecho la modificación.', 'undo-summary' => 'Deshecha la revisión $1 de [[Special:Contributions/$2|$2]] ([[User talk:$2|disc.]])', 'undo-summary-username-hidden' => 'Deshacer revisión $1 por usuario oculto', # Account creation failure 'cantcreateaccounttitle' => 'No se puede crear la cuenta', 'cantcreateaccount-text' => "La creación de cuentas desde esta dirección IP ('''$1''') ha sido bloqueada por [[User:$3|$3]]. El motivo dado por $3 es ''$2''", 'cantcreateaccount-range-text' => "La creación de cuentas de usuario desde direcciones IP en el rango '''$1''', que incluye tu dirección IP ('''$4'''), ha sido bloqueada por [[User:$3|$3]]. El motivo dado por $3 es ''$2''", # History pages 'viewpagelogs' => 'Ver los registros de esta página', 'nohistory' => 'No hay historial de ediciones para esta página.', 'currentrev' => 'Revisión actual', 'currentrev-asof' => 'Última revisión de $1', 'revisionasof' => 'Revisión de $1', 'revision-info' => 'Revisión a fecha de $1; $2', 'previousrevision' => '← Revisión anterior', 'nextrevision' => 'Revisión siguiente →', 'currentrevisionlink' => 'Revisión actual', 'cur' => 'act', 'next' => 'sig', 'last' => 'ant', 'page_first' => 'primeras', 'page_last' => 'últimas', 'histlegend' => "Selección de diferencias: marca los selectores de las versiones a comparar y pulsa ''enter'' o el botón de abajo.<br /> Leyenda: '''(act)''' = diferencias con la versión actual, '''(ant)''' = diferencias con la versión anterior, '''m''' = edición menor", 'history-fieldset-title' => 'Buscar en el historial', 'history-show-deleted' => 'Solo ediciones ocultadas', 'histfirst' => 'primeras', 'histlast' => 'últimas', 'historysize' => '({{PLURAL:$1|1 byte|$1 bytes}})', 'historyempty' => '(vacío)', # Revision feed 'history-feed-title' => 'Historial de revisiones', 'history-feed-description' => 'Historial de revisiones para esta página en el wiki', 'history-feed-item-nocomment' => '$1 en $2', 'history-feed-empty' => 'La página solicitada no existe. Puede haber sido borrada del wiki o renombrada. Prueba a [[Special:Search|buscar en el wiki]] nuevas páginas relevantes.', # Revision deletion 'rev-deleted-comment' => '(resumen de edición eliminado)', 'rev-deleted-user' => '(nombre de usuario eliminado)', 'rev-deleted-event' => '(entrada borrada)', 'rev-deleted-user-contribs' => '[nombre de usuario o dirección IP eliminada - edición ocultada de la lista de contribuciones]', 'rev-deleted-text-permission' => "Esta revisión de la página ha sido '''borrada'''. Puede haber detalles en el [{{fullurl:{{#Special:Log}}/delete|page={{FULLPAGENAMEE}}}} registro de borrados].", 'rev-deleted-text-unhide' => "Esta revisión de la página ha sido '''borrada'''. Puede haber más detalles en el [{{fullurl:{{#Special:Log}}/delete|page={{FULLPAGENAMEE}}}} registro de borrados]. Como administrador todavía puedes [$1 ver esta revisión] si así lo deseas.", 'rev-suppressed-text-unhide' => "Esta revisión de la página ha sido '''suprimida'''. Puede haber más detalles en el [{{fullurl:{{#Special:Log}}/suppress|page={{FULLPAGENAMEE}}}} registro de supresiones]. Como administrador podrá seguir [$1 viendo esta revisión] si desea continuar.", 'rev-deleted-text-view' => "Esta revisión de la página ha sido '''borrada'''. Aún tiene la posibilidad de verla; puede ampliar los detalles en el [{{fullurl:{{#Special:Log}}/delete|page={{FULLPAGENAMEE}}}} registro de borrados].", 'rev-suppressed-text-view' => "Esta revisión de la página ha sido '''suprimida'''. Aún tiene la posibilidad de verla; puede ampliar los detalles en el [{{fullurl:{{#Special:Log}}/suppress|page={{FULLPAGENAMEE}}}} registro de supresiones].", 'rev-deleted-no-diff' => "No puedes ver esta diferencia porque una de las revisiones ha sido '''borrada'''. Puedes encontrar más detalles en el [{{fullurl:{{#Special:Log}}/delete|page={{FULLPAGENAMEE}}}} registro de borrados].", 'rev-suppressed-no-diff' => "No puedes ver esta diferencia porque una de las revisiones ha sido '''borrada'''.", 'rev-deleted-unhide-diff' => "Una de las revisiones de esta diferencia ha sido '''borrada'''. Puede ampliar los detalles en el [{{fullurl:{{#Special:Log}}/delete|page={{FULLPAGENAMEE}}}} registro de borrados]. Aún puede [$1 ver este cambio] si así lo desea.", 'rev-suppressed-unhide-diff' => "Una de las revisiones de esta diferencia ha sido '''suprimida'''. Puede haber detalles en el [{{fullurl:{{#Special:Log}}/suppress|page={{FULLPAGENAMEE}}}} registro de supresiones]. Aún puede [$1 ver esta diferencia] si desea así lo desea.", 'rev-deleted-diff-view' => "Una de las revisiones de esta diferencia ha sido '''borrada'''. Aún tiene la posibilidad de verla; puede ampliar los detalles en el [{{fullurl:{{#Special:Log}}/delete|page={{FULLPAGENAMEE}}}} registro de borrados].", 'rev-suppressed-diff-view' => "Una de las revisiones de esta diferencia ha sido '''suprimida'''. Aún tiene la posibilidad de verla; puede ampliar los detalles en el [{{fullurl:{{#Special:Log}}/suppress|page={{FULLPAGENAMEE}}}} registro de supresiones].", 'rev-delundel' => 'mostrar/ocultar', 'rev-showdeleted' => 'mostrar', 'revisiondelete' => 'Borrar/restaurar revisiones', 'revdelete-nooldid-title' => 'No hay revisión destino', 'revdelete-nooldid-text' => 'No se ha especificado una revisión o revisiones destino sobre las que realizar esta función.', 'revdelete-no-file' => 'El archivo especificado no existe.', 'revdelete-show-file-confirm' => '¿Quieres ver la revisión borrada del archivo «<nowiki>$1</nowiki>» del $2 a las $3?', 'revdelete-show-file-submit' => 'Sí', 'revdelete-selected' => "'''{{PLURAL:$2|Revisión seleccionada|Revisiones seleccionadas}} de [[:$1]]:'''", 'logdelete-selected' => "'''{{PLURAL:$1|Seleccionado un evento|Seleccionados eventos}}:'''", 'revdelete-text' => "Las revisiones borradas aún aparecerán en el historial de la página y en los registros, pero sus contenidos no serán accesibles al público.''' Otros administradores de {{SITENAME}} aún podrán acceder al contenido oculto y podrán deshacer el borrado a través de la misma interfaz, a menos que se establezcan restricciones adicionales.", 'revdelete-confirm' => 'Por favor confirma que deseas realizar la operación, que entiendes las consecuencias y que estás ejecutando dicha acción acorde con [[{{MediaWiki:Policy-url}}|las políticas]].', 'revdelete-suppress-text' => "La herramienta de supresión '''solo''' debería usarse en los siguientes casos: * información potencialmente injuriosa o calumniante. * información personal inapropiada, tal como: *: ''nombres, domicilios, números de teléfono, números de la seguridad social e información análoga.''", 'revdelete-legend' => 'Establecer restricciones de revisión:', 'revdelete-hide-text' => 'Texto de la revisión', 'revdelete-hide-image' => 'Ocultar el contenido del archivo', 'revdelete-hide-name' => 'Ocultar acción y objetivo', 'revdelete-hide-comment' => 'Resumen de edición', 'revdelete-hide-user' => 'Nombre/IP del editor', 'revdelete-hide-restricted' => 'Suprimir datos a los administradores así como al resto', 'revdelete-radio-same' => '(no cambiar)', 'revdelete-radio-set' => 'Oculta', 'revdelete-radio-unset' => 'Visible', 'revdelete-suppress' => 'Suprimir datos a los administradores así como al resto', 'revdelete-unsuppress' => 'Eliminar restricciones de revisiones restauradas', 'revdelete-log' => 'Motivo:', 'revdelete-submit' => 'Aplicar a {{PLURAL:$1|la revisión seleccionada|las revisiones seleccionadas}}', 'revdelete-success' => "'''La visibilidad de revisiones ha sido cambiada correctamente.'''", 'revdelete-failure' => "'''La visibilidad de la revisión no pudo ser establecida:''' $1", 'logdelete-success' => 'Visibilidad de eventos cambiada correctamente.', 'logdelete-failure' => "'''La visibilidad del registro no pudo ser ajustada:''' $1", 'revdel-restore' => 'cambiar visibilidad', 'pagehist' => 'Historial de la página', 'deletedhist' => 'Historial borrado', 'revdelete-hide-current' => 'Error al ocultar el objeto de fecha $1 a las $2: es la revisión actual. No puede ser ocultada.', 'revdelete-show-no-access' => 'Error mostrando el objeto de fecha $2, $1: este objeto ha sido marcado como "restringido". No tiene acceso a él.', 'revdelete-modify-no-access' => 'Error modificando el objeto de fecha $2, $1: este objeto ha sido marcado como "restringido". No tiene acceso a él.', 'revdelete-modify-missing' => 'Error modificando el objeto ID $1: ¡no se encuentra en la base de datos!', 'revdelete-no-change' => "'''Atención:''' la revisión de fecha $1 a las $2 ya tiene las restricciones de visibilidad solicitadas.", 'revdelete-concurrent-change' => 'Error modificando el objeto de fecha $2, $1: su estado parece haber sido cambiado por alguien más cuando tratabas de modificarlo. Por favor verifica los registros.', 'revdelete-only-restricted' => 'Error ocultando el item de fecha $2, $1: no puedes suprimir elementos de vista de los administradores sin seleccionar asímismo una de las otras opciones de visibilidad.', 'revdelete-reason-dropdown' => '*Razones de borrado comunes ** Violación a los derechos de autor ** Comentario o información personal inapropiados ** Nombre de usuario inapropiado ** Información potencialmente injuriosa o calumniante', 'revdelete-otherreason' => 'Otro motivo:', 'revdelete-reasonotherlist' => 'Otro motivo', 'revdelete-edit-reasonlist' => 'Editar motivos de borrado', 'revdelete-offender' => 'Autor de la revisión:', # Suppression log 'suppressionlog' => 'Registro de supresiones', 'suppressionlogtext' => 'A continuación hay una lista con los borrados y bloqueos cuyo contenido se encuentra oculto para los administradores. Véase la [[Special:BlockList|lista de bloqueos]] que incluye las prohibiciones y bloqueos actualmente operativos.', # History merging 'mergehistory' => 'Fusionar historiales de páginas', 'mergehistory-header' => 'Esta página te permite fusionar revisiones del historial de una página origen en otra más reciente. Asegúrate de que esto mantendrá la continuidad histórica de la página.', 'mergehistory-box' => 'Fusionar los historiales de dos páginas:', 'mergehistory-from' => 'Página origen:', 'mergehistory-into' => 'Página destino:', 'mergehistory-list' => 'Historial de ediciones fusionable', 'mergehistory-merge' => 'Las siguientes revisiones de [[:$1]] pueden fusionarse en [[:$2]]. Usa la columna de casillas para fusionar sólo las revisiones creadas en y antes de la fecha especificada. Nota que usar los enlaces de navegación borrará las selecciones de esta columna.', 'mergehistory-go' => 'Mostrar ediciones fusionables', 'mergehistory-submit' => 'Fusionar revisiones', 'mergehistory-empty' => 'No hay revisiones fusionables.', 'mergehistory-success' => '$3 {{PLURAL:$3|revisión|revisiones}} de [[:$1]] fusionadas de forma exitosa en [[:$2]].', 'mergehistory-fail' => 'No se puede realizar la fusión de historiales, por favor revisa la página y los parámetros de tiempo.', 'mergehistory-no-source' => 'La página origen $1 no existe.', 'mergehistory-no-destination' => 'La página destino $1 no existe.', 'mergehistory-invalid-source' => 'La página origen debe tener un título válido.', 'mergehistory-invalid-destination' => 'La página de destino ha de tener un título válido.', 'mergehistory-autocomment' => 'Fusionando [[:$1]] en [[:$2]]', 'mergehistory-comment' => 'Fusionando [[:$1]] en [[:$2]]: $3', 'mergehistory-same-destination' => 'Las páginas de origen y destino no pueden ser la misma', 'mergehistory-reason' => 'Motivo:', # Merge log 'mergelog' => 'Registro de fusiones', 'pagemerge-logentry' => 'fusionó [[$1]] en [[$2]] (revisiones hasta $3)', 'revertmerge' => 'Deshacer fusión', 'mergelogpagetext' => 'Debajo está una lista de las fusiones más recientes de historial de una página en otra.', # Diffs 'history-title' => 'Historial de revisiones para «$1»', 'difference-title' => 'Diferencia entre revisiones de «$1»', 'difference-title-multipage' => 'Diferencia entre las páginas «$1» y «$2»', 'difference-multipage' => '(Diferencia entre las páginas)', 'lineno' => 'Línea $1:', 'compareselectedversions' => 'Comparar versiones seleccionadas', 'showhideselectedversions' => 'Mostrar/ocultar versiones seleccionadas', 'editundo' => 'deshacer', 'diff-empty' => '(Sin diferencias)', 'diff-multi-sameuser' => '({{PLURAL:$1|Una revisión intermedia|$1 revisiones intermedias}} por el mismo usuario no mostrado)', 'diff-multi-manyusers' => '(No se {{PLURAL:$1|muestra una edición intermedia|muestran $1 ediciones intermedias}} de {{PLURAL:$2|un usuario|$2 usuarios}})', 'difference-missing-revision' => 'No {{PLURAL:$2|se ha encontrado|se han encontrado}} {{PLURAL:$2|una revisión|$2 revisiones}} de esta diferencia ($1). Esto suele deberse a seguir un enlace obsoleto hacia una página que ya ha sido borrada. Los detalles pueden encontrarse en el [{{fullurl:{{#Special:Log}}/delete|page={{FULLPAGENAMEE}}}} registro de borrado].', # Search results 'searchresults' => 'Resultados de la búsqueda', 'searchresults-title' => 'Resultados de la búsqueda de «$1»', 'toomanymatches' => 'Se han obtenido muchos resultados; por favor intenta una consulta diferente', 'titlematches' => 'Coincidencias de título de artículo', 'textmatches' => 'Coincidencias de texto de artículo', 'notextmatches' => 'No hay coincidencias de texto de artículo', 'prevn' => '{{PLURAL:$1|$1}} previas', 'nextn' => '{{PLURAL:$1|$1}} siguientes', 'prevn-title' => '$1 {{PLURAL:$1|resultado|resultados}} previos', 'nextn-title' => 'Próximos $1 {{PLURAL:$1|resultado|resultados}}', 'shown-title' => 'Mostrar $1 {{PLURAL:$1|resultado|resultados}} por página', 'viewprevnext' => 'Ver ($1 {{int:pipe-separator}} $2) ($3).', 'searchmenu-exists' => "'''Hay una página llamada \"[[:\$1]]\" en esta wiki.'''", 'searchmenu-new' => '<strong>Crear la página «[[:$1]]» en este wiki.</strong> {{PLURAL:$2|0=|Véase también la página encontrada con la búsqueda.|Véanse también los resultados de la búsqueda.}}', 'searchprofile-articles' => 'Páginas de contenido', 'searchprofile-project' => 'Páginas de ayuda y de proyecto', 'searchprofile-images' => 'Multimedia', 'searchprofile-everything' => 'Todo', 'searchprofile-advanced' => 'Avanzado', 'searchprofile-articles-tooltip' => 'Buscar en $1', 'searchprofile-project-tooltip' => 'Buscar en $1', 'searchprofile-images-tooltip' => 'Buscar archivos', 'searchprofile-everything-tooltip' => 'Buscar en todo el contenido (incluyendo páginas de discusión)', 'searchprofile-advanced-tooltip' => 'Buscar en espacios de nombres personalizados', 'search-result-size' => '$1 ({{PLURAL:$2|1 palabra|$2 palabras}})', 'search-result-category-size' => '{{PLURAL:$1|1 miembro|$1 miembros}} ({{PLURAL:$2|1 subcategoría|$2 subcategorías}}, {{PLURAL:$3|1 fichero|$3 ficheros}})', 'search-result-score' => 'Relevancia: $1%', 'search-redirect' => '(redirige desde $1)', 'search-section' => '(sección $1)', 'search-file-match' => '(coincide con el contenido del archivo)', 'search-suggest' => 'Quizás quieres buscar: $1', 'search-interwiki-caption' => 'Proyectos hermanos', 'search-interwiki-default' => 'Resultados de $1:', 'search-interwiki-more' => '(más)', 'search-relatedarticle' => 'Relacionado', 'searcheverything-enable' => 'Buscar en todos los espacios de nombres', 'searchrelated' => 'relacionado', 'searchall' => 'todos', 'showingresults' => "Abajo se {{PLURAL:$1|muestra '''1''' resultado|muestran hasta '''$1''' resultados}} comenzando por el n.º '''$2'''.", 'showingresultsnum' => "Abajo se {{PLURAL:$3|muestra '''1''' resultado|muestran los '''$3''' resultados}} comenzando por el n.º '''$2'''.", 'showingresultsheader' => "{{PLURAL:$5|Resultado '''$1''' de '''$3'''|Resultados '''$1-$2''' de '''$3'''}} para '''$4'''", 'search-nonefound' => 'No hay resultados que cumplan los criterios de búsqueda.', 'powersearch-legend' => 'Búsqueda avanzada', 'powersearch-ns' => 'Buscar en los espacios de nombres:', 'powersearch-redir' => 'Listar redirecciones', 'powersearch-togglelabel' => 'Seleccionar:', 'powersearch-toggleall' => 'Todos', 'powersearch-togglenone' => 'Ninguno', 'search-external' => 'Búsqueda externa', 'searchdisabled' => 'Las búsquedas en {{SITENAME}} están temporalmente desactivadas. Mientras tanto puedes buscar mediante Google, pero ten en cuenta que sus índices relativos a {{SITENAME}} pueden estar desactualizados.', 'search-error' => 'Ha ocurrido un error al buscar: $1', # Preferences page 'preferences' => 'Preferencias', 'mypreferences' => 'Preferencias', 'prefs-edits' => 'Cantidad de ediciones:', 'prefsnologintext2' => 'Necesitas $1 para definir las preferencias del usuario.', 'prefs-skin' => 'Apariencia', 'skin-preview' => 'Previsualizar', 'datedefault' => 'Sin preferencia', 'prefs-beta' => 'Funciones en pruebas', 'prefs-datetime' => 'Fecha y hora', 'prefs-labs' => 'Características de los laboratorios', 'prefs-user-pages' => 'Páginas de usuario', 'prefs-personal' => 'Perfil de usuario', 'prefs-rc' => 'Cambios recientes', 'prefs-watchlist' => 'Seguimiento', 'prefs-watchlist-days' => 'Número de días a mostrar en la lista de seguimiento:', 'prefs-watchlist-days-max' => 'Máximo $1 {{PLURAL:$1|día|días}}', 'prefs-watchlist-edits' => 'Número de ediciones a mostrar en la lista expandida:', 'prefs-watchlist-edits-max' => 'Cantidad máxima: 1000', 'prefs-watchlist-token' => 'Ficha de lista de seguimiento:', 'prefs-misc' => 'Miscelánea', 'prefs-resetpass' => 'Cambiar contraseña', 'prefs-changeemail' => 'Cambiar correo electrónico', 'prefs-setemail' => 'Establecer una dirección de correo electrónico', 'prefs-email' => 'Opciones de correo electrónico', 'prefs-rendering' => 'Apariencia', 'saveprefs' => 'Guardar', 'restoreprefs' => 'Restaurar la configuración predeterminada', 'prefs-editing' => 'Edición', 'rows' => 'Filas:', 'columns' => 'Columnas:', 'searchresultshead' => 'Búsquedas', 'stub-threshold' => 'Límite para formato de <a href="#" class="stub">enlace a esbozo</a> (bytes):', 'stub-threshold-disabled' => 'Desactivado', 'recentchangesdays' => 'Días a mostrar en cambios recientes:', 'recentchangesdays-max' => '(máximo {{PLURAL:$1|un día|$1 días}})', 'recentchangescount' => 'Número de ediciones a mostrar de manera predeterminada:', 'prefs-help-recentchangescount' => 'Esto incluye cambios recientes, historiales de página, y registros.', 'prefs-help-watchlist-token2' => 'Esta es la clave secreta para el canal de contenido web de tu lista de seguimiento. Cualquier persona que la conozca podría leer tu lista, así que no la compartas. [[Special:ResetTokens|Pulsa aquí si necesitas restablecerla]].', 'savedprefs' => 'Se han guardado tus preferencias.', 'timezonelegend' => 'Huso horario:', 'localtime' => 'Hora local:', 'timezoneuseserverdefault' => 'Usar la hora del servidor ($1)', 'timezoneuseoffset' => 'Otra (especifica la diferencia horaria)', 'servertime' => 'Hora del servidor:', 'guesstimezone' => 'Rellenar a partir de la hora del navegador', 'timezoneregion-africa' => 'África', 'timezoneregion-america' => 'América', 'timezoneregion-antarctica' => 'Antártida', 'timezoneregion-arctic' => 'Ártico', 'timezoneregion-asia' => 'Asia', 'timezoneregion-atlantic' => 'Océano Atlántico', 'timezoneregion-australia' => 'Australia', 'timezoneregion-europe' => 'Europa', 'timezoneregion-indian' => 'Océano Índico', 'timezoneregion-pacific' => 'Océano Pacífico', 'allowemail' => 'Aceptar correo electrónico de otros usuarios', 'prefs-searchoptions' => 'Buscar', 'prefs-namespaces' => 'Espacios de nombres', 'defaultns' => 'De lo contrario, buscar en estos espacios de nombres:', 'default' => 'predeterminado', 'prefs-files' => 'Archivos', 'prefs-custom-css' => 'CSS personalizado', 'prefs-custom-js' => 'JavaScript personalizado', 'prefs-common-css-js' => 'CSS/JS compartido para todas las skins:', 'prefs-reset-intro' => 'Puedes usar esta página para restaurar tus preferencias a las predeterminadas del sitio. Esto no se puede deshacer.', 'prefs-emailconfirm-label' => 'Confirmación de correo electrónico:', 'youremail' => 'Correo electrónico:', 'username' => '{{GENDER:$1|Nombre de usuario|Nombre de usuaria}}:', 'uid' => 'ID de {{GENDER:$1|usuario|usuaria}}:', 'prefs-memberingroups' => '{{GENDER:$2|Miembro}} {{PLURAL:$1|del grupo|de los grupos}}:', 'prefs-registration' => 'Fecha y hora de registro:', 'yourrealname' => 'Nombre real:', 'yourlanguage' => 'Idioma:', 'yourvariant' => 'Variante lingüística del contenido:', 'prefs-help-variant' => 'Tu variante u ortografía preferida para mostrar las páginas de contenido de este wiki.', 'yournick' => 'Firma nueva:', 'prefs-help-signature' => 'Los comentarios en páginas de discusión deberían firmarse con «<nowiki>~~~~</nowiki>», que se convertirá en tu firma con fecha y hora.', 'badsig' => 'El código de tu firma no es válido; comprueba las etiquetas HTML.', 'badsiglength' => 'Tu firma es muy larga. Debe contener un máximo de {{PLURAL:$1|un carácter|$1 caracteres}}.', 'yourgender' => 'Sexo:', 'gender-unknown' => 'Prefiero no especificarlo', 'gender-male' => 'Masculino', 'gender-female' => 'Femenino', 'prefs-help-gender' => 'Opcional: empleado para que sea usado correctamente el género por parte del software. Esta información será pública.', 'email' => 'Correo electrónico', 'prefs-help-realname' => 'El nombre real es opcional. Si decides proporcionarlo, se usará para dar atribución a tu trabajo.', 'prefs-help-email' => 'La dirección de correo electrónico es opcional, pero es necesaria para el restablecimiento de tu contraseña, en caso de que la olvides.', 'prefs-help-email-others' => 'También puedes permitir que otros usuarios te contacten por correo a través de un enlace en tus páginas de usuario y de discusión. Tu dirección de correo no se revela cuando otros usuarios te contactan.', 'prefs-help-email-required' => 'Es necesario proporcionar una dirección de correo electrónico.', 'prefs-info' => 'Información básica', 'prefs-i18n' => 'Internacionalización', 'prefs-signature' => 'Firma', 'prefs-dateformat' => 'Formato de fecha', 'prefs-timeoffset' => 'Diferencia horaria', 'prefs-advancedediting' => 'Opciones generales', 'prefs-editor' => 'Editor', 'prefs-preview' => 'Previsualización', 'prefs-advancedrc' => 'Opciones avanzadas', 'prefs-advancedrendering' => 'Opciones avanzadas', 'prefs-advancedsearchoptions' => 'Opciones avanzadas', 'prefs-advancedwatchlist' => 'Opciones avanzadas', 'prefs-displayrc' => 'Opciones de mostrado', 'prefs-displaysearchoptions' => 'Opciones de visualización', 'prefs-displaywatchlist' => 'Opciones de visualización', 'prefs-tokenwatchlist' => 'Clave', 'prefs-diffs' => 'Diferencias', 'prefs-help-prefershttps' => 'Esta preferencia tendrá efecto en tu próximo inicio de sesión.', 'prefs-tabs-navigation-hint' => 'Sugerencia: Puede utilizar las teclas de flecha izquierda y derecha para navegar entre las pestañas de la lista de pestañas.', # User preference: email validation using jQuery 'email-address-validity-valid' => 'La dirección de correo electrónico parece ser válida', 'email-address-validity-invalid' => 'Introduce una dirección de correo válida', # User rights 'userrights' => 'Gestión de permisos del usuario', 'userrights-lookup-user' => 'Configurar grupos de usuarios', 'userrights-user-editname' => 'Escriba un nombre de usuario:', 'editusergroup' => 'Modificar grupos de usuarios', 'editinguser' => "Cambiando los derechos del usuario '''[[User:$1|$1]]''' $2", 'userrights-editusergroup' => 'Modificar grupos de usuarios', 'saveusergroups' => 'Guardar grupos de usuarios', 'userrights-groupsmember' => 'Miembro de:', 'userrights-groupsmember-auto' => 'Miembro implícito de:', 'userrights-groups-help' => 'Puedes modificar los grupos a los que pertenece {{GENDER:$1|este usuario|esta usuaria}}: * Un recuadro marcado significa que {{GENDER:$1|el usuario|la usuaria}} está en ese grupo. * Un recuadro no marcado significa que {{GENDER:$1|el usuario|la usuaria}} no está en ese grupo. * Un * indica que no podrás eliminar el grupo una vez que lo agregues, o viceversa.', 'userrights-reason' => 'Motivo:', 'userrights-no-interwiki' => 'No tienes permiso para editar los grupos a los que pertenece un usuario en otros wikis.', 'userrights-nodatabase' => 'La base de datos $1 no existe o no es local.', 'userrights-nologin' => 'Debes [[Special:UserLogin|iniciar sesión]] con una cuenta de administrador para poder editar los grupos de los usuarios.', 'userrights-notallowed' => 'No tienes permiso para agregar o quitar derechos de usuario.', 'userrights-changeable-col' => 'Grupos que puedes cambiar', 'userrights-unchangeable-col' => 'Grupos que no puedes cambiar', 'userrights-conflict' => '¡Conflicto de cambio de los derechos de usuario! Por favor, revisar y confirmar tus cambios.', 'userrights-removed-self' => 'Usted eliminado con éxito sus propios derechos. Por lo tanto, usted ya no es capaz de acceder a esta página.', # Groups 'group' => 'Grupo:', 'group-user' => 'Usuarios', 'group-autoconfirmed' => 'Usuarios autoconfirmados', 'group-bot' => 'Bots', 'group-sysop' => 'Administradores', 'group-bureaucrat' => 'Burócratas', 'group-suppress' => 'Supresores de ediciones', 'group-all' => '(todos)', 'group-user-member' => '{{GENDER:$1|usuario|usuaria}}', 'group-autoconfirmed-member' => '{{GENDER:$1|usuario autoconfirmado|usuaria autoconfirmada}}', 'group-bot-member' => 'bot', 'group-sysop-member' => '{{GENDER:$1|administrador|administradora}}', 'group-bureaucrat-member' => 'burócrata', 'group-suppress-member' => '{{GENDER:$1|supresor|supresora}} de ediciones', 'grouppage-user' => '{{ns:project}}:Usuarios', 'grouppage-autoconfirmed' => '{{ns:project}}:Usuarios autoconfirmados', 'grouppage-bot' => '{{ns:project}}:Bots', 'grouppage-sysop' => '{{ns:project}}:Administradores', 'grouppage-bureaucrat' => '{{ns:project}}:Burócratas', 'grouppage-suppress' => '{{ns:project}}:Supresores de ediciones', # Rights 'right-read' => 'Leer páginas', 'right-edit' => 'Editar páginas', 'right-createpage' => 'Crear páginas que no sean páginas de discusión', 'right-createtalk' => 'Crear páginas de discusión', 'right-createaccount' => 'Crear cuentas de usuario nuevas', 'right-minoredit' => 'Marcar ediciones como menores', 'right-move' => 'Trasladar páginas', 'right-move-subpages' => 'Trasladar páginas con sus subpáginas', 'right-move-rootuserpages' => 'Trasladar páginas de usuario raíz', 'right-movefile' => 'Trasladar archivos', 'right-suppressredirect' => 'No crear redirecciones de las páginas fuente al trasladar páginas', 'right-upload' => 'Subir archivos', 'right-reupload' => 'Subir una nueva versión de un archivo existente', 'right-reupload-own' => 'Subir una nueva versión de un archivo creado por uno mismo', 'right-reupload-shared' => 'Sobreescribir localmente ficheros del repositorio multimedia', 'right-upload_by_url' => 'Subir un archivo a traves de un URL', 'right-purge' => 'Purgar la caché en el servidor sin tener que dar confirmación', 'right-autoconfirmed' => 'No ser afectado por los límites de frecuencia basados en el IP', 'right-bot' => 'Ser tratado como un programa automático', 'right-nominornewtalk' => 'No accionar el aviso de nuevos mensajes al realizar ediciones menores de páginas de discusión', 'right-apihighlimits' => 'Tener límites más altos de peticiones a través del API', 'right-writeapi' => 'Hacer uso del API para escribir', 'right-delete' => 'Borrar páginas', 'right-bigdelete' => 'Borrar páginas con historiales grandes', 'right-deletelogentry' => 'Borrar y recuperar entradas de registro específicas', 'right-deleterevision' => 'Borrar y restaurar revisiones específicas de páginas', 'right-deletedhistory' => 'Ver el historial de páginas borradas, sin el texto asociado', 'right-deletedtext' => 'Ver texto borrado y cambios entre revisiones borradas', 'right-browsearchive' => 'Buscar páginas borradas', 'right-undelete' => 'Restaurar una página', 'right-suppressrevision' => 'Revisar y restaurar revisiones escondidas por administradores', 'right-suppressionlog' => 'Ver registros privados', 'right-block' => 'Bloquear a otros usuarios para que no editen', 'right-blockemail' => 'Bloquear a un usuario para que no pueda mandar correos electrónicos', 'right-hideuser' => 'Bloquear un nombre de usuario, haciéndolo invisible', 'right-ipblock-exempt' => 'Pasar por encima de bloqueos de IPs, auto-bloqueos y bloqueos de rangos.', 'right-proxyunbannable' => 'Pasar por encima de bloqueos automáticos de proxies', 'right-unblockself' => 'Desbloquearse uno mismo', 'right-protect' => 'Cambiar niveles de protección y editar páginas protegidas en cascada', 'right-editprotected' => 'Editar páginas protegidas como «{{int:protect-level-sysop}}»', 'right-editsemiprotected' => 'Editar páginas protegidas como «{{int:protect-level-autoconfirmed}}»', 'right-editinterface' => 'Editar la interfaz de usuario', 'right-editusercssjs' => 'Editar las páginas de CSS y JS de otros usuarios', 'right-editusercss' => 'Editar las páginas de CSS de otros usuarios', 'right-edituserjs' => 'Editar las páginas de JS de otros usuarios', 'right-editmyusercss' => 'Editar tus archivos de usuario CSS', 'right-editmyuserjs' => 'Editar tus propios archivos JavaScript de usuario', 'right-viewmywatchlist' => 'Ver tu lista de seguimiento', 'right-editmywatchlist' => 'Editar tu lista de seguimiento. Algunas acciones seguirán agregando páginas aún sin este derecho.', 'right-viewmyprivateinfo' => 'Ver tu información privada (ej. email, nombre real)', 'right-editmyprivateinfo' => 'Editar tus propios datos privados (ej: email, nombre real)', 'right-editmyoptions' => 'Editar tus propias preferencias', 'right-rollback' => 'Revertir rápidamente las ediciones del último usuario que modificó una página en particular', 'right-markbotedits' => 'Marcar ediciones deshechas como ediciones de un bot', 'right-noratelimit' => 'No afectado por límites de frecuencia', 'right-import' => 'Importar páginas desde otras wikis', 'right-importupload' => 'Importar páginas de un archivo subido', 'right-patrol' => 'Marcar ediciones de otros como patrulladas', 'right-autopatrol' => 'Marcar como patrulladas sus ediciones automáticamente', 'right-patrolmarks' => 'Ver las marcas de patrullaje de cambios recientes', 'right-unwatchedpages' => 'Ver una lista de páginas no vigiladas', 'right-mergehistory' => 'Fusionar historiales', 'right-userrights' => 'Modificar todos los derechos de usuario', 'right-userrights-interwiki' => 'Modificar los derechos de usuarios en otros wikis', 'right-siteadmin' => 'Bloquear y desbloquear la base de datos', 'right-override-export-depth' => 'Exporta páginas incluyendo aquellas enlazadas hasta una profundidad de 5', 'right-sendemail' => 'Enviar un correo electrónico a otros usuarios', 'right-passwordreset' => 'Ver os correos electrónicos de restablecimiento de contraseñas', # Special:Log/newusers 'newuserlogpage' => 'Registro de creación de usuarios', 'newuserlogpagetext' => 'Este es un registro de creación de usuarios.', # User rights log 'rightslog' => 'Cambios de perfil de usuario', 'rightslogtext' => 'Este es un registro de cambios en los permisos de usuarios.', # Associated actions - in the sentence "You do not have permission to X" 'action-read' => 'leer esta página', 'action-edit' => 'modificar esta página', 'action-createpage' => 'crear páginas', 'action-createtalk' => 'crear páginas de discusión', 'action-createaccount' => 'crear esta cuenta de usuario', 'action-minoredit' => 'marcar este cambio como menor', 'action-move' => 'trasladar esta página', 'action-move-subpages' => 'trasladar esta página y sus subpáginas', 'action-move-rootuserpages' => 'trasladar páginas de usuario raíz', 'action-movefile' => 'trasladar este archivo', 'action-upload' => 'subir este archivo', 'action-reupload' => 'reemplazar este archivo existente', 'action-reupload-shared' => 'reemplazar este archivo existente en un depósito compartido', 'action-upload_by_url' => 'subir este archivo desde una dirección URL', 'action-writeapi' => 'utilizar el API de escritura', 'action-delete' => 'borrar esta página', 'action-deleterevision' => 'borrar esta revisión', 'action-deletedhistory' => 'ver el historial borrado de esta página', 'action-browsearchive' => 'buscar páginas borradas', 'action-undelete' => 'recuperar esta página', 'action-suppressrevision' => 'revisar y restaurar esta revisión escondida', 'action-suppressionlog' => 'ver este registro privado', 'action-block' => 'bloquear a este usuario para que no edite', 'action-protect' => 'cambiar los niveles de protección para esta página', 'action-rollback' => 'revertir rápidamente las ediciones del último usuario que modificó una página en particular', 'action-import' => 'importar páginas desde otro wiki', 'action-importupload' => 'importar páginas mediante la carga de un archivo', 'action-patrol' => 'marcar ediciones de otros como patrulladas', 'action-autopatrol' => 'marcar como patrulladas tus propias ediciones', 'action-unwatchedpages' => 'ver la lista de páginas no vigiladas', 'action-mergehistory' => 'fusionar el historial de esta página', 'action-userrights' => 'modificar todos los derechos de usuario', 'action-userrights-interwiki' => 'modificar los derechos de usuarios en otros wikis', 'action-siteadmin' => 'bloquear o desbloquear la base de datos', 'action-sendemail' => 'enviar correos electrónicos', 'action-editmywatchlist' => 'Editar tu lista de seguimiento', 'action-viewmywatchlist' => 'Ver tu lista de seguimiento', 'action-viewmyprivateinfo' => 'ver tu información privada', 'action-editmyprivateinfo' => 'Editar tu información privada', # Recent changes 'nchanges' => '$1 {{PLURAL:$1|cambio|cambios}}', 'enhancedrc-since-last-visit' => '$1 {{PLURAL:$1|desde la última visita}}', 'enhancedrc-history' => 'historial', 'recentchanges' => 'Cambios recientes', 'recentchanges-legend' => 'Opciones sobre cambios recientes', 'recentchanges-summary' => 'Sigue los cambios más recientes de la wiki en esta página.', 'recentchanges-noresult' => 'No hubo cambios durante el período seleccionado que respondan a esos criterios.', 'recentchanges-feed-description' => 'Realiza un seguimiento de los cambios más recientes en el wiki en este canal.', 'recentchanges-label-newpage' => 'Esta edición creó una nueva página', 'recentchanges-label-minor' => 'Esta es una edición menor', 'recentchanges-label-bot' => 'Esta edición fue realizada por un robot', 'recentchanges-label-unpatrolled' => 'Esta edición todavía no se ha patrullado', 'recentchanges-label-plusminus' => 'El tamaño de la página cambió esta cantidad de bytes', 'recentchanges-legend-heading' => "'''Leyenda:'''", 'recentchanges-legend-newpage' => '(véase también la [[Special:NewPages|lista de páginas nuevas]])', 'rcnotefrom' => 'A continuación se muestran los cambios desde <b>$2</b> (hasta <b>$1</b>).', 'rclistfrom' => 'Mostrar nuevos cambios desde $1', 'rcshowhideminor' => '$1 ediciones menores', 'rcshowhidebots' => '$1 bots', 'rcshowhideliu' => '$1 usuarios registrados', 'rcshowhideanons' => '$1 usuarios anónimos', 'rcshowhidepatr' => '$1 ediciones patrulladas', 'rcshowhidemine' => '$1 mis ediciones', 'rclinks' => 'Ver los últimos $1 cambios en los últimos $2 días.<br />$3', 'diff' => 'dif', 'hist' => 'hist', 'hide' => 'Ocultar', 'show' => 'mostrar', 'minoreditletter' => 'm', 'newpageletter' => 'N', 'boteditletter' => 'b', 'number_of_watching_users_pageview' => '[$1 {{PLURAL:$1|usuario|usuarios}} vigilando]', 'rc_categories' => 'Limitar a las categorías (separadas por «|»)', 'rc_categories_any' => 'Cualquiera', 'rc-change-size-new' => '$1 {{PLURAL:$1|byte|bytes}} después del cambio', 'newsectionsummary' => 'Nueva sección: /* $1 */', 'rc-enhanced-expand' => 'Mostrar detalles', 'rc-enhanced-hide' => 'Ocultar detalles', 'rc-old-title' => 'originalmente creado como "$1"', # Recent changes linked 'recentchangeslinked' => 'Cambios relacionados', 'recentchangeslinked-feed' => 'Cambios relacionados', 'recentchangeslinked-toolbox' => 'Cambios relacionados', 'recentchangeslinked-title' => 'Cambios relacionados con «$1»', 'recentchangeslinked-summary' => "Esta página es una lista de los últimos cambios en las páginas enlazadas desde una página (o en las pertenecientes a una categoría). Las páginas que están en tu [[Special:Watchlist|lista de seguimiento]] aparecen en '''negrita'''.", 'recentchangeslinked-page' => 'Nombre de la página:', 'recentchangeslinked-to' => 'Muestra los cambios recientes en lugar de la página indicada', # Upload 'upload' => 'Subir un archivo', 'uploadbtn' => 'Subir un archivo', 'reuploaddesc' => 'Regresar al formulario para subir.', 'upload-tryagain' => 'Envíe la descripción del archivo modificado', 'uploadnologin' => 'No has iniciado sesión', 'uploadnologintext' => 'Tienes que $1 para subir archivos.', 'upload_directory_missing' => 'El directorio de subida de archivos ($1) no existe, y no puede ser creado por el servidor.', 'upload_directory_read_only' => 'El servidor web no puede escribir en el directorio de subida de archivos ($1).', 'uploaderror' => 'Error al intentar subir archivo', 'upload-recreate-warning' => "'''Aviso: Un archivo con ese nombre ha sido eliminado o renombrado.''' A continuación se muestra el registro de borrados y traslados de esta página:", 'uploadtext' => "Utiliza el siguiente formulario para subir archivos. Para ver o buscar archivos subidos con anterioridad, ve a la [[Special:FileList|lista de archivos subidos]]. Los archivos subidos quedarán registrados además en el [[Special:Log/upload|registro de archivos subidos]] y los borrados en el [[Special:Log/delete|registro de borrados]]. Para incluir un archivo en una página, usa un enlace como los mostrados a continuación: * '''<code><nowiki>[[</nowiki>{{ns:file}}<nowiki>:File.jpg]]</nowiki></code>''' para usar el fichero en tamaño completo * '''<code><nowiki>[[</nowiki>{{ns:file}}<nowiki>:File.png|200px|thumb|left|texto descriptivo]]</nowiki></code>''' para una versión de 200 píxeles de ancho en una caja en el margen izquierdo con 'texto descriptivo' como descripción * '''<code><nowiki>[[</nowiki>{{ns:media}}<nowiki>:File.ogg]]</nowiki></code>''' para enlazar directamente al fichero sin mostrarlo.", 'upload-permitted' => 'Tipos de archivo permitidos: $1.', 'upload-preferred' => 'Tipos de archivo preferidos: $1.', 'upload-prohibited' => 'Tipos de archivo prohibidos: $1.', 'uploadlog' => 'registro de subidas', 'uploadlogpage' => 'Subidas de archivos', 'uploadlogpagetext' => 'Abajo hay una lista de los últimos archivos subidos. Mira la [[Special:NewFiles|galería de archivos nuevos]] para una descripción visual', 'filename' => 'Nombre del archivo', 'filedesc' => 'Sumario', 'fileuploadsummary' => 'Descripción:', 'filereuploadsummary' => 'Cambios de archivo:', 'filestatus' => 'Estado de copyright:', 'filesource' => 'Fuente:', 'uploadedfiles' => 'Archivos subidos', 'ignorewarning' => 'Ignorar aviso y guardar de todos modos', 'ignorewarnings' => 'Ignorar cualquier aviso', 'minlength1' => 'Los nombres de archivo deben tener al menos una letra.', 'illegalfilename' => 'El nombre de archivo «$1» contiene caracteres que no están permitidos en títulos de páginas. Por favor, renombra el archivo e intenta volver a subirlo.', 'filename-toolong' => 'Los nombres de archivo no pueden tener más de 240 bytes.', 'badfilename' => 'El nombre de la imagen se ha cambiado a «$1».', 'filetype-mime-mismatch' => 'La extensión de archivo «.$1» no coincide con el tipo detectado de MIME del archivo ($2).', 'filetype-badmime' => 'No se permite subir archivos de tipo MIME «$1».', 'filetype-bad-ie-mime' => 'No se puede subir este archivo porque Internet Explorer podría considerarlo como «$1», que es un tipo de archivo no permitido y potencialmente peligroso.', 'filetype-unwanted-type' => "'''«.$1»''' no está entre los tipos de fichero aconsejados. {{PLURAL:$3|El único tipo aconsejado es|Los tipos aconsejados son}} $2.", 'filetype-banned-type' => '\'\'\'".$1"\'\'\' {{PLURAL:$4|no es un tipo de archivo permitido|no son tipos de archivos permitidos}}. {{PLURAL:$3|El tipo de archivo permitido es|Los tipos de archivos permitidos son}} $2.', 'filetype-missing' => 'El archivo no tiene extensión (como «.jpg»).', 'empty-file' => 'El archivo que enviaste estaba vacío.', 'file-too-large' => 'El archivo que enviste era demasiado grande.', 'filename-tooshort' => 'El nombre de archivo es demasiado corto.', 'filetype-banned' => 'El tipo de archivo está prohibido.', 'verification-error' => 'Este archivo no pasó la verificación de archivos.', 'hookaborted' => 'La modificación que ha intentado realizar fue cancelada por un adicional de extensión.', 'illegal-filename' => 'El nombre de archivo no está permitido.', 'overwrite' => 'Sobrescribir un archivo existente no está permitido.', 'unknown-error' => 'Ocurrió un error desconocido.', 'tmp-create-error' => 'No se pudo crear archivo temporal.', 'tmp-write-error' => 'Error al escribir archivo temporal.', 'large-file' => 'Se recomienda que los archivos no sean mayores de $1; este archivo ocupa $2.', 'largefileserver' => 'El tamaño de este archivo es mayor del que este servidor admite por configuración.', 'emptyfile' => 'El archivo que has intentado subir parece estar vacío; por favor, verifica que realmente se trate del archivo que intentabas subir.', 'windows-nonascii-filename' => 'Este wiki no admite nombres de archivo con caracteres especiales.', 'fileexists' => 'Ya existe un archivo con este nombre, por favor comprueba <strong>[[:$1]]</strong> si no estás seguro de querer cambiarlo. [[$1|thumb]]', 'filepageexists' => 'La página de descripción de este archivo ya ha sido creada en <strong>[[:$1]]</strong>, pero no existe actualmente ningún fichero con este nombre. El resumen que ha ingresado no aparecerá en la página de descripción. Para que el sumario aparezca, deberá editarlo manualmente. [[$1|thumb]]', 'fileexists-extension' => 'Existe un archivo con un nombre similar: [[$2|thumb]] * Nombre del archivo que se está subiendo: <strong>[[:$1]]</strong> * Nombre del archivo ya existente: <strong>[[:$2]]</strong> Por favor, elige un nombre diferente.', 'fileexists-thumbnail-yes' => "El archivo parece ser una imagen de tamaño reducido ''(thumbnail)''. [[$1|thumb]] Por favor comprueba el archivo <strong>[[:$1]]</strong>. Si el archivo comprobado es la misma imagen a tamaño original no es necesario subir un thumbnail más.", 'file-thumbnail-no' => "El nombre del archivo comienza con <strong>$1</strong>. Parece ser una imagen de tamaño reducido ''(thumbnail)''. Si tiene esta imagen a toda resolución súbala, si no, por favor cambie el nombre del archivo.", 'fileexists-forbidden' => 'Ya existe un archivo con este nombre, y no puede ser grabado encima de otro. Si quiere subir su archivo de todos modos, por favor vuelva atrás y utilice otro nombre. [[File:$1|thumb|center|$1]]', 'fileexists-shared-forbidden' => 'Ya existe un archivo con este nombre en el repositorio compartido. Si todavía quiere subir su archivo, por favor, regrese a la página anterior y use otro nombre. [[File:$1|thumb|center|$1]]', 'file-exists-duplicate' => 'Este archivo es un duplicado {{PLURAL:$1|del siguiente|de los siguientes}}:', 'file-deleted-duplicate' => 'Un archivo idéntico a este ([[:$1]]) ha sido borrado con anterioridad. Debes comprobar el historial de borrado del archivo ante de volver a subirlo.', 'file-deleted-duplicate-notitle' => 'Un archivo idéntico a este ha sido borrado con anterioridad, y el título ha sido suprimido. Deberías contactar con alguien capaz de ver los datos de archivos borrados para que revise esta situación antes de proceder a subir de nuevo este archivo.', 'uploadwarning' => 'Advertencia de subida de archivo', 'uploadwarning-text' => 'Por favor, modifique la descripción del archivo abajo indicada e inténtelo de nuevo.', 'savefile' => 'Guardar archivo', 'uploadedimage' => 'subió «[[$1]]»', 'overwroteimage' => 'subió una nueva versión de «[[$1]]»', 'uploaddisabled' => 'Subida de archivos deshabilitada', 'copyuploaddisabled' => 'Carga por URL deshabilitada.', 'uploadfromurl-queued' => 'Tu carga ha sido enviada a la cola.', 'uploaddisabledtext' => 'No es posible subir archivos.', 'php-uploaddisabledtext' => 'La subida de archivos está deshabilitada en PHP. Por favor compruebe <code>file_uploads</code> en php.ini.', 'uploadscripted' => 'Este archivo contiene script o código HTML que puede ser interpretado erróneamente por un navegador web.', 'uploadvirus' => '¡El archivo contiene un virus! Detalles: $1', 'uploadjava' => 'El archivo es un ZIP que contiene un archivo .class de Java. No se permite subir archivos Java, porque pueden causar que se puedan saltar restricciones de seguridad.', 'upload-source' => 'Archivo origen', 'sourcefilename' => 'Nombre del archivo origen:', 'sourceurl' => 'Dirección original:', 'destfilename' => 'Nombre del archivo de destino:', 'upload-maxfilesize' => 'Tamaño máximo del archivo: $1', 'upload-description' => 'Descripción de archivo', 'upload-options' => 'Opciones de carga', 'watchthisupload' => 'Vigilar este archivo', 'filewasdeleted' => 'Un archivo con este nombre se subió con anterioridad y posteriormente ha sido borrado. Deberías revisar el $1 antes de subirlo de nuevo.', 'filename-bad-prefix' => "El nombre del archivo que estás subiendo comienza por '''«$1»''', un nombre nada descriptivo de su contenido. Es un típico nombre de los que asignan automáticamente las cámaras digitales. Por favor, elige un nombre más descriptivo.", 'filename-prefix-blacklist' => ' #<!-- deja esta línea exactamente como está --> <pre> # La sintaxis de esta página es la siguiente: # * Todo texto que se encuentre después del carácter "#" hasta el final de la línea se tratará como un comentario y será ignorado # * Cualquier línea que no esté en blanco será interpretada como un prefijo típico en nombres de archivo que suelen asignar automáticamente las cámaras digitales CIMG # Casio DSC_ # Nikon DSCF # Fuji DSCN # Nikon DUW # algunos teléfonos móviles / celulares IMG # genérico JD # Jenoptik MGP # Pentax PICT # misc. #</pre> <!-- deja esta línea exactamente como está -->', 'upload-success-subj' => 'Subida con éxito', 'upload-success-msg' => 'Tu carga de [$2] fue exitosa. Está disponible aquí: [[:{{ns:file}}:$1]]', 'upload-failure-subj' => 'Problema en la carga', 'upload-failure-msg' => 'Hubo un problema durante la carga desde [$2]: $1', 'upload-warning-subj' => 'Alerta de carga', 'upload-warning-msg' => 'Hubo un problema con tu carga de [$2]. Puedes regresar al [[Special:Upload/stash/$1|formulario de carga]] para corregir este problema.', 'upload-proto-error' => 'Protocolo incorrecto', 'upload-proto-error-text' => 'Para subir archivos desde otra página la URL debe comenzar por <code>http://</code> o <code>ftp://</code>.', 'upload-file-error' => 'Error interno al subir el archivo', 'upload-file-error-text' => 'Ha ocurrido un error interno mientras se intentaba crear un fichero temporal en el servidor. Por favor, contacta con un [[Special:ListUsers/sysop|administrador]].', 'upload-misc-error' => 'Error desconocido en la subida', 'upload-misc-error-text' => 'Ha ocurrido un error durante la subida. Por favor verifica que la URL es válida y accesible e inténtalo de nuevo. Si el problema persiste, contacta con un [[Special:ListUsers/sysop|administrador]].', 'upload-too-many-redirects' => 'La URL contenía demasiadas redirecciones', 'upload-unknown-size' => 'Tamaño desconocido', 'upload-http-error' => 'Ha ocurrido un error HTTP: $1', 'upload-copy-upload-invalid-domain' => 'No se pueden realizar cargas remotas desde este dominio.', # File backend 'backend-fail-stream' => 'No se pudo transmitir el archivo «$1».', 'backend-fail-backup' => 'No pudo hacer copia de seguridad del archivo «$1».', 'backend-fail-notexists' => 'El archivo $1 no existe.', 'backend-fail-hashes' => 'No se pudieron obtener los hashes de los ficheros para compararlos.', 'backend-fail-notsame' => 'Ya existe un fichero distinto en $1.', 'backend-fail-invalidpath' => '$1 no es una ruta de almacenamiento válida', 'backend-fail-delete' => 'No se pudo borrar el archivo «$1».', 'backend-fail-describe' => 'No pudieron cambiar los metadatos del archivo "$1".', 'backend-fail-alreadyexists' => 'El archivo $1 ya existe.', 'backend-fail-store' => 'No se pudo almacenar el archivo $1 en $2.', 'backend-fail-copy' => 'No se pudo copiar el archivo $1 a $2.', 'backend-fail-move' => 'No se pudo trasladar el archivo $1 a $2.', 'backend-fail-opentemp' => 'No se pudo crear archivo temporal.', 'backend-fail-writetemp' => 'No se pudo escribir en el archivo temporal.', 'backend-fail-closetemp' => 'No se pudo cerrar el archivo temporal.', 'backend-fail-read' => 'No se pudo leer el archivo «$1».', 'backend-fail-create' => 'No se pudo escribir el archivo $1.', 'backend-fail-maxsize' => 'No se pudo escribir el archivo $1 porque es mayor de {{PLURAL:$2|un byte|$2 bytes}}.', 'backend-fail-readonly' => 'El servidor (back-end) de almacenamiento "$1" está actualmente en estado de sólo lectura. La razón aducida fue: "$2"', 'backend-fail-synced' => 'El archivo "$1" se encuentra en un estado incoherente dentro de los servidores (backends) de almacenamiento interno', 'backend-fail-connect' => 'No se pudo conectar al servidor (backend) de almacenamiento "$1".', 'backend-fail-internal' => 'Se ha producido un error desconocido en el servidor (backend) de almacenamiento "$1".', 'backend-fail-contenttype' => 'No se pudo determinar el tipo de contenido del archivo a guardar en " $1 ".', 'backend-fail-batchsize' => 'El servidor (back-end) de almacenamiento ha suministrado un lote de $1 {{PLURAL:$1|operación|operaciones}} de archivo; el límite es de $2 {{PLURAL:$2|operación|operaciones}}.', 'backend-fail-usable' => 'No se pudo leer o escribir el archivo "$1" debido a permisos insuficientes o directorios/contenedores desaparecidos.', # File journal errors 'filejournal-fail-dbconnect' => 'No se pudo conectar a la base de datos del registro del sistema de almacenamiento "$1".', 'filejournal-fail-dbquery' => 'No se pudo actualizar la base de datos del registro del sistema de almacenamiento "$1".', # Lock manager 'lockmanager-notlocked' => 'No se pudo desbloquear "$1": no se encontraba bloqueado.', 'lockmanager-fail-closelock' => 'No se pudo cerrar la referencia para el archivo de bloqueo de "$1".', 'lockmanager-fail-deletelock' => 'No se pudo eliminar el archivo de bloqueo para "$1".', 'lockmanager-fail-acquirelock' => 'No pudo adquirir el bloqueo para "$1".', 'lockmanager-fail-openlock' => 'No se pudo abrir el archivo de bloqueo para "$1".', 'lockmanager-fail-releaselock' => 'No se pudo liberar el bloqueo de "$1".', 'lockmanager-fail-db-bucket' => 'No se pudo contactar con las suficientes bases de datos del conjunto $1.', 'lockmanager-fail-db-release' => 'No se pudieron liberar los bloqueos registrados en la base de datos $1.', 'lockmanager-fail-svr-acquire' => 'No se pudieron obtener bloqueos en el servidor $1.', 'lockmanager-fail-svr-release' => 'No se pudieron liberar los bloqueos registrados en el servidor $1.', # ZipDirectoryReader 'zip-file-open-error' => 'Se encontró un error al abrir el archivo ZIP para su comprobación.', 'zip-wrong-format' => 'El archivo especificado no es un archivo ZIP.', 'zip-bad' => 'El archivo es un ZIP dañado o que no se puede leer. No se puede comprobar su seguridad.', 'zip-unsupported' => 'El archivo es un archivo que utiliza características ZIP no compatibles con MediaWiki. No puede comprobarse adecuadamente su seguridad.', # Special:UploadStash 'uploadstash' => 'Ficheros escondidos', 'uploadstash-summary' => 'Esta página da acceso a los ficheros enviados (o que están en el proceso de envío) pero que aún no han sido publicados en la wiki. Estos ficheros no son visibles para nadie, excepto para el usuario que los envió.', 'uploadstash-clear' => 'Borrar los ficheros escondidos', 'uploadstash-nofiles' => 'No tienes archivos escondidos.', 'uploadstash-badtoken' => 'No fue posible ejecutar esa operación, tal vez porque sus credenciales de edición expiraron. Reinténtelo.', 'uploadstash-errclear' => 'El borrado de los archivos no tuvo éxito.', 'uploadstash-refresh' => 'Actualizar la lista de archivos', 'invalid-chunk-offset' => 'Desplazamiento inválido del fragmento', # img_auth script messages 'img-auth-accessdenied' => 'Acceso denegado', 'img-auth-nopathinfo' => 'Falta PATH_INFO. El servidor no está configurado para proporcionar esta información. Es posible que esté basado en CGI y que no sea compatible con img_auth. Consulte https://www.mediawiki.org/wiki/Manual:Image_Authorization.', 'img-auth-notindir' => 'Ruta solicitad no esá en el directorio de cargas configurado', 'img-auth-badtitle' => 'Incapaz de construir un título válido de «$1».', 'img-auth-nologinnWL' => 'No has iniciado sesión y «$1» no está en la lista blanca.', 'img-auth-nofile' => 'El archivo «$1» no existe.', 'img-auth-isdir' => 'Estás tratando de acceder a un directorio «$1». Solo se permite el acceso a los archivos.', 'img-auth-streaming' => 'Streaming «$1».', 'img-auth-public' => 'La función de img_auth.php es mostrar archivos desde una wiki privada. Esta wiki está configurada como pública. Para óptima seguridad, img_auth.php está desactivado.', 'img-auth-noread' => 'El usuario no tiene acceso para leer «$1».', 'img-auth-bad-query-string' => 'La dirección URL tiene una cadena de consulta no válida.', # HTTP errors 'http-invalid-url' => 'URL inválida: $1', 'http-invalid-scheme' => 'Las URLs con el esquema «$1» no son compatibles.', 'http-request-error' => 'La solicitud HTTP falló debido a un error desconocido.', 'http-read-error' => 'Error de lectura HTTP.', 'http-timed-out' => 'La solicitud HTTP ha expirado.', 'http-curl-error' => 'Error al recuperar el URL: $1', 'http-bad-status' => 'Ha habido un problema durante la solicitud HTTP: $1 $2', # Some likely curl errors. More could be added from <http://curl.haxx.se/libcurl/c/libcurl-errors.html> 'upload-curl-error6' => 'No se pudo alcanzar la URL', 'upload-curl-error6-text' => 'La URL no pudo ser alcanzada. Por favor comprueba que la URL es correcta y el sitio web está funcionando.', 'upload-curl-error28' => 'Tiempo de espera excedido', 'upload-curl-error28-text' => 'La página tardó demasiado en responder. Por favor, comprueba que el servidor está funcionando, espera un poco y vuelva a intentarlo. Quizás desees intentarlo en otro momento de menos carga.', 'license' => 'Licencia:', 'license-header' => 'Licencia', 'nolicense' => 'Ninguna seleccionada', 'license-nopreview' => '(Previsualización no disponible)', 'upload_source_url' => ' (una URL válida y accesible públicamente)', 'upload_source_file' => ' (un archivo en tu disco)', # Special:ListFiles 'listfiles-summary' => 'Esta página especial muestra todos los archivos subidos. Cuando el usuario la filtra, solo se muestran los archivos cargados por el usuario en su versión más reciente.', 'listfiles_search_for' => 'Buscar por nombre de imagen:', 'imgfile' => 'archivo', 'listfiles' => 'Lista de archivos', 'listfiles_thumb' => 'Miniatura', 'listfiles_date' => 'Fecha', 'listfiles_name' => 'Nombre', 'listfiles_user' => 'Usuario', 'listfiles_size' => 'Tamaño (bytes)', 'listfiles_description' => 'Descripción', 'listfiles_count' => 'Versiones', 'listfiles-show-all' => 'Incluir versiones antiguas de las imágenes', 'listfiles-latestversion' => 'Versión actual', 'listfiles-latestversion-yes' => 'Sí', 'listfiles-latestversion-no' => 'No', # File description page 'file-anchor-link' => 'Archivo', 'filehist' => 'Historial del archivo', 'filehist-help' => 'Haz clic sobre una fecha/hora para ver el archivo a esa fecha.', 'filehist-deleteall' => 'borrar todo', 'filehist-deleteone' => 'borrar', 'filehist-revert' => 'revertir', 'filehist-current' => 'act', 'filehist-datetime' => 'Fecha y hora', 'filehist-thumb' => 'Miniatura', 'filehist-thumbtext' => 'Miniatura de la versión de $1', 'filehist-nothumb' => 'Sin miniatura', 'filehist-user' => 'Usuario', 'filehist-dimensions' => 'Dimensiones', 'filehist-filesize' => 'Tamaño', 'filehist-comment' => 'Comentario', 'filehist-missing' => 'No se encuentra el archivo', 'imagelinks' => 'Usos del archivo', 'linkstoimage' => '{{PLURAL:$1|La siguiente página enlaza|Las siguientes páginas enlazan}} a este archivo:', 'linkstoimage-more' => 'Hay más de {{PLURAL:$1|una página que enlaza|$1 páginas que enlazan}} con este archivo. La lista siguiente sólo muestra {{PLURAL:$1|la primera página que enlaza|las primeras $1 páginas que enlazan}} con este archivo. También puedes consultar la [[Special:WhatLinksHere/$2|lista completa]].', 'nolinkstoimage' => 'No hay páginas que enlacen a esta imagen.', 'morelinkstoimage' => 'Vea [[Special:WhatLinksHere/$1|más enlaces]] a este archivo.', 'linkstoimage-redirect' => '$1 (archivo de redirección) $2', 'duplicatesoffile' => '{{PLURAL:$1|El siguiente archivo es un duplicado|Los siguientes $1 archivos son duplicados}} de éste ([[Special:FileDuplicateSearch/$2|más detalles]]):', 'sharedupload' => 'Este archivo es de $1 y puede ser usado por otros proyectos.', 'sharedupload-desc-there' => 'Este archivo es de $1 y puede ser usado por otros proyectos. Por favor mira la [$2 página de descripción del archivo] para información adicional.', 'sharedupload-desc-here' => 'Este archivo es de $1 y puede ser usado por otros proyectos. La descripción en su [$2 página de descripción del archivo] está mostrada debajo.', 'sharedupload-desc-edit' => 'Este archivo es de $1 y puede ser utilizado por otros proyectos. Tal vez desee editar la descripción de su [$2 página de descripción del archivo] allí.', 'sharedupload-desc-create' => 'Este archivo es de $1 y puede ser utilizado por otros proyectos. Tal vez desee editar la descripción de su [$2 página de descripción del archivo] allí.', 'filepage-nofile' => 'No existe ningún archivo con este nombre.', 'filepage-nofile-link' => 'No existe ningún archivo con este nombre, pero puedes [$1 subirlo].', 'uploadnewversion-linktext' => 'Subir una nueva versión de este archivo', 'shared-repo-from' => 'de $1', 'shared-repo' => 'un repositorio compartido', 'filepage.css' => '/* Los estilos CSS colocados aquí se incluirán en las páginas de descripción de archivos, incluso en los wikis externos que incluyan estas páginas */', 'upload-disallowed-here' => 'No puedes sobrescribir este archivo.', # File reversion 'filerevert' => 'Revertir $1', 'filerevert-legend' => 'Reversión de archivos', 'filerevert-intro' => "Estás revirtiendo '''[[Media:$1|$1]]''' a la [$4 versión del $2 a las $3].", 'filerevert-comment' => 'Motivo:', 'filerevert-defaultcomment' => 'Revertido a la versión subida el $1 a las $2', 'filerevert-submit' => 'Revertir', 'filerevert-success' => "'''[[Media:$1|$1]]''' ha sido revertido a la [$4 versión del $2 a las $3].", 'filerevert-badversion' => 'No existe version local previa de este archivo con esa marca de tiempo.', # File deletion 'filedelete' => 'Borrar $1', 'filedelete-legend' => 'Borrar archivo', 'filedelete-intro' => "Estás borrando el archivo '''[[Media:$1|$1]]''' así como todo su historial.", 'filedelete-intro-old' => "Estás borrando la versión de '''[[Media:$1|$1]]''' del [$4 $2 a las $3].", 'filedelete-comment' => 'Motivo:', 'filedelete-submit' => 'Eliminar', 'filedelete-success' => "'''$1''' ha sido borrado.", 'filedelete-success-old' => "La version de '''[[Media:$1|$1]]''' del $2 a las $3 ha sido borrada.", 'filedelete-nofile' => "'''$1''' no existe.", 'filedelete-nofile-old' => "No existe una versión guardada de '''$1''' con los atributos especificados.", 'filedelete-otherreason' => 'Otra razón:', 'filedelete-reason-otherlist' => 'Otra razón', 'filedelete-reason-dropdown' => '*Razones de borrado habituales ** Violación de copyright ** Archivo duplicado', 'filedelete-edit-reasonlist' => 'Edita los motivos del borrado', 'filedelete-maintenance' => 'Borrado y restauración de archivos temporalmente deshabilitados durante el mantenimiento.', 'filedelete-maintenance-title' => 'No se puede eliminar el archivo', # MIME search 'mimesearch' => 'Búsqueda por MIME', 'mimesearch-summary' => 'Esta página permite el filtrado de ficheros por su tipo MIME. Entrada: contenttype/subtype, p. ej. <code>image/jpeg</code>.', 'mimetype' => 'Tipo MIME:', 'download' => 'descargar', # Unwatched pages 'unwatchedpages' => 'Páginas no vigiladas', # List redirects 'listredirects' => 'Lista de redirecciones', # Unused templates 'unusedtemplates' => 'Plantillas sin uso', 'unusedtemplatestext' => 'Aquí se enumeran todas las páginas en el espacio de nombres {{ns:template}} que no están incluidas en otras páginas. Recuerda mirar lo que enlaza a las plantillas antes de borrarlas.', 'unusedtemplateswlh' => 'otros enlaces', # Random page 'randompage' => 'Página aleatoria', 'randompage-nopages' => 'No hay páginas en los siguientes {{PLURAL:$2|espacio de nombre|espacios de nombre}}: $1.', # Random page in category 'randomincategory' => 'Página aleatoria en categoría', 'randomincategory-invalidcategory' => '"$1" no es una categoría válida.', 'randomincategory-nopages' => 'No hay páginas en la categoría [[:Category:$1|$1]].', 'randomincategory-selectcategory' => 'Obtener una página aleatoria de categoría: $1 $2.', 'randomincategory-selectcategory-submit' => 'Ir', # Random redirect 'randomredirect' => 'Ir a una redirección cualquiera', 'randomredirect-nopages' => 'No hay redirecciones en el espacio de nombres «$1».', # Statistics 'statistics' => 'Estadísticas', 'statistics-header-pages' => 'Estadísticas de páginas', 'statistics-header-edits' => 'Estadísticas de ediciones', 'statistics-header-views' => 'Estadísticas de visitas', 'statistics-header-users' => 'Estadísticas de usuario', 'statistics-header-hooks' => 'Otras estadísticas', 'statistics-articles' => 'Páginas de contenido', 'statistics-pages' => 'Páginas', 'statistics-pages-desc' => 'Todas las páginas en el wiki, incluyendo páginas de discusión, redirecciones, etc.', 'statistics-files' => 'Archivos subidos', 'statistics-edits' => 'Ediciones en páginas desde que {{SITENAME}} fue instalado', 'statistics-edits-average' => 'Media de ediciones por página', 'statistics-views-total' => 'Visitas totales', 'statistics-views-total-desc' => 'No se incluyen accesos a páginas no existentes ni páginas especiales', 'statistics-views-peredit' => 'Visitas por edición', 'statistics-users' => '[[Special:ListUsers|Usuarios]] registrados', 'statistics-users-active' => 'Usuarios activos', 'statistics-users-active-desc' => 'Usuarios que han ejecutado una acción en {{PLURAL:$1|el último día|los últimos $1 días}}', 'statistics-mostpopular' => 'Páginas más vistas', 'pageswithprop' => 'Páginas con una propiedad de página', 'pageswithprop-legend' => 'Páginas con una propiedad de página', 'pageswithprop-text' => 'Esta página muestra las páginas que usan la propiedad de una página en particular', 'pageswithprop-prop' => 'Nombre de la propiedad', 'pageswithprop-submit' => 'Ir', 'pageswithprop-prophidden-long' => 'hay un largo valor en la propiedad texto oculta ($1)', 'pageswithprop-prophidden-binary' => 'valor de la propiedad binaria oculta ($1)', 'doubleredirects' => 'Redirecciones dobles', 'doubleredirectstext' => 'Esta página contiene una lista de páginas que redirigen a otras páginas de redirección. Cada fila contiene enlaces a la segunda y tercera redirección, así como la primera línea de la segunda redirección, en la que usualmente se encontrará el artículo «real» al que la primera redirección debería apuntar. Las entradas <del>tachadas</del> han sido resueltas.', 'double-redirect-fixed-move' => '[[$1]] ha sido trasladado, ahora es una redirección a [[$2]]', 'double-redirect-fixed-maintenance' => 'Corrigiendo la doble redirección desde [[$1]] a [[$2]].', 'double-redirect-fixer' => 'Corrector de redirecciones', 'brokenredirects' => 'Redirecciones incorrectas', 'brokenredirectstext' => 'Las siguientes redirecciones enlazan a páginas que no existen:', 'brokenredirects-edit' => 'editar', 'brokenredirects-delete' => 'borrar', 'withoutinterwiki' => 'Páginas sin interwikis', 'withoutinterwiki-summary' => 'Las siguientes páginas no enlazan a versiones en otros idiomas:', 'withoutinterwiki-legend' => 'Prefijo', 'withoutinterwiki-submit' => 'Mostrar', 'fewestrevisions' => 'Artículos con menos ediciones', # Miscellaneous special pages 'nbytes' => '$1 {{PLURAL:$1|byte|bytes}}', 'ncategories' => '$1 {{PLURAL:$1|categoría|categorías}}', 'ninterwikis' => '$1 {{PLURAL:$1|interwiki|interwikis}}', 'nlinks' => '$1 {{PLURAL:$1|enlace|enlaces}}', 'nmembers' => '$1 {{PLURAL:$1|artículo|artículos}}', 'nmemberschanged' => '$1 → $2 {{PLURAL:$2|miembro|miembros}}', 'nrevisions' => '$1 {{PLURAL:$1|revisión|revisiones}}', 'nviews' => '$1 {{PLURAL:$1|vista|vistas}}', 'nimagelinks' => 'Usado en {{PLURAL:$1|una página|$1 páginas}}', 'ntransclusions' => 'usado en {{PLURAL:$1|una página|$1 páginas}}', 'specialpage-empty' => 'Esta página está vacía.', 'lonelypages' => 'Páginas huérfanas', 'lonelypagestext' => 'Las siguientes páginas no están enlazadas ni transcluídas en otras páginas de {{SITENAME}}.', 'uncategorizedpages' => 'Páginas sin categorizar', 'uncategorizedcategories' => 'Categorías sin categorizar', 'uncategorizedimages' => 'Imágenes sin categorizar', 'uncategorizedtemplates' => 'Plantillas sin categorizar', 'unusedcategories' => 'Categorías sin uso', 'unusedimages' => 'Imágenes sin uso', 'popularpages' => 'Páginas populares', 'wantedcategories' => 'Categorías requeridas', 'wantedpages' => 'Páginas requeridas', 'wantedpages-badtitle' => 'Título inválido en conjunto de resultados: $1', 'wantedfiles' => 'Ficheros requeridos', 'wantedfiletext-cat' => 'Los siguientes archivos están en uso, pero no existen. Es posible que algunos de ellos estén almacenados en repositorios externos y se hayan incluido aquí por error; dichas entradas aparecen <del>tachadas</del>. De igual manera, las páginas que incluyen archivos inexistentes se enumeran en [[:$1]].', 'wantedfiletext-nocat' => 'Los siguientes archivos están en uso, pero no existen. Es posible que algunos de ellos estén almacenados en repositorios externos y se hayan incluido aquí por error; dichas entradas aparecen <del>tachadas</del>.', 'wantedtemplates' => 'Plantillas requeridas', 'mostlinked' => 'Artículos más enlazados', 'mostlinkedcategories' => 'Categorías más enlazadas', 'mostlinkedtemplates' => 'Plantillas más enlazadas', 'mostcategories' => 'Páginas con más categorías', 'mostimages' => 'Imágenes más usadas', 'mostinterwikis' => 'Páginas con más interwikis', 'mostrevisions' => 'Artículos con más ediciones', 'prefixindex' => 'Todas las páginas con prefijo', 'prefixindex-namespace' => 'Todas las páginas con el prefijo (espacio de nombres $1)', 'prefixindex-strip' => 'Prefijo de la hilera en la lista', 'shortpages' => 'Páginas cortas', 'longpages' => 'Páginas largas', 'deadendpages' => 'Páginas sin salida', 'deadendpagestext' => 'Las siguientes páginas no enlazan a otras páginas de {{SITENAME}}.', 'protectedpages' => 'Páginas protegidas', 'protectedpages-indef' => 'Sólo protecciones indefinidas', 'protectedpages-cascade' => 'Sólo protecciones en cascada', 'protectedpages-noredirect' => 'Ocultar redirecciones', 'protectedpagesempty' => 'Actualmente no hay ninguna página protegida con esos parámetros.', 'protectedtitles' => 'Títulos protegidos', 'protectedtitlesempty' => 'Actualmente no existen entradas protegidas con esos parámetros.', 'listusers' => 'Lista de usuarios', 'listusers-editsonly' => 'Muestra sólo usuarios con ediciones', 'listusers-creationsort' => 'Ordenado por fecha de creación', 'listusers-desc' => 'Ordenar de forma descendente', 'usereditcount' => '$1 {{PLURAL:$1|edición|ediciones}}', 'usercreated' => '{{GENDER:$3|Registrado|Registrada}} el $1 a las $2', 'newpages' => 'Páginas nuevas', 'newpages-username' => 'Nombre de usuario', 'ancientpages' => 'Artículos más antiguos', 'move' => 'Trasladar', 'movethispage' => 'Trasladar esta página', 'unusedimagestext' => 'Los siguientes archivos existen pero no están insertados en ninguna página. Por favor note que otros sitios web pueden vincular a un archivo con un URL directo, y por tanto pueden ser listados aquí a pesar de estar en uso activo.', 'unusedcategoriestext' => 'Las siguientes categorías han sido creadas, pero ningún artículo o categoría las utiliza.', 'notargettitle' => 'No hay página objetivo', 'notargettext' => 'Especifique sobre qué página desea llevar a cabo esta acción.', 'nopagetitle' => 'No existe la página destino', 'nopagetext' => 'La página destino que ha especificado no existe.', 'pager-newer-n' => '{{PLURAL:$1|1 siguiente|$1 siguientes}}', 'pager-older-n' => '{{PLURAL:$1|1 anterior|$1 anteriores}}', 'suppress' => 'Supresor de ediciones', 'querypage-disabled' => 'Esta página especial está deshabilitada por motivos de rendimiento.', # Book sources 'booksources' => 'Fuentes de libros', 'booksources-search-legend' => 'Buscar fuentes de libros', 'booksources-go' => 'Ir', 'booksources-text' => 'Abajo hay una lista de enlaces a otros sitios que venden libros nuevos y usados, puede que contengan más información sobre los libros que estás buscando.', 'booksources-invalid-isbn' => 'El número de ISBN no parece ser válido; comprueba los errores copiándolo de la fuente original.', # Special:Log 'specialloguserlabel' => 'Usuario:', 'speciallogtitlelabel' => 'Objetivo (título o usuario):', 'log' => 'Registros', 'all-logs-page' => 'Todos los registros públicos', 'alllogstext' => 'Vista combinada de todos los registros de {{SITENAME}}. Puedes filtrar la vista seleccionando un tipo de registro, el nombre del usuario o la página afectada. Se distinguen mayúsculas de minúsculas.', 'logempty' => 'No hay elementos en el registro con esas condiciones.', 'log-title-wildcard' => 'Buscar títulos que empiecen con este texto', 'showhideselectedlogentries' => 'Mostrar u ocultar las entradas seleccionadas del registro', # Special:AllPages 'allpages' => 'Todas las páginas', 'alphaindexline' => '$1 a $2', 'nextpage' => 'Siguiente página ($1)', 'prevpage' => 'Página anterior ($1)', 'allpagesfrom' => 'Mostrar páginas que empiecen por:', 'allpagesto' => 'Mostrar páginas terminadas con:', 'allarticles' => 'Todos los artículos', 'allinnamespace' => 'Todas las páginas (espacio de nombres $1)', 'allpagessubmit' => 'Mostrar', 'allpagesprefix' => 'Mostrar páginas con el prefijo:', 'allpagesbadtitle' => 'El título dado era inválido o tenía un prefijo de enlace inter-idioma o inter-wiki. Puede contener uno o más caracteres que no se pueden usar en títulos.', 'allpages-bad-ns' => '{{SITENAME}} no tiene un espacio de nombres llamado «$1».', 'allpages-hide-redirects' => 'Ocultar redirecciones', # SpecialCachedPage 'cachedspecial-viewing-cached-ttl' => 'Usted está viendo una versión en caché de esta página, que puede tener hasta $1 días de antigüedad.', 'cachedspecial-viewing-cached-ts' => 'Está viendo una versión en caché de esta página, que puede no estar completamente actualizada.', 'cachedspecial-refresh-now' => 'Ver lo más reciente.', # Special:Categories 'categories' => 'Categorías', 'categoriespagetext' => 'Las siguientes {{PLURAL:$1|categoría contiene|categorías contienen}} páginas o medios. No se muestran aquí las [[Special:UnusedCategories|categorías sin uso]]. Véase también las [[Special:WantedCategories|categorías requeridas]].', 'categoriesfrom' => 'Mostrar categorías que empiecen por:', 'special-categories-sort-count' => 'ordenar por conteo', 'special-categories-sort-abc' => 'ordenar alfabéticamente', # Special:DeletedContributions 'deletedcontributions' => 'Contribuciones borradas de usuario', 'deletedcontributions-title' => 'Contribuciones borradas de usuario', 'sp-deletedcontributions-contribs' => 'contribuciones', # Special:LinkSearch 'linksearch' => 'Enlaces externos', 'linksearch-pat' => 'Patrón de búsqueda:', 'linksearch-ns' => 'Espacio de nombre:', 'linksearch-ok' => 'Buscar', 'linksearch-text' => 'Se pueden usar caracteres comodín como "*.wikipedia.org". Es necesario, por lo menos, un dominio de alto nivel, por ejemplo "*.org".<br /> {{PLURAL:$2|Protocolo|Protocolos}} soportados: <code>$1</code> (si no se especifica ninguno, el protocolo por defecto es http://).', 'linksearch-line' => '$1 enlazado desde $2', 'linksearch-error' => 'Los comodines sólo pueden aparecer al principio del nombre de sitio.', # Special:ListUsers 'listusersfrom' => 'Mostrar usuarios que empiecen por:', 'listusers-submit' => 'Mostrar', 'listusers-noresult' => 'No se encontró al usuario.', 'listusers-blocked' => '({{GENDER:$1|bloqueado|bloqueada}})', # Special:ActiveUsers 'activeusers' => 'Lista de usuarios activos', 'activeusers-intro' => 'Esta es una lista de usuarios que han tenido alguna actividad en los últimos $1 {{PLURAL:$1|día|días}}.', 'activeusers-count' => '$1 {{PLURAL:$1|acción|acciones}} en los últimos {{PLURAL:$3|día|$3 días}}', 'activeusers-from' => 'Mostrando a los usuarios empezando por:', 'activeusers-hidebots' => 'Ocultar robots', 'activeusers-hidesysops' => 'Ocultar administradores', 'activeusers-noresult' => 'No se encontraron usuarios.', # Special:ListGroupRights 'listgrouprights' => 'Permisos del grupo de usuarios', 'listgrouprights-summary' => 'La siguiente es una lista de los grupos de usuario definidos en esta wiki y de sus privilegios de acceso asociados. Puede haber información adicional sobre privilegios individuales en [[{{MediaWiki:Listgrouprights-helppage}}]]', 'listgrouprights-key' => 'Leyenda: * <span class="listgrouprights-granted">Derecho concedido</span> * <span class="listgrouprights-revoked">Derecho revocado</span>', 'listgrouprights-group' => 'Grupo', 'listgrouprights-rights' => 'Derechos', 'listgrouprights-helppage' => 'Help:Derechos de grupos', 'listgrouprights-members' => '(ver los miembros de este grupo)', 'listgrouprights-addgroup' => 'Agregar {{PLURAL:$2|grupo|grupos}}: $1', 'listgrouprights-removegroup' => 'Eliminar {{PLURAL:$2|grupo|grupos}}: $1', 'listgrouprights-addgroup-all' => 'Agregar todos los grupos', 'listgrouprights-removegroup-all' => 'Eliminar todos los grupos', 'listgrouprights-addgroup-self' => 'Agregar {{PLURAL:$2|grupo|grupos}} a tu propia cuenta: $1', 'listgrouprights-removegroup-self' => 'Eliminar {{PLURAL:$2|grupo|grupos}} de tu propia cuenta: $1', 'listgrouprights-addgroup-self-all' => 'Agregar todos los grupos a tu propia cuenta', 'listgrouprights-removegroup-self-all' => 'Eliminar todos los grupos de tu propia cuenta', # Email user 'mailnologin' => 'Ninguna dirección de envio', 'mailnologintext' => 'Debes [[Special:UserLogin|iniciar sesión]] y tener una dirección electrónica válida en tus [[Special:Preferences|preferencias]] para enviar un correo electrónico a otros usuarios.', 'emailuser' => 'Enviar un correo electrónico a {{GENDER:{{BASEPAGENAME}}|este usuario|esta usuaria}}', 'emailuser-title-target' => 'Enviar un correo electrónico a {{GENDER:$1|este usuario|esta usuaria}}', 'emailuser-title-notarget' => 'Enviar un correo electrónico al usuario', 'emailpage' => 'Enviar un correo electrónico a un usuario', 'emailpagetext' => 'Puedes usar el formulario de abajo para enviar un correo electrónico a {{GENDER:$1|este usuario|esta usuaria}}. La dirección de correo electrónico que indicaste en [[Special:Preferences|tus preferencias de usuario]] aparecerá en el campo "Remitente" o "De" para que el destinatario pueda responderte.', 'usermailererror' => 'El sistema de correo devolvió un error:', 'defemailsubject' => 'Correo electrónico enviado por el usuario «$1» desde {{SITENAME}}', 'usermaildisabled' => 'Correo electrónico del usuario deshabilitado', 'usermaildisabledtext' => 'No puedes enviar correos electrónicos a otros usuarios en esta wiki', 'noemailtitle' => 'No hay dirección de correo electrónico', 'noemailtext' => 'Este usuario no ha especificado una dirección de correo electrónico válida.', 'nowikiemailtitle' => 'correos electrónicos no permitidos', 'nowikiemailtext' => 'Este usuario ha elegido no recibir correos electrónicos de otros usuarios.', 'emailnotarget' => 'Nombre de usuario no existente o no válido para el destinatario.', 'emailtarget' => 'Introduce el nombre de usuario del destinatario', 'emailusername' => 'Nombre de usuario:', 'emailusernamesubmit' => 'Enviar', 'email-legend' => 'Enviar un correo electrónico a otro usuario de {{SITENAME}}', 'emailfrom' => 'De:', 'emailto' => 'Para:', 'emailsubject' => 'Asunto:', 'emailmessage' => 'Mensaje:', 'emailsend' => 'Enviar', 'emailccme' => 'Enviarme una copia de mi mensaje.', 'emailccsubject' => 'Copia de tu mensaje a $1: $2', 'emailsent' => 'Correo electrónico enviado', 'emailsenttext' => 'Se ha enviado tu mensaje de correo electrónico.', 'emailuserfooter' => 'Este correo electrónico fue enviado por $1 a $2 a través de la función «Enviar un correo electrónico a este usuario» en {{SITENAME}}.', # User Messenger 'usermessage-summary' => 'Dejando un mensaje de sistema.', 'usermessage-editor' => 'Mensajero del sistema', # Watchlist 'watchlist' => 'Lista de seguimiento', 'mywatchlist' => 'Lista de seguimiento', 'watchlistfor2' => 'Para $1 $2', 'nowatchlist' => 'No tienes ninguna página en tu lista de seguimiento.', 'watchlistanontext' => 'Para ver o editar las entradas de tu lista de seguimiento es necesario $1.', 'watchnologin' => 'No has iniciado sesión', 'watchnologintext' => 'Debes [[Special:UserLogin|iniciar sesión]] para modificar tu lista de seguimiento.', 'addwatch' => 'Añadir a la lista de seguimiento', 'addedwatchtext' => 'La página «[[:$1]]» ha sido añadida a tu [[Special:Watchlist|lista de seguimiento]]. Los cambios futuros en esta página y en su página de discusión asociada se indicarán ahí.', 'removewatch' => 'Quitar de la lista de seguimiento', 'removedwatchtext' => 'Se ha eliminado la página «[[:$1]]» de tu [[Special:Watchlist|lista de seguimiento]].', 'watch' => 'Vigilar', 'watchthispage' => 'Vigilar esta página', 'unwatch' => 'Dejar de vigilar', 'unwatchthispage' => 'Dejar de vigilar', 'notanarticle' => 'No es un artículo', 'notvisiblerev' => 'La última revisión de un usuario diferente ha sido borrada', 'watchlist-details' => '{{PLURAL:$1|$1 página|$1 páginas}} en su lista de seguimiento, sin contar las de discusión.', 'wlheader-enotif' => 'La notificación por correo está activada.', 'wlheader-showupdated' => "Las páginas modificadas desde su última visita aparecen en '''negrita'''.", 'watchmethod-recent' => 'revisando cambios recientes en páginas vigiladas', 'watchmethod-list' => 'revisando las páginas vigiladas en busca de cambios recientes', 'watchlistcontains' => 'Tu lista de seguimiento posee $1 {{PLURAL:$1|página|páginas}}.', 'iteminvalidname' => "Problema con el artículo '$1', nombre inválido...", 'wlnote2' => 'A continuación se muestran los cambios de {{PLURAL:$1|la última hora|las últimas <strong>$1</strong> horas}}, a partir del $2, $3.', 'wlshowlast' => 'Ver los cambios de las últimas $1 horas, $2 días $3', 'watchlist-options' => 'Opciones de la lista de seguimiento', # Displayed when you click the "watch" button and it is in the process of watching 'watching' => 'Vigilando...', 'unwatching' => 'Eliminando de la lista de seguimiento...', 'watcherrortext' => 'Ocurrió un error al cambiar la configuración de tu lista de seguimiento para «$1».', 'enotif_mailer' => 'Notificación por correo de {{SITENAME}}', 'enotif_reset' => 'Marcar todas las páginas como visitadas', 'enotif_impersonal_salutation' => 'usuario de {{SITENAME}}', 'enotif_subject_deleted' => '$2 ha borrado la página $1 de {{SITENAME}}', 'enotif_subject_created' => '$2 ha creado la página $1 en {{SITENAME}}', 'enotif_subject_moved' => '$2 ha trasladado la página $1 de {{SITENAME}}', 'enotif_subject_restored' => '$2 ha restaurado la página $1 de {{SITENAME}}', 'enotif_subject_changed' => '$2 ha modificado la página $1 de {{SITENAME}}', 'enotif_body_intro_deleted' => 'La página $1 de {{SITENAME}} ha sido borrada el $PAGEEDITDATE por {{GENDER:$2|$2}}, véase $3.', 'enotif_body_intro_created' => 'La página $1 de {{SITENAME}} ha sido creada el $PAGEEDITDATE por {{GENDER:$2|$2}}, véase $3 para la revisión actual.', 'enotif_body_intro_moved' => 'La página $1 de {{SITENAME}} ha sido trasladada el $PAGEEDITDATE por {{GENDER:$2|$2}}, véase $3 para la revisión actual.', 'enotif_body_intro_restored' => 'La página $1 de {{SITENAME}} ha sido restaurada el $PAGEEDITDATE por {{GENDER:$2|$2}}, véase $3 para la revisión actual.', 'enotif_body_intro_changed' => 'La página $1 de {{SITENAME}} ha sido cambiada el $PAGEEDITDATE por {{GENDER:$2|$2}}, véase $3 para la revisión actual.', 'enotif_lastvisited' => 'Consulta $1 para ver todos los cambios realizados desde tu última visita.', 'enotif_lastdiff' => 'Consulta $1 para ver este cambio.', 'enotif_anon_editor' => 'usuario anónimo $1', 'enotif_body' => 'Hola, $WATCHINGUSERNAME: $PAGEINTRO $NEWPAGE Resumen del editor: $PAGESUMMARY $PAGEMINOREDIT Contacta al editor: correo: $PAGEEDITOR_EMAIL wiki: $PAGEEDITOR_WIKI No enviaremos más notificaciones si ocurre más actividad, a menos que visites esta página con la sesión iniciada. También puedes restablecer los estados de notificación para todas las páginas en tu lista de seguimiento. Atentamente, el sistema de notificaciones de {{SITENAME}} -- Para cambiar tus ajustes de notificación por correo, visita {{canonicalurl:{{#special:Preferences}}}} Para cambiar los ajustes de tu lista de seguimiento, visita {{canonicalurl:{{#special:EditWatchlist}}}} Para quitar la página de tu lista de seguimiento, visita $UNWATCHURL Para ayuda y comentarios: {{canonicalurl:{{MediaWiki:Helppage}}}}', 'created' => 'creada', 'changed' => 'modificada', # Delete 'deletepage' => 'Borrar esta página', 'confirm' => 'Confirmar', 'excontent' => 'el contenido era: «$1»', 'excontentauthor' => 'el contenido era: «$1» (y el único autor fue «[[Special:Contributions/$2|$2]]»)', 'exbeforeblank' => 'El contenido antes de blanquear era: «$1»', 'exblank' => 'la página estaba vacía', 'delete-confirm' => 'Borrar «$1»', 'delete-legend' => 'Borrar', 'historywarning' => "'''Aviso:''' La página que estás a punto de borrar tiene un historial de aproximadamente $1 {{PLURAL:$1|revisión|revisiones}}:", 'confirmdeletetext' => 'Estás a punto de borrar una página en forma permanente, así como todo su historial. Por favor, confirma que realmente quieres hacer eso, que entiendes las consecuencias, y que lo estás haciendo de acuerdo con [[{{MediaWiki:Policy-url}}|las políticas]].', 'actioncomplete' => 'Acción completada', 'actionfailed' => 'Acción fallida', 'deletedtext' => '«$1» ha sido borrado. Véase $2 para un registro de los borrados recientes.', 'dellogpage' => 'Registro de borrados', 'dellogpagetext' => 'A continuación se muestra una lista de los borrados más recientes.', 'deletionlog' => 'registro de borrados', 'reverted' => 'Revertido a una revisión anterior', 'deletecomment' => 'Motivo:', 'deleteotherreason' => 'Otro motivo:', 'deletereasonotherlist' => 'Otro motivo', 'deletereason-dropdown' => '*Razones comunes de borrado ** Spam ** Vandalismo ** Violación de copyright ** A petición del mismo autor ** Redirección incorrecta', 'delete-edit-reasonlist' => 'Editar razones de borrado', 'delete-toobig' => 'Esta página tiene un historial muy grande, con más de $1 {{PLURAL:$1|revisión|revisiones}}. Borrar este tipo de páginas ha sido restringido para prevenir posibles problemas en {{SITENAME}}.', 'delete-warning-toobig' => 'Esta página tiene un historial de más de $1 {{PLURAL:$1|revisión|revisiones}}. Eliminarla puede perturbar las operaciones de la base de datos de {{SITENAME}}. Ten cuidado al borrar.', 'deleting-backlinks-warning' => "'''Advertencia:''' Otras páginas están enlazadas o son inclusión desde la página que estás por eliminar.", # Rollback 'rollback' => 'Revertir ediciones', 'rollback_short' => 'Revertir', 'rollbacklink' => 'revertir', 'rollbacklinkcount' => 'revertir $1 {{PLURAL:$1|edición|ediciones}}', 'rollbacklinkcount-morethan' => 'revertir más de $1 {{PLURAL:$1|edición|ediciones}}', 'rollbackfailed' => 'No se pudo revertir', 'cantrollback' => 'No se puede revertir la edición; el último colaborador es el único autor de esta página.', 'alreadyrolled' => 'No se puede revertir la última edición de [[:$1]] hecha por [[User:$2|$2]] ([[User talk:$2|discusión]]{{int:pipe-separator}}[[Special:Contributions/$2|{{int:contribslink}}]]); alguien más ya ha editado o revertido esa página. La última edición fue hecha por [[User:$3|$3]] ([[User talk:$3|discusión]]{{int:pipe-separator}}[[Special:Contributions/$3|{{int:contribslink}}]]).', 'editcomment' => "El resumen de la edición fue: ''«$1»''.", 'revertpage' => 'Revertidos los cambios de [[Special:Contributions/$2|$2]] ([[User talk:$2|disc.]]) a la última edición de [[User:$1|$1]]', 'revertpage-nouser' => 'Revertidas las ediciones hechas por un usuario oculto a la última revisión hecha por [[User:$1|$1]]', 'rollback-success' => 'Revertidas las ediciones de $1; recuperada la última versión de $2.', # Edit tokens 'sessionfailure-title' => 'Error de sesión', 'sessionfailure' => 'Parece que hay un problema con tu sesión; esta acción ha sido cancelada como medida de precaución contra secuestros de sesión. Por favor, pulsa «Atrás», recarga la página de la que viniste e inténtalo de nuevo.', # Protect 'protectlogpage' => 'Registro de protección', 'protectlogtext' => 'Abajo se presenta una lista de protección y desprotección de página. Véase [[Special:ProtectedPages|la lista de páginas protegidas]] para ver las protecciones activas en páginas.', 'protectedarticle' => 'protegió «[[$1]]»', 'modifiedarticleprotection' => 'cambió el nivel de protección de «[[$1]]»', 'unprotectedarticle' => 'desprotegió «[[$1]]»', 'movedarticleprotection' => 'cambiadas protecciones de «[[$2]]» a «[[$1]]»', 'protect-title' => 'Cambiando el nivel de protección de «$1»', 'protect-title-notallowed' => 'Ver el nivel de protección de «$1»', 'prot_1movedto2' => 'heredando la protección al trasladar [[$1]] a [[$2]]', 'protect-badnamespace-title' => 'Espacio de nombres no protegible', 'protect-badnamespace-text' => 'Las páginas de este espacio de nombres no pueden ser protegidas', 'protect-norestrictiontypes-text' => 'Esta página no se puede proteger ya que no hay ningún tipo de restricción disponible.', 'protect-norestrictiontypes-title' => 'Página no protegible', 'protect-legend' => 'Confirmar protección', 'protectcomment' => 'Motivo:', 'protectexpiry' => 'Caducidad:', 'protect_expiry_invalid' => 'Tiempo de caducidad incorrecto.', 'protect_expiry_old' => 'El tiempo de expiración está en el pasado.', 'protect-unchain-permissions' => 'Desbloquear opciones de protección adicionales', 'protect-text' => "Puedes ver y modificar el nivel de protección de la página '''$1'''.", 'protect-locked-blocked' => "No puede cambiar los niveles de protección estando bloqueado. A continuación se muestran las opciones actuales de la página '''$1''':", 'protect-locked-dblock' => "Los niveles de protección no se pueden cambiar debido a un bloqueo activo de la base de datos. A continuación se muestran las opciones actuales de la página '''$1''':", 'protect-locked-access' => "Su cuenta no tiene permiso para cambiar los niveles de protección de una página. A continuación se muestran las opciones actuales de la página '''$1''':", 'protect-cascadeon' => 'Actualmente esta página está protegida porque está incluida en {{PLURAL:$1|la siguiente página|las siguientes páginas}}, que tienen activada la opción de protección en cascada. Puedes cambiar el nivel de protección de esta página, pero no afectará a la protección en cascada.', 'protect-default' => 'Permitir todos los usuarios', 'protect-fallback' => 'Solo permitir usuarios con el permiso «$1»', 'protect-level-autoconfirmed' => 'Solo permitir usuarios autoconfirmados', 'protect-level-sysop' => 'Solo permitir administradores', 'protect-summary-cascade' => 'en cascada', 'protect-expiring' => 'caduca el $1 (UTC)', 'protect-expiring-local' => 'caduca el $1', 'protect-expiry-indefinite' => 'indefinido', 'protect-cascade' => 'Protección en cascada - proteger todas las páginas incluidas en ésta.', 'protect-cantedit' => 'No puedes cambiar el nivel de protección porque no tienes permiso para hacer ediciones.', 'protect-othertime' => 'Especificar caducidad:', 'protect-othertime-op' => 'otra (especificar)', 'protect-existing-expiry' => 'Fecha de caducidad actual: $2 a las $3', 'protect-otherreason' => 'Otra razón:', 'protect-otherreason-op' => 'Otra razón', 'protect-dropdown' => '*Razones de protección habituales **Vandalismo excesivo **Spam excesivo **Guerra de ediciones **Página muy visitada', 'protect-edit-reasonlist' => 'Editar las razones de protección', 'protect-expiry-options' => '1 hora:1 hour,1 día:1 day,1 semana:1 week,2 semanas:2 weeks,1 mes:1 month,3 meses:3 months,6 meses:6 months,1 año:1 year,para siempre:infinite', 'restriction-type' => 'Permiso:', 'restriction-level' => 'Nivel de restricción:', 'minimum-size' => 'Tamaño mínimo', 'maximum-size' => 'Tamaño máximo:', 'pagesize' => '(bytes)', # Restrictions (nouns) 'restriction-edit' => 'Editar', 'restriction-move' => 'Pueden trasladar', 'restriction-create' => 'Crear', 'restriction-upload' => 'Subir', # Restriction levels 'restriction-level-sysop' => 'completamente protegida', 'restriction-level-autoconfirmed' => 'semiprotegida', 'restriction-level-all' => 'cualquier nivel', # Undelete 'undelete' => 'Restaurar una página borrada', 'undeletepage' => 'Ver y restaurar páginas borradas', 'undeletepagetitle' => "'''Las siguientes son las revisiones borradas de [[:$1|$1]]'''.", 'viewdeletedpage' => 'Ver páginas borradas', 'undeletepagetext' => '{{PLURAL:$1|La siguiente página ha sido borrada pero aún está en el archivo y puede ser restaurada.|Las siguientes $1 páginas han sido borradas pero aún están en el archivo y pueden ser restauradas.}} Puede que el archivo se limpie periódicamente.', 'undelete-fieldset-title' => 'Restaurar revisiones', 'undeleteextrahelp' => "Para restaurar todo el historial de la página, deja todas las casillas sin seleccionar y pulsa '''''{{int:undeletebtn}}'''''. Para realizar una restauración selectiva, marca las revisiones a ser restauradas y pulsa '''''{{int:undeletebtn}}'''''.", 'undeleterevisions' => '$1 {{PLURAL:$1|revisión|revisiones}} archivadas', 'undeletehistory' => 'Si restauras una página, todas sus revisiones serán restauradas al historial. Si una nueva página con el mismo nombre ha sido creada desde que se borró la original, las versiones restauradas aparecerán como historial anterior, y la revisión actual de la página actual no se reemplazará automáticamente.', 'undeleterevdel' => 'No se deshará el borrado si éste resulta en el borrado parcial de la última revisión de la página. En tal caso, desmarque o muestre las revisiones borradas más recientes. Las revisiones de archivos que no tiene permitido ver no se restaurarán.', 'undeletehistorynoadmin' => 'El artículo ha sido borrado. La razón de su eliminación se indica abajo en el resumen, así como los detalles de las ediciones realizadas antes del borrado. El texto completo del artículo está disponible sólo para usuarios con permisos de administrador.', 'undelete-revision' => 'Edición borrada de $1 (fechada $4, a $5) por $3:', 'undeleterevision-missing' => 'Revisión no válida o perdida. Puede deberse a un enlace incorrecto, o a que la revisión haya sido restaurada o eliminada del archivo.', 'undelete-nodiff' => 'No existe una revisión previa.', 'undeletebtn' => 'Restaurar', 'undeletelink' => 'ver/restaurar', 'undeleteviewlink' => 'ver', 'undeleteinvert' => 'Invertir selección', 'undeletecomment' => 'Razón:', 'undeletedrevisions' => '{{PLURAL:$1|Una edición restaurada|$1 ediciones restauradas}}', 'undeletedrevisions-files' => '$1 {{PLURAL:$1|ediciones restauradas y $2 archivo restaurado|ediciones y $2 archivos restaurados}}', 'undeletedfiles' => '$1 {{PLURAL:$1|archivo restaurado|archivos restaurados}}', 'cannotundelete' => 'Hubo un error durante la restauración: $1', 'undeletedpage' => "'''Se ha restaurado $1''' Consulta el [[Special:Log/delete|registro de borrados]] para ver una lista de los últimos borrados y restauraciones.", 'undelete-header' => 'En el [[Special:Log/delete|registro de borrados]] se listan las páginas eliminadas.', 'undelete-search-title' => 'Buscar páginas borradas', 'undelete-search-box' => 'Buscar páginas borradas', 'undelete-search-prefix' => 'Mostrar páginas que empiecen por:', 'undelete-search-submit' => 'Buscar', 'undelete-no-results' => 'No se encontraron páginas borradas para ese criterio de búsqueda.', 'undelete-filename-mismatch' => 'No se puede restaurar la versión con marca de tiempo $1: No concuerda el nombre de fichero', 'undelete-bad-store-key' => 'No se puede restaurar la versión con marca de tiempo $1: el fichero fue omitido antes del borrado.', 'undelete-cleanup-error' => 'Error al borrar el archivo no utilizado "$1".', 'undelete-missing-filearchive' => 'No se ha podido restaurar el archivo de ID $1 debido a que no está en la base de datos. Puede que ya haya sido restaurado.', 'undelete-error' => 'Error restaurando la página', 'undelete-error-short' => 'Error restaurando archivo: $1', 'undelete-error-long' => 'Se encontraron errores mientras se restauraba el archivo: $1', 'undelete-show-file-confirm' => '¿Estás seguro de que quieres ver una revisión borrada del archivo «<nowiki>$1</nowiki>» del $2 a las $3?', 'undelete-show-file-submit' => 'Sí', # Namespace form on various pages 'namespace' => 'Espacio de nombres:', 'invert' => 'Invertir selección', 'tooltip-invert' => 'Marca esta casilla para ocultar los cambios a las páginas dentro del espacio de nombres seleccionado (y el espacio de nombres asociado si está activada)', 'namespace_association' => 'Espacio de nombres asociado', 'tooltip-namespace_association' => 'Marca esta casilla para incluir también el espacio de nombres de discusión asociado con el espacio de nombres seleccionado', 'blanknamespace' => '(Principal)', # Contributions 'contributions' => 'Contribuciones {{GENDER:$1|del usuario|de la usuaria}}', 'contributions-title' => 'Contribuciones {{GENDER:$1|del usuario|de la usuaria}} $1', 'mycontris' => 'Contribuciones', 'contribsub2' => 'Para {{GENDER:$3|$1}} ($2)', 'nocontribs' => 'No se encontraron cambios que cumplieran estos criterios.', 'uctop' => '(edición actual)', 'month' => 'Desde el mes (y anteriores):', 'year' => 'Desde el año (y anteriores):', 'sp-contributions-newbies' => 'Mostrar solo las contribuciones de usuarios nuevos', 'sp-contributions-newbies-sub' => 'Para cuentas nuevas', 'sp-contributions-newbies-title' => 'Contribuciones de usuarios nuevos', 'sp-contributions-blocklog' => 'registro de bloqueos', 'sp-contributions-deleted' => 'contribuciones de usuario borradas', 'sp-contributions-uploads' => 'subidas', 'sp-contributions-logs' => 'registros', 'sp-contributions-talk' => 'discusión', 'sp-contributions-userrights' => 'administración de derechos de usuarios', 'sp-contributions-blocked-notice' => 'Este usuario está actualmente bloqueado. La última entrada del registro de bloqueos es presentada debajo para mayor referencia:', 'sp-contributions-blocked-notice-anon' => 'Esta dirección IP se encuentra actualmente bloqueada. A continuación se muestra la última entrada del registro de bloqueos para mayor referencia.', 'sp-contributions-search' => 'Buscar contribuciones', 'sp-contributions-username' => 'Dirección IP o nombre de usuario:', 'sp-contributions-toponly' => 'Solo mostrar últimas ediciones de página', 'sp-contributions-submit' => 'Buscar', # What links here 'whatlinkshere' => 'Lo que enlaza aquí', 'whatlinkshere-title' => 'Páginas que enlazan con «$1»', 'whatlinkshere-page' => 'Página:', 'linkshere' => "Las siguientes páginas enlazan a '''[[:$1]]''':", 'nolinkshere' => "Ninguna página enlaza con '''[[:$1]]'''.", 'nolinkshere-ns' => "Ninguna página enlaza con '''[[:$1]]''' en el espacio de nombres elegido.", 'isredirect' => 'página redirigida', 'istemplate' => 'inclusión', 'isimage' => 'Enlace de imagen', 'whatlinkshere-prev' => '{{PLURAL:$1|previa|previas $1}}', 'whatlinkshere-next' => '{{PLURAL:$1|siguiente|siguientes $1}}', 'whatlinkshere-links' => '← enlaces', 'whatlinkshere-hideredirs' => '$1 redirecciones', 'whatlinkshere-hidetrans' => '$1 inclusiones', 'whatlinkshere-hidelinks' => '$1 enlaces', 'whatlinkshere-hideimages' => '$1 enlaces a archivos', 'whatlinkshere-filters' => 'Filtros', # Block/unblock 'autoblockid' => 'Bloqueo automático #$1', 'block' => 'Bloquear usuario', 'unblock' => 'Desbloquear usuario', 'blockip' => 'Bloquear usuario', 'blockip-legend' => 'Bloquear usuario', 'blockiptext' => 'Usa el siguiente formulario para bloquear el acceso de escritura desde una dirección IP específica o nombre de usuario. Esto debería hacerse sólo para prevenir vandalismos, y de acuerdo a las [[{{MediaWiki:Policy-url}}|políticas]]. Explica la razón específica del bloqueo (por ejemplo, citando las páginas en particular que han sido objeto de vandalismo).', 'ipadressorusername' => 'Dirección IP o nombre de usuario:', 'ipbexpiry' => 'Caducidad:', 'ipbreason' => 'Motivo:', 'ipbreason-dropdown' => '*Motivos comunes de bloqueo ** Añadir información falsa ** Eliminar contenido de las páginas ** Publicitar enlaces a otras páginas web ** Añadir basura a las páginas ** Comportamiento intimidatorio u hostil ** Abuso de múltiples cuentas ** Nombre de usuario inaceptable', 'ipb-hardblock' => 'Impedir que los usuarios identificados editen desde esta dirección IP', 'ipbcreateaccount' => 'Prevenir la creación de cuentas de usuario', 'ipbemailban' => 'Prevenir que el usuario envíe correo electrónico', 'ipbenableautoblock' => 'Bloquear automáticamente la dirección IP usada por este usuario y cualquier IP posterior desde la cual intente editar', 'ipbsubmit' => 'Bloquear a este usuario', 'ipbother' => 'Especificar caducidad', 'ipboptions' => '2 horas:2 hours,1 día:1 day,3 días:3 days,1 semana:1 week,2 semanas:2 weeks,1 mes:1 month,3 meses:3 months,6 meses:6 months,1 año:1 year,para siempre:infinite', 'ipbhidename' => 'Ocultar nombre de usuario de ediciones y listas', 'ipbwatchuser' => 'Vigilar las páginas de usuario y de discusión de este usuario', 'ipb-disableusertalk' => 'Impedir que este usuario edite su propia página de discusión mientras esté bloqueado', 'ipb-change-block' => 'Rebloquear al usuario con estos datos', 'ipb-confirm' => 'Confirmar bloqueo', 'badipaddress' => 'La dirección IP no tiene el formato correcto.', 'blockipsuccesssub' => 'Bloqueo realizado con éxito', 'blockipsuccesstext' => '"[[Special:Contributions/$1|$1]]" ha sido bloqueado.<br /> Véase la [[Special:BlockList|lista de bloqueos]] para revisarlo.', 'ipb-blockingself' => '¡Estás a punto de bloquearte a ti mismo! ¿Estás seguro de que quieres hacerlo?', 'ipb-confirmhideuser' => 'Estás a punto de bloquear un usuario con la opción de supresión activada. Esto suprimirá el nombre de usuario en todas las listas y entradas de registro. ¿Estás seguro de que deseas proceder?', 'ipb-confirmaction' => 'Si estás seguro de querer hacerlo, por favor, marca el campo «{{int:ipb-confirm}}» que hay al final.', 'ipb-edit-dropdown' => 'Editar motivo del bloqueo', 'ipb-unblock-addr' => 'Desbloquear $1', 'ipb-unblock' => 'Desbloquear un usuario o una IP', 'ipb-blocklist' => 'Ver bloqueos vigentes', 'ipb-blocklist-contribs' => 'Contribuciones de $1', 'unblockip' => 'Desbloquear usuario', 'unblockiptext' => 'Use el formulario a continuación para devolver los permisos de escritura a una dirección IP que ha sido bloqueada.', 'ipusubmit' => 'Desactivar este bloqueo', 'unblocked' => '[[User:$1|$1]] ha sido {{GENDER:$1|desbloqueado|desbloqueada}}', 'unblocked-range' => '$1 ha sido desbloqueado', 'unblocked-id' => 'Se ha eliminado el bloqueo $1', 'blocklist' => 'Usuarios bloqueados', 'ipblocklist' => 'Usuarios bloqueados', 'ipblocklist-legend' => 'Encontrar a un usuario bloqueado', 'blocklist-userblocks' => 'Ocultar bloqueos de cuenta', 'blocklist-tempblocks' => 'Ocultar bloqueos temporales', 'blocklist-addressblocks' => 'Ocultar bloqueos de una sola dirección IP', 'blocklist-rangeblocks' => 'Ocultar bloqueos de rango', 'blocklist-timestamp' => 'Fecha y hora', 'blocklist-target' => 'Destino', 'blocklist-expiry' => 'Caduca', 'blocklist-by' => 'Administrador bloqueante', 'blocklist-params' => 'Parámetros de bloqueo', 'blocklist-reason' => 'Motivo', 'ipblocklist-submit' => 'Buscar', 'ipblocklist-localblock' => 'Bloqueo local', 'ipblocklist-otherblocks' => 'Otros {{PLURAL:$1|bloqueo| bloqueos}}', 'infiniteblock' => 'infinito', 'expiringblock' => 'expira el $1 a las $2', 'anononlyblock' => 'sólo anón.', 'noautoblockblock' => 'bloqueo automático deshabilitado', 'createaccountblock' => 'creación de cuenta bloqueada', 'emailblock' => 'correo electrónico bloqueado', 'blocklist-nousertalk' => 'no puede editar su propia página de discusión', 'ipblocklist-empty' => 'La lista de bloqueos está vacía.', 'ipblocklist-no-results' => 'El nombre de usuario o IP indicado no está bloqueado.', 'blocklink' => 'bloquear', 'unblocklink' => 'desbloquear', 'change-blocklink' => 'cambiar bloqueo', 'contribslink' => 'contribuciones', 'emaillink' => 'enviar correo electrónico', 'autoblocker' => 'Has sido bloqueado automáticamente porque tu dirección IP ha sido usada recientemente por «[[User:$1|$1]]». El motivo por el que se bloqueó a [[User:$1|$1]] es «$2».', 'blocklogpage' => 'Registro de bloqueos', 'blocklog-showlog' => 'Este usuario ha sido bloqueado previamente. Debajo se provee el registro de bloqueos para mayor referencia:', 'blocklog-showsuppresslog' => 'Este usuario ha sido bloqueado y ocultado. Se provee el registro de supresiones para más detalle:', 'blocklogentry' => 'bloqueó a [[$1]] $3 durante un plazo de $2', 'reblock-logentry' => 'cambió el bloqueo para [[$1]] con una caducidad de $2 $3', 'blocklogtext' => 'Esto es un registro de acciones de bloqueo y desbloqueo de usuarios. Las direcciones IP bloqueadas automáticamente no aparecen aquí. Consulta la [[Special:BlockList|lista de bloqueos]] para ver la lista de bloqueos y prohibiciones de operar en vigor.', 'unblocklogentry' => 'desbloqueó a $1', 'block-log-flags-anononly' => 'sólo anónimos', 'block-log-flags-nocreate' => 'desactivada la creación de cuentas', 'block-log-flags-noautoblock' => 'bloqueo automático desactivado', 'block-log-flags-noemail' => 'correo electrónico deshabilitado', 'block-log-flags-nousertalk' => 'no puede editar su propia página de discusión', 'block-log-flags-angry-autoblock' => 'autobloqueo avanzado habilitado', 'block-log-flags-hiddenname' => 'nombre de usuario ocultado', 'range_block_disabled' => 'La facultad de administrador de crear bloqueos por rangos está deshabilitada.', 'ipb_expiry_invalid' => 'El tiempo de caducidad no es válido.', 'ipb_expiry_temp' => 'Los bloqueos a nombres de usuario ocultos deben ser permanentes.', 'ipb_hide_invalid' => 'No se puede suprimir esta cuenta; tiene más de {{PLURAL:$1|una edición|$1 ediciones}}.', 'ipb_already_blocked' => '"$1" ya se encuentra bloqueado.', 'ipb-needreblock' => '$1 ya está bloqueado. ¿Quieres cambiar el bloqueo?', 'ipb-otherblocks-header' => '{{PLURAL:$1|Otro bloqueo|Otros bloqueos}}', 'unblock-hideuser' => 'No se puede desbloquear a este usuario, porque su nombre de usuario está oculto.', 'ipb_cant_unblock' => "'''Error''': Número ID $1 de bloqueo no encontrado. Pudo haber sido desbloqueado ya.", 'ipb_blocked_as_range' => 'Error: la dirección IP $1 no está bloqueada directamente y no puede ser desbloqueada. Sin embargo, está bloqueada como parte del rango $2, que puede ser desbloqueado.', 'ip_range_invalid' => 'El rango de IP no es válido.', 'ip_range_toolarge' => 'Los bloqueos de rango superiores a /$1 no están permitidos.', 'proxyblocker' => 'Bloqueador de proxies', 'proxyblockreason' => 'Su dirección IP ha sido bloqueada porque es un proxy abierto. Por favor, contacte con su proveedor de servicios de Internet o con su servicio de asistencia técnica e infórmeles de este grave problema de seguridad.', 'sorbsreason' => 'Su dirección IP está listada como proxy abierto en DNSBL.', 'sorbs_create_account_reason' => 'Su dirección IP está listada como proxy abierto en DNSBL. No puede crear una cuenta', 'xffblockreason' => 'Una dirección IP presente en la cabecera X-Forwarded-For, tuya o del servidor proxy que estás usando, ha sido bloqueada. El motivo original del bloqueo fue: $1', 'cant-see-hidden-user' => 'El usuario que está intentando bloquear ya ha sido bloqueado y oculto. Puesto que usted no tiene el derecho hideuser, usted no puede ver o editar los bloqueos del usuario.', 'ipbblocked' => 'No puedes bloquear o desbloquear a otros usuarios porque estás bloqueado', 'ipbnounblockself' => 'No puedes desbloquearte', # Developer tools 'lockdb' => 'Bloquear la base de datos', 'unlockdb' => 'Desbloquear la base de datos', 'lockdbtext' => 'El bloqueo de la base de datos impedirá a todos los usuarios editar páginas, cambiar sus preferencias, modificar sus listas de seguimiento y cualquier otra función que requiera realizar cambios en la base de datos. Por favor, confirme que ésto es precisamente lo que quiere hacer y que desbloqueará la base de datos tan pronto haya finalizado las operaciones de mantenimiento.', 'unlockdbtext' => 'El desbloqueo de la base de datos permitirá a todos los usuarios editar páginas, cambiar sus preferencias, modificar sus listas de seguimiento y cualesquiera otras funciones que impliquen modificar la base de datos. Por favor, confirme que esto es precisamente lo que quiere hacer.', 'lockconfirm' => 'Sí, realmente quiero bloquear la base de datos.', 'unlockconfirm' => 'Sí, realmente quiero desbloquear la base de datos.', 'lockbtn' => 'Bloquear la base de datos', 'unlockbtn' => 'Desbloquear la base de datos', 'locknoconfirm' => 'No ha confirmado lo que desea hacer.', 'lockdbsuccesssub' => 'El bloqueo se ha realizado con éxito', 'unlockdbsuccesssub' => 'El desbloqueo se ha realizado con éxito', 'lockdbsuccesstext' => 'La base de datos de {{SITENAME}} ha sido bloqueada. <br />Recuerde retirar el bloqueo después de completar las tareas de mantenimiento.', 'unlockdbsuccesstext' => 'La base de datos de {{SITENAME}} ha sido desbloqueada.', 'lockfilenotwritable' => 'El archivo-cerrojo de la base de datos no tiene permiso de escritura. Para bloquear o desbloquear la base de datos, este archivo tiene que ser escribible por el servidor web.', 'databasenotlocked' => 'La base de datos no está bloqueada.', 'lockedbyandtime' => '(por {{GENDER:$1|$1}} el $2 a las $3)', # Move page 'move-page' => 'Trasladar $1', 'move-page-legend' => 'Renombrar página', 'movepagetext' => "Mediante el siguiente formulario puedes renombrar una página, moviendo todo su historial al nombre nuevo. El título anterior redirigirá al nuevo. Puedes actualizar automáticamente las redirecciones que apuntan al título original. Si eliges no hacerlo, asegúrate de revisar posibles redirecciones [[Special:DoubleRedirects|dobles]] o [[Special:BrokenRedirects|rotas]]. Tú eres responsable de asegurar que los enlaces continúen funcionando correctamente. Nota que la página '''no''' se moverá si ya hay una página con el título nuevo, a menos de que ésta sea una redirección y no tenga historial de ediciones pasadas. Esto significa que puedes deshacer el renombrado en caso de un error, y que no puedes sobreescribir una página existente. '''Aviso''' Esto puede representar un cambio drástico e inesperado para una página popular; asegúrate de entender las consecuencias de esta acción antes de proceder.", 'movepagetext-noredirectfixer' => "Usando el siguiente formulario se renombrará una página, trasladando todo su historial al nuevo nombre. El título anterior se convertirá en una redirección al nuevo título. Asegúrate de no dejar [[Special:DoubleRedirects|redirecciones dobles]] o [[Special:BrokenRedirects|rotas]]. Tú eres responsable de hacer que los enlaces sigan apuntando adonde se supone que deberían hacerlo. Recuerda que la página '''no''' será renombrada si ya existe una página con el nuevo título, a no ser que sea una página vacía o una redirección sin historial. Esto significa que podrás renombrar una página a su título original si has cometido un error, pero que no podrás sobrescribir una página existente. '''¡Aviso!''' Este puede ser un cambio drástico e inesperado para una página popular; por favor, asegúrate de entender las consecuencias del procedimiento antes de seguir adelante.", 'movepagetalktext' => "La página de discusión asociada, si existe, será renombrada automáticamente '''a menos que:''' *Estés trasladando la página entre espacios de nombres diferentes, *Una página de discusión no vacía ya exista con el nombre nuevo, o *No marques el recuadro «Renombrar la página de discusión asociada». En estos casos, deberás trasladar manualmente el contenido de la página de discusión.", 'movearticle' => 'Renombrar página', 'moveuserpage-warning' => "'''Aviso:''' estás a punto de trasladar una página de usuario. Ten en cuenta que solo será trasladada la página; el usuario '''no''' será renombrado.", 'movenologintext' => 'Es necesario ser usuario registrado y [[Special:UserLogin|haber iniciado sesión]] para renombrar una página.', 'movenotallowed' => 'No tienes permiso para trasladar páginas.', 'movenotallowedfile' => 'No tienes permiso para trasladar archivos.', 'cant-move-user-page' => 'No tienes permiso para trasladar páginas de usuario (excepto subpáginas).', 'cant-move-to-user-page' => 'No tienes permiso para trasladar una página a una página de usuario (excepto a subpáginas de usuario).', 'newtitle' => 'A título nuevo:', 'move-watch' => 'Vigilar páginas de origen y destino', 'movepagebtn' => 'Renombrar página', 'pagemovedsub' => 'Renombrado realizado con éxito', 'movepage-moved' => "'''«$1» ha sido trasladado a «$2».'''", 'movepage-moved-redirect' => 'Se ha creado una redirección.', 'movepage-moved-noredirect' => 'Se ha suprimido la creación de la redirección.', 'articleexists' => 'Ya existe una página con ese nombre, o el nombre que has escogido no es válido. Por favor, elige otro nombre.', 'cantmove-titleprotected' => 'No puedes trasladar la página a esta ubicación, porque el nuevo título ha sido protegido para evitar su creación.', 'movetalk' => 'Renombrar la página de discusión asociada', 'move-subpages' => 'Intentar trasladar las subpáginas (hasta $1)', 'move-talk-subpages' => 'Intentar trasladar las subpáginas de discusión (hasta $1)', 'movepage-page-exists' => 'La página $1 ya existe, por lo que no puede ser renombrada automáticamente.', 'movepage-page-moved' => 'La página $1 ha sido trasladada a $2.', 'movepage-page-unmoved' => 'La página $1 no se ha podido trasladar a $2.', 'movepage-max-pages' => 'Se {{PLURAL:$1|ha trasladado un máximo de una página|han trasladado un máximo de $1 páginas}}, y no van a trasladarse más automáticamente.', 'movelogpage' => 'Registro de traslados', 'movelogpagetext' => 'Abajo se encuentra una lista de páginas trasladadas.', 'movesubpage' => '{{PLURAL:$1|Subpágina|Subpáginas}}', 'movesubpagetext' => 'Esta página tiene {{PLURAL:$1|la siguiente subpágina|las siguientes $1 subpáginas}}:', 'movenosubpage' => 'Esta página no tiene subpáginas.', 'movereason' => 'Motivo:', 'revertmove' => 'revertir', 'delete_and_move' => 'Borrar y trasladar', 'delete_and_move_text' => '==Se necesita borrado== La página de destino ("[[:$1]]") ya existe. ¿Quiere borrarla para permitir al traslado?', 'delete_and_move_confirm' => 'Sí, borrar la página', 'delete_and_move_reason' => 'Borrada para trasladar [[$1]]', 'selfmove' => 'Los títulos de origen y destino son los mismos; no se puede trasladar una página sobre sí misma.', 'immobile-source-namespace' => 'No se pueden trasladar páginas en el espacio de nombres «$1»', 'immobile-target-namespace' => 'No se puede trasladar páginas al espacio de nombres «$1»', 'immobile-target-namespace-iw' => 'Un enlace interwiki no es un destino válido para trasladar una página.', 'immobile-source-page' => 'Esta página no se puede renombrar.', 'immobile-target-page' => 'No se puede trasladar a tal título.', 'bad-target-model' => 'El destino deseado utiliza un modelo diferente de contenido. No se puede realizar la conversión de $1 a $2.', 'imagenocrossnamespace' => 'No se puede trasladar el fichero a otro espacio de nombres', 'nonfile-cannot-move-to-file' => 'No es posible trasladar lo que no es un archivo al espacio de nombres de archivo', 'imagetypemismatch' => 'La nueva extensión de archivo no corresponde con su tipo', 'imageinvalidfilename' => 'El nombre del fichero de destino no es válido', 'fix-double-redirects' => 'Actualizar las redirecciones que apuntan al título original', 'move-leave-redirect' => 'Dejar una redirección', 'protectedpagemovewarning' => "'''Advertencia:''' Esta página ha sido bloqueada de tal manera que solamente usuarios con privilegios de administrador puedan trasladarla. A continuación se muestra la última entrada de registro para referencia:", 'semiprotectedpagemovewarning' => "'''Nota:''' Esta página ha sido bloqueada para que solamente usuarios registrados pueden moverla. A continuación se muestra la última entrada de registro para referencia:", 'move-over-sharedrepo' => '== El archivo existe == [[:$1]] existe en un repositorio compartido. El traslado a este título invalidará la compartición del archivo.', 'file-exists-sharedrepo' => 'El nombre de archivo elegido ya está siendo usado en un repositorio compartido. Por favor, elige otro nombre.', # Export 'export' => 'Exportar páginas', 'exporttext' => 'Puedes exportar el texto y el historial de ediciones de una página en particular o de un conjunto de páginas a un texto XML. En el futuro, este texto podría importarse en otro wiki que ejecutase MediaWiki a través de [[Special:Import|importar página]]. Para exportar páginas, escribe los títulos en la caja de texto de abajo, un título por línea, y selecciona si quieres la versión actual junto a las versiones anteriores, con las líneas del historial, o sólo la versión actual con la información sobre la última edición. En el último caso también puedes usar un enlace, por ejemplo [[{{#Special:Export}}/{{MediaWiki:Mainpage}}]] para la página "[[{{MediaWiki:Mainpage}}]]".', 'exportall' => 'Exportar todas las páginas', 'exportcuronly' => 'Incluye sólo la revisión actual, no el historial de revisiones al completo.', 'exportnohistory' => "---- '''Nota:''' Exportar el historial completo de páginas a través de este formulario ha sido deshabilitado debido a problemas de rendimiento del servidor.", 'exportlistauthors' => 'Incluir una lista completa de colaboradores para cada página', 'export-submit' => 'Exportar', 'export-addcattext' => 'Añadir páginas desde la categoría:', 'export-addcat' => 'Añadir', 'export-addnstext' => 'Agregar páginas del nombre del sitio:', 'export-addns' => 'Agregar', 'export-download' => 'Guardar como archivo', 'export-templates' => 'Incluir plantillas', 'export-pagelinks' => 'Incluir páginas enlazadas a una profundidad de:', # Namespace 8 related 'allmessages' => 'Todos los mensajes de MediaWiki', 'allmessagesname' => 'Nombre', 'allmessagesdefault' => 'Texto predeterminado', 'allmessagescurrent' => 'Texto actual', 'allmessagestext' => 'Esta es una lista de mensajes del sistema disponibles en el espacio de nombres MediaWiki: Por favor visita [https://www.mediawiki.org/wiki/Localisation Localización MediaWiki] y [//translatewiki.net translatewiki.net] si deseas contribuir con la localización genérica MediaWiki.', 'allmessagesnotsupportedDB' => "Esta página no está disponible porque '''\$wgUseDatabaseMessages''' está deshabilitado.", 'allmessages-filter-legend' => 'Filtro', 'allmessages-filter' => 'Filtrar por estado de personalización:', 'allmessages-filter-unmodified' => 'Sin modificar', 'allmessages-filter-all' => 'Todos', 'allmessages-filter-modified' => 'Modificados', 'allmessages-prefix' => 'Filtrar por prefijo:', 'allmessages-language' => 'Idioma:', 'allmessages-filter-submit' => 'Ir', 'allmessages-filter-translate' => 'Traducir', # Thumbnails 'thumbnail-more' => 'Aumentar', 'filemissing' => 'Falta archivo', 'thumbnail_error' => 'Error al crear miniatura: $1', 'thumbnail_error_remote' => 'Mensaje de error de $1 : $2', 'djvu_page_error' => 'Página DjVu fuera de rango', 'djvu_no_xml' => 'Imposible obtener XML para el archivo DjVu', 'thumbnail-temp-create' => 'No se ha podido crear el archivo temporal de la miniatura', 'thumbnail-dest-create' => 'No se ha podido guardar la miniatura', 'thumbnail_invalid_params' => 'Parámetros del thumbnail no válidos', 'thumbnail_dest_directory' => 'Incapaz de crear el directorio de destino', 'thumbnail_image-type' => 'Tipo de imagen no contemplado', 'thumbnail_gd-library' => 'Configuración de la librería GD incompleta: falta la función $1', 'thumbnail_image-missing' => 'El fichero parece no existir: $1', # Special:Import 'import' => 'Importar páginas', 'importinterwiki' => 'Importación transwiki', 'import-interwiki-text' => 'Selecciona un wiki y un título de página para importar. Las fechas de revisiones y los nombres de editores se preservarán. Todas las importaciones transwiki se registran en el [[Special:Log/import|registro de importaciones]].', 'import-interwiki-source' => 'Wiki o página origen:', 'import-interwiki-history' => 'Copiar todas las versiones históricas para esta página', 'import-interwiki-templates' => 'Incluir todas las plantillas', 'import-interwiki-submit' => 'Importar', 'import-interwiki-namespace' => 'Espacio de nombres de destino:', 'import-interwiki-rootpage' => 'Página raíz del destino (opcional):', 'import-upload-filename' => 'Nombre de archivo:', 'import-comment' => 'Comentario:', 'importtext' => 'Por favor, exporta el archivo desde el wiki de origen usando la [[Special:Export|herramienta de exportación]], guárdalo en tu disco y súbelo aquí.', 'importstart' => 'Importando páginas...', 'import-revision-count' => '$1 {{PLURAL:$1|revisión|revisiones}}', 'importnopages' => 'No hay páginas que importar.', 'imported-log-entries' => 'Importados $1 {{PLURAL:$1|entradas de registro|entradas de registro}}.', 'importfailed' => 'La importación ha fallado: $1', 'importunknownsource' => 'Tipo de fuente de importación desconocida', 'importcantopen' => 'No se pudo importar el archivo', 'importbadinterwiki' => 'Enlace interwiki anómalo', 'importnotext' => 'Vacío o sin texto', 'importsuccess' => '¡La importación se ha realizado con éxito!', 'importhistoryconflict' => 'Existen revisiones en conflicto en el historial (puede que se haya importado esta página antes)', 'importnosources' => 'No hay fuentes de importación transwiki y no está permitido subir directamente el historial.', 'importnofile' => 'No se subieron archivos de importación.', 'importuploaderrorsize' => 'Falló la carga del archivo de importaciones. Su tamaño es superior al máximo permitido.', 'importuploaderrorpartial' => 'Falló la subida del fichero de importación. Se subió sólo parcialmente.', 'importuploaderrortemp' => 'Falló la subida del fichero de importación. No hay un directorio temporal.', 'import-parse-failure' => 'Error de lectura al importar XML', 'import-noarticle' => '¡No hay páginas para importar!', 'import-nonewrevisions' => 'Ninguna revisión fue importada (todas ya estaban presentes o fueron omitido debido a errores).', 'xml-error-string' => '$1 en la línea $2, col $3 (byte $4): $5', 'import-upload' => 'Subir datos XML', 'import-token-mismatch' => 'Pérdida de datos de sesión. Por favor, inténtalo de nuevo.', 'import-invalid-interwiki' => 'No se puede importar de la wiki especificada.', 'import-error-edit' => 'La página $1 no se importó porque no tienes permisos para editarla.', 'import-error-create' => 'La página «$1» no se importó porque no tienes permisos para crearla.', 'import-error-interwiki' => 'La página "$1" no se ha importado porque su nombre está reservado para la vinculación externa (interwikis).', 'import-error-special' => 'La página "$1" no se ha importado porque pertenece a un espacio de nombres especial que no admite páginas.', 'import-error-invalid' => 'La página "$1" no se ha importado porque su nombre no es válido.', 'import-error-unserialize' => 'La revisión $2 de la página "$1" no pudo dejar de hacerse en serie. Se informó de la revisión para utilizar el modelo de contenidos $3 ejecutado en serie como $4.', 'import-options-wrong' => '{{PLURAL:$2|Opción errónea|Opciones erróneas}}: <nowiki>$1</nowiki>', 'import-rootpage-invalid' => 'La página raíz dada es un título inválido.', 'import-rootpage-nosubpage' => 'El espacio de nombres "$1" de la página raíz no permite subpáginas.', # Import log 'importlogpage' => 'Registro de importaciones', 'importlogpagetext' => 'Importaciones administrativas de páginas con historial desde otros wikis.', 'import-logentry-upload' => 'importó [[$1]] por subida de archivo', 'import-logentry-upload-detail' => '$1 {{PLURAL:$1|revisión|revisiones}}', 'import-logentry-interwiki' => 'transwikificada $1', 'import-logentry-interwiki-detail' => '$1 {{PLURAL:$1|revisión|revisiones}} desde $2', # JavaScriptTest 'javascripttest' => 'Pruebas de JavaScript', 'javascripttest-title' => 'Pruebas de $1 en ejecución', 'javascripttest-pagetext-noframework' => 'Esta página está reservada para ejecutar pruebas de JavaScript.', 'javascripttest-pagetext-unknownframework' => 'Marco de pruebas desconocido "$1".', 'javascripttest-pagetext-frameworks' => 'Por favor, seleccione uno de los marcos de pruebas siguientes: $1', 'javascripttest-pagetext-skins' => 'Elija un aspecto (skin) para ejecutar las pruebas:', 'javascripttest-qunit-intro' => 'Consulte la [$1 documentación sobre las pruebas] en mediawiki.org.', 'javascripttest-qunit-heading' => 'Conjunto de pruebas MediaWiki JavaScript QUnit', # Tooltip help for the actions 'tooltip-pt-userpage' => 'Tu página de {{gender:|usuario|usuaria}}', 'tooltip-pt-anonuserpage' => 'La página de usuario de la IP desde la que editas', 'tooltip-pt-mytalk' => 'Tu página de discusión', 'tooltip-pt-anontalk' => 'Discusión sobre ediciones hechas desde esta dirección IP', 'tooltip-pt-preferences' => 'Tus preferencias', 'tooltip-pt-watchlist' => 'Lista de páginas cuyos cambios vigilas', 'tooltip-pt-mycontris' => 'Lista de tus contribuciones', 'tooltip-pt-login' => 'Te recomendamos iniciar sesión, sin embargo no es obligatorio', 'tooltip-pt-logout' => 'Salir de la sesión', 'tooltip-ca-talk' => 'Discusión acerca del artículo', 'tooltip-ca-edit' => 'Puedes editar esta página. Utiliza el botón de previsualización antes de guardar', 'tooltip-ca-addsection' => 'Inicia una nueva sección', 'tooltip-ca-viewsource' => 'Esta página está protegida. Puedes ver su código fuente', 'tooltip-ca-history' => 'Versiones anteriores de esta página y sus autores', 'tooltip-ca-protect' => 'Proteger esta página', 'tooltip-ca-unprotect' => 'Cambiar protección de esta página', 'tooltip-ca-delete' => 'Borrar esta página', 'tooltip-ca-undelete' => 'Restaurar las ediciones hechas a esta página antes de que fuese borrada', 'tooltip-ca-move' => 'Trasladar esta página', 'tooltip-ca-watch' => 'Añadir esta página a tu lista de seguimiento', 'tooltip-ca-unwatch' => 'Borrar esta página de su lista de seguimiento', 'tooltip-search' => 'Buscar en {{SITENAME}}', 'tooltip-search-go' => 'Ir al artículo con este nombre exacto si existe', 'tooltip-search-fulltext' => 'Busca este texto en las páginas', 'tooltip-p-logo' => 'Visitar la página principal', 'tooltip-n-mainpage' => 'Visitar la página principal', 'tooltip-n-mainpage-description' => 'Visitar la página principal', 'tooltip-n-portal' => 'Acerca del proyecto, lo que puedes hacer, dónde encontrar información', 'tooltip-n-currentevents' => 'Información de contexto sobre acontecimientos actuales', 'tooltip-n-recentchanges' => 'Lista de cambios recientes en el wiki', 'tooltip-n-randompage' => 'Cargar una página al azar', 'tooltip-n-help' => 'El lugar para aprender', 'tooltip-t-whatlinkshere' => 'Lista de todas las páginas del wiki que enlazan aquí', 'tooltip-t-recentchangeslinked' => 'Cambios recientes en las páginas que enlazan con ésta', 'tooltip-feed-rss' => 'Sindicación RSS de esta página', 'tooltip-feed-atom' => 'Sindicación Atom de esta página', 'tooltip-t-contributions' => 'Lista de contribuciones de este usuario', 'tooltip-t-emailuser' => 'Enviar un mensaje de correo a este usuario', 'tooltip-t-upload' => 'Subir imágenes o archivos multimedia', 'tooltip-t-specialpages' => 'Lista de todas las páginas especiales', 'tooltip-t-print' => 'Versión imprimible de esta página', 'tooltip-t-permalink' => 'Enlace permanente a esta versión de la página', 'tooltip-ca-nstab-main' => 'Ver el artículo', 'tooltip-ca-nstab-user' => 'Ver la página de usuario', 'tooltip-ca-nstab-media' => 'Ver la página de multimedia', 'tooltip-ca-nstab-special' => 'Esta es una página especial, no se puede editar la página en sí', 'tooltip-ca-nstab-project' => 'Ver la página de proyecto', 'tooltip-ca-nstab-image' => 'Ver la página de la imagen', 'tooltip-ca-nstab-mediawiki' => 'Ver el mensaje de sistema', 'tooltip-ca-nstab-template' => 'Ver la plantilla', 'tooltip-ca-nstab-help' => 'Ver la página de ayuda', 'tooltip-ca-nstab-category' => 'Ver la página de categoría', 'tooltip-minoredit' => 'Marcar este cambio como menor', 'tooltip-save' => 'Guardar los cambios', 'tooltip-preview' => 'Previsualiza los cambios realizados. ¡Por favor, hazlo antes de grabar!', 'tooltip-diff' => 'Muestra los cambios que ha introducido en el texto.', 'tooltip-compareselectedversions' => 'Ver las diferencias entre las dos versiones seleccionadas de esta página.', 'tooltip-watch' => 'Añadir esta página a tu lista de seguimiento', 'tooltip-watchlistedit-normal-submit' => 'Borrar páginas', 'tooltip-watchlistedit-raw-submit' => 'Actualizar lista de seguimiento', 'tooltip-recreate' => 'Recupera una página que ha sido borrada', 'tooltip-upload' => 'Empieza la subida', 'tooltip-rollback' => '«Revertir» revierte todas las ediciones del último usuario con un solo clic.', 'tooltip-undo' => '«Deshacer» revierte la edición seleccionada y abre la página de edición en el modo de previsualización. Permite añadir una razón al resumen de edición.', 'tooltip-preferences-save' => 'Guardar las preferencias', 'tooltip-summary' => 'Introduce un breve resumen', 'interlanguage-link-title' => '$1 ($2)', # Stylesheets 'common.css' => '/* El CSS colocado en esta página será aplicado a todas las apariencias */', 'cologneblue.css' => '/* El CSS colocado en esta página afectará a los usuarios que usen la apariencia Cologne Blue */', 'monobook.css' => '/* El CSS colocado en esta página afectará a los usuarios que usen la apariencia "MonoBook" */', 'modern.css' => '/* El CSS colocado en esta página afectará a los usuarios que usen la apariencia Moderna */', 'vector.css' => '/* El CSS colocado en esta página afectará a los usuarios que usen la apariencia "Vector" */', 'print.css' => '/* Los estilos CSS colocados aquí afectarán la impresión */', 'noscript.css' => '/* Los estilos CSS colocados aquí se aplicarán a los usuarios que hayan desactivado el JavaScript en su navegador */', 'group-autoconfirmed.css' => '/* Los estilos CSS colocados aquí se aplicarán para todos los usuarios del grupo Usuarios autoconfirmados */', 'group-bot.css' => '/* Los estilos CSS colocados aquí se aplicarán para todos los usuarios del grupo Bots */', 'group-sysop.css' => '/* Los estilos CSS colocados aquí se aplicarán para todos los usuarios del grupo Administradores */', 'group-bureaucrat.css' => '/* Los estilos CSS colocados aquí se aplicarán para todos los usuarios del grupo Burócratas */', # Scripts 'common.js' => '/* Cualquier código JavaScript escrito aquí se cargará para todos los usuarios en cada carga de página */', 'cologneblue.js' => '/* Cualquier código JavaScript escrito aquí se cargará para todos los usuarios que usen la piel Colonia azul */', 'monobook.js' => '/* El código JavaScript que se ponga aquí será cargado por los usuarios de la apariencia MonoBook */', 'modern.js' => '/* Cualquier código JavaScript escrito aquí se cargará para todos los usuarios que usen la apariencia Moderna */', 'vector.js' => '/* Cualquier código JavaScript escrito aquí se cargará para todos los usuarios que usen la apariencia Vector */', 'group-autoconfirmed.js' => '/* Cualquier código JavaScript escrito aquí se cargará para todos los usuarios del grupo Usuarios autoconfirmados */', 'group-bot.js' => '/* Cualquier código JavaScript escrito aquí se cargará para todos los usuarios del grupo Bots */', 'group-sysop.js' => '/* Cualquier código JavaScript escrito aquí se cargará para todos los usuarios del grupo Administradores */', 'group-bureaucrat.js' => '/* Cualquier código JavaScript escrito aquí se cargará para todos los usuarios del grupo Burócratas */', # Metadata 'notacceptable' => 'El servidor wiki no puede proveer los datos en un formato que su cliente (navegador) pueda entender.', # Attribution 'anonymous' => '{{PLURAL:$1|Usuario anónimo|Usuarios anónimos}} de {{SITENAME}}', 'siteuser' => '{{GENDER:$1|Usuario|Usuaria}} $1 de {{SITENAME}}', 'anonuser' => '{{SITENAME}} usuario anónimo $1', 'lastmodifiedatby' => 'Esta página fue modificada por última vez en $2, $1 por $3.', 'othercontribs' => 'Basado en el trabajo de $1.', 'others' => 'otros', 'siteusers' => '{{PLURAL:$2|Usuario|Usuarios}} $1 de {{SITENAME}}', 'anonusers' => '{{SITENAME}} {{PLURAL:$2|usuario|usuarios}} anónimos $1', 'creditspage' => 'Créditos de la página', 'nocredits' => 'No hay información de créditos para esta página.', # Spam protection 'spamprotectiontitle' => 'Filtro de protección contra spam', 'spamprotectiontext' => 'La página que quería guardar fue bloqueada por el filtro de spam. Esto podría estar causado por un enlace a un sitio externo incluido en la lista negra.', 'spamprotectionmatch' => 'El siguiente texto es el que activó nuestro filtro de spam: $1', 'spambot_username' => 'Limpieza de spam de MediaWiki', 'spam_reverting' => 'Revirtiendo a la última versión que no contenga enlaces a $1', 'spam_blanking' => 'Todas las revisiones contienen enlaces a $1, blanqueando', 'spam_deleting' => 'Todas las revisiones que contienen enlaces a $1, en proceso de eliminación', 'simpleantispam-label' => 'Comprobación anti-spam ¡NO rellenes esto!', # Info page 'pageinfo-title' => 'Información para «$1»', 'pageinfo-not-current' => 'Lo sentimos, no es posible mostrar esta información para las revisiones antiguas.', 'pageinfo-header-basic' => 'Información básica', 'pageinfo-header-edits' => 'Historial de ediciones', 'pageinfo-header-restrictions' => 'Protección de página', 'pageinfo-header-properties' => 'Propiedades de página', 'pageinfo-display-title' => 'Visualizar el título', 'pageinfo-default-sort' => 'Criterio de ordenación predeterminado', 'pageinfo-length' => 'Longitud de la página (en bytes)', 'pageinfo-article-id' => 'Identificador ID de la página', 'pageinfo-language' => 'Idioma de la página', 'pageinfo-content-model' => 'Modelo de contenido de la página', 'pageinfo-robot-policy' => 'Indización por robots', 'pageinfo-robot-index' => 'Permitido', 'pageinfo-robot-noindex' => 'No permitido', 'pageinfo-views' => 'Número de vistas', 'pageinfo-watchers' => 'Número de usuarios que vigilan la página', 'pageinfo-few-watchers' => 'Menos de $1 {{PLURAL:$1|vigilante|vigilantes}}', 'pageinfo-redirects-name' => 'Número de redirecciones a esta página', 'pageinfo-redirects-value' => '$1', 'pageinfo-subpages-name' => 'Subpáginas de esta página', 'pageinfo-subpages-value' => '$1 ($2 {{PLURAL:$2|redirección|redirecciones}}; $3 {{PLURAL:$3|no-redirección|no-redirecciones}})', 'pageinfo-firstuser' => 'Creador de la página', 'pageinfo-firsttime' => 'Fecha de creación de la página', 'pageinfo-lastuser' => 'Último editor', 'pageinfo-lasttime' => 'Fecha de la última edición', 'pageinfo-edits' => 'Número total de ediciones', 'pageinfo-authors' => 'Número total de autores distintos', 'pageinfo-recent-edits' => 'Número de ediciones recientes (en los últimos $1)', 'pageinfo-recent-authors' => 'Número de autores distintos recientes', 'pageinfo-magic-words' => '{{PLURAL:$1|Palabra mágica|Palabras mágicas}} ($1)', 'pageinfo-hidden-categories' => '{{PLURAL:$1|Categoría oculta|Categorías ocultas}} ($1)', 'pageinfo-templates' => '{{PLURAL:$1|Plantilla incluida|Plantillas incluidas}} ($1)', 'pageinfo-transclusions' => '{{PLURAL:$1|Página incluida|Páginas incluidas}} ($1)', 'pageinfo-toolboxlink' => 'Información de la página', 'pageinfo-redirectsto' => 'Redirige a', 'pageinfo-redirectsto-info' => 'Información', 'pageinfo-contentpage' => 'Contado como página de contenido', 'pageinfo-contentpage-yes' => 'Sí', 'pageinfo-protect-cascading' => 'Protecciones en serie activadas', 'pageinfo-protect-cascading-yes' => 'Sí', 'pageinfo-protect-cascading-from' => 'Protecciones en serie activadas', 'pageinfo-category-info' => 'Información de la categoría', 'pageinfo-category-pages' => 'Número de páginas', 'pageinfo-category-subcats' => 'Número de subcategorías', 'pageinfo-category-files' => 'Número de archivos', # Skin names 'skinname-cologneblue' => 'Colonia azul', 'skinname-monobook' => 'MonoBook', 'skinname-modern' => 'Moderna', 'skinname-vector' => 'Vector', # Patrolling 'markaspatrolleddiff' => 'Marcar como revisado', 'markaspatrolledtext' => 'Marcar este artículo como revisado', 'markedaspatrolled' => 'Marcado como revisado', 'markedaspatrolledtext' => 'La revisión seleccionada de [[:$1|$1]] ha sido marcada como revisada.', 'rcpatroldisabled' => 'Se ha desactivado la supervisión de cambios recientes', 'rcpatroldisabledtext' => 'La capacidad de revisar los Cambios Recientes está deshabilitada en este momento.', 'markedaspatrollederror' => 'No se puede marcar como patrullada', 'markedaspatrollederrortext' => 'Debes especificar una revisión para marcarla como patrullada.', 'markedaspatrollederror-noautopatrol' => 'No tienes permisos para marcar tus propios cambios como revisados.', 'markedaspatrollednotify' => 'Este cambio realizado en $1 se ha marcado como revisado.', 'markedaspatrollederrornotify' => 'Error al marcar como revisado.', # Patrol log 'patrol-log-page' => 'Registro de revisiones', 'patrol-log-header' => 'Este es un registro de revisiones patrulladas.', 'log-show-hide-patrol' => '$1 registro de patrullaje', # Image deletion 'deletedrevision' => 'Borrada revisión antigua $1', 'filedeleteerror-short' => 'Se produjo un error al borrar el archivo: $1', 'filedeleteerror-long' => 'Se han producido errores mientras se borraba el archivo: $1', 'filedelete-missing' => 'No se pudo borrar el archivo "$1" porque no existe.', 'filedelete-old-unregistered' => 'La revisión de archivo "$1" no está en la base de datos.', 'filedelete-current-unregistered' => 'El archivo «$1» no existe en la base de datos.', 'filedelete-archive-read-only' => 'El servidor web no logra escribir en el directorio archivo "$1".', # Browsing diffs 'previousdiff' => '← Edición anterior', 'nextdiff' => 'Edición siguiente →', # Media information 'mediawarning' => "'''Atención''': Este fichero puede contener código malicioso. Ejecutarlo podría comprometer la seguridad de su equipo.", 'imagemaxsize' => "Límite de tamaño de imagen:<br />''(para páginas de descripción de archivo)''", 'thumbsize' => 'Tamaño de las vistas en miniatura:', 'widthheight' => '$1 × $2', 'widthheightpage' => '$1 × $2, $3 {{PLURAL:|página|páginas}}', 'file-info' => 'tamaño de archivo: $1; tipo MIME: $2', 'file-info-size' => '$1 × $2 píxeles; tamaño de archivo: $3; tipo MIME: $4', 'file-info-size-pages' => '$1 × $2 píxeles, tamaño de archivo: $3, tipo MIME: $4, $5 {{PLURAL:$5|página|páginas}}', 'file-nohires' => 'No disponible a mayor resolución.', 'svg-long-desc' => 'archivo SVG, nominalmente $1 × $2 píxeles, tamaño de archivo: $3', 'svg-long-desc-animated' => 'Archivo SVG animado, nominalmente de $1 × $2 píxeles, tamaño del archivo: $3', 'svg-long-error' => 'Archivo SVG no válido: $1', 'show-big-image' => 'Archivo original', 'show-big-image-preview' => 'Tamaño de esta previsualización: $1.', 'show-big-image-other' => '{{PLURAL:$2|Otra resolución|Otras resoluciones}}: $1.', 'show-big-image-size' => '$1 × $2 píxeles', 'file-info-gif-looped' => 'bucleado', 'file-info-gif-frames' => '$1 {{PLURAL:$1|frame|frames}}', 'file-info-png-looped' => 'bucleado', 'file-info-png-repeat' => 'reproducido $1 {{PLURAL:$1|vez|veces}}', 'file-info-png-frames' => '$1 {{PLURAL:$1|marco|marcos}}', 'file-no-thumb-animation' => "'''Nota: debido a limitaciones técnicas, las miniaturas de este archivo no están animadas.'''", 'file-no-thumb-animation-gif' => "'''Nota: Debido a limitaciones técnicas, las miniaturas de imágenes GIF de alta resolución como esta no están animadas.'''", # Special:NewFiles 'newimages' => 'Galería de imágenes nuevas', 'imagelisttext' => "Debajo hay una lista de '''$1''' {{PLURAL:$1|imagen|imágenes}} ordenadas $2.", 'newimages-summary' => 'Esta página especial muestra una galería de los últimos archivos subidos.', 'newimages-legend' => 'Nombre del fichero', 'newimages-label' => 'Nombre del fichero (o una parte):', 'showhidebots' => '($1 bots)', 'noimages' => 'No hay nada que ver.', 'ilsubmit' => 'Buscar', 'bydate' => 'por fecha', 'sp-newimages-showfrom' => 'Mostrar nuevas imágenes empezando por $2, $1', # Video information, used by Language::formatTimePeriod() to format lengths in the above messages 'seconds-abbrev' => '$1s', 'minutes-abbrev' => '$1m', 'hours-abbrev' => '$1h', 'days-abbrev' => '$1d', 'seconds' => '{{PLURAL:$1|un segundo|$1 segundos}}', 'minutes' => '{{PLURAL:$1|un minuto|$1 minutos}}', 'hours' => '{{PLURAL:$1|una hora|$1 horas}}', 'days' => '{{PLURAL:$1|un día|$1 días}}', 'weeks' => '{{PLURAL:$1|$1 semana|$1 semanas}}', 'months' => '{{PLURAL:$1|$1 mes|$1 meses}}', 'years' => '{{PLURAL:$1|$1 año|$1 años}}', 'ago' => 'hace $1', 'just-now' => 'Ahora mismo', # Human-readable timestamps 'hours-ago' => 'hace $1 {{PLURAL:$1|hora|horas}}', 'minutes-ago' => 'hace {{PLURAL:$1|un minuto|$1 minutos}}', 'seconds-ago' => 'hace $1 {{PLURAL:$1|segundo|segundos}}', 'monday-at' => 'El lunes a las $1', 'tuesday-at' => 'El martes a las $1', 'wednesday-at' => 'El miércoles a las $1', 'thursday-at' => 'El jueves a las $1', 'friday-at' => 'El viernes a las $1', 'saturday-at' => 'El sábado a las $1', 'sunday-at' => 'El domingo a las $1', 'yesterday-at' => 'Ayer a las $1', # Bad image list 'bad_image_list' => 'El formato es el siguiente: Solo se reconocen elementos de lista (líneas que comienzan con «*»). El primer enlace de cada línea debe ser un enlace al archivo que se quiere bloquear. Todos los demás enlaces en la misma línea se tomarán como excepciones (es decir, páginas donde sí se puede usar el archivo).', # Metadata 'metadata' => 'Metadatos', 'metadata-help' => 'Este archivo contiene información adicional (metadatos), probablemente añadida por la cámara digital, el escáner o el programa usado para crearlo o digitalizarlo. Si el archivo ha sido modificado desde su estado original, pueden haberse perdido algunos detalles.', 'metadata-expand' => 'Mostrar datos detallados', 'metadata-collapse' => 'Ocultar datos detallados', 'metadata-fields' => 'Los campos de metadatos que se listan en este mensaje se mostrarán en la página de descripción de la imagen aún cuando la tabla de metadatos esté plegada. Existen otros campos que se mantendrán ocultos por defecto. * make * model * datetimeoriginal * exposuretime * fnumber * isospeedratings * focallength * artist * copyright * imagedescription * gpslatitude * gpslongitude * gpsaltitude', # Exif tags 'exif-imagewidth' => 'Anchura', 'exif-imagelength' => 'Altura', 'exif-bitspersample' => 'Bits por componente', 'exif-compression' => 'Esquema de compresión', 'exif-photometricinterpretation' => 'Composición de pixel', 'exif-orientation' => 'Orientación', 'exif-samplesperpixel' => 'Número de componentes', 'exif-planarconfiguration' => 'Distribución de datos', 'exif-ycbcrsubsampling' => 'Razón de submuestreo de Y a C', 'exif-ycbcrpositioning' => 'Posicionamientos Y y C', 'exif-xresolution' => 'Resolución horizontal', 'exif-yresolution' => 'Resolución vertical', 'exif-stripoffsets' => 'Localización de datos de imagen', 'exif-rowsperstrip' => 'Número de filas por banda', 'exif-stripbytecounts' => 'Bytes por banda comprimida', 'exif-jpeginterchangeformat' => 'Desplazamiento al JPEG SOI', 'exif-jpeginterchangeformatlength' => 'Bytes de datos JPEG', 'exif-whitepoint' => 'Cromacidad de punto blanco', 'exif-primarychromaticities' => 'Cromacidades primarias', 'exif-ycbcrcoefficients' => 'Coeficientes de la matriz de transformación de espacio de color', 'exif-referenceblackwhite' => 'Pareja de valores blanco y negro de referencia', 'exif-datetime' => 'Fecha y hora de modificación del archivo', 'exif-imagedescription' => 'Título de la imagen', 'exif-make' => 'Fabricante de la cámara', 'exif-model' => 'Modelo de cámara', 'exif-software' => 'Software usado', 'exif-artist' => 'Autor', 'exif-copyright' => 'Titular de los derechos de autor', 'exif-exifversion' => 'Versión Exif', 'exif-flashpixversion' => 'Versión admitida de Flashpix', 'exif-colorspace' => 'Espacio de color', 'exif-componentsconfiguration' => 'Significado de cada componente', 'exif-compressedbitsperpixel' => 'Modo de compresión de la imagen', 'exif-pixelydimension' => 'Ancho de la imagen', 'exif-pixelxdimension' => 'Altura de la imagen', 'exif-usercomment' => 'Comentarios de usuario', 'exif-relatedsoundfile' => 'Archivo de audio relacionado', 'exif-datetimeoriginal' => 'Fecha y hora de la generación de los datos', 'exif-datetimedigitized' => 'Fecha y hora de la digitalización', 'exif-subsectime' => 'Fecha y hora (precisión por debajo del segundo)', 'exif-subsectimeoriginal' => 'Fecha y hora de la generación de los datos (precisión por debajo del segundo)', 'exif-subsectimedigitized' => 'Fecha y hora de la digitalización (precisión por debajo del segundo)', 'exif-exposuretime' => 'Tiempo de exposición', 'exif-exposuretime-format' => '$1 seg ($2)', 'exif-fnumber' => 'Número F', 'exif-exposureprogram' => 'Programa de exposición', 'exif-spectralsensitivity' => 'Sensibilidad espectral', 'exif-isospeedratings' => 'Calificación de velocidad ISO', 'exif-shutterspeedvalue' => 'Velocidad de obturación APEX', 'exif-aperturevalue' => 'Apertura APEX', 'exif-brightnessvalue' => 'Brillo APEX', 'exif-exposurebiasvalue' => 'Sesgo de exposición', 'exif-maxaperturevalue' => 'Valor máximo de apertura', 'exif-subjectdistance' => 'Distancia al sujeto', 'exif-meteringmode' => 'Modo de medición', 'exif-lightsource' => 'Fuente de luz', 'exif-flash' => 'Flash', 'exif-focallength' => 'Longitud focal de la lente', 'exif-subjectarea' => 'Área del sujeto', 'exif-flashenergy' => 'Energía del flash', 'exif-focalplanexresolution' => 'Resolución X del plano focal', 'exif-focalplaneyresolution' => 'Resolución Y del plano focal', 'exif-focalplaneresolutionunit' => 'Unidad de resolución del plano focal', 'exif-subjectlocation' => 'Localización del sujeto', 'exif-exposureindex' => 'Índice de exposición', 'exif-sensingmethod' => 'Método de sensor', 'exif-filesource' => 'Fuente de archivo', 'exif-scenetype' => 'Tipo de escena', 'exif-customrendered' => 'Procesador personalizado de imagen', 'exif-exposuremode' => 'Modo de exposición', 'exif-whitebalance' => 'Balance de blanco', 'exif-digitalzoomratio' => 'Razón de zoom digital', 'exif-focallengthin35mmfilm' => 'Longitud focal en película de 35 mm', 'exif-scenecapturetype' => 'Tipo de captura de escena', 'exif-gaincontrol' => 'Control de escena', 'exif-contrast' => 'Contraste', 'exif-saturation' => 'Saturación', 'exif-sharpness' => 'Agudeza', 'exif-devicesettingdescription' => 'Descripción de los ajustes del dispositivo', 'exif-subjectdistancerange' => 'Rango de distancia al sujeto', 'exif-imageuniqueid' => 'ID único de imagen', 'exif-gpsversionid' => 'Versión de la etiqueta GPS', 'exif-gpslatituderef' => 'Latitud norte o sur', 'exif-gpslatitude' => 'Latitud', 'exif-gpslongituderef' => 'Longitud este u oeste', 'exif-gpslongitude' => 'Longitud', 'exif-gpsaltituderef' => 'Refencia de altitud', 'exif-gpsaltitude' => 'Altitud', 'exif-gpstimestamp' => 'Tiempo GPS (reloj atómico)', 'exif-gpssatellites' => 'Satélites usados para la medición', 'exif-gpsstatus' => 'Estado del receptor', 'exif-gpsmeasuremode' => 'Modo de medición', 'exif-gpsdop' => 'Precisión de medición', 'exif-gpsspeedref' => 'Unidad de velocidad', 'exif-gpsspeed' => 'Velocidad del receptor GPS', 'exif-gpstrackref' => 'Referencia para la dirección del movimiento', 'exif-gpstrack' => 'Dirección del movimiento', 'exif-gpsimgdirectionref' => 'Referencia de la dirección de imágen', 'exif-gpsimgdirection' => 'Dirección de imagen', 'exif-gpsmapdatum' => 'Utilizados datos de medición geodésica', 'exif-gpsdestlatituderef' => 'Referencia para la latitud del destino', 'exif-gpsdestlatitude' => 'Destino de latitud', 'exif-gpsdestlongituderef' => 'Referencia para la longitud del destino', 'exif-gpsdestlongitude' => 'Longitud del destino', 'exif-gpsdestbearingref' => 'Referencia para la orientación al destino', 'exif-gpsdestbearing' => 'Orientación del destino', 'exif-gpsdestdistanceref' => 'Referencia para la distancia al destino', 'exif-gpsdestdistance' => 'Distancia al destino', 'exif-gpsprocessingmethod' => 'Nombre del método de procesado GPS', 'exif-gpsareainformation' => 'Nombre de la área GPS', 'exif-gpsdatestamp' => 'Fecha GPS', 'exif-gpsdifferential' => 'Corrección diferencial de GPS', 'exif-jpegfilecomment' => 'Comentario de archivo JPEG', 'exif-keywords' => 'Palabras clave', 'exif-worldregioncreated' => 'Región del mundo en la que se tomó la imagen', 'exif-countrycreated' => 'País en el que se tomó la imagen', 'exif-countrycodecreated' => 'Código para el país en el que la imagen fue tomada', 'exif-provinceorstatecreated' => 'Provincia o estado en el que la imagen fue tomada', 'exif-citycreated' => 'Ciudad en la que se tomó la imagen', 'exif-sublocationcreated' => 'Región de la ciudad en la que la foto fue tomada', 'exif-worldregiondest' => 'Región del mundo mostrada', 'exif-countrydest' => 'País mostrado', 'exif-countrycodedest' => 'Código de país mostrado', 'exif-provinceorstatedest' => 'Provincia o estado mostrado', 'exif-citydest' => 'Ciudad mostrada', 'exif-sublocationdest' => 'Región de la ciudad mostrada', 'exif-objectname' => 'Título breve', 'exif-specialinstructions' => 'Instrucciones especiales', 'exif-headline' => 'Encabezado', 'exif-credit' => 'Crédito/proveedor', 'exif-source' => 'Fuente', 'exif-editstatus' => 'Estado editorial de la imagen', 'exif-urgency' => 'Urgencia', 'exif-fixtureidentifier' => 'Nome del elemento habitual', 'exif-locationdest' => 'Ubicación mostrada', 'exif-locationdestcode' => 'Código de la ubicación mostrada', 'exif-objectcycle' => 'Hora del día para la cual está destinado este archivo', 'exif-contact' => 'Información de contacto', 'exif-writer' => 'Escritor', 'exif-languagecode' => 'Idioma', 'exif-iimversion' => 'Versión IIM', 'exif-iimcategory' => 'Categoría', 'exif-iimsupplementalcategory' => 'Categorías suplementarias', 'exif-datetimeexpires' => 'No usar después de', 'exif-datetimereleased' => 'Lanzado el', 'exif-originaltransmissionref' => 'Código de ubicación de transmisión original', 'exif-identifier' => 'Identificador', 'exif-lens' => 'Lente utilizada', 'exif-serialnumber' => 'Número de serie de la cámara', 'exif-cameraownername' => 'Propietario de la cámara', 'exif-label' => 'Etiqueta', 'exif-datetimemetadata' => 'Fecha en la cual fueron modificados por última vez los metadatos', 'exif-nickname' => 'Nombre informal de la imagen', 'exif-rating' => 'Valoración (sobre 5)', 'exif-rightscertificate' => 'Certificado de gestión de derechos', 'exif-copyrighted' => 'Estado de copyright', 'exif-copyrightowner' => 'Titular del copyright', 'exif-usageterms' => 'Términos de uso', 'exif-webstatement' => 'Declaración de derechos de autor en línea', 'exif-originaldocumentid' => 'Id. único del documento original', 'exif-licenseurl' => 'URL para la licencia de copyright', 'exif-morepermissionsurl' => 'Información de licencia alternativa', 'exif-attributionurl' => 'Cuando reutilices este trabajo, por favor enlaza a', 'exif-preferredattributionname' => 'Al volver a utilizar este trabajo, por favor da crédito', 'exif-pngfilecomment' => 'Comentario de archivo PNG', 'exif-disclaimer' => 'Aviso legal', 'exif-contentwarning' => 'Advertencia de contenido', 'exif-giffilecomment' => 'Comentario de archivo GIF', 'exif-intellectualgenre' => 'Tipo de elemento', 'exif-subjectnewscode' => 'Código de asunto', 'exif-scenecode' => 'Código de escena IPTC', 'exif-event' => 'Evento representado', 'exif-organisationinimage' => 'Organización representada', 'exif-personinimage' => 'Persona representada', 'exif-originalimageheight' => 'Altura de la imagen antes de que fuera recortada', 'exif-originalimagewidth' => 'Ancho de la imagen antes de que fuera recortada', # Exif attributes 'exif-compression-1' => 'Sin comprimir', 'exif-compression-2' => 'CCITT Group 3 1-Dimensional Modified Huffman run length encoding', 'exif-compression-3' => 'Codificación de fax CCITT grupo 3', 'exif-compression-4' => 'Codificación de fax CCITT grupo 4', 'exif-copyrighted-true' => 'Con derechos de autor', 'exif-copyrighted-false' => 'No se ha definido el estado del copyright', 'exif-unknowndate' => 'Fecha desconocida', 'exif-orientation-1' => 'Normal', 'exif-orientation-2' => 'Volteada horizontalmente', 'exif-orientation-3' => 'Rotada 180°', 'exif-orientation-4' => 'Volteada verticalmente', 'exif-orientation-5' => 'Rotada 90° CCW y volteada verticalmente', 'exif-orientation-6' => 'Rotada 90° a la izquierda', 'exif-orientation-7' => 'Rotada 90° CW y volteada verticalmente', 'exif-orientation-8' => 'Rotada 90° a la derecha', 'exif-planarconfiguration-1' => 'formato panorámico', 'exif-planarconfiguration-2' => 'formato plano', 'exif-colorspace-65535' => 'Sin calibrar', 'exif-componentsconfiguration-0' => 'no existe', 'exif-exposureprogram-0' => 'No definido', 'exif-exposureprogram-1' => 'Manual', 'exif-exposureprogram-2' => 'Programa normal', 'exif-exposureprogram-3' => 'Prioridad de apertura', 'exif-exposureprogram-4' => 'Prioridad de obturador', 'exif-exposureprogram-5' => 'Programa creativo (con prioridad a la profundidad de campo)', 'exif-exposureprogram-6' => 'Programa de acción (alta velocidad de obturador)', 'exif-exposureprogram-7' => 'Modo retrato (para primeros planos con el fondo desenfocado)', 'exif-exposureprogram-8' => 'Modo panorama (para fotos panorámicas con el fondo enfocado)', 'exif-subjectdistance-value' => '$1 metros', 'exif-meteringmode-0' => 'Desconocido', 'exif-meteringmode-1' => 'Media', 'exif-meteringmode-2' => 'Promedio centrado', 'exif-meteringmode-3' => 'Puntual', 'exif-meteringmode-4' => 'Multipunto', 'exif-meteringmode-5' => 'Patrón', 'exif-meteringmode-6' => 'Parcial', 'exif-meteringmode-255' => 'Otro', 'exif-lightsource-0' => 'Desconocido', 'exif-lightsource-1' => 'Luz diurna', 'exif-lightsource-2' => 'Fluorescente', 'exif-lightsource-3' => 'Tungsteno (luz incandescente)', 'exif-lightsource-4' => 'Flash', 'exif-lightsource-9' => 'Buen tiempo', 'exif-lightsource-10' => 'Tiempo nublado', 'exif-lightsource-11' => 'Penumbra', 'exif-lightsource-12' => 'Fluorescente de luz diurna (D 5700 – 7100K)', 'exif-lightsource-13' => 'Fluorescente de día soleado (N 4600 – 5400K)', 'exif-lightsource-14' => 'Fluorescente blanco frío (W 3900 – 4500K)', 'exif-lightsource-15' => 'Fluroescente blanco (WW 3200 – 3700K)', 'exif-lightsource-17' => 'Luz estándar A', 'exif-lightsource-18' => 'Luz estándar B', 'exif-lightsource-19' => 'Luz estándar C', 'exif-lightsource-24' => 'Tungsteno de estudio ISO', 'exif-lightsource-255' => 'Otra fuente de luz', # Flash modes 'exif-flash-fired-0' => 'No se disparó el flash', 'exif-flash-fired-1' => 'Flash disparado', 'exif-flash-return-0' => 'no hay función de detección del retorno de la luz estroboscópica', 'exif-flash-return-2' => 'no se detectó retorno de luz estroboscópica', 'exif-flash-return-3' => 'detectado retorno de luz estroboscópica', 'exif-flash-mode-1' => 'disparo de flash forzado', 'exif-flash-mode-2' => 'disparo de flash anulado', 'exif-flash-mode-3' => 'modo automático', 'exif-flash-function-1' => 'Modo sin flash', 'exif-flash-redeye-1' => 'modo de reducción de ojos rojos', 'exif-focalplaneresolutionunit-2' => 'pulgadas', 'exif-sensingmethod-1' => 'No definido', 'exif-sensingmethod-2' => 'Sensor de área de color de un chip', 'exif-sensingmethod-3' => 'Sensor de área de color de dos chips', 'exif-sensingmethod-4' => 'Sensor de área de color de tres chips', 'exif-sensingmethod-5' => 'Sensor de área secuencial de color', 'exif-sensingmethod-7' => 'Sensor trilineal', 'exif-sensingmethod-8' => 'Sensor lineal secuencial de color', 'exif-filesource-3' => 'Cámara digital', 'exif-scenetype-1' => 'Una imagen directamente fotografiada', 'exif-customrendered-0' => 'Proceso normal', 'exif-customrendered-1' => 'Proceso personalizado', 'exif-exposuremode-0' => 'Exposición automática', 'exif-exposuremode-1' => 'Exposición manual', 'exif-exposuremode-2' => 'Auto bracket', 'exif-whitebalance-0' => 'Balance de blanco automático', 'exif-whitebalance-1' => 'Balance de blanco manual', 'exif-scenecapturetype-0' => 'Estándar', 'exif-scenecapturetype-1' => 'Paisaje', 'exif-scenecapturetype-2' => 'Retrato', 'exif-scenecapturetype-3' => 'Escena nocturna', 'exif-gaincontrol-0' => 'Ninguna', 'exif-gaincontrol-1' => 'Bajo aumento de ganancia', 'exif-gaincontrol-2' => 'Alto aumento de ganancia', 'exif-gaincontrol-3' => 'Baja disminución de ganancia', 'exif-gaincontrol-4' => 'Alta disminución de ganancia', 'exif-contrast-0' => 'Normal', 'exif-contrast-1' => 'Suave', 'exif-contrast-2' => 'Duro', 'exif-saturation-0' => 'Normal', 'exif-saturation-1' => 'Baja saturación', 'exif-saturation-2' => 'Alta saturación', 'exif-sharpness-0' => 'Normal', 'exif-sharpness-1' => 'Suave', 'exif-sharpness-2' => 'Dura', 'exif-subjectdistancerange-0' => 'Desconocida', 'exif-subjectdistancerange-1' => 'Macro', 'exif-subjectdistancerange-2' => 'Vista cercana', 'exif-subjectdistancerange-3' => 'Vista lejana', # Pseudotags used for GPSLatitudeRef and GPSDestLatitudeRef 'exif-gpslatitude-n' => 'Latitud norte', 'exif-gpslatitude-s' => 'Latitud sur', # Pseudotags used for GPSLongitudeRef and GPSDestLongitudeRef 'exif-gpslongitude-e' => 'Longitud este', 'exif-gpslongitude-w' => 'Longitud oeste', # Pseudotags used for GPSAltitudeRef 'exif-gpsaltitude-above-sealevel' => '$1 {{PLURAL:$1|metro|metros}} sobre el nivel del mar', 'exif-gpsaltitude-below-sealevel' => '$1 {{PLURAL:$1|metro|metros}} bajo el nivel del mar', 'exif-gpsstatus-a' => 'Medida en progreso', 'exif-gpsstatus-v' => 'Interoperabilidad de medida', 'exif-gpsmeasuremode-2' => 'Medición bidimensional', 'exif-gpsmeasuremode-3' => 'Medición tridimensional', # Pseudotags used for GPSSpeedRef 'exif-gpsspeed-k' => 'Kilómetros por hora', 'exif-gpsspeed-m' => 'Millas por hora', 'exif-gpsspeed-n' => 'Nudos', # Pseudotags used for GPSDestDistanceRef 'exif-gpsdestdistance-k' => 'Kilómetros', 'exif-gpsdestdistance-m' => 'Millas', 'exif-gpsdestdistance-n' => 'Millas náuticas', 'exif-gpsdop-excellent' => 'Excelente ($1)', 'exif-gpsdop-good' => 'Bueno ( $1 )', 'exif-gpsdop-moderate' => 'Moderado ($1)', 'exif-gpsdop-fair' => 'Pasable ($1)', 'exif-gpsdop-poor' => 'Pobre ( $1 )', 'exif-objectcycle-a' => 'Sólo por la mañana', 'exif-objectcycle-p' => 'Sólo por el atardecer', 'exif-objectcycle-b' => 'Tanto por la mañana y por la tarde', # Pseudotags used for GPSTrackRef, GPSImgDirectionRef and GPSDestBearingRef 'exif-gpsdirection-t' => 'Dirección real', 'exif-gpsdirection-m' => 'Dirección magnética', 'exif-ycbcrpositioning-1' => 'Centrado', 'exif-ycbcrpositioning-2' => 'Co-localizados', 'exif-dc-contributor' => 'Colaboradores', 'exif-dc-coverage' => 'Ámbito espacial o temporal del medio', 'exif-dc-date' => 'Fecha(s)', 'exif-dc-publisher' => 'Editorial', 'exif-dc-relation' => 'Medios relacionados', 'exif-dc-rights' => 'Derechos', 'exif-dc-source' => 'Medios de origen', 'exif-dc-type' => 'Tipo de medio', 'exif-rating-rejected' => 'Rechazado', 'exif-isospeedratings-overflow' => 'Más de 65535', 'exif-iimcategory-ace' => 'Arte, cultura y entretenimiento', 'exif-iimcategory-clj' => 'Crimen y ley', 'exif-iimcategory-dis' => 'Desastres y accidentes', 'exif-iimcategory-fin' => 'Economía y negocios', 'exif-iimcategory-edu' => 'Educación', 'exif-iimcategory-evn' => 'Medio ambiente', 'exif-iimcategory-hth' => 'Salud', 'exif-iimcategory-hum' => 'Interés humano', 'exif-iimcategory-lab' => 'Trabajo', 'exif-iimcategory-lif' => 'Estilo de vida y ocio', 'exif-iimcategory-pol' => 'Política', 'exif-iimcategory-rel' => 'Religión y creencias', 'exif-iimcategory-sci' => 'Ciencia y tecnología', 'exif-iimcategory-soi' => 'Cuestiones sociales', 'exif-iimcategory-spo' => 'Deportes', 'exif-iimcategory-war' => 'Guerra, conflictos y disturbios', 'exif-iimcategory-wea' => 'Clima', 'exif-urgency-normal' => 'Normal ($1)', 'exif-urgency-low' => 'Bajo ($1)', 'exif-urgency-high' => 'Alto ($1)', 'exif-urgency-other' => 'Prioridad definida por el usuario ($1)', # 'all' in various places, this might be different for inflected languages 'watchlistall2' => 'todos', 'namespacesall' => 'todos', 'monthsall' => 'todos', # Email address confirmation 'confirmemail' => 'Confirmar dirección de correo electrónico', 'confirmemail_noemail' => 'No tienes una dirección de correo electrónico válida en tus [[Special:Preferences|preferencias de usuario]].', 'confirmemail_text' => '{{SITENAME}} requiere la validación de tu dirección de correo antes de usarlo. Pulsa el botón de abajo para enviar la confirmación. El correo incluirá un enlace con un código. Introdúcelo para confirmar la validez de tu dirección.', 'confirmemail_pending' => 'Ya se te ha enviado un código de confirmación; si creaste una cuenta recientemente, puede que tengas que esperar unos minutos para que te llegue antes de intentar pedir un nuevo código.', 'confirmemail_send' => 'Envíar el código de confimación.', 'confirmemail_sent' => 'Confirmación de correo enviada.', 'confirmemail_oncreate' => 'Se ha enviado un código de confirmación a tu dirección de correo electrónico. Este código no es necesario para iniciar sesión, pero necesitarás proporcionarlo antes de activar cualquier función basada en correo electrónico en el wiki.', 'confirmemail_sendfailed' => 'No fue posible enviar el correo de confirmación. Por favor, comprueba la validez de la dirección de correo. El servidor indicó el error: $1', 'confirmemail_invalid' => 'Código de confirmación incorrecto. El código debe haber expirado.', 'confirmemail_needlogin' => 'Necesitas $1 para confirmar tu dirección electrónica.', 'confirmemail_success' => 'Su dirección de correo ha sido confirmada Ahora puedes [[Special:UserLogin|identificarte]] y colaborar en el wiki.', 'confirmemail_loggedin' => 'Tu dirección de correo electrónico ha sido confirmada.', 'confirmemail_subject' => 'confirmación de la dirección de correo de {{SITENAME}}', 'confirmemail_body' => 'Alguien, probablemente usted mismo, ha registrado desde la dirección IP $1 la cuenta "$2" en {{SITENAME}}, utilizando esta dirección de correo. Para confirmar que esta cuenta realmente le pertenece y activar el correo en {{SITENAME}}, siga este enlace: $3 Si la cuenta *no* es suya, siga este otro enlace para cancelar la confirmación de la dirección de correo: $5 El código de confirmación expirará en $4.', 'confirmemail_body_changed' => 'Alguien, probablemente tú, ha modificado la dirección de correo electrónico asociado a la cuenta "$2" hacia esta en {{SITENAME}}, desde la dirección IP $1. Para confirmar que esta cuenta realmente te pertenece y reactivar las funciones de correo electrónico en {{SITENAME}}, abre este enlace en su navegador: $3 Si la cuenta *no* te pertenece, sigue el siguiente enlace para cancelar la confirmación: $5 Este código de confirmación expirará el $4.', 'confirmemail_body_set' => 'Alguien, probablemente tu desde la dirección IP $1, ha cambiado la dirección de correo electrónico de la cuenta $2 a esta dirección en {{SITENAME}}. Para confirmar que esta cuenta realmente te pertenece y activar las capacidades del correo electrónico en {{SITENAME}}, abre este enlace en tu navegador: $3 Si la cuenta *no* te pertenece sigue entonces este otro enlace para cancelar la confirmación del correo electrónico: $5 Este código de confirmación caducará el $4.', 'confirmemail_invalidated' => 'La confirmación de la dirección de correo electrónico ha sido cancelada', 'invalidateemail' => 'Cancelar confirmación de correo electrónico', # Scary transclusion 'scarytranscludedisabled' => '[Transclusión interwiki está deshabilitada]', 'scarytranscludefailed' => '[Obtención de plantilla falló para $1]', 'scarytranscludefailed-httpstatus' => '[Error de recuperación de plantilla para $1: HTTP $2]', 'scarytranscludetoolong' => '[El URL es demasiado largo]', # Delete conflict 'deletedwhileediting' => "'''Aviso''': ¡Esta página fue borrada después de que usted empezara a editar!", 'confirmrecreate' => "El usuario [[User:$1|$1]] ([[User talk:$1|disc.]]) borró esta página después de que comenzaste a editarla, por el motivo: : ''$2'' Confirma que realmente quieres volver a crear esta página.", 'confirmrecreate-noreason' => 'El usuario [[User:$1|$1]] ([[User talk:$1|discusión]]) borró esta página después de que comenzaras a editarla. Por favor confirma que realmente quieres recrear esta página.', 'recreate' => 'Crear de nuevo', # action=purge 'confirm_purge_button' => 'Aceptar', 'confirm-purge-top' => '¿Limpiar la caché de esta página?', 'confirm-purge-bottom' => 'Purgar una página limpia la caché y fuerza a que aparezca la versión más actual.', # action=watch/unwatch 'confirm-watch-button' => 'Aceptar', 'confirm-watch-top' => '¿Añadir esta página a tu lista de seguimiento?', 'confirm-unwatch-button' => 'Aceptar', 'confirm-unwatch-top' => '¿Quitar esta página de tu lista de seguimiento?', # Separators for various lists, etc. 'comma-separator' => ',&#32;', 'quotation-marks' => '«$1»', # Multipage image navigation 'imgmultipageprev' => '← página anterior', 'imgmultipagenext' => 'siguiente página →', 'imgmultigo' => '¡Ir!', 'imgmultigoto' => 'Ir a la página $1', # Language selector for translatable SVGs 'img-lang-default' => '(idioma predeterminado)', 'img-lang-info' => 'Renderizar esta imagen en $1. $2', 'img-lang-go' => 'Adelante', # Table pager 'ascending_abbrev' => 'asc', 'descending_abbrev' => 'desc', 'table_pager_next' => 'Página siguiente', 'table_pager_prev' => 'Página anterior', 'table_pager_first' => 'Primera página', 'table_pager_last' => 'Última página', 'table_pager_limit' => 'Mostrar $1 elementos por página', 'table_pager_limit_label' => 'Elementos por página:', 'table_pager_limit_submit' => 'Ir', 'table_pager_empty' => 'No hay resultados', # Auto-summaries 'autosumm-blank' => 'Página blanqueada', 'autosumm-replace' => 'Página reemplazada por «$1»', 'autoredircomment' => 'Página redirigida a [[$1]]', 'autosumm-new' => 'Página creada con «$1»', # Live preview 'livepreview-loading' => 'Cargando…', 'livepreview-ready' => 'Cargando… ¡Listo!', 'livepreview-failed' => '¡La previsualización al vuelo falló! Prueba la previsualización normal.', 'livepreview-error' => 'No se pudo conectar: $1 «$2». Intenta usar la previsualización normal.', # Friendlier slave lag warnings 'lag-warn-normal' => 'Los cambios realizados en {{PLURAL:$1|el último segundo|los últimos $1 segundos}} podrían no mostrarse en esta lista.', 'lag-warn-high' => 'Debido a una alta latencia el servidor de base de datos, los cambios realizados en {{PLURAL:$1|el último segundo|los últimos $1 segundos}} podrían no mostrarse en esta lista.', # Watchlist editor 'watchlistedit-numitems' => 'Tu lista de seguimiento tiene {{PLURAL:$1|una página |$1 páginas}}, excluyendo las páginas de discusión.', 'watchlistedit-noitems' => 'Tu lista de seguimiento está vacía.', 'watchlistedit-normal-title' => 'Editar lista de seguimiento', 'watchlistedit-normal-legend' => 'Borrar títulos de la lista de seguimiento', 'watchlistedit-normal-explain' => 'A continuación se listan las páginas en tu lista de seguimiento. Para quitar un título, marca la casilla junto a él, y pulsa «{{int:Watchlistedit-normal-submit}}». También puedes [[Special:EditWatchlist/raw|editar la lista en crudo]].', 'watchlistedit-normal-submit' => 'Borrar páginas', 'watchlistedit-normal-done' => '{{PLURAL:$1|1 página ha sido borrada|$1 páginas han sido borradas}} de tu lista de seguimiento:', 'watchlistedit-raw-title' => 'Editar lista de seguimiento en crudo', 'watchlistedit-raw-legend' => 'Editar tu lista de seguimiento en modo texto', 'watchlistedit-raw-explain' => 'A continuación se listan las páginas en tu lista de seguimiento. Esta lista puede editarse añadiendo o eliminando líneas de la lista; un título por línea. Cuando acabes, pulsa «{{int:Watchlistedit-raw-submit}}». También puedes [[Special:EditWatchlist|usar el editor estándar]].', 'watchlistedit-raw-titles' => 'Páginas:', 'watchlistedit-raw-submit' => 'Actualizar lista de seguimiento', 'watchlistedit-raw-done' => 'Tu lista de seguimiento se ha actualizado.', 'watchlistedit-raw-added' => '{{PLURAL:$1|Se ha añadido una página|Se han añadido $1 páginas}}:', 'watchlistedit-raw-removed' => '{{PLURAL:$1|Una página ha sido borrada|$1 páginas han sido borradas}}:', # Watchlist editing tools 'watchlisttools-view' => 'Ver cambios', 'watchlisttools-edit' => 'Ver y editar tu lista de seguimiento', 'watchlisttools-raw' => 'Editar lista de seguimiento en crudo', # Signatures 'signature' => '[[{{ns:user}}:$1|$2]] ([[{{ns:user_talk}}:$1|discusión]])', # Core parser functions 'unknown_extension_tag' => 'Etiqueta desconocida «$1»', 'duplicate-defaultsort' => "'''Atención:''' La clave de ordenamiento predeterminada «$2» anula la clave de ordenamiento anterior «$1».", # Special:Version 'version' => 'Versión', 'version-extensions' => 'Extensiones instaladas', 'version-specialpages' => 'Páginas especiales', 'version-parserhooks' => 'Extensiones del analizador sintáctico', 'version-variables' => 'Variables', 'version-antispam' => 'Prevención de spam', 'version-skins' => 'Apariencias', 'version-other' => 'Otro', 'version-mediahandlers' => 'Manejadores multimedia', 'version-hooks' => 'Extensiones', 'version-parser-extensiontags' => 'Etiquetas de extensiones sintácticas', 'version-parser-function-hooks' => 'Extensiones de funciones sintácticas', 'version-hook-name' => 'Nombre de la extensión', 'version-hook-subscribedby' => 'Suscrito por', 'version-version' => '($1)', 'version-license' => 'Licencia de MediaWiki', 'version-ext-license' => 'Licencia', 'version-ext-colheader-name' => 'Extensión', 'version-ext-colheader-version' => 'Versión', 'version-ext-colheader-license' => 'Licencia', 'version-ext-colheader-description' => 'Descripción', 'version-ext-colheader-credits' => 'Autores', 'version-license-title' => 'Licencia para $1', 'version-license-not-found' => 'No se han encontrado información detallada de licencia para esta extensión.', 'version-credits-title' => 'Reconocimiento para $1', 'version-credits-not-found' => 'No se ha encontrado información detallada de reconocimiento para esta extensión.', 'version-poweredby-credits' => "Este wiki funciona gracias a '''[https://www.mediawiki.org/ MediaWiki]''', copyright © 2001-$1 $2.", 'version-poweredby-others' => 'otros', 'version-poweredby-translators' => 'Traductores de translatewiki.net', 'version-credits-summary' => 'Queremos reconocer a las siguientes personas por su contribución a [[Special:Version|MediaWiki]].', 'version-license-info' => 'MediaWiki es software libre; puedes redistribuirlo y/o modificarlo bajo los términos de la Licencia General Pública de GNU como la publica la Free Software Foundation; ya sea la versión 2 de la licencia, o (a tu elección) cualquier versión posterior. MediaWiki se distribuye con la esperanza de que será útil, pero SIN NINGUNA GARANTÍA; sin siquiera con la garantía implícita de COMERCIALIZACIÓN o IDONEIDAD PARA UN PROPÓSITO PARTICULAR. Consulta la Licencia Pública General de GNU para más detalles. Has recibido [{{SERVER}}{{SCRIPTPATH}}/COPYING una copia de la Licencia Pública General de GNU] junto a este programa; si no es así, escríbele a la Free Software Foundation, Inc., Calle Franklin 51, quinto piso, Boston, MA 02110-1301, EE. UU. o [//www.gnu.org/licenses/old-licenses/gpl-2.0.html léela en línea].', 'version-software' => 'Software instalado', 'version-software-product' => 'Producto', 'version-software-version' => 'Versión', 'version-entrypoints' => 'URL del punto de entrada', 'version-entrypoints-header-entrypoint' => 'Punto de entrada', 'version-entrypoints-header-url' => 'Dirección URL', 'version-entrypoints-articlepath' => '[https://www.mediawiki.org/wiki/Manual:$wgArticlePath Ruta del artículo]', 'version-entrypoints-scriptpath' => '[https://www.mediawiki.org/wiki/Manual:$wgScriptPath Ruta de la secuencia de comandos (script)]', # Special:Redirect 'redirect' => 'Redirigir por archivo, usuario, página o ID de revisión', 'redirect-legend' => 'Redirigir a un archivo o página', 'redirect-summary' => 'Esta página especial redirige a un fichero (dado un nombre de fichero), a una página (dado un identificador de revisión o de página) o a una página de usuario (dado un identificador numérico de usuario). Uso: [[{{#Special:Redirect}}/file/Example.jpg]], [[{{#Special:Redirect}}/revision/328429]], o [[{{#Special:Redirect}}/user/101]].', 'redirect-submit' => 'Ir', 'redirect-lookup' => 'Buscar:', 'redirect-value' => 'Valor:', 'redirect-user' => 'Id. del usuario', 'redirect-page' => 'ID de la página', 'redirect-revision' => 'Revisión de página', 'redirect-file' => 'Nombre de fichero', 'redirect-not-exists' => 'No se encontró el valor', # Special:FileDuplicateSearch 'fileduplicatesearch' => 'Búsqueda de archivos duplicados', 'fileduplicatesearch-summary' => 'Búsqueda de archivos duplicados en base a su valor hash.', 'fileduplicatesearch-legend' => 'Busca duplicados', 'fileduplicatesearch-filename' => 'Nombre del fichero:', 'fileduplicatesearch-submit' => 'Buscar', 'fileduplicatesearch-info' => '$1 × $2 píxeles<br />Tamaño: $3<br />Tipo MIME: $4', 'fileduplicatesearch-result-1' => 'El archivo «$1» no tiene duplicados idénticos.', 'fileduplicatesearch-result-n' => 'El archivo «$1» tiene {{PLURAL:$2|1 duplicado idéntico|$2 duplicados idénticos}}.', 'fileduplicatesearch-noresults' => 'Ningún archivo con el nombre «$1» encontrado.', # Special:SpecialPages 'specialpages' => 'Páginas especiales', 'specialpages-note-top' => 'Leyenda', 'specialpages-note' => '* Páginas especiales normales * <span class="mw-specialpagerestricted">Páginas especiales restringidas.</span> * <span class="mw-specialpagecached">Páginas especiales en caché (podrían ser obsoletas).</span>', 'specialpages-group-maintenance' => 'Reportes de mantenimiento', 'specialpages-group-other' => 'Otras páginas especiales', 'specialpages-group-login' => 'Iniciar sesión / Crear cuenta', 'specialpages-group-changes' => 'Cambios recientes y registros', 'specialpages-group-media' => 'Páginas sobre archivos', 'specialpages-group-users' => 'Usuarios y permisos', 'specialpages-group-highuse' => 'Páginas sobre usos', 'specialpages-group-pages' => 'Listas de páginas', 'specialpages-group-pagetools' => 'Herramientas de páginas', 'specialpages-group-wiki' => 'Herramientas y datos', 'specialpages-group-redirects' => 'Búsquedas y redirecciones', 'specialpages-group-spam' => 'Herramientas anti-SPAM', # Special:BlankPage 'blankpage' => 'Página vacía', 'intentionallyblankpage' => 'Esta pagina está en blanco de manera intencionada.', # External image whitelist 'external_image_whitelist' => ' #Deja esta línea exactamente como está<pre> #Colocar fragmentos de expresiones regulares (sólo la parte que va entre los //) debajo #Estos coincidirán con los URLs de las imágenes externas (hotlinked) #Aquellos que coincidan serán mostrados como imágenes, de lo contrario solamente un vínculo a la imagen será mostrada #Las líneas que empiezan por «#» se consideran comentarios #Esta es insensible a las mayúsculas #Colocar todos los fragmentos regex arriba de esta línea. Deja esta línea exactamente como está</pre>', # Special:Tags 'tags' => 'Etiquetas de cambios', 'tag-filter' => 'Filtro de [[Special:Tags|etiquetas]]:', 'tag-filter-submit' => 'Filtro', 'tag-list-wrapper' => '([[Special:Tags|{{PLURAL:$1|Etiqueta|Etiquetas}}]]: $2)', 'tags-title' => 'Etiquetas', 'tags-intro' => 'Esta página lista las etiquetas con las que el software puede marcar una edición y su significado.', 'tags-tag' => 'Nombre de etiqueta', 'tags-display-header' => 'Apariencia de la lista de cambios', 'tags-description-header' => 'Descripción completa de significado', 'tags-active-header' => '¿Activo?', 'tags-hitcount-header' => 'Cambios etiquetados', 'tags-active-yes' => 'Sí', 'tags-active-no' => 'No', 'tags-edit' => 'editar', 'tags-hitcount' => '$1 {{PLURAL:$1|cambio|cambios}}', # Special:ComparePages 'comparepages' => 'Comparar páginas', 'compare-page1' => 'Página 1', 'compare-page2' => 'Página 2', 'compare-rev1' => 'Revisión 1', 'compare-rev2' => 'Revisión 2', 'compare-submit' => 'Comparar', 'compare-invalid-title' => 'El título especificado es inválido.', 'compare-title-not-exists' => 'El título especificado no existe.', 'compare-revision-not-exists' => 'La revisión especificada no existe.', # Database error messages 'dberr-header' => 'Este wiki tiene un problema', 'dberr-problems' => 'Lo sentimos. Este sitio está experimentando dificultades técnicas.', 'dberr-again' => 'Prueba a recargar dentro de unos minutos.', 'dberr-info' => '(No se puede contactar con la base de datos del servidor: $1)', 'dberr-info-hidden' => '(No se puede contactar con la base de datos del servidor)', 'dberr-usegoogle' => 'Mientras tanto puedes probar buscando a través de Google.', 'dberr-outofdate' => 'Ten en cuenta que su índice de nuestro contenido puede estar desactualizado.', 'dberr-cachederror' => 'La siguiente es una página guardada de la página solicitada, y puede no estar actualizada.', # HTML forms 'htmlform-invalid-input' => 'Hay problemas con alguno de los datos que has ingresado', 'htmlform-select-badoption' => 'El valor que especificaste no es una opción válida.', 'htmlform-int-invalid' => 'El valor que especificaste no es un entero.', 'htmlform-float-invalid' => 'El valor que ha especificado no es un número.', 'htmlform-int-toolow' => 'El valor que especificaste está debajo del mínimo de $1', 'htmlform-int-toohigh' => 'El valor que especificaste está arriba del máximo de $1', 'htmlform-required' => 'Este valor es obligatorio', 'htmlform-submit' => 'Enviar', 'htmlform-reset' => 'Deshacer cambios', 'htmlform-selectorother-other' => 'Otro', 'htmlform-no' => 'No', 'htmlform-yes' => 'Sí', 'htmlform-chosen-placeholder' => 'Selecciona una opción', # SQLite database support 'sqlite-has-fts' => '$1 con soporte para búsqueda de texto completo', 'sqlite-no-fts' => '$1 sin soporte para búsqueda de texto completo', # New logging system 'logentry-delete-delete' => '$1 {{GENDER:$2|borró}} la página «$3»', 'logentry-delete-restore' => '$1 restauró la página «$3»', 'logentry-delete-event' => '$1 {{GENDER:$2|modificó}} la visibilidad de {{PLURAL:$5|un evento|$5 eventos}} del registro en $3: $4', 'logentry-delete-revision' => '$1 {{GENDER:$2|modificó}} la visibilidad de {{PLURAL:$5|una revisión |$5 revisiones}} en la página $3: $4', 'logentry-delete-event-legacy' => '$1 ha {{GENDER:$2|cambiado}} la visibilidad de registro de eventos en $3', 'logentry-delete-revision-legacy' => '$1 ha {{GENDER:$2|cambiado}} la visibilidad de las revisiones en la página $3', 'logentry-suppress-delete' => '$1 {{GENDER:$2|borró}}, con restricciones para administradores aplicadas, la página $3', 'logentry-suppress-event' => '$1 {{GENDER:$2|modificó}} secretamente la visibilidad de {{PLURAL:$5|una edición|$5 ediciones}} en la página $3: $4', 'logentry-suppress-revision' => '$1 modificó secretamente la visibilidad de {{PLURAL:$5|una edición|$5 ediciones}} en la página $3: $4', 'logentry-suppress-event-legacy' => '$1 {{GENDER:$2|modificó}} secretamente la visibilidad de los eventos del registro en $3', 'logentry-suppress-revision-legacy' => '$1 {{GENDER:$2|modificó}} secretamente la visibilidad de varias ediciones en la página $3', 'revdelete-content-hid' => 'contenido ocultado', 'revdelete-summary-hid' => 'resumen de edición oculto', 'revdelete-uname-hid' => 'nombre de usuario ocultado', 'revdelete-content-unhid' => 'contenido mostrado', 'revdelete-summary-unhid' => 'resumen de edición mostrado', 'revdelete-uname-unhid' => 'nombre de usuario mostrado', 'revdelete-restricted' => 'restricciones para administradores aplicadas', 'revdelete-unrestricted' => 'restricciones para administradores eliminadas', 'logentry-move-move' => '$1 movió la página $3 a $4', 'logentry-move-move-noredirect' => '$1 movió la página $3 a $4 sin dejar una redirección', 'logentry-move-move_redir' => '$1 movió la página $3 a $4 sobre una redirección', 'logentry-move-move_redir-noredirect' => '$1 movió la página $3 a $4 sobre una redirección y sin dejar una redirección', 'logentry-patrol-patrol' => '$1 {{GENDER:$2|marcó}} como patrullada la edición $4 de la página $3', 'logentry-patrol-patrol-auto' => '$1 {{GENDER:$2|marcó}} automáticamente la edición $4 de la página $3 como patrullada', 'logentry-newusers-newusers' => 'La cuenta de usuario $1 ha sido {{GENDER:$2|creada}}', 'logentry-newusers-create' => 'La cuenta de usuario $1 ha sido creada', 'logentry-newusers-create2' => 'La cuenta de usuario $3 ha sido creada por $1', 'logentry-newusers-byemail' => 'la cuenta de usuario $3 ha sido creada por $1 y la contraseña ha sido enviada por correo', 'logentry-newusers-autocreate' => 'La cuenta $1 fue creada automáticamente', 'logentry-rights-rights' => '$1 modificó los grupos a los que pertenece $3: de $4 a $5', 'logentry-rights-rights-legacy' => '$1 modificó los grupos a los que pertenece $3', 'logentry-rights-autopromote' => '$1 ha sido {{GENDER:$2|promocionado|promocionada}} automáticamente de $4 a $5', 'rightsnone' => '(ninguno)', # Feedback 'feedback-bugornote' => 'Si estás preparado para describir en detalle un problema técnico, [$1 informa de un bug] por favor. En otro caso, puedes usar el siguiente formulario. Tu comentario será añadido a la página [$3 $2], junto con tu nombre de usuario y el navegador que usas.', 'feedback-subject' => 'Asunto:', 'feedback-message' => 'Mensaje:', 'feedback-cancel' => 'Cancelar', 'feedback-submit' => 'Enviar comentarios', 'feedback-adding' => 'Añadiendo comentarios a la página...', 'feedback-error1' => 'Error: No se reconoce resultado de API', 'feedback-error2' => 'Error: Falló la edición', 'feedback-error3' => 'Error: No hay respuesta de la API', 'feedback-thanks' => '¡Gracias! Su comentario ha sido anotado en la página [$2 $1].', 'feedback-close' => 'Hecho', 'feedback-bugcheck' => '¡Perfecto! Únicamente comprueba que no sea un [$1 fallo conocido].', 'feedback-bugnew' => 'Lo he comprobado. Informar de un nuevo fallo.', # Search suggestions 'searchsuggest-search' => 'Buscar', 'searchsuggest-containing' => 'que contiene...', # API errors 'api-error-badaccess-groups' => 'No puedes cargar archivos en este wiki.', 'api-error-badtoken' => 'Error interno: Símbolo incorrecto.', 'api-error-copyuploaddisabled' => 'La subida por URL está desactivada en este servidor.', 'api-error-duplicate' => 'Ya existe{{PLURAL:$1| [$2 otro archivo]|[$2 n otros archivos]}} en el sitio con el mismo contenido.', 'api-error-duplicate-archive' => 'Ya {{PLURAL:$1|existía [$2 otro archivo]|existían [$2 otros archivos]}} en el sitio con el mismo contenido, pero {{PLURAL:$1|fue|fueron}} {{PLURAL:$1|eliminado|eliminados}}.', 'api-error-duplicate-archive-popup-title' => '{{PLURAL:$1|Archivo|Archivos}} {{PLURAL:$1|duplicado|duplicados}} que ya se han eliminado', 'api-error-duplicate-popup-title' => '{{PLURAL:$1|Archivo|Archivos}} {{PLURAL:$1|duplicado|duplicados}}', 'api-error-empty-file' => 'El archivo que enviaste estaba vacío.', 'api-error-emptypage' => 'No se pueden crear páginas nuevas que estén vacías.', 'api-error-fetchfileerror' => 'Error interno: Algo salió mal mientras se obtenía el archivo.', 'api-error-fileexists-forbidden' => 'Ya existe el archivo "$1" y no se puede sobreescribir.', 'api-error-fileexists-shared-forbidden' => 'Ya existe "$1" en el repositorio de archivos compartidos y no se puede sobreescribir.', 'api-error-file-too-large' => 'El archivo que enviaste era demasiado grande.', 'api-error-filename-tooshort' => 'El nombre de archivo es demasiado corto.', 'api-error-filetype-banned' => 'Este tipo de archivo está prohibido.', 'api-error-filetype-banned-type' => '$1 {{PLURAL:$4|no es un tipo de archivo permitido|no son tipos de archivos permitidos}}. {{PLURAL:$3|El tipo de archivo permitido es|Los tipos de archivos permitidos son}} $2.', 'api-error-filetype-missing' => 'El archivo no tiene extensión de archivo.', 'api-error-hookaborted' => 'La modificación que intentaste hacer fue cancelada por un gancho de extensión.', 'api-error-http' => 'Error interno: No se puede conectar al servidor.', 'api-error-illegal-filename' => 'El nombre de archivo no está permitido.', 'api-error-internal-error' => 'Error interno: Algo salió mal al procesar tu subida en el wiki.', 'api-error-invalid-file-key' => 'Error interno: No se encontró el archivo en el almacenamiento temporal.', 'api-error-missingparam' => 'Error interno: Faltan parámetros en la solicitud.', 'api-error-missingresult' => 'Error interno: No se pudo determinar si la copia tuvo éxito.', 'api-error-mustbeloggedin' => 'Debes iniciar sesión para subir archivos.', 'api-error-mustbeposted' => 'Error interno: La solicitud requiere HTTP POST.', 'api-error-noimageinfo' => 'La carga se realizó correctamente, pero el servidor no nos dio ninguna información sobre el archivo.', 'api-error-nomodule' => 'Error interno: No hay un módulo de carga configurado.', 'api-error-ok-but-empty' => 'Error interno: No hay respuesta del servidor.', 'api-error-overwrite' => 'No se permite sobrescribir un archivo existente.', 'api-error-stashfailed' => 'Error interno: El servidor no pudo almacenar el archivo temporal.', 'api-error-publishfailed' => 'Error interno: el servidor no pudo publicar el archivo temporal.', 'api-error-stasherror' => 'Ha ocurrido un error al subir el archivo al depósito.', 'api-error-timeout' => 'El servidor no respondió en el plazo previsto.', 'api-error-unclassified' => 'Ocurrió un error desconocido.', 'api-error-unknown-code' => 'Error desconocido: «$1»', 'api-error-unknown-error' => 'Error interno: Algo salió mal al intentar cargar el archivo.', 'api-error-unknown-warning' => 'Advertencia desconocida: $1', 'api-error-unknownerror' => 'Error desconocido: «$1».', 'api-error-uploaddisabled' => 'Las subidas están desactivadas en este wiki.', 'api-error-verification-error' => 'Este archivo puede estar dañado, o tiene una extensión incorrecta.', # Durations 'duration-seconds' => '$1 {{PLURAL:$1|segundo|segundos}}', 'duration-minutes' => '$1 {{PLURAL:$1|minuto|minutos}}', 'duration-hours' => '$1 {{PLURAL:$1|hora|horas}}', 'duration-days' => '$1 {{PLURAL:$1|día|días}}', 'duration-weeks' => '$1 {{PLURAL:$1|semana|semanas}}', 'duration-years' => '$1 {{PLURAL:$1|año|años}}', 'duration-decades' => '$1 {{PLURAL:$1|década|décadas}}', 'duration-centuries' => '$1 {{PLURAL:$1|siglo|siglos}}', 'duration-millennia' => '$1 {{PLURAL:$1|milenio|milenios}}', # Image rotation 'rotate-comment' => 'Imagen girada por $1 {{PLURAL:$1|grado|grados}} en el sentido de las agujas del reloj', # Limit report 'limitreport-title' => 'Datos de perfilado del analizador:', 'limitreport-cputime' => 'Tiempo de uso de CPU', 'limitreport-cputime-value' => '$1 {{PLURAL:$1|segundo|segundos}}', 'limitreport-walltime' => 'Tiempo real de uso', 'limitreport-walltime-value' => '$1 {{PLURAL:$1|segundo|segundos}}', 'limitreport-ppvisitednodes' => 'N.º de nodos visitados por el preprocesador', 'limitreport-ppgeneratednodes' => 'N.º de nodos generados por el preprocesador', 'limitreport-postexpandincludesize' => 'Tamaño de inclusión posexpansión', 'limitreport-postexpandincludesize-value' => '$1/$2 {{PLURAL:$2|byte|bytes}}', 'limitreport-templateargumentsize' => 'Argumento del tamaño de la plantilla', 'limitreport-templateargumentsize-value' => '$1/$2 {{PLURAL:$2|byte|bytes}}', 'limitreport-expansiondepth' => 'Profundidad máxima de expansión', 'limitreport-expensivefunctioncount' => 'Cuenta de la funcion expansiva del analizador', # Special:ExpandTemplates 'expandtemplates' => 'Expandir plantillas', 'expand_templates_intro' => 'Esta página especial toma un texto wiki y expande todas sus plantillas recursivamente. También expande las funciones sintácticas como <code><nowiki>{{</nowiki>#language:…}}</code>, y variables como <code><nowiki>{{</nowiki>CURRENTDAY}}</code>. De hecho, expande casi cualquier cosa que esté entre llaves dobles.', 'expand_templates_title' => 'Título de la página, útil para expandir <nowiki>{{PAGENAME}}</nowiki> o similares', 'expand_templates_input' => 'Texto a expandir:', 'expand_templates_output' => 'Resultado:', 'expand_templates_xml_output' => 'Salida XML', 'expand_templates_html_output' => 'Salida HTML en crudo', 'expand_templates_ok' => 'Aceptar', 'expand_templates_remove_comments' => 'Eliminar comentarios (<!-- ... -->)', 'expand_templates_remove_nowiki' => 'Suprimir <nowiki> etiquetas en resultado', 'expand_templates_generate_xml' => 'Mostrar el árbol XML.', 'expand_templates_generate_rawhtml' => 'Mostrar HTML en crudo', 'expand_templates_preview' => 'Previsualización', # Unknown messages 'uploadinvalidxml' => 'No se pudo analizar el XML del archivo cargado.', ); // Changes by Gershon Bialer to fix image namespace $namespaceNames[NS_FILE] = 'Imagen'; $namespaceNames[NS_FILE_TALK] = 'Imagen_discusión'; unset($namespaceAliases['Imagen']); unset($namespaceAliases['Imagen_Discusión']); $namespaceAliases['Archivo'] = NS_FILE; $namespaceAliases['Archivo_Discusión'] = NS_FILE_TALK;
legoktm/wikihow-src
languages/messages/MessagesEs.php
PHP
gpl-2.0
270,207
<?php function tie_home_tabs(){ $home_tabs_active = tie_get_option('home_tabs_box'); $home_tabs = tie_get_option('home_tabs'); $Posts = 5; if( $home_tabs_active && $home_tabs ): ?> <div id="cats-tabs-box" class="cat-box-content clear cat-box"> <div class="cat-tabs-header"> <ul> <?php foreach ($home_tabs as $cat ) { ?> <li><a href="#catab<?php echo $cat; ?>"><?php echo get_the_category_by_ID($cat) ?></a></li> <?php } ?> </ul> </div> <?php $cat_num = 0; foreach ($home_tabs as $cat ) { $count = 0; $cat_num ++; $cat_query = new WP_Query('cat='.$cat.'&posts_per_page='.$Posts); ?> <div id="catab<?php echo $cat; ?>" class="cat-tabs-wrap cat-tabs-wrap<?php echo $cat_num; ?>"> <?php if($cat_query->have_posts()): ?> <ul> <?php while ( $cat_query->have_posts() ) : $cat_query->the_post(); $count ++ ;?> <?php if($count == 1) : ?> <li <?php tie_post_class('first-news'); ?>> <?php if ( function_exists("has_post_thumbnail") && has_post_thumbnail() ) : ?> <div class="post-thumbnail"> <a href="<?php the_permalink(); ?>" title="<?php printf( esc_attr__( 'Permalink to %s', 'tie' ), the_title_attribute( 'echo=0' ) ); ?>" rel="bookmark"> <?php tie_thumb( 'tie-medium' ); ?> <span class="overlay-icon"></span> </a> </div><!-- post-thumbnail /--> <?php endif; ?> <h2 class="post-box-title"><a href="<?php the_permalink(); ?>" title="<?php printf( esc_attr__( 'Permalink to %s', 'tie' ), the_title_attribute( 'echo=0' ) ); ?>" rel="bookmark"><?php the_title(); ?></a></h2> <?php get_template_part( 'includes/boxes-meta' ); ?> <div class="entry"> <?php tie_excerpt_home() ?> <a class="more-link" href="<?php the_permalink() ?>"><?php _e( 'Read More &raquo;', 'tie' ) ?></a> </div> </li><!-- .first-news --> <?php else: ?> <li <?php tie_post_class(); ?>> <?php if ( function_exists("has_post_thumbnail") && has_post_thumbnail() ) : ?> <div class="post-thumbnail"> <a href="<?php the_permalink(); ?>" title="<?php printf( esc_attr__( 'Permalink to %s', 'tie' ), the_title_attribute( 'echo=0' ) ); ?>" rel="bookmark"><?php tie_thumb(); ?><span class="overlay-icon"></span></a> </div><!-- post-thumbnail /--> <?php endif; ?> <h3 class="post-box-title"><a href="<?php the_permalink(); ?>" title="<?php printf( esc_attr__( 'Permalink to %s', 'tie' ), the_title_attribute( 'echo=0' ) ); ?>" rel="bookmark"><?php the_title(); ?></a></h3> <?php get_template_part( 'includes/boxes-meta' ); ?> </li> <?php endif; ?> <?php endwhile;?> </ul> <div class="clear"></div> <?php endif; ?> </div> <?php } ?> </div><!-- #cats-tabs-box /--> <?php endif; } ?>
shiedman/wordpress
wp-content/themes/sahifa/functions/home-cat-tabs.php
PHP
gpl-2.0
2,817
/* This file is part of Cyclos (www.cyclos.org). A project of the Social Trade Organisation (www.socialtrade.org). Cyclos is free software; you can redistribute it and/or modify it under the terms of the GNU General Public License as published by the Free Software Foundation; either version 2 of the License, or (at your option) any later version. Cyclos is distributed in the hope that it will be useful, but WITHOUT ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License for more details. You should have received a copy of the GNU General Public License along with Cyclos; if not, write to the Free Software Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA */ package nl.strohalm.cyclos.controls.reports.members.transactions; import java.util.Collection; import java.util.Map; import nl.strohalm.cyclos.entities.accounts.AccountType; import nl.strohalm.cyclos.entities.accounts.transactions.PaymentFilter; import nl.strohalm.cyclos.entities.groups.MemberGroup; import nl.strohalm.cyclos.utils.DataObject; import nl.strohalm.cyclos.entities.utils.Period; public class MembersTransactionsReportDTO extends DataObject { public static enum DetailsLevel { SUMMARY, TRANSACTIONS; } private static final long serialVersionUID = -5856820625601506756L; private boolean memberName; private boolean brokerUsername; private boolean brokerName; private Collection<AccountType> accountTypes; private Collection<MemberGroup> memberGroups; private Period period; private boolean incomingTransactions; private boolean outgoingTransactions; private boolean includeNoTraders; private DetailsLevel detailsLevel; private Collection<PaymentFilter> transactionsPaymentFilters; private Map<PaymentFilter, Integer> transactionsColSpan; private Map<AccountType, Collection<PaymentFilter>> paymentFiltersByAccountType; public Collection<AccountType> getAccountTypes() { return accountTypes; } public int getBrokerColSpan() { int colspan = 0; if (isBrokerName()) { colspan++; } if (isBrokerUsername()) { colspan++; } return colspan; } public DetailsLevel getDetailsLevel() { return detailsLevel; } public int getMemberColSpan() { if (isMemberName()) { return 2; } else { return 1; } } public Collection<MemberGroup> getMemberGroups() { return memberGroups; } public Map<AccountType, Collection<PaymentFilter>> getPaymentFiltersByAccountType() { return paymentFiltersByAccountType; } public Period getPeriod() { return period; } public Map<PaymentFilter, Integer> getTransactionsColSpan() { return transactionsColSpan; } public Collection<PaymentFilter> getTransactionsPaymentFilters() { return transactionsPaymentFilters; } public boolean isBrokerName() { return brokerName; } public boolean isBrokerUsername() { return brokerUsername; } public boolean isDebitsAndCredits() { return isIncomingTransactions() && isOutgoingTransactions(); } public boolean isIncludeNoTraders() { return includeNoTraders; } public boolean isIncomingTransactions() { return incomingTransactions; } public boolean isMemberName() { return memberName; } public boolean isOutgoingTransactions() { return outgoingTransactions; } public boolean isTransactions() { return isIncomingTransactions() || isOutgoingTransactions(); } public void setAccountTypes(final Collection<AccountType> accountTypes) { this.accountTypes = accountTypes; } public void setBrokerName(final boolean brokerName) { this.brokerName = brokerName; } public void setBrokerUsername(final boolean brokerUsername) { this.brokerUsername = brokerUsername; } public void setDetailsLevel(final DetailsLevel detailsLevel) { this.detailsLevel = detailsLevel; } public void setIncludeNoTraders(final boolean includeNoTraders) { this.includeNoTraders = includeNoTraders; } public void setIncomingTransactions(final boolean incomingTransactions) { this.incomingTransactions = incomingTransactions; } public void setMemberGroups(final Collection<MemberGroup> memberGroups) { this.memberGroups = memberGroups; } public void setMemberName(final boolean memberName) { this.memberName = memberName; } public void setOutgoingTransactions(final boolean outgoingTransactions) { this.outgoingTransactions = outgoingTransactions; } public void setPaymentFiltersByAccountType(final Map<AccountType, Collection<PaymentFilter>> paymentFiltersByAccountType) { this.paymentFiltersByAccountType = paymentFiltersByAccountType; } public void setPeriod(final Period period) { this.period = period; } public void setTransactionsColSpan(final Map<PaymentFilter, Integer> transactionsColSpan) { this.transactionsColSpan = transactionsColSpan; } public void setTransactionsPaymentFilters(final Collection<PaymentFilter> transactionsPaymentFilters) { this.transactionsPaymentFilters = transactionsPaymentFilters; } }
mateli/OpenCyclos
src/main/java/nl/strohalm/cyclos/controls/reports/members/transactions/MembersTransactionsReportDTO.java
Java
gpl-2.0
5,944
<?php /* * Old Pricing Table */ /* vc_map( array( 'name' =>'Webnus PricingTable', 'base' => 'pricing_table', 'category' => __( 'Webnus Shortcodes', 'WEBNUS_TEXT_DOMAIN' ), 'params' => array( array( 'type' => 'textfield', 'heading' => __( 'Title', 'WEBNUS_TEXT_DOMAIN' ), 'param_name' => 'title', 'value' => 'Title', 'description' => __( 'Enter the Pricing Table Title', 'WEBNUS_TEXT_DOMAIN') ), array( 'type' => 'textfield', 'heading' => __( 'Price', 'WEBNUS_TEXT_DOMAIN' ), 'param_name' => 'price', 'value' => '$30', 'description' => __( 'Enter the Pricing Table Price', 'WEBNUS_TEXT_DOMAIN') ), array( 'type' => 'textfield', 'heading' => __( 'Period', 'WEBNUS_TEXT_DOMAIN' ), 'param_name' => 'period', 'value' => '/Month', 'description' => __( 'Enter the Pricing Table Period', 'WEBNUS_TEXT_DOMAIN') ), array( 'type' => 'textfield', 'heading' => __( 'Link URL', 'WEBNUS_TEXT_DOMAIN' ), 'param_name' => 'link', 'value' => '#', 'description' => __( 'Enter the Pricing Table Link URL', 'WEBNUS_TEXT_DOMAIN') ), array( 'type' => 'textfield', 'heading' => __( 'Link Title', 'WEBNUS_TEXT_DOMAIN' ), 'param_name' => 'link_title', 'value' => 'Order Now', 'description' => __( 'Enter the Pricing Table Link Text', 'WEBNUS_TEXT_DOMAIN') ), array( 'type' => 'textarea_html', 'heading' => __( 'Table Items', 'WEBNUS_TEXT_DOMAIN' ), 'param_name' => 'content', 'value' => '[price_item]2 Users[/price_item][price_item]100 mb Disk space[/price_item][price_item]20 Gig Data transfer[/price_item][price_item]Starter Admin Panel[/price_item][price_item]- APIs[/price_item][price_item]Email Support[/price_item]', 'description' => __( 'Enter the Pricing Table Content, [price_item] Acceptable', 'WEBNUS_TEXT_DOMAIN') ), ), ) ); */ global $wpdb; $query = "SELECT option_name FROM {$wpdb->options} WHERE option_name LIKE 'css3_grid_shortcode_settings%' ORDER BY option_name"; $pricing_tables_list = $wpdb->get_results($query); $css3GridAllShortcodeIds = array(); foreach($pricing_tables_list as $pricing_table) $css3GridAllShortcodeIds[] = substr($pricing_table->option_name,29,strlen($pricing_table->option_name)); sort($css3GridAllShortcodeIds); vc_map( array( 'name' =>'Webnus Css3PricingTable', 'base' => 'css3_grid', "description" => "Pricing table", "icon" => "webnus_pricingtable", 'category' => __( 'Webnus Shortcodes', 'WEBNUS_TEXT_DOMAIN' ), 'params' => array( array( 'type' => 'dropdown', 'heading' => __( 'Pricing table ID', 'WEBNUS_TEXT_DOMAIN' ), 'param_name' => 'id', 'value' => $css3GridAllShortcodeIds, 'description' => __( 'Select the pricing table ID', 'WEBNUS_TEXT_DOMAIN') ), ), ) ); ?>
anujsm/test
wp-content/themes/florida-wp/inc/visualcomposer/shortcodes/12-pricingtable.php
PHP
gpl-2.0
3,222
// Copyright (c) 2015 The Chromium Embedded Framework Authors. All rights // reserved. Use of this source code is governed by a BSD-style license that // can be found in the LICENSE file. #include "Chiika/browser/preferences_test.h" #include <sstream> #include <string> #include <vector> #include "include/base/cef_logging.h" #include "include/cef_command_line.h" #include "include/cef_parser.h" namespace client { namespace preferences_test { namespace { const char kTestUrl[] = "http://tests/preferences"; // Application-specific error codes. const int kMessageFormatError = 1; const int kPreferenceApplicationError = 1; // Common to all messages. const char kNameKey[] = "name"; const char kNameValueGet[] = "preferences_get"; const char kNameValueSet[] = "preferences_set"; const char kNameValueState[] = "preferences_state"; // Used with "preferences_get" messages. const char kIncludeDefaultsKey[] = "include_defaults"; // Used with "preferences_set" messages. const char kPreferencesKey[] = "preferences"; // Handle messages in the browser process. Only accessed on the UI thread. class Handler : public CefMessageRouterBrowserSide::Handler { public: typedef std::vector<std::string> NameVector; Handler() { CEF_REQUIRE_UI_THREAD(); } // Called due to cefQuery execution in preferences.html. bool OnQuery(CefRefPtr<CefBrowser> browser, CefRefPtr<CefFrame> frame, int64 query_id, const CefString& request, bool persistent, CefRefPtr<Callback> callback) OVERRIDE { CEF_REQUIRE_UI_THREAD(); // Only handle messages from the test URL. std::string url = frame->GetURL(); if (url.find(kTestUrl) != 0) return false; // Parse |request| as a JSON dictionary. CefRefPtr<CefDictionaryValue> request_dict = ParseJSON(request); if (!request_dict) { callback->Failure(kMessageFormatError, "Incorrect message format"); return true; } // Verify the "name" key. if (!VerifyKey(request_dict, kNameKey, VTYPE_STRING, callback)) return true; const std::string& message_name = request_dict->GetString(kNameKey); if (message_name == kNameValueGet) { // JavaScript is requesting a JSON representation of the preferences tree. // Verify the "include_defaults" key. if (!VerifyKey(request_dict, kIncludeDefaultsKey, VTYPE_BOOL, callback)) return true; const bool include_defaults = request_dict->GetBool(kIncludeDefaultsKey); OnPreferencesGet(browser, include_defaults, callback); return true; } else if (message_name == kNameValueSet) { // JavaScript is requesting that preferences be updated to match the // specified JSON representation. // Verify the "preferences" key. if (!VerifyKey(request_dict, kPreferencesKey, VTYPE_DICTIONARY, callback)) return true; CefRefPtr<CefDictionaryValue> preferences = request_dict->GetDictionary(kPreferencesKey); OnPreferencesSet(browser, preferences, callback); return true; } else if (message_name == kNameValueState) { // JavaScript is requesting global state information. OnPreferencesState(browser, callback); return true; } return false; } private: // Execute |callback| with the preferences dictionary as a JSON string. static void OnPreferencesGet(CefRefPtr<CefBrowser> browser, bool include_defaults, CefRefPtr<Callback> callback) { CefRefPtr<CefRequestContext> context = browser->GetHost()->GetRequestContext(); // Retrieve all preference values. CefRefPtr<CefDictionaryValue> prefs = context->GetAllPreferences(include_defaults); // Serialize the preferences to JSON and return to the JavaScript caller. callback->Success(GetJSON(prefs)); } // Set preferences based on the contents of |preferences|. Execute |callback| // with a descriptive result message. static void OnPreferencesSet(CefRefPtr<CefBrowser> browser, CefRefPtr<CefDictionaryValue> preferences, CefRefPtr<Callback> callback) { CefRefPtr<CefRequestContext> context = browser->GetHost()->GetRequestContext(); CefRefPtr<CefValue> value = CefValue::Create(); value->SetDictionary(preferences); std::string error; NameVector changed_names; // Apply preferences. This may result in errors. const bool success = ApplyPrefs(context, std::string(), value, error, changed_names); // Create a message that accurately represents the result. std::string message; if (!changed_names.empty()) { std::stringstream ss; ss << "Successfully changed " << changed_names.size() << " preferences; "; for (size_t i = 0; i < changed_names.size(); ++i) { ss << changed_names[i]; if (i < changed_names.size() - 1) ss << ", "; } message = ss.str(); } if (!success) { DCHECK(!error.empty()); if (!message.empty()) message += "\n"; message += error; } if (changed_names.empty()) { if (!message.empty()) message += "\n"; message += "No preferences changed."; } // Return the message to the JavaScript caller. if (success) callback->Success(message); else callback->Failure(kPreferenceApplicationError, message); } // Execute |callback| with the global state dictionary as a JSON string. static void OnPreferencesState(CefRefPtr<CefBrowser> browser, CefRefPtr<Callback> callback) { CefRefPtr<CefCommandLine> command_line = CefCommandLine::GetGlobalCommandLine(); CefRefPtr<CefDictionaryValue> dict = CefDictionaryValue::Create(); // If spell checking is disabled via the command-line then it cannot be // enabled via preferences. dict->SetBool("spellcheck_disabled", command_line->HasSwitch("disable-spell-checking")); // If proxy settings are configured via the command-line then they cannot // be modified via preferences. dict->SetBool("proxy_configured", command_line->HasSwitch("no-proxy-server") || command_line->HasSwitch("proxy-auto-detect") || command_line->HasSwitch("proxy-pac-url") || command_line->HasSwitch("proxy-server")); // If allow running insecure content is enabled via the command-line then it // cannot be enabled via preferences. dict->SetBool("allow_running_insecure_content", command_line->HasSwitch("allow-running-insecure-content")); // Serialize the state to JSON and return to the JavaScript caller. callback->Success(GetJSON(dict)); } // Convert a JSON string to a dictionary value. static CefRefPtr<CefDictionaryValue> ParseJSON(const CefString& string) { CefRefPtr<CefValue> value = CefParseJSON(string, JSON_PARSER_RFC); if (value.get() && value->GetType() == VTYPE_DICTIONARY) return value->GetDictionary(); return NULL; } // Convert a dictionary value to a JSON string. static CefString GetJSON(CefRefPtr<CefDictionaryValue> dictionary) { CefRefPtr<CefValue> value = CefValue::Create(); value->SetDictionary(dictionary); return CefWriteJSON(value, JSON_WRITER_DEFAULT); } // Verify that |key| exists in |dictionary| and has type |value_type|. Fails // |callback| and returns false on failure. static bool VerifyKey(CefRefPtr<CefDictionaryValue> dictionary, const char* key, cef_value_type_t value_type, CefRefPtr<Callback> callback) { if (!dictionary->HasKey(key) || dictionary->GetType(key) != value_type) { callback->Failure(kMessageFormatError, "Missing or incorrectly formatted message key: " + std::string(key)); return false; } return true; } // Apply preferences. Returns true on success. Returns false and sets |error| // to a descriptive error string on failure. |changed_names| is the list of // preferences that were successfully changed. static bool ApplyPrefs(CefRefPtr<CefRequestContext> context, const std::string& name, CefRefPtr<CefValue> value, std::string& error, NameVector& changed_names) { if (!name.empty() && context->HasPreference(name)) { // The preference exists. Set the value. return SetPref(context, name, value, error, changed_names); } if (value->GetType() == VTYPE_DICTIONARY) { // A dictionary type value that is not an existing preference. Try to set // each of the elements individually. CefRefPtr<CefDictionaryValue> dict = value->GetDictionary(); CefDictionaryValue::KeyList keys; dict->GetKeys(keys); for (size_t i = 0; i < keys.size(); ++i) { const std::string& key = keys[i]; const std::string& current_name = name.empty() ? key : name + "." + key; if (!ApplyPrefs(context, current_name, dict->GetValue(key), error, changed_names)) { return false; } } return true; } error = "Trying to create an unregistered preference: " + name; return false; } // Set a specific preference value. Returns true if the value is set // successfully or has not changed. If the value has changed then |name| will // be added to |changed_names|. Returns false and sets |error| to a // descriptive error string on failure. static bool SetPref(CefRefPtr<CefRequestContext> context, const std::string& name, CefRefPtr<CefValue> value, std::string& error, NameVector& changed_names) { CefRefPtr<CefValue> existing_value = context->GetPreference(name); DCHECK(existing_value); if (value->GetType() == VTYPE_STRING && existing_value->GetType() != VTYPE_STRING) { // Since |value| is coming from JSON all basic types will be represented // as strings. Convert to the expected data type. const std::string& string_val = value->GetString(); switch (existing_value->GetType()) { case VTYPE_BOOL: if (string_val == "true" || string_val == "1") value->SetBool(true); else if (string_val == "false" || string_val == "0") value->SetBool(false); break; case VTYPE_INT: value->SetInt(atoi(string_val.c_str())); break; case VTYPE_DOUBLE: value->SetInt(atof(string_val.c_str())); break; default: // Other types cannot be converted. break; } } // Nothing to do if the value hasn't changed. if (existing_value->IsEqual(value)) return true; // Attempt to set the preference. CefString error_str; if (!context->SetPreference(name, value, error_str)) { error = error_str.ToString() + ": " + name; return false; } // The preference was set successfully. changed_names.push_back(name); return true; } DISALLOW_COPY_AND_ASSIGN(Handler); }; } // namespace void CreateMessageHandlers(test_runner::MessageHandlerSet& handlers) { handlers.insert(new Handler()); } } // namespace preferences_test } // namespace client
arkenthera/ChiikaCef
Chiika/browser/preferences_test.cc
C++
gpl-2.0
11,565
using System; using System.Collections.Generic; using System.Linq; using System.Runtime.Serialization; using System.Text; using System.Threading.Tasks; namespace AutomationService.Data.DynamicDataItem { public delegate void LogMessageFn(String xsMessage); [DataContract] public class ExecutionJobEnvironment { // Visible for debugging public Stack<DataItemComposite> aoDataStack; // Debugging public List<DataItemComposite> aoDebuggingStack; // Logging messages public LogMessageFn oLogMessage; public ExecutionJobEnvironment(LogMessageFn xoLoggingFunction) { oLogMessage = xoLoggingFunction; aoDataStack = new Stack<DataItemComposite>(); aoDebuggingStack = new List<DataItemComposite>(); } public void PushDataContainer(DataItemComposite xoContainer) { aoDataStack.Push(xoContainer); aoDebuggingStack.Add(xoContainer); } public DataItemComposite PeekDataContainer() { return aoDataStack.Peek(); } public DataItemComposite PopDataContainer() { return aoDataStack.Pop(); } } }
Aegz/AutomationSuite
AutomationBackEnd/Data/DynamicDataItem/ExecutionJobEnvironment.cs
C#
gpl-2.0
1,236
<?php if($mylayout == 'empty') include('emptypage-layout.php'); if( $mylayout == 'blankempty') include('blankemptypage-layout.php'); if($mylayout == 'client') include('client-layout.php'); ?>
narasimha99/medbid
wp-content/plugins/networklocum/app/views/layouts/public.php
PHP
gpl-2.0
196
<?php namespace ascio\v3; class PollQueue { /** * @var PollQueueRequest $request */ protected $request = null; /** * @param PollQueueRequest $request */ public function __construct($request) { $this->request = $request; } /** * @return PollQueueRequest */ public function getRequest() { return $this->request; } /** * @param PollQueueRequest $request * @return \ascio\v3\PollQueue */ public function setRequest($request) { $this->request = $request; return $this; } }
rendermani/ascio-php-examples
aws-v3/service/PollQueue.php
PHP
gpl-2.0
639
# -*- coding: utf-8 -*- """ logol_analyse provide some analyse tools for logol xml results. Without any option, it will provide the number of hit, how many sequences have at least one hit, and a graph with the repartition of the hits. Usage: logol_analyse.py <input> <data> [options] options: --graph, -g=<name> The graph name, to save it directly. --help, -h It call help. UNBELIEVABLE!!!!! --nograph -n No graph creation --origin, -o INT The 0 emplacement on sequences [default: 150] --position -p=<name> Return a file containing position of each motif --result -r=<name> Save a fasta file with the matched sequences. --signature, -s=<name> Create a file with for each sequences the hits. --hits, -t Display a hits/sequences graph. --version, -v Maybe it's a trap ^^ --xclude, -x=<name> Create a file containing all unmatched sequences """ ########## # IMPORT # ########## import matplotlib.pyplot as plt import pylab import glob import os from docopt import docopt from lxml import etree from Bio import SeqIO ############# # ARGUMENTS # ############# if __name__ == '__main__': arguments = docopt(__doc__, version = '1.3') ######## # MAIN # ######## def __main__(arguments): total = 0 count = 0 hit = [] se = set() # Contain sequences header hits_per_seq = [] # Here we check all the .xml file for f in glob.glob(os.getcwd()+"/"+arguments['<input>']+"*.xml"): nb_hit = 0 total += 1 tree = etree.parse(f) # Collect of the hit beginning and ID for seq in tree.xpath("/sequences/match/begin"): count += 1 nb_hit +=1 hit.append(int(seq.text)-int(arguments['--origin'])) [se.add(a.text) for a in tree.xpath("/sequences/fastaHeader")] if nb_hit > 0: hits_per_seq.append(nb_hit) print("Nombre de hits: "+str(count)) print("Nombre de séquences touchées: "+str(len(se))+" sur "+str(total)) print("Nombre max de hits par séquences: "+str(max(hits_per_seq))) if arguments['--result'] != None: seq_match(se) if arguments['--xclude'] != None: seq_no_match(se) if arguments['--nograph'] == False: graph(hit) if arguments['--signature'] != None: save_signature() if arguments['--position'] != None: save_position() if arguments['--hits'] != False: display_hits(hits_per_seq) ############# # FUNCTIONS # ############# def seq_match(seq): out = open(os.getcwd()+'/'+arguments['--result'], 'w') data = open(os.getcwd()+'/'+arguments['<data>'], "rU") for s in SeqIO.parse(data, "fasta"): if s.id in seq: out.write(s.format("fasta")) out.close() data.close() def seq_no_match(seq): out = open(os.getcwd()+'/'+arguments['--xclude'], 'w') data = open(os.getcwd()+'/'+arguments['<data>'], "rU") for s in SeqIO.parse(data, "fasta"): if s.id not in seq: out.write(s.format("fasta")) out.close() data.close() def graph(hit): plt.hist(hit, range(min(hit), max(hit))) plt.xticks(range(min(hit), max(hit), 10)) plt.xlabel("Emplacement des hits sur les séquences") plt.ylabel("Nombre de hits") if arguments['--graph'] != None: plt.savefig(arguments['--graph']+'.png') pylab.close() else: plt.show() def save_signature(): sign = open(os.getcwd()+'/'+arguments['--signature'], 'w') for f in glob.glob(os.getcwd()+"/"+arguments['<input>']+"*"): fr = [] # Will have the last char of var, which is frag nb c = 0 tree = etree.parse(f) if tree.xpath("/sequences/match/variable") != []: [sign.write('>'+h.text+'\n') for h in tree.xpath("/sequences/fastaHeader")] [fr.append((int(i.get("name")[-1]))) for i in tree.xpath("/sequences/match/variable")] m = max(fr) # Fragments number to have the complete match for i in tree.xpath("/sequences/match/variable/content"): c += 1 sign.write(i.text) if c >= m: sign.write("\n") c = 0 sign.close() def save_position(): begin = [] # Will contain all the begining number end = [] seq = [] # Will contain all the sequences found iD = [] # Will contair the sequences ID n = 0 # nb of line we will have to write i = 0 pos = open(os.getcwd()+'/'+arguments['--position'], 'w') pos.write("ID\tbegin\tsequence\tend\n") for f in glob.glob(os.getcwd()+"/"+arguments['<input>']+"*"): tree = etree.parse(f) for s in tree.xpath("/sequences/match/variable/content"): n += 1 seq.append(s.text) [iD.append(h.text) for h in tree.xpath("/sequences/fastaHeader")] for b in tree.xpath("/sequences/match/variable/begin"): begin.append(str(b.text)) for e in tree.xpath("/sequences/match/variable/end"): end.append(str(e.text)) # Now, we write those info into the file while i < n: pos.write(iD[i]+"\t"+begin[i]+"\t"+seq[i]+"\t"+end[i]+"\n") i += 1 pos.close() def display_hits(hits_per_seq): plt.hist(hits_per_seq, range(min(hits_per_seq), max(hits_per_seq))) plt.xticks(range(min(hits_per_seq), max(hits_per_seq), 1)) plt.xlabel("Nombre de hits par séquences") plt.ylabel("Nombre de séquences") plt.show() ########## # LAUNCH # ########## __main__(arguments)
Nedgang/logol_analyse
analyse_logol.py
Python
gpl-2.0
5,660
//======================================================================== // // SplashOutputDev.cc // // Copyright 2003 Glyph & Cog, LLC // //======================================================================== //======================================================================== // // Modified under the Poppler project - http://poppler.freedesktop.org // // All changes made under the Poppler project to this file are licensed // under GPL version 2 or later // // Copyright (C) 2005 Takashi Iwai <tiwai@suse.de> // Copyright (C) 2006 Stefan Schweizer <genstef@gentoo.org> // Copyright (C) 2006-2014 Albert Astals Cid <aacid@kde.org> // Copyright (C) 2006 Krzysztof Kowalczyk <kkowalczyk@gmail.com> // Copyright (C) 2006 Scott Turner <scotty1024@mac.com> // Copyright (C) 2007 Koji Otani <sho@bbr.jp> // Copyright (C) 2009 Petr Gajdos <pgajdos@novell.com> // Copyright (C) 2009-2014 Thomas Freitag <Thomas.Freitag@alfa.de> // Copyright (C) 2009 Carlos Garcia Campos <carlosgc@gnome.org> // Copyright (C) 2009 William Bader <williambader@hotmail.com> // Copyright (C) 2010 Patrick Spendrin <ps_ml@gmx.de> // Copyright (C) 2010 Brian Cameron <brian.cameron@oracle.com> // Copyright (C) 2010 Paweł Wiejacha <pawel.wiejacha@gmail.com> // Copyright (C) 2010 Christian Feuersänger <cfeuersaenger@googlemail.com> // Copyright (C) 2011 Andreas Hartmetz <ahartmetz@gmail.com> // Copyright (C) 2011 Andrea Canciani <ranma42@gmail.com> // Copyright (C) 2011, 2012 Adrian Johnson <ajohnson@redneon.com> // Copyright (C) 2013 Lu Wang <coolwanglu@gmail.com> // Copyright (C) 2013 Li Junling <lijunling@sina.com> // Copyright (C) 2014 Ed Porras <ed@moto-research.com> // // To see a description of the changes please see the Changelog file that // came with your tarball or type make ChangeLog if you are building from git // //======================================================================== #include <config.h> #ifdef USE_GCC_PRAGMAS #pragma implementation #endif #include <string.h> #include <math.h> #include "goo/gfile.h" #include "GlobalParams.h" #include "Error.h" #include "Object.h" #include "Gfx.h" #include "GfxFont.h" #include "Page.h" #include "PDFDoc.h" #include "Link.h" #include "FontEncodingTables.h" #include "fofi/FoFiTrueType.h" #include "splash/SplashBitmap.h" #include "splash/SplashGlyphBitmap.h" #include "splash/SplashPattern.h" #include "splash/SplashScreen.h" #include "splash/SplashPath.h" #include "splash/SplashState.h" #include "splash/SplashErrorCodes.h" #include "splash/SplashFontEngine.h" #include "splash/SplashFont.h" #include "splash/SplashFontFile.h" #include "splash/SplashFontFileID.h" #include "splash/Splash.h" #include "SplashOutputDev.h" #ifdef VMS #if (__VMS_VER < 70000000) extern "C" int unlink(char *filename); #endif #endif #ifdef _MSC_VER #include <float.h> #define isfinite(x) _finite(x) #endif #ifdef __sun #include <ieeefp.h> #define isfinite(x) finite(x) #endif static inline void convertGfxColor(SplashColorPtr dest, SplashColorMode colorMode, GfxColorSpace *colorSpace, GfxColor *src) { SplashColor color; GfxGray gray; GfxRGB rgb; #if SPLASH_CMYK GfxCMYK cmyk; GfxColor deviceN; #endif // make gcc happy color[0] = color[1] = color[2] = 0; #if SPLASH_CMYK color[3] = 0; #endif switch (colorMode) { case splashModeMono1: case splashModeMono8: colorSpace->getGray(src, &gray); color[0] = colToByte(gray); break; case splashModeXBGR8: color[3] = 255; case splashModeBGR8: case splashModeRGB8: colorSpace->getRGB(src, &rgb); color[0] = colToByte(rgb.r); color[1] = colToByte(rgb.g); color[2] = colToByte(rgb.b); break; #if SPLASH_CMYK case splashModeCMYK8: colorSpace->getCMYK(src, &cmyk); color[0] = colToByte(cmyk.c); color[1] = colToByte(cmyk.m); color[2] = colToByte(cmyk.y); color[3] = colToByte(cmyk.k); break; case splashModeDeviceN8: colorSpace->getDeviceN(src, &deviceN); for (int i = 0; i < SPOT_NCOMPS + 4; i++) color[i] = colToByte(deviceN.c[i]); break; #endif } splashColorCopy(dest, color); } //------------------------------------------------------------------------ // SplashGouraudPattern //------------------------------------------------------------------------ SplashGouraudPattern::SplashGouraudPattern(GBool bDirectColorTranslationA, GfxState *stateA, GfxGouraudTriangleShading *shadingA, SplashColorMode modeA) { SplashColor defaultColor; GfxColor srcColor; state = stateA; shading = shadingA; mode = modeA; bDirectColorTranslation = bDirectColorTranslationA; shadingA->getColorSpace()->getDefaultColor(&srcColor); convertGfxColor(defaultColor, mode, shadingA->getColorSpace(), &srcColor); gfxMode = shadingA->getColorSpace()->getMode(); } SplashGouraudPattern::~SplashGouraudPattern() { } void SplashGouraudPattern::getParameterizedColor(double colorinterp, SplashColorMode mode, SplashColorPtr dest) { GfxColor src; GfxColorSpace* srcColorSpace = shading->getColorSpace(); int colorComps = 3; #if SPLASH_CMYK if (mode == splashModeCMYK8) colorComps=4; else if (mode == splashModeDeviceN8) colorComps=4 + SPOT_NCOMPS; #endif shading->getParameterizedColor(colorinterp, &src); if (bDirectColorTranslation) { for (int m = 0; m < colorComps; ++m) dest[m] = colToByte(src.c[m]); } else { convertGfxColor(dest, mode, srcColorSpace, &src); } } //------------------------------------------------------------------------ // SplashUnivariatePattern //------------------------------------------------------------------------ SplashUnivariatePattern::SplashUnivariatePattern(SplashColorMode colorModeA, GfxState *stateA, GfxUnivariateShading *shadingA) { Matrix ctm; double xMin, yMin, xMax, yMax; shading = shadingA; state = stateA; colorMode = colorModeA; state->getCTM(&ctm); ctm.invertTo(&ictm); // get the function domain t0 = shading->getDomain0(); t1 = shading->getDomain1(); dt = t1 - t0; stateA->getUserClipBBox(&xMin, &yMin, &xMax, &yMax); shadingA->setupCache(&ctm, xMin, yMin, xMax, yMax); gfxMode = shadingA->getColorSpace()->getMode(); } SplashUnivariatePattern::~SplashUnivariatePattern() { } GBool SplashUnivariatePattern::getColor(int x, int y, SplashColorPtr c) { GfxColor gfxColor; double xc, yc, t; ictm.transform(x, y, &xc, &yc); if (! getParameter (xc, yc, &t)) return gFalse; shading->getColor(t, &gfxColor); convertGfxColor(c, colorMode, shading->getColorSpace(), &gfxColor); return gTrue; } GBool SplashUnivariatePattern::testPosition(int x, int y) { double xc, yc, t; ictm.transform(x, y, &xc, &yc); if (! getParameter (xc, yc, &t)) return gFalse; return (t0 < t1) ? (t > t0 && t < t1) : (t > t1 && t < t0); } //------------------------------------------------------------------------ // SplashRadialPattern //------------------------------------------------------------------------ #define RADIAL_EPSILON (1. / 1024 / 1024) SplashRadialPattern::SplashRadialPattern(SplashColorMode colorModeA, GfxState *stateA, GfxRadialShading *shadingA): SplashUnivariatePattern(colorModeA, stateA, shadingA) { SplashColor defaultColor; GfxColor srcColor; shadingA->getCoords(&x0, &y0, &r0, &dx, &dy, &dr); dx -= x0; dy -= y0; dr -= r0; a = dx*dx + dy*dy - dr*dr; if (fabs(a) > RADIAL_EPSILON) inva = 1.0 / a; shadingA->getColorSpace()->getDefaultColor(&srcColor); convertGfxColor(defaultColor, colorModeA, shadingA->getColorSpace(), &srcColor); } SplashRadialPattern::~SplashRadialPattern() { } GBool SplashRadialPattern::getParameter(double xs, double ys, double *t) { double b, c, s0, s1; // We want to solve this system of equations: // // 1. (x - xc(s))^2 + (y -yc(s))^2 = rc(s)^2 // 2. xc(s) = x0 + s * (x1 - xo) // 3. yc(s) = y0 + s * (y1 - yo) // 4. rc(s) = r0 + s * (r1 - ro) // // To simplify the system a little, we translate // our coordinates to have the origin in (x0,y0) xs -= x0; ys -= y0; // Then we have to solve the equation: // A*s^2 - 2*B*s + C = 0 // where // A = dx^2 + dy^2 - dr^2 // B = xs*dx + ys*dy + r0*dr // C = xs^2 + ys^2 - r0^2 b = xs*dx + ys*dy + r0*dr; c = xs*xs + ys*ys - r0*r0; if (fabs(a) <= RADIAL_EPSILON) { // A is 0, thus the equation simplifies to: // -2*B*s + C = 0 // If B is 0, we can either have no solution or an indeterminate // equation, thus we behave as if we had an invalid solution if (fabs(b) <= RADIAL_EPSILON) return gFalse; s0 = s1 = 0.5 * c / b; } else { double d; d = b*b - a*c; if (d < 0) return gFalse; d = sqrt (d); s0 = b + d; s1 = b - d; // If A < 0, one of the two solutions will have negative radius, // thus it will be ignored. Otherwise we know that s1 <= s0 // (because d >=0 implies b - d <= b + d), so if both are valid it // will be the true solution. s0 *= inva; s1 *= inva; } if (r0 + s0 * dr >= 0) { if (0 <= s0 && s0 <= 1) { *t = t0 + dt * s0; return gTrue; } else if (s0 < 0 && shading->getExtend0()) { *t = t0; return gTrue; } else if (s0 > 1 && shading->getExtend1()) { *t = t1; return gTrue; } } if (r0 + s1 * dr >= 0) { if (0 <= s1 && s1 <= 1) { *t = t0 + dt * s1; return gTrue; } else if (s1 < 0 && shading->getExtend0()) { *t = t0; return gTrue; } else if (s1 > 1 && shading->getExtend1()) { *t = t1; return gTrue; } } return gFalse; } #undef RADIAL_EPSILON //------------------------------------------------------------------------ // SplashAxialPattern //------------------------------------------------------------------------ SplashAxialPattern::SplashAxialPattern(SplashColorMode colorModeA, GfxState *stateA, GfxAxialShading *shadingA): SplashUnivariatePattern(colorModeA, stateA, shadingA) { SplashColor defaultColor; GfxColor srcColor; shadingA->getCoords(&x0, &y0, &x1, &y1); dx = x1 - x0; dy = y1 - y0; mul = 1 / (dx * dx + dy * dy); shadingA->getColorSpace()->getDefaultColor(&srcColor); convertGfxColor(defaultColor, colorModeA, shadingA->getColorSpace(), &srcColor); } SplashAxialPattern::~SplashAxialPattern() { } GBool SplashAxialPattern::getParameter(double xc, double yc, double *t) { double s; xc -= x0; yc -= y0; s = (xc * dx + yc * dy) * mul; if (0 <= s && s <= 1) { *t = t0 + dt * s; } else if (s < 0 && shading->getExtend0()) { *t = t0; } else if (s > 1 && shading->getExtend1()) { *t = t1; } else { return gFalse; } return gTrue; } //------------------------------------------------------------------------ // Type 3 font cache size parameters #define type3FontCacheAssoc 8 #define type3FontCacheMaxSets 8 #define type3FontCacheSize (128*1024) //------------------------------------------------------------------------ // Divide a 16-bit value (in [0, 255*255]) by 255, returning an 8-bit result. static inline Guchar div255(int x) { return (Guchar)((x + (x >> 8) + 0x80) >> 8); } #if SPLASH_CMYK #include "GfxState_helpers.h" //------------------------------------------------------------------------- // helper for Blend functions (convert CMYK to RGB, do blend, convert back) //------------------------------------------------------------------------- // based in GfxState.cc static void cmykToRGB(SplashColorPtr cmyk, SplashColor rgb) { double c, m, y, k, c1, m1, y1, k1, r, g, b; c = colToDbl(byteToCol(cmyk[0])); m = colToDbl(byteToCol(cmyk[1])); y = colToDbl(byteToCol(cmyk[2])); k = colToDbl(byteToCol(cmyk[3])); c1 = 1 - c; m1 = 1 - m; y1 = 1 - y; k1 = 1 - k; cmykToRGBMatrixMultiplication(c, m, y, k, c1, m1, y1, k1, r, g, b); rgb[0] = colToByte(clip01(dblToCol(r))); rgb[1] = colToByte(clip01(dblToCol(g))); rgb[2] = colToByte(clip01(dblToCol(b))); } static void rgbToCMYK(SplashColor rgb, SplashColorPtr cmyk) { GfxColorComp c, m, y, k; c = clip01(gfxColorComp1 - byteToCol(rgb[0])); m = clip01(gfxColorComp1 - byteToCol(rgb[1])); y = clip01(gfxColorComp1 - byteToCol(rgb[2])); k = c; if (m < k) { k = m; } if (y < k) { k = y; } cmyk[0] = colToByte(c - k); cmyk[1] = colToByte(m - k); cmyk[2] = colToByte(y - k); cmyk[3] = colToByte(k); } #endif //------------------------------------------------------------------------ // Blend functions //------------------------------------------------------------------------ static void splashOutBlendMultiply(SplashColorPtr src, SplashColorPtr dest, SplashColorPtr blend, SplashColorMode cm) { int i; #if SPLASH_CMYK if (cm == splashModeCMYK8 || cm == splashModeDeviceN8) { SplashColor rgbSrc; SplashColor rgbDest; SplashColor rgbBlend; cmykToRGB(src, rgbSrc); cmykToRGB(dest, rgbDest); for (i = 0; i < 3; ++i) { rgbBlend[i] = (rgbDest[i] * rgbSrc[i]) / 255; } rgbToCMYK(rgbBlend, blend); } else #endif { for (i = 0; i < splashColorModeNComps[cm]; ++i) { blend[i] = (dest[i] * src[i]) / 255; } } } static void splashOutBlendScreen(SplashColorPtr src, SplashColorPtr dest, SplashColorPtr blend, SplashColorMode cm) { int i; #if SPLASH_CMYK if (cm == splashModeCMYK8 || cm == splashModeDeviceN8) { SplashColor rgbSrc; SplashColor rgbDest; SplashColor rgbBlend; cmykToRGB(src, rgbSrc); cmykToRGB(dest, rgbDest); for (i = 0; i < 3; ++i) { rgbBlend[i] = rgbDest[i] + rgbSrc[i] - (rgbDest[i] * rgbSrc[i]) / 255; } rgbToCMYK(rgbBlend, blend); } else #endif { for (i = 0; i < splashColorModeNComps[cm]; ++i) { blend[i] = dest[i] + src[i] - (dest[i] * src[i]) / 255; } } } static void splashOutBlendOverlay(SplashColorPtr src, SplashColorPtr dest, SplashColorPtr blend, SplashColorMode cm) { int i; #if SPLASH_CMYK if (cm == splashModeCMYK8 || cm == splashModeDeviceN8) { SplashColor rgbSrc; SplashColor rgbDest; SplashColor rgbBlend; cmykToRGB(src, rgbSrc); cmykToRGB(dest, rgbDest); for (i = 0; i < 3; ++i) { rgbBlend[i] = rgbDest[i] < 0x80 ? (rgbSrc[i] * 2 * rgbDest[i]) / 255 : 255 - 2 * ((255 - rgbSrc[i]) * (255 - rgbDest[i])) / 255; } rgbToCMYK(rgbBlend, blend); } else #endif { for (i = 0; i < splashColorModeNComps[cm]; ++i) { blend[i] = dest[i] < 0x80 ? (src[i] * 2 * dest[i]) / 255 : 255 - 2 * ((255 - src[i]) * (255 - dest[i])) / 255; } } } static void splashOutBlendDarken(SplashColorPtr src, SplashColorPtr dest, SplashColorPtr blend, SplashColorMode cm) { int i; #if SPLASH_CMYK if (cm == splashModeCMYK8 || cm == splashModeDeviceN8) { SplashColor rgbSrc; SplashColor rgbDest; SplashColor rgbBlend; cmykToRGB(src, rgbSrc); cmykToRGB(dest, rgbDest); for (i = 0; i < 3; ++i) { rgbBlend[i] = rgbDest[i] < rgbSrc[i] ? rgbDest[i] : rgbSrc[i]; } rgbToCMYK(rgbBlend, blend); } else #endif { for (i = 0; i < splashColorModeNComps[cm]; ++i) { blend[i] = dest[i] < src[i] ? dest[i] : src[i]; } } } static void splashOutBlendLighten(SplashColorPtr src, SplashColorPtr dest, SplashColorPtr blend, SplashColorMode cm) { int i; #if SPLASH_CMYK if (cm == splashModeCMYK8 || cm == splashModeDeviceN8) { SplashColor rgbSrc; SplashColor rgbDest; SplashColor rgbBlend; cmykToRGB(src, rgbSrc); cmykToRGB(dest, rgbDest); for (i = 0; i < 3; ++i) { rgbBlend[i] = rgbDest[i] > rgbSrc[i] ? rgbDest[i] : rgbSrc[i]; } rgbToCMYK(rgbBlend, blend); } else #endif { for (i = 0; i < splashColorModeNComps[cm]; ++i) { blend[i] = dest[i] > src[i] ? dest[i] : src[i]; } } } static void splashOutBlendColorDodge(SplashColorPtr src, SplashColorPtr dest, SplashColorPtr blend, SplashColorMode cm) { int i, x; #if SPLASH_CMYK if (cm == splashModeCMYK8 || cm == splashModeDeviceN8) { SplashColor rgbSrc; SplashColor rgbDest; SplashColor rgbBlend; cmykToRGB(src, rgbSrc); cmykToRGB(dest, rgbDest); for (i = 0; i < 3; ++i) { if (rgbSrc[i] == 255) { rgbBlend[i] = 255; } else { x = (rgbDest[i] * 255) / (255 - rgbSrc[i]); rgbBlend[i] = x <= 255 ? x : 255; } } rgbToCMYK(rgbBlend, blend); } else #endif { for (i = 0; i < splashColorModeNComps[cm]; ++i) { if (src[i] == 255) { blend[i] = 255; } else { x = (dest[i] * 255) / (255 - src[i]); blend[i] = x <= 255 ? x : 255; } } } } static void splashOutBlendColorBurn(SplashColorPtr src, SplashColorPtr dest, SplashColorPtr blend, SplashColorMode cm) { int i, x; #if SPLASH_CMYK if (cm == splashModeCMYK8 || cm == splashModeDeviceN8) { SplashColor rgbSrc; SplashColor rgbDest; SplashColor rgbBlend; cmykToRGB(src, rgbSrc); cmykToRGB(dest, rgbDest); for (i = 0; i < 3; ++i) { if (rgbSrc[i] == 0) { rgbBlend[i] = 0; } else { x = ((255 - rgbDest[i]) * 255) / rgbSrc[i]; rgbBlend[i] = x <= 255 ? 255 - x : 0; } } rgbToCMYK(rgbBlend, blend); } else #endif { for (i = 0; i < splashColorModeNComps[cm]; ++i) { if (src[i] == 0) { blend[i] = 0; } else { x = ((255 - dest[i]) * 255) / src[i]; blend[i] = x <= 255 ? 255 - x : 0; } } } } static void splashOutBlendHardLight(SplashColorPtr src, SplashColorPtr dest, SplashColorPtr blend, SplashColorMode cm) { int i; #if SPLASH_CMYK if (cm == splashModeCMYK8 || cm == splashModeDeviceN8) { SplashColor rgbSrc; SplashColor rgbDest; SplashColor rgbBlend; cmykToRGB(src, rgbSrc); cmykToRGB(dest, rgbDest); for (i = 0; i < 3; ++i) { rgbBlend[i] = rgbSrc[i] < 0x80 ? (rgbDest[i] * 2 * rgbSrc[i]) / 255 : 255 - 2 * ((255 - rgbDest[i]) * (255 - rgbSrc[i])) / 255; } rgbToCMYK(rgbBlend, blend); } else #endif { for (i = 0; i < splashColorModeNComps[cm]; ++i) { blend[i] = src[i] < 0x80 ? (dest[i] * 2 * src[i]) / 255 : 255 - 2 * ((255 - dest[i]) * (255 - src[i])) / 255; } } } static void splashOutBlendSoftLight(SplashColorPtr src, SplashColorPtr dest, SplashColorPtr blend, SplashColorMode cm) { int i, x; #if SPLASH_CMYK if (cm == splashModeCMYK8 || cm == splashModeDeviceN8) { SplashColor rgbSrc; SplashColor rgbDest; SplashColor rgbBlend; cmykToRGB(src, rgbSrc); cmykToRGB(dest, rgbDest); for (i = 0; i < 3; ++i) { if (rgbSrc[i] < 0x80) { rgbBlend[i] = rgbDest[i] - (255 - 2 * rgbSrc[i]) * rgbDest[i] * (255 - rgbDest[i]) / (255 * 255); } else { if (rgbDest[i] < 0x40) { x = (((((16 * rgbDest[i] - 12 * 255) * rgbDest[i]) / 255) + 4 * 255) * rgbDest[i]) / 255; } else { x = (int)sqrt(255.0 * rgbDest[i]); } rgbBlend[i] = rgbDest[i] + (2 * rgbSrc[i] - 255) * (x - rgbDest[i]) / 255; } } rgbToCMYK(rgbBlend, blend); } else #endif { for (i = 0; i < splashColorModeNComps[cm]; ++i) { if (src[i] < 0x80) { blend[i] = dest[i] - (255 - 2 * src[i]) * dest[i] * (255 - dest[i]) / (255 * 255); } else { if (dest[i] < 0x40) { x = (((((16 * dest[i] - 12 * 255) * dest[i]) / 255) + 4 * 255) * dest[i]) / 255; } else { x = (int)sqrt(255.0 * dest[i]); } blend[i] = dest[i] + (2 * src[i] - 255) * (x - dest[i]) / 255; } } } } static void splashOutBlendDifference(SplashColorPtr src, SplashColorPtr dest, SplashColorPtr blend, SplashColorMode cm) { int i; #if SPLASH_CMYK if (cm == splashModeCMYK8 || cm == splashModeDeviceN8) { SplashColor rgbSrc; SplashColor rgbDest; SplashColor rgbBlend; cmykToRGB(src, rgbSrc); cmykToRGB(dest, rgbDest); for (i = 0; i < 3; ++i) { rgbBlend[i] = rgbDest[i] < rgbSrc[i] ? rgbSrc[i] - rgbDest[i] : rgbDest[i] - rgbSrc[i]; } rgbToCMYK(rgbBlend, blend); } else #endif { for (i = 0; i < splashColorModeNComps[cm]; ++i) { blend[i] = dest[i] < src[i] ? src[i] - dest[i] : dest[i] - src[i]; } } } static void splashOutBlendExclusion(SplashColorPtr src, SplashColorPtr dest, SplashColorPtr blend, SplashColorMode cm) { int i; #if SPLASH_CMYK if (cm == splashModeCMYK8 || cm == splashModeDeviceN8) { SplashColor rgbSrc; SplashColor rgbDest; SplashColor rgbBlend; cmykToRGB(src, rgbSrc); cmykToRGB(dest, rgbDest); for (i = 0; i < 3; ++i) { rgbBlend[i] = rgbDest[i] + rgbSrc[i] - (2 * rgbDest[i] * rgbSrc[i]) / 255; } rgbToCMYK(rgbBlend, blend); } else #endif { for (i = 0; i < splashColorModeNComps[cm]; ++i) { blend[i] = dest[i] + src[i] - (2 * dest[i] * src[i]) / 255; } } } static int getLum(int r, int g, int b) { return (int)(0.3 * r + 0.59 * g + 0.11 * b); } static int getSat(int r, int g, int b) { int rgbMin, rgbMax; rgbMin = rgbMax = r; if (g < rgbMin) { rgbMin = g; } else if (g > rgbMax) { rgbMax = g; } if (b < rgbMin) { rgbMin = b; } else if (b > rgbMax) { rgbMax = b; } return rgbMax - rgbMin; } static void clipColor(int rIn, int gIn, int bIn, Guchar *rOut, Guchar *gOut, Guchar *bOut) { int lum, rgbMin, rgbMax; lum = getLum(rIn, gIn, bIn); rgbMin = rgbMax = rIn; if (gIn < rgbMin) { rgbMin = gIn; } else if (gIn > rgbMax) { rgbMax = gIn; } if (bIn < rgbMin) { rgbMin = bIn; } else if (bIn > rgbMax) { rgbMax = bIn; } if (rgbMin < 0) { *rOut = (Guchar)(lum + ((rIn - lum) * lum) / (lum - rgbMin)); *gOut = (Guchar)(lum + ((gIn - lum) * lum) / (lum - rgbMin)); *bOut = (Guchar)(lum + ((bIn - lum) * lum) / (lum - rgbMin)); } else if (rgbMax > 255) { *rOut = (Guchar)(lum + ((rIn - lum) * (255 - lum)) / (rgbMax - lum)); *gOut = (Guchar)(lum + ((gIn - lum) * (255 - lum)) / (rgbMax - lum)); *bOut = (Guchar)(lum + ((bIn - lum) * (255 - lum)) / (rgbMax - lum)); } else { *rOut = rIn; *gOut = gIn; *bOut = bIn; } } static void setLum(Guchar rIn, Guchar gIn, Guchar bIn, int lum, Guchar *rOut, Guchar *gOut, Guchar *bOut) { int d; d = lum - getLum(rIn, gIn, bIn); clipColor(rIn + d, gIn + d, bIn + d, rOut, gOut, bOut); } static void setSat(Guchar rIn, Guchar gIn, Guchar bIn, int sat, Guchar *rOut, Guchar *gOut, Guchar *bOut) { int rgbMin, rgbMid, rgbMax; Guchar *minOut, *midOut, *maxOut; if (rIn < gIn) { rgbMin = rIn; minOut = rOut; rgbMid = gIn; midOut = gOut; } else { rgbMin = gIn; minOut = gOut; rgbMid = rIn; midOut = rOut; } if (bIn > rgbMid) { rgbMax = bIn; maxOut = bOut; } else if (bIn > rgbMin) { rgbMax = rgbMid; maxOut = midOut; rgbMid = bIn; midOut = bOut; } else { rgbMax = rgbMid; maxOut = midOut; rgbMid = rgbMin; midOut = minOut; rgbMin = bIn; minOut = bOut; } if (rgbMax > rgbMin) { *midOut = (Guchar)((rgbMid - rgbMin) * sat) / (rgbMax - rgbMin); *maxOut = (Guchar)sat; } else { *midOut = *maxOut = 0; } *minOut = 0; } static void splashOutBlendHue(SplashColorPtr src, SplashColorPtr dest, SplashColorPtr blend, SplashColorMode cm) { Guchar r0, g0, b0; #ifdef SPLASH_CMYK Guchar r1, g1, b1; int i; SplashColor src2, dest2; #endif switch (cm) { case splashModeMono1: case splashModeMono8: blend[0] = dest[0]; break; case splashModeXBGR8: src[3] = 255; case splashModeRGB8: case splashModeBGR8: setSat(src[0], src[1], src[2], getSat(dest[0], dest[1], dest[2]), &r0, &g0, &b0); setLum(r0, g0, b0, getLum(dest[0], dest[1], dest[2]), &blend[0], &blend[1], &blend[2]); break; #if SPLASH_CMYK case splashModeCMYK8: case splashModeDeviceN8: for (i = 0; i < 4; i++) { // convert to additive src2[i] = 0xff - src[i]; dest2[i] = 0xff - dest[i]; } // NB: inputs have already been converted to additive mode setSat(src2[0], src2[1], src2[2], getSat(dest2[0], dest2[1], dest2[2]), &r0, &g0, &b0); setLum(r0, g0, b0, getLum(dest2[0], dest2[1], dest2[2]), &r1, &g1, &b1); blend[0] = r1; blend[1] = g1; blend[2] = b1; blend[3] = dest2[3]; for (i = 0; i < 4; i++) { // convert back to subtractive blend[i] = 0xff - blend[i]; } break; #endif } } static void splashOutBlendSaturation(SplashColorPtr src, SplashColorPtr dest, SplashColorPtr blend, SplashColorMode cm) { Guchar r0, g0, b0; #ifdef SPLASH_CMYK Guchar r1, g1, b1; int i; SplashColor src2, dest2; #endif switch (cm) { case splashModeMono1: case splashModeMono8: blend[0] = dest[0]; break; case splashModeXBGR8: src[3] = 255; case splashModeRGB8: case splashModeBGR8: setSat(dest[0], dest[1], dest[2], getSat(src[0], src[1], src[2]), &r0, &g0, &b0); setLum(r0, g0, b0, getLum(dest[0], dest[1], dest[2]), &blend[0], &blend[1], &blend[2]); break; #if SPLASH_CMYK case splashModeCMYK8: case splashModeDeviceN8: for (i = 0; i < 4; i++) { // convert to additive src2[i] = 0xff - src[i]; dest2[i] = 0xff - dest[i]; } setSat(dest2[0], dest2[1], dest2[2], getSat(src2[0], src2[1], src2[2]), &r0, &g0, &b0); setLum(r0, g0, b0, getLum(dest2[0], dest2[1], dest2[2]), &r1, &g1, &b1); blend[0] = r1; blend[1] = g1; blend[2] = b1; blend[3] = dest2[3]; for (i = 0; i < 4; i++) { // convert back to subtractive blend[i] = 0xff - blend[i]; } break; #endif } } static void splashOutBlendColor(SplashColorPtr src, SplashColorPtr dest, SplashColorPtr blend, SplashColorMode cm) { #if SPLASH_CMYK Guchar r, g, b; int i; SplashColor src2, dest2; #endif switch (cm) { case splashModeMono1: case splashModeMono8: blend[0] = dest[0]; break; case splashModeXBGR8: src[3] = 255; case splashModeRGB8: case splashModeBGR8: setLum(src[0], src[1], src[2], getLum(dest[0], dest[1], dest[2]), &blend[0], &blend[1], &blend[2]); break; #if SPLASH_CMYK case splashModeCMYK8: case splashModeDeviceN8: for (i = 0; i < 4; i++) { // convert to additive src2[i] = 0xff - src[i]; dest2[i] = 0xff - dest[i]; } setLum(src2[0], src2[1], src2[2], getLum(dest2[0], dest2[1], dest2[2]), &r, &g, &b); blend[0] = r; blend[1] = g; blend[2] = b; blend[3] = dest2[3]; for (i = 0; i < 4; i++) { // convert back to subtractive blend[i] = 0xff - blend[i]; } break; #endif } } static void splashOutBlendLuminosity(SplashColorPtr src, SplashColorPtr dest, SplashColorPtr blend, SplashColorMode cm) { #if SPLASH_CMYK Guchar r, g, b; int i; SplashColor src2, dest2; #endif switch (cm) { case splashModeMono1: case splashModeMono8: blend[0] = dest[0]; break; case splashModeXBGR8: src[3] = 255; case splashModeRGB8: case splashModeBGR8: setLum(dest[0], dest[1], dest[2], getLum(src[0], src[1], src[2]), &blend[0], &blend[1], &blend[2]); break; #if SPLASH_CMYK case splashModeCMYK8: case splashModeDeviceN8: for (i = 0; i < 4; i++) { // convert to additive src2[i] = 0xff - src[i]; dest2[i] = 0xff - dest[i]; } setLum(dest2[0], dest2[1], dest2[2], getLum(src2[0], src2[1], src2[2]), &r, &g, &b); blend[0] = r; blend[1] = g; blend[2] = b; blend[3] = src2[3]; for (i = 0; i < 4; i++) { // convert back to subtractive blend[i] = 0xff - blend[i]; } break; #endif } } // NB: This must match the GfxBlendMode enum defined in GfxState.h. static const SplashBlendFunc splashOutBlendFuncs[] = { NULL, &splashOutBlendMultiply, &splashOutBlendScreen, &splashOutBlendOverlay, &splashOutBlendDarken, &splashOutBlendLighten, &splashOutBlendColorDodge, &splashOutBlendColorBurn, &splashOutBlendHardLight, &splashOutBlendSoftLight, &splashOutBlendDifference, &splashOutBlendExclusion, &splashOutBlendHue, &splashOutBlendSaturation, &splashOutBlendColor, &splashOutBlendLuminosity }; //------------------------------------------------------------------------ // SplashOutFontFileID //------------------------------------------------------------------------ class SplashOutFontFileID: public SplashFontFileID { public: SplashOutFontFileID(Ref *rA) { r = *rA; } ~SplashOutFontFileID() {} GBool matches(SplashFontFileID *id) { return ((SplashOutFontFileID *)id)->r.num == r.num && ((SplashOutFontFileID *)id)->r.gen == r.gen; } private: Ref r; }; //------------------------------------------------------------------------ // T3FontCache //------------------------------------------------------------------------ struct T3FontCacheTag { Gushort code; Gushort mru; // valid bit (0x8000) and MRU index }; class T3FontCache { public: T3FontCache(Ref *fontID, double m11A, double m12A, double m21A, double m22A, int glyphXA, int glyphYA, int glyphWA, int glyphHA, GBool aa, GBool validBBoxA); ~T3FontCache(); GBool matches(Ref *idA, double m11A, double m12A, double m21A, double m22A) { return fontID.num == idA->num && fontID.gen == idA->gen && m11 == m11A && m12 == m12A && m21 == m21A && m22 == m22A; } Ref fontID; // PDF font ID double m11, m12, m21, m22; // transform matrix int glyphX, glyphY; // pixel offset of glyph bitmaps int glyphW, glyphH; // size of glyph bitmaps, in pixels GBool validBBox; // false if the bbox was [0 0 0 0] int glyphSize; // size of glyph bitmaps, in bytes int cacheSets; // number of sets in cache int cacheAssoc; // cache associativity (glyphs per set) Guchar *cacheData; // glyph pixmap cache T3FontCacheTag *cacheTags; // cache tags, i.e., char codes }; T3FontCache::T3FontCache(Ref *fontIDA, double m11A, double m12A, double m21A, double m22A, int glyphXA, int glyphYA, int glyphWA, int glyphHA, GBool validBBoxA, GBool aa) { int i; fontID = *fontIDA; m11 = m11A; m12 = m12A; m21 = m21A; m22 = m22A; glyphX = glyphXA; glyphY = glyphYA; glyphW = glyphWA; glyphH = glyphHA; validBBox = validBBoxA; // sanity check for excessively large glyphs (which most likely // indicate an incorrect BBox) i = glyphW * glyphH; if (i > 100000 || glyphW > INT_MAX / glyphH || glyphW <= 0 || glyphH <= 0) { glyphW = glyphH = 100; validBBox = gFalse; } if (aa) { glyphSize = glyphW * glyphH; } else { glyphSize = ((glyphW + 7) >> 3) * glyphH; } cacheAssoc = type3FontCacheAssoc; for (cacheSets = type3FontCacheMaxSets; cacheSets > 1 && cacheSets * cacheAssoc * glyphSize > type3FontCacheSize; cacheSets >>= 1) ; if (glyphSize < 10485760 / cacheAssoc / cacheSets) { cacheData = (Guchar *)gmallocn_checkoverflow(cacheSets * cacheAssoc, glyphSize); } else { error(errSyntaxWarning, -1, "Not creating cacheData for T3FontCache, it asked for too much memory.\n" " This could teoretically result in wrong rendering,\n" " but most probably the document is bogus.\n" " Please report a bug if you think the rendering may be wrong because of this."); cacheData = NULL; } if (cacheData != NULL) { cacheTags = (T3FontCacheTag *)gmallocn(cacheSets * cacheAssoc, sizeof(T3FontCacheTag)); for (i = 0; i < cacheSets * cacheAssoc; ++i) { cacheTags[i].mru = i & (cacheAssoc - 1); } } else { cacheTags = NULL; } } T3FontCache::~T3FontCache() { gfree(cacheData); gfree(cacheTags); } struct T3GlyphStack { Gushort code; // character code //----- cache info T3FontCache *cache; // font cache for the current font T3FontCacheTag *cacheTag; // pointer to cache tag for the glyph Guchar *cacheData; // pointer to cache data for the glyph //----- saved state SplashBitmap *origBitmap; Splash *origSplash; double origCTM4, origCTM5; T3GlyphStack *next; // next object on stack }; //------------------------------------------------------------------------ // SplashTransparencyGroup //------------------------------------------------------------------------ struct SplashTransparencyGroup { int tx, ty; // translation coordinates SplashBitmap *tBitmap; // bitmap for transparency group GfxColorSpace *blendingColorSpace; GBool isolated; //----- for knockout SplashBitmap *shape; GBool knockout; SplashCoord knockoutOpacity; GBool fontAA; //----- saved state SplashBitmap *origBitmap; Splash *origSplash; SplashTransparencyGroup *next; }; //------------------------------------------------------------------------ // SplashOutputDev //------------------------------------------------------------------------ SplashOutputDev::SplashOutputDev(SplashColorMode colorModeA, int bitmapRowPadA, GBool reverseVideoA, SplashColorPtr paperColorA, GBool bitmapTopDownA, GBool allowAntialiasA, SplashThinLineMode thinLineMode, GBool overprintPreviewA) { colorMode = colorModeA; bitmapRowPad = bitmapRowPadA; bitmapTopDown = bitmapTopDownA; bitmapUpsideDown = gFalse; allowAntialias = allowAntialiasA; vectorAntialias = allowAntialias && globalParams->getVectorAntialias() && colorMode != splashModeMono1; overprintPreview = overprintPreviewA; enableFreeTypeHinting = gFalse; enableSlightHinting = gFalse; setupScreenParams(72.0, 72.0); reverseVideo = reverseVideoA; if (paperColorA != NULL) { splashColorCopy(paperColor, paperColorA); } else { splashClearColor(paperColor); } skipHorizText = gFalse; skipRotatedText = gFalse; keepAlphaChannel = paperColorA == NULL; doc = NULL; bitmap = new SplashBitmap(1, 1, bitmapRowPad, colorMode, colorMode != splashModeMono1, bitmapTopDown); splash = new Splash(bitmap, vectorAntialias, &screenParams); splash->setMinLineWidth(globalParams->getMinLineWidth()); splash->setThinLineMode(thinLineMode); splash->clear(paperColor, 0); fontEngine = NULL; nT3Fonts = 0; t3GlyphStack = NULL; font = NULL; needFontUpdate = gFalse; textClipPath = NULL; transpGroupStack = NULL; nestCount = 0; xref = NULL; } void SplashOutputDev::setupScreenParams(double hDPI, double vDPI) { screenParams.size = globalParams->getScreenSize(); screenParams.dotRadius = globalParams->getScreenDotRadius(); screenParams.gamma = (SplashCoord)globalParams->getScreenGamma(); screenParams.blackThreshold = (SplashCoord)globalParams->getScreenBlackThreshold(); screenParams.whiteThreshold = (SplashCoord)globalParams->getScreenWhiteThreshold(); switch (globalParams->getScreenType()) { case screenDispersed: screenParams.type = splashScreenDispersed; if (screenParams.size < 0) { screenParams.size = 4; } break; case screenClustered: screenParams.type = splashScreenClustered; if (screenParams.size < 0) { screenParams.size = 10; } break; case screenStochasticClustered: screenParams.type = splashScreenStochasticClustered; if (screenParams.size < 0) { screenParams.size = 64; } if (screenParams.dotRadius < 0) { screenParams.dotRadius = 2; } break; case screenUnset: default: // use clustered dithering for resolution >= 300 dpi // (compare to 299.9 to avoid floating point issues) if (hDPI > 299.9 && vDPI > 299.9) { screenParams.type = splashScreenStochasticClustered; if (screenParams.size < 0) { screenParams.size = 64; } if (screenParams.dotRadius < 0) { screenParams.dotRadius = 2; } } else { screenParams.type = splashScreenDispersed; if (screenParams.size < 0) { screenParams.size = 4; } } } } SplashOutputDev::~SplashOutputDev() { int i; for (i = 0; i < nT3Fonts; ++i) { delete t3FontCache[i]; } if (fontEngine) { delete fontEngine; } if (splash) { delete splash; } if (bitmap) { delete bitmap; } } void SplashOutputDev::startDoc(PDFDoc *docA) { int i; doc = docA; if (fontEngine) { delete fontEngine; } fontEngine = new SplashFontEngine( #if HAVE_T1LIB_H globalParams->getEnableT1lib(), #endif #if HAVE_FREETYPE_FREETYPE_H || HAVE_FREETYPE_H globalParams->getEnableFreeType(), enableFreeTypeHinting, enableSlightHinting, #endif allowAntialias && globalParams->getAntialias() && colorMode != splashModeMono1); for (i = 0; i < nT3Fonts; ++i) { delete t3FontCache[i]; } nT3Fonts = 0; } void SplashOutputDev::startPage(int pageNum, GfxState *state, XRef *xrefA) { int w, h; double *ctm; SplashCoord mat[6]; SplashColor color; xref = xrefA; if (state) { setupScreenParams(state->getHDPI(), state->getVDPI()); w = (int)(state->getPageWidth() + 0.5); if (w <= 0) { w = 1; } h = (int)(state->getPageHeight() + 0.5); if (h <= 0) { h = 1; } } else { w = h = 1; } SplashThinLineMode thinLineMode = splashThinLineDefault; if (splash) { thinLineMode = splash->getThinLineMode(); delete splash; splash = NULL; } if (!bitmap || w != bitmap->getWidth() || h != bitmap->getHeight()) { if (bitmap) { delete bitmap; bitmap = NULL; } bitmap = new SplashBitmap(w, h, bitmapRowPad, colorMode, colorMode != splashModeMono1, bitmapTopDown); if (!bitmap->getDataPtr()) { delete bitmap; w = h = 1; bitmap = new SplashBitmap(w, h, bitmapRowPad, colorMode, colorMode != splashModeMono1, bitmapTopDown); } } splash = new Splash(bitmap, vectorAntialias, &screenParams); splash->setThinLineMode(thinLineMode); splash->setMinLineWidth(globalParams->getMinLineWidth()); if (state) { ctm = state->getCTM(); mat[0] = (SplashCoord)ctm[0]; mat[1] = (SplashCoord)ctm[1]; mat[2] = (SplashCoord)ctm[2]; mat[3] = (SplashCoord)ctm[3]; mat[4] = (SplashCoord)ctm[4]; mat[5] = (SplashCoord)ctm[5]; splash->setMatrix(mat); } switch (colorMode) { case splashModeMono1: case splashModeMono8: color[0] = 0; break; case splashModeXBGR8: color[3] = 255; case splashModeRGB8: case splashModeBGR8: color[0] = color[1] = color[2] = 0; break; #if SPLASH_CMYK case splashModeCMYK8: color[0] = color[1] = color[2] = color[3] = 0; break; case splashModeDeviceN8: for (int i = 0; i < 4 + SPOT_NCOMPS; i++) color[i] = 0; break; #endif } splash->setStrokePattern(new SplashSolidColor(color)); splash->setFillPattern(new SplashSolidColor(color)); splash->setLineCap(splashLineCapButt); splash->setLineJoin(splashLineJoinMiter); splash->setLineDash(NULL, 0, 0); splash->setMiterLimit(10); splash->setFlatness(1); // the SA parameter supposedly defaults to false, but Acrobat // apparently hardwires it to true splash->setStrokeAdjust(globalParams->getStrokeAdjust()); splash->clear(paperColor, 0); } void SplashOutputDev::endPage() { if (colorMode != splashModeMono1 && !keepAlphaChannel) { splash->compositeBackground(paperColor); } } void SplashOutputDev::saveState(GfxState *state) { splash->saveState(); } void SplashOutputDev::restoreState(GfxState *state) { splash->restoreState(); needFontUpdate = gTrue; } void SplashOutputDev::updateAll(GfxState *state) { updateLineDash(state); updateLineJoin(state); updateLineCap(state); updateLineWidth(state); updateFlatness(state); updateMiterLimit(state); updateStrokeAdjust(state); updateFillColorSpace(state); updateFillColor(state); updateStrokeColorSpace(state); updateStrokeColor(state); needFontUpdate = gTrue; } void SplashOutputDev::updateCTM(GfxState *state, double m11, double m12, double m21, double m22, double m31, double m32) { double *ctm; SplashCoord mat[6]; ctm = state->getCTM(); mat[0] = (SplashCoord)ctm[0]; mat[1] = (SplashCoord)ctm[1]; mat[2] = (SplashCoord)ctm[2]; mat[3] = (SplashCoord)ctm[3]; mat[4] = (SplashCoord)ctm[4]; mat[5] = (SplashCoord)ctm[5]; splash->setMatrix(mat); } void SplashOutputDev::updateLineDash(GfxState *state) { double *dashPattern; int dashLength; double dashStart; SplashCoord dash[20]; int i; state->getLineDash(&dashPattern, &dashLength, &dashStart); if (dashLength > 20) { dashLength = 20; } for (i = 0; i < dashLength; ++i) { dash[i] = (SplashCoord)dashPattern[i]; if (dash[i] < 0) { dash[i] = 0; } } splash->setLineDash(dash, dashLength, (SplashCoord)dashStart); } void SplashOutputDev::updateFlatness(GfxState *state) { #if 0 // Acrobat ignores the flatness setting, and always renders curves // with a fairly small flatness value splash->setFlatness(state->getFlatness()); #endif } void SplashOutputDev::updateLineJoin(GfxState *state) { splash->setLineJoin(state->getLineJoin()); } void SplashOutputDev::updateLineCap(GfxState *state) { splash->setLineCap(state->getLineCap()); } void SplashOutputDev::updateMiterLimit(GfxState *state) { splash->setMiterLimit(state->getMiterLimit()); } void SplashOutputDev::updateLineWidth(GfxState *state) { splash->setLineWidth(state->getLineWidth()); } void SplashOutputDev::updateStrokeAdjust(GfxState * /*state*/) { #if 0 // the SA parameter supposedly defaults to false, but Acrobat // apparently hardwires it to true splash->setStrokeAdjust(state->getStrokeAdjust()); #endif } void SplashOutputDev::updateFillColorSpace(GfxState *state) { #if SPLASH_CMYK if (colorMode == splashModeDeviceN8) state->getFillColorSpace()->createMapping(bitmap->getSeparationList(), SPOT_NCOMPS); #endif } void SplashOutputDev::updateStrokeColorSpace(GfxState *state) { #if SPLASH_CMYK if (colorMode == splashModeDeviceN8) state->getStrokeColorSpace()->createMapping(bitmap->getSeparationList(), SPOT_NCOMPS); #endif } void SplashOutputDev::updateFillColor(GfxState *state) { GfxGray gray; GfxRGB rgb; #if SPLASH_CMYK GfxCMYK cmyk; GfxColor deviceN; #endif switch (colorMode) { case splashModeMono1: case splashModeMono8: state->getFillGray(&gray); splash->setFillPattern(getColor(gray)); break; case splashModeXBGR8: case splashModeRGB8: case splashModeBGR8: state->getFillRGB(&rgb); splash->setFillPattern(getColor(&rgb)); break; #if SPLASH_CMYK case splashModeCMYK8: state->getFillCMYK(&cmyk); splash->setFillPattern(getColor(&cmyk)); break; case splashModeDeviceN8: state->getFillDeviceN(&deviceN); splash->setFillPattern(getColor(&deviceN)); break; #endif } } void SplashOutputDev::updateStrokeColor(GfxState *state) { GfxGray gray; GfxRGB rgb; #if SPLASH_CMYK GfxCMYK cmyk; GfxColor deviceN; #endif switch (colorMode) { case splashModeMono1: case splashModeMono8: state->getStrokeGray(&gray); splash->setStrokePattern(getColor(gray)); break; case splashModeXBGR8: case splashModeRGB8: case splashModeBGR8: state->getStrokeRGB(&rgb); splash->setStrokePattern(getColor(&rgb)); break; #if SPLASH_CMYK case splashModeCMYK8: state->getStrokeCMYK(&cmyk); splash->setStrokePattern(getColor(&cmyk)); break; case splashModeDeviceN8: state->getStrokeDeviceN(&deviceN); splash->setStrokePattern(getColor(&deviceN)); break; #endif } } SplashPattern *SplashOutputDev::getColor(GfxGray gray) { SplashColor color; if (reverseVideo) { gray = gfxColorComp1 - gray; } color[0] = colToByte(gray); return new SplashSolidColor(color); } SplashPattern *SplashOutputDev::getColor(GfxRGB *rgb) { GfxColorComp r, g, b; SplashColor color; if (reverseVideo) { r = gfxColorComp1 - rgb->r; g = gfxColorComp1 - rgb->g; b = gfxColorComp1 - rgb->b; } else { r = rgb->r; g = rgb->g; b = rgb->b; } color[0] = colToByte(r); color[1] = colToByte(g); color[2] = colToByte(b); if (colorMode == splashModeXBGR8) color[3] = 255; return new SplashSolidColor(color); } #if SPLASH_CMYK SplashPattern *SplashOutputDev::getColor(GfxCMYK *cmyk) { SplashColor color; color[0] = colToByte(cmyk->c); color[1] = colToByte(cmyk->m); color[2] = colToByte(cmyk->y); color[3] = colToByte(cmyk->k); return new SplashSolidColor(color); } SplashPattern *SplashOutputDev::getColor(GfxColor *deviceN) { SplashColor color; for (int i = 0; i < 4 + SPOT_NCOMPS; i++) color[i] = colToByte(deviceN->c[i]); return new SplashSolidColor(color); } #endif void SplashOutputDev::setOverprintMask(GfxColorSpace *colorSpace, GBool overprintFlag, int overprintMode, GfxColor *singleColor, GBool grayIndexed) { #if SPLASH_CMYK Guint mask; GfxCMYK cmyk; GBool additive = gFalse; int i; if (colorSpace->getMode() == csIndexed) { setOverprintMask(((GfxIndexedColorSpace *)colorSpace)->getBase(), overprintFlag, overprintMode, singleColor, grayIndexed); return; } if (overprintFlag && overprintPreview) { mask = colorSpace->getOverprintMask(); if (singleColor && overprintMode && colorSpace->getMode() == csDeviceCMYK) { colorSpace->getCMYK(singleColor, &cmyk); if (cmyk.c == 0) { mask &= ~1; } if (cmyk.m == 0) { mask &= ~2; } if (cmyk.y == 0) { mask &= ~4; } if (cmyk.k == 0) { mask &= ~8; } } if (grayIndexed) { mask &= ~7; } else if (colorSpace->getMode() == csSeparation) { GfxSeparationColorSpace *deviceSep = (GfxSeparationColorSpace *)colorSpace; additive = deviceSep->getName()->cmp("All") != 0 && mask == 0x0f && !deviceSep->isNonMarking(); } else if (colorSpace->getMode() == csDeviceN) { GfxDeviceNColorSpace *deviceNCS = (GfxDeviceNColorSpace *)colorSpace; additive = mask == 0x0f && !deviceNCS->isNonMarking(); for (i = 0; i < deviceNCS->getNComps() && additive; i++) { if (deviceNCS->getColorantName(i)->cmp("Cyan") == 0) { additive = gFalse; } else if (deviceNCS->getColorantName(i)->cmp("Magenta") == 0) { additive = gFalse; } else if (deviceNCS->getColorantName(i)->cmp("Yellow") == 0) { additive = gFalse; } else if (deviceNCS->getColorantName(i)->cmp("Black") == 0) { additive = gFalse; } } } } else { mask = 0xffffffff; } splash->setOverprintMask(mask, additive); #endif } void SplashOutputDev::updateBlendMode(GfxState *state) { splash->setBlendFunc(splashOutBlendFuncs[state->getBlendMode()]); } void SplashOutputDev::updateFillOpacity(GfxState *state) { splash->setFillAlpha((SplashCoord)state->getFillOpacity()); if (transpGroupStack != NULL && (SplashCoord)state->getFillOpacity() < transpGroupStack->knockoutOpacity) { transpGroupStack->knockoutOpacity = (SplashCoord)state->getFillOpacity(); } } void SplashOutputDev::updateStrokeOpacity(GfxState *state) { splash->setStrokeAlpha((SplashCoord)state->getStrokeOpacity()); if (transpGroupStack != NULL && (SplashCoord)state->getStrokeOpacity() < transpGroupStack->knockoutOpacity) { transpGroupStack->knockoutOpacity = (SplashCoord)state->getStrokeOpacity(); } } void SplashOutputDev::updateFillOverprint(GfxState *state) { splash->setFillOverprint(state->getFillOverprint()); } void SplashOutputDev::updateStrokeOverprint(GfxState *state) { splash->setStrokeOverprint(state->getStrokeOverprint()); } void SplashOutputDev::updateOverprintMode(GfxState *state) { splash->setOverprintMode(state->getOverprintMode()); } void SplashOutputDev::updateTransfer(GfxState *state) { Function **transfer; Guchar red[256], green[256], blue[256], gray[256]; double x, y; int i; transfer = state->getTransfer(); if (transfer[0] && transfer[0]->getInputSize() == 1 && transfer[0]->getOutputSize() == 1) { if (transfer[1] && transfer[1]->getInputSize() == 1 && transfer[1]->getOutputSize() == 1 && transfer[2] && transfer[2]->getInputSize() == 1 && transfer[2]->getOutputSize() == 1 && transfer[3] && transfer[3]->getInputSize() == 1 && transfer[3]->getOutputSize() == 1) { for (i = 0; i < 256; ++i) { x = i / 255.0; transfer[0]->transform(&x, &y); red[i] = (Guchar)(y * 255.0 + 0.5); transfer[1]->transform(&x, &y); green[i] = (Guchar)(y * 255.0 + 0.5); transfer[2]->transform(&x, &y); blue[i] = (Guchar)(y * 255.0 + 0.5); transfer[3]->transform(&x, &y); gray[i] = (Guchar)(y * 255.0 + 0.5); } } else { for (i = 0; i < 256; ++i) { x = i / 255.0; transfer[0]->transform(&x, &y); red[i] = green[i] = blue[i] = gray[i] = (Guchar)(y * 255.0 + 0.5); } } } else { for (i = 0; i < 256; ++i) { red[i] = green[i] = blue[i] = gray[i] = (Guchar)i; } } splash->setTransfer(red, green, blue, gray); } void SplashOutputDev::updateFont(GfxState * /*state*/) { needFontUpdate = gTrue; } void SplashOutputDev::doUpdateFont(GfxState *state) { GfxFont *gfxFont; GfxFontLoc *fontLoc; GfxFontType fontType; SplashOutFontFileID *id; SplashFontFile *fontFile; SplashFontSrc *fontsrc = NULL; FoFiTrueType *ff; Object refObj, strObj; GooString *fileName; char *tmpBuf; int tmpBufLen; int *codeToGID; double *textMat; double m11, m12, m21, m22, fontSize; int faceIndex = 0; SplashCoord mat[4]; int n, i; GBool recreateFont = gFalse; GBool doAdjustFontMatrix = gFalse; needFontUpdate = gFalse; font = NULL; fileName = NULL; tmpBuf = NULL; fontLoc = NULL; if (!(gfxFont = state->getFont())) { goto err1; } fontType = gfxFont->getType(); if (fontType == fontType3) { goto err1; } // sanity-check the font size - skip anything larger than 10 inches // (this avoids problems allocating memory for the font cache) if (state->getTransformedFontSize() > 10 * (state->getHDPI() + state->getVDPI())) { goto err1; } // check the font file cache id = new SplashOutFontFileID(gfxFont->getID()); if ((fontFile = fontEngine->getFontFile(id))) { delete id; } else { if (!(fontLoc = gfxFont->locateFont((xref) ? xref : doc->getXRef(), gFalse))) { error(errSyntaxError, -1, "Couldn't find a font for '{0:s}'", gfxFont->getName() ? gfxFont->getName()->getCString() : "(unnamed)"); goto err2; } // embedded font if (fontLoc->locType == gfxFontLocEmbedded) { // if there is an embedded font, read it to memory tmpBuf = gfxFont->readEmbFontFile((xref) ? xref : doc->getXRef(), &tmpBufLen); if (! tmpBuf) goto err2; // external font } else { // gfxFontLocExternal fileName = fontLoc->path; fontType = fontLoc->fontType; doAdjustFontMatrix = gTrue; } fontsrc = new SplashFontSrc; if (fileName) fontsrc->setFile(fileName, gFalse); else fontsrc->setBuf(tmpBuf, tmpBufLen, gTrue); // load the font file switch (fontType) { case fontType1: if (!(fontFile = fontEngine->loadType1Font( id, fontsrc, (const char **)((Gfx8BitFont *)gfxFont)->getEncoding()))) { error(errSyntaxError, -1, "Couldn't create a font for '{0:s}'", gfxFont->getName() ? gfxFont->getName()->getCString() : "(unnamed)"); goto err2; } break; case fontType1C: if (!(fontFile = fontEngine->loadType1CFont( id, fontsrc, (const char **)((Gfx8BitFont *)gfxFont)->getEncoding()))) { error(errSyntaxError, -1, "Couldn't create a font for '{0:s}'", gfxFont->getName() ? gfxFont->getName()->getCString() : "(unnamed)"); goto err2; } break; case fontType1COT: if (!(fontFile = fontEngine->loadOpenTypeT1CFont( id, fontsrc, (const char **)((Gfx8BitFont *)gfxFont)->getEncoding()))) { error(errSyntaxError, -1, "Couldn't create a font for '{0:s}'", gfxFont->getName() ? gfxFont->getName()->getCString() : "(unnamed)"); goto err2; } break; case fontTrueType: case fontTrueTypeOT: if (fileName) ff = FoFiTrueType::load(fileName->getCString()); else ff = FoFiTrueType::make(tmpBuf, tmpBufLen); if (ff) { codeToGID = ((Gfx8BitFont *)gfxFont)->getCodeToGIDMap(ff); n = 256; delete ff; // if we're substituting for a non-TrueType font, we need to mark // all notdef codes as "do not draw" (rather than drawing TrueType // notdef glyphs) if (gfxFont->getType() != fontTrueType && gfxFont->getType() != fontTrueTypeOT) { for (i = 0; i < 256; ++i) { if (codeToGID[i] == 0) { codeToGID[i] = -1; } } } } else { codeToGID = NULL; n = 0; } if (!(fontFile = fontEngine->loadTrueTypeFont( id, fontsrc, codeToGID, n))) { error(errSyntaxError, -1, "Couldn't create a font for '{0:s}'", gfxFont->getName() ? gfxFont->getName()->getCString() : "(unnamed)"); goto err2; } break; case fontCIDType0: case fontCIDType0C: if (!(fontFile = fontEngine->loadCIDFont( id, fontsrc))) { error(errSyntaxError, -1, "Couldn't create a font for '{0:s}'", gfxFont->getName() ? gfxFont->getName()->getCString() : "(unnamed)"); goto err2; } break; case fontCIDType0COT: if (((GfxCIDFont *)gfxFont)->getCIDToGID()) { n = ((GfxCIDFont *)gfxFont)->getCIDToGIDLen(); codeToGID = (int *)gmallocn(n, sizeof(int)); memcpy(codeToGID, ((GfxCIDFont *)gfxFont)->getCIDToGID(), n * sizeof(int)); } else { codeToGID = NULL; n = 0; } if (!(fontFile = fontEngine->loadOpenTypeCFFFont( id, fontsrc, codeToGID, n))) { error(errSyntaxError, -1, "Couldn't create a font for '{0:s}'", gfxFont->getName() ? gfxFont->getName()->getCString() : "(unnamed)"); goto err2; } break; case fontCIDType2: case fontCIDType2OT: codeToGID = NULL; n = 0; if (((GfxCIDFont *)gfxFont)->getCIDToGID()) { n = ((GfxCIDFont *)gfxFont)->getCIDToGIDLen(); if (n) { codeToGID = (int *)gmallocn(n, sizeof(int)); memcpy(codeToGID, ((GfxCIDFont *)gfxFont)->getCIDToGID(), n * sizeof(int)); } } else { if (fileName) ff = FoFiTrueType::load(fileName->getCString()); else ff = FoFiTrueType::make(tmpBuf, tmpBufLen); if (! ff) { error(errSyntaxError, -1, "Couldn't create a font for '{0:s}'", gfxFont->getName() ? gfxFont->getName()->getCString() : "(unnamed)"); goto err2; } codeToGID = ((GfxCIDFont *)gfxFont)->getCodeToGIDMap(ff, &n); delete ff; } if (!(fontFile = fontEngine->loadTrueTypeFont( id, fontsrc, codeToGID, n, faceIndex))) { error(errSyntaxError, -1, "Couldn't create a font for '{0:s}'", gfxFont->getName() ? gfxFont->getName()->getCString() : "(unnamed)"); goto err2; } break; default: // this shouldn't happen goto err2; } fontFile->doAdjustMatrix = doAdjustFontMatrix; } // get the font matrix textMat = state->getTextMat(); fontSize = state->getFontSize(); m11 = textMat[0] * fontSize * state->getHorizScaling(); m12 = textMat[1] * fontSize * state->getHorizScaling(); m21 = textMat[2] * fontSize; m22 = textMat[3] * fontSize; // create the scaled font mat[0] = m11; mat[1] = m12; mat[2] = m21; mat[3] = m22; font = fontEngine->getFont(fontFile, mat, splash->getMatrix()); // for substituted fonts: adjust the font matrix -- compare the // width of 'm' in the original font and the substituted font if (fontFile->doAdjustMatrix && !gfxFont->isCIDFont()) { double w1, w2; CharCode code; char *name; for (code = 0; code < 256; ++code) { if ((name = ((Gfx8BitFont *)gfxFont)->getCharName(code)) && name[0] == 'm' && name[1] == '\0') { break; } } if (code < 256) { w1 = ((Gfx8BitFont *)gfxFont)->getWidth(code); w2 = font->getGlyphAdvance(code); if (!gfxFont->isSymbolic() && w2 > 0) { // if real font is substantially narrower than substituted // font, reduce the font size accordingly if (w1 > 0.01 && w1 < 0.9 * w2) { w1 /= w2; m11 *= w1; m21 *= w1; recreateFont = gTrue; } } } } if (recreateFont) { mat[0] = m11; mat[1] = m12; mat[2] = m21; mat[3] = m22; font = fontEngine->getFont(fontFile, mat, splash->getMatrix()); } delete fontLoc; if (fontsrc && !fontsrc->isFile) fontsrc->unref(); return; err2: delete id; delete fontLoc; err1: if (fontsrc && !fontsrc->isFile) fontsrc->unref(); return; } void SplashOutputDev::stroke(GfxState *state) { SplashPath *path; if (state->getStrokeColorSpace()->isNonMarking()) { return; } setOverprintMask(state->getStrokeColorSpace(), state->getStrokeOverprint(), state->getOverprintMode(), state->getStrokeColor()); path = convertPath(state, state->getPath(), gFalse); splash->stroke(path); delete path; } void SplashOutputDev::fill(GfxState *state) { SplashPath *path; if (state->getFillColorSpace()->isNonMarking()) { return; } setOverprintMask(state->getFillColorSpace(), state->getFillOverprint(), state->getOverprintMode(), state->getFillColor()); path = convertPath(state, state->getPath(), gTrue); splash->fill(path, gFalse); delete path; } void SplashOutputDev::eoFill(GfxState *state) { SplashPath *path; if (state->getFillColorSpace()->isNonMarking()) { return; } setOverprintMask(state->getFillColorSpace(), state->getFillOverprint(), state->getOverprintMode(), state->getFillColor()); path = convertPath(state, state->getPath(), gTrue); splash->fill(path, gTrue); delete path; } void SplashOutputDev::clip(GfxState *state) { SplashPath *path; path = convertPath(state, state->getPath(), gTrue); splash->clipToPath(path, gFalse); delete path; } void SplashOutputDev::eoClip(GfxState *state) { SplashPath *path; path = convertPath(state, state->getPath(), gTrue); splash->clipToPath(path, gTrue); delete path; } void SplashOutputDev::clipToStrokePath(GfxState *state) { SplashPath *path, *path2; path = convertPath(state, state->getPath(), gFalse); path2 = splash->makeStrokePath(path, state->getLineWidth()); delete path; splash->clipToPath(path2, gFalse); delete path2; } SplashPath *SplashOutputDev::convertPath(GfxState *state, GfxPath *path, GBool dropEmptySubpaths) { SplashPath *sPath; GfxSubpath *subpath; int n, i, j; n = dropEmptySubpaths ? 1 : 0; sPath = new SplashPath(); for (i = 0; i < path->getNumSubpaths(); ++i) { subpath = path->getSubpath(i); if (subpath->getNumPoints() > n) { sPath->moveTo((SplashCoord)subpath->getX(0), (SplashCoord)subpath->getY(0)); j = 1; while (j < subpath->getNumPoints()) { if (subpath->getCurve(j)) { sPath->curveTo((SplashCoord)subpath->getX(j), (SplashCoord)subpath->getY(j), (SplashCoord)subpath->getX(j+1), (SplashCoord)subpath->getY(j+1), (SplashCoord)subpath->getX(j+2), (SplashCoord)subpath->getY(j+2)); j += 3; } else { sPath->lineTo((SplashCoord)subpath->getX(j), (SplashCoord)subpath->getY(j)); ++j; } } if (subpath->isClosed()) { sPath->close(); } } } return sPath; } void SplashOutputDev::drawChar(GfxState *state, double x, double y, double dx, double dy, double originX, double originY, CharCode code, int nBytes, Unicode *u, int uLen) { SplashPath *path; int render; GBool doFill, doStroke, doClip, strokeAdjust; double m[4]; GBool horiz; if (skipHorizText || skipRotatedText) { state->getFontTransMat(&m[0], &m[1], &m[2], &m[3]); horiz = m[0] > 0 && fabs(m[1]) < 0.001 && fabs(m[2]) < 0.001 && m[3] < 0; if ((skipHorizText && horiz) || (skipRotatedText && !horiz)) { return; } } // check for invisible text -- this is used by Acrobat Capture render = state->getRender(); if (render == 3) { return; } if (needFontUpdate) { doUpdateFont(state); } if (!font) { return; } x -= originX; y -= originY; doFill = !(render & 1) && !state->getFillColorSpace()->isNonMarking(); doStroke = ((render & 3) == 1 || (render & 3) == 2) && !state->getStrokeColorSpace()->isNonMarking(); doClip = render & 4; path = NULL; if (doStroke || doClip) { if ((path = font->getGlyphPath(code))) { path->offset((SplashCoord)x, (SplashCoord)y); } } // don't use stroke adjustment when stroking text -- the results // tend to be ugly (because characters with horizontal upper or // lower edges get misaligned relative to the other characters) strokeAdjust = gFalse; // make gcc happy if (doStroke) { strokeAdjust = splash->getStrokeAdjust(); splash->setStrokeAdjust(gFalse); } // fill and stroke if (doFill && doStroke) { if (path) { setOverprintMask(state->getFillColorSpace(), state->getFillOverprint(), state->getOverprintMode(), state->getFillColor()); splash->fill(path, gFalse); setOverprintMask(state->getStrokeColorSpace(), state->getStrokeOverprint(), state->getOverprintMode(), state->getStrokeColor()); splash->stroke(path); } // fill } else if (doFill) { setOverprintMask(state->getFillColorSpace(), state->getFillOverprint(), state->getOverprintMode(), state->getFillColor()); splash->fillChar((SplashCoord)x, (SplashCoord)y, code, font); // stroke } else if (doStroke) { if (path) { setOverprintMask(state->getStrokeColorSpace(), state->getStrokeOverprint(), state->getOverprintMode(), state->getStrokeColor()); splash->stroke(path); } } // clip if (doClip) { if (path) { if (textClipPath) { textClipPath->append(path); } else { textClipPath = path; path = NULL; } } } if (doStroke) { splash->setStrokeAdjust(strokeAdjust); } if (path) { delete path; } } GBool SplashOutputDev::beginType3Char(GfxState *state, double x, double y, double dx, double dy, CharCode code, Unicode *u, int uLen) { GfxFont *gfxFont; Ref *fontID; double *ctm, *bbox; T3FontCache *t3Font; T3GlyphStack *t3gs; GBool validBBox; double m[4]; GBool horiz; double x1, y1, xMin, yMin, xMax, yMax, xt, yt; int i, j; if (skipHorizText || skipRotatedText) { state->getFontTransMat(&m[0], &m[1], &m[2], &m[3]); horiz = m[0] > 0 && fabs(m[1]) < 0.001 && fabs(m[2]) < 0.001 && m[3] < 0; if ((skipHorizText && horiz) || (skipRotatedText && !horiz)) { return gTrue; } } if (!(gfxFont = state->getFont())) { return gFalse; } fontID = gfxFont->getID(); ctm = state->getCTM(); state->transform(0, 0, &xt, &yt); // is it the first (MRU) font in the cache? if (!(nT3Fonts > 0 && t3FontCache[0]->matches(fontID, ctm[0], ctm[1], ctm[2], ctm[3]))) { // is the font elsewhere in the cache? for (i = 1; i < nT3Fonts; ++i) { if (t3FontCache[i]->matches(fontID, ctm[0], ctm[1], ctm[2], ctm[3])) { t3Font = t3FontCache[i]; for (j = i; j > 0; --j) { t3FontCache[j] = t3FontCache[j - 1]; } t3FontCache[0] = t3Font; break; } } if (i >= nT3Fonts) { // create new entry in the font cache if (nT3Fonts == splashOutT3FontCacheSize) { t3gs = t3GlyphStack; while (t3gs != NULL) { if (t3gs->cache == t3FontCache[nT3Fonts - 1]) { error(errSyntaxWarning, -1, "t3FontCache reaches limit but font still on stack in SplashOutputDev::beginType3Char"); return gTrue; } t3gs = t3gs->next; } delete t3FontCache[nT3Fonts - 1]; --nT3Fonts; } for (j = nT3Fonts; j > 0; --j) { t3FontCache[j] = t3FontCache[j - 1]; } ++nT3Fonts; bbox = gfxFont->getFontBBox(); if (bbox[0] == 0 && bbox[1] == 0 && bbox[2] == 0 && bbox[3] == 0) { // unspecified bounding box -- just take a guess xMin = xt - 5; xMax = xMin + 30; yMax = yt + 15; yMin = yMax - 45; validBBox = gFalse; } else { state->transform(bbox[0], bbox[1], &x1, &y1); xMin = xMax = x1; yMin = yMax = y1; state->transform(bbox[0], bbox[3], &x1, &y1); if (x1 < xMin) { xMin = x1; } else if (x1 > xMax) { xMax = x1; } if (y1 < yMin) { yMin = y1; } else if (y1 > yMax) { yMax = y1; } state->transform(bbox[2], bbox[1], &x1, &y1); if (x1 < xMin) { xMin = x1; } else if (x1 > xMax) { xMax = x1; } if (y1 < yMin) { yMin = y1; } else if (y1 > yMax) { yMax = y1; } state->transform(bbox[2], bbox[3], &x1, &y1); if (x1 < xMin) { xMin = x1; } else if (x1 > xMax) { xMax = x1; } if (y1 < yMin) { yMin = y1; } else if (y1 > yMax) { yMax = y1; } validBBox = gTrue; } t3FontCache[0] = new T3FontCache(fontID, ctm[0], ctm[1], ctm[2], ctm[3], (int)floor(xMin - xt) - 2, (int)floor(yMin - yt) - 2, (int)ceil(xMax) - (int)floor(xMin) + 4, (int)ceil(yMax) - (int)floor(yMin) + 4, validBBox, colorMode != splashModeMono1); } } t3Font = t3FontCache[0]; // is the glyph in the cache? i = (code & (t3Font->cacheSets - 1)) * t3Font->cacheAssoc; for (j = 0; j < t3Font->cacheAssoc; ++j) { if (t3Font->cacheTags != NULL) { if ((t3Font->cacheTags[i+j].mru & 0x8000) && t3Font->cacheTags[i+j].code == code) { drawType3Glyph(state, t3Font, &t3Font->cacheTags[i+j], t3Font->cacheData + (i+j) * t3Font->glyphSize); return gTrue; } } } // push a new Type 3 glyph record t3gs = new T3GlyphStack(); t3gs->next = t3GlyphStack; t3GlyphStack = t3gs; t3GlyphStack->code = code; t3GlyphStack->cache = t3Font; t3GlyphStack->cacheTag = NULL; t3GlyphStack->cacheData = NULL; haveT3Dx = gFalse; return gFalse; } void SplashOutputDev::endType3Char(GfxState *state) { T3GlyphStack *t3gs; double *ctm; if (t3GlyphStack->cacheTag) { --nestCount; memcpy(t3GlyphStack->cacheData, bitmap->getDataPtr(), t3GlyphStack->cache->glyphSize); delete bitmap; delete splash; bitmap = t3GlyphStack->origBitmap; splash = t3GlyphStack->origSplash; ctm = state->getCTM(); state->setCTM(ctm[0], ctm[1], ctm[2], ctm[3], t3GlyphStack->origCTM4, t3GlyphStack->origCTM5); updateCTM(state, 0, 0, 0, 0, 0, 0); drawType3Glyph(state, t3GlyphStack->cache, t3GlyphStack->cacheTag, t3GlyphStack->cacheData); } t3gs = t3GlyphStack; t3GlyphStack = t3gs->next; delete t3gs; } void SplashOutputDev::type3D0(GfxState *state, double wx, double wy) { haveT3Dx = gTrue; } void SplashOutputDev::type3D1(GfxState *state, double wx, double wy, double llx, double lly, double urx, double ury) { double *ctm; T3FontCache *t3Font; SplashColor color; double xt, yt, xMin, xMax, yMin, yMax, x1, y1; int i, j; // ignore multiple d0/d1 operators if (haveT3Dx) { return; } haveT3Dx = gTrue; if (unlikely(t3GlyphStack == NULL)) { error(errSyntaxWarning, -1, "t3GlyphStack was null in SplashOutputDev::type3D1"); return; } if (unlikely(t3GlyphStack->origBitmap != NULL)) { error(errSyntaxWarning, -1, "t3GlyphStack origBitmap was not null in SplashOutputDev::type3D1"); return; } if (unlikely(t3GlyphStack->origSplash != NULL)) { error(errSyntaxWarning, -1, "t3GlyphStack origSplash was not null in SplashOutputDev::type3D1"); return; } t3Font = t3GlyphStack->cache; // check for a valid bbox state->transform(0, 0, &xt, &yt); state->transform(llx, lly, &x1, &y1); xMin = xMax = x1; yMin = yMax = y1; state->transform(llx, ury, &x1, &y1); if (x1 < xMin) { xMin = x1; } else if (x1 > xMax) { xMax = x1; } if (y1 < yMin) { yMin = y1; } else if (y1 > yMax) { yMax = y1; } state->transform(urx, lly, &x1, &y1); if (x1 < xMin) { xMin = x1; } else if (x1 > xMax) { xMax = x1; } if (y1 < yMin) { yMin = y1; } else if (y1 > yMax) { yMax = y1; } state->transform(urx, ury, &x1, &y1); if (x1 < xMin) { xMin = x1; } else if (x1 > xMax) { xMax = x1; } if (y1 < yMin) { yMin = y1; } else if (y1 > yMax) { yMax = y1; } if (xMin - xt < t3Font->glyphX || yMin - yt < t3Font->glyphY || xMax - xt > t3Font->glyphX + t3Font->glyphW || yMax - yt > t3Font->glyphY + t3Font->glyphH) { if (t3Font->validBBox) { error(errSyntaxWarning, -1, "Bad bounding box in Type 3 glyph"); } return; } if (t3Font->cacheTags == NULL) return; // allocate a cache entry i = (t3GlyphStack->code & (t3Font->cacheSets - 1)) * t3Font->cacheAssoc; for (j = 0; j < t3Font->cacheAssoc; ++j) { if ((t3Font->cacheTags[i+j].mru & 0x7fff) == t3Font->cacheAssoc - 1) { t3Font->cacheTags[i+j].mru = 0x8000; t3Font->cacheTags[i+j].code = t3GlyphStack->code; t3GlyphStack->cacheTag = &t3Font->cacheTags[i+j]; t3GlyphStack->cacheData = t3Font->cacheData + (i+j) * t3Font->glyphSize; } else { ++t3Font->cacheTags[i+j].mru; } } // save state t3GlyphStack->origBitmap = bitmap; t3GlyphStack->origSplash = splash; ctm = state->getCTM(); t3GlyphStack->origCTM4 = ctm[4]; t3GlyphStack->origCTM5 = ctm[5]; // create the temporary bitmap if (colorMode == splashModeMono1) { bitmap = new SplashBitmap(t3Font->glyphW, t3Font->glyphH, 1, splashModeMono1, gFalse); splash = new Splash(bitmap, gFalse, t3GlyphStack->origSplash->getScreen()); color[0] = 0; splash->clear(color); color[0] = 0xff; } else { bitmap = new SplashBitmap(t3Font->glyphW, t3Font->glyphH, 1, splashModeMono8, gFalse); splash = new Splash(bitmap, vectorAntialias, t3GlyphStack->origSplash->getScreen()); color[0] = 0x00; splash->clear(color); color[0] = 0xff; } splash->setMinLineWidth(globalParams->getMinLineWidth()); splash->setThinLineMode(splashThinLineDefault); splash->setFillPattern(new SplashSolidColor(color)); splash->setStrokePattern(new SplashSolidColor(color)); //~ this should copy other state from t3GlyphStack->origSplash? state->setCTM(ctm[0], ctm[1], ctm[2], ctm[3], -t3Font->glyphX, -t3Font->glyphY); updateCTM(state, 0, 0, 0, 0, 0, 0); ++nestCount; } void SplashOutputDev::drawType3Glyph(GfxState *state, T3FontCache *t3Font, T3FontCacheTag * /*tag*/, Guchar *data) { SplashGlyphBitmap glyph; setOverprintMask(state->getFillColorSpace(), state->getFillOverprint(), state->getOverprintMode(), state->getFillColor()); glyph.x = -t3Font->glyphX; glyph.y = -t3Font->glyphY; glyph.w = t3Font->glyphW; glyph.h = t3Font->glyphH; glyph.aa = colorMode != splashModeMono1; glyph.data = data; glyph.freeData = gFalse; splash->fillGlyph(0, 0, &glyph); } void SplashOutputDev::beginTextObject(GfxState *state) { } void SplashOutputDev::endTextObject(GfxState *state) { if (textClipPath) { splash->clipToPath(textClipPath, gFalse); delete textClipPath; textClipPath = NULL; } } struct SplashOutImageMaskData { ImageStream *imgStr; GBool invert; int width, height, y; }; GBool SplashOutputDev::imageMaskSrc(void *data, SplashColorPtr line) { SplashOutImageMaskData *imgMaskData = (SplashOutImageMaskData *)data; Guchar *p; SplashColorPtr q; int x; if (imgMaskData->y == imgMaskData->height) { return gFalse; } if (!(p = imgMaskData->imgStr->getLine())) { return gFalse; } for (x = 0, q = line; x < imgMaskData->width; ++x) { *q++ = *p++ ^ imgMaskData->invert; } ++imgMaskData->y; return gTrue; } void SplashOutputDev::drawImageMask(GfxState *state, Object *ref, Stream *str, int width, int height, GBool invert, GBool interpolate, GBool inlineImg) { double *ctm; SplashCoord mat[6]; SplashOutImageMaskData imgMaskData; if (state->getFillColorSpace()->isNonMarking()) { return; } setOverprintMask(state->getFillColorSpace(), state->getFillOverprint(), state->getOverprintMode(), state->getFillColor()); ctm = state->getCTM(); for (int i = 0; i < 6; ++i) { if (!isfinite(ctm[i])) return; } mat[0] = ctm[0]; mat[1] = ctm[1]; mat[2] = -ctm[2]; mat[3] = -ctm[3]; mat[4] = ctm[2] + ctm[4]; mat[5] = ctm[3] + ctm[5]; imgMaskData.imgStr = new ImageStream(str, width, 1, 1); imgMaskData.imgStr->reset(); imgMaskData.invert = invert ? 0 : 1; imgMaskData.width = width; imgMaskData.height = height; imgMaskData.y = 0; splash->fillImageMask(&imageMaskSrc, &imgMaskData, width, height, mat, t3GlyphStack != NULL); if (inlineImg) { while (imgMaskData.y < height) { imgMaskData.imgStr->getLine(); ++imgMaskData.y; } } delete imgMaskData.imgStr; str->close(); } void SplashOutputDev::setSoftMaskFromImageMask(GfxState *state, Object *ref, Stream *str, int width, int height, GBool invert, GBool inlineImg, double *baseMatrix) { double *ctm; SplashCoord mat[6]; SplashOutImageMaskData imgMaskData; Splash *maskSplash; SplashColor maskColor; double bbox[4] = {0, 0, 1, 1}; // default; if (state->getFillColorSpace()->isNonMarking()) { return; } ctm = state->getCTM(); for (int i = 0; i < 6; ++i) { if (!isfinite(ctm[i])) return; } beginTransparencyGroup(state, bbox, NULL, gFalse, gFalse, gFalse); baseMatrix[4] -= transpGroupStack->tx; baseMatrix[5] -= transpGroupStack->ty; ctm = state->getCTM(); mat[0] = ctm[0]; mat[1] = ctm[1]; mat[2] = -ctm[2]; mat[3] = -ctm[3]; mat[4] = ctm[2] + ctm[4]; mat[5] = ctm[3] + ctm[5]; imgMaskData.imgStr = new ImageStream(str, width, 1, 1); imgMaskData.imgStr->reset(); imgMaskData.invert = invert ? 0 : 1; imgMaskData.width = width; imgMaskData.height = height; imgMaskData.y = 0; maskBitmap = new SplashBitmap(bitmap->getWidth(), bitmap->getHeight(), 1, splashModeMono8, gFalse); maskSplash = new Splash(maskBitmap, vectorAntialias); maskColor[0] = 0; maskSplash->clear(maskColor); maskColor[0] = 0xff; maskSplash->setFillPattern(new SplashSolidColor(maskColor)); maskSplash->fillImageMask(&imageMaskSrc, &imgMaskData, width, height, mat, t3GlyphStack != NULL); delete maskSplash; delete imgMaskData.imgStr; str->close(); } void SplashOutputDev::unsetSoftMaskFromImageMask(GfxState *state, double *baseMatrix) { double bbox[4] = {0,0,1,1}; // dummy /* transfer mask to alpha channel! */ // memcpy(maskBitmap->getAlphaPtr(), maskBitmap->getDataPtr(), bitmap->getRowSize() * bitmap->getHeight()); // memset(maskBitmap->getDataPtr(), 0, bitmap->getRowSize() * bitmap->getHeight()); Guchar *dest = bitmap->getAlphaPtr(); Guchar *src = maskBitmap->getDataPtr(); for (int c= 0; c < maskBitmap->getRowSize() * maskBitmap->getHeight(); c++) { dest[c] = src[c]; } delete maskBitmap; maskBitmap = NULL; endTransparencyGroup(state); baseMatrix[4] += transpGroupStack->tx; baseMatrix[5] += transpGroupStack->ty; paintTransparencyGroup(state, bbox); } struct SplashOutImageData { ImageStream *imgStr; GfxImageColorMap *colorMap; SplashColorPtr lookup; int *maskColors; SplashColorMode colorMode; int width, height, y; }; GBool SplashOutputDev::imageSrc(void *data, SplashColorPtr colorLine, Guchar * /*alphaLine*/) { SplashOutImageData *imgData = (SplashOutImageData *)data; Guchar *p; SplashColorPtr q, col; GfxRGB rgb; GfxGray gray; #if SPLASH_CMYK GfxCMYK cmyk; GfxColor deviceN; #endif int nComps, x; if (imgData->y == imgData->height) { return gFalse; } if (!(p = imgData->imgStr->getLine())) { return gFalse; } nComps = imgData->colorMap->getNumPixelComps(); if (imgData->lookup) { switch (imgData->colorMode) { case splashModeMono1: case splashModeMono8: for (x = 0, q = colorLine; x < imgData->width; ++x, ++p) { *q++ = imgData->lookup[*p]; } break; case splashModeRGB8: case splashModeBGR8: for (x = 0, q = colorLine; x < imgData->width; ++x, ++p) { col = &imgData->lookup[3 * *p]; *q++ = col[0]; *q++ = col[1]; *q++ = col[2]; } break; case splashModeXBGR8: for (x = 0, q = colorLine; x < imgData->width; ++x, ++p) { col = &imgData->lookup[4 * *p]; *q++ = col[0]; *q++ = col[1]; *q++ = col[2]; *q++ = col[3]; } break; #if SPLASH_CMYK case splashModeCMYK8: for (x = 0, q = colorLine; x < imgData->width; ++x, ++p) { col = &imgData->lookup[4 * *p]; *q++ = col[0]; *q++ = col[1]; *q++ = col[2]; *q++ = col[3]; } break; case splashModeDeviceN8: for (x = 0, q = colorLine; x < imgData->width; ++x, ++p) { col = &imgData->lookup[(SPOT_NCOMPS+4) * *p]; for (int cp = 0; cp < SPOT_NCOMPS+4; cp++) *q++ = col[cp]; } break; #endif } } else { switch (imgData->colorMode) { case splashModeMono1: case splashModeMono8: for (x = 0, q = colorLine; x < imgData->width; ++x, p += nComps) { imgData->colorMap->getGray(p, &gray); *q++ = colToByte(gray); } break; case splashModeRGB8: case splashModeBGR8: if (imgData->colorMap->useRGBLine()) { imgData->colorMap->getRGBLine(p, (Guchar *) colorLine, imgData->width); } else { for (x = 0, q = colorLine; x < imgData->width; ++x, p += nComps) { imgData->colorMap->getRGB(p, &rgb); *q++ = colToByte(rgb.r); *q++ = colToByte(rgb.g); *q++ = colToByte(rgb.b); } } break; case splashModeXBGR8: if (imgData->colorMap->useRGBLine()) { imgData->colorMap->getRGBXLine(p, (Guchar *) colorLine, imgData->width); } else { for (x = 0, q = colorLine; x < imgData->width; ++x, p += nComps) { imgData->colorMap->getRGB(p, &rgb); *q++ = colToByte(rgb.r); *q++ = colToByte(rgb.g); *q++ = colToByte(rgb.b); *q++ = 255; } } break; #if SPLASH_CMYK case splashModeCMYK8: if (imgData->colorMap->useCMYKLine()) { imgData->colorMap->getCMYKLine(p, (Guchar *) colorLine, imgData->width); } else { for (x = 0, q = colorLine; x < imgData->width; ++x, p += nComps) { imgData->colorMap->getCMYK(p, &cmyk); *q++ = colToByte(cmyk.c); *q++ = colToByte(cmyk.m); *q++ = colToByte(cmyk.y); *q++ = colToByte(cmyk.k); } } break; case splashModeDeviceN8: if (imgData->colorMap->useDeviceNLine()) { imgData->colorMap->getDeviceNLine(p, (Guchar *) colorLine, imgData->width); } else { for (x = 0, q = colorLine; x < imgData->width; ++x, p += nComps) { imgData->colorMap->getDeviceN(p, &deviceN); for (int cp = 0; cp < SPOT_NCOMPS+4; cp++) *q++ = colToByte(deviceN.c[cp]); } } break; #endif } } ++imgData->y; return gTrue; } GBool SplashOutputDev::alphaImageSrc(void *data, SplashColorPtr colorLine, Guchar *alphaLine) { SplashOutImageData *imgData = (SplashOutImageData *)data; Guchar *p, *aq; SplashColorPtr q, col; GfxRGB rgb; GfxGray gray; #if SPLASH_CMYK GfxCMYK cmyk; GfxColor deviceN; #endif Guchar alpha; int nComps, x, i; if (imgData->y == imgData->height) { return gFalse; } if (!(p = imgData->imgStr->getLine())) { return gFalse; } nComps = imgData->colorMap->getNumPixelComps(); for (x = 0, q = colorLine, aq = alphaLine; x < imgData->width; ++x, p += nComps) { alpha = 0; for (i = 0; i < nComps; ++i) { if (p[i] < imgData->maskColors[2*i] || p[i] > imgData->maskColors[2*i+1]) { alpha = 0xff; break; } } if (imgData->lookup) { switch (imgData->colorMode) { case splashModeMono1: case splashModeMono8: *q++ = imgData->lookup[*p]; break; case splashModeRGB8: case splashModeBGR8: col = &imgData->lookup[3 * *p]; *q++ = col[0]; *q++ = col[1]; *q++ = col[2]; break; case splashModeXBGR8: col = &imgData->lookup[4 * *p]; *q++ = col[0]; *q++ = col[1]; *q++ = col[2]; *q++ = 255; break; #if SPLASH_CMYK case splashModeCMYK8: col = &imgData->lookup[4 * *p]; *q++ = col[0]; *q++ = col[1]; *q++ = col[2]; *q++ = col[3]; break; case splashModeDeviceN8: col = &imgData->lookup[(SPOT_NCOMPS+4) * *p]; for (int cp = 0; cp < SPOT_NCOMPS+4; cp++) *q++ = col[cp]; break; #endif } *aq++ = alpha; } else { switch (imgData->colorMode) { case splashModeMono1: case splashModeMono8: imgData->colorMap->getGray(p, &gray); *q++ = colToByte(gray); break; case splashModeXBGR8: case splashModeRGB8: case splashModeBGR8: imgData->colorMap->getRGB(p, &rgb); *q++ = colToByte(rgb.r); *q++ = colToByte(rgb.g); *q++ = colToByte(rgb.b); if (imgData->colorMode == splashModeXBGR8) *q++ = 255; break; #if SPLASH_CMYK case splashModeCMYK8: imgData->colorMap->getCMYK(p, &cmyk); *q++ = colToByte(cmyk.c); *q++ = colToByte(cmyk.m); *q++ = colToByte(cmyk.y); *q++ = colToByte(cmyk.k); break; case splashModeDeviceN8: imgData->colorMap->getDeviceN(p, &deviceN); for (int cp = 0; cp < SPOT_NCOMPS+4; cp++) *q++ = colToByte(deviceN.c[cp]); break; #endif } *aq++ = alpha; } } ++imgData->y; return gTrue; } struct TilingSplashOutBitmap { SplashBitmap *bitmap; SplashPattern *pattern; SplashColorMode colorMode; int paintType; int repeatX; int repeatY; int y; }; GBool SplashOutputDev::tilingBitmapSrc(void *data, SplashColorPtr colorLine, Guchar *alphaLine) { TilingSplashOutBitmap *imgData = (TilingSplashOutBitmap *)data; if (imgData->y == imgData->bitmap->getHeight()) { imgData->repeatY--; if (imgData->repeatY == 0) return gFalse; imgData->y = 0; } if (imgData->paintType == 1) { const SplashColorMode cMode = imgData->bitmap->getMode(); SplashColorPtr q = colorLine; // For splashModeBGR8 and splashModeXBGR8 we need to use getPixel // for the others we can use raw access if (cMode == splashModeBGR8 || cMode == splashModeXBGR8) { for (int m = 0; m < imgData->repeatX; m++) { for (int x = 0; x < imgData->bitmap->getWidth(); x++) { imgData->bitmap->getPixel(x, imgData->y, q); q += splashColorModeNComps[cMode]; } } } else { const int n = imgData->bitmap->getRowSize(); SplashColorPtr p; for (int m = 0; m < imgData->repeatX; m++) { p = imgData->bitmap->getDataPtr() + imgData->y * imgData->bitmap->getRowSize(); for (int x = 0; x < n; ++x) { *q++ = *p++; } } } if (alphaLine != NULL) { SplashColorPtr aq = alphaLine; SplashColorPtr p; const int n = imgData->bitmap->getWidth() - 1; for (int m = 0; m < imgData->repeatX; m++) { p = imgData->bitmap->getAlphaPtr() + imgData->y * imgData->bitmap->getWidth(); for (int x = 0; x < n; ++x) { *aq++ = *p++; } // This is a hack, because of how Splash antialias works if we overwrite the // last alpha pixel of the tile most/all of the files look much better *aq++ = (n == 0) ? *p : *(p - 1); } } } else { SplashColor col, pat; SplashColorPtr dest = colorLine; for (int m = 0; m < imgData->repeatX; m++) { for (int x = 0; x < imgData->bitmap->getWidth(); x++) { imgData->bitmap->getPixel(x, imgData->y, col); imgData->pattern->getColor(x, imgData->y, pat); for (int i = 0; i < splashColorModeNComps[imgData->colorMode]; ++i) { #if SPLASH_CMYK if (imgData->colorMode == splashModeCMYK8 || imgData->colorMode == splashModeDeviceN8) dest[i] = div255(pat[i] * (255 - col[0])); else #endif dest[i] = 255 - div255((255 - pat[i]) * (255 - col[0])); } dest += splashColorModeNComps[imgData->colorMode]; } } if (alphaLine != NULL) { const int y = (imgData->y == imgData->bitmap->getHeight() - 1 && imgData->y > 50) ? imgData->y - 1 : imgData->y; SplashColorPtr aq = alphaLine; SplashColorPtr p; const int n = imgData->bitmap->getWidth(); for (int m = 0; m < imgData->repeatX; m++) { p = imgData->bitmap->getAlphaPtr() + y * imgData->bitmap->getWidth(); for (int x = 0; x < n; ++x) { *aq++ = *p++; } } } } ++imgData->y; return gTrue; } void SplashOutputDev::drawImage(GfxState *state, Object *ref, Stream *str, int width, int height, GfxImageColorMap *colorMap, GBool interpolate, int *maskColors, GBool inlineImg) { double *ctm; SplashCoord mat[6]; SplashOutImageData imgData; SplashColorMode srcMode; SplashImageSource src; GfxGray gray; GfxRGB rgb; #if SPLASH_CMYK GfxCMYK cmyk; GBool grayIndexed = gFalse; GfxColor deviceN; #endif Guchar pix; int n, i; ctm = state->getCTM(); for (i = 0; i < 6; ++i) { if (!isfinite(ctm[i])) return; } mat[0] = ctm[0]; mat[1] = ctm[1]; mat[2] = -ctm[2]; mat[3] = -ctm[3]; mat[4] = ctm[2] + ctm[4]; mat[5] = ctm[3] + ctm[5]; imgData.imgStr = new ImageStream(str, width, colorMap->getNumPixelComps(), colorMap->getBits()); imgData.imgStr->reset(); imgData.colorMap = colorMap; imgData.maskColors = maskColors; imgData.colorMode = colorMode; imgData.width = width; imgData.height = height; imgData.y = 0; // special case for one-channel (monochrome/gray/separation) images: // build a lookup table here imgData.lookup = NULL; if (colorMap->getNumPixelComps() == 1) { n = 1 << colorMap->getBits(); switch (colorMode) { case splashModeMono1: case splashModeMono8: imgData.lookup = (SplashColorPtr)gmalloc(n); for (i = 0; i < n; ++i) { pix = (Guchar)i; colorMap->getGray(&pix, &gray); imgData.lookup[i] = colToByte(gray); } break; case splashModeRGB8: case splashModeBGR8: imgData.lookup = (SplashColorPtr)gmallocn(n, 3); for (i = 0; i < n; ++i) { pix = (Guchar)i; colorMap->getRGB(&pix, &rgb); imgData.lookup[3*i] = colToByte(rgb.r); imgData.lookup[3*i+1] = colToByte(rgb.g); imgData.lookup[3*i+2] = colToByte(rgb.b); } break; case splashModeXBGR8: imgData.lookup = (SplashColorPtr)gmallocn(n, 4); for (i = 0; i < n; ++i) { pix = (Guchar)i; colorMap->getRGB(&pix, &rgb); imgData.lookup[4*i] = colToByte(rgb.r); imgData.lookup[4*i+1] = colToByte(rgb.g); imgData.lookup[4*i+2] = colToByte(rgb.b); imgData.lookup[4*i+3] = 255; } break; #if SPLASH_CMYK case splashModeCMYK8: grayIndexed = colorMap->getColorSpace()->getMode() != csDeviceGray; imgData.lookup = (SplashColorPtr)gmallocn(n, 4); for (i = 0; i < n; ++i) { pix = (Guchar)i; colorMap->getCMYK(&pix, &cmyk); if (cmyk.c != 0 || cmyk.m != 0 || cmyk.y != 0) { grayIndexed = gFalse; } imgData.lookup[4*i] = colToByte(cmyk.c); imgData.lookup[4*i+1] = colToByte(cmyk.m); imgData.lookup[4*i+2] = colToByte(cmyk.y); imgData.lookup[4*i+3] = colToByte(cmyk.k); } break; case splashModeDeviceN8: colorMap->getColorSpace()->createMapping(bitmap->getSeparationList(), SPOT_NCOMPS); grayIndexed = colorMap->getColorSpace()->getMode() != csDeviceGray; imgData.lookup = (SplashColorPtr)gmallocn(n, SPOT_NCOMPS+4); for (i = 0; i < n; ++i) { pix = (Guchar)i; colorMap->getCMYK(&pix, &cmyk); if (cmyk.c != 0 || cmyk.m != 0 || cmyk.y != 0) { grayIndexed = gFalse; } colorMap->getDeviceN(&pix, &deviceN); for (int cp = 0; cp < SPOT_NCOMPS+4; cp++) imgData.lookup[(SPOT_NCOMPS+4)*i +cp] = colToByte(deviceN.c[cp]); } break; #endif } } #if SPLASH_CMYK setOverprintMask(colorMap->getColorSpace(), state->getFillOverprint(), state->getOverprintMode(), NULL, grayIndexed); #else setOverprintMask(colorMap->getColorSpace(), state->getFillOverprint(), state->getOverprintMode(), NULL); #endif if (colorMode == splashModeMono1) { srcMode = splashModeMono8; } else { srcMode = colorMode; } src = maskColors ? &alphaImageSrc : &imageSrc; splash->drawImage(src, &imgData, srcMode, maskColors ? gTrue : gFalse, width, height, mat, interpolate); if (inlineImg) { while (imgData.y < height) { imgData.imgStr->getLine(); ++imgData.y; } } gfree(imgData.lookup); delete imgData.imgStr; str->close(); } struct SplashOutMaskedImageData { ImageStream *imgStr; GfxImageColorMap *colorMap; SplashBitmap *mask; SplashColorPtr lookup; SplashColorMode colorMode; int width, height, y; }; GBool SplashOutputDev::maskedImageSrc(void *data, SplashColorPtr colorLine, Guchar *alphaLine) { SplashOutMaskedImageData *imgData = (SplashOutMaskedImageData *)data; Guchar *p, *aq; SplashColorPtr q, col; GfxRGB rgb; GfxGray gray; #if SPLASH_CMYK GfxCMYK cmyk; GfxColor deviceN; #endif Guchar alpha; Guchar *maskPtr; int maskBit; int nComps, x; if (imgData->y == imgData->height) { return gFalse; } if (!(p = imgData->imgStr->getLine())) { return gFalse; } nComps = imgData->colorMap->getNumPixelComps(); maskPtr = imgData->mask->getDataPtr() + imgData->y * imgData->mask->getRowSize(); maskBit = 0x80; for (x = 0, q = colorLine, aq = alphaLine; x < imgData->width; ++x, p += nComps) { alpha = (*maskPtr & maskBit) ? 0xff : 0x00; if (!(maskBit >>= 1)) { ++maskPtr; maskBit = 0x80; } if (imgData->lookup) { switch (imgData->colorMode) { case splashModeMono1: case splashModeMono8: *q++ = imgData->lookup[*p]; break; case splashModeRGB8: case splashModeBGR8: col = &imgData->lookup[3 * *p]; *q++ = col[0]; *q++ = col[1]; *q++ = col[2]; break; case splashModeXBGR8: col = &imgData->lookup[4 * *p]; *q++ = col[0]; *q++ = col[1]; *q++ = col[2]; *q++ = 255; break; #if SPLASH_CMYK case splashModeCMYK8: col = &imgData->lookup[4 * *p]; *q++ = col[0]; *q++ = col[1]; *q++ = col[2]; *q++ = col[3]; break; case splashModeDeviceN8: col = &imgData->lookup[(SPOT_NCOMPS+4) * *p]; for (int cp = 0; cp < SPOT_NCOMPS+4; cp++) *q++ = col[cp]; break; #endif } *aq++ = alpha; } else { switch (imgData->colorMode) { case splashModeMono1: case splashModeMono8: imgData->colorMap->getGray(p, &gray); *q++ = colToByte(gray); break; case splashModeXBGR8: case splashModeRGB8: case splashModeBGR8: imgData->colorMap->getRGB(p, &rgb); *q++ = colToByte(rgb.r); *q++ = colToByte(rgb.g); *q++ = colToByte(rgb.b); if (imgData->colorMode == splashModeXBGR8) *q++ = 255; break; #if SPLASH_CMYK case splashModeCMYK8: imgData->colorMap->getCMYK(p, &cmyk); *q++ = colToByte(cmyk.c); *q++ = colToByte(cmyk.m); *q++ = colToByte(cmyk.y); *q++ = colToByte(cmyk.k); break; case splashModeDeviceN8: imgData->colorMap->getDeviceN(p, &deviceN); for (int cp = 0; cp < SPOT_NCOMPS+4; cp++) *q++ = colToByte(deviceN.c[cp]); break; #endif } *aq++ = alpha; } } ++imgData->y; return gTrue; } void SplashOutputDev::drawMaskedImage(GfxState *state, Object *ref, Stream *str, int width, int height, GfxImageColorMap *colorMap, GBool interpolate, Stream *maskStr, int maskWidth, int maskHeight, GBool maskInvert, GBool maskInterpolate) { GfxImageColorMap *maskColorMap; Object maskDecode, decodeLow, decodeHigh; double *ctm; SplashCoord mat[6]; SplashOutMaskedImageData imgData; SplashOutImageMaskData imgMaskData; SplashColorMode srcMode; SplashBitmap *maskBitmap; Splash *maskSplash; SplashColor maskColor; GfxGray gray; GfxRGB rgb; #if SPLASH_CMYK GfxCMYK cmyk; GfxColor deviceN; #endif Guchar pix; int n, i; #if SPLASH_CMYK colorMap->getColorSpace()->createMapping(bitmap->getSeparationList(), SPOT_NCOMPS); #endif setOverprintMask(colorMap->getColorSpace(), state->getFillOverprint(), state->getOverprintMode(), NULL); // If the mask is higher resolution than the image, use // drawSoftMaskedImage() instead. if (maskWidth > width || maskHeight > height) { decodeLow.initInt(maskInvert ? 0 : 1); decodeHigh.initInt(maskInvert ? 1 : 0); maskDecode.initArray((xref) ? xref : doc->getXRef()); maskDecode.arrayAdd(&decodeLow); maskDecode.arrayAdd(&decodeHigh); maskColorMap = new GfxImageColorMap(1, &maskDecode, new GfxDeviceGrayColorSpace()); maskDecode.free(); drawSoftMaskedImage(state, ref, str, width, height, colorMap, interpolate, maskStr, maskWidth, maskHeight, maskColorMap, maskInterpolate); delete maskColorMap; } else { //----- scale the mask image to the same size as the source image mat[0] = (SplashCoord)width; mat[1] = 0; mat[2] = 0; mat[3] = (SplashCoord)height; mat[4] = 0; mat[5] = 0; imgMaskData.imgStr = new ImageStream(maskStr, maskWidth, 1, 1); imgMaskData.imgStr->reset(); imgMaskData.invert = maskInvert ? 0 : 1; imgMaskData.width = maskWidth; imgMaskData.height = maskHeight; imgMaskData.y = 0; maskBitmap = new SplashBitmap(width, height, 1, splashModeMono1, gFalse); maskSplash = new Splash(maskBitmap, gFalse); maskColor[0] = 0; maskSplash->clear(maskColor); maskColor[0] = 0xff; maskSplash->setFillPattern(new SplashSolidColor(maskColor)); maskSplash->fillImageMask(&imageMaskSrc, &imgMaskData, maskWidth, maskHeight, mat, gFalse); delete imgMaskData.imgStr; maskStr->close(); delete maskSplash; //----- draw the source image ctm = state->getCTM(); for (i = 0; i < 6; ++i) { if (!isfinite(ctm[i])) { delete maskBitmap; return; } } mat[0] = ctm[0]; mat[1] = ctm[1]; mat[2] = -ctm[2]; mat[3] = -ctm[3]; mat[4] = ctm[2] + ctm[4]; mat[5] = ctm[3] + ctm[5]; imgData.imgStr = new ImageStream(str, width, colorMap->getNumPixelComps(), colorMap->getBits()); imgData.imgStr->reset(); imgData.colorMap = colorMap; imgData.mask = maskBitmap; imgData.colorMode = colorMode; imgData.width = width; imgData.height = height; imgData.y = 0; // special case for one-channel (monochrome/gray/separation) images: // build a lookup table here imgData.lookup = NULL; if (colorMap->getNumPixelComps() == 1) { n = 1 << colorMap->getBits(); switch (colorMode) { case splashModeMono1: case splashModeMono8: imgData.lookup = (SplashColorPtr)gmalloc(n); for (i = 0; i < n; ++i) { pix = (Guchar)i; colorMap->getGray(&pix, &gray); imgData.lookup[i] = colToByte(gray); } break; case splashModeRGB8: case splashModeBGR8: imgData.lookup = (SplashColorPtr)gmallocn(n, 3); for (i = 0; i < n; ++i) { pix = (Guchar)i; colorMap->getRGB(&pix, &rgb); imgData.lookup[3*i] = colToByte(rgb.r); imgData.lookup[3*i+1] = colToByte(rgb.g); imgData.lookup[3*i+2] = colToByte(rgb.b); } break; case splashModeXBGR8: imgData.lookup = (SplashColorPtr)gmallocn(n, 4); for (i = 0; i < n; ++i) { pix = (Guchar)i; colorMap->getRGB(&pix, &rgb); imgData.lookup[4*i] = colToByte(rgb.r); imgData.lookup[4*i+1] = colToByte(rgb.g); imgData.lookup[4*i+2] = colToByte(rgb.b); imgData.lookup[4*i+3] = 255; } break; #if SPLASH_CMYK case splashModeCMYK8: imgData.lookup = (SplashColorPtr)gmallocn(n, 4); for (i = 0; i < n; ++i) { pix = (Guchar)i; colorMap->getCMYK(&pix, &cmyk); imgData.lookup[4*i] = colToByte(cmyk.c); imgData.lookup[4*i+1] = colToByte(cmyk.m); imgData.lookup[4*i+2] = colToByte(cmyk.y); imgData.lookup[4*i+3] = colToByte(cmyk.k); } break; case splashModeDeviceN8: imgData.lookup = (SplashColorPtr)gmallocn(n, SPOT_NCOMPS+4); for (i = 0; i < n; ++i) { pix = (Guchar)i; colorMap->getDeviceN(&pix, &deviceN); for (int cp = 0; cp < SPOT_NCOMPS+4; cp++) imgData.lookup[(SPOT_NCOMPS+4)*i + cp] = colToByte(deviceN.c[cp]); } break; #endif } } if (colorMode == splashModeMono1) { srcMode = splashModeMono8; } else { srcMode = colorMode; } splash->drawImage(&maskedImageSrc, &imgData, srcMode, gTrue, width, height, mat, interpolate); delete maskBitmap; gfree(imgData.lookup); delete imgData.imgStr; str->close(); } } void SplashOutputDev::drawSoftMaskedImage(GfxState *state, Object *ref, Stream *str, int width, int height, GfxImageColorMap *colorMap, GBool interpolate, Stream *maskStr, int maskWidth, int maskHeight, GfxImageColorMap *maskColorMap, GBool maskInterpolate) { double *ctm; SplashCoord mat[6]; SplashOutImageData imgData; SplashOutImageData imgMaskData; SplashColorMode srcMode; SplashBitmap *maskBitmap; Splash *maskSplash; SplashColor maskColor; GfxGray gray; GfxRGB rgb; #if SPLASH_CMYK GfxCMYK cmyk; GfxColor deviceN; #endif Guchar pix; int n, i; #if SPLASH_CMYK colorMap->getColorSpace()->createMapping(bitmap->getSeparationList(), SPOT_NCOMPS); #endif setOverprintMask(colorMap->getColorSpace(), state->getFillOverprint(), state->getOverprintMode(), NULL); ctm = state->getCTM(); for (i = 0; i < 6; ++i) { if (!isfinite(ctm[i])) return; } mat[0] = ctm[0]; mat[1] = ctm[1]; mat[2] = -ctm[2]; mat[3] = -ctm[3]; mat[4] = ctm[2] + ctm[4]; mat[5] = ctm[3] + ctm[5]; //----- set up the soft mask imgMaskData.imgStr = new ImageStream(maskStr, maskWidth, maskColorMap->getNumPixelComps(), maskColorMap->getBits()); imgMaskData.imgStr->reset(); imgMaskData.colorMap = maskColorMap; imgMaskData.maskColors = NULL; imgMaskData.colorMode = splashModeMono8; imgMaskData.width = maskWidth; imgMaskData.height = maskHeight; imgMaskData.y = 0; n = 1 << maskColorMap->getBits(); imgMaskData.lookup = (SplashColorPtr)gmalloc(n); for (i = 0; i < n; ++i) { pix = (Guchar)i; maskColorMap->getGray(&pix, &gray); imgMaskData.lookup[i] = colToByte(gray); } maskBitmap = new SplashBitmap(bitmap->getWidth(), bitmap->getHeight(), 1, splashModeMono8, gFalse); maskSplash = new Splash(maskBitmap, vectorAntialias); maskColor[0] = 0; maskSplash->clear(maskColor); maskSplash->drawImage(&imageSrc, &imgMaskData, splashModeMono8, gFalse, maskWidth, maskHeight, mat, maskInterpolate); delete imgMaskData.imgStr; maskStr->close(); gfree(imgMaskData.lookup); delete maskSplash; splash->setSoftMask(maskBitmap); //----- draw the source image imgData.imgStr = new ImageStream(str, width, colorMap->getNumPixelComps(), colorMap->getBits()); imgData.imgStr->reset(); imgData.colorMap = colorMap; imgData.maskColors = NULL; imgData.colorMode = colorMode; imgData.width = width; imgData.height = height; imgData.y = 0; // special case for one-channel (monochrome/gray/separation) images: // build a lookup table here imgData.lookup = NULL; if (colorMap->getNumPixelComps() == 1) { n = 1 << colorMap->getBits(); switch (colorMode) { case splashModeMono1: case splashModeMono8: imgData.lookup = (SplashColorPtr)gmalloc(n); for (i = 0; i < n; ++i) { pix = (Guchar)i; colorMap->getGray(&pix, &gray); imgData.lookup[i] = colToByte(gray); } break; case splashModeRGB8: case splashModeBGR8: imgData.lookup = (SplashColorPtr)gmallocn(n, 3); for (i = 0; i < n; ++i) { pix = (Guchar)i; colorMap->getRGB(&pix, &rgb); imgData.lookup[3*i] = colToByte(rgb.r); imgData.lookup[3*i+1] = colToByte(rgb.g); imgData.lookup[3*i+2] = colToByte(rgb.b); } break; case splashModeXBGR8: imgData.lookup = (SplashColorPtr)gmallocn(n, 4); for (i = 0; i < n; ++i) { pix = (Guchar)i; colorMap->getRGB(&pix, &rgb); imgData.lookup[4*i] = colToByte(rgb.r); imgData.lookup[4*i+1] = colToByte(rgb.g); imgData.lookup[4*i+2] = colToByte(rgb.b); imgData.lookup[4*i+3] = 255; } break; #if SPLASH_CMYK case splashModeCMYK8: imgData.lookup = (SplashColorPtr)gmallocn(n, 4); for (i = 0; i < n; ++i) { pix = (Guchar)i; colorMap->getCMYK(&pix, &cmyk); imgData.lookup[4*i] = colToByte(cmyk.c); imgData.lookup[4*i+1] = colToByte(cmyk.m); imgData.lookup[4*i+2] = colToByte(cmyk.y); imgData.lookup[4*i+3] = colToByte(cmyk.k); } break; case splashModeDeviceN8: imgData.lookup = (SplashColorPtr)gmallocn(n, SPOT_NCOMPS+4); for (i = 0; i < n; ++i) { pix = (Guchar)i; colorMap->getDeviceN(&pix, &deviceN); for (int cp = 0; cp < SPOT_NCOMPS+4; cp++) imgData.lookup[(SPOT_NCOMPS+4)*i + cp] = colToByte(deviceN.c[cp]); } break; #endif } } if (colorMode == splashModeMono1) { srcMode = splashModeMono8; } else { srcMode = colorMode; } splash->drawImage(&imageSrc, &imgData, srcMode, gFalse, width, height, mat, interpolate); splash->setSoftMask(NULL); gfree(imgData.lookup); delete imgData.imgStr; str->close(); } GBool SplashOutputDev::checkTransparencyGroup(GfxState *state, GBool knockout) { if (state->getFillOpacity() != 1 || state->getStrokeOpacity() != 1 || state->getAlphaIsShape() || state->getBlendMode() != gfxBlendNormal || splash->getSoftMask() != NULL || knockout) return gTrue; return transpGroupStack != NULL && transpGroupStack->shape != NULL; } void SplashOutputDev::beginTransparencyGroup(GfxState *state, double *bbox, GfxColorSpace *blendingColorSpace, GBool isolated, GBool knockout, GBool forSoftMask) { SplashTransparencyGroup *transpGroup; SplashColor color; double xMin, yMin, xMax, yMax, x, y; int tx, ty, w, h, i; // transform the bbox state->transform(bbox[0], bbox[1], &x, &y); xMin = xMax = x; yMin = yMax = y; state->transform(bbox[0], bbox[3], &x, &y); if (x < xMin) { xMin = x; } else if (x > xMax) { xMax = x; } if (y < yMin) { yMin = y; } else if (y > yMax) { yMax = y; } state->transform(bbox[2], bbox[1], &x, &y); if (x < xMin) { xMin = x; } else if (x > xMax) { xMax = x; } if (y < yMin) { yMin = y; } else if (y > yMax) { yMax = y; } state->transform(bbox[2], bbox[3], &x, &y); if (x < xMin) { xMin = x; } else if (x > xMax) { xMax = x; } if (y < yMin) { yMin = y; } else if (y > yMax) { yMax = y; } tx = (int)floor(xMin); if (tx < 0) { tx = 0; } else if (tx >= bitmap->getWidth()) { tx = bitmap->getWidth() - 1; } ty = (int)floor(yMin); if (ty < 0) { ty = 0; } else if (ty >= bitmap->getHeight()) { ty = bitmap->getHeight() - 1; } w = (int)ceil(xMax) - tx + 1; if (tx + w > bitmap->getWidth()) { w = bitmap->getWidth() - tx; } if (w < 1) { w = 1; } h = (int)ceil(yMax) - ty + 1; if (ty + h > bitmap->getHeight()) { h = bitmap->getHeight() - ty; } if (h < 1) { h = 1; } // push a new stack entry transpGroup = new SplashTransparencyGroup(); transpGroup->tx = tx; transpGroup->ty = ty; transpGroup->blendingColorSpace = blendingColorSpace; transpGroup->isolated = isolated; transpGroup->shape = (knockout && !isolated) ? SplashBitmap::copy(bitmap) : NULL; transpGroup->knockout = (knockout && isolated); transpGroup->knockoutOpacity = 1.0; transpGroup->next = transpGroupStack; transpGroupStack = transpGroup; // save state transpGroup->origBitmap = bitmap; transpGroup->origSplash = splash; transpGroup->fontAA = fontEngine->getAA(); //~ this handles the blendingColorSpace arg for soft masks, but //~ not yet for transparency groups // switch to the blending color space if (forSoftMask && isolated && blendingColorSpace) { if (blendingColorSpace->getMode() == csDeviceGray || blendingColorSpace->getMode() == csCalGray || (blendingColorSpace->getMode() == csICCBased && blendingColorSpace->getNComps() == 1)) { colorMode = splashModeMono8; } else if (blendingColorSpace->getMode() == csDeviceRGB || blendingColorSpace->getMode() == csCalRGB || (blendingColorSpace->getMode() == csICCBased && blendingColorSpace->getNComps() == 3)) { //~ does this need to use BGR8? colorMode = splashModeRGB8; #if SPLASH_CMYK } else if (blendingColorSpace->getMode() == csDeviceCMYK || (blendingColorSpace->getMode() == csICCBased && blendingColorSpace->getNComps() == 4)) { colorMode = splashModeCMYK8; #endif } } // create the temporary bitmap bitmap = new SplashBitmap(w, h, bitmapRowPad, colorMode, gTrue, bitmapTopDown, bitmap->getSeparationList()); splash = new Splash(bitmap, vectorAntialias, transpGroup->origSplash->getScreen()); if (transpGroup->next != NULL && transpGroup->next->knockout) { fontEngine->setAA(gFalse); } splash->setThinLineMode(transpGroup->origSplash->getThinLineMode()); splash->setMinLineWidth(globalParams->getMinLineWidth()); //~ Acrobat apparently copies at least the fill and stroke colors, and //~ maybe other state(?) -- but not the clipping path (and not sure //~ what else) //~ [this is likely the same situation as in type3D1()] splash->setFillPattern(transpGroup->origSplash->getFillPattern()->copy()); splash->setStrokePattern( transpGroup->origSplash->getStrokePattern()->copy()); if (isolated) { for (i = 0; i < splashMaxColorComps; ++i) { color[i] = 0; } if (colorMode == splashModeXBGR8) color[3] = 255; splash->clear(color, 0); } else { SplashBitmap *shape = (knockout) ? transpGroup->shape : (transpGroup->next != NULL && transpGroup->next->shape != NULL) ? transpGroup->next->shape : transpGroup->origBitmap; int shapeTx = (knockout) ? tx : (transpGroup->next != NULL && transpGroup->next->shape != NULL) ? transpGroup->next->tx + tx : tx; int shapeTy = (knockout) ? ty : (transpGroup->next != NULL && transpGroup->next->shape != NULL) ? transpGroup->next->ty + ty : ty; splash->blitTransparent(transpGroup->origBitmap, tx, ty, 0, 0, w, h); splash->setInNonIsolatedGroup(shape, shapeTx, shapeTy); } transpGroup->tBitmap = bitmap; state->shiftCTMAndClip(-tx, -ty); updateCTM(state, 0, 0, 0, 0, 0, 0); ++nestCount; } void SplashOutputDev::endTransparencyGroup(GfxState *state) { // restore state --nestCount; delete splash; bitmap = transpGroupStack->origBitmap; colorMode = bitmap->getMode(); splash = transpGroupStack->origSplash; state->shiftCTMAndClip(transpGroupStack->tx, transpGroupStack->ty); updateCTM(state, 0, 0, 0, 0, 0, 0); } void SplashOutputDev::paintTransparencyGroup(GfxState *state, double *bbox) { SplashBitmap *tBitmap; SplashTransparencyGroup *transpGroup; GBool isolated; int tx, ty; tx = transpGroupStack->tx; ty = transpGroupStack->ty; tBitmap = transpGroupStack->tBitmap; isolated = transpGroupStack->isolated; // paint the transparency group onto the parent bitmap // - the clip path was set in the parent's state) if (tx < bitmap->getWidth() && ty < bitmap->getHeight()) { SplashCoord knockoutOpacity = (transpGroupStack->next != NULL) ? transpGroupStack->next->knockoutOpacity : transpGroupStack->knockoutOpacity; splash->setOverprintMask(0xffffffff, gFalse); splash->composite(tBitmap, 0, 0, tx, ty, tBitmap->getWidth(), tBitmap->getHeight(), gFalse, !isolated, transpGroupStack->next != NULL && transpGroupStack->next->knockout, knockoutOpacity); fontEngine->setAA(transpGroupStack->fontAA); if (transpGroupStack->next != NULL && transpGroupStack->next->shape != NULL) { transpGroupStack->next->knockout = gTrue; } } // pop the stack transpGroup = transpGroupStack; transpGroupStack = transpGroup->next; if (transpGroupStack != NULL && transpGroup->knockoutOpacity < transpGroupStack->knockoutOpacity) { transpGroupStack->knockoutOpacity = transpGroup->knockoutOpacity; } delete transpGroup->shape; delete transpGroup; delete tBitmap; } void SplashOutputDev::setSoftMask(GfxState *state, double *bbox, GBool alpha, Function *transferFunc, GfxColor *backdropColor) { SplashBitmap *softMask, *tBitmap; Splash *tSplash; SplashTransparencyGroup *transpGroup; SplashColor color; SplashColorPtr p; GfxGray gray; GfxRGB rgb; #if SPLASH_CMYK GfxCMYK cmyk; GfxColor deviceN; #endif double lum, lum2; int tx, ty, x, y; tx = transpGroupStack->tx; ty = transpGroupStack->ty; tBitmap = transpGroupStack->tBitmap; // composite with backdrop color if (!alpha && tBitmap->getMode() != splashModeMono1) { //~ need to correctly handle the case where no blending color //~ space is given if (transpGroupStack->blendingColorSpace) { tSplash = new Splash(tBitmap, vectorAntialias, transpGroupStack->origSplash->getScreen()); switch (tBitmap->getMode()) { case splashModeMono1: // transparency is not supported in mono1 mode break; case splashModeMono8: transpGroupStack->blendingColorSpace->getGray(backdropColor, &gray); color[0] = colToByte(gray); tSplash->compositeBackground(color); break; case splashModeXBGR8: color[3] = 255; case splashModeRGB8: case splashModeBGR8: transpGroupStack->blendingColorSpace->getRGB(backdropColor, &rgb); color[0] = colToByte(rgb.r); color[1] = colToByte(rgb.g); color[2] = colToByte(rgb.b); tSplash->compositeBackground(color); break; #if SPLASH_CMYK case splashModeCMYK8: transpGroupStack->blendingColorSpace->getCMYK(backdropColor, &cmyk); color[0] = colToByte(cmyk.c); color[1] = colToByte(cmyk.m); color[2] = colToByte(cmyk.y); color[3] = colToByte(cmyk.k); tSplash->compositeBackground(color); break; case splashModeDeviceN8: transpGroupStack->blendingColorSpace->getDeviceN(backdropColor, &deviceN); for (int cp=0; cp < SPOT_NCOMPS+4; cp++) color[cp] = colToByte(deviceN.c[cp]); tSplash->compositeBackground(color); break; #endif } delete tSplash; } } softMask = new SplashBitmap(bitmap->getWidth(), bitmap->getHeight(), 1, splashModeMono8, gFalse); unsigned char fill = 0; if (transpGroupStack->blendingColorSpace) { transpGroupStack->blendingColorSpace->getGray(backdropColor, &gray); fill = colToByte(gray); } memset(softMask->getDataPtr(), fill, softMask->getRowSize() * softMask->getHeight()); p = softMask->getDataPtr() + ty * softMask->getRowSize() + tx; int xMax = tBitmap->getWidth(); int yMax = tBitmap->getHeight(); if (xMax + tx > bitmap->getWidth()) xMax = bitmap->getWidth() - tx; if (yMax + ty > bitmap->getHeight()) yMax = bitmap->getHeight() - ty; for (y = 0; y < yMax; ++y) { for (x = 0; x < xMax; ++x) { if (alpha) { if (transferFunc) { lum = tBitmap->getAlpha(x, y) / 255.0; transferFunc->transform(&lum, &lum2); p[x] = (int)(lum2 * 255.0 + 0.5); } else p[x] = tBitmap->getAlpha(x, y); } else { tBitmap->getPixel(x, y, color); // convert to luminosity switch (tBitmap->getMode()) { case splashModeMono1: case splashModeMono8: lum = color[0] / 255.0; break; case splashModeXBGR8: case splashModeRGB8: case splashModeBGR8: lum = (0.3 / 255.0) * color[0] + (0.59 / 255.0) * color[1] + (0.11 / 255.0) * color[2]; break; #if SPLASH_CMYK case splashModeCMYK8: case splashModeDeviceN8: lum = (1 - color[3] / 255.0) - (0.3 / 255.0) * color[0] - (0.59 / 255.0) * color[1] - (0.11 / 255.0) * color[2]; if (lum < 0) { lum = 0; } break; #endif } if (transferFunc) { transferFunc->transform(&lum, &lum2); } else { lum2 = lum; } p[x] = (int)(lum2 * 255.0 + 0.5); } } p += softMask->getRowSize(); } splash->setSoftMask(softMask); // pop the stack transpGroup = transpGroupStack; transpGroupStack = transpGroup->next; delete transpGroup; delete tBitmap; } void SplashOutputDev::clearSoftMask(GfxState *state) { splash->setSoftMask(NULL); } void SplashOutputDev::setPaperColor(SplashColorPtr paperColorA) { splashColorCopy(paperColor, paperColorA); } int SplashOutputDev::getBitmapWidth() { return bitmap->getWidth(); } int SplashOutputDev::getBitmapHeight() { return bitmap->getHeight(); } SplashBitmap *SplashOutputDev::takeBitmap() { SplashBitmap *ret; ret = bitmap; bitmap = new SplashBitmap(1, 1, bitmapRowPad, colorMode, colorMode != splashModeMono1, bitmapTopDown); return ret; } void SplashOutputDev::getModRegion(int *xMin, int *yMin, int *xMax, int *yMax) { splash->getModRegion(xMin, yMin, xMax, yMax); } void SplashOutputDev::clearModRegion() { splash->clearModRegion(); } #if 1 //~tmp: turn off anti-aliasing temporarily GBool SplashOutputDev::getVectorAntialias() { return splash->getVectorAntialias(); } void SplashOutputDev::setVectorAntialias(GBool vaa) { vectorAntialias = vaa; splash->setVectorAntialias(vaa); } #endif void SplashOutputDev::setFreeTypeHinting(GBool enable, GBool enableSlightHintingA) { enableFreeTypeHinting = enable; enableSlightHinting = enableSlightHintingA; } GBool SplashOutputDev::tilingPatternFill(GfxState *state, Gfx *gfxA, Catalog *catalog, Object *str, double *ptm, int paintType, int /*tilingType*/, Dict *resDict, double *mat, double *bbox, int x0, int y0, int x1, int y1, double xStep, double yStep) { PDFRectangle box; Gfx *gfx; Splash *formerSplash = splash; SplashBitmap *formerBitmap = bitmap; double width, height; int surface_width, surface_height, result_width, result_height, i; int repeatX, repeatY; SplashCoord matc[6]; Matrix m1; double *ctm, savedCTM[6]; double kx, ky, sx, sy; GBool retValue = gFalse; width = bbox[2] - bbox[0]; height = bbox[3] - bbox[1]; if (xStep != width || yStep != height) return gFalse; // calculate offsets ctm = state->getCTM(); for (i = 0; i < 6; ++i) { savedCTM[i] = ctm[i]; } state->concatCTM(mat[0], mat[1], mat[2], mat[3], mat[4], mat[5]); state->concatCTM(1, 0, 0, 1, bbox[0], bbox[1]); ctm = state->getCTM(); for (i = 0; i < 6; ++i) { if (!isfinite(ctm[i])) { state->setCTM(savedCTM[0], savedCTM[1], savedCTM[2], savedCTM[3], savedCTM[4], savedCTM[5]); return gFalse; } } matc[4] = x0 * xStep * ctm[0] + y0 * yStep * ctm[2] + ctm[4]; matc[5] = x0 * xStep * ctm[1] + y0 * yStep * ctm[3] + ctm[5]; if (splashAbs(ctm[1]) > splashAbs(ctm[0])) { kx = -ctm[1]; ky = ctm[2] - (ctm[0] * ctm[3]) / ctm[1]; } else { kx = ctm[0]; ky = ctm[3] - (ctm[1] * ctm[2]) / ctm[0]; } result_width = (int) ceil(fabs(kx * width * (x1 - x0))); result_height = (int) ceil(fabs(ky * height * (y1 - y0))); kx = state->getHDPI() / 72.0; ky = state->getVDPI() / 72.0; m1.m[0] = (ptm[0] == 0) ? fabs(ptm[2]) * kx : fabs(ptm[0]) * kx; m1.m[1] = 0; m1.m[2] = 0; m1.m[3] = (ptm[3] == 0) ? fabs(ptm[1]) * ky : fabs(ptm[3]) * ky; m1.m[4] = 0; m1.m[5] = 0; m1.transform(width, height, &kx, &ky); surface_width = (int) ceil (fabs(kx)); surface_height = (int) ceil (fabs(ky)); sx = (double) result_width / (surface_width * (x1 - x0)); sy = (double) result_height / (surface_height * (y1 - y0)); m1.m[0] *= sx; m1.m[3] *= sy; m1.transform(width, height, &kx, &ky); if(fabs(kx) < 1 && fabs(ky) < 1) { kx = std::min<double>(kx, ky); ky = 2 / kx; m1.m[0] *= ky; m1.m[3] *= ky; m1.transform(width, height, &kx, &ky); surface_width = (int) ceil (fabs(kx)); surface_height = (int) ceil (fabs(ky)); repeatX = x1 - x0; repeatY = y1 - y0; } else { if ((unsigned long) result_width * result_height > 0x800000L) { state->setCTM(savedCTM[0], savedCTM[1], savedCTM[2], savedCTM[3], savedCTM[4], savedCTM[5]); return gFalse; } while(fabs(kx) > 16384 || fabs(ky) > 16384) { // limit pattern bitmap size m1.m[0] /= 2; m1.m[3] /= 2; m1.transform(width, height, &kx, &ky); } surface_width = (int) ceil (fabs(kx)); surface_height = (int) ceil (fabs(ky)); // adjust repeat values to completely fill region repeatX = result_width / surface_width; repeatY = result_height / surface_height; if (surface_width * repeatX < result_width) repeatX++; if (surface_height * repeatY < result_height) repeatY++; if (x1 - x0 > repeatX) repeatX = x1 - x0; if (y1 - y0 > repeatY) repeatY = y1 - y0; } // restore CTM and calculate rotate and scale with rounded matric state->setCTM(savedCTM[0], savedCTM[1], savedCTM[2], savedCTM[3], savedCTM[4], savedCTM[5]); state->concatCTM(mat[0], mat[1], mat[2], mat[3], mat[4], mat[5]); state->concatCTM(width * repeatX, 0, 0, height * repeatY, bbox[0], bbox[1]); ctm = state->getCTM(); matc[0] = ctm[0]; matc[1] = ctm[1]; matc[2] = ctm[2]; matc[3] = ctm[3]; if (surface_width == 0 || surface_height == 0) { state->setCTM(savedCTM[0], savedCTM[1], savedCTM[2], savedCTM[3], savedCTM[4], savedCTM[5]); return gFalse; } m1.transform(bbox[0], bbox[1], &kx, &ky); m1.m[4] = -kx; m1.m[5] = -ky; bitmap = new SplashBitmap(surface_width, surface_height, 1, (paintType == 1) ? colorMode : splashModeMono8, gTrue); splash = new Splash(bitmap, gTrue); if (paintType == 2) { SplashColor clearColor; #if SPLASH_CMYK clearColor[0] = (colorMode == splashModeCMYK8 || colorMode == splashModeDeviceN8) ? 0x00 : 0xFF; #else clearColor[0] = 0xFF; #endif splash->clear(clearColor, 0); } else { splash->clear(paperColor, 0); } splash->setThinLineMode(formerSplash->getThinLineMode()); splash->setMinLineWidth(globalParams->getMinLineWidth()); box.x1 = bbox[0]; box.y1 = bbox[1]; box.x2 = bbox[2]; box.y2 = bbox[3]; gfx = new Gfx(doc, this, resDict, &box, NULL, NULL, NULL, gfxA->getXRef()); // set pattern transformation matrix gfx->getState()->setCTM(m1.m[0], m1.m[1], m1.m[2], m1.m[3], m1.m[4], m1.m[5]); updateCTM(gfx->getState(), m1.m[0], m1.m[1], m1.m[2], m1.m[3], m1.m[4], m1.m[5]); gfx->display(str); delete splash; splash = formerSplash; TilingSplashOutBitmap imgData; imgData.bitmap = bitmap; imgData.paintType = paintType; imgData.pattern = splash->getFillPattern(); imgData.colorMode = colorMode; imgData.y = 0; imgData.repeatX = repeatX; imgData.repeatY = repeatY; SplashBitmap *tBitmap = bitmap; bitmap = formerBitmap; result_width = tBitmap->getWidth() * imgData.repeatX; result_height = tBitmap->getHeight() * imgData.repeatY; if (splashAbs(matc[1]) > splashAbs(matc[0])) { kx = -matc[1]; ky = matc[2] - (matc[0] * matc[3]) / matc[1]; } else { kx = matc[0]; ky = matc[3] - (matc[1] * matc[2]) / matc[0]; } kx = result_width / (fabs(kx) + 1); ky = result_height / (fabs(ky) + 1); state->concatCTM(kx, 0, 0, ky, 0, 0); ctm = state->getCTM(); matc[0] = ctm[0]; matc[1] = ctm[1]; matc[2] = ctm[2]; matc[3] = ctm[3]; GBool minorAxisZero = matc[1] == 0 && matc[2] == 0; if (matc[0] > 0 && minorAxisZero && matc[3] > 0) { // draw the tiles for (int y = 0; y < imgData.repeatY; ++y) { for (int x = 0; x < imgData.repeatX; ++x) { x0 = splashFloor(matc[4]) + x * tBitmap->getWidth(); y0 = splashFloor(matc[5]) + y * tBitmap->getHeight(); splash->blitImage(tBitmap, gTrue, x0, y0); } } retValue = gTrue; } else { retValue = splash->drawImage(&tilingBitmapSrc, &imgData, colorMode, gTrue, result_width, result_height, matc, gFalse, gTrue) == splashOk; } delete tBitmap; delete gfx; return retValue; } GBool SplashOutputDev::gouraudTriangleShadedFill(GfxState *state, GfxGouraudTriangleShading *shading) { GfxColorSpaceMode shadingMode = shading->getColorSpace()->getMode(); GBool bDirectColorTranslation = gFalse; // triggers an optimization. switch (colorMode) { case splashModeRGB8: bDirectColorTranslation = (shadingMode == csDeviceRGB); break; #if SPLASH_CMYK case splashModeCMYK8: case splashModeDeviceN8: bDirectColorTranslation = (shadingMode == csDeviceCMYK || shadingMode == csDeviceN); break; #endif default: break; } SplashGouraudColor *splashShading = new SplashGouraudPattern(bDirectColorTranslation, state, shading, colorMode); // restore vector antialias because we support it here if (shading->isParameterized()) { GBool vaa = getVectorAntialias(); GBool retVal = gFalse; setVectorAntialias(gTrue); retVal = splash->gouraudTriangleShadedFill(splashShading); setVectorAntialias(vaa); return retVal; } delete splashShading; return gFalse; } GBool SplashOutputDev::univariateShadedFill(GfxState *state, SplashUnivariatePattern *pattern, double tMin, double tMax) { double xMin, yMin, xMax, yMax; SplashPath *path; GBool vaa = getVectorAntialias(); // restore vector antialias because we support it here setVectorAntialias(gTrue); GBool retVal = gFalse; // get the clip region bbox if (pattern->getShading()->getHasBBox()) { pattern->getShading()->getBBox(&xMin, &yMin, &xMax, &yMax); } else { state->getClipBBox(&xMin, &yMin, &xMax, &yMax); xMin = floor (xMin); yMin = floor (yMin); xMax = ceil (xMax); yMax = ceil (yMax); { Matrix ctm, ictm; double x[4], y[4]; int i; state->getCTM(&ctm); ctm.invertTo(&ictm); ictm.transform(xMin, yMin, &x[0], &y[0]); ictm.transform(xMax, yMin, &x[1], &y[1]); ictm.transform(xMin, yMax, &x[2], &y[2]); ictm.transform(xMax, yMax, &x[3], &y[3]); xMin = xMax = x[0]; yMin = yMax = y[0]; for (i = 1; i < 4; i++) { xMin = std::min<double>(xMin, x[i]); yMin = std::min<double>(yMin, y[i]); xMax = std::max<double>(xMax, x[i]); yMax = std::max<double>(yMax, y[i]); } } } // fill the region state->moveTo(xMin, yMin); state->lineTo(xMax, yMin); state->lineTo(xMax, yMax); state->lineTo(xMin, yMax); state->closePath(); path = convertPath(state, state->getPath(), gTrue); #if SPLASH_CMYK pattern->getShading()->getColorSpace()->createMapping(bitmap->getSeparationList(), SPOT_NCOMPS); #endif setOverprintMask(pattern->getShading()->getColorSpace(), state->getFillOverprint(), state->getOverprintMode(), NULL); retVal = (splash->shadedFill(path, pattern->getShading()->getHasBBox(), pattern) == splashOk); state->clearPath(); setVectorAntialias(vaa); delete path; return retVal; } GBool SplashOutputDev::axialShadedFill(GfxState *state, GfxAxialShading *shading, double tMin, double tMax) { SplashAxialPattern *pattern = new SplashAxialPattern(colorMode, state, shading); GBool retVal = univariateShadedFill(state, pattern, tMin, tMax); delete pattern; return retVal; } GBool SplashOutputDev::radialShadedFill(GfxState *state, GfxRadialShading *shading, double tMin, double tMax) { SplashRadialPattern *pattern = new SplashRadialPattern(colorMode, state, shading); GBool retVal = univariateShadedFill(state, pattern, tMin, tMax); delete pattern; return retVal; }
anujkhare/poppler
poppler/SplashOutputDev.cc
C++
gpl-2.0
124,396
/*********************************************************************** AlignTrackingMarkers - Utility to define a reasonable coordinate system based on tracking marker positions detected by an optical tracking system. Copyright (c) 2008-2010 Oliver Kreylos This file is part of the Vrui calibration utility package. The Vrui calibration utility package is free software; you can redistribute it and/or modify it under the terms of the GNU General Public License as published by the Free Software Foundation; either version 2 of the License, or (at your option) any later version. The Vrui calibration utility package is distributed in the hope that it will be useful, but WITHOUT ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License for more details. You should have received a copy of the GNU General Public License along with the Vrui calibration utility package; if not, write to the Free Software Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA ***********************************************************************/ #include <string.h> #include <stdlib.h> #include <stdexcept> #include <utility> #include <vector> #include <iostream> #include <Misc/ThrowStdErr.h> #include <Math/Math.h> #include <Math/Constants.h> #include <Geometry/Point.h> #include <Geometry/AffineCombiner.h> #include <Geometry/Vector.h> #include <Geometry/OrthonormalTransformation.h> #include <Geometry/Ray.h> #include <Geometry/SolidHitResult.h> #include <Geometry/Sphere.h> #include <Geometry/Cylinder.h> #include <Geometry/GeometryValueCoders.h> #include <GL/gl.h> #include <GL/GLColorTemplates.h> #include <GL/GLColor.h> #include <GL/GLMaterial.h> #include <GL/GLModels.h> #include <GL/GLGeometryWrappers.h> #include <GL/GLTransformationWrappers.h> #include <GLMotif/Blind.h> #include <GLMotif/Label.h> #include <GLMotif/Button.h> #include <GLMotif/ToggleButton.h> #include <GLMotif/TextField.h> #include <GLMotif/RowColumn.h> #include <GLMotif/Menu.h> #include <GLMotif/PopupMenu.h> #include <GLMotif/PopupWindow.h> #include <Vrui/Vrui.h> #include <Vrui/InputDevice.h> #include <Vrui/ToolManager.h> #include <Vrui/Tool.h> #include <Vrui/GenericToolFactory.h> #include <Vrui/Application.h> #include "ReadOptiTrackMarkerFile.h" #include "NaturalPointClient.h" namespace { /************************************************************************************** Helper function to query relative marker positions from a NaturalPoint tracking server: **************************************************************************************/ void queryRigidBody(const char* naturalPointServerName,int rigidBodyId,double scale,bool flipZ,std::vector<Geometry::Point<double,3> >& markers) { /* Open a connection to the NaturalPoint server: */ NaturalPointClient npc(naturalPointServerName,1510,"224.0.0.1",1511); std::cout<<"Server name: "<<npc.getServerName()<<std::endl; std::cout<<"Server version: "<<npc.getServerVersion()[0]<<'.'<<npc.getServerVersion()[1]<<'.'<<npc.getServerVersion()[2]<<'.'<<npc.getServerVersion()[3]<<std::endl; std::cout<<"Protocol version: "<<npc.getProtocolVersion()[0]<<'.'<<npc.getProtocolVersion()[1]<<'.'<<npc.getProtocolVersion()[2]<<'.'<<npc.getProtocolVersion()[3]<<std::endl; /* Track the requested rigid body for a number of frames to calculate average relative marker positions: */ std::cout<<"Please show the rigid body with ID "<<rigidBodyId<<" to the OptiTrack system"<<std::endl; unsigned int numFrames=0; std::vector<NaturalPointClient::Point> initialMarkers; std::vector<NaturalPointClient::Point::AffineCombiner> markerCombiners; while(numFrames<50) { /* Wait for the next frame from the NaturalPoint engine: */ const NaturalPointClient::Frame& frame=npc.waitForNextFrame(); /* Check if the frame contains the requested rigid body: */ for(std::vector<NaturalPointClient::RigidBody>::const_iterator rbIt=frame.rigidBodies.begin();rbIt!=frame.rigidBodies.end();++rbIt) if(rbIt->id==rigidBodyId) { /* Check if this is the first frame: */ if(numFrames==0) { std::cout<<"Found rigid body "<<rigidBodyId<<", capturing frames..."<<std::flush; for(std::vector<NaturalPointClient::Point>::const_iterator mIt=rbIt->markers.begin();mIt!=rbIt->markers.end();++mIt) { /* Transform the marker to rigid body coordinates: */ NaturalPointClient::Point m=NaturalPointClient::Point::origin+rbIt->orientation.inverseTransform(*mIt-rbIt->position); /* Store the initial marker position and create an accumulator: */ initialMarkers.push_back(m); markerCombiners.push_back(NaturalPointClient::Point::AffineCombiner()); } } /* Find the best match for each marker in the initial configuration and accumulate their positions: */ for(std::vector<NaturalPointClient::Point>::const_iterator mIt=rbIt->markers.begin();mIt!=rbIt->markers.end();++mIt) { /* Transform the marker to rigid body coordinates: */ NaturalPointClient::Point m=NaturalPointClient::Point::origin+rbIt->orientation.inverseTransform(*mIt-rbIt->position); /* Find the best-matching initial marker: */ size_t bestIndex=0; NaturalPointClient::Scalar bestDist2=Geometry::sqrDist(m,initialMarkers[0]); for(size_t i=1;i<initialMarkers.size();++i) { NaturalPointClient::Scalar dist2=Geometry::sqrDist(m,initialMarkers[i]); if(bestDist2>dist2) { bestIndex=i; bestDist2=dist2; } } /* Accumulate the point: */ markerCombiners[bestIndex].addPoint(m); } ++numFrames; } } std::cout<<" done"<<std::endl; /* Store the averaged marker positions: */ for(std::vector<NaturalPointClient::Point::AffineCombiner>::iterator mcIt=markerCombiners.begin();mcIt!=markerCombiners.end();++mcIt) { Geometry::Point<double,3> m; for(int i=0;i<3;++i) m[i]=double(mcIt->getPoint()[i])*scale; if(flipZ) m[2]=-m[2]; markers.push_back(m); } } } class AlignTrackingMarkers:public Vrui::Application { /* Embedded classes: */ private: typedef double Scalar; typedef Geometry::Point<Scalar,3> Point; typedef Geometry::Vector<Scalar,3> Vector; typedef Geometry::OrthonormalTransformation<Scalar,3> ONTransform; typedef Geometry::Ray<Scalar,3> Ray; typedef std::vector<Point> PointList; typedef std::pair<Point,Point> Line; typedef std::vector<Line> LineList; class MarkerTool; typedef Vrui::GenericToolFactory<MarkerTool> MarkerToolFactory; class MarkerTool:public Vrui::Tool,public Vrui::Application::Tool<AlignTrackingMarkers> { friend class Vrui::GenericToolFactory<MarkerTool>; /* Elements: */ private: static MarkerToolFactory* factory; GLMotif::PopupWindow* dialogPopup; // Marker tool's measurement dialog box GLMotif::TextField* pos[2][3]; // Current position text fields GLMotif::TextField* dist; // Current distance text field bool dragging; // Flag whether the tool is currently dragging a line or the origin Point start; // Starting point of the currently dragged line Point current; // Current end point of currently dragged line /* Constructors and destructors: */ public: MarkerTool(const Vrui::ToolFactory* sFactory,const Vrui::ToolInputAssignment& inputAssignment); virtual ~MarkerTool(void); /* Methods from class Vrui::Tool: */ virtual const Vrui::ToolFactory* getFactory(void) const { return factory; } virtual void buttonCallback(int buttonSlotIndex,Vrui::InputDevice::ButtonCallbackData* cbData); virtual void frame(void); virtual void display(GLContextData& contextData) const; }; /* Elements: */ private: ONTransform transform; // Transformation from original coordinate system to aligned coordinate system Scalar axisLength; // Length for the initial coordinate axes Scalar markerSize; // Size to draw markers in scaled local tracker coordinates Scalar lineSize; // Size to draw lines in scaled local tracker coordinates PointList markers; // List of marker positions in scaled local tracker coordinates LineList lines; // List of lines used to define coordinate axes GLMotif::PopupMenu* mainMenuPopup; // The program's main menu bool moveOrigin; // Flag whether marker tools will move the transformation's origin /* Private methods: */ GLMotif::PopupMenu* createMainMenu(void); // Creates the program's main menu /* Constructors and destructors: */ public: AlignTrackingMarkers(int& argc,char**& argv,char**& appDefaults); virtual ~AlignTrackingMarkers(void); /* Methods from class Vrui::Application: */ virtual void display(GLContextData& contextData) const; /* New methods: */ Point snap(const Point& p) const; // Snaps a 3D point to the existing markers/lines Point snap(const Ray& ray) const; // Snaps a 3D ray to the existing markers/lines Point snap(const Point& start,const Point& p) const; // Snaps a 3D point to the existing markers/lines, with line start point for angle snapping Point snap(const Point& start,const Ray& ray) const; // Snaps a 3D ray to the existing markers/lines, with line start point for angle snapping void addLine(const Point& p1,const Point& p2); // Adds a line to the list void setOrigin(const Point& p); // Sets the current coordinate system's origin void removeLastLineCallback(Misc::CallbackData* cbData); // Removes the most recently added line void alignXAxisCallback(Misc::CallbackData* cbData); // Aligns the X axis to the most recently added line void alignNegXAxisCallback(Misc::CallbackData* cbData); // Aligns the negative X axis to the most recently added line void alignYAxisCallback(Misc::CallbackData* cbData); // Aligns the Y axis to the most recently added line void alignNegYAxisCallback(Misc::CallbackData* cbData); // Aligns the negative Y axis to the most recently added line void alignZAxisCallback(Misc::CallbackData* cbData); // Aligns the Z axis to the most recently added line void alignNegZAxisCallback(Misc::CallbackData* cbData); // Aligns the negative Z axis to the most recently added line void moveOriginCallback(GLMotif::ToggleButton::ValueChangedCallbackData* cbData); // Moves the origin of the coordinate system }; /********************************************************* Static elements of class AlignTrackingMarkers::MarkerTool: *********************************************************/ AlignTrackingMarkers::MarkerToolFactory* AlignTrackingMarkers::MarkerTool::factory=0; /************************************************* Methods of class AlignTrackingMarkers::MarkerTool: *************************************************/ AlignTrackingMarkers::MarkerTool::MarkerTool(const Vrui::ToolFactory* sFactory,const Vrui::ToolInputAssignment& inputAssignment) :Vrui::Tool(sFactory,inputAssignment), dialogPopup(0), dragging(false) { /* Create the measurement dialog: */ dialogPopup=new GLMotif::PopupWindow("DialogPopup",Vrui::getWidgetManager(),"Marker Measurements"); dialogPopup->setResizableFlags(true,false); GLMotif::RowColumn* dialog=new GLMotif::RowColumn("Dialog",dialogPopup,false); dialog->setNumMinorWidgets(2); new GLMotif::Label("Pos1Label",dialog,"Point 1"); GLMotif::RowColumn* pos1Box=new GLMotif::RowColumn("Pos1Box",dialog,false); pos1Box->setOrientation(GLMotif::RowColumn::HORIZONTAL); pos1Box->setPacking(GLMotif::RowColumn::PACK_GRID); for(int i=0;i<3;++i) { char labelName[40]; snprintf(labelName,sizeof(labelName),"Pos1-%d",i+1); pos[0][i]=new GLMotif::TextField(labelName,pos1Box,12); pos[0][i]->setPrecision(6); } pos1Box->manageChild(); new GLMotif::Label("Pos2Label",dialog,"Point 2"); GLMotif::RowColumn* pos2Box=new GLMotif::RowColumn("Pos2Box",dialog,false); pos2Box->setOrientation(GLMotif::RowColumn::HORIZONTAL); pos2Box->setPacking(GLMotif::RowColumn::PACK_GRID); for(int i=0;i<3;++i) { char labelName[40]; snprintf(labelName,sizeof(labelName),"Pos2-%d",i+1); pos[1][i]=new GLMotif::TextField(labelName,pos2Box,12); pos[1][i]->setPrecision(6); } pos2Box->manageChild(); new GLMotif::Label("DistLabel",dialog,"Distance"); GLMotif::RowColumn* distBox=new GLMotif::RowColumn("DistBox",dialog,false); distBox->setOrientation(GLMotif::RowColumn::HORIZONTAL); distBox->setPacking(GLMotif::RowColumn::PACK_GRID); dist=new GLMotif::TextField("Dist",distBox,16); dist->setPrecision(10); new GLMotif::Blind("Blind",distBox); distBox->manageChild(); dialog->manageChild(); /* Pop up the measurement dialog: */ Vrui::popupPrimaryWidget(dialogPopup); } AlignTrackingMarkers::MarkerTool::~MarkerTool(void) { /* Pop down and destroy the measurement dialog: */ Vrui::popdownPrimaryWidget(dialogPopup); delete dialogPopup; } void AlignTrackingMarkers::MarkerTool::buttonCallback(int,Vrui::InputDevice::ButtonCallbackData* cbData) { if(cbData->newButtonState) { /* Begin dragging a line or moving the origin: */ start=current; /* Clear the measurement dialog: */ Point s=application->transform.inverseTransform(start); for(int i=0;i<3;++i) { pos[0][i]->setValue(double(s[i])); pos[1][i]->setString(""); } dist->setString(""); dragging=true; } else { if(!application->moveOrigin) { /* Stop dragging the current line: */ application->addLine(start,current); } dragging=false; } } void AlignTrackingMarkers::MarkerTool::frame(void) { /* Get pointer to input device that caused the event: */ Vrui::InputDevice* device=getButtonDevice(0); /* Snap the current input device to the existing marker set: */ Vrui::NavTrackerState transform=Vrui::getDeviceTransformation(device); if(device->isRayDevice()) { if(dragging) current=application->snap(start,Ray(transform.getOrigin(),transform.transform(device->getDeviceRayDirection()))); else current=application->snap(Ray(transform.getOrigin(),transform.transform(device->getDeviceRayDirection()))); } else { if(dragging) current=application->snap(start,transform.getOrigin()); else current=application->snap(transform.getOrigin()); } /* Update the measurement dialog: */ Point c=application->transform.inverseTransform(current); if(dragging&&!application->moveOrigin) { for(int i=0;i<3;++i) pos[1][i]->setValue(double(c[i])); dist->setValue(double(Geometry::dist(start,current))); } else { for(int i=0;i<3;++i) pos[0][i]->setValue(double(c[i])); } if(dragging&&application->moveOrigin) application->setOrigin(current); } void AlignTrackingMarkers::MarkerTool::display(GLContextData& contextData) const { if(dragging&&!application->moveOrigin) { /* Draw the currently dragged line: */ glPushAttrib(GL_ENABLE_BIT|GL_LINE_BIT); glDisable(GL_LIGHTING); glLineWidth(1.0f); glPushMatrix(); glMultMatrix(Vrui::getNavigationTransformation()); glBegin(GL_LINES); glColor3f(1.0f,0.0f,0.0f); glVertex(start); glVertex(current); glEnd(); glPopMatrix(); glPopAttrib(); } } /************************************* Methods of class AlignTrackingMarkers: *************************************/ GLMotif::PopupMenu* AlignTrackingMarkers::createMainMenu(void) { /* Create a popup shell to hold the main menu: */ GLMotif::PopupMenu* mainMenuPopup=new GLMotif::PopupMenu("MainMenuPopup",Vrui::getWidgetManager()); mainMenuPopup->setTitle("Marker Alignment"); /* Create the main menu itself: */ GLMotif::Menu* mainMenu=new GLMotif::Menu("MainMenu",mainMenuPopup,false); /* Create the menu buttons: */ GLMotif::Button* removeLastLineButton=new GLMotif::Button("RemoveLastLineButton",mainMenu,"Remove Last Line"); removeLastLineButton->getSelectCallbacks().add(this,&AlignTrackingMarkers::removeLastLineCallback); GLMotif::Button* alignXAxisButton=new GLMotif::Button("AlignXAxisButton",mainMenu,"Align X Axis"); alignXAxisButton->getSelectCallbacks().add(this,&AlignTrackingMarkers::alignXAxisCallback); GLMotif::Button* alignNegXAxisButton=new GLMotif::Button("AlignNegXAxisButton",mainMenu,"Align -X Axis"); alignNegXAxisButton->getSelectCallbacks().add(this,&AlignTrackingMarkers::alignNegXAxisCallback); GLMotif::Button* alignYAxisButton=new GLMotif::Button("AlignYAxisButton",mainMenu,"Align Y Axis"); alignYAxisButton->getSelectCallbacks().add(this,&AlignTrackingMarkers::alignYAxisCallback); GLMotif::Button* alignNegYAxisButton=new GLMotif::Button("AlignNegYAxisButton",mainMenu,"Align -Y Axis"); alignNegYAxisButton->getSelectCallbacks().add(this,&AlignTrackingMarkers::alignNegYAxisCallback); GLMotif::Button* alignZAxisButton=new GLMotif::Button("AlignZAxisButton",mainMenu,"Align Z Axis"); alignZAxisButton->getSelectCallbacks().add(this,&AlignTrackingMarkers::alignZAxisCallback); GLMotif::Button* alignNegZAxisButton=new GLMotif::Button("AlignNegZAxisButton",mainMenu,"Align -Z Axis"); alignNegZAxisButton->getSelectCallbacks().add(this,&AlignTrackingMarkers::alignNegZAxisCallback); GLMotif::ToggleButton* moveOriginToggle=new GLMotif::ToggleButton("MoveOriginToggle",mainMenu,"Move Origin"); moveOriginToggle->getValueChangedCallbacks().add(this,&AlignTrackingMarkers::moveOriginCallback); /* Finish building the main menu: */ mainMenu->manageChild(); return mainMenuPopup; } AlignTrackingMarkers::AlignTrackingMarkers(int& argc,char**& argv,char**& appDefaults) :Vrui::Application(argc,argv,appDefaults), transform(ONTransform::identity), markerSize(Scalar(Vrui::getInchFactor())*Scalar(0.25)), lineSize(markerSize/Scalar(3)), mainMenuPopup(0), moveOrigin(false) { /* Create and register the marker tool class: */ MarkerToolFactory* markerToolFactory=new MarkerToolFactory("MarkerTool","Marker Selector",0,*Vrui::getToolManager()); markerToolFactory->setNumButtons(1); markerToolFactory->setButtonFunction(0,"Select Markers"); Vrui::getToolManager()->addClass(markerToolFactory,Vrui::ToolManager::defaultToolFactoryDestructor); /* Parse the command line: */ const char* fileName=0; const char* bodyName=0; const char* naturalPointServerName=0; int naturalPointRigidBodyId=-1; Scalar scale=Scalar(1); bool flipZ=false; for(int i=1;i<argc;++i) { if(argv[i][0]=='-') { if(strcasecmp(argv[i]+1,"size")==0) { ++i; markerSize=Scalar(atof(argv[i])); } else if(strcasecmp(argv[i]+1,"scale")==0) { ++i; scale=Scalar(atof(argv[i])); } else if(strcasecmp(argv[i]+1,"inches")==0) { /* Set scale factor from meters to inches: */ scale=Scalar(1000)/Scalar(25.4); } else if(strcasecmp(argv[i]+1,"flipZ")==0) flipZ=true; else if(strcasecmp(argv[i]+1,"npc")==0) { ++i; naturalPointServerName=argv[i]; ++i; naturalPointRigidBodyId=atoi(argv[i]); } } else if(fileName==0) fileName=argv[i]; else bodyName=argv[i]; } if((fileName==0||bodyName==0)&&(naturalPointServerName==0||naturalPointRigidBodyId==-1)) { std::cerr<<"Usage: "<<argv[0]<<" ( <rigid body definition file name> <rigid body name> ) | ( -npc <NaturalPoint server name> <rigid body ID> ) [-scale <unit scale factor>] [-inches] [-flipZ] [-size <marker size>]"<<std::endl; Misc::throwStdErr("AlignTrackingMarkers::AlignTrackingMarkers: No file name and rigid body name or NaturalPoint server name and rigid body ID provided"); } if(fileName!=0&&bodyName!=0) { /* Determine the marker file name's extension: */ const char* extPtr=0; for(const char* fnPtr=fileName;*fnPtr!='\0';++fnPtr) if(*fnPtr=='.') extPtr=fnPtr; /* Read the marker file: */ if(extPtr!=0&&strcasecmp(extPtr,".rdef")==0) readOptiTrackMarkerFile(fileName,bodyName,scale,flipZ,markers); else Misc::throwStdErr("AlignTrackingMarkers::AlignTrackingMarkers: marker file %s has unrecognized extension",fileName); } else { /* Get a rigid body definition from the NaturalPoint server: */ queryRigidBody(naturalPointServerName,naturalPointRigidBodyId,scale,flipZ,markers); } /* Create the main menu: */ mainMenuPopup=createMainMenu(); Vrui::setMainMenu(mainMenuPopup); /* Initialize the navigation transformation: */ Point::AffineCombiner centroidC; for(PointList::const_iterator mIt=markers.begin();mIt!=markers.end();++mIt) centroidC.addPoint(*mIt); Point centroid=centroidC.getPoint(); Scalar maxSqrDist=Scalar(0); for(PointList::const_iterator mIt=markers.begin();mIt!=markers.end();++mIt) { Scalar sqrDist=Geometry::sqrDist(centroid,*mIt); if(maxSqrDist<sqrDist) maxSqrDist=sqrDist; } axisLength=Math::sqrt(maxSqrDist)*Scalar(2); Vrui::setNavigationTransformation(centroid,axisLength); } AlignTrackingMarkers::~AlignTrackingMarkers(void) { /* Print the updated transformation: */ std::cout<<"Final transformation: "<<Misc::ValueCoder<ONTransform>::encode(transform)<<std::endl; /* Delete the main menu: */ delete mainMenuPopup; } void AlignTrackingMarkers::display(GLContextData& contextData) const { /* Set up OpenGL state: */ glPushAttrib(GL_ENABLE_BIT|GL_LINE_BIT); glDisable(GL_LIGHTING); glLineWidth(1.0f); /* Draw the current coordinate axes: */ glPushMatrix(); glMultMatrix(transform); glBegin(GL_LINES); glColor3f(1.0f,0.0f,0.0f); glVertex3f(-axisLength,0.0f,0.0f); glVertex3f( axisLength,0.0f,0.0f); glColor3f(0.0f,1.0f,0.0f); glVertex3f(0.0f,-axisLength,0.0f); glVertex3f(0.0f, axisLength,0.0f); glColor3f(0.0f,0.0f,1.0f); glVertex3f(0.0f,0.0f,-axisLength); glVertex3f(0.0f,0.0f, axisLength); glEnd(); glPopMatrix(); glEnable(GL_LIGHTING); glEnable(GL_CULL_FACE); glCullFace(GL_BACK); glMaterial(GLMaterialEnums::FRONT,GLMaterial(GLMaterial::Color(1.0f,1.0f,1.0f),GLMaterial::Color(1.0f,1.0f,1.0f),25.0f)); static const GLColor<GLfloat,3> markerColors[8]= { GLColor<GLfloat,3>(0.75f,0.25f,0.25f), GLColor<GLfloat,3>(0.25f,0.75f,0.25f), GLColor<GLfloat,3>(0.25f,0.25f,0.75f), GLColor<GLfloat,3>(0.75f,0.75f,0.25f), GLColor<GLfloat,3>(0.25f,0.75f,0.75f), GLColor<GLfloat,3>(0.75f,0.25f,0.75f), GLColor<GLfloat,3>(0.33f,0.33f,0.33f), GLColor<GLfloat,3>(0.67f,0.67f,0.67f) }; glEnable(GL_COLOR_MATERIAL); glColorMaterial(GL_FRONT,GL_AMBIENT_AND_DIFFUSE); /* Draw all markers: */ int colorIndex=0; for(PointList::const_iterator mIt=markers.begin();mIt!=markers.end();++mIt,++colorIndex) { glPushMatrix(); glTranslate(*mIt-Point::origin); glColor(markerColors[colorIndex%8]); glDrawSphereIcosahedron(markerSize,4); glPopMatrix(); } /* Draw all lines: */ for(LineList::const_iterator lIt=lines.begin();lIt!=lines.end();++lIt) { Point p1=lIt->first; Point p2=lIt->second; Vector axis=p2-p1; Scalar height=Geometry::mag(axis); axis/=height; Vector x=Geometry::normal(axis); x.normalize(); Vector y=Geometry::cross(axis,x); y.normalize(); glBegin(GL_QUAD_STRIP); glColor3f(0.5f,0.5f,0.5f); for(int i=0;i<=12;++i) { Scalar angle=Scalar(2)*Math::Constants<Scalar>::pi*Scalar(i)/Scalar(12); Vector normal=x*Math::cos(angle)+y*Math::sin(angle); glNormal(normal); glVertex(p2+normal*lineSize); glVertex(p1+normal*lineSize); } glEnd(); } /* Reset OpenGL state: */ glPopAttrib(); } AlignTrackingMarkers::Point AlignTrackingMarkers::snap(const AlignTrackingMarkers::Point& p) const { Point bestPoint=p; Scalar bestSqrDist=Math::sqr(markerSize); /* Compare the point against all lines: */ for(LineList::const_iterator lIt=lines.begin();lIt!=lines.end();++lIt) { Point p1=lIt->first; Point p2=lIt->second; Vector axis=p2-p1; Scalar height=Geometry::mag(axis); axis/=height; Scalar sqrDist=Scalar(0); Vector pp1=p-p1; Scalar along=pp1*axis; if(along<Scalar(0)) sqrDist+=Math::sqr(along); else if(along>height) sqrDist+=Math::sqr(along-height); sqrDist+=Geometry::sqr(pp1)-Math::sqr(along); sqrDist*=Scalar(9); if(sqrDist<bestSqrDist) { if(along<=Scalar(0)) bestPoint=p1; else if(along>=height) bestPoint=p2; else bestPoint=p1+axis*along; bestSqrDist=sqrDist; } } /* Compare the point against all markers: */ for(PointList::const_iterator mIt=markers.begin();mIt!=markers.end();++mIt) { Scalar sqrDist=Geometry::sqrDist(*mIt,p); if(sqrDist<bestSqrDist) { bestPoint=*mIt; bestSqrDist=sqrDist; } } return bestPoint; } AlignTrackingMarkers::Point AlignTrackingMarkers::snap(const AlignTrackingMarkers::Ray& ray) const { Point bestPoint=ray.getOrigin(); Scalar bestLambda=Math::Constants<Scalar>::max; /* Compare the ray against all lines: */ for(LineList::const_iterator lIt=lines.begin();lIt!=lines.end();++lIt) { Geometry::Cylinder<Scalar,3> cylinder(lIt->first,lIt->second,lineSize); Geometry::Cylinder<Scalar,3>::HitResult hr=cylinder.intersectRay(ray); if(hr.isValid()&&hr.getParameter()<bestLambda) { bestPoint=cylinder.getP1()+cylinder.getAxis()*((ray(hr.getParameter())-cylinder.getP1())*cylinder.getAxis()); bestLambda=hr.getParameter(); } } /* Compare the ray against all markers: */ for(PointList::const_iterator mIt=markers.begin();mIt!=markers.end();++mIt) { Geometry::Sphere<Scalar,3> sphere(*mIt,markerSize); Geometry::Sphere<Scalar,3>::HitResult hr=sphere.intersectRay(ray); if(hr.isValid()&&hr.getParameter()<bestLambda) { bestPoint=*mIt; bestLambda=hr.getParameter(); } } return bestPoint; } AlignTrackingMarkers::Point AlignTrackingMarkers::snap(const AlignTrackingMarkers::Point& start,const AlignTrackingMarkers::Point& p) const { Point bestPoint=p; Scalar bestSqrDist=Math::sqr(markerSize); /* Compare the point against all lines: */ for(LineList::const_iterator lIt=lines.begin();lIt!=lines.end();++lIt) { Point p1=lIt->first; Point p2=lIt->second; Vector axis=p2-p1; Scalar height=Geometry::mag(axis); axis/=height; Scalar sqrDist=Scalar(0); Vector pp1=p-p1; Scalar along=pp1*axis; if(along<Scalar(0)) sqrDist+=Math::sqr(along); else if(along>height) sqrDist+=Math::sqr(along-height); sqrDist+=Geometry::sqr(pp1)-Math::sqr(along); sqrDist*=Scalar(9); if(sqrDist<bestSqrDist) { if(along<=Scalar(0)) bestPoint=p1; else if(along>=height) bestPoint=p2; else bestPoint=p1+axis*along; /* Check if the two lines' angles should be snapped to a right angle: */ Vector line=start-bestPoint; Scalar cosAngle=(axis*line)/Geometry::mag(line); if(Math::abs(cosAngle)<Math::cos(Math::rad(Scalar(85)))) bestPoint=p1+axis*((start-p1)*axis); bestSqrDist=sqrDist; } } /* Compare the point against all markers: */ for(PointList::const_iterator mIt=markers.begin();mIt!=markers.end();++mIt) { Scalar sqrDist=Geometry::sqrDist(*mIt,p); if(sqrDist<bestSqrDist) { bestPoint=*mIt; bestSqrDist=sqrDist; } } return bestPoint; } AlignTrackingMarkers::Point AlignTrackingMarkers::snap(const AlignTrackingMarkers::Point& start,const AlignTrackingMarkers::Ray& ray) const { Point bestPoint=ray.getOrigin(); Scalar bestLambda=Math::Constants<Scalar>::max; /* Compare the ray against all lines: */ for(LineList::const_iterator lIt=lines.begin();lIt!=lines.end();++lIt) { Geometry::Cylinder<Scalar,3> cylinder(lIt->first,lIt->second,lineSize); Geometry::Cylinder<Scalar,3>::HitResult hr=cylinder.intersectRay(ray); if(hr.isValid()&&hr.getParameter()<bestLambda) { bestPoint=cylinder.getP1()+cylinder.getAxis()*((ray(hr.getParameter())-cylinder.getP1())*cylinder.getAxis()); /* Check if the two lines' angles should be snapped to a right angle: */ Vector line=start-bestPoint; Scalar cosAngle=(cylinder.getAxis()*line)/Geometry::mag(line); if(Math::abs(cosAngle)<Math::cos(Math::rad(Scalar(85)))) bestPoint=cylinder.getP1()+cylinder.getAxis()*((start-cylinder.getP1())*cylinder.getAxis()); bestLambda=hr.getParameter(); } } /* Compare the ray against all markers: */ for(PointList::const_iterator mIt=markers.begin();mIt!=markers.end();++mIt) { Geometry::Sphere<Scalar,3> sphere(*mIt,markerSize); Geometry::Sphere<Scalar,3>::HitResult hr=sphere.intersectRay(ray); if(hr.isValid()&&hr.getParameter()<bestLambda) { bestPoint=*mIt; bestLambda=hr.getParameter(); } } return bestPoint; } void AlignTrackingMarkers::addLine(const AlignTrackingMarkers::Point& p1,const AlignTrackingMarkers::Point& p2) { /* Store the line: */ lines.push_back(std::make_pair(p1,p2)); Vrui::requestUpdate(); } void AlignTrackingMarkers::setOrigin(const AlignTrackingMarkers::Point& p) { transform.leftMultiply(ONTransform::translate(p-transform.getOrigin())); transform.renormalize(); Vrui::requestUpdate(); } void AlignTrackingMarkers::removeLastLineCallback(Misc::CallbackData* cbData) { if(!lines.empty()) lines.pop_back(); Vrui::requestUpdate(); } void AlignTrackingMarkers::alignXAxisCallback(Misc::CallbackData* cbData) { if(!lines.empty()) { /* Get the last line's direction in current system coordinates: */ Vector line=transform.inverseTransform(lines.back().second-lines.back().first); /* Align the coordinate system's X axis with the line direction: */ transform*=ONTransform::rotate(ONTransform::Rotation::rotateFromTo(Vector(1,0,0),line)); transform.renormalize(); } Vrui::requestUpdate(); } void AlignTrackingMarkers::alignNegXAxisCallback(Misc::CallbackData* cbData) { if(!lines.empty()) { /* Get the last line's direction in current system coordinates: */ Vector line=transform.inverseTransform(lines.back().second-lines.back().first); /* Align the coordinate system's -X axis with the line direction: */ transform*=ONTransform::rotate(ONTransform::Rotation::rotateFromTo(Vector(-1,0,0),line)); transform.renormalize(); } Vrui::requestUpdate(); } void AlignTrackingMarkers::alignYAxisCallback(Misc::CallbackData* cbData) { if(!lines.empty()) { /* Get the last line's direction in current system coordinates: */ Vector line=transform.inverseTransform(lines.back().second-lines.back().first); /* Align the coordinate system's Y axis with the line direction: */ transform*=ONTransform::rotate(ONTransform::Rotation::rotateFromTo(Vector(0,1,0),line)); transform.renormalize(); } Vrui::requestUpdate(); } void AlignTrackingMarkers::alignNegYAxisCallback(Misc::CallbackData* cbData) { if(!lines.empty()) { /* Get the last line's direction in current system coordinates: */ Vector line=transform.inverseTransform(lines.back().second-lines.back().first); /* Align the coordinate system's -Y axis with the line direction: */ transform*=ONTransform::rotate(ONTransform::Rotation::rotateFromTo(Vector(0,-1,0),line)); transform.renormalize(); } Vrui::requestUpdate(); } void AlignTrackingMarkers::alignZAxisCallback(Misc::CallbackData* cbData) { if(!lines.empty()) { /* Get the last line's direction in current system coordinates: */ Vector line=transform.inverseTransform(lines.back().second-lines.back().first); /* Align the coordinate system's Z axis with the line direction: */ transform*=ONTransform::rotate(ONTransform::Rotation::rotateFromTo(Vector(0,0,1),line)); transform.renormalize(); } Vrui::requestUpdate(); } void AlignTrackingMarkers::alignNegZAxisCallback(Misc::CallbackData* cbData) { if(!lines.empty()) { /* Get the last line's direction in current system coordinates: */ Vector line=transform.inverseTransform(lines.back().second-lines.back().first); /* Align the coordinate system's -Z axis with the line direction: */ transform*=ONTransform::rotate(ONTransform::Rotation::rotateFromTo(Vector(0,0,-1),line)); transform.renormalize(); } Vrui::requestUpdate(); } void AlignTrackingMarkers::moveOriginCallback(GLMotif::ToggleButton::ValueChangedCallbackData* cbData) { moveOrigin=cbData->set; } /************* Main function: *************/ int main(int argc,char* argv[]) { try { char** appDefaults=0; AlignTrackingMarkers app(argc,argv,appDefaults); app.run(); } catch(std::runtime_error err) { std::cerr<<"Caught exception "<<err.what()<<std::endl; return 1; } return 0; }
VisualIdeation/Vrui-2.2-003
Calibration/AlignTrackingMarkers.cpp
C++
gpl-2.0
32,122
/******************************** * 프로젝트 : gargoyle-rax * 패키지 : com.kyj.fx.rax * 작성일 : 2018. 7. 3. * 작성자 : KYJ *******************************/ package com.kyj.fx.rax; import java.util.function.Function; import com.kyj.fx.commons.utils.FxUtil; import com.kyj.fx.commons.utils.ValueUtil; import com.kyj.fx.rax.item.FormulaParameter; import javafx.scene.paint.Color; import javafx.scene.text.Font; /** * * Utility Function.<br/> * * * @author KYJ * */ public abstract class AbstractFomulaParameterToLabelFunction implements Function<FormulaParameter, RaxVirtualCommentLabel> { @Override public RaxVirtualCommentLabel apply(FormulaParameter stepParam) { RaxVirtualCommentLabel lbl = null; if (ValueUtil.isNotEmpty(stepParam)) { lbl = new RaxVirtualCommentLabel(toString(stepParam)); lbl.setTextFill(Color.DEEPSKYBLUE); } if (lbl != null) { lbl.setFont(Font.font(8.0d)); lbl.setBackground(FxUtil.getBackgroundColor(Color.WHITESMOKE)); } return lbl; } public abstract String toString(FormulaParameter stepParam); }
callakrsos/Gargoyle
gargoyle-rax/src/main/java/com/kyj/fx/rax/AbstractFomulaParameterToLabelFunction.java
Java
gpl-2.0
1,093
/* KeePass Password Safe - The Open-Source Password Manager Copyright (C) 2003-2019 Dominik Reichl <dominik.reichl@t-online.de> This program is free software; you can redistribute it and/or modify it under the terms of the GNU General Public License as published by the Free Software Foundation; either version 2 of the License, or (at your option) any later version. This program is distributed in the hope that it will be useful, but WITHOUT ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License for more details. You should have received a copy of the GNU General Public License along with this program; if not, write to the Free Software Foundation, Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA */ using System; using System.Collections.Generic; using System.Diagnostics; using System.IO; using System.Security; using System.Text; #if !KeePassUAP using System.Security.Cryptography; #endif using KeePassLib.Resources; namespace KeePassLib.Cryptography.Cipher { public sealed class StandardAesEngine : ICipherEngine { #if !KeePassUAP private const CipherMode SaeCipherMode = CipherMode.CBC; private const PaddingMode SaePaddingMode = PaddingMode.PKCS7; #endif private static PwUuid g_uuidAes = null; public static PwUuid AesUuid { get { PwUuid pu = g_uuidAes; if(pu == null) { pu = new PwUuid(new byte[] { 0x31, 0xC1, 0xF2, 0xE6, 0xBF, 0x71, 0x43, 0x50, 0xBE, 0x58, 0x05, 0x21, 0x6A, 0xFC, 0x5A, 0xFF }); g_uuidAes = pu; } return pu; } } public PwUuid CipherUuid { get { return StandardAesEngine.AesUuid; } } public string DisplayName { get { return ("AES/Rijndael (" + KLRes.KeyBits.Replace(@"{PARAM}", "256") + ", FIPS 197)"); } } private static void ValidateArguments(Stream s, bool bEncrypt, byte[] pbKey, byte[] pbIV) { if(s == null) { Debug.Assert(false); throw new ArgumentNullException("s"); } if(pbKey == null) { Debug.Assert(false); throw new ArgumentNullException("pbKey"); } if(pbKey.Length != 32) { Debug.Assert(false); throw new ArgumentOutOfRangeException("pbKey"); } if(pbIV == null) { Debug.Assert(false); throw new ArgumentNullException("pbIV"); } if(pbIV.Length != 16) { Debug.Assert(false); throw new ArgumentOutOfRangeException("pbIV"); } if(bEncrypt) { Debug.Assert(s.CanWrite); if(!s.CanWrite) throw new ArgumentException("Stream must be writable!"); } else // Decrypt { Debug.Assert(s.CanRead); if(!s.CanRead) throw new ArgumentException("Stream must be readable!"); } } private static Stream CreateStream(Stream s, bool bEncrypt, byte[] pbKey, byte[] pbIV) { StandardAesEngine.ValidateArguments(s, bEncrypt, pbKey, pbIV); #if KeePassUAP return StandardAesEngineExt.CreateStream(s, bEncrypt, pbKey, pbIV); #else SymmetricAlgorithm a = CryptoUtil.CreateAes(); if(a.BlockSize != 128) // AES block size { Debug.Assert(false); a.BlockSize = 128; } a.KeySize = 256; a.Mode = SaeCipherMode; a.Padding = SaePaddingMode; ICryptoTransform t; if(bEncrypt) t = a.CreateEncryptor(pbKey, pbIV); else t = a.CreateDecryptor(pbKey, pbIV); if(t == null) { Debug.Assert(false); throw new SecurityException("Unable to create AES transform!"); } return new CryptoStreamEx(s, t, bEncrypt ? CryptoStreamMode.Write : CryptoStreamMode.Read, a); #endif } public Stream EncryptStream(Stream s, byte[] pbKey, byte[] pbIV) { return StandardAesEngine.CreateStream(s, true, pbKey, pbIV); } public Stream DecryptStream(Stream s, byte[] pbKey, byte[] pbIV) { return StandardAesEngine.CreateStream(s, false, pbKey, pbIV); } } }
joshuadugie/KeePass-2.x
KeePassLib/Cryptography/Cipher/StandardAesEngine.cs
C#
gpl-2.0
3,938
<?php $this->breadcrumbs = array( 'Danh mục tuyển dụng' => array('index'), 'Manage', ); $this->menu = array( array('label' => 'Thêm mới', 'url' => array('create')) ); Yii::app()->clientScript->registerScript('search', " $('.search-button').click(function(){ $('.search-form').toggle(); return false; }); $('.search-form form').submit(function(){ $('#product-grid').yiiGridView('update', { data: $(this).serialize() }); return false; }); "); ?> <h1>Danh sách</h1> <?php echo CHtml::link('Tìm kiếm', '#', array('class' => 'search-button')); ?> <div class="search-form" style="display:none"> <?php $this->renderPartial('_search', array( 'model' => $model, )); ?> </div><!-- search-form --> <?php $form = $this->beginWidget('CActiveForm', array( 'enableAjaxValidation' => TRUE, )); ?> <?php $this->widget('zii.widgets.grid.CGridView', array( 'id' => 'album-grid', 'dataProvider' => $model->search(), 'filter' => $model, 'selectableRows' => 2, 'columns' => array( array( 'id' => 'autoId', 'class' => 'CCheckBoxColumn', 'selectableRows' => '50', ), array( 'name' => 'location', 'value' => 'CHtml::textField("setLocation[$data->id]",$data->location)', 'type' => 'raw', ), array( 'name' => 'education', 'value' => function($data) { if ($data->education == Jobs::JOB_UNIVERSITY) $item = 'Đại học'; elseif ($data->education == Jobs::JOB_COLLEGE) $item = 'Cao đẳng'; elseif ($data->education == Jobs::JOB_INTERMEDIATE) $item = 'Trung cấp'; else $item = 'Lao động phổ thông'; return $item; }, 'filter' => array(Jobs::JOB_UNIVERSITY => 'Đại học', Jobs::JOB_COLLEGE => 'Cao Đẳng', Jobs::JOB_INTERMEDIATE => ' Trung cấp', Jobs::JOB_GENERAL => 'Lao động phổ thông'), ), array( 'name' => 'wage', 'value' => 'CHtml::textField("setWage[$data->id]",$data->wage)', 'type' => 'raw', ), array( 'name' => 'gender', 'value' => function($data) { if ($data->gender == 1) $item = 'Nam'; elseif ($data->gender == 0) $item = 'Nữ'; else $item = 'Nam/Nữ'; return $item; }, 'filter' => array(1 => 'Nam', '2' => 'Nữ', '10' => 'Nam/Nữ'), ), array( 'name' => 'job_type', 'value' => 'CHtml::textField("setJob_type[$data->id]",$data->job_type,array("style"=>"width:100px;"))', 'type' => 'raw', 'filter' => FALSE, ), array( 'name' => 'probation_period', 'value' => 'CHtml::textField("setProbation_period[$data->id]",$data->probation_period,array("style"=>"width:100px;"))', 'type' => 'raw', 'filter' => FALSE, ), array(// display 'create_time' using an expression 'name' => 'create_time', 'value' => 'CHtml::textField("setCreate_time[$data->id]", date("d-m-Y", $data->create_time),array("style"=>"width:80px;"))', 'type' => 'raw', 'filter' => FALSE, ), array(// display 'create_time' using an expression 'name' => 'update_time', 'value' => 'CHtml::textField("setUpdate_time[$data->id]", date("d-m-Y", $data->update_time),array("style"=>"width:80px;"))', 'type' => 'raw', 'filter' => FALSE, ), array( 'name' => 'status', 'value' => '$data->status==1?"Hiện":"Ẩn"', 'filter' => array(1 => 'Hiện', 0 => 'Ẩn'), ), array( 'class' => 'CButtonColumn', ), ), )); ?> <script> function reloadGrid(data) { $.fn.yiiGridView.update('album-grid'); } </script> <span>Tick chọn:</span> <?php echo CHtml::ajaxSubmitButton('Filter', array('jobs/ajaxUpdate'), array(), array("style" => "display:none;")); ?> <?php echo CHtml::ajaxSubmitButton('Hiện', array('jobs/ajaxUpdate', 'act' => 'doActive'), array('success' => 'reloadGrid')); ?> <?php echo CHtml::ajaxSubmitButton('Ẩn', array('jobs/ajaxUpdate', 'act' => 'doInactive'), array('success' => 'reloadGrid')); ?> <br/><BR> <span> Cập nhật: </span> <?php echo CHtml::ajaxSubmitButton('Vị trí', array('jobs/ajaxUpdate', 'act' => 'doLocation'), array('success' => 'reloadGrid')); ?> <?php echo CHtml::ajaxSubmitButton('Mức lương', array('jobs/ajaxUpdate', 'act' => 'dowage'), array('success' => 'reloadGrid')); ?> <?php echo CHtml::ajaxSubmitButton('Hình thức làm việc', array('jobs/ajaxUpdate', 'act' => 'doJob_type'), array('success' => 'reloadGrid')); ?> <?php echo CHtml::ajaxSubmitButton('Thời gian thử việc', array('jobs/ajaxUpdate', 'act' => 'doProbation_period'), array('success' => 'reloadGrid')); ?> <?php echo CHtml::ajaxSubmitButton('Thứ hạng', array('jobs/ajaxUpdate', 'act' => 'doSortRank'), array('success' => 'reloadGrid')); ?> <?php echo CHtml::ajaxSubmitButton('Ngày hết hạn', array('jobs/ajaxUpdate', 'act' => 'doUpdate_time'), array('success' => 'reloadGrid')); ?> <?php $this->endWidget(); ?> <style> #preview { position: absolute; border: 1px solid #ccc; background: #333; padding: 5px; display: none; color: #fff; } #preview img { max-width: 500px; max-height: 500px; } </style>
sonha/camera
protected/views/admin/jobs/admin.php
PHP
gpl-2.0
5,774
package net.minecraft.src; public class RequestDelete extends Request { public RequestDelete(String par1Str, int par2, int par3) { super(par1Str, par2, par3); } public RequestDelete func_96370_f() { try { this.field_96367_a.setDoOutput(true); this.field_96367_a.setRequestMethod("DELETE"); this.field_96367_a.connect(); return this; } catch (Exception var2) { throw new ExceptionMcoHttp("Failed URL: " + this.field_96365_b, var2); } } public Request func_96359_e() { return this.func_96370_f(); } }
LolololTrololol/InsertNameHere
minecraft/net/minecraft/src/RequestDelete.java
Java
gpl-2.0
662
/** * Created by kuku on 10/01/15. */ $(document).ready(function(){ $('.form-usuario-perfil').attr('disabled', 'disabled'); //Disable }); $(".editarFormularioUsuarioPerfil").click(mostrarBotonesPerfil); function mostrarBotonesPerfil(){ $("#botoneraPerfil").show("slow"); $(".editarFormularioUsuarioPerfil").hide("slow"); }
IsmiKin/Podonet
web/js/usuario/perfilUsuario.js
JavaScript
gpl-2.0
342
<?php use Illuminate\Database\Migrations\Migration; use Illuminate\Database\Schema\Blueprint; use Illuminate\Support\Facades\Schema; class CreateExperimentScientistsTable extends Migration { /** * Run the migrations. * * @return void */ public function up() { Schema::create('experiment_scientists', function (Blueprint $table) { $table->id(); $table->integer('experiment_id'); $table->integer('user_id'); $table->timestamps(); // $table->foreign('experiment_id')->references('id')->on('experiments'); // $table->foreign('user_id')->references('id')->on('users'); }); } /** * Reverse the migrations. * * @return void */ public function down() { Schema::dropIfExists('experiment_scientists'); } }
khaivngo/QuickEval
database/migrations/2021_05_14_012802_create_experiment_scientists_table.php
PHP
gpl-2.0
870
<?php /* Finding the path to the wp-admin folder */ $iswin = preg_match('/:\\\/', dirname(__file__)); $slash = ($iswin) ? "\\" : "/"; $wp_path = preg_split('/(?=((\\\|\/)wp-content)).*/', dirname(__file__)); $wp_path = (isset($wp_path[0]) && $wp_path[0] != "") ? $wp_path[0] : $_SERVER["DOCUMENT_ROOT"]; /** Load WordPress Administration Bootstrap */ require_once($wp_path . $slash . 'wp-load.php'); require_once($wp_path . $slash . 'wp-admin' . $slash . 'admin.php'); load_plugin_textdomain( 'kimili-flash-embed', FALSE, 'kimili-flash-embed/langs/'); $title = "Kimili Flash Embed"; ?> <!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> <html xmlns="http://www.w3.org/1999/xhtml" <?php do_action('admin_xml_ns'); ?> <?php language_attributes(); ?>> <head> <meta http-equiv="Content-Type" content="<?php bloginfo('html_type'); ?>; charset=<?php echo get_option('blog_charset'); ?>" /> <title><?php bloginfo('name') ?> &rsaquo; <?php echo wp_specialchars( $title ); ?> &#8212; WordPress</title> <?php wp_admin_css( 'css/global' ); wp_admin_css(); wp_admin_css( 'css/colors' ); wp_admin_css( 'css/ie' ); $hook_suffix = ''; if ( isset($page_hook) ) $hook_suffix = "$page_hook"; else if ( isset($plugin_page) ) $hook_suffix = "$plugin_page"; else if ( isset($pagenow) ) $hook_suffix = "$pagenow"; do_action("admin_print_styles-$hook_suffix"); do_action('admin_print_styles'); do_action("admin_print_scripts-$hook_suffix"); do_action('admin_print_scripts'); do_action("admin_head-$hook_suffix"); do_action('admin_head'); ?> <link rel="stylesheet" href="<?php echo plugins_url('/kimili-flash-embed/css/generator.css'); ?>?ver=<?php echo $KimiliFlashEmbed->version ?>" type="text/css" media="screen" title="no title" charset="utf-8" /> <script src="<?php echo plugins_url('/kimili-flash-embed/js/kfe.js'); ?>?ver=<?php echo $KimiliFlashEmbed->version ?>" type="text/javascript" charset="utf-8"></script> <!-- <?php echo wp_specialchars($title." Tag Generator" ); ?> is heavily based on SWFObject 2 HTML and JavaScript generator v1.2 <http://code.google.com/p/swfobject/> Copyright (c) 2007-2008 Geoff Stearns, Michael Williams, and Bobby van der Sluis This software is released under the MIT License <http://www.opensource.org/licenses/mit-license.php> --> </head> <body class="<?php echo apply_filters( 'admin_body_class', '' ); ?>"> <div class="wrap" id="KFE_Generator"> <h2><?php echo wp_specialchars($title." ".__("Tag Generator",'kimili-flash-embed') ); ?></h2> <div class="note"><?php _e('Asterisk (<span class="req">*</span>) indicates required field','kimili-flash-embed'); ?></div> <fieldset> <legend><?php _e("SWFObject Configuration",'kimili-flash-embed'); ?> [ <a id="toggle1" href="#">-</a> ]</legend> <div id="toggleable1"> <div class="col1"> <label for="publishingMethod"><?php _e("Publish method",'kimili-flash-embed'); ?>:</label> <span class="req">*</span> </div> <div class="col2"> <select id="publishingMethod" name="publishmethod"> <option value="static" <?php if (!get_option('kml_flashembed_publish_method')) echo "selected=\"selected\""; ?>><?php _e("Static publishing",'kimili-flash-embed'); ?></option> <option value="dynamic" <?php if (get_option('kml_flashembed_publish_method')) echo "selected=\"selected\""; ?>><?php _e("Dynamic publishing",'kimili-flash-embed'); ?></option> </select> <a id="togglePublishingMethodHelp" href="#"><?php _e("what is this?",'kimili-flash-embed'); ?></a> </div> <div class="clear">&nbsp;</div> <div id="publishingMethodHelp" class="help"> <h2><?php _e("Static publishing",'kimili-flash-embed'); ?></h2> <h3><?php _e("Description",'kimili-flash-embed'); ?></h3> <p><?php _e("Embed Flash content and alternative content using standards compliant markup, and use unobtrusive JavaScript to resolve the issues that markup alone cannot solve.",'kimili-flash-embed'); ?></p> <h3><?php _e("Pros",'kimili-flash-embed'); ?></h3> <p><?php _e("The embedding of Flash content does not rely on JavaScript and the actual authoring of standards compliant markup is promoted.",'kimili-flash-embed'); ?></p> <h3><?php _e("Cons",'kimili-flash-embed'); ?></h3> <p><?php _e("Does not solve 'click-to-activate' mechanisms in Internet Explorer 6+ and Opera 9+.",'kimili-flash-embed'); ?></p> <h2><?php _e("Dynamic publishing",'kimili-flash-embed'); ?></h2> <h3><?php _e("Description",'kimili-flash-embed'); ?></h3> <p><?php _e("Create alternative content using standards compliant markup and embed Flash content with unobtrusive JavaScript.",'kimili-flash-embed'); ?></p> <h3><?php _e("Pros",'kimili-flash-embed'); ?></h3> <p><?php _e("Avoids 'click-to-activate' mechanisms in Internet Explorer 6+ and Opera 9+.",'kimili-flash-embed'); ?></p> <h3><?php _e("Cons",'kimili-flash-embed'); ?></h3> <p><?php _e("The embedding of Flash content relies on JavaScript, so if you have the Flash plug-in installed, but have JavaScript disabled or use a browser that doesn't support JavaScript, you will not be able to see your Flash content, however you will see alternative content instead. Flash content will also not be shown on a device like Sony PSP, which has very poor JavaScript support, and automated tools like RSS readers are not able to pick up Flash content.",'kimili-flash-embed'); ?></p> </div> <div class="col1"> <label title="<?php _e("Flash version consists of major, minor and release version",'kimili-flash-embed'); ?>" class="info"><?php _e("Flash Version",'kimili-flash-embed'); ?></label>: <span class="req">*</span> </div> <div class="col2"> <input type="text" id="major" name="major" value="<?php echo get_option('kml_flashembed_version_major'); ?>" size="4" maxlength="2" /> . <input type="text" id="minor" name="minor" value="<?php echo get_option('kml_flashembed_version_minor'); ?>" size="4" maxlength="4" /> . <input type="text" id="release" name="release" value="<?php echo get_option('kml_flashembed_version_revision'); ?>" size="4" maxlength="4" /> </div> <div class="clear">&nbsp;</div> <div class="col1"> <label for="expressInstall" title="<?php _e("Check checkbox to activate express install functionality on your swf.",'kimili-flash-embed'); ?>" class="info"><?php _e("Adobe Express Install",'kimili-flash-embed'); ?>:</label> </div> <div class="col2"> <input type="checkbox" id="expressInstall" name="useexpressinstall" value="true" <?php if (get_option('kml_flashembed_use_express_install')) echo "checked=\"checked\""; ?> /> </div> <div class="clear">&nbsp;</div> <div id="toggleReplaceId"> <div class="col1"> <label for="replaceId"><?php _e("HTML container ID",'kimili-flash-embed'); ?>:</label> </div> <div class="col2"> <input type="text" id="replaceId" name="replaceId" value="" size="20" /> <a id="toggleReplaceIdHelp" href="#"><?php _e("what is this?",'kimili-flash-embed'); ?></a> </div> <div id="replaceIdHelp" class="help"> <p><?php _e("Specifies the id attribute of the HTML container element that will be replaced with Flash content if enough JavaScript and Flash support is available.",'kimili-flash-embed'); ?></p> <p><?php _e("This HTML container will be generated automatically and will embed your alternative HTML content as defined in the HTML section.",'kimili-flash-embed'); ?></p> <p><?php _e("If you don't define an ID here, KFE will randomly generate an ID for you.",'kimili-flash-embed'); ?></p> </div> <div class="clear">&nbsp;</div> </div> </div> </fieldset> <fieldset> <legend><?php _e("SWF definition",'kimili-flash-embed'); ?> [ <a id="toggle2" href="#">-</a> ]</legend> <div id="toggleable2"> <div class="col1"> <label for="swf" title="<?php _e("The relative or absolute path to your Flash content .swf file",'kimili-flash-embed'); ?>" class="info"><?php _e("Flash (.swf)",'kimili-flash-embed'); ?>:</label> <span class="req">*</span> </div> <div class="col2"> <input type="text" id="swf" name="movie" value="<?php echo get_option('kml_flashembed_filename'); ?>" size="20" /> </div> <div class="clear">&nbsp;</div> <div class="col1"> <label title="<?php _e("Width &times; height (unit)",'kimili-flash-embed'); ?>" class="info"><?php _e("Dimensions",'kimili-flash-embed'); ?>:</label> <span class="req">*</span> </div> <div class="col2"> <input type="text" id="width" name="width" value="<?php echo get_option('kml_flashembed_width'); ?>" size="5" maxlength="5" /> &times; <input type="text" id="height" name="height" value="<?php echo get_option('kml_flashembed_height'); ?>" size="5" maxlength="5" /> <select id="unit" name="unit"> <option <?php if (get_option('kml_flashembed_dimensions_unit') == "pixels") echo "selected=\"selected\""; ?> value="pixels"><?php _e("pixels",'kimili-flash-embed'); ?></option> <option <?php if (get_option('kml_flashembed_dimensions_unit') == "percentage") echo "selected=\"selected\""; ?> value="percentage"><?php _e("percentage",'kimili-flash-embed'); ?></option> </select> </div> <div class="clear">&nbsp;</div> <div id="toggleAttsParamsContainer"> <div class="col1"><label class="info" title="<?php _e("HTML object element attributes",'kimili-flash-embed'); ?>"><?php _e("Attributes",'kimili-flash-embed'); ?>:</label></div> <div class="col3"> <label for="attId" class="info" title="<?php _e("Uniquely identifies the Flash movie so that it can be referenced using a scripting language or by CSS",'kimili-flash-embed'); ?>"><?php _e("Flash content ID",'kimili-flash-embed'); ?></label> </div> <div class="col4"> <input type="text" id="attId" name="fid" value="<?php echo get_option('kml_flashembed_flash_id'); ?>" size="15" /> </div> <div class="clear">&nbsp;</div> <div class="col1">&nbsp;</div> <div class="col3"> <label for="attClass" class="info" title="<?php _e("Classifies the Flash movie so that it can be referenced using a scripting language or by CSS",'kimili-flash-embed'); ?>">class</label> </div> <div class="col4"> <input type="text" id="attClass" name="targetclass" value="<?php echo get_option('kml_flashembed_target_class'); ?>" size="15" /> </div> <div class="clear">&nbsp;</div> <div class="col1">&nbsp;</div> <div class="col3"> <label for="align" class="info" title="<?php _e("HTML alignment of the object element. If this attribute is omitted, it by default centers the movie and crops edges if the browser window is smaller than the movie. NOTE: Using this attribute is not valid in XHTML 1.0 Strict.",'kimili-flash-embed'); ?>">align</label> </div> <div class="col4"> <select id="align" name="align"> <option value=""><?php _e("Choose",'kimili-flash-embed'); ?>...</option> <option <?php if (get_option('kml_flashembed_align') == "left") echo "selected=\"selected\""; ?> value="left">left</option> <option <?php if (get_option('kml_flashembed_align') == "right") echo "selected=\"selected\""; ?> value="right">right</option> <option <?php if (get_option('kml_flashembed_align') == "top") echo "selected=\"selected\""; ?> value="top">top</option> <option <?php if (get_option('kml_flashembed_align') == "bottom") echo "selected=\"selected\""; ?> value="bottom">bottom</option> </select> </div> <div class="clear">&nbsp;</div> <div class="col1"> <label class="info" title="<?php _e("HTML object element nested param elements",'kimili-flash-embed'); ?>"><?php _e("Parameters",'kimili-flash-embed'); ?>:</label> </div> <div class="col3"> <label for="play" class="info" title="<?php _e("Specifies whether the movie begins playing immediately on loading in the browser. The default value is true if this attribute is omitted.",'kimili-flash-embed'); ?>">play</label> </div> <div class="col4"> <select id="play" name="play"> <option value=""><?php _e("Choose",'kimili-flash-embed'); ?>...</option> <option <?php if (get_option('kml_flashembed_play') == "true") echo "selected=\"selected\""; ?> value="true">true</option> <option <?php if (get_option('kml_flashembed_play') == "false") echo "selected=\"selected\""; ?> value="false">false</option> </select> </div> <div class="col3"> <label for="loop" class="info" title="<?php _e("Specifies whether the movie repeats indefinitely or stops when it reaches the last frame. The default value is true if this attribute is omitted",'kimili-flash-embed'); ?>.">loop</label> </div> <div class="col4"> <select id="loop" name="loop"> <option value=""><?php _e("Choose",'kimili-flash-embed'); ?>...</option> <option <?php if (get_option('kml_flashembed_loop') == "true") echo "selected=\"selected\""; ?> value="true">true</option> <option <?php if (get_option('kml_flashembed_loop') == "false") echo "selected=\"selected\""; ?> value="false">false</option> </select> </div> <div class="clear">&nbsp;</div> <div class="col1">&nbsp;</div> <div class="col3"> <label for="menu" class="info" title="<?php _e("Shows a shortcut menu when users right-click (Windows) or control-click (Macintosh) the SWF file. To show only About Flash in the shortcut menu, deselect this option. By default, this option is set to true.",'kimili-flash-embed'); ?>">menu</label> </div> <div class="col4"> <select id="menu" name="menu"> <option value=""><?php _e("Choose",'kimili-flash-embed'); ?>...</option> <option <?php if (get_option('kml_flashembed_menu') == "true") echo "selected=\"selected\""; ?> value="true">true</option> <option <?php if (get_option('kml_flashembed_menu') == "false") echo "selected=\"selected\""; ?> value="false">false</option> </select> </div> <div class="col3"> <label for="quality" class="info" title="<?php _e("Specifies the trade-off between processing time and appearance. The default value is 'high' if this attribute is omitted.",'kimili-flash-embed'); ?>">quality</label> </div> <div class="col4"> <select id="quality" name="quality"> <option value=""><?php _e("Choose",'kimili-flash-embed'); ?>...</option> <option <?php if (get_option('kml_flashembed_quality') == "best") echo "selected=\"selected\""; ?> value="best">best</option> <option <?php if (get_option('kml_flashembed_quality') == "high") echo "selected=\"selected\""; ?> value="high">high</option> <option <?php if (get_option('kml_flashembed_quality') == "medium") echo "selected=\"selected\""; ?> value="medium">medium</option> <option <?php if (get_option('kml_flashembed_quality') == "autohigh") echo "selected=\"selected\""; ?> value="autohigh">autohigh</option> <option <?php if (get_option('kml_flashembed_quality') == "autolow") echo "selected=\"selected\""; ?> value="autolow">autolow</option> <option <?php if (get_option('kml_flashembed_quality') == "low") echo "selected=\"selected\""; ?> value="low">low</option> </select> </div> <div class="clear">&nbsp;</div> <div class="col1">&nbsp;</div> <div class="col3"> <label for="scale" class="info" title="<?php _e("Specifies scaling, aspect ratio, borders, distortion and cropping for if you have changed the document's original width and height.",'kimili-flash-embed'); ?>">scale</label> </div> <div class="col4"> <select id="scale" name="scale"> <option value=""><?php _e("Choose",'kimili-flash-embed'); ?>...</option> <option <?php if (get_option('kml_flashembed_scale') == "showall") echo "selected=\"selected\""; ?> value="showall">showall</option> <option <?php if (get_option('kml_flashembed_scale') == "noborder") echo "selected=\"selected\""; ?> value="noborder">noborder</option> <option <?php if (get_option('kml_flashembed_scale') == "exactfit") echo "selected=\"selected\""; ?> value="exactfit">exactfit</option> <option <?php if (get_option('kml_flashembed_scale') == "noscale") echo "selected=\"selected\""; ?> value="noscale">noscale</option> </select> </div> <div class="col3"> <label for="salign" class="info" title="<?php _e("Specifies where the content is placed within the application window and how it is cropped.",'kimili-flash-embed'); ?>">salign</label> </div> <div class="col4"> <select id="salign" name="salign"> <option value=""><?php _e("Choose",'kimili-flash-embed'); ?>...</option> <option <?php if (get_option('kml_flashembed_salign') == "tl") echo "selected=\"selected\""; ?> value="tl">tl</option> <option <?php if (get_option('kml_flashembed_salign') == "tr") echo "selected=\"selected\""; ?> value="tr">tr</option> <option <?php if (get_option('kml_flashembed_salign') == "bl") echo "selected=\"selected\""; ?> value="bl">bl</option> <option <?php if (get_option('kml_flashembed_salign') == "br") echo "selected=\"selected\""; ?> value="br">br</option> <option <?php if (get_option('kml_flashembed_salign') == "l") echo "selected=\"selected\""; ?> value="l">l</option> <option <?php if (get_option('kml_flashembed_salign') == "t") echo "selected=\"selected\""; ?> value="t">t</option> <option <?php if (get_option('kml_flashembed_salign') == "r") echo "selected=\"selected\""; ?> value="r">r</option> <option <?php if (get_option('kml_flashembed_salign') == "b") echo "selected=\"selected\""; ?> value="b">b</option> </select> </div> <div class="clear">&nbsp;</div> <div class="col1">&nbsp;</div> <div class="col3"> <label for="wmode" class="info" title="<?php _e("Sets the Window Mode property of the Flash movie for transparency, layering, and positioning in the browser. The default value is 'window' if this attribute is omitted.",'kimili-flash-embed'); ?>">wmode</label> </div> <div class="col4"> <select id="wmode" name="wmode"> <option value=""><?php _e("Choose",'kimili-flash-embed'); ?>...</option> <option <?php if (get_option('kml_flashembed_wmode') == "window") echo "selected=\"selected\""; ?> value="window">window</option> <option <?php if (get_option('kml_flashembed_wmode') == "opaque") echo "selected=\"selected\""; ?> value="opaque">opaque</option> <option <?php if (get_option('kml_flashembed_wmode') == "transparent") echo "selected=\"selected\""; ?> value="transparent">transparent</option> <option <?php if (get_option('kml_flashembed_wmode') == "direct") echo "selected=\"selected\""; ?> value="direct">direct</option> <option <?php if (get_option('kml_flashembed_wmode') == "gpu") echo "selected=\"selected\""; ?> value="gpu">gpu</option> </select> </div> <div class="col3"> <label for="bgcolor" class="info" title="<?php _e("Hexadecimal RGB value in the format #RRGGBB, which specifies the background color of the movie, which will override the background color setting specified in the Flash file.",'kimili-flash-embed'); ?>">bgcolor</label> </div> <div class="col4"> <input type="text" id="bgcolor" name="bgcolor" value="<?php echo get_option('kml_flashembed_bgcolor'); ?>" size="15" maxlength="7" /> </div> <div class="clear">&nbsp;</div> <div class="col1">&nbsp;</div> <div class="col3"> <label for="devicefont" class="info" title="<?php _e("Specifies whether static text objects that the Device Font option has not been selected for will be drawn using device fonts anyway, if the necessary fonts are available from the operating system.",'kimili-flash-embed'); ?>">devicefont</label> </div> <div class="col4"> <select id="devicefont" name="devicefont"> <option value=""><?php _e("Choose",'kimili-flash-embed'); ?>...</option> <option <?php if (get_option('kml_flashembed_devicefont') == "true") echo "selected=\"selected\""; ?> value="true">true</option> <option <?php if (get_option('kml_flashembed_devicefont') == "false") echo "selected=\"selected\""; ?> value="false">false</option> </select> </div> <div class="col3"> <label for="seamlesstabbing" class="info" title="<?php _e("Specifies whether users are allowed to use the Tab key to move keyboard focus out of a Flash movie and into the surrounding HTML (or the browser, if there is nothing focusable in the HTML following the Flash movie). The default value is true if this attribute is omitted.",'kimili-flash-embed'); ?>">seamlesstabbing</label> </div> <div class="col4"> <select id="seamlesstabbing" name="seamlesstabbing"> <option value=""><?php _e("Choose",'kimili-flash-embed'); ?>...</option> <option <?php if (get_option('kml_flashembed_seamlesstabbing') == "true") echo "selected=\"selected\""; ?> value="true">true</option> <option <?php if (get_option('kml_flashembed_seamlesstabbing') == "false") echo "selected=\"selected\""; ?> value="false">false</option> </select> </div> <div class="clear">&nbsp;</div> <div class="col1">&nbsp;</div> <div class="col3"> <label for="swliveconnect" class="info" title="<?php _e("Specifies whether the browser should start Java when loading the Flash Player for the first time. The default value is false if this attribute is omitted. If you use JavaScript and Flash on the same page, Java must be running for the FSCommand to work.",'kimili-flash-embed'); ?>">swliveconnect</label> </div> <div class="col4"> <select id="swliveconnect" name="swliveconnect"> <option value=""><?php _e("Choose",'kimili-flash-embed'); ?>...</option> <option <?php if (get_option('kml_flashembed_swliveconnect') == "true") echo "selected=\"selected\""; ?> value="true">true</option> <option <?php if (get_option('kml_flashembed_swliveconnect') == "false") echo "selected=\"selected\""; ?> value="false">false</option> </select> </div> <div class="col3"> <label for="allowfullscreen" class="info" title="<?php _e("Enables full-screen mode. The default value is false if this attribute is omitted. You must have version 9,0,28,0 or greater of Flash Player installed to use full-screen mode.",'kimili-flash-embed'); ?>">allowfullscreen</label> </div> <div class="col4"> <select id="allowfullscreen" name="allowfullscreen"> <option value=""><?php _e("Choose",'kimili-flash-embed'); ?>...</option> <option <?php if (get_option('kml_flashembed_allowfullscreen') == "true") echo "selected=\"selected\""; ?> value="true">true</option> <option <?php if (get_option('kml_flashembed_allowfullscreen') == "false") echo "selected=\"selected\""; ?> value="false">false</option> </select> </div> <div class="clear">&nbsp;</div> <div class="col1">&nbsp;</div> <div class="col3"> <label for="allowscriptaccess" class="info" title="<?php _e("Controls the ability to perform outbound scripting from within a Flash SWF. The default value is 'always' if this attribute is omitted.",'kimili-flash-embed'); ?>">allowscriptaccess</label> </div> <div class="col4"> <select id="allowscriptaccess" name="allowscriptaccess"> <option value=""><?php _e("Choose",'kimili-flash-embed'); ?>...</option> <option <?php if (get_option('kml_flashembed_allowscriptaccess') == "always") echo "selected=\"selected\""; ?> value="always">always</option> <option <?php if (get_option('kml_flashembed_allowscriptaccess') == "sameDomain") echo "selected=\"selected\""; ?> value="sameDomain">sameDomain</option> <option <?php if (get_option('kml_flashembed_allowscriptaccess') == "never") echo "selected=\"selected\""; ?> value="never">never</option> </select> </div> <div class="col3"> <label for="allownetworking" class="info" title="<?php _e("Controls a SWF file's access to network functionality. The default value is 'all' if this attribute is omitted.",'kimili-flash-embed'); ?>">allownetworking</label> </div> <div class="col4"> <select id="allownetworking" name="allownetworking"> <option value=""><?php _e("Choose",'kimili-flash-embed'); ?>...</option> <option <?php if (get_option('kml_flashembed_allownetworking') == "all") echo "selected=\"selected\""; ?> value="all">all</option> <option <?php if (get_option('kml_flashembed_allownetworking') == "internal") echo "selected=\"selected\""; ?> value="internal">internal</option> <option <?php if (get_option('kml_flashembed_allownetworking') == "none") echo "selected=\"selected\""; ?> value="none">none</option> </select> </div> <div class="clear">&nbsp;</div> <div class="col1">&nbsp;</div> <div class="col3"> <label for="base" class="info" title="<?php _e("Specifies the base directory or URL used to resolve all relative path statements in the Flash Player movie. This attribute is helpful when your Flash Player movies are kept in a different directory from your other files.",'kimili-flash-embed'); ?>">base</label> </div> <div class="col5"> <input type="text" id="base" name="base" value="<?php echo get_option('kml_flashembed_base'); ?>" size="15" /> </div> <div class="clear">&nbsp;</div> <div class="col1"> <label class="info" title="<?php _e("Method to pass variables to a Flash movie. You need to separate individual name/variable pairs with a semicolon (i.e. name=John Doe ; count=3).",'kimili-flash-embed'); ?>">fvars:</label> </div> <div class="col2"> <textarea name="fvars" id="fvars" rows="4" cols="40"><?php echo stripcslashes(get_option('kml_flashembed_fvars')); ?></textarea> </div> </div> <div class="clear">&nbsp;</div> <div class="col1"><a id="toggleAttsParams" href="#"><?php _e("more",'kimili-flash-embed'); ?></a></div> <div class="clear">&nbsp;</div> </div> </fieldset> <fieldset> <legend><?php _e("Alternative Content",'kimili-flash-embed'); ?> [ <a id="toggle3" href="#">-</a> ]</legend> <div id="toggleable3"> <div class="col2"> <label for="alternativeContent"><?php _e("Alternative content",'kimili-flash-embed'); ?>:</label> <a id="toggleAlternativeContentHelp" href="#alternativeContentHelp"><?php _e("what is this",'kimili-flash-embed'); ?>?</a> </div> <div id="alternativeContentHelp" class="help"> <p> <?php _e("The object element allows you to nest alternative HTML content inside of it, which will be displayed if Flash is not installed or supported. This content will also be picked up by search engines, making it a great tool for creating search-engine-friendly content.",'kimili-flash-embed'); ?> </p> <p><?php _e("Summarized, you should use alternative content for the following:",'kimili-flash-embed'); ?></p> <ul> <li><?php _e("When you like to create content that is accessible for people who browse the Web without plugins",'kimili-flash-embed'); ?></li> <li><?php _e("When you like to create search-engine-friendly content",'kimili-flash-embed'); ?></li> <li><?php _e("To tell visitors that they can have a richer user experience by downloading the Flash plugin",'kimili-flash-embed'); ?></li> </ul> </div> <div class="clear"> </div> <div class="col2"> <textarea id="alternativeContent" name="alternativeContent" rows="6" cols="10"><?php echo stripcslashes(get_option('kml_flashembed_alt_content')); ?></textarea> </div> <div class="clear"> </div> </div> </fieldset> <div class="col1"> <input type="button" class="button" id="generate" name="generate" value="<?php _e("Generate",'kimili-flash-embed'); ?>" /> </div> </div> <script type="text/javascript" charset="utf-8"> // <![CDATA[ jQuery(document).ready(function(){ try { Kimili.Flash.Generator.initialize(); Kimili.Flash.Generator.i18n = { more : "<?php _e("more",'kimili-flash-embed'); ?>", less : "<?php _e("less",'kimili-flash-embed'); ?>" }; } catch (e) { throw "<?php _e("Kimili is not defined. This generator isn't going to put a KFE tag in your code.",'kimili-flash-embed'); ?>"; } }); // ]]> </script> </body> </html>
EthanBlast/Glam-Star-Life
wp-content/plugins/kimili-flash-embed/admin/config.php
PHP
gpl-2.0
28,850
using System; using System.Collections.Generic; using System.Linq; using System.Reflection; using HA4IoT.Contracts.Api; using HA4IoT.Contracts.Services; using HA4IoT.Contracts.Services.Backup; using HA4IoT.Contracts.Services.Resources; using HA4IoT.Contracts.Services.Settings; using HA4IoT.Contracts.Services.Storage; using HA4IoT.Settings; using Newtonsoft.Json.Linq; namespace HA4IoT.Services.Resources { [ApiServiceClass(typeof(IResourceService))] public class ResourceService : ServiceBase, IResourceService { private const string StorageFilename = "ResourceService.json"; private const string BackupKeyName = "Resources"; private readonly object _syncRoot = new object(); private readonly List<Resource> _resources = new List<Resource>(); private readonly IStorageService _storageService; private readonly ISettingsService _settingsService; private ControllerSettings _controllerSettings; public ResourceService(IBackupService backupService, IStorageService storageService, ISettingsService settingsService) { if (backupService == null) throw new ArgumentNullException(nameof(backupService)); if (storageService == null) throw new ArgumentNullException(nameof(storageService)); if (settingsService == null) throw new ArgumentNullException(nameof(settingsService)); _storageService = storageService; _settingsService = settingsService; backupService.CreatingBackup += (s, e) => CreateBackup(e); backupService.RestoringBackup += (s, e) => RestoreBackup(e); } public void Initialize() { _controllerSettings = _settingsService.GetSettings<ControllerSettings>(); lock (_syncRoot) { TryLoadResources(); } } public void RegisterText(Enum id, string value) { var uri = GenerateUri(id); lock (_syncRoot) { var resource = _resources.FirstOrDefault(r => r.Uri.Equals(uri)); if (resource != null) { return; } resource = new Resource(uri, value); _resources.Add(resource); SaveResources(); } } public string GetText(Enum id) { var uri = GenerateUri(id); lock (_syncRoot) { var resource = _resources.FirstOrDefault(r => r.Uri.Equals(uri)); if (resource == null) { return $"#Resource '{uri}' not found."; } var resourceValue = resource.Values.FirstOrDefault(rv => rv.LanguageCode.Equals(_controllerSettings.Language)); if (resourceValue == null) { return resource.DefaultValue; } return resourceValue.Value; } } public string GetText(Enum id, params object[] formatParameterObjects) { if (formatParameterObjects == null) throw new ArgumentNullException(nameof(formatParameterObjects)); var text = GetText(id); foreach (var formatParameter in formatParameterObjects) { foreach (var property in formatParameter.GetType().GetProperties()) { text = ReplaceFormatParameter(text, property.Name, property.GetValue(formatParameter)); } } return text; } public string GetText(Enum id, IDictionary<string, object> formatParameters) { if (formatParameters == null) throw new ArgumentNullException(nameof(formatParameters)); var text = GetText(id); foreach (var formatParameter in formatParameters) { text = ReplaceFormatParameter(text, formatParameter.Key, formatParameter.Value); } return text; } [ApiMethod] public void SetTexts(IApiContext apiContext) { lock (_syncRoot) { var request = apiContext.Request.ToObject<SetTextsRequest>(); if (request?.Resources == null || !request.Resources.Any()) { apiContext.ResultCode = ApiResultCode.InvalidBody; return; } foreach (var updatedResource in request.Resources) { var existingResource = _resources.FirstOrDefault(r => r.Uri.Equals(updatedResource.Uri)); if (existingResource != null) { _resources.Remove(existingResource); } _resources.Add(updatedResource); } SaveResources(); } } [ApiMethod] public void GetTexts(IApiContext apiContext) { lock (_syncRoot) { var request = apiContext.Request.ToObject<GetTextsRequest>(); var matchingResources = _resources; if (!string.IsNullOrEmpty(request.Category)) { matchingResources = _resources.Where(r => r.Uri.StartsWith(request.Category + ".")).ToList(); } apiContext.Response["Resources"] = JToken.FromObject(matchingResources); } } private void TryLoadResources() { List<Resource> persistedResources; if (_storageService.TryRead(StorageFilename, out persistedResources)) { _resources.AddRange(persistedResources); } } private void SaveResources() { _storageService.Write(StorageFilename, _resources); } private string GenerateUri(Enum id) { return $"{id.GetType().Name}.{id}"; } private string ReplaceFormatParameter(string text, string name, object value) { return text.Replace("{" + name + "}", Convert.ToString(value)); } private void CreateBackup(BackupEventArgs backupEventArgs) { lock (_syncRoot) { backupEventArgs.Backup[BackupKeyName] = JToken.FromObject(_resources); } } private void RestoreBackup(BackupEventArgs backupEventArgs) { if (backupEventArgs.Backup.Property(BackupKeyName) == null) { return; } var resources = backupEventArgs.Backup[BackupKeyName].Value<List<Resource>>(); lock (_syncRoot) { _resources.Clear(); _resources.AddRange(resources); } } } }
byrialsen/HA4IoT
SDK/HA4IoT/Services/Resources/ResourceService.cs
C#
gpl-2.0
7,003
(function($){ $(function(){ boxHeight(0.4,0.7); var imgSrc1 = $('.view-banner .views-field-field-image-banner img').attr('src'); var current2 = $('.view-banner .views-field-field-image-banner'); $('.view-banner .views-field-field-image-banner img').remove(); $(current2).append('<div class="backbg"></div>'); $('.view-banner .views-field-field-image-banner .backbg').css('background-image', 'url(' + imgSrc1 + ')'); var imgSrc1 = $('#header-image img').attr('src'); var current2 = $('#header-image'); $('#header-image img').remove(); $(current2).append('<div class="backbg"></div>'); $('#header-image .backbg').css('background-image', 'url(' + imgSrc1 + ')'); function boxHeight(w,h) { var height=$(window).height(); var width=$(window).width(); $('#block-views-team-bio-block').css({'height':h*height}); $('#block-views-team-bio-block').css({'width':w*width}); } if($(window).width()<950) { boxHeight(0.7,0.6); } if($(window).width()<767) { boxHeight(0.8,0.7); } $(window).resize(function(){ boxHeight(0.4,0.7); if($(window).width()<950) { boxHeight(0.7,0.6); } if($(window).width()<767) { boxHeight(0.8,0.7); } }); }); })(jQuery);
CCI-Studios/RE-Dale
sites/all/themes/redale/js/background-size.js
JavaScript
gpl-2.0
1,248
<?php /** * ------------------------------------------------------------------------- * Fields plugin for GLPI * ------------------------------------------------------------------------- * * LICENSE * * This file is part of Fields. * * Fields is free software; you can redistribute it and/or modify * it under the terms of the GNU General Public License as published by * the Free Software Foundation; either version 2 of the License, or * (at your option) any later version. * * Fields is distributed in the hope that it will be useful, * but WITHOUT ANY WARRANTY; without even the implied warranty of * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the * GNU General Public License for more details. * * You should have received a copy of the GNU General Public License * along with Fields. If not, see <http://www.gnu.org/licenses/>. * ------------------------------------------------------------------------- * @copyright Copyright (C) 2013-2022 by Fields plugin team. * @license GPLv2 https://www.gnu.org/licenses/gpl-2.0.html * @link https://github.com/pluginsGLPI/fields * ------------------------------------------------------------------------- */ include "../../../inc/includes.php"; if (preg_match('/[a-z]/i', $_REQUEST['ddtype']) !== 1) { throw new \RuntimeException(sprintf('Invalid itemtype "%"', $_REQUEST['ddtype'])); } $path = PLUGINFIELDS_FRONT_PATH . '/' . $_REQUEST['ddtype'] . '.form.php'; require_once $path;
pluginsGLPI/fields
front/commondropdown.form.php
PHP
gpl-2.0
1,481
using System; using System.Collections.Generic; using System.Linq; using System.Linq.Expressions; using Configuration; using Domain; using Core; using Extensions; namespace Extensions { public static class CollectionExtensions { /// <summary> /// Merge elements in the ordered sequence <code>collection</code> based on <code>groupSelector</code>. Return results for each group using <code>resultSelector</code>. /// </summary> /// <param name="collection"></param> /// <param name="groupSelector"></param> /// <param name="resultSelector"></param> /// <returns></returns> public static IEnumerable<TResult> GroupMerge<T,TResult>(this IEnumerable<T> collection,Func<T,T,int> orderingFunction,Func<IEnumerable<T>,T,bool> groupSelector,Func<IEnumerable<T>,TResult> resultSelector) { // Create groups by the group selector var groups=new List<List<T>>(); foreach(T item in collection.OrderBy(item => item,orderingFunction)) { var groupForItem=groups.FirstOrDefault(group => groupSelector.Invoke(group,item)); if(groupForItem!=null) { groupForItem.Add(item); } else { var newGroup=new List<T>(); newGroup.Add(item); groups.Add(newGroup); } } // And project the results for each group using the resultSelector return groups.Select(group => resultSelector.Invoke(group)); } public static IEnumerable<T> OrderBy<T>(this IEnumerable<T> objects, Func<T,T,int> orderingFunction) { return objects.OrderBy(t => t, new LambdaComparer<T> (orderingFunction)); } public static IEnumerable<T> OrderBy<T,TKey>(this IEnumerable<T> objects, Func<T,TKey> keySelector, Func<TKey,TKey,int> orderingFunction) { return objects.OrderBy(keySelector, new LambdaComparer<TKey> (orderingFunction)); } public static IEnumerable<T> FetchAllRelated<T>(this IEnumerable<T> objects) where T:class,new() { return Prefetcher<T>.FetchAllRelated(objects); } public static IEnumerable<T> FetchRelated<T>(this IEnumerable<T> objects,params Expression<Func<T,object>>[] propertySelectors) where T:class,new() { return Prefetcher<T>.FetchRelated(objects,propertySelectors); } public static bool IsSubSetOf<T>(this IEnumerable<T> objects, IEnumerable<T> otherObjects) { return !objects.Except (otherObjects).Any (); } public static string ToIdString<T>(this IEnumerable<T> objects) where T: HasId { return objects.Select(c => c.id).ToIdString(); } public static string ToIdString(this IEnumerable<int> objects) { return objects.Aggregate("",(str,obj) => string.IsNullOrEmpty(str)?obj.ToString():string.Format("{0},{1}",str,obj)); } } }
olale/GenericDAO
GenericDAO/Extensions/CollectionExtensions.cs
C#
gpl-2.0
2,940
// display the calendar here var hotelTable = document.getElementById("hotelCalendarTable"); var defaultData = hotelTable.innerHTML; var stringHTML = ""; var date=31; var count=0; // stringHTML = "<tr><td>1</td><td>2</td></tr>"; var table = document.getElementById("hotelCalendarTable"); for (var i = 1; i <= date; i++) { if (count === 0){ stringHTML += "<tr>"; count++ } if (count === 7 || i === date) { stringHTML += "<td>" + i + "</td></tr>"; count=0; } else { stringHTML += "<td>" + i + "</td>"; count++; } } hotelTable.innerHTML += stringHTML;
Athit101/ITE220
Week2-2/js/calendar.js
JavaScript
gpl-2.0
566
<?php /** * @package HikaShop for Joomla! * @version 2.6.1 * @author hikashop.com * @copyright (C) 2010-2016 HIKARI SOFTWARE. All rights reserved. * @license GNU/GPLv3 http://www.gnu.org/licenses/gpl-3.0.html */ defined('_JEXEC') or die('Restricted access'); ?><?php class hikashopOrderHelper { var $table = ''; var $pkey = ''; var $groupMap = ''; var $groupVal = ''; var $orderingMap = ''; function order($down = true, $useCID = true) { $database = JFactory::getDBO(); if($down){ $sign = '>'; $dir = 'ASC'; }else{ $sign = '<'; $dir = 'DESC'; } $orders = JRequest::getVar( 'order', array(), '', 'array' ); if($useCID) { $ids = JRequest::getVar( 'cid', array(), '', 'array' ); } else { $ids = array_keys($orders); } $orderingMap = $this->orderingMap; $id = (int) $ids[0]; $pkey = $this->pkey; if(!empty($this->main_pkey)){ $main = $this->main_pkey; }else{ $main = $pkey; } $query = 'SELECT a.'.$orderingMap.',a.'.$pkey.' FROM '.hikashop_table($this->table).' as b, '.hikashop_table($this->table).' as a'; $query .= ' WHERE a.'.$orderingMap.' '.$sign.' b.'.$orderingMap.' AND b.'.$main.' = '.$id.$this->group(false,'a').$this->group(false,'b'); $query .= ' ORDER BY a.'.$orderingMap.' '.$dir.' LIMIT 1'; $database->setQuery($query); $secondElement = $database->loadObject(); if(empty($secondElement)) return false; $firstElement = new stdClass(); if($main==$pkey){ $firstElement->$pkey = $id; }else{ $database->setQuery('SELECT '.$pkey.' FROM '.hikashop_table($this->table).' WHERE '.$main.' = '.$id.$this->group(false)); $firstElement->$pkey = (int)$database->loadResult(); } $firstElement->$orderingMap = $secondElement->$orderingMap; if($down)$secondElement->$orderingMap--; else $secondElement->$orderingMap++; $status1 = $database->updateObject(hikashop_table($this->table),$firstElement,$pkey); $status2 = $database->updateObject(hikashop_table($this->table),$secondElement,$pkey); $status = $status1 && $status2; if($status){ if (!HIKASHOP_PHP5) { $app =& JFactory::getApplication(); }else{ $app = JFactory::getApplication(); } $app->enqueueMessage(JText::_( 'NEW_ORDERING_SAVED' ), 'message'); } return $status; } function save($useCID = true) { $app = JFactory::getApplication(); $pkey = $this->pkey; if(!empty($this->main_pkey)){ $main = $this->main_pkey; }else{ $main = $pkey; } $orderingMap = $this->orderingMap; $order = JRequest::getVar('order', array(), 'post', 'array'); if($useCID) { $cid = JRequest::getVar('cid', array(), 'post', 'array'); JArrayHelper::toInteger($cid); } else { $cid = array_keys($order); } if(empty($cid)) { $app->enqueueMessage(JText::_('ERROR_ORDERING'), 'error'); return false; } $database = JFactory::getDBO(); if(!empty($this->groupMap)){ $query = 'SELECT `'.$main.'` FROM '.hikashop_table($this->table).' WHERE `'.$main.'` IN ('.implode(',',$cid).') '. $this->group(); $database->setQuery($query); if(!HIKASHOP_J25){ $results = $database->loadResultArray(); } else { $results = $database->loadColumn(); } $newcid = array(); $neworder=array(); foreach($cid as $key => $val){ if(in_array($val,$results)){ $newcid[] = $val; if($useCID) { $neworder[] = $order[$key]; } else { $neworder[] = $order[$val]; } } } $cid = $newcid; $order = $neworder; if($main!=$pkey){ $query = 'SELECT `'.$main.'`,`'.$pkey.'` FROM '.hikashop_table($this->table).' WHERE `'.$main.'` IN ('.implode(',',$cid).') '. $this->group(); $database->setQuery($query); $results = $database->loadObjectList($main); $newcid=array(); foreach($cid as $id){ $newcid[] = $results[$id]->$pkey; } $cid = $newcid; } } if(empty($cid)) { $app->enqueueMessage(JText::_( 'ERROR_ORDERING' ), 'error'); return false; } $query = 'SELECT `'.$orderingMap.'`,`'.$pkey.'` FROM '.hikashop_table($this->table).' WHERE `'.$pkey.'` NOT IN ('.implode(',',$cid).') ' . $this->group(); $query .= ' ORDER BY `'.$orderingMap.'` ASC'; $database->setQuery($query); $results = $database->loadObjectList($pkey); $oldResults = $results; asort($order); $newOrder = array(); while(!empty($order) || !empty($results)){ $dbElement = reset($results); if(!empty($order) && empty($dbElement->$orderingMap) || (!empty($order) && reset($order) <= $dbElement->$orderingMap)){ $newOrder[] = $cid[(int)key($order)]; unset($order[key($order)]); }else{ $newOrder[] = $dbElement->$pkey; unset($results[$dbElement->$pkey]); } } $i = 1; $status = true; $element = new stdClass(); foreach($newOrder as $val){ $element->$pkey = $val; $element->$orderingMap = $i; if(!isset($oldResults[$val]) || $oldResults[$val]->$orderingMap != $i){ $status = $database->updateObject(hikashop_table($this->table),$element,$pkey) && $status; } $i++; } if($status){ $app->enqueueMessage(JText::_( 'NEW_ORDERING_SAVED' ), 'message'); }else{ $app->enqueueMessage(JText::_( 'ERROR_ORDERING' ), 'error'); } return $status; } function reOrder() { $db = JFactory::getDBO(); $orderingMap = $this->orderingMap; $query = 'SELECT MAX(`'.$orderingMap.'`) FROM '.hikashop_table($this->table) . $this->group(true); $db->setQuery($query); $max = $db->loadResult(); $max++; $query = 'UPDATE '.hikashop_table($this->table).' SET `'.$orderingMap.'` ='.$max.' WHERE `'.$orderingMap.'`=0' . $this->group(); $db->setQuery($query); $db->query(); $query = 'SELECT `'.$orderingMap.'`,`'.$this->pkey.'` FROM '.hikashop_table($this->table) . $this->group(true); $query .= ' ORDER BY `'.$orderingMap.'` ASC'; $db->setQuery($query); $results = $db->loadObjectList(); $i = 1; if(!empty($results)){ foreach($results as $oneResult){ if($oneResult->$orderingMap != $i){ $oneResult->$orderingMap = $i; $db->updateObject( hikashop_table($this->table), $oneResult, $this->pkey); } $i++; } } } function group($addWhere = false,$table = '') { if(!empty($this->groupMap)){ $db = JFactory::getDBO(); if(is_array($this->groupMap)){ $groups = array(); foreach($this->groupMap as $k => $group){ if(!empty($table)){ $group = $table.'.'.$group; } $groups[]= $group.' = '.$db->Quote($this->groupVal[$k]); } $groups = ' ' . implode(' AND ',$groups); }else{ $groups = ' ' .(!empty($table)?$table.'.':''). $this->groupMap.' = '.$db->Quote($this->groupVal); } if($addWhere){ $groups = ' WHERE'.$groups; }else{ $groups = ' AND'.$groups; } }else{ $groups=''; } return $groups; } }
githubupttik/upttik
administrator/components/com_hikashop/helpers/order.php
PHP
gpl-2.0
6,728
/** * @file region.cc * @author Thomas M. Howard (tmhoward@csail.mit.edu) * Matthew R. Walter (mwalter@csail.mit.edu) * @version 1.0 * * @section LICENSE * * This file is part of h2sl. * * Copyright (C) 2014 by the Massachusetts Institute of Technology * * This program is free software; you can redistribute it and/or modify * it under the terms of the GNU General Public License as published by * the Free Software Foundation; either version 2 of the License, or (at * your option) any later version. * * This program is distributed in the hope that it will be useful, but * WITHOUT ANY WARRANTY; without even the implied warranty of * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU * General Public License for more details. * * You should have received a copy of the GNU General Public License * along with this program; if not, see * <http://www.gnu.org/licenses/gpl-2.0.html> or write to the Free * Software Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA * 02110-1301, USA. * * @section DESCRIPTION * * The implementation of a class used to describe a region of space */ #include "h2sl/region.h" using namespace std; using namespace h2sl; Region:: Region( const string& regionType, const Object& object ) : Grounding(), _object( object ) { insert_prop< std::string >( _properties, "region_type", regionType ); } Region:: Region( xmlNodePtr root ) : Grounding(), _object() { insert_prop< std::string >( _properties, "region_type", "na" ); from_xml( root ); } Region:: ~Region() { } Region:: Region( const Region& other ) : Grounding( other ), _object( other._object ){ } Region& Region:: operator=( const Region& other ) { _properties = other._properties; _object = other._object; return (*this); } bool Region:: operator==( const Region& other )const{ if( region_type() != other.region_type() ){ return false; } if( _object != other._object ){ return false; } else { return true; } } bool Region:: operator!=( const Region& other )const{ return !( *this == other ); } Grounding* Region:: dup( void )const{ return new Region( *this ); } void Region:: to_xml( const string& filename )const{ xmlDocPtr doc = xmlNewDoc( ( xmlChar* )( "1.0" ) ); xmlNodePtr root = xmlNewDocNode( doc, NULL, ( xmlChar* )( "root" ), NULL ); xmlDocSetRootElement( doc, root ); to_xml( doc, root ); xmlSaveFormatFileEnc( filename.c_str(), doc, "UTF-8", 1 ); xmlFreeDoc( doc ); return; } void Region:: to_xml( xmlDocPtr doc, xmlNodePtr root )const{ xmlNodePtr node = xmlNewDocNode( doc, NULL, ( const xmlChar* )( "region" ), NULL ); xmlNewProp( node, ( const xmlChar* )( "region_type" ), ( const xmlChar* )( get_prop< std::string >( _properties, "region_type" ).c_str() ) ); _object.to_xml( doc, node ); xmlAddChild( root, node ); return; } void Region:: from_xml( const string& filename ){ xmlDoc * doc = NULL; xmlNodePtr root = NULL; doc = xmlReadFile( filename.c_str(), NULL, 0 ); if( doc != NULL ){ root = xmlDocGetRootElement( doc ); if( root->type == XML_ELEMENT_NODE ){ xmlNodePtr l1 = NULL; for( l1 = root->children; l1; l1 = l1->next ){ if( l1->type == XML_ELEMENT_NODE ){ if( xmlStrcmp( l1->name, ( const xmlChar* )( "region" ) ) == 0 ){ from_xml( l1 ); } } } } xmlFreeDoc( doc ); } return; } void Region:: from_xml( xmlNodePtr root ){ region_type() = "na"; _object = Object(); if( root->type == XML_ELEMENT_NODE ){ pair< bool, string > region_type_prop = has_prop< std::string >( root, "region_type" ); if( region_type_prop.first ){ region_type() = region_type_prop.second; } for( xmlNodePtr l1 = root->children; l1; l1 = l1->next ){ if( l1->type == XML_ELEMENT_NODE ){ if( xmlStrcmp( l1->name, ( const xmlChar* )( "object" ) ) == 0 ){ _object.from_xml( l1 ); } } } } return; } namespace h2sl { ostream& operator<<( ostream& out, const Region& other ) { out << "Region("; out << "region_type=\"" << other.region_type() << "\","; out << "object=" << other.object(); out << ")"; return out; } }
tmhoward/h2sl
src/symbol/region.cc
C++
gpl-2.0
4,358
// // view_dialogs.hpp // BoE // // Created by Celtic Minstrel on 17-01-21. // // #ifndef BOE_VIEW_DIALOGS_HPP #define BOE_VIEW_DIALOGS_HPP void put_item_info(class cDialog& me, const class cItem& s_i, const class cScenario& scen); void put_monst_info(class cDialog& me, const class cMonster& store_m, const class cScenario& scen); void put_monst_info(class cDialog& me, const class cCreature& store_m, const class cScenario& scen); #endif
calref/cboe
src/view_dialogs.hpp
C++
gpl-2.0
446
#include "SparseDataLoader.h" void SparseDataLoader::readSparseData(std::string filename){ std::ifstream file (filename); std::string temp; std::getline(file, temp); while (std::getline(file, temp)) { std::istringstream buffer(temp); std::vector<int> tmpLine((std::istream_iterator<int>(buffer)), std::istream_iterator<int>()); std::vector<std::pair<int,float>> tmpVector; for(std::vector<int>::iterator it = tmpLine.begin(); it != tmpLine.end();++it) { int index = *it; if(index > maxIndex) maxIndex = index; ++it; tmpVector.push_back(std::make_pair(index,(float) *it)); } this->rowVector.push_back(tmpVector); } file.close(); } void SparseDataLoader::displayRow(){ for(SparseDataVector::iterator it = rowVector.begin(); it != rowVector.end(); ++it) { for(std::vector<std::pair<int,float>>::iterator rowIt = (*it).begin(); rowIt != (*it).end(); ++rowIt) { std::cout << "Index slowa: " << (*rowIt).first << " liczba wystapien " << (*rowIt).second <<" "; } std::cout << std::endl; } } SparseDataVector SparseDataLoader::getRowVector() { return rowVector; }
adam-andrzejczak/k_plus_triangle
SparseDataLoader.cpp
C++
gpl-2.0
1,281
#!/usr/bin/python import sys import csv import json import pycountry import codecs from collections import defaultdict class Region(object): def __init__(self, name, code=None, level=0, parent=None, verbose=False): self.name = name self.code = code self.level = level self.contains = [] self.parent = parent try: self.country = pycountry.countries.get(numeric='%03d' % (int(code))) except: self.country = None if verbose: print "Created region %s in parent %s" % (name, parent) def add(self, region): self.contains.append(region) def get_countries(self): ''' return list of countries (pycountry objects) in this region ''' if self.country: return [ self.country ] clist = [] for region in self.contains: clist += region.get_countries() return clist def includes_country(self, cc): ''' Return True if this region has country with country code alpha2=cc ''' if self.country is not None and self.country.alpha2==cc: return True for region in self.contains: if region.includes_country(cc): return True return False def __unicode__(self): return ("<[%d] " % self.level) + self.name + " in " + str(self.parent or 'None') + " >" __str__ = __unicode__ #cdat = csv.DictReader(codecs.open('un_world_geographic_regions.csv','rU', encoding='utf8')) cdat = csv.DictReader(open('un_world_geographic_regions.csv','rU')) regions = {} regions_by_level = defaultdict(list) current_region = Region("World", '001', 5) verbose = True stack = [] for cd in cdat: level = int(cd.get('Level', 0) or 0) inlevel = level code = cd['Numerical_code'] name = cd['name'] if not name: # skip blank # print "skipping %s" % cd continue if not name in regions: region = Region(name, code, level, parent=None) regions[name] = region regions_by_level[level].append(region) else: region = regions[name] level = region.level if level==0: # it's a country: always add to current_region current_region.add(region) if region.parent is None: region.parent = current_region elif inlevel < 0: # add to current_region, and don't change current_region print "==> Adding to current_region" print "Stack has %s" % map(str, stack) current_region.add(region) elif level < current_region.level: # subregion: add, then make region the current one current_region.add(region) if region.parent is None: region.parent = current_region stack.append(current_region) # use stack for parents current_region = region else: # go up until at right level if verbose: print "==> Going up tree" print "Stack has %s" % map(str, stack) while current_region.level <= level: current_region = stack.pop() current_region.add(region) if region.parent is None: region.parent = current_region stack.append(current_region) # use stack for parents current_region = region if verbose: print " added: " + str(region) #----------------------------------------------------------------------------- # output csv's of countries in each region, with alpha2 country code print "-"*77 print "France: " print regions['France'] print "Americas: " print regions['Americas'] print "Haiti: " print regions['Haiti'] print print map(str, regions['Americas'].contains) print regions['Asia'] print map(str, regions['Asia'].contains) print regions['Europe'] print map(str, regions['Europe'].contains) print regions['Africa'] print map(str, regions['Africa'].contains) print "latin america:" print regions['Latin America and the Caribbean'] print map(str, regions['Latin America and the Caribbean'].contains) # sys.exit(0) def dump_region(cset, name, verbose=True): fn = "Countries_in_%s.csv" % name fp = codecs.open(fn, 'w', encoding='utf8') fp.write('cc, code, name\n') for country in cset: #fp.write(('%s,%s,' % (country.alpha2, country.numeric)) + country.name + '\n') fp.write(('%s,%s,' % (country.alpha2, country.numeric))) fp.write(country.name + '\n') #fp.write(country.alpha2 + '\n') fp.close() if verbose: print "Wrote %s" % fn for level in range(4,0,-1): print "Regions in Level %d: " % level for r in regions_by_level[level]: print " %s" % r dump_region(r.get_countries(), r.name, verbose=False) #----------------------------------------------------------------------------- # Africa print "-"*77 print "Countries in Africa:" # cset = [ dict(name=x.name, cc=x.alpha2) for x in regions['Africa'].get_countries() ] # print json.dumps(cset, indent=2) dump_region(regions['Africa'].get_countries(), 'Africa') #----------------------------------------------------------------------------- # Least developed countries print "-"*77 rname = "Least developed countries" print "Countries in %s:" % rname #cset = [ dict(name=x.name, cc=x.alpha2) for x in regions[rname].get_countries() ] #print json.dumps(cset, indent=2) dump_region(regions[rname].get_countries(), rname) #----------------------------------------------------------------------------- # developing nations rnames = ['Africa', 'Americas', 'Caribbean', 'Central America', 'South America', 'Asia', 'Oceania'] rset = set() for rname in rnames: rset = rset.union(set(regions[rname].get_countries())) dump_region(regions[rname].get_countries(), rname) # remove northern america, Japan, Australia, New Zealand northam = regions['Northern America'].get_countries() rset = rset.difference(northam) rset = rset.difference(regions['Japan'].get_countries()) rset = rset.difference(regions['Australia'].get_countries()) rset = rset.difference(regions['New Zealand'].get_countries()) dump_region(rset, 'Developing_Nations') #----------------------------------------------------------------------------- # sub-saharan africa = Africa - Northern Africa + Sudan rnames = ['Africa'] rset = set() for rname in rnames: rset = rset.union(set(regions[rname].get_countries())) rset = rset.difference(regions['Northern Africa'].get_countries()) rset = rset.union(set(regions['Sudan'].get_countries())) dump_region(rset, 'Sub-Saharan-Africa')
mitodl/world_geographic_regions
CountriesByRegion.py
Python
gpl-2.0
6,565
# Created by Thomas Jones on 17/12/2015 - thomas@tomtecsolutions.com # pingspec.py, a plugin for minqlx to spec players who have network latency over a certain amount. # This plugin is released to everyone, for any purpose. It comes with no warranty, no guarantee it works, it's released AS IS. # You can modify everything, except for lines 1-4 and the !tomtec_versions code. They're there to indicate I whacked this together originally. Please make it better :D """ This plugin requires Minqlx Core version v0.4.1 or greater. The following cvars are used on this plugin: qlx_pingSpecSecondsBetweenChecks: Specifies the seconds between checking every player's ping. Default: 15 qlx_pingSpecMaxPing: Specifies the maximum ping permitted on the server before the user is put to spec. Default: 125 """ import minqlx class pingspec(minqlx.Plugin): def __init__(self): self.add_hook("frame", self.process_frame, priority=minqlx.PRI_LOWEST) self.add_command("tomtec_versions", self.cmd_showversion) self.set_cvar_once("qlx_pingSpecSecondsBetweenChecks", "15") self.set_cvar_once("qlx_pingSpecMaxPing", "125") self.plugin_version = "1.3" # Don't touch this: self.frame_counter = 0 def process_frame(self): self.frame_counter += 1 if self.frame_counter == (int(self.get_cvar("qlx_pingSpecSecondsBetweenChecks")) * int(minqlx.get_cvar("sv_fps"))): self.frame_counter = 0 self.check_ping() def check_ping(self): for player in self.players(): if player.ping > int(self.get_cvar("qlx_pingSpecMaxPing")): if self.game.state == "warmup": player.tell("^1Your ping is over the maximum ping tolerated here ({}).".format(self.get_cvar("qlx_pingSpecMaxPing"))) player.tell("You will be put to spec when the game starts if it remains above the threshold.") else: if player.team != "spectator": player.put("spectator") self.msg("{} has been put in spec automatically for having a ping over {}.".format(player.clean_name, self.get_cvar("qlx_pingSpecMaxPing"))) player.tell("^1Your ping is over {}, the threshold.^7".format(self.get_cvar("qlx_pingSpecMaxPing"))) player.tell("You have been put in spec.") def cmd_showversion(self, player, msg, channel): channel.reply("^4pingspec.py^7 - version {}, created by Thomas Jones on 17/12/2015.".format(self.plugin_version))
tjone270/QuakeLiveDS_Scripts
minqlx-plugins/archive/beta/pingspec.py
Python
gpl-2.0
2,601
/////////////////////////////////////////////////////////////////////////////////////// // Copyright (C) 2006-2015 Esper Team. All rights reserved. / // http://esper.codehaus.org / // ---------------------------------------------------------------------------------- / // The software in this package is published under the terms of the GPL license / // a copy of which has been included with this distribution in the license.txt file. / /////////////////////////////////////////////////////////////////////////////////////// using System; using System.Collections.Generic; using System.IO; using System.Linq; using com.espertech.esper.common.client; using com.espertech.esper.common.@internal.epl.agg.core; using com.espertech.esper.common.@internal.epl.enummethod.dot; using com.espertech.esper.common.@internal.epl.expression.agg.accessagg; using com.espertech.esper.common.@internal.epl.expression.chain; using com.espertech.esper.common.@internal.epl.expression.core; using com.espertech.esper.common.@internal.epl.expression.table; using com.espertech.esper.common.@internal.epl.expression.visitor; using com.espertech.esper.common.@internal.epl.index.advanced.index.quadtree; using com.espertech.esper.common.@internal.epl.join.analyze; using com.espertech.esper.common.@internal.epl.streamtype; using com.espertech.esper.common.@internal.epl.table.compiletime; using com.espertech.esper.common.@internal.epl.variable.compiletime; using com.espertech.esper.common.@internal.@event.core; using com.espertech.esper.common.@internal.@event.property; using com.espertech.esper.common.@internal.@event.propertyparser; using com.espertech.esper.common.@internal.rettype; using com.espertech.esper.common.@internal.settings; using com.espertech.esper.compat; using com.espertech.esper.compat.collections; namespace com.espertech.esper.common.@internal.epl.expression.dot.core { /// <summary> /// Represents an Dot-operator expression, for use when "(expression).method(...).method(...)" /// </summary> public class ExprDotNodeImpl : ExprNodeBase, ExprDotNode, ExprStreamRefNode, ExprNodeInnerNodeProvider { private IList<Chainable> _chainSpec; private readonly bool _isDuckTyping; private readonly bool _isUdfCache; [NonSerialized] private ExprDotNodeForge _forge; public ExprDotNodeImpl( IList<Chainable> chainSpec, bool isDuckTyping, bool isUDFCache) { _chainSpec = chainSpec.AsReadOnlyList(); // for safety, make it unmodifiable the list _isDuckTyping = isDuckTyping; _isUdfCache = isUDFCache; } public override ExprNode Validate(ExprValidationContext validationContext) { // check for plannable methods: these are validated according to different rules var appDotMethod = GetAppDotMethod(validationContext.IsFilterExpression); if (appDotMethod != null) { return appDotMethod; } // determine if there is an implied binding, replace first chain element with evaluation node if there is if (validationContext.StreamTypeService.HasTableTypes && validationContext.TableCompileTimeResolver != null && _chainSpec.Count > 1 && _chainSpec[0] is ChainableName) { var tableNode = TableCompileTimeUtil.GetTableNodeChainable( validationContext.StreamTypeService, _chainSpec, validationContext.IsAllowTableAggReset, validationContext.TableCompileTimeResolver); if (tableNode != null) { var node = ExprNodeUtilityValidate.GetValidatedSubtree(ExprNodeOrigin.DOTNODE, tableNode.First, validationContext); if (tableNode.Second.IsEmpty()) { return node; } IList<Chainable> modifiedChainX = new List<Chainable>(tableNode.Second); ChainSpec = modifiedChainX; AddChildNode(node); } } // handle aggregation methods: method on aggregation state coming from certain aggregations or from table column (both table-access or table-in-from-clause) // this is done here as a walker does not have the information that the validated child node has var aggregationMethodNode = HandleAggregationMethod(validationContext); if (aggregationMethodNode != null) { if (aggregationMethodNode.Second.IsEmpty()) { return aggregationMethodNode.First; } IList<Chainable> modifiedChainX = new List<Chainable>(aggregationMethodNode.Second); ChainSpec = modifiedChainX; ChildNodes[0] = aggregationMethodNode.First; } // validate all parameters ExprNodeUtilityValidate.Validate(ExprNodeOrigin.DOTNODEPARAMETER, _chainSpec, validationContext); // determine if there are enumeration method expressions in the chain var hasEnumerationMethod = false; foreach (var chain in _chainSpec) { if (!(chain is ChainableCall)) { continue; } var call = (ChainableCall) chain; if (EnumMethodResolver.IsEnumerationMethod(call.Name, validationContext.ImportService)) { hasEnumerationMethod = true; break; } } // The root node expression may provide the input value: // Such as "window(*).DoIt(...)" or "(select * from Window).DoIt()" or "prevwindow(sb).DoIt(...)", // in which case the expression to act on is a child expression // var streamTypeService = validationContext.StreamTypeService; if (ChildNodes.Length != 0) { // the root expression is the first child node var rootNode = ChildNodes[0]; // the root expression may also provide a lambda-function input (Iterator<EventBean>) // Determine collection-type and evaluator if any for root node var enumSrc = ExprDotNodeUtility.GetEnumerationSource( rootNode, validationContext.StreamTypeService, hasEnumerationMethod, validationContext.IsDisablePropertyExpressionEventCollCache, validationContext.StatementRawInfo, validationContext.StatementCompileTimeService); EPType typeInfoX; if (enumSrc.ReturnType == null) { typeInfoX = EPTypeHelper.SingleValue(rootNode.Forge.EvaluationType); // not a collection type, treat as scalar } else { typeInfoX = enumSrc.ReturnType; } var evalsX = ExprDotNodeUtility.GetChainEvaluators( enumSrc.StreamOfProviderIfApplicable, typeInfoX, _chainSpec, validationContext, _isDuckTyping, new ExprDotNodeFilterAnalyzerInputExpr()); _forge = new ExprDotNodeForgeRootChild( this, null, null, null, hasEnumerationMethod, rootNode.Forge, enumSrc.Enumeration, typeInfoX, evalsX.Chain, evalsX.ChainWithUnpack, false); return null; } // No root node, and this is a 1-element chain i.e. "something(param,...)". // Plug-in single-row methods are not handled here. // Plug-in aggregation methods are not handled here. if (_chainSpec.Count == 1) { var chainable = _chainSpec[0]; if (!(chainable is ChainableCall)) { throw new IllegalStateException("Unexpected chainable : " + chainable); } var call = (ChainableCall) chainable; if (call.Parameters.IsEmpty()) { throw HandleNotFound(call.Name); } // single-parameter can resolve to a property Pair<PropertyResolutionDescriptor, string> propertyInfoPairX = null; try { propertyInfoPairX = ExprIdentNodeUtil.GetTypeFromStream( streamTypeService, call.Name, streamTypeService.HasPropertyAgnosticType, false, validationContext.TableCompileTimeResolver); } catch (ExprValidationPropertyException) { // fine } // if not a property then try built-in single-row non-grammar functions if (propertyInfoPairX == null && call.Name.Equals(ImportServiceCompileTimeConstants.EXT_SINGLEROW_FUNCTION_TRANSPOSE, StringComparison.InvariantCultureIgnoreCase)) { if (call.Parameters.Count != 1) { throw new ExprValidationException( "The " + ImportServiceCompileTimeConstants.EXT_SINGLEROW_FUNCTION_TRANSPOSE + " function requires a single parameter expression"); } _forge = new ExprDotNodeForgeTransposeAsStream(this, call.Parameters[0].Forge); } else if (call.Parameters.Count != 1) { throw HandleNotFound(call.Name); } else { if (propertyInfoPairX == null) { throw new ExprValidationException( "Unknown single-row function, aggregation function or mapped or indexed property named '" + call.Name + "' could not be resolved"); } _forge = GetPropertyPairEvaluator(call.Parameters[0].Forge, propertyInfoPairX, validationContext); } return null; } // handle the case where the first chain spec element is a stream name. ExprValidationException prefixedStreamNumException = null; var prefixedStreamNumber = PrefixedStreamName(_chainSpec, validationContext.StreamTypeService); if (prefixedStreamNumber != -1) { var first = (ChainableName) _chainSpec[0]; var specAfterStreamName = _chainSpec[1]; // Attempt to resolve as property Pair<PropertyResolutionDescriptor, string> propertyInfoPairX = null; try { var propName = first.Name + "." + specAfterStreamName.GetRootNameOrEmptyString(); propertyInfoPairX = ExprIdentNodeUtil.GetTypeFromStream( streamTypeService, propName, streamTypeService.HasPropertyAgnosticType, true, validationContext.TableCompileTimeResolver); } catch (ExprValidationPropertyException) { // fine } if (propertyInfoPairX != null) { IList<Chainable> chain = new List<Chainable>(_chainSpec); // handle "property[x]" and "property(x)" if (chain.Count == 2 && specAfterStreamName.GetParametersOrEmpty().Count == 1) { _forge = GetPropertyPairEvaluator(specAfterStreamName.GetParametersOrEmpty()[0].Forge, propertyInfoPairX, validationContext); return null; } chain.RemoveAt(0); chain.RemoveAt(0); var desc = HandlePropertyInfoPair( true, specAfterStreamName, chain, propertyInfoPairX, hasEnumerationMethod, validationContext, this); desc.Apply(this); return null; } // Attempt to resolve as event-underlying object instance method var eventType = validationContext.StreamTypeService.EventTypes[prefixedStreamNumber]; var type = eventType.UnderlyingType; IList<Chainable> remainderChain = new List<Chainable>(_chainSpec); remainderChain.RemoveAt(0); ExprValidationException methodEx = null; ExprDotForge[] underlyingMethodChain = null; try { var typeInfoX = EPTypeHelper.SingleValue(type); if (validationContext.TableCompileTimeResolver.ResolveTableFromEventType(eventType) != null) { typeInfoX = new ClassEPType(typeof(object[])); } underlyingMethodChain = ExprDotNodeUtility.GetChainEvaluators( prefixedStreamNumber, typeInfoX, remainderChain, validationContext, false, new ExprDotNodeFilterAnalyzerInputStream(prefixedStreamNumber)) .ChainWithUnpack; } catch (ExprValidationException ex) { methodEx = ex; // expected - may not be able to find the methods on the underlying } ExprDotForge[] eventTypeMethodChain = null; ExprValidationException enumDatetimeEx = null; FilterExprAnalyzerAffector filterExprAnalyzerAffector = null; try { var typeInfoX = EPTypeHelper.SingleEvent(eventType); var chain = ExprDotNodeUtility.GetChainEvaluators( prefixedStreamNumber, typeInfoX, remainderChain, validationContext, false, new ExprDotNodeFilterAnalyzerInputStream(prefixedStreamNumber)); eventTypeMethodChain = chain.ChainWithUnpack; filterExprAnalyzerAffector = chain.FilterAnalyzerDesc; } catch (ExprValidationException ex) { enumDatetimeEx = ex; // expected - may not be able to find the methods on the underlying } if (underlyingMethodChain != null) { _forge = new ExprDotNodeForgeStream( this, filterExprAnalyzerAffector, prefixedStreamNumber, eventType, underlyingMethodChain, true); } else if (eventTypeMethodChain != null) { _forge = new ExprDotNodeForgeStream( this, filterExprAnalyzerAffector, prefixedStreamNumber, eventType, eventTypeMethodChain, false); } if (_forge != null) { return null; } else { var remainerName = remainderChain[0].GetRootNameOrEmptyString(); if (ExprDotNodeUtility.IsDatetimeOrEnumMethod(remainerName, validationContext.ImportService)) { prefixedStreamNumException = enumDatetimeEx; } else { prefixedStreamNumException = new ExprValidationException( "Failed to solve '" + remainerName + "' to either an date-time or enumeration method, an event property or a method on the event underlying object: " + methodEx.Message, methodEx); } } } // There no root node, in this case the classname or property name is provided as part of the chain. // Such as "MyClass.myStaticLib(...)" or "mycollectionproperty.DoIt(...)" // IList<Chainable> modifiedChain = new List<Chainable>(_chainSpec); var firstItem = modifiedChain.DeleteAt(0); var firstItemName = firstItem.GetRootNameOrEmptyString(); Pair<PropertyResolutionDescriptor, string> propertyInfoPair = null; try { propertyInfoPair = ExprIdentNodeUtil.GetTypeFromStream( streamTypeService, firstItemName, streamTypeService.HasPropertyAgnosticType, true, validationContext.TableCompileTimeResolver); } catch (ExprValidationPropertyException) { // not a property } // If property then treat it as such if (propertyInfoPair != null) { var desc = HandlePropertyInfoPair( false, firstItem, modifiedChain, propertyInfoPair, hasEnumerationMethod, validationContext, this); desc.Apply(this); return null; } // If variable then resolve as such var variable = validationContext.VariableCompileTimeResolver.Resolve(firstItemName); if (variable != null) { if (variable.OptionalContextName != null) { throw new ExprValidationException("Method invocation on context-specific variable is not supported"); } EPType typeInfoX; ExprDotStaticMethodWrap wrap; if (variable.Type.IsArray) { typeInfoX = EPTypeHelper.CollectionOfSingleValue( variable.Type.GetElementType(), variable.Type); wrap = new ExprDotStaticMethodWrapArrayScalar(variable.VariableName, variable.Type); } else if (variable.EventType != null) { typeInfoX = EPTypeHelper.SingleEvent(variable.EventType); wrap = null; } else { typeInfoX = EPTypeHelper.SingleValue(variable.Type); wrap = null; } var evalsX = ExprDotNodeUtility.GetChainEvaluators( null, typeInfoX, modifiedChain, validationContext, false, new ExprDotNodeFilterAnalyzerInputStatic()); _forge = new ExprDotNodeForgeVariable(this, variable, wrap, evalsX.ChainWithUnpack); return null; } // try resolve as enumeration class with value var enumconstantDesc = ImportCompileTimeUtil.ResolveIdentAsEnumConst( firstItemName, validationContext.ImportService, validationContext.ClassProvidedExtension, false); if (enumconstantDesc != null && modifiedChain[0] is ChainableCall) { // try resolve method var methodSpec = (ChainableCall) modifiedChain[0]; var enumvalue = firstItemName; ExprNodeUtilResolveExceptionHandler handler = new ProxyExprNodeUtilResolveExceptionHandler() { ProcHandle = (ex) => { return new ExprValidationException( "Failed to resolve method '" + methodSpec.Name + "' on enumeration value '" + enumvalue + "': " + ex.Message); }, }; var wildcardType = validationContext.StreamTypeService.EventTypes.Length != 1 ? null : validationContext.StreamTypeService.EventTypes[0]; var methodDesc = ExprNodeUtilityResolve.ResolveMethodAllowWildcardAndStream( enumconstantDesc.Value.GetType().Name, enumconstantDesc.Value.GetType(), methodSpec.Name, methodSpec.Parameters, wildcardType != null, wildcardType, handler, methodSpec.Name, validationContext.StatementRawInfo, validationContext.StatementCompileTimeService); // method resolved, hook up modifiedChain.RemoveAt(0); // we identified this piece var optionalLambdaWrapX = ExprDotStaticMethodWrapFactory.Make( methodDesc.ReflectionMethod, modifiedChain, null, validationContext); var typeInfoX = optionalLambdaWrapX != null ? optionalLambdaWrapX.TypeInfo : EPTypeHelper.SingleValue(methodDesc.ReflectionMethod.ReturnType); var evalsX = ExprDotNodeUtility.GetChainEvaluators( null, typeInfoX, modifiedChain, validationContext, false, new ExprDotNodeFilterAnalyzerInputStatic()); _forge = new ExprDotNodeForgeStaticMethod( this, false, firstItemName, methodDesc.ReflectionMethod, methodDesc.ChildForges, false, evalsX.ChainWithUnpack, optionalLambdaWrapX, false, enumconstantDesc, validationContext.StatementName, methodDesc.IsLocalInlinedClass); return null; } // if prefixed by a stream name, we are giving up if (prefixedStreamNumException != null) { throw prefixedStreamNumException; } // If class then resolve as class var secondItem = modifiedChain.DeleteAt(0); var allowWildcard = validationContext.StreamTypeService.EventTypes.Length == 1; EventType streamZeroType = null; if (validationContext.StreamTypeService.EventTypes.Length > 0) { streamZeroType = validationContext.StreamTypeService.EventTypes[0]; } var secondItemName = secondItem.GetRootNameOrEmptyString(); var separator = string.IsNullOrWhiteSpace(secondItemName) ? "" : "."; var msgHandler = new ExprNodeUtilResolveExceptionHandlerDefault(firstItemName + separator + secondItemName, false); var method = ExprNodeUtilityResolve.ResolveMethodAllowWildcardAndStream( firstItemName, null, secondItem.GetRootNameOrEmptyString(), secondItem.GetParametersOrEmpty(), allowWildcard, streamZeroType, msgHandler, secondItem.GetRootNameOrEmptyString(), validationContext.StatementRawInfo, validationContext.StatementCompileTimeService); var isConstantParameters = method.IsAllConstants && _isUdfCache; var isReturnsConstantResult = isConstantParameters && modifiedChain.IsEmpty(); // this may return a pair of null if there is no lambda or the result cannot be wrapped for lambda-function use var optionalLambdaWrap = ExprDotStaticMethodWrapFactory.Make(method.ReflectionMethod, modifiedChain, null, validationContext); var typeInfo = optionalLambdaWrap != null ? optionalLambdaWrap.TypeInfo : EPTypeHelper.SingleValue(method.ReflectionMethod.ReturnType); var evals = ExprDotNodeUtility.GetChainEvaluators( null, typeInfo, modifiedChain, validationContext, false, new ExprDotNodeFilterAnalyzerInputStatic()); _forge = new ExprDotNodeForgeStaticMethod( this, isReturnsConstantResult, firstItemName, method.ReflectionMethod, method.ChildForges, isConstantParameters, evals.ChainWithUnpack, optionalLambdaWrap, false, null, validationContext.StatementName, method.IsLocalInlinedClass); return null; } private static PropertyInfoPairDesc HandlePropertyInfoPair( bool nestedComplexProperty, Chainable firstItem, IList<Chainable> chain, Pair<PropertyResolutionDescriptor, string> propertyInfoPair, bool hasEnumerationMethod, ExprValidationContext validationContext, ExprDotNodeImpl myself) { var streamTypeService = validationContext.StreamTypeService; var propertyName = propertyInfoPair.First.PropertyName; var streamId = propertyInfoPair.First.StreamNum; var streamType = (EventTypeSPI) streamTypeService.EventTypes[streamId]; ExprEnumerationForge enumerationForge = null; EPType inputType; ExprForge rootNodeForge = null; EventPropertyGetterSPI getter; var rootIsEventBean = false; if (firstItem is ChainableName) { getter = streamType.GetGetterSPI(propertyName); // Handle first-chainable not an array if (!(chain[0] is ChainableArray)) { var allowEnum = nestedComplexProperty || hasEnumerationMethod; var propertyEval = ExprDotNodeUtility.GetPropertyEnumerationSource( propertyName, streamId, streamType, allowEnum, validationContext.IsDisablePropertyExpressionEventCollCache); enumerationForge = propertyEval.Enumeration; inputType = propertyEval.ReturnType; rootNodeForge = new PropertyDotNonLambdaForge(streamId, getter, propertyInfoPair.First.PropertyType.GetBoxedType()); } else { // first-chainable is an array, use array-of-fragments or array-of-type var array = (ChainableArray) chain[0]; var indexExpression = ChainableArray.ValidateSingleIndexExpr(array.Indexes, () => "property '" + propertyName + "'"); var propertyType = streamType.GetPropertyType(propertyName); var fragmentEventType = streamType.GetFragmentType(propertyName); if (fragmentEventType != null && fragmentEventType.IsIndexed) { // handle array-of-fragment by including the array operation in the root inputType = EPTypeHelper.SingleEvent(fragmentEventType.FragmentType); chain = chain.SubList(1, chain.Count); // we remove the array operation from the chain as its handled by the forge rootNodeForge = new PropertyDotNonLambdaFragmentIndexedForge(streamId, getter, indexExpression, propertyName); rootIsEventBean = true; } else if (propertyType.IsArray) { // handle array-of-type by simple property and array operation as part of chain inputType = EPTypeHelper.SingleValue(propertyType); rootNodeForge = new PropertyDotNonLambdaForge(streamId, getter, propertyInfoPair.First.PropertyType.GetBoxedType()); } else { throw new ExprValidationException("Invalid array operation for property '" + propertyName + "'"); } } } else { // property with parameter - mapped or indexed property getter = null; var call = (ChainableCall) firstItem; var desc = EventTypeUtility.GetNestablePropertyDescriptor( streamTypeService.EventTypes[propertyInfoPair.First.StreamNum], call.Name); if (call.Parameters.Count > 1) { throw new ExprValidationException("Property '" + call.Name + "' may not be accessed passing 2 or more parameters"); } var paramEval = call.Parameters[0].Forge; inputType = EPTypeHelper.SingleValue(desc.PropertyComponentType); if (desc.IsMapped) { if (paramEval.EvaluationType != typeof(string)) { throw new ExprValidationException( "Parameter expression to mapped property '" + propertyName + "' is expected to return a string-type value but returns " + paramEval.EvaluationType.CleanName()); } var mappedGetter = ((EventTypeSPI) propertyInfoPair.First.StreamEventType).GetGetterMappedSPI(propertyName); if (mappedGetter == null) { throw new ExprValidationException("Mapped property named '" + propertyName + "' failed to obtain getter-object"); } rootNodeForge = new PropertyDotNonLambdaMappedForge(streamId, mappedGetter, paramEval, desc.PropertyComponentType); } if (desc.IsIndexed) { if (paramEval.EvaluationType.GetBoxedType() != typeof(int?)) { throw new ExprValidationException( "Parameter expression to mapped property '" + propertyName + "' is expected to return a Integer-type value but returns " + paramEval.EvaluationType.CleanName()); } var indexedGetter = ((EventTypeSPI) propertyInfoPair.First.StreamEventType).GetGetterIndexedSPI(propertyName); if (indexedGetter == null) { throw new ExprValidationException("Mapped property named '" + propertyName + "' failed to obtain getter-object"); } rootNodeForge = new PropertyDotNonLambdaIndexedForge(streamId, indexedGetter, paramEval, desc.PropertyComponentType); } } // try to build chain based on the input (non-fragment) ExprDotNodeRealizedChain evals; var filterAnalyzerInputProp = new ExprDotNodeFilterAnalyzerInputProp(propertyInfoPair.First.StreamNum, propertyName); try { evals = ExprDotNodeUtility.GetChainEvaluators(streamId, inputType, chain, validationContext, myself._isDuckTyping, filterAnalyzerInputProp); } catch (ExprValidationException) { if (inputType is EventEPType || inputType is EventMultiValuedEPType) { throw; } // try building the chain based on the fragment event type (i.e. A.after(B) based on A-configured start time where A is a fragment) var fragment = propertyInfoPair.First.FragmentEventType; if (fragment == null) { throw; } rootIsEventBean = true; EPType fragmentTypeInfo; if (!fragment.IsIndexed) { if (chain[0] is ChainableArray) { throw new ExprValidationException("Cannot perform array operation as property '" + propertyName + "' does not return an array"); } fragmentTypeInfo = EPTypeHelper.SingleEvent(fragment.FragmentType); } else { fragmentTypeInfo = EPTypeHelper.ArrayOfEvents(fragment.FragmentType); } inputType = fragmentTypeInfo; rootNodeForge = new PropertyDotNonLambdaFragmentForge(streamId, getter, fragment.IsIndexed); evals = ExprDotNodeUtility.GetChainEvaluators( propertyInfoPair.First.StreamNum, fragmentTypeInfo, chain, validationContext, myself._isDuckTyping, filterAnalyzerInputProp); } var filterExprAnalyzerAffector = evals.FilterAnalyzerDesc; var streamNumReferenced = propertyInfoPair.First.StreamNum; var forge = new ExprDotNodeForgeRootChild( myself, filterExprAnalyzerAffector, streamNumReferenced, propertyName, hasEnumerationMethod, rootNodeForge, enumerationForge, inputType, evals.Chain, evals.ChainWithUnpack, !rootIsEventBean); return new PropertyInfoPairDesc(forge); } private Pair<ExprDotNodeAggregationMethodRootNode, IList<Chainable>> HandleAggregationMethod(ExprValidationContext validationContext) { if (_chainSpec.IsEmpty() || ChildNodes.Length == 0) { return null; } var chainFirst = _chainSpec[0]; if (chainFirst is ChainableArray) { return null; } var rootNode = ChildNodes[0]; var aggMethodParams = chainFirst.GetParametersOrEmpty().ToArray(); var aggMethodName = chainFirst.GetRootNameOrEmptyString(); // handle property, such as "sortedcolumn.floorKey('a')" since "floorKey" can also be a property if (chainFirst is ChainableName) { var prop = PropertyParserNoDep.ParseAndWalkLaxToSimple(chainFirst.GetRootNameOrEmptyString(), false); if (prop is MappedProperty) { var mappedProperty = (MappedProperty) prop; aggMethodName = mappedProperty.PropertyNameAtomic; aggMethodParams = new ExprNode[] {new ExprConstantNodeImpl(mappedProperty.Key)}; } } if (!(rootNode is ExprTableAccessNodeSubprop) && !(rootNode is ExprAggMultiFunctionNode) && !(rootNode is ExprTableIdentNode)) { return null; } ExprDotNodeAggregationMethodForge aggregationMethodForge; if (rootNode is ExprAggMultiFunctionNode) { // handle local aggregation var mf = (ExprAggMultiFunctionNode) rootNode; if (!mf.AggregationForgeFactory.AggregationPortableValidation.IsAggregationMethod(aggMethodName, aggMethodParams, validationContext)) { return null; } aggregationMethodForge = new ExprDotNodeAggregationMethodForgeLocal( this, aggMethodName, aggMethodParams, mf.AggregationForgeFactory.AggregationPortableValidation, mf); } else if (rootNode is ExprTableIdentNode) { // handle table-column via from-clause var tableSubprop = (ExprTableIdentNode) rootNode; var column = tableSubprop.TableMetadata.Columns.Get(tableSubprop.ColumnName); if (!(column is TableMetadataColumnAggregation)) { return null; } var columnAggregation = (TableMetadataColumnAggregation) column; if (aggMethodName.ToLowerInvariant().Equals("reset")) { if (!validationContext.IsAllowTableAggReset) { throw new ExprValidationException(AggregationPortableValidationBase.INVALID_TABLE_AGG_RESET); } aggregationMethodForge = new ExprDotNodeAggregationMethodForgeTableReset( this, aggMethodName, aggMethodParams, columnAggregation.AggregationPortableValidation, tableSubprop, columnAggregation); } else { if (columnAggregation.IsMethodAgg || !columnAggregation.AggregationPortableValidation.IsAggregationMethod(aggMethodName, aggMethodParams, validationContext)) { return null; } aggregationMethodForge = new ExprDotNodeAggregationMethodForgeTableIdent( this, aggMethodName, aggMethodParams, columnAggregation.AggregationPortableValidation, tableSubprop, columnAggregation); } } else if (rootNode is ExprTableAccessNodeSubprop) { // handle table-column via table-access var tableSubprop = (ExprTableAccessNodeSubprop) rootNode; var column = tableSubprop.TableMeta.Columns.Get(tableSubprop.SubpropName); if (!(column is TableMetadataColumnAggregation)) { return null; } var columnAggregation = (TableMetadataColumnAggregation) column; if (columnAggregation.IsMethodAgg || !columnAggregation.AggregationPortableValidation.IsAggregationMethod(aggMethodName, aggMethodParams, validationContext)) { return null; } aggregationMethodForge = new ExprDotNodeAggregationMethodForgeTableAccess( this, aggMethodName, aggMethodParams, columnAggregation.AggregationPortableValidation, tableSubprop, columnAggregation); } else { throw new IllegalStateException("Unhandled aggregation method root node"); } // validate aggregationMethodForge.Validate(validationContext); var newChain = _chainSpec.Count == 1 ? (IList<Chainable>) EmptyList<Chainable>.Instance : new List<Chainable>(_chainSpec.SubList(1, _chainSpec.Count)); var root = new ExprDotNodeAggregationMethodRootNode(aggregationMethodForge); root.AddChildNode(rootNode); return new Pair<ExprDotNodeAggregationMethodRootNode, IList<Chainable>>(root, newChain); } public FilterExprAnalyzerAffector GetAffector(bool isOuterJoin) { CheckValidated(_forge); return isOuterJoin ? null : _forge.FilterExprAnalyzerAffector; } private ExprDotNodeForge GetPropertyPairEvaluator( ExprForge parameterForge, Pair<PropertyResolutionDescriptor, string> propertyInfoPair, ExprValidationContext validationContext) { var propertyName = propertyInfoPair.First.PropertyName; var propertyDesc = EventTypeUtility.GetNestablePropertyDescriptor(propertyInfoPair.First.StreamEventType, propertyName); if (propertyDesc == null || (!propertyDesc.IsMapped && !propertyDesc.IsIndexed)) { throw new ExprValidationException( "Unknown single-row function, aggregation function or mapped or indexed property named '" + propertyName + "' could not be resolved"); } var streamNum = propertyInfoPair.First.StreamNum; EventPropertyGetterMappedSPI mappedGetter = null; EventPropertyGetterIndexedSPI indexedGetter = null; var propertyType = typeof(object); if (propertyDesc.IsMapped) { if (parameterForge.EvaluationType != typeof(string)) { throw new ExprValidationException( "Parameter expression to mapped property '" + propertyDesc.PropertyName + "' is expected to return a string-type value but returns " + parameterForge.EvaluationType.CleanName()); } mappedGetter = ((EventTypeSPI) propertyInfoPair.First.StreamEventType).GetGetterMappedSPI(propertyInfoPair.First.PropertyName); if (mappedGetter == null) { throw new ExprValidationException("Mapped property named '" + propertyName + "' failed to obtain getter-object"); } } else { if (parameterForge.EvaluationType.GetBoxedType() != typeof(int?)) { throw new ExprValidationException( "Parameter expression to indexed property '" + propertyDesc.PropertyName + "' is expected to return a Integer-type value but returns " + parameterForge.EvaluationType.CleanName()); } indexedGetter = ((EventTypeSPI) propertyInfoPair.First.StreamEventType).GetGetterIndexedSPI(propertyInfoPair.First.PropertyName); if (indexedGetter == null) { throw new ExprValidationException("Indexed property named '" + propertyName + "' failed to obtain getter-object"); } } if (propertyDesc.PropertyComponentType != null) { propertyType = propertyDesc.PropertyComponentType.GetBoxedType(); } return new ExprDotNodeForgePropertyExpr( this, validationContext.StatementName, propertyDesc.PropertyName, streamNum, parameterForge, propertyType, indexedGetter, mappedGetter); } private int PrefixedStreamName( IList<Chainable> chainSpec, StreamTypeService streamTypeService) { if (chainSpec.Count < 1) { return -1; } var spec = chainSpec[0]; if (!(spec is ChainableName)) { return -1; } var name = (ChainableName) spec; return streamTypeService.GetStreamNumForStreamName(name.Name); } public override void Accept(ExprNodeVisitor visitor) { base.Accept(visitor); ExprNodeUtilityQuery.AcceptChain(visitor, _chainSpec); } public override void Accept(ExprNodeVisitorWithParent visitor) { base.Accept(visitor); ExprNodeUtilityQuery.AcceptChain(visitor, _chainSpec); } public override void AcceptChildnodes( ExprNodeVisitorWithParent visitor, ExprNode parent) { base.AcceptChildnodes(visitor, parent); ExprNodeUtilityQuery.AcceptChain(visitor, _chainSpec, this); } public override void ReplaceUnlistedChildNode( ExprNode nodeToReplace, ExprNode newNode) { ExprNodeUtilityModify.ReplaceChainChildNode(nodeToReplace, newNode, _chainSpec); } public IList<Chainable> ChainSpec { get => _chainSpec; set => _chainSpec = value.AsReadOnlyList(); } public ExprEvaluator ExprEvaluator { get { CheckValidated(_forge); return _forge.ExprEvaluator; } } public bool IsConstantResult { get { CheckValidated(_forge); return _forge.IsReturnsConstantResult; } } public override ExprForge Forge { get { CheckValidated(_forge); return _forge; } } public int? StreamReferencedIfAny { get { CheckValidated(_forge); return _forge.StreamNumReferenced; } } public string RootPropertyNameIfAny { get { CheckValidated(_forge); return _forge.RootPropertyName; } } public override void ToPrecedenceFreeEPL( TextWriter writer, ExprNodeRenderableFlags flags) { if (ChildNodes.Length != 0) { writer.Write(ExprNodeUtilityPrint.ToExpressionStringMinPrecedenceSafe(ChildNodes[0])); } ExprNodeUtilityPrint.ToExpressionString(_chainSpec, writer, ChildNodes.Length != 0, null); } public override ExprPrecedenceEnum Precedence => ExprPrecedenceEnum.UNARY; public IDictionary<string, object> EventType => null; public override bool EqualsNode( ExprNode node, bool ignoreStreamPrefix) { if (!(node is ExprDotNodeImpl)) { return false; } var other = (ExprDotNodeImpl) node; if (other._chainSpec.Count != _chainSpec.Count) { return false; } for (var i = 0; i < _chainSpec.Count; i++) { if (!_chainSpec[i].Equals(other._chainSpec[i])) { return false; } } return true; } public IList<ExprNode> AdditionalNodes => ExprNodeUtilityQuery.CollectChainParameters(_chainSpec); public VariableMetaData IsVariableOpGetName(VariableCompileTimeResolver variableCompileTimeResolver) { if (_chainSpec.Count > 0 && _chainSpec[0] is ChainableName) { return variableCompileTimeResolver.Resolve(((ChainableName) _chainSpec[0]).Name); } return null; } private ExprValidationException HandleNotFound(string name) { var appDotMethodDidYouMean = GetAppDotMethodDidYouMean(); var message = "Unknown single-row function, expression declaration, script or aggregation function named '" + name + "' could not be resolved"; if (appDotMethodDidYouMean != null) { message += " (did you mean '" + appDotMethodDidYouMean + "')"; } return new ExprValidationException(message); } private string GetAppDotMethodDidYouMean() { var lhsName = _chainSpec[0].GetRootNameOrEmptyString().ToLowerInvariant(); if (lhsName.Equals("rectangle")) { return "rectangle.intersects"; } if (lhsName.Equals("point")) { return "point.inside"; } return null; } private ExprAppDotMethodImpl GetAppDotMethod(bool filterExpression) { if (_chainSpec.Count < 2) { return null; } if (!(_chainSpec[1] is ChainableCall)) { return null; } var call = (ChainableCall) _chainSpec[1]; var lhsName = _chainSpec[0].GetRootNameOrEmptyString(); var operationName = call.Name.ToLowerInvariant(); var pointInside = lhsName.Equals("point") && operationName.Equals("inside"); var rectangleIntersects = lhsName.Equals("rectangle") && operationName.Equals("intersects"); if (!pointInside && !rectangleIntersects) { return null; } if (call.Parameters.Count != 1) { throw GetAppDocMethodException(lhsName, operationName); } var param = call.Parameters[0]; if (!(param is ExprDotNode)) { throw GetAppDocMethodException(lhsName, operationName); } var compared = (ExprDotNode) call.Parameters[0]; if (compared.ChainSpec.Count != 1) { throw GetAppDocMethodException(lhsName, operationName); } var rhsName = compared.ChainSpec[0].GetRootNameOrEmptyString().ToLowerInvariant(); var pointInsideRectangle = pointInside && rhsName.Equals("rectangle"); var rectangleIntersectsRectangle = rectangleIntersects && rhsName.Equals("rectangle"); if (!pointInsideRectangle && !rectangleIntersectsRectangle) { throw GetAppDocMethodException(lhsName, operationName); } var lhsExpressions = _chainSpec[0].GetParametersOrEmpty(); ExprNode[] indexNamedParameter = null; IList<ExprNode> lhsExpressionsValues = new List<ExprNode>(); foreach (var lhsExpression in lhsExpressions) { if (lhsExpression is ExprNamedParameterNode) { var named = (ExprNamedParameterNode) lhsExpression; if (named.ParameterName.Equals(ExprDotNodeConstants.FILTERINDEX_NAMED_PARAMETER, StringComparison.InvariantCultureIgnoreCase)) { if (!filterExpression) { throw new ExprValidationException("The '" + named.ParameterName + "' named parameter can only be used in in filter expressions"); } indexNamedParameter = named.ChildNodes; } else { throw new ExprValidationException(lhsName + " does not accept '" + named.ParameterName + "' as a named parameter"); } } else { lhsExpressionsValues.Add(lhsExpression); } } var lhs = ExprNodeUtilityQuery.ToArray(lhsExpressionsValues); var rhs = ExprNodeUtilityQuery.ToArray(compared.ChainSpec[0].GetParametersOrEmpty()); SettingsApplicationDotMethod predefined; if (pointInsideRectangle) { predefined = new SettingsApplicationDotMethodPointInsideRectangle(this, lhsName, lhs, operationName, rhsName, rhs, indexNamedParameter); } else { predefined = new SettingsApplicationDotMethodRectangeIntersectsRectangle(this, lhsName, lhs, operationName, rhsName, rhs, indexNamedParameter); } return new ExprAppDotMethodImpl(predefined); } public bool IsLocalInlinedClass => _forge.IsLocalInlinedClass; private ExprValidationException GetAppDocMethodException( string lhsName, string operationName) { return new ExprValidationException(lhsName + "." + operationName + " requires a single rectangle as parameter"); } private class PropertyInfoPairDesc { public PropertyInfoPairDesc(ExprDotNodeForgeRootChild forge) { Forge = forge; } public ExprDotNodeForgeRootChild Forge { get; } public void Apply(ExprDotNodeImpl node) { node._forge = Forge; } } } } // end of namespace
espertechinc/nesper
src/NEsper.Common/common/internal/epl/expression/dot/core/ExprDotNodeImpl.cs
C#
gpl-2.0
41,544
package de.bitbrain.craft.graphics.shader; import com.badlogic.gdx.graphics.g2d.Batch; /** * Handles multiple shaders for a single target * * @author Miguel Gonzalez <miguel-gonzalez@gmx.de> * @since 0.1 * @version 0.1 */ public interface ShadeArea { // =========================================================== // Constants // =========================================================== // =========================================================== // Methods // =========================================================== /** * * * @param batch * @param delta * @param currentShader */ void draw(Batch batch, float delta); }
bitbrain-gaming/craft
core/src/de/bitbrain/craft/graphics/shader/ShadeArea.java
Java
gpl-2.0
676
/* * To change this license header, choose License Headers in Project Properties. * To change this template file, choose Tools | Templates * and open the template in the editor. */ package utilesFXAvisos.forms.util; import ListDatos.IBusquedaListener; import utilesFX.*; import ListDatos.IFilaDatos; import ListDatos.JListDatos; import javafx.collections.ObservableList; import javafx.scene.control.TableCell; import javafx.scene.control.TableColumn; /** * * @author eduardo */ public class JTableViewEventos extends JTableViewCZ { private IBusquedaListener moListRecuperar; public JTableViewEventos() { super(); } @Override public void setModel(JListDatos poList, ObservableList<IFilaDatos> poListObservable) throws Exception { moList = poList; asignarEventos(); getColumns().clear(); layout(); TableColumn filaCol = new TableColumn("Tareas"); filaCol.setCellFactory(column -> { return new TableCell<IFilaDatos, IFilaDatos>() { private JPanelTableRender moRenderEventos = new JPanelTableRender(); private JTableRenderEventoParam moParam = new JTableRenderEventoParam(); @Override protected void updateItem(IFilaDatos item, boolean empty) { super.updateItem(item, empty); if (item == null || empty) { setText(null); setStyle(""); } else { moParam.setFila((IFilaDatos)item ); moRenderEventos.setValue(moParam, false); setGraphic(moRenderEventos); } } }; }); filaCol.setCellValueFactory(new TableCellValueEventos()); filaCol.setOnEditCommit(null); filaCol.setId(String.valueOf(0)); filaCol.setEditable(poList.getFields(0).isEditable()); getColumns().add(filaCol); reengancharTabla(poList, poListObservable); } }
Creativa3d/box3d
paquetesGUIFX/src/utilesFXAvisos/forms/util/JTableViewEventos.java
Java
gpl-2.0
2,135
<?php defined('WYSIJA') or die('Restricted access'); class WYSIJA_control_front_confirm extends WYSIJA_control_front{ var $model='user'; var $view='confirm'; function WYSIJA_control_front_confirm(){ parent::WYSIJA_control_front(); } function _testKeyuser(){ $this->helperUser=WYSIJA::get('user','helper'); $this->userData=$this->helperUser->checkUserKey(); add_action('init',array($this,'testsession')); if(!$this->userData){ $this->title=__('Page does not exist.',WYSIJA); $this->subtitle=__('Please verify your link to this page.',WYSIJA); return false; } return true; } /** * confirm subscription page * return boolean */ function subscribe(){ $list_ids=array(); if(isset($_REQUEST['wysiconf'])) $list_ids= unserialize(base64_decode($_REQUEST['wysiconf'])); $model_list=WYSIJA::get('list','model'); $lists_names_res=$model_list->get(array('name'),array('list_id'=>$list_ids)); $names=array(); foreach($lists_names_res as $nameob) $names[]=$nameob['name']; $model_config=WYSIJA::get('config','model'); // we need to call the translation otherwise it will not be loaded and translated $model_config->add_translated_default(); $this->title=$model_config->getValue('subscribed_title'); if(!isset($model_config->values['subscribed_title'])) $this->title=__('You\'ve subscribed to: %1$s',WYSIJA); $this->title=sprintf($this->title, implode(', ', $names)); $this->subtitle=$model_config->getValue('subscribed_subtitle'); if(!isset($model_config->values['subscribed_subtitle'])) $this->subtitle=__("Yup, we've added you to our list. You'll hear from us shortly.",WYSIJA); if(!isset($_REQUEST['demo'])){ if($this->_testKeyuser()){ //user is not confirmed yet if((int)$this->userData['details']['status']<1){ $this->helperUser->subscribe($this->userData['details']['user_id'],true, false,$list_ids); $this->helperUser->uid=$this->userData['details']['user_id']; // send a notification to the email specified in the settings if required to if($model_config->getValue('emails_notified') && $model_config->getValue('emails_notified_when_sub')){ $this->helperUser->_notify($this->userData['details']['email']); } return true; }else{ if(isset($_REQUEST['wysiconf'])){ $needs_subscription=false; foreach($this->userData['lists'] as $list){ if(in_array($list['list_id'],$list_ids) && (int)$list['sub_date']<1){ $needs_subscription=true; } } if($needs_subscription){ $this->helperUser->subscribe($this->userData['details']['user_id'],true,false,$list_ids); $this->title=sprintf($model_config->getValue('subscribed_title'), implode(', ', $names)); $this->subtitle=$model_config->getValue('subscribed_subtitle'); // send a notification to the email specified in the settings if required to if($model_config->getValue('emails_notified') && $model_config->getValue('emails_notified_when_sub')){ $this->helperUser->_notify($this->userData['details']['email'], true, $list_ids); } }else{ $this->title=sprintf(__('You are already subscribed to : %1$s',WYSIJA), implode(', ', $names)); } }else{ $this->title=__('You are already subscribed.',WYSIJA); } return true; } } } return true; } function unsubscribe(){ $model_config=WYSIJA::get('config','model'); // we need to call the translation otherwise it will not be loaded and translated $model_config->add_translated_default(); $this->title=$model_config->getValue('unsubscribed_title'); if(!isset($model_config->values['unsubscribed_title'])) $this->title=__("You've unsubscribed!",WYSIJA); $this->subtitle=$model_config->getValue('unsubscribed_subtitle'); if(!isset($model_config->values['unsubscribed_subtitle'])) $this->subtitle=__("Great, you'll never hear from us again!",WYSIJA); $undo_paramsurl=array( 'wysija-page'=>1, 'controller'=>'confirm', 'action'=>'undounsubscribe', 'wysija-key'=>$_REQUEST['wysija-key'] ); if(!isset($_REQUEST['demo'])){ if($this->_testKeyuser()){ $statusint=(int)$this->userData['details']['status']; if( ($model_config->getValue('confirm_dbleoptin') && $statusint>0) || (!$model_config->getValue('confirm_dbleoptin') && $statusint>=0)){ $listids=$this->helperUser->unsubscribe($this->userData['details']['user_id']); $this->helperUser->uid=$this->userData['details']['user_id']; if($model_config->getValue('emails_notified') && $model_config->getValue('emails_notified_when_unsub')) $this->helperUser->_notify($this->userData['details']['email'],false,$listids); }else{ $this->title=__('You are already unsubscribed.',WYSIJA); return false; } } } else $undo_paramsurl['demo'] = 1; $this->subtitle .= str_replace( array('[link]','[/link]'), array('<a href="'.WYSIJA::get_permalink($model_config->getValue('confirm_email_link'),$undo_paramsurl).'">','</a>'), '<p><b>'.__('You made a mistake? [link]Undo unsubscribe[/link].',WYSIJA)).'</b></p>'; return true; } function undounsubscribe(){ $model_config=WYSIJA::get('config','model'); // we need to call the translation otherwise it will not be loaded and translated $model_config->add_translated_default(); $this->title =__("You've been subscribed!",WYSIJA); $user_object = false; if(!isset($_REQUEST['demo'])){ if($this->_testKeyuser()){ $user_object = (object)$this->userData['details']; $this->helperUser->undounsubscribe($this->userData['details']['user_id']); } } //manage subcription link if(($model_config->getValue('manage_subscriptions'))){ $helper_user = WYSIJA::get('config','helper'); $model_user = WYSIJA::get('user','model'); $editsubscriptiontxt = $model_config->getValue('manage_subscriptions_linkname'); if(empty($editsubscriptiontxt)) $editsubscriptiontxt =__('Edit your subscription',WYSIJA); $this->subtitle = '<p>'.$model_user->getEditsubLink($user_object,false,'').'.</p>'; } return true; } function subscriptions(){ $data=array(); //get the user_id out of the params passed if($this->_testKeyuser()){ $data['user']=$this->userData; //get the list of user $model_list=WYSIJA::get('list','model'); $model_list->orderBy('ordering','ASC'); $data['list']=$model_list->get(array('list_id','name','description'),array('is_enabled'=>true,'is_public'=>true)); $this->title=sprintf(__('Edit your subscriber profile: %1$s',WYSIJA),$data['user']['details']['email']); $this->subtitle=$this->viewObj->subscriptions($data); return true; } } function resend(){ $this->title='The link you clicked has expired'; $this->subtitle=$this->viewObj->resend(); } function resendconfirm(){ //make sure the user has the right to access this action if($this->requireSecurity()){ //resend email $helper_mailer=WYSIJA::get('mailer','helper'); $helper_mailer->sendOne((int)$_REQUEST['email_id'],(int)$_REQUEST['user_id']); $this->title='Please check your inbox!'; $this->subtitle='<h3>A new email with working links has been sent to you.<h3/>'; } } function save(){ //get the user_id out of the params passed */ if($this->_testKeyuser()){ //update the general details */ $userid=$_REQUEST['wysija']['user']['user_id']; unset($_REQUEST['wysija']['user']['user_id']); $model_config=WYSIJA::get('config','model'); // we need to call the translation otherwise it will not be loaded and translated $model_config->add_translated_default(); $this->helperUser->uid=$userid; //if the status changed we might need to send notifications */ if((int)$_REQUEST['wysija']['user']['status'] !=(int)$this->userData['details']['status']){ if($_REQUEST['wysija']['user']['status']>0){ if($model_config->getValue('emails_notified_when_sub')) $this->helperUser->_notify($this->userData['details']['email']); }else{ if($model_config->getValue('emails_notified_when_unsub')) $this->helperUser->_notify($this->userData['details']['email'],false); } } //check whether the email address has changed if so then we should make sure that the new address doesnt exists already if(isset($_REQUEST['wysija']['user']['email'])){ $_REQUEST['wysija']['user']['email']=trim($_REQUEST['wysija']['user']['email']); if($this->userData['details']['email']!=$_REQUEST['wysija']['user']['email']){ $this->modelObj->reset(); $result=$this->modelObj->getOne(false,array('email'=>$_REQUEST['wysija']['user']['email'])); if($result){ $this->error(sprintf(__('Email %1$s already exists.',WYSIJA),$_REQUEST['wysija']['user']['email']),1); unset($_REQUEST['wysija']['user']['email']); } } } $this->modelObj->update($_REQUEST['wysija']['user'],array('user_id'=>$userid)); $id=$userid; $hUser=WYSIJA::get('user','helper'); //update the list subscriptions */ //run the unsubscribe process if needed if((int)$_REQUEST['wysija']['user']['status']==-1){ $hUser->unsubscribe($id); } //update subscriptions */ $modelUL=WYSIJA::get('user_list','model'); $modelUL->backSave=true; /* list of core list */ $modelLIST=WYSIJA::get('list','model'); $results=$modelLIST->get(array('list_id'),array('is_enabled'=>'0')); $core_listids=array(); foreach($results as $res){ $core_listids[]=$res['list_id']; } //0 - get current lists of the user $userlists=$modelUL->get(array('list_id','unsub_date'),array('user_id'=>$id)); $oldlistids=$newlistids=array(); foreach($userlists as $listdata) $oldlistids[$listdata['list_id']]=$listdata['unsub_date']; $config=WYSIJA::get('config','model'); $dbloptin=$config->getValue('confirm_dbleoptin'); //1 - insert new user_list if(isset($_POST['wysija']['user_list']) && $_POST['wysija']['user_list']){ $modelUL->reset(); $modelUL->update(array('sub_date'=>time()),array('user_id'=>$id)); foreach($_POST['wysija']['user_list']['list_id'] as $list_id){ //if the list is not already recorded for the user then we will need to insert it if(!isset($oldlistids[$list_id])){ $modelUL->reset(); $newlistids[]=$list_id; $dataul=array('user_id'=>$id,'list_id'=>$list_id,'sub_date'=>time()); //if double optin is on then we want to send a confirmation email for newly added subscription if($dbloptin){ unset($dataul['sub_date']); $modelUL->nohook=true; } $modelUL->insert($dataul); //if the list is recorded already then let's check the status, if it is an unsubed one then we update it }else{ if($oldlistids[$list_id]>0){ $modelUL->reset(); $modelUL->update(array('unsub_date'=>0,'sub_date'=>time()),array('user_id'=>$id,'list_id'=>$list_id)); } //$alreadysubscribelistids[]=$list_id; } } } //if a confirmation email needs to be sent then we send it if($dbloptin && !empty($newlistids)){ $hUser->sendConfirmationEmail($id,true,$newlistids); } // list ids $list_ids = !empty($_POST['wysija']['user_list']['list_id']) ? $_POST['wysija']['user_list']['list_id'] : array(); if(is_array($list_ids) === false) $list_ids = array(); $notEqual = array_merge($core_listids, $list_ids); //delete the lists from which you've removed yourself $condiFirst = array('notequal'=>array('list_id'=> $notEqual), 'equal' => array('user_id' => $id, 'unsub_date' => 0)); $modelUL=WYSIJA::get('user_list','model'); $modelUL->update(array('unsub_date'=>time()),$condiFirst); $modelUL->reset(); $this->notice(__('Newsletter profile has been updated.',WYSIJA)); $this->subscriptions(); //reset post otherwise wordpress will not recognise the post !!! $_POST=array(); } return true; } }
eyanai/hop
wp-content/plugins/wysija-newsletters/controllers/front/confirm.php
PHP
gpl-2.0
14,472
<?php include("config_mynonprofit.php"); include("connect.php"); include("functions.php"); include("template_header.php"); ?> <h1>A confirmation email has been sent</h1><p>Follow the enclosed link to activate your account.</p> </body> </html>
Enjabain/My-NP
register-success.php
PHP
gpl-2.0
244
package netdata.packet; import netdata.Payload; public class ARPpacket extends Packet{ public enum OPERATION{ REQUEST, REPLY }; private int type; private OPERATION arpOp; private String sourceMAC, destMAC = null; public ARPpacket(String sourceip, String destip, String sourceMAC, String destMAC, int type, OPERATION op, short TTL) { super(sourceip, destip, TTL, null); this.sourceMAC = sourceMAC; this.destMAC = destMAC; this.type = type; this.arpOp = op; // TODO Auto-generated constructor stub } public int getProtocolType() { return type; } public OPERATION getOperation() { return arpOp; } public String getSourceMAC() { return sourceMAC; } public String getDestinationMAC() { return destMAC; } }
frawg/NetFramework
src/netdata/packet/ARPpacket.java
Java
gpl-2.0
768
<?php /** * @version SVN: <svn_id> * @package Quick2cart * @author Techjoomla <extensions@techjoomla.com> * @copyright Copyright (c) 2009-2016 TechJoomla. All rights reserved. * @license GNU General Public License version 2 or later. */ // No direct access. defined('_JEXEC') or die(); jimport('joomla.form.formfield'); /** * Supports an HTML select list of gateways * * @since 1.6 */ class JFormFieldBssetup extends JFormField { /** * The form field type. * * @var string * @since 1.6 */ public $type = 'Bssetup'; /** * Function to fetch elements * * @return STRING html */ public function getInput() { return $this->fetchElement($this->name, $this->value, $this->element, $this->options['control']); } /** * Function to fetch elements * * @param STRING $name name * @param STRING $value value * @param STRING $node node * @param STRING $control_name control_name * * @return STRING html */ public function fetchElement($name, $value, $node, $control_name) { $actionLink = JURI::base() . "index.php?option=com_quick2cart&view=dashboard&layout=setup"; // Show link for payment plugins. $html = '<a href="' . $actionLink . '" target="_blank" class="btn btn-small btn-primary ">' . JText::_('COM_QUICK2CART_CLICK_BS_SETUP_INSTRUCTION') . '</a>'; return $html; } }
nitesh146/Motleymart
administrator/components/com_quick2cart/assets/elements/bssetup.php
PHP
gpl-2.0
1,407
/* * Copyright (C) 2008-2012 TrinityCore <http://www.trinitycore.org/> * * This program is free software; you can redistribute it and/or modify it * under the terms of the GNU General Public License as published by the * Free Software Foundation; either version 2 of the License, or (at your * option) any later version. * * This program is distributed in the hope that it will be useful, but WITHOUT * ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or * FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License for * more details. * * You should have received a copy of the GNU General Public License along * with this program. If not, see <http://www.gnu.org/licenses/>. */ #include <string> #include "Spell.h" #include "SpellAuras.h" #include "SpellScript.h" #include "SpellMgr.h" bool _SpellScript::_Validate(SpellInfo const* entry) { if (!Validate(entry)) { sLog->outError("TSCR: Spell `%u` did not pass Validate() function of script `%s` - script will be not added to the spell", entry->Id, m_scriptName->c_str()); return false; } return true; } void _SpellScript::_Register() { m_currentScriptState = SPELL_SCRIPT_STATE_REGISTRATION; Register(); m_currentScriptState = SPELL_SCRIPT_STATE_NONE; } void _SpellScript::_Unload() { m_currentScriptState = SPELL_SCRIPT_STATE_UNLOADING; Unload(); m_currentScriptState = SPELL_SCRIPT_STATE_NONE; } void _SpellScript::_Init(std::string const* scriptname, uint32 spellId) { m_currentScriptState = SPELL_SCRIPT_STATE_NONE; m_scriptName = scriptname; m_scriptSpellId = spellId; } std::string const* _SpellScript::_GetScriptName() const { return m_scriptName; } _SpellScript::EffectHook::EffectHook(uint8 _effIndex) { // effect index must be in range <0;2>, allow use of special effindexes ASSERT(_effIndex == EFFECT_ALL || _effIndex == EFFECT_FIRST_FOUND || _effIndex < MAX_SPELL_EFFECTS); effIndex = _effIndex; } uint8 _SpellScript::EffectHook::GetAffectedEffectsMask(SpellInfo const* spellEntry) { uint8 mask = 0; if ((effIndex == EFFECT_ALL) || (effIndex == EFFECT_FIRST_FOUND)) { for (uint8 i = 0; i < MAX_SPELL_EFFECTS; ++i) { if ((effIndex == EFFECT_FIRST_FOUND) && mask) return mask; if (CheckEffect(spellEntry, i)) mask |= (uint8)1<<i; } } else { if (CheckEffect(spellEntry, effIndex)) mask |= (uint8)1<<effIndex; } return mask; } bool _SpellScript::EffectHook::IsEffectAffected(SpellInfo const* spellEntry, uint8 effIndex) { return GetAffectedEffectsMask(spellEntry) & 1<<effIndex; } std::string _SpellScript::EffectHook::EffIndexToString() { switch (effIndex) { case EFFECT_ALL: return "EFFECT_ALL"; case EFFECT_FIRST_FOUND: return "EFFECT_FIRST_FOUND"; case EFFECT_0: return "EFFECT_0"; case EFFECT_1: return "EFFECT_1"; case EFFECT_2: return "EFFECT_2"; } return "Invalid Value"; } bool _SpellScript::EffectNameCheck::Check(SpellInfo const* spellEntry, uint8 effIndex) { if (!spellEntry->Effects[effIndex].Effect && !effName) return true; if (!spellEntry->Effects[effIndex].Effect) return false; return (effName == SPELL_EFFECT_ANY) || (spellEntry->Effects[effIndex].Effect == effName); } std::string _SpellScript::EffectNameCheck::ToString() { switch (effName) { case SPELL_EFFECT_ANY: return "SPELL_EFFECT_ANY"; default: char num[10]; sprintf (num, "%u", effName); return num; } } bool _SpellScript::EffectAuraNameCheck::Check(SpellInfo const* spellEntry, uint8 effIndex) { if (!spellEntry->Effects[effIndex].ApplyAuraName && !effAurName) return true; if (!spellEntry->Effects[effIndex].ApplyAuraName) return false; return (effAurName == SPELL_EFFECT_ANY) || (spellEntry->Effects[effIndex].ApplyAuraName == effAurName); } std::string _SpellScript::EffectAuraNameCheck::ToString() { switch (effAurName) { case SPELL_AURA_ANY: return "SPELL_AURA_ANY"; default: char num[10]; sprintf (num, "%u", effAurName); return num; } } SpellScript::CastHandler::CastHandler(SpellCastFnType _pCastHandlerScript) { pCastHandlerScript = _pCastHandlerScript; } void SpellScript::CastHandler::Call(SpellScript* spellScript) { (spellScript->*pCastHandlerScript)(); } SpellScript::CheckCastHandler::CheckCastHandler(SpellCheckCastFnType checkCastHandlerScript) { _checkCastHandlerScript = checkCastHandlerScript; } SpellCastResult SpellScript::CheckCastHandler::Call(SpellScript* spellScript) { return (spellScript->*_checkCastHandlerScript)(); } SpellScript::EffectHandler::EffectHandler(SpellEffectFnType _pEffectHandlerScript, uint8 _effIndex, uint16 _effName) : _SpellScript::EffectNameCheck(_effName), _SpellScript::EffectHook(_effIndex) { pEffectHandlerScript = _pEffectHandlerScript; } std::string SpellScript::EffectHandler::ToString() { return "Index: " + EffIndexToString() + " Name: " +_SpellScript::EffectNameCheck::ToString(); } bool SpellScript::EffectHandler::CheckEffect(SpellInfo const* spellEntry, uint8 effIndex) { return _SpellScript::EffectNameCheck::Check(spellEntry, effIndex); } void SpellScript::EffectHandler::Call(SpellScript* spellScript, SpellEffIndex effIndex) { (spellScript->*pEffectHandlerScript)(effIndex); } SpellScript::HitHandler::HitHandler(SpellHitFnType _pHitHandlerScript) { pHitHandlerScript = _pHitHandlerScript; } void SpellScript::HitHandler::Call(SpellScript* spellScript) { (spellScript->*pHitHandlerScript)(); } SpellScript::UnitTargetHandler::UnitTargetHandler(SpellUnitTargetFnType _pUnitTargetHandlerScript, uint8 _effIndex, uint16 _targetType) : _SpellScript::EffectHook(_effIndex), targetType(_targetType) { pUnitTargetHandlerScript = _pUnitTargetHandlerScript; } std::string SpellScript::UnitTargetHandler::ToString() { std::ostringstream oss; oss << "Index: " << EffIndexToString() << " Target: " << targetType; return oss.str(); } bool SpellScript::UnitTargetHandler::CheckEffect(SpellInfo const* spellEntry, uint8 effIndex) { if (!targetType) return false; return (effIndex == EFFECT_ALL) || (spellEntry->Effects[effIndex].TargetA.GetTarget() == targetType || spellEntry->Effects[effIndex].TargetB.GetTarget() == targetType); } void SpellScript::UnitTargetHandler::Call(SpellScript* spellScript, std::list<Unit*>& unitTargets) { (spellScript->*pUnitTargetHandlerScript)(unitTargets); } bool SpellScript::_Validate(SpellInfo const* entry) { for (std::list<EffectHandler>::iterator itr = OnEffectLaunch.begin(); itr != OnEffectLaunch.end(); ++itr) if (!(*itr).GetAffectedEffectsMask(entry)) sLog->outError("TSCR: Spell `%u` Effect `%s` of script `%s` did not match dbc effect data - handler bound to hook `OnEffectLaunch` of SpellScript won't be executed", entry->Id, (*itr).ToString().c_str(), m_scriptName->c_str()); for (std::list<EffectHandler>::iterator itr = OnEffectLaunchTarget.begin(); itr != OnEffectLaunchTarget.end(); ++itr) if (!(*itr).GetAffectedEffectsMask(entry)) sLog->outError("TSCR: Spell `%u` Effect `%s` of script `%s` did not match dbc effect data - handler bound to hook `OnEffectLaunchTarget` of SpellScript won't be executed", entry->Id, (*itr).ToString().c_str(), m_scriptName->c_str()); for (std::list<EffectHandler>::iterator itr = OnEffectHit.begin(); itr != OnEffectHit.end(); ++itr) if (!(*itr).GetAffectedEffectsMask(entry)) sLog->outError("TSCR: Spell `%u` Effect `%s` of script `%s` did not match dbc effect data - handler bound to hook `OnEffectHit` of SpellScript won't be executed", entry->Id, (*itr).ToString().c_str(), m_scriptName->c_str()); for (std::list<EffectHandler>::iterator itr = OnEffectHitTarget.begin(); itr != OnEffectHitTarget.end(); ++itr) if (!(*itr).GetAffectedEffectsMask(entry)) sLog->outError("TSCR: Spell `%u` Effect `%s` of script `%s` did not match dbc effect data - handler bound to hook `OnEffectHitTarget` of SpellScript won't be executed", entry->Id, (*itr).ToString().c_str(), m_scriptName->c_str()); for (std::list<UnitTargetHandler>::iterator itr = OnUnitTargetSelect.begin(); itr != OnUnitTargetSelect.end(); ++itr) if (!(*itr).GetAffectedEffectsMask(entry)) sLog->outError("TSCR: Spell `%u` Effect `%s` of script `%s` did not match dbc effect data - handler bound to hook `OnUnitTargetSelect` of SpellScript won't be executed", entry->Id, (*itr).ToString().c_str(), m_scriptName->c_str()); return _SpellScript::_Validate(entry); } bool SpellScript::_Load(Spell* spell) { m_spell = spell; _PrepareScriptCall((SpellScriptHookType)SPELL_SCRIPT_STATE_LOADING); bool load = Load(); _FinishScriptCall(); return load; } void SpellScript::_InitHit() { m_hitPreventEffectMask = 0; m_hitPreventDefaultEffectMask = 0; } void SpellScript::_PrepareScriptCall(SpellScriptHookType hookType) { m_currentScriptState = hookType; } void SpellScript::_FinishScriptCall() { m_currentScriptState = SPELL_SCRIPT_STATE_NONE; } bool SpellScript::IsInCheckCastHook() const { return m_currentScriptState == SPELL_SCRIPT_HOOK_CHECK_CAST; } bool SpellScript::IsInTargetHook() const { switch (m_currentScriptState) { case SPELL_SCRIPT_HOOK_EFFECT_LAUNCH_TARGET: case SPELL_SCRIPT_HOOK_EFFECT_HIT_TARGET: case SPELL_SCRIPT_HOOK_BEFORE_HIT: case SPELL_SCRIPT_HOOK_HIT: case SPELL_SCRIPT_HOOK_AFTER_HIT: return true; } return false; } bool SpellScript::IsInHitPhase() const { return (m_currentScriptState >= HOOK_SPELL_HIT_START && m_currentScriptState < HOOK_SPELL_HIT_END); } bool SpellScript::IsInEffectHook() const { return (m_currentScriptState >= SPELL_SCRIPT_HOOK_EFFECT_LAUNCH && m_currentScriptState <= SPELL_SCRIPT_HOOK_EFFECT_HIT_TARGET); } Unit* SpellScript::GetCaster() { return m_spell->GetCaster(); } Unit* SpellScript::GetOriginalCaster() { return m_spell->GetOriginalCaster(); } SpellInfo const* SpellScript::GetSpellInfo() { return m_spell->GetSpellInfo(); } WorldLocation const* SpellScript::GetTargetDest() { if (m_spell->m_targets.HasDst()) return m_spell->m_targets.GetDstPos(); return NULL; } void SpellScript::SetTargetDest(WorldLocation& loc) { m_spell->m_targets.SetDst(loc); } Unit* SpellScript::GetTargetUnit() { return m_spell->m_targets.GetUnitTarget(); } GameObject* SpellScript::GetTargetGObj() { return m_spell->m_targets.GetGOTarget(); } Item* SpellScript::GetTargetItem() { return m_spell->m_targets.GetItemTarget(); } Unit* SpellScript::GetHitUnit() { if (!IsInTargetHook()) { sLog->outError("TSCR: Script: `%s` Spell: `%u`: function SpellScript::GetHitUnit was called, but function has no effect in current hook!", m_scriptName->c_str(), m_scriptSpellId); return NULL; } return m_spell->unitTarget; } Creature* SpellScript::GetHitCreature() { if (!IsInTargetHook()) { sLog->outError("TSCR: Script: `%s` Spell: `%u`: function SpellScript::GetHitCreature was called, but function has no effect in current hook!", m_scriptName->c_str(), m_scriptSpellId); return NULL; } if (m_spell->unitTarget) return m_spell->unitTarget->ToCreature(); else return NULL; } Player* SpellScript::GetHitPlayer() { if (!IsInTargetHook()) { sLog->outError("TSCR: Script: `%s` Spell: `%u`: function SpellScript::GetHitPlayer was called, but function has no effect in current hook!", m_scriptName->c_str(), m_scriptSpellId); return NULL; } if (m_spell->unitTarget) return m_spell->unitTarget->ToPlayer(); else return NULL; } Item* SpellScript::GetHitItem() { if (!IsInTargetHook()) { sLog->outError("TSCR: Script: `%s` Spell: `%u`: function SpellScript::GetHitItem was called, but function has no effect in current hook!", m_scriptName->c_str(), m_scriptSpellId); return NULL; } return m_spell->itemTarget; } GameObject* SpellScript::GetHitGObj() { if (!IsInTargetHook()) { sLog->outError("TSCR: Script: `%s` Spell: `%u`: function SpellScript::GetHitGObj was called, but function has no effect in current hook!", m_scriptName->c_str(), m_scriptSpellId); return NULL; } return m_spell->gameObjTarget; } WorldLocation* SpellScript::GetHitDest() { if (!IsInEffectHook()) { sLog->outError("TSCR: Script: `%s` Spell: `%u`: function SpellScript::GetHitGObj was called, but function has no effect in current hook!", m_scriptName->c_str(), m_scriptSpellId); return NULL; } return m_spell->destTarget; } int32 SpellScript::GetHitDamage() { if (!IsInTargetHook()) { sLog->outError("TSCR: Script: `%s` Spell: `%u`: function SpellScript::GetHitDamage was called, but function has no effect in current hook!", m_scriptName->c_str(), m_scriptSpellId); return 0; } return m_spell->m_damage; } void SpellScript::SetHitDamage(int32 damage) { if (!IsInTargetHook()) { sLog->outError("TSCR: Script: `%s` Spell: `%u`: function SpellScript::SetHitDamage was called, but function has no effect in current hook!", m_scriptName->c_str(), m_scriptSpellId); return; } m_spell->m_damage = damage; } int32 SpellScript::GetHitHeal() { if (!IsInTargetHook()) { sLog->outError("TSCR: Script: `%s` Spell: `%u`: function SpellScript::GetHitHeal was called, but function has no effect in current hook!", m_scriptName->c_str(), m_scriptSpellId); return 0; } return m_spell->m_healing; } void SpellScript::SetHitHeal(int32 heal) { if (!IsInTargetHook()) { sLog->outError("TSCR: Script: `%s` Spell: `%u`: function SpellScript::SetHitHeal was called, but function has no effect in current hook!", m_scriptName->c_str(), m_scriptSpellId); return; } m_spell->m_healing = heal; } Aura* SpellScript::GetHitAura() { if (!IsInTargetHook()) { sLog->outError("TSCR: Script: `%s` Spell: `%u`: function SpellScript::GetHitAura was called, but function has no effect in current hook!", m_scriptName->c_str(), m_scriptSpellId); return NULL; } if (!m_spell->m_spellAura) return NULL; if (m_spell->m_spellAura->IsRemoved()) return NULL; return m_spell->m_spellAura; } void SpellScript::PreventHitAura() { if (!IsInTargetHook()) { sLog->outError("TSCR: Script: `%s` Spell: `%u`: function SpellScript::PreventHitAura was called, but function has no effect in current hook!", m_scriptName->c_str(), m_scriptSpellId); return; } if (m_spell->m_spellAura) m_spell->m_spellAura->Remove(); } void SpellScript::PreventHitEffect(SpellEffIndex effIndex) { if (!IsInHitPhase() && !IsInEffectHook()) { sLog->outError("TSCR: Script: `%s` Spell: `%u`: function SpellScript::PreventHitEffect was called, but function has no effect in current hook!", m_scriptName->c_str(), m_scriptSpellId); return; } m_hitPreventEffectMask |= 1 << effIndex; PreventHitDefaultEffect(effIndex); } void SpellScript::PreventHitDefaultEffect(SpellEffIndex effIndex) { if (!IsInHitPhase() && !IsInEffectHook()) { sLog->outError("TSCR: Script: `%s` Spell: `%u`: function SpellScript::PreventHitDefaultEffect was called, but function has no effect in current hook!", m_scriptName->c_str(), m_scriptSpellId); return; } m_hitPreventDefaultEffectMask |= 1 << effIndex; } int32 SpellScript::GetEffectValue() { if (!IsInEffectHook()) { sLog->outError("TSCR: Script: `%s` Spell: `%u`: function SpellScript::PreventHitDefaultEffect was called, but function has no effect in current hook!", m_scriptName->c_str(), m_scriptSpellId); return 0; } return m_spell->damage; } Item* SpellScript::GetCastItem() { return m_spell->m_CastItem; } void SpellScript::CreateItem(uint32 effIndex, uint32 itemId) { m_spell->DoCreateItem(effIndex, itemId); } SpellInfo const* SpellScript::GetTriggeringSpell() { return m_spell->m_triggeredByAuraSpell; } void SpellScript::FinishCast(SpellCastResult result) { m_spell->SendCastResult(result); m_spell->finish(result == SPELL_CAST_OK); } void SpellScript::SetCustomCastResultMessage(SpellCustomErrors result) { if (!IsInCheckCastHook()) { sLog->outError("TSCR: Script: `%s` Spell: `%u`: function SpellScript::SetCustomCastResultMessage was called while spell not in check cast phase!", m_scriptName->c_str(), m_scriptSpellId); return; } m_spell->m_customError = result; } SpellValue const* SpellScript::GetSpellValue() { return m_spell->m_spellValue; } bool AuraScript::_Validate(SpellInfo const* entry) { for (std::list<CheckAreaTargetHandler>::iterator itr = DoCheckAreaTarget.begin(); itr != DoCheckAreaTarget.end(); ++itr) if (!entry->HasAreaAuraEffect()) sLog->outError("TSCR: Spell `%u` of script `%s` does not have area aura effect - handler bound to hook `DoCheckAreaTarget` of AuraScript won't be executed", entry->Id, m_scriptName->c_str()); for (std::list<AuraDispelHandler>::iterator itr = OnDispel.begin(); itr != OnDispel.end(); ++itr) if (!entry->HasEffect(SPELL_EFFECT_APPLY_AURA) && !entry->HasAreaAuraEffect()) sLog->outError("TSCR: Spell `%u` of script `%s` does not have apply aura effect - handler bound to hook `OnDispel` of AuraScript won't be executed", entry->Id, m_scriptName->c_str()); for (std::list<AuraDispelHandler>::iterator itr = AfterDispel.begin(); itr != AfterDispel.end(); ++itr) if (!entry->HasEffect(SPELL_EFFECT_APPLY_AURA) && !entry->HasAreaAuraEffect()) sLog->outError("TSCR: Spell `%u` of script `%s` does not have apply aura effect - handler bound to hook `AfterDispel` of AuraScript won't be executed", entry->Id, m_scriptName->c_str()); for (std::list<EffectApplyHandler>::iterator itr = OnEffectApply.begin(); itr != OnEffectApply.end(); ++itr) if (!(*itr).GetAffectedEffectsMask(entry)) sLog->outError("TSCR: Spell `%u` Effect `%s` of script `%s` did not match dbc effect data - handler bound to hook `OnEffectApply` of AuraScript won't be executed", entry->Id, (*itr).ToString().c_str(), m_scriptName->c_str()); for (std::list<EffectApplyHandler>::iterator itr = OnEffectRemove.begin(); itr != OnEffectRemove.end(); ++itr) if (!(*itr).GetAffectedEffectsMask(entry)) sLog->outError("TSCR: Spell `%u` Effect `%s` of script `%s` did not match dbc effect data - handler bound to hook `OnEffectRemove` of AuraScript won't be executed", entry->Id, (*itr).ToString().c_str(), m_scriptName->c_str()); for (std::list<EffectApplyHandler>::iterator itr = AfterEffectApply.begin(); itr != AfterEffectApply.end(); ++itr) if (!(*itr).GetAffectedEffectsMask(entry)) sLog->outError("TSCR: Spell `%u` Effect `%s` of script `%s` did not match dbc effect data - handler bound to hook `AfterEffectApply` of AuraScript won't be executed", entry->Id, (*itr).ToString().c_str(), m_scriptName->c_str()); for (std::list<EffectApplyHandler>::iterator itr = AfterEffectRemove.begin(); itr != AfterEffectRemove.end(); ++itr) if (!(*itr).GetAffectedEffectsMask(entry)) sLog->outError("TSCR: Spell `%u` Effect `%s` of script `%s` did not match dbc effect data - handler bound to hook `AfterEffectRemove` of AuraScript won't be executed", entry->Id, (*itr).ToString().c_str(), m_scriptName->c_str()); for (std::list<EffectPeriodicHandler>::iterator itr = OnEffectPeriodic.begin(); itr != OnEffectPeriodic.end(); ++itr) if (!(*itr).GetAffectedEffectsMask(entry)) sLog->outError("TSCR: Spell `%u` Effect `%s` of script `%s` did not match dbc effect data - handler bound to hook `OnEffectPeriodic` of AuraScript won't be executed", entry->Id, (*itr).ToString().c_str(), m_scriptName->c_str()); for (std::list<EffectUpdatePeriodicHandler>::iterator itr = OnEffectUpdatePeriodic.begin(); itr != OnEffectUpdatePeriodic.end(); ++itr) if (!(*itr).GetAffectedEffectsMask(entry)) sLog->outError("TSCR: Spell `%u` Effect `%s` of script `%s` did not match dbc effect data - handler bound to hook `OnEffectUpdatePeriodic` of AuraScript won't be executed", entry->Id, (*itr).ToString().c_str(), m_scriptName->c_str()); for (std::list<EffectCalcAmountHandler>::iterator itr = DoEffectCalcAmount.begin(); itr != DoEffectCalcAmount.end(); ++itr) if (!(*itr).GetAffectedEffectsMask(entry)) sLog->outError("TSCR: Spell `%u` Effect `%s` of script `%s` did not match dbc effect data - handler bound to hook `DoEffectCalcAmount` of AuraScript won't be executed", entry->Id, (*itr).ToString().c_str(), m_scriptName->c_str()); for (std::list<EffectCalcPeriodicHandler>::iterator itr = DoEffectCalcPeriodic.begin(); itr != DoEffectCalcPeriodic.end(); ++itr) if (!(*itr).GetAffectedEffectsMask(entry)) sLog->outError("TSCR: Spell `%u` Effect `%s` of script `%s` did not match dbc effect data - handler bound to hook `DoEffectCalcPeriodic` of AuraScript won't be executed", entry->Id, (*itr).ToString().c_str(), m_scriptName->c_str()); for (std::list<EffectCalcSpellModHandler>::iterator itr = DoEffectCalcSpellMod.begin(); itr != DoEffectCalcSpellMod.end(); ++itr) if (!(*itr).GetAffectedEffectsMask(entry)) sLog->outError("TSCR: Spell `%u` Effect `%s` of script `%s` did not match dbc effect data - handler bound to hook `DoEffectCalcSpellMod` of AuraScript won't be executed", entry->Id, (*itr).ToString().c_str(), m_scriptName->c_str()); for (std::list<EffectAbsorbHandler>::iterator itr = OnEffectAbsorb.begin(); itr != OnEffectAbsorb.end(); ++itr) if (!(*itr).GetAffectedEffectsMask(entry)) sLog->outError("TSCR: Spell `%u` Effect `%s` of script `%s` did not match dbc effect data - handler bound to hook `OnEffectAbsorb` of AuraScript won't be executed", entry->Id, (*itr).ToString().c_str(), m_scriptName->c_str()); for (std::list<EffectAbsorbHandler>::iterator itr = AfterEffectAbsorb.begin(); itr != AfterEffectAbsorb.end(); ++itr) if (!(*itr).GetAffectedEffectsMask(entry)) sLog->outError("TSCR: Spell `%u` Effect `%s` of script `%s` did not match dbc effect data - handler bound to hook `AfterEffectAbsorb` of AuraScript won't be executed", entry->Id, (*itr).ToString().c_str(), m_scriptName->c_str()); for (std::list<EffectManaShieldHandler>::iterator itr = OnEffectManaShield.begin(); itr != OnEffectManaShield.end(); ++itr) if (!(*itr).GetAffectedEffectsMask(entry)) sLog->outError("TSCR: Spell `%u` Effect `%s` of script `%s` did not match dbc effect data - handler bound to hook `OnEffectManaShield` of AuraScript won't be executed", entry->Id, (*itr).ToString().c_str(), m_scriptName->c_str()); for (std::list<EffectManaShieldHandler>::iterator itr = AfterEffectManaShield.begin(); itr != AfterEffectManaShield.end(); ++itr) if (!(*itr).GetAffectedEffectsMask(entry)) sLog->outError("TSCR: Spell `%u` Effect `%s` of script `%s` did not match dbc effect data - handler bound to hook `AfterEffectManaShield` of AuraScript won't be executed", entry->Id, (*itr).ToString().c_str(), m_scriptName->c_str()); return _SpellScript::_Validate(entry); } AuraScript::CheckAreaTargetHandler::CheckAreaTargetHandler(AuraCheckAreaTargetFnType _pHandlerScript) { pHandlerScript = _pHandlerScript; } bool AuraScript::CheckAreaTargetHandler::Call(AuraScript* auraScript, Unit* _target) { return (auraScript->*pHandlerScript)(_target); } AuraScript::AuraDispelHandler::AuraDispelHandler(AuraDispelFnType _pHandlerScript) { pHandlerScript = _pHandlerScript; } void AuraScript::AuraDispelHandler::Call(AuraScript* auraScript, DispelInfo* _dispelInfo) { (auraScript->*pHandlerScript)(_dispelInfo); } AuraScript::EffectBase::EffectBase(uint8 _effIndex, uint16 _effName) : _SpellScript::EffectAuraNameCheck(_effName), _SpellScript::EffectHook(_effIndex) { } bool AuraScript::EffectBase::CheckEffect(SpellInfo const* spellEntry, uint8 effIndex) { return _SpellScript::EffectAuraNameCheck::Check(spellEntry, effIndex); } std::string AuraScript::EffectBase::ToString() { return "Index: " + EffIndexToString() + " AuraName: " +_SpellScript::EffectAuraNameCheck::ToString(); } AuraScript::EffectPeriodicHandler::EffectPeriodicHandler(AuraEffectPeriodicFnType _pEffectHandlerScript, uint8 _effIndex, uint16 _effName) : AuraScript::EffectBase(_effIndex, _effName) { pEffectHandlerScript = _pEffectHandlerScript; } void AuraScript::EffectPeriodicHandler::Call(AuraScript* auraScript, AuraEffect const* _aurEff) { (auraScript->*pEffectHandlerScript)(_aurEff); } AuraScript::EffectUpdatePeriodicHandler::EffectUpdatePeriodicHandler(AuraEffectUpdatePeriodicFnType _pEffectHandlerScript, uint8 _effIndex, uint16 _effName) : AuraScript::EffectBase(_effIndex, _effName) { pEffectHandlerScript = _pEffectHandlerScript; } void AuraScript::EffectUpdatePeriodicHandler::Call(AuraScript* auraScript, AuraEffect* aurEff) { (auraScript->*pEffectHandlerScript)(aurEff); } AuraScript::EffectCalcAmountHandler::EffectCalcAmountHandler(AuraEffectCalcAmountFnType _pEffectHandlerScript, uint8 _effIndex, uint16 _effName) : AuraScript::EffectBase(_effIndex, _effName) { pEffectHandlerScript = _pEffectHandlerScript; } void AuraScript::EffectCalcAmountHandler::Call(AuraScript* auraScript, AuraEffect const* aurEff, int32& amount, bool& canBeRecalculated) { (auraScript->*pEffectHandlerScript)(aurEff, amount, canBeRecalculated); } AuraScript::EffectCalcPeriodicHandler::EffectCalcPeriodicHandler(AuraEffectCalcPeriodicFnType _pEffectHandlerScript, uint8 _effIndex, uint16 _effName) : AuraScript::EffectBase(_effIndex, _effName) { pEffectHandlerScript = _pEffectHandlerScript; } void AuraScript::EffectCalcPeriodicHandler::Call(AuraScript* auraScript, AuraEffect const* aurEff, bool& isPeriodic, int32& periodicTimer) { (auraScript->*pEffectHandlerScript)(aurEff, isPeriodic, periodicTimer); } AuraScript::EffectCalcSpellModHandler::EffectCalcSpellModHandler(AuraEffectCalcSpellModFnType _pEffectHandlerScript, uint8 _effIndex, uint16 _effName) : AuraScript::EffectBase(_effIndex, _effName) { pEffectHandlerScript = _pEffectHandlerScript; } void AuraScript::EffectCalcSpellModHandler::Call(AuraScript* auraScript, AuraEffect const* aurEff, SpellModifier*& spellMod) { (auraScript->*pEffectHandlerScript)(aurEff, spellMod); } AuraScript::EffectApplyHandler::EffectApplyHandler(AuraEffectApplicationModeFnType _pEffectHandlerScript, uint8 _effIndex, uint16 _effName, AuraEffectHandleModes _mode) : AuraScript::EffectBase(_effIndex, _effName) { pEffectHandlerScript = _pEffectHandlerScript; mode = _mode; } void AuraScript::EffectApplyHandler::Call(AuraScript* auraScript, AuraEffect const* _aurEff, AuraEffectHandleModes _mode) { if (_mode & mode) (auraScript->*pEffectHandlerScript)(_aurEff, _mode); } AuraScript::EffectAbsorbHandler::EffectAbsorbHandler(AuraEffectAbsorbFnType _pEffectHandlerScript, uint8 _effIndex) : AuraScript::EffectBase(_effIndex, SPELL_AURA_SCHOOL_ABSORB) { pEffectHandlerScript = _pEffectHandlerScript; } void AuraScript::EffectAbsorbHandler::Call(AuraScript* auraScript, AuraEffect* aurEff, DamageInfo& dmgInfo, uint32& absorbAmount) { (auraScript->*pEffectHandlerScript)(aurEff, dmgInfo, absorbAmount); } AuraScript::EffectManaShieldHandler::EffectManaShieldHandler(AuraEffectAbsorbFnType _pEffectHandlerScript, uint8 _effIndex) : AuraScript::EffectBase(_effIndex, SPELL_AURA_MANA_SHIELD) { pEffectHandlerScript = _pEffectHandlerScript; } void AuraScript::EffectManaShieldHandler::Call(AuraScript* auraScript, AuraEffect* aurEff, DamageInfo& dmgInfo, uint32& absorbAmount) { (auraScript->*pEffectHandlerScript)(aurEff, dmgInfo, absorbAmount); } bool AuraScript::_Load(Aura* aura) { m_aura = aura; _PrepareScriptCall((AuraScriptHookType)SPELL_SCRIPT_STATE_LOADING, NULL); bool load = Load(); _FinishScriptCall(); return load; } void AuraScript::_PrepareScriptCall(AuraScriptHookType hookType, AuraApplication const* aurApp) { m_scriptStates.push(ScriptStateStore(m_currentScriptState, m_auraApplication, m_defaultActionPrevented)); m_currentScriptState = hookType; m_defaultActionPrevented = false; m_auraApplication = aurApp; } void AuraScript::_FinishScriptCall() { ScriptStateStore stateStore = m_scriptStates.top(); m_currentScriptState = stateStore._currentScriptState; m_auraApplication = stateStore._auraApplication; m_defaultActionPrevented = stateStore._defaultActionPrevented; m_scriptStates.pop(); } bool AuraScript::_IsDefaultActionPrevented() { switch (m_currentScriptState) { case AURA_SCRIPT_HOOK_EFFECT_APPLY: case AURA_SCRIPT_HOOK_EFFECT_REMOVE: case AURA_SCRIPT_HOOK_EFFECT_PERIODIC: case AURA_SCRIPT_HOOK_EFFECT_ABSORB: return m_defaultActionPrevented; default: ASSERT(false && "AuraScript::_IsDefaultActionPrevented is called in a wrong place"); return false; } } void AuraScript::PreventDefaultAction() { switch (m_currentScriptState) { case AURA_SCRIPT_HOOK_EFFECT_APPLY: case AURA_SCRIPT_HOOK_EFFECT_REMOVE: case AURA_SCRIPT_HOOK_EFFECT_PERIODIC: case AURA_SCRIPT_HOOK_EFFECT_ABSORB: m_defaultActionPrevented = true; break; default: sLog->outError("TSCR: Script: `%s` Spell: `%u` AuraScript::PreventDefaultAction called in a hook in which the call won't have effect!", m_scriptName->c_str(), m_scriptSpellId); break; } } SpellInfo const* AuraScript::GetSpellInfo() const { return m_aura->GetSpellInfo(); } uint32 AuraScript::GetId() const { return m_aura->GetId(); } uint64 AuraScript::GetCasterGUID() const { return m_aura->GetCasterGUID(); } Unit* AuraScript::GetCaster() const { return m_aura->GetCaster(); } WorldObject* AuraScript::GetOwner() const { return m_aura->GetOwner(); } Unit* AuraScript::GetUnitOwner() const { return m_aura->GetUnitOwner(); } DynamicObject* AuraScript::GetDynobjOwner() const { return m_aura->GetDynobjOwner(); } void AuraScript::Remove(uint32 removeMode) { m_aura->Remove((AuraRemoveMode)removeMode); } Aura* AuraScript::GetAura() const { return m_aura; } AuraObjectType AuraScript::GetType() const { return m_aura->GetType(); } int32 AuraScript::GetDuration() const { return m_aura->GetDuration(); } void AuraScript::SetDuration(int32 duration, bool withMods) { m_aura->SetDuration(duration, withMods); } void AuraScript::RefreshDuration() { m_aura->RefreshDuration(); } time_t AuraScript::GetApplyTime() const { return m_aura->GetApplyTime(); } int32 AuraScript::GetMaxDuration() const { return m_aura->GetMaxDuration(); } void AuraScript::SetMaxDuration(int32 duration) { m_aura->SetMaxDuration(duration); } int32 AuraScript::CalcMaxDuration() const { return m_aura->CalcMaxDuration(); } bool AuraScript::IsExpired() const { return m_aura->IsExpired(); } bool AuraScript::IsPermanent() const { return m_aura->IsPermanent(); } uint8 AuraScript::GetCharges() const { return m_aura->GetCharges(); } void AuraScript::SetCharges(uint8 charges) { m_aura->SetCharges(charges); } uint8 AuraScript::CalcMaxCharges() const { return m_aura->CalcMaxCharges(); } bool AuraScript::ModCharges(int8 num, AuraRemoveMode removeMode /*= AURA_REMOVE_BY_DEFAULT*/) { return m_aura->ModCharges(num, removeMode); } bool AuraScript::DropCharge(AuraRemoveMode removeMode) { return m_aura->DropCharge(removeMode); } uint8 AuraScript::GetStackAmount() const { return m_aura->GetStackAmount(); } void AuraScript::SetStackAmount(uint8 num) { m_aura->SetStackAmount(num); } bool AuraScript::ModStackAmount(int32 num, AuraRemoveMode removeMode) { return m_aura->ModStackAmount(num, removeMode); } bool AuraScript::IsPassive() const { return m_aura->IsPassive(); } bool AuraScript::IsDeathPersistent() const { return m_aura->IsDeathPersistent(); } bool AuraScript::HasEffect(uint8 effIndex) const { return m_aura->HasEffect(effIndex); } AuraEffect* AuraScript::GetEffect(uint8 effIndex) const { return m_aura->GetEffect(effIndex); } bool AuraScript::HasEffectType(AuraType type) const { return m_aura->HasEffectType(type); } Unit* AuraScript::GetTarget() const { switch (m_currentScriptState) { case AURA_SCRIPT_HOOK_EFFECT_APPLY: case AURA_SCRIPT_HOOK_EFFECT_REMOVE: case AURA_SCRIPT_HOOK_EFFECT_AFTER_APPLY: case AURA_SCRIPT_HOOK_EFFECT_AFTER_REMOVE: case AURA_SCRIPT_HOOK_EFFECT_PERIODIC: case AURA_SCRIPT_HOOK_EFFECT_ABSORB: case AURA_SCRIPT_HOOK_EFFECT_AFTER_ABSORB: case AURA_SCRIPT_HOOK_EFFECT_MANASHIELD: case AURA_SCRIPT_HOOK_EFFECT_AFTER_MANASHIELD: return m_auraApplication->GetTarget(); default: sLog->outError("TSCR: Script: `%s` Spell: `%u` AuraScript::GetTarget called in a hook in which the call won't have effect!", m_scriptName->c_str(), m_scriptSpellId); } return NULL; } AuraApplication const* AuraScript::GetTargetApplication() const { return m_auraApplication; }
BlackWolfsDen/Justicar-WoW
src/server/game/Spells/SpellScript.cpp
C++
gpl-2.0
34,032
<?php /** * @copyright Ilch 2.0 * @package ilch */ return array ( 'menuCalendarList' => 'Calender', 'noCalendar' => 'no Entries available', 'term' => 'Term', 'title' => 'Title', 'text' => 'Text', 'color' => 'Term Color', 'place' => 'Place', 'start' => 'Start', 'end' => 'End', 'description' => 'Description', 'noDescription' => 'no Description available', 'at' => 'at', 'clock' => 'o\'clock', );
jurri/Ilch-2.0
application/modules/calendar/translations/en.php
PHP
gpl-2.0
452
var interface_data_cell_phone = [ [ "callButtonClicked:", "interface_data_cell_phone.html#abb91ce98f4b5920f486508bbf150c68a", null ], [ "mainTextLabel", "interface_data_cell_phone.html#aefc998f3932ae7f2decba1eaaec427c0", null ], [ "titleLabel", "interface_data_cell_phone.html#a0c3e159f8e753caaaa07fe67776faacb", null ] ];
BiCoR/RailsServer
public/doc/iphone_client/interface_data_cell_phone.js
JavaScript
gpl-2.0
334
/****************************************************************************** * Icinga 2 * * Copyright (C) 2012-2017 Icinga Development Team (https://www.icinga.com/) * * * * This program is free software; you can redistribute it and/or * * modify it under the terms of the GNU General Public License * * as published by the Free Software Foundation; either version 2 * * of the License, or (at your option) any later version. * * * * This program is distributed in the hope that it will be useful, * * but WITHOUT ANY WARRANTY; without even the implied warranty of * * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the * * GNU General Public License for more details. * * * * You should have received a copy of the GNU General Public License * * along with this program; if not, write to the Free Software Foundation * * Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301, USA. * ******************************************************************************/ #include "methods/icingachecktask.hpp" #include "icinga/cib.hpp" #include "icinga/service.hpp" #include "icinga/icingaapplication.hpp" #include "base/application.hpp" #include "base/objectlock.hpp" #include "base/utility.hpp" #include "base/perfdatavalue.hpp" #include "base/function.hpp" #include "base/configtype.hpp" using namespace icinga; REGISTER_SCRIPTFUNCTION_NS(Internal, IcingaCheck, &IcingaCheckTask::ScriptFunc, "checkable:cr:resolvedMacros:useResolvedMacros"); void IcingaCheckTask::ScriptFunc(const Checkable::Ptr& service, const CheckResult::Ptr& cr, const Dictionary::Ptr& resolvedMacros, bool useResolvedMacros) { if (resolvedMacros && !useResolvedMacros) return; double interval = Utility::GetTime() - Application::GetStartTime(); if (interval > 60) interval = 60; /* use feature stats perfdata */ std::pair<Dictionary::Ptr, Array::Ptr> feature_stats = CIB::GetFeatureStats(); Array::Ptr perfdata = feature_stats.second; perfdata->Add(new PerfdataValue("active_host_checks", CIB::GetActiveHostChecksStatistics(interval) / interval)); perfdata->Add(new PerfdataValue("passive_host_checks", CIB::GetPassiveHostChecksStatistics(interval) / interval)); perfdata->Add(new PerfdataValue("active_host_checks_1min", CIB::GetActiveHostChecksStatistics(60))); perfdata->Add(new PerfdataValue("passive_host_checks_1min", CIB::GetPassiveHostChecksStatistics(60))); perfdata->Add(new PerfdataValue("active_host_checks_5min", CIB::GetActiveHostChecksStatistics(60 * 5))); perfdata->Add(new PerfdataValue("passive_host_checks_5min", CIB::GetPassiveHostChecksStatistics(60 * 5))); perfdata->Add(new PerfdataValue("active_host_checks_15min", CIB::GetActiveHostChecksStatistics(60 * 15))); perfdata->Add(new PerfdataValue("passive_host_checks_15min", CIB::GetPassiveHostChecksStatistics(60 * 15))); perfdata->Add(new PerfdataValue("active_service_checks", CIB::GetActiveServiceChecksStatistics(interval) / interval)); perfdata->Add(new PerfdataValue("passive_service_checks", CIB::GetPassiveServiceChecksStatistics(interval) / interval)); perfdata->Add(new PerfdataValue("active_service_checks_1min", CIB::GetActiveServiceChecksStatistics(60))); perfdata->Add(new PerfdataValue("passive_service_checks_1min", CIB::GetPassiveServiceChecksStatistics(60))); perfdata->Add(new PerfdataValue("active_service_checks_5min", CIB::GetActiveServiceChecksStatistics(60 * 5))); perfdata->Add(new PerfdataValue("passive_service_checks_5min", CIB::GetPassiveServiceChecksStatistics(60 * 5))); perfdata->Add(new PerfdataValue("active_service_checks_15min", CIB::GetActiveServiceChecksStatistics(60 * 15))); perfdata->Add(new PerfdataValue("passive_service_checks_15min", CIB::GetPassiveServiceChecksStatistics(60 * 15))); CheckableCheckStatistics scs = CIB::CalculateServiceCheckStats(); perfdata->Add(new PerfdataValue("min_latency", scs.min_latency)); perfdata->Add(new PerfdataValue("max_latency", scs.max_latency)); perfdata->Add(new PerfdataValue("avg_latency", scs.avg_latency)); perfdata->Add(new PerfdataValue("min_execution_time", scs.min_execution_time)); perfdata->Add(new PerfdataValue("max_execution_time", scs.max_execution_time)); perfdata->Add(new PerfdataValue("avg_execution_time", scs.avg_execution_time)); ServiceStatistics ss = CIB::CalculateServiceStats(); perfdata->Add(new PerfdataValue("num_services_ok", ss.services_ok)); perfdata->Add(new PerfdataValue("num_services_warning", ss.services_warning)); perfdata->Add(new PerfdataValue("num_services_critical", ss.services_critical)); perfdata->Add(new PerfdataValue("num_services_unknown", ss.services_unknown)); perfdata->Add(new PerfdataValue("num_services_pending", ss.services_pending)); perfdata->Add(new PerfdataValue("num_services_unreachable", ss.services_unreachable)); perfdata->Add(new PerfdataValue("num_services_flapping", ss.services_flapping)); perfdata->Add(new PerfdataValue("num_services_in_downtime", ss.services_in_downtime)); perfdata->Add(new PerfdataValue("num_services_acknowledged", ss.services_acknowledged)); double uptime = Utility::GetTime() - Application::GetStartTime(); perfdata->Add(new PerfdataValue("uptime", uptime)); HostStatistics hs = CIB::CalculateHostStats(); perfdata->Add(new PerfdataValue("num_hosts_up", hs.hosts_up)); perfdata->Add(new PerfdataValue("num_hosts_down", hs.hosts_down)); perfdata->Add(new PerfdataValue("num_hosts_pending", hs.hosts_pending)); perfdata->Add(new PerfdataValue("num_hosts_unreachable", hs.hosts_unreachable)); perfdata->Add(new PerfdataValue("num_hosts_flapping", hs.hosts_flapping)); perfdata->Add(new PerfdataValue("num_hosts_in_downtime", hs.hosts_in_downtime)); perfdata->Add(new PerfdataValue("num_hosts_acknowledged", hs.hosts_acknowledged)); std::vector<Endpoint::Ptr> endpoints = ConfigType::GetObjectsByType<Endpoint>(); double lastMessageSent = 0; double lastMessageReceived = 0; double messagesSentPerSecond = 0; double messagesReceivedPerSecond = 0; double bytesSentPerSecond = 0; double bytesReceivedPerSecond = 0; for (Endpoint::Ptr endpoint : endpoints) { if (endpoint->GetLastMessageSent() > lastMessageSent) lastMessageSent = endpoint->GetLastMessageSent(); if (endpoint->GetLastMessageReceived() > lastMessageReceived) lastMessageReceived = endpoint->GetLastMessageReceived(); messagesSentPerSecond += endpoint->GetMessagesSentPerSecond(); messagesReceivedPerSecond += endpoint->GetMessagesReceivedPerSecond(); bytesSentPerSecond += endpoint->GetBytesSentPerSecond(); bytesReceivedPerSecond += endpoint->GetBytesReceivedPerSecond(); } perfdata->Add(new PerfdataValue("last_messages_sent", lastMessageSent)); perfdata->Add(new PerfdataValue("last_messages_received", lastMessageReceived)); perfdata->Add(new PerfdataValue("sum_messages_sent_per_second", messagesSentPerSecond)); perfdata->Add(new PerfdataValue("sum_messages_received_per_second", messagesReceivedPerSecond)); perfdata->Add(new PerfdataValue("sum_bytes_sent_per_second", bytesSentPerSecond)); perfdata->Add(new PerfdataValue("sum_bytes_received_per_second", bytesReceivedPerSecond)); cr->SetOutput("Icinga 2 has been running for " + Utility::FormatDuration(uptime) + ". Version: " + Application::GetAppVersion()); cr->SetPerformanceData(perfdata); double lastReloadFailed = Application::GetLastReloadFailed(); if (lastReloadFailed > 0) { cr->SetOutput(cr->GetOutput() + "; Last reload attempt failed at " + Utility::FormatDateTime("%Y-%m-%d %H:%M:%S %z", lastReloadFailed)); cr->SetState(ServiceWarning); } else cr->SetState(ServiceOK); service->ProcessCheckResult(cr); }
Tontonitch/icinga2
lib/methods/icingachecktask.cpp
C++
gpl-2.0
8,065
//////////////////////////////////////////////////////////// // // File: parser.cpp // Author: Frank Boerman // Parsers for files /////////////////////////////////////////////////////////// //#pragma warning(disable : 4244) //converting double to int is needed when calculating gridsize, so disable that warning //#pragma warning(disable : 4018)//same goes for signed/unsigned mismatch (due to if statements) #include <string> #include <sstream> #include <iostream> #include <fstream> #include "drawtools.h" #include <list> #include "GameOfLife.h" #include "List.h" #include "Parser.h" #include <limits> #include <sstream> #include "SharedGlobals.h" #include "Colours.h" using namespace std; //the parser for .gol files int* GOLParser(std::string filename, int maxwidht, int maxheight, list<item*>* DrawList, int* cell_dimension) { int gridsize[2]; ifstream file; string fline; file.open(filename); if (file.fail()) //open the stream { cout << "Error reading file " << filename << endl; return nullptr; } //due to rewriting parts of this procedure the code looks a bit silly and can be written more elogant. however there was no more time left for that List<string>* parsedfile = new List<string>(); //list of strings that holds the int leftline = numeric_limits<int>::max(); //holds the position of most left live cell while (getline(file, fline)) //fetch line per line of the file { if (fline.find("O") != string::npos) //if there is an living cell in the line { stringstream parsedline; for (int i = 0; i < (int)fline.size(); i++)//iterate through the line { //send the line to the stream, save the most left cell encountered in the file if (fline[i] == 'O') { if (i < leftline) { leftline = i; } } parsedline << fline[i]; //if (fline[i] == 'O' || parsedline.tellp() > 0) //{ // parsedline << fline[i]; // //line_list->append(fline[i]); //} } if (parsedline.tellp() > 0) { //parsedfile->append(*line_list); parsedfile->append(parsedline.str()); } } } //find the largest line and also correct the line to drop all not needed dead cells after last living one, and all not needed dead cells before the most left living cell in the figure int maxsizex = 0; for (int i = 0; i < parsedfile->len(); i++) { string line = parsedfile->Get_String(i); //cut the line to only include the necesarry cells for the figure string line_corrected = line.substr(0, line.find_last_of('O')+1).substr(leftline,string::npos);//NOTETOSELF: leave two substrings because of offset parsedfile->Set(i, line_corrected); //save the corrected line int line_length = line_corrected.size(); if (line_length > maxsizex) //save the biggest size of length { maxsizex = line_length; } } //calculate minimal height and width int minheight = (2 * WHITEBAND + parsedfile->len())* *cell_dimension; int minwidth = (2 * WHITEBAND + maxsizex)* *cell_dimension; //check against the constraints given //if figure doesnt fit with the given whiteband, than resize the cell_dimension of all the cells if (minheight > maxheight) { *cell_dimension = (int)floor(maxheight/parsedfile->len()); if (minwidth > maxwidht) { if (floor(maxwidht / maxsizex) < *cell_dimension) { *cell_dimension = (int)floor(maxwidht / maxsizex); } gridsize[0] = *cell_dimension * (2 * WHITEBAND + maxsizex); } else { gridsize[0] = maxwidht; } gridsize[1] = *cell_dimension * (2 * WHITEBAND + parsedfile->len()); } else if (minwidth > maxwidht) { *cell_dimension = (int)floor(maxwidht / maxsizex); gridsize[0] = *cell_dimension * (2 * WHITEBAND + maxsizex); gridsize[1] = maxheight; } else { gridsize[0] = maxwidht; gridsize[1] = maxheight; } //init the grid gridheight = gridsize[1] / *cell_dimension; gridwidth = (gridsize[0] / *cell_dimension); GLOBAL_GRID = new cell**[gridsize[0] / *cell_dimension]; float p1[2], p2[2]; int gridy = gridsize[1] / *cell_dimension; int gridx = gridsize[0] / *cell_dimension; for (int x = 0; x < gridx;x++)//travers through the grid and create the cells, fill in the figure { p1[0] = x * (int)*cell_dimension; p2[0] = (x + 1) * (int)*cell_dimension; GLOBAL_GRID[x] = new cell*[gridsize[1] / *cell_dimension];//create the height row for (int y = 0; y < gridy; y++) { p1[1] = y * (int)*cell_dimension; p2[1] = (y + 1) * (int)*cell_dimension; //create the new square square* sqr = new square(DrawList, p1, p2, LINECOLOR, Blue); //check if were outside the sidebands if (x >= WHITEBAND && y >= WHITEBAND && (y-WHITEBAND) < parsedfile->len() && (x-WHITEBAND) < maxsizex){ //check if x is in reange of the parsed line string line = parsedfile->Get_String((parsedfile->len() - 1) - (y - WHITEBAND)); if ((x - WHITEBAND) >= (int)line.size()) { GLOBAL_GRID[x][y] = new cell(sqr, 0); } else { //create the new cell //change the y because grid is drawn bottom up, while file is parsed top down //cout << "DEBUG: x: " << x << " y:" << y << endl; if (line[x - WHITEBAND] == 'O') { GLOBAL_GRID[x][y] = new cell(sqr, 1); } else { GLOBAL_GRID[x][y] = new cell(sqr, 0); } } } else { //if not than just insert empty cell GLOBAL_GRID[x][y] = new cell(sqr, 0); } } } cout << "dimension calculated: " << *cell_dimension << " gridwidth: " << gridwidth << " gridheight: " << gridheight << endl; //update the whitelines for (int x = 0; x < gridwidth; x++) { for (int y = 0; y < gridheight; y++) { GLOBAL_GRID[x][y]->CheckNeighbors(x, y); } } //return the size return gridsize; } string findstring(string line) { int first = line.find_first_of("\""); int last = line.find_last_of("\""); return line.substr(first, last - first); } void readEDIF(string fname, string* windowname, list<item*>* DrawList) //old parser { ifstream file; string fline; file.open(fname); if (file.fail()) { cout << "Error reading file " << fname << endl; return; } cout << "Parsing file " << fname << endl; while (getline(file, fline)) { stringstream sstream(fline); string command, title, ftext; float p1[2], p2[2], clr[3], width; pixel* pxl; line* ln; text* txt; if (fline[0] != '.' || fline == "") { //comment line continue; } switch (fline[1]) { case 'd': //change window title *windowname = findstring(sstream.str()); cout << "Parsed windowname: " << windowname << endl; break; case 'p': //draw pixel sstream >> command >> p1[0] >> p1[1] >> clr[0] >> clr[1] >> clr[2]; pxl = new pixel(DrawList, p1, clr); cout << "Parsed a pixel: "; pxl->print(); break; case 't': //draw text sstream >> command >> p1[0] >> p1[1] >> clr[0] >> clr[1] >> clr[2]; ftext = findstring(sstream.str()); txt = new text(DrawList, ftext, clr, p1[0], p1[1]); cout << "Parsed a string: "; txt->print(); break; case 'l': //draw line sstream >> command >> p1[0] >> p1[1] >> p2[0] >> p2[1] >> clr[0] >> clr[1] >> clr[2] >> width; ln = new line(DrawList, p1, p2, clr, width); cout << "Parsed a line: "; ln->print(); break; } } }
williewonka/computation2_C
Computation2_finaltask/GameOfLife/Parser.cpp
C++
gpl-2.0
7,205
<?php /** * Joomla! Content Management System * * @copyright Copyright (C) 2005 - 2020 Open Source Matters, Inc. All rights reserved. * @license GNU General Public License version 2 or later; see LICENSE */ namespace Joomla\CMS\Event\WebAsset; \defined('JPATH_PLATFORM') or die; use BadMethodCallException; use Joomla\CMS\Event\AbstractImmutableEvent; /** * Event class for WebAsset events * * @since 4.0.0 */ abstract class AbstractEvent extends AbstractImmutableEvent { /** * Constructor. * * @param string $name The event name. * @param array $arguments The event arguments. * * @throws BadMethodCallException * * @since 4.0.0 */ public function __construct($name, array $arguments = array()) { if (!\array_key_exists('subject', $arguments)) { throw new BadMethodCallException("Argument 'subject' of event {$this->name} is required but has not been provided"); } parent::__construct($name, $arguments); } }
twister65/joomla-cms
libraries/src/Event/WebAsset/AbstractEvent.php
PHP
gpl-2.0
979
<!DOCTYPE html> <html <?php language_attributes(); ?>> <head> <meta charset="<?php bloginfo( 'charset' ); ?>" /> <meta name="viewport" content="width=device-width" /> <title><?php wp_title( ' | ', true, 'right' ); ?></title> <link rel="stylesheet" type="text/css" href="<?php echo get_stylesheet_uri(); ?>" /> <script src="//code.jquery.com/jquery-1.11.0.min.js"></script> <?php //wp_head(); ?> <script> /********** My functions **********/ $(document).ready(function() { // The maximum supported horizontal resolution, cloud width, and banner height var maxres = 1260; var cloud_width = 256; var banner_height = $("#banner").height; // The current weather condition var condition = "snow"; // The number of clouds and a helper variable (sorry) var clouds = 10; var range = (maxres + cloud_width) / clouds; // Place all clouds dynamically for (var i = 0; i < clouds; i++) { var offset = Math.floor(i * range + Math.random() * range - cloud_width) $("#clouds").append( "<div class='cloud' style='left: " + offset + "px;'> \ <img src='http://www.harvardrunningclub.com/wp-content/uploads/2014/05/cloud_tiny" + (i%4 + 1) + ".png' alt=''> \ </div>"); } // If there is a weather condition if (condition != "") { // Create a weather box under each cloud for displaying weather $(".cloud").each(function() { $(this).append("<div class='weather'></div>"); }); // Add the appropriate weather condition $(".weather").each(function() { var offset = Math.random() * 200 - 320; $(this).append( "<div class='condition' style='top: " + offset + "px;'> \ <img src='http://www.harvardrunningclub.com/wp-content/uploads/2014/05/" + condition + ".png'> \ </div>"); }); } // This function is called every 40ms setInterval(function() { // Update cloud movement, wrapping around the screen $("#clouds").width($("body").width()); $(".cloud").each(function() { var pos = $(this).position().left - 1; if (pos < -cloud_width || pos > maxres) pos = maxres; $(this).css("left", pos); }); // Update weather condition movement $(".condition").each(function() { var pos = $(this).position().top + 2; if (pos > 100) pos = -120; $(this).css("top", pos); }); }, 40); }); </script> </head> <body>
Koda1004/harvardrunningclub
wp-content/themes/simple and clean/header.php
PHP
gpl-2.0
2,330
<?php /* Plugin Name: Memcached Description: Memcached backend for the WP Object Cache. Version: 2.1.2 Plugin URI: http://wordpress.org/extend/plugins/memcached/ Author: Ryan Boren, Denis de Bernardy, Matt Martz, Km.Van Install this file to wp-content/object-cache.php */ function wp_cache_add($key, $data, $group = '', $expire = 0) { global $wp_object_cache; return $wp_object_cache->add($key, $data, $group, $expire); } function wp_cache_incr($key, $n = 1, $group = '') { global $wp_object_cache; return $wp_object_cache->incr($key, $n, $group); } function wp_cache_decr($key, $n = 1, $group = '') { global $wp_object_cache; return $wp_object_cache->decr($key, $n, $group); } function wp_cache_close() { global $wp_object_cache; return $wp_object_cache->close(); } function wp_cache_delete($key, $group = '') { global $wp_object_cache; return $wp_object_cache->delete($key, $group); } function wp_cache_flush() { global $wp_object_cache; return $wp_object_cache->flush(); } function wp_cache_get($key, $group = '', $force = false) { global $wp_object_cache; return $wp_object_cache->get($key, $group, $force); } function wp_cache_init() { global $wp_object_cache; $wp_object_cache = new WP_Object_Cache(); } function wp_cache_replace($key, $data, $group = '', $expire = 0) { global $wp_object_cache; return $wp_object_cache->replace($key, $data, $group, $expire); } function wp_cache_set($key, $data, $group = '', $expire = 0) { global $wp_object_cache; if ( defined('WP_INSTALLING') == false ) return $wp_object_cache->set($key, $data, $group, $expire); else return $wp_object_cache->delete($key, $group); } function wp_cache_add_global_groups( $groups ) { global $wp_object_cache; $wp_object_cache->add_global_groups($groups); } function wp_cache_add_non_persistent_groups( $groups ) { global $wp_object_cache; $wp_object_cache->add_non_persistent_groups($groups); } class WP_Object_Cache { var $global_groups = []; var $no_mc_groups = []; var $cache = []; var $mc = []; var $stats = []; var $group_ops = []; var $cache_enabled = true; var $default_expiration = 0; //29 days var $ns_key = ''; var $ns_time = ''; function add($id, $data, $group = null, $expire = 0) { if(!$group) $group = 'default'; $key = $this->key($id, $group); if ( is_object( $data ) ) $data = clone $data; if ( in_array($group, $this->no_mc_groups) ) { $this->cache[$key] = $data; return true; } elseif ( isset($this->cache[$key]) && $this->cache[$key] !== false ) { return false; } $mc =& $this->get_mc($group); if($expire === 0) $expire = $this->default_expiration; $result = $mc->add($key, $data, false, $expire); if ( false !== $result ) { @ ++$this->stats['add']; $this->group_ops[$group][] = "add $id"; $this->cache[$key] = $data; } return $result; } function add_global_groups($groups) { if ( ! is_array($groups) ) $groups = (array) $groups; $this->global_groups = array_merge($this->global_groups, $groups); $this->global_groups = array_unique($this->global_groups); } function add_non_persistent_groups($groups) { if ( ! is_array($groups) ) $groups = (array) $groups; $this->no_mc_groups = array_merge($this->no_mc_groups, $groups); $this->no_mc_groups = array_unique($this->no_mc_groups); } function incr($id, $n = 1, $group = 'default' ) { if(!$group) $group = 'default'; $key = $this->key($id, $group); $mc =& $this->get_mc($group); $this->cache[ $key ] = $mc->increment( $key, $n ); return $this->cache[ $key ]; } function decr($id, $n = 1, $group = 'default' ) { if(!$group) $group = 'default'; $key = $this->key($id, $group); $mc =& $this->get_mc($group); $this->cache[ $key ] = $mc->decrement( $key, $n ); return $this->cache[ $key ]; } function close() { foreach ( $this->mc as $bucket => $mc ) $mc->close(); } function delete($id, $group = 'default') { if(!$group) $group = 'default'; $key = $this->key($id, $group); if ( in_array($group, $this->no_mc_groups) ) { unset($this->cache[$key]); return true; } $mc =& $this->get_mc($group); $result = $mc->delete($key); @ ++$this->stats['delete']; $this->group_ops[$group][] = "delete $id"; if ( false !== $result ) unset($this->cache[$key]); return $result; } function flush() { // Don't flush if multi-blog. if ( function_exists('is_site_admin') || defined('CUSTOM_USER_TABLE') && defined('CUSTOM_USER_META_TABLE') ) return true; $ret = true; foreach ( array_keys($this->mc) as $group ){ if(strpos($group,WP_CACHE_KEY_SALT) !== false){ $mc =& $this->get_mc('default'); $this->ns_time = $_SERVER['REQUEST_TIME']; $ret = $mc->set($this->ns_key,$_SERVER['REQUEST_TIME']); //$ret &= $this->mc[$group]->flush(); return $ret; } } return $ret; } function get($id, $group = null, $force = false) { if(!$group) $group = 'default'; $key = $this->key($id, $group); $mc =& $this->get_mc($group); if ( isset($this->cache[$key]) && ( !$force || in_array($group, $this->no_mc_groups) ) ) { if ( is_object( $this->cache[$key] ) ) $value = clone $this->cache[$key]; else $value = $this->cache[$key]; } else if ( in_array($group, $this->no_mc_groups) ) { $this->cache[$key] = $value = false; } else { $value = $mc->get($key); if ( NULL === $value ){ $value = false; } $this->cache[$key] = $value; } @ ++$this->stats['get']; $this->group_ops[$group][] = "get $id"; if ( 'checkthedatabaseplease' === $value ) { unset( $this->cache[$key] ); $value = false; } return $value; } function get_multi( $groups ) { /* format: $get['group-name'] = array( 'key1', 'key2' ); */ $return = []; foreach ( $groups as $group => $ids ) { $mc =& $this->get_mc($group); foreach ( $ids as $id ) { $key = $this->key($id, $group); if ( isset($this->cache[$key]) ) { if ( is_object( $this->cache[$key] ) ) $return[$key] = clone $this->cache[$key]; else $return[$key] = $this->cache[$key]; continue; } else if ( in_array($group, $this->no_mc_groups) ) { $return[$key] = false; continue; } else { $return[$key] = $mc->get($key); } } if ( $to_get ) { $vals = $mc->get_multi( $to_get ); $return = array_merge( $return, $vals ); } } @ ++$this->stats['get_multi']; $this->group_ops[$group][] = "get_multi $id"; $this->cache = array_merge( $this->cache, $return ); return $return; } function key($key, $group) { if ( false !== array_search($group, $this->global_groups) ) $prefix = $this->global_prefix; else $prefix = $this->blog_prefix; return $this->ns_time . $prefix . $group . ':' . $key; } function replace($id, $data, $group = null, $expire = 0) { if(!$group) $group = 'default'; $key = $this->key($id, $group); if($expire === 0) $expire = $this->default_expiration; $mc =& $this->get_mc($group); if ( is_object( $data ) ) $data = clone $data; $result = $mc->replace($key, $data, false, $expire); if ( false !== $result ) $this->cache[$key] = $data; return $result; } function set($id, $data, $group = null, $expire = 0) { if(!$group) $group = 'default'; $key = $this->key($id, $group); if ( isset($this->cache[$key]) && ('checkthedatabaseplease' === $this->cache[$key]) ) return false; if ( is_object($data) ) $data = clone $data; $this->cache[$key] = $data; if ( in_array($group, $this->no_mc_groups) ) return true; if($expire === 0) $expire = $this->default_expiration; $mc =& $this->get_mc($group); $result = $mc->set($key, $data, false, $expire); return $result; } function colorize_debug_line($line) { $colors = array( 'get' => 'green', 'set' => 'purple', 'add' => 'blue', 'delete' => 'red'); $cmd = substr($line, 0, strpos($line, ' ')); $cmd2 = "<span style='color:{$colors[$cmd]}'>$cmd</span>"; return $cmd2 . substr($line, strlen($cmd)) . "\n"; } function stats() { echo "<p>\n"; foreach ( $this->stats as $stat => $n ) { echo "<strong>$stat</strong> $n"; echo "<br/>\n"; } echo "</p>\n"; echo "<h3>Memcached:</h3>"; foreach ( $this->group_ops as $group => $ops ) { if ( !isset($_GET['debug_queries']) && 500 < count($ops) ) { $ops = array_slice( $ops, 0, 500 ); echo "<big>Too many to show! <a href='" . add_query_arg( 'debug_queries', 'true' ) . "'>Show them anyway</a>.</big>\n"; } echo "<h4>$group commands</h4>"; echo "<pre>\n"; $lines = []; foreach ( $ops as $op ) { $lines[] = $this->colorize_debug_line($op); } print_r($lines); echo "</pre>\n"; } if ( $this->debug ) var_dump($this->memcache_debug); } function &get_mc($group = null) { if(!$group) $group = 'default'; $group = WP_CACHE_KEY_SALT . $group; if ( isset($this->mc[$group]) ) return $this->mc[$group]; return $this->mc[WP_CACHE_KEY_SALT . 'default']; } function failure_callback($host, $port) { die('Can not connect memcache server.'); } function __construct() { if(!class_exists('Memcache')){ die('Your server is NOT support Memcache service, please delete "wp-content/object-cache.php" and refresh page.'); } global $memcached_servers,$_wp_using_ext_object_cache; if ( !defined( 'WP_CACHE_KEY_SALT' ) ){ define( 'WP_CACHE_KEY_SALT', md5(AUTH_KEY) ); } $_wp_using_ext_object_cache = true; if ( isset($memcached_servers) ){ $buckets = $memcached_servers; }else{ $buckets = array('127.0.0.1'); } $buckets = array(WP_CACHE_KEY_SALT . 'default' => $buckets); foreach ( $buckets as $bucket => $servers) { $this->mc[$bucket] = new Memcache(); foreach ( $servers as $server ) { $node_port = explode(':', $server); $node = $node_port[0]; $port = isset($node_port[1]) ? $node_port[1] : (int)ini_get('memcache.default_port'); if ( !$port ) $port = 11211; $this->mc[$bucket]->addServer($node, $port, true, 1, 1, 15, true, array($this, 'failure_callback')); $this->mc[$bucket]->setCompressThreshold(20000, 0.2); } } global $blog_id, $table_prefix; $this->global_prefix = ''; $this->blog_prefix = ''; if ( function_exists( 'is_multisite' ) ) { $this->global_prefix = ( is_multisite() || defined('CUSTOM_USER_TABLE') && defined('CUSTOM_USER_META_TABLE') ) ? '' : $table_prefix; $this->blog_prefix = ( is_multisite() ? $blog_id : $table_prefix ) . ':'; } $this->cache_hits =& $this->stats['get']; $this->cache_misses =& $this->stats['add']; /** * set nameplace time */ $mc =& $this->get_mc('default'); $this->ns_key = 'nskey_' . WP_CACHE_KEY_SALT; $this->ns_time = $mc->get($this->ns_key); if(!$this->ns_time){ $mc->set($this->ns_key,$_SERVER['REQUEST_TIME']); $this->ns_time = $_SERVER['REQUEST_TIME']; } } }
hensonvip/zzyzan
wp-content/themes/mx/addons/cache/object-cache.php
PHP
gpl-2.0
11,422
using System; using Server.Network; using Server.Items; namespace Server.Items { [FlipableAttribute( 0x27A8, 0x27F3 )] public class Bokuto : BaseSword { public override WeaponAbility PrimaryAbility{ get{ return WeaponAbility.CrushingBlow; } } public override WeaponAbility SecondaryAbility{ get{ return WeaponAbility.ArmorIgnore; } } public override int AosStrengthReq{ get{ return 20; } } public override int AosMinDamage{ get{ return 9; } } public override int AosMaxDamage{ get{ return 11; } } public override int AosSpeed{ get{ return 53; } } public override int OldStrengthReq{ get{ return 20; } } public override int OldMinDamage{ get{ return 9; } } public override int OldMaxDamage{ get{ return 11; } } public override int OldSpeed{ get{ return 53; } } public override int DefHitSound{ get{ return 0x536; } } public override int DefMissSound{ get{ return 0x23A; } } public override int InitMinHits{ get{ return 25; } } public override int InitMaxHits{ get{ return 50; } } [Constructable] public Bokuto() : base( 0x27A8 ) { Weight = 7.0; } public Bokuto( Serial serial ) : base( serial ) { } public override void Serialize( GenericWriter writer ) { base.Serialize( writer ); writer.Write( (int) 0 ); // version } public override void Deserialize( GenericReader reader ) { base.Deserialize( reader ); /*int version = */reader.ReadInt(); } } }
brodock/sunuo
scripts/legacy/Items/Weapons/SE Weapons/Bokuto.cs
C#
gpl-2.0
1,431
// // -------------------------------------------------------------------------- // Gurux Ltd // // // // // Version: $Revision: 9806 $, // $Date: 2018-01-12 11:44:00 +0200 (pe, 12 tammi 2018) $ // $Author: gurux01 $ // // Copyright (c) Gurux Ltd // //--------------------------------------------------------------------------- // // DESCRIPTION // // This file is a part of Gurux Device Framework. // // Gurux Device Framework is Open Source software; you can redistribute it // and/or modify it under the terms of the GNU General Public License // as published by the Free Software Foundation; version 2 of the License. // Gurux Device Framework is distributed in the hope that it will be useful, // but WITHOUT ANY WARRANTY; without even the implied warranty of // MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. // See the GNU General Public License for more details. // // More information of Gurux DLMS/COSEM Director: https://www.gurux.org/GXDLMSDirector // // This code is licensed under the GNU General Public License v2. // Full text may be retrieved at http://www.gnu.org/licenses/gpl-2.0.txt //--------------------------------------------------------------------------- using System.Collections; using System.ComponentModel; namespace GXDLMSDirector { public class GXConformanceValueDescriptorCollection : PropertyDescriptorCollection { public GXConformanceValueDescriptorCollection(PropertyDescriptor[] properties) : base(properties) { } public override PropertyDescriptorCollection Sort(IComparer comparer) { GXConformanceValue customComparer = new GXConformanceValue(); return base.Sort(customComparer); } } }
Gurux/GXDLMSDirector
Development/ConformanceTests/Internal/GXConformanceValueDescriptorCollection.cs
C#
gpl-2.0
1,766
#include "stdafx.h" // // this is the path to amplugin.h and all the plugin/libs // by default all the libs, (debug/x64/x86) are copied to the /Plugins/ folder. // // If you want to copy them somewhere else // 1) Make sure that the inlcude path below is valid // 2) Make sure that the library path is valid // Project > Properties > Linker > "Aditional Library properties" // The path that was used is relative to the "Piger" project. #include "../../amplugin.h" PLUGIN_API AM_RESPONSE am_Msg(AM_MSG msg, AM_UINT wParam, AM_INT lParam) { switch (msg) { case AM_MSG_INIT: { // // the plugin manager. AmPlugin* p = (AmPlugin*)(lParam); // // get the full path of this plugin // call 'getCommand( 0, ... ) and it will return this file. WCHAR szPath[MAX_PATH]; size_t l = p->GetCommand(0, MAX_PATH, szPath); // // This is the name of the action e will call // the second param is who to call when this happens // in this case, we want Piger to call us back here. // but we could launch something else. p->AddAction(L"OnTop", szPath); } break; case AM_MSG_DEINIT: break; case AM_MSG_MAIN: { // // Our action as called! AmPlugin* p = (AmPlugin*)(lParam); // get the window HWND hWnd = (HWND)p->GetForegroundWindow(); // is it a valid handle? if (NULL != hWnd) { if (::GetWindowLong(hWnd, GWL_EXSTYLE) & WS_EX_TOPMOST) { // Revert back ::SetWindowPos(hWnd, HWND_NOTOPMOST, 0, 0, 0, 0, SWP_NOMOVE | SWP_NOSIZE); } else { // Make topmost ::SetWindowPos(hWnd, HWND_TOPMOST, 0, 0, 0, 0, SWP_NOMOVE | SWP_NOSIZE); } MessageBeep(MB_ICONINFORMATION); } else { MessageBeep(MB_ICONERROR); } } break; case AM_MSG_NAME: // get the name of this action // WPARAM is the size of the buffer. // LPARAM is the buffer, (wchar_t*) return AM_RESP_NOT_SUPPORTED; break; case AM_MSG_PATH_CMD: // this is the root path of the commands, %appdata%\myoddweb\ActionMonitor\RootCommands case AM_MSG_PATH_IN: // this is the path of actions called on Piger start up, %appdata%\myoddweb\ActionMonitor\RootCommands\__in case AM_MSG_PATH_OUT: // this is the path of actions called on Piger closing down, %appdata%\myoddweb\ActionMonitor\RootCommands\__out case AM_MSG_PATH_TMP: // this is the path ignored by piger, %appdata%\myoddweb\ActionMonitor\RootCommands\__tmp case AM_MSG_PATH_PLUGIN: // the path where the plugins are located, (also where _we_ are located). // Paths - lParam is a pointer to const wchar_t* // const wchar_t* path = (const wchar_t*)lParam return AM_RESP_NOT_SUPPORTED; break; default: break; } // not handled here. return AM_RESP_NOT_SUPPORTED; }
FFMG/myoddweb.piger
plugins/OnTop/OnTop/OnTop.cpp
C++
gpl-2.0
2,935
using System; using System.Linq; namespace BirthdayGreetings { public class BirthdayGreetingsEngine { private readonly PeopleRepository _peopleRepository; private readonly GreetingsDeliveryService _greetingsDeliverService; public BirthdayGreetingsEngine(PeopleRepository peopleRepository, GreetingsDeliveryService greetingsDeliverService) { _peopleRepository = peopleRepository; _greetingsDeliverService = greetingsDeliverService; } public void SendGreetingsToPeopleBornInThis(DateTime date) { var people = _peopleRepository.GetAll().ToList(); if (!people.Any()) return; var recipients = people.Where(p => p.Birthday.Month == date.Month && p.Birthday.Day == date.Day).ToList(); if (!recipients.Any()) return; var greetings = recipients.Select(CreateGreetingDto); _greetingsDeliverService.Deliver(greetings); } private static GreetingDto CreateGreetingDto(PersonDto p) { return new GreetingDto { Email = p.Email, Text = string.Format("Dear {0} {1}, happy birthday!", p.FirstName, p.LastName) }; } } }
PaoloLaurenti/BirthdayGreetingsKata
src/BirthdayGreetings/BirthdayGreetingsEngine.cs
C#
gpl-2.0
1,320
<script language="javascript"> function fncSubmit() { document.house.submit(); } function getLocation() { if (navigator.geolocation) { navigator.geolocation.getCurrentPosition(showPosition); } else { x.innerHTML = "Geolocation is not supported by this browser."; } } function showPosition(position) { var lat = position.coords.latitude; var lng = position.coords.longitude; $("#ygis").val (lat); $("#xgis").val (lng); } </script> <?php $pcucode = $data->GetStringData("select offid as cc from office where offid<>'0000x' limit 1"); if ($_POST['exec'] == 'true'): $sqlupdate = "update house set hid='" . $_POST['hid'] . "', hno='" . $_POST['hno'] . "', road='" . $_POST['road'] . "', telephonehouse='" . $_POST['telephonehouse'] . "', area='" . $_POST['area'] . "', communityno='" . $_POST['communityno'] . "', housechar='" . $_POST['housechar'] . "', housecharground='" . $_POST['housecharground'] . "', xgis='" . $_POST['xgis'] . "', ygis='" . $_POST['ygis'] . "', pid='" . $_POST['pid'] . "', pidvola='" . $_POST['pidvola'] . "', usernamedoc='" . $_POST['usernamedoc'] . "', pcucodeperson='" . $pcucode . "', pcucodepersonvola='" . $pcucode . "' where hcode='" . $_POST['hcode'] . "'"; $db->exec($sqlupdate); echo "<script> "; echo"alert('บันทึกเสร็จเรียบร้อยครับ')"; echo "</script> "; echo "<script>"; echo "window.location='index.php?url=" . $encode->encodeUrl('page/familyfolder/family_folder.php') . "&house_id=" .$_POST['hcode'] . "';"; echo "</script>"; endif; ?> <form name="house" id="house" method="post"> <?php $hcode = $encode->decodeUrl($_REQUEST['hcode']); $sql = "select h.pcucodeperson,h.pid,h.pcucodepersonvola,h.pidvola, h.area,h.pcucode,h.hcode,h.villcode,h.hid,h.hno,h.road, h.telephonehouse,h.communityno,h.housechar,h.housecharground, h.housepic,h.xgis,h.ygis,h.usernamedoc from house as h where h.hcode='" . $hcode . "'"; $result = $db->query($sql, PDO::FETCH_OBJ); foreach ($result as $row) { ?> <ul data-role="listview" data-theme="a" data-divider-theme="a" data-inset="true" > <li data-role='list-divider'><h4>แก้ไขรายละเอียดบ้าน</h4></li> <input type="hidden" name="exec" value="true"> <input type="hidden" name="hcode" value="<?= $hcode ?>"> <li> <div class="ui-field-contain"> <label for="hid">รหัสทะเบียนบ้าน :</label> <input type="text" data-mini="true" name="hid" id="hid" value="<?= $row->hid; ?>" placeholder="รหัสทะเบียนบ้าน"> </div> <div class="ui-field-contain"> <label for="hno">บ้านเลขที่ :</label> <input type="text" data-mini="true" name="hno" id="hno" value="<?= $row->hno; ?>" placeholder="บ้านเลขที่"> </div> <div class="ui-field-contain"> <label for="road">ถนน :</label> <input type="text" data-mini="true" name="road" id="road" value="<?= $row->road; ?>" placeholder="ถนน"> </div> <div class="ui-field-contain"> <label for="telephonehouse">เบอร์โทรศัพท์ :</label> <input type="text" data-mini="true" name="telephonehouse" id="telephonehouse" value="<?= $row->telephonehouse; ?>" placeholder="เบอร์โทรศัพท์"> </div> <div class="ui-field-contain"> <label for="area">เขตที่ตั้ง :</label> <select name="area" id="area" data-native-menu="false" data-mini="true" class="filterable-select"> <option value="<?= $row->area ?>"><?php if ($row->area == 1):echo"อบต."; else:echo"เทศบาล"; endif; ?></option> <option value="1">อบต.</option> <option value="2">เทศบาล</option> </select> </div> <div class="ui-field-contain"> <label for="communityno">ลำดับที่ของชุมชน :</label> <input type="text" data-mini="true" name="communityno" id="communityno" value="<?= $row->communityno; ?>" placeholder="ลำดับที่ของชุมชน"> </div> <div class="ui-field-contain"> <label for="housechar">ลักษณะที่ตั้งของบ้าน :</label> <select name="housechar" id="housechar" data-native-menu="false" data-mini="true" class="filterable-select"> <option value="<?= $row->housechar; ?>"><?= $data->GetStringData("select housechar_name as cc from chousechar where housechar='" . $row->housechar . "'"); ?></option> <?php $sqlhc = "select * from chousechar"; $hc = $db->query($sqlhc, PDO::FETCH_OBJ); foreach ($hc as $h) { ?> <option value="<?= $h->housechar ?>"><?= $h->housechar_name ?></option> <?php } ?> </select> </div> <div class="ui-field-contain"> <label for="housecharground">ลักษณะพื้นที่ของบ้าน :</label> <input type="text" data-mini="true" name="housecharground" id="housecharground" value="<?= $row->housecharground; ?>" placeholder="ลักษณะพื้นที่ที่ตั้งของบ้าน"> </div> <div class="ui-field-contain"> <label for="ygis">ละติจูด :</label> <input type="text" data-mini="true" name="ygis" id="ygis" value="<?= $row->ygis; ?>" placeholder="ละติจูด"> </div> <div class="ui-field-contain"> <label for="xgis">ลองจิจูด :</label> <input type="text" data-mini="true" name="xgis" id="xgis" value="<?= $row->xgis; ?>" placeholder="ลองจิจูด"> </div> <div class="ui-field-contain"> <label>ระบุพิกัดอัตโนมัติ:</label> <a href="#" class="ui-btn ui-mini ui-btn-f ui-icon-location ui-btn-icon-left" onclick="getLocation()">GPS</a> </div> <div class="ui-field-contain"> <label for="pid">หัวหน้าครอบครัว :</label> <select name="pid" id="pid" data-native-menu="false" data-mini="true"> <option value="<?= $row->pid; ?>"><?= $data->GetStringData("select concat(t.titlename,p.fname,' ',p.lname) as cc from ctitle t, person p where t.titlecode=p.prename and p.pid='" . $row->pid . "'"); ?></option> <?php $sqlpid = "SELECT p.pid, concat(t.titlename,p.fname,' ',p.lname) as ptname from ctitle t, person p where t.titlecode=p.prename and p.hcode='" . $hcode . "' order by p.birth"; $rpid = $db->query($sqlpid, PDO::FETCH_OBJ); foreach ($rpid as $p) { ?> <option value="<?= $p->pid ?>"><?= $p->ptname ?></option> <?php } ?> </select> </div> <div class="ui-field-contain"> <label for="pidvola">อสม. :</label> <select name="pidvola" data-native-menu="true" data-mini="true"> <option value="<?= $row->pidvola; ?>"><?= $data->GetStringData("select concat(t.titlename,p.fname,' ',p.lname) as cc from ctitle t, person p where t.titlecode=p.prename and p.pid='" . $row->pidvola . "'"); ?></option> <?php $sqlpidvo = "select p.pid,concat(t.titlename,p.fname,' ',p.lname) as ptname from person p, persontype pt, ctitle t,house h where t.titlecode=p.prename and pt.typecode='09' and p.pid=pt.pid and h.hcode=p.hcode and p.pcucodeperson=h.pcucode and h.villcode='" . $row->villcode . "'"; $rpidvo = $db->query($sqlpidvo, PDO::FETCH_OBJ); foreach ($rpidvo as $pvo) { ?> <option value="<?= $pvo->pid ?>"><?= $pvo->ptname ?></option> <?php } ?> </select> </div> <div class="ui-field-contain"> <label for="usernamedoc">จนท.สธ :</label> <select name="usernamedoc" data-native-menu="true" data-mini="true"> <option value="<?= $row->usernamedoc; ?>"><?= $data->GetStringData("select concat(fname,' ',lname) as cc from user where username='" . $row->usernamedoc . "'"); ?></option> <?php $sqldoc = "SELECT u.username,concat(fname,' ',lname) as dname from user u where u.markdelete is null and u.fname is not null "; $doc = $db->query($sqldoc, PDO::FETCH_OBJ); foreach ($doc as $d) { ?> <option value="<?= $d->username ?>"><?= $d->dname ?></option> <?php } ?> </select> </div> </li> </ul> <?php } ?> <div data-role="footer" data-position="fixed" data-theme="d"> <div data-role="navbar"> <ul> <li> <a href="#menu" data-inline="true" data-mini="true" data-icon="check" onclick="fncSubmit();" > บันทึก </a> </li> </ul> </div> </div> </form>
kukks205/jhhc
page/familyfolder/house_edt.php
PHP
gpl-2.0
10,864
/* Smooth scrolling Changes links that link to other parts of this page to scroll smoothly to those links rather than jump to them directly, which can be a little disorienting. sil, http://www.kryogenix.org/ v1.0 2003-11-11 v1.1 2005-06-16 wrap it up in an object */ var ss = { fixAllLinks: function() { // Get a list of all links in the page var allLinks = document.getElementsByTagName('a'); // Walk through the list for (var i=0;i<allLinks.length;i++) { var lnk = allLinks[i]; if ((lnk.href && lnk.href.indexOf('#') != -1) && ( (lnk.pathname == location.pathname) || ('/'+lnk.pathname == location.pathname) ) && (lnk.search == location.search)) { // If the link is internal to the page (begins in #) // then attach the smoothScroll function as an onclick // event handler ss.addEvent(lnk,'click',ss.smoothScroll); } } }, smoothScroll: function(e) { // This is an event handler; get the clicked on element, // in a cross-browser fashion if (window.event) { target = window.event.srcElement; } else if (e) { target = e.target; } else return; // Make sure that the target is an element, not a text node // within an element if (target.nodeName.toLowerCase() != 'a') { target = target.parentNode; } // Paranoia; check this is an A tag if (target.nodeName.toLowerCase() != 'a') return; // Find the <a name> tag corresponding to this href // First strip off the hash (first character) anchor = target.hash.substr(1); // Now loop all A tags until we find one with that name var allLinks = document.getElementsByTagName('a'); var destinationLink = null; for (var i=0;i<allLinks.length;i++) { var lnk = allLinks[i]; if (lnk.name && (lnk.name == anchor)) { destinationLink = lnk; break; } } if (!destinationLink) destinationLink = document.getElementById(anchor); // If we didn't find a destination, give up and let the browser do // its thing if (!destinationLink) return true; // Find the destination's position var destx = destinationLink.offsetLeft; var desty = destinationLink.offsetTop; var thisNode = destinationLink; while (thisNode.offsetParent && (thisNode.offsetParent != document.body)) { thisNode = thisNode.offsetParent; destx += thisNode.offsetLeft; desty += thisNode.offsetTop; } // Stop any current scrolling clearInterval(ss.INTERVAL); cypos = ss.getCurrentYPos(); ss_stepsize = parseInt((desty-cypos)/ss.STEPS); ss.INTERVAL = setInterval('ss.scrollWindow('+ss_stepsize+','+desty+',"'+anchor+'")',10); // And stop the actual click happening if (window.event) { window.event.cancelBubble = true; window.event.returnValue = false; } if (e && e.preventDefault && e.stopPropagation) { e.preventDefault(); e.stopPropagation(); } }, scrollWindow: function(scramount,dest,anchor) { wascypos = ss.getCurrentYPos(); isAbove = (wascypos < dest); window.scrollTo(0,wascypos + scramount); iscypos = ss.getCurrentYPos(); isAboveNow = (iscypos < dest); if ((isAbove != isAboveNow) || (wascypos == iscypos)) { // if we've just scrolled past the destination, or // we haven't moved from the last scroll (i.e., we're at the // bottom of the page) then scroll exactly to the link window.scrollTo(0,dest); // cancel the repeating timer clearInterval(ss.INTERVAL); // and jump to the link directly so the URL's right location.hash = anchor; } }, getCurrentYPos: function() { if (document.body && document.body.scrollTop) return document.body.scrollTop; if (document.documentElement && document.documentElement.scrollTop) return document.documentElement.scrollTop; if (window.pageYOffset) return window.pageYOffset; return 0; }, addEvent: function(elm, evType, fn, useCapture) { // addEvent and removeEvent // cross-browser event handling for IE5+, NS6 and Mozilla // By Scott Andrew if (elm.addEventListener){ elm.addEventListener(evType, fn, useCapture); return true; } else if (elm.attachEvent){ var r = elm.attachEvent("on"+evType, fn); return r; } else { alert("Handler could not be removed"); } } } ss.STEPS = 20; ss.addEvent(window,"load",ss.fixAllLinks);
tatematsu/tatematsu
common/js/scroll.js
JavaScript
gpl-2.0
4,557
# This file is part of BurnMan - a thermoelastic and thermodynamic toolkit for # the Earth and Planetary Sciences # Copyright (C) 2012 - 2022 by the BurnMan team, released under the GNU # GPL v2 or later. """ example_fit_solution -------------------- This example demonstrates how to fit parameters for solution models using a range of compositionally-variable experimental data. The example in this file deals with finding optimized parameters for the forsterite-fayalite binary using a mixture of volume and seismic velocity data. teaches: - least squares fitting for solution data """ import numpy as np import matplotlib.pyplot as plt from numpy import random import burnman from burnman.utils.misc import pretty_print_values from burnman.optimize.eos_fitting import fit_XPTp_data from burnman.optimize.nonlinear_fitting import plot_residuals, extreme_values from burnman.optimize.nonlinear_fitting import corner_plot from burnman.optimize.nonlinear_fitting import weighted_residual_plot if __name__ == "__main__": # Set np.array printing precision to be low # (for more readable covariance matrices) np.set_printoptions(precision=1) # First, let's create a solution to optimise. # In this case, we choose a solution model that exists in # the BurnMan repository; the Mg-Fe olivine from # the Stixrude and Lithgow-Bertelloni dataset solution = burnman.minerals.SLB_2011.mg_fe_olivine() solution.set_state(1.e5, 300.) print('Names of endmembers in the olivine solution:') print(solution.endmember_names) print('') # Fit parameters are provided via a list of lists. # The first element of each list is a string that corresponds # either to one of the keys in an endmember parameter dictionary, # or to an excess property for a binary join in the solution. # The next parameters correspond to the indices of the endmembers # to which the parameter corresponds. # Here, we choose to fit he standard state volume, isothermal # bulk modulus and its first derivative for both endmembers. # Endmember 0 is forsterite, and Endmember 1 is fayalite. # We also choose to fit the excess volume on the binary join. fit_params = [['V_0', 0], ['V_0', 1], ['K_0', 0], ['K_0', 1], ['Kprime_0', 0], ['Kprime_0', 1], ['G_0', 0], ['G_0', 1], ['V', 0, 1]] # Next, we make some synthetic data n_data = 100 data = [] data_covariances = [] flags = [] # For this example, we add some Gaussian noise # to the volumes of olivines on the binary between # 0-10 GPa and 300-1300 K. # Here 1 standard deviation is set as 0.1% of the # volume at P and T f_Verror = 1.e-3 # Choose a specific seed for the random number generator # so that this example is reproducible. random.seed(10) for i in range(n_data): x_fa = random.random() P = random.random() * 1.e10 T = random.random() * 1000. + 300. X = [1.-x_fa, x_fa] solution.set_composition(X) solution.set_state(P, T) f = (1. + (random.normal() - 0.5)*f_Verror) V = solution.V * f data.append([1.-x_fa, x_fa, P, T, V]) data_covariances.append(np.zeros((5, 5))) data_covariances[-1][4, 4] = np.power(solution.V*f_Verror, 2.) flags.append('V') # Here, we add one awful data point in the middle of the domain # We do this to demonstrate the semi-automatic removal of bad data # using extreme value theory. solution.set_composition([0.5, 0.5]) solution.set_state(5.e9, 800.) data.append([0.5, 0.5, 5.e9, 800., solution.V + 3.e-7]) data_covariances.append(np.zeros((5, 5))) data_covariances[-1][4, 4] = np.power(solution.V*f_Verror, 2.) flags.append('V') # Now create some velocity data, again adding # some Gaussian noise. # Here 1 standard deviation is set as 1% of the # P wave velocity at P and T n_data = 20 f_Vperror = 1.e-2 for i in range(n_data): x_fa = random.random() P = random.random() * 1.e10 T = random.random() * 1000. + 300. X = [1.-x_fa, x_fa] solution.set_composition(X) solution.set_state(P, T) f = (1. + (random.normal() - 0.5)*f_Vperror) Vp = solution.p_wave_velocity * f data.append([1.-x_fa, x_fa, P, T, Vp]) data_covariances.append(np.zeros((5, 5))) data_covariances[-1][4, 4] = np.power(solution.p_wave_velocity * f_Vperror, 2.) flags.append('p_wave_velocity') data = np.array(data) data_covariances = np.array(data_covariances) flags = np.array(flags) # Here are some (optional) initial step sizes for the optimizer. delta_params = np.array([1.e-8, 1.e-8, 1.e7, 1.e7, 1.e-1, 1.e-1, 1.e-1, 1.e-1, 1.e-8]) # And some bounds. For this example the bounds are not necessary, # but if the data is somewhat shaky it can be useful to provide some # guidance for the least squares minimizer. bounds = np.array([[0, np.inf], [0, np.inf], [0, np.inf], [0, np.inf], [3.5, 6.], [3.5, 6.], [0, np.inf], [0, np.inf], [-np.inf, np.inf]]) param_tolerance = 1.e-5 # Finally, some post-processing options confidence_interval = 0.95 remove_outliers = True good_data_confidence_interval = 0.99 properties_for_data_comparison_plots = [('V', 1.e6, 'Volume (cm^3/mol)'), ('p_wave_velocity', 1.e-3, '$V_P$ (km/s)')] # The following line fits the parameters to the data we defined above. print('Starting to fit user-defined data. Please be patient.') fitted_eos = fit_XPTp_data(solution=solution, flags=flags, fit_params=fit_params, data=data, data_covariances=data_covariances, delta_params=delta_params, bounds=bounds, param_tolerance=param_tolerance, verbose=False) # Print the optimized parameters print('Optimized equation of state:') pretty_print_values(fitted_eos.popt, fitted_eos.pcov, fitted_eos.fit_params_strings) print('\nParameters:') print(fitted_eos.popt) print('\nFull covariance matrix:') print(fitted_eos.pcov) print('\nGoodness of fit:') print(fitted_eos.goodness_of_fit) print('\n') # Create a plot of the residuals fig, ax = plt.subplots() plot_residuals(ax=ax, weighted_residuals=fitted_eos.weighted_residuals, flags=fitted_eos.flags) plt.show() val_extreme = extreme_values(fitted_eos.weighted_residuals, good_data_confidence_interval) confidence_bound, indices, probabilities = val_extreme if indices != [] and remove_outliers is True: print(f'Removing {len(indices):d} outliers' f' (at the {good_data_confidence_interval*100.:.1f}% ' 'confidence interval) and refitting. ' 'Please wait just a little longer.') mask = [i for i in range(len(fitted_eos.weighted_residuals)) if i not in indices] data = data[mask] flags = flags[mask] data_covariances = data_covariances[mask] fitted_eos = fit_XPTp_data(solution=solution, flags=flags, fit_params=fit_params, data=data, data_covariances=data_covariances, param_tolerance=param_tolerance, verbose=False) # Print the optimized parameters print('Optimized equation of state:') pretty_print_values(fitted_eos.popt, fitted_eos.pcov, fitted_eos.fit_params_strings) print('\nParameters:') print(fitted_eos.popt) print('\nFull covariance matrix:') print(fitted_eos.pcov) print('\nGoodness of fit:') print(fitted_eos.goodness_of_fit) print('\n') # Create a plot of the residuals fig, ax = plt.subplots() plot_residuals(ax=ax, weighted_residuals=fitted_eos.weighted_residuals, flags=fitted_eos.flags) plt.show() # Create a corner plot of the covariances fig, ax_array = corner_plot(popt=fitted_eos.popt, pcov=fitted_eos.pcov, param_names=fitted_eos.fit_params_strings) plt.show() # Create plots for the weighted residuals of each type of measurement enum_prps = enumerate(properties_for_data_comparison_plots) for i, (material_property, scaling, name) in enum_prps: fig, ax = plt.subplots() weighted_residual_plot(ax=ax, model=fitted_eos, flag=material_property, sd_limit=3, cmap=plt.cm.RdYlBu, plot_axes=[2, 3], scale_axes=[1.e-9, 1.]) ax.set_title(f'Weighted residual plot for {name:s}') ax.set_xlabel('Pressure (GPa)') ax.set_ylabel('Temperature (K)') plt.show()
geodynamics/burnman
examples/example_fit_solution.py
Python
gpl-2.0
9,817
/* Control over an attribute of a line Copyright (C) 2005 Free Software Foundation, Inc. This file is part of GNU Classpath. GNU Classpath is free software; you can redistribute it and/or modify it under the terms of the GNU General Public License as published by the Free Software Foundation; either version 2, or (at your option) any later version. GNU Classpath is distributed in the hope that it will be useful, but WITHOUT ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License for more details. You should have received a copy of the GNU General Public License along with GNU Classpath; see the file COPYING. If not, write to the Free Software Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA. Linking this library statically or dynamically with other modules is making a combined work based on this library. Thus, the terms and conditions of the GNU General Public License cover the whole combination. As a special exception, the copyright holders of this library give you permission to link this library with independent modules to produce an executable, regardless of the license terms of these independent modules, and to copy and distribute the resulting executable under terms of your choice, provided that you also meet, for each linked independent module, the terms and conditions of the license of that module. An independent module is a module which is not derived from or based on this library. If you modify this library, you may extend this exception to your version of the library, but you are not obligated to do so. If you do not wish to do so, delete this exception statement from your version. */ package ddf.minim.javax.sound.sampled; /** * A control provides the ability to affect some attribute of a line, for * instance its volume. * * @since 1.3 */ public abstract class Control { /** * This describes a single control. * * @since 1.3 */ public static class Type { private String name; /** * Create a new Type given its name. * * @param name * the name of the type */ protected Type(String name) { this.name = name; } public final boolean equals(Object o) { return super.equals(o); } public final int hashCode() { return super.hashCode(); } /** * Return the name of this Type. */ public final String toString() { return name; } } private Type type; /** * Create a new Control given its Type. * * @param type * the type */ protected Control(Type type) { this.type = type; } /** * Return the Type of this Control. */ public Type getType() { return type; } /** * Return a String descrsibing this control. In particular the value will * include the name of the associated Type. */ public String toString() { return type.toString(); } }
DASAR/Minim-Android
src/ddf/minim/javax/sound/sampled/Control.java
Java
gpl-2.0
3,000
<?php // The Query $args = array( 'post_type'=> 'pizza', 'cat' => 2, 'p' => 50 ); $the_query = new WP_Query( $args); // The Loop if ( $the_query->have_posts() ) { while ( $the_query->have_posts() ) { $the_query->the_post(); $theme_options = ifne( $GLOBALS, 'theme_options', array() ); $page_fields = get_fields(); // Content goes here ?> <a href="#"><?php the_title(); ?></a> <div class="menu-item"> <div class="fb-like" data-href="http://herospizza.com.au" data-send="false" data-layout="button_count" data-width="100" data-show-faces="false"></div> <?php $image = ifne( $page_fields, 'pizza_banner' ); ?> <img src="<?php echo $image['url']; ?>" alt="<?php the_title(); ?>" class="pizza-banner" /> <?php $image = ifne( $page_fields, 'pizza_thumbnail' ); ?> <div class="pizza-thumb-wrap" style="background-image: url(<?php echo $image['url'];?>)"> <span class="price-overlay"></span> <span class="price"><?php echo ifne( $page_fields, 'price' ); ?></span> </div><!-- .pizza-thumb-wrap --> <div class="menu-content"> <h3 class="menu-title"><?php the_title(); ?> (<?php echo ifne( $page_fields, 'alternate' ); ?>)</h3> <p><?php the_content(); ?></p> <h5>Ingredients:</h5> <p><?php echo ifne( $page_fields, 'ingredients' ); ?></p> </div><!-- .menu-content --> <table> <thead> <tr> <td width="14%">Energy /100g</td> <td width="14%">Calories /100g</td> <td width="14%">Protein /100g</td> <td width="14%">Fat total /100g</td> <td width="14%">Fat sat /100g</td> <td width="14%">Carbs /100g</td> <td width="14%">Sodium /100g</td> </tr> </thead> <tbody> <tr> <td width="14%"><?php echo ifne( $page_fields, 'energy' ); ?></td> <td width="14%"><?php echo ifne( $page_fields, 'calories' ); ?></td> <td width="14%"><?php echo ifne( $page_fields, 'protein' ); ?></td> <td width="14%"><?php echo ifne( $page_fields, 'fat_total' ); ?></td> <td width="14%"><?php echo ifne( $page_fields, 'fat_sat' ); ?></td> <td width="14%"><?php echo ifne( $page_fields, 'carbs' ); ?></td> <td width="14%"><?php echo ifne( $page_fields, 'sodium' ); ?></td> </tr> </tbody> </table> </div><!-- .menu-item --> <?php } } /* Restore original Post Data */ wp_reset_postdata(); ?>
guardiancomics/Heros-Pizza
wp-content/themes/herospizza/parts/pizzas/sides_superhumanSpinach.php
PHP
gpl-2.0
2,274
using System; using Newtonsoft.Json; namespace Ombi.Settings.Settings.Models.Notifications { public class DiscordNotificationSettings : Settings { public bool Enabled { get; set; } public string WebhookUrl { get; set; } public string Username { get; set; } public string Icon { get; set; } public bool HideUser { get; set; } [JsonIgnore] public string WebHookId => SplitWebUrl(4); [JsonIgnore] public string Token => SplitWebUrl(5); private string SplitWebUrl(int index) { if (!WebhookUrl.StartsWith("http", StringComparison.CurrentCulture)) { WebhookUrl = "https://" + WebhookUrl; } var split = WebhookUrl.Split(new[] { '/' }, StringSplitOptions.RemoveEmptyEntries); return split.Length < index ? string.Empty : split[index]; } } }
tidusjar/Ombi
src/Ombi.Settings/Settings/Models/Notifications/DiscordNotificationSettings.cs
C#
gpl-2.0
956
<?php /** * Openinghtml Module class file * * @category Markup * @package Xiphe\HTML * @author Hannes Diercks <xiphe@gmx.de> * @license http://www.gnu.org/licenses/gpl-2.0.txt GNU GENERAL PUBLIC LICENSE * @link https://github.com/Xiphe/-HTML/blob/master/modules/Openinghtml.php */ namespace Xiphe\HTML\modules; use Xiphe\HTML\core as Core; /** * Openinghtml Module class * * @category Markup * @package Xiphe\HTML * @author Hannes Diercks <xiphe@gmx.de> * @license http://www.gnu.org/licenses/gpl-2.0.txt GNU GENERAL PUBLIC LICENSE * @link https://github.com/Xiphe/-HTML */ class Openinghtml extends Core\BasicModule implements Core\ModuleInterface { /** * Module Logic * * @return void */ public function execute() { $this->htmlattrs = array('class' => 'no-js'.$this->ieClass(' ').$this->browserClass(' ')); $this->headattrs = array(); if ($this->called == 'xhtml') { $this->xhtml(); } else { $this->html5(); } } /** * Generate a XHTML header. * * @return void */ public function xhtml() { $this->htmlattrs['xmlns'] = 'http://www.w3.org/1999/xhtml'; echo '<?xml version="1.0" ?>'; Core\Generator::lineBreak(); echo '<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN"'; Core\Generator::lineBreak(); Core\Config::set('tabs', '++'); Core\Generator::tabs(); echo '"http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd">'; Core\Generator::lineBreak(); Core\Config::set('tabs', '--'); echo $this->getHtml(); echo $this->getHead(); } /** * Generate a HTML5 header. * * @return void */ public function html5() { echo '<!DOCTYPE HTML>'; Core\Generator::lineBreak(); echo $this->getHtml(); echo $this->getHead(); \Xiphe\HTML::get()->utf8() ->meta('http-equiv=X-UA-Compatible|content=IE\=edge,chrome\=1'); } /** * Returns the actual html tag. * * @return Tag */ public function getHtml() { $html = new Core\Tag( 'html', array((isset($this->args[1]) ? $this->args[1] : null)), array('generate', 'start') ); $html->setAttrs($this->htmlattrs); return $html; } /** * Returns the head tag. * * @return Tag */ public function getHead() { $head = new Core\Tag( 'head', array((isset($this->args[0]) ? $this->args[0] : null)), array('generate', 'start') ); $head->setAttrs($this->headattrs); return $head; } /** * Checks if \Xiphe\THETOOLS exists and append ie classes. * * @param string $before separator. * * @return string */ public function ieClass($before = '') { $sIeClass = ''; if (class_exists('Xiphe\THEMASTER\core\THEMASTER')) { if (\Xiphe\THETOOLS::is_browser('ie')) { if (\Xiphe\THETOOLS::is_browser('ie6x')) { $sIeClass = $before.'lt-ie10 lt-ie9 lt-ie8 lt-ie7'; } elseif (\Xiphe\THETOOLS::is_browser('ie7x')) { $sIeClass = $before.'lt-ie10 lt-ie9 lt-ie8'; } elseif (\Xiphe\THETOOLS::is_browser('ie8x')) { $sIeClass = $before.'lt-ie10 lt-ie9'; } elseif (\Xiphe\THETOOLS::is_browser('ie9x')) { $sIeClass = $before.'lt-ie10'; } } } return $sIeClass; } /** * Checks if \Xiphe\THETOOLS exists and appends browser classes. * * @param string $before separator. * * @return string */ public function browserClass($before = '') { if (class_exists('Xiphe\THEMASTER\core\THEMASTER')) { $browser = str_replace(' ', '_', strtolower(\Xiphe\THETOOLS::get_browser())); $version = str_replace('.', '-', \Xiphe\THETOOLS::get_browserVersion()); $engine = strtolower(\Xiphe\THETOOLS::get_layoutEngine()); if (!empty($engine)) { $engine .=' '; } return "$before$engine$browser $browser-$version"; } return ''; } }
Xiphe/DropboxConflictMerger
src/Xiphe/HTML/modules/Openinghtml.php
PHP
gpl-2.0
4,576
/* Kopete Oscar Protocol connection.cpp - independent protocol encapsulation Copyright (c) 2004-2005 by Matt Rogers <mattr@kde.org> Based on code Copyright (c) 2004 SuSE Linux AG <http://www.suse.com> Based on Iris, Copyright (C) 2003 Justin Karneges Kopete (c) 2002-2005 by the Kopete developers <kopete-devel@kde.org> ************************************************************************* * * * This library is free software; you can redistribute it and/or * * modify it under the terms of the GNU Lesser General Public * * License as published by the Free Software Foundation; either * * version 2 of the License, or (at your option) any later version. * * * ************************************************************************* */ #include "connection.h" #include "client.h" #include "connector.h" #include "oscarclientstream.h" #include "rateclassmanager.h" #include "task.h" #include "transfer.h" #include <kapplication.h> #include <kdebug.h> #include "oscartypeclasses.h" const Oscar::WORD StarSequences[] = { 5695, 23595, 23620, 23049, 0x2886, 0x2493, 23620, 23049, 2853, 17372, 1255, 1796, 1657, 13606, 1930, 23918, 31234, 30120, 0x1BEA, 0x5342, 0x30CC, 0x2294, 0x5697, 0x25FA, 0x3C26, 0x3303, 0x078A, 0x0FC5, 0x25D6, 0x26EE,0x7570, 0x7F33, 0x4E94, 0x07C9, 0x7339, 0x42A8 //0x39B1, 0x1F07 }; class ConnectionPrivate { public: DWORD snacSequence; WORD flapSequence; QValueList<int> familyList; RateClassManager* rateClassManager; ClientStream* clientStream; Connector* connector; Client* client; Task* root; }; Connection::Connection( Connector* connector, ClientStream* cs, const char* name ) : QObject( 0, name ) { d = new ConnectionPrivate(); d->clientStream = cs; d->client = 0; d->connector = connector; d->rateClassManager = new RateClassManager( this ); d->root = new Task( this, true /* isRoot */ ); m_loggedIn = false; initSequence(); } Connection::~Connection() { delete d->rateClassManager; delete d->clientStream; delete d->connector; delete d->root; delete d; } void Connection::setClient( Client* c ) { d->client = c; connect( c, SIGNAL( loggedIn() ), this, SLOT( loggedIn() ) ); } void Connection::connectToServer( const QString& host, bool auth ) { connect( d->clientStream, SIGNAL( error( int ) ), this, SLOT( streamSocketError( int ) ) ); connect( d->clientStream, SIGNAL( readyRead() ), this, SLOT( streamReadyRead() ) ); connect( d->clientStream, SIGNAL( connected() ), this, SIGNAL( connected() ) ); d->clientStream->connectToServer( host, auth ); } void Connection::close() { d->clientStream->close(); reset(); } bool Connection::isSupported( int family ) const { return ( d->familyList.findIndex( family ) != -1 ); } QValueList<int> Connection::supportedFamilies() const { return d->familyList; } void Connection::addToSupportedFamilies( const QValueList<int>& familyList ) { d->familyList += familyList; } void Connection::addToSupportedFamilies( int family ) { d->familyList.append( family ); } void Connection::taskError( const Oscar::SNAC& s, int errCode ) { d->client->notifyTaskError( s, errCode, false /*fatal*/ ); } void Connection::fatalTaskError( const Oscar::SNAC& s, int errCode ) { d->client->notifyTaskError( s, errCode, true /* fatal */ ); } Oscar::Settings* Connection::settings() const { return d->client->clientSettings(); } Q_UINT16 Connection::flapSequence() { d->flapSequence++; if ( d->flapSequence >= 0x8000 ) //the max flap sequence is 0x8000 ( HEX ) d->flapSequence = 1; return d->flapSequence; } Q_UINT32 Connection::snacSequence() { d->snacSequence++; return d->snacSequence; } QString Connection::userId() const { return d->client->userId(); } QString Connection::password() const { return d->client->password(); } bool Connection::isIcq() const { return d->client->isIcq(); } Task* Connection::rootTask() const { return d->root; } SSIManager* Connection::ssiManager() const { return d->client->ssiManager(); } const Oscar::ClientVersion* Connection::version() const { return d->client->version(); } bool Connection::isLoggedIn() const { return m_loggedIn; } RateClassManager* Connection::rateManager() const { return d->rateClassManager; } void Connection::send( Transfer* request ) const { if( !d->clientStream ) { kdDebug(OSCAR_RAW_DEBUG) << k_funcinfo << "No stream to write on!" << endl; return; } d->rateClassManager->queue( request ); } void Connection::forcedSend( Transfer* request ) const { if ( !d->clientStream ) { kdDebug(OSCAR_RAW_DEBUG) << k_funcinfo << "No stream to write on" << endl; return; } d->clientStream->write( request ); } void Connection::initSequence() { d->snacSequence = ( KApplication::random() & 0xFFFF ); int startSequencesIndex = KApplication::random() % ((sizeof StarSequences) / (sizeof StarSequences[0])); d->flapSequence = StarSequences[startSequencesIndex] - 1; } void Connection::distribute( Transfer * transfer ) const { //d->rateClassManager->recalcRateLevels(); if( !rootTask()->take( transfer ) ) kdDebug(OSCAR_RAW_DEBUG) << k_funcinfo << "root task refused transfer" << endl; delete transfer; } void Connection::reset() { //clear the family list d->familyList.clear(); d->rateClassManager->reset(); } void Connection::streamReadyRead() { // take the incoming transfer and distribute it to the task tree Transfer * transfer = d->clientStream->read(); distribute( transfer ); } void Connection::loggedIn() { m_loggedIn = true; } void Connection::streamSocketError( int code ) { emit socketError( code, d->clientStream->errorText() ); } #include "connection.moc" //kate: tab-width 4; indent-mode csands;
iegor/kdenetwork
kopete/protocols/oscar/liboscar/connection.cpp
C++
gpl-2.0
5,832
package Arboles; /** * Esta clase crea una lista y Nodos * * @author Christian A. Rodriguez * @version 1.0 * @since 25octubre2015 */ public class Funciones { Mensajes mensajes = new Mensajes(); Nodo raiz; int cantidad = 0; int altura = 0; Nodo izquierda, derecha; public Funciones() { raiz = null; } /** * Método permite crear la lista desde el inicio ingresado cada nodo por * parte de la clase Estudiante * * @param dato Numero */ public void adicionarNodoArbol(int dato) { Nodo nuevo; nuevo = new Nodo(); nuevo.dato = dato; nuevo.izquierda = null; nuevo.derecha = null; if (raiz == null) { raiz = nuevo; } else { Nodo anterior = null, nodo; nodo = raiz; while (nodo != null) { anterior = nodo; if (dato < nodo.dato) { nodo = nodo.izquierda; } else { nodo = nodo.derecha; } } if (dato < anterior.dato) { anterior.izquierda = nuevo; } else { anterior.derecha = nuevo; } } } private void imprimirPre(Nodo nodo) { if (nodo != null) { System.out.print(nodo.dato + " "); mensajes.mostrarInformacion(nodo.dato + " "); imprimirPre(nodo.izquierda); imprimirPre(nodo.derecha); } } public void imprimirPre() { imprimirPre(raiz); System.out.println(); } private void imprimirEntre(Nodo nodo) { if (nodo != null) { imprimirEntre(nodo.izquierda); System.out.print(nodo.dato + " "); mensajes.mostrarInformacion(nodo.dato + " "); imprimirEntre(nodo.derecha); } } public void imprimirEntre() { imprimirEntre(raiz); System.out.println(); } private void imprimirPost(Nodo nodo) { if (nodo != null) { imprimirPost(nodo.izquierda); imprimirPost(nodo.derecha); System.out.print(nodo.dato + " "); mensajes.mostrarInformacion(nodo.dato + " "); } } public void imprimirPost() { imprimirPost(raiz); System.out.println(); } public void cantidad(Nodo reco) { if (reco != null) { cantidad++; cantidad(reco.izquierda); cantidad(reco.derecha); } } public int cantidad() { cantidad = 0; cantidad(raiz); return cantidad; } private void cantidadNodosHoja(Nodo reco) { if (reco != null) { if (reco.izquierda == null && reco.derecha == null) { cantidad++; } cantidadNodosHoja(reco.izquierda); cantidadNodosHoja(reco.derecha); } } public int cantidadNodosHoja() { cantidad = 0; cantidadNodosHoja(raiz); return cantidad; } private void imprimirEntreConNivel(Nodo reco, int nivel) { if (reco != null) { imprimirEntreConNivel(reco.izquierda, nivel + 1); System.out.print(reco.dato + " (" + nivel + ") - "); imprimirEntreConNivel(reco.derecha, nivel + 1); } } public void imprimirEntreConNivel() { imprimirEntreConNivel(raiz, 1); System.out.println(); } private void retornarAltura(Nodo reco, int nivel) { if (reco != null) { retornarAltura(reco.izquierda, nivel + 1); if (nivel > altura) { altura = nivel; } retornarAltura(reco.derecha, nivel + 1); } } public int retornarAltura() { altura = 0; retornarAltura(raiz, 1); return altura; } public void mayorValor() { if (raiz != null) { Nodo reco = raiz; while (reco.derecha != null) { reco = reco.derecha; } mensajes.mostrarInformacion("Mayor valor del árbol:" + reco.dato); } } }
cristian0193/EstructuraDatos
EstructuraDatos1/src/Arboles/Funciones.java
Java
gpl-2.0
4,396
'use strict'; var config = require('./config') function init(opts) { Object.assign(config, opts) } module.exports = { init: init, routes: require('./routes'), models: require('./models'), entry: require('./entry'), channel: require('./channel'), user: require('./user'), security: require('./security'), wpml: require('../common/wpml'), riot: require('../common/riot'), config: config, webmention: require('./webmention'), store: require('./store') }
dogada/coect-umedia
server/index.js
JavaScript
gpl-2.0
480
define("ace/theme/yesterday",["require","exports","module","ace/lib/dom"], function(require, exports, module) { exports.isDark = false; exports.cssClass = "ace-yesterday"; exports.cssText = ".ace-yesterday .ace_gutter {\ background: #fff;\ border-right: 1px solid #ddd;\ color: #999;\ font-size: 10pt\ }\ .ace-yesterday .ace_print-margin {\ width: 1px;\ background: #f6f6f6\ }\ .ace-yesterday {\ background-color: #FFFFFF;\ color: #4D4D4C\ }\ .ace-yesterday .ace_cursor {\ color: #AEAFAD\ }\ .ace_scroller.ace_scroll-left {\ box-shadow: none\ }\ .ace-yesterday .ace_marker-layer .ace_selection {\ background: #D6D6D6\ }\ .ace-yesterday.ace_multiselect .ace_selection.ace_start {\ box-shadow: 0 0 3px 0px #FFFFFF;\ border-radius: 2px\ }\ .ace-yesterday .ace_marker-layer .ace_step {\ background: rgb(255, 255, 0)\ }\ .ace-yesterday .ace_marker-layer .ace_bracket {\ margin: -1px 0 0 -1px;\ border: 1px solid #D1D1D1\ }\ .ace-yesterday .ace_marker-layer .ace_active-line {\ background: #EFEFEF\ }\ .ace-yesterday .ace_gutter-active-line {\ background-color : #dcdcdc\ }\ .ace-yesterday .ace_marker-layer .ace_selected-word {\ border: 1px solid #D6D6D6\ }\ .ace-yesterday .ace_invisible {\ color: #D1D1D1\ }\ .ace-yesterday .ace_keyword,\ .ace-yesterday .ace_meta,\ .ace-yesterday .ace_storage,\ .ace-yesterday .ace_storage.ace_type,\ .ace-yesterday .ace_support.ace_type {\ color: #8959A8\ }\ .ace-yesterday .ace_keyword.ace_operator {\ color: #3E999F\ }\ .ace-yesterday .ace_constant.ace_character,\ .ace-yesterday .ace_constant.ace_language,\ .ace-yesterday .ace_constant.ace_numeric,\ .ace-yesterday .ace_keyword.ace_other.ace_unit,\ .ace-yesterday .ace_support.ace_constant,\ .ace-yesterday .ace_variable.ace_parameter {\ color: #F5871F\ }\ .ace-yesterday .ace_constant.ace_other {\ color: #666969\ }\ .ace-yesterday .ace_invalid {\ color: #FFFFFF;\ background-color: #C82829\ }\ .ace-yesterday .ace_invalid.ace_deprecated {\ color: #FFFFFF;\ background-color: #8959A8\ }\ .ace-yesterday .ace_fold {\ background-color: #4271AE;\ border-color: #4D4D4C\ }\ .ace-yesterday .ace_entity.ace_name.ace_function,\ .ace-yesterday .ace_support.ace_function,\ .ace-yesterday .ace_variable {\ color: #4271AE\ }\ .ace-yesterday .ace_support.ace_class,\ .ace-yesterday .ace_support.ace_type {\ color: #C99E00\ }\ .ace-yesterday .ace_heading,\ .ace-yesterday .ace_markup.ace_heading,\ .ace-yesterday .ace_string {\ color: #718C00\ }\ .ace-yesterday .ace_entity.ace_name.ace_tag,\ .ace-yesterday .ace_entity.ace_other.ace_attribute-name,\ .ace-yesterday .ace_meta.ace_tag,\ .ace-yesterday .ace_string.ace_regexp,\ .ace-yesterday .ace_variable {\ color: #C82829\ }\ .ace-yesterday .ace_comment {\ color: #8E908C\ }\ .ace-yesterday .ace_indent-guide {\ background: url(data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAAEAAAACCAYAAACZgbYnAAAAE0lEQVQImWP4////f4bdu3f/BwAlfgctduB85QAAAABJRU5ErkJggg==) right repeat-y\ }"; var dom = require("../lib/dom"); dom.importCssString(exports.cssText, exports.cssClass); });
DHUers/rigidoj
lib/assets/javascripts/ace/theme-yesterday.js
JavaScript
gpl-2.0
3,006
package clustering.results; public class ResultadoMerge { public int[][] merge; public final int length; public ResultadoMerge(int size) { merge=new int[2][size]; length=size; } public int[] getId1(){ return merge[0]; } public int[] getId2(){ return merge[1]; } }
LBAB-Humboldt/JavaHierarchicalClustering
HierarchicalClustering/src/clustering/results/ResultadoMerge.java
Java
gpl-2.0
281
<?php /** * glFusion CMS * * UTF-8 Language File for Links Plugin * * @license GNU General Public License version 2 or later * http://www.opensource.org/licenses/gpl-license.php * * Copyright (C) 2008-2018 by the following authors: * Mark R. Evans mark AT glfusion DOT org * * Based on prior work Copyright (C) 2001-2007 by the following authors: * Tony Bibbs - tony AT tonybibbs DOT com * Trinity Bays - trinity93 AT gmail DOT com * Tom Willett - twillett AT users DOT sourceforge DOT net * */ if (!defined ('GVERSION')) { die ('This file cannot be used on its own.'); } global $LANG32; ############################################################################### # Array Format: # $LANGXX[YY]: $LANG - variable name # XX - file id number # YY - phrase id number ############################################################################### /** * the link plugin's lang array * * @global array $LANG_LINKS */ $LANG_LINKS = array( 10 => 'Submissions', 14 => 'Links', 84 => 'Links', 88 => 'No new links', 114 => 'Links', 116 => 'Add A Link', 117 => 'Report Broken Link', 118 => 'Broken Link Report', 119 => 'The following link has been reported to be broken: ', 120 => 'To edit the link, click here: ', 121 => 'The broken Link was reported by: ', 122 => 'Thank you for reporting this broken link. The administrator will correct the problem as soon as possible', 123 => 'Thank you', 124 => 'Go', 125 => 'Categories', 126 => 'You are here:', 'root' => 'Root', 'error_header' => 'Link Submission Error', 'verification_failed' => 'The URL specified does not appear to be a valid URL', 'category_not_found' => 'The Category does not appear to be valid', 'no_links' => 'No links have been entered.', ); ############################################################################### # for stats /** * the link plugin's lang stats array * * @global array $LANG_LINKS_STATS */ $LANG_LINKS_STATS = array( 'links' => 'Links (Clicks) in the System', 'stats_headline' => 'Top Ten Links', 'stats_page_title' => 'Links', 'stats_hits' => 'Hits', 'stats_no_hits' => 'It appears that there are no links on this site or no one has ever clicked on one.', ); ############################################################################### # for the search /** * the link plugin's lang search array * * @global array $LANG_LINKS_SEARCH */ $LANG_LINKS_SEARCH = array( 'results' => 'Link Results', 'title' => 'Title', 'date' => 'Date Added', 'author' => 'Submited by', 'hits' => 'Clicks' ); ############################################################################### # for the submission form /** * the link plugin's lang submit form array * * @global array $LANG_LINKS_SUBMIT */ $LANG_LINKS_SUBMIT = array( 1 => 'Submit a Link', 2 => 'Link', 3 => 'Category', 4 => 'Other', 5 => 'If other, please specify', 6 => 'Error: Missing Category', 7 => 'When selecting "Other" please also provide a category name', 8 => 'Title', 9 => 'URL', 10 => 'Category', 11 => 'Link Submissions', 12 => 'Submitted By', ); ############################################################################### # autotag description $LANG_LI_AUTOTAG = array( 'desc_link' => 'Link: to the detail page for a Link on this site; link_text defaults to the link name. usage: [link:<i>link_id</i> {link_text}]', ); ############################################################################### # Messages for COM_showMessage the submission form $PLG_links_MESSAGE1 = "Thank-you for submitting a link to {$_CONF['site_name']}. It has been submitted to our staff for approval. If approved, your link will be seen in the <a href={$_CONF['site_url']}/links/index.php>links</a> section."; $PLG_links_MESSAGE2 = 'Your link has been successfully saved.'; $PLG_links_MESSAGE3 = 'The link has been successfully deleted.'; $PLG_links_MESSAGE4 = "Thank-you for submitting a link to {$_CONF['site_name']}. You can see it now in the <a href={$_CONF['site_url']}/links/index.php>links</a> section."; $PLG_links_MESSAGE5 = "You do not have sufficient access rights to view this category."; $PLG_links_MESSAGE6 = 'You do not have sufficient rights to edit this category.'; $PLG_links_MESSAGE7 = 'Please enter a Category Name and Description.'; $PLG_links_MESSAGE10 = 'Your category has been successfully saved.'; $PLG_links_MESSAGE11 = 'You are not allowed to set the id of a category to "site" or "user" - these are reserved for internal use.'; $PLG_links_MESSAGE12 = 'You are trying to make a parent category the child of it\'s own subcategory. This would create an orphan category, so please first move the child category or categories up to a higher level.'; $PLG_links_MESSAGE13 = 'The category has been successfully deleted.'; $PLG_links_MESSAGE14 = 'Category contains links and/or categories. Please remove these first.'; $PLG_links_MESSAGE15 = 'You do not have sufficient rights to delete this category.'; $PLG_links_MESSAGE16 = 'No such category exists.'; $PLG_links_MESSAGE17 = 'This category id is already in use.'; // Messages for the plugin upgrade $PLG_links_MESSAGE3001 = 'Plugin upgrade not supported.'; $PLG_links_MESSAGE3002 = $LANG32[9]; ############################################################################### # admin/link.php /** * the link plugin's lang admin array * * @global array $LANG_LINKS_ADMIN */ $LANG_LINKS_ADMIN = array( 1 => 'Link Editor', 2 => 'Link ID', 3 => 'Link Title', 4 => 'Link URL', 5 => 'Category', 6 => '(include http://)', 7 => 'Other', 8 => 'Link Hits', 9 => 'Link Description', 10 => 'You need to provide a link Title, URL and Description.', 11 => 'Link Administration', 12 => 'To modify or delete a link, click on that link\'s edit icon below. To create a new link or a new category, click on "New link" or "New category" above. To edit multiple categories, click on "Edit categories" above.', 14 => 'Link Category', 16 => 'Access Denied', 17 => "You are trying to access a link that you don't have rights to. This attempt has been logged. Please <a href=\"{$_CONF['site_admin_url']}/plugins/links/index.php\">go back to the link administration screen</a>.", 20 => 'If other, specify', 21 => 'save', 22 => 'cancel', 23 => 'delete', 24 => 'Link not found', 25 => 'The link you selected for editing could not be found.', 26 => 'Validate Links', 27 => 'HTML Status', 28 => 'Edit category', 29 => 'Enter or edit the details below.', 30 => 'Category', 31 => 'Description', 32 => 'Category ID', 33 => 'Topic', 34 => 'Parent', 35 => 'All', 40 => 'Edit this category', 41 => 'Add', 42 => 'Delete this category', 43 => 'Site categories', 44 => 'Add Subcategory', 46 => 'User %s tried to delete a category to which they do not have access rights', 50 => 'Category Admin', 51 => 'New Link', 52 => 'New Root Category', 53 => 'Links Admin', 54 => 'Link Category Administration', 55 => 'Edit categories below. Note that you cannot delete a category that contains other categories or links - you should delete these first, or move them to another category.', 56 => 'Category Editor', 57 => 'Not validated yet', 58 => 'Validate now', 59 => '<br /><br />To validate all links displayed, please click on the "Validate now" link below. The validation process may take some time depending on the amount of links displayed.', 60 => 'User %s tried illegally to edit category %s.', 61 => 'Owner', 62 => 'Last Updated', 63 => 'Are you sure you want to delete this link?', 64 => 'Are you sure you want to delete this category?', 65 => 'Moderate Link', 66 => 'This screen allows you to create / edit links.', 67 => 'This screen allows you to create / edit a links category.', ); $LANG_LINKS_STATUS = array( 100 => "Continue", 101 => "Switching Protocols", 200 => "OK", 201 => "Created", 202 => "Accepted", 203 => "Non-Authoritative Information", 204 => "No Content", 205 => "Reset Content", 206 => "Partial Content", 300 => "Multiple Choices", 301 => "Moved Permanently", 302 => "Found", 303 => "See Other", 304 => "Not Modified", 305 => "Use Proxy", 307 => "Temporary Redirect", 400 => "Bad Request", 401 => "Unauthorized", 402 => "Payment Required", 403 => "Forbidden", 404 => "Not Found", 405 => "Method Not Allowed", 406 => "Not Acceptable", 407 => "Proxy Authentication Required", 408 => "Request Timeout", 409 => "Conflict", 410 => "Gone", 411 => "Length Required", 412 => "Precondition Failed", 413 => "Request Entity Too Large", 414 => "Request-URI Too Long", 415 => "Unsupported Media Type", 416 => "Requested Range Not Satisfiable", 417 => "Expectation Failed", 500 => "Internal Server Error", 501 => "Not Implemented", 502 => "Bad Gateway", 503 => "Service Unavailable", 504 => "Gateway Timeout", 505 => "HTTP Version Not Supported", 999 => "Connection Timed out" ); // Localization of the Admin Configuration UI $LANG_configsections['links'] = array( 'label' => 'Links', 'title' => 'Links Configuration' ); $LANG_confignames['links'] = array( 'linksloginrequired' => 'Links Login Required', 'linksubmission' => 'Enable Link Submission Queue', 'newlinksinterval' => 'New Links Interval', 'hidenewlinks' => 'Hide New Links', 'hidelinksmenu' => 'Hide Links Menu Entry', 'linkcols' => 'Categories per Column', 'linksperpage' => 'Links per Page', 'show_top10' => 'Show Top 10 Links', 'notification' => 'Notification Email', 'delete_links' => 'Delete Links with Owner', 'aftersave' => 'After Saving Link', 'show_category_descriptions' => 'Show Category Description', 'root' => 'ID of Root Category', 'default_permissions' => 'Link Default Permissions', 'target_blank' => 'Open Links in New Window', 'displayblocks' => 'Display glFusion Blocks', 'submission' => 'Link Submission', ); $LANG_configsubgroups['links'] = array( 'sg_main' => 'Main Settings' ); $LANG_fs['links'] = array( 'fs_public' => 'Public Links List Settings', 'fs_admin' => 'Links Admin Settings', 'fs_permissions' => 'Default Permissions' ); $LANG_configSelect['links'] = array( 0 => array(1=>'True', 0=>'False'), 1 => array(true=>'True', false=>'False'), 9 => array('item'=>'Forward to Linked Site', 'list'=>'Display Admin List', 'plugin'=>'Display Public List', 'home'=>'Display Home', 'admin'=>'Display Admin'), 12 => array(0=>'No access', 2=>'Read-Only', 3=>'Read-Write'), 13 => array(0=>'Left Blocks', 1=>'Right Blocks', 2=>'Left & Right Blocks', 3=>'None'), 14 => array(0=>'None', 1=>'Logged-in Only', 2=>'Anyone', 3=>'None') ); ?>
glFusion/glfusion
private/plugins/links/language/english_utf-8.php
PHP
gpl-2.0
11,040
/****************************************************************************** * Icinga 2 * * Copyright (C) 2012-2015 Icinga Development Team (http://www.icinga.org) * * * * This program is free software; you can redistribute it and/or * * modify it under the terms of the GNU General Public License * * as published by the Free Software Foundation; either version 2 * * of the License, or (at your option) any later version. * * * * This program is distributed in the hope that it will be useful, * * but WITHOUT ANY WARRANTY; without even the implied warranty of * * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the * * GNU General Public License for more details. * * * * You should have received a copy of the GNU General Public License * * along with this program; if not, write to the Free Software Foundation * * Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301, USA. * ******************************************************************************/ #include "icinga/compatutility.hpp" #include "icinga/checkcommand.hpp" #include "icinga/eventcommand.hpp" #include "icinga/pluginutility.hpp" #include "icinga/service.hpp" #include "base/utility.hpp" #include "base/configtype.hpp" #include "base/objectlock.hpp" #include "base/convert.hpp" #include <boost/foreach.hpp> #include <boost/algorithm/string/replace.hpp> #include <boost/algorithm/string/join.hpp> using namespace icinga; /* command */ String CompatUtility::GetCommandLine(const Command::Ptr& command) { Value commandLine = command->GetCommandLine(); String result; if (commandLine.IsObjectType<Array>()) { Array::Ptr args = commandLine; ObjectLock olock(args); String arg; BOOST_FOREACH(arg, args) { // This is obviously incorrect for non-trivial cases. result += " \"" + EscapeString(arg) + "\""; } } else if (!commandLine.IsEmpty()) { result = EscapeString(Convert::ToString(commandLine)); } else { result = "<internal>"; } return result; } String CompatUtility::GetCommandNamePrefix(const Command::Ptr command) { if (!command) return Empty; String prefix; if (command->GetType() == ConfigType::GetByName("CheckCommand")) prefix = "check_"; else if (command->GetType() == ConfigType::GetByName("NotificationCommand")) prefix = "notification_"; else if (command->GetType() == ConfigType::GetByName("EventCommand")) prefix = "event_"; return prefix; } String CompatUtility::GetCommandName(const Command::Ptr command) { if (!command) return Empty; return GetCommandNamePrefix(command) + command->GetName(); } /* host */ int CompatUtility::GetHostCurrentState(const Host::Ptr& host) { if (host->GetState() != HostUp && !host->IsReachable()) return 2; /* hardcoded compat state */ return host->GetState(); } String CompatUtility::GetHostStateString(const Host::Ptr& host) { if (host->GetState() != HostUp && !host->IsReachable()) return "UNREACHABLE"; /* hardcoded compat state */ return Host::StateToString(host->GetState()); } String CompatUtility::GetHostAlias(const Host::Ptr& host) { if (!host->GetDisplayName().IsEmpty()) return host->GetName(); else return host->GetDisplayName(); } int CompatUtility::GetHostNotifyOnDown(const Host::Ptr& host) { unsigned long notification_state_filter = GetCheckableNotificationStateFilter(host); if (notification_state_filter & (1<<ServiceCritical) || notification_state_filter & (1<<ServiceWarning)) return 1; return 0; } int CompatUtility::GetHostNotifyOnUnreachable(const Host::Ptr& host) { unsigned long notification_state_filter = GetCheckableNotificationStateFilter(host); if (notification_state_filter & (1<<ServiceUnknown)) return 1; return 0; } /* service */ String CompatUtility::GetCheckableCommandArgs(const Checkable::Ptr& checkable) { CheckCommand::Ptr command = checkable->GetCheckCommand(); Dictionary::Ptr args = new Dictionary(); if (command) { Host::Ptr host; Service::Ptr service; tie(host, service) = GetHostService(checkable); String command_line = GetCommandLine(command); Dictionary::Ptr command_vars = command->GetVars(); if (command_vars) { ObjectLock olock(command_vars); BOOST_FOREACH(const Dictionary::Pair& kv, command_vars) { String macro = "$" + kv.first + "$"; // this is too simple if (command_line.Contains(macro)) args->Set(kv.first, kv.second); } } Dictionary::Ptr host_vars = host->GetVars(); if (host_vars) { ObjectLock olock(host_vars); BOOST_FOREACH(const Dictionary::Pair& kv, host_vars) { String macro = "$" + kv.first + "$"; // this is too simple if (command_line.Contains(macro)) args->Set(kv.first, kv.second); macro = "$host.vars." + kv.first + "$"; if (command_line.Contains(macro)) args->Set(kv.first, kv.second); } } if (service) { Dictionary::Ptr service_vars = service->GetVars(); if (service_vars) { ObjectLock olock(service_vars); BOOST_FOREACH(const Dictionary::Pair& kv, service_vars) { String macro = "$" + kv.first + "$"; // this is too simple if (command_line.Contains(macro)) args->Set(kv.first, kv.second); macro = "$service.vars." + kv.first + "$"; if (command_line.Contains(macro)) args->Set(kv.first, kv.second); } } } String arg_string; ObjectLock olock(args); BOOST_FOREACH(const Dictionary::Pair& kv, args) { arg_string += Convert::ToString(kv.first) + "=" + Convert::ToString(kv.second) + "!"; } return arg_string; } return Empty; } int CompatUtility::GetCheckableCheckType(const Checkable::Ptr& checkable) { return (checkable->GetEnableActiveChecks() ? 0 : 1); } double CompatUtility::GetCheckableCheckInterval(const Checkable::Ptr& checkable) { return checkable->GetCheckInterval() / 60.0; } double CompatUtility::GetCheckableRetryInterval(const Checkable::Ptr& checkable) { return checkable->GetRetryInterval() / 60.0; } String CompatUtility::GetCheckableCheckPeriod(const Checkable::Ptr& checkable) { TimePeriod::Ptr check_period = checkable->GetCheckPeriod(); if (check_period) return check_period->GetName(); else return "24x7"; } int CompatUtility::GetCheckableHasBeenChecked(const Checkable::Ptr& checkable) { return (checkable->GetLastCheckResult() ? 1 : 0); } int CompatUtility::GetCheckableProblemHasBeenAcknowledged(const Checkable::Ptr& checkable) { return (checkable->GetAcknowledgement() != AcknowledgementNone ? 1 : 0); } int CompatUtility::GetCheckableAcknowledgementType(const Checkable::Ptr& checkable) { return static_cast<int>(checkable->GetAcknowledgement()); } int CompatUtility::GetCheckablePassiveChecksEnabled(const Checkable::Ptr& checkable) { return (checkable->GetEnablePassiveChecks() ? 1 : 0); } int CompatUtility::GetCheckableActiveChecksEnabled(const Checkable::Ptr& checkable) { return (checkable->GetEnableActiveChecks() ? 1 : 0); } int CompatUtility::GetCheckableEventHandlerEnabled(const Checkable::Ptr& checkable) { return (checkable->GetEnableEventHandler() ? 1 : 0); } int CompatUtility::GetCheckableFlapDetectionEnabled(const Checkable::Ptr& checkable) { return (checkable->GetEnableFlapping() ? 1 : 0); } int CompatUtility::GetCheckableIsFlapping(const Checkable::Ptr& checkable) { return (checkable->IsFlapping() ? 1 : 0); } int CompatUtility::GetCheckableIsReachable(const Checkable::Ptr& checkable) { return (checkable->IsReachable() ? 1 : 0); } double CompatUtility::GetCheckablePercentStateChange(const Checkable::Ptr& checkable) { return checkable->GetFlappingCurrent(); } int CompatUtility::GetCheckableProcessPerformanceData(const Checkable::Ptr& checkable) { return (checkable->GetEnablePerfdata() ? 1 : 0); } String CompatUtility::GetCheckableEventHandler(const Checkable::Ptr& checkable) { String event_command_str; EventCommand::Ptr eventcommand = checkable->GetEventCommand(); if (eventcommand) event_command_str = eventcommand->GetName(); return event_command_str; } String CompatUtility::GetCheckableCheckCommand(const Checkable::Ptr& checkable) { String check_command_str; CheckCommand::Ptr checkcommand = checkable->GetCheckCommand(); if (checkcommand) check_command_str = checkcommand->GetName(); return check_command_str; } int CompatUtility::GetCheckableIsVolatile(const Checkable::Ptr& checkable) { return (checkable->GetVolatile() ? 1 : 0); } double CompatUtility::GetCheckableLowFlapThreshold(const Checkable::Ptr& checkable) { return checkable->GetFlappingThreshold(); } double CompatUtility::GetCheckableHighFlapThreshold(const Checkable::Ptr& checkable) { return checkable->GetFlappingThreshold(); } int CompatUtility::GetCheckableFreshnessChecksEnabled(const Checkable::Ptr& checkable) { return (checkable->GetCheckInterval() > 0 ? 1 : 0); } int CompatUtility::GetCheckableFreshnessThreshold(const Checkable::Ptr& checkable) { return static_cast<int>(checkable->GetCheckInterval()); } double CompatUtility::GetCheckableStaleness(const Checkable::Ptr& checkable) { if (checkable->HasBeenChecked() && checkable->GetLastCheck() > 0) return (Utility::GetTime() - checkable->GetLastCheck()) / (checkable->GetCheckInterval() * 3600); return 0.0; } int CompatUtility::GetCheckableIsAcknowledged(const Checkable::Ptr& checkable) { return (checkable->IsAcknowledged() ? 1 : 0); } int CompatUtility::GetCheckableNoMoreNotifications(const Checkable::Ptr& checkable) { if (CompatUtility::GetCheckableNotificationNotificationInterval(checkable) == 0 && !checkable->GetVolatile()) return 1; return 0; } int CompatUtility::GetCheckableInCheckPeriod(const Checkable::Ptr& checkable) { TimePeriod::Ptr timeperiod = checkable->GetCheckPeriod(); /* none set means always checked */ if (!timeperiod) return 1; return (timeperiod->IsInside(Utility::GetTime()) ? 1 : 0); } int CompatUtility::GetCheckableInNotificationPeriod(const Checkable::Ptr& checkable) { BOOST_FOREACH(const Notification::Ptr& notification, checkable->GetNotifications()) { ObjectLock olock(notification); TimePeriod::Ptr timeperiod = notification->GetPeriod(); /* first notification wins */ if (timeperiod) return (timeperiod->IsInside(Utility::GetTime()) ? 1 : 0); } /* none set means always notified */ return 1; } /* vars attr */ Dictionary::Ptr CompatUtility::GetCustomAttributeConfig(const CustomVarObject::Ptr& object) { Dictionary::Ptr vars = object->GetVars(); if (!vars) return Dictionary::Ptr(); return vars; } String CompatUtility::GetCustomAttributeConfig(const CustomVarObject::Ptr& object, const String& name) { Dictionary::Ptr vars = object->GetVars(); if (!vars) return Empty; return vars->Get(name); } Array::Ptr CompatUtility::GetModifiedAttributesList(const CustomVarObject::Ptr& object) { Array::Ptr mod_attr_list = new Array(); if (object->GetType() != ConfigType::GetByName("Host") && object->GetType() != ConfigType::GetByName("Service") && object->GetType() != ConfigType::GetByName("User") && object->GetType() != ConfigType::GetByName("CheckCommand") && object->GetType() != ConfigType::GetByName("EventCommand") && object->GetType() != ConfigType::GetByName("NotificationCommand")) return mod_attr_list; int flags = object->GetModifiedAttributes(); if ((flags & ModAttrNotificationsEnabled)) mod_attr_list->Add("notifications_enabled"); if ((flags & ModAttrActiveChecksEnabled)) mod_attr_list->Add("active_checks_enabled"); if ((flags & ModAttrPassiveChecksEnabled)) mod_attr_list->Add("passive_checks_enabled"); if ((flags & ModAttrFlapDetectionEnabled)) mod_attr_list->Add("flap_detection_enabled"); if ((flags & ModAttrEventHandlerEnabled)) mod_attr_list->Add("event_handler_enabled"); if ((flags & ModAttrPerformanceDataEnabled)) mod_attr_list->Add("performance_data_enabled"); if ((flags & ModAttrNormalCheckInterval)) mod_attr_list->Add("check_interval"); if ((flags & ModAttrRetryCheckInterval)) mod_attr_list->Add("retry_interval"); if ((flags & ModAttrEventHandlerCommand)) mod_attr_list->Add("event_handler_command"); if ((flags & ModAttrCheckCommand)) mod_attr_list->Add("check_command"); if ((flags & ModAttrMaxCheckAttempts)) mod_attr_list->Add("max_check_attemps"); if ((flags & ModAttrCheckTimeperiod)) mod_attr_list->Add("check_timeperiod"); if ((flags & ModAttrCustomVariable)) mod_attr_list->Add("custom_variable"); return mod_attr_list; } /* notifications */ int CompatUtility::GetCheckableNotificationsEnabled(const Checkable::Ptr& checkable) { return (checkable->GetEnableNotifications() ? 1 : 0); } int CompatUtility::GetCheckableNotificationLastNotification(const Checkable::Ptr& checkable) { double last_notification = 0.0; BOOST_FOREACH(const Notification::Ptr& notification, checkable->GetNotifications()) { if (notification->GetLastNotification() > last_notification) last_notification = notification->GetLastNotification(); } return static_cast<int>(last_notification); } int CompatUtility::GetCheckableNotificationNextNotification(const Checkable::Ptr& checkable) { double next_notification = 0.0; BOOST_FOREACH(const Notification::Ptr& notification, checkable->GetNotifications()) { if (next_notification == 0 || notification->GetNextNotification() < next_notification) next_notification = notification->GetNextNotification(); } return static_cast<int>(next_notification); } int CompatUtility::GetCheckableNotificationNotificationNumber(const Checkable::Ptr& checkable) { int notification_number = 0; BOOST_FOREACH(const Notification::Ptr& notification, checkable->GetNotifications()) { if (notification->GetNotificationNumber() > notification_number) notification_number = notification->GetNotificationNumber(); } return notification_number; } double CompatUtility::GetCheckableNotificationNotificationInterval(const Checkable::Ptr& checkable) { double notification_interval = -1; BOOST_FOREACH(const Notification::Ptr& notification, checkable->GetNotifications()) { if (notification_interval == -1 || notification->GetInterval() < notification_interval) notification_interval = notification->GetInterval(); } if (notification_interval == -1) notification_interval = 60; return notification_interval / 60.0; } String CompatUtility::GetCheckableNotificationNotificationPeriod(const Checkable::Ptr& checkable) { TimePeriod::Ptr notification_period; BOOST_FOREACH(const Notification::Ptr& notification, checkable->GetNotifications()) { if (notification->GetPeriod()) notification_period = notification->GetPeriod(); } if (!notification_period) return Empty; return notification_period->GetName(); } String CompatUtility::GetCheckableNotificationNotificationOptions(const Checkable::Ptr& checkable) { Host::Ptr host; Service::Ptr service; tie(host, service) = GetHostService(checkable); unsigned long notification_type_filter = 0; unsigned long notification_state_filter = 0; BOOST_FOREACH(const Notification::Ptr& notification, checkable->GetNotifications()) { notification_type_filter = notification->GetTypeFilter(); notification_state_filter = notification->GetStateFilter(); } std::vector<String> notification_options; /* notification state filters */ if (service) { if (notification_state_filter & (1<<ServiceWarning)) { notification_options.push_back("w"); } if (notification_state_filter & (1<<ServiceUnknown)) { notification_options.push_back("u"); } if (notification_state_filter & (1<<ServiceCritical)) { notification_options.push_back("c"); } } else { if (notification_state_filter & (1<<HostDown)) { notification_options.push_back("d"); } } /* notification type filters */ if (notification_type_filter & (1<<NotificationRecovery)) { notification_options.push_back("r"); } if (notification_type_filter & (1<<NotificationFlappingStart) || notification_type_filter & (1<<NotificationFlappingEnd)) { notification_options.push_back("f"); } if (notification_type_filter & (1<<NotificationDowntimeStart) || notification_type_filter & (1<<NotificationDowntimeEnd) || notification_type_filter & (1<<NotificationDowntimeRemoved)) { notification_options.push_back("s"); } return boost::algorithm::join(notification_options, ","); } int CompatUtility::GetCheckableNotificationTypeFilter(const Checkable::Ptr& checkable) { unsigned long notification_type_filter = 0; BOOST_FOREACH(const Notification::Ptr& notification, checkable->GetNotifications()) { ObjectLock olock(notification); notification_type_filter = notification->GetTypeFilter(); } return notification_type_filter; } int CompatUtility::GetCheckableNotificationStateFilter(const Checkable::Ptr& checkable) { unsigned long notification_state_filter = 0; BOOST_FOREACH(const Notification::Ptr& notification, checkable->GetNotifications()) { ObjectLock olock(notification); notification_state_filter = notification->GetStateFilter(); } return notification_state_filter; } int CompatUtility::GetCheckableNotifyOnWarning(const Checkable::Ptr& checkable) { if (GetCheckableNotificationStateFilter(checkable) & (1<<ServiceWarning)) return 1; return 0; } int CompatUtility::GetCheckableNotifyOnCritical(const Checkable::Ptr& checkable) { if (GetCheckableNotificationStateFilter(checkable) & (1<<ServiceCritical)) return 1; return 0; } int CompatUtility::GetCheckableNotifyOnUnknown(const Checkable::Ptr& checkable) { if (GetCheckableNotificationStateFilter(checkable) & (1<<ServiceUnknown)) return 1; return 0; } int CompatUtility::GetCheckableNotifyOnRecovery(const Checkable::Ptr& checkable) { if (GetCheckableNotificationTypeFilter(checkable) & (1<<NotificationRecovery)) return 1; return 0; } int CompatUtility::GetCheckableNotifyOnFlapping(const Checkable::Ptr& checkable) { unsigned long notification_type_filter = GetCheckableNotificationTypeFilter(checkable); if (notification_type_filter & (1<<NotificationFlappingStart) || notification_type_filter & (1<<NotificationFlappingEnd)) return 1; return 0; } int CompatUtility::GetCheckableNotifyOnDowntime(const Checkable::Ptr& checkable) { unsigned long notification_type_filter = GetCheckableNotificationTypeFilter(checkable); if (notification_type_filter & (1<<NotificationDowntimeStart) || notification_type_filter & (1<<NotificationDowntimeEnd) || notification_type_filter & (1<<NotificationDowntimeRemoved)) return 1; return 0; } std::set<User::Ptr> CompatUtility::GetCheckableNotificationUsers(const Checkable::Ptr& checkable) { /* Service -> Notifications -> (Users + UserGroups -> Users) */ std::set<User::Ptr> allUsers; std::set<User::Ptr> users; BOOST_FOREACH(const Notification::Ptr& notification, checkable->GetNotifications()) { ObjectLock olock(notification); users = notification->GetUsers(); std::copy(users.begin(), users.end(), std::inserter(allUsers, allUsers.begin())); BOOST_FOREACH(const UserGroup::Ptr& ug, notification->GetUserGroups()) { std::set<User::Ptr> members = ug->GetMembers(); std::copy(members.begin(), members.end(), std::inserter(allUsers, allUsers.begin())); } } return allUsers; } std::set<UserGroup::Ptr> CompatUtility::GetCheckableNotificationUserGroups(const Checkable::Ptr& checkable) { std::set<UserGroup::Ptr> usergroups; /* Service -> Notifications -> UserGroups */ BOOST_FOREACH(const Notification::Ptr& notification, checkable->GetNotifications()) { ObjectLock olock(notification); BOOST_FOREACH(const UserGroup::Ptr& ug, notification->GetUserGroups()) { usergroups.insert(ug); } } return usergroups; } String CompatUtility::GetCheckResultOutput(const CheckResult::Ptr& cr) { if (!cr) return Empty; String output; String raw_output = cr->GetOutput(); /* * replace semi-colons with colons in output * semi-colon is used as delimiter in various interfaces */ boost::algorithm::replace_all(raw_output, ";", ":"); size_t line_end = raw_output.Find("\n"); return raw_output.SubStr(0, line_end); } String CompatUtility::GetCheckResultLongOutput(const CheckResult::Ptr& cr) { if (!cr) return Empty; String long_output; String output; String raw_output = cr->GetOutput(); /* * replace semi-colons with colons in output * semi-colon is used as delimiter in various interfaces */ boost::algorithm::replace_all(raw_output, ";", ":"); size_t line_end = raw_output.Find("\n"); if (line_end > 0 && line_end != String::NPos) { long_output = raw_output.SubStr(line_end+1, raw_output.GetLength()); return EscapeString(long_output); } return Empty; } String CompatUtility::GetCheckResultPerfdata(const CheckResult::Ptr& cr) { if (!cr) return String(); return PluginUtility::FormatPerfdata(cr->GetPerformanceData()); } String CompatUtility::EscapeString(const String& str) { String result = str; boost::algorithm::replace_all(result, "\n", "\\n"); return result; } String CompatUtility::UnEscapeString(const String& str) { String result = str; boost::algorithm::replace_all(result, "\\n", "\n"); return result; } std::pair<unsigned long, unsigned long> CompatUtility::ConvertTimestamp(double time) { unsigned long time_sec = static_cast<long>(time); unsigned long time_usec = (time - time_sec) * 1000 * 1000; return std::make_pair(time_sec, time_usec); } int CompatUtility::MapNotificationReasonType(NotificationType type) { switch (type) { case NotificationDowntimeStart: return 5; case NotificationDowntimeEnd: return 6; case NotificationDowntimeRemoved: return 7; case NotificationCustom: return 8; case NotificationAcknowledgement: return 1; case NotificationProblem: return 0; case NotificationRecovery: return 0; case NotificationFlappingStart: return 2; case NotificationFlappingEnd: return 3; default: return 0; } } int CompatUtility::MapExternalCommandType(const String& name) { if (name == "NONE") return 0; if (name == "ADD_HOST_COMMENT") return 1; if (name == "DEL_HOST_COMMENT") return 2; if (name == "ADD_SVC_COMMENT") return 3; if (name == "DEL_SVC_COMMENT") return 4; if (name == "ENABLE_SVC_CHECK") return 5; if (name == "DISABLE_SVC_CHECK") return 6; if (name == "SCHEDULE_SVC_CHECK") return 7; if (name == "DELAY_SVC_NOTIFICATION") return 9; if (name == "DELAY_HOST_NOTIFICATION") return 10; if (name == "DISABLE_NOTIFICATIONS") return 11; if (name == "ENABLE_NOTIFICATIONS") return 12; if (name == "RESTART_PROCESS") return 13; if (name == "SHUTDOWN_PROCESS") return 14; if (name == "ENABLE_HOST_SVC_CHECKS") return 15; if (name == "DISABLE_HOST_SVC_CHECKS") return 16; if (name == "SCHEDULE_HOST_SVC_CHECKS") return 17; if (name == "DELAY_HOST_SVC_NOTIFICATIONS") return 19; if (name == "DEL_ALL_HOST_COMMENTS") return 20; if (name == "DEL_ALL_SVC_COMMENTS") return 21; if (name == "ENABLE_SVC_NOTIFICATIONS") return 22; if (name == "DISABLE_SVC_NOTIFICATIONS") return 23; if (name == "ENABLE_HOST_NOTIFICATIONS") return 24; if (name == "DISABLE_HOST_NOTIFICATIONS") return 25; if (name == "ENABLE_ALL_NOTIFICATIONS_BEYOND_HOST") return 26; if (name == "DISABLE_ALL_NOTIFICATIONS_BEYOND_HOST") return 27; if (name == "ENABLE_HOST_SVC_NOTIFICATIONS") return 28; if (name == "DISABLE_HOST_SVC_NOTIFICATIONS") return 29; if (name == "PROCESS_SERVICE_CHECK_RESULT") return 30; if (name == "SAVE_STATE_INFORMATION") return 31; if (name == "READ_STATE_INFORMATION") return 32; if (name == "ACKNOWLEDGE_HOST_PROBLEM") return 33; if (name == "ACKNOWLEDGE_SVC_PROBLEM") return 34; if (name == "START_EXECUTING_SVC_CHECKS") return 35; if (name == "STOP_EXECUTING_SVC_CHECKS") return 36; if (name == "START_ACCEPTING_PASSIVE_SVC_CHECKS") return 37; if (name == "STOP_ACCEPTING_PASSIVE_SVC_CHECKS") return 38; if (name == "ENABLE_PASSIVE_SVC_CHECKS") return 39; if (name == "DISABLE_PASSIVE_SVC_CHECKS") return 40; if (name == "ENABLE_EVENT_HANDLERS") return 41; if (name == "DISABLE_EVENT_HANDLERS") return 42; if (name == "ENABLE_HOST_EVENT_HANDLER") return 43; if (name == "DISABLE_HOST_EVENT_HANDLER") return 44; if (name == "ENABLE_SVC_EVENT_HANDLER") return 45; if (name == "DISABLE_SVC_EVENT_HANDLER") return 46; if (name == "ENABLE_HOST_CHECK") return 47; if (name == "DISABLE_HOST_CHECK") return 48; if (name == "START_OBSESSING_OVER_SVC_CHECKS") return 49; if (name == "STOP_OBSESSING_OVER_SVC_CHECKS") return 50; if (name == "REMOVE_HOST_ACKNOWLEDGEMENT") return 51; if (name == "REMOVE_SVC_ACKNOWLEDGEMENT") return 52; if (name == "SCHEDULE_FORCED_HOST_SVC_CHECKS") return 53; if (name == "SCHEDULE_FORCED_SVC_CHECK") return 54; if (name == "SCHEDULE_HOST_DOWNTIME") return 55; if (name == "SCHEDULE_SVC_DOWNTIME") return 56; if (name == "ENABLE_HOST_FLAP_DETECTION") return 57; if (name == "DISABLE_HOST_FLAP_DETECTION") return 58; if (name == "ENABLE_SVC_FLAP_DETECTION") return 59; if (name == "DISABLE_SVC_FLAP_DETECTION") return 60; if (name == "ENABLE_FLAP_DETECTION") return 61; if (name == "DISABLE_FLAP_DETECTION") return 62; if (name == "ENABLE_HOSTGROUP_SVC_NOTIFICATIONS") return 63; if (name == "DISABLE_HOSTGROUP_SVC_NOTIFICATIONS") return 64; if (name == "ENABLE_HOSTGROUP_HOST_NOTIFICATIONS") return 65; if (name == "DISABLE_HOSTGROUP_HOST_NOTIFICATIONS") return 66; if (name == "ENABLE_HOSTGROUP_SVC_CHECKS") return 67; if (name == "DISABLE_HOSTGROUP_SVC_CHECKS") return 68; if (name == "CANCEL_HOST_DOWNTIME") return 69; if (name == "CANCEL_SVC_DOWNTIME") return 70; if (name == "CANCEL_ACTIVE_HOST_DOWNTIME") return 71; if (name == "CANCEL_PENDING_HOST_DOWNTIME") return 72; if (name == "CANCEL_ACTIVE_SVC_DOWNTIME") return 73; if (name == "CANCEL_PENDING_SVC_DOWNTIME") return 74; if (name == "CANCEL_ACTIVE_HOST_SVC_DOWNTIME") return 75; if (name == "CANCEL_PENDING_HOST_SVC_DOWNTIME") return 76; if (name == "FLUSH_PENDING_COMMANDS") return 77; if (name == "DEL_HOST_DOWNTIME") return 78; if (name == "DEL_SVC_DOWNTIME") return 79; if (name == "ENABLE_FAILURE_PREDICTION") return 80; if (name == "DISABLE_FAILURE_PREDICTION") return 81; if (name == "ENABLE_PERFORMANCE_DATA") return 82; if (name == "DISABLE_PERFORMANCE_DATA") return 83; if (name == "SCHEDULE_HOSTGROUP_HOST_DOWNTIME") return 84; if (name == "SCHEDULE_HOSTGROUP_SVC_DOWNTIME") return 85; if (name == "SCHEDULE_HOST_SVC_DOWNTIME") return 86; if (name == "PROCESS_HOST_CHECK_RESULT") return 87; if (name == "START_EXECUTING_HOST_CHECKS") return 88; if (name == "STOP_EXECUTING_HOST_CHECKS") return 89; if (name == "START_ACCEPTING_PASSIVE_HOST_CHECKS") return 90; if (name == "STOP_ACCEPTING_PASSIVE_HOST_CHECKS") return 91; if (name == "ENABLE_PASSIVE_HOST_CHECKS") return 92; if (name == "DISABLE_PASSIVE_HOST_CHECKS") return 93; if (name == "START_OBSESSING_OVER_HOST_CHECKS") return 94; if (name == "STOP_OBSESSING_OVER_HOST_CHECKS") return 95; if (name == "SCHEDULE_HOST_CHECK") return 96; if (name == "SCHEDULE_FORCED_HOST_CHECK") return 98; if (name == "START_OBSESSING_OVER_SVC") return 99; if (name == "STOP_OBSESSING_OVER_SVC") return 100; if (name == "START_OBSESSING_OVER_HOST") return 101; if (name == "STOP_OBSESSING_OVER_HOST") return 102; if (name == "ENABLE_HOSTGROUP_HOST_CHECKS") return 103; if (name == "DISABLE_HOSTGROUP_HOST_CHECKS") return 104; if (name == "ENABLE_HOSTGROUP_PASSIVE_SVC_CHECKS") return 105; if (name == "DISABLE_HOSTGROUP_PASSIVE_SVC_CHECKS") return 106; if (name == "ENABLE_HOSTGROUP_PASSIVE_HOST_CHECKS") return 107; if (name == "DISABLE_HOSTGROUP_PASSIVE_HOST_CHECKS") return 108; if (name == "ENABLE_SERVICEGROUP_SVC_NOTIFICATIONS") return 109; if (name == "DISABLE_SERVICEGROUP_SVC_NOTIFICATIONS") return 110; if (name == "ENABLE_SERVICEGROUP_HOST_NOTIFICATIONS") return 111; if (name == "DISABLE_SERVICEGROUP_HOST_NOTIFICATIONS") return 112; if (name == "ENABLE_SERVICEGROUP_SVC_CHECKS") return 113; if (name == "DISABLE_SERVICEGROUP_SVC_CHECKS") return 114; if (name == "ENABLE_SERVICEGROUP_HOST_CHECKS") return 115; if (name == "DISABLE_SERVICEGROUP_HOST_CHECKS") return 116; if (name == "ENABLE_SERVICEGROUP_PASSIVE_SVC_CHECKS") return 117; if (name == "DISABLE_SERVICEGROUP_PASSIVE_SVC_CHECKS") return 118; if (name == "ENABLE_SERVICEGROUP_PASSIVE_HOST_CHECKS") return 119; if (name == "DISABLE_SERVICEGROUP_PASSIVE_HOST_CHECKS") return 120; if (name == "SCHEDULE_SERVICEGROUP_HOST_DOWNTIME") return 121; if (name == "SCHEDULE_SERVICEGROUP_SVC_DOWNTIME") return 122; if (name == "CHANGE_GLOBAL_HOST_EVENT_HANDLER") return 123; if (name == "CHANGE_GLOBAL_SVC_EVENT_HANDLER") return 124; if (name == "CHANGE_HOST_EVENT_HANDLER") return 125; if (name == "CHANGE_SVC_EVENT_HANDLER") return 126; if (name == "CHANGE_HOST_CHECK_COMMAND") return 127; if (name == "CHANGE_SVC_CHECK_COMMAND") return 128; if (name == "CHANGE_NORMAL_HOST_CHECK_INTERVAL") return 129; if (name == "CHANGE_NORMAL_SVC_CHECK_INTERVAL") return 130; if (name == "CHANGE_RETRY_SVC_CHECK_INTERVAL") return 131; if (name == "CHANGE_MAX_HOST_CHECK_ATTEMPTS") return 132; if (name == "CHANGE_MAX_SVC_CHECK_ATTEMPTS") return 133; if (name == "SCHEDULE_AND_PROPAGATE_TRIGGERED_HOST_DOWNTIME") return 134; if (name == "ENABLE_HOST_AND_CHILD_NOTIFICATIONS") return 135; if (name == "DISABLE_HOST_AND_CHILD_NOTIFICATIONS") return 136; if (name == "SCHEDULE_AND_PROPAGATE_HOST_DOWNTIME") return 137; if (name == "ENABLE_SERVICE_FRESHNESS_CHECKS") return 138; if (name == "DISABLE_SERVICE_FRESHNESS_CHECKS") return 139; if (name == "ENABLE_HOST_FRESHNESS_CHECKS") return 140; if (name == "DISABLE_HOST_FRESHNESS_CHECKS") return 141; if (name == "SET_HOST_NOTIFICATION_NUMBER") return 142; if (name == "SET_SVC_NOTIFICATION_NUMBER") return 143; if (name == "CHANGE_HOST_CHECK_TIMEPERIOD") return 144; if (name == "CHANGE_SVC_CHECK_TIMEPERIOD") return 145; if (name == "PROCESS_FILE") return 146; if (name == "CHANGE_CUSTOM_HOST_VAR") return 147; if (name == "CHANGE_CUSTOM_SVC_VAR") return 148; if (name == "CHANGE_CUSTOM_CONTACT_VAR") return 149; if (name == "ENABLE_CONTACT_HOST_NOTIFICATIONS") return 150; if (name == "DISABLE_CONTACT_HOST_NOTIFICATIONS") return 151; if (name == "ENABLE_CONTACT_SVC_NOTIFICATIONS") return 152; if (name == "DISABLE_CONTACT_SVC_NOTIFICATIONS") return 153; if (name == "ENABLE_CONTACTGROUP_HOST_NOTIFICATIONS") return 154; if (name == "DISABLE_CONTACTGROUP_HOST_NOTIFICATIONS") return 155; if (name == "ENABLE_CONTACTGROUP_SVC_NOTIFICATIONS") return 156; if (name == "DISABLE_CONTACTGROUP_SVC_NOTIFICATIONS") return 157; if (name == "CHANGE_RETRY_HOST_CHECK_INTERVAL") return 158; if (name == "SEND_CUSTOM_HOST_NOTIFICATION") return 159; if (name == "SEND_CUSTOM_SVC_NOTIFICATION") return 160; if (name == "CHANGE_HOST_NOTIFICATION_TIMEPERIOD") return 161; if (name == "CHANGE_SVC_NOTIFICATION_TIMEPERIOD") return 162; if (name == "CHANGE_CONTACT_HOST_NOTIFICATION_TIMEPERIOD") return 163; if (name == "CHANGE_CONTACT_SVC_NOTIFICATION_TIMEPERIOD") return 164; if (name == "CHANGE_HOST_MODATTR") return 165; if (name == "CHANGE_SVC_MODATTR") return 166; if (name == "CHANGE_CONTACT_MODATTR") return 167; if (name == "CHANGE_CONTACT_MODHATTR") return 168; if (name == "CHANGE_CONTACT_MODSATTR") return 169; if (name == "SYNC_STATE_INFORMATION") return 170; if (name == "DEL_DOWNTIME_BY_HOST_NAME") return 171; if (name == "DEL_DOWNTIME_BY_HOSTGROUP_NAME") return 172; if (name == "DEL_DOWNTIME_BY_START_TIME_COMMENT") return 173; if (name == "ACKNOWLEDGE_HOST_PROBLEM_EXPIRE") return 174; if (name == "ACKNOWLEDGE_SVC_PROBLEM_EXPIRE") return 175; if (name == "DISABLE_NOTIFICATIONS_EXPIRE_TIME") return 176; if (name == "CUSTOM_COMMAND") return 999; return 0; }
ogg1980/icinga2
lib/icinga/compatutility.cpp
C++
gpl-2.0
32,466
<?php /** * Copyright © Magento, Inc. All rights reserved. * See COPYING.txt for license details. */ /** * Sales order view items block * * @author Magento Core Team <core@magentocommerce.com> */ namespace Magento\Shipping\Block; /** * @api * @since 100.0.2 */ class Items extends \Magento\Sales\Block\Items\AbstractItems { /** * Core registry * * @var \Magento\Framework\Registry */ protected $_coreRegistry = null; /** * @param \Magento\Framework\View\Element\Template\Context $context * @param \Magento\Framework\Registry $registry * @param array $data */ public function __construct( \Magento\Framework\View\Element\Template\Context $context, \Magento\Framework\Registry $registry, array $data = [] ) { $this->_coreRegistry = $registry; parent::__construct($context, $data); } /** * Retrieve current order model instance * * @return \Magento\Sales\Model\Order */ public function getOrder() { return $this->_coreRegistry->registry('current_order'); } /** * @param object $shipment * @return string */ public function getPrintShipmentUrl($shipment) { return $this->getUrl('*/*/printShipment', ['shipment_id' => $shipment->getId()]); } /** * @param object $order * @return string */ public function getPrintAllShipmentsUrl($order) { return $this->getUrl('*/*/printShipment', ['order_id' => $order->getId()]); } /** * Get html of shipment comments block * * @param \Magento\Sales\Model\Order\Shipment $shipment * @return string */ public function getCommentsHtml($shipment) { $html = ''; $comments = $this->getChildBlock('shipment_comments'); if ($comments) { $comments->setEntity($shipment)->setTitle(__('About Your Shipment')); $html = $comments->toHtml(); } return $html; } }
kunj1988/Magento2
app/code/Magento/Shipping/Block/Items.php
PHP
gpl-2.0
2,035
<?php /** * @file * Provides hook documentation for PGAPI module. */ function hook_pgapi_callback($transaction) { } function hook_pgapi_format_price($type, $price, $symbol) { } function hook_pgapi_transaction($status, $transaction) { } function hook_pgapi_transaction_all($status, $transaction) { } function hook_pgapi_gw($op, $a3 = NULL, $a4 = NULL) { } function hook_pgapi_transaction_status(&$status) { } function hook_pgapi_transaction_workflow(&$workflow) { }
usabilidoido/corais
sites/all/modules/pgapi/pgapi.api.php
PHP
gpl-2.0
489
class Ruby_highline < PACKMAN::Package url PACKMAN.gem_url('highline-1.7.2.gem') sha1 'd7114ed98c5651b928cc7195aded7b0000e09689' version '1.7.2' label :try_system_package_first def install PACKMAN.gem "install highline-#{version}.gem" end def remove PACKMAN.gem 'uninstall -x highline' end def installed? PACKMAN.is_gem_installed? 'highline', version end end
dongli/packman
packages/ruby_highline.rb
Ruby
gpl-2.0
395
spellEffects[ 'FlagFlap' ] = function( args ) { var self = this, _ccd = Component.bugcraft.currentCharacterObject.characterData, _moveFrames = {}, _tc = args.targetCharacter, _tcd = _tc.characterData, _changeFrameFunctionPointer = null, _currentIndex = 1, _maxFrames = 1, _backgroundSound = null; this.ID = spellEffects.layer[0].push( this ) - 1; this.characterSpellEffectID = _tc._internal.spellEffects.push( this ) - 1; this.offsetX = 20; this.offsetY = 20; this.rotation = _tcd.character_rotation; this.deleteRange = 40; this.previousX = _tcd.character_zone_x - this.offsetX; this.previousY = _tcd.character_zone_y - this.offsetY; // initialize var _soundLoop = function() { _backgroundSound = Application.sound.playExclusive({ url: '/components/bugcraft/resources/public/component.bugcraft.spellEffects/sounds/FlagFlap/FlagFlap.mp3', volume: spellEffects.volumeByRangeVoice( _ccd.character_zone_x, _ccd.character_zone_y, _tcd.character_zone_x, _tcd.character_zone_y, spellEffects.volumeRangeLong ), onFinish: function() { _soundLoop(); } }); } // for(var i=1;i<=_maxFrames;i++) // { // _moveFrames[ i ] = { image: new Image(), alpha: 0 }; // _moveFrames[ i ].image.src = '/components/bugcraft/resources/public/component.bugcraft.spellEffects/images/FlagFlap/FlagFlap' + i + '.png'; // } //draw the bombardierBeetleDeath spatter this.draw = function() { // Map.ctx.save(); // Map.ctx.translate( self.previousX + self.offsetX + Map.viewPortX, self.previousY + self.offsetY + Map.viewPortY ); // Map.ctx.rotate( ( self.rotation - 90 ) * Math.PI / 180 ); // Map.ctx.shadowColor = 'rgba(0, 0, 0, 0.7)'; // Map.ctx.shadowOffsetX = 3; // Map.ctx.shadowOffsetY = 3; // Map.ctx.drawImage( // _moveFrames[ _currentIndex ].image, // - self.offsetX, // - self.offsetY // ); // Map.ctx.restore(); // Map.ctx.globalAlpha = 1; } //remove the deathDecay this.remove = function() { clearTimeout( _changeFrameFunctionPointer ); if( _backgroundSound ) { _backgroundSound.stop(); } spellEffects.layerCleaner.push( this ); spellEffects.layer[0][ this.ID ] = null; delete _tc._internal.spellEffects[ this.characterSpellEffectID ]; } var _changeFrameFunction = function() { _currentIndex++; if( _currentIndex > _maxFrames ) { _currentIndex = 1; setTimeout( _changeFrameFunction, 2000 + Math.random() * 5000 ); return; } _changeFrameFunctionPointer = setTimeout( _changeFrameFunction, 100 ); } _soundLoop(); // _changeFrameFunction(); } //end bombardierBeetleDeath
victoralex/gameleon
public_web/components/bugcraft/resources/public/component.bugcraft.spellEffects/class.spellEffects.FlagFlap.js
JavaScript
gpl-2.0
3,039
/* Copyright (c) 2008 Volker Krause <vkrause@kde.org> This library is free software; you can redistribute it and/or modify it under the terms of the GNU Library General Public License as published by the Free Software Foundation; either version 2 of the License, or (at your option) any later version. This library is distributed in the hope that it will be useful, but WITHOUT ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU Library General Public License for more details. You should have received a copy of the GNU Library General Public License along with this library; see the file COPYING.LIB. If not, write to the Free Software Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. */ #include "entitydisplayattribute.h" #include "imapparser_p.h" #include <KIcon> using namespace Akonadi; class EntityDisplayAttribute::Private { public: Private() : hidden(false) { } QString name; QString icon; QString activeIcon; QColor backgroundColor; bool hidden; }; EntityDisplayAttribute::EntityDisplayAttribute() : d(new Private) { } EntityDisplayAttribute::~ EntityDisplayAttribute() { delete d; } QString EntityDisplayAttribute::displayName() const { return d->name; } void EntityDisplayAttribute::setDisplayName(const QString &name) { d->name = name; } KIcon EntityDisplayAttribute::icon() const { return KIcon(d->icon); } QString EntityDisplayAttribute::iconName() const { return d->icon; } void EntityDisplayAttribute::setIconName(const QString &icon) { d->icon = icon; } QByteArray Akonadi::EntityDisplayAttribute::type() const { return "ENTITYDISPLAY"; } EntityDisplayAttribute *EntityDisplayAttribute::clone() const { EntityDisplayAttribute *attr = new EntityDisplayAttribute(); attr->d->name = d->name; attr->d->icon = d->icon; attr->d->activeIcon = d->activeIcon; attr->d->backgroundColor = d->backgroundColor; return attr; } QByteArray EntityDisplayAttribute::serialized() const { QList<QByteArray> l; l << ImapParser::quote(d->name.toUtf8()); l << ImapParser::quote(d->icon.toUtf8()); l << ImapParser::quote(d->activeIcon.toUtf8()); QList<QByteArray> components; if (d->backgroundColor.isValid()) { components = QList<QByteArray>() << QByteArray::number(d->backgroundColor.red()) << QByteArray::number(d->backgroundColor.green()) << QByteArray::number(d->backgroundColor.blue()) << QByteArray::number(d->backgroundColor.alpha()); } l << '(' + ImapParser::join(components, " ") + ')'; return '(' + ImapParser::join(l, " ") + ')'; } void EntityDisplayAttribute::deserialize(const QByteArray &data) { QList<QByteArray> l; ImapParser::parseParenthesizedList(data, l); int size = l.size(); Q_ASSERT(size >= 2); d->name = QString::fromUtf8(l[0]); d->icon = QString::fromUtf8(l[1]); if (size >= 3) { d->activeIcon = QString::fromUtf8(l[2]); } if (size >= 4) { if (!l[3].isEmpty()) { QList<QByteArray> componentData; ImapParser::parseParenthesizedList(l[3], componentData); if (componentData.size() != 4) { return; } QList<int> components; bool ok; for (int i = 0; i <= 3; ++i) { components << componentData.at(i).toInt(&ok); if (!ok) { return; } } d->backgroundColor = QColor(components.at(0), components.at(1), components.at(2), components.at(3)); } } } void EntityDisplayAttribute::setActiveIconName(const QString &name) { d->activeIcon = name; } KIcon EntityDisplayAttribute::activeIcon() const { return KIcon(d->activeIcon); } QString EntityDisplayAttribute::activeIconName() const { return d->activeIcon; } QColor EntityDisplayAttribute::backgroundColor() const { return d->backgroundColor; } void EntityDisplayAttribute::setBackgroundColor(const QColor &color) { d->backgroundColor = color; }
kolab-groupware/kdepimlibs
akonadi/entitydisplayattribute.cpp
C++
gpl-2.0
4,253
/* * Turbo Sliders++ * Copyright (C) 2013-2014 Martin Newhouse * * This program is free software; you can redistribute it and/or modify * it under the terms of the GNU General Public License as published by * the Free Software Foundation; either version 2 of the License, or * (at your option) any later version. * * This program is distributed in the hope that it will be useful, * but WITHOUT ANY WARRANTY; without even the implied warranty of * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the * GNU General Public License for more details. * * You should have received a copy of the GNU General Public License along * with this program; if not, write to the Free Software Foundation, Inc., * 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA. */ #pragma once #ifndef GUI_INPUT_INTERFACE_HPP #define GUI_INPUT_INTERFACE_HPP #include <SFML/Window.hpp> #include "mouse.hpp" namespace ts { namespace gui { struct Key_modifiers { static const unsigned int None = 0; static const unsigned int Shift = 1; static const unsigned int Ctrl = 2; static const unsigned int Alt = 4; }; struct SFML_Input_interface { public: void handle_event(const sf::Event& event); protected: ~SFML_Input_interface() = default; private: virtual void process_mouse_move(Vector2i new_position, unsigned int key_modifiers) = 0; virtual void process_mouse_button_down(mouse::Button button, unsigned int key_modifiers) = 0; virtual void process_mouse_button_up(mouse::Button button, unsigned int key_modifiers) = 0; virtual void process_mouse_wheel(int wheel_delta, unsigned int key_modifiers) = 0; virtual void process_key_up(sf::Keyboard::Key key_code, unsigned int key_modifiers) = 0; virtual void process_key_down(sf::Keyboard::Key key_code, unsigned int key_modifiers) = 0; virtual void process_text_input(utf8::uint32_t code_point) = 0; }; } } #endif
mnewhouse/tspp
src/user_interface/input_interface.hpp
C++
gpl-2.0
2,178
using System; using System.Collections.Generic; using System.Linq; using System.Text; using Virvar.Net; using Microsoft.Xna.Framework; using GameObjects.DrawableClasses; using GameObjects; using GameObjects.ProtoClasses; namespace GameProcess.Actors.Client { class HitsActor : IActor, IClientPacketHandler { private GameStateClient _gameState; public HitsActor(GameStateClient gameState) { this._gameState = gameState; } public void Update(GameTime gameTime) { ushort sequence = _gameState.NetPlayer.ClientPacket.Sequence; lock (_gameState.NetPlayer.ClientPacket.Shoots) { lock (_gameState.Player) { _gameState.NetPlayer.ClientPacket.Shoots[sequence] = _gameState.Player.ShootingTime; _gameState.Player.ShootingTime = 0; } } } public void Receive(ServerPacket msg) { // анимация выстрела foreach (var player in _gameState.Players.Values) { player.IsShooting = false; } lock (msg.ShootingPlayers) { foreach (var player in msg.ShootingPlayers) { _gameState.Players[player].IsShooting = true; } } // удаляем из пакета выстрелы игрока, которые уже были обработаны сервером HashSet<ushort> keysToRemove = new HashSet<ushort>(); foreach (var shootSeq in _gameState.NetPlayer.ClientPacket.Shoots.Keys) { if (msg.Ack > shootSeq) { keysToRemove.Add(shootSeq); } } float deletedValue; foreach (var key in keysToRemove) { _gameState.NetPlayer.ClientPacket.Shoots.TryRemove(key, out deletedValue); } } } }
virvar/StillAlive
StillAlive/GameProcess/Actors/Client/HitsActor.cs
C#
gpl-2.0
2,078
<?php /** * @package RedSHOP.Backend * @subpackage Table * * @copyright Copyright (C) 2008 - 2015 redCOMPONENT.com. All rights reserved. * @license GNU General Public License version 2 or later; see LICENSE */ defined('_JEXEC') or die; class Tablesample_detail extends JTable { public $sample_id = null; public $sample_name = null; public $published = null; public function __construct(&$db) { $this->_table_prefix = '#__redshop_'; parent::__construct($this->_table_prefix . 'catalog_sample', 'sample_id', $db); } public function bind($array, $ignore = '') { if (array_key_exists('params', $array) && is_array($array['params'])) { $registry = new JRegistry; $registry->loadArray($array['params']); $array['params'] = $registry->toString(); } return parent::bind($array, $ignore); } }
RCoomes/reynard-rs-v1.5.0.4
component/admin/tables/sample_detail.php
PHP
gpl-2.0
839
package com.jhr.jarvis.commands; import java.io.IOException; import java.util.Date; import java.util.HashMap; import java.util.List; import java.util.Map; import java.util.stream.Collectors; import org.springframework.beans.factory.annotation.Autowired; import org.springframework.shell.core.CommandMarker; import org.springframework.shell.core.annotation.CliCommand; import org.springframework.shell.core.annotation.CliOption; import org.springframework.shell.support.util.OsUtils; import org.springframework.shell.support.util.StringUtils; import org.springframework.stereotype.Component; import com.fasterxml.jackson.core.JsonParseException; import com.fasterxml.jackson.databind.JsonMappingException; import com.google.common.collect.ImmutableList; import com.jhr.jarvis.exceptions.SystemNotFoundException; import com.jhr.jarvis.model.Ship; import com.jhr.jarvis.model.StarSystem; import com.jhr.jarvis.model.Station; import com.jhr.jarvis.service.ShipService; import com.jhr.jarvis.service.StarSystemService; import com.jhr.jarvis.service.StationService; import com.jhr.jarvis.table.TableRenderer; import com.jhr.jarvis.util.DrawUtils; @Component public class SystemCommands implements CommandMarker { @Autowired private ShipService shipService; @Autowired private StarSystemService starSystemService; @Autowired private StationService stationService; @Autowired private DrawUtils drawUtils; @CliCommand(value = { "system" }, help = "usage: system <exact or starts with>") public String osystem( @CliOption(key = { "", "command" }, optionContext = "disable-string-converter availableCommands", help = "usage: system <regex>") String buffer) { String out = ""; String usage = "Usage: sys <regex>"; StarSystem starSystem; Date start = new Date(); if (StringUtils.isEmpty(buffer)) { out += drawUtils.messageBox(3, "Error: No systems matching '" + buffer + "' could be found.", usage, "Jarvis won't store a system until you've been close to it."); return out; } try { starSystem = starSystemService.findExactSystemOrientDb(buffer); } catch (SystemNotFoundException e) { List<StarSystem> systems = starSystemService.findSystemsOrientDb(buffer); if (systems.size() == 0) { out += drawUtils.messageBox(3, "Error: No systems matching '" + buffer + "' could be found.", "Jarvis won't load a system until you've been close to it."); return out; } else if (systems.size() == 1) { starSystem = systems.get(0); } else { List<Map<String, Object>> tableData = systems.stream().map(sys->{ Map<String, Object> tableRow = new HashMap<>(); tableRow.put("SYSTEM", sys.getName()); tableRow.put("X", sys.getX()); tableRow.put("Y", sys.getY()); tableRow.put("Z", sys.getZ()); return tableRow; }).collect(Collectors.toList()); out += "Systems matching '" + buffer + "'" + OsUtils.LINE_SEPARATOR; out += OsUtils.LINE_SEPARATOR + TableRenderer.renderMapDataAsTable(tableData, ImmutableList.of("SYSTEM", "X", "Y", "Z")); out += OsUtils.LINE_SEPARATOR + "executed in " + (new Date().getTime() - start.getTime())/1000.0 + " seconds."; return out; } } out += starSystemService.printStarSystemTable(starSystem); return out; } @CliCommand(value = { "path" }, help = "usage: path --from 'System Name' --to 'System Name'") public String path( @CliOption(key = { "from" }, mandatory = false, help = "Starting System") final String from, @CliOption(key = { "to" }, mandatory = false, help = "End System") final String to ) throws JsonParseException, JsonMappingException, IOException { String out = ""; String usage = "Usage: path --from 'System Name' --to 'System Name'"; Ship ship; try { ship = shipService.loadShip(); } catch (IOException e) { out += drawUtils.messageBox(3, "Error: There was an error loading your ship.", "Check your write permissions in the ../data dir."); return out; } StarSystem foundFrom = null; if (StringUtils.isEmpty(from)) { String storedSystem = starSystemService.getUserLastStoredSystem(); if (StringUtils.isEmpty(storedSystem)) { out += drawUtils.messageBox(3, "Error: Could not find 'from' system matching '" + from + "'", usage, "Example: path --from igala --to pemede", "If you have stored a station with a 'find' or 'station' command, it will default to 'from'."); return out; } try { foundFrom = starSystemService.findExactSystemOrientDb(storedSystem); } catch (SystemNotFoundException e) { out += drawUtils.messageBox(3, "Error: Could not find 'from' system matching '" + from + "'", usage, "Example: path --from igala --to pemede", "If you have stored a station with a 'find' or 'station' command, it will default to 'from'."); return out; } } else { try { foundFrom = starSystemService.findUniqueSystemOrientDb(from); } catch (SystemNotFoundException e) { out += drawUtils.messageBox(3, "Error: Could not find 'from' system matching '" + from + "'", usage, "Example: path --from igala --to pemede"); return out; } } StarSystem foundTo = null; if (StringUtils.isEmpty(to)) { out += drawUtils.messageBox(3, "Error: Could not find 'to' system matching '" + to + "'", usage, "Example: path --from igala --to pemede"); return out; } try { foundTo = starSystemService.findUniqueSystemOrientDb(to); } catch (SystemNotFoundException e) { out += drawUtils.messageBox(3, "Error: Could not find 'to' system matching '" + to + "'", usage, "Example: path --from igala --to pemede"); return out; } return starSystemService.calculateShortestPathBetweenSystems(ship, foundFrom.getName(), foundTo.getName()); } }
jrosocha/jarvisCli
src/main/java/com/jhr/jarvis/commands/SystemCommands.java
Java
gpl-2.0
7,281
module Katello class ProductsController < Katello::ApplicationController respond_to :html, :js before_action :find_product, :only => [:available_repositories, :toggle_repository] before_action :find_provider, :only => [:available_repositories, :toggle_repository] before_action :find_content, :only => [:toggle_repository] include ForemanTasks::Triggers def section_id 'contents' end def available_repositories if @product.custom? render_bad_parameters _('Repository sets are not available for custom products.') else task = sync_task(::Actions::Katello::RepositorySet::ScanCdn, @product, params[:content_id]) repos = task.output[:results] repos = exclude_rolling_kickstart_repos(repos) repos = available_synced_repos(repos, params[:content_id]) locals = {:scan_cdn => task, :repos => repos, :error_message => nil} locals[:error_message => task_error(task)] if task.result == 'warning' render :partial => 'katello/providers/redhat/repos', :locals => locals end end def toggle_repository action_class = if params[:repo] == '1' ::Actions::Katello::RepositorySet::EnableRepository else ::Actions::Katello::RepositorySet::DisableRepository end task = sync_task(action_class, @product, @content, substitutions) render :json => { :task_id => task.id } rescue => e render :partial => 'katello/providers/redhat/enable_errors', :locals => { :error_message => e.message}, :status => 500 end private def find_provider @provider = @product.provider if @product #don't trust the provider_id coming in if we don't need it @provider ||= Provider.find(params[:provider_id]) end def find_product @product = Product.find(params[:id]) end def find_content if (product_content = @product.product_content_by_id(params[:content_id])) @content = product_content.content else fail HttpErrors::NotFound, _("Couldn't find content '%s'") % params[:content_id] end end def substitutions params.permit(:basearch, :releasever, :registry_name).to_h end def task_error(task) task.failed_steps.first.action(task.execution_plan).steps.map { |s| s.try(:error).try(:message) }.reject(&:blank?).join(', ') end def exclude_rolling_kickstart_repos(repos) repos.select do |repo| if repo[:path].include?('kickstart') variants = ['Server', 'Client', 'ComputeNode', 'Workstation'] has_variant = variants.any? { |v| repo[:substitutions][:releasever].try(:include?, v) } has_variant ? repo[:enabled] : true else true end end end def available_synced_repos(repos, content_id) @product.repositories.in_default_view.where(:content_id => content_id).find_each do |product_repo| found = repos.detect do |repo| product_repo.id == repo[:repository_id] end unless found repos << { :repo_name => product_repo.name, :path => product_repo.url, :pulp_id => product_repo.pulp_id, :content_id => product_repo.content_id, :substitutions => { :basearch => product_repo.arch, :releasever => product_repo.minor }, :enabled => true, :promoted => product_repo.promoted?, :registry_name => product_repo.docker_upstream_name } end end repos end end end
stbenjam/katello
app/controllers/katello/products_controller.rb
Ruby
gpl-2.0
3,669
<?php /* +--------------------------------------------------------------------+ | CiviCRM version 1.8 | +--------------------------------------------------------------------+ | Copyright CiviCRM LLC (c) 2004-2007 | +--------------------------------------------------------------------+ | This file is a part of CiviCRM. | | | | CiviCRM is free software; you can copy, modify, and distribute it | | under the terms of the Affero General Public License Version 1, | | March 2002. | | | | CiviCRM is distributed in the hope that it will be useful, but | | WITHOUT ANY WARRANTY; without even the implied warranty of | | MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. | | See the Affero General Public License for more details. | | | | You should have received a copy of the Affero General Public | | License along with this program; if not, contact CiviCRM LLC | | at info[AT]civicrm[DOT]org. If you have questions about the | | Affero General Public License or the licensing of CiviCRM, | | see the CiviCRM license FAQ at http://civicrm.org/licensing | +--------------------------------------------------------------------+ */ /** * * * @package CRM * @copyright CiviCRM LLC (c) 2004-2007 * $Id$ * */ class CRM_Core_BAO_CustomQuery { const PREFIX = 'custom_value_'; /** * the set of custom field ids * * @var array */ protected $_ids; /** * the select clause * * @var array */ public $_select; /** * the name of the elements that are in the select clause * used to extract the values * * @var array */ public $_element; /** * the tables involved in the query * * @var array */ public $_tables; public $_whereTables; /** * the where clause * * @var array */ public $_where; /** * The english language version of the query * * @var array */ public $_qill; /** * The cache to translate the option values into labels * * @var array */ public $_options; /** * The custom fields information * * @var array */ protected $_fields; /** * This stores custom data group types and tables that it extends * * @var array * @static */ static $extendsMap = array( 'Contact' => 'civicrm_contact', 'Individual' => 'civicrm_contact', 'Household' => 'civicrm_contact', 'Organization' => 'civicrm_contact', 'Contribution' => 'civicrm_contribution', 'Membership' => 'civicrm_membership', 'Participant' => 'civicrm_participant', 'Group' => 'civicrm_group', 'Relationship' => 'civicrm_relationship', 'Event' => 'civicrm_event', 'Activity' => 'civicrm_activity', 'Meeting' => 'civicrm_meeting', 'Phonecall' => 'civicrm_phonecall' ); /** * class constructor * * Takes in a set of custom field ids andsets up the data structures to * generate a query * * @param array $ids the set of custom field ids * * @access public */ function __construct( $ids ) { $this->_ids =& $ids; $this->_select = array( ); $this->_element = array( ); $this->_tables = array( ); $this->_whereTables = array( ); $this->_where = array( ); $this->_qill = array( ); $this->_options = array( ); $this->_fields = array( ); if ( empty( $this->_ids ) ) { return; } // initialize the field array $tmpArray = array_keys( $this->_ids ); $query = 'select * from civicrm_custom_field where is_active = 1 AND id IN ( ' . implode( ',', $tmpArray ) . ' ) '; $dao =& CRM_Core_DAO::executeQuery( $query, CRM_Core_DAO::$_nullArray ); $optionIds = array( ); while ( $dao->fetch( ) ) { // get the group dao to figure which class this custom field extends $extends =& CRM_Core_DAO::getFieldValue( 'CRM_Core_DAO_CustomGroup', $dao->custom_group_id, 'extends' ); $extendsTable = self::$extendsMap[$extends]; $this->_fields[$dao->id] = array( 'id' => $dao->id, 'label' => $dao->label, 'extends' => $extendsTable, 'data_type' => $dao->data_type, 'html_type' => $dao->html_type, 'is_search_range' => $dao->is_search_range, 'db_field' => CRM_Core_BAO_CustomValue::typeToField( $dao->data_type ) ); // store it in the options cache to make things easier // during option lookup $this->_options[$dao->id] = array( ); $this->_options[$dao->id]['attributes'] = array( 'label' => $dao->label, 'data_type' => $dao->data_type, 'html_type' => $dao->html_type ); if ( $dao->html_type == 'CheckBox' || $dao->html_type == 'Radio' || $dao->html_type == 'Select' || $dao->html_type == 'Multi-Select' ) { $optionIds[] = $dao->id; } } // build the cache for custom values with options (label => value) if ( ! empty( $optionIds ) ) { $optionIdString = implode( ',', $optionIds ); $query = " SELECT entity_id, label, value FROM civicrm_custom_option WHERE entity_id IN ( $optionIdString ) AND entity_table = 'civicrm_custom_field' "; $dao =& CRM_Core_DAO::executeQuery( $query, CRM_Core_DAO::$_nullArray ); while ( $dao->fetch( ) ) { $dataType = $this->_fields[$dao->entity_id]['data_type']; if ( $dataType == 'Int' || $dataType == 'Float' ) { $num = round($dao->value, 2); $this->_options[$dao->entity_id]["$num"] = $dao->label; } else { $this->_options[$dao->entity_id][$dao->value] = $dao->label; } } } } /** * generate the select clause and the associated tables * for the from clause * * @param NULL * @return void * @access public */ function select( ) { if ( empty( $this->_fields ) ) { return; } foreach ( $this->_fields as $id => $field ) { $name = self::PREFIX . $field['id']; $fieldName = 'custom_' . $field['id']; $this->_select["{$name}_id"] = "{$name}.id as {$name}_id"; $this->_element["{$name}_id"] = 1; $this->_select[$fieldName] = $name . '.' . $field['db_field'] . " as $fieldName"; $this->_element[$fieldName] = 1; if ( $field['extends'] == 'civicrm_contact' ) { $this->_tables[$name] = "\nLEFT JOIN civicrm_custom_value $name ON $name.custom_field_id = " . $field['id'] . " AND $name.entity_table = 'civicrm_contact' AND $name.entity_id = contact_a.id "; if ( $this->_ids[$id] ) { $this->_whereTables[$name] = $this->_tables[$name]; } } else if ( $field['extends'] == 'civicrm_contribution' ) { $this->_tables[$name] = "\nLEFT JOIN civicrm_custom_value $name ON $name.custom_field_id = " . $field['id'] . " AND $name.entity_table = 'civicrm_contribution' AND $name.entity_id = civicrm_contribution.id "; $this->_whereTables['civicrm_contribution'] = $this->_tables['civicrm_contribution'] = 1; if ( $this->_ids[$id] ) { $this->_whereTables[$name] = $this->_tables[$name]; } } else if ( $field['extends'] == 'civicrm_participant' ) { $this->_tables[$name] = "\nLEFT JOIN civicrm_custom_value $name ON $name.custom_field_id = " . $field['id'] . " AND $name.entity_table = 'civicrm_participant' AND $name.entity_id = civicrm_participant.id "; $this->_whereTables['civicrm_participant'] = $this->_tables['civicrm_participant'] = 1; if ( $this->_ids[$id] ) { $this->_whereTables[$name] = $this->_tables[$name]; } } else if ( $field['extends'] == 'civicrm_membership' ) { $this->_tables[$name] = "\nLEFT JOIN civicrm_custom_value $name ON $name.custom_field_id = " . $field['id'] . " AND $name.entity_table = 'civicrm_membership' AND $name.entity_id = civicrm_membership.id "; $this->_whereTables['civicrm_membership'] = $this->_tables['civicrm_membership'] = 1; if ( $this->_ids[$id] ) { $this->_whereTables[$name] = $this->_tables[$name]; } } } } /** * generate the where clause and also the english language * equivalent * * @param NULL * * @return void * * @access public */ function where( ) { //CRM_Core_Error::debug( 'fld', $this->_fields ); //CRM_Core_Error::debug( 'ids', $this->_ids ); foreach ( $this->_ids as $id => $values ) { // Fixed for Isuue CRM 607 if ( CRM_Utils_Array::value( $id, $this->_fields ) === null || ! $values ) { continue; } foreach ( $values as $tuple ) { list( $name, $op, $value, $grouping, $wildcard ) = $tuple; // fix $value here to escape sql injection attacks $field = $this->_fields[$id]; $qillValue = CRM_Core_BAO_CustomField::getDisplayValue( $value, $id, $this->_options ); if ( ! is_array( $value ) ) { $value = addslashes(trim($value)); } switch ( $field['data_type'] ) { case 'String': $sql = 'LOWER(' . self::PREFIX . $field['id'] . '.char_data) '; // if we are coming in from listings, for checkboxes the value is already in the right format and is NOT an array if ( is_array( $value ) ) { require_once 'CRM/Core/BAO/CustomOption.php'; //ignoring $op value for checkbox and multi select $sqlValue = array( ); if ($field['html_type'] == 'CheckBox') { foreach ( $value as $k => $v ) { $sqlValue[] = "( $sql like '%" . CRM_Core_BAO_CustomOption::VALUE_SEPERATOR . $k . CRM_Core_BAO_CustomOption::VALUE_SEPERATOR . "%' ) "; } $this->_where[$grouping][] = implode( ' AND ', $sqlValue ); $this->_qill[$grouping][] = "$field[label] $op $qillValue"; } else { // for multi select foreach ( $value as $k => $v ) { $sqlValue[] = "( $sql like '%" . CRM_Core_BAO_CustomOption::VALUE_SEPERATOR . $v . CRM_Core_BAO_CustomOption::VALUE_SEPERATOR . "%' ) "; } $this->_where[$grouping][] = implode( ' AND ', $sqlValue ); $this->_qill[$grouping][] = "$field[label] $op $qillValue"; } } else { if ( $field['is_search_range'] && is_array( $value ) ) { $this->searchRange( $field['id'], $field['label'], 'char_data', $value, $grouping ); } else { $val = CRM_Utils_Type::escape( strtolower(trim($value)), 'String' ); $this->_where[$grouping][] = "{$sql} {$op} '{$val}'"; $this->_qill[$grouping][] = "$field[label] $op $qillValue"; } } continue; case 'Int': if ( $field['is_search_range'] && is_array( $value ) ) { $this->searchRange( $field['id'], $field['label'], 'int_data', $value, $grouping ); } else { $this->_where[$grouping][] = self::PREFIX . $field['id'] . ".int_data {$op} " . CRM_Utils_Type::escape( $value, 'Integer' ); $this->_qill[$grouping][] = $field['label'] . " $op $value"; } continue; case 'Boolean': $value = (int ) $value; $value = ( $value == 1 ) ? 1 : 0; $this->_where[$grouping][] = self::PREFIX . $field['id'] . ".int_data {$op} " . CRM_Utils_Type::escape( $value, 'Integer' ); $value = $value ? ts('Yes') : ts('No'); $this->_qill[$grouping][] = $field['label'] . " {$op} {$value}"; continue; case 'Float': if ( $field['is_search_range'] && is_array( $value ) ) { $this->searchRange( $field['id'], $field['label'], 'float_data', $value, $grouping ); } else { $this->_where[$grouping][] = self::PREFIX . $field['id'] . ".float_data {$op} " . CRM_Utils_Type::escape( $value, 'Float' ); $this->_qill[$grouping][] = $field['label'] . " {$op} {$value}"; } continue; case 'Money': if ( $field['is_search_range'] && is_array( $value ) ) { foreach( $value as $key => $val ) { require_once "CRM/Utils/Rule.php"; $moneyFormat = CRM_Utils_Rule::cleanMoney($value[$key]); $value[$key] = $moneyFormat; } $this->searchRange( $field['id'], $field['label'], 'decimal_data', $value, $grouping ); } else { $moneyFormat = CRM_Utils_Rule::cleanMoney($value); $value = $moneyFormat; $this->_where[$grouping][] = self::PREFIX . $field['id'] . ".decimal_data {$op} " . CRM_Utils_Type::escape( $value, 'Float' ); $this->_qill[$grouping][] = $field['label'] . " {$op} {$value}"; } continue; case 'Memo': $val = CRM_Utils_Type::escape( strtolower(trim($value)), 'String' ); $this->_where[$grouping][] = self::PREFIX . $field['id'] . ".memo_data {$op} '{$val}'"; $this->_qill[$grouping][] = "$field[label] $op $value"; continue; case 'Date': $fromValue = CRM_Utils_Array::value( 'from', $value ); $toValue = CRM_Utils_Array::value( 'to' , $value ); if ( ! $fromValue && ! $toValue ) { $date = CRM_Utils_Date::format( $value ); if ( ! $date ) { continue; } $this->_where[$grouping][] = self::PREFIX . $field['id'] . ".date_data {$op} {$date}"; $date = CRM_Utils_Date::format( $value, '-' ); $this->_qill[$grouping][] = $field['label'] . " {$op} " . CRM_Utils_Date::customFormat( $date ); } else { $fromDate = CRM_Utils_Date::format( $fromValue ); $toDate = CRM_Utils_Date::format( $toValue ); if ( ! $fromDate && ! $toDate ) { continue; } if ( $fromDate ) { $this->_where[$grouping][] = self::PREFIX . $field['id'] . ".date_data >= $fromDate"; $fromDate = CRM_Utils_Date::format( $fromValue, '-' ); $this->_qill[$grouping][] = $field['label'] . ' >= ' . CRM_Utils_Date::customFormat( $fromDate ); } if ( $toDate ) { $this->_where[$grouping][] = self::PREFIX . $field['id'] . ".date_data <= $toDate"; $toDate = CRM_Utils_Date::format( $toValue, '-' ); $this->_qill[$grouping][] = $field['label'] . ' <= ' . CRM_Utils_Date::customFormat( $toDate ); } } continue; case 'StateProvince': $states =& CRM_Core_PseudoConstant::stateProvince(); if ( ! is_numeric( $value ) ) { $value = array_search( $value, $states ); } if ( $value ) { $this->_where[$grouping][] = self::PREFIX . $field['id'] . ".int_data {$op} " . CRM_Utils_Type::escape( $value, 'Int' ); $this->_qill[$grouping][] = $field['label'] . " {$op} {$states[$value]}"; } continue; case 'Country': $countries =& CRM_Core_PseudoConstant::country(); if ( ! is_numeric( $value ) ) { $value = array_search( $value, $countries ); } if ( $value ) { $this->_where[$grouping][] = self::PREFIX . $field['id'] . ".int_data {$op} " . CRM_Utils_Type::escape( $value, 'Int' ); $this->_qill[$grouping][] = $field['label'] . " {$op} {$countries[$value]}"; } continue; } } //CRM_Core_Error::debug( 'w', $this->_where ); } } /** * function that does the actual query generation * basically ties all the above functions together * * @param NULL * @return array array of strings * @access public */ function query( ) { $this->select( ); $this->where( ); $whereStr = null; if ( ! empty( $this->_where ) ) { $clauses = array( ); foreach ( $this->_where as $grouping => $values ) { if ( ! empty( $values ) ) { $clauses[] = implode( ' AND ', $values ); } } if ( ! empty( $clauses ) ) { $whereStr = implode( ' OR ', $clauses ); } } return array( implode( ' , ' , $this->_select ), implode( ' ' , $this->_tables ), $whereStr ); } function searchRange( &$id, &$label, $type, &$value, &$grouping ) { $qill = array( ); $crmType = CRM_Core_BAO_CustomValue::fieldToType( $type ); if ( isset( $value['from'] ) ) { $val = CRM_Utils_Type::escape( $value['from'], $crmType ); if ( $type == 'char_data' ) { $this->_where[$grouping][] = self::PREFIX . "$id.$type >= '$val'"; } else { $this->_where[$grouping][] = self::PREFIX . "$id.$type >= $val"; } $qill[] = ts( 'greater than or equal to "%1"', array( 1 => $value['from'] ) ); } if ( isset( $value['to'] ) ) { $val = CRM_Utils_Type::escape( $value['to'], $crmType ); if ( $type == 'char_data' ) { $this->_where[$grouping][] = self::PREFIX . "$id.$type <= '$val'"; } else { $this->_where[$grouping][] = self::PREFIX . "$id.$type <= $val"; } $qill[] = ts( 'less than or equal to "%1"', array( 1 => $value['to'] ) ); } if ( ! empty( $qill ) ) { $this->_qill[$grouping][] = $label . ' - ' . implode( ' ' . ts('and') . ' ', $qill ); } } } ?>
zakiya/Peoples-History
sites/all/modules/civicrm/CRM/Core/BAO/CustomQuery.php
PHP
gpl-2.0
21,723
#!/usr/bin/env python # -*- coding: utf-8 -*- # # Authors : David Castellanos <dcastellanos@indra.es> # # Copyright (c) 2012, Telefonica Móviles España S.A.U. # # This program is free software; you can redistribute it and/or # modify it under the terms of the GNU Lesser General Public # License as published by the Free Software Foundation; either # version 2.1 of the License, or (at your option) any later version. # # This program is distributed in the hope that it will be useful, # but WITHOUT ANY WARRANTY; without even the implied warranty of # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU # Lesser General Public License for more details. # # You should have received a copy of the GNU Lesser General Public # License along with this program; if not, write to the # Free Software Foundation, Inc., 59 Temple Place - Suite 330, # Boston, MA 02111-1307, USA. # """ TGCM Logging is a daemon designed to gather TGCM logs """ __version__ = '0.1' __author__ = 'David Castellanos <dcastellanos@indra.es>'
tgcmteam/tgcmlinux
src/tgcm/contrib/tgcm-logging/src/tgcmlogging/__init__.py
Python
gpl-2.0
1,034
Grailbird.data.tweets_2010_03 = [ { "source" : "\u003Ca href=\"http:\/\/twitter.com\" rel=\"nofollow\"\u003ETwitter Web Client\u003C\/a\u003E", "entities" : { "user_mentions" : [ ], "media" : [ ], "hashtags" : [ ], "urls" : [ ] }, "geo" : { }, "id_str" : "10548776482", "text" : "Published a new blog post: Of Themes and Winnings http:\/\/bit.ly\/cr7moP", "id" : 10548776482, "created_at" : "2010-03-16 00:00:00 +0000", "user" : { "name" : "Jamie Harrell", "screen_name" : "peoii", "protected" : false, "id_str" : "38397135", "profile_image_url_https" : "https:\/\/pbs.twimg.com\/profile_images\/567774981887508480\/kEDNPXn7_normal.jpeg", "id" : 38397135, "verified" : false } }, { "source" : "\u003Ca href=\"http:\/\/www.google.com\/\" rel=\"nofollow\"\u003EGoogle\u003C\/a\u003E", "entities" : { "user_mentions" : [ ], "media" : [ ], "hashtags" : [ ], "urls" : [ ] }, "geo" : { }, "id_str" : "10304534365", "text" : "I favorited a YouTube video -- Academy Award Winning Movie Trailer http:\/\/youtu.be\/nFicqklGuB0?a", "id" : 10304534365, "created_at" : "2010-03-11 00:00:00 +0000", "user" : { "name" : "Jamie Harrell", "screen_name" : "peoii", "protected" : false, "id_str" : "38397135", "profile_image_url_https" : "https:\/\/pbs.twimg.com\/profile_images\/567774981887508480\/kEDNPXn7_normal.jpeg", "id" : 38397135, "verified" : false } }, { "source" : "\u003Ca href=\"http:\/\/www.google.com\/\" rel=\"nofollow\"\u003EGoogle\u003C\/a\u003E", "entities" : { "user_mentions" : [ ], "media" : [ ], "hashtags" : [ ], "urls" : [ ] }, "geo" : { }, "id_str" : "10000863331", "text" : "I favorited a YouTube video -- Rise Against - Audience Of One http:\/\/youtu.be\/4MjLKjPc7q8?a", "id" : 10000863331, "created_at" : "2010-03-05 00:00:00 +0000", "user" : { "name" : "Jamie Harrell", "screen_name" : "peoii", "protected" : false, "id_str" : "38397135", "profile_image_url_https" : "https:\/\/pbs.twimg.com\/profile_images\/567774981887508480\/kEDNPXn7_normal.jpeg", "id" : 38397135, "verified" : false } }, { "source" : "\u003Ca href=\"http:\/\/www.google.com\/\" rel=\"nofollow\"\u003EGoogle\u003C\/a\u003E", "entities" : { "user_mentions" : [ ], "media" : [ ], "hashtags" : [ ], "urls" : [ ] }, "geo" : { }, "id_str" : "9992930940", "text" : "I favorited a YouTube video -- Capercaillie - Heart of the Highland http:\/\/youtu.be\/PZEIKnKLfVM?a", "id" : 9992930940, "created_at" : "2010-03-04 00:00:00 +0000", "user" : { "name" : "Jamie Harrell", "screen_name" : "peoii", "protected" : false, "id_str" : "38397135", "profile_image_url_https" : "https:\/\/pbs.twimg.com\/profile_images\/567774981887508480\/kEDNPXn7_normal.jpeg", "id" : 38397135, "verified" : false } }, { "source" : "\u003Ca href=\"http:\/\/www.google.com\/\" rel=\"nofollow\"\u003EGoogle\u003C\/a\u003E", "entities" : { "user_mentions" : [ ], "media" : [ ], "hashtags" : [ ], "urls" : [ ] }, "geo" : { }, "id_str" : "9992981333", "text" : "I favorited a YouTube video -- Regina Spektor - \"Us\" [OFFICIAL VIDEO] http:\/\/youtu.be\/x_13MYoqULM?a", "id" : 9992981333, "created_at" : "2010-03-04 00:00:00 +0000", "user" : { "name" : "Jamie Harrell", "screen_name" : "peoii", "protected" : false, "id_str" : "38397135", "profile_image_url_https" : "https:\/\/pbs.twimg.com\/profile_images\/567774981887508480\/kEDNPXn7_normal.jpeg", "id" : 38397135, "verified" : false } } ]
peoii/twit_archive
data/js/tweets/2010_03.js
JavaScript
gpl-2.0
3,659
<?php /** * fvcn-admin-dashboard.php * * Admin Dashboard * * @package FV Community News * @subpackage Admin Dashboard * @author Frank Verhoeven <info@frank-verhoeven.com> */ if (!defined('ABSPATH')) { exit; } /** * FvCommunityNews_Admin_Dashboard * */ class FvCommunityNews_Admin_Dashboard { /** * __construct() * * @version 20120729 * @return void */ public function __construct() { $this->registerWidgets(); } /** * registerWidgets() * * @version 20120719 * @return FvCommunityNews_Admin_Dashboard */ public function registerWidgets() { add_action('wp_dashboard_setup', array(new FvCommunityNews_Admin_Dashboard_Widget_RecentPosts(), 'register')); do_action('fvcn_register_dashboard_widgets'); return $this; } } /** * FvCommunityNews_Admin_Dashboard_Widget_RecentPosts_Interface * */ interface FvCommunityNews_Admin_Dashboard_Widget_RecentPosts_Interface { /** * register() * * @return FvCommunityNews_Admin_Dashboard_Widget_RecentPosts_Interface */ public function register(); /** * widget() * * @return void */ public function widget(); } /** * FvCommunityNews_Admin_Dashboard_Widget_RecentPosts * */ class FvCommunityNews_Admin_Dashboard_Widget_RecentPosts implements FvCommunityNews_Admin_Dashboard_Widget_RecentPosts_Interface { /** * __construct() * * @version 20120729 * @return void */ public function __construct() { add_action('fvcn_admin_enqueue_scripts', array($this, 'enqueueScripts')); add_action('fvcn_admin_head', array($this, 'dashboardHead')); add_action('wp_ajax_fvcn-dashboard-widget-rp-ajax', array($this, 'ajaxResponse')); $this->response(); } /** * enqueueScripts() * * @version 20120729 * @return void */ public function enqueueScripts() { wp_enqueue_script( 'fvcn-dashboard-widget-rp-js', FvCommunityNews_Registry::get('adminUrl') . 'js/dashboard.js', array('jquery'), '20120721' ); wp_localize_script( 'fvcn-dashboard-widget-rp-js', 'FvCommunityNewsAdminDashboardOptions', array( 'ajaxurl' => esc_url( admin_url('admin-ajax.php') ), 'action' => 'fvcn-dashboard-widget-rp-ajax', 'nonce' => wp_create_nonce('fvcn-dashboard') ) ); do_action('fvcn_enqueue_dashboard_widget_recent_posts_scripts'); } /** * dashboardHead() * * @version 20120729 * @return void */ public function dashboardHead() { ?> <style type="text/css"> #fvcn-dashboard-recent-posts .inside { margin: 0 auto; padding: 0; } #fvcn-dashboard-recent-posts .inside .dashboard-widget-control-form { padding: 0 10px 10px; } #fvcn-dashboard-recent-posts-list .fvcn-post { clear: both; padding: 10px; border-top: 1px solid #dfdfdf; } #fvcn-dashboard-recent-posts-list .fvcn-post:first-child { border-top: none; } #fvcn-dashboard-recent-posts-list .fvcn-post.pending { background-color: #ffffe0; } #fvcn-dashboard-recent-posts-list .fvcn-post .avatar, #fvcn-dashboard-recent-posts-list .fvcn-post .wp-post-image { float: left; margin: 0 10px 10px 0; } #fvcn-dashboard-recent-posts-list .fvcn-post .fvcn-dashboard-post-wrap blockquote { margin: 0 auto; } #fvcn-dashboard-recent-posts-list .fvcn-post .fvcn-row-actions { visibility: hidden; margin: 3px 0 0; } #fvcn-dashboard-recent-posts-list .fvcn-post:hover .fvcn-row-actions { visibility: visible; } #fvcn-dashboard-recent-posts-list .fvcn-post .fvcn-row-actions .publish a { color: #006505; } #fvcn-dashboard-recent-posts-list .fvcn-post .fvcn-row-actions .unpublish a { color: #d98500; } #fvcn-dashboard-recent-posts-list .fvcn-post .fvcn-row-actions .spam a { color: #bc0b0b; } #fvcn-dashboard-recent-posts-list .fvcn-post .fvcn-row-actions .trash a { color: #bc0b0b; } #fvcn-dashboard-recent-posts-list .fvcn-post .fvcn-row-actions .trash a:hover, #fvcn-dashboard-recent-posts-list .fvcn-post .fvcn-row-actions .spam a:hover, #fvcn-dashboard-recent-posts-list .fvcn-post .fvcn-row-actions .unpublish a:hover, #fvcn-dashboard-recent-posts-list .fvcn-post .fvcn-row-actions .publish a:hover { color: #d54e21; } #fvcn-dashboard-recent-posts-list .fvcn-post.approved .fvcn-row-actions .publish, #fvcn-dashboard-recent-posts-list .fvcn-post.pending .fvcn-row-actions .unpublish { display: none; } #fvcn-dashboard-view-links { margin: 10px 10px; } </style> <?php do_action('fvcn_dashboard_widget_recent_posts_styles'); } /** * response() * * @version 20120729 * @return void */ public function response() { if (!isset($_GET['action'], $_GET['post_id']) || false === strpos($_GET['action'], 'fvcn')) { return; } $this->_updatePostStatus($_GET['post_id'], $_GET['action']); } /** * ajaxResponse() * * @version 20120729 * @return void */ public function ajaxResponse() { $success = false; $message = false; if (!isset($_POST['nonce'], $_POST['post_id'], $_POST['fvcn_action']) || !wp_verify_nonce($_POST['nonce'], 'fvcn-dashboard') || !is_numeric($_POST['post_id']) || !fvcn_get_post($_POST['post_id']) || !current_user_can('edit_posts', $_POST['post_id'])) { $message = __('Are you sure?', 'fvcn'); } if (false === $message) { $success = $this->_updatePostStatus($_POST['post_id'], $_POST['fvcn_action']); if (false === $success) { $message = __('Invallid action', 'fvcn'); } } if (false === $success) { $response = array( 'success' => false, 'message' => $message ); } else { $response = array( 'success' => true ); } echo json_encode( $response ); exit; } /** * _updatePostStatus() * * @version 20120729 * @param string $action * @return bool */ protected function _updatePostStatus($postId, $action) { switch ($action) { case 'fvcn_toggle_post_spam_status' : check_admin_referer('fvcn-spam-post_' . $postId); return fvcn_is_post_spam($postId) ? fvcn_publish_post($postId) : fvcn_spam_post($postId); break; case 'fvcn_toggle_post_publish_status' : check_admin_referer('fvcn-publish-post_' . $postId); return fvcn_is_post_published($postId) ? fvcn_unpublish_post($postId) : fvcn_publish_post($postId); break; default: return false; } } /** * register() * * @version 20120719 * @return FvCommunityNews_Admin_Dashboard_Widget_RecentPosts */ public function register() { if (current_user_can('edit_posts')) { wp_add_dashboard_widget( 'fvcn-dashboard-recent-posts', __('Recent Community News', 'fvcn'), array($this, 'widget'), array($this, 'control') ); } return $this; } /** * widget() * * @version 20120721 * @return void */ public function widget() { $options = array( 'posts_per_page' => fvcn_get_option('_fvcn_dashboard_rp_num'), 'post_status' => fvcn_get_public_post_status() . ',' . fvcn_get_pending_post_status() ); if (fvcn_has_posts($options)) : $alt = 'odd alt'; ?> <div id="fvcn-dashboard-recent-posts-list"> <?php while (fvcn_posts()) : fvcn_the_post(); ?> <?php $class = 'fvcn-post '; if (fvcn_get_pending_post_status() == fvcn_get_post_status()) { $class .= 'pending '; } else { $class .= 'approved '; } $class .= $alt; ?> <div id="fvcn-post-<?php fvcn_post_id(); ?>" class="<?php echo $class; ?>"> <?php if (fvcn_has_post_thumbnail()) { fvcn_post_thumbnail(0, array(50, 50)); } else { fvcn_post_author_avatar(0, 50); } ?> <div class="fvcn-dashboard-post-wrap"> <h4 class="fvcn-post-title"> <?php if (fvcn_has_post_link()) : ?> <a href="<?php fvcn_post_link(); ?>"><?php fvcn_post_title(); ?></a> <?php else : ?> <?php fvcn_post_title(); ?> <?php endif; ?> <a href="<?php fvcn_post_permalink(); ?>">#</a> </h4> <blockquote><?php fvcn_post_excerpt(); ?></blockquote> <p class="fvcn-row-actions"> <?php $publish_uri = esc_url( wp_nonce_url( add_query_arg(array( 'post_id' => fvcn_get_post_id(), 'action' => 'fvcn_toggle_post_publish_status' ), 'index.php'), 'fvcn-publish-post_' . fvcn_get_post_id())); $edit_uri = esc_url( add_query_arg(array( 'post' => fvcn_get_post_id(), 'action' => 'edit' ), 'post.php')); $spam_uri = esc_url( wp_nonce_url( add_query_arg(array( 'post_id' => fvcn_get_post_id(), 'action' => 'fvcn_toggle_post_spam_status' ), 'index.php'), 'fvcn-spam-post_' . fvcn_get_post_id())); $trash_uri = esc_url( wp_nonce_url( add_query_arg(array( 'post' => fvcn_get_post_id(), 'action' => 'trash' ), 'post.php'), 'trash-' . fvcn_get_post_type() . '_' . fvcn_get_post_id())); ?> <span class="publish"><a href="<?php echo $publish_uri; ?>"><?php _e('Publish', 'fvcn'); ?></a></span> <span class="unpublish"><a href="<?php echo $publish_uri; ?>"><?php _e('Unpublish', 'fvcn'); ?></a></span> <span class="edit"> | <a href="<?php echo $edit_uri; ?>"><?php _e('Edit', 'fvcn'); ?></a></span> <span class="spam"> | <a href="<?php echo $spam_uri; ?>"><?php _e('Spam', 'fvcn'); ?></a></span> <span class="trash"> | <a href="<?php echo $trash_uri; ?>"><?php _e('Trash', 'fvcn'); ?></a></span> </p> </div> </div> <?php $alt = ($alt == 'even' ? 'odd alt' : 'even'); endwhile; ?> </div> <p id="fvcn-dashboard-view-links"> <a href="edit.php?post_type=<?php fvcn_post_type(); ?>"><?php _e('View All', 'fvcn'); ?></a> </p> <?php else : ?> <p><?php _e('No posts found, yet.', 'fvcn'); ?></p> <?php endif; } /** * control() * * @version 20120729 * @return void */ public function control() { if ('post' == strtolower($_SERVER['REQUEST_METHOD']) && isset($_POST['_fvcn_dashboard_rp'])) { update_option('_fvcn_dashboard_rp_num', min( max((int) $_POST['_fvcn_dashboard_rp_num'], 1), 30)); } ?> <p> <label for="_fvcn_dashboard_rp_num"><?php _e('Number of posts to show:', 'fvcn'); ?></label> <input type="text" name="_fvcn_dashboard_rp_num" id="_fvcn_dashboard_rp_num" value="<?php echo fvcn_form_option('_fvcn_dashboard_rp_num'); ?>" size="3" /> <small><?php _e('(1 - 30)', 'fvcn'); ?></small> </p> <input type="hidden" name="_fvcn_dashboard_rp" id="_fvcn_dashboard_rp" value="1" /> <?php } }
tresemece/AndesMills
wp-content/plugins/fv-community-news/fvcn-admin/fvcn-admin-dashboard.php
PHP
gpl-2.0
10,681
$(function () { var max_upload = parseInt($('#max_upload').val()); var temid = parseInt($('#temid').val()); var albumid = parseInt($('#albumid').val()); var limit = max_upload - temid; $('#file_upload').uploadify({ 'swf': swf_link, 'uploader': upload_link, 'cancelImg': cancel_link, 'buttonText': 'CHỌN ẢNH...', 'removeTimeout': 5, 'uploadLimit': limit, 'queueSizeLimit': limit, 'fileSizeLimit': '5221908 byte', 'fileTypeExts': '*.jpg;*.jpeg;*.png;*.gif', 'fileDesc': '.jpg, .jpeg, .png, .gif', 'removeCompleted': true, 'formData': { 'uploadfile': '1', 'modname': nv_module_name, 'siteroot': nv_siteroot, 'module_logo': module_logo, 'folder': folder, 'albumid': albumid, 'limit': temid }, 'onUploadSuccess': function (file, data, response) { var tem = parseInt($('#temid').val()) + 1; $('#temid').val(tem); var info = data.split('[NV3]'); if (info[0] == "OK") { var status= "status_" + tem + ""; var a = ''; a += '<div id="row_' + tem + '">'; a += '<div class="loopc">'; a += ' <div class="img">'; a += ' <input class="rid" rel="' + tem + '" type="hidden" value="' + info[3] + '" name="rid_' + tem + '" id="rid_' + tem + '" />'; a += ' <input type="hidden" value="' + info[1] + '" name="thumb_' + tem + '" id="thumb_' + tem + '" />'; a += ' <span id="del_' + tem + '" onclick="delete_image(' + tem + ', 0, ' +albumid+ ', ' + admin_site + ');" title="Xóa ảnh này" class="delete"></span>'; a += '<span title="Trạng thái" class="status">'; a += ' <input id="status_' + tem + '" name="status_' + tem + '" onclick="status_image(\'status_' + tem + '\',' + info[3] + ',' + albumid + ');" value="1" checked type="checkbox">'; a += '</span>'; a += '<span title="Chọn làm ảnh mặc định album" class="default">'; a += '<input id="fileimg_' + tem + '" name="fileimg_' + tem + '" value="' + info[2] + '" type="hidden">'; a += '<input id="default_' + tem + '" name="default_' + tem + '" onclick="get_image(\'' + tem + '\',\'' + info[3] + '\', \'' +albumid+ '\', \'' + info[4] + '\', \'' + info[5] + '\', \'' + info[6] + '\');" value="1" type="radio">'; a += '</span>'; a += ' <a class="duan-thumb" rel="' + info[2] + '" href="' + info[2] + '">'; a += ' <img width="100px" src="' + info[1] + '" />'; a += ' </a>'; a += ' </div>'; a += '</div>'; a += '</div>'; $("#showimage").append(a); $('.duan-thumb').lightBox(); } else { $('#file_upload').uploadify('settings', 'queueSizeLimit', tem); $('#file_upload').uploadify('settings', 'queueSizeLimit', tem); //alert(info[1]); } } }); }); function delete_image(delrow, rid, albumid) { if (confirm('Bạn có chắc chắn xóa ảnh này')) { $.ajax({ async: false, type: 'POST', url: admin_site + 'index.php?' + nv_name_variable + '=' + nv_module_name + '&' + nv_fc_variable + '=uploads&del=1', data: 'rid=' + rid + '&albumid=' + albumid, success: function (a) { var b = a.split("[NV3]"); if (b[0] == 'OK') { $('#row_' + delrow).remove(); var i=1; $.each($('.rid'), function () { $('#row_' + $(this).attr('rel')).attr('id', 'row_' + i); tmp = $(this).attr('rel'); $('#del_' + tmp).attr('onclick', "delete_image(" + i + ", " + $('#rid_' + tmp).val() + ", " + albumid + ")"); $('#del_' + tmp).attr('id', 'del_' + i); $('#picture_' + tmp).attr('name', 'picture_' + i); $('#picture_' + tmp).attr('id', 'picture_' + i); $('#thumb_' + tmp).attr('name', 'thumb_' + i); $('#thumb_' + tmp).attr('id', 'thumb_' + i); $(this).attr('name', 'rid_' + i); $(this).attr('id', 'rid_' + i); $(this).attr('rel', i); ++i; }); var tem = parseInt($('#temid').val()) - 1; $('#temid').val(tem); } else if (b[0] == 'ERR') { alert(b[1]); } } }); } return false; } function status_image(checkbox_id, rid, albumid ) { if (confirm(nv_is_change_act_confirm[0])) { var nv_timer = nv_settimeout_disable(checkbox_id, 5000); nv_ajax("post", script_name, nv_name_variable + '=' + nv_module_name + '&' + nv_fc_variable + '=uploads&act=1&rid=' + rid + '&albumid=' + albumid + '&loop=' + checkbox_id + '&num=' + nv_randomPassword(8), '', 'status_image_res'); } else { var sl = document.getElementById(checkbox_id); if (sl.checked == true) sl.checked = false; else sl.checked = true; } return; } // --------------------------------------- function status_image_res(res) { var r_split = res.split("|"); if (r_split[0] != 'OK') { alert(nv_is_change_act_confirm[2]); var sl = document.getElementById(r_split[1]); if (sl.checked == true) sl.checked = false; else sl.checked = true; clearTimeout(nv_timer); sl.disabled = true; } return false; } function reset_content() { $('#crop-img').hide(); return false; }; function updateCoords(c) { $('#x').val(c.x); $('#y').val(c.y); $('#w').val(c.w); $('#h').val(c.h); }; function checkCoords() { if (parseInt($('#w').val())) { var x = $('#x').val(); var y = $('#y').val(); var w = $('#w').val(); var h = $('#h').val(); var targ_w = 402; var targ_h = 254; var imgw = $('#imgw').val(); var imgh = $('#imgh').val(); var imgfile = $('#imgfile').val(); var alias_ab = $('#alias_ab').val(); var rid = $('#rid').val(); var albumid = $('#albumid').val(); var tems = $('#tems').val(); $.ajax({ url: admin_site + 'index.php?' + nv_lang_variable + '=' + nv_sitelang + '&' + nv_name_variable + '=' + nv_module_name + '&' + nv_fc_variable + '=uploads&upload=1&nocache=' + new Date().getTime(), type: "POST", data: 'leftX=' + x + '&leftY=' + y + '&newwidth=' + w + '&newheight=' + h + '&imgw=' + imgw + '&imgh=' + imgh + '&tems=' + tems + '&imgfile=' + imgfile+ '&alias_ab=' + alias_ab+ '&rid=' + rid+ '&albumid=' + albumid, success: function (res) { var r_split = res.split("[NV3]"); if (r_split[0] == 'OK') { document.getElementById("contentimg1").innerHTML = '<img src="' + r_split[1] + '" width="220" height="139" >'; $('#frontimg').val(r_split[1]); }else { alert(r_split[1]); } $('#crop-img').hide(); $('#response').hide(); } }); } else { alert('Hãy chọn vùng ảnh trước khi bấm lưu vùng ảnh đã chọn'); } return false; }; function get_image(i,rid,albumid,w,h,tems) { var img = document.getElementById('fileimg_'+i).value; $('#imgfile').val(img); $('#rid').val(rid); $('#imgw').val(w); $('#imgh').val(h); $('#tems').val(tems); $('#albumid').val(albumid); document.getElementById("response").innerHTML = '<img id="cropbox" src="' + img + '" width="' + w + '" height="' + h + '">'; $('#cropbox').Jcrop({ //aspectRatio: 1, bgFade: true, bgOpacity: .2, minSize: [402, 254], maxSize: [630, 380], aspectRatio: 630 / 380, onSelect: updateCoords }); $('#crop-img').show(); }
dangdinhtu2014/nukeviet_photo
modules/photo/js/New folder/uploads.js
JavaScript
gpl-2.0
7,904
public class DragAction : System.Enum, System.IComparable, System.IFormattable, System.IConvertible { // Methods public virtual bool Equals(object obj) {} public virtual int GetHashCode() {} public virtual string ToString() {} public virtual string ToString(string format, System.IFormatProvider provider) {} public virtual int CompareTo(object target) {} public virtual string ToString(System.IFormatProvider provider) {} public virtual System.TypeCode GetTypeCode() {} public string ToString(string format) {} public Type GetType() {} // Fields public int value__; public DragAction Continue; public DragAction Drop; public DragAction Cancel; }
Pengfei-Gao/source-Insight-3-for-centos7
SourceInsight3/NetFramework/DragAction.cs
C#
gpl-2.0
665
//事件兼容pc $.each("String Boolean RegExp Number Date Object Null Undefined".split(" "), function( i, name ){ var fn; if( 'is' + name in $ ) return;//already defined then ignore. switch (name) { case 'Null': fn = function(obj){ return obj === null; }; break; case 'Undefined': fn = function(obj){ return obj === undefined; }; break; default: fn = function(obj){ return new RegExp(name + ']', 'i').test( toString(obj) )}; } $['is'+name] = fn; }); (function () { var $onFn = $.fn.on, $offFn = $.fn.off, transEvent = { touchstart: 'mousedown', touchend: 'mouseup', touchmove: 'mousemove', tap: 'click' }, reversalEvent= { mousedown: 'touchstart', mouseup: 'touchend', mousemove: 'touchmove', click: 'tap' }, transFn = function(e) { var events, org, event; if($.isObject(e)){ org = e; $.each(e, function(key){ event = parse(key); !$.support.touch && transEvent[event.e] && (org[transEvent[event.e]+event.ns] = this); }); return org; }else { events = []; $.each((e || '').split(' '), function(i, type) { event = parse(type); events.push(!$.support.touch && transEvent[event.e] ? transEvent[event.e]+event.ns : type); }); return events.join(' '); } }, parse = function(event) { var idx = event.indexOf('.'), e, ns; if(idx>-1) { e = event.substr(0, idx); ns = event.substr(idx); } else { e = event; ns = ''; } return {e:e, ns:ns}; }, callbackStack = []; $.extend($.fn, { on: function(event, selector, callback) { if( Object.prototype.toString.call(selector) === '[object Function]' ) { callback = selector; selector = null; } $.proxy(callback); var targetActived = false; var transedEvent = transFn(event); var _callback = function(e){ var options = e || {}; options.changedTouches = options.changedTouches || []; var bubbles = typeof options.bubbles != 'undefined' ? options.bubbles : true ; var cancelable = typeof options.cancelable != 'undefined' ? options.cancelable : (event != "touchcancel"); var view = typeof options.view != 'undefined' ? options.view : window; var detail = typeof options.detail != 'undefined' ? options.detail : 0; var clientX = typeof options.pageX != 'undefined' ? options.pageX : 0; var clientY = typeof options.pageY != 'undefined' ? options.pageY : 0; var ctrlKey = typeof options.ctrlKey != 'undefined' ? options.ctrlKey : false; var altKey = typeof options.altKey != 'undefined' ? options.altKey : false; var shiftKey = typeof options.shiftKey != 'undefined' ? options.shiftKey : false; var metaKey = typeof options.metaKey != 'undefined' ? options.metaKey : false; var scale = typeof options.scale != 'undefined' ? options.scale : 1.0; var rotation = typeof options.rotation != 'undefined' ? options.rotation : 0.0; var relatedTarget = typeof options.relatedTarget != 'undefined' ? options.relatedTarget : null; var touches = []; var targetTouches = []; var changedTouches = []; var _event = document.createEvent('MouseEvents'); _event.initMouseEvent(reversalEvent[e.type] || e.type, bubbles, cancelable, view, 1, 0, 0, clientX, clientY, ctrlKey, altKey, shiftKey, metaKey, touches, targetTouches, changedTouches, scale, rotation, relatedTarget); _event.touches = [e]; switch( e.type ){ case 'mousedown': targetActived = true; callback.call(null, _event); break; case 'mousemove': if( !targetActived ) { // 如果touchstart没触发,touchmove(mousemove)应该不响应 return; } else { callback.call(null, _event); break; } case 'mouseup': targetActived = false; callback.call(null, _event); break; } }; callbackStack.push({ 'target': this, 'event': transedEvent, 'selector': selector, 'callback': callback, '_callback': _callback }); _callback._zid = callback._zid; return $onFn.call(this, transedEvent, selector, _callback); }, off: function(event, selector, callback) { return $offFn.call(this, transFn(event), selector, callback); } }); })();
elppac/moment
demo/GMU-master/examples/assets/mobileevent2pc.js
JavaScript
gpl-2.0
5,558
# -*- coding: utf-8 -*- __author__ = 'frank' from flask.ext.sqlalchemy import SQLAlchemy from sqlalchemy.dialects import mysql from datetime import datetime db = SQLAlchemy() # 时间都存为utcnow,具体显示根据不同的本地环境进行相应转换 # 如分析数据,或者在本地显示(采用moment插件前端显示) class Application(db.Model): """twitter application""" __tablename__ = 'applications' id = db.Column(db.Integer, primary_key=True) consumer_token = db.Column(db.String(30)) consumer_secret = db.Column(db.String(60)) created_at = db.Column(db.DateTime, default=datetime.utcnow) is_valid = db.Column(db.Boolean, default=True) access_tokens = db.relationship('AccessToken', backref='application', lazy='dynamic', order_by='desc(AccessToken.created_at)') class User(db.Model): """用户信息表""" __tablename__ = 'users' # 其中id用于外键链接,user_id与api交互 # 针对于mysql数据库 id = db.Column(mysql.INTEGER(30), primary_key=True) # id_str user_id = db.Column(db.String(30)) name = db.Column(db.String(50)) screen_name = db.Column(db.String(50)) location = db.Column(db.String(30)) statuses_count = db.Column(db.Integer) followers_count = db.Column(db.Integer) # 关注人员数, following friends_count = db.Column(db.Integer) created_at = db.Column(db.DateTime) # 下次待抓取消息id下限 since_id = db.Column(db.String(30), default='0') # 是否为待监控用户 is_target = db.Column(db.Boolean, default=False) # 关注者id,表明该待同步用户被monitor_user_id关注 monitor_user_id = db.Column(mysql.INTEGER(30)) # 图像地址 profile_image_url = db.Column(db.String(150)) # url 主页地址 url = db.Column(db.String(150)) access_tokens = db.relationship( 'AccessToken', backref='user', lazy='dynamic', order_by='desc(AccessToken.created_at)') statuses = db.relationship( 'Status', backref='user', lazy='dynamic', order_by='desc(Status.created_at)') def __repr__(self): return 'User %s' % self.screen_name class AccessToken(db.Model): """access_token信息表""" __tablename__ = 'accesstokens' id = db.Column(db.Integer, primary_key=True) access_token = db.Column(db.String(50)) access_token_secret = db.Column(db.String(45)) is_valid = db.Column(db.Boolean, default=True) created_at = db.Column(db.DateTime, default=datetime.utcnow) user_id = db.Column(mysql.INTEGER(30), db.ForeignKey('users.id')) applcation_id = db.Column(db.Integer, db.ForeignKey('applications.id')) def __repr__(self): return "AccessToken userid %d" % self.user_id class Status(db.Model): """状态信息表""" __tablename__ = 'statuses' # 针对于mysql数据库 id = db.Column(mysql.INTEGER(30), primary_key=True) # twitter_status_id status_id = db.Column(db.String(30)) text = db.Column(db.String(150)) created_at = db.Column(db.DateTime) # 图片地址 media_url = db.Column(db.String(150)) # 被关注者id,表明该tweet是user_id发出的 user_id = db.Column(mysql.INTEGER(30), db.ForeignKey('users.id')) # 关注者id,表明该tweet是id关注待同步用户之后产生的 monitor_user_id = db.Column(mysql.INTEGER(30)) def __repr__(self): print "Status %s" % self.status_id
Fansion/crawltwitter
crawltwitter/models.py
Python
gpl-2.0
3,522
/* * Copyright (C) 2008-2014 TrinityCore <http://www.trinitycore.org/> * Copyright (C) 2013-2014 Phoenixia Productions <phoenixia-gaming.no-ip.biz> * * This program is free software; you can redistribute it and/or modify it * under the terms of the GNU General Public License as published by the * Free Software Foundation; either version 2 of the License, or (at your * option) any later version. * * This program is distributed in the hope that it will be useful, but WITHOUT * ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or * FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License for * more details. * * You should have received a copy of the GNU General Public License along * with this program. If not, see <http://www.gnu.org/licenses/>. */ #include "ScriptMgr.h" #include "ScriptedCreature.h" #include "mana_tombs.h" enum Yells { SAY_INTRO = 0, SAY_AGGRO = 1, SAY_SLAY = 2, SAY_SUMMON = 3, SAY_DEAD = 4 }; enum Spells { SPELL_BLINK = 34605, SPELL_FROSTBOLT = 32364, SPELL_FIREBALL = 32363, SPELL_FROSTNOVA = 32365, SPELL_ETHEREAL_BEACON = 32371, SPELL_ETHEREAL_BEACON_VISUAL = 32368, SPELL_ARCANE_BOLT = 15254, SPELL_ETHEREAL_APPRENTICE = 32372 }; enum Creatures { NPC_BEACON = 18431, NPC_SHAFFAR = 18344 }; enum EtherealApprentice { SPELL_ETHEREAL_APPRENTICE_FIREBOLT = 32369, SPELL_ETHEREAL_APPRENTICE_FROSTBOLT = 32370, EVENT_ETHEREAL_APPRENTICE_FIREBOLT = 1, EVENT_ETHEREAL_APPRENTICE_FROSTBOLT }; enum EtherealBeacon { EVENT_APPRENTICE = 1, EVENT_ARCANE_BOLT }; enum Misc { NR_INITIAL_BEACONS = 3 }; enum Events { EVENT_BLINK = 1, EVENT_BEACON, EVENT_FIREBALL, EVENT_FROSTBOLT, EVENT_FROST_NOVA }; enum Yor { SPELL_DOUBLE_BREATH = 38361, EVENT_DOUBLE_BREATH = 1 }; /*************** Boss : Nexus' Prince Shaffar ***************/ class boss_nexusprince_shaffar : public CreatureScript { public: boss_nexusprince_shaffar() : CreatureScript("boss_nexusprince_shaffar") {} struct boss_nexusprince_shaffarAI : public BossAI { boss_nexusprince_shaffarAI(Creature* creature) : BossAI(creature, DATA_NEXUSPRINCE_SHAFFAR) { _hasTaunted = false; } void Reset() override { _Reset(); float dist = 8.0f; float posX, posY, posZ, angle; me->GetHomePosition(posX, posY, posZ, angle); me->SummonCreature(NPC_BEACON, posX - dist, posY - dist, posZ, angle, TEMPSUMMON_CORPSE_TIMED_DESPAWN, 7200000); me->SummonCreature(NPC_BEACON, posX - dist, posY + dist, posZ, angle, TEMPSUMMON_CORPSE_TIMED_DESPAWN, 7200000); me->SummonCreature(NPC_BEACON, posX + dist, posY, posZ, angle, TEMPSUMMON_CORPSE_TIMED_DESPAWN, 7200000); } void MoveInLineOfSight(Unit* who) override { if (!_hasTaunted && who->GetTypeId() == TYPEID_PLAYER && me->IsWithinDistInMap(who, 100.0f)) { Talk(SAY_INTRO); _hasTaunted = true; } } void EnterCombat(Unit* /*who*/) override { Talk(SAY_AGGRO); _EnterCombat(); events.ScheduleEvent(EVENT_BEACON, 10000); events.ScheduleEvent(EVENT_FIREBALL, 8000); events.ScheduleEvent(EVENT_FROSTBOLT, 4000); events.ScheduleEvent(EVENT_FROST_NOVA, 15000); } void JustSummoned(Creature* summoned) override { if (summoned->GetEntry() == NPC_BEACON) { summoned->CastSpell(summoned, SPELL_ETHEREAL_BEACON_VISUAL, false); if (Unit* target = SelectTarget(SELECT_TARGET_RANDOM, 0)) summoned->AI()->AttackStart(target); } summons.Summon(summoned); } void KilledUnit(Unit* victim) override { if (victim->GetTypeId() == TYPEID_PLAYER) Talk(SAY_SLAY); } void JustDied(Unit* /*killer*/) override { Talk(SAY_DEAD); _JustDied(); } void ExecuteEvent(uint32 eventId) override { switch (eventId) { case EVENT_BLINK: if (me->IsNonMeleeSpellCast(false)) me->InterruptNonMeleeSpells(true); if (me->GetMotionMaster()->GetCurrentMovementGeneratorType() == CHASE_MOTION_TYPE) me->GetMotionMaster()->MovementExpired(); DoCast(me, SPELL_BLINK); break; case EVENT_BEACON: if (!urand(0, 3)) Talk(SAY_SUMMON); DoCast(me, SPELL_ETHEREAL_BEACON, true); events.ScheduleEvent(EVENT_BEACON, 10000); break; case EVENT_FIREBALL: DoCastVictim(SPELL_FROSTBOLT); events.ScheduleEvent(EVENT_FIREBALL, urand(4500, 6000)); break; case EVENT_FROSTBOLT: DoCastVictim(SPELL_FROSTBOLT); events.ScheduleEvent(EVENT_FROSTBOLT, urand(4500, 6000)); break; case EVENT_FROST_NOVA: DoCast(me, SPELL_FROSTNOVA); events.ScheduleEvent(EVENT_FROST_NOVA, urand(17500, 25000)); events.ScheduleEvent(EVENT_BLINK, 1500); break; default: break; } } private: bool _hasTaunted; }; CreatureAI* GetAI(Creature* creature) const override { return GetManaTombsAI<boss_nexusprince_shaffarAI>(creature); } }; /*************** Creature : Ethereal Apprentice ***************/ class npc_ethereal_apprentice : public CreatureScript { public: npc_ethereal_apprentice() : CreatureScript("npc_ethereal_apprentice") {} struct npc_ethereal_apprenticeAI : public ScriptedAI { npc_ethereal_apprenticeAI(Creature* creature) : ScriptedAI(creature) {} void Reset() override { _events.Reset(); } void EnterCombat(Unit* /*who*/) override { _events.ScheduleEvent(EVENT_ETHEREAL_APPRENTICE_FIREBOLT, 3000); } void UpdateAI(uint32 diff) override { if (!UpdateVictim()) return; _events.Update(diff); if (me->HasUnitState(UNIT_STATE_CASTING)) return; while (uint32 eventId = _events.ExecuteEvent()) { switch (eventId) { case EVENT_ETHEREAL_APPRENTICE_FIREBOLT: DoCastVictim(SPELL_ETHEREAL_APPRENTICE_FIREBOLT, true); _events.ScheduleEvent(EVENT_ETHEREAL_APPRENTICE_FROSTBOLT, 3000); break; case EVENT_ETHEREAL_APPRENTICE_FROSTBOLT: DoCastVictim(SPELL_ETHEREAL_APPRENTICE_FROSTBOLT, true); _events.ScheduleEvent(EVENT_ETHEREAL_APPRENTICE_FIREBOLT, 3000); break; default: break; } } } private: EventMap _events; }; CreatureAI* GetAI(Creature* creature) const override { return new npc_ethereal_apprenticeAI(creature); } }; /*************** Creature : Ethereal Beacon ***************/ class npc_ethereal_beacon : public CreatureScript { public: npc_ethereal_beacon() : CreatureScript("npc_ethereal_beacon") {} struct npc_ethereal_beaconAI : public ScriptedAI { npc_ethereal_beaconAI(Creature* creature) : ScriptedAI(creature) {} void Reset() override { _events.Reset(); } void EnterCombat(Unit* who) override { if (Creature* shaffar = me->FindNearestCreature(NPC_SHAFFAR, 100.0f)) if (!shaffar->IsInCombat()) shaffar->AI()->AttackStart(who); _events.ScheduleEvent(EVENT_APPRENTICE, DUNGEON_MODE(20000, 10000)); _events.ScheduleEvent(EVENT_ARCANE_BOLT, 1000); } void JustSummoned(Creature* summoned) override { summoned->AI()->AttackStart(me->GetVictim()); } void UpdateAI(uint32 diff) override { if (!UpdateVictim()) return; _events.Update(diff); if (me->HasUnitState(UNIT_STATE_CASTING)) return; while (uint32 eventId = _events.ExecuteEvent()) { switch (eventId) { case EVENT_APPRENTICE: DoCast(me, SPELL_ETHEREAL_APPRENTICE, true); me->DespawnOrUnsummon(); break; case EVENT_ARCANE_BOLT: DoCastVictim(SPELL_ARCANE_BOLT); _events.ScheduleEvent(EVENT_ARCANE_BOLT, urand(2000, 4500)); break; default: break; } } } private: EventMap _events; }; CreatureAI* GetAI(Creature* creature) const override { return new npc_ethereal_beaconAI(creature); } }; /*************** Creature : Yor ***************/ class npc_yor : public CreatureScript { public: npc_yor() : CreatureScript("npc_yor") {} struct npc_yorAI : public ScriptedAI { npc_yorAI(Creature* creature) : ScriptedAI(creature) {} void Reset() override {} void EnterCombat(Unit* /*who*/) override { _events.ScheduleEvent(EVENT_DOUBLE_BREATH, urand(6000,9000)); } void UpdateAI(uint32 diff) override { if (!UpdateVictim()) return; _events.Update(diff); while (uint32 eventId = _events.ExecuteEvent()) { switch (eventId) { case EVENT_DOUBLE_BREATH: if (me->IsWithinDist(me->GetVictim(), ATTACK_DISTANCE)) DoCastVictim(SPELL_DOUBLE_BREATH); _events.ScheduleEvent(EVENT_DOUBLE_BREATH, urand(6000,9000)); break; default: break; } } DoMeleeAttackIfReady(); } private: EventMap _events; }; CreatureAI* GetAI(Creature* creature) const override { return new npc_yorAI(creature); } }; /*************** Add Scripts ***************/ void AddSC_boss_nexusprince_shaffar() { new boss_nexusprince_shaffar; new npc_ethereal_beacon; new npc_ethereal_apprentice; new npc_yor; }
PhoenixiaGaming/WoP-v4
src/server/scripts/Outland/Auchindoun/ManaTombs/boss_nexusprince_shaffar.cpp
C++
gpl-2.0
12,485
/** * @license AngularJS v1.3.11 * (c) 2010-2014 Google, Inc. http://angularjs.org * License: MIT */ (function(window, document, undefined) {'use strict'; /** * @description * * This object provides a utility for producing rich Error messages within * Angular. It can be called as follows: * * var exampleMinErr = minErr('example'); * throw exampleMinErr('one', 'This {0} is {1}', foo, bar); * * The above creates an instance of minErr in the example namespace. The * resulting error will have a namespaced error code of example.one. The * resulting error will replace {0} with the value of foo, and {1} with the * value of bar. The object is not restricted in the number of arguments it can * take. * * If fewer arguments are specified than necessary for interpolation, the extra * interpolation markers will be preserved in the final string. * * Since data will be parsed statically during a build step, some restrictions * are applied with respect to how minErr instances are created and called. * Instances should have names of the form namespaceMinErr for a minErr created * using minErr('namespace') . Error codes, namespaces and template strings * should all be static strings, not variables or general expressions. * * @param {string} module The namespace to use for the new minErr instance. * @param {function} ErrorConstructor Custom error constructor to be instantiated when returning * error from returned function, for cases when a particular type of error is useful. * @returns {function(code:string, template:string, ...templateArgs): Error} minErr instance */ function minErr(module, ErrorConstructor) { ErrorConstructor = ErrorConstructor || Error; return function() { var code = arguments[0], prefix = '[' + (module ? module + ':' : '') + code + '] ', template = arguments[1], templateArgs = arguments, message, i; message = prefix + template.replace(/\{\d+\}/g, function(match) { var index = +match.slice(1, -1), arg; if (index + 2 < templateArgs.length) { return toDebugString(templateArgs[index + 2]); } return match; }); message = message + '\nhttp://errors.angularjs.org/1.3.11/' + (module ? module + '/' : '') + code; for (i = 2; i < arguments.length; i++) { message = message + (i == 2 ? '?' : '&') + 'p' + (i - 2) + '=' + encodeURIComponent(toDebugString(arguments[i])); } return new ErrorConstructor(message); }; } /* We need to tell jshint what variables are being exported */ /* global angular: true, msie: true, jqLite: true, jQuery: true, slice: true, splice: true, push: true, toString: true, ngMinErr: true, angularModule: true, uid: true, REGEX_STRING_REGEXP: true, VALIDITY_STATE_PROPERTY: true, lowercase: true, uppercase: true, manualLowercase: true, manualUppercase: true, nodeName_: true, isArrayLike: true, forEach: true, sortedKeys: true, forEachSorted: true, reverseParams: true, nextUid: true, setHashKey: true, extend: true, int: true, inherit: true, noop: true, identity: true, valueFn: true, isUndefined: true, isDefined: true, isObject: true, isString: true, isNumber: true, isDate: true, isArray: true, isFunction: true, isRegExp: true, isWindow: true, isScope: true, isFile: true, isFormData: true, isBlob: true, isBoolean: true, isPromiseLike: true, trim: true, escapeForRegexp: true, isElement: true, makeMap: true, includes: true, arrayRemove: true, copy: true, shallowCopy: true, equals: true, csp: true, concat: true, sliceArgs: true, bind: true, toJsonReplacer: true, toJson: true, fromJson: true, startingTag: true, tryDecodeURIComponent: true, parseKeyValue: true, toKeyValue: true, encodeUriSegment: true, encodeUriQuery: true, angularInit: true, bootstrap: true, getTestability: true, snake_case: true, bindJQuery: true, assertArg: true, assertArgFn: true, assertNotHasOwnProperty: true, getter: true, getBlockNodes: true, hasOwnProperty: true, createMap: true, NODE_TYPE_ELEMENT: true, NODE_TYPE_TEXT: true, NODE_TYPE_COMMENT: true, NODE_TYPE_DOCUMENT: true, NODE_TYPE_DOCUMENT_FRAGMENT: true, */ //////////////////////////////////// /** * @ngdoc module * @name ng * @module ng * @description * * # ng (core module) * The ng module is loaded by default when an AngularJS application is started. The module itself * contains the essential components for an AngularJS application to function. The table below * lists a high level breakdown of each of the services/factories, filters, directives and testing * components available within this core module. * * <div doc-module-components="ng"></div> */ var REGEX_STRING_REGEXP = /^\/(.+)\/([a-z]*)$/; // The name of a form control's ValidityState property. // This is used so that it's possible for internal tests to create mock ValidityStates. var VALIDITY_STATE_PROPERTY = 'validity'; /** * @ngdoc function * @name angular.lowercase * @module ng * @kind function * * @description Converts the specified string to lowercase. * @param {string} string String to be converted to lowercase. * @returns {string} Lowercased string. */ var lowercase = function(string) {return isString(string) ? string.toLowerCase() : string;}; var hasOwnProperty = Object.prototype.hasOwnProperty; /** * @ngdoc function * @name angular.uppercase * @module ng * @kind function * * @description Converts the specified string to uppercase. * @param {string} string String to be converted to uppercase. * @returns {string} Uppercased string. */ var uppercase = function(string) {return isString(string) ? string.toUpperCase() : string;}; var manualLowercase = function(s) { /* jshint bitwise: false */ return isString(s) ? s.replace(/[A-Z]/g, function(ch) {return String.fromCharCode(ch.charCodeAt(0) | 32);}) : s; }; var manualUppercase = function(s) { /* jshint bitwise: false */ return isString(s) ? s.replace(/[a-z]/g, function(ch) {return String.fromCharCode(ch.charCodeAt(0) & ~32);}) : s; }; // String#toLowerCase and String#toUpperCase don't produce correct results in browsers with Turkish // locale, for this reason we need to detect this case and redefine lowercase/uppercase methods // with correct but slower alternatives. if ('i' !== 'I'.toLowerCase()) { lowercase = manualLowercase; uppercase = manualUppercase; } var msie, // holds major version number for IE, or NaN if UA is not IE. jqLite, // delay binding since jQuery could be loaded after us. jQuery, // delay binding slice = [].slice, splice = [].splice, push = [].push, toString = Object.prototype.toString, ngMinErr = minErr('ng'), /** @name angular */ angular = window.angular || (window.angular = {}), angularModule, uid = 0; /** * documentMode is an IE-only property * http://msdn.microsoft.com/en-us/library/ie/cc196988(v=vs.85).aspx */ msie = document.documentMode; /** * @private * @param {*} obj * @return {boolean} Returns true if `obj` is an array or array-like object (NodeList, Arguments, * String ...) */ function isArrayLike(obj) { if (obj == null || isWindow(obj)) { return false; } var length = obj.length; if (obj.nodeType === NODE_TYPE_ELEMENT && length) { return true; } return isString(obj) || isArray(obj) || length === 0 || typeof length === 'number' && length > 0 && (length - 1) in obj; } /** * @ngdoc function * @name angular.forEach * @module ng * @kind function * * @description * Invokes the `iterator` function once for each item in `obj` collection, which can be either an * object or an array. The `iterator` function is invoked with `iterator(value, key, obj)`, where `value` * is the value of an object property or an array element, `key` is the object property key or * array element index and obj is the `obj` itself. Specifying a `context` for the function is optional. * * It is worth noting that `.forEach` does not iterate over inherited properties because it filters * using the `hasOwnProperty` method. * * Unlike ES262's * [Array.prototype.forEach](http://www.ecma-international.org/ecma-262/5.1/#sec-15.4.4.18), * Providing 'undefined' or 'null' values for `obj` will not throw a TypeError, but rather just * return the value provided. * ```js var values = {name: 'misko', gender: 'male'}; var log = []; angular.forEach(values, function(value, key) { this.push(key + ': ' + value); }, log); expect(log).toEqual(['name: misko', 'gender: male']); ``` * * @param {Object|Array} obj Object to iterate over. * @param {Function} iterator Iterator function. * @param {Object=} context Object to become context (`this`) for the iterator function. * @returns {Object|Array} Reference to `obj`. */ function forEach(obj, iterator, context) { var key, length; if (obj) { if (isFunction(obj)) { for (key in obj) { // Need to check if hasOwnProperty exists, // as on IE8 the result of querySelectorAll is an object without a hasOwnProperty function if (key != 'prototype' && key != 'length' && key != 'name' && (!obj.hasOwnProperty || obj.hasOwnProperty(key))) { iterator.call(context, obj[key], key, obj); } } } else if (isArray(obj) || isArrayLike(obj)) { var isPrimitive = typeof obj !== 'object'; for (key = 0, length = obj.length; key < length; key++) { if (isPrimitive || key in obj) { iterator.call(context, obj[key], key, obj); } } } else if (obj.forEach && obj.forEach !== forEach) { obj.forEach(iterator, context, obj); } else { for (key in obj) { if (obj.hasOwnProperty(key)) { iterator.call(context, obj[key], key, obj); } } } } return obj; } function sortedKeys(obj) { return Object.keys(obj).sort(); } function forEachSorted(obj, iterator, context) { var keys = sortedKeys(obj); for (var i = 0; i < keys.length; i++) { iterator.call(context, obj[keys[i]], keys[i]); } return keys; } /** * when using forEach the params are value, key, but it is often useful to have key, value. * @param {function(string, *)} iteratorFn * @returns {function(*, string)} */ function reverseParams(iteratorFn) { return function(value, key) { iteratorFn(key, value); }; } /** * A consistent way of creating unique IDs in angular. * * Using simple numbers allows us to generate 28.6 million unique ids per second for 10 years before * we hit number precision issues in JavaScript. * * Math.pow(2,53) / 60 / 60 / 24 / 365 / 10 = 28.6M * * @returns {number} an unique alpha-numeric string */ function nextUid() { return ++uid; } /** * Set or clear the hashkey for an object. * @param obj object * @param h the hashkey (!truthy to delete the hashkey) */ function setHashKey(obj, h) { if (h) { obj.$$hashKey = h; } else { delete obj.$$hashKey; } } /** * @ngdoc function * @name angular.extend * @module ng * @kind function * * @description * Extends the destination object `dst` by copying own enumerable properties from the `src` object(s) * to `dst`. You can specify multiple `src` objects. If you want to preserve original objects, you can do so * by passing an empty object as the target: `var object = angular.extend({}, object1, object2)`. * Note: Keep in mind that `angular.extend` does not support recursive merge (deep copy). * * @param {Object} dst Destination object. * @param {...Object} src Source object(s). * @returns {Object} Reference to `dst`. */ function extend(dst) { var h = dst.$$hashKey; for (var i = 1, ii = arguments.length; i < ii; i++) { var obj = arguments[i]; if (obj) { var keys = Object.keys(obj); for (var j = 0, jj = keys.length; j < jj; j++) { var key = keys[j]; dst[key] = obj[key]; } } } setHashKey(dst, h); return dst; } function int(str) { return parseInt(str, 10); } function inherit(parent, extra) { return extend(Object.create(parent), extra); } /** * @ngdoc function * @name angular.noop * @module ng * @kind function * * @description * A function that performs no operations. This function can be useful when writing code in the * functional style. ```js function foo(callback) { var result = calculateResult(); (callback || angular.noop)(result); } ``` */ function noop() {} noop.$inject = []; /** * @ngdoc function * @name angular.identity * @module ng * @kind function * * @description * A function that returns its first argument. This function is useful when writing code in the * functional style. * ```js function transformer(transformationFn, value) { return (transformationFn || angular.identity)(value); }; ``` * @param {*} value to be returned. * @returns {*} the value passed in. */ function identity($) {return $;} identity.$inject = []; function valueFn(value) {return function() {return value;};} /** * @ngdoc function * @name angular.isUndefined * @module ng * @kind function * * @description * Determines if a reference is undefined. * * @param {*} value Reference to check. * @returns {boolean} True if `value` is undefined. */ function isUndefined(value) {return typeof value === 'undefined';} /** * @ngdoc function * @name angular.isDefined * @module ng * @kind function * * @description * Determines if a reference is defined. * * @param {*} value Reference to check. * @returns {boolean} True if `value` is defined. */ function isDefined(value) {return typeof value !== 'undefined';} /** * @ngdoc function * @name angular.isObject * @module ng * @kind function * * @description * Determines if a reference is an `Object`. Unlike `typeof` in JavaScript, `null`s are not * considered to be objects. Note that JavaScript arrays are objects. * * @param {*} value Reference to check. * @returns {boolean} True if `value` is an `Object` but not `null`. */ function isObject(value) { // http://jsperf.com/isobject4 return value !== null && typeof value === 'object'; } /** * @ngdoc function * @name angular.isString * @module ng * @kind function * * @description * Determines if a reference is a `String`. * * @param {*} value Reference to check. * @returns {boolean} True if `value` is a `String`. */ function isString(value) {return typeof value === 'string';} /** * @ngdoc function * @name angular.isNumber * @module ng * @kind function * * @description * Determines if a reference is a `Number`. * * @param {*} value Reference to check. * @returns {boolean} True if `value` is a `Number`. */ function isNumber(value) {return typeof value === 'number';} /** * @ngdoc function * @name angular.isDate * @module ng * @kind function * * @description * Determines if a value is a date. * * @param {*} value Reference to check. * @returns {boolean} True if `value` is a `Date`. */ function isDate(value) { return toString.call(value) === '[object Date]'; } /** * @ngdoc function * @name angular.isArray * @module ng * @kind function * * @description * Determines if a reference is an `Array`. * * @param {*} value Reference to check. * @returns {boolean} True if `value` is an `Array`. */ var isArray = Array.isArray; /** * @ngdoc function * @name angular.isFunction * @module ng * @kind function * * @description * Determines if a reference is a `Function`. * * @param {*} value Reference to check. * @returns {boolean} True if `value` is a `Function`. */ function isFunction(value) {return typeof value === 'function';} /** * Determines if a value is a regular expression object. * * @private * @param {*} value Reference to check. * @returns {boolean} True if `value` is a `RegExp`. */ function isRegExp(value) { return toString.call(value) === '[object RegExp]'; } /** * Checks if `obj` is a window object. * * @private * @param {*} obj Object to check * @returns {boolean} True if `obj` is a window obj. */ function isWindow(obj) { return obj && obj.window === obj; } function isScope(obj) { return obj && obj.$evalAsync && obj.$watch; } function isFile(obj) { return toString.call(obj) === '[object File]'; } function isFormData(obj) { return toString.call(obj) === '[object FormData]'; } function isBlob(obj) { return toString.call(obj) === '[object Blob]'; } function isBoolean(value) { return typeof value === 'boolean'; } function isPromiseLike(obj) { return obj && isFunction(obj.then); } var trim = function(value) { return isString(value) ? value.trim() : value; }; // Copied from: // http://docs.closure-library.googlecode.com/git/local_closure_goog_string_string.js.source.html#line1021 // Prereq: s is a string. var escapeForRegexp = function(s) { return s.replace(/([-()\[\]{}+?*.$\^|,:#<!\\])/g, '\\$1'). replace(/\x08/g, '\\x08'); }; /** * @ngdoc function * @name angular.isElement * @module ng * @kind function * * @description * Determines if a reference is a DOM element (or wrapped jQuery element). * * @param {*} value Reference to check. * @returns {boolean} True if `value` is a DOM element (or wrapped jQuery element). */ function isElement(node) { return !!(node && (node.nodeName // we are a direct element || (node.prop && node.attr && node.find))); // we have an on and find method part of jQuery API } /** * @param str 'key1,key2,...' * @returns {object} in the form of {key1:true, key2:true, ...} */ function makeMap(str) { var obj = {}, items = str.split(","), i; for (i = 0; i < items.length; i++) obj[ items[i] ] = true; return obj; } function nodeName_(element) { return lowercase(element.nodeName || (element[0] && element[0].nodeName)); } function includes(array, obj) { return Array.prototype.indexOf.call(array, obj) != -1; } function arrayRemove(array, value) { var index = array.indexOf(value); if (index >= 0) array.splice(index, 1); return value; } /** * @ngdoc function * @name angular.copy * @module ng * @kind function * * @description * Creates a deep copy of `source`, which should be an object or an array. * * * If no destination is supplied, a copy of the object or array is created. * * If a destination is provided, all of its elements (for arrays) or properties (for objects) * are deleted and then all elements/properties from the source are copied to it. * * If `source` is not an object or array (inc. `null` and `undefined`), `source` is returned. * * If `source` is identical to 'destination' an exception will be thrown. * * @param {*} source The source that will be used to make a copy. * Can be any type, including primitives, `null`, and `undefined`. * @param {(Object|Array)=} destination Destination into which the source is copied. If * provided, must be of the same type as `source`. * @returns {*} The copy or updated `destination`, if `destination` was specified. * * @example <example module="copyExample"> <file name="index.html"> <div ng-controller="ExampleController"> <form novalidate class="simple-form"> Name: <input type="text" ng-model="user.name" /><br /> E-mail: <input type="email" ng-model="user.email" /><br /> Gender: <input type="radio" ng-model="user.gender" value="male" />male <input type="radio" ng-model="user.gender" value="female" />female<br /> <button ng-click="reset()">RESET</button> <button ng-click="update(user)">SAVE</button> </form> <pre>form = {{user | json}}</pre> <pre>master = {{master | json}}</pre> </div> <script> angular.module('copyExample', []) .controller('ExampleController', ['$scope', function($scope) { $scope.master= {}; $scope.update = function(user) { // Example with 1 argument $scope.master= angular.copy(user); }; $scope.reset = function() { // Example with 2 arguments angular.copy($scope.master, $scope.user); }; $scope.reset(); }]); </script> </file> </example> */ function copy(source, destination, stackSource, stackDest) { if (isWindow(source) || isScope(source)) { throw ngMinErr('cpws', "Can't copy! Making copies of Window or Scope instances is not supported."); } if (!destination) { destination = source; if (source) { if (isArray(source)) { destination = copy(source, [], stackSource, stackDest); } else if (isDate(source)) { destination = new Date(source.getTime()); } else if (isRegExp(source)) { destination = new RegExp(source.source, source.toString().match(/[^\/]*$/)[0]); destination.lastIndex = source.lastIndex; } else if (isObject(source)) { var emptyObject = Object.create(Object.getPrototypeOf(source)); destination = copy(source, emptyObject, stackSource, stackDest); } } } else { if (source === destination) throw ngMinErr('cpi', "Can't copy! Source and destination are identical."); stackSource = stackSource || []; stackDest = stackDest || []; if (isObject(source)) { var index = stackSource.indexOf(source); if (index !== -1) return stackDest[index]; stackSource.push(source); stackDest.push(destination); } var result; if (isArray(source)) { destination.length = 0; for (var i = 0; i < source.length; i++) { result = copy(source[i], null, stackSource, stackDest); if (isObject(source[i])) { stackSource.push(source[i]); stackDest.push(result); } destination.push(result); } } else { var h = destination.$$hashKey; if (isArray(destination)) { destination.length = 0; } else { forEach(destination, function(value, key) { delete destination[key]; }); } for (var key in source) { if (source.hasOwnProperty(key)) { result = copy(source[key], null, stackSource, stackDest); if (isObject(source[key])) { stackSource.push(source[key]); stackDest.push(result); } destination[key] = result; } } setHashKey(destination,h); } } return destination; } /** * Creates a shallow copy of an object, an array or a primitive. * * Assumes that there are no proto properties for objects. */ function shallowCopy(src, dst) { if (isArray(src)) { dst = dst || []; for (var i = 0, ii = src.length; i < ii; i++) { dst[i] = src[i]; } } else if (isObject(src)) { dst = dst || {}; for (var key in src) { if (!(key.charAt(0) === '$' && key.charAt(1) === '$')) { dst[key] = src[key]; } } } return dst || src; } /** * @ngdoc function * @name angular.equals * @module ng * @kind function * * @description * Determines if two objects or two values are equivalent. Supports value types, regular * expressions, arrays and objects. * * Two objects or values are considered equivalent if at least one of the following is true: * * * Both objects or values pass `===` comparison. * * Both objects or values are of the same type and all of their properties are equal by * comparing them with `angular.equals`. * * Both values are NaN. (In JavaScript, NaN == NaN => false. But we consider two NaN as equal) * * Both values represent the same regular expression (In JavaScript, * /abc/ == /abc/ => false. But we consider two regular expressions as equal when their textual * representation matches). * * During a property comparison, properties of `function` type and properties with names * that begin with `$` are ignored. * * Scope and DOMWindow objects are being compared only by identify (`===`). * * @param {*} o1 Object or value to compare. * @param {*} o2 Object or value to compare. * @returns {boolean} True if arguments are equal. */ function equals(o1, o2) { if (o1 === o2) return true; if (o1 === null || o2 === null) return false; if (o1 !== o1 && o2 !== o2) return true; // NaN === NaN var t1 = typeof o1, t2 = typeof o2, length, key, keySet; if (t1 == t2) { if (t1 == 'object') { if (isArray(o1)) { if (!isArray(o2)) return false; if ((length = o1.length) == o2.length) { for (key = 0; key < length; key++) { if (!equals(o1[key], o2[key])) return false; } return true; } } else if (isDate(o1)) { if (!isDate(o2)) return false; return equals(o1.getTime(), o2.getTime()); } else if (isRegExp(o1) && isRegExp(o2)) { return o1.toString() == o2.toString(); } else { if (isScope(o1) || isScope(o2) || isWindow(o1) || isWindow(o2) || isArray(o2)) return false; keySet = {}; for (key in o1) { if (key.charAt(0) === '$' || isFunction(o1[key])) continue; if (!equals(o1[key], o2[key])) return false; keySet[key] = true; } for (key in o2) { if (!keySet.hasOwnProperty(key) && key.charAt(0) !== '$' && o2[key] !== undefined && !isFunction(o2[key])) return false; } return true; } } } return false; } var csp = function() { if (isDefined(csp.isActive_)) return csp.isActive_; var active = !!(document.querySelector('[ng-csp]') || document.querySelector('[data-ng-csp]')); if (!active) { try { /* jshint -W031, -W054 */ new Function(''); /* jshint +W031, +W054 */ } catch (e) { active = true; } } return (csp.isActive_ = active); }; function concat(array1, array2, index) { return array1.concat(slice.call(array2, index)); } function sliceArgs(args, startIndex) { return slice.call(args, startIndex || 0); } /* jshint -W101 */ /** * @ngdoc function * @name angular.bind * @module ng * @kind function * * @description * Returns a function which calls function `fn` bound to `self` (`self` becomes the `this` for * `fn`). You can supply optional `args` that are prebound to the function. This feature is also * known as [partial application](http://en.wikipedia.org/wiki/Partial_application), as * distinguished from [function currying](http://en.wikipedia.org/wiki/Currying#Contrast_with_partial_function_application). * * @param {Object} self Context which `fn` should be evaluated in. * @param {function()} fn Function to be bound. * @param {...*} args Optional arguments to be prebound to the `fn` function call. * @returns {function()} Function that wraps the `fn` with all the specified bindings. */ /* jshint +W101 */ function bind(self, fn) { var curryArgs = arguments.length > 2 ? sliceArgs(arguments, 2) : []; if (isFunction(fn) && !(fn instanceof RegExp)) { return curryArgs.length ? function() { return arguments.length ? fn.apply(self, concat(curryArgs, arguments, 0)) : fn.apply(self, curryArgs); } : function() { return arguments.length ? fn.apply(self, arguments) : fn.call(self); }; } else { // in IE, native methods are not functions so they cannot be bound (note: they don't need to be) return fn; } } function toJsonReplacer(key, value) { var val = value; if (typeof key === 'string' && key.charAt(0) === '$' && key.charAt(1) === '$') { val = undefined; } else if (isWindow(value)) { val = '$WINDOW'; } else if (value && document === value) { val = '$DOCUMENT'; } else if (isScope(value)) { val = '$SCOPE'; } return val; } /** * @ngdoc function * @name angular.toJson * @module ng * @kind function * * @description * Serializes input into a JSON-formatted string. Properties with leading $$ characters will be * stripped since angular uses this notation internally. * * @param {Object|Array|Date|string|number} obj Input to be serialized into JSON. * @param {boolean|number=} pretty If set to true, the JSON output will contain newlines and whitespace. * If set to an integer, the JSON output will contain that many spaces per indentation (the default is 2). * @returns {string|undefined} JSON-ified string representing `obj`. */ function toJson(obj, pretty) { if (typeof obj === 'undefined') return undefined; if (!isNumber(pretty)) { pretty = pretty ? 2 : null; } return JSON.stringify(obj, toJsonReplacer, pretty); } /** * @ngdoc function * @name angular.fromJson * @module ng * @kind function * * @description * Deserializes a JSON string. * * @param {string} json JSON string to deserialize. * @returns {Object|Array|string|number} Deserialized JSON string. */ function fromJson(json) { return isString(json) ? JSON.parse(json) : json; } /** * @returns {string} Returns the string representation of the element. */ function startingTag(element) { element = jqLite(element).clone(); try { // turns out IE does not let you set .html() on elements which // are not allowed to have children. So we just ignore it. element.empty(); } catch (e) {} var elemHtml = jqLite('<div>').append(element).html(); try { return element[0].nodeType === NODE_TYPE_TEXT ? lowercase(elemHtml) : elemHtml. match(/^(<[^>]+>)/)[1]. replace(/^<([\w\-]+)/, function(match, nodeName) { return '<' + lowercase(nodeName); }); } catch (e) { return lowercase(elemHtml); } } ///////////////////////////////////////////////// /** * Tries to decode the URI component without throwing an exception. * * @private * @param str value potential URI component to check. * @returns {boolean} True if `value` can be decoded * with the decodeURIComponent function. */ function tryDecodeURIComponent(value) { try { return decodeURIComponent(value); } catch (e) { // Ignore any invalid uri component } } /** * Parses an escaped url query string into key-value pairs. * @returns {Object.<string,boolean|Array>} */ function parseKeyValue(/**string*/keyValue) { var obj = {}, key_value, key; forEach((keyValue || "").split('&'), function(keyValue) { if (keyValue) { key_value = keyValue.replace(/\+/g,'%20').split('='); key = tryDecodeURIComponent(key_value[0]); if (isDefined(key)) { var val = isDefined(key_value[1]) ? tryDecodeURIComponent(key_value[1]) : true; if (!hasOwnProperty.call(obj, key)) { obj[key] = val; } else if (isArray(obj[key])) { obj[key].push(val); } else { obj[key] = [obj[key],val]; } } } }); return obj; } function toKeyValue(obj) { var parts = []; forEach(obj, function(value, key) { if (isArray(value)) { forEach(value, function(arrayValue) { parts.push(encodeUriQuery(key, true) + (arrayValue === true ? '' : '=' + encodeUriQuery(arrayValue, true))); }); } else { parts.push(encodeUriQuery(key, true) + (value === true ? '' : '=' + encodeUriQuery(value, true))); } }); return parts.length ? parts.join('&') : ''; } /** * We need our custom method because encodeURIComponent is too aggressive and doesn't follow * http://www.ietf.org/rfc/rfc3986.txt with regards to the character set (pchar) allowed in path * segments: * segment = *pchar * pchar = unreserved / pct-encoded / sub-delims / ":" / "@" * pct-encoded = "%" HEXDIG HEXDIG * unreserved = ALPHA / DIGIT / "-" / "." / "_" / "~" * sub-delims = "!" / "$" / "&" / "'" / "(" / ")" * / "*" / "+" / "," / ";" / "=" */ function encodeUriSegment(val) { return encodeUriQuery(val, true). replace(/%26/gi, '&'). replace(/%3D/gi, '='). replace(/%2B/gi, '+'); } /** * This method is intended for encoding *key* or *value* parts of query component. We need a custom * method because encodeURIComponent is too aggressive and encodes stuff that doesn't have to be * encoded per http://tools.ietf.org/html/rfc3986: * query = *( pchar / "/" / "?" ) * pchar = unreserved / pct-encoded / sub-delims / ":" / "@" * unreserved = ALPHA / DIGIT / "-" / "." / "_" / "~" * pct-encoded = "%" HEXDIG HEXDIG * sub-delims = "!" / "$" / "&" / "'" / "(" / ")" * / "*" / "+" / "," / ";" / "=" */ function encodeUriQuery(val, pctEncodeSpaces) { return encodeURIComponent(val). replace(/%40/gi, '@'). replace(/%3A/gi, ':'). replace(/%24/g, '$'). replace(/%2C/gi, ','). replace(/%3B/gi, ';'). replace(/%20/g, (pctEncodeSpaces ? '%20' : '+')); } var ngAttrPrefixes = ['ng-', 'data-ng-', 'ng:', 'x-ng-']; function getNgAttribute(element, ngAttr) { var attr, i, ii = ngAttrPrefixes.length; element = jqLite(element); for (i = 0; i < ii; ++i) { attr = ngAttrPrefixes[i] + ngAttr; if (isString(attr = element.attr(attr))) { return attr; } } return null; } /** * @ngdoc directive * @name ngApp * @module ng * * @element ANY * @param {angular.Module} ngApp an optional application * {@link angular.module module} name to load. * @param {boolean=} ngStrictDi if this attribute is present on the app element, the injector will be * created in "strict-di" mode. This means that the application will fail to invoke functions which * do not use explicit function annotation (and are thus unsuitable for minification), as described * in {@link guide/di the Dependency Injection guide}, and useful debugging info will assist in * tracking down the root of these bugs. * * @description * * Use this directive to **auto-bootstrap** an AngularJS application. The `ngApp` directive * designates the **root element** of the application and is typically placed near the root element * of the page - e.g. on the `<body>` or `<html>` tags. * * Only one AngularJS application can be auto-bootstrapped per HTML document. The first `ngApp` * found in the document will be used to define the root element to auto-bootstrap as an * application. To run multiple applications in an HTML document you must manually bootstrap them using * {@link angular.bootstrap} instead. AngularJS applications cannot be nested within each other. * * You can specify an **AngularJS module** to be used as the root module for the application. This * module will be loaded into the {@link auto.$injector} when the application is bootstrapped. It * should contain the application code needed or have dependencies on other modules that will * contain the code. See {@link angular.module} for more information. * * In the example below if the `ngApp` directive were not placed on the `html` element then the * document would not be compiled, the `AppController` would not be instantiated and the `{{ a+b }}` * would not be resolved to `3`. * * `ngApp` is the easiest, and most common way to bootstrap an application. * <example module="ngAppDemo"> <file name="index.html"> <div ng-controller="ngAppDemoController"> I can add: {{a}} + {{b}} = {{ a+b }} </div> </file> <file name="script.js"> angular.module('ngAppDemo', []).controller('ngAppDemoController', function($scope) { $scope.a = 1; $scope.b = 2; }); </file> </example> * * Using `ngStrictDi`, you would see something like this: * <example ng-app-included="true"> <file name="index.html"> <div ng-app="ngAppStrictDemo" ng-strict-di> <div ng-controller="GoodController1"> I can add: {{a}} + {{b}} = {{ a+b }} <p>This renders because the controller does not fail to instantiate, by using explicit annotation style (see script.js for details) </p> </div> <div ng-controller="GoodController2"> Name: <input ng-model="name"><br /> Hello, {{name}}! <p>This renders because the controller does not fail to instantiate, by using explicit annotation style (see script.js for details) </p> </div> <div ng-controller="BadController"> I can add: {{a}} + {{b}} = {{ a+b }} <p>The controller could not be instantiated, due to relying on automatic function annotations (which are disabled in strict mode). As such, the content of this section is not interpolated, and there should be an error in your web console. </p> </div> </div> </file> <file name="script.js"> angular.module('ngAppStrictDemo', []) // BadController will fail to instantiate, due to relying on automatic function annotation, // rather than an explicit annotation .controller('BadController', function($scope) { $scope.a = 1; $scope.b = 2; }) // Unlike BadController, GoodController1 and GoodController2 will not fail to be instantiated, // due to using explicit annotations using the array style and $inject property, respectively. .controller('GoodController1', ['$scope', function($scope) { $scope.a = 1; $scope.b = 2; }]) .controller('GoodController2', GoodController2); function GoodController2($scope) { $scope.name = "World"; } GoodController2.$inject = ['$scope']; </file> <file name="style.css"> div[ng-controller] { margin-bottom: 1em; -webkit-border-radius: 4px; border-radius: 4px; border: 1px solid; padding: .5em; } div[ng-controller^=Good] { border-color: #d6e9c6; background-color: #dff0d8; color: #3c763d; } div[ng-controller^=Bad] { border-color: #ebccd1; background-color: #f2dede; color: #a94442; margin-bottom: 0; } </file> </example> */ function angularInit(element, bootstrap) { var appElement, module, config = {}; // The element `element` has priority over any other element forEach(ngAttrPrefixes, function(prefix) { var name = prefix + 'app'; if (!appElement && element.hasAttribute && element.hasAttribute(name)) { appElement = element; module = element.getAttribute(name); } }); forEach(ngAttrPrefixes, function(prefix) { var name = prefix + 'app'; var candidate; if (!appElement && (candidate = element.querySelector('[' + name.replace(':', '\\:') + ']'))) { appElement = candidate; module = candidate.getAttribute(name); } }); if (appElement) { config.strictDi = getNgAttribute(appElement, "strict-di") !== null; bootstrap(appElement, module ? [module] : [], config); } } /** * @ngdoc function * @name angular.bootstrap * @module ng * @description * Use this function to manually start up angular application. * * See: {@link guide/bootstrap Bootstrap} * * Note that Protractor based end-to-end tests cannot use this function to bootstrap manually. * They must use {@link ng.directive:ngApp ngApp}. * * Angular will detect if it has been loaded into the browser more than once and only allow the * first loaded script to be bootstrapped and will report a warning to the browser console for * each of the subsequent scripts. This prevents strange results in applications, where otherwise * multiple instances of Angular try to work on the DOM. * * ```html * <!doctype html> * <html> * <body> * <div ng-controller="WelcomeController"> * {{greeting}} * </div> * * <script src="angular.js"></script> * <script> * var app = angular.module('demo', []) * .controller('WelcomeController', function($scope) { * $scope.greeting = 'Welcome!'; * }); * angular.bootstrap(document, ['demo']); * </script> * </body> * </html> * ``` * * @param {DOMElement} element DOM element which is the root of angular application. * @param {Array<String|Function|Array>=} modules an array of modules to load into the application. * Each item in the array should be the name of a predefined module or a (DI annotated) * function that will be invoked by the injector as a `config` block. * See: {@link angular.module modules} * @param {Object=} config an object for defining configuration options for the application. The * following keys are supported: * * * `strictDi` - disable automatic function annotation for the application. This is meant to * assist in finding bugs which break minified code. Defaults to `false`. * * @returns {auto.$injector} Returns the newly created injector for this app. */ function bootstrap(element, modules, config) { if (!isObject(config)) config = {}; var defaultConfig = { strictDi: false }; config = extend(defaultConfig, config); var doBootstrap = function() { element = jqLite(element); if (element.injector()) { var tag = (element[0] === document) ? 'document' : startingTag(element); //Encode angle brackets to prevent input from being sanitized to empty string #8683 throw ngMinErr( 'btstrpd', "App Already Bootstrapped with this Element '{0}'", tag.replace(/</,'&lt;').replace(/>/,'&gt;')); } modules = modules || []; modules.unshift(['$provide', function($provide) { $provide.value('$rootElement', element); }]); if (config.debugInfoEnabled) { // Pushing so that this overrides `debugInfoEnabled` setting defined in user's `modules`. modules.push(['$compileProvider', function($compileProvider) { $compileProvider.debugInfoEnabled(true); }]); } modules.unshift('ng'); var injector = createInjector(modules, config.strictDi); injector.invoke(['$rootScope', '$rootElement', '$compile', '$injector', function bootstrapApply(scope, element, compile, injector) { scope.$apply(function() { element.data('$injector', injector); compile(element)(scope); }); }] ); return injector; }; var NG_ENABLE_DEBUG_INFO = /^NG_ENABLE_DEBUG_INFO!/; var NG_DEFER_BOOTSTRAP = /^NG_DEFER_BOOTSTRAP!/; if (window && NG_ENABLE_DEBUG_INFO.test(window.name)) { config.debugInfoEnabled = true; window.name = window.name.replace(NG_ENABLE_DEBUG_INFO, ''); } if (window && !NG_DEFER_BOOTSTRAP.test(window.name)) { return doBootstrap(); } window.name = window.name.replace(NG_DEFER_BOOTSTRAP, ''); angular.resumeBootstrap = function(extraModules) { forEach(extraModules, function(module) { modules.push(module); }); doBootstrap(); }; } /** * @ngdoc function * @name angular.reloadWithDebugInfo * @module ng * @description * Use this function to reload the current application with debug information turned on. * This takes precedence over a call to `$compileProvider.debugInfoEnabled(false)`. * * See {@link ng.$compileProvider#debugInfoEnabled} for more. */ function reloadWithDebugInfo() { window.name = 'NG_ENABLE_DEBUG_INFO!' + window.name; window.location.reload(); } /** * @name angular.getTestability * @module ng * @description * Get the testability service for the instance of Angular on the given * element. * @param {DOMElement} element DOM element which is the root of angular application. */ function getTestability(rootElement) { var injector = angular.element(rootElement).injector(); if (!injector) { throw ngMinErr('test', 'no injector found for element argument to getTestability'); } return injector.get('$$testability'); } var SNAKE_CASE_REGEXP = /[A-Z]/g; function snake_case(name, separator) { separator = separator || '_'; return name.replace(SNAKE_CASE_REGEXP, function(letter, pos) { return (pos ? separator : '') + letter.toLowerCase(); }); } var bindJQueryFired = false; var skipDestroyOnNextJQueryCleanData; function bindJQuery() { var originalCleanData; if (bindJQueryFired) { return; } // bind to jQuery if present; jQuery = window.jQuery; // Use jQuery if it exists with proper functionality, otherwise default to us. // Angular 1.2+ requires jQuery 1.7+ for on()/off() support. // Angular 1.3+ technically requires at least jQuery 2.1+ but it may work with older // versions. It will not work for sure with jQuery <1.7, though. if (jQuery && jQuery.fn.on) { jqLite = jQuery; extend(jQuery.fn, { scope: JQLitePrototype.scope, isolateScope: JQLitePrototype.isolateScope, controller: JQLitePrototype.controller, injector: JQLitePrototype.injector, inheritedData: JQLitePrototype.inheritedData }); // All nodes removed from the DOM via various jQuery APIs like .remove() // are passed through jQuery.cleanData. Monkey-patch this method to fire // the $destroy event on all removed nodes. originalCleanData = jQuery.cleanData; jQuery.cleanData = function(elems) { var events; if (!skipDestroyOnNextJQueryCleanData) { for (var i = 0, elem; (elem = elems[i]) != null; i++) { events = jQuery._data(elem, "events"); if (events && events.$destroy) { jQuery(elem).triggerHandler('$destroy'); } } } else { skipDestroyOnNextJQueryCleanData = false; } originalCleanData(elems); }; } else { jqLite = JQLite; } angular.element = jqLite; // Prevent double-proxying. bindJQueryFired = true; } /** * throw error if the argument is falsy. */ function assertArg(arg, name, reason) { if (!arg) { throw ngMinErr('areq', "Argument '{0}' is {1}", (name || '?'), (reason || "required")); } return arg; } function assertArgFn(arg, name, acceptArrayAnnotation) { if (acceptArrayAnnotation && isArray(arg)) { arg = arg[arg.length - 1]; } assertArg(isFunction(arg), name, 'not a function, got ' + (arg && typeof arg === 'object' ? arg.constructor.name || 'Object' : typeof arg)); return arg; } /** * throw error if the name given is hasOwnProperty * @param {String} name the name to test * @param {String} context the context in which the name is used, such as module or directive */ function assertNotHasOwnProperty(name, context) { if (name === 'hasOwnProperty') { throw ngMinErr('badname', "hasOwnProperty is not a valid {0} name", context); } } /** * Return the value accessible from the object by path. Any undefined traversals are ignored * @param {Object} obj starting object * @param {String} path path to traverse * @param {boolean} [bindFnToScope=true] * @returns {Object} value as accessible by path */ //TODO(misko): this function needs to be removed function getter(obj, path, bindFnToScope) { if (!path) return obj; var keys = path.split('.'); var key; var lastInstance = obj; var len = keys.length; for (var i = 0; i < len; i++) { key = keys[i]; if (obj) { obj = (lastInstance = obj)[key]; } } if (!bindFnToScope && isFunction(obj)) { return bind(lastInstance, obj); } return obj; } /** * Return the DOM siblings between the first and last node in the given array. * @param {Array} array like object * @returns {jqLite} jqLite collection containing the nodes */ function getBlockNodes(nodes) { // TODO(perf): just check if all items in `nodes` are siblings and if they are return the original // collection, otherwise update the original collection. var node = nodes[0]; var endNode = nodes[nodes.length - 1]; var blockNodes = [node]; do { node = node.nextSibling; if (!node) break; blockNodes.push(node); } while (node !== endNode); return jqLite(blockNodes); } /** * Creates a new object without a prototype. This object is useful for lookup without having to * guard against prototypically inherited properties via hasOwnProperty. * * Related micro-benchmarks: * - http://jsperf.com/object-create2 * - http://jsperf.com/proto-map-lookup/2 * - http://jsperf.com/for-in-vs-object-keys2 * * @returns {Object} */ function createMap() { return Object.create(null); } var NODE_TYPE_ELEMENT = 1; var NODE_TYPE_TEXT = 3; var NODE_TYPE_COMMENT = 8; var NODE_TYPE_DOCUMENT = 9; var NODE_TYPE_DOCUMENT_FRAGMENT = 11; /** * @ngdoc type * @name angular.Module * @module ng * @description * * Interface for configuring angular {@link angular.module modules}. */ function setupModuleLoader(window) { var $injectorMinErr = minErr('$injector'); var ngMinErr = minErr('ng'); function ensure(obj, name, factory) { return obj[name] || (obj[name] = factory()); } var angular = ensure(window, 'angular', Object); // We need to expose `angular.$$minErr` to modules such as `ngResource` that reference it during bootstrap angular.$$minErr = angular.$$minErr || minErr; return ensure(angular, 'module', function() { /** @type {Object.<string, angular.Module>} */ var modules = {}; /** * @ngdoc function * @name angular.module * @module ng * @description * * The `angular.module` is a global place for creating, registering and retrieving Angular * modules. * All modules (angular core or 3rd party) that should be available to an application must be * registered using this mechanism. * * When passed two or more arguments, a new module is created. If passed only one argument, an * existing module (the name passed as the first argument to `module`) is retrieved. * * * # Module * * A module is a collection of services, directives, controllers, filters, and configuration information. * `angular.module` is used to configure the {@link auto.$injector $injector}. * * ```js * // Create a new module * var myModule = angular.module('myModule', []); * * // register a new service * myModule.value('appName', 'MyCoolApp'); * * // configure existing services inside initialization blocks. * myModule.config(['$locationProvider', function($locationProvider) { * // Configure existing providers * $locationProvider.hashPrefix('!'); * }]); * ``` * * Then you can create an injector and load your modules like this: * * ```js * var injector = angular.injector(['ng', 'myModule']) * ``` * * However it's more likely that you'll just use * {@link ng.directive:ngApp ngApp} or * {@link angular.bootstrap} to simplify this process for you. * * @param {!string} name The name of the module to create or retrieve. * @param {!Array.<string>=} requires If specified then new module is being created. If * unspecified then the module is being retrieved for further configuration. * @param {Function=} configFn Optional configuration function for the module. Same as * {@link angular.Module#config Module#config()}. * @returns {module} new module with the {@link angular.Module} api. */ return function module(name, requires, configFn) { var assertNotHasOwnProperty = function(name, context) { if (name === 'hasOwnProperty') { throw ngMinErr('badname', 'hasOwnProperty is not a valid {0} name', context); } }; assertNotHasOwnProperty(name, 'module'); if (requires && modules.hasOwnProperty(name)) { modules[name] = null; } return ensure(modules, name, function() { if (!requires) { throw $injectorMinErr('nomod', "Module '{0}' is not available! You either misspelled " + "the module name or forgot to load it. If registering a module ensure that you " + "specify the dependencies as the second argument.", name); } /** @type {!Array.<Array.<*>>} */ var invokeQueue = []; /** @type {!Array.<Function>} */ var configBlocks = []; /** @type {!Array.<Function>} */ var runBlocks = []; var config = invokeLater('$injector', 'invoke', 'push', configBlocks); /** @type {angular.Module} */ var moduleInstance = { // Private state _invokeQueue: invokeQueue, _configBlocks: configBlocks, _runBlocks: runBlocks, /** * @ngdoc property * @name angular.Module#requires * @module ng * * @description * Holds the list of modules which the injector will load before the current module is * loaded. */ requires: requires, /** * @ngdoc property * @name angular.Module#name * @module ng * * @description * Name of the module. */ name: name, /** * @ngdoc method * @name angular.Module#provider * @module ng * @param {string} name service name * @param {Function} providerType Construction function for creating new instance of the * service. * @description * See {@link auto.$provide#provider $provide.provider()}. */ provider: invokeLater('$provide', 'provider'), /** * @ngdoc method * @name angular.Module#factory * @module ng * @param {string} name service name * @param {Function} providerFunction Function for creating new instance of the service. * @description * See {@link auto.$provide#factory $provide.factory()}. */ factory: invokeLater('$provide', 'factory'), /** * @ngdoc method * @name angular.Module#service * @module ng * @param {string} name service name * @param {Function} constructor A constructor function that will be instantiated. * @description * See {@link auto.$provide#service $provide.service()}. */ service: invokeLater('$provide', 'service'), /** * @ngdoc method * @name angular.Module#value * @module ng * @param {string} name service name * @param {*} object Service instance object. * @description * See {@link auto.$provide#value $provide.value()}. */ value: invokeLater('$provide', 'value'), /** * @ngdoc method * @name angular.Module#constant * @module ng * @param {string} name constant name * @param {*} object Constant value. * @description * Because the constant are fixed, they get applied before other provide methods. * See {@link auto.$provide#constant $provide.constant()}. */ constant: invokeLater('$provide', 'constant', 'unshift'), /** * @ngdoc method * @name angular.Module#animation * @module ng * @param {string} name animation name * @param {Function} animationFactory Factory function for creating new instance of an * animation. * @description * * **NOTE**: animations take effect only if the **ngAnimate** module is loaded. * * * Defines an animation hook that can be later used with * {@link ngAnimate.$animate $animate} service and directives that use this service. * * ```js * module.animation('.animation-name', function($inject1, $inject2) { * return { * eventName : function(element, done) { * //code to run the animation * //once complete, then run done() * return function cancellationFunction(element) { * //code to cancel the animation * } * } * } * }) * ``` * * See {@link ng.$animateProvider#register $animateProvider.register()} and * {@link ngAnimate ngAnimate module} for more information. */ animation: invokeLater('$animateProvider', 'register'), /** * @ngdoc method * @name angular.Module#filter * @module ng * @param {string} name Filter name. * @param {Function} filterFactory Factory function for creating new instance of filter. * @description * See {@link ng.$filterProvider#register $filterProvider.register()}. */ filter: invokeLater('$filterProvider', 'register'), /** * @ngdoc method * @name angular.Module#controller * @module ng * @param {string|Object} name Controller name, or an object map of controllers where the * keys are the names and the values are the constructors. * @param {Function} constructor Controller constructor function. * @description * See {@link ng.$controllerProvider#register $controllerProvider.register()}. */ controller: invokeLater('$controllerProvider', 'register'), /** * @ngdoc method * @name angular.Module#directive * @module ng * @param {string|Object} name Directive name, or an object map of directives where the * keys are the names and the values are the factories. * @param {Function} directiveFactory Factory function for creating new instance of * directives. * @description * See {@link ng.$compileProvider#directive $compileProvider.directive()}. */ directive: invokeLater('$compileProvider', 'directive'), /** * @ngdoc method * @name angular.Module#config * @module ng * @param {Function} configFn Execute this function on module load. Useful for service * configuration. * @description * Use this method to register work which needs to be performed on module loading. * For more about how to configure services, see * {@link providers#provider-recipe Provider Recipe}. */ config: config, /** * @ngdoc method * @name angular.Module#run * @module ng * @param {Function} initializationFn Execute this function after injector creation. * Useful for application initialization. * @description * Use this method to register work which should be performed when the injector is done * loading all modules. */ run: function(block) { runBlocks.push(block); return this; } }; if (configFn) { config(configFn); } return moduleInstance; /** * @param {string} provider * @param {string} method * @param {String=} insertMethod * @returns {angular.Module} */ function invokeLater(provider, method, insertMethod, queue) { if (!queue) queue = invokeQueue; return function() { queue[insertMethod || 'push']([provider, method, arguments]); return moduleInstance; }; } }); }; }); } /* global: toDebugString: true */ function serializeObject(obj) { var seen = []; return JSON.stringify(obj, function(key, val) { val = toJsonReplacer(key, val); if (isObject(val)) { if (seen.indexOf(val) >= 0) return '<<already seen>>'; seen.push(val); } return val; }); } function toDebugString(obj) { if (typeof obj === 'function') { return obj.toString().replace(/ \{[\s\S]*$/, ''); } else if (typeof obj === 'undefined') { return 'undefined'; } else if (typeof obj !== 'string') { return serializeObject(obj); } return obj; } /* global angularModule: true, version: true, $LocaleProvider, $CompileProvider, htmlAnchorDirective, inputDirective, inputDirective, formDirective, scriptDirective, selectDirective, styleDirective, optionDirective, ngBindDirective, ngBindHtmlDirective, ngBindTemplateDirective, ngClassDirective, ngClassEvenDirective, ngClassOddDirective, ngCspDirective, ngCloakDirective, ngControllerDirective, ngFormDirective, ngHideDirective, ngIfDirective, ngIncludeDirective, ngIncludeFillContentDirective, ngInitDirective, ngNonBindableDirective, ngPluralizeDirective, ngRepeatDirective, ngShowDirective, ngStyleDirective, ngSwitchDirective, ngSwitchWhenDirective, ngSwitchDefaultDirective, ngOptionsDirective, ngTranscludeDirective, ngModelDirective, ngListDirective, ngChangeDirective, patternDirective, patternDirective, requiredDirective, requiredDirective, minlengthDirective, minlengthDirective, maxlengthDirective, maxlengthDirective, ngValueDirective, ngModelOptionsDirective, ngAttributeAliasDirectives, ngEventDirectives, $AnchorScrollProvider, $AnimateProvider, $BrowserProvider, $CacheFactoryProvider, $ControllerProvider, $DocumentProvider, $ExceptionHandlerProvider, $FilterProvider, $InterpolateProvider, $IntervalProvider, $HttpProvider, $HttpBackendProvider, $LocationProvider, $LogProvider, $ParseProvider, $RootScopeProvider, $QProvider, $$QProvider, $$SanitizeUriProvider, $SceProvider, $SceDelegateProvider, $SnifferProvider, $TemplateCacheProvider, $TemplateRequestProvider, $$TestabilityProvider, $TimeoutProvider, $$RAFProvider, $$AsyncCallbackProvider, $WindowProvider, $$jqLiteProvider */ /** * @ngdoc object * @name angular.version * @module ng * @description * An object that contains information about the current AngularJS version. This object has the * following properties: * * - `full` – `{string}` – Full version string, such as "0.9.18". * - `major` – `{number}` – Major version number, such as "0". * - `minor` – `{number}` – Minor version number, such as "9". * - `dot` – `{number}` – Dot version number, such as "18". * - `codeName` – `{string}` – Code name of the release, such as "jiggling-armfat". */ var version = { full: '1.3.11', // all of these placeholder strings will be replaced by grunt's major: 1, // package task minor: 3, dot: 11, codeName: 'spiffy-manatee' }; function publishExternalAPI(angular) { extend(angular, { 'bootstrap': bootstrap, 'copy': copy, 'extend': extend, 'equals': equals, 'element': jqLite, 'forEach': forEach, 'injector': createInjector, 'noop': noop, 'bind': bind, 'toJson': toJson, 'fromJson': fromJson, 'identity': identity, 'isUndefined': isUndefined, 'isDefined': isDefined, 'isString': isString, 'isFunction': isFunction, 'isObject': isObject, 'isNumber': isNumber, 'isElement': isElement, 'isArray': isArray, 'version': version, 'isDate': isDate, 'lowercase': lowercase, 'uppercase': uppercase, 'callbacks': {counter: 0}, 'getTestability': getTestability, '$$minErr': minErr, '$$csp': csp, 'reloadWithDebugInfo': reloadWithDebugInfo }); angularModule = setupModuleLoader(window); try { angularModule('ngLocale'); } catch (e) { angularModule('ngLocale', []).provider('$locale', $LocaleProvider); } angularModule('ng', ['ngLocale'], ['$provide', function ngModule($provide) { // $$sanitizeUriProvider needs to be before $compileProvider as it is used by it. $provide.provider({ $$sanitizeUri: $$SanitizeUriProvider }); $provide.provider('$compile', $CompileProvider). directive({ a: htmlAnchorDirective, input: inputDirective, textarea: inputDirective, form: formDirective, script: scriptDirective, select: selectDirective, style: styleDirective, option: optionDirective, ngBind: ngBindDirective, ngBindHtml: ngBindHtmlDirective, ngBindTemplate: ngBindTemplateDirective, ngClass: ngClassDirective, ngClassEven: ngClassEvenDirective, ngClassOdd: ngClassOddDirective, ngCloak: ngCloakDirective, ngController: ngControllerDirective, ngForm: ngFormDirective, ngHide: ngHideDirective, ngIf: ngIfDirective, ngInclude: ngIncludeDirective, ngInit: ngInitDirective, ngNonBindable: ngNonBindableDirective, ngPluralize: ngPluralizeDirective, ngRepeat: ngRepeatDirective, ngShow: ngShowDirective, ngStyle: ngStyleDirective, ngSwitch: ngSwitchDirective, ngSwitchWhen: ngSwitchWhenDirective, ngSwitchDefault: ngSwitchDefaultDirective, ngOptions: ngOptionsDirective, ngTransclude: ngTranscludeDirective, ngModel: ngModelDirective, ngList: ngListDirective, ngChange: ngChangeDirective, pattern: patternDirective, ngPattern: patternDirective, required: requiredDirective, ngRequired: requiredDirective, minlength: minlengthDirective, ngMinlength: minlengthDirective, maxlength: maxlengthDirective, ngMaxlength: maxlengthDirective, ngValue: ngValueDirective, ngModelOptions: ngModelOptionsDirective }). directive({ ngInclude: ngIncludeFillContentDirective }). directive(ngAttributeAliasDirectives). directive(ngEventDirectives); $provide.provider({ $anchorScroll: $AnchorScrollProvider, $animate: $AnimateProvider, $browser: $BrowserProvider, $cacheFactory: $CacheFactoryProvider, $controller: $ControllerProvider, $document: $DocumentProvider, $exceptionHandler: $ExceptionHandlerProvider, $filter: $FilterProvider, $interpolate: $InterpolateProvider, $interval: $IntervalProvider, $http: $HttpProvider, $httpBackend: $HttpBackendProvider, $location: $LocationProvider, $log: $LogProvider, $parse: $ParseProvider, $rootScope: $RootScopeProvider, $q: $QProvider, $$q: $$QProvider, $sce: $SceProvider, $sceDelegate: $SceDelegateProvider, $sniffer: $SnifferProvider, $templateCache: $TemplateCacheProvider, $templateRequest: $TemplateRequestProvider, $$testability: $$TestabilityProvider, $timeout: $TimeoutProvider, $window: $WindowProvider, $$rAF: $$RAFProvider, $$asyncCallback: $$AsyncCallbackProvider, $$jqLite: $$jqLiteProvider }); } ]); } /* global JQLitePrototype: true, addEventListenerFn: true, removeEventListenerFn: true, BOOLEAN_ATTR: true, ALIASED_ATTR: true, */ ////////////////////////////////// //JQLite ////////////////////////////////// /** * @ngdoc function * @name angular.element * @module ng * @kind function * * @description * Wraps a raw DOM element or HTML string as a [jQuery](http://jquery.com) element. * * If jQuery is available, `angular.element` is an alias for the * [jQuery](http://api.jquery.com/jQuery/) function. If jQuery is not available, `angular.element` * delegates to Angular's built-in subset of jQuery, called "jQuery lite" or "jqLite." * * <div class="alert alert-success">jqLite is a tiny, API-compatible subset of jQuery that allows * Angular to manipulate the DOM in a cross-browser compatible way. **jqLite** implements only the most * commonly needed functionality with the goal of having a very small footprint.</div> * * To use jQuery, simply load it before `DOMContentLoaded` event fired. * * <div class="alert">**Note:** all element references in Angular are always wrapped with jQuery or * jqLite; they are never raw DOM references.</div> * * ## Angular's jqLite * jqLite provides only the following jQuery methods: * * - [`addClass()`](http://api.jquery.com/addClass/) * - [`after()`](http://api.jquery.com/after/) * - [`append()`](http://api.jquery.com/append/) * - [`attr()`](http://api.jquery.com/attr/) - Does not support functions as parameters * - [`bind()`](http://api.jquery.com/bind/) - Does not support namespaces, selectors or eventData * - [`children()`](http://api.jquery.com/children/) - Does not support selectors * - [`clone()`](http://api.jquery.com/clone/) * - [`contents()`](http://api.jquery.com/contents/) * - [`css()`](http://api.jquery.com/css/) - Only retrieves inline-styles, does not call `getComputedStyle()` * - [`data()`](http://api.jquery.com/data/) * - [`detach()`](http://api.jquery.com/detach/) * - [`empty()`](http://api.jquery.com/empty/) * - [`eq()`](http://api.jquery.com/eq/) * - [`find()`](http://api.jquery.com/find/) - Limited to lookups by tag name * - [`hasClass()`](http://api.jquery.com/hasClass/) * - [`html()`](http://api.jquery.com/html/) * - [`next()`](http://api.jquery.com/next/) - Does not support selectors * - [`on()`](http://api.jquery.com/on/) - Does not support namespaces, selectors or eventData * - [`off()`](http://api.jquery.com/off/) - Does not support namespaces or selectors * - [`one()`](http://api.jquery.com/one/) - Does not support namespaces or selectors * - [`parent()`](http://api.jquery.com/parent/) - Does not support selectors * - [`prepend()`](http://api.jquery.com/prepend/) * - [`prop()`](http://api.jquery.com/prop/) * - [`ready()`](http://api.jquery.com/ready/) * - [`remove()`](http://api.jquery.com/remove/) * - [`removeAttr()`](http://api.jquery.com/removeAttr/) * - [`removeClass()`](http://api.jquery.com/removeClass/) * - [`removeData()`](http://api.jquery.com/removeData/) * - [`replaceWith()`](http://api.jquery.com/replaceWith/) * - [`text()`](http://api.jquery.com/text/) * - [`toggleClass()`](http://api.jquery.com/toggleClass/) * - [`triggerHandler()`](http://api.jquery.com/triggerHandler/) - Passes a dummy event object to handlers. * - [`unbind()`](http://api.jquery.com/unbind/) - Does not support namespaces * - [`val()`](http://api.jquery.com/val/) * - [`wrap()`](http://api.jquery.com/wrap/) * * ## jQuery/jqLite Extras * Angular also provides the following additional methods and events to both jQuery and jqLite: * * ### Events * - `$destroy` - AngularJS intercepts all jqLite/jQuery's DOM destruction apis and fires this event * on all DOM nodes being removed. This can be used to clean up any 3rd party bindings to the DOM * element before it is removed. * * ### Methods * - `controller(name)` - retrieves the controller of the current element or its parent. By default * retrieves controller associated with the `ngController` directive. If `name` is provided as * camelCase directive name, then the controller for this directive will be retrieved (e.g. * `'ngModel'`). * - `injector()` - retrieves the injector of the current element or its parent. * - `scope()` - retrieves the {@link ng.$rootScope.Scope scope} of the current * element or its parent. Requires {@link guide/production#disabling-debug-data Debug Data} to * be enabled. * - `isolateScope()` - retrieves an isolate {@link ng.$rootScope.Scope scope} if one is attached directly to the * current element. This getter should be used only on elements that contain a directive which starts a new isolate * scope. Calling `scope()` on this element always returns the original non-isolate scope. * Requires {@link guide/production#disabling-debug-data Debug Data} to be enabled. * - `inheritedData()` - same as `data()`, but walks up the DOM until a value is found or the top * parent element is reached. * * @param {string|DOMElement} element HTML string or DOMElement to be wrapped into jQuery. * @returns {Object} jQuery object. */ JQLite.expando = 'ng339'; var jqCache = JQLite.cache = {}, jqId = 1, addEventListenerFn = function(element, type, fn) { element.addEventListener(type, fn, false); }, removeEventListenerFn = function(element, type, fn) { element.removeEventListener(type, fn, false); }; /* * !!! This is an undocumented "private" function !!! */ JQLite._data = function(node) { //jQuery always returns an object on cache miss return this.cache[node[this.expando]] || {}; }; function jqNextId() { return ++jqId; } var SPECIAL_CHARS_REGEXP = /([\:\-\_]+(.))/g; var MOZ_HACK_REGEXP = /^moz([A-Z])/; var MOUSE_EVENT_MAP= { mouseleave: "mouseout", mouseenter: "mouseover"}; var jqLiteMinErr = minErr('jqLite'); /** * Converts snake_case to camelCase. * Also there is special case for Moz prefix starting with upper case letter. * @param name Name to normalize */ function camelCase(name) { return name. replace(SPECIAL_CHARS_REGEXP, function(_, separator, letter, offset) { return offset ? letter.toUpperCase() : letter; }). replace(MOZ_HACK_REGEXP, 'Moz$1'); } var SINGLE_TAG_REGEXP = /^<(\w+)\s*\/?>(?:<\/\1>|)$/; var HTML_REGEXP = /<|&#?\w+;/; var TAG_NAME_REGEXP = /<([\w:]+)/; var XHTML_TAG_REGEXP = /<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:]+)[^>]*)\/>/gi; var wrapMap = { 'option': [1, '<select multiple="multiple">', '</select>'], 'thead': [1, '<table>', '</table>'], 'col': [2, '<table><colgroup>', '</colgroup></table>'], 'tr': [2, '<table><tbody>', '</tbody></table>'], 'td': [3, '<table><tbody><tr>', '</tr></tbody></table>'], '_default': [0, "", ""] }; wrapMap.optgroup = wrapMap.option; wrapMap.tbody = wrapMap.tfoot = wrapMap.colgroup = wrapMap.caption = wrapMap.thead; wrapMap.th = wrapMap.td; function jqLiteIsTextNode(html) { return !HTML_REGEXP.test(html); } function jqLiteAcceptsData(node) { // The window object can accept data but has no nodeType // Otherwise we are only interested in elements (1) and documents (9) var nodeType = node.nodeType; return nodeType === NODE_TYPE_ELEMENT || !nodeType || nodeType === NODE_TYPE_DOCUMENT; } function jqLiteBuildFragment(html, context) { var tmp, tag, wrap, fragment = context.createDocumentFragment(), nodes = [], i; if (jqLiteIsTextNode(html)) { // Convert non-html into a text node nodes.push(context.createTextNode(html)); } else { // Convert html into DOM nodes tmp = tmp || fragment.appendChild(context.createElement("div")); tag = (TAG_NAME_REGEXP.exec(html) || ["", ""])[1].toLowerCase(); wrap = wrapMap[tag] || wrapMap._default; tmp.innerHTML = wrap[1] + html.replace(XHTML_TAG_REGEXP, "<$1></$2>") + wrap[2]; // Descend through wrappers to the right content i = wrap[0]; while (i--) { tmp = tmp.lastChild; } nodes = concat(nodes, tmp.childNodes); tmp = fragment.firstChild; tmp.textContent = ""; } // Remove wrapper from fragment fragment.textContent = ""; fragment.innerHTML = ""; // Clear inner HTML forEach(nodes, function(node) { fragment.appendChild(node); }); return fragment; } function jqLiteParseHTML(html, context) { context = context || document; var parsed; if ((parsed = SINGLE_TAG_REGEXP.exec(html))) { return [context.createElement(parsed[1])]; } if ((parsed = jqLiteBuildFragment(html, context))) { return parsed.childNodes; } return []; } ///////////////////////////////////////////// function JQLite(element) { if (element instanceof JQLite) { return element; } var argIsString; if (isString(element)) { element = trim(element); argIsString = true; } if (!(this instanceof JQLite)) { if (argIsString && element.charAt(0) != '<') { throw jqLiteMinErr('nosel', 'Looking up elements via selectors is not supported by jqLite! See: http://docs.angularjs.org/api/angular.element'); } return new JQLite(element); } if (argIsString) { jqLiteAddNodes(this, jqLiteParseHTML(element)); } else { jqLiteAddNodes(this, element); } } function jqLiteClone(element) { return element.cloneNode(true); } function jqLiteDealoc(element, onlyDescendants) { if (!onlyDescendants) jqLiteRemoveData(element); if (element.querySelectorAll) { var descendants = element.querySelectorAll('*'); for (var i = 0, l = descendants.length; i < l; i++) { jqLiteRemoveData(descendants[i]); } } } function jqLiteOff(element, type, fn, unsupported) { if (isDefined(unsupported)) throw jqLiteMinErr('offargs', 'jqLite#off() does not support the `selector` argument'); var expandoStore = jqLiteExpandoStore(element); var events = expandoStore && expandoStore.events; var handle = expandoStore && expandoStore.handle; if (!handle) return; //no listeners registered if (!type) { for (type in events) { if (type !== '$destroy') { removeEventListenerFn(element, type, handle); } delete events[type]; } } else { forEach(type.split(' '), function(type) { if (isDefined(fn)) { var listenerFns = events[type]; arrayRemove(listenerFns || [], fn); if (listenerFns && listenerFns.length > 0) { return; } } removeEventListenerFn(element, type, handle); delete events[type]; }); } } function jqLiteRemoveData(element, name) { var expandoId = element.ng339; var expandoStore = expandoId && jqCache[expandoId]; if (expandoStore) { if (name) { delete expandoStore.data[name]; return; } if (expandoStore.handle) { if (expandoStore.events.$destroy) { expandoStore.handle({}, '$destroy'); } jqLiteOff(element); } delete jqCache[expandoId]; element.ng339 = undefined; // don't delete DOM expandos. IE and Chrome don't like it } } function jqLiteExpandoStore(element, createIfNecessary) { var expandoId = element.ng339, expandoStore = expandoId && jqCache[expandoId]; if (createIfNecessary && !expandoStore) { element.ng339 = expandoId = jqNextId(); expandoStore = jqCache[expandoId] = {events: {}, data: {}, handle: undefined}; } return expandoStore; } function jqLiteData(element, key, value) { if (jqLiteAcceptsData(element)) { var isSimpleSetter = isDefined(value); var isSimpleGetter = !isSimpleSetter && key && !isObject(key); var massGetter = !key; var expandoStore = jqLiteExpandoStore(element, !isSimpleGetter); var data = expandoStore && expandoStore.data; if (isSimpleSetter) { // data('key', value) data[key] = value; } else { if (massGetter) { // data() return data; } else { if (isSimpleGetter) { // data('key') // don't force creation of expandoStore if it doesn't exist yet return data && data[key]; } else { // mass-setter: data({key1: val1, key2: val2}) extend(data, key); } } } } } function jqLiteHasClass(element, selector) { if (!element.getAttribute) return false; return ((" " + (element.getAttribute('class') || '') + " ").replace(/[\n\t]/g, " "). indexOf(" " + selector + " ") > -1); } function jqLiteRemoveClass(element, cssClasses) { if (cssClasses && element.setAttribute) { forEach(cssClasses.split(' '), function(cssClass) { element.setAttribute('class', trim( (" " + (element.getAttribute('class') || '') + " ") .replace(/[\n\t]/g, " ") .replace(" " + trim(cssClass) + " ", " ")) ); }); } } function jqLiteAddClass(element, cssClasses) { if (cssClasses && element.setAttribute) { var existingClasses = (' ' + (element.getAttribute('class') || '') + ' ') .replace(/[\n\t]/g, " "); forEach(cssClasses.split(' '), function(cssClass) { cssClass = trim(cssClass); if (existingClasses.indexOf(' ' + cssClass + ' ') === -1) { existingClasses += cssClass + ' '; } }); element.setAttribute('class', trim(existingClasses)); } } function jqLiteAddNodes(root, elements) { // THIS CODE IS VERY HOT. Don't make changes without benchmarking. if (elements) { // if a Node (the most common case) if (elements.nodeType) { root[root.length++] = elements; } else { var length = elements.length; // if an Array or NodeList and not a Window if (typeof length === 'number' && elements.window !== elements) { if (length) { for (var i = 0; i < length; i++) { root[root.length++] = elements[i]; } } } else { root[root.length++] = elements; } } } } function jqLiteController(element, name) { return jqLiteInheritedData(element, '$' + (name || 'ngController') + 'Controller'); } function jqLiteInheritedData(element, name, value) { // if element is the document object work with the html element instead // this makes $(document).scope() possible if (element.nodeType == NODE_TYPE_DOCUMENT) { element = element.documentElement; } var names = isArray(name) ? name : [name]; while (element) { for (var i = 0, ii = names.length; i < ii; i++) { if ((value = jqLite.data(element, names[i])) !== undefined) return value; } // If dealing with a document fragment node with a host element, and no parent, use the host // element as the parent. This enables directives within a Shadow DOM or polyfilled Shadow DOM // to lookup parent controllers. element = element.parentNode || (element.nodeType === NODE_TYPE_DOCUMENT_FRAGMENT && element.host); } } function jqLiteEmpty(element) { jqLiteDealoc(element, true); while (element.firstChild) { element.removeChild(element.firstChild); } } function jqLiteRemove(element, keepData) { if (!keepData) jqLiteDealoc(element); var parent = element.parentNode; if (parent) parent.removeChild(element); } function jqLiteDocumentLoaded(action, win) { win = win || window; if (win.document.readyState === 'complete') { // Force the action to be run async for consistent behaviour // from the action's point of view // i.e. it will definitely not be in a $apply win.setTimeout(action); } else { // No need to unbind this handler as load is only ever called once jqLite(win).on('load', action); } } ////////////////////////////////////////// // Functions which are declared directly. ////////////////////////////////////////// var JQLitePrototype = JQLite.prototype = { ready: function(fn) { var fired = false; function trigger() { if (fired) return; fired = true; fn(); } // check if document is already loaded if (document.readyState === 'complete') { setTimeout(trigger); } else { this.on('DOMContentLoaded', trigger); // works for modern browsers and IE9 // we can not use jqLite since we are not done loading and jQuery could be loaded later. // jshint -W064 JQLite(window).on('load', trigger); // fallback to window.onload for others // jshint +W064 } }, toString: function() { var value = []; forEach(this, function(e) { value.push('' + e);}); return '[' + value.join(', ') + ']'; }, eq: function(index) { return (index >= 0) ? jqLite(this[index]) : jqLite(this[this.length + index]); }, length: 0, push: push, sort: [].sort, splice: [].splice }; ////////////////////////////////////////// // Functions iterating getter/setters. // these functions return self on setter and // value on get. ////////////////////////////////////////// var BOOLEAN_ATTR = {}; forEach('multiple,selected,checked,disabled,readOnly,required,open'.split(','), function(value) { BOOLEAN_ATTR[lowercase(value)] = value; }); var BOOLEAN_ELEMENTS = {}; forEach('input,select,option,textarea,button,form,details'.split(','), function(value) { BOOLEAN_ELEMENTS[value] = true; }); var ALIASED_ATTR = { 'ngMinlength': 'minlength', 'ngMaxlength': 'maxlength', 'ngMin': 'min', 'ngMax': 'max', 'ngPattern': 'pattern' }; function getBooleanAttrName(element, name) { // check dom last since we will most likely fail on name var booleanAttr = BOOLEAN_ATTR[name.toLowerCase()]; // booleanAttr is here twice to minimize DOM access return booleanAttr && BOOLEAN_ELEMENTS[nodeName_(element)] && booleanAttr; } function getAliasedAttrName(element, name) { var nodeName = element.nodeName; return (nodeName === 'INPUT' || nodeName === 'TEXTAREA') && ALIASED_ATTR[name]; } forEach({ data: jqLiteData, removeData: jqLiteRemoveData }, function(fn, name) { JQLite[name] = fn; }); forEach({ data: jqLiteData, inheritedData: jqLiteInheritedData, scope: function(element) { // Can't use jqLiteData here directly so we stay compatible with jQuery! return jqLite.data(element, '$scope') || jqLiteInheritedData(element.parentNode || element, ['$isolateScope', '$scope']); }, isolateScope: function(element) { // Can't use jqLiteData here directly so we stay compatible with jQuery! return jqLite.data(element, '$isolateScope') || jqLite.data(element, '$isolateScopeNoTemplate'); }, controller: jqLiteController, injector: function(element) { return jqLiteInheritedData(element, '$injector'); }, removeAttr: function(element, name) { element.removeAttribute(name); }, hasClass: jqLiteHasClass, css: function(element, name, value) { name = camelCase(name); if (isDefined(value)) { element.style[name] = value; } else { return element.style[name]; } }, attr: function(element, name, value) { var lowercasedName = lowercase(name); if (BOOLEAN_ATTR[lowercasedName]) { if (isDefined(value)) { if (!!value) { element[name] = true; element.setAttribute(name, lowercasedName); } else { element[name] = false; element.removeAttribute(lowercasedName); } } else { return (element[name] || (element.attributes.getNamedItem(name) || noop).specified) ? lowercasedName : undefined; } } else if (isDefined(value)) { element.setAttribute(name, value); } else if (element.getAttribute) { // the extra argument "2" is to get the right thing for a.href in IE, see jQuery code // some elements (e.g. Document) don't have get attribute, so return undefined var ret = element.getAttribute(name, 2); // normalize non-existing attributes to undefined (as jQuery) return ret === null ? undefined : ret; } }, prop: function(element, name, value) { if (isDefined(value)) { element[name] = value; } else { return element[name]; } }, text: (function() { getText.$dv = ''; return getText; function getText(element, value) { if (isUndefined(value)) { var nodeType = element.nodeType; return (nodeType === NODE_TYPE_ELEMENT || nodeType === NODE_TYPE_TEXT) ? element.textContent : ''; } element.textContent = value; } })(), val: function(element, value) { if (isUndefined(value)) { if (element.multiple && nodeName_(element) === 'select') { var result = []; forEach(element.options, function(option) { if (option.selected) { result.push(option.value || option.text); } }); return result.length === 0 ? null : result; } return element.value; } element.value = value; }, html: function(element, value) { if (isUndefined(value)) { return element.innerHTML; } jqLiteDealoc(element, true); element.innerHTML = value; }, empty: jqLiteEmpty }, function(fn, name) { /** * Properties: writes return selection, reads return first value */ JQLite.prototype[name] = function(arg1, arg2) { var i, key; var nodeCount = this.length; // jqLiteHasClass has only two arguments, but is a getter-only fn, so we need to special-case it // in a way that survives minification. // jqLiteEmpty takes no arguments but is a setter. if (fn !== jqLiteEmpty && (((fn.length == 2 && (fn !== jqLiteHasClass && fn !== jqLiteController)) ? arg1 : arg2) === undefined)) { if (isObject(arg1)) { // we are a write, but the object properties are the key/values for (i = 0; i < nodeCount; i++) { if (fn === jqLiteData) { // data() takes the whole object in jQuery fn(this[i], arg1); } else { for (key in arg1) { fn(this[i], key, arg1[key]); } } } // return self for chaining return this; } else { // we are a read, so read the first child. // TODO: do we still need this? var value = fn.$dv; // Only if we have $dv do we iterate over all, otherwise it is just the first element. var jj = (value === undefined) ? Math.min(nodeCount, 1) : nodeCount; for (var j = 0; j < jj; j++) { var nodeValue = fn(this[j], arg1, arg2); value = value ? value + nodeValue : nodeValue; } return value; } } else { // we are a write, so apply to all children for (i = 0; i < nodeCount; i++) { fn(this[i], arg1, arg2); } // return self for chaining return this; } }; }); function createEventHandler(element, events) { var eventHandler = function(event, type) { // jQuery specific api event.isDefaultPrevented = function() { return event.defaultPrevented; }; var eventFns = events[type || event.type]; var eventFnsLength = eventFns ? eventFns.length : 0; if (!eventFnsLength) return; if (isUndefined(event.immediatePropagationStopped)) { var originalStopImmediatePropagation = event.stopImmediatePropagation; event.stopImmediatePropagation = function() { event.immediatePropagationStopped = true; if (event.stopPropagation) { event.stopPropagation(); } if (originalStopImmediatePropagation) { originalStopImmediatePropagation.call(event); } }; } event.isImmediatePropagationStopped = function() { return event.immediatePropagationStopped === true; }; // Copy event handlers in case event handlers array is modified during execution. if ((eventFnsLength > 1)) { eventFns = shallowCopy(eventFns); } for (var i = 0; i < eventFnsLength; i++) { if (!event.isImmediatePropagationStopped()) { eventFns[i].call(element, event); } } }; // TODO: this is a hack for angularMocks/clearDataCache that makes it possible to deregister all // events on `element` eventHandler.elem = element; return eventHandler; } ////////////////////////////////////////// // Functions iterating traversal. // These functions chain results into a single // selector. ////////////////////////////////////////// forEach({ removeData: jqLiteRemoveData, on: function jqLiteOn(element, type, fn, unsupported) { if (isDefined(unsupported)) throw jqLiteMinErr('onargs', 'jqLite#on() does not support the `selector` or `eventData` parameters'); // Do not add event handlers to non-elements because they will not be cleaned up. if (!jqLiteAcceptsData(element)) { return; } var expandoStore = jqLiteExpandoStore(element, true); var events = expandoStore.events; var handle = expandoStore.handle; if (!handle) { handle = expandoStore.handle = createEventHandler(element, events); } // http://jsperf.com/string-indexof-vs-split var types = type.indexOf(' ') >= 0 ? type.split(' ') : [type]; var i = types.length; while (i--) { type = types[i]; var eventFns = events[type]; if (!eventFns) { events[type] = []; if (type === 'mouseenter' || type === 'mouseleave') { // Refer to jQuery's implementation of mouseenter & mouseleave // Read about mouseenter and mouseleave: // http://www.quirksmode.org/js/events_mouse.html#link8 jqLiteOn(element, MOUSE_EVENT_MAP[type], function(event) { var target = this, related = event.relatedTarget; // For mousenter/leave call the handler if related is outside the target. // NB: No relatedTarget if the mouse left/entered the browser window if (!related || (related !== target && !target.contains(related))) { handle(event, type); } }); } else { if (type !== '$destroy') { addEventListenerFn(element, type, handle); } } eventFns = events[type]; } eventFns.push(fn); } }, off: jqLiteOff, one: function(element, type, fn) { element = jqLite(element); //add the listener twice so that when it is called //you can remove the original function and still be //able to call element.off(ev, fn) normally element.on(type, function onFn() { element.off(type, fn); element.off(type, onFn); }); element.on(type, fn); }, replaceWith: function(element, replaceNode) { var index, parent = element.parentNode; jqLiteDealoc(element); forEach(new JQLite(replaceNode), function(node) { if (index) { parent.insertBefore(node, index.nextSibling); } else { parent.replaceChild(node, element); } index = node; }); }, children: function(element) { var children = []; forEach(element.childNodes, function(element) { if (element.nodeType === NODE_TYPE_ELEMENT) children.push(element); }); return children; }, contents: function(element) { return element.contentDocument || element.childNodes || []; }, append: function(element, node) { var nodeType = element.nodeType; if (nodeType !== NODE_TYPE_ELEMENT && nodeType !== NODE_TYPE_DOCUMENT_FRAGMENT) return; node = new JQLite(node); for (var i = 0, ii = node.length; i < ii; i++) { var child = node[i]; element.appendChild(child); } }, prepend: function(element, node) { if (element.nodeType === NODE_TYPE_ELEMENT) { var index = element.firstChild; forEach(new JQLite(node), function(child) { element.insertBefore(child, index); }); } }, wrap: function(element, wrapNode) { wrapNode = jqLite(wrapNode).eq(0).clone()[0]; var parent = element.parentNode; if (parent) { parent.replaceChild(wrapNode, element); } wrapNode.appendChild(element); }, remove: jqLiteRemove, detach: function(element) { jqLiteRemove(element, true); }, after: function(element, newElement) { var index = element, parent = element.parentNode; newElement = new JQLite(newElement); for (var i = 0, ii = newElement.length; i < ii; i++) { var node = newElement[i]; parent.insertBefore(node, index.nextSibling); index = node; } }, addClass: jqLiteAddClass, removeClass: jqLiteRemoveClass, toggleClass: function(element, selector, condition) { if (selector) { forEach(selector.split(' '), function(className) { var classCondition = condition; if (isUndefined(classCondition)) { classCondition = !jqLiteHasClass(element, className); } (classCondition ? jqLiteAddClass : jqLiteRemoveClass)(element, className); }); } }, parent: function(element) { var parent = element.parentNode; return parent && parent.nodeType !== NODE_TYPE_DOCUMENT_FRAGMENT ? parent : null; }, next: function(element) { return element.nextElementSibling; }, find: function(element, selector) { if (element.getElementsByTagName) { return element.getElementsByTagName(selector); } else { return []; } }, clone: jqLiteClone, triggerHandler: function(element, event, extraParameters) { var dummyEvent, eventFnsCopy, handlerArgs; var eventName = event.type || event; var expandoStore = jqLiteExpandoStore(element); var events = expandoStore && expandoStore.events; var eventFns = events && events[eventName]; if (eventFns) { // Create a dummy event to pass to the handlers dummyEvent = { preventDefault: function() { this.defaultPrevented = true; }, isDefaultPrevented: function() { return this.defaultPrevented === true; }, stopImmediatePropagation: function() { this.immediatePropagationStopped = true; }, isImmediatePropagationStopped: function() { return this.immediatePropagationStopped === true; }, stopPropagation: noop, type: eventName, target: element }; // If a custom event was provided then extend our dummy event with it if (event.type) { dummyEvent = extend(dummyEvent, event); } // Copy event handlers in case event handlers array is modified during execution. eventFnsCopy = shallowCopy(eventFns); handlerArgs = extraParameters ? [dummyEvent].concat(extraParameters) : [dummyEvent]; forEach(eventFnsCopy, function(fn) { if (!dummyEvent.isImmediatePropagationStopped()) { fn.apply(element, handlerArgs); } }); } } }, function(fn, name) { /** * chaining functions */ JQLite.prototype[name] = function(arg1, arg2, arg3) { var value; for (var i = 0, ii = this.length; i < ii; i++) { if (isUndefined(value)) { value = fn(this[i], arg1, arg2, arg3); if (isDefined(value)) { // any function which returns a value needs to be wrapped value = jqLite(value); } } else { jqLiteAddNodes(value, fn(this[i], arg1, arg2, arg3)); } } return isDefined(value) ? value : this; }; // bind legacy bind/unbind to on/off JQLite.prototype.bind = JQLite.prototype.on; JQLite.prototype.unbind = JQLite.prototype.off; }); // Provider for private $$jqLite service function $$jqLiteProvider() { this.$get = function $$jqLite() { return extend(JQLite, { hasClass: function(node, classes) { if (node.attr) node = node[0]; return jqLiteHasClass(node, classes); }, addClass: function(node, classes) { if (node.attr) node = node[0]; return jqLiteAddClass(node, classes); }, removeClass: function(node, classes) { if (node.attr) node = node[0]; return jqLiteRemoveClass(node, classes); } }); }; } /** * Computes a hash of an 'obj'. * Hash of a: * string is string * number is number as string * object is either result of calling $$hashKey function on the object or uniquely generated id, * that is also assigned to the $$hashKey property of the object. * * @param obj * @returns {string} hash string such that the same input will have the same hash string. * The resulting string key is in 'type:hashKey' format. */ function hashKey(obj, nextUidFn) { var key = obj && obj.$$hashKey; if (key) { if (typeof key === 'function') { key = obj.$$hashKey(); } return key; } var objType = typeof obj; if (objType == 'function' || (objType == 'object' && obj !== null)) { key = obj.$$hashKey = objType + ':' + (nextUidFn || nextUid)(); } else { key = objType + ':' + obj; } return key; } /** * HashMap which can use objects as keys */ function HashMap(array, isolatedUid) { if (isolatedUid) { var uid = 0; this.nextUid = function() { return ++uid; }; } forEach(array, this.put, this); } HashMap.prototype = { /** * Store key value pair * @param key key to store can be any type * @param value value to store can be any type */ put: function(key, value) { this[hashKey(key, this.nextUid)] = value; }, /** * @param key * @returns {Object} the value for the key */ get: function(key) { return this[hashKey(key, this.nextUid)]; }, /** * Remove the key/value pair * @param key */ remove: function(key) { var value = this[key = hashKey(key, this.nextUid)]; delete this[key]; return value; } }; /** * @ngdoc function * @module ng * @name angular.injector * @kind function * * @description * Creates an injector object that can be used for retrieving services as well as for * dependency injection (see {@link guide/di dependency injection}). * * @param {Array.<string|Function>} modules A list of module functions or their aliases. See * {@link angular.module}. The `ng` module must be explicitly added. * @param {boolean=} [strictDi=false] Whether the injector should be in strict mode, which * disallows argument name annotation inference. * @returns {injector} Injector object. See {@link auto.$injector $injector}. * * @example * Typical usage * ```js * // create an injector * var $injector = angular.injector(['ng']); * * // use the injector to kick off your application * // use the type inference to auto inject arguments, or use implicit injection * $injector.invoke(function($rootScope, $compile, $document) { * $compile($document)($rootScope); * $rootScope.$digest(); * }); * ``` * * Sometimes you want to get access to the injector of a currently running Angular app * from outside Angular. Perhaps, you want to inject and compile some markup after the * application has been bootstrapped. You can do this using the extra `injector()` added * to JQuery/jqLite elements. See {@link angular.element}. * * *This is fairly rare but could be the case if a third party library is injecting the * markup.* * * In the following example a new block of HTML containing a `ng-controller` * directive is added to the end of the document body by JQuery. We then compile and link * it into the current AngularJS scope. * * ```js * var $div = $('<div ng-controller="MyCtrl">{{content.label}}</div>'); * $(document.body).append($div); * * angular.element(document).injector().invoke(function($compile) { * var scope = angular.element($div).scope(); * $compile($div)(scope); * }); * ``` */ /** * @ngdoc module * @name auto * @description * * Implicit module which gets automatically added to each {@link auto.$injector $injector}. */ var FN_ARGS = /^function\s*[^\(]*\(\s*([^\)]*)\)/m; var FN_ARG_SPLIT = /,/; var FN_ARG = /^\s*(_?)(\S+?)\1\s*$/; var STRIP_COMMENTS = /((\/\/.*$)|(\/\*[\s\S]*?\*\/))/mg; var $injectorMinErr = minErr('$injector'); function anonFn(fn) { // For anonymous functions, showing at the very least the function signature can help in // debugging. var fnText = fn.toString().replace(STRIP_COMMENTS, ''), args = fnText.match(FN_ARGS); if (args) { return 'function(' + (args[1] || '').replace(/[\s\r\n]+/, ' ') + ')'; } return 'fn'; } function annotate(fn, strictDi, name) { var $inject, fnText, argDecl, last; if (typeof fn === 'function') { if (!($inject = fn.$inject)) { $inject = []; if (fn.length) { if (strictDi) { if (!isString(name) || !name) { name = fn.name || anonFn(fn); } throw $injectorMinErr('strictdi', '{0} is not using explicit annotation and cannot be invoked in strict mode', name); } fnText = fn.toString().replace(STRIP_COMMENTS, ''); argDecl = fnText.match(FN_ARGS); forEach(argDecl[1].split(FN_ARG_SPLIT), function(arg) { arg.replace(FN_ARG, function(all, underscore, name) { $inject.push(name); }); }); } fn.$inject = $inject; } } else if (isArray(fn)) { last = fn.length - 1; assertArgFn(fn[last], 'fn'); $inject = fn.slice(0, last); } else { assertArgFn(fn, 'fn', true); } return $inject; } /////////////////////////////////////// /** * @ngdoc service * @name $injector * * @description * * `$injector` is used to retrieve object instances as defined by * {@link auto.$provide provider}, instantiate types, invoke methods, * and load modules. * * The following always holds true: * * ```js * var $injector = angular.injector(); * expect($injector.get('$injector')).toBe($injector); * expect($injector.invoke(function($injector) { * return $injector; * })).toBe($injector); * ``` * * # Injection Function Annotation * * JavaScript does not have annotations, and annotations are needed for dependency injection. The * following are all valid ways of annotating function with injection arguments and are equivalent. * * ```js * // inferred (only works if code not minified/obfuscated) * $injector.invoke(function(serviceA){}); * * // annotated * function explicit(serviceA) {}; * explicit.$inject = ['serviceA']; * $injector.invoke(explicit); * * // inline * $injector.invoke(['serviceA', function(serviceA){}]); * ``` * * ## Inference * * In JavaScript calling `toString()` on a function returns the function definition. The definition * can then be parsed and the function arguments can be extracted. This method of discovering * annotations is disallowed when the injector is in strict mode. * *NOTE:* This does not work with minification, and obfuscation tools since these tools change the * argument names. * * ## `$inject` Annotation * By adding an `$inject` property onto a function the injection parameters can be specified. * * ## Inline * As an array of injection names, where the last item in the array is the function to call. */ /** * @ngdoc method * @name $injector#get * * @description * Return an instance of the service. * * @param {string} name The name of the instance to retrieve. * @param {string} caller An optional string to provide the origin of the function call for error messages. * @return {*} The instance. */ /** * @ngdoc method * @name $injector#invoke * * @description * Invoke the method and supply the method arguments from the `$injector`. * * @param {!Function} fn The function to invoke. Function parameters are injected according to the * {@link guide/di $inject Annotation} rules. * @param {Object=} self The `this` for the invoked method. * @param {Object=} locals Optional object. If preset then any argument names are read from this * object first, before the `$injector` is consulted. * @returns {*} the value returned by the invoked `fn` function. */ /** * @ngdoc method * @name $injector#has * * @description * Allows the user to query if the particular service exists. * * @param {string} name Name of the service to query. * @returns {boolean} `true` if injector has given service. */ /** * @ngdoc method * @name $injector#instantiate * @description * Create a new instance of JS type. The method takes a constructor function, invokes the new * operator, and supplies all of the arguments to the constructor function as specified by the * constructor annotation. * * @param {Function} Type Annotated constructor function. * @param {Object=} locals Optional object. If preset then any argument names are read from this * object first, before the `$injector` is consulted. * @returns {Object} new instance of `Type`. */ /** * @ngdoc method * @name $injector#annotate * * @description * Returns an array of service names which the function is requesting for injection. This API is * used by the injector to determine which services need to be injected into the function when the * function is invoked. There are three ways in which the function can be annotated with the needed * dependencies. * * # Argument names * * The simplest form is to extract the dependencies from the arguments of the function. This is done * by converting the function into a string using `toString()` method and extracting the argument * names. * ```js * // Given * function MyController($scope, $route) { * // ... * } * * // Then * expect(injector.annotate(MyController)).toEqual(['$scope', '$route']); * ``` * * You can disallow this method by using strict injection mode. * * This method does not work with code minification / obfuscation. For this reason the following * annotation strategies are supported. * * # The `$inject` property * * If a function has an `$inject` property and its value is an array of strings, then the strings * represent names of services to be injected into the function. * ```js * // Given * var MyController = function(obfuscatedScope, obfuscatedRoute) { * // ... * } * // Define function dependencies * MyController['$inject'] = ['$scope', '$route']; * * // Then * expect(injector.annotate(MyController)).toEqual(['$scope', '$route']); * ``` * * # The array notation * * It is often desirable to inline Injected functions and that's when setting the `$inject` property * is very inconvenient. In these situations using the array notation to specify the dependencies in * a way that survives minification is a better choice: * * ```js * // We wish to write this (not minification / obfuscation safe) * injector.invoke(function($compile, $rootScope) { * // ... * }); * * // We are forced to write break inlining * var tmpFn = function(obfuscatedCompile, obfuscatedRootScope) { * // ... * }; * tmpFn.$inject = ['$compile', '$rootScope']; * injector.invoke(tmpFn); * * // To better support inline function the inline annotation is supported * injector.invoke(['$compile', '$rootScope', function(obfCompile, obfRootScope) { * // ... * }]); * * // Therefore * expect(injector.annotate( * ['$compile', '$rootScope', function(obfus_$compile, obfus_$rootScope) {}]) * ).toEqual(['$compile', '$rootScope']); * ``` * * @param {Function|Array.<string|Function>} fn Function for which dependent service names need to * be retrieved as described above. * * @param {boolean=} [strictDi=false] Disallow argument name annotation inference. * * @returns {Array.<string>} The names of the services which the function requires. */ /** * @ngdoc service * @name $provide * * @description * * The {@link auto.$provide $provide} service has a number of methods for registering components * with the {@link auto.$injector $injector}. Many of these functions are also exposed on * {@link angular.Module}. * * An Angular **service** is a singleton object created by a **service factory**. These **service * factories** are functions which, in turn, are created by a **service provider**. * The **service providers** are constructor functions. When instantiated they must contain a * property called `$get`, which holds the **service factory** function. * * When you request a service, the {@link auto.$injector $injector} is responsible for finding the * correct **service provider**, instantiating it and then calling its `$get` **service factory** * function to get the instance of the **service**. * * Often services have no configuration options and there is no need to add methods to the service * provider. The provider will be no more than a constructor function with a `$get` property. For * these cases the {@link auto.$provide $provide} service has additional helper methods to register * services without specifying a provider. * * * {@link auto.$provide#provider provider(provider)} - registers a **service provider** with the * {@link auto.$injector $injector} * * {@link auto.$provide#constant constant(obj)} - registers a value/object that can be accessed by * providers and services. * * {@link auto.$provide#value value(obj)} - registers a value/object that can only be accessed by * services, not providers. * * {@link auto.$provide#factory factory(fn)} - registers a service **factory function**, `fn`, * that will be wrapped in a **service provider** object, whose `$get` property will contain the * given factory function. * * {@link auto.$provide#service service(class)} - registers a **constructor function**, `class` * that will be wrapped in a **service provider** object, whose `$get` property will instantiate * a new object using the given constructor function. * * See the individual methods for more information and examples. */ /** * @ngdoc method * @name $provide#provider * @description * * Register a **provider function** with the {@link auto.$injector $injector}. Provider functions * are constructor functions, whose instances are responsible for "providing" a factory for a * service. * * Service provider names start with the name of the service they provide followed by `Provider`. * For example, the {@link ng.$log $log} service has a provider called * {@link ng.$logProvider $logProvider}. * * Service provider objects can have additional methods which allow configuration of the provider * and its service. Importantly, you can configure what kind of service is created by the `$get` * method, or how that service will act. For example, the {@link ng.$logProvider $logProvider} has a * method {@link ng.$logProvider#debugEnabled debugEnabled} * which lets you specify whether the {@link ng.$log $log} service will log debug messages to the * console or not. * * @param {string} name The name of the instance. NOTE: the provider will be available under `name + 'Provider'` key. * @param {(Object|function())} provider If the provider is: * * - `Object`: then it should have a `$get` method. The `$get` method will be invoked using * {@link auto.$injector#invoke $injector.invoke()} when an instance needs to be created. * - `Constructor`: a new instance of the provider will be created using * {@link auto.$injector#instantiate $injector.instantiate()}, then treated as `object`. * * @returns {Object} registered provider instance * @example * * The following example shows how to create a simple event tracking service and register it using * {@link auto.$provide#provider $provide.provider()}. * * ```js * // Define the eventTracker provider * function EventTrackerProvider() { * var trackingUrl = '/track'; * * // A provider method for configuring where the tracked events should been saved * this.setTrackingUrl = function(url) { * trackingUrl = url; * }; * * // The service factory function * this.$get = ['$http', function($http) { * var trackedEvents = {}; * return { * // Call this to track an event * event: function(event) { * var count = trackedEvents[event] || 0; * count += 1; * trackedEvents[event] = count; * return count; * }, * // Call this to save the tracked events to the trackingUrl * save: function() { * $http.post(trackingUrl, trackedEvents); * } * }; * }]; * } * * describe('eventTracker', function() { * var postSpy; * * beforeEach(module(function($provide) { * // Register the eventTracker provider * $provide.provider('eventTracker', EventTrackerProvider); * })); * * beforeEach(module(function(eventTrackerProvider) { * // Configure eventTracker provider * eventTrackerProvider.setTrackingUrl('/custom-track'); * })); * * it('tracks events', inject(function(eventTracker) { * expect(eventTracker.event('login')).toEqual(1); * expect(eventTracker.event('login')).toEqual(2); * })); * * it('saves to the tracking url', inject(function(eventTracker, $http) { * postSpy = spyOn($http, 'post'); * eventTracker.event('login'); * eventTracker.save(); * expect(postSpy).toHaveBeenCalled(); * expect(postSpy.mostRecentCall.args[0]).not.toEqual('/track'); * expect(postSpy.mostRecentCall.args[0]).toEqual('/custom-track'); * expect(postSpy.mostRecentCall.args[1]).toEqual({ 'login': 1 }); * })); * }); * ``` */ /** * @ngdoc method * @name $provide#factory * @description * * Register a **service factory**, which will be called to return the service instance. * This is short for registering a service where its provider consists of only a `$get` property, * which is the given service factory function. * You should use {@link auto.$provide#factory $provide.factory(getFn)} if you do not need to * configure your service in a provider. * * @param {string} name The name of the instance. * @param {function()} $getFn The $getFn for the instance creation. Internally this is a short hand * for `$provide.provider(name, {$get: $getFn})`. * @returns {Object} registered provider instance * * @example * Here is an example of registering a service * ```js * $provide.factory('ping', ['$http', function($http) { * return function ping() { * return $http.send('/ping'); * }; * }]); * ``` * You would then inject and use this service like this: * ```js * someModule.controller('Ctrl', ['ping', function(ping) { * ping(); * }]); * ``` */ /** * @ngdoc method * @name $provide#service * @description * * Register a **service constructor**, which will be invoked with `new` to create the service * instance. * This is short for registering a service where its provider's `$get` property is the service * constructor function that will be used to instantiate the service instance. * * You should use {@link auto.$provide#service $provide.service(class)} if you define your service * as a type/class. * * @param {string} name The name of the instance. * @param {Function} constructor A class (constructor function) that will be instantiated. * @returns {Object} registered provider instance * * @example * Here is an example of registering a service using * {@link auto.$provide#service $provide.service(class)}. * ```js * var Ping = function($http) { * this.$http = $http; * }; * * Ping.$inject = ['$http']; * * Ping.prototype.send = function() { * return this.$http.get('/ping'); * }; * $provide.service('ping', Ping); * ``` * You would then inject and use this service like this: * ```js * someModule.controller('Ctrl', ['ping', function(ping) { * ping.send(); * }]); * ``` */ /** * @ngdoc method * @name $provide#value * @description * * Register a **value service** with the {@link auto.$injector $injector}, such as a string, a * number, an array, an object or a function. This is short for registering a service where its * provider's `$get` property is a factory function that takes no arguments and returns the **value * service**. * * Value services are similar to constant services, except that they cannot be injected into a * module configuration function (see {@link angular.Module#config}) but they can be overridden by * an Angular * {@link auto.$provide#decorator decorator}. * * @param {string} name The name of the instance. * @param {*} value The value. * @returns {Object} registered provider instance * * @example * Here are some examples of creating value services. * ```js * $provide.value('ADMIN_USER', 'admin'); * * $provide.value('RoleLookup', { admin: 0, writer: 1, reader: 2 }); * * $provide.value('halfOf', function(value) { * return value / 2; * }); * ``` */ /** * @ngdoc method * @name $provide#constant * @description * * Register a **constant service**, such as a string, a number, an array, an object or a function, * with the {@link auto.$injector $injector}. Unlike {@link auto.$provide#value value} it can be * injected into a module configuration function (see {@link angular.Module#config}) and it cannot * be overridden by an Angular {@link auto.$provide#decorator decorator}. * * @param {string} name The name of the constant. * @param {*} value The constant value. * @returns {Object} registered instance * * @example * Here a some examples of creating constants: * ```js * $provide.constant('SHARD_HEIGHT', 306); * * $provide.constant('MY_COLOURS', ['red', 'blue', 'grey']); * * $provide.constant('double', function(value) { * return value * 2; * }); * ``` */ /** * @ngdoc method * @name $provide#decorator * @description * * Register a **service decorator** with the {@link auto.$injector $injector}. A service decorator * intercepts the creation of a service, allowing it to override or modify the behaviour of the * service. The object returned by the decorator may be the original service, or a new service * object which replaces or wraps and delegates to the original service. * * @param {string} name The name of the service to decorate. * @param {function()} decorator This function will be invoked when the service needs to be * instantiated and should return the decorated service instance. The function is called using * the {@link auto.$injector#invoke injector.invoke} method and is therefore fully injectable. * Local injection arguments: * * * `$delegate` - The original service instance, which can be monkey patched, configured, * decorated or delegated to. * * @example * Here we decorate the {@link ng.$log $log} service to convert warnings to errors by intercepting * calls to {@link ng.$log#error $log.warn()}. * ```js * $provide.decorator('$log', ['$delegate', function($delegate) { * $delegate.warn = $delegate.error; * return $delegate; * }]); * ``` */ function createInjector(modulesToLoad, strictDi) { strictDi = (strictDi === true); var INSTANTIATING = {}, providerSuffix = 'Provider', path = [], loadedModules = new HashMap([], true), providerCache = { $provide: { provider: supportObject(provider), factory: supportObject(factory), service: supportObject(service), value: supportObject(value), constant: supportObject(constant), decorator: decorator } }, providerInjector = (providerCache.$injector = createInternalInjector(providerCache, function(serviceName, caller) { if (angular.isString(caller)) { path.push(caller); } throw $injectorMinErr('unpr', "Unknown provider: {0}", path.join(' <- ')); })), instanceCache = {}, instanceInjector = (instanceCache.$injector = createInternalInjector(instanceCache, function(serviceName, caller) { var provider = providerInjector.get(serviceName + providerSuffix, caller); return instanceInjector.invoke(provider.$get, provider, undefined, serviceName); })); forEach(loadModules(modulesToLoad), function(fn) { instanceInjector.invoke(fn || noop); }); return instanceInjector; //////////////////////////////////// // $provider //////////////////////////////////// function supportObject(delegate) { return function(key, value) { if (isObject(key)) { forEach(key, reverseParams(delegate)); } else { return delegate(key, value); } }; } function provider(name, provider_) { assertNotHasOwnProperty(name, 'service'); if (isFunction(provider_) || isArray(provider_)) { provider_ = providerInjector.instantiate(provider_); } if (!provider_.$get) { throw $injectorMinErr('pget', "Provider '{0}' must define $get factory method.", name); } return providerCache[name + providerSuffix] = provider_; } function enforceReturnValue(name, factory) { return function enforcedReturnValue() { var result = instanceInjector.invoke(factory, this); if (isUndefined(result)) { throw $injectorMinErr('undef', "Provider '{0}' must return a value from $get factory method.", name); } return result; }; } function factory(name, factoryFn, enforce) { return provider(name, { $get: enforce !== false ? enforceReturnValue(name, factoryFn) : factoryFn }); } function service(name, constructor) { return factory(name, ['$injector', function($injector) { return $injector.instantiate(constructor); }]); } function value(name, val) { return factory(name, valueFn(val), false); } function constant(name, value) { assertNotHasOwnProperty(name, 'constant'); providerCache[name] = value; instanceCache[name] = value; } function decorator(serviceName, decorFn) { var origProvider = providerInjector.get(serviceName + providerSuffix), orig$get = origProvider.$get; origProvider.$get = function() { var origInstance = instanceInjector.invoke(orig$get, origProvider); return instanceInjector.invoke(decorFn, null, {$delegate: origInstance}); }; } //////////////////////////////////// // Module Loading //////////////////////////////////// function loadModules(modulesToLoad) { var runBlocks = [], moduleFn; forEach(modulesToLoad, function(module) { if (loadedModules.get(module)) return; loadedModules.put(module, true); function runInvokeQueue(queue) { var i, ii; for (i = 0, ii = queue.length; i < ii; i++) { var invokeArgs = queue[i], provider = providerInjector.get(invokeArgs[0]); provider[invokeArgs[1]].apply(provider, invokeArgs[2]); } } try { if (isString(module)) { moduleFn = angularModule(module); runBlocks = runBlocks.concat(loadModules(moduleFn.requires)).concat(moduleFn._runBlocks); runInvokeQueue(moduleFn._invokeQueue); runInvokeQueue(moduleFn._configBlocks); } else if (isFunction(module)) { runBlocks.push(providerInjector.invoke(module)); } else if (isArray(module)) { runBlocks.push(providerInjector.invoke(module)); } else { assertArgFn(module, 'module'); } } catch (e) { if (isArray(module)) { module = module[module.length - 1]; } if (e.message && e.stack && e.stack.indexOf(e.message) == -1) { // Safari & FF's stack traces don't contain error.message content // unlike those of Chrome and IE // So if stack doesn't contain message, we create a new string that contains both. // Since error.stack is read-only in Safari, I'm overriding e and not e.stack here. /* jshint -W022 */ e = e.message + '\n' + e.stack; } throw $injectorMinErr('modulerr', "Failed to instantiate module {0} due to:\n{1}", module, e.stack || e.message || e); } }); return runBlocks; } //////////////////////////////////// // internal Injector //////////////////////////////////// function createInternalInjector(cache, factory) { function getService(serviceName, caller) { if (cache.hasOwnProperty(serviceName)) { if (cache[serviceName] === INSTANTIATING) { throw $injectorMinErr('cdep', 'Circular dependency found: {0}', serviceName + ' <- ' + path.join(' <- ')); } return cache[serviceName]; } else { try { path.unshift(serviceName); cache[serviceName] = INSTANTIATING; return cache[serviceName] = factory(serviceName, caller); } catch (err) { if (cache[serviceName] === INSTANTIATING) { delete cache[serviceName]; } throw err; } finally { path.shift(); } } } function invoke(fn, self, locals, serviceName) { if (typeof locals === 'string') { serviceName = locals; locals = null; } var args = [], $inject = annotate(fn, strictDi, serviceName), length, i, key; for (i = 0, length = $inject.length; i < length; i++) { key = $inject[i]; if (typeof key !== 'string') { throw $injectorMinErr('itkn', 'Incorrect injection token! Expected service name as string, got {0}', key); } args.push( locals && locals.hasOwnProperty(key) ? locals[key] : getService(key, serviceName) ); } if (isArray(fn)) { fn = fn[length]; } // http://jsperf.com/angularjs-invoke-apply-vs-switch // #5388 return fn.apply(self, args); } function instantiate(Type, locals, serviceName) { // Check if Type is annotated and use just the given function at n-1 as parameter // e.g. someModule.factory('greeter', ['$window', function(renamed$window) {}]); // Object creation: http://jsperf.com/create-constructor/2 var instance = Object.create((isArray(Type) ? Type[Type.length - 1] : Type).prototype || null); var returnedValue = invoke(Type, instance, locals, serviceName); return isObject(returnedValue) || isFunction(returnedValue) ? returnedValue : instance; } return { invoke: invoke, instantiate: instantiate, get: getService, annotate: annotate, has: function(name) { return providerCache.hasOwnProperty(name + providerSuffix) || cache.hasOwnProperty(name); } }; } } createInjector.$$annotate = annotate; /** * @ngdoc provider * @name $anchorScrollProvider * * @description * Use `$anchorScrollProvider` to disable automatic scrolling whenever * {@link ng.$location#hash $location.hash()} changes. */ function $AnchorScrollProvider() { var autoScrollingEnabled = true; /** * @ngdoc method * @name $anchorScrollProvider#disableAutoScrolling * * @description * By default, {@link ng.$anchorScroll $anchorScroll()} will automatically detect changes to * {@link ng.$location#hash $location.hash()} and scroll to the element matching the new hash.<br /> * Use this method to disable automatic scrolling. * * If automatic scrolling is disabled, one must explicitly call * {@link ng.$anchorScroll $anchorScroll()} in order to scroll to the element related to the * current hash. */ this.disableAutoScrolling = function() { autoScrollingEnabled = false; }; /** * @ngdoc service * @name $anchorScroll * @kind function * @requires $window * @requires $location * @requires $rootScope * * @description * When called, it checks the current value of {@link ng.$location#hash $location.hash()} and * scrolls to the related element, according to the rules specified in the * [Html5 spec](http://dev.w3.org/html5/spec/Overview.html#the-indicated-part-of-the-document). * * It also watches the {@link ng.$location#hash $location.hash()} and automatically scrolls to * match any anchor whenever it changes. This can be disabled by calling * {@link ng.$anchorScrollProvider#disableAutoScrolling $anchorScrollProvider.disableAutoScrolling()}. * * Additionally, you can use its {@link ng.$anchorScroll#yOffset yOffset} property to specify a * vertical scroll-offset (either fixed or dynamic). * * @property {(number|function|jqLite)} yOffset * If set, specifies a vertical scroll-offset. This is often useful when there are fixed * positioned elements at the top of the page, such as navbars, headers etc. * * `yOffset` can be specified in various ways: * - **number**: A fixed number of pixels to be used as offset.<br /><br /> * - **function**: A getter function called everytime `$anchorScroll()` is executed. Must return * a number representing the offset (in pixels).<br /><br /> * - **jqLite**: A jqLite/jQuery element to be used for specifying the offset. The distance from * the top of the page to the element's bottom will be used as offset.<br /> * **Note**: The element will be taken into account only as long as its `position` is set to * `fixed`. This option is useful, when dealing with responsive navbars/headers that adjust * their height and/or positioning according to the viewport's size. * * <br /> * <div class="alert alert-warning"> * In order for `yOffset` to work properly, scrolling should take place on the document's root and * not some child element. * </div> * * @example <example module="anchorScrollExample"> <file name="index.html"> <div id="scrollArea" ng-controller="ScrollController"> <a ng-click="gotoBottom()">Go to bottom</a> <a id="bottom"></a> You're at the bottom! </div> </file> <file name="script.js"> angular.module('anchorScrollExample', []) .controller('ScrollController', ['$scope', '$location', '$anchorScroll', function ($scope, $location, $anchorScroll) { $scope.gotoBottom = function() { // set the location.hash to the id of // the element you wish to scroll to. $location.hash('bottom'); // call $anchorScroll() $anchorScroll(); }; }]); </file> <file name="style.css"> #scrollArea { height: 280px; overflow: auto; } #bottom { display: block; margin-top: 2000px; } </file> </example> * * <hr /> * The example below illustrates the use of a vertical scroll-offset (specified as a fixed value). * See {@link ng.$anchorScroll#yOffset $anchorScroll.yOffset} for more details. * * @example <example module="anchorScrollOffsetExample"> <file name="index.html"> <div class="fixed-header" ng-controller="headerCtrl"> <a href="" ng-click="gotoAnchor(x)" ng-repeat="x in [1,2,3,4,5]"> Go to anchor {{x}} </a> </div> <div id="anchor{{x}}" class="anchor" ng-repeat="x in [1,2,3,4,5]"> Anchor {{x}} of 5 </div> </file> <file name="script.js"> angular.module('anchorScrollOffsetExample', []) .run(['$anchorScroll', function($anchorScroll) { $anchorScroll.yOffset = 50; // always scroll by 50 extra pixels }]) .controller('headerCtrl', ['$anchorScroll', '$location', '$scope', function ($anchorScroll, $location, $scope) { $scope.gotoAnchor = function(x) { var newHash = 'anchor' + x; if ($location.hash() !== newHash) { // set the $location.hash to `newHash` and // $anchorScroll will automatically scroll to it $location.hash('anchor' + x); } else { // call $anchorScroll() explicitly, // since $location.hash hasn't changed $anchorScroll(); } }; } ]); </file> <file name="style.css"> body { padding-top: 50px; } .anchor { border: 2px dashed DarkOrchid; padding: 10px 10px 200px 10px; } .fixed-header { background-color: rgba(0, 0, 0, 0.2); height: 50px; position: fixed; top: 0; left: 0; right: 0; } .fixed-header > a { display: inline-block; margin: 5px 15px; } </file> </example> */ this.$get = ['$window', '$location', '$rootScope', function($window, $location, $rootScope) { var document = $window.document; // Helper function to get first anchor from a NodeList // (using `Array#some()` instead of `angular#forEach()` since it's more performant // and working in all supported browsers.) function getFirstAnchor(list) { var result = null; Array.prototype.some.call(list, function(element) { if (nodeName_(element) === 'a') { result = element; return true; } }); return result; } function getYOffset() { var offset = scroll.yOffset; if (isFunction(offset)) { offset = offset(); } else if (isElement(offset)) { var elem = offset[0]; var style = $window.getComputedStyle(elem); if (style.position !== 'fixed') { offset = 0; } else { offset = elem.getBoundingClientRect().bottom; } } else if (!isNumber(offset)) { offset = 0; } return offset; } function scrollTo(elem) { if (elem) { elem.scrollIntoView(); var offset = getYOffset(); if (offset) { // `offset` is the number of pixels we should scroll UP in order to align `elem` properly. // This is true ONLY if the call to `elem.scrollIntoView()` initially aligns `elem` at the // top of the viewport. // // IF the number of pixels from the top of `elem` to the end of the page's content is less // than the height of the viewport, then `elem.scrollIntoView()` will align the `elem` some // way down the page. // // This is often the case for elements near the bottom of the page. // // In such cases we do not need to scroll the whole `offset` up, just the difference between // the top of the element and the offset, which is enough to align the top of `elem` at the // desired position. var elemTop = elem.getBoundingClientRect().top; $window.scrollBy(0, elemTop - offset); } } else { $window.scrollTo(0, 0); } } function scroll() { var hash = $location.hash(), elm; // empty hash, scroll to the top of the page if (!hash) scrollTo(null); // element with given id else if ((elm = document.getElementById(hash))) scrollTo(elm); // first anchor with given name :-D else if ((elm = getFirstAnchor(document.getElementsByName(hash)))) scrollTo(elm); // no element and hash == 'top', scroll to the top of the page else if (hash === 'top') scrollTo(null); } // does not scroll when user clicks on anchor link that is currently on // (no url change, no $location.hash() change), browser native does scroll if (autoScrollingEnabled) { $rootScope.$watch(function autoScrollWatch() {return $location.hash();}, function autoScrollWatchAction(newVal, oldVal) { // skip the initial scroll if $location.hash is empty if (newVal === oldVal && newVal === '') return; jqLiteDocumentLoaded(function() { $rootScope.$evalAsync(scroll); }); }); } return scroll; }]; } var $animateMinErr = minErr('$animate'); /** * @ngdoc provider * @name $animateProvider * * @description * Default implementation of $animate that doesn't perform any animations, instead just * synchronously performs DOM * updates and calls done() callbacks. * * In order to enable animations the ngAnimate module has to be loaded. * * To see the functional implementation check out src/ngAnimate/animate.js */ var $AnimateProvider = ['$provide', function($provide) { this.$$selectors = {}; /** * @ngdoc method * @name $animateProvider#register * * @description * Registers a new injectable animation factory function. The factory function produces the * animation object which contains callback functions for each event that is expected to be * animated. * * * `eventFn`: `function(Element, doneFunction)` The element to animate, the `doneFunction` * must be called once the element animation is complete. If a function is returned then the * animation service will use this function to cancel the animation whenever a cancel event is * triggered. * * * ```js * return { * eventFn : function(element, done) { * //code to run the animation * //once complete, then run done() * return function cancellationFunction() { * //code to cancel the animation * } * } * } * ``` * * @param {string} name The name of the animation. * @param {Function} factory The factory function that will be executed to return the animation * object. */ this.register = function(name, factory) { var key = name + '-animation'; if (name && name.charAt(0) != '.') throw $animateMinErr('notcsel', "Expecting class selector starting with '.' got '{0}'.", name); this.$$selectors[name.substr(1)] = key; $provide.factory(key, factory); }; /** * @ngdoc method * @name $animateProvider#classNameFilter * * @description * Sets and/or returns the CSS class regular expression that is checked when performing * an animation. Upon bootstrap the classNameFilter value is not set at all and will * therefore enable $animate to attempt to perform an animation on any element. * When setting the classNameFilter value, animations will only be performed on elements * that successfully match the filter expression. This in turn can boost performance * for low-powered devices as well as applications containing a lot of structural operations. * @param {RegExp=} expression The className expression which will be checked against all animations * @return {RegExp} The current CSS className expression value. If null then there is no expression value */ this.classNameFilter = function(expression) { if (arguments.length === 1) { this.$$classNameFilter = (expression instanceof RegExp) ? expression : null; } return this.$$classNameFilter; }; this.$get = ['$$q', '$$asyncCallback', '$rootScope', function($$q, $$asyncCallback, $rootScope) { var currentDefer; function runAnimationPostDigest(fn) { var cancelFn, defer = $$q.defer(); defer.promise.$$cancelFn = function ngAnimateMaybeCancel() { cancelFn && cancelFn(); }; $rootScope.$$postDigest(function ngAnimatePostDigest() { cancelFn = fn(function ngAnimateNotifyComplete() { defer.resolve(); }); }); return defer.promise; } function resolveElementClasses(element, classes) { var toAdd = [], toRemove = []; var hasClasses = createMap(); forEach((element.attr('class') || '').split(/\s+/), function(className) { hasClasses[className] = true; }); forEach(classes, function(status, className) { var hasClass = hasClasses[className]; // If the most recent class manipulation (via $animate) was to remove the class, and the // element currently has the class, the class is scheduled for removal. Otherwise, if // the most recent class manipulation (via $animate) was to add the class, and the // element does not currently have the class, the class is scheduled to be added. if (status === false && hasClass) { toRemove.push(className); } else if (status === true && !hasClass) { toAdd.push(className); } }); return (toAdd.length + toRemove.length) > 0 && [toAdd.length ? toAdd : null, toRemove.length ? toRemove : null]; } function cachedClassManipulation(cache, classes, op) { for (var i=0, ii = classes.length; i < ii; ++i) { var className = classes[i]; cache[className] = op; } } function asyncPromise() { // only serve one instance of a promise in order to save CPU cycles if (!currentDefer) { currentDefer = $$q.defer(); $$asyncCallback(function() { currentDefer.resolve(); currentDefer = null; }); } return currentDefer.promise; } function applyStyles(element, options) { if (angular.isObject(options)) { var styles = extend(options.from || {}, options.to || {}); element.css(styles); } } /** * * @ngdoc service * @name $animate * @description The $animate service provides rudimentary DOM manipulation functions to * insert, remove and move elements within the DOM, as well as adding and removing classes. * This service is the core service used by the ngAnimate $animator service which provides * high-level animation hooks for CSS and JavaScript. * * $animate is available in the AngularJS core, however, the ngAnimate module must be included * to enable full out animation support. Otherwise, $animate will only perform simple DOM * manipulation operations. * * To learn more about enabling animation support, click here to visit the {@link ngAnimate * ngAnimate module page} as well as the {@link ngAnimate.$animate ngAnimate $animate service * page}. */ return { animate: function(element, from, to) { applyStyles(element, { from: from, to: to }); return asyncPromise(); }, /** * * @ngdoc method * @name $animate#enter * @kind function * @description Inserts the element into the DOM either after the `after` element or * as the first child within the `parent` element. When the function is called a promise * is returned that will be resolved at a later time. * @param {DOMElement} element the element which will be inserted into the DOM * @param {DOMElement} parent the parent element which will append the element as * a child (if the after element is not present) * @param {DOMElement} after the sibling element which will append the element * after itself * @param {object=} options an optional collection of styles that will be applied to the element. * @return {Promise} the animation callback promise */ enter: function(element, parent, after, options) { applyStyles(element, options); after ? after.after(element) : parent.prepend(element); return asyncPromise(); }, /** * * @ngdoc method * @name $animate#leave * @kind function * @description Removes the element from the DOM. When the function is called a promise * is returned that will be resolved at a later time. * @param {DOMElement} element the element which will be removed from the DOM * @param {object=} options an optional collection of options that will be applied to the element. * @return {Promise} the animation callback promise */ leave: function(element, options) { element.remove(); return asyncPromise(); }, /** * * @ngdoc method * @name $animate#move * @kind function * @description Moves the position of the provided element within the DOM to be placed * either after the `after` element or inside of the `parent` element. When the function * is called a promise is returned that will be resolved at a later time. * * @param {DOMElement} element the element which will be moved around within the * DOM * @param {DOMElement} parent the parent element where the element will be * inserted into (if the after element is not present) * @param {DOMElement} after the sibling element where the element will be * positioned next to * @param {object=} options an optional collection of options that will be applied to the element. * @return {Promise} the animation callback promise */ move: function(element, parent, after, options) { // Do not remove element before insert. Removing will cause data associated with the // element to be dropped. Insert will implicitly do the remove. return this.enter(element, parent, after, options); }, /** * * @ngdoc method * @name $animate#addClass * @kind function * @description Adds the provided className CSS class value to the provided element. * When the function is called a promise is returned that will be resolved at a later time. * @param {DOMElement} element the element which will have the className value * added to it * @param {string} className the CSS class which will be added to the element * @param {object=} options an optional collection of options that will be applied to the element. * @return {Promise} the animation callback promise */ addClass: function(element, className, options) { return this.setClass(element, className, [], options); }, $$addClassImmediately: function(element, className, options) { element = jqLite(element); className = !isString(className) ? (isArray(className) ? className.join(' ') : '') : className; forEach(element, function(element) { jqLiteAddClass(element, className); }); applyStyles(element, options); return asyncPromise(); }, /** * * @ngdoc method * @name $animate#removeClass * @kind function * @description Removes the provided className CSS class value from the provided element. * When the function is called a promise is returned that will be resolved at a later time. * @param {DOMElement} element the element which will have the className value * removed from it * @param {string} className the CSS class which will be removed from the element * @param {object=} options an optional collection of options that will be applied to the element. * @return {Promise} the animation callback promise */ removeClass: function(element, className, options) { return this.setClass(element, [], className, options); }, $$removeClassImmediately: function(element, className, options) { element = jqLite(element); className = !isString(className) ? (isArray(className) ? className.join(' ') : '') : className; forEach(element, function(element) { jqLiteRemoveClass(element, className); }); applyStyles(element, options); return asyncPromise(); }, /** * * @ngdoc method * @name $animate#setClass * @kind function * @description Adds and/or removes the given CSS classes to and from the element. * When the function is called a promise is returned that will be resolved at a later time. * @param {DOMElement} element the element which will have its CSS classes changed * removed from it * @param {string} add the CSS classes which will be added to the element * @param {string} remove the CSS class which will be removed from the element * @param {object=} options an optional collection of options that will be applied to the element. * @return {Promise} the animation callback promise */ setClass: function(element, add, remove, options) { var self = this; var STORAGE_KEY = '$$animateClasses'; var createdCache = false; element = jqLite(element); var cache = element.data(STORAGE_KEY); if (!cache) { cache = { classes: {}, options: options }; createdCache = true; } else if (options && cache.options) { cache.options = angular.extend(cache.options || {}, options); } var classes = cache.classes; add = isArray(add) ? add : add.split(' '); remove = isArray(remove) ? remove : remove.split(' '); cachedClassManipulation(classes, add, true); cachedClassManipulation(classes, remove, false); if (createdCache) { cache.promise = runAnimationPostDigest(function(done) { var cache = element.data(STORAGE_KEY); element.removeData(STORAGE_KEY); // in the event that the element is removed before postDigest // is run then the cache will be undefined and there will be // no need anymore to add or remove and of the element classes if (cache) { var classes = resolveElementClasses(element, cache.classes); if (classes) { self.$$setClassImmediately(element, classes[0], classes[1], cache.options); } } done(); }); element.data(STORAGE_KEY, cache); } return cache.promise; }, $$setClassImmediately: function(element, add, remove, options) { add && this.$$addClassImmediately(element, add); remove && this.$$removeClassImmediately(element, remove); applyStyles(element, options); return asyncPromise(); }, enabled: noop, cancel: noop }; }]; }]; function $$AsyncCallbackProvider() { this.$get = ['$$rAF', '$timeout', function($$rAF, $timeout) { return $$rAF.supported ? function(fn) { return $$rAF(fn); } : function(fn) { return $timeout(fn, 0, false); }; }]; } /* global stripHash: true */ /** * ! This is a private undocumented service ! * * @name $browser * @requires $log * @description * This object has two goals: * * - hide all the global state in the browser caused by the window object * - abstract away all the browser specific features and inconsistencies * * For tests we provide {@link ngMock.$browser mock implementation} of the `$browser` * service, which can be used for convenient testing of the application without the interaction with * the real browser apis. */ /** * @param {object} window The global window object. * @param {object} document jQuery wrapped document. * @param {object} $log window.console or an object with the same interface. * @param {object} $sniffer $sniffer service */ function Browser(window, document, $log, $sniffer) { var self = this, rawDocument = document[0], location = window.location, history = window.history, setTimeout = window.setTimeout, clearTimeout = window.clearTimeout, pendingDeferIds = {}; self.isMock = false; var outstandingRequestCount = 0; var outstandingRequestCallbacks = []; // TODO(vojta): remove this temporary api self.$$completeOutstandingRequest = completeOutstandingRequest; self.$$incOutstandingRequestCount = function() { outstandingRequestCount++; }; /** * Executes the `fn` function(supports currying) and decrements the `outstandingRequestCallbacks` * counter. If the counter reaches 0, all the `outstandingRequestCallbacks` are executed. */ function completeOutstandingRequest(fn) { try { fn.apply(null, sliceArgs(arguments, 1)); } finally { outstandingRequestCount--; if (outstandingRequestCount === 0) { while (outstandingRequestCallbacks.length) { try { outstandingRequestCallbacks.pop()(); } catch (e) { $log.error(e); } } } } } function getHash(url) { var index = url.indexOf('#'); return index === -1 ? '' : url.substr(index + 1); } /** * @private * Note: this method is used only by scenario runner * TODO(vojta): prefix this method with $$ ? * @param {function()} callback Function that will be called when no outstanding request */ self.notifyWhenNoOutstandingRequests = function(callback) { // force browser to execute all pollFns - this is needed so that cookies and other pollers fire // at some deterministic time in respect to the test runner's actions. Leaving things up to the // regular poller would result in flaky tests. forEach(pollFns, function(pollFn) { pollFn(); }); if (outstandingRequestCount === 0) { callback(); } else { outstandingRequestCallbacks.push(callback); } }; ////////////////////////////////////////////////////////////// // Poll Watcher API ////////////////////////////////////////////////////////////// var pollFns = [], pollTimeout; /** * @name $browser#addPollFn * * @param {function()} fn Poll function to add * * @description * Adds a function to the list of functions that poller periodically executes, * and starts polling if not started yet. * * @returns {function()} the added function */ self.addPollFn = function(fn) { if (isUndefined(pollTimeout)) startPoller(100, setTimeout); pollFns.push(fn); return fn; }; /** * @param {number} interval How often should browser call poll functions (ms) * @param {function()} setTimeout Reference to a real or fake `setTimeout` function. * * @description * Configures the poller to run in the specified intervals, using the specified * setTimeout fn and kicks it off. */ function startPoller(interval, setTimeout) { (function check() { forEach(pollFns, function(pollFn) { pollFn(); }); pollTimeout = setTimeout(check, interval); })(); } ////////////////////////////////////////////////////////////// // URL API ////////////////////////////////////////////////////////////// var cachedState, lastHistoryState, lastBrowserUrl = location.href, baseElement = document.find('base'), reloadLocation = null; cacheState(); lastHistoryState = cachedState; /** * @name $browser#url * * @description * GETTER: * Without any argument, this method just returns current value of location.href. * * SETTER: * With at least one argument, this method sets url to new value. * If html5 history api supported, pushState/replaceState is used, otherwise * location.href/location.replace is used. * Returns its own instance to allow chaining * * NOTE: this api is intended for use only by the $location service. Please use the * {@link ng.$location $location service} to change url. * * @param {string} url New url (when used as setter) * @param {boolean=} replace Should new url replace current history record? * @param {object=} state object to use with pushState/replaceState */ self.url = function(url, replace, state) { // In modern browsers `history.state` is `null` by default; treating it separately // from `undefined` would cause `$browser.url('/foo')` to change `history.state` // to undefined via `pushState`. Instead, let's change `undefined` to `null` here. if (isUndefined(state)) { state = null; } // Android Browser BFCache causes location, history reference to become stale. if (location !== window.location) location = window.location; if (history !== window.history) history = window.history; // setter if (url) { var sameState = lastHistoryState === state; // Don't change anything if previous and current URLs and states match. This also prevents // IE<10 from getting into redirect loop when in LocationHashbangInHtml5Url mode. // See https://github.com/angular/angular.js/commit/ffb2701 if (lastBrowserUrl === url && (!$sniffer.history || sameState)) { return self; } var sameBase = lastBrowserUrl && stripHash(lastBrowserUrl) === stripHash(url); lastBrowserUrl = url; lastHistoryState = state; // Don't use history API if only the hash changed // due to a bug in IE10/IE11 which leads // to not firing a `hashchange` nor `popstate` event // in some cases (see #9143). if ($sniffer.history && (!sameBase || !sameState)) { history[replace ? 'replaceState' : 'pushState'](state, '', url); cacheState(); // Do the assignment again so that those two variables are referentially identical. lastHistoryState = cachedState; } else { if (!sameBase) { reloadLocation = url; } if (replace) { location.replace(url); } else if (!sameBase) { location.href = url; } else { location.hash = getHash(url); } } return self; // getter } else { // - reloadLocation is needed as browsers don't allow to read out // the new location.href if a reload happened. // - the replacement is a workaround for https://bugzilla.mozilla.org/show_bug.cgi?id=407172 return reloadLocation || location.href.replace(/%27/g,"'"); } }; /** * @name $browser#state * * @description * This method is a getter. * * Return history.state or null if history.state is undefined. * * @returns {object} state */ self.state = function() { return cachedState; }; var urlChangeListeners = [], urlChangeInit = false; function cacheStateAndFireUrlChange() { cacheState(); fireUrlChange(); } // This variable should be used *only* inside the cacheState function. var lastCachedState = null; function cacheState() { // This should be the only place in $browser where `history.state` is read. cachedState = window.history.state; cachedState = isUndefined(cachedState) ? null : cachedState; // Prevent callbacks fo fire twice if both hashchange & popstate were fired. if (equals(cachedState, lastCachedState)) { cachedState = lastCachedState; } lastCachedState = cachedState; } function fireUrlChange() { if (lastBrowserUrl === self.url() && lastHistoryState === cachedState) { return; } lastBrowserUrl = self.url(); lastHistoryState = cachedState; forEach(urlChangeListeners, function(listener) { listener(self.url(), cachedState); }); } /** * @name $browser#onUrlChange * * @description * Register callback function that will be called, when url changes. * * It's only called when the url is changed from outside of angular: * - user types different url into address bar * - user clicks on history (forward/back) button * - user clicks on a link * * It's not called when url is changed by $browser.url() method * * The listener gets called with new url as parameter. * * NOTE: this api is intended for use only by the $location service. Please use the * {@link ng.$location $location service} to monitor url changes in angular apps. * * @param {function(string)} listener Listener function to be called when url changes. * @return {function(string)} Returns the registered listener fn - handy if the fn is anonymous. */ self.onUrlChange = function(callback) { // TODO(vojta): refactor to use node's syntax for events if (!urlChangeInit) { // We listen on both (hashchange/popstate) when available, as some browsers (e.g. Opera) // don't fire popstate when user change the address bar and don't fire hashchange when url // changed by push/replaceState // html5 history api - popstate event if ($sniffer.history) jqLite(window).on('popstate', cacheStateAndFireUrlChange); // hashchange event jqLite(window).on('hashchange', cacheStateAndFireUrlChange); urlChangeInit = true; } urlChangeListeners.push(callback); return callback; }; /** * Checks whether the url has changed outside of Angular. * Needs to be exported to be able to check for changes that have been done in sync, * as hashchange/popstate events fire in async. */ self.$$checkUrlChange = fireUrlChange; ////////////////////////////////////////////////////////////// // Misc API ////////////////////////////////////////////////////////////// /** * @name $browser#baseHref * * @description * Returns current <base href> * (always relative - without domain) * * @returns {string} The current base href */ self.baseHref = function() { var href = baseElement.attr('href'); return href ? href.replace(/^(https?\:)?\/\/[^\/]*/, '') : ''; }; ////////////////////////////////////////////////////////////// // Cookies API ////////////////////////////////////////////////////////////// var lastCookies = {}; var lastCookieString = ''; var cookiePath = self.baseHref(); function safeDecodeURIComponent(str) { try { return decodeURIComponent(str); } catch (e) { return str; } } /** * @name $browser#cookies * * @param {string=} name Cookie name * @param {string=} value Cookie value * * @description * The cookies method provides a 'private' low level access to browser cookies. * It is not meant to be used directly, use the $cookie service instead. * * The return values vary depending on the arguments that the method was called with as follows: * * - cookies() -> hash of all cookies, this is NOT a copy of the internal state, so do not modify * it * - cookies(name, value) -> set name to value, if value is undefined delete the cookie * - cookies(name) -> the same as (name, undefined) == DELETES (no one calls it right now that * way) * * @returns {Object} Hash of all cookies (if called without any parameter) */ self.cookies = function(name, value) { var cookieLength, cookieArray, cookie, i, index; if (name) { if (value === undefined) { rawDocument.cookie = encodeURIComponent(name) + "=;path=" + cookiePath + ";expires=Thu, 01 Jan 1970 00:00:00 GMT"; } else { if (isString(value)) { cookieLength = (rawDocument.cookie = encodeURIComponent(name) + '=' + encodeURIComponent(value) + ';path=' + cookiePath).length + 1; // per http://www.ietf.org/rfc/rfc2109.txt browser must allow at minimum: // - 300 cookies // - 20 cookies per unique domain // - 4096 bytes per cookie if (cookieLength > 4096) { $log.warn("Cookie '" + name + "' possibly not set or overflowed because it was too large (" + cookieLength + " > 4096 bytes)!"); } } } } else { if (rawDocument.cookie !== lastCookieString) { lastCookieString = rawDocument.cookie; cookieArray = lastCookieString.split("; "); lastCookies = {}; for (i = 0; i < cookieArray.length; i++) { cookie = cookieArray[i]; index = cookie.indexOf('='); if (index > 0) { //ignore nameless cookies name = safeDecodeURIComponent(cookie.substring(0, index)); // the first value that is seen for a cookie is the most // specific one. values for the same cookie name that // follow are for less specific paths. if (lastCookies[name] === undefined) { lastCookies[name] = safeDecodeURIComponent(cookie.substring(index + 1)); } } } } return lastCookies; } }; /** * @name $browser#defer * @param {function()} fn A function, who's execution should be deferred. * @param {number=} [delay=0] of milliseconds to defer the function execution. * @returns {*} DeferId that can be used to cancel the task via `$browser.defer.cancel()`. * * @description * Executes a fn asynchronously via `setTimeout(fn, delay)`. * * Unlike when calling `setTimeout` directly, in test this function is mocked and instead of using * `setTimeout` in tests, the fns are queued in an array, which can be programmatically flushed * via `$browser.defer.flush()`. * */ self.defer = function(fn, delay) { var timeoutId; outstandingRequestCount++; timeoutId = setTimeout(function() { delete pendingDeferIds[timeoutId]; completeOutstandingRequest(fn); }, delay || 0); pendingDeferIds[timeoutId] = true; return timeoutId; }; /** * @name $browser#defer.cancel * * @description * Cancels a deferred task identified with `deferId`. * * @param {*} deferId Token returned by the `$browser.defer` function. * @returns {boolean} Returns `true` if the task hasn't executed yet and was successfully * canceled. */ self.defer.cancel = function(deferId) { if (pendingDeferIds[deferId]) { delete pendingDeferIds[deferId]; clearTimeout(deferId); completeOutstandingRequest(noop); return true; } return false; }; } function $BrowserProvider() { this.$get = ['$window', '$log', '$sniffer', '$document', function($window, $log, $sniffer, $document) { return new Browser($window, $document, $log, $sniffer); }]; } /** * @ngdoc service * @name $cacheFactory * * @description * Factory that constructs {@link $cacheFactory.Cache Cache} objects and gives access to * them. * * ```js * * var cache = $cacheFactory('cacheId'); * expect($cacheFactory.get('cacheId')).toBe(cache); * expect($cacheFactory.get('noSuchCacheId')).not.toBeDefined(); * * cache.put("key", "value"); * cache.put("another key", "another value"); * * // We've specified no options on creation * expect(cache.info()).toEqual({id: 'cacheId', size: 2}); * * ``` * * * @param {string} cacheId Name or id of the newly created cache. * @param {object=} options Options object that specifies the cache behavior. Properties: * * - `{number=}` `capacity` — turns the cache into LRU cache. * * @returns {object} Newly created cache object with the following set of methods: * * - `{object}` `info()` — Returns id, size, and options of cache. * - `{{*}}` `put({string} key, {*} value)` — Puts a new key-value pair into the cache and returns * it. * - `{{*}}` `get({string} key)` — Returns cached value for `key` or undefined for cache miss. * - `{void}` `remove({string} key)` — Removes a key-value pair from the cache. * - `{void}` `removeAll()` — Removes all cached values. * - `{void}` `destroy()` — Removes references to this cache from $cacheFactory. * * @example <example module="cacheExampleApp"> <file name="index.html"> <div ng-controller="CacheController"> <input ng-model="newCacheKey" placeholder="Key"> <input ng-model="newCacheValue" placeholder="Value"> <button ng-click="put(newCacheKey, newCacheValue)">Cache</button> <p ng-if="keys.length">Cached Values</p> <div ng-repeat="key in keys"> <span ng-bind="key"></span> <span>: </span> <b ng-bind="cache.get(key)"></b> </div> <p>Cache Info</p> <div ng-repeat="(key, value) in cache.info()"> <span ng-bind="key"></span> <span>: </span> <b ng-bind="value"></b> </div> </div> </file> <file name="script.js"> angular.module('cacheExampleApp', []). controller('CacheController', ['$scope', '$cacheFactory', function($scope, $cacheFactory) { $scope.keys = []; $scope.cache = $cacheFactory('cacheId'); $scope.put = function(key, value) { if ($scope.cache.get(key) === undefined) { $scope.keys.push(key); } $scope.cache.put(key, value === undefined ? null : value); }; }]); </file> <file name="style.css"> p { margin: 10px 0 3px; } </file> </example> */ function $CacheFactoryProvider() { this.$get = function() { var caches = {}; function cacheFactory(cacheId, options) { if (cacheId in caches) { throw minErr('$cacheFactory')('iid', "CacheId '{0}' is already taken!", cacheId); } var size = 0, stats = extend({}, options, {id: cacheId}), data = {}, capacity = (options && options.capacity) || Number.MAX_VALUE, lruHash = {}, freshEnd = null, staleEnd = null; /** * @ngdoc type * @name $cacheFactory.Cache * * @description * A cache object used to store and retrieve data, primarily used by * {@link $http $http} and the {@link ng.directive:script script} directive to cache * templates and other data. * * ```js * angular.module('superCache') * .factory('superCache', ['$cacheFactory', function($cacheFactory) { * return $cacheFactory('super-cache'); * }]); * ``` * * Example test: * * ```js * it('should behave like a cache', inject(function(superCache) { * superCache.put('key', 'value'); * superCache.put('another key', 'another value'); * * expect(superCache.info()).toEqual({ * id: 'super-cache', * size: 2 * }); * * superCache.remove('another key'); * expect(superCache.get('another key')).toBeUndefined(); * * superCache.removeAll(); * expect(superCache.info()).toEqual({ * id: 'super-cache', * size: 0 * }); * })); * ``` */ return caches[cacheId] = { /** * @ngdoc method * @name $cacheFactory.Cache#put * @kind function * * @description * Inserts a named entry into the {@link $cacheFactory.Cache Cache} object to be * retrieved later, and incrementing the size of the cache if the key was not already * present in the cache. If behaving like an LRU cache, it will also remove stale * entries from the set. * * It will not insert undefined values into the cache. * * @param {string} key the key under which the cached data is stored. * @param {*} value the value to store alongside the key. If it is undefined, the key * will not be stored. * @returns {*} the value stored. */ put: function(key, value) { if (capacity < Number.MAX_VALUE) { var lruEntry = lruHash[key] || (lruHash[key] = {key: key}); refresh(lruEntry); } if (isUndefined(value)) return; if (!(key in data)) size++; data[key] = value; if (size > capacity) { this.remove(staleEnd.key); } return value; }, /** * @ngdoc method * @name $cacheFactory.Cache#get * @kind function * * @description * Retrieves named data stored in the {@link $cacheFactory.Cache Cache} object. * * @param {string} key the key of the data to be retrieved * @returns {*} the value stored. */ get: function(key) { if (capacity < Number.MAX_VALUE) { var lruEntry = lruHash[key]; if (!lruEntry) return; refresh(lruEntry); } return data[key]; }, /** * @ngdoc method * @name $cacheFactory.Cache#remove * @kind function * * @description * Removes an entry from the {@link $cacheFactory.Cache Cache} object. * * @param {string} key the key of the entry to be removed */ remove: function(key) { if (capacity < Number.MAX_VALUE) { var lruEntry = lruHash[key]; if (!lruEntry) return; if (lruEntry == freshEnd) freshEnd = lruEntry.p; if (lruEntry == staleEnd) staleEnd = lruEntry.n; link(lruEntry.n,lruEntry.p); delete lruHash[key]; } delete data[key]; size--; }, /** * @ngdoc method * @name $cacheFactory.Cache#removeAll * @kind function * * @description * Clears the cache object of any entries. */ removeAll: function() { data = {}; size = 0; lruHash = {}; freshEnd = staleEnd = null; }, /** * @ngdoc method * @name $cacheFactory.Cache#destroy * @kind function * * @description * Destroys the {@link $cacheFactory.Cache Cache} object entirely, * removing it from the {@link $cacheFactory $cacheFactory} set. */ destroy: function() { data = null; stats = null; lruHash = null; delete caches[cacheId]; }, /** * @ngdoc method * @name $cacheFactory.Cache#info * @kind function * * @description * Retrieve information regarding a particular {@link $cacheFactory.Cache Cache}. * * @returns {object} an object with the following properties: * <ul> * <li>**id**: the id of the cache instance</li> * <li>**size**: the number of entries kept in the cache instance</li> * <li>**...**: any additional properties from the options object when creating the * cache.</li> * </ul> */ info: function() { return extend({}, stats, {size: size}); } }; /** * makes the `entry` the freshEnd of the LRU linked list */ function refresh(entry) { if (entry != freshEnd) { if (!staleEnd) { staleEnd = entry; } else if (staleEnd == entry) { staleEnd = entry.n; } link(entry.n, entry.p); link(entry, freshEnd); freshEnd = entry; freshEnd.n = null; } } /** * bidirectionally links two entries of the LRU linked list */ function link(nextEntry, prevEntry) { if (nextEntry != prevEntry) { if (nextEntry) nextEntry.p = prevEntry; //p stands for previous, 'prev' didn't minify if (prevEntry) prevEntry.n = nextEntry; //n stands for next, 'next' didn't minify } } } /** * @ngdoc method * @name $cacheFactory#info * * @description * Get information about all the caches that have been created * * @returns {Object} - key-value map of `cacheId` to the result of calling `cache#info` */ cacheFactory.info = function() { var info = {}; forEach(caches, function(cache, cacheId) { info[cacheId] = cache.info(); }); return info; }; /** * @ngdoc method * @name $cacheFactory#get * * @description * Get access to a cache object by the `cacheId` used when it was created. * * @param {string} cacheId Name or id of a cache to access. * @returns {object} Cache object identified by the cacheId or undefined if no such cache. */ cacheFactory.get = function(cacheId) { return caches[cacheId]; }; return cacheFactory; }; } /** * @ngdoc service * @name $templateCache * * @description * The first time a template is used, it is loaded in the template cache for quick retrieval. You * can load templates directly into the cache in a `script` tag, or by consuming the * `$templateCache` service directly. * * Adding via the `script` tag: * * ```html * <script type="text/ng-template" id="templateId.html"> * <p>This is the content of the template</p> * </script> * ``` * * **Note:** the `script` tag containing the template does not need to be included in the `head` of * the document, but it must be a descendent of the {@link ng.$rootElement $rootElement} (IE, * element with ng-app attribute), otherwise the template will be ignored. * * Adding via the $templateCache service: * * ```js * var myApp = angular.module('myApp', []); * myApp.run(function($templateCache) { * $templateCache.put('templateId.html', 'This is the content of the template'); * }); * ``` * * To retrieve the template later, simply use it in your HTML: * ```html * <div ng-include=" 'templateId.html' "></div> * ``` * * or get it via Javascript: * ```js * $templateCache.get('templateId.html') * ``` * * See {@link ng.$cacheFactory $cacheFactory}. * */ function $TemplateCacheProvider() { this.$get = ['$cacheFactory', function($cacheFactory) { return $cacheFactory('templates'); }]; } /* ! VARIABLE/FUNCTION NAMING CONVENTIONS THAT APPLY TO THIS FILE! * * DOM-related variables: * * - "node" - DOM Node * - "element" - DOM Element or Node * - "$node" or "$element" - jqLite-wrapped node or element * * * Compiler related stuff: * * - "linkFn" - linking fn of a single directive * - "nodeLinkFn" - function that aggregates all linking fns for a particular node * - "childLinkFn" - function that aggregates all linking fns for child nodes of a particular node * - "compositeLinkFn" - function that aggregates all linking fns for a compilation root (nodeList) */ /** * @ngdoc service * @name $compile * @kind function * * @description * Compiles an HTML string or DOM into a template and produces a template function, which * can then be used to link {@link ng.$rootScope.Scope `scope`} and the template together. * * The compilation is a process of walking the DOM tree and matching DOM elements to * {@link ng.$compileProvider#directive directives}. * * <div class="alert alert-warning"> * **Note:** This document is an in-depth reference of all directive options. * For a gentle introduction to directives with examples of common use cases, * see the {@link guide/directive directive guide}. * </div> * * ## Comprehensive Directive API * * There are many different options for a directive. * * The difference resides in the return value of the factory function. * You can either return a "Directive Definition Object" (see below) that defines the directive properties, * or just the `postLink` function (all other properties will have the default values). * * <div class="alert alert-success"> * **Best Practice:** It's recommended to use the "directive definition object" form. * </div> * * Here's an example directive declared with a Directive Definition Object: * * ```js * var myModule = angular.module(...); * * myModule.directive('directiveName', function factory(injectables) { * var directiveDefinitionObject = { * priority: 0, * template: '<div></div>', // or // function(tElement, tAttrs) { ... }, * // or * // templateUrl: 'directive.html', // or // function(tElement, tAttrs) { ... }, * transclude: false, * restrict: 'A', * templateNamespace: 'html', * scope: false, * controller: function($scope, $element, $attrs, $transclude, otherInjectables) { ... }, * controllerAs: 'stringAlias', * require: 'siblingDirectiveName', // or // ['^parentDirectiveName', '?optionalDirectiveName', '?^optionalParent'], * compile: function compile(tElement, tAttrs, transclude) { * return { * pre: function preLink(scope, iElement, iAttrs, controller) { ... }, * post: function postLink(scope, iElement, iAttrs, controller) { ... } * } * // or * // return function postLink( ... ) { ... } * }, * // or * // link: { * // pre: function preLink(scope, iElement, iAttrs, controller) { ... }, * // post: function postLink(scope, iElement, iAttrs, controller) { ... } * // } * // or * // link: function postLink( ... ) { ... } * }; * return directiveDefinitionObject; * }); * ``` * * <div class="alert alert-warning"> * **Note:** Any unspecified options will use the default value. You can see the default values below. * </div> * * Therefore the above can be simplified as: * * ```js * var myModule = angular.module(...); * * myModule.directive('directiveName', function factory(injectables) { * var directiveDefinitionObject = { * link: function postLink(scope, iElement, iAttrs) { ... } * }; * return directiveDefinitionObject; * // or * // return function postLink(scope, iElement, iAttrs) { ... } * }); * ``` * * * * ### Directive Definition Object * * The directive definition object provides instructions to the {@link ng.$compile * compiler}. The attributes are: * * #### `multiElement` * When this property is set to true, the HTML compiler will collect DOM nodes between * nodes with the attributes `directive-name-start` and `directive-name-end`, and group them * together as the directive elements. It is recommended that this feature be used on directives * which are not strictly behavioural (such as {@link ngClick}), and which * do not manipulate or replace child nodes (such as {@link ngInclude}). * * #### `priority` * When there are multiple directives defined on a single DOM element, sometimes it * is necessary to specify the order in which the directives are applied. The `priority` is used * to sort the directives before their `compile` functions get called. Priority is defined as a * number. Directives with greater numerical `priority` are compiled first. Pre-link functions * are also run in priority order, but post-link functions are run in reverse order. The order * of directives with the same priority is undefined. The default priority is `0`. * * #### `terminal` * If set to true then the current `priority` will be the last set of directives * which will execute (any directives at the current priority will still execute * as the order of execution on same `priority` is undefined). Note that expressions * and other directives used in the directive's template will also be excluded from execution. * * #### `scope` * **If set to `true`,** then a new scope will be created for this directive. If multiple directives on the * same element request a new scope, only one new scope is created. The new scope rule does not * apply for the root of the template since the root of the template always gets a new scope. * * **If set to `{}` (object hash),** then a new "isolate" scope is created. The 'isolate' scope differs from * normal scope in that it does not prototypically inherit from the parent scope. This is useful * when creating reusable components, which should not accidentally read or modify data in the * parent scope. * * The 'isolate' scope takes an object hash which defines a set of local scope properties * derived from the parent scope. These local properties are useful for aliasing values for * templates. Locals definition is a hash of local scope property to its source: * * * `@` or `@attr` - bind a local scope property to the value of DOM attribute. The result is * always a string since DOM attributes are strings. If no `attr` name is specified then the * attribute name is assumed to be the same as the local name. * Given `<widget my-attr="hello {{name}}">` and widget definition * of `scope: { localName:'@myAttr' }`, then widget scope property `localName` will reflect * the interpolated value of `hello {{name}}`. As the `name` attribute changes so will the * `localName` property on the widget scope. The `name` is read from the parent scope (not * component scope). * * * `=` or `=attr` - set up bi-directional binding between a local scope property and the * parent scope property of name defined via the value of the `attr` attribute. If no `attr` * name is specified then the attribute name is assumed to be the same as the local name. * Given `<widget my-attr="parentModel">` and widget definition of * `scope: { localModel:'=myAttr' }`, then widget scope property `localModel` will reflect the * value of `parentModel` on the parent scope. Any changes to `parentModel` will be reflected * in `localModel` and any changes in `localModel` will reflect in `parentModel`. If the parent * scope property doesn't exist, it will throw a NON_ASSIGNABLE_MODEL_EXPRESSION exception. You * can avoid this behavior using `=?` or `=?attr` in order to flag the property as optional. If * you want to shallow watch for changes (i.e. $watchCollection instead of $watch) you can use * `=*` or `=*attr` (`=*?` or `=*?attr` if the property is optional). * * * `&` or `&attr` - provides a way to execute an expression in the context of the parent scope. * If no `attr` name is specified then the attribute name is assumed to be the same as the * local name. Given `<widget my-attr="count = count + value">` and widget definition of * `scope: { localFn:'&myAttr' }`, then isolate scope property `localFn` will point to * a function wrapper for the `count = count + value` expression. Often it's desirable to * pass data from the isolated scope via an expression to the parent scope, this can be * done by passing a map of local variable names and values into the expression wrapper fn. * For example, if the expression is `increment(amount)` then we can specify the amount value * by calling the `localFn` as `localFn({amount: 22})`. * * * #### `bindToController` * When an isolate scope is used for a component (see above), and `controllerAs` is used, `bindToController: true` will * allow a component to have its properties bound to the controller, rather than to scope. When the controller * is instantiated, the initial values of the isolate scope bindings are already available. * * #### `controller` * Controller constructor function. The controller is instantiated before the * pre-linking phase and it is shared with other directives (see * `require` attribute). This allows the directives to communicate with each other and augment * each other's behavior. The controller is injectable (and supports bracket notation) with the following locals: * * * `$scope` - Current scope associated with the element * * `$element` - Current element * * `$attrs` - Current attributes object for the element * * `$transclude` - A transclude linking function pre-bound to the correct transclusion scope: * `function([scope], cloneLinkingFn, futureParentElement)`. * * `scope`: optional argument to override the scope. * * `cloneLinkingFn`: optional argument to create clones of the original transcluded content. * * `futureParentElement`: * * defines the parent to which the `cloneLinkingFn` will add the cloned elements. * * default: `$element.parent()` resp. `$element` for `transclude:'element'` resp. `transclude:true`. * * only needed for transcludes that are allowed to contain non html elements (e.g. SVG elements) * and when the `cloneLinkinFn` is passed, * as those elements need to created and cloned in a special way when they are defined outside their * usual containers (e.g. like `<svg>`). * * See also the `directive.templateNamespace` property. * * * #### `require` * Require another directive and inject its controller as the fourth argument to the linking function. The * `require` takes a string name (or array of strings) of the directive(s) to pass in. If an array is used, the * injected argument will be an array in corresponding order. If no such directive can be * found, or if the directive does not have a controller, then an error is raised. The name can be prefixed with: * * * (no prefix) - Locate the required controller on the current element. Throw an error if not found. * * `?` - Attempt to locate the required controller or pass `null` to the `link` fn if not found. * * `^` - Locate the required controller by searching the element and its parents. Throw an error if not found. * * `^^` - Locate the required controller by searching the element's parents. Throw an error if not found. * * `?^` - Attempt to locate the required controller by searching the element and its parents or pass * `null` to the `link` fn if not found. * * `?^^` - Attempt to locate the required controller by searching the element's parents, or pass * `null` to the `link` fn if not found. * * * #### `controllerAs` * Controller alias at the directive scope. An alias for the controller so it * can be referenced at the directive template. The directive needs to define a scope for this * configuration to be used. Useful in the case when directive is used as component. * * * #### `restrict` * String of subset of `EACM` which restricts the directive to a specific directive * declaration style. If omitted, the defaults (elements and attributes) are used. * * * `E` - Element name (default): `<my-directive></my-directive>` * * `A` - Attribute (default): `<div my-directive="exp"></div>` * * `C` - Class: `<div class="my-directive: exp;"></div>` * * `M` - Comment: `<!-- directive: my-directive exp -->` * * * #### `templateNamespace` * String representing the document type used by the markup in the template. * AngularJS needs this information as those elements need to be created and cloned * in a special way when they are defined outside their usual containers like `<svg>` and `<math>`. * * * `html` - All root nodes in the template are HTML. Root nodes may also be * top-level elements such as `<svg>` or `<math>`. * * `svg` - The root nodes in the template are SVG elements (excluding `<math>`). * * `math` - The root nodes in the template are MathML elements (excluding `<svg>`). * * If no `templateNamespace` is specified, then the namespace is considered to be `html`. * * #### `template` * HTML markup that may: * * Replace the contents of the directive's element (default). * * Replace the directive's element itself (if `replace` is true - DEPRECATED). * * Wrap the contents of the directive's element (if `transclude` is true). * * Value may be: * * * A string. For example `<div red-on-hover>{{delete_str}}</div>`. * * A function which takes two arguments `tElement` and `tAttrs` (described in the `compile` * function api below) and returns a string value. * * * #### `templateUrl` * This is similar to `template` but the template is loaded from the specified URL, asynchronously. * * Because template loading is asynchronous the compiler will suspend compilation of directives on that element * for later when the template has been resolved. In the meantime it will continue to compile and link * sibling and parent elements as though this element had not contained any directives. * * The compiler does not suspend the entire compilation to wait for templates to be loaded because this * would result in the whole app "stalling" until all templates are loaded asynchronously - even in the * case when only one deeply nested directive has `templateUrl`. * * Template loading is asynchronous even if the template has been preloaded into the {@link $templateCache} * * You can specify `templateUrl` as a string representing the URL or as a function which takes two * arguments `tElement` and `tAttrs` (described in the `compile` function api below) and returns * a string value representing the url. In either case, the template URL is passed through {@link * $sce#getTrustedResourceUrl $sce.getTrustedResourceUrl}. * * * #### `replace` ([*DEPRECATED*!], will be removed in next major release - i.e. v2.0) * specify what the template should replace. Defaults to `false`. * * * `true` - the template will replace the directive's element. * * `false` - the template will replace the contents of the directive's element. * * The replacement process migrates all of the attributes / classes from the old element to the new * one. See the {@link guide/directive#template-expanding-directive * Directives Guide} for an example. * * There are very few scenarios where element replacement is required for the application function, * the main one being reusable custom components that are used within SVG contexts * (because SVG doesn't work with custom elements in the DOM tree). * * #### `transclude` * Extract the contents of the element where the directive appears and make it available to the directive. * The contents are compiled and provided to the directive as a **transclusion function**. See the * {@link $compile#transclusion Transclusion} section below. * * There are two kinds of transclusion depending upon whether you want to transclude just the contents of the * directive's element or the entire element: * * * `true` - transclude the content (i.e. the child nodes) of the directive's element. * * `'element'` - transclude the whole of the directive's element including any directives on this * element that defined at a lower priority than this directive. When used, the `template` * property is ignored. * * * #### `compile` * * ```js * function compile(tElement, tAttrs, transclude) { ... } * ``` * * The compile function deals with transforming the template DOM. Since most directives do not do * template transformation, it is not used often. The compile function takes the following arguments: * * * `tElement` - template element - The element where the directive has been declared. It is * safe to do template transformation on the element and child elements only. * * * `tAttrs` - template attributes - Normalized list of attributes declared on this element shared * between all directive compile functions. * * * `transclude` - [*DEPRECATED*!] A transclude linking function: `function(scope, cloneLinkingFn)` * * <div class="alert alert-warning"> * **Note:** The template instance and the link instance may be different objects if the template has * been cloned. For this reason it is **not** safe to do anything other than DOM transformations that * apply to all cloned DOM nodes within the compile function. Specifically, DOM listener registration * should be done in a linking function rather than in a compile function. * </div> * <div class="alert alert-warning"> * **Note:** The compile function cannot handle directives that recursively use themselves in their * own templates or compile functions. Compiling these directives results in an infinite loop and a * stack overflow errors. * * This can be avoided by manually using $compile in the postLink function to imperatively compile * a directive's template instead of relying on automatic template compilation via `template` or * `templateUrl` declaration or manual compilation inside the compile function. * </div> * * <div class="alert alert-error"> * **Note:** The `transclude` function that is passed to the compile function is deprecated, as it * e.g. does not know about the right outer scope. Please use the transclude function that is passed * to the link function instead. * </div> * A compile function can have a return value which can be either a function or an object. * * * returning a (post-link) function - is equivalent to registering the linking function via the * `link` property of the config object when the compile function is empty. * * * returning an object with function(s) registered via `pre` and `post` properties - allows you to * control when a linking function should be called during the linking phase. See info about * pre-linking and post-linking functions below. * * * #### `link` * This property is used only if the `compile` property is not defined. * * ```js * function link(scope, iElement, iAttrs, controller, transcludeFn) { ... } * ``` * * The link function is responsible for registering DOM listeners as well as updating the DOM. It is * executed after the template has been cloned. This is where most of the directive logic will be * put. * * * `scope` - {@link ng.$rootScope.Scope Scope} - The scope to be used by the * directive for registering {@link ng.$rootScope.Scope#$watch watches}. * * * `iElement` - instance element - The element where the directive is to be used. It is safe to * manipulate the children of the element only in `postLink` function since the children have * already been linked. * * * `iAttrs` - instance attributes - Normalized list of attributes declared on this element shared * between all directive linking functions. * * * `controller` - a controller instance - A controller instance if at least one directive on the * element defines a controller. The controller is shared among all the directives, which allows * the directives to use the controllers as a communication channel. * * * `transcludeFn` - A transclude linking function pre-bound to the correct transclusion scope. * This is the same as the `$transclude` * parameter of directive controllers, see there for details. * `function([scope], cloneLinkingFn, futureParentElement)`. * * #### Pre-linking function * * Executed before the child elements are linked. Not safe to do DOM transformation since the * compiler linking function will fail to locate the correct elements for linking. * * #### Post-linking function * * Executed after the child elements are linked. * * Note that child elements that contain `templateUrl` directives will not have been compiled * and linked since they are waiting for their template to load asynchronously and their own * compilation and linking has been suspended until that occurs. * * It is safe to do DOM transformation in the post-linking function on elements that are not waiting * for their async templates to be resolved. * * * ### Transclusion * * Transclusion is the process of extracting a collection of DOM element from one part of the DOM and * copying them to another part of the DOM, while maintaining their connection to the original AngularJS * scope from where they were taken. * * Transclusion is used (often with {@link ngTransclude}) to insert the * original contents of a directive's element into a specified place in the template of the directive. * The benefit of transclusion, over simply moving the DOM elements manually, is that the transcluded * content has access to the properties on the scope from which it was taken, even if the directive * has isolated scope. * See the {@link guide/directive#creating-a-directive-that-wraps-other-elements Directives Guide}. * * This makes it possible for the widget to have private state for its template, while the transcluded * content has access to its originating scope. * * <div class="alert alert-warning"> * **Note:** When testing an element transclude directive you must not place the directive at the root of the * DOM fragment that is being compiled. See {@link guide/unit-testing#testing-transclusion-directives * Testing Transclusion Directives}. * </div> * * #### Transclusion Functions * * When a directive requests transclusion, the compiler extracts its contents and provides a **transclusion * function** to the directive's `link` function and `controller`. This transclusion function is a special * **linking function** that will return the compiled contents linked to a new transclusion scope. * * <div class="alert alert-info"> * If you are just using {@link ngTransclude} then you don't need to worry about this function, since * ngTransclude will deal with it for us. * </div> * * If you want to manually control the insertion and removal of the transcluded content in your directive * then you must use this transclude function. When you call a transclude function it returns a a jqLite/JQuery * object that contains the compiled DOM, which is linked to the correct transclusion scope. * * When you call a transclusion function you can pass in a **clone attach function**. This function accepts * two parameters, `function(clone, scope) { ... }`, where the `clone` is a fresh compiled copy of your transcluded * content and the `scope` is the newly created transclusion scope, to which the clone is bound. * * <div class="alert alert-info"> * **Best Practice**: Always provide a `cloneFn` (clone attach function) when you call a translude function * since you then get a fresh clone of the original DOM and also have access to the new transclusion scope. * </div> * * It is normal practice to attach your transcluded content (`clone`) to the DOM inside your **clone * attach function**: * * ```js * var transcludedContent, transclusionScope; * * $transclude(function(clone, scope) { * element.append(clone); * transcludedContent = clone; * transclusionScope = scope; * }); * ``` * * Later, if you want to remove the transcluded content from your DOM then you should also destroy the * associated transclusion scope: * * ```js * transcludedContent.remove(); * transclusionScope.$destroy(); * ``` * * <div class="alert alert-info"> * **Best Practice**: if you intend to add and remove transcluded content manually in your directive * (by calling the transclude function to get the DOM and and calling `element.remove()` to remove it), * then you are also responsible for calling `$destroy` on the transclusion scope. * </div> * * The built-in DOM manipulation directives, such as {@link ngIf}, {@link ngSwitch} and {@link ngRepeat} * automatically destroy their transluded clones as necessary so you do not need to worry about this if * you are simply using {@link ngTransclude} to inject the transclusion into your directive. * * * #### Transclusion Scopes * * When you call a transclude function it returns a DOM fragment that is pre-bound to a **transclusion * scope**. This scope is special, in that it is a child of the directive's scope (and so gets destroyed * when the directive's scope gets destroyed) but it inherits the properties of the scope from which it * was taken. * * For example consider a directive that uses transclusion and isolated scope. The DOM hierarchy might look * like this: * * ```html * <div ng-app> * <div isolate> * <div transclusion> * </div> * </div> * </div> * ``` * * The `$parent` scope hierarchy will look like this: * * ``` * - $rootScope * - isolate * - transclusion * ``` * * but the scopes will inherit prototypically from different scopes to their `$parent`. * * ``` * - $rootScope * - transclusion * - isolate * ``` * * * ### Attributes * * The {@link ng.$compile.directive.Attributes Attributes} object - passed as a parameter in the * `link()` or `compile()` functions. It has a variety of uses. * * accessing *Normalized attribute names:* * Directives like 'ngBind' can be expressed in many ways: 'ng:bind', `data-ng-bind`, or 'x-ng-bind'. * the attributes object allows for normalized access to * the attributes. * * * *Directive inter-communication:* All directives share the same instance of the attributes * object which allows the directives to use the attributes object as inter directive * communication. * * * *Supports interpolation:* Interpolation attributes are assigned to the attribute object * allowing other directives to read the interpolated value. * * * *Observing interpolated attributes:* Use `$observe` to observe the value changes of attributes * that contain interpolation (e.g. `src="{{bar}}"`). Not only is this very efficient but it's also * the only way to easily get the actual value because during the linking phase the interpolation * hasn't been evaluated yet and so the value is at this time set to `undefined`. * * ```js * function linkingFn(scope, elm, attrs, ctrl) { * // get the attribute value * console.log(attrs.ngModel); * * // change the attribute * attrs.$set('ngModel', 'new value'); * * // observe changes to interpolated attribute * attrs.$observe('ngModel', function(value) { * console.log('ngModel has changed value to ' + value); * }); * } * ``` * * ## Example * * <div class="alert alert-warning"> * **Note**: Typically directives are registered with `module.directive`. The example below is * to illustrate how `$compile` works. * </div> * <example module="compileExample"> <file name="index.html"> <script> angular.module('compileExample', [], function($compileProvider) { // configure new 'compile' directive by passing a directive // factory function. The factory function injects the '$compile' $compileProvider.directive('compile', function($compile) { // directive factory creates a link function return function(scope, element, attrs) { scope.$watch( function(scope) { // watch the 'compile' expression for changes return scope.$eval(attrs.compile); }, function(value) { // when the 'compile' expression changes // assign it into the current DOM element.html(value); // compile the new DOM and link it to the current // scope. // NOTE: we only compile .childNodes so that // we don't get into infinite loop compiling ourselves $compile(element.contents())(scope); } ); }; }); }) .controller('GreeterController', ['$scope', function($scope) { $scope.name = 'Angular'; $scope.html = 'Hello {{name}}'; }]); </script> <div ng-controller="GreeterController"> <input ng-model="name"> <br> <textarea ng-model="html"></textarea> <br> <div compile="html"></div> </div> </file> <file name="protractor.js" type="protractor"> it('should auto compile', function() { var textarea = $('textarea'); var output = $('div[compile]'); // The initial state reads 'Hello Angular'. expect(output.getText()).toBe('Hello Angular'); textarea.clear(); textarea.sendKeys('{{name}}!'); expect(output.getText()).toBe('Angular!'); }); </file> </example> * * * @param {string|DOMElement} element Element or HTML string to compile into a template function. * @param {function(angular.Scope, cloneAttachFn=)} transclude function available to directives - DEPRECATED. * * <div class="alert alert-error"> * **Note:** Passing a `transclude` function to the $compile function is deprecated, as it * e.g. will not use the right outer scope. Please pass the transclude function as a * `parentBoundTranscludeFn` to the link function instead. * </div> * * @param {number} maxPriority only apply directives lower than given priority (Only effects the * root element(s), not their children) * @returns {function(scope, cloneAttachFn=, options=)} a link function which is used to bind template * (a DOM element/tree) to a scope. Where: * * * `scope` - A {@link ng.$rootScope.Scope Scope} to bind to. * * `cloneAttachFn` - If `cloneAttachFn` is provided, then the link function will clone the * `template` and call the `cloneAttachFn` function allowing the caller to attach the * cloned elements to the DOM document at the appropriate place. The `cloneAttachFn` is * called as: <br> `cloneAttachFn(clonedElement, scope)` where: * * * `clonedElement` - is a clone of the original `element` passed into the compiler. * * `scope` - is the current scope with which the linking function is working with. * * * `options` - An optional object hash with linking options. If `options` is provided, then the following * keys may be used to control linking behavior: * * * `parentBoundTranscludeFn` - the transclude function made available to * directives; if given, it will be passed through to the link functions of * directives found in `element` during compilation. * * `transcludeControllers` - an object hash with keys that map controller names * to controller instances; if given, it will make the controllers * available to directives. * * `futureParentElement` - defines the parent to which the `cloneAttachFn` will add * the cloned elements; only needed for transcludes that are allowed to contain non html * elements (e.g. SVG elements). See also the directive.controller property. * * Calling the linking function returns the element of the template. It is either the original * element passed in, or the clone of the element if the `cloneAttachFn` is provided. * * After linking the view is not updated until after a call to $digest which typically is done by * Angular automatically. * * If you need access to the bound view, there are two ways to do it: * * - If you are not asking the linking function to clone the template, create the DOM element(s) * before you send them to the compiler and keep this reference around. * ```js * var element = $compile('<p>{{total}}</p>')(scope); * ``` * * - if on the other hand, you need the element to be cloned, the view reference from the original * example would not point to the clone, but rather to the original template that was cloned. In * this case, you can access the clone via the cloneAttachFn: * ```js * var templateElement = angular.element('<p>{{total}}</p>'), * scope = ....; * * var clonedElement = $compile(templateElement)(scope, function(clonedElement, scope) { * //attach the clone to DOM document at the right place * }); * * //now we have reference to the cloned DOM via `clonedElement` * ``` * * * For information on how the compiler works, see the * {@link guide/compiler Angular HTML Compiler} section of the Developer Guide. */ var $compileMinErr = minErr('$compile'); /** * @ngdoc provider * @name $compileProvider * * @description */ $CompileProvider.$inject = ['$provide', '$$sanitizeUriProvider']; function $CompileProvider($provide, $$sanitizeUriProvider) { var hasDirectives = {}, Suffix = 'Directive', COMMENT_DIRECTIVE_REGEXP = /^\s*directive\:\s*([\w\-]+)\s+(.*)$/, CLASS_DIRECTIVE_REGEXP = /(([\w\-]+)(?:\:([^;]+))?;?)/, ALL_OR_NOTHING_ATTRS = makeMap('ngSrc,ngSrcset,src,srcset'), REQUIRE_PREFIX_REGEXP = /^(?:(\^\^?)?(\?)?(\^\^?)?)?/; // Ref: http://developers.whatwg.org/webappapis.html#event-handler-idl-attributes // The assumption is that future DOM event attribute names will begin with // 'on' and be composed of only English letters. var EVENT_HANDLER_ATTR_REGEXP = /^(on[a-z]+|formaction)$/; function parseIsolateBindings(scope, directiveName) { var LOCAL_REGEXP = /^\s*([@&]|=(\*?))(\??)\s*(\w*)\s*$/; var bindings = {}; forEach(scope, function(definition, scopeName) { var match = definition.match(LOCAL_REGEXP); if (!match) { throw $compileMinErr('iscp', "Invalid isolate scope definition for directive '{0}'." + " Definition: {... {1}: '{2}' ...}", directiveName, scopeName, definition); } bindings[scopeName] = { mode: match[1][0], collection: match[2] === '*', optional: match[3] === '?', attrName: match[4] || scopeName }; }); return bindings; } /** * @ngdoc method * @name $compileProvider#directive * @kind function * * @description * Register a new directive with the compiler. * * @param {string|Object} name Name of the directive in camel-case (i.e. <code>ngBind</code> which * will match as <code>ng-bind</code>), or an object map of directives where the keys are the * names and the values are the factories. * @param {Function|Array} directiveFactory An injectable directive factory function. See * {@link guide/directive} for more info. * @returns {ng.$compileProvider} Self for chaining. */ this.directive = function registerDirective(name, directiveFactory) { assertNotHasOwnProperty(name, 'directive'); if (isString(name)) { assertArg(directiveFactory, 'directiveFactory'); if (!hasDirectives.hasOwnProperty(name)) { hasDirectives[name] = []; $provide.factory(name + Suffix, ['$injector', '$exceptionHandler', function($injector, $exceptionHandler) { var directives = []; forEach(hasDirectives[name], function(directiveFactory, index) { try { var directive = $injector.invoke(directiveFactory); if (isFunction(directive)) { directive = { compile: valueFn(directive) }; } else if (!directive.compile && directive.link) { directive.compile = valueFn(directive.link); } directive.priority = directive.priority || 0; directive.index = index; directive.name = directive.name || name; directive.require = directive.require || (directive.controller && directive.name); directive.restrict = directive.restrict || 'EA'; if (isObject(directive.scope)) { directive.$$isolateBindings = parseIsolateBindings(directive.scope, directive.name); } directives.push(directive); } catch (e) { $exceptionHandler(e); } }); return directives; }]); } hasDirectives[name].push(directiveFactory); } else { forEach(name, reverseParams(registerDirective)); } return this; }; /** * @ngdoc method * @name $compileProvider#aHrefSanitizationWhitelist * @kind function * * @description * Retrieves or overrides the default regular expression that is used for whitelisting of safe * urls during a[href] sanitization. * * The sanitization is a security measure aimed at preventing XSS attacks via html links. * * Any url about to be assigned to a[href] via data-binding is first normalized and turned into * an absolute url. Afterwards, the url is matched against the `aHrefSanitizationWhitelist` * regular expression. If a match is found, the original url is written into the dom. Otherwise, * the absolute url is prefixed with `'unsafe:'` string and only then is it written into the DOM. * * @param {RegExp=} regexp New regexp to whitelist urls with. * @returns {RegExp|ng.$compileProvider} Current RegExp if called without value or self for * chaining otherwise. */ this.aHrefSanitizationWhitelist = function(regexp) { if (isDefined(regexp)) { $$sanitizeUriProvider.aHrefSanitizationWhitelist(regexp); return this; } else { return $$sanitizeUriProvider.aHrefSanitizationWhitelist(); } }; /** * @ngdoc method * @name $compileProvider#imgSrcSanitizationWhitelist * @kind function * * @description * Retrieves or overrides the default regular expression that is used for whitelisting of safe * urls during img[src] sanitization. * * The sanitization is a security measure aimed at prevent XSS attacks via html links. * * Any url about to be assigned to img[src] via data-binding is first normalized and turned into * an absolute url. Afterwards, the url is matched against the `imgSrcSanitizationWhitelist` * regular expression. If a match is found, the original url is written into the dom. Otherwise, * the absolute url is prefixed with `'unsafe:'` string and only then is it written into the DOM. * * @param {RegExp=} regexp New regexp to whitelist urls with. * @returns {RegExp|ng.$compileProvider} Current RegExp if called without value or self for * chaining otherwise. */ this.imgSrcSanitizationWhitelist = function(regexp) { if (isDefined(regexp)) { $$sanitizeUriProvider.imgSrcSanitizationWhitelist(regexp); return this; } else { return $$sanitizeUriProvider.imgSrcSanitizationWhitelist(); } }; /** * @ngdoc method * @name $compileProvider#debugInfoEnabled * * @param {boolean=} enabled update the debugInfoEnabled state if provided, otherwise just return the * current debugInfoEnabled state * @returns {*} current value if used as getter or itself (chaining) if used as setter * * @kind function * * @description * Call this method to enable/disable various debug runtime information in the compiler such as adding * binding information and a reference to the current scope on to DOM elements. * If enabled, the compiler will add the following to DOM elements that have been bound to the scope * * `ng-binding` CSS class * * `$binding` data property containing an array of the binding expressions * * You may want to disable this in production for a significant performance boost. See * {@link guide/production#disabling-debug-data Disabling Debug Data} for more. * * The default value is true. */ var debugInfoEnabled = true; this.debugInfoEnabled = function(enabled) { if (isDefined(enabled)) { debugInfoEnabled = enabled; return this; } return debugInfoEnabled; }; this.$get = [ '$injector', '$interpolate', '$exceptionHandler', '$templateRequest', '$parse', '$controller', '$rootScope', '$document', '$sce', '$animate', '$$sanitizeUri', function($injector, $interpolate, $exceptionHandler, $templateRequest, $parse, $controller, $rootScope, $document, $sce, $animate, $$sanitizeUri) { var Attributes = function(element, attributesToCopy) { if (attributesToCopy) { var keys = Object.keys(attributesToCopy); var i, l, key; for (i = 0, l = keys.length; i < l; i++) { key = keys[i]; this[key] = attributesToCopy[key]; } } else { this.$attr = {}; } this.$$element = element; }; Attributes.prototype = { /** * @ngdoc method * @name $compile.directive.Attributes#$normalize * @kind function * * @description * Converts an attribute name (e.g. dash/colon/underscore-delimited string, optionally prefixed with `x-` or * `data-`) to its normalized, camelCase form. * * Also there is special case for Moz prefix starting with upper case letter. * * For further information check out the guide on {@link guide/directive#matching-directives Matching Directives} * * @param {string} name Name to normalize */ $normalize: directiveNormalize, /** * @ngdoc method * @name $compile.directive.Attributes#$addClass * @kind function * * @description * Adds the CSS class value specified by the classVal parameter to the element. If animations * are enabled then an animation will be triggered for the class addition. * * @param {string} classVal The className value that will be added to the element */ $addClass: function(classVal) { if (classVal && classVal.length > 0) { $animate.addClass(this.$$element, classVal); } }, /** * @ngdoc method * @name $compile.directive.Attributes#$removeClass * @kind function * * @description * Removes the CSS class value specified by the classVal parameter from the element. If * animations are enabled then an animation will be triggered for the class removal. * * @param {string} classVal The className value that will be removed from the element */ $removeClass: function(classVal) { if (classVal && classVal.length > 0) { $animate.removeClass(this.$$element, classVal); } }, /** * @ngdoc method * @name $compile.directive.Attributes#$updateClass * @kind function * * @description * Adds and removes the appropriate CSS class values to the element based on the difference * between the new and old CSS class values (specified as newClasses and oldClasses). * * @param {string} newClasses The current CSS className value * @param {string} oldClasses The former CSS className value */ $updateClass: function(newClasses, oldClasses) { var toAdd = tokenDifference(newClasses, oldClasses); if (toAdd && toAdd.length) { $animate.addClass(this.$$element, toAdd); } var toRemove = tokenDifference(oldClasses, newClasses); if (toRemove && toRemove.length) { $animate.removeClass(this.$$element, toRemove); } }, /** * Set a normalized attribute on the element in a way such that all directives * can share the attribute. This function properly handles boolean attributes. * @param {string} key Normalized key. (ie ngAttribute) * @param {string|boolean} value The value to set. If `null` attribute will be deleted. * @param {boolean=} writeAttr If false, does not write the value to DOM element attribute. * Defaults to true. * @param {string=} attrName Optional none normalized name. Defaults to key. */ $set: function(key, value, writeAttr, attrName) { // TODO: decide whether or not to throw an error if "class" //is set through this function since it may cause $updateClass to //become unstable. var node = this.$$element[0], booleanKey = getBooleanAttrName(node, key), aliasedKey = getAliasedAttrName(node, key), observer = key, nodeName; if (booleanKey) { this.$$element.prop(key, value); attrName = booleanKey; } else if (aliasedKey) { this[aliasedKey] = value; observer = aliasedKey; } this[key] = value; // translate normalized key to actual key if (attrName) { this.$attr[key] = attrName; } else { attrName = this.$attr[key]; if (!attrName) { this.$attr[key] = attrName = snake_case(key, '-'); } } nodeName = nodeName_(this.$$element); if ((nodeName === 'a' && key === 'href') || (nodeName === 'img' && key === 'src')) { // sanitize a[href] and img[src] values this[key] = value = $$sanitizeUri(value, key === 'src'); } else if (nodeName === 'img' && key === 'srcset') { // sanitize img[srcset] values var result = ""; // first check if there are spaces because it's not the same pattern var trimmedSrcset = trim(value); // ( 999x ,| 999w ,| ,|, ) var srcPattern = /(\s+\d+x\s*,|\s+\d+w\s*,|\s+,|,\s+)/; var pattern = /\s/.test(trimmedSrcset) ? srcPattern : /(,)/; // split srcset into tuple of uri and descriptor except for the last item var rawUris = trimmedSrcset.split(pattern); // for each tuples var nbrUrisWith2parts = Math.floor(rawUris.length / 2); for (var i = 0; i < nbrUrisWith2parts; i++) { var innerIdx = i * 2; // sanitize the uri result += $$sanitizeUri(trim(rawUris[innerIdx]), true); // add the descriptor result += (" " + trim(rawUris[innerIdx + 1])); } // split the last item into uri and descriptor var lastTuple = trim(rawUris[i * 2]).split(/\s/); // sanitize the last uri result += $$sanitizeUri(trim(lastTuple[0]), true); // and add the last descriptor if any if (lastTuple.length === 2) { result += (" " + trim(lastTuple[1])); } this[key] = value = result; } if (writeAttr !== false) { if (value === null || value === undefined) { this.$$element.removeAttr(attrName); } else { this.$$element.attr(attrName, value); } } // fire observers var $$observers = this.$$observers; $$observers && forEach($$observers[observer], function(fn) { try { fn(value); } catch (e) { $exceptionHandler(e); } }); }, /** * @ngdoc method * @name $compile.directive.Attributes#$observe * @kind function * * @description * Observes an interpolated attribute. * * The observer function will be invoked once during the next `$digest` following * compilation. The observer is then invoked whenever the interpolated value * changes. * * @param {string} key Normalized key. (ie ngAttribute) . * @param {function(interpolatedValue)} fn Function that will be called whenever the interpolated value of the attribute changes. * See the {@link guide/directive#text-and-attribute-bindings Directives} guide for more info. * @returns {function()} Returns a deregistration function for this observer. */ $observe: function(key, fn) { var attrs = this, $$observers = (attrs.$$observers || (attrs.$$observers = createMap())), listeners = ($$observers[key] || ($$observers[key] = [])); listeners.push(fn); $rootScope.$evalAsync(function() { if (!listeners.$$inter && attrs.hasOwnProperty(key)) { // no one registered attribute interpolation function, so lets call it manually fn(attrs[key]); } }); return function() { arrayRemove(listeners, fn); }; } }; function safeAddClass($element, className) { try { $element.addClass(className); } catch (e) { // ignore, since it means that we are trying to set class on // SVG element, where class name is read-only. } } var startSymbol = $interpolate.startSymbol(), endSymbol = $interpolate.endSymbol(), denormalizeTemplate = (startSymbol == '{{' || endSymbol == '}}') ? identity : function denormalizeTemplate(template) { return template.replace(/\{\{/g, startSymbol).replace(/}}/g, endSymbol); }, NG_ATTR_BINDING = /^ngAttr[A-Z]/; compile.$$addBindingInfo = debugInfoEnabled ? function $$addBindingInfo($element, binding) { var bindings = $element.data('$binding') || []; if (isArray(binding)) { bindings = bindings.concat(binding); } else { bindings.push(binding); } $element.data('$binding', bindings); } : noop; compile.$$addBindingClass = debugInfoEnabled ? function $$addBindingClass($element) { safeAddClass($element, 'ng-binding'); } : noop; compile.$$addScopeInfo = debugInfoEnabled ? function $$addScopeInfo($element, scope, isolated, noTemplate) { var dataName = isolated ? (noTemplate ? '$isolateScopeNoTemplate' : '$isolateScope') : '$scope'; $element.data(dataName, scope); } : noop; compile.$$addScopeClass = debugInfoEnabled ? function $$addScopeClass($element, isolated) { safeAddClass($element, isolated ? 'ng-isolate-scope' : 'ng-scope'); } : noop; return compile; //================================ function compile($compileNodes, transcludeFn, maxPriority, ignoreDirective, previousCompileContext) { if (!($compileNodes instanceof jqLite)) { // jquery always rewraps, whereas we need to preserve the original selector so that we can // modify it. $compileNodes = jqLite($compileNodes); } // We can not compile top level text elements since text nodes can be merged and we will // not be able to attach scope data to them, so we will wrap them in <span> forEach($compileNodes, function(node, index) { if (node.nodeType == NODE_TYPE_TEXT && node.nodeValue.match(/\S+/) /* non-empty */ ) { $compileNodes[index] = jqLite(node).wrap('<span></span>').parent()[0]; } }); var compositeLinkFn = compileNodes($compileNodes, transcludeFn, $compileNodes, maxPriority, ignoreDirective, previousCompileContext); compile.$$addScopeClass($compileNodes); var namespace = null; return function publicLinkFn(scope, cloneConnectFn, options) { assertArg(scope, 'scope'); options = options || {}; var parentBoundTranscludeFn = options.parentBoundTranscludeFn, transcludeControllers = options.transcludeControllers, futureParentElement = options.futureParentElement; // When `parentBoundTranscludeFn` is passed, it is a // `controllersBoundTransclude` function (it was previously passed // as `transclude` to directive.link) so we must unwrap it to get // its `boundTranscludeFn` if (parentBoundTranscludeFn && parentBoundTranscludeFn.$$boundTransclude) { parentBoundTranscludeFn = parentBoundTranscludeFn.$$boundTransclude; } if (!namespace) { namespace = detectNamespaceForChildElements(futureParentElement); } var $linkNode; if (namespace !== 'html') { // When using a directive with replace:true and templateUrl the $compileNodes // (or a child element inside of them) // might change, so we need to recreate the namespace adapted compileNodes // for call to the link function. // Note: This will already clone the nodes... $linkNode = jqLite( wrapTemplate(namespace, jqLite('<div>').append($compileNodes).html()) ); } else if (cloneConnectFn) { // important!!: we must call our jqLite.clone() since the jQuery one is trying to be smart // and sometimes changes the structure of the DOM. $linkNode = JQLitePrototype.clone.call($compileNodes); } else { $linkNode = $compileNodes; } if (transcludeControllers) { for (var controllerName in transcludeControllers) { $linkNode.data('$' + controllerName + 'Controller', transcludeControllers[controllerName].instance); } } compile.$$addScopeInfo($linkNode, scope); if (cloneConnectFn) cloneConnectFn($linkNode, scope); if (compositeLinkFn) compositeLinkFn(scope, $linkNode, $linkNode, parentBoundTranscludeFn); return $linkNode; }; } function detectNamespaceForChildElements(parentElement) { // TODO: Make this detect MathML as well... var node = parentElement && parentElement[0]; if (!node) { return 'html'; } else { return nodeName_(node) !== 'foreignobject' && node.toString().match(/SVG/) ? 'svg' : 'html'; } } /** * Compile function matches each node in nodeList against the directives. Once all directives * for a particular node are collected their compile functions are executed. The compile * functions return values - the linking functions - are combined into a composite linking * function, which is the a linking function for the node. * * @param {NodeList} nodeList an array of nodes or NodeList to compile * @param {function(angular.Scope, cloneAttachFn=)} transcludeFn A linking function, where the * scope argument is auto-generated to the new child of the transcluded parent scope. * @param {DOMElement=} $rootElement If the nodeList is the root of the compilation tree then * the rootElement must be set the jqLite collection of the compile root. This is * needed so that the jqLite collection items can be replaced with widgets. * @param {number=} maxPriority Max directive priority. * @returns {Function} A composite linking function of all of the matched directives or null. */ function compileNodes(nodeList, transcludeFn, $rootElement, maxPriority, ignoreDirective, previousCompileContext) { var linkFns = [], attrs, directives, nodeLinkFn, childNodes, childLinkFn, linkFnFound, nodeLinkFnFound; for (var i = 0; i < nodeList.length; i++) { attrs = new Attributes(); // we must always refer to nodeList[i] since the nodes can be replaced underneath us. directives = collectDirectives(nodeList[i], [], attrs, i === 0 ? maxPriority : undefined, ignoreDirective); nodeLinkFn = (directives.length) ? applyDirectivesToNode(directives, nodeList[i], attrs, transcludeFn, $rootElement, null, [], [], previousCompileContext) : null; if (nodeLinkFn && nodeLinkFn.scope) { compile.$$addScopeClass(attrs.$$element); } childLinkFn = (nodeLinkFn && nodeLinkFn.terminal || !(childNodes = nodeList[i].childNodes) || !childNodes.length) ? null : compileNodes(childNodes, nodeLinkFn ? ( (nodeLinkFn.transcludeOnThisElement || !nodeLinkFn.templateOnThisElement) && nodeLinkFn.transclude) : transcludeFn); if (nodeLinkFn || childLinkFn) { linkFns.push(i, nodeLinkFn, childLinkFn); linkFnFound = true; nodeLinkFnFound = nodeLinkFnFound || nodeLinkFn; } //use the previous context only for the first element in the virtual group previousCompileContext = null; } // return a linking function if we have found anything, null otherwise return linkFnFound ? compositeLinkFn : null; function compositeLinkFn(scope, nodeList, $rootElement, parentBoundTranscludeFn) { var nodeLinkFn, childLinkFn, node, childScope, i, ii, idx, childBoundTranscludeFn; var stableNodeList; if (nodeLinkFnFound) { // copy nodeList so that if a nodeLinkFn removes or adds an element at this DOM level our // offsets don't get screwed up var nodeListLength = nodeList.length; stableNodeList = new Array(nodeListLength); // create a sparse array by only copying the elements which have a linkFn for (i = 0; i < linkFns.length; i+=3) { idx = linkFns[i]; stableNodeList[idx] = nodeList[idx]; } } else { stableNodeList = nodeList; } for (i = 0, ii = linkFns.length; i < ii;) { node = stableNodeList[linkFns[i++]]; nodeLinkFn = linkFns[i++]; childLinkFn = linkFns[i++]; if (nodeLinkFn) { if (nodeLinkFn.scope) { childScope = scope.$new(); compile.$$addScopeInfo(jqLite(node), childScope); } else { childScope = scope; } if (nodeLinkFn.transcludeOnThisElement) { childBoundTranscludeFn = createBoundTranscludeFn( scope, nodeLinkFn.transclude, parentBoundTranscludeFn, nodeLinkFn.elementTranscludeOnThisElement); } else if (!nodeLinkFn.templateOnThisElement && parentBoundTranscludeFn) { childBoundTranscludeFn = parentBoundTranscludeFn; } else if (!parentBoundTranscludeFn && transcludeFn) { childBoundTranscludeFn = createBoundTranscludeFn(scope, transcludeFn); } else { childBoundTranscludeFn = null; } nodeLinkFn(childLinkFn, childScope, node, $rootElement, childBoundTranscludeFn); } else if (childLinkFn) { childLinkFn(scope, node.childNodes, undefined, parentBoundTranscludeFn); } } } } function createBoundTranscludeFn(scope, transcludeFn, previousBoundTranscludeFn, elementTransclusion) { var boundTranscludeFn = function(transcludedScope, cloneFn, controllers, futureParentElement, containingScope) { if (!transcludedScope) { transcludedScope = scope.$new(false, containingScope); transcludedScope.$$transcluded = true; } return transcludeFn(transcludedScope, cloneFn, { parentBoundTranscludeFn: previousBoundTranscludeFn, transcludeControllers: controllers, futureParentElement: futureParentElement }); }; return boundTranscludeFn; } /** * Looks for directives on the given node and adds them to the directive collection which is * sorted. * * @param node Node to search. * @param directives An array to which the directives are added to. This array is sorted before * the function returns. * @param attrs The shared attrs object which is used to populate the normalized attributes. * @param {number=} maxPriority Max directive priority. */ function collectDirectives(node, directives, attrs, maxPriority, ignoreDirective) { var nodeType = node.nodeType, attrsMap = attrs.$attr, match, className; switch (nodeType) { case NODE_TYPE_ELEMENT: /* Element */ // use the node name: <directive> addDirective(directives, directiveNormalize(nodeName_(node)), 'E', maxPriority, ignoreDirective); // iterate over the attributes for (var attr, name, nName, ngAttrName, value, isNgAttr, nAttrs = node.attributes, j = 0, jj = nAttrs && nAttrs.length; j < jj; j++) { var attrStartName = false; var attrEndName = false; attr = nAttrs[j]; name = attr.name; value = trim(attr.value); // support ngAttr attribute binding ngAttrName = directiveNormalize(name); if (isNgAttr = NG_ATTR_BINDING.test(ngAttrName)) { name = name.replace(PREFIX_REGEXP, '') .substr(8).replace(/_(.)/g, function(match, letter) { return letter.toUpperCase(); }); } var directiveNName = ngAttrName.replace(/(Start|End)$/, ''); if (directiveIsMultiElement(directiveNName)) { if (ngAttrName === directiveNName + 'Start') { attrStartName = name; attrEndName = name.substr(0, name.length - 5) + 'end'; name = name.substr(0, name.length - 6); } } nName = directiveNormalize(name.toLowerCase()); attrsMap[nName] = name; if (isNgAttr || !attrs.hasOwnProperty(nName)) { attrs[nName] = value; if (getBooleanAttrName(node, nName)) { attrs[nName] = true; // presence means true } } addAttrInterpolateDirective(node, directives, value, nName, isNgAttr); addDirective(directives, nName, 'A', maxPriority, ignoreDirective, attrStartName, attrEndName); } // use class as directive className = node.className; if (isObject(className)) { // Maybe SVGAnimatedString className = className.animVal; } if (isString(className) && className !== '') { while (match = CLASS_DIRECTIVE_REGEXP.exec(className)) { nName = directiveNormalize(match[2]); if (addDirective(directives, nName, 'C', maxPriority, ignoreDirective)) { attrs[nName] = trim(match[3]); } className = className.substr(match.index + match[0].length); } } break; case NODE_TYPE_TEXT: /* Text Node */ addTextInterpolateDirective(directives, node.nodeValue); break; case NODE_TYPE_COMMENT: /* Comment */ try { match = COMMENT_DIRECTIVE_REGEXP.exec(node.nodeValue); if (match) { nName = directiveNormalize(match[1]); if (addDirective(directives, nName, 'M', maxPriority, ignoreDirective)) { attrs[nName] = trim(match[2]); } } } catch (e) { // turns out that under some circumstances IE9 throws errors when one attempts to read // comment's node value. // Just ignore it and continue. (Can't seem to reproduce in test case.) } break; } directives.sort(byPriority); return directives; } /** * Given a node with an directive-start it collects all of the siblings until it finds * directive-end. * @param node * @param attrStart * @param attrEnd * @returns {*} */ function groupScan(node, attrStart, attrEnd) { var nodes = []; var depth = 0; if (attrStart && node.hasAttribute && node.hasAttribute(attrStart)) { do { if (!node) { throw $compileMinErr('uterdir', "Unterminated attribute, found '{0}' but no matching '{1}' found.", attrStart, attrEnd); } if (node.nodeType == NODE_TYPE_ELEMENT) { if (node.hasAttribute(attrStart)) depth++; if (node.hasAttribute(attrEnd)) depth--; } nodes.push(node); node = node.nextSibling; } while (depth > 0); } else { nodes.push(node); } return jqLite(nodes); } /** * Wrapper for linking function which converts normal linking function into a grouped * linking function. * @param linkFn * @param attrStart * @param attrEnd * @returns {Function} */ function groupElementsLinkFnWrapper(linkFn, attrStart, attrEnd) { return function(scope, element, attrs, controllers, transcludeFn) { element = groupScan(element[0], attrStart, attrEnd); return linkFn(scope, element, attrs, controllers, transcludeFn); }; } /** * Once the directives have been collected, their compile functions are executed. This method * is responsible for inlining directive templates as well as terminating the application * of the directives if the terminal directive has been reached. * * @param {Array} directives Array of collected directives to execute their compile function. * this needs to be pre-sorted by priority order. * @param {Node} compileNode The raw DOM node to apply the compile functions to * @param {Object} templateAttrs The shared attribute function * @param {function(angular.Scope, cloneAttachFn=)} transcludeFn A linking function, where the * scope argument is auto-generated to the new * child of the transcluded parent scope. * @param {JQLite} jqCollection If we are working on the root of the compile tree then this * argument has the root jqLite array so that we can replace nodes * on it. * @param {Object=} originalReplaceDirective An optional directive that will be ignored when * compiling the transclusion. * @param {Array.<Function>} preLinkFns * @param {Array.<Function>} postLinkFns * @param {Object} previousCompileContext Context used for previous compilation of the current * node * @returns {Function} linkFn */ function applyDirectivesToNode(directives, compileNode, templateAttrs, transcludeFn, jqCollection, originalReplaceDirective, preLinkFns, postLinkFns, previousCompileContext) { previousCompileContext = previousCompileContext || {}; var terminalPriority = -Number.MAX_VALUE, newScopeDirective, controllerDirectives = previousCompileContext.controllerDirectives, controllers, newIsolateScopeDirective = previousCompileContext.newIsolateScopeDirective, templateDirective = previousCompileContext.templateDirective, nonTlbTranscludeDirective = previousCompileContext.nonTlbTranscludeDirective, hasTranscludeDirective = false, hasTemplate = false, hasElementTranscludeDirective = previousCompileContext.hasElementTranscludeDirective, $compileNode = templateAttrs.$$element = jqLite(compileNode), directive, directiveName, $template, replaceDirective = originalReplaceDirective, childTranscludeFn = transcludeFn, linkFn, directiveValue; // executes all directives on the current element for (var i = 0, ii = directives.length; i < ii; i++) { directive = directives[i]; var attrStart = directive.$$start; var attrEnd = directive.$$end; // collect multiblock sections if (attrStart) { $compileNode = groupScan(compileNode, attrStart, attrEnd); } $template = undefined; if (terminalPriority > directive.priority) { break; // prevent further processing of directives } if (directiveValue = directive.scope) { // skip the check for directives with async templates, we'll check the derived sync // directive when the template arrives if (!directive.templateUrl) { if (isObject(directiveValue)) { // This directive is trying to add an isolated scope. // Check that there is no scope of any kind already assertNoDuplicate('new/isolated scope', newIsolateScopeDirective || newScopeDirective, directive, $compileNode); newIsolateScopeDirective = directive; } else { // This directive is trying to add a child scope. // Check that there is no isolated scope already assertNoDuplicate('new/isolated scope', newIsolateScopeDirective, directive, $compileNode); } } newScopeDirective = newScopeDirective || directive; } directiveName = directive.name; if (!directive.templateUrl && directive.controller) { directiveValue = directive.controller; controllerDirectives = controllerDirectives || {}; assertNoDuplicate("'" + directiveName + "' controller", controllerDirectives[directiveName], directive, $compileNode); controllerDirectives[directiveName] = directive; } if (directiveValue = directive.transclude) { hasTranscludeDirective = true; // Special case ngIf and ngRepeat so that we don't complain about duplicate transclusion. // This option should only be used by directives that know how to safely handle element transclusion, // where the transcluded nodes are added or replaced after linking. if (!directive.$$tlb) { assertNoDuplicate('transclusion', nonTlbTranscludeDirective, directive, $compileNode); nonTlbTranscludeDirective = directive; } if (directiveValue == 'element') { hasElementTranscludeDirective = true; terminalPriority = directive.priority; $template = $compileNode; $compileNode = templateAttrs.$$element = jqLite(document.createComment(' ' + directiveName + ': ' + templateAttrs[directiveName] + ' ')); compileNode = $compileNode[0]; replaceWith(jqCollection, sliceArgs($template), compileNode); childTranscludeFn = compile($template, transcludeFn, terminalPriority, replaceDirective && replaceDirective.name, { // Don't pass in: // - controllerDirectives - otherwise we'll create duplicates controllers // - newIsolateScopeDirective or templateDirective - combining templates with // element transclusion doesn't make sense. // // We need only nonTlbTranscludeDirective so that we prevent putting transclusion // on the same element more than once. nonTlbTranscludeDirective: nonTlbTranscludeDirective }); } else { $template = jqLite(jqLiteClone(compileNode)).contents(); $compileNode.empty(); // clear contents childTranscludeFn = compile($template, transcludeFn); } } if (directive.template) { hasTemplate = true; assertNoDuplicate('template', templateDirective, directive, $compileNode); templateDirective = directive; directiveValue = (isFunction(directive.template)) ? directive.template($compileNode, templateAttrs) : directive.template; directiveValue = denormalizeTemplate(directiveValue); if (directive.replace) { replaceDirective = directive; if (jqLiteIsTextNode(directiveValue)) { $template = []; } else { $template = removeComments(wrapTemplate(directive.templateNamespace, trim(directiveValue))); } compileNode = $template[0]; if ($template.length != 1 || compileNode.nodeType !== NODE_TYPE_ELEMENT) { throw $compileMinErr('tplrt', "Template for directive '{0}' must have exactly one root element. {1}", directiveName, ''); } replaceWith(jqCollection, $compileNode, compileNode); var newTemplateAttrs = {$attr: {}}; // combine directives from the original node and from the template: // - take the array of directives for this element // - split it into two parts, those that already applied (processed) and those that weren't (unprocessed) // - collect directives from the template and sort them by priority // - combine directives as: processed + template + unprocessed var templateDirectives = collectDirectives(compileNode, [], newTemplateAttrs); var unprocessedDirectives = directives.splice(i + 1, directives.length - (i + 1)); if (newIsolateScopeDirective) { markDirectivesAsIsolate(templateDirectives); } directives = directives.concat(templateDirectives).concat(unprocessedDirectives); mergeTemplateAttributes(templateAttrs, newTemplateAttrs); ii = directives.length; } else { $compileNode.html(directiveValue); } } if (directive.templateUrl) { hasTemplate = true; assertNoDuplicate('template', templateDirective, directive, $compileNode); templateDirective = directive; if (directive.replace) { replaceDirective = directive; } nodeLinkFn = compileTemplateUrl(directives.splice(i, directives.length - i), $compileNode, templateAttrs, jqCollection, hasTranscludeDirective && childTranscludeFn, preLinkFns, postLinkFns, { controllerDirectives: controllerDirectives, newIsolateScopeDirective: newIsolateScopeDirective, templateDirective: templateDirective, nonTlbTranscludeDirective: nonTlbTranscludeDirective }); ii = directives.length; } else if (directive.compile) { try { linkFn = directive.compile($compileNode, templateAttrs, childTranscludeFn); if (isFunction(linkFn)) { addLinkFns(null, linkFn, attrStart, attrEnd); } else if (linkFn) { addLinkFns(linkFn.pre, linkFn.post, attrStart, attrEnd); } } catch (e) { $exceptionHandler(e, startingTag($compileNode)); } } if (directive.terminal) { nodeLinkFn.terminal = true; terminalPriority = Math.max(terminalPriority, directive.priority); } } nodeLinkFn.scope = newScopeDirective && newScopeDirective.scope === true; nodeLinkFn.transcludeOnThisElement = hasTranscludeDirective; nodeLinkFn.elementTranscludeOnThisElement = hasElementTranscludeDirective; nodeLinkFn.templateOnThisElement = hasTemplate; nodeLinkFn.transclude = childTranscludeFn; previousCompileContext.hasElementTranscludeDirective = hasElementTranscludeDirective; // might be normal or delayed nodeLinkFn depending on if templateUrl is present return nodeLinkFn; //////////////////// function addLinkFns(pre, post, attrStart, attrEnd) { if (pre) { if (attrStart) pre = groupElementsLinkFnWrapper(pre, attrStart, attrEnd); pre.require = directive.require; pre.directiveName = directiveName; if (newIsolateScopeDirective === directive || directive.$$isolateScope) { pre = cloneAndAnnotateFn(pre, {isolateScope: true}); } preLinkFns.push(pre); } if (post) { if (attrStart) post = groupElementsLinkFnWrapper(post, attrStart, attrEnd); post.require = directive.require; post.directiveName = directiveName; if (newIsolateScopeDirective === directive || directive.$$isolateScope) { post = cloneAndAnnotateFn(post, {isolateScope: true}); } postLinkFns.push(post); } } function getControllers(directiveName, require, $element, elementControllers) { var value, retrievalMethod = 'data', optional = false; var $searchElement = $element; var match; if (isString(require)) { match = require.match(REQUIRE_PREFIX_REGEXP); require = require.substring(match[0].length); if (match[3]) { if (match[1]) match[3] = null; else match[1] = match[3]; } if (match[1] === '^') { retrievalMethod = 'inheritedData'; } else if (match[1] === '^^') { retrievalMethod = 'inheritedData'; $searchElement = $element.parent(); } if (match[2] === '?') { optional = true; } value = null; if (elementControllers && retrievalMethod === 'data') { if (value = elementControllers[require]) { value = value.instance; } } value = value || $searchElement[retrievalMethod]('$' + require + 'Controller'); if (!value && !optional) { throw $compileMinErr('ctreq', "Controller '{0}', required by directive '{1}', can't be found!", require, directiveName); } return value || null; } else if (isArray(require)) { value = []; forEach(require, function(require) { value.push(getControllers(directiveName, require, $element, elementControllers)); }); } return value; } function nodeLinkFn(childLinkFn, scope, linkNode, $rootElement, boundTranscludeFn) { var i, ii, linkFn, controller, isolateScope, elementControllers, transcludeFn, $element, attrs; if (compileNode === linkNode) { attrs = templateAttrs; $element = templateAttrs.$$element; } else { $element = jqLite(linkNode); attrs = new Attributes($element, templateAttrs); } if (newIsolateScopeDirective) { isolateScope = scope.$new(true); } if (boundTranscludeFn) { // track `boundTranscludeFn` so it can be unwrapped if `transcludeFn` // is later passed as `parentBoundTranscludeFn` to `publicLinkFn` transcludeFn = controllersBoundTransclude; transcludeFn.$$boundTransclude = boundTranscludeFn; } if (controllerDirectives) { // TODO: merge `controllers` and `elementControllers` into single object. controllers = {}; elementControllers = {}; forEach(controllerDirectives, function(directive) { var locals = { $scope: directive === newIsolateScopeDirective || directive.$$isolateScope ? isolateScope : scope, $element: $element, $attrs: attrs, $transclude: transcludeFn }, controllerInstance; controller = directive.controller; if (controller == '@') { controller = attrs[directive.name]; } controllerInstance = $controller(controller, locals, true, directive.controllerAs); // For directives with element transclusion the element is a comment, // but jQuery .data doesn't support attaching data to comment nodes as it's hard to // clean up (http://bugs.jquery.com/ticket/8335). // Instead, we save the controllers for the element in a local hash and attach to .data // later, once we have the actual element. elementControllers[directive.name] = controllerInstance; if (!hasElementTranscludeDirective) { $element.data('$' + directive.name + 'Controller', controllerInstance.instance); } controllers[directive.name] = controllerInstance; }); } if (newIsolateScopeDirective) { compile.$$addScopeInfo($element, isolateScope, true, !(templateDirective && (templateDirective === newIsolateScopeDirective || templateDirective === newIsolateScopeDirective.$$originalDirective))); compile.$$addScopeClass($element, true); var isolateScopeController = controllers && controllers[newIsolateScopeDirective.name]; var isolateBindingContext = isolateScope; if (isolateScopeController && isolateScopeController.identifier && newIsolateScopeDirective.bindToController === true) { isolateBindingContext = isolateScopeController.instance; } forEach(isolateScope.$$isolateBindings = newIsolateScopeDirective.$$isolateBindings, function(definition, scopeName) { var attrName = definition.attrName, optional = definition.optional, mode = definition.mode, // @, =, or & lastValue, parentGet, parentSet, compare; switch (mode) { case '@': attrs.$observe(attrName, function(value) { isolateBindingContext[scopeName] = value; }); attrs.$$observers[attrName].$$scope = scope; if (attrs[attrName]) { // If the attribute has been provided then we trigger an interpolation to ensure // the value is there for use in the link fn isolateBindingContext[scopeName] = $interpolate(attrs[attrName])(scope); } break; case '=': if (optional && !attrs[attrName]) { return; } parentGet = $parse(attrs[attrName]); if (parentGet.literal) { compare = equals; } else { compare = function(a, b) { return a === b || (a !== a && b !== b); }; } parentSet = parentGet.assign || function() { // reset the change, or we will throw this exception on every $digest lastValue = isolateBindingContext[scopeName] = parentGet(scope); throw $compileMinErr('nonassign', "Expression '{0}' used with directive '{1}' is non-assignable!", attrs[attrName], newIsolateScopeDirective.name); }; lastValue = isolateBindingContext[scopeName] = parentGet(scope); var parentValueWatch = function parentValueWatch(parentValue) { if (!compare(parentValue, isolateBindingContext[scopeName])) { // we are out of sync and need to copy if (!compare(parentValue, lastValue)) { // parent changed and it has precedence isolateBindingContext[scopeName] = parentValue; } else { // if the parent can be assigned then do so parentSet(scope, parentValue = isolateBindingContext[scopeName]); } } return lastValue = parentValue; }; parentValueWatch.$stateful = true; var unwatch; if (definition.collection) { unwatch = scope.$watchCollection(attrs[attrName], parentValueWatch); } else { unwatch = scope.$watch($parse(attrs[attrName], parentValueWatch), null, parentGet.literal); } isolateScope.$on('$destroy', unwatch); break; case '&': parentGet = $parse(attrs[attrName]); isolateBindingContext[scopeName] = function(locals) { return parentGet(scope, locals); }; break; } }); } if (controllers) { forEach(controllers, function(controller) { controller(); }); controllers = null; } // PRELINKING for (i = 0, ii = preLinkFns.length; i < ii; i++) { linkFn = preLinkFns[i]; invokeLinkFn(linkFn, linkFn.isolateScope ? isolateScope : scope, $element, attrs, linkFn.require && getControllers(linkFn.directiveName, linkFn.require, $element, elementControllers), transcludeFn ); } // RECURSION // We only pass the isolate scope, if the isolate directive has a template, // otherwise the child elements do not belong to the isolate directive. var scopeToChild = scope; if (newIsolateScopeDirective && (newIsolateScopeDirective.template || newIsolateScopeDirective.templateUrl === null)) { scopeToChild = isolateScope; } childLinkFn && childLinkFn(scopeToChild, linkNode.childNodes, undefined, boundTranscludeFn); // POSTLINKING for (i = postLinkFns.length - 1; i >= 0; i--) { linkFn = postLinkFns[i]; invokeLinkFn(linkFn, linkFn.isolateScope ? isolateScope : scope, $element, attrs, linkFn.require && getControllers(linkFn.directiveName, linkFn.require, $element, elementControllers), transcludeFn ); } // This is the function that is injected as `$transclude`. // Note: all arguments are optional! function controllersBoundTransclude(scope, cloneAttachFn, futureParentElement) { var transcludeControllers; // No scope passed in: if (!isScope(scope)) { futureParentElement = cloneAttachFn; cloneAttachFn = scope; scope = undefined; } if (hasElementTranscludeDirective) { transcludeControllers = elementControllers; } if (!futureParentElement) { futureParentElement = hasElementTranscludeDirective ? $element.parent() : $element; } return boundTranscludeFn(scope, cloneAttachFn, transcludeControllers, futureParentElement, scopeToChild); } } } function markDirectivesAsIsolate(directives) { // mark all directives as needing isolate scope. for (var j = 0, jj = directives.length; j < jj; j++) { directives[j] = inherit(directives[j], {$$isolateScope: true}); } } /** * looks up the directive and decorates it with exception handling and proper parameters. We * call this the boundDirective. * * @param {string} name name of the directive to look up. * @param {string} location The directive must be found in specific format. * String containing any of theses characters: * * * `E`: element name * * `A': attribute * * `C`: class * * `M`: comment * @returns {boolean} true if directive was added. */ function addDirective(tDirectives, name, location, maxPriority, ignoreDirective, startAttrName, endAttrName) { if (name === ignoreDirective) return null; var match = null; if (hasDirectives.hasOwnProperty(name)) { for (var directive, directives = $injector.get(name + Suffix), i = 0, ii = directives.length; i < ii; i++) { try { directive = directives[i]; if ((maxPriority === undefined || maxPriority > directive.priority) && directive.restrict.indexOf(location) != -1) { if (startAttrName) { directive = inherit(directive, {$$start: startAttrName, $$end: endAttrName}); } tDirectives.push(directive); match = directive; } } catch (e) { $exceptionHandler(e); } } } return match; } /** * looks up the directive and returns true if it is a multi-element directive, * and therefore requires DOM nodes between -start and -end markers to be grouped * together. * * @param {string} name name of the directive to look up. * @returns true if directive was registered as multi-element. */ function directiveIsMultiElement(name) { if (hasDirectives.hasOwnProperty(name)) { for (var directive, directives = $injector.get(name + Suffix), i = 0, ii = directives.length; i < ii; i++) { directive = directives[i]; if (directive.multiElement) { return true; } } } return false; } /** * When the element is replaced with HTML template then the new attributes * on the template need to be merged with the existing attributes in the DOM. * The desired effect is to have both of the attributes present. * * @param {object} dst destination attributes (original DOM) * @param {object} src source attributes (from the directive template) */ function mergeTemplateAttributes(dst, src) { var srcAttr = src.$attr, dstAttr = dst.$attr, $element = dst.$$element; // reapply the old attributes to the new element forEach(dst, function(value, key) { if (key.charAt(0) != '$') { if (src[key] && src[key] !== value) { value += (key === 'style' ? ';' : ' ') + src[key]; } dst.$set(key, value, true, srcAttr[key]); } }); // copy the new attributes on the old attrs object forEach(src, function(value, key) { if (key == 'class') { safeAddClass($element, value); dst['class'] = (dst['class'] ? dst['class'] + ' ' : '') + value; } else if (key == 'style') { $element.attr('style', $element.attr('style') + ';' + value); dst['style'] = (dst['style'] ? dst['style'] + ';' : '') + value; // `dst` will never contain hasOwnProperty as DOM parser won't let it. // You will get an "InvalidCharacterError: DOM Exception 5" error if you // have an attribute like "has-own-property" or "data-has-own-property", etc. } else if (key.charAt(0) != '$' && !dst.hasOwnProperty(key)) { dst[key] = value; dstAttr[key] = srcAttr[key]; } }); } function compileTemplateUrl(directives, $compileNode, tAttrs, $rootElement, childTranscludeFn, preLinkFns, postLinkFns, previousCompileContext) { var linkQueue = [], afterTemplateNodeLinkFn, afterTemplateChildLinkFn, beforeTemplateCompileNode = $compileNode[0], origAsyncDirective = directives.shift(), // The fact that we have to copy and patch the directive seems wrong! derivedSyncDirective = extend({}, origAsyncDirective, { templateUrl: null, transclude: null, replace: null, $$originalDirective: origAsyncDirective }), templateUrl = (isFunction(origAsyncDirective.templateUrl)) ? origAsyncDirective.templateUrl($compileNode, tAttrs) : origAsyncDirective.templateUrl, templateNamespace = origAsyncDirective.templateNamespace; $compileNode.empty(); $templateRequest($sce.getTrustedResourceUrl(templateUrl)) .then(function(content) { var compileNode, tempTemplateAttrs, $template, childBoundTranscludeFn; content = denormalizeTemplate(content); if (origAsyncDirective.replace) { if (jqLiteIsTextNode(content)) { $template = []; } else { $template = removeComments(wrapTemplate(templateNamespace, trim(content))); } compileNode = $template[0]; if ($template.length != 1 || compileNode.nodeType !== NODE_TYPE_ELEMENT) { throw $compileMinErr('tplrt', "Template for directive '{0}' must have exactly one root element. {1}", origAsyncDirective.name, templateUrl); } tempTemplateAttrs = {$attr: {}}; replaceWith($rootElement, $compileNode, compileNode); var templateDirectives = collectDirectives(compileNode, [], tempTemplateAttrs); if (isObject(origAsyncDirective.scope)) { markDirectivesAsIsolate(templateDirectives); } directives = templateDirectives.concat(directives); mergeTemplateAttributes(tAttrs, tempTemplateAttrs); } else { compileNode = beforeTemplateCompileNode; $compileNode.html(content); } directives.unshift(derivedSyncDirective); afterTemplateNodeLinkFn = applyDirectivesToNode(directives, compileNode, tAttrs, childTranscludeFn, $compileNode, origAsyncDirective, preLinkFns, postLinkFns, previousCompileContext); forEach($rootElement, function(node, i) { if (node == compileNode) { $rootElement[i] = $compileNode[0]; } }); afterTemplateChildLinkFn = compileNodes($compileNode[0].childNodes, childTranscludeFn); while (linkQueue.length) { var scope = linkQueue.shift(), beforeTemplateLinkNode = linkQueue.shift(), linkRootElement = linkQueue.shift(), boundTranscludeFn = linkQueue.shift(), linkNode = $compileNode[0]; if (scope.$$destroyed) continue; if (beforeTemplateLinkNode !== beforeTemplateCompileNode) { var oldClasses = beforeTemplateLinkNode.className; if (!(previousCompileContext.hasElementTranscludeDirective && origAsyncDirective.replace)) { // it was cloned therefore we have to clone as well. linkNode = jqLiteClone(compileNode); } replaceWith(linkRootElement, jqLite(beforeTemplateLinkNode), linkNode); // Copy in CSS classes from original node safeAddClass(jqLite(linkNode), oldClasses); } if (afterTemplateNodeLinkFn.transcludeOnThisElement) { childBoundTranscludeFn = createBoundTranscludeFn(scope, afterTemplateNodeLinkFn.transclude, boundTranscludeFn); } else { childBoundTranscludeFn = boundTranscludeFn; } afterTemplateNodeLinkFn(afterTemplateChildLinkFn, scope, linkNode, $rootElement, childBoundTranscludeFn); } linkQueue = null; }); return function delayedNodeLinkFn(ignoreChildLinkFn, scope, node, rootElement, boundTranscludeFn) { var childBoundTranscludeFn = boundTranscludeFn; if (scope.$$destroyed) return; if (linkQueue) { linkQueue.push(scope, node, rootElement, childBoundTranscludeFn); } else { if (afterTemplateNodeLinkFn.transcludeOnThisElement) { childBoundTranscludeFn = createBoundTranscludeFn(scope, afterTemplateNodeLinkFn.transclude, boundTranscludeFn); } afterTemplateNodeLinkFn(afterTemplateChildLinkFn, scope, node, rootElement, childBoundTranscludeFn); } }; } /** * Sorting function for bound directives. */ function byPriority(a, b) { var diff = b.priority - a.priority; if (diff !== 0) return diff; if (a.name !== b.name) return (a.name < b.name) ? -1 : 1; return a.index - b.index; } function assertNoDuplicate(what, previousDirective, directive, element) { if (previousDirective) { throw $compileMinErr('multidir', 'Multiple directives [{0}, {1}] asking for {2} on: {3}', previousDirective.name, directive.name, what, startingTag(element)); } } function addTextInterpolateDirective(directives, text) { var interpolateFn = $interpolate(text, true); if (interpolateFn) { directives.push({ priority: 0, compile: function textInterpolateCompileFn(templateNode) { var templateNodeParent = templateNode.parent(), hasCompileParent = !!templateNodeParent.length; // When transcluding a template that has bindings in the root // we don't have a parent and thus need to add the class during linking fn. if (hasCompileParent) compile.$$addBindingClass(templateNodeParent); return function textInterpolateLinkFn(scope, node) { var parent = node.parent(); if (!hasCompileParent) compile.$$addBindingClass(parent); compile.$$addBindingInfo(parent, interpolateFn.expressions); scope.$watch(interpolateFn, function interpolateFnWatchAction(value) { node[0].nodeValue = value; }); }; } }); } } function wrapTemplate(type, template) { type = lowercase(type || 'html'); switch (type) { case 'svg': case 'math': var wrapper = document.createElement('div'); wrapper.innerHTML = '<' + type + '>' + template + '</' + type + '>'; return wrapper.childNodes[0].childNodes; default: return template; } } function getTrustedContext(node, attrNormalizedName) { if (attrNormalizedName == "srcdoc") { return $sce.HTML; } var tag = nodeName_(node); // maction[xlink:href] can source SVG. It's not limited to <maction>. if (attrNormalizedName == "xlinkHref" || (tag == "form" && attrNormalizedName == "action") || (tag != "img" && (attrNormalizedName == "src" || attrNormalizedName == "ngSrc"))) { return $sce.RESOURCE_URL; } } function addAttrInterpolateDirective(node, directives, value, name, allOrNothing) { var trustedContext = getTrustedContext(node, name); allOrNothing = ALL_OR_NOTHING_ATTRS[name] || allOrNothing; var interpolateFn = $interpolate(value, true, trustedContext, allOrNothing); // no interpolation found -> ignore if (!interpolateFn) return; if (name === "multiple" && nodeName_(node) === "select") { throw $compileMinErr("selmulti", "Binding to the 'multiple' attribute is not supported. Element: {0}", startingTag(node)); } directives.push({ priority: 100, compile: function() { return { pre: function attrInterpolatePreLinkFn(scope, element, attr) { var $$observers = (attr.$$observers || (attr.$$observers = {})); if (EVENT_HANDLER_ATTR_REGEXP.test(name)) { throw $compileMinErr('nodomevents', "Interpolations for HTML DOM event attributes are disallowed. Please use the " + "ng- versions (such as ng-click instead of onclick) instead."); } // If the attribute has changed since last $interpolate()ed var newValue = attr[name]; if (newValue !== value) { // we need to interpolate again since the attribute value has been updated // (e.g. by another directive's compile function) // ensure unset/empty values make interpolateFn falsy interpolateFn = newValue && $interpolate(newValue, true, trustedContext, allOrNothing); value = newValue; } // if attribute was updated so that there is no interpolation going on we don't want to // register any observers if (!interpolateFn) return; // initialize attr object so that it's ready in case we need the value for isolate // scope initialization, otherwise the value would not be available from isolate // directive's linking fn during linking phase attr[name] = interpolateFn(scope); ($$observers[name] || ($$observers[name] = [])).$$inter = true; (attr.$$observers && attr.$$observers[name].$$scope || scope). $watch(interpolateFn, function interpolateFnWatchAction(newValue, oldValue) { //special case for class attribute addition + removal //so that class changes can tap into the animation //hooks provided by the $animate service. Be sure to //skip animations when the first digest occurs (when //both the new and the old values are the same) since //the CSS classes are the non-interpolated values if (name === 'class' && newValue != oldValue) { attr.$updateClass(newValue, oldValue); } else { attr.$set(name, newValue); } }); } }; } }); } /** * This is a special jqLite.replaceWith, which can replace items which * have no parents, provided that the containing jqLite collection is provided. * * @param {JqLite=} $rootElement The root of the compile tree. Used so that we can replace nodes * in the root of the tree. * @param {JqLite} elementsToRemove The jqLite element which we are going to replace. We keep * the shell, but replace its DOM node reference. * @param {Node} newNode The new DOM node. */ function replaceWith($rootElement, elementsToRemove, newNode) { var firstElementToRemove = elementsToRemove[0], removeCount = elementsToRemove.length, parent = firstElementToRemove.parentNode, i, ii; if ($rootElement) { for (i = 0, ii = $rootElement.length; i < ii; i++) { if ($rootElement[i] == firstElementToRemove) { $rootElement[i++] = newNode; for (var j = i, j2 = j + removeCount - 1, jj = $rootElement.length; j < jj; j++, j2++) { if (j2 < jj) { $rootElement[j] = $rootElement[j2]; } else { delete $rootElement[j]; } } $rootElement.length -= removeCount - 1; // If the replaced element is also the jQuery .context then replace it // .context is a deprecated jQuery api, so we should set it only when jQuery set it // http://api.jquery.com/context/ if ($rootElement.context === firstElementToRemove) { $rootElement.context = newNode; } break; } } } if (parent) { parent.replaceChild(newNode, firstElementToRemove); } // TODO(perf): what's this document fragment for? is it needed? can we at least reuse it? var fragment = document.createDocumentFragment(); fragment.appendChild(firstElementToRemove); // Copy over user data (that includes Angular's $scope etc.). Don't copy private // data here because there's no public interface in jQuery to do that and copying over // event listeners (which is the main use of private data) wouldn't work anyway. jqLite(newNode).data(jqLite(firstElementToRemove).data()); // Remove data of the replaced element. We cannot just call .remove() // on the element it since that would deallocate scope that is needed // for the new node. Instead, remove the data "manually". if (!jQuery) { delete jqLite.cache[firstElementToRemove[jqLite.expando]]; } else { // jQuery 2.x doesn't expose the data storage. Use jQuery.cleanData to clean up after // the replaced element. The cleanData version monkey-patched by Angular would cause // the scope to be trashed and we do need the very same scope to work with the new // element. However, we cannot just cache the non-patched version and use it here as // that would break if another library patches the method after Angular does (one // example is jQuery UI). Instead, set a flag indicating scope destroying should be // skipped this one time. skipDestroyOnNextJQueryCleanData = true; jQuery.cleanData([firstElementToRemove]); } for (var k = 1, kk = elementsToRemove.length; k < kk; k++) { var element = elementsToRemove[k]; jqLite(element).remove(); // must do this way to clean up expando fragment.appendChild(element); delete elementsToRemove[k]; } elementsToRemove[0] = newNode; elementsToRemove.length = 1; } function cloneAndAnnotateFn(fn, annotation) { return extend(function() { return fn.apply(null, arguments); }, fn, annotation); } function invokeLinkFn(linkFn, scope, $element, attrs, controllers, transcludeFn) { try { linkFn(scope, $element, attrs, controllers, transcludeFn); } catch (e) { $exceptionHandler(e, startingTag($element)); } } }]; } var PREFIX_REGEXP = /^((?:x|data)[\:\-_])/i; /** * Converts all accepted directives format into proper directive name. * @param name Name to normalize */ function directiveNormalize(name) { return camelCase(name.replace(PREFIX_REGEXP, '')); } /** * @ngdoc type * @name $compile.directive.Attributes * * @description * A shared object between directive compile / linking functions which contains normalized DOM * element attributes. The values reflect current binding state `{{ }}`. The normalization is * needed since all of these are treated as equivalent in Angular: * * ``` * <span ng:bind="a" ng-bind="a" data-ng-bind="a" x-ng-bind="a"> * ``` */ /** * @ngdoc property * @name $compile.directive.Attributes#$attr * * @description * A map of DOM element attribute names to the normalized name. This is * needed to do reverse lookup from normalized name back to actual name. */ /** * @ngdoc method * @name $compile.directive.Attributes#$set * @kind function * * @description * Set DOM element attribute value. * * * @param {string} name Normalized element attribute name of the property to modify. The name is * reverse-translated using the {@link ng.$compile.directive.Attributes#$attr $attr} * property to the original name. * @param {string} value Value to set the attribute to. The value can be an interpolated string. */ /** * Closure compiler type information */ function nodesetLinkingFn( /* angular.Scope */ scope, /* NodeList */ nodeList, /* Element */ rootElement, /* function(Function) */ boundTranscludeFn ) {} function directiveLinkingFn( /* nodesetLinkingFn */ nodesetLinkingFn, /* angular.Scope */ scope, /* Node */ node, /* Element */ rootElement, /* function(Function) */ boundTranscludeFn ) {} function tokenDifference(str1, str2) { var values = '', tokens1 = str1.split(/\s+/), tokens2 = str2.split(/\s+/); outer: for (var i = 0; i < tokens1.length; i++) { var token = tokens1[i]; for (var j = 0; j < tokens2.length; j++) { if (token == tokens2[j]) continue outer; } values += (values.length > 0 ? ' ' : '') + token; } return values; } function removeComments(jqNodes) { jqNodes = jqLite(jqNodes); var i = jqNodes.length; if (i <= 1) { return jqNodes; } while (i--) { var node = jqNodes[i]; if (node.nodeType === NODE_TYPE_COMMENT) { splice.call(jqNodes, i, 1); } } return jqNodes; } /** * @ngdoc provider * @name $controllerProvider * @description * The {@link ng.$controller $controller service} is used by Angular to create new * controllers. * * This provider allows controller registration via the * {@link ng.$controllerProvider#register register} method. */ function $ControllerProvider() { var controllers = {}, globals = false, CNTRL_REG = /^(\S+)(\s+as\s+(\w+))?$/; /** * @ngdoc method * @name $controllerProvider#register * @param {string|Object} name Controller name, or an object map of controllers where the keys are * the names and the values are the constructors. * @param {Function|Array} constructor Controller constructor fn (optionally decorated with DI * annotations in the array notation). */ this.register = function(name, constructor) { assertNotHasOwnProperty(name, 'controller'); if (isObject(name)) { extend(controllers, name); } else { controllers[name] = constructor; } }; /** * @ngdoc method * @name $controllerProvider#allowGlobals * @description If called, allows `$controller` to find controller constructors on `window` */ this.allowGlobals = function() { globals = true; }; this.$get = ['$injector', '$window', function($injector, $window) { /** * @ngdoc service * @name $controller * @requires $injector * * @param {Function|string} constructor If called with a function then it's considered to be the * controller constructor function. Otherwise it's considered to be a string which is used * to retrieve the controller constructor using the following steps: * * * check if a controller with given name is registered via `$controllerProvider` * * check if evaluating the string on the current scope returns a constructor * * if $controllerProvider#allowGlobals, check `window[constructor]` on the global * `window` object (not recommended) * * The string can use the `controller as property` syntax, where the controller instance is published * as the specified property on the `scope`; the `scope` must be injected into `locals` param for this * to work correctly. * * @param {Object} locals Injection locals for Controller. * @return {Object} Instance of given controller. * * @description * `$controller` service is responsible for instantiating controllers. * * It's just a simple call to {@link auto.$injector $injector}, but extracted into * a service, so that one can override this service with [BC version](https://gist.github.com/1649788). */ return function(expression, locals, later, ident) { // PRIVATE API: // param `later` --- indicates that the controller's constructor is invoked at a later time. // If true, $controller will allocate the object with the correct // prototype chain, but will not invoke the controller until a returned // callback is invoked. // param `ident` --- An optional label which overrides the label parsed from the controller // expression, if any. var instance, match, constructor, identifier; later = later === true; if (ident && isString(ident)) { identifier = ident; } if (isString(expression)) { match = expression.match(CNTRL_REG), constructor = match[1], identifier = identifier || match[3]; expression = controllers.hasOwnProperty(constructor) ? controllers[constructor] : getter(locals.$scope, constructor, true) || (globals ? getter($window, constructor, true) : undefined); assertArgFn(expression, constructor, true); } if (later) { // Instantiate controller later: // This machinery is used to create an instance of the object before calling the // controller's constructor itself. // // This allows properties to be added to the controller before the constructor is // invoked. Primarily, this is used for isolate scope bindings in $compile. // // This feature is not intended for use by applications, and is thus not documented // publicly. // Object creation: http://jsperf.com/create-constructor/2 var controllerPrototype = (isArray(expression) ? expression[expression.length - 1] : expression).prototype; instance = Object.create(controllerPrototype || null); if (identifier) { addIdentifier(locals, identifier, instance, constructor || expression.name); } return extend(function() { $injector.invoke(expression, instance, locals, constructor); return instance; }, { instance: instance, identifier: identifier }); } instance = $injector.instantiate(expression, locals, constructor); if (identifier) { addIdentifier(locals, identifier, instance, constructor || expression.name); } return instance; }; function addIdentifier(locals, identifier, instance, name) { if (!(locals && isObject(locals.$scope))) { throw minErr('$controller')('noscp', "Cannot export controller '{0}' as '{1}'! No $scope object provided via `locals`.", name, identifier); } locals.$scope[identifier] = instance; } }]; } /** * @ngdoc service * @name $document * @requires $window * * @description * A {@link angular.element jQuery or jqLite} wrapper for the browser's `window.document` object. * * @example <example module="documentExample"> <file name="index.html"> <div ng-controller="ExampleController"> <p>$document title: <b ng-bind="title"></b></p> <p>window.document title: <b ng-bind="windowTitle"></b></p> </div> </file> <file name="script.js"> angular.module('documentExample', []) .controller('ExampleController', ['$scope', '$document', function($scope, $document) { $scope.title = $document[0].title; $scope.windowTitle = angular.element(window.document)[0].title; }]); </file> </example> */ function $DocumentProvider() { this.$get = ['$window', function(window) { return jqLite(window.document); }]; } /** * @ngdoc service * @name $exceptionHandler * @requires ng.$log * * @description * Any uncaught exception in angular expressions is delegated to this service. * The default implementation simply delegates to `$log.error` which logs it into * the browser console. * * In unit tests, if `angular-mocks.js` is loaded, this service is overridden by * {@link ngMock.$exceptionHandler mock $exceptionHandler} which aids in testing. * * ## Example: * * ```js * angular.module('exceptionOverride', []).factory('$exceptionHandler', function() { * return function(exception, cause) { * exception.message += ' (caused by "' + cause + '")'; * throw exception; * }; * }); * ``` * * This example will override the normal action of `$exceptionHandler`, to make angular * exceptions fail hard when they happen, instead of just logging to the console. * * <hr /> * Note, that code executed in event-listeners (even those registered using jqLite's `on`/`bind` * methods) does not delegate exceptions to the {@link ng.$exceptionHandler $exceptionHandler} * (unless executed during a digest). * * If you wish, you can manually delegate exceptions, e.g. * `try { ... } catch(e) { $exceptionHandler(e); }` * * @param {Error} exception Exception associated with the error. * @param {string=} cause optional information about the context in which * the error was thrown. * */ function $ExceptionHandlerProvider() { this.$get = ['$log', function($log) { return function(exception, cause) { $log.error.apply($log, arguments); }; }]; } var APPLICATION_JSON = 'application/json'; var CONTENT_TYPE_APPLICATION_JSON = {'Content-Type': APPLICATION_JSON + ';charset=utf-8'}; var JSON_START = /^\[|^\{(?!\{)/; var JSON_ENDS = { '[': /]$/, '{': /}$/ }; var JSON_PROTECTION_PREFIX = /^\)\]\}',?\n/; function defaultHttpResponseTransform(data, headers) { if (isString(data)) { // Strip json vulnerability protection prefix and trim whitespace var tempData = data.replace(JSON_PROTECTION_PREFIX, '').trim(); if (tempData) { var contentType = headers('Content-Type'); if ((contentType && (contentType.indexOf(APPLICATION_JSON) === 0)) || isJsonLike(tempData)) { data = fromJson(tempData); } } } return data; } function isJsonLike(str) { var jsonStart = str.match(JSON_START); return jsonStart && JSON_ENDS[jsonStart[0]].test(str); } /** * Parse headers into key value object * * @param {string} headers Raw headers as a string * @returns {Object} Parsed headers as key value object */ function parseHeaders(headers) { var parsed = createMap(), key, val, i; if (!headers) return parsed; forEach(headers.split('\n'), function(line) { i = line.indexOf(':'); key = lowercase(trim(line.substr(0, i))); val = trim(line.substr(i + 1)); if (key) { parsed[key] = parsed[key] ? parsed[key] + ', ' + val : val; } }); return parsed; } /** * Returns a function that provides access to parsed headers. * * Headers are lazy parsed when first requested. * @see parseHeaders * * @param {(string|Object)} headers Headers to provide access to. * @returns {function(string=)} Returns a getter function which if called with: * * - if called with single an argument returns a single header value or null * - if called with no arguments returns an object containing all headers. */ function headersGetter(headers) { var headersObj = isObject(headers) ? headers : undefined; return function(name) { if (!headersObj) headersObj = parseHeaders(headers); if (name) { var value = headersObj[lowercase(name)]; if (value === void 0) { value = null; } return value; } return headersObj; }; } /** * Chain all given functions * * This function is used for both request and response transforming * * @param {*} data Data to transform. * @param {function(string=)} headers HTTP headers getter fn. * @param {number} status HTTP status code of the response. * @param {(Function|Array.<Function>)} fns Function or an array of functions. * @returns {*} Transformed data. */ function transformData(data, headers, status, fns) { if (isFunction(fns)) return fns(data, headers, status); forEach(fns, function(fn) { data = fn(data, headers, status); }); return data; } function isSuccess(status) { return 200 <= status && status < 300; } /** * @ngdoc provider * @name $httpProvider * @description * Use `$httpProvider` to change the default behavior of the {@link ng.$http $http} service. * */ function $HttpProvider() { /** * @ngdoc property * @name $httpProvider#defaults * @description * * Object containing default values for all {@link ng.$http $http} requests. * * - **`defaults.cache`** - {Object} - an object built with {@link ng.$cacheFactory `$cacheFactory`} * that will provide the cache for all requests who set their `cache` property to `true`. * If you set the `default.cache = false` then only requests that specify their own custom * cache object will be cached. See {@link $http#caching $http Caching} for more information. * * - **`defaults.xsrfCookieName`** - {string} - Name of cookie containing the XSRF token. * Defaults value is `'XSRF-TOKEN'`. * * - **`defaults.xsrfHeaderName`** - {string} - Name of HTTP header to populate with the * XSRF token. Defaults value is `'X-XSRF-TOKEN'`. * * - **`defaults.headers`** - {Object} - Default headers for all $http requests. * Refer to {@link ng.$http#setting-http-headers $http} for documentation on * setting default headers. * - **`defaults.headers.common`** * - **`defaults.headers.post`** * - **`defaults.headers.put`** * - **`defaults.headers.patch`** * **/ var defaults = this.defaults = { // transform incoming response data transformResponse: [defaultHttpResponseTransform], // transform outgoing request data transformRequest: [function(d) { return isObject(d) && !isFile(d) && !isBlob(d) && !isFormData(d) ? toJson(d) : d; }], // default headers headers: { common: { 'Accept': 'application/json, text/plain, */*' }, post: shallowCopy(CONTENT_TYPE_APPLICATION_JSON), put: shallowCopy(CONTENT_TYPE_APPLICATION_JSON), patch: shallowCopy(CONTENT_TYPE_APPLICATION_JSON) }, xsrfCookieName: 'XSRF-TOKEN', xsrfHeaderName: 'X-XSRF-TOKEN' }; var useApplyAsync = false; /** * @ngdoc method * @name $httpProvider#useApplyAsync * @description * * Configure $http service to combine processing of multiple http responses received at around * the same time via {@link ng.$rootScope.Scope#$applyAsync $rootScope.$applyAsync}. This can result in * significant performance improvement for bigger applications that make many HTTP requests * concurrently (common during application bootstrap). * * Defaults to false. If no value is specifed, returns the current configured value. * * @param {boolean=} value If true, when requests are loaded, they will schedule a deferred * "apply" on the next tick, giving time for subsequent requests in a roughly ~10ms window * to load and share the same digest cycle. * * @returns {boolean|Object} If a value is specified, returns the $httpProvider for chaining. * otherwise, returns the current configured value. **/ this.useApplyAsync = function(value) { if (isDefined(value)) { useApplyAsync = !!value; return this; } return useApplyAsync; }; /** * @ngdoc property * @name $httpProvider#interceptors * @description * * Array containing service factories for all synchronous or asynchronous {@link ng.$http $http} * pre-processing of request or postprocessing of responses. * * These service factories are ordered by request, i.e. they are applied in the same order as the * array, on request, but reverse order, on response. * * {@link ng.$http#interceptors Interceptors detailed info} **/ var interceptorFactories = this.interceptors = []; this.$get = ['$httpBackend', '$browser', '$cacheFactory', '$rootScope', '$q', '$injector', function($httpBackend, $browser, $cacheFactory, $rootScope, $q, $injector) { var defaultCache = $cacheFactory('$http'); /** * Interceptors stored in reverse order. Inner interceptors before outer interceptors. * The reversal is needed so that we can build up the interception chain around the * server request. */ var reversedInterceptors = []; forEach(interceptorFactories, function(interceptorFactory) { reversedInterceptors.unshift(isString(interceptorFactory) ? $injector.get(interceptorFactory) : $injector.invoke(interceptorFactory)); }); /** * @ngdoc service * @kind function * @name $http * @requires ng.$httpBackend * @requires $cacheFactory * @requires $rootScope * @requires $q * @requires $injector * * @description * The `$http` service is a core Angular service that facilitates communication with the remote * HTTP servers via the browser's [XMLHttpRequest](https://developer.mozilla.org/en/xmlhttprequest) * object or via [JSONP](http://en.wikipedia.org/wiki/JSONP). * * For unit testing applications that use `$http` service, see * {@link ngMock.$httpBackend $httpBackend mock}. * * For a higher level of abstraction, please check out the {@link ngResource.$resource * $resource} service. * * The $http API is based on the {@link ng.$q deferred/promise APIs} exposed by * the $q service. While for simple usage patterns this doesn't matter much, for advanced usage * it is important to familiarize yourself with these APIs and the guarantees they provide. * * * ## General usage * The `$http` service is a function which takes a single argument — a configuration object — * that is used to generate an HTTP request and returns a {@link ng.$q promise} * with two $http specific methods: `success` and `error`. * * ```js * // Simple GET request example : * $http.get('/someUrl'). * success(function(data, status, headers, config) { * // this callback will be called asynchronously * // when the response is available * }). * error(function(data, status, headers, config) { * // called asynchronously if an error occurs * // or server returns response with an error status. * }); * ``` * * ```js * // Simple POST request example (passing data) : * $http.post('/someUrl', {msg:'hello word!'}). * success(function(data, status, headers, config) { * // this callback will be called asynchronously * // when the response is available * }). * error(function(data, status, headers, config) { * // called asynchronously if an error occurs * // or server returns response with an error status. * }); * ``` * * * Since the returned value of calling the $http function is a `promise`, you can also use * the `then` method to register callbacks, and these callbacks will receive a single argument – * an object representing the response. See the API signature and type info below for more * details. * * A response status code between 200 and 299 is considered a success status and * will result in the success callback being called. Note that if the response is a redirect, * XMLHttpRequest will transparently follow it, meaning that the error callback will not be * called for such responses. * * ## Writing Unit Tests that use $http * When unit testing (using {@link ngMock ngMock}), it is necessary to call * {@link ngMock.$httpBackend#flush $httpBackend.flush()} to flush each pending * request using trained responses. * * ``` * $httpBackend.expectGET(...); * $http.get(...); * $httpBackend.flush(); * ``` * * ## Shortcut methods * * Shortcut methods are also available. All shortcut methods require passing in the URL, and * request data must be passed in for POST/PUT requests. * * ```js * $http.get('/someUrl').success(successCallback); * $http.post('/someUrl', data).success(successCallback); * ``` * * Complete list of shortcut methods: * * - {@link ng.$http#get $http.get} * - {@link ng.$http#head $http.head} * - {@link ng.$http#post $http.post} * - {@link ng.$http#put $http.put} * - {@link ng.$http#delete $http.delete} * - {@link ng.$http#jsonp $http.jsonp} * - {@link ng.$http#patch $http.patch} * * * ## Setting HTTP Headers * * The $http service will automatically add certain HTTP headers to all requests. These defaults * can be fully configured by accessing the `$httpProvider.defaults.headers` configuration * object, which currently contains this default configuration: * * - `$httpProvider.defaults.headers.common` (headers that are common for all requests): * - `Accept: application/json, text/plain, * / *` * - `$httpProvider.defaults.headers.post`: (header defaults for POST requests) * - `Content-Type: application/json` * - `$httpProvider.defaults.headers.put` (header defaults for PUT requests) * - `Content-Type: application/json` * * To add or overwrite these defaults, simply add or remove a property from these configuration * objects. To add headers for an HTTP method other than POST or PUT, simply add a new object * with the lowercased HTTP method name as the key, e.g. * `$httpProvider.defaults.headers.get = { 'My-Header' : 'value' }. * * The defaults can also be set at runtime via the `$http.defaults` object in the same * fashion. For example: * * ``` * module.run(function($http) { * $http.defaults.headers.common.Authorization = 'Basic YmVlcDpib29w' * }); * ``` * * In addition, you can supply a `headers` property in the config object passed when * calling `$http(config)`, which overrides the defaults without changing them globally. * * To explicitly remove a header automatically added via $httpProvider.defaults.headers on a per request basis, * Use the `headers` property, setting the desired header to `undefined`. For example: * * ```js * var req = { * method: 'POST', * url: 'http://example.com', * headers: { * 'Content-Type': undefined * }, * data: { test: 'test' }, * } * * $http(req).success(function(){...}).error(function(){...}); * ``` * * ## Transforming Requests and Responses * * Both requests and responses can be transformed using transformation functions: `transformRequest` * and `transformResponse`. These properties can be a single function that returns * the transformed value (`function(data, headersGetter, status)`) or an array of such transformation functions, * which allows you to `push` or `unshift` a new transformation function into the transformation chain. * * ### Default Transformations * * The `$httpProvider` provider and `$http` service expose `defaults.transformRequest` and * `defaults.transformResponse` properties. If a request does not provide its own transformations * then these will be applied. * * You can augment or replace the default transformations by modifying these properties by adding to or * replacing the array. * * Angular provides the following default transformations: * * Request transformations (`$httpProvider.defaults.transformRequest` and `$http.defaults.transformRequest`): * * - If the `data` property of the request configuration object contains an object, serialize it * into JSON format. * * Response transformations (`$httpProvider.defaults.transformResponse` and `$http.defaults.transformResponse`): * * - If XSRF prefix is detected, strip it (see Security Considerations section below). * - If JSON response is detected, deserialize it using a JSON parser. * * * ### Overriding the Default Transformations Per Request * * If you wish override the request/response transformations only for a single request then provide * `transformRequest` and/or `transformResponse` properties on the configuration object passed * into `$http`. * * Note that if you provide these properties on the config object the default transformations will be * overwritten. If you wish to augment the default transformations then you must include them in your * local transformation array. * * The following code demonstrates adding a new response transformation to be run after the default response * transformations have been run. * * ```js * function appendTransform(defaults, transform) { * * // We can't guarantee that the default transformation is an array * defaults = angular.isArray(defaults) ? defaults : [defaults]; * * // Append the new transformation to the defaults * return defaults.concat(transform); * } * * $http({ * url: '...', * method: 'GET', * transformResponse: appendTransform($http.defaults.transformResponse, function(value) { * return doTransform(value); * }) * }); * ``` * * * ## Caching * * To enable caching, set the request configuration `cache` property to `true` (to use default * cache) or to a custom cache object (built with {@link ng.$cacheFactory `$cacheFactory`}). * When the cache is enabled, `$http` stores the response from the server in the specified * cache. The next time the same request is made, the response is served from the cache without * sending a request to the server. * * Note that even if the response is served from cache, delivery of the data is asynchronous in * the same way that real requests are. * * If there are multiple GET requests for the same URL that should be cached using the same * cache, but the cache is not populated yet, only one request to the server will be made and * the remaining requests will be fulfilled using the response from the first request. * * You can change the default cache to a new object (built with * {@link ng.$cacheFactory `$cacheFactory`}) by updating the * {@link ng.$http#defaults `$http.defaults.cache`} property. All requests who set * their `cache` property to `true` will now use this cache object. * * If you set the default cache to `false` then only requests that specify their own custom * cache object will be cached. * * ## Interceptors * * Before you start creating interceptors, be sure to understand the * {@link ng.$q $q and deferred/promise APIs}. * * For purposes of global error handling, authentication, or any kind of synchronous or * asynchronous pre-processing of request or postprocessing of responses, it is desirable to be * able to intercept requests before they are handed to the server and * responses before they are handed over to the application code that * initiated these requests. The interceptors leverage the {@link ng.$q * promise APIs} to fulfill this need for both synchronous and asynchronous pre-processing. * * The interceptors are service factories that are registered with the `$httpProvider` by * adding them to the `$httpProvider.interceptors` array. The factory is called and * injected with dependencies (if specified) and returns the interceptor. * * There are two kinds of interceptors (and two kinds of rejection interceptors): * * * `request`: interceptors get called with a http `config` object. The function is free to * modify the `config` object or create a new one. The function needs to return the `config` * object directly, or a promise containing the `config` or a new `config` object. * * `requestError`: interceptor gets called when a previous interceptor threw an error or * resolved with a rejection. * * `response`: interceptors get called with http `response` object. The function is free to * modify the `response` object or create a new one. The function needs to return the `response` * object directly, or as a promise containing the `response` or a new `response` object. * * `responseError`: interceptor gets called when a previous interceptor threw an error or * resolved with a rejection. * * * ```js * // register the interceptor as a service * $provide.factory('myHttpInterceptor', function($q, dependency1, dependency2) { * return { * // optional method * 'request': function(config) { * // do something on success * return config; * }, * * // optional method * 'requestError': function(rejection) { * // do something on error * if (canRecover(rejection)) { * return responseOrNewPromise * } * return $q.reject(rejection); * }, * * * * // optional method * 'response': function(response) { * // do something on success * return response; * }, * * // optional method * 'responseError': function(rejection) { * // do something on error * if (canRecover(rejection)) { * return responseOrNewPromise * } * return $q.reject(rejection); * } * }; * }); * * $httpProvider.interceptors.push('myHttpInterceptor'); * * * // alternatively, register the interceptor via an anonymous factory * $httpProvider.interceptors.push(function($q, dependency1, dependency2) { * return { * 'request': function(config) { * // same as above * }, * * 'response': function(response) { * // same as above * } * }; * }); * ``` * * ## Security Considerations * * When designing web applications, consider security threats from: * * - [JSON vulnerability](http://haacked.com/archive/2008/11/20/anatomy-of-a-subtle-json-vulnerability.aspx) * - [XSRF](http://en.wikipedia.org/wiki/Cross-site_request_forgery) * * Both server and the client must cooperate in order to eliminate these threats. Angular comes * pre-configured with strategies that address these issues, but for this to work backend server * cooperation is required. * * ### JSON Vulnerability Protection * * A [JSON vulnerability](http://haacked.com/archive/2008/11/20/anatomy-of-a-subtle-json-vulnerability.aspx) * allows third party website to turn your JSON resource URL into * [JSONP](http://en.wikipedia.org/wiki/JSONP) request under some conditions. To * counter this your server can prefix all JSON requests with following string `")]}',\n"`. * Angular will automatically strip the prefix before processing it as JSON. * * For example if your server needs to return: * ```js * ['one','two'] * ``` * * which is vulnerable to attack, your server can return: * ```js * )]}', * ['one','two'] * ``` * * Angular will strip the prefix, before processing the JSON. * * * ### Cross Site Request Forgery (XSRF) Protection * * [XSRF](http://en.wikipedia.org/wiki/Cross-site_request_forgery) is a technique by which * an unauthorized site can gain your user's private data. Angular provides a mechanism * to counter XSRF. When performing XHR requests, the $http service reads a token from a cookie * (by default, `XSRF-TOKEN`) and sets it as an HTTP header (`X-XSRF-TOKEN`). Since only * JavaScript that runs on your domain could read the cookie, your server can be assured that * the XHR came from JavaScript running on your domain. The header will not be set for * cross-domain requests. * * To take advantage of this, your server needs to set a token in a JavaScript readable session * cookie called `XSRF-TOKEN` on the first HTTP GET request. On subsequent XHR requests the * server can verify that the cookie matches `X-XSRF-TOKEN` HTTP header, and therefore be sure * that only JavaScript running on your domain could have sent the request. The token must be * unique for each user and must be verifiable by the server (to prevent the JavaScript from * making up its own tokens). We recommend that the token is a digest of your site's * authentication cookie with a [salt](https://en.wikipedia.org/wiki/Salt_(cryptography&#41;) * for added security. * * The name of the headers can be specified using the xsrfHeaderName and xsrfCookieName * properties of either $httpProvider.defaults at config-time, $http.defaults at run-time, * or the per-request config object. * * * @param {object} config Object describing the request to be made and how it should be * processed. The object has following properties: * * - **method** – `{string}` – HTTP method (e.g. 'GET', 'POST', etc) * - **url** – `{string}` – Absolute or relative URL of the resource that is being requested. * - **params** – `{Object.<string|Object>}` – Map of strings or objects which will be turned * to `?key1=value1&key2=value2` after the url. If the value is not a string, it will be * JSONified. * - **data** – `{string|Object}` – Data to be sent as the request message data. * - **headers** – `{Object}` – Map of strings or functions which return strings representing * HTTP headers to send to the server. If the return value of a function is null, the * header will not be sent. * - **xsrfHeaderName** – `{string}` – Name of HTTP header to populate with the XSRF token. * - **xsrfCookieName** – `{string}` – Name of cookie containing the XSRF token. * - **transformRequest** – * `{function(data, headersGetter)|Array.<function(data, headersGetter)>}` – * transform function or an array of such functions. The transform function takes the http * request body and headers and returns its transformed (typically serialized) version. * See {@link ng.$http#overriding-the-default-transformations-per-request * Overriding the Default Transformations} * - **transformResponse** – * `{function(data, headersGetter, status)|Array.<function(data, headersGetter, status)>}` – * transform function or an array of such functions. The transform function takes the http * response body, headers and status and returns its transformed (typically deserialized) version. * See {@link ng.$http#overriding-the-default-transformations-per-request * Overriding the Default Transformations} * - **cache** – `{boolean|Cache}` – If true, a default $http cache will be used to cache the * GET request, otherwise if a cache instance built with * {@link ng.$cacheFactory $cacheFactory}, this cache will be used for * caching. * - **timeout** – `{number|Promise}` – timeout in milliseconds, or {@link ng.$q promise} * that should abort the request when resolved. * - **withCredentials** - `{boolean}` - whether to set the `withCredentials` flag on the * XHR object. See [requests with credentials](https://developer.mozilla.org/docs/Web/HTTP/Access_control_CORS#Requests_with_credentials) * for more information. * - **responseType** - `{string}` - see * [requestType](https://developer.mozilla.org/en-US/docs/DOM/XMLHttpRequest#responseType). * * @returns {HttpPromise} Returns a {@link ng.$q promise} object with the * standard `then` method and two http specific methods: `success` and `error`. The `then` * method takes two arguments a success and an error callback which will be called with a * response object. The `success` and `error` methods take a single argument - a function that * will be called when the request succeeds or fails respectively. The arguments passed into * these functions are destructured representation of the response object passed into the * `then` method. The response object has these properties: * * - **data** – `{string|Object}` – The response body transformed with the transform * functions. * - **status** – `{number}` – HTTP status code of the response. * - **headers** – `{function([headerName])}` – Header getter function. * - **config** – `{Object}` – The configuration object that was used to generate the request. * - **statusText** – `{string}` – HTTP status text of the response. * * @property {Array.<Object>} pendingRequests Array of config objects for currently pending * requests. This is primarily meant to be used for debugging purposes. * * * @example <example module="httpExample"> <file name="index.html"> <div ng-controller="FetchController"> <select ng-model="method"> <option>GET</option> <option>JSONP</option> </select> <input type="text" ng-model="url" size="80"/> <button id="fetchbtn" ng-click="fetch()">fetch</button><br> <button id="samplegetbtn" ng-click="updateModel('GET', 'http-hello.html')">Sample GET</button> <button id="samplejsonpbtn" ng-click="updateModel('JSONP', 'https://angularjs.org/greet.php?callback=JSON_CALLBACK&name=Super%20Hero')"> Sample JSONP </button> <button id="invalidjsonpbtn" ng-click="updateModel('JSONP', 'https://angularjs.org/doesntexist&callback=JSON_CALLBACK')"> Invalid JSONP </button> <pre>http status code: {{status}}</pre> <pre>http response data: {{data}}</pre> </div> </file> <file name="script.js"> angular.module('httpExample', []) .controller('FetchController', ['$scope', '$http', '$templateCache', function($scope, $http, $templateCache) { $scope.method = 'GET'; $scope.url = 'http-hello.html'; $scope.fetch = function() { $scope.code = null; $scope.response = null; $http({method: $scope.method, url: $scope.url, cache: $templateCache}). success(function(data, status) { $scope.status = status; $scope.data = data; }). error(function(data, status) { $scope.data = data || "Request failed"; $scope.status = status; }); }; $scope.updateModel = function(method, url) { $scope.method = method; $scope.url = url; }; }]); </file> <file name="http-hello.html"> Hello, $http! </file> <file name="protractor.js" type="protractor"> var status = element(by.binding('status')); var data = element(by.binding('data')); var fetchBtn = element(by.id('fetchbtn')); var sampleGetBtn = element(by.id('samplegetbtn')); var sampleJsonpBtn = element(by.id('samplejsonpbtn')); var invalidJsonpBtn = element(by.id('invalidjsonpbtn')); it('should make an xhr GET request', function() { sampleGetBtn.click(); fetchBtn.click(); expect(status.getText()).toMatch('200'); expect(data.getText()).toMatch(/Hello, \$http!/); }); // Commented out due to flakes. See https://github.com/angular/angular.js/issues/9185 // it('should make a JSONP request to angularjs.org', function() { // sampleJsonpBtn.click(); // fetchBtn.click(); // expect(status.getText()).toMatch('200'); // expect(data.getText()).toMatch(/Super Hero!/); // }); it('should make JSONP request to invalid URL and invoke the error handler', function() { invalidJsonpBtn.click(); fetchBtn.click(); expect(status.getText()).toMatch('0'); expect(data.getText()).toMatch('Request failed'); }); </file> </example> */ function $http(requestConfig) { if (!angular.isObject(requestConfig)) { throw minErr('$http')('badreq', 'Http request configuration must be an object. Received: {0}', requestConfig); } var config = extend({ method: 'get', transformRequest: defaults.transformRequest, transformResponse: defaults.transformResponse }, requestConfig); config.headers = mergeHeaders(requestConfig); config.method = uppercase(config.method); var serverRequest = function(config) { var headers = config.headers; var reqData = transformData(config.data, headersGetter(headers), undefined, config.transformRequest); // strip content-type if data is undefined if (isUndefined(reqData)) { forEach(headers, function(value, header) { if (lowercase(header) === 'content-type') { delete headers[header]; } }); } if (isUndefined(config.withCredentials) && !isUndefined(defaults.withCredentials)) { config.withCredentials = defaults.withCredentials; } // send request return sendReq(config, reqData).then(transformResponse, transformResponse); }; var chain = [serverRequest, undefined]; var promise = $q.when(config); // apply interceptors forEach(reversedInterceptors, function(interceptor) { if (interceptor.request || interceptor.requestError) { chain.unshift(interceptor.request, interceptor.requestError); } if (interceptor.response || interceptor.responseError) { chain.push(interceptor.response, interceptor.responseError); } }); while (chain.length) { var thenFn = chain.shift(); var rejectFn = chain.shift(); promise = promise.then(thenFn, rejectFn); } promise.success = function(fn) { promise.then(function(response) { fn(response.data, response.status, response.headers, config); }); return promise; }; promise.error = function(fn) { promise.then(null, function(response) { fn(response.data, response.status, response.headers, config); }); return promise; }; return promise; function transformResponse(response) { // make a copy since the response must be cacheable var resp = extend({}, response); if (!response.data) { resp.data = response.data; } else { resp.data = transformData(response.data, response.headers, response.status, config.transformResponse); } return (isSuccess(response.status)) ? resp : $q.reject(resp); } function executeHeaderFns(headers) { var headerContent, processedHeaders = {}; forEach(headers, function(headerFn, header) { if (isFunction(headerFn)) { headerContent = headerFn(); if (headerContent != null) { processedHeaders[header] = headerContent; } } else { processedHeaders[header] = headerFn; } }); return processedHeaders; } function mergeHeaders(config) { var defHeaders = defaults.headers, reqHeaders = extend({}, config.headers), defHeaderName, lowercaseDefHeaderName, reqHeaderName; defHeaders = extend({}, defHeaders.common, defHeaders[lowercase(config.method)]); // using for-in instead of forEach to avoid unecessary iteration after header has been found defaultHeadersIteration: for (defHeaderName in defHeaders) { lowercaseDefHeaderName = lowercase(defHeaderName); for (reqHeaderName in reqHeaders) { if (lowercase(reqHeaderName) === lowercaseDefHeaderName) { continue defaultHeadersIteration; } } reqHeaders[defHeaderName] = defHeaders[defHeaderName]; } // execute if header value is a function for merged headers return executeHeaderFns(reqHeaders); } } $http.pendingRequests = []; /** * @ngdoc method * @name $http#get * * @description * Shortcut method to perform `GET` request. * * @param {string} url Relative or absolute URL specifying the destination of the request * @param {Object=} config Optional configuration object * @returns {HttpPromise} Future object */ /** * @ngdoc method * @name $http#delete * * @description * Shortcut method to perform `DELETE` request. * * @param {string} url Relative or absolute URL specifying the destination of the request * @param {Object=} config Optional configuration object * @returns {HttpPromise} Future object */ /** * @ngdoc method * @name $http#head * * @description * Shortcut method to perform `HEAD` request. * * @param {string} url Relative or absolute URL specifying the destination of the request * @param {Object=} config Optional configuration object * @returns {HttpPromise} Future object */ /** * @ngdoc method * @name $http#jsonp * * @description * Shortcut method to perform `JSONP` request. * * @param {string} url Relative or absolute URL specifying the destination of the request. * The name of the callback should be the string `JSON_CALLBACK`. * @param {Object=} config Optional configuration object * @returns {HttpPromise} Future object */ createShortMethods('get', 'delete', 'head', 'jsonp'); /** * @ngdoc method * @name $http#post * * @description * Shortcut method to perform `POST` request. * * @param {string} url Relative or absolute URL specifying the destination of the request * @param {*} data Request content * @param {Object=} config Optional configuration object * @returns {HttpPromise} Future object */ /** * @ngdoc method * @name $http#put * * @description * Shortcut method to perform `PUT` request. * * @param {string} url Relative or absolute URL specifying the destination of the request * @param {*} data Request content * @param {Object=} config Optional configuration object * @returns {HttpPromise} Future object */ /** * @ngdoc method * @name $http#patch * * @description * Shortcut method to perform `PATCH` request. * * @param {string} url Relative or absolute URL specifying the destination of the request * @param {*} data Request content * @param {Object=} config Optional configuration object * @returns {HttpPromise} Future object */ createShortMethodsWithData('post', 'put', 'patch'); /** * @ngdoc property * @name $http#defaults * * @description * Runtime equivalent of the `$httpProvider.defaults` property. Allows configuration of * default headers, withCredentials as well as request and response transformations. * * See "Setting HTTP Headers" and "Transforming Requests and Responses" sections above. */ $http.defaults = defaults; return $http; function createShortMethods(names) { forEach(arguments, function(name) { $http[name] = function(url, config) { return $http(extend(config || {}, { method: name, url: url })); }; }); } function createShortMethodsWithData(name) { forEach(arguments, function(name) { $http[name] = function(url, data, config) { return $http(extend(config || {}, { method: name, url: url, data: data })); }; }); } /** * Makes the request. * * !!! ACCESSES CLOSURE VARS: * $httpBackend, defaults, $log, $rootScope, defaultCache, $http.pendingRequests */ function sendReq(config, reqData) { var deferred = $q.defer(), promise = deferred.promise, cache, cachedResp, reqHeaders = config.headers, url = buildUrl(config.url, config.params); $http.pendingRequests.push(config); promise.then(removePendingReq, removePendingReq); if ((config.cache || defaults.cache) && config.cache !== false && (config.method === 'GET' || config.method === 'JSONP')) { cache = isObject(config.cache) ? config.cache : isObject(defaults.cache) ? defaults.cache : defaultCache; } if (cache) { cachedResp = cache.get(url); if (isDefined(cachedResp)) { if (isPromiseLike(cachedResp)) { // cached request has already been sent, but there is no response yet cachedResp.then(resolvePromiseWithResult, resolvePromiseWithResult); } else { // serving from cache if (isArray(cachedResp)) { resolvePromise(cachedResp[1], cachedResp[0], shallowCopy(cachedResp[2]), cachedResp[3]); } else { resolvePromise(cachedResp, 200, {}, 'OK'); } } } else { // put the promise for the non-transformed response into cache as a placeholder cache.put(url, promise); } } // if we won't have the response in cache, set the xsrf headers and // send the request to the backend if (isUndefined(cachedResp)) { var xsrfValue = urlIsSameOrigin(config.url) ? $browser.cookies()[config.xsrfCookieName || defaults.xsrfCookieName] : undefined; if (xsrfValue) { reqHeaders[(config.xsrfHeaderName || defaults.xsrfHeaderName)] = xsrfValue; } $httpBackend(config.method, url, reqData, done, reqHeaders, config.timeout, config.withCredentials, config.responseType); } return promise; /** * Callback registered to $httpBackend(): * - caches the response if desired * - resolves the raw $http promise * - calls $apply */ function done(status, response, headersString, statusText) { if (cache) { if (isSuccess(status)) { cache.put(url, [status, response, parseHeaders(headersString), statusText]); } else { // remove promise from the cache cache.remove(url); } } function resolveHttpPromise() { resolvePromise(response, status, headersString, statusText); } if (useApplyAsync) { $rootScope.$applyAsync(resolveHttpPromise); } else { resolveHttpPromise(); if (!$rootScope.$$phase) $rootScope.$apply(); } } /** * Resolves the raw $http promise. */ function resolvePromise(response, status, headers, statusText) { // normalize internal statuses to 0 status = Math.max(status, 0); (isSuccess(status) ? deferred.resolve : deferred.reject)({ data: response, status: status, headers: headersGetter(headers), config: config, statusText: statusText }); } function resolvePromiseWithResult(result) { resolvePromise(result.data, result.status, shallowCopy(result.headers()), result.statusText); } function removePendingReq() { var idx = $http.pendingRequests.indexOf(config); if (idx !== -1) $http.pendingRequests.splice(idx, 1); } } function buildUrl(url, params) { if (!params) return url; var parts = []; forEachSorted(params, function(value, key) { if (value === null || isUndefined(value)) return; if (!isArray(value)) value = [value]; forEach(value, function(v) { if (isObject(v)) { if (isDate(v)) { v = v.toISOString(); } else { v = toJson(v); } } parts.push(encodeUriQuery(key) + '=' + encodeUriQuery(v)); }); }); if (parts.length > 0) { url += ((url.indexOf('?') == -1) ? '?' : '&') + parts.join('&'); } return url; } }]; } function createXhr() { return new window.XMLHttpRequest(); } /** * @ngdoc service * @name $httpBackend * @requires $window * @requires $document * * @description * HTTP backend used by the {@link ng.$http service} that delegates to * XMLHttpRequest object or JSONP and deals with browser incompatibilities. * * You should never need to use this service directly, instead use the higher-level abstractions: * {@link ng.$http $http} or {@link ngResource.$resource $resource}. * * During testing this implementation is swapped with {@link ngMock.$httpBackend mock * $httpBackend} which can be trained with responses. */ function $HttpBackendProvider() { this.$get = ['$browser', '$window', '$document', function($browser, $window, $document) { return createHttpBackend($browser, createXhr, $browser.defer, $window.angular.callbacks, $document[0]); }]; } function createHttpBackend($browser, createXhr, $browserDefer, callbacks, rawDocument) { // TODO(vojta): fix the signature return function(method, url, post, callback, headers, timeout, withCredentials, responseType) { $browser.$$incOutstandingRequestCount(); url = url || $browser.url(); if (lowercase(method) == 'jsonp') { var callbackId = '_' + (callbacks.counter++).toString(36); callbacks[callbackId] = function(data) { callbacks[callbackId].data = data; callbacks[callbackId].called = true; }; var jsonpDone = jsonpReq(url.replace('JSON_CALLBACK', 'angular.callbacks.' + callbackId), callbackId, function(status, text) { completeRequest(callback, status, callbacks[callbackId].data, "", text); callbacks[callbackId] = noop; }); } else { var xhr = createXhr(); xhr.open(method, url, true); forEach(headers, function(value, key) { if (isDefined(value)) { xhr.setRequestHeader(key, value); } }); xhr.onload = function requestLoaded() { var statusText = xhr.statusText || ''; // responseText is the old-school way of retrieving response (supported by IE8 & 9) // response/responseType properties were introduced in XHR Level2 spec (supported by IE10) var response = ('response' in xhr) ? xhr.response : xhr.responseText; // normalize IE9 bug (http://bugs.jquery.com/ticket/1450) var status = xhr.status === 1223 ? 204 : xhr.status; // fix status code when it is 0 (0 status is undocumented). // Occurs when accessing file resources or on Android 4.1 stock browser // while retrieving files from application cache. if (status === 0) { status = response ? 200 : urlResolve(url).protocol == 'file' ? 404 : 0; } completeRequest(callback, status, response, xhr.getAllResponseHeaders(), statusText); }; var requestError = function() { // The response is always empty // See https://xhr.spec.whatwg.org/#request-error-steps and https://fetch.spec.whatwg.org/#concept-network-error completeRequest(callback, -1, null, null, ''); }; xhr.onerror = requestError; xhr.onabort = requestError; if (withCredentials) { xhr.withCredentials = true; } if (responseType) { try { xhr.responseType = responseType; } catch (e) { // WebKit added support for the json responseType value on 09/03/2013 // https://bugs.webkit.org/show_bug.cgi?id=73648. Versions of Safari prior to 7 are // known to throw when setting the value "json" as the response type. Other older // browsers implementing the responseType // // The json response type can be ignored if not supported, because JSON payloads are // parsed on the client-side regardless. if (responseType !== 'json') { throw e; } } } xhr.send(post || null); } if (timeout > 0) { var timeoutId = $browserDefer(timeoutRequest, timeout); } else if (isPromiseLike(timeout)) { timeout.then(timeoutRequest); } function timeoutRequest() { jsonpDone && jsonpDone(); xhr && xhr.abort(); } function completeRequest(callback, status, response, headersString, statusText) { // cancel timeout and subsequent timeout promise resolution if (timeoutId !== undefined) { $browserDefer.cancel(timeoutId); } jsonpDone = xhr = null; callback(status, response, headersString, statusText); $browser.$$completeOutstandingRequest(noop); } }; function jsonpReq(url, callbackId, done) { // we can't use jQuery/jqLite here because jQuery does crazy shit with script elements, e.g.: // - fetches local scripts via XHR and evals them // - adds and immediately removes script elements from the document var script = rawDocument.createElement('script'), callback = null; script.type = "text/javascript"; script.src = url; script.async = true; callback = function(event) { removeEventListenerFn(script, "load", callback); removeEventListenerFn(script, "error", callback); rawDocument.body.removeChild(script); script = null; var status = -1; var text = "unknown"; if (event) { if (event.type === "load" && !callbacks[callbackId].called) { event = { type: "error" }; } text = event.type; status = event.type === "error" ? 404 : 200; } if (done) { done(status, text); } }; addEventListenerFn(script, "load", callback); addEventListenerFn(script, "error", callback); rawDocument.body.appendChild(script); return callback; } } var $interpolateMinErr = minErr('$interpolate'); /** * @ngdoc provider * @name $interpolateProvider * * @description * * Used for configuring the interpolation markup. Defaults to `{{` and `}}`. * * @example <example module="customInterpolationApp"> <file name="index.html"> <script> var customInterpolationApp = angular.module('customInterpolationApp', []); customInterpolationApp.config(function($interpolateProvider) { $interpolateProvider.startSymbol('//'); $interpolateProvider.endSymbol('//'); }); customInterpolationApp.controller('DemoController', function() { this.label = "This binding is brought you by // interpolation symbols."; }); </script> <div ng-app="App" ng-controller="DemoController as demo"> //demo.label// </div> </file> <file name="protractor.js" type="protractor"> it('should interpolate binding with custom symbols', function() { expect(element(by.binding('demo.label')).getText()).toBe('This binding is brought you by // interpolation symbols.'); }); </file> </example> */ function $InterpolateProvider() { var startSymbol = '{{'; var endSymbol = '}}'; /** * @ngdoc method * @name $interpolateProvider#startSymbol * @description * Symbol to denote start of expression in the interpolated string. Defaults to `{{`. * * @param {string=} value new value to set the starting symbol to. * @returns {string|self} Returns the symbol when used as getter and self if used as setter. */ this.startSymbol = function(value) { if (value) { startSymbol = value; return this; } else { return startSymbol; } }; /** * @ngdoc method * @name $interpolateProvider#endSymbol * @description * Symbol to denote the end of expression in the interpolated string. Defaults to `}}`. * * @param {string=} value new value to set the ending symbol to. * @returns {string|self} Returns the symbol when used as getter and self if used as setter. */ this.endSymbol = function(value) { if (value) { endSymbol = value; return this; } else { return endSymbol; } }; this.$get = ['$parse', '$exceptionHandler', '$sce', function($parse, $exceptionHandler, $sce) { var startSymbolLength = startSymbol.length, endSymbolLength = endSymbol.length, escapedStartRegexp = new RegExp(startSymbol.replace(/./g, escape), 'g'), escapedEndRegexp = new RegExp(endSymbol.replace(/./g, escape), 'g'); function escape(ch) { return '\\\\\\' + ch; } /** * @ngdoc service * @name $interpolate * @kind function * * @requires $parse * @requires $sce * * @description * * Compiles a string with markup into an interpolation function. This service is used by the * HTML {@link ng.$compile $compile} service for data binding. See * {@link ng.$interpolateProvider $interpolateProvider} for configuring the * interpolation markup. * * * ```js * var $interpolate = ...; // injected * var exp = $interpolate('Hello {{name | uppercase}}!'); * expect(exp({name:'Angular'}).toEqual('Hello ANGULAR!'); * ``` * * `$interpolate` takes an optional fourth argument, `allOrNothing`. If `allOrNothing` is * `true`, the interpolation function will return `undefined` unless all embedded expressions * evaluate to a value other than `undefined`. * * ```js * var $interpolate = ...; // injected * var context = {greeting: 'Hello', name: undefined }; * * // default "forgiving" mode * var exp = $interpolate('{{greeting}} {{name}}!'); * expect(exp(context)).toEqual('Hello !'); * * // "allOrNothing" mode * exp = $interpolate('{{greeting}} {{name}}!', false, null, true); * expect(exp(context)).toBeUndefined(); * context.name = 'Angular'; * expect(exp(context)).toEqual('Hello Angular!'); * ``` * * `allOrNothing` is useful for interpolating URLs. `ngSrc` and `ngSrcset` use this behavior. * * ####Escaped Interpolation * $interpolate provides a mechanism for escaping interpolation markers. Start and end markers * can be escaped by preceding each of their characters with a REVERSE SOLIDUS U+005C (backslash). * It will be rendered as a regular start/end marker, and will not be interpreted as an expression * or binding. * * This enables web-servers to prevent script injection attacks and defacing attacks, to some * degree, while also enabling code examples to work without relying on the * {@link ng.directive:ngNonBindable ngNonBindable} directive. * * **For security purposes, it is strongly encouraged that web servers escape user-supplied data, * replacing angle brackets (&lt;, &gt;) with &amp;lt; and &amp;gt; respectively, and replacing all * interpolation start/end markers with their escaped counterparts.** * * Escaped interpolation markers are only replaced with the actual interpolation markers in rendered * output when the $interpolate service processes the text. So, for HTML elements interpolated * by {@link ng.$compile $compile}, or otherwise interpolated with the `mustHaveExpression` parameter * set to `true`, the interpolated text must contain an unescaped interpolation expression. As such, * this is typically useful only when user-data is used in rendering a template from the server, or * when otherwise untrusted data is used by a directive. * * <example> * <file name="index.html"> * <div ng-init="username='A user'"> * <p ng-init="apptitle='Escaping demo'">{{apptitle}}: \{\{ username = "defaced value"; \}\} * </p> * <p><strong>{{username}}</strong> attempts to inject code which will deface the * application, but fails to accomplish their task, because the server has correctly * escaped the interpolation start/end markers with REVERSE SOLIDUS U+005C (backslash) * characters.</p> * <p>Instead, the result of the attempted script injection is visible, and can be removed * from the database by an administrator.</p> * </div> * </file> * </example> * * @param {string} text The text with markup to interpolate. * @param {boolean=} mustHaveExpression if set to true then the interpolation string must have * embedded expression in order to return an interpolation function. Strings with no * embedded expression will return null for the interpolation function. * @param {string=} trustedContext when provided, the returned function passes the interpolated * result through {@link ng.$sce#getTrusted $sce.getTrusted(interpolatedResult, * trustedContext)} before returning it. Refer to the {@link ng.$sce $sce} service that * provides Strict Contextual Escaping for details. * @param {boolean=} allOrNothing if `true`, then the returned function returns undefined * unless all embedded expressions evaluate to a value other than `undefined`. * @returns {function(context)} an interpolation function which is used to compute the * interpolated string. The function has these parameters: * * - `context`: evaluation context for all expressions embedded in the interpolated text */ function $interpolate(text, mustHaveExpression, trustedContext, allOrNothing) { allOrNothing = !!allOrNothing; var startIndex, endIndex, index = 0, expressions = [], parseFns = [], textLength = text.length, exp, concat = [], expressionPositions = []; while (index < textLength) { if (((startIndex = text.indexOf(startSymbol, index)) != -1) && ((endIndex = text.indexOf(endSymbol, startIndex + startSymbolLength)) != -1)) { if (index !== startIndex) { concat.push(unescapeText(text.substring(index, startIndex))); } exp = text.substring(startIndex + startSymbolLength, endIndex); expressions.push(exp); parseFns.push($parse(exp, parseStringifyInterceptor)); index = endIndex + endSymbolLength; expressionPositions.push(concat.length); concat.push(''); } else { // we did not find an interpolation, so we have to add the remainder to the separators array if (index !== textLength) { concat.push(unescapeText(text.substring(index))); } break; } } // Concatenating expressions makes it hard to reason about whether some combination of // concatenated values are unsafe to use and could easily lead to XSS. By requiring that a // single expression be used for iframe[src], object[src], etc., we ensure that the value // that's used is assigned or constructed by some JS code somewhere that is more testable or // make it obvious that you bound the value to some user controlled value. This helps reduce // the load when auditing for XSS issues. if (trustedContext && concat.length > 1) { throw $interpolateMinErr('noconcat', "Error while interpolating: {0}\nStrict Contextual Escaping disallows " + "interpolations that concatenate multiple expressions when a trusted value is " + "required. See http://docs.angularjs.org/api/ng.$sce", text); } if (!mustHaveExpression || expressions.length) { var compute = function(values) { for (var i = 0, ii = expressions.length; i < ii; i++) { if (allOrNothing && isUndefined(values[i])) return; concat[expressionPositions[i]] = values[i]; } return concat.join(''); }; var getValue = function(value) { return trustedContext ? $sce.getTrusted(trustedContext, value) : $sce.valueOf(value); }; var stringify = function(value) { if (value == null) { // null || undefined return ''; } switch (typeof value) { case 'string': break; case 'number': value = '' + value; break; default: value = toJson(value); } return value; }; return extend(function interpolationFn(context) { var i = 0; var ii = expressions.length; var values = new Array(ii); try { for (; i < ii; i++) { values[i] = parseFns[i](context); } return compute(values); } catch (err) { var newErr = $interpolateMinErr('interr', "Can't interpolate: {0}\n{1}", text, err.toString()); $exceptionHandler(newErr); } }, { // all of these properties are undocumented for now exp: text, //just for compatibility with regular watchers created via $watch expressions: expressions, $$watchDelegate: function(scope, listener, objectEquality) { var lastValue; return scope.$watchGroup(parseFns, function interpolateFnWatcher(values, oldValues) { var currValue = compute(values); if (isFunction(listener)) { listener.call(this, currValue, values !== oldValues ? lastValue : currValue, scope); } lastValue = currValue; }, objectEquality); } }); } function unescapeText(text) { return text.replace(escapedStartRegexp, startSymbol). replace(escapedEndRegexp, endSymbol); } function parseStringifyInterceptor(value) { try { value = getValue(value); return allOrNothing && !isDefined(value) ? value : stringify(value); } catch (err) { var newErr = $interpolateMinErr('interr', "Can't interpolate: {0}\n{1}", text, err.toString()); $exceptionHandler(newErr); } } } /** * @ngdoc method * @name $interpolate#startSymbol * @description * Symbol to denote the start of expression in the interpolated string. Defaults to `{{`. * * Use {@link ng.$interpolateProvider#startSymbol `$interpolateProvider.startSymbol`} to change * the symbol. * * @returns {string} start symbol. */ $interpolate.startSymbol = function() { return startSymbol; }; /** * @ngdoc method * @name $interpolate#endSymbol * @description * Symbol to denote the end of expression in the interpolated string. Defaults to `}}`. * * Use {@link ng.$interpolateProvider#endSymbol `$interpolateProvider.endSymbol`} to change * the symbol. * * @returns {string} end symbol. */ $interpolate.endSymbol = function() { return endSymbol; }; return $interpolate; }]; } function $IntervalProvider() { this.$get = ['$rootScope', '$window', '$q', '$$q', function($rootScope, $window, $q, $$q) { var intervals = {}; /** * @ngdoc service * @name $interval * * @description * Angular's wrapper for `window.setInterval`. The `fn` function is executed every `delay` * milliseconds. * * The return value of registering an interval function is a promise. This promise will be * notified upon each tick of the interval, and will be resolved after `count` iterations, or * run indefinitely if `count` is not defined. The value of the notification will be the * number of iterations that have run. * To cancel an interval, call `$interval.cancel(promise)`. * * In tests you can use {@link ngMock.$interval#flush `$interval.flush(millis)`} to * move forward by `millis` milliseconds and trigger any functions scheduled to run in that * time. * * <div class="alert alert-warning"> * **Note**: Intervals created by this service must be explicitly destroyed when you are finished * with them. In particular they are not automatically destroyed when a controller's scope or a * directive's element are destroyed. * You should take this into consideration and make sure to always cancel the interval at the * appropriate moment. See the example below for more details on how and when to do this. * </div> * * @param {function()} fn A function that should be called repeatedly. * @param {number} delay Number of milliseconds between each function call. * @param {number=} [count=0] Number of times to repeat. If not set, or 0, will repeat * indefinitely. * @param {boolean=} [invokeApply=true] If set to `false` skips model dirty checking, otherwise * will invoke `fn` within the {@link ng.$rootScope.Scope#$apply $apply} block. * @returns {promise} A promise which will be notified on each iteration. * * @example * <example module="intervalExample"> * <file name="index.html"> * <script> * angular.module('intervalExample', []) * .controller('ExampleController', ['$scope', '$interval', * function($scope, $interval) { * $scope.format = 'M/d/yy h:mm:ss a'; * $scope.blood_1 = 100; * $scope.blood_2 = 120; * * var stop; * $scope.fight = function() { * // Don't start a new fight if we are already fighting * if ( angular.isDefined(stop) ) return; * * stop = $interval(function() { * if ($scope.blood_1 > 0 && $scope.blood_2 > 0) { * $scope.blood_1 = $scope.blood_1 - 3; * $scope.blood_2 = $scope.blood_2 - 4; * } else { * $scope.stopFight(); * } * }, 100); * }; * * $scope.stopFight = function() { * if (angular.isDefined(stop)) { * $interval.cancel(stop); * stop = undefined; * } * }; * * $scope.resetFight = function() { * $scope.blood_1 = 100; * $scope.blood_2 = 120; * }; * * $scope.$on('$destroy', function() { * // Make sure that the interval is destroyed too * $scope.stopFight(); * }); * }]) * // Register the 'myCurrentTime' directive factory method. * // We inject $interval and dateFilter service since the factory method is DI. * .directive('myCurrentTime', ['$interval', 'dateFilter', * function($interval, dateFilter) { * // return the directive link function. (compile function not needed) * return function(scope, element, attrs) { * var format, // date format * stopTime; // so that we can cancel the time updates * * // used to update the UI * function updateTime() { * element.text(dateFilter(new Date(), format)); * } * * // watch the expression, and update the UI on change. * scope.$watch(attrs.myCurrentTime, function(value) { * format = value; * updateTime(); * }); * * stopTime = $interval(updateTime, 1000); * * // listen on DOM destroy (removal) event, and cancel the next UI update * // to prevent updating time after the DOM element was removed. * element.on('$destroy', function() { * $interval.cancel(stopTime); * }); * } * }]); * </script> * * <div> * <div ng-controller="ExampleController"> * Date format: <input ng-model="format"> <hr/> * Current time is: <span my-current-time="format"></span> * <hr/> * Blood 1 : <font color='red'>{{blood_1}}</font> * Blood 2 : <font color='red'>{{blood_2}}</font> * <button type="button" data-ng-click="fight()">Fight</button> * <button type="button" data-ng-click="stopFight()">StopFight</button> * <button type="button" data-ng-click="resetFight()">resetFight</button> * </div> * </div> * * </file> * </example> */ function interval(fn, delay, count, invokeApply) { var setInterval = $window.setInterval, clearInterval = $window.clearInterval, iteration = 0, skipApply = (isDefined(invokeApply) && !invokeApply), deferred = (skipApply ? $$q : $q).defer(), promise = deferred.promise; count = isDefined(count) ? count : 0; promise.then(null, null, fn); promise.$$intervalId = setInterval(function tick() { deferred.notify(iteration++); if (count > 0 && iteration >= count) { deferred.resolve(iteration); clearInterval(promise.$$intervalId); delete intervals[promise.$$intervalId]; } if (!skipApply) $rootScope.$apply(); }, delay); intervals[promise.$$intervalId] = deferred; return promise; } /** * @ngdoc method * @name $interval#cancel * * @description * Cancels a task associated with the `promise`. * * @param {promise} promise returned by the `$interval` function. * @returns {boolean} Returns `true` if the task was successfully canceled. */ interval.cancel = function(promise) { if (promise && promise.$$intervalId in intervals) { intervals[promise.$$intervalId].reject('canceled'); $window.clearInterval(promise.$$intervalId); delete intervals[promise.$$intervalId]; return true; } return false; }; return interval; }]; } /** * @ngdoc service * @name $locale * * @description * $locale service provides localization rules for various Angular components. As of right now the * only public api is: * * * `id` – `{string}` – locale id formatted as `languageId-countryId` (e.g. `en-us`) */ function $LocaleProvider() { this.$get = function() { return { id: 'en-us', NUMBER_FORMATS: { DECIMAL_SEP: '.', GROUP_SEP: ',', PATTERNS: [ { // Decimal Pattern minInt: 1, minFrac: 0, maxFrac: 3, posPre: '', posSuf: '', negPre: '-', negSuf: '', gSize: 3, lgSize: 3 },{ //Currency Pattern minInt: 1, minFrac: 2, maxFrac: 2, posPre: '\u00A4', posSuf: '', negPre: '(\u00A4', negSuf: ')', gSize: 3, lgSize: 3 } ], CURRENCY_SYM: '$' }, DATETIME_FORMATS: { MONTH: 'January,February,March,April,May,June,July,August,September,October,November,December' .split(','), SHORTMONTH: 'Jan,Feb,Mar,Apr,May,Jun,Jul,Aug,Sep,Oct,Nov,Dec'.split(','), DAY: 'Sunday,Monday,Tuesday,Wednesday,Thursday,Friday,Saturday'.split(','), SHORTDAY: 'Sun,Mon,Tue,Wed,Thu,Fri,Sat'.split(','), AMPMS: ['AM','PM'], medium: 'MMM d, y h:mm:ss a', 'short': 'M/d/yy h:mm a', fullDate: 'EEEE, MMMM d, y', longDate: 'MMMM d, y', mediumDate: 'MMM d, y', shortDate: 'M/d/yy', mediumTime: 'h:mm:ss a', shortTime: 'h:mm a' }, pluralCat: function(num) { if (num === 1) { return 'one'; } return 'other'; } }; }; } var PATH_MATCH = /^([^\?#]*)(\?([^#]*))?(#(.*))?$/, DEFAULT_PORTS = {'http': 80, 'https': 443, 'ftp': 21}; var $locationMinErr = minErr('$location'); /** * Encode path using encodeUriSegment, ignoring forward slashes * * @param {string} path Path to encode * @returns {string} */ function encodePath(path) { var segments = path.split('/'), i = segments.length; while (i--) { segments[i] = encodeUriSegment(segments[i]); } return segments.join('/'); } function parseAbsoluteUrl(absoluteUrl, locationObj) { var parsedUrl = urlResolve(absoluteUrl); locationObj.$$protocol = parsedUrl.protocol; locationObj.$$host = parsedUrl.hostname; locationObj.$$port = int(parsedUrl.port) || DEFAULT_PORTS[parsedUrl.protocol] || null; } function parseAppUrl(relativeUrl, locationObj) { var prefixed = (relativeUrl.charAt(0) !== '/'); if (prefixed) { relativeUrl = '/' + relativeUrl; } var match = urlResolve(relativeUrl); locationObj.$$path = decodeURIComponent(prefixed && match.pathname.charAt(0) === '/' ? match.pathname.substring(1) : match.pathname); locationObj.$$search = parseKeyValue(match.search); locationObj.$$hash = decodeURIComponent(match.hash); // make sure path starts with '/'; if (locationObj.$$path && locationObj.$$path.charAt(0) != '/') { locationObj.$$path = '/' + locationObj.$$path; } } /** * * @param {string} begin * @param {string} whole * @returns {string} returns text from whole after begin or undefined if it does not begin with * expected string. */ function beginsWith(begin, whole) { if (whole.indexOf(begin) === 0) { return whole.substr(begin.length); } } function stripHash(url) { var index = url.indexOf('#'); return index == -1 ? url : url.substr(0, index); } function trimEmptyHash(url) { return url.replace(/(#.+)|#$/, '$1'); } function stripFile(url) { return url.substr(0, stripHash(url).lastIndexOf('/') + 1); } /* return the server only (scheme://host:port) */ function serverBase(url) { return url.substring(0, url.indexOf('/', url.indexOf('//') + 2)); } /** * LocationHtml5Url represents an url * This object is exposed as $location service when HTML5 mode is enabled and supported * * @constructor * @param {string} appBase application base URL * @param {string} basePrefix url path prefix */ function LocationHtml5Url(appBase, basePrefix) { this.$$html5 = true; basePrefix = basePrefix || ''; var appBaseNoFile = stripFile(appBase); parseAbsoluteUrl(appBase, this); /** * Parse given html5 (regular) url string into properties * @param {string} url HTML5 url * @private */ this.$$parse = function(url) { var pathUrl = beginsWith(appBaseNoFile, url); if (!isString(pathUrl)) { throw $locationMinErr('ipthprfx', 'Invalid url "{0}", missing path prefix "{1}".', url, appBaseNoFile); } parseAppUrl(pathUrl, this); if (!this.$$path) { this.$$path = '/'; } this.$$compose(); }; /** * Compose url and update `absUrl` property * @private */ this.$$compose = function() { var search = toKeyValue(this.$$search), hash = this.$$hash ? '#' + encodeUriSegment(this.$$hash) : ''; this.$$url = encodePath(this.$$path) + (search ? '?' + search : '') + hash; this.$$absUrl = appBaseNoFile + this.$$url.substr(1); // first char is always '/' }; this.$$parseLinkUrl = function(url, relHref) { if (relHref && relHref[0] === '#') { // special case for links to hash fragments: // keep the old url and only replace the hash fragment this.hash(relHref.slice(1)); return true; } var appUrl, prevAppUrl; var rewrittenUrl; if ((appUrl = beginsWith(appBase, url)) !== undefined) { prevAppUrl = appUrl; if ((appUrl = beginsWith(basePrefix, appUrl)) !== undefined) { rewrittenUrl = appBaseNoFile + (beginsWith('/', appUrl) || appUrl); } else { rewrittenUrl = appBase + prevAppUrl; } } else if ((appUrl = beginsWith(appBaseNoFile, url)) !== undefined) { rewrittenUrl = appBaseNoFile + appUrl; } else if (appBaseNoFile == url + '/') { rewrittenUrl = appBaseNoFile; } if (rewrittenUrl) { this.$$parse(rewrittenUrl); } return !!rewrittenUrl; }; } /** * LocationHashbangUrl represents url * This object is exposed as $location service when developer doesn't opt into html5 mode. * It also serves as the base class for html5 mode fallback on legacy browsers. * * @constructor * @param {string} appBase application base URL * @param {string} hashPrefix hashbang prefix */ function LocationHashbangUrl(appBase, hashPrefix) { var appBaseNoFile = stripFile(appBase); parseAbsoluteUrl(appBase, this); /** * Parse given hashbang url into properties * @param {string} url Hashbang url * @private */ this.$$parse = function(url) { var withoutBaseUrl = beginsWith(appBase, url) || beginsWith(appBaseNoFile, url); var withoutHashUrl; if (withoutBaseUrl.charAt(0) === '#') { // The rest of the url starts with a hash so we have // got either a hashbang path or a plain hash fragment withoutHashUrl = beginsWith(hashPrefix, withoutBaseUrl); if (isUndefined(withoutHashUrl)) { // There was no hashbang prefix so we just have a hash fragment withoutHashUrl = withoutBaseUrl; } } else { // There was no hashbang path nor hash fragment: // If we are in HTML5 mode we use what is left as the path; // Otherwise we ignore what is left withoutHashUrl = this.$$html5 ? withoutBaseUrl : ''; } parseAppUrl(withoutHashUrl, this); this.$$path = removeWindowsDriveName(this.$$path, withoutHashUrl, appBase); this.$$compose(); /* * In Windows, on an anchor node on documents loaded from * the filesystem, the browser will return a pathname * prefixed with the drive name ('/C:/path') when a * pathname without a drive is set: * * a.setAttribute('href', '/foo') * * a.pathname === '/C:/foo' //true * * Inside of Angular, we're always using pathnames that * do not include drive names for routing. */ function removeWindowsDriveName(path, url, base) { /* Matches paths for file protocol on windows, such as /C:/foo/bar, and captures only /foo/bar. */ var windowsFilePathExp = /^\/[A-Z]:(\/.*)/; var firstPathSegmentMatch; //Get the relative path from the input URL. if (url.indexOf(base) === 0) { url = url.replace(base, ''); } // The input URL intentionally contains a first path segment that ends with a colon. if (windowsFilePathExp.exec(url)) { return path; } firstPathSegmentMatch = windowsFilePathExp.exec(path); return firstPathSegmentMatch ? firstPathSegmentMatch[1] : path; } }; /** * Compose hashbang url and update `absUrl` property * @private */ this.$$compose = function() { var search = toKeyValue(this.$$search), hash = this.$$hash ? '#' + encodeUriSegment(this.$$hash) : ''; this.$$url = encodePath(this.$$path) + (search ? '?' + search : '') + hash; this.$$absUrl = appBase + (this.$$url ? hashPrefix + this.$$url : ''); }; this.$$parseLinkUrl = function(url, relHref) { if (stripHash(appBase) == stripHash(url)) { this.$$parse(url); return true; } return false; }; } /** * LocationHashbangUrl represents url * This object is exposed as $location service when html5 history api is enabled but the browser * does not support it. * * @constructor * @param {string} appBase application base URL * @param {string} hashPrefix hashbang prefix */ function LocationHashbangInHtml5Url(appBase, hashPrefix) { this.$$html5 = true; LocationHashbangUrl.apply(this, arguments); var appBaseNoFile = stripFile(appBase); this.$$parseLinkUrl = function(url, relHref) { if (relHref && relHref[0] === '#') { // special case for links to hash fragments: // keep the old url and only replace the hash fragment this.hash(relHref.slice(1)); return true; } var rewrittenUrl; var appUrl; if (appBase == stripHash(url)) { rewrittenUrl = url; } else if ((appUrl = beginsWith(appBaseNoFile, url))) { rewrittenUrl = appBase + hashPrefix + appUrl; } else if (appBaseNoFile === url + '/') { rewrittenUrl = appBaseNoFile; } if (rewrittenUrl) { this.$$parse(rewrittenUrl); } return !!rewrittenUrl; }; this.$$compose = function() { var search = toKeyValue(this.$$search), hash = this.$$hash ? '#' + encodeUriSegment(this.$$hash) : ''; this.$$url = encodePath(this.$$path) + (search ? '?' + search : '') + hash; // include hashPrefix in $$absUrl when $$url is empty so IE8 & 9 do not reload page because of removal of '#' this.$$absUrl = appBase + hashPrefix + this.$$url; }; } var locationPrototype = { /** * Are we in html5 mode? * @private */ $$html5: false, /** * Has any change been replacing? * @private */ $$replace: false, /** * @ngdoc method * @name $location#absUrl * * @description * This method is getter only. * * Return full url representation with all segments encoded according to rules specified in * [RFC 3986](http://www.ietf.org/rfc/rfc3986.txt). * * * ```js * // given url http://example.com/#/some/path?foo=bar&baz=xoxo * var absUrl = $location.absUrl(); * // => "http://example.com/#/some/path?foo=bar&baz=xoxo" * ``` * * @return {string} full url */ absUrl: locationGetter('$$absUrl'), /** * @ngdoc method * @name $location#url * * @description * This method is getter / setter. * * Return url (e.g. `/path?a=b#hash`) when called without any parameter. * * Change path, search and hash, when called with parameter and return `$location`. * * * ```js * // given url http://example.com/#/some/path?foo=bar&baz=xoxo * var url = $location.url(); * // => "/some/path?foo=bar&baz=xoxo" * ``` * * @param {string=} url New url without base prefix (e.g. `/path?a=b#hash`) * @return {string} url */ url: function(url) { if (isUndefined(url)) return this.$$url; var match = PATH_MATCH.exec(url); if (match[1] || url === '') this.path(decodeURIComponent(match[1])); if (match[2] || match[1] || url === '') this.search(match[3] || ''); this.hash(match[5] || ''); return this; }, /** * @ngdoc method * @name $location#protocol * * @description * This method is getter only. * * Return protocol of current url. * * * ```js * // given url http://example.com/#/some/path?foo=bar&baz=xoxo * var protocol = $location.protocol(); * // => "http" * ``` * * @return {string} protocol of current url */ protocol: locationGetter('$$protocol'), /** * @ngdoc method * @name $location#host * * @description * This method is getter only. * * Return host of current url. * * * ```js * // given url http://example.com/#/some/path?foo=bar&baz=xoxo * var host = $location.host(); * // => "example.com" * ``` * * @return {string} host of current url. */ host: locationGetter('$$host'), /** * @ngdoc method * @name $location#port * * @description * This method is getter only. * * Return port of current url. * * * ```js * // given url http://example.com/#/some/path?foo=bar&baz=xoxo * var port = $location.port(); * // => 80 * ``` * * @return {Number} port */ port: locationGetter('$$port'), /** * @ngdoc method * @name $location#path * * @description * This method is getter / setter. * * Return path of current url when called without any parameter. * * Change path when called with parameter and return `$location`. * * Note: Path should always begin with forward slash (/), this method will add the forward slash * if it is missing. * * * ```js * // given url http://example.com/#/some/path?foo=bar&baz=xoxo * var path = $location.path(); * // => "/some/path" * ``` * * @param {(string|number)=} path New path * @return {string} path */ path: locationGetterSetter('$$path', function(path) { path = path !== null ? path.toString() : ''; return path.charAt(0) == '/' ? path : '/' + path; }), /** * @ngdoc method * @name $location#search * * @description * This method is getter / setter. * * Return search part (as object) of current url when called without any parameter. * * Change search part when called with parameter and return `$location`. * * * ```js * // given url http://example.com/#/some/path?foo=bar&baz=xoxo * var searchObject = $location.search(); * // => {foo: 'bar', baz: 'xoxo'} * * // set foo to 'yipee' * $location.search('foo', 'yipee'); * // $location.search() => {foo: 'yipee', baz: 'xoxo'} * ``` * * @param {string|Object.<string>|Object.<Array.<string>>} search New search params - string or * hash object. * * When called with a single argument the method acts as a setter, setting the `search` component * of `$location` to the specified value. * * If the argument is a hash object containing an array of values, these values will be encoded * as duplicate search parameters in the url. * * @param {(string|Number|Array<string>|boolean)=} paramValue If `search` is a string or number, then `paramValue` * will override only a single search property. * * If `paramValue` is an array, it will override the property of the `search` component of * `$location` specified via the first argument. * * If `paramValue` is `null`, the property specified via the first argument will be deleted. * * If `paramValue` is `true`, the property specified via the first argument will be added with no * value nor trailing equal sign. * * @return {Object} If called with no arguments returns the parsed `search` object. If called with * one or more arguments returns `$location` object itself. */ search: function(search, paramValue) { switch (arguments.length) { case 0: return this.$$search; case 1: if (isString(search) || isNumber(search)) { search = search.toString(); this.$$search = parseKeyValue(search); } else if (isObject(search)) { search = copy(search, {}); // remove object undefined or null properties forEach(search, function(value, key) { if (value == null) delete search[key]; }); this.$$search = search; } else { throw $locationMinErr('isrcharg', 'The first argument of the `$location#search()` call must be a string or an object.'); } break; default: if (isUndefined(paramValue) || paramValue === null) { delete this.$$search[search]; } else { this.$$search[search] = paramValue; } } this.$$compose(); return this; }, /** * @ngdoc method * @name $location#hash * * @description * This method is getter / setter. * * Return hash fragment when called without any parameter. * * Change hash fragment when called with parameter and return `$location`. * * * ```js * // given url http://example.com/#/some/path?foo=bar&baz=xoxo#hashValue * var hash = $location.hash(); * // => "hashValue" * ``` * * @param {(string|number)=} hash New hash fragment * @return {string} hash */ hash: locationGetterSetter('$$hash', function(hash) { return hash !== null ? hash.toString() : ''; }), /** * @ngdoc method * @name $location#replace * * @description * If called, all changes to $location during current `$digest` will be replacing current history * record, instead of adding new one. */ replace: function() { this.$$replace = true; return this; } }; forEach([LocationHashbangInHtml5Url, LocationHashbangUrl, LocationHtml5Url], function(Location) { Location.prototype = Object.create(locationPrototype); /** * @ngdoc method * @name $location#state * * @description * This method is getter / setter. * * Return the history state object when called without any parameter. * * Change the history state object when called with one parameter and return `$location`. * The state object is later passed to `pushState` or `replaceState`. * * NOTE: This method is supported only in HTML5 mode and only in browsers supporting * the HTML5 History API (i.e. methods `pushState` and `replaceState`). If you need to support * older browsers (like IE9 or Android < 4.0), don't use this method. * * @param {object=} state State object for pushState or replaceState * @return {object} state */ Location.prototype.state = function(state) { if (!arguments.length) return this.$$state; if (Location !== LocationHtml5Url || !this.$$html5) { throw $locationMinErr('nostate', 'History API state support is available only ' + 'in HTML5 mode and only in browsers supporting HTML5 History API'); } // The user might modify `stateObject` after invoking `$location.state(stateObject)` // but we're changing the $$state reference to $browser.state() during the $digest // so the modification window is narrow. this.$$state = isUndefined(state) ? null : state; return this; }; }); function locationGetter(property) { return function() { return this[property]; }; } function locationGetterSetter(property, preprocess) { return function(value) { if (isUndefined(value)) return this[property]; this[property] = preprocess(value); this.$$compose(); return this; }; } /** * @ngdoc service * @name $location * * @requires $rootElement * * @description * The $location service parses the URL in the browser address bar (based on the * [window.location](https://developer.mozilla.org/en/window.location)) and makes the URL * available to your application. Changes to the URL in the address bar are reflected into * $location service and changes to $location are reflected into the browser address bar. * * **The $location service:** * * - Exposes the current URL in the browser address bar, so you can * - Watch and observe the URL. * - Change the URL. * - Synchronizes the URL with the browser when the user * - Changes the address bar. * - Clicks the back or forward button (or clicks a History link). * - Clicks on a link. * - Represents the URL object as a set of methods (protocol, host, port, path, search, hash). * * For more information see {@link guide/$location Developer Guide: Using $location} */ /** * @ngdoc provider * @name $locationProvider * @description * Use the `$locationProvider` to configure how the application deep linking paths are stored. */ function $LocationProvider() { var hashPrefix = '', html5Mode = { enabled: false, requireBase: true, rewriteLinks: true }; /** * @ngdoc method * @name $locationProvider#hashPrefix * @description * @param {string=} prefix Prefix for hash part (containing path and search) * @returns {*} current value if used as getter or itself (chaining) if used as setter */ this.hashPrefix = function(prefix) { if (isDefined(prefix)) { hashPrefix = prefix; return this; } else { return hashPrefix; } }; /** * @ngdoc method * @name $locationProvider#html5Mode * @description * @param {(boolean|Object)=} mode If boolean, sets `html5Mode.enabled` to value. * If object, sets `enabled`, `requireBase` and `rewriteLinks` to respective values. Supported * properties: * - **enabled** – `{boolean}` – (default: false) If true, will rely on `history.pushState` to * change urls where supported. Will fall back to hash-prefixed paths in browsers that do not * support `pushState`. * - **requireBase** - `{boolean}` - (default: `true`) When html5Mode is enabled, specifies * whether or not a <base> tag is required to be present. If `enabled` and `requireBase` are * true, and a base tag is not present, an error will be thrown when `$location` is injected. * See the {@link guide/$location $location guide for more information} * - **rewriteLinks** - `{boolean}` - (default: `true`) When html5Mode is enabled, * enables/disables url rewriting for relative links. * * @returns {Object} html5Mode object if used as getter or itself (chaining) if used as setter */ this.html5Mode = function(mode) { if (isBoolean(mode)) { html5Mode.enabled = mode; return this; } else if (isObject(mode)) { if (isBoolean(mode.enabled)) { html5Mode.enabled = mode.enabled; } if (isBoolean(mode.requireBase)) { html5Mode.requireBase = mode.requireBase; } if (isBoolean(mode.rewriteLinks)) { html5Mode.rewriteLinks = mode.rewriteLinks; } return this; } else { return html5Mode; } }; /** * @ngdoc event * @name $location#$locationChangeStart * @eventType broadcast on root scope * @description * Broadcasted before a URL will change. * * This change can be prevented by calling * `preventDefault` method of the event. See {@link ng.$rootScope.Scope#$on} for more * details about event object. Upon successful change * {@link ng.$location#$locationChangeSuccess $locationChangeSuccess} is fired. * * The `newState` and `oldState` parameters may be defined only in HTML5 mode and when * the browser supports the HTML5 History API. * * @param {Object} angularEvent Synthetic event object. * @param {string} newUrl New URL * @param {string=} oldUrl URL that was before it was changed. * @param {string=} newState New history state object * @param {string=} oldState History state object that was before it was changed. */ /** * @ngdoc event * @name $location#$locationChangeSuccess * @eventType broadcast on root scope * @description * Broadcasted after a URL was changed. * * The `newState` and `oldState` parameters may be defined only in HTML5 mode and when * the browser supports the HTML5 History API. * * @param {Object} angularEvent Synthetic event object. * @param {string} newUrl New URL * @param {string=} oldUrl URL that was before it was changed. * @param {string=} newState New history state object * @param {string=} oldState History state object that was before it was changed. */ this.$get = ['$rootScope', '$browser', '$sniffer', '$rootElement', '$window', function($rootScope, $browser, $sniffer, $rootElement, $window) { var $location, LocationMode, baseHref = $browser.baseHref(), // if base[href] is undefined, it defaults to '' initialUrl = $browser.url(), appBase; if (html5Mode.enabled) { if (!baseHref && html5Mode.requireBase) { throw $locationMinErr('nobase', "$location in HTML5 mode requires a <base> tag to be present!"); } appBase = serverBase(initialUrl) + (baseHref || '/'); LocationMode = $sniffer.history ? LocationHtml5Url : LocationHashbangInHtml5Url; } else { appBase = stripHash(initialUrl); LocationMode = LocationHashbangUrl; } $location = new LocationMode(appBase, '#' + hashPrefix); $location.$$parseLinkUrl(initialUrl, initialUrl); debugger; if($browser && $browser.state){ console.log(999999999999999999999999999999999999999999999999999999999); $location.$$state = $browser.state(); } var IGNORE_URI_REGEXP = /^\s*(javascript|mailto):/i; function setBrowserUrlWithFallback(url, replace, state) { var oldUrl = $location.url(); var oldState = $location.$$state; try { $browser.url(url, replace, state); // Make sure $location.state() returns referentially identical (not just deeply equal) // state object; this makes possible quick checking if the state changed in the digest // loop. Checking deep equality would be too expensive. $location.$$state = $browser.state(); } catch (e) { // Restore old values if pushState fails $location.url(oldUrl); $location.$$state = oldState; throw e; } } $rootElement.on('click', function(event) { // TODO(vojta): rewrite link when opening in new tab/window (in legacy browser) // currently we open nice url link and redirect then if (!html5Mode.rewriteLinks || event.ctrlKey || event.metaKey || event.shiftKey || event.which == 2 || event.button == 2) return; var elm = jqLite(event.target); // traverse the DOM up to find first A tag while (nodeName_(elm[0]) !== 'a') { // ignore rewriting if no A tag (reached root element, or no parent - removed from document) if (elm[0] === $rootElement[0] || !(elm = elm.parent())[0]) return; } var absHref = elm.prop('href'); // get the actual href attribute - see // http://msdn.microsoft.com/en-us/library/ie/dd347148(v=vs.85).aspx var relHref = elm.attr('href') || elm.attr('xlink:href'); if (isObject(absHref) && absHref.toString() === '[object SVGAnimatedString]') { // SVGAnimatedString.animVal should be identical to SVGAnimatedString.baseVal, unless during // an animation. absHref = urlResolve(absHref.animVal).href; } // Ignore when url is started with javascript: or mailto: if (IGNORE_URI_REGEXP.test(absHref)) return; if (absHref && !elm.attr('target') && !event.isDefaultPrevented()) { if ($location.$$parseLinkUrl(absHref, relHref)) { // We do a preventDefault for all urls that are part of the angular application, // in html5mode and also without, so that we are able to abort navigation without // getting double entries in the location history. event.preventDefault(); // update location manually if ($location.absUrl() != $browser.url()) { $rootScope.$apply(); // hack to work around FF6 bug 684208 when scenario runner clicks on links $window.angular['ff-684208-preventDefault'] = true; } } } }); // rewrite hashbang url <> html5 url if ($location.absUrl() != initialUrl) { $browser.url($location.absUrl(), true); } var initializing = true; // update $location when $browser url changes $browser.onUrlChange(function(newUrl, newState) { $rootScope.$evalAsync(function() { var oldUrl = $location.absUrl(); var oldState = $location.$$state; var defaultPrevented; $location.$$parse(newUrl); $location.$$state = newState; defaultPrevented = $rootScope.$broadcast('$locationChangeStart', newUrl, oldUrl, newState, oldState).defaultPrevented; // if the location was changed by a `$locationChangeStart` handler then stop // processing this location change if ($location.absUrl() !== newUrl) return; if (defaultPrevented) { $location.$$parse(oldUrl); $location.$$state = oldState; setBrowserUrlWithFallback(oldUrl, false, oldState); } else { initializing = false; afterLocationChange(oldUrl, oldState); } }); if (!$rootScope.$$phase) $rootScope.$digest(); }); // update browser $rootScope.$watch(function $locationWatch() { var oldUrl = trimEmptyHash($browser.url()); var newUrl = trimEmptyHash($location.absUrl()); var oldState = $browser.state(); var currentReplace = $location.$$replace; var urlOrStateChanged = oldUrl !== newUrl || ($location.$$html5 && $sniffer.history && oldState !== $location.$$state); if (initializing || urlOrStateChanged) { initializing = false; $rootScope.$evalAsync(function() { var newUrl = $location.absUrl(); var defaultPrevented = $rootScope.$broadcast('$locationChangeStart', newUrl, oldUrl, $location.$$state, oldState).defaultPrevented; // if the location was changed by a `$locationChangeStart` handler then stop // processing this location change if ($location.absUrl() !== newUrl) return; if (defaultPrevented) { $location.$$parse(oldUrl); $location.$$state = oldState; } else { if (urlOrStateChanged) { setBrowserUrlWithFallback(newUrl, currentReplace, oldState === $location.$$state ? null : $location.$$state); } afterLocationChange(oldUrl, oldState); } }); } $location.$$replace = false; // we don't need to return anything because $evalAsync will make the digest loop dirty when // there is a change }); return $location; function afterLocationChange(oldUrl, oldState) { $rootScope.$broadcast('$locationChangeSuccess', $location.absUrl(), oldUrl, $location.$$state, oldState); } }]; } /** * @ngdoc service * @name $log * @requires $window * * @description * Simple service for logging. Default implementation safely writes the message * into the browser's console (if present). * * The main purpose of this service is to simplify debugging and troubleshooting. * * The default is to log `debug` messages. You can use * {@link ng.$logProvider ng.$logProvider#debugEnabled} to change this. * * @example <example module="logExample"> <file name="script.js"> angular.module('logExample', []) .controller('LogController', ['$scope', '$log', function($scope, $log) { $scope.$log = $log; $scope.message = 'Hello World!'; }]); </file> <file name="index.html"> <div ng-controller="LogController"> <p>Reload this page with open console, enter text and hit the log button...</p> Message: <input type="text" ng-model="message"/> <button ng-click="$log.log(message)">log</button> <button ng-click="$log.warn(message)">warn</button> <button ng-click="$log.info(message)">info</button> <button ng-click="$log.error(message)">error</button> </div> </file> </example> */ /** * @ngdoc provider * @name $logProvider * @description * Use the `$logProvider` to configure how the application logs messages */ function $LogProvider() { var debug = true, self = this; /** * @ngdoc method * @name $logProvider#debugEnabled * @description * @param {boolean=} flag enable or disable debug level messages * @returns {*} current value if used as getter or itself (chaining) if used as setter */ this.debugEnabled = function(flag) { if (isDefined(flag)) { debug = flag; return this; } else { return debug; } }; this.$get = ['$window', function($window) { return { /** * @ngdoc method * @name $log#log * * @description * Write a log message */ log: consoleLog('log'), /** * @ngdoc method * @name $log#info * * @description * Write an information message */ info: consoleLog('info'), /** * @ngdoc method * @name $log#warn * * @description * Write a warning message */ warn: consoleLog('warn'), /** * @ngdoc method * @name $log#error * * @description * Write an error message */ error: consoleLog('error'), /** * @ngdoc method * @name $log#debug * * @description * Write a debug message */ debug: (function() { var fn = consoleLog('debug'); return function() { if (debug) { fn.apply(self, arguments); } }; }()) }; function formatError(arg) { if (arg instanceof Error) { if (arg.stack) { arg = (arg.message && arg.stack.indexOf(arg.message) === -1) ? 'Error: ' + arg.message + '\n' + arg.stack : arg.stack; } else if (arg.sourceURL) { arg = arg.message + '\n' + arg.sourceURL + ':' + arg.line; } } return arg; } function consoleLog(type) { var console = $window.console || {}, logFn = console[type] || console.log || noop, hasApply = false; // Note: reading logFn.apply throws an error in IE11 in IE8 document mode. // The reason behind this is that console.log has type "object" in IE8... try { hasApply = !!logFn.apply; } catch (e) {} if (hasApply) { return function() { var args = []; forEach(arguments, function(arg) { args.push(formatError(arg)); }); return logFn.apply(console, args); }; } // we are IE which either doesn't have window.console => this is noop and we do nothing, // or we are IE where console.log doesn't have apply so we log at least first 2 args return function(arg1, arg2) { logFn(arg1, arg2 == null ? '' : arg2); }; } }]; } var $parseMinErr = minErr('$parse'); // Sandboxing Angular Expressions // ------------------------------ // Angular expressions are generally considered safe because these expressions only have direct // access to `$scope` and locals. However, one can obtain the ability to execute arbitrary JS code by // obtaining a reference to native JS functions such as the Function constructor. // // As an example, consider the following Angular expression: // // {}.toString.constructor('alert("evil JS code")') // // This sandboxing technique is not perfect and doesn't aim to be. The goal is to prevent exploits // against the expression language, but not to prevent exploits that were enabled by exposing // sensitive JavaScript or browser APIs on Scope. Exposing such objects on a Scope is never a good // practice and therefore we are not even trying to protect against interaction with an object // explicitly exposed in this way. // // In general, it is not possible to access a Window object from an angular expression unless a // window or some DOM object that has a reference to window is published onto a Scope. // Similarly we prevent invocations of function known to be dangerous, as well as assignments to // native objects. // // See https://docs.angularjs.org/guide/security function ensureSafeMemberName(name, fullExpression) { if (name === "__defineGetter__" || name === "__defineSetter__" || name === "__lookupGetter__" || name === "__lookupSetter__" || name === "__proto__") { throw $parseMinErr('isecfld', 'Attempting to access a disallowed field in Angular expressions! ' + 'Expression: {0}', fullExpression); } return name; } function ensureSafeObject(obj, fullExpression) { // nifty check if obj is Function that is fast and works across iframes and other contexts if (obj) { if (obj.constructor === obj) { throw $parseMinErr('isecfn', 'Referencing Function in Angular expressions is disallowed! Expression: {0}', fullExpression); } else if (// isWindow(obj) obj.window === obj) { throw $parseMinErr('isecwindow', 'Referencing the Window in Angular expressions is disallowed! Expression: {0}', fullExpression); } else if (// isElement(obj) obj.children && (obj.nodeName || (obj.prop && obj.attr && obj.find))) { throw $parseMinErr('isecdom', 'Referencing DOM nodes in Angular expressions is disallowed! Expression: {0}', fullExpression); } else if (// block Object so that we can't get hold of dangerous Object.* methods obj === Object) { throw $parseMinErr('isecobj', 'Referencing Object in Angular expressions is disallowed! Expression: {0}', fullExpression); } } return obj; } var CALL = Function.prototype.call; var APPLY = Function.prototype.apply; var BIND = Function.prototype.bind; function ensureSafeFunction(obj, fullExpression) { if (obj) { if (obj.constructor === obj) { throw $parseMinErr('isecfn', 'Referencing Function in Angular expressions is disallowed! Expression: {0}', fullExpression); } else if (obj === CALL || obj === APPLY || obj === BIND) { throw $parseMinErr('isecff', 'Referencing call, apply or bind in Angular expressions is disallowed! Expression: {0}', fullExpression); } } } //Keyword constants var CONSTANTS = createMap(); forEach({ 'null': function() { return null; }, 'true': function() { return true; }, 'false': function() { return false; }, 'undefined': function() {} }, function(constantGetter, name) { constantGetter.constant = constantGetter.literal = constantGetter.sharedGetter = true; CONSTANTS[name] = constantGetter; }); //Not quite a constant, but can be lex/parsed the same CONSTANTS['this'] = function(self) { return self; }; CONSTANTS['this'].sharedGetter = true; //Operators - will be wrapped by binaryFn/unaryFn/assignment/filter var OPERATORS = extend(createMap(), { '+':function(self, locals, a, b) { a=a(self, locals); b=b(self, locals); if (isDefined(a)) { if (isDefined(b)) { return a + b; } return a; } return isDefined(b) ? b : undefined;}, '-':function(self, locals, a, b) { a=a(self, locals); b=b(self, locals); return (isDefined(a) ? a : 0) - (isDefined(b) ? b : 0); }, '*':function(self, locals, a, b) {return a(self, locals) * b(self, locals);}, '/':function(self, locals, a, b) {return a(self, locals) / b(self, locals);}, '%':function(self, locals, a, b) {return a(self, locals) % b(self, locals);}, '===':function(self, locals, a, b) {return a(self, locals) === b(self, locals);}, '!==':function(self, locals, a, b) {return a(self, locals) !== b(self, locals);}, '==':function(self, locals, a, b) {return a(self, locals) == b(self, locals);}, '!=':function(self, locals, a, b) {return a(self, locals) != b(self, locals);}, '<':function(self, locals, a, b) {return a(self, locals) < b(self, locals);}, '>':function(self, locals, a, b) {return a(self, locals) > b(self, locals);}, '<=':function(self, locals, a, b) {return a(self, locals) <= b(self, locals);}, '>=':function(self, locals, a, b) {return a(self, locals) >= b(self, locals);}, '&&':function(self, locals, a, b) {return a(self, locals) && b(self, locals);}, '||':function(self, locals, a, b) {return a(self, locals) || b(self, locals);}, '!':function(self, locals, a) {return !a(self, locals);}, //Tokenized as operators but parsed as assignment/filters '=':true, '|':true }); var ESCAPE = {"n":"\n", "f":"\f", "r":"\r", "t":"\t", "v":"\v", "'":"'", '"':'"'}; ///////////////////////////////////////// /** * @constructor */ var Lexer = function(options) { this.options = options; }; Lexer.prototype = { constructor: Lexer, lex: function(text) { this.text = text; this.index = 0; this.tokens = []; while (this.index < this.text.length) { var ch = this.text.charAt(this.index); if (ch === '"' || ch === "'") { this.readString(ch); } else if (this.isNumber(ch) || ch === '.' && this.isNumber(this.peek())) { this.readNumber(); } else if (this.isIdent(ch)) { this.readIdent(); } else if (this.is(ch, '(){}[].,;:?')) { this.tokens.push({index: this.index, text: ch}); this.index++; } else if (this.isWhitespace(ch)) { this.index++; } else { var ch2 = ch + this.peek(); var ch3 = ch2 + this.peek(2); var op1 = OPERATORS[ch]; var op2 = OPERATORS[ch2]; var op3 = OPERATORS[ch3]; if (op1 || op2 || op3) { var token = op3 ? ch3 : (op2 ? ch2 : ch); this.tokens.push({index: this.index, text: token, operator: true}); this.index += token.length; } else { this.throwError('Unexpected next character ', this.index, this.index + 1); } } } return this.tokens; }, is: function(ch, chars) { return chars.indexOf(ch) !== -1; }, peek: function(i) { var num = i || 1; return (this.index + num < this.text.length) ? this.text.charAt(this.index + num) : false; }, isNumber: function(ch) { return ('0' <= ch && ch <= '9') && typeof ch === "string"; }, isWhitespace: function(ch) { // IE treats non-breaking space as \u00A0 return (ch === ' ' || ch === '\r' || ch === '\t' || ch === '\n' || ch === '\v' || ch === '\u00A0'); }, isIdent: function(ch) { return ('a' <= ch && ch <= 'z' || 'A' <= ch && ch <= 'Z' || '_' === ch || ch === '$'); }, isExpOperator: function(ch) { return (ch === '-' || ch === '+' || this.isNumber(ch)); }, throwError: function(error, start, end) { end = end || this.index; var colStr = (isDefined(start) ? 's ' + start + '-' + this.index + ' [' + this.text.substring(start, end) + ']' : ' ' + end); throw $parseMinErr('lexerr', 'Lexer Error: {0} at column{1} in expression [{2}].', error, colStr, this.text); }, readNumber: function() { var number = ''; var start = this.index; while (this.index < this.text.length) { var ch = lowercase(this.text.charAt(this.index)); if (ch == '.' || this.isNumber(ch)) { number += ch; } else { var peekCh = this.peek(); if (ch == 'e' && this.isExpOperator(peekCh)) { number += ch; } else if (this.isExpOperator(ch) && peekCh && this.isNumber(peekCh) && number.charAt(number.length - 1) == 'e') { number += ch; } else if (this.isExpOperator(ch) && (!peekCh || !this.isNumber(peekCh)) && number.charAt(number.length - 1) == 'e') { this.throwError('Invalid exponent'); } else { break; } } this.index++; } this.tokens.push({ index: start, text: number, constant: true, value: Number(number) }); }, readIdent: function() { var start = this.index; while (this.index < this.text.length) { var ch = this.text.charAt(this.index); if (!(this.isIdent(ch) || this.isNumber(ch))) { break; } this.index++; } this.tokens.push({ index: start, text: this.text.slice(start, this.index), identifier: true }); }, readString: function(quote) { var start = this.index; this.index++; var string = ''; var rawString = quote; var escape = false; while (this.index < this.text.length) { var ch = this.text.charAt(this.index); rawString += ch; if (escape) { if (ch === 'u') { var hex = this.text.substring(this.index + 1, this.index + 5); if (!hex.match(/[\da-f]{4}/i)) this.throwError('Invalid unicode escape [\\u' + hex + ']'); this.index += 4; string += String.fromCharCode(parseInt(hex, 16)); } else { var rep = ESCAPE[ch]; string = string + (rep || ch); } escape = false; } else if (ch === '\\') { escape = true; } else if (ch === quote) { this.index++; this.tokens.push({ index: start, text: rawString, constant: true, value: string }); return; } else { string += ch; } this.index++; } this.throwError('Unterminated quote', start); } }; function isConstant(exp) { return exp.constant; } /** * @constructor */ var Parser = function(lexer, $filter, options) { this.lexer = lexer; this.$filter = $filter; this.options = options; }; Parser.ZERO = extend(function() { return 0; }, { sharedGetter: true, constant: true }); Parser.prototype = { constructor: Parser, parse: function(text) { this.text = text; this.tokens = this.lexer.lex(text); var value = this.statements(); if (this.tokens.length !== 0) { this.throwError('is an unexpected token', this.tokens[0]); } value.literal = !!value.literal; value.constant = !!value.constant; return value; }, primary: function() { var primary; if (this.expect('(')) { primary = this.filterChain(); this.consume(')'); } else if (this.expect('[')) { primary = this.arrayDeclaration(); } else if (this.expect('{')) { primary = this.object(); } else if (this.peek().identifier && this.peek().text in CONSTANTS) { primary = CONSTANTS[this.consume().text]; } else if (this.peek().identifier) { primary = this.identifier(); } else if (this.peek().constant) { primary = this.constant(); } else { this.throwError('not a primary expression', this.peek()); } var next, context; while ((next = this.expect('(', '[', '.'))) { if (next.text === '(') { primary = this.functionCall(primary, context); context = null; } else if (next.text === '[') { context = primary; primary = this.objectIndex(primary); } else if (next.text === '.') { context = primary; primary = this.fieldAccess(primary); } else { this.throwError('IMPOSSIBLE'); } } return primary; }, throwError: function(msg, token) { throw $parseMinErr('syntax', 'Syntax Error: Token \'{0}\' {1} at column {2} of the expression [{3}] starting at [{4}].', token.text, msg, (token.index + 1), this.text, this.text.substring(token.index)); }, peekToken: function() { if (this.tokens.length === 0) throw $parseMinErr('ueoe', 'Unexpected end of expression: {0}', this.text); return this.tokens[0]; }, peek: function(e1, e2, e3, e4) { return this.peekAhead(0, e1, e2, e3, e4); }, peekAhead: function(i, e1, e2, e3, e4) { if (this.tokens.length > i) { var token = this.tokens[i]; var t = token.text; if (t === e1 || t === e2 || t === e3 || t === e4 || (!e1 && !e2 && !e3 && !e4)) { return token; } } return false; }, expect: function(e1, e2, e3, e4) { var token = this.peek(e1, e2, e3, e4); if (token) { this.tokens.shift(); return token; } return false; }, consume: function(e1) { if (this.tokens.length === 0) { throw $parseMinErr('ueoe', 'Unexpected end of expression: {0}', this.text); } var token = this.expect(e1); if (!token) { this.throwError('is unexpected, expecting [' + e1 + ']', this.peek()); } return token; }, unaryFn: function(op, right) { var fn = OPERATORS[op]; return extend(function $parseUnaryFn(self, locals) { return fn(self, locals, right); }, { constant:right.constant, inputs: [right] }); }, binaryFn: function(left, op, right, isBranching) { var fn = OPERATORS[op]; return extend(function $parseBinaryFn(self, locals) { return fn(self, locals, left, right); }, { constant: left.constant && right.constant, inputs: !isBranching && [left, right] }); }, identifier: function() { var id = this.consume().text; //Continue reading each `.identifier` unless it is a method invocation while (this.peek('.') && this.peekAhead(1).identifier && !this.peekAhead(2, '(')) { id += this.consume().text + this.consume().text; } return getterFn(id, this.options, this.text); }, constant: function() { var value = this.consume().value; return extend(function $parseConstant() { return value; }, { constant: true, literal: true }); }, statements: function() { var statements = []; while (true) { if (this.tokens.length > 0 && !this.peek('}', ')', ';', ']')) statements.push(this.filterChain()); if (!this.expect(';')) { // optimize for the common case where there is only one statement. // TODO(size): maybe we should not support multiple statements? return (statements.length === 1) ? statements[0] : function $parseStatements(self, locals) { var value; for (var i = 0, ii = statements.length; i < ii; i++) { value = statements[i](self, locals); } return value; }; } } }, filterChain: function() { var left = this.expression(); var token; while ((token = this.expect('|'))) { left = this.filter(left); } return left; }, filter: function(inputFn) { var fn = this.$filter(this.consume().text); var argsFn; var args; if (this.peek(':')) { argsFn = []; args = []; // we can safely reuse the array while (this.expect(':')) { argsFn.push(this.expression()); } } var inputs = [inputFn].concat(argsFn || []); return extend(function $parseFilter(self, locals) { var input = inputFn(self, locals); if (args) { args[0] = input; var i = argsFn.length; while (i--) { args[i + 1] = argsFn[i](self, locals); } return fn.apply(undefined, args); } return fn(input); }, { constant: !fn.$stateful && inputs.every(isConstant), inputs: !fn.$stateful && inputs }); }, expression: function() { return this.assignment(); }, assignment: function() { var left = this.ternary(); var right; var token; if ((token = this.expect('='))) { if (!left.assign) { this.throwError('implies assignment but [' + this.text.substring(0, token.index) + '] can not be assigned to', token); } right = this.ternary(); return extend(function $parseAssignment(scope, locals) { return left.assign(scope, right(scope, locals), locals); }, { inputs: [left, right] }); } return left; }, ternary: function() { var left = this.logicalOR(); var middle; var token; if ((token = this.expect('?'))) { middle = this.assignment(); if (this.consume(':')) { var right = this.assignment(); return extend(function $parseTernary(self, locals) { return left(self, locals) ? middle(self, locals) : right(self, locals); }, { constant: left.constant && middle.constant && right.constant }); } } return left; }, logicalOR: function() { var left = this.logicalAND(); var token; while ((token = this.expect('||'))) { left = this.binaryFn(left, token.text, this.logicalAND(), true); } return left; }, logicalAND: function() { var left = this.equality(); var token; while ((token = this.expect('&&'))) { left = this.binaryFn(left, token.text, this.equality(), true); } return left; }, equality: function() { var left = this.relational(); var token; while ((token = this.expect('==','!=','===','!=='))) { left = this.binaryFn(left, token.text, this.relational()); } return left; }, relational: function() { var left = this.additive(); var token; while ((token = this.expect('<', '>', '<=', '>='))) { left = this.binaryFn(left, token.text, this.additive()); } return left; }, additive: function() { var left = this.multiplicative(); var token; while ((token = this.expect('+','-'))) { left = this.binaryFn(left, token.text, this.multiplicative()); } return left; }, multiplicative: function() { var left = this.unary(); var token; while ((token = this.expect('*','/','%'))) { left = this.binaryFn(left, token.text, this.unary()); } return left; }, unary: function() { var token; if (this.expect('+')) { return this.primary(); } else if ((token = this.expect('-'))) { return this.binaryFn(Parser.ZERO, token.text, this.unary()); } else if ((token = this.expect('!'))) { return this.unaryFn(token.text, this.unary()); } else { return this.primary(); } }, fieldAccess: function(object) { var getter = this.identifier(); return extend(function $parseFieldAccess(scope, locals, self) { var o = self || object(scope, locals); return (o == null) ? undefined : getter(o); }, { assign: function(scope, value, locals) { var o = object(scope, locals); if (!o) object.assign(scope, o = {}, locals); return getter.assign(o, value); } }); }, objectIndex: function(obj) { var expression = this.text; var indexFn = this.expression(); this.consume(']'); return extend(function $parseObjectIndex(self, locals) { var o = obj(self, locals), i = indexFn(self, locals), v; ensureSafeMemberName(i, expression); if (!o) return undefined; v = ensureSafeObject(o[i], expression); return v; }, { assign: function(self, value, locals) { var key = ensureSafeMemberName(indexFn(self, locals), expression); // prevent overwriting of Function.constructor which would break ensureSafeObject check var o = ensureSafeObject(obj(self, locals), expression); if (!o) obj.assign(self, o = {}, locals); return o[key] = value; } }); }, functionCall: function(fnGetter, contextGetter) { var argsFn = []; if (this.peekToken().text !== ')') { do { argsFn.push(this.expression()); } while (this.expect(',')); } this.consume(')'); var expressionText = this.text; // we can safely reuse the array across invocations var args = argsFn.length ? [] : null; return function $parseFunctionCall(scope, locals) { var context = contextGetter ? contextGetter(scope, locals) : isDefined(contextGetter) ? undefined : scope; var fn = fnGetter(scope, locals, context) || noop; if (args) { var i = argsFn.length; while (i--) { args[i] = ensureSafeObject(argsFn[i](scope, locals), expressionText); } } ensureSafeObject(context, expressionText); ensureSafeFunction(fn, expressionText); // IE doesn't have apply for some native functions var v = fn.apply ? fn.apply(context, args) : fn(args[0], args[1], args[2], args[3], args[4]); return ensureSafeObject(v, expressionText); }; }, // This is used with json array declaration arrayDeclaration: function() { var elementFns = []; if (this.peekToken().text !== ']') { do { if (this.peek(']')) { // Support trailing commas per ES5.1. break; } elementFns.push(this.expression()); } while (this.expect(',')); } this.consume(']'); return extend(function $parseArrayLiteral(self, locals) { var array = []; for (var i = 0, ii = elementFns.length; i < ii; i++) { array.push(elementFns[i](self, locals)); } return array; }, { literal: true, constant: elementFns.every(isConstant), inputs: elementFns }); }, object: function() { var keys = [], valueFns = []; if (this.peekToken().text !== '}') { do { if (this.peek('}')) { // Support trailing commas per ES5.1. break; } var token = this.consume(); if (token.constant) { keys.push(token.value); } else if (token.identifier) { keys.push(token.text); } else { this.throwError("invalid key", token); } this.consume(':'); valueFns.push(this.expression()); } while (this.expect(',')); } this.consume('}'); return extend(function $parseObjectLiteral(self, locals) { var object = {}; for (var i = 0, ii = valueFns.length; i < ii; i++) { object[keys[i]] = valueFns[i](self, locals); } return object; }, { literal: true, constant: valueFns.every(isConstant), inputs: valueFns }); } }; ////////////////////////////////////////////////// // Parser helper functions ////////////////////////////////////////////////// function setter(obj, locals, path, setValue, fullExp) { ensureSafeObject(obj, fullExp); ensureSafeObject(locals, fullExp); var element = path.split('.'), key; for (var i = 0; element.length > 1; i++) { key = ensureSafeMemberName(element.shift(), fullExp); var propertyObj = (i === 0 && locals && locals[key]) || obj[key]; if (!propertyObj) { propertyObj = {}; obj[key] = propertyObj; } obj = ensureSafeObject(propertyObj, fullExp); } key = ensureSafeMemberName(element.shift(), fullExp); ensureSafeObject(obj[key], fullExp); obj[key] = setValue; return setValue; } var getterFnCacheDefault = createMap(); var getterFnCacheExpensive = createMap(); function isPossiblyDangerousMemberName(name) { return name == 'constructor'; } /** * Implementation of the "Black Hole" variant from: * - http://jsperf.com/angularjs-parse-getter/4 * - http://jsperf.com/path-evaluation-simplified/7 */ function cspSafeGetterFn(key0, key1, key2, key3, key4, fullExp, expensiveChecks) { ensureSafeMemberName(key0, fullExp); ensureSafeMemberName(key1, fullExp); ensureSafeMemberName(key2, fullExp); ensureSafeMemberName(key3, fullExp); ensureSafeMemberName(key4, fullExp); var eso = function(o) { return ensureSafeObject(o, fullExp); }; var eso0 = (expensiveChecks || isPossiblyDangerousMemberName(key0)) ? eso : identity; var eso1 = (expensiveChecks || isPossiblyDangerousMemberName(key1)) ? eso : identity; var eso2 = (expensiveChecks || isPossiblyDangerousMemberName(key2)) ? eso : identity; var eso3 = (expensiveChecks || isPossiblyDangerousMemberName(key3)) ? eso : identity; var eso4 = (expensiveChecks || isPossiblyDangerousMemberName(key4)) ? eso : identity; return function cspSafeGetter(scope, locals) { var pathVal = (locals && locals.hasOwnProperty(key0)) ? locals : scope; if (pathVal == null) return pathVal; pathVal = eso0(pathVal[key0]); if (!key1) return pathVal; if (pathVal == null) return undefined; pathVal = eso1(pathVal[key1]); if (!key2) return pathVal; if (pathVal == null) return undefined; pathVal = eso2(pathVal[key2]); if (!key3) return pathVal; if (pathVal == null) return undefined; pathVal = eso3(pathVal[key3]); if (!key4) return pathVal; if (pathVal == null) return undefined; pathVal = eso4(pathVal[key4]); return pathVal; }; } function getterFnWithEnsureSafeObject(fn, fullExpression) { return function(s, l) { return fn(s, l, ensureSafeObject, fullExpression); }; } function getterFn(path, options, fullExp) { var expensiveChecks = options.expensiveChecks; var getterFnCache = (expensiveChecks ? getterFnCacheExpensive : getterFnCacheDefault); var fn = getterFnCache[path]; if (fn) return fn; var pathKeys = path.split('.'), pathKeysLength = pathKeys.length; // http://jsperf.com/angularjs-parse-getter/6 if (options.csp) { if (pathKeysLength < 6) { fn = cspSafeGetterFn(pathKeys[0], pathKeys[1], pathKeys[2], pathKeys[3], pathKeys[4], fullExp, expensiveChecks); } else { fn = function cspSafeGetter(scope, locals) { var i = 0, val; do { val = cspSafeGetterFn(pathKeys[i++], pathKeys[i++], pathKeys[i++], pathKeys[i++], pathKeys[i++], fullExp, expensiveChecks)(scope, locals); locals = undefined; // clear after first iteration scope = val; } while (i < pathKeysLength); return val; }; } } else { var code = ''; if (expensiveChecks) { code += 's = eso(s, fe);\nl = eso(l, fe);\n'; } var needsEnsureSafeObject = expensiveChecks; forEach(pathKeys, function(key, index) { ensureSafeMemberName(key, fullExp); var lookupJs = (index // we simply dereference 's' on any .dot notation ? 's' // but if we are first then we check locals first, and if so read it first : '((l&&l.hasOwnProperty("' + key + '"))?l:s)') + '.' + key; if (expensiveChecks || isPossiblyDangerousMemberName(key)) { lookupJs = 'eso(' + lookupJs + ', fe)'; needsEnsureSafeObject = true; } code += 'if(s == null) return undefined;\n' + 's=' + lookupJs + ';\n'; }); code += 'return s;'; /* jshint -W054 */ var evaledFnGetter = new Function('s', 'l', 'eso', 'fe', code); // s=scope, l=locals, eso=ensureSafeObject /* jshint +W054 */ evaledFnGetter.toString = valueFn(code); if (needsEnsureSafeObject) { evaledFnGetter = getterFnWithEnsureSafeObject(evaledFnGetter, fullExp); } fn = evaledFnGetter; } fn.sharedGetter = true; fn.assign = function(self, value, locals) { return setter(self, locals, path, value, path); }; getterFnCache[path] = fn; return fn; } var objectValueOf = Object.prototype.valueOf; function getValueOf(value) { return isFunction(value.valueOf) ? value.valueOf() : objectValueOf.call(value); } /////////////////////////////////// /** * @ngdoc service * @name $parse * @kind function * * @description * * Converts Angular {@link guide/expression expression} into a function. * * ```js * var getter = $parse('user.name'); * var setter = getter.assign; * var context = {user:{name:'angular'}}; * var locals = {user:{name:'local'}}; * * expect(getter(context)).toEqual('angular'); * setter(context, 'newValue'); * expect(context.user.name).toEqual('newValue'); * expect(getter(context, locals)).toEqual('local'); * ``` * * * @param {string} expression String expression to compile. * @returns {function(context, locals)} a function which represents the compiled expression: * * * `context` – `{object}` – an object against which any expressions embedded in the strings * are evaluated against (typically a scope object). * * `locals` – `{object=}` – local variables context object, useful for overriding values in * `context`. * * The returned function also has the following properties: * * `literal` – `{boolean}` – whether the expression's top-level node is a JavaScript * literal. * * `constant` – `{boolean}` – whether the expression is made entirely of JavaScript * constant literals. * * `assign` – `{?function(context, value)}` – if the expression is assignable, this will be * set to a function to change its value on the given context. * */ /** * @ngdoc provider * @name $parseProvider * * @description * `$parseProvider` can be used for configuring the default behavior of the {@link ng.$parse $parse} * service. */ function $ParseProvider() { var cacheDefault = createMap(); var cacheExpensive = createMap(); this.$get = ['$filter', '$sniffer', function($filter, $sniffer) { var $parseOptions = { csp: $sniffer.csp, expensiveChecks: false }, $parseOptionsExpensive = { csp: $sniffer.csp, expensiveChecks: true }; function wrapSharedExpression(exp) { var wrapped = exp; if (exp.sharedGetter) { wrapped = function $parseWrapper(self, locals) { return exp(self, locals); }; wrapped.literal = exp.literal; wrapped.constant = exp.constant; wrapped.assign = exp.assign; } return wrapped; } return function $parse(exp, interceptorFn, expensiveChecks) { var parsedExpression, oneTime, cacheKey; switch (typeof exp) { case 'string': cacheKey = exp = exp.trim(); var cache = (expensiveChecks ? cacheExpensive : cacheDefault); parsedExpression = cache[cacheKey]; if (!parsedExpression) { if (exp.charAt(0) === ':' && exp.charAt(1) === ':') { oneTime = true; exp = exp.substring(2); } var parseOptions = expensiveChecks ? $parseOptionsExpensive : $parseOptions; var lexer = new Lexer(parseOptions); var parser = new Parser(lexer, $filter, parseOptions); parsedExpression = parser.parse(exp); if (parsedExpression.constant) { parsedExpression.$$watchDelegate = constantWatchDelegate; } else if (oneTime) { //oneTime is not part of the exp passed to the Parser so we may have to //wrap the parsedExpression before adding a $$watchDelegate parsedExpression = wrapSharedExpression(parsedExpression); parsedExpression.$$watchDelegate = parsedExpression.literal ? oneTimeLiteralWatchDelegate : oneTimeWatchDelegate; } else if (parsedExpression.inputs) { parsedExpression.$$watchDelegate = inputsWatchDelegate; } cache[cacheKey] = parsedExpression; } return addInterceptor(parsedExpression, interceptorFn); case 'function': return addInterceptor(exp, interceptorFn); default: return addInterceptor(noop, interceptorFn); } }; function collectExpressionInputs(inputs, list) { for (var i = 0, ii = inputs.length; i < ii; i++) { var input = inputs[i]; if (!input.constant) { if (input.inputs) { collectExpressionInputs(input.inputs, list); } else if (list.indexOf(input) === -1) { // TODO(perf) can we do better? list.push(input); } } } return list; } function expressionInputDirtyCheck(newValue, oldValueOfValue) { if (newValue == null || oldValueOfValue == null) { // null/undefined return newValue === oldValueOfValue; } if (typeof newValue === 'object') { // attempt to convert the value to a primitive type // TODO(docs): add a note to docs that by implementing valueOf even objects and arrays can // be cheaply dirty-checked newValue = getValueOf(newValue); if (typeof newValue === 'object') { // objects/arrays are not supported - deep-watching them would be too expensive return false; } // fall-through to the primitive equality check } //Primitive or NaN return newValue === oldValueOfValue || (newValue !== newValue && oldValueOfValue !== oldValueOfValue); } function inputsWatchDelegate(scope, listener, objectEquality, parsedExpression) { var inputExpressions = parsedExpression.$$inputs || (parsedExpression.$$inputs = collectExpressionInputs(parsedExpression.inputs, [])); var lastResult; if (inputExpressions.length === 1) { var oldInputValue = expressionInputDirtyCheck; // init to something unique so that equals check fails inputExpressions = inputExpressions[0]; return scope.$watch(function expressionInputWatch(scope) { var newInputValue = inputExpressions(scope); if (!expressionInputDirtyCheck(newInputValue, oldInputValue)) { lastResult = parsedExpression(scope); oldInputValue = newInputValue && getValueOf(newInputValue); } return lastResult; }, listener, objectEquality); } var oldInputValueOfValues = []; for (var i = 0, ii = inputExpressions.length; i < ii; i++) { oldInputValueOfValues[i] = expressionInputDirtyCheck; // init to something unique so that equals check fails } return scope.$watch(function expressionInputsWatch(scope) { var changed = false; for (var i = 0, ii = inputExpressions.length; i < ii; i++) { var newInputValue = inputExpressions[i](scope); if (changed || (changed = !expressionInputDirtyCheck(newInputValue, oldInputValueOfValues[i]))) { oldInputValueOfValues[i] = newInputValue && getValueOf(newInputValue); } } if (changed) { lastResult = parsedExpression(scope); } return lastResult; }, listener, objectEquality); } function oneTimeWatchDelegate(scope, listener, objectEquality, parsedExpression) { var unwatch, lastValue; return unwatch = scope.$watch(function oneTimeWatch(scope) { return parsedExpression(scope); }, function oneTimeListener(value, old, scope) { lastValue = value; if (isFunction(listener)) { listener.apply(this, arguments); } if (isDefined(value)) { scope.$$postDigest(function() { if (isDefined(lastValue)) { unwatch(); } }); } }, objectEquality); } function oneTimeLiteralWatchDelegate(scope, listener, objectEquality, parsedExpression) { var unwatch, lastValue; return unwatch = scope.$watch(function oneTimeWatch(scope) { return parsedExpression(scope); }, function oneTimeListener(value, old, scope) { lastValue = value; if (isFunction(listener)) { listener.call(this, value, old, scope); } if (isAllDefined(value)) { scope.$$postDigest(function() { if (isAllDefined(lastValue)) unwatch(); }); } }, objectEquality); function isAllDefined(value) { var allDefined = true; forEach(value, function(val) { if (!isDefined(val)) allDefined = false; }); return allDefined; } } function constantWatchDelegate(scope, listener, objectEquality, parsedExpression) { var unwatch; return unwatch = scope.$watch(function constantWatch(scope) { return parsedExpression(scope); }, function constantListener(value, old, scope) { if (isFunction(listener)) { listener.apply(this, arguments); } unwatch(); }, objectEquality); } function addInterceptor(parsedExpression, interceptorFn) { if (!interceptorFn) return parsedExpression; var watchDelegate = parsedExpression.$$watchDelegate; var regularWatch = watchDelegate !== oneTimeLiteralWatchDelegate && watchDelegate !== oneTimeWatchDelegate; var fn = regularWatch ? function regularInterceptedExpression(scope, locals) { var value = parsedExpression(scope, locals); return interceptorFn(value, scope, locals); } : function oneTimeInterceptedExpression(scope, locals) { var value = parsedExpression(scope, locals); var result = interceptorFn(value, scope, locals); // we only return the interceptor's result if the // initial value is defined (for bind-once) return isDefined(value) ? result : value; }; // Propagate $$watchDelegates other then inputsWatchDelegate if (parsedExpression.$$watchDelegate && parsedExpression.$$watchDelegate !== inputsWatchDelegate) { fn.$$watchDelegate = parsedExpression.$$watchDelegate; } else if (!interceptorFn.$stateful) { // If there is an interceptor, but no watchDelegate then treat the interceptor like // we treat filters - it is assumed to be a pure function unless flagged with $stateful fn.$$watchDelegate = inputsWatchDelegate; fn.inputs = [parsedExpression]; } return fn; } }]; } /** * @ngdoc service * @name $q * @requires $rootScope * * @description * A service that helps you run functions asynchronously, and use their return values (or exceptions) * when they are done processing. * * This is an implementation of promises/deferred objects inspired by * [Kris Kowal's Q](https://github.com/kriskowal/q). * * $q can be used in two fashions --- one which is more similar to Kris Kowal's Q or jQuery's Deferred * implementations, and the other which resembles ES6 promises to some degree. * * # $q constructor * * The streamlined ES6 style promise is essentially just using $q as a constructor which takes a `resolver` * function as the first argument. This is similar to the native Promise implementation from ES6 Harmony, * see [MDN](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Promise). * * While the constructor-style use is supported, not all of the supporting methods from ES6 Harmony promises are * available yet. * * It can be used like so: * * ```js * // for the purpose of this example let's assume that variables `$q` and `okToGreet` * // are available in the current lexical scope (they could have been injected or passed in). * * function asyncGreet(name) { * // perform some asynchronous operation, resolve or reject the promise when appropriate. * return $q(function(resolve, reject) { * setTimeout(function() { * if (okToGreet(name)) { * resolve('Hello, ' + name + '!'); * } else { * reject('Greeting ' + name + ' is not allowed.'); * } * }, 1000); * }); * } * * var promise = asyncGreet('Robin Hood'); * promise.then(function(greeting) { * alert('Success: ' + greeting); * }, function(reason) { * alert('Failed: ' + reason); * }); * ``` * * Note: progress/notify callbacks are not currently supported via the ES6-style interface. * * However, the more traditional CommonJS-style usage is still available, and documented below. * * [The CommonJS Promise proposal](http://wiki.commonjs.org/wiki/Promises) describes a promise as an * interface for interacting with an object that represents the result of an action that is * performed asynchronously, and may or may not be finished at any given point in time. * * From the perspective of dealing with error handling, deferred and promise APIs are to * asynchronous programming what `try`, `catch` and `throw` keywords are to synchronous programming. * * ```js * // for the purpose of this example let's assume that variables `$q` and `okToGreet` * // are available in the current lexical scope (they could have been injected or passed in). * * function asyncGreet(name) { * var deferred = $q.defer(); * * setTimeout(function() { * deferred.notify('About to greet ' + name + '.'); * * if (okToGreet(name)) { * deferred.resolve('Hello, ' + name + '!'); * } else { * deferred.reject('Greeting ' + name + ' is not allowed.'); * } * }, 1000); * * return deferred.promise; * } * * var promise = asyncGreet('Robin Hood'); * promise.then(function(greeting) { * alert('Success: ' + greeting); * }, function(reason) { * alert('Failed: ' + reason); * }, function(update) { * alert('Got notification: ' + update); * }); * ``` * * At first it might not be obvious why this extra complexity is worth the trouble. The payoff * comes in the way of guarantees that promise and deferred APIs make, see * https://github.com/kriskowal/uncommonjs/blob/master/promises/specification.md. * * Additionally the promise api allows for composition that is very hard to do with the * traditional callback ([CPS](http://en.wikipedia.org/wiki/Continuation-passing_style)) approach. * For more on this please see the [Q documentation](https://github.com/kriskowal/q) especially the * section on serial or parallel joining of promises. * * # The Deferred API * * A new instance of deferred is constructed by calling `$q.defer()`. * * The purpose of the deferred object is to expose the associated Promise instance as well as APIs * that can be used for signaling the successful or unsuccessful completion, as well as the status * of the task. * * **Methods** * * - `resolve(value)` – resolves the derived promise with the `value`. If the value is a rejection * constructed via `$q.reject`, the promise will be rejected instead. * - `reject(reason)` – rejects the derived promise with the `reason`. This is equivalent to * resolving it with a rejection constructed via `$q.reject`. * - `notify(value)` - provides updates on the status of the promise's execution. This may be called * multiple times before the promise is either resolved or rejected. * * **Properties** * * - promise – `{Promise}` – promise object associated with this deferred. * * * # The Promise API * * A new promise instance is created when a deferred instance is created and can be retrieved by * calling `deferred.promise`. * * The purpose of the promise object is to allow for interested parties to get access to the result * of the deferred task when it completes. * * **Methods** * * - `then(successCallback, errorCallback, notifyCallback)` – regardless of when the promise was or * will be resolved or rejected, `then` calls one of the success or error callbacks asynchronously * as soon as the result is available. The callbacks are called with a single argument: the result * or rejection reason. Additionally, the notify callback may be called zero or more times to * provide a progress indication, before the promise is resolved or rejected. * * This method *returns a new promise* which is resolved or rejected via the return value of the * `successCallback`, `errorCallback`. It also notifies via the return value of the * `notifyCallback` method. The promise cannot be resolved or rejected from the notifyCallback * method. * * - `catch(errorCallback)` – shorthand for `promise.then(null, errorCallback)` * * - `finally(callback, notifyCallback)` – allows you to observe either the fulfillment or rejection of a promise, * but to do so without modifying the final value. This is useful to release resources or do some * clean-up that needs to be done whether the promise was rejected or resolved. See the [full * specification](https://github.com/kriskowal/q/wiki/API-Reference#promisefinallycallback) for * more information. * * # Chaining promises * * Because calling the `then` method of a promise returns a new derived promise, it is easily * possible to create a chain of promises: * * ```js * promiseB = promiseA.then(function(result) { * return result + 1; * }); * * // promiseB will be resolved immediately after promiseA is resolved and its value * // will be the result of promiseA incremented by 1 * ``` * * It is possible to create chains of any length and since a promise can be resolved with another * promise (which will defer its resolution further), it is possible to pause/defer resolution of * the promises at any point in the chain. This makes it possible to implement powerful APIs like * $http's response interceptors. * * * # Differences between Kris Kowal's Q and $q * * There are two main differences: * * - $q is integrated with the {@link ng.$rootScope.Scope} Scope model observation * mechanism in angular, which means faster propagation of resolution or rejection into your * models and avoiding unnecessary browser repaints, which would result in flickering UI. * - Q has many more features than $q, but that comes at a cost of bytes. $q is tiny, but contains * all the important functionality needed for common async tasks. * * # Testing * * ```js * it('should simulate promise', inject(function($q, $rootScope) { * var deferred = $q.defer(); * var promise = deferred.promise; * var resolvedValue; * * promise.then(function(value) { resolvedValue = value; }); * expect(resolvedValue).toBeUndefined(); * * // Simulate resolving of promise * deferred.resolve(123); * // Note that the 'then' function does not get called synchronously. * // This is because we want the promise API to always be async, whether or not * // it got called synchronously or asynchronously. * expect(resolvedValue).toBeUndefined(); * * // Propagate promise resolution to 'then' functions using $apply(). * $rootScope.$apply(); * expect(resolvedValue).toEqual(123); * })); * ``` * * @param {function(function, function)} resolver Function which is responsible for resolving or * rejecting the newly created promise. The first parameter is a function which resolves the * promise, the second parameter is a function which rejects the promise. * * @returns {Promise} The newly created promise. */ function $QProvider() { this.$get = ['$rootScope', '$exceptionHandler', function($rootScope, $exceptionHandler) { return qFactory(function(callback) { $rootScope.$evalAsync(callback); }, $exceptionHandler); }]; } function $$QProvider() { this.$get = ['$browser', '$exceptionHandler', function($browser, $exceptionHandler) { return qFactory(function(callback) { $browser.defer(callback); }, $exceptionHandler); }]; } /** * Constructs a promise manager. * * @param {function(function)} nextTick Function for executing functions in the next turn. * @param {function(...*)} exceptionHandler Function into which unexpected exceptions are passed for * debugging purposes. * @returns {object} Promise manager. */ function qFactory(nextTick, exceptionHandler) { var $qMinErr = minErr('$q', TypeError); function callOnce(self, resolveFn, rejectFn) { var called = false; function wrap(fn) { return function(value) { if (called) return; called = true; fn.call(self, value); }; } return [wrap(resolveFn), wrap(rejectFn)]; } /** * @ngdoc method * @name ng.$q#defer * @kind function * * @description * Creates a `Deferred` object which represents a task which will finish in the future. * * @returns {Deferred} Returns a new instance of deferred. */ var defer = function() { return new Deferred(); }; function Promise() { this.$$state = { status: 0 }; } Promise.prototype = { then: function(onFulfilled, onRejected, progressBack) { var result = new Deferred(); this.$$state.pending = this.$$state.pending || []; this.$$state.pending.push([result, onFulfilled, onRejected, progressBack]); if (this.$$state.status > 0) scheduleProcessQueue(this.$$state); return result.promise; }, "catch": function(callback) { return this.then(null, callback); }, "finally": function(callback, progressBack) { return this.then(function(value) { return handleCallback(value, true, callback); }, function(error) { return handleCallback(error, false, callback); }, progressBack); } }; //Faster, more basic than angular.bind http://jsperf.com/angular-bind-vs-custom-vs-native function simpleBind(context, fn) { return function(value) { fn.call(context, value); }; } function processQueue(state) { var fn, promise, pending; pending = state.pending; state.processScheduled = false; state.pending = undefined; for (var i = 0, ii = pending.length; i < ii; ++i) { promise = pending[i][0]; fn = pending[i][state.status]; try { if (isFunction(fn)) { promise.resolve(fn(state.value)); } else if (state.status === 1) { promise.resolve(state.value); } else { promise.reject(state.value); } } catch (e) { promise.reject(e); exceptionHandler(e); } } } function scheduleProcessQueue(state) { if (state.processScheduled || !state.pending) return; state.processScheduled = true; nextTick(function() { processQueue(state); }); } function Deferred() { this.promise = new Promise(); //Necessary to support unbound execution :/ this.resolve = simpleBind(this, this.resolve); this.reject = simpleBind(this, this.reject); this.notify = simpleBind(this, this.notify); } Deferred.prototype = { resolve: function(val) { if (this.promise.$$state.status) return; if (val === this.promise) { this.$$reject($qMinErr( 'qcycle', "Expected promise to be resolved with value other than itself '{0}'", val)); } else { this.$$resolve(val); } }, $$resolve: function(val) { var then, fns; fns = callOnce(this, this.$$resolve, this.$$reject); try { if ((isObject(val) || isFunction(val))) then = val && val.then; if (isFunction(then)) { this.promise.$$state.status = -1; then.call(val, fns[0], fns[1], this.notify); } else { this.promise.$$state.value = val; this.promise.$$state.status = 1; scheduleProcessQueue(this.promise.$$state); } } catch (e) { fns[1](e); exceptionHandler(e); } }, reject: function(reason) { if (this.promise.$$state.status) return; this.$$reject(reason); }, $$reject: function(reason) { this.promise.$$state.value = reason; this.promise.$$state.status = 2; scheduleProcessQueue(this.promise.$$state); }, notify: function(progress) { var callbacks = this.promise.$$state.pending; if ((this.promise.$$state.status <= 0) && callbacks && callbacks.length) { nextTick(function() { var callback, result; for (var i = 0, ii = callbacks.length; i < ii; i++) { result = callbacks[i][0]; callback = callbacks[i][3]; try { result.notify(isFunction(callback) ? callback(progress) : progress); } catch (e) { exceptionHandler(e); } } }); } } }; /** * @ngdoc method * @name $q#reject * @kind function * * @description * Creates a promise that is resolved as rejected with the specified `reason`. This api should be * used to forward rejection in a chain of promises. If you are dealing with the last promise in * a promise chain, you don't need to worry about it. * * When comparing deferreds/promises to the familiar behavior of try/catch/throw, think of * `reject` as the `throw` keyword in JavaScript. This also means that if you "catch" an error via * a promise error callback and you want to forward the error to the promise derived from the * current promise, you have to "rethrow" the error by returning a rejection constructed via * `reject`. * * ```js * promiseB = promiseA.then(function(result) { * // success: do something and resolve promiseB * // with the old or a new result * return result; * }, function(reason) { * // error: handle the error if possible and * // resolve promiseB with newPromiseOrValue, * // otherwise forward the rejection to promiseB * if (canHandle(reason)) { * // handle the error and recover * return newPromiseOrValue; * } * return $q.reject(reason); * }); * ``` * * @param {*} reason Constant, message, exception or an object representing the rejection reason. * @returns {Promise} Returns a promise that was already resolved as rejected with the `reason`. */ var reject = function(reason) { var result = new Deferred(); result.reject(reason); return result.promise; }; var makePromise = function makePromise(value, resolved) { var result = new Deferred(); if (resolved) { result.resolve(value); } else { result.reject(value); } return result.promise; }; var handleCallback = function handleCallback(value, isResolved, callback) { var callbackOutput = null; try { if (isFunction(callback)) callbackOutput = callback(); } catch (e) { return makePromise(e, false); } if (isPromiseLike(callbackOutput)) { return callbackOutput.then(function() { return makePromise(value, isResolved); }, function(error) { return makePromise(error, false); }); } else { return makePromise(value, isResolved); } }; /** * @ngdoc method * @name $q#when * @kind function * * @description * Wraps an object that might be a value or a (3rd party) then-able promise into a $q promise. * This is useful when you are dealing with an object that might or might not be a promise, or if * the promise comes from a source that can't be trusted. * * @param {*} value Value or a promise * @returns {Promise} Returns a promise of the passed value or promise */ var when = function(value, callback, errback, progressBack) { var result = new Deferred(); result.resolve(value); return result.promise.then(callback, errback, progressBack); }; /** * @ngdoc method * @name $q#all * @kind function * * @description * Combines multiple promises into a single promise that is resolved when all of the input * promises are resolved. * * @param {Array.<Promise>|Object.<Promise>} promises An array or hash of promises. * @returns {Promise} Returns a single promise that will be resolved with an array/hash of values, * each value corresponding to the promise at the same index/key in the `promises` array/hash. * If any of the promises is resolved with a rejection, this resulting promise will be rejected * with the same rejection value. */ function all(promises) { var deferred = new Deferred(), counter = 0, results = isArray(promises) ? [] : {}; forEach(promises, function(promise, key) { counter++; when(promise).then(function(value) { if (results.hasOwnProperty(key)) return; results[key] = value; if (!(--counter)) deferred.resolve(results); }, function(reason) { if (results.hasOwnProperty(key)) return; deferred.reject(reason); }); }); if (counter === 0) { deferred.resolve(results); } return deferred.promise; } var $Q = function Q(resolver) { if (!isFunction(resolver)) { throw $qMinErr('norslvr', "Expected resolverFn, got '{0}'", resolver); } if (!(this instanceof Q)) { // More useful when $Q is the Promise itself. return new Q(resolver); } var deferred = new Deferred(); function resolveFn(value) { deferred.resolve(value); } function rejectFn(reason) { deferred.reject(reason); } resolver(resolveFn, rejectFn); return deferred.promise; }; $Q.defer = defer; $Q.reject = reject; $Q.when = when; $Q.all = all; return $Q; } function $$RAFProvider() { //rAF this.$get = ['$window', '$timeout', function($window, $timeout) { var requestAnimationFrame = $window.requestAnimationFrame || $window.webkitRequestAnimationFrame; var cancelAnimationFrame = $window.cancelAnimationFrame || $window.webkitCancelAnimationFrame || $window.webkitCancelRequestAnimationFrame; var rafSupported = !!requestAnimationFrame; var raf = rafSupported ? function(fn) { var id = requestAnimationFrame(fn); return function() { cancelAnimationFrame(id); }; } : function(fn) { var timer = $timeout(fn, 16.66, false); // 1000 / 60 = 16.666 return function() { $timeout.cancel(timer); }; }; raf.supported = rafSupported; return raf; }]; } /** * DESIGN NOTES * * The design decisions behind the scope are heavily favored for speed and memory consumption. * * The typical use of scope is to watch the expressions, which most of the time return the same * value as last time so we optimize the operation. * * Closures construction is expensive in terms of speed as well as memory: * - No closures, instead use prototypical inheritance for API * - Internal state needs to be stored on scope directly, which means that private state is * exposed as $$____ properties * * Loop operations are optimized by using while(count--) { ... } * - this means that in order to keep the same order of execution as addition we have to add * items to the array at the beginning (unshift) instead of at the end (push) * * Child scopes are created and removed often * - Using an array would be slow since inserts in middle are expensive so we use linked list * * There are few watches then a lot of observers. This is why you don't want the observer to be * implemented in the same way as watch. Watch requires return of initialization function which * are expensive to construct. */ /** * @ngdoc provider * @name $rootScopeProvider * @description * * Provider for the $rootScope service. */ /** * @ngdoc method * @name $rootScopeProvider#digestTtl * @description * * Sets the number of `$digest` iterations the scope should attempt to execute before giving up and * assuming that the model is unstable. * * The current default is 10 iterations. * * In complex applications it's possible that the dependencies between `$watch`s will result in * several digest iterations. However if an application needs more than the default 10 digest * iterations for its model to stabilize then you should investigate what is causing the model to * continuously change during the digest. * * Increasing the TTL could have performance implications, so you should not change it without * proper justification. * * @param {number} limit The number of digest iterations. */ /** * @ngdoc service * @name $rootScope * @description * * Every application has a single root {@link ng.$rootScope.Scope scope}. * All other scopes are descendant scopes of the root scope. Scopes provide separation * between the model and the view, via a mechanism for watching the model for changes. * They also provide an event emission/broadcast and subscription facility. See the * {@link guide/scope developer guide on scopes}. */ function $RootScopeProvider() { var TTL = 10; var $rootScopeMinErr = minErr('$rootScope'); var lastDirtyWatch = null; var applyAsyncId = null; this.digestTtl = function(value) { if (arguments.length) { TTL = value; } return TTL; }; this.$get = ['$injector', '$exceptionHandler', '$parse', '$browser', function($injector, $exceptionHandler, $parse, $browser) { /** * @ngdoc type * @name $rootScope.Scope * * @description * A root scope can be retrieved using the {@link ng.$rootScope $rootScope} key from the * {@link auto.$injector $injector}. Child scopes are created using the * {@link ng.$rootScope.Scope#$new $new()} method. (Most scopes are created automatically when * compiled HTML template is executed.) * * Here is a simple scope snippet to show how you can interact with the scope. * ```html * <file src="./test/ng/rootScopeSpec.js" tag="docs1" /> * ``` * * # Inheritance * A scope can inherit from a parent scope, as in this example: * ```js var parent = $rootScope; var child = parent.$new(); parent.salutation = "Hello"; expect(child.salutation).toEqual('Hello'); child.salutation = "Welcome"; expect(child.salutation).toEqual('Welcome'); expect(parent.salutation).toEqual('Hello'); * ``` * * When interacting with `Scope` in tests, additional helper methods are available on the * instances of `Scope` type. See {@link ngMock.$rootScope.Scope ngMock Scope} for additional * details. * * * @param {Object.<string, function()>=} providers Map of service factory which need to be * provided for the current scope. Defaults to {@link ng}. * @param {Object.<string, *>=} instanceCache Provides pre-instantiated services which should * append/override services provided by `providers`. This is handy * when unit-testing and having the need to override a default * service. * @returns {Object} Newly created scope. * */ function Scope() { this.$id = nextUid(); this.$$phase = this.$parent = this.$$watchers = this.$$nextSibling = this.$$prevSibling = this.$$childHead = this.$$childTail = null; this.$root = this; this.$$destroyed = false; this.$$listeners = {}; this.$$listenerCount = {}; this.$$isolateBindings = null; } /** * @ngdoc property * @name $rootScope.Scope#$id * * @description * Unique scope ID (monotonically increasing) useful for debugging. */ /** * @ngdoc property * @name $rootScope.Scope#$parent * * @description * Reference to the parent scope. */ /** * @ngdoc property * @name $rootScope.Scope#$root * * @description * Reference to the root scope. */ Scope.prototype = { constructor: Scope, /** * @ngdoc method * @name $rootScope.Scope#$new * @kind function * * @description * Creates a new child {@link ng.$rootScope.Scope scope}. * * The parent scope will propagate the {@link ng.$rootScope.Scope#$digest $digest()} event. * The scope can be removed from the scope hierarchy using {@link ng.$rootScope.Scope#$destroy $destroy()}. * * {@link ng.$rootScope.Scope#$destroy $destroy()} must be called on a scope when it is * desired for the scope and its child scopes to be permanently detached from the parent and * thus stop participating in model change detection and listener notification by invoking. * * @param {boolean} isolate If true, then the scope does not prototypically inherit from the * parent scope. The scope is isolated, as it can not see parent scope properties. * When creating widgets, it is useful for the widget to not accidentally read parent * state. * * @param {Scope} [parent=this] The {@link ng.$rootScope.Scope `Scope`} that will be the `$parent` * of the newly created scope. Defaults to `this` scope if not provided. * This is used when creating a transclude scope to correctly place it * in the scope hierarchy while maintaining the correct prototypical * inheritance. * * @returns {Object} The newly created child scope. * */ $new: function(isolate, parent) { var child; parent = parent || this; if (isolate) { child = new Scope(); child.$root = this.$root; } else { // Only create a child scope class if somebody asks for one, // but cache it to allow the VM to optimize lookups. if (!this.$$ChildScope) { this.$$ChildScope = function ChildScope() { this.$$watchers = this.$$nextSibling = this.$$childHead = this.$$childTail = null; this.$$listeners = {}; this.$$listenerCount = {}; this.$id = nextUid(); this.$$ChildScope = null; }; this.$$ChildScope.prototype = this; } child = new this.$$ChildScope(); } child.$parent = parent; child.$$prevSibling = parent.$$childTail; if (parent.$$childHead) { parent.$$childTail.$$nextSibling = child; parent.$$childTail = child; } else { parent.$$childHead = parent.$$childTail = child; } // When the new scope is not isolated or we inherit from `this`, and // the parent scope is destroyed, the property `$$destroyed` is inherited // prototypically. In all other cases, this property needs to be set // when the parent scope is destroyed. // The listener needs to be added after the parent is set if (isolate || parent != this) child.$on('$destroy', destroyChild); return child; function destroyChild() { child.$$destroyed = true; } }, /** * @ngdoc method * @name $rootScope.Scope#$watch * @kind function * * @description * Registers a `listener` callback to be executed whenever the `watchExpression` changes. * * - The `watchExpression` is called on every call to {@link ng.$rootScope.Scope#$digest * $digest()} and should return the value that will be watched. (Since * {@link ng.$rootScope.Scope#$digest $digest()} reruns when it detects changes the * `watchExpression` can execute multiple times per * {@link ng.$rootScope.Scope#$digest $digest()} and should be idempotent.) * - The `listener` is called only when the value from the current `watchExpression` and the * previous call to `watchExpression` are not equal (with the exception of the initial run, * see below). Inequality is determined according to reference inequality, * [strict comparison](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Operators/Comparison_Operators) * via the `!==` Javascript operator, unless `objectEquality == true` * (see next point) * - When `objectEquality == true`, inequality of the `watchExpression` is determined * according to the {@link angular.equals} function. To save the value of the object for * later comparison, the {@link angular.copy} function is used. This therefore means that * watching complex objects will have adverse memory and performance implications. * - The watch `listener` may change the model, which may trigger other `listener`s to fire. * This is achieved by rerunning the watchers until no changes are detected. The rerun * iteration limit is 10 to prevent an infinite loop deadlock. * * * If you want to be notified whenever {@link ng.$rootScope.Scope#$digest $digest} is called, * you can register a `watchExpression` function with no `listener`. (Since `watchExpression` * can execute multiple times per {@link ng.$rootScope.Scope#$digest $digest} cycle when a * change is detected, be prepared for multiple calls to your listener.) * * After a watcher is registered with the scope, the `listener` fn is called asynchronously * (via {@link ng.$rootScope.Scope#$evalAsync $evalAsync}) to initialize the * watcher. In rare cases, this is undesirable because the listener is called when the result * of `watchExpression` didn't change. To detect this scenario within the `listener` fn, you * can compare the `newVal` and `oldVal`. If these two values are identical (`===`) then the * listener was called due to initialization. * * * * # Example * ```js // let's assume that scope was dependency injected as the $rootScope var scope = $rootScope; scope.name = 'misko'; scope.counter = 0; expect(scope.counter).toEqual(0); scope.$watch('name', function(newValue, oldValue) { scope.counter = scope.counter + 1; }); expect(scope.counter).toEqual(0); scope.$digest(); // the listener is always called during the first $digest loop after it was registered expect(scope.counter).toEqual(1); scope.$digest(); // but now it will not be called unless the value changes expect(scope.counter).toEqual(1); scope.name = 'adam'; scope.$digest(); expect(scope.counter).toEqual(2); // Using a function as a watchExpression var food; scope.foodCounter = 0; expect(scope.foodCounter).toEqual(0); scope.$watch( // This function returns the value being watched. It is called for each turn of the $digest loop function() { return food; }, // This is the change listener, called when the value returned from the above function changes function(newValue, oldValue) { if ( newValue !== oldValue ) { // Only increment the counter if the value changed scope.foodCounter = scope.foodCounter + 1; } } ); // No digest has been run so the counter will be zero expect(scope.foodCounter).toEqual(0); // Run the digest but since food has not changed count will still be zero scope.$digest(); expect(scope.foodCounter).toEqual(0); // Update food and run digest. Now the counter will increment food = 'cheeseburger'; scope.$digest(); expect(scope.foodCounter).toEqual(1); * ``` * * * * @param {(function()|string)} watchExpression Expression that is evaluated on each * {@link ng.$rootScope.Scope#$digest $digest} cycle. A change in the return value triggers * a call to the `listener`. * * - `string`: Evaluated as {@link guide/expression expression} * - `function(scope)`: called with current `scope` as a parameter. * @param {function(newVal, oldVal, scope)} listener Callback called whenever the value * of `watchExpression` changes. * * - `newVal` contains the current value of the `watchExpression` * - `oldVal` contains the previous value of the `watchExpression` * - `scope` refers to the current scope * @param {boolean=} objectEquality Compare for object equality using {@link angular.equals} instead of * comparing for reference equality. * @returns {function()} Returns a deregistration function for this listener. */ $watch: function(watchExp, listener, objectEquality) { var get = $parse(watchExp); if (get.$$watchDelegate) { return get.$$watchDelegate(this, listener, objectEquality, get); } var scope = this, array = scope.$$watchers, watcher = { fn: listener, last: initWatchVal, get: get, exp: watchExp, eq: !!objectEquality }; lastDirtyWatch = null; if (!isFunction(listener)) { watcher.fn = noop; } if (!array) { array = scope.$$watchers = []; } // we use unshift since we use a while loop in $digest for speed. // the while loop reads in reverse order. array.unshift(watcher); return function deregisterWatch() { arrayRemove(array, watcher); lastDirtyWatch = null; }; }, /** * @ngdoc method * @name $rootScope.Scope#$watchGroup * @kind function * * @description * A variant of {@link ng.$rootScope.Scope#$watch $watch()} where it watches an array of `watchExpressions`. * If any one expression in the collection changes the `listener` is executed. * * - The items in the `watchExpressions` array are observed via standard $watch operation and are examined on every * call to $digest() to see if any items changes. * - The `listener` is called whenever any expression in the `watchExpressions` array changes. * * @param {Array.<string|Function(scope)>} watchExpressions Array of expressions that will be individually * watched using {@link ng.$rootScope.Scope#$watch $watch()} * * @param {function(newValues, oldValues, scope)} listener Callback called whenever the return value of any * expression in `watchExpressions` changes * The `newValues` array contains the current values of the `watchExpressions`, with the indexes matching * those of `watchExpression` * and the `oldValues` array contains the previous values of the `watchExpressions`, with the indexes matching * those of `watchExpression` * The `scope` refers to the current scope. * @returns {function()} Returns a de-registration function for all listeners. */ $watchGroup: function(watchExpressions, listener) { var oldValues = new Array(watchExpressions.length); var newValues = new Array(watchExpressions.length); var deregisterFns = []; var self = this; var changeReactionScheduled = false; var firstRun = true; if (!watchExpressions.length) { // No expressions means we call the listener ASAP var shouldCall = true; self.$evalAsync(function() { if (shouldCall) listener(newValues, newValues, self); }); return function deregisterWatchGroup() { shouldCall = false; }; } if (watchExpressions.length === 1) { // Special case size of one return this.$watch(watchExpressions[0], function watchGroupAction(value, oldValue, scope) { newValues[0] = value; oldValues[0] = oldValue; listener(newValues, (value === oldValue) ? newValues : oldValues, scope); }); } forEach(watchExpressions, function(expr, i) { var unwatchFn = self.$watch(expr, function watchGroupSubAction(value, oldValue) { newValues[i] = value; oldValues[i] = oldValue; if (!changeReactionScheduled) { changeReactionScheduled = true; self.$evalAsync(watchGroupAction); } }); deregisterFns.push(unwatchFn); }); function watchGroupAction() { changeReactionScheduled = false; if (firstRun) { firstRun = false; listener(newValues, newValues, self); } else { listener(newValues, oldValues, self); } } return function deregisterWatchGroup() { while (deregisterFns.length) { deregisterFns.shift()(); } }; }, /** * @ngdoc method * @name $rootScope.Scope#$watchCollection * @kind function * * @description * Shallow watches the properties of an object and fires whenever any of the properties change * (for arrays, this implies watching the array items; for object maps, this implies watching * the properties). If a change is detected, the `listener` callback is fired. * * - The `obj` collection is observed via standard $watch operation and is examined on every * call to $digest() to see if any items have been added, removed, or moved. * - The `listener` is called whenever anything within the `obj` has changed. Examples include * adding, removing, and moving items belonging to an object or array. * * * # Example * ```js $scope.names = ['igor', 'matias', 'misko', 'james']; $scope.dataCount = 4; $scope.$watchCollection('names', function(newNames, oldNames) { $scope.dataCount = newNames.length; }); expect($scope.dataCount).toEqual(4); $scope.$digest(); //still at 4 ... no changes expect($scope.dataCount).toEqual(4); $scope.names.pop(); $scope.$digest(); //now there's been a change expect($scope.dataCount).toEqual(3); * ``` * * * @param {string|function(scope)} obj Evaluated as {@link guide/expression expression}. The * expression value should evaluate to an object or an array which is observed on each * {@link ng.$rootScope.Scope#$digest $digest} cycle. Any shallow change within the * collection will trigger a call to the `listener`. * * @param {function(newCollection, oldCollection, scope)} listener a callback function called * when a change is detected. * - The `newCollection` object is the newly modified data obtained from the `obj` expression * - The `oldCollection` object is a copy of the former collection data. * Due to performance considerations, the`oldCollection` value is computed only if the * `listener` function declares two or more arguments. * - The `scope` argument refers to the current scope. * * @returns {function()} Returns a de-registration function for this listener. When the * de-registration function is executed, the internal watch operation is terminated. */ $watchCollection: function(obj, listener) { $watchCollectionInterceptor.$stateful = true; var self = this; // the current value, updated on each dirty-check run var newValue; // a shallow copy of the newValue from the last dirty-check run, // updated to match newValue during dirty-check run var oldValue; // a shallow copy of the newValue from when the last change happened var veryOldValue; // only track veryOldValue if the listener is asking for it var trackVeryOldValue = (listener.length > 1); var changeDetected = 0; var changeDetector = $parse(obj, $watchCollectionInterceptor); var internalArray = []; var internalObject = {}; var initRun = true; var oldLength = 0; function $watchCollectionInterceptor(_value) { newValue = _value; var newLength, key, bothNaN, newItem, oldItem; // If the new value is undefined, then return undefined as the watch may be a one-time watch if (isUndefined(newValue)) return; if (!isObject(newValue)) { // if primitive if (oldValue !== newValue) { oldValue = newValue; changeDetected++; } } else if (isArrayLike(newValue)) { if (oldValue !== internalArray) { // we are transitioning from something which was not an array into array. oldValue = internalArray; oldLength = oldValue.length = 0; changeDetected++; } newLength = newValue.length; if (oldLength !== newLength) { // if lengths do not match we need to trigger change notification changeDetected++; oldValue.length = oldLength = newLength; } // copy the items to oldValue and look for changes. for (var i = 0; i < newLength; i++) { oldItem = oldValue[i]; newItem = newValue[i]; bothNaN = (oldItem !== oldItem) && (newItem !== newItem); if (!bothNaN && (oldItem !== newItem)) { changeDetected++; oldValue[i] = newItem; } } } else { if (oldValue !== internalObject) { // we are transitioning from something which was not an object into object. oldValue = internalObject = {}; oldLength = 0; changeDetected++; } // copy the items to oldValue and look for changes. newLength = 0; for (key in newValue) { if (newValue.hasOwnProperty(key)) { newLength++; newItem = newValue[key]; oldItem = oldValue[key]; if (key in oldValue) { bothNaN = (oldItem !== oldItem) && (newItem !== newItem); if (!bothNaN && (oldItem !== newItem)) { changeDetected++; oldValue[key] = newItem; } } else { oldLength++; oldValue[key] = newItem; changeDetected++; } } } if (oldLength > newLength) { // we used to have more keys, need to find them and destroy them. changeDetected++; for (key in oldValue) { if (!newValue.hasOwnProperty(key)) { oldLength--; delete oldValue[key]; } } } } return changeDetected; } function $watchCollectionAction() { if (initRun) { initRun = false; listener(newValue, newValue, self); } else { listener(newValue, veryOldValue, self); } // make a copy for the next time a collection is changed if (trackVeryOldValue) { if (!isObject(newValue)) { //primitive veryOldValue = newValue; } else if (isArrayLike(newValue)) { veryOldValue = new Array(newValue.length); for (var i = 0; i < newValue.length; i++) { veryOldValue[i] = newValue[i]; } } else { // if object veryOldValue = {}; for (var key in newValue) { if (hasOwnProperty.call(newValue, key)) { veryOldValue[key] = newValue[key]; } } } } } return this.$watch(changeDetector, $watchCollectionAction); }, /** * @ngdoc method * @name $rootScope.Scope#$digest * @kind function * * @description * Processes all of the {@link ng.$rootScope.Scope#$watch watchers} of the current scope and * its children. Because a {@link ng.$rootScope.Scope#$watch watcher}'s listener can change * the model, the `$digest()` keeps calling the {@link ng.$rootScope.Scope#$watch watchers} * until no more listeners are firing. This means that it is possible to get into an infinite * loop. This function will throw `'Maximum iteration limit exceeded.'` if the number of * iterations exceeds 10. * * Usually, you don't call `$digest()` directly in * {@link ng.directive:ngController controllers} or in * {@link ng.$compileProvider#directive directives}. * Instead, you should call {@link ng.$rootScope.Scope#$apply $apply()} (typically from within * a {@link ng.$compileProvider#directive directive}), which will force a `$digest()`. * * If you want to be notified whenever `$digest()` is called, * you can register a `watchExpression` function with * {@link ng.$rootScope.Scope#$watch $watch()} with no `listener`. * * In unit tests, you may need to call `$digest()` to simulate the scope life cycle. * * # Example * ```js var scope = ...; scope.name = 'misko'; scope.counter = 0; expect(scope.counter).toEqual(0); scope.$watch('name', function(newValue, oldValue) { scope.counter = scope.counter + 1; }); expect(scope.counter).toEqual(0); scope.$digest(); // the listener is always called during the first $digest loop after it was registered expect(scope.counter).toEqual(1); scope.$digest(); // but now it will not be called unless the value changes expect(scope.counter).toEqual(1); scope.name = 'adam'; scope.$digest(); expect(scope.counter).toEqual(2); * ``` * */ $digest: function() { var watch, value, last, watchers, length, dirty, ttl = TTL, next, current, target = this, watchLog = [], logIdx, logMsg, asyncTask; beginPhase('$digest'); // Check for changes to browser url that happened in sync before the call to $digest $browser.$$checkUrlChange(); if (this === $rootScope && applyAsyncId !== null) { // If this is the root scope, and $applyAsync has scheduled a deferred $apply(), then // cancel the scheduled $apply and flush the queue of expressions to be evaluated. $browser.defer.cancel(applyAsyncId); flushApplyAsync(); } lastDirtyWatch = null; do { // "while dirty" loop dirty = false; current = target; while (asyncQueue.length) { try { asyncTask = asyncQueue.shift(); asyncTask.scope.$eval(asyncTask.expression, asyncTask.locals); } catch (e) { $exceptionHandler(e); } lastDirtyWatch = null; } traverseScopesLoop: do { // "traverse the scopes" loop if ((watchers = current.$$watchers)) { // process our watches length = watchers.length; while (length--) { try { watch = watchers[length]; // Most common watches are on primitives, in which case we can short // circuit it with === operator, only when === fails do we use .equals if (watch) { if ((value = watch.get(current)) !== (last = watch.last) && !(watch.eq ? equals(value, last) : (typeof value === 'number' && typeof last === 'number' && isNaN(value) && isNaN(last)))) { dirty = true; lastDirtyWatch = watch; watch.last = watch.eq ? copy(value, null) : value; watch.fn(value, ((last === initWatchVal) ? value : last), current); if (ttl < 5) { logIdx = 4 - ttl; if (!watchLog[logIdx]) watchLog[logIdx] = []; watchLog[logIdx].push({ msg: isFunction(watch.exp) ? 'fn: ' + (watch.exp.name || watch.exp.toString()) : watch.exp, newVal: value, oldVal: last }); } } else if (watch === lastDirtyWatch) { // If the most recently dirty watcher is now clean, short circuit since the remaining watchers // have already been tested. dirty = false; break traverseScopesLoop; } } } catch (e) { $exceptionHandler(e); } } } // Insanity Warning: scope depth-first traversal // yes, this code is a bit crazy, but it works and we have tests to prove it! // this piece should be kept in sync with the traversal in $broadcast if (!(next = (current.$$childHead || (current !== target && current.$$nextSibling)))) { while (current !== target && !(next = current.$$nextSibling)) { current = current.$parent; } } } while ((current = next)); // `break traverseScopesLoop;` takes us to here if ((dirty || asyncQueue.length) && !(ttl--)) { clearPhase(); throw $rootScopeMinErr('infdig', '{0} $digest() iterations reached. Aborting!\n' + 'Watchers fired in the last 5 iterations: {1}', TTL, watchLog); } } while (dirty || asyncQueue.length); clearPhase(); while (postDigestQueue.length) { try { postDigestQueue.shift()(); } catch (e) { $exceptionHandler(e); } } }, /** * @ngdoc event * @name $rootScope.Scope#$destroy * @eventType broadcast on scope being destroyed * * @description * Broadcasted when a scope and its children are being destroyed. * * Note that, in AngularJS, there is also a `$destroy` jQuery event, which can be used to * clean up DOM bindings before an element is removed from the DOM. */ /** * @ngdoc method * @name $rootScope.Scope#$destroy * @kind function * * @description * Removes the current scope (and all of its children) from the parent scope. Removal implies * that calls to {@link ng.$rootScope.Scope#$digest $digest()} will no longer * propagate to the current scope and its children. Removal also implies that the current * scope is eligible for garbage collection. * * The `$destroy()` is usually used by directives such as * {@link ng.directive:ngRepeat ngRepeat} for managing the * unrolling of the loop. * * Just before a scope is destroyed, a `$destroy` event is broadcasted on this scope. * Application code can register a `$destroy` event handler that will give it a chance to * perform any necessary cleanup. * * Note that, in AngularJS, there is also a `$destroy` jQuery event, which can be used to * clean up DOM bindings before an element is removed from the DOM. */ $destroy: function() { // we can't destroy the root scope or a scope that has been already destroyed if (this.$$destroyed) return; var parent = this.$parent; this.$broadcast('$destroy'); this.$$destroyed = true; if (this === $rootScope) return; for (var eventName in this.$$listenerCount) { decrementListenerCount(this, this.$$listenerCount[eventName], eventName); } // sever all the references to parent scopes (after this cleanup, the current scope should // not be retained by any of our references and should be eligible for garbage collection) if (parent.$$childHead == this) parent.$$childHead = this.$$nextSibling; if (parent.$$childTail == this) parent.$$childTail = this.$$prevSibling; if (this.$$prevSibling) this.$$prevSibling.$$nextSibling = this.$$nextSibling; if (this.$$nextSibling) this.$$nextSibling.$$prevSibling = this.$$prevSibling; // Disable listeners, watchers and apply/digest methods this.$destroy = this.$digest = this.$apply = this.$evalAsync = this.$applyAsync = noop; this.$on = this.$watch = this.$watchGroup = function() { return noop; }; this.$$listeners = {}; // All of the code below is bogus code that works around V8's memory leak via optimized code // and inline caches. // // see: // - https://code.google.com/p/v8/issues/detail?id=2073#c26 // - https://github.com/angular/angular.js/issues/6794#issuecomment-38648909 // - https://github.com/angular/angular.js/issues/1313#issuecomment-10378451 this.$parent = this.$$nextSibling = this.$$prevSibling = this.$$childHead = this.$$childTail = this.$root = this.$$watchers = null; }, /** * @ngdoc method * @name $rootScope.Scope#$eval * @kind function * * @description * Executes the `expression` on the current scope and returns the result. Any exceptions in * the expression are propagated (uncaught). This is useful when evaluating Angular * expressions. * * # Example * ```js var scope = ng.$rootScope.Scope(); scope.a = 1; scope.b = 2; expect(scope.$eval('a+b')).toEqual(3); expect(scope.$eval(function(scope){ return scope.a + scope.b; })).toEqual(3); * ``` * * @param {(string|function())=} expression An angular expression to be executed. * * - `string`: execute using the rules as defined in {@link guide/expression expression}. * - `function(scope)`: execute the function with the current `scope` parameter. * * @param {(object)=} locals Local variables object, useful for overriding values in scope. * @returns {*} The result of evaluating the expression. */ $eval: function(expr, locals) { return $parse(expr)(this, locals); }, /** * @ngdoc method * @name $rootScope.Scope#$evalAsync * @kind function * * @description * Executes the expression on the current scope at a later point in time. * * The `$evalAsync` makes no guarantees as to when the `expression` will be executed, only * that: * * - it will execute after the function that scheduled the evaluation (preferably before DOM * rendering). * - at least one {@link ng.$rootScope.Scope#$digest $digest cycle} will be performed after * `expression` execution. * * Any exceptions from the execution of the expression are forwarded to the * {@link ng.$exceptionHandler $exceptionHandler} service. * * __Note:__ if this function is called outside of a `$digest` cycle, a new `$digest` cycle * will be scheduled. However, it is encouraged to always call code that changes the model * from within an `$apply` call. That includes code evaluated via `$evalAsync`. * * @param {(string|function())=} expression An angular expression to be executed. * * - `string`: execute using the rules as defined in {@link guide/expression expression}. * - `function(scope)`: execute the function with the current `scope` parameter. * * @param {(object)=} locals Local variables object, useful for overriding values in scope. */ $evalAsync: function(expr, locals) { // if we are outside of an $digest loop and this is the first time we are scheduling async // task also schedule async auto-flush if (!$rootScope.$$phase && !asyncQueue.length) { $browser.defer(function() { if (asyncQueue.length) { $rootScope.$digest(); } }); } asyncQueue.push({scope: this, expression: expr, locals: locals}); }, $$postDigest: function(fn) { postDigestQueue.push(fn); }, /** * @ngdoc method * @name $rootScope.Scope#$apply * @kind function * * @description * `$apply()` is used to execute an expression in angular from outside of the angular * framework. (For example from browser DOM events, setTimeout, XHR or third party libraries). * Because we are calling into the angular framework we need to perform proper scope life * cycle of {@link ng.$exceptionHandler exception handling}, * {@link ng.$rootScope.Scope#$digest executing watches}. * * ## Life cycle * * # Pseudo-Code of `$apply()` * ```js function $apply(expr) { try { return $eval(expr); } catch (e) { $exceptionHandler(e); } finally { $root.$digest(); } } * ``` * * * Scope's `$apply()` method transitions through the following stages: * * 1. The {@link guide/expression expression} is executed using the * {@link ng.$rootScope.Scope#$eval $eval()} method. * 2. Any exceptions from the execution of the expression are forwarded to the * {@link ng.$exceptionHandler $exceptionHandler} service. * 3. The {@link ng.$rootScope.Scope#$watch watch} listeners are fired immediately after the * expression was executed using the {@link ng.$rootScope.Scope#$digest $digest()} method. * * * @param {(string|function())=} exp An angular expression to be executed. * * - `string`: execute using the rules as defined in {@link guide/expression expression}. * - `function(scope)`: execute the function with current `scope` parameter. * * @returns {*} The result of evaluating the expression. */ $apply: function(expr) { try { beginPhase('$apply'); return this.$eval(expr); } catch (e) { $exceptionHandler(e); } finally { clearPhase(); try { $rootScope.$digest(); } catch (e) { $exceptionHandler(e); throw e; } } }, /** * @ngdoc method * @name $rootScope.Scope#$applyAsync * @kind function * * @description * Schedule the invocation of $apply to occur at a later time. The actual time difference * varies across browsers, but is typically around ~10 milliseconds. * * This can be used to queue up multiple expressions which need to be evaluated in the same * digest. * * @param {(string|function())=} exp An angular expression to be executed. * * - `string`: execute using the rules as defined in {@link guide/expression expression}. * - `function(scope)`: execute the function with current `scope` parameter. */ $applyAsync: function(expr) { var scope = this; expr && applyAsyncQueue.push($applyAsyncExpression); scheduleApplyAsync(); function $applyAsyncExpression() { scope.$eval(expr); } }, /** * @ngdoc method * @name $rootScope.Scope#$on * @kind function * * @description * Listens on events of a given type. See {@link ng.$rootScope.Scope#$emit $emit} for * discussion of event life cycle. * * The event listener function format is: `function(event, args...)`. The `event` object * passed into the listener has the following attributes: * * - `targetScope` - `{Scope}`: the scope on which the event was `$emit`-ed or * `$broadcast`-ed. * - `currentScope` - `{Scope}`: the scope that is currently handling the event. Once the * event propagates through the scope hierarchy, this property is set to null. * - `name` - `{string}`: name of the event. * - `stopPropagation` - `{function=}`: calling `stopPropagation` function will cancel * further event propagation (available only for events that were `$emit`-ed). * - `preventDefault` - `{function}`: calling `preventDefault` sets `defaultPrevented` flag * to true. * - `defaultPrevented` - `{boolean}`: true if `preventDefault` was called. * * @param {string} name Event name to listen on. * @param {function(event, ...args)} listener Function to call when the event is emitted. * @returns {function()} Returns a deregistration function for this listener. */ $on: function(name, listener) { var namedListeners = this.$$listeners[name]; if (!namedListeners) { this.$$listeners[name] = namedListeners = []; } namedListeners.push(listener); var current = this; do { if (!current.$$listenerCount[name]) { current.$$listenerCount[name] = 0; } current.$$listenerCount[name]++; } while ((current = current.$parent)); var self = this; return function() { var indexOfListener = namedListeners.indexOf(listener); if (indexOfListener !== -1) { namedListeners[indexOfListener] = null; decrementListenerCount(self, 1, name); } }; }, /** * @ngdoc method * @name $rootScope.Scope#$emit * @kind function * * @description * Dispatches an event `name` upwards through the scope hierarchy notifying the * registered {@link ng.$rootScope.Scope#$on} listeners. * * The event life cycle starts at the scope on which `$emit` was called. All * {@link ng.$rootScope.Scope#$on listeners} listening for `name` event on this scope get * notified. Afterwards, the event traverses upwards toward the root scope and calls all * registered listeners along the way. The event will stop propagating if one of the listeners * cancels it. * * Any exception emitted from the {@link ng.$rootScope.Scope#$on listeners} will be passed * onto the {@link ng.$exceptionHandler $exceptionHandler} service. * * @param {string} name Event name to emit. * @param {...*} args Optional one or more arguments which will be passed onto the event listeners. * @return {Object} Event object (see {@link ng.$rootScope.Scope#$on}). */ $emit: function(name, args) { var empty = [], namedListeners, scope = this, stopPropagation = false, event = { name: name, targetScope: scope, stopPropagation: function() {stopPropagation = true;}, preventDefault: function() { event.defaultPrevented = true; }, defaultPrevented: false }, listenerArgs = concat([event], arguments, 1), i, length; do { namedListeners = scope.$$listeners[name] || empty; event.currentScope = scope; for (i = 0, length = namedListeners.length; i < length; i++) { // if listeners were deregistered, defragment the array if (!namedListeners[i]) { namedListeners.splice(i, 1); i--; length--; continue; } try { //allow all listeners attached to the current scope to run namedListeners[i].apply(null, listenerArgs); } catch (e) { $exceptionHandler(e); } } //if any listener on the current scope stops propagation, prevent bubbling if (stopPropagation) { event.currentScope = null; return event; } //traverse upwards scope = scope.$parent; } while (scope); event.currentScope = null; return event; }, /** * @ngdoc method * @name $rootScope.Scope#$broadcast * @kind function * * @description * Dispatches an event `name` downwards to all child scopes (and their children) notifying the * registered {@link ng.$rootScope.Scope#$on} listeners. * * The event life cycle starts at the scope on which `$broadcast` was called. All * {@link ng.$rootScope.Scope#$on listeners} listening for `name` event on this scope get * notified. Afterwards, the event propagates to all direct and indirect scopes of the current * scope and calls all registered listeners along the way. The event cannot be canceled. * * Any exception emitted from the {@link ng.$rootScope.Scope#$on listeners} will be passed * onto the {@link ng.$exceptionHandler $exceptionHandler} service. * * @param {string} name Event name to broadcast. * @param {...*} args Optional one or more arguments which will be passed onto the event listeners. * @return {Object} Event object, see {@link ng.$rootScope.Scope#$on} */ $broadcast: function(name, args) { var target = this, current = target, next = target, event = { name: name, targetScope: target, preventDefault: function() { event.defaultPrevented = true; }, defaultPrevented: false }; if (!target.$$listenerCount[name]) return event; var listenerArgs = concat([event], arguments, 1), listeners, i, length; //down while you can, then up and next sibling or up and next sibling until back at root while ((current = next)) { event.currentScope = current; listeners = current.$$listeners[name] || []; for (i = 0, length = listeners.length; i < length; i++) { // if listeners were deregistered, defragment the array if (!listeners[i]) { listeners.splice(i, 1); i--; length--; continue; } try { listeners[i].apply(null, listenerArgs); } catch (e) { $exceptionHandler(e); } } // Insanity Warning: scope depth-first traversal // yes, this code is a bit crazy, but it works and we have tests to prove it! // this piece should be kept in sync with the traversal in $digest // (though it differs due to having the extra check for $$listenerCount) if (!(next = ((current.$$listenerCount[name] && current.$$childHead) || (current !== target && current.$$nextSibling)))) { while (current !== target && !(next = current.$$nextSibling)) { current = current.$parent; } } } event.currentScope = null; return event; } }; var $rootScope = new Scope(); //The internal queues. Expose them on the $rootScope for debugging/testing purposes. var asyncQueue = $rootScope.$$asyncQueue = []; var postDigestQueue = $rootScope.$$postDigestQueue = []; var applyAsyncQueue = $rootScope.$$applyAsyncQueue = []; return $rootScope; function beginPhase(phase) { if ($rootScope.$$phase) { throw $rootScopeMinErr('inprog', '{0} already in progress', $rootScope.$$phase); } $rootScope.$$phase = phase; } function clearPhase() { $rootScope.$$phase = null; } function decrementListenerCount(current, count, name) { do { current.$$listenerCount[name] -= count; if (current.$$listenerCount[name] === 0) { delete current.$$listenerCount[name]; } } while ((current = current.$parent)); } /** * function used as an initial value for watchers. * because it's unique we can easily tell it apart from other values */ function initWatchVal() {} function flushApplyAsync() { while (applyAsyncQueue.length) { try { applyAsyncQueue.shift()(); } catch (e) { $exceptionHandler(e); } } applyAsyncId = null; } function scheduleApplyAsync() { if (applyAsyncId === null) { applyAsyncId = $browser.defer(function() { $rootScope.$apply(flushApplyAsync); }); } } }]; } /** * @description * Private service to sanitize uris for links and images. Used by $compile and $sanitize. */ function $$SanitizeUriProvider() { var aHrefSanitizationWhitelist = /^\s*(https?|ftp|mailto|tel|file):/, imgSrcSanitizationWhitelist = /^\s*((https?|ftp|file|blob):|data:image\/)/; /** * @description * Retrieves or overrides the default regular expression that is used for whitelisting of safe * urls during a[href] sanitization. * * The sanitization is a security measure aimed at prevent XSS attacks via html links. * * Any url about to be assigned to a[href] via data-binding is first normalized and turned into * an absolute url. Afterwards, the url is matched against the `aHrefSanitizationWhitelist` * regular expression. If a match is found, the original url is written into the dom. Otherwise, * the absolute url is prefixed with `'unsafe:'` string and only then is it written into the DOM. * * @param {RegExp=} regexp New regexp to whitelist urls with. * @returns {RegExp|ng.$compileProvider} Current RegExp if called without value or self for * chaining otherwise. */ this.aHrefSanitizationWhitelist = function(regexp) { if (isDefined(regexp)) { aHrefSanitizationWhitelist = regexp; return this; } return aHrefSanitizationWhitelist; }; /** * @description * Retrieves or overrides the default regular expression that is used for whitelisting of safe * urls during img[src] sanitization. * * The sanitization is a security measure aimed at prevent XSS attacks via html links. * * Any url about to be assigned to img[src] via data-binding is first normalized and turned into * an absolute url. Afterwards, the url is matched against the `imgSrcSanitizationWhitelist` * regular expression. If a match is found, the original url is written into the dom. Otherwise, * the absolute url is prefixed with `'unsafe:'` string and only then is it written into the DOM. * * @param {RegExp=} regexp New regexp to whitelist urls with. * @returns {RegExp|ng.$compileProvider} Current RegExp if called without value or self for * chaining otherwise. */ this.imgSrcSanitizationWhitelist = function(regexp) { if (isDefined(regexp)) { imgSrcSanitizationWhitelist = regexp; return this; } return imgSrcSanitizationWhitelist; }; this.$get = function() { return function sanitizeUri(uri, isImage) { var regex = isImage ? imgSrcSanitizationWhitelist : aHrefSanitizationWhitelist; var normalizedVal; normalizedVal = urlResolve(uri).href; if (normalizedVal !== '' && !normalizedVal.match(regex)) { return 'unsafe:' + normalizedVal; } return uri; }; }; } var $sceMinErr = minErr('$sce'); var SCE_CONTEXTS = { HTML: 'html', CSS: 'css', URL: 'url', // RESOURCE_URL is a subtype of URL used in contexts where a privileged resource is sourced from a // url. (e.g. ng-include, script src, templateUrl) RESOURCE_URL: 'resourceUrl', JS: 'js' }; // Helper functions follow. function adjustMatcher(matcher) { if (matcher === 'self') { return matcher; } else if (isString(matcher)) { // Strings match exactly except for 2 wildcards - '*' and '**'. // '*' matches any character except those from the set ':/.?&'. // '**' matches any character (like .* in a RegExp). // More than 2 *'s raises an error as it's ill defined. if (matcher.indexOf('***') > -1) { throw $sceMinErr('iwcard', 'Illegal sequence *** in string matcher. String: {0}', matcher); } matcher = escapeForRegexp(matcher). replace('\\*\\*', '.*'). replace('\\*', '[^:/.?&;]*'); return new RegExp('^' + matcher + '$'); } else if (isRegExp(matcher)) { // The only other type of matcher allowed is a Regexp. // Match entire URL / disallow partial matches. // Flags are reset (i.e. no global, ignoreCase or multiline) return new RegExp('^' + matcher.source + '$'); } else { throw $sceMinErr('imatcher', 'Matchers may only be "self", string patterns or RegExp objects'); } } function adjustMatchers(matchers) { var adjustedMatchers = []; if (isDefined(matchers)) { forEach(matchers, function(matcher) { adjustedMatchers.push(adjustMatcher(matcher)); }); } return adjustedMatchers; } /** * @ngdoc service * @name $sceDelegate * @kind function * * @description * * `$sceDelegate` is a service that is used by the `$sce` service to provide {@link ng.$sce Strict * Contextual Escaping (SCE)} services to AngularJS. * * Typically, you would configure or override the {@link ng.$sceDelegate $sceDelegate} instead of * the `$sce` service to customize the way Strict Contextual Escaping works in AngularJS. This is * because, while the `$sce` provides numerous shorthand methods, etc., you really only need to * override 3 core functions (`trustAs`, `getTrusted` and `valueOf`) to replace the way things * work because `$sce` delegates to `$sceDelegate` for these operations. * * Refer {@link ng.$sceDelegateProvider $sceDelegateProvider} to configure this service. * * The default instance of `$sceDelegate` should work out of the box with little pain. While you * can override it completely to change the behavior of `$sce`, the common case would * involve configuring the {@link ng.$sceDelegateProvider $sceDelegateProvider} instead by setting * your own whitelists and blacklists for trusting URLs used for loading AngularJS resources such as * templates. Refer {@link ng.$sceDelegateProvider#resourceUrlWhitelist * $sceDelegateProvider.resourceUrlWhitelist} and {@link * ng.$sceDelegateProvider#resourceUrlBlacklist $sceDelegateProvider.resourceUrlBlacklist} */ /** * @ngdoc provider * @name $sceDelegateProvider * @description * * The `$sceDelegateProvider` provider allows developers to configure the {@link ng.$sceDelegate * $sceDelegate} service. This allows one to get/set the whitelists and blacklists used to ensure * that the URLs used for sourcing Angular templates are safe. Refer {@link * ng.$sceDelegateProvider#resourceUrlWhitelist $sceDelegateProvider.resourceUrlWhitelist} and * {@link ng.$sceDelegateProvider#resourceUrlBlacklist $sceDelegateProvider.resourceUrlBlacklist} * * For the general details about this service in Angular, read the main page for {@link ng.$sce * Strict Contextual Escaping (SCE)}. * * **Example**: Consider the following case. <a name="example"></a> * * - your app is hosted at url `http://myapp.example.com/` * - but some of your templates are hosted on other domains you control such as * `http://srv01.assets.example.com/`,  `http://srv02.assets.example.com/`, etc. * - and you have an open redirect at `http://myapp.example.com/clickThru?...`. * * Here is what a secure configuration for this scenario might look like: * * ``` * angular.module('myApp', []).config(function($sceDelegateProvider) { * $sceDelegateProvider.resourceUrlWhitelist([ * // Allow same origin resource loads. * 'self', * // Allow loading from our assets domain. Notice the difference between * and **. * 'http://srv*.assets.example.com/**' * ]); * * // The blacklist overrides the whitelist so the open redirect here is blocked. * $sceDelegateProvider.resourceUrlBlacklist([ * 'http://myapp.example.com/clickThru**' * ]); * }); * ``` */ function $SceDelegateProvider() { this.SCE_CONTEXTS = SCE_CONTEXTS; // Resource URLs can also be trusted by policy. var resourceUrlWhitelist = ['self'], resourceUrlBlacklist = []; /** * @ngdoc method * @name $sceDelegateProvider#resourceUrlWhitelist * @kind function * * @param {Array=} whitelist When provided, replaces the resourceUrlWhitelist with the value * provided. This must be an array or null. A snapshot of this array is used so further * changes to the array are ignored. * * Follow {@link ng.$sce#resourceUrlPatternItem this link} for a description of the items * allowed in this array. * * Note: **an empty whitelist array will block all URLs**! * * @return {Array} the currently set whitelist array. * * The **default value** when no whitelist has been explicitly set is `['self']` allowing only * same origin resource requests. * * @description * Sets/Gets the whitelist of trusted resource URLs. */ this.resourceUrlWhitelist = function(value) { if (arguments.length) { resourceUrlWhitelist = adjustMatchers(value); } return resourceUrlWhitelist; }; /** * @ngdoc method * @name $sceDelegateProvider#resourceUrlBlacklist * @kind function * * @param {Array=} blacklist When provided, replaces the resourceUrlBlacklist with the value * provided. This must be an array or null. A snapshot of this array is used so further * changes to the array are ignored. * * Follow {@link ng.$sce#resourceUrlPatternItem this link} for a description of the items * allowed in this array. * * The typical usage for the blacklist is to **block * [open redirects](http://cwe.mitre.org/data/definitions/601.html)** served by your domain as * these would otherwise be trusted but actually return content from the redirected domain. * * Finally, **the blacklist overrides the whitelist** and has the final say. * * @return {Array} the currently set blacklist array. * * The **default value** when no whitelist has been explicitly set is the empty array (i.e. there * is no blacklist.) * * @description * Sets/Gets the blacklist of trusted resource URLs. */ this.resourceUrlBlacklist = function(value) { if (arguments.length) { resourceUrlBlacklist = adjustMatchers(value); } return resourceUrlBlacklist; }; this.$get = ['$injector', function($injector) { var htmlSanitizer = function htmlSanitizer(html) { throw $sceMinErr('unsafe', 'Attempting to use an unsafe value in a safe context.'); }; if ($injector.has('$sanitize')) { htmlSanitizer = $injector.get('$sanitize'); } function matchUrl(matcher, parsedUrl) { if (matcher === 'self') { return urlIsSameOrigin(parsedUrl); } else { // definitely a regex. See adjustMatchers() return !!matcher.exec(parsedUrl.href); } } function isResourceUrlAllowedByPolicy(url) { var parsedUrl = urlResolve(url.toString()); var i, n, allowed = false; // Ensure that at least one item from the whitelist allows this url. for (i = 0, n = resourceUrlWhitelist.length; i < n; i++) { if (matchUrl(resourceUrlWhitelist[i], parsedUrl)) { allowed = true; break; } } if (allowed) { // Ensure that no item from the blacklist blocked this url. for (i = 0, n = resourceUrlBlacklist.length; i < n; i++) { if (matchUrl(resourceUrlBlacklist[i], parsedUrl)) { allowed = false; break; } } } return allowed; } function generateHolderType(Base) { var holderType = function TrustedValueHolderType(trustedValue) { this.$$unwrapTrustedValue = function() { return trustedValue; }; }; if (Base) { holderType.prototype = new Base(); } holderType.prototype.valueOf = function sceValueOf() { return this.$$unwrapTrustedValue(); }; holderType.prototype.toString = function sceToString() { return this.$$unwrapTrustedValue().toString(); }; return holderType; } var trustedValueHolderBase = generateHolderType(), byType = {}; byType[SCE_CONTEXTS.HTML] = generateHolderType(trustedValueHolderBase); byType[SCE_CONTEXTS.CSS] = generateHolderType(trustedValueHolderBase); byType[SCE_CONTEXTS.URL] = generateHolderType(trustedValueHolderBase); byType[SCE_CONTEXTS.JS] = generateHolderType(trustedValueHolderBase); byType[SCE_CONTEXTS.RESOURCE_URL] = generateHolderType(byType[SCE_CONTEXTS.URL]); /** * @ngdoc method * @name $sceDelegate#trustAs * * @description * Returns an object that is trusted by angular for use in specified strict * contextual escaping contexts (such as ng-bind-html, ng-include, any src * attribute interpolation, any dom event binding attribute interpolation * such as for onclick, etc.) that uses the provided value. * See {@link ng.$sce $sce} for enabling strict contextual escaping. * * @param {string} type The kind of context in which this value is safe for use. e.g. url, * resourceUrl, html, js and css. * @param {*} value The value that that should be considered trusted/safe. * @returns {*} A value that can be used to stand in for the provided `value` in places * where Angular expects a $sce.trustAs() return value. */ function trustAs(type, trustedValue) { var Constructor = (byType.hasOwnProperty(type) ? byType[type] : null); if (!Constructor) { throw $sceMinErr('icontext', 'Attempted to trust a value in invalid context. Context: {0}; Value: {1}', type, trustedValue); } if (trustedValue === null || trustedValue === undefined || trustedValue === '') { return trustedValue; } // All the current contexts in SCE_CONTEXTS happen to be strings. In order to avoid trusting // mutable objects, we ensure here that the value passed in is actually a string. if (typeof trustedValue !== 'string') { throw $sceMinErr('itype', 'Attempted to trust a non-string value in a content requiring a string: Context: {0}', type); } return new Constructor(trustedValue); } /** * @ngdoc method * @name $sceDelegate#valueOf * * @description * If the passed parameter had been returned by a prior call to {@link ng.$sceDelegate#trustAs * `$sceDelegate.trustAs`}, returns the value that had been passed to {@link * ng.$sceDelegate#trustAs `$sceDelegate.trustAs`}. * * If the passed parameter is not a value that had been returned by {@link * ng.$sceDelegate#trustAs `$sceDelegate.trustAs`}, returns it as-is. * * @param {*} value The result of a prior {@link ng.$sceDelegate#trustAs `$sceDelegate.trustAs`} * call or anything else. * @returns {*} The `value` that was originally provided to {@link ng.$sceDelegate#trustAs * `$sceDelegate.trustAs`} if `value` is the result of such a call. Otherwise, returns * `value` unchanged. */ function valueOf(maybeTrusted) { if (maybeTrusted instanceof trustedValueHolderBase) { return maybeTrusted.$$unwrapTrustedValue(); } else { return maybeTrusted; } } /** * @ngdoc method * @name $sceDelegate#getTrusted * * @description * Takes the result of a {@link ng.$sceDelegate#trustAs `$sceDelegate.trustAs`} call and * returns the originally supplied value if the queried context type is a supertype of the * created type. If this condition isn't satisfied, throws an exception. * * @param {string} type The kind of context in which this value is to be used. * @param {*} maybeTrusted The result of a prior {@link ng.$sceDelegate#trustAs * `$sceDelegate.trustAs`} call. * @returns {*} The value the was originally provided to {@link ng.$sceDelegate#trustAs * `$sceDelegate.trustAs`} if valid in this context. Otherwise, throws an exception. */ function getTrusted(type, maybeTrusted) { if (maybeTrusted === null || maybeTrusted === undefined || maybeTrusted === '') { return maybeTrusted; } var constructor = (byType.hasOwnProperty(type) ? byType[type] : null); if (constructor && maybeTrusted instanceof constructor) { return maybeTrusted.$$unwrapTrustedValue(); } // If we get here, then we may only take one of two actions. // 1. sanitize the value for the requested type, or // 2. throw an exception. if (type === SCE_CONTEXTS.RESOURCE_URL) { if (isResourceUrlAllowedByPolicy(maybeTrusted)) { return maybeTrusted; } else { throw $sceMinErr('insecurl', 'Blocked loading resource from url not allowed by $sceDelegate policy. URL: {0}', maybeTrusted.toString()); } } else if (type === SCE_CONTEXTS.HTML) { return htmlSanitizer(maybeTrusted); } throw $sceMinErr('unsafe', 'Attempting to use an unsafe value in a safe context.'); } return { trustAs: trustAs, getTrusted: getTrusted, valueOf: valueOf }; }]; } /** * @ngdoc provider * @name $sceProvider * @description * * The $sceProvider provider allows developers to configure the {@link ng.$sce $sce} service. * - enable/disable Strict Contextual Escaping (SCE) in a module * - override the default implementation with a custom delegate * * Read more about {@link ng.$sce Strict Contextual Escaping (SCE)}. */ /* jshint maxlen: false*/ /** * @ngdoc service * @name $sce * @kind function * * @description * * `$sce` is a service that provides Strict Contextual Escaping services to AngularJS. * * # Strict Contextual Escaping * * Strict Contextual Escaping (SCE) is a mode in which AngularJS requires bindings in certain * contexts to result in a value that is marked as safe to use for that context. One example of * such a context is binding arbitrary html controlled by the user via `ng-bind-html`. We refer * to these contexts as privileged or SCE contexts. * * As of version 1.2, Angular ships with SCE enabled by default. * * Note: When enabled (the default), IE<11 in quirks mode is not supported. In this mode, IE<11 allow * one to execute arbitrary javascript by the use of the expression() syntax. Refer * <http://blogs.msdn.com/b/ie/archive/2008/10/16/ending-expressions.aspx> to learn more about them. * You can ensure your document is in standards mode and not quirks mode by adding `<!doctype html>` * to the top of your HTML document. * * SCE assists in writing code in way that (a) is secure by default and (b) makes auditing for * security vulnerabilities such as XSS, clickjacking, etc. a lot easier. * * Here's an example of a binding in a privileged context: * * ``` * <input ng-model="userHtml"> * <div ng-bind-html="userHtml"></div> * ``` * * Notice that `ng-bind-html` is bound to `userHtml` controlled by the user. With SCE * disabled, this application allows the user to render arbitrary HTML into the DIV. * In a more realistic example, one may be rendering user comments, blog articles, etc. via * bindings. (HTML is just one example of a context where rendering user controlled input creates * security vulnerabilities.) * * For the case of HTML, you might use a library, either on the client side, or on the server side, * to sanitize unsafe HTML before binding to the value and rendering it in the document. * * How would you ensure that every place that used these types of bindings was bound to a value that * was sanitized by your library (or returned as safe for rendering by your server?) How can you * ensure that you didn't accidentally delete the line that sanitized the value, or renamed some * properties/fields and forgot to update the binding to the sanitized value? * * To be secure by default, you want to ensure that any such bindings are disallowed unless you can * determine that something explicitly says it's safe to use a value for binding in that * context. You can then audit your code (a simple grep would do) to ensure that this is only done * for those values that you can easily tell are safe - because they were received from your server, * sanitized by your library, etc. You can organize your codebase to help with this - perhaps * allowing only the files in a specific directory to do this. Ensuring that the internal API * exposed by that code doesn't markup arbitrary values as safe then becomes a more manageable task. * * In the case of AngularJS' SCE service, one uses {@link ng.$sce#trustAs $sce.trustAs} * (and shorthand methods such as {@link ng.$sce#trustAsHtml $sce.trustAsHtml}, etc.) to * obtain values that will be accepted by SCE / privileged contexts. * * * ## How does it work? * * In privileged contexts, directives and code will bind to the result of {@link ng.$sce#getTrusted * $sce.getTrusted(context, value)} rather than to the value directly. Directives use {@link * ng.$sce#parseAs $sce.parseAs} rather than `$parse` to watch attribute bindings, which performs the * {@link ng.$sce#getTrusted $sce.getTrusted} behind the scenes on non-constant literals. * * As an example, {@link ng.directive:ngBindHtml ngBindHtml} uses {@link * ng.$sce#parseAsHtml $sce.parseAsHtml(binding expression)}. Here's the actual code (slightly * simplified): * * ``` * var ngBindHtmlDirective = ['$sce', function($sce) { * return function(scope, element, attr) { * scope.$watch($sce.parseAsHtml(attr.ngBindHtml), function(value) { * element.html(value || ''); * }); * }; * }]; * ``` * * ## Impact on loading templates * * This applies both to the {@link ng.directive:ngInclude `ng-include`} directive as well as * `templateUrl`'s specified by {@link guide/directive directives}. * * By default, Angular only loads templates from the same domain and protocol as the application * document. This is done by calling {@link ng.$sce#getTrustedResourceUrl * $sce.getTrustedResourceUrl} on the template URL. To load templates from other domains and/or * protocols, you may either either {@link ng.$sceDelegateProvider#resourceUrlWhitelist whitelist * them} or {@link ng.$sce#trustAsResourceUrl wrap it} into a trusted value. * * *Please note*: * The browser's * [Same Origin Policy](https://code.google.com/p/browsersec/wiki/Part2#Same-origin_policy_for_XMLHttpRequest) * and [Cross-Origin Resource Sharing (CORS)](http://www.w3.org/TR/cors/) * policy apply in addition to this and may further restrict whether the template is successfully * loaded. This means that without the right CORS policy, loading templates from a different domain * won't work on all browsers. Also, loading templates from `file://` URL does not work on some * browsers. * * ## This feels like too much overhead * * It's important to remember that SCE only applies to interpolation expressions. * * If your expressions are constant literals, they're automatically trusted and you don't need to * call `$sce.trustAs` on them (remember to include the `ngSanitize` module) (e.g. * `<div ng-bind-html="'<b>implicitly trusted</b>'"></div>`) just works. * * Additionally, `a[href]` and `img[src]` automatically sanitize their URLs and do not pass them * through {@link ng.$sce#getTrusted $sce.getTrusted}. SCE doesn't play a role here. * * The included {@link ng.$sceDelegate $sceDelegate} comes with sane defaults to allow you to load * templates in `ng-include` from your application's domain without having to even know about SCE. * It blocks loading templates from other domains or loading templates over http from an https * served document. You can change these by setting your own custom {@link * ng.$sceDelegateProvider#resourceUrlWhitelist whitelists} and {@link * ng.$sceDelegateProvider#resourceUrlBlacklist blacklists} for matching such URLs. * * This significantly reduces the overhead. It is far easier to pay the small overhead and have an * application that's secure and can be audited to verify that with much more ease than bolting * security onto an application later. * * <a name="contexts"></a> * ## What trusted context types are supported? * * | Context | Notes | * |---------------------|----------------| * | `$sce.HTML` | For HTML that's safe to source into the application. The {@link ng.directive:ngBindHtml ngBindHtml} directive uses this context for bindings. If an unsafe value is encountered and the {@link ngSanitize $sanitize} module is present this will sanitize the value instead of throwing an error. | * | `$sce.CSS` | For CSS that's safe to source into the application. Currently unused. Feel free to use it in your own directives. | * | `$sce.URL` | For URLs that are safe to follow as links. Currently unused (`<a href=` and `<img src=` sanitize their urls and don't constitute an SCE context. | * | `$sce.RESOURCE_URL` | For URLs that are not only safe to follow as links, but whose contents are also safe to include in your application. Examples include `ng-include`, `src` / `ngSrc` bindings for tags other than `IMG` (e.g. `IFRAME`, `OBJECT`, etc.) <br><br>Note that `$sce.RESOURCE_URL` makes a stronger statement about the URL than `$sce.URL` does and therefore contexts requiring values trusted for `$sce.RESOURCE_URL` can be used anywhere that values trusted for `$sce.URL` are required. | * | `$sce.JS` | For JavaScript that is safe to execute in your application's context. Currently unused. Feel free to use it in your own directives. | * * ## Format of items in {@link ng.$sceDelegateProvider#resourceUrlWhitelist resourceUrlWhitelist}/{@link ng.$sceDelegateProvider#resourceUrlBlacklist Blacklist} <a name="resourceUrlPatternItem"></a> * * Each element in these arrays must be one of the following: * * - **'self'** * - The special **string**, `'self'`, can be used to match against all URLs of the **same * domain** as the application document using the **same protocol**. * - **String** (except the special value `'self'`) * - The string is matched against the full *normalized / absolute URL* of the resource * being tested (substring matches are not good enough.) * - There are exactly **two wildcard sequences** - `*` and `**`. All other characters * match themselves. * - `*`: matches zero or more occurrences of any character other than one of the following 6 * characters: '`:`', '`/`', '`.`', '`?`', '`&`' and ';'. It's a useful wildcard for use * in a whitelist. * - `**`: matches zero or more occurrences of *any* character. As such, it's not * not appropriate to use in for a scheme, domain, etc. as it would match too much. (e.g. * http://**.example.com/ would match http://evil.com/?ignore=.example.com/ and that might * not have been the intention.) Its usage at the very end of the path is ok. (e.g. * http://foo.example.com/templates/**). * - **RegExp** (*see caveat below*) * - *Caveat*: While regular expressions are powerful and offer great flexibility, their syntax * (and all the inevitable escaping) makes them *harder to maintain*. It's easy to * accidentally introduce a bug when one updates a complex expression (imho, all regexes should * have good test coverage.). For instance, the use of `.` in the regex is correct only in a * small number of cases. A `.` character in the regex used when matching the scheme or a * subdomain could be matched against a `:` or literal `.` that was likely not intended. It * is highly recommended to use the string patterns and only fall back to regular expressions * if they as a last resort. * - The regular expression must be an instance of RegExp (i.e. not a string.) It is * matched against the **entire** *normalized / absolute URL* of the resource being tested * (even when the RegExp did not have the `^` and `$` codes.) In addition, any flags * present on the RegExp (such as multiline, global, ignoreCase) are ignored. * - If you are generating your JavaScript from some other templating engine (not * recommended, e.g. in issue [#4006](https://github.com/angular/angular.js/issues/4006)), * remember to escape your regular expression (and be aware that you might need more than * one level of escaping depending on your templating engine and the way you interpolated * the value.) Do make use of your platform's escaping mechanism as it might be good * enough before coding your own. e.g. Ruby has * [Regexp.escape(str)](http://www.ruby-doc.org/core-2.0.0/Regexp.html#method-c-escape) * and Python has [re.escape](http://docs.python.org/library/re.html#re.escape). * Javascript lacks a similar built in function for escaping. Take a look at Google * Closure library's [goog.string.regExpEscape(s)]( * http://docs.closure-library.googlecode.com/git/closure_goog_string_string.js.source.html#line962). * * Refer {@link ng.$sceDelegateProvider $sceDelegateProvider} for an example. * * ## Show me an example using SCE. * * <example module="mySceApp" deps="angular-sanitize.js"> * <file name="index.html"> * <div ng-controller="AppController as myCtrl"> * <i ng-bind-html="myCtrl.explicitlyTrustedHtml" id="explicitlyTrustedHtml"></i><br><br> * <b>User comments</b><br> * By default, HTML that isn't explicitly trusted (e.g. Alice's comment) is sanitized when * $sanitize is available. If $sanitize isn't available, this results in an error instead of an * exploit. * <div class="well"> * <div ng-repeat="userComment in myCtrl.userComments"> * <b>{{userComment.name}}</b>: * <span ng-bind-html="userComment.htmlComment" class="htmlComment"></span> * <br> * </div> * </div> * </div> * </file> * * <file name="script.js"> * angular.module('mySceApp', ['ngSanitize']) * .controller('AppController', ['$http', '$templateCache', '$sce', * function($http, $templateCache, $sce) { * var self = this; * $http.get("test_data.json", {cache: $templateCache}).success(function(userComments) { * self.userComments = userComments; * }); * self.explicitlyTrustedHtml = $sce.trustAsHtml( * '<span onmouseover="this.textContent=&quot;Explicitly trusted HTML bypasses ' + * 'sanitization.&quot;">Hover over this text.</span>'); * }]); * </file> * * <file name="test_data.json"> * [ * { "name": "Alice", * "htmlComment": * "<span onmouseover='this.textContent=\"PWN3D!\"'>Is <i>anyone</i> reading this?</span>" * }, * { "name": "Bob", * "htmlComment": "<i>Yes!</i> Am I the only other one?" * } * ] * </file> * * <file name="protractor.js" type="protractor"> * describe('SCE doc demo', function() { * it('should sanitize untrusted values', function() { * expect(element.all(by.css('.htmlComment')).first().getInnerHtml()) * .toBe('<span>Is <i>anyone</i> reading this?</span>'); * }); * * it('should NOT sanitize explicitly trusted values', function() { * expect(element(by.id('explicitlyTrustedHtml')).getInnerHtml()).toBe( * '<span onmouseover="this.textContent=&quot;Explicitly trusted HTML bypasses ' + * 'sanitization.&quot;">Hover over this text.</span>'); * }); * }); * </file> * </example> * * * * ## Can I disable SCE completely? * * Yes, you can. However, this is strongly discouraged. SCE gives you a lot of security benefits * for little coding overhead. It will be much harder to take an SCE disabled application and * either secure it on your own or enable SCE at a later stage. It might make sense to disable SCE * for cases where you have a lot of existing code that was written before SCE was introduced and * you're migrating them a module at a time. * * That said, here's how you can completely disable SCE: * * ``` * angular.module('myAppWithSceDisabledmyApp', []).config(function($sceProvider) { * // Completely disable SCE. For demonstration purposes only! * // Do not use in new projects. * $sceProvider.enabled(false); * }); * ``` * */ /* jshint maxlen: 100 */ function $SceProvider() { var enabled = true; /** * @ngdoc method * @name $sceProvider#enabled * @kind function * * @param {boolean=} value If provided, then enables/disables SCE. * @return {boolean} true if SCE is enabled, false otherwise. * * @description * Enables/disables SCE and returns the current value. */ this.enabled = function(value) { if (arguments.length) { enabled = !!value; } return enabled; }; /* Design notes on the default implementation for SCE. * * The API contract for the SCE delegate * ------------------------------------- * The SCE delegate object must provide the following 3 methods: * * - trustAs(contextEnum, value) * This method is used to tell the SCE service that the provided value is OK to use in the * contexts specified by contextEnum. It must return an object that will be accepted by * getTrusted() for a compatible contextEnum and return this value. * * - valueOf(value) * For values that were not produced by trustAs(), return them as is. For values that were * produced by trustAs(), return the corresponding input value to trustAs. Basically, if * trustAs is wrapping the given values into some type, this operation unwraps it when given * such a value. * * - getTrusted(contextEnum, value) * This function should return the a value that is safe to use in the context specified by * contextEnum or throw and exception otherwise. * * NOTE: This contract deliberately does NOT state that values returned by trustAs() must be * opaque or wrapped in some holder object. That happens to be an implementation detail. For * instance, an implementation could maintain a registry of all trusted objects by context. In * such a case, trustAs() would return the same object that was passed in. getTrusted() would * return the same object passed in if it was found in the registry under a compatible context or * throw an exception otherwise. An implementation might only wrap values some of the time based * on some criteria. getTrusted() might return a value and not throw an exception for special * constants or objects even if not wrapped. All such implementations fulfill this contract. * * * A note on the inheritance model for SCE contexts * ------------------------------------------------ * I've used inheritance and made RESOURCE_URL wrapped types a subtype of URL wrapped types. This * is purely an implementation details. * * The contract is simply this: * * getTrusted($sce.RESOURCE_URL, value) succeeding implies that getTrusted($sce.URL, value) * will also succeed. * * Inheritance happens to capture this in a natural way. In some future, we * may not use inheritance anymore. That is OK because no code outside of * sce.js and sceSpecs.js would need to be aware of this detail. */ this.$get = ['$parse', '$sceDelegate', function( $parse, $sceDelegate) { // Prereq: Ensure that we're not running in IE<11 quirks mode. In that mode, IE < 11 allow // the "expression(javascript expression)" syntax which is insecure. if (enabled && msie < 8) { throw $sceMinErr('iequirks', 'Strict Contextual Escaping does not support Internet Explorer version < 11 in quirks ' + 'mode. You can fix this by adding the text <!doctype html> to the top of your HTML ' + 'document. See http://docs.angularjs.org/api/ng.$sce for more information.'); } var sce = shallowCopy(SCE_CONTEXTS); /** * @ngdoc method * @name $sce#isEnabled * @kind function * * @return {Boolean} true if SCE is enabled, false otherwise. If you want to set the value, you * have to do it at module config time on {@link ng.$sceProvider $sceProvider}. * * @description * Returns a boolean indicating if SCE is enabled. */ sce.isEnabled = function() { return enabled; }; sce.trustAs = $sceDelegate.trustAs; sce.getTrusted = $sceDelegate.getTrusted; sce.valueOf = $sceDelegate.valueOf; if (!enabled) { sce.trustAs = sce.getTrusted = function(type, value) { return value; }; sce.valueOf = identity; } /** * @ngdoc method * @name $sce#parseAs * * @description * Converts Angular {@link guide/expression expression} into a function. This is like {@link * ng.$parse $parse} and is identical when the expression is a literal constant. Otherwise, it * wraps the expression in a call to {@link ng.$sce#getTrusted $sce.getTrusted(*type*, * *result*)} * * @param {string} type The kind of SCE context in which this result will be used. * @param {string} expression String expression to compile. * @returns {function(context, locals)} a function which represents the compiled expression: * * * `context` – `{object}` – an object against which any expressions embedded in the strings * are evaluated against (typically a scope object). * * `locals` – `{object=}` – local variables context object, useful for overriding values in * `context`. */ sce.parseAs = function sceParseAs(type, expr) { var parsed = $parse(expr); if (parsed.literal && parsed.constant) { return parsed; } else { return $parse(expr, function(value) { return sce.getTrusted(type, value); }); } }; /** * @ngdoc method * @name $sce#trustAs * * @description * Delegates to {@link ng.$sceDelegate#trustAs `$sceDelegate.trustAs`}. As such, * returns an object that is trusted by angular for use in specified strict contextual * escaping contexts (such as ng-bind-html, ng-include, any src attribute * interpolation, any dom event binding attribute interpolation such as for onclick, etc.) * that uses the provided value. See * {@link ng.$sce $sce} for enabling strict contextual * escaping. * * @param {string} type The kind of context in which this value is safe for use. e.g. url, * resource_url, html, js and css. * @param {*} value The value that that should be considered trusted/safe. * @returns {*} A value that can be used to stand in for the provided `value` in places * where Angular expects a $sce.trustAs() return value. */ /** * @ngdoc method * @name $sce#trustAsHtml * * @description * Shorthand method. `$sce.trustAsHtml(value)` → * {@link ng.$sceDelegate#trustAs `$sceDelegate.trustAs($sce.HTML, value)`} * * @param {*} value The value to trustAs. * @returns {*} An object that can be passed to {@link ng.$sce#getTrustedHtml * $sce.getTrustedHtml(value)} to obtain the original value. (privileged directives * only accept expressions that are either literal constants or are the * return value of {@link ng.$sce#trustAs $sce.trustAs}.) */ /** * @ngdoc method * @name $sce#trustAsUrl * * @description * Shorthand method. `$sce.trustAsUrl(value)` → * {@link ng.$sceDelegate#trustAs `$sceDelegate.trustAs($sce.URL, value)`} * * @param {*} value The value to trustAs. * @returns {*} An object that can be passed to {@link ng.$sce#getTrustedUrl * $sce.getTrustedUrl(value)} to obtain the original value. (privileged directives * only accept expressions that are either literal constants or are the * return value of {@link ng.$sce#trustAs $sce.trustAs}.) */ /** * @ngdoc method * @name $sce#trustAsResourceUrl * * @description * Shorthand method. `$sce.trustAsResourceUrl(value)` → * {@link ng.$sceDelegate#trustAs `$sceDelegate.trustAs($sce.RESOURCE_URL, value)`} * * @param {*} value The value to trustAs. * @returns {*} An object that can be passed to {@link ng.$sce#getTrustedResourceUrl * $sce.getTrustedResourceUrl(value)} to obtain the original value. (privileged directives * only accept expressions that are either literal constants or are the return * value of {@link ng.$sce#trustAs $sce.trustAs}.) */ /** * @ngdoc method * @name $sce#trustAsJs * * @description * Shorthand method. `$sce.trustAsJs(value)` → * {@link ng.$sceDelegate#trustAs `$sceDelegate.trustAs($sce.JS, value)`} * * @param {*} value The value to trustAs. * @returns {*} An object that can be passed to {@link ng.$sce#getTrustedJs * $sce.getTrustedJs(value)} to obtain the original value. (privileged directives * only accept expressions that are either literal constants or are the * return value of {@link ng.$sce#trustAs $sce.trustAs}.) */ /** * @ngdoc method * @name $sce#getTrusted * * @description * Delegates to {@link ng.$sceDelegate#getTrusted `$sceDelegate.getTrusted`}. As such, * takes the result of a {@link ng.$sce#trustAs `$sce.trustAs`}() call and returns the * originally supplied value if the queried context type is a supertype of the created type. * If this condition isn't satisfied, throws an exception. * * @param {string} type The kind of context in which this value is to be used. * @param {*} maybeTrusted The result of a prior {@link ng.$sce#trustAs `$sce.trustAs`} * call. * @returns {*} The value the was originally provided to * {@link ng.$sce#trustAs `$sce.trustAs`} if valid in this context. * Otherwise, throws an exception. */ /** * @ngdoc method * @name $sce#getTrustedHtml * * @description * Shorthand method. `$sce.getTrustedHtml(value)` → * {@link ng.$sceDelegate#getTrusted `$sceDelegate.getTrusted($sce.HTML, value)`} * * @param {*} value The value to pass to `$sce.getTrusted`. * @returns {*} The return value of `$sce.getTrusted($sce.HTML, value)` */ /** * @ngdoc method * @name $sce#getTrustedCss * * @description * Shorthand method. `$sce.getTrustedCss(value)` → * {@link ng.$sceDelegate#getTrusted `$sceDelegate.getTrusted($sce.CSS, value)`} * * @param {*} value The value to pass to `$sce.getTrusted`. * @returns {*} The return value of `$sce.getTrusted($sce.CSS, value)` */ /** * @ngdoc method * @name $sce#getTrustedUrl * * @description * Shorthand method. `$sce.getTrustedUrl(value)` → * {@link ng.$sceDelegate#getTrusted `$sceDelegate.getTrusted($sce.URL, value)`} * * @param {*} value The value to pass to `$sce.getTrusted`. * @returns {*} The return value of `$sce.getTrusted($sce.URL, value)` */ /** * @ngdoc method * @name $sce#getTrustedResourceUrl * * @description * Shorthand method. `$sce.getTrustedResourceUrl(value)` → * {@link ng.$sceDelegate#getTrusted `$sceDelegate.getTrusted($sce.RESOURCE_URL, value)`} * * @param {*} value The value to pass to `$sceDelegate.getTrusted`. * @returns {*} The return value of `$sce.getTrusted($sce.RESOURCE_URL, value)` */ /** * @ngdoc method * @name $sce#getTrustedJs * * @description * Shorthand method. `$sce.getTrustedJs(value)` → * {@link ng.$sceDelegate#getTrusted `$sceDelegate.getTrusted($sce.JS, value)`} * * @param {*} value The value to pass to `$sce.getTrusted`. * @returns {*} The return value of `$sce.getTrusted($sce.JS, value)` */ /** * @ngdoc method * @name $sce#parseAsHtml * * @description * Shorthand method. `$sce.parseAsHtml(expression string)` → * {@link ng.$sce#parseAs `$sce.parseAs($sce.HTML, value)`} * * @param {string} expression String expression to compile. * @returns {function(context, locals)} a function which represents the compiled expression: * * * `context` – `{object}` – an object against which any expressions embedded in the strings * are evaluated against (typically a scope object). * * `locals` – `{object=}` – local variables context object, useful for overriding values in * `context`. */ /** * @ngdoc method * @name $sce#parseAsCss * * @description * Shorthand method. `$sce.parseAsCss(value)` → * {@link ng.$sce#parseAs `$sce.parseAs($sce.CSS, value)`} * * @param {string} expression String expression to compile. * @returns {function(context, locals)} a function which represents the compiled expression: * * * `context` – `{object}` – an object against which any expressions embedded in the strings * are evaluated against (typically a scope object). * * `locals` – `{object=}` – local variables context object, useful for overriding values in * `context`. */ /** * @ngdoc method * @name $sce#parseAsUrl * * @description * Shorthand method. `$sce.parseAsUrl(value)` → * {@link ng.$sce#parseAs `$sce.parseAs($sce.URL, value)`} * * @param {string} expression String expression to compile. * @returns {function(context, locals)} a function which represents the compiled expression: * * * `context` – `{object}` – an object against which any expressions embedded in the strings * are evaluated against (typically a scope object). * * `locals` – `{object=}` – local variables context object, useful for overriding values in * `context`. */ /** * @ngdoc method * @name $sce#parseAsResourceUrl * * @description * Shorthand method. `$sce.parseAsResourceUrl(value)` → * {@link ng.$sce#parseAs `$sce.parseAs($sce.RESOURCE_URL, value)`} * * @param {string} expression String expression to compile. * @returns {function(context, locals)} a function which represents the compiled expression: * * * `context` – `{object}` – an object against which any expressions embedded in the strings * are evaluated against (typically a scope object). * * `locals` – `{object=}` – local variables context object, useful for overriding values in * `context`. */ /** * @ngdoc method * @name $sce#parseAsJs * * @description * Shorthand method. `$sce.parseAsJs(value)` → * {@link ng.$sce#parseAs `$sce.parseAs($sce.JS, value)`} * * @param {string} expression String expression to compile. * @returns {function(context, locals)} a function which represents the compiled expression: * * * `context` – `{object}` – an object against which any expressions embedded in the strings * are evaluated against (typically a scope object). * * `locals` – `{object=}` – local variables context object, useful for overriding values in * `context`. */ // Shorthand delegations. var parse = sce.parseAs, getTrusted = sce.getTrusted, trustAs = sce.trustAs; forEach(SCE_CONTEXTS, function(enumValue, name) { var lName = lowercase(name); sce[camelCase("parse_as_" + lName)] = function(expr) { return parse(enumValue, expr); }; sce[camelCase("get_trusted_" + lName)] = function(value) { return getTrusted(enumValue, value); }; sce[camelCase("trust_as_" + lName)] = function(value) { return trustAs(enumValue, value); }; }); return sce; }]; } /** * !!! This is an undocumented "private" service !!! * * @name $sniffer * @requires $window * @requires $document * * @property {boolean} history Does the browser support html5 history api ? * @property {boolean} transitions Does the browser support CSS transition events ? * @property {boolean} animations Does the browser support CSS animation events ? * * @description * This is very simple implementation of testing browser's features. */ function $SnifferProvider() { this.$get = ['$window', '$document', function($window, $document) { var eventSupport = {}, android = int((/android (\d+)/.exec(lowercase(($window.navigator || {}).userAgent)) || [])[1]), boxee = /Boxee/i.test(($window.navigator || {}).userAgent), document = $document[0] || {}, vendorPrefix, vendorRegex = /^(Moz|webkit|ms)(?=[A-Z])/, bodyStyle = document.body && document.body.style, transitions = false, animations = false, match; if (bodyStyle) { for (var prop in bodyStyle) { if (match = vendorRegex.exec(prop)) { vendorPrefix = match[0]; vendorPrefix = vendorPrefix.substr(0, 1).toUpperCase() + vendorPrefix.substr(1); break; } } if (!vendorPrefix) { vendorPrefix = ('WebkitOpacity' in bodyStyle) && 'webkit'; } transitions = !!(('transition' in bodyStyle) || (vendorPrefix + 'Transition' in bodyStyle)); animations = !!(('animation' in bodyStyle) || (vendorPrefix + 'Animation' in bodyStyle)); if (android && (!transitions || !animations)) { transitions = isString(document.body.style.webkitTransition); animations = isString(document.body.style.webkitAnimation); } } return { // Android has history.pushState, but it does not update location correctly // so let's not use the history API at all. // http://code.google.com/p/android/issues/detail?id=17471 // https://github.com/angular/angular.js/issues/904 // older webkit browser (533.9) on Boxee box has exactly the same problem as Android has // so let's not use the history API also // We are purposefully using `!(android < 4)` to cover the case when `android` is undefined // jshint -W018 history: !!($window.history && $window.history.pushState && !(android < 4) && !boxee), // jshint +W018 hasEvent: function(event) { // IE9 implements 'input' event it's so fubared that we rather pretend that it doesn't have // it. In particular the event is not fired when backspace or delete key are pressed or // when cut operation is performed. // IE10+ implements 'input' event but it erroneously fires under various situations, // e.g. when placeholder changes, or a form is focused. if (event === 'input' && msie <= 11) return false; if (isUndefined(eventSupport[event])) { var divElm = document.createElement('div'); eventSupport[event] = 'on' + event in divElm; } return eventSupport[event]; }, csp: csp(), vendorPrefix: vendorPrefix, transitions: transitions, animations: animations, android: android }; }]; } var $compileMinErr = minErr('$compile'); /** * @ngdoc service * @name $templateRequest * * @description * The `$templateRequest` service downloads the provided template using `$http` and, upon success, * stores the contents inside of `$templateCache`. If the HTTP request fails or the response data * of the HTTP request is empty, a `$compile` error will be thrown (the exception can be thwarted * by setting the 2nd parameter of the function to true). * * @param {string} tpl The HTTP request template URL * @param {boolean=} ignoreRequestError Whether or not to ignore the exception when the request fails or the template is empty * * @return {Promise} the HTTP Promise for the given. * * @property {number} totalPendingRequests total amount of pending template requests being downloaded. */ function $TemplateRequestProvider() { this.$get = ['$templateCache', '$http', '$q', function($templateCache, $http, $q) { function handleRequestFn(tpl, ignoreRequestError) { handleRequestFn.totalPendingRequests++; var transformResponse = $http.defaults && $http.defaults.transformResponse; if (isArray(transformResponse)) { transformResponse = transformResponse.filter(function(transformer) { return transformer !== defaultHttpResponseTransform; }); } else if (transformResponse === defaultHttpResponseTransform) { transformResponse = null; } var httpOptions = { cache: $templateCache, transformResponse: transformResponse }; return $http.get(tpl, httpOptions) .finally(function() { handleRequestFn.totalPendingRequests--; }) .then(function(response) { return response.data; }, handleError); function handleError(resp) { if (!ignoreRequestError) { throw $compileMinErr('tpload', 'Failed to load template: {0}', tpl); } return $q.reject(resp); } } handleRequestFn.totalPendingRequests = 0; return handleRequestFn; }]; } function $$TestabilityProvider() { this.$get = ['$rootScope', '$browser', '$location', function($rootScope, $browser, $location) { /** * @name $testability * * @description * The private $$testability service provides a collection of methods for use when debugging * or by automated test and debugging tools. */ var testability = {}; /** * @name $$testability#findBindings * * @description * Returns an array of elements that are bound (via ng-bind or {{}}) * to expressions matching the input. * * @param {Element} element The element root to search from. * @param {string} expression The binding expression to match. * @param {boolean} opt_exactMatch If true, only returns exact matches * for the expression. Filters and whitespace are ignored. */ testability.findBindings = function(element, expression, opt_exactMatch) { var bindings = element.getElementsByClassName('ng-binding'); var matches = []; forEach(bindings, function(binding) { var dataBinding = angular.element(binding).data('$binding'); if (dataBinding) { forEach(dataBinding, function(bindingName) { if (opt_exactMatch) { var matcher = new RegExp('(^|\\s)' + escapeForRegexp(expression) + '(\\s|\\||$)'); if (matcher.test(bindingName)) { matches.push(binding); } } else { if (bindingName.indexOf(expression) != -1) { matches.push(binding); } } }); } }); return matches; }; /** * @name $$testability#findModels * * @description * Returns an array of elements that are two-way found via ng-model to * expressions matching the input. * * @param {Element} element The element root to search from. * @param {string} expression The model expression to match. * @param {boolean} opt_exactMatch If true, only returns exact matches * for the expression. */ testability.findModels = function(element, expression, opt_exactMatch) { var prefixes = ['ng-', 'data-ng-', 'ng\\:']; for (var p = 0; p < prefixes.length; ++p) { var attributeEquals = opt_exactMatch ? '=' : '*='; var selector = '[' + prefixes[p] + 'model' + attributeEquals + '"' + expression + '"]'; var elements = element.querySelectorAll(selector); if (elements.length) { return elements; } } }; /** * @name $$testability#getLocation * * @description * Shortcut for getting the location in a browser agnostic way. Returns * the path, search, and hash. (e.g. /path?a=b#hash) */ testability.getLocation = function() { return $location.url(); }; /** * @name $$testability#setLocation * * @description * Shortcut for navigating to a location without doing a full page reload. * * @param {string} url The location url (path, search and hash, * e.g. /path?a=b#hash) to go to. */ testability.setLocation = function(url) { if (url !== $location.url()) { $location.url(url); $rootScope.$digest(); } }; /** * @name $$testability#whenStable * * @description * Calls the callback when $timeout and $http requests are completed. * * @param {function} callback */ testability.whenStable = function(callback) { $browser.notifyWhenNoOutstandingRequests(callback); }; return testability; }]; } function $TimeoutProvider() { this.$get = ['$rootScope', '$browser', '$q', '$$q', '$exceptionHandler', function($rootScope, $browser, $q, $$q, $exceptionHandler) { var deferreds = {}; /** * @ngdoc service * @name $timeout * * @description * Angular's wrapper for `window.setTimeout`. The `fn` function is wrapped into a try/catch * block and delegates any exceptions to * {@link ng.$exceptionHandler $exceptionHandler} service. * * The return value of registering a timeout function is a promise, which will be resolved when * the timeout is reached and the timeout function is executed. * * To cancel a timeout request, call `$timeout.cancel(promise)`. * * In tests you can use {@link ngMock.$timeout `$timeout.flush()`} to * synchronously flush the queue of deferred functions. * * @param {function()} fn A function, whose execution should be delayed. * @param {number=} [delay=0] Delay in milliseconds. * @param {boolean=} [invokeApply=true] If set to `false` skips model dirty checking, otherwise * will invoke `fn` within the {@link ng.$rootScope.Scope#$apply $apply} block. * @returns {Promise} Promise that will be resolved when the timeout is reached. The value this * promise will be resolved with is the return value of the `fn` function. * */ function timeout(fn, delay, invokeApply) { var skipApply = (isDefined(invokeApply) && !invokeApply), deferred = (skipApply ? $$q : $q).defer(), promise = deferred.promise, timeoutId; timeoutId = $browser.defer(function() { try { deferred.resolve(fn()); } catch (e) { deferred.reject(e); $exceptionHandler(e); } finally { delete deferreds[promise.$$timeoutId]; } if (!skipApply) $rootScope.$apply(); }, delay); promise.$$timeoutId = timeoutId; deferreds[timeoutId] = deferred; return promise; } /** * @ngdoc method * @name $timeout#cancel * * @description * Cancels a task associated with the `promise`. As a result of this, the promise will be * resolved with a rejection. * * @param {Promise=} promise Promise returned by the `$timeout` function. * @returns {boolean} Returns `true` if the task hasn't executed yet and was successfully * canceled. */ timeout.cancel = function(promise) { if (promise && promise.$$timeoutId in deferreds) { deferreds[promise.$$timeoutId].reject('canceled'); delete deferreds[promise.$$timeoutId]; return $browser.defer.cancel(promise.$$timeoutId); } return false; }; return timeout; }]; } // NOTE: The usage of window and document instead of $window and $document here is // deliberate. This service depends on the specific behavior of anchor nodes created by the // browser (resolving and parsing URLs) that is unlikely to be provided by mock objects and // cause us to break tests. In addition, when the browser resolves a URL for XHR, it // doesn't know about mocked locations and resolves URLs to the real document - which is // exactly the behavior needed here. There is little value is mocking these out for this // service. var urlParsingNode = document.createElement("a"); var originUrl = urlResolve(window.location.href); /** * * Implementation Notes for non-IE browsers * ---------------------------------------- * Assigning a URL to the href property of an anchor DOM node, even one attached to the DOM, * results both in the normalizing and parsing of the URL. Normalizing means that a relative * URL will be resolved into an absolute URL in the context of the application document. * Parsing means that the anchor node's host, hostname, protocol, port, pathname and related * properties are all populated to reflect the normalized URL. This approach has wide * compatibility - Safari 1+, Mozilla 1+, Opera 7+,e etc. See * http://www.aptana.com/reference/html/api/HTMLAnchorElement.html * * Implementation Notes for IE * --------------------------- * IE >= 8 and <= 10 normalizes the URL when assigned to the anchor node similar to the other * browsers. However, the parsed components will not be set if the URL assigned did not specify * them. (e.g. if you assign a.href = "foo", then a.protocol, a.host, etc. will be empty.) We * work around that by performing the parsing in a 2nd step by taking a previously normalized * URL (e.g. by assigning to a.href) and assigning it a.href again. This correctly populates the * properties such as protocol, hostname, port, etc. * * IE7 does not normalize the URL when assigned to an anchor node. (Apparently, it does, if one * uses the inner HTML approach to assign the URL as part of an HTML snippet - * http://stackoverflow.com/a/472729) However, setting img[src] does normalize the URL. * Unfortunately, setting img[src] to something like "javascript:foo" on IE throws an exception. * Since the primary usage for normalizing URLs is to sanitize such URLs, we can't use that * method and IE < 8 is unsupported. * * References: * http://developer.mozilla.org/en-US/docs/Web/API/HTMLAnchorElement * http://www.aptana.com/reference/html/api/HTMLAnchorElement.html * http://url.spec.whatwg.org/#urlutils * https://github.com/angular/angular.js/pull/2902 * http://james.padolsey.com/javascript/parsing-urls-with-the-dom/ * * @kind function * @param {string} url The URL to be parsed. * @description Normalizes and parses a URL. * @returns {object} Returns the normalized URL as a dictionary. * * | member name | Description | * |---------------|----------------| * | href | A normalized version of the provided URL if it was not an absolute URL | * | protocol | The protocol including the trailing colon | * | host | The host and port (if the port is non-default) of the normalizedUrl | * | search | The search params, minus the question mark | * | hash | The hash string, minus the hash symbol * | hostname | The hostname * | port | The port, without ":" * | pathname | The pathname, beginning with "/" * */ function urlResolve(url) { var href = url; if (msie) { // Normalize before parse. Refer Implementation Notes on why this is // done in two steps on IE. urlParsingNode.setAttribute("href", href); href = urlParsingNode.href; } urlParsingNode.setAttribute('href', href); // urlParsingNode provides the UrlUtils interface - http://url.spec.whatwg.org/#urlutils return { href: urlParsingNode.href, protocol: urlParsingNode.protocol ? urlParsingNode.protocol.replace(/:$/, '') : '', host: urlParsingNode.host, search: urlParsingNode.search ? urlParsingNode.search.replace(/^\?/, '') : '', hash: urlParsingNode.hash ? urlParsingNode.hash.replace(/^#/, '') : '', hostname: urlParsingNode.hostname, port: urlParsingNode.port, pathname: (urlParsingNode.pathname.charAt(0) === '/') ? urlParsingNode.pathname : '/' + urlParsingNode.pathname }; } /** * Parse a request URL and determine whether this is a same-origin request as the application document. * * @param {string|object} requestUrl The url of the request as a string that will be resolved * or a parsed URL object. * @returns {boolean} Whether the request is for the same origin as the application document. */ function urlIsSameOrigin(requestUrl) { var parsed = (isString(requestUrl)) ? urlResolve(requestUrl) : requestUrl; return (parsed.protocol === originUrl.protocol && parsed.host === originUrl.host); } /** * @ngdoc service * @name $window * * @description * A reference to the browser's `window` object. While `window` * is globally available in JavaScript, it causes testability problems, because * it is a global variable. In angular we always refer to it through the * `$window` service, so it may be overridden, removed or mocked for testing. * * Expressions, like the one defined for the `ngClick` directive in the example * below, are evaluated with respect to the current scope. Therefore, there is * no risk of inadvertently coding in a dependency on a global value in such an * expression. * * @example <example module="windowExample"> <file name="index.html"> <script> angular.module('windowExample', []) .controller('ExampleController', ['$scope', '$window', function($scope, $window) { $scope.greeting = 'Hello, World!'; $scope.doGreeting = function(greeting) { $window.alert(greeting); }; }]); </script> <div ng-controller="ExampleController"> <input type="text" ng-model="greeting" /> <button ng-click="doGreeting(greeting)">ALERT</button> </div> </file> <file name="protractor.js" type="protractor"> it('should display the greeting in the input box', function() { element(by.model('greeting')).sendKeys('Hello, E2E Tests'); // If we click the button it will block the test runner // element(':button').click(); }); </file> </example> */ function $WindowProvider() { this.$get = valueFn(window); } /* global currencyFilter: true, dateFilter: true, filterFilter: true, jsonFilter: true, limitToFilter: true, lowercaseFilter: true, numberFilter: true, orderByFilter: true, uppercaseFilter: true, */ /** * @ngdoc provider * @name $filterProvider * @description * * Filters are just functions which transform input to an output. However filters need to be * Dependency Injected. To achieve this a filter definition consists of a factory function which is * annotated with dependencies and is responsible for creating a filter function. * * ```js * // Filter registration * function MyModule($provide, $filterProvider) { * // create a service to demonstrate injection (not always needed) * $provide.value('greet', function(name){ * return 'Hello ' + name + '!'; * }); * * // register a filter factory which uses the * // greet service to demonstrate DI. * $filterProvider.register('greet', function(greet){ * // return the filter function which uses the greet service * // to generate salutation * return function(text) { * // filters need to be forgiving so check input validity * return text && greet(text) || text; * }; * }); * } * ``` * * The filter function is registered with the `$injector` under the filter name suffix with * `Filter`. * * ```js * it('should be the same instance', inject( * function($filterProvider) { * $filterProvider.register('reverse', function(){ * return ...; * }); * }, * function($filter, reverseFilter) { * expect($filter('reverse')).toBe(reverseFilter); * }); * ``` * * * For more information about how angular filters work, and how to create your own filters, see * {@link guide/filter Filters} in the Angular Developer Guide. */ /** * @ngdoc service * @name $filter * @kind function * @description * Filters are used for formatting data displayed to the user. * * The general syntax in templates is as follows: * * {{ expression [| filter_name[:parameter_value] ... ] }} * * @param {String} name Name of the filter function to retrieve * @return {Function} the filter function * @example <example name="$filter" module="filterExample"> <file name="index.html"> <div ng-controller="MainCtrl"> <h3>{{ originalText }}</h3> <h3>{{ filteredText }}</h3> </div> </file> <file name="script.js"> angular.module('filterExample', []) .controller('MainCtrl', function($scope, $filter) { $scope.originalText = 'hello'; $scope.filteredText = $filter('uppercase')($scope.originalText); }); </file> </example> */ $FilterProvider.$inject = ['$provide']; function $FilterProvider($provide) { var suffix = 'Filter'; /** * @ngdoc method * @name $filterProvider#register * @param {string|Object} name Name of the filter function, or an object map of filters where * the keys are the filter names and the values are the filter factories. * @returns {Object} Registered filter instance, or if a map of filters was provided then a map * of the registered filter instances. */ function register(name, factory) { if (isObject(name)) { var filters = {}; forEach(name, function(filter, key) { filters[key] = register(key, filter); }); return filters; } else { return $provide.factory(name + suffix, factory); } } this.register = register; this.$get = ['$injector', function($injector) { return function(name) { return $injector.get(name + suffix); }; }]; //////////////////////////////////////// /* global currencyFilter: false, dateFilter: false, filterFilter: false, jsonFilter: false, limitToFilter: false, lowercaseFilter: false, numberFilter: false, orderByFilter: false, uppercaseFilter: false, */ register('currency', currencyFilter); register('date', dateFilter); register('filter', filterFilter); register('json', jsonFilter); register('limitTo', limitToFilter); register('lowercase', lowercaseFilter); register('number', numberFilter); register('orderBy', orderByFilter); register('uppercase', uppercaseFilter); } /** * @ngdoc filter * @name filter * @kind function * * @description * Selects a subset of items from `array` and returns it as a new array. * * @param {Array} array The source array. * @param {string|Object|function()} expression The predicate to be used for selecting items from * `array`. * * Can be one of: * * - `string`: The string is used for matching against the contents of the `array`. All strings or * objects with string properties in `array` that match this string will be returned. This also * applies to nested object properties. * The predicate can be negated by prefixing the string with `!`. * * - `Object`: A pattern object can be used to filter specific properties on objects contained * by `array`. For example `{name:"M", phone:"1"}` predicate will return an array of items * which have property `name` containing "M" and property `phone` containing "1". A special * property name `$` can be used (as in `{$:"text"}`) to accept a match against any * property of the object or its nested object properties. That's equivalent to the simple * substring match with a `string` as described above. The predicate can be negated by prefixing * the string with `!`. * For example `{name: "!M"}` predicate will return an array of items which have property `name` * not containing "M". * * Note that a named property will match properties on the same level only, while the special * `$` property will match properties on the same level or deeper. E.g. an array item like * `{name: {first: 'John', last: 'Doe'}}` will **not** be matched by `{name: 'John'}`, but * **will** be matched by `{$: 'John'}`. * * - `function(value, index)`: A predicate function can be used to write arbitrary filters. The * function is called for each element of `array`. The final result is an array of those * elements that the predicate returned true for. * * @param {function(actual, expected)|true|undefined} comparator Comparator which is used in * determining if the expected value (from the filter expression) and actual value (from * the object in the array) should be considered a match. * * Can be one of: * * - `function(actual, expected)`: * The function will be given the object value and the predicate value to compare and * should return true if both values should be considered equal. * * - `true`: A shorthand for `function(actual, expected) { return angular.equals(actual, expected)}`. * This is essentially strict comparison of expected and actual. * * - `false|undefined`: A short hand for a function which will look for a substring match in case * insensitive way. * * @example <example> <file name="index.html"> <div ng-init="friends = [{name:'John', phone:'555-1276'}, {name:'Mary', phone:'800-BIG-MARY'}, {name:'Mike', phone:'555-4321'}, {name:'Adam', phone:'555-5678'}, {name:'Julie', phone:'555-8765'}, {name:'Juliette', phone:'555-5678'}]"></div> Search: <input ng-model="searchText"> <table id="searchTextResults"> <tr><th>Name</th><th>Phone</th></tr> <tr ng-repeat="friend in friends | filter:searchText"> <td>{{friend.name}}</td> <td>{{friend.phone}}</td> </tr> </table> <hr> Any: <input ng-model="search.$"> <br> Name only <input ng-model="search.name"><br> Phone only <input ng-model="search.phone"><br> Equality <input type="checkbox" ng-model="strict"><br> <table id="searchObjResults"> <tr><th>Name</th><th>Phone</th></tr> <tr ng-repeat="friendObj in friends | filter:search:strict"> <td>{{friendObj.name}}</td> <td>{{friendObj.phone}}</td> </tr> </table> </file> <file name="protractor.js" type="protractor"> var expectFriendNames = function(expectedNames, key) { element.all(by.repeater(key + ' in friends').column(key + '.name')).then(function(arr) { arr.forEach(function(wd, i) { expect(wd.getText()).toMatch(expectedNames[i]); }); }); }; it('should search across all fields when filtering with a string', function() { var searchText = element(by.model('searchText')); searchText.clear(); searchText.sendKeys('m'); expectFriendNames(['Mary', 'Mike', 'Adam'], 'friend'); searchText.clear(); searchText.sendKeys('76'); expectFriendNames(['John', 'Julie'], 'friend'); }); it('should search in specific fields when filtering with a predicate object', function() { var searchAny = element(by.model('search.$')); searchAny.clear(); searchAny.sendKeys('i'); expectFriendNames(['Mary', 'Mike', 'Julie', 'Juliette'], 'friendObj'); }); it('should use a equal comparison when comparator is true', function() { var searchName = element(by.model('search.name')); var strict = element(by.model('strict')); searchName.clear(); searchName.sendKeys('Julie'); strict.click(); expectFriendNames(['Julie'], 'friendObj'); }); </file> </example> */ function filterFilter() { return function(array, expression, comparator) { if (!isArray(array)) return array; var predicateFn; var matchAgainstAnyProp; switch (typeof expression) { case 'function': predicateFn = expression; break; case 'boolean': case 'number': case 'string': matchAgainstAnyProp = true; //jshint -W086 case 'object': //jshint +W086 predicateFn = createPredicateFn(expression, comparator, matchAgainstAnyProp); break; default: return array; } return array.filter(predicateFn); }; } // Helper functions for `filterFilter` function createPredicateFn(expression, comparator, matchAgainstAnyProp) { var shouldMatchPrimitives = isObject(expression) && ('$' in expression); var predicateFn; if (comparator === true) { comparator = equals; } else if (!isFunction(comparator)) { comparator = function(actual, expected) { if (isObject(actual) || isObject(expected)) { // Prevent an object to be considered equal to a string like `'[object'` return false; } actual = lowercase('' + actual); expected = lowercase('' + expected); return actual.indexOf(expected) !== -1; }; } predicateFn = function(item) { if (shouldMatchPrimitives && !isObject(item)) { return deepCompare(item, expression.$, comparator, false); } return deepCompare(item, expression, comparator, matchAgainstAnyProp); }; return predicateFn; } function deepCompare(actual, expected, comparator, matchAgainstAnyProp, dontMatchWholeObject) { var actualType = typeof actual; var expectedType = typeof expected; if ((expectedType === 'string') && (expected.charAt(0) === '!')) { return !deepCompare(actual, expected.substring(1), comparator, matchAgainstAnyProp); } else if (isArray(actual)) { // In case `actual` is an array, consider it a match // if ANY of it's items matches `expected` return actual.some(function(item) { return deepCompare(item, expected, comparator, matchAgainstAnyProp); }); } switch (actualType) { case 'object': var key; if (matchAgainstAnyProp) { for (key in actual) { if ((key.charAt(0) !== '$') && deepCompare(actual[key], expected, comparator, true)) { return true; } } return dontMatchWholeObject ? false : deepCompare(actual, expected, comparator, false); } else if (expectedType === 'object') { for (key in expected) { var expectedVal = expected[key]; if (isFunction(expectedVal)) { continue; } var matchAnyProperty = key === '$'; var actualVal = matchAnyProperty ? actual : actual[key]; if (!deepCompare(actualVal, expectedVal, comparator, matchAnyProperty, matchAnyProperty)) { return false; } } return true; } else { return comparator(actual, expected); } break; case 'function': return false; default: return comparator(actual, expected); } } /** * @ngdoc filter * @name currency * @kind function * * @description * Formats a number as a currency (ie $1,234.56). When no currency symbol is provided, default * symbol for current locale is used. * * @param {number} amount Input to filter. * @param {string=} symbol Currency symbol or identifier to be displayed. * @param {number=} fractionSize Number of decimal places to round the amount to, defaults to default max fraction size for current locale * @returns {string} Formatted number. * * * @example <example module="currencyExample"> <file name="index.html"> <script> angular.module('currencyExample', []) .controller('ExampleController', ['$scope', function($scope) { $scope.amount = 1234.56; }]); </script> <div ng-controller="ExampleController"> <input type="number" ng-model="amount"> <br> default currency symbol ($): <span id="currency-default">{{amount | currency}}</span><br> custom currency identifier (USD$): <span id="currency-custom">{{amount | currency:"USD$"}}</span> no fractions (0): <span id="currency-no-fractions">{{amount | currency:"USD$":0}}</span> </div> </file> <file name="protractor.js" type="protractor"> it('should init with 1234.56', function() { expect(element(by.id('currency-default')).getText()).toBe('$1,234.56'); expect(element(by.id('currency-custom')).getText()).toBe('USD$1,234.56'); expect(element(by.id('currency-no-fractions')).getText()).toBe('USD$1,235'); }); it('should update', function() { if (browser.params.browser == 'safari') { // Safari does not understand the minus key. See // https://github.com/angular/protractor/issues/481 return; } element(by.model('amount')).clear(); element(by.model('amount')).sendKeys('-1234'); expect(element(by.id('currency-default')).getText()).toBe('($1,234.00)'); expect(element(by.id('currency-custom')).getText()).toBe('(USD$1,234.00)'); expect(element(by.id('currency-no-fractions')).getText()).toBe('(USD$1,234)'); }); </file> </example> */ currencyFilter.$inject = ['$locale']; function currencyFilter($locale) { var formats = $locale.NUMBER_FORMATS; return function(amount, currencySymbol, fractionSize) { if (isUndefined(currencySymbol)) { currencySymbol = formats.CURRENCY_SYM; } if (isUndefined(fractionSize)) { fractionSize = formats.PATTERNS[1].maxFrac; } // if null or undefined pass it through return (amount == null) ? amount : formatNumber(amount, formats.PATTERNS[1], formats.GROUP_SEP, formats.DECIMAL_SEP, fractionSize). replace(/\u00A4/g, currencySymbol); }; } /** * @ngdoc filter * @name number * @kind function * * @description * Formats a number as text. * * If the input is not a number an empty string is returned. * * @param {number|string} number Number to format. * @param {(number|string)=} fractionSize Number of decimal places to round the number to. * If this is not provided then the fraction size is computed from the current locale's number * formatting pattern. In the case of the default locale, it will be 3. * @returns {string} Number rounded to decimalPlaces and places a “,” after each third digit. * * @example <example module="numberFilterExample"> <file name="index.html"> <script> angular.module('numberFilterExample', []) .controller('ExampleController', ['$scope', function($scope) { $scope.val = 1234.56789; }]); </script> <div ng-controller="ExampleController"> Enter number: <input ng-model='val'><br> Default formatting: <span id='number-default'>{{val | number}}</span><br> No fractions: <span>{{val | number:0}}</span><br> Negative number: <span>{{-val | number:4}}</span> </div> </file> <file name="protractor.js" type="protractor"> it('should format numbers', function() { expect(element(by.id('number-default')).getText()).toBe('1,234.568'); expect(element(by.binding('val | number:0')).getText()).toBe('1,235'); expect(element(by.binding('-val | number:4')).getText()).toBe('-1,234.5679'); }); it('should update', function() { element(by.model('val')).clear(); element(by.model('val')).sendKeys('3374.333'); expect(element(by.id('number-default')).getText()).toBe('3,374.333'); expect(element(by.binding('val | number:0')).getText()).toBe('3,374'); expect(element(by.binding('-val | number:4')).getText()).toBe('-3,374.3330'); }); </file> </example> */ numberFilter.$inject = ['$locale']; function numberFilter($locale) { var formats = $locale.NUMBER_FORMATS; return function(number, fractionSize) { // if null or undefined pass it through return (number == null) ? number : formatNumber(number, formats.PATTERNS[0], formats.GROUP_SEP, formats.DECIMAL_SEP, fractionSize); }; } var DECIMAL_SEP = '.'; function formatNumber(number, pattern, groupSep, decimalSep, fractionSize) { if (!isFinite(number) || isObject(number)) return ''; var isNegative = number < 0; number = Math.abs(number); var numStr = number + '', formatedText = '', parts = []; var hasExponent = false; if (numStr.indexOf('e') !== -1) { var match = numStr.match(/([\d\.]+)e(-?)(\d+)/); if (match && match[2] == '-' && match[3] > fractionSize + 1) { number = 0; } else { formatedText = numStr; hasExponent = true; } } if (!hasExponent) { var fractionLen = (numStr.split(DECIMAL_SEP)[1] || '').length; // determine fractionSize if it is not specified if (isUndefined(fractionSize)) { fractionSize = Math.min(Math.max(pattern.minFrac, fractionLen), pattern.maxFrac); } // safely round numbers in JS without hitting imprecisions of floating-point arithmetics // inspired by: // https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Math/round number = +(Math.round(+(number.toString() + 'e' + fractionSize)).toString() + 'e' + -fractionSize); var fraction = ('' + number).split(DECIMAL_SEP); var whole = fraction[0]; fraction = fraction[1] || ''; var i, pos = 0, lgroup = pattern.lgSize, group = pattern.gSize; if (whole.length >= (lgroup + group)) { pos = whole.length - lgroup; for (i = 0; i < pos; i++) { if ((pos - i) % group === 0 && i !== 0) { formatedText += groupSep; } formatedText += whole.charAt(i); } } for (i = pos; i < whole.length; i++) { if ((whole.length - i) % lgroup === 0 && i !== 0) { formatedText += groupSep; } formatedText += whole.charAt(i); } // format fraction part. while (fraction.length < fractionSize) { fraction += '0'; } if (fractionSize && fractionSize !== "0") formatedText += decimalSep + fraction.substr(0, fractionSize); } else { if (fractionSize > 0 && number < 1) { formatedText = number.toFixed(fractionSize); number = parseFloat(formatedText); } } if (number === 0) { isNegative = false; } parts.push(isNegative ? pattern.negPre : pattern.posPre, formatedText, isNegative ? pattern.negSuf : pattern.posSuf); return parts.join(''); } function padNumber(num, digits, trim) { var neg = ''; if (num < 0) { neg = '-'; num = -num; } num = '' + num; while (num.length < digits) num = '0' + num; if (trim) num = num.substr(num.length - digits); return neg + num; } function dateGetter(name, size, offset, trim) { offset = offset || 0; return function(date) { var value = date['get' + name](); if (offset > 0 || value > -offset) value += offset; if (value === 0 && offset == -12) value = 12; return padNumber(value, size, trim); }; } function dateStrGetter(name, shortForm) { return function(date, formats) { var value = date['get' + name](); var get = uppercase(shortForm ? ('SHORT' + name) : name); return formats[get][value]; }; } function timeZoneGetter(date) { var zone = -1 * date.getTimezoneOffset(); var paddedZone = (zone >= 0) ? "+" : ""; paddedZone += padNumber(Math[zone > 0 ? 'floor' : 'ceil'](zone / 60), 2) + padNumber(Math.abs(zone % 60), 2); return paddedZone; } function getFirstThursdayOfYear(year) { // 0 = index of January var dayOfWeekOnFirst = (new Date(year, 0, 1)).getDay(); // 4 = index of Thursday (+1 to account for 1st = 5) // 11 = index of *next* Thursday (+1 account for 1st = 12) return new Date(year, 0, ((dayOfWeekOnFirst <= 4) ? 5 : 12) - dayOfWeekOnFirst); } function getThursdayThisWeek(datetime) { return new Date(datetime.getFullYear(), datetime.getMonth(), // 4 = index of Thursday datetime.getDate() + (4 - datetime.getDay())); } function weekGetter(size) { return function(date) { var firstThurs = getFirstThursdayOfYear(date.getFullYear()), thisThurs = getThursdayThisWeek(date); var diff = +thisThurs - +firstThurs, result = 1 + Math.round(diff / 6.048e8); // 6.048e8 ms per week return padNumber(result, size); }; } function ampmGetter(date, formats) { return date.getHours() < 12 ? formats.AMPMS[0] : formats.AMPMS[1]; } var DATE_FORMATS = { yyyy: dateGetter('FullYear', 4), yy: dateGetter('FullYear', 2, 0, true), y: dateGetter('FullYear', 1), MMMM: dateStrGetter('Month'), MMM: dateStrGetter('Month', true), MM: dateGetter('Month', 2, 1), M: dateGetter('Month', 1, 1), dd: dateGetter('Date', 2), d: dateGetter('Date', 1), HH: dateGetter('Hours', 2), H: dateGetter('Hours', 1), hh: dateGetter('Hours', 2, -12), h: dateGetter('Hours', 1, -12), mm: dateGetter('Minutes', 2), m: dateGetter('Minutes', 1), ss: dateGetter('Seconds', 2), s: dateGetter('Seconds', 1), // while ISO 8601 requires fractions to be prefixed with `.` or `,` // we can be just safely rely on using `sss` since we currently don't support single or two digit fractions sss: dateGetter('Milliseconds', 3), EEEE: dateStrGetter('Day'), EEE: dateStrGetter('Day', true), a: ampmGetter, Z: timeZoneGetter, ww: weekGetter(2), w: weekGetter(1) }; var DATE_FORMATS_SPLIT = /((?:[^yMdHhmsaZEw']+)|(?:'(?:[^']|'')*')|(?:E+|y+|M+|d+|H+|h+|m+|s+|a|Z|w+))(.*)/, NUMBER_STRING = /^\-?\d+$/; /** * @ngdoc filter * @name date * @kind function * * @description * Formats `date` to a string based on the requested `format`. * * `format` string can be composed of the following elements: * * * `'yyyy'`: 4 digit representation of year (e.g. AD 1 => 0001, AD 2010 => 2010) * * `'yy'`: 2 digit representation of year, padded (00-99). (e.g. AD 2001 => 01, AD 2010 => 10) * * `'y'`: 1 digit representation of year, e.g. (AD 1 => 1, AD 199 => 199) * * `'MMMM'`: Month in year (January-December) * * `'MMM'`: Month in year (Jan-Dec) * * `'MM'`: Month in year, padded (01-12) * * `'M'`: Month in year (1-12) * * `'dd'`: Day in month, padded (01-31) * * `'d'`: Day in month (1-31) * * `'EEEE'`: Day in Week,(Sunday-Saturday) * * `'EEE'`: Day in Week, (Sun-Sat) * * `'HH'`: Hour in day, padded (00-23) * * `'H'`: Hour in day (0-23) * * `'hh'`: Hour in AM/PM, padded (01-12) * * `'h'`: Hour in AM/PM, (1-12) * * `'mm'`: Minute in hour, padded (00-59) * * `'m'`: Minute in hour (0-59) * * `'ss'`: Second in minute, padded (00-59) * * `'s'`: Second in minute (0-59) * * `'sss'`: Millisecond in second, padded (000-999) * * `'a'`: AM/PM marker * * `'Z'`: 4 digit (+sign) representation of the timezone offset (-1200-+1200) * * `'ww'`: Week of year, padded (00-53). Week 01 is the week with the first Thursday of the year * * `'w'`: Week of year (0-53). Week 1 is the week with the first Thursday of the year * * `format` string can also be one of the following predefined * {@link guide/i18n localizable formats}: * * * `'medium'`: equivalent to `'MMM d, y h:mm:ss a'` for en_US locale * (e.g. Sep 3, 2010 12:05:08 PM) * * `'short'`: equivalent to `'M/d/yy h:mm a'` for en_US locale (e.g. 9/3/10 12:05 PM) * * `'fullDate'`: equivalent to `'EEEE, MMMM d, y'` for en_US locale * (e.g. Friday, September 3, 2010) * * `'longDate'`: equivalent to `'MMMM d, y'` for en_US locale (e.g. September 3, 2010) * * `'mediumDate'`: equivalent to `'MMM d, y'` for en_US locale (e.g. Sep 3, 2010) * * `'shortDate'`: equivalent to `'M/d/yy'` for en_US locale (e.g. 9/3/10) * * `'mediumTime'`: equivalent to `'h:mm:ss a'` for en_US locale (e.g. 12:05:08 PM) * * `'shortTime'`: equivalent to `'h:mm a'` for en_US locale (e.g. 12:05 PM) * * `format` string can contain literal values. These need to be escaped by surrounding with single quotes (e.g. * `"h 'in the morning'"`). In order to output a single quote, escape it - i.e., two single quotes in a sequence * (e.g. `"h 'o''clock'"`). * * @param {(Date|number|string)} date Date to format either as Date object, milliseconds (string or * number) or various ISO 8601 datetime string formats (e.g. yyyy-MM-ddTHH:mm:ss.sssZ and its * shorter versions like yyyy-MM-ddTHH:mmZ, yyyy-MM-dd or yyyyMMddTHHmmssZ). If no timezone is * specified in the string input, the time is considered to be in the local timezone. * @param {string=} format Formatting rules (see Description). If not specified, * `mediumDate` is used. * @param {string=} timezone Timezone to be used for formatting. Right now, only `'UTC'` is supported. * If not specified, the timezone of the browser will be used. * @returns {string} Formatted string or the input if input is not recognized as date/millis. * * @example <example> <file name="index.html"> <span ng-non-bindable>{{1288323623006 | date:'medium'}}</span>: <span>{{1288323623006 | date:'medium'}}</span><br> <span ng-non-bindable>{{1288323623006 | date:'yyyy-MM-dd HH:mm:ss Z'}}</span>: <span>{{1288323623006 | date:'yyyy-MM-dd HH:mm:ss Z'}}</span><br> <span ng-non-bindable>{{1288323623006 | date:'MM/dd/yyyy @ h:mma'}}</span>: <span>{{'1288323623006' | date:'MM/dd/yyyy @ h:mma'}}</span><br> <span ng-non-bindable>{{1288323623006 | date:"MM/dd/yyyy 'at' h:mma"}}</span>: <span>{{'1288323623006' | date:"MM/dd/yyyy 'at' h:mma"}}</span><br> </file> <file name="protractor.js" type="protractor"> it('should format date', function() { expect(element(by.binding("1288323623006 | date:'medium'")).getText()). toMatch(/Oct 2\d, 2010 \d{1,2}:\d{2}:\d{2} (AM|PM)/); expect(element(by.binding("1288323623006 | date:'yyyy-MM-dd HH:mm:ss Z'")).getText()). toMatch(/2010\-10\-2\d \d{2}:\d{2}:\d{2} (\-|\+)?\d{4}/); expect(element(by.binding("'1288323623006' | date:'MM/dd/yyyy @ h:mma'")).getText()). toMatch(/10\/2\d\/2010 @ \d{1,2}:\d{2}(AM|PM)/); expect(element(by.binding("'1288323623006' | date:\"MM/dd/yyyy 'at' h:mma\"")).getText()). toMatch(/10\/2\d\/2010 at \d{1,2}:\d{2}(AM|PM)/); }); </file> </example> */ dateFilter.$inject = ['$locale']; function dateFilter($locale) { var R_ISO8601_STR = /^(\d{4})-?(\d\d)-?(\d\d)(?:T(\d\d)(?::?(\d\d)(?::?(\d\d)(?:\.(\d+))?)?)?(Z|([+-])(\d\d):?(\d\d))?)?$/; // 1 2 3 4 5 6 7 8 9 10 11 function jsonStringToDate(string) { var match; if (match = string.match(R_ISO8601_STR)) { var date = new Date(0), tzHour = 0, tzMin = 0, dateSetter = match[8] ? date.setUTCFullYear : date.setFullYear, timeSetter = match[8] ? date.setUTCHours : date.setHours; if (match[9]) { tzHour = int(match[9] + match[10]); tzMin = int(match[9] + match[11]); } dateSetter.call(date, int(match[1]), int(match[2]) - 1, int(match[3])); var h = int(match[4] || 0) - tzHour; var m = int(match[5] || 0) - tzMin; var s = int(match[6] || 0); var ms = Math.round(parseFloat('0.' + (match[7] || 0)) * 1000); timeSetter.call(date, h, m, s, ms); return date; } return string; } return function(date, format, timezone) { var text = '', parts = [], fn, match; format = format || 'mediumDate'; format = $locale.DATETIME_FORMATS[format] || format; if (isString(date)) { date = NUMBER_STRING.test(date) ? int(date) : jsonStringToDate(date); } if (isNumber(date)) { date = new Date(date); } if (!isDate(date)) { return date; } while (format) { match = DATE_FORMATS_SPLIT.exec(format); if (match) { parts = concat(parts, match, 1); format = parts.pop(); } else { parts.push(format); format = null; } } if (timezone && timezone === 'UTC') { date = new Date(date.getTime()); date.setMinutes(date.getMinutes() + date.getTimezoneOffset()); } forEach(parts, function(value) { fn = DATE_FORMATS[value]; text += fn ? fn(date, $locale.DATETIME_FORMATS) : value.replace(/(^'|'$)/g, '').replace(/''/g, "'"); }); return text; }; } /** * @ngdoc filter * @name json * @kind function * * @description * Allows you to convert a JavaScript object into JSON string. * * This filter is mostly useful for debugging. When using the double curly {{value}} notation * the binding is automatically converted to JSON. * * @param {*} object Any JavaScript object (including arrays and primitive types) to filter. * @param {number=} spacing The number of spaces to use per indentation, defaults to 2. * @returns {string} JSON string. * * * @example <example> <file name="index.html"> <pre id="default-spacing">{{ {'name':'value'} | json }}</pre> <pre id="custom-spacing">{{ {'name':'value'} | json:4 }}</pre> </file> <file name="protractor.js" type="protractor"> it('should jsonify filtered objects', function() { expect(element(by.id('default-spacing')).getText()).toMatch(/\{\n "name": ?"value"\n}/); expect(element(by.id('custom-spacing')).getText()).toMatch(/\{\n "name": ?"value"\n}/); }); </file> </example> * */ function jsonFilter() { return function(object, spacing) { if (isUndefined(spacing)) { spacing = 2; } return toJson(object, spacing); }; } /** * @ngdoc filter * @name lowercase * @kind function * @description * Converts string to lowercase. * @see angular.lowercase */ var lowercaseFilter = valueFn(lowercase); /** * @ngdoc filter * @name uppercase * @kind function * @description * Converts string to uppercase. * @see angular.uppercase */ var uppercaseFilter = valueFn(uppercase); /** * @ngdoc filter * @name limitTo * @kind function * * @description * Creates a new array or string containing only a specified number of elements. The elements * are taken from either the beginning or the end of the source array, string or number, as specified by * the value and sign (positive or negative) of `limit`. If a number is used as input, it is * converted to a string. * * @param {Array|string|number} input Source array, string or number to be limited. * @param {string|number} limit The length of the returned array or string. If the `limit` number * is positive, `limit` number of items from the beginning of the source array/string are copied. * If the number is negative, `limit` number of items from the end of the source array/string * are copied. The `limit` will be trimmed if it exceeds `array.length` * @returns {Array|string} A new sub-array or substring of length `limit` or less if input array * had less than `limit` elements. * * @example <example module="limitToExample"> <file name="index.html"> <script> angular.module('limitToExample', []) .controller('ExampleController', ['$scope', function($scope) { $scope.numbers = [1,2,3,4,5,6,7,8,9]; $scope.letters = "abcdefghi"; $scope.longNumber = 2345432342; $scope.numLimit = 3; $scope.letterLimit = 3; $scope.longNumberLimit = 3; }]); </script> <div ng-controller="ExampleController"> Limit {{numbers}} to: <input type="number" step="1" ng-model="numLimit"> <p>Output numbers: {{ numbers | limitTo:numLimit }}</p> Limit {{letters}} to: <input type="number" step="1" ng-model="letterLimit"> <p>Output letters: {{ letters | limitTo:letterLimit }}</p> Limit {{longNumber}} to: <input type="number" step="1" ng-model="longNumberLimit"> <p>Output long number: {{ longNumber | limitTo:longNumberLimit }}</p> </div> </file> <file name="protractor.js" type="protractor"> var numLimitInput = element(by.model('numLimit')); var letterLimitInput = element(by.model('letterLimit')); var longNumberLimitInput = element(by.model('longNumberLimit')); var limitedNumbers = element(by.binding('numbers | limitTo:numLimit')); var limitedLetters = element(by.binding('letters | limitTo:letterLimit')); var limitedLongNumber = element(by.binding('longNumber | limitTo:longNumberLimit')); it('should limit the number array to first three items', function() { expect(numLimitInput.getAttribute('value')).toBe('3'); expect(letterLimitInput.getAttribute('value')).toBe('3'); expect(longNumberLimitInput.getAttribute('value')).toBe('3'); expect(limitedNumbers.getText()).toEqual('Output numbers: [1,2,3]'); expect(limitedLetters.getText()).toEqual('Output letters: abc'); expect(limitedLongNumber.getText()).toEqual('Output long number: 234'); }); // There is a bug in safari and protractor that doesn't like the minus key // it('should update the output when -3 is entered', function() { // numLimitInput.clear(); // numLimitInput.sendKeys('-3'); // letterLimitInput.clear(); // letterLimitInput.sendKeys('-3'); // longNumberLimitInput.clear(); // longNumberLimitInput.sendKeys('-3'); // expect(limitedNumbers.getText()).toEqual('Output numbers: [7,8,9]'); // expect(limitedLetters.getText()).toEqual('Output letters: ghi'); // expect(limitedLongNumber.getText()).toEqual('Output long number: 342'); // }); it('should not exceed the maximum size of input array', function() { numLimitInput.clear(); numLimitInput.sendKeys('100'); letterLimitInput.clear(); letterLimitInput.sendKeys('100'); longNumberLimitInput.clear(); longNumberLimitInput.sendKeys('100'); expect(limitedNumbers.getText()).toEqual('Output numbers: [1,2,3,4,5,6,7,8,9]'); expect(limitedLetters.getText()).toEqual('Output letters: abcdefghi'); expect(limitedLongNumber.getText()).toEqual('Output long number: 2345432342'); }); </file> </example> */ function limitToFilter() { return function(input, limit) { if (isNumber(input)) input = input.toString(); if (!isArray(input) && !isString(input)) return input; if (Math.abs(Number(limit)) === Infinity) { limit = Number(limit); } else { limit = int(limit); } //NaN check on limit if (limit) { return limit > 0 ? input.slice(0, limit) : input.slice(limit); } else { return isString(input) ? "" : []; } }; } /** * @ngdoc filter * @name orderBy * @kind function * * @description * Orders a specified `array` by the `expression` predicate. It is ordered alphabetically * for strings and numerically for numbers. Note: if you notice numbers are not being sorted * correctly, make sure they are actually being saved as numbers and not strings. * * @param {Array} array The array to sort. * @param {function(*)|string|Array.<(function(*)|string)>=} expression A predicate to be * used by the comparator to determine the order of elements. * * Can be one of: * * - `function`: Getter function. The result of this function will be sorted using the * `<`, `=`, `>` operator. * - `string`: An Angular expression. The result of this expression is used to compare elements * (for example `name` to sort by a property called `name` or `name.substr(0, 3)` to sort by * 3 first characters of a property called `name`). The result of a constant expression * is interpreted as a property name to be used in comparisons (for example `"special name"` * to sort object by the value of their `special name` property). An expression can be * optionally prefixed with `+` or `-` to control ascending or descending sort order * (for example, `+name` or `-name`). If no property is provided, (e.g. `'+'`) then the array * element itself is used to compare where sorting. * - `Array`: An array of function or string predicates. The first predicate in the array * is used for sorting, but when two items are equivalent, the next predicate is used. * * If the predicate is missing or empty then it defaults to `'+'`. * * @param {boolean=} reverse Reverse the order of the array. * @returns {Array} Sorted copy of the source array. * * @example <example module="orderByExample"> <file name="index.html"> <script> angular.module('orderByExample', []) .controller('ExampleController', ['$scope', function($scope) { $scope.friends = [{name:'John', phone:'555-1212', age:10}, {name:'Mary', phone:'555-9876', age:19}, {name:'Mike', phone:'555-4321', age:21}, {name:'Adam', phone:'555-5678', age:35}, {name:'Julie', phone:'555-8765', age:29}]; $scope.predicate = '-age'; }]); </script> <div ng-controller="ExampleController"> <pre>Sorting predicate = {{predicate}}; reverse = {{reverse}}</pre> <hr/> [ <a href="" ng-click="predicate=''">unsorted</a> ] <table class="friend"> <tr> <th><a href="" ng-click="predicate = 'name'; reverse=false">Name</a> (<a href="" ng-click="predicate = '-name'; reverse=false">^</a>)</th> <th><a href="" ng-click="predicate = 'phone'; reverse=!reverse">Phone Number</a></th> <th><a href="" ng-click="predicate = 'age'; reverse=!reverse">Age</a></th> </tr> <tr ng-repeat="friend in friends | orderBy:predicate:reverse"> <td>{{friend.name}}</td> <td>{{friend.phone}}</td> <td>{{friend.age}}</td> </tr> </table> </div> </file> </example> * * It's also possible to call the orderBy filter manually, by injecting `$filter`, retrieving the * filter routine with `$filter('orderBy')`, and calling the returned filter routine with the * desired parameters. * * Example: * * @example <example module="orderByExample"> <file name="index.html"> <div ng-controller="ExampleController"> <table class="friend"> <tr> <th><a href="" ng-click="reverse=false;order('name', false)">Name</a> (<a href="" ng-click="order('-name',false)">^</a>)</th> <th><a href="" ng-click="reverse=!reverse;order('phone', reverse)">Phone Number</a></th> <th><a href="" ng-click="reverse=!reverse;order('age',reverse)">Age</a></th> </tr> <tr ng-repeat="friend in friends"> <td>{{friend.name}}</td> <td>{{friend.phone}}</td> <td>{{friend.age}}</td> </tr> </table> </div> </file> <file name="script.js"> angular.module('orderByExample', []) .controller('ExampleController', ['$scope', '$filter', function($scope, $filter) { var orderBy = $filter('orderBy'); $scope.friends = [ { name: 'John', phone: '555-1212', age: 10 }, { name: 'Mary', phone: '555-9876', age: 19 }, { name: 'Mike', phone: '555-4321', age: 21 }, { name: 'Adam', phone: '555-5678', age: 35 }, { name: 'Julie', phone: '555-8765', age: 29 } ]; $scope.order = function(predicate, reverse) { $scope.friends = orderBy($scope.friends, predicate, reverse); }; $scope.order('-age',false); }]); </file> </example> */ orderByFilter.$inject = ['$parse']; function orderByFilter($parse) { return function(array, sortPredicate, reverseOrder) { if (!(isArrayLike(array))) return array; sortPredicate = isArray(sortPredicate) ? sortPredicate : [sortPredicate]; if (sortPredicate.length === 0) { sortPredicate = ['+']; } sortPredicate = sortPredicate.map(function(predicate) { var descending = false, get = predicate || identity; if (isString(predicate)) { if ((predicate.charAt(0) == '+' || predicate.charAt(0) == '-')) { descending = predicate.charAt(0) == '-'; predicate = predicate.substring(1); } if (predicate === '') { // Effectively no predicate was passed so we compare identity return reverseComparator(compare, descending); } get = $parse(predicate); if (get.constant) { var key = get(); return reverseComparator(function(a, b) { return compare(a[key], b[key]); }, descending); } } return reverseComparator(function(a, b) { return compare(get(a),get(b)); }, descending); }); return slice.call(array).sort(reverseComparator(comparator, reverseOrder)); function comparator(o1, o2) { for (var i = 0; i < sortPredicate.length; i++) { var comp = sortPredicate[i](o1, o2); if (comp !== 0) return comp; } return 0; } function reverseComparator(comp, descending) { return descending ? function(a, b) {return comp(b,a);} : comp; } function isPrimitive(value) { switch (typeof value) { case 'number': /* falls through */ case 'boolean': /* falls through */ case 'string': return true; default: return false; } } function objectToString(value) { if (value === null) return 'null'; if (typeof value.valueOf === 'function') { value = value.valueOf(); if (isPrimitive(value)) return value; } if (typeof value.toString === 'function') { value = value.toString(); if (isPrimitive(value)) return value; } return ''; } function compare(v1, v2) { var t1 = typeof v1; var t2 = typeof v2; if (t1 === t2 && t1 === "object") { v1 = objectToString(v1); v2 = objectToString(v2); } if (t1 === t2) { if (t1 === "string") { v1 = v1.toLowerCase(); v2 = v2.toLowerCase(); } if (v1 === v2) return 0; return v1 < v2 ? -1 : 1; } else { return t1 < t2 ? -1 : 1; } } }; } function ngDirective(directive) { if (isFunction(directive)) { directive = { link: directive }; } directive.restrict = directive.restrict || 'AC'; return valueFn(directive); } /** * @ngdoc directive * @name a * @restrict E * * @description * Modifies the default behavior of the html A tag so that the default action is prevented when * the href attribute is empty. * * This change permits the easy creation of action links with the `ngClick` directive * without changing the location or causing page reloads, e.g.: * `<a href="" ng-click="list.addItem()">Add Item</a>` */ var htmlAnchorDirective = valueFn({ restrict: 'E', compile: function(element, attr) { if (!attr.href && !attr.xlinkHref && !attr.name) { return function(scope, element) { // If the linked element is not an anchor tag anymore, do nothing if (element[0].nodeName.toLowerCase() !== 'a') return; // SVGAElement does not use the href attribute, but rather the 'xlinkHref' attribute. var href = toString.call(element.prop('href')) === '[object SVGAnimatedString]' ? 'xlink:href' : 'href'; element.on('click', function(event) { // if we have no href url, then don't navigate anywhere. if (!element.attr(href)) { event.preventDefault(); } }); }; } } }); /** * @ngdoc directive * @name ngHref * @restrict A * @priority 99 * * @description * Using Angular markup like `{{hash}}` in an href attribute will * make the link go to the wrong URL if the user clicks it before * Angular has a chance to replace the `{{hash}}` markup with its * value. Until Angular replaces the markup the link will be broken * and will most likely return a 404 error. The `ngHref` directive * solves this problem. * * The wrong way to write it: * ```html * <a href="http://www.gravatar.com/avatar/{{hash}}">link1</a> * ``` * * The correct way to write it: * ```html * <a ng-href="http://www.gravatar.com/avatar/{{hash}}">link1</a> * ``` * * @element A * @param {template} ngHref any string which can contain `{{}}` markup. * * @example * This example shows various combinations of `href`, `ng-href` and `ng-click` attributes * in links and their different behaviors: <example> <file name="index.html"> <input ng-model="value" /><br /> <a id="link-1" href ng-click="value = 1">link 1</a> (link, don't reload)<br /> <a id="link-2" href="" ng-click="value = 2">link 2</a> (link, don't reload)<br /> <a id="link-3" ng-href="/{{'123'}}">link 3</a> (link, reload!)<br /> <a id="link-4" href="" name="xx" ng-click="value = 4">anchor</a> (link, don't reload)<br /> <a id="link-5" name="xxx" ng-click="value = 5">anchor</a> (no link)<br /> <a id="link-6" ng-href="{{value}}">link</a> (link, change location) </file> <file name="protractor.js" type="protractor"> it('should execute ng-click but not reload when href without value', function() { element(by.id('link-1')).click(); expect(element(by.model('value')).getAttribute('value')).toEqual('1'); expect(element(by.id('link-1')).getAttribute('href')).toBe(''); }); it('should execute ng-click but not reload when href empty string', function() { element(by.id('link-2')).click(); expect(element(by.model('value')).getAttribute('value')).toEqual('2'); expect(element(by.id('link-2')).getAttribute('href')).toBe(''); }); it('should execute ng-click and change url when ng-href specified', function() { expect(element(by.id('link-3')).getAttribute('href')).toMatch(/\/123$/); element(by.id('link-3')).click(); // At this point, we navigate away from an Angular page, so we need // to use browser.driver to get the base webdriver. browser.wait(function() { return browser.driver.getCurrentUrl().then(function(url) { return url.match(/\/123$/); }); }, 5000, 'page should navigate to /123'); }); xit('should execute ng-click but not reload when href empty string and name specified', function() { element(by.id('link-4')).click(); expect(element(by.model('value')).getAttribute('value')).toEqual('4'); expect(element(by.id('link-4')).getAttribute('href')).toBe(''); }); it('should execute ng-click but not reload when no href but name specified', function() { element(by.id('link-5')).click(); expect(element(by.model('value')).getAttribute('value')).toEqual('5'); expect(element(by.id('link-5')).getAttribute('href')).toBe(null); }); it('should only change url when only ng-href', function() { element(by.model('value')).clear(); element(by.model('value')).sendKeys('6'); expect(element(by.id('link-6')).getAttribute('href')).toMatch(/\/6$/); element(by.id('link-6')).click(); // At this point, we navigate away from an Angular page, so we need // to use browser.driver to get the base webdriver. browser.wait(function() { return browser.driver.getCurrentUrl().then(function(url) { return url.match(/\/6$/); }); }, 5000, 'page should navigate to /6'); }); </file> </example> */ /** * @ngdoc directive * @name ngSrc * @restrict A * @priority 99 * * @description * Using Angular markup like `{{hash}}` in a `src` attribute doesn't * work right: The browser will fetch from the URL with the literal * text `{{hash}}` until Angular replaces the expression inside * `{{hash}}`. The `ngSrc` directive solves this problem. * * The buggy way to write it: * ```html * <img src="http://www.gravatar.com/avatar/{{hash}}"/> * ``` * * The correct way to write it: * ```html * <img ng-src="http://www.gravatar.com/avatar/{{hash}}"/> * ``` * * @element IMG * @param {template} ngSrc any string which can contain `{{}}` markup. */ /** * @ngdoc directive * @name ngSrcset * @restrict A * @priority 99 * * @description * Using Angular markup like `{{hash}}` in a `srcset` attribute doesn't * work right: The browser will fetch from the URL with the literal * text `{{hash}}` until Angular replaces the expression inside * `{{hash}}`. The `ngSrcset` directive solves this problem. * * The buggy way to write it: * ```html * <img srcset="http://www.gravatar.com/avatar/{{hash}} 2x"/> * ``` * * The correct way to write it: * ```html * <img ng-srcset="http://www.gravatar.com/avatar/{{hash}} 2x"/> * ``` * * @element IMG * @param {template} ngSrcset any string which can contain `{{}}` markup. */ /** * @ngdoc directive * @name ngDisabled * @restrict A * @priority 100 * * @description * * We shouldn't do this, because it will make the button enabled on Chrome/Firefox but not on IE8 and older IEs: * ```html * <div ng-init="scope = { isDisabled: false }"> * <button disabled="{{scope.isDisabled}}">Disabled</button> * </div> * ``` * * The HTML specification does not require browsers to preserve the values of boolean attributes * such as disabled. (Their presence means true and their absence means false.) * If we put an Angular interpolation expression into such an attribute then the * binding information would be lost when the browser removes the attribute. * The `ngDisabled` directive solves this problem for the `disabled` attribute. * This complementary directive is not removed by the browser and so provides * a permanent reliable place to store the binding information. * * @example <example> <file name="index.html"> Click me to toggle: <input type="checkbox" ng-model="checked"><br/> <button ng-model="button" ng-disabled="checked">Button</button> </file> <file name="protractor.js" type="protractor"> it('should toggle button', function() { expect(element(by.css('button')).getAttribute('disabled')).toBeFalsy(); element(by.model('checked')).click(); expect(element(by.css('button')).getAttribute('disabled')).toBeTruthy(); }); </file> </example> * * @element INPUT * @param {expression} ngDisabled If the {@link guide/expression expression} is truthy, * then special attribute "disabled" will be set on the element */ /** * @ngdoc directive * @name ngChecked * @restrict A * @priority 100 * * @description * The HTML specification does not require browsers to preserve the values of boolean attributes * such as checked. (Their presence means true and their absence means false.) * If we put an Angular interpolation expression into such an attribute then the * binding information would be lost when the browser removes the attribute. * The `ngChecked` directive solves this problem for the `checked` attribute. * This complementary directive is not removed by the browser and so provides * a permanent reliable place to store the binding information. * @example <example> <file name="index.html"> Check me to check both: <input type="checkbox" ng-model="master"><br/> <input id="checkSlave" type="checkbox" ng-checked="master"> </file> <file name="protractor.js" type="protractor"> it('should check both checkBoxes', function() { expect(element(by.id('checkSlave')).getAttribute('checked')).toBeFalsy(); element(by.model('master')).click(); expect(element(by.id('checkSlave')).getAttribute('checked')).toBeTruthy(); }); </file> </example> * * @element INPUT * @param {expression} ngChecked If the {@link guide/expression expression} is truthy, * then special attribute "checked" will be set on the element */ /** * @ngdoc directive * @name ngReadonly * @restrict A * @priority 100 * * @description * The HTML specification does not require browsers to preserve the values of boolean attributes * such as readonly. (Their presence means true and their absence means false.) * If we put an Angular interpolation expression into such an attribute then the * binding information would be lost when the browser removes the attribute. * The `ngReadonly` directive solves this problem for the `readonly` attribute. * This complementary directive is not removed by the browser and so provides * a permanent reliable place to store the binding information. * @example <example> <file name="index.html"> Check me to make text readonly: <input type="checkbox" ng-model="checked"><br/> <input type="text" ng-readonly="checked" value="I'm Angular"/> </file> <file name="protractor.js" type="protractor"> it('should toggle readonly attr', function() { expect(element(by.css('[type="text"]')).getAttribute('readonly')).toBeFalsy(); element(by.model('checked')).click(); expect(element(by.css('[type="text"]')).getAttribute('readonly')).toBeTruthy(); }); </file> </example> * * @element INPUT * @param {expression} ngReadonly If the {@link guide/expression expression} is truthy, * then special attribute "readonly" will be set on the element */ /** * @ngdoc directive * @name ngSelected * @restrict A * @priority 100 * * @description * The HTML specification does not require browsers to preserve the values of boolean attributes * such as selected. (Their presence means true and their absence means false.) * If we put an Angular interpolation expression into such an attribute then the * binding information would be lost when the browser removes the attribute. * The `ngSelected` directive solves this problem for the `selected` attribute. * This complementary directive is not removed by the browser and so provides * a permanent reliable place to store the binding information. * * @example <example> <file name="index.html"> Check me to select: <input type="checkbox" ng-model="selected"><br/> <select> <option>Hello!</option> <option id="greet" ng-selected="selected">Greetings!</option> </select> </file> <file name="protractor.js" type="protractor"> it('should select Greetings!', function() { expect(element(by.id('greet')).getAttribute('selected')).toBeFalsy(); element(by.model('selected')).click(); expect(element(by.id('greet')).getAttribute('selected')).toBeTruthy(); }); </file> </example> * * @element OPTION * @param {expression} ngSelected If the {@link guide/expression expression} is truthy, * then special attribute "selected" will be set on the element */ /** * @ngdoc directive * @name ngOpen * @restrict A * @priority 100 * * @description * The HTML specification does not require browsers to preserve the values of boolean attributes * such as open. (Their presence means true and their absence means false.) * If we put an Angular interpolation expression into such an attribute then the * binding information would be lost when the browser removes the attribute. * The `ngOpen` directive solves this problem for the `open` attribute. * This complementary directive is not removed by the browser and so provides * a permanent reliable place to store the binding information. * @example <example> <file name="index.html"> Check me check multiple: <input type="checkbox" ng-model="open"><br/> <details id="details" ng-open="open"> <summary>Show/Hide me</summary> </details> </file> <file name="protractor.js" type="protractor"> it('should toggle open', function() { expect(element(by.id('details')).getAttribute('open')).toBeFalsy(); element(by.model('open')).click(); expect(element(by.id('details')).getAttribute('open')).toBeTruthy(); }); </file> </example> * * @element DETAILS * @param {expression} ngOpen If the {@link guide/expression expression} is truthy, * then special attribute "open" will be set on the element */ var ngAttributeAliasDirectives = {}; // boolean attrs are evaluated forEach(BOOLEAN_ATTR, function(propName, attrName) { // binding to multiple is not supported if (propName == "multiple") return; var normalized = directiveNormalize('ng-' + attrName); ngAttributeAliasDirectives[normalized] = function() { return { restrict: 'A', priority: 100, link: function(scope, element, attr) { scope.$watch(attr[normalized], function ngBooleanAttrWatchAction(value) { attr.$set(attrName, !!value); }); } }; }; }); // aliased input attrs are evaluated forEach(ALIASED_ATTR, function(htmlAttr, ngAttr) { ngAttributeAliasDirectives[ngAttr] = function() { return { priority: 100, link: function(scope, element, attr) { //special case ngPattern when a literal regular expression value //is used as the expression (this way we don't have to watch anything). if (ngAttr === "ngPattern" && attr.ngPattern.charAt(0) == "/") { var match = attr.ngPattern.match(REGEX_STRING_REGEXP); if (match) { attr.$set("ngPattern", new RegExp(match[1], match[2])); return; } } scope.$watch(attr[ngAttr], function ngAttrAliasWatchAction(value) { attr.$set(ngAttr, value); }); } }; }; }); // ng-src, ng-srcset, ng-href are interpolated forEach(['src', 'srcset', 'href'], function(attrName) { var normalized = directiveNormalize('ng-' + attrName); ngAttributeAliasDirectives[normalized] = function() { return { priority: 99, // it needs to run after the attributes are interpolated link: function(scope, element, attr) { var propName = attrName, name = attrName; if (attrName === 'href' && toString.call(element.prop('href')) === '[object SVGAnimatedString]') { name = 'xlinkHref'; attr.$attr[name] = 'xlink:href'; propName = null; } attr.$observe(normalized, function(value) { if (!value) { if (attrName === 'href') { attr.$set(name, null); } return; } attr.$set(name, value); // on IE, if "ng:src" directive declaration is used and "src" attribute doesn't exist // then calling element.setAttribute('src', 'foo') doesn't do anything, so we need // to set the property as well to achieve the desired effect. // we use attr[attrName] value since $set can sanitize the url. if (msie && propName) element.prop(propName, attr[name]); }); } }; }; }); /* global -nullFormCtrl, -SUBMITTED_CLASS, addSetValidityMethod: true */ var nullFormCtrl = { $addControl: noop, $$renameControl: nullFormRenameControl, $removeControl: noop, $setValidity: noop, $setDirty: noop, $setPristine: noop, $setSubmitted: noop }, SUBMITTED_CLASS = 'ng-submitted'; function nullFormRenameControl(control, name) { control.$name = name; } /** * @ngdoc type * @name form.FormController * * @property {boolean} $pristine True if user has not interacted with the form yet. * @property {boolean} $dirty True if user has already interacted with the form. * @property {boolean} $valid True if all of the containing forms and controls are valid. * @property {boolean} $invalid True if at least one containing control or form is invalid. * @property {boolean} $submitted True if user has submitted the form even if its invalid. * * @property {Object} $error Is an object hash, containing references to controls or * forms with failing validators, where: * * - keys are validation tokens (error names), * - values are arrays of controls or forms that have a failing validator for given error name. * * Built-in validation tokens: * * - `email` * - `max` * - `maxlength` * - `min` * - `minlength` * - `number` * - `pattern` * - `required` * - `url` * - `date` * - `datetimelocal` * - `time` * - `week` * - `month` * * @description * `FormController` keeps track of all its controls and nested forms as well as the state of them, * such as being valid/invalid or dirty/pristine. * * Each {@link ng.directive:form form} directive creates an instance * of `FormController`. * */ //asks for $scope to fool the BC controller module FormController.$inject = ['$element', '$attrs', '$scope', '$animate', '$interpolate']; function FormController(element, attrs, $scope, $animate, $interpolate) { var form = this, controls = []; var parentForm = form.$$parentForm = element.parent().controller('form') || nullFormCtrl; // init state form.$error = {}; form.$$success = {}; form.$pending = undefined; form.$name = $interpolate(attrs.name || attrs.ngForm || '')($scope); form.$dirty = false; form.$pristine = true; form.$valid = true; form.$invalid = false; form.$submitted = false; parentForm.$addControl(form); /** * @ngdoc method * @name form.FormController#$rollbackViewValue * * @description * Rollback all form controls pending updates to the `$modelValue`. * * Updates may be pending by a debounced event or because the input is waiting for a some future * event defined in `ng-model-options`. This method is typically needed by the reset button of * a form that uses `ng-model-options` to pend updates. */ form.$rollbackViewValue = function() { forEach(controls, function(control) { control.$rollbackViewValue(); }); }; /** * @ngdoc method * @name form.FormController#$commitViewValue * * @description * Commit all form controls pending updates to the `$modelValue`. * * Updates may be pending by a debounced event or because the input is waiting for a some future * event defined in `ng-model-options`. This method is rarely needed as `NgModelController` * usually handles calling this in response to input events. */ form.$commitViewValue = function() { forEach(controls, function(control) { control.$commitViewValue(); }); }; /** * @ngdoc method * @name form.FormController#$addControl * * @description * Register a control with the form. * * Input elements using ngModelController do this automatically when they are linked. */ form.$addControl = function(control) { // Breaking change - before, inputs whose name was "hasOwnProperty" were quietly ignored // and not added to the scope. Now we throw an error. assertNotHasOwnProperty(control.$name, 'input'); controls.push(control); if (control.$name) { form[control.$name] = control; } }; // Private API: rename a form control form.$$renameControl = function(control, newName) { var oldName = control.$name; if (form[oldName] === control) { delete form[oldName]; } form[newName] = control; control.$name = newName; }; /** * @ngdoc method * @name form.FormController#$removeControl * * @description * Deregister a control from the form. * * Input elements using ngModelController do this automatically when they are destroyed. */ form.$removeControl = function(control) { if (control.$name && form[control.$name] === control) { delete form[control.$name]; } forEach(form.$pending, function(value, name) { form.$setValidity(name, null, control); }); forEach(form.$error, function(value, name) { form.$setValidity(name, null, control); }); forEach(form.$$success, function(value, name) { form.$setValidity(name, null, control); }); arrayRemove(controls, control); }; /** * @ngdoc method * @name form.FormController#$setValidity * * @description * Sets the validity of a form control. * * This method will also propagate to parent forms. */ addSetValidityMethod({ ctrl: this, $element: element, set: function(object, property, controller) { var list = object[property]; if (!list) { object[property] = [controller]; } else { var index = list.indexOf(controller); if (index === -1) { list.push(controller); } } }, unset: function(object, property, controller) { var list = object[property]; if (!list) { return; } arrayRemove(list, controller); if (list.length === 0) { delete object[property]; } }, parentForm: parentForm, $animate: $animate }); /** * @ngdoc method * @name form.FormController#$setDirty * * @description * Sets the form to a dirty state. * * This method can be called to add the 'ng-dirty' class and set the form to a dirty * state (ng-dirty class). This method will also propagate to parent forms. */ form.$setDirty = function() { $animate.removeClass(element, PRISTINE_CLASS); $animate.addClass(element, DIRTY_CLASS); form.$dirty = true; form.$pristine = false; parentForm.$setDirty(); }; /** * @ngdoc method * @name form.FormController#$setPristine * * @description * Sets the form to its pristine state. * * This method can be called to remove the 'ng-dirty' class and set the form to its pristine * state (ng-pristine class). This method will also propagate to all the controls contained * in this form. * * Setting a form back to a pristine state is often useful when we want to 'reuse' a form after * saving or resetting it. */ form.$setPristine = function() { $animate.setClass(element, PRISTINE_CLASS, DIRTY_CLASS + ' ' + SUBMITTED_CLASS); form.$dirty = false; form.$pristine = true; form.$submitted = false; forEach(controls, function(control) { control.$setPristine(); }); }; /** * @ngdoc method * @name form.FormController#$setUntouched * * @description * Sets the form to its untouched state. * * This method can be called to remove the 'ng-touched' class and set the form controls to their * untouched state (ng-untouched class). * * Setting a form controls back to their untouched state is often useful when setting the form * back to its pristine state. */ form.$setUntouched = function() { forEach(controls, function(control) { control.$setUntouched(); }); }; /** * @ngdoc method * @name form.FormController#$setSubmitted * * @description * Sets the form to its submitted state. */ form.$setSubmitted = function() { $animate.addClass(element, SUBMITTED_CLASS); form.$submitted = true; parentForm.$setSubmitted(); }; } /** * @ngdoc directive * @name ngForm * @restrict EAC * * @description * Nestable alias of {@link ng.directive:form `form`} directive. HTML * does not allow nesting of form elements. It is useful to nest forms, for example if the validity of a * sub-group of controls needs to be determined. * * Note: the purpose of `ngForm` is to group controls, * but not to be a replacement for the `<form>` tag with all of its capabilities * (e.g. posting to the server, ...). * * @param {string=} ngForm|name Name of the form. If specified, the form controller will be published into * related scope, under this name. * */ /** * @ngdoc directive * @name form * @restrict E * * @description * Directive that instantiates * {@link form.FormController FormController}. * * If the `name` attribute is specified, the form controller is published onto the current scope under * this name. * * # Alias: {@link ng.directive:ngForm `ngForm`} * * In Angular forms can be nested. This means that the outer form is valid when all of the child * forms are valid as well. However, browsers do not allow nesting of `<form>` elements, so * Angular provides the {@link ng.directive:ngForm `ngForm`} directive which behaves identically to * `<form>` but can be nested. This allows you to have nested forms, which is very useful when * using Angular validation directives in forms that are dynamically generated using the * {@link ng.directive:ngRepeat `ngRepeat`} directive. Since you cannot dynamically generate the `name` * attribute of input elements using interpolation, you have to wrap each set of repeated inputs in an * `ngForm` directive and nest these in an outer `form` element. * * * # CSS classes * - `ng-valid` is set if the form is valid. * - `ng-invalid` is set if the form is invalid. * - `ng-pristine` is set if the form is pristine. * - `ng-dirty` is set if the form is dirty. * - `ng-submitted` is set if the form was submitted. * * Keep in mind that ngAnimate can detect each of these classes when added and removed. * * * # Submitting a form and preventing the default action * * Since the role of forms in client-side Angular applications is different than in classical * roundtrip apps, it is desirable for the browser not to translate the form submission into a full * page reload that sends the data to the server. Instead some javascript logic should be triggered * to handle the form submission in an application-specific way. * * For this reason, Angular prevents the default action (form submission to the server) unless the * `<form>` element has an `action` attribute specified. * * You can use one of the following two ways to specify what javascript method should be called when * a form is submitted: * * - {@link ng.directive:ngSubmit ngSubmit} directive on the form element * - {@link ng.directive:ngClick ngClick} directive on the first * button or input field of type submit (input[type=submit]) * * To prevent double execution of the handler, use only one of the {@link ng.directive:ngSubmit ngSubmit} * or {@link ng.directive:ngClick ngClick} directives. * This is because of the following form submission rules in the HTML specification: * * - If a form has only one input field then hitting enter in this field triggers form submit * (`ngSubmit`) * - if a form has 2+ input fields and no buttons or input[type=submit] then hitting enter * doesn't trigger submit * - if a form has one or more input fields and one or more buttons or input[type=submit] then * hitting enter in any of the input fields will trigger the click handler on the *first* button or * input[type=submit] (`ngClick`) *and* a submit handler on the enclosing form (`ngSubmit`) * * Any pending `ngModelOptions` changes will take place immediately when an enclosing form is * submitted. Note that `ngClick` events will occur before the model is updated. Use `ngSubmit` * to have access to the updated model. * * ## Animation Hooks * * Animations in ngForm are triggered when any of the associated CSS classes are added and removed. * These classes are: `.ng-pristine`, `.ng-dirty`, `.ng-invalid` and `.ng-valid` as well as any * other validations that are performed within the form. Animations in ngForm are similar to how * they work in ngClass and animations can be hooked into using CSS transitions, keyframes as well * as JS animations. * * The following example shows a simple way to utilize CSS transitions to style a form element * that has been rendered as invalid after it has been validated: * * <pre> * //be sure to include ngAnimate as a module to hook into more * //advanced animations * .my-form { * transition:0.5s linear all; * background: white; * } * .my-form.ng-invalid { * background: red; * color:white; * } * </pre> * * @example <example deps="angular-animate.js" animations="true" fixBase="true" module="formExample"> <file name="index.html"> <script> angular.module('formExample', []) .controller('FormController', ['$scope', function($scope) { $scope.userType = 'guest'; }]); </script> <style> .my-form { -webkit-transition:all linear 0.5s; transition:all linear 0.5s; background: transparent; } .my-form.ng-invalid { background: red; } </style> <form name="myForm" ng-controller="FormController" class="my-form"> userType: <input name="input" ng-model="userType" required> <span class="error" ng-show="myForm.input.$error.required">Required!</span><br> <tt>userType = {{userType}}</tt><br> <tt>myForm.input.$valid = {{myForm.input.$valid}}</tt><br> <tt>myForm.input.$error = {{myForm.input.$error}}</tt><br> <tt>myForm.$valid = {{myForm.$valid}}</tt><br> <tt>myForm.$error.required = {{!!myForm.$error.required}}</tt><br> </form> </file> <file name="protractor.js" type="protractor"> it('should initialize to model', function() { var userType = element(by.binding('userType')); var valid = element(by.binding('myForm.input.$valid')); expect(userType.getText()).toContain('guest'); expect(valid.getText()).toContain('true'); }); it('should be invalid if empty', function() { var userType = element(by.binding('userType')); var valid = element(by.binding('myForm.input.$valid')); var userInput = element(by.model('userType')); userInput.clear(); userInput.sendKeys(''); expect(userType.getText()).toEqual('userType ='); expect(valid.getText()).toContain('false'); }); </file> </example> * * @param {string=} name Name of the form. If specified, the form controller will be published into * related scope, under this name. */ var formDirectiveFactory = function(isNgForm) { return ['$timeout', function($timeout) { var formDirective = { name: 'form', restrict: isNgForm ? 'EAC' : 'E', controller: FormController, compile: function ngFormCompile(formElement) { // Setup initial state of the control formElement.addClass(PRISTINE_CLASS).addClass(VALID_CLASS); return { pre: function ngFormPreLink(scope, formElement, attr, controller) { // if `action` attr is not present on the form, prevent the default action (submission) if (!('action' in attr)) { // we can't use jq events because if a form is destroyed during submission the default // action is not prevented. see #1238 // // IE 9 is not affected because it doesn't fire a submit event and try to do a full // page reload if the form was destroyed by submission of the form via a click handler // on a button in the form. Looks like an IE9 specific bug. var handleFormSubmission = function(event) { scope.$apply(function() { controller.$commitViewValue(); controller.$setSubmitted(); }); event.preventDefault(); }; addEventListenerFn(formElement[0], 'submit', handleFormSubmission); // unregister the preventDefault listener so that we don't not leak memory but in a // way that will achieve the prevention of the default action. formElement.on('$destroy', function() { $timeout(function() { removeEventListenerFn(formElement[0], 'submit', handleFormSubmission); }, 0, false); }); } var parentFormCtrl = controller.$$parentForm, alias = controller.$name; if (alias) { setter(scope, null, alias, controller, alias); attr.$observe(attr.name ? 'name' : 'ngForm', function(newValue) { if (alias === newValue) return; setter(scope, null, alias, undefined, alias); alias = newValue; setter(scope, null, alias, controller, alias); parentFormCtrl.$$renameControl(controller, alias); }); } formElement.on('$destroy', function() { parentFormCtrl.$removeControl(controller); if (alias) { setter(scope, null, alias, undefined, alias); } extend(controller, nullFormCtrl); //stop propagating child destruction handlers upwards }); } }; } }; return formDirective; }]; }; var formDirective = formDirectiveFactory(); var ngFormDirective = formDirectiveFactory(true); /* global VALID_CLASS: false, INVALID_CLASS: false, PRISTINE_CLASS: false, DIRTY_CLASS: false, UNTOUCHED_CLASS: false, TOUCHED_CLASS: false, $ngModelMinErr: false, */ // Regex code is obtained from SO: https://stackoverflow.com/questions/3143070/javascript-regex-iso-datetime#answer-3143231 var ISO_DATE_REGEXP = /\d{4}-[01]\d-[0-3]\dT[0-2]\d:[0-5]\d:[0-5]\d\.\d+([+-][0-2]\d:[0-5]\d|Z)/; var URL_REGEXP = /^(ftp|http|https):\/\/(\w+:{0,1}\w*@)?(\S+)(:[0-9]+)?(\/|\/([\w#!:.?+=&%@!\-\/]))?$/; var EMAIL_REGEXP = /^[a-z0-9!#$%&'*+\/=?^_`{|}~.-]+@[a-z0-9]([a-z0-9-]*[a-z0-9])?(\.[a-z0-9]([a-z0-9-]*[a-z0-9])?)*$/i; var NUMBER_REGEXP = /^\s*(\-|\+)?(\d+|(\d*(\.\d*)))\s*$/; var DATE_REGEXP = /^(\d{4})-(\d{2})-(\d{2})$/; var DATETIMELOCAL_REGEXP = /^(\d{4})-(\d\d)-(\d\d)T(\d\d):(\d\d)(?::(\d\d)(\.\d{1,3})?)?$/; var WEEK_REGEXP = /^(\d{4})-W(\d\d)$/; var MONTH_REGEXP = /^(\d{4})-(\d\d)$/; var TIME_REGEXP = /^(\d\d):(\d\d)(?::(\d\d)(\.\d{1,3})?)?$/; var inputType = { /** * @ngdoc input * @name input[text] * * @description * Standard HTML text input with angular data binding, inherited by most of the `input` elements. * * * @param {string} ngModel Assignable angular expression to data-bind to. * @param {string=} name Property name of the form under which the control is published. * @param {string=} required Adds `required` validation error key if the value is not entered. * @param {string=} ngRequired Adds `required` attribute and `required` validation constraint to * the element when the ngRequired expression evaluates to true. Use `ngRequired` instead of * `required` when you want to data-bind to the `required` attribute. * @param {number=} ngMinlength Sets `minlength` validation error key if the value is shorter than * minlength. * @param {number=} ngMaxlength Sets `maxlength` validation error key if the value is longer than * maxlength. Setting the attribute to a negative or non-numeric value, allows view values of * any length. * @param {string=} pattern Similar to `ngPattern` except that the attribute value is the actual string * that contains the regular expression body that will be converted to a regular expression * as in the ngPattern directive. * @param {string=} ngPattern Sets `pattern` validation error key if the ngModel value does not match * a RegExp found by evaluating the Angular expression given in the attribute value. * If the expression evaluates to a RegExp object then this is used directly. * If the expression is a string then it will be converted to a RegExp after wrapping it in `^` and `$` * characters. For instance, `"abc"` will be converted to `new RegExp('^abc$')`. * @param {string=} ngChange Angular expression to be executed when input changes due to user * interaction with the input element. * @param {boolean=} [ngTrim=true] If set to false Angular will not automatically trim the input. * This parameter is ignored for input[type=password] controls, which will never trim the * input. * * @example <example name="text-input-directive" module="textInputExample"> <file name="index.html"> <script> angular.module('textInputExample', []) .controller('ExampleController', ['$scope', function($scope) { $scope.example = { text: 'guest', word: /^\s*\w*\s*$/ }; }]); </script> <form name="myForm" ng-controller="ExampleController"> Single word: <input type="text" name="input" ng-model="example.text" ng-pattern="example.word" required ng-trim="false"> <span class="error" ng-show="myForm.input.$error.required"> Required!</span> <span class="error" ng-show="myForm.input.$error.pattern"> Single word only!</span> <tt>text = {{example.text}}</tt><br/> <tt>myForm.input.$valid = {{myForm.input.$valid}}</tt><br/> <tt>myForm.input.$error = {{myForm.input.$error}}</tt><br/> <tt>myForm.$valid = {{myForm.$valid}}</tt><br/> <tt>myForm.$error.required = {{!!myForm.$error.required}}</tt><br/> </form> </file> <file name="protractor.js" type="protractor"> var text = element(by.binding('example.text')); var valid = element(by.binding('myForm.input.$valid')); var input = element(by.model('example.text')); it('should initialize to model', function() { expect(text.getText()).toContain('guest'); expect(valid.getText()).toContain('true'); }); it('should be invalid if empty', function() { input.clear(); input.sendKeys(''); expect(text.getText()).toEqual('text ='); expect(valid.getText()).toContain('false'); }); it('should be invalid if multi word', function() { input.clear(); input.sendKeys('hello world'); expect(valid.getText()).toContain('false'); }); </file> </example> */ 'text': textInputType, /** * @ngdoc input * @name input[date] * * @description * Input with date validation and transformation. In browsers that do not yet support * the HTML5 date input, a text element will be used. In that case, text must be entered in a valid ISO-8601 * date format (yyyy-MM-dd), for example: `2009-01-06`. Since many * modern browsers do not yet support this input type, it is important to provide cues to users on the * expected input format via a placeholder or label. * * The model must always be a Date object, otherwise Angular will throw an error. * Invalid `Date` objects (dates whose `getTime()` is `NaN`) will be rendered as an empty string. * * The timezone to be used to read/write the `Date` instance in the model can be defined using * {@link ng.directive:ngModelOptions ngModelOptions}. By default, this is the timezone of the browser. * * @param {string} ngModel Assignable angular expression to data-bind to. * @param {string=} name Property name of the form under which the control is published. * @param {string=} min Sets the `min` validation error key if the value entered is less than `min`. This must be a * valid ISO date string (yyyy-MM-dd). * @param {string=} max Sets the `max` validation error key if the value entered is greater than `max`. This must be * a valid ISO date string (yyyy-MM-dd). * @param {string=} required Sets `required` validation error key if the value is not entered. * @param {string=} ngRequired Adds `required` attribute and `required` validation constraint to * the element when the ngRequired expression evaluates to true. Use `ngRequired` instead of * `required` when you want to data-bind to the `required` attribute. * @param {string=} ngChange Angular expression to be executed when input changes due to user * interaction with the input element. * * @example <example name="date-input-directive" module="dateInputExample"> <file name="index.html"> <script> angular.module('dateInputExample', []) .controller('DateController', ['$scope', function($scope) { $scope.example = { value: new Date(2013, 9, 22) }; }]); </script> <form name="myForm" ng-controller="DateController as dateCtrl"> Pick a date in 2013: <input type="date" id="exampleInput" name="input" ng-model="example.value" placeholder="yyyy-MM-dd" min="2013-01-01" max="2013-12-31" required /> <span class="error" ng-show="myForm.input.$error.required"> Required!</span> <span class="error" ng-show="myForm.input.$error.date"> Not a valid date!</span> <tt>value = {{example.value | date: "yyyy-MM-dd"}}</tt><br/> <tt>myForm.input.$valid = {{myForm.input.$valid}}</tt><br/> <tt>myForm.input.$error = {{myForm.input.$error}}</tt><br/> <tt>myForm.$valid = {{myForm.$valid}}</tt><br/> <tt>myForm.$error.required = {{!!myForm.$error.required}}</tt><br/> </form> </file> <file name="protractor.js" type="protractor"> var value = element(by.binding('example.value | date: "yyyy-MM-dd"')); var valid = element(by.binding('myForm.input.$valid')); var input = element(by.model('example.value')); // currently protractor/webdriver does not support // sending keys to all known HTML5 input controls // for various browsers (see https://github.com/angular/protractor/issues/562). function setInput(val) { // set the value of the element and force validation. var scr = "var ipt = document.getElementById('exampleInput'); " + "ipt.value = '" + val + "';" + "angular.element(ipt).scope().$apply(function(s) { s.myForm[ipt.name].$setViewValue('" + val + "'); });"; browser.executeScript(scr); } it('should initialize to model', function() { expect(value.getText()).toContain('2013-10-22'); expect(valid.getText()).toContain('myForm.input.$valid = true'); }); it('should be invalid if empty', function() { setInput(''); expect(value.getText()).toEqual('value ='); expect(valid.getText()).toContain('myForm.input.$valid = false'); }); it('should be invalid if over max', function() { setInput('2015-01-01'); expect(value.getText()).toContain(''); expect(valid.getText()).toContain('myForm.input.$valid = false'); }); </file> </example> */ 'date': createDateInputType('date', DATE_REGEXP, createDateParser(DATE_REGEXP, ['yyyy', 'MM', 'dd']), 'yyyy-MM-dd'), /** * @ngdoc input * @name input[datetime-local] * * @description * Input with datetime validation and transformation. In browsers that do not yet support * the HTML5 date input, a text element will be used. In that case, the text must be entered in a valid ISO-8601 * local datetime format (yyyy-MM-ddTHH:mm:ss), for example: `2010-12-28T14:57:00`. * * The model must always be a Date object, otherwise Angular will throw an error. * Invalid `Date` objects (dates whose `getTime()` is `NaN`) will be rendered as an empty string. * * The timezone to be used to read/write the `Date` instance in the model can be defined using * {@link ng.directive:ngModelOptions ngModelOptions}. By default, this is the timezone of the browser. * * @param {string} ngModel Assignable angular expression to data-bind to. * @param {string=} name Property name of the form under which the control is published. * @param {string=} min Sets the `min` validation error key if the value entered is less than `min`. This must be a * valid ISO datetime format (yyyy-MM-ddTHH:mm:ss). * @param {string=} max Sets the `max` validation error key if the value entered is greater than `max`. This must be * a valid ISO datetime format (yyyy-MM-ddTHH:mm:ss). * @param {string=} required Sets `required` validation error key if the value is not entered. * @param {string=} ngRequired Adds `required` attribute and `required` validation constraint to * the element when the ngRequired expression evaluates to true. Use `ngRequired` instead of * `required` when you want to data-bind to the `required` attribute. * @param {string=} ngChange Angular expression to be executed when input changes due to user * interaction with the input element. * * @example <example name="datetimelocal-input-directive" module="dateExample"> <file name="index.html"> <script> angular.module('dateExample', []) .controller('DateController', ['$scope', function($scope) { $scope.example = { value: new Date(2010, 11, 28, 14, 57) }; }]); </script> <form name="myForm" ng-controller="DateController as dateCtrl"> Pick a date between in 2013: <input type="datetime-local" id="exampleInput" name="input" ng-model="example.value" placeholder="yyyy-MM-ddTHH:mm:ss" min="2001-01-01T00:00:00" max="2013-12-31T00:00:00" required /> <span class="error" ng-show="myForm.input.$error.required"> Required!</span> <span class="error" ng-show="myForm.input.$error.datetimelocal"> Not a valid date!</span> <tt>value = {{example.value | date: "yyyy-MM-ddTHH:mm:ss"}}</tt><br/> <tt>myForm.input.$valid = {{myForm.input.$valid}}</tt><br/> <tt>myForm.input.$error = {{myForm.input.$error}}</tt><br/> <tt>myForm.$valid = {{myForm.$valid}}</tt><br/> <tt>myForm.$error.required = {{!!myForm.$error.required}}</tt><br/> </form> </file> <file name="protractor.js" type="protractor"> var value = element(by.binding('example.value | date: "yyyy-MM-ddTHH:mm:ss"')); var valid = element(by.binding('myForm.input.$valid')); var input = element(by.model('example.value')); // currently protractor/webdriver does not support // sending keys to all known HTML5 input controls // for various browsers (https://github.com/angular/protractor/issues/562). function setInput(val) { // set the value of the element and force validation. var scr = "var ipt = document.getElementById('exampleInput'); " + "ipt.value = '" + val + "';" + "angular.element(ipt).scope().$apply(function(s) { s.myForm[ipt.name].$setViewValue('" + val + "'); });"; browser.executeScript(scr); } it('should initialize to model', function() { expect(value.getText()).toContain('2010-12-28T14:57:00'); expect(valid.getText()).toContain('myForm.input.$valid = true'); }); it('should be invalid if empty', function() { setInput(''); expect(value.getText()).toEqual('value ='); expect(valid.getText()).toContain('myForm.input.$valid = false'); }); it('should be invalid if over max', function() { setInput('2015-01-01T23:59:00'); expect(value.getText()).toContain(''); expect(valid.getText()).toContain('myForm.input.$valid = false'); }); </file> </example> */ 'datetime-local': createDateInputType('datetimelocal', DATETIMELOCAL_REGEXP, createDateParser(DATETIMELOCAL_REGEXP, ['yyyy', 'MM', 'dd', 'HH', 'mm', 'ss', 'sss']), 'yyyy-MM-ddTHH:mm:ss.sss'), /** * @ngdoc input * @name input[time] * * @description * Input with time validation and transformation. In browsers that do not yet support * the HTML5 date input, a text element will be used. In that case, the text must be entered in a valid ISO-8601 * local time format (HH:mm:ss), for example: `14:57:00`. Model must be a Date object. This binding will always output a * Date object to the model of January 1, 1970, or local date `new Date(1970, 0, 1, HH, mm, ss)`. * * The model must always be a Date object, otherwise Angular will throw an error. * Invalid `Date` objects (dates whose `getTime()` is `NaN`) will be rendered as an empty string. * * The timezone to be used to read/write the `Date` instance in the model can be defined using * {@link ng.directive:ngModelOptions ngModelOptions}. By default, this is the timezone of the browser. * * @param {string} ngModel Assignable angular expression to data-bind to. * @param {string=} name Property name of the form under which the control is published. * @param {string=} min Sets the `min` validation error key if the value entered is less than `min`. This must be a * valid ISO time format (HH:mm:ss). * @param {string=} max Sets the `max` validation error key if the value entered is greater than `max`. This must be a * valid ISO time format (HH:mm:ss). * @param {string=} required Sets `required` validation error key if the value is not entered. * @param {string=} ngRequired Adds `required` attribute and `required` validation constraint to * the element when the ngRequired expression evaluates to true. Use `ngRequired` instead of * `required` when you want to data-bind to the `required` attribute. * @param {string=} ngChange Angular expression to be executed when input changes due to user * interaction with the input element. * * @example <example name="time-input-directive" module="timeExample"> <file name="index.html"> <script> angular.module('timeExample', []) .controller('DateController', ['$scope', function($scope) { $scope.example = { value: new Date(1970, 0, 1, 14, 57, 0) }; }]); </script> <form name="myForm" ng-controller="DateController as dateCtrl"> Pick a between 8am and 5pm: <input type="time" id="exampleInput" name="input" ng-model="example.value" placeholder="HH:mm:ss" min="08:00:00" max="17:00:00" required /> <span class="error" ng-show="myForm.input.$error.required"> Required!</span> <span class="error" ng-show="myForm.input.$error.time"> Not a valid date!</span> <tt>value = {{example.value | date: "HH:mm:ss"}}</tt><br/> <tt>myForm.input.$valid = {{myForm.input.$valid}}</tt><br/> <tt>myForm.input.$error = {{myForm.input.$error}}</tt><br/> <tt>myForm.$valid = {{myForm.$valid}}</tt><br/> <tt>myForm.$error.required = {{!!myForm.$error.required}}</tt><br/> </form> </file> <file name="protractor.js" type="protractor"> var value = element(by.binding('example.value | date: "HH:mm:ss"')); var valid = element(by.binding('myForm.input.$valid')); var input = element(by.model('example.value')); // currently protractor/webdriver does not support // sending keys to all known HTML5 input controls // for various browsers (https://github.com/angular/protractor/issues/562). function setInput(val) { // set the value of the element and force validation. var scr = "var ipt = document.getElementById('exampleInput'); " + "ipt.value = '" + val + "';" + "angular.element(ipt).scope().$apply(function(s) { s.myForm[ipt.name].$setViewValue('" + val + "'); });"; browser.executeScript(scr); } it('should initialize to model', function() { expect(value.getText()).toContain('14:57:00'); expect(valid.getText()).toContain('myForm.input.$valid = true'); }); it('should be invalid if empty', function() { setInput(''); expect(value.getText()).toEqual('value ='); expect(valid.getText()).toContain('myForm.input.$valid = false'); }); it('should be invalid if over max', function() { setInput('23:59:00'); expect(value.getText()).toContain(''); expect(valid.getText()).toContain('myForm.input.$valid = false'); }); </file> </example> */ 'time': createDateInputType('time', TIME_REGEXP, createDateParser(TIME_REGEXP, ['HH', 'mm', 'ss', 'sss']), 'HH:mm:ss.sss'), /** * @ngdoc input * @name input[week] * * @description * Input with week-of-the-year validation and transformation to Date. In browsers that do not yet support * the HTML5 week input, a text element will be used. In that case, the text must be entered in a valid ISO-8601 * week format (yyyy-W##), for example: `2013-W02`. * * The model must always be a Date object, otherwise Angular will throw an error. * Invalid `Date` objects (dates whose `getTime()` is `NaN`) will be rendered as an empty string. * * The timezone to be used to read/write the `Date` instance in the model can be defined using * {@link ng.directive:ngModelOptions ngModelOptions}. By default, this is the timezone of the browser. * * @param {string} ngModel Assignable angular expression to data-bind to. * @param {string=} name Property name of the form under which the control is published. * @param {string=} min Sets the `min` validation error key if the value entered is less than `min`. This must be a * valid ISO week format (yyyy-W##). * @param {string=} max Sets the `max` validation error key if the value entered is greater than `max`. This must be * a valid ISO week format (yyyy-W##). * @param {string=} required Sets `required` validation error key if the value is not entered. * @param {string=} ngRequired Adds `required` attribute and `required` validation constraint to * the element when the ngRequired expression evaluates to true. Use `ngRequired` instead of * `required` when you want to data-bind to the `required` attribute. * @param {string=} ngChange Angular expression to be executed when input changes due to user * interaction with the input element. * * @example <example name="week-input-directive" module="weekExample"> <file name="index.html"> <script> angular.module('weekExample', []) .controller('DateController', ['$scope', function($scope) { $scope.example = { value: new Date(2013, 0, 3) }; }]); </script> <form name="myForm" ng-controller="DateController as dateCtrl"> Pick a date between in 2013: <input id="exampleInput" type="week" name="input" ng-model="example.value" placeholder="YYYY-W##" min="2012-W32" max="2013-W52" required /> <span class="error" ng-show="myForm.input.$error.required"> Required!</span> <span class="error" ng-show="myForm.input.$error.week"> Not a valid date!</span> <tt>value = {{example.value | date: "yyyy-Www"}}</tt><br/> <tt>myForm.input.$valid = {{myForm.input.$valid}}</tt><br/> <tt>myForm.input.$error = {{myForm.input.$error}}</tt><br/> <tt>myForm.$valid = {{myForm.$valid}}</tt><br/> <tt>myForm.$error.required = {{!!myForm.$error.required}}</tt><br/> </form> </file> <file name="protractor.js" type="protractor"> var value = element(by.binding('example.value | date: "yyyy-Www"')); var valid = element(by.binding('myForm.input.$valid')); var input = element(by.model('example.value')); // currently protractor/webdriver does not support // sending keys to all known HTML5 input controls // for various browsers (https://github.com/angular/protractor/issues/562). function setInput(val) { // set the value of the element and force validation. var scr = "var ipt = document.getElementById('exampleInput'); " + "ipt.value = '" + val + "';" + "angular.element(ipt).scope().$apply(function(s) { s.myForm[ipt.name].$setViewValue('" + val + "'); });"; browser.executeScript(scr); } it('should initialize to model', function() { expect(value.getText()).toContain('2013-W01'); expect(valid.getText()).toContain('myForm.input.$valid = true'); }); it('should be invalid if empty', function() { setInput(''); expect(value.getText()).toEqual('value ='); expect(valid.getText()).toContain('myForm.input.$valid = false'); }); it('should be invalid if over max', function() { setInput('2015-W01'); expect(value.getText()).toContain(''); expect(valid.getText()).toContain('myForm.input.$valid = false'); }); </file> </example> */ 'week': createDateInputType('week', WEEK_REGEXP, weekParser, 'yyyy-Www'), /** * @ngdoc input * @name input[month] * * @description * Input with month validation and transformation. In browsers that do not yet support * the HTML5 month input, a text element will be used. In that case, the text must be entered in a valid ISO-8601 * month format (yyyy-MM), for example: `2009-01`. * * The model must always be a Date object, otherwise Angular will throw an error. * Invalid `Date` objects (dates whose `getTime()` is `NaN`) will be rendered as an empty string. * If the model is not set to the first of the month, the next view to model update will set it * to the first of the month. * * The timezone to be used to read/write the `Date` instance in the model can be defined using * {@link ng.directive:ngModelOptions ngModelOptions}. By default, this is the timezone of the browser. * * @param {string} ngModel Assignable angular expression to data-bind to. * @param {string=} name Property name of the form under which the control is published. * @param {string=} min Sets the `min` validation error key if the value entered is less than `min`. This must be * a valid ISO month format (yyyy-MM). * @param {string=} max Sets the `max` validation error key if the value entered is greater than `max`. This must * be a valid ISO month format (yyyy-MM). * @param {string=} required Sets `required` validation error key if the value is not entered. * @param {string=} ngRequired Adds `required` attribute and `required` validation constraint to * the element when the ngRequired expression evaluates to true. Use `ngRequired` instead of * `required` when you want to data-bind to the `required` attribute. * @param {string=} ngChange Angular expression to be executed when input changes due to user * interaction with the input element. * * @example <example name="month-input-directive" module="monthExample"> <file name="index.html"> <script> angular.module('monthExample', []) .controller('DateController', ['$scope', function($scope) { $scope.example = { value: new Date(2013, 9, 1) }; }]); </script> <form name="myForm" ng-controller="DateController as dateCtrl"> Pick a month in 2013: <input id="exampleInput" type="month" name="input" ng-model="example.value" placeholder="yyyy-MM" min="2013-01" max="2013-12" required /> <span class="error" ng-show="myForm.input.$error.required"> Required!</span> <span class="error" ng-show="myForm.input.$error.month"> Not a valid month!</span> <tt>value = {{example.value | date: "yyyy-MM"}}</tt><br/> <tt>myForm.input.$valid = {{myForm.input.$valid}}</tt><br/> <tt>myForm.input.$error = {{myForm.input.$error}}</tt><br/> <tt>myForm.$valid = {{myForm.$valid}}</tt><br/> <tt>myForm.$error.required = {{!!myForm.$error.required}}</tt><br/> </form> </file> <file name="protractor.js" type="protractor"> var value = element(by.binding('example.value | date: "yyyy-MM"')); var valid = element(by.binding('myForm.input.$valid')); var input = element(by.model('example.value')); // currently protractor/webdriver does not support // sending keys to all known HTML5 input controls // for various browsers (https://github.com/angular/protractor/issues/562). function setInput(val) { // set the value of the element and force validation. var scr = "var ipt = document.getElementById('exampleInput'); " + "ipt.value = '" + val + "';" + "angular.element(ipt).scope().$apply(function(s) { s.myForm[ipt.name].$setViewValue('" + val + "'); });"; browser.executeScript(scr); } it('should initialize to model', function() { expect(value.getText()).toContain('2013-10'); expect(valid.getText()).toContain('myForm.input.$valid = true'); }); it('should be invalid if empty', function() { setInput(''); expect(value.getText()).toEqual('value ='); expect(valid.getText()).toContain('myForm.input.$valid = false'); }); it('should be invalid if over max', function() { setInput('2015-01'); expect(value.getText()).toContain(''); expect(valid.getText()).toContain('myForm.input.$valid = false'); }); </file> </example> */ 'month': createDateInputType('month', MONTH_REGEXP, createDateParser(MONTH_REGEXP, ['yyyy', 'MM']), 'yyyy-MM'), /** * @ngdoc input * @name input[number] * * @description * Text input with number validation and transformation. Sets the `number` validation * error if not a valid number. * * The model must always be a number, otherwise Angular will throw an error. * * @param {string} ngModel Assignable angular expression to data-bind to. * @param {string=} name Property name of the form under which the control is published. * @param {string=} min Sets the `min` validation error key if the value entered is less than `min`. * @param {string=} max Sets the `max` validation error key if the value entered is greater than `max`. * @param {string=} required Sets `required` validation error key if the value is not entered. * @param {string=} ngRequired Adds `required` attribute and `required` validation constraint to * the element when the ngRequired expression evaluates to true. Use `ngRequired` instead of * `required` when you want to data-bind to the `required` attribute. * @param {number=} ngMinlength Sets `minlength` validation error key if the value is shorter than * minlength. * @param {number=} ngMaxlength Sets `maxlength` validation error key if the value is longer than * maxlength. Setting the attribute to a negative or non-numeric value, allows view values of * any length. * @param {string=} pattern Similar to `ngPattern` except that the attribute value is the actual string * that contains the regular expression body that will be converted to a regular expression * as in the ngPattern directive. * @param {string=} ngPattern Sets `pattern` validation error key if the ngModel value does not match * a RegExp found by evaluating the Angular expression given in the attribute value. * If the expression evaluates to a RegExp object then this is used directly. * If the expression is a string then it will be converted to a RegExp after wrapping it in `^` and `$` * characters. For instance, `"abc"` will be converted to `new RegExp('^abc$')`. * @param {string=} ngChange Angular expression to be executed when input changes due to user * interaction with the input element. * * @example <example name="number-input-directive" module="numberExample"> <file name="index.html"> <script> angular.module('numberExample', []) .controller('ExampleController', ['$scope', function($scope) { $scope.example = { value: 12 }; }]); </script> <form name="myForm" ng-controller="ExampleController"> Number: <input type="number" name="input" ng-model="example.value" min="0" max="99" required> <span class="error" ng-show="myForm.input.$error.required"> Required!</span> <span class="error" ng-show="myForm.input.$error.number"> Not valid number!</span> <tt>value = {{example.value}}</tt><br/> <tt>myForm.input.$valid = {{myForm.input.$valid}}</tt><br/> <tt>myForm.input.$error = {{myForm.input.$error}}</tt><br/> <tt>myForm.$valid = {{myForm.$valid}}</tt><br/> <tt>myForm.$error.required = {{!!myForm.$error.required}}</tt><br/> </form> </file> <file name="protractor.js" type="protractor"> var value = element(by.binding('example.value')); var valid = element(by.binding('myForm.input.$valid')); var input = element(by.model('example.value')); it('should initialize to model', function() { expect(value.getText()).toContain('12'); expect(valid.getText()).toContain('true'); }); it('should be invalid if empty', function() { input.clear(); input.sendKeys(''); expect(value.getText()).toEqual('value ='); expect(valid.getText()).toContain('false'); }); it('should be invalid if over max', function() { input.clear(); input.sendKeys('123'); expect(value.getText()).toEqual('value ='); expect(valid.getText()).toContain('false'); }); </file> </example> */ 'number': numberInputType, /** * @ngdoc input * @name input[url] * * @description * Text input with URL validation. Sets the `url` validation error key if the content is not a * valid URL. * * <div class="alert alert-warning"> * **Note:** `input[url]` uses a regex to validate urls that is derived from the regex * used in Chromium. If you need stricter validation, you can use `ng-pattern` or modify * the built-in validators (see the {@link guide/forms Forms guide}) * </div> * * @param {string} ngModel Assignable angular expression to data-bind to. * @param {string=} name Property name of the form under which the control is published. * @param {string=} required Sets `required` validation error key if the value is not entered. * @param {string=} ngRequired Adds `required` attribute and `required` validation constraint to * the element when the ngRequired expression evaluates to true. Use `ngRequired` instead of * `required` when you want to data-bind to the `required` attribute. * @param {number=} ngMinlength Sets `minlength` validation error key if the value is shorter than * minlength. * @param {number=} ngMaxlength Sets `maxlength` validation error key if the value is longer than * maxlength. Setting the attribute to a negative or non-numeric value, allows view values of * any length. * @param {string=} pattern Similar to `ngPattern` except that the attribute value is the actual string * that contains the regular expression body that will be converted to a regular expression * as in the ngPattern directive. * @param {string=} ngPattern Sets `pattern` validation error key if the ngModel value does not match * a RegExp found by evaluating the Angular expression given in the attribute value. * If the expression evaluates to a RegExp object then this is used directly. * If the expression is a string then it will be converted to a RegExp after wrapping it in `^` and `$` * characters. For instance, `"abc"` will be converted to `new RegExp('^abc$')`. * @param {string=} ngChange Angular expression to be executed when input changes due to user * interaction with the input element. * * @example <example name="url-input-directive" module="urlExample"> <file name="index.html"> <script> angular.module('urlExample', []) .controller('ExampleController', ['$scope', function($scope) { $scope.url = { text: 'http://google.com' }; }]); </script> <form name="myForm" ng-controller="ExampleController"> URL: <input type="url" name="input" ng-model="url.text" required> <span class="error" ng-show="myForm.input.$error.required"> Required!</span> <span class="error" ng-show="myForm.input.$error.url"> Not valid url!</span> <tt>text = {{url.text}}</tt><br/> <tt>myForm.input.$valid = {{myForm.input.$valid}}</tt><br/> <tt>myForm.input.$error = {{myForm.input.$error}}</tt><br/> <tt>myForm.$valid = {{myForm.$valid}}</tt><br/> <tt>myForm.$error.required = {{!!myForm.$error.required}}</tt><br/> <tt>myForm.$error.url = {{!!myForm.$error.url}}</tt><br/> </form> </file> <file name="protractor.js" type="protractor"> var text = element(by.binding('url.text')); var valid = element(by.binding('myForm.input.$valid')); var input = element(by.model('url.text')); it('should initialize to model', function() { expect(text.getText()).toContain('http://google.com'); expect(valid.getText()).toContain('true'); }); it('should be invalid if empty', function() { input.clear(); input.sendKeys(''); expect(text.getText()).toEqual('text ='); expect(valid.getText()).toContain('false'); }); it('should be invalid if not url', function() { input.clear(); input.sendKeys('box'); expect(valid.getText()).toContain('false'); }); </file> </example> */ 'url': urlInputType, /** * @ngdoc input * @name input[email] * * @description * Text input with email validation. Sets the `email` validation error key if not a valid email * address. * * <div class="alert alert-warning"> * **Note:** `input[email]` uses a regex to validate email addresses that is derived from the regex * used in Chromium. If you need stricter validation (e.g. requiring a top-level domain), you can * use `ng-pattern` or modify the built-in validators (see the {@link guide/forms Forms guide}) * </div> * * @param {string} ngModel Assignable angular expression to data-bind to. * @param {string=} name Property name of the form under which the control is published. * @param {string=} required Sets `required` validation error key if the value is not entered. * @param {string=} ngRequired Adds `required` attribute and `required` validation constraint to * the element when the ngRequired expression evaluates to true. Use `ngRequired` instead of * `required` when you want to data-bind to the `required` attribute. * @param {number=} ngMinlength Sets `minlength` validation error key if the value is shorter than * minlength. * @param {number=} ngMaxlength Sets `maxlength` validation error key if the value is longer than * maxlength. Setting the attribute to a negative or non-numeric value, allows view values of * any length. * @param {string=} pattern Similar to `ngPattern` except that the attribute value is the actual string * that contains the regular expression body that will be converted to a regular expression * as in the ngPattern directive. * @param {string=} ngPattern Sets `pattern` validation error key if the ngModel value does not match * a RegExp found by evaluating the Angular expression given in the attribute value. * If the expression evaluates to a RegExp object then this is used directly. * If the expression is a string then it will be converted to a RegExp after wrapping it in `^` and `$` * characters. For instance, `"abc"` will be converted to `new RegExp('^abc$')`. * @param {string=} ngChange Angular expression to be executed when input changes due to user * interaction with the input element. * * @example <example name="email-input-directive" module="emailExample"> <file name="index.html"> <script> angular.module('emailExample', []) .controller('ExampleController', ['$scope', function($scope) { $scope.email = { text: 'me@example.com' }; }]); </script> <form name="myForm" ng-controller="ExampleController"> Email: <input type="email" name="input" ng-model="email.text" required> <span class="error" ng-show="myForm.input.$error.required"> Required!</span> <span class="error" ng-show="myForm.input.$error.email"> Not valid email!</span> <tt>text = {{email.text}}</tt><br/> <tt>myForm.input.$valid = {{myForm.input.$valid}}</tt><br/> <tt>myForm.input.$error = {{myForm.input.$error}}</tt><br/> <tt>myForm.$valid = {{myForm.$valid}}</tt><br/> <tt>myForm.$error.required = {{!!myForm.$error.required}}</tt><br/> <tt>myForm.$error.email = {{!!myForm.$error.email}}</tt><br/> </form> </file> <file name="protractor.js" type="protractor"> var text = element(by.binding('email.text')); var valid = element(by.binding('myForm.input.$valid')); var input = element(by.model('email.text')); it('should initialize to model', function() { expect(text.getText()).toContain('me@example.com'); expect(valid.getText()).toContain('true'); }); it('should be invalid if empty', function() { input.clear(); input.sendKeys(''); expect(text.getText()).toEqual('text ='); expect(valid.getText()).toContain('false'); }); it('should be invalid if not email', function() { input.clear(); input.sendKeys('xxx'); expect(valid.getText()).toContain('false'); }); </file> </example> */ 'email': emailInputType, /** * @ngdoc input * @name input[radio] * * @description * HTML radio button. * * @param {string} ngModel Assignable angular expression to data-bind to. * @param {string} value The value to which the expression should be set when selected. * @param {string=} name Property name of the form under which the control is published. * @param {string=} ngChange Angular expression to be executed when input changes due to user * interaction with the input element. * @param {string} ngValue Angular expression which sets the value to which the expression should * be set when selected. * * @example <example name="radio-input-directive" module="radioExample"> <file name="index.html"> <script> angular.module('radioExample', []) .controller('ExampleController', ['$scope', function($scope) { $scope.color = { name: 'blue' }; $scope.specialValue = { "id": "12345", "value": "green" }; }]); </script> <form name="myForm" ng-controller="ExampleController"> <input type="radio" ng-model="color.name" value="red"> Red <br/> <input type="radio" ng-model="color.name" ng-value="specialValue"> Green <br/> <input type="radio" ng-model="color.name" value="blue"> Blue <br/> <tt>color = {{color.name | json}}</tt><br/> </form> Note that `ng-value="specialValue"` sets radio item's value to be the value of `$scope.specialValue`. </file> <file name="protractor.js" type="protractor"> it('should change state', function() { var color = element(by.binding('color.name')); expect(color.getText()).toContain('blue'); element.all(by.model('color.name')).get(0).click(); expect(color.getText()).toContain('red'); }); </file> </example> */ 'radio': radioInputType, /** * @ngdoc input * @name input[checkbox] * * @description * HTML checkbox. * * @param {string} ngModel Assignable angular expression to data-bind to. * @param {string=} name Property name of the form under which the control is published. * @param {expression=} ngTrueValue The value to which the expression should be set when selected. * @param {expression=} ngFalseValue The value to which the expression should be set when not selected. * @param {string=} ngChange Angular expression to be executed when input changes due to user * interaction with the input element. * * @example <example name="checkbox-input-directive" module="checkboxExample"> <file name="index.html"> <script> angular.module('checkboxExample', []) .controller('ExampleController', ['$scope', function($scope) { $scope.checkboxModel = { value1 : true, value2 : 'YES' }; }]); </script> <form name="myForm" ng-controller="ExampleController"> Value1: <input type="checkbox" ng-model="checkboxModel.value1"> <br/> Value2: <input type="checkbox" ng-model="checkboxModel.value2" ng-true-value="'YES'" ng-false-value="'NO'"> <br/> <tt>value1 = {{checkboxModel.value1}}</tt><br/> <tt>value2 = {{checkboxModel.value2}}</tt><br/> </form> </file> <file name="protractor.js" type="protractor"> it('should change state', function() { var value1 = element(by.binding('checkboxModel.value1')); var value2 = element(by.binding('checkboxModel.value2')); expect(value1.getText()).toContain('true'); expect(value2.getText()).toContain('YES'); element(by.model('checkboxModel.value1')).click(); element(by.model('checkboxModel.value2')).click(); expect(value1.getText()).toContain('false'); expect(value2.getText()).toContain('NO'); }); </file> </example> */ 'checkbox': checkboxInputType, 'hidden': noop, 'button': noop, 'submit': noop, 'reset': noop, 'file': noop }; function stringBasedInputType(ctrl) { ctrl.$formatters.push(function(value) { return ctrl.$isEmpty(value) ? value : value.toString(); }); } function textInputType(scope, element, attr, ctrl, $sniffer, $browser) { baseInputType(scope, element, attr, ctrl, $sniffer, $browser); stringBasedInputType(ctrl); } function baseInputType(scope, element, attr, ctrl, $sniffer, $browser) { var type = lowercase(element[0].type); // In composition mode, users are still inputing intermediate text buffer, // hold the listener until composition is done. // More about composition events: https://developer.mozilla.org/en-US/docs/Web/API/CompositionEvent if (!$sniffer.android) { var composing = false; element.on('compositionstart', function(data) { composing = true; }); element.on('compositionend', function() { composing = false; listener(); }); } var listener = function(ev) { if (timeout) { $browser.defer.cancel(timeout); timeout = null; } if (composing) return; var value = element.val(), event = ev && ev.type; // By default we will trim the value // If the attribute ng-trim exists we will avoid trimming // If input type is 'password', the value is never trimmed if (type !== 'password' && (!attr.ngTrim || attr.ngTrim !== 'false')) { value = trim(value); } // If a control is suffering from bad input (due to native validators), browsers discard its // value, so it may be necessary to revalidate (by calling $setViewValue again) even if the // control's value is the same empty value twice in a row. if (ctrl.$viewValue !== value || (value === '' && ctrl.$$hasNativeValidators)) { ctrl.$setViewValue(value, event); } }; // if the browser does support "input" event, we are fine - except on IE9 which doesn't fire the // input event on backspace, delete or cut if ($sniffer.hasEvent('input')) { element.on('input', listener); } else { var timeout; var deferListener = function(ev, input, origValue) { if (!timeout) { timeout = $browser.defer(function() { timeout = null; if (!input || input.value !== origValue) { listener(ev); } }); } }; element.on('keydown', function(event) { var key = event.keyCode; // ignore // command modifiers arrows if (key === 91 || (15 < key && key < 19) || (37 <= key && key <= 40)) return; deferListener(event, this, this.value); }); // if user modifies input value using context menu in IE, we need "paste" and "cut" events to catch it if ($sniffer.hasEvent('paste')) { element.on('paste cut', deferListener); } } // if user paste into input using mouse on older browser // or form autocomplete on newer browser, we need "change" event to catch it element.on('change', listener); ctrl.$render = function() { element.val(ctrl.$isEmpty(ctrl.$viewValue) ? '' : ctrl.$viewValue); }; } function weekParser(isoWeek, existingDate) { if (isDate(isoWeek)) { return isoWeek; } if (isString(isoWeek)) { WEEK_REGEXP.lastIndex = 0; var parts = WEEK_REGEXP.exec(isoWeek); if (parts) { var year = +parts[1], week = +parts[2], hours = 0, minutes = 0, seconds = 0, milliseconds = 0, firstThurs = getFirstThursdayOfYear(year), addDays = (week - 1) * 7; if (existingDate) { hours = existingDate.getHours(); minutes = existingDate.getMinutes(); seconds = existingDate.getSeconds(); milliseconds = existingDate.getMilliseconds(); } return new Date(year, 0, firstThurs.getDate() + addDays, hours, minutes, seconds, milliseconds); } } return NaN; } function createDateParser(regexp, mapping) { return function(iso, date) { var parts, map; if (isDate(iso)) { return iso; } if (isString(iso)) { // When a date is JSON'ified to wraps itself inside of an extra // set of double quotes. This makes the date parsing code unable // to match the date string and parse it as a date. if (iso.charAt(0) == '"' && iso.charAt(iso.length - 1) == '"') { iso = iso.substring(1, iso.length - 1); } if (ISO_DATE_REGEXP.test(iso)) { return new Date(iso); } regexp.lastIndex = 0; parts = regexp.exec(iso); if (parts) { parts.shift(); if (date) { map = { yyyy: date.getFullYear(), MM: date.getMonth() + 1, dd: date.getDate(), HH: date.getHours(), mm: date.getMinutes(), ss: date.getSeconds(), sss: date.getMilliseconds() / 1000 }; } else { map = { yyyy: 1970, MM: 1, dd: 1, HH: 0, mm: 0, ss: 0, sss: 0 }; } forEach(parts, function(part, index) { if (index < mapping.length) { map[mapping[index]] = +part; } }); return new Date(map.yyyy, map.MM - 1, map.dd, map.HH, map.mm, map.ss || 0, map.sss * 1000 || 0); } } return NaN; }; } function createDateInputType(type, regexp, parseDate, format) { return function dynamicDateInputType(scope, element, attr, ctrl, $sniffer, $browser, $filter) { badInputChecker(scope, element, attr, ctrl); baseInputType(scope, element, attr, ctrl, $sniffer, $browser); var timezone = ctrl && ctrl.$options && ctrl.$options.timezone; var previousDate; ctrl.$$parserName = type; ctrl.$parsers.push(function(value) { if (ctrl.$isEmpty(value)) return null; if (regexp.test(value)) { // Note: We cannot read ctrl.$modelValue, as there might be a different // parser/formatter in the processing chain so that the model // contains some different data format! var parsedDate = parseDate(value, previousDate); if (timezone === 'UTC') { parsedDate.setMinutes(parsedDate.getMinutes() - parsedDate.getTimezoneOffset()); } return parsedDate; } return undefined; }); ctrl.$formatters.push(function(value) { if (value && !isDate(value)) { throw $ngModelMinErr('datefmt', 'Expected `{0}` to be a date', value); } if (isValidDate(value)) { previousDate = value; if (previousDate && timezone === 'UTC') { var timezoneOffset = 60000 * previousDate.getTimezoneOffset(); previousDate = new Date(previousDate.getTime() + timezoneOffset); } return $filter('date')(value, format, timezone); } else { previousDate = null; return ''; } }); if (isDefined(attr.min) || attr.ngMin) { var minVal; ctrl.$validators.min = function(value) { return !isValidDate(value) || isUndefined(minVal) || parseDate(value) >= minVal; }; attr.$observe('min', function(val) { minVal = parseObservedDateValue(val); ctrl.$validate(); }); } if (isDefined(attr.max) || attr.ngMax) { var maxVal; ctrl.$validators.max = function(value) { return !isValidDate(value) || isUndefined(maxVal) || parseDate(value) <= maxVal; }; attr.$observe('max', function(val) { maxVal = parseObservedDateValue(val); ctrl.$validate(); }); } function isValidDate(value) { // Invalid Date: getTime() returns NaN return value && !(value.getTime && value.getTime() !== value.getTime()); } function parseObservedDateValue(val) { return isDefined(val) ? (isDate(val) ? val : parseDate(val)) : undefined; } }; } function badInputChecker(scope, element, attr, ctrl) { var node = element[0]; var nativeValidation = ctrl.$$hasNativeValidators = isObject(node.validity); if (nativeValidation) { ctrl.$parsers.push(function(value) { var validity = element.prop(VALIDITY_STATE_PROPERTY) || {}; // Detect bug in FF35 for input[email] (https://bugzilla.mozilla.org/show_bug.cgi?id=1064430): // - also sets validity.badInput (should only be validity.typeMismatch). // - see http://www.whatwg.org/specs/web-apps/current-work/multipage/forms.html#e-mail-state-(type=email) // - can ignore this case as we can still read out the erroneous email... return validity.badInput && !validity.typeMismatch ? undefined : value; }); } } function numberInputType(scope, element, attr, ctrl, $sniffer, $browser) { badInputChecker(scope, element, attr, ctrl); baseInputType(scope, element, attr, ctrl, $sniffer, $browser); ctrl.$$parserName = 'number'; ctrl.$parsers.push(function(value) { if (ctrl.$isEmpty(value)) return null; if (NUMBER_REGEXP.test(value)) return parseFloat(value); return undefined; }); ctrl.$formatters.push(function(value) { if (!ctrl.$isEmpty(value)) { if (!isNumber(value)) { throw $ngModelMinErr('numfmt', 'Expected `{0}` to be a number', value); } value = value.toString(); } return value; }); if (attr.min || attr.ngMin) { var minVal; ctrl.$validators.min = function(value) { return ctrl.$isEmpty(value) || isUndefined(minVal) || value >= minVal; }; attr.$observe('min', function(val) { if (isDefined(val) && !isNumber(val)) { val = parseFloat(val, 10); } minVal = isNumber(val) && !isNaN(val) ? val : undefined; // TODO(matsko): implement validateLater to reduce number of validations ctrl.$validate(); }); } if (attr.max || attr.ngMax) { var maxVal; ctrl.$validators.max = function(value) { return ctrl.$isEmpty(value) || isUndefined(maxVal) || value <= maxVal; }; attr.$observe('max', function(val) { if (isDefined(val) && !isNumber(val)) { val = parseFloat(val, 10); } maxVal = isNumber(val) && !isNaN(val) ? val : undefined; // TODO(matsko): implement validateLater to reduce number of validations ctrl.$validate(); }); } } function urlInputType(scope, element, attr, ctrl, $sniffer, $browser) { // Note: no badInputChecker here by purpose as `url` is only a validation // in browsers, i.e. we can always read out input.value even if it is not valid! baseInputType(scope, element, attr, ctrl, $sniffer, $browser); stringBasedInputType(ctrl); ctrl.$$parserName = 'url'; ctrl.$validators.url = function(modelValue, viewValue) { var value = modelValue || viewValue; return ctrl.$isEmpty(value) || URL_REGEXP.test(value); }; } function emailInputType(scope, element, attr, ctrl, $sniffer, $browser) { // Note: no badInputChecker here by purpose as `url` is only a validation // in browsers, i.e. we can always read out input.value even if it is not valid! baseInputType(scope, element, attr, ctrl, $sniffer, $browser); stringBasedInputType(ctrl); ctrl.$$parserName = 'email'; ctrl.$validators.email = function(modelValue, viewValue) { var value = modelValue || viewValue; return ctrl.$isEmpty(value) || EMAIL_REGEXP.test(value); }; } function radioInputType(scope, element, attr, ctrl) { // make the name unique, if not defined if (isUndefined(attr.name)) { element.attr('name', nextUid()); } var listener = function(ev) { if (element[0].checked) { ctrl.$setViewValue(attr.value, ev && ev.type); } }; element.on('click', listener); ctrl.$render = function() { var value = attr.value; element[0].checked = (value == ctrl.$viewValue); }; attr.$observe('value', ctrl.$render); } function parseConstantExpr($parse, context, name, expression, fallback) { var parseFn; if (isDefined(expression)) { parseFn = $parse(expression); if (!parseFn.constant) { throw minErr('ngModel')('constexpr', 'Expected constant expression for `{0}`, but saw ' + '`{1}`.', name, expression); } return parseFn(context); } return fallback; } function checkboxInputType(scope, element, attr, ctrl, $sniffer, $browser, $filter, $parse) { var trueValue = parseConstantExpr($parse, scope, 'ngTrueValue', attr.ngTrueValue, true); var falseValue = parseConstantExpr($parse, scope, 'ngFalseValue', attr.ngFalseValue, false); var listener = function(ev) { ctrl.$setViewValue(element[0].checked, ev && ev.type); }; element.on('click', listener); ctrl.$render = function() { element[0].checked = ctrl.$viewValue; }; // Override the standard `$isEmpty` because the $viewValue of an empty checkbox is always set to `false` // This is because of the parser below, which compares the `$modelValue` with `trueValue` to convert // it to a boolean. ctrl.$isEmpty = function(value) { return value === false; }; ctrl.$formatters.push(function(value) { return equals(value, trueValue); }); ctrl.$parsers.push(function(value) { return value ? trueValue : falseValue; }); } /** * @ngdoc directive * @name textarea * @restrict E * * @description * HTML textarea element control with angular data-binding. The data-binding and validation * properties of this element are exactly the same as those of the * {@link ng.directive:input input element}. * * @param {string} ngModel Assignable angular expression to data-bind to. * @param {string=} name Property name of the form under which the control is published. * @param {string=} required Sets `required` validation error key if the value is not entered. * @param {string=} ngRequired Adds `required` attribute and `required` validation constraint to * the element when the ngRequired expression evaluates to true. Use `ngRequired` instead of * `required` when you want to data-bind to the `required` attribute. * @param {number=} ngMinlength Sets `minlength` validation error key if the value is shorter than * minlength. * @param {number=} ngMaxlength Sets `maxlength` validation error key if the value is longer than * maxlength. Setting the attribute to a negative or non-numeric value, allows view values of any * length. * @param {string=} ngPattern Sets `pattern` validation error key if the value does not match the * RegExp pattern expression. Expected value is `/regexp/` for inline patterns or `regexp` for * patterns defined as scope expressions. * @param {string=} ngChange Angular expression to be executed when input changes due to user * interaction with the input element. * @param {boolean=} [ngTrim=true] If set to false Angular will not automatically trim the input. */ /** * @ngdoc directive * @name input * @restrict E * * @description * HTML input element control. When used together with {@link ngModel `ngModel`}, it provides data-binding, * input state control, and validation. * Input control follows HTML5 input types and polyfills the HTML5 validation behavior for older browsers. * * <div class="alert alert-warning"> * **Note:** Not every feature offered is available for all input types. * Specifically, data binding and event handling via `ng-model` is unsupported for `input[file]`. * </div> * * @param {string} ngModel Assignable angular expression to data-bind to. * @param {string=} name Property name of the form under which the control is published. * @param {string=} required Sets `required` validation error key if the value is not entered. * @param {boolean=} ngRequired Sets `required` attribute if set to true * @param {number=} ngMinlength Sets `minlength` validation error key if the value is shorter than * minlength. * @param {number=} ngMaxlength Sets `maxlength` validation error key if the value is longer than * maxlength. Setting the attribute to a negative or non-numeric value, allows view values of any * length. * @param {string=} ngPattern Sets `pattern` validation error key if the value does not match the * RegExp pattern expression. Expected value is `/regexp/` for inline patterns or `regexp` for * patterns defined as scope expressions. * @param {string=} ngChange Angular expression to be executed when input changes due to user * interaction with the input element. * @param {boolean=} [ngTrim=true] If set to false Angular will not automatically trim the input. * This parameter is ignored for input[type=password] controls, which will never trim the * input. * * @example <example name="input-directive" module="inputExample"> <file name="index.html"> <script> angular.module('inputExample', []) .controller('ExampleController', ['$scope', function($scope) { $scope.user = {name: 'guest', last: 'visitor'}; }]); </script> <div ng-controller="ExampleController"> <form name="myForm"> User name: <input type="text" name="userName" ng-model="user.name" required> <span class="error" ng-show="myForm.userName.$error.required"> Required!</span><br> Last name: <input type="text" name="lastName" ng-model="user.last" ng-minlength="3" ng-maxlength="10"> <span class="error" ng-show="myForm.lastName.$error.minlength"> Too short!</span> <span class="error" ng-show="myForm.lastName.$error.maxlength"> Too long!</span><br> </form> <hr> <tt>user = {{user}}</tt><br/> <tt>myForm.userName.$valid = {{myForm.userName.$valid}}</tt><br> <tt>myForm.userName.$error = {{myForm.userName.$error}}</tt><br> <tt>myForm.lastName.$valid = {{myForm.lastName.$valid}}</tt><br> <tt>myForm.lastName.$error = {{myForm.lastName.$error}}</tt><br> <tt>myForm.$valid = {{myForm.$valid}}</tt><br> <tt>myForm.$error.required = {{!!myForm.$error.required}}</tt><br> <tt>myForm.$error.minlength = {{!!myForm.$error.minlength}}</tt><br> <tt>myForm.$error.maxlength = {{!!myForm.$error.maxlength}}</tt><br> </div> </file> <file name="protractor.js" type="protractor"> var user = element(by.exactBinding('user')); var userNameValid = element(by.binding('myForm.userName.$valid')); var lastNameValid = element(by.binding('myForm.lastName.$valid')); var lastNameError = element(by.binding('myForm.lastName.$error')); var formValid = element(by.binding('myForm.$valid')); var userNameInput = element(by.model('user.name')); var userLastInput = element(by.model('user.last')); it('should initialize to model', function() { expect(user.getText()).toContain('{"name":"guest","last":"visitor"}'); expect(userNameValid.getText()).toContain('true'); expect(formValid.getText()).toContain('true'); }); it('should be invalid if empty when required', function() { userNameInput.clear(); userNameInput.sendKeys(''); expect(user.getText()).toContain('{"last":"visitor"}'); expect(userNameValid.getText()).toContain('false'); expect(formValid.getText()).toContain('false'); }); it('should be valid if empty when min length is set', function() { userLastInput.clear(); userLastInput.sendKeys(''); expect(user.getText()).toContain('{"name":"guest","last":""}'); expect(lastNameValid.getText()).toContain('true'); expect(formValid.getText()).toContain('true'); }); it('should be invalid if less than required min length', function() { userLastInput.clear(); userLastInput.sendKeys('xx'); expect(user.getText()).toContain('{"name":"guest"}'); expect(lastNameValid.getText()).toContain('false'); expect(lastNameError.getText()).toContain('minlength'); expect(formValid.getText()).toContain('false'); }); it('should be invalid if longer than max length', function() { userLastInput.clear(); userLastInput.sendKeys('some ridiculously long name'); expect(user.getText()).toContain('{"name":"guest"}'); expect(lastNameValid.getText()).toContain('false'); expect(lastNameError.getText()).toContain('maxlength'); expect(formValid.getText()).toContain('false'); }); </file> </example> */ var inputDirective = ['$browser', '$sniffer', '$filter', '$parse', function($browser, $sniffer, $filter, $parse) { return { restrict: 'E', require: ['?ngModel'], link: { pre: function(scope, element, attr, ctrls) { if (ctrls[0]) { (inputType[lowercase(attr.type)] || inputType.text)(scope, element, attr, ctrls[0], $sniffer, $browser, $filter, $parse); } } } }; }]; var CONSTANT_VALUE_REGEXP = /^(true|false|\d+)$/; /** * @ngdoc directive * @name ngValue * * @description * Binds the given expression to the value of `<option>` or {@link input[radio] `input[radio]`}, * so that when the element is selected, the {@link ngModel `ngModel`} of that element is set to * the bound value. * * `ngValue` is useful when dynamically generating lists of radio buttons using * {@link ngRepeat `ngRepeat`}, as shown below. * * Likewise, `ngValue` can be used to generate `<option>` elements for * the {@link select `select`} element. In that case however, only strings are supported * for the `value `attribute, so the resulting `ngModel` will always be a string. * Support for `select` models with non-string values is available via `ngOptions`. * * @element input * @param {string=} ngValue angular expression, whose value will be bound to the `value` attribute * of the `input` element * * @example <example name="ngValue-directive" module="valueExample"> <file name="index.html"> <script> angular.module('valueExample', []) .controller('ExampleController', ['$scope', function($scope) { $scope.names = ['pizza', 'unicorns', 'robots']; $scope.my = { favorite: 'unicorns' }; }]); </script> <form ng-controller="ExampleController"> <h2>Which is your favorite?</h2> <label ng-repeat="name in names" for="{{name}}"> {{name}} <input type="radio" ng-model="my.favorite" ng-value="name" id="{{name}}" name="favorite"> </label> <div>You chose {{my.favorite}}</div> </form> </file> <file name="protractor.js" type="protractor"> var favorite = element(by.binding('my.favorite')); it('should initialize to model', function() { expect(favorite.getText()).toContain('unicorns'); }); it('should bind the values to the inputs', function() { element.all(by.model('my.favorite')).get(0).click(); expect(favorite.getText()).toContain('pizza'); }); </file> </example> */ var ngValueDirective = function() { return { restrict: 'A', priority: 100, compile: function(tpl, tplAttr) { if (CONSTANT_VALUE_REGEXP.test(tplAttr.ngValue)) { return function ngValueConstantLink(scope, elm, attr) { attr.$set('value', scope.$eval(attr.ngValue)); }; } else { return function ngValueLink(scope, elm, attr) { scope.$watch(attr.ngValue, function valueWatchAction(value) { attr.$set('value', value); }); }; } } }; }; /** * @ngdoc directive * @name ngBind * @restrict AC * * @description * The `ngBind` attribute tells Angular to replace the text content of the specified HTML element * with the value of a given expression, and to update the text content when the value of that * expression changes. * * Typically, you don't use `ngBind` directly, but instead you use the double curly markup like * `{{ expression }}` which is similar but less verbose. * * It is preferable to use `ngBind` instead of `{{ expression }}` if a template is momentarily * displayed by the browser in its raw state before Angular compiles it. Since `ngBind` is an * element attribute, it makes the bindings invisible to the user while the page is loading. * * An alternative solution to this problem would be using the * {@link ng.directive:ngCloak ngCloak} directive. * * * @element ANY * @param {expression} ngBind {@link guide/expression Expression} to evaluate. * * @example * Enter a name in the Live Preview text box; the greeting below the text box changes instantly. <example module="bindExample"> <file name="index.html"> <script> angular.module('bindExample', []) .controller('ExampleController', ['$scope', function($scope) { $scope.name = 'Whirled'; }]); </script> <div ng-controller="ExampleController"> Enter name: <input type="text" ng-model="name"><br> Hello <span ng-bind="name"></span>! </div> </file> <file name="protractor.js" type="protractor"> it('should check ng-bind', function() { var nameInput = element(by.model('name')); expect(element(by.binding('name')).getText()).toBe('Whirled'); nameInput.clear(); nameInput.sendKeys('world'); expect(element(by.binding('name')).getText()).toBe('world'); }); </file> </example> */ var ngBindDirective = ['$compile', function($compile) { return { restrict: 'AC', compile: function ngBindCompile(templateElement) { $compile.$$addBindingClass(templateElement); return function ngBindLink(scope, element, attr) { $compile.$$addBindingInfo(element, attr.ngBind); element = element[0]; scope.$watch(attr.ngBind, function ngBindWatchAction(value) { element.textContent = value === undefined ? '' : value; }); }; } }; }]; /** * @ngdoc directive * @name ngBindTemplate * * @description * The `ngBindTemplate` directive specifies that the element * text content should be replaced with the interpolation of the template * in the `ngBindTemplate` attribute. * Unlike `ngBind`, the `ngBindTemplate` can contain multiple `{{` `}}` * expressions. This directive is needed since some HTML elements * (such as TITLE and OPTION) cannot contain SPAN elements. * * @element ANY * @param {string} ngBindTemplate template of form * <tt>{{</tt> <tt>expression</tt> <tt>}}</tt> to eval. * * @example * Try it here: enter text in text box and watch the greeting change. <example module="bindExample"> <file name="index.html"> <script> angular.module('bindExample', []) .controller('ExampleController', ['$scope', function($scope) { $scope.salutation = 'Hello'; $scope.name = 'World'; }]); </script> <div ng-controller="ExampleController"> Salutation: <input type="text" ng-model="salutation"><br> Name: <input type="text" ng-model="name"><br> <pre ng-bind-template="{{salutation}} {{name}}!"></pre> </div> </file> <file name="protractor.js" type="protractor"> it('should check ng-bind', function() { var salutationElem = element(by.binding('salutation')); var salutationInput = element(by.model('salutation')); var nameInput = element(by.model('name')); expect(salutationElem.getText()).toBe('Hello World!'); salutationInput.clear(); salutationInput.sendKeys('Greetings'); nameInput.clear(); nameInput.sendKeys('user'); expect(salutationElem.getText()).toBe('Greetings user!'); }); </file> </example> */ var ngBindTemplateDirective = ['$interpolate', '$compile', function($interpolate, $compile) { return { compile: function ngBindTemplateCompile(templateElement) { $compile.$$addBindingClass(templateElement); return function ngBindTemplateLink(scope, element, attr) { var interpolateFn = $interpolate(element.attr(attr.$attr.ngBindTemplate)); $compile.$$addBindingInfo(element, interpolateFn.expressions); element = element[0]; attr.$observe('ngBindTemplate', function(value) { element.textContent = value === undefined ? '' : value; }); }; } }; }]; /** * @ngdoc directive * @name ngBindHtml * * @description * Evaluates the expression and inserts the resulting HTML into the element in a secure way. By default, * the resulting HTML content will be sanitized using the {@link ngSanitize.$sanitize $sanitize} service. * To utilize this functionality, ensure that `$sanitize` is available, for example, by including {@link * ngSanitize} in your module's dependencies (not in core Angular). In order to use {@link ngSanitize} * in your module's dependencies, you need to include "angular-sanitize.js" in your application. * * You may also bypass sanitization for values you know are safe. To do so, bind to * an explicitly trusted value via {@link ng.$sce#trustAsHtml $sce.trustAsHtml}. See the example * under {@link ng.$sce#show-me-an-example-using-sce- Strict Contextual Escaping (SCE)}. * * Note: If a `$sanitize` service is unavailable and the bound value isn't explicitly trusted, you * will have an exception (instead of an exploit.) * * @element ANY * @param {expression} ngBindHtml {@link guide/expression Expression} to evaluate. * * @example <example module="bindHtmlExample" deps="angular-sanitize.js"> <file name="index.html"> <div ng-controller="ExampleController"> <p ng-bind-html="myHTML"></p> </div> </file> <file name="script.js"> angular.module('bindHtmlExample', ['ngSanitize']) .controller('ExampleController', ['$scope', function($scope) { $scope.myHTML = 'I am an <code>HTML</code>string with ' + '<a href="#">links!</a> and other <em>stuff</em>'; }]); </file> <file name="protractor.js" type="protractor"> it('should check ng-bind-html', function() { expect(element(by.binding('myHTML')).getText()).toBe( 'I am an HTMLstring with links! and other stuff'); }); </file> </example> */ var ngBindHtmlDirective = ['$sce', '$parse', '$compile', function($sce, $parse, $compile) { return { restrict: 'A', compile: function ngBindHtmlCompile(tElement, tAttrs) { var ngBindHtmlGetter = $parse(tAttrs.ngBindHtml); var ngBindHtmlWatch = $parse(tAttrs.ngBindHtml, function getStringValue(value) { return (value || '').toString(); }); $compile.$$addBindingClass(tElement); return function ngBindHtmlLink(scope, element, attr) { $compile.$$addBindingInfo(element, attr.ngBindHtml); scope.$watch(ngBindHtmlWatch, function ngBindHtmlWatchAction() { // we re-evaluate the expr because we want a TrustedValueHolderType // for $sce, not a string element.html($sce.getTrustedHtml(ngBindHtmlGetter(scope)) || ''); }); }; } }; }]; /** * @ngdoc directive * @name ngChange * * @description * Evaluate the given expression when the user changes the input. * The expression is evaluated immediately, unlike the JavaScript onchange event * which only triggers at the end of a change (usually, when the user leaves the * form element or presses the return key). * * The `ngChange` expression is only evaluated when a change in the input value causes * a new value to be committed to the model. * * It will not be evaluated: * * if the value returned from the `$parsers` transformation pipeline has not changed * * if the input has continued to be invalid since the model will stay `null` * * if the model is changed programmatically and not by a change to the input value * * * Note, this directive requires `ngModel` to be present. * * @element input * @param {expression} ngChange {@link guide/expression Expression} to evaluate upon change * in input value. * * @example * <example name="ngChange-directive" module="changeExample"> * <file name="index.html"> * <script> * angular.module('changeExample', []) * .controller('ExampleController', ['$scope', function($scope) { * $scope.counter = 0; * $scope.change = function() { * $scope.counter++; * }; * }]); * </script> * <div ng-controller="ExampleController"> * <input type="checkbox" ng-model="confirmed" ng-change="change()" id="ng-change-example1" /> * <input type="checkbox" ng-model="confirmed" id="ng-change-example2" /> * <label for="ng-change-example2">Confirmed</label><br /> * <tt>debug = {{confirmed}}</tt><br/> * <tt>counter = {{counter}}</tt><br/> * </div> * </file> * <file name="protractor.js" type="protractor"> * var counter = element(by.binding('counter')); * var debug = element(by.binding('confirmed')); * * it('should evaluate the expression if changing from view', function() { * expect(counter.getText()).toContain('0'); * * element(by.id('ng-change-example1')).click(); * * expect(counter.getText()).toContain('1'); * expect(debug.getText()).toContain('true'); * }); * * it('should not evaluate the expression if changing from model', function() { * element(by.id('ng-change-example2')).click(); * expect(counter.getText()).toContain('0'); * expect(debug.getText()).toContain('true'); * }); * </file> * </example> */ var ngChangeDirective = valueFn({ restrict: 'A', require: 'ngModel', link: function(scope, element, attr, ctrl) { ctrl.$viewChangeListeners.push(function() { scope.$eval(attr.ngChange); }); } }); function classDirective(name, selector) { name = 'ngClass' + name; return ['$animate', function($animate) { return { restrict: 'AC', link: function(scope, element, attr) { var oldVal; scope.$watch(attr[name], ngClassWatchAction, true); attr.$observe('class', function(value) { ngClassWatchAction(scope.$eval(attr[name])); }); if (name !== 'ngClass') { scope.$watch('$index', function($index, old$index) { // jshint bitwise: false var mod = $index & 1; if (mod !== (old$index & 1)) { var classes = arrayClasses(scope.$eval(attr[name])); mod === selector ? addClasses(classes) : removeClasses(classes); } }); } function addClasses(classes) { var newClasses = digestClassCounts(classes, 1); attr.$addClass(newClasses); } function removeClasses(classes) { var newClasses = digestClassCounts(classes, -1); attr.$removeClass(newClasses); } function digestClassCounts(classes, count) { var classCounts = element.data('$classCounts') || {}; var classesToUpdate = []; forEach(classes, function(className) { if (count > 0 || classCounts[className]) { classCounts[className] = (classCounts[className] || 0) + count; if (classCounts[className] === +(count > 0)) { classesToUpdate.push(className); } } }); element.data('$classCounts', classCounts); return classesToUpdate.join(' '); } function updateClasses(oldClasses, newClasses) { var toAdd = arrayDifference(newClasses, oldClasses); var toRemove = arrayDifference(oldClasses, newClasses); toAdd = digestClassCounts(toAdd, 1); toRemove = digestClassCounts(toRemove, -1); if (toAdd && toAdd.length) { $animate.addClass(element, toAdd); } if (toRemove && toRemove.length) { $animate.removeClass(element, toRemove); } } function ngClassWatchAction(newVal) { if (selector === true || scope.$index % 2 === selector) { var newClasses = arrayClasses(newVal || []); if (!oldVal) { addClasses(newClasses); } else if (!equals(newVal,oldVal)) { var oldClasses = arrayClasses(oldVal); updateClasses(oldClasses, newClasses); } } oldVal = shallowCopy(newVal); } } }; function arrayDifference(tokens1, tokens2) { var values = []; outer: for (var i = 0; i < tokens1.length; i++) { var token = tokens1[i]; for (var j = 0; j < tokens2.length; j++) { if (token == tokens2[j]) continue outer; } values.push(token); } return values; } function arrayClasses(classVal) { if (isArray(classVal)) { return classVal; } else if (isString(classVal)) { return classVal.split(' '); } else if (isObject(classVal)) { var classes = []; forEach(classVal, function(v, k) { if (v) { classes = classes.concat(k.split(' ')); } }); return classes; } return classVal; } }]; } /** * @ngdoc directive * @name ngClass * @restrict AC * * @description * The `ngClass` directive allows you to dynamically set CSS classes on an HTML element by databinding * an expression that represents all classes to be added. * * The directive operates in three different ways, depending on which of three types the expression * evaluates to: * * 1. If the expression evaluates to a string, the string should be one or more space-delimited class * names. * * 2. If the expression evaluates to an array, each element of the array should be a string that is * one or more space-delimited class names. * * 3. If the expression evaluates to an object, then for each key-value pair of the * object with a truthy value the corresponding key is used as a class name. * * The directive won't add duplicate classes if a particular class was already set. * * When the expression changes, the previously added classes are removed and only then the * new classes are added. * * @animations * **add** - happens just before the class is applied to the elements * * **remove** - happens just before the class is removed from the element * * @element ANY * @param {expression} ngClass {@link guide/expression Expression} to eval. The result * of the evaluation can be a string representing space delimited class * names, an array, or a map of class names to boolean values. In the case of a map, the * names of the properties whose values are truthy will be added as css classes to the * element. * * @example Example that demonstrates basic bindings via ngClass directive. <example> <file name="index.html"> <p ng-class="{strike: deleted, bold: important, red: error}">Map Syntax Example</p> <input type="checkbox" ng-model="deleted"> deleted (apply "strike" class)<br> <input type="checkbox" ng-model="important"> important (apply "bold" class)<br> <input type="checkbox" ng-model="error"> error (apply "red" class) <hr> <p ng-class="style">Using String Syntax</p> <input type="text" ng-model="style" placeholder="Type: bold strike red"> <hr> <p ng-class="[style1, style2, style3]">Using Array Syntax</p> <input ng-model="style1" placeholder="Type: bold, strike or red"><br> <input ng-model="style2" placeholder="Type: bold, strike or red"><br> <input ng-model="style3" placeholder="Type: bold, strike or red"><br> </file> <file name="style.css"> .strike { text-decoration: line-through; } .bold { font-weight: bold; } .red { color: red; } </file> <file name="protractor.js" type="protractor"> var ps = element.all(by.css('p')); it('should let you toggle the class', function() { expect(ps.first().getAttribute('class')).not.toMatch(/bold/); expect(ps.first().getAttribute('class')).not.toMatch(/red/); element(by.model('important')).click(); expect(ps.first().getAttribute('class')).toMatch(/bold/); element(by.model('error')).click(); expect(ps.first().getAttribute('class')).toMatch(/red/); }); it('should let you toggle string example', function() { expect(ps.get(1).getAttribute('class')).toBe(''); element(by.model('style')).clear(); element(by.model('style')).sendKeys('red'); expect(ps.get(1).getAttribute('class')).toBe('red'); }); it('array example should have 3 classes', function() { expect(ps.last().getAttribute('class')).toBe(''); element(by.model('style1')).sendKeys('bold'); element(by.model('style2')).sendKeys('strike'); element(by.model('style3')).sendKeys('red'); expect(ps.last().getAttribute('class')).toBe('bold strike red'); }); </file> </example> ## Animations The example below demonstrates how to perform animations using ngClass. <example module="ngAnimate" deps="angular-animate.js" animations="true"> <file name="index.html"> <input id="setbtn" type="button" value="set" ng-click="myVar='my-class'"> <input id="clearbtn" type="button" value="clear" ng-click="myVar=''"> <br> <span class="base-class" ng-class="myVar">Sample Text</span> </file> <file name="style.css"> .base-class { -webkit-transition:all cubic-bezier(0.250, 0.460, 0.450, 0.940) 0.5s; transition:all cubic-bezier(0.250, 0.460, 0.450, 0.940) 0.5s; } .base-class.my-class { color: red; font-size:3em; } </file> <file name="protractor.js" type="protractor"> it('should check ng-class', function() { expect(element(by.css('.base-class')).getAttribute('class')).not. toMatch(/my-class/); element(by.id('setbtn')).click(); expect(element(by.css('.base-class')).getAttribute('class')). toMatch(/my-class/); element(by.id('clearbtn')).click(); expect(element(by.css('.base-class')).getAttribute('class')).not. toMatch(/my-class/); }); </file> </example> ## ngClass and pre-existing CSS3 Transitions/Animations The ngClass directive still supports CSS3 Transitions/Animations even if they do not follow the ngAnimate CSS naming structure. Upon animation ngAnimate will apply supplementary CSS classes to track the start and end of an animation, but this will not hinder any pre-existing CSS transitions already on the element. To get an idea of what happens during a class-based animation, be sure to view the step by step details of {@link ng.$animate#addClass $animate.addClass} and {@link ng.$animate#removeClass $animate.removeClass}. */ var ngClassDirective = classDirective('', true); /** * @ngdoc directive * @name ngClassOdd * @restrict AC * * @description * The `ngClassOdd` and `ngClassEven` directives work exactly as * {@link ng.directive:ngClass ngClass}, except they work in * conjunction with `ngRepeat` and take effect only on odd (even) rows. * * This directive can be applied only within the scope of an * {@link ng.directive:ngRepeat ngRepeat}. * * @element ANY * @param {expression} ngClassOdd {@link guide/expression Expression} to eval. The result * of the evaluation can be a string representing space delimited class names or an array. * * @example <example> <file name="index.html"> <ol ng-init="names=['John', 'Mary', 'Cate', 'Suz']"> <li ng-repeat="name in names"> <span ng-class-odd="'odd'" ng-class-even="'even'"> {{name}} </span> </li> </ol> </file> <file name="style.css"> .odd { color: red; } .even { color: blue; } </file> <file name="protractor.js" type="protractor"> it('should check ng-class-odd and ng-class-even', function() { expect(element(by.repeater('name in names').row(0).column('name')).getAttribute('class')). toMatch(/odd/); expect(element(by.repeater('name in names').row(1).column('name')).getAttribute('class')). toMatch(/even/); }); </file> </example> */ var ngClassOddDirective = classDirective('Odd', 0); /** * @ngdoc directive * @name ngClassEven * @restrict AC * * @description * The `ngClassOdd` and `ngClassEven` directives work exactly as * {@link ng.directive:ngClass ngClass}, except they work in * conjunction with `ngRepeat` and take effect only on odd (even) rows. * * This directive can be applied only within the scope of an * {@link ng.directive:ngRepeat ngRepeat}. * * @element ANY * @param {expression} ngClassEven {@link guide/expression Expression} to eval. The * result of the evaluation can be a string representing space delimited class names or an array. * * @example <example> <file name="index.html"> <ol ng-init="names=['John', 'Mary', 'Cate', 'Suz']"> <li ng-repeat="name in names"> <span ng-class-odd="'odd'" ng-class-even="'even'"> {{name}} &nbsp; &nbsp; &nbsp; </span> </li> </ol> </file> <file name="style.css"> .odd { color: red; } .even { color: blue; } </file> <file name="protractor.js" type="protractor"> it('should check ng-class-odd and ng-class-even', function() { expect(element(by.repeater('name in names').row(0).column('name')).getAttribute('class')). toMatch(/odd/); expect(element(by.repeater('name in names').row(1).column('name')).getAttribute('class')). toMatch(/even/); }); </file> </example> */ var ngClassEvenDirective = classDirective('Even', 1); /** * @ngdoc directive * @name ngCloak * @restrict AC * * @description * The `ngCloak` directive is used to prevent the Angular html template from being briefly * displayed by the browser in its raw (uncompiled) form while your application is loading. Use this * directive to avoid the undesirable flicker effect caused by the html template display. * * The directive can be applied to the `<body>` element, but the preferred usage is to apply * multiple `ngCloak` directives to small portions of the page to permit progressive rendering * of the browser view. * * `ngCloak` works in cooperation with the following css rule embedded within `angular.js` and * `angular.min.js`. * For CSP mode please add `angular-csp.css` to your html file (see {@link ng.directive:ngCsp ngCsp}). * * ```css * [ng\:cloak], [ng-cloak], [data-ng-cloak], [x-ng-cloak], .ng-cloak, .x-ng-cloak { * display: none !important; * } * ``` * * When this css rule is loaded by the browser, all html elements (including their children) that * are tagged with the `ngCloak` directive are hidden. When Angular encounters this directive * during the compilation of the template it deletes the `ngCloak` element attribute, making * the compiled element visible. * * For the best result, the `angular.js` script must be loaded in the head section of the html * document; alternatively, the css rule above must be included in the external stylesheet of the * application. * * Legacy browsers, like IE7, do not provide attribute selector support (added in CSS 2.1) so they * cannot match the `[ng\:cloak]` selector. To work around this limitation, you must add the css * class `ng-cloak` in addition to the `ngCloak` directive as shown in the example below. * * @element ANY * * @example <example> <file name="index.html"> <div id="template1" ng-cloak>{{ 'hello' }}</div> <div id="template2" ng-cloak class="ng-cloak">{{ 'hello IE7' }}</div> </file> <file name="protractor.js" type="protractor"> it('should remove the template directive and css class', function() { expect($('#template1').getAttribute('ng-cloak')). toBeNull(); expect($('#template2').getAttribute('ng-cloak')). toBeNull(); }); </file> </example> * */ var ngCloakDirective = ngDirective({ compile: function(element, attr) { attr.$set('ngCloak', undefined); element.removeClass('ng-cloak'); } }); /** * @ngdoc directive * @name ngController * * @description * The `ngController` directive attaches a controller class to the view. This is a key aspect of how angular * supports the principles behind the Model-View-Controller design pattern. * * MVC components in angular: * * * Model — Models are the properties of a scope; scopes are attached to the DOM where scope properties * are accessed through bindings. * * View — The template (HTML with data bindings) that is rendered into the View. * * Controller — The `ngController` directive specifies a Controller class; the class contains business * logic behind the application to decorate the scope with functions and values * * Note that you can also attach controllers to the DOM by declaring it in a route definition * via the {@link ngRoute.$route $route} service. A common mistake is to declare the controller * again using `ng-controller` in the template itself. This will cause the controller to be attached * and executed twice. * * @element ANY * @scope * @priority 500 * @param {expression} ngController Name of a constructor function registered with the current * {@link ng.$controllerProvider $controllerProvider} or an {@link guide/expression expression} * that on the current scope evaluates to a constructor function. * * The controller instance can be published into a scope property by specifying * `ng-controller="as propertyName"`. * * If the current `$controllerProvider` is configured to use globals (via * {@link ng.$controllerProvider#allowGlobals `$controllerProvider.allowGlobals()` }), this may * also be the name of a globally accessible constructor function (not recommended). * * @example * Here is a simple form for editing user contact information. Adding, removing, clearing, and * greeting are methods declared on the controller (see source tab). These methods can * easily be called from the angular markup. Any changes to the data are automatically reflected * in the View without the need for a manual update. * * Two different declaration styles are included below: * * * one binds methods and properties directly onto the controller using `this`: * `ng-controller="SettingsController1 as settings"` * * one injects `$scope` into the controller: * `ng-controller="SettingsController2"` * * The second option is more common in the Angular community, and is generally used in boilerplates * and in this guide. However, there are advantages to binding properties directly to the controller * and avoiding scope. * * * Using `controller as` makes it obvious which controller you are accessing in the template when * multiple controllers apply to an element. * * If you are writing your controllers as classes you have easier access to the properties and * methods, which will appear on the scope, from inside the controller code. * * Since there is always a `.` in the bindings, you don't have to worry about prototypal * inheritance masking primitives. * * This example demonstrates the `controller as` syntax. * * <example name="ngControllerAs" module="controllerAsExample"> * <file name="index.html"> * <div id="ctrl-as-exmpl" ng-controller="SettingsController1 as settings"> * Name: <input type="text" ng-model="settings.name"/> * [ <a href="" ng-click="settings.greet()">greet</a> ]<br/> * Contact: * <ul> * <li ng-repeat="contact in settings.contacts"> * <select ng-model="contact.type"> * <option>phone</option> * <option>email</option> * </select> * <input type="text" ng-model="contact.value"/> * [ <a href="" ng-click="settings.clearContact(contact)">clear</a> * | <a href="" ng-click="settings.removeContact(contact)">X</a> ] * </li> * <li>[ <a href="" ng-click="settings.addContact()">add</a> ]</li> * </ul> * </div> * </file> * <file name="app.js"> * angular.module('controllerAsExample', []) * .controller('SettingsController1', SettingsController1); * * function SettingsController1() { * this.name = "John Smith"; * this.contacts = [ * {type: 'phone', value: '408 555 1212'}, * {type: 'email', value: 'john.smith@example.org'} ]; * } * * SettingsController1.prototype.greet = function() { * alert(this.name); * }; * * SettingsController1.prototype.addContact = function() { * this.contacts.push({type: 'email', value: 'yourname@example.org'}); * }; * * SettingsController1.prototype.removeContact = function(contactToRemove) { * var index = this.contacts.indexOf(contactToRemove); * this.contacts.splice(index, 1); * }; * * SettingsController1.prototype.clearContact = function(contact) { * contact.type = 'phone'; * contact.value = ''; * }; * </file> * <file name="protractor.js" type="protractor"> * it('should check controller as', function() { * var container = element(by.id('ctrl-as-exmpl')); * expect(container.element(by.model('settings.name')) * .getAttribute('value')).toBe('John Smith'); * * var firstRepeat = * container.element(by.repeater('contact in settings.contacts').row(0)); * var secondRepeat = * container.element(by.repeater('contact in settings.contacts').row(1)); * * expect(firstRepeat.element(by.model('contact.value')).getAttribute('value')) * .toBe('408 555 1212'); * * expect(secondRepeat.element(by.model('contact.value')).getAttribute('value')) * .toBe('john.smith@example.org'); * * firstRepeat.element(by.linkText('clear')).click(); * * expect(firstRepeat.element(by.model('contact.value')).getAttribute('value')) * .toBe(''); * * container.element(by.linkText('add')).click(); * * expect(container.element(by.repeater('contact in settings.contacts').row(2)) * .element(by.model('contact.value')) * .getAttribute('value')) * .toBe('yourname@example.org'); * }); * </file> * </example> * * This example demonstrates the "attach to `$scope`" style of controller. * * <example name="ngController" module="controllerExample"> * <file name="index.html"> * <div id="ctrl-exmpl" ng-controller="SettingsController2"> * Name: <input type="text" ng-model="name"/> * [ <a href="" ng-click="greet()">greet</a> ]<br/> * Contact: * <ul> * <li ng-repeat="contact in contacts"> * <select ng-model="contact.type"> * <option>phone</option> * <option>email</option> * </select> * <input type="text" ng-model="contact.value"/> * [ <a href="" ng-click="clearContact(contact)">clear</a> * | <a href="" ng-click="removeContact(contact)">X</a> ] * </li> * <li>[ <a href="" ng-click="addContact()">add</a> ]</li> * </ul> * </div> * </file> * <file name="app.js"> * angular.module('controllerExample', []) * .controller('SettingsController2', ['$scope', SettingsController2]); * * function SettingsController2($scope) { * $scope.name = "John Smith"; * $scope.contacts = [ * {type:'phone', value:'408 555 1212'}, * {type:'email', value:'john.smith@example.org'} ]; * * $scope.greet = function() { * alert($scope.name); * }; * * $scope.addContact = function() { * $scope.contacts.push({type:'email', value:'yourname@example.org'}); * }; * * $scope.removeContact = function(contactToRemove) { * var index = $scope.contacts.indexOf(contactToRemove); * $scope.contacts.splice(index, 1); * }; * * $scope.clearContact = function(contact) { * contact.type = 'phone'; * contact.value = ''; * }; * } * </file> * <file name="protractor.js" type="protractor"> * it('should check controller', function() { * var container = element(by.id('ctrl-exmpl')); * * expect(container.element(by.model('name')) * .getAttribute('value')).toBe('John Smith'); * * var firstRepeat = * container.element(by.repeater('contact in contacts').row(0)); * var secondRepeat = * container.element(by.repeater('contact in contacts').row(1)); * * expect(firstRepeat.element(by.model('contact.value')).getAttribute('value')) * .toBe('408 555 1212'); * expect(secondRepeat.element(by.model('contact.value')).getAttribute('value')) * .toBe('john.smith@example.org'); * * firstRepeat.element(by.linkText('clear')).click(); * * expect(firstRepeat.element(by.model('contact.value')).getAttribute('value')) * .toBe(''); * * container.element(by.linkText('add')).click(); * * expect(container.element(by.repeater('contact in contacts').row(2)) * .element(by.model('contact.value')) * .getAttribute('value')) * .toBe('yourname@example.org'); * }); * </file> *</example> */ var ngControllerDirective = [function() { return { restrict: 'A', scope: true, controller: '@', priority: 500 }; }]; /** * @ngdoc directive * @name ngCsp * * @element html * @description * Enables [CSP (Content Security Policy)](https://developer.mozilla.org/en/Security/CSP) support. * * This is necessary when developing things like Google Chrome Extensions or Universal Windows Apps. * * CSP forbids apps to use `eval` or `Function(string)` generated functions (among other things). * For Angular to be CSP compatible there are only two things that we need to do differently: * * - don't use `Function` constructor to generate optimized value getters * - don't inject custom stylesheet into the document * * AngularJS uses `Function(string)` generated functions as a speed optimization. Applying the `ngCsp` * directive will cause Angular to use CSP compatibility mode. When this mode is on AngularJS will * evaluate all expressions up to 30% slower than in non-CSP mode, but no security violations will * be raised. * * CSP forbids JavaScript to inline stylesheet rules. In non CSP mode Angular automatically * includes some CSS rules (e.g. {@link ng.directive:ngCloak ngCloak}). * To make those directives work in CSP mode, include the `angular-csp.css` manually. * * Angular tries to autodetect if CSP is active and automatically turn on the CSP-safe mode. This * autodetection however triggers a CSP error to be logged in the console: * * ``` * Refused to evaluate a string as JavaScript because 'unsafe-eval' is not an allowed source of * script in the following Content Security Policy directive: "default-src 'self'". Note that * 'script-src' was not explicitly set, so 'default-src' is used as a fallback. * ``` * * This error is harmless but annoying. To prevent the error from showing up, put the `ngCsp` * directive on the root element of the application or on the `angular.js` script tag, whichever * appears first in the html document. * * *Note: This directive is only available in the `ng-csp` and `data-ng-csp` attribute form.* * * @example * This example shows how to apply the `ngCsp` directive to the `html` tag. ```html <!doctype html> <html ng-app ng-csp> ... ... </html> ``` * @example // Note: the suffix `.csp` in the example name triggers // csp mode in our http server! <example name="example.csp" module="cspExample" ng-csp="true"> <file name="index.html"> <div ng-controller="MainController as ctrl"> <div> <button ng-click="ctrl.inc()" id="inc">Increment</button> <span id="counter"> {{ctrl.counter}} </span> </div> <div> <button ng-click="ctrl.evil()" id="evil">Evil</button> <span id="evilError"> {{ctrl.evilError}} </span> </div> </div> </file> <file name="script.js"> angular.module('cspExample', []) .controller('MainController', function() { this.counter = 0; this.inc = function() { this.counter++; }; this.evil = function() { // jshint evil:true try { eval('1+2'); } catch (e) { this.evilError = e.message; } }; }); </file> <file name="protractor.js" type="protractor"> var util, webdriver; var incBtn = element(by.id('inc')); var counter = element(by.id('counter')); var evilBtn = element(by.id('evil')); var evilError = element(by.id('evilError')); function getAndClearSevereErrors() { return browser.manage().logs().get('browser').then(function(browserLog) { return browserLog.filter(function(logEntry) { return logEntry.level.value > webdriver.logging.Level.WARNING.value; }); }); } function clearErrors() { getAndClearSevereErrors(); } function expectNoErrors() { getAndClearSevereErrors().then(function(filteredLog) { expect(filteredLog.length).toEqual(0); if (filteredLog.length) { console.log('browser console errors: ' + util.inspect(filteredLog)); } }); } function expectError(regex) { getAndClearSevereErrors().then(function(filteredLog) { var found = false; filteredLog.forEach(function(log) { if (log.message.match(regex)) { found = true; } }); if (!found) { throw new Error('expected an error that matches ' + regex); } }); } beforeEach(function() { util = require('util'); webdriver = require('protractor/node_modules/selenium-webdriver'); }); // For now, we only test on Chrome, // as Safari does not load the page with Protractor's injected scripts, // and Firefox webdriver always disables content security policy (#6358) if (browser.params.browser !== 'chrome') { return; } it('should not report errors when the page is loaded', function() { // clear errors so we are not dependent on previous tests clearErrors(); // Need to reload the page as the page is already loaded when // we come here browser.driver.getCurrentUrl().then(function(url) { browser.get(url); }); expectNoErrors(); }); it('should evaluate expressions', function() { expect(counter.getText()).toEqual('0'); incBtn.click(); expect(counter.getText()).toEqual('1'); expectNoErrors(); }); it('should throw and report an error when using "eval"', function() { evilBtn.click(); expect(evilError.getText()).toMatch(/Content Security Policy/); expectError(/Content Security Policy/); }); </file> </example> */ // ngCsp is not implemented as a proper directive any more, because we need it be processed while we // bootstrap the system (before $parse is instantiated), for this reason we just have // the csp.isActive() fn that looks for ng-csp attribute anywhere in the current doc /** * @ngdoc directive * @name ngClick * * @description * The ngClick directive allows you to specify custom behavior when * an element is clicked. * * @element ANY * @priority 0 * @param {expression} ngClick {@link guide/expression Expression} to evaluate upon * click. ({@link guide/expression#-event- Event object is available as `$event`}) * * @example <example> <file name="index.html"> <button ng-click="count = count + 1" ng-init="count=0"> Increment </button> <span> count: {{count}} </span> </file> <file name="protractor.js" type="protractor"> it('should check ng-click', function() { expect(element(by.binding('count')).getText()).toMatch('0'); element(by.css('button')).click(); expect(element(by.binding('count')).getText()).toMatch('1'); }); </file> </example> */ /* * A collection of directives that allows creation of custom event handlers that are defined as * angular expressions and are compiled and executed within the current scope. */ var ngEventDirectives = {}; // For events that might fire synchronously during DOM manipulation // we need to execute their event handlers asynchronously using $evalAsync, // so that they are not executed in an inconsistent state. var forceAsyncEvents = { 'blur': true, 'focus': true }; forEach( 'click dblclick mousedown mouseup mouseover mouseout mousemove mouseenter mouseleave keydown keyup keypress submit focus blur copy cut paste'.split(' '), function(eventName) { var directiveName = directiveNormalize('ng-' + eventName); ngEventDirectives[directiveName] = ['$parse', '$rootScope', function($parse, $rootScope) { return { restrict: 'A', compile: function($element, attr) { // We expose the powerful $event object on the scope that provides access to the Window, // etc. that isn't protected by the fast paths in $parse. We explicitly request better // checks at the cost of speed since event handler expressions are not executed as // frequently as regular change detection. var fn = $parse(attr[directiveName], /* interceptorFn */ null, /* expensiveChecks */ true); return function ngEventHandler(scope, element) { element.on(eventName, function(event) { var callback = function() { fn(scope, {$event:event}); }; if (forceAsyncEvents[eventName] && $rootScope.$$phase) { scope.$evalAsync(callback); } else { scope.$apply(callback); } }); }; } }; }]; } ); /** * @ngdoc directive * @name ngDblclick * * @description * The `ngDblclick` directive allows you to specify custom behavior on a dblclick event. * * @element ANY * @priority 0 * @param {expression} ngDblclick {@link guide/expression Expression} to evaluate upon * a dblclick. (The Event object is available as `$event`) * * @example <example> <file name="index.html"> <button ng-dblclick="count = count + 1" ng-init="count=0"> Increment (on double click) </button> count: {{count}} </file> </example> */ /** * @ngdoc directive * @name ngMousedown * * @description * The ngMousedown directive allows you to specify custom behavior on mousedown event. * * @element ANY * @priority 0 * @param {expression} ngMousedown {@link guide/expression Expression} to evaluate upon * mousedown. ({@link guide/expression#-event- Event object is available as `$event`}) * * @example <example> <file name="index.html"> <button ng-mousedown="count = count + 1" ng-init="count=0"> Increment (on mouse down) </button> count: {{count}} </file> </example> */ /** * @ngdoc directive * @name ngMouseup * * @description * Specify custom behavior on mouseup event. * * @element ANY * @priority 0 * @param {expression} ngMouseup {@link guide/expression Expression} to evaluate upon * mouseup. ({@link guide/expression#-event- Event object is available as `$event`}) * * @example <example> <file name="index.html"> <button ng-mouseup="count = count + 1" ng-init="count=0"> Increment (on mouse up) </button> count: {{count}} </file> </example> */ /** * @ngdoc directive * @name ngMouseover * * @description * Specify custom behavior on mouseover event. * * @element ANY * @priority 0 * @param {expression} ngMouseover {@link guide/expression Expression} to evaluate upon * mouseover. ({@link guide/expression#-event- Event object is available as `$event`}) * * @example <example> <file name="index.html"> <button ng-mouseover="count = count + 1" ng-init="count=0"> Increment (when mouse is over) </button> count: {{count}} </file> </example> */ /** * @ngdoc directive * @name ngMouseenter * * @description * Specify custom behavior on mouseenter event. * * @element ANY * @priority 0 * @param {expression} ngMouseenter {@link guide/expression Expression} to evaluate upon * mouseenter. ({@link guide/expression#-event- Event object is available as `$event`}) * * @example <example> <file name="index.html"> <button ng-mouseenter="count = count + 1" ng-init="count=0"> Increment (when mouse enters) </button> count: {{count}} </file> </example> */ /** * @ngdoc directive * @name ngMouseleave * * @description * Specify custom behavior on mouseleave event. * * @element ANY * @priority 0 * @param {expression} ngMouseleave {@link guide/expression Expression} to evaluate upon * mouseleave. ({@link guide/expression#-event- Event object is available as `$event`}) * * @example <example> <file name="index.html"> <button ng-mouseleave="count = count + 1" ng-init="count=0"> Increment (when mouse leaves) </button> count: {{count}} </file> </example> */ /** * @ngdoc directive * @name ngMousemove * * @description * Specify custom behavior on mousemove event. * * @element ANY * @priority 0 * @param {expression} ngMousemove {@link guide/expression Expression} to evaluate upon * mousemove. ({@link guide/expression#-event- Event object is available as `$event`}) * * @example <example> <file name="index.html"> <button ng-mousemove="count = count + 1" ng-init="count=0"> Increment (when mouse moves) </button> count: {{count}} </file> </example> */ /** * @ngdoc directive * @name ngKeydown * * @description * Specify custom behavior on keydown event. * * @element ANY * @priority 0 * @param {expression} ngKeydown {@link guide/expression Expression} to evaluate upon * keydown. (Event object is available as `$event` and can be interrogated for keyCode, altKey, etc.) * * @example <example> <file name="index.html"> <input ng-keydown="count = count + 1" ng-init="count=0"> key down count: {{count}} </file> </example> */ /** * @ngdoc directive * @name ngKeyup * * @description * Specify custom behavior on keyup event. * * @element ANY * @priority 0 * @param {expression} ngKeyup {@link guide/expression Expression} to evaluate upon * keyup. (Event object is available as `$event` and can be interrogated for keyCode, altKey, etc.) * * @example <example> <file name="index.html"> <p>Typing in the input box below updates the key count</p> <input ng-keyup="count = count + 1" ng-init="count=0"> key up count: {{count}} <p>Typing in the input box below updates the keycode</p> <input ng-keyup="event=$event"> <p>event keyCode: {{ event.keyCode }}</p> <p>event altKey: {{ event.altKey }}</p> </file> </example> */ /** * @ngdoc directive * @name ngKeypress * * @description * Specify custom behavior on keypress event. * * @element ANY * @param {expression} ngKeypress {@link guide/expression Expression} to evaluate upon * keypress. ({@link guide/expression#-event- Event object is available as `$event`} * and can be interrogated for keyCode, altKey, etc.) * * @example <example> <file name="index.html"> <input ng-keypress="count = count + 1" ng-init="count=0"> key press count: {{count}} </file> </example> */ /** * @ngdoc directive * @name ngSubmit * * @description * Enables binding angular expressions to onsubmit events. * * Additionally it prevents the default action (which for form means sending the request to the * server and reloading the current page), but only if the form does not contain `action`, * `data-action`, or `x-action` attributes. * * <div class="alert alert-warning"> * **Warning:** Be careful not to cause "double-submission" by using both the `ngClick` and * `ngSubmit` handlers together. See the * {@link form#submitting-a-form-and-preventing-the-default-action `form` directive documentation} * for a detailed discussion of when `ngSubmit` may be triggered. * </div> * * @element form * @priority 0 * @param {expression} ngSubmit {@link guide/expression Expression} to eval. * ({@link guide/expression#-event- Event object is available as `$event`}) * * @example <example module="submitExample"> <file name="index.html"> <script> angular.module('submitExample', []) .controller('ExampleController', ['$scope', function($scope) { $scope.list = []; $scope.text = 'hello'; $scope.submit = function() { if ($scope.text) { $scope.list.push(this.text); $scope.text = ''; } }; }]); </script> <form ng-submit="submit()" ng-controller="ExampleController"> Enter text and hit enter: <input type="text" ng-model="text" name="text" /> <input type="submit" id="submit" value="Submit" /> <pre>list={{list}}</pre> </form> </file> <file name="protractor.js" type="protractor"> it('should check ng-submit', function() { expect(element(by.binding('list')).getText()).toBe('list=[]'); element(by.css('#submit')).click(); expect(element(by.binding('list')).getText()).toContain('hello'); expect(element(by.model('text')).getAttribute('value')).toBe(''); }); it('should ignore empty strings', function() { expect(element(by.binding('list')).getText()).toBe('list=[]'); element(by.css('#submit')).click(); element(by.css('#submit')).click(); expect(element(by.binding('list')).getText()).toContain('hello'); }); </file> </example> */ /** * @ngdoc directive * @name ngFocus * * @description * Specify custom behavior on focus event. * * Note: As the `focus` event is executed synchronously when calling `input.focus()` * AngularJS executes the expression using `scope.$evalAsync` if the event is fired * during an `$apply` to ensure a consistent state. * * @element window, input, select, textarea, a * @priority 0 * @param {expression} ngFocus {@link guide/expression Expression} to evaluate upon * focus. ({@link guide/expression#-event- Event object is available as `$event`}) * * @example * See {@link ng.directive:ngClick ngClick} */ /** * @ngdoc directive * @name ngBlur * * @description * Specify custom behavior on blur event. * * A [blur event](https://developer.mozilla.org/en-US/docs/Web/Events/blur) fires when * an element has lost focus. * * Note: As the `blur` event is executed synchronously also during DOM manipulations * (e.g. removing a focussed input), * AngularJS executes the expression using `scope.$evalAsync` if the event is fired * during an `$apply` to ensure a consistent state. * * @element window, input, select, textarea, a * @priority 0 * @param {expression} ngBlur {@link guide/expression Expression} to evaluate upon * blur. ({@link guide/expression#-event- Event object is available as `$event`}) * * @example * See {@link ng.directive:ngClick ngClick} */ /** * @ngdoc directive * @name ngCopy * * @description * Specify custom behavior on copy event. * * @element window, input, select, textarea, a * @priority 0 * @param {expression} ngCopy {@link guide/expression Expression} to evaluate upon * copy. ({@link guide/expression#-event- Event object is available as `$event`}) * * @example <example> <file name="index.html"> <input ng-copy="copied=true" ng-init="copied=false; value='copy me'" ng-model="value"> copied: {{copied}} </file> </example> */ /** * @ngdoc directive * @name ngCut * * @description * Specify custom behavior on cut event. * * @element window, input, select, textarea, a * @priority 0 * @param {expression} ngCut {@link guide/expression Expression} to evaluate upon * cut. ({@link guide/expression#-event- Event object is available as `$event`}) * * @example <example> <file name="index.html"> <input ng-cut="cut=true" ng-init="cut=false; value='cut me'" ng-model="value"> cut: {{cut}} </file> </example> */ /** * @ngdoc directive * @name ngPaste * * @description * Specify custom behavior on paste event. * * @element window, input, select, textarea, a * @priority 0 * @param {expression} ngPaste {@link guide/expression Expression} to evaluate upon * paste. ({@link guide/expression#-event- Event object is available as `$event`}) * * @example <example> <file name="index.html"> <input ng-paste="paste=true" ng-init="paste=false" placeholder='paste here'> pasted: {{paste}} </file> </example> */ /** * @ngdoc directive * @name ngIf * @restrict A * * @description * The `ngIf` directive removes or recreates a portion of the DOM tree based on an * {expression}. If the expression assigned to `ngIf` evaluates to a false * value then the element is removed from the DOM, otherwise a clone of the * element is reinserted into the DOM. * * `ngIf` differs from `ngShow` and `ngHide` in that `ngIf` completely removes and recreates the * element in the DOM rather than changing its visibility via the `display` css property. A common * case when this difference is significant is when using css selectors that rely on an element's * position within the DOM, such as the `:first-child` or `:last-child` pseudo-classes. * * Note that when an element is removed using `ngIf` its scope is destroyed and a new scope * is created when the element is restored. The scope created within `ngIf` inherits from * its parent scope using * [prototypal inheritance](https://github.com/angular/angular.js/wiki/Understanding-Scopes#javascript-prototypal-inheritance). * An important implication of this is if `ngModel` is used within `ngIf` to bind to * a javascript primitive defined in the parent scope. In this case any modifications made to the * variable within the child scope will override (hide) the value in the parent scope. * * Also, `ngIf` recreates elements using their compiled state. An example of this behavior * is if an element's class attribute is directly modified after it's compiled, using something like * jQuery's `.addClass()` method, and the element is later removed. When `ngIf` recreates the element * the added class will be lost because the original compiled state is used to regenerate the element. * * Additionally, you can provide animations via the `ngAnimate` module to animate the `enter` * and `leave` effects. * * @animations * enter - happens just after the `ngIf` contents change and a new DOM element is created and injected into the `ngIf` container * leave - happens just before the `ngIf` contents are removed from the DOM * * @element ANY * @scope * @priority 600 * @param {expression} ngIf If the {@link guide/expression expression} is falsy then * the element is removed from the DOM tree. If it is truthy a copy of the compiled * element is added to the DOM tree. * * @example <example module="ngAnimate" deps="angular-animate.js" animations="true"> <file name="index.html"> Click me: <input type="checkbox" ng-model="checked" ng-init="checked=true" /><br/> Show when checked: <span ng-if="checked" class="animate-if"> This is removed when the checkbox is unchecked. </span> </file> <file name="animations.css"> .animate-if { background:white; border:1px solid black; padding:10px; } .animate-if.ng-enter, .animate-if.ng-leave { -webkit-transition:all cubic-bezier(0.250, 0.460, 0.450, 0.940) 0.5s; transition:all cubic-bezier(0.250, 0.460, 0.450, 0.940) 0.5s; } .animate-if.ng-enter, .animate-if.ng-leave.ng-leave-active { opacity:0; } .animate-if.ng-leave, .animate-if.ng-enter.ng-enter-active { opacity:1; } </file> </example> */ var ngIfDirective = ['$animate', function($animate) { return { multiElement: true, transclude: 'element', priority: 600, terminal: true, restrict: 'A', $$tlb: true, link: function($scope, $element, $attr, ctrl, $transclude) { var block, childScope, previousElements; $scope.$watch($attr.ngIf, function ngIfWatchAction(value) { if (value) { if (!childScope) { $transclude(function(clone, newScope) { childScope = newScope; clone[clone.length++] = document.createComment(' end ngIf: ' + $attr.ngIf + ' '); // Note: We only need the first/last node of the cloned nodes. // However, we need to keep the reference to the jqlite wrapper as it might be changed later // by a directive with templateUrl when its template arrives. block = { clone: clone }; $animate.enter(clone, $element.parent(), $element); }); } } else { if (previousElements) { previousElements.remove(); previousElements = null; } if (childScope) { childScope.$destroy(); childScope = null; } if (block) { previousElements = getBlockNodes(block.clone); $animate.leave(previousElements).then(function() { previousElements = null; }); block = null; } } }); } }; }]; /** * @ngdoc directive * @name ngInclude * @restrict ECA * * @description * Fetches, compiles and includes an external HTML fragment. * * By default, the template URL is restricted to the same domain and protocol as the * application document. This is done by calling {@link $sce#getTrustedResourceUrl * $sce.getTrustedResourceUrl} on it. To load templates from other domains or protocols * you may either {@link ng.$sceDelegateProvider#resourceUrlWhitelist whitelist them} or * {@link $sce#trustAsResourceUrl wrap them} as trusted values. Refer to Angular's {@link * ng.$sce Strict Contextual Escaping}. * * In addition, the browser's * [Same Origin Policy](https://code.google.com/p/browsersec/wiki/Part2#Same-origin_policy_for_XMLHttpRequest) * and [Cross-Origin Resource Sharing (CORS)](http://www.w3.org/TR/cors/) * policy may further restrict whether the template is successfully loaded. * For example, `ngInclude` won't work for cross-domain requests on all browsers and for `file://` * access on some browsers. * * @animations * enter - animation is used to bring new content into the browser. * leave - animation is used to animate existing content away. * * The enter and leave animation occur concurrently. * * @scope * @priority 400 * * @param {string} ngInclude|src angular expression evaluating to URL. If the source is a string constant, * make sure you wrap it in **single** quotes, e.g. `src="'myPartialTemplate.html'"`. * @param {string=} onload Expression to evaluate when a new partial is loaded. * * @param {string=} autoscroll Whether `ngInclude` should call {@link ng.$anchorScroll * $anchorScroll} to scroll the viewport after the content is loaded. * * - If the attribute is not set, disable scrolling. * - If the attribute is set without value, enable scrolling. * - Otherwise enable scrolling only if the expression evaluates to truthy value. * * @example <example module="includeExample" deps="angular-animate.js" animations="true"> <file name="index.html"> <div ng-controller="ExampleController"> <select ng-model="template" ng-options="t.name for t in templates"> <option value="">(blank)</option> </select> url of the template: <code>{{template.url}}</code> <hr/> <div class="slide-animate-container"> <div class="slide-animate" ng-include="template.url"></div> </div> </div> </file> <file name="script.js"> angular.module('includeExample', ['ngAnimate']) .controller('ExampleController', ['$scope', function($scope) { $scope.templates = [ { name: 'template1.html', url: 'template1.html'}, { name: 'template2.html', url: 'template2.html'} ]; $scope.template = $scope.templates[0]; }]); </file> <file name="template1.html"> Content of template1.html </file> <file name="template2.html"> Content of template2.html </file> <file name="animations.css"> .slide-animate-container { position:relative; background:white; border:1px solid black; height:40px; overflow:hidden; } .slide-animate { padding:10px; } .slide-animate.ng-enter, .slide-animate.ng-leave { -webkit-transition:all cubic-bezier(0.250, 0.460, 0.450, 0.940) 0.5s; transition:all cubic-bezier(0.250, 0.460, 0.450, 0.940) 0.5s; position:absolute; top:0; left:0; right:0; bottom:0; display:block; padding:10px; } .slide-animate.ng-enter { top:-50px; } .slide-animate.ng-enter.ng-enter-active { top:0; } .slide-animate.ng-leave { top:0; } .slide-animate.ng-leave.ng-leave-active { top:50px; } </file> <file name="protractor.js" type="protractor"> var templateSelect = element(by.model('template')); var includeElem = element(by.css('[ng-include]')); it('should load template1.html', function() { expect(includeElem.getText()).toMatch(/Content of template1.html/); }); it('should load template2.html', function() { if (browser.params.browser == 'firefox') { // Firefox can't handle using selects // See https://github.com/angular/protractor/issues/480 return; } templateSelect.click(); templateSelect.all(by.css('option')).get(2).click(); expect(includeElem.getText()).toMatch(/Content of template2.html/); }); it('should change to blank', function() { if (browser.params.browser == 'firefox') { // Firefox can't handle using selects return; } templateSelect.click(); templateSelect.all(by.css('option')).get(0).click(); expect(includeElem.isPresent()).toBe(false); }); </file> </example> */ /** * @ngdoc event * @name ngInclude#$includeContentRequested * @eventType emit on the scope ngInclude was declared in * @description * Emitted every time the ngInclude content is requested. * * @param {Object} angularEvent Synthetic event object. * @param {String} src URL of content to load. */ /** * @ngdoc event * @name ngInclude#$includeContentLoaded * @eventType emit on the current ngInclude scope * @description * Emitted every time the ngInclude content is reloaded. * * @param {Object} angularEvent Synthetic event object. * @param {String} src URL of content to load. */ /** * @ngdoc event * @name ngInclude#$includeContentError * @eventType emit on the scope ngInclude was declared in * @description * Emitted when a template HTTP request yields an erroneous response (status < 200 || status > 299) * * @param {Object} angularEvent Synthetic event object. * @param {String} src URL of content to load. */ var ngIncludeDirective = ['$templateRequest', '$anchorScroll', '$animate', '$sce', function($templateRequest, $anchorScroll, $animate, $sce) { return { restrict: 'ECA', priority: 400, terminal: true, transclude: 'element', controller: angular.noop, compile: function(element, attr) { var srcExp = attr.ngInclude || attr.src, onloadExp = attr.onload || '', autoScrollExp = attr.autoscroll; return function(scope, $element, $attr, ctrl, $transclude) { var changeCounter = 0, currentScope, previousElement, currentElement; var cleanupLastIncludeContent = function() { if (previousElement) { previousElement.remove(); previousElement = null; } if (currentScope) { currentScope.$destroy(); currentScope = null; } if (currentElement) { $animate.leave(currentElement).then(function() { previousElement = null; }); previousElement = currentElement; currentElement = null; } }; scope.$watch($sce.parseAsResourceUrl(srcExp), function ngIncludeWatchAction(src) { var afterAnimation = function() { if (isDefined(autoScrollExp) && (!autoScrollExp || scope.$eval(autoScrollExp))) { $anchorScroll(); } }; var thisChangeId = ++changeCounter; if (src) { //set the 2nd param to true to ignore the template request error so that the inner //contents and scope can be cleaned up. $templateRequest(src, true).then(function(response) { if (thisChangeId !== changeCounter) return; var newScope = scope.$new(); ctrl.template = response; // Note: This will also link all children of ng-include that were contained in the original // html. If that content contains controllers, ... they could pollute/change the scope. // However, using ng-include on an element with additional content does not make sense... // Note: We can't remove them in the cloneAttchFn of $transclude as that // function is called before linking the content, which would apply child // directives to non existing elements. var clone = $transclude(newScope, function(clone) { cleanupLastIncludeContent(); $animate.enter(clone, null, $element).then(afterAnimation); }); currentScope = newScope; currentElement = clone; currentScope.$emit('$includeContentLoaded', src); scope.$eval(onloadExp); }, function() { if (thisChangeId === changeCounter) { cleanupLastIncludeContent(); scope.$emit('$includeContentError', src); } }); scope.$emit('$includeContentRequested', src); } else { cleanupLastIncludeContent(); ctrl.template = null; } }); }; } }; }]; // This directive is called during the $transclude call of the first `ngInclude` directive. // It will replace and compile the content of the element with the loaded template. // We need this directive so that the element content is already filled when // the link function of another directive on the same element as ngInclude // is called. var ngIncludeFillContentDirective = ['$compile', function($compile) { return { restrict: 'ECA', priority: -400, require: 'ngInclude', link: function(scope, $element, $attr, ctrl) { if (/SVG/.test($element[0].toString())) { // WebKit: https://bugs.webkit.org/show_bug.cgi?id=135698 --- SVG elements do not // support innerHTML, so detect this here and try to generate the contents // specially. $element.empty(); $compile(jqLiteBuildFragment(ctrl.template, document).childNodes)(scope, function namespaceAdaptedClone(clone) { $element.append(clone); }, {futureParentElement: $element}); return; } $element.html(ctrl.template); $compile($element.contents())(scope); } }; }]; /** * @ngdoc directive * @name ngInit * @restrict AC * * @description * The `ngInit` directive allows you to evaluate an expression in the * current scope. * * <div class="alert alert-error"> * The only appropriate use of `ngInit` is for aliasing special properties of * {@link ng.directive:ngRepeat `ngRepeat`}, as seen in the demo below. Besides this case, you * should use {@link guide/controller controllers} rather than `ngInit` * to initialize values on a scope. * </div> * <div class="alert alert-warning"> * **Note**: If you have assignment in `ngInit` along with {@link ng.$filter `$filter`}, make * sure you have parenthesis for correct precedence: * <pre class="prettyprint"> * `<div ng-init="test1 = (data | orderBy:'name')"></div>` * </pre> * </div> * * @priority 450 * * @element ANY * @param {expression} ngInit {@link guide/expression Expression} to eval. * * @example <example module="initExample"> <file name="index.html"> <script> angular.module('initExample', []) .controller('ExampleController', ['$scope', function($scope) { $scope.list = [['a', 'b'], ['c', 'd']]; }]); </script> <div ng-controller="ExampleController"> <div ng-repeat="innerList in list" ng-init="outerIndex = $index"> <div ng-repeat="value in innerList" ng-init="innerIndex = $index"> <span class="example-init">list[ {{outerIndex}} ][ {{innerIndex}} ] = {{value}};</span> </div> </div> </div> </file> <file name="protractor.js" type="protractor"> it('should alias index positions', function() { var elements = element.all(by.css('.example-init')); expect(elements.get(0).getText()).toBe('list[ 0 ][ 0 ] = a;'); expect(elements.get(1).getText()).toBe('list[ 0 ][ 1 ] = b;'); expect(elements.get(2).getText()).toBe('list[ 1 ][ 0 ] = c;'); expect(elements.get(3).getText()).toBe('list[ 1 ][ 1 ] = d;'); }); </file> </example> */ var ngInitDirective = ngDirective({ priority: 450, compile: function() { return { pre: function(scope, element, attrs) { scope.$eval(attrs.ngInit); } }; } }); /** * @ngdoc directive * @name ngList * * @description * Text input that converts between a delimited string and an array of strings. The default * delimiter is a comma followed by a space - equivalent to `ng-list=", "`. You can specify a custom * delimiter as the value of the `ngList` attribute - for example, `ng-list=" | "`. * * The behaviour of the directive is affected by the use of the `ngTrim` attribute. * * If `ngTrim` is set to `"false"` then whitespace around both the separator and each * list item is respected. This implies that the user of the directive is responsible for * dealing with whitespace but also allows you to use whitespace as a delimiter, such as a * tab or newline character. * * Otherwise whitespace around the delimiter is ignored when splitting (although it is respected * when joining the list items back together) and whitespace around each list item is stripped * before it is added to the model. * * ### Example with Validation * * <example name="ngList-directive" module="listExample"> * <file name="app.js"> * angular.module('listExample', []) * .controller('ExampleController', ['$scope', function($scope) { * $scope.names = ['morpheus', 'neo', 'trinity']; * }]); * </file> * <file name="index.html"> * <form name="myForm" ng-controller="ExampleController"> * List: <input name="namesInput" ng-model="names" ng-list required> * <span class="error" ng-show="myForm.namesInput.$error.required"> * Required!</span> * <br> * <tt>names = {{names}}</tt><br/> * <tt>myForm.namesInput.$valid = {{myForm.namesInput.$valid}}</tt><br/> * <tt>myForm.namesInput.$error = {{myForm.namesInput.$error}}</tt><br/> * <tt>myForm.$valid = {{myForm.$valid}}</tt><br/> * <tt>myForm.$error.required = {{!!myForm.$error.required}}</tt><br/> * </form> * </file> * <file name="protractor.js" type="protractor"> * var listInput = element(by.model('names')); * var names = element(by.exactBinding('names')); * var valid = element(by.binding('myForm.namesInput.$valid')); * var error = element(by.css('span.error')); * * it('should initialize to model', function() { * expect(names.getText()).toContain('["morpheus","neo","trinity"]'); * expect(valid.getText()).toContain('true'); * expect(error.getCssValue('display')).toBe('none'); * }); * * it('should be invalid if empty', function() { * listInput.clear(); * listInput.sendKeys(''); * * expect(names.getText()).toContain(''); * expect(valid.getText()).toContain('false'); * expect(error.getCssValue('display')).not.toBe('none'); * }); * </file> * </example> * * ### Example - splitting on whitespace * <example name="ngList-directive-newlines"> * <file name="index.html"> * <textarea ng-model="list" ng-list="&#10;" ng-trim="false"></textarea> * <pre>{{ list | json }}</pre> * </file> * <file name="protractor.js" type="protractor"> * it("should split the text by newlines", function() { * var listInput = element(by.model('list')); * var output = element(by.binding('list | json')); * listInput.sendKeys('abc\ndef\nghi'); * expect(output.getText()).toContain('[\n "abc",\n "def",\n "ghi"\n]'); * }); * </file> * </example> * * @element input * @param {string=} ngList optional delimiter that should be used to split the value. */ var ngListDirective = function() { return { restrict: 'A', priority: 100, require: 'ngModel', link: function(scope, element, attr, ctrl) { // We want to control whitespace trimming so we use this convoluted approach // to access the ngList attribute, which doesn't pre-trim the attribute var ngList = element.attr(attr.$attr.ngList) || ', '; var trimValues = attr.ngTrim !== 'false'; var separator = trimValues ? trim(ngList) : ngList; var parse = function(viewValue) { // If the viewValue is invalid (say required but empty) it will be `undefined` if (isUndefined(viewValue)) return; var list = []; if (viewValue) { forEach(viewValue.split(separator), function(value) { if (value) list.push(trimValues ? trim(value) : value); }); } return list; }; ctrl.$parsers.push(parse); ctrl.$formatters.push(function(value) { if (isArray(value)) { return value.join(ngList); } return undefined; }); // Override the standard $isEmpty because an empty array means the input is empty. ctrl.$isEmpty = function(value) { return !value || !value.length; }; } }; }; /* global VALID_CLASS: true, INVALID_CLASS: true, PRISTINE_CLASS: true, DIRTY_CLASS: true, UNTOUCHED_CLASS: true, TOUCHED_CLASS: true, */ var VALID_CLASS = 'ng-valid', INVALID_CLASS = 'ng-invalid', PRISTINE_CLASS = 'ng-pristine', DIRTY_CLASS = 'ng-dirty', UNTOUCHED_CLASS = 'ng-untouched', TOUCHED_CLASS = 'ng-touched', PENDING_CLASS = 'ng-pending'; var $ngModelMinErr = new minErr('ngModel'); /** * @ngdoc type * @name ngModel.NgModelController * * @property {string} $viewValue Actual string value in the view. * @property {*} $modelValue The value in the model that the control is bound to. * @property {Array.<Function>} $parsers Array of functions to execute, as a pipeline, whenever the control reads value from the DOM. The functions are called in array order, each passing its return value through to the next. The last return value is forwarded to the {@link ngModel.NgModelController#$validators `$validators`} collection. Parsers are used to sanitize / convert the {@link ngModel.NgModelController#$viewValue `$viewValue`}. Returning `undefined` from a parser means a parse error occurred. In that case, no {@link ngModel.NgModelController#$validators `$validators`} will run and the `ngModel` will be set to `undefined` unless {@link ngModelOptions `ngModelOptions.allowInvalid`} is set to `true`. The parse error is stored in `ngModel.$error.parse`. * * @property {Array.<Function>} $formatters Array of functions to execute, as a pipeline, whenever the model value changes. The functions are called in reverse array order, each passing the value through to the next. The last return value is used as the actual DOM value. Used to format / convert values for display in the control. * ```js * function formatter(value) { * if (value) { * return value.toUpperCase(); * } * } * ngModel.$formatters.push(formatter); * ``` * * @property {Object.<string, function>} $validators A collection of validators that are applied * whenever the model value changes. The key value within the object refers to the name of the * validator while the function refers to the validation operation. The validation operation is * provided with the model value as an argument and must return a true or false value depending * on the response of that validation. * * ```js * ngModel.$validators.validCharacters = function(modelValue, viewValue) { * var value = modelValue || viewValue; * return /[0-9]+/.test(value) && * /[a-z]+/.test(value) && * /[A-Z]+/.test(value) && * /\W+/.test(value); * }; * ``` * * @property {Object.<string, function>} $asyncValidators A collection of validations that are expected to * perform an asynchronous validation (e.g. a HTTP request). The validation function that is provided * is expected to return a promise when it is run during the model validation process. Once the promise * is delivered then the validation status will be set to true when fulfilled and false when rejected. * When the asynchronous validators are triggered, each of the validators will run in parallel and the model * value will only be updated once all validators have been fulfilled. As long as an asynchronous validator * is unfulfilled, its key will be added to the controllers `$pending` property. Also, all asynchronous validators * will only run once all synchronous validators have passed. * * Please note that if $http is used then it is important that the server returns a success HTTP response code * in order to fulfill the validation and a status level of `4xx` in order to reject the validation. * * ```js * ngModel.$asyncValidators.uniqueUsername = function(modelValue, viewValue) { * var value = modelValue || viewValue; * * // Lookup user by username * return $http.get('/api/users/' + value). * then(function resolved() { * //username exists, this means validation fails * return $q.reject('exists'); * }, function rejected() { * //username does not exist, therefore this validation passes * return true; * }); * }; * ``` * * @property {Array.<Function>} $viewChangeListeners Array of functions to execute whenever the * view value has changed. It is called with no arguments, and its return value is ignored. * This can be used in place of additional $watches against the model value. * * @property {Object} $error An object hash with all failing validator ids as keys. * @property {Object} $pending An object hash with all pending validator ids as keys. * * @property {boolean} $untouched True if control has not lost focus yet. * @property {boolean} $touched True if control has lost focus. * @property {boolean} $pristine True if user has not interacted with the control yet. * @property {boolean} $dirty True if user has already interacted with the control. * @property {boolean} $valid True if there is no error. * @property {boolean} $invalid True if at least one error on the control. * @property {string} $name The name attribute of the control. * * @description * * `NgModelController` provides API for the {@link ngModel `ngModel`} directive. * The controller contains services for data-binding, validation, CSS updates, and value formatting * and parsing. It purposefully does not contain any logic which deals with DOM rendering or * listening to DOM events. * Such DOM related logic should be provided by other directives which make use of * `NgModelController` for data-binding to control elements. * Angular provides this DOM logic for most {@link input `input`} elements. * At the end of this page you can find a {@link ngModel.NgModelController#custom-control-example * custom control example} that uses `ngModelController` to bind to `contenteditable` elements. * * @example * ### Custom Control Example * This example shows how to use `NgModelController` with a custom control to achieve * data-binding. Notice how different directives (`contenteditable`, `ng-model`, and `required`) * collaborate together to achieve the desired result. * * Note that `contenteditable` is an HTML5 attribute, which tells the browser to let the element * contents be edited in place by the user. This will not work on older browsers. * * We are using the {@link ng.service:$sce $sce} service here and include the {@link ngSanitize $sanitize} * module to automatically remove "bad" content like inline event listener (e.g. `<span onclick="...">`). * However, as we are using `$sce` the model can still decide to provide unsafe content if it marks * that content using the `$sce` service. * * <example name="NgModelController" module="customControl" deps="angular-sanitize.js"> <file name="style.css"> [contenteditable] { border: 1px solid black; background-color: white; min-height: 20px; } .ng-invalid { border: 1px solid red; } </file> <file name="script.js"> angular.module('customControl', ['ngSanitize']). directive('contenteditable', ['$sce', function($sce) { return { restrict: 'A', // only activate on element attribute require: '?ngModel', // get a hold of NgModelController link: function(scope, element, attrs, ngModel) { if (!ngModel) return; // do nothing if no ng-model // Specify how UI should be updated ngModel.$render = function() { element.html($sce.getTrustedHtml(ngModel.$viewValue || '')); }; // Listen for change events to enable binding element.on('blur keyup change', function() { scope.$evalAsync(read); }); read(); // initialize // Write data to the model function read() { var html = element.html(); // When we clear the content editable the browser leaves a <br> behind // If strip-br attribute is provided then we strip this out if ( attrs.stripBr && html == '<br>' ) { html = ''; } ngModel.$setViewValue(html); } } }; }]); </file> <file name="index.html"> <form name="myForm"> <div contenteditable name="myWidget" ng-model="userContent" strip-br="true" required>Change me!</div> <span ng-show="myForm.myWidget.$error.required">Required!</span> <hr> <textarea ng-model="userContent"></textarea> </form> </file> <file name="protractor.js" type="protractor"> it('should data-bind and become invalid', function() { if (browser.params.browser == 'safari' || browser.params.browser == 'firefox') { // SafariDriver can't handle contenteditable // and Firefox driver can't clear contenteditables very well return; } var contentEditable = element(by.css('[contenteditable]')); var content = 'Change me!'; expect(contentEditable.getText()).toEqual(content); contentEditable.clear(); contentEditable.sendKeys(protractor.Key.BACK_SPACE); expect(contentEditable.getText()).toEqual(''); expect(contentEditable.getAttribute('class')).toMatch(/ng-invalid-required/); }); </file> * </example> * * */ var NgModelController = ['$scope', '$exceptionHandler', '$attrs', '$element', '$parse', '$animate', '$timeout', '$rootScope', '$q', '$interpolate', function($scope, $exceptionHandler, $attr, $element, $parse, $animate, $timeout, $rootScope, $q, $interpolate) { this.$viewValue = Number.NaN; this.$modelValue = Number.NaN; this.$$rawModelValue = undefined; // stores the parsed modelValue / model set from scope regardless of validity. this.$validators = {}; this.$asyncValidators = {}; this.$parsers = []; this.$formatters = []; this.$viewChangeListeners = []; this.$untouched = true; this.$touched = false; this.$pristine = true; this.$dirty = false; this.$valid = true; this.$invalid = false; this.$error = {}; // keep invalid keys here this.$$success = {}; // keep valid keys here this.$pending = undefined; // keep pending keys here this.$name = $interpolate($attr.name || '', false)($scope); var parsedNgModel = $parse($attr.ngModel), parsedNgModelAssign = parsedNgModel.assign, ngModelGet = parsedNgModel, ngModelSet = parsedNgModelAssign, pendingDebounce = null, ctrl = this; this.$$setOptions = function(options) { ctrl.$options = options; if (options && options.getterSetter) { var invokeModelGetter = $parse($attr.ngModel + '()'), invokeModelSetter = $parse($attr.ngModel + '($$$p)'); ngModelGet = function($scope) { var modelValue = parsedNgModel($scope); if (isFunction(modelValue)) { modelValue = invokeModelGetter($scope); } return modelValue; }; ngModelSet = function($scope, newValue) { if (isFunction(parsedNgModel($scope))) { invokeModelSetter($scope, {$$$p: ctrl.$modelValue}); } else { parsedNgModelAssign($scope, ctrl.$modelValue); } }; } else if (!parsedNgModel.assign) { throw $ngModelMinErr('nonassign', "Expression '{0}' is non-assignable. Element: {1}", $attr.ngModel, startingTag($element)); } }; /** * @ngdoc method * @name ngModel.NgModelController#$render * * @description * Called when the view needs to be updated. It is expected that the user of the ng-model * directive will implement this method. * * The `$render()` method is invoked in the following situations: * * * `$rollbackViewValue()` is called. If we are rolling back the view value to the last * committed value then `$render()` is called to update the input control. * * The value referenced by `ng-model` is changed programmatically and both the `$modelValue` and * the `$viewValue` are different to last time. * * Since `ng-model` does not do a deep watch, `$render()` is only invoked if the values of * `$modelValue` and `$viewValue` are actually different to their previous value. If `$modelValue` * or `$viewValue` are objects (rather than a string or number) then `$render()` will not be * invoked if you only change a property on the objects. */ this.$render = noop; /** * @ngdoc method * @name ngModel.NgModelController#$isEmpty * * @description * This is called when we need to determine if the value of an input is empty. * * For instance, the required directive does this to work out if the input has data or not. * * The default `$isEmpty` function checks whether the value is `undefined`, `''`, `null` or `NaN`. * * You can override this for input directives whose concept of being empty is different to the * default. The `checkboxInputType` directive does this because in its case a value of `false` * implies empty. * * @param {*} value The value of the input to check for emptiness. * @returns {boolean} True if `value` is "empty". */ this.$isEmpty = function(value) { return isUndefined(value) || value === '' || value === null || value !== value; }; var parentForm = $element.inheritedData('$formController') || nullFormCtrl, currentValidationRunId = 0; /** * @ngdoc method * @name ngModel.NgModelController#$setValidity * * @description * Change the validity state, and notify the form. * * This method can be called within $parsers/$formatters or a custom validation implementation. * However, in most cases it should be sufficient to use the `ngModel.$validators` and * `ngModel.$asyncValidators` collections which will call `$setValidity` automatically. * * @param {string} validationErrorKey Name of the validator. The `validationErrorKey` will be assigned * to either `$error[validationErrorKey]` or `$pending[validationErrorKey]` * (for unfulfilled `$asyncValidators`), so that it is available for data-binding. * The `validationErrorKey` should be in camelCase and will get converted into dash-case * for class name. Example: `myError` will result in `ng-valid-my-error` and `ng-invalid-my-error` * class and can be bound to as `{{someForm.someControl.$error.myError}}` . * @param {boolean} isValid Whether the current state is valid (true), invalid (false), pending (undefined), * or skipped (null). Pending is used for unfulfilled `$asyncValidators`. * Skipped is used by Angular when validators do not run because of parse errors and * when `$asyncValidators` do not run because any of the `$validators` failed. */ addSetValidityMethod({ ctrl: this, $element: $element, set: function(object, property) { object[property] = true; }, unset: function(object, property) { delete object[property]; }, parentForm: parentForm, $animate: $animate }); /** * @ngdoc method * @name ngModel.NgModelController#$setPristine * * @description * Sets the control to its pristine state. * * This method can be called to remove the `ng-dirty` class and set the control to its pristine * state (`ng-pristine` class). A model is considered to be pristine when the control * has not been changed from when first compiled. */ this.$setPristine = function() { ctrl.$dirty = false; ctrl.$pristine = true; $animate.removeClass($element, DIRTY_CLASS); $animate.addClass($element, PRISTINE_CLASS); }; /** * @ngdoc method * @name ngModel.NgModelController#$setDirty * * @description * Sets the control to its dirty state. * * This method can be called to remove the `ng-pristine` class and set the control to its dirty * state (`ng-dirty` class). A model is considered to be dirty when the control has been changed * from when first compiled. */ this.$setDirty = function() { ctrl.$dirty = true; ctrl.$pristine = false; $animate.removeClass($element, PRISTINE_CLASS); $animate.addClass($element, DIRTY_CLASS); parentForm.$setDirty(); }; /** * @ngdoc method * @name ngModel.NgModelController#$setUntouched * * @description * Sets the control to its untouched state. * * This method can be called to remove the `ng-touched` class and set the control to its * untouched state (`ng-untouched` class). Upon compilation, a model is set as untouched * by default, however this function can be used to restore that state if the model has * already been touched by the user. */ this.$setUntouched = function() { ctrl.$touched = false; ctrl.$untouched = true; $animate.setClass($element, UNTOUCHED_CLASS, TOUCHED_CLASS); }; /** * @ngdoc method * @name ngModel.NgModelController#$setTouched * * @description * Sets the control to its touched state. * * This method can be called to remove the `ng-untouched` class and set the control to its * touched state (`ng-touched` class). A model is considered to be touched when the user has * first focused the control element and then shifted focus away from the control (blur event). */ this.$setTouched = function() { ctrl.$touched = true; ctrl.$untouched = false; $animate.setClass($element, TOUCHED_CLASS, UNTOUCHED_CLASS); }; /** * @ngdoc method * @name ngModel.NgModelController#$rollbackViewValue * * @description * Cancel an update and reset the input element's value to prevent an update to the `$modelValue`, * which may be caused by a pending debounced event or because the input is waiting for a some * future event. * * If you have an input that uses `ng-model-options` to set up debounced events or events such * as blur you can have a situation where there is a period when the `$viewValue` * is out of synch with the ngModel's `$modelValue`. * * In this case, you can run into difficulties if you try to update the ngModel's `$modelValue` * programmatically before these debounced/future events have resolved/occurred, because Angular's * dirty checking mechanism is not able to tell whether the model has actually changed or not. * * The `$rollbackViewValue()` method should be called before programmatically changing the model of an * input which may have such events pending. This is important in order to make sure that the * input field will be updated with the new model value and any pending operations are cancelled. * * <example name="ng-model-cancel-update" module="cancel-update-example"> * <file name="app.js"> * angular.module('cancel-update-example', []) * * .controller('CancelUpdateController', ['$scope', function($scope) { * $scope.resetWithCancel = function(e) { * if (e.keyCode == 27) { * $scope.myForm.myInput1.$rollbackViewValue(); * $scope.myValue = ''; * } * }; * $scope.resetWithoutCancel = function(e) { * if (e.keyCode == 27) { * $scope.myValue = ''; * } * }; * }]); * </file> * <file name="index.html"> * <div ng-controller="CancelUpdateController"> * <p>Try typing something in each input. See that the model only updates when you * blur off the input. * </p> * <p>Now see what happens if you start typing then press the Escape key</p> * * <form name="myForm" ng-model-options="{ updateOn: 'blur' }"> * <p>With $rollbackViewValue()</p> * <input name="myInput1" ng-model="myValue" ng-keydown="resetWithCancel($event)"><br/> * myValue: "{{ myValue }}" * * <p>Without $rollbackViewValue()</p> * <input name="myInput2" ng-model="myValue" ng-keydown="resetWithoutCancel($event)"><br/> * myValue: "{{ myValue }}" * </form> * </div> * </file> * </example> */ this.$rollbackViewValue = function() { $timeout.cancel(pendingDebounce); ctrl.$viewValue = ctrl.$$lastCommittedViewValue; ctrl.$render(); }; /** * @ngdoc method * @name ngModel.NgModelController#$validate * * @description * Runs each of the registered validators (first synchronous validators and then * asynchronous validators). * If the validity changes to invalid, the model will be set to `undefined`, * unless {@link ngModelOptions `ngModelOptions.allowInvalid`} is `true`. * If the validity changes to valid, it will set the model to the last available valid * modelValue, i.e. either the last parsed value or the last value set from the scope. */ this.$validate = function() { // ignore $validate before model is initialized if (isNumber(ctrl.$modelValue) && isNaN(ctrl.$modelValue)) { return; } var viewValue = ctrl.$$lastCommittedViewValue; // Note: we use the $$rawModelValue as $modelValue might have been // set to undefined during a view -> model update that found validation // errors. We can't parse the view here, since that could change // the model although neither viewValue nor the model on the scope changed var modelValue = ctrl.$$rawModelValue; // Check if the there's a parse error, so we don't unset it accidentially var parserName = ctrl.$$parserName || 'parse'; var parserValid = ctrl.$error[parserName] ? false : undefined; var prevValid = ctrl.$valid; var prevModelValue = ctrl.$modelValue; var allowInvalid = ctrl.$options && ctrl.$options.allowInvalid; ctrl.$$runValidators(parserValid, modelValue, viewValue, function(allValid) { // If there was no change in validity, don't update the model // This prevents changing an invalid modelValue to undefined if (!allowInvalid && prevValid !== allValid) { // Note: Don't check ctrl.$valid here, as we could have // external validators (e.g. calculated on the server), // that just call $setValidity and need the model value // to calculate their validity. ctrl.$modelValue = allValid ? modelValue : undefined; if (ctrl.$modelValue !== prevModelValue) { ctrl.$$writeModelToScope(); } } }); }; this.$$runValidators = function(parseValid, modelValue, viewValue, doneCallback) { currentValidationRunId++; var localValidationRunId = currentValidationRunId; // check parser error if (!processParseErrors(parseValid)) { validationDone(false); return; } if (!processSyncValidators()) { validationDone(false); return; } processAsyncValidators(); function processParseErrors(parseValid) { var errorKey = ctrl.$$parserName || 'parse'; if (parseValid === undefined) { setValidity(errorKey, null); } else { setValidity(errorKey, parseValid); if (!parseValid) { forEach(ctrl.$validators, function(v, name) { setValidity(name, null); }); forEach(ctrl.$asyncValidators, function(v, name) { setValidity(name, null); }); return false; } } return true; } function processSyncValidators() { var syncValidatorsValid = true; forEach(ctrl.$validators, function(validator, name) { var result = validator(modelValue, viewValue); syncValidatorsValid = syncValidatorsValid && result; setValidity(name, result); }); if (!syncValidatorsValid) { forEach(ctrl.$asyncValidators, function(v, name) { setValidity(name, null); }); return false; } return true; } function processAsyncValidators() { var validatorPromises = []; var allValid = true; forEach(ctrl.$asyncValidators, function(validator, name) { var promise = validator(modelValue, viewValue); if (!isPromiseLike(promise)) { throw $ngModelMinErr("$asyncValidators", "Expected asynchronous validator to return a promise but got '{0}' instead.", promise); } setValidity(name, undefined); validatorPromises.push(promise.then(function() { setValidity(name, true); }, function(error) { allValid = false; setValidity(name, false); })); }); if (!validatorPromises.length) { validationDone(true); } else { $q.all(validatorPromises).then(function() { validationDone(allValid); }, noop); } } function setValidity(name, isValid) { if (localValidationRunId === currentValidationRunId) { ctrl.$setValidity(name, isValid); } } function validationDone(allValid) { if (localValidationRunId === currentValidationRunId) { doneCallback(allValid); } } }; /** * @ngdoc method * @name ngModel.NgModelController#$commitViewValue * * @description * Commit a pending update to the `$modelValue`. * * Updates may be pending by a debounced event or because the input is waiting for a some future * event defined in `ng-model-options`. this method is rarely needed as `NgModelController` * usually handles calling this in response to input events. */ this.$commitViewValue = function() { var viewValue = ctrl.$viewValue; $timeout.cancel(pendingDebounce); // If the view value has not changed then we should just exit, except in the case where there is // a native validator on the element. In this case the validation state may have changed even though // the viewValue has stayed empty. if (ctrl.$$lastCommittedViewValue === viewValue && (viewValue !== '' || !ctrl.$$hasNativeValidators)) { return; } ctrl.$$lastCommittedViewValue = viewValue; // change to dirty if (ctrl.$pristine) { this.$setDirty(); } this.$$parseAndValidate(); }; this.$$parseAndValidate = function() { var viewValue = ctrl.$$lastCommittedViewValue; var modelValue = viewValue; var parserValid = isUndefined(modelValue) ? undefined : true; if (parserValid) { for (var i = 0; i < ctrl.$parsers.length; i++) { modelValue = ctrl.$parsers[i](modelValue); if (isUndefined(modelValue)) { parserValid = false; break; } } } if (isNumber(ctrl.$modelValue) && isNaN(ctrl.$modelValue)) { // ctrl.$modelValue has not been touched yet... ctrl.$modelValue = ngModelGet($scope); } var prevModelValue = ctrl.$modelValue; var allowInvalid = ctrl.$options && ctrl.$options.allowInvalid; ctrl.$$rawModelValue = modelValue; if (allowInvalid) { ctrl.$modelValue = modelValue; writeToModelIfNeeded(); } // Pass the $$lastCommittedViewValue here, because the cached viewValue might be out of date. // This can happen if e.g. $setViewValue is called from inside a parser ctrl.$$runValidators(parserValid, modelValue, ctrl.$$lastCommittedViewValue, function(allValid) { if (!allowInvalid) { // Note: Don't check ctrl.$valid here, as we could have // external validators (e.g. calculated on the server), // that just call $setValidity and need the model value // to calculate their validity. ctrl.$modelValue = allValid ? modelValue : undefined; writeToModelIfNeeded(); } }); function writeToModelIfNeeded() { if (ctrl.$modelValue !== prevModelValue) { ctrl.$$writeModelToScope(); } } }; this.$$writeModelToScope = function() { ngModelSet($scope, ctrl.$modelValue); forEach(ctrl.$viewChangeListeners, function(listener) { try { listener(); } catch (e) { $exceptionHandler(e); } }); }; /** * @ngdoc method * @name ngModel.NgModelController#$setViewValue * * @description * Update the view value. * * This method should be called when an input directive want to change the view value; typically, * this is done from within a DOM event handler. * * For example {@link ng.directive:input input} calls it when the value of the input changes and * {@link ng.directive:select select} calls it when an option is selected. * * If the new `value` is an object (rather than a string or a number), we should make a copy of the * object before passing it to `$setViewValue`. This is because `ngModel` does not perform a deep * watch of objects, it only looks for a change of identity. If you only change the property of * the object then ngModel will not realise that the object has changed and will not invoke the * `$parsers` and `$validators` pipelines. * * For this reason, you should not change properties of the copy once it has been passed to * `$setViewValue`. Otherwise you may cause the model value on the scope to change incorrectly. * * When this method is called, the new `value` will be staged for committing through the `$parsers` * and `$validators` pipelines. If there are no special {@link ngModelOptions} specified then the staged * value sent directly for processing, finally to be applied to `$modelValue` and then the * **expression** specified in the `ng-model` attribute. * * Lastly, all the registered change listeners, in the `$viewChangeListeners` list, are called. * * In case the {@link ng.directive:ngModelOptions ngModelOptions} directive is used with `updateOn` * and the `default` trigger is not listed, all those actions will remain pending until one of the * `updateOn` events is triggered on the DOM element. * All these actions will be debounced if the {@link ng.directive:ngModelOptions ngModelOptions} * directive is used with a custom debounce for this particular event. * * Note that calling this function does not trigger a `$digest`. * * @param {string} value Value from the view. * @param {string} trigger Event that triggered the update. */ this.$setViewValue = function(value, trigger) { ctrl.$viewValue = value; if (!ctrl.$options || ctrl.$options.updateOnDefault) { ctrl.$$debounceViewValueCommit(trigger); } }; this.$$debounceViewValueCommit = function(trigger) { var debounceDelay = 0, options = ctrl.$options, debounce; if (options && isDefined(options.debounce)) { debounce = options.debounce; if (isNumber(debounce)) { debounceDelay = debounce; } else if (isNumber(debounce[trigger])) { debounceDelay = debounce[trigger]; } else if (isNumber(debounce['default'])) { debounceDelay = debounce['default']; } } $timeout.cancel(pendingDebounce); if (debounceDelay) { pendingDebounce = $timeout(function() { ctrl.$commitViewValue(); }, debounceDelay); } else if ($rootScope.$$phase) { ctrl.$commitViewValue(); } else { $scope.$apply(function() { ctrl.$commitViewValue(); }); } }; // model -> value // Note: we cannot use a normal scope.$watch as we want to detect the following: // 1. scope value is 'a' // 2. user enters 'b' // 3. ng-change kicks in and reverts scope value to 'a' // -> scope value did not change since the last digest as // ng-change executes in apply phase // 4. view should be changed back to 'a' $scope.$watch(function ngModelWatch() { var modelValue = ngModelGet($scope); // if scope model value and ngModel value are out of sync // TODO(perf): why not move this to the action fn? if (modelValue !== ctrl.$modelValue) { ctrl.$modelValue = ctrl.$$rawModelValue = modelValue; var formatters = ctrl.$formatters, idx = formatters.length; var viewValue = modelValue; while (idx--) { viewValue = formatters[idx](viewValue); } if (ctrl.$viewValue !== viewValue) { ctrl.$viewValue = ctrl.$$lastCommittedViewValue = viewValue; ctrl.$render(); ctrl.$$runValidators(undefined, modelValue, viewValue, noop); } } return modelValue; }); }]; /** * @ngdoc directive * @name ngModel * * @element input * @priority 1 * * @description * The `ngModel` directive binds an `input`,`select`, `textarea` (or custom form control) to a * property on the scope using {@link ngModel.NgModelController NgModelController}, * which is created and exposed by this directive. * * `ngModel` is responsible for: * * - Binding the view into the model, which other directives such as `input`, `textarea` or `select` * require. * - Providing validation behavior (i.e. required, number, email, url). * - Keeping the state of the control (valid/invalid, dirty/pristine, touched/untouched, validation errors). * - Setting related css classes on the element (`ng-valid`, `ng-invalid`, `ng-dirty`, `ng-pristine`, `ng-touched`, `ng-untouched`) including animations. * - Registering the control with its parent {@link ng.directive:form form}. * * Note: `ngModel` will try to bind to the property given by evaluating the expression on the * current scope. If the property doesn't already exist on this scope, it will be created * implicitly and added to the scope. * * For best practices on using `ngModel`, see: * * - [Understanding Scopes](https://github.com/angular/angular.js/wiki/Understanding-Scopes) * * For basic examples, how to use `ngModel`, see: * * - {@link ng.directive:input input} * - {@link input[text] text} * - {@link input[checkbox] checkbox} * - {@link input[radio] radio} * - {@link input[number] number} * - {@link input[email] email} * - {@link input[url] url} * - {@link input[date] date} * - {@link input[datetime-local] datetime-local} * - {@link input[time] time} * - {@link input[month] month} * - {@link input[week] week} * - {@link ng.directive:select select} * - {@link ng.directive:textarea textarea} * * # CSS classes * The following CSS classes are added and removed on the associated input/select/textarea element * depending on the validity of the model. * * - `ng-valid`: the model is valid * - `ng-invalid`: the model is invalid * - `ng-valid-[key]`: for each valid key added by `$setValidity` * - `ng-invalid-[key]`: for each invalid key added by `$setValidity` * - `ng-pristine`: the control hasn't been interacted with yet * - `ng-dirty`: the control has been interacted with * - `ng-touched`: the control has been blurred * - `ng-untouched`: the control hasn't been blurred * - `ng-pending`: any `$asyncValidators` are unfulfilled * * Keep in mind that ngAnimate can detect each of these classes when added and removed. * * ## Animation Hooks * * Animations within models are triggered when any of the associated CSS classes are added and removed * on the input element which is attached to the model. These classes are: `.ng-pristine`, `.ng-dirty`, * `.ng-invalid` and `.ng-valid` as well as any other validations that are performed on the model itself. * The animations that are triggered within ngModel are similar to how they work in ngClass and * animations can be hooked into using CSS transitions, keyframes as well as JS animations. * * The following example shows a simple way to utilize CSS transitions to style an input element * that has been rendered as invalid after it has been validated: * * <pre> * //be sure to include ngAnimate as a module to hook into more * //advanced animations * .my-input { * transition:0.5s linear all; * background: white; * } * .my-input.ng-invalid { * background: red; * color:white; * } * </pre> * * @example * <example deps="angular-animate.js" animations="true" fixBase="true" module="inputExample"> <file name="index.html"> <script> angular.module('inputExample', []) .controller('ExampleController', ['$scope', function($scope) { $scope.val = '1'; }]); </script> <style> .my-input { -webkit-transition:all linear 0.5s; transition:all linear 0.5s; background: transparent; } .my-input.ng-invalid { color:white; background: red; } </style> Update input to see transitions when valid/invalid. Integer is a valid value. <form name="testForm" ng-controller="ExampleController"> <input ng-model="val" ng-pattern="/^\d+$/" name="anim" class="my-input" /> </form> </file> * </example> * * ## Binding to a getter/setter * * Sometimes it's helpful to bind `ngModel` to a getter/setter function. A getter/setter is a * function that returns a representation of the model when called with zero arguments, and sets * the internal state of a model when called with an argument. It's sometimes useful to use this * for models that have an internal representation that's different than what the model exposes * to the view. * * <div class="alert alert-success"> * **Best Practice:** It's best to keep getters fast because Angular is likely to call them more * frequently than other parts of your code. * </div> * * You use this behavior by adding `ng-model-options="{ getterSetter: true }"` to an element that * has `ng-model` attached to it. You can also add `ng-model-options="{ getterSetter: true }"` to * a `<form>`, which will enable this behavior for all `<input>`s within it. See * {@link ng.directive:ngModelOptions `ngModelOptions`} for more. * * The following example shows how to use `ngModel` with a getter/setter: * * @example * <example name="ngModel-getter-setter" module="getterSetterExample"> <file name="index.html"> <div ng-controller="ExampleController"> <form name="userForm"> Name: <input type="text" name="userName" ng-model="user.name" ng-model-options="{ getterSetter: true }" /> </form> <pre>user.name = <span ng-bind="user.name()"></span></pre> </div> </file> <file name="app.js"> angular.module('getterSetterExample', []) .controller('ExampleController', ['$scope', function($scope) { var _name = 'Brian'; $scope.user = { name: function(newName) { if (angular.isDefined(newName)) { _name = newName; } return _name; } }; }]); </file> * </example> */ var ngModelDirective = ['$rootScope', function($rootScope) { return { restrict: 'A', require: ['ngModel', '^?form', '^?ngModelOptions'], controller: NgModelController, // Prelink needs to run before any input directive // so that we can set the NgModelOptions in NgModelController // before anyone else uses it. priority: 1, compile: function ngModelCompile(element) { // Setup initial state of the control element.addClass(PRISTINE_CLASS).addClass(UNTOUCHED_CLASS).addClass(VALID_CLASS); return { pre: function ngModelPreLink(scope, element, attr, ctrls) { var modelCtrl = ctrls[0], formCtrl = ctrls[1] || nullFormCtrl; modelCtrl.$$setOptions(ctrls[2] && ctrls[2].$options); // notify others, especially parent forms formCtrl.$addControl(modelCtrl); attr.$observe('name', function(newValue) { if (modelCtrl.$name !== newValue) { formCtrl.$$renameControl(modelCtrl, newValue); } }); scope.$on('$destroy', function() { formCtrl.$removeControl(modelCtrl); }); }, post: function ngModelPostLink(scope, element, attr, ctrls) { var modelCtrl = ctrls[0]; if (modelCtrl.$options && modelCtrl.$options.updateOn) { element.on(modelCtrl.$options.updateOn, function(ev) { modelCtrl.$$debounceViewValueCommit(ev && ev.type); }); } element.on('blur', function(ev) { if (modelCtrl.$touched) return; if ($rootScope.$$phase) { scope.$evalAsync(modelCtrl.$setTouched); } else { scope.$apply(modelCtrl.$setTouched); } }); } }; } }; }]; var DEFAULT_REGEXP = /(\s+|^)default(\s+|$)/; /** * @ngdoc directive * @name ngModelOptions * * @description * Allows tuning how model updates are done. Using `ngModelOptions` you can specify a custom list of * events that will trigger a model update and/or a debouncing delay so that the actual update only * takes place when a timer expires; this timer will be reset after another change takes place. * * Given the nature of `ngModelOptions`, the value displayed inside input fields in the view might * be different than the value in the actual model. This means that if you update the model you * should also invoke {@link ngModel.NgModelController `$rollbackViewValue`} on the relevant input field in * order to make sure it is synchronized with the model and that any debounced action is canceled. * * The easiest way to reference the control's {@link ngModel.NgModelController `$rollbackViewValue`} * method is by making sure the input is placed inside a form that has a `name` attribute. This is * important because `form` controllers are published to the related scope under the name in their * `name` attribute. * * Any pending changes will take place immediately when an enclosing form is submitted via the * `submit` event. Note that `ngClick` events will occur before the model is updated. Use `ngSubmit` * to have access to the updated model. * * `ngModelOptions` has an effect on the element it's declared on and its descendants. * * @param {Object} ngModelOptions options to apply to the current model. Valid keys are: * - `updateOn`: string specifying which event should the input be bound to. You can set several * events using an space delimited list. There is a special event called `default` that * matches the default events belonging of the control. * - `debounce`: integer value which contains the debounce model update value in milliseconds. A * value of 0 triggers an immediate update. If an object is supplied instead, you can specify a * custom value for each event. For example: * `ng-model-options="{ updateOn: 'default blur', debounce: {'default': 500, 'blur': 0} }"` * - `allowInvalid`: boolean value which indicates that the model can be set with values that did * not validate correctly instead of the default behavior of setting the model to undefined. * - `getterSetter`: boolean value which determines whether or not to treat functions bound to `ngModel` as getters/setters. * - `timezone`: Defines the timezone to be used to read/write the `Date` instance in the model for * `<input type="date">`, `<input type="time">`, ... . Right now, the only supported value is `'UTC'`, * otherwise the default timezone of the browser will be used. * * @example The following example shows how to override immediate updates. Changes on the inputs within the form will update the model only when the control loses focus (blur event). If `escape` key is pressed while the input field is focused, the value is reset to the value in the current model. <example name="ngModelOptions-directive-blur" module="optionsExample"> <file name="index.html"> <div ng-controller="ExampleController"> <form name="userForm"> Name: <input type="text" name="userName" ng-model="user.name" ng-model-options="{ updateOn: 'blur' }" ng-keyup="cancel($event)" /><br /> Other data: <input type="text" ng-model="user.data" /><br /> </form> <pre>user.name = <span ng-bind="user.name"></span></pre> </div> </file> <file name="app.js"> angular.module('optionsExample', []) .controller('ExampleController', ['$scope', function($scope) { $scope.user = { name: 'say', data: '' }; $scope.cancel = function(e) { if (e.keyCode == 27) { $scope.userForm.userName.$rollbackViewValue(); } }; }]); </file> <file name="protractor.js" type="protractor"> var model = element(by.binding('user.name')); var input = element(by.model('user.name')); var other = element(by.model('user.data')); it('should allow custom events', function() { input.sendKeys(' hello'); input.click(); expect(model.getText()).toEqual('say'); other.click(); expect(model.getText()).toEqual('say hello'); }); it('should $rollbackViewValue when model changes', function() { input.sendKeys(' hello'); expect(input.getAttribute('value')).toEqual('say hello'); input.sendKeys(protractor.Key.ESCAPE); expect(input.getAttribute('value')).toEqual('say'); other.click(); expect(model.getText()).toEqual('say'); }); </file> </example> This one shows how to debounce model changes. Model will be updated only 1 sec after last change. If the `Clear` button is pressed, any debounced action is canceled and the value becomes empty. <example name="ngModelOptions-directive-debounce" module="optionsExample"> <file name="index.html"> <div ng-controller="ExampleController"> <form name="userForm"> Name: <input type="text" name="userName" ng-model="user.name" ng-model-options="{ debounce: 1000 }" /> <button ng-click="userForm.userName.$rollbackViewValue(); user.name=''">Clear</button><br /> </form> <pre>user.name = <span ng-bind="user.name"></span></pre> </div> </file> <file name="app.js"> angular.module('optionsExample', []) .controller('ExampleController', ['$scope', function($scope) { $scope.user = { name: 'say' }; }]); </file> </example> This one shows how to bind to getter/setters: <example name="ngModelOptions-directive-getter-setter" module="getterSetterExample"> <file name="index.html"> <div ng-controller="ExampleController"> <form name="userForm"> Name: <input type="text" name="userName" ng-model="user.name" ng-model-options="{ getterSetter: true }" /> </form> <pre>user.name = <span ng-bind="user.name()"></span></pre> </div> </file> <file name="app.js"> angular.module('getterSetterExample', []) .controller('ExampleController', ['$scope', function($scope) { var _name = 'Brian'; $scope.user = { name: function(newName) { return angular.isDefined(newName) ? (_name = newName) : _name; } }; }]); </file> </example> */ var ngModelOptionsDirective = function() { return { restrict: 'A', controller: ['$scope', '$attrs', function($scope, $attrs) { var that = this; this.$options = $scope.$eval($attrs.ngModelOptions); // Allow adding/overriding bound events if (this.$options.updateOn !== undefined) { this.$options.updateOnDefault = false; // extract "default" pseudo-event from list of events that can trigger a model update this.$options.updateOn = trim(this.$options.updateOn.replace(DEFAULT_REGEXP, function() { that.$options.updateOnDefault = true; return ' '; })); } else { this.$options.updateOnDefault = true; } }] }; }; // helper methods function addSetValidityMethod(context) { var ctrl = context.ctrl, $element = context.$element, classCache = {}, set = context.set, unset = context.unset, parentForm = context.parentForm, $animate = context.$animate; classCache[INVALID_CLASS] = !(classCache[VALID_CLASS] = $element.hasClass(VALID_CLASS)); ctrl.$setValidity = setValidity; function setValidity(validationErrorKey, state, controller) { if (state === undefined) { createAndSet('$pending', validationErrorKey, controller); } else { unsetAndCleanup('$pending', validationErrorKey, controller); } if (!isBoolean(state)) { unset(ctrl.$error, validationErrorKey, controller); unset(ctrl.$$success, validationErrorKey, controller); } else { if (state) { unset(ctrl.$error, validationErrorKey, controller); set(ctrl.$$success, validationErrorKey, controller); } else { set(ctrl.$error, validationErrorKey, controller); unset(ctrl.$$success, validationErrorKey, controller); } } if (ctrl.$pending) { cachedToggleClass(PENDING_CLASS, true); ctrl.$valid = ctrl.$invalid = undefined; toggleValidationCss('', null); } else { cachedToggleClass(PENDING_CLASS, false); ctrl.$valid = isObjectEmpty(ctrl.$error); ctrl.$invalid = !ctrl.$valid; toggleValidationCss('', ctrl.$valid); } // re-read the state as the set/unset methods could have // combined state in ctrl.$error[validationError] (used for forms), // where setting/unsetting only increments/decrements the value, // and does not replace it. var combinedState; if (ctrl.$pending && ctrl.$pending[validationErrorKey]) { combinedState = undefined; } else if (ctrl.$error[validationErrorKey]) { combinedState = false; } else if (ctrl.$$success[validationErrorKey]) { combinedState = true; } else { combinedState = null; } toggleValidationCss(validationErrorKey, combinedState); parentForm.$setValidity(validationErrorKey, combinedState, ctrl); } function createAndSet(name, value, controller) { if (!ctrl[name]) { ctrl[name] = {}; } set(ctrl[name], value, controller); } function unsetAndCleanup(name, value, controller) { if (ctrl[name]) { unset(ctrl[name], value, controller); } if (isObjectEmpty(ctrl[name])) { ctrl[name] = undefined; } } function cachedToggleClass(className, switchValue) { if (switchValue && !classCache[className]) { $animate.addClass($element, className); classCache[className] = true; } else if (!switchValue && classCache[className]) { $animate.removeClass($element, className); classCache[className] = false; } } function toggleValidationCss(validationErrorKey, isValid) { validationErrorKey = validationErrorKey ? '-' + snake_case(validationErrorKey, '-') : ''; cachedToggleClass(VALID_CLASS + validationErrorKey, isValid === true); cachedToggleClass(INVALID_CLASS + validationErrorKey, isValid === false); } } function isObjectEmpty(obj) { if (obj) { for (var prop in obj) { return false; } } return true; } /** * @ngdoc directive * @name ngNonBindable * @restrict AC * @priority 1000 * * @description * The `ngNonBindable` directive tells Angular not to compile or bind the contents of the current * DOM element. This is useful if the element contains what appears to be Angular directives and * bindings but which should be ignored by Angular. This could be the case if you have a site that * displays snippets of code, for instance. * * @element ANY * * @example * In this example there are two locations where a simple interpolation binding (`{{}}`) is present, * but the one wrapped in `ngNonBindable` is left alone. * * @example <example> <file name="index.html"> <div>Normal: {{1 + 2}}</div> <div ng-non-bindable>Ignored: {{1 + 2}}</div> </file> <file name="protractor.js" type="protractor"> it('should check ng-non-bindable', function() { expect(element(by.binding('1 + 2')).getText()).toContain('3'); expect(element.all(by.css('div')).last().getText()).toMatch(/1 \+ 2/); }); </file> </example> */ var ngNonBindableDirective = ngDirective({ terminal: true, priority: 1000 }); /** * @ngdoc directive * @name ngPluralize * @restrict EA * * @description * `ngPluralize` is a directive that displays messages according to en-US localization rules. * These rules are bundled with angular.js, but can be overridden * (see {@link guide/i18n Angular i18n} dev guide). You configure ngPluralize directive * by specifying the mappings between * [plural categories](http://unicode.org/repos/cldr-tmp/trunk/diff/supplemental/language_plural_rules.html) * and the strings to be displayed. * * # Plural categories and explicit number rules * There are two * [plural categories](http://unicode.org/repos/cldr-tmp/trunk/diff/supplemental/language_plural_rules.html) * in Angular's default en-US locale: "one" and "other". * * While a plural category may match many numbers (for example, in en-US locale, "other" can match * any number that is not 1), an explicit number rule can only match one number. For example, the * explicit number rule for "3" matches the number 3. There are examples of plural categories * and explicit number rules throughout the rest of this documentation. * * # Configuring ngPluralize * You configure ngPluralize by providing 2 attributes: `count` and `when`. * You can also provide an optional attribute, `offset`. * * The value of the `count` attribute can be either a string or an {@link guide/expression * Angular expression}; these are evaluated on the current scope for its bound value. * * The `when` attribute specifies the mappings between plural categories and the actual * string to be displayed. The value of the attribute should be a JSON object. * * The following example shows how to configure ngPluralize: * * ```html * <ng-pluralize count="personCount" when="{'0': 'Nobody is viewing.', * 'one': '1 person is viewing.', * 'other': '{} people are viewing.'}"> * </ng-pluralize> *``` * * In the example, `"0: Nobody is viewing."` is an explicit number rule. If you did not * specify this rule, 0 would be matched to the "other" category and "0 people are viewing" * would be shown instead of "Nobody is viewing". You can specify an explicit number rule for * other numbers, for example 12, so that instead of showing "12 people are viewing", you can * show "a dozen people are viewing". * * You can use a set of closed braces (`{}`) as a placeholder for the number that you want substituted * into pluralized strings. In the previous example, Angular will replace `{}` with * <span ng-non-bindable>`{{personCount}}`</span>. The closed braces `{}` is a placeholder * for <span ng-non-bindable>{{numberExpression}}</span>. * * # Configuring ngPluralize with offset * The `offset` attribute allows further customization of pluralized text, which can result in * a better user experience. For example, instead of the message "4 people are viewing this document", * you might display "John, Kate and 2 others are viewing this document". * The offset attribute allows you to offset a number by any desired value. * Let's take a look at an example: * * ```html * <ng-pluralize count="personCount" offset=2 * when="{'0': 'Nobody is viewing.', * '1': '{{person1}} is viewing.', * '2': '{{person1}} and {{person2}} are viewing.', * 'one': '{{person1}}, {{person2}} and one other person are viewing.', * 'other': '{{person1}}, {{person2}} and {} other people are viewing.'}"> * </ng-pluralize> * ``` * * Notice that we are still using two plural categories(one, other), but we added * three explicit number rules 0, 1 and 2. * When one person, perhaps John, views the document, "John is viewing" will be shown. * When three people view the document, no explicit number rule is found, so * an offset of 2 is taken off 3, and Angular uses 1 to decide the plural category. * In this case, plural category 'one' is matched and "John, Mary and one other person are viewing" * is shown. * * Note that when you specify offsets, you must provide explicit number rules for * numbers from 0 up to and including the offset. If you use an offset of 3, for example, * you must provide explicit number rules for 0, 1, 2 and 3. You must also provide plural strings for * plural categories "one" and "other". * * @param {string|expression} count The variable to be bound to. * @param {string} when The mapping between plural category to its corresponding strings. * @param {number=} offset Offset to deduct from the total number. * * @example <example module="pluralizeExample"> <file name="index.html"> <script> angular.module('pluralizeExample', []) .controller('ExampleController', ['$scope', function($scope) { $scope.person1 = 'Igor'; $scope.person2 = 'Misko'; $scope.personCount = 1; }]); </script> <div ng-controller="ExampleController"> Person 1:<input type="text" ng-model="person1" value="Igor" /><br/> Person 2:<input type="text" ng-model="person2" value="Misko" /><br/> Number of People:<input type="text" ng-model="personCount" value="1" /><br/> <!--- Example with simple pluralization rules for en locale ---> Without Offset: <ng-pluralize count="personCount" when="{'0': 'Nobody is viewing.', 'one': '1 person is viewing.', 'other': '{} people are viewing.'}"> </ng-pluralize><br> <!--- Example with offset ---> With Offset(2): <ng-pluralize count="personCount" offset=2 when="{'0': 'Nobody is viewing.', '1': '{{person1}} is viewing.', '2': '{{person1}} and {{person2}} are viewing.', 'one': '{{person1}}, {{person2}} and one other person are viewing.', 'other': '{{person1}}, {{person2}} and {} other people are viewing.'}"> </ng-pluralize> </div> </file> <file name="protractor.js" type="protractor"> it('should show correct pluralized string', function() { var withoutOffset = element.all(by.css('ng-pluralize')).get(0); var withOffset = element.all(by.css('ng-pluralize')).get(1); var countInput = element(by.model('personCount')); expect(withoutOffset.getText()).toEqual('1 person is viewing.'); expect(withOffset.getText()).toEqual('Igor is viewing.'); countInput.clear(); countInput.sendKeys('0'); expect(withoutOffset.getText()).toEqual('Nobody is viewing.'); expect(withOffset.getText()).toEqual('Nobody is viewing.'); countInput.clear(); countInput.sendKeys('2'); expect(withoutOffset.getText()).toEqual('2 people are viewing.'); expect(withOffset.getText()).toEqual('Igor and Misko are viewing.'); countInput.clear(); countInput.sendKeys('3'); expect(withoutOffset.getText()).toEqual('3 people are viewing.'); expect(withOffset.getText()).toEqual('Igor, Misko and one other person are viewing.'); countInput.clear(); countInput.sendKeys('4'); expect(withoutOffset.getText()).toEqual('4 people are viewing.'); expect(withOffset.getText()).toEqual('Igor, Misko and 2 other people are viewing.'); }); it('should show data-bound names', function() { var withOffset = element.all(by.css('ng-pluralize')).get(1); var personCount = element(by.model('personCount')); var person1 = element(by.model('person1')); var person2 = element(by.model('person2')); personCount.clear(); personCount.sendKeys('4'); person1.clear(); person1.sendKeys('Di'); person2.clear(); person2.sendKeys('Vojta'); expect(withOffset.getText()).toEqual('Di, Vojta and 2 other people are viewing.'); }); </file> </example> */ var ngPluralizeDirective = ['$locale', '$interpolate', function($locale, $interpolate) { var BRACE = /{}/g, IS_WHEN = /^when(Minus)?(.+)$/; return { restrict: 'EA', link: function(scope, element, attr) { var numberExp = attr.count, whenExp = attr.$attr.when && element.attr(attr.$attr.when), // we have {{}} in attrs offset = attr.offset || 0, whens = scope.$eval(whenExp) || {}, whensExpFns = {}, startSymbol = $interpolate.startSymbol(), endSymbol = $interpolate.endSymbol(), braceReplacement = startSymbol + numberExp + '-' + offset + endSymbol, watchRemover = angular.noop, lastCount; forEach(attr, function(expression, attributeName) { var tmpMatch = IS_WHEN.exec(attributeName); if (tmpMatch) { var whenKey = (tmpMatch[1] ? '-' : '') + lowercase(tmpMatch[2]); whens[whenKey] = element.attr(attr.$attr[attributeName]); } }); forEach(whens, function(expression, key) { whensExpFns[key] = $interpolate(expression.replace(BRACE, braceReplacement)); }); scope.$watch(numberExp, function ngPluralizeWatchAction(newVal) { var count = parseFloat(newVal); var countIsNaN = isNaN(count); if (!countIsNaN && !(count in whens)) { // If an explicit number rule such as 1, 2, 3... is defined, just use it. // Otherwise, check it against pluralization rules in $locale service. count = $locale.pluralCat(count - offset); } // If both `count` and `lastCount` are NaN, we don't need to re-register a watch. // In JS `NaN !== NaN`, so we have to exlicitly check. if ((count !== lastCount) && !(countIsNaN && isNaN(lastCount))) { watchRemover(); watchRemover = scope.$watch(whensExpFns[count], updateElementText); lastCount = count; } }); function updateElementText(newText) { element.text(newText || ''); } } }; }]; /** * @ngdoc directive * @name ngRepeat * * @description * The `ngRepeat` directive instantiates a template once per item from a collection. Each template * instance gets its own scope, where the given loop variable is set to the current collection item, * and `$index` is set to the item index or key. * * Special properties are exposed on the local scope of each template instance, including: * * | Variable | Type | Details | * |-----------|-----------------|-----------------------------------------------------------------------------| * | `$index` | {@type number} | iterator offset of the repeated element (0..length-1) | * | `$first` | {@type boolean} | true if the repeated element is first in the iterator. | * | `$middle` | {@type boolean} | true if the repeated element is between the first and last in the iterator. | * | `$last` | {@type boolean} | true if the repeated element is last in the iterator. | * | `$even` | {@type boolean} | true if the iterator position `$index` is even (otherwise false). | * | `$odd` | {@type boolean} | true if the iterator position `$index` is odd (otherwise false). | * * Creating aliases for these properties is possible with {@link ng.directive:ngInit `ngInit`}. * This may be useful when, for instance, nesting ngRepeats. * * # Iterating over object properties * * It is possible to get `ngRepeat` to iterate over the properties of an object using the following * syntax: * * ```js * <div ng-repeat="(key, value) in myObj"> ... </div> * ``` * * You need to be aware that the JavaScript specification does not define what order * it will return the keys for an object. In order to have a guaranteed deterministic order * for the keys, Angular versions up to and including 1.3 **sort the keys alphabetically**. * * If this is not desired, the recommended workaround is to convert your object into an array * that is sorted into the order that you prefer before providing it to `ngRepeat`. You could * do this with a filter such as [toArrayFilter](http://ngmodules.org/modules/angular-toArrayFilter) * or implement a `$watch` on the object yourself. * * In version 1.4 we will remove the sorting, since it seems that browsers generally follow the * strategy of providing keys in the order in which they were defined, although there are exceptions * when keys are deleted and reinstated. * * * # Special repeat start and end points * To repeat a series of elements instead of just one parent element, ngRepeat (as well as other ng directives) supports extending * the range of the repeater by defining explicit start and end points by using **ng-repeat-start** and **ng-repeat-end** respectively. * The **ng-repeat-start** directive works the same as **ng-repeat**, but will repeat all the HTML code (including the tag it's defined on) * up to and including the ending HTML tag where **ng-repeat-end** is placed. * * The example below makes use of this feature: * ```html * <header ng-repeat-start="item in items"> * Header {{ item }} * </header> * <div class="body"> * Body {{ item }} * </div> * <footer ng-repeat-end> * Footer {{ item }} * </footer> * ``` * * And with an input of {@type ['A','B']} for the items variable in the example above, the output will evaluate to: * ```html * <header> * Header A * </header> * <div class="body"> * Body A * </div> * <footer> * Footer A * </footer> * <header> * Header B * </header> * <div class="body"> * Body B * </div> * <footer> * Footer B * </footer> * ``` * * The custom start and end points for ngRepeat also support all other HTML directive syntax flavors provided in AngularJS (such * as **data-ng-repeat-start**, **x-ng-repeat-start** and **ng:repeat-start**). * * @animations * **.enter** - when a new item is added to the list or when an item is revealed after a filter * * **.leave** - when an item is removed from the list or when an item is filtered out * * **.move** - when an adjacent item is filtered out causing a reorder or when the item contents are reordered * * @element ANY * @scope * @priority 1000 * @param {repeat_expression} ngRepeat The expression indicating how to enumerate a collection. These * formats are currently supported: * * * `variable in expression` – where variable is the user defined loop variable and `expression` * is a scope expression giving the collection to enumerate. * * For example: `album in artist.albums`. * * * `(key, value) in expression` – where `key` and `value` can be any user defined identifiers, * and `expression` is the scope expression giving the collection to enumerate. * * For example: `(name, age) in {'adam':10, 'amalie':12}`. * * * `variable in expression track by tracking_expression` – You can also provide an optional tracking function * which can be used to associate the objects in the collection with the DOM elements. If no tracking function * is specified the ng-repeat associates elements by identity in the collection. It is an error to have * more than one tracking function to resolve to the same key. (This would mean that two distinct objects are * mapped to the same DOM element, which is not possible.) Filters should be applied to the expression, * before specifying a tracking expression. * * For example: `item in items` is equivalent to `item in items track by $id(item)`. This implies that the DOM elements * will be associated by item identity in the array. * * For example: `item in items track by $id(item)`. A built in `$id()` function can be used to assign a unique * `$$hashKey` property to each item in the array. This property is then used as a key to associated DOM elements * with the corresponding item in the array by identity. Moving the same object in array would move the DOM * element in the same way in the DOM. * * For example: `item in items track by item.id` is a typical pattern when the items come from the database. In this * case the object identity does not matter. Two objects are considered equivalent as long as their `id` * property is same. * * For example: `item in items | filter:searchText track by item.id` is a pattern that might be used to apply a filter * to items in conjunction with a tracking expression. * * * `variable in expression as alias_expression` – You can also provide an optional alias expression which will then store the * intermediate results of the repeater after the filters have been applied. Typically this is used to render a special message * when a filter is active on the repeater, but the filtered result set is empty. * * For example: `item in items | filter:x as results` will store the fragment of the repeated items as `results`, but only after * the items have been processed through the filter. * * @example * This example initializes the scope to a list of names and * then uses `ngRepeat` to display every person: <example module="ngAnimate" deps="angular-animate.js" animations="true"> <file name="index.html"> <div ng-init="friends = [ {name:'John', age:25, gender:'boy'}, {name:'Jessie', age:30, gender:'girl'}, {name:'Johanna', age:28, gender:'girl'}, {name:'Joy', age:15, gender:'girl'}, {name:'Mary', age:28, gender:'girl'}, {name:'Peter', age:95, gender:'boy'}, {name:'Sebastian', age:50, gender:'boy'}, {name:'Erika', age:27, gender:'girl'}, {name:'Patrick', age:40, gender:'boy'}, {name:'Samantha', age:60, gender:'girl'} ]"> I have {{friends.length}} friends. They are: <input type="search" ng-model="q" placeholder="filter friends..." /> <ul class="example-animate-container"> <li class="animate-repeat" ng-repeat="friend in friends | filter:q as results"> [{{$index + 1}}] {{friend.name}} who is {{friend.age}} years old. </li> <li class="animate-repeat" ng-if="results.length == 0"> <strong>No results found...</strong> </li> </ul> </div> </file> <file name="animations.css"> .example-animate-container { background:white; border:1px solid black; list-style:none; margin:0; padding:0 10px; } .animate-repeat { line-height:40px; list-style:none; box-sizing:border-box; } .animate-repeat.ng-move, .animate-repeat.ng-enter, .animate-repeat.ng-leave { -webkit-transition:all linear 0.5s; transition:all linear 0.5s; } .animate-repeat.ng-leave.ng-leave-active, .animate-repeat.ng-move, .animate-repeat.ng-enter { opacity:0; max-height:0; } .animate-repeat.ng-leave, .animate-repeat.ng-move.ng-move-active, .animate-repeat.ng-enter.ng-enter-active { opacity:1; max-height:40px; } </file> <file name="protractor.js" type="protractor"> var friends = element.all(by.repeater('friend in friends')); it('should render initial data set', function() { expect(friends.count()).toBe(10); expect(friends.get(0).getText()).toEqual('[1] John who is 25 years old.'); expect(friends.get(1).getText()).toEqual('[2] Jessie who is 30 years old.'); expect(friends.last().getText()).toEqual('[10] Samantha who is 60 years old.'); expect(element(by.binding('friends.length')).getText()) .toMatch("I have 10 friends. They are:"); }); it('should update repeater when filter predicate changes', function() { expect(friends.count()).toBe(10); element(by.model('q')).sendKeys('ma'); expect(friends.count()).toBe(2); expect(friends.get(0).getText()).toEqual('[1] Mary who is 28 years old.'); expect(friends.last().getText()).toEqual('[2] Samantha who is 60 years old.'); }); </file> </example> */ var ngRepeatDirective = ['$parse', '$animate', function($parse, $animate) { var NG_REMOVED = '$$NG_REMOVED'; var ngRepeatMinErr = minErr('ngRepeat'); var updateScope = function(scope, index, valueIdentifier, value, keyIdentifier, key, arrayLength) { // TODO(perf): generate setters to shave off ~40ms or 1-1.5% scope[valueIdentifier] = value; if (keyIdentifier) scope[keyIdentifier] = key; scope.$index = index; scope.$first = (index === 0); scope.$last = (index === (arrayLength - 1)); scope.$middle = !(scope.$first || scope.$last); // jshint bitwise: false scope.$odd = !(scope.$even = (index&1) === 0); // jshint bitwise: true }; var getBlockStart = function(block) { return block.clone[0]; }; var getBlockEnd = function(block) { return block.clone[block.clone.length - 1]; }; return { restrict: 'A', multiElement: true, transclude: 'element', priority: 1000, terminal: true, $$tlb: true, compile: function ngRepeatCompile($element, $attr) { var expression = $attr.ngRepeat; var ngRepeatEndComment = document.createComment(' end ngRepeat: ' + expression + ' '); var match = expression.match(/^\s*([\s\S]+?)\s+in\s+([\s\S]+?)(?:\s+as\s+([\s\S]+?))?(?:\s+track\s+by\s+([\s\S]+?))?\s*$/); if (!match) { throw ngRepeatMinErr('iexp', "Expected expression in form of '_item_ in _collection_[ track by _id_]' but got '{0}'.", expression); } var lhs = match[1]; var rhs = match[2]; var aliasAs = match[3]; var trackByExp = match[4]; match = lhs.match(/^(?:(\s*[\$\w]+)|\(\s*([\$\w]+)\s*,\s*([\$\w]+)\s*\))$/); if (!match) { throw ngRepeatMinErr('iidexp', "'_item_' in '_item_ in _collection_' should be an identifier or '(_key_, _value_)' expression, but got '{0}'.", lhs); } var valueIdentifier = match[3] || match[1]; var keyIdentifier = match[2]; if (aliasAs && (!/^[$a-zA-Z_][$a-zA-Z0-9_]*$/.test(aliasAs) || /^(null|undefined|this|\$index|\$first|\$middle|\$last|\$even|\$odd|\$parent|\$root|\$id)$/.test(aliasAs))) { throw ngRepeatMinErr('badident', "alias '{0}' is invalid --- must be a valid JS identifier which is not a reserved name.", aliasAs); } var trackByExpGetter, trackByIdExpFn, trackByIdArrayFn, trackByIdObjFn; var hashFnLocals = {$id: hashKey}; if (trackByExp) { trackByExpGetter = $parse(trackByExp); } else { trackByIdArrayFn = function(key, value) { return hashKey(value); }; trackByIdObjFn = function(key) { return key; }; } return function ngRepeatLink($scope, $element, $attr, ctrl, $transclude) { if (trackByExpGetter) { trackByIdExpFn = function(key, value, index) { // assign key, value, and $index to the locals so that they can be used in hash functions if (keyIdentifier) hashFnLocals[keyIdentifier] = key; hashFnLocals[valueIdentifier] = value; hashFnLocals.$index = index; return trackByExpGetter($scope, hashFnLocals); }; } // Store a list of elements from previous run. This is a hash where key is the item from the // iterator, and the value is objects with following properties. // - scope: bound scope // - element: previous element. // - index: position // // We are using no-proto object so that we don't need to guard against inherited props via // hasOwnProperty. var lastBlockMap = createMap(); //watch props $scope.$watchCollection(rhs, function ngRepeatAction(collection) { var index, length, previousNode = $element[0], // node that cloned nodes should be inserted after // initialized to the comment node anchor nextNode, // Same as lastBlockMap but it has the current state. It will become the // lastBlockMap on the next iteration. nextBlockMap = createMap(), collectionLength, key, value, // key/value of iteration trackById, trackByIdFn, collectionKeys, block, // last object information {scope, element, id} nextBlockOrder, elementsToRemove; if (aliasAs) { $scope[aliasAs] = collection; } if (isArrayLike(collection)) { collectionKeys = collection; trackByIdFn = trackByIdExpFn || trackByIdArrayFn; } else { trackByIdFn = trackByIdExpFn || trackByIdObjFn; // if object, extract keys, sort them and use to determine order of iteration over obj props collectionKeys = []; for (var itemKey in collection) { if (collection.hasOwnProperty(itemKey) && itemKey.charAt(0) != '$') { collectionKeys.push(itemKey); } } collectionKeys.sort(); } collectionLength = collectionKeys.length; nextBlockOrder = new Array(collectionLength); // locate existing items for (index = 0; index < collectionLength; index++) { key = (collection === collectionKeys) ? index : collectionKeys[index]; value = collection[key]; trackById = trackByIdFn(key, value, index); if (lastBlockMap[trackById]) { // found previously seen block block = lastBlockMap[trackById]; delete lastBlockMap[trackById]; nextBlockMap[trackById] = block; nextBlockOrder[index] = block; } else if (nextBlockMap[trackById]) { // if collision detected. restore lastBlockMap and throw an error forEach(nextBlockOrder, function(block) { if (block && block.scope) lastBlockMap[block.id] = block; }); throw ngRepeatMinErr('dupes', "Duplicates in a repeater are not allowed. Use 'track by' expression to specify unique keys. Repeater: {0}, Duplicate key: {1}, Duplicate value: {2}", expression, trackById, value); } else { // new never before seen block nextBlockOrder[index] = {id: trackById, scope: undefined, clone: undefined}; nextBlockMap[trackById] = true; } } // remove leftover items for (var blockKey in lastBlockMap) { block = lastBlockMap[blockKey]; elementsToRemove = getBlockNodes(block.clone); $animate.leave(elementsToRemove); if (elementsToRemove[0].parentNode) { // if the element was not removed yet because of pending animation, mark it as deleted // so that we can ignore it later for (index = 0, length = elementsToRemove.length; index < length; index++) { elementsToRemove[index][NG_REMOVED] = true; } } block.scope.$destroy(); } // we are not using forEach for perf reasons (trying to avoid #call) for (index = 0; index < collectionLength; index++) { key = (collection === collectionKeys) ? index : collectionKeys[index]; value = collection[key]; block = nextBlockOrder[index]; if (block.scope) { // if we have already seen this object, then we need to reuse the // associated scope/element nextNode = previousNode; // skip nodes that are already pending removal via leave animation do { nextNode = nextNode.nextSibling; } while (nextNode && nextNode[NG_REMOVED]); if (getBlockStart(block) != nextNode) { // existing item which got moved $animate.move(getBlockNodes(block.clone), null, jqLite(previousNode)); } previousNode = getBlockEnd(block); updateScope(block.scope, index, valueIdentifier, value, keyIdentifier, key, collectionLength); } else { // new item which we don't know about $transclude(function ngRepeatTransclude(clone, scope) { block.scope = scope; // http://jsperf.com/clone-vs-createcomment var endNode = ngRepeatEndComment.cloneNode(false); clone[clone.length++] = endNode; // TODO(perf): support naked previousNode in `enter` to avoid creation of jqLite wrapper? $animate.enter(clone, null, jqLite(previousNode)); previousNode = endNode; // Note: We only need the first/last node of the cloned nodes. // However, we need to keep the reference to the jqlite wrapper as it might be changed later // by a directive with templateUrl when its template arrives. block.clone = clone; nextBlockMap[block.id] = block; updateScope(block.scope, index, valueIdentifier, value, keyIdentifier, key, collectionLength); }); } } lastBlockMap = nextBlockMap; }); }; } }; }]; var NG_HIDE_CLASS = 'ng-hide'; var NG_HIDE_IN_PROGRESS_CLASS = 'ng-hide-animate'; /** * @ngdoc directive * @name ngShow * * @description * The `ngShow` directive shows or hides the given HTML element based on the expression * provided to the `ngShow` attribute. The element is shown or hidden by removing or adding * the `.ng-hide` CSS class onto the element. The `.ng-hide` CSS class is predefined * in AngularJS and sets the display style to none (using an !important flag). * For CSP mode please add `angular-csp.css` to your html file (see {@link ng.directive:ngCsp ngCsp}). * * ```html * <!-- when $scope.myValue is truthy (element is visible) --> * <div ng-show="myValue"></div> * * <!-- when $scope.myValue is falsy (element is hidden) --> * <div ng-show="myValue" class="ng-hide"></div> * ``` * * When the `ngShow` expression evaluates to a falsy value then the `.ng-hide` CSS class is added to the class * attribute on the element causing it to become hidden. When truthy, the `.ng-hide` CSS class is removed * from the element causing the element not to appear hidden. * * ## Why is !important used? * * You may be wondering why !important is used for the `.ng-hide` CSS class. This is because the `.ng-hide` selector * can be easily overridden by heavier selectors. For example, something as simple * as changing the display style on a HTML list item would make hidden elements appear visible. * This also becomes a bigger issue when dealing with CSS frameworks. * * By using !important, the show and hide behavior will work as expected despite any clash between CSS selector * specificity (when !important isn't used with any conflicting styles). If a developer chooses to override the * styling to change how to hide an element then it is just a matter of using !important in their own CSS code. * * ### Overriding `.ng-hide` * * By default, the `.ng-hide` class will style the element with `display: none!important`. If you wish to change * the hide behavior with ngShow/ngHide then this can be achieved by restating the styles for the `.ng-hide` * class in CSS: * * ```css * .ng-hide { * /&#42; this is just another form of hiding an element &#42;/ * display: block!important; * position: absolute; * top: -9999px; * left: -9999px; * } * ``` * * By default you don't need to override in CSS anything and the animations will work around the display style. * * ## A note about animations with `ngShow` * * Animations in ngShow/ngHide work with the show and hide events that are triggered when the directive expression * is true and false. This system works like the animation system present with ngClass except that * you must also include the !important flag to override the display property * so that you can perform an animation when the element is hidden during the time of the animation. * * ```css * // * //a working example can be found at the bottom of this page * // * .my-element.ng-hide-add, .my-element.ng-hide-remove { * /&#42; this is required as of 1.3x to properly * apply all styling in a show/hide animation &#42;/ * transition: 0s linear all; * } * * .my-element.ng-hide-add-active, * .my-element.ng-hide-remove-active { * /&#42; the transition is defined in the active class &#42;/ * transition: 1s linear all; * } * * .my-element.ng-hide-add { ... } * .my-element.ng-hide-add.ng-hide-add-active { ... } * .my-element.ng-hide-remove { ... } * .my-element.ng-hide-remove.ng-hide-remove-active { ... } * ``` * * Keep in mind that, as of AngularJS version 1.3.0-beta.11, there is no need to change the display * property to block during animation states--ngAnimate will handle the style toggling automatically for you. * * @animations * addClass: `.ng-hide` - happens after the `ngShow` expression evaluates to a truthy value and the just before contents are set to visible * removeClass: `.ng-hide` - happens after the `ngShow` expression evaluates to a non truthy value and just before the contents are set to hidden * * @element ANY * @param {expression} ngShow If the {@link guide/expression expression} is truthy * then the element is shown or hidden respectively. * * @example <example module="ngAnimate" deps="angular-animate.js" animations="true"> <file name="index.html"> Click me: <input type="checkbox" ng-model="checked"><br/> <div> Show: <div class="check-element animate-show" ng-show="checked"> <span class="glyphicon glyphicon-thumbs-up"></span> I show up when your checkbox is checked. </div> </div> <div> Hide: <div class="check-element animate-show" ng-hide="checked"> <span class="glyphicon glyphicon-thumbs-down"></span> I hide when your checkbox is checked. </div> </div> </file> <file name="glyphicons.css"> @import url(../../components/bootstrap-3.1.1/css/bootstrap.css); </file> <file name="animations.css"> .animate-show { line-height: 20px; opacity: 1; padding: 10px; border: 1px solid black; background: white; } .animate-show.ng-hide-add.ng-hide-add-active, .animate-show.ng-hide-remove.ng-hide-remove-active { -webkit-transition: all linear 0.5s; transition: all linear 0.5s; } .animate-show.ng-hide { line-height: 0; opacity: 0; padding: 0 10px; } .check-element { padding: 10px; border: 1px solid black; background: white; } </file> <file name="protractor.js" type="protractor"> var thumbsUp = element(by.css('span.glyphicon-thumbs-up')); var thumbsDown = element(by.css('span.glyphicon-thumbs-down')); it('should check ng-show / ng-hide', function() { expect(thumbsUp.isDisplayed()).toBeFalsy(); expect(thumbsDown.isDisplayed()).toBeTruthy(); element(by.model('checked')).click(); expect(thumbsUp.isDisplayed()).toBeTruthy(); expect(thumbsDown.isDisplayed()).toBeFalsy(); }); </file> </example> */ var ngShowDirective = ['$animate', function($animate) { return { restrict: 'A', multiElement: true, link: function(scope, element, attr) { scope.$watch(attr.ngShow, function ngShowWatchAction(value) { // we're adding a temporary, animation-specific class for ng-hide since this way // we can control when the element is actually displayed on screen without having // to have a global/greedy CSS selector that breaks when other animations are run. // Read: https://github.com/angular/angular.js/issues/9103#issuecomment-58335845 $animate[value ? 'removeClass' : 'addClass'](element, NG_HIDE_CLASS, { tempClasses: NG_HIDE_IN_PROGRESS_CLASS }); }); } }; }]; /** * @ngdoc directive * @name ngHide * * @description * The `ngHide` directive shows or hides the given HTML element based on the expression * provided to the `ngHide` attribute. The element is shown or hidden by removing or adding * the `ng-hide` CSS class onto the element. The `.ng-hide` CSS class is predefined * in AngularJS and sets the display style to none (using an !important flag). * For CSP mode please add `angular-csp.css` to your html file (see {@link ng.directive:ngCsp ngCsp}). * * ```html * <!-- when $scope.myValue is truthy (element is hidden) --> * <div ng-hide="myValue" class="ng-hide"></div> * * <!-- when $scope.myValue is falsy (element is visible) --> * <div ng-hide="myValue"></div> * ``` * * When the `ngHide` expression evaluates to a truthy value then the `.ng-hide` CSS class is added to the class * attribute on the element causing it to become hidden. When falsy, the `.ng-hide` CSS class is removed * from the element causing the element not to appear hidden. * * ## Why is !important used? * * You may be wondering why !important is used for the `.ng-hide` CSS class. This is because the `.ng-hide` selector * can be easily overridden by heavier selectors. For example, something as simple * as changing the display style on a HTML list item would make hidden elements appear visible. * This also becomes a bigger issue when dealing with CSS frameworks. * * By using !important, the show and hide behavior will work as expected despite any clash between CSS selector * specificity (when !important isn't used with any conflicting styles). If a developer chooses to override the * styling to change how to hide an element then it is just a matter of using !important in their own CSS code. * * ### Overriding `.ng-hide` * * By default, the `.ng-hide` class will style the element with `display: none!important`. If you wish to change * the hide behavior with ngShow/ngHide then this can be achieved by restating the styles for the `.ng-hide` * class in CSS: * * ```css * .ng-hide { * /&#42; this is just another form of hiding an element &#42;/ * display: block!important; * position: absolute; * top: -9999px; * left: -9999px; * } * ``` * * By default you don't need to override in CSS anything and the animations will work around the display style. * * ## A note about animations with `ngHide` * * Animations in ngShow/ngHide work with the show and hide events that are triggered when the directive expression * is true and false. This system works like the animation system present with ngClass, except that the `.ng-hide` * CSS class is added and removed for you instead of your own CSS class. * * ```css * // * //a working example can be found at the bottom of this page * // * .my-element.ng-hide-add, .my-element.ng-hide-remove { * transition: 0.5s linear all; * } * * .my-element.ng-hide-add { ... } * .my-element.ng-hide-add.ng-hide-add-active { ... } * .my-element.ng-hide-remove { ... } * .my-element.ng-hide-remove.ng-hide-remove-active { ... } * ``` * * Keep in mind that, as of AngularJS version 1.3.0-beta.11, there is no need to change the display * property to block during animation states--ngAnimate will handle the style toggling automatically for you. * * @animations * removeClass: `.ng-hide` - happens after the `ngHide` expression evaluates to a truthy value and just before the contents are set to hidden * addClass: `.ng-hide` - happens after the `ngHide` expression evaluates to a non truthy value and just before the contents are set to visible * * @element ANY * @param {expression} ngHide If the {@link guide/expression expression} is truthy then * the element is shown or hidden respectively. * * @example <example module="ngAnimate" deps="angular-animate.js" animations="true"> <file name="index.html"> Click me: <input type="checkbox" ng-model="checked"><br/> <div> Show: <div class="check-element animate-hide" ng-show="checked"> <span class="glyphicon glyphicon-thumbs-up"></span> I show up when your checkbox is checked. </div> </div> <div> Hide: <div class="check-element animate-hide" ng-hide="checked"> <span class="glyphicon glyphicon-thumbs-down"></span> I hide when your checkbox is checked. </div> </div> </file> <file name="glyphicons.css"> @import url(../../components/bootstrap-3.1.1/css/bootstrap.css); </file> <file name="animations.css"> .animate-hide { -webkit-transition: all linear 0.5s; transition: all linear 0.5s; line-height: 20px; opacity: 1; padding: 10px; border: 1px solid black; background: white; } .animate-hide.ng-hide { line-height: 0; opacity: 0; padding: 0 10px; } .check-element { padding: 10px; border: 1px solid black; background: white; } </file> <file name="protractor.js" type="protractor"> var thumbsUp = element(by.css('span.glyphicon-thumbs-up')); var thumbsDown = element(by.css('span.glyphicon-thumbs-down')); it('should check ng-show / ng-hide', function() { expect(thumbsUp.isDisplayed()).toBeFalsy(); expect(thumbsDown.isDisplayed()).toBeTruthy(); element(by.model('checked')).click(); expect(thumbsUp.isDisplayed()).toBeTruthy(); expect(thumbsDown.isDisplayed()).toBeFalsy(); }); </file> </example> */ var ngHideDirective = ['$animate', function($animate) { return { restrict: 'A', multiElement: true, link: function(scope, element, attr) { scope.$watch(attr.ngHide, function ngHideWatchAction(value) { // The comment inside of the ngShowDirective explains why we add and // remove a temporary class for the show/hide animation $animate[value ? 'addClass' : 'removeClass'](element,NG_HIDE_CLASS, { tempClasses: NG_HIDE_IN_PROGRESS_CLASS }); }); } }; }]; /** * @ngdoc directive * @name ngStyle * @restrict AC * * @description * The `ngStyle` directive allows you to set CSS style on an HTML element conditionally. * * @element ANY * @param {expression} ngStyle * * {@link guide/expression Expression} which evals to an * object whose keys are CSS style names and values are corresponding values for those CSS * keys. * * Since some CSS style names are not valid keys for an object, they must be quoted. * See the 'background-color' style in the example below. * * @example <example> <file name="index.html"> <input type="button" value="set color" ng-click="myStyle={color:'red'}"> <input type="button" value="set background" ng-click="myStyle={'background-color':'blue'}"> <input type="button" value="clear" ng-click="myStyle={}"> <br/> <span ng-style="myStyle">Sample Text</span> <pre>myStyle={{myStyle}}</pre> </file> <file name="style.css"> span { color: black; } </file> <file name="protractor.js" type="protractor"> var colorSpan = element(by.css('span')); it('should check ng-style', function() { expect(colorSpan.getCssValue('color')).toBe('rgba(0, 0, 0, 1)'); element(by.css('input[value=\'set color\']')).click(); expect(colorSpan.getCssValue('color')).toBe('rgba(255, 0, 0, 1)'); element(by.css('input[value=clear]')).click(); expect(colorSpan.getCssValue('color')).toBe('rgba(0, 0, 0, 1)'); }); </file> </example> */ var ngStyleDirective = ngDirective(function(scope, element, attr) { scope.$watchCollection(attr.ngStyle, function ngStyleWatchAction(newStyles, oldStyles) { if (oldStyles && (newStyles !== oldStyles)) { forEach(oldStyles, function(val, style) { element.css(style, '');}); } if (newStyles) element.css(newStyles); }); }); /** * @ngdoc directive * @name ngSwitch * @restrict EA * * @description * The `ngSwitch` directive is used to conditionally swap DOM structure on your template based on a scope expression. * Elements within `ngSwitch` but without `ngSwitchWhen` or `ngSwitchDefault` directives will be preserved at the location * as specified in the template. * * The directive itself works similar to ngInclude, however, instead of downloading template code (or loading it * from the template cache), `ngSwitch` simply chooses one of the nested elements and makes it visible based on which element * matches the value obtained from the evaluated expression. In other words, you define a container element * (where you place the directive), place an expression on the **`on="..."` attribute** * (or the **`ng-switch="..."` attribute**), define any inner elements inside of the directive and place * a when attribute per element. The when attribute is used to inform ngSwitch which element to display when the on * expression is evaluated. If a matching expression is not found via a when attribute then an element with the default * attribute is displayed. * * <div class="alert alert-info"> * Be aware that the attribute values to match against cannot be expressions. They are interpreted * as literal string values to match against. * For example, **`ng-switch-when="someVal"`** will match against the string `"someVal"` not against the * value of the expression `$scope.someVal`. * </div> * @animations * enter - happens after the ngSwitch contents change and the matched child element is placed inside the container * leave - happens just after the ngSwitch contents change and just before the former contents are removed from the DOM * * @usage * * ``` * <ANY ng-switch="expression"> * <ANY ng-switch-when="matchValue1">...</ANY> * <ANY ng-switch-when="matchValue2">...</ANY> * <ANY ng-switch-default>...</ANY> * </ANY> * ``` * * * @scope * @priority 1200 * @param {*} ngSwitch|on expression to match against <tt>ng-switch-when</tt>. * On child elements add: * * * `ngSwitchWhen`: the case statement to match against. If match then this * case will be displayed. If the same match appears multiple times, all the * elements will be displayed. * * `ngSwitchDefault`: the default case when no other case match. If there * are multiple default cases, all of them will be displayed when no other * case match. * * * @example <example module="switchExample" deps="angular-animate.js" animations="true"> <file name="index.html"> <div ng-controller="ExampleController"> <select ng-model="selection" ng-options="item for item in items"> </select> <tt>selection={{selection}}</tt> <hr/> <div class="animate-switch-container" ng-switch on="selection"> <div class="animate-switch" ng-switch-when="settings">Settings Div</div> <div class="animate-switch" ng-switch-when="home">Home Span</div> <div class="animate-switch" ng-switch-default>default</div> </div> </div> </file> <file name="script.js"> angular.module('switchExample', ['ngAnimate']) .controller('ExampleController', ['$scope', function($scope) { $scope.items = ['settings', 'home', 'other']; $scope.selection = $scope.items[0]; }]); </file> <file name="animations.css"> .animate-switch-container { position:relative; background:white; border:1px solid black; height:40px; overflow:hidden; } .animate-switch { padding:10px; } .animate-switch.ng-animate { -webkit-transition:all cubic-bezier(0.250, 0.460, 0.450, 0.940) 0.5s; transition:all cubic-bezier(0.250, 0.460, 0.450, 0.940) 0.5s; position:absolute; top:0; left:0; right:0; bottom:0; } .animate-switch.ng-leave.ng-leave-active, .animate-switch.ng-enter { top:-50px; } .animate-switch.ng-leave, .animate-switch.ng-enter.ng-enter-active { top:0; } </file> <file name="protractor.js" type="protractor"> var switchElem = element(by.css('[ng-switch]')); var select = element(by.model('selection')); it('should start in settings', function() { expect(switchElem.getText()).toMatch(/Settings Div/); }); it('should change to home', function() { select.all(by.css('option')).get(1).click(); expect(switchElem.getText()).toMatch(/Home Span/); }); it('should select default', function() { select.all(by.css('option')).get(2).click(); expect(switchElem.getText()).toMatch(/default/); }); </file> </example> */ var ngSwitchDirective = ['$animate', function($animate) { return { restrict: 'EA', require: 'ngSwitch', // asks for $scope to fool the BC controller module controller: ['$scope', function ngSwitchController() { this.cases = {}; }], link: function(scope, element, attr, ngSwitchController) { var watchExpr = attr.ngSwitch || attr.on, selectedTranscludes = [], selectedElements = [], previousLeaveAnimations = [], selectedScopes = []; var spliceFactory = function(array, index) { return function() { array.splice(index, 1); }; }; scope.$watch(watchExpr, function ngSwitchWatchAction(value) { var i, ii; for (i = 0, ii = previousLeaveAnimations.length; i < ii; ++i) { $animate.cancel(previousLeaveAnimations[i]); } previousLeaveAnimations.length = 0; for (i = 0, ii = selectedScopes.length; i < ii; ++i) { var selected = getBlockNodes(selectedElements[i].clone); selectedScopes[i].$destroy(); var promise = previousLeaveAnimations[i] = $animate.leave(selected); promise.then(spliceFactory(previousLeaveAnimations, i)); } selectedElements.length = 0; selectedScopes.length = 0; if ((selectedTranscludes = ngSwitchController.cases['!' + value] || ngSwitchController.cases['?'])) { forEach(selectedTranscludes, function(selectedTransclude) { selectedTransclude.transclude(function(caseElement, selectedScope) { selectedScopes.push(selectedScope); var anchor = selectedTransclude.element; caseElement[caseElement.length++] = document.createComment(' end ngSwitchWhen: '); var block = { clone: caseElement }; selectedElements.push(block); $animate.enter(caseElement, anchor.parent(), anchor); }); }); } }); } }; }]; var ngSwitchWhenDirective = ngDirective({ transclude: 'element', priority: 1200, require: '^ngSwitch', multiElement: true, link: function(scope, element, attrs, ctrl, $transclude) { ctrl.cases['!' + attrs.ngSwitchWhen] = (ctrl.cases['!' + attrs.ngSwitchWhen] || []); ctrl.cases['!' + attrs.ngSwitchWhen].push({ transclude: $transclude, element: element }); } }); var ngSwitchDefaultDirective = ngDirective({ transclude: 'element', priority: 1200, require: '^ngSwitch', multiElement: true, link: function(scope, element, attr, ctrl, $transclude) { ctrl.cases['?'] = (ctrl.cases['?'] || []); ctrl.cases['?'].push({ transclude: $transclude, element: element }); } }); /** * @ngdoc directive * @name ngTransclude * @restrict EAC * * @description * Directive that marks the insertion point for the transcluded DOM of the nearest parent directive that uses transclusion. * * Any existing content of the element that this directive is placed on will be removed before the transcluded content is inserted. * * @element ANY * * @example <example module="transcludeExample"> <file name="index.html"> <script> angular.module('transcludeExample', []) .directive('pane', function(){ return { restrict: 'E', transclude: true, scope: { title:'@' }, template: '<div style="border: 1px solid black;">' + '<div style="background-color: gray">{{title}}</div>' + '<ng-transclude></ng-transclude>' + '</div>' }; }) .controller('ExampleController', ['$scope', function($scope) { $scope.title = 'Lorem Ipsum'; $scope.text = 'Neque porro quisquam est qui dolorem ipsum quia dolor...'; }]); </script> <div ng-controller="ExampleController"> <input ng-model="title"> <br/> <textarea ng-model="text"></textarea> <br/> <pane title="{{title}}">{{text}}</pane> </div> </file> <file name="protractor.js" type="protractor"> it('should have transcluded', function() { var titleElement = element(by.model('title')); titleElement.clear(); titleElement.sendKeys('TITLE'); var textElement = element(by.model('text')); textElement.clear(); textElement.sendKeys('TEXT'); expect(element(by.binding('title')).getText()).toEqual('TITLE'); expect(element(by.binding('text')).getText()).toEqual('TEXT'); }); </file> </example> * */ var ngTranscludeDirective = ngDirective({ restrict: 'EAC', link: function($scope, $element, $attrs, controller, $transclude) { if (!$transclude) { throw minErr('ngTransclude')('orphan', 'Illegal use of ngTransclude directive in the template! ' + 'No parent directive that requires a transclusion found. ' + 'Element: {0}', startingTag($element)); } $transclude(function(clone) { $element.empty(); $element.append(clone); }); } }); /** * @ngdoc directive * @name script * @restrict E * * @description * Load the content of a `<script>` element into {@link ng.$templateCache `$templateCache`}, so that the * template can be used by {@link ng.directive:ngInclude `ngInclude`}, * {@link ngRoute.directive:ngView `ngView`}, or {@link guide/directive directives}. The type of the * `<script>` element must be specified as `text/ng-template`, and a cache name for the template must be * assigned through the element's `id`, which can then be used as a directive's `templateUrl`. * * @param {string} type Must be set to `'text/ng-template'`. * @param {string} id Cache name of the template. * * @example <example> <file name="index.html"> <script type="text/ng-template" id="/tpl.html"> Content of the template. </script> <a ng-click="currentTpl='/tpl.html'" id="tpl-link">Load inlined template</a> <div id="tpl-content" ng-include src="currentTpl"></div> </file> <file name="protractor.js" type="protractor"> it('should load template defined inside script tag', function() { element(by.css('#tpl-link')).click(); expect(element(by.css('#tpl-content')).getText()).toMatch(/Content of the template/); }); </file> </example> */ var scriptDirective = ['$templateCache', function($templateCache) { return { restrict: 'E', terminal: true, compile: function(element, attr) { if (attr.type == 'text/ng-template') { var templateUrl = attr.id, text = element[0].text; $templateCache.put(templateUrl, text); } } }; }]; var ngOptionsMinErr = minErr('ngOptions'); /** * @ngdoc directive * @name select * @restrict E * * @description * HTML `SELECT` element with angular data-binding. * * # `ngOptions` * * The `ngOptions` attribute can be used to dynamically generate a list of `<option>` * elements for the `<select>` element using the array or object obtained by evaluating the * `ngOptions` comprehension expression. * * In many cases, `ngRepeat` can be used on `<option>` elements instead of `ngOptions` to achieve a * similar result. However, `ngOptions` provides some benefits such as reducing memory and * increasing speed by not creating a new scope for each repeated instance, as well as providing * more flexibility in how the `<select>`'s model is assigned via the `select` **`as`** part of the * comprehension expression. `ngOptions` should be used when the `<select>` model needs to be bound * to a non-string value. This is because an option element can only be bound to string values at * present. * * When an item in the `<select>` menu is selected, the array element or object property * represented by the selected option will be bound to the model identified by the `ngModel` * directive. * * Optionally, a single hard-coded `<option>` element, with the value set to an empty string, can * be nested into the `<select>` element. This element will then represent the `null` or "not selected" * option. See example below for demonstration. * * <div class="alert alert-warning"> * **Note:** `ngModel` compares by reference, not value. This is important when binding to an * array of objects. See an example [in this jsfiddle](http://jsfiddle.net/qWzTb/). * </div> * * ## `select` **`as`** * * Using `select` **`as`** will bind the result of the `select` expression to the model, but * the value of the `<select>` and `<option>` html elements will be either the index (for array data sources) * or property name (for object data sources) of the value within the collection. If a **`track by`** expression * is used, the result of that expression will be set as the value of the `option` and `select` elements. * * * ### `select` **`as`** and **`track by`** * * <div class="alert alert-warning"> * Do not use `select` **`as`** and **`track by`** in the same expression. They are not designed to work together. * </div> * * Consider the following example: * * ```html * <select ng-options="item.subItem as item.label for item in values track by item.id" ng-model="selected"> * ``` * * ```js * $scope.values = [{ * id: 1, * label: 'aLabel', * subItem: { name: 'aSubItem' } * }, { * id: 2, * label: 'bLabel', * subItem: { name: 'bSubItem' } * }]; * * $scope.selected = { name: 'aSubItem' }; * ``` * * With the purpose of preserving the selection, the **`track by`** expression is always applied to the element * of the data source (to `item` in this example). To calculate whether an element is selected, we do the * following: * * 1. Apply **`track by`** to the elements in the array. In the example: `[1, 2]` * 2. Apply **`track by`** to the already selected value in `ngModel`. * In the example: this is not possible as **`track by`** refers to `item.id`, but the selected * value from `ngModel` is `{name: 'aSubItem'}`, so the **`track by`** expression is applied to * a wrong object, the selected element can't be found, `<select>` is always reset to the "not * selected" option. * * * @param {string} ngModel Assignable angular expression to data-bind to. * @param {string=} name Property name of the form under which the control is published. * @param {string=} required The control is considered valid only if value is entered. * @param {string=} ngRequired Adds `required` attribute and `required` validation constraint to * the element when the ngRequired expression evaluates to true. Use `ngRequired` instead of * `required` when you want to data-bind to the `required` attribute. * @param {comprehension_expression=} ngOptions in one of the following forms: * * * for array data sources: * * `label` **`for`** `value` **`in`** `array` * * `select` **`as`** `label` **`for`** `value` **`in`** `array` * * `label` **`group by`** `group` **`for`** `value` **`in`** `array` * * `label` **`group by`** `group` **`for`** `value` **`in`** `array` **`track by`** `trackexpr` * * `label` **`for`** `value` **`in`** `array` | orderBy:`orderexpr` **`track by`** `trackexpr` * (for including a filter with `track by`) * * for object data sources: * * `label` **`for (`**`key` **`,`** `value`**`) in`** `object` * * `select` **`as`** `label` **`for (`**`key` **`,`** `value`**`) in`** `object` * * `label` **`group by`** `group` **`for (`**`key`**`,`** `value`**`) in`** `object` * * `select` **`as`** `label` **`group by`** `group` * **`for` `(`**`key`**`,`** `value`**`) in`** `object` * * Where: * * * `array` / `object`: an expression which evaluates to an array / object to iterate over. * * `value`: local variable which will refer to each item in the `array` or each property value * of `object` during iteration. * * `key`: local variable which will refer to a property name in `object` during iteration. * * `label`: The result of this expression will be the label for `<option>` element. The * `expression` will most likely refer to the `value` variable (e.g. `value.propertyName`). * * `select`: The result of this expression will be bound to the model of the parent `<select>` * element. If not specified, `select` expression will default to `value`. * * `group`: The result of this expression will be used to group options using the `<optgroup>` * DOM element. * * `trackexpr`: Used when working with an array of objects. The result of this expression will be * used to identify the objects in the array. The `trackexpr` will most likely refer to the * `value` variable (e.g. `value.propertyName`). With this the selection is preserved * even when the options are recreated (e.g. reloaded from the server). * * @example <example module="selectExample"> <file name="index.html"> <script> angular.module('selectExample', []) .controller('ExampleController', ['$scope', function($scope) { $scope.colors = [ {name:'black', shade:'dark'}, {name:'white', shade:'light'}, {name:'red', shade:'dark'}, {name:'blue', shade:'dark'}, {name:'yellow', shade:'light'} ]; $scope.myColor = $scope.colors[2]; // red }]); </script> <div ng-controller="ExampleController"> <ul> <li ng-repeat="color in colors"> Name: <input ng-model="color.name"> [<a href ng-click="colors.splice($index, 1)">X</a>] </li> <li> [<a href ng-click="colors.push({})">add</a>] </li> </ul> <hr/> Color (null not allowed): <select ng-model="myColor" ng-options="color.name for color in colors"></select><br> Color (null allowed): <span class="nullable"> <select ng-model="myColor" ng-options="color.name for color in colors"> <option value="">-- choose color --</option> </select> </span><br/> Color grouped by shade: <select ng-model="myColor" ng-options="color.name group by color.shade for color in colors"> </select><br/> Select <a href ng-click="myColor = { name:'not in list', shade: 'other' }">bogus</a>.<br> <hr/> Currently selected: {{ {selected_color:myColor} }} <div style="border:solid 1px black; height:20px" ng-style="{'background-color':myColor.name}"> </div> </div> </file> <file name="protractor.js" type="protractor"> it('should check ng-options', function() { expect(element(by.binding('{selected_color:myColor}')).getText()).toMatch('red'); element.all(by.model('myColor')).first().click(); element.all(by.css('select[ng-model="myColor"] option')).first().click(); expect(element(by.binding('{selected_color:myColor}')).getText()).toMatch('black'); element(by.css('.nullable select[ng-model="myColor"]')).click(); element.all(by.css('.nullable select[ng-model="myColor"] option')).first().click(); expect(element(by.binding('{selected_color:myColor}')).getText()).toMatch('null'); }); </file> </example> */ var ngOptionsDirective = valueFn({ restrict: 'A', terminal: true }); // jshint maxlen: false var selectDirective = ['$compile', '$parse', function($compile, $parse) { //000011111111110000000000022222222220000000000000000000003333333333000000000000004444444444444440000000005555555555555550000000666666666666666000000000000000777777777700000000000000000008888888888 var NG_OPTIONS_REGEXP = /^\s*([\s\S]+?)(?:\s+as\s+([\s\S]+?))?(?:\s+group\s+by\s+([\s\S]+?))?\s+for\s+(?:([\$\w][\$\w]*)|(?:\(\s*([\$\w][\$\w]*)\s*,\s*([\$\w][\$\w]*)\s*\)))\s+in\s+([\s\S]+?)(?:\s+track\s+by\s+([\s\S]+?))?$/, nullModelCtrl = {$setViewValue: noop}; // jshint maxlen: 100 return { restrict: 'E', require: ['select', '?ngModel'], controller: ['$element', '$scope', '$attrs', function($element, $scope, $attrs) { var self = this, optionsMap = {}, ngModelCtrl = nullModelCtrl, nullOption, unknownOption; self.databound = $attrs.ngModel; self.init = function(ngModelCtrl_, nullOption_, unknownOption_) { ngModelCtrl = ngModelCtrl_; nullOption = nullOption_; unknownOption = unknownOption_; }; self.addOption = function(value, element) { assertNotHasOwnProperty(value, '"option value"'); optionsMap[value] = true; if (ngModelCtrl.$viewValue == value) { $element.val(value); if (unknownOption.parent()) unknownOption.remove(); } // Workaround for https://code.google.com/p/chromium/issues/detail?id=381459 // Adding an <option selected="selected"> element to a <select required="required"> should // automatically select the new element if (element && element[0].hasAttribute('selected')) { element[0].selected = true; } }; self.removeOption = function(value) { if (this.hasOption(value)) { delete optionsMap[value]; if (ngModelCtrl.$viewValue === value) { this.renderUnknownOption(value); } } }; self.renderUnknownOption = function(val) { var unknownVal = '? ' + hashKey(val) + ' ?'; unknownOption.val(unknownVal); $element.prepend(unknownOption); $element.val(unknownVal); unknownOption.prop('selected', true); // needed for IE }; self.hasOption = function(value) { return optionsMap.hasOwnProperty(value); }; $scope.$on('$destroy', function() { // disable unknown option so that we don't do work when the whole select is being destroyed self.renderUnknownOption = noop; }); }], link: function(scope, element, attr, ctrls) { // if ngModel is not defined, we don't need to do anything if (!ctrls[1]) return; var selectCtrl = ctrls[0], ngModelCtrl = ctrls[1], multiple = attr.multiple, optionsExp = attr.ngOptions, nullOption = false, // if false, user will not be able to select it (used by ngOptions) emptyOption, renderScheduled = false, // we can't just jqLite('<option>') since jqLite is not smart enough // to create it in <select> and IE barfs otherwise. optionTemplate = jqLite(document.createElement('option')), optGroupTemplate =jqLite(document.createElement('optgroup')), unknownOption = optionTemplate.clone(); // find "null" option for (var i = 0, children = element.children(), ii = children.length; i < ii; i++) { if (children[i].value === '') { emptyOption = nullOption = children.eq(i); break; } } selectCtrl.init(ngModelCtrl, nullOption, unknownOption); // required validator if (multiple) { ngModelCtrl.$isEmpty = function(value) { return !value || value.length === 0; }; } if (optionsExp) setupAsOptions(scope, element, ngModelCtrl); else if (multiple) setupAsMultiple(scope, element, ngModelCtrl); else setupAsSingle(scope, element, ngModelCtrl, selectCtrl); //////////////////////////// function setupAsSingle(scope, selectElement, ngModelCtrl, selectCtrl) { ngModelCtrl.$render = function() { var viewValue = ngModelCtrl.$viewValue; if (selectCtrl.hasOption(viewValue)) { if (unknownOption.parent()) unknownOption.remove(); selectElement.val(viewValue); if (viewValue === '') emptyOption.prop('selected', true); // to make IE9 happy } else { if (isUndefined(viewValue) && emptyOption) { selectElement.val(''); } else { selectCtrl.renderUnknownOption(viewValue); } } }; selectElement.on('change', function() { scope.$apply(function() { if (unknownOption.parent()) unknownOption.remove(); ngModelCtrl.$setViewValue(selectElement.val()); }); }); } function setupAsMultiple(scope, selectElement, ctrl) { var lastView; ctrl.$render = function() { var items = new HashMap(ctrl.$viewValue); forEach(selectElement.find('option'), function(option) { option.selected = isDefined(items.get(option.value)); }); }; // we have to do it on each watch since ngModel watches reference, but // we need to work of an array, so we need to see if anything was inserted/removed scope.$watch(function selectMultipleWatch() { if (!equals(lastView, ctrl.$viewValue)) { lastView = shallowCopy(ctrl.$viewValue); ctrl.$render(); } }); selectElement.on('change', function() { scope.$apply(function() { var array = []; forEach(selectElement.find('option'), function(option) { if (option.selected) { array.push(option.value); } }); ctrl.$setViewValue(array); }); }); } function setupAsOptions(scope, selectElement, ctrl) { var match; if (!(match = optionsExp.match(NG_OPTIONS_REGEXP))) { throw ngOptionsMinErr('iexp', "Expected expression in form of " + "'_select_ (as _label_)? for (_key_,)?_value_ in _collection_'" + " but got '{0}'. Element: {1}", optionsExp, startingTag(selectElement)); } var displayFn = $parse(match[2] || match[1]), valueName = match[4] || match[6], selectAs = / as /.test(match[0]) && match[1], selectAsFn = selectAs ? $parse(selectAs) : null, keyName = match[5], groupByFn = $parse(match[3] || ''), valueFn = $parse(match[2] ? match[1] : valueName), valuesFn = $parse(match[7]), track = match[8], trackFn = track ? $parse(match[8]) : null, trackKeysCache = {}, // This is an array of array of existing option groups in DOM. // We try to reuse these if possible // - optionGroupsCache[0] is the options with no option group // - optionGroupsCache[?][0] is the parent: either the SELECT or OPTGROUP element optionGroupsCache = [[{element: selectElement, label:''}]], //re-usable object to represent option's locals locals = {}; if (nullOption) { // compile the element since there might be bindings in it $compile(nullOption)(scope); // remove the class, which is added automatically because we recompile the element and it // becomes the compilation root nullOption.removeClass('ng-scope'); // we need to remove it before calling selectElement.empty() because otherwise IE will // remove the label from the element. wtf? nullOption.remove(); } // clear contents, we'll add what's needed based on the model selectElement.empty(); selectElement.on('change', selectionChanged); ctrl.$render = render; scope.$watchCollection(valuesFn, scheduleRendering); scope.$watchCollection(getLabels, scheduleRendering); if (multiple) { scope.$watchCollection(function() { return ctrl.$modelValue; }, scheduleRendering); } // ------------------------------------------------------------------ // function callExpression(exprFn, key, value) { locals[valueName] = value; if (keyName) locals[keyName] = key; return exprFn(scope, locals); } function selectionChanged() { scope.$apply(function() { var collection = valuesFn(scope) || []; var viewValue; if (multiple) { viewValue = []; forEach(selectElement.val(), function(selectedKey) { selectedKey = trackFn ? trackKeysCache[selectedKey] : selectedKey; viewValue.push(getViewValue(selectedKey, collection[selectedKey])); }); } else { var selectedKey = trackFn ? trackKeysCache[selectElement.val()] : selectElement.val(); viewValue = getViewValue(selectedKey, collection[selectedKey]); } ctrl.$setViewValue(viewValue); render(); }); } function getViewValue(key, value) { if (key === '?') { return undefined; } else if (key === '') { return null; } else { var viewValueFn = selectAsFn ? selectAsFn : valueFn; return callExpression(viewValueFn, key, value); } } function getLabels() { var values = valuesFn(scope); var toDisplay; if (values && isArray(values)) { toDisplay = new Array(values.length); for (var i = 0, ii = values.length; i < ii; i++) { toDisplay[i] = callExpression(displayFn, i, values[i]); } return toDisplay; } else if (values) { // TODO: Add a test for this case toDisplay = {}; for (var prop in values) { if (values.hasOwnProperty(prop)) { toDisplay[prop] = callExpression(displayFn, prop, values[prop]); } } } return toDisplay; } function createIsSelectedFn(viewValue) { var selectedSet; if (multiple) { if (trackFn && isArray(viewValue)) { selectedSet = new HashMap([]); for (var trackIndex = 0; trackIndex < viewValue.length; trackIndex++) { // tracking by key selectedSet.put(callExpression(trackFn, null, viewValue[trackIndex]), true); } } else { selectedSet = new HashMap(viewValue); } } else if (trackFn) { viewValue = callExpression(trackFn, null, viewValue); } return function isSelected(key, value) { var compareValueFn; if (trackFn) { compareValueFn = trackFn; } else if (selectAsFn) { compareValueFn = selectAsFn; } else { compareValueFn = valueFn; } if (multiple) { return isDefined(selectedSet.remove(callExpression(compareValueFn, key, value))); } else { return viewValue === callExpression(compareValueFn, key, value); } }; } function scheduleRendering() { if (!renderScheduled) { scope.$$postDigest(render); renderScheduled = true; } } /** * A new labelMap is created with each render. * This function is called for each existing option with added=false, * and each new option with added=true. * - Labels that are passed to this method twice, * (once with added=true and once with added=false) will end up with a value of 0, and * will cause no change to happen to the corresponding option. * - Labels that are passed to this method only once with added=false will end up with a * value of -1 and will eventually be passed to selectCtrl.removeOption() * - Labels that are passed to this method only once with added=true will end up with a * value of 1 and will eventually be passed to selectCtrl.addOption() */ function updateLabelMap(labelMap, label, added) { labelMap[label] = labelMap[label] || 0; labelMap[label] += (added ? 1 : -1); } function render() { renderScheduled = false; // Temporary location for the option groups before we render them var optionGroups = {'':[]}, optionGroupNames = [''], optionGroupName, optionGroup, option, existingParent, existingOptions, existingOption, viewValue = ctrl.$viewValue, values = valuesFn(scope) || [], keys = keyName ? sortedKeys(values) : values, key, value, groupLength, length, groupIndex, index, labelMap = {}, selected, isSelected = createIsSelectedFn(viewValue), anySelected = false, lastElement, element, label, optionId; trackKeysCache = {}; // We now build up the list of options we need (we merge later) for (index = 0; length = keys.length, index < length; index++) { key = index; if (keyName) { key = keys[index]; if (key.charAt(0) === '$') continue; } value = values[key]; optionGroupName = callExpression(groupByFn, key, value) || ''; if (!(optionGroup = optionGroups[optionGroupName])) { optionGroup = optionGroups[optionGroupName] = []; optionGroupNames.push(optionGroupName); } selected = isSelected(key, value); anySelected = anySelected || selected; label = callExpression(displayFn, key, value); // what will be seen by the user // doing displayFn(scope, locals) || '' overwrites zero values label = isDefined(label) ? label : ''; optionId = trackFn ? trackFn(scope, locals) : (keyName ? keys[index] : index); if (trackFn) { trackKeysCache[optionId] = key; } optionGroup.push({ // either the index into array or key from object id: optionId, label: label, selected: selected // determine if we should be selected }); } if (!multiple) { if (nullOption || viewValue === null) { // insert null option if we have a placeholder, or the model is null optionGroups[''].unshift({id:'', label:'', selected:!anySelected}); } else if (!anySelected) { // option could not be found, we have to insert the undefined item optionGroups[''].unshift({id:'?', label:'', selected:true}); } } // Now we need to update the list of DOM nodes to match the optionGroups we computed above for (groupIndex = 0, groupLength = optionGroupNames.length; groupIndex < groupLength; groupIndex++) { // current option group name or '' if no group optionGroupName = optionGroupNames[groupIndex]; // list of options for that group. (first item has the parent) optionGroup = optionGroups[optionGroupName]; if (optionGroupsCache.length <= groupIndex) { // we need to grow the optionGroups existingParent = { element: optGroupTemplate.clone().attr('label', optionGroupName), label: optionGroup.label }; existingOptions = [existingParent]; optionGroupsCache.push(existingOptions); selectElement.append(existingParent.element); } else { existingOptions = optionGroupsCache[groupIndex]; existingParent = existingOptions[0]; // either SELECT (no group) or OPTGROUP element // update the OPTGROUP label if not the same. if (existingParent.label != optionGroupName) { existingParent.element.attr('label', existingParent.label = optionGroupName); } } lastElement = null; // start at the beginning for (index = 0, length = optionGroup.length; index < length; index++) { option = optionGroup[index]; if ((existingOption = existingOptions[index + 1])) { // reuse elements lastElement = existingOption.element; if (existingOption.label !== option.label) { updateLabelMap(labelMap, existingOption.label, false); updateLabelMap(labelMap, option.label, true); lastElement.text(existingOption.label = option.label); lastElement.prop('label', existingOption.label); } if (existingOption.id !== option.id) { lastElement.val(existingOption.id = option.id); } // lastElement.prop('selected') provided by jQuery has side-effects if (lastElement[0].selected !== option.selected) { lastElement.prop('selected', (existingOption.selected = option.selected)); if (msie) { // See #7692 // The selected item wouldn't visually update on IE without this. // Tested on Win7: IE9, IE10 and IE11. Future IEs should be tested as well lastElement.prop('selected', existingOption.selected); } } } else { // grow elements // if it's a null option if (option.id === '' && nullOption) { // put back the pre-compiled element element = nullOption; } else { // jQuery(v1.4.2) Bug: We should be able to chain the method calls, but // in this version of jQuery on some browser the .text() returns a string // rather then the element. (element = optionTemplate.clone()) .val(option.id) .prop('selected', option.selected) .attr('selected', option.selected) .prop('label', option.label) .text(option.label); } existingOptions.push(existingOption = { element: element, label: option.label, id: option.id, selected: option.selected }); updateLabelMap(labelMap, option.label, true); if (lastElement) { lastElement.after(element); } else { existingParent.element.append(element); } lastElement = element; } } // remove any excessive OPTIONs in a group index++; // increment since the existingOptions[0] is parent element not OPTION while (existingOptions.length > index) { option = existingOptions.pop(); updateLabelMap(labelMap, option.label, false); option.element.remove(); } } // remove any excessive OPTGROUPs from select while (optionGroupsCache.length > groupIndex) { // remove all the labels in the option group optionGroup = optionGroupsCache.pop(); for (index = 1; index < optionGroup.length; ++index) { updateLabelMap(labelMap, optionGroup[index].label, false); } optionGroup[0].element.remove(); } forEach(labelMap, function(count, label) { if (count > 0) { selectCtrl.addOption(label); } else if (count < 0) { selectCtrl.removeOption(label); } }); } } } }; }]; var optionDirective = ['$interpolate', function($interpolate) { var nullSelectCtrl = { addOption: noop, removeOption: noop }; return { restrict: 'E', priority: 100, compile: function(element, attr) { if (isUndefined(attr.value)) { var interpolateFn = $interpolate(element.text(), true); if (!interpolateFn) { attr.$set('value', element.text()); } } return function(scope, element, attr) { var selectCtrlName = '$selectController', parent = element.parent(), selectCtrl = parent.data(selectCtrlName) || parent.parent().data(selectCtrlName); // in case we are in optgroup if (!selectCtrl || !selectCtrl.databound) { selectCtrl = nullSelectCtrl; } if (interpolateFn) { scope.$watch(interpolateFn, function interpolateWatchAction(newVal, oldVal) { attr.$set('value', newVal); if (oldVal !== newVal) { selectCtrl.removeOption(oldVal); } selectCtrl.addOption(newVal, element); }); } else { selectCtrl.addOption(attr.value, element); } element.on('$destroy', function() { selectCtrl.removeOption(attr.value); }); }; } }; }]; var styleDirective = valueFn({ restrict: 'E', terminal: false }); var requiredDirective = function() { return { restrict: 'A', require: '?ngModel', link: function(scope, elm, attr, ctrl) { if (!ctrl) return; attr.required = true; // force truthy in case we are on non input element ctrl.$validators.required = function(modelValue, viewValue) { return !attr.required || !ctrl.$isEmpty(viewValue); }; attr.$observe('required', function() { ctrl.$validate(); }); } }; }; var patternDirective = function() { return { restrict: 'A', require: '?ngModel', link: function(scope, elm, attr, ctrl) { if (!ctrl) return; var regexp, patternExp = attr.ngPattern || attr.pattern; attr.$observe('pattern', function(regex) { if (isString(regex) && regex.length > 0) { regex = new RegExp('^' + regex + '$'); } if (regex && !regex.test) { throw minErr('ngPattern')('noregexp', 'Expected {0} to be a RegExp but was {1}. Element: {2}', patternExp, regex, startingTag(elm)); } regexp = regex || undefined; ctrl.$validate(); }); ctrl.$validators.pattern = function(value) { return ctrl.$isEmpty(value) || isUndefined(regexp) || regexp.test(value); }; } }; }; var maxlengthDirective = function() { return { restrict: 'A', require: '?ngModel', link: function(scope, elm, attr, ctrl) { if (!ctrl) return; var maxlength = -1; attr.$observe('maxlength', function(value) { var intVal = int(value); maxlength = isNaN(intVal) ? -1 : intVal; ctrl.$validate(); }); ctrl.$validators.maxlength = function(modelValue, viewValue) { return (maxlength < 0) || ctrl.$isEmpty(modelValue) || (viewValue.length <= maxlength); }; } }; }; var minlengthDirective = function() { return { restrict: 'A', require: '?ngModel', link: function(scope, elm, attr, ctrl) { if (!ctrl) return; var minlength = 0; attr.$observe('minlength', function(value) { minlength = int(value) || 0; ctrl.$validate(); }); ctrl.$validators.minlength = function(modelValue, viewValue) { return ctrl.$isEmpty(viewValue) || viewValue.length >= minlength; }; } }; }; if (window.angular.bootstrap) { //AngularJS is already loaded, so we can return here... console.log('WARNING: Tried to load angular more than once.'); return; } //try to bind to jquery now so that one can write jqLite(document).ready() //but we will rebind on bootstrap again. bindJQuery(); publishExternalAPI(angular); jqLite(document).ready(function() { angularInit(document, bootstrap); }); })(window, document); !window.angular.$$csp() && window.angular.element(document).find('head').prepend('<style type="text/css">@charset "UTF-8";[ng\\:cloak],[ng-cloak],[data-ng-cloak],[x-ng-cloak],.ng-cloak,.x-ng-cloak,.ng-hide:not(.ng-hide-animate){display:none !important;}ng\\:form{display:block;}</style>');
joseluisillana/api-restful-spring-jersey
erep-services/src/main/webapp/bower_components/angular/angular.js
JavaScript
gpl-2.0
952,168
<?php /** * @package Joomla! 2.5 * @version 4.x * @author 2008-2012 (c) Denys Nosov (aka Dutch) * @author web-site: www.joomla-ua.org * @copyright This module is licensed under a Creative Commons Attribution-Noncommercial-No Derivative Works 3.0 License. **/ // no direct access defined('_JEXEC') or die; $com_path = JPATH_SITE.'/components/com_content/'; require_once $com_path.'router.php'; require_once $com_path.'helpers/route.php'; JModelLegacy::addIncludePath($com_path . '/models', 'ContentModel'); abstract class modJUNewsUltraHelper { public static function getList(&$params) { $app = JFactory::getApplication(); $db = JFactory::getDbo(); $query = $db->getQuery(true); $model = JModelLegacy::getInstance('Articles', 'ContentModel', array('ignore_request' => true)); $version = new JVersion; $joomla = substr($version->getShortVersion(), 0, 3); $appParams = JFactory::getApplication()->getParams(); $model->setState('params', $appParams); // Introtext $show_intro = $params->get( 'show_intro'); $introtext_limit = intval( $params->get( 'introtext_limit') ); $li = $params->get('li'); $lmttext = $params->get('lmttext'); $clear_tag = $params->get('clear_tag'); // Fulltext $show_full = $params->get( 'show_full', 0); $fulltext_limit = intval( $params->get( 'fulltext_limit') ); $li_full = $params->get('li_full'); $lmttext_full = $params->get('lmttext_full'); $clear_tag_full = $params->get('clear_tag_full'); // Date $data_format = $params->get('data_format'); $df_d = $params->get('df_d'); $df_m = $params->get('df_m'); $df_y = $params->get('df_y'); // Image $pik = $params->def('pik'); $imageWidth = intval($params->get('imageWidth')); $imageHeight = intval($params->get('imageHeight')); $thumb_width = intval($params->get('thumb_width')); $noimage = $params->def('noimage'); $imglink = $params->def('imglink'); $link_enabled = $params->get('link_enabled', 1); $youtube_img_show = $params->def('youtube_img_show', 1); $gallery = $params->def('gallery', 1); // Set the filters based on the module params $model->setState('list.start', (int) $params->get('count_skip', 0)); $model->setState('list.limit', (int) $params->get('count', 5)); $model->setState('filter.published', 1); if($joomla >= '3.0') { $model->setState('list.select', 'a.id, a.asset_id, a.title, a.alias, a.introtext, a.fulltext, ' . 'CASE WHEN badcats.id is null THEN a.state ELSE 0 END AS state, ' . 'a.catid, a.created, a.created_by, a.created_by_alias, ' . 'CASE WHEN a.modified = ' . $db->q($db->getNullDate()) . ' THEN a.created ELSE a.modified END as modified, ' . 'a.modified_by, a.checked_out, a.checked_out_time, a.publish_up, a.publish_down, ' . 'a.images, a.urls, a.attribs, a.version, a.ordering, ' . 'a.metakey, a.metadesc, a.access, a.hits, a.metadata, a.featured, a.language, a.xreference' ); } else { $model->setState('list.select', 'a.fulltext, a.id, a.title, a.alias, a.title_alias, a.introtext, a.state, a.catid, a.created, a.created_by, a.created_by_alias,' . ' a.modified, a.modified_by, a.publish_up, a.publish_down, a.images, a.urls, a.attribs, a.metadata, a.metakey, a.metadesc, a.access,' . ' a.hits, a.featured' ); } // Access filter $access = !JComponentHelper::getParams('com_content')->get('show_noauth'); $authorised = JAccess::getAuthorisedViewLevels(JFactory::getUser()->get('id')); $model->setState('filter.access', $access); // User filter $userId = JFactory::getUser()->get('id'); switch ($params->get('user_id')) { case 'by_me': $model->setState('filter.author_id', (int) $userId); break; case 'not_me': $model->setState('filter.author_id', $userId); $model->setState('filter.author_id.include', false); break; case '0': break; default: $model->setState('filter.author_id', (int) $params->get('user_id')); break; } // Filter by language $model->setState('filter.language', $app->getLanguageFilter()); // Featured switch switch ($params->get('show_featured')) { case '1': $model->setState('filter.featured', 'only'); break; case '0': $model->setState('filter.featured', 'hide'); break; default: $model->setState('filter.featured', 'show'); break; } // Set ordering $order_map = array( 'title_asc' => 'a.title', 'title_desc' => 'a.title DESC', 'id_asc' => 'a.id', 'id_desc' => 'a.id DESC', 'hits_asc' => 'a.hits', 'hits_desc' => 'a.hits DESC', 'created_asc' => 'a.created', 'created_desc' => 'a.created DESC', 'modified_desc' => 'a.modified DESC', 'modified_created_dsc' => 'a.modified DESC, a.created', 'modified_touch_dsc' => 'CASE WHEN (a.modified = '.$db->quote($db->getNullDate()).') THEN a.created ELSE a.modified END', 'ordering_asc' => 'a.ordering', 'ordering_desc' => 'a.ordering DESC', 'rand' => 'rand()', 'publish_dsc' => 'a.publish_up', 'rating_dsc' => 'v.rating_count', ); $ordering = JArrayHelper::getValue($order_map, $params->get('ordering'), 'a.publish_up'); $dir = ''; $model->setState('list.ordering', $ordering); $model->setState('list.direction', $dir); // Select article or categories if($params->def('display_article') == 1) { // Article filter $model->setState('filter.article_id', $params->def('articleid', array())); } else { // Category filter //$catids = $params->get('catid'); $catids = $params->get('catid', array()); if($params->get('category_filtering_type') == 1) { $model->setState('filter.category_id.include', (bool) $params->get('category_filtering_type')); } if ($catids) { if ($params->get('show_child_category_articles', 0) && (int) $params->get('levels', 0) > 0) { $categories = JModelLegacy::getInstance('Categories', 'ContentModel', array('ignore_request' => true)); $categories->setState('params', $appParams); $levels = $params->get('levels', 1) ? $params->get('levels', 1) : 99999; $categories->setState('filter.get_children', $levels); $categories->setState('filter.published', 1); $categories->setState('filter.access', $access); $additional_catids = array(); foreach($catids as $catid) { $categories->setState('filter.parentId', $catid); $recursive = true; $items = $categories->getItems($recursive); if ($items) { foreach($items as $category) { $condition = (($category->level - $categories->getParent()->level) <= $levels); if ($condition) { $additional_catids[] = $category->id; } } } } $catids = array_unique(array_merge($catids, $additional_catids)); } $model->setState('filter.category_id', $catids); } $excluded_articles = $params->get('excluded_articles', ''); if ($excluded_articles) { $excluded_articles = explode("\r\n", $excluded_articles); $model->setState('filter.article_id', $excluded_articles); $model->setState('filter.article_id.include', false); // Exclude } } $date_filtering = $params->get('date_filtering', 0); $relative_date = $params->get('relative_date', 0); if ($date_filtering == 1) { $model->setState('filter.date_filtering', (($date_filtering == 1 && $relative_date == 1) ? 'range' : 'relative')); $model->setState('filter.date_field', $params->get('date_field', 'a.created')); switch ($relative_date) { case '1': $model->setState('filter.start_date_range', $params->get('start_date_range', date('Y-m-d') .' 00:00:00')); $model->setState('filter.end_date_range', $params->get('end_date_range', date('Y-m-d H:i:s'))); break; case '2': $model->setState('filter.relative_date', '7'); break; case '3': $model->setState('filter.relative_date', '14'); break; case '4': $model->setState('filter.relative_date', cal_days_in_month(CAL_GREGORIAN, date('m'), date('Y'))); break; case '5': $model->setState('filter.relative_date', '365'); break; case '6': $model->setState('filter.relative_date', $params->get('custom_days', '30')); break; case '0': default: $model->setState('filter.relative_date', '1'); break; } } $items = $model->getItems(); // JComments integration if ($params->def('JC') == 1 && count($items)) { $comments = JPATH_SITE . '/components/com_jcomments/jcomments.php'; if (file_exists($comments)) { $ids = array(); foreach($items as $item) { $ids[] = $item->id; } $db->setQuery('SELECT object_id, count(*) AS cnt FROM #__jcomments WHERE object_group = "com_content" AND object_id IN ('.implode(',', $ids).') AND published = "1"'); $commentsCount = $db->loadObjectList('object_id'); foreach($items as &$item) { $item->comments = isset($commentsCount[$item->id]) ? $commentsCount[$item->id]->cnt : 0; $item->commentslink = '#comments'; $item->commentstext = JText::plural('LINK_READ_COMMENTS', $item->comments); if ($item->comments == 0) { $item->comments = ''; $item->commentslink = '#addcomments'; $item->commentstext = JText::_('LINK_ADD_COMMENT'); } } } else { echo '<strong style="color: green;">'. JText::_('MOD_JUNEWS_JC_NOT_INSTALLED') .'</strong>'; } } foreach ($items as &$item) { $item->slug = $item->id.':'.$item->alias; $item->catslug = $item->catid.':'.$item->category_alias; if ($access || in_array($item->access, $authorised)) { $item->link = JRoute::_(ContentHelperRoute::getArticleRoute($item->slug, $item->catslug)); $catlink = JRoute::_(ContentHelperRoute::getCategoryRoute($item->catslug)); } else { $item->link = JRoute::_('index.php?option=com_users&view=login'); $catlink = $item->link; } // article title $item->title = preg_replace('#"(.*?)"#is', '«\\1»', strip_tags( $item->title )); // category title if($params->get('showcat') == 1) { $cattitle = strip_tags( $item->category_title ); if($params->get('showcatlink') == 1) { $item->cattitle = '<a href="'. $catlink .'">'. $cattitle .'</a>'; } else { $item->cattitle = $cattitle; } } if ($pik == 1) { if ($imglink == 1) { $imlink = '<a href="'. $item->link .'"'. ($params->get('tips') == 1 ? ' title="'. strip_tags( $item->title ) .'"' : '') .'>'; $imlink2 = '</a>'; } else { $imlink = ''; $imlink2 = ''; } ; $junuimgresmatche = $item->introtext . $item->fulltext; if (preg_match('/{gallery\s+(.*?)}/i', $junuimgresmatche, $junuimgsource) && $gallery == '1') { $junuimgsource = $junuimgsource[1]; $imglist = explode("|", $junuimgsource); $junuimgsource = $imglist[0]; $imglist = ''; $root = JPATH_BASE .'/'; $folder = 'images/'. $junuimgsource; $img_folder = $root . $folder; if (is_dir($img_folder)) { $files = array(); $dir = opendir($img_folder); while(($file = readdir($dir)) !== false) { if($file !== '.' && $file !== '..' && (strtolower(substr($file, -3)) === 'jpg' || strtolower(substr($file, -3)) === 'png' || strtolower(substr($file, -3)) === 'gif')) { $files[] = $file; break; } } closedir($dir); sort($files); $junuimgsource = $folder .'/'. $files[0]; } else { $junuimgsource = ''; } } elseif (preg_match('/<img(.*?)src="(.*?)"(.*?)>\s*(<\/img>)?/', $junuimgresmatche, $junuimgsource)) { $junuimgsource = $junuimgsource[2]; } // images from article parameters $images = json_decode($item->images); if( ($params->def('image_source', 0) > '0') && ((isset($images->image_intro) && !empty($images->image_intro) ) || (isset($images->image_fulltext) && !empty($images->image_fulltext) )) ) { if( $params->def('image_source', 0) == '1' ) { if( isset($images->image_intro) && !empty($images->image_intro) ) { $junuimgsource = htmlspecialchars($images->image_intro); // raw image source $item->imagesource = htmlspecialchars($images->image_intro); } elseif( isset($images->image_fulltext) && !empty($images->image_fulltext) ) { $junuimgsource = htmlspecialchars($images->image_fulltext); // raw image source $item->imagesource = htmlspecialchars($images->image_fulltext); } } elseif( $params->def('image_source', 0) == '2' && ( isset($images->image_intro) && !empty($images->image_intro) ) ) { $junuimgsource = htmlspecialchars($images->image_intro); // raw image source $item->imagesource = htmlspecialchars($images->image_intro); } elseif( $params->def('image_source', 0) == '3' && ( isset($images->image_fulltext) && !empty($images->image_fulltext) ) ) { $junuimgsource = htmlspecialchars($images->image_fulltext); // raw image source $item->imagesource = htmlspecialchars($images->image_fulltext); } } else { if( $junuimgsource ) { $junuimgsource = str_replace(JURI::base(), '', $junuimgsource); // raw image source $item->imagesource = $junuimgsource; } else { $junuimgsource = ''; } } switch ($thumb_width) { case '0': $contentimage = $imlink .'<img src="'. $junuimgsource .'" width="'. $imageWidth .'" alt="'. strip_tags( $item->title ) .'" />'. $imlink2; $blankimage = $imlink .'<img src="'. JURI::base().'/media/mod_junewsultra/' . $noimage .'" width="'. $imageWidth .'" alt="'. strip_tags( $item->title ) .'" />'. $imlink2; if($youtube_img_show == 1) { $regex1 = '%(?:youtube(?:-nocookie)?\.com/(?:[^/]+/.+/|(?:v|e(?:mbed)?)/|.*[?&]v=)|youtu\.be/)([^>"&?/ ]{11})%i'; $regex2 = '#(player.vimeo.com)/video/([0-9]+)#i'; if (preg_match($regex1, $junuimgresmatche, $match)) { $yimg = modJUNewsUltraHelper::video('http://youtu.be/'. $match[1],'hqthumb'); $item->image = $imlink .'<img src="'. $yimg .'" width="'. $imageWidth .'" alt="'. strip_tags( $item->title ) .'" />'. $imlink2; $item->imagesource = $yimg; } elseif (preg_match($regex2, $junuimgresmatche, $match)) { $yimg = modJUNewsUltraHelper::video('http://vimeo.com/'. $match[2],'hqthumb'); $item->image = $imlink .'<img src="'. $yimg .'" width="'. $imageWidth .'" alt="'. strip_tags( $item->title ) .'" />'. $imlink2; $item->imagesource = $yimg; } elseif( $junuimgsource ) { $item->image = $contentimage; } elseif($params->def('defaultimg', 1) == 1) { $item->image = $blankimage; } } elseif( $junuimgsource ) { $item->image = $contentimage; } elseif($params->def('defaultimg', 1) == 1) { $item->image = $blankimage; } break; case '1': default: $thumb_img = modJUNewsUltraHelper::RenderImage( $junuimgsource, $params, '', '', '', '' ); list($width, $height, $type, $attr) = getimagesize( $thumb_img ); $contentimage = $imlink .'<img src="'. $thumb_img .'" '. $attr .' alt="'. strip_tags( $item->title ) .'" />'. $imlink2; $blank_thumb_img = modJUNewsUltraHelper::RenderImage( 'media/mod_junewsultra/'. $noimage, $params, '', '', '', ''); list($width, $height, $type, $attr) = getimagesize( $blank_thumb_img ); $blankimage = $imlink .'<img src="'. $blank_thumb_img .'" '. $attr .' alt="'. strip_tags( $item->title ) .'" />'. $imlink2; if(($youtube_img_show == 1) && ($link_enabled == 1)) { $regex1 = '%(?:youtube(?:-nocookie)?\.com/(?:[^/]+/.+/|(?:v|e(?:mbed)?)/|.*[?&]v=)|youtu\.be/)([^>"&?/ ]{11})%i'; $regex2 = '#(player.vimeo.com)/video/([0-9]+)#i'; if (preg_match($regex1, $junuimgresmatche, $match)) { $yimg = modJUNewsUltraHelper::video('http://youtu.be/'. $match[1],'hqthumb'); $video_img = modJUNewsUltraHelper::RenderImage($yimg, $params, '', '', '', ''); list($width, $height, $type, $attr) = getimagesize( $video_img); $item->image = $imlink .'<img src="'. $video_img .'" '. $attr .' alt="'. strip_tags( $item->title ) .'" />'. $imlink2; $item->imagesource = $yimg; } elseif (preg_match($regex2, $junuimgresmatche, $match)) { $yimg = modJUNewsUltraHelper::video('http://vimeo.com/'. $match[2],'hqthumb'); $video_img = modJUNewsUltraHelper::RenderImage($yimg, $params, '', '', '', ''); list($width, $height, $type, $attr) = getimagesize( $video_img); $item->image = $imlink .'<img src="'. $video_img .'" '. $attr .' alt="'. strip_tags( $item->title ) .'" />'. $imlink2; $item->imagesource = $yimg; } elseif( $junuimgsource ) { $item->image = $contentimage; } elseif($params->def('defaultimg', 1) == 1) { $item->image = $blankimage; } } elseif( $junuimgsource ) { $item->image = $contentimage; } elseif($params->def('defaultimg', 1) == 1) { $item->image = $blankimage; } break; } } // introtext if($show_intro == '1') { if ($clear_tag == '1') { $item->introtext = preg_replace('/{([a-zA-Z0-9\-_]*)\s*(.*?)}/i', '', $item->introtext); $item->introtext = str_replace( '&nbsp;', ' ', $item->introtext ); $item->introtext = strip_tags( $item->introtext ); } else { $item->introtext = preg_replace('/{([a-zA-Z0-9\-_]*)\s*(.*?)}/i', '', $item->introtext); $item->introtext = preg_replace('/<img(.*?)>/i', '', $item->introtext); } if ($li == '1') { if ($lmttext == '1') { $item->introtext = trim(implode(" ", array_slice(explode(" ", $item->introtext), 0, $introtext_limit))); } else { $item->introtext = trim(JString::substr($item->introtext, 0, $introtext_limit)); } if (!preg_match('#(\.|\?|\!)$#ismu', $item->introtext)) { $item->introtext = preg_replace('#^\s?(\,|\;|\:|\-)#ismu', '', $item->introtext); $item->introtext = $item->introtext . '...'; } } } // fulltext if($show_full == '1') { if ($clear_tag == '1') { $item->fulltext = preg_replace('/{([a-zA-Z0-9\-_]*)\s*(.*?)}/i', '', $item->fulltext); $item->fulltext = str_replace( '&nbsp;', ' ', $item->fulltext ); $item->fulltext = strip_tags( $item->fulltext ); } else { $item->fulltext = preg_replace('/{([a-zA-Z0-9\-_]*)\s*(.*?)}/i', '', $item->fulltext); $item->fulltext = preg_replace('/<img(.*?)>/i', '', $item->fulltext); } if ($li_full == '1') { if ($lmttext_full == '1') { $item->fulltext = trim(implode(" ", array_slice(explode(" ", $item->fulltext), 0, $fulltext_limit))); } else { $item->fulltext = trim(JString::substr($item->fulltext, 0, $fulltext_limit)); } if (!preg_match('#(\.|\?|\!)$#ismu', $item->fulltext)) { $item->fulltext = preg_replace('#^\s?(\,|\;|\:|\-)#ismu', '', $item->fulltext); $item->fulltext = $item->fulltext . '...'; } } } // author if ($params->def('juauthor') == 1) { if ( $item->created_by_alias ) { $item->author = $item->created_by_alias; } else { $item->author = $item->author; } } // date if ($params->get('show_date') == 1) { $item->date = JHtml::date($item->created, $data_format); $item->df_d = JHtml::date($item->created, $df_d); $item->df_m = JHtml::date($item->created, $df_m); $item->df_y = JHtml::date($item->created, $df_y); } // hits if ($params->get('showHits') == 1) { $item->hits = $item->hits; } // rating if ($params->get('showRating') == 1) { $template = str_replace('_:', '', $params->def('template')); $starImageOn = JHTML::_('image.site', 'modules/mod_junewsultra/tmpl/'.$template.'/images/rating_star.png', null);; $starImageOff = JHtml::_('image.site','modules/mod_junewsultra/tmpl/'.$template.'/images/rating_star_blank.png', NULL, NULL, true); $img = ''; for ($i=0; $i < $item->rating; $i++) { $img .= $starImageOn; } for ($i=$item->rating; $i < 5; $i++) { $img .= $starImageOff; } $item->rating = $img; } } return $items; } public static function RenderImage($url, &$params, $nw, $nh, $nzc, $nq) { $img_cache = $params->get( 'img_cache', 'cache' ); $cache_maxfiles_img = $params->get( 'cache_maxfiles_img', '200' ); $cache_maxsize_img = $params->get( 'cache_maxsize_img', '10' ); $cache_maxage_img = $params->get( 'cache_maxage_img', '30' ); $w = ($nw ? $nw : intval($params->get( 'imageWidth' ))); $h = ($nh ? $nh : intval($params->get( 'imageHeight' ))); $zc = ($nzc ? $nzc : intval($params->get( 'Zoom_Crop', 1 ))); $q = ($nq ? $nq : '99' ); $f = $params->def( 'img_ext', 'jpg' ); $thumb_filtercolor = intval($params->get( 'thumb_filtercolor', 0 )); $colorized = $params->get( 'colorized', '25' ); $colorpicker = $params->get( 'colorpicker', '#0000ff' ); $thumb_th = $params->def( 'thumb_th', 0 ); $thumb_th_seting = $params->def( 'thumb_th_seting', 0 ); $link_enabled = $params->get( 'link_enabled', 1 ); $error_image = JPATH_BASE .'/media/mod_junewsultra/'. $params->def( 'noimage' ); $thumb_filters = $params->def( 'thumb_filters', 1 ); $usm = $params->def( 'thumb_unsharp', 1 ); $thumb_unsharp_amount = $params->def( 'thumb_unsharp_amount', 80 ); $thumb_unsharp_radius = $params->def( 'thumb_unsharp_radius', 1 ); $thumb_unsharp_threshold = $params->def( 'thumb_unsharp_threshold', 3 ); $thumb_blur = $params->def( 'thumb_blur', 0 ); $thumb_blur_seting = $params->def( 'thumb_blur_seting', 1 ); $thumb_brit = $params->def( 'thumb_brit', 0 ); $thumb_brit_seting = $params->def( 'thumb_brit_seting', 50 ); $thumb_cont = $params->def( 'thumb_cont', 0 ); $thumb_cont_seting = $params->def( 'thumb_cont_seting', 50 ); if(preg_match('#^(http|https|ftp)://#i', $url)) { $url = $url; } else { $url = (!file_exists($url) ? $error_image : JPATH_BASE .'/'. $url); } $path_parts = pathinfo($url); $imgfile = explode(".", basename($url)); $img_name = $imgfile[0]; $imgurl = str_replace(array('.', ',', '-', '_', '|', '+', '=', '%', '^', '&', '(', ')', ' ', '"', '\''), '', $img_name); $subfolder = $img_cache .'/junewsultra/'. $w.'x'.$h .'/'. substr( strtolower( MD5($path_parts['dirname'] ) ), -1); $target = $subfolder .'/junews_'. substr( strtolower( $imgurl ), 0, 150) .'-'. MD5( $url . $q . $zc . $f . $params->get('use_imagemagick') . $usm . $thumb_unsharp_amount . $thumb_unsharp_radius . $thumb_unsharp_threshold . $thumb_filtercolor . $colorized . $colorpicker . $thumb_blur . $thumb_blur_seting . $thumb_brit . $thumb_brit_seting . $thumb_cont . $thumb_cont_seting . $thumb_th . $thumb_th_seting ) .'.'. $f; if (($link_enabled == 0) && preg_match('#^(http|https|ftp)://#i', $url)) { $outpute = $error_image; return $outpute; } modJUNewsUltraHelper::MakeDirectory($dir = JPATH_BASE .'/'. $subfolder, $mode = 0777); if (file_exists(JPATH_BASE .'/'. $target)) { $outpute = JURI::base(false) . $target; } else { include_once(JPATH_BASE .'/modules/mod_junewsultra/img/phpthumb.class.php'); $phpThumb = new phpThumb(); $phpThumb->resetObject(); $phpThumb->setParameter('config_max_source_pixels', round(max(intval(ini_get('memory_limit')), intval(get_cfg_var('memory_limit'))) * 1048576 / 6) ); $phpThumb->setParameter('config_temp_directory', JPATH_BASE .'/'. $img_cache .'/junewsultra/' ); $phpThumb->setParameter('config_cache_directory', JPATH_BASE .'/'. $img_cache .'/junewsultra/' ); $phpThumb->setCacheDirectory(); $phpThumb->setParameter('config_cache_maxfiles', $cache_maxfiles_img ); $phpThumb->setParameter('config_cache_maxsize', $cache_maxsize_img * 1024 * 1024 ); $phpThumb->setParameter('config_cache_maxage', 86400 * $cache_maxage_img ); $phpThumb->setSourceFilename( $url ); if($w) { $phpThumb->setParameter( 'w', $w ); } if($h) { $phpThumb->setParameter( 'h', $h ); } if($q) { $phpThumb->setParameter( 'q', $q ); } $phpThumb->setParameter( 'f', $f ); $phpThumb->setParameter( 'zc', $zc ); $phpThumb->setParameter( 'aoe', '1' ); switch ($thumb_filtercolor) { case '1': $phpThumb->setParameter( 'fltr', 'gray' ); break; case '2': $phpThumb->setParameter( 'fltr', 'sep' ); break; case '3': $phpThumb->setParameter( 'fltr', 'th|'. $thumb_th_seting ); break; case '4': $phpThumb->setParameter( 'fltr', 'clr|'. $colorized .'|'. str_replace('#', '', $colorpicker) ); break; default: break; } if($thumb_filters == 1) { if($usm == 1) { $phpThumb->setParameter( 'fltr', 'usm|'. $thumb_unsharp_amount .'|'. $thumb_unsharp_radius .'|'. $thumb_unsharp_threshold ); } if($thumb_blur == 1) { $phpThumb->setParameter( 'fltr', 'blur|'. $thumb_blur_seting ); } if($thumb_brit == 1) { $phpThumb->setParameter( 'fltr', 'brit|'. $thumb_brit_seting ); } if($thumb_cont == 1) { $phpThumb->setParameter( 'fltr', 'cont|'. $thumb_cont_seting ); } } if($params->get('use_imagemagick') == 1) { if (strtoupper(substr(PHP_OS, 0, 3)) == 'WIN') { $imagemagick = ($params->get( 'imagemagick_path' ) == '' ? 'C:/ImageMagick/convert.exe' : $params->get( 'imagemagick_path' )); } else { $imagemagick = $params->get( 'imagemagick_path', '' ); } $phpThumb->setParameter('config_imagemagick_path', $imagemagick); $phpThumb->setParameter('config_prefer_imagemagick', ($params->get('use_imagemagick') == 1 ? true : false) ); $phpThumb->setParameter('config_imagemagick_use_thumbnail', true); } if ($phpThumb->GenerateThumbnail()) { if ($phpThumb->RenderToFile( JPATH_BASE .'/'. $target )) { $outpute = JURI::base(false) . $target; } else { $outpute = ''; } } else { $outpute = ''; } } return $outpute; } public static function MakeDirectory($dir, $mode) { if (is_dir($dir) || @mkdir($dir,$mode)) return TRUE; if (!modJUNewsUltraHelper::MakeDirectory(dirname($dir),$mode)) return FALSE; return @mkdir($dir,$mode); } /* * parse_video() PHP function * Author: takien * URL: http://takien.com * * Author: takien, slaffko * URL: http://takien.com, http://slaffko.name */ public static function video($url,$return='embed',$width='',$height='',$rel=0) { $urls = parse_url($url); //url is http://vimeo.com/xxxx if($urls['host'] == 'vimeo.com'){ $vid = ltrim($urls['path'],'/'); } //url is http://youtu.be/xxxx else if($urls['host'] == 'youtu.be'){ $yid = ltrim($urls['path'],'/'); } //url is http://www.youtube.com/embed/xxxx else if(strpos($urls['path'],'embed') == 1){ $yid = end(explode('/',$urls['path'])); } //url is xxxx only else if(strpos($url,'/')===false){ $yid = $url; } //http://www.youtube.com/watch?feature=player_embedded&v=m-t4pcO99gI //url is http://www.youtube.com/watch?v=xxxx else{ parse_str($urls['query']); $yid = $v; if(!empty($feature)){ $yid = end(explode('v=',$urls['query'])); $arr = explode('&',$yid); $yid = $arr[0]; } } if($yid) { //return embed iframe if($return == 'embed'){ return '<iframe width="'.($width?$width:560).'" height="'.($height?$height:349).'" src="http://www.youtube.com/embed/'.$yid.'?rel='.$rel.'" frameborder="0" ebkitAllowFullScreen mozallowfullscreen allowFullScreen></iframe>'; } //return normal thumb else if($return == 'thumb' || $return == 'thumbmed'){ return 'http://i1.ytimg.com/vi/'.$yid.'/default.jpg'; } //return hqthumb else if($return == 'hqthumb' ){ return 'http://i1.ytimg.com/vi/'.$yid.'/hqdefault.jpg'; } // else return id else{ return $yid; } } else if($vid) { $vimeoObject = json_decode(file_get_contents("http://vimeo.com/api/v2/video/".$vid.".json")); if (!empty($vimeoObject)) { //return embed iframe if($return == 'embed'){ return '<iframe width="'.($width?$width:$vimeoObject[0]->width).'" height="'.($height?$height:$vimeoObject[0]->height).'" src="http://player.vimeo.com/video/'.$vid.'?title=0&byline=0&portrait=0" frameborder="0" webkitAllowFullScreen mozallowfullscreen allowFullScreen></iframe>'; } //return normal thumb else if($return == 'thumb'){ return $vimeoObject[0]->thumbnail_small; } //return medium thumb else if($return == 'thumbmed'){ return $vimeoObject[0]->thumbnail_medium; } //return hqthumb else if($return == 'hqthumb'){ return $vimeoObject[0]->thumbnail_large; } // else return id else{ return $vid; } } } } }
akvlad/lemond
modules/mod_junewsultra/helper.php
PHP
gpl-2.0
36,138
<?php /** * @package ZOO Category Module * @file mod_zoocategory.php * @version 2.0.0 May 2010 * @author YOOtheme http://www.yootheme.com * @copyright Copyright (C) 2007 - 2010 YOOtheme GmbH * @license http://www.gnu.org/licenses/gpl-2.0.html GNU/GPLv2 only */ // no direct access defined('_JEXEC') or die('Restricted access'); // load config require_once(JPATH_ADMINISTRATOR.'/components/com_zoo/config.php'); $app = YTable::getInstance('application')->get($params->get('application', 0)); // is application ? if (empty($app)) { return null; } // set one or multiple categories $categories = array(); $all_categories = $app->getCategoryTree(true); if (isset($all_categories[$params->get('category', 0)])) { $categories = $all_categories[$params->get('category', 0)]->getChildren(); } if (count($categories)) { $menu_item = $params->get('menu_item'); $itemid = $menu_item ? '&Itemid='.$menu_item : ''; $url = 'index.php?option=com_zoo&task=category'.$itemid.'&category_id='; $max_depth = $params->get('depth', 0); include(JModuleHelper::getLayoutPath('mod_zoocategory', $params->get('theme', 'default'))); }
alecerosiete/webBancaria
modules/mod_zoocategory/mod_zoocategory.php
PHP
gpl-2.0
1,178
/* Quarn OS / Manes * * Type class * * Copyright (C) 2008-2009 Pawel Dziepak * * This program is free software; you can redistribute it and/or modify * it under the terms of the GNU General Public License as published by * the Free Software Foundation; either version 2 of the License, or * (at your option) any later version. * * This program is distributed in the hope that it will be useful, * but WITHOUT ANY WARRANTY; without even the implied warranty of * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the * GNU General Public License for more details. * * You should have received a copy of the GNU General Public License along * with this program; if not, write to the Free Software Foundation, Inc., * 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA. * */ #include "component.h" #include "type.h" #include "manes/error.h" #include "factory.h" #include "abstract.h" #include "libs/string.h" #include "manes/manec.h" using namespace manes; using namespace manes::cds; type::type(const component_name &_name, const component_name &_base, const delegate<p<component> > creat) : base(_base), create_impl(creat) { this->name = _name; } component_name type::get_base() const { return base; } bool type::is(const component_name &x) const { if (x == name) return true; p<type> tpe = manec::get()->get_factory()->get_component(component_name::from_path((string)"/type," + base.get_name())).cast<type>(); if (!tpe.cast<abstract>().valid()) return false; if (!tpe.valid()) return false; return tpe->is(x); } p<component> type::create_component() { assert((string)"type: attempt to create implementation of abstract type: " + name.get_name(), create_impl.null()); p<component> comp = create_impl(); comp->set(this); return comp; } bool type::operator==(const type &x) const { return x.name == name; } bool type::operator!=(const type &x) const { return !operator==(x); }
pdziepak/quarnos-old2
manes/cds/type.cpp
C++
gpl-2.0
1,946
import sys import os import arcEC def GNDBruninTOC_exe_G2N(parameters, messages): # *** Start Edtiting etc. the receiving layer # http://resources.arcgis.com/en/help/main/10.2/index.html#//00s300000008000000 # XXX Check that we are actually in an edit session ... workspace = r"C:\Users\b004218\AppData\Roaming\ESRI\Desktop10.3\ArcCatalog\EC_nis_editor@green3.sde"#\NIS.Vores_Navne" #os.path.dirname(lay_in.dataSource) lay_in = "\NIS.Vores_Navne\NIS.NamesAtest" arcEC.SetMsg(" WS : "+str(workspace), 0) edit = arcpy.da.Editor(workspace) edit.startEditing() # Edit session is started without (False) an undo/redo stack for versioned data edit.startOperation() # Start an edit operation # *** for each record: arcEC.SetMsg("\nRunning through the rows ...", 0) lst_fields_we_want = ["GST_NID","OBJNAM","NOBJNM","NIS_EDITOR_COMMENT","NAMETYPE"] lst_Fails = list() with arcpy.da.UpdateCursor(workspace+lay_in, lst_fields_we_want, "GST_NID IS NOT NULL") as cursor: for row in cursor: pass # *** Start Edtiting etc. the receiving layer edit.stopOperation() # Stop the edit operation. edit.stopEditing(True) # Stop the edit session and save the changes arcEC.SetMsg("Processed rows : "+str(num_row_count), 0) arcEC.SetMsg(" Changed rows : "+str(num_row_changed), 0) arcEC.SetMsg(" Failed rows : "+str(len(lstFails)), 0) return len(lstFails) # *** End of function GNDBruninTOC() if __name__ == "__main__": # This allows the 'executes' to be called from classic .tbx parameters = [arcpy.GetParameterAsText(0), arcpy.GetParameterAsText(1), arcpy.GetParameterAsText(2), arcpy.GetParameterAsText(3)] messages = [] result = GNDBruninTOC_exe_G2N(parameters, messages) # *** End of Script *** # Music that accompanied the coding of this script: # Kid Creole & the Coconuts - Tropical gangster
MartinHvidberg/GNDB
GNDB_exe_GNDB2NamesA.py
Python
gpl-2.0
1,978
/* * ObjManager.cpp * Nuvie * * Created by Eric Fry on Sat Mar 15 2003. * Copyright (c) 2003. All rights reserved. * * This program is free software; you can redistribute it and/or * modify it under the terms of the GNU General Public License * as published by the Free Software Foundation; either version 2 * of the License, or (at your option) any later version. * * This program is distributed in the hope that it will be useful, * but WITHOUT ANY WARRANTY; without even the implied warranty of * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the * GNU General Public License for more details. * * You should have received a copy of the GNU General Public License * along with this program; if not, write to the Free Software * Foundation, Inc., 59 Temple Place - Suite 330, Boston, MA 02111-1307, USA. * */ #include <cassert> #include "nuvieDefs.h" #include "Configuration.h" #include "ActorManager.h" #include "EggManager.h" #include "TileManager.h" #include "ObjManager.h" #include "UseCode.h" #include "U6misc.h" #include "U6objects.h" #include "U6LList.h" #include "NuvieIOFile.h" #include "Game.h" #include "MapWindow.h" #include "Script.h" #include "MsgScroll.h" static const int obj_egg_table[5] = {0, // NUVIE_GAME_NONE 335, // NUVIE_GAME_U6 466, // NUVIE_GAME_MD 0, 230}; // NUVIE_GAME_SE static iAVLKey get_iAVLKey(const void *item) { return ((ObjTreeNode *)item)->key; } ObjManager::ObjManager(Configuration *cfg, TileManager *tm, EggManager *em) { uint8 i; std::string show_eggs_key; config = cfg; tile_manager = tm; egg_manager = em; usecode = NULL; obj_save_count = 0; load_basetile(); load_weight_table(); memset(actor_inventories,0,sizeof(actor_inventories)); for(i=0;i<64;i++) { surface[i] = iAVLAllocTree(get_iAVLKey); } for(i=0;i<5;i++) { dungeon[i] = iAVLAllocTree(get_iAVLKey); } last_obj_blk_x = 0; last_obj_blk_y = 0; last_obj_blk_z = OBJ_TEMP_INIT; config->value("config/GameType",game_type); //save the egg tile_num incase we want to switch egg display on again. egg_tile_num = get_obj_tile_num(obj_egg_table[game_type]); show_eggs_key = config_get_game_key(config); show_eggs_key.append("/show_eggs"); config->value(show_eggs_key, show_eggs); //if(!show_eggs) // show_egg_objs(false); std::string custom_tile_str; config->value(config_get_game_key(config) +"/custom_actor_tiles", custom_tile_str, "default"); if(custom_tile_str == "default") { if(Game::get_game()->is_new_style()) custom_actor_tiles = true; else custom_actor_tiles = false; } else if(custom_tile_str == "yes") custom_actor_tiles = true; else custom_actor_tiles = false; } ObjManager::~ObjManager() { clean(); unsigned int i; for(i=0;i<64;i++) iAVLFreeTree(surface[i], clean_obj_tree_node); for(i=0;i<5;i++) iAVLFreeTree(dungeon[i], clean_obj_tree_node); for(uint16 i=0; i < 256; i++) { if(actor_inventories[i]) { delete actor_inventories[i]; } } } bool ObjManager::load_basetile() { std::string filename; NuvieIOFileRead basetile; uint16 i; config_get_path(config,"basetile",filename); if(basetile.open(filename) == false) return false; for(i=0;i<1024;i++) { obj_to_tile[i] = basetile.read2(); obj_stackable[i] = (uint8)tile_manager->tile_is_stackable(obj_to_tile[i]); } // FIXME: tile_manager's tile_is_stackable is incorrect for (at least) Zu Ylem, silver snake venom. return true; } bool ObjManager::load_weight_table() { std::string filename; NuvieIOFileRead tileflag; config_get_path(config,"tileflag",filename); if(tileflag.open(filename) == false) return false; tileflag.seek(0x1000); tileflag.readToBuf(obj_weight,1024); return true; } bool ObjManager::load_super_chunk(NuvieIO *chunk_buf, uint8 level, uint8 chunk_offset) { NuvieIOFileRead file; U6LList *list; uint16 num_objs; Obj *obj; uint16 i; U6LList *inventory_list; iAVLTree *obj_tree; if(level == 0) obj_tree = surface[chunk_offset]; else obj_tree = dungeon[level - 1]; list = new U6LList(); num_objs = chunk_buf->read2(); //DEBUG(0,LEVEL_DEBUGGING,"chunk %02d number of objects: %d\n", chunk_offset, num_objs); for(i=0;i<num_objs;i++) { obj = loadObj(chunk_buf); list->add(obj); if(obj->obj_n == obj_egg_table[game_type]) { egg_manager->add_egg(obj); // set egg visibility obj->set_invisible(Game::get_game()->are_cheats_enabled() ? !show_eggs : true); } if(usecode->is_container(obj)) //object type is container, but may be empty { obj->make_container(); } if(obj->get_engine_loc() == OBJ_LOC_INV || obj->get_engine_loc() == OBJ_LOC_READIED) //triggered when object in actor's inventory OR equipped { //FIXME need to add to inventory properly!! eg set engine loc. inventory_list = get_actor_inventory(obj->x); inventory_list->add(obj); } else { if(obj->is_in_container()) //object in container { addObjToContainer(list,obj); } else { add_obj(obj); // show remaining objects /* if(show_eggs || obj->obj_n != obj_egg_table[game_type]) // show remaining objects, hiding eggs if neccecary. { add_obj(obj); // print_obj(obj,false); }*/ } } //print_obj(obj,false); } delete list; return true; } bool ObjManager::save_super_chunk(NuvieIO *save_buf, uint8 level, uint8 chunk_offset) { iAVLTree *obj_tree; ObjTreeNode *item; U6Link *link; iAVLCursor node; uint32 start_pos; uint32 finish_pos; uint16 egg_type = obj_egg_table[game_type]; if(level == 0) obj_tree = surface[chunk_offset]; else obj_tree = dungeon[level-1]; item = (ObjTreeNode *)iAVLFirst(&node, obj_tree); start_pos = save_buf->position(); //skip the 2 bytes for number of objects. save_buf->write2(0); // we'll fill this in later on. obj_save_count = 0; for(;item;) { for(link = item->obj_list->end(); link != NULL; link=link->prev) { if(((Obj *)link->data)->obj_n != egg_type) // we don't save eggs here. They are saved in save_eggs() save_obj(save_buf, (Obj *)link->data, obj_save_count); } item = (ObjTreeNode *)iAVLNext(&node); } finish_pos = save_buf->position(); save_buf->seek(start_pos); save_buf->write2(obj_save_count); save_buf->seek(finish_pos); return true; } bool ObjManager::save_eggs(NuvieIO *save_buf) { uint32 start_pos; uint32 finish_pos; std::list<Egg *> *egg_list; std::list<Egg *>::iterator egg; start_pos = save_buf->position(); //skip number of objects we will fill that in at the end. save_buf->write2(0); egg_list = egg_manager->get_egg_list(); obj_save_count = 0; for(egg = egg_list->begin(); egg != egg_list->end();egg++) save_obj(save_buf, (*egg)->obj, obj_save_count); finish_pos = save_buf->position(); save_buf->seek(start_pos); save_buf->write2(obj_save_count); save_buf->seek(finish_pos); DEBUG(0,LEVEL_DEBUGGING,"Eggs: %d\n", obj_save_count); return true; } bool ObjManager::save_inventories(NuvieIO *save_buf) { uint32 start_pos; uint32 finish_pos; U6Link *link; uint16 i; start_pos = save_buf->position(); save_buf->write2(0); obj_save_count = 0; for(i=0;i<256;i++) { if(actor_inventories[i] != NULL) { for(link=actor_inventories[i]->start(); link != NULL; link=link->next) { save_obj(save_buf, (Obj *)link->data, obj_save_count); } } } DEBUG(0,LEVEL_DEBUGGING,"Actor Inventories: %d\n", obj_save_count); finish_pos = save_buf->position(); save_buf->seek(start_pos); save_buf->write2(obj_save_count); save_buf->seek(finish_pos); return true; } bool ObjManager::save_obj(NuvieIO *save_buf, Obj *obj, uint16 parent_objblk_n) { uint8 b; U6Link *link; uint16 objblk_n; if(obj->is_in_container()) //obj is in a container { //obj->in_container(); // in container obj->x = parent_objblk_n & 0x3ff; //save 10bits in x obj->y &= 0xffc0; //clear lower 6 bits obj->y |= (parent_objblk_n >> 10); //save top 6bits } else { if(!obj->is_readied()) { obj->status &= (0xff ^ OBJ_STATUS_IN_CONTAINER); } } if(obj->is_in_inventory(OBJ_DONT_CHECK_PARENT)) obj->x = obj->get_actor_holding_obj()->get_actor_num(); //set original status location bits. obj->status &= OBJ_STATUS_MASK_SET; switch(obj->get_engine_loc()) { case OBJ_LOC_MAP : obj->status |= OBJ_STATUS_ON_MAP; break; case OBJ_LOC_CONT : obj->status |= OBJ_STATUS_IN_CONTAINER; break; case OBJ_LOC_INV : obj->status |= OBJ_STATUS_IN_INVENTORY; break; case OBJ_LOC_READIED : obj->status |= OBJ_STATUS_READIED; break; } save_buf->write1(obj->status); save_buf->write1(obj->x & 0xff); b = obj->x >> 8; b += obj->y << 2; save_buf->write1(b); b = obj->y >> 6; b += obj->z << 4; save_buf->write1(b); save_buf->write1(obj->obj_n & 0xff); b = obj->obj_n >> 8; b += obj->frame_n << 2; save_buf->write1(b); save_buf->write1((uint8)(obj->qty & 0xff)); //only save the lower byte to disk. if(is_stackable(obj)) save_buf->write1(obj->qty >> 8); else save_buf->write1(obj->quality); objblk_n = obj_save_count; obj_save_count += 1; if(obj->container) { for(link = obj->container->end(); link != NULL; link=link->prev) save_obj(save_buf, (Obj *)link->data, objblk_n); } return true; } void ObjManager::clean() { uint8 i; egg_manager->clean(Game::get_game()->are_cheats_enabled() ? show_eggs : false); //show_eggs determines wether we delete the actual Objs from egg manager. for(i=0;i<64;i++) iAVLCleanTree(surface[i], clean_obj_tree_node); for(i=0;i<5;i++) iAVLCleanTree(dungeon[i], clean_obj_tree_node); clean_actor_inventories(); // remove the temporary object list. The objects were deleted from the surface and dungeon trees. temp_obj_list.clear(); for (std::list<Obj *>::iterator it = tile_obj_list.begin(); it != tile_obj_list.end(); ++it) { delete *it; } tile_obj_list.clear(); return; } void ObjManager::clean_actor_inventories() { U6Link *link; uint16 i; for(i=0; i < 256; i++) { if(actor_inventories[i]) { for(link=actor_inventories[i]->start(); link != NULL; ) { Obj *obj = (Obj *)link->data; link=link->next; delete_obj(obj); } actor_inventories[i]->removeAll(); } } return; } /* U6LList *ObjManager::get_obj_superchunk(uint16 x, uint16 y, uint8 level) { uint16 i; if(level == 0) { i = y * 8 + x; return surface[i]; } return dungeon[level-1]; } */ bool ObjManager::is_boundary(uint16 x, uint16 y, uint8 level, uint8 boundary_type, Obj *excluded_obj) { U6Link *link; U6LList *obj_list; Obj *obj; Tile *tile, *tile1; uint16 tile_num; bool check_tile; uint16 i,j; uint16 next_x, next_y; next_x = WRAPPED_COORD(x+1,level); next_y = WRAPPED_COORD(y+1,level); for(j=y;j<=y+1;j++) { for(i=x;i<=x+1;i++) { obj_list = get_obj_list(WRAPPED_COORD(i,level), WRAPPED_COORD(j,level), level); if(obj_list != NULL) { link = obj_list->end(); for(check_tile = false;link != NULL;link = link->prev) { obj = (Obj *)link->data; if(obj == excluded_obj) continue; tile_num = get_obj_tile_num(obj->obj_n)+obj->frame_n; tile = tile_manager->get_original_tile(tile_num); if(obj->x == x && obj->y == y) { check_tile = true; } if(tile->dbl_width && obj->x == next_x && obj->y == y) { tile_num--; check_tile = true; } if(tile->dbl_height && obj->x == x && obj->y == next_y) { tile_num--; check_tile = true; } if(obj->x == next_x && obj->y == next_y && tile->dbl_width && tile->dbl_height) { tile_num -= 2; check_tile = true; } if(check_tile) { tile1 = tile_manager->get_tile(tile_num); if(tile1->flags2 & boundary_type) //either TILEFLAG_BOUNDARY or TILEFLAG_MISSILE_BOUNDARY return true; check_tile = false; } } } } } return false; } /* no longer needed. //FIX this needs to be moved magicnumbers :( bool ObjManager::is_door(Obj * obj) { //for U6 if((obj->obj_n >= 297 && obj->obj_n <= 300) || obj->obj_n == 334 || obj->obj_n == 213) //OBJ_U6_MOUSEHOLE) return true; return false; } */ uint8 ObjManager::is_passable(uint16 x, uint16 y, uint8 level) { U6Link *link; U6LList *obj_list; Obj *obj; Tile *tile, *tile1; uint16 tile_num; bool check_tile; bool object_at_location = false; uint16 i,j; uint16 x2 = WRAPPED_COORD((x+1),level); // wrap on map edge uint16 y2 = WRAPPED_COORD((y+1),level); for(i=x;;i=x2) // only checks x and x2 { for(j=y;;j=y2) // only checks y and y2 { obj_list = get_obj_list(i,j,level); if(i == x && j == y && obj_list) { if(obj_list->end() != NULL) object_at_location = true; } if(obj_list != NULL) { link = obj_list->end(); for(check_tile = false;link != NULL;link = link->prev) { obj = (Obj *)link->data; tile_num = get_obj_tile_num(obj->obj_n)+obj->frame_n; tile = tile_manager->get_original_tile(tile_num); if(obj->x == x && obj->y == y) { check_tile = true; } if(tile->dbl_width && obj->x == x2 && obj->y == y) { tile_num--; check_tile = true; } if(tile->dbl_height && obj->x == x && obj->y == y2) { tile_num--; check_tile = true; } if(obj->x == x2 && obj->y == y2 && tile->dbl_width && tile->dbl_height) { tile_num -= 3; check_tile = true; } if(check_tile) { tile1 = tile_manager->get_original_tile(tile_num); if(tile1->passable == false) return OBJ_NOT_PASSABLE; check_tile = false; } } } if(j == y) j = y2; else break; } if(i == x) i = x2; else break; } if(object_at_location) return OBJ_PASSABLE; return OBJ_NO_OBJ; } bool ObjManager::is_forced_passable(uint16 x, uint16 y, uint8 level) { U6LList *obj_list; U6Link *link; Obj *obj; Tile *tile; obj_list = get_obj_list(x,y,level); if(obj_list) { for(link=obj_list->start();link!=NULL;link=link->next) { obj = (Obj *)link->data; tile = tile_manager->get_tile(get_obj_tile_num(obj->obj_n)+obj->frame_n); if(tile->flags3 & TILEFLAG_FORCED_PASSABLE) return true; } } return false; } bool ObjManager::is_door(uint16 x, uint16 y, uint8 level) { U6LList *obj_list = get_obj_list(x, y, level); U6Link *link; Obj *obj; if (obj_list) { for (link = obj_list->start(); link != NULL; link = link->next) { obj = (Obj *)link->data; if (usecode->is_door(obj)) return true; } } return false; } bool ObjManager::is_damaging(uint16 x, uint16 y, uint8 level) { U6LList *obj_list; U6Link *link; Obj *obj; Tile *tile; obj_list = get_obj_list(x,y,level); if(obj_list) { for(link=obj_list->start();link!=NULL;link=link->next) { obj = (Obj *)link->data; tile = tile_manager->get_original_tile(get_obj_tile_num(obj->obj_n)+obj->frame_n);//get_tile(get_obj_tile_num(obj->obj_n)+obj->frame_n); if(tile->flags1 & TILEFLAG_DAMAGING) return true; } } return false; } bool ObjManager::is_stackable(Obj *obj) { // Tile *tile; if(obj == NULL) return false; if(obj->is_readied()) // readied objects cannot be stacked --SB-X return false; /* tile = tile_manager->get_tile(get_obj_tile_num(obj->obj_n)+obj->frame_n); if(tile_manager->tile_is_stackable(tile->tile_num)) return true; return false; */ if(game_type==NUVIE_GAME_U6) { switch (obj->obj_n) { case OBJ_U6_TORCH: // 0x5A, // torch if(obj->frame_n == 1) { return false; } else { return true; } case OBJ_U6_LOCK_PICK: // 0x3F, // lock pick case OBJ_U6_GEM: // 0x4D, // gem case OBJ_U6_ARROW: // 0x37, // arrow case OBJ_U6_BOLT: // 0x38, // bolt case OBJ_U6_BLACK_PEARL: // 0x41, // black pearl case OBJ_U6_BLOOD_MOSS: // 0x42, // bit of blood moss case OBJ_U6_GARLIC: // 0x43, // bulb of garlic case OBJ_U6_GINSENG: // 0x44, // ginseng root case OBJ_U6_MANDRAKE_ROOT: // 0x45, // mandrake root case OBJ_U6_NIGHTSHADE: // 0x46, // nightshade mushroom case OBJ_U6_SPIDER_SILK: // 0x47, // strand of spidersilk case OBJ_U6_SULFUROUS_ASH: // 0x48, // bit of sulfurous ash case OBJ_U6_EFFECT: // 0x151, // effect case OBJ_U6_BREAD: // 0x80, // loaf of bread case OBJ_U6_MEAT_PORTION: // 0x81, // portion of meat case OBJ_U6_FLASK_OF_OIL: // 0x53, // flask of oil case OBJ_U6_EGG: // 0x14F, // egg case OBJ_U6_GOLD_NUGGET: // 0x59, // gold nugget case OBJ_U6_ZU_YLEM: // 0x5B, // Zu Ylem case OBJ_U6_SNAKE_VENOM: // 0x5C, // silver snake venom case OBJ_U6_GOLD: // 0x58 // Gold coin return true; default: return false; } } if(game_type==NUVIE_GAME_SE) { switch (obj->obj_n) { case OBJ_SE_MAGNESIUM_RIBBON: case OBJ_SE_SPEAR: case OBJ_SE_THROWING_AXE: case OBJ_SE_POISONED_DART: case OBJ_SE_RIFLE_BULLET: case OBJ_SE_KNIFE: case OBJ_SE_ARROW: case OBJ_SE_TURTLE_BAIT: case OBJ_SE_FEATHER: case OBJ_SE_CHOCOLATL: case OBJ_SE_PINDE: case OBJ_SE_YOPO: case OBJ_SE_GOLD: case OBJ_SE_GOLD_NUGGET: case OBJ_SE_DIAMOND: case OBJ_SE_EMERALD: case OBJ_SE_RUBY: case OBJ_SE_CORN_MEAL: case OBJ_SE_TORTILLA: case OBJ_SE_MEAT_103: case OBJ_SE_BERRY: case OBJ_SE_CAKE: case OBJ_SE_CORN: case OBJ_SE_BEAN: case OBJ_SE_MEAT_110: case OBJ_SE_ORCHID: case OBJ_SE_PEPPER: case OBJ_SE_SULFUR: case OBJ_SE_CHARCOAL: case OBJ_SE_POTASSIUM_NITRATE: case OBJ_SE_SOFT_CLAY_POT: case OBJ_SE_FIRED_CLAY_POT: case OBJ_SE_CLOTH_STRIP: case OBJ_SE_GRENADE: case OBJ_SE_TAR: case OBJ_SE_WATER: case OBJ_SE_CLOTH: case OBJ_SE_TARRED_CLOTH_STRIP: case OBJ_SE_CLAY: case OBJ_SE_GUNPOWDER: case OBJ_SE_BRANCH: case OBJ_SE_TORCH: case OBJ_SE_FLAX: case OBJ_SE_RIB_BONE: case OBJ_SE_CHOP: case OBJ_SE_DEVICE: return true; default: return false; } } if(game_type == NUVIE_GAME_MD) { switch (obj->obj_n) { case OBJ_MD_PISTOL_ROUND: case OBJ_MD_SHOTGUN_SHELL: case OBJ_MD_RIFLE_ROUND: case OBJ_MD_ELEPHANT_GUN_ROUND: case OBJ_MD_SLING_STONE: case OBJ_MD_ARROW: case OBJ_MD_CAN_OF_LAMP_OIL: case OBJ_MD_MATCH: case OBJ_MD_TORCH: case OBJ_MD_BLOB_OF_OXIUM: case OBJ_MD_BERRY: case OBJ_MD_BERRY1: case OBJ_MD_BERRY2: case OBJ_MD_BERRY4: case OBJ_MD_CHIP_OF_RADIUM: case OBJ_MD_DOLLAR: case OBJ_MD_RUBLE: case OBJ_MD_WORMSBANE_SEED: case OBJ_MD_PAGE: case OBJ_MD_BERRY3: case OBJ_MD_OXYGENATED_AIR_BOTTLE: return true; default: return false; } } return (bool)obj_stackable[obj->obj_n]; } bool ObjManager::is_breakable(Obj *obj) { if(game_type==NUVIE_GAME_U6) { switch (obj->obj_n) { case OBJ_U6_FLASK_OF_OIL: case OBJ_U6_SNAKE_VENOM: case OBJ_U6_CRYSTAL_BALL: case OBJ_U6_MIRROR: case OBJ_U6_WINE: case OBJ_U6_MEAD: case OBJ_U6_ALE: case OBJ_U6_WINE_GLASS: case OBJ_U6_PLATE: case OBJ_U6_MUG: case OBJ_U6_HONEY_JAR: case OBJ_U6_JAR_OF_HONEY: case OBJ_U6_POTION: case OBJ_U6_WATER_VASE: case OBJ_U6_DRAGON_EGG: return true; default: break; } } else if(game_type==NUVIE_GAME_SE) { switch (obj->obj_n) { case OBJ_SE_MORTAR: case OBJ_SE_GRINDING_STONE: case OBJ_SE_JUG_OF_PLACHTA: case OBJ_SE_BOTTLE_OF_LIQUOR: case OBJ_SE_JAR: case OBJ_SE_FIRED_CLAY_POT: case OBJ_SE_GRENADE: case OBJ_SE_JUG: case OBJ_SE_POT: return true; default: break; } } return false; } bool ObjManager::can_store_obj(Obj *target, Obj *src) { if(target == src || !can_get_obj(src) || target == NULL) return false; if(game_type==NUVIE_GAME_U6) { if(src->obj_n == OBJ_U6_TRAP) return false; if(target->obj_n == OBJ_U6_BAG || target->obj_n == OBJ_U6_BACKPACK || target->obj_n == OBJ_U6_BASKET || (target->obj_n == OBJ_U6_CRATE && target->frame_n == 0) || (target->obj_n == OBJ_U6_BARREL && target->frame_n == 0) || (target->obj_n == OBJ_U6_CHEST && target->frame_n == 0) || (target->obj_n == OBJ_U6_SPELLBOOK && src->obj_n == OBJ_U6_SPELL && !target->find_in_container(OBJ_U6_SPELL, src->quality) && !target->find_in_container(OBJ_U6_SPELL, 255)) // this quality contains all spells || (target->obj_n == OBJ_U6_VORTEX_CUBE && src->obj_n == OBJ_U6_MOONSTONE)) return true; if((target->is_in_inventory() || Game::get_game()->doubleclick_opens_containers()) && ((target->obj_n == OBJ_U6_CHEST && target->frame_n == 1) || target->obj_n == OBJ_U6_DEAD_BODY || target->obj_n == OBJ_U6_MOUSE || target->obj_n == OBJ_U6_REMAINS || target->obj_n == OBJ_U6_DRAKE || target->obj_n == OBJ_U6_MONGBAT)) return true; if(Game::get_game()->doubleclick_opens_containers() && (target->obj_n == OBJ_U6_DESK || target->obj_n == OBJ_U6_DRAWER || target->obj_n == OBJ_U6_GRAVE || target->obj_n == OBJ_U6_REAPER || target->obj_n == OBJ_U6_DEAD_GARGOYLE || target->obj_n == OBJ_U6_DEAD_CYCLOPS)) return true; } else if(game_type==NUVIE_GAME_SE) { if(src->has_container() || usecode->is_container(src)) return false; if(target->obj_n == OBJ_SE_JUG || target->obj_n == OBJ_SE_POUCH || target->obj_n == OBJ_SE_BASKET || target->obj_n == OBJ_SE_POT) return true; if(target->obj_n == OBJ_SE_MORTAR || target->obj_n == OBJ_SE_GRINDING_STONE || target->obj_n == OBJ_SE_JAR) { switch (src->obj_n) { case OBJ_SE_MAGNESIUM_RIBBON: case OBJ_SE_CHOCOLATL: case OBJ_SE_PINDE: case OBJ_SE_YOPO: case OBJ_SE_CORN_MEAL: case OBJ_SE_CORN: case OBJ_SE_SULFUR: case OBJ_SE_CHARCOAL: case OBJ_SE_POTASSIUM_NITRATE: case OBJ_SE_GUNPOWDER: if(target->obj_n == OBJ_SE_JAR) { if(target->container_count_objects() == 0 || // only allow one object target->find_in_container(src->obj_n, src->quality)) return true; else return false; } return true; default: return false; } } } else // MD { if(src->has_container() || usecode->is_container(src)) return false; switch (target->obj_n) { case OBJ_MD_BRASS_CHEST: case OBJ_MD_OBSIDIAN_BOX: case OBJ_MD_WOODEN_CRATE: case OBJ_MD_STEAMER_TRUNK: case OBJ_MD_BARREL: case OBJ_MD_CRATE: case OBJ_MD_BRASS_TRUNK: if(target->frame_n == 0) { return true; } else return false; case OBJ_MD_BACKPACK: case OBJ_MD_LARGE_SACK: case OBJ_MD_SMALL_POUCH: case OBJ_MD_CARPET_BAG: case OBJ_MD_BAG: case OBJ_MD_LEAD_BOX: return true; default: return false; } } return false; } bool ObjManager::can_get_obj(Obj *obj) { // objects with 0 weight aren't gettable. //255 is the max weight and means an object is movable but not getable. //we can't get object that contains toptiles either. This makes dragon bits ungettable etc. // excluding container items here, we just want the object itself to // check if it weighs 0 or 255. no need to scale as we don't compare // with other weights if(obj == NULL) return false; if(Game::get_game()->get_script()->call_can_get_obj_override(obj)) return true; float weight = get_obj_weight(obj, OBJ_WEIGHT_EXCLUDE_CONTAINER_ITEMS,OBJ_WEIGHT_DONT_SCALE, OBJ_WEIGHT_EXCLUDE_QTY); if((weight != 0 && weight != 255 && has_toptile(obj) == false && (!obj->is_on_map() || !Game::get_game()->get_map_window()->tile_is_black(obj->x, obj->y, obj))) || Game::get_game()->using_hackmove()) return true; return false; } bool ObjManager::has_reduced_weight(uint16 obj_n) { // FIXME: HERE BE HARDCODED VALUES! FIXME: not sure if this list is complete! if (game_type==NUVIE_GAME_U6) // luteijn: I only know about U6... { if ( (obj_n == OBJ_U6_GOLD) || (obj_n == OBJ_U6_BLACK_PEARL) // not using range because don't want to depend on underlying magic numbers relations || (obj_n == OBJ_U6_BLOOD_MOSS) || (obj_n == OBJ_U6_GARLIC) || (obj_n == OBJ_U6_GINSENG) || (obj_n == OBJ_U6_MANDRAKE_ROOT) || (obj_n == OBJ_U6_NIGHTSHADE) || (obj_n == OBJ_U6_SPIDER_SILK) || (obj_n == OBJ_U6_SULFUROUS_ASH) ) { return true; } } else if(game_type==NUVIE_GAME_SE) { switch (obj_n) { case OBJ_SE_RIFLE_BULLET: case OBJ_SE_FEATHER: case OBJ_SE_CHOCOLATL: case OBJ_SE_PINDE: case OBJ_SE_YOPO: case OBJ_SE_GOLD: case OBJ_SE_DIAMOND: case OBJ_SE_EMERALD: case OBJ_SE_RUBY: case OBJ_SE_PEPPER: case OBJ_SE_SULFUR: case OBJ_SE_CHARCOAL: case OBJ_SE_POTASSIUM_NITRATE: case OBJ_SE_CLOTH_STRIP: return true; default: return false; } } else if(game_type==NUVIE_GAME_MD) { switch(obj_n) { case OBJ_MD_PISTOL_ROUND: case OBJ_MD_SHOTGUN_SHELL: case OBJ_MD_RIFLE_ROUND: case OBJ_MD_ELEPHANT_GUN_ROUND: case OBJ_MD_SLING_STONE: case OBJ_MD_ARROW: case OBJ_MD_POCKETWATCH: case OBJ_MD_SPECTACLES: case OBJ_MD_MASONIC_SYMBOL: case OBJ_MD_MATCH: case OBJ_MD_BLOB_OF_OXIUM: case OBJ_MD_BERRY: case OBJ_MD_BERRY1: case OBJ_MD_BERRY2: case OBJ_MD_BERRY4: case OBJ_MD_DREAMSTUFF: case OBJ_MD_DOLLAR: case OBJ_MD_RUBLE: return true; default: return false; } } return false; } bool ObjManager::has_toptile(Obj *obj) { Tile *tile; uint8 i = 1; tile = tile_manager->get_tile(get_obj_tile_num(obj->obj_n)+obj->frame_n); if(tile->dbl_width) i++; if(tile->dbl_height) i++; if(tile->dbl_width && tile->dbl_height) i++; for(; i > 0; i--) { if(tile->toptile) return true; if(i != 1) tile = tile_manager->get_tile(tile->tile_num - 1); } return false; } //gets the linked list of objects at a particular location. U6LList *ObjManager::get_obj_list(uint16 x, uint16 y, uint8 level) { iAVLTree *obj_tree; iAVLKey key; ObjTreeNode *item; WRAP_COORD(x,level); // wrap on map edge WRAP_COORD(y,level); obj_tree = get_obj_tree(x,y,level); key = get_obj_tree_key(x,y,level); item = (ObjTreeNode *)iAVLSearch(obj_tree,key); if(item) return item->obj_list; return NULL; } Tile *ObjManager::get_obj_tile(uint16 obj_n, uint8 frame_n) { return tile_manager->get_tile(get_obj_tile_num(obj_n)+frame_n); } Tile *ObjManager::get_obj_tile(uint16 x, uint16 y, uint8 level, bool top_obj) { Obj *obj; Tile *tile; uint16 tile_num; obj = get_obj(x,y,level, top_obj); if(obj == NULL) return NULL; tile_num = get_obj_tile_num(obj->obj_n)+obj->frame_n; tile = tile_manager->get_tile(tile_num); if(tile->dbl_width && obj->x == x+1 && obj->y == y) tile_num--; if(tile->dbl_height && obj->x == x && obj->y == y+1) tile_num--; if(obj->x == x+1 && obj->y == y+1 && tile->dbl_width && tile->dbl_height) tile_num -= 2; return tile_manager->get_original_tile(tile_num); } Tile *ObjManager::get_obj_dmg_tile(uint16 x, uint16 y, uint8 level) { Tile *tile; U6LList *obj_list; U6Link *link; Obj *obj = NULL; obj_list = get_obj_list(x,y,level); if(obj_list != NULL) { for(link=obj_list->end();link != NULL; link=link->prev) { obj = (Obj *)link->data; tile = tile_manager->get_original_tile(get_obj_tile_num(obj->obj_n)+obj->frame_n); if(tile->damages == true) return tile; } } return NULL; } bool ObjManager::obj_is_damaging(Obj *obj, Actor *actor) { if(!obj) return false; Tile *tile = tile_manager->get_original_tile(get_obj_tile_num(obj->obj_n)+obj->frame_n); if(tile && tile->damages == true) { if(actor) { MsgScroll *scroll = Game::get_game()->get_scroll(); scroll->display_string("\n\nNot possible\n"); Game::get_game()->get_script()->call_actor_tile_dmg(actor, tile->tile_num); actor->display_condition(); // indicate that object hurt the player scroll->display_string("\n"); scroll->display_prompt(); } return true; } else return false; } Obj *ObjManager::get_obj(uint16 x, uint16 y, uint8 level, bool top_obj, bool include_ignored_objects, Obj *excluded_obj) { Obj *obj; Tile *tile; obj = get_objBasedAt(x,y,level,top_obj,include_ignored_objects, excluded_obj); if(obj != NULL) return obj; obj = get_objBasedAt(x+1,y+1,level,top_obj,include_ignored_objects, excluded_obj); if(obj != NULL) { tile = tile_manager->get_tile(get_obj_tile_num(obj->obj_n)+obj->frame_n); if(tile->dbl_width && tile->dbl_height) return obj; } obj = get_objBasedAt(x,y+1,level,top_obj,include_ignored_objects, excluded_obj); if(obj != NULL) { tile = tile_manager->get_tile(get_obj_tile_num(obj->obj_n)+obj->frame_n); if(tile->dbl_height) return obj; } obj = get_objBasedAt(x+1,y,level,top_obj,include_ignored_objects, excluded_obj); if(obj != NULL) { tile = tile_manager->get_tile(get_obj_tile_num(obj->obj_n)+obj->frame_n); if(tile->dbl_width) return obj; } return NULL; } Obj *ObjManager::get_obj_of_type_from_location_inc_multi_tile(uint16 obj_n, uint16 x, uint16 y, uint8 z) { return get_obj_of_type_from_location_inc_multi_tile(obj_n, -1, -1, x, y, z); } Obj *ObjManager::get_obj_of_type_from_location_inc_multi_tile(uint16 obj_n, sint16 quality, sint32 qty, uint16 x, uint16 y, uint8 z) { Obj *obj; Tile *tile; obj = get_obj_of_type_from_location(obj_n, quality, qty, x, y, z); if(obj != NULL) return obj; obj = get_obj_of_type_from_location(obj_n, quality, qty, x+1, y+1, z); if(obj != NULL) { tile = tile_manager->get_tile(get_obj_tile_num(obj->obj_n)+obj->frame_n); if(tile->dbl_width && tile->dbl_height) return obj; } obj = get_obj_of_type_from_location(obj_n, quality, qty, x, y+1, z); if(obj != NULL) { tile = tile_manager->get_tile(get_obj_tile_num(obj->obj_n)+obj->frame_n); if(tile->dbl_height) return obj; } obj = get_obj_of_type_from_location(obj_n, quality, qty, x+1, y, z); if(obj != NULL) { tile = tile_manager->get_tile(get_obj_tile_num(obj->obj_n)+obj->frame_n); if(tile->dbl_width) return obj; } return NULL; } Obj *ObjManager::get_obj_of_type_from_location(uint16 obj_n, uint16 x, uint16 y, uint8 z) { return get_obj_of_type_from_location(obj_n, -1, -1, x, y, z); } Obj *ObjManager::get_obj_of_type_from_location(uint16 obj_n, sint16 quality, sint32 qty, uint16 x, uint16 y, uint8 z) { U6LList *obj_list; U6Link *link; Obj *obj; obj_list = get_obj_list(x,y,z); if(obj_list == NULL) return NULL; // start from the top of the stack for(link=obj_list->end();link != NULL; link=link->prev) { obj = (Obj *)link->data; if(obj->obj_n == obj_n) { if(quality != -1 && obj->quality != (uint8)quality) continue; if(qty != -1 && obj->qty != (uint16)qty) continue; return obj; } } return NULL; } // x, y in world coords Obj *ObjManager::get_objBasedAt(uint16 x, uint16 y, uint8 level, bool top_obj, bool include_ignored_objects, Obj *excluded_obj) { U6Link *link; U6LList *obj_list; Obj *obj; obj_list = get_obj_list(x,y,level); if(obj_list != NULL) { if(top_obj) link = obj_list->end(); else link = obj_list->start(); while(link != NULL) { obj = (Obj *)link->data; if(obj != excluded_obj) { if(include_ignored_objects) return obj; Tile *tile = get_obj_tile(obj->obj_n, obj->frame_n); if ((tile->flags3 & TILEFLAG_IGNORE) != TILEFLAG_IGNORE) return obj; } if(top_obj) link = link->prev; else link = link->next; } } return NULL; } // ObjManager keeps one instance of tile_obj per object. // SE has 3 tile objects (Trees, Yucca Plants, and Oven Fires) Obj *ObjManager::get_tile_obj(uint16 obj_n) { for (std::list<Obj *>::iterator it = tile_obj_list.begin(); it != tile_obj_list.end(); ++it) { if ((*it)->obj_n == obj_n) { return *it; } } Obj *obj = new Obj(); obj->obj_n = obj_n; obj->set_on_map(NULL); tile_obj_list.push_back(obj); return obj; } /* bool ObjManager::add_obj(Obj *obj, bool addOnTop) { return add_obj(get_obj_tree(obj->x,obj->y,obj->z), obj, addOnTop); } */ bool ObjManager::remove_obj_from_map(Obj *obj) { U6LList *obj_list; if(obj->get_engine_loc() != OBJ_LOC_MAP) return false; obj_list = (U6LList *)obj->parent; if(obj_list == NULL) return false; obj_list->remove(obj); remove_obj(obj); return true; } void ObjManager::remove_obj(Obj *obj) { if(obj->status & OBJ_STATUS_TEMPORARY) temp_obj_list_remove(obj); if(obj->obj_n == obj_egg_table[game_type]) { egg_manager->remove_egg(obj); } obj->set_noloc(); return; } // remove all objects of type obj_n from location (x,y,z) bool ObjManager::remove_obj_type_from_location(uint16 obj_n, uint16 x, uint16 y, uint8 z) { U6LList *obj_list; U6Link *link; Obj *obj; bool objects_deleted = false; obj_list = get_obj_list(x,y,z); if(obj_list != NULL) { for(link=obj_list->start();link != NULL; ) { obj = (Obj *)link->data; link=link->next; if(obj->obj_n == obj_n) { remove_obj_from_map(obj); delete_obj(obj); objects_deleted = true; } } } return objects_deleted; } Obj *ObjManager::copy_obj(Obj *obj) { Obj *new_obj; if(obj == NULL) return NULL; new_obj = new Obj(*obj); /* changed to direct copy in case we add new members to Obj --SB-X new_obj->obj_n = obj->obj_n; new_obj->frame_n = obj->frame_n; new_obj->status = obj->status; new_obj->qty = obj->qty; new_obj->quality = obj->quality; new_obj->x = obj->x; new_obj->y = obj->y; new_obj->z = obj->z;*/ // should we copy container??? new_obj->container = 0; return new_obj; } bool ObjManager::move(Obj *obj, uint16 x, uint16 y, uint8 level) { if(remove_obj_from_map(obj) == false) return false; obj->x = x; obj->y = y; obj->z = level; add_obj(obj,true); // add the object on top of the stack return true; } /* Returns an objects look-string, its general description. */ const char *ObjManager::look_obj(Obj *obj, bool show_prefix) { const char *desc; if(obj == NULL) return NULL; desc = tile_manager->lookAtTile(get_obj_tile_num(obj)+obj->frame_n,obj->qty,show_prefix); return desc; } const char *ObjManager::get_obj_name(Obj *obj) { return tile_manager->lookAtTile(get_obj_tile_num(obj->obj_n),0,false); } const char *ObjManager::get_obj_name(uint16 obj_n) { return tile_manager->lookAtTile(get_obj_tile_num(obj_n),0,false); } const char *ObjManager::get_obj_name(uint16 obj_n, uint8 frame_n) { return tile_manager->lookAtTile(get_obj_tile_num(obj_n)+frame_n,0,false); } float ObjManager::get_obj_weight(uint16 obj_n) { float weight = (float)get_obj_weight_unscaled(obj_n); if(has_reduced_weight(obj_n)) { weight /= 10; } return weight / 10; } float ObjManager::get_obj_weight(Obj *obj, bool include_container_items, bool scale, bool include_qty) { float weight; U6Link *link; weight = obj_weight[obj->obj_n]; if(is_stackable(obj)) { if(include_qty) { if(obj->qty == 0) obj->qty = 1; weight *= obj->qty; } /* luteijn: only some need to be divided by an extra 10 for a total of 100. * unfortunately can't seem to find a tileflag that controls this so would have to be hardcoded! */ if (has_reduced_weight(obj)) { weight /= 10; // luteijn: regardless of the scaling flag! } } if(obj->container != NULL && include_container_items == OBJ_WEIGHT_INCLUDE_CONTAINER_ITEMS) { for(link=obj->container->start();link != NULL;link=link->next) /* weight += get_obj_weight(reinterpret_cast<Obj*>(link->data), false);*/ //don't scale container objects yet. weight += get_obj_weight(reinterpret_cast<Obj*>(link->data), OBJ_WEIGHT_INCLUDE_CONTAINER_ITEMS, OBJ_WEIGHT_DONT_SCALE); //don't scale container objects yet. luteijn: and use the right flag to do so! } if(scale == OBJ_WEIGHT_DO_SCALE) { weight /= 10; } return weight; } uint16 ObjManager::get_obj_tile_num(uint16 obj_num) //assume obj_num is < 1024 :) { return obj_to_tile[obj_num]; } inline bool ObjManager::is_corpse(Obj *obj) { if(game_type == NUVIE_GAME_U6) { switch(obj->obj_n) { case OBJ_U6_DEAD_BODY: case OBJ_U6_DEAD_CYCLOPS: case OBJ_U6_DEAD_GARGOYLE: case OBJ_U6_DOG: // Kador id_n 135 case OBJ_U6_MOUSE: // Sherry id_n 9 case OBJ_U6_HORSE_CARCASS: // Pushme Pullyu id 130, Smith id 132 return true; default: break; } } else if(game_type == NUVIE_GAME_SE) { switch(obj->obj_n) { // TODO - add SE body obj numbers default: break; } } else { // MD switch(obj->obj_n) { // TODO - add MD body obj numbers default: break; } } return false; } uint16 ObjManager::get_obj_tile_num(Obj *obj) //assume obj_num is < 1024 :) { if(custom_actor_tiles && is_corpse(obj)) { return Game::get_game()->get_actor_manager()->get_actor(obj->quality)->get_custom_tile_num(obj->obj_n); } uint16 obj_num = obj->obj_n; // Savage Empire Tile Object (Get Tile from Map Location) if (game_type == NUVIE_GAME_SE && Game::get_game()->get_script()->call_is_tile_object(obj_num)) { return(Game::get_game()->get_game_map()->get_tile(obj->x, obj->y, obj->z)->tile_num); } return get_obj_tile_num(obj_num); } void ObjManager::set_obj_tile_num(uint16 obj_num, uint16 tile_num) { obj_to_tile[obj_num] = tile_num; return; } /* Animate all visible tiles of an object `loop_count' times. */ void ObjManager::animate_forwards(Obj *obj, uint32 loop_count) { // In U6 there is no place where one object must animate and nearby objects // of the same type don't also animate, so just forward to TileManager. tile_manager->set_anim_loop(get_obj_tile_num(obj->obj_n), loop_count, 0); } /* Animate in reverse all visible tiles of an object `loop_count' times. */ void ObjManager::animate_backwards(Obj *obj, uint32 loop_count) { tile_manager->set_anim_loop(get_obj_tile_num(obj->obj_n), loop_count, 1); } U6LList *ObjManager::get_actor_inventory(uint16 actor_num) { if(actor_num >= 256) return NULL; if(actor_inventories[actor_num] == NULL) { actor_inventories[actor_num] = new U6LList(); } return actor_inventories[actor_num]; } bool ObjManager::actor_has_inventory(uint16 actor_num) { if(actor_inventories[actor_num] != NULL) { if(actor_inventories[actor_num]->start() != NULL) return true; } return false; } Obj *ObjManager::find_next_obj(uint8 level, Obj *prev_obj, bool match_frame_n, bool match_quality) { if(prev_obj == NULL) return NULL; Obj **p = &prev_obj; return find_obj(level, prev_obj->obj_n, prev_obj->quality, match_quality, prev_obj->frame_n, match_frame_n, p); } Obj *ObjManager::find_obj(uint8 level, uint16 obj_n, uint8 quality, bool match_quality, uint16 frame_n, bool match_frame_n, Obj **prev_obj) { uint8 i; Obj *new_obj; if(level == 0) { for(i=0;i<64;i++) { new_obj = find_obj_in_tree(obj_n, quality, match_quality, frame_n, match_frame_n, prev_obj, surface[i]); if(new_obj != NULL) return new_obj; } } else { new_obj = find_obj_in_tree(obj_n, quality, match_quality, frame_n, match_frame_n, prev_obj, dungeon[level-1]); if(new_obj != NULL) return new_obj; } return NULL; } inline Obj *ObjManager::find_obj_in_tree(uint16 obj_n, uint8 quality, bool match_quality, uint8 frame_n, bool match_frame_n, Obj **prev_obj, iAVLTree *obj_tree) { iAVLCursor cursor; ObjTreeNode *node; U6Link *link; Obj *new_obj; node = (ObjTreeNode *)iAVLFirst(&cursor,obj_tree); for(;node != NULL;) { link = ((U6LList *)(node->obj_list))->start(); for(;link != NULL;link=link->next) { new_obj = (Obj *)link->data; if( new_obj->obj_n == obj_n && (match_quality == false || new_obj->quality == quality) && (match_frame_n == false || new_obj->frame_n == frame_n)) { if(prev_obj != NULL && new_obj == *prev_obj) *prev_obj = NULL; else { if(prev_obj == NULL || *prev_obj == NULL) return new_obj; } } /* Don't search containers. if(prev_obj == NULL) { new_obj = new_obj->find_in_container(obj_n, quality, match_quality, frame_n, match_frame_n, prev_obj); if(new_obj) return new_obj; } */ } node = (ObjTreeNode *)iAVLNext(&cursor); } return NULL; } bool ObjManager::add_obj(Obj *obj, bool addOnTop) { iAVLTree *obj_tree; ObjTreeNode *node; U6LList *obj_list; iAVLKey key; obj_tree = get_obj_tree(obj->x, obj->y, obj->z); key = get_obj_tree_key(obj); node = (ObjTreeNode *)iAVLSearch(obj_tree,key); if(node == NULL) { obj_list = new U6LList(); node = new ObjTreeNode; node->key = key; node->obj_list = obj_list; iAVLInsert(obj_tree, node); } else { obj_list = node->obj_list; } if(addOnTop) obj_list->add(obj); else obj_list->addAtPos(0,obj); if(obj->status & OBJ_STATUS_TEMPORARY) temp_obj_list_add(obj); obj->set_on_map(obj_list); //mark object as on map. return true; } bool ObjManager::addObjToContainer(U6LList *llist, Obj *obj) { U6Link *link; Obj *c_obj = NULL; //container object uint16 index; index = ((obj->y & 0x3f) << 10) + obj->x; //10 bits from x and 6 bits from y link = llist->gotoPos(index); if(link != NULL) c_obj = (Obj *)link->data; if(c_obj) // we've found our container. { c_obj->add(obj); //DEBUG(0,LEVEL_DEBUGGING,"Cont: %s\n", tile_manager->lookAtTile(get_obj_tile_num(c_obj->obj_n)+c_obj->frame_n,0,false)); //DEBUG(0,LEVEL_DEBUGGING,"Add to container %s", tile_manager->lookAtTile(get_obj_tile_num(obj->obj_n)+obj->frame_n,0,false)); //DEBUG(1,LEVEL_DEBUGGING," -> %s (%x,%x,%x)\n", tile_manager->lookAtTile(get_obj_tile_num(c_obj->obj_n)+c_obj->frame_n,0,false),c_obj->x,c_obj->y,c_obj->z); return true; } return false; } Obj *ObjManager::loadObj(NuvieIO *buf) { uint8 b1,b2; Obj *obj; obj = new Obj(); //obj->objblk_n = objblk_n; obj->status = buf->read1(); //set new nuvie location bits. switch(obj->status & OBJ_STATUS_MASK_GET) { case OBJ_STATUS_ON_MAP : obj->set_on_map(NULL); break;//obj->nuvie_status |= OBJ_LOC_MAP; break; case OBJ_STATUS_IN_CONTAINER : obj->set_in_container(NULL); break;//obj->nuvie_status |= OBJ_LOC_CONT; break; case OBJ_STATUS_IN_INVENTORY : obj->set_in_inventory(); break;//obj->nuvie_status |= OBJ_LOC_INV; break; case OBJ_STATUS_READIED : obj->readied(); break;//obj->nuvie_status |= OBJ_LOC_READIED; break; } obj->x = buf->read1(); // h b1 = buf->read1(); obj->x += (b1 & 0x3) << 8; obj->y = (b1 & 0xfc) >> 2; b2 = buf->read1(); obj->y += (b2 & 0xf) << 6; obj->z = (b2 & 0xf0) >> 4; b1 = buf->read1(); b2 = buf->read1(); obj->obj_n = b1; obj->obj_n += (b2 & 0x3) << 8; obj->frame_n = (b2 & 0xfc) >> 2; obj->qty = buf->read1(); obj->quality = buf->read1(); if(is_stackable(obj)) obj->qty = (uint16)(obj->quality << 8) + obj->qty; //if(obj->qty == 0) // obj->qty = 1; return obj; } iAVLTree *ObjManager::get_obj_tree(uint16 x, uint16 y, uint8 level) { if(level == 0) { x >>= 7; // x = floor(x / 128) 128 = superchunk width y >>= 7; // y = floor(y / 128) 128 = superchunk height return surface[x + y * 8]; } if(level > 5) return NULL; return dungeon[level-1]; } inline iAVLKey ObjManager::get_obj_tree_key(Obj *obj) { return get_obj_tree_key(obj->x, obj->y, obj->z); } iAVLKey ObjManager::get_obj_tree_key(uint16 x, uint16 y, uint8 level) { if(level == 0) return y * 1024 + x; else return y * 256 + x; } void ObjManager::update(uint16 x, uint16 y, uint8 z, bool teleport) { uint16 cur_blk_x, cur_blk_y; cur_blk_x = x >> 3; // x / 8; cur_blk_y = y >> 3; // y / 8; // We're changing levels so clean out all temp objects on the current level. if(last_obj_blk_z != z) { if(last_obj_blk_z != OBJ_TEMP_INIT) temp_obj_list_clean_level(last_obj_blk_z); egg_manager->spawn_eggs(x, y, z, teleport); last_obj_blk_x = cur_blk_x; last_obj_blk_y = cur_blk_y; last_obj_blk_z = z; return; } //FIX for level change. we want to remove all temps on level change. if(cur_blk_x != last_obj_blk_x || cur_blk_y != last_obj_blk_y) { last_obj_blk_x = cur_blk_x; last_obj_blk_y = cur_blk_y; temp_obj_list_clean_area(x, y); egg_manager->spawn_eggs(x, y, z, teleport); } return; } bool ObjManager::temp_obj_list_add(Obj *obj) { if(obj == NULL) return false; temp_obj_list.push_back(obj); return true; } bool ObjManager::temp_obj_list_remove(Obj *obj) { temp_obj_list.remove(obj); return true; } void ObjManager::remove_temp_obj(Obj *tmp_obj) { //FIXME MD has special temp object flag override logic. This should be implemented in lua script. if(game_type != NUVIE_GAME_MD || (tmp_obj->obj_n != OBJ_MD_DREAM_TELEPORTER && tmp_obj->frame_n != 0)) { DEBUG(0, LEVEL_DEBUGGING, "Removing obj %s.\n", tile_manager->lookAtTile(get_obj_tile_num((tmp_obj)->obj_n) + (tmp_obj)->frame_n, 0, false)); remove_obj_from_map(tmp_obj); delete_obj(tmp_obj); } } // clean objects from a whole level. void ObjManager::temp_obj_list_clean_level(uint8 z) { std::list<Obj *>::iterator obj; Obj *tmp_obj; for(obj = temp_obj_list.begin(); obj != temp_obj_list.end();) { if((*obj)->z == z) { tmp_obj = *obj++; remove_temp_obj(tmp_obj); } else obj++; } return; } // Clean objects more than 19 tiles from position void ObjManager::temp_obj_list_clean_area(uint16 x, uint16 y) { std::list<Obj *>::iterator obj; Obj *tmp_obj; sint16 dist_x, dist_y; for(obj = temp_obj_list.begin(); obj != temp_obj_list.end();) { dist_x = abs((sint16)(*obj)->x - x); dist_y = abs((sint16)(*obj)->y - y); if(dist_x > 19 || dist_y > 19) { tmp_obj = *obj++; remove_temp_obj(tmp_obj); } else obj++; } return; } /* inline U6LList *ObjManager::get_schunk_list(uint16 x, uint16 y, uint8 level) { uint16 sx, sy; if(level == 0) { sx = x / 128; sy = y / 128; return surface[sy * 8 + sx]; } return dungeon[level-1]; } */ //prints a human readable list of object number / names. void ObjManager::print_object_list() { uint16 i; DEBUG(0,LEVEL_INFORMATIONAL,"print_object_list:\n"); for(i=0;i<1024;i++) { DEBUG(1,LEVEL_INFORMATIONAL,"%04d: %s\n",i,tile_manager->lookAtTile(get_obj_tile_num(i),0,false)); } return; } void ObjManager::print_egg_list() { uint8 i; for(i=0;i < 64;i++) print_egg_tree(surface[i]); for(i=0;i < 5;i++) print_egg_tree(dungeon[i]); return; } inline void ObjManager::print_egg_tree(iAVLTree *obj_tree) { ObjTreeNode *tree_node; iAVLCursor cursor; U6LList *obj_list; U6Link *link; Obj *obj; tree_node = (ObjTreeNode *)iAVLFirst(&cursor,obj_tree); for(;tree_node != NULL;tree_node = (ObjTreeNode *)iAVLNext(&cursor) ) { obj_list = (U6LList *)tree_node->obj_list; for(link = obj_list->start(); link != NULL; link = link->next) { obj = (Obj *)link->data; if(obj->obj_n == 335) { print_obj(obj,false); } } } return; } void ObjManager::print_obj(Obj *obj, bool in_container, uint8 indent) { U6Link *link; Obj *container_obj; const CombatType *c_type=NULL; Actor *a = Game::get_game()->get_player()->get_actor(); if(a != NULL) c_type = a->get_object_combat_type(obj->obj_n); DEBUG(1,LEVEL_INFORMATIONAL,"\n"); print_indent(LEVEL_INFORMATIONAL,indent); DEBUG(1,LEVEL_INFORMATIONAL,"%s ",tile_manager->lookAtTile(get_obj_tile_num(obj->obj_n)+obj->frame_n,0,false)); if(in_container == false) DEBUG(1,LEVEL_INFORMATIONAL,"at %x, %x, %x (%d,%d,%d)",obj->x, obj->y, obj->z, obj->x, obj->y, obj->z); DEBUG(1,LEVEL_INFORMATIONAL,"\n"); print_indent(LEVEL_INFORMATIONAL,indent); DEBUG(1,LEVEL_INFORMATIONAL,"object (Obj *) %p\n", obj); print_indent(LEVEL_INFORMATIONAL,indent); DEBUG(1,LEVEL_INFORMATIONAL,"engine loc: "); switch(obj->get_engine_loc()) { case OBJ_LOC_MAP : DEBUG(1,LEVEL_INFORMATIONAL,"MAP"); break; case OBJ_LOC_CONT : DEBUG(1,LEVEL_INFORMATIONAL,"CONTAINER"); break; case OBJ_LOC_INV : DEBUG(1,LEVEL_INFORMATIONAL,"INVENTORY"); break; case OBJ_LOC_READIED : DEBUG(1,LEVEL_INFORMATIONAL,"INVENTORY READIED"); break; case OBJ_LOC_NONE : DEBUG(1,LEVEL_INFORMATIONAL,"NONE"); break; default : DEBUG(1,LEVEL_INFORMATIONAL,"**UNKNOWN**"); break; } if(obj->is_actor_obj()) DEBUG(1,LEVEL_INFORMATIONAL," (ACTOR_OBJ)"); DEBUG(1,LEVEL_INFORMATIONAL,"\n"); DEBUG(1,LEVEL_INFORMATIONAL,"parent ("); switch(obj->get_engine_loc()) { case OBJ_LOC_MAP : DEBUG(1,LEVEL_INFORMATIONAL,"U6LList"); break; case OBJ_LOC_CONT : DEBUG(1,LEVEL_INFORMATIONAL,"Obj"); break; case OBJ_LOC_INV : case OBJ_LOC_READIED : DEBUG(1,LEVEL_INFORMATIONAL,"Actor"); break; default : DEBUG(1,LEVEL_INFORMATIONAL,"void"); break; } DEBUG(1,LEVEL_INFORMATIONAL," *) %p\n", obj->parent); print_indent(LEVEL_INFORMATIONAL,indent); // DEBUG(1,LEVEL_DEBUGGING,"objblk_n: %d\n", obj->objblk_n); print_indent(LEVEL_INFORMATIONAL,indent); DEBUG(1,LEVEL_INFORMATIONAL,"obj_n: %d\n",obj->obj_n); print_indent(LEVEL_INFORMATIONAL,indent); DEBUG(1,LEVEL_INFORMATIONAL,"frame_n: %d\n",obj->frame_n); print_indent(LEVEL_INFORMATIONAL,indent); DEBUG(1,LEVEL_INFORMATIONAL,"Tile: %d\n", get_obj_tile_num(obj->obj_n)); print_indent(LEVEL_INFORMATIONAL,indent); DEBUG(1,LEVEL_INFORMATIONAL,"Status: "); print_b(LEVEL_INFORMATIONAL,obj->status); if(obj->status != 0) { DEBUG(1,LEVEL_INFORMATIONAL," ( "); if(obj->is_readied()) DEBUG(1,LEVEL_INFORMATIONAL,"POS:Ready "); else if(obj->is_in_container()) DEBUG(1,LEVEL_INFORMATIONAL,"POS:Cont "); else if(obj->is_in_inventory()) DEBUG(1,LEVEL_INFORMATIONAL,"POS:Inv "); if(obj->is_ok_to_take()) DEBUG(1,LEVEL_INFORMATIONAL,"OK "); if(obj->is_temporary()) DEBUG(1,LEVEL_INFORMATIONAL,"TEMP "); if(obj->is_invisible()) DEBUG(1,LEVEL_INFORMATIONAL,"INVIS "); if(obj->is_egg_active()) { if(obj->obj_n < 256) DEBUG(1,LEVEL_INFORMATIONAL,"MUTANT "); else DEBUG(1,LEVEL_INFORMATIONAL,"BROKEN "); } DEBUG(1,LEVEL_INFORMATIONAL,")"); } DEBUG(1,LEVEL_INFORMATIONAL,"\n"); if(in_container) { print_indent(LEVEL_INFORMATIONAL,indent); DEBUG(1,LEVEL_INFORMATIONAL,"parent_id = %d, y = %d, z = %d\n", obj->x, obj->y, obj->z); } print_indent(LEVEL_INFORMATIONAL,indent); DEBUG(1,LEVEL_INFORMATIONAL,"Quantity: %d\n",obj->qty); print_indent(LEVEL_INFORMATIONAL,indent); DEBUG(1,LEVEL_INFORMATIONAL,"Quality: %d\n",obj->quality); if(c_type!=NULL) { DEBUG(1,LEVEL_INFORMATIONAL,"attack/damage = %d, defence/defense = %d\n", c_type->damage, c_type->defense); // FIXME add the rest of the combat values } if(obj->container) { print_indent(LEVEL_INFORMATIONAL,indent); DEBUG(1,LEVEL_INFORMATIONAL,"Container\n"); print_indent(LEVEL_INFORMATIONAL,indent); DEBUG(1,LEVEL_INFORMATIONAL,"---------"); for(link = obj->container->start(); link != NULL; link = link->next) { container_obj = (Obj *)link->data; print_obj(container_obj, true, indent + 2); } print_indent(LEVEL_INFORMATIONAL,indent); DEBUG(1,LEVEL_INFORMATIONAL,"---------\n"); } if(in_container == false) DEBUG(1,LEVEL_INFORMATIONAL,"\n"); return; } Obj *new_obj(uint16 obj_n, uint8 frame_n, uint16 x, uint16 y, uint16 z) { Obj *obj; obj = new Obj(); obj->obj_n = obj_n; obj->frame_n = frame_n; obj->x = x; obj->y = y; obj->z = z; return obj; } void delete_obj(Obj *obj) { U6Link *link; if(obj->is_script_obj() == false) { if(obj->container) { for(link=obj->container->start();link != NULL; ) { Obj *cont_obj = (Obj *)link->data; link=link->next; delete_obj(cont_obj); } } if(obj->container) delete obj->container; delete obj; } return; } // add object to list, stacking with existing objects if possible // This is used for adding objects to inventory OR a container. // *It will stack onto the new object and delete the existing object!* //FIXME!!!!! We need to set on_map() etc if going to the map. bool ObjManager::list_add_obj(U6LList *llist, Obj *obj, bool stack_objects, uint32 pos) { Obj *stack_with; uint16 new_qty; U6Link *link; if(!llist || !obj) return false; assert(pos == 0 || pos < llist->count()); if(stack_objects && is_stackable(obj)) { for(link=llist->start();link != NULL; ) { stack_with = (Obj *)link->data; link = link->next; if(stack_with->obj_n == obj->obj_n && stack_with->frame_n == obj->frame_n && stack_with->quality == obj->quality && is_stackable(stack_with)) { new_qty = obj->qty + stack_with->qty; obj->qty = new_qty; llist->addAtPos(llist->findPos(stack_with), obj); llist->remove(stack_with); delete_obj(stack_with); return true; } } } llist->addAtPos(pos,obj); return true; } /* Call load usecode for all objects (after loading them). This should be in * loadObj() but that was crashing when usecode tried to use timers. */ void ObjManager::startObjs() { uint8 i; //iterate through surface chunks. for(i = 0;i < 64; i++) start_obj_usecode(surface[i]); //iterate through dungeon chunks. for(i=0;i < 5;i++) start_obj_usecode(dungeon[i]); } inline void ObjManager::start_obj_usecode(iAVLTree *obj_tree) { ObjTreeNode *tree_node; iAVLCursor cursor; U6LList *obj_list; U6Link *link; Obj *obj; tree_node = (ObjTreeNode *)iAVLFirst(&cursor,obj_tree); for(;tree_node != NULL;tree_node = (ObjTreeNode *)iAVLNext(&cursor) ) { obj_list = (U6LList *)tree_node->obj_list; for(link = obj_list->start(); link != NULL; link = link->next) { obj = (Obj *)link->data; if(usecode->has_loadcode(obj)) usecode->load_obj(obj); } } } /* Subtract an object stack with quantity set to `count' from original object * stack `obj'. * Returns a new object if a stack could be subtracted from the original, * leaving the original intact. * Returns the original if its quantity was smaller than the requested count or * it is not stackable. */ Obj *ObjManager::get_obj_from_stack(Obj *obj, uint32 count) { if(count == 0 || obj->qty <= count || !is_stackable(obj)) return(obj); // requested is over 0, original quantity is greater than requested, object // is stackable Obj *new_obj = copy_obj(obj); new_obj->qty = count; obj->qty -= count; // remove requested from original return(new_obj); } void clean_obj_tree_node(void *node) { U6Link *link; ObjTreeNode *obj_node = (ObjTreeNode *)node; for(link=obj_node->obj_list->start();link != NULL; ) { Obj *obj = (Obj *)link->data; link=link->next; delete_obj(obj); } delete obj_node->obj_list; delete obj_node; return; } bool ObjManager::unlink_from_engine(Obj *obj, bool run_usecode) { Actor *a; Obj *cont_obj; switch(obj->get_engine_loc()) { case OBJ_LOC_NONE : break; case OBJ_LOC_MAP : remove_obj_from_map(obj); break; // inventory_remove_obj unreadies case OBJ_LOC_READIED :/* a = (Actor *)obj->parent; a->remove_readied_object(obj, run_usecode); a->inventory_remove_obj(obj, run_usecode); break; */ case OBJ_LOC_INV : a = (Actor *)obj->parent; a->inventory_remove_obj(obj, run_usecode); break; case OBJ_LOC_CONT : cont_obj = obj->get_container_obj(); if(cont_obj) cont_obj->remove(obj); //remove from parent container. break; break; } return true; } bool ObjManager::moveto_map(Obj *obj, MapCoord location) { unlink_from_engine(obj); obj->x = location.x; obj->y = location.y; obj->z = location.z; add_obj(obj, OBJ_ADD_TOP); return true; } bool ObjManager::moveto_inventory(Obj *obj, uint16 actor_num) { ActorManager *am = Game::get_game()->get_actor_manager(); if(!am) return false; return moveto_inventory(obj, am->get_actor(actor_num)); } bool ObjManager::moveto_inventory(Obj *obj, Actor *actor) { unlink_from_engine(obj); actor->inventory_add_object(obj); return true; } bool ObjManager::moveto_container(Obj *obj, Obj *container_obj, bool stack) { if(obj == container_obj) return false; unlink_from_engine(obj); container_obj->add(obj, stack); if(game_type == NUVIE_GAME_SE) { if(container_obj->obj_n == OBJ_SE_JAR) { // frame changes depending on contents switch (obj->obj_n) { case OBJ_SE_CORN_MEAL: case OBJ_SE_CORN: case OBJ_SE_SULFUR: container_obj->frame_n = 1; // yellow jar break; case OBJ_SE_MAGNESIUM_RIBBON: case OBJ_SE_POTASSIUM_NITRATE: container_obj->frame_n = 2; // white jar break; default: container_obj->frame_n = 3; // black jar break; } } } return true; }
nuvie/nuvie
ObjManager.cpp
C++
gpl-2.0
58,257
<?php /** * File containing the TestInitDbCommand class. * * @copyright Copyright (C) 2013 eZ Systems AS. All rights reserved. * @license http://www.gnu.org/licenses/gpl-2.0.txt GNU General Public License v2 * @version //autogentag// */ namespace eZ\Bundle\EzPublishCoreBundle\Command; use Symfony\Bundle\FrameworkBundle\Command\ContainerAwareCommand; use Symfony\Component\Console\Input\InputInterface; use Symfony\Component\Console\Output\OutputInterface; class TestInitDbCommand extends ContainerAwareCommand { protected function configure() { $this ->setName( 'ezpublish:test:init_db' ) ->setDescription( 'Inits the configured database for test use based on existing fixtures for eZ Demo install (4.7 atm)' ) ->setHelp( <<<EOT The command <info>%command.name%</info> initializes current configured database with existing fixture data. WARNING: This command will delete all data in the configured database before filling it with fixture data. EOT ); } protected function execute( InputInterface $input, OutputInterface $output ) { $database = $this->getContainer()->get( 'ezpublish.config.resolver' )->getParameter( 'database.params' ); if ( is_array( $database ) ) { $dbType = $database['type']; $database = $database['database']; } else { $dbType = preg_replace( '(^([a-z]+).*)', '\\1', $database ); } if ( $input->isInteractive() && !$this->getHelperSet()->get( 'dialog' )->askConfirmation( $output, "<question>Are you sure you want to delete all data in '{$database}' database?</question>", false ) ) { return; } $output->writeln( "<info>Database is now being emptied and re filled with fixture data.</info>" ); // @TODO Reuse API Integration tests SetupFactory when it has been refactored to be able to use Symfony DIC $this->applyStatements( $this->getSchemaStatements( $dbType ) ); $this->insertData( $dbType ); } /** * Insert the database data * * @param string $dbType Name of Database type (mysql, sqlite, pgsql, ..) * @return void */ public function insertData( $dbType ) { // Get Initial fixture data and union with some tables that must be present but sometimes aren't $data = $this->getInitialData() + array( 'ezcontentobject_trash' => array(), 'ezurlwildcard' => array(), 'ezmedia' => array(), 'ezkeyword' => array() ); $handler = $this->getDatabaseHandler(); foreach ( $data as $table => $rows ) { // Cleanup before inserting $deleteQuery = $handler->createDeleteQuery(); $deleteQuery->deleteFrom( $handler->quoteIdentifier( $table ) ); $stmt = $deleteQuery->prepare(); $stmt->execute(); // Check that at least one row exists if ( !isset( $rows[0] ) ) { continue; } $q = $handler->createInsertQuery(); $q->insertInto( $handler->quoteIdentifier( $table ) ); // Contains the bound parameters $values = array(); // Binding the parameters foreach ( $rows[0] as $col => $val ) { $q->set( $handler->quoteIdentifier( $col ), $q->bindParam( $values[$col] ) ); } $stmt = $q->prepare(); foreach ( $rows as $row ) { try { // This CANNOT be replaced by: // $values = $row // each $values[$col] is a PHP reference which should be // kept for parameters binding to work foreach ( $row as $col => $val ) { $values[$col] = $val; } $stmt->execute(); } catch ( Exception $e ) { echo "$table ( ", implode( ', ', $row ), " )\n"; throw $e; } } } $this->applyStatements( $this->getPostInsertStatements( $dbType ) ); } /** * Returns statements to be executed after data insert * * @param string $dbType Name of Database type (mysql, sqlite, pgsql, ..) * @return string[] */ protected function getPostInsertStatements( $dbType ) { if ( $dbType === 'pgsql' ) { $setvalPath = __DIR__ . '/../../../Publish/Core/Persistence/Legacy/Tests/_fixtures/setval.pgsql.sql'; return array_filter( preg_split( '(;\\s*$)m', file_get_contents( $setvalPath ) ) ); } return array(); } /** * Returns the initial database data * * @return array */ protected function getInitialData() { return include __DIR__ . "/../../../../data/demo_data.php"; } /** * Applies the given SQL $statements to the database in use * * @param array $statements * * @return void */ protected function applyStatements( array $statements ) { $handler = $this->getDatabaseHandler(); foreach ( $statements as $statement ) { $handler->exec( $statement ); } } /** * Returns the database schema as an array of SQL statements * * @param string $dbType Name of Database type (mysql, sqlite, pgsql, ..) * @return string[] */ protected function getSchemaStatements( $dbType ) { $schemaPath = __DIR__ . "/../../../../data/{$dbType}/schema.sql"; return array_filter( preg_split( '(;\\s*$)m', file_get_contents( $schemaPath ) ) ); } /** * Returns the database handler from the service container * * @return \EzcDbHandler */ protected function getDatabaseHandler() { return $this->getContainer()->get( 'ezpublish.api.storage_engine.legacy.dbhandler' ); } }
gbentley/ezpublish-kernel
eZ/Bundle/EzPublishCoreBundle/Command/TestInitDbCommand.php
PHP
gpl-2.0
6,315
#include <stdafx.h> #include <vd2/system/error.h> #include <vd2/system/cpuaccel.h> #include <vd2/system/vdalloc.h> #include <vd2/system/time.h> #include <vd2/Kasumi/pixmap.h> #include <vd2/Kasumi/pixmaputils.h> #include <vd2/Kasumi/resample.h> #include <vd2/Dita/services.h> #include "ProgressDialog.h" #include "InputFile.h" #include "VideoSource.h" #include "AVIOutput.h" #include "AVIOutputFile.h" #include <vector> extern const char g_szError[]; namespace { static const uint8 ditherred[16][16]={ 35, 80,227,165, 64,199, 42,189,138, 74,238,111, 43,153, 13,211, 197,135, 20, 99,244, 4,162,105, 25,210, 38,134,225, 78,242, 87, 63,249,126,192, 50,174, 82,251,116,148, 97,176, 19,167, 52,163, 187, 30, 85,142,219, 71,194, 45,169, 11,241, 58,216,106,204, 5, 94,151,235, 9,112,155, 17,224, 91,206, 84,188,120, 36,132,233, 177, 48,124,201, 40,239,125, 66,180, 51,160, 7,152,255, 89, 56, 16,209, 72,161,121, 59,208,150, 28,248, 75,229,101, 26,140,220, 170,110,226, 22,252,139, 1,109,195,115,172, 39,200,114,191, 68, 136, 34, 96,183, 44,175, 95,234, 81, 15,143,217, 62,164, 2,237, 57,245,154, 61,203, 70,213, 37,137,243, 98, 23,179, 86,198,103, 184, 12,123,221, 6,129,156, 88,185, 53,127,228, 49,250, 31,130, 77,205, 83,145,107,247, 29,223, 10,212,159, 79,168, 73,146,232, 173, 41,240, 24,190, 54,178,102,149,118, 33,202, 8,215,119, 18, 92,158, 67,166, 76,207,133, 47,254, 65,230,100,131,157, 69,193, 253, 3,214,117,231, 14, 93,171, 21,182,144, 55,246, 27,222, 46, 141,181,104, 32,147,113,236, 60,218,122, 0,196, 90,186,128,108, }; static const uint8 dithergrn[16][16]={ 130,239, 48,211, 19,242, 33, 85,120,252, 72,207,107, 26,179, 39, 67,112,184, 92,156, 75,164,213, 17,138,188, 2,245,140, 87,225, 198,147, 11,254, 41,219,129, 60,194, 49,115,176, 95, 45,170, 15, 109, 51,177, 84,165,117, 6,247,132, 90,201, 56,155,215, 80,250, 136,229, 65,206, 28,189, 97,169, 36,223, 24,241,124, 8,181, 34, 212, 1,143,104,234, 70,220, 57,121,159,102,144, 42,232,133, 96, 71,123,246, 22,149,128, 16,137,237, 10,208, 77,191,111, 53,195, 158,187, 58,175, 44,193,110,202, 82,183, 61,255, 21,151,226, 18, 94, 32,214, 88,228, 64,249, 30,172, 47,162, 89,173, 63,106,200, 236,141, 68,166, 3,161, 93,153, 74,231, 0,216, 38,240,139, 46, 118, 13,253,114,205, 52,186, 14,199,113,142,101,192,125, 7,178, 222,103,154, 37,131,244, 79,221,134, 54,251, 27,157, 83,209, 78, 29,190, 73,217, 98, 25,174,108, 35,185, 91,210, 66,243, 50,171, 248, 55,168, 9,146,227, 69,148,238,127, 12,122,180, 20,145,116, 100,203, 86,235,119, 43,197, 5, 81,204, 99,230, 59,126,196, 4, 150, 23,163, 62,182,105,135,224,160, 31,167, 40,152,233, 76,218, }; static const uint8 ditherblu[16][16]={ 184, 97,174, 29,118,218, 69,249,152, 5,172,126, 31,120,164, 59, 135, 12,140,214, 76,161,122, 26, 93,205, 80,242,106,220, 82,250, 108,228, 91, 40,182, 1,202,142,236, 55,160, 44,167, 9,179, 34, 204, 56,128,255, 86,231, 99, 49,130,187, 20,201, 78,209, 73,158, 4,153,192, 18,170, 35,131,193, 10, 87,253,116,151, 28,245,123, 234, 43,103,212, 74,156,221, 61,230,163,102, 50,223,105,143, 68, 89,183,136, 52,243,113, 22,146,121, 30,206,132, 3,196, 48,173, 217, 25,203,119, 7,188, 92,248, 72,171, 83,240,147, 63,238, 15, 79,166, 64,235,138, 58,208, 38,197, 13,186, 36,110,177, 94,154, 251,104,190, 41,175,100,150,124, 81,219, 66,127,210, 19,222, 37, 117, 11,134,215, 24,252, 2,226,159, 27,144,246, 75,162, 88,194, 141,227, 54,114,165, 77,180, 53,115,233, 98, 8,199, 51,176, 70, 33,169, 85,239, 47,211,139, 90,195, 46,189,133,107,225, 0,244, 207,101,155, 6,185,112, 32,241, 14,168, 84,254, 42,149,129, 60, 145, 23,198,125, 62,224, 96,137,200, 57,157, 21,181, 65,191,111, 45,232, 67,247,148, 17,178, 39,109,229, 71,213, 95,237, 16,216, }; } void VDCreateTestPal8Video(VDGUIHandle h) { CPUEnableExtensions(CPUCheckForExtensions()); try { tVDInputDrivers inputDrivers; std::vector<int> xlat; VDGetInputDrivers(inputDrivers, IVDInputDriver::kF_Video); const VDStringW filter(VDMakeInputDriverFileFilter(inputDrivers, xlat)); const VDFileDialogOption opt[]={ { VDFileDialogOption::kSelectedFilter }, 0 }; int optval[1]={0}; const VDStringW srcfile(VDGetLoadFileName('pl8s', h, L"Choose source file", filter.c_str(), NULL, opt, optval)); if (srcfile.empty()) return; IVDInputDriver *pDrv; int filtidx = xlat[optval[0] - 1]; if (filtidx < 0) pDrv = VDAutoselectInputDriverForFile(srcfile.c_str(), IVDInputDriver::kF_Video); else { tVDInputDrivers::iterator itDrv(inputDrivers.begin()); std::advance(itDrv, filtidx); pDrv = *itDrv; } vdrefptr<InputFile> pIF(pDrv->CreateInputFile(0)); pIF->Init(srcfile.c_str()); const VDStringW dstfile(VDGetSaveFileName('pl8d', h, L"Choose destination 8-bit file", L"Audio-video interleaved (*.avi)\0*.avi\0All files\0*.*", L"avi", NULL, NULL)); if (dstfile.empty()) return; vdrefptr<IVDVideoSource> pVS; pIF->GetVideoSource(0, ~pVS); IVDStreamSource *pVSS = pVS->asStream(); const VDPosition frames = pVSS->getLength(); if (!pVS->setTargetFormat(nsVDPixmap::kPixFormat_XRGB8888)) throw MyError("Cannot set decompression format to 32-bit."); vdautoptr<IVDMediaOutputAVIFile> pOut(VDCreateMediaOutputAVIFile()); IVDMediaOutputStream *pVSOut = pOut->createVideoStream(); const VDPixmap& pxsrc = pVS->getTargetFormat(); const uint32 rowbytes = (pxsrc.w+3) & ~3; VDXStreamInfo si; VDXAVIStreamHeader& hdr = si.aviHeader; hdr.fccType = 'sdiv'; hdr.fccHandler = 0; hdr.dwFlags = 0; hdr.wPriority = 0; hdr.wLanguage = 0; hdr.dwScale = pVSS->getStreamInfo().dwScale; hdr.dwRate = pVSS->getStreamInfo().dwRate; hdr.dwStart = 0; hdr.dwLength = 0; hdr.dwInitialFrames = 0; hdr.dwSuggestedBufferSize = 0; hdr.dwQuality = -1; hdr.dwSampleSize = 0; hdr.rcFrame.left = 0; hdr.rcFrame.top = 0; hdr.rcFrame.right = (short)pxsrc.w; hdr.rcFrame.bottom = (short)pxsrc.h; pVSOut->setStreamInfo(si); vdstructex<BITMAPINFOHEADER> bih; bih.resize(sizeof(BITMAPINFOHEADER) + sizeof(RGBQUAD)*252); bih->biSize = sizeof(BITMAPINFOHEADER); bih->biWidth = pxsrc.w; bih->biHeight = pxsrc.h; bih->biPlanes = 1; bih->biBitCount = 8; bih->biCompression = BI_RGB; bih->biSizeImage = rowbytes*pxsrc.h; bih->biXPelsPerMeter = 0; bih->biYPelsPerMeter = 0; bih->biClrUsed = 252; bih->biClrImportant = 252; RGBQUAD *pal = (RGBQUAD *)((char *)bih.data() + sizeof(BITMAPINFOHEADER)); for(int i=0; i<252; ++i) { pal[i].rgbRed = (BYTE)((i/42)*51); pal[i].rgbGreen = (BYTE)((((i/6)%7)*85)>>1); pal[i].rgbBlue = (BYTE)((i%6)*51); pal[i].rgbReserved = 0; } pVSOut->setFormat(bih.data(), bih.size()); pOut->init(dstfile.c_str()); ProgressDialog dlg((HWND)h, "Processing video stream", "Palettizing frames", (long)frames, true); vdblock<uint8> outbuf(rowbytes * pxsrc.h); const vdpixsize w = pxsrc.w; const vdpixsize h = pxsrc.h; try { for(uint32 frame=0; frame<frames; ++frame) { pVS->getFrame(frame); const uint8 *src = (const uint8 *)pxsrc.data; ptrdiff_t srcpitch = pxsrc.pitch; uint8 *dst = &outbuf[rowbytes * (pxsrc.h - 1)]; for(int y=0; y<h; ++y) { const uint8 *dr = ditherred[y & 15]; const uint8 *dg = dithergrn[y & 15]; const uint8 *db = ditherblu[y & 15]; for(int x=0; x<w; ++x) { const uint8 b = (uint8)((((src[0] * 1286)>>8) + dr[x&15]) >> 8); const uint8 g = (uint8)((((src[1] * 1543)>>8) + dg[x&15]) >> 8); const uint8 r = (uint8)((((src[2] * 1286)>>8) + db[x&15]) >> 8); src += 4; dst[x] = (uint8)(r*42 + g*6 + b); } vdptrstep(dst, -(ptrdiff_t)rowbytes); vdptrstep(src, srcpitch - w*4); } pVSOut->write(AVIOutputStream::kFlagKeyFrame, outbuf.data(), outbuf.size(), 1); dlg.advance(frame); dlg.check(); } } catch(const MyUserAbortError&) { } pVSOut->flush(); pOut->finalize(); } catch(const MyError& e) { e.post((HWND)h, g_szError); } }
shekh/VirtualDub2
src/VirtualDub/source/test_pal8.cpp
C++
gpl-2.0
8,056
#!/usr/bin/env python import matplotlib.pyplot as plt # dict: {title of plot : [measure value files]} # The input data may not have a \n at file end. inputFiles = {'LibMergeSort_Sortierszenarien_im_Vergleich': ['sorted', 'shuffle', 'reverse']} # different colors of the function graphs COLORS = ['g', 'k', 'm'] print(inputFiles.items()) counter = 0 for outputFileName, fileNames in inputFiles.items(): fig = plt.figure() ax1 = fig.add_subplot(111) for fileName in fileNames: with open(fileName) as f: data = f.read() data = data.split('\n') #print(str(fileName) + str(data)) x = [row.split()[0] for row in data] y = [float(row.split()[1]) for row in data] err = [float(row.split()[2]) for row in data] ax1.plot(x, y, c=COLORS[counter], label=fileName) ax1.errorbar(x, y, yerr=err, fmt='_', ecolor=COLORS[counter], capthick=2) counter = counter + 1 # ax1.set_title(outputFileName) ax1.set_xlabel('Anzahl Elemente N') ax1.set_ylabel('Laufzeit [s]') leg = ax1.legend(loc='upper left') #leg = ax1.legend(loc='lower right') # ax1.set_yscale('log') #fig.savefig(outputFileName + '.png', format='png') fig.savefig(outputFileName + '.pdf', format='pdf') # plt.show()
rm--/matplotlib_examples
example1/evaluate1.py
Python
gpl-2.0
1,327
Meteor.publish('applications-counter', function (id,skip,limit,filter,flagged) { if (flagged==false){ query = sectionQueryBuilder(filter,'sub') var cursor = Project.find({'osxcollector_section':'applications','osxcollector_incident_id':id,"$or":query}) Counts.publish(this, 'applications-counter',cursor,{noReady: true}) }else if(flagged == true && filter==""){ var cursor = Project.find({'osxcollector_section':'applications','osxcollector_incident_id':id,'flagged':true}) Counts.publish(this, 'applications-counter',cursor,{noReady: true}) }else{ query = sectionQueryBuilder(filter,'sub') var cursor = Project.find({'osxcollector_section':'applications','osxcollector_incident_id':id,"$or":query,'flagged':true}) Counts.publish(this, 'applications-counter',cursor,{noReady: true}) } }) Meteor.publish('applications', function (id,skip,limit,filter,flagged) { if (flagged==false){ query = sectionQueryBuilder(filter,'sub') return Project.find({'osxcollector_section':'applications','osxcollector_incident_id':id,"$or":query}, {limit: limit,skip: skip}) }else if (flagged==true && filter==""){ return Project.find({'osxcollector_section':'applications','osxcollector_incident_id':id,'flagged':true}, {limit: limit,skip: skip}) }else if(flagged == true && filter!=""){ query = sectionQueryBuilder(filter,'sub') return Project.find({'osxcollector_section':'applications','osxcollector_incident_id':id,"$or":query,'flagged':true}, {limit: limit,skip: skip}) }}) function sectionQueryBuilder(str,section){ var sep = str.split('::') list = [] for (var i = sep.length - 1; i >= 1; i--) { if(section=='sub'){ list.push({"osxcollector_subsection":sep[i]}) }else{ list.push({"osxcollector_section":sep[i]}) } } return list }
wfsec/osxstrata
server/pubs/applications.js
JavaScript
gpl-2.0
1,772
from django.contrib.auth.models import User, Permission, Group from rest_framework import serializers from apps.account.serializers.PermissionSerializer import PermissionSerializer class GroupSerializer(serializers.ModelSerializer): permissions = PermissionSerializer(instance=Permission, many=True) class Meta: model = Group fields = ('name', 'permissions')
mmmaaaxxx77/Python-Django-AdminLTE2
Demo/apps/account/serializers/GroupSerializer.py
Python
gpl-2.0
384
using System; using System.Collections.Generic; using System.Linq; using System.Text; namespace Pathfinder { class AiBotBetter : AiBotBase { //public override void Setup(Level lvl, Player plr) { } public int direction = 0; /* 0 *3 1 * 2 */ bool walling = false; public AiBotBetter(int x, int y) : base(x, y) { } protected override void ChooseNextGridLocation(Level level, Player plr) { Coord2 pos; if (!walling) { //move towards the player if (GridPosition.X > plr.GridPosition.X) { direction = 3; //left } else if (GridPosition.X < plr.GridPosition.X) { direction = 1; //right } else if (GridPosition.Y > plr.GridPosition.Y) { direction = 2; //down } else if (GridPosition.Y < plr.GridPosition.Y) { direction = 0; //up } pos = GridPosition; pos = move(direction); if (!level.ValidPosition(pos)) { walling = true; Random rnd = new Random(); int dir = rnd.Next(0, 2); if (dir == 0) { direction--; } else { direction++; } if (direction < 0) direction = 3; if (direction > 3) direction = 0; } } if (0 == nextToWall(level)) { walling = false; } if (2 == nextToWall(level)) { Random rnd = new Random(); int dir = rnd.Next(0, 2); if (dir == 0) { direction--; } else { direction++; } if (direction < 0) direction = 3; if (direction > 3) direction = 0; } pos = move(direction); SetNextGridPosition(pos, level); } private Coord2 move(int direction) { Coord2 pos = GridPosition; switch (direction) { case 0: pos.Y++; break; case 1: pos.X++; break; case 2: pos.Y--; break; case 3: pos.X--; break; } return pos; } int nextToWall(Level level) { int ntw = 0; Coord2 pos = GridPosition; pos.X++; if (!level.ValidPosition(pos)) { ntw++; } pos.X -= 2; if (!level.ValidPosition(pos)) { ntw++; } pos.X++; pos.Y++; if (!level.ValidPosition(pos)) { ntw++; } pos.Y -= 2; if (!level.ValidPosition(pos)) { ntw++; } return ntw; } } }
BenjaminJStock/AI-Dijkstras
Pathfinder/AiBotSimple2.cs
C#
gpl-2.0
3,806
#include <netinet/in.h> #include <arpa/inet.h> #include <stdio.h> #include <errno.h> #include <stdlib.h> #include <string.h> #include <unistd.h> #include <time.h> #include <iostream> #include <sys/time.h> #include <assert.h> #include <semaphore.h> #include <netinet/tcp.h> using namespace std; typedef unsigned long long u64; typedef unsigned int u32; int main() { struct sockaddr_in serveraddr; bzero(&serveraddr, sizeof(serveraddr)); serveraddr.sin_family = AF_INET; const char *local_addr = "127.0.0.1"; //const char *local_addr = "192.168.99.85"; inet_aton(local_addr,&(serveraddr.sin_addr)); serveraddr.sin_port=ntohs(5531); int fd = socket(AF_INET, SOCK_STREAM, 0); // Disable the Nagle (TCP No Delay) algorithm /* int flag = 1; int ret = setsockopt(fd, IPPROTO_TCP, TCP_NODELAY, (char *)&flag, sizeof(flag) ); if (ret == -1) { printf("Couldn't setsockopt(TCP_NODELAY)\n"); exit(-1); } */ int rslt = connect(fd, (sockaddr*)&serveraddr, sizeof(serveraddr)); if (rslt) { perror("faild:"); exit(1); } sleep(5); //char a[20004]; char a[1028]; memset(a,0, 1028); int num = 0; u32 trys = 100; //while(trys--) while(1) { write(fd, a, 4); write(fd, a, 100); //write(fd, a, 104); read(fd, a, 104); sleep(2); } close(fd); } //g++ -g client.cpp -o client.exe
diqiu50/ice-dev
Ice/example/Connection/Epoll/client.cpp
C++
gpl-2.0
1,324
/** * Copyright 陈延军 All rights reserved. */ package org.fairyks.im.server.util; import java.io.InputStream; import javax.servlet.http.HttpServletRequest; import org.apache.commons.io.IOUtils; import org.apache.log4j.Logger; import com.google.gson.Gson; /** * <p>Copyright: Copyright (c) 2011</p> * <p>公司名称 :陈延军 </p> * <p>项目名称 : ImServer</p> * <p>创建时间 : 2016年1月4日 下午3:34:23</p> * <p>类描述 : </p> * * * @version 1.0.0 * @author <a href=" ">陈延军</a> */ public class HttpRequestUtil { private static HttpRequestUtil httpRequestUtil; private HttpRequestUtil() { } public static HttpRequestUtil getInstance() { if (httpRequestUtil != null) { return httpRequestUtil; } else { httpRequestUtil = new HttpRequestUtil(); return httpRequestUtil; } } private static final Logger logger = Logger.getLogger(HttpRequestUtil.class); public static String getRequestData(HttpServletRequest request) { try { request.setCharacterEncoding("UTF-8"); InputStream inputStream = request.getInputStream(); String requestData = IOUtils.toString(inputStream,"Utf-8"); return requestData; } catch (Exception e) { e.printStackTrace(); logger.error("fail to get RequestData,the reason is " + e.getMessage().toString()); return null; } } }
fairyks/ImServer
src/org/fairyks/im/server/util/HttpRequestUtil.java
Java
gpl-2.0
1,403
<?php function webnus_iconbox( $attributes, $content = null ) { extract(shortcode_atts(array( "type"=>'', 'icon_title'=>'', 'icon_link_url'=>'', 'icon_link_text'=>'', "icon_name"=>'', "iconbox_content"=>'', "icon_size"=>'', "icon_color"=>'', "title_color"=>'', "content_color"=>'', "link_color"=>'', "link_target"=>'self', "icon_image"=>'', ), $attributes)); ob_start(); $type = ($type==0) ? '' : $type ; $iconbox_style = ( !empty($icon_color) ) ? ' style="color: ' . $icon_color . '"' : '' ; $type17_start_wrap = $type17_end_wrap = ''; if ( $type==17 ) { $type17_start_wrap = '<div class="icon-wrap" style="background-color:'.$icon_color.'">'; $type17_end_wrap = '</div>'; } echo '<article class="icon-box' . $type . '" ' . $iconbox_style . '>'; if(!empty($icon_name) && $icon_name != 'none'): if(!empty($icon_link_url)) echo '' . $type17_start_wrap . '<a target="_'.$link_target.'" href="' . $icon_link_url . '">' . do_shortcode( "[icon name='$icon_name' size='$icon_size' color='$icon_color']" ).'</a>' . $type17_end_wrap . ''; else echo $type17_start_wrap . do_shortcode( "[icon name='$icon_name' size='$icon_size' color='$icon_color']" ) . $type17_end_wrap; elseif(!empty($icon_image)): if(is_numeric($icon_image)){ $icon_image = wp_get_attachment_url( $icon_image ); } if(!empty($icon_link_url)) echo "<a target='_".$link_target."' href='$icon_link_url'>" . '<img src="'.$icon_image.'" />' . '</a>' ; else echo '<img src="'.$icon_image.'" />'; endif; $title_style = !empty($title_color)?' style="color:'.$title_color.'"':''; echo '<h4'.$title_style.'>' . $icon_title . '</h4>'; $content_style = !empty($content_color)?' style="color:'.$content_color.'"':''; echo '<p'.$content_style.'>'.$iconbox_content .'</p>' ; $link_style = !empty($link_color)?' style="color:'.$link_color.'"':''; echo (!empty($icon_link_url) && (!empty($icon_link_text)) )?"<a target=\"_".$link_target."\" ".$link_style." class=\"magicmore\" href=\"{$icon_link_url}\">{$icon_link_text}</a>":''; echo '</article>'; $out = ob_get_contents(); ob_end_clean(); $out = str_replace('<p></p>','',$out); return $out; } add_shortcode('iconbox', 'webnus_iconbox'); ?>
arkev/IntelligentMode
wp-content/themes/florida-wp/inc/shortcodes/iconbox.php
PHP
gpl-2.0
2,299
/* This file is part of Jedi Academy. Jedi Academy is free software: you can redistribute it and/or modify it under the terms of the GNU General Public License version 2 as published by the Free Software Foundation. Jedi Academy is distributed in the hope that it will be useful, but WITHOUT ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License for more details. You should have received a copy of the GNU General Public License along with Jedi Academy. If not, see <http://www.gnu.org/licenses/>. */ // Copyright 2001-2013 Raven Software //NPC_utils.cpp #include "b_local.h" #include "Q3_Interface.h" #include "g_navigator.h" #include "../cgame/cg_local.h" #include "g_nav.h" extern Vehicle_t *G_IsRidingVehicle( gentity_t *pEnt ); int teamNumbers[TEAM_NUM_TEAMS]; int teamStrength[TEAM_NUM_TEAMS]; int teamCounter[TEAM_NUM_TEAMS]; #define VALID_ATTACK_CONE 2.0f //Degrees void GetAnglesForDirection( const vec3_t p1, const vec3_t p2, vec3_t out ); /* void CalcEntitySpot ( gentity_t *ent, spot_t spot, vec3_t point ) Added: Uses shootAngles if a NPC has them */ extern void ViewHeightFix(const gentity_t *const ent); extern void AddLeanOfs(const gentity_t *const ent, vec3_t point); extern void SubtractLeanOfs(const gentity_t *const ent, vec3_t point); void CalcEntitySpot ( const gentity_t *ent, const spot_t spot, vec3_t point ) { vec3_t forward, up, right; vec3_t start, end; trace_t tr; if ( !ent ) { return; } ViewHeightFix(ent); switch ( spot ) { case SPOT_ORIGIN: if(VectorCompare(ent->currentOrigin, vec3_origin)) {//brush VectorSubtract(ent->absmax, ent->absmin, point);//size VectorMA(ent->absmin, 0.5, point, point); } else { VectorCopy ( ent->currentOrigin, point ); } break; case SPOT_CHEST: case SPOT_HEAD: if ( ent->client && VectorLengthSquared( ent->client->renderInfo.eyePoint ) && (ent->client->ps.viewEntity <= 0 || ent->client->ps.viewEntity >= ENTITYNUM_WORLD) ) {//Actual tag_head eyespot! //FIXME: Stasis aliens may have a problem here... VectorCopy( ent->client->renderInfo.eyePoint, point ); if ( ent->client->NPC_class == CLASS_ATST ) {//adjust up some point[2] += 28;//magic number :) } if ( ent->NPC ) {//always aim from the center of my bbox, so we don't wiggle when we lean forward or backwards point[0] = ent->currentOrigin[0]; point[1] = ent->currentOrigin[1]; } else if ( !ent->s.number ) { SubtractLeanOfs( ent, point ); } } else { VectorCopy ( ent->currentOrigin, point ); if ( ent->client ) { point[2] += ent->client->ps.viewheight; } } if ( spot == SPOT_CHEST && ent->client ) { if ( ent->client->NPC_class != CLASS_ATST ) {//adjust up some point[2] -= ent->maxs[2]*0.2f; } } break; case SPOT_HEAD_LEAN: if ( ent->client && VectorLengthSquared( ent->client->renderInfo.eyePoint ) && (ent->client->ps.viewEntity <= 0 || ent->client->ps.viewEntity >= ENTITYNUM_WORLD) ) {//Actual tag_head eyespot! //FIXME: Stasis aliens may have a problem here... VectorCopy( ent->client->renderInfo.eyePoint, point ); if ( ent->client->NPC_class == CLASS_ATST ) {//adjust up some point[2] += 28;//magic number :) } if ( ent->NPC ) {//always aim from the center of my bbox, so we don't wiggle when we lean forward or backwards point[0] = ent->currentOrigin[0]; point[1] = ent->currentOrigin[1]; } else if ( !ent->s.number ) { SubtractLeanOfs( ent, point ); } //NOTE: automatically takes leaning into account! } else { VectorCopy ( ent->currentOrigin, point ); if ( ent->client ) { point[2] += ent->client->ps.viewheight; } //AddLeanOfs ( ent, point ); } break; //FIXME: implement... //case SPOT_CHEST: //Returns point 3/4 from tag_torso to tag_head? //break; case SPOT_LEGS: VectorCopy ( ent->currentOrigin, point ); point[2] += (ent->mins[2] * 0.5); break; case SPOT_WEAPON: if( ent->NPC && !VectorCompare( ent->NPC->shootAngles, vec3_origin ) && !VectorCompare( ent->NPC->shootAngles, ent->client->ps.viewangles )) { AngleVectors( ent->NPC->shootAngles, forward, right, up ); } else { AngleVectors( ent->client->ps.viewangles, forward, right, up ); } CalcMuzzlePoint( (gentity_t*)ent, forward, right, up, point, 0 ); //NOTE: automatically takes leaning into account! break; case SPOT_GROUND: // if entity is on the ground, just use it's absmin if ( ent->s.groundEntityNum != -1 ) { VectorCopy( ent->currentOrigin, point ); point[2] = ent->absmin[2]; break; } // if it is reasonably close to the ground, give the point underneath of it VectorCopy( ent->currentOrigin, start ); start[2] = ent->absmin[2]; VectorCopy( start, end ); end[2] -= 64; gi.trace( &tr, start, ent->mins, ent->maxs, end, ent->s.number, MASK_PLAYERSOLID, (EG2_Collision)0, 0 ); if ( tr.fraction < 1.0 ) { VectorCopy( tr.endpos, point); break; } // otherwise just use the origin VectorCopy( ent->currentOrigin, point ); break; default: VectorCopy ( ent->currentOrigin, point ); break; } } //=================================================================================== /* qboolean NPC_UpdateAngles ( qboolean doPitch, qboolean doYaw ) Added: option to do just pitch or just yaw Does not include "aim" in it's calculations FIXME: stop compressing angles into shorts!!!! */ extern cvar_t *g_timescale; extern bool NPC_IsTrooper( gentity_t *ent ); qboolean NPC_UpdateAngles ( qboolean doPitch, qboolean doYaw ) { #if 1 float error; float decay; float targetPitch = 0; float targetYaw = 0; float yawSpeed; qboolean exact = qtrue; // if angle changes are locked; just keep the current angles // aimTime isn't even set anymore... so this code was never reached, but I need a way to lock NPC's yaw, so instead of making a new SCF_ flag, just use the existing render flag... - dmv if ( !NPC->enemy && ( (level.time < NPCInfo->aimTime) || NPC->client->renderInfo.renderFlags & RF_LOCKEDANGLE) ) { if(doPitch) targetPitch = NPCInfo->lockedDesiredPitch; if(doYaw) targetYaw = NPCInfo->lockedDesiredYaw; } else { // we're changing the lockedDesired Pitch/Yaw below so it's lost it's original meaning, get rid of the lock flag NPC->client->renderInfo.renderFlags &= ~RF_LOCKEDANGLE; if(doPitch) { targetPitch = NPCInfo->desiredPitch; NPCInfo->lockedDesiredPitch = NPCInfo->desiredPitch; } if(doYaw) { targetYaw = NPCInfo->desiredYaw; NPCInfo->lockedDesiredYaw = NPCInfo->desiredYaw; } } if ( NPC->s.weapon == WP_EMPLACED_GUN ) { // FIXME: this seems to do nothing, actually... yawSpeed = 20; } else { if ( NPC->client->NPC_class == CLASS_ROCKETTROOPER && !NPC->enemy ) {//just slowly lookin' around yawSpeed = 1; } else { yawSpeed = NPCInfo->stats.yawSpeed; } } if ( NPC->s.weapon == WP_SABER && NPC->client->ps.forcePowersActive&(1<<FP_SPEED) ) { yawSpeed *= 1.0f/g_timescale->value; } if (!NPC_IsTrooper(NPC) && NPC->enemy && !G_IsRidingVehicle( NPC ) && NPC->client->NPC_class != CLASS_VEHICLE ) { if (NPC->s.weapon==WP_BLASTER_PISTOL || NPC->s.weapon==WP_BLASTER || NPC->s.weapon==WP_BOWCASTER || NPC->s.weapon==WP_REPEATER || NPC->s.weapon==WP_FLECHETTE || NPC->s.weapon==WP_BRYAR_PISTOL || NPC->s.weapon==WP_NOGHRI_STICK) { yawSpeed *= 10.0f; } } if( doYaw ) { // decay yaw error error = AngleDelta ( NPC->client->ps.viewangles[YAW], targetYaw ); if( fabs(error) > MIN_ANGLE_ERROR ) { if ( error ) { exact = qfalse; decay = 60.0 + yawSpeed * 3; decay *= 50.0f / 1000.0f;//msec if ( error < 0.0 ) { error += decay; if ( error > 0.0 ) { error = 0.0; } } else { error -= decay; if ( error < 0.0 ) { error = 0.0; } } } } ucmd.angles[YAW] = ANGLE2SHORT( targetYaw + error ) - client->ps.delta_angles[YAW]; } //FIXME: have a pitchSpeed? if( doPitch ) { // decay pitch error error = AngleDelta ( NPC->client->ps.viewangles[PITCH], targetPitch ); if ( fabs(error) > MIN_ANGLE_ERROR ) { if ( error ) { exact = qfalse; decay = 60.0 + yawSpeed * 3; decay *= 50.0f / 1000.0f;//msec if ( error < 0.0 ) { error += decay; if ( error > 0.0 ) { error = 0.0; } } else { error -= decay; if ( error < 0.0 ) { error = 0.0; } } } } ucmd.angles[PITCH] = ANGLE2SHORT( targetPitch + error ) - client->ps.delta_angles[PITCH]; } ucmd.angles[ROLL] = ANGLE2SHORT ( NPC->client->ps.viewangles[ROLL] ) - client->ps.delta_angles[ROLL]; if ( exact && Q3_TaskIDPending( NPC, TID_ANGLE_FACE ) ) { Q3_TaskIDComplete( NPC, TID_ANGLE_FACE ); } return exact; #else float error; float decay; float targetPitch = 0; float targetYaw = 0; float yawSpeed; //float runningMod = NPCInfo->currentSpeed/100.0f; qboolean exact = qtrue; qboolean doSound = qfalse; // if angle changes are locked; just keep the current angles if ( level.time < NPCInfo->aimTime ) { if(doPitch) targetPitch = NPCInfo->lockedDesiredPitch; if(doYaw) targetYaw = NPCInfo->lockedDesiredYaw; } else { if(doPitch) targetPitch = NPCInfo->desiredPitch; if(doYaw) targetYaw = NPCInfo->desiredYaw; // NPCInfo->aimTime = level.time + 250; if(doPitch) NPCInfo->lockedDesiredPitch = NPCInfo->desiredPitch; if(doYaw) NPCInfo->lockedDesiredYaw = NPCInfo->desiredYaw; } yawSpeed = NPCInfo->stats.yawSpeed; if(doYaw) { // decay yaw error error = AngleDelta ( NPC->client->ps.viewangles[YAW], targetYaw ); if( fabs(error) > MIN_ANGLE_ERROR ) { /* if(NPC->client->playerTeam == TEAM_BORG&& NPCInfo->behaviorState != BS_FACE&&NPCInfo->tempBehavior!= BS_FACE) {//HACK - borg turn more jittery if ( error ) { exact = qfalse; decay = 60.0 + yawSpeed * 3; decay *= 50.0 / 1000.0;//msec //Snap to if(fabs(error) > 10) { if(random() > 0.6) { doSound = qtrue; } } if ( error < 0.0)//-10.0 ) { error += decay; if ( error > 0.0 ) { error = 0.0; } } else if ( error > 0.0)//10.0 ) { error -= decay; if ( error < 0.0 ) { error = 0.0; } } } } else*/ if ( error ) { exact = qfalse; decay = 60.0 + yawSpeed * 3; decay *= 50.0 / 1000.0;//msec if ( error < 0.0 ) { error += decay; if ( error > 0.0 ) { error = 0.0; } } else { error -= decay; if ( error < 0.0 ) { error = 0.0; } } } } ucmd.angles[YAW] = ANGLE2SHORT( targetYaw + error ) - client->ps.delta_angles[YAW]; } //FIXME: have a pitchSpeed? if(doPitch) { // decay pitch error error = AngleDelta ( NPC->client->ps.viewangles[PITCH], targetPitch ); if ( fabs(error) > MIN_ANGLE_ERROR ) { /* if(NPC->client->playerTeam == TEAM_BORG&& NPCInfo->behaviorState != BS_FACE&&NPCInfo->tempBehavior!= BS_FACE) {//HACK - borg turn more jittery if ( error ) { exact = qfalse; decay = 60.0 + yawSpeed * 3; decay *= 50.0 / 1000.0;//msec //Snap to if(fabs(error) > 10) { if(random() > 0.6) { doSound = qtrue; } } if ( error < 0.0)//-10.0 ) { error += decay; if ( error > 0.0 ) { error = 0.0; } } else if ( error > 0.0)//10.0 ) { error -= decay; if ( error < 0.0 ) { error = 0.0; } } } } else*/ if ( error ) { exact = qfalse; decay = 60.0 + yawSpeed * 3; decay *= 50.0 / 1000.0;//msec if ( error < 0.0 ) { error += decay; if ( error > 0.0 ) { error = 0.0; } } else { error -= decay; if ( error < 0.0 ) { error = 0.0; } } } } ucmd.angles[PITCH] = ANGLE2SHORT( targetPitch + error ) - client->ps.delta_angles[PITCH]; } ucmd.angles[ROLL] = ANGLE2SHORT ( NPC->client->ps.viewangles[ROLL] ) - client->ps.delta_angles[ROLL]; /* if(doSound) { G_Sound(NPC, G_SoundIndex(va("sound/enemies/borg/borgservo%d.wav", Q_irand(1, 8)))); } */ return exact; #endif } void NPC_AimWiggle( vec3_t enemy_org ) { //shoot for somewhere between the head and torso //NOTE: yes, I know this looks weird, but it works if ( NPCInfo->aimErrorDebounceTime < level.time ) { NPCInfo->aimOfs[0] = 0.3*Q_flrand(NPC->enemy->mins[0], NPC->enemy->maxs[0]); NPCInfo->aimOfs[1] = 0.3*Q_flrand(NPC->enemy->mins[1], NPC->enemy->maxs[1]); if ( NPC->enemy->maxs[2] > 0 ) { NPCInfo->aimOfs[2] = NPC->enemy->maxs[2]*Q_flrand(0.0f, -1.0f); } } VectorAdd( enemy_org, NPCInfo->aimOfs, enemy_org ); } /* qboolean NPC_UpdateFiringAngles ( qboolean doPitch, qboolean doYaw ) Includes aim when determining angles - so they don't always hit... */ qboolean NPC_UpdateFiringAngles ( qboolean doPitch, qboolean doYaw ) { #if 0 float diff; float error; float targetPitch = 0; float targetYaw = 0; qboolean exact = qtrue; if ( level.time < NPCInfo->aimTime ) { if( doPitch ) targetPitch = NPCInfo->lockedDesiredPitch; if( doYaw ) targetYaw = NPCInfo->lockedDesiredYaw; } else { if( doPitch ) { targetPitch = NPCInfo->desiredPitch; NPCInfo->lockedDesiredPitch = NPCInfo->desiredPitch; } if( doYaw ) { targetYaw = NPCInfo->desiredYaw; NPCInfo->lockedDesiredYaw = NPCInfo->desiredYaw; } } if( doYaw ) { // add yaw error based on NPCInfo->aim value error = ((float)(6 - NPCInfo->stats.aim)) * Q_flrand(-1, 1); if(Q_irand(0, 1)) error *= -1; diff = AngleDelta ( NPC->client->ps.viewangles[YAW], targetYaw ); if ( diff ) exact = qfalse; ucmd.angles[YAW] = ANGLE2SHORT( targetYaw + diff + error ) - client->ps.delta_angles[YAW]; } if( doPitch ) { // add pitch error based on NPCInfo->aim value error = ((float)(6 - NPCInfo->stats.aim)) * Q_flrand(-1, 1); diff = AngleDelta ( NPC->client->ps.viewangles[PITCH], targetPitch ); if ( diff ) exact = qfalse; ucmd.angles[PITCH] = ANGLE2SHORT( targetPitch + diff + error ) - client->ps.delta_angles[PITCH]; } ucmd.angles[ROLL] = ANGLE2SHORT ( NPC->client->ps.viewangles[ROLL] ) - client->ps.delta_angles[ROLL]; return exact; #else float error, diff; float decay; float targetPitch = 0; float targetYaw = 0; qboolean exact = qtrue; // if angle changes are locked; just keep the current angles if ( level.time < NPCInfo->aimTime ) { if(doPitch) targetPitch = NPCInfo->lockedDesiredPitch; if(doYaw) targetYaw = NPCInfo->lockedDesiredYaw; } else { if(doPitch) targetPitch = NPCInfo->desiredPitch; if(doYaw) targetYaw = NPCInfo->desiredYaw; // NPCInfo->aimTime = level.time + 250; if(doPitch) NPCInfo->lockedDesiredPitch = NPCInfo->desiredPitch; if(doYaw) NPCInfo->lockedDesiredYaw = NPCInfo->desiredYaw; } if ( NPCInfo->aimErrorDebounceTime < level.time ) { if ( Q_irand(0, 1 ) ) { NPCInfo->lastAimErrorYaw = ((float)(6 - NPCInfo->stats.aim)) * Q_flrand(-1, 1); } if ( Q_irand(0, 1 ) ) { NPCInfo->lastAimErrorPitch = ((float)(6 - NPCInfo->stats.aim)) * Q_flrand(-1, 1); } NPCInfo->aimErrorDebounceTime = level.time + Q_irand(250, 2000); } if(doYaw) { // decay yaw diff diff = AngleDelta ( NPC->client->ps.viewangles[YAW], targetYaw ); if ( diff) { exact = qfalse; decay = 60.0 + 80.0; decay *= 50.0f / 1000.0f;//msec if ( diff < 0.0 ) { diff += decay; if ( diff > 0.0 ) { diff = 0.0; } } else { diff -= decay; if ( diff < 0.0 ) { diff = 0.0; } } } // add yaw error based on NPCInfo->aim value error = NPCInfo->lastAimErrorYaw; /* if(Q_irand(0, 1)) { error *= -1; } */ ucmd.angles[YAW] = ANGLE2SHORT( targetYaw + diff + error ) - client->ps.delta_angles[YAW]; } if(doPitch) { // decay pitch diff diff = AngleDelta ( NPC->client->ps.viewangles[PITCH], targetPitch ); if ( diff) { exact = qfalse; decay = 60.0 + 80.0; decay *= 50.0f / 1000.0f;//msec if ( diff < 0.0 ) { diff += decay; if ( diff > 0.0 ) { diff = 0.0; } } else { diff -= decay; if ( diff < 0.0 ) { diff = 0.0; } } } error = NPCInfo->lastAimErrorPitch; ucmd.angles[PITCH] = ANGLE2SHORT( targetPitch + diff + error ) - client->ps.delta_angles[PITCH]; } ucmd.angles[ROLL] = ANGLE2SHORT ( NPC->client->ps.viewangles[ROLL] ) - client->ps.delta_angles[ROLL]; return exact; #endif } //=================================================================================== /* static void NPC_UpdateShootAngles (vec3_t angles, qboolean doPitch, qboolean doYaw ) Does update angles on shootAngles */ void NPC_UpdateShootAngles (vec3_t angles, qboolean doPitch, qboolean doYaw ) {//FIXME: shoot angles either not set right or not used! float error; float decay; float targetPitch = 0; float targetYaw = 0; if(doPitch) targetPitch = angles[PITCH]; if(doYaw) targetYaw = angles[YAW]; if(doYaw) { // decay yaw error error = AngleDelta ( NPCInfo->shootAngles[YAW], targetYaw ); if ( error ) { decay = 60.0 + 80.0 * NPCInfo->stats.aim; decay *= 100.0f / 1000.0f;//msec if ( error < 0.0 ) { error += decay; if ( error > 0.0 ) { error = 0.0; } } else { error -= decay; if ( error < 0.0 ) { error = 0.0; } } } NPCInfo->shootAngles[YAW] = targetYaw + error; } if(doPitch) { // decay pitch error error = AngleDelta ( NPCInfo->shootAngles[PITCH], targetPitch ); if ( error ) { decay = 60.0 + 80.0 * NPCInfo->stats.aim; decay *= 100.0f / 1000.0f;//msec if ( error < 0.0 ) { error += decay; if ( error > 0.0 ) { error = 0.0; } } else { error -= decay; if ( error < 0.0 ) { error = 0.0; } } } NPCInfo->shootAngles[PITCH] = targetPitch + error; } } /* void SetTeamNumbers (void) Sets the number of living clients on each team FIXME: Does not account for non-respawned players! FIXME: Don't include medics? */ void SetTeamNumbers (void) { gentity_t *found; int i; for( i = 0; i < TEAM_NUM_TEAMS; i++ ) { teamNumbers[i] = 0; teamStrength[i] = 0; } for( i = 0; i < 1 ; i++ ) { found = &g_entities[i]; if( found->client ) { if( found->health > 0 )//FIXME: or if a player! { teamNumbers[found->client->playerTeam]++; teamStrength[found->client->playerTeam] += found->health; } } } for( i = 0; i < TEAM_NUM_TEAMS; i++ ) {//Get the average health teamStrength[i] = floor( ((float)(teamStrength[i])) / ((float)(teamNumbers[i])) ); } } extern stringID_table_t BSTable[]; extern stringID_table_t BSETTable[]; qboolean G_ActivateBehavior (gentity_t *self, int bset ) { bState_t bSID = (bState_t)-1; char *bs_name = NULL; if ( !self ) { return qfalse; } bs_name = self->behaviorSet[bset]; if( !(VALIDSTRING( bs_name )) ) { return qfalse; } if ( self->NPC ) { bSID = (bState_t)(GetIDForString( BSTable, bs_name )); } if(bSID != (bState_t)-1) { self->NPC->tempBehavior = BS_DEFAULT; self->NPC->behaviorState = bSID; if ( bSID == BS_SEARCH || bSID == BS_WANDER ) { //FIXME: Reimplement? if( self->waypoint != WAYPOINT_NONE ) { NPC_BSSearchStart( self->waypoint, bSID ); } else { self->waypoint = NAV::GetNearestNode(self); if( self->waypoint != WAYPOINT_NONE ) { NPC_BSSearchStart( self->waypoint, bSID ); } } } } else { Quake3Game()->DebugPrint( IGameInterface::WL_VERBOSE, "%s attempting to run bSet %s (%s)\n", self->targetname, GetStringForID( BSETTable, bset ), bs_name ); Quake3Game()->RunScript( self, bs_name ); } return qtrue; } /* ============================================================================= Extended Functions ============================================================================= */ /* ------------------------- NPC_ValidEnemy ------------------------- */ qboolean G_ValidEnemy( gentity_t *self, gentity_t *enemy ) { //Must be a valid pointer if ( enemy == NULL ) return qfalse; //Must not be me if ( enemy == self ) return qfalse; //Must not be deleted if ( enemy->inuse == qfalse ) return qfalse; //Must be alive if ( enemy->health <= 0 ) return qfalse; //In case they're in notarget mode if ( enemy->flags & FL_NOTARGET ) return qfalse; //Must be an NPC if ( enemy->client == NULL ) { if ( enemy->svFlags&SVF_NONNPC_ENEMY ) {//still potentially valid if (self->client) { if ( enemy->noDamageTeam == self->client->playerTeam ) { return qfalse; } else { return qtrue; } } else { if ( enemy->noDamageTeam == self->noDamageTeam ) { return qfalse; } else { return qtrue; } } } else { return qfalse; } } if ( enemy->client->playerTeam == TEAM_FREE && enemy->s.number < MAX_CLIENTS ) {//An evil player, everyone attacks him return qtrue; } //Can't be on the same team if ( enemy->client->playerTeam == self->client->playerTeam ) { return qfalse; } //if haven't seen him in a while, give up //if ( NPCInfo->enemyLastSeenTime != 0 && level.time - NPCInfo->enemyLastSeenTime > 7000 )//FIXME: make a stat? // return qfalse; if ( enemy->client->playerTeam == self->client->enemyTeam //simplest case: they're on my enemy team || (self->client->enemyTeam == TEAM_FREE && enemy->client->NPC_class != self->client->NPC_class )//I get mad at anyone and this guy isn't the same class as me || (enemy->client->NPC_class == CLASS_WAMPA && enemy->enemy )//a rampaging wampa || (enemy->client->NPC_class == CLASS_RANCOR && enemy->enemy )//a rampaging rancor || (enemy->client->playerTeam == TEAM_FREE && enemy->client->enemyTeam == TEAM_FREE && enemy->enemy && enemy->enemy->client && (enemy->enemy->client->playerTeam == self->client->playerTeam||(enemy->enemy->client->playerTeam != TEAM_ENEMY&&self->client->playerTeam==TEAM_PLAYER))) //enemy is a rampaging non-aligned creature who is attacking someone on our team or a non-enemy (this last condition is used only if we're a good guy - in effect, we protect the innocent) ) { return qtrue; } //all other cases = false? return qfalse; } qboolean NPC_ValidEnemy( gentity_t *ent ) { return G_ValidEnemy( NPC, ent ); } /* ------------------------- NPC_TargetVisible ------------------------- */ qboolean NPC_TargetVisible( gentity_t *ent ) { //Make sure we're in a valid range if ( DistanceSquared( ent->currentOrigin, NPC->currentOrigin ) > ( NPCInfo->stats.visrange * NPCInfo->stats.visrange ) ) return qfalse; //Check our FOV if ( InFOV( ent, NPC, NPCInfo->stats.hfov, NPCInfo->stats.vfov ) == qfalse ) return qfalse; //Check for sight if ( NPC_ClearLOS( ent ) == qfalse ) return qfalse; return qtrue; } /* ------------------------- NPC_GetCheckDelta ------------------------- */ /* #define CHECK_TIME_BASE 250 #define CHECK_TIME_BASE_SQUARED ( CHECK_TIME_BASE * CHECK_TIME_BASE ) static int NPC_GetCheckDelta( void ) { if ( NPC_ValidEnemy( NPC->enemy ) == qfalse ) { int distance = DistanceSquared( NPC->currentOrigin, g_entities[0].currentOrigin ); distance /= CHECK_TIME_BASE_SQUARED; return ( CHECK_TIME_BASE * distance ); } return 0; } */ /* ------------------------- NPC_FindNearestEnemy ------------------------- */ #define MAX_RADIUS_ENTS 256 //NOTE: This can cause entities to be lost #define NEAR_DEFAULT_RADIUS 256 extern gentity_t *G_CheckControlledTurretEnemy(gentity_t *self, gentity_t *enemy, qboolean validate ); int NPC_FindNearestEnemy( gentity_t *ent ) { gentity_t *radiusEnts[ MAX_RADIUS_ENTS ]; gentity_t *nearest; vec3_t mins, maxs; int nearestEntID = -1; float nearestDist = (float)WORLD_SIZE*(float)WORLD_SIZE; float distance; int numEnts, numChecks = 0; int i; //Setup the bbox to search in for ( i = 0; i < 3; i++ ) { mins[i] = ent->currentOrigin[i] - NPCInfo->stats.visrange; maxs[i] = ent->currentOrigin[i] + NPCInfo->stats.visrange; } //Get a number of entities in a given space numEnts = gi.EntitiesInBox( mins, maxs, radiusEnts, MAX_RADIUS_ENTS ); for ( i = 0; i < numEnts; i++ ) { nearest = G_CheckControlledTurretEnemy(ent, radiusEnts[i], qtrue); //Don't consider self if ( nearest == ent ) continue; //Must be valid if ( NPC_ValidEnemy( nearest ) == qfalse ) continue; numChecks++; //Must be visible if ( NPC_TargetVisible( nearest ) == qfalse ) continue; distance = DistanceSquared( ent->currentOrigin, nearest->currentOrigin ); //Found one closer to us if ( distance < nearestDist ) { nearestEntID = nearest->s.number; nearestDist = distance; } } return nearestEntID; } /* ------------------------- NPC_PickEnemyExt ------------------------- */ gentity_t *NPC_PickEnemyExt( qboolean checkAlerts = qfalse ) { //Check for Hazard Team status and remove this check /* if ( NPC->client->playerTeam != TEAM_STARFLEET ) { //If we've found the player, return it if ( NPC_FindPlayer() ) return &g_entities[0]; } */ //If we've asked for the closest enemy int entID = NPC_FindNearestEnemy( NPC ); //If we have a valid enemy, use it if ( entID >= 0 ) return &g_entities[entID]; if ( checkAlerts ) { int alertEvent = NPC_CheckAlertEvents( qtrue, qtrue, -1, qtrue, AEL_DISCOVERED ); //There is an event to look at if ( alertEvent >= 0 ) { alertEvent_t *event = &level.alertEvents[alertEvent]; //Don't pay attention to our own alerts if ( event->owner == NPC ) return NULL; if ( event->level >= AEL_DISCOVERED ) { //If it's the player, attack him if ( event->owner == &g_entities[0] ) return event->owner; //If it's on our team, then take its enemy as well if ( ( event->owner->client ) && ( event->owner->client->playerTeam == NPC->client->playerTeam ) ) return event->owner->enemy; } } } return NULL; } /* ------------------------- NPC_FindPlayer ------------------------- */ qboolean NPC_FindPlayer( void ) { return NPC_TargetVisible( &g_entities[0] ); } /* ------------------------- NPC_CheckPlayerDistance ------------------------- */ static qboolean NPC_CheckPlayerDistance( void ) { //Make sure we have an enemy if ( NPC->enemy == NULL ) return qfalse; //Only do this for non-players if ( NPC->enemy->s.number == 0 ) return qfalse; //must be set up to get mad at player if ( !NPC->client || NPC->client->enemyTeam != TEAM_PLAYER ) return qfalse; //Must be within our FOV if ( InFOV( &g_entities[0], NPC, NPCInfo->stats.hfov, NPCInfo->stats.vfov ) == qfalse ) return qfalse; float distance = DistanceSquared( NPC->currentOrigin, NPC->enemy->currentOrigin ); if ( distance > DistanceSquared( NPC->currentOrigin, g_entities[0].currentOrigin ) ) { G_SetEnemy( NPC, &g_entities[0] ); return qtrue; } return qfalse; } /* ------------------------- NPC_FindEnemy ------------------------- */ qboolean NPC_FindEnemy( qboolean checkAlerts = qfalse ) { //We're ignoring all enemies for now if( NPC->svFlags & SVF_IGNORE_ENEMIES ) { G_ClearEnemy( NPC ); return qfalse; } //we can't pick up any enemies for now if( NPCInfo->confusionTime > level.time ) { G_ClearEnemy( NPC ); return qfalse; } //Don't want a new enemy if ( ( NPC_ValidEnemy( NPC->enemy ) ) && ( NPC->svFlags & SVF_LOCKEDENEMY ) ) return qtrue; //See if the player is closer than our current enemy if ( NPC->client->NPC_class != CLASS_RANCOR && NPC->client->NPC_class != CLASS_WAMPA && NPC->client->NPC_class != CLASS_SAND_CREATURE && NPC_CheckPlayerDistance() ) {//rancors, wampas & sand creatures don't care if player is closer, they always go with closest return qtrue; } //Otherwise, turn off the flag NPC->svFlags &= ~SVF_LOCKEDENEMY; //If we've gotten here alright, then our target it still valid if ( NPC_ValidEnemy( NPC->enemy ) ) return qtrue; gentity_t *newenemy = NPC_PickEnemyExt( checkAlerts ); //if we found one, take it as the enemy if( NPC_ValidEnemy( newenemy ) ) { G_SetEnemy( NPC, newenemy ); return qtrue; } G_ClearEnemy( NPC ); return qfalse; } /* ------------------------- NPC_CheckEnemyExt ------------------------- */ qboolean NPC_CheckEnemyExt( qboolean checkAlerts ) { //Make sure we're ready to think again /* if ( NPCInfo->enemyCheckDebounceTime > level.time ) return qfalse; //Get our next think time NPCInfo->enemyCheckDebounceTime = level.time + NPC_GetCheckDelta(); //Attempt to find an enemy return NPC_FindEnemy(); */ return NPC_FindEnemy( checkAlerts ); } /* ------------------------- NPC_FacePosition ------------------------- */ qboolean NPC_FacePosition( vec3_t position, qboolean doPitch ) { vec3_t muzzle; qboolean facing = qtrue; //Get the positions if ( NPC->client && (NPC->client->NPC_class == CLASS_RANCOR || NPC->client->NPC_class == CLASS_WAMPA || NPC->client->NPC_class == CLASS_SAND_CREATURE) ) { CalcEntitySpot( NPC, SPOT_ORIGIN, muzzle ); muzzle[2] += NPC->maxs[2] * 0.75f; } else if ( NPC->client && NPC->client->NPC_class == CLASS_GALAKMECH ) { CalcEntitySpot( NPC, SPOT_WEAPON, muzzle ); } else { CalcEntitySpot( NPC, SPOT_HEAD_LEAN, muzzle );//SPOT_HEAD if ( NPC->client->NPC_class == CLASS_ROCKETTROOPER ) {//*sigh*, look down more position[2] -= 32; } } //Find the desired angles vec3_t angles; GetAnglesForDirection( muzzle, position, angles ); NPCInfo->desiredYaw = AngleNormalize360( angles[YAW] ); NPCInfo->desiredPitch = AngleNormalize360( angles[PITCH] ); if ( NPC->enemy && NPC->enemy->client && NPC->enemy->client->NPC_class == CLASS_ATST ) { // FIXME: this is kind of dumb, but it was the easiest way to get it to look sort of ok NPCInfo->desiredYaw += Q_flrand( -5, 5 ) + sin( level.time * 0.004f ) * 7; NPCInfo->desiredPitch += Q_flrand( -2, 2 ); } //Face that yaw NPC_UpdateAngles( qtrue, qtrue ); //Find the delta between our goal and our current facing float yawDelta = AngleNormalize360( NPCInfo->desiredYaw - ( SHORT2ANGLE( ucmd.angles[YAW] + client->ps.delta_angles[YAW] ) ) ); //See if we are facing properly if ( fabs( yawDelta ) > VALID_ATTACK_CONE ) facing = qfalse; if ( doPitch ) { //Find the delta between our goal and our current facing float currentAngles = ( SHORT2ANGLE( ucmd.angles[PITCH] + client->ps.delta_angles[PITCH] ) ); float pitchDelta = NPCInfo->desiredPitch - currentAngles; //See if we are facing properly if ( fabs( pitchDelta ) > VALID_ATTACK_CONE ) facing = qfalse; } return facing; } /* ------------------------- NPC_FaceEntity ------------------------- */ qboolean NPC_FaceEntity( gentity_t *ent, qboolean doPitch ) { vec3_t entPos; //Get the positions CalcEntitySpot( ent, SPOT_HEAD_LEAN, entPos ); return NPC_FacePosition( entPos, doPitch ); } /* ------------------------- NPC_FaceEnemy ------------------------- */ qboolean NPC_FaceEnemy( qboolean doPitch ) { if ( NPC == NULL ) return qfalse; if ( NPC->enemy == NULL ) return qfalse; return NPC_FaceEntity( NPC->enemy, doPitch ); } /* ------------------------- NPC_CheckCanAttackExt ------------------------- */ qboolean NPC_CheckCanAttackExt( void ) { //We don't want them to shoot if( NPCInfo->scriptFlags & SCF_DONT_FIRE ) return qfalse; //Turn to face if ( NPC_FaceEnemy( qtrue ) == qfalse ) return qfalse; //Must have a clear line of sight to the target if ( NPC_ClearShot( NPC->enemy ) == qfalse ) return qfalse; return qtrue; } /* ------------------------- NPC_ClearLookTarget ------------------------- */ void NPC_ClearLookTarget( gentity_t *self ) { if ( !self->client ) { return; } self->client->renderInfo.lookTarget = ENTITYNUM_NONE;//ENTITYNUM_WORLD; self->client->renderInfo.lookTargetClearTime = 0; } /* ------------------------- NPC_SetLookTarget ------------------------- */ void NPC_SetLookTarget( gentity_t *self, int entNum, int clearTime ) { if ( !self->client ) { return; } self->client->renderInfo.lookTarget = entNum; self->client->renderInfo.lookTargetClearTime = clearTime; } /* ------------------------- NPC_CheckLookTarget ------------------------- */ qboolean NPC_CheckLookTarget( gentity_t *self ) { if ( self->client ) { if ( self->client->renderInfo.lookTarget >= 0 && self->client->renderInfo.lookTarget < ENTITYNUM_WORLD ) {//within valid range if ( (&g_entities[self->client->renderInfo.lookTarget] == NULL) || !g_entities[self->client->renderInfo.lookTarget].inuse ) {//lookTarget not inuse or not valid anymore NPC_ClearLookTarget( self ); } else if ( self->client->renderInfo.lookTargetClearTime && self->client->renderInfo.lookTargetClearTime < level.time ) {//Time to clear lookTarget NPC_ClearLookTarget( self ); } else if ( g_entities[self->client->renderInfo.lookTarget].client && self->enemy && (&g_entities[self->client->renderInfo.lookTarget] != self->enemy) ) {//should always look at current enemy if engaged in battle... FIXME: this could override certain scripted lookTargets...??? NPC_ClearLookTarget( self ); } else { return qtrue; } } } return qfalse; } /* ------------------------- NPC_CheckCharmed ------------------------- */ extern void G_AddVoiceEvent( gentity_t *self, int event, int speakDebounceTime ); void G_CheckCharmed( gentity_t *self ) { if ( self && self->client && self->client->playerTeam == TEAM_PLAYER && self->NPC && self->NPC->charmedTime && (self->NPC->charmedTime < level.time ||self->health <= 0) ) {//we were charmed, set us back! //NOTE: presumptions here... team_t savTeam = self->client->enemyTeam; self->client->enemyTeam = self->client->playerTeam; self->client->playerTeam = savTeam; self->client->leader = NULL; self->NPC->charmedTime = 0; if ( self->health > 0 ) { if ( self->NPC->tempBehavior == BS_FOLLOW_LEADER ) { self->NPC->tempBehavior = BS_DEFAULT; } G_ClearEnemy( self ); //say something to let player know you've snapped out of it G_AddVoiceEvent( self, Q_irand(EV_CONFUSE1, EV_CONFUSE3), 2000 ); } } } void G_GetBoltPosition( gentity_t *self, int boltIndex, vec3_t pos, int modelIndex = 0 ) { if ( !self || !self->ghoul2.size() ) { return; } mdxaBone_t boltMatrix; vec3_t result, angles={0,self->currentAngles[YAW],0}; gi.G2API_GetBoltMatrix( self->ghoul2, modelIndex, boltIndex, &boltMatrix, angles, self->currentOrigin, (cg.time?cg.time:level.time), NULL, self->s.modelScale ); if ( pos ) { gi.G2API_GiveMeVectorFromMatrix( boltMatrix, ORIGIN, result ); VectorCopy( result, pos ); } } float NPC_EntRangeFromBolt( gentity_t *targEnt, int boltIndex ) { vec3_t org = { 0.0f }; if ( !targEnt ) { return Q3_INFINITE; } G_GetBoltPosition( NPC, boltIndex, org ); return (Distance( targEnt->currentOrigin, org )); } float NPC_EnemyRangeFromBolt( int boltIndex ) { return (NPC_EntRangeFromBolt( NPC->enemy, boltIndex )); } int G_GetEntsNearBolt( gentity_t *self, gentity_t **radiusEnts, float radius, int boltIndex, vec3_t boltOrg ) { vec3_t mins, maxs; int i; //get my handRBolt's position vec3_t org = { 0.0f }; G_GetBoltPosition( self, boltIndex, org ); VectorCopy( org, boltOrg ); //Setup the bbox to search in for ( i = 0; i < 3; i++ ) { mins[i] = boltOrg[i] - radius; maxs[i] = boltOrg[i] + radius; } //Get the number of entities in a given space return (gi.EntitiesInBox( mins, maxs, radiusEnts, 128 )); } int NPC_GetEntsNearBolt( gentity_t **radiusEnts, float radius, int boltIndex, vec3_t boltOrg ) { return (G_GetEntsNearBolt( NPC, radiusEnts, radius, boltIndex, boltOrg )); } extern qboolean RT_Flying( gentity_t *self ); extern void RT_FlyStart( gentity_t *self ); extern void RT_FlyStop( gentity_t *self ); extern qboolean Boba_Flying( gentity_t *self ); extern void Boba_FlyStart( gentity_t *self ); extern void Boba_FlyStop( gentity_t *self ); qboolean JET_Flying( gentity_t *self ) { if ( !self || !self->client ) { return qfalse; } if ( self->client->NPC_class == CLASS_BOBAFETT ) { return (Boba_Flying(self)); } else if ( self->client->NPC_class == CLASS_ROCKETTROOPER ) { return (RT_Flying(self)); } else { return qfalse; } } void JET_FlyStart( gentity_t *self ) { if ( !self || !self->client ) { return; } self->lastInAirTime = level.time; if ( self->client->NPC_class == CLASS_BOBAFETT ) { Boba_FlyStart( self ); } else if ( self->client->NPC_class == CLASS_ROCKETTROOPER ) { RT_FlyStart( self ); } } void JET_FlyStop( gentity_t *self ) { if ( !self || !self->client ) { return; } if ( self->client->NPC_class == CLASS_BOBAFETT ) { Boba_FlyStop( self ); } else if ( self->client->NPC_class == CLASS_ROCKETTROOPER ) { RT_FlyStop( self ); } }
BruceJohnJennerLawso/OtherJK
code/game/NPC_utils.cpp
C++
gpl-2.0
37,217
<?php /* Plugin Name: Unused Shortcodes Plugin URI: https://surpriseazwebservices.com/wordpress-plugins/wordpress-unused-shortcodes/ Donate link: https://www.paypal.com/cgi-bin/webscr?cmd=_s-xclick&hosted_button_id=4CZMFDE6YG95L Description: A plugin to display shortcodes that are not currently being used on a WordPress site. Version: 1.0.1 Author: Scott DeLuzio Author URI: https://surpriseazwebservices.com License: GPL2 */ /* Copyright 2013 Scott DeLuzio (email : scott (at) surpriseazwebservices.com) This program is free software; you can redistribute it and/or modify it under the terms of the GNU General Public License, version 2, as published by the Free Software Foundation. This program is distributed in the hope that it will be useful, but WITHOUT ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License for more details. You should have received a copy of the GNU General Public License along with this program; if not, write to the Free Software Foundation, Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA */ /* Add language support */ function unused_sc_lang() { load_plugin_textdomain('php_info_translate', false, dirname(plugin_basename(__FILE__)) . '/lang/'); } add_action('init', 'unused_sc_lang'); /* Settings Page */ // Hook for adding admin menus add_action('admin_menu', 'unusedshortcodes'); // action function for above hook function unusedshortcodes() { // Add a new submenu under Settings: add_options_page('Unused Shortcodes','Unused Shortcodes', 'manage_options', 'unusedshortcodes', 'unusedshortcodespage'); } add_action('admin_init', 'register_unused_shortcodes_settings'); function activate_unused_shortcodes() { add_option('find_shortcode', 'Enter Shortcode Here'); } function deactivate_unused_shortcodes() { delete_option('find_shortcode'); } register_activation_hook(__FILE__, 'activate_unused_shortcodes'); register_deactivation_hook(__FILE__, 'deactivate_unused_shortcodes'); function register_unused_shortcodes_settings() { register_setting( 'unused_shortcodes_group', 'find_shortcode'); } // Display the page content for the submenu function unusedshortcodespage() { include(WP_PLUGIN_DIR.'/unused-shortcodes/options.php'); } /* Find each available shortcode in a page or post */ function find_shortcodes($atts) { ob_start(); extract(shortcode_atts(array('find' => ''), $atts)); $string = "["; $string .= $atts['find']; $args = array('s' => $string); $the_query = new WP_Query( $args ); if ( $the_query->have_posts() ) { echo '<strong>' . $string . ']</strong> '; echo _e('is currently in use in the following page(s)/post(s):', 'unused_sc_lang'); echo '<ul>'; while ( $the_query->have_posts() ) { $the_query->the_post(); ?> <li><a href="<?php the_permalink(); ?>"><?php the_title(); ?></a> | <?php edit_post_link(); ?></li> <?php } echo '</ul>'; } else { echo _e('No posts found using the shortcode ', 'unused_sc_lang') . '<strong>' . $string . ']</strong>'; } wp_reset_postdata(); return ob_get_clean(); } add_shortcode('unusedshortcodes', 'find_shortcodes'); ?>
wp-plugins/unused-shortcodes
unused-shortcodes.php
PHP
gpl-2.0
3,379
using UnityEngine; using System.Collections; public class FloppySpin : MonoBehaviour { void Update () { transform.Rotate(new Vector3(0.0f, 1.0f, 0.0f), -90.0f * Time.deltaTime, Space.World); } }
RocketSurgery/DDRGame
Assets/Scripts/FloppySpin.cs
C#
gpl-2.0
204
<?php /** * @package Chunk */ get_header(); ?> <?php if ( is_archive() ) : ?> <div class="page-title"> <h2> <?php if ( is_day() ) : ?> <?php printf( __( 'Posted on %s &hellip;', 'chunk' ), '<span>' . get_the_date() . '</span>' ); ?> <?php elseif ( is_month() ) : ?> <?php printf( __( 'Posted in %s &hellip;', 'chunk' ), '<span>' . get_the_date( 'F Y' ) . '</span>' ); ?> <?php elseif ( is_year() ) : ?> <?php printf( __( 'Posted in %s &hellip;', 'chunk' ), '<span>' . get_the_date( 'Y' ) . '</span>' ); ?> <?php elseif( is_author() ) : ?> <?php printf( __( 'Posted by %s &hellip;', 'chunk' ), '<span>' . get_the_author() . '</span>' ); ?> <?php elseif ( is_category() ) : ?> <?php printf( __( 'Filed under %s &hellip;', 'chunk' ), '<span>' . single_cat_title( '', false ) . '</span>' ); ?> <?php elseif ( is_tag() ) : ?> <?php printf( __( 'Tagged with %s &hellip;', 'chunk' ), '<span>' . single_tag_title( '', false ) . '</span>' ); ?> <?php endif; ?> </h2> </div> <?php endif; ?> <?php if ( is_search() ) : ?> <div class="page-title"> <h2> <?php printf( __( 'Matches for: &ldquo;%s&rdquo; &hellip;', 'chunk' ), '<span>' . get_search_query() . '</span>' ); ?> </h2> </div> <?php endif; ?> <div id="contents"> <?php if ( have_posts() ) : ?> <?php while ( have_posts() ) : the_post(); ?> <?php get_template_part( 'content', get_post_format() ); ?> <?php endwhile; ?> <?php else : ?> <div class="hentry error404"> <div class="postbody text"> <h1><?php _e( 'Nothing Found', 'chunk' ); ?></h1> <div class="content"> <p><?php _e( 'Apologies, but no results were found for the requested archive. Perhaps searching will help find a related post.', 'chunk' ); ?></p> <?php get_search_form(); ?> </div><!-- .content --> </div><!-- .postbody --> </div> <?php endif; ?> </div><!-- #contents --> <div class="navigation"> <div class="nav-previous"><?php next_posts_link( __( '<span class="meta-nav">&larr;</span> Older posts', 'chunk' ) ); ?></div> <div class="nav-next"><?php previous_posts_link( __( 'Newer posts <span class="meta-nav">&rarr;</span>', 'chunk' ) ); ?></div> </div> <?php get_footer(); ?>
firmread/avsysblog
wp-content/themes/chunk/index.php
PHP
gpl-2.0
2,209