content stringlengths 27 928k | path stringlengths 4 230 | size int64 27 928k | nl_text stringlengths 21 396k | nl_size int64 21 396k | nl_language stringlengths 2 3 | nl_language_score float64 0.04 1 |
|---|---|---|---|---|---|---|
from types import BeaverException, Variable, Collection, EmptyCollection, updated_context
from copy import deepcopy as copy
class Statement(object):
'''A generic statement containing any number of variable parts.'''
def __init__(self, subject, verb_objects):
self.subject = subject
self.verb_objects = [(v, list(o)) for v, o in verb_objects]
def __str__(self):
return '%s %s .' % (str(self.subject),
' ; '.join(['%s %s' % (str(verb),
', '.join([str(o) for o in objects]))
for verb, objects in self.verb_objects])
)
def __repr__(self): return str(self)
def __eq__(self, x): return str(self) == str(x)
def replace(self, *varsets):
'''Checks each part of the statement against defined variables. If any
matches are found, the statement is updated. If the statement is a function
call, a new set of statements is returned; otherwise, None is returned.'''
matched = False
# check for single variables in statement
subj = self.subject
if isinstance(subj, Variable):
result, new_match = def_match(subj, varsets)
if result:
self.subject = new_match
return self.replace(*varsets)
for n, (verb, objects) in enumerate(self.verb_objects):
if isinstance(verb, Variable):
result, new_match = def_match(verb, varsets)
if result:
v, o = self.verb_objects[n]
self.verb_objects[n] = (new_match, o)
return self.replace(*varsets)
for m, obj in enumerate(objects):
if isinstance(obj, Variable):
result, new_match = def_match(obj, varsets)
if result:
objects[m] = new_match
return self.replace(*varsets)
return None
def match(given, definition):
'''Returns true if a given argument matches the definition.'''
if isinstance(definition, Variable): return True
return definition == given
def def_match(part, varsets):
matched = False
for varset in varsets:
if matched: break
if part in varset:
defs = varset[part]
for (pattern, definition) in defs:
if matched: break
if part == definition: continue
if pattern is None:
definition = copy(definition)
# a match was found; replace the variable with its definition
if isinstance(definition, tuple): definition = list(definition)
return (True, definition)
return (False, None)
| lib/statement.py | 2,998 | A generic statement containing any number of variable parts.
Returns true if a given argument matches the definition.
Checks each part of the statement against defined variables. If any
matches are found, the statement is updated. If the statement is a function
call, a new set of statements is returned; otherwise, None is returned.
check for single variables in statement a match was found; replace the variable with its definition | 435 | en | 0.851862 |
import copy
import numpy as np
import torch
from mmpose.core import (aggregate_results, get_group_preds,
get_multi_stage_outputs)
def test_get_multi_stage_outputs():
fake_outputs = [torch.zeros((1, 4, 2, 2))]
fake_flip_outputs = [torch.ones((1, 4, 2, 2))]
# outputs_flip
outputs, heatmaps, tags = \
get_multi_stage_outputs(outputs=copy.deepcopy(fake_outputs),
outputs_flip=None,
num_joints=4, with_heatmaps=[False],
with_ae=[True])
assert heatmaps == []
outputs, heatmaps, tags = \
get_multi_stage_outputs(outputs=copy.deepcopy(fake_outputs),
outputs_flip=None,
num_joints=2, with_heatmaps=[True],
with_ae=[True])
assert len(heatmaps) == 1
flip_index = [1, 0]
outputs, heatmaps, tags = \
get_multi_stage_outputs(outputs=copy.deepcopy(fake_outputs),
outputs_flip=fake_flip_outputs,
num_joints=2, with_heatmaps=[True],
with_ae=[True], flip_index=flip_index)
assert len(heatmaps) == 2
outputs, heatmaps, tags = \
get_multi_stage_outputs(outputs=copy.deepcopy(fake_outputs),
tag_per_joint=False,
outputs_flip=fake_flip_outputs,
num_joints=2, with_heatmaps=[True],
with_ae=[True], flip_index=flip_index)
assert len(heatmaps) == 2
# with heatmaps & with ae
fake_outputs = [torch.zeros((1, 4, 2, 2)), torch.ones((1, 2, 4, 4))]
fake_flip_outputs = [torch.ones((1, 4, 2, 2)), torch.ones((1, 2, 4, 4))]
outputs, heatmaps, tags = \
get_multi_stage_outputs(outputs=copy.deepcopy(fake_outputs),
outputs_flip=None,
num_joints=2, with_heatmaps=[True, False],
with_ae=[True, True])
assert torch.allclose(heatmaps[0], torch.tensor(0.))
outputs, heatmaps, tags = \
get_multi_stage_outputs(outputs=copy.deepcopy(fake_outputs),
outputs_flip=fake_flip_outputs,
num_joints=2, with_heatmaps=[True, True],
with_ae=[True, False])
assert torch.allclose(heatmaps[0], torch.tensor(0.5))
outputs, heatmaps, tags = \
get_multi_stage_outputs(outputs=copy.deepcopy(fake_outputs),
outputs_flip=fake_flip_outputs,
num_joints=2, with_heatmaps=[True, False],
with_ae=[True, False], flip_index=flip_index)
assert torch.allclose(heatmaps[0], torch.tensor(0.))
# size_projected
outputs, heatmaps, tags = \
get_multi_stage_outputs(outputs=copy.deepcopy(fake_outputs),
outputs_flip=None,
num_joints=2, with_heatmaps=[True, True],
with_ae=[True, False],
size_projected=(8, 8))
assert heatmaps[0].shape == torch.Size([1, 2, 8, 8])
outputs, heatmaps, tags = \
get_multi_stage_outputs(outputs=copy.deepcopy(fake_outputs),
outputs_flip=fake_flip_outputs,
num_joints=2, with_heatmaps=[True, True],
with_ae=[True, False],
align_corners=True)
assert torch.allclose(heatmaps[0], torch.tensor(0.5))
def test_aggregate_results():
fake_heatmaps = [torch.zeros((1, 2, 2, 2))]
fake_tags = [torch.zeros((1, 2, 2, 2))]
aggregated_heatmaps, tags_list = \
aggregate_results(scale=1, aggregated_heatmaps=None, tags_list=[],
heatmaps=fake_heatmaps, tags=fake_tags,
test_scale_factor=[1], project2image=True,
flip_test=False)
assert torch.allclose(aggregated_heatmaps, torch.tensor(0.))
fake_aggr_heatmaps = torch.ones(1, 2, 2, 2)
aggregated_heatmaps, tags_list = \
aggregate_results(scale=1, aggregated_heatmaps=fake_aggr_heatmaps,
tags_list=[], heatmaps=fake_heatmaps,
tags=fake_tags, test_scale_factor=[1],
project2image=True, flip_test=False)
assert torch.allclose(aggregated_heatmaps, torch.tensor(1.))
aggregated_heatmaps, tags_list = \
aggregate_results(scale=1, aggregated_heatmaps=fake_aggr_heatmaps,
tags_list=[], heatmaps=fake_heatmaps,
tags=fake_tags, test_scale_factor=[1],
project2image=True, flip_test=False,
align_corners=True)
assert torch.allclose(aggregated_heatmaps, torch.tensor(1.))
fake_heatmaps = [torch.zeros((1, 2, 2, 2)), torch.ones((1, 2, 2, 2))]
fake_aggr_heatmaps = torch.ones(1, 2, 4, 4)
aggregated_heatmaps, tags_list = \
aggregate_results(scale=1, aggregated_heatmaps=fake_aggr_heatmaps,
tags_list=[], heatmaps=fake_heatmaps,
tags=fake_tags, test_scale_factor=[1],
project2image=False, flip_test=True)
assert aggregated_heatmaps.shape == torch.Size((1, 2, 4, 4))
aggregated_heatmaps, tags_list = \
aggregate_results(scale=2, aggregated_heatmaps=fake_aggr_heatmaps,
tags_list=[], heatmaps=fake_heatmaps,
tags=fake_tags, test_scale_factor=[1, 2],
project2image=False, flip_test=True)
assert aggregated_heatmaps.shape == torch.Size((1, 2, 4, 4))
def test_get_group_preds():
fake_grouped_joints = [np.array([[[0, 0], [1, 1]]])]
results = get_group_preds(
fake_grouped_joints,
center=np.array([0, 0]),
scale=np.array([1, 1]),
heatmap_size=np.array([2, 2]))
assert not results == []
results = get_group_preds(
fake_grouped_joints,
center=np.array([0, 0]),
scale=np.array([1, 1]),
heatmap_size=np.array([2, 2]),
use_udp=True)
assert not results == []
| tests/test_evaluation/test_bottom_up_eval.py | 6,525 | outputs_flip with heatmaps & with ae size_projected | 51 | en | 0.902308 |
import typing
from typing import List
from quarkchain.core import (
CrossShardTransactionList,
MinorBlock,
MinorBlockHeader,
RootBlock,
TransactionReceipt,
Log,
FixedSizeBytesSerializer,
biguint,
Constant,
)
from quarkchain.core import (
TypedTransaction,
Optional,
PrependedSizeBytesSerializer,
PrependedSizeListSerializer,
Serializable,
Address,
Branch,
TokenBalanceMap,
PrependedSizeMapSerializer,
)
from quarkchain.core import (
hash256,
uint16,
uint32,
uint64,
uint256,
boolean,
signature65,
)
# RPCs to initialize a cluster
class Ping(Serializable):
FIELDS = [
("id", PrependedSizeBytesSerializer(4)),
("full_shard_id_list", PrependedSizeListSerializer(4, uint32)),
("root_tip", Optional(RootBlock)), # Initialize ShardState if not None
]
def __init__(self, id, full_shard_id_list, root_tip):
""" Empty full_shard_id_list means root """
if isinstance(id, bytes):
self.id = id
else:
self.id = bytes(id, "ascii")
self.full_shard_id_list = full_shard_id_list
self.root_tip = root_tip
class Pong(Serializable):
FIELDS = [
("id", PrependedSizeBytesSerializer(4)),
("full_shard_id_list", PrependedSizeListSerializer(4, uint32)),
]
def __init__(self, id, full_shard_id_list):
""" Empty slave_id and full_shard_id_list means root """
if isinstance(id, bytes):
self.id = id
else:
self.id = bytes(id, "ascii")
self.full_shard_id_list = full_shard_id_list
class SlaveInfo(Serializable):
FIELDS = [
("id", PrependedSizeBytesSerializer(4)),
("host", PrependedSizeBytesSerializer(4)),
("port", uint16),
("full_shard_id_list", PrependedSizeListSerializer(4, uint32)),
]
def __init__(self, id, host, port, full_shard_id_list):
self.id = id if isinstance(id, bytes) else bytes(id, "ascii")
self.host = host if isinstance(host, bytes) else bytes(host, "ascii")
self.port = port
self.full_shard_id_list = full_shard_id_list
class ConnectToSlavesRequest(Serializable):
""" Master instructs a slave to connect to other slaves """
FIELDS = [("slave_info_list", PrependedSizeListSerializer(4, SlaveInfo))]
def __init__(self, slave_info_list):
self.slave_info_list = slave_info_list
class ConnectToSlavesResponse(Serializable):
""" result_list must have the same size as salve_info_list in the request.
Empty result means success otherwise it would a serialized error message.
"""
FIELDS = [
("result_list", PrependedSizeListSerializer(4, PrependedSizeBytesSerializer(4)))
]
def __init__(self, result_list):
self.result_list = result_list
class ArtificialTxConfig(Serializable):
FIELDS = [("target_root_block_time", uint32), ("target_minor_block_time", uint32)]
def __init__(self, target_root_block_time, target_minor_block_time):
self.target_root_block_time = target_root_block_time
self.target_minor_block_time = target_minor_block_time
class MineRequest(Serializable):
"""Send mining instructions to slaves"""
FIELDS = [
("artificial_tx_config", ArtificialTxConfig),
("mining", boolean), # False to halt mining
]
def __init__(self, artificial_tx_config, mining):
self.artificial_tx_config = artificial_tx_config
self.mining = mining
class MineResponse(Serializable):
FIELDS = [("error_code", uint32)]
def __init__(self, error_code):
self.error_code = error_code
class GenTxRequest(Serializable):
"""Generate transactions for loadtesting"""
FIELDS = [
("num_tx_per_shard", uint32),
("x_shard_percent", uint32), # [0, 100]
("tx", TypedTransaction), # sample tx
]
def __init__(self, num_tx_per_shard, x_shard_percent, tx):
self.num_tx_per_shard = num_tx_per_shard
self.x_shard_percent = x_shard_percent
self.tx = tx
class GenTxResponse(Serializable):
FIELDS = [("error_code", uint32)]
def __init__(self, error_code):
self.error_code = error_code
# Virtual connection management
class CreateClusterPeerConnectionRequest(Serializable):
""" Broadcast to the cluster and announce that a peer connection is created
Assume always succeed.
"""
FIELDS = [("cluster_peer_id", uint64)]
def __init__(self, cluster_peer_id):
self.cluster_peer_id = cluster_peer_id
class CreateClusterPeerConnectionResponse(Serializable):
FIELDS = [("error_code", uint32)]
def __init__(self, error_code):
self.error_code = error_code
class DestroyClusterPeerConnectionCommand(Serializable):
""" Broadcast to the cluster and announce that a peer connection is lost
As a contract, the master will not send traffic after the command.
"""
FIELDS = [("cluster_peer_id", uint64)]
def __init__(self, cluster_peer_id):
self.cluster_peer_id = cluster_peer_id
# RPCs to lookup data from shards (master -> slaves)
class GetMinorBlockRequest(Serializable):
FIELDS = [
("branch", Branch),
("minor_block_hash", hash256),
("height", uint64),
("need_extra_info", boolean),
]
def __init__(self, branch, minor_block_hash=None, height=0, need_extra_info=False):
self.branch = branch
self.minor_block_hash = minor_block_hash if minor_block_hash else bytes(32)
self.height = height
self.need_extra_info = need_extra_info
class MinorBlockExtraInfo(Serializable):
FIELDS = [
("effective_difficulty", biguint),
("posw_mineable_blocks", uint16),
("posw_mined_blocks", uint16),
]
def __init__(
self,
effective_difficulty: int,
posw_mineable_blocks: int,
posw_mined_blocks: int,
):
self.effective_difficulty = effective_difficulty
self.posw_mineable_blocks = posw_mineable_blocks
self.posw_mined_blocks = posw_mined_blocks
class GetMinorBlockResponse(Serializable):
FIELDS = [
("error_code", uint32),
("minor_block", MinorBlock),
("extra_info", Optional(MinorBlockExtraInfo)),
]
def __init__(self, error_code, minor_block, extra_info=None):
self.error_code = error_code
self.minor_block = minor_block
self.extra_info = extra_info
class GetTransactionRequest(Serializable):
FIELDS = [("tx_hash", hash256), ("branch", Branch)]
def __init__(self, tx_hash, branch):
self.tx_hash = tx_hash
self.branch = branch
class GetTransactionResponse(Serializable):
FIELDS = [("error_code", uint32), ("minor_block", MinorBlock), ("index", uint32)]
def __init__(self, error_code, minor_block, index):
self.error_code = error_code
self.minor_block = minor_block
self.index = index
class ExecuteTransactionRequest(Serializable):
FIELDS = [
("tx", TypedTransaction),
("from_address", Address),
("block_height", Optional(uint64)),
]
def __init__(self, tx, from_address, block_height: typing.Optional[int]):
self.tx = tx
self.from_address = from_address
self.block_height = block_height
class ExecuteTransactionResponse(Serializable):
FIELDS = [("error_code", uint32), ("result", PrependedSizeBytesSerializer(4))]
def __init__(self, error_code, result):
self.error_code = error_code
self.result = result
class GetTransactionReceiptRequest(Serializable):
FIELDS = [("tx_hash", hash256), ("branch", Branch)]
def __init__(self, tx_hash, branch):
self.tx_hash = tx_hash
self.branch = branch
class GetTransactionReceiptResponse(Serializable):
FIELDS = [
("error_code", uint32),
("minor_block", MinorBlock),
("index", uint32),
("receipt", TransactionReceipt),
]
def __init__(self, error_code, minor_block, index, receipt):
self.error_code = error_code
self.minor_block = minor_block
self.index = index
self.receipt = receipt
class GetTransactionListByAddressRequest(Serializable):
FIELDS = [
("address", Address),
("transfer_token_id", Optional(uint64)),
("start", PrependedSizeBytesSerializer(4)),
("limit", uint32),
]
def __init__(self, address, transfer_token_id, start, limit):
self.address = address
self.transfer_token_id = transfer_token_id
self.start = start
self.limit = limit
class TransactionDetail(Serializable):
FIELDS = [
("tx_hash", hash256),
("nonce", uint64),
("from_address", Address),
("to_address", Optional(Address)),
("value", uint256),
("block_height", uint64),
("timestamp", uint64), # block timestamp
("success", boolean),
("gas_token_id", uint64),
("transfer_token_id", uint64),
("is_from_root_chain", boolean),
]
def __init__(
self,
tx_hash,
nonce,
from_address,
to_address,
value,
block_height,
timestamp,
success,
gas_token_id,
transfer_token_id,
is_from_root_chain,
):
self.tx_hash = tx_hash
self.nonce = nonce
self.from_address = from_address
self.to_address = to_address
self.value = value
self.block_height = block_height
self.timestamp = timestamp
self.success = success
self.gas_token_id = gas_token_id
self.transfer_token_id = transfer_token_id
self.is_from_root_chain = is_from_root_chain
class GetTransactionListByAddressResponse(Serializable):
FIELDS = [
("error_code", uint32),
("tx_list", PrependedSizeListSerializer(4, TransactionDetail)),
("next", PrependedSizeBytesSerializer(4)),
]
def __init__(self, error_code, tx_list, next):
self.error_code = error_code
self.tx_list = tx_list
self.next = next
class GetAllTransactionsRequest(Serializable):
FIELDS = [
("branch", Branch),
("start", PrependedSizeBytesSerializer(4)),
("limit", uint32),
]
def __init__(self, branch, start, limit):
self.branch = branch
self.start = start
self.limit = limit
class GetAllTransactionsResponse(Serializable):
FIELDS = [
("error_code", uint32),
("tx_list", PrependedSizeListSerializer(4, TransactionDetail)),
("next", PrependedSizeBytesSerializer(4)),
]
def __init__(self, error_code, tx_list, next):
self.error_code = error_code
self.tx_list = tx_list
self.next = next
# RPCs to update blockchains
# master -> slave
class AddRootBlockRequest(Serializable):
""" Add root block to each slave
"""
FIELDS = [("root_block", RootBlock), ("expect_switch", boolean)]
def __init__(self, root_block, expect_switch):
self.root_block = root_block
self.expect_switch = expect_switch
class AddRootBlockResponse(Serializable):
FIELDS = [("error_code", uint32), ("switched", boolean)]
def __init__(self, error_code, switched):
self.error_code = error_code
self.switched = switched
class EcoInfo(Serializable):
""" Necessary information for master to decide the best block to mine """
FIELDS = [
("branch", Branch),
("height", uint64),
("coinbase_amount", uint256),
("difficulty", biguint),
("unconfirmed_headers_coinbase_amount", uint256),
]
def __init__(
self,
branch,
height,
coinbase_amount,
difficulty,
unconfirmed_headers_coinbase_amount,
):
self.branch = branch
self.height = height
self.coinbase_amount = coinbase_amount
self.difficulty = difficulty
self.unconfirmed_headers_coinbase_amount = unconfirmed_headers_coinbase_amount
class GetEcoInfoListRequest(Serializable):
FIELDS = []
def __init__(self):
pass
class GetEcoInfoListResponse(Serializable):
FIELDS = [
("error_code", uint32),
("eco_info_list", PrependedSizeListSerializer(4, EcoInfo)),
]
def __init__(self, error_code, eco_info_list):
self.error_code = error_code
self.eco_info_list = eco_info_list
class GetNextBlockToMineRequest(Serializable):
FIELDS = [
("branch", Branch),
("address", Address),
("artificial_tx_config", ArtificialTxConfig),
]
def __init__(self, branch, address, artificial_tx_config):
self.branch = branch
self.address = address
self.artificial_tx_config = artificial_tx_config
class GetNextBlockToMineResponse(Serializable):
FIELDS = [("error_code", uint32), ("block", MinorBlock)]
def __init__(self, error_code, block):
self.error_code = error_code
self.block = block
class AddMinorBlockRequest(Serializable):
"""For adding blocks mined through JRPC"""
FIELDS = [("minor_block_data", PrependedSizeBytesSerializer(4))]
def __init__(self, minor_block_data):
self.minor_block_data = minor_block_data
class AddMinorBlockResponse(Serializable):
FIELDS = [("error_code", uint32)]
def __init__(self, error_code):
self.error_code = error_code
class CheckMinorBlockRequest(Serializable):
"""For adding blocks mined through JRPC"""
FIELDS = [("minor_block_header", MinorBlockHeader)]
def __init__(self, minor_block_header):
self.minor_block_header = minor_block_header
class CheckMinorBlockResponse(Serializable):
FIELDS = [("error_code", uint32)]
def __init__(self, error_code):
self.error_code = error_code
class HeadersInfo(Serializable):
FIELDS = [
("branch", Branch),
("header_list", PrependedSizeListSerializer(4, MinorBlockHeader)),
]
def __init__(self, branch, header_list):
self.branch = branch
self.header_list = header_list
class GetUnconfirmedHeadersRequest(Serializable):
"""To collect minor block headers to build a new root block"""
FIELDS = []
def __init__(self):
pass
class GetUnconfirmedHeadersResponse(Serializable):
FIELDS = [
("error_code", uint32),
("headers_info_list", PrependedSizeListSerializer(4, HeadersInfo)),
]
def __init__(self, error_code, headers_info_list):
self.error_code = error_code
self.headers_info_list = headers_info_list
class GetAccountDataRequest(Serializable):
FIELDS = [("address", Address), ("block_height", Optional(uint64))]
def __init__(self, address: Address, block_height: typing.Optional[int] = None):
self.address = address
self.block_height = block_height
class AccountBranchData(Serializable):
FIELDS = [
("branch", Branch),
("transaction_count", uint256),
("token_balances", TokenBalanceMap),
("is_contract", boolean),
("posw_mineable_blocks", uint16),
("mined_blocks", uint16),
]
def __init__(
self,
branch,
transaction_count,
token_balances,
is_contract,
mined_blocks=0,
posw_mineable_blocks=0,
):
self.branch = branch
self.transaction_count = transaction_count
self.token_balances = token_balances
self.is_contract = is_contract
self.mined_blocks = mined_blocks
self.posw_mineable_blocks = posw_mineable_blocks
class GetAccountDataResponse(Serializable):
FIELDS = [
("error_code", uint32),
("account_branch_data_list", PrependedSizeListSerializer(4, AccountBranchData)),
]
def __init__(self, error_code, account_branch_data_list):
self.error_code = error_code
self.account_branch_data_list = account_branch_data_list
class AddTransactionRequest(Serializable):
FIELDS = [("tx", TypedTransaction)]
def __init__(self, tx):
self.tx = tx
class AddTransactionResponse(Serializable):
FIELDS = [("error_code", uint32)]
def __init__(self, error_code):
self.error_code = error_code
class ShardStats(Serializable):
FIELDS = [
("branch", Branch),
("height", uint64),
("difficulty", biguint),
("coinbase_address", Address),
("timestamp", uint64),
("tx_count60s", uint32),
("pending_tx_count", uint32),
("total_tx_count", uint32),
("block_count60s", uint32),
("stale_block_count60s", uint32),
("last_block_time", uint32),
]
def __init__(
self,
branch: Branch,
height: int,
difficulty: int,
coinbase_address: Address,
timestamp: int,
tx_count60s: int,
pending_tx_count: int,
total_tx_count: int,
block_count60s: int,
stale_block_count60s: int,
last_block_time: int,
):
self.branch = branch
self.height = height
self.difficulty = difficulty
self.coinbase_address = coinbase_address
self.timestamp = timestamp
self.tx_count60s = tx_count60s
self.pending_tx_count = pending_tx_count
self.total_tx_count = total_tx_count
self.block_count60s = block_count60s
self.stale_block_count60s = stale_block_count60s
self.last_block_time = last_block_time
class RootBlockSychronizerStats(Serializable):
FIELDS = [
("headers_downloaded", uint64),
("blocks_downloaded", uint64),
("blocks_added", uint64),
("ancestor_not_found_count", uint64),
("ancestor_lookup_requests", uint64),
]
def __init__(
self,
headers_downloaded=0,
blocks_downloaded=0,
blocks_added=0,
ancestor_not_found_count=0,
ancestor_lookup_requests=0,
):
self.headers_downloaded = headers_downloaded
self.blocks_downloaded = blocks_downloaded
self.blocks_added = blocks_added
self.ancestor_not_found_count = ancestor_not_found_count
self.ancestor_lookup_requests = ancestor_lookup_requests
class SyncMinorBlockListRequest(Serializable):
FIELDS = [
("minor_block_hash_list", PrependedSizeListSerializer(4, hash256)),
("branch", Branch),
("cluster_peer_id", uint64),
]
def __init__(self, minor_block_hash_list, branch, cluster_peer_id):
self.minor_block_hash_list = minor_block_hash_list
self.branch = branch
self.cluster_peer_id = cluster_peer_id
class SyncMinorBlockListResponse(Serializable):
FIELDS = [
("error_code", uint32),
("block_coinbase_map", PrependedSizeMapSerializer(4, hash256, TokenBalanceMap)),
("shard_stats", Optional(ShardStats)),
]
def __init__(self, error_code, block_coinbase_map=None, shard_stats=None):
self.error_code = error_code
self.block_coinbase_map = block_coinbase_map or {}
self.shard_stats = shard_stats
# slave -> master
class AddMinorBlockHeaderRequest(Serializable):
""" Notify master about a successfully added minor block.
Piggyback the ShardStats in the same request.
"""
FIELDS = [
("minor_block_header", MinorBlockHeader),
("tx_count", uint32), # the total number of tx in the block
("x_shard_tx_count", uint32), # the number of xshard tx in the block
("coinbase_amount_map", TokenBalanceMap),
("shard_stats", ShardStats),
]
def __init__(
self,
minor_block_header,
tx_count,
x_shard_tx_count,
coinbase_amount_map,
shard_stats,
):
self.minor_block_header = minor_block_header
self.tx_count = tx_count
self.x_shard_tx_count = x_shard_tx_count
self.coinbase_amount_map = coinbase_amount_map
self.shard_stats = shard_stats
class AddMinorBlockHeaderResponse(Serializable):
FIELDS = [("error_code", uint32), ("artificial_tx_config", ArtificialTxConfig)]
def __init__(self, error_code, artificial_tx_config):
self.error_code = error_code
self.artificial_tx_config = artificial_tx_config
class AddMinorBlockHeaderListRequest(Serializable):
""" Notify master about a list of successfully added minor block.
Mostly used for minor block sync triggered by root block sync
"""
FIELDS = [
("minor_block_header_list", PrependedSizeListSerializer(4, MinorBlockHeader)),
("coinbase_amount_map_list", PrependedSizeListSerializer(4, TokenBalanceMap)),
]
def __init__(self, minor_block_header_list, coinbase_amount_map_list):
self.minor_block_header_list = minor_block_header_list
self.coinbase_amount_map_list = coinbase_amount_map_list
class AddMinorBlockHeaderListResponse(Serializable):
FIELDS = [("error_code", uint32)]
def __init__(self, error_code):
self.error_code = error_code
# slave -> slave
class AddXshardTxListRequest(Serializable):
FIELDS = [
("branch", Branch),
("minor_block_hash", hash256),
("tx_list", CrossShardTransactionList),
]
def __init__(self, branch, minor_block_hash, tx_list):
self.branch = branch
self.minor_block_hash = minor_block_hash
self.tx_list = tx_list
class AddXshardTxListResponse(Serializable):
FIELDS = [("error_code", uint32)]
def __init__(self, error_code):
self.error_code = error_code
class BatchAddXshardTxListRequest(Serializable):
FIELDS = [
(
"add_xshard_tx_list_request_list",
PrependedSizeListSerializer(4, AddXshardTxListRequest),
)
]
def __init__(self, add_xshard_tx_list_request_list):
self.add_xshard_tx_list_request_list = add_xshard_tx_list_request_list
class BatchAddXshardTxListResponse(Serializable):
FIELDS = [("error_code", uint32)]
def __init__(self, error_code):
self.error_code = error_code
class GetLogRequest(Serializable):
FIELDS = [
("branch", Branch),
("addresses", PrependedSizeListSerializer(4, Address)),
(
"topics",
PrependedSizeListSerializer(
4, PrependedSizeListSerializer(4, FixedSizeBytesSerializer(32))
),
),
("start_block", uint64),
("end_block", uint64),
]
def __init__(
self,
branch: Branch,
addresses: List[Address],
topics: List[List[bytes]],
start_block: int,
end_block: int,
):
self.branch = branch
self.addresses = addresses
self.topics = topics
self.start_block = start_block
self.end_block = end_block
class GetLogResponse(Serializable):
FIELDS = [("error_code", uint32), ("logs", PrependedSizeListSerializer(4, Log))]
def __init__(self, error_code: int, logs: List[Log]):
self.error_code = error_code
self.logs = logs
class EstimateGasRequest(Serializable):
FIELDS = [("tx", TypedTransaction), ("from_address", Address)]
def __init__(self, tx: TypedTransaction, from_address: Address):
self.tx = tx
self.from_address = from_address
class EstimateGasResponse(Serializable):
FIELDS = [("error_code", uint32), ("result", uint32)]
def __init__(self, error_code: int, result: int):
self.error_code = error_code
self.result = result
class GetStorageRequest(Serializable):
FIELDS = [
("address", Address),
("key", uint256),
("block_height", Optional(uint64)),
]
def __init__(
self, address: Address, key: int, block_height: typing.Optional[int] = None
):
self.address = address
self.key = key
self.block_height = block_height
class GetStorageResponse(Serializable):
FIELDS = [("error_code", uint32), ("result", FixedSizeBytesSerializer(32))]
def __init__(self, error_code: int, result: bytes):
self.error_code = error_code
self.result = result
class GetCodeRequest(Serializable):
FIELDS = [("address", Address), ("block_height", Optional(uint64))]
def __init__(self, address: Address, block_height: typing.Optional[int] = None):
self.address = address
self.block_height = block_height
class GetCodeResponse(Serializable):
FIELDS = [("error_code", uint32), ("result", PrependedSizeBytesSerializer(4))]
def __init__(self, error_code: int, result: bytes):
self.error_code = error_code
self.result = result
class GasPriceRequest(Serializable):
FIELDS = [("branch", Branch), ("token_id", uint64)]
def __init__(self, branch: Branch, token_id: int):
self.branch = branch
self.token_id = token_id
class GasPriceResponse(Serializable):
FIELDS = [("error_code", uint32), ("result", uint64)]
def __init__(self, error_code: int, result: int):
self.error_code = error_code
self.result = result
class GetWorkRequest(Serializable):
FIELDS = [("branch", Branch), ("coinbase_addr", Optional(Address))]
def __init__(self, branch: Branch, coinbase_addr: typing.Optional[Address]):
self.branch = branch
self.coinbase_addr = coinbase_addr
class GetWorkResponse(Serializable):
FIELDS = [
("error_code", uint32),
("header_hash", hash256),
("height", uint64),
("difficulty", biguint),
]
def __init__(
self,
error_code: int,
header_hash: bytes = bytes(Constant.HASH_LENGTH),
height: int = 0,
difficulty: int = 0,
):
self.error_code = error_code
self.header_hash = header_hash
self.height = height
self.difficulty = difficulty
class SubmitWorkRequest(Serializable):
FIELDS = [
("branch", Branch),
("header_hash", hash256),
("nonce", uint64),
("mixhash", hash256),
("signature", Optional(signature65)),
]
def __init__(
self,
branch: Branch,
header_hash: bytes,
nonce: int,
mixhash: bytes,
signature: bytes,
):
self.branch = branch
self.header_hash = header_hash
self.nonce = nonce
self.mixhash = mixhash
self.signature = signature
class SubmitWorkResponse(Serializable):
FIELDS = [("error_code", uint32), ("success", boolean)]
def __init__(self, error_code: int, success: bool):
self.error_code = error_code
self.success = success
class GetRootChainStakesRequest(Serializable):
FIELDS = [("address", Address), ("minor_block_hash", hash256)]
def __init__(self, address: Address, minor_block_hash: bytes):
self.address = address
self.minor_block_hash = minor_block_hash
class GetRootChainStakesResponse(Serializable):
FIELDS = [
("error_code", uint32),
("stakes", biguint),
("signer", FixedSizeBytesSerializer(20)),
]
def __init__(self, error_code: int, stakes: int = 0, signer: bytes = bytes(20)):
self.error_code = error_code
self.stakes = stakes
self.signer = signer
class GetTotalBalanceRequest(Serializable):
FIELDS = [
("branch", Branch),
("start", Optional(hash256)),
("token_id", uint64), # TODO: double check max token ID
("limit", uint32),
("minor_block_hash", hash256),
("root_block_hash", Optional(hash256)),
]
def __init__(
self,
branch: Branch,
start: typing.Optional[bytes],
token_id: int,
limit: int,
minor_block_hash: bytes,
root_block_hash: typing.Optional[bytes],
):
self.branch = branch
self.start = start
self.token_id = token_id
self.limit = limit
self.minor_block_hash = minor_block_hash
self.root_block_hash = root_block_hash
class GetTotalBalanceResponse(Serializable):
FIELDS = [
("error_code", uint32),
("total_balance", biguint),
("next", PrependedSizeBytesSerializer(4)),
]
def __init__(self, error_code: int, total_balance: int, next: bytes):
self.error_code = error_code
self.total_balance = total_balance
self.next = next
CLUSTER_OP_BASE = 128
class ClusterOp:
# TODO: Remove cluster op base as cluster op should be independent to p2p op
PING = 1 + CLUSTER_OP_BASE
PONG = 2 + CLUSTER_OP_BASE
CONNECT_TO_SLAVES_REQUEST = 3 + CLUSTER_OP_BASE
CONNECT_TO_SLAVES_RESPONSE = 4 + CLUSTER_OP_BASE
ADD_ROOT_BLOCK_REQUEST = 5 + CLUSTER_OP_BASE
ADD_ROOT_BLOCK_RESPONSE = 6 + CLUSTER_OP_BASE
GET_ECO_INFO_LIST_REQUEST = 7 + CLUSTER_OP_BASE
GET_ECO_INFO_LIST_RESPONSE = 8 + CLUSTER_OP_BASE
GET_NEXT_BLOCK_TO_MINE_REQUEST = 9 + CLUSTER_OP_BASE
GET_NEXT_BLOCK_TO_MINE_RESPONSE = 10 + CLUSTER_OP_BASE
GET_UNCONFIRMED_HEADERS_REQUEST = 11 + CLUSTER_OP_BASE
GET_UNCONFIRMED_HEADERS_RESPONSE = 12 + CLUSTER_OP_BASE
GET_ACCOUNT_DATA_REQUEST = 13 + CLUSTER_OP_BASE
GET_ACCOUNT_DATA_RESPONSE = 14 + CLUSTER_OP_BASE
ADD_TRANSACTION_REQUEST = 15 + CLUSTER_OP_BASE
ADD_TRANSACTION_RESPONSE = 16 + CLUSTER_OP_BASE
ADD_MINOR_BLOCK_HEADER_REQUEST = 17 + CLUSTER_OP_BASE
ADD_MINOR_BLOCK_HEADER_RESPONSE = 18 + CLUSTER_OP_BASE
ADD_XSHARD_TX_LIST_REQUEST = 19 + CLUSTER_OP_BASE
ADD_XSHARD_TX_LIST_RESPONSE = 20 + CLUSTER_OP_BASE
SYNC_MINOR_BLOCK_LIST_REQUEST = 21 + CLUSTER_OP_BASE
SYNC_MINOR_BLOCK_LIST_RESPONSE = 22 + CLUSTER_OP_BASE
ADD_MINOR_BLOCK_REQUEST = 23 + CLUSTER_OP_BASE
ADD_MINOR_BLOCK_RESPONSE = 24 + CLUSTER_OP_BASE
CREATE_CLUSTER_PEER_CONNECTION_REQUEST = 25 + CLUSTER_OP_BASE
CREATE_CLUSTER_PEER_CONNECTION_RESPONSE = 26 + CLUSTER_OP_BASE
DESTROY_CLUSTER_PEER_CONNECTION_COMMAND = 27 + CLUSTER_OP_BASE
GET_MINOR_BLOCK_REQUEST = 29 + CLUSTER_OP_BASE
GET_MINOR_BLOCK_RESPONSE = 30 + CLUSTER_OP_BASE
GET_TRANSACTION_REQUEST = 31 + CLUSTER_OP_BASE
GET_TRANSACTION_RESPONSE = 32 + CLUSTER_OP_BASE
BATCH_ADD_XSHARD_TX_LIST_REQUEST = 33 + CLUSTER_OP_BASE
BATCH_ADD_XSHARD_TX_LIST_RESPONSE = 34 + CLUSTER_OP_BASE
EXECUTE_TRANSACTION_REQUEST = 35 + CLUSTER_OP_BASE
EXECUTE_TRANSACTION_RESPONSE = 36 + CLUSTER_OP_BASE
GET_TRANSACTION_RECEIPT_REQUEST = 37 + CLUSTER_OP_BASE
GET_TRANSACTION_RECEIPT_RESPONSE = 38 + CLUSTER_OP_BASE
MINE_REQUEST = 39 + CLUSTER_OP_BASE
MINE_RESPONSE = 40 + CLUSTER_OP_BASE
GEN_TX_REQUEST = 41 + CLUSTER_OP_BASE
GEN_TX_RESPONSE = 42 + CLUSTER_OP_BASE
GET_TRANSACTION_LIST_BY_ADDRESS_REQUEST = 43 + CLUSTER_OP_BASE
GET_TRANSACTION_LIST_BY_ADDRESS_RESPONSE = 44 + CLUSTER_OP_BASE
GET_LOG_REQUEST = 45 + CLUSTER_OP_BASE
GET_LOG_RESPONSE = 46 + CLUSTER_OP_BASE
ESTIMATE_GAS_REQUEST = 47 + CLUSTER_OP_BASE
ESTIMATE_GAS_RESPONSE = 48 + CLUSTER_OP_BASE
GET_STORAGE_REQUEST = 49 + CLUSTER_OP_BASE
GET_STORAGE_RESPONSE = 50 + CLUSTER_OP_BASE
GET_CODE_REQUEST = 51 + CLUSTER_OP_BASE
GET_CODE_RESPONSE = 52 + CLUSTER_OP_BASE
GAS_PRICE_REQUEST = 53 + CLUSTER_OP_BASE
GAS_PRICE_RESPONSE = 54 + CLUSTER_OP_BASE
GET_WORK_REQUEST = 55 + CLUSTER_OP_BASE
GET_WORK_RESPONSE = 56 + CLUSTER_OP_BASE
SUBMIT_WORK_REQUEST = 57 + CLUSTER_OP_BASE
SUBMIT_WORK_RESPONSE = 58 + CLUSTER_OP_BASE
ADD_MINOR_BLOCK_HEADER_LIST_REQUEST = 59 + CLUSTER_OP_BASE
ADD_MINOR_BLOCK_HEADER_LIST_RESPONSE = 60 + CLUSTER_OP_BASE
CHECK_MINOR_BLOCK_REQUEST = 61 + CLUSTER_OP_BASE
CHECK_MINOR_BLOCK_RESPONSE = 62 + CLUSTER_OP_BASE
GET_ALL_TRANSACTIONS_REQUEST = 63 + CLUSTER_OP_BASE
GET_ALL_TRANSACTIONS_RESPONSE = 64 + CLUSTER_OP_BASE
GET_ROOT_CHAIN_STAKES_REQUEST = 65 + CLUSTER_OP_BASE
GET_ROOT_CHAIN_STAKES_RESPONSE = 66 + CLUSTER_OP_BASE
GET_TOTAL_BALANCE_REQUEST = 67 + CLUSTER_OP_BASE
GET_TOTAL_BALANCE_RESPONSE = 68 + CLUSTER_OP_BASE
CLUSTER_OP_SERIALIZER_MAP = {
ClusterOp.PING: Ping,
ClusterOp.PONG: Pong,
ClusterOp.CONNECT_TO_SLAVES_REQUEST: ConnectToSlavesRequest,
ClusterOp.CONNECT_TO_SLAVES_RESPONSE: ConnectToSlavesResponse,
ClusterOp.ADD_ROOT_BLOCK_REQUEST: AddRootBlockRequest,
ClusterOp.ADD_ROOT_BLOCK_RESPONSE: AddRootBlockResponse,
ClusterOp.GET_ECO_INFO_LIST_REQUEST: GetEcoInfoListRequest,
ClusterOp.GET_ECO_INFO_LIST_RESPONSE: GetEcoInfoListResponse,
ClusterOp.GET_NEXT_BLOCK_TO_MINE_REQUEST: GetNextBlockToMineRequest,
ClusterOp.GET_NEXT_BLOCK_TO_MINE_RESPONSE: GetNextBlockToMineResponse,
ClusterOp.ADD_MINOR_BLOCK_REQUEST: AddMinorBlockRequest,
ClusterOp.ADD_MINOR_BLOCK_RESPONSE: AddMinorBlockResponse,
ClusterOp.GET_UNCONFIRMED_HEADERS_REQUEST: GetUnconfirmedHeadersRequest,
ClusterOp.GET_UNCONFIRMED_HEADERS_RESPONSE: GetUnconfirmedHeadersResponse,
ClusterOp.ADD_MINOR_BLOCK_HEADER_REQUEST: AddMinorBlockHeaderRequest,
ClusterOp.ADD_MINOR_BLOCK_HEADER_RESPONSE: AddMinorBlockHeaderResponse,
ClusterOp.ADD_XSHARD_TX_LIST_REQUEST: AddXshardTxListRequest,
ClusterOp.ADD_XSHARD_TX_LIST_RESPONSE: AddXshardTxListResponse,
ClusterOp.GET_ACCOUNT_DATA_REQUEST: GetAccountDataRequest,
ClusterOp.GET_ACCOUNT_DATA_RESPONSE: GetAccountDataResponse,
ClusterOp.ADD_TRANSACTION_REQUEST: AddTransactionRequest,
ClusterOp.ADD_TRANSACTION_RESPONSE: AddTransactionResponse,
ClusterOp.SYNC_MINOR_BLOCK_LIST_REQUEST: SyncMinorBlockListRequest,
ClusterOp.SYNC_MINOR_BLOCK_LIST_RESPONSE: SyncMinorBlockListResponse,
ClusterOp.CREATE_CLUSTER_PEER_CONNECTION_REQUEST: CreateClusterPeerConnectionRequest,
ClusterOp.CREATE_CLUSTER_PEER_CONNECTION_RESPONSE: CreateClusterPeerConnectionResponse,
ClusterOp.DESTROY_CLUSTER_PEER_CONNECTION_COMMAND: DestroyClusterPeerConnectionCommand,
ClusterOp.GET_MINOR_BLOCK_REQUEST: GetMinorBlockRequest,
ClusterOp.GET_MINOR_BLOCK_RESPONSE: GetMinorBlockResponse,
ClusterOp.GET_TRANSACTION_REQUEST: GetTransactionRequest,
ClusterOp.GET_TRANSACTION_RESPONSE: GetTransactionResponse,
ClusterOp.BATCH_ADD_XSHARD_TX_LIST_REQUEST: BatchAddXshardTxListRequest,
ClusterOp.BATCH_ADD_XSHARD_TX_LIST_RESPONSE: BatchAddXshardTxListResponse,
ClusterOp.EXECUTE_TRANSACTION_REQUEST: ExecuteTransactionRequest,
ClusterOp.EXECUTE_TRANSACTION_RESPONSE: ExecuteTransactionResponse,
ClusterOp.GET_TRANSACTION_RECEIPT_REQUEST: GetTransactionReceiptRequest,
ClusterOp.GET_TRANSACTION_RECEIPT_RESPONSE: GetTransactionReceiptResponse,
ClusterOp.MINE_REQUEST: MineRequest,
ClusterOp.MINE_RESPONSE: MineResponse,
ClusterOp.GEN_TX_REQUEST: GenTxRequest,
ClusterOp.GEN_TX_RESPONSE: GenTxResponse,
ClusterOp.GET_TRANSACTION_LIST_BY_ADDRESS_REQUEST: GetTransactionListByAddressRequest,
ClusterOp.GET_TRANSACTION_LIST_BY_ADDRESS_RESPONSE: GetTransactionListByAddressResponse,
ClusterOp.GET_LOG_REQUEST: GetLogRequest,
ClusterOp.GET_LOG_RESPONSE: GetLogResponse,
ClusterOp.ESTIMATE_GAS_REQUEST: EstimateGasRequest,
ClusterOp.ESTIMATE_GAS_RESPONSE: EstimateGasResponse,
ClusterOp.GET_STORAGE_REQUEST: GetStorageRequest,
ClusterOp.GET_STORAGE_RESPONSE: GetStorageResponse,
ClusterOp.GET_CODE_REQUEST: GetCodeRequest,
ClusterOp.GET_CODE_RESPONSE: GetCodeResponse,
ClusterOp.GAS_PRICE_REQUEST: GasPriceRequest,
ClusterOp.GAS_PRICE_RESPONSE: GasPriceResponse,
ClusterOp.GET_WORK_REQUEST: GetWorkRequest,
ClusterOp.GET_WORK_RESPONSE: GetWorkResponse,
ClusterOp.SUBMIT_WORK_REQUEST: SubmitWorkRequest,
ClusterOp.SUBMIT_WORK_RESPONSE: SubmitWorkResponse,
ClusterOp.ADD_MINOR_BLOCK_HEADER_LIST_REQUEST: AddMinorBlockHeaderListRequest,
ClusterOp.ADD_MINOR_BLOCK_HEADER_LIST_RESPONSE: AddMinorBlockHeaderListResponse,
ClusterOp.CHECK_MINOR_BLOCK_REQUEST: CheckMinorBlockRequest,
ClusterOp.CHECK_MINOR_BLOCK_RESPONSE: CheckMinorBlockResponse,
ClusterOp.GET_ALL_TRANSACTIONS_REQUEST: GetAllTransactionsRequest,
ClusterOp.GET_ALL_TRANSACTIONS_RESPONSE: GetAllTransactionsResponse,
ClusterOp.GET_ROOT_CHAIN_STAKES_REQUEST: GetRootChainStakesRequest,
ClusterOp.GET_ROOT_CHAIN_STAKES_RESPONSE: GetRootChainStakesResponse,
ClusterOp.GET_TOTAL_BALANCE_REQUEST: GetTotalBalanceRequest,
ClusterOp.GET_TOTAL_BALANCE_RESPONSE: GetTotalBalanceResponse,
}
| quarkchain/cluster/rpc.py | 36,516 | Notify master about a list of successfully added minor block.
Mostly used for minor block sync triggered by root block sync
Notify master about a successfully added minor block.
Piggyback the ShardStats in the same request.
For adding blocks mined through JRPC
Add root block to each slave
For adding blocks mined through JRPC
Master instructs a slave to connect to other slaves
result_list must have the same size as salve_info_list in the request.
Empty result means success otherwise it would a serialized error message.
Broadcast to the cluster and announce that a peer connection is created
Assume always succeed.
Broadcast to the cluster and announce that a peer connection is lost
As a contract, the master will not send traffic after the command.
Necessary information for master to decide the best block to mine
Generate transactions for loadtesting
To collect minor block headers to build a new root block
Send mining instructions to slaves
Empty full_shard_id_list means root
Empty slave_id and full_shard_id_list means root
RPCs to initialize a cluster Initialize ShardState if not None False to halt mining [0, 100] sample tx Virtual connection management RPCs to lookup data from shards (master -> slaves) block timestamp RPCs to update blockchains master -> slave slave -> master the total number of tx in the block the number of xshard tx in the block slave -> slave TODO: double check max token ID TODO: Remove cluster op base as cluster op should be independent to p2p op | 1,500 | en | 0.878613 |
# -*- coding: utf-8 -*-
from __future__ import unicode_literals
import sys
import marshal
from math import log, exp
from ..utils.frequency import AddOneProb
class Bayes(object):
def __init__(self):
self.d = {}
self.total = 0
def save(self, fname):
d = {}
d['total'] = self.total
d['d'] = {}
for k, v in self.d.items():
d['d'][k] = v.__dict__
if sys.version_info[0] == 3:
fname = fname + '.3'
marshal.dump(d, open(fname, 'wb'))
def load(self, fname):
if sys.version_info[0] == 3:
fname = fname + '.3'
d = marshal.load(open(fname, 'rb'))
self.total = d['total']
self.d = {}
for k, v in d['d'].items():
self.d[k] = AddOneProb()
self.d[k].__dict__ = v
def train(self, data):
for d in data:
c = d[1]
if c not in self.d:
self.d[c] = AddOneProb()
for word in d[0]:
self.d[c].add(word, 1)
self.total = sum(map(lambda x: self.d[x].getsum(), self.d.keys()))
def classify(self, x):
tmp = {}
for k in self.d:
tmp[k] = 0
for word in x:
tmp[k] += log(self.d[k].getsum()) - log(self.total)\
+ log(self.d[k].freq(word))
ret, prob = 0, 0
for k in self.d:
now = 0
for otherk in self.d:
now += exp(tmp[otherk]-tmp[k])
now = 1/now
if now > prob:
ret, prob = k, now
return (ret, prob)
| snownlp/classification/bayes.py | 1,621 | -*- coding: utf-8 -*- | 21 | en | 0.767281 |
# -*- coding: utf-8 -*-
# (C) 2015 Muthiah Annamalai
# setup the paths
from opentamiltests import *
from solthiruthi.data_parser import *
from solthiruthi.solthiruthi import Solthiruthi
import sys
class CmdLineIO(unittest.TestCase):
def test_CLI_interface_help(self):
return
# find a way to run this test which exits the suite
_, parser = Solthiruthi.get_CLI_options(do_parse=False)
args = parser.parse_args(["--help"])
self.assertEqual(args.help, True)
def test_CLI_defaults(self):
_, parser = Solthiruthi.get_CLI_options(do_parse=False)
args = parser.parse_args(["-stdin"])
self.assertEqual(args.files, "")
self.assertEqual(args.help, False)
self.assertEqual(args.nalt, 10)
self.assertEqual(args.Dictionary, ["std"])
self.assertEqual(args.dialects, ["std"])
def test_CLI_files(self):
ips = ["-files", "poonga", "vanam", "sethu", "ezhuthu"]
_, parser = Solthiruthi.get_CLI_options(do_parse=False)
args = parser.parse_args(ips)
self.assertEqual(args.files, ips[1:])
def test_CLI_dicts(self):
ips = ["-Dict", "std", "wikipedia", "madurai"]
_, parser = Solthiruthi.get_CLI_options(do_parse=False)
args = parser.parse_args(ips)
self.assertEqual(args.Dictionary, ips[1:])
class DataParserTest(unittest.TestCase):
def test_worlists(self):
obj = DataParser.run(["data/maligaiporul.txt", "data/vilangugal.txt"])
r = obj.analysis()
self.assertEqual(r["catlen"], 5)
# self.assertEqual(r['total'],141)
self.assertEqual(
sorted(list(map(len, r["dict"].values()))), sorted([56, 28, 15, 8, 3])
)
if __name__ == "__main__":
unittest.main()
| tests/solthiruthi_data_parser.py | 1,780 | -*- coding: utf-8 -*- (C) 2015 Muthiah Annamalai setup the paths find a way to run this test which exits the suite self.assertEqual(r['total'],141) | 147 | en | 0.751123 |
# Copyright 2015 OpenStack Foundation
# All Rights Reserved.
#
# Licensed under the Apache License, Version 2.0 (the "License"); you may
# not use this file except in compliance with the License. You may obtain
# a copy of the License at
#
# http://www.apache.org/licenses/LICENSE-2.0
#
# Unless required by applicable law or agreed to in writing, software
# distributed under the License is distributed on an "AS IS" BASIS, WITHOUT
# WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the
# License for the specific language governing permissions and limitations
# under the License.
from oslo_config import cfg
api_paste_config_opt = cfg.StrOpt('api_paste_config',
default="api-paste.ini",
help='File name for the paste.deploy config for nova-api')
wsgi_log_format_opt = cfg.StrOpt('wsgi_log_format',
default='%(client_ip)s "%(request_line)s" status: %(status_code)s'
' len: %(body_length)s time: %(wall_seconds).7f',
help='A python format string that is used as the template to '
'generate log lines. The following values can be formatted '
'into it: client_ip, date_time, request_line, status_code, '
'body_length, wall_seconds.')
secure_proxy_ssl_header_opt = cfg.StrOpt('secure_proxy_ssl_header',
help='The HTTP header used to determine the scheme for the '
'original request, even if it was removed by an SSL '
'terminating proxy. Typical value is '
'"HTTP_X_FORWARDED_PROTO".')
ssl_ca_file_opt = cfg.StrOpt('ssl_ca_file',
help="CA certificate file to use to verify "
"connecting clients")
ssl_cert_file_opt = cfg.StrOpt('ssl_cert_file',
help="SSL certificate of API server")
ssl_key_file_opt = cfg.StrOpt('ssl_key_file',
help="SSL private key of API server")
tcp_keepidle_opt = cfg.IntOpt('tcp_keepidle',
default=600,
help="Sets the value of TCP_KEEPIDLE in seconds for each "
"server socket. Not supported on OS X.")
wsgi_default_pool_size_opt = cfg.IntOpt('wsgi_default_pool_size',
default=1000,
help="Size of the pool of greenthreads used by wsgi")
max_header_line_opt = cfg.IntOpt('max_header_line',
default=16384,
help="Maximum line size of message headers to be accepted. "
"max_header_line may need to be increased when using "
"large tokens (typically those generated by the "
"Keystone v3 API with big service catalogs).")
wsgi_keep_alive_opt = cfg.BoolOpt('wsgi_keep_alive',
default=True,
help="If False, closes the client socket connection "
"explicitly.")
client_socket_timeout_opt = cfg.IntOpt('client_socket_timeout', default=900,
help="Timeout for client connections' socket operations. "
"If an incoming connection is idle for this number of "
"seconds it will be closed. A value of '0' means "
"wait forever.")
ALL_OPTS = [api_paste_config_opt,
wsgi_log_format_opt,
secure_proxy_ssl_header_opt,
ssl_ca_file_opt,
ssl_cert_file_opt,
ssl_key_file_opt,
tcp_keepidle_opt,
wsgi_default_pool_size_opt,
max_header_line_opt,
wsgi_keep_alive_opt,
client_socket_timeout_opt
]
def register_opts(conf):
conf.register_opts(ALL_OPTS)
def list_opts():
return {"DEFAULT": ALL_OPTS}
| nova/conf/wsgi.py | 3,577 | Copyright 2015 OpenStack Foundation All Rights Reserved. Licensed under the Apache License, Version 2.0 (the "License"); you may not use this file except in compliance with the License. You may obtain a copy of the License at http://www.apache.org/licenses/LICENSE-2.0 Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the specific language governing permissions and limitations under the License. | 606 | en | 0.869052 |
import math
from pyvolution.EvolutionManager import *
from pyvolution.GeneLibrary import *
"""
This example attempts to find a solution to the following system of equations:
a + b + c + d - 17 = 0
a^2 + b^2 - 5 = 0
sin(a) + c - d - 20 = 0
"""
def fitnessFunction(chromosome):
"""
Given a "chromosome", this function must determine its fitness score
The fitness score should be a floating point value. If the fitness is zero or smaller
then the chromosome will not be allowed to "reproduce"
"""
#you can access the attributes of a chromosome using square brackets
#the key is the description of the gene
a = chromosome["a"]
b = chromosome["b"]
c = chromosome["c"]
d = chromosome["d"]
#for a perfect solution each of the values will be zero
val1 = math.fabs(a + b + c + d - 17)
val2 = math.fabs(math.pow(a, 2) + math.pow(b, 2) - 5)
val3 = math.sin(a) + c - d - 20
#minimize the "distance", this gives a better fitness estimate than summing the values
dist = math.sqrt(math.pow(val1, 2) + math.pow(val2, 2) + math.pow(val3, 2))
#number returned must be a positive floating point value
if dist != 0:
return 1 / dist #lower dist means better fitness, the closer to a good solution the higher this will be
else:
return None #returning None indicates that a perfect solution has been found
#configure the evolution manager as you see fit
#see EvolutionManager.py for documentation on the arguments for this class
em = EvolutionManager(fitnessFunction,
individualsPerGeneration=100,
mutationRate=0.2, #a mutation rate of 0.2 means that 20% of the genes will be mutated each round
maxGenerations=1000)
#standard floating point genes
#The values of the genes in the first generation are chosen randomly in a gaussian distribution.
#generatorAverage and generatorSTDEV describe the gaussian distribution
#When a gene mutates, the amount that it changes by is also chosen from a gaussian distribution with
#a standard deviation of mutationSTDEV
atype = FloatGeneType("a", generatorAverage=0, generatorSTDEV=100, mutationSTDEV=1.0)
btype = FloatGeneType("b", generatorAverage=0, generatorSTDEV=100, mutationSTDEV=1.0)
ctype = FloatGeneType("c", generatorAverage=0, generatorSTDEV=100, mutationSTDEV=1.0)
dtype = FloatGeneType("d", generatorAverage=0, generatorSTDEV=100, mutationSTDEV=1.0)
em.addGeneType(atype)
em.addGeneType(btype)
em.addGeneType(ctype)
em.addGeneType(dtype)
result = em.run() | examples/EquationSolver_simple.py | 2,566 | Given a "chromosome", this function must determine its fitness score
The fitness score should be a floating point value. If the fitness is zero or smaller
then the chromosome will not be allowed to "reproduce"
you can access the attributes of a chromosome using square bracketsthe key is the description of the genefor a perfect solution each of the values will be zerominimize the "distance", this gives a better fitness estimate than summing the valuesnumber returned must be a positive floating point valuelower dist means better fitness, the closer to a good solution the higher this will bereturning None indicates that a perfect solution has been foundconfigure the evolution manager as you see fitsee EvolutionManager.py for documentation on the arguments for this classa mutation rate of 0.2 means that 20% of the genes will be mutated each roundstandard floating point genesThe values of the genes in the first generation are chosen randomly in a gaussian distribution.generatorAverage and generatorSTDEV describe the gaussian distributionWhen a gene mutates, the amount that it changes by is also chosen from a gaussian distribution witha standard deviation of mutationSTDEV | 1,188 | en | 0.813346 |
import json
import argparse
from time import sleep
import psycopg2
import subprocess
import os
import signal
def connTemp(puser, phost, pport, stmt):
conn = psycopg2.connect(database = 'postgres', user = puser, host = phost, port = pport)
conn.autocommit = True
cur = conn.cursor()
cur.execute(stmt)
#res = cur.fetchall()
conn.commit()
cur.close()
conn.close()
def makeTemp(host, path):
stmt = 'ssh ' + defuser + '@' + host + " 'mkdir -p " + path + "'"
subprocess.run(stmt, shell = True)
print('ssh mkdir : ' + stmt)
print()
def remoTemp(host, path):
stmt = 'ssh ' + defuser + '@' + host + " 'rm -rf " + path + "'"
subprocess.run(stmt, shell = True)
print('ssh rm : ' + stmt)
print()
def sshTemp(host, stmt, time):
stmt = 'ssh ' + defuser + '@' + host + " 'cd " + defbase + ' && source env.sh && ' + stmt + "'"
print('ssh common : ' + stmt)
p = subprocess.Popen(stmt, shell = True)
os.kill(p.pid, signal.SIGCONT)
sleep(time)
print()
def readJsonFile():
Of = open(File,encoding='utf-8')
Ofload = json.loads(Of.read())
gtm = Ofload['gtm']
gtms = Ofload['gtm_slave']
cn = Ofload['coordinator']
dn = Ofload['datanode']
dns = Ofload['datanode_slave']
global gtmhost, gtmport, gtmdata, gtmuser, gtmname
global gtmshost, gtmsport, gtmsdata, gtmsuser, gtmsname
global cnhost, cnport, cndata, cnuser, cnname, cnpooler
global dnhost, dnport, dndata, dnuser, dnname, dnpooler
global dnsname, dnshost, dnsport, dnsdata, dnsuser, dnspooler, dnsmname, dnsmuser, dnsmport, dnsmhost
gtmhost, gtmport, gtmdata, gtmuser, gtmname = [], [], [], [], []
gtmshost, gtmsport, gtmsdata, gtmsuser, gtmsname = [], [], [], [], []
cnhost, cnport, cndata, cnuser, cnname, cnpooler = [], [], [], [], [], []
dnhost, dnport, dndata, dnuser, dnname, dnpooler = [], [], [], [], [], []
dnsname, dnshost, dnsport, dnsdata, dnsuser, dnspooler, dnsmname, dnsmuser, dnsmport, dnsmhost = [], [], [], [], [], [], [], [], [], []
for i in gtm:
Gtmhost = i["host"]
Gtmport = i["port"]
Gtmdata = i["datadir"]
Gtmuser = i["user"]
Gtmname = i["name"]
gtmhost.append(Gtmhost)
gtmport.append(Gtmport)
gtmdata.append(Gtmdata)
gtmuser.append(Gtmuser)
gtmname.append(Gtmname)
for i in gtms:
Gtmshost = i["host"]
Gtmsport = i["port"]
Gtmsdata = i["datadir"]
Gtmsuser = i["user"]
Gtmsname = i["name"]
gtmshost.append(Gtmshost)
gtmsport.append(Gtmsport)
gtmsdata.append(Gtmsdata)
gtmsuser.append(Gtmsuser)
gtmsname.append(Gtmsname)
for i in cn:
Cnhost = i["host"]
Cnport = i["port"]
Cndata = i["datadir"]
Cnuser = i["user"]
Cnname = i["name"]
Cnpooler = i["pooler_port"]
cnhost.append(Cnhost)
cnport.append(Cnport)
cnuser.append(Cnuser)
cndata.append(Cndata)
cnname.append(Cnname)
cnpooler.append(Cnpooler)
for i in dn:
Dnhost = i["host"]
Dnport = i["port"]
Dndata = i["datadir"]
Dnuser = i["user"]
Dnname = i["name"]
Dnpooler = i["pooler_port"]
dnhost.append(Dnhost)
dnport.append(Dnport)
dndata.append(Dndata)
dnuser.append(Dnuser)
dnname.append(Dnname)
dnpooler.append(Dnpooler)
for i in dns:
Dnshost = i["host"]
Dnsport = i["port"]
Dnsdata = i["datadir"]
Dnsuser = i["user"]
Dnspooler = i["pooler_port"]
Dnsname = i["name"]
Dnsmport = i["Master_port"]
Dnsmuser = i["Master_user"]
Dnsmname = i["Master_name"]
Dnsmhost = i["Master_host"]
dnshost.append(Dnshost)
dnsport.append(Dnsport)
dnsdata.append(Dnsdata)
dnsuser.append(Dnsuser)
dnspooler.append(Dnspooler)
dnsname.append(Dnsname)
dnsmport.append(Dnsmport)
dnsmuser.append(Dnsmuser)
dnsmname.append(Dnsmname)
dnsmhost.append(Dnsmhost)
def install():
allhost = []
allhost.extend(gtmhost)
allhost.extend(gtmshost)
allhost.extend(dnhost)
allhost.extend(cnhost)
allhost.extend(dnshost)
ahost = list(set(allhost))
#print(ahost)
pakname = package.replace('./','')
pakname = pakname.replace('.tgz','')
# create env file
print('======== deploy packages ========')
f = open('./env.sh', 'w')
stmt1 = 'export PATH=' + defbase + '/' + pakname + '/bin:$PATH'
stmt2 = 'export LD_LIBRARY_PATH=' + defbase + '/' + pakname + '/lib:$LD_LIBRARY_PATH'
f.write(stmt1 + '\n' + stmt2 + '\n')
f.close()
# scp package & env file to each instance ======================
for i in ahost:
stmt = 'scp' + ' ' + package + ' ' + defuser + '@' + i + ':' + defbase
stmt3 = 'scp' + ' ./env.sh ' + defuser + '@' + i + ':' + defbase
stmt5 = 'scp' + ' ./install.sh ' + defuser + '@' + i + ':' + defbase
subprocess.run(stmt, shell = True)
print(stmt)
subprocess.run(stmt3, shell = True)
print(stmt3)
subprocess.run(stmt5, shell = True)
print(stmt5)
stmt7 = 'tar -zxf ' + defbase + '/' + package
sshTemp(i, stmt7, 1)
print()
# -------------------------- gtm -------------------------------------
# init gtm master node ==================================
print('\n ======== creating gtm master node ======== \n')
makeTemp(gtmhost[0], gtmdata[0])
initgtm = 'initgtm -Z gtm -D ' + gtmdata[0]
sshTemp(gtmhost[0], initgtm, 1)
# change gtm configuration ===================================
gtmconf = '/bin/bash ' + defbase + '/install.sh gtm ' + gtmhost[0] + ' ' + str(gtmport[0]) + ' ' + gtmname[0] + ' ' + gtmdata[0] + ' ' + gtmuser[0]
sshTemp(gtmhost[0], gtmconf, 1)
# start gtm =============================
startgtm = 'gtm_ctl -Z gtm -D ' + gtmdata[0] + ' start'
sshTemp(gtmhost[0], startgtm, 1)
# -------------------------- gtm slave -----------------------------
n = 0
print('\n ======== creating gtm slave node ========')
for i in gtmshost:
makeTemp(i, gtmsdata[n])
print('\n creating gtm slave node ' + gtmsname[n])
# init gtm slave node ====================
initgtms = 'initgtm -Z gtm -D ' + gtmsdata[n]
sshTemp(i, initgtms, 1)
# change gtm slave configuration =====================
gtmsconf = '/bin/bash ' + defbase + '/install.sh gtm_slave ' + gtmhost[0] + ' ' + str(gtmsport[n]) + ' ' + gtmsname[n] + ' ' + gtmsdata[n] + ' ' + str(gtmport[0])
sshTemp(i, gtmsconf, 1)
#start gtm slave ==================
startgtms = 'gtm_ctl -Z gtm_standby -D ' + gtmsdata[n] + ' start'
sshTemp(i, startgtms, 1)
n = n + 1
# ------------------------- cn node --------------------------------
n = 0
print('\n ======== creating cn node ========')
#initdb --locale=zh_CN.UTF-8 -U kunlun -E utf8 -D /home/kunlun/TPC/postgres-xz/data/cn01 --nodename=cn01 --nodetype=coordinator --master_gtm_nodename gtm --master_gtm_ip 192.168.0.134 --master_gtm_port 23001
for i in cnhost:
makeTemp(i, cndata[n])
print('\n ==========creating cn node ' + cnname[n])
# init cn node ===============
if types == 'pgxz':
initcn = 'initdb --locale=en_US.UTF-8 -U ' + cnuser[n] + ' -E utf8 -D ' + cndata[n] + ' --nodename=' + cnname[n] + ' --nodetype=coordinator --master_gtm_nodename ' + gtmname[0] + ' --master_gtm_ip ' + gtmhost[0] + ' --master_gtm_port ' + str(gtmport[0])
sshTemp(i, initcn, 3)
elif types == 'pgxc':
initcn = 'initdb -D ' + cndata[n] + ' --nodename ' + cnname[n]
sshTemp(i, initcn, 3)
# change cn node configuration =============
if types == 'pgxz':
cnconf = '/bin/bash ' + defbase + '/install.sh cn ' + str(cnport[n]) + ' ' + str(cnpooler[n]) + ' ' + cndata[n] + ' ' + gtmhost[0] + ' ' + str(gtmport[0])
sshTemp(i, cnconf, 1)
elif types == 'pgxc':
cnconf = '/bin/bash ' + defbase + '/install.sh cn ' + str(cnport[n]) + ' ' + str(cnpooler[n]) + ' ' + cndata[n] + ' ' + gtmhost[0] + ' ' + str(gtmport[0]) + ' ' + types
sshTemp(i, cnconf, 2)
# start cn node =================
startcn = 'pg_ctl -Z coordinator -D ' + cndata[n] + ' start'
reloadcn = 'pg_ctl -D ' + cndata[n] + ' reload'
sshTemp(i, startcn, 3)
if types == 'pgxc':
restartcn = 'pg_ctl -Z coordinator restart -m f -D ' + cndata[n]
sshTemp(i, restartcn, 2)
sshTemp(i, reloadcn, 1)
n = n + 1
# ------------------------- dn node --------------------------------
n = 0
print('\n ======== creating dn master node ========')
for i in dnhost:
makeTemp(i, dndata[n])
print('\n ================creating dn node ' + dnname[n])
# init dn node ===============
if types == 'pgxz':
initdn = 'initdb --locale=en_US.UTF-8 -U ' + dnuser[n] + ' -E utf8 -D ' + dndata[n] + ' --nodename=' + dnname[n] + ' --nodetype=datanode --master_gtm_nodename ' + gtmname[0] + ' --master_gtm_ip ' + gtmhost[0] + ' --master_gtm_port ' + str(gtmport[0])
sshTemp(i, initdn, 3)
elif types == 'pgxc':
initdn = 'initdb -D ' + dndata[n] + ' --nodename ' + dnname[n]
sshTemp(i, initdn, 5)
# change dn configuration ====================
if types == 'pgxz':
dnconf = '/bin/bash ' + defbase + '/install.sh dn ' + str(dnport[n]) + ' ' + str(dnpooler[n]) + ' ' + dndata[n] + ' ' + gtmhost[0] + ' ' + str(gtmport[0])
sshTemp(i, dnconf, 1)
elif types == 'pgxc':
dnconf = '/bin/bash ' + defbase + '/install.sh dn ' + str(dnport[n]) + ' ' + str(dnpooler[n]) + ' ' + dndata[n] + ' ' + gtmhost[0] + ' ' + str(gtmport[0]) + ' ' + types
sshTemp(i, dnconf, 2)
# start dn node =================
startdn = 'pg_ctl -Z datanode -D ' + dndata[n] + ' start'
reloaddn = 'pg_ctl -D ' + dndata[n] + ' reload'
sshTemp(i, startdn, 3)
if types == 'pgxc':
restartdn = 'pg_ctl -Z datanode restart -m f -D ' + dndata[n]
sshTemp(i, restartdn, 2)
sshTemp(i, reloaddn, 1)
n = n + 1
# ----------------------- dn slave node --------------------------
# pg_basebackup -p 23003 -h 192.168.0.132 -U kunlun -D /home/kunlun/TPC/postgres-xz/data/dn01s1 -X f -P -v
n = 0
print('\n ======== creating dn slave node ========')
for i in dnshost:
makeTemp(i, dnsdata[n])
print('\n ==============creating dns node ' + dnsname[n])
# init dns node ===============
initdns = 'pg_basebackup -p ' + dnsmport[n] + ' -h ' + dnsmhost[n] + ' -U ' + dnsuser[n] + ' -D ' + dnsdata[n] + ' -X f -P -v'
sshTemp(i, initdns, 5)
# change dns configuration ==================
dnsconf = '/bin/bash ' + defbase + '/install.sh dn_slave ' + str(dnsport[n]) + ' ' + str(dnspooler[n]) + ' ' + dnsdata[n] + ' ' + dnsmhost[n] + ' ' + dnsmport[n] + ' ' + dnsmuser[n] + ' ' + dnsmname[n]
changedir = 'chmod 700 ' + dnsdata[n]
sshTemp(i, dnsconf, 2)
sshTemp(i, changedir, 1)
# start dns node ==================
startdns = 'pg_ctl -Z datanode -D ' + dnsdata[n] + ' start'
reloaddns = 'pg_ctl -D ' + dnsdata[n] + ' reload'
sshTemp(i, startdns, 3)
if types == 'pgxc':
restartdns = 'pg_ctl -Z datanode restart -m f -D ' + dnsdata[n]
sshTemp(i, restartdns, 2)
sshTemp(i, reloaddns, 1)
n = n + 1
def ConfigRoute():
# 配置路由
print('\n======== Configration Route ========')
cof = ['cn','dn']
for i in cof:
if i == 'cn':
ns = 0
for a in cnhost:
print('\npsql -h '+ cnhost[ns] + ' -d postgres -p ' + str(cnport[ns]))
for b in cof:
if b == 'cn':
n = 0
for c in cnhost:
if c == a:
stmt = 'alter node ' + cnname[n] + " with(host='" + c + "',port=" + str(cnport[n]) + ')'
print(cnuser[ns],cnhost[ns], cnport[ns],stmt)
connTemp(cnuser[ns], cnhost[ns], cnport[ns], stmt)
n = n + 1
else:
stmt = 'create node ' + cnname[n] + " with(type=coordinator,host='" + c + "',port=" + str(cnport[n]) + ',primary=false,preferred=false)'
print(cnuser[ns], cnhost[ns], cnport[ns],stmt)
connTemp(cnuser[ns], cnhost[ns], cnport[ns], stmt)
n = n + 1
else:
n = 0
for c in dnhost:
stmt = 'create node ' + dnname[n] + " with(type=datanode,host='" + c + "',port=" + str(dnport[n]) + ',primary=false,preferred=false)'
print(cnuser[ns], cnhost[ns], cnport[ns],stmt)
connTemp(cnuser[ns], cnhost[ns], cnport[ns], stmt)
n = n + 1
ns = ns + 1
if i == 'dn':
nn = 0
for a in dnhost:
print('\npsql -h '+ dnhost[nn] + ' -d postgres -p ' + str(dnport[nn]))
for b in cof:
if b == 'dn':
n = 0
for c in dnhost:
if c == a:
stmt = 'alter node ' + dnname[n] + " with(host='" + c + "',port=" + str(dnport[n]) + ')'
print(dnuser[nn], dnhost[nn], dnport[nn],stmt)
connTemp(dnuser[nn], dnhost[nn], dnport[nn], stmt)
n = n + 1
else:
stmt = 'create node ' + dnname[n] + " with(type=datanode,host='" + c + "',port=" + str(dnport[n]) + ',primary=false,preferred=false)'
print(dnuser[nn], dnhost[nn], dnport[nn], stmt)
connTemp(dnuser[nn], dnhost[nn], dnport[nn], stmt)
n = n + 1
else:
n = 0
for c in cnhost:
stmt = 'create node ' + cnname[n] + " with(type=coordinator,host='" + c + "',port=" + str(cnport[n]) + ',primary=false,preferred=false)'
print(cnuser[nn], cnhost[nn], cnport[nn], stmt)
connTemp(dnuser[nn], dnhost[nn], dnport[nn], stmt)
n = n + 1
nn = nn + 1
print('\ncreating sharding')
alldn = ''
for i in dnname:
if i == dnname[0]:
alldn = i
else:
alldn = alldn + ',' + i
stmt1 = 'create default node group default_group with(' + alldn + ')'
connTemp(cnuser[0], cnhost[0], cnport[0], stmt1)
stmt2 = 'create sharding group to group default_group'
connTemp(cnuser[0], cnhost[0], cnport[0], stmt2)
stmt3 = 'clean sharding'
connTemp(cnuser[0], cnhost[0], cnport[0], stmt3)
def clean():
#pg_ctl -D /home/charles/data/pgdatadir stop -m immediate
gtmclean = 'gtm_ctl -Z gtm -m immediate -D ' + gtmdata[0] + '\n'
sshTemp(gtmhost[0], gtmclean, 1)
n = 0
for i in gtmshost:
gtmsclean = 'gtm_ctl -Z gtm_standby stop -m immediate -D ' + gtmsdata[n] + '\n'
sshTemp(i, gtmsclean, 1)
n = n +1
n = 0
for i in cnhost:
cnclean = 'pg_ctl stop -m immediate -D ' + cndata[n] + '\n'
sshTemp(i, cnclean, 1)
n = n + 1
n = 0
for i in dnhost:
dnclean = 'pg_ctl stop -m immediate -D ' + dndata[n] + '\n'
sshTemp(i, dnclean, 1)
n = n + 1
n = 0
for i in dnshost:
dnsclean = 'pg_ctl stop -m immediate -D ' + dnsdata[n] + '\n'
sshTemp(i, dnsclean, 1)
n = n + 1
remoTemp(gtmhost[0], gtmdata[0])
n = 0
for i in gtmshost:
remoTemp(i, gtmsdata[n])
n = n +1
n = 0
for i in cnhost:
remoTemp(i, cndata[n])
n = n + 1
n = 0
for i in dnhost:
remoTemp(i, dndata[n])
n = n + 1
n = 0
for i in dnshost:
remoTemp(i, dnsdata[n])
n = n + 1
if __name__ == '__main__':
parser = argparse.ArgumentParser(description = 'the pgxz/pgxl/pgxc install script.')
parser.add_argument('--type', default='pgxc', help = 'pgxc, pgxz, pgxl')
parser.add_argument('--config', default='install.json', help = 'the config json file')
parser.add_argument('--defbase', default='/home/kunlun/compare/postgres-xc/base', help = 'default basedir')
parser.add_argument('--defuser', default='kunlun', help = 'default user')
parser.add_argument('--package', default='package', help = 'the package of pgxz/xl/xc')
parser.add_argument('--opt', default='install', help = 'can be "i" or "c", "i" = "install" \n "c" = "clean"')
args = parser.parse_args()
File = args.config
defbase = args.defbase
defuser = args.defuser
package = args.package
types = args.type
opt = args.opt
print(args)
readJsonFile()
if opt == 'i':
install()
ConfigRoute()
elif opt == 'c':
clean()
#print('gtm\n', gtmhost,'\n', gtmport, '\n', gtmdata, '\n',gtmuser, '\n', gtmname, '\n' , '\ngtm_slave \n',gtmshost, '\n', gtmsport, '\n', gtmsdata, '\n', gtmsuser, '\n', gtmsname, '\n', '\ncn\n', cnhost, '\n', cnport, '\n', cndata, '\n', cnuser, '\n', cnname, '\n', '\ndn\n', dnhost, '\n', dnport, '\n', dndata, '\n', dnuser, '\n', dnname, '\n', dnpooler, '\n', '\ndn_slave \n', dnshost, '\n', dnsport, '\n', dnsdata, '\n', dnsuser, '\n', dnspooler, '\n', dnsname, '\n', dnsmport, '\n', dnsmname, '\n', dnsmhost)
| person/charles/PGX/pgx_install.py | 18,308 | res = cur.fetchall()print(ahost) create env file scp package & env file to each instance ====================== -------------------------- gtm ------------------------------------- init gtm master node ================================== change gtm configuration =================================== start gtm ============================= -------------------------- gtm slave ----------------------------- init gtm slave node ==================== change gtm slave configuration =====================start gtm slave ================== ------------------------- cn node --------------------------------initdb --locale=zh_CN.UTF-8 -U kunlun -E utf8 -D /home/kunlun/TPC/postgres-xz/data/cn01 --nodename=cn01 --nodetype=coordinator --master_gtm_nodename gtm --master_gtm_ip 192.168.0.134 --master_gtm_port 23001 init cn node =============== change cn node configuration ============= start cn node ================= ------------------------- dn node -------------------------------- init dn node =============== change dn configuration ==================== start dn node ================= ----------------------- dn slave node -------------------------- pg_basebackup -p 23003 -h 192.168.0.132 -U kunlun -D /home/kunlun/TPC/postgres-xz/data/dn01s1 -X f -P -v init dns node =============== change dns configuration ================== start dns node ================== 配置路由pg_ctl -D /home/charles/data/pgdatadir stop -m immediateprint('gtm\n', gtmhost,'\n', gtmport, '\n', gtmdata, '\n',gtmuser, '\n', gtmname, '\n' , '\ngtm_slave \n',gtmshost, '\n', gtmsport, '\n', gtmsdata, '\n', gtmsuser, '\n', gtmsname, '\n', '\ncn\n', cnhost, '\n', cnport, '\n', cndata, '\n', cnuser, '\n', cnname, '\n', '\ndn\n', dnhost, '\n', dnport, '\n', dndata, '\n', dnuser, '\n', dnname, '\n', dnpooler, '\n', '\ndn_slave \n', dnshost, '\n', dnsport, '\n', dnsdata, '\n', dnsuser, '\n', dnspooler, '\n', dnsname, '\n', dnsmport, '\n', dnsmname, '\n', dnsmhost) | 1,933 | en | 0.29501 |
# -*- coding: utf-8 -*-
"""
Created on Tue Jun 07 2016
@author: Matthew Carse
"""
#@ Class containing methods for machine learning.
#@ Chromosomes must be preprocessed through feature scaling standardisation prior to being
#@ used in machine learning. The class implements Scikit-learn to apply feature scaling to the
#@ training chromosomes. The scaling factors are retained for use with the validation
#@ and testing datasets.
#@ The class is also responsible for reading in groupings for model generation and prediction
#@ validation. The prediction validation (fitness) can be accuracy, precision, recall or f-statistic.
#@ Outputs HTML confusion matrices for split mode (lda and rfc on held-out data) and confusion matrix (lda)
#@ and ROC curve for cross-validation.
import numpy, os
import vpGenList as vpGenList
from sklearn import preprocessing
from sklearn.discriminant_analysis import LinearDiscriminantAnalysis
from sklearn.metrics import precision_recall_fscore_support
from sklearn.ensemble import RandomForestClassifier
from sklearn import cross_validation
from sklearn.pipeline import make_pipeline
from sklearn.metrics import confusion_matrix
import plotly as py
from plotly.graph_objs import Heatmap, Figure
import warnings
warnings.filterwarnings("ignore") # warnings about collinearity are ignored as not relating to number of vpGens
class machineLearning:
def __init__(self, mode):
self.mode = mode
# call function to read groupings for validation of classification
# the file reading will only be performed once with the results
# saved to class variables
self.groupingsRead()
self.cm = False # variable to toggle plotting of confusion matrix for highest-scoring model
# use scikit-learn preprocessing to scale features using standardisation ((X-mean)/s.d.)
# feature scaling results in 0 or near-0 mean and unit variance for non-0 features
def preprocess(self):
# scaling values created using training set
# list of training feature set dictionaries decomposed to obtain feature sets
self.scaler = preprocessing.StandardScaler().fit(numpy.asarray(self.getFSets(vpGenList.allTrainFSets)))
# keys used to remake dictionary (both allvpGens and all*FSets in same order)
# saved as class variable
if len(keys) == 0:
for k in vpGenList.allTrainFSets[0]:
keys.append(k)
# list of dictionaries of scaled feature sets to be sent back to vpGenList
allFSetsScaled = list()
x = self.scaler.transform(numpy.asarray(self.getFSets(vpGenList.allTrainFSets)))
# use list of dictionaries
for seq in x:
d = {keys[i]: list(seq[i*6:(i+1)*6]) for i in range(400)}
allFSetsScaled.append(d)
return allFSetsScaled
# read through each dictionary in the list of feature sets
# reforming the feature sets into 2400-feature list
# results in list of length # sequences * 2400 (400*6)
# used to calculate feature scaling values
def getFSets(self, fsets):
l = list()
for d in fsets:
subl = list()
for fset in d.values():
subl += fset
l.append(subl)
return l
# read in protein groupings for use with classification validation
# use hard-coded file names, as checked for with program call
def groupingsRead(self):
if len(trainGroupings) == 0:
if self.mode == "split":
f = open(("{0}/training_groupings.txt").format(os.getcwd())).read()
else:
f = open(("{0}/all_groupings.txt").format(os.getcwd())).read()
# split using whitespace delimiter
for g in f.split():
trainGroupings.append(g)
#print trainGroupings
print 'Training groupings created!'
if len(validGroupings) == 0:
if self.mode == "split":
f = open(("{0}/validation_groupings.txt").format(os.getcwd())).read()
# split using whitespace delimiter
for g in f.split():
validGroupings.append(g)
#print validGroupings
print 'Validation groupings created!'
if len(testGroupings) == 0:
if self.mode == "split":
f = open(("{0}/testing_groupings.txt").format(os.getcwd())).read()
# split using whitespace delimiter
for g in f.split():
testGroupings.append(g)
#print testGroupings
print 'Testing groupings created!'
# function which uses the scaling factors derived from the training dataset
# to scale the validation and test datasets' chromosomes
def scale(self, dataset):
# list of dictionaries of scaled feature sets to be sent back to vpGenList
allFSetsScaled = list()
# scale feature sets
if dataset == 'valid':
x = self.scaler.transform(numpy.asarray(self.getFSets(vpGenList.allValidFSets)))
if dataset == 'test':
x = self.scaler.transform(numpy.asarray(self.getFSets(vpGenList.allTestFSets)))
# use list of dictionaries
# for each scaled sequence (2400 features, 400 feature sets)
# decompose this into feature sets, incrementally taking the next 6 features
# each feature set is added to a dictionary with the appropriate id key
# each dictionary (one per sequence) is then added to a list and returned
for seq in x:
d = {keys[i]: list(seq[i*6:(i+1)*6]) for i in range(400)}
allFSetsScaled.append(d)
return allFSetsScaled
# function to create an lda model using the training chromosome list
# of the defined number of chromosomes and the correct peptide groupings
# the same identifiers are used to create the validation chromosome list
# the lda model predicts the classifications of the validation set
# the predictions, along with the correct groupings, are used to calculate
# several fitness metrics - precision, accuracy, f-statistic, accuracy
def classifyLDA(self, tCList, vCList):
if self.mode == "cv":
# LDA object
clf = make_pipeline(preprocessing.StandardScaler(), LinearDiscriminantAnalysis())
predicted = cross_validation.cross_val_predict(clf, tCList, trainGroupings, cv=3)
if self.cm:
self.confusionMatrix(trainGroupings, predicted, 'lda_cv')
return precision_recall_fscore_support(trainGroupings, predicted, average = 'weighted')[2]
else:
clf = LinearDiscriminantAnalysis()
# fit lda model using training chromosomes
clf.fit(numpy.asarray(tCList), numpy.asarray(trainGroupings))
if self.cm:
self.confusionMatrix(validGroupings, predicted, 'lda_valid')
# return precision ([0]), recall ([1]) or f1 score ([2]), replace with clf.score(numpy.asarray(vCList), validGroupings) for accuracy
return precision_recall_fscore_support(validGroupings, clf.predict(numpy.asarray(vCList)), average = 'weighted')[2] # fitness for validation set
# return clf.score(numpy.asarray(vCList), validGroupings) # accuracy for validation set
# create a random forest model using the training chromosomes
# predict the groupings of the validation set
### CHANGE: n_estimators = NUMBER OF DECISION TREES ###
def classifyRFC( self, tCList, vCList):
rfc = RandomForestClassifier(n_estimators=5, random_state=1, max_features=None)
# fit model using training chromosomes
rfc.fit(numpy.asarray(tCList), numpy.asarray(trainGroupings))
predicted = rfc.predict(vCList)
self.confusionMatrix(validGroupings, predicted, 'rfc_valid')
# return precision ([0]), recall ([1]) or f1 score ([2]), replace with rfc.score(numpy.asarray(vCList), validGroupings) for accuracy
return precision_recall_fscore_support(validGroupings, predicted, average = 'weighted')[2] # fitness for validation set
# return rfc.score(vCList, numpy.asarray(validGroupings)) # accuracy for validation set
# create an lda model using the training chromosomes
# predict the groupings of the test set
def testEvaluateLDA(self, trCList, teCList):
# LDA object
clf = LinearDiscriminantAnalysis()
# fit lda model using training chromosomes
clf.fit(numpy.asarray(trCList), numpy.asarray(trainGroupings))
predicted = clf.predict(teCList)
self.confusionMatrix(testGroupings, predicted, 'lda_test')
# return precision ([0]), recall ([1]) or f1 score ([2]), replace with clf.score(numpy.asarray(teCList), testGroupings) for accuracy
return precision_recall_fscore_support(testGroupings, predicted, average = 'weighted')[2] # fitness for test set
# return clf.score(numpy.asarray(teCList), testGroupings) # accuracy for test set
# create a random forest model using the training chromosomes
# predict the groupings of the test set
### CHANGE: n_estimators = NUMBER OF DECISION TREES ###
def testEvaluateRFC(self, trCList, teCList):
rfc = RandomForestClassifier(n_estimators=10, random_state=1, max_features=None)
# fit model using training chromosomes
rfc.fit(numpy.asarray(trCList), numpy.asarray(trainGroupings))
predicted = rfc.predict(teCList)
self.confusionMatrix(testGroupings, predicted, 'rfc_test')
# return precision ([0]), recall ([1]) or f1 score ([2]), replace with rfc.score(numpy.asarray(teCList), testGroupings) for accuracy
return precision_recall_fscore_support(testGroupings, predicted, average = 'weighted')[2] # fitness for test set
# return rfc.score(teCList, numpy.asarray(testGroupings)) # accuracy for test set
# function to plot a confusion matrix heatmap
# takes as parameters:
# the correct groupings for the test set
# the predicted groupings
# the classifier type - lda or rfc (to change title/filename)
# outputs an html file
def confusionMatrix(self, groupings, predicted, clf):
cm = confusion_matrix(groupings, predicted)
z = cm
x=["Hydrolase","Mem. Trans","Structural"] # change as necessary
y=["Hydrolase","Mem. Trans","Structural"] # change as necessary
data = [Heatmap(z=z,x=x,y=y)]
annotations = []
for n, row in enumerate(z):
for m, val in enumerate(row):
annotations.append(
dict(
text="{:4.2f}% ({})".format((float(val)/len(groupings)*100),str(val)),
x=x[m], y=y[n],
xref='x1', yref='y1',
font=dict(color='white'),
showarrow=False)
)
xaxis = dict(title='Predicted class',ticks='')
yaxis = dict(title='Actual class',ticks='')
if clf == 'lda_test':
title = "Confusion matrix - linear discriminant analysis classification"
filename = "Confusion matrix_test_lda"
if clf == 'rfc_test':
title = "Confusion matrix - random forest classification"
filename = "Confusion matrix_test_rfc"
if clf == 'lda_cv':
title = "Confusion matrix - linear discriminant analysis classification"
filename = "Confusion matrix_cv_lda"
if clf == 'lda_valid':
title = "Confusion matrix - linear discriminant analysis classification"
filename = "Confusion matrix_valid_lda"
if clf == 'rfc_valid':
title = "Confusion matrix - random forest classification"
filename = "Confusion matrix_valid_rfc"
fig = Figure(data=data)
fig['layout'].update(title=title, xaxis=xaxis, yaxis=yaxis, annotations=annotations)
py.offline.plot(fig, filename=filename)
# function to plot roc curve for a cross-validation model
# outputs an html file
def rocCurve(self, tCList):
from sklearn.cross_validation import KFold
from sklearn.metrics import roc_curve, auc
from sklearn.preprocessing import label_binarize
from sklearn.multiclass import OneVsRestClassifier
from plotly.graph_objs import Scatter
cv = KFold(len(trainGroupings)+1, n_folds=6)
mean_tpr = 0.0
fig = py.tools.make_subplots(shared_xaxes=True, shared_yaxes=True, print_grid=False)
for index, (train, test) in enumerate(cv):
classes = list(set(trainGroupings))
classes.sort()
y = label_binarize(trainGroupings, classes=classes)
n_classes = len(classes)
trainL, testL = [e for e in train], [e for e in test]
del trainL[-1] # delete last element otherwise too many
del testL[-1]
trainL, testL = numpy.asarray(trainL), numpy.asarray(testL)
# split dataset for fold into training and testing sets and groupings
X_train, X_test, y_train, y_test = numpy.asarray(tCList)[trainL], numpy.asarray(tCList)[testL], numpy.asarray(y)[trainL], numpy.asarray(y)[testL]
scaler = preprocessing.StandardScaler().fit(X_train) # create feature scaling values using training set
X_train_transformed = scaler.transform(X_train) # scale training set
X_test_transformed = scaler.transform(X_test) # scale test set
classifier = OneVsRestClassifier(LinearDiscriminantAnalysis()) # one vs rest classifier for multi-class
y_score = classifier.fit(X_train_transformed, y_train).decision_function(X_test_transformed)
fpr = dict()
tpr = dict()
roc_auc = dict() # roc area under curve
for i in range(n_classes):
fpr[i], tpr[i], _ = roc_curve(y_test[:, i], y_score[:, i])
roc_auc[i] = auc(fpr[i], tpr[i])
fpr["micro"], tpr["micro"], _ = roc_curve(y_test.ravel(), y_score.ravel())
roc_auc["micro"] = auc(fpr["micro"], tpr["micro"])
all_fpr = numpy.unique(numpy.concatenate([fpr[i] for i in range(n_classes)]))
mean_tpr = numpy.zeros_like(all_fpr)
for i in range(n_classes):
mean_tpr += numpy.interp(all_fpr, fpr[i], tpr[i])
mean_tpr /= n_classes
fpr["macro"] = all_fpr
tpr["macro"] = mean_tpr
roc_auc["macro"] = auc(fpr["macro"], tpr["macro"])
# add trace for micro and macro averages
trace1 = Scatter(x=fpr["micro"],y=tpr["micro"],name=('Micro-average ROC curve fold {} (area = {:03.2f})').format(index, roc_auc["micro"]),mode='lines')
fig.append_trace(trace1, 1, 1)
trace2 = Scatter(x=fpr["macro"],y=tpr["macro"],name=('Macro-average ROC curve fold {} (area = {:03.2f})').format(index, roc_auc["macro"]),mode='lines')
fig.append_trace(trace2, 1, 1)
trace1 = Scatter(x=[0,1],y=[0,1],name='Chance',mode='lines') # add diagonal line for change
fig.append_trace(trace1, 1, 1)
title = 'Cross-validation Receiver Operating Characteristic'
xaxis = dict(title='False Positive Rate')
yaxis = dict(title='True Positive Rate')
fig['layout'].update(title=title, xaxis=xaxis, yaxis=yaxis)
saveName = '6fold_cv_roc'
py.offline.plot(fig, filename=saveName)
# class variables
trainGroupings = list()
validGroupings = list()
testGroupings = list()
keys = list()
| machineLearning.py | 16,607 | -*- coding: utf-8 -*-@ Class containing methods for machine learning.@ Chromosomes must be preprocessed through feature scaling standardisation prior to being @ used in machine learning. The class implements Scikit-learn to apply feature scaling to the@ training chromosomes. The scaling factors are retained for use with the validation@ and testing datasets.@ The class is also responsible for reading in groupings for model generation and prediction@ validation. The prediction validation (fitness) can be accuracy, precision, recall or f-statistic.@ Outputs HTML confusion matrices for split mode (lda and rfc on held-out data) and confusion matrix (lda)@ and ROC curve for cross-validation. warnings about collinearity are ignored as not relating to number of vpGens call function to read groupings for validation of classification the file reading will only be performed once with the results saved to class variables variable to toggle plotting of confusion matrix for highest-scoring model use scikit-learn preprocessing to scale features using standardisation ((X-mean)/s.d.) feature scaling results in 0 or near-0 mean and unit variance for non-0 features scaling values created using training set list of training feature set dictionaries decomposed to obtain feature sets keys used to remake dictionary (both allvpGens and all*FSets in same order) saved as class variable list of dictionaries of scaled feature sets to be sent back to vpGenList use list of dictionaries read through each dictionary in the list of feature sets reforming the feature sets into 2400-feature list results in list of length sequences * 2400 (400*6) used to calculate feature scaling values read in protein groupings for use with classification validation use hard-coded file names, as checked for with program call split using whitespace delimiterprint trainGroupings split using whitespace delimiterprint validGroupings split using whitespace delimiterprint testGroupings function which uses the scaling factors derived from the training dataset to scale the validation and test datasets' chromosomes list of dictionaries of scaled feature sets to be sent back to vpGenList scale feature sets use list of dictionaries for each scaled sequence (2400 features, 400 feature sets) decompose this into feature sets, incrementally taking the next 6 features each feature set is added to a dictionary with the appropriate id key each dictionary (one per sequence) is then added to a list and returned function to create an lda model using the training chromosome list of the defined number of chromosomes and the correct peptide groupings the same identifiers are used to create the validation chromosome list the lda model predicts the classifications of the validation set the predictions, along with the correct groupings, are used to calculate several fitness metrics - precision, accuracy, f-statistic, accuracy LDA object fit lda model using training chromosomes return precision ([0]), recall ([1]) or f1 score ([2]), replace with clf.score(numpy.asarray(vCList), validGroupings) for accuracy fitness for validation set return clf.score(numpy.asarray(vCList), validGroupings) accuracy for validation set create a random forest model using the training chromosomes predict the groupings of the validation set CHANGE: n_estimators = NUMBER OF DECISION TREES fit model using training chromosomes return precision ([0]), recall ([1]) or f1 score ([2]), replace with rfc.score(numpy.asarray(vCList), validGroupings) for accuracy fitness for validation set return rfc.score(vCList, numpy.asarray(validGroupings)) accuracy for validation set create an lda model using the training chromosomes predict the groupings of the test set LDA object fit lda model using training chromosomes return precision ([0]), recall ([1]) or f1 score ([2]), replace with clf.score(numpy.asarray(teCList), testGroupings) for accuracy fitness for test set return clf.score(numpy.asarray(teCList), testGroupings) accuracy for test set create a random forest model using the training chromosomes predict the groupings of the test set CHANGE: n_estimators = NUMBER OF DECISION TREES fit model using training chromosomes return precision ([0]), recall ([1]) or f1 score ([2]), replace with rfc.score(numpy.asarray(teCList), testGroupings) for accuracy fitness for test set return rfc.score(teCList, numpy.asarray(testGroupings)) accuracy for test set function to plot a confusion matrix heatmap takes as parameters: the correct groupings for the test set the predicted groupings the classifier type - lda or rfc (to change title/filename) outputs an html file change as necessary change as necessary function to plot roc curve for a cross-validation model outputs an html file delete last element otherwise too many split dataset for fold into training and testing sets and groupings create feature scaling values using training set scale training set scale test set one vs rest classifier for multi-class roc area under curve add trace for micro and macro averages add diagonal line for change class variables | 5,127 | en | 0.783423 |
"""
In this exercise you are going to apply what you learned about stacks with a real world problem.
We will be using stacks to make sure the parentheses are balanced in mathematical expressions such as:
((3^2 + 8)*(5/2))/(2+6)
In real life you can see this extend to many things such as text editor plugins
and interactive development environments for all sorts of bracket completion checks.
Take a string as an input and return `True` if it's parentheses are balanced or `False` if it is not.
"""
from typing import List
class Stack:
def __init__(self):
self.items = []
def size(self):
return len(self.items)
def push(self, item):
self.items.append(item)
def pop(self):
if self.size() == 0:
return None
else:
return self.items.pop()
def equation_checker(equation):
"""
Check equation for balanced parentheses
Args:
equation(string): String form of equation
Returns:
bool: Return if parentheses are balanced or not
"""
opening_parenthesis = Stack()
closing_parenthesis = Stack()
for _ in equation:
if _ == "(":
opening_parenthesis.push(_)
elif _ == ")":
closing_parenthesis.push(_)
return opening_parenthesis.size() == closing_parenthesis.size()
def _equation_checker(equation):
"""
Check equation for balanced parentheses
"""
# not in the the spirit
return equation.count("(") == equation.count(")")
def udacity_equation_checker(equation):
stack = Stack()
for char in equation:
if char == "(":
stack.push(char)
elif char == ")":
if stack.pop() == None:
return False
return stack.size() == 0
| 3. data_structures/stack/balanced_parantheses.py | 1,781 | Check equation for balanced parentheses
Check equation for balanced parentheses
Args:
equation(string): String form of equation
Returns:
bool: Return if parentheses are balanced or not
In this exercise you are going to apply what you learned about stacks with a real world problem.
We will be using stacks to make sure the parentheses are balanced in mathematical expressions such as:
((3^2 + 8)*(5/2))/(2+6)
In real life you can see this extend to many things such as text editor plugins
and interactive development environments for all sorts of bracket completion checks.
Take a string as an input and return `True` if it's parentheses are balanced or `False` if it is not.
not in the the spirit | 718 | en | 0.859393 |
import os
import re
import uuid
import typing as t
import logging
import pathlib
import functools
from typing import TYPE_CHECKING
from distutils.dir_util import copy_tree
from simple_di import inject
from simple_di import Provide
import bentoml
from bentoml import Tag
from bentoml.exceptions import BentoMLException
from bentoml.exceptions import MissingDependencyException
from ..types import LazyType
from ..runner.utils import Params
from ..utils.tensorflow import get_tf_version
from ..utils.tensorflow import is_gpu_available
from ..utils.tensorflow import hook_loaded_model
from .common.model_runner import BaseModelRunner
from ..configuration.containers import BentoMLContainer
logger = logging.getLogger(__name__)
try:
import tensorflow as tf # type: ignore
except ImportError: # pragma: no cover
raise MissingDependencyException(
"""\
`tensorflow` is required in order to use `bentoml.tensorflow`.
Instruction: `pip install tensorflow`
"""
)
try:
import tensorflow_hub as hub # type: ignore
from tensorflow_hub import resolve # type: ignore
from tensorflow_hub import native_module # type: ignore
except ImportError: # pragma: no cover
logger.warning(
"""\
If you want to use `bentoml.tensorflow.import_from_tfhub(),
make sure to `pip install --upgrade tensorflow_hub` before using.
"""
)
hub = None
try:
import importlib.metadata as importlib_metadata
except ImportError:
import importlib_metadata
if TYPE_CHECKING:
from tensorflow_hub import Module as HubModule # type: ignore
from tensorflow_hub import KerasLayer # type: ignore
from .. import external_typing as ext
from ..types import PathType
from ..models import ModelStore
from ..external_typing import tensorflow as tf_ext
TFArgType = t.Union[t.List[t.Union[int, float]], ext.NpNDArray, tf_ext.Tensor]
MODULE_NAME = "bentoml.tensorflow_v2"
def _clean_name(name: str) -> str: # pragma: no cover
if name.startswith(("http://", "https://")):
name = name.split("/", maxsplit=3)[-1]
else:
name = name.split("/")[-1]
return re.sub(r"\W|^(?=\d)-", "_", name)
@inject
def load(
bento_tag: t.Union[str, Tag],
tags: t.Optional[t.List[str]] = None,
options: t.Optional["tf_ext.SaveOptions"] = None,
load_as_hub_module: t.Optional[bool] = None,
model_store: "ModelStore" = Provide[BentoMLContainer.model_store],
) -> t.Union["tf_ext.AutoTrackable", "tf_ext.Module", "HubModule", "KerasLayer"]:
"""
Load a model from BentoML local modelstore with given name.
Args:
bento_tag (:code:`Union[str, Tag]`):
Tag of a saved model in BentoML local modelstore.
tags (:code:`str`, `optional`, defaults to `None`):
A set of strings specifying the graph variant to use, if loading from a v1 module.
options (:code:`tensorflow.saved_model.SaveOptions`, `optional`, default to :code:`None`):
:code:`tensorflow.saved_model.LoadOptions` object that specifies options for loading. This
argument can only be used from TensorFlow 2.3 onwards.
load_as_hub_module (`bool`, `optional`, default to :code:`True`):
Load the given weight that is saved from tfhub as either `hub.KerasLayer` or `hub.Module`.
The latter only applies for TF1.
model_store (:mod:`~bentoml._internal.models.store.ModelStore`, default to :mod:`BentoMLContainer.model_store`):
BentoML modelstore, provided by DI Container.
Returns:
:obj:`SavedModel`: an instance of :obj:`SavedModel` format from BentoML modelstore.
Examples:
.. code-block:: python
import bentoml
# load a model back into memory
model = bentoml.tensorflow.load("my_tensorflow_model")
""" # noqa: LN001
model = model_store.get(bento_tag)
if model.info.module not in (MODULE_NAME, __name__):
raise BentoMLException(
f"Model {bento_tag} was saved with module {model.info.module}, failed loading with {MODULE_NAME}."
)
if model.info.context["import_from_tfhub"]:
assert load_as_hub_module is not None, (
"You have to specified `load_as_hub_module=True | False`"
" to load a `tensorflow_hub` module. If True is chosen,"
" then BentoML will return either an instance of `hub.KerasLayer`"
" or `hub.Module` depending on your TF version. For most usecase,"
" we recommend to keep `load_as_hub_module=True`. If you wish to extend"
" the functionalities of the given model, set `load_as_hub_module=False`"
" will return a SavedModel object."
)
if hub is None:
raise MissingDependencyException(
"""\
`tensorflow_hub` does not exists.
Make sure to `pip install --upgrade tensorflow_hub` before using.
"""
)
module_path = model.path_of(model.info.options["local_path"])
if load_as_hub_module:
return (
hub.Module(module_path)
if get_tf_version().startswith("1")
else hub.KerasLayer(module_path)
)
# In case users want to load as a SavedModel file object.
# https://github.com/tensorflow/hub/blob/master/tensorflow_hub/module_v2.py#L93
is_hub_module_v1: bool = tf.io.gfile.exists( # type: ignore
native_module.get_module_proto_path(module_path)
)
if tags is None and is_hub_module_v1:
tags = []
if options is not None:
if not LazyType(
"tensorflow.python.saved_model.save_options.SaveOptions"
).isinstance(options):
raise BentoMLException(
f"`options` has to be of type `tf.saved_model.SaveOptions`, got {type(options)} instead."
)
if not hasattr(getattr(tf, "saved_model", None), "LoadOptions"):
raise NotImplementedError(
"options are not supported for TF < 2.3.x,"
f" Current version: {get_tf_version()}"
)
tf_model: "tf_ext.AutoTrackable" = tf.compat.v1.saved_model.load_v2( # type: ignore
module_path,
tags=tags,
options=options, # type: ignore
)
else:
tf_model: "tf_ext.AutoTrackable" = tf.compat.v1.saved_model.load_v2( # type: ignore
module_path,
tags=tags,
)
tf_model._is_hub_module_v1 = (
is_hub_module_v1 # pylint: disable=protected-access # noqa
)
return tf_model
else:
tf_model: "tf_ext.AutoTrackable" = tf.compat.v1.saved_model.load_v2(model.path) # type: ignore
return hook_loaded_model(tf_model, MODULE_NAME)
@inject
def import_from_tfhub(
identifier: t.Union[str, "HubModule", "KerasLayer"],
name: t.Optional[str] = None,
labels: t.Optional[t.Dict[str, str]] = None,
custom_objects: t.Optional[t.Dict[str, t.Any]] = None,
metadata: t.Optional[t.Dict[str, t.Any]] = None,
model_store: "ModelStore" = Provide[BentoMLContainer.model_store],
) -> Tag:
"""
Import a model from `Tensorflow Hub <https://tfhub.dev/>`_ to BentoML modelstore.
Args:
identifier (:code:`Union[str, tensorflow_hub.Module, tensorflow_hub.KerasLayer]`): Identifier accepts
two type of inputs:
- if `type` of :code:`identifier` either of type :code:`tensorflow_hub.Module` (**legacy** `tensorflow_hub`) or :code:`tensorflow_hub.KerasLayer` (`tensorflow_hub`), then we will save the given model to a :code:`SavedModel` format.
- if `type` of :code:`identifier` is a :obj:`str`, we assume that this is the URI retrieved from Tensorflow Hub. We then clean the given URI, and get a local copy of a given model to BentoML modelstore. name (:code:`str`, `optional`, defaults to `None`): An optional name for the model. If :code:`identifier` is a :obj:`str`, then name can be autogenerated from the given URI.
name (:code:`str`, `optional`, default to `None`):
Optional name for the saved model. If None, then name will be generated from :code:`identifier`.
labels (:code:`Dict[str, str]`, `optional`, default to :code:`None`):
user-defined labels for managing models, e.g. team=nlp, stage=dev
custom_objects (:code:`Dict[str, Any]]`, `optional`, default to :code:`None`):
user-defined additional python objects to be saved alongside the model,
e.g. a tokenizer instance, preprocessor function, model configuration json
metadata (:code:`Dict[str, Any]`, `optional`, default to :code:`None`):
Custom metadata for given model.
model_store (:mod:`~bentoml._internal.models.store.ModelStore`, default to :mod:`BentoMLContainer.model_store`):
BentoML modelstore, provided by DI Container.
Returns:
:obj:`~bentoml.Tag`: A :obj:`~bentoml.Tag` object that can be used to retrieve the model with :func:`bentoml.tensorflow.load`:
Example for importing a model from Tensorflow Hub:
.. code-block:: python
import tensorflow_text as text # noqa # pylint: disable
import bentoml
tag = bentoml.tensorflow.import_from_tfhub("https://tfhub.dev/tensorflow/bert_en_uncased_preprocess/3")
# load model back with `load`:
model = bentoml.tensorflow.load(tag, load_as_hub_module=True)
Example for importing a custom Tensorflow Hub model:
.. code-block:: python
import tensorflow as tf
import tensorflow_hub as hub
import bentoml
def _plus_one_model_tf2():
obj = tf.train.Checkpoint()
@tf.function(input_signature=[tf.TensorSpec(None, dtype=tf.float32)])
def plus_one(x):
return x + 1
obj.__call__ = plus_one
return obj
# then save the given model to BentoML modelstore:
model = _plus_one_model_tf2()
tag = bentoml.tensorflow.import_from_tfhub(model)
""" # noqa
if hub is None:
raise MissingDependencyException(
"""\
`tensorflow_hub` does not exists.
Make sure to `pip install --upgrade tensorflow_hub` before using.
"""
)
context: t.Dict[str, t.Any] = {
"framework_name": "tensorflow",
"pip_dependencies": [
f"tensorflow=={get_tf_version()}",
f"tensorflow_hub=={importlib_metadata.version('tensorflow_hub')}",
],
"import_from_tfhub": True,
}
if name is None:
if isinstance(identifier, str):
name = _clean_name(identifier)
else:
name = f"{identifier.__class__.__name__}_{uuid.uuid4().hex[:5].upper()}"
with bentoml.models.create(
name,
module=MODULE_NAME,
options=None,
context=context,
metadata=metadata,
labels=labels,
custom_objects=custom_objects,
) as _model:
if isinstance(identifier, str):
current_cache_dir = os.environ.get("TFHUB_CACHE_DIR")
os.environ["TFHUB_CACHE_DIR"] = _model.path
fpath: str = resolve(identifier)
folder = fpath.split("/")[-1]
_model.info.options = {"model": identifier, "local_path": folder}
if current_cache_dir is not None:
os.environ["TFHUB_CACHE_DIR"] = current_cache_dir
else:
if hasattr(identifier, "export"):
# hub.Module.export()
with tf.compat.v1.Session(graph=tf.compat.v1.get_default_graph()) as sess: # type: ignore
sess.run(tf.compat.v1.global_variables_initializer()) # type: ignore
identifier.export(_model.path, sess) # type: ignore
else:
tf.saved_model.save(identifier, _model.path)
_model.info.options = {
"model": identifier.__class__.__name__,
"local_path": ".",
}
return _model.tag
@inject
def save(
name: str,
model: t.Union["PathType", "tf_ext.KerasModel", "tf_ext.Module"],
*,
signatures: t.Optional["tf_ext.ConcreteFunction"] = None,
options: t.Optional["tf_ext.SaveOptions"] = None,
labels: t.Optional[t.Dict[str, str]] = None,
custom_objects: t.Optional[t.Dict[str, t.Any]] = None,
metadata: t.Optional[t.Dict[str, t.Any]] = None,
model_store: "ModelStore" = Provide[BentoMLContainer.model_store],
) -> Tag:
"""
Save a model instance to BentoML modelstore.
Args:
name (:code:`str`):
Name for given model instance. This should pass Python identifier check.
model (:code:`Union[keras.Model, tf.Module, path-like objects]`):
Instance of model to be saved
labels (:code:`Dict[str, str]`, `optional`, default to :code:`None`):
user-defined labels for managing models, e.g. team=nlp, stage=dev
custom_objects (:code:`Dict[str, Any]]`, `optional`, default to :code:`None`):
user-defined additional python objects to be saved alongside the model,
e.g. a tokenizer instance, preprocessor function, model configuration json
metadata (:code:`Dict[str, Any]`, `optional`, default to :code:`None`):
Custom metadata for given model.
model_store (:mod:`~bentoml._internal.models.store.ModelStore`, default to :mod:`BentoMLContainer.model_store`):
BentoML modelstore, provided by DI Container.
signatures (:code:`Union[Callable[..., Any], dict]`, `optional`, default to :code:`None`):
Refers to `Signatures explanation <https://www.tensorflow.org/api_docs/python/tf/saved_model/save>`_
from Tensorflow documentation for more information.
options (`tf.saved_model.SaveOptions`, `optional`, default to :code:`None`):
:obj:`tf.saved_model.SaveOptions` object that specifies options for saving.
Raises:
ValueError: If :obj:`obj` is not trackable.
Returns:
:obj:`~bentoml.Tag`: A :obj:`tag` with a format `name:version` where `name` is the user-defined model's name, and a generated `version` by BentoML.
Examples:
.. code-block:: python
import tensorflow as tf
import numpy as np
import bentoml
class NativeModel(tf.Module):
def __init__(self):
super().__init__()
self.weights = np.asfarray([[1.0], [1.0], [1.0], [1.0], [1.0]])
self.dense = lambda inputs: tf.matmul(inputs, self.weights)
@tf.function(
input_signature=[tf.TensorSpec(shape=[1, 5], dtype=tf.float64, name="inputs")]
)
def __call__(self, inputs):
return self.dense(inputs)
# then save the given model to BentoML modelstore:
model = NativeModel()
tag = bentoml.tensorflow.save("native_toy", model)
.. note::
:code:`bentoml.tensorflow.save` API also support saving `RaggedTensor <https://www.tensorflow.org/guide/ragged_tensor>`_ model and Keras model. If you choose to save a Keras model
with :code:`bentoml.tensorflow.save`, then the model will be saved under a :obj:`SavedModel` format instead of :obj:`.h5`.
""" # noqa
context: t.Dict[str, t.Any] = {
"framework_name": "tensorflow",
"pip_dependencies": [f"tensorflow=={get_tf_version()}"],
"import_from_tfhub": False,
}
with bentoml.models.create(
name,
module=MODULE_NAME,
options=None,
context=context,
labels=labels,
custom_objects=custom_objects,
metadata=metadata,
) as _model:
if isinstance(model, (str, bytes, os.PathLike, pathlib.Path)): # type: ignore[reportUnknownMemberType]
assert os.path.isdir(model)
copy_tree(str(model), _model.path)
else:
if options:
logger.warning(
f"Parameter 'options: {str(options)}' is ignored when "
f"using tensorflow {get_tf_version()}"
)
tf.saved_model.save(
model, _model.path, signatures=signatures, options=options
)
return _model.tag
class _TensorflowRunner(BaseModelRunner):
def __init__(
self,
tag: t.Union[str, Tag],
predict_fn_name: str,
device_id: str,
partial_kwargs: t.Optional[t.Dict[str, t.Any]],
name: t.Optional[str] = None,
):
super().__init__(tag, name=name)
self._device_id = device_id
self._configure(device_id)
self._predict_fn_name = predict_fn_name
self._partial_kwargs: t.Dict[str, t.Any] = (
partial_kwargs if partial_kwargs is not None else dict()
)
def _configure(self, device_id: str) -> None:
if "GPU" in device_id:
tf.config.set_visible_devices(device_id, "GPU")
self._config_proto = dict(
allow_soft_placement=True,
log_device_placement=False,
intra_op_parallelism_threads=self._num_threads,
inter_op_parallelism_threads=self._num_threads,
)
@property
def _num_threads(self) -> int:
if is_gpu_available() and self.resource_quota.on_gpu:
return 1
return int(round(self.resource_quota.cpu))
@property
def num_replica(self) -> int:
if is_gpu_available() and self.resource_quota.on_gpu:
return len(self.resource_quota.gpus)
return 1
def _setup(self) -> None:
self._model = load(self._tag, model_store=self.model_store)
raw_predict_fn = getattr(self._model, self._predict_fn_name) # type: ignore
self._predict_fn = functools.partial(raw_predict_fn, **self._partial_kwargs)
def _run_batch(self, *args: "TFArgType", **kwargs: "TFArgType") -> "ext.NpNDArray":
params = Params["TFArgType"](*args, **kwargs)
with tf.device(self._device_id): # type: ignore
def _mapping(item: "TFArgType") -> "tf_ext.TensorLike":
if not LazyType["tf_ext.TensorLike"]("tf.Tensor").isinstance(item):
return t.cast("tf_ext.TensorLike", tf.convert_to_tensor(item))
else:
return item
params = params.map(_mapping)
tf.compat.v1.global_variables_initializer() # type: ignore
res = self._predict_fn(*params.args, **params.kwargs)
return t.cast("ext.NpNDArray", res.numpy())
def load_runner(
tag: t.Union[str, Tag],
*,
predict_fn_name: str = "__call__",
device_id: str = "CPU:0",
name: t.Optional[str] = None,
partial_kwargs: t.Optional[t.Dict[str, t.Any]] = None,
) -> "_TensorflowRunner":
"""
Runner represents a unit of serving logic that can be scaled horizontally to
maximize throughput. `bentoml.tensorflow.load_runner` implements a Runner class that
wrap around a Tensorflow model, which optimize it for the BentoML runtime.
Args:
tag (:code:`Union[str, Tag]`):
Tag of a saved model in BentoML local modelstore.
predict_fn_name (:code:`str`, default to :code:`__call__`):
Inference function to be used.
partial_kwargs (:code:`Dict[str, Any]`, `optional`, default to :code:`None`):
Dictionary of partial kwargs that can be shared across different model.
device_id (:code:`str`, `optional`, default to the first CPU):
Optional devices to put the given model on. Refers to `Logical Devices <https://www.tensorflow.org/api_docs/python/tf/config/list_logical_devices>`_ from TF documentation.
Returns:
:obj:`~bentoml._internal.runner.Runner`: Runner instances for :mod:`bentoml.tensorflow` model
Examples:
.. code-block:: python
import bentoml
# load a runner from a given flag
runner = bentoml.tensorflow.load_runner(tag)
# load a runner on GPU:0
runner = bentoml.tensorflow.load_runner(tag, resource_quota=dict(gpus=0), device_id="GPU:0")
"""
return _TensorflowRunner(
tag=tag,
predict_fn_name=predict_fn_name,
device_id=device_id,
partial_kwargs=partial_kwargs,
name=name,
)
| bentoml/_internal/frameworks/tensorflow_v2.py | 20,533 | Import a model from `Tensorflow Hub <https://tfhub.dev/>`_ to BentoML modelstore.
Args:
identifier (:code:`Union[str, tensorflow_hub.Module, tensorflow_hub.KerasLayer]`): Identifier accepts
two type of inputs:
- if `type` of :code:`identifier` either of type :code:`tensorflow_hub.Module` (**legacy** `tensorflow_hub`) or :code:`tensorflow_hub.KerasLayer` (`tensorflow_hub`), then we will save the given model to a :code:`SavedModel` format.
- if `type` of :code:`identifier` is a :obj:`str`, we assume that this is the URI retrieved from Tensorflow Hub. We then clean the given URI, and get a local copy of a given model to BentoML modelstore. name (:code:`str`, `optional`, defaults to `None`): An optional name for the model. If :code:`identifier` is a :obj:`str`, then name can be autogenerated from the given URI.
name (:code:`str`, `optional`, default to `None`):
Optional name for the saved model. If None, then name will be generated from :code:`identifier`.
labels (:code:`Dict[str, str]`, `optional`, default to :code:`None`):
user-defined labels for managing models, e.g. team=nlp, stage=dev
custom_objects (:code:`Dict[str, Any]]`, `optional`, default to :code:`None`):
user-defined additional python objects to be saved alongside the model,
e.g. a tokenizer instance, preprocessor function, model configuration json
metadata (:code:`Dict[str, Any]`, `optional`, default to :code:`None`):
Custom metadata for given model.
model_store (:mod:`~bentoml._internal.models.store.ModelStore`, default to :mod:`BentoMLContainer.model_store`):
BentoML modelstore, provided by DI Container.
Returns:
:obj:`~bentoml.Tag`: A :obj:`~bentoml.Tag` object that can be used to retrieve the model with :func:`bentoml.tensorflow.load`:
Example for importing a model from Tensorflow Hub:
.. code-block:: python
import tensorflow_text as text # noqa # pylint: disable
import bentoml
tag = bentoml.tensorflow.import_from_tfhub("https://tfhub.dev/tensorflow/bert_en_uncased_preprocess/3")
# load model back with `load`:
model = bentoml.tensorflow.load(tag, load_as_hub_module=True)
Example for importing a custom Tensorflow Hub model:
.. code-block:: python
import tensorflow as tf
import tensorflow_hub as hub
import bentoml
def _plus_one_model_tf2():
obj = tf.train.Checkpoint()
@tf.function(input_signature=[tf.TensorSpec(None, dtype=tf.float32)])
def plus_one(x):
return x + 1
obj.__call__ = plus_one
return obj
# then save the given model to BentoML modelstore:
model = _plus_one_model_tf2()
tag = bentoml.tensorflow.import_from_tfhub(model)
Load a model from BentoML local modelstore with given name.
Args:
bento_tag (:code:`Union[str, Tag]`):
Tag of a saved model in BentoML local modelstore.
tags (:code:`str`, `optional`, defaults to `None`):
A set of strings specifying the graph variant to use, if loading from a v1 module.
options (:code:`tensorflow.saved_model.SaveOptions`, `optional`, default to :code:`None`):
:code:`tensorflow.saved_model.LoadOptions` object that specifies options for loading. This
argument can only be used from TensorFlow 2.3 onwards.
load_as_hub_module (`bool`, `optional`, default to :code:`True`):
Load the given weight that is saved from tfhub as either `hub.KerasLayer` or `hub.Module`.
The latter only applies for TF1.
model_store (:mod:`~bentoml._internal.models.store.ModelStore`, default to :mod:`BentoMLContainer.model_store`):
BentoML modelstore, provided by DI Container.
Returns:
:obj:`SavedModel`: an instance of :obj:`SavedModel` format from BentoML modelstore.
Examples:
.. code-block:: python
import bentoml
# load a model back into memory
model = bentoml.tensorflow.load("my_tensorflow_model")
Runner represents a unit of serving logic that can be scaled horizontally to
maximize throughput. `bentoml.tensorflow.load_runner` implements a Runner class that
wrap around a Tensorflow model, which optimize it for the BentoML runtime.
Args:
tag (:code:`Union[str, Tag]`):
Tag of a saved model in BentoML local modelstore.
predict_fn_name (:code:`str`, default to :code:`__call__`):
Inference function to be used.
partial_kwargs (:code:`Dict[str, Any]`, `optional`, default to :code:`None`):
Dictionary of partial kwargs that can be shared across different model.
device_id (:code:`str`, `optional`, default to the first CPU):
Optional devices to put the given model on. Refers to `Logical Devices <https://www.tensorflow.org/api_docs/python/tf/config/list_logical_devices>`_ from TF documentation.
Returns:
:obj:`~bentoml._internal.runner.Runner`: Runner instances for :mod:`bentoml.tensorflow` model
Examples:
.. code-block:: python
import bentoml
# load a runner from a given flag
runner = bentoml.tensorflow.load_runner(tag)
# load a runner on GPU:0
runner = bentoml.tensorflow.load_runner(tag, resource_quota=dict(gpus=0), device_id="GPU:0")
Save a model instance to BentoML modelstore.
Args:
name (:code:`str`):
Name for given model instance. This should pass Python identifier check.
model (:code:`Union[keras.Model, tf.Module, path-like objects]`):
Instance of model to be saved
labels (:code:`Dict[str, str]`, `optional`, default to :code:`None`):
user-defined labels for managing models, e.g. team=nlp, stage=dev
custom_objects (:code:`Dict[str, Any]]`, `optional`, default to :code:`None`):
user-defined additional python objects to be saved alongside the model,
e.g. a tokenizer instance, preprocessor function, model configuration json
metadata (:code:`Dict[str, Any]`, `optional`, default to :code:`None`):
Custom metadata for given model.
model_store (:mod:`~bentoml._internal.models.store.ModelStore`, default to :mod:`BentoMLContainer.model_store`):
BentoML modelstore, provided by DI Container.
signatures (:code:`Union[Callable[..., Any], dict]`, `optional`, default to :code:`None`):
Refers to `Signatures explanation <https://www.tensorflow.org/api_docs/python/tf/saved_model/save>`_
from Tensorflow documentation for more information.
options (`tf.saved_model.SaveOptions`, `optional`, default to :code:`None`):
:obj:`tf.saved_model.SaveOptions` object that specifies options for saving.
Raises:
ValueError: If :obj:`obj` is not trackable.
Returns:
:obj:`~bentoml.Tag`: A :obj:`tag` with a format `name:version` where `name` is the user-defined model's name, and a generated `version` by BentoML.
Examples:
.. code-block:: python
import tensorflow as tf
import numpy as np
import bentoml
class NativeModel(tf.Module):
def __init__(self):
super().__init__()
self.weights = np.asfarray([[1.0], [1.0], [1.0], [1.0], [1.0]])
self.dense = lambda inputs: tf.matmul(inputs, self.weights)
@tf.function(
input_signature=[tf.TensorSpec(shape=[1, 5], dtype=tf.float64, name="inputs")]
)
def __call__(self, inputs):
return self.dense(inputs)
# then save the given model to BentoML modelstore:
model = NativeModel()
tag = bentoml.tensorflow.save("native_toy", model)
.. note::
:code:`bentoml.tensorflow.save` API also support saving `RaggedTensor <https://www.tensorflow.org/guide/ragged_tensor>`_ model and Keras model. If you choose to save a Keras model
with :code:`bentoml.tensorflow.save`, then the model will be saved under a :obj:`SavedModel` format instead of :obj:`.h5`.
type: ignore pragma: no cover type: ignore type: ignore type: ignore pragma: no cover type: ignore type: ignore pragma: no cover noqa: LN001 In case users want to load as a SavedModel file object. https://github.com/tensorflow/hub/blob/master/tensorflow_hub/module_v2.pyL93 type: ignore type: ignore type: ignore type: ignore pylint: disable=protected-access noqa type: ignore noqa hub.Module.export() type: ignore type: ignore type: ignore noqa type: ignore[reportUnknownMemberType] type: ignore type: ignore type: ignore | 8,312 | en | 0.50811 |
"""
Django settings for modelos project.
Generated by 'django-admin startproject' using Django 1.9.7.
For more information on this file, see
https://docs.djangoproject.com/en/1.9/topics/settings/
For the full list of settings and their values, see
https://docs.djangoproject.com/en/1.9/ref/settings/
"""
import os
# Build paths inside the project like this: os.path.join(BASE_DIR, ...)
BASE_DIR = os.path.dirname(os.path.dirname(os.path.abspath(__file__)))
# Quick-start development settings - unsuitable for production
# See https://docs.djangoproject.com/en/1.9/howto/deployment/checklist/
# SECURITY WARNING: keep the secret key used in production secret!
SECRET_KEY = 'yxb@kgu3r$vjy8lfl0gti)+l5j6mvpt2r6xl^$(i-@iyttnd!!'
# SECURITY WARNING: don't run with debug turned on in production!
DEBUG = True
ALLOWED_HOSTS = []
# Application definition
INSTALLED_APPS = [
'django.contrib.admin',
'django.contrib.auth',
'django.contrib.contenttypes',
'django.contrib.sessions',
'django.contrib.messages',
'django.contrib.staticfiles',
# #nuestras apps
'myapp',
]
MIDDLEWARE_CLASSES = [
'django.middleware.security.SecurityMiddleware',
'django.contrib.sessions.middleware.SessionMiddleware',
'django.middleware.common.CommonMiddleware',
'django.middleware.csrf.CsrfViewMiddleware',
'django.contrib.auth.middleware.AuthenticationMiddleware',
'django.contrib.auth.middleware.SessionAuthenticationMiddleware',
'django.contrib.messages.middleware.MessageMiddleware',
'django.middleware.clickjacking.XFrameOptionsMiddleware',
]
ROOT_URLCONF = 'modelos.urls'
TEMPLATES = [
{
'BACKEND': 'django.template.backends.django.DjangoTemplates',
'DIRS': [],
'APP_DIRS': True,
'OPTIONS': {
'context_processors': [
'django.template.context_processors.debug',
'django.template.context_processors.request',
'django.contrib.auth.context_processors.auth',
'django.contrib.messages.context_processors.messages',
],
},
},
]
WSGI_APPLICATION = 'modelos.wsgi.application'
# Database
# https://docs.djangoproject.com/en/1.9/ref/settings/#databases
DATABASES = {
'default': {
'ENGINE': 'django.db.backends.sqlite3',
'NAME': os.path.join(BASE_DIR, 'db.sqlite3'),
}
}
# Password validation
# https://docs.djangoproject.com/en/1.9/ref/settings/#auth-password-validators
AUTH_PASSWORD_VALIDATORS = [
{
'NAME': 'django.contrib.auth.password_validation.UserAttributeSimilarityValidator',
},
{
'NAME': 'django.contrib.auth.password_validation.MinimumLengthValidator',
},
{
'NAME': 'django.contrib.auth.password_validation.CommonPasswordValidator',
},
{
'NAME': 'django.contrib.auth.password_validation.NumericPasswordValidator',
},
]
# Internationalization
# https://docs.djangoproject.com/en/1.9/topics/i18n/
LANGUAGE_CODE = 'en-us'
TIME_ZONE = 'UTC'
USE_I18N = True
USE_L10N = True
USE_TZ = True
# Static files (CSS, JavaScript, Images)
# https://docs.djangoproject.com/en/1.9/howto/static-files/
STATIC_URL = '/static/'
| src/modelos/settings.py | 3,207 | Django settings for modelos project.
Generated by 'django-admin startproject' using Django 1.9.7.
For more information on this file, see
https://docs.djangoproject.com/en/1.9/topics/settings/
For the full list of settings and their values, see
https://docs.djangoproject.com/en/1.9/ref/settings/
Build paths inside the project like this: os.path.join(BASE_DIR, ...) Quick-start development settings - unsuitable for production See https://docs.djangoproject.com/en/1.9/howto/deployment/checklist/ SECURITY WARNING: keep the secret key used in production secret! SECURITY WARNING: don't run with debug turned on in production! Application definition nuestras apps Database https://docs.djangoproject.com/en/1.9/ref/settings/databases Password validation https://docs.djangoproject.com/en/1.9/ref/settings/auth-password-validators Internationalization https://docs.djangoproject.com/en/1.9/topics/i18n/ Static files (CSS, JavaScript, Images) https://docs.djangoproject.com/en/1.9/howto/static-files/ | 1,002 | en | 0.627144 |
"""nflDAs URL Configuration
The `urlpatterns` list routes URLs to views. For more information please see:
https://docs.djangoproject.com/en/2.0/topics/http/urls/
Examples:
Function views
1. Add an import: from my_app import views
2. Add a URL to urlpatterns: path('', views.home, name='home')
Class-based views
1. Add an import: from other_app.views import Home
2. Add a URL to urlpatterns: path('', Home.as_view(), name='home')
Including another URLconf
1. Import the include() function: from django.urls import include, path
2. Add a URL to urlpatterns: path('blog/', include('blog.urls'))
"""
from django.contrib import admin
from django.urls import path
urlpatterns = [
path('admin/', admin.site.urls),
]
| nflDAs/nflDAs/urls.py | 748 | nflDAs URL Configuration
The `urlpatterns` list routes URLs to views. For more information please see:
https://docs.djangoproject.com/en/2.0/topics/http/urls/
Examples:
Function views
1. Add an import: from my_app import views
2. Add a URL to urlpatterns: path('', views.home, name='home')
Class-based views
1. Add an import: from other_app.views import Home
2. Add a URL to urlpatterns: path('', Home.as_view(), name='home')
Including another URLconf
1. Import the include() function: from django.urls import include, path
2. Add a URL to urlpatterns: path('blog/', include('blog.urls')) | 622 | en | 0.624706 |
from spn.structure.Base import Product, Sum, get_nodes_by_type
from spn.structure.leaves.cltree.CLTree import CLTree
from spn.algorithms.Validity import is_consistent
from scipy.sparse.csgraph import minimum_spanning_tree
from scipy.sparse.csgraph import depth_first_order
from error import RootVarError
import numpy as np
ROOT = -1
class VTreeNode:
""" used to model a Vtree """
def __init__(self, var_id=None, children=[]):
self.var_id = var_id
self.parent = None
self.innerNode = True if self.var_id is None else False
self.set_children(children)
self.scopes = None
def get_var_id(self):
return self.var_id
def get_parent(self):
return self.parent
def get_children(self):
return self.children
def set_children(self, children):
self.children = children
for child in children:
child.parent = self
def set_scopes(self, scopes):
self.scopes = scopes
def get_scopes(self):
return self.scopes
def is_leaf(self):
return len(self.children) == 0
def is_inner(self):
return len(self.children) != 0
class DTreeNode:
""" used to model a dependency tree """
def __init__(self, var_id, parent=None):
self.var_id = var_id
self.set_parent(parent)
self.children = []
self.tree = None
def get_var_id(self):
return self.var_id
def get_parent(self):
return self.parent
def get_children(self):
return self.children
def set_parent(self, parent):
if parent is not None:
self.parent = parent
self.parent.children.append(self)
def set_tree(self, scope, tree):
self.tree = [scope, tree]
def get_tree(self):
return self.tree
def is_leaf(self):
return len(self.children) == 0
def compute_probs(data, alpha):
#
# for fast np dot
if data.dtype != np.float32:
data = data.astype(np.float32)
n_features = data.shape[1]
n_samples = data.shape[0]
j_ones = np.dot(data.T, data)
#
# to avoid normalization errors (weights of sum nodes have to sum up to 1)
j_ones = j_ones.astype(np.float64)
j_ones_diag = np.diag(j_ones)
cols_diag = j_ones_diag * np.ones((n_features, n_features))
rows_diag = cols_diag.transpose()
probs = np.zeros((n_features, 2))
j_probs = np.zeros((n_features, n_features, 2, 2))
probs[:, 1] = (j_ones_diag + 2 * alpha) / (n_samples + 4 * alpha)
probs[:, 0] = 1 - probs[:, 1]
j_probs[:, :, 0, 0] = n_samples - cols_diag - rows_diag + j_ones + alpha
j_probs[:, :, 0, 1] = cols_diag - j_ones + alpha
j_probs[:, :, 1, 0] = rows_diag - j_ones + alpha
j_probs[:, :, 1, 1] = j_ones + alpha
j_probs = j_probs / (n_samples + 4 * alpha)
return probs, j_probs
def compute_factors(probs, j_probs, tree):
factors = np.zeros((probs.shape[0], 2, 2))
root_id = tree.index(ROOT)
features = np.arange(probs.shape[0]).tolist()
features.remove(root_id)
parents = tree.copy()
parents.pop(root_id)
factors[root_id, 0, 0] = factors[root_id, 1, 0] = probs[root_id, 0]
factors[root_id, 0, 1] = factors[root_id, 1, 1] = probs[root_id, 1]
factors[features, 0, 0] = j_probs[features, parents, 0, 0] / probs[parents, 0]
factors[features, 1, 0] = j_probs[features, parents, 0, 1] / probs[parents, 1]
factors[features, 0, 1] = j_probs[features, parents, 1, 0] / probs[parents, 0]
factors[features, 1, 1] = j_probs[features, parents, 1, 1] / probs[parents, 1]
return factors
def compute_mi_by_probs(probs, j_probs, log_j_probs):
prod_probs = np.zeros((probs.shape[0], probs.shape[0], 2, 2))
prod_probs[:, :, 0, 0] = np.outer(probs[:, 0], probs[:, 0])
prod_probs[:, :, 0, 1] = np.outer(probs[:, 0], probs[:, 1])
prod_probs[:, :, 1, 0] = np.outer(probs[:, 1], probs[:, 0])
prod_probs[:, :, 1, 1] = np.outer(probs[:, 1], probs[:, 1])
mut_info = np.sum(j_probs * (log_j_probs - np.log(prod_probs)), axis=(2, 3))
np.fill_diagonal(mut_info, 0)
return mut_info
def compute_mi(data, alpha):
probs, j_probs = compute_probs(data, alpha)
return compute_mi_by_probs(probs, j_probs, np.log(j_probs))
def build_dependency_tree_from_mi(mut_info, scope, root_var=None):
if root_var is None:
root_var = np.random.choice(scope)
else:
if root_var not in scope:
raise RootVarError()
root_id = scope.index(root_var)
mst = minimum_spanning_tree(-(mut_info + 1))
dfs_tree = depth_first_order(mst, directed=False, i_start=root_id)
tree = dfs_tree[1].tolist()
tree[root_id] = ROOT
dtree_nodes = {var_id: DTreeNode(var_id) for var_id in scope}
parents = np.arange(mut_info.shape[0]).tolist()
parents.remove(root_id)
for p in parents:
dtree_nodes[scope[p]].set_parent(dtree_nodes[scope[tree[p]]])
dtree_nodes[scope[root_id]].set_tree(scope, tree)
return dtree_nodes[scope[root_id]]
def learn_cltree(data, scope, root_var, alpha):
if root_var not in scope:
raise RootVarError()
probs, j_probs = compute_probs(data, alpha)
mut_info = compute_mi_by_probs(probs, j_probs, np.log(j_probs))
dtree_root = build_dependency_tree_from_mi(mut_info, scope, root_var)
factors = compute_factors(probs, j_probs, dtree_root.get_tree()[1])
factors_dict = {var: factors[scope.index(var)] for var in scope}
return dtree_root, factors_dict
def create_factors_dict(data, dtree_root, alpha):
probs, j_probs = compute_probs(data, alpha)
scope = dtree_root.get_tree()[0]
tree = dtree_root.get_tree()[1]
factors = compute_factors(probs, j_probs, tree)
factors_dict = {var: factors[scope.index(var)] for var in scope}
return factors_dict
def create_dtree_dict(data_l, cl_parts_l, conj_vars_l, alpha):
n_vars = data_l[0].shape[1]
sum_mut_info = np.zeros((n_vars, n_vars))
for i in range(len(data_l)):
for part in cl_parts_l[i]:
mi = compute_mi(part.get_slice(data_l[i]), alpha)
sum_mut_info[part.col_ids[:, None], part.col_ids] += mi
#
# create a dependency tree for each scope in scopes
free_vars = list(set(np.arange(n_vars))-set([var for conj_vars in conj_vars_l for var in conj_vars]))
if free_vars:
scopes = conj_vars_l + [free_vars]
else:
scopes = conj_vars_l
dtrees = []
for scope in scopes:
dtrees.append(build_dependency_tree_from_mi(sum_mut_info[scope][:, scope], scope))
scope = dtrees[-1].get_tree()[0].copy()
tree = dtrees[-1].get_tree()[1].copy()
#
# concatenate dtrees
for k in reversed(range(0, len(dtrees) - 1)):
tree += [t + len(scope) if t != ROOT else t for t in dtrees[k].get_tree()[1]]
tree[tree.index(ROOT)] = tree.index(ROOT, len(scope))
scope += dtrees[k].get_tree()[0]
dtrees[k].set_tree(scope.copy(), tree.copy())
dtrees[k + 1].set_parent(dtrees[k])
#
# return a dictionary of dtrees where keys are scope lengths
return {len(dtree.get_tree()[0]): dtree for dtree in dtrees}
def is_structured_decomposable(spn, verbose=False):
if not is_consistent(spn):
return False
nodes = get_nodes_by_type(spn)
scope_set = set()
for n in nodes:
if isinstance(n, Product):
scope_set.add(tuple(n.scope))
elif isinstance(n, CLTree):
vtree = from_dtree_to_vtree(n.dtree_root)
scope_set.update([tuple(s) for s in vtree.scopes])
scopes = list(scope_set)
scopes = [set(t) for t in scopes]
#
# ordering is not needed, but useful for printing
if verbose:
scopes.sort(key=len)
for s in scopes:
print(s)
for i in range(len(scopes)):
for j in range(len(scopes)):
int_len = len(scopes[i].intersection(scopes[j]))
if int_len != 0 and int_len != min(len(scopes[i]), len(scopes[j])):
return False
return True
def circuit_size(spn):
nodes = get_nodes_by_type(spn)
size = 0
for n in nodes:
if isinstance(n, Product) or isinstance(n, Sum):
size += len(n.children)
elif isinstance(n, CLTree):
queue = [n.dtree_root]
clt_size = 0
while queue:
peek_node = queue.pop(0)
queue.extend(peek_node.children)
if not peek_node.is_leaf():
clt_size += (1 + len(peek_node.children)) * 2
clt_size += 4
size += clt_size - 2
return size
def from_dtree_to_vtree(dtree_root):
if len(dtree_root.get_tree()[0]) == 1:
vtree_root = VTreeNode(var_id=dtree_root.get_tree()[0][0])
vtree_root.set_scopes([dtree_root.get_tree()[0]])
return vtree_root
scopes = []
scopes_t = []
last_node_visited = None
dtree_stack = [dtree_root]
buffer = []
while dtree_stack:
peek_dnode = dtree_stack[-1]
if not peek_dnode.children or (last_node_visited in peek_dnode.children):
if not peek_dnode.is_leaf():
leaves = []
n_parents = 0
for child in peek_dnode.children:
if child.is_leaf():
leaves.append(VTreeNode(child.var_id))
else:
n_parents += 1
if n_parents:
temp_buffer = buffer[-n_parents:]
del buffer[-n_parents:]
else:
temp_buffer = []
vtree_root = VTreeNode(children=leaves + temp_buffer + [VTreeNode(peek_dnode.var_id)])
#
# this piece of code store all the scopes of the vtree
# ------
scope = []
n_inner_children = 0
for n in vtree_root.children:
if not n.is_inner():
scope.append(n.var_id)
else:
n_inner_children += 1
if n_inner_children:
prev_scopes = scopes_t[-n_inner_children:]
del scopes_t[-n_inner_children:]
scope.extend([v for s in prev_scopes for v in s])
scopes_t.append(scope)
scopes.append(scope)
# ------
buffer.append(vtree_root)
dtree_stack.pop()
last_node_visited = peek_dnode
else:
dtree_stack.extend(peek_dnode.children)
vtree_root.set_scopes(scopes)
return vtree_root
| utils.py | 10,747 | used to model a dependency tree
used to model a Vtree
for fast np dot to avoid normalization errors (weights of sum nodes have to sum up to 1) create a dependency tree for each scope in scopes concatenate dtrees return a dictionary of dtrees where keys are scope lengths ordering is not needed, but useful for printing this piece of code store all the scopes of the vtree ------ ------ | 389 | en | 0.856603 |
# Copyright 2021 Huawei Technologies Co., Ltd
#
# Licensed under the Apache License, Version 2.0 (the "License");
# you may not use this file except in compliance with the License.
# You may obtain a copy of the License at
#
# http://www.apache.org/licenses/LICENSE-2.0
#
# Unless required by applicable law or agreed to in writing, software
# distributed under the License is distributed on an "AS IS" BASIS,
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
# See the License for the specific language governing permissions and
# limitations under the License.
# ============================================================================
import argparse
import os
import glob
import numpy as np
import PIL.Image as Image
parser = argparse.ArgumentParser()
parser.add_argument('--out_dir', type=str, required=True,
help='directory to store the image with noise')
parser.add_argument('--image_path', type=str, required=True,
help='directory of image to add noise')
parser.add_argument('--channel', type=int, default=3
, help='image channel, 3 for color, 1 for gray')
parser.add_argument('--sigma', type=int, default=15, help='level of noise')
args = parser.parse_args()
def add_noise(out_dir, image_path, channel, sigma):
file_list = glob.glob(image_path+'*') # image_path must end by '/'
if not os.path.exists(out_dir):
os.makedirs(out_dir)
for file in file_list:
print("Adding noise to: ", file)
# read image
if channel == 3:
img_clean = np.array(Image.open(file), dtype='float32') / 255.0
else:
img_clean = np.expand_dims(np.array(Image.open(file).convert('L'), dtype='float32') / 255.0, axis=2)
np.random.seed(0) #obtain the same random data when it is in the test phase
img_test = img_clean + np.random.normal(0, sigma/255.0, img_clean.shape).astype(np.float32)#HWC
img_test = np.expand_dims(img_test.transpose((2, 0, 1)), 0)#NCHW
#img_test = np.clip(img_test, 0, 1)
filename = file.split('/')[-1].split('.')[0] # get the name of image file
img_test.tofile(os.path.join(out_dir, filename+'_noise.bin'))
if __name__ == "__main__":
add_noise(args.out_dir, args.image_path, args.channel, args.sigma)
| official/cv/brdnet/preprocess.py | 2,411 | Copyright 2021 Huawei Technologies Co., Ltd Licensed under the Apache License, Version 2.0 (the "License"); you may not use this file except in compliance with the License. You may obtain a copy of the License at http://www.apache.org/licenses/LICENSE-2.0 Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the specific language governing permissions and limitations under the License. ============================================================================ image_path must end by '/' read imageobtain the same random data when it is in the test phaseHWCNCHWimg_test = np.clip(img_test, 0, 1) get the name of image file | 800 | fr | 0.283949 |
from __future__ import absolute_import
# Copyright (c) 2010-2019 openpyxl
import pytest
from io import BytesIO
from zipfile import ZipFile
from openpyxl.xml.functions import fromstring, tostring
from openpyxl.tests.helper import compare_xml
from ..manifest import WORKSHEET_TYPE
@pytest.fixture
def FileExtension():
from ..manifest import FileExtension
return FileExtension
class TestFileExtension:
def test_ctor(self, FileExtension):
ext = FileExtension(
ContentType="application/xml",
Extension="xml"
)
xml = tostring(ext.to_tree())
expected = """
<Default ContentType="application/xml" Extension="xml"/>
"""
diff = compare_xml(xml, expected)
assert diff is None, diff
def test_from_xml(self, FileExtension):
src = """
<Default ContentType="application/xml" Extension="xml"/>
"""
node = fromstring(src)
ext = FileExtension.from_tree(node)
assert ext == FileExtension(ContentType="application/xml", Extension="xml")
@pytest.fixture
def Override():
from ..manifest import Override
return Override
class TestOverride:
def test_ctor(self, Override):
override = Override(
ContentType="application/vnd.openxmlformats-officedocument.spreadsheetml.sheet.main+xml",
PartName="/xl/workbook.xml"
)
xml = tostring(override.to_tree())
expected = """
<Override ContentType="application/vnd.openxmlformats-officedocument.spreadsheetml.sheet.main+xml"
PartName="/xl/workbook.xml"/>
"""
diff = compare_xml(xml, expected)
assert diff is None, diff
def test_from_xml(self, Override):
src = """
<Override ContentType="application/vnd.openxmlformats-officedocument.spreadsheetml.sheet.main+xml"
PartName="/xl/workbook.xml"/>
"""
node = fromstring(src)
override = Override.from_tree(node)
assert override == Override(
ContentType="application/vnd.openxmlformats-officedocument.spreadsheetml.sheet.main+xml",
PartName="/xl/workbook.xml"
)
@pytest.fixture
def Manifest():
from ..manifest import Manifest
return Manifest
class TestManifest:
def test_ctor(self, Manifest):
manifest = Manifest()
xml = tostring(manifest.to_tree())
expected = """
<Types xmlns="http://schemas.openxmlformats.org/package/2006/content-types">
<Default ContentType="application/vnd.openxmlformats-package.relationships+xml" Extension="rels" />
<Default ContentType="application/xml" Extension="xml" />
<Override ContentType="application/vnd.openxmlformats-officedocument.spreadsheetml.styles+xml"
PartName="/xl/styles.xml"/>
<Override ContentType="application/vnd.openxmlformats-officedocument.theme+xml"
PartName="/xl/theme/theme1.xml"/>
<Override ContentType="application/vnd.openxmlformats-package.core-properties+xml"
PartName="/docProps/core.xml"/>
<Override ContentType="application/vnd.openxmlformats-officedocument.extended-properties+xml"
PartName="/docProps/app.xml"/>
</Types>
"""
diff = compare_xml(xml, expected)
assert diff is None, diff
def test_from_xml(self, datadir, Manifest):
datadir.chdir()
with open("manifest.xml") as src:
node = fromstring(src.read())
manifest = Manifest.from_tree(node)
assert len(manifest.Default) == 2
defaults = [
("application/xml", 'xml'),
("application/vnd.openxmlformats-package.relationships+xml", 'rels'),
]
assert [(ct.ContentType, ct.Extension) for ct in manifest.Default] == defaults
overrides = [
('application/vnd.openxmlformats-officedocument.spreadsheetml.sheet.main+xml',
'/xl/workbook.xml'),
('application/vnd.openxmlformats-officedocument.spreadsheetml.worksheet+xml',
'/xl/worksheets/sheet1.xml'),
('application/vnd.openxmlformats-officedocument.spreadsheetml.chartsheet+xml',
'/xl/chartsheets/sheet1.xml'),
('application/vnd.openxmlformats-officedocument.theme+xml',
'/xl/theme/theme1.xml'),
('application/vnd.openxmlformats-officedocument.spreadsheetml.styles+xml',
'/xl/styles.xml'),
('application/vnd.openxmlformats-officedocument.spreadsheetml.sharedStrings+xml',
'/xl/sharedStrings.xml'),
('application/vnd.openxmlformats-officedocument.drawing+xml',
'/xl/drawings/drawing1.xml'),
('application/vnd.openxmlformats-officedocument.drawingml.chart+xml',
'/xl/charts/chart1.xml'),
('application/vnd.openxmlformats-package.core-properties+xml',
'/docProps/core.xml'),
('application/vnd.openxmlformats-officedocument.extended-properties+xml',
'/docProps/app.xml')
]
assert [(ct.ContentType, ct.PartName) for ct in manifest.Override] == overrides
def test_filenames(self, datadir, Manifest):
datadir.chdir()
with open("manifest.xml") as src:
node = fromstring(src.read())
manifest = Manifest.from_tree(node)
assert manifest.filenames == [
'/xl/workbook.xml',
'/xl/worksheets/sheet1.xml',
'/xl/chartsheets/sheet1.xml',
'/xl/theme/theme1.xml',
'/xl/styles.xml',
'/xl/sharedStrings.xml',
'/xl/drawings/drawing1.xml',
'/xl/charts/chart1.xml',
'/docProps/core.xml',
'/docProps/app.xml',
]
def test_exts(self, datadir, Manifest):
datadir.chdir()
with open("manifest.xml") as src:
node = fromstring(src.read())
manifest = Manifest.from_tree(node)
assert manifest.extensions == [
('xml', 'application/xml'),
]
def test_no_dupe_overrides(self, Manifest):
manifest = Manifest()
assert len(manifest.Override) == 4
manifest.Override.append("a")
manifest.Override.append("a")
assert len(manifest.Override) == 5
def test_no_dupe_types(self, Manifest):
manifest = Manifest()
assert len(manifest.Default) == 2
manifest.Default.append("a")
manifest.Default.append("a")
assert len(manifest.Default) == 3
def test_append(self, Manifest):
from openpyxl import Workbook
wb = Workbook()
ws = wb.active
manifest = Manifest()
manifest.append(ws)
assert len(manifest.Override) == 5
def test_write(self, Manifest):
mf = Manifest()
from openpyxl import Workbook
wb = Workbook()
archive = ZipFile(BytesIO(), "w")
mf._write(archive, wb)
assert "/xl/workbook.xml" in mf.filenames
@pytest.mark.parametrize("file, registration",
[
('xl/media/image1.png',
'<Default ContentType="image/png" Extension="png" />'),
('xl/drawings/commentsDrawing.vml',
'<Default ContentType="application/vnd.openxmlformats-officedocument.vmlDrawing" Extension="vml" />'),
]
)
def test_media(self, Manifest, file, registration):
from openpyxl import Workbook
wb = Workbook()
manifest = Manifest()
manifest._register_mimetypes([file])
xml = tostring(manifest.Default[-1].to_tree())
diff = compare_xml(xml, registration)
assert diff is None, diff
def test_vba(self, datadir, Manifest):
datadir.chdir()
from openpyxl import load_workbook
wb = load_workbook('sample.xlsm', keep_vba=True)
manifest = Manifest()
manifest._write_vba(wb)
partnames = set([t.PartName for t in manifest.Override])
expected = set([
'/xl/workbook.xml',
'/xl/worksheets/sheet1.xml',
'/xl/worksheets/sheet2.xml',
'/xl/worksheets/sheet3.xml',
'/xl/theme/theme1.xml',
'/xl/styles.xml',
'/docProps/core.xml',
'/docProps/app.xml',
])
assert partnames == expected
def test_no_defaults(self, Manifest):
"""
LibreOffice does not use the Default element
"""
xml = """
<Types xmlns="http://schemas.openxmlformats.org/package/2006/content-types">
<Override PartName="/_rels/.rels" ContentType="application/vnd.openxmlformats-package.relationships+xml"/>
</Types>
"""
node = fromstring(xml)
manifest = Manifest.from_tree(node)
exts = manifest.extensions
assert exts == []
def test_find(self, datadir, Manifest):
datadir.chdir()
with open("manifest.xml", "rb") as src:
xml = src.read()
tree = fromstring(xml)
manifest = Manifest.from_tree(tree)
ws = manifest.find(WORKSHEET_TYPE)
assert ws.PartName == "/xl/worksheets/sheet1.xml"
def test_find_none(self, Manifest):
manifest = Manifest()
assert manifest.find(WORKSHEET_TYPE) is None
def test_findall(self, datadir, Manifest):
datadir.chdir()
with open("manifest.xml", "rb") as src:
xml = src.read()
tree = fromstring(xml)
manifest = Manifest.from_tree(tree)
sheets = manifest.findall(WORKSHEET_TYPE)
assert len(list(sheets)) == 1
| openpyxl/packaging/tests/test_manifest.py | 9,812 | LibreOffice does not use the Default element
Copyright (c) 2010-2019 openpyxl | 79 | en | 0.465622 |
import asyncio
import logging
import ssl
import time
import traceback
from ipaddress import IPv6Address, ip_address, ip_network, IPv4Network, IPv6Network
from pathlib import Path
from secrets import token_bytes
from typing import Any, Callable, Dict, List, Optional, Union, Set, Tuple
from aiohttp import ClientSession, ClientTimeout, ServerDisconnectedError, WSCloseCode, client_exceptions, web
from aiohttp.web_app import Application
from aiohttp.web_runner import TCPSite
from cryptography import x509
from cryptography.hazmat.backends import default_backend
from cryptography.hazmat.primitives import hashes, serialization
from greenberry.protocols.protocol_message_types import ProtocolMessageTypes
from greenberry.protocols.shared_protocol import protocol_version
from greenberry.server.introducer_peers import IntroducerPeers
from greenberry.server.outbound_message import Message, NodeType
from greenberry.server.ssl_context import private_ssl_paths, public_ssl_paths
from greenberry.server.ws_connection import WSGreenBerryConnection
from greenberry.types.blockchain_format.sized_bytes import bytes32
from greenberry.types.peer_info import PeerInfo
from greenberry.util.errors import Err, ProtocolError
from greenberry.util.ints import uint16
from greenberry.util.network import is_localhost, is_in_network
def ssl_context_for_server(
ca_cert: Path, ca_key: Path, private_cert_path: Path, private_key_path: Path
) -> Optional[ssl.SSLContext]:
ssl_context = ssl._create_unverified_context(purpose=ssl.Purpose.SERVER_AUTH, cafile=str(ca_cert))
ssl_context.check_hostname = False
ssl_context.load_cert_chain(certfile=str(private_cert_path), keyfile=str(private_key_path))
ssl_context.verify_mode = ssl.CERT_REQUIRED
return ssl_context
def ssl_context_for_root(
ca_cert_file: str,
) -> Optional[ssl.SSLContext]:
ssl_context = ssl.create_default_context(purpose=ssl.Purpose.SERVER_AUTH, cafile=ca_cert_file)
return ssl_context
def ssl_context_for_client(
ca_cert: Path,
ca_key: Path,
private_cert_path: Path,
private_key_path: Path,
) -> Optional[ssl.SSLContext]:
ssl_context = ssl._create_unverified_context(purpose=ssl.Purpose.SERVER_AUTH, cafile=str(ca_cert))
ssl_context.check_hostname = False
ssl_context.load_cert_chain(certfile=str(private_cert_path), keyfile=str(private_key_path))
ssl_context.verify_mode = ssl.CERT_REQUIRED
return ssl_context
class GreenBerryServer:
def __init__(
self,
port: int,
node: Any,
api: Any,
local_type: NodeType,
ping_interval: int,
network_id: str,
inbound_rate_limit_percent: int,
outbound_rate_limit_percent: int,
root_path: Path,
config: Dict,
private_ca_crt_key: Tuple[Path, Path],
greenberry_ca_crt_key: Tuple[Path, Path],
name: str = None,
introducer_peers: Optional[IntroducerPeers] = None,
):
# Keeps track of all connections to and from this node.
logging.basicConfig(level=logging.DEBUG)
self.all_connections: Dict[bytes32, WSGreenBerryConnection] = {}
self.tasks: Set[asyncio.Task] = set()
self.connection_by_type: Dict[NodeType, Dict[bytes32, WSGreenBerryConnection]] = {
NodeType.FULL_NODE: {},
NodeType.WALLET: {},
NodeType.HARVESTER: {},
NodeType.FARMER: {},
NodeType.TIMELORD: {},
NodeType.INTRODUCER: {},
}
self._port = port # TCP port to identify our node
self._local_type: NodeType = local_type
self._ping_interval = ping_interval
self._network_id = network_id
self._inbound_rate_limit_percent = inbound_rate_limit_percent
self._outbound_rate_limit_percent = outbound_rate_limit_percent
# Task list to keep references to tasks, so they don't get GCd
self._tasks: List[asyncio.Task] = []
if name:
self.log = logging.getLogger(name)
else:
self.log = logging.getLogger(__name__)
# Our unique random node id that we will send to other peers, regenerated on launch
self.api = api
self.node = node
self.root_path = root_path
self.config = config
self.on_connect: Optional[Callable] = None
self.incoming_messages: asyncio.Queue = asyncio.Queue()
self.shut_down_event = asyncio.Event()
if self._local_type is NodeType.INTRODUCER:
self.introducer_peers = IntroducerPeers()
if self._local_type is not NodeType.INTRODUCER:
self._private_cert_path, self._private_key_path = private_ssl_paths(root_path, config)
if self._local_type is not NodeType.HARVESTER:
self.p2p_crt_path, self.p2p_key_path = public_ssl_paths(root_path, config)
else:
self.p2p_crt_path, self.p2p_key_path = None, None
self.ca_private_crt_path, self.ca_private_key_path = private_ca_crt_key
self.greenberry_ca_crt_path, self.greenberry_ca_key_path = greenberry_ca_crt_key
self.node_id = self.my_id()
self.incoming_task = asyncio.create_task(self.incoming_api_task())
self.gc_task: asyncio.Task = asyncio.create_task(self.garbage_collect_connections_task())
self.app: Optional[Application] = None
self.runner: Optional[web.AppRunner] = None
self.site: Optional[TCPSite] = None
self.connection_close_task: Optional[asyncio.Task] = None
self.site_shutdown_task: Optional[asyncio.Task] = None
self.app_shut_down_task: Optional[asyncio.Task] = None
self.received_message_callback: Optional[Callable] = None
self.api_tasks: Dict[bytes32, asyncio.Task] = {}
self.execute_tasks: Set[bytes32] = set()
self.tasks_from_peer: Dict[bytes32, Set[bytes32]] = {}
self.banned_peers: Dict[str, float] = {}
self.invalid_protocol_ban_seconds = 10
self.api_exception_ban_seconds = 10
self.exempt_peer_networks: List[Union[IPv4Network, IPv6Network]] = [
ip_network(net, strict=False) for net in config.get("exempt_peer_networks", [])
]
def my_id(self) -> bytes32:
"""If node has public cert use that one for id, if not use private."""
if self.p2p_crt_path is not None:
pem_cert = x509.load_pem_x509_certificate(self.p2p_crt_path.read_bytes(), default_backend())
else:
pem_cert = x509.load_pem_x509_certificate(self._private_cert_path.read_bytes(), default_backend())
der_cert_bytes = pem_cert.public_bytes(encoding=serialization.Encoding.DER)
der_cert = x509.load_der_x509_certificate(der_cert_bytes, default_backend())
return bytes32(der_cert.fingerprint(hashes.SHA256()))
def set_received_message_callback(self, callback: Callable):
self.received_message_callback = callback
async def garbage_collect_connections_task(self) -> None:
"""
Periodically checks for connections with no activity (have not sent us any data), and removes them,
to allow room for other peers.
"""
while True:
await asyncio.sleep(600)
to_remove: List[WSGreenBerryConnection] = []
for connection in self.all_connections.values():
if self._local_type == NodeType.FULL_NODE and connection.connection_type == NodeType.FULL_NODE:
if time.time() - connection.last_message_time > 1800:
to_remove.append(connection)
for connection in to_remove:
self.log.debug(f"Garbage collecting connection {connection.peer_host} due to inactivity")
await connection.close()
# Also garbage collect banned_peers dict
to_remove_ban = []
for peer_ip, ban_until_time in self.banned_peers.items():
if time.time() > ban_until_time:
to_remove_ban.append(peer_ip)
for peer_ip in to_remove_ban:
del self.banned_peers[peer_ip]
async def start_server(self, on_connect: Callable = None):
if self._local_type in [NodeType.WALLET, NodeType.HARVESTER, NodeType.TIMELORD]:
return None
self.app = web.Application()
self.on_connect = on_connect
routes = [
web.get("/ws", self.incoming_connection),
]
self.app.add_routes(routes)
self.runner = web.AppRunner(self.app, access_log=None, logger=self.log)
await self.runner.setup()
authenticate = self._local_type not in (NodeType.FULL_NODE, NodeType.INTRODUCER)
if authenticate:
ssl_context = ssl_context_for_server(
self.ca_private_crt_path, self.ca_private_key_path, self._private_cert_path, self._private_key_path
)
else:
self.p2p_crt_path, self.p2p_key_path = public_ssl_paths(self.root_path, self.config)
ssl_context = ssl_context_for_server(
self.greenberry_ca_crt_path, self.greenberry_ca_key_path, self.p2p_crt_path, self.p2p_key_path
)
self.site = web.TCPSite(
self.runner,
port=self._port,
shutdown_timeout=3,
ssl_context=ssl_context,
)
await self.site.start()
self.log.info(f"Started listening on port: {self._port}")
async def incoming_connection(self, request):
if request.remote in self.banned_peers and time.time() < self.banned_peers[request.remote]:
self.log.warning(f"Peer {request.remote} is banned, refusing connection")
return None
ws = web.WebSocketResponse(max_msg_size=50 * 1024 * 1024)
await ws.prepare(request)
close_event = asyncio.Event()
cert_bytes = request.transport._ssl_protocol._extra["ssl_object"].getpeercert(True)
der_cert = x509.load_der_x509_certificate(cert_bytes)
peer_id = bytes32(der_cert.fingerprint(hashes.SHA256()))
if peer_id == self.node_id:
return ws
connection: Optional[WSGreenBerryConnection] = None
try:
connection = WSGreenBerryConnection(
self._local_type,
ws,
self._port,
self.log,
False,
False,
request.remote,
self.incoming_messages,
self.connection_closed,
peer_id,
self._inbound_rate_limit_percent,
self._outbound_rate_limit_percent,
close_event,
)
handshake = await connection.perform_handshake(
self._network_id,
protocol_version,
self._port,
self._local_type,
)
assert handshake is True
# Limit inbound connections to config's specifications.
if not self.accept_inbound_connections(connection.connection_type) and not is_in_network(
connection.peer_host, self.exempt_peer_networks
):
self.log.info(f"Not accepting inbound connection: {connection.get_peer_info()}.Inbound limit reached.")
await connection.close()
close_event.set()
else:
await self.connection_added(connection, self.on_connect)
if self._local_type is NodeType.INTRODUCER and connection.connection_type is NodeType.FULL_NODE:
self.introducer_peers.add(connection.get_peer_info())
except ProtocolError as e:
if connection is not None:
await connection.close(self.invalid_protocol_ban_seconds, WSCloseCode.PROTOCOL_ERROR, e.code)
if e.code == Err.INVALID_HANDSHAKE:
self.log.warning("Invalid handshake with peer. Maybe the peer is running old software.")
close_event.set()
elif e.code == Err.INCOMPATIBLE_NETWORK_ID:
self.log.warning("Incompatible network ID. Maybe the peer is on another network")
close_event.set()
elif e.code == Err.SELF_CONNECTION:
close_event.set()
else:
error_stack = traceback.format_exc()
self.log.error(f"Exception {e}, exception Stack: {error_stack}")
close_event.set()
except Exception as e:
if connection is not None:
await connection.close(ws_close_code=WSCloseCode.PROTOCOL_ERROR, error=Err.UNKNOWN)
error_stack = traceback.format_exc()
self.log.error(f"Exception {e}, exception Stack: {error_stack}")
close_event.set()
await close_event.wait()
return ws
async def connection_added(self, connection: WSGreenBerryConnection, on_connect=None):
# If we already had a connection to this peer_id, close the old one. This is secure because peer_ids are based
# on TLS public keys
if connection.peer_node_id in self.all_connections:
con = self.all_connections[connection.peer_node_id]
await con.close()
self.all_connections[connection.peer_node_id] = connection
if connection.connection_type is not None:
self.connection_by_type[connection.connection_type][connection.peer_node_id] = connection
if on_connect is not None:
await on_connect(connection)
else:
self.log.error(f"Invalid connection type for connection {connection}")
def is_duplicate_or_self_connection(self, target_node: PeerInfo) -> bool:
if is_localhost(target_node.host) and target_node.port == self._port:
# Don't connect to self
self.log.debug(f"Not connecting to {target_node}")
return True
for connection in self.all_connections.values():
if connection.host == target_node.host and connection.peer_server_port == target_node.port:
self.log.debug(f"Not connecting to {target_node}, duplicate connection")
return True
return False
async def start_client(
self,
target_node: PeerInfo,
on_connect: Callable = None,
auth: bool = False,
is_feeler: bool = False,
) -> bool:
"""
Tries to connect to the target node, adding one connection into the pipeline, if successful.
An on connect method can also be specified, and this will be saved into the instance variables.
"""
if self.is_duplicate_or_self_connection(target_node):
return False
if target_node.host in self.banned_peers and time.time() < self.banned_peers[target_node.host]:
self.log.warning(f"Peer {target_node.host} is still banned, not connecting to it")
return False
if auth:
ssl_context = ssl_context_for_client(
self.ca_private_crt_path, self.ca_private_key_path, self._private_cert_path, self._private_key_path
)
else:
ssl_context = ssl_context_for_client(
self.greenberry_ca_crt_path, self.greenberry_ca_key_path, self.p2p_crt_path, self.p2p_key_path
)
session = None
connection: Optional[WSGreenBerryConnection] = None
try:
timeout = ClientTimeout(total=30)
session = ClientSession(timeout=timeout)
try:
if type(ip_address(target_node.host)) is IPv6Address:
target_node = PeerInfo(f"[{target_node.host}]", target_node.port)
except ValueError:
pass
url = f"wss://{target_node.host}:{target_node.port}/ws"
self.log.debug(f"Connecting: {url}, Peer info: {target_node}")
try:
ws = await session.ws_connect(
url, autoclose=True, autoping=True, heartbeat=60, ssl=ssl_context, max_msg_size=50 * 1024 * 1024
)
except ServerDisconnectedError:
self.log.debug(f"Server disconnected error connecting to {url}. Perhaps we are banned by the peer.")
await session.close()
return False
except asyncio.TimeoutError:
self.log.debug(f"Timeout error connecting to {url}")
await session.close()
return False
if ws is not None:
assert ws._response.connection is not None and ws._response.connection.transport is not None
transport = ws._response.connection.transport # type: ignore
cert_bytes = transport._ssl_protocol._extra["ssl_object"].getpeercert(True) # type: ignore
der_cert = x509.load_der_x509_certificate(cert_bytes, default_backend())
peer_id = bytes32(der_cert.fingerprint(hashes.SHA256()))
if peer_id == self.node_id:
raise RuntimeError(f"Trying to connect to a peer ({target_node}) with the same peer_id: {peer_id}")
connection = WSGreenBerryConnection(
self._local_type,
ws,
self._port,
self.log,
True,
False,
target_node.host,
self.incoming_messages,
self.connection_closed,
peer_id,
self._inbound_rate_limit_percent,
self._outbound_rate_limit_percent,
session=session,
)
handshake = await connection.perform_handshake(
self._network_id,
protocol_version,
self._port,
self._local_type,
)
assert handshake is True
await self.connection_added(connection, on_connect)
connection_type_str = ""
if connection.connection_type is not None:
connection_type_str = connection.connection_type.name.lower()
self.log.info(f"Connected with {connection_type_str} {target_node}")
if is_feeler:
asyncio.create_task(connection.close())
return True
else:
await session.close()
return False
except client_exceptions.ClientConnectorError as e:
self.log.info(f"{e}")
except ProtocolError as e:
if connection is not None:
await connection.close(self.invalid_protocol_ban_seconds, WSCloseCode.PROTOCOL_ERROR, e.code)
if e.code == Err.INVALID_HANDSHAKE:
self.log.warning(f"Invalid handshake with peer {target_node}. Maybe the peer is running old software.")
elif e.code == Err.INCOMPATIBLE_NETWORK_ID:
self.log.warning("Incompatible network ID. Maybe the peer is on another network")
elif e.code == Err.SELF_CONNECTION:
pass
else:
error_stack = traceback.format_exc()
self.log.error(f"Exception {e}, exception Stack: {error_stack}")
except Exception as e:
if connection is not None:
await connection.close(self.invalid_protocol_ban_seconds, WSCloseCode.PROTOCOL_ERROR, Err.UNKNOWN)
error_stack = traceback.format_exc()
self.log.error(f"Exception {e}, exception Stack: {error_stack}")
if session is not None:
await session.close()
return False
def connection_closed(self, connection: WSGreenBerryConnection, ban_time: int):
if is_localhost(connection.peer_host) and ban_time != 0:
self.log.warning(f"Trying to ban localhost for {ban_time}, but will not ban")
ban_time = 0
self.log.info(f"Connection closed: {connection.peer_host}, node id: {connection.peer_node_id}")
if ban_time > 0:
ban_until: float = time.time() + ban_time
self.log.warning(f"Banning {connection.peer_host} for {ban_time} seconds")
if connection.peer_host in self.banned_peers:
if ban_until > self.banned_peers[connection.peer_host]:
self.banned_peers[connection.peer_host] = ban_until
else:
self.banned_peers[connection.peer_host] = ban_until
if connection.peer_node_id in self.all_connections:
self.all_connections.pop(connection.peer_node_id)
if connection.connection_type is not None:
if connection.peer_node_id in self.connection_by_type[connection.connection_type]:
self.connection_by_type[connection.connection_type].pop(connection.peer_node_id)
else:
# This means the handshake was enver finished with this peer
self.log.debug(
f"Invalid connection type for connection {connection.peer_host},"
f" while closing. Handshake never finished."
)
on_disconnect = getattr(self.node, "on_disconnect", None)
if on_disconnect is not None:
on_disconnect(connection)
self.cancel_tasks_from_peer(connection.peer_node_id)
def cancel_tasks_from_peer(self, peer_id: bytes32):
if peer_id not in self.tasks_from_peer:
return None
task_ids = self.tasks_from_peer[peer_id]
for task_id in task_ids:
if task_id in self.execute_tasks:
continue
task = self.api_tasks[task_id]
task.cancel()
async def incoming_api_task(self) -> None:
self.tasks = set()
while True:
payload_inc, connection_inc = await self.incoming_messages.get()
if payload_inc is None or connection_inc is None:
continue
async def api_call(full_message: Message, connection: WSGreenBerryConnection, task_id):
start_time = time.time()
try:
if self.received_message_callback is not None:
await self.received_message_callback(connection)
connection.log.debug(
f"<- {ProtocolMessageTypes(full_message.type).name} from peer "
f"{connection.peer_node_id} {connection.peer_host}"
)
message_type: str = ProtocolMessageTypes(full_message.type).name
f = getattr(self.api, message_type, None)
if f is None:
self.log.error(f"Non existing function: {message_type}")
raise ProtocolError(Err.INVALID_PROTOCOL_MESSAGE, [message_type])
if not hasattr(f, "api_function"):
self.log.error(f"Peer trying to call non api function {message_type}")
raise ProtocolError(Err.INVALID_PROTOCOL_MESSAGE, [message_type])
# If api is not ready ignore the request
if hasattr(self.api, "api_ready"):
if self.api.api_ready is False:
return None
timeout: Optional[int] = 600
if hasattr(f, "execute_task"):
# Don't timeout on methods with execute_task decorator, these need to run fully
self.execute_tasks.add(task_id)
timeout = None
if hasattr(f, "peer_required"):
coroutine = f(full_message.data, connection)
else:
coroutine = f(full_message.data)
async def wrapped_coroutine() -> Optional[Message]:
try:
result = await coroutine
return result
except asyncio.CancelledError:
pass
except Exception as e:
tb = traceback.format_exc()
connection.log.error(f"Exception: {e}, {connection.get_peer_info()}. {tb}")
raise e
return None
response: Optional[Message] = await asyncio.wait_for(wrapped_coroutine(), timeout=timeout)
connection.log.debug(
f"Time taken to process {message_type} from {connection.peer_node_id} is "
f"{time.time() - start_time} seconds"
)
if response is not None:
response_message = Message(response.type, full_message.id, response.data)
await connection.reply_to_request(response_message)
except Exception as e:
if self.connection_close_task is None:
tb = traceback.format_exc()
connection.log.error(
f"Exception: {e} {type(e)}, closing connection {connection.get_peer_info()}. {tb}"
)
else:
connection.log.debug(f"Exception: {e} while closing connection")
# TODO: actually throw one of the errors from errors.py and pass this to close
await connection.close(self.api_exception_ban_seconds, WSCloseCode.PROTOCOL_ERROR, Err.UNKNOWN)
finally:
if task_id in self.api_tasks:
self.api_tasks.pop(task_id)
if task_id in self.tasks_from_peer[connection.peer_node_id]:
self.tasks_from_peer[connection.peer_node_id].remove(task_id)
if task_id in self.execute_tasks:
self.execute_tasks.remove(task_id)
task_id = token_bytes()
api_task = asyncio.create_task(api_call(payload_inc, connection_inc, task_id))
self.api_tasks[task_id] = api_task
if connection_inc.peer_node_id not in self.tasks_from_peer:
self.tasks_from_peer[connection_inc.peer_node_id] = set()
self.tasks_from_peer[connection_inc.peer_node_id].add(task_id)
async def send_to_others(
self,
messages: List[Message],
node_type: NodeType,
origin_peer: WSGreenBerryConnection,
):
for node_id, connection in self.all_connections.items():
if node_id == origin_peer.peer_node_id:
continue
if connection.connection_type is node_type:
for message in messages:
await connection.send_message(message)
async def send_to_all(self, messages: List[Message], node_type: NodeType):
for _, connection in self.all_connections.items():
if connection.connection_type is node_type:
for message in messages:
await connection.send_message(message)
async def send_to_all_except(self, messages: List[Message], node_type: NodeType, exclude: bytes32):
for _, connection in self.all_connections.items():
if connection.connection_type is node_type and connection.peer_node_id != exclude:
for message in messages:
await connection.send_message(message)
async def send_to_specific(self, messages: List[Message], node_id: bytes32):
if node_id in self.all_connections:
connection = self.all_connections[node_id]
for message in messages:
await connection.send_message(message)
def get_outgoing_connections(self) -> List[WSGreenBerryConnection]:
result = []
for _, connection in self.all_connections.items():
if connection.is_outbound:
result.append(connection)
return result
def get_full_node_outgoing_connections(self) -> List[WSGreenBerryConnection]:
result = []
connections = self.get_full_node_connections()
for connection in connections:
if connection.is_outbound:
result.append(connection)
return result
def get_full_node_connections(self) -> List[WSGreenBerryConnection]:
return list(self.connection_by_type[NodeType.FULL_NODE].values())
def get_connections(self) -> List[WSGreenBerryConnection]:
result = []
for _, connection in self.all_connections.items():
result.append(connection)
return result
async def close_all_connections(self) -> None:
keys = [a for a, b in self.all_connections.items()]
for node_id in keys:
try:
if node_id in self.all_connections:
connection = self.all_connections[node_id]
await connection.close()
except Exception as e:
self.log.error(f"Exception while closing connection {e}")
def close_all(self) -> None:
self.connection_close_task = asyncio.create_task(self.close_all_connections())
if self.runner is not None:
self.site_shutdown_task = asyncio.create_task(self.runner.cleanup())
if self.app is not None:
self.app_shut_down_task = asyncio.create_task(self.app.shutdown())
for task_id, task in self.api_tasks.items():
task.cancel()
self.shut_down_event.set()
self.incoming_task.cancel()
self.gc_task.cancel()
async def await_closed(self) -> None:
self.log.debug("Await Closed")
await self.shut_down_event.wait()
if self.connection_close_task is not None:
await self.connection_close_task
if self.app_shut_down_task is not None:
await self.app_shut_down_task
if self.site_shutdown_task is not None:
await self.site_shutdown_task
async def get_peer_info(self) -> Optional[PeerInfo]:
ip = None
port = self._port
try:
async with ClientSession() as session:
async with session.get("https://checkip.amazonaws.com/") as resp:
if resp.status == 200:
ip = str(await resp.text())
ip = ip.rstrip()
except Exception:
ip = None
if ip is None:
return None
peer = PeerInfo(ip, uint16(port))
if not peer.is_valid():
return None
return peer
def accept_inbound_connections(self, node_type: NodeType) -> bool:
if not self._local_type == NodeType.FULL_NODE:
return True
inbound_count = len([conn for _, conn in self.connection_by_type[node_type].items() if not conn.is_outbound])
if node_type == NodeType.FULL_NODE:
return inbound_count < self.config["target_peer_count"] - self.config["target_outbound_peer_count"]
if node_type == NodeType.WALLET:
return inbound_count < self.config["max_inbound_wallet"]
if node_type == NodeType.FARMER:
return inbound_count < self.config["max_inbound_farmer"]
if node_type == NodeType.TIMELORD:
return inbound_count < self.config["max_inbound_timelord"]
return True
def is_trusted_peer(self, peer: WSGreenBerryConnection, trusted_peers: Dict) -> bool:
if trusted_peers is None:
return False
for trusted_peer in trusted_peers:
cert = self.root_path / trusted_peers[trusted_peer]
pem_cert = x509.load_pem_x509_certificate(cert.read_bytes())
cert_bytes = pem_cert.public_bytes(encoding=serialization.Encoding.DER)
der_cert = x509.load_der_x509_certificate(cert_bytes)
peer_id = bytes32(der_cert.fingerprint(hashes.SHA256()))
if peer_id == peer.peer_node_id:
self.log.debug(f"trusted node {peer.peer_node_id} {peer.peer_host}")
return True
return False
| greenberry/server/server.py | 32,187 | If node has public cert use that one for id, if not use private.
Keeps track of all connections to and from this node. TCP port to identify our node Task list to keep references to tasks, so they don't get GCd Our unique random node id that we will send to other peers, regenerated on launch Also garbage collect banned_peers dict Limit inbound connections to config's specifications. If we already had a connection to this peer_id, close the old one. This is secure because peer_ids are based on TLS public keys Don't connect to self type: ignore type: ignore This means the handshake was enver finished with this peer If api is not ready ignore the request Don't timeout on methods with execute_task decorator, these need to run fully TODO: actually throw one of the errors from errors.py and pass this to close | 815 | en | 0.931976 |
# Copyright 2019-2020 QuantumBlack Visual Analytics Limited
#
# Licensed under the Apache License, Version 2.0 (the "License");
# you may not use this file except in compliance with the License.
# You may obtain a copy of the License at
#
# http://www.apache.org/licenses/LICENSE-2.0
#
# THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND,
# EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES
# OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE, AND
# NONINFRINGEMENT. IN NO EVENT WILL THE LICENSOR OR OTHER CONTRIBUTORS
# BE LIABLE FOR ANY CLAIM, DAMAGES, OR OTHER LIABILITY, WHETHER IN AN
# ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF, OR IN
# CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
#
# The QuantumBlack Visual Analytics Limited ("QuantumBlack") name and logo
# (either separately or in combination, "QuantumBlack Trademarks") are
# trademarks of QuantumBlack. The License does not grant you any right or
# license to the QuantumBlack Trademarks. You may not use the QuantumBlack
# Trademarks or any confusingly similar mark as a trademark for your product,
# or use the QuantumBlack Trademarks in any other manner that might cause
# confusion in the marketplace, including but not limited to in advertising,
# on websites, or on software.
#
# See the License for the specific language governing permissions and
# limitations under the License.
"""
Tools to learn a ``StructureModel`` which describes the conditional dependencies between variables in a dataset.
"""
import logging
from copy import deepcopy
from typing import Dict, Iterable, List, Tuple, Union
import numpy as np
import pandas as pd
from sklearn.utils import check_array
from causalnex.structure.pytorch.core import NotearsMLP
from causalnex.structure.pytorch.dist_type import DistTypeContinuous, dist_type_aliases
from causalnex.structure.structuremodel import StructureModel
__all__ = ["from_numpy", "from_pandas"]
# pylint: disable=too-many-locals
# pylint: disable=too-many-arguments
def from_numpy(
X: np.ndarray,
dist_type_schema: Dict[int, str] = None,
lasso_beta: float = 0.0,
ridge_beta: float = 0.0,
use_bias: bool = False,
hidden_layer_units: Iterable[int] = None,
w_threshold: float = None,
max_iter: int = 100,
tabu_edges: List[Tuple[int, int]] = None,
tabu_parent_nodes: List[int] = None,
tabu_child_nodes: List[int] = None,
**kwargs
) -> StructureModel:
"""
Learn the `StructureModel`, the graph structure with lasso regularisation
describing conditional dependencies between variables in data presented as a numpy array.
Based on DAGs with NO TEARS.
@inproceedings{zheng2018dags,
author = {Zheng, Xun and Aragam, Bryon and Ravikumar, Pradeep and Xing, Eric P.},
booktitle = {Advances in Neural Information Processing Systems},
title = {{DAGs with NO TEARS: Continuous Optimization for Structure Learning}},
year = {2018},
codebase = {https://github.com/xunzheng/notears}
}
Args:
X: 2d input data, axis=0 is data rows, axis=1 is data columns. Data must be row oriented.
dist_type_schema: The dist type schema corresponding to the passed in data X.
It maps the positional column in X to the string alias of a dist type.
A list of alias names can be found in ``dist_type/__init__.py``.
If None, assumes that all data in X is continuous.
lasso_beta: Constant that multiplies the lasso term (l1 regularisation).
NOTE when using nonlinearities, the l1 loss only applies to the dag_layer.
use_bias: Whether to fit a bias parameter in the NOTEARS algorithm.
ridge_beta: Constant that multiplies the ridge term (l2 regularisation).
When using nonlinear layers use of this parameter is recommended.
hidden_layer_units: An iterable where its length determine the number of layers used,
and the numbers determine the number of nodes used for the layer in order.
w_threshold: fixed threshold for absolute edge weights.
max_iter: max number of dual ascent steps during optimisation.
tabu_edges: list of edges(from, to) not to be included in the graph.
tabu_parent_nodes: list of nodes banned from being a parent of any other nodes.
tabu_child_nodes: list of nodes banned from being a child of any other nodes.
**kwargs: additional arguments for NOTEARS MLP model
Returns:
StructureModel: a graph of conditional dependencies between data variables.
Raises:
ValueError: If X does not contain data.
ValueError: If schema does not correspond to columns.
"""
# n examples, d properties
if not X.size:
raise ValueError("Input data X is empty, cannot learn any structure")
logging.info("Learning structure using 'NOTEARS' optimisation.")
# Check array for NaN or inf values
check_array(X)
if dist_type_schema is not None:
# make sure that there is one provided key per column
if set(range(X.shape[1])).symmetric_difference(set(dist_type_schema.keys())):
raise ValueError(
"Difference indices and expected indices. Got {} schema".format(
dist_type_schema
)
)
# if dist_type_schema is None, assume all columns are continuous, else ini
dist_types = (
[DistTypeContinuous(idx=idx) for idx in np.arange(X.shape[1])]
if dist_type_schema is None
else [
dist_type_aliases[alias](idx=idx) for idx, alias in dist_type_schema.items()
]
)
_, d = X.shape
# if None or empty, convert into a list with single item
if hidden_layer_units is None:
hidden_layer_units = [0]
elif isinstance(hidden_layer_units, list) and not hidden_layer_units:
hidden_layer_units = [0]
# if no hidden layer units, still take 1 iteration step with bounds
hidden_layer_bnds = hidden_layer_units[0] if hidden_layer_units[0] else 1
# Flip i and j because Pytorch flattens the vector in another direction
bnds = [
(0, 0)
if i == j
else (0, 0)
if tabu_edges is not None and (i, j) in tabu_edges
else (0, 0)
if tabu_parent_nodes is not None and i in tabu_parent_nodes
else (0, 0)
if tabu_child_nodes is not None and j in tabu_child_nodes
else (None, None)
for j in range(d)
for _ in range(hidden_layer_bnds)
for i in range(d)
]
model = NotearsMLP(
n_features=d,
dist_types=dist_types,
hidden_layer_units=hidden_layer_units,
lasso_beta=lasso_beta,
ridge_beta=ridge_beta,
bounds=bnds,
use_bias=use_bias,
**kwargs
)
model.fit(X, max_iter=max_iter)
sm = StructureModel(model.adj)
if w_threshold:
sm.remove_edges_below_threshold(w_threshold)
mean_effect = model.adj_mean_effect
# extract the mean effect and add as edge attribute
for u, v, edge_dict in sm.edges.data(True):
sm.add_edge(
u,
v,
origin="learned",
weight=edge_dict["weight"],
mean_effect=mean_effect[u, v],
)
# set bias as node attribute
bias = model.bias
for node in sm.nodes():
value = None
if bias is not None:
value = bias[node]
sm.nodes[node]["bias"] = value
for dist_type in dist_types:
# attach each dist_type object to corresponding node
sm.nodes[dist_type.idx]["dist_type"] = dist_type
# preserve the structure_learner as a graph attribute
sm.graph["structure_learner"] = model
return sm
# pylint: disable=too-many-locals
# pylint: disable=too-many-arguments
def from_pandas(
X: pd.DataFrame,
dist_type_schema: Dict[Union[str, int], str] = None,
lasso_beta: float = 0.0,
ridge_beta: float = 0.0,
use_bias: bool = False,
hidden_layer_units: Iterable[int] = None,
max_iter: int = 100,
w_threshold: float = None,
tabu_edges: List[Tuple[str, str]] = None,
tabu_parent_nodes: List[str] = None,
tabu_child_nodes: List[str] = None,
**kwargs
) -> StructureModel:
"""
Learn the `StructureModel`, the graph structure describing conditional dependencies between variables
in data presented as a pandas dataframe.
The optimisation is to minimise a score function :math:`F(W)` over the graph's
weighted adjacency matrix, :math:`W`, subject to the a constraint function :math:`h(W)`,
where :math:`h(W) == 0` characterises an acyclic graph.
:math:`h(W) > 0` is a continuous, differentiable function that encapsulated how acyclic the graph is
(less == more acyclic).
Full details of this approach to structure learning are provided in the publication:
Based on DAGs with NO TEARS.
@inproceedings{zheng2018dags,
author = {Zheng, Xun and Aragam, Bryon and Ravikumar, Pradeep and Xing, Eric P.},
booktitle = {Advances in Neural Information Processing Systems},
title = {{DAGs with NO TEARS: Continuous Optimization for Structure Learning}},
year = {2018},
codebase = {https://github.com/xunzheng/notears}
}
Args:
X: 2d input data, axis=0 is data rows, axis=1 is data columns. Data must be row oriented.
dist_type_schema: The dist type schema corresponding to the passed in data X.
It maps the pandas column name in X to the string alias of a dist type.
A list of alias names can be found in ``dist_type/__init__.py``.
If None, assumes that all data in X is continuous.
lasso_beta: Constant that multiplies the lasso term (l1 regularisation).
NOTE when using nonlinearities, the l1 loss only applies to the dag_layer.
use_bias: Whether to fit a bias parameter in the NOTEARS algorithm.
ridge_beta: Constant that multiplies the ridge term (l2 regularisation).
When using nonlinear layers use of this parameter is recommended.
hidden_layer_units: An iterable where its length determine the number of layers used,
and the numbers determine the number of nodes used for the layer in order.
w_threshold: fixed threshold for absolute edge weights.
max_iter: max number of dual ascent steps during optimisation.
tabu_edges: list of edges(from, to) not to be included in the graph.
tabu_parent_nodes: list of nodes banned from being a parent of any other nodes.
tabu_child_nodes: list of nodes banned from being a child of any other nodes.
**kwargs: additional arguments for NOTEARS MLP model
Returns:
StructureModel: graph of conditional dependencies between data variables.
Raises:
ValueError: If X does not contain data.
"""
data = deepcopy(X)
# if dist_type_schema is not None, convert dist_type_schema from cols to idx
dist_type_schema = (
dist_type_schema
if dist_type_schema is None
else {X.columns.get_loc(col): alias for col, alias in dist_type_schema.items()}
)
non_numeric_cols = data.select_dtypes(exclude="number").columns
if len(non_numeric_cols) > 0:
raise ValueError(
"All columns must have numeric data. "
"Consider mapping the following columns to int {non_numeric_cols}".format(
non_numeric_cols=non_numeric_cols
)
)
col_idx = {c: i for i, c in enumerate(data.columns)}
idx_col = {i: c for c, i in col_idx.items()}
if tabu_edges:
tabu_edges = [(col_idx[u], col_idx[v]) for u, v in tabu_edges]
if tabu_parent_nodes:
tabu_parent_nodes = [col_idx[n] for n in tabu_parent_nodes]
if tabu_child_nodes:
tabu_child_nodes = [col_idx[n] for n in tabu_child_nodes]
g = from_numpy(
X=data.values,
dist_type_schema=dist_type_schema,
lasso_beta=lasso_beta,
ridge_beta=ridge_beta,
use_bias=use_bias,
hidden_layer_units=hidden_layer_units,
w_threshold=w_threshold,
max_iter=max_iter,
tabu_edges=tabu_edges,
tabu_parent_nodes=tabu_parent_nodes,
tabu_child_nodes=tabu_child_nodes,
**kwargs
)
sm = StructureModel()
sm.add_nodes_from(data.columns)
# recover the edge weights from g
for u, v, edge_dict in g.edges.data(True):
sm.add_edge(
idx_col[u],
idx_col[v],
origin="learned",
weight=edge_dict["weight"],
mean_effect=edge_dict["mean_effect"],
)
# retrieve all graphs attrs
for key, val in g.graph.items():
sm.graph[key] = val
# recover the node biases from g
for node in g.nodes(data=True):
node_name = idx_col[node[0]]
sm.nodes[node_name]["bias"] = node[1]["bias"]
# recover and preseve the node dist_types
for node in g.nodes(data=True):
node_name = idx_col[node[0]]
sm.nodes[node_name]["dist_type"] = node[1]["dist_type"]
return sm
| causalnex/structure/pytorch/notears.py | 13,168 | Learn the `StructureModel`, the graph structure with lasso regularisation
describing conditional dependencies between variables in data presented as a numpy array.
Based on DAGs with NO TEARS.
@inproceedings{zheng2018dags,
author = {Zheng, Xun and Aragam, Bryon and Ravikumar, Pradeep and Xing, Eric P.},
booktitle = {Advances in Neural Information Processing Systems},
title = {{DAGs with NO TEARS: Continuous Optimization for Structure Learning}},
year = {2018},
codebase = {https://github.com/xunzheng/notears}
}
Args:
X: 2d input data, axis=0 is data rows, axis=1 is data columns. Data must be row oriented.
dist_type_schema: The dist type schema corresponding to the passed in data X.
It maps the positional column in X to the string alias of a dist type.
A list of alias names can be found in ``dist_type/__init__.py``.
If None, assumes that all data in X is continuous.
lasso_beta: Constant that multiplies the lasso term (l1 regularisation).
NOTE when using nonlinearities, the l1 loss only applies to the dag_layer.
use_bias: Whether to fit a bias parameter in the NOTEARS algorithm.
ridge_beta: Constant that multiplies the ridge term (l2 regularisation).
When using nonlinear layers use of this parameter is recommended.
hidden_layer_units: An iterable where its length determine the number of layers used,
and the numbers determine the number of nodes used for the layer in order.
w_threshold: fixed threshold for absolute edge weights.
max_iter: max number of dual ascent steps during optimisation.
tabu_edges: list of edges(from, to) not to be included in the graph.
tabu_parent_nodes: list of nodes banned from being a parent of any other nodes.
tabu_child_nodes: list of nodes banned from being a child of any other nodes.
**kwargs: additional arguments for NOTEARS MLP model
Returns:
StructureModel: a graph of conditional dependencies between data variables.
Raises:
ValueError: If X does not contain data.
ValueError: If schema does not correspond to columns.
Learn the `StructureModel`, the graph structure describing conditional dependencies between variables
in data presented as a pandas dataframe.
The optimisation is to minimise a score function :math:`F(W)` over the graph's
weighted adjacency matrix, :math:`W`, subject to the a constraint function :math:`h(W)`,
where :math:`h(W) == 0` characterises an acyclic graph.
:math:`h(W) > 0` is a continuous, differentiable function that encapsulated how acyclic the graph is
(less == more acyclic).
Full details of this approach to structure learning are provided in the publication:
Based on DAGs with NO TEARS.
@inproceedings{zheng2018dags,
author = {Zheng, Xun and Aragam, Bryon and Ravikumar, Pradeep and Xing, Eric P.},
booktitle = {Advances in Neural Information Processing Systems},
title = {{DAGs with NO TEARS: Continuous Optimization for Structure Learning}},
year = {2018},
codebase = {https://github.com/xunzheng/notears}
}
Args:
X: 2d input data, axis=0 is data rows, axis=1 is data columns. Data must be row oriented.
dist_type_schema: The dist type schema corresponding to the passed in data X.
It maps the pandas column name in X to the string alias of a dist type.
A list of alias names can be found in ``dist_type/__init__.py``.
If None, assumes that all data in X is continuous.
lasso_beta: Constant that multiplies the lasso term (l1 regularisation).
NOTE when using nonlinearities, the l1 loss only applies to the dag_layer.
use_bias: Whether to fit a bias parameter in the NOTEARS algorithm.
ridge_beta: Constant that multiplies the ridge term (l2 regularisation).
When using nonlinear layers use of this parameter is recommended.
hidden_layer_units: An iterable where its length determine the number of layers used,
and the numbers determine the number of nodes used for the layer in order.
w_threshold: fixed threshold for absolute edge weights.
max_iter: max number of dual ascent steps during optimisation.
tabu_edges: list of edges(from, to) not to be included in the graph.
tabu_parent_nodes: list of nodes banned from being a parent of any other nodes.
tabu_child_nodes: list of nodes banned from being a child of any other nodes.
**kwargs: additional arguments for NOTEARS MLP model
Returns:
StructureModel: graph of conditional dependencies between data variables.
Raises:
ValueError: If X does not contain data.
Tools to learn a ``StructureModel`` which describes the conditional dependencies between variables in a dataset.
Copyright 2019-2020 QuantumBlack Visual Analytics Limited Licensed under the Apache License, Version 2.0 (the "License"); you may not use this file except in compliance with the License. You may obtain a copy of the License at http://www.apache.org/licenses/LICENSE-2.0 THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE, AND NONINFRINGEMENT. IN NO EVENT WILL THE LICENSOR OR OTHER CONTRIBUTORS BE LIABLE FOR ANY CLAIM, DAMAGES, OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF, OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. The QuantumBlack Visual Analytics Limited ("QuantumBlack") name and logo (either separately or in combination, "QuantumBlack Trademarks") are trademarks of QuantumBlack. The License does not grant you any right or license to the QuantumBlack Trademarks. You may not use the QuantumBlack Trademarks or any confusingly similar mark as a trademark for your product, or use the QuantumBlack Trademarks in any other manner that might cause confusion in the marketplace, including but not limited to in advertising, on websites, or on software. See the License for the specific language governing permissions and limitations under the License. pylint: disable=too-many-locals pylint: disable=too-many-arguments n examples, d properties Check array for NaN or inf values make sure that there is one provided key per column if dist_type_schema is None, assume all columns are continuous, else ini if None or empty, convert into a list with single item if no hidden layer units, still take 1 iteration step with bounds Flip i and j because Pytorch flattens the vector in another direction extract the mean effect and add as edge attribute set bias as node attribute attach each dist_type object to corresponding node preserve the structure_learner as a graph attribute pylint: disable=too-many-locals pylint: disable=too-many-arguments if dist_type_schema is not None, convert dist_type_schema from cols to idx recover the edge weights from g retrieve all graphs attrs recover the node biases from g recover and preseve the node dist_types | 6,936 | en | 0.779083 |
import re
from . import inlinepatterns
from . import util
from . import odict
def build_treeprocessors(md_instance, **kwargs):
""" Build the default treeprocessors for Markdown. """
treeprocessors = odict.OrderedDict()
treeprocessors["inline"] = InlineProcessor(md_instance)
treeprocessors["prettify"] = PrettifyTreeprocessor(md_instance)
return treeprocessors
def isString(s):
""" Check if it's string """
if not isinstance(s, util.AtomicString):
return isinstance(s, str)
return False
class Processor:
def __init__(self, markdown_instance=None):
if markdown_instance:
self.markdown = markdown_instance
class Treeprocessor(Processor):
"""
Treeprocessors are run on the ElementTree object before serialization.
Each Treeprocessor implements a "run" method that takes a pointer to an
ElementTree, modifies it as necessary and returns an ElementTree
object.
Treeprocessors must extend markdown.Treeprocessor.
"""
def run(self, root):
"""
Subclasses of Treeprocessor should implement a `run` method, which
takes a root ElementTree. This method can return another ElementTree
object, and the existing root ElementTree will be replaced, or it can
modify the current tree and return None.
"""
pass
class InlineProcessor(Treeprocessor):
"""
A Treeprocessor that traverses a tree, applying inline patterns.
"""
def __init__(self, md):
self.__placeholder_prefix = util.INLINE_PLACEHOLDER_PREFIX
self.__placeholder_suffix = util.ETX
self.__placeholder_length = 4 + len(self.__placeholder_prefix) \
+ len(self.__placeholder_suffix)
self.__placeholder_re = util.INLINE_PLACEHOLDER_RE
self.markdown = md
def __makePlaceholder(self, type):
""" Generate a placeholder """
id = "%04d" % len(self.stashed_nodes)
hash = util.INLINE_PLACEHOLDER % id
return hash, id
def __findPlaceholder(self, data, index):
"""
Extract id from data string, start from index
Keyword arguments:
* data: string
* index: index, from which we start search
Returns: placeholder id and string index, after the found placeholder.
"""
m = self.__placeholder_re.search(data, index)
if m:
return m.group(1), m.end()
else:
return None, index + 1
def __stashNode(self, node, type):
""" Add node to stash """
placeholder, id = self.__makePlaceholder(type)
self.stashed_nodes[id] = node
return placeholder
def __handleInline(self, data, patternIndex=0):
"""
Process string with inline patterns and replace it
with placeholders
Keyword arguments:
* data: A line of Markdown text
* patternIndex: The index of the inlinePattern to start with
Returns: String with placeholders.
"""
if not isinstance(data, util.AtomicString):
startIndex = 0
while patternIndex < len(self.markdown.inlinePatterns):
data, matched, startIndex = self.__applyPattern(
self.markdown.inlinePatterns.value_for_index(patternIndex),
data, patternIndex, startIndex)
if not matched:
patternIndex += 1
return data
def __processElementText(self, node, subnode, isText=True):
"""
Process placeholders in Element.text or Element.tail
of Elements popped from self.stashed_nodes.
Keywords arguments:
* node: parent node
* subnode: processing node
* isText: bool variable, True - it's text, False - it's tail
Returns: None
"""
if isText:
text = subnode.text
subnode.text = None
else:
text = subnode.tail
subnode.tail = None
childResult = self.__processPlaceholders(text, subnode)
if not isText and node is not subnode:
pos = node.getchildren().index(subnode)
node.remove(subnode)
else:
pos = 0
childResult.reverse()
for newChild in childResult:
node.insert(pos, newChild)
def __processPlaceholders(self, data, parent):
"""
Process string with placeholders and generate ElementTree tree.
Keyword arguments:
* data: string with placeholders instead of ElementTree elements.
* parent: Element, which contains processing inline data
Returns: list with ElementTree elements with applied inline patterns.
"""
def linkText(text):
if text:
if result:
if result[-1].tail:
result[-1].tail += text
else:
result[-1].tail = text
else:
if parent.text:
parent.text += text
else:
parent.text = text
result = []
strartIndex = 0
while data:
index = data.find(self.__placeholder_prefix, strartIndex)
if index != -1:
id, phEndIndex = self.__findPlaceholder(data, index)
if id in self.stashed_nodes:
node = self.stashed_nodes.get(id)
if index > 0:
text = data[strartIndex:index]
linkText(text)
if not isString(node): # it's Element
for child in [node] + node.getchildren():
if child.tail:
if child.tail.strip():
self.__processElementText(node, child,False)
if child.text:
if child.text.strip():
self.__processElementText(child, child)
else: # it's just a string
linkText(node)
strartIndex = phEndIndex
continue
strartIndex = phEndIndex
result.append(node)
else: # wrong placeholder
end = index + len(self.__placeholder_prefix)
linkText(data[strartIndex:end])
strartIndex = end
else:
text = data[strartIndex:]
if isinstance(data, util.AtomicString):
# We don't want to loose the AtomicString
text = util.AtomicString(text)
linkText(text)
data = ""
return result
def __applyPattern(self, pattern, data, patternIndex, startIndex=0):
"""
Check if the line fits the pattern, create the necessary
elements, add it to stashed_nodes.
Keyword arguments:
* data: the text to be processed
* pattern: the pattern to be checked
* patternIndex: index of current pattern
* startIndex: string index, from which we start searching
Returns: String with placeholders instead of ElementTree elements.
"""
match = pattern.getCompiledRegExp().match(data[startIndex:])
leftData = data[:startIndex]
if not match:
return data, False, 0
node = pattern.handleMatch(match)
if node is None:
return data, True, len(leftData)+match.span(len(match.groups()))[0]
if not isString(node):
if not isinstance(node.text, util.AtomicString):
# We need to process current node too
for child in [node] + node.getchildren():
if not isString(node):
if child.text:
child.text = self.__handleInline(child.text,
patternIndex + 1)
if child.tail:
child.tail = self.__handleInline(child.tail,
patternIndex)
placeholder = self.__stashNode(node, pattern.type())
return "%s%s%s%s" % (leftData,
match.group(1),
placeholder, match.groups()[-1]), True, 0
def run(self, tree):
"""Apply inline patterns to a parsed Markdown tree.
Iterate over ElementTree, find elements with inline tag, apply inline
patterns and append newly created Elements to tree. If you don't
want to process your data with inline paterns, instead of normal string,
use subclass AtomicString:
node.text = markdown.AtomicString("This will not be processed.")
Arguments:
* tree: ElementTree object, representing Markdown tree.
Returns: ElementTree object with applied inline patterns.
"""
self.stashed_nodes = {}
stack = [tree]
while stack:
currElement = stack.pop()
insertQueue = []
for child in currElement.getchildren():
if child.text and not isinstance(child.text, util.AtomicString):
text = child.text
child.text = None
lst = self.__processPlaceholders(self.__handleInline(
text), child)
stack += lst
insertQueue.append((child, lst))
if child.tail:
tail = self.__handleInline(child.tail)
dumby = util.etree.Element('d')
tailResult = self.__processPlaceholders(tail, dumby)
if dumby.text:
child.tail = dumby.text
else:
child.tail = None
pos = currElement.getchildren().index(child) + 1
tailResult.reverse()
for newChild in tailResult:
currElement.insert(pos, newChild)
if child.getchildren():
stack.append(child)
for element, lst in insertQueue:
if self.markdown.enable_attributes:
if element.text:
element.text = \
inlinepatterns.handleAttributes(element.text,
element)
i = 0
for newChild in lst:
if self.markdown.enable_attributes:
# Processing attributes
if newChild.tail:
newChild.tail = \
inlinepatterns.handleAttributes(newChild.tail,
element)
if newChild.text:
newChild.text = \
inlinepatterns.handleAttributes(newChild.text,
newChild)
element.insert(i, newChild)
i += 1
return tree
class PrettifyTreeprocessor(Treeprocessor):
""" Add linebreaks to the html document. """
def _prettifyETree(self, elem):
""" Recursively add linebreaks to ElementTree children. """
i = "\n"
if util.isBlockLevel(elem.tag) and elem.tag not in ['code', 'pre']:
if (not elem.text or not elem.text.strip()) \
and len(elem) and util.isBlockLevel(elem[0].tag):
elem.text = i
for e in elem:
if util.isBlockLevel(e.tag):
self._prettifyETree(e)
if not elem.tail or not elem.tail.strip():
elem.tail = i
if not elem.tail or not elem.tail.strip():
elem.tail = i
def run(self, root):
""" Add linebreaks to ElementTree root object. """
self._prettifyETree(root)
# Do <br />'s seperately as they are often in the middle of
# inline content and missed by _prettifyETree.
brs = root.getiterator('br')
for br in brs:
if not br.tail or not br.tail.strip():
br.tail = '\n'
else:
br.tail = '\n%s' % br.tail
| Tensorflow_LightGBM_Scipy_nightly/source/markdown/treeprocessors.py | 12,649 | A Treeprocessor that traverses a tree, applying inline patterns.
Add linebreaks to the html document.
Treeprocessors are run on the ElementTree object before serialization.
Each Treeprocessor implements a "run" method that takes a pointer to an
ElementTree, modifies it as necessary and returns an ElementTree
object.
Treeprocessors must extend markdown.Treeprocessor.
Check if the line fits the pattern, create the necessary
elements, add it to stashed_nodes.
Keyword arguments:
* data: the text to be processed
* pattern: the pattern to be checked
* patternIndex: index of current pattern
* startIndex: string index, from which we start searching
Returns: String with placeholders instead of ElementTree elements.
Extract id from data string, start from index
Keyword arguments:
* data: string
* index: index, from which we start search
Returns: placeholder id and string index, after the found placeholder.
Process string with inline patterns and replace it
with placeholders
Keyword arguments:
* data: A line of Markdown text
* patternIndex: The index of the inlinePattern to start with
Returns: String with placeholders.
Generate a placeholder
Process placeholders in Element.text or Element.tail
of Elements popped from self.stashed_nodes.
Keywords arguments:
* node: parent node
* subnode: processing node
* isText: bool variable, True - it's text, False - it's tail
Returns: None
Process string with placeholders and generate ElementTree tree.
Keyword arguments:
* data: string with placeholders instead of ElementTree elements.
* parent: Element, which contains processing inline data
Returns: list with ElementTree elements with applied inline patterns.
Add node to stash
Recursively add linebreaks to ElementTree children.
Build the default treeprocessors for Markdown.
Check if it's string
Subclasses of Treeprocessor should implement a `run` method, which
takes a root ElementTree. This method can return another ElementTree
object, and the existing root ElementTree will be replaced, or it can
modify the current tree and return None.
Apply inline patterns to a parsed Markdown tree.
Iterate over ElementTree, find elements with inline tag, apply inline
patterns and append newly created Elements to tree. If you don't
want to process your data with inline paterns, instead of normal string,
use subclass AtomicString:
node.text = markdown.AtomicString("This will not be processed.")
Arguments:
* tree: ElementTree object, representing Markdown tree.
Returns: ElementTree object with applied inline patterns.
Add linebreaks to ElementTree root object.
it's Element it's just a string wrong placeholder We don't want to loose the AtomicString We need to process current node too Processing attributes Do <br />'s seperately as they are often in the middle of inline content and missed by _prettifyETree. | 2,854 | en | 0.753993 |
from selenium import webdriver
import time
url = "http://localhost/litecart/admin/"
browser = webdriver.Chrome()
browser.implicitly_wait(1)
without_title = 0
try:
browser.get(url)
# логинемся
login = browser.find_element_by_css_selector("[name='username']")
login.send_keys("admin")
password = browser.find_element_by_css_selector("[name='password']")
password.send_keys("admin")
button = browser.find_element_by_css_selector("[name='login']")
button.click()
time.sleep(1) # без этого слипа программа перестает работать, очень хотелось бы обсудить этот момент
# читаем основное меню
main_menu = browser.find_elements_by_css_selector("#box-apps-menu > li")
for i in range(len(main_menu)):
main_menu_temp = browser.find_elements_by_css_selector("#box-apps-menu > li")
main_menu_temp[i].click()
# читаем подменю
sub_menu = browser.find_elements_by_css_selector(".docs > li")
# условие для пунктов меню, в которых отсутствует подменю
if len(sub_menu) < 1:
title = browser.find_element_by_css_selector("#content > h1").text
if len(title) == 0:
without_title += 1
for j in range(len(sub_menu)):
sub_menu_temp = browser.find_elements_by_css_selector(".docs > li")
sub_menu_temp[j].click()
title = browser.find_element_by_css_selector("#content > h1").text
if len(title) == 0:
without_title += 1
if without_title > 0:
print('BUG!')
else:
print('NO BUG')
finally:
browser.quit()
| selenium/find_elements/app_main_menu.py | 1,780 | логинемся без этого слипа программа перестает работать, очень хотелось бы обсудить этот момент читаем основное меню читаем подменю условие для пунктов меню, в которых отсутствует подменю | 186 | ru | 0.999324 |
"""
Considerando duas listas de inteiros ou floats (lista A e lista B)
Some os valores nas listas retornando uma nova lista com os valores somados:
Se uma lista for maior que a outra, a soma só vai considerar o tamanho da
menor.
Exemplo:
lista_a = [1, 2, 3, 4, 5, 6, 7]
lista_b = [1, 2, 3, 4]
=================== resultado
lista_soma = [2, 4, 6, 8]
"""
lista_a = [10, 2, 3, 40, 5, 6, 7]
lista_b = [1, 2, 3, 4]
lista_soma = [v1 + v2 for v1, v2 in zip(lista_a, lista_b)]
print(lista_soma)
| aulaspythonintermediario/exercicios06/exercicio01.py | 498 | Considerando duas listas de inteiros ou floats (lista A e lista B)
Some os valores nas listas retornando uma nova lista com os valores somados:
Se uma lista for maior que a outra, a soma só vai considerar o tamanho da
menor.
Exemplo:
lista_a = [1, 2, 3, 4, 5, 6, 7]
lista_b = [1, 2, 3, 4]
=================== resultado
lista_soma = [2, 4, 6, 8] | 353 | pt | 0.944817 |
import functools
from teamiclink.slack.model import GoalContent
from typing import Any, Dict
from slack_bolt import Ack
from slack_bolt.context import BoltContext
from pydantic import ValidationError
CREATE_GOAL_CALLBACK_ID = "create_goal_view_id"
CREATE_GOAL_INPUT = "create_goal_action"
CREATE_GOAL_INPUT_BLOCK = "create_goal_input_block"
CREATE_GOAL = {
"type": "modal",
"callback_id": CREATE_GOAL_CALLBACK_ID,
"title": {"type": "plain_text", "text": "Teamiclink"},
"submit": {"type": "plain_text", "text": "Submit"},
"close": {"type": "plain_text", "text": "Cancel"},
"blocks": [
{
"type": "input",
"block_id": CREATE_GOAL_INPUT_BLOCK,
"element": {"type": "plain_text_input", "action_id": CREATE_GOAL_INPUT},
"label": {"type": "plain_text", "text": "Create goal"},
}
],
}
def add_goal_to_payload(func):
"""Adds a goal to payload for 't-goal' key."""
@functools.wraps(func)
def wrapper_inject_goal(ack: Ack, payload: Dict[str, Any], context: BoltContext):
try:
content = GoalContent(
content=payload["state"]["values"][CREATE_GOAL_INPUT_BLOCK][
CREATE_GOAL_INPUT
]["value"]
).content
except ValidationError as error:
return ack(
response_action="errors",
errors={CREATE_GOAL_INPUT_BLOCK: error.errors()[0]["msg"]},
)
payload["t-goal"] = content
return func(ack=ack, payload=payload, context=context)
return wrapper_inject_goal
| teamiclink/slack/view_goal_create.py | 1,608 | Adds a goal to payload for 't-goal' key. | 40 | en | 0.863309 |
import concurrent.futures
import contextlib
import http.client
import json
import math
import os
import time
from .common import FileDownloader
from .http import HttpFD
from ..aes import aes_cbc_decrypt_bytes, unpad_pkcs7
from ..compat import compat_os_name, compat_struct_pack, compat_urllib_error
from ..utils import (
DownloadError,
encodeFilename,
error_to_compat_str,
sanitized_Request,
traverse_obj,
)
class HttpQuietDownloader(HttpFD):
def to_screen(self, *args, **kargs):
pass
console_title = to_screen
class FragmentFD(FileDownloader):
"""
A base file downloader class for fragmented media (e.g. f4m/m3u8 manifests).
Available options:
fragment_retries: Number of times to retry a fragment for HTTP error (DASH
and hlsnative only)
skip_unavailable_fragments:
Skip unavailable fragments (DASH and hlsnative only)
keep_fragments: Keep downloaded fragments on disk after downloading is
finished
concurrent_fragment_downloads: The number of threads to use for native hls and dash downloads
_no_ytdl_file: Don't use .ytdl file
For each incomplete fragment download yt-dlp keeps on disk a special
bookkeeping file with download state and metadata (in future such files will
be used for any incomplete download handled by yt-dlp). This file is
used to properly handle resuming, check download file consistency and detect
potential errors. The file has a .ytdl extension and represents a standard
JSON file of the following format:
extractor:
Dictionary of extractor related data. TBD.
downloader:
Dictionary of downloader related data. May contain following data:
current_fragment:
Dictionary with current (being downloaded) fragment data:
index: 0-based index of current fragment among all fragments
fragment_count:
Total count of fragments
This feature is experimental and file format may change in future.
"""
def report_retry_fragment(self, err, frag_index, count, retries):
self.to_screen(
'\r[download] Got server HTTP error: %s. Retrying fragment %d (attempt %d of %s) ...'
% (error_to_compat_str(err), frag_index, count, self.format_retries(retries)))
self.sleep_retry('fragment', count)
def report_skip_fragment(self, frag_index, err=None):
err = f' {err};' if err else ''
self.to_screen(f'[download]{err} Skipping fragment {frag_index:d} ...')
def _prepare_url(self, info_dict, url):
headers = info_dict.get('http_headers')
return sanitized_Request(url, None, headers) if headers else url
def _prepare_and_start_frag_download(self, ctx, info_dict):
self._prepare_frag_download(ctx)
self._start_frag_download(ctx, info_dict)
def __do_ytdl_file(self, ctx):
return ctx['live'] is not True and ctx['tmpfilename'] != '-' and not self.params.get('_no_ytdl_file')
def _read_ytdl_file(self, ctx):
assert 'ytdl_corrupt' not in ctx
stream, _ = self.sanitize_open(self.ytdl_filename(ctx['filename']), 'r')
try:
ytdl_data = json.loads(stream.read())
ctx['fragment_index'] = ytdl_data['downloader']['current_fragment']['index']
if 'extra_state' in ytdl_data['downloader']:
ctx['extra_state'] = ytdl_data['downloader']['extra_state']
except Exception:
ctx['ytdl_corrupt'] = True
finally:
stream.close()
def _write_ytdl_file(self, ctx):
frag_index_stream, _ = self.sanitize_open(self.ytdl_filename(ctx['filename']), 'w')
try:
downloader = {
'current_fragment': {
'index': ctx['fragment_index'],
},
}
if 'extra_state' in ctx:
downloader['extra_state'] = ctx['extra_state']
if ctx.get('fragment_count') is not None:
downloader['fragment_count'] = ctx['fragment_count']
frag_index_stream.write(json.dumps({'downloader': downloader}))
finally:
frag_index_stream.close()
def _download_fragment(self, ctx, frag_url, info_dict, headers=None, request_data=None):
fragment_filename = '%s-Frag%d' % (ctx['tmpfilename'], ctx['fragment_index'])
fragment_info_dict = {
'url': frag_url,
'http_headers': headers or info_dict.get('http_headers'),
'request_data': request_data,
'ctx_id': ctx.get('ctx_id'),
}
success, _ = ctx['dl'].download(fragment_filename, fragment_info_dict)
if not success:
return False
if fragment_info_dict.get('filetime'):
ctx['fragment_filetime'] = fragment_info_dict.get('filetime')
ctx['fragment_filename_sanitized'] = fragment_filename
return True
def _read_fragment(self, ctx):
if not ctx.get('fragment_filename_sanitized'):
return None
try:
down, frag_sanitized = self.sanitize_open(ctx['fragment_filename_sanitized'], 'rb')
except FileNotFoundError:
if ctx.get('live'):
return None
raise
ctx['fragment_filename_sanitized'] = frag_sanitized
frag_content = down.read()
down.close()
return frag_content
def _append_fragment(self, ctx, frag_content):
try:
ctx['dest_stream'].write(frag_content)
ctx['dest_stream'].flush()
finally:
if self.__do_ytdl_file(ctx):
self._write_ytdl_file(ctx)
if not self.params.get('keep_fragments', False):
self.try_remove(encodeFilename(ctx['fragment_filename_sanitized']))
del ctx['fragment_filename_sanitized']
def _prepare_frag_download(self, ctx):
if 'live' not in ctx:
ctx['live'] = False
if not ctx['live']:
total_frags_str = '%d' % ctx['total_frags']
ad_frags = ctx.get('ad_frags', 0)
if ad_frags:
total_frags_str += ' (not including %d ad)' % ad_frags
else:
total_frags_str = 'unknown (live)'
self.to_screen(f'[{self.FD_NAME}] Total fragments: {total_frags_str}')
self.report_destination(ctx['filename'])
dl = HttpQuietDownloader(self.ydl, {
**self.params,
'noprogress': True,
'test': False,
})
tmpfilename = self.temp_name(ctx['filename'])
open_mode = 'wb'
resume_len = 0
# Establish possible resume length
if os.path.isfile(encodeFilename(tmpfilename)):
open_mode = 'ab'
resume_len = os.path.getsize(encodeFilename(tmpfilename))
# Should be initialized before ytdl file check
ctx.update({
'tmpfilename': tmpfilename,
'fragment_index': 0,
})
if self.__do_ytdl_file(ctx):
if os.path.isfile(encodeFilename(self.ytdl_filename(ctx['filename']))):
self._read_ytdl_file(ctx)
is_corrupt = ctx.get('ytdl_corrupt') is True
is_inconsistent = ctx['fragment_index'] > 0 and resume_len == 0
if is_corrupt or is_inconsistent:
message = (
'.ytdl file is corrupt' if is_corrupt else
'Inconsistent state of incomplete fragment download')
self.report_warning(
'%s. Restarting from the beginning ...' % message)
ctx['fragment_index'] = resume_len = 0
if 'ytdl_corrupt' in ctx:
del ctx['ytdl_corrupt']
self._write_ytdl_file(ctx)
else:
self._write_ytdl_file(ctx)
assert ctx['fragment_index'] == 0
dest_stream, tmpfilename = self.sanitize_open(tmpfilename, open_mode)
ctx.update({
'dl': dl,
'dest_stream': dest_stream,
'tmpfilename': tmpfilename,
# Total complete fragments downloaded so far in bytes
'complete_frags_downloaded_bytes': resume_len,
})
def _start_frag_download(self, ctx, info_dict):
resume_len = ctx['complete_frags_downloaded_bytes']
total_frags = ctx['total_frags']
ctx_id = ctx.get('ctx_id')
# This dict stores the download progress, it's updated by the progress
# hook
state = {
'status': 'downloading',
'downloaded_bytes': resume_len,
'fragment_index': ctx['fragment_index'],
'fragment_count': total_frags,
'filename': ctx['filename'],
'tmpfilename': ctx['tmpfilename'],
}
start = time.time()
ctx.update({
'started': start,
'fragment_started': start,
# Amount of fragment's bytes downloaded by the time of the previous
# frag progress hook invocation
'prev_frag_downloaded_bytes': 0,
})
def frag_progress_hook(s):
if s['status'] not in ('downloading', 'finished'):
return
if not total_frags and ctx.get('fragment_count'):
state['fragment_count'] = ctx['fragment_count']
if ctx_id is not None and s.get('ctx_id') != ctx_id:
return
state['max_progress'] = ctx.get('max_progress')
state['progress_idx'] = ctx.get('progress_idx')
time_now = time.time()
state['elapsed'] = time_now - start
frag_total_bytes = s.get('total_bytes') or 0
s['fragment_info_dict'] = s.pop('info_dict', {})
if not ctx['live']:
estimated_size = (
(ctx['complete_frags_downloaded_bytes'] + frag_total_bytes)
/ (state['fragment_index'] + 1) * total_frags)
state['total_bytes_estimate'] = estimated_size
if s['status'] == 'finished':
state['fragment_index'] += 1
ctx['fragment_index'] = state['fragment_index']
state['downloaded_bytes'] += frag_total_bytes - ctx['prev_frag_downloaded_bytes']
ctx['complete_frags_downloaded_bytes'] = state['downloaded_bytes']
ctx['speed'] = state['speed'] = self.calc_speed(
ctx['fragment_started'], time_now, frag_total_bytes)
ctx['fragment_started'] = time.time()
ctx['prev_frag_downloaded_bytes'] = 0
else:
frag_downloaded_bytes = s['downloaded_bytes']
state['downloaded_bytes'] += frag_downloaded_bytes - ctx['prev_frag_downloaded_bytes']
if not ctx['live']:
state['eta'] = self.calc_eta(
start, time_now, estimated_size - resume_len,
state['downloaded_bytes'] - resume_len)
ctx['speed'] = state['speed'] = self.calc_speed(
ctx['fragment_started'], time_now, frag_downloaded_bytes)
ctx['prev_frag_downloaded_bytes'] = frag_downloaded_bytes
self._hook_progress(state, info_dict)
ctx['dl'].add_progress_hook(frag_progress_hook)
return start
def _finish_frag_download(self, ctx, info_dict):
ctx['dest_stream'].close()
if self.__do_ytdl_file(ctx):
ytdl_filename = encodeFilename(self.ytdl_filename(ctx['filename']))
if os.path.isfile(ytdl_filename):
self.try_remove(ytdl_filename)
elapsed = time.time() - ctx['started']
if ctx['tmpfilename'] == '-':
downloaded_bytes = ctx['complete_frags_downloaded_bytes']
else:
self.try_rename(ctx['tmpfilename'], ctx['filename'])
if self.params.get('updatetime', True):
filetime = ctx.get('fragment_filetime')
if filetime:
with contextlib.suppress(Exception):
os.utime(ctx['filename'], (time.time(), filetime))
downloaded_bytes = os.path.getsize(encodeFilename(ctx['filename']))
self._hook_progress({
'downloaded_bytes': downloaded_bytes,
'total_bytes': downloaded_bytes,
'filename': ctx['filename'],
'status': 'finished',
'elapsed': elapsed,
'ctx_id': ctx.get('ctx_id'),
'max_progress': ctx.get('max_progress'),
'progress_idx': ctx.get('progress_idx'),
}, info_dict)
def _prepare_external_frag_download(self, ctx):
if 'live' not in ctx:
ctx['live'] = False
if not ctx['live']:
total_frags_str = '%d' % ctx['total_frags']
ad_frags = ctx.get('ad_frags', 0)
if ad_frags:
total_frags_str += ' (not including %d ad)' % ad_frags
else:
total_frags_str = 'unknown (live)'
self.to_screen(f'[{self.FD_NAME}] Total fragments: {total_frags_str}')
tmpfilename = self.temp_name(ctx['filename'])
# Should be initialized before ytdl file check
ctx.update({
'tmpfilename': tmpfilename,
'fragment_index': 0,
})
def decrypter(self, info_dict):
_key_cache = {}
def _get_key(url):
if url not in _key_cache:
_key_cache[url] = self.ydl.urlopen(self._prepare_url(info_dict, url)).read()
return _key_cache[url]
def decrypt_fragment(fragment, frag_content):
decrypt_info = fragment.get('decrypt_info')
if not decrypt_info or decrypt_info['METHOD'] != 'AES-128':
return frag_content
iv = decrypt_info.get('IV') or compat_struct_pack('>8xq', fragment['media_sequence'])
decrypt_info['KEY'] = decrypt_info.get('KEY') or _get_key(info_dict.get('_decryption_key_url') or decrypt_info['URI'])
# Don't decrypt the content in tests since the data is explicitly truncated and it's not to a valid block
# size (see https://github.com/ytdl-org/youtube-dl/pull/27660). Tests only care that the correct data downloaded,
# not what it decrypts to.
if self.params.get('test', False):
return frag_content
return unpad_pkcs7(aes_cbc_decrypt_bytes(frag_content, decrypt_info['KEY'], iv))
return decrypt_fragment
def download_and_append_fragments_multiple(self, *args, pack_func=None, finish_func=None):
'''
@params (ctx1, fragments1, info_dict1), (ctx2, fragments2, info_dict2), ...
all args must be either tuple or list
'''
interrupt_trigger = [True]
max_progress = len(args)
if max_progress == 1:
return self.download_and_append_fragments(*args[0], pack_func=pack_func, finish_func=finish_func)
max_workers = self.params.get('concurrent_fragment_downloads', 1)
if max_progress > 1:
self._prepare_multiline_status(max_progress)
is_live = any(traverse_obj(args, (..., 2, 'is_live'), default=[]))
def thread_func(idx, ctx, fragments, info_dict, tpe):
ctx['max_progress'] = max_progress
ctx['progress_idx'] = idx
return self.download_and_append_fragments(
ctx, fragments, info_dict, pack_func=pack_func, finish_func=finish_func,
tpe=tpe, interrupt_trigger=interrupt_trigger)
class FTPE(concurrent.futures.ThreadPoolExecutor):
# has to stop this or it's going to wait on the worker thread itself
def __exit__(self, exc_type, exc_val, exc_tb):
pass
if compat_os_name == 'nt':
def future_result(future):
while True:
try:
return future.result(0.1)
except KeyboardInterrupt:
raise
except concurrent.futures.TimeoutError:
continue
else:
def future_result(future):
return future.result()
def interrupt_trigger_iter(fg):
for f in fg:
if not interrupt_trigger[0]:
break
yield f
spins = []
for idx, (ctx, fragments, info_dict) in enumerate(args):
tpe = FTPE(math.ceil(max_workers / max_progress))
job = tpe.submit(thread_func, idx, ctx, interrupt_trigger_iter(fragments), info_dict, tpe)
spins.append((tpe, job))
result = True
for tpe, job in spins:
try:
result = result and future_result(job)
except KeyboardInterrupt:
interrupt_trigger[0] = False
finally:
tpe.shutdown(wait=True)
if not interrupt_trigger[0] and not is_live:
raise KeyboardInterrupt()
# we expect the user wants to stop and DO WANT the preceding postprocessors to run;
# so returning a intermediate result here instead of KeyboardInterrupt on live
return result
def download_and_append_fragments(
self, ctx, fragments, info_dict, *, pack_func=None, finish_func=None,
tpe=None, interrupt_trigger=None):
if not interrupt_trigger:
interrupt_trigger = (True, )
fragment_retries = self.params.get('fragment_retries', 0)
is_fatal = (
((lambda _: False) if info_dict.get('is_live') else (lambda idx: idx == 0))
if self.params.get('skip_unavailable_fragments', True) else (lambda _: True))
if not pack_func:
pack_func = lambda frag_content, _: frag_content
def download_fragment(fragment, ctx):
if not interrupt_trigger[0]:
return
frag_index = ctx['fragment_index'] = fragment['frag_index']
ctx['last_error'] = None
headers = info_dict.get('http_headers', {}).copy()
byte_range = fragment.get('byte_range')
if byte_range:
headers['Range'] = 'bytes=%d-%d' % (byte_range['start'], byte_range['end'] - 1)
# Never skip the first fragment
fatal, count = is_fatal(fragment.get('index') or (frag_index - 1)), 0
while count <= fragment_retries:
try:
ctx['fragment_count'] = fragment.get('fragment_count')
if self._download_fragment(ctx, fragment['url'], info_dict, headers):
break
return
except (compat_urllib_error.HTTPError, http.client.IncompleteRead) as err:
# Unavailable (possibly temporary) fragments may be served.
# First we try to retry then either skip or abort.
# See https://github.com/ytdl-org/youtube-dl/issues/10165,
# https://github.com/ytdl-org/youtube-dl/issues/10448).
count += 1
ctx['last_error'] = err
if count <= fragment_retries:
self.report_retry_fragment(err, frag_index, count, fragment_retries)
except DownloadError:
# Don't retry fragment if error occurred during HTTP downloading
# itself since it has own retry settings
if not fatal:
break
raise
if count > fragment_retries and fatal:
ctx['dest_stream'].close()
self.report_error('Giving up after %s fragment retries' % fragment_retries)
def append_fragment(frag_content, frag_index, ctx):
if frag_content:
self._append_fragment(ctx, pack_func(frag_content, frag_index))
elif not is_fatal(frag_index - 1):
self.report_skip_fragment(frag_index, 'fragment not found')
else:
ctx['dest_stream'].close()
self.report_error(f'fragment {frag_index} not found, unable to continue')
return False
return True
decrypt_fragment = self.decrypter(info_dict)
max_workers = math.ceil(
self.params.get('concurrent_fragment_downloads', 1) / ctx.get('max_progress', 1))
if max_workers > 1:
def _download_fragment(fragment):
ctx_copy = ctx.copy()
download_fragment(fragment, ctx_copy)
return fragment, fragment['frag_index'], ctx_copy.get('fragment_filename_sanitized')
self.report_warning('The download speed shown is only of one thread. This is a known issue and patches are welcome')
with tpe or concurrent.futures.ThreadPoolExecutor(max_workers) as pool:
try:
for fragment, frag_index, frag_filename in pool.map(_download_fragment, fragments):
ctx.update({
'fragment_filename_sanitized': frag_filename,
'fragment_index': frag_index,
})
if not append_fragment(decrypt_fragment(fragment, self._read_fragment(ctx)), frag_index, ctx):
return False
except KeyboardInterrupt:
self._finish_multiline_status()
self.report_error(
'Interrupted by user. Waiting for all threads to shutdown...', is_error=False, tb=False)
pool.shutdown(wait=False)
raise
else:
for fragment in fragments:
if not interrupt_trigger[0]:
break
try:
download_fragment(fragment, ctx)
result = append_fragment(
decrypt_fragment(fragment, self._read_fragment(ctx)), fragment['frag_index'], ctx)
except KeyboardInterrupt:
if info_dict.get('is_live'):
break
raise
if not result:
return False
if finish_func is not None:
ctx['dest_stream'].write(finish_func())
ctx['dest_stream'].flush()
self._finish_frag_download(ctx, info_dict)
return True
| yt_dlp/downloader/fragment.py | 22,684 | A base file downloader class for fragmented media (e.g. f4m/m3u8 manifests).
Available options:
fragment_retries: Number of times to retry a fragment for HTTP error (DASH
and hlsnative only)
skip_unavailable_fragments:
Skip unavailable fragments (DASH and hlsnative only)
keep_fragments: Keep downloaded fragments on disk after downloading is
finished
concurrent_fragment_downloads: The number of threads to use for native hls and dash downloads
_no_ytdl_file: Don't use .ytdl file
For each incomplete fragment download yt-dlp keeps on disk a special
bookkeeping file with download state and metadata (in future such files will
be used for any incomplete download handled by yt-dlp). This file is
used to properly handle resuming, check download file consistency and detect
potential errors. The file has a .ytdl extension and represents a standard
JSON file of the following format:
extractor:
Dictionary of extractor related data. TBD.
downloader:
Dictionary of downloader related data. May contain following data:
current_fragment:
Dictionary with current (being downloaded) fragment data:
index: 0-based index of current fragment among all fragments
fragment_count:
Total count of fragments
This feature is experimental and file format may change in future.
@params (ctx1, fragments1, info_dict1), (ctx2, fragments2, info_dict2), ...
all args must be either tuple or list
Establish possible resume length Should be initialized before ytdl file check Total complete fragments downloaded so far in bytes This dict stores the download progress, it's updated by the progress hook Amount of fragment's bytes downloaded by the time of the previous frag progress hook invocation Should be initialized before ytdl file check Don't decrypt the content in tests since the data is explicitly truncated and it's not to a valid block size (see https://github.com/ytdl-org/youtube-dl/pull/27660). Tests only care that the correct data downloaded, not what it decrypts to. has to stop this or it's going to wait on the worker thread itself we expect the user wants to stop and DO WANT the preceding postprocessors to run; so returning a intermediate result here instead of KeyboardInterrupt on live Never skip the first fragment Unavailable (possibly temporary) fragments may be served. First we try to retry then either skip or abort. See https://github.com/ytdl-org/youtube-dl/issues/10165, https://github.com/ytdl-org/youtube-dl/issues/10448). Don't retry fragment if error occurred during HTTP downloading itself since it has own retry settings | 2,686 | en | 0.854526 |
from functools import partial
from typing import Any, Callable, List, Optional, Sequence, Type, Union
from torch import nn
from torchvision.prototype.transforms import VideoClassificationEval
from torchvision.transforms.functional import InterpolationMode
from ....models.video.resnet import (
BasicBlock,
BasicStem,
Bottleneck,
Conv2Plus1D,
Conv3DSimple,
Conv3DNoTemporal,
R2Plus1dStem,
VideoResNet,
)
from .._api import WeightsEnum, Weights
from .._meta import _KINETICS400_CATEGORIES
from .._utils import handle_legacy_interface, _ovewrite_named_param
__all__ = [
"VideoResNet",
"R3D_18_Weights",
"MC3_18_Weights",
"R2Plus1D_18_Weights",
"r3d_18",
"mc3_18",
"r2plus1d_18",
]
def _video_resnet(
block: Type[Union[BasicBlock, Bottleneck]],
conv_makers: Sequence[Type[Union[Conv3DSimple, Conv3DNoTemporal, Conv2Plus1D]]],
layers: List[int],
stem: Callable[..., nn.Module],
weights: Optional[WeightsEnum],
progress: bool,
**kwargs: Any,
) -> VideoResNet:
if weights is not None:
_ovewrite_named_param(kwargs, "num_classes", len(weights.meta["categories"]))
model = VideoResNet(block, conv_makers, layers, stem, **kwargs)
if weights is not None:
model.load_state_dict(weights.get_state_dict(progress=progress))
return model
_COMMON_META = {
"task": "video_classification",
"publication_year": 2017,
"size": (112, 112),
"min_size": (1, 1),
"categories": _KINETICS400_CATEGORIES,
"interpolation": InterpolationMode.BILINEAR,
"recipe": "https://github.com/pytorch/vision/tree/main/references/video_classification",
}
class R3D_18_Weights(WeightsEnum):
KINETICS400_V1 = Weights(
url="https://download.pytorch.org/models/r3d_18-b3b3357e.pth",
transforms=partial(VideoClassificationEval, crop_size=(112, 112), resize_size=(128, 171)),
meta={
**_COMMON_META,
"architecture": "R3D",
"num_params": 33371472,
"acc@1": 52.75,
"acc@5": 75.45,
},
)
DEFAULT = KINETICS400_V1
class MC3_18_Weights(WeightsEnum):
KINETICS400_V1 = Weights(
url="https://download.pytorch.org/models/mc3_18-a90a0ba3.pth",
transforms=partial(VideoClassificationEval, crop_size=(112, 112), resize_size=(128, 171)),
meta={
**_COMMON_META,
"architecture": "MC3",
"num_params": 11695440,
"acc@1": 53.90,
"acc@5": 76.29,
},
)
DEFAULT = KINETICS400_V1
class R2Plus1D_18_Weights(WeightsEnum):
KINETICS400_V1 = Weights(
url="https://download.pytorch.org/models/r2plus1d_18-91a641e6.pth",
transforms=partial(VideoClassificationEval, crop_size=(112, 112), resize_size=(128, 171)),
meta={
**_COMMON_META,
"architecture": "R(2+1)D",
"num_params": 31505325,
"acc@1": 57.50,
"acc@5": 78.81,
},
)
DEFAULT = KINETICS400_V1
@handle_legacy_interface(weights=("pretrained", R3D_18_Weights.KINETICS400_V1))
def r3d_18(*, weights: Optional[R3D_18_Weights] = None, progress: bool = True, **kwargs: Any) -> VideoResNet:
weights = R3D_18_Weights.verify(weights)
return _video_resnet(
BasicBlock,
[Conv3DSimple] * 4,
[2, 2, 2, 2],
BasicStem,
weights,
progress,
**kwargs,
)
@handle_legacy_interface(weights=("pretrained", MC3_18_Weights.KINETICS400_V1))
def mc3_18(*, weights: Optional[MC3_18_Weights] = None, progress: bool = True, **kwargs: Any) -> VideoResNet:
weights = MC3_18_Weights.verify(weights)
return _video_resnet(
BasicBlock,
[Conv3DSimple] + [Conv3DNoTemporal] * 3, # type: ignore[list-item]
[2, 2, 2, 2],
BasicStem,
weights,
progress,
**kwargs,
)
@handle_legacy_interface(weights=("pretrained", R2Plus1D_18_Weights.KINETICS400_V1))
def r2plus1d_18(*, weights: Optional[R2Plus1D_18_Weights] = None, progress: bool = True, **kwargs: Any) -> VideoResNet:
weights = R2Plus1D_18_Weights.verify(weights)
return _video_resnet(
BasicBlock,
[Conv2Plus1D] * 4,
[2, 2, 2, 2],
R2Plus1dStem,
weights,
progress,
**kwargs,
)
| torchvision/prototype/models/video/resnet.py | 4,350 | type: ignore[list-item] | 23 | fr | 0.272261 |
from __future__ import print_function
from __future__ import absolute_import
from builtins import range
from abc import ABCMeta, abstractmethod, abstractproperty
import os
import re
import json
from . import globalDictionaries
from . import configTemplates
from .dataset import Dataset
from .helperFunctions import replaceByMap, addIndex, getCommandOutput2, boolfromstring, pythonboolstring
from .TkAlExceptions import AllInOneError
from six import with_metaclass
class ValidationMetaClass(ABCMeta):
sets = ["mandatories", "optionals", "needpackages"]
dicts = ["defaults"]
def __new__(cls, clsname, bases, dct):
for setname in cls.sets:
if setname not in dct: dct[setname] = set()
dct[setname] = set.union(dct[setname], *(getattr(base, setname) for base in bases if hasattr(base, setname)))
for dictname in cls.dicts:
if dictname not in dct: dct[dictname] = {}
for base in bases:
if not hasattr(base, dictname): continue
newdict = getattr(base, dictname)
for key in set(newdict) & set(dct[dictname]):
if newdict[key] != dct[dictname][key]:
raise ValueError("Inconsistent values of defaults[{}]: {}, {}".format(key, newdict[key], dct[dictname][key]))
dct[dictname].update(newdict)
for setname in cls.sets: #e.g. removemandatories, used in preexistingvalidation
#use with caution
if "remove"+setname not in dct: dct["remove"+setname] = set()
dct["remove"+setname] = set.union(dct["remove"+setname], *(getattr(base, "remove"+setname) for base in bases if hasattr(base, "remove"+setname)))
dct[setname] -= dct["remove"+setname]
return super(ValidationMetaClass, cls).__new__(cls, clsname, bases, dct)
class GenericValidation(with_metaclass(ValidationMetaClass,object)):
defaultReferenceName = "DEFAULT"
mandatories = set()
defaults = {
"cmssw": os.environ['CMSSW_BASE'],
"parallelJobs": "1",
"jobid": "",
"needsproxy": "false",
}
needpackages = {"Alignment/OfflineValidation"}
optionals = {"jobmode"}
def __init__(self, valName, alignment, config):
import random
self.name = valName
self.alignmentToValidate = alignment
self.general = config.getGeneral()
self.randomWorkdirPart = "%0i"%random.randint(1,10e9)
self.configFiles = []
self.config = config
self.jobid = ""
theUpdate = config.getResultingSection(self.valType+":"+self.name,
defaultDict = self.defaults,
demandPars = self.mandatories)
self.general.update(theUpdate)
self.jobmode = self.general["jobmode"]
self.NJobs = int(self.general["parallelJobs"])
self.needsproxy = boolfromstring(self.general["needsproxy"], "needsproxy")
# limit maximum number of parallel jobs to 40
# (each output file is approximately 20MB)
maximumNumberJobs = 40
if self.NJobs > maximumNumberJobs:
msg = ("Maximum allowed number of parallel jobs "
+str(maximumNumberJobs)+" exceeded!!!")
raise AllInOneError(msg)
if self.NJobs > 1 and not isinstance(self, ParallelValidation):
raise AllInOneError("Parallel jobs not implemented for {}!\n"
"Please set parallelJobs = 1.".format(type(self).__name__))
self.jobid = self.general["jobid"]
if self.jobid:
try: #make sure it's actually a valid jobid
output = getCommandOutput2("bjobs %(jobid)s 2>&1"%self.general)
if "is not found" in output: raise RuntimeError
except RuntimeError:
raise AllInOneError("%s is not a valid jobid.\nMaybe it finished already?"%self.jobid)
self.cmssw = self.general["cmssw"]
badcharacters = r"\'"
for character in badcharacters:
if character in self.cmssw:
raise AllInOneError("The bad characters " + badcharacters + " are not allowed in the cmssw\n"
"path name. If you really have it in such a ridiculously named location,\n"
"try making a symbolic link somewhere with a decent name.")
try:
os.listdir(self.cmssw)
except OSError:
raise AllInOneError("Your cmssw release " + self.cmssw + ' does not exist')
if self.cmssw == os.environ["CMSSW_BASE"]:
self.scramarch = os.environ["SCRAM_ARCH"]
self.cmsswreleasebase = os.environ["CMSSW_RELEASE_BASE"]
else:
command = ("cd '" + self.cmssw + "' && eval `scramv1 ru -sh 2> /dev/null`"
' && echo "$CMSSW_BASE\n$SCRAM_ARCH\n$CMSSW_RELEASE_BASE"')
commandoutput = getCommandOutput2(command).split('\n')
self.cmssw = commandoutput[0]
self.scramarch = commandoutput[1]
self.cmsswreleasebase = commandoutput[2]
self.packages = {}
for package in self.needpackages:
for placetolook in self.cmssw, self.cmsswreleasebase:
pkgpath = os.path.join(placetolook, "src", package)
if os.path.exists(pkgpath):
self.packages[package] = pkgpath
break
else:
raise AllInOneError("Package {} does not exist in {} or {}!".format(package, self.cmssw, self.cmsswreleasebase))
self.AutoAlternates = True
if config.has_option("alternateTemplates","AutoAlternates"):
try:
self.AutoAlternates = json.loads(config.get("alternateTemplates","AutoAlternates").lower())
except ValueError:
raise AllInOneError("AutoAlternates needs to be true or false, not %s" % config.get("alternateTemplates","AutoAlternates"))
knownOpts = set(self.defaults.keys())|self.mandatories|self.optionals
ignoreOpts = []
config.checkInput(self.valType+":"+self.name,
knownSimpleOptions = knownOpts,
ignoreOptions = ignoreOpts)
def getRepMap(self, alignment = None):
from .plottingOptions import PlottingOptions
if alignment == None:
alignment = self.alignmentToValidate
try:
result = PlottingOptions(self.config, self.valType)
except KeyError:
result = {}
result.update(alignment.getRepMap())
result.update(self.general)
result.update({
"workdir": os.path.join(self.general["workdir"],
self.randomWorkdirPart),
"datadir": self.general["datadir"],
"logdir": self.general["logdir"],
"CommandLineTemplate": ("#run configfile and post-proccess it\n"
"cmsRun %(cfgFile)s\n"
"%(postProcess)s "),
"CMSSW_BASE": self.cmssw,
"SCRAM_ARCH": self.scramarch,
"CMSSW_RELEASE_BASE": self.cmsswreleasebase,
"alignmentName": alignment.name,
"condLoad": alignment.getConditions(),
"LoadGlobalTagTemplate": configTemplates.loadGlobalTagTemplate,
})
result.update(self.packages)
return result
@abstractproperty
def filesToCompare(self):
pass
def getCompareStrings( self, requestId = None, plain = False ):
result = {}
repMap = self.getRepMap().copy()
for validationId in self.filesToCompare:
repMap["file"] = self.filesToCompare[ validationId ]
if repMap["file"].startswith( "/castor/" ):
repMap["file"] = "rfio:%(file)s"%repMap
elif repMap["file"].startswith( "/store/" ):
repMap["file"] = "root://eoscms.cern.ch//eos/cms%(file)s"%repMap
if plain:
result[validationId]=repMap["file"]
else:
result[validationId]= "%(file)s=%(title)s|%(color)s|%(style)s"%repMap
if requestId == None:
return result
else:
if not "." in requestId:
requestId += ".%s"%self.defaultReferenceName
if not requestId.split(".")[-1] in result:
msg = ("could not find %s in reference Objects!"
%requestId.split(".")[-1])
raise AllInOneError(msg)
return result[ requestId.split(".")[-1] ]
def createFiles(self, fileContents, path, repMap = None, repMaps = None):
"""repMap: single map for all files
repMaps: a dict, with the filenames as the keys"""
if repMap is not None and repMaps is not None:
raise AllInOneError("createFiles can only take repMap or repMaps (or neither), not both")
result = []
for fileName in fileContents:
filePath = os.path.join(path, fileName)
result.append(filePath)
for (i, filePathi) in enumerate(addIndex(filePath, self.NJobs)):
theFile = open( filePathi, "w" )
fileContentsi = fileContents[ fileName ]
if repMaps is not None:
repMap = repMaps[fileName]
if repMap is not None:
repMap.update({"nIndex": str(i)})
fileContentsi = replaceByMap(fileContentsi, repMap)
theFile.write( fileContentsi )
theFile.close()
return result
def createConfiguration(self, fileContents, path, schedule = None, repMap = None, repMaps = None):
self.configFiles = self.createFiles(fileContents,
path, repMap = repMap, repMaps = repMaps)
if not schedule == None:
schedule = [os.path.join( path, cfgName) for cfgName in schedule]
for cfgName in schedule:
if not cfgName in self.configFiles:
msg = ("scheduled %s missing in generated configfiles: %s"
%(cfgName, self.configFiles))
raise AllInOneError(msg)
for cfgName in self.configFiles:
if not cfgName in schedule:
msg = ("generated configuration %s not scheduled: %s"
%(cfgName, schedule))
raise AllInOneError(msg)
self.configFiles = schedule
return self.configFiles
def createScript(self, fileContents, path, downloadFiles=[], repMap = None, repMaps = None):
self.scriptFiles = self.createFiles(fileContents,
path, repMap = repMap, repMaps = repMaps)
for script in self.scriptFiles:
for scriptwithindex in addIndex(script, self.NJobs):
os.chmod(scriptwithindex,0o755)
return self.scriptFiles
def createCrabCfg(self, fileContents, path ):
if self.NJobs > 1:
msg = ("jobmode 'crab' not supported for parallel validation."
" Please set parallelJobs = 1.")
raise AllInOneError(msg)
self.crabConfigFiles = self.createFiles(fileContents, path)
return self.crabConfigFiles
class GenericValidationData(GenericValidation):
"""
Subclass of `GenericValidation` which is the base for validations using
datasets.
"""
needParentFiles = False
mandatories = {"dataset", "maxevents"}
defaults = {
"runRange": "",
"firstRun": "",
"lastRun": "",
"begin": "",
"end": "",
"JSON": "",
"dasinstance": "prod/global",
"ttrhbuilder":"WithAngleAndTemplate",
"usepixelqualityflag": "True",
}
optionals = {"magneticfield"}
def __init__(self, valName, alignment, config):
"""
This method adds additional items to the `self.general` dictionary
which are only needed for validations using datasets.
Arguments:
- `valName`: String which identifies individual validation instances
- `alignment`: `Alignment` instance to validate
- `config`: `BetterConfigParser` instance which includes the
configuration of the validations
"""
super(GenericValidationData, self).__init__(valName, alignment, config)
# if maxevents is not specified, cannot calculate number of events for
# each parallel job, and therefore running only a single job
if int( self.general["maxevents"] ) < 0 and self.NJobs > 1:
msg = ("Maximum number of events (maxevents) not specified: "
"cannot use parallel jobs.")
raise AllInOneError(msg)
if int( self.general["maxevents"] ) / self.NJobs != float( self.general["maxevents"] ) / self.NJobs:
msg = ("maxevents has to be divisible by parallelJobs")
raise AllInOneError(msg)
tryPredefinedFirst = (not self.jobmode.split( ',' )[0] == "crab" and self.general["JSON"] == ""
and self.general["firstRun"] == "" and self.general["lastRun"] == ""
and self.general["begin"] == "" and self.general["end"] == "")
if self.general["dataset"] not in globalDictionaries.usedDatasets:
globalDictionaries.usedDatasets[self.general["dataset"]] = {}
if self.cmssw not in globalDictionaries.usedDatasets[self.general["dataset"]]:
if globalDictionaries.usedDatasets[self.general["dataset"]] != {}:
print(("Warning: you use the same dataset '%s' in multiple cmssw releases.\n"
"This is allowed, but make sure it's not a mistake") % self.general["dataset"])
globalDictionaries.usedDatasets[self.general["dataset"]][self.cmssw] = {False: None, True: None}
Bfield = self.general.get("magneticfield", None)
if globalDictionaries.usedDatasets[self.general["dataset"]][self.cmssw][tryPredefinedFirst] is None:
dataset = Dataset(
self.general["dataset"], tryPredefinedFirst = tryPredefinedFirst,
cmssw = self.cmssw, cmsswrelease = self.cmsswreleasebase, magneticfield = Bfield,
dasinstance = self.general["dasinstance"])
globalDictionaries.usedDatasets[self.general["dataset"]][self.cmssw][tryPredefinedFirst] = dataset
if tryPredefinedFirst and not dataset.predefined(): #No point finding the data twice in that case
globalDictionaries.usedDatasets[self.general["dataset"]][self.cmssw][False] = dataset
self.dataset = globalDictionaries.usedDatasets[self.general["dataset"]][self.cmssw][tryPredefinedFirst]
self.general["magneticField"] = self.dataset.magneticField()
self.general["defaultMagneticField"] = "MagneticField"
if self.general["magneticField"] == "unknown":
print("Could not get the magnetic field for this dataset.")
print("Using the default: ", self.general["defaultMagneticField"])
self.general["magneticField"] = '.oO[defaultMagneticField]Oo.'
if not self.jobmode.split( ',' )[0] == "crab":
try:
self.general["datasetDefinition"] = self.dataset.datasetSnippet(
jsonPath = self.general["JSON"],
firstRun = self.general["firstRun"],
lastRun = self.general["lastRun"],
begin = self.general["begin"],
end = self.general["end"],
parent = self.needParentFiles )
except AllInOneError as e:
msg = "In section [%s:%s]: "%(self.valType, self.name)
msg += str(e)
raise AllInOneError(msg)
else:
if self.dataset.predefined():
msg = ("For jobmode 'crab' you cannot use predefined datasets "
"(in your case: '%s')."%( self.dataset.name() ))
raise AllInOneError( msg )
try:
theUpdate = config.getResultingSection(self.valType+":"+self.name,
demandPars = ["parallelJobs"])
except AllInOneError as e:
msg = str(e)[:-1]+" when using 'jobmode: crab'."
raise AllInOneError(msg)
self.general.update(theUpdate)
if self.general["begin"] or self.general["end"]:
( self.general["begin"],
self.general["end"],
self.general["firstRun"],
self.general["lastRun"] ) = self.dataset.convertTimeToRun(
firstRun = self.general["firstRun"],
lastRun = self.general["lastRun"],
begin = self.general["begin"],
end = self.general["end"],
shortTuple = False)
if self.general["begin"] == None:
self.general["begin"] = ""
if self.general["end"] == None:
self.general["end"] = ""
self.general["firstRun"] = str( self.general["firstRun"] )
self.general["lastRun"] = str( self.general["lastRun"] )
if ( not self.general["firstRun"] ) and \
( self.general["end"] or self.general["lastRun"] ):
self.general["firstRun"] = str(
self.dataset.runList()[0]["run_number"])
if ( not self.general["lastRun"] ) and \
( self.general["begin"] or self.general["firstRun"] ):
self.general["lastRun"] = str(
self.dataset.runList()[-1]["run_number"])
if self.general["firstRun"] and self.general["lastRun"]:
if int(self.general["firstRun"]) > int(self.general["lastRun"]):
msg = ( "The lower time/runrange limit ('begin'/'firstRun') "
"chosen is greater than the upper time/runrange limit "
"('end'/'lastRun').")
raise AllInOneError( msg )
self.general["runRange"] = (self.general["firstRun"]
+ '-' + self.general["lastRun"])
try:
self.general["datasetDefinition"] = self.dataset.datasetSnippet(
jsonPath = self.general["JSON"],
firstRun = self.general["firstRun"],
lastRun = self.general["lastRun"],
begin = self.general["begin"],
end = self.general["end"],
crab = True )
except AllInOneError as e:
msg = "In section [%s:%s]: "%(self.valType, self.name)
msg += str( e )
raise AllInOneError( msg )
self.general["usepixelqualityflag"] = pythonboolstring(self.general["usepixelqualityflag"], "usepixelqualityflag")
def getRepMap(self, alignment = None):
result = super(GenericValidationData, self).getRepMap(alignment)
outputfile = os.path.expandvars(replaceByMap(
"%s_%s_.oO[name]Oo..root" % (self.outputBaseName, self.name)
, result))
resultfile = os.path.expandvars(replaceByMap(("/store/group/alca_trackeralign/AlignmentValidation/.oO[eosdir]Oo./" +
"%s_%s_.oO[name]Oo..root" % (self.resultBaseName, self.name))
, result))
result.update({
"resultFile": ".oO[resultFiles[.oO[nIndex]Oo.]]Oo.",
"resultFiles": addIndex(resultfile, self.NJobs),
"finalResultFile": resultfile,
"outputFile": ".oO[outputFiles[.oO[nIndex]Oo.]]Oo.",
"outputFiles": addIndex(outputfile, self.NJobs),
"finalOutputFile": outputfile,
"ProcessName": self.ProcessName,
"Bookkeeping": self.Bookkeeping,
"LoadBasicModules": self.LoadBasicModules,
"TrackSelectionRefitting": self.TrackSelectionRefitting,
"ValidationConfig": self.ValidationTemplate,
"FileOutputTemplate": self.FileOutputTemplate,
"DefinePath": self.DefinePath,
})
return result
@property
def cfgName(self):
return "%s.%s.%s_cfg.py"%( self.configBaseName, self.name,
self.alignmentToValidate.name )
@abstractproperty
def ProcessName(self):
pass
@property
def cfgTemplate(self):
return configTemplates.cfgTemplate
@abstractproperty
def ValidationTemplate(self):
pass
@property
def filesToCompare(self):
return {self.defaultReferenceName: self.getRepMap()["finalResultFile"]}
def createConfiguration(self, path ):
repMap = self.getRepMap()
cfgs = {self.cfgName: self.cfgTemplate}
super(GenericValidationData, self).createConfiguration(cfgs, path, repMap=repMap)
def createScript(self, path, template = configTemplates.scriptTemplate, downloadFiles=[], repMap = None, repMaps = None):
scriptName = "%s.%s.%s.sh"%(self.scriptBaseName, self.name,
self.alignmentToValidate.name )
if repMap is None and repMaps is None:
repMap = self.getRepMap()
repMap["CommandLine"]=""
for cfg in self.configFiles:
repMap["CommandLine"]+= repMap["CommandLineTemplate"]%{"cfgFile":addIndex(cfg, self.NJobs, ".oO[nIndex]Oo."),
"postProcess":""
}
scripts = {scriptName: template}
return super(GenericValidationData, self).createScript(scripts, path, downloadFiles = downloadFiles,
repMap = repMap, repMaps = repMaps)
def createCrabCfg(self, path, crabCfgBaseName):
"""
Method which creates a `crab.cfg` for a validation on datasets.
Arguments:
- `path`: Path at which the file will be stored.
- `crabCfgBaseName`: String which depends on the actual type of
validation calling this method.
"""
crabCfgName = "crab.%s.%s.%s.cfg"%( crabCfgBaseName, self.name,
self.alignmentToValidate.name )
repMap = self.getRepMap()
repMap["script"] = "dummy_script.sh"
# repMap["crabOutputDir"] = os.path.basename( path )
repMap["crabWorkingDir"] = crabCfgName.split( '.cfg' )[0]
self.crabWorkingDir = repMap["crabWorkingDir"]
repMap["numberOfJobs"] = self.general["parallelJobs"]
repMap["cfgFile"] = self.configFiles[0]
repMap["queue"] = self.jobmode.split( ',' )[1].split( '-q' )[1]
if self.dataset.dataType() == "mc":
repMap["McOrData"] = "events = .oO[nEvents]Oo."
elif self.dataset.dataType() == "data":
repMap["McOrData"] = "lumis = -1"
if self.jobmode.split( ',' )[0] == "crab":
print ("For jobmode 'crab' the parameter 'maxevents' will be "
"ignored and all events will be processed.")
else:
raise AllInOneError("Unknown data type! Can't run in crab mode")
crabCfg = {crabCfgName: replaceByMap( configTemplates.crabCfgTemplate,
repMap ) }
return super(GenericValidationData, self).createCrabCfg( crabCfg, path )
@property
def Bookkeeping(self):
return configTemplates.Bookkeeping
@property
def LoadBasicModules(self):
return configTemplates.LoadBasicModules
@abstractproperty
def TrackSelectionRefitting(self):
pass
@property
def FileOutputTemplate(self):
return configTemplates.FileOutputTemplate
@abstractproperty
def DefinePath(self):
pass
class GenericValidationData_CTSR(GenericValidationData):
#common track selection and refitting
defaults = {
"momentumconstraint": "None",
"openmasswindow": "False",
"cosmicsdecomode": "True",
"removetrackhitfiltercommands": "",
"appendtrackhitfiltercommands": "",
}
def getRepMap(self, alignment=None):
result = super(GenericValidationData_CTSR, self).getRepMap(alignment)
from .trackSplittingValidation import TrackSplittingValidation
result.update({
"ValidationSequence": self.ValidationSequence,
"istracksplitting": str(isinstance(self, TrackSplittingValidation)),
"cosmics0T": str(self.cosmics0T),
"use_d0cut": str(self.use_d0cut),
"ispvvalidation": str(self.isPVValidation)
})
commands = []
for removeorappend in "remove", "append":
optionname = removeorappend + "trackhitfiltercommands"
if result[optionname]:
for command in result[optionname].split(","):
command = command.strip()
commands.append('process.TrackerTrackHitFilter.commands.{}("{}")'.format(removeorappend, command))
result["trackhitfiltercommands"] = "\n".join(commands)
return result
@property
def use_d0cut(self):
return "Cosmics" not in self.general["trackcollection"] #use it for collisions only
@property
def isPVValidation(self):
return False # only for PV Validation sequence
@property
def TrackSelectionRefitting(self):
return configTemplates.CommonTrackSelectionRefitting
@property
def DefinePath(self):
return configTemplates.DefinePath_CommonSelectionRefitting
@abstractproperty
def ValidationSequence(self):
pass
@property
def cosmics0T(self):
if "Cosmics" not in self.general["trackcollection"]: return False
Bfield = self.dataset.magneticFieldForRun()
if Bfield < 0.5: return True
if isinstance(Bfield, str):
if "unknown " in Bfield:
msg = Bfield.replace("unknown ","",1)
elif Bfield == "unknown":
msg = "Can't get the B field for %s." % self.dataset.name()
else:
msg = "B field = {}???".format(Bfield)
raise AllInOneError(msg + "\n"
"To use this dataset, specify magneticfield = [value] in your .ini config file.")
return False
class ParallelValidation(GenericValidation):
@classmethod
def initMerge(cls):
return ""
@abstractmethod
def appendToMerge(self):
pass
@classmethod
def doInitMerge(cls):
from .plottingOptions import PlottingOptions
result = cls.initMerge()
result = replaceByMap(result, PlottingOptions(None, cls))
if result and result[-1] != "\n": result += "\n"
return result
def doMerge(self):
result = self.appendToMerge()
if result[-1] != "\n": result += "\n"
result += ("if [[ tmpMergeRetCode -eq 0 ]]; then\n"
" xrdcp -f .oO[finalOutputFile]Oo. root://eoscms//eos/cms.oO[finalResultFile]Oo.\n"
"fi\n"
"if [[ ${tmpMergeRetCode} -gt ${mergeRetCode} ]]; then\n"
" mergeRetCode=${tmpMergeRetCode}\n"
"fi\n")
result = replaceByMap(result, self.getRepMap())
return result
class ValidationWithPlots(GenericValidation):
@classmethod
def runPlots(cls, validations):
return ("cp .oO[plottingscriptpath]Oo. .\n"
"root -x -b -q .oO[plottingscriptname]Oo.++")
@abstractmethod
def appendToPlots(self):
pass
@abstractmethod
def plottingscriptname(cls):
"""override with a classmethod"""
@abstractmethod
def plottingscripttemplate(cls):
"""override with a classmethod"""
@abstractmethod
def plotsdirname(cls):
"""override with a classmethod"""
@classmethod
def doRunPlots(cls, validations):
from .plottingOptions import PlottingOptions
cls.createPlottingScript(validations)
result = cls.runPlots(validations)
result = replaceByMap(result, PlottingOptions(None, cls))
if result and result[-1] != "\n": result += "\n"
return result
@classmethod
def createPlottingScript(cls, validations):
from .plottingOptions import PlottingOptions
repmap = PlottingOptions(None, cls).copy()
filename = replaceByMap(".oO[plottingscriptpath]Oo.", repmap)
repmap["PlottingInstantiation"] = "\n".join(
replaceByMap(v.appendToPlots(), v.getRepMap()).rstrip("\n")
for v in validations
)
plottingscript = replaceByMap(cls.plottingscripttemplate(), repmap)
with open(filename, 'w') as f:
f.write(plottingscript)
class ValidationWithPlotsSummaryBase(ValidationWithPlots):
class SummaryItem(object):
def __init__(self, name, values, format=None, latexname=None, latexformat=None):
"""
name: name of the summary item, goes on top of the column
values: value for each alignment (in order of rows)
format: python format string (default: {:.3g}, meaning up to 3 significant digits)
latexname: name in latex form, e.g. if name=sigma you might want latexname=\sigma (default: name)
latexformat: format for latex (default: format)
"""
if format is None: format = "{:.3g}"
if latexname is None: latexname = name
if latexformat is None: latexformat = format
self.__name = name
self.__values = values
self.__format = format
self.__latexname = latexname
self.__latexformat = latexformat
def name(self, latex=False):
if latex:
return self.__latexname
else:
return self.__name
def format(self, value, latex=False):
if latex:
fmt = self.__latexformat
else:
fmt = self.__format
if re.match(".*[{][^}]*[fg][}].*", fmt):
value = float(value)
return fmt.format(value)
def values(self, latex=False):
result = [self.format(v, latex=latex) for v in self.__values]
return result
def value(self, i, latex):
return self.values(latex)[i]
@abstractmethod
def getsummaryitems(cls, folder):
"""override with a classmethod that returns a list of SummaryItems
based on the plots saved in folder"""
__summaryitems = None
__lastfolder = None
@classmethod
def summaryitemsstring(cls, folder=None, latex=False, transpose=True):
if folder is None: folder = cls.plotsdirname()
if folder.startswith( "/castor/" ):
folder = "rfio:%(file)s"%repMap
elif folder.startswith( "/store/" ):
folder = "root://eoscms.cern.ch//eos/cms%(file)s"%repMap
if cls.__summaryitems is None or cls.__lastfolder != folder:
cls.__lastfolder = folder
cls.__summaryitems = cls.getsummaryitems(folder)
summaryitems = cls.__summaryitems
if not summaryitems:
raise AllInOneError("No summary items!")
size = {len(_.values(latex)) for _ in summaryitems}
if len(size) != 1:
raise AllInOneError("Some summary items have different numbers of values\n{}".format(size))
size = size.pop()
if transpose:
columnwidths = ([max(len(_.name(latex)) for _ in summaryitems)]
+ [max(len(_.value(i, latex)) for _ in summaryitems) for i in range(size)])
else:
columnwidths = [max(len(entry) for entry in [_.name(latex)] + _.values(latex)) for _ in summaryitems]
if latex:
join = " & "
else:
join = " "
row = join.join("{{:{}}}".format(width) for width in columnwidths)
if transpose:
rows = [row.format(*[_.name(latex)]+_.values(latex)) for _ in summaryitems]
else:
rows = []
rows.append(row.format(*(_.name for _ in summaryitems)))
for i in range(size):
rows.append(row.format(*(_.value(i, latex) for _ in summaryitems)))
if latex:
join = " \\\\\n"
else:
join = "\n"
result = join.join(rows)
if latex:
result = (r"\begin{{tabular}}{{{}}}".format("|" + "|".join("c"*(len(columnwidths))) + "|") + "\n"
+ result + "\n"
+ r"\end{tabular}")
return result
@classmethod
def printsummaryitems(cls, *args, **kwargs):
print(cls.summaryitemsstring(*args, **kwargs))
@classmethod
def writesummaryitems(cls, filename, *args, **kwargs):
with open(filename, "w") as f:
f.write(cls.summaryitemsstring(*args, **kwargs)+"\n")
class ValidationWithPlotsSummary(ValidationWithPlotsSummaryBase):
@classmethod
def getsummaryitems(cls, folder):
result = []
with open(os.path.join(folder, "{}Summary.txt".format(cls.__name__))) as f:
for line in f:
split = line.rstrip("\n").split("\t")
kwargs = {}
for thing in split[:]:
if thing.startswith("format="):
kwargs["format"] = thing.replace("format=", "", 1)
split.remove(thing)
if thing.startswith("latexname="):
kwargs["latexname"] = thing.replace("latexname=", "", 1)
split.remove(thing)
if thing.startswith("latexformat="):
kwargs["latexformat"] = thing.replace("latexformat=", "", 1)
split.remove(thing)
name = split[0]
values = split[1:]
result.append(cls.SummaryItem(name, values, **kwargs))
return result
class ValidationWithComparison(GenericValidation):
@classmethod
def doComparison(cls, validations):
from .plottingOptions import PlottingOptions
repmap = PlottingOptions(None, cls).copy()
repmap["compareStrings"] = " , ".join(v.getCompareStrings("OfflineValidation") for v in validations)
repmap["compareStringsPlain"] = " , ".join(v.getCompareStrings("OfflineValidation", True) for v in validations)
comparison = replaceByMap(cls.comparisontemplate(), repmap)
return comparison
@classmethod
def comparisontemplate(cls):
return configTemplates.compareAlignmentsExecution
@classmethod
def comparealignmentspath(cls):
return ".oO[Alignment/OfflineValidation]Oo./scripts/.oO[compareAlignmentsName]Oo."
@abstractmethod
def comparealignmentsname(cls):
"""classmethod"""
class ValidationForPresentation(ValidationWithPlots):
@abstractmethod
def presentationsubsections(cls):
"""classmethod"""
| Alignment/OfflineValidation/python/TkAlAllInOneTool/genericValidation.py | 36,034 | Subclass of `GenericValidation` which is the base for validations using
datasets.
This method adds additional items to the `self.general` dictionary
which are only needed for validations using datasets.
Arguments:
- `valName`: String which identifies individual validation instances
- `alignment`: `Alignment` instance to validate
- `config`: `BetterConfigParser` instance which includes the
configuration of the validations
name: name of the summary item, goes on top of the column
values: value for each alignment (in order of rows)
format: python format string (default: {:.3g}, meaning up to 3 significant digits)
latexname: name in latex form, e.g. if name=sigma you might want latexname=\sigma (default: name)
latexformat: format for latex (default: format)
classmethod
Method which creates a `crab.cfg` for a validation on datasets.
Arguments:
- `path`: Path at which the file will be stored.
- `crabCfgBaseName`: String which depends on the actual type of
validation calling this method.
repMap: single map for all files
repMaps: a dict, with the filenames as the keys
override with a classmethod that returns a list of SummaryItems
based on the plots saved in folder
override with a classmethod
override with a classmethod
override with a classmethod
classmethod
e.g. removemandatories, used in preexistingvalidationuse with caution limit maximum number of parallel jobs to 40 (each output file is approximately 20MB)make sure it's actually a valid jobid if maxevents is not specified, cannot calculate number of events for each parallel job, and therefore running only a single jobNo point finding the data twice in that case repMap["crabOutputDir"] = os.path.basename( path )common track selection and refittinguse it for collisions only only for PV Validation sequence | 1,835 | en | 0.763299 |
# ----------------------------------------------------------------------
#
# Brad T. Aagaard, U.S. Geological Survey
# Charles A. Williams, GNS Science
# Matthew G. Knepley, University at Buffalo
#
# This code was developed as part of the Computational Infrastructure
# for Geodynamics (http://geodynamics.org).
#
# Copyright (c) 2010-2021 University of California, Davis
#
# See LICENSE.md for license information.
#
# ----------------------------------------------------------------------
#
# Application for searching PyLith .cfg files.
import sys
import argparse
import pathlib
import textwrap
import os
from pylith.utils.converters import string_to_list
from pylith.utils.SimulationMetadata import fromFile
class ConfigSearchApp():
"""Application for searching PyLith .cfg files.
"""
def __init__(self):
"""Constructor.
"""
self.filters = {}
def main(self, **kwargs):
"""Main entry point.
Keyword arguments:
searchpath (str), default: "."
Search path for .cfg files.
display (str), default: "all"
List of metadata to display in search results.
keywords (str), default: None
Comma delimited list of keywords for filtering search results.
features (str), default: None
Comma delimited list of features for filtering search results.
authors (str), default: None
Comma delimited list of authors for filtering search results.
version (str), default: None
PyLith version for filtering search results.
"""
args = argparse.Namespace(
**kwargs) if kwargs else self._parse_command_line()
self._set_filters(args)
for filename in sorted(pathlib.Path(args.searchpath).glob("**/*.cfg")):
metadata = fromFile(filename)
if metadata:
if not len(metadata.arguments):
if args.verbose:
print(f"INFO: Skipping file {filename} with only base metadata.")
continue
filter_fn = self._apply_filters_incompatible if args.incompatible else self._apply_filters
if filter_fn(metadata):
self._display_metadata(filename, metadata, args.display)
elif args.verbose:
print(f"MISMATCH: File {filename} did not pass metadata filter.")
elif args.verbose:
print(f"INFO: File {filename} missing simulation metadata.")
def _set_filters(self, options):
"""Set filters for display from command line option.
Args:
options (argsparse.Namespace)
Command line options.
"""
if options.keywords:
self.filters["keywords"] = string_to_list(options.keywords)
if options.features:
self.filters["features"] = string_to_list(options.features)
if options.authors:
self.filters["authors"] = string_to_list(options.authors)
if options.version:
self.filters["version"] = options.version
def _apply_filters(self, metadata):
"""Apply filters to metadata.
Args:
metadata (pylith.utils.SimulationMetadata)
Simulation metadata.
Returns: (bool)
True if metadata meets filter requirements, False otherwise.
"""
if "keywords" in self.filters:
if not metadata.keywords:
return False
if not all(keyword in metadata.keywords for keyword in self.filters["keywords"]):
return False
if "features" in self.filters:
if not metadata.features:
return False
if not all(feature in metadata.features for feature in self.filters["features"]):
return False
if "authors" in self.filters:
if not metadata.authors:
return False
if not all(author in metadata.authors for author in self.filters["authors"]):
return False
if "version" in self.filters:
if not metadata.pylith_version:
return False
for verMeta in metadata.pylith_version:
if not eval("{ver} {verMeta}".format(ver=self.filters["version"], verMeta=verMeta)):
return False
return True
def _apply_filters_incompatible(self, metadata):
"""Apply filters to metadata to find incompatible parameter files.
Args:
metadata (pylith.utils.SimulationMetadata)
Simulation metadata.
Returns: (bool)
True if metadata is incompatible with filter requirements, False otherwise.
"""
if "keywords" in self.filters:
if not metadata.keywords:
return True
if "features" in self.filters:
if not "features" in metadata:
return True
if "authors" in self.filters:
if not "authors" in metadata:
return True
if "version" in self.filters:
if not metadata.pylith_version:
return True
for verMeta in metadata.pylith_version:
if not eval("{ver} {verMeta}".format(ver=self.filters["version"], verMeta=verMeta)):
return True
return False
def _display_metadata(self, filename, metadata, options):
"""Print metadata to stdout.
Args:
filename (str)
Name of simulation .cfg file.
metadata (pylith.utils.SimulationMetadata)
Simulation metadata.
options (list of str)
List of metadata to display.
"""
INDENT = " "*4
show_all = "all" in options
options = string_to_list(options)
line0 = f"{filename}"
if "version" in options or show_all:
if metadata.version:
line0 += f" v{metadata.version}"
else:
line0 += " missing 'version'"
if "pylith_version" in options or show_all:
if metadata.pylith_version:
line0 += "; requires PyLith " + " and ".join(metadata.pylith_version)
else:
line0 += "; missing 'pylith_version'"
lines = []
if "description" in options or show_all:
if metadata.description:
lines += [metadata.description]
else:
lines += ["missing 'description'"]
if "authors" in options or show_all:
if metadata.authors:
lines += ["Authors: " + ", ".join(metadata.authors)]
else:
lines += ["missing 'authors'"]
if "keywords" in options or show_all:
if metadata.keywords:
lines += ["Keywords: " + ", ".join(metadata.keywords)]
else:
lines += ["missing 'keywords'"]
if "features" in options or show_all:
if metadata.features:
features = textwrap.fill(", ".join(metadata.features), width=120)
lines += ["Features:"] + textwrap.indent(features, INDENT).split("\n")
else:
lines += ["missing 'features'"]
if "arguments" in options or show_all:
if metadata.arguments:
lines += ["pylith " + " ".join(metadata.arguments)]
else:
lines += ["missing 'arguments'"]
print(line0)
if len(lines):
print(textwrap.indent("\n".join(lines), INDENT))
def _parse_command_line(self):
"""Parse command line arguments.
Returns (argsparse.Namespace)
Command line arguments.
"""
DESCRIPTION = (
"Application for searching PyLith .cfg parameter files."
)
parser = argparse.ArgumentParser(description=DESCRIPTION,
formatter_class=argparse.ArgumentDefaultsHelpFormatter)
parser.add_argument("--path", action="store",
dest="searchpath", default=".", help="Search path for .cfg files.")
parser.add_argument("--display", action="store",
dest="display", default="all", help="List of metadata to display in search results.")
parser.add_argument("--verbose", action="store_true", dest="verbose",
help="Report missing metadata.")
parser.add_argument("--keywords", action="store", dest="keywords",
help="Comma delimited list of keywords for filtering search results.")
parser.add_argument("--features", action="store", dest="features",
help="Comma delimited list of features for filtering search results.")
parser.add_argument("--authors", action="store", dest="authors",
help="Comma delimited list of authors for filtering search results.")
parser.add_argument("--version", action="store", dest="version",
help="PyLith version for filtering search results.")
parser.add_argument("--incompatible", action="store_true", dest="incompatible",
help="Filter search results to show incompatible parameter files.")
args = parser.parse_args()
return args
# End of file
| pylith/apps/ConfigSearchApp.py | 9,501 | Application for searching PyLith .cfg files.
Constructor.
Apply filters to metadata.
Args:
metadata (pylith.utils.SimulationMetadata)
Simulation metadata.
Returns: (bool)
True if metadata meets filter requirements, False otherwise.
Apply filters to metadata to find incompatible parameter files.
Args:
metadata (pylith.utils.SimulationMetadata)
Simulation metadata.
Returns: (bool)
True if metadata is incompatible with filter requirements, False otherwise.
Print metadata to stdout.
Args:
filename (str)
Name of simulation .cfg file.
metadata (pylith.utils.SimulationMetadata)
Simulation metadata.
options (list of str)
List of metadata to display.
Parse command line arguments.
Returns (argsparse.Namespace)
Command line arguments.
Set filters for display from command line option.
Args:
options (argsparse.Namespace)
Command line options.
Main entry point.
Keyword arguments:
searchpath (str), default: "."
Search path for .cfg files.
display (str), default: "all"
List of metadata to display in search results.
keywords (str), default: None
Comma delimited list of keywords for filtering search results.
features (str), default: None
Comma delimited list of features for filtering search results.
authors (str), default: None
Comma delimited list of authors for filtering search results.
version (str), default: None
PyLith version for filtering search results.
---------------------------------------------------------------------- Brad T. Aagaard, U.S. Geological Survey Charles A. Williams, GNS Science Matthew G. Knepley, University at Buffalo This code was developed as part of the Computational Infrastructure for Geodynamics (http://geodynamics.org). Copyright (c) 2010-2021 University of California, Davis See LICENSE.md for license information. ---------------------------------------------------------------------- Application for searching PyLith .cfg files. End of file | 2,064 | en | 0.483434 |
# Interview Questions
"""
Given the following list of objects {user, loginTime, logoutTime}. What is the maximum number of concurrent users logged in at the same time?
Input:
[
{user: A, login: 1, logout: 3},
{user: B, login: 3, logout: 4},
{user: C, login: 1, logout: 2},
{user: D, login: 123123123, logout: 987987987},
{user: E, login: 1, logout: 3}
]
Output:
3
"""
datas = [
{'user': 'A', 'login': 1, 'logout': 3},
{'user': 'B', 'login': 3, 'logout': 4},
{'user': 'C', 'login': 1, 'logout': 2},
{'user': 'D', 'login': 123123123, 'logout': 987987987},
{'user': 'E', 'login': 1, 'logout': 3}
]
from collections import Counter
def c(data):
v = [[e['login'] for e in data],[e['logout'] for e in data]]
t = [Counter(v[0]),Counter(v[1])]
tmp = Counter()
allt = list(set(v[0]+v[1]))
allt.sort()
ret = []
cp = 0
for e in allt:
cp += t[0][e]
cp -= t[1][e]
ret.append(cp)
return max(ret)
max = c(datas)
print(max)
| interview/booking.com/max_concurrent.py | 1,052 | Given the following list of objects {user, loginTime, logoutTime}. What is the maximum number of concurrent users logged in at the same time?
Input:
[
{user: A, login: 1, logout: 3},
{user: B, login: 3, logout: 4},
{user: C, login: 1, logout: 2},
{user: D, login: 123123123, logout: 987987987},
{user: E, login: 1, logout: 3}
]
Output:
3
Interview Questions | 453 | en | 0.758208 |
# Copyright (c) 2020 PaddlePaddle Authors. All Rights Reserved.
#
# Licensed under the Apache License, Version 2.0 (the "License");
# you may not use this file except in compliance with the License.
# You may obtain a copy of the License at
#
# http://www.apache.org/licenses/LICENSE-2.0
#
# Unless required by applicable law or agreed to in writing, software
# distributed under the License is distributed on an "AS IS" BASIS,
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
# See the License for the specific language governing permissions and
# limitations under the License.
from __future__ import print_function
import unittest
import paddle
import numpy as np
import paddle.fluid.core as core
from op_test import OpTest
import paddle.fluid as fluid
from paddle.fluid import Program, program_guard
class TestRollOp(OpTest):
def setUp(self):
self.op_type = "roll"
self.init_dtype_type()
self.inputs = {'X': np.random.random(self.x_shape).astype(self.dtype)}
self.attrs = {'shifts': self.shifts, 'dims': self.dims}
self.outputs = {
'Out': np.roll(self.inputs['X'], self.attrs['shifts'],
self.attrs['dims'])
}
def init_dtype_type(self):
self.dtype = np.float64
self.x_shape = (100, 4, 5)
self.shifts = [101, -1]
self.dims = [0, -2]
def test_check_output(self):
self.check_output()
def test_check_grad_normal(self):
self.check_grad(['X'], 'Out')
class TestRollOpCase2(TestRollOp):
def init_dtype_type(self):
self.dtype = np.float32
self.x_shape = (100, 10, 5)
self.shifts = [8, -1]
self.dims = [-1, -2]
class TestRollAPI(unittest.TestCase):
def input_data(self):
self.data_x = np.array(
[[1.0, 2.0, 3.0], [4.0, 5.0, 6.0], [7.0, 8.0, 9.0]])
def test_roll_op_api(self):
self.input_data()
# case 1:
with program_guard(Program(), Program()):
x = fluid.layers.data(name='x', shape=[-1, 3])
z = paddle.roll(x, shifts=1)
exe = fluid.Executor(fluid.CPUPlace())
res, = exe.run(feed={'x': self.data_x},
fetch_list=[z.name],
return_numpy=False)
expect_out = np.array([[9.0, 1.0, 2.0], [3.0, 4.0, 5.0],
[6.0, 7.0, 8.0]])
self.assertTrue(np.allclose(expect_out, np.array(res)))
# case 2:
with program_guard(Program(), Program()):
x = fluid.layers.data(name='x', shape=[-1, 3])
z = paddle.roll(x, shifts=1, dims=0)
exe = fluid.Executor(fluid.CPUPlace())
res, = exe.run(feed={'x': self.data_x},
fetch_list=[z.name],
return_numpy=False)
expect_out = np.array([[7.0, 8.0, 9.0], [1.0, 2.0, 3.0],
[4.0, 5.0, 6.0]])
self.assertTrue(np.allclose(expect_out, np.array(res)))
def test_dygraph_api(self):
self.input_data()
# case 1:
with fluid.dygraph.guard():
x = fluid.dygraph.to_variable(self.data_x)
z = paddle.roll(x, shifts=1)
np_z = z.numpy()
expect_out = np.array([[9.0, 1.0, 2.0], [3.0, 4.0, 5.0],
[6.0, 7.0, 8.0]])
self.assertTrue(np.allclose(expect_out, np_z))
# case 2:
with fluid.dygraph.guard():
x = fluid.dygraph.to_variable(self.data_x)
z = paddle.roll(x, shifts=1, dims=0)
np_z = z.numpy()
expect_out = np.array([[7.0, 8.0, 9.0], [1.0, 2.0, 3.0],
[4.0, 5.0, 6.0]])
self.assertTrue(np.allclose(expect_out, np_z))
if __name__ == "__main__":
unittest.main()
| python/paddle/fluid/tests/unittests/test_roll_op.py | 3,876 | Copyright (c) 2020 PaddlePaddle Authors. All Rights Reserved. Licensed under the Apache License, Version 2.0 (the "License"); you may not use this file except in compliance with the License. You may obtain a copy of the License at http://www.apache.org/licenses/LICENSE-2.0 Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the specific language governing permissions and limitations under the License. case 1: case 2: case 1: case 2: | 615 | en | 0.852302 |
import importlib
import os
from datasets.hdf5 import get_test_loaders
from unet3d import utils
from unet3d.config import load_config
from unet3d.model import get_model
logger = utils.get_logger('UNet3DPredictor')
def _get_predictor(model, loader, output_file, config):
predictor_config = config.get('predictor', {})
class_name = predictor_config.get('name', 'StandardPredictor')
m = importlib.import_module('unet3d.predictor')
predictor_class = getattr(m, class_name)
# model: UNet3D, loader: test_loader, output_file: data.h5, config: config.yaml
return predictor_class(model, loader, output_file, config, **predictor_config)
def main():
# Load configuration
config = load_config()
# Create the model
model = get_model(config)
# Load model state
model_path = config['model_path']
logger.info(f'Loading model from {model_path}...')
utils.load_checkpoint(model_path, model)
logger.info(f"Sending the model to '{config['device']}'")
model = model.to(config['device'])
logger.info('Loading HDF5 datasets...')
test_loader = get_test_loaders(config)['test']
for i, data_pair in enumerate(test_loader):
output_file = 'predict_' + str(i) + '.h5'
predictor = _get_predictor(model, data_pair, output_file, config)
predictor.predict()
if __name__ == '__main__':
main()
| predict.py | 1,420 | model: UNet3D, loader: test_loader, output_file: data.h5, config: config.yaml Load configuration Create the model Load model state | 130 | en | 0.270328 |
# -*- coding: utf-8 -*-
#
# django-staticbuilder documentation build configuration file, created by
# sphinx-quickstart on Wed Jan 30 22:32:51 2013.
#
# This file is execfile()d with the current directory set to its containing dir.
#
# Note that not all possible configuration values are present in this
# autogenerated file.
#
# All configuration values have a default; values that are commented out
# serve to show the default.
import re, sys, os
# If extensions (or modules to document with autodoc) are in another directory,
# add these directories to sys.path here. If the directory is relative to the
# documentation root, use os.path.abspath to make it absolute, like shown here.
#sys.path.insert(0, os.path.abspath('.'))
# -- General configuration -----------------------------------------------------
# If your documentation needs a minimal Sphinx version, state it here.
#needs_sphinx = '1.0'
# Add any Sphinx extension module names here, as strings. They can be extensions
# coming with Sphinx (named 'sphinx.ext.*') or your custom ones.
extensions = ['sphinx.ext.todo']
# Add any paths that contain templates here, relative to this directory.
templates_path = ['_templates']
# The suffix of source filenames.
source_suffix = '.rst'
# The encoding of source files.
#source_encoding = 'utf-8-sig'
# The master toctree document.
master_doc = 'index'
# General information about the project.
project = u'django-staticbuilder'
copyright = u'2013, Matthew Tretter'
pkgmeta = {}
execfile(os.path.join(os.path.dirname(__file__), '..', '..', 'staticbuilder',
'pkgmeta.py'), pkgmeta)
# The version info for the project you're documenting, acts as replacement for
# |version| and |release|, also used in various other places throughout the
# built documents.
#
# The short X.Y version.
version = re.match('\d+\.\d+', pkgmeta['__version__']).group()
# The full version, including alpha/beta/rc tags.
release = pkgmeta['__version__']
# The language for content autogenerated by Sphinx. Refer to documentation
# for a list of supported languages.
#language = None
# There are two options for replacing |today|: either, you set today to some
# non-false value, then it is used:
#today = ''
# Else, today_fmt is used as the format for a strftime call.
#today_fmt = '%B %d, %Y'
# List of patterns, relative to source directory, that match files and
# directories to ignore when looking for source files.
exclude_patterns = []
# The reST default role (used for this markup: `text`) to use for all documents.
#default_role = None
# If true, '()' will be appended to :func: etc. cross-reference text.
#add_function_parentheses = True
# If true, the current module name will be prepended to all description
# unit titles (such as .. function::).
#add_module_names = True
# If true, sectionauthor and moduleauthor directives will be shown in the
# output. They are ignored by default.
#show_authors = False
# The name of the Pygments (syntax highlighting) style to use.
pygments_style = 'sphinx'
# A list of ignored prefixes for module index sorting.
#modindex_common_prefix = []
# -- Options for HTML output ---------------------------------------------------
# The theme to use for HTML and HTML Help pages. See the documentation for
# a list of builtin themes.
html_theme = 'default'
# Theme options are theme-specific and customize the look and feel of a theme
# further. For a list of options available for each theme, see the
# documentation.
#html_theme_options = {}
# Add any paths that contain custom themes here, relative to this directory.
#html_theme_path = []
# The name for this set of Sphinx documents. If None, it defaults to
# "<project> v<release> documentation".
#html_title = None
# A shorter title for the navigation bar. Default is the same as html_title.
#html_short_title = None
# The name of an image file (relative to this directory) to place at the top
# of the sidebar.
#html_logo = None
# The name of an image file (within the static path) to use as favicon of the
# docs. This file should be a Windows icon file (.ico) being 16x16 or 32x32
# pixels large.
#html_favicon = None
# Add any paths that contain custom static files (such as style sheets) here,
# relative to this directory. They are copied after the builtin static files,
# so a file named "default.css" will overwrite the builtin "default.css".
html_static_path = ['_static']
# If not '', a 'Last updated on:' timestamp is inserted at every page bottom,
# using the given strftime format.
#html_last_updated_fmt = '%b %d, %Y'
# If true, SmartyPants will be used to convert quotes and dashes to
# typographically correct entities.
#html_use_smartypants = True
# Custom sidebar templates, maps document names to template names.
#html_sidebars = {}
# Additional templates that should be rendered to pages, maps page names to
# template names.
#html_additional_pages = {}
# If false, no module index is generated.
#html_domain_indices = True
# If false, no index is generated.
#html_use_index = True
# If true, the index is split into individual pages for each letter.
#html_split_index = False
# If true, links to the reST sources are added to the pages.
#html_show_sourcelink = True
# If true, "Created using Sphinx" is shown in the HTML footer. Default is True.
#html_show_sphinx = True
# If true, "(C) Copyright ..." is shown in the HTML footer. Default is True.
#html_show_copyright = True
# If true, an OpenSearch description file will be output, and all pages will
# contain a <link> tag referring to it. The value of this option must be the
# base URL from which the finished HTML is served.
#html_use_opensearch = ''
# This is the file name suffix for HTML files (e.g. ".xhtml").
#html_file_suffix = None
# Output file base name for HTML help builder.
htmlhelp_basename = 'django-staticbuilderdoc'
# -- Options for LaTeX output --------------------------------------------------
latex_elements = {
# The paper size ('letterpaper' or 'a4paper').
#'papersize': 'letterpaper',
# The font size ('10pt', '11pt' or '12pt').
#'pointsize': '10pt',
# Additional stuff for the LaTeX preamble.
#'preamble': '',
}
# Grouping the document tree into LaTeX files. List of tuples
# (source start file, target name, title, author, documentclass [howto/manual]).
latex_documents = [
('index', 'django-staticbuilder.tex', u'django-staticbuilder Documentation',
u'Matthew Tretter', 'manual'),
]
# The name of an image file (relative to this directory) to place at the top of
# the title page.
#latex_logo = None
# For "manual" documents, if this is true, then toplevel headings are parts,
# not chapters.
#latex_use_parts = False
# If true, show page references after internal links.
#latex_show_pagerefs = False
# If true, show URL addresses after external links.
#latex_show_urls = False
# Documents to append as an appendix to all manuals.
#latex_appendices = []
# If false, no module index is generated.
#latex_domain_indices = True
# -- Options for manual page output --------------------------------------------
# One entry per manual page. List of tuples
# (source start file, name, description, authors, manual section).
man_pages = [
('index', 'django-staticbuilder', u'django-staticbuilder Documentation',
[u'Matthew Tretter'], 1)
]
# If true, show URL addresses after external links.
#man_show_urls = False
# -- Options for Texinfo output ------------------------------------------------
# Grouping the document tree into Texinfo files. List of tuples
# (source start file, target name, title, author,
# dir menu entry, description, category)
texinfo_documents = [
('index', 'django-staticbuilder', u'django-staticbuilder Documentation',
u'Matthew Tretter', 'django-staticbuilder', 'One line description of project.',
'Miscellaneous'),
]
# Documents to append as an appendix to all manuals.
#texinfo_appendices = []
# If false, no module index is generated.
#texinfo_domain_indices = True
# How to display URL addresses: 'footnote', 'no', or 'inline'.
#texinfo_show_urls = 'footnote'
| docs/source/conf.py | 8,079 | -*- coding: utf-8 -*- django-staticbuilder documentation build configuration file, created by sphinx-quickstart on Wed Jan 30 22:32:51 2013. This file is execfile()d with the current directory set to its containing dir. Note that not all possible configuration values are present in this autogenerated file. All configuration values have a default; values that are commented out serve to show the default. If extensions (or modules to document with autodoc) are in another directory, add these directories to sys.path here. If the directory is relative to the documentation root, use os.path.abspath to make it absolute, like shown here.sys.path.insert(0, os.path.abspath('.')) -- General configuration ----------------------------------------------------- If your documentation needs a minimal Sphinx version, state it here.needs_sphinx = '1.0' Add any Sphinx extension module names here, as strings. They can be extensions coming with Sphinx (named 'sphinx.ext.*') or your custom ones. Add any paths that contain templates here, relative to this directory. The suffix of source filenames. The encoding of source files.source_encoding = 'utf-8-sig' The master toctree document. General information about the project. The version info for the project you're documenting, acts as replacement for |version| and |release|, also used in various other places throughout the built documents. The short X.Y version. The full version, including alpha/beta/rc tags. The language for content autogenerated by Sphinx. Refer to documentation for a list of supported languages.language = None There are two options for replacing |today|: either, you set today to some non-false value, then it is used:today = '' Else, today_fmt is used as the format for a strftime call.today_fmt = '%B %d, %Y' List of patterns, relative to source directory, that match files and directories to ignore when looking for source files. The reST default role (used for this markup: `text`) to use for all documents.default_role = None If true, '()' will be appended to :func: etc. cross-reference text.add_function_parentheses = True If true, the current module name will be prepended to all description unit titles (such as .. function::).add_module_names = True If true, sectionauthor and moduleauthor directives will be shown in the output. They are ignored by default.show_authors = False The name of the Pygments (syntax highlighting) style to use. A list of ignored prefixes for module index sorting.modindex_common_prefix = [] -- Options for HTML output --------------------------------------------------- The theme to use for HTML and HTML Help pages. See the documentation for a list of builtin themes. Theme options are theme-specific and customize the look and feel of a theme further. For a list of options available for each theme, see the documentation.html_theme_options = {} Add any paths that contain custom themes here, relative to this directory.html_theme_path = [] The name for this set of Sphinx documents. If None, it defaults to "<project> v<release> documentation".html_title = None A shorter title for the navigation bar. Default is the same as html_title.html_short_title = None The name of an image file (relative to this directory) to place at the top of the sidebar.html_logo = None The name of an image file (within the static path) to use as favicon of the docs. This file should be a Windows icon file (.ico) being 16x16 or 32x32 pixels large.html_favicon = None Add any paths that contain custom static files (such as style sheets) here, relative to this directory. They are copied after the builtin static files, so a file named "default.css" will overwrite the builtin "default.css". If not '', a 'Last updated on:' timestamp is inserted at every page bottom, using the given strftime format.html_last_updated_fmt = '%b %d, %Y' If true, SmartyPants will be used to convert quotes and dashes to typographically correct entities.html_use_smartypants = True Custom sidebar templates, maps document names to template names.html_sidebars = {} Additional templates that should be rendered to pages, maps page names to template names.html_additional_pages = {} If false, no module index is generated.html_domain_indices = True If false, no index is generated.html_use_index = True If true, the index is split into individual pages for each letter.html_split_index = False If true, links to the reST sources are added to the pages.html_show_sourcelink = True If true, "Created using Sphinx" is shown in the HTML footer. Default is True.html_show_sphinx = True If true, "(C) Copyright ..." is shown in the HTML footer. Default is True.html_show_copyright = True If true, an OpenSearch description file will be output, and all pages will contain a <link> tag referring to it. The value of this option must be the base URL from which the finished HTML is served.html_use_opensearch = '' This is the file name suffix for HTML files (e.g. ".xhtml").html_file_suffix = None Output file base name for HTML help builder. -- Options for LaTeX output -------------------------------------------------- The paper size ('letterpaper' or 'a4paper').'papersize': 'letterpaper', The font size ('10pt', '11pt' or '12pt').'pointsize': '10pt', Additional stuff for the LaTeX preamble.'preamble': '', Grouping the document tree into LaTeX files. List of tuples (source start file, target name, title, author, documentclass [howto/manual]). The name of an image file (relative to this directory) to place at the top of the title page.latex_logo = None For "manual" documents, if this is true, then toplevel headings are parts, not chapters.latex_use_parts = False If true, show page references after internal links.latex_show_pagerefs = False If true, show URL addresses after external links.latex_show_urls = False Documents to append as an appendix to all manuals.latex_appendices = [] If false, no module index is generated.latex_domain_indices = True -- Options for manual page output -------------------------------------------- One entry per manual page. List of tuples (source start file, name, description, authors, manual section). If true, show URL addresses after external links.man_show_urls = False -- Options for Texinfo output ------------------------------------------------ Grouping the document tree into Texinfo files. List of tuples (source start file, target name, title, author, dir menu entry, description, category) Documents to append as an appendix to all manuals.texinfo_appendices = [] If false, no module index is generated.texinfo_domain_indices = True How to display URL addresses: 'footnote', 'no', or 'inline'.texinfo_show_urls = 'footnote' | 6,654 | en | 0.652461 |
# coding: utf-8
"""
Purity//FB REST Client
Client for Purity//FB REST API (1.0 - 1.6), developed by [Pure Storage, Inc](http://www.purestorage.com/). Documentations can be found at [purity-fb.readthedocs.io](http://purity-fb.readthedocs.io/).
OpenAPI spec version: 1.6
Contact: info@purestorage.com
Generated by: https://github.com/swagger-api/swagger-codegen.git
"""
from __future__ import absolute_import
import sys
import os
import re
# python 2 and python 3 compatibility library
from six import iteritems
from ..configuration import Configuration
from ..api_client import ApiClient
class UsageUsersApi(object):
"""
NOTE: This class is auto generated by the swagger code generator program.
Do not edit the class manually.
Ref: https://github.com/swagger-api/swagger-codegen
"""
def __init__(self, api_client=None):
config = Configuration()
if api_client:
self.api_client = api_client
else:
if not config.api_client:
config.api_client = ApiClient()
self.api_client = config.api_client
def list_user_usage(self, **kwargs):
"""
A list of usage user entries
This method makes a synchronous HTTP request by default. To make an
asynchronous HTTP request, please define a `callback` function
to be invoked when receiving the response.
>>> def callback_function(response):
>>> pprint(response)
>>>
>>> thread = api.list_user_usage(callback=callback_function)
:param callback function: The callback function
for asynchronous request. (optional)
:param list[str] names: A list of names.
:param str filter: The filter to be used for query.
:param int limit: limit, should be >= 0
:param str sort: The way to order the results.
:param int start: start
:param str token: token
:param list[str] file_system_names: A comma-separated list of file system names. If after filtering, there is not at least one resource that matches each of the elements of names, then an error is returned.
:param list[str] uids: A comma-separated list of user IDs. If after filtering, there is not at least one resource that matches each of the elements of user IDs, then an error is returned. This cannot be provided together with user_names query parameter.
:return: QuotasUserResponse
If the method is called asynchronously,
returns the request thread.
"""
kwargs['_return_http_data_only'] = True
if kwargs.get('callback'):
return self.list_user_usage_with_http_info(**kwargs)
else:
(data) = self.list_user_usage_with_http_info(**kwargs)
return data
def list_user_usage_with_http_info(self, **kwargs):
"""
A list of usage user entries
This method makes a synchronous HTTP request by default. To make an
asynchronous HTTP request, please define a `callback` function
to be invoked when receiving the response.
>>> def callback_function(response):
>>> pprint(response)
>>>
>>> thread = api.list_user_usage_with_http_info(callback=callback_function)
:param callback function: The callback function
for asynchronous request. (optional)
:param list[str] names: A list of names.
:param str filter: The filter to be used for query.
:param int limit: limit, should be >= 0
:param str sort: The way to order the results.
:param int start: start
:param str token: token
:param list[str] file_system_names: A comma-separated list of file system names. If after filtering, there is not at least one resource that matches each of the elements of names, then an error is returned.
:param list[str] uids: A comma-separated list of user IDs. If after filtering, there is not at least one resource that matches each of the elements of user IDs, then an error is returned. This cannot be provided together with user_names query parameter.
:return: QuotasUserResponse
If the method is called asynchronously,
returns the request thread.
"""
all_params = ['names', 'filter', 'limit', 'sort', 'start', 'token', 'file_system_names', 'uids']
all_params.append('callback')
all_params.append('_return_http_data_only')
all_params.append('_preload_content')
all_params.append('_request_timeout')
params = locals()
for key, val in iteritems(params['kwargs']):
if key not in all_params:
raise TypeError(
"Got an unexpected keyword argument '%s'"
" to method list_user_usage" % key
)
params[key] = val
del params['kwargs']
collection_formats = {}
path_params = {}
query_params = []
if 'names' in params:
query_params.append(('names', params['names']))
collection_formats['names'] = 'csv'
if 'filter' in params:
query_params.append(('filter', params['filter']))
if 'limit' in params:
query_params.append(('limit', params['limit']))
if 'sort' in params:
query_params.append(('sort', params['sort']))
if 'start' in params:
query_params.append(('start', params['start']))
if 'token' in params:
query_params.append(('token', params['token']))
if 'file_system_names' in params:
query_params.append(('file_system_names', params['file_system_names']))
collection_formats['file_system_names'] = 'csv'
if 'uids' in params:
query_params.append(('uids', params['uids']))
collection_formats['uids'] = 'csv'
header_params = {}
form_params = []
local_var_files = {}
body_params = None
# HTTP header `Accept`
header_params['Accept'] = self.api_client.\
select_header_accept(['application/json'])
# Authentication setting
auth_settings = ['AuthTokenHeader']
return self.api_client.call_api('/1.6/usage/users', 'GET',
path_params,
query_params,
header_params,
body=body_params,
post_params=form_params,
files=local_var_files,
response_type='QuotasUserResponse',
auth_settings=auth_settings,
callback=params.get('callback'),
_return_http_data_only=params.get('_return_http_data_only'),
_preload_content=params.get('_preload_content', True),
_request_timeout=params.get('_request_timeout'),
collection_formats=collection_formats)
| purity_fb/purity_fb_1dot6/apis/usage_users_api.py | 7,269 | NOTE: This class is auto generated by the swagger code generator program.
Do not edit the class manually.
Ref: https://github.com/swagger-api/swagger-codegen
A list of usage user entries
This method makes a synchronous HTTP request by default. To make an
asynchronous HTTP request, please define a `callback` function
to be invoked when receiving the response.
>>> def callback_function(response):
>>> pprint(response)
>>>
>>> thread = api.list_user_usage(callback=callback_function)
:param callback function: The callback function
for asynchronous request. (optional)
:param list[str] names: A list of names.
:param str filter: The filter to be used for query.
:param int limit: limit, should be >= 0
:param str sort: The way to order the results.
:param int start: start
:param str token: token
:param list[str] file_system_names: A comma-separated list of file system names. If after filtering, there is not at least one resource that matches each of the elements of names, then an error is returned.
:param list[str] uids: A comma-separated list of user IDs. If after filtering, there is not at least one resource that matches each of the elements of user IDs, then an error is returned. This cannot be provided together with user_names query parameter.
:return: QuotasUserResponse
If the method is called asynchronously,
returns the request thread.
A list of usage user entries
This method makes a synchronous HTTP request by default. To make an
asynchronous HTTP request, please define a `callback` function
to be invoked when receiving the response.
>>> def callback_function(response):
>>> pprint(response)
>>>
>>> thread = api.list_user_usage_with_http_info(callback=callback_function)
:param callback function: The callback function
for asynchronous request. (optional)
:param list[str] names: A list of names.
:param str filter: The filter to be used for query.
:param int limit: limit, should be >= 0
:param str sort: The way to order the results.
:param int start: start
:param str token: token
:param list[str] file_system_names: A comma-separated list of file system names. If after filtering, there is not at least one resource that matches each of the elements of names, then an error is returned.
:param list[str] uids: A comma-separated list of user IDs. If after filtering, there is not at least one resource that matches each of the elements of user IDs, then an error is returned. This cannot be provided together with user_names query parameter.
:return: QuotasUserResponse
If the method is called asynchronously,
returns the request thread.
Purity//FB REST Client
Client for Purity//FB REST API (1.0 - 1.6), developed by [Pure Storage, Inc](http://www.purestorage.com/). Documentations can be found at [purity-fb.readthedocs.io](http://purity-fb.readthedocs.io/).
OpenAPI spec version: 1.6
Contact: info@purestorage.com
Generated by: https://github.com/swagger-api/swagger-codegen.git
coding: utf-8 python 2 and python 3 compatibility library HTTP header `Accept` Authentication setting | 3,068 | en | 0.764704 |
"""
Unit tests for the structured metamodel component.
"""
import unittest
import inspect
import numpy as np
from numpy.testing import assert_almost_equal
import openmdao.api as om
from openmdao.utils.assert_utils import assert_near_equal, assert_warning, assert_check_partials
from openmdao.utils.general_utils import set_pyoptsparse_opt
scipy_gte_019 = True
try:
from scipy.interpolate._bsplines import make_interp_spline
except ImportError:
scipy_gte_019 = False
# check that pyoptsparse is installed
# if it is, try to use SNOPT but fall back to SLSQP
OPT, OPTIMIZER = set_pyoptsparse_opt('SNOPT')
if OPTIMIZER:
from openmdao.drivers.pyoptsparse_driver import pyOptSparseDriver
x = np.array([-0.97727788, -0.15135721, -0.10321885, 0.40015721, 0.4105985,
0.95008842, 0.97873798, 1.76405235, 1.86755799, 2.2408932 ])
y = np.array([ 0.12167502, 0.14404357, 0.44386323, 0.76103773, 1.45427351])
z = np.array([-2.55298982, -1.45436567, -0.85409574, -0.74216502, -0.20515826, 0.04575852,
0.3130677, 0.33367433, 0.6536186, 0.8644362, 1.49407907, 2.26975462])
f = np.array([
[[-0.18718385, 1.53277921, 1.46935877, 0.15494743, 0.37816252, -0.88778575,
-1.98079647, -0.34791215, 0.15634897, 1.23029068, 1.20237985, -0.38732682],
[-0.30230275, -1.04855297, -1.42001794, -1.70627019, 1.9507754, -0.50965218,
-0.4380743, -1.25279536, 0.77749036, -1.61389785, -0.21274028, -0.89546656],
[ 0.3869025, -0.51080514, -1.18063218, -0.02818223, 0.42833187, 0.06651722,
0.3024719, -0.63432209, -0.36274117, -0.67246045, -0.35955316, -0.81314628],
[-1.7262826, 0.17742614, -0.40178094, -1.63019835, 0.46278226, -0.90729836,
0.0519454, 0.72909056, 0.12898291, 1.13940068, -1.23482582, 0.40234164],
[-0.68481009, -0.87079715, -0.57884966, -0.31155253, 0.05616534, -1.16514984,
0.90082649, 0.46566244, -1.53624369, 1.48825219, 1.89588918, 1.17877957]],
[[-0.17992484, -1.07075262, 1.05445173, -0.40317695, 1.22244507, 0.20827498,
0.97663904, 0.3563664, 0.70657317, 0.01050002, 1.78587049, 0.12691209],
[ 0.40198936, 1.8831507, -1.34775906, -1.270485, 0.96939671, -1.17312341,
1.94362119, -0.41361898, -0.74745481, 1.92294203, 1.48051479, 1.86755896],
[ 0.90604466, -0.86122569, 1.91006495, -0.26800337, 0.8024564, 0.94725197,
-0.15501009, 0.61407937, 0.92220667, 0.37642553, -1.09940079, 0.29823817],
[ 1.3263859, -0.69456786, -0.14963454, -0.43515355, 1.84926373, 0.67229476,
0.40746184, -0.76991607, 0.53924919, -0.67433266, 0.03183056, -0.63584608],
[ 0.67643329, 0.57659082, -0.20829876, 0.39600671, -1.09306151, -1.49125759,
0.4393917, 0.1666735, 0.63503144, 2.38314477, 0.94447949, -0.91282223]],
[[ 1.11701629, -1.31590741, -0.4615846, -0.06824161, 1.71334272, -0.74475482,
-0.82643854, -0.09845252, -0.66347829, 1.12663592, -1.07993151, -1.14746865],
[-0.43782004, -0.49803245, 1.92953205, 0.94942081, 0.08755124, -1.22543552,
0.84436298, -1.00021535, -1.5447711, 1.18802979, 0.31694261, 0.92085882],
[ 0.31872765, 0.85683061, -0.65102559, -1.03424284, 0.68159452, -0.80340966,
-0.68954978, -0.4555325, 0.01747916, -0.35399391, -1.37495129, -0.6436184 ],
[-2.22340315, 0.62523145, -1.60205766, -1.10438334, 0.05216508, -0.739563,
1.5430146, -1.29285691, 0.26705087, -0.03928282, -1.1680935, 0.52327666],
[-0.17154633, 0.77179055, 0.82350415, 2.16323595, 1.33652795, -0.36918184,
-0.23937918, 1.0996596, 0.65526373, 0.64013153, -1.61695604, -0.02432612]],
[[-0.73803091, 0.2799246, -0.09815039, 0.91017891, 0.31721822, 0.78632796,
-0.4664191, -0.94444626, -0.41004969, -0.01702041, 0.37915174, 2.25930895],
[-0.04225715, -0.955945 , -0.34598178, -0.46359597, 0.48148147, -1.54079701,
0.06326199, 0.15650654, 0.23218104, -0.59731607, -0.23792173, -1.42406091],
[-0.49331988, -0.54286148, 0.41605005, -1.15618243, 0.7811981, 1.49448454,
-2.06998503, 0.42625873, 0.67690804, -0.63743703, -0.39727181, -0.13288058],
[-0.29779088, -0.30901297, -1.67600381, 1.15233156, 1.07961859, -0.81336426,
-1.46642433, 0.52106488, -0.57578797, 0.14195316, -0.31932842, 0.69153875],
[ 0.69474914, -0.72559738, -1.38336396, -1.5829384, 0.61037938, -1.18885926,
-0.50681635, -0.59631404, -0.0525673, -1.93627981, 0.1887786, 0.52389102]],
[[ 0.08842209, -0.31088617, 0.09740017, 0.39904635, -2.77259276, 1.95591231,
0.39009332, -0.65240858, -0.39095338, 0.49374178, -0.11610394, -2.03068447],
[ 2.06449286, -0.11054066, 1.02017271, -0.69204985, 1.53637705, 0.28634369,
0.60884383, -1.04525337, 1.21114529, 0.68981816, 1.30184623, -0.62808756],
[-0.48102712, 2.3039167, -1.06001582, -0.1359497, 1.13689136, 0.09772497,
0.58295368, -0.39944903, 0.37005589, -1.30652685, 1.65813068, -0.11816405],
[-0.6801782, 0.66638308, -0.46071979, -1.33425847, -1.34671751, 0.69377315,
-0.15957344, -0.13370156, 1.07774381, -1.12682581, -0.73067775, -0.38487981],
[ 0.09435159, -0.04217145, -0.28688719, -0.0616264, -0.10730528, -0.71960439,
-0.81299299, 0.27451636, -0.89091508, -1.15735526, -0.31229225, -0.15766702]],
[[ 2.2567235, -0.70470028, 0.94326072, 0.74718833, -1.18894496, 0.77325298,
-1.18388064, -2.65917224, 0.60631952, -1.75589058, 0.45093446, -0.6840109 ],
[ 1.6595508, 1.0685094, -0.4533858, -0.68783761, -1.2140774, -0.44092263,
-0.2803555, -0.36469354, 0.15670386, 0.5785215, 0.34965446, -0.76414392],
[-1.43779147, 1.36453185, -0.68944918, -0.6522936, -0.52118931, -1.84306955,
-0.477974 , -0.47965581, 0.6203583, 0.69845715, 0.00377089, 0.93184837],
[ 0.33996498, -0.01568211, 0.16092817, -0.19065349, -0.39484951, -0.26773354,
-1.12801133, 0.28044171, -0.99312361, 0.84163126, -0.24945858, 0.04949498],
[ 0.49383678, 0.64331447, -1.57062341, -0.20690368, 0.88017891, -1.69810582,
0.38728048, -2.25556423, -1.02250684, 0.03863055, -1.6567151, -0.98551074]],
[[-1.47183501, 1.64813493, 0.16422776, 0.56729028, -0.2226751, -0.35343175,
-1.61647419, -0.29183736, -0.76149221, 0.85792392, 1.14110187, 1.46657872],
[ 0.85255194, -0.59865394, -1.11589699, 0.76666318, 0.35629282, -1.76853845,
0.35548179, 0.81451982, 0.05892559, -0.18505367, -0.80764849, -1.4465347 ],
[ 0.80029795, -0.30911444, -0.23346666, 1.73272119, 0.68450111, 0.370825 ,
0.14206181, 1.51999486, 1.71958931, 0.92950511, 0.58222459, -2.09460307],
[ 0.12372191, -0.13010695, 0.09395323, 0.94304609, -2.73967717, -0.56931205,
0.26990435, -0.46684555, -1.41690611, 0.86896349, 0.27687191, -0.97110457],
[ 0.3148172, 0.82158571, 0.00529265, 0.8005648, 0.07826018, -0.39522898,
-1.15942052, -0.08593077, 0.19429294, 0.87583276, -0.11510747, 0.45741561]],
[[-0.96461201, -0.78262916, -0.1103893, -1.05462846, 0.82024784, 0.46313033,
0.27909576, 0.33890413, 2.02104356, -0.46886419, -2.20144129, 0.1993002 ],
[-0.05060354, -0.51751904, -0.97882986, -0.43918952, 0.18133843, -0.5028167,
2.41245368, -0.96050438, -0.79311736, -2.28862004, 0.25148442, -2.01640663],
[-0.53945463, -0.27567053, -0.70972797, 1.73887268, 0.99439439, 1.31913688,
-0.88241882, 1.12859406, 0.49600095, 0.77140595, 1.02943883, -0.90876325],
[-0.42431762, 0.86259601, -2.65561909, 1.51332808, 0.55313206, -0.04570396,
0.22050766, -1.02993528, -0.34994336, 1.10028434, 1.29802197, 2.69622405],
[-0.07392467, -0.65855297, -0.51423397, -1.01804188, -0.07785476, 0.38273243,
-0.03424228, 1.09634685, -0.2342158, -0.34745065, -0.58126848, -1.63263453]],
[[-1.56776772, -1.17915793, 1.30142807, 0.89526027, 1.37496407, -1.33221165,
-1.96862469, -0.66005632, 0.17581895, 0.49869027, 1.04797216, 0.28427967],
[ 1.74266878, -0.22260568, -0.91307922, -1.68121822, -0.88897136, 0.24211796,
-0.88872026, 0.93674246, 1.41232771, -2.36958691, 0.8640523, -2.23960406],
[ 0.40149906, 1.22487056, 0.06485611, -1.27968917, -0.5854312, -0.26164545,
-0.18224478, -0.20289684, -0.10988278, 0.21348005, -1.20857365, -0.24201983],
[ 1.51826117, -0.38464542, -0.44383609, 1.0781973, -2.55918467, 1.1813786,
-0.63190376, 0.16392857, 0.09632136, 0.94246812, -0.26759475, -0.67802578],
[ 1.29784579, -2.36417382, 0.02033418, -1.34792542, -0.76157339, 2.01125668,
-0.04459543, 0.1950697, -1.78156286, -0.72904466, 0.1965574, 0.35475769]],
[[ 0.61688655, 0.0086279, 0.52700421, 0.45378191, -1.82974041, 0.03700572,
0.76790241, 0.58987982, -0.36385881, -0.80562651, -1.11831192, -0.13105401],
[ 1.13307988, -1.9518041, -0.65989173, -1.13980246, 0.78495752, -0.55430963,
-0.47063766, -0.21694957, 0.44539325, -0.392389, -3.04614305, 0.54331189],
[ 0.43904296, -0.21954103, -1.08403662, 0.35178011, 0.37923553, -0.47003288,
-0.21673147, -0.9301565, -0.17858909, -1.55042935, 0.41731882, -0.94436849],
[ 0.23810315, -1.40596292, -0.59005765, -0.11048941, -1.66069981, 0.11514787,
-0.37914756, -1.7423562, -1.30324275, 0.60512008, 0.89555599, -0.13190864],
[ 0.40476181, 0.22384356, 0.32962298, 1.28598401, -1.5069984, 0.67646073,
-0.38200896, -0.22425893, -0.30224973, -0.37514712, -1.22619619, 0.1833392 ]
]])
g = np.array([
[[ 1.67094303e+00, -5.61330204e-02, -1.38504274e-03,
-6.87299037e-01, -1.17474546e-01, 4.66166426e-01,
-3.70242441e-01, -4.53804041e-01, 4.03264540e-01,
-9.18004770e-01, 2.52496627e-01, 8.20321797e-01],
[ 1.35994854e+00, -9.03820073e-02, 1.36759724e+00,
1.03440989e+00, -9.96212640e-01, -1.21793851e+00,
-3.04963638e-01, 1.02893549e+00, -7.22870076e-02,
-6.00657558e-01, 1.55224318e+00, 2.86904488e-01],
[-2.32059428e+00, 3.17160626e-01, 5.20040615e-01,
2.25608654e-01, 4.49712100e-01, -6.72756089e-02,
-1.31839587e+00, -3.70704003e-01, -9.45615796e-01,
-9.32740911e-01, -1.26306835e+00, 4.52489093e-01],
[ 9.78961454e-02, -4.48165363e-01, -6.49337928e-01,
-2.34231050e-02, 1.07919473e+00, -2.00421572e+00,
3.76876521e-01, -5.45711974e-01, -1.88458584e+00,
-1.94570308e+00, -9.12783494e-01, 2.19509556e-01],
[ 3.93062934e-01, -9.38981573e-01, 1.01702099e+00,
1.42298350e+00, 3.96086585e-01, -5.91402668e-01,
1.12441918e+00, 7.55395696e-01, 8.67407411e-01,
-6.56463675e-01, -2.83455451e+00, 2.11679102e+00]],
[[-1.61087840e+00, -3.57680719e-02, 2.38074535e+00,
3.30576756e-01, 9.49246474e-01, -1.50239657e+00,
-1.77766695e+00, -5.32702792e-01, 1.09074973e+00,
-3.46249448e-01, -7.94636321e-01, 1.97967290e-01],
[ 1.08193522e+00, -1.44494020e+00, -1.21054299e+00,
-7.88669255e-01, 1.09463837e+00, 2.34821526e-01,
2.13215341e+00, 9.36445726e-01, -3.50951769e-02,
1.26507784e+00, 2.11497013e-01, -7.04921353e-01],
[ 6.79974844e-01, -6.96326654e-01, -2.90397101e-01,
1.32778270e+00, -1.01281486e-01, -8.03141387e-01,
-4.64337691e-01, 1.02179059e+00, -5.52540673e-01,
-3.86870847e-01, -5.10292740e-01, 1.83925494e-01],
[-3.85489760e-01, -1.60183605e+00, -8.87180942e-01,
-9.32789042e-01, 1.24331938e+00, 8.12674042e-01,
5.87259379e-01, -5.05358317e-01, -8.15791542e-01,
-5.07517602e-01, -1.05188010e+00, 2.49720039e+00],
[-2.24532165e+00, 5.64008535e-01, -1.28455230e+00,
-1.04343491e-01, -9.88001942e-01, -1.17762896e+00,
-1.14019630e+00, 1.75498615e+00, -1.32988422e-01,
-7.65702194e-01, 5.55786964e-01, 1.03493146e-02]],
[[ 7.20033759e-01, -1.82425666e+00, 3.03603904e-01,
7.72694837e-01, -1.66159829e+00, 4.48195284e-01,
1.69618157e+00, -1.48577034e-02, 8.21405937e-01,
6.70570450e-01, -7.07505698e-01, 3.97667346e-02],
[-1.56699471e+00, -4.51303037e-01, 2.65687975e-01,
7.23100494e-01, 2.46121252e-02, 7.19983730e-01,
-1.10290621e+00, -1.01697275e-01, 1.92793845e-02,
1.84959125e+00, -2.14166656e-01, -4.99016638e-01],
[ 2.13512238e-02, -9.19113445e-01, 1.92753849e-01,
-3.65055217e-01, -1.79132755e+00, -5.85865511e-02,
-3.17543094e-01, -1.63242330e+00, -6.71341546e-02,
1.48935596e+00, 5.21303748e-01, 6.11927193e-01],
[-1.34149673e+00, 4.76898369e-01, 1.48449581e-01,
5.29045238e-01, 4.22628622e-01, -1.35978073e+00,
-4.14008116e-02, -7.57870860e-01, -5.00840943e-02,
-8.97400927e-01, 1.31247037e+00, -8.58972388e-01],
[-8.98942156e-01, 7.45864065e-02, -1.07709907e+00,
-4.24663302e-01, -8.29964598e-01, 1.41117206e+00,
7.85803827e-01, -5.74695185e-02, -3.91217052e-01,
9.40917615e-01, 4.05204080e-01, 4.98052405e-01]],
[[-2.61922373e-02, -1.68823003e+00, -1.12465983e-01,
-5.32489919e-01, 6.45055273e-01, 1.01184243e+00,
-6.57951045e-01, 4.68385234e-01, 1.73587900e+00,
-6.67712721e-01, 1.68192174e+00, -8.52585847e-01],
[ 2.29597556e-02, -1.11456118e-02, 1.14988999e-02,
-8.37678042e-01, -5.91183104e-01, -6.67720286e-01,
3.26962595e-01, 3.30035115e-01, 2.22594433e+00,
1.37098901e+00, -5.09843242e-01, 3.24869616e-01],
[ 9.97117981e-01, 3.06018243e-02, -6.96415784e-02,
5.15749428e-02, 8.67276629e-01, -8.48320523e-01,
-3.25669469e-01, 4.70433145e-01, 3.11447072e-01,
2.39582760e-01, -3.69801166e-01, 9.72535789e-01],
[ 2.13386825e+00, 4.06415494e-01, -1.93176702e-01,
7.55740289e-01, -5.39132637e-01, -7.49690345e-01,
3.28087476e-02, -2.58279663e+00, -1.15395036e+00,
-3.47961856e-01, -1.35338886e+00, -1.03264310e+00],
[-4.36748337e-01, -1.64296529e+00, -4.06071796e-01,
-5.35270165e-01, 2.54052084e-02, 1.15418403e+00,
1.72504416e-01, 2.10620213e-02, 9.94544570e-02,
2.27392775e-01, -1.01673865e+00, -1.14775325e-01]],
[[ 3.08751242e-01, -1.37075998e+00, 8.65652923e-01,
1.08137603e+00, -6.31375988e-01, -2.41337791e-01,
-8.78190343e-01, 6.99380484e-01, -1.06122229e+00,
-2.22477010e-01, -8.58919908e-01, 5.09542770e-02],
[-1.79422927e+00, 1.32646164e+00, -9.64606424e-01,
5.98946831e-02, -2.12523045e-01, -7.62114512e-01,
-8.87780137e-01, 9.36398544e-01, -5.25640593e-01,
2.71170185e-01, -8.01496885e-01, -6.47181432e-01],
[ 4.72247150e-01, 9.30408496e-01, -1.75316402e-01,
-1.42191987e+00, 1.99795608e+00, -8.56549308e-01,
-1.54158740e+00, 2.59442459e+00, -4.04032294e-01,
-1.46173269e+00, -6.83439767e-01, 3.67544896e-01],
[ 1.90311558e-01, -8.51729197e-01, 1.82272360e+00,
-5.21579678e-01, -1.18468659e+00, 9.60693398e-01,
1.32906285e+00, -8.17493098e-01, -1.40134729e+00,
1.03043827e+00, -2.04732361e+00, -1.22662166e+00],
[ 9.67446150e-01, -5.53525480e-02, -2.63937349e-01,
3.52816606e-01, -1.52774424e-01, -1.29868672e+00,
1.27607535e+00, 1.32501405e+00, 2.05332564e-01,
4.51340154e-02, 2.33962481e+00, -2.76432845e-01]],
[[-2.59576982e-01, 3.64481249e-01, 1.47132196e+00,
1.59277075e+00, -2.58572632e-01, 3.08331246e-01,
-1.37808347e+00, -3.11976108e-01, -8.40290395e-01,
-1.00683175e+00, 1.68157672e+00, -7.92286662e-01],
[-5.31605908e-01, 3.65848788e-01, 1.29782527e+00,
4.81115126e-01, 2.75935511e+00, -7.46679783e-02,
2.58716440e-01, 2.75600674e-01, 1.43504939e+00,
5.07238951e-01, -1.16229700e-01, -9.47488595e-01],
[ 2.44443456e-01, 1.40134483e+00, -4.10381794e-01,
5.28943618e-01, 2.46147789e-01, 8.63519658e-01,
-8.04753741e-01, 2.34664703e+00, -1.27916111e+00,
-3.65551090e-01, 9.38092541e-01, 2.96733172e-01],
[ 8.29986159e-01, -4.96102334e-01, -7.48049827e-02,
1.22319836e-02, 1.56925961e+00, 6.90429024e-01,
7.96672108e-01, -6.57926093e-01, 9.68882639e-01,
2.25581664e-01, 1.38914532e+00, 2.01406015e+00],
[-3.06765776e-01, -4.06303130e-01, -8.64044991e-01,
-1.43579512e-01, -3.82025449e-01, 3.59504400e-01,
-1.44566817e-01, -3.61599281e-01, 1.06458514e+00,
-9.37880231e-01, 4.33107953e-01, -4.05941727e-01]],
[[ 7.24368505e-01, 1.38526155e+00, -3.03098253e-01,
4.41032907e-01, 1.78792866e-01, -7.99422400e-01,
2.40787510e-01, 2.89120505e-01, 4.12870820e-01,
-1.98398897e-01, 9.41923003e-02, -1.14761094e+00],
[-3.58114075e-01, 5.55962680e-01, 8.92473887e-01,
-4.22314824e-01, 1.04714029e-01, 2.28053325e-01,
2.01479947e-01, 5.40773585e-01, -1.81807763e+00,
-4.93240701e-02, 2.39033601e-01, -1.00033035e+00],
[ 1.67398571e+00, 1.61559267e-01, 1.56340475e+00,
-7.90523022e-01, -9.07300122e-01, 2.24252221e-01,
-1.67868836e+00, 2.14965591e-01, 9.72192320e-02,
1.01566528e+00, 7.01041341e-01, -4.17477350e-01],
[-1.09749665e+00, 1.71230522e+00, -7.92115021e-01,
-1.04552456e+00, -1.08485606e+00, 1.11730532e+00,
-5.18900204e-01, -7.53704466e-01, 1.37689826e-01,
-2.06944711e-01, -6.78095461e-01, 7.53991467e-01],
[ 1.06531549e+00, 9.85317509e-01, 7.66919670e-01,
4.02625531e-01, -1.77588800e+00, 1.66925081e+00,
3.01989210e-01, 6.08156428e-01, 1.11496232e+00,
1.43335250e+00, 4.18398011e-01, 4.35546159e-01]],
[[-5.99224277e-01, 3.30897511e-02, -8.54161261e-01,
-7.19940532e-01, -8.93574402e-01, -1.56023891e-01,
1.04909319e+00, 3.17097477e+00, 1.89499638e-01,
-1.34841309e+00, 1.26498333e+00, -3.00783876e-01],
[-6.60608594e-01, 2.09849478e-01, -1.24062460e+00,
2.22463164e-01, -8.83755232e-02, 9.83779068e-02,
3.81416254e-01, 6.74922572e-02, 1.63380841e-02,
2.84314519e-01, 4.15400626e-01, -1.03148246e+00],
[-1.42999126e+00, -6.16380522e-02, -1.43273549e+00,
8.75314709e-02, 9.38746876e-01, 6.07111672e-01,
-1.04817041e+00, -8.60262452e-01, 3.28301295e-01,
-4.01297805e-01, -3.16655295e-01, 5.96906481e-01],
[-9.87286693e-01, -4.01234710e-01, -8.00082476e-01,
-1.04312950e+00, -8.57078189e-01, 6.77462169e-01,
5.18203895e-02, -8.79160629e-01, -2.31101608e-01,
-1.63880731e+00, -7.33312808e-01, 2.14957453e+00],
[-9.02438497e-02, 7.31658927e-01, -6.54883751e-02,
3.48169235e-01, 6.63258090e-01, -1.10461660e+00,
-3.09362573e-02, 1.57886519e+00, -7.95500550e-01,
-5.66439854e-01, -3.07691277e-01, 2.69024073e-01]],
[[ 5.24917864e-01, 1.26741165e+00, 4.99498233e-01,
-6.20531258e-02, 1.25916713e+00, 7.04111022e-01,
-1.49567952e+00, 2.52636824e+00, 1.76992139e+00,
-1.68214223e-01, 3.77910102e-01, 1.32435875e+00],
[-1.72200793e-01, 7.30351790e-01, 1.10457847e+00,
-1.01482591e+00, -6.02331854e-01, 9.21408398e-01,
4.60814477e-01, 9.23796560e-01, -1.32568015e-01,
-2.89005211e-01, -1.99863948e+00, -1.14600043e+00],
[ 4.70660947e-02, 8.24557220e-01, 5.31178367e-01,
-1.28241974e-01, -2.71771566e-01, 2.17179633e-01,
7.82111811e-02, 1.40454551e+00, 1.46440770e-01,
-1.48124596e+00, -1.27255814e+00, 1.51875934e+00],
[-1.17116046e+00, 7.64497453e-01, -2.68372735e-01,
-1.69758294e-01, -1.34132783e-01, 1.22138496e+00,
-1.92841829e-01, -3.33192828e-02, -1.53080350e+00,
2.06690512e-01, 5.31042507e-01, 2.39145581e-01],
[ 1.39789626e+00, 5.51713548e-02, 2.98977456e-01,
1.64850401e+00, -1.55001419e+00, -4.55825348e-01,
1.42615875e+00, 9.36129148e-01, 6.78380099e-01,
8.32650739e-01, 3.27066209e-01, 1.63159743e+00]],
[[ 3.77759170e-01, 2.39867106e-01, 1.58958674e-01,
1.92863956e-01, -1.15701728e+00, 7.70673054e-01,
-1.30439734e-01, 1.82191510e+00, -7.56504706e-02,
4.20918284e-01, 2.46602186e-01, -6.25557035e-01],
[ 9.92136829e-01, 1.90506364e+00, -1.47772197e-02,
-3.00478786e-01, -3.55028731e-01, -1.89236189e+00,
-1.77813144e-01, 2.50998116e-01, 1.05475793e+00,
9.60047741e-01, -4.16499082e-01, -2.76822995e-01],
[ 1.12390531e+00, -1.73463897e-01, -5.10029540e-01,
1.39251845e+00, 1.03758567e+00, 1.87917918e-02,
-5.93777448e-01, -2.01188032e+00, 5.89703606e-01,
-8.96369723e-01, -1.96273201e+00, 1.58482053e+00],
[ 6.47967791e-01, -1.13900819e+00, -1.21440138e+00,
8.70961782e-01, -8.77970617e-01, 1.29614987e+00,
6.16459313e-01, 5.36596521e-01, 4.04695456e-01,
1.91450872e-01, 8.80511199e-01, -4.54080363e-01],
[ 8.59519734e-02, 7.51946588e-01, 5.62989719e-01,
-1.19498681e+00, -5.00409667e-01, 2.52803505e-01,
-4.08014709e-01, 1.77465856e+00, -3.93153195e-01,
-1.62218448e-01, 7.69430178e-01, 3.30532743e-01]]
])
class SampleMap(object):
param_data = []
np.random.seed(0)
param_data.append({'name': 'x',
'units': None,
'default': 0,
'values': x})
param_data.append({'name': 'y',
'units': None,
'default': 0,
'values': y})
param_data.append({'name': 'z',
'units': None,
'default': 0,
'values': z})
output_data = []
output_data.append({'name': 'f',
'units': None,
'default': 0,
'values': f})
output_data.append({'name': 'g',
'units': None,
'default': 0,
'values': g})
@unittest.skipIf(not scipy_gte_019, "only run if scipy>=0.19.")
class TestMetaModelStructuredScipy(unittest.TestCase):
"""
Tests the regular grid map component. specifically the analytic derivatives
vs. finite difference estimates.
"""
def setUp(self):
model = om.Group()
ivc = om.IndepVarComp()
mapdata = SampleMap()
params = mapdata.param_data
x, y, z = params
outs = mapdata.output_data
z = outs[0]
ivc.add_output('x', x['default'], units=x['units'])
ivc.add_output('y', y['default'], units=y['units'])
ivc.add_output('z', z['default'], units=z['units'])
model.add_subsystem('des_vars', ivc, promotes=["*"])
comp = om.MetaModelStructuredComp(method='scipy_slinear', extrapolate=True)
for param in params:
comp.add_input(param['name'], param['default'], param['values'])
for out in outs:
comp.add_output(out['name'], out['default'], out['values'])
model.add_subsystem('comp', comp, promotes=["*"])
self.prob = om.Problem(model)
self.prob.setup()
self.prob['x'] = 1.0
self.prob['y'] = 0.75
self.prob['z'] = -1.7
def test_deriv1(self):
# run at default pt
self.run_and_check_derivs(self.prob)
# test output values
f, g = self.prob['comp.f'], self.prob['comp.g']
tol = 1e-6
assert_near_equal(f, -0.05624571, tol)
assert_near_equal(g, 1.02068754, tol)
def test_deriv1_swap(self):
# Bugfix test that we can add outputs before inputs.
model = om.Group()
ivc = om.IndepVarComp()
mapdata = SampleMap()
params = mapdata.param_data
x, y, z = params
outs = mapdata.output_data
z = outs[0]
ivc.add_output('x', x['default'], units=x['units'])
ivc.add_output('y', y['default'], units=y['units'])
ivc.add_output('z', z['default'], units=z['units'])
model.add_subsystem('des_vars', ivc, promotes=["*"])
comp = om.MetaModelStructuredComp(method='scipy_slinear', extrapolate=True)
for out in outs:
comp.add_output(out['name'], out['default'], out['values'])
for param in params:
comp.add_input(param['name'], param['default'], param['values'])
model.add_subsystem('comp', comp, promotes=["*"])
prob = om.Problem(model)
prob.setup()
prob['x'] = 1.0
prob['y'] = 0.75
prob['z'] = -1.7
# run at default pt
self.run_and_check_derivs(prob)
def test_deriv2(self):
self.prob['x'] = 10.0
self.prob['y'] = 0.81
self.prob['z'] = 1.1
self.run_and_check_derivs(self.prob)
def test_deriv3(self):
self.prob['x'] = 90.0
self.prob['y'] = 1.2
self.prob['z'] = 2.1
self.run_and_check_derivs(self.prob)
def test_deriv4(self):
# Tests extrapolation.
self.prob['x'] = 65.0
self.prob['y'] = 0.951
self.prob['z'] = 2.5
self.run_and_check_derivs(self.prob)
def test_raise_out_of_bounds_error(self):
model = om.Group()
ivc = om.IndepVarComp()
mapdata = SampleMap()
params = mapdata.param_data
x, y, z = params
outs = mapdata.output_data
z = outs[0]
ivc.add_output('x', x['default'], units=x['units'])
ivc.add_output('y', y['default'], units=y['units'])
ivc.add_output('z', z['default'], units=z['units'])
model.add_subsystem('des_vars', ivc, promotes=["*"])
# Need to make sure extrapolate is False for bounds to be checked
comp = om.MetaModelStructuredComp(method='scipy_slinear', extrapolate=False)
for param in params:
comp.add_input(param['name'], param['default'], param['values'])
for out in outs:
comp.add_output(out['name'], out['default'], out['values'])
model.add_subsystem('comp', comp, promotes=["*"])
self.prob = om.Problem(model)
self.prob.setup()
self.prob['x'] = 1.0
self.prob['y'] = 0.75
self.prob['z'] = 9.0 # intentionally set to be out of bounds
# The interpolating output name is given as a regexp because the exception could
# happen with f or g first. The order those are evaluated comes from the keys of
# dict so no guarantee on the order except for Python 3.6 !
msg = "'comp' <class MetaModelStructuredComp>: Error interpolating output '[f|g]' because input 'comp.z' was " \
"out of bounds \('.*', '.*'\) with value '9.0'"
with self.assertRaisesRegex(om.AnalysisError, msg):
self.run_and_check_derivs(self.prob)
def test_training_gradient(self):
model = om.Group()
ivc = om.IndepVarComp()
mapdata = SampleMap()
params = mapdata.param_data
outs = mapdata.output_data
ivc.add_output('x', np.array([-0.3, 0.7, 1.2]))
ivc.add_output('y', np.array([0.14, 0.313, 1.41]))
ivc.add_output('z', np.array([-2.11, -1.2, 2.01]))
ivc.add_output('f_train', outs[0]['values'])
ivc.add_output('g_train', outs[1]['values'])
comp = om.MetaModelStructuredComp(training_data_gradients=True,
method='scipy_cubic',
vec_size=3)
for param in params:
comp.add_input(param['name'], param['default'], param['values'])
for out in outs:
comp.add_output(out['name'], out['default'], out['values'])
model.add_subsystem('ivc', ivc, promotes=["*"])
model.add_subsystem('comp',
comp,
promotes=["*"])
prob = om.Problem(model)
prob.setup()
prob.run_model()
val0 = np.array([ 50.26787317, 49.76106232, 19.66117913])
val1 = np.array([-32.62094041, -31.67449135, -27.46959668])
tol = 1e-5
assert_near_equal(prob['f'], val0, tol)
assert_near_equal(prob['g'], val1, tol)
self.run_and_check_derivs(prob)
def test_training_gradient_setup_called_twice(self):
model = om.Group()
ivc = om.IndepVarComp()
mapdata = SampleMap()
params = mapdata.param_data
outs = mapdata.output_data
ivc.add_output('x', np.array([-0.3, 0.7, 1.2]))
ivc.add_output('y', np.array([0.14, 0.313, 1.41]))
ivc.add_output('z', np.array([-2.11, -1.2, 2.01]))
ivc.add_output('f_train', outs[0]['values'])
ivc.add_output('g_train', outs[1]['values'])
comp = om.MetaModelStructuredComp(training_data_gradients=True,
method='scipy_cubic',
vec_size=3)
for param in params:
comp.add_input(param['name'], param['default'], param['values'])
for out in outs:
comp.add_output(out['name'], out['default'], out['values'])
model.add_subsystem('ivc', ivc, promotes=["*"])
model.add_subsystem('comp',
comp,
promotes=["*"])
prob = om.Problem(model)
prob.setup()
prob.run_model()
val0 = np.array([ 50.26787317, 49.76106232, 19.66117913])
val1 = np.array([-32.62094041, -31.67449135, -27.46959668])
tol = 1e-5
assert_near_equal(prob['f'], val0, tol)
assert_near_equal(prob['g'], val1, tol)
self.run_and_check_derivs(prob)
# Setup and run again
prob.setup()
prob.run_model()
val0 = np.array([ 50.26787317, 49.76106232, 19.66117913])
val1 = np.array([-32.62094041, -31.67449135, -27.46959668])
tol = 1e-5
assert_near_equal(prob['f'], val0, tol)
assert_near_equal(prob['g'], val1, tol)
self.run_and_check_derivs(prob)
def run_and_check_derivs(self, prob, tol=1e-5, verbose=False):
"""Runs check_partials and compares to analytic derivatives."""
prob.run_model()
derivs = prob.check_partials(out_stream=None)
for i in derivs['comp'].keys():
if verbose:
print("Checking derivative pair:", i)
if derivs['comp'][i]['J_fwd'].sum() != 0.0:
rel_err = derivs['comp'][i]['rel error'][0]
self.assertLessEqual(rel_err, tol)
def test_error_msg_vectorized(self):
# Tests bug in error message where it doesn't give the correct node value.
x_bp = np.array([0., 1.])
y_data = np.array([0., 4.])
nn = 5
class MMComp(om.MetaModelStructuredComp):
def setup(self):
nn = self.options['vec_size']
self.add_input(name='x', val=np.ones(nn), units=None, training_data=x_bp)
self.add_output(name='y', val=np.zeros(nn), units=None, training_data=y_data)
p = om.Problem()
ivc = om.IndepVarComp()
ivc.add_output('x', val=np.linspace(.5, 1.1, nn))
p.model.add_subsystem('ivc', ivc, promotes=['x'])
p.model.add_subsystem('MM', MMComp(vec_size=nn), promotes=['x', 'y'])
p.setup()
with self.assertRaises(om.AnalysisError) as cm:
p.run_model()
msg = ("'MM' <class MMComp>: Error interpolating output 'y' because input 'MM.x' was out of bounds ('0.0', '1.0') with value '1.1'")
self.assertEqual(str(cm.exception), msg)
class TestMetaModelStructuredPython(unittest.TestCase):
"""
Tests the regular grid map component. specifically the analytic derivatives
vs. finite difference estimates.
"""
def setUp(self):
model = om.Group()
ivc = om.IndepVarComp()
mapdata = SampleMap()
params = mapdata.param_data
x, y, z = params
outs = mapdata.output_data
z = outs[0]
ivc.add_output('x', x['default'], units=x['units'])
ivc.add_output('y', y['default'], units=y['units'])
ivc.add_output('z', z['default'], units=z['units'])
model.add_subsystem('des_vars', ivc, promotes=["*"])
comp = om.MetaModelStructuredComp(method='slinear', extrapolate=True)
for param in params:
comp.add_input(param['name'], param['default'], param['values'])
for out in outs:
comp.add_output(out['name'], out['default'], out['values'])
model.add_subsystem('comp', comp, promotes=["*"])
self.prob = om.Problem(model)
self.prob.setup()
self.prob['x'] = 1.0
self.prob['y'] = 0.75
self.prob['z'] = -1.7
def run_and_check_derivs(self, prob, tol=1e-5, verbose=False):
"""Runs check_partials and compares to analytic derivatives."""
prob.run_model()
derivs = prob.check_partials(method='cs', out_stream=None)
for i in derivs['comp'].keys():
if verbose:
print("Checking derivative pair:", i)
if derivs['comp'][i]['J_fwd'].sum() != 0.0:
rel_err = derivs['comp'][i]['rel error'][0]
self.assertLessEqual(rel_err, tol)
def test_deriv1(self):
# run at default pt
self.run_and_check_derivs(self.prob)
# test output values
f, g = self.prob['comp.f'], self.prob['comp.g']
tol = 1e-6
assert_near_equal(f, -0.05624571, tol)
assert_near_equal(g, 1.02068754, tol)
def test_deriv1_swap(self):
# Bugfix test that we can add outputs before inputs.
model = om.Group()
ivc = om.IndepVarComp()
mapdata = SampleMap()
params = mapdata.param_data
x, y, z = params
outs = mapdata.output_data
z = outs[0]
ivc.add_output('x', x['default'], units=x['units'])
ivc.add_output('y', y['default'], units=y['units'])
ivc.add_output('z', z['default'], units=z['units'])
model.add_subsystem('des_vars', ivc, promotes=["*"])
comp = om.MetaModelStructuredComp(method='slinear', extrapolate=True)
for out in outs:
comp.add_output(out['name'], out['default'], out['values'])
for param in params:
comp.add_input(param['name'], param['default'], param['values'])
model.add_subsystem('comp', comp, promotes=["*"])
prob = om.Problem(model)
prob.setup()
prob['x'] = 1.0
prob['y'] = 0.75
prob['z'] = -1.7
# run at default pt
self.run_and_check_derivs(prob)
def test_deriv2(self):
self.prob['x'] = 10.0
self.prob['y'] = 0.81
self.prob['z'] = 1.1
self.run_and_check_derivs(self.prob)
def test_deriv3(self):
self.prob['x'] = 90.0
self.prob['y'] = 1.2
self.prob['z'] = 2.1
self.run_and_check_derivs(self.prob)
def test_deriv4(self):
# Tests extrapolation.
self.prob['x'] = 65.0
self.prob['y'] = 0.951
self.prob['z'] = 2.5
self.run_and_check_derivs(self.prob)
def test_vectorized_linear(self):
prob = om.Problem()
model = prob.model
ivc = om.IndepVarComp()
mapdata = SampleMap()
params = mapdata.param_data
x, y, _ = params
outs = mapdata.output_data
z = outs[0]
ivc.add_output('x', np.array([x['default'], x['default'], x['default']]),
units=x['units'])
ivc.add_output('y', np.array([y['default'], y['default'], y['default']]),
units=x['units'])
ivc.add_output('z', np.array([z['default'], z['default'], z['default']]),
units=x['units'])
model.add_subsystem('des_vars', ivc, promotes=["*"])
comp = om.MetaModelStructuredComp(method='slinear', extrapolate=True, vec_size=3)
for param in params:
comp.add_input(param['name'], np.array([param['default'], param['default'], param['default']]),
param['values'])
for out in outs:
comp.add_output(out['name'], np.array([out['default'], out['default'], out['default']]),
out['values'])
model.add_subsystem('comp', comp, promotes=["*"])
prob.setup(force_alloc_complex=True)
prob['x'] = np.array([1.0, 10.0, 90.0])
prob['y'] = np.array([0.75, 0.81, 1.2])
prob['z'] = np.array([-1.7, 1.1, 2.1])
prob.run_model()
partials = prob.check_partials(method='cs', out_stream=None)
assert_check_partials(partials, rtol=1e-10)
def test_vectorized_lagrange2(self):
prob = om.Problem()
model = prob.model
ivc = om.IndepVarComp()
mapdata = SampleMap()
params = mapdata.param_data
x, y, _ = params
outs = mapdata.output_data
z = outs[0]
ivc.add_output('x', np.array([x['default'], x['default'], x['default']]),
units=x['units'])
ivc.add_output('y', np.array([y['default'], y['default'], y['default']]),
units=x['units'])
ivc.add_output('z', np.array([z['default'], z['default'], z['default']]),
units=x['units'])
model.add_subsystem('des_vars', ivc, promotes=["*"])
comp = om.MetaModelStructuredComp(method='lagrange2', extrapolate=True, vec_size=3)
for param in params:
comp.add_input(param['name'], np.array([param['default'], param['default'], param['default']]),
param['values'])
for out in outs:
comp.add_output(out['name'], np.array([out['default'], out['default'], out['default']]),
out['values'])
model.add_subsystem('comp', comp, promotes=["*"])
prob.setup(force_alloc_complex=True)
prob['x'] = np.array([1.0, 10.0, 90.0])
prob['y'] = np.array([0.75, 0.81, 1.2])
prob['z'] = np.array([-1.7, 1.1, 2.1])
prob.run_model()
partials = prob.check_partials(method='cs', out_stream=None)
# Derivs are large, so ignore atol.
assert_check_partials(partials, atol=1e10, rtol=1e-10)
def test_vectorized_lagrange3(self):
prob = om.Problem()
model = prob.model
mapdata = SampleMap()
params = mapdata.param_data
x, y, _ = params
outs = mapdata.output_data
comp = om.MetaModelStructuredComp(method='lagrange3', extrapolate=True, vec_size=3)
for param in params:
comp.add_input(param['name'], np.array([param['default'], param['default'], param['default']]),
param['values'], units=param['units'])
for out in outs:
comp.add_output(out['name'], np.array([out['default'], out['default'], out['default']]),
out['values'])
model.add_subsystem('comp', comp, promotes=["*"])
prob.setup(force_alloc_complex=True)
prob.set_val('x', np.array([1.0, 10.0, 90.0]))
prob.set_val('y', np.array([0.75, 0.81, 1.2]))
prob.set_val('z', np.array([-1.7, 1.1, 2.1]))
prob.run_model()
partials = prob.check_partials(method='cs', out_stream=None)
# Derivs are large, so ignore atol.
assert_check_partials(partials, atol=1e10, rtol=1e-10)
def test_vectorized_akima(self):
prob = om.Problem()
model = prob.model
ivc = om.IndepVarComp()
mapdata = SampleMap()
params = mapdata.param_data
x, y, _ = params
outs = mapdata.output_data
z = outs[0]
ivc.add_output('x', np.array([x['default'], x['default'], x['default']]),
units=x['units'])
ivc.add_output('y', np.array([y['default'], y['default'], y['default']]),
units=y['units'])
ivc.add_output('z', np.array([z['default'], z['default'], z['default']]),
units=z['units'])
model.add_subsystem('des_vars', ivc, promotes=["*"])
comp = om.MetaModelStructuredComp(method='akima', extrapolate=True, vec_size=3)
for param in params:
comp.add_input(param['name'], np.array([param['default'], param['default'], param['default']]),
param['values'])
for out in outs:
comp.add_output(out['name'], np.array([out['default'], out['default'], out['default']]),
out['values'])
model.add_subsystem('comp', comp, promotes=["*"])
prob.setup(force_alloc_complex=True)
prob['x'] = np.array([1.0, 10.0, 90.0])
prob['y'] = np.array([0.75, 0.81, 1.2])
prob['z'] = np.array([-1.7, 1.1, 2.1])
prob.run_model()
partials = prob.check_partials(method='cs', out_stream=None)
# Derivs are large, so ignore atol.
assert_check_partials(partials, atol=1e10, rtol=1e-10)
def test_vectorized_cubic(self):
prob = om.Problem()
model = prob.model
ivc = om.IndepVarComp()
mapdata = SampleMap()
params = mapdata.param_data
x, y, _ = params
outs = mapdata.output_data
z = outs[0]
ivc.add_output('x', np.array([x['default'], x['default'], x['default']]),
units=x['units'])
ivc.add_output('y', np.array([y['default'], y['default'], y['default']]),
units=x['units'])
ivc.add_output('z', np.array([z['default'], z['default'], z['default']]),
units=x['units'])
model.add_subsystem('des_vars', ivc, promotes=["*"])
comp = om.MetaModelStructuredComp(method='cubic', extrapolate=True, vec_size=3)
for param in params:
comp.add_input(param['name'], np.array([param['default'], param['default'], param['default']]),
param['values'])
for out in outs:
comp.add_output(out['name'], np.array([out['default'], out['default'], out['default']]),
out['values'])
model.add_subsystem('comp', comp, promotes=["*"])
prob.setup(force_alloc_complex=True)
prob['x'] = np.array([1.0, 10.0, 90.0])
prob['y'] = np.array([0.75, 0.81, 1.2])
prob['z'] = np.array([-1.7, 1.1, 2.1])
prob.run_model()
partials = prob.check_partials(method='cs', out_stream=None)
# Derivs are large, so ignore atol.
assert_check_partials(partials, atol=1e10, rtol=1e-10)
def test_training_gradient_lagrange3(self):
model = om.Group()
ivc = om.IndepVarComp()
mapdata = SampleMap()
params = mapdata.param_data
outs = mapdata.output_data
ivc.add_output('x', np.array([-0.3, 0.7, 1.2]))
ivc.add_output('y', np.array([0.14, 0.313, 1.41]))
ivc.add_output('z', np.array([-2.11, -1.2, 2.01]))
ivc.add_output('f_train', outs[0]['values'])
ivc.add_output('g_train', outs[1]['values'])
comp = om.MetaModelStructuredComp(training_data_gradients=True,
method='lagrange3', vec_size=3)
for param in params:
comp.add_input(param['name'], param['default'], param['values'])
for out in outs:
comp.add_output(out['name'], out['default'], out['values'])
model.add_subsystem('ivc', ivc, promotes=["*"])
model.add_subsystem('comp',
comp,
promotes=["*"])
prob = om.Problem(model)
prob.setup()
prob.run_model()
self.run_and_check_derivs(prob)
def test_training_gradient_akima(self):
model = om.Group()
ivc = om.IndepVarComp()
mapdata = SampleMap()
params = mapdata.param_data
outs = mapdata.output_data
ivc.add_output('x', np.array([-0.3, 0.7, 1.2]))
ivc.add_output('y', np.array([0.14, 0.313, 1.41]))
ivc.add_output('z', np.array([-2.11, -1.2, 2.01]))
ivc.add_output('f_train', outs[0]['values'])
ivc.add_output('g_train', outs[1]['values'])
comp = om.MetaModelStructuredComp(training_data_gradients=True,
method='akima', vec_size=3)
for param in params:
comp.add_input(param['name'], param['default'], param['values'])
for out in outs:
comp.add_output(out['name'], out['default'], out['values'])
model.add_subsystem('ivc', ivc, promotes=["*"])
model.add_subsystem('comp',
comp,
promotes=["*"])
prob = om.Problem(model)
prob.setup(force_alloc_complex=True)
prob.run_model()
self.run_and_check_derivs(prob)
def test_training_gradient_akima_basic(self):
# Mimics usage as an order-reducing interpolating polynomial.
model = om.Group()
ivc = om.IndepVarComp()
mapdata = SampleMap()
params = mapdata.param_data
outs = mapdata.output_data
ivc.add_output('x', np.array([.33]))
ivc.add_output('f_train', np.array([.3, .7, .5, .6, .3, .4, .2]))
comp = om.MetaModelStructuredComp(training_data_gradients=True,
method='akima', vec_size=1)
comp.add_input('x', 0.0, np.array([.1, .2, .3, .4, .5, .6, .7]))
comp.add_output('f', 0.0, np.array([.3, .7, .5, .6, .3, .4, .2]))
model.add_subsystem('ivc', ivc, promotes=["*"])
model.add_subsystem('comp',
comp,
promotes=["*"])
prob = om.Problem(model)
prob.setup(force_alloc_complex=True)
prob.run_model()
self.run_and_check_derivs(prob)
@unittest.skipIf(OPT is None or OPTIMIZER is None, "only run if pyoptsparse is installed.")
def test_analysis_error_warning_msg(self):
x_tr = np.linspace(0, 2*np.pi, 100)
y_tr = np.sin(x_tr)
p = om.Problem(model=om.Group())
p.driver = om.pyOptSparseDriver(optimizer=OPTIMIZER)
mm = om.MetaModelStructuredComp(extrapolate=False)
mm.add_input('x', val=1.0, training_data=x_tr)
mm.add_output('y', val=1.0, training_data=y_tr)
p.model.add_subsystem('interp', mm, promotes_inputs=['x'], promotes_outputs=['y'])
p.model.add_objective('y', scaler=-1)
p.model.add_design_var('x', lower=6, upper=10)
p.set_solver_print(level=0)
p.setup()
p.set_val('x', 0.75)
msg = "Analysis Error: 'interp' <class MetaModelStructuredComp> " \
"Line 203 of file {}".format(inspect.getsourcefile(om.MetaModelStructuredComp))
with assert_warning(UserWarning, msg):
p.run_driver()
@unittest.skipIf(not scipy_gte_019, "only run if scipy>=0.19.")
class TestMetaModelStructuredCompFeature(unittest.TestCase):
@unittest.skipIf(not scipy_gte_019, "only run if scipy>=0.19.")
def test_xor(self):
import numpy as np
import openmdao.api as om
# Create regular grid interpolator instance
xor_interp = om.MetaModelStructuredComp(method='scipy_slinear')
# set up inputs and outputs
xor_interp.add_input('x', 0.0, training_data=np.array([0.0, 1.0]), units=None)
xor_interp.add_input('y', 1.0, training_data=np.array([0.0, 1.0]), units=None)
xor_interp.add_output('xor', 1.0, training_data=np.array([[0.0, 1.0], [1.0, 0.0]]), units=None)
# Set up the OpenMDAO model
model = om.Group()
model.add_subsystem('comp', xor_interp, promotes=["*"])
prob = om.Problem(model)
prob.setup()
prob.set_val('x', 0)
# Now test out a 'fuzzy' XOR
prob.set_val('x', 0.9)
prob.set_val('y', 0.001242)
prob.run_model()
computed = prob.get_val('xor')
actual = 0.8990064
assert_almost_equal(computed, actual)
# we can verify all gradients by checking against finite-difference
prob.check_partials(compact_print=True)
@unittest.skipIf(not scipy_gte_019, "only run if scipy>=0.19.")
def test_shape(self):
import numpy as np
import openmdao.api as om
# create input param training data, of sizes 25, 5, and 10 points resp.
p1 = np.linspace(0, 100, 25)
p2 = np.linspace(-10, 10, 5)
p3 = np.linspace(0, 1, 10)
# can use meshgrid to create a 3D array of test data
P1, P2, P3 = np.meshgrid(p1, p2, p3, indexing='ij')
f = np.sqrt(P1) + P2 * P3
# verify the shape matches the order and size of the input params
print(f.shape)
# Create regular grid interpolator instance
interp = om.MetaModelStructuredComp(method='scipy_cubic')
interp.add_input('p1', 0.5, training_data=p1)
interp.add_input('p2', 0.0, training_data=p2)
interp.add_input('p3', 3.14, training_data=p3)
interp.add_output('f', 0.0, training_data=f)
# Set up the OpenMDAO model
model = om.Group()
model.add_subsystem('comp', interp, promotes=["*"])
prob = om.Problem(model)
prob.setup()
# set inputs
prob.set_val('p1', 55.12)
prob.set_val('p2', -2.14)
prob.set_val('p3', 0.323)
prob.run_model()
computed = prob.get_val('f')
actual = 6.73306472
assert_almost_equal(computed, actual)
# we can verify all gradients by checking against finite-difference
prob.check_partials(compact_print=True)
@unittest.skipIf(not scipy_gte_019, "only run if scipy>=0.19.")
def test_vectorized(self):
import numpy as np
import openmdao.api as om
# create input param training data, of sizes 25, 5, and 10 points resp.
p1 = np.linspace(0, 100, 25)
p2 = np.linspace(-10, 10, 5)
p3 = np.linspace(0, 1, 10)
# can use meshgrid to create a 3D array of test data
P1, P2, P3 = np.meshgrid(p1, p2, p3, indexing='ij')
f = np.sqrt(P1) + P2 * P3
# Create regular grid interpolator instance
interp = om.MetaModelStructuredComp(method='scipy_cubic', vec_size=2)
interp.add_input('p1', 0.5, training_data=p1)
interp.add_input('p2', 0.0, training_data=p2)
interp.add_input('p3', 3.14, training_data=p3)
interp.add_output('f', 0.0, training_data=f)
# Set up the OpenMDAO model
model = om.Group()
model.add_subsystem('comp', interp, promotes=["*"])
prob = om.Problem(model)
prob.setup()
# set inputs
prob.set_val('p1', np.array([55.12, 12.0]))
prob.set_val('p2', np.array([-2.14, 3.5]))
prob.set_val('p3', np.array([0.323, 0.5]))
prob.run_model()
computed = prob['f']
actual = np.array([6.73306472, 5.2118645])
assert_almost_equal(computed, actual)
@unittest.skipIf(not scipy_gte_019, "only run if scipy>=0.19.")
def test_training_derivatives(self):
import numpy as np
import openmdao.api as om
# create input param training data, of sizes 25, 5, and 10 points resp.
p1 = np.linspace(0, 100, 25)
p2 = np.linspace(-10, 10, 5)
p3 = np.linspace(0, 1, 10)
# can use meshgrid to create a 3D array of test data
P1, P2, P3 = np.meshgrid(p1, p2, p3, indexing='ij')
f = np.sqrt(P1) + P2 * P3
# verify the shape matches the order and size of the input params
print(f.shape)
# Create regular grid interpolator instance
interp = om.MetaModelStructuredComp(method='scipy_cubic', training_data_gradients=True)
interp.add_input('p1', 0.5, p1)
interp.add_input('p2', 0.0, p2)
interp.add_input('p3', 3.14, p3)
interp.add_output('f', 0.0, f)
# Set up the OpenMDAO model
model = om.Group()
model.add_subsystem('comp', interp, promotes=["*"])
prob = om.Problem(model)
prob.setup()
# set inputs
prob.set_val('p1', 55.12)
prob.set_val('p2', -2.14)
prob.set_val('p3', 0.323)
prob.run_model()
computed = prob.get_val('f')
actual = 6.73306472
assert_almost_equal(computed, actual)
# we can verify all gradients by checking against finite-difference
prob.check_partials(compact_print=True)
def test_error_messages_scalar_only(self):
prob = om.Problem()
model = prob.model
comp = om.MetaModelStructuredComp(training_data_gradients=True,
method='slinear', vec_size=3)
with self.assertRaises(ValueError) as cm:
comp.add_input('x1', np.array([1.0, 2.0]))
msg = "MetaModelStructuredComp: Input x1 must either be scalar, or of length equal to vec_size."
self.assertEqual(str(cm.exception), msg)
with self.assertRaises(ValueError) as cm:
comp.add_input('x1', np.zeros((3, 3)))
self.assertEqual(str(cm.exception), msg)
with self.assertRaises(ValueError) as cm:
comp.add_output('x1', np.array([1.0, 2.0]))
msg = "MetaModelStructuredComp: Output x1 must either be scalar, or of length equal to vec_size."
self.assertEqual(str(cm.exception), msg)
with self.assertRaises(ValueError) as cm:
comp.add_output('x1', np.zeros((3, 3)))
self.assertEqual(str(cm.exception), msg)
if __name__ == "__main__":
unittest.main()
| openmdao/components/tests/test_meta_model_structured_comp.py | 54,074 | Tests the regular grid map component. specifically the analytic derivatives
vs. finite difference estimates.
Tests the regular grid map component. specifically the analytic derivatives
vs. finite difference estimates.
Runs check_partials and compares to analytic derivatives.
Runs check_partials and compares to analytic derivatives.
Unit tests for the structured metamodel component.
check that pyoptsparse is installed if it is, try to use SNOPT but fall back to SLSQP run at default pt test output values Bugfix test that we can add outputs before inputs. run at default pt Tests extrapolation. Need to make sure extrapolate is False for bounds to be checked intentionally set to be out of bounds The interpolating output name is given as a regexp because the exception could happen with f or g first. The order those are evaluated comes from the keys of dict so no guarantee on the order except for Python 3.6 ! Setup and run again Tests bug in error message where it doesn't give the correct node value. run at default pt test output values Bugfix test that we can add outputs before inputs. run at default pt Tests extrapolation. Derivs are large, so ignore atol. Derivs are large, so ignore atol. Derivs are large, so ignore atol. Derivs are large, so ignore atol. Mimics usage as an order-reducing interpolating polynomial. Create regular grid interpolator instance set up inputs and outputs Set up the OpenMDAO model Now test out a 'fuzzy' XOR we can verify all gradients by checking against finite-difference create input param training data, of sizes 25, 5, and 10 points resp. can use meshgrid to create a 3D array of test data verify the shape matches the order and size of the input params Create regular grid interpolator instance Set up the OpenMDAO model set inputs we can verify all gradients by checking against finite-difference create input param training data, of sizes 25, 5, and 10 points resp. can use meshgrid to create a 3D array of test data Create regular grid interpolator instance Set up the OpenMDAO model set inputs create input param training data, of sizes 25, 5, and 10 points resp. can use meshgrid to create a 3D array of test data verify the shape matches the order and size of the input params Create regular grid interpolator instance Set up the OpenMDAO model set inputs we can verify all gradients by checking against finite-difference | 2,384 | en | 0.753891 |
"""Collection of Jax network layers, wrapped to fit Ivy syntax and
signature.
"""
# global
import jax.numpy as jnp
import jax.lax as jlax
# local
from ivy.functional.backends.jax import JaxArray
def conv1d(
x: JaxArray,
filters: JaxArray,
strides: int,
padding: str,
data_format: str = "NWC",
dilations: int = 1,
) -> JaxArray:
strides = (strides,) if isinstance(strides, int) else strides
dilations = (dilations,) if isinstance(dilations, int) else dilations
return jlax.conv_general_dilated(
x, filters, strides, padding, None, dilations, (data_format, "WIO", data_format)
)
def conv1d_transpose(*_):
raise Exception("Convolutions not yet implemented for jax library")
def conv2d(x, filters, strides, padding, data_format="NHWC", dilations=1):
strides = [strides] * 2 if isinstance(strides, int) else strides
dilations = [dilations] * 2 if isinstance(dilations, int) else dilations
return jlax.conv_general_dilated(
x,
filters,
strides,
padding,
None,
dilations,
(data_format, "HWIO", data_format),
)
def depthwise_conv2d(*_):
raise Exception("Convolutions not yet implemented for jax library")
def conv2d_transpose(*_):
raise Exception("Convolutions not yet implemented for jax library")
def conv3d(*_):
raise Exception("Convolutions not yet implemented for jax library")
def conv3d_transpose(*_):
raise Exception("Convolutions not yet implemented for jax library")
| ivy/functional/backends/jax/layers.py | 1,525 | Collection of Jax network layers, wrapped to fit Ivy syntax and
signature.
global local | 89 | en | 0.608649 |
import numpy
import torch
import pytorch_pfn_extras as ppe
from torch.utils.data import Dataset
class TabularDataset(Dataset):
"""An abstract class that represents tabular dataset.
This class represents a tabular dataset.
In a tabular dataset, all examples have the same number of elements.
For example, all examples of the dataset below have three elements
(:obj:`a[i]`, :obj:`b[i]`, and :obj:`c[i]`).
.. csv-table::
:header: , a, b, c
0, :obj:`a[0]`, :obj:`b[0]`, :obj:`c[0]`
1, :obj:`a[1]`, :obj:`b[1]`, :obj:`c[1]`
2, :obj:`a[2]`, :obj:`b[2]`, :obj:`c[2]`
3, :obj:`a[3]`, :obj:`b[3]`, :obj:`c[3]`
Since an example can be represented by both tuple and dict (
:obj:`(a[i], b[i], c[i])` and :obj:`{'a': a[i], 'b': b[i], 'c': c[i]}`),
this class uses :attr:`mode` to indicate which representation will be used.
If there is only one column, an example also can be represented by a value
(:obj:`a[i]`). In this case, :attr:`mode` is :obj:`None`.
An inheritance should implement
:meth:`__len__`, :attr:`keys`, :attr:`mode` and :meth:`get_examples`.
>>> import numpy as np
>>>
>>> from pytorch_pfn_extras import dataset
>>>
>>> class MyDataset(dataset.TabularDataset):
...
... def __len__(self):
... return 4
...
... @property
... def keys(self):
... return ('a', 'b', 'c')
...
... @property
... def mode(self):
... return tuple
...
... def get_examples(self, indices, key_indices):
... data = np.arange(12).reshape((4, 3))
... if indices is not None:
... data = data[indices]
... if key_indices is not None:
... data = data[:, list(key_indices)]
... return tuple(data.transpose())
...
>>> dataset = MyDataset()
>>> len(dataset)
4
>>> dataset.keys
('a', 'b', 'c')
>>> dataset.astuple()[0]
(0, 1, 2)
>>> sorted(dataset.asdict()[0].items())
[('a', 0), ('b', 1), ('c', 2)]
>>>
>>> view = dataset.slice[[3, 2], ('c', 0)]
>>> len(view)
2
>>> view.keys
('c', 'a')
>>> view.astuple()[1]
(8, 6)
>>> sorted(view.asdict()[1].items())
[('a', 6), ('c', 8)]
"""
def __len__(self):
raise NotImplementedError
@property
def keys(self):
"""Names of columns.
A tuple of strings that indicate the names of columns.
"""
raise NotImplementedError
@property
def mode(self):
"""Mode of representation.
This indicates the type of value returned
by :meth:`fetch` and :meth:`__getitem__`.
:class:`tuple`, :class:`dict`, and :obj:`None` are supported.
"""
raise NotImplementedError
def get_examples(self, indices, key_indices):
"""Return a part of data.
Args:
indices (list of ints or slice): Indices of requested rows.
If this argument is :obj:`None`, it indicates all rows.
key_indices (tuple of ints): Indices of requested columns.
If this argument is :obj:`None`, it indicates all columns.
Returns:
tuple of lists/arrays
"""
raise NotImplementedError
@property
def slice(self):
"""Get a slice of dataset.
Args:
indices (list/array of ints/bools or slice): Requested rows.
keys (tuple of ints/strs or int or str): Requested columns.
Returns:
A view of specified range.
"""
return ppe.dataset.tabular._slice._SliceHelper(self)
def fetch(self):
"""Fetch data.
This method fetches all data of the dataset/view.
Note that this method returns a column-major data
(i.e. :obj:`([a[0], ..., a[3]], ..., [c[0], ... c[3]])`,
:obj:`{'a': [a[0], ..., a[3]], ..., 'c': [c[0], ..., c[3]]}`, or
:obj:`[a[0], ..., a[3]]`).
Returns:
If :attr:`mode` is :class:`tuple`,
this method returns a tuple of lists/arrays.
If :attr:`mode` is :class:`dict`,
this method returns a dict of lists/arrays.
"""
examples = self.get_examples(None, None)
if self.mode is tuple:
return examples
elif self.mode is dict:
return dict(zip(self.keys, examples))
elif self.mode is None:
return examples[0]
def convert(self, data):
"""Convert fetched data.
This method takes data fetched by :meth:`fetch` and
pre-process them before passing them to models.
The default behaviour is converting each column into an ndarray.
This behaviour can be overridden by :meth:`with_converter`.
If the dataset is constructed by :meth:`concat` or :meth:`join`,
the converter of the first dataset is used.
Args:
data (tuple or dict): Data from :meth:`fetch`.
Returns:
A tuple or dict.
Each value is an ndarray.
"""
if isinstance(data, tuple):
return tuple(_as_array(d) for d in data)
elif isinstance(data, dict):
return {k: _as_array(v) for k, v in data.items()}
else:
return _as_array(data)
def astuple(self):
"""Return a view with tuple mode.
Returns:
A view whose :attr:`mode` is :class:`tuple`.
"""
return ppe.dataset.tabular._asmode._Astuple(self)
def asdict(self):
"""Return a view with dict mode.
Returns:
A view whose :attr:`mode` is :class:`dict`.
"""
return ppe.dataset.tabular._asmode._Asdict(self)
def concat(self, *datasets):
"""Stack datasets along rows.
Args:
datasets (iterable of :class:`TabularDataset`):
Datasets to be concatenated.
All datasets must have the same :attr:`keys`.
Returns:
A concatenated dataset.
"""
return ppe.dataset.tabular._concat._Concat(
self, *datasets)
def join(self, *datasets):
"""Stack datasets along columns.
Args: datasets (iterable of :class:`TabularDataset`):
Datasets to be concatenated.
All datasets must have the same length
Returns:
A joined dataset.
"""
return ppe.dataset.tabular._join._Join(self, *datasets)
def transform(self, keys, transform):
"""Apply a transform to each example.
The transformations are a list where each element
is a tuple that holds the transformation signature and
a callable that is the transformation itself.
The transformation signature is a tuple of 2 elements with
the first one being the keys of the dataset that are taken
as inputs. And the last one the outputs it produces for the
transformation `keys` argument.
When multiple transformations are specified, the outputs
must be disjoint or `ValueError` will be risen.
Args:
keys (tuple of strs): The keys of transformed examples.
transform (list of tuples): A list where each element
specifies a transformation with a tuple with the
transformation signature and a callable that takes an example
and returns transformed example. :attr:`mode` of
transformed dataset is determined by the transformed
examples.
Returns:
A transfromed dataset.
"""
return ppe.dataset.tabular._transform._Transform(
self, keys, transform)
def transform_batch(self, keys, transform_batch):
"""Apply a transform to examples.
The transformations are a list where each element
is a tuple that holds the transformation signature and
a callable that is the transformation itself.
The transformation signature is a tuple of 2 elements with
the first one being the keys of the dataset that are taken
as inputs. And the last one the outputs it produces for the
transformation `keys` argument.
When multiple transformations are specified, the outputs
must be disjoint or `ValueError` will be risen.
Args:
keys (tuple of strs): The keys of transformed examples.
transform_batch (list of tuples): A list where each element
specifies a transformation with a tuple with the
transformation signature and a callable that takes a
batch of examples and returns a batch of transformed examples.
:attr:`mode` of transformed dataset is determined by
the transformed examples.
Returns:
A transfromed dataset.
"""
return ppe.dataset.tabular._transform._TransformBatch(
self, keys, transform_batch)
def with_converter(self, converter):
"""Override the behaviour of :meth:`convert`.
This method overrides :meth:`convert`.
Args:
converter (callable): A new converter.
Returns:
A dataset with the new converter.
"""
return ppe.dataset.tabular._with_converter._WithConverter(
self, converter)
def get_example(self, i):
example = self.get_examples([i], None)
example = tuple(col[0] for col in example)
if self.mode is tuple:
return example
elif self.mode is dict:
return dict(zip(self.keys, example))
elif self.mode is None:
return example[0]
def __iter__(self):
return (self.get_example(i) for i in range(len(self)))
def __getitem__(self, index):
"""Returns an example or a sequence of examples.
It implements the standard Python indexing and one-dimensional integer
array indexing. It uses the :meth:`get_example` method by default, but
it may be overridden by the implementation to, for example, improve the
slicing performance.
Args:
index (int, slice, list or numpy.ndarray): An index of an example
or indexes of examples.
Returns:
If index is int, returns an example created by `get_example`.
If index is either slice or one-dimensional list or numpy.ndarray,
returns a list of examples created by `get_example`.
"""
if isinstance(index, slice):
current, stop, step = index.indices(len(self))
return [self.get_example(i) for i in
range(current, stop, step)]
elif isinstance(index, list) or isinstance(index, numpy.ndarray):
return [self.get_example(i) for i in index]
else:
return self.get_example(index)
def _as_array(data):
if isinstance(data, (numpy.ndarray, torch.Tensor)):
return data
else:
return numpy.array(data)
| pytorch_pfn_extras/dataset/tabular/tabular_dataset.py | 11,149 | An abstract class that represents tabular dataset.
This class represents a tabular dataset.
In a tabular dataset, all examples have the same number of elements.
For example, all examples of the dataset below have three elements
(:obj:`a[i]`, :obj:`b[i]`, and :obj:`c[i]`).
.. csv-table::
:header: , a, b, c
0, :obj:`a[0]`, :obj:`b[0]`, :obj:`c[0]`
1, :obj:`a[1]`, :obj:`b[1]`, :obj:`c[1]`
2, :obj:`a[2]`, :obj:`b[2]`, :obj:`c[2]`
3, :obj:`a[3]`, :obj:`b[3]`, :obj:`c[3]`
Since an example can be represented by both tuple and dict (
:obj:`(a[i], b[i], c[i])` and :obj:`{'a': a[i], 'b': b[i], 'c': c[i]}`),
this class uses :attr:`mode` to indicate which representation will be used.
If there is only one column, an example also can be represented by a value
(:obj:`a[i]`). In this case, :attr:`mode` is :obj:`None`.
An inheritance should implement
:meth:`__len__`, :attr:`keys`, :attr:`mode` and :meth:`get_examples`.
>>> import numpy as np
>>>
>>> from pytorch_pfn_extras import dataset
>>>
>>> class MyDataset(dataset.TabularDataset):
...
... def __len__(self):
... return 4
...
... @property
... def keys(self):
... return ('a', 'b', 'c')
...
... @property
... def mode(self):
... return tuple
...
... def get_examples(self, indices, key_indices):
... data = np.arange(12).reshape((4, 3))
... if indices is not None:
... data = data[indices]
... if key_indices is not None:
... data = data[:, list(key_indices)]
... return tuple(data.transpose())
...
>>> dataset = MyDataset()
>>> len(dataset)
4
>>> dataset.keys
('a', 'b', 'c')
>>> dataset.astuple()[0]
(0, 1, 2)
>>> sorted(dataset.asdict()[0].items())
[('a', 0), ('b', 1), ('c', 2)]
>>>
>>> view = dataset.slice[[3, 2], ('c', 0)]
>>> len(view)
2
>>> view.keys
('c', 'a')
>>> view.astuple()[1]
(8, 6)
>>> sorted(view.asdict()[1].items())
[('a', 6), ('c', 8)]
Returns an example or a sequence of examples.
It implements the standard Python indexing and one-dimensional integer
array indexing. It uses the :meth:`get_example` method by default, but
it may be overridden by the implementation to, for example, improve the
slicing performance.
Args:
index (int, slice, list or numpy.ndarray): An index of an example
or indexes of examples.
Returns:
If index is int, returns an example created by `get_example`.
If index is either slice or one-dimensional list or numpy.ndarray,
returns a list of examples created by `get_example`.
Return a view with dict mode.
Returns:
A view whose :attr:`mode` is :class:`dict`.
Return a view with tuple mode.
Returns:
A view whose :attr:`mode` is :class:`tuple`.
Stack datasets along rows.
Args:
datasets (iterable of :class:`TabularDataset`):
Datasets to be concatenated.
All datasets must have the same :attr:`keys`.
Returns:
A concatenated dataset.
Convert fetched data.
This method takes data fetched by :meth:`fetch` and
pre-process them before passing them to models.
The default behaviour is converting each column into an ndarray.
This behaviour can be overridden by :meth:`with_converter`.
If the dataset is constructed by :meth:`concat` or :meth:`join`,
the converter of the first dataset is used.
Args:
data (tuple or dict): Data from :meth:`fetch`.
Returns:
A tuple or dict.
Each value is an ndarray.
Fetch data.
This method fetches all data of the dataset/view.
Note that this method returns a column-major data
(i.e. :obj:`([a[0], ..., a[3]], ..., [c[0], ... c[3]])`,
:obj:`{'a': [a[0], ..., a[3]], ..., 'c': [c[0], ..., c[3]]}`, or
:obj:`[a[0], ..., a[3]]`).
Returns:
If :attr:`mode` is :class:`tuple`,
this method returns a tuple of lists/arrays.
If :attr:`mode` is :class:`dict`,
this method returns a dict of lists/arrays.
Return a part of data.
Args:
indices (list of ints or slice): Indices of requested rows.
If this argument is :obj:`None`, it indicates all rows.
key_indices (tuple of ints): Indices of requested columns.
If this argument is :obj:`None`, it indicates all columns.
Returns:
tuple of lists/arrays
Stack datasets along columns.
Args: datasets (iterable of :class:`TabularDataset`):
Datasets to be concatenated.
All datasets must have the same length
Returns:
A joined dataset.
Names of columns.
A tuple of strings that indicate the names of columns.
Mode of representation.
This indicates the type of value returned
by :meth:`fetch` and :meth:`__getitem__`.
:class:`tuple`, :class:`dict`, and :obj:`None` are supported.
Get a slice of dataset.
Args:
indices (list/array of ints/bools or slice): Requested rows.
keys (tuple of ints/strs or int or str): Requested columns.
Returns:
A view of specified range.
Apply a transform to each example.
The transformations are a list where each element
is a tuple that holds the transformation signature and
a callable that is the transformation itself.
The transformation signature is a tuple of 2 elements with
the first one being the keys of the dataset that are taken
as inputs. And the last one the outputs it produces for the
transformation `keys` argument.
When multiple transformations are specified, the outputs
must be disjoint or `ValueError` will be risen.
Args:
keys (tuple of strs): The keys of transformed examples.
transform (list of tuples): A list where each element
specifies a transformation with a tuple with the
transformation signature and a callable that takes an example
and returns transformed example. :attr:`mode` of
transformed dataset is determined by the transformed
examples.
Returns:
A transfromed dataset.
Apply a transform to examples.
The transformations are a list where each element
is a tuple that holds the transformation signature and
a callable that is the transformation itself.
The transformation signature is a tuple of 2 elements with
the first one being the keys of the dataset that are taken
as inputs. And the last one the outputs it produces for the
transformation `keys` argument.
When multiple transformations are specified, the outputs
must be disjoint or `ValueError` will be risen.
Args:
keys (tuple of strs): The keys of transformed examples.
transform_batch (list of tuples): A list where each element
specifies a transformation with a tuple with the
transformation signature and a callable that takes a
batch of examples and returns a batch of transformed examples.
:attr:`mode` of transformed dataset is determined by
the transformed examples.
Returns:
A transfromed dataset.
Override the behaviour of :meth:`convert`.
This method overrides :meth:`convert`.
Args:
converter (callable): A new converter.
Returns:
A dataset with the new converter. | 6,886 | en | 0.695728 |
# All Rights Reserved.
#
# Licensed under the Apache License, Version 2.0 (the "License"); you may
# not use this file except in compliance with the License. You may obtain
# a copy of the License at
#
# http://www.apache.org/licenses/LICENSE-2.0
#
# Unless required by applicable law or agreed to in writing, software
# distributed under the License is distributed on an "AS IS" BASIS, WITHOUT
# WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the
# License for the specific language governing permissions and limitations
# under the License.
"""Tests for Serial Console."""
import socket
import mock
import six.moves
from nova.console import serial
from nova import exception
from nova import test
class SerialTestCase(test.NoDBTestCase):
def setUp(self):
super(SerialTestCase, self).setUp()
serial.ALLOCATED_PORTS = set()
def test_get_port_range(self):
start, stop = serial._get_port_range()
self.assertEqual(10000, start)
self.assertEqual(20000, stop)
def test_get_port_range_customized(self):
self.flags(port_range='30000:40000', group='serial_console')
start, stop = serial._get_port_range()
self.assertEqual(30000, start)
self.assertEqual(40000, stop)
def test_get_port_range_bad_range(self):
self.flags(port_range='40000:30000', group='serial_console')
start, stop = serial._get_port_range()
self.assertEqual(10000, start)
self.assertEqual(20000, stop)
def test_get_port_range_not_numeric(self):
self.flags(port_range='xxx:yyy', group='serial_console')
start, stop = serial._get_port_range()
self.assertEqual(10000, start)
self.assertEqual(20000, stop)
def test_get_port_range_invalid_syntax(self):
self.flags(port_range='10:20:30', group='serial_console')
start, stop = serial._get_port_range()
self.assertEqual(10000, start)
self.assertEqual(20000, stop)
@mock.patch('socket.socket')
def test_verify_port(self, fake_socket):
s = mock.MagicMock()
fake_socket.return_value = s
serial._verify_port('127.0.0.1', 10)
s.bind.assert_called_once_with(('127.0.0.1', 10))
@mock.patch('socket.socket')
def test_verify_port_in_use(self, fake_socket):
s = mock.MagicMock()
s.bind.side_effect = socket.error()
fake_socket.return_value = s
self.assertRaises(
exception.SocketPortInUseException,
serial._verify_port, '127.0.0.1', 10)
s.bind.assert_called_once_with(('127.0.0.1', 10))
@mock.patch('nova.console.serial._verify_port', lambda x, y: None)
def test_acquire_port(self):
start, stop = 15, 20
self.flags(
port_range='%d:%d' % (start, stop),
group='serial_console')
for port in six.moves.range(start, stop):
self.assertEqual(port, serial.acquire_port('127.0.0.1'))
for port in six.moves.range(start, stop):
self.assertEqual(port, serial.acquire_port('127.0.0.2'))
self.assertTrue(10, len(serial.ALLOCATED_PORTS))
@mock.patch('nova.console.serial._verify_port')
def test_acquire_port_in_use(self, fake_verify_port):
def port_10000_already_used(host, port):
if port == 10000 and host == '127.0.0.1':
raise exception.SocketPortInUseException(
port=port,
host=host,
error="already in use")
fake_verify_port.side_effect = port_10000_already_used
self.assertEqual(10001, serial.acquire_port('127.0.0.1'))
self.assertEqual(10000, serial.acquire_port('127.0.0.2'))
self.assertNotIn(('127.0.0.1', 10000), serial.ALLOCATED_PORTS)
self.assertIn(('127.0.0.1', 10001), serial.ALLOCATED_PORTS)
self.assertIn(('127.0.0.2', 10000), serial.ALLOCATED_PORTS)
@mock.patch('nova.console.serial._verify_port')
def test_acquire_port_not_ble_to_bind_at_any_port(self, fake_verify_port):
start, stop = 15, 20
self.flags(
port_range='%d:%d' % (start, stop),
group='serial_console')
fake_verify_port.side_effect = (
exception.SocketPortRangeExhaustedException(host='127.0.0.1'))
self.assertRaises(
exception.SocketPortRangeExhaustedException,
serial.acquire_port, '127.0.0.1')
def test_release_port(self):
serial.ALLOCATED_PORTS.add(('127.0.0.1', 100))
serial.ALLOCATED_PORTS.add(('127.0.0.2', 100))
self.assertEqual(2, len(serial.ALLOCATED_PORTS))
serial.release_port('127.0.0.1', 100)
self.assertEqual(1, len(serial.ALLOCATED_PORTS))
serial.release_port('127.0.0.2', 100)
self.assertEqual(0, len(serial.ALLOCATED_PORTS))
| nova/tests/unit/console/test_serial.py | 4,892 | Tests for Serial Console.
All Rights Reserved. Licensed under the Apache License, Version 2.0 (the "License"); you may not use this file except in compliance with the License. You may obtain a copy of the License at http://www.apache.org/licenses/LICENSE-2.0 Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the specific language governing permissions and limitations under the License. | 598 | en | 0.874696 |
# Copyright 2018-2021 Streamlit Inc.
#
# Licensed under the Apache License, Version 2.0 (the "License");
# you may not use this file except in compliance with the License.
# You may obtain a copy of the License at
#
# http://www.apache.org/licenses/LICENSE-2.0
#
# Unless required by applicable law or agreed to in writing, software
# distributed under the License is distributed on an "AS IS" BASIS,
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
# See the License for the specific language governing permissions and
# limitations under the License.
import os
import signal
import sys
from typing import Any, Dict
import click
import tornado.ioloop
from streamlit.git_util import GitRepo, MIN_GIT_VERSION
from streamlit import version
from streamlit import config
from streamlit import net_util
from streamlit import url_util
from streamlit import env_util
from streamlit import secrets
from streamlit import util
from streamlit.config import CONFIG_FILENAMES
from streamlit.logger import get_logger
from streamlit.report import Report
from streamlit.secrets import SECRETS_FILE_LOC
from streamlit.server.server import Server, server_address_is_unix_socket
from streamlit.watcher.file_watcher import watch_file
from streamlit.watcher.file_watcher import report_watchdog_availability
LOGGER = get_logger(__name__)
# Wait for 1 second before opening a browser. This gives old tabs a chance to
# reconnect.
# This must be >= 2 * WebSocketConnection.ts#RECONNECT_WAIT_TIME_MS.
BROWSER_WAIT_TIMEOUT_SEC = 1
NEW_VERSION_TEXT = """
%(new_version)s
See what's new at https://discuss.streamlit.io/c/announcements
Enter the following command to upgrade:
%(prompt)s %(command)s
""" % {
"new_version": click.style(
"A new version of Streamlit is available.", fg="blue", bold=True
),
"prompt": click.style("$", fg="blue"),
"command": click.style("pip install streamlit --upgrade", bold=True),
}
def _set_up_signal_handler():
LOGGER.debug("Setting up signal handler")
def signal_handler(signal_number, stack_frame):
# The server will shut down its threads and stop the ioloop
Server.get_current().stop()
signal.signal(signal.SIGTERM, signal_handler)
signal.signal(signal.SIGINT, signal_handler)
if sys.platform == "win32":
signal.signal(signal.SIGBREAK, signal_handler)
else:
signal.signal(signal.SIGQUIT, signal_handler)
def _fix_sys_path(script_path):
"""Add the script's folder to the sys path.
Python normally does this automatically, but since we exec the script
ourselves we need to do it instead.
"""
sys.path.insert(0, os.path.dirname(script_path))
def _fix_matplotlib_crash():
"""Set Matplotlib backend to avoid a crash.
The default Matplotlib backend crashes Python on OSX when run on a thread
that's not the main thread, so here we set a safer backend as a fix.
Users can always disable this behavior by setting the config
runner.fixMatplotlib = false.
This fix is OS-independent. We didn't see a good reason to make this
Mac-only. Consistency within Streamlit seemed more important.
"""
if config.get_option("runner.fixMatplotlib"):
try:
# TODO: a better option may be to set
# os.environ["MPLBACKEND"] = "Agg". We'd need to do this towards
# the top of __init__.py, before importing anything that imports
# pandas (which imports matplotlib). Alternately, we could set
# this environment variable in a new entrypoint defined in
# setup.py. Both of these introduce additional trickiness: they
# need to run without consulting streamlit.config.get_option,
# because this would import streamlit, and therefore matplotlib.
import matplotlib
matplotlib.use("Agg")
except ImportError:
pass
def _fix_tornado_crash():
"""Set default asyncio policy to be compatible with Tornado 6.
Tornado 6 (at least) is not compatible with the default
asyncio implementation on Windows. So here we
pick the older SelectorEventLoopPolicy when the OS is Windows
if the known-incompatible default policy is in use.
This has to happen as early as possible to make it a low priority and
overrideable
See: https://github.com/tornadoweb/tornado/issues/2608
FIXME: if/when tornado supports the defaults in asyncio,
remove and bump tornado requirement for py38
"""
if env_util.IS_WINDOWS and sys.version_info >= (3, 8):
import asyncio
try:
from asyncio import ( # type: ignore[attr-defined]
WindowsProactorEventLoopPolicy,
WindowsSelectorEventLoopPolicy,
)
except ImportError:
pass
# Not affected
else:
if type(asyncio.get_event_loop_policy()) is WindowsProactorEventLoopPolicy:
# WindowsProactorEventLoopPolicy is not compatible with
# Tornado 6 fallback to the pre-3.8 default of Selector
asyncio.set_event_loop_policy(WindowsSelectorEventLoopPolicy())
def _fix_sys_argv(script_path, args):
"""sys.argv needs to exclude streamlit arguments and parameters
and be set to what a user's script may expect.
"""
import sys
sys.argv = [script_path] + list(args)
def _on_server_start(server):
_maybe_print_old_git_warning(server.script_path)
_print_url(server.is_running_hello)
report_watchdog_availability()
_print_new_version_message()
# Load secrets.toml if it exists. If the file doesn't exist, this
# function will return without raising an exception. We catch any parse
# errors and display them here.
try:
secrets.load_if_toml_exists()
except BaseException as e:
LOGGER.error(f"Failed to load {SECRETS_FILE_LOC}", exc_info=e)
def maybe_open_browser():
if config.get_option("server.headless"):
# Don't open browser when in headless mode.
return
if server.browser_is_connected:
# Don't auto-open browser if there's already a browser connected.
# This can happen if there's an old tab repeatedly trying to
# connect, and it happens to success before we launch the browser.
return
if config.is_manually_set("browser.serverAddress"):
addr = config.get_option("browser.serverAddress")
elif config.is_manually_set("server.address"):
if server_address_is_unix_socket():
# Don't open browser when server address is an unix socket
return
addr = config.get_option("server.address")
else:
addr = "localhost"
util.open_browser(Report.get_url(addr))
# Schedule the browser to open using the IO Loop on the main thread, but
# only if no other browser connects within 1s.
ioloop = tornado.ioloop.IOLoop.current()
ioloop.call_later(BROWSER_WAIT_TIMEOUT_SEC, maybe_open_browser)
def _fix_pydeck_mapbox_api_warning():
"""Sets MAPBOX_API_KEY environment variable needed for PyDeck otherwise it will throw an exception"""
os.environ["MAPBOX_API_KEY"] = config.get_option("mapbox.token")
def _print_new_version_message():
if version.should_show_new_version_notice():
click.secho(NEW_VERSION_TEXT)
def _print_url(is_running_hello):
if is_running_hello:
title_message = "Welcome to Streamlit. Check out our demo in your browser."
else:
title_message = "You can now view your Streamlit app in your browser."
named_urls = []
if config.is_manually_set("browser.serverAddress"):
named_urls = [
("URL", Report.get_url(config.get_option("browser.serverAddress")))
]
elif (
config.is_manually_set("server.address") and not server_address_is_unix_socket()
):
named_urls = [
("URL", Report.get_url(config.get_option("server.address"))),
]
elif config.get_option("server.headless"):
internal_ip = net_util.get_internal_ip()
if internal_ip:
named_urls.append(("Network URL", Report.get_url(internal_ip)))
external_ip = net_util.get_external_ip()
if external_ip:
named_urls.append(("External URL", Report.get_url(external_ip)))
else:
named_urls = [
("Local URL", Report.get_url("localhost")),
]
internal_ip = net_util.get_internal_ip()
if internal_ip:
named_urls.append(("Network URL", Report.get_url(internal_ip)))
click.secho("")
click.secho(" %s" % title_message, fg="blue", bold=True)
click.secho("")
for url_name, url in named_urls:
url_util.print_url(url_name, url)
click.secho("")
if is_running_hello:
click.secho(" Ready to create your own Python apps super quickly?")
click.secho(" Head over to ", nl=False)
click.secho("https://docs.streamlit.io", bold=True)
click.secho("")
click.secho(" May you create awesome apps!")
click.secho("")
click.secho("")
def _maybe_print_old_git_warning(script_path: str) -> None:
"""If our script is running in a Git repo, and we're running a very old
Git version, print a warning that Git integration will be unavailable.
"""
repo = GitRepo(script_path)
if (
not repo.is_valid()
and repo.git_version is not None
and repo.git_version < MIN_GIT_VERSION
):
git_version_string = ".".join(str(val) for val in repo.git_version)
min_version_string = ".".join(str(val) for val in MIN_GIT_VERSION)
click.secho("")
click.secho(" Git integration is disabled.", fg="yellow", bold=True)
click.secho("")
click.secho(
f" Streamlit requires Git {min_version_string} or later, "
f"but you have {git_version_string}.",
fg="yellow",
)
click.secho(
" Git is used by Streamlit Sharing (https://streamlit.io/sharing).",
fg="yellow",
)
click.secho(" To enable this feature, please update Git.", fg="yellow")
def load_config_options(flag_options: Dict[str, Any]):
"""Load config options from config.toml files, then overlay the ones set by
flag_options.
The "streamlit run" command supports passing Streamlit's config options
as flags. This function reads through the config options set via flag,
massages them, and passes them to get_config_options() so that they
overwrite config option defaults and those loaded from config.toml files.
Parameters
----------
flag_options : Dict[str, Any]
A dict of config options where the keys are the CLI flag version of the
config option names.
"""
options_from_flags = {
name.replace("_", "."): val
for name, val in flag_options.items()
if val is not None
}
# Force a reparse of config files (if they exist). The result is cached
# for future calls.
config.get_config_options(force_reparse=True, options_from_flags=options_from_flags)
def _install_config_watchers(flag_options: Dict[str, Any]):
def on_config_changed(_path):
load_config_options(flag_options)
for filename in CONFIG_FILENAMES:
if os.path.exists(filename):
watch_file(filename, on_config_changed)
def run(script_path, command_line, args, flag_options):
"""Run a script in a separate thread and start a server for the app.
This starts a blocking ioloop.
Parameters
----------
script_path : str
command_line : str
args : [str]
flag_options : Dict[str, Any]
"""
_fix_sys_path(script_path)
_fix_matplotlib_crash()
_fix_tornado_crash()
_fix_sys_argv(script_path, args)
_fix_pydeck_mapbox_api_warning()
_install_config_watchers(flag_options)
# Install a signal handler that will shut down the ioloop
# and close all our threads
_set_up_signal_handler()
ioloop = tornado.ioloop.IOLoop.current()
# Create and start the server.
server = Server(ioloop, script_path, command_line)
server.start(_on_server_start)
# (Must come after start(), because this starts a new thread and start()
# may call sys.exit() which doesn't kill other threads.
server.add_preheated_report_session()
# Start the ioloop. This function will not return until the
# server is shut down.
ioloop.start()
| notebook/lib/python3.9/site-packages/streamlit/bootstrap.py | 12,616 | Set Matplotlib backend to avoid a crash.
The default Matplotlib backend crashes Python on OSX when run on a thread
that's not the main thread, so here we set a safer backend as a fix.
Users can always disable this behavior by setting the config
runner.fixMatplotlib = false.
This fix is OS-independent. We didn't see a good reason to make this
Mac-only. Consistency within Streamlit seemed more important.
Sets MAPBOX_API_KEY environment variable needed for PyDeck otherwise it will throw an exception
sys.argv needs to exclude streamlit arguments and parameters
and be set to what a user's script may expect.
Add the script's folder to the sys path.
Python normally does this automatically, but since we exec the script
ourselves we need to do it instead.
Set default asyncio policy to be compatible with Tornado 6.
Tornado 6 (at least) is not compatible with the default
asyncio implementation on Windows. So here we
pick the older SelectorEventLoopPolicy when the OS is Windows
if the known-incompatible default policy is in use.
This has to happen as early as possible to make it a low priority and
overrideable
See: https://github.com/tornadoweb/tornado/issues/2608
FIXME: if/when tornado supports the defaults in asyncio,
remove and bump tornado requirement for py38
If our script is running in a Git repo, and we're running a very old
Git version, print a warning that Git integration will be unavailable.
Load config options from config.toml files, then overlay the ones set by
flag_options.
The "streamlit run" command supports passing Streamlit's config options
as flags. This function reads through the config options set via flag,
massages them, and passes them to get_config_options() so that they
overwrite config option defaults and those loaded from config.toml files.
Parameters
----------
flag_options : Dict[str, Any]
A dict of config options where the keys are the CLI flag version of the
config option names.
Run a script in a separate thread and start a server for the app.
This starts a blocking ioloop.
Parameters
----------
script_path : str
command_line : str
args : [str]
flag_options : Dict[str, Any]
Copyright 2018-2021 Streamlit Inc. Licensed under the Apache License, Version 2.0 (the "License"); you may not use this file except in compliance with the License. You may obtain a copy of the License at http://www.apache.org/licenses/LICENSE-2.0 Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the specific language governing permissions and limitations under the License. Wait for 1 second before opening a browser. This gives old tabs a chance to reconnect. This must be >= 2 * WebSocketConnection.tsRECONNECT_WAIT_TIME_MS. The server will shut down its threads and stop the ioloop TODO: a better option may be to set os.environ["MPLBACKEND"] = "Agg". We'd need to do this towards the top of __init__.py, before importing anything that imports pandas (which imports matplotlib). Alternately, we could set this environment variable in a new entrypoint defined in setup.py. Both of these introduce additional trickiness: they need to run without consulting streamlit.config.get_option, because this would import streamlit, and therefore matplotlib. type: ignore[attr-defined] Not affected WindowsProactorEventLoopPolicy is not compatible with Tornado 6 fallback to the pre-3.8 default of Selector Load secrets.toml if it exists. If the file doesn't exist, this function will return without raising an exception. We catch any parse errors and display them here. Don't open browser when in headless mode. Don't auto-open browser if there's already a browser connected. This can happen if there's an old tab repeatedly trying to connect, and it happens to success before we launch the browser. Don't open browser when server address is an unix socket Schedule the browser to open using the IO Loop on the main thread, but only if no other browser connects within 1s. Force a reparse of config files (if they exist). The result is cached for future calls. Install a signal handler that will shut down the ioloop and close all our threads Create and start the server. (Must come after start(), because this starts a new thread and start() may call sys.exit() which doesn't kill other threads. Start the ioloop. This function will not return until the server is shut down. | 4,506 | en | 0.82448 |
{
'repo_type' : 'archive',
'download_locations' : [
#UPDATECHECKS: http://fftw.org/download.html
#{ "url" : "http://fftw.org/fftw-3.3.9.tar.gz", "hashes" : [ { "type" : "sha256", "sum" : "bf2c7ce40b04ae811af714deb512510cc2c17b9ab9d6ddcf49fe4487eea7af3d" }, ], },
#{ "url" : "https://fossies.org/linux/misc/fftw-3.3.9.tar.gz", "hashes" : [ { "type" : "sha256", "sum" : "bf2c7ce40b04ae811af714deb512510cc2c17b9ab9d6ddcf49fe4487eea7af3d" }, ], },
{ "url" : "http://fftw.org/fftw-3.3.10.tar.gz", "hashes" : [ { "type" : "sha256", "sum" : "56c932549852cddcfafdab3820b0200c7742675be92179e59e6215b340e26467" }, ], },
{ "url" : "https://fossies.org/linux/misc/fftw-3.3.10.tar.gz", "hashes" : [ { "type" : "sha256", "sum" : "56c932549852cddcfafdab3820b0200c7742675be92179e59e6215b340e26467" }, ], },
],
'rename_folder' : 'fftw3_dll_double',
'configure_options': '--host={target_host} --prefix={output_prefix}/fftw3_dll --exec-prefix={output_prefix}/fftw3_dll '
'--enable-shared --disable-static '
'--disable-silent-rules --disable-doc '
'--disable-alloca --with-our-malloc --with-windows-f77-mangling '
'--enable-threads --with-combined-threads '
'--disable-float --disable-long-double -disable-quad-precision ' # 2019.12.13 the default is "DOUBLE"
'--enable-sse2 --enable-avx --enable-avx2 --disable-altivec --disable-vsx --disable-neon ' # 2019.12.13 removed --enable-sse as SSE only builds with "FLOAT/SINGLE"
,
'regex_replace': {
'post_patch': [
{
0: r'fftw\${{PREC_SUFFIX}}\.pc',
1: r'fftw3${{PREC_SUFFIX}}.pc',
'in_file': './CMakeLists.txt'
},
],
},
'run_post_install' : (
'ls -alR {output_prefix}/fftw3_dll/bin',
),
'update_check' : { 'url' : 'ftp://ftp.fftw.org/pub/fftw/', 'type' : 'ftpindex', 'regex' : r'fftw-(?P<version_num>[\d.]+)\.tar\.gz' },
'_info' : { 'version' : '3.3.10', 'fancy_name' : 'fftw3_dll_double' },
} | packages/dependencies/fftw3_dll_double.py | 2,022 | UPDATECHECKS: http://fftw.org/download.html{ "url" : "http://fftw.org/fftw-3.3.9.tar.gz", "hashes" : [ { "type" : "sha256", "sum" : "bf2c7ce40b04ae811af714deb512510cc2c17b9ab9d6ddcf49fe4487eea7af3d" }, ], },{ "url" : "https://fossies.org/linux/misc/fftw-3.3.9.tar.gz", "hashes" : [ { "type" : "sha256", "sum" : "bf2c7ce40b04ae811af714deb512510cc2c17b9ab9d6ddcf49fe4487eea7af3d" }, ], }, 2019.12.13 the default is "DOUBLE" 2019.12.13 removed --enable-sse as SSE only builds with "FLOAT/SINGLE" | 492 | en | 0.504637 |
from django.shortcuts import render
# Create your views here.
from django.http import HttpResponse
def index(request):
category_list = Category.objects.order_by('-name')[:5]
#category_list = Category.objects().order_by('-name')
context = {'categories': category_list} # Aquí van la las variables para la plantilla
return render(request,'index.html', context)
| rango/views.py | 382 | Create your views here.category_list = Category.objects().order_by('-name') Aquí van la las variables para la plantilla | 119 | es | 0.411851 |
import numpy as np
from LoopStructural.utils import getLogger
logger = getLogger(__name__)
def gradients(vals, func, releps=1e-3, abseps=None, mineps=1e-9, reltol=1,
epsscale=0.5):
"""
Calculate the partial derivatives of a function at a set of values. The
derivatives are calculated using the central difference, using an iterative
method to check that the values converge as step size decreases.
Parameters
----------
vals: array_like
A set of values, that are passed to a function, at which to calculate
the gradient of that function
func:
A function that takes in an array of values.
releps: float, array_like, 1e-3
The initial relative step size for calculating the derivative.
abseps: float, array_like, None
The initial absolute step size for calculating the derivative.
This overrides `releps` if set.
`releps` is set then that is used.
mineps: float, 1e-9
The minimum relative step size at which to stop iterations if no
convergence is achieved.
epsscale: float, 0.5
The factor by which releps if scaled in each iteration.
Returns
-------
grads: array_like
An array of gradients for each non-fixed value.
"""
grads = np.zeros(len(vals))
# maximum number of times the gradient can change sign
flipflopmax = 10.
# set steps
if abseps is None:
if isinstance(releps, float):
eps = np.abs(vals) * releps
eps[eps == 0.] = releps # if any values are zero set eps to releps
teps = releps * np.ones(len(vals))
elif isinstance(releps, (list, np.ndarray)):
if len(releps) != len(vals):
raise ValueError("Problem with input relative step sizes")
eps = np.multiply(np.abs(vals), releps)
eps[eps == 0.] = np.array(releps)[eps == 0.]
teps = releps
else:
raise RuntimeError("Relative step sizes are not a recognised type!")
else:
if isinstance(abseps, float):
eps = abseps * np.ones(len(vals))
elif isinstance(abseps, (list, np.ndarray)):
if len(abseps) != len(vals):
raise ValueError("Problem with input absolute step sizes")
eps = np.array(abseps)
else:
raise RuntimeError("Absolute step sizes are not a recognised type!")
teps = eps
# for each value in vals calculate the gradient
count = 0
for i in range(len(vals)):
# initial parameter diffs
leps = eps[i]
cureps = teps[i]
flipflop = 0
# get central finite difference
fvals = np.copy(vals)
bvals = np.copy(vals)
# central difference
fvals[i] += 0.5 * leps # change forwards distance to half eps
bvals[i] -= 0.5 * leps # change backwards distance to half eps
cdiff = (func(fvals) - func(bvals)) / leps
while 1:
fvals[i] -= 0.5 * leps # remove old step
bvals[i] += 0.5 * leps
# change the difference by a factor of two
cureps *= epsscale
if cureps < mineps or flipflop > flipflopmax:
# if no convergence set flat derivative (TODO: check if there is a better thing to do instead)
logger.warn("Derivative calculation did not converge: setting flat derivative.")
grads[count] = 0.
break
leps *= epsscale
# central difference
fvals[i] += 0.5 * leps # change forwards distance to half eps
bvals[i] -= 0.5 * leps # change backwards distance to half eps
cdiffnew = (func(fvals) - func(bvals)) / leps
if cdiffnew == cdiff:
grads[count] = cdiff
break
# check whether previous diff and current diff are the same within reltol
rat = (cdiff / cdiffnew)
if np.isfinite(rat) and rat > 0.:
# gradient has not changed sign
if np.abs(1. - rat) < reltol:
grads[count] = cdiffnew
break
else:
cdiff = cdiffnew
continue
else:
cdiff = cdiffnew
flipflop += 1
continue
count += 1
return grads | LoopStructural/probability/_gradient_calculator.py | 4,432 | Calculate the partial derivatives of a function at a set of values. The
derivatives are calculated using the central difference, using an iterative
method to check that the values converge as step size decreases.
Parameters
----------
vals: array_like
A set of values, that are passed to a function, at which to calculate
the gradient of that function
func:
A function that takes in an array of values.
releps: float, array_like, 1e-3
The initial relative step size for calculating the derivative.
abseps: float, array_like, None
The initial absolute step size for calculating the derivative.
This overrides `releps` if set.
`releps` is set then that is used.
mineps: float, 1e-9
The minimum relative step size at which to stop iterations if no
convergence is achieved.
epsscale: float, 0.5
The factor by which releps if scaled in each iteration.
Returns
-------
grads: array_like
An array of gradients for each non-fixed value.
maximum number of times the gradient can change sign set steps if any values are zero set eps to releps for each value in vals calculate the gradient initial parameter diffs get central finite difference central difference change forwards distance to half eps change backwards distance to half eps remove old step change the difference by a factor of two if no convergence set flat derivative (TODO: check if there is a better thing to do instead) central difference change forwards distance to half eps change backwards distance to half eps check whether previous diff and current diff are the same within reltol gradient has not changed sign | 1,620 | en | 0.811213 |
'''
@author: xiayuanhuang
'''
import csv
import matchECtoDemog
import decisionTreeV7
import family_treeV4
import inference
import combine_new_ped
def combine(addressFile, nameFile, demoFile, accountFile, outputFile, patientFile, ecFile, familyTreeOutput):
reader_add = csv.reader(open(addressFile, 'r'), delimiter = ',')
h_add = next(reader_add)
exp_header_add = ['study_id', 'street_1', 'street_2', 'city', 'state', 'zip', 'from_year', 'thru_year']
if not h_add == exp_header_add:
raise Exception("Address file (%s) doesn't have the header expected: %s" % (addressFile, exp_header_add))
reader_name = csv.reader(open(nameFile, 'r'), delimiter = ',')
h_name = next(reader_name)
exp_header_name = ['study_id', 'last_name_id', 'first_name_id', 'middle_name_id', 'from_year', 'thru_year']
if not h_name == exp_header_name:
raise Exception("Name file (%s) doesn't have the header expected: %s" % (nameFile, exp_header_name))
reader_demo = csv.reader(open(demoFile, 'r'), delimiter = ',')
h_demo = next(reader_demo)
exp_header_demo = ['study_id', 'GENDER_CODE', 'birth_year', 'deceased_year', 'PHONE_NUM_id', 'from_year', 'thru_year']
if not h_demo == exp_header_demo:
raise Exception("Demographic data file (%s) doesn't have the header expected: %s" % (demoFile, exp_header_demo))
reader_acc = csv.reader(open(accountFile, 'r'), delimiter = ',')
h_acc = next(reader_acc)
exp_header_acc = ['study_id', 'ACCT_NUM_id', 'from_year', 'thru_year']
if not h_acc == exp_header_acc:
raise Exception("Account file (%s) doesn't have the header expected: %s" % (accountFile, exp_header_acc))
reader_p = csv.reader(open(patientFile, 'r'), delimiter = ',')
h_p = next(reader_p)
exp_header_p = ['PatientID', 'FirstName', 'LastName', 'Sex', 'PhoneNumber', 'Zipcode', 'birth_year', 'deceased_year']
if not h_p == exp_header_p:
raise Exception("Patient data file (%s) doesn't have the header expected: %s" % (patientFile, exp_header_p))
reader_ec = csv.reader(open(ecFile, 'r'), delimiter = ',')
h_ec = next(reader_ec)
exp_header_ec = ['PatientID', 'EC_FirstName', 'EC_LastName', 'EC_PhoneNumber', 'EC_Zipcode', 'EC_Relationship']
if not h_ec == exp_header_ec:
raise Exception("Emergency contact data file (%s) doesn't have the header expected: %s" % (ecFile, exp_header_ec))
args = input("Enter one PED file if any:")
if args != '':
ped = args.strip().split(' ')[0]
reader_ped = csv.reader(open(ped, 'r'), delimiter = ',')
h_ped = next(reader_ped)
exp_header_ped = ['familyID', 'family_member', 'study_ID', 'StudyID_MATERNAL', 'StudyID_PATERNAL', 'Sex']
if not h_ped == exp_header_ped:
raise Exception("PED data file (%s) doesn't have the header expected: %s" % (ped, exp_header_ped))
### run combined algorithm
### riftehr
mt = matchECtoDemog.matches(patientFile, ecFile)
mt.assignFamily('riftehr_pedigree.csv')
### fppa
newDT = decisionTreeV7.DT(addressFile, nameFile, demoFile, accountFile)
newDT.predict()
newDT.writeToFile(outputFile)
newFamilyTree = family_treeV4.familyTree(newDT)
newFamilyTree.filter(outputFile)
newFamilyTree.buildTree()
#newFamilyTree.connected('fppa_pedigree.csv')
new_infer = inference.matches(mt.qc_matches, mt.sex, newFamilyTree.edges, newFamilyTree.gender, familyTreeOutput)
#new_infer.assignFamilies(familyTreeOutput)
comb = combine_new_ped.matches(ped, new_infer.ec, new_infer.sex, new_infer.fppa_pair, new_infer.p_c_gender, new_infer.famOut)
else:
### run combined algorithm
### riftehr
mt = matchECtoDemog.matches(patientFile, ecFile)
mt.assignFamily('riftehr_pedigree.csv')
### fppa
newDT = decisionTreeV7.DT(addressFile, nameFile, demoFile, accountFile)
newDT.predict()
newDT.writeToFile(outputFile)
newFamilyTree = family_treeV4.familyTree(newDT)
newFamilyTree.filter(outputFile)
newFamilyTree.buildTree()
#newFamilyTree.connected('fppa_pedigree.csv')
new_infer = inference.matches(mt.qc_matches, mt.sex, newFamilyTree.edges, newFamilyTree.gender, familyTreeOutput)
new_infer.assignFamilies()
'''
### run combined algorithm
### riftehr
mt = matchECtoDemog.matches(patientFile, ecFile, 'riftehr_pedigree.csv')
### fppa
newDT = decisionTreeV7.DT(addressFile, nameFile, demoFile, accountFile)
newDT.predict()
newDT.writeToFile(outputFile)
newFamilyTree = family_treeV4.familyTree(newDT)
newFamilyTree.filter(outputFile)
newFamilyTree.buildTree()
#newFamilyTree.connected('fppa_pedigree.csv')
new_infer = inference.matches(mt.qc_matches, mt.sex, newFamilyTree.edges, newFamilyTree.gender, familyTreeOutput)
''' | Source/combine.py | 4,965 | @author: xiayuanhuang
run combined algorithm riftehr fppanewFamilyTree.connected('fppa_pedigree.csv')new_infer.assignFamilies(familyTreeOutput) run combined algorithm riftehr fppanewFamilyTree.connected('fppa_pedigree.csv') | 225 | en | 0.668918 |
import acequia as aq
from acequia import KnmiStations
if 1: # test KnmiStations.prec_stns()
knmi = KnmiStations()
print("Retrieving list of all available precipitation stations.")
#filepath = r'..\02_data\knmi_locations\stn-prc-available.csv'
filepath = 'stn-prc-available.csv'
dfprc = knmi.prc_stns(filepath)
print(f'{len(dfprc)} precipitation stations available on KMNI website.')
print()
if 1: # test KnmiStations.wheater_stns()
knmi = KnmiStations()
print("retrieving list of all available weather stations.")
#filepath = r'..\02_data\knmi_locations\stn-wht-available.csv'
filepath = 'stn-wht-available.csv'
dfwt = knmi.wtr_stns(filepath)
print(f'{len(dfwt)} weather stations available on KMNI website.')
print()
| old_tests/test_read_knmistations.py | 785 | test KnmiStations.prec_stns()filepath = r'..\02_data\knmi_locations\stn-prc-available.csv' test KnmiStations.wheater_stns()filepath = r'..\02_data\knmi_locations\stn-wht-available.csv' | 184 | en | 0.360748 |
from kivy.core.window import Window
from kivy.app import App
from kivy.uix.button import Button
from kivy.uix.textinput import TextInput
from kivy.uix.label import Label
from kivy.uix.boxlayout import BoxLayout
from kivy.uix.screenmanager import ScreenManager, Screen
from ins import *
from ruffier import*
from kivy.core.window import Window
from seconds import Seconds
age = None
name = None
p1,p2,p3 = None , None , None
ruf_index = 0
window_color = (0, 0.20, 0.20, 1)
Window.clearcolor = window_color
btn_color = (0, 0.6, 0.9, 1)
Window.size = (300, 600)
def get_num(num):
try:
num = int(num)
if num > 7 :
return num
else :
return False
except:
return False
class MainScr(Screen):
def __init__(self,**kwargs):
super().__init__(**kwargs) # имя экрана должно передаваться конструктору класса Screen
txt = Label(text=txt_ins)
self.user_name = TextInput(multiline=False)
self.user_age = TextInput(multiline=False)
txt_name = Label(text = "Name:")
txt_age = Label(text = "Age")
self.btn = Button(text = "Next")
self.btn.background_color = btn_color
self.btn.on_press = self.next
self.on_enter = self.clean_text_input
main_bl = BoxLayout(orientation="vertical")
bl1 = BoxLayout(orientation="vertical" , size_hint=(1,.70))
bl2 = BoxLayout(size_hint=(1,.10))
bl3 = BoxLayout(size_hint=(1,.10))
bl4 = BoxLayout(size_hint=(1,.10))
bl1.add_widget(txt)
bl2.add_widget(txt_name)
bl2.add_widget(self.user_name)
bl3.add_widget(txt_age)
bl3.add_widget(self.user_age)
bl4.add_widget(self.btn)
main_bl.add_widget(bl1)
main_bl.add_widget(bl2)
main_bl.add_widget(bl3)
main_bl.add_widget(bl4)
self.add_widget(main_bl)
def next(self):
global name
global age
name = self.user_name.text
age = get_num(self.user_age.text)
if age == False :
self.user_age.text = ""
else :
self.manager.transition.direction = 'left'
self.manager.current = '2'
def clean_text_input(self):
self.user_name.text = ""
self.user_age.text = ""
Window.clearcolor = window_color
class Scr2(Screen):
def __init__(self,**kwargs):
super().__init__(**kwargs) # имя экрана должно передаваться конструктору класса Screen
txt = Label(text=ins_test1)
self.pulse = TextInput(multiline=False)
txt_pulse = Label(text = "Pulse")
self.btn = Button(text = "Start")
self.btn.on_press = self.next
self.lbl_sec = Seconds(15)
self.on_enter = self.clean_text_input
main_bl = BoxLayout(orientation="vertical")
bl1 = BoxLayout(orientation="vertical" , size_hint=(1,.56))
bl2 = BoxLayout(size_hint=(1,.08))
bl3 = BoxLayout(size_hint=(1,.08))
bl4 = BoxLayout(size_hint=(1,.08))
self.btn.background_color = btn_color
bl1.add_widget(txt)
bl2.add_widget(txt_pulse)
bl2.add_widget(self.pulse)
bl3.add_widget(self.btn)
bl4.add_widget(self.lbl_sec)
main_bl.add_widget(bl1)
main_bl.add_widget(bl4)
main_bl.add_widget(bl2)
main_bl.add_widget(bl3)
self.add_widget(main_bl)
def next(self):
global p1
if self.btn.text == "Start" :
self.lbl_sec.start()
self.btn.text = "Next"
else :
p1 = get_num(self.pulse.text)
if p1 == False:
self.pulse.text=""
else:
self.manager.transition.direction = 'left'
self.manager.current = '3'
def clean_text_input(self):
self.pulse.text = ""
self.btn.text = "Start"
Window.clearcolor = window_color
class Scr3(Screen):
def __init__(self,**kwargs):
super().__init__(**kwargs) # имя экрана должно передаваться конструктору класса Screen
txt = Label(text=ins_test2)
self.btn = Button(text = "Start")
self.btn.on_press = self.next
self.btn.background_color = btn_color
self.lbl_sec = Seconds(15)
self.on_enter = self.clean_text_input
main_bl = BoxLayout(orientation="vertical")
bl1 = BoxLayout(orientation="vertical" , size_hint=(1,.60))
bl2 = BoxLayout(size_hint=(1,.10))
bl4 = BoxLayout(size_hint=(1,.08))
bl1.add_widget(txt)
bl2.add_widget(self.btn)
bl4.add_widget(self.lbl_sec)
main_bl.add_widget(bl1)
main_bl.add_widget(bl4)
main_bl.add_widget(bl2)
self.add_widget(main_bl)
def next(self):
if self.btn.text == "Start" :
self.lbl_sec.start()
self.btn.text = "Next"
else :
self.manager.transition.direction = 'left'
self.manager.current = '4'
def clean_text_input(self):
self.btn.text = "Start"
Window.clearcolor = window_color
class Scr4(Screen):
def __init__(self,**kwargs):
super().__init__(**kwargs) # имя экрана должно передаваться конструктору класса Screen
txt = Label(text=txt_test3)
self.pulse2 = TextInput(multiline=False)
self.pulse3 = TextInput(multiline=False)
txt_name = Label(text = "Pulse_1")
txt_age = Label(text = "Pulse_2")
self.btn = Button(text = "Next")
self.btn.on_press = self.next
self.btn.background_color = btn_color
self.on_enter = self.clean_text_input
main_bl = BoxLayout(orientation="vertical")
bl1 = BoxLayout(orientation="vertical" , size_hint=(1,.70))
bl2 = BoxLayout(size_hint=(1,.10))
bl3 = BoxLayout(size_hint=(1,.10))
bl4 = BoxLayout(size_hint=(1,.10))
bl1.add_widget(txt)
bl2.add_widget(txt_name)
bl2.add_widget(self.pulse2)
bl3.add_widget(txt_age)
bl3.add_widget(self.pulse3)
bl4.add_widget(self.btn)
main_bl.add_widget(bl1)
main_bl.add_widget(bl2)
main_bl.add_widget(bl3)
main_bl.add_widget(bl4)
self.add_widget(main_bl)
def next(self):
global p2
global p3
if self.btn.text == "Start" :
self.lbl_sec.start()
self.btn.text = "Next"
else :
p2 = get_num(self.pulse2.text)
p3 = get_num(self.pulse3.text)
self.manager.transition.direction = 'left'
self.manager.current = '5'
def clean_text_input(self):
self.pulse2.text = ""
self.pulse3.text = ""
Window.clearcolor = window_color
class Scr5(Screen):
def __init__(self,**kwargs):
super().__init__(**kwargs) # имя экрана должно передаваться конструктору класса Screen
self.txt = Label(text = "")
self.btn = Button(text = "rebut")
self.btn.on_press = self.back
self.btn.background_color = btn_color
main_bl = BoxLayout(orientation="vertical")
bl1 = BoxLayout(orientation="vertical" , size_hint=(1,.90))
bl2 = BoxLayout(size_hint=(1,.10))
bl1.add_widget(self.txt)
bl2.add_widget(self.btn)
main_bl.add_widget(bl1)
main_bl.add_widget(bl2)
self.add_widget(main_bl)
self.on_enter = self.index_ruffier
def index_ruffier(self):
ir = (4*(p1+p2+p3)-200)/10
self.txt.text = txt_ending +str(ir)
def back(self):
self.manager.transition.direction = 'right'
self.manager.current = 'main'
global p1
global p2
global p3
def clean_text_input(self):
Window.clearcolor = window_color
class MyApp(App):
def build(self):
sm = ScreenManager()
sm.add_widget(MainScr(name='main'))
sm.add_widget(Scr2(name='2'))
sm.add_widget(Scr3(name="3"))
sm.add_widget(Scr4(name='4'))
sm.add_widget(Scr5(name='5'))
return sm
app = MyApp()
app.run() | main.py | 8,742 | имя экрана должно передаваться конструктору класса Screen имя экрана должно передаваться конструктору класса Screen имя экрана должно передаваться конструктору класса Screen имя экрана должно передаваться конструктору класса Screen имя экрана должно передаваться конструктору класса Screen | 289 | ru | 0.996645 |
from rest_framework import serializers
class HelloSerializer(serializers.Serializer):
"""serializers a name field for testing our APIView"""
name = serializers.CharField(max_length = 10) | profile_api/serializers.py | 195 | serializers a name field for testing our APIView | 48 | en | 0.717424 |
#!/usr/bin/env python3
import iterm2
# To install, update, or remove packages from PyPI, use Scripts > Manage > Manage Dependencies...
import subprocess
async def main(connection):
component = iterm2.StatusBarComponent(
short_description = 'k8s current context',
detailed_description = 'Display k8s current context',
knobs = [],
exemplar = 'cluster-1',
update_cadence = 3,
identifier = 'com.github.bassaer.iterm2-k8s-context'
)
@iterm2.StatusBarRPC
async def coro(knobs):
result = subprocess.run(
['kubectl', 'config', 'current-context'],
stdout=subprocess.PIPE,
stderr=subprocess.PIPE,
encoding='utf-8')
tmpl = '⎈ {}'
if result.returncode != 0:
return tmpl.format('Error');
return tmpl.format(result.stdout.strip());
await component.async_register(connection, coro)
# This instructs the script to run the "main" coroutine and to keep running even after it returns.
iterm2.run_forever(main)
| k8s-context.py | 1,099 | !/usr/bin/env python3 To install, update, or remove packages from PyPI, use Scripts > Manage > Manage Dependencies... This instructs the script to run the "main" coroutine and to keep running even after it returns. | 214 | en | 0.809949 |
# celery settings
broker_url = 'amqp://guest:guest@rabbitmq:5672/'
result_backend = 'rpc://'
accept_content = ['json']
task_serializer = 'json'
task_soft_time_limit = 60 * 3 # 3 minute timeout
result_serializer = 'json'
timezone = 'UTC'
enable_utc = True
| config/celeryconfig.py | 258 | celery settings 3 minute timeout | 32 | en | 0.518293 |
# Copyright (C) 2019-2021 HERE Europe B.V.
# SPDX-License-Identifier: Apache-2.0
"""This module defines all the configs which will be required as inputs to autosuggest API."""
from .base_config import Bunch
class SearchCircle:
"""A class to define ``SearchCircle``
Results will be returned if they are located within the specified circular area
defined by its center and radius(in meters).
"""
def __init__(self, lat: float, lng: float, radius: int):
self.lat = lat
self.lng = lng
self.radius = radius
class PoliticalView(Bunch):
"""A Class to define constant values for political view
``RUS``:
expressing the Russian view on Crimea
``SRB``:
expressing the Serbian view on Kosovo, Vukovar and Sarengrad Islands
``MAR``:
expressing the Moroccan view on Western Sahara
"""
#: Use this config for political_view of Autosuggest API.
#: Example: for ``RUS`` political_view use ``POLITICAL_VIEW.RUS``.
POLITICAL_VIEW = PoliticalView(
**{
"RUS": "RUS",
"SRB": "SRB",
"MAR": "MAR",
}
)
class Show(Bunch):
"""A Class to define constant values for showing additional fields to be
rendered in the response.
``phonemes``:
Renders phonemes for address and place names into the results.
``tz``:
BETA: Renders result items with additional time zone information.
Please note that this may impact latency significantly.
"""
#: Use this config for show of Autosuggest API.
#: Example: for ``RUS`` show use ``SHOW.phonemes``.
SHOW = Show(**{"phonemes": "phonemes", "tz": "tz"})
| here_location_services/config/autosuggest_config.py | 1,622 | A Class to define constant values for political view
``RUS``:
expressing the Russian view on Crimea
``SRB``:
expressing the Serbian view on Kosovo, Vukovar and Sarengrad Islands
``MAR``:
expressing the Moroccan view on Western Sahara
A class to define ``SearchCircle``
Results will be returned if they are located within the specified circular area
defined by its center and radius(in meters).
A Class to define constant values for showing additional fields to be
rendered in the response.
``phonemes``:
Renders phonemes for address and place names into the results.
``tz``:
BETA: Renders result items with additional time zone information.
Please note that this may impact latency significantly.
This module defines all the configs which will be required as inputs to autosuggest API.
Copyright (C) 2019-2021 HERE Europe B.V. SPDX-License-Identifier: Apache-2.0: Use this config for political_view of Autosuggest API.: Example: for ``RUS`` political_view use ``POLITICAL_VIEW.RUS``.: Use this config for show of Autosuggest API.: Example: for ``RUS`` show use ``SHOW.phonemes``. | 1,091 | en | 0.760122 |
LAB_SOURCE_FILE = "lab05.py"
""" Lab 05: Trees and Proj2 Prep """
def couple(lst1, lst2):
"""Return a list that contains lists with i-th elements of two sequences
coupled together.
>>> lst1 = [1, 2, 3]
>>> lst2 = [4, 5, 6]
>>> couple(lst1, lst2)
[[1, 4], [2, 5], [3, 6]]
>>> lst3 = ['c', 6]
>>> lst4 = ['s', '1']
>>> couple(lst3, lst4)
[['c', 's'], [6, '1']]
"""
assert len(lst1) == len(lst2)
a = []
for i in range(len(lst1)):
a.append([lst1[i], lst2[i]])
return a
from math import sqrt
def distance(city1, city2):
"""
>>> city1 = make_city('city1', 0, 1)
>>> city2 = make_city('city2', 0, 2)
>>> distance(city1, city2)
1.0
>>> city3 = make_city('city3', 6.5, 12)
>>> city4 = make_city('city4', 2.5, 15)
>>> distance(city3, city4)
5.0
"""
x1, y1 = get_lat(city1), get_lon(city1)
x2, y2 = get_lat(city2), get_lon(city2)
return sqrt((x1 - x2)**2 + (y1 - y2)**2)
def closer_city(lat, lon, city1, city2):
"""
Returns the name of either city1 or city2, whichever is closest to
coordinate (lat, lon).
>>> berkeley = make_city('Berkeley', 37.87, 112.26)
>>> stanford = make_city('Stanford', 34.05, 118.25)
>>> closer_city(38.33, 121.44, berkeley, stanford)
'Stanford'
>>> bucharest = make_city('Bucharest', 44.43, 26.10)
>>> vienna = make_city('Vienna', 48.20, 16.37)
>>> closer_city(41.29, 174.78, bucharest, vienna)
'Bucharest'
"""
tmp = make_city('tmp', lat, lon)
dis1 = distance(city1, tmp)
dis2 = distance(city2, tmp)
if dis1 > dis2:
return get_name(city2)
else:
return get_name(city1)
def check_abstraction():
"""
There's nothing for you to do for this function, it's just here for the extra doctest
>>> change_abstraction(True)
>>> city1 = make_city('city1', 0, 1)
>>> city2 = make_city('city2', 0, 2)
>>> distance(city1, city2)
1.0
>>> city3 = make_city('city3', 6.5, 12)
>>> city4 = make_city('city4', 2.5, 15)
>>> distance(city3, city4)
5.0
>>> berkeley = make_city('Berkeley', 37.87, 112.26)
>>> stanford = make_city('Stanford', 34.05, 118.25)
>>> closer_city(38.33, 121.44, berkeley, stanford)
'Stanford'
>>> bucharest = make_city('Bucharest', 44.43, 26.10)
>>> vienna = make_city('Vienna', 48.20, 16.37)
>>> closer_city(41.29, 174.78, bucharest, vienna)
'Bucharest'
>>> change_abstraction(False)
"""
# Treat all the following code as being behind an abstraction layer, you shouldn't need to look at it!
def make_city(name, lat, lon):
"""
>>> city = make_city('Berkeley', 0, 1)
>>> get_name(city)
'Berkeley'
>>> get_lat(city)
0
>>> get_lon(city)
1
"""
if change_abstraction.changed:
return {"name" : name, "lat" : lat, "lon" : lon}
else:
return [name, lat, lon]
def get_name(city):
"""
>>> city = make_city('Berkeley', 0, 1)
>>> get_name(city)
'Berkeley'
"""
if change_abstraction.changed:
return city["name"]
else:
return city[0]
def get_lat(city):
"""
>>> city = make_city('Berkeley', 0, 1)
>>> get_lat(city)
0
"""
if change_abstraction.changed:
return city["lat"]
else:
return city[1]
def get_lon(city):
"""
>>> city = make_city('Berkeley', 0, 1)
>>> get_lon(city)
1
"""
if change_abstraction.changed:
return city["lon"]
else:
return city[2]
def change_abstraction(change):
change_abstraction.changed = change
change_abstraction.changed = False
def nut_finder(t):
"""Returns True if t contains a node with the value 'nut' and
False otherwise.
>>> scrat = tree('nut')
>>> nut_finder(scrat)
True
>>> sproul = tree('roots', [tree('branch1', [tree('leaf'), tree('nut')]), tree('branch2')])
>>> nut_finder(sproul)
True
>>> numbers = tree(1, [tree(2), tree(3, [tree(4), tree(5)]), tree(6, [tree(7)])])
>>> nut_finder(numbers)
False
>>> t = tree(1, [tree('nut',[tree('not nut')])])
>>> nut_finder(t)
True
"""
if label(t) == 'nut':
return True
for node in branches(t):
if nut_finder(node):
return True
return False
def sprout_leaves(t, values):
"""Sprout new leaves containing the data in values at each leaf in
the original tree t and return the resulting tree.
>>> t1 = tree(1, [tree(2), tree(3)])
>>> print_tree(t1)
1
2
3
>>> new1 = sprout_leaves(t1, [4, 5])
>>> print_tree(new1)
1
2
4
5
3
4
5
>>> t2 = tree(1, [tree(2, [tree(3)])])
>>> print_tree(t2)
1
2
3
>>> new2 = sprout_leaves(t2, [6, 1, 2])
>>> print_tree(new2)
1
2
3
6
1
2
"""
if is_leaf(t):
return tree(label(t),[tree(v) for v in values])
return tree(label(t),[sprout_leaves(b, values) for b in branches(t)])
# Tree ADT
def tree(label, branches=[]):
"""Construct a tree with the given label value and a list of branches."""
for branch in branches:
assert is_tree(branch), 'branches must be trees'
return [label] + list(branches)
def label(tree):
"""Return the label value of a tree."""
return tree[0]
def branches(tree):
"""Return the list of branches of the given tree."""
return tree[1:]
def is_tree(tree):
"""Returns True if the given tree is a tree, and False otherwise."""
if type(tree) != list or len(tree) < 1:
return False
for branch in branches(tree):
if not is_tree(branch):
return False
return True
def is_leaf(tree):
"""Returns True if the given tree's list of branches is empty, and False
otherwise.
"""
return not branches(tree)
def print_tree(t, indent=0):
"""Print a representation of this tree in which each node is
indented by two spaces times its depth from the root.
>>> print_tree(tree(1))
1
>>> print_tree(tree(1, [tree(2)]))
1
2
>>> numbers = tree(1, [tree(2), tree(3, [tree(4), tree(5)]), tree(6, [tree(7)])])
>>> print_tree(numbers)
1
2
3
4
5
6
7
"""
print(' ' * indent + str(label(t)))
for b in branches(t):
print_tree(b, indent + 1)
def copy_tree(t):
"""Returns a copy of t. Only for testing purposes.
>>> t = tree(5)
>>> copy = copy_tree(t)
>>> t = tree(6)
>>> print_tree(copy)
5
"""
return tree(label(t), [copy_tree(b) for b in branches(t)])
def add_chars(w1, w2):
"""
Return a string containing the characters you need to add to w1 to get w2.
You may assume that w1 is a subsequence of w2.
>>> add_chars("owl", "howl")
'h'
>>> add_chars("want", "wanton")
'on'
>>> add_chars("rat", "radiate")
'diae'
>>> add_chars("a", "prepare")
'prepre'
>>> add_chars("resin", "recursion")
'curo'
>>> add_chars("fin", "effusion")
'efuso'
>>> add_chars("coy", "cacophony")
'acphon'
>>> from construct_check import check
>>> # ban iteration and sets
>>> check(LAB_SOURCE_FILE, 'add_chars',
... ['For', 'While', 'Set', 'SetComp']) # Must use recursion
True
"""
"*** YOUR CODE HERE ***"
def add_trees(t1, t2):
"""
>>> numbers = tree(1,
... [tree(2,
... [tree(3),
... tree(4)]),
... tree(5,
... [tree(6,
... [tree(7)]),
... tree(8)])])
>>> print_tree(add_trees(numbers, numbers))
2
4
6
8
10
12
14
16
>>> print_tree(add_trees(tree(2), tree(3, [tree(4), tree(5)])))
5
4
5
>>> print_tree(add_trees(tree(2, [tree(3)]), tree(2, [tree(3), tree(4)])))
4
6
4
>>> print_tree(add_trees(tree(2, [tree(3, [tree(4), tree(5)])]), \
tree(2, [tree(3, [tree(4)]), tree(5)])))
4
6
8
5
5
"""
"*** YOUR CODE HERE ***"
# Shakespeare and Dictionaries
def build_successors_table(tokens):
"""Return a dictionary: keys are words; values are lists of successors.
>>> text = ['We', 'came', 'to', 'investigate', ',', 'catch', 'bad', 'guys', 'and', 'to', 'eat', 'pie', '.']
>>> table = build_successors_table(text)
>>> sorted(table)
[',', '.', 'We', 'and', 'bad', 'came', 'catch', 'eat', 'guys', 'investigate', 'pie', 'to']
>>> table['to']
['investigate', 'eat']
>>> table['pie']
['.']
>>> table['.']
['We']
"""
table = {}
prev = '.'
for word in tokens:
if prev not in table:
"*** YOUR CODE HERE ***"
"*** YOUR CODE HERE ***"
prev = word
return table
def construct_sent(word, table):
"""Prints a random sentence starting with word, sampling from
table.
>>> table = {'Wow': ['!'], 'Sentences': ['are'], 'are': ['cool'], 'cool': ['.']}
>>> construct_sent('Wow', table)
'Wow!'
>>> construct_sent('Sentences', table)
'Sentences are cool.'
"""
import random
result = ''
while word not in ['.', '!', '?']:
"*** YOUR CODE HERE ***"
return result.strip() + word
def shakespeare_tokens(path='shakespeare.txt', url='http://composingprograms.com/shakespeare.txt'):
"""Return the words of Shakespeare's plays as a list."""
import os
from urllib.request import urlopen
if os.path.exists(path):
return open('shakespeare.txt', encoding='ascii').read().split()
else:
shakespeare = urlopen(url)
return shakespeare.read().decode(encoding='ascii').split()
# Uncomment the following two lines
# tokens = shakespeare_tokens()
# table = build_successors_table(tokens)
def random_sent():
import random
return construct_sent(random.choice(table['.']), table)
| lab/lab05/lab05.py | 10,067 | Return a string containing the characters you need to add to w1 to get w2.
You may assume that w1 is a subsequence of w2.
>>> add_chars("owl", "howl")
'h'
>>> add_chars("want", "wanton")
'on'
>>> add_chars("rat", "radiate")
'diae'
>>> add_chars("a", "prepare")
'prepre'
>>> add_chars("resin", "recursion")
'curo'
>>> add_chars("fin", "effusion")
'efuso'
>>> add_chars("coy", "cacophony")
'acphon'
>>> from construct_check import check
>>> # ban iteration and sets
>>> check(LAB_SOURCE_FILE, 'add_chars',
... ['For', 'While', 'Set', 'SetComp']) # Must use recursion
True
>>> numbers = tree(1,
... [tree(2,
... [tree(3),
... tree(4)]),
... tree(5,
... [tree(6,
... [tree(7)]),
... tree(8)])])
>>> print_tree(add_trees(numbers, numbers))
2
4
6
8
10
12
14
16
>>> print_tree(add_trees(tree(2), tree(3, [tree(4), tree(5)])))
5
4
5
>>> print_tree(add_trees(tree(2, [tree(3)]), tree(2, [tree(3), tree(4)])))
4
6
4
>>> print_tree(add_trees(tree(2, [tree(3, [tree(4), tree(5)])]), tree(2, [tree(3, [tree(4)]), tree(5)])))
4
6
8
5
5
Return the list of branches of the given tree.
Return a dictionary: keys are words; values are lists of successors.
>>> text = ['We', 'came', 'to', 'investigate', ',', 'catch', 'bad', 'guys', 'and', 'to', 'eat', 'pie', '.']
>>> table = build_successors_table(text)
>>> sorted(table)
[',', '.', 'We', 'and', 'bad', 'came', 'catch', 'eat', 'guys', 'investigate', 'pie', 'to']
>>> table['to']
['investigate', 'eat']
>>> table['pie']
['.']
>>> table['.']
['We']
There's nothing for you to do for this function, it's just here for the extra doctest
>>> change_abstraction(True)
>>> city1 = make_city('city1', 0, 1)
>>> city2 = make_city('city2', 0, 2)
>>> distance(city1, city2)
1.0
>>> city3 = make_city('city3', 6.5, 12)
>>> city4 = make_city('city4', 2.5, 15)
>>> distance(city3, city4)
5.0
>>> berkeley = make_city('Berkeley', 37.87, 112.26)
>>> stanford = make_city('Stanford', 34.05, 118.25)
>>> closer_city(38.33, 121.44, berkeley, stanford)
'Stanford'
>>> bucharest = make_city('Bucharest', 44.43, 26.10)
>>> vienna = make_city('Vienna', 48.20, 16.37)
>>> closer_city(41.29, 174.78, bucharest, vienna)
'Bucharest'
>>> change_abstraction(False)
Returns the name of either city1 or city2, whichever is closest to
coordinate (lat, lon).
>>> berkeley = make_city('Berkeley', 37.87, 112.26)
>>> stanford = make_city('Stanford', 34.05, 118.25)
>>> closer_city(38.33, 121.44, berkeley, stanford)
'Stanford'
>>> bucharest = make_city('Bucharest', 44.43, 26.10)
>>> vienna = make_city('Vienna', 48.20, 16.37)
>>> closer_city(41.29, 174.78, bucharest, vienna)
'Bucharest'
Prints a random sentence starting with word, sampling from
table.
>>> table = {'Wow': ['!'], 'Sentences': ['are'], 'are': ['cool'], 'cool': ['.']}
>>> construct_sent('Wow', table)
'Wow!'
>>> construct_sent('Sentences', table)
'Sentences are cool.'
Returns a copy of t. Only for testing purposes.
>>> t = tree(5)
>>> copy = copy_tree(t)
>>> t = tree(6)
>>> print_tree(copy)
5
Return a list that contains lists with i-th elements of two sequences
coupled together.
>>> lst1 = [1, 2, 3]
>>> lst2 = [4, 5, 6]
>>> couple(lst1, lst2)
[[1, 4], [2, 5], [3, 6]]
>>> lst3 = ['c', 6]
>>> lst4 = ['s', '1']
>>> couple(lst3, lst4)
[['c', 's'], [6, '1']]
>>> city1 = make_city('city1', 0, 1)
>>> city2 = make_city('city2', 0, 2)
>>> distance(city1, city2)
1.0
>>> city3 = make_city('city3', 6.5, 12)
>>> city4 = make_city('city4', 2.5, 15)
>>> distance(city3, city4)
5.0
>>> city = make_city('Berkeley', 0, 1)
>>> get_lat(city)
0
>>> city = make_city('Berkeley', 0, 1)
>>> get_lon(city)
1
>>> city = make_city('Berkeley', 0, 1)
>>> get_name(city)
'Berkeley'
Returns True if the given tree's list of branches is empty, and False
otherwise.
Returns True if the given tree is a tree, and False otherwise.
Return the label value of a tree.
>>> city = make_city('Berkeley', 0, 1)
>>> get_name(city)
'Berkeley'
>>> get_lat(city)
0
>>> get_lon(city)
1
Returns True if t contains a node with the value 'nut' and
False otherwise.
>>> scrat = tree('nut')
>>> nut_finder(scrat)
True
>>> sproul = tree('roots', [tree('branch1', [tree('leaf'), tree('nut')]), tree('branch2')])
>>> nut_finder(sproul)
True
>>> numbers = tree(1, [tree(2), tree(3, [tree(4), tree(5)]), tree(6, [tree(7)])])
>>> nut_finder(numbers)
False
>>> t = tree(1, [tree('nut',[tree('not nut')])])
>>> nut_finder(t)
True
Print a representation of this tree in which each node is
indented by two spaces times its depth from the root.
>>> print_tree(tree(1))
1
>>> print_tree(tree(1, [tree(2)]))
1
2
>>> numbers = tree(1, [tree(2), tree(3, [tree(4), tree(5)]), tree(6, [tree(7)])])
>>> print_tree(numbers)
1
2
3
4
5
6
7
Return the words of Shakespeare's plays as a list.
Sprout new leaves containing the data in values at each leaf in
the original tree t and return the resulting tree.
>>> t1 = tree(1, [tree(2), tree(3)])
>>> print_tree(t1)
1
2
3
>>> new1 = sprout_leaves(t1, [4, 5])
>>> print_tree(new1)
1
2
4
5
3
4
5
>>> t2 = tree(1, [tree(2, [tree(3)])])
>>> print_tree(t2)
1
2
3
>>> new2 = sprout_leaves(t2, [6, 1, 2])
>>> print_tree(new2)
1
2
3
6
1
2
Construct a tree with the given label value and a list of branches.
Treat all the following code as being behind an abstraction layer, you shouldn't need to look at it! Tree ADT Shakespeare and Dictionaries Uncomment the following two lines tokens = shakespeare_tokens() table = build_successors_table(tokens) | 5,678 | en | 0.613587 |
import itertools
import re
import detectEnglish
import freqAnalysis
vigenereCipher = __import__('vigenereCipher')
LETTERS = 'ABCDEFGHIJKLMNOPQRSTUVWXYZ'
# SILENT_MODE = False # If set to True, program doesn't print anything.
SILENT_MODE = True
NUM_MOST_FREQ_LETTERS = 4 # Attempt this many letters per subkey.
MAX_KEY_LENGTH = 16 # Will not attempt keys longer than this.
NONLETTERS_PATTERN = re.compile('[^A-Z]')
def find_repeat_sequences_spacings(message):
# Goes through the message and finds any 3 to 5 letter sequences
# that are repeated. Returns a dict with the keys of the sequence and
# values of a list of spacings (num of letters between the repeats).
# Use a regular expression to remove non-letters from the message:
message = NONLETTERS_PATTERN.sub('', message.upper())
# Compile a list of seqLen-letter sequences found in the message:
seq_spacings = {} # Keys are sequences, values are lists of int spacings.
for seqLen in range(3, 6):
for seqStart in range(len(message) - seqLen):
# Determine what the sequence is, and store it in seq:
seq = message[seqStart:seqStart + seqLen]
# Look for this sequence in the rest of the message:
for i in range(seqStart + seqLen, len(message) - seqLen):
if message[i:i + seqLen] == seq:
# Found a repeated sequence.
if seq not in seq_spacings:
seq_spacings[seq] = [] # Initialize a blank list.
# Append the spacing distance between the repeated
# sequence and the original sequence:
seq_spacings[seq].append(i - seqStart)
return seq_spacings
def get_useful_factors(num):
# Returns a list of useful factors of num. By "useful" we mean factors
# less than MAX_KEY_LENGTH + 1 and not 1. For example,
# getUsefulFactors(144) returns [2, 3, 4, 6, 8, 9, 12, 16]
if num < 2:
return [] # Numbers less than 2 have no useful factors.
factors = [] # The list of factors found.
# When finding factors, you only need to check the integers up to
# MAX_KEY_LENGTH.
for i in range(2, MAX_KEY_LENGTH + 1): # Don't test 1: it's not useful.
if num % i == 0:
factors.append(i)
other_factor = int(num / i)
if other_factor < MAX_KEY_LENGTH + 1 and other_factor != 1:
factors.append(other_factor)
return list(set(factors)) # Remove duplicate factors.
def get_item_at_index_one(items):
return items[1]
def get_most_common_factors(seq_factors):
# First, get a count of how many times a factor occurs in seqFactors:
factor_counts = {} # Key is a factor, value is how often it occurs.
# seqFactors keys are sequences, values are lists of factors of the
# spacings. seqFactors has a value like: {'GFD': [2, 3, 4, 6, 9, 12,
# 18, 23, 36, 46, 69, 92, 138, 207], 'ALW': [2, 3, 4, 6, ...], ...}
for seq in seq_factors:
factor_list = seq_factors[seq]
for factor in factor_list:
if factor not in factor_counts:
factor_counts[factor] = 0
factor_counts[factor] += 1
# Second, put the factor and its count into a tuple, and make a list
# of these tuples so we can sort them:
factors_by_count = []
for factor in factor_counts:
# Exclude factors larger than MAX_KEY_LENGTH:
if factor <= MAX_KEY_LENGTH:
# factors_by_count is a list of tuples: (factor, factorCount)
# factors_by_count has a value like: [(3, 497), (2, 487), ...]
factors_by_count.append((factor, factor_counts[factor]))
# Sort the list by the factor count:
factors_by_count.sort(key=get_item_at_index_one, reverse=True)
return factors_by_count
def kasiski_examination(ciphertext):
# Find out the sequences of 3 to 5 letters that occur multiple times
# in the ciphertext. repeated_seq_spacings has a value like:
# {'EXG': [192], 'NAF': [339, 972, 633], ... }
repeated_seq_spacings = find_repeat_sequences_spacings(ciphertext)
# (See getMostCommonFactors() for a description of seq_factors.)
seq_factors = {}
for seq in repeated_seq_spacings:
seq_factors[seq] = []
for spacing in repeated_seq_spacings[seq]:
seq_factors[seq].extend(get_useful_factors(spacing))
# (See getMostCommonFactors() for a description of factors_by_count.)
factors_by_count = get_most_common_factors(seq_factors)
# Now we extract the factor counts from factors_by_count and
# put them in all_likely_key_lengths so that they are easier to
# use later:
all_likely_key_lengths = []
for twoIntTuple in factors_by_count:
all_likely_key_lengths.append(twoIntTuple[0])
return all_likely_key_lengths
def get_nth_subkeys_letters(nth, key_length, message):
# Returns every nth letter for each keyLength set of letters in text.
# E.g. getNthSubkeysLetters(1, 3, 'ABCABCABC') returns 'AAA'
# getNthSubkeysLetters(2, 3, 'ABCABCABC') returns 'BBB'
# getNthSubkeysLetters(3, 3, 'ABCABCABC') returns 'CCC'
# getNthSubkeysLetters(1, 5, 'ABCDEFGHI') returns 'AF'
# Use a regular expression to remove non-letters from the message:
message = NONLETTERS_PATTERN.sub('', message)
i = nth - 1
letters = []
while i < len(message):
letters.append(message[i])
i += key_length
return ''.join(letters)
def attempt_hack_with_key_length(ciphertext, most_likely_key_length):
# Determine the most likely letters for each letter in the key:
ciphertext_up = ciphertext.upper()
# all_freq_scores is a list of mostLikelyKeyLength number of lists.
# These inner lists are the freq_scores lists.
all_freq_scores = []
for nth in range(1, most_likely_key_length + 1):
nth_letters = get_nth_subkeys_letters(nth, most_likely_key_length, ciphertext_up)
# freq_scores is a list of tuples like:
# [(<letter>, <Eng. Freq. match score>), ... ]
# List is sorted by match score. Higher score means better match.
# See the englishFreqMatchScore() comments in freqAnalysis.py.
freq_scores = []
for possible_key in LETTERS:
crypt = vigenereCipher.Vigenere(possible_key)
decrypted_text = crypt.decrypt(nth_letters)
key_and_freq_match_tuple = (possible_key, freqAnalysis.englishFreqMatchScore(decrypted_text))
freq_scores.append(key_and_freq_match_tuple)
# Sort by match score:
freq_scores.sort(key=get_item_at_index_one, reverse=True)
all_freq_scores.append(freq_scores[:NUM_MOST_FREQ_LETTERS])
if not SILENT_MODE:
for i in range(len(all_freq_scores)):
# Use i + 1 so the first letter is not called the "0th" letter:
print('Possible letters for letter %s of the key: ' % (i + 1) + ' ')
for freqScore in all_freq_scores[i]:
print('%s ' % freqScore[0] + ' ')
print('')
# Try every combination of the most likely letters for each position
# in the key:
for indexes in itertools.product(range(NUM_MOST_FREQ_LETTERS), repeat=most_likely_key_length):
# Create a possible key from the letters in all_freq_scores:
possible_key = ''
for i in range(most_likely_key_length):
possible_key += all_freq_scores[i][indexes[i]][0]
if not SILENT_MODE:
print(f'Attempting with key: {possible_key}')
crypt = vigenereCipher.Vigenere(possible_key)
decrypted_text = crypt.decrypt(ciphertext_up)
if detectEnglish.isEnglish(decrypted_text):
# Set the hacked ciphertext to the original casing:
orig_case = []
for i in range(len(ciphertext)):
if ciphertext[i].isupper():
orig_case.append(decrypted_text[i].upper())
else:
orig_case.append(decrypted_text[i].lower())
decrypted_text = ''.join(orig_case)
print("\nPossible decrypted message:")
print(f" Key {possible_key}({len(possible_key)}). part of decrypted message: {decrypted_text[:200]}")
response = input("\nEnter D if done, or any other key to continue the attack: ")
if response.strip().upper().startswith('D'):
return decrypted_text
# No English-looking decryption found, so return None:
return None
def hack_vigenere(ciphertext):
# First, we need to do Kasiski Examination to figure out what the
# length of the ciphertext's encryption key is:
all_likely_key_lengths = kasiski_examination(ciphertext)
if not SILENT_MODE:
key_length_str = ''
for keyLength in all_likely_key_lengths:
key_length_str += f'{keyLength} '
print('\nKasiski Examination results say the most likely key lengths are: ' + key_length_str + '\n')
hacked_message = None
for keyLength in all_likely_key_lengths:
if not SILENT_MODE:
print('Attempting decrypt with key length %s (%s possible keys)...' % (
keyLength, NUM_MOST_FREQ_LETTERS ** keyLength))
hacked_message = attempt_hack_with_key_length(ciphertext, keyLength)
if hacked_message is not None:
break
# If none of the key lengths we found using Kasiski Examination
# worked, start brute-forcing through key lengths:
if hacked_message is None:
if not SILENT_MODE:
print('Unable to hack message with likely key length(s). Brute forcing key length...')
for keyLength in range(1, MAX_KEY_LENGTH + 1):
# Don't re-check key lengths already tried from Kasiski:
if keyLength not in all_likely_key_lengths:
if not SILENT_MODE:
print(
f'Attempting decrypt with key length {keyLength} ({NUM_MOST_FREQ_LETTERS ** keyLength} possible keys)...')
hacked_message = attempt_hack_with_key_length(ciphertext, keyLength)
if hacked_message is not None:
break
return hacked_message
def main():
# Instead of typing this ciphertext out, you can copy & paste it
# from https://www.nostarch.com/crackingcodes/.
ciphertext = """Adiz Avtzqeci Tmzubb wsa m Pmilqev halpqavtakuoi, lgouqdaf, kdmktsvmztsl, izr xoexghzr kkusitaaf. Vz wsa twbhdg ubalmmzhdad qz hce vmhsgohuqbo ox kaakulmd gxiwvos, krgdurdny i rcmmstugvtawz ca tzm ocicwxfg jf "stscmilpy" oid "uwydptsbuci" wabt hce Lcdwig eiovdnw. Bgfdny qe kddwtk qjnkqpsmev ba pz tzm roohwz at xoexghzr kkusicw izr vrlqrwxist uboedtuuznum. Pimifo Icmlv Emf DI, Lcdwig owdyzd xwd hce Ywhsmnemzh Xovm mby Cqxtsm Supacg (GUKE) oo Bdmfqclwg Bomk, Tzuhvif'a ocyetzqofifo ositjm. Rcm a lqys ce oie vzav wr Vpt 8, lpq gzclqab mekxabnittq tjr Ymdavn fihog cjgbhvnstkgds. Zm psqikmp o iuejqf jf lmoviiicqg aoj jdsvkavs Uzreiz qdpzmdg, dnutgrdny bts helpar jf lpq pjmtm, mb zlwkffjmwktoiiuix avczqzs ohsb ocplv nuby swbfwigk naf ohw Mzwbms umqcifm. Mtoej bts raj pq kjrcmp oo tzm Zooigvmz Khqauqvl Dincmalwdm, rhwzq vz cjmmhzd gvq ca tzm rwmsl lqgdgfa rcm a kbafzd-hzaumae kaakulmd, hce SKQ. Wi 1948 Tmzubb jgqzsy Msf Zsrmsv'e Qjmhcfwig Dincmalwdm vt Eizqcekbqf Pnadqfnilg, ivzrw pq onsaafsy if bts yenmxckmwvf ca tzm Yoiczmehzr uwydptwze oid tmoohe avfsmekbqr dn eifvzmsbuqvl tqazjgq. Pq kmolm m dvpwz ab ohw ktshiuix pvsaa at hojxtcbefmewn, afl bfzdakfsy okkuzgalqzu xhwuuqvl jmmqoigve gpcz ie hce Tmxcpsgd-Lvvbgbubnkq zqoxtawz, kciup isme xqdgo otaqfqev qz hce 1960k. Bgfdny'a tchokmjivlabk fzsmtfsy if i ofdmavmz krgaqqptawz wi 1952, wzmz vjmgaqlpad iohn wwzq goidt uzgeyix wi tzm Gbdtwl Wwigvwy. Vz aukqdoev bdsvtemzh rilp rshadm tcmmgvqg (xhwuuqvl uiehmalqab) vs sv mzoejvmhdvw ba dmikwz. Hpravs rdev qz 1954, xpsl whsm tow iszkk jqtjrw pug 42id tqdhcdsg, rfjm ugmbddw xawnofqzu. Vn avcizsl lqhzreqzsy tzif vds vmmhc wsa eidcalq; vds ewfvzr svp gjmw wfvzrk jqzdenmp vds vmmhc wsa mqxivmzhvl. Gv 10 Esktwunsm 2009, fgtxcrifo mb Dnlmdbzt uiydviyv, Nfdtaat Dmiem Ywiikbqf Bojlab Wrgez avdw iz cafakuog pmjxwx ahwxcby gv nscadn at ohw Jdwoikp scqejvysit xwd "hce sxboglavs kvy zm ion tjmmhzd." Sa at Haq 2012 i bfdvsbq azmtmd'g widt ion bwnafz tzm Tcpsw wr Zjrva ivdcz eaigd yzmbo Tmzubb a kbmhptgzk dvrvwz wa efiohzd."""
# ciphertext = input('\nEnter ciphertext: ')
decoded_message = hack_vigenere(ciphertext)
if decoded_message is None:
print("\nFailed to break encryption.\n")
else:
print("Decoded Message:")
print("--------------------")
print(decoded_message)
if __name__ == '__main__':
main()
| crypto/vigenere/vigenere_breaker.py | 12,778 | SILENT_MODE = False If set to True, program doesn't print anything. Attempt this many letters per subkey. Will not attempt keys longer than this. Goes through the message and finds any 3 to 5 letter sequences that are repeated. Returns a dict with the keys of the sequence and values of a list of spacings (num of letters between the repeats). Use a regular expression to remove non-letters from the message: Compile a list of seqLen-letter sequences found in the message: Keys are sequences, values are lists of int spacings. Determine what the sequence is, and store it in seq: Look for this sequence in the rest of the message: Found a repeated sequence. Initialize a blank list. Append the spacing distance between the repeated sequence and the original sequence: Returns a list of useful factors of num. By "useful" we mean factors less than MAX_KEY_LENGTH + 1 and not 1. For example, getUsefulFactors(144) returns [2, 3, 4, 6, 8, 9, 12, 16] Numbers less than 2 have no useful factors. The list of factors found. When finding factors, you only need to check the integers up to MAX_KEY_LENGTH. Don't test 1: it's not useful. Remove duplicate factors. First, get a count of how many times a factor occurs in seqFactors: Key is a factor, value is how often it occurs. seqFactors keys are sequences, values are lists of factors of the spacings. seqFactors has a value like: {'GFD': [2, 3, 4, 6, 9, 12, 18, 23, 36, 46, 69, 92, 138, 207], 'ALW': [2, 3, 4, 6, ...], ...} Second, put the factor and its count into a tuple, and make a list of these tuples so we can sort them: Exclude factors larger than MAX_KEY_LENGTH: factors_by_count is a list of tuples: (factor, factorCount) factors_by_count has a value like: [(3, 497), (2, 487), ...] Sort the list by the factor count: Find out the sequences of 3 to 5 letters that occur multiple times in the ciphertext. repeated_seq_spacings has a value like: {'EXG': [192], 'NAF': [339, 972, 633], ... } (See getMostCommonFactors() for a description of seq_factors.) (See getMostCommonFactors() for a description of factors_by_count.) Now we extract the factor counts from factors_by_count and put them in all_likely_key_lengths so that they are easier to use later: Returns every nth letter for each keyLength set of letters in text. E.g. getNthSubkeysLetters(1, 3, 'ABCABCABC') returns 'AAA' getNthSubkeysLetters(2, 3, 'ABCABCABC') returns 'BBB' getNthSubkeysLetters(3, 3, 'ABCABCABC') returns 'CCC' getNthSubkeysLetters(1, 5, 'ABCDEFGHI') returns 'AF' Use a regular expression to remove non-letters from the message: Determine the most likely letters for each letter in the key: all_freq_scores is a list of mostLikelyKeyLength number of lists. These inner lists are the freq_scores lists. freq_scores is a list of tuples like: [(<letter>, <Eng. Freq. match score>), ... ] List is sorted by match score. Higher score means better match. See the englishFreqMatchScore() comments in freqAnalysis.py. Sort by match score: Use i + 1 so the first letter is not called the "0th" letter: Try every combination of the most likely letters for each position in the key: Create a possible key from the letters in all_freq_scores: Set the hacked ciphertext to the original casing: No English-looking decryption found, so return None: First, we need to do Kasiski Examination to figure out what the length of the ciphertext's encryption key is: If none of the key lengths we found using Kasiski Examination worked, start brute-forcing through key lengths: Don't re-check key lengths already tried from Kasiski: Instead of typing this ciphertext out, you can copy & paste it from https://www.nostarch.com/crackingcodes/. ciphertext = input('\nEnter ciphertext: ') | 3,708 | en | 0.855258 |
# Pyrogram - Telegram MTProto API Client Library for Python
# Copyright (C) 2017-2020 Dan <https://github.com/delivrance>
#
# This file is part of Pyrogram.
#
# Pyrogram is free software: you can redistribute it and/or modify
# it under the terms of the GNU Lesser General Public License as published
# by the Free Software Foundation, either version 3 of the License, or
# (at your option) any later version.
#
# Pyrogram is distributed in the hope that it will be useful,
# but WITHOUT ANY WARRANTY; without even the implied warranty of
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
# GNU Lesser General Public License for more details.
#
# You should have received a copy of the GNU Lesser General Public License
# along with Pyrogram. If not, see <http://www.gnu.org/licenses/>.
from io import BytesIO
from pyrogram.raw.core.primitives import Int, Long, Int128, Int256, Bool, Bytes, String, Double, Vector
from pyrogram.raw.core import TLObject
from pyrogram import raw
from typing import List, Union, Any
# # # # # # # # # # # # # # # # # # # # # # # #
# !!! WARNING !!! #
# This is a generated file! #
# All changes made in this file will be lost! #
# # # # # # # # # # # # # # # # # # # # # # # #
class GetDialogUnreadMarks(TLObject): # type: ignore
"""Telegram API method.
Details:
- Layer: ``117``
- ID: ``0x22e24e22``
**No parameters required.**
Returns:
List of :obj:`DialogPeer <pyrogram.raw.base.DialogPeer>`
"""
__slots__: List[str] = []
ID = 0x22e24e22
QUALNAME = "functions.messages.GetDialogUnreadMarks"
def __init__(self) -> None:
pass
@staticmethod
def read(data: BytesIO, *args: Any) -> "GetDialogUnreadMarks":
# No flags
return GetDialogUnreadMarks()
def write(self) -> bytes:
data = BytesIO()
data.write(Int(self.ID, False))
# No flags
return data.getvalue()
| venv/Lib/site-packages/pyrogram/raw/functions/messages/get_dialog_unread_marks.py | 2,020 | Telegram API method.
Details:
- Layer: ``117``
- ID: ``0x22e24e22``
**No parameters required.**
Returns:
List of :obj:`DialogPeer <pyrogram.raw.base.DialogPeer>`
Pyrogram - Telegram MTProto API Client Library for Python Copyright (C) 2017-2020 Dan <https://github.com/delivrance> This file is part of Pyrogram. Pyrogram is free software: you can redistribute it and/or modify it under the terms of the GNU Lesser General Public License as published by the Free Software Foundation, either version 3 of the License, or (at your option) any later version. Pyrogram is distributed in the hope that it will be useful, but WITHOUT ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU Lesser General Public License for more details. You should have received a copy of the GNU Lesser General Public License along with Pyrogram. If not, see <http://www.gnu.org/licenses/>. !!! WARNING !!! This is a generated file! All changes made in this file will be lost! type: ignore No flags No flags | 1,171 | en | 0.821111 |
# Copyright 2022 Google LLC
#
# Licensed under the Apache License, Version 2.0 (the License);
# you may not use this file except in compliance with the License.
# You may obtain a copy of the License at
#
# https://www.apache.org/licenses/LICENSE-2.0
#
# Unless required by applicable law or agreed to in writing, software
# distributed under the License is distributed on an AS IS BASIS,
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
# See the License for the specific language governing permissions and
# limitations under the License.
"""Module for concrete model entities."""
from typing import Dict, Optional, List
from model.entity_field import EntityField
from model.entity_type import EntityType
class Entity(object):
"""Class to represent entities within the concrete model.
Attributes:
name: Human readable name of an entity.
guid: UUID4 value for an entity.
cloud_device_id: IoT application device id.
type_name: Instance of EntityType class.
fields: Mapping of standard field names to EntityField instances.
is_reporting: if an entity maps 1:1 to a reporting device, it is a reporting
entity.
metadata: Contextual metadata coming from a physical device. i.e.
{
location: '/Sif-Solo/Site 1 - Sif/Charleston Road North/B13 - 1875
Charleston/Roof',
control_programs: ['Trane AC-1', '1875 Charleston'],
device_id: 'DEV:2809009'
}
"""
def __init__(self,
name: str,
cloud_device_id: Optional[str],
type_name: EntityType,
fields: List[EntityField],
is_reporting: bool,
guid: Optional[str] = None,
metadata: Optional[Dict[str, str]] = None):
"""Init.
Args:
name: the entity's name.
cloud_device_id: Device id iot core or any iot application.
type_name: DBO entity type stored in EntityType instance.
fields: List of standard field names.
is_reporting: if an entity maps 1:1 to a reporting device, it is a
reporting entity.
guid: [Optional] Universally Unique identification code for an entity.
metadata: Contextual metadata about an entity.
"""
self.name = name
self._guid = guid
self.cloud_device_id = cloud_device_id
self.type_name = type_name
self._fields = fields
self.is_reporting = is_reporting
self.metadata = metadata
@classmethod
def FromDict(cls, entity_dict: Dict[str, object]):
"""class method to create an instance of Entity from mapping of entity attributes to values.
Args:
entity_dict: dictionary mapping field attributes to values from a
loadsheet or building configuration.
Returns:
An instance of Entity class.
"""
@property
def fields(self) -> Dict[str, EntityField]:
"""Returns a mapping of standard field names to EntityField instances associated with self."""
return self._fields
@fields.setter
def fields(self, new_fields: Dict[str, EntityField]) -> None:
"""Validates that each value of new_fields is an instance of EntityField class and sets.
Arguments:
new_fields: A mapping of standard field names to EntityField instances.
"""
@property
def guid(self) -> str:
"""Returns the GUID associated with self."""
return self._guid
@guid.setter
def guid(self, guid: Optional[str] = None) -> None:
"""If guid argument is none, generate a new guid for set or just set if none.
Args:
guid: [Optional] A UUID string.
"""
| tools/concrete_model/model/entity.py | 3,581 | Class to represent entities within the concrete model.
Attributes:
name: Human readable name of an entity.
guid: UUID4 value for an entity.
cloud_device_id: IoT application device id.
type_name: Instance of EntityType class.
fields: Mapping of standard field names to EntityField instances.
is_reporting: if an entity maps 1:1 to a reporting device, it is a reporting
entity.
metadata: Contextual metadata coming from a physical device. i.e.
{
location: '/Sif-Solo/Site 1 - Sif/Charleston Road North/B13 - 1875
Charleston/Roof',
control_programs: ['Trane AC-1', '1875 Charleston'],
device_id: 'DEV:2809009'
}
class method to create an instance of Entity from mapping of entity attributes to values.
Args:
entity_dict: dictionary mapping field attributes to values from a
loadsheet or building configuration.
Returns:
An instance of Entity class.
Init.
Args:
name: the entity's name.
cloud_device_id: Device id iot core or any iot application.
type_name: DBO entity type stored in EntityType instance.
fields: List of standard field names.
is_reporting: if an entity maps 1:1 to a reporting device, it is a
reporting entity.
guid: [Optional] Universally Unique identification code for an entity.
metadata: Contextual metadata about an entity.
Returns a mapping of standard field names to EntityField instances associated with self.
Validates that each value of new_fields is an instance of EntityField class and sets.
Arguments:
new_fields: A mapping of standard field names to EntityField instances.
Returns the GUID associated with self.
If guid argument is none, generate a new guid for set or just set if none.
Args:
guid: [Optional] A UUID string.
Module for concrete model entities.
Copyright 2022 Google LLC Licensed under the Apache License, Version 2.0 (the License); you may not use this file except in compliance with the License. You may obtain a copy of the License at https://www.apache.org/licenses/LICENSE-2.0 Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on an AS IS BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the specific language governing permissions and limitations under the License. | 2,321 | en | 0.795702 |
#!/usr/bin/env python
#encoding: utf8
import unittest, rostest
import rosnode, rospy
import time
from pimouse_ros.msg import MotorFreqs
from geometry_msgs.msg import Twist
from std_srvs.srv import Trigger, TriggerResponse
from pimouse_ros.srv import TimedMotion
class MotorTest(unittest.TestCase):
def setUp(self):
rospy.wait_for_service('/motor_on')
rospy.wait_for_service('/motor_off')
rospy.wait_for_service('/timed_motion')
on = rospy.ServiceProxy('/motor_on', Trigger)
ret = on()
def file_check(self,dev,value,message):
with open("/dev/" + dev,"r") as f:
self.assertEqual(f.readline(),str(value)+"\n",message)
def test_node_exist(self):
nodes = rosnode.get_node_names()
self.assertIn('/motors', nodes, "node does not exist")
def test_put_freq(self):
pub = rospy.Publisher('/motor_raw', MotorFreqs)
m = MotorFreqs()
m.left_hz = 123
m.right_hz = 456
for i in range(10):
pub.publish(m)
time.sleep(0.1)
self.file_check("rtmotor_raw_l0",m.left_hz,"wrong left value from motor_raw")
self.file_check("rtmotor_raw_r0",m.right_hz,"wrong right value from motor_raw")
def test_put_cmd_vel(self):
pub = rospy.Publisher('/cmd_vel', Twist)
m = Twist()
m.linear.x = 0.1414
m.angular.z = 1.57
for i in range(10):
pub.publish(m)
time.sleep(0.1)
self.file_check("rtmotor_raw_l0",200,"wrong left value from cmd_vel")
self.file_check("rtmotor_raw_r0",600,"wrong right value from cmd_vel")
time.sleep(1.1)
self.file_check("rtmotor_raw_r0",0,"don't stop after 1[s]")
self.file_check("rtmotor_raw_l0",0,"don't stop after 1[s]")
def test_on_off(self):
off = rospy.ServiceProxy('/motor_off', Trigger)
ret = off()
self.assertEqual(ret.success, True, "motor off does not succeeded")
self.assertEqual(ret.message, "OFF", "motor off wrong message")
with open("/dev/rtmotoren0","r") as f:
data = f.readline()
self.assertEqual(data,"0\n","wrong value in rtmotor0 at motor off")
on = rospy.ServiceProxy('motor_on', Trigger)
ret = on()
self.assertEqual(ret.success, True, "motor on does not succeeded")
self.assertEqual(ret.message, "ON", "motor on wrong message")
with open("/dev/rtmotoren0","r") as f:
data = f.readline()
self.assertEqual(data,"1\n","wrong value in rtmotor0 at motor on")
def test_put_value_timed(self):
tm = rospy.ServiceProxy('/timed_motion', TimedMotion)
tm(-321, 654, 1500)
with open("/dev/rtmotor0", "r") as f:
data = f.readline()
self.assertEqual(data, "-321 654 1500\n", "value does not written to rtmotor0")
if __name__ == '__main__':
rospy.init_node('travis_test_motors')
rostest.rosrun('pimouse_ros','travis_test_motors', MotorTest)
| test/travis_test_motors.py | 3,022 | !/usr/bin/env pythonencoding: utf8 | 34 | ca | 0.189331 |
# Python GLFW hello world example based on C++ guide at
# http://www.glfw.org/docs/latest/quick.html
import sys
import glfw
import numpy
from OpenGL import GL
from OpenGL.GL.shaders import compileShader, compileProgram
from OpenGL.arrays import vbo
from openvr.glframework.glmatrix import rotate_z, ortho, pack
def main():
# Initialize GLFW OpenGL API
glfw.set_error_callback(error_callback)
if not glfw.init():
raise Exception("GLFW Initialization error")
# Use modern OpenGL version 4.5 core
glfw.window_hint(glfw.CONTEXT_VERSION_MAJOR, 4)
glfw.window_hint(glfw.CONTEXT_VERSION_MINOR, 5)
glfw.window_hint(glfw.OPENGL_PROFILE, glfw.OPENGL_CORE_PROFILE)
# Create OpenGL window and context
window = glfw.create_window(640, 480, "Triangle Viewer", None, None)
if not window:
glfw.terminate()
raise RuntimeError("Failed to create glfw window")
glfw.make_context_current(window)
glfw.swap_interval(1)
# Create vertex array object, apparently required for modern OpenGL
vao = GL.glGenVertexArrays(1)
GL.glBindVertexArray(vao)
# Create triangle geometry: corner 2D location and colors
vertices = vbo.VBO(numpy.array([
[-0.6, -0.4, 1.0, 0.0, 0.0], # x, y, r, g, b
[0.6, -0.4, 0.0, 1.0, 0.0],
[0.0, 0.6, 0.0, 0.0, 1.0],
], dtype='float32'))
vertices.bind()
# hard-code shader parameter location indices
mvp_location = 0
vpos_location = 0
vcol_location = 1
GL.glEnableVertexAttribArray(vpos_location)
fsize = vertices.dtype.itemsize # 4 bytes per float32
GL.glVertexAttribPointer(vpos_location, 2, GL.GL_FLOAT, False,
fsize * 5, vertices + fsize * 0)
GL.glEnableVertexAttribArray(vcol_location)
GL.glVertexAttribPointer(vcol_location, 3, GL.GL_FLOAT, False,
fsize * 5, vertices + fsize * 2)
# Create GLSL shader program
vertex_shader = compileShader(
"""#version 450 core
#line 55
layout(location = %d) uniform mat4 MVP = mat4(1);
layout(location = %d) in vec2 vPos;
layout(location = %d) in vec3 vCol;
out vec3 color;
void main()
{
gl_Position = MVP * vec4(vPos, 0.0, 1.0);
color = vCol;
}
""" % (mvp_location, vpos_location, vcol_location),
GL.GL_VERTEX_SHADER)
fragment_shader = compileShader(
"""#version 450 core
#line 73
in vec3 color;
out vec4 fragColor;
void main()
{
fragColor = vec4(color, 1);
}
""",
GL.GL_FRAGMENT_SHADER)
program = compileProgram(vertex_shader, fragment_shader)
# Repeatedly draw until some event stops the program
while not glfw.window_should_close(window):
glfw.make_context_current(window)
width, height = glfw.get_framebuffer_size(window)
GL.glViewport(0, 0, width, height)
GL.glClear(GL.GL_COLOR_BUFFER_BIT)
m = rotate_z(glfw.get_time()) # modelview matrix, m
ratio = width / float(height)
# projection matrix, p
p = ortho(-ratio, ratio, -1.0, 1.0, 1.0, -1.0)
mvp = m * p
GL.glBindVertexArray(vao)
GL.glUseProgram(program)
GL.glUniformMatrix4fv(mvp_location, 1, False, pack(mvp))
GL.glDrawArrays(GL.GL_TRIANGLES, 0, 3)
glfw.swap_buffers(window)
glfw.poll_events()
# Clean up and exit
glfw.make_context_current(window)
glfw.destroy_window(window)
glfw.terminate()
sys.exit(0)
def error_callback(description):
raise RuntimeError(description)
if __name__ == "__main__":
main()
| src/python/vrprim/mesh/glfw_triangle.py | 3,844 | Python GLFW hello world example based on C++ guide at http://www.glfw.org/docs/latest/quick.html Initialize GLFW OpenGL API Use modern OpenGL version 4.5 core Create OpenGL window and context Create vertex array object, apparently required for modern OpenGL Create triangle geometry: corner 2D location and colors x, y, r, g, b hard-code shader parameter location indices 4 bytes per float32 Create GLSL shader program Repeatedly draw until some event stops the program modelview matrix, m projection matrix, p Clean up and exit | 529 | en | 0.554313 |
"""general utility functions for HTML Map templates"""
def safe_quotes(text, escape_single_quotes=False):
"""htmlify string"""
if isinstance(text, str):
safe_text = text.replace('"', """)
if escape_single_quotes:
safe_text = safe_text.replace("'", "\'")
return safe_text.replace('True', 'true')
return text
def quote_filter(value):
return safe_quotes(value.unescape())
def iframe_size_filter(value):
if isinstance(value, str):
return value
return '%spx;' % value
def clear_none_filter(value):
return dict(filter(lambda item: item[1] is not None, value.items()))
| cartoframes/viz/html/utils.py | 652 | htmlify string
general utility functions for HTML Map templates | 63 | en | 0.472752 |
import unittest
from quarkchain.cluster.tests.test_utils import (
create_transfer_transaction,
ClusterContext,
)
from quarkchain.core import (
Address,
Branch,
Identity,
TokenBalanceMap,
XshardTxCursorInfo,
)
from quarkchain.evm import opcodes
from quarkchain.utils import call_async, assert_true_with_timeout
from quarkchain.cluster.p2p_commands import (
CommandOp,
GetRootBlockHeaderListWithSkipRequest,
GetMinorBlockHeaderListWithSkipRequest,
Direction,
)
def _tip_gen(shard_state):
coinbase_amount = (
shard_state.env.quark_chain_config.shards[
shard_state.full_shard_id
].COINBASE_AMOUNT
// 2
)
b = shard_state.get_tip().create_block_to_append()
evm_state = shard_state.run_block(b)
coinbase_amount_map = TokenBalanceMap(evm_state.block_fee_tokens)
coinbase_amount_map.add(
{shard_state.env.quark_chain_config.genesis_token: coinbase_amount}
)
b.finalize(evm_state=evm_state, coinbase_amount_map=coinbase_amount_map)
return b
class TestCluster(unittest.TestCase):
def test_single_cluster(self):
id1 = Identity.create_random_identity()
acc1 = Address.create_from_identity(id1, full_shard_key=0)
with ClusterContext(1, acc1) as clusters:
self.assertEqual(len(clusters), 1)
def test_three_clusters(self):
with ClusterContext(3) as clusters:
self.assertEqual(len(clusters), 3)
def test_create_shard_at_different_height(self):
acc1 = Address.create_random_account(0)
id1 = 0 << 16 | 1 | 0
id2 = 1 << 16 | 1 | 0
genesis_root_heights = {id1: 1, id2: 2}
with ClusterContext(
1,
acc1,
chain_size=2,
shard_size=1,
genesis_root_heights=genesis_root_heights,
) as clusters:
master = clusters[0].master
self.assertIsNone(clusters[0].get_shard(id1))
self.assertIsNone(clusters[0].get_shard(id2))
# Add root block with height 1, which will automatically create genesis block for shard 0
root0 = call_async(master.get_next_block_to_mine(acc1, branch_value=None))
self.assertEqual(root0.header.height, 1)
self.assertEqual(len(root0.minor_block_header_list), 0)
self.assertEqual(
root0.header.coinbase_amount_map.balance_map[
master.env.quark_chain_config.genesis_token
],
master.env.quark_chain_config.ROOT.COINBASE_AMOUNT,
)
call_async(master.add_root_block(root0))
# shard 0 created at root height 1
self.assertIsNotNone(clusters[0].get_shard(id1))
self.assertIsNone(clusters[0].get_shard(id2))
# shard 0 block should have correct root block and cursor info
shard_state = clusters[0].get_shard(id1).state
self.assertEqual(
shard_state.header_tip.hash_prev_root_block, root0.header.get_hash()
)
self.assertEqual(
shard_state.get_tip().meta.xshard_tx_cursor_info,
XshardTxCursorInfo(1, 0, 0),
)
self.assertEqual(
shard_state.get_token_balance(
acc1.recipient, shard_state.env.quark_chain_config.genesis_token
),
1000000, # from create_test_clusters in genesis alloc
)
# Add root block with height 2, which will automatically create genesis block for shard 1
root1 = call_async(master.get_next_block_to_mine(acc1, branch_value=None))
self.assertEqual(len(root1.minor_block_header_list), 1)
self.assertEqual(
root1.header.coinbase_amount_map.balance_map[
master.env.quark_chain_config.genesis_token
],
master.env.quark_chain_config.ROOT.COINBASE_AMOUNT
+ root1.minor_block_header_list[0].coinbase_amount_map.balance_map[
master.env.quark_chain_config.genesis_token
],
)
self.assertEqual(root1.minor_block_header_list[0], shard_state.header_tip)
call_async(master.add_root_block(root1))
self.assertIsNotNone(clusters[0].get_shard(id1))
# shard 1 created at root height 2
self.assertIsNotNone(clusters[0].get_shard(id2))
# X-shard from root should be deposited to the shard
mblock = shard_state.create_block_to_mine()
self.assertEqual(
mblock.meta.xshard_tx_cursor_info,
XshardTxCursorInfo(root1.header.height + 1, 0, 0),
)
call_async(clusters[0].get_shard(id1).add_block(mblock))
self.assertEqual(
shard_state.get_token_balance(
acc1.recipient, shard_state.env.quark_chain_config.genesis_token
),
root1.header.coinbase_amount_map.balance_map[
shard_state.env.quark_chain_config.genesis_token
]
+ root0.header.coinbase_amount_map.balance_map[
shard_state.env.quark_chain_config.genesis_token
]
+ 1000000, # from create_test_clusters in genesis alloc
)
self.assertEqual(
mblock.header.coinbase_amount_map.balance_map[
shard_state.env.quark_chain_config.genesis_token
],
shard_state.shard_config.COINBASE_AMOUNT // 2,
)
# Add root block with height 3, which will include
# - the genesis block for shard 1; and
# - the added block for shard 0.
root2 = call_async(master.get_next_block_to_mine(acc1, branch_value=None))
self.assertEqual(len(root2.minor_block_header_list), 2)
def test_get_primary_account_data(self):
id1 = Identity.create_random_identity()
acc1 = Address.create_from_identity(id1, full_shard_key=0)
acc2 = Address.create_random_account(full_shard_key=1)
with ClusterContext(1, acc1) as clusters:
master = clusters[0].master
slaves = clusters[0].slave_list
self.assertEqual(
call_async(master.get_primary_account_data(acc1)).transaction_count, 0
)
tx = create_transfer_transaction(
shard_state=clusters[0].get_shard_state(0b10),
key=id1.get_key(),
from_address=acc1,
to_address=acc1,
value=12345,
)
self.assertTrue(slaves[0].add_tx(tx))
root = call_async(
master.get_next_block_to_mine(address=acc1, branch_value=None)
)
call_async(master.add_root_block(root))
block1 = call_async(
master.get_next_block_to_mine(address=acc1, branch_value=0b10)
)
self.assertTrue(
call_async(
master.add_raw_minor_block(block1.header.branch, block1.serialize())
)
)
self.assertEqual(
call_async(master.get_primary_account_data(acc1)).transaction_count, 1
)
self.assertEqual(
call_async(master.get_primary_account_data(acc2)).transaction_count, 0
)
def test_add_transaction(self):
id1 = Identity.create_random_identity()
acc1 = Address.create_from_identity(id1, full_shard_key=0)
acc2 = Address.create_from_identity(id1, full_shard_key=1)
with ClusterContext(2, acc1) as clusters:
master = clusters[0].master
root = call_async(master.get_next_block_to_mine(acc1, branch_value=None))
call_async(master.add_root_block(root))
tx1 = create_transfer_transaction(
shard_state=clusters[0].get_shard_state(0b10),
key=id1.get_key(),
from_address=acc1,
to_address=acc1,
value=12345,
)
self.assertTrue(call_async(master.add_transaction(tx1)))
self.assertEqual(len(clusters[0].get_shard_state(0b10).tx_queue), 1)
tx2 = create_transfer_transaction(
shard_state=clusters[0].get_shard_state(0b11),
key=id1.get_key(),
from_address=acc2,
to_address=acc1,
value=12345,
gas=30000,
)
self.assertTrue(call_async(master.add_transaction(tx2)))
self.assertEqual(len(clusters[0].get_shard_state(0b11).tx_queue), 1)
# check the tx is received by the other cluster
tx_queue = clusters[1].get_shard_state(0b10).tx_queue
assert_true_with_timeout(lambda: len(tx_queue) == 1)
self.assertEqual(tx_queue.pop_transaction(), tx1.tx.to_evm_tx())
tx_queue = clusters[1].get_shard_state(0b11).tx_queue
assert_true_with_timeout(lambda: len(tx_queue) == 1)
self.assertEqual(tx_queue.pop_transaction(), tx2.tx.to_evm_tx())
def test_add_minor_block_request_list(self):
id1 = Identity.create_random_identity()
acc1 = Address.create_from_identity(id1, full_shard_key=0)
with ClusterContext(2, acc1) as clusters:
shard_state = clusters[0].get_shard_state(0b10)
b1 = _tip_gen(shard_state)
add_result = call_async(
clusters[0].master.add_raw_minor_block(b1.header.branch, b1.serialize())
)
self.assertTrue(add_result)
# Make sure the xshard list is not broadcasted to the other shard
self.assertFalse(
clusters[0]
.get_shard_state(0b11)
.contain_remote_minor_block_hash(b1.header.get_hash())
)
self.assertTrue(
clusters[0].master.root_state.db.contain_minor_block_by_hash(
b1.header.get_hash()
)
)
# Make sure another cluster received the new block
assert_true_with_timeout(
lambda: clusters[0]
.get_shard_state(0b10)
.contain_block_by_hash(b1.header.get_hash())
)
assert_true_with_timeout(
lambda: clusters[1].master.root_state.db.contain_minor_block_by_hash(
b1.header.get_hash()
)
)
def test_add_root_block_request_list(self):
id1 = Identity.create_random_identity()
acc1 = Address.create_from_identity(id1, full_shard_key=0)
with ClusterContext(2, acc1) as clusters:
# shutdown cluster connection
clusters[1].peer.close()
# add blocks in cluster 0
block_header_list = [clusters[0].get_shard_state(2 | 0).header_tip]
shard_state0 = clusters[0].get_shard_state(0b10)
for i in range(7):
b1 = _tip_gen(shard_state0)
add_result = call_async(
clusters[0].master.add_raw_minor_block(
b1.header.branch, b1.serialize()
)
)
self.assertTrue(add_result)
block_header_list.append(b1.header)
block_header_list.append(clusters[0].get_shard_state(2 | 1).header_tip)
shard_state0 = clusters[0].get_shard_state(0b11)
b2 = _tip_gen(shard_state0)
add_result = call_async(
clusters[0].master.add_raw_minor_block(b2.header.branch, b2.serialize())
)
self.assertTrue(add_result)
block_header_list.append(b2.header)
# add 1 block in cluster 1
shard_state1 = clusters[1].get_shard_state(0b11)
b3 = _tip_gen(shard_state1)
add_result = call_async(
clusters[1].master.add_raw_minor_block(b3.header.branch, b3.serialize())
)
self.assertTrue(add_result)
self.assertEqual(clusters[1].get_shard_state(0b11).header_tip, b3.header)
# reestablish cluster connection
call_async(
clusters[1].network.connect(
"127.0.0.1",
clusters[0].master.env.cluster_config.SIMPLE_NETWORK.BOOTSTRAP_PORT,
)
)
root_block1 = clusters[0].master.root_state.create_block_to_mine(
block_header_list, acc1
)
call_async(clusters[0].master.add_root_block(root_block1))
# Make sure the root block tip of local cluster is changed
self.assertEqual(clusters[0].master.root_state.tip, root_block1.header)
# Make sure the root block tip of cluster 1 is changed
assert_true_with_timeout(
lambda: clusters[1].master.root_state.tip == root_block1.header, 2
)
# Minor block is downloaded
self.assertEqual(b1.header.height, 7)
assert_true_with_timeout(
lambda: clusters[1].get_shard_state(0b10).header_tip == b1.header
)
# The tip is overwritten due to root chain first consensus
assert_true_with_timeout(
lambda: clusters[1].get_shard_state(0b11).header_tip == b2.header
)
def test_shard_synchronizer_with_fork(self):
id1 = Identity.create_random_identity()
acc1 = Address.create_from_identity(id1, full_shard_key=0)
with ClusterContext(2, acc1) as clusters:
# shutdown cluster connection
clusters[1].peer.close()
block_list = []
# cluster 0 has 13 blocks added
shard_state0 = clusters[0].get_shard_state(0b10)
for i in range(13):
block = _tip_gen(shard_state0)
add_result = call_async(
clusters[0].master.add_raw_minor_block(
block.header.branch, block.serialize()
)
)
self.assertTrue(add_result)
block_list.append(block)
self.assertEqual(clusters[0].get_shard_state(0b10).header_tip.height, 13)
# cluster 1 has 12 blocks added
shard_state0 = clusters[1].get_shard_state(0b10)
for i in range(12):
block = _tip_gen(shard_state0)
add_result = call_async(
clusters[1].master.add_raw_minor_block(
block.header.branch, block.serialize()
)
)
self.assertTrue(add_result)
self.assertEqual(clusters[1].get_shard_state(0b10).header_tip.height, 12)
# reestablish cluster connection
call_async(
clusters[1].network.connect(
"127.0.0.1",
clusters[0].master.env.cluster_config.SIMPLE_NETWORK.BOOTSTRAP_PORT,
)
)
# a new block from cluster 0 will trigger sync in cluster 1
shard_state0 = clusters[0].get_shard_state(0b10)
block = _tip_gen(shard_state0)
add_result = call_async(
clusters[0].master.add_raw_minor_block(
block.header.branch, block.serialize()
)
)
self.assertTrue(add_result)
block_list.append(block)
# expect cluster 1 has all the blocks from cluter 0 and
# has the same tip as cluster 0
for block in block_list:
assert_true_with_timeout(
lambda: clusters[1]
.slave_list[0]
.shards[Branch(0b10)]
.state.contain_block_by_hash(block.header.get_hash())
)
assert_true_with_timeout(
lambda: clusters[
1
].master.root_state.db.contain_minor_block_by_hash(
block.header.get_hash()
)
)
self.assertEqual(
clusters[1].get_shard_state(0b10).header_tip,
clusters[0].get_shard_state(0b10).header_tip,
)
def test_shard_genesis_fork_fork(self):
""" Test shard forks at genesis blocks due to root chain fork at GENESIS.ROOT_HEIGHT"""
acc1 = Address.create_random_account(0)
acc2 = Address.create_random_account(1)
genesis_root_heights = {2: 0, 3: 1}
with ClusterContext(
2,
acc1,
chain_size=1,
shard_size=2,
genesis_root_heights=genesis_root_heights,
) as clusters:
# shutdown cluster connection
clusters[1].peer.close()
master0 = clusters[0].master
root0 = call_async(master0.get_next_block_to_mine(acc1, branch_value=None))
call_async(master0.add_root_block(root0))
genesis0 = (
clusters[0].get_shard_state(2 | 1).db.get_minor_block_by_height(0)
)
self.assertEqual(
genesis0.header.hash_prev_root_block, root0.header.get_hash()
)
master1 = clusters[1].master
root1 = call_async(master1.get_next_block_to_mine(acc2, branch_value=None))
self.assertNotEqual(root0.header.get_hash(), root1.header.get_hash())
call_async(master1.add_root_block(root1))
genesis1 = (
clusters[1].get_shard_state(2 | 1).db.get_minor_block_by_height(0)
)
self.assertEqual(
genesis1.header.hash_prev_root_block, root1.header.get_hash()
)
self.assertNotEqual(genesis0.header.get_hash(), genesis1.header.get_hash())
# let's make cluster1's root chain longer than cluster0's
root2 = call_async(master1.get_next_block_to_mine(acc2, branch_value=None))
call_async(master1.add_root_block(root2))
self.assertEqual(master1.root_state.tip.height, 2)
# reestablish cluster connection
call_async(
clusters[1].network.connect(
"127.0.0.1",
clusters[0].master.env.cluster_config.SIMPLE_NETWORK.BOOTSTRAP_PORT,
)
)
# Expect cluster0's genesis change to genesis1
assert_true_with_timeout(
lambda: clusters[0]
.get_shard_state(2 | 1)
.db.get_minor_block_by_height(0)
.header.get_hash()
== genesis1.header.get_hash()
)
self.assertTrue(clusters[0].get_shard_state(2 | 1).root_tip == root2.header)
def test_broadcast_cross_shard_transactions(self):
""" Test the cross shard transactions are broadcasted to the destination shards """
id1 = Identity.create_random_identity()
acc1 = Address.create_from_identity(id1, full_shard_key=0)
acc3 = Address.create_random_account(full_shard_key=1)
with ClusterContext(1, acc1) as clusters:
master = clusters[0].master
slaves = clusters[0].slave_list
genesis_token = (
clusters[0].get_shard_state(2 | 0).env.quark_chain_config.genesis_token
)
# Add a root block first so that later minor blocks referring to this root
# can be broadcasted to other shards
root_block = call_async(
master.get_next_block_to_mine(
Address.create_empty_account(), branch_value=None
)
)
call_async(master.add_root_block(root_block))
tx1 = create_transfer_transaction(
shard_state=clusters[0].get_shard_state(2 | 0),
key=id1.get_key(),
from_address=acc1,
to_address=acc3,
value=54321,
gas=opcodes.GTXXSHARDCOST + opcodes.GTXCOST,
)
self.assertTrue(slaves[0].add_tx(tx1))
b1 = clusters[0].get_shard_state(2 | 0).create_block_to_mine(address=acc1)
b2 = clusters[0].get_shard_state(2 | 0).create_block_to_mine(address=acc1)
b2.header.create_time += 1
self.assertNotEqual(b1.header.get_hash(), b2.header.get_hash())
call_async(clusters[0].get_shard(2 | 0).add_block(b1))
# expect shard 1 got the CrossShardTransactionList of b1
xshard_tx_list = (
clusters[0]
.get_shard_state(2 | 1)
.db.get_minor_block_xshard_tx_list(b1.header.get_hash())
)
self.assertEqual(len(xshard_tx_list.tx_list), 1)
self.assertEqual(xshard_tx_list.tx_list[0].tx_hash, tx1.get_hash())
self.assertEqual(xshard_tx_list.tx_list[0].from_address, acc1)
self.assertEqual(xshard_tx_list.tx_list[0].to_address, acc3)
self.assertEqual(xshard_tx_list.tx_list[0].value, 54321)
call_async(clusters[0].get_shard(2 | 0).add_block(b2))
# b2 doesn't update tip
self.assertEqual(clusters[0].get_shard_state(2 | 0).header_tip, b1.header)
# expect shard 1 got the CrossShardTransactionList of b2
xshard_tx_list = (
clusters[0]
.get_shard_state(2 | 1)
.db.get_minor_block_xshard_tx_list(b2.header.get_hash())
)
self.assertEqual(len(xshard_tx_list.tx_list), 1)
self.assertEqual(xshard_tx_list.tx_list[0].tx_hash, tx1.get_hash())
self.assertEqual(xshard_tx_list.tx_list[0].from_address, acc1)
self.assertEqual(xshard_tx_list.tx_list[0].to_address, acc3)
self.assertEqual(xshard_tx_list.tx_list[0].value, 54321)
b3 = (
clusters[0]
.get_shard_state(2 | 1)
.create_block_to_mine(address=acc1.address_in_shard(1))
)
call_async(master.add_raw_minor_block(b3.header.branch, b3.serialize()))
root_block = call_async(
master.get_next_block_to_mine(address=acc1, branch_value=None)
)
call_async(master.add_root_block(root_block))
# b4 should include the withdraw of tx1
b4 = (
clusters[0]
.get_shard_state(2 | 1)
.create_block_to_mine(address=acc1.address_in_shard(1))
)
# adding b1, b2, b3 again shouldn't affect b4 to be added later
self.assertTrue(
call_async(master.add_raw_minor_block(b1.header.branch, b1.serialize()))
)
self.assertTrue(
call_async(master.add_raw_minor_block(b2.header.branch, b2.serialize()))
)
self.assertTrue(
call_async(master.add_raw_minor_block(b3.header.branch, b3.serialize()))
)
self.assertTrue(
call_async(master.add_raw_minor_block(b4.header.branch, b4.serialize()))
)
self.assertEqual(
call_async(
master.get_primary_account_data(acc3)
).token_balances.balance_map,
{genesis_token: 54321},
)
def test_broadcast_cross_shard_transactions_to_neighbor_only(self):
""" Test the broadcast is only done to the neighbors """
id1 = Identity.create_random_identity()
acc1 = Address.create_from_identity(id1, full_shard_key=0)
# create 64 shards so that the neighbor rule can kick in
# explicitly set num_slaves to 4 so that it does not spin up 64 slaves
with ClusterContext(1, acc1, shard_size=64, num_slaves=4) as clusters:
master = clusters[0].master
# Add a root block first so that later minor blocks referring to this root
# can be broadcasted to other shards
root_block = call_async(
master.get_next_block_to_mine(
Address.create_empty_account(), branch_value=None
)
)
call_async(master.add_root_block(root_block))
b1 = clusters[0].get_shard_state(64).create_block_to_mine(address=acc1)
self.assertTrue(
call_async(master.add_raw_minor_block(b1.header.branch, b1.serialize()))
)
neighbor_shards = [2 ** i for i in range(6)]
for shard_id in range(64):
xshard_tx_list = (
clusters[0]
.get_shard_state(64 | shard_id)
.db.get_minor_block_xshard_tx_list(b1.header.get_hash())
)
# Only neighbor should have it
if shard_id in neighbor_shards:
self.assertIsNotNone(xshard_tx_list)
else:
self.assertIsNone(xshard_tx_list)
def test_get_work_from_slave(self):
genesis = Address.create_empty_account(full_shard_key=0)
with ClusterContext(1, genesis, remote_mining=True) as clusters:
slaves = clusters[0].slave_list
# no posw
state = clusters[0].get_shard_state(2 | 0)
branch = state.create_block_to_mine().header.branch
work = call_async(slaves[0].get_work(branch))
self.assertEqual(work.difficulty, 10)
# enable posw, with total stakes cover all the window
state.shard_config.POSW_CONFIG.ENABLED = True
state.shard_config.POSW_CONFIG.TOTAL_STAKE_PER_BLOCK = 500000
work = call_async(slaves[0].get_work(branch))
self.assertEqual(work.difficulty, 0)
def test_handle_get_minor_block_list_request_with_total_diff(self):
id1 = Identity.create_random_identity()
acc1 = Address.create_from_identity(id1, full_shard_key=0)
with ClusterContext(2, acc1) as clusters:
cluster0_root_state = clusters[0].master.root_state
cluster1_root_state = clusters[1].master.root_state
coinbase = cluster1_root_state._calculate_root_block_coinbase([], 0)
# Cluster 0 generates a root block of height 1 with 1e6 difficulty
rb0 = cluster0_root_state.get_tip_block()
rb1 = rb0.create_block_to_append(difficulty=int(1e6)).finalize(coinbase)
# Establish cluster connection
call_async(
clusters[1].network.connect(
"127.0.0.1",
clusters[0].master.env.cluster_config.SIMPLE_NETWORK.BOOTSTRAP_PORT,
)
)
# Cluster 0 broadcasts the root block to cluster 1
call_async(clusters[0].master.add_root_block(rb1))
self.assertEqual(cluster0_root_state.tip.get_hash(), rb1.header.get_hash())
# Make sure the root block tip of cluster 1 is changed
assert_true_with_timeout(lambda: cluster1_root_state.tip == rb1.header, 2)
# Cluster 1 generates a minor block and broadcasts to cluster 0
shard_state = clusters[1].get_shard_state(0b10)
b1 = _tip_gen(shard_state)
add_result = call_async(
clusters[1].master.add_raw_minor_block(b1.header.branch, b1.serialize())
)
self.assertTrue(add_result)
# Make sure another cluster received the new minor block
assert_true_with_timeout(
lambda: clusters[1]
.get_shard_state(0b10)
.contain_block_by_hash(b1.header.get_hash())
)
assert_true_with_timeout(
lambda: clusters[0].master.root_state.db.contain_minor_block_by_hash(
b1.header.get_hash()
)
)
# Cluster 1 generates a new root block with higher total difficulty
rb2 = rb0.create_block_to_append(difficulty=int(3e6)).finalize(coinbase)
call_async(clusters[1].master.add_root_block(rb2))
self.assertEqual(cluster1_root_state.tip.get_hash(), rb2.header.get_hash())
# Generate a minor block b2
b2 = _tip_gen(shard_state)
add_result = call_async(
clusters[1].master.add_raw_minor_block(b2.header.branch, b2.serialize())
)
self.assertTrue(add_result)
# Make sure another cluster received the new minor block
assert_true_with_timeout(
lambda: clusters[1]
.get_shard_state(0b10)
.contain_block_by_hash(b2.header.get_hash())
)
assert_true_with_timeout(
lambda: clusters[0].master.root_state.db.contain_minor_block_by_hash(
b2.header.get_hash()
)
)
def test_new_block_header_pool(self):
id1 = Identity.create_random_identity()
acc1 = Address.create_from_identity(id1, full_shard_key=0)
with ClusterContext(1, acc1) as clusters:
shard_state = clusters[0].get_shard_state(0b10)
b1 = _tip_gen(shard_state)
add_result = call_async(
clusters[0].master.add_raw_minor_block(b1.header.branch, b1.serialize())
)
self.assertTrue(add_result)
# Update config to force checking diff
clusters[
0
].master.env.quark_chain_config.SKIP_MINOR_DIFFICULTY_CHECK = False
b2 = b1.create_block_to_append(difficulty=12345)
shard = clusters[0].slave_list[0].shards[b2.header.branch]
with self.assertRaises(ValueError):
call_async(shard.handle_new_block(b2))
# Also the block should not exist in new block pool
self.assertTrue(
b2.header.get_hash() not in shard.state.new_block_header_pool
)
def test_get_root_block_headers_with_skip(self):
""" Test the broadcast is only done to the neighbors """
id1 = Identity.create_random_identity()
acc1 = Address.create_from_identity(id1, full_shard_key=0)
with ClusterContext(2, acc1) as clusters:
master = clusters[0].master
# Add a root block first so that later minor blocks referring to this root
# can be broadcasted to other shards
root_block_header_list = [master.root_state.tip]
for i in range(10):
root_block = call_async(
master.get_next_block_to_mine(
Address.create_empty_account(), branch_value=None
)
)
call_async(master.add_root_block(root_block))
root_block_header_list.append(root_block.header)
self.assertEqual(root_block_header_list[-1].height, 10)
assert_true_with_timeout(
lambda: clusters[1].master.root_state.tip.height == 10
)
peer = clusters[1].peer
# Test Case 1 ###################################################
op, resp, rpc_id = call_async(
peer.write_rpc_request(
op=CommandOp.GET_ROOT_BLOCK_HEADER_LIST_WITH_SKIP_REQUEST,
cmd=GetRootBlockHeaderListWithSkipRequest.create_for_height(
height=1, skip=1, limit=3, direction=Direction.TIP
),
)
)
self.assertEqual(len(resp.block_header_list), 3)
self.assertEqual(resp.block_header_list[0], root_block_header_list[1])
self.assertEqual(resp.block_header_list[1], root_block_header_list[3])
self.assertEqual(resp.block_header_list[2], root_block_header_list[5])
op, resp, rpc_id = call_async(
peer.write_rpc_request(
op=CommandOp.GET_ROOT_BLOCK_HEADER_LIST_WITH_SKIP_REQUEST,
cmd=GetRootBlockHeaderListWithSkipRequest.create_for_hash(
hash=root_block_header_list[1].get_hash(),
skip=1,
limit=3,
direction=Direction.TIP,
),
)
)
self.assertEqual(len(resp.block_header_list), 3)
self.assertEqual(resp.block_header_list[0], root_block_header_list[1])
self.assertEqual(resp.block_header_list[1], root_block_header_list[3])
self.assertEqual(resp.block_header_list[2], root_block_header_list[5])
# Test Case 2 ###################################################
op, resp, rpc_id = call_async(
peer.write_rpc_request(
op=CommandOp.GET_ROOT_BLOCK_HEADER_LIST_WITH_SKIP_REQUEST,
cmd=GetRootBlockHeaderListWithSkipRequest.create_for_height(
height=2, skip=2, limit=4, direction=Direction.TIP
),
)
)
self.assertEqual(len(resp.block_header_list), 3)
self.assertEqual(resp.block_header_list[0], root_block_header_list[2])
self.assertEqual(resp.block_header_list[1], root_block_header_list[5])
self.assertEqual(resp.block_header_list[2], root_block_header_list[8])
op, resp, rpc_id = call_async(
peer.write_rpc_request(
op=CommandOp.GET_ROOT_BLOCK_HEADER_LIST_WITH_SKIP_REQUEST,
cmd=GetRootBlockHeaderListWithSkipRequest.create_for_hash(
hash=root_block_header_list[2].get_hash(),
skip=2,
limit=4,
direction=Direction.TIP,
),
)
)
self.assertEqual(len(resp.block_header_list), 3)
self.assertEqual(resp.block_header_list[0], root_block_header_list[2])
self.assertEqual(resp.block_header_list[1], root_block_header_list[5])
self.assertEqual(resp.block_header_list[2], root_block_header_list[8])
# Test Case 3 ###################################################
op, resp, rpc_id = call_async(
peer.write_rpc_request(
op=CommandOp.GET_ROOT_BLOCK_HEADER_LIST_WITH_SKIP_REQUEST,
cmd=GetRootBlockHeaderListWithSkipRequest.create_for_height(
height=6, skip=0, limit=100, direction=Direction.TIP
),
)
)
self.assertEqual(len(resp.block_header_list), 5)
self.assertEqual(resp.block_header_list[0], root_block_header_list[6])
self.assertEqual(resp.block_header_list[1], root_block_header_list[7])
self.assertEqual(resp.block_header_list[2], root_block_header_list[8])
self.assertEqual(resp.block_header_list[3], root_block_header_list[9])
self.assertEqual(resp.block_header_list[4], root_block_header_list[10])
op, resp, rpc_id = call_async(
peer.write_rpc_request(
op=CommandOp.GET_ROOT_BLOCK_HEADER_LIST_WITH_SKIP_REQUEST,
cmd=GetRootBlockHeaderListWithSkipRequest.create_for_hash(
hash=root_block_header_list[6].get_hash(),
skip=0,
limit=100,
direction=Direction.TIP,
),
)
)
self.assertEqual(len(resp.block_header_list), 5)
self.assertEqual(resp.block_header_list[0], root_block_header_list[6])
self.assertEqual(resp.block_header_list[1], root_block_header_list[7])
self.assertEqual(resp.block_header_list[2], root_block_header_list[8])
self.assertEqual(resp.block_header_list[3], root_block_header_list[9])
self.assertEqual(resp.block_header_list[4], root_block_header_list[10])
# Test Case 4 ###################################################
op, resp, rpc_id = call_async(
peer.write_rpc_request(
op=CommandOp.GET_ROOT_BLOCK_HEADER_LIST_WITH_SKIP_REQUEST,
cmd=GetRootBlockHeaderListWithSkipRequest.create_for_height(
height=2, skip=2, limit=4, direction=Direction.GENESIS
),
)
)
self.assertEqual(len(resp.block_header_list), 1)
self.assertEqual(resp.block_header_list[0], root_block_header_list[2])
op, resp, rpc_id = call_async(
peer.write_rpc_request(
op=CommandOp.GET_ROOT_BLOCK_HEADER_LIST_WITH_SKIP_REQUEST,
cmd=GetRootBlockHeaderListWithSkipRequest.create_for_hash(
hash=root_block_header_list[2].get_hash(),
skip=2,
limit=4,
direction=Direction.GENESIS,
),
)
)
self.assertEqual(len(resp.block_header_list), 1)
self.assertEqual(resp.block_header_list[0], root_block_header_list[2])
# Test Case 5 ###################################################
op, resp, rpc_id = call_async(
peer.write_rpc_request(
op=CommandOp.GET_ROOT_BLOCK_HEADER_LIST_WITH_SKIP_REQUEST,
cmd=GetRootBlockHeaderListWithSkipRequest.create_for_height(
height=11, skip=2, limit=4, direction=Direction.GENESIS
),
)
)
self.assertEqual(len(resp.block_header_list), 0)
op, resp, rpc_id = call_async(
peer.write_rpc_request(
op=CommandOp.GET_ROOT_BLOCK_HEADER_LIST_WITH_SKIP_REQUEST,
cmd=GetRootBlockHeaderListWithSkipRequest.create_for_hash(
hash=bytes(32), skip=2, limit=4, direction=Direction.GENESIS
),
)
)
self.assertEqual(len(resp.block_header_list), 0)
# Test Case 6 ###################################################
op, resp, rpc_id = call_async(
peer.write_rpc_request(
op=CommandOp.GET_ROOT_BLOCK_HEADER_LIST_WITH_SKIP_REQUEST,
cmd=GetRootBlockHeaderListWithSkipRequest.create_for_height(
height=8, skip=1, limit=5, direction=Direction.GENESIS
),
)
)
self.assertEqual(len(resp.block_header_list), 5)
self.assertEqual(resp.block_header_list[0], root_block_header_list[8])
self.assertEqual(resp.block_header_list[1], root_block_header_list[6])
self.assertEqual(resp.block_header_list[2], root_block_header_list[4])
self.assertEqual(resp.block_header_list[3], root_block_header_list[2])
self.assertEqual(resp.block_header_list[4], root_block_header_list[0])
op, resp, rpc_id = call_async(
peer.write_rpc_request(
op=CommandOp.GET_ROOT_BLOCK_HEADER_LIST_WITH_SKIP_REQUEST,
cmd=GetRootBlockHeaderListWithSkipRequest.create_for_hash(
hash=root_block_header_list[8].get_hash(),
skip=1,
limit=5,
direction=Direction.GENESIS,
),
)
)
self.assertEqual(len(resp.block_header_list), 5)
self.assertEqual(resp.block_header_list[0], root_block_header_list[8])
self.assertEqual(resp.block_header_list[1], root_block_header_list[6])
self.assertEqual(resp.block_header_list[2], root_block_header_list[4])
self.assertEqual(resp.block_header_list[3], root_block_header_list[2])
self.assertEqual(resp.block_header_list[4], root_block_header_list[0])
def test_get_root_block_header_sync_from_genesis(self):
""" Test the broadcast is only done to the neighbors """
id1 = Identity.create_random_identity()
acc1 = Address.create_from_identity(id1, full_shard_key=0)
with ClusterContext(2, acc1, connect=False) as clusters:
master = clusters[0].master
root_block_header_list = [master.root_state.tip]
for i in range(10):
root_block = call_async(
master.get_next_block_to_mine(
Address.create_empty_account(), branch_value=None
)
)
call_async(master.add_root_block(root_block))
root_block_header_list.append(root_block.header)
# Connect and the synchronizer should automically download
call_async(clusters[1].network.connect(
"127.0.0.1",
clusters[0].network.env.cluster_config.P2P_PORT)
)
assert_true_with_timeout(lambda: clusters[1].master.root_state.tip == root_block_header_list[-1])
self.assertEqual(clusters[1].master.synchronizer.stats.blocks_downloaded, len(root_block_header_list) - 1)
def test_get_root_block_header_sync_from_height_3(self):
""" Test the broadcast is only done to the neighbors """
id1 = Identity.create_random_identity()
acc1 = Address.create_from_identity(id1, full_shard_key=0)
with ClusterContext(2, acc1, connect=False) as clusters:
master0 = clusters[0].master
root_block_list = []
for i in range(10):
root_block = call_async(
master0.get_next_block_to_mine(
Address.create_empty_account(), branch_value=None
)
)
call_async(master0.add_root_block(root_block))
root_block_list.append(root_block)
# Add 3 blocks to another cluster
master1 = clusters[1].master
for i in range(3):
call_async(master1.add_root_block(root_block_list[i]))
assert_true_with_timeout(lambda: master1.root_state.tip == root_block_list[2].header)
# Connect and the synchronizer should automically download
call_async(clusters[1].network.connect(
"127.0.0.1",
clusters[0].network.env.cluster_config.P2P_PORT)
)
assert_true_with_timeout(lambda: master1.root_state.tip == root_block_list[-1].header)
self.assertEqual(master1.synchronizer.stats.blocks_downloaded, len(root_block_list) - 3)
self.assertEqual(master1.synchronizer.stats.ancestor_lookup_requests, 1)
def test_get_root_block_header_sync_with_fork(self):
""" Test the broadcast is only done to the neighbors """
id1 = Identity.create_random_identity()
acc1 = Address.create_from_identity(id1, full_shard_key=0)
with ClusterContext(2, acc1, connect=False) as clusters:
master0 = clusters[0].master
root_block_list = []
for i in range(10):
root_block = call_async(
master0.get_next_block_to_mine(
Address.create_empty_account(), branch_value=None
)
)
call_async(master0.add_root_block(root_block))
root_block_list.append(root_block)
# Add 2+3 blocks to another cluster: 2 are the same as cluster 0, and 3 are the fork
master1 = clusters[1].master
for i in range(2):
call_async(master1.add_root_block(root_block_list[i]))
for i in range(3):
root_block = call_async(
master1.get_next_block_to_mine(
acc1, branch_value=None
)
)
call_async(master1.add_root_block(root_block))
# Connect and the synchronizer should automically download
call_async(clusters[1].network.connect(
"127.0.0.1",
clusters[0].network.env.cluster_config.P2P_PORT)
)
assert_true_with_timeout(lambda: master1.root_state.tip == root_block_list[-1].header)
self.assertEqual(master1.synchronizer.stats.blocks_downloaded, len(root_block_list) - 2)
self.assertEqual(master1.synchronizer.stats.ancestor_lookup_requests, 1)
def test_get_root_block_header_sync_with_staleness(self):
""" Test the broadcast is only done to the neighbors """
id1 = Identity.create_random_identity()
acc1 = Address.create_from_identity(id1, full_shard_key=0)
with ClusterContext(2, acc1, connect=False) as clusters:
master0 = clusters[0].master
root_block_list = []
for i in range(10):
root_block = call_async(
master0.get_next_block_to_mine(
Address.create_empty_account(), branch_value=None
)
)
call_async(master0.add_root_block(root_block))
root_block_list.append(root_block)
assert_true_with_timeout(lambda: master0.root_state.tip == root_block_list[-1].header)
# Add 3 blocks to another cluster
master1 = clusters[1].master
for i in range(8):
root_block = call_async(
master1.get_next_block_to_mine(
acc1, branch_value=None
)
)
call_async(master1.add_root_block(root_block))
master1.env.quark_chain_config.ROOT.MAX_STALE_ROOT_BLOCK_HEIGHT_DIFF = 5
assert_true_with_timeout(lambda: master1.root_state.tip == root_block.header)
# Connect and the synchronizer should automically download
call_async(clusters[1].network.connect(
"127.0.0.1",
clusters[0].network.env.cluster_config.P2P_PORT)
)
assert_true_with_timeout(lambda: master1.synchronizer.stats.ancestor_not_found_count == 1)
self.assertEqual(master1.synchronizer.stats.blocks_downloaded, 0)
self.assertEqual(master1.synchronizer.stats.ancestor_lookup_requests, 1)
def test_get_root_block_header_sync_with_multiple_lookup(self):
""" Test the broadcast is only done to the neighbors """
id1 = Identity.create_random_identity()
acc1 = Address.create_from_identity(id1, full_shard_key=0)
with ClusterContext(2, acc1, connect=False) as clusters:
master0 = clusters[0].master
root_block_list = []
for i in range(12):
root_block = call_async(
master0.get_next_block_to_mine(
Address.create_empty_account(), branch_value=None
)
)
call_async(master0.add_root_block(root_block))
root_block_list.append(root_block)
assert_true_with_timeout(lambda: master0.root_state.tip == root_block_list[-1].header)
# Add 4+4 blocks to another cluster
master1 = clusters[1].master
for i in range(4):
call_async(master1.add_root_block(root_block_list[i]))
for i in range(4):
root_block = call_async(
master1.get_next_block_to_mine(
acc1, branch_value=None
)
)
call_async(master1.add_root_block(root_block))
master1.synchronizer.root_block_header_list_limit = 4
# Connect and the synchronizer should automically download
call_async(clusters[1].network.connect(
"127.0.0.1",
clusters[0].network.env.cluster_config.P2P_PORT)
)
assert_true_with_timeout(lambda: master1.root_state.tip == root_block_list[-1].header)
self.assertEqual(master1.synchronizer.stats.blocks_downloaded, 8)
self.assertEqual(master1.synchronizer.stats.headers_downloaded, 5 + 8)
self.assertEqual(master1.synchronizer.stats.ancestor_lookup_requests, 2)
def test_get_root_block_header_sync_with_start_equal_end(self):
id1 = Identity.create_random_identity()
acc1 = Address.create_from_identity(id1, full_shard_key=0)
with ClusterContext(2, acc1, connect=False) as clusters:
master0 = clusters[0].master
root_block_list = []
for i in range(5):
root_block = call_async(
master0.get_next_block_to_mine(
Address.create_empty_account(), branch_value=None
)
)
call_async(master0.add_root_block(root_block))
root_block_list.append(root_block)
assert_true_with_timeout(lambda: master0.root_state.tip == root_block_list[-1].header)
# Add 3+1 blocks to another cluster
master1 = clusters[1].master
for i in range(3):
call_async(master1.add_root_block(root_block_list[i]))
for i in range(1):
root_block = call_async(
master1.get_next_block_to_mine(
acc1, branch_value=None
)
)
call_async(master1.add_root_block(root_block))
master1.synchronizer.root_block_header_list_limit = 3
# Connect and the synchronizer should automically download
call_async(clusters[1].network.connect(
"127.0.0.1",
clusters[0].network.env.cluster_config.P2P_PORT)
)
assert_true_with_timeout(lambda: master1.root_state.tip == root_block_list[-1].header)
self.assertEqual(master1.synchronizer.stats.blocks_downloaded, 2)
self.assertEqual(master1.synchronizer.stats.headers_downloaded, 6)
self.assertEqual(master1.synchronizer.stats.ancestor_lookup_requests, 2)
def test_get_root_block_header_sync_with_best_ancestor(self):
id1 = Identity.create_random_identity()
acc1 = Address.create_from_identity(id1, full_shard_key=0)
with ClusterContext(2, acc1, connect=False) as clusters:
master0 = clusters[0].master
root_block_list = []
for i in range(5):
root_block = call_async(
master0.get_next_block_to_mine(
Address.create_empty_account(), branch_value=None
)
)
call_async(master0.add_root_block(root_block))
root_block_list.append(root_block)
assert_true_with_timeout(lambda: master0.root_state.tip == root_block_list[-1].header)
# Add 2+2 blocks to another cluster
master1 = clusters[1].master
for i in range(2):
call_async(master1.add_root_block(root_block_list[i]))
for i in range(2):
root_block = call_async(
master1.get_next_block_to_mine(
acc1, branch_value=None
)
)
call_async(master1.add_root_block(root_block))
master1.synchronizer.root_block_header_list_limit = 3
# Lookup will be [0, 2, 4], and then [3], where 3 cannot be found and thus 2 is the best.
# Connect and the synchronizer should automically download
call_async(clusters[1].network.connect(
"127.0.0.1",
clusters[0].network.env.cluster_config.P2P_PORT)
)
assert_true_with_timeout(lambda: master1.root_state.tip == root_block_list[-1].header)
self.assertEqual(master1.synchronizer.stats.blocks_downloaded, 3)
self.assertEqual(master1.synchronizer.stats.headers_downloaded, 4 + 3)
self.assertEqual(master1.synchronizer.stats.ancestor_lookup_requests, 2)
def test_get_minor_block_headers_with_skip(self):
""" Test the broadcast is only done to the neighbors """
id1 = Identity.create_random_identity()
acc1 = Address.create_from_identity(id1, full_shard_key=0)
with ClusterContext(2, acc1) as clusters:
master = clusters[0].master
shard = next(iter(clusters[0].slave_list[0].shards.values()))
# Add a root block first so that later minor blocks referring to this root
# can be broadcasted to other shards
minor_block_header_list = [shard.state.header_tip]
branch = shard.state.header_tip.branch
for i in range(10):
b = shard.state.create_block_to_mine()
call_async(master.add_raw_minor_block(b.header.branch, b.serialize()))
minor_block_header_list.append(b.header)
self.assertEqual(minor_block_header_list[-1].height, 10)
peer = next(iter(clusters[1].slave_list[0].shards[branch].peers.values()))
# Test Case 1 ###################################################
op, resp, rpc_id = call_async(
peer.write_rpc_request(
op=CommandOp.GET_MINOR_BLOCK_HEADER_LIST_WITH_SKIP_REQUEST,
cmd=GetMinorBlockHeaderListWithSkipRequest.create_for_height(
height=1, branch=branch, skip=1, limit=3, direction=Direction.TIP
),
)
)
self.assertEqual(len(resp.block_header_list), 3)
self.assertEqual(resp.block_header_list[0], minor_block_header_list[1])
self.assertEqual(resp.block_header_list[1], minor_block_header_list[3])
self.assertEqual(resp.block_header_list[2], minor_block_header_list[5])
op, resp, rpc_id = call_async(
peer.write_rpc_request(
op=CommandOp.GET_MINOR_BLOCK_HEADER_LIST_WITH_SKIP_REQUEST,
cmd=GetMinorBlockHeaderListWithSkipRequest.create_for_hash(
hash=minor_block_header_list[1].get_hash(),
branch=branch,
skip=1,
limit=3,
direction=Direction.TIP,
),
)
)
self.assertEqual(len(resp.block_header_list), 3)
self.assertEqual(resp.block_header_list[0], minor_block_header_list[1])
self.assertEqual(resp.block_header_list[1], minor_block_header_list[3])
self.assertEqual(resp.block_header_list[2], minor_block_header_list[5])
# Test Case 2 ###################################################
op, resp, rpc_id = call_async(
peer.write_rpc_request(
op=CommandOp.GET_MINOR_BLOCK_HEADER_LIST_WITH_SKIP_REQUEST,
cmd=GetMinorBlockHeaderListWithSkipRequest.create_for_height(
height=2, branch=branch, skip=2, limit=4, direction=Direction.TIP
),
)
)
self.assertEqual(len(resp.block_header_list), 3)
self.assertEqual(resp.block_header_list[0], minor_block_header_list[2])
self.assertEqual(resp.block_header_list[1], minor_block_header_list[5])
self.assertEqual(resp.block_header_list[2], minor_block_header_list[8])
op, resp, rpc_id = call_async(
peer.write_rpc_request(
op=CommandOp.GET_MINOR_BLOCK_HEADER_LIST_WITH_SKIP_REQUEST,
cmd=GetMinorBlockHeaderListWithSkipRequest.create_for_hash(
hash=minor_block_header_list[2].get_hash(),
branch=branch,
skip=2,
limit=4,
direction=Direction.TIP,
),
)
)
self.assertEqual(len(resp.block_header_list), 3)
self.assertEqual(resp.block_header_list[0], minor_block_header_list[2])
self.assertEqual(resp.block_header_list[1], minor_block_header_list[5])
self.assertEqual(resp.block_header_list[2], minor_block_header_list[8])
# Test Case 3 ###################################################
op, resp, rpc_id = call_async(
peer.write_rpc_request(
op=CommandOp.GET_MINOR_BLOCK_HEADER_LIST_WITH_SKIP_REQUEST,
cmd=GetMinorBlockHeaderListWithSkipRequest.create_for_height(
height=6, branch=branch, skip=0, limit=100, direction=Direction.TIP
),
)
)
self.assertEqual(len(resp.block_header_list), 5)
self.assertEqual(resp.block_header_list[0], minor_block_header_list[6])
self.assertEqual(resp.block_header_list[1], minor_block_header_list[7])
self.assertEqual(resp.block_header_list[2], minor_block_header_list[8])
self.assertEqual(resp.block_header_list[3], minor_block_header_list[9])
self.assertEqual(resp.block_header_list[4], minor_block_header_list[10])
op, resp, rpc_id = call_async(
peer.write_rpc_request(
op=CommandOp.GET_MINOR_BLOCK_HEADER_LIST_WITH_SKIP_REQUEST,
cmd=GetMinorBlockHeaderListWithSkipRequest.create_for_hash(
hash=minor_block_header_list[6].get_hash(),
branch=branch,
skip=0,
limit=100,
direction=Direction.TIP,
),
)
)
self.assertEqual(len(resp.block_header_list), 5)
self.assertEqual(resp.block_header_list[0], minor_block_header_list[6])
self.assertEqual(resp.block_header_list[1], minor_block_header_list[7])
self.assertEqual(resp.block_header_list[2], minor_block_header_list[8])
self.assertEqual(resp.block_header_list[3], minor_block_header_list[9])
self.assertEqual(resp.block_header_list[4], minor_block_header_list[10])
# Test Case 4 ###################################################
op, resp, rpc_id = call_async(
peer.write_rpc_request(
op=CommandOp.GET_MINOR_BLOCK_HEADER_LIST_WITH_SKIP_REQUEST,
cmd=GetMinorBlockHeaderListWithSkipRequest.create_for_height(
height=2, branch=branch, skip=2, limit=4, direction=Direction.GENESIS
),
)
)
self.assertEqual(len(resp.block_header_list), 1)
self.assertEqual(resp.block_header_list[0], minor_block_header_list[2])
op, resp, rpc_id = call_async(
peer.write_rpc_request(
op=CommandOp.GET_MINOR_BLOCK_HEADER_LIST_WITH_SKIP_REQUEST,
cmd=GetMinorBlockHeaderListWithSkipRequest.create_for_hash(
hash=minor_block_header_list[2].get_hash(),
branch=branch,
skip=2,
limit=4,
direction=Direction.GENESIS,
),
)
)
self.assertEqual(len(resp.block_header_list), 1)
self.assertEqual(resp.block_header_list[0], minor_block_header_list[2])
# Test Case 5 ###################################################
op, resp, rpc_id = call_async(
peer.write_rpc_request(
op=CommandOp.GET_MINOR_BLOCK_HEADER_LIST_WITH_SKIP_REQUEST,
cmd=GetMinorBlockHeaderListWithSkipRequest.create_for_height(
height=11, branch=branch, skip=2, limit=4, direction=Direction.GENESIS
),
)
)
self.assertEqual(len(resp.block_header_list), 0)
op, resp, rpc_id = call_async(
peer.write_rpc_request(
op=CommandOp.GET_MINOR_BLOCK_HEADER_LIST_WITH_SKIP_REQUEST,
cmd=GetMinorBlockHeaderListWithSkipRequest.create_for_hash(
hash=bytes(32), branch=branch, skip=2, limit=4, direction=Direction.GENESIS
),
)
)
self.assertEqual(len(resp.block_header_list), 0)
# Test Case 6 ###################################################
op, resp, rpc_id = call_async(
peer.write_rpc_request(
op=CommandOp.GET_MINOR_BLOCK_HEADER_LIST_WITH_SKIP_REQUEST,
cmd=GetMinorBlockHeaderListWithSkipRequest.create_for_height(
height=8, branch=branch, skip=1, limit=5, direction=Direction.GENESIS
),
)
)
self.assertEqual(len(resp.block_header_list), 5)
self.assertEqual(resp.block_header_list[0], minor_block_header_list[8])
self.assertEqual(resp.block_header_list[1], minor_block_header_list[6])
self.assertEqual(resp.block_header_list[2], minor_block_header_list[4])
self.assertEqual(resp.block_header_list[3], minor_block_header_list[2])
self.assertEqual(resp.block_header_list[4], minor_block_header_list[0])
op, resp, rpc_id = call_async(
peer.write_rpc_request(
op=CommandOp.GET_MINOR_BLOCK_HEADER_LIST_WITH_SKIP_REQUEST,
cmd=GetMinorBlockHeaderListWithSkipRequest.create_for_hash(
hash=minor_block_header_list[8].get_hash(),
branch=branch,
skip=1,
limit=5,
direction=Direction.GENESIS,
),
)
)
self.assertEqual(len(resp.block_header_list), 5)
self.assertEqual(resp.block_header_list[0], minor_block_header_list[8])
self.assertEqual(resp.block_header_list[1], minor_block_header_list[6])
self.assertEqual(resp.block_header_list[2], minor_block_header_list[4])
self.assertEqual(resp.block_header_list[3], minor_block_header_list[2])
self.assertEqual(resp.block_header_list[4], minor_block_header_list[0])
| quarkchain/cluster/tests/test_cluster.py | 63,239 | Test the cross shard transactions are broadcasted to the destination shards
Test the broadcast is only done to the neighbors
Test the broadcast is only done to the neighbors
Test the broadcast is only done to the neighbors
Test the broadcast is only done to the neighbors
Test the broadcast is only done to the neighbors
Test the broadcast is only done to the neighbors
Test the broadcast is only done to the neighbors
Test the broadcast is only done to the neighbors
Test shard forks at genesis blocks due to root chain fork at GENESIS.ROOT_HEIGHT
Add root block with height 1, which will automatically create genesis block for shard 0 shard 0 created at root height 1 shard 0 block should have correct root block and cursor info from create_test_clusters in genesis alloc Add root block with height 2, which will automatically create genesis block for shard 1 shard 1 created at root height 2 X-shard from root should be deposited to the shard from create_test_clusters in genesis alloc Add root block with height 3, which will include - the genesis block for shard 1; and - the added block for shard 0. check the tx is received by the other cluster Make sure the xshard list is not broadcasted to the other shard Make sure another cluster received the new block shutdown cluster connection add blocks in cluster 0 add 1 block in cluster 1 reestablish cluster connection Make sure the root block tip of local cluster is changed Make sure the root block tip of cluster 1 is changed Minor block is downloaded The tip is overwritten due to root chain first consensus shutdown cluster connection cluster 0 has 13 blocks added cluster 1 has 12 blocks added reestablish cluster connection a new block from cluster 0 will trigger sync in cluster 1 expect cluster 1 has all the blocks from cluter 0 and has the same tip as cluster 0 shutdown cluster connection let's make cluster1's root chain longer than cluster0's reestablish cluster connection Expect cluster0's genesis change to genesis1 Add a root block first so that later minor blocks referring to this root can be broadcasted to other shards expect shard 1 got the CrossShardTransactionList of b1 b2 doesn't update tip expect shard 1 got the CrossShardTransactionList of b2 b4 should include the withdraw of tx1 adding b1, b2, b3 again shouldn't affect b4 to be added later create 64 shards so that the neighbor rule can kick in explicitly set num_slaves to 4 so that it does not spin up 64 slaves Add a root block first so that later minor blocks referring to this root can be broadcasted to other shards Only neighbor should have it no posw enable posw, with total stakes cover all the window Cluster 0 generates a root block of height 1 with 1e6 difficulty Establish cluster connection Cluster 0 broadcasts the root block to cluster 1 Make sure the root block tip of cluster 1 is changed Cluster 1 generates a minor block and broadcasts to cluster 0 Make sure another cluster received the new minor block Cluster 1 generates a new root block with higher total difficulty Generate a minor block b2 Make sure another cluster received the new minor block Update config to force checking diff Also the block should not exist in new block pool Add a root block first so that later minor blocks referring to this root can be broadcasted to other shards Test Case 1 Test Case 2 Test Case 3 Test Case 4 Test Case 5 Test Case 6 Connect and the synchronizer should automically download Add 3 blocks to another cluster Connect and the synchronizer should automically download Add 2+3 blocks to another cluster: 2 are the same as cluster 0, and 3 are the fork Connect and the synchronizer should automically download Add 3 blocks to another cluster Connect and the synchronizer should automically download Add 4+4 blocks to another cluster Connect and the synchronizer should automically download Add 3+1 blocks to another cluster Connect and the synchronizer should automically download Add 2+2 blocks to another cluster Lookup will be [0, 2, 4], and then [3], where 3 cannot be found and thus 2 is the best. Connect and the synchronizer should automically download Add a root block first so that later minor blocks referring to this root can be broadcasted to other shards Test Case 1 Test Case 2 Test Case 3 Test Case 4 Test Case 5 Test Case 6 | 4,312 | en | 0.918712 |
from __future__ import absolute_import
from __future__ import division
from __future__ import print_function
from __future__ import unicode_literals
import numpy as np # type: ignore
import onnx
from ..base import Base
from . import expect
from ..utils import all_numeric_dtypes
class Max(Base):
@staticmethod
def export(): # type: () -> None
data_0 = np.array([3, 2, 1]).astype(np.float32)
data_1 = np.array([1, 4, 4]).astype(np.float32)
data_2 = np.array([2, 5, 3]).astype(np.float32)
result = np.array([3, 5, 4]).astype(np.float32)
node = onnx.helper.make_node(
'Max',
inputs=['data_0', 'data_1', 'data_2'],
outputs=['result'],
)
expect(node, inputs=[data_0, data_1, data_2], outputs=[result],
name='test_max_example')
node = onnx.helper.make_node(
'Max',
inputs=['data_0'],
outputs=['result'],
)
expect(node, inputs=[data_0], outputs=[data_0],
name='test_max_one_input')
result = np.maximum(data_0, data_1)
node = onnx.helper.make_node(
'Max',
inputs=['data_0', 'data_1'],
outputs=['result'],
)
expect(node, inputs=[data_0, data_1], outputs=[result],
name='test_max_two_inputs')
@staticmethod
def export_max_all_numeric_types(): # type: () -> None
for op_dtype in all_numeric_dtypes:
data_0 = np.array([3, 2, 1]).astype(op_dtype)
data_1 = np.array([1, 4, 4]).astype(op_dtype)
result = np.array([3, 4, 4]).astype(op_dtype)
node = onnx.helper.make_node(
'Max',
inputs=['data_0', 'data_1'],
outputs=['result'],
)
expect(node, inputs=[data_0, data_1], outputs=[result],
name='test_max_{0}'.format(np.dtype(op_dtype).name))
| onnx/backend/test/case/node/max.py | 1,962 | type: ignore type: () -> None type: () -> None | 46 | en | 0.314945 |
import theano.tensor as T
import theano
import numpy as np
from scipy.spatial.distance import pdist, squareform, cdist
import random
import time
'''
Sample code to reproduce our results for the Bayesian neural network example.
Our settings are almost the same as Hernandez-Lobato and Adams (ICML15) https://jmhldotorg.files.wordpress.com/2015/05/pbp-icml2015.pdf
Our implementation is also based on their Python code.
p(y | W, X, \gamma) = \prod_i^N N(y_i | f(x_i; W), \gamma^{-1})
p(W | \lambda) = \prod_i N(w_i | 0, \lambda^{-1})
p(\gamma) = Gamma(\gamma | a0, b0)
p(\lambda) = Gamma(\lambda | a0, b0)
The posterior distribution is as follows:
p(W, \gamma, \lambda) = p(y | W, X, \gamma) p(W | \lambda) p(\gamma) p(\lambda)
To avoid negative values of \gamma and \lambda, we update loggamma and loglambda instead.
Copyright (c) 2016, Qiang Liu & Dilin Wang
All rights reserved.
'''
class svgd_bayesnn:
'''
We define a one-hidden-layer-neural-network specifically. We leave extension of deep neural network as our future work.
Input
-- X_train: training dataset, features
-- y_train: training labels
-- batch_size: sub-sampling batch size
-- max_iter: maximum iterations for the training procedure
-- M: number of particles are used to fit the posterior distribution
-- n_hidden: number of hidden units
-- a0, b0: hyper-parameters of Gamma distribution
-- master_stepsize, auto_corr: parameters of adgrad
'''
def __init__(self, X_train, y_train, X_test, y_text, batch_size = 100, max_iter = 1000, M = 20, n_hidden = 50,
a0 = 1, b0 = 0.1, master_stepsize = 1e-3, auto_corr = 0.9, h=-1, alpha = 0.9,
method = 'none',m=5, cf = False, uStat = True, regCoeff = 0.1, adver = False, adverMaxIter = 5,
maxTime = 20, numTimeSteps = 20):
self.n_hidden = n_hidden
self.d = X_train.shape[1] # number of data, dimension
self.M = M
num_vars = self.d * n_hidden + n_hidden * 2 + 3 # w1: d*n_hidden; b1: n_hidden; w2 = n_hidden; b2 = 1; 2 variances
self.theta = np.zeros([self.M, num_vars]) # particles, will be initialized later
'''
We keep the last 10% (maximum 500) of training data points for model developing
'''
size_dev = min(int(np.round(0.1 * X_train.shape[0])), 500)
X_dev, y_dev = X_train[-size_dev:], y_train[-size_dev:]
X_train, y_train = X_train[:-size_dev], y_train[:-size_dev]
'''
The data sets are normalized so that the input features and the targets have zero mean and unit variance
'''
self.std_X_train = np.std(X_train, 0)
self.std_X_train[ self.std_X_train == 0 ] = 1
self.mean_X_train = np.mean(X_train, 0)
self.mean_y_train = np.mean(y_train)
self.std_y_train = np.std(y_train)
'''
Theano symbolic variables
Define the neural network here
'''
X = T.matrix('X') # Feature matrix
y = T.vector('y') # labels
w_1 = T.matrix('w_1') # weights between input layer and hidden layer
b_1 = T.vector('b_1') # bias vector of hidden layer
w_2 = T.vector('w_2') # weights between hidden layer and output layer
b_2 = T.scalar('b_2') # bias of output
N = T.scalar('N') # number of observations
log_gamma = T.scalar('log_gamma') # variances related parameters
log_lambda = T.scalar('log_lambda')
###
prediction = T.dot(T.nnet.relu(T.dot(X, w_1)+b_1), w_2) + b_2
''' define the log posterior distribution '''
log_lik_data = -0.5 * X.shape[0] * (T.log(2*np.pi) - log_gamma) - (T.exp(log_gamma)/2) * T.sum(T.power(prediction - y, 2))
log_prior_data = (a0 - 1) * log_gamma - b0 * T.exp(log_gamma) + log_gamma
log_prior_w = -0.5 * (num_vars-2) * (T.log(2*np.pi)-log_lambda) - (T.exp(log_lambda)/2)*((w_1**2).sum() + (w_2**2).sum() + (b_1**2).sum() + b_2**2) \
+ (a0-1) * log_lambda - b0 * T.exp(log_lambda) + log_lambda
# sub-sampling mini-batches of data, where (X, y) is the batch data, and N is the number of whole observations
log_posterior = (log_lik_data * N / X.shape[0] + log_prior_data + log_prior_w)
dw_1, db_1, dw_2, db_2, d_log_gamma, d_log_lambda = T.grad(log_posterior, [w_1, b_1, w_2, b_2, log_gamma, log_lambda])
# automatic gradient
logp_gradient = theano.function(
inputs = [X, y, w_1, b_1, w_2, b_2, log_gamma, log_lambda, N],
outputs = [dw_1, db_1, dw_2, db_2, d_log_gamma, d_log_lambda]
)
# prediction function
self.nn_predict = theano.function(inputs = [X, w_1, b_1, w_2, b_2], outputs = prediction)
'''
Training with SVGD
'''
# normalization
X_train, y_train = self.normalization(X_train, y_train)
N0 = X_train.shape[0] # number of observations
''' initializing all particles '''
for i in range(self.M):
w1, b1, w2, b2, loggamma, loglambda = self.init_weights(a0, b0)
# use better initialization for gamma
ridx = np.random.choice(range(X_train.shape[0]), \
np.min([X_train.shape[0], 1000]), replace = False)
y_hat = self.nn_predict(X_train[ridx,:], w1, b1, w2, b2)
loggamma = -np.log(np.mean(np.power(y_hat - y_train[ridx], 2)))
self.theta[i,:] = self.pack_weights(w1, b1, w2, b2, loggamma, loglambda)
grad_theta = np.zeros([self.M, num_vars]) # gradient
# adagrad with momentum
fudge_factor = 1e-6
historical_grad = 0
self.y_historical_grad = 0
self.h_historical_grad = 0
self.rmse_overTime = np.zeros(numTimeSteps) # RMSE
self.llh_overTime = np.zeros(numTimeSteps) # LLH
self.iter_overTime = np.zeros(numTimeSteps) # LLH
timeStepUnit = maxTime / numTimeSteps # Time to check every iteration
timeInd = 0;
start_time = time.time()
for iter in range(max_iter):
if method == 'subparticles':
self.Sqy = np.zeros([m, num_vars]) # Sqy
elif method == 'inducedPoints' or method == 'none':
self.Sqx = np.zeros([self.M, num_vars]) # Sqx
h = -1;
# sub-sampling
batch = [ i % N0 for i in range(iter * batch_size, (iter + 1) * batch_size) ]
if method == 'none' or method =='inducedPoints':
for i in range(self.M):
w1, b1, w2, b2, loggamma, loglambda = self.unpack_weights(self.theta[i,:])
dw1, db1, dw2, db2, dloggamma, dloglambda = logp_gradient(X_train[batch,:], y_train[batch], w1, b1, w2, b2, loggamma, loglambda, N0)
self.Sqx[i,:] = self.pack_weights(dw1, db1, dw2, db2, dloggamma, dloglambda)
if method == 'none':
grad_theta = self.svgd_kernel(h=h)
elif method == 'inducedPoints':
self.yInd = np.random.choice(self.theta.shape[0], m, replace=False)
self.y = self.theta[self.yInd]
grad_theta = self.svgd_kernel_inducedPoints(h=h, uStat = uStat, regCoeff = regCoeff, adver=adver, adverMaxIter = adverMaxIter)
elif method == 'subparticles':
self.yInd = np.random.choice(self.theta.shape[0], m, replace=False)
self.y = self.theta[self.yInd]
for i in range(m):
w1, b1, w2, b2, loggamma, loglambda = self.unpack_weights(self.y[i,:])
dw1, db1, dw2, db2, dloggamma, dloglambda = logp_gradient(X_train[batch,:], y_train[batch], w1, b1, w2, b2, loggamma, loglambda, N0)
self.Sqy[i,:] = self.pack_weights(dw1, db1, dw2, db2, dloggamma, dloglambda)
grad_theta = self.svgd_kernel_subset(h=-1, cf=cf)
[adj_grad, historical_grad] = self.get_adamUpdate(iter, grad_theta, historical_grad,master_stepsize, alpha, fudge_factor)
self.theta = self.theta + adj_grad;
elapsed_time = time.time() - start_time
if elapsed_time > timeStepUnit:
self.thetaCopy = np.copy(self.theta)
# Evaluate and save
'''
Model selection by using a development set
'''
X_dev = self.normalization(X_dev)
for i in range(self.M):
w1, b1, w2, b2, loggamma, loglambda = self.unpack_weights(self.thetaCopy[i, :])
pred_y_dev = self.nn_predict(X_dev, w1, b1, w2, b2) * self.std_y_train + self.mean_y_train
# likelihood
def f_log_lik(loggamma): return np.sum( np.log(np.sqrt(np.exp(loggamma)) /np.sqrt(2*np.pi) * np.exp( -1 * (np.power(pred_y_dev - y_dev, 2) / 2) * np.exp(loggamma) )) )
# The higher probability is better
lik1 = f_log_lik(loggamma)
# one heuristic setting
loggamma = -np.log(np.mean(np.power(pred_y_dev - y_dev, 2)))
lik2 = f_log_lik(loggamma)
if lik2 > lik1:
self.thetaCopy[i,-2] = loggamma # update loggamma
svgd_rmse, svgd_ll = self.evaluation(X_test, y_test)
self.rmse_overTime[timeInd] = svgd_rmse
self.llh_overTime[timeInd] = svgd_ll
self.iter_overTime[timeInd] = iter
start_time = time.time()
timeInd = timeInd + 1
# Break after maxTime
if timeInd >= numTimeSteps:
print('Reached ', iter, 'iterations\n')
break
def normalization(self, X, y = None):
X = (X - np.full(X.shape, self.mean_X_train)) / \
np.full(X.shape, self.std_X_train)
if y is not None:
y = (y - self.mean_y_train) / self.std_y_train
return (X, y)
else:
return X
'''
Initialize all particles
'''
def init_weights(self, a0, b0):
w1 = 1.0 / np.sqrt(self.d + 1) * np.random.randn(self.d, self.n_hidden)
b1 = np.zeros((self.n_hidden,))
w2 = 1.0 / np.sqrt(self.n_hidden + 1) * np.random.randn(self.n_hidden)
b2 = 0.
loggamma = np.log(np.random.gamma(a0, b0))
loglambda = np.log(np.random.gamma(a0, b0))
return (w1, b1, w2, b2, loggamma, loglambda)
'''
Returns control functional weights
'''
def getWeights(self, KpMat):
condNumber = self.getConditionNumber(KpMat)
z = KpMat.shape[0]
# Get weights
KPrime = KpMat + condNumber * z * np.identity(z)
num = np.matmul(np.ones(z),np.linalg.inv(KPrime))
denom = 1 + np.matmul(num,np.ones(z))
weights = num / denom
weights = weights / sum(weights)
return (weights)
'''
Given a kernel matrix K, let lambda be smallest power of 10 such that
kernel matrix K0 + lamba*I has condition number lower than 10^10
Note we use 2-norm for computing condition number
'''
def getConditionNumber(self, K):
condNumber = 10e-10
condA = 10e11
matSize = K.shape[0]
while condA > 10e10:
condNumber = condNumber * 10
A = K + condNumber * np.identity(matSize)
condA = np.linalg.norm(A, ord=2) * np.linalg.norm(np.linalg.inv(A), ord=2)
return (condNumber)
'''
Calculate kernel matrix and its gradient: K, \nabla_x k
'''
def svgd_kernel(self, h = -1):
n,d = self.theta.shape
sq_dist = pdist(self.theta)
pairwise_dists = squareform(sq_dist)**2
if h < 0: # if h < 0, using median trick
h = np.median(pairwise_dists)
h = np.sqrt(0.5 * h / np.log(n+1))
# compute the rbf kernel
Kxy = np.exp( -pairwise_dists / h**2 / 2)
dxkxy = -np.matmul(Kxy, self.theta)
sumkxy = np.sum(Kxy, axis=1)
for i in range(d):
dxkxy[:, i] = dxkxy[:,i] + np.multiply(self.theta[:,i],sumkxy)
dxkxy = dxkxy / (h**2)
grad_theta = (np.matmul(Kxy, self.Sqx) + dxkxy) / n
return grad_theta
'''
Compute gradient update for theta using svgd random subset (with optional control functional)
'''
def svgd_kernel_subset(self, h=-1, cf = False):
n,d = self.theta.shape
m = self.y.shape[0]
pairwise_dists = cdist(self.theta, self.y)**2
if h < 0: # if h < 0, using median trick
h = np.median(pairwise_dists)
h = np.sqrt(0.5 * h / np.log(n+1))
# compute the rbf kernel
Kxy = np.exp( -pairwise_dists / h**2 / 2)
if cf == True : # Using control functional
sqxdy_part = np.array([np.sum(np.multiply(self.Sqy,self.y),axis=1),]*m).T
sqxdy = -(np.matmul(self.Sqy,self.y.T)- sqxdy_part)/ h**2
dxsqy = sqxdy.T
dxdy = -pairwise_dists[self.yInd]/h**4 +d/h**2
KxySub = Kxy[self.yInd]
KpMat = (np.matmul(self.Sqy, self.Sqy.T) + sqxdy + dxsqy + dxdy)
KpMat = np.multiply(KpMat, KxySub)
weights = self.getWeights(KpMat)
Kxy = np.multiply(Kxy, np.matlib.repmat(weights, n, 1))
dxkxy = -np.matmul(Kxy, self.y)
sumkxy = np.sum(Kxy, axis=1)
for i in range(d):
dxkxy[:, i] = dxkxy[:,i] + np.multiply(self.theta[:,i],sumkxy)
dxkxy = dxkxy / (h**2)
grad_theta = (np.matmul(Kxy, self.Sqy) + dxkxy)
if cf == False:
grad_theta = grad_theta / m
return grad_theta
'''
Perform a step of adam update
'''
def get_adamUpdate(self, iterInd, ori_grad, hist_grad, stepsize = 1e-3, alpha = 0.9, fudge_factor = 1e-6):
if iterInd == 0:
hist_grad = hist_grad + ori_grad ** 2
else:
hist_grad = alpha * hist_grad + (1 - alpha) * (ori_grad ** 2)
adj_grad = np.divide(ori_grad, fudge_factor+np.sqrt(hist_grad))
return (stepsize * adj_grad, hist_grad)
'''
Compute gradient update for y
'''
def svgd_kernel_grady(self, h=-1, uStat=True, regCoeff=0.1):
m = self.y.shape[0]
xAdverSubsetInd = np.random.choice(self.theta.shape[0], m, replace=False)
self.thetaSubset = self.theta[xAdverSubsetInd,:]
self.SqxSubset = self.Sqx[xAdverSubsetInd,:]
#self.thetaSubset = np.copy(self.theta)
#self.SqxSubset = np.copy(self.Sqx)
n,d = self.thetaSubset.shape
pairwise_dists = cdist(self.thetaSubset, self.y)**2
if h < 0: # if h < 0, using median trick
h = np.median(pairwise_dists)
h = np.sqrt(0.5 * h / np.log(n+1))
# compute the rbf kernel
Kxy = np.exp( -pairwise_dists / h**2 / 2)
yGrad = np.zeros((m,d));
# Compute gradient
for yInd in range(m):
Kxy_cur = Kxy[:,yInd];
xmy = (self.thetaSubset - np.tile(self.y[yInd,:],[n,1]))/h**2
Sqxxmy = self.SqxSubset - xmy;
back = np.tile(np.array([Kxy_cur]).T,(1,d)) * Sqxxmy
inner = np.tile(np.array([np.sum(np.matmul(back, back.T),axis=1)]).T,[1,d])
yGrad[yInd,:] = np.sum(xmy * inner,axis=0) + np.sum(back,axis=0) * np.sum(Kxy_cur)/h**2
# For U-statistic
if uStat:
front_u = np.tile(np.array([(Kxy_cur**2) * np.sum(Sqxxmy **2,axis=1)]).T,[1,d]) * xmy;
back_u = np.tile(np.array([Kxy_cur**2 / h**2]).T,[1,d]) * Sqxxmy
yGrad[yInd,:] = yGrad[yInd,:] - np.sum(front_u + back_u,axis=0)
if uStat:
yGrad = yGrad * 2 / (n*(n-1)*m);
else:
yGrad = yGrad * 2 / (n**2 * m);
if regCoeff > 0 :
H_y = cdist(self.y, self.y)**2
Kxy_y = np.exp( -H_y / h**2 / 2)
sumKxy_y = np.sum(Kxy_y,axis=1)
yReg = (self.y * np.tile(np.array([sumKxy_y]).T,[1,d]) - np.matmul(Kxy_y,self.y))/(h**2 * m)
yGrad = yGrad + regCoeff * yReg
return (yGrad)
'''
Compute gradient update for h
'''
def svgd_kernel_gradh(self, h=-1, uStat=True):
n,d = self.thetaSubset.shape
m = self.y.shape[0]
H = cdist(self.thetaSubset, self.y)**2
if h < 0: # if h < 0, using median trick
h = np.median(H)
h = np.sqrt(0.5 * h / np.log(n+1))
# compute the rbf kernel
Kxy = np.exp( -H / h**2 / 2)
hGrad = 0;
# For each induced point
for yInd in range(m):
Kxy_cur = Kxy[:,yInd]
H_cur = H[:,yInd]
xmy = (self.thetaSubset - np.tile(self.y[yInd,:],[n,1]))/h**2
Sqxxmy = self.SqxSubset - xmy
part2 = np.tile(np.array([Kxy_cur]).T,[1,d]) * Sqxxmy
part1_1 = np.tile(np.array([H_cur/h**3]).T,[1,d]) * part2
part1_2 = np.tile(np.array([Kxy_cur]).T,[1,d]) * (2*xmy / h**3)
part = np.matmul(part1_1 + part1_2, part2.T)
hGrad = hGrad + np.sum(np.sum(part,axis=1))
if uStat:
front_u = (Kxy_cur**2) * (H_cur/h**3) * np.sum(Sqxxmy**2, axis=1)
back_u = np.sum((2*xmy/h**3) * Sqxxmy,axis=1)
hGrad = hGrad - np.sum(Kxy_cur**2 * (front_u + back_u),axis=0)
if uStat:
hGrad = hGrad * 2 / (n*(n-1)*m);
else:
hGrad = hGrad * 2 / (n**2 * m);
return (hGrad)
'''
Induced Points Method
'''
def svgd_kernel_inducedPoints(self, h=-1, uStat=True, regCoeff=0.1, adver = False, adverMaxIter = 5, stepsize = 1e-3, alpha = 0.9):
n,d = self.theta.shape
m = self.y.shape[0]
# If we want to perform EM
if adver == True:
# Perform update emMaxIter number of times
fudge_factor = 1e-6
for adverIter in range(0,adverMaxIter):
grad_y = self.svgd_kernel_grady(h=h,uStat=uStat, regCoeff=regCoeff)
[update_y,hist_grad] = self.get_adamUpdate(adverIter, grad_y, self.y_historical_grad,stepsize = stepsize, alpha = alpha)
self.y = self.y + update_y
self.y_historical_grad = hist_grad
grad_h = self.svgd_kernel_gradh(h=h,uStat=uStat)
[update_h, hist_grad] = self.get_adamUpdate(adverIter, grad_h, self.h_historical_grad,stepsize = stepsize, alpha = alpha)
h = h + update_h
self.h_historical_grad = hist_grad
pairwise_dists = cdist(self.theta, self.y)**2
# compute the rbf kernel
Kxy = np.exp( -pairwise_dists / h**2 / 2)
innerTerm_1 = np.matmul(Kxy.T, (self.Sqx - self.theta/ h**2))
sumkxy = np.sum(Kxy, axis=0)
innerTerm_2 = np.multiply(np.tile(np.array([sumkxy]).T,(1,d)), self.y/h**2)
innerTerm = (innerTerm_1 + innerTerm_2)/n
gradTheta = np.matmul(Kxy, innerTerm)/m
return (gradTheta)
'''
Pack all parameters in our model
'''
def pack_weights(self, w1, b1, w2, b2, loggamma, loglambda):
params = np.concatenate([w1.flatten(), b1, w2, [b2], [loggamma],[loglambda]])
return params
'''
Unpack all parameters in our model
'''
def unpack_weights(self, z):
w = z
w1 = np.reshape(w[:self.d*self.n_hidden], [self.d, self.n_hidden])
b1 = w[self.d*self.n_hidden:(self.d+1)*self.n_hidden]
w = w[(self.d+1)*self.n_hidden:]
w2, b2 = w[:self.n_hidden], w[-3]
# the last two parameters are log variance
loggamma, loglambda= w[-2], w[-1]
return (w1, b1, w2, b2, loggamma, loglambda)
'''
Evaluating testing rmse and log-likelihood, which is the same as in PBP
Input:
-- X_test: unnormalized testing feature set
-- y_test: unnormalized testing labels
'''
def evaluation(self, X_test, y_test):
# normalization
X_test = self.normalization(X_test)
# average over the output
pred_y_test = np.zeros([self.M, len(y_test)])
prob = np.zeros([self.M, len(y_test)])
'''
Since we have M particles, we use a Bayesian view to calculate rmse and log-likelihood
'''
for i in range(self.M):
w1, b1, w2, b2, loggamma, loglambda = self.unpack_weights(self.thetaCopy[i, :])
pred_y_test[i, :] = self.nn_predict(X_test, w1, b1, w2, b2) * self.std_y_train + self.mean_y_train
prob[i, :] = np.sqrt(np.exp(loggamma)) /np.sqrt(2*np.pi) * np.exp( -1 * (np.power(pred_y_test[i, :] - y_test, 2) / 2) * np.exp(loggamma) )
pred = np.mean(pred_y_test, axis=0)
# evaluation
svgd_rmse = np.sqrt(np.mean((pred - y_test)**2))
svgd_ll = np.mean(np.log(np.mean(prob, axis = 0)))
return (svgd_rmse, svgd_ll)
'''
Returns the result of the iterations
'''
def getResults(self):
return (self.rmse_overTime, self.llh_overTime, self.iter_overTime)
if __name__ == '__main__':
print ('Theano', theano.version.version) #our implementation is based on theano 0.8.2
np.random.seed(1)
''' load data file '''
for dataInd in range(0,1):
if dataInd == 0:
data = np.loadtxt('../data/boston_housing')
datasetName = 'Boston Housing'
elif dataInd == 1:
data = np.loadtxt(open("../data/Concrete.csv", "rb"), delimiter=",", skiprows=1) # Concrete
datasetName = 'Concrete'
elif dataInd == 2:
data = np.loadtxt(open("../data/Energy.csv", "rb"), delimiter=",", skiprows=1) # Energy
datasetName = 'Energy'
elif dataInd == 3:
data = np.loadtxt(open("../data/kin8nm.csv", "rb"), delimiter=",", skiprows=0) # Kin8nm Dataset
datasetName = 'Kin8nm'
print('-------------------',datasetName,'-------------------')
if dataInd == 2:
X_input = data[ :, range(data.shape[ 1 ] - 2) ]
y_input = data[ :, data.shape[ 1 ] - 2 ]
else:
# Please make sure that the last column is the label and the other columns are features
X_input = data[ :, range(data.shape[ 1 ] - 1) ]
y_input = data[ :, data.shape[ 1 ] - 1 ]
''' build the training and testing data set'''
train_ratio = 0.9 # We create the train and test sets with 90% and 10% of the data
permutation = np.arange(X_input.shape[0])
random.shuffle(permutation)
size_train = int(np.round(X_input.shape[ 0 ] * train_ratio))
index_train = permutation[ 0 : size_train]
index_test = permutation[ size_train : ]
X_train, y_train = X_input[ index_train, : ], y_input[ index_train ]
X_test, y_test = X_input[ index_test, : ], y_input[ index_test ]
#names = ['Base','Subset','Subset-CF','Induced Points'];
names = ['Base','Subset','Subset-CF','Induced Points','Adversarial Induced Points'];
#names = ['Base','Induced Points','Adversarial Induced Points'];
numIter = 10
maxTime = 100
numTimeSteps = 20
modelNum = len(names);
svgd_rmse_final = np.zeros((modelNum, numTimeSteps))
svgd_ll_final = np.zeros((modelNum, numTimeSteps))
svgd_iter_final = np.zeros((modelNum, numTimeSteps))
''' Training Bayesian neural network with SVGD '''
#batch_size, n_hidden, max_iter, numParticles = 100, 50, 2000, 30 # max_iter is a trade-off between running time and performance
batch_size, n_hidden, max_iter, numParticles = 100, 50, 100000, 20 # max_iter is a trade-off between running time and performance
max_iterRS = 100000
max_iterRSCF = 100000
max_iterIP = 100000
max_iterAIP = 100000
m, adverMaxIter = 10,1
max_iters = [max_iter, max_iterRS, max_iterRSCF, max_iterIP];
np.set_printoptions(precision=4)
for modelInd in range(0,5):
for t in range(0,numIter):
np.random.seed(t)
print(names[modelInd], ': Iteration ', t+1, '/', numIter)
start = time.time()
if modelInd == 0 :# base
svgd = svgd_bayesnn(X_train, y_train, X_test, y_test, numTimeSteps = numTimeSteps, maxTime = maxTime,
batch_size = batch_size, n_hidden = n_hidden, M=numParticles, max_iter = max_iter,
method = 'none')
elif modelInd == 1 : # Subset
svgd = svgd_bayesnn(X_train, y_train, X_test, y_test, numTimeSteps = numTimeSteps, maxTime = maxTime,
batch_size = batch_size, n_hidden = n_hidden, M=numParticles, max_iter = max_iterRS,
method = 'subparticles',m=m,cf=False)
elif modelInd == 2 : # Subset (CF)
svgd = svgd_bayesnn(X_train, y_train, X_test, y_test, numTimeSteps = numTimeSteps, maxTime = maxTime,
batch_size = batch_size, n_hidden = n_hidden, M=numParticles, max_iter = max_iterRSCF,
method = 'subparticles',m=m,cf=True)
elif modelInd == 3 : # Induced Points
svgd = svgd_bayesnn(X_train, y_train, X_test, y_test, numTimeSteps = numTimeSteps, maxTime = maxTime,
batch_size = batch_size, n_hidden = n_hidden, M=numParticles, max_iter = max_iterIP,
method = 'inducedPoints',m=m, uStat = True, adver=False)
elif modelInd == 4 : # Induced Points (Adver)
svgd = svgd_bayesnn(X_train, y_train, X_test, y_test, numTimeSteps = numTimeSteps, maxTime = maxTime,
batch_size = batch_size, n_hidden = n_hidden, M=numParticles, max_iter = max_iterAIP,
method = 'inducedPoints',m=m, uStat = True, adver=True, adverMaxIter = adverMaxIter)
[rmseResult, llResult, iterResult] = svgd.getResults()
svgd_rmse_final[modelInd,:] = svgd_rmse_final[modelInd,:] + rmseResult / numIter
svgd_ll_final[modelInd,:] = svgd_ll_final[modelInd,:] + llResult / numIter
svgd_iter_final[modelInd,:] = svgd_iter_final[modelInd,:] + np.round(iterResult / numIter)
np.save('./subset_1adver_rmseResult_'+datasetName,svgd_rmse_final)
np.save('./subset_1adver_llResult_'+datasetName,svgd_ll_final)
np.save('./subset_1adver_iterResult_'+datasetName,svgd_iter_final)
#print('--------------------------------------------------------------------------------')
#print('Dataset : ', datasetName)
#print('[Options] : M=',numParticles, ', m=',m, ', max_iter=', max_iter, ', n_hidden=',n_hidden, ', batch_size=',batch_size)
#print('--------------------------------------------------------------------------------')
#for modelInd in range(0,modelNum):
# print (names[modelInd],' [Average of', numIter, 'runs] : ', max_iters[modelInd], ' iterations')
# print ('[rmse] Mean : ', "%.4f" % np.mean(svgd_rmse_final[modelInd,]), ' st.dev : ', "%.4f" % np.std(svgd_rmse_final[modelInd,]) )
# print ('[llik] Mean : ', "%.4f" % np.mean(svgd_ll_final[modelInd,]), ' st.dev : ', "%.4f" % np.std(svgd_ll_final[modelInd,]) )
# print ('[time] Mean : ', "%.2f" % np.mean(svgd_time_final[modelInd,]), ' st.dev : ', "%.2f" % np.std(svgd_time_final[modelInd,]), '\n')
| python/bayesian_nn_subset.py | 27,850 | We define a one-hidden-layer-neural-network specifically. We leave extension of deep neural network as our future work.
Input
-- X_train: training dataset, features
-- y_train: training labels
-- batch_size: sub-sampling batch size
-- max_iter: maximum iterations for the training procedure
-- M: number of particles are used to fit the posterior distribution
-- n_hidden: number of hidden units
-- a0, b0: hyper-parameters of Gamma distribution
-- master_stepsize, auto_corr: parameters of adgrad
number of data, dimension w1: d*n_hidden; b1: n_hidden; w2 = n_hidden; b2 = 1; 2 variances particles, will be initialized later Feature matrix labels weights between input layer and hidden layer bias vector of hidden layer weights between hidden layer and output layer bias of output number of observations variances related parameters sub-sampling mini-batches of data, where (X, y) is the batch data, and N is the number of whole observations automatic gradient prediction function normalization number of observations use better initialization for gamma gradient adagrad with momentum RMSE LLH LLH Time to check every iteration Sqy Sqx sub-sampling Evaluate and save likelihood The higher probability is better one heuristic setting update loggamma Break after maxTime Get weights if h < 0, using median trick compute the rbf kernel if h < 0, using median trick compute the rbf kernel Using control functionalself.thetaSubset = np.copy(self.theta)self.SqxSubset = np.copy(self.Sqx) if h < 0, using median trick compute the rbf kernel Compute gradient For U-statistic if h < 0, using median trick compute the rbf kernel For each induced point If we want to perform EM Perform update emMaxIter number of times compute the rbf kernel the last two parameters are log variance normalization average over the output evaluationour implementation is based on theano 0.8.2 Concrete Energy Kin8nm Dataset Please make sure that the last column is the label and the other columns are features We create the train and test sets with 90% and 10% of the datanames = ['Base','Subset','Subset-CF','Induced Points'];names = ['Base','Induced Points','Adversarial Induced Points'];batch_size, n_hidden, max_iter, numParticles = 100, 50, 2000, 30 max_iter is a trade-off between running time and performance max_iter is a trade-off between running time and performance base Subset Subset (CF) Induced Points Induced Points (Adver)print('--------------------------------------------------------------------------------')print('Dataset : ', datasetName)print('[Options] : M=',numParticles, ', m=',m, ', max_iter=', max_iter, ', n_hidden=',n_hidden, ', batch_size=',batch_size)print('--------------------------------------------------------------------------------')for modelInd in range(0,modelNum): print (names[modelInd],' [Average of', numIter, 'runs] : ', max_iters[modelInd], ' iterations') print ('[rmse] Mean : ', "%.4f" % np.mean(svgd_rmse_final[modelInd,]), ' st.dev : ', "%.4f" % np.std(svgd_rmse_final[modelInd,]) ) print ('[llik] Mean : ', "%.4f" % np.mean(svgd_ll_final[modelInd,]), ' st.dev : ', "%.4f" % np.std(svgd_ll_final[modelInd,]) ) print ('[time] Mean : ', "%.2f" % np.mean(svgd_time_final[modelInd,]), ' st.dev : ', "%.2f" % np.std(svgd_time_final[modelInd,]), '\n') | 3,316 | en | 0.624863 |
'''
This file contains test cases for tflearn
'''
import tensorflow as tf
import zqtflearn
import unittest
class TestInputs(unittest.TestCase):
'''
This class contains test cases for serval input types
'''
INPUT_DATA_1 = [ [ 1 ], [ 2 ], [ 3 ], [ 4 ], [ 5 ] ]
INPUT_DATA_2 = [ [ 6 ], [ 7 ], [ 8 ], [ 9 ], [ 10 ] ]
TARGET = [ [ 14 ], [ 18 ], [ 22 ], [ 26 ], [ 30 ] ] # (input1 + input2) * 2
def test_list_inputs(self):
"""Test input a list
"""
with tf.Graph().as_default():
model, inputs, target = self.build_simple_model()
model.fit([ inpData for _, _, inpData in inputs ], target, batch_size = 1)
def test_dict_inputs(self):
"""Test input a dict with layer name
"""
with tf.Graph().as_default():
model, inputs, target = self.build_simple_model()
model.fit({ name: inpData for name, _, inpData in inputs }, target, batch_size = 1)
def test_dict_withtensor_inputs(self):
"""Test input a dict with placeholder
"""
with tf.Graph().as_default():
model, inputs, target = self.build_simple_model()
model.fit({ placeholder: inpData for _, placeholder, inpData in inputs }, target, batch_size = 1)
def build_simple_model(self):
"""Build a simple model for test
Returns:
DNN, [ (input layer name, input placeholder, input data) ], Target data
"""
inputPlaceholder1, inputPlaceholder2 = \
tf.placeholder(tf.float32, (1, 1), name = "input1"), tf.placeholder(tf.float32, (1, 1), name = "input2")
input1 = zqtflearn.input_data(placeholder = inputPlaceholder1)
input2 = zqtflearn.input_data(placeholder = inputPlaceholder2)
network = zqtflearn.merge([input1, input2], "sum")
network = zqtflearn.reshape(network, (1, 1))
network = zqtflearn.fully_connected(network, 1)
network = zqtflearn.regression(network)
return (
zqtflearn.DNN(network),
[ ("input1:0", inputPlaceholder1, self.INPUT_DATA_1), ("input2:0", inputPlaceholder2, self.INPUT_DATA_2) ],
self.TARGET,
)
if __name__ == "__main__":
unittest.main()
| zqtflearn2/tests/test_inputs.py | 2,253 | This class contains test cases for serval input types
Build a simple model for test
Returns:
DNN, [ (input layer name, input placeholder, input data) ], Target data
Test input a dict with layer name
Test input a dict with placeholder
Test input a list
This file contains test cases for tflearn
(input1 + input2) * 2 | 348 | en | 0.496812 |
# Copyright 2019 Huawei Technologies Co., Ltd
#
# Licensed under the Apache License, Version 2.0 (the "License");
# you may not use this file except in compliance with the License.
# You may obtain a copy of the License at
#
# http://www.apache.org/licenses/LICENSE-2.0
#
# Unless required by applicable law or agreed to in writing, software
# distributed under the License is distributed on an "AS IS" BASIS,
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
# See the License for the specific language governing permissions and
# limitations under the License.
import numpy as np
import mindspore as ms
import mindspore.nn as nn
from mindspore import Tensor, context
from mindspore.common.parameter import Parameter
from mindspore.nn.loss import SoftmaxCrossEntropyWithLogits
from mindspore.nn.optim.momentum import Momentum
from mindspore.ops import operations as P
from mindspore.train import Model
from mindspore.context import ParallelMode
from tests.dataset_mock import MindData
class Dataset(MindData):
def __init__(self, predict, label, length=3):
super(Dataset, self).__init__(size=length)
self.predict = predict
self.label = label
self.index = 0
self.length = length
def __iter__(self):
return self
def __next__(self):
if self.index >= self.length:
raise StopIteration
self.index += 1
return self.predict, self.label
def reset(self):
self.index = 0
class TransposeNet(nn.Cell):
def __init__(self, strategy1, strategy2):
super(TransposeNet, self).__init__()
self.matmul = P.MatMul().set_strategy(((8, 1), (1, 1)))
self.matmul_weight = Parameter(Tensor(np.ones([128, 256]), dtype=ms.float32), name="weight")
self.transpose1 = P.Transpose().set_strategy(strategy1)
self.transpose2 = P.Transpose().set_strategy(strategy2)
def construct(self, x):
x = self.matmul(x, self.matmul_weight)
x = self.transpose1(x, (1, 0))
x = self.transpose2(x, (1, 0))
return x
def transpose_net(strategy1, strategy2):
return TransposeNet(strategy1=strategy1, strategy2=strategy2)
def transpose_common(strategy1, strategy2):
learning_rate = 0.1
momentum = 0.9
epoch_size = 2
context.reset_auto_parallel_context()
context.set_auto_parallel_context(parallel_mode=ParallelMode.SEMI_AUTO_PARALLEL, device_num=8,
parameter_broadcast=False)
predict = Tensor(np.ones([32, 128]), dtype=ms.float32)
label = Tensor(np.ones([32]), dtype=ms.int32)
dataset = Dataset(predict, label, 2)
net = transpose_net(strategy1, strategy2)
loss = SoftmaxCrossEntropyWithLogits(sparse=True, reduction='mean')
loss.softmax_cross_entropy.set_strategy(((8, 1), (8, 1)))
opt = Momentum(net.trainable_params(), learning_rate, momentum)
context.set_context(mode=context.GRAPH_MODE)
model = Model(net, loss, opt)
model.train(epoch_size, dataset, dataset_sink_mode=False)
def test_transpose1():
strategy1 = ((1, 8),)
strategy2 = ((1, 8),)
transpose_common(strategy1, strategy2)
def test_transpose2():
strategy1 = ((1, 4),)
strategy2 = ((1, 8),)
transpose_common(strategy1, strategy2)
if __name__ == '__main__':
test_transpose1()
test_transpose2()
| tests/ut/python/parallel/test_transpose.py | 3,369 | Copyright 2019 Huawei Technologies Co., Ltd Licensed under the Apache License, Version 2.0 (the "License"); you may not use this file except in compliance with the License. You may obtain a copy of the License at http://www.apache.org/licenses/LICENSE-2.0 Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the specific language governing permissions and limitations under the License. | 561 | en | 0.849356 |
# Quiet TensorFlow.
import os
import numpy as np
# from transformers import AutoTokenizer, TFAutoModelForSequenceClassification, pipeline
from transformers import BertTokenizer, BertForSequenceClassification
import textattack
from textattack import Attacker
from textattack.attack_recipes.my_attack.my_textfooler import MyTextFoolerJin2019
from textattack.datasets import HuggingFaceDataset
from textattack.models.wrappers import ModelWrapper, huggingface_model_wrapper
from textattack.models.wrappers import HuggingFaceModelWrapper
def load_dataset_sst(path = '/mnt/cloud/bairu/repos/text_pgd_attack/sst-2/'):
def process_file(file):
# sentence_list = []
# label_list = []
data_list = []
with open(path + file,'r',encoding = 'utf-8') as f:
for line in f:
sen, label = line.split("\t",1)
data_item = [sen, int(label)]
data_list.append(data_item)
return data_list
train_dataset = process_file("train.tsv")
valid_dataset = process_file("valid.tsv")
test_dataset = process_file("test.tsv")
return test_dataset
directory = '/mnt/cloud/bairu/repos/std_text_pgd_attack/checkpoints/bert-base-uncased-sst'
model = BertForSequenceClassification.from_pretrained(directory)
tokenizer = BertTokenizer.from_pretrained('/mnt/cloud/bairu/repos/text_pgd_attack/checkpoints/bert-base-uncased-sst')
wrapper_model = huggingface_model_wrapper.HuggingFaceModelWrapper(model, tokenizer)
recipe = MyTextFoolerJin2019.build(wrapper_model)
# dataset = HuggingFaceDataset("allocine", split="test")
dataset = load_dataset_sst()
dataset = textattack.datasets.Dataset(dataset)
# attack_args = textattack.AttackArgs(num_examples = -1, log_to_txt = './log/textfooler_sst_bertbase_query2000.txt', query_budget = 2000)
attack_args = textattack.AttackArgs(num_examples = -1, log_to_txt = './log/ddd.txt', query_budget = 2000)
# attack_args = textattack.AttackArgs(num_examples = 10, log_to_txt = './log/ddd.txt', query_budget = 500)
attacker = Attacker(recipe, dataset, attack_args)
results = attacker.attack_dataset()
| experiments/sst/attack_bert_textfooler_sst.py | 2,116 | Quiet TensorFlow. from transformers import AutoTokenizer, TFAutoModelForSequenceClassification, pipeline sentence_list = [] label_list = [] dataset = HuggingFaceDataset("allocine", split="test") attack_args = textattack.AttackArgs(num_examples = -1, log_to_txt = './log/textfooler_sst_bertbase_query2000.txt', query_budget = 2000) attack_args = textattack.AttackArgs(num_examples = 10, log_to_txt = './log/ddd.txt', query_budget = 500) | 435 | en | 0.478609 |
from utilities import *
from model import get_model
from data import get_data, get_loaders
from augmentations import get_augs
from test_epoch import test_epoch
import gc
import neptune
from accelerate import Accelerator, DistributedType
import pandas as pd
import numpy as np
def run_inference(df,
df_old,
df_test,
CFG,
run = None):
'''
Run inference loop
'''
# tests
assert isinstance(CFG, dict), 'CFG has to be a dict with parameters'
assert isinstance(df, pd.DataFrame), 'df has to be a pandas dataframe'
# placeholders
oof = None
sub = None
# inference
for fold in range(CFG['num_folds']):
# initialize accelerator
accelerator = Accelerator(device_placement = True,
fp16 = CFG['use_fp16'],
split_batches = False)
if CFG['device'] == 'GPU':
accelerator.state.device = torch.device('cuda:{}'.format(CFG['device_index']))
# feedback
accelerator.print('-' * 55)
accelerator.print('FOLD {:d}/{:d}'.format(fold + 1, CFG['num_folds']))
accelerator.print('-' * 55)
# get data
df_trn, df_val = get_data(df = df,
df_old = df_old,
fold = fold,
CFG = CFG,
accelerator = accelerator,
silent = True)
# get test loader
_, val_loader = get_loaders(df_train = df_trn,
df_valid = df_val,
CFG = CFG,
accelerator = accelerator,
labeled = False,
silent = True)
_, test_loader = get_loaders(df_train = df_trn,
df_valid = df_test,
CFG = CFG,
accelerator = accelerator,
labeled = False,
silent = True)
# prepare model
model = get_model(CFG = CFG,
pretrained = CFG['out_path'] + 'weights_fold{}.pth'.format(int(fold)))
# handle device placement
model, val_loader, test_loader = accelerator.prepare(model, val_loader, test_loader)
# inference for validation data
if CFG['predict_oof']:
# produce OOF preds
val_preds = test_epoch(loader = val_loader,
model = model,
CFG = CFG,
accelerator = accelerator,
num_tta = CFG['num_tta'])
# store OOF preds
val_preds_df = pd.DataFrame(val_preds, columns = ['pred'])
val_preds_df = pd.concat([df_val, val_preds_df], axis = 1)
oof = pd.concat([oof, val_preds_df], axis = 0).reset_index(drop = True)
# inference for test data
if CFG['predict_test']:
# produce test preds
test_preds = test_epoch(loader = test_loader,
model = model,
CFG = CFG,
accelerator = accelerator,
num_tta = CFG['num_tta'])
# store test preds
test_preds_df = pd.DataFrame(test_preds, columns = ['pred_fold{}'.format(int(fold))])
sub = pd.concat([sub, test_preds_df], axis = 1)
# clear memory
del model, val_loader, test_loader
del accelerator
gc.collect()
# export OOF preds
if CFG['predict_oof']:
oof.to_csv(CFG['out_path'] + 'oof.csv', index = False)
if CFG['tracking']:
run['oof'].upload(CFG['out_path'] + 'oof.csv')
# export test preds
if CFG['predict_test']:
sub = pd.concat([df_test['Id'], sub], axis = 1)
sub.to_csv(CFG['out_path'] + 'submission.csv', index = False)
if CFG['tracking']:
run['submission'].upload(CFG['out_path'] + 'submission.csv')
| code/run_inference.py | 4,693 | Run inference loop
tests placeholders inference initialize accelerator feedback get data get test loader prepare model handle device placement inference for validation data produce OOF preds store OOF preds inference for test data produce test preds store test preds clear memory export OOF preds export test preds | 316 | en | 0.519201 |
# -*- coding: utf-8 -*-
from chatterbot import ChatBot
from chatterbot.trainers import ChatterBotCorpusTrainer
from settings import Microsoft
'''
See the Microsoft DirectLine api documentation for how to get a user access token.
https://docs.botframework.com/en-us/restapi/directline/
'''
chatbot = ChatBot(
'MicrosoftBot',
directline_host=Microsoft['directline_host'],
direct_line_token_or_secret=Microsoft['direct_line_token_or_secret'],
conversation_id=Microsoft['conversation_id'],
input_adapter='chatterbot.input.Microsoft',
output_adapter='chatterbot.output.Microsoft'
)
trainer = ChatterBotCorpusTrainer(chatbot)
trainer.train('chatterbot.corpus.english')
# The following loop will execute each time the user enters input
while True:
try:
response = chatbot.get_response(None)
# Press ctrl-c or ctrl-d on the keyboard to exit
except (KeyboardInterrupt, EOFError, SystemExit):
break
| examples/microsoft_bot.py | 947 | -*- coding: utf-8 -*- The following loop will execute each time the user enters input Press ctrl-c or ctrl-d on the keyboard to exit | 132 | en | 0.770185 |
import picamera
from time import sleep
camera = picamera.PiCamera()
camera.capture('image.jpg')
#camera.resolution = (640, 480) #max resolution is 2592 x 1944 for stills,
# 1920 x 1080 (<15fps) for video
#camera.framerate = 45
camera.vflip = True
camera.start_recording('video.h264')
camera.image_effect = 'negative'
for j in range (10):
for i in range(200):
camera.annotate_text = "everyday we stray further from God's light"
camera.annotate_text_size = abs(i-100)+6
camera.brightness = abs(i-100)
sleep(0.001)
camera.stop_recording()
| src/test.py | 612 | camera.resolution = (640, 480) max resolution is 2592 x 1944 for stills, 1920 x 1080 (<15fps) for videocamera.framerate = 45 | 141 | en | 0.747164 |
# coding: utf-8
"""
Adobe Experience Manager (AEM) API
Swagger AEM is an OpenAPI specification for Adobe Experience Manager (AEM) API
OpenAPI spec version: 2.2.0
Contact: opensource@shinesolutions.com
Generated by: https://github.com/swagger-api/swagger-codegen.git
"""
from __future__ import absolute_import
import sys
import os
import re
# python 2 and python 3 compatibility library
from six import iteritems
from ..api_client import ApiClient
class CrxApi(object):
"""
NOTE: This class is auto generated by the swagger code generator program.
Do not edit the class manually.
Ref: https://github.com/swagger-api/swagger-codegen
"""
def __init__(self, api_client=None):
if api_client is None:
api_client = ApiClient()
self.api_client = api_client
def get_crxde_status(self, **kwargs):
"""
This method makes a synchronous HTTP request by default. To make an
asynchronous HTTP request, please pass async=True
>>> thread = api.get_crxde_status(async=True)
>>> result = thread.get()
:param async bool
:return: str
If the method is called asynchronously,
returns the request thread.
"""
kwargs['_return_http_data_only'] = True
if kwargs.get('async'):
return self.get_crxde_status_with_http_info(**kwargs)
else:
(data) = self.get_crxde_status_with_http_info(**kwargs)
return data
def get_crxde_status_with_http_info(self, **kwargs):
"""
This method makes a synchronous HTTP request by default. To make an
asynchronous HTTP request, please pass async=True
>>> thread = api.get_crxde_status_with_http_info(async=True)
>>> result = thread.get()
:param async bool
:return: str
If the method is called asynchronously,
returns the request thread.
"""
all_params = []
all_params.append('async')
all_params.append('_return_http_data_only')
all_params.append('_preload_content')
all_params.append('_request_timeout')
params = locals()
for key, val in iteritems(params['kwargs']):
if key not in all_params:
raise TypeError(
"Got an unexpected keyword argument '%s'"
" to method get_crxde_status" % key
)
params[key] = val
del params['kwargs']
collection_formats = {}
path_params = {}
query_params = []
header_params = {}
form_params = []
local_var_files = {}
body_params = None
# HTTP header `Accept`
header_params['Accept'] = self.api_client.\
select_header_accept(['plain/text'])
# Authentication setting
auth_settings = ['aemAuth']
return self.api_client.call_api('/crx/server/crx.default/jcr:root/.1.json', 'GET',
path_params,
query_params,
header_params,
body=body_params,
post_params=form_params,
files=local_var_files,
response_type='str',
auth_settings=auth_settings,
async=params.get('async'),
_return_http_data_only=params.get('_return_http_data_only'),
_preload_content=params.get('_preload_content', True),
_request_timeout=params.get('_request_timeout'),
collection_formats=collection_formats)
def get_install_status(self, **kwargs):
"""
This method makes a synchronous HTTP request by default. To make an
asynchronous HTTP request, please pass async=True
>>> thread = api.get_install_status(async=True)
>>> result = thread.get()
:param async bool
:return: InstallStatus
If the method is called asynchronously,
returns the request thread.
"""
kwargs['_return_http_data_only'] = True
if kwargs.get('async'):
return self.get_install_status_with_http_info(**kwargs)
else:
(data) = self.get_install_status_with_http_info(**kwargs)
return data
def get_install_status_with_http_info(self, **kwargs):
"""
This method makes a synchronous HTTP request by default. To make an
asynchronous HTTP request, please pass async=True
>>> thread = api.get_install_status_with_http_info(async=True)
>>> result = thread.get()
:param async bool
:return: InstallStatus
If the method is called asynchronously,
returns the request thread.
"""
all_params = []
all_params.append('async')
all_params.append('_return_http_data_only')
all_params.append('_preload_content')
all_params.append('_request_timeout')
params = locals()
for key, val in iteritems(params['kwargs']):
if key not in all_params:
raise TypeError(
"Got an unexpected keyword argument '%s'"
" to method get_install_status" % key
)
params[key] = val
del params['kwargs']
collection_formats = {}
path_params = {}
query_params = []
header_params = {}
form_params = []
local_var_files = {}
body_params = None
# HTTP header `Accept`
header_params['Accept'] = self.api_client.\
select_header_accept(['application/json'])
# Authentication setting
auth_settings = ['aemAuth']
return self.api_client.call_api('/crx/packmgr/installstatus.jsp', 'GET',
path_params,
query_params,
header_params,
body=body_params,
post_params=form_params,
files=local_var_files,
response_type='InstallStatus',
auth_settings=auth_settings,
async=params.get('async'),
_return_http_data_only=params.get('_return_http_data_only'),
_preload_content=params.get('_preload_content', True),
_request_timeout=params.get('_request_timeout'),
collection_formats=collection_formats)
def post_package_service(self, cmd, **kwargs):
"""
This method makes a synchronous HTTP request by default. To make an
asynchronous HTTP request, please pass async=True
>>> thread = api.post_package_service(cmd, async=True)
>>> result = thread.get()
:param async bool
:param str cmd: (required)
:return: str
If the method is called asynchronously,
returns the request thread.
"""
kwargs['_return_http_data_only'] = True
if kwargs.get('async'):
return self.post_package_service_with_http_info(cmd, **kwargs)
else:
(data) = self.post_package_service_with_http_info(cmd, **kwargs)
return data
def post_package_service_with_http_info(self, cmd, **kwargs):
"""
This method makes a synchronous HTTP request by default. To make an
asynchronous HTTP request, please pass async=True
>>> thread = api.post_package_service_with_http_info(cmd, async=True)
>>> result = thread.get()
:param async bool
:param str cmd: (required)
:return: str
If the method is called asynchronously,
returns the request thread.
"""
all_params = ['cmd']
all_params.append('async')
all_params.append('_return_http_data_only')
all_params.append('_preload_content')
all_params.append('_request_timeout')
params = locals()
for key, val in iteritems(params['kwargs']):
if key not in all_params:
raise TypeError(
"Got an unexpected keyword argument '%s'"
" to method post_package_service" % key
)
params[key] = val
del params['kwargs']
# verify the required parameter 'cmd' is set
if ('cmd' not in params) or (params['cmd'] is None):
raise ValueError("Missing the required parameter `cmd` when calling `post_package_service`")
collection_formats = {}
path_params = {}
query_params = []
if 'cmd' in params:
query_params.append(('cmd', params['cmd']))
header_params = {}
form_params = []
local_var_files = {}
body_params = None
# HTTP header `Accept`
header_params['Accept'] = self.api_client.\
select_header_accept(['text/xml'])
# Authentication setting
auth_settings = ['aemAuth']
return self.api_client.call_api('/crx/packmgr/service.jsp', 'POST',
path_params,
query_params,
header_params,
body=body_params,
post_params=form_params,
files=local_var_files,
response_type='str',
auth_settings=auth_settings,
async=params.get('async'),
_return_http_data_only=params.get('_return_http_data_only'),
_preload_content=params.get('_preload_content', True),
_request_timeout=params.get('_request_timeout'),
collection_formats=collection_formats)
def post_package_service_json(self, path, cmd, **kwargs):
"""
This method makes a synchronous HTTP request by default. To make an
asynchronous HTTP request, please pass async=True
>>> thread = api.post_package_service_json(path, cmd, async=True)
>>> result = thread.get()
:param async bool
:param str path: (required)
:param str cmd: (required)
:param str group_name:
:param str package_name:
:param str package_version:
:param str charset_:
:param bool force:
:param bool recursive:
:param file package:
:return: str
If the method is called asynchronously,
returns the request thread.
"""
kwargs['_return_http_data_only'] = True
if kwargs.get('async'):
return self.post_package_service_json_with_http_info(path, cmd, **kwargs)
else:
(data) = self.post_package_service_json_with_http_info(path, cmd, **kwargs)
return data
def post_package_service_json_with_http_info(self, path, cmd, **kwargs):
"""
This method makes a synchronous HTTP request by default. To make an
asynchronous HTTP request, please pass async=True
>>> thread = api.post_package_service_json_with_http_info(path, cmd, async=True)
>>> result = thread.get()
:param async bool
:param str path: (required)
:param str cmd: (required)
:param str group_name:
:param str package_name:
:param str package_version:
:param str charset_:
:param bool force:
:param bool recursive:
:param file package:
:return: str
If the method is called asynchronously,
returns the request thread.
"""
all_params = ['path', 'cmd', 'group_name', 'package_name', 'package_version', 'charset_', 'force', 'recursive', 'package']
all_params.append('async')
all_params.append('_return_http_data_only')
all_params.append('_preload_content')
all_params.append('_request_timeout')
params = locals()
for key, val in iteritems(params['kwargs']):
if key not in all_params:
raise TypeError(
"Got an unexpected keyword argument '%s'"
" to method post_package_service_json" % key
)
params[key] = val
del params['kwargs']
# verify the required parameter 'path' is set
if ('path' not in params) or (params['path'] is None):
raise ValueError("Missing the required parameter `path` when calling `post_package_service_json`")
# verify the required parameter 'cmd' is set
if ('cmd' not in params) or (params['cmd'] is None):
raise ValueError("Missing the required parameter `cmd` when calling `post_package_service_json`")
collection_formats = {}
path_params = {}
if 'path' in params:
path_params['path'] = params['path']
query_params = []
if 'cmd' in params:
query_params.append(('cmd', params['cmd']))
if 'group_name' in params:
query_params.append(('groupName', params['group_name']))
if 'package_name' in params:
query_params.append(('packageName', params['package_name']))
if 'package_version' in params:
query_params.append(('packageVersion', params['package_version']))
if 'charset_' in params:
query_params.append(('_charset_', params['charset_']))
if 'force' in params:
query_params.append(('force', params['force']))
if 'recursive' in params:
query_params.append(('recursive', params['recursive']))
header_params = {}
form_params = []
local_var_files = {}
if 'package' in params:
local_var_files['package'] = params['package']
body_params = None
# HTTP header `Accept`
header_params['Accept'] = self.api_client.\
select_header_accept(['application/json'])
# HTTP header `Content-Type`
header_params['Content-Type'] = self.api_client.\
select_header_content_type(['multipart/form-data'])
# Authentication setting
auth_settings = ['aemAuth']
return self.api_client.call_api('/crx/packmgr/service/.json/{path}', 'POST',
path_params,
query_params,
header_params,
body=body_params,
post_params=form_params,
files=local_var_files,
response_type='str',
auth_settings=auth_settings,
async=params.get('async'),
_return_http_data_only=params.get('_return_http_data_only'),
_preload_content=params.get('_preload_content', True),
_request_timeout=params.get('_request_timeout'),
collection_formats=collection_formats)
def post_package_update(self, group_name, package_name, version, path, **kwargs):
"""
This method makes a synchronous HTTP request by default. To make an
asynchronous HTTP request, please pass async=True
>>> thread = api.post_package_update(group_name, package_name, version, path, async=True)
>>> result = thread.get()
:param async bool
:param str group_name: (required)
:param str package_name: (required)
:param str version: (required)
:param str path: (required)
:param str filter:
:param str charset_:
:return: str
If the method is called asynchronously,
returns the request thread.
"""
kwargs['_return_http_data_only'] = True
if kwargs.get('async'):
return self.post_package_update_with_http_info(group_name, package_name, version, path, **kwargs)
else:
(data) = self.post_package_update_with_http_info(group_name, package_name, version, path, **kwargs)
return data
def post_package_update_with_http_info(self, group_name, package_name, version, path, **kwargs):
"""
This method makes a synchronous HTTP request by default. To make an
asynchronous HTTP request, please pass async=True
>>> thread = api.post_package_update_with_http_info(group_name, package_name, version, path, async=True)
>>> result = thread.get()
:param async bool
:param str group_name: (required)
:param str package_name: (required)
:param str version: (required)
:param str path: (required)
:param str filter:
:param str charset_:
:return: str
If the method is called asynchronously,
returns the request thread.
"""
all_params = ['group_name', 'package_name', 'version', 'path', 'filter', 'charset_']
all_params.append('async')
all_params.append('_return_http_data_only')
all_params.append('_preload_content')
all_params.append('_request_timeout')
params = locals()
for key, val in iteritems(params['kwargs']):
if key not in all_params:
raise TypeError(
"Got an unexpected keyword argument '%s'"
" to method post_package_update" % key
)
params[key] = val
del params['kwargs']
# verify the required parameter 'group_name' is set
if ('group_name' not in params) or (params['group_name'] is None):
raise ValueError("Missing the required parameter `group_name` when calling `post_package_update`")
# verify the required parameter 'package_name' is set
if ('package_name' not in params) or (params['package_name'] is None):
raise ValueError("Missing the required parameter `package_name` when calling `post_package_update`")
# verify the required parameter 'version' is set
if ('version' not in params) or (params['version'] is None):
raise ValueError("Missing the required parameter `version` when calling `post_package_update`")
# verify the required parameter 'path' is set
if ('path' not in params) or (params['path'] is None):
raise ValueError("Missing the required parameter `path` when calling `post_package_update`")
collection_formats = {}
path_params = {}
query_params = []
if 'group_name' in params:
query_params.append(('groupName', params['group_name']))
if 'package_name' in params:
query_params.append(('packageName', params['package_name']))
if 'version' in params:
query_params.append(('version', params['version']))
if 'path' in params:
query_params.append(('path', params['path']))
if 'filter' in params:
query_params.append(('filter', params['filter']))
if 'charset_' in params:
query_params.append(('_charset_', params['charset_']))
header_params = {}
form_params = []
local_var_files = {}
body_params = None
# HTTP header `Accept`
header_params['Accept'] = self.api_client.\
select_header_accept(['application/json'])
# Authentication setting
auth_settings = ['aemAuth']
return self.api_client.call_api('/crx/packmgr/update.jsp', 'POST',
path_params,
query_params,
header_params,
body=body_params,
post_params=form_params,
files=local_var_files,
response_type='str',
auth_settings=auth_settings,
async=params.get('async'),
_return_http_data_only=params.get('_return_http_data_only'),
_preload_content=params.get('_preload_content', True),
_request_timeout=params.get('_request_timeout'),
collection_formats=collection_formats)
def post_set_password(self, old, plain, verify, **kwargs):
"""
This method makes a synchronous HTTP request by default. To make an
asynchronous HTTP request, please pass async=True
>>> thread = api.post_set_password(old, plain, verify, async=True)
>>> result = thread.get()
:param async bool
:param str old: (required)
:param str plain: (required)
:param str verify: (required)
:return: str
If the method is called asynchronously,
returns the request thread.
"""
kwargs['_return_http_data_only'] = True
if kwargs.get('async'):
return self.post_set_password_with_http_info(old, plain, verify, **kwargs)
else:
(data) = self.post_set_password_with_http_info(old, plain, verify, **kwargs)
return data
def post_set_password_with_http_info(self, old, plain, verify, **kwargs):
"""
This method makes a synchronous HTTP request by default. To make an
asynchronous HTTP request, please pass async=True
>>> thread = api.post_set_password_with_http_info(old, plain, verify, async=True)
>>> result = thread.get()
:param async bool
:param str old: (required)
:param str plain: (required)
:param str verify: (required)
:return: str
If the method is called asynchronously,
returns the request thread.
"""
all_params = ['old', 'plain', 'verify']
all_params.append('async')
all_params.append('_return_http_data_only')
all_params.append('_preload_content')
all_params.append('_request_timeout')
params = locals()
for key, val in iteritems(params['kwargs']):
if key not in all_params:
raise TypeError(
"Got an unexpected keyword argument '%s'"
" to method post_set_password" % key
)
params[key] = val
del params['kwargs']
# verify the required parameter 'old' is set
if ('old' not in params) or (params['old'] is None):
raise ValueError("Missing the required parameter `old` when calling `post_set_password`")
# verify the required parameter 'plain' is set
if ('plain' not in params) or (params['plain'] is None):
raise ValueError("Missing the required parameter `plain` when calling `post_set_password`")
# verify the required parameter 'verify' is set
if ('verify' not in params) or (params['verify'] is None):
raise ValueError("Missing the required parameter `verify` when calling `post_set_password`")
collection_formats = {}
path_params = {}
query_params = []
if 'old' in params:
query_params.append(('old', params['old']))
if 'plain' in params:
query_params.append(('plain', params['plain']))
if 'verify' in params:
query_params.append(('verify', params['verify']))
header_params = {}
form_params = []
local_var_files = {}
body_params = None
# HTTP header `Accept`
header_params['Accept'] = self.api_client.\
select_header_accept(['text/plain'])
# Authentication setting
auth_settings = ['aemAuth']
return self.api_client.call_api('/crx/explorer/ui/setpassword.jsp', 'POST',
path_params,
query_params,
header_params,
body=body_params,
post_params=form_params,
files=local_var_files,
response_type='str',
auth_settings=auth_settings,
async=params.get('async'),
_return_http_data_only=params.get('_return_http_data_only'),
_preload_content=params.get('_preload_content', True),
_request_timeout=params.get('_request_timeout'),
collection_formats=collection_formats)
| clients/python/generated/swaggeraem/apis/crx_api.py | 25,860 | coding: utf-8 python 2 and python 3 compatibility library HTTP header `Accept` Authentication setting HTTP header `Accept` Authentication setting verify the required parameter 'cmd' is set HTTP header `Accept` Authentication setting verify the required parameter 'path' is set verify the required parameter 'cmd' is set HTTP header `Accept` HTTP header `Content-Type` Authentication setting verify the required parameter 'group_name' is set verify the required parameter 'package_name' is set verify the required parameter 'version' is set verify the required parameter 'path' is set HTTP header `Accept` Authentication setting verify the required parameter 'old' is set verify the required parameter 'plain' is set verify the required parameter 'verify' is set HTTP header `Accept` Authentication setting | 805 | en | 0.260959 |
import json
import re
from django.http import JsonResponse
from django.db.models import Q
from django.urls import reverse
from django.views.decorators.csrf import csrf_exempt
from apps.vit.models import Vit
from apps.notification.utilities import notify
from apps.vit.utilities import find_mention, find_plustag
from .forms import VitForm
from apps.develop.backends import KeyBackend
def like(request):
user = KeyBackend().authenticate(request)
if request.user.is_authenticated:
try:
vit = Vit.objects.get(id=request.GET.get('vit_pk'))
if vit.likes.filter(id=request.user.id).exists():
vit.likes.remove(request.user)
vit.like_count -= 1
vit.save()
return JsonResponse({'status': 'success', 'likes': vit.likes.count(), 'liked': False}, status=200)
else:
vit.likes.add(request.user)
vit.like_count += 1
vit.save()
if vit.user != request.user:
notify(message=f"{request.user.username.title()} liked your Vit - '{vit.body}'", notification_type="like", to_user=vit.user,
by_user=request.user, link=reverse('vit_detail', kwargs={'pk': vit.id}))
return JsonResponse({'status': 'success', 'likes': vit.likes.count(), 'liked': True}, status=200)
except Vit.DoesNotExist:
return JsonResponse({'error': 'Vit not found'}, status=404)
else:
return JsonResponse({'error': 'You must be logged in'}, status=401)
def get_vits(request):
user = KeyBackend().authenticate(request)
if request.user.is_authenticated:
vits = Vit.objects.filter(Q(user=request.user) | Q(
user__profile__in=request.user.profile.follows.all()) | Q(user__profile__in=request.user.profile.followed_by.all())).order_by('-date')
return JsonResponse({'vits': [vit.to_json() for vit in vits]})
else:
return JsonResponse({'error': 'You must be logged in'}, status=401)
def get_vit(request, id):
user = KeyBackend().authenticate(request)
if request.user.is_authenticated:
try:
vit = Vit.objects.get(id=id)
return JsonResponse({'vit': vit.to_json()}, status=200)
except:
return JsonResponse({'error': 'Vit not found'}, status=404)
else:
return JsonResponse({'error': 'You must be logged in'}, status=401)
@csrf_exempt
def add_vit(request):
"""
Add a new vit with API, currently image and video are not supported
"""
user = KeyBackend().authenticate(request)
if request.method == "POST":
if request.user.is_authenticated:
form = VitForm(request.POST)
if form.is_valid():
vit = form.save(commit=False)
vit.user = request.user
vit.save()
return JsonResponse({'status': 'success', 'vit': vit.to_json()}, status=201)
else:
return JsonResponse({'error': 'No vit body provided'}, status=400)
else:
return JsonResponse({'error': 'You must be logged in'}, status=401)
else:
return JsonResponse({'error': 'Invalid request'}, status=400)
@csrf_exempt
def edit_vit(request):
"""
Edit a vit with API
"""
user = KeyBackend().authenticate(request)
if request.method == "POST":
if request.user.is_authenticated:
try:
vit = Vit.objects.get(id=request.POST.get('vit_pk'))
if vit.user == request.user:
form = VitForm(request.POST, instance=vit)
if form.is_valid():
vit = form.save(commit=False)
vit.save()
return JsonResponse({'status': 'success', 'vit': vit.to_json()}, status=201)
else:
return JsonResponse({'error': 'No vit body provided'}, status=400)
else:
return JsonResponse({'error': 'You do not have permission to edit this vit'}, status=403)
except Vit.DoesNotExist:
return JsonResponse({'error': 'Vit not found'}, status=404)
else:
return JsonResponse({'error': 'You must be logged in'}, status=401)
else:
return JsonResponse({'error': 'Invalid request'}, status=400)
@csrf_exempt
def delete_vit(request):
"""
Delete a vit with API
"""
user = KeyBackend().authenticate(request)
if request.method == "POST":
if request.user.is_authenticated:
try:
vit = Vit.objects.get(id=request.POST.get('vit_pk'))
if vit.user == request.user:
vit.delete()
return JsonResponse({'status': 'success'}, status=200)
else:
return JsonResponse({'error': 'You do not have permission to delete this vit'}, status=403)
except Vit.DoesNotExist:
return JsonResponse({'error': 'Vit not found'}, status=404)
else:
return JsonResponse({'error': 'You must be logged in'}, status=401)
else:
return JsonResponse({'error': 'Invalid request'}, status=400)
| apps/vit/api.py | 5,280 | Add a new vit with API, currently image and video are not supported
Delete a vit with API
Edit a vit with API | 109 | en | 0.94291 |
import math
import torch
import torch.nn as nn
import torch.nn.functional as F
#-------------------------------------------------#
# MISH激活函数
#-------------------------------------------------#
class Mish(nn.Module):
def __init__(self):
super(Mish, self).__init__()
def forward(self, x):
return x * torch.tanh(F.softplus(x))
#---------------------------------------------------#
# 卷积块 -> 卷积 + 标准化 + 激活函数
# Conv2d + BatchNormalization + Mish
#---------------------------------------------------#
class CBM(nn.Module):
def __init__(self, in_channels, out_channels, kernel_size, stride=1):
super(CBM, self).__init__()
#pad = kernel_size//2,表示1x1卷积不补零,3x3卷积补一圈0,这样输出图片的尺寸不会改变
self.conv = nn.Conv2d(in_channels, out_channels, kernel_size, stride, kernel_size//2, bias=False)
self.bn = nn.BatchNorm2d(out_channels)
self.activation = Mish()
def forward(self, x):
x = self.conv(x)
x = self.bn(x)
x = self.activation(x)
return x
#---------------------------------------------------#
# CSPdarknet的结构块的组成部分
# 内部堆叠的残差块
#---------------------------------------------------#
class Resblock(nn.Module):
def __init__(self, channels, hidden_channels=None):
super(Resblock, self).__init__()
if hidden_channels is None:
hidden_channels = channels
self.block = nn.Sequential(
CBM(channels, hidden_channels, 1),
CBM(hidden_channels, channels, 3)
)
def forward(self, x):
return x + self.block(x)
#--------------------------------------------------------------------#
# CSPdarknet的结构块
# 首先利用ZeroPadding2D和一个步长为2x2的卷积块进行高和宽的压缩
# 然后建立一个大的残差边shortconv、这个大残差边绕过了很多的残差结构
# 主干部分会对num_blocks进行循环,循环内部是残差结构。
# 对于整个CSPdarknet的结构块,就是一个大残差块+内部多个小残差块
#--------------------------------------------------------------------#
class Resblock_body(nn.Module):
def __init__(self, in_channels, out_channels, num_blocks, first):
super(Resblock_body, self).__init__()
#----------------------------------------------------------------#
# 利用一个步长为2x2的卷积块进行高和宽的压缩
#----------------------------------------------------------------#
self.downsample_conv = CBM(in_channels, out_channels, 3, stride=2)
if first:
#--------------------------------------------------------------------------#
# 然后建立一个大的残差边self.split_conv0、这个大残差边绕过了很多的残差结构
#--------------------------------------------------------------------------#
self.split_conv0 = CBM(out_channels, out_channels, 1)
#----------------------------------------------------------------#
# 主干部分会对num_blocks进行循环,循环内部是残差结构。
#----------------------------------------------------------------#
self.split_conv1 = CBM(out_channels, out_channels, 1)
self.blocks_conv = nn.Sequential(
Resblock(channels=out_channels, hidden_channels=out_channels//2),
CBM(out_channels, out_channels, 1)
)
self.concat_conv = CBM(out_channels*2, out_channels, 1)
else:
#--------------------------------------------------------------------------#
# 然后建立一个大的残差边self.split_conv0、这个大残差边绕过了很多的残差结构
#--------------------------------------------------------------------------#
self.split_conv0 = CBM(out_channels, out_channels//2, 1)
#----------------------------------------------------------------#
# 主干部分会对num_blocks进行循环,循环内部是残差结构。
#----------------------------------------------------------------#
self.split_conv1 = CBM(out_channels, out_channels//2, 1)
self.blocks_conv = nn.Sequential(
*[Resblock(out_channels//2) for _ in range(num_blocks)],
CBM(out_channels//2, out_channels//2, 1)
)
self.concat_conv = CBM(out_channels, out_channels, 1)
def forward(self, x):
x = self.downsample_conv(x)
x0 = self.split_conv0(x)
x1 = self.split_conv1(x)
x1 = self.blocks_conv(x1)
#------------------------------------#
# 将大残差边再堆叠回来
#------------------------------------#
x = torch.cat([x1, x0], dim=1)
#------------------------------------#
# 最后对通道数进行整合
#------------------------------------#
x = self.concat_conv(x)
return x
#---------------------------------------------------#
# CSPdarknet53 的主体部分
# 输入为一张416x416x3的图片
# 输出为三个有效特征层
#---------------------------------------------------#
class CSPDarkNet(nn.Module):
def __init__(self, layers):
super(CSPDarkNet, self).__init__()
self.inplanes = 32
# 416,416,3 -> 416,416,32
self.conv1 = CBM(3, self.inplanes, kernel_size=3, stride=1)
self.feature_channels = [64, 128, 256, 512, 1024]
self.stages = nn.ModuleList([
# 416,416,32 -> 208,208,64
Resblock_body(self.inplanes, self.feature_channels[0], layers[0], first=True),
# 208,208,64 -> 104,104,128
Resblock_body(self.feature_channels[0], self.feature_channels[1], layers[1], first=False),
# 104,104,128 -> 52,52,256
Resblock_body(self.feature_channels[1], self.feature_channels[2], layers[2], first=False),
# 52,52,256 -> 26,26,512
Resblock_body(self.feature_channels[2], self.feature_channels[3], layers[3], first=False),
# 26,26,512 -> 13,13,1024
Resblock_body(self.feature_channels[3], self.feature_channels[4], layers[4], first=False)
])
self.num_features = 1
for m in self.modules():
if isinstance(m, nn.Conv2d):
n = m.kernel_size[0] * m.kernel_size[1] * m.out_channels
m.weight.data.normal_(0, math.sqrt(2. / n))
elif isinstance(m, nn.BatchNorm2d):
m.weight.data.fill_(1)
m.bias.data.zero_()
def forward(self, x):
x = self.conv1(x)
x = self.stages[0](x)
x = self.stages[1](x)
out3 = self.stages[2](x)
out4 = self.stages[3](out3)
out5 = self.stages[4](out4)
return out3, out4, out5
def darknet53(pretrained, **kwargs):
model = CSPDarkNet([1, 2, 8, 8, 4])
if pretrained:
if isinstance(pretrained, str):
model.load_state_dict(torch.load(pretrained))
else:
raise Exception("darknet request a pretrained path. got [{}]".format(pretrained))
return model
| .history/nets/CSPdarknet_20210816140029.py | 7,299 | ------------------------------------------------- MISH激活函数---------------------------------------------------------------------------------------------------- 卷积块 -> 卷积 + 标准化 + 激活函数 Conv2d + BatchNormalization + Mish---------------------------------------------------pad = kernel_size//2,表示1x1卷积不补零,3x3卷积补一圈0,这样输出图片的尺寸不会改变--------------------------------------------------- CSPdarknet的结构块的组成部分 内部堆叠的残差块----------------------------------------------------------------------------------------------------------------------- CSPdarknet的结构块 首先利用ZeroPadding2D和一个步长为2x2的卷积块进行高和宽的压缩 然后建立一个大的残差边shortconv、这个大残差边绕过了很多的残差结构 主干部分会对num_blocks进行循环,循环内部是残差结构。 对于整个CSPdarknet的结构块,就是一个大残差块+内部多个小残差块------------------------------------------------------------------------------------------------------------------------------------ 利用一个步长为2x2的卷积块进行高和宽的压缩------------------------------------------------------------------------------------------------------------------------------------------ 然后建立一个大的残差边self.split_conv0、这个大残差边绕过了很多的残差结构------------------------------------------------------------------------------------------------------------------------------------------ 主干部分会对num_blocks进行循环,循环内部是残差结构。------------------------------------------------------------------------------------------------------------------------------------------ 然后建立一个大的残差边self.split_conv0、这个大残差边绕过了很多的残差结构------------------------------------------------------------------------------------------------------------------------------------------ 主干部分会对num_blocks进行循环,循环内部是残差结构。---------------------------------------------------------------------------------------------------- 将大残差边再堆叠回来------------------------------------------------------------------------ 最后对通道数进行整合--------------------------------------------------------------------------------------- CSPdarknet53 的主体部分 输入为一张416x416x3的图片 输出为三个有效特征层--------------------------------------------------- 416,416,3 -> 416,416,32 416,416,32 -> 208,208,64 208,208,64 -> 104,104,128 104,104,128 -> 52,52,256 52,52,256 -> 26,26,512 26,26,512 -> 13,13,1024 | 2,110 | zh | 0.260455 |
# -*- coding: utf-8 -*-
# Scrapy settings for mySpider project
#
# For simplicity, this file contains only settings considered important or
# commonly used. You can find more settings consulting the documentation:
#
# https://doc.scrapy.org/en/latest/topics/settings.html
# https://doc.scrapy.org/en/latest/topics/downloader-middleware.html
# https://doc.scrapy.org/en/latest/topics/spider-middleware.html
BOT_NAME = 'mySpider'
SPIDER_MODULES = ['mySpider.spiders']
NEWSPIDER_MODULE = 'mySpider.spiders'
# Crawl responsibly by identifying yourself (and your website) on the user-agent
USER_AGENT = 'mySpider (+http://www.yourdomain.com)'
# Obey robots.txt rules
ROBOTSTXT_OBEY = True
# Configure maximum concurrent requests performed by Scrapy (default: 16)
#CONCURRENT_REQUESTS = 32
# Configure a delay for requests for the same website (default: 0)
# See https://doc.scrapy.org/en/latest/topics/settings.html#download-delay
# See also autothrottle settings and docs
#DOWNLOAD_DELAY = 3
# The download delay setting will honor only one of:
#CONCURRENT_REQUESTS_PER_DOMAIN = 16
#CONCURRENT_REQUESTS_PER_IP = 16
# Disable cookies (enabled by default)
#COOKIES_ENABLED = False
# Disable Telnet Console (enabled by default)
#TELNETCONSOLE_ENABLED = False
# Override the default request headers:
#DEFAULT_REQUEST_HEADERS = {
# 'Accept': 'text/html,application/xhtml+xml,application/xml;q=0.9,*/*;q=0.8',
# 'Accept-Language': 'en',
#}
# Enable or disable spider middlewares
# See https://doc.scrapy.org/en/latest/topics/spider-middleware.html
#SPIDER_MIDDLEWARES = {
# 'mySpider.middlewares.MyspiderSpiderMiddleware': 543,
#}
# Enable or disable downloader middlewares
# See https://doc.scrapy.org/en/latest/topics/downloader-middleware.html
#DOWNLOADER_MIDDLEWARES = {
# 'mySpider.middlewares.MyspiderDownloaderMiddleware': 543,
#}
# Enable or disable extensions
# See https://doc.scrapy.org/en/latest/topics/extensions.html
#EXTENSIONS = {
# 'scrapy.extensions.telnet.TelnetConsole': None,
#}
# Configure item pipelines
# See https://doc.scrapy.org/en/latest/topics/item-pipeline.html
ITEM_PIPELINES = {
'mySpider.pipelines.MyspiderPipeline': 300,
}
# Enable and configure the AutoThrottle extension (disabled by default)
# See https://doc.scrapy.org/en/latest/topics/autothrottle.html
#AUTOTHROTTLE_ENABLED = True
# The initial download delay
#AUTOTHROTTLE_START_DELAY = 5
# The maximum download delay to be set in case of high latencies
#AUTOTHROTTLE_MAX_DELAY = 60
# The average number of requests Scrapy should be sending in parallel to
# each remote server
#AUTOTHROTTLE_TARGET_CONCURRENCY = 1.0
# Enable showing throttling stats for every response received:
#AUTOTHROTTLE_DEBUG = False
# Enable and configure HTTP caching (disabled by default)
# See https://doc.scrapy.org/en/latest/topics/downloader-middleware.html#httpcache-middleware-settings
#HTTPCACHE_ENABLED = True
#HTTPCACHE_EXPIRATION_SECS = 0
#HTTPCACHE_DIR = 'httpcache'
#HTTPCACHE_IGNORE_HTTP_CODES = []
#HTTPCACHE_STORAGE = 'scrapy.extensions.httpcache.FilesystemCacheStorage'
| mySpider/mySpider/settings.py | 3,089 | -*- coding: utf-8 -*- Scrapy settings for mySpider project For simplicity, this file contains only settings considered important or commonly used. You can find more settings consulting the documentation: https://doc.scrapy.org/en/latest/topics/settings.html https://doc.scrapy.org/en/latest/topics/downloader-middleware.html https://doc.scrapy.org/en/latest/topics/spider-middleware.html Crawl responsibly by identifying yourself (and your website) on the user-agent Obey robots.txt rules Configure maximum concurrent requests performed by Scrapy (default: 16)CONCURRENT_REQUESTS = 32 Configure a delay for requests for the same website (default: 0) See https://doc.scrapy.org/en/latest/topics/settings.htmldownload-delay See also autothrottle settings and docsDOWNLOAD_DELAY = 3 The download delay setting will honor only one of:CONCURRENT_REQUESTS_PER_DOMAIN = 16CONCURRENT_REQUESTS_PER_IP = 16 Disable cookies (enabled by default)COOKIES_ENABLED = False Disable Telnet Console (enabled by default)TELNETCONSOLE_ENABLED = False Override the default request headers:DEFAULT_REQUEST_HEADERS = { 'Accept': 'text/html,application/xhtml+xml,application/xml;q=0.9,*/*;q=0.8', 'Accept-Language': 'en',} Enable or disable spider middlewares See https://doc.scrapy.org/en/latest/topics/spider-middleware.htmlSPIDER_MIDDLEWARES = { 'mySpider.middlewares.MyspiderSpiderMiddleware': 543,} Enable or disable downloader middlewares See https://doc.scrapy.org/en/latest/topics/downloader-middleware.htmlDOWNLOADER_MIDDLEWARES = { 'mySpider.middlewares.MyspiderDownloaderMiddleware': 543,} Enable or disable extensions See https://doc.scrapy.org/en/latest/topics/extensions.htmlEXTENSIONS = { 'scrapy.extensions.telnet.TelnetConsole': None,} Configure item pipelines See https://doc.scrapy.org/en/latest/topics/item-pipeline.html Enable and configure the AutoThrottle extension (disabled by default) See https://doc.scrapy.org/en/latest/topics/autothrottle.htmlAUTOTHROTTLE_ENABLED = True The initial download delayAUTOTHROTTLE_START_DELAY = 5 The maximum download delay to be set in case of high latenciesAUTOTHROTTLE_MAX_DELAY = 60 The average number of requests Scrapy should be sending in parallel to each remote serverAUTOTHROTTLE_TARGET_CONCURRENCY = 1.0 Enable showing throttling stats for every response received:AUTOTHROTTLE_DEBUG = False Enable and configure HTTP caching (disabled by default) See https://doc.scrapy.org/en/latest/topics/downloader-middleware.htmlhttpcache-middleware-settingsHTTPCACHE_ENABLED = TrueHTTPCACHE_EXPIRATION_SECS = 0HTTPCACHE_DIR = 'httpcache'HTTPCACHE_IGNORE_HTTP_CODES = []HTTPCACHE_STORAGE = 'scrapy.extensions.httpcache.FilesystemCacheStorage' | 2,698 | en | 0.621626 |
# Generated by Django 3.1.2 on 2020-12-07 05:13
from django.db import migrations, models
import django.db.models.deletion
class Migration(migrations.Migration):
initial = True
dependencies = [
('zooniverse', '0006_auto_20201207_0713'),
]
operations = [
migrations.CreateModel(
name='FinalAnnotation',
fields=[
('id', models.AutoField(auto_created=True, primary_key=True, serialize=False, verbose_name='ID')),
('question', models.CharField(blank=True, max_length=255)),
('answer', models.TextField(blank=True)),
('retirement', models.ForeignKey(on_delete=django.db.models.deletion.CASCADE, to='zooniverse.retirement')),
],
),
]
| quality_control/migrations/0001_initial.py | 777 | Generated by Django 3.1.2 on 2020-12-07 05:13 | 45 | en | 0.74866 |
#!/usr/bin/env python
# -*- coding: utf-8 -*-
"""
Code from:
https://github.com/michailbrynard/ethereum-bip44-python
This submodule provides the PublicKey, PrivateKey, and Signature classes.
It also provides HDPublicKey and HDPrivateKey classes for working with HD
wallets."""
import os
import math
import codecs
import random
import base58
import base64
import binascii
import hashlib
import hmac
from mnemonic.mnemonic import Mnemonic
from pywallet.crypto.ecdsa_base import Point
from pywallet.crypto.ecdsa import ECPointAffine
from pywallet.crypto.ecdsa import secp256k1
bitcoin_curve = secp256k1()
from Crypto.Hash import keccak
sha3_256 = lambda x: keccak.new(digest_bits=256, data=x)
def sha3(seed):
return sha3_256(seed).digest()
def get_bytes(s):
"""Returns the byte representation of a hex- or byte-string."""
if isinstance(s, bytes):
b = s
elif isinstance(s, str):
b = bytes.fromhex(s)
else:
raise TypeError("s must be either 'bytes' or 'str'!")
return b
class PrivateKeyBase(object):
""" Base class for both PrivateKey and HDPrivateKey.
As this class is a base class it should not be used directly.
Args:
k (int): The private key.
Returns:
PrivateKey: The object representing the private key.
"""
@staticmethod
def from_b58check(private_key):
""" Decodes a Base58Check encoded private-key.
Args:
private_key (str): A Base58Check encoded private key.
Returns:
PrivateKey: A PrivateKey object
"""
raise NotImplementedError
def __init__(self, k):
self.key = k
self._public_key = None
@property
def public_key(self):
""" Returns the public key associated with this private key.
Returns:
PublicKey:
The PublicKey object that corresponds to this
private key.
"""
return self._public_key
def raw_sign(self, message, do_hash=True):
""" Signs message using this private key.
Args:
message (bytes): The message to be signed. If a string is
provided it is assumed the encoding is 'ascii' and
converted to bytes. If this is not the case, it is up
to the caller to convert the string to bytes
appropriately and pass in the bytes.
do_hash (bool): True if the message should be hashed prior
to signing, False if not. This should always be left as
True except in special situations which require doing
the hash outside (e.g. handling Bitcoin bugs).
Returns:
ECPointAffine:
a raw point (r = pt.x, s = pt.y) which is
the signature.
"""
raise NotImplementedError
def sign(self, message, do_hash=True):
""" Signs message using this private key.
Note:
This differs from `raw_sign()` since it returns a
Signature object.
Args:
message (bytes or str): The message to be signed. If a
string is provided it is assumed the encoding is
'ascii' and converted to bytes. If this is not the
case, it is up to the caller to convert the string to
bytes appropriately and pass in the bytes.
do_hash (bool): True if the message should be hashed prior
to signing, False if not. This should always be left as
True except in special situations which require doing
the hash outside (e.g. handling Bitcoin bugs).
Returns:
Signature: The signature corresponding to message.
"""
raise NotImplementedError
def sign_bitcoin(self, message, compressed=False):
""" Signs a message using this private key such that it
is compatible with bitcoind, bx, and other Bitcoin
clients/nodes/utilities.
Note:
0x18 + b\"Bitcoin Signed Message:" + newline + len(message) is
prepended to the message before signing.
Args:
message (bytes or str): Message to be signed.
compressed (bool): True if the corresponding public key will be
used in compressed format. False if the uncompressed version
is used.
Returns:
bytes: A Base64-encoded byte string of the signed message.
The first byte of the encoded message contains information
about how to recover the public key. In bitcoind parlance,
this is the magic number containing the recovery ID and
whether or not the key was compressed or not. (This function
always processes full, uncompressed public-keys, so the magic
number will always be either 27 or 28).
"""
raise NotImplementedError
def to_b58check(self, testnet=False):
""" Generates a Base58Check encoding of this private key.
Returns:
str: A Base58Check encoded string representing the key.
"""
raise NotImplementedError
def to_hex(self):
""" Generates a hex encoding of the serialized key.
Returns:
str: A hex encoded string representing the key.
"""
return codecs.encode(bytes(self), 'hex_codec').decode('ascii')
def __bytes__(self):
raise NotImplementedError
def __int__(self):
raise NotImplementedError
class PublicKeyBase(object):
""" Base class for both PublicKey and HDPublicKey.
As this class is a base class it should not be used directly.
Args:
x (int): The x component of the public key point.
y (int): The y component of the public key point.
Returns:
PublicKey: The object representing the public key.
"""
@staticmethod
def from_bytes(key_bytes):
""" Generates a public key object from a byte (or hex) string.
Args:
key_bytes (bytes or str): A byte stream.
Returns:
PublicKey: A PublicKey object.
"""
raise NotImplementedError
@staticmethod
def from_private_key(private_key):
""" Generates a public key object from a PrivateKey object.
Args:
private_key (PrivateKey): The private key object from
which to derive this object.
Returns:
PublicKey: A PublicKey object.
"""
return private_key.public_key
def __init__(self):
pass
def hash160(self, compressed=True):
""" Return the RIPEMD-160 hash of the SHA-256 hash of the
public key.
Args:
compressed (bool): Whether or not the compressed key should
be used.
Returns:
bytes: RIPEMD-160 byte string.
"""
raise NotImplementedError
def address(self, compressed=True, testnet=False):
""" Address property that returns the Base58Check
encoded version of the HASH160.
Args:
compressed (bool): Whether or not the compressed key should
be used.
testnet (bool): Whether or not the key is intended for testnet
usage. False indicates mainnet usage.
Returns:
bytes: Base58Check encoded string
"""
raise NotImplementedError
def verify(self, message, signature, do_hash=True):
""" Verifies that message was appropriately signed.
Args:
message (bytes): The message to be verified.
signature (Signature): A signature object.
do_hash (bool): True if the message should be hashed prior
to signing, False if not. This should always be left as
True except in special situations which require doing
the hash outside (e.g. handling Bitcoin bugs).
Returns:
verified (bool): True if the signature is verified, False
otherwise.
"""
raise NotImplementedError
def to_hex(self):
""" Hex representation of the serialized byte stream.
Returns:
h (str): A hex-encoded string.
"""
return codecs.encode(bytes(self), 'hex_codec').decode('ascii')
def __bytes__(self):
raise NotImplementedError
def __int__(self):
raise NotImplementedError
@property
def compressed_bytes(self):
""" Byte string corresponding to a compressed representation
of this public key.
Returns:
b (bytes): A 33-byte long byte string.
"""
raise NotImplementedError
class PrivateKey(PrivateKeyBase):
""" Encapsulation of a Bitcoin ECDSA private key.
This class provides capability to generate private keys,
obtain the corresponding public key, sign messages and
serialize/deserialize into a variety of formats.
Args:
k (int): The private key.
Returns:
PrivateKey: The object representing the private key.
"""
TESTNET_VERSION = 0xEF
MAINNET_VERSION = 0x80
@staticmethod
def from_bytes(b):
""" Generates PrivateKey from the underlying bytes.
Args:
b (bytes): A byte stream containing a 256-bit (32-byte) integer.
Returns:
tuple(PrivateKey, bytes): A PrivateKey object and the remainder
of the bytes.
"""
if len(b) < 32:
raise ValueError('b must contain at least 32 bytes')
return PrivateKey(int.from_bytes(b[:32], 'big'))
@staticmethod
def from_hex(h):
""" Generates PrivateKey from a hex-encoded string.
Args:
h (str): A hex-encoded string containing a 256-bit
(32-byte) integer.
Returns:
PrivateKey: A PrivateKey object.
"""
return PrivateKey.from_bytes(bytes.fromhex(h))
@staticmethod
def from_int(i):
""" Initializes a private key from an integer.
Args:
i (int): Integer that is the private key.
Returns:
PrivateKey: The object representing the private key.
"""
return PrivateKey(i)
@staticmethod
def from_b58check(private_key):
""" Decodes a Base58Check encoded private-key.
Args:
private_key (str): A Base58Check encoded private key.
Returns:
PrivateKey: A PrivateKey object
"""
b58dec = base58.b58decode_check(private_key)
version = b58dec[0]
assert version in [PrivateKey.TESTNET_VERSION,
PrivateKey.MAINNET_VERSION]
return PrivateKey(int.from_bytes(b58dec[1:], 'big'))
@staticmethod
def from_random():
""" Initializes a private key from a random integer.
Returns:
PrivateKey: The object representing the private key.
"""
return PrivateKey(random.SystemRandom().randrange(1, bitcoin_curve.n))
def __init__(self, k):
self.key = k
self._public_key = None
@property
def public_key(self):
""" Returns the public key associated with this private key.
Returns:
PublicKey:
The PublicKey object that corresponds to this
private key.
"""
if self._public_key is None:
self._public_key = PublicKey.from_point(
bitcoin_curve.public_key(self.key))
return self._public_key
def raw_sign(self, message, do_hash=True):
""" Signs message using this private key.
Args:
message (bytes): The message to be signed. If a string is
provided it is assumed the encoding is 'ascii' and
converted to bytes. If this is not the case, it is up
to the caller to convert the string to bytes
appropriately and pass in the bytes.
do_hash (bool): True if the message should be hashed prior
to signing, False if not. This should always be left as
True except in special situations which require doing
the hash outside (e.g. handling Bitcoin bugs).
Returns:
ECPointAffine:
a raw point (r = pt.x, s = pt.y) which is
the signature.
"""
if isinstance(message, str):
msg = bytes(message, 'ascii')
elif isinstance(message, bytes):
msg = message
else:
raise TypeError("message must be either str or bytes!")
sig_pt, rec_id = bitcoin_curve.sign(msg, self.key, do_hash)
# Take care of large s:
# Bitcoin deals with large s, by subtracting
# s from the curve order. See:
# https://bitcointalk.org/index.php?topic=285142.30;wap2
if sig_pt.y >= (bitcoin_curve.n // 2):
sig_pt = Point(sig_pt.x, bitcoin_curve.n - sig_pt.y)
rec_id ^= 0x1
return (sig_pt, rec_id)
def sign(self, message, do_hash=True):
""" Signs message using this private key.
Note:
This differs from `raw_sign()` since it returns a Signature object.
Args:
message (bytes or str): The message to be signed. If a
string is provided it is assumed the encoding is
'ascii' and converted to bytes. If this is not the
case, it is up to the caller to convert the string to
bytes appropriately and pass in the bytes.
do_hash (bool): True if the message should be hashed prior
to signing, False if not. This should always be left as
True except in special situations which require doing
the hash outside (e.g. handling Bitcoin bugs).
Returns:
Signature: The signature corresponding to message.
"""
# Some BTC things want to have the recovery id to extract the public
# key, so we should figure that out.
sig_pt, rec_id = self.raw_sign(message, do_hash)
return Signature(sig_pt.x, sig_pt.y, rec_id)
def sign_bitcoin(self, message, compressed=False):
""" Signs a message using this private key such that it
is compatible with bitcoind, bx, and other Bitcoin
clients/nodes/utilities.
Note:
0x18 + b\"Bitcoin Signed Message:" + newline + len(message) is
prepended to the message before signing.
Args:
message (bytes or str): Message to be signed.
compressed (bool): True if the corresponding public key will be
used in compressed format. False if the uncompressed version
is used.
Returns:
bytes: A Base64-encoded byte string of the signed message.
The first byte of the encoded message contains information
about how to recover the public key. In bitcoind parlance,
this is the magic number containing the recovery ID and
whether or not the key was compressed or not.
"""
if isinstance(message, str):
msg_in = bytes(message, 'ascii')
elif isinstance(message, bytes):
msg_in = message
else:
raise TypeError("message must be either str or bytes!")
msg = b"\x18Bitcoin Signed Message:\n" + bytes([len(msg_in)]) + msg_in
msg_hash = hashlib.sha256(msg).digest()
sig = self.sign(msg_hash)
comp_adder = 4 if compressed else 0
magic = 27 + sig.recovery_id + comp_adder
return base64.b64encode(bytes([magic]) + bytes(sig))
def to_b58check(self, testnet=False):
""" Generates a Base58Check encoding of this private key.
Returns:
str: A Base58Check encoded string representing the key.
"""
version = self.TESTNET_VERSION if testnet else self.MAINNET_VERSION
return base58.b58encode_check(bytes([version]) + bytes(self))
def __bytes__(self):
return self.key.to_bytes(32, 'big')
def __int__(self):
return self.key
class PublicKey(PublicKeyBase):
""" Encapsulation of a Bitcoin ECDSA public key.
This class provides a high-level API to using an ECDSA public
key, specifically for Bitcoin (secp256k1) purposes.
Args:
x (int): The x component of the public key point.
y (int): The y component of the public key point.
Returns:
PublicKey: The object representing the public key.
"""
TESTNET_VERSION = 0x6F
MAINNET_VERSION = 0x00
@staticmethod
def from_point(p):
""" Generates a public key object from any object
containing x, y coordinates.
Args:
p (Point): An object containing a two-dimensional, affine
representation of a point on the secp256k1 curve.
Returns:
PublicKey: A PublicKey object.
"""
return PublicKey(p.x, p.y)
@staticmethod
def from_int(i):
""" Generates a public key object from an integer.
Note:
This assumes that the upper 32 bytes of the integer
are the x component of the public key point and the
lower 32 bytes are the y component.
Args:
i (Bignum): A 512-bit integer representing the public
key point on the secp256k1 curve.
Returns:
PublicKey: A PublicKey object.
"""
point = ECPointAffine.from_int(bitcoin_curve, i)
return PublicKey.from_point(point)
@staticmethod
def from_base64(b64str, testnet=False):
""" Generates a public key object from a Base64 encoded string.
Args:
b64str (str): A Base64-encoded string.
testnet (bool) (Optional): If True, changes the version that
is prepended to the key.
Returns:
PublicKey: A PublicKey object.
"""
return PublicKey.from_bytes(base64.b64decode(b64str))
@staticmethod
def from_bytes(key_bytes):
""" Generates a public key object from a byte (or hex) string.
The byte stream must be of the SEC variety
(http://www.secg.org/): beginning with a single byte telling
what key representation follows. A full, uncompressed key
is represented by: 0x04 followed by 64 bytes containing
the x and y components of the point. For compressed keys
with an even y component, 0x02 is followed by 32 bytes
containing the x component. For compressed keys with an
odd y component, 0x03 is followed by 32 bytes containing
the x component.
Args:
key_bytes (bytes or str): A byte stream that conforms to the above.
Returns:
PublicKey: A PublicKey object.
"""
b = get_bytes(key_bytes)
key_bytes_len = len(b)
key_type = b[0]
if key_type == 0x04:
# Uncompressed
if key_bytes_len != 65:
raise ValueError("key_bytes must be exactly 65 bytes long when uncompressed.")
x = int.from_bytes(b[1:33], 'big')
y = int.from_bytes(b[33:65], 'big')
elif key_type == 0x02 or key_type == 0x03:
if key_bytes_len != 33:
raise ValueError("key_bytes must be exactly 33 bytes long when compressed.")
x = int.from_bytes(b[1:33], 'big')
ys = bitcoin_curve.y_from_x(x)
# Pick the one that corresponds to key_type
last_bit = key_type - 0x2
for y in ys:
if y & 0x1 == last_bit:
break
else:
return None
return PublicKey(x, y)
@staticmethod
def from_hex(h):
""" Generates a public key object from a hex-encoded string.
See from_bytes() for requirements of the hex string.
Args:
h (str): A hex-encoded string.
Returns:
PublicKey: A PublicKey object.
"""
return PublicKey.from_bytes(h)
@staticmethod
def from_signature(message, signature):
""" Attempts to create PublicKey object by deriving it
from the message and signature.
Args:
message (bytes): The message to be verified.
signature (Signature): The signature for message.
The recovery_id must not be None!
Returns:
PublicKey:
A PublicKey object derived from the
signature, it it exists. None otherwise.
"""
if signature.recovery_id is None:
raise ValueError("The signature must have a recovery_id.")
msg = get_bytes(message)
pub_keys = bitcoin_curve.recover_public_key(msg,
signature,
signature.recovery_id)
for k, recid in pub_keys:
if signature.recovery_id is not None and recid == signature.recovery_id:
return PublicKey(k.x, k.y)
return None
@staticmethod
def verify_bitcoin(message, signature, address):
""" Verifies a message signed using PrivateKey.sign_bitcoin()
or any of the bitcoin utils (e.g. bitcoin-cli, bx, etc.)
Args:
message(bytes): The message that the signature corresponds to.
signature (bytes or str): A Base64 encoded signature
address (str): Base58Check encoded address.
Returns:
bool: True if the signature verified properly, False otherwise.
"""
magic_sig = base64.b64decode(signature)
magic = magic_sig[0]
sig = Signature.from_bytes(magic_sig[1:])
sig.recovery_id = (magic - 27) & 0x3
compressed = ((magic - 27) & 0x4) != 0
# Build the message that was signed
msg = b"\x18Bitcoin Signed Message:\n" + bytes([len(message)]) + message
msg_hash = hashlib.sha256(msg).digest()
derived_public_key = PublicKey.from_signature(msg_hash, sig)
if derived_public_key is None:
raise ValueError("Could not recover public key from the provided signature.")
n = base58.b58decode_check(address)
version = n[0]
h160 = n[1:]
hash160 = derived_public_key.hash160(compressed)
if hash160 != h160:
return False
return derived_public_key.verify(msg_hash, sig)
def __init__(self, x, y):
p = ECPointAffine(bitcoin_curve, x, y)
if not bitcoin_curve.is_on_curve(p):
raise ValueError("The provided (x, y) are not on the secp256k1 curve.")
self.point = p
# RIPEMD-160 of SHA-256
r = hashlib.new('ripemd160')
r.update(hashlib.sha256(bytes(self)).digest())
self.ripe = r.digest()
r = hashlib.new('ripemd160')
r.update(hashlib.sha256(self.compressed_bytes).digest())
self.ripe_compressed = r.digest()
self.keccak = sha3(bytes(self)[1:])
def hash160(self, compressed=True):
""" Return the RIPEMD-160 hash of the SHA-256 hash of the
public key.
Args:
compressed (bool): Whether or not the compressed key should
be used.
Returns:
bytes: RIPEMD-160 byte string.
"""
return self.ripe_compressed if compressed else self.ripe
def address(self, compressed=True, testnet=False):
""" Address property that returns the Base58Check
encoded version of the HASH160.
Args:
compressed (bool): Whether or not the compressed key should
be used.
testnet (bool): Whether or not the key is intended for testnet
usage. False indicates mainnet usage.
Returns:
bytes: Base58Check encoded string
"""
version = '0x'
return version + binascii.hexlify(self.keccak[12:]).decode('ascii')
# Put the version byte in front, 0x00 for Mainnet, 0x6F for testnet
# version = bytes([self.TESTNET_VERSION]) if testnet else bytes([self.MAINNET_VERSION])
# return base58.b58encode_check(version + self.hash160(compressed))
def verify(self, message, signature, do_hash=True):
""" Verifies that message was appropriately signed.
Args:
message (bytes): The message to be verified.
signature (Signature): A signature object.
do_hash (bool): True if the message should be hashed prior
to signing, False if not. This should always be left as
True except in special situations which require doing
the hash outside (e.g. handling Bitcoin bugs).
Returns:
verified (bool): True if the signature is verified, False
otherwise.
"""
msg = get_bytes(message)
return bitcoin_curve.verify(msg, signature, self.point, do_hash)
def to_base64(self):
""" Hex representation of the serialized byte stream.
Returns:
b (str): A Base64-encoded string.
"""
return base64.b64encode(bytes(self))
def __int__(self):
mask = 2 ** 256 - 1
return ((self.point.x & mask) << bitcoin_curve.nlen) | (self.point.y & mask)
def __bytes__(self):
return bytes(self.point)
@property
def compressed_bytes(self):
""" Byte string corresponding to a compressed representation
of this public key.
Returns:
b (bytes): A 33-byte long byte string.
"""
return self.point.compressed_bytes
class Signature(object):
""" Encapsulation of a ECDSA signature for Bitcoin purposes.
Args:
r (Bignum): r component of the signature.
s (Bignum): s component of the signature.
recovery_id (int) (Optional): Must be between 0 and 3 specifying
which of the public keys generated by the algorithm specified
in http://www.secg.org/sec1-v2.pdf Section 4.1.6 (Public Key
Recovery Operation) is the correct one for this signature.
Returns:
sig (Signature): A Signature object.
"""
@staticmethod
def from_der(der):
""" Decodes a Signature that was DER-encoded.
Args:
der (bytes or str): The DER encoding to be decoded.
Returns:
Signature: The deserialized signature.
"""
d = get_bytes(der)
# d must conform to (from btcd):
# [0 ] 0x30 - ASN.1 identifier for sequence
# [1 ] <1-byte> - total remaining length
# [2 ] 0x02 - ASN.1 identifier to specify an integer follows
# [3 ] <1-byte> - length of R
# [4.] <bytes> - R
# [..] 0x02 - ASN.1 identifier to specify an integer follows
# [..] <1-byte> - length of S
# [..] <bytes> - S
# 6 bytes + R (min. 1 byte) + S (min. 1 byte)
if len(d) < 8:
raise ValueError("DER signature string is too short.")
# 6 bytes + R (max. 33 bytes) + S (max. 33 bytes)
if len(d) > 72:
raise ValueError("DER signature string is too long.")
if d[0] != 0x30:
raise ValueError("DER signature does not start with 0x30.")
if d[1] != len(d[2:]):
raise ValueError("DER signature length incorrect.")
total_length = d[1]
if d[2] != 0x02:
raise ValueError("DER signature no 1st int marker.")
if d[3] <= 0 or d[3] > (total_length - 7):
raise ValueError("DER signature incorrect R length.")
# Grab R, check for errors
rlen = d[3]
s_magic_index = 4 + rlen
rb = d[4:s_magic_index]
if rb[0] & 0x80 != 0:
raise ValueError("DER signature R is negative.")
if len(rb) > 1 and rb[0] == 0 and rb[1] & 0x80 != 0x80:
raise ValueError("DER signature R is excessively padded.")
r = int.from_bytes(rb, 'big')
# Grab S, check for errors
if d[s_magic_index] != 0x02:
raise ValueError("DER signature no 2nd int marker.")
slen_index = s_magic_index + 1
slen = d[slen_index]
if slen <= 0 or slen > len(d) - (slen_index + 1):
raise ValueError("DER signature incorrect S length.")
sb = d[slen_index + 1:]
if sb[0] & 0x80 != 0:
raise ValueError("DER signature S is negative.")
if len(sb) > 1 and sb[0] == 0 and sb[1] & 0x80 != 0x80:
raise ValueError("DER signature S is excessively padded.")
s = int.from_bytes(sb, 'big')
if r < 1 or r >= bitcoin_curve.n:
raise ValueError("DER signature R is not between 1 and N - 1.")
if s < 1 or s >= bitcoin_curve.n:
raise ValueError("DER signature S is not between 1 and N - 1.")
return Signature(r, s)
@staticmethod
def from_base64(b64str):
""" Generates a signature object from a Base64 encoded string.
Args:
b64str (str): A Base64-encoded string.
Returns:
Signature: A Signature object.
"""
return Signature.from_bytes(base64.b64decode(b64str))
@staticmethod
def from_bytes(b):
""" Extracts the r and s components from a byte string.
Args:
b (bytes): A 64-byte long string. The first 32 bytes are
extracted as the r component and the second 32 bytes
are extracted as the s component.
Returns:
Signature: A Signature object.
Raises:
ValueError: If signature is incorrect length
"""
if len(b) != 64:
raise ValueError("from_bytes: Signature length != 64.")
r = int.from_bytes(b[0:32], 'big')
s = int.from_bytes(b[32:64], 'big')
return Signature(r, s)
@staticmethod
def from_hex(h):
""" Extracts the r and s components from a hex-encoded string.
Args:
h (str): A 64-byte (128 character) long string. The first
32 bytes are extracted as the r component and the
second 32 bytes are extracted as the s component.
Returns:
Signature: A Signature object.
"""
return Signature.from_bytes(bytes.fromhex(h))
def __init__(self, r, s, recovery_id=None):
self.r = r
self.s = s
self.recovery_id = recovery_id
@property
def x(self):
""" Convenience property for any method that requires
this object to provide a Point interface.
"""
return self.r
@property
def y(self):
""" Convenience property for any method that requires
this object to provide a Point interface.
"""
return self.s
def _canonicalize(self):
rv = []
for x in [self.r, self.s]:
# Compute minimum bytes to represent integer
bl = math.ceil(x.bit_length() / 8)
# Make sure it's at least one byte in length
if bl == 0:
bl += 1
x_bytes = x.to_bytes(bl, 'big')
# make sure there's no way it could be interpreted
# as a negative integer
if x_bytes[0] & 0x80:
x_bytes = bytes([0]) + x_bytes
rv.append(x_bytes)
return rv
def to_der(self):
""" Encodes this signature using DER
Returns:
bytes: The DER encoding of (self.r, self.s).
"""
# Output should be:
# 0x30 <length> 0x02 <length r> r 0x02 <length s> s
r, s = self._canonicalize()
total_length = 6 + len(r) + len(s)
der = bytes([0x30, total_length - 2, 0x02, len(r)]) + r + bytes([0x02, len(s)]) + s
return der
def to_hex(self):
""" Hex representation of the serialized byte stream.
Returns:
str: A hex-encoded string.
"""
return codecs.encode(bytes(self), 'hex_codec').decode('ascii')
def to_base64(self):
""" Hex representation of the serialized byte stream.
Returns:
str: A Base64-encoded string.
"""
return base64.b64encode(bytes(self))
def __bytes__(self):
nbytes = math.ceil(bitcoin_curve.nlen / 8)
return self.r.to_bytes(nbytes, 'big') + self.s.to_bytes(nbytes, 'big')
class HDKey(object):
""" Base class for HDPrivateKey and HDPublicKey.
Args:
key (PrivateKey or PublicKey): The underlying simple private or
public key that is used to sign/verify.
chain_code (bytes): The chain code associated with the HD key.
depth (int): How many levels below the master node this key is. By
definition, depth = 0 for the master node.
index (int): A value between 0 and 0xffffffff indicating the child
number. Values >= 0x80000000 are considered hardened children.
parent_fingerprint (bytes): The fingerprint of the parent node. This
is 0x00000000 for the master node.
Returns:
HDKey: An HDKey object.
"""
@staticmethod
def from_b58check(key):
""" Decodes a Base58Check encoded key.
The encoding must conform to the description in:
https://github.com/bitcoin/bips/blob/master/bip-0032.mediawiki#serialization-format
Args:
key (str): A Base58Check encoded key.
Returns:
HDPrivateKey or HDPublicKey:
Either an HD private or
public key object, depending on what was serialized.
"""
return HDKey.from_bytes(base58.b58decode_check(key))
@staticmethod
def from_bytes(b):
""" Generates either a HDPrivateKey or HDPublicKey from the underlying
bytes.
The serialization must conform to the description in:
https://github.com/bitcoin/bips/blob/master/bip-0032.mediawiki#serialization-format
Args:
b (bytes): A byte stream conforming to the above.
Returns:
HDPrivateKey or HDPublicKey:
Either an HD private or
public key object, depending on what was serialized.
"""
if len(b) < 78:
raise ValueError("b must be at least 78 bytes long.")
version = int.from_bytes(b[:4], 'big')
depth = b[4]
parent_fingerprint = b[5:9]
index = int.from_bytes(b[9:13], 'big')
chain_code = b[13:45]
key_bytes = b[45:78]
rv = None
if version == HDPrivateKey.MAINNET_VERSION or version == HDPrivateKey.TESTNET_VERSION:
if key_bytes[0] != 0:
raise ValueError("First byte of private key must be 0x00!")
private_key = int.from_bytes(key_bytes[1:], 'big')
rv = HDPrivateKey(key=private_key,
chain_code=chain_code,
index=index,
depth=depth,
parent_fingerprint=parent_fingerprint)
elif version == HDPublicKey.MAINNET_VERSION or version == HDPublicKey.TESTNET_VERSION:
if key_bytes[0] != 0x02 and key_bytes[0] != 0x03:
raise ValueError("First byte of public key must be 0x02 or 0x03!")
public_key = PublicKey.from_bytes(key_bytes)
rv = HDPublicKey(x=public_key.point.x,
y=public_key.point.y,
chain_code=chain_code,
index=index,
depth=depth,
parent_fingerprint=parent_fingerprint)
else:
raise ValueError("incorrect encoding.")
return rv
@staticmethod
def from_hex(h):
""" Generates either a HDPrivateKey or HDPublicKey from the underlying
hex-encoded string.
The serialization must conform to the description in:
https://github.com/bitcoin/bips/blob/master/bip-0032.mediawiki#serialization-format
Args:
h (str): A hex-encoded string conforming to the above.
Returns:
HDPrivateKey or HDPublicKey:
Either an HD private or
public key object, depending on what was serialized.
"""
return HDKey.from_bytes(bytes.fromhex(h))
@staticmethod
def from_path(root_key, path):
p = HDKey.parse_path(path)
if p[0] == "m":
if root_key.master:
p = p[1:]
else:
raise ValueError("root_key must be a master key if 'm' is the first element of the path.")
keys = [root_key]
for i in p:
if isinstance(i, str):
hardened = i[-1] == "'"
index = int(i[:-1], 0) | 0x80000000 if hardened else int(i, 0)
else:
index = i
k = keys[-1]
klass = k.__class__
keys.append(klass.from_parent(k, index))
return keys
@staticmethod
def parse_path(path):
if isinstance(path, str):
# Remove trailing "/"
p = path.rstrip("/").split("/")
elif isinstance(path, bytes):
p = path.decode('utf-8').rstrip("/").split("/")
else:
p = list(path)
return p
@staticmethod
def path_from_indices(l):
p = []
for n in l:
if n == "m":
p.append(n)
else:
if n & 0x80000000:
_n = n & 0x7fffffff
p.append(str(_n) + "'")
else:
p.append(str(n))
return "/".join(p)
def __init__(self, key, chain_code, index, depth, parent_fingerprint):
if index < 0 or index > 0xffffffff:
raise ValueError("index is out of range: 0 <= index <= 2**32 - 1")
if not isinstance(chain_code, bytes):
raise TypeError("chain_code must be bytes")
self._key = key
self.chain_code = chain_code
self.depth = depth
self.index = index
self.parent_fingerprint = get_bytes(parent_fingerprint)
@property
def master(self):
""" Whether or not this is a master node.
Returns:
bool: True if this is a master node, False otherwise.
"""
return self.depth == 0
@property
def hardened(self):
""" Whether or not this is a hardened node.
Hardened nodes are those with indices >= 0x80000000.
Returns:
bool: True if this is hardened, False otherwise.
"""
# A hardened key is a key with index >= 2 ** 31, so
# we check that the MSB of a uint32 is set.
return self.index & 0x80000000
@property
def identifier(self):
""" Returns the identifier for the key.
A key's identifier and fingerprint are defined as:
https://github.com/bitcoin/bips/blob/master/bip-0032.mediawiki#key-identifiers
Returns:
bytes: A 20-byte RIPEMD-160 hash.
"""
raise NotImplementedError
@property
def fingerprint(self):
""" Returns the key's fingerprint, which is the first 4 bytes
of its identifier.
A key's identifier and fingerprint are defined as:
https://github.com/bitcoin/bips/blob/master/bip-0032.mediawiki#key-identifiers
Returns:
bytes: The first 4 bytes of the RIPEMD-160 hash.
"""
return self.identifier[:4]
def to_b58check(self, testnet=False):
""" Generates a Base58Check encoding of this key.
Args:
testnet (bool): True if the key is to be used with
testnet, False otherwise.
Returns:
str: A Base58Check encoded string representing the key.
"""
b = self.testnet_bytes if testnet else bytes(self)
return base58.b58encode_check(b)
def _serialize(self, testnet=False):
version = self.TESTNET_VERSION if testnet else self.MAINNET_VERSION
key_bytes = self._key.compressed_bytes if isinstance(self, HDPublicKey) else b'\x00' + bytes(self._key)
return (version.to_bytes(length=4, byteorder='big') +
bytes([self.depth]) +
self.parent_fingerprint +
self.index.to_bytes(length=4, byteorder='big') +
self.chain_code +
key_bytes)
def __bytes__(self):
return self._serialize()
@property
def testnet_bytes(self):
""" Serialization of the key for testnet.
Returns:
bytes:
A 78-byte serialization of the key, specifically for
testnet (i.e. the first 2 bytes will be 0x0435).
"""
return self._serialize(True)
class HDPrivateKey(HDKey, PrivateKeyBase):
""" Implements an HD Private Key according to BIP-0032:
https://github.com/bitcoin/bips/blob/master/bip-0032.mediawiki
For the vast majority of use cases, the 3 static functions
(HDPrivateKey.master_key_from_entropy,
HDPrivateKey.master_key_from_seed and
HDPrivateKey.from_parent) will be used rather than directly
constructing an object.
Args:
key (PrivateKey or PublicKey): The underlying simple private or
public key that is used to sign/verify.
chain_code (bytes): The chain code associated with the HD key.
depth (int): How many levels below the master node this key is. By
definition, depth = 0 for the master node.
index (int): A value between 0 and 0xffffffff indicating the child
number. Values >= 0x80000000 are considered hardened children.
parent_fingerprint (bytes): The fingerprint of the parent node. This
is 0x00000000 for the master node.
Returns:
HDKey: An HDKey object.
"""
MAINNET_VERSION = 0x0488ADE4
TESTNET_VERSION = 0x04358394
@staticmethod
def master_key_from_mnemonic(mnemonic, passphrase=''):
""" Generates a master key from a mnemonic.
Args:
mnemonic (str): The mnemonic sentence representing
the seed from which to generate the master key.
passphrase (str): Password if one was used.
Returns:
HDPrivateKey: the master private key.
"""
return HDPrivateKey.master_key_from_seed(
Mnemonic.to_seed(mnemonic, passphrase))
@staticmethod
def master_key_from_entropy(passphrase='', strength=128):
""" Generates a master key from system entropy.
Args:
strength (int): Amount of entropy desired. This should be
a multiple of 32 between 128 and 256.
passphrase (str): An optional passphrase for the generated
mnemonic string.
Returns:
HDPrivateKey, str:
a tuple consisting of the master
private key and a mnemonic string from which the seed
can be recovered.
"""
if strength % 32 != 0:
raise ValueError("strength must be a multiple of 32")
if strength < 128 or strength > 256:
raise ValueError("strength should be >= 128 and <= 256")
entropy = os.urandom(strength // 8)
m = Mnemonic(language='english')
n = m.to_mnemonic(entropy)
return HDPrivateKey.master_key_from_seed(
Mnemonic.to_seed(n, passphrase)), n
@staticmethod
def master_key_from_seed(seed):
""" Generates a master key from a provided seed.
Args:
seed (bytes or str): a string of bytes or a hex string
Returns:
HDPrivateKey: the master private key.
"""
S = get_bytes(seed)
I = hmac.new(b"Bitcoin seed", S, hashlib.sha512).digest()
Il, Ir = I[:32], I[32:]
parse_Il = int.from_bytes(Il, 'big')
if parse_Il == 0 or parse_Il >= bitcoin_curve.n:
raise ValueError("Bad seed, resulting in invalid key!")
return HDPrivateKey(key=parse_Il, chain_code=Ir, index=0, depth=0)
@staticmethod
def from_parent(parent_key, i):
""" Derives a child private key from a parent
private key. It is not possible to derive a child
private key from a public parent key.
Args:
parent_private_key (HDPrivateKey):
"""
if not isinstance(parent_key, HDPrivateKey):
raise TypeError("parent_key must be an HDPrivateKey object.")
hmac_key = parent_key.chain_code
if i & 0x80000000:
hmac_data = b'\x00' + bytes(parent_key._key) + i.to_bytes(length=4, byteorder='big')
else:
hmac_data = parent_key.public_key.compressed_bytes + i.to_bytes(length=4, byteorder='big')
I = hmac.new(hmac_key, hmac_data, hashlib.sha512).digest()
Il, Ir = I[:32], I[32:]
parse_Il = int.from_bytes(Il, 'big')
if parse_Il >= bitcoin_curve.n:
return None
child_key = (parse_Il + parent_key._key.key) % bitcoin_curve.n
if child_key == 0:
# Incredibly unlucky choice
return None
child_depth = parent_key.depth + 1
return HDPrivateKey(key=child_key,
chain_code=Ir,
index=i,
depth=child_depth,
parent_fingerprint=parent_key.fingerprint)
def __init__(self, key, chain_code, index, depth,
parent_fingerprint=b'\x00\x00\x00\x00'):
if index < 0 or index > 0xffffffff:
raise ValueError("index is out of range: 0 <= index <= 2**32 - 1")
private_key = PrivateKey(key)
HDKey.__init__(self, private_key, chain_code, index, depth,
parent_fingerprint)
self._public_key = None
@property
def public_key(self):
""" Returns the public key associated with this private key.
Returns:
HDPublicKey:
The HDPublicKey object that corresponds to this
private key.
"""
if self._public_key is None:
self._public_key = HDPublicKey(x=self._key.public_key.point.x,
y=self._key.public_key.point.y,
chain_code=self.chain_code,
index=self.index,
depth=self.depth,
parent_fingerprint=self.parent_fingerprint)
return self._public_key
def raw_sign(self, message, do_hash=True):
""" Signs message using the underlying non-extended private key.
Args:
message (bytes): The message to be signed. If a string is
provided it is assumed the encoding is 'ascii' and
converted to bytes. If this is not the case, it is up
to the caller to convert the string to bytes
appropriately and pass in the bytes.
do_hash (bool): True if the message should be hashed prior
to signing, False if not. This should always be left as
True except in special situations which require doing
the hash outside (e.g. handling Bitcoin bugs).
Returns:
ECPointAffine:
a raw point (r = pt.x, s = pt.y) which is
the signature.
"""
return self._key.raw_sign(message, do_hash)
def sign(self, message, do_hash=True):
""" Signs message using the underlying non-extended private key.
Note:
This differs from `raw_sign()` since it returns a Signature object.
Args:
message (bytes or str): The message to be signed. If a
string is provided it is assumed the encoding is
'ascii' and converted to bytes. If this is not the
case, it is up to the caller to convert the string to
bytes appropriately and pass in the bytes.
do_hash (bool): True if the message should be hashed prior
to signing, False if not. This should always be left as
True except in special situations which require doing
the hash outside (e.g. handling Bitcoin bugs).
Returns:
Signature: The signature corresponding to message.
"""
return self._key.sign(message, do_hash)
def sign_bitcoin(self, message, compressed=False):
""" Signs a message using the underlying non-extended private
key such that it is compatible with bitcoind, bx, and other
Bitcoin clients/nodes/utilities.
Note:
0x18 + b\"Bitcoin Signed Message:" + newline + len(message) is
prepended to the message before signing.
Args:
message (bytes or str): Message to be signed.
compressed (bool):
True if the corresponding public key will be
used in compressed format. False if the uncompressed version
is used.
Returns:
bytes: A Base64-encoded byte string of the signed message.
The first byte of the encoded message contains information
about how to recover the public key. In bitcoind parlance,
this is the magic number containing the recovery ID and
whether or not the key was compressed or not. (This function
always processes full, uncompressed public-keys, so the
magic number will always be either 27 or 28).
"""
return self._key.sign_bitcoin(message, compressed)
@property
def identifier(self):
""" Returns the identifier for the key.
A key's identifier and fingerprint are defined as:
https://github.com/bitcoin/bips/blob/master/bip-0032.mediawiki#key-identifiers
In this case, it will return the RIPEMD-160 hash of the
corresponding public key.
Returns:
bytes: A 20-byte RIPEMD-160 hash.
"""
return self.public_key.hash160()
def __int__(self):
return int(self.key)
class HDPublicKey(HDKey, PublicKeyBase):
""" Implements an HD Public Key according to BIP-0032:
https://github.com/bitcoin/bips/blob/master/bip-0032.mediawiki
For the vast majority of use cases, the static function
HDPublicKey.from_parent() will be used rather than directly
constructing an object.
Args:
x (int): x component of the point representing the public key.
y (int): y component of the point representing the public key.
chain_code (bytes): The chain code associated with the HD key.
depth (int): How many levels below the master node this key is. By
definition, depth = 0 for the master node.
index (int): A value between 0 and 0xffffffff indicating the child
number. Values >= 0x80000000 are considered hardened children.
parent_fingerprint (bytes): The fingerprint of the parent node. This
is 0x00000000 for the master node.
Returns:
HDPublicKey: An HDPublicKey object.
"""
MAINNET_VERSION = 0x0488B21E
TESTNET_VERSION = 0x043587CF
@staticmethod
def from_parent(parent_key, i):
"""
"""
if isinstance(parent_key, HDPrivateKey):
# Get child private key
return HDPrivateKey.from_parent(parent_key, i).public_key
elif isinstance(parent_key, HDPublicKey):
if i & 0x80000000:
raise ValueError("Can't generate a hardened child key from a parent public key.")
else:
I = hmac.new(parent_key.chain_code,
parent_key.compressed_bytes + i.to_bytes(length=4, byteorder='big'),
hashlib.sha512).digest()
Il, Ir = I[:32], I[32:]
parse_Il = int.from_bytes(Il, 'big')
if parse_Il >= bitcoin_curve.n:
return None
temp_priv_key = PrivateKey(parse_Il)
Ki = temp_priv_key.public_key.point + parent_key._key.point
if Ki.infinity:
return None
child_depth = parent_key.depth + 1
return HDPublicKey(x=Ki.x,
y=Ki.y,
chain_code=Ir,
index=i,
depth=child_depth,
parent_fingerprint=parent_key.fingerprint)
else:
raise TypeError("parent_key must be either a HDPrivateKey or HDPublicKey object")
def __init__(self, x, y, chain_code, index, depth,
parent_fingerprint=b'\x00\x00\x00\x00'):
key = PublicKey(x, y)
HDKey.__init__(self, key, chain_code, index, depth, parent_fingerprint)
PublicKeyBase.__init__(self)
@property
def identifier(self):
""" Returns the identifier for the key.
A key's identifier and fingerprint are defined as:
https://github.com/bitcoin/bips/blob/master/bip-0032.mediawiki#key-identifiers
In this case, it will return the RIPEMD-160 hash of the
non-extended public key.
Returns:
bytes: A 20-byte RIPEMD-160 hash.
"""
return self.hash160()
def hash160(self, compressed=True):
""" Return the RIPEMD-160 hash of the SHA-256 hash of the
non-extended public key.
Note:
This always returns the hash of the compressed version of
the public key.
Returns:
bytes: RIPEMD-160 byte string.
"""
return self._key.hash160(True)
def address(self, compressed=True, testnet=False):
""" Address property that returns the Base58Check
encoded version of the HASH160.
Args:
compressed (bool): Whether or not the compressed key should
be used.
testnet (bool): Whether or not the key is intended for testnet
usage. False indicates mainnet usage.
Returns:
bytes: Base58Check encoded string
"""
return self._key.address(True, testnet)
def verify(self, message, signature, do_hash=True):
""" Verifies that message was appropriately signed.
Args:
message (bytes): The message to be verified.
signature (Signature): A signature object.
do_hash (bool): True if the message should be hashed prior
to signing, False if not. This should always be left as
True except in special situations which require doing
the hash outside (e.g. handling Bitcoin bugs).
Returns:
verified (bool): True if the signature is verified, False
otherwise.
"""
return self._key.verify(message, signature, do_hash)
@property
def compressed_bytes(self):
""" Byte string corresponding to a compressed representation
of this public key.
Returns:
b (bytes): A 33-byte long byte string.
"""
return self._key.compressed_bytes
| pywallet/utils/ethereum.py | 55,633 | Base class for HDPrivateKey and HDPublicKey.
Args:
key (PrivateKey or PublicKey): The underlying simple private or
public key that is used to sign/verify.
chain_code (bytes): The chain code associated with the HD key.
depth (int): How many levels below the master node this key is. By
definition, depth = 0 for the master node.
index (int): A value between 0 and 0xffffffff indicating the child
number. Values >= 0x80000000 are considered hardened children.
parent_fingerprint (bytes): The fingerprint of the parent node. This
is 0x00000000 for the master node.
Returns:
HDKey: An HDKey object.
Implements an HD Private Key according to BIP-0032:
https://github.com/bitcoin/bips/blob/master/bip-0032.mediawiki
For the vast majority of use cases, the 3 static functions
(HDPrivateKey.master_key_from_entropy,
HDPrivateKey.master_key_from_seed and
HDPrivateKey.from_parent) will be used rather than directly
constructing an object.
Args:
key (PrivateKey or PublicKey): The underlying simple private or
public key that is used to sign/verify.
chain_code (bytes): The chain code associated with the HD key.
depth (int): How many levels below the master node this key is. By
definition, depth = 0 for the master node.
index (int): A value between 0 and 0xffffffff indicating the child
number. Values >= 0x80000000 are considered hardened children.
parent_fingerprint (bytes): The fingerprint of the parent node. This
is 0x00000000 for the master node.
Returns:
HDKey: An HDKey object.
Implements an HD Public Key according to BIP-0032:
https://github.com/bitcoin/bips/blob/master/bip-0032.mediawiki
For the vast majority of use cases, the static function
HDPublicKey.from_parent() will be used rather than directly
constructing an object.
Args:
x (int): x component of the point representing the public key.
y (int): y component of the point representing the public key.
chain_code (bytes): The chain code associated with the HD key.
depth (int): How many levels below the master node this key is. By
definition, depth = 0 for the master node.
index (int): A value between 0 and 0xffffffff indicating the child
number. Values >= 0x80000000 are considered hardened children.
parent_fingerprint (bytes): The fingerprint of the parent node. This
is 0x00000000 for the master node.
Returns:
HDPublicKey: An HDPublicKey object.
Encapsulation of a Bitcoin ECDSA private key.
This class provides capability to generate private keys,
obtain the corresponding public key, sign messages and
serialize/deserialize into a variety of formats.
Args:
k (int): The private key.
Returns:
PrivateKey: The object representing the private key.
Base class for both PrivateKey and HDPrivateKey.
As this class is a base class it should not be used directly.
Args:
k (int): The private key.
Returns:
PrivateKey: The object representing the private key.
Encapsulation of a Bitcoin ECDSA public key.
This class provides a high-level API to using an ECDSA public
key, specifically for Bitcoin (secp256k1) purposes.
Args:
x (int): The x component of the public key point.
y (int): The y component of the public key point.
Returns:
PublicKey: The object representing the public key.
Base class for both PublicKey and HDPublicKey.
As this class is a base class it should not be used directly.
Args:
x (int): The x component of the public key point.
y (int): The y component of the public key point.
Returns:
PublicKey: The object representing the public key.
Encapsulation of a ECDSA signature for Bitcoin purposes.
Args:
r (Bignum): r component of the signature.
s (Bignum): s component of the signature.
recovery_id (int) (Optional): Must be between 0 and 3 specifying
which of the public keys generated by the algorithm specified
in http://www.secg.org/sec1-v2.pdf Section 4.1.6 (Public Key
Recovery Operation) is the correct one for this signature.
Returns:
sig (Signature): A Signature object.
Address property that returns the Base58Check
encoded version of the HASH160.
Args:
compressed (bool): Whether or not the compressed key should
be used.
testnet (bool): Whether or not the key is intended for testnet
usage. False indicates mainnet usage.
Returns:
bytes: Base58Check encoded string
Address property that returns the Base58Check
encoded version of the HASH160.
Args:
compressed (bool): Whether or not the compressed key should
be used.
testnet (bool): Whether or not the key is intended for testnet
usage. False indicates mainnet usage.
Returns:
bytes: Base58Check encoded string
Address property that returns the Base58Check
encoded version of the HASH160.
Args:
compressed (bool): Whether or not the compressed key should
be used.
testnet (bool): Whether or not the key is intended for testnet
usage. False indicates mainnet usage.
Returns:
bytes: Base58Check encoded string
Byte string corresponding to a compressed representation
of this public key.
Returns:
b (bytes): A 33-byte long byte string.
Byte string corresponding to a compressed representation
of this public key.
Returns:
b (bytes): A 33-byte long byte string.
Byte string corresponding to a compressed representation
of this public key.
Returns:
b (bytes): A 33-byte long byte string.
Returns the key's fingerprint, which is the first 4 bytes
of its identifier.
A key's identifier and fingerprint are defined as:
https://github.com/bitcoin/bips/blob/master/bip-0032.mediawiki#key-identifiers
Returns:
bytes: The first 4 bytes of the RIPEMD-160 hash.
Decodes a Base58Check encoded private-key.
Args:
private_key (str): A Base58Check encoded private key.
Returns:
PrivateKey: A PrivateKey object
Decodes a Base58Check encoded private-key.
Args:
private_key (str): A Base58Check encoded private key.
Returns:
PrivateKey: A PrivateKey object
Decodes a Base58Check encoded key.
The encoding must conform to the description in:
https://github.com/bitcoin/bips/blob/master/bip-0032.mediawiki#serialization-format
Args:
key (str): A Base58Check encoded key.
Returns:
HDPrivateKey or HDPublicKey:
Either an HD private or
public key object, depending on what was serialized.
Generates a public key object from a Base64 encoded string.
Args:
b64str (str): A Base64-encoded string.
testnet (bool) (Optional): If True, changes the version that
is prepended to the key.
Returns:
PublicKey: A PublicKey object.
Generates a signature object from a Base64 encoded string.
Args:
b64str (str): A Base64-encoded string.
Returns:
Signature: A Signature object.
Generates a public key object from a byte (or hex) string.
Args:
key_bytes (bytes or str): A byte stream.
Returns:
PublicKey: A PublicKey object.
Generates PrivateKey from the underlying bytes.
Args:
b (bytes): A byte stream containing a 256-bit (32-byte) integer.
Returns:
tuple(PrivateKey, bytes): A PrivateKey object and the remainder
of the bytes.
Generates a public key object from a byte (or hex) string.
The byte stream must be of the SEC variety
(http://www.secg.org/): beginning with a single byte telling
what key representation follows. A full, uncompressed key
is represented by: 0x04 followed by 64 bytes containing
the x and y components of the point. For compressed keys
with an even y component, 0x02 is followed by 32 bytes
containing the x component. For compressed keys with an
odd y component, 0x03 is followed by 32 bytes containing
the x component.
Args:
key_bytes (bytes or str): A byte stream that conforms to the above.
Returns:
PublicKey: A PublicKey object.
Extracts the r and s components from a byte string.
Args:
b (bytes): A 64-byte long string. The first 32 bytes are
extracted as the r component and the second 32 bytes
are extracted as the s component.
Returns:
Signature: A Signature object.
Raises:
ValueError: If signature is incorrect length
Generates either a HDPrivateKey or HDPublicKey from the underlying
bytes.
The serialization must conform to the description in:
https://github.com/bitcoin/bips/blob/master/bip-0032.mediawiki#serialization-format
Args:
b (bytes): A byte stream conforming to the above.
Returns:
HDPrivateKey or HDPublicKey:
Either an HD private or
public key object, depending on what was serialized.
Decodes a Signature that was DER-encoded.
Args:
der (bytes or str): The DER encoding to be decoded.
Returns:
Signature: The deserialized signature.
Generates PrivateKey from a hex-encoded string.
Args:
h (str): A hex-encoded string containing a 256-bit
(32-byte) integer.
Returns:
PrivateKey: A PrivateKey object.
Generates a public key object from a hex-encoded string.
See from_bytes() for requirements of the hex string.
Args:
h (str): A hex-encoded string.
Returns:
PublicKey: A PublicKey object.
Extracts the r and s components from a hex-encoded string.
Args:
h (str): A 64-byte (128 character) long string. The first
32 bytes are extracted as the r component and the
second 32 bytes are extracted as the s component.
Returns:
Signature: A Signature object.
Generates either a HDPrivateKey or HDPublicKey from the underlying
hex-encoded string.
The serialization must conform to the description in:
https://github.com/bitcoin/bips/blob/master/bip-0032.mediawiki#serialization-format
Args:
h (str): A hex-encoded string conforming to the above.
Returns:
HDPrivateKey or HDPublicKey:
Either an HD private or
public key object, depending on what was serialized.
Initializes a private key from an integer.
Args:
i (int): Integer that is the private key.
Returns:
PrivateKey: The object representing the private key.
Generates a public key object from an integer.
Note:
This assumes that the upper 32 bytes of the integer
are the x component of the public key point and the
lower 32 bytes are the y component.
Args:
i (Bignum): A 512-bit integer representing the public
key point on the secp256k1 curve.
Returns:
PublicKey: A PublicKey object.
Derives a child private key from a parent
private key. It is not possible to derive a child
private key from a public parent key.
Args:
parent_private_key (HDPrivateKey):
Generates a public key object from any object
containing x, y coordinates.
Args:
p (Point): An object containing a two-dimensional, affine
representation of a point on the secp256k1 curve.
Returns:
PublicKey: A PublicKey object.
Generates a public key object from a PrivateKey object.
Args:
private_key (PrivateKey): The private key object from
which to derive this object.
Returns:
PublicKey: A PublicKey object.
Initializes a private key from a random integer.
Returns:
PrivateKey: The object representing the private key.
Attempts to create PublicKey object by deriving it
from the message and signature.
Args:
message (bytes): The message to be verified.
signature (Signature): The signature for message.
The recovery_id must not be None!
Returns:
PublicKey:
A PublicKey object derived from the
signature, it it exists. None otherwise.
Returns the byte representation of a hex- or byte-string.
Whether or not this is a hardened node.
Hardened nodes are those with indices >= 0x80000000.
Returns:
bool: True if this is hardened, False otherwise.
Return the RIPEMD-160 hash of the SHA-256 hash of the
public key.
Args:
compressed (bool): Whether or not the compressed key should
be used.
Returns:
bytes: RIPEMD-160 byte string.
Return the RIPEMD-160 hash of the SHA-256 hash of the
public key.
Args:
compressed (bool): Whether or not the compressed key should
be used.
Returns:
bytes: RIPEMD-160 byte string.
Return the RIPEMD-160 hash of the SHA-256 hash of the
non-extended public key.
Note:
This always returns the hash of the compressed version of
the public key.
Returns:
bytes: RIPEMD-160 byte string.
Returns the identifier for the key.
A key's identifier and fingerprint are defined as:
https://github.com/bitcoin/bips/blob/master/bip-0032.mediawiki#key-identifiers
Returns:
bytes: A 20-byte RIPEMD-160 hash.
Returns the identifier for the key.
A key's identifier and fingerprint are defined as:
https://github.com/bitcoin/bips/blob/master/bip-0032.mediawiki#key-identifiers
In this case, it will return the RIPEMD-160 hash of the
corresponding public key.
Returns:
bytes: A 20-byte RIPEMD-160 hash.
Returns the identifier for the key.
A key's identifier and fingerprint are defined as:
https://github.com/bitcoin/bips/blob/master/bip-0032.mediawiki#key-identifiers
In this case, it will return the RIPEMD-160 hash of the
non-extended public key.
Returns:
bytes: A 20-byte RIPEMD-160 hash.
Whether or not this is a master node.
Returns:
bool: True if this is a master node, False otherwise.
Generates a master key from system entropy.
Args:
strength (int): Amount of entropy desired. This should be
a multiple of 32 between 128 and 256.
passphrase (str): An optional passphrase for the generated
mnemonic string.
Returns:
HDPrivateKey, str:
a tuple consisting of the master
private key and a mnemonic string from which the seed
can be recovered.
Generates a master key from a mnemonic.
Args:
mnemonic (str): The mnemonic sentence representing
the seed from which to generate the master key.
passphrase (str): Password if one was used.
Returns:
HDPrivateKey: the master private key.
Generates a master key from a provided seed.
Args:
seed (bytes or str): a string of bytes or a hex string
Returns:
HDPrivateKey: the master private key.
Returns the public key associated with this private key.
Returns:
PublicKey:
The PublicKey object that corresponds to this
private key.
Returns the public key associated with this private key.
Returns:
PublicKey:
The PublicKey object that corresponds to this
private key.
Returns the public key associated with this private key.
Returns:
HDPublicKey:
The HDPublicKey object that corresponds to this
private key.
Signs message using this private key.
Args:
message (bytes): The message to be signed. If a string is
provided it is assumed the encoding is 'ascii' and
converted to bytes. If this is not the case, it is up
to the caller to convert the string to bytes
appropriately and pass in the bytes.
do_hash (bool): True if the message should be hashed prior
to signing, False if not. This should always be left as
True except in special situations which require doing
the hash outside (e.g. handling Bitcoin bugs).
Returns:
ECPointAffine:
a raw point (r = pt.x, s = pt.y) which is
the signature.
Signs message using this private key.
Args:
message (bytes): The message to be signed. If a string is
provided it is assumed the encoding is 'ascii' and
converted to bytes. If this is not the case, it is up
to the caller to convert the string to bytes
appropriately and pass in the bytes.
do_hash (bool): True if the message should be hashed prior
to signing, False if not. This should always be left as
True except in special situations which require doing
the hash outside (e.g. handling Bitcoin bugs).
Returns:
ECPointAffine:
a raw point (r = pt.x, s = pt.y) which is
the signature.
Signs message using the underlying non-extended private key.
Args:
message (bytes): The message to be signed. If a string is
provided it is assumed the encoding is 'ascii' and
converted to bytes. If this is not the case, it is up
to the caller to convert the string to bytes
appropriately and pass in the bytes.
do_hash (bool): True if the message should be hashed prior
to signing, False if not. This should always be left as
True except in special situations which require doing
the hash outside (e.g. handling Bitcoin bugs).
Returns:
ECPointAffine:
a raw point (r = pt.x, s = pt.y) which is
the signature.
Signs message using this private key.
Note:
This differs from `raw_sign()` since it returns a
Signature object.
Args:
message (bytes or str): The message to be signed. If a
string is provided it is assumed the encoding is
'ascii' and converted to bytes. If this is not the
case, it is up to the caller to convert the string to
bytes appropriately and pass in the bytes.
do_hash (bool): True if the message should be hashed prior
to signing, False if not. This should always be left as
True except in special situations which require doing
the hash outside (e.g. handling Bitcoin bugs).
Returns:
Signature: The signature corresponding to message.
Signs message using this private key.
Note:
This differs from `raw_sign()` since it returns a Signature object.
Args:
message (bytes or str): The message to be signed. If a
string is provided it is assumed the encoding is
'ascii' and converted to bytes. If this is not the
case, it is up to the caller to convert the string to
bytes appropriately and pass in the bytes.
do_hash (bool): True if the message should be hashed prior
to signing, False if not. This should always be left as
True except in special situations which require doing
the hash outside (e.g. handling Bitcoin bugs).
Returns:
Signature: The signature corresponding to message.
Signs message using the underlying non-extended private key.
Note:
This differs from `raw_sign()` since it returns a Signature object.
Args:
message (bytes or str): The message to be signed. If a
string is provided it is assumed the encoding is
'ascii' and converted to bytes. If this is not the
case, it is up to the caller to convert the string to
bytes appropriately and pass in the bytes.
do_hash (bool): True if the message should be hashed prior
to signing, False if not. This should always be left as
True except in special situations which require doing
the hash outside (e.g. handling Bitcoin bugs).
Returns:
Signature: The signature corresponding to message.
Signs a message using this private key such that it
is compatible with bitcoind, bx, and other Bitcoin
clients/nodes/utilities.
Note:
0x18 + b"Bitcoin Signed Message:" + newline + len(message) is
prepended to the message before signing.
Args:
message (bytes or str): Message to be signed.
compressed (bool): True if the corresponding public key will be
used in compressed format. False if the uncompressed version
is used.
Returns:
bytes: A Base64-encoded byte string of the signed message.
The first byte of the encoded message contains information
about how to recover the public key. In bitcoind parlance,
this is the magic number containing the recovery ID and
whether or not the key was compressed or not. (This function
always processes full, uncompressed public-keys, so the magic
number will always be either 27 or 28).
Signs a message using this private key such that it
is compatible with bitcoind, bx, and other Bitcoin
clients/nodes/utilities.
Note:
0x18 + b"Bitcoin Signed Message:" + newline + len(message) is
prepended to the message before signing.
Args:
message (bytes or str): Message to be signed.
compressed (bool): True if the corresponding public key will be
used in compressed format. False if the uncompressed version
is used.
Returns:
bytes: A Base64-encoded byte string of the signed message.
The first byte of the encoded message contains information
about how to recover the public key. In bitcoind parlance,
this is the magic number containing the recovery ID and
whether or not the key was compressed or not.
Signs a message using the underlying non-extended private
key such that it is compatible with bitcoind, bx, and other
Bitcoin clients/nodes/utilities.
Note:
0x18 + b"Bitcoin Signed Message:" + newline + len(message) is
prepended to the message before signing.
Args:
message (bytes or str): Message to be signed.
compressed (bool):
True if the corresponding public key will be
used in compressed format. False if the uncompressed version
is used.
Returns:
bytes: A Base64-encoded byte string of the signed message.
The first byte of the encoded message contains information
about how to recover the public key. In bitcoind parlance,
this is the magic number containing the recovery ID and
whether or not the key was compressed or not. (This function
always processes full, uncompressed public-keys, so the
magic number will always be either 27 or 28).
Serialization of the key for testnet.
Returns:
bytes:
A 78-byte serialization of the key, specifically for
testnet (i.e. the first 2 bytes will be 0x0435).
Generates a Base58Check encoding of this private key.
Returns:
str: A Base58Check encoded string representing the key.
Generates a Base58Check encoding of this private key.
Returns:
str: A Base58Check encoded string representing the key.
Generates a Base58Check encoding of this key.
Args:
testnet (bool): True if the key is to be used with
testnet, False otherwise.
Returns:
str: A Base58Check encoded string representing the key.
Hex representation of the serialized byte stream.
Returns:
b (str): A Base64-encoded string.
Hex representation of the serialized byte stream.
Returns:
str: A Base64-encoded string.
Encodes this signature using DER
Returns:
bytes: The DER encoding of (self.r, self.s).
Generates a hex encoding of the serialized key.
Returns:
str: A hex encoded string representing the key.
Hex representation of the serialized byte stream.
Returns:
h (str): A hex-encoded string.
Hex representation of the serialized byte stream.
Returns:
str: A hex-encoded string.
Verifies that message was appropriately signed.
Args:
message (bytes): The message to be verified.
signature (Signature): A signature object.
do_hash (bool): True if the message should be hashed prior
to signing, False if not. This should always be left as
True except in special situations which require doing
the hash outside (e.g. handling Bitcoin bugs).
Returns:
verified (bool): True if the signature is verified, False
otherwise.
Verifies that message was appropriately signed.
Args:
message (bytes): The message to be verified.
signature (Signature): A signature object.
do_hash (bool): True if the message should be hashed prior
to signing, False if not. This should always be left as
True except in special situations which require doing
the hash outside (e.g. handling Bitcoin bugs).
Returns:
verified (bool): True if the signature is verified, False
otherwise.
Verifies that message was appropriately signed.
Args:
message (bytes): The message to be verified.
signature (Signature): A signature object.
do_hash (bool): True if the message should be hashed prior
to signing, False if not. This should always be left as
True except in special situations which require doing
the hash outside (e.g. handling Bitcoin bugs).
Returns:
verified (bool): True if the signature is verified, False
otherwise.
Verifies a message signed using PrivateKey.sign_bitcoin()
or any of the bitcoin utils (e.g. bitcoin-cli, bx, etc.)
Args:
message(bytes): The message that the signature corresponds to.
signature (bytes or str): A Base64 encoded signature
address (str): Base58Check encoded address.
Returns:
bool: True if the signature verified properly, False otherwise.
Convenience property for any method that requires
this object to provide a Point interface.
Convenience property for any method that requires
this object to provide a Point interface.
Code from:
https://github.com/michailbrynard/ethereum-bip44-python
This submodule provides the PublicKey, PrivateKey, and Signature classes.
It also provides HDPublicKey and HDPrivateKey classes for working with HD
wallets.
!/usr/bin/env python -*- coding: utf-8 -*- Take care of large s: Bitcoin deals with large s, by subtracting s from the curve order. See: https://bitcointalk.org/index.php?topic=285142.30;wap2 Some BTC things want to have the recovery id to extract the public key, so we should figure that out. Uncompressed Pick the one that corresponds to key_type Build the message that was signed RIPEMD-160 of SHA-256 Put the version byte in front, 0x00 for Mainnet, 0x6F for testnet version = bytes([self.TESTNET_VERSION]) if testnet else bytes([self.MAINNET_VERSION]) return base58.b58encode_check(version + self.hash160(compressed)) d must conform to (from btcd): [0 ] 0x30 - ASN.1 identifier for sequence [1 ] <1-byte> - total remaining length [2 ] 0x02 - ASN.1 identifier to specify an integer follows [3 ] <1-byte> - length of R [4.] <bytes> - R [..] 0x02 - ASN.1 identifier to specify an integer follows [..] <1-byte> - length of S [..] <bytes> - S 6 bytes + R (min. 1 byte) + S (min. 1 byte) 6 bytes + R (max. 33 bytes) + S (max. 33 bytes) Grab R, check for errors Grab S, check for errors Compute minimum bytes to represent integer Make sure it's at least one byte in length make sure there's no way it could be interpreted as a negative integer Output should be: 0x30 <length> 0x02 <length r> r 0x02 <length s> s Remove trailing "/" A hardened key is a key with index >= 2 ** 31, so we check that the MSB of a uint32 is set. Incredibly unlucky choice Get child private key | 26,199 | en | 0.75154 |
# -*- coding: utf-8 -*-
from tkinter import (
Frame,
LabelFrame,
Text,
Scrollbar,
Button,
Label,
RIDGE,
W,
E,
N,
S,
FLAT,
CENTER,
SUNKEN,
END,
INSERT,
)
from tkinter.simpledialog import askinteger, askstring
from tkinter.messagebox import askquestion, showinfo, YES, WARNING
from pdp8 import pdp8
class Emulatore(object):
"""
Interfaccia grafica per l'emulatore del pdp8
"""
def __init__(self, master, codice, calcolatore, emulatore):
"""
Inizializza i frame per l'interfaccia dell'emulatore
"""
self.CD = calcolatore
self.codice = codice
self.delay = 100
self.master = Frame(master)
self.root = emulatore
# Memoria Ram
self.ram = LabelFrame(
self.master,
text="Memoria RAM",
relief=RIDGE,
borderwidth=5,
labelanchor="n",
pady=5,
)
self.ram.rowconfigure(0, weight=1)
self.ram.columnconfigure(0, weight=1)
self.ram.grid(row=0, column=0, rowspan=3, columnspan=5, sticky=W + E + N + S)
# Controlli
self.controlli = Frame(self.master, padx=10, pady=10)
self.controlli.grid(row=0, column=5, rowspan=1)
# Status CD
self.registri = LabelFrame(
self.master,
text="REGISTRI",
relief=RIDGE,
borderwidth=5,
labelanchor="n",
padx=25,
pady=10,
)
self.registri.grid(row=0, column=6, rowspan=1, sticky=W + E + N + S)
self.unita = LabelFrame(
self.master,
text="UC",
relief=RIDGE,
borderwidth=5,
labelanchor="n",
padx=10,
pady=10,
)
self.unita.grid(row=2, column=6, rowspan=1, sticky=N)
# Var
self.variabili = Frame(self.master)
self.variabili.grid(row=2, column=5)
self.nstep = LabelFrame(
self.variabili,
text="Num. Step",
relief=RIDGE,
borderwidth=5,
labelanchor="n",
)
self.nstep.grid(row=0, column=5, sticky=W + E)
self.delays = LabelFrame(
self.variabili, text="Delay", relief=RIDGE, borderwidth=5, labelanchor="n"
)
self.delays.grid(row=1, column=5, sticky=W + E)
self.tempo = LabelFrame(
self.variabili, text="Tempo", relief=RIDGE, borderwidth=5, labelanchor="n"
)
self.tempo.grid(row=1, column=6, sticky=W + E)
# Unita' di controllo
self.unitas = LabelFrame(self.unita, text="S", labelanchor="s", padx=10)
self.unitas.grid(row=0, column=0, sticky=N)
self.unitaf = LabelFrame(self.unita, text="F", labelanchor="s", padx=10)
self.unitaf.grid(row=0, column=1, sticky=N)
self.unitar = LabelFrame(self.unita, text="R", labelanchor="s", padx=10)
self.unitar.grid(row=0, column=2, sticky=N)
self.unitaint = LabelFrame(self.unita, text="Int.", labelanchor="s", padx=10)
self.unitaint.grid(row=0, column=3, sticky=N)
# Registri
self.programc = LabelFrame(
self.registri, text="PC", relief=FLAT, labelanchor="e", padx=5
)
self.programc.grid(row=0, column=0, sticky=W + E)
self.mar = LabelFrame(
self.registri, text="MAR", relief=FLAT, labelanchor="e", padx=5
)
self.mar.grid(row=1, column=0, sticky=W + E)
self.mbr = LabelFrame(
self.registri, text="MBR", relief=FLAT, labelanchor="e", padx=5
)
self.mbr.grid(row=2, column=0, sticky=W + E)
self.lopr = LabelFrame(
self.registri, text="OPR", relief=FLAT, labelanchor="e", padx=5
)
self.lopr.grid(row=3, column=0, sticky=W + E)
self.vari = LabelFrame(
self.registri, text="I", relief=FLAT, labelanchor="e", padx=5
)
self.vari.grid(row=4, column=0, sticky=W + E)
self.vare = LabelFrame(
self.registri, text="E", relief=FLAT, labelanchor="e", padx=5
)
self.vare.grid(row=5, column=0, sticky=W + E)
self.lac = LabelFrame(
self.registri, text="AC", relief=FLAT, labelanchor="e", padx=5
)
self.lac.grid(row=6, column=0, sticky=W + E)
self.lacint = LabelFrame(
self.registri, text="INT AC", relief=FLAT, labelanchor="e", padx=5
)
self.lacint.grid(row=7, column=0, sticky=W + E)
self.lachex = LabelFrame(
self.registri, text="HEX AC", relief=FLAT, labelanchor="e", padx=5
)
self.lachex.grid(row=8, column=0, sticky=W + E)
# Microistruzioni
self.micro = LabelFrame(
self.master,
text="Microistruzioni eseguite",
relief=RIDGE,
borderwidth=5,
labelanchor="n",
pady=5,
)
self.micro.rowconfigure(0, weight=1)
self.micro.columnconfigure(0, weight=1)
self.micro.grid(row=3, column=4, rowspan=5, columnspan=5, sticky=W + E + N + S)
# Inout
self.inout = LabelFrame(
self.master,
text="Input & Output",
relief=RIDGE,
borderwidth=5,
labelanchor="n",
pady=5,
)
self.inout.rowconfigure(0, weight=1)
self.inout.columnconfigure(0, weight=1)
self.inout.grid(row=3, column=0, columnspan=4, sticky=W + E + N + S)
self.create_widgets()
def create_widgets(self):
"""
Crea il layout del programma, finestra dell'emulatore
"""
# Memoria RAM
self.Visualizza = Text(self.ram, width=80)
self.Visualizzascrollbar = Scrollbar(self.ram)
self.Visualizzascrollbar.config(command=self.Visualizza.yview)
self.Visualizza.config(yscrollcommand=self.Visualizzascrollbar.set)
self.Visualizzascrollbar.grid(row=0, column=1, sticky=N + S)
self.Visualizza.grid(row=0, column=0, sticky=W)
# INOUT
self.Visualizzainout = Text(
self.inout, width=62, height=7, fg="green", bg="black"
)
self.Visualizzascrollbar_inout = Scrollbar(self.inout)
self.Visualizzascrollbar_inout.config(command=self.Visualizzainout.yview)
self.Visualizzainout.config(yscrollcommand=self.Visualizzascrollbar_inout.set)
self.Visualizzascrollbar_inout.grid(row=0, column=1, sticky=N + S)
self.Visualizzainout.grid(row=0, column=0, sticky=W)
# Mircroistruzioni
self.Visualizzamicro = Text(self.micro, width=55, height=7)
self.Visualizzascrollbar_m = Scrollbar(self.micro)
self.Visualizzascrollbar_m.config(command=self.Visualizzamicro.yview)
self.Visualizzamicro.config(yscrollcommand=self.Visualizzascrollbar_m.set)
self.Visualizzascrollbar_m.grid(row=0, column=1, sticky=N + S)
self.Visualizzamicro.grid(row=0, column=0, sticky=W)
# Pulsanti
self.butload = Button(
self.controlli,
text="LOAD",
anchor=CENTER,
width=15,
command=self.loading,
bg="SkyBlue",
)
self.butload.grid(row=0, column=0)
self.butstep = Button(
self.controlli,
text="Step",
anchor=CENTER,
width=15,
command=self.step,
bg="linen",
)
self.butstep.grid(row=1, column=0)
self.butminstep = Button(
self.controlli,
text="miniStep",
anchor=CENTER,
width=15,
command=self.mini_step,
bg="linen",
)
self.butminstep.grid(row=2, column=0)
self.butstep = Button(
self.controlli,
text="microStep",
anchor=CENTER,
width=15,
command=self.micro_step,
bg="linen",
)
self.butstep.grid(row=3, column=0)
self.butsetstep = Button(
self.controlli,
text="Set n Step",
anchor=CENTER,
width=15,
command=self.setnstep,
bg="linen",
)
self.butsetstep.grid(row=4, column=0)
self.butsetdelay = Button(
self.controlli,
text="Set Delay",
anchor=CENTER,
width=15,
command=self.setdelay,
bg="linen",
)
self.butsetdelay.grid(row=5, column=0)
self.butstart = Button(
self.controlli,
text="START",
anchor=CENTER,
width=15,
command=self.start,
bg="DarkOliveGreen3",
)
self.butstart.grid(row=6, column=0)
self.butreset = Button(
self.controlli,
text="RESET",
anchor=CENTER,
width=15,
command=self.resetCD,
bg="Orange3",
)
self.butreset.grid(row=7, column=0)
self.butstop = Button(
self.controlli,
text="STOP",
anchor=CENTER,
width=15,
command=self.stop,
bg="IndianRed",
)
self.butstop.grid(row=8, column=0)
self.butbreak = Button(
self.controlli,
text="BREAK",
anchor=CENTER,
width=15,
command=self.breakpoint,
bg="Magenta2",
)
self.butbreak.grid(row=9, column=0)
self.butcontinue = Button(
self.controlli,
text="CONTINUA",
anchor=CENTER,
width=15,
command=self.continua,
bg="Magenta2",
)
self.butcontinue.grid(row=10, column=0)
self.butesegui = Button(
self.controlli,
text="ESEGUI",
anchor=CENTER,
width=15,
command=self.esegui,
bg="Yellow",
)
self.butesegui.grid(row=11, column=0)
# Labels
self.labelprogramc = Label(
self.programc, text="00000000000", relief=SUNKEN, bg="red"
)
self.labelprogramc.grid()
self.labelmar = Label(self.mar, text="00000000000", relief=SUNKEN, bg="yellow")
self.labelmar.grid()
self.labelmbr = Label(self.mbr, text="000000000000000", relief=SUNKEN)
self.labelmbr.grid()
self.labelvari = Label(self.vari, text="0", relief=SUNKEN)
self.labelvari.grid()
self.labelopr = Label(self.lopr, text="000", relief=SUNKEN)
self.labelopr.grid()
self.labelucs = Label(self.unitas, text="0")
self.labelucs.grid()
self.labelucf = Label(self.unitaf, text="0")
self.labelucf.grid()
self.labelucr = Label(self.unitar, text="0")
self.labelucr.grid()
self.labelucint = Label(self.unitaint, text="0")
self.labelucint.grid()
self.labelnstep = Label(self.nstep, text="1")
self.labelnstep.grid()
self.labeldelay = Label(self.delays, text=str(self.delay))
self.labeldelay.grid()
self.labeltempo = Label(self.tempo, text=str(self.CD.tempo))
self.labeltempo.grid()
self.labelac = Label(self.lac, text="000000000000000", relief=SUNKEN)
self.labelac.grid()
self.labelacint = Label(self.lacint, text="000000000000000", relief=SUNKEN)
self.labelacint.grid()
self.labelachex = Label(self.lachex, text="000000000000000", relief=SUNKEN)
self.labelachex.grid()
self.labelvare = Label(self.vare, text="0", relief=SUNKEN)
self.labelvare.grid()
def continua(self):
"""
Continua l'esecuzione dopo un break
"""
self.CD.S = True
self.esegui()
def micro_step(self):
"""
Esegue il metodo step del calcolatore didattico ed aggiorna
"""
if self.CD.S:
self.CD.step(self.root, self.codice)
if self.CD.tempo == 0 and not self.CD.F and not self.CD.R:
self.CD.previstr = self.CD.nextistr
self.aggiornaall()
def step(self):
"""
Esegue il metodo step del calcolatore didattico ed aggiorna
"""
var = True
if self.CD.S and self.CD.nstep > 0:
while var and self.CD.S:
self.CD.step(self.root, self.codice)
if not self.CD.F and not self.CD.R and self.CD.tempo == 0:
self.CD.nstep -= 1
self.aggiornaall()
self.CD.previstr = self.CD.nextistr
var = False
if self.CD.nstep > 0:
self.butstep.after(self.delay, self.step)
else:
self.CD.setnstep(1)
else:
self.CD.setnstep(1)
self.aggiornaall()
def esegui(self):
"""
Esegue il programma fino all'arresto della macchina tramite
l'istruzione HLT
"""
while self.CD.S:
self.CD.step(self.root, self.codice)
if not self.CD.F and not self.CD.R and self.CD.tempo == 0:
self.aggiornaall()
self.CD.previstr = self.CD.nextistr
break
if self.CD.S:
self.butesegui.after(self.delay, self.esegui)
else:
self.CD.setnstep(1)
self.aggiornaall()
def mini_step(self):
"""
Esegue un singolo ciclo della macchina
"""
if self.CD.S:
for x in range(0, 4):
self.CD.step(self.root, self.codice)
self.CD.nstep = 1
self.aggiornaall()
if self.CD.F is False and self.CD.R is False:
self.CD.previstr = self.CD.nextistr
def cerca_istr_prev(self):
"""
Evidenzia di VERDE l'ultima istruzione eseguita
"""
if self.CD.PC == "000000000000":
return
try:
if self.CD.previstr == "" and int(self.CD.PC, 2) == self.CD.START:
return
else:
pospc = str(3.0 + self.CD.previstr)
self.Visualizza.tag_add(
"PISTR", str(pospc[:-1] + "16"), str(pospc[:-1] + "end")
)
self.Visualizza.tag_config("PISTR", background="green")
self.Visualizza.see(pospc)
except TypeError:
pass # Errore che si ottiene durante il reset del CD
# NOTA : METODO NON NECESSARIO NEL PROGRAMMA FINALE
# def cerca_istr_corr(self):
# """
# Evidenzia di verde l'istruzione che si dovrà eseguire
# """
# if self.CD.PC == '000000000000':
# return
# try:
# if int(self.CD.PC,2) == self.CD.START:
# Inizio esecuzione del programma
# Il PC e l'istruzione da eseguire sono allo stesso 'livello'
# pos = str(3.0)
# self.Visualizza.tag_add("ISTR", str(pos[0]+'.16'), str(pos[:-1]+'end'))
# self.Visualizza.tag_config("ISTR", background = "green")
# else:
# pospc = str(3.0 + self.CD.nextistr)
# self.Visualizza.tag_add("ISTR", str(pospc[:-1]+'16'), str(pospc[:-1]+'end'))
# self.Visualizza.tag_config("ISTR", background = "green")
# self.Visualizza.see(pospc)
# except TypeError:
# pass ## Errore che si ottiene durante il reset del CD
def cerca_MAR(self):
"""
Evidenzia di giallo l'indirizzo puntato dal MAR
"""
try:
pos = 3.0
stringa = self.Visualizza.get(str(pos), "end")
while (
stringa[:12] != self.CD.MAR
and int(pos) < len(self.CD.RAM) + 3
and len(self.CD.RAM) > 0
):
pos += 1
stringa = self.Visualizza.get(str(pos), "end")
if int(pos) >= len(self.CD.RAM) + 3:
return
self.Visualizza.tag_add("MAR", pos, str(float(pos) + 0.12))
self.Visualizza.tag_config("MAR", background="yellow")
except TypeError:
pass # Errore che si ottiene durante il reset del CD
def cerca_PC(self):
"""
Evidenzia di rosso l'indirizzo puntato da PC
"""
try:
pos = 3.0
stringa = self.Visualizza.get(str(pos), "end")
while (
stringa[:12] != self.CD.PC
and int(pos) < len(self.CD.RAM) + 3
and len(self.CD.RAM) > 0
):
pos += 1
stringa = self.Visualizza.get(str(pos), "end")
if int(pos) >= len(self.CD.RAM) + 3:
return
self.Visualizza.tag_add("PC", pos, str(float(pos) + 0.12))
self.Visualizza.tag_config("PC", background="red")
except TypeError:
pass # Errore che si ottiene durante il reset del CD
def aggiornaout(self):
"""
Aggiorna micro e input/output
"""
self.aggiornamicro()
self.aggiornainout()
def aggiornamicro(self):
"""
Aggiorna le microistruzioni eseguite
"""
self.Visualizzamicro.delete(1.0, END)
stringa = self.CD.microistruzioni
self.Visualizzamicro.insert(INSERT, stringa)
self.Visualizzamicro.see(END)
def aggiornainout(self):
"""
Aggiorna gli input ed output di sistema
"""
self.Visualizzainout.delete(1.0, END)
stringa = self.CD.inout
self.Visualizzainout.insert(INSERT, stringa)
self.Visualizzainout.see(END)
def aggiornaram(self):
"""
Aggiorna lo stato della RAM
"""
self.Visualizza.delete(1.0, END)
stringa = self.CD.statusRAM()
self.Visualizza.insert(INSERT, stringa)
self.cerca_MAR()
self.cerca_PC()
self.cerca_istr_prev()
# self.cerca_istr_corr() #Non più necessaria nella versione finale
def aggiornareg(self):
"""
Aggiorna lo stato dei Registri
"""
self.labelprogramc.config(text=self.CD.PC)
self.labelmar.config(text=self.CD.MAR)
self.labelmbr.config(text=self.CD.MBR)
self.labelac.config(text=self.CD.AC)
self.labelacint.config(text=str(self.CD.range(int(self.CD.AC, 2))))
self.labelachex.config(text=str((hex(int(self.CD.AC, 2))[2:].upper())).zfill(4))
self.labelvare.config(text=self.CD.E)
self.labelvari.config(text=self.CD.I)
self.labelopr.config(text=self.CD.OPR)
def aggiornauc(self):
"""
Aggiorna lo stato dell'unita' di controllo
"""
if self.CD.S and not self.CD.breaks:
self.labelucs.config(text=self.CD.S, bg="green")
self.unitas.config(bg="green")
elif not self.CD.S and self.CD.breaks:
self.labelucs.config(text=self.CD.S, bg="Magenta2")
self.unitas.config(bg="Magenta2")
else:
self.labelucs.config(text=self.CD.S, bg="red")
self.unitas.config(bg="red")
self.labelucf.config(text=self.CD.F)
self.labelucr.config(text=self.CD.R)
self.labelucint.config(text=self.CD.Interrupt)
self.labeltempo.config(text=self.CD.tempo)
def aggiornaall(self):
"""
Aggiorna tutto
"""
self.aggiornaram()
self.aggiornareg()
self.aggiornauc()
self.aggiornamicro()
self.aggiornaout()
self.labelnstep.config(text=self.CD.nstep)
def loading(self):
"""
Carica il contenuto del codice assembly decodificandolo in binario
nella RAM
"""
contenuto = self.codice.Inserisci.get(1.0, END)
if len(contenuto) > 1:
self.resetCD()
if self.CD.carica(contenuto, self) is not None:
self.CD.S = 0
self.aggiornaall()
def resetCD(self):
"""
Resetta il calcolatore didattico
"""
self.CD = pdp8()
self.aggiornaall()
def start(self):
"""
Mette la variabile Start (S) ad 1, cioe' True
"""
self.CD.S = True
if self.CD.breaks == True:
self.CD.breaks = False
self.aggiornauc()
def stop(self):
"""
Mette la variabile Start (S) ad 0, cioe' False
"""
self.CD.S = False
self.aggiornauc()
def setnstep(self):
"""
Setta, in base al valore passato, il numero di cicli da eseguire
"""
temp = askinteger(
"Num Step",
"Numero di step da eseguire",
initialvalue=1,
minvalue=1,
parent=self.root,
)
if temp is None:
self.CD.setnstep(1)
else:
self.CD.setnstep(temp)
self.labelnstep.config(text=self.CD.nstep)
def setdelay(self):
"""
Setta, in base al valore passato, il ritardo di esecuzione.
Il valore è espresso in millisecondi, di default = 1000
"""
temp = askinteger(
"Set Delay",
"Ritardo in millisecondi",
initialvalue=100,
minvalue=1,
parent=self.root,
)
if temp is not None:
self.delay = temp
self.labeldelay.config(text=self.delay)
def breakpoint(self):
"""
Setta o elimina i breakpoint dal programma caricato in memoria
"""
temp = askstring("Cella di memoria", "Indirizzo esadecimale", parent=self.root)
if temp is not None:
temp = self.CD.binario(int(temp, 16)).zfill(12)
self.CD.breakpoint(temp)
self.aggiornaram()
def exit(self):
"""
Esce dal programma
"""
if askquestion("Exit", "Sicuro di voler uscire?", parent=self.master) == YES:
self.codice.master.quit()
self.codice.master.destroy()
else:
showinfo(
"Suggerimento",
"""Forse e' meglio fare una pausa!""",
icon=WARNING,
parent=self.master,
)
| Emulatore.py | 23,048 | Interfaccia grafica per l'emulatore del pdp8
Inizializza i frame per l'interfaccia dell'emulatore
Aggiorna tutto
Aggiorna gli input ed output di sistema
Aggiorna le microistruzioni eseguite
Aggiorna micro e input/output
Aggiorna lo stato della RAM
Aggiorna lo stato dei Registri
Aggiorna lo stato dell'unita' di controllo
Setta o elimina i breakpoint dal programma caricato in memoria
Evidenzia di giallo l'indirizzo puntato dal MAR
Evidenzia di rosso l'indirizzo puntato da PC
Evidenzia di VERDE l'ultima istruzione eseguita
Continua l'esecuzione dopo un break
Crea il layout del programma, finestra dell'emulatore
Esegue il programma fino all'arresto della macchina tramite
l'istruzione HLT
Esce dal programma
Carica il contenuto del codice assembly decodificandolo in binario
nella RAM
Esegue il metodo step del calcolatore didattico ed aggiorna
Esegue un singolo ciclo della macchina
Resetta il calcolatore didattico
Setta, in base al valore passato, il ritardo di esecuzione.
Il valore è espresso in millisecondi, di default = 1000
Setta, in base al valore passato, il numero di cicli da eseguire
Mette la variabile Start (S) ad 1, cioe' True
Esegue il metodo step del calcolatore didattico ed aggiorna
Mette la variabile Start (S) ad 0, cioe' False
-*- coding: utf-8 -*- Memoria Ram Controlli Status CD Var Unita' di controllo Registri Microistruzioni Inout Memoria RAM INOUT Mircroistruzioni Pulsanti Labels Errore che si ottiene durante il reset del CD NOTA : METODO NON NECESSARIO NEL PROGRAMMA FINALE def cerca_istr_corr(self): """ Evidenzia di verde l'istruzione che si dovrà eseguire """ if self.CD.PC == '000000000000': return try: if int(self.CD.PC,2) == self.CD.START: Inizio esecuzione del programma Il PC e l'istruzione da eseguire sono allo stesso 'livello' pos = str(3.0) self.Visualizza.tag_add("ISTR", str(pos[0]+'.16'), str(pos[:-1]+'end')) self.Visualizza.tag_config("ISTR", background = "green") else: pospc = str(3.0 + self.CD.nextistr) self.Visualizza.tag_add("ISTR", str(pospc[:-1]+'16'), str(pospc[:-1]+'end')) self.Visualizza.tag_config("ISTR", background = "green") self.Visualizza.see(pospc) except TypeError: pass Errore che si ottiene durante il reset del CD Errore che si ottiene durante il reset del CD Errore che si ottiene durante il reset del CD self.cerca_istr_corr() Non più necessaria nella versione finale | 2,467 | it | 0.950258 |
# Copyright (c) Facebook, Inc. and its affiliates. All Rights Reserved
import sys
from pathlib import Path
from typing import Any
import nevergrad as ng
from hydra.core.override_parser.overrides_parser import OverridesParser
from hydra.core.plugins import Plugins
from hydra.plugins.sweeper import Sweeper
from hydra.test_utils.test_utils import (
TSweepRunner,
chdir_plugin_root,
run_process,
run_python_script,
)
from omegaconf import DictConfig, OmegaConf
from pytest import mark
from hydra_plugins.hydra_nevergrad_sweeper import _impl
from hydra_plugins.hydra_nevergrad_sweeper.nevergrad_sweeper import NevergradSweeper
chdir_plugin_root()
def test_discovery() -> None:
assert NevergradSweeper.__name__ in [
x.__name__ for x in Plugins.instance().discover(Sweeper)
]
def assert_ng_param_equals(expected: Any, actual: Any) -> None:
assert type(expected) == type(actual)
if isinstance(actual, ng.p.Choice) or isinstance(actual, ng.p.TransitionChoice):
assert sorted(expected.choices.value) == sorted(actual.choices.value)
elif isinstance(actual, ng.p.Log) or isinstance(actual, ng.p.Scalar):
assert expected.bounds == actual.bounds
assert expected.integer == actual.integer
else:
assert False, f"Unexpected type: {type(actual)}"
def get_scalar_with_integer_bounds(lower: int, upper: int, type: Any) -> ng.p.Scalar:
scalar = type(lower=lower, upper=upper)
scalar.set_integer_casting()
assert isinstance(scalar, ng.p.Scalar)
return scalar
@mark.parametrize(
"input, expected",
[
([1, 2, 3], ng.p.Choice([1, 2, 3])),
(["1", "2", "3"], ng.p.Choice(["1", "2", "3"])),
({"lower": 1, "upper": 12, "log": True}, ng.p.Log(lower=1, upper=12)),
({"lower": 1, "upper": 12}, ng.p.Scalar(lower=1, upper=12)),
(
{"lower": 1, "upper": 12, "integer": True},
get_scalar_with_integer_bounds(1, 12, ng.p.Scalar),
),
(
{"lower": 1, "upper": 12, "log": True, "integer": True},
get_scalar_with_integer_bounds(1, 12, ng.p.Log),
),
],
)
def test_create_nevergrad_parameter_from_config(
input: Any,
expected: Any,
) -> None:
actual = _impl.create_nevergrad_param_from_config(input)
assert_ng_param_equals(expected, actual)
@mark.parametrize(
"input, expected",
[
("key=choice(1,2)", ng.p.Choice([1, 2])),
("key=choice('hello','world')", ng.p.Choice(["hello", "world"])),
("key=tag(ordered, choice(1,2,3))", ng.p.TransitionChoice([1, 2, 3])),
(
"key=tag(ordered, choice('hello','world', 'nevergrad'))",
ng.p.TransitionChoice(["hello", "world", "nevergrad"]),
),
("key=range(1,3)", ng.p.Choice([1, 2])),
("key=shuffle(range(1,3))", ng.p.Choice([1, 2])),
("key=range(1,5)", ng.p.Choice([1, 2, 3, 4])),
("key=float(range(1,5))", ng.p.Choice([1.0, 2.0, 3.0, 4.0])),
(
"key=int(interval(1,12))",
get_scalar_with_integer_bounds(lower=1, upper=12, type=ng.p.Scalar),
),
("key=tag(log, interval(1,12))", ng.p.Log(lower=1, upper=12)),
(
"key=tag(log, int(interval(1,12)))",
get_scalar_with_integer_bounds(lower=1, upper=12, type=ng.p.Log),
),
],
)
def test_create_nevergrad_parameter_from_override(
input: Any,
expected: Any,
) -> None:
parser = OverridesParser.create()
parsed = parser.parse_overrides([input])[0]
param = _impl.create_nevergrad_parameter_from_override(parsed)
assert_ng_param_equals(param, expected)
def test_launched_jobs(hydra_sweep_runner: TSweepRunner) -> None:
budget = 8
sweep = hydra_sweep_runner(
calling_file=None,
calling_module="hydra.test_utils.a_module",
config_path="configs",
config_name="compose.yaml",
task_function=None,
overrides=[
"hydra/sweeper=nevergrad",
"hydra/launcher=basic",
f"hydra.sweeper.optim.budget={budget}", # small budget to test fast
"hydra.sweeper.optim.num_workers=3",
"foo=1,2",
"bar=4:8",
],
)
with sweep:
assert sweep.returns is None
@mark.parametrize("with_commandline", (True, False))
def test_nevergrad_example(with_commandline: bool, tmpdir: Path) -> None:
budget = 32 if with_commandline else 1 # make a full test only once (faster)
cmd = [
"example/my_app.py",
"-m",
"hydra.sweep.dir=" + str(tmpdir),
f"hydra.sweeper.optim.budget={budget}", # small budget to test fast
f"hydra.sweeper.optim.num_workers={min(8, budget)}",
"hydra.sweeper.optim.seed=12", # avoid random failures
]
if with_commandline:
cmd += [
"db=mnist,cifar",
"batch_size=4,8,12,16",
"lr=tag(log, interval(0.001, 1.0))",
"dropout=interval(0,1)",
]
run_python_script(cmd)
returns = OmegaConf.load(f"{tmpdir}/optimization_results.yaml")
assert isinstance(returns, DictConfig)
assert returns.name == "nevergrad"
assert len(returns) == 3
best_parameters = returns.best_evaluated_params
assert not best_parameters.dropout.is_integer()
if budget > 1:
assert best_parameters.batch_size == 4 # this argument should be easy to find
# check that all job folders are created
last_job = max(int(fp.name) for fp in Path(tmpdir).iterdir() if fp.name.isdigit())
assert last_job == budget - 1
@mark.parametrize("max_failure_rate", (0.5, 1.0))
def test_failure_rate(max_failure_rate: float, tmpdir: Path) -> None:
cmd = [
sys.executable,
"example/my_app.py",
"-m",
f"hydra.sweep.dir={tmpdir}",
"hydra.sweeper.optim.budget=2", # small budget to test fast
"hydra.sweeper.optim.num_workers=2",
f"hydra.sweeper.optim.max_failure_rate={max_failure_rate}",
"error=true",
]
out, err = run_process(cmd, print_error=False, raise_exception=False)
assert "Returning infinity for failed experiment" in out
error_string = "RuntimeError: cfg.error is True"
if max_failure_rate < 1.0:
assert error_string in err
else:
assert error_string not in err
| plugins/hydra_nevergrad_sweeper/tests/test_nevergrad_sweeper_plugin.py | 6,336 | Copyright (c) Facebook, Inc. and its affiliates. All Rights Reserved small budget to test fast make a full test only once (faster) small budget to test fast avoid random failures this argument should be easy to find check that all job folders are created small budget to test fast | 280 | en | 0.898251 |
#!/usr/bin/env python3
def sum_recursin(numList):
if len(numList) == 1:
return numList[0]
else:
return numList[0] + sum_recursin(numList[1:])
if __name__ == "__main__":
print(sum_recursin(list(range(1, 101))))
| 07_RSI/ch03/sum.py | 240 | !/usr/bin/env python3 | 21 | fr | 0.448822 |
#!/content/Python/bin/python3.6
import os
import torch
from setuptools import setup, find_packages
from torch.utils.cpp_extension import BuildExtension, CUDAExtension
from compiler_args import nvcc_args, cxx_args
setup(
name='interpolation_cuda',
ext_modules=[
CUDAExtension('interpolation_cuda', [
'interpolation_cuda.cc',
'interpolation_cuda_kernel.cu'
], extra_compile_args={'cxx': cxx_args, 'nvcc': nvcc_args})
],
cmdclass={
'build_ext': BuildExtension
})
| my_package/Interpolation/setup.py | 531 | !/content/Python/bin/python3.6 | 30 | en | 0.826878 |
# Copyright 2018-2020 Streamlit Inc.
#
# Licensed under the Apache License, Version 2.0 (the "License");
# you may not use this file except in compliance with the License.
# You may obtain a copy of the License at
#
# http://www.apache.org/licenses/LICENSE-2.0
#
# Unless required by applicable law or agreed to in writing, software
# distributed under the License is distributed on an "AS IS" BASIS,
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
# See the License for the specific language governing permissions and
# limitations under the License.
"""Allows us to create and absorb changes (aka Deltas) to elements."""
import functools
import json
import random
import textwrap
import numbers
import re
from datetime import datetime
from datetime import date
from datetime import time
from streamlit import caching
from streamlit import config
from streamlit import cursor
from streamlit import type_util
from streamlit.ReportThread import get_report_ctx
from streamlit.errors import DuplicateWidgetID
from streamlit.errors import StreamlitAPIException
from streamlit.errors import NoSessionContext
from streamlit.file_util import get_encoded_file_data
from streamlit.js_number import JSNumber
from streamlit.js_number import JSNumberBoundsException
from streamlit.proto import Alert_pb2
from streamlit.proto import Balloons_pb2
from streamlit.proto import BlockPath_pb2
from streamlit.proto import ForwardMsg_pb2
from streamlit.proto.NumberInput_pb2 import NumberInput
from streamlit.proto.TextInput_pb2 import TextInput
from streamlit.logger import get_logger
from streamlit.type_util import is_type
LOGGER = get_logger(__name__)
# Save the type built-in for when we override the name "type".
_type = type
MAX_DELTA_BYTES = 14 * 1024 * 1024 # 14MB
# List of Streamlit commands that perform a Pandas "melt" operation on
# input dataframes.
DELTAS_TYPES_THAT_MELT_DATAFRAMES = ("line_chart", "area_chart", "bar_chart")
def _wraps_with_cleaned_sig(wrapped, num_args_to_remove):
"""Simplify the function signature by removing arguments from it.
Removes the first N arguments from function signature (where N is
num_args_to_remove). This is useful since function signatures are visible
in our user-facing docs, and many methods in DeltaGenerator have arguments
that users have no access to.
Note that "self" is ignored by default. So to remove both "self" and the
next argument you'd pass num_args_to_remove=1.
"""
# By passing (None, ...), we're removing (arg1, ...) from *args
args_to_remove = (None,) * num_args_to_remove
fake_wrapped = functools.partial(wrapped, *args_to_remove)
fake_wrapped.__doc__ = wrapped.__doc__
fake_wrapped.__name__ = wrapped.__name__ # type: ignore[attr-defined]
fake_wrapped.__module__ = wrapped.__module__
return functools.wraps(fake_wrapped)
def _with_element(method):
"""Wrap function and pass a NewElement proto to be filled.
This is a function decorator.
Converts a method of the with arguments (self, element, ...) into a method
with arguments (self, ...). Thus, the instantiation of the element proto
object and creation of the element are handled automatically.
Parameters
----------
method : callable
A DeltaGenerator method with arguments (self, element, ...)
Returns
-------
callable
A new DeltaGenerator method with arguments (self, ...)
"""
@_wraps_with_cleaned_sig(method, 1) # Remove self and element from sig.
def wrapped_method(dg, *args, **kwargs):
# Warn if we're called from within an @st.cache function
caching.maybe_show_cached_st_function_warning(dg, method.__name__)
delta_type = method.__name__
last_index = None
if delta_type in DELTAS_TYPES_THAT_MELT_DATAFRAMES and len(args) > 0:
data = args[0]
if type_util.is_dataframe_compatible(data):
data = type_util.convert_anything_to_df(data)
if data.index.size > 0:
last_index = data.index[-1]
else:
last_index = None
def marshall_element(element):
return method(dg, element, *args, **kwargs)
return dg._enqueue_new_element_delta(marshall_element, delta_type, last_index)
return wrapped_method
def _build_duplicate_widget_message(widget_type, user_key=None):
if user_key is not None:
message = textwrap.dedent(
"""
There are multiple identical `st.{widget_type}` widgets with
`key='{user_key}'`.
To fix this, please make sure that the `key` argument is unique for
each `st.{widget_type}` you create.
"""
)
else:
message = textwrap.dedent(
"""
There are multiple identical `st.{widget_type}` widgets with the
same generated key.
(When a widget is created, it's assigned an internal key based on
its structure. Multiple widgets with an identical structure will
result in the same internal key, which causes this error.)
To fix this, please pass a unique `key` argument to
`st.{widget_type}`.
"""
)
return message.strip("\n").format(widget_type=widget_type, user_key=user_key)
def _set_widget_id(widget_type, element, user_key=None):
"""Set the widget id.
Parameters
----------
widget_type : str
The type of the widget as stored in proto.
element : proto
The proto of the element
user_key : str
Optional user-specified key to use for the widget ID.
If this is None, we'll generate an ID by hashing the element.
"""
element_hash = hash(element.SerializeToString())
if user_key is not None:
widget_id = "%s-%s" % (user_key, element_hash)
else:
widget_id = "%s" % element_hash
ctx = get_report_ctx()
if ctx is not None:
added = ctx.widget_ids_this_run.add(widget_id)
if not added:
raise DuplicateWidgetID(
_build_duplicate_widget_message(widget_type, user_key)
)
el = getattr(element, widget_type)
el.id = widget_id
def _get_widget_ui_value(widget_type, element, user_key=None):
"""Get the widget ui_value from the report context.
NOTE: This function should be called after the proto has been filled.
Parameters
----------
widget_type : str
The type of the widget as stored in proto.
element : proto
The proto of the element
user_key : str
Optional user-specified string to use as the widget ID.
If this is None, we'll generate an ID by hashing the element.
Returns
-------
ui_value : any
The value of the widget set by the client or
the default value passed. If the report context
doesn't exist, None will be returned.
"""
_set_widget_id(widget_type, element, user_key)
el = getattr(element, widget_type)
ctx = get_report_ctx()
ui_value = ctx.widgets.get_widget_value(el.id) if ctx else None
return ui_value
def _get_pandas_index_attr(data, attr):
return getattr(data.index, attr, None)
class NoValue(object):
"""Return this from DeltaGenerator.foo_widget() when you want the st.foo_widget()
call to return None. This is needed because `_enqueue_new_element_delta`
replaces `None` with a `DeltaGenerator` (for use in non-widget elements).
"""
pass
class DeltaGenerator(object):
"""Creator of Delta protobuf messages.
Parameters
----------
container: BlockPath_pb2.BlockPath or None
The root container for this DeltaGenerator. If None, this is a null
DeltaGenerator which doesn't print to the app at all (useful for
testing).
cursor: cursor.AbstractCursor or None
"""
# The pydoc below is for user consumption, so it doesn't talk about
# DeltaGenerator constructor parameters (which users should never use). For
# those, see above.
def __init__(self, container=BlockPath_pb2.BlockPath.MAIN, cursor=None):
"""Inserts or updates elements in Streamlit apps.
As a user, you should never initialize this object by hand. Instead,
DeltaGenerator objects are initialized for you in two places:
1) When you call `dg = st.foo()` for some method "foo", sometimes `dg`
is a DeltaGenerator object. You can call methods on the `dg` object to
update the element `foo` that appears in the Streamlit app.
2) This is an internal detail, but `st.sidebar` itself is a
DeltaGenerator. That's why you can call `st.sidebar.foo()` to place
an element `foo` inside the sidebar.
"""
self._container = container
# This is either:
# - None: if this is the running DeltaGenerator for a top-level
# container.
# - RunningCursor: if this is the running DeltaGenerator for a
# non-top-level container (created with dg._block())
# - LockedCursor: if this is a locked DeltaGenerator returned by some
# other DeltaGenerator method. E.g. the dg returned in dg =
# st.text("foo").
#
# You should never use this! Instead use self._cursor, which is a
# computed property that fetches the right cursor.
#
self._provided_cursor = cursor
def __getattr__(self, name):
import streamlit as st
streamlit_methods = [
method_name for method_name in dir(st) if callable(getattr(st, method_name))
]
def wrapper(*args, **kwargs):
if name in streamlit_methods:
if self._container == BlockPath_pb2.BlockPath.SIDEBAR:
message = (
"Method `%(name)s()` does not exist for "
"`st.sidebar`. Did you mean `st.%(name)s()`?" % {"name": name}
)
else:
message = (
"Method `%(name)s()` does not exist for "
"`DeltaGenerator` objects. Did you mean "
"`st.%(name)s()`?" % {"name": name}
)
else:
message = "`%(name)s()` is not a valid Streamlit command." % {
"name": name
}
raise StreamlitAPIException(message)
return wrapper
@property
def _cursor(self):
if self._provided_cursor is None:
return cursor.get_container_cursor(self._container)
else:
return self._provided_cursor
def _get_coordinates(self):
"""Returns the element's 4-component location as string like "M.(1,2).3".
This function uniquely identifies the element's position in the front-end,
which allows (among other potential uses) the MediaFileManager to maintain
session-specific maps of MediaFile objects placed with their "coordinates".
This way, users can (say) use st.image with a stream of different images,
and Streamlit will expire the older images and replace them in place.
"""
container = self._container # Proto index of container (e.g. MAIN=1)
if self._cursor:
path = (
self._cursor.path
) # [uint, uint] - "breadcrumbs" w/ ancestor positions
index = self._cursor.index # index - element's own position
else:
# Case in which we have started up in headless mode.
path = "(,)"
index = ""
return "{}.{}.{}".format(container, path, index)
def _enqueue_new_element_delta(
self,
marshall_element,
delta_type,
last_index=None,
element_width=None,
element_height=None,
):
"""Create NewElement delta, fill it, and enqueue it.
Parameters
----------
marshall_element : callable
Function which sets the fields for a NewElement protobuf.
element_width : int or None
Desired width for the element
element_height : int or None
Desired height for the element
Returns
-------
DeltaGenerator
A DeltaGenerator that can be used to modify the newly-created
element.
"""
rv = None
# Always call marshall_element() so users can run their script without
# Streamlit.
msg = ForwardMsg_pb2.ForwardMsg()
rv = marshall_element(msg.delta.new_element)
msg_was_enqueued = False
# Only enqueue message if there's a container.
if self._container and self._cursor:
msg.metadata.parent_block.container = self._container
msg.metadata.parent_block.path[:] = self._cursor.path
msg.metadata.delta_id = self._cursor.index
if element_width is not None:
msg.metadata.element_dimension_spec.width = element_width
if element_height is not None:
msg.metadata.element_dimension_spec.height = element_height
_enqueue_message(msg)
msg_was_enqueued = True
if msg_was_enqueued:
# Get a DeltaGenerator that is locked to the current element
# position.
output_dg = DeltaGenerator(
container=self._container,
cursor=self._cursor.get_locked_cursor(
delta_type=delta_type, last_index=last_index
),
)
else:
# If the message was not enqueued, just return self since it's a
# no-op from the point of view of the app.
output_dg = self
return _value_or_dg(rv, output_dg)
def _block(self):
if self._container is None or self._cursor is None:
return self
msg = ForwardMsg_pb2.ForwardMsg()
msg.delta.new_block = True
msg.metadata.parent_block.container = self._container
msg.metadata.parent_block.path[:] = self._cursor.path
msg.metadata.delta_id = self._cursor.index
# Normally we'd return a new DeltaGenerator that uses the locked cursor
# below. But in this case we want to return a DeltaGenerator that uses
# a brand new cursor for this new block we're creating.
block_cursor = cursor.RunningCursor(
path=self._cursor.path + (self._cursor.index,)
)
block_dg = DeltaGenerator(container=self._container, cursor=block_cursor)
# Must be called to increment this cursor's index.
self._cursor.get_locked_cursor(None)
_enqueue_message(msg)
return block_dg
@_with_element
def balloons(self, element):
"""Draw celebratory balloons.
Example
-------
>>> st.balloons()
...then watch your app and get ready for a celebration!
"""
element.balloons.type = Balloons_pb2.Balloons.DEFAULT
element.balloons.execution_id = random.randrange(0xFFFFFFFF)
@_with_element
def text(self, element, body):
"""Write fixed-width and preformatted text.
Parameters
----------
body : str
The string to display.
Example
-------
>>> st.text('This is some text.')
.. output::
https://share.streamlit.io/0.25.0-2JkNY/index.html?id=PYxU1kee5ubuhGR11NsnT1
height: 50px
"""
element.text.body = _clean_text(body)
@_with_element
def markdown(self, element, body, unsafe_allow_html=False):
"""Display string formatted as Markdown.
Parameters
----------
body : str
The string to display as Github-flavored Markdown. Syntax
information can be found at: https://github.github.com/gfm.
This also supports:
* Emoji shortcodes, such as `:+1:` and `:sunglasses:`.
For a list of all supported codes,
see https://raw.githubusercontent.com/omnidan/node-emoji/master/lib/emoji.json.
* LaTeX expressions, by just wrapping them in "$" or "$$" (the "$$"
must be on their own lines). Supported LaTeX functions are listed
at https://katex.org/docs/supported.html.
unsafe_allow_html : bool
By default, any HTML tags found in the body will be escaped and
therefore treated as pure text. This behavior may be turned off by
setting this argument to True.
That said, we *strongly advise against it*. It is hard to write
secure HTML, so by using this argument you may be compromising your
users' security. For more information, see:
https://github.com/streamlit/streamlit/issues/152
*Also note that `unsafe_allow_html` is a temporary measure and may
be removed from Streamlit at any time.*
If you decide to turn on HTML anyway, we ask you to please tell us
your exact use case here:
https://discuss.streamlit.io/t/96
This will help us come up with safe APIs that allow you to do what
you want.
Example
-------
>>> st.markdown('Streamlit is **_really_ cool**.')
.. output::
https://share.streamlit.io/0.25.0-2JkNY/index.html?id=PXz9xgY8aB88eziDVEZLyS
height: 50px
"""
element.markdown.body = _clean_text(body)
element.markdown.allow_html = unsafe_allow_html
@_with_element
def latex(self, element, body):
# This docstring needs to be "raw" because of the backslashes in the
# example below.
r"""Display mathematical expressions formatted as LaTeX.
Supported LaTeX functions are listed at
https://katex.org/docs/supported.html.
Parameters
----------
body : str or SymPy expression
The string or SymPy expression to display as LaTeX. If str, it's
a good idea to use raw Python strings since LaTeX uses backslashes
a lot.
Example
-------
>>> st.latex(r'''
... a + ar + a r^2 + a r^3 + \cdots + a r^{n-1} =
... \sum_{k=0}^{n-1} ar^k =
... a \left(\frac{1-r^{n}}{1-r}\right)
... ''')
.. output::
https://share.streamlit.io/0.50.0-td2L/index.html?id=NJFsy6NbGTsH2RF9W6ioQ4
height: 75px
"""
if type_util.is_sympy_expession(body):
import sympy
body = sympy.latex(body)
element.markdown.body = "$$\n%s\n$$" % _clean_text(body)
@_with_element
def code(self, element, body, language="python"):
"""Display a code block with optional syntax highlighting.
(This is a convenience wrapper around `st.markdown()`)
Parameters
----------
body : str
The string to display as code.
language : str
The language that the code is written in, for syntax highlighting.
If omitted, the code will be unstyled.
Example
-------
>>> code = '''def hello():
... print("Hello, Streamlit!")'''
>>> st.code(code, language='python')
.. output::
https://share.streamlit.io/0.27.0-kBtt/index.html?id=VDRnaCEZWSBCNUd5gNQZv2
height: 100px
"""
markdown = "```%(language)s\n%(body)s\n```" % {
"language": language or "",
"body": body,
}
element.markdown.body = _clean_text(markdown)
@_with_element
def json(self, element, body):
"""Display object or string as a pretty-printed JSON string.
Parameters
----------
body : Object or str
The object to print as JSON. All referenced objects should be
serializable to JSON as well. If object is a string, we assume it
contains serialized JSON.
Example
-------
>>> st.json({
... 'foo': 'bar',
... 'baz': 'boz',
... 'stuff': [
... 'stuff 1',
... 'stuff 2',
... 'stuff 3',
... 'stuff 5',
... ],
... })
.. output::
https://share.streamlit.io/0.25.0-2JkNY/index.html?id=CTFkMQd89hw3yZbZ4AUymS
height: 280px
"""
import streamlit as st
if not isinstance(body, str):
try:
body = json.dumps(body, default=lambda o: str(type(o)))
except TypeError as err:
st.warning(
"Warning: this data structure was not fully serializable as "
"JSON due to one or more unexpected keys. (Error was: %s)" % err
)
body = json.dumps(body, skipkeys=True, default=lambda o: str(type(o)))
element.json.body = body
@_with_element
def title(self, element, body):
"""Display text in title formatting.
Each document should have a single `st.title()`, although this is not
enforced.
Parameters
----------
body : str
The text to display.
Example
-------
>>> st.title('This is a title')
.. output::
https://share.streamlit.io/0.25.0-2JkNY/index.html?id=SFcBGANWd8kWXF28XnaEZj
height: 100px
"""
element.markdown.body = "# %s" % _clean_text(body)
@_with_element
def header(self, element, body):
"""Display text in header formatting.
Parameters
----------
body : str
The text to display.
Example
-------
>>> st.header('This is a header')
.. output::
https://share.streamlit.io/0.25.0-2JkNY/index.html?id=AnfQVFgSCQtGv6yMUMUYjj
height: 100px
"""
element.markdown.body = "## %s" % _clean_text(body)
@_with_element
def subheader(self, element, body):
"""Display text in subheader formatting.
Parameters
----------
body : str
The text to display.
Example
-------
>>> st.subheader('This is a subheader')
.. output::
https://share.streamlit.io/0.25.0-2JkNY/index.html?id=LBKJTfFUwudrbWENSHV6cJ
height: 100px
"""
element.markdown.body = "### %s" % _clean_text(body)
@_with_element
def error(self, element, body):
"""Display error message.
Parameters
----------
body : str
The error text to display.
Example
-------
>>> st.error('This is an error')
"""
element.alert.body = _clean_text(body)
element.alert.format = Alert_pb2.Alert.ERROR
@_with_element
def warning(self, element, body):
"""Display warning message.
Parameters
----------
body : str
The warning text to display.
Example
-------
>>> st.warning('This is a warning')
"""
element.alert.body = _clean_text(body)
element.alert.format = Alert_pb2.Alert.WARNING
@_with_element
def info(self, element, body):
"""Display an informational message.
Parameters
----------
body : str
The info text to display.
Example
-------
>>> st.info('This is a purely informational message')
"""
element.alert.body = _clean_text(body)
element.alert.format = Alert_pb2.Alert.INFO
@_with_element
def success(self, element, body):
"""Display a success message.
Parameters
----------
body : str
The success text to display.
Example
-------
>>> st.success('This is a success message!')
"""
element.alert.body = _clean_text(body)
element.alert.format = Alert_pb2.Alert.SUCCESS
@_with_element
def help(self, element, obj):
"""Display object's doc string, nicely formatted.
Displays the doc string for this object.
Parameters
----------
obj : Object
The object whose docstring should be displayed.
Example
-------
Don't remember how to initialize a dataframe? Try this:
>>> st.help(pandas.DataFrame)
Want to quickly check what datatype is output by a certain function?
Try:
>>> x = my_poorly_documented_function()
>>> st.help(x)
"""
import streamlit.elements.doc_string as doc_string
doc_string.marshall(element, obj)
@_with_element
def exception(self, element, exception):
"""Display an exception.
Parameters
----------
exception : Exception
The exception to display.
Example
-------
>>> e = RuntimeError('This is an exception of type RuntimeError')
>>> st.exception(e)
"""
import streamlit.elements.exception_proto as exception_proto
exception_proto.marshall(element.exception, exception)
def dataframe(self, data=None, width=None, height=None):
"""Display a dataframe as an interactive table.
Parameters
----------
data : pandas.DataFrame, pandas.Styler, numpy.ndarray, Iterable, dict,
or None
The data to display.
If 'data' is a pandas.Styler, it will be used to style its
underyling DataFrame. Streamlit supports custom cell
values and colors. (It does not support some of the more exotic
pandas styling features, like bar charts, hovering, and captions.)
Styler support is experimental!
width : int or None
Desired width of the UI element expressed in pixels. If None, a
default width based on the page width is used.
height : int or None
Desired height of the UI element expressed in pixels. If None, a
default height is used.
Examples
--------
>>> df = pd.DataFrame(
... np.random.randn(50, 20),
... columns=('col %d' % i for i in range(20)))
...
>>> st.dataframe(df) # Same as st.write(df)
.. output::
https://share.streamlit.io/0.25.0-2JkNY/index.html?id=165mJbzWdAC8Duf8a4tjyQ
height: 330px
>>> st.dataframe(df, 200, 100)
You can also pass a Pandas Styler object to change the style of
the rendered DataFrame:
>>> df = pd.DataFrame(
... np.random.randn(10, 20),
... columns=('col %d' % i for i in range(20)))
...
>>> st.dataframe(df.style.highlight_max(axis=0))
.. output::
https://share.streamlit.io/0.29.0-dV1Y/index.html?id=Hb6UymSNuZDzojUNybzPby
height: 285px
"""
import streamlit.elements.data_frame_proto as data_frame_proto
def set_data_frame(delta):
data_frame_proto.marshall_data_frame(data, delta.data_frame)
return self._enqueue_new_element_delta(
set_data_frame, "dataframe", element_width=width, element_height=height
)
@_with_element
def line_chart(
self, element, data=None, width=0, height=0, use_container_width=True
):
"""Display a line chart.
This is just syntax-sugar around st.altair_chart. The main difference
is this command uses the data's own column and indices to figure out
the chart's spec. As a result this is easier to use for many "just plot
this" scenarios, while being less customizable.
Parameters
----------
data : pandas.DataFrame, pandas.Styler, numpy.ndarray, Iterable, dict
or None
Data to be plotted.
width : int
The chart width in pixels. If 0, selects the width automatically.
height : int
The chart width in pixels. If 0, selects the height automatically.
use_container_width : bool
If True, set the chart width to the column width. This takes
precedence over the width argument.
Example
-------
>>> chart_data = pd.DataFrame(
... np.random.randn(20, 3),
... columns=['a', 'b', 'c'])
...
>>> st.line_chart(chart_data)
.. output::
https://share.streamlit.io/0.50.0-td2L/index.html?id=BdxXG3MmrVBfJyqS2R2ki8
height: 220px
"""
import streamlit.elements.altair as altair
chart = altair.generate_chart("line", data, width, height)
altair.marshall(element.vega_lite_chart, chart, use_container_width)
@_with_element
def area_chart(
self, element, data=None, width=0, height=0, use_container_width=True
):
"""Display a area chart.
This is just syntax-sugar around st.altair_chart. The main difference
is this command uses the data's own column and indices to figure out
the chart's spec. As a result this is easier to use for many "just plot
this" scenarios, while being less customizable.
Parameters
----------
data : pandas.DataFrame, pandas.Styler, numpy.ndarray, Iterable, or dict
Data to be plotted.
width : int
The chart width in pixels. If 0, selects the width automatically.
height : int
The chart width in pixels. If 0, selects the height automatically.
use_container_width : bool
If True, set the chart width to the column width. This takes
precedence over the width argument.
Example
-------
>>> chart_data = pd.DataFrame(
... np.random.randn(20, 3),
... columns=['a', 'b', 'c'])
...
>>> st.area_chart(chart_data)
.. output::
https://share.streamlit.io/0.50.0-td2L/index.html?id=Pp65STuFj65cJRDfhGh4Jt
height: 220px
"""
import streamlit.elements.altair as altair
chart = altair.generate_chart("area", data, width, height)
altair.marshall(element.vega_lite_chart, chart, use_container_width)
@_with_element
def bar_chart(
self, element, data=None, width=0, height=0, use_container_width=True
):
"""Display a bar chart.
This is just syntax-sugar around st.altair_chart. The main difference
is this command uses the data's own column and indices to figure out
the chart's spec. As a result this is easier to use for many "just plot
this" scenarios, while being less customizable.
Parameters
----------
data : pandas.DataFrame, pandas.Styler, numpy.ndarray, Iterable, or dict
Data to be plotted.
width : int
The chart width in pixels. If 0, selects the width automatically.
height : int
The chart width in pixels. If 0, selects the height automatically.
use_container_width : bool
If True, set the chart width to the column width. This takes
precedence over the width argument.
Example
-------
>>> chart_data = pd.DataFrame(
... np.random.randn(50, 3),
... columns=["a", "b", "c"])
...
>>> st.bar_chart(chart_data)
.. output::
https://share.streamlit.io/0.50.0-td2L/index.html?id=5U5bjR2b3jFwnJdDfSvuRk
height: 220px
"""
import streamlit.elements.altair as altair
chart = altair.generate_chart("bar", data, width, height)
altair.marshall(element.vega_lite_chart, chart, use_container_width)
@_with_element
def vega_lite_chart(
self,
element,
data=None,
spec=None,
width=0,
use_container_width=False,
**kwargs,
):
"""Display a chart using the Vega-Lite library.
Parameters
----------
data : pandas.DataFrame, pandas.Styler, numpy.ndarray, Iterable, dict,
or None
Either the data to be plotted or a Vega-Lite spec containing the
data (which more closely follows the Vega-Lite API).
spec : dict or None
The Vega-Lite spec for the chart. If the spec was already passed in
the previous argument, this must be set to None. See
https://vega.github.io/vega-lite/docs/ for more info.
width : number
Deprecated. If != 0 (default), will show an alert.
From now on you should set the width directly in the Vega-Lite
spec. Please refer to the Vega-Lite documentation for details.
use_container_width : bool
If True, set the chart width to the column width. This takes
precedence over Vega-Lite's native `width` value.
**kwargs : any
Same as spec, but as keywords.
Example
-------
>>> import pandas as pd
>>> import numpy as np
>>>
>>> df = pd.DataFrame(
... np.random.randn(200, 3),
... columns=['a', 'b', 'c'])
>>>
>>> st.vega_lite_chart(df, {
... 'mark': {'type': 'circle', 'tooltip': True},
... 'encoding': {
... 'x': {'field': 'a', 'type': 'quantitative'},
... 'y': {'field': 'b', 'type': 'quantitative'},
... 'size': {'field': 'c', 'type': 'quantitative'},
... 'color': {'field': 'c', 'type': 'quantitative'},
... },
... })
.. output::
https://share.streamlit.io/0.25.0-2JkNY/index.html?id=8jmmXR8iKoZGV4kXaKGYV5
height: 200px
Examples of Vega-Lite usage without Streamlit can be found at
https://vega.github.io/vega-lite/examples/. Most of those can be easily
translated to the syntax shown above.
"""
import streamlit.elements.vega_lite as vega_lite
if width != 0:
import streamlit as st
st.warning(
"The `width` argument in `st.vega_lite_chart` is deprecated and will be removed on 2020-03-04. To set the width, you should instead use Vega-Lite's native `width` argument as described at https://vega.github.io/vega-lite/docs/size.html"
)
vega_lite.marshall(
element.vega_lite_chart,
data,
spec,
use_container_width=use_container_width,
**kwargs,
)
@_with_element
def altair_chart(self, element, altair_chart, width=0, use_container_width=False):
"""Display a chart using the Altair library.
Parameters
----------
altair_chart : altair.vegalite.v2.api.Chart
The Altair chart object to display.
width : number
Deprecated. If != 0 (default), will show an alert.
From now on you should set the width directly in the Altair
spec. Please refer to the Altair documentation for details.
use_container_width : bool
If True, set the chart width to the column width. This takes
precedence over Altair's native `width` value.
Example
-------
>>> import pandas as pd
>>> import numpy as np
>>> import altair as alt
>>>
>>> df = pd.DataFrame(
... np.random.randn(200, 3),
... columns=['a', 'b', 'c'])
...
>>> c = alt.Chart(df).mark_circle().encode(
... x='a', y='b', size='c', color='c', tooltip=['a', 'b', 'c'])
>>>
>>> st.altair_chart(c, use_container_width=True)
.. output::
https://share.streamlit.io/0.25.0-2JkNY/index.html?id=8jmmXR8iKoZGV4kXaKGYV5
height: 200px
Examples of Altair charts can be found at
https://altair-viz.github.io/gallery/.
"""
import streamlit.elements.altair as altair
if width != 0:
import streamlit as st
st.warning(
"The `width` argument in `st.vega_lite_chart` is deprecated and will be removed on 2020-03-04. To set the width, you should instead use altair's native `width` argument as described at https://altair-viz.github.io/user_guide/generated/toplevel/altair.Chart.html"
)
altair.marshall(
element.vega_lite_chart,
altair_chart,
use_container_width=use_container_width,
)
@_with_element
def graphviz_chart(
self, element, figure_or_dot, width=0, height=0, use_container_width=False
):
"""Display a graph using the dagre-d3 library.
Parameters
----------
figure_or_dot : graphviz.dot.Graph, graphviz.dot.Digraph, str
The Graphlib graph object or dot string to display
width : number
Deprecated. If != 0 (default), will show an alert.
From now on you should set the width directly in the Graphviz
spec. Please refer to the Graphviz documentation for details.
height : number
Deprecated. If != 0 (default), will show an alert.
From now on you should set the height directly in the Graphviz
spec. Please refer to the Graphviz documentation for details.
use_container_width : bool
If True, set the chart width to the column width. This takes
precedence over the figure's native `width` value.
Example
-------
>>> import streamlit as st
>>> import graphviz as graphviz
>>>
>>> # Create a graphlib graph object
>>> graph = graphviz.Digraph()
>>> graph.edge('run', 'intr')
>>> graph.edge('intr', 'runbl')
>>> graph.edge('runbl', 'run')
>>> graph.edge('run', 'kernel')
>>> graph.edge('kernel', 'zombie')
>>> graph.edge('kernel', 'sleep')
>>> graph.edge('kernel', 'runmem')
>>> graph.edge('sleep', 'swap')
>>> graph.edge('swap', 'runswap')
>>> graph.edge('runswap', 'new')
>>> graph.edge('runswap', 'runmem')
>>> graph.edge('new', 'runmem')
>>> graph.edge('sleep', 'runmem')
>>>
>>> st.graphviz_chart(graph)
Or you can render the chart from the graph using GraphViz's Dot
language:
>>> st.graphviz_chart('''
digraph {
run -> intr
intr -> runbl
runbl -> run
run -> kernel
kernel -> zombie
kernel -> sleep
kernel -> runmem
sleep -> swap
swap -> runswap
runswap -> new
runswap -> runmem
new -> runmem
sleep -> runmem
}
''')
.. output::
https://share.streamlit.io/0.56.0-xTAd/index.html?id=GBn3GXZie5K1kXuBKe4yQL
height: 400px
"""
import streamlit.elements.graphviz_chart as graphviz_chart
if width != 0 and height != 0:
import streamlit as st
st.warning(
"The `width` and `height` arguments in `st.graphviz` are deprecated and will be removed on 2020-03-04"
)
elif width != 0:
import streamlit as st
st.warning(
"The `width` argument in `st.graphviz` is deprecated and will be removed on 2020-03-04"
)
elif height != 0:
import streamlit as st
st.warning(
"The `height` argument in `st.graphviz` is deprecated and will be removed on 2020-03-04"
)
graphviz_chart.marshall(
element.graphviz_chart, figure_or_dot, use_container_width
)
@_with_element
def plotly_chart(
self,
element,
figure_or_data,
width=0,
height=0,
use_container_width=False,
sharing="streamlit",
**kwargs,
):
"""Display an interactive Plotly chart.
Plotly is a charting library for Python. The arguments to this function
closely follow the ones for Plotly's `plot()` function. You can find
more about Plotly at https://plot.ly/python.
Parameters
----------
figure_or_data : plotly.graph_objs.Figure, plotly.graph_objs.Data,
dict/list of plotly.graph_objs.Figure/Data, or
matplotlib.figure.Figure
See https://plot.ly/python/ for examples of graph descriptions.
If a Matplotlib Figure, converts it to a Plotly figure and displays
it.
width : int
Deprecated. If != 0 (default), will show an alert.
From now on you should set the width directly in the figure.
Please refer to the Plotly documentation for details.
height : int
Deprecated. If != 0 (default), will show an alert.
From now on you should set the height directly in the figure.
Please refer to the Plotly documentation for details.
use_container_width : bool
If True, set the chart width to the column width. This takes
precedence over the figure's native `width` value.
sharing : {'streamlit', 'private', 'secret', 'public'}
Use 'streamlit' to insert the plot and all its dependencies
directly in the Streamlit app, which means it works offline too.
This is the default.
Use any other sharing mode to send the app to Plotly's servers,
and embed the result into the Streamlit app. See
https://plot.ly/python/privacy/ for more. Note that these sharing
modes require a Plotly account.
**kwargs
Any argument accepted by Plotly's `plot()` function.
To show Plotly charts in Streamlit, just call `st.plotly_chart`
wherever you would call Plotly's `py.plot` or `py.iplot`.
Example
-------
The example below comes straight from the examples at
https://plot.ly/python:
>>> import streamlit as st
>>> import plotly.figure_factory as ff
>>> import numpy as np
>>>
>>> # Add histogram data
>>> x1 = np.random.randn(200) - 2
>>> x2 = np.random.randn(200)
>>> x3 = np.random.randn(200) + 2
>>>
>>> # Group data together
>>> hist_data = [x1, x2, x3]
>>>
>>> group_labels = ['Group 1', 'Group 2', 'Group 3']
>>>
>>> # Create distplot with custom bin_size
>>> fig = ff.create_distplot(
... hist_data, group_labels, bin_size=[.1, .25, .5])
>>>
>>> # Plot!
>>> st.plotly_chart(fig, use_container_width=True)
.. output::
https://share.streamlit.io/0.56.0-xTAd/index.html?id=TuP96xX8JnsoQeUGAPjkGQ
height: 400px
"""
# NOTE: "figure_or_data" is the name used in Plotly's .plot() method
# for their main parameter. I don't like the name, but it's best to
# keep it in sync with what Plotly calls it.
import streamlit.elements.plotly_chart as plotly_chart
if width != 0 and height != 0:
import streamlit as st
st.warning(
"The `width` and `height` arguments in `st.plotly_chart` are deprecated and will be removed on 2020-03-04. To set these values, you should instead use Plotly's native arguments as described at https://plot.ly/python/setting-graph-size/"
)
elif width != 0:
import streamlit as st
st.warning(
"The `width` argument in `st.plotly_chart` is deprecated and will be removed on 2020-03-04. To set the width, you should instead use Plotly's native `width` argument as described at https://plot.ly/python/setting-graph-size/"
)
elif height != 0:
import streamlit as st
st.warning(
"The `height` argument in `st.plotly_chart` is deprecated and will be removed on 2020-03-04. To set the height, you should instead use Plotly's native `height` argument as described at https://plot.ly/python/setting-graph-size/"
)
plotly_chart.marshall(
element.plotly_chart, figure_or_data, use_container_width, sharing, **kwargs
)
@_with_element
def pyplot(self, element, fig=None, clear_figure=None, **kwargs):
"""Display a matplotlib.pyplot figure.
Parameters
----------
fig : Matplotlib Figure
The figure to plot. When this argument isn't specified, which is
the usual case, this function will render the global plot.
clear_figure : bool
If True, the figure will be cleared after being rendered.
If False, the figure will not be cleared after being rendered.
If left unspecified, we pick a default based on the value of `fig`.
* If `fig` is set, defaults to `False`.
* If `fig` is not set, defaults to `True`. This simulates Jupyter's
approach to matplotlib rendering.
**kwargs : any
Arguments to pass to Matplotlib's savefig function.
Example
-------
>>> import matplotlib.pyplot as plt
>>> import numpy as np
>>>
>>> arr = np.random.normal(1, 1, size=100)
>>> plt.hist(arr, bins=20)
>>>
>>> st.pyplot()
.. output::
https://share.streamlit.io/0.25.0-2JkNY/index.html?id=PwzFN7oLZsvb6HDdwdjkRB
height: 530px
Notes
-----
Matplotlib support several different types of "backends". If you're
getting an error using Matplotlib with Streamlit, try setting your
backend to "TkAgg"::
echo "backend: TkAgg" >> ~/.matplotlib/matplotlibrc
For more information, see https://matplotlib.org/faq/usage_faq.html.
"""
import streamlit.elements.pyplot as pyplot
pyplot.marshall(self._get_coordinates, element, fig, clear_figure, **kwargs)
@_with_element
def bokeh_chart(self, element, figure, use_container_width=False):
"""Display an interactive Bokeh chart.
Bokeh is a charting library for Python. The arguments to this function
closely follow the ones for Bokeh's `show` function. You can find
more about Bokeh at https://bokeh.pydata.org.
Parameters
----------
figure : bokeh.plotting.figure.Figure
A Bokeh figure to plot.
use_container_width : bool
If True, set the chart width to the column width. This takes
precedence over Bokeh's native `width` value.
To show Bokeh charts in Streamlit, just call `st.bokeh_chart`
wherever you would call Bokeh's `show`.
Example
-------
>>> import streamlit as st
>>> from bokeh.plotting import figure
>>>
>>> x = [1, 2, 3, 4, 5]
>>> y = [6, 7, 2, 4, 5]
>>>
>>> p = figure(
... title='simple line example',
... x_axis_label='x',
... y_axis_label='y')
...
>>> p.line(x, y, legend='Trend', line_width=2)
>>>
>>> st.bokeh_chart(p, use_container_width=True)
.. output::
https://share.streamlit.io/0.56.0-xTAd/index.html?id=Fdhg51uMbGMLRRxXV6ubzp
height: 600px
"""
import streamlit.elements.bokeh_chart as bokeh_chart
bokeh_chart.marshall(element.bokeh_chart, figure, use_container_width)
@_with_element
def image(
self,
element,
image,
caption=None,
width=None,
use_column_width=False,
clamp=False,
channels="RGB",
format="JPEG",
):
"""Display an image or list of images.
Parameters
----------
image : numpy.ndarray, [numpy.ndarray], BytesIO, str, or [str]
Monochrome image of shape (w,h) or (w,h,1)
OR a color image of shape (w,h,3)
OR an RGBA image of shape (w,h,4)
OR a URL to fetch the image from
OR a list of one of the above, to display multiple images.
caption : str or list of str
Image caption. If displaying multiple images, caption should be a
list of captions (one for each image).
width : int or None
Image width. None means use the image width.
use_column_width : bool
If True, set the image width to the column width. This takes
precedence over the `width` parameter.
clamp : bool
Clamp image pixel values to a valid range ([0-255] per channel).
This is only meaningful for byte array images; the parameter is
ignored for image URLs. If this is not set, and an image has an
out-of-range value, an error will be thrown.
channels : 'RGB' or 'BGR'
If image is an nd.array, this parameter denotes the format used to
represent color information. Defaults to 'RGB', meaning
`image[:, :, 0]` is the red channel, `image[:, :, 1]` is green, and
`image[:, :, 2]` is blue. For images coming from libraries like
OpenCV you should set this to 'BGR', instead.
format : 'JPEG' or 'PNG'
This parameter specifies the image format to use when transferring
the image data. Defaults to 'JPEG'.
Example
-------
>>> from PIL import Image
>>> image = Image.open('sunrise.jpg')
>>>
>>> st.image(image, caption='Sunrise by the mountains',
... use_column_width=True)
.. output::
https://share.streamlit.io/0.25.0-2JkNY/index.html?id=YCFaqPgmgpEz7jwE4tHAzY
height: 630px
"""
from .elements import image_proto
if use_column_width:
width = -2
elif width is None:
width = -1
elif width <= 0:
raise StreamlitAPIException("Image width must be positive.")
image_proto.marshall_images(
self._get_coordinates(),
image,
caption,
width,
element.imgs,
clamp,
channels,
format,
)
@_with_element
def audio(self, element, data, format="audio/wav", start_time=0):
"""Display an audio player.
Parameters
----------
data : str, bytes, BytesIO, numpy.ndarray, or file opened with
io.open().
Raw audio data, filename, or a URL pointing to the file to load.
Numpy arrays and raw data formats must include all necessary file
headers to match specified file format.
start_time: int
The time from which this element should start playing.
format : str
The mime type for the audio file. Defaults to 'audio/wav'.
See https://tools.ietf.org/html/rfc4281 for more info.
Example
-------
>>> audio_file = open('myaudio.ogg', 'rb')
>>> audio_bytes = audio_file.read()
>>>
>>> st.audio(audio_bytes, format='audio/ogg')
.. output::
https://share.streamlit.io/0.25.0-2JkNY/index.html?id=Dv3M9sA7Cg8gwusgnVNTHb
height: 400px
"""
from .elements import media_proto
media_proto.marshall_audio(
self._get_coordinates(), element.audio, data, format, start_time
)
@_with_element
def video(self, element, data, format="video/mp4", start_time=0):
"""Display a video player.
Parameters
----------
data : str, bytes, BytesIO, numpy.ndarray, or file opened with
io.open().
Raw video data, filename, or URL pointing to a video to load.
Includes support for YouTube URLs.
Numpy arrays and raw data formats must include all necessary file
headers to match specified file format.
format : str
The mime type for the video file. Defaults to 'video/mp4'.
See https://tools.ietf.org/html/rfc4281 for more info.
start_time: int
The time from which this element should start playing.
Example
-------
>>> video_file = open('myvideo.mp4', 'rb')
>>> video_bytes = video_file.read()
>>>
>>> st.video(video_bytes)
.. output::
https://share.streamlit.io/0.25.0-2JkNY/index.html?id=Wba9sZELKfKwXH4nDCCbMv
height: 600px
.. note::
Some videos may not display if they are encoded using MP4V (which is an export option in OpenCV), as this codec is
not widely supported by browsers. Converting your video to H.264 will allow the video to be displayed in Streamlit.
See this `StackOverflow post <https://stackoverflow.com/a/49535220/2394542>`_ or this
`Streamlit forum post <https://discuss.streamlit.io/t/st-video-doesnt-show-opencv-generated-mp4/3193/2>`_
for more information.
"""
from .elements import media_proto
media_proto.marshall_video(
self._get_coordinates(), element.video, data, format, start_time
)
@_with_element
def button(self, element, label, key=None):
"""Display a button widget.
Parameters
----------
label : str
A short label explaining to the user what this button is for.
key : str
An optional string to use as the unique key for the widget.
If this is omitted, a key will be generated for the widget
based on its content. Multiple widgets of the same type may
not share the same key.
Returns
-------
bool
If the button was clicked on the last run of the app.
Example
-------
>>> if st.button('Say hello'):
... st.write('Why hello there')
... else:
... st.write('Goodbye')
"""
element.button.label = label
element.button.default = False
ui_value = _get_widget_ui_value("button", element, user_key=key)
current_value = ui_value if ui_value is not None else False
return current_value
@_with_element
def checkbox(self, element, label, value=False, key=None):
"""Display a checkbox widget.
Parameters
----------
label : str
A short label explaining to the user what this checkbox is for.
value : bool
Preselect the checkbox when it first renders. This will be
cast to bool internally.
key : str
An optional string to use as the unique key for the widget.
If this is omitted, a key will be generated for the widget
based on its content. Multiple widgets of the same type may
not share the same key.
Returns
-------
bool
Whether or not the checkbox is checked.
Example
-------
>>> agree = st.checkbox('I agree')
>>>
>>> if agree:
... st.write('Great!')
"""
element.checkbox.label = label
element.checkbox.default = bool(value)
ui_value = _get_widget_ui_value("checkbox", element, user_key=key)
current_value = ui_value if ui_value is not None else value
return bool(current_value)
@_with_element
def multiselect(
self, element, label, options, default=None, format_func=str, key=None
):
"""Display a multiselect widget.
The multiselect widget starts as empty.
Parameters
----------
label : str
A short label explaining to the user what this select widget is for.
options : list, tuple, numpy.ndarray, or pandas.Series
Labels for the select options. This will be cast to str internally
by default.
default: [str] or None
List of default values.
format_func : function
Function to modify the display of selectbox options. It receives
the raw option as an argument and should output the label to be
shown for that option. This has no impact on the return value of
the selectbox.
key : str
An optional string to use as the unique key for the widget.
If this is omitted, a key will be generated for the widget
based on its content. Multiple widgets of the same type may
not share the same key.
Returns
-------
[str]
A list with the selected options
Example
-------
>>> options = st.multiselect(
... 'What are your favorite colors',
... ['Green', 'Yellow', 'Red', 'Blue'],
... ['Yellow', 'Red'])
>>>
>>> st.write('You selected:', options)
.. note::
User experience can be degraded for large lists of `options` (100+), as this widget
is not designed to handle arbitrary text search efficiently. See this
`thread <https://discuss.streamlit.io/t/streamlit-loading-column-data-takes-too-much-time/1791>`_
on the Streamlit community forum for more information and
`GitHub issue #1059 <https://github.com/streamlit/streamlit/issues/1059>`_ for updates on the issue.
"""
# Perform validation checks and return indices base on the default values.
def _check_and_convert_to_indices(options, default_values):
if default_values is None and None not in options:
return None
if not isinstance(default_values, list):
# This if is done before others because calling if not x (done
# right below) when x is of type pd.Series() or np.array() throws a
# ValueError exception.
if is_type(default_values, "numpy.ndarray") or is_type(
default_values, "pandas.core.series.Series"
):
default_values = list(default_values)
elif not default_values:
default_values = [default_values]
else:
default_values = list(default_values)
for value in default_values:
if value not in options:
raise StreamlitAPIException(
"Every Multiselect default value must exist in options"
)
return [options.index(value) for value in default_values]
indices = _check_and_convert_to_indices(options, default)
element.multiselect.label = label
default_value = [] if indices is None else indices
element.multiselect.default[:] = default_value
element.multiselect.options[:] = [
str(format_func(option)) for option in options
]
ui_value = _get_widget_ui_value("multiselect", element, user_key=key)
current_value = ui_value.value if ui_value is not None else default_value
return [options[i] for i in current_value]
@_with_element
def radio(self, element, label, options, index=0, format_func=str, key=None):
"""Display a radio button widget.
Parameters
----------
label : str
A short label explaining to the user what this radio group is for.
options : list, tuple, numpy.ndarray, or pandas.Series
Labels for the radio options. This will be cast to str internally
by default.
index : int
The index of the preselected option on first render.
format_func : function
Function to modify the display of radio options. It receives
the raw option as an argument and should output the label to be
shown for that option. This has no impact on the return value of
the radio.
key : str
An optional string to use as the unique key for the widget.
If this is omitted, a key will be generated for the widget
based on its content. Multiple widgets of the same type may
not share the same key.
Returns
-------
any
The selected option.
Example
-------
>>> genre = st.radio(
... "What\'s your favorite movie genre",
... ('Comedy', 'Drama', 'Documentary'))
>>>
>>> if genre == 'Comedy':
... st.write('You selected comedy.')
... else:
... st.write("You didn\'t select comedy.")
"""
if not isinstance(index, int):
raise StreamlitAPIException(
"Radio Value has invalid type: %s" % type(index).__name__
)
if len(options) > 0 and not 0 <= index < len(options):
raise StreamlitAPIException(
"Radio index must be between 0 and length of options"
)
element.radio.label = label
element.radio.default = index
element.radio.options[:] = [str(format_func(option)) for option in options]
ui_value = _get_widget_ui_value("radio", element, user_key=key)
current_value = ui_value if ui_value is not None else index
return (
options[current_value]
if len(options) > 0 and options[current_value] is not None
else NoValue
)
@_with_element
def selectbox(self, element, label, options, index=0, format_func=str, key=None):
"""Display a select widget.
Parameters
----------
label : str
A short label explaining to the user what this select widget is for.
options : list, tuple, numpy.ndarray, or pandas.Series
Labels for the select options. This will be cast to str internally
by default.
index : int
The index of the preselected option on first render.
format_func : function
Function to modify the display of the labels. It receives the option
as an argument and its output will be cast to str.
key : str
An optional string to use as the unique key for the widget.
If this is omitted, a key will be generated for the widget
based on its content. Multiple widgets of the same type may
not share the same key.
Returns
-------
any
The selected option
Example
-------
>>> option = st.selectbox(
... 'How would you like to be contacted?',
... ('Email', 'Home phone', 'Mobile phone'))
>>>
>>> st.write('You selected:', option)
"""
if not isinstance(index, int):
raise StreamlitAPIException(
"Selectbox Value has invalid type: %s" % type(index).__name__
)
if len(options) > 0 and not 0 <= index < len(options):
raise StreamlitAPIException(
"Selectbox index must be between 0 and length of options"
)
element.selectbox.label = label
element.selectbox.default = index
element.selectbox.options[:] = [str(format_func(option)) for option in options]
ui_value = _get_widget_ui_value("selectbox", element, user_key=key)
current_value = ui_value if ui_value is not None else index
return (
options[current_value]
if len(options) > 0 and options[current_value] is not None
else NoValue
)
@_with_element
def slider(
self,
element,
label,
min_value=None,
max_value=None,
value=None,
step=None,
format=None,
key=None,
):
"""Display a slider widget.
This also allows you to render a range slider by passing a two-element tuple or list as the `value`.
Parameters
----------
label : str or None
A short label explaining to the user what this slider is for.
min_value : int/float or None
The minimum permitted value.
Defaults to 0 if the value is an int, 0.0 otherwise.
max_value : int/float or None
The maximum permitted value.
Defaults 100 if the value is an int, 1.0 otherwise.
value : int/float or a tuple/list of int/float or None
The value of the slider when it first renders. If a tuple/list
of two values is passed here, then a range slider with those lower
and upper bounds is rendered. For example, if set to `(1, 10)` the
slider will have a selectable range between 1 and 10.
Defaults to min_value.
step : int/float or None
The stepping interval.
Defaults to 1 if the value is an int, 0.01 otherwise.
format : str or None
A printf-style format string controlling how the interface should
display numbers. This does not impact the return value.
Valid formatters: %d %e %f %g %i
key : str
An optional string to use as the unique key for the widget.
If this is omitted, a key will be generated for the widget
based on its content. Multiple widgets of the same type may
not share the same key.
Returns
-------
int/float or tuple of int/float
The current value of the slider widget. The return type will match
the data type of the value parameter.
Examples
--------
>>> age = st.slider('How old are you?', 0, 130, 25)
>>> st.write("I'm ", age, 'years old')
And here's an example of a range slider:
>>> values = st.slider(
... 'Select a range of values',
... 0.0, 100.0, (25.0, 75.0))
>>> st.write('Values:', values)
"""
# Set value default.
if value is None:
value = min_value if min_value is not None else 0
# Ensure that the value is either a single value or a range of values.
single_value = isinstance(value, (int, float))
range_value = isinstance(value, (list, tuple)) and len(value) in (0, 1, 2)
if not single_value and not range_value:
raise StreamlitAPIException(
"Slider value should either be an int/float or a list/tuple of "
"0 to 2 ints/floats"
)
# Ensure that the value is either an int/float or a list/tuple of ints/floats.
if single_value:
int_value = isinstance(value, int)
float_value = isinstance(value, float)
else:
int_value = all(map(lambda v: isinstance(v, int), value))
float_value = all(map(lambda v: isinstance(v, float), value))
if not int_value and not float_value:
raise StreamlitAPIException(
"Slider tuple/list components must be of the same type."
)
# Set corresponding defaults.
if min_value is None:
min_value = 0 if int_value else 0.0
if max_value is None:
max_value = 100 if int_value else 1.0
if step is None:
step = 1 if int_value else 0.01
# Ensure that all arguments are of the same type.
args = [min_value, max_value, step]
int_args = all(map(lambda a: isinstance(a, int), args))
float_args = all(map(lambda a: isinstance(a, float), args))
if not int_args and not float_args:
raise StreamlitAPIException(
"Slider value arguments must be of the same type."
"\n`value` has %(value_type)s type."
"\n`min_value` has %(min_type)s type."
"\n`max_value` has %(max_type)s type."
% {
"value_type": type(value).__name__,
"min_type": type(min_value).__name__,
"max_type": type(max_value).__name__,
}
)
# Ensure that the value matches arguments' types.
all_ints = int_value and int_args
all_floats = float_value and float_args
if not all_ints and not all_floats:
raise StreamlitAPIException(
"Both value and arguments must be of the same type."
"\n`value` has %(value_type)s type."
"\n`min_value` has %(min_type)s type."
"\n`max_value` has %(max_type)s type."
% {
"value_type": type(value).__name__,
"min_type": type(min_value).__name__,
"max_type": type(max_value).__name__,
}
)
# Ensure that min <= value <= max.
if single_value:
if not min_value <= value <= max_value:
raise StreamlitAPIException(
"The default `value` of %(value)s "
"must lie between the `min_value` of %(min)s "
"and the `max_value` of %(max)s, inclusively."
% {"value": value, "min": min_value, "max": max_value}
)
elif len(value) == 2:
start, end = value
if not min_value <= start <= end <= max_value:
raise StreamlitAPIException(
"The value and/or arguments are out of range."
)
else:
value = [min_value, max_value]
# Bounds checks. JSNumber produces human-readable exceptions that
# we simply re-package as StreamlitAPIExceptions.
# (We check `min_value` and `max_value` here; `value` and `step` are
# already known to be in the [min_value, max_value] range.)
try:
if all_ints:
JSNumber.validate_int_bounds(min_value, "`min_value`")
JSNumber.validate_int_bounds(max_value, "`max_value`")
else:
JSNumber.validate_float_bounds(min_value, "`min_value`")
JSNumber.validate_float_bounds(max_value, "`max_value`")
except JSNumberBoundsException as e:
raise StreamlitAPIException(str(e))
# Set format default.
if format is None:
if all_ints:
format = "%d"
else:
format = "%0.2f"
# It would be great if we could guess the number of decimal places from
# the `step` argument, but this would only be meaningful if step were a
# decimal. As a possible improvement we could make this function accept
# decimals and/or use some heuristics for floats.
element.slider.label = label
element.slider.format = format
element.slider.default[:] = [value] if single_value else value
element.slider.min = min_value
element.slider.max = max_value
element.slider.step = step
ui_value = _get_widget_ui_value("slider", element, user_key=key)
# Convert the current value to the appropriate type.
current_value = ui_value if ui_value is not None else value
# Cast ui_value to the same type as the input arguments
if ui_value is not None:
current_value = getattr(ui_value, "value")
# Convert float array into int array if the rest of the arguments
# are ints
if all_ints:
current_value = list(map(int, current_value))
# If there is only one value in the array destructure it into a
# single variable
current_value = current_value[0] if single_value else current_value
return current_value if single_value else tuple(current_value)
@_with_element
def file_uploader(
self, element, label, type=None, encoding="auto", key=None,
):
"""Display a file uploader widget.
By default, uploaded files are limited to 200MB. You can configure
this using the `server.maxUploadSize` config option.
Parameters
----------
label : str or None
A short label explaining to the user what this file uploader is for.
type : str or list of str or None
Array of allowed extensions. ['png', 'jpg']
By default, all extensions are allowed.
encoding : str or None
The encoding to use when opening textual files (i.e. non-binary).
For example: 'utf-8'. If set to 'auto', will try to guess the
encoding. If None, will assume the file is binary.
key : str
An optional string to use as the unique key for the widget.
If this is omitted, a key will be generated for the widget
based on its content. Multiple widgets of the same type may
not share the same key.
Returns
-------
BytesIO or StringIO or or list of BytesIO/StringIO or None
If no file has been uploaded, returns None. Otherwise, returns
the data for the uploaded file(s):
- If the file is in a well-known textual format (or if the encoding
parameter is set), the file data is a StringIO.
- Otherwise the file data is BytesIO.
- If multiple_files is True, a list of file data will be returned.
Note that BytesIO/StringIO are "file-like", which means you can
pass them anywhere where a file is expected!
Examples
--------
>>> uploaded_file = st.file_uploader("Choose a CSV file", type="csv")
>>> if uploaded_file is not None:
... data = pd.read_csv(uploaded_file)
... st.write(data)
"""
# Don't release this just yet. (When ready to release, turn test back
# on at file_uploader_test.py)
accept_multiple_files = False
if isinstance(type, str):
type = [type]
element.file_uploader.label = label
element.file_uploader.type[:] = type if type is not None else []
element.file_uploader.max_upload_size_mb = config.get_option(
"server.maxUploadSize"
)
element.file_uploader.multiple_files = accept_multiple_files
_set_widget_id("file_uploader", element, user_key=key)
files = None
ctx = get_report_ctx()
if ctx is not None:
files = ctx.uploaded_file_mgr.get_files(
session_id=ctx.session_id, widget_id=element.file_uploader.id
)
if files is None:
return NoValue
file_datas = [get_encoded_file_data(file.data, encoding) for file in files]
return file_datas if accept_multiple_files else file_datas[0]
@_with_element
def beta_color_picker(self, element, label, value=None, key=None):
"""Display a color picker widget.
Note: This is a beta feature. See
https://docs.streamlit.io/en/latest/pre_release_features.html for more
information.
Parameters
----------
label : str
A short label explaining to the user what this input is for.
value : str or None
The hex value of this widget when it first renders. If None,
defaults to black.
key : str
An optional string to use as the unique key for the widget.
If this is omitted, a key will be generated for the widget
based on its content. Multiple widgets of the same type may
not share the same key.
Returns
-------
str
The selected color as a hex string.
Example
-------
>>> color = st.beta_color_picker('Pick A Color', '#00f900')
>>> st.write('The current color is', color)
"""
# set value default
if value is None:
value = "#000000"
# make sure the value is a string
if not isinstance(value, str):
raise StreamlitAPIException(
"""
Color Picker Value has invalid type: %s. Expects a hex string
like '#00FFAA' or '#000'.
"""
% type(value).__name__
)
# validate the value and expects a hex string
match = re.match(r"^#(?:[0-9a-fA-F]{3}){1,2}$", value)
if not match:
raise StreamlitAPIException(
"""
'%s' is not a valid hex code for colors. Valid ones are like
'#00FFAA' or '#000'.
"""
% value
)
element.color_picker.label = label
element.color_picker.default = str(value)
ui_value = _get_widget_ui_value("color_picker", element, user_key=key)
current_value = ui_value if ui_value is not None else value
return str(current_value)
@_with_element
def text_input(
self, element, label, value="", max_chars=None, key=None, type="default"
):
"""Display a single-line text input widget.
Parameters
----------
label : str
A short label explaining to the user what this input is for.
value : any
The text value of this widget when it first renders. This will be
cast to str internally.
max_chars : int or None
Max number of characters allowed in text input.
key : str
An optional string to use as the unique key for the widget.
If this is omitted, a key will be generated for the widget
based on its content. Multiple widgets of the same type may
not share the same key.
type : str
The type of the text input. This can be either "default" (for
a regular text input), or "password" (for a text input that
masks the user's typed value). Defaults to "default".
Returns
-------
str
The current value of the text input widget.
Example
-------
>>> title = st.text_input('Movie title', 'Life of Brian')
>>> st.write('The current movie title is', title)
"""
element.text_input.label = label
element.text_input.default = str(value)
if max_chars is not None:
element.text_input.max_chars = max_chars
if type == "default":
element.text_input.type = TextInput.DEFAULT
elif type == "password":
element.text_input.type = TextInput.PASSWORD
else:
raise StreamlitAPIException(
"'%s' is not a valid text_input type. Valid types are 'default' and 'password'."
% type
)
ui_value = _get_widget_ui_value("text_input", element, user_key=key)
current_value = ui_value if ui_value is not None else value
return str(current_value)
@_with_element
def text_area(
self, element, label, value="", height=None, max_chars=None, key=None
):
"""Display a multi-line text input widget.
Parameters
----------
label : str
A short label explaining to the user what this input is for.
value : any
The text value of this widget when it first renders. This will be
cast to str internally.
height : int or None
Desired height of the UI element expressed in pixels. If None, a
default height is used.
max_chars : int or None
Maximum number of characters allowed in text area.
key : str
An optional string to use as the unique key for the widget.
If this is omitted, a key will be generated for the widget
based on its content. Multiple widgets of the same type may
not share the same key.
Returns
-------
str
The current value of the text input widget.
Example
-------
>>> txt = st.text_area('Text to analyze', '''
... It was the best of times, it was the worst of times, it was
... the age of wisdom, it was the age of foolishness, it was
... the epoch of belief, it was the epoch of incredulity, it
... was the season of Light, it was the season of Darkness, it
... was the spring of hope, it was the winter of despair, (...)
... ''')
>>> st.write('Sentiment:', run_sentiment_analysis(txt))
"""
element.text_area.label = label
element.text_area.default = str(value)
if height is not None:
element.text_area.height = height
if max_chars is not None:
element.text_area.max_chars = max_chars
ui_value = _get_widget_ui_value("text_area", element, user_key=key)
current_value = ui_value if ui_value is not None else value
return str(current_value)
@_with_element
def time_input(self, element, label, value=None, key=None):
"""Display a time input widget.
Parameters
----------
label : str
A short label explaining to the user what this time input is for.
value : datetime.time/datetime.datetime
The value of this widget when it first renders. This will be
cast to str internally. Defaults to the current time.
key : str
An optional string to use as the unique key for the widget.
If this is omitted, a key will be generated for the widget
based on its content. Multiple widgets of the same type may
not share the same key.
Returns
-------
datetime.time
The current value of the time input widget.
Example
-------
>>> t = st.time_input('Set an alarm for', datetime.time(8, 45))
>>> st.write('Alarm is set for', t)
"""
# Set value default.
if value is None:
value = datetime.now().time()
# Ensure that the value is either datetime/time
if not isinstance(value, datetime) and not isinstance(value, time):
raise StreamlitAPIException(
"The type of the value should be either datetime or time."
)
# Convert datetime to time
if isinstance(value, datetime):
value = value.time()
element.time_input.label = label
element.time_input.default = time.strftime(value, "%H:%M")
ui_value = _get_widget_ui_value("time_input", element, user_key=key)
current_value = (
datetime.strptime(ui_value, "%H:%M").time()
if ui_value is not None
else value
)
return current_value
@_with_element
def date_input(
self,
element,
label,
value=None,
min_value=datetime.min,
max_value=None,
key=None,
):
"""Display a date input widget.
Parameters
----------
label : str
A short label explaining to the user what this date input is for.
value : datetime.date or datetime.datetime or list/tuple of datetime.date or datetime.datetime or None
The value of this widget when it first renders. If a list/tuple with
0 to 2 date/datetime values is provided, the datepicker will allow
users to provide a range. Defaults to today as a single-date picker.
min_value : datetime.date or datetime.datetime
The minimum selectable date. Defaults to datetime.min.
max_value : datetime.date or datetime.datetime
The maximum selectable date. Defaults to today+10y.
key : str
An optional string to use as the unique key for the widget.
If this is omitted, a key will be generated for the widget
based on its content. Multiple widgets of the same type may
not share the same key.
Returns
-------
datetime.date
The current value of the date input widget.
Example
-------
>>> d = st.date_input(
... "When\'s your birthday",
... datetime.date(2019, 7, 6))
>>> st.write('Your birthday is:', d)
"""
# Set value default.
if value is None:
value = datetime.now().date()
single_value = isinstance(value, (date, datetime))
range_value = isinstance(value, (list, tuple)) and len(value) in (0, 1, 2)
if not single_value and not range_value:
raise StreamlitAPIException(
"DateInput value should either be an date/datetime or a list/tuple of "
"0 - 2 date/datetime values"
)
if single_value:
value = [value]
element.date_input.is_range = range_value
value = [v.date() if isinstance(v, datetime) else v for v in value]
element.date_input.label = label
element.date_input.default[:] = [date.strftime(v, "%Y/%m/%d") for v in value]
if isinstance(min_value, datetime):
min_value = min_value.date()
element.date_input.min = date.strftime(min_value, "%Y/%m/%d")
if max_value is None:
today = date.today()
max_value = date(today.year + 10, today.month, today.day)
if isinstance(max_value, datetime):
max_value = max_value.date()
element.date_input.max = date.strftime(max_value, "%Y/%m/%d")
ui_value = _get_widget_ui_value("date_input", element, user_key=key)
if ui_value is not None:
value = getattr(ui_value, "data")
value = [datetime.strptime(v, "%Y/%m/%d").date() for v in value]
if single_value:
return value[0]
else:
return tuple(value)
@_with_element
def number_input(
self,
element,
label,
min_value=None,
max_value=None,
value=NoValue(),
step=None,
format=None,
key=None,
):
"""Display a numeric input widget.
Parameters
----------
label : str or None
A short label explaining to the user what this input is for.
min_value : int or float or None
The minimum permitted value.
If None, there will be no minimum.
max_value : int or float or None
The maximum permitted value.
If None, there will be no maximum.
value : int or float or None
The value of this widget when it first renders.
Defaults to min_value, or 0.0 if min_value is None
step : int or float or None
The stepping interval.
Defaults to 1 if the value is an int, 0.01 otherwise.
If the value is not specified, the format parameter will be used.
format : str or None
A printf-style format string controlling how the interface should
display numbers. Output must be purely numeric. This does not impact
the return value. Valid formatters: %d %e %f %g %i
key : str
An optional string to use as the unique key for the widget.
If this is omitted, a key will be generated for the widget
based on its content. Multiple widgets of the same type may
not share the same key.
Returns
-------
int or float
The current value of the numeric input widget. The return type
will match the data type of the value parameter.
Example
-------
>>> number = st.number_input('Insert a number')
>>> st.write('The current number is ', number)
"""
if isinstance(value, NoValue):
if min_value:
value = min_value
else:
value = 0.0 # We set a float as default
int_value = isinstance(value, numbers.Integral)
float_value = isinstance(value, float)
if value is None:
raise StreamlitAPIException(
"Default value for number_input should be an int or a float."
)
else:
if format is None:
format = "%d" if int_value else "%0.2f"
if format in ["%d", "%u", "%i"] and float_value:
# Warn user to check if displaying float as int was really intended.
import streamlit as st
st.warning(
"Warning: NumberInput value below is float, but format {} displays as integer.".format(
format
)
)
if step is None:
step = 1 if int_value else 0.01
try:
float(format % 2)
except (TypeError, ValueError):
raise StreamlitAPIException(
"Format string for st.number_input contains invalid characters: %s"
% format
)
# Ensure that all arguments are of the same type.
args = [min_value, max_value, step]
int_args = all(
map(
lambda a: (
isinstance(a, numbers.Integral) or isinstance(a, type(None))
),
args,
)
)
float_args = all(
map(lambda a: (isinstance(a, float) or isinstance(a, type(None))), args)
)
if not int_args and not float_args:
raise StreamlitAPIException(
"All arguments must be of the same type."
"\n`value` has %(value_type)s type."
"\n`min_value` has %(min_type)s type."
"\n`max_value` has %(max_type)s type."
% {
"value_type": type(value).__name__,
"min_type": type(min_value).__name__,
"max_type": type(max_value).__name__,
}
)
# Ensure that the value matches arguments' types.
all_ints = int_value and int_args
all_floats = float_value and float_args
if not all_ints and not all_floats:
raise StreamlitAPIException(
"All numerical arguments must be of the same type."
"\n`value` has %(value_type)s type."
"\n`min_value` has %(min_type)s type."
"\n`max_value` has %(max_type)s type."
"\n`step` has %(step_type)s type."
% {
"value_type": type(value).__name__,
"min_type": type(min_value).__name__,
"max_type": type(max_value).__name__,
"step_type": type(step).__name__,
}
)
if (min_value and min_value > value) or (max_value and max_value < value):
raise StreamlitAPIException(
"The default `value` of %(value)s "
"must lie between the `min_value` of %(min)s "
"and the `max_value` of %(max)s, inclusively."
% {"value": value, "min": min_value, "max": max_value}
)
# Bounds checks. JSNumber produces human-readable exceptions that
# we simply re-package as StreamlitAPIExceptions.
try:
if all_ints:
if min_value is not None:
JSNumber.validate_int_bounds(min_value, "`min_value`")
if max_value is not None:
JSNumber.validate_int_bounds(max_value, "`max_value`")
if step is not None:
JSNumber.validate_int_bounds(step, "`step`")
JSNumber.validate_int_bounds(value, "`value`")
else:
if min_value is not None:
JSNumber.validate_float_bounds(min_value, "`min_value`")
if max_value is not None:
JSNumber.validate_float_bounds(max_value, "`max_value`")
if step is not None:
JSNumber.validate_float_bounds(step, "`step`")
JSNumber.validate_float_bounds(value, "`value`")
except JSNumberBoundsException as e:
raise StreamlitAPIException(str(e))
number_input = element.number_input
number_input.data_type = NumberInput.INT if all_ints else NumberInput.FLOAT
number_input.label = label
number_input.default = value
if min_value is not None:
number_input.min = min_value
number_input.has_min = True
if max_value is not None:
number_input.max = max_value
number_input.has_max = True
if step is not None:
number_input.step = step
if format is not None:
number_input.format = format
ui_value = _get_widget_ui_value("number_input", element, user_key=key)
return ui_value if ui_value is not None else value
@_with_element
def progress(self, element, value):
"""Display a progress bar.
Parameters
----------
value : int or float
0 <= value <= 100 for int
0.0 <= value <= 1.0 for float
Example
-------
Here is an example of a progress bar increasing over time:
>>> import time
>>>
>>> my_bar = st.progress(0)
>>>
>>> for percent_complete in range(100):
... time.sleep(0.1)
... my_bar.progress(percent_complete + 1)
"""
# TODO: standardize numerical type checking across st.* functions.
if isinstance(value, float):
if 0.0 <= value <= 1.0:
element.progress.value = int(value * 100)
else:
raise StreamlitAPIException(
"Progress Value has invalid value [0.0, 1.0]: %f" % value
)
elif isinstance(value, int):
if 0 <= value <= 100:
element.progress.value = value
else:
raise StreamlitAPIException(
"Progress Value has invalid value [0, 100]: %d" % value
)
else:
raise StreamlitAPIException(
"Progress Value has invalid type: %s" % type(value).__name__
)
@_with_element
def empty(self, element):
"""Add a placeholder to the app.
The placeholder can be filled any time by calling methods on the return
value.
Example
-------
>>> my_placeholder = st.empty()
>>>
>>> # Now replace the placeholder with some text:
>>> my_placeholder.text("Hello world!")
>>>
>>> # And replace the text with an image:
>>> my_placeholder.image(my_image_bytes)
"""
# The protobuf needs something to be set
element.empty.unused = True
@_with_element
def map(self, element, data=None, zoom=None, use_container_width=True):
"""Display a map with points on it.
This is a wrapper around st.pydeck_chart to quickly create scatterplot
charts on top of a map, with auto-centering and auto-zoom.
When using this command, we advise all users to use a personal Mapbox
token. This ensures the map tiles used in this chart are more
robust. You can do this with the mapbox.token config option.
To get a token for yourself, create an account at
https://mapbox.com. It's free! (for moderate usage levels) See
https://docs.streamlit.io/en/latest/cli.html#view-all-config-options for more
info on how to set config options.
Parameters
----------
data : pandas.DataFrame, pandas.Styler, numpy.ndarray, Iterable, dict,
or None
The data to be plotted. Must have columns called 'lat', 'lon',
'latitude', or 'longitude'.
zoom : int
Zoom level as specified in
https://wiki.openstreetmap.org/wiki/Zoom_levels
Example
-------
>>> import pandas as pd
>>> import numpy as np
>>>
>>> df = pd.DataFrame(
... np.random.randn(1000, 2) / [50, 50] + [37.76, -122.4],
... columns=['lat', 'lon'])
>>>
>>> st.map(df)
.. output::
https://share.streamlit.io/0.53.0-SULT/index.html?id=9gTiomqPEbvHY2huTLoQtH
height: 600px
"""
import streamlit.elements.map as streamlit_map
element.deck_gl_json_chart.json = streamlit_map.to_deckgl_json(data, zoom)
element.deck_gl_json_chart.use_container_width = use_container_width
@_with_element
def deck_gl_chart(self, element, spec=None, use_container_width=False, **kwargs):
"""Draw a map chart using the Deck.GL library.
This API closely follows Deck.GL's JavaScript API
(https://deck.gl/#/documentation), with a few small adaptations and
some syntax sugar.
When using this command, we advise all users to use a personal Mapbox
token. This ensures the map tiles used in this chart are more
robust. You can do this with the mapbox.token config option.
To get a token for yourself, create an account at
https://mapbox.com. It's free! (for moderate usage levels) See
https://docs.streamlit.io/en/latest/cli.html#view-all-config-options for more
info on how to set config options.
Parameters
----------
spec : dict
Keys in this dict can be:
- Anything accepted by Deck.GL's top level element, such as
"viewport", "height", "width".
- "layers": a list of dicts containing information to build a new
Deck.GL layer in the map. Each layer accepts the following keys:
- "data" : DataFrame
The data for the current layer.
- "type" : str
One of the Deck.GL layer types that are currently supported
by Streamlit: ArcLayer, GridLayer, HexagonLayer, LineLayer,
PointCloudLayer, ScatterplotLayer, ScreenGridLayer,
TextLayer.
- Plus anything accepted by that layer type. The exact keys that
are accepted depend on the "type" field, above. For example, for
ScatterplotLayer you can set fields like "opacity", "filled",
"stroked", and so on.
In addition, Deck.GL"s documentation for ScatterplotLayer
shows you can use a "getRadius" field to individually set
the radius of each circle in the plot. So here you would
set "getRadius": "my_column" where "my_column" is the name
of the column containing the radius data.
For things like "getPosition", which expect an array rather
than a scalar value, we provide alternates that make the
API simpler to use with dataframes:
- Instead of "getPosition" : use "getLatitude" and
"getLongitude".
- Instead of "getSourcePosition" : use "getLatitude" and
"getLongitude".
- Instead of "getTargetPosition" : use "getTargetLatitude"
and "getTargetLongitude".
- Instead of "getColor" : use "getColorR", "getColorG",
"getColorB", and (optionally) "getColorA", for red,
green, blue and alpha.
- Instead of "getSourceColor" : use the same as above.
- Instead of "getTargetColor" : use "getTargetColorR", etc.
use_container_width : bool
If True, set the chart width to the column width. This takes
precedence over the figure's native `width` value.
**kwargs : any
Same as spec, but as keywords. Keys are "unflattened" at the
underscore characters. For example, foo_bar_baz=123 becomes
foo={'bar': {'bar': 123}}.
Example
-------
>>> st.deck_gl_chart(
... viewport={
... 'latitude': 37.76,
... 'longitude': -122.4,
... 'zoom': 11,
... 'pitch': 50,
... },
... layers=[{
... 'type': 'HexagonLayer',
... 'data': df,
... 'radius': 200,
... 'elevationScale': 4,
... 'elevationRange': [0, 1000],
... 'pickable': True,
... 'extruded': True,
... }, {
... 'type': 'ScatterplotLayer',
... 'data': df,
... }])
...
.. output::
https://share.streamlit.io/0.50.0-td2L/index.html?id=3GfRygWqxuqB5UitZLjz9i
height: 530px
"""
suppress_deprecation_warning = config.get_option(
"global.suppressDeprecationWarnings"
)
if not suppress_deprecation_warning:
import streamlit as st
st.warning(
"""
The `deck_gl_chart` widget is deprecated and will be removed on
2020-05-01. To render a map, you should use `st.pydeck_chart` widget.
"""
)
import streamlit.elements.deck_gl as deck_gl
deck_gl.marshall(element.deck_gl_chart, spec, use_container_width, **kwargs)
@_with_element
def pydeck_chart(self, element, pydeck_obj=None, use_container_width=False):
"""Draw a chart using the PyDeck library.
This supports 3D maps, point clouds, and more! More info about PyDeck
at https://deckgl.readthedocs.io/en/latest/.
These docs are also quite useful:
- DeckGL docs: https://github.com/uber/deck.gl/tree/master/docs
- DeckGL JSON docs: https://github.com/uber/deck.gl/tree/master/modules/json
When using this command, we advise all users to use a personal Mapbox
token. This ensures the map tiles used in this chart are more
robust. You can do this with the mapbox.token config option.
To get a token for yourself, create an account at
https://mapbox.com. It's free! (for moderate usage levels) See
https://docs.streamlit.io/en/latest/cli.html#view-all-config-options for more
info on how to set config options.
Parameters
----------
spec: pydeck.Deck or None
Object specifying the PyDeck chart to draw.
Example
-------
Here's a chart using a HexagonLayer and a ScatterplotLayer on top of
the light map style:
>>> df = pd.DataFrame(
... np.random.randn(1000, 2) / [50, 50] + [37.76, -122.4],
... columns=['lat', 'lon'])
>>>
>>> st.pydeck_chart(pdk.Deck(
... map_style='mapbox://styles/mapbox/light-v9',
... initial_view_state=pdk.ViewState(
... latitude=37.76,
... longitude=-122.4,
... zoom=11,
... pitch=50,
... ),
... layers=[
... pdk.Layer(
... 'HexagonLayer',
... data=df,
... get_position='[lon, lat]',
... radius=200,
... elevation_scale=4,
... elevation_range=[0, 1000],
... pickable=True,
... extruded=True,
... ),
... pdk.Layer(
... 'ScatterplotLayer',
... data=df,
... get_position='[lon, lat]',
... get_color='[200, 30, 0, 160]',
... get_radius=200,
... ),
... ],
... ))
.. output::
https://share.streamlit.io/0.25.0-2JkNY/index.html?id=ASTdExBpJ1WxbGceneKN1i
height: 530px
"""
import streamlit.elements.deck_gl_json_chart as deck_gl_json_chart
deck_gl_json_chart.marshall(element, pydeck_obj, use_container_width)
@_with_element
def table(self, element, data=None):
"""Display a static table.
This differs from `st.dataframe` in that the table in this case is
static: its entire contents are just laid out directly on the page.
Parameters
----------
data : pandas.DataFrame, pandas.Styler, numpy.ndarray, Iterable, dict,
or None
The table data.
Example
-------
>>> df = pd.DataFrame(
... np.random.randn(10, 5),
... columns=('col %d' % i for i in range(5)))
...
>>> st.table(df)
.. output::
https://share.streamlit.io/0.25.0-2JkNY/index.html?id=KfZvDMprL4JFKXbpjD3fpq
height: 480px
"""
import streamlit.elements.data_frame_proto as data_frame_proto
data_frame_proto.marshall_data_frame(data, element.table)
def add_rows(self, data=None, **kwargs):
"""Concatenate a dataframe to the bottom of the current one.
Parameters
----------
data : pandas.DataFrame, pandas.Styler, numpy.ndarray, Iterable, dict,
or None
Table to concat. Optional.
**kwargs : pandas.DataFrame, numpy.ndarray, Iterable, dict, or None
The named dataset to concat. Optional. You can only pass in 1
dataset (including the one in the data parameter).
Example
-------
>>> df1 = pd.DataFrame(
... np.random.randn(50, 20),
... columns=('col %d' % i for i in range(20)))
...
>>> my_table = st.table(df1)
>>>
>>> df2 = pd.DataFrame(
... np.random.randn(50, 20),
... columns=('col %d' % i for i in range(20)))
...
>>> my_table.add_rows(df2)
>>> # Now the table shown in the Streamlit app contains the data for
>>> # df1 followed by the data for df2.
You can do the same thing with plots. For example, if you want to add
more data to a line chart:
>>> # Assuming df1 and df2 from the example above still exist...
>>> my_chart = st.line_chart(df1)
>>> my_chart.add_rows(df2)
>>> # Now the chart shown in the Streamlit app contains the data for
>>> # df1 followed by the data for df2.
And for plots whose datasets are named, you can pass the data with a
keyword argument where the key is the name:
>>> my_chart = st.vega_lite_chart({
... 'mark': 'line',
... 'encoding': {'x': 'a', 'y': 'b'},
... 'datasets': {
... 'some_fancy_name': df1, # <-- named dataset
... },
... 'data': {'name': 'some_fancy_name'},
... }),
>>> my_chart.add_rows(some_fancy_name=df2) # <-- name used as keyword
"""
if self._container is None or self._cursor is None:
return self
if not self._cursor.is_locked:
raise StreamlitAPIException("Only existing elements can `add_rows`.")
# Accept syntax st.add_rows(df).
if data is not None and len(kwargs) == 0:
name = ""
# Accept syntax st.add_rows(foo=df).
elif len(kwargs) == 1:
name, data = kwargs.popitem()
# Raise error otherwise.
else:
raise StreamlitAPIException(
"Wrong number of arguments to add_rows()."
"Command requires exactly one dataset"
)
# When doing add_rows on an element that does not already have data
# (for example, st.line_chart() without any args), call the original
# st.foo() element with new data instead of doing an add_rows().
if (
self._cursor.props["delta_type"] in DELTAS_TYPES_THAT_MELT_DATAFRAMES
and self._cursor.props["last_index"] is None
):
# IMPORTANT: This assumes delta types and st method names always
# match!
st_method_name = self._cursor.props["delta_type"]
st_method = getattr(self, st_method_name)
st_method(data, **kwargs)
return
data, self._cursor.props["last_index"] = _maybe_melt_data_for_add_rows(
data, self._cursor.props["delta_type"], self._cursor.props["last_index"]
)
msg = ForwardMsg_pb2.ForwardMsg()
msg.metadata.parent_block.container = self._container
msg.metadata.parent_block.path[:] = self._cursor.path
msg.metadata.delta_id = self._cursor.index
import streamlit.elements.data_frame_proto as data_frame_proto
data_frame_proto.marshall_data_frame(data, msg.delta.add_rows.data)
if name:
msg.delta.add_rows.name = name
msg.delta.add_rows.has_name = True
_enqueue_message(msg)
return self
def _maybe_melt_data_for_add_rows(data, delta_type, last_index):
import pandas as pd
import streamlit.elements.data_frame_proto as data_frame_proto
# For some delta types we have to reshape the data structure
# otherwise the input data and the actual data used
# by vega_lite will be different and it will throw an error.
if delta_type in DELTAS_TYPES_THAT_MELT_DATAFRAMES:
if not isinstance(data, pd.DataFrame):
data = type_util.convert_anything_to_df(data)
if type(data.index) is pd.RangeIndex:
old_step = _get_pandas_index_attr(data, "step")
# We have to drop the predefined index
data = data.reset_index(drop=True)
old_stop = _get_pandas_index_attr(data, "stop")
if old_step is None or old_stop is None:
raise StreamlitAPIException(
"'RangeIndex' object has no attribute 'step'"
)
start = last_index + old_step
stop = last_index + old_step + old_stop
data.index = pd.RangeIndex(start=start, stop=stop, step=old_step)
last_index = stop - 1
index_name = data.index.name
if index_name is None:
index_name = "index"
data = pd.melt(data.reset_index(), id_vars=[index_name])
return data, last_index
def _clean_text(text):
return textwrap.dedent(str(text)).strip()
def _value_or_dg(value, dg):
"""Return either value, or None, or dg.
This is needed because Widgets have meaningful return values. This is
unlike other elements, which always return None. Then we internally replace
that None with a DeltaGenerator instance.
However, sometimes a widget may want to return None, and in this case it
should not be replaced by a DeltaGenerator. So we have a special NoValue
object that gets replaced by None.
"""
if value is NoValue:
return None
if value is None:
return dg
return value
def _enqueue_message(msg):
"""Enqueues a ForwardMsg proto to send to the app."""
ctx = get_report_ctx()
if ctx is None:
raise NoSessionContext()
ctx.enqueue(msg)
| lib/streamlit/DeltaGenerator.py | 112,188 | Creator of Delta protobuf messages.
Parameters
----------
container: BlockPath_pb2.BlockPath or None
The root container for this DeltaGenerator. If None, this is a null
DeltaGenerator which doesn't print to the app at all (useful for
testing).
cursor: cursor.AbstractCursor or None
Return this from DeltaGenerator.foo_widget() when you want the st.foo_widget()
call to return None. This is needed because `_enqueue_new_element_delta`
replaces `None` with a `DeltaGenerator` (for use in non-widget elements).
Inserts or updates elements in Streamlit apps.
As a user, you should never initialize this object by hand. Instead,
DeltaGenerator objects are initialized for you in two places:
1) When you call `dg = st.foo()` for some method "foo", sometimes `dg`
is a DeltaGenerator object. You can call methods on the `dg` object to
update the element `foo` that appears in the Streamlit app.
2) This is an internal detail, but `st.sidebar` itself is a
DeltaGenerator. That's why you can call `st.sidebar.foo()` to place
an element `foo` inside the sidebar.
Enqueues a ForwardMsg proto to send to the app.
Create NewElement delta, fill it, and enqueue it.
Parameters
----------
marshall_element : callable
Function which sets the fields for a NewElement protobuf.
element_width : int or None
Desired width for the element
element_height : int or None
Desired height for the element
Returns
-------
DeltaGenerator
A DeltaGenerator that can be used to modify the newly-created
element.
Returns the element's 4-component location as string like "M.(1,2).3".
This function uniquely identifies the element's position in the front-end,
which allows (among other potential uses) the MediaFileManager to maintain
session-specific maps of MediaFile objects placed with their "coordinates".
This way, users can (say) use st.image with a stream of different images,
and Streamlit will expire the older images and replace them in place.
Get the widget ui_value from the report context.
NOTE: This function should be called after the proto has been filled.
Parameters
----------
widget_type : str
The type of the widget as stored in proto.
element : proto
The proto of the element
user_key : str
Optional user-specified string to use as the widget ID.
If this is None, we'll generate an ID by hashing the element.
Returns
-------
ui_value : any
The value of the widget set by the client or
the default value passed. If the report context
doesn't exist, None will be returned.
Set the widget id.
Parameters
----------
widget_type : str
The type of the widget as stored in proto.
element : proto
The proto of the element
user_key : str
Optional user-specified key to use for the widget ID.
If this is None, we'll generate an ID by hashing the element.
Return either value, or None, or dg.
This is needed because Widgets have meaningful return values. This is
unlike other elements, which always return None. Then we internally replace
that None with a DeltaGenerator instance.
However, sometimes a widget may want to return None, and in this case it
should not be replaced by a DeltaGenerator. So we have a special NoValue
object that gets replaced by None.
Wrap function and pass a NewElement proto to be filled.
This is a function decorator.
Converts a method of the with arguments (self, element, ...) into a method
with arguments (self, ...). Thus, the instantiation of the element proto
object and creation of the element are handled automatically.
Parameters
----------
method : callable
A DeltaGenerator method with arguments (self, element, ...)
Returns
-------
callable
A new DeltaGenerator method with arguments (self, ...)
Simplify the function signature by removing arguments from it.
Removes the first N arguments from function signature (where N is
num_args_to_remove). This is useful since function signatures are visible
in our user-facing docs, and many methods in DeltaGenerator have arguments
that users have no access to.
Note that "self" is ignored by default. So to remove both "self" and the
next argument you'd pass num_args_to_remove=1.
Concatenate a dataframe to the bottom of the current one.
Parameters
----------
data : pandas.DataFrame, pandas.Styler, numpy.ndarray, Iterable, dict,
or None
Table to concat. Optional.
**kwargs : pandas.DataFrame, numpy.ndarray, Iterable, dict, or None
The named dataset to concat. Optional. You can only pass in 1
dataset (including the one in the data parameter).
Example
-------
>>> df1 = pd.DataFrame(
... np.random.randn(50, 20),
... columns=('col %d' % i for i in range(20)))
...
>>> my_table = st.table(df1)
>>>
>>> df2 = pd.DataFrame(
... np.random.randn(50, 20),
... columns=('col %d' % i for i in range(20)))
...
>>> my_table.add_rows(df2)
>>> # Now the table shown in the Streamlit app contains the data for
>>> # df1 followed by the data for df2.
You can do the same thing with plots. For example, if you want to add
more data to a line chart:
>>> # Assuming df1 and df2 from the example above still exist...
>>> my_chart = st.line_chart(df1)
>>> my_chart.add_rows(df2)
>>> # Now the chart shown in the Streamlit app contains the data for
>>> # df1 followed by the data for df2.
And for plots whose datasets are named, you can pass the data with a
keyword argument where the key is the name:
>>> my_chart = st.vega_lite_chart({
... 'mark': 'line',
... 'encoding': {'x': 'a', 'y': 'b'},
... 'datasets': {
... 'some_fancy_name': df1, # <-- named dataset
... },
... 'data': {'name': 'some_fancy_name'},
... }),
>>> my_chart.add_rows(some_fancy_name=df2) # <-- name used as keyword
Display a chart using the Altair library.
Parameters
----------
altair_chart : altair.vegalite.v2.api.Chart
The Altair chart object to display.
width : number
Deprecated. If != 0 (default), will show an alert.
From now on you should set the width directly in the Altair
spec. Please refer to the Altair documentation for details.
use_container_width : bool
If True, set the chart width to the column width. This takes
precedence over Altair's native `width` value.
Example
-------
>>> import pandas as pd
>>> import numpy as np
>>> import altair as alt
>>>
>>> df = pd.DataFrame(
... np.random.randn(200, 3),
... columns=['a', 'b', 'c'])
...
>>> c = alt.Chart(df).mark_circle().encode(
... x='a', y='b', size='c', color='c', tooltip=['a', 'b', 'c'])
>>>
>>> st.altair_chart(c, use_container_width=True)
.. output::
https://share.streamlit.io/0.25.0-2JkNY/index.html?id=8jmmXR8iKoZGV4kXaKGYV5
height: 200px
Examples of Altair charts can be found at
https://altair-viz.github.io/gallery/.
Display a area chart.
This is just syntax-sugar around st.altair_chart. The main difference
is this command uses the data's own column and indices to figure out
the chart's spec. As a result this is easier to use for many "just plot
this" scenarios, while being less customizable.
Parameters
----------
data : pandas.DataFrame, pandas.Styler, numpy.ndarray, Iterable, or dict
Data to be plotted.
width : int
The chart width in pixels. If 0, selects the width automatically.
height : int
The chart width in pixels. If 0, selects the height automatically.
use_container_width : bool
If True, set the chart width to the column width. This takes
precedence over the width argument.
Example
-------
>>> chart_data = pd.DataFrame(
... np.random.randn(20, 3),
... columns=['a', 'b', 'c'])
...
>>> st.area_chart(chart_data)
.. output::
https://share.streamlit.io/0.50.0-td2L/index.html?id=Pp65STuFj65cJRDfhGh4Jt
height: 220px
Display an audio player.
Parameters
----------
data : str, bytes, BytesIO, numpy.ndarray, or file opened with
io.open().
Raw audio data, filename, or a URL pointing to the file to load.
Numpy arrays and raw data formats must include all necessary file
headers to match specified file format.
start_time: int
The time from which this element should start playing.
format : str
The mime type for the audio file. Defaults to 'audio/wav'.
See https://tools.ietf.org/html/rfc4281 for more info.
Example
-------
>>> audio_file = open('myaudio.ogg', 'rb')
>>> audio_bytes = audio_file.read()
>>>
>>> st.audio(audio_bytes, format='audio/ogg')
.. output::
https://share.streamlit.io/0.25.0-2JkNY/index.html?id=Dv3M9sA7Cg8gwusgnVNTHb
height: 400px
Draw celebratory balloons.
Example
-------
>>> st.balloons()
...then watch your app and get ready for a celebration!
Display a bar chart.
This is just syntax-sugar around st.altair_chart. The main difference
is this command uses the data's own column and indices to figure out
the chart's spec. As a result this is easier to use for many "just plot
this" scenarios, while being less customizable.
Parameters
----------
data : pandas.DataFrame, pandas.Styler, numpy.ndarray, Iterable, or dict
Data to be plotted.
width : int
The chart width in pixels. If 0, selects the width automatically.
height : int
The chart width in pixels. If 0, selects the height automatically.
use_container_width : bool
If True, set the chart width to the column width. This takes
precedence over the width argument.
Example
-------
>>> chart_data = pd.DataFrame(
... np.random.randn(50, 3),
... columns=["a", "b", "c"])
...
>>> st.bar_chart(chart_data)
.. output::
https://share.streamlit.io/0.50.0-td2L/index.html?id=5U5bjR2b3jFwnJdDfSvuRk
height: 220px
Display a color picker widget.
Note: This is a beta feature. See
https://docs.streamlit.io/en/latest/pre_release_features.html for more
information.
Parameters
----------
label : str
A short label explaining to the user what this input is for.
value : str or None
The hex value of this widget when it first renders. If None,
defaults to black.
key : str
An optional string to use as the unique key for the widget.
If this is omitted, a key will be generated for the widget
based on its content. Multiple widgets of the same type may
not share the same key.
Returns
-------
str
The selected color as a hex string.
Example
-------
>>> color = st.beta_color_picker('Pick A Color', '#00f900')
>>> st.write('The current color is', color)
Display an interactive Bokeh chart.
Bokeh is a charting library for Python. The arguments to this function
closely follow the ones for Bokeh's `show` function. You can find
more about Bokeh at https://bokeh.pydata.org.
Parameters
----------
figure : bokeh.plotting.figure.Figure
A Bokeh figure to plot.
use_container_width : bool
If True, set the chart width to the column width. This takes
precedence over Bokeh's native `width` value.
To show Bokeh charts in Streamlit, just call `st.bokeh_chart`
wherever you would call Bokeh's `show`.
Example
-------
>>> import streamlit as st
>>> from bokeh.plotting import figure
>>>
>>> x = [1, 2, 3, 4, 5]
>>> y = [6, 7, 2, 4, 5]
>>>
>>> p = figure(
... title='simple line example',
... x_axis_label='x',
... y_axis_label='y')
...
>>> p.line(x, y, legend='Trend', line_width=2)
>>>
>>> st.bokeh_chart(p, use_container_width=True)
.. output::
https://share.streamlit.io/0.56.0-xTAd/index.html?id=Fdhg51uMbGMLRRxXV6ubzp
height: 600px
Display a button widget.
Parameters
----------
label : str
A short label explaining to the user what this button is for.
key : str
An optional string to use as the unique key for the widget.
If this is omitted, a key will be generated for the widget
based on its content. Multiple widgets of the same type may
not share the same key.
Returns
-------
bool
If the button was clicked on the last run of the app.
Example
-------
>>> if st.button('Say hello'):
... st.write('Why hello there')
... else:
... st.write('Goodbye')
Display a checkbox widget.
Parameters
----------
label : str
A short label explaining to the user what this checkbox is for.
value : bool
Preselect the checkbox when it first renders. This will be
cast to bool internally.
key : str
An optional string to use as the unique key for the widget.
If this is omitted, a key will be generated for the widget
based on its content. Multiple widgets of the same type may
not share the same key.
Returns
-------
bool
Whether or not the checkbox is checked.
Example
-------
>>> agree = st.checkbox('I agree')
>>>
>>> if agree:
... st.write('Great!')
Display a code block with optional syntax highlighting.
(This is a convenience wrapper around `st.markdown()`)
Parameters
----------
body : str
The string to display as code.
language : str
The language that the code is written in, for syntax highlighting.
If omitted, the code will be unstyled.
Example
-------
>>> code = '''def hello():
... print("Hello, Streamlit!")'''
>>> st.code(code, language='python')
.. output::
https://share.streamlit.io/0.27.0-kBtt/index.html?id=VDRnaCEZWSBCNUd5gNQZv2
height: 100px
Display a dataframe as an interactive table.
Parameters
----------
data : pandas.DataFrame, pandas.Styler, numpy.ndarray, Iterable, dict,
or None
The data to display.
If 'data' is a pandas.Styler, it will be used to style its
underyling DataFrame. Streamlit supports custom cell
values and colors. (It does not support some of the more exotic
pandas styling features, like bar charts, hovering, and captions.)
Styler support is experimental!
width : int or None
Desired width of the UI element expressed in pixels. If None, a
default width based on the page width is used.
height : int or None
Desired height of the UI element expressed in pixels. If None, a
default height is used.
Examples
--------
>>> df = pd.DataFrame(
... np.random.randn(50, 20),
... columns=('col %d' % i for i in range(20)))
...
>>> st.dataframe(df) # Same as st.write(df)
.. output::
https://share.streamlit.io/0.25.0-2JkNY/index.html?id=165mJbzWdAC8Duf8a4tjyQ
height: 330px
>>> st.dataframe(df, 200, 100)
You can also pass a Pandas Styler object to change the style of
the rendered DataFrame:
>>> df = pd.DataFrame(
... np.random.randn(10, 20),
... columns=('col %d' % i for i in range(20)))
...
>>> st.dataframe(df.style.highlight_max(axis=0))
.. output::
https://share.streamlit.io/0.29.0-dV1Y/index.html?id=Hb6UymSNuZDzojUNybzPby
height: 285px
Display a date input widget.
Parameters
----------
label : str
A short label explaining to the user what this date input is for.
value : datetime.date or datetime.datetime or list/tuple of datetime.date or datetime.datetime or None
The value of this widget when it first renders. If a list/tuple with
0 to 2 date/datetime values is provided, the datepicker will allow
users to provide a range. Defaults to today as a single-date picker.
min_value : datetime.date or datetime.datetime
The minimum selectable date. Defaults to datetime.min.
max_value : datetime.date or datetime.datetime
The maximum selectable date. Defaults to today+10y.
key : str
An optional string to use as the unique key for the widget.
If this is omitted, a key will be generated for the widget
based on its content. Multiple widgets of the same type may
not share the same key.
Returns
-------
datetime.date
The current value of the date input widget.
Example
-------
>>> d = st.date_input(
... "When's your birthday",
... datetime.date(2019, 7, 6))
>>> st.write('Your birthday is:', d)
Draw a map chart using the Deck.GL library.
This API closely follows Deck.GL's JavaScript API
(https://deck.gl/#/documentation), with a few small adaptations and
some syntax sugar.
When using this command, we advise all users to use a personal Mapbox
token. This ensures the map tiles used in this chart are more
robust. You can do this with the mapbox.token config option.
To get a token for yourself, create an account at
https://mapbox.com. It's free! (for moderate usage levels) See
https://docs.streamlit.io/en/latest/cli.html#view-all-config-options for more
info on how to set config options.
Parameters
----------
spec : dict
Keys in this dict can be:
- Anything accepted by Deck.GL's top level element, such as
"viewport", "height", "width".
- "layers": a list of dicts containing information to build a new
Deck.GL layer in the map. Each layer accepts the following keys:
- "data" : DataFrame
The data for the current layer.
- "type" : str
One of the Deck.GL layer types that are currently supported
by Streamlit: ArcLayer, GridLayer, HexagonLayer, LineLayer,
PointCloudLayer, ScatterplotLayer, ScreenGridLayer,
TextLayer.
- Plus anything accepted by that layer type. The exact keys that
are accepted depend on the "type" field, above. For example, for
ScatterplotLayer you can set fields like "opacity", "filled",
"stroked", and so on.
In addition, Deck.GL"s documentation for ScatterplotLayer
shows you can use a "getRadius" field to individually set
the radius of each circle in the plot. So here you would
set "getRadius": "my_column" where "my_column" is the name
of the column containing the radius data.
For things like "getPosition", which expect an array rather
than a scalar value, we provide alternates that make the
API simpler to use with dataframes:
- Instead of "getPosition" : use "getLatitude" and
"getLongitude".
- Instead of "getSourcePosition" : use "getLatitude" and
"getLongitude".
- Instead of "getTargetPosition" : use "getTargetLatitude"
and "getTargetLongitude".
- Instead of "getColor" : use "getColorR", "getColorG",
"getColorB", and (optionally) "getColorA", for red,
green, blue and alpha.
- Instead of "getSourceColor" : use the same as above.
- Instead of "getTargetColor" : use "getTargetColorR", etc.
use_container_width : bool
If True, set the chart width to the column width. This takes
precedence over the figure's native `width` value.
**kwargs : any
Same as spec, but as keywords. Keys are "unflattened" at the
underscore characters. For example, foo_bar_baz=123 becomes
foo={'bar': {'bar': 123}}.
Example
-------
>>> st.deck_gl_chart(
... viewport={
... 'latitude': 37.76,
... 'longitude': -122.4,
... 'zoom': 11,
... 'pitch': 50,
... },
... layers=[{
... 'type': 'HexagonLayer',
... 'data': df,
... 'radius': 200,
... 'elevationScale': 4,
... 'elevationRange': [0, 1000],
... 'pickable': True,
... 'extruded': True,
... }, {
... 'type': 'ScatterplotLayer',
... 'data': df,
... }])
...
.. output::
https://share.streamlit.io/0.50.0-td2L/index.html?id=3GfRygWqxuqB5UitZLjz9i
height: 530px
Add a placeholder to the app.
The placeholder can be filled any time by calling methods on the return
value.
Example
-------
>>> my_placeholder = st.empty()
>>>
>>> # Now replace the placeholder with some text:
>>> my_placeholder.text("Hello world!")
>>>
>>> # And replace the text with an image:
>>> my_placeholder.image(my_image_bytes)
Display error message.
Parameters
----------
body : str
The error text to display.
Example
-------
>>> st.error('This is an error')
Display an exception.
Parameters
----------
exception : Exception
The exception to display.
Example
-------
>>> e = RuntimeError('This is an exception of type RuntimeError')
>>> st.exception(e)
Display a file uploader widget.
By default, uploaded files are limited to 200MB. You can configure
this using the `server.maxUploadSize` config option.
Parameters
----------
label : str or None
A short label explaining to the user what this file uploader is for.
type : str or list of str or None
Array of allowed extensions. ['png', 'jpg']
By default, all extensions are allowed.
encoding : str or None
The encoding to use when opening textual files (i.e. non-binary).
For example: 'utf-8'. If set to 'auto', will try to guess the
encoding. If None, will assume the file is binary.
key : str
An optional string to use as the unique key for the widget.
If this is omitted, a key will be generated for the widget
based on its content. Multiple widgets of the same type may
not share the same key.
Returns
-------
BytesIO or StringIO or or list of BytesIO/StringIO or None
If no file has been uploaded, returns None. Otherwise, returns
the data for the uploaded file(s):
- If the file is in a well-known textual format (or if the encoding
parameter is set), the file data is a StringIO.
- Otherwise the file data is BytesIO.
- If multiple_files is True, a list of file data will be returned.
Note that BytesIO/StringIO are "file-like", which means you can
pass them anywhere where a file is expected!
Examples
--------
>>> uploaded_file = st.file_uploader("Choose a CSV file", type="csv")
>>> if uploaded_file is not None:
... data = pd.read_csv(uploaded_file)
... st.write(data)
Display a graph using the dagre-d3 library.
Parameters
----------
figure_or_dot : graphviz.dot.Graph, graphviz.dot.Digraph, str
The Graphlib graph object or dot string to display
width : number
Deprecated. If != 0 (default), will show an alert.
From now on you should set the width directly in the Graphviz
spec. Please refer to the Graphviz documentation for details.
height : number
Deprecated. If != 0 (default), will show an alert.
From now on you should set the height directly in the Graphviz
spec. Please refer to the Graphviz documentation for details.
use_container_width : bool
If True, set the chart width to the column width. This takes
precedence over the figure's native `width` value.
Example
-------
>>> import streamlit as st
>>> import graphviz as graphviz
>>>
>>> # Create a graphlib graph object
>>> graph = graphviz.Digraph()
>>> graph.edge('run', 'intr')
>>> graph.edge('intr', 'runbl')
>>> graph.edge('runbl', 'run')
>>> graph.edge('run', 'kernel')
>>> graph.edge('kernel', 'zombie')
>>> graph.edge('kernel', 'sleep')
>>> graph.edge('kernel', 'runmem')
>>> graph.edge('sleep', 'swap')
>>> graph.edge('swap', 'runswap')
>>> graph.edge('runswap', 'new')
>>> graph.edge('runswap', 'runmem')
>>> graph.edge('new', 'runmem')
>>> graph.edge('sleep', 'runmem')
>>>
>>> st.graphviz_chart(graph)
Or you can render the chart from the graph using GraphViz's Dot
language:
>>> st.graphviz_chart('''
digraph {
run -> intr
intr -> runbl
runbl -> run
run -> kernel
kernel -> zombie
kernel -> sleep
kernel -> runmem
sleep -> swap
swap -> runswap
runswap -> new
runswap -> runmem
new -> runmem
sleep -> runmem
}
''')
.. output::
https://share.streamlit.io/0.56.0-xTAd/index.html?id=GBn3GXZie5K1kXuBKe4yQL
height: 400px
Display text in header formatting.
Parameters
----------
body : str
The text to display.
Example
-------
>>> st.header('This is a header')
.. output::
https://share.streamlit.io/0.25.0-2JkNY/index.html?id=AnfQVFgSCQtGv6yMUMUYjj
height: 100px
Display object's doc string, nicely formatted.
Displays the doc string for this object.
Parameters
----------
obj : Object
The object whose docstring should be displayed.
Example
-------
Don't remember how to initialize a dataframe? Try this:
>>> st.help(pandas.DataFrame)
Want to quickly check what datatype is output by a certain function?
Try:
>>> x = my_poorly_documented_function()
>>> st.help(x)
Display an image or list of images.
Parameters
----------
image : numpy.ndarray, [numpy.ndarray], BytesIO, str, or [str]
Monochrome image of shape (w,h) or (w,h,1)
OR a color image of shape (w,h,3)
OR an RGBA image of shape (w,h,4)
OR a URL to fetch the image from
OR a list of one of the above, to display multiple images.
caption : str or list of str
Image caption. If displaying multiple images, caption should be a
list of captions (one for each image).
width : int or None
Image width. None means use the image width.
use_column_width : bool
If True, set the image width to the column width. This takes
precedence over the `width` parameter.
clamp : bool
Clamp image pixel values to a valid range ([0-255] per channel).
This is only meaningful for byte array images; the parameter is
ignored for image URLs. If this is not set, and an image has an
out-of-range value, an error will be thrown.
channels : 'RGB' or 'BGR'
If image is an nd.array, this parameter denotes the format used to
represent color information. Defaults to 'RGB', meaning
`image[:, :, 0]` is the red channel, `image[:, :, 1]` is green, and
`image[:, :, 2]` is blue. For images coming from libraries like
OpenCV you should set this to 'BGR', instead.
format : 'JPEG' or 'PNG'
This parameter specifies the image format to use when transferring
the image data. Defaults to 'JPEG'.
Example
-------
>>> from PIL import Image
>>> image = Image.open('sunrise.jpg')
>>>
>>> st.image(image, caption='Sunrise by the mountains',
... use_column_width=True)
.. output::
https://share.streamlit.io/0.25.0-2JkNY/index.html?id=YCFaqPgmgpEz7jwE4tHAzY
height: 630px
Display an informational message.
Parameters
----------
body : str
The info text to display.
Example
-------
>>> st.info('This is a purely informational message')
Display object or string as a pretty-printed JSON string.
Parameters
----------
body : Object or str
The object to print as JSON. All referenced objects should be
serializable to JSON as well. If object is a string, we assume it
contains serialized JSON.
Example
-------
>>> st.json({
... 'foo': 'bar',
... 'baz': 'boz',
... 'stuff': [
... 'stuff 1',
... 'stuff 2',
... 'stuff 3',
... 'stuff 5',
... ],
... })
.. output::
https://share.streamlit.io/0.25.0-2JkNY/index.html?id=CTFkMQd89hw3yZbZ4AUymS
height: 280px
Display mathematical expressions formatted as LaTeX.
Supported LaTeX functions are listed at
https://katex.org/docs/supported.html.
Parameters
----------
body : str or SymPy expression
The string or SymPy expression to display as LaTeX. If str, it's
a good idea to use raw Python strings since LaTeX uses backslashes
a lot.
Example
-------
>>> st.latex(r'''
... a + ar + a r^2 + a r^3 + \cdots + a r^{n-1} =
... \sum_{k=0}^{n-1} ar^k =
... a \left(\frac{1-r^{n}}{1-r}\right)
... ''')
.. output::
https://share.streamlit.io/0.50.0-td2L/index.html?id=NJFsy6NbGTsH2RF9W6ioQ4
height: 75px
Display a line chart.
This is just syntax-sugar around st.altair_chart. The main difference
is this command uses the data's own column and indices to figure out
the chart's spec. As a result this is easier to use for many "just plot
this" scenarios, while being less customizable.
Parameters
----------
data : pandas.DataFrame, pandas.Styler, numpy.ndarray, Iterable, dict
or None
Data to be plotted.
width : int
The chart width in pixels. If 0, selects the width automatically.
height : int
The chart width in pixels. If 0, selects the height automatically.
use_container_width : bool
If True, set the chart width to the column width. This takes
precedence over the width argument.
Example
-------
>>> chart_data = pd.DataFrame(
... np.random.randn(20, 3),
... columns=['a', 'b', 'c'])
...
>>> st.line_chart(chart_data)
.. output::
https://share.streamlit.io/0.50.0-td2L/index.html?id=BdxXG3MmrVBfJyqS2R2ki8
height: 220px
Display a map with points on it.
This is a wrapper around st.pydeck_chart to quickly create scatterplot
charts on top of a map, with auto-centering and auto-zoom.
When using this command, we advise all users to use a personal Mapbox
token. This ensures the map tiles used in this chart are more
robust. You can do this with the mapbox.token config option.
To get a token for yourself, create an account at
https://mapbox.com. It's free! (for moderate usage levels) See
https://docs.streamlit.io/en/latest/cli.html#view-all-config-options for more
info on how to set config options.
Parameters
----------
data : pandas.DataFrame, pandas.Styler, numpy.ndarray, Iterable, dict,
or None
The data to be plotted. Must have columns called 'lat', 'lon',
'latitude', or 'longitude'.
zoom : int
Zoom level as specified in
https://wiki.openstreetmap.org/wiki/Zoom_levels
Example
-------
>>> import pandas as pd
>>> import numpy as np
>>>
>>> df = pd.DataFrame(
... np.random.randn(1000, 2) / [50, 50] + [37.76, -122.4],
... columns=['lat', 'lon'])
>>>
>>> st.map(df)
.. output::
https://share.streamlit.io/0.53.0-SULT/index.html?id=9gTiomqPEbvHY2huTLoQtH
height: 600px
Display string formatted as Markdown.
Parameters
----------
body : str
The string to display as Github-flavored Markdown. Syntax
information can be found at: https://github.github.com/gfm.
This also supports:
* Emoji shortcodes, such as `:+1:` and `:sunglasses:`.
For a list of all supported codes,
see https://raw.githubusercontent.com/omnidan/node-emoji/master/lib/emoji.json.
* LaTeX expressions, by just wrapping them in "$" or "$$" (the "$$"
must be on their own lines). Supported LaTeX functions are listed
at https://katex.org/docs/supported.html.
unsafe_allow_html : bool
By default, any HTML tags found in the body will be escaped and
therefore treated as pure text. This behavior may be turned off by
setting this argument to True.
That said, we *strongly advise against it*. It is hard to write
secure HTML, so by using this argument you may be compromising your
users' security. For more information, see:
https://github.com/streamlit/streamlit/issues/152
*Also note that `unsafe_allow_html` is a temporary measure and may
be removed from Streamlit at any time.*
If you decide to turn on HTML anyway, we ask you to please tell us
your exact use case here:
https://discuss.streamlit.io/t/96
This will help us come up with safe APIs that allow you to do what
you want.
Example
-------
>>> st.markdown('Streamlit is **_really_ cool**.')
.. output::
https://share.streamlit.io/0.25.0-2JkNY/index.html?id=PXz9xgY8aB88eziDVEZLyS
height: 50px
Display a multiselect widget.
The multiselect widget starts as empty.
Parameters
----------
label : str
A short label explaining to the user what this select widget is for.
options : list, tuple, numpy.ndarray, or pandas.Series
Labels for the select options. This will be cast to str internally
by default.
default: [str] or None
List of default values.
format_func : function
Function to modify the display of selectbox options. It receives
the raw option as an argument and should output the label to be
shown for that option. This has no impact on the return value of
the selectbox.
key : str
An optional string to use as the unique key for the widget.
If this is omitted, a key will be generated for the widget
based on its content. Multiple widgets of the same type may
not share the same key.
Returns
-------
[str]
A list with the selected options
Example
-------
>>> options = st.multiselect(
... 'What are your favorite colors',
... ['Green', 'Yellow', 'Red', 'Blue'],
... ['Yellow', 'Red'])
>>>
>>> st.write('You selected:', options)
.. note::
User experience can be degraded for large lists of `options` (100+), as this widget
is not designed to handle arbitrary text search efficiently. See this
`thread <https://discuss.streamlit.io/t/streamlit-loading-column-data-takes-too-much-time/1791>`_
on the Streamlit community forum for more information and
`GitHub issue #1059 <https://github.com/streamlit/streamlit/issues/1059>`_ for updates on the issue.
Display a numeric input widget.
Parameters
----------
label : str or None
A short label explaining to the user what this input is for.
min_value : int or float or None
The minimum permitted value.
If None, there will be no minimum.
max_value : int or float or None
The maximum permitted value.
If None, there will be no maximum.
value : int or float or None
The value of this widget when it first renders.
Defaults to min_value, or 0.0 if min_value is None
step : int or float or None
The stepping interval.
Defaults to 1 if the value is an int, 0.01 otherwise.
If the value is not specified, the format parameter will be used.
format : str or None
A printf-style format string controlling how the interface should
display numbers. Output must be purely numeric. This does not impact
the return value. Valid formatters: %d %e %f %g %i
key : str
An optional string to use as the unique key for the widget.
If this is omitted, a key will be generated for the widget
based on its content. Multiple widgets of the same type may
not share the same key.
Returns
-------
int or float
The current value of the numeric input widget. The return type
will match the data type of the value parameter.
Example
-------
>>> number = st.number_input('Insert a number')
>>> st.write('The current number is ', number)
Display an interactive Plotly chart.
Plotly is a charting library for Python. The arguments to this function
closely follow the ones for Plotly's `plot()` function. You can find
more about Plotly at https://plot.ly/python.
Parameters
----------
figure_or_data : plotly.graph_objs.Figure, plotly.graph_objs.Data,
dict/list of plotly.graph_objs.Figure/Data, or
matplotlib.figure.Figure
See https://plot.ly/python/ for examples of graph descriptions.
If a Matplotlib Figure, converts it to a Plotly figure and displays
it.
width : int
Deprecated. If != 0 (default), will show an alert.
From now on you should set the width directly in the figure.
Please refer to the Plotly documentation for details.
height : int
Deprecated. If != 0 (default), will show an alert.
From now on you should set the height directly in the figure.
Please refer to the Plotly documentation for details.
use_container_width : bool
If True, set the chart width to the column width. This takes
precedence over the figure's native `width` value.
sharing : {'streamlit', 'private', 'secret', 'public'}
Use 'streamlit' to insert the plot and all its dependencies
directly in the Streamlit app, which means it works offline too.
This is the default.
Use any other sharing mode to send the app to Plotly's servers,
and embed the result into the Streamlit app. See
https://plot.ly/python/privacy/ for more. Note that these sharing
modes require a Plotly account.
**kwargs
Any argument accepted by Plotly's `plot()` function.
To show Plotly charts in Streamlit, just call `st.plotly_chart`
wherever you would call Plotly's `py.plot` or `py.iplot`.
Example
-------
The example below comes straight from the examples at
https://plot.ly/python:
>>> import streamlit as st
>>> import plotly.figure_factory as ff
>>> import numpy as np
>>>
>>> # Add histogram data
>>> x1 = np.random.randn(200) - 2
>>> x2 = np.random.randn(200)
>>> x3 = np.random.randn(200) + 2
>>>
>>> # Group data together
>>> hist_data = [x1, x2, x3]
>>>
>>> group_labels = ['Group 1', 'Group 2', 'Group 3']
>>>
>>> # Create distplot with custom bin_size
>>> fig = ff.create_distplot(
... hist_data, group_labels, bin_size=[.1, .25, .5])
>>>
>>> # Plot!
>>> st.plotly_chart(fig, use_container_width=True)
.. output::
https://share.streamlit.io/0.56.0-xTAd/index.html?id=TuP96xX8JnsoQeUGAPjkGQ
height: 400px
Display a progress bar.
Parameters
----------
value : int or float
0 <= value <= 100 for int
0.0 <= value <= 1.0 for float
Example
-------
Here is an example of a progress bar increasing over time:
>>> import time
>>>
>>> my_bar = st.progress(0)
>>>
>>> for percent_complete in range(100):
... time.sleep(0.1)
... my_bar.progress(percent_complete + 1)
Draw a chart using the PyDeck library.
This supports 3D maps, point clouds, and more! More info about PyDeck
at https://deckgl.readthedocs.io/en/latest/.
These docs are also quite useful:
- DeckGL docs: https://github.com/uber/deck.gl/tree/master/docs
- DeckGL JSON docs: https://github.com/uber/deck.gl/tree/master/modules/json
When using this command, we advise all users to use a personal Mapbox
token. This ensures the map tiles used in this chart are more
robust. You can do this with the mapbox.token config option.
To get a token for yourself, create an account at
https://mapbox.com. It's free! (for moderate usage levels) See
https://docs.streamlit.io/en/latest/cli.html#view-all-config-options for more
info on how to set config options.
Parameters
----------
spec: pydeck.Deck or None
Object specifying the PyDeck chart to draw.
Example
-------
Here's a chart using a HexagonLayer and a ScatterplotLayer on top of
the light map style:
>>> df = pd.DataFrame(
... np.random.randn(1000, 2) / [50, 50] + [37.76, -122.4],
... columns=['lat', 'lon'])
>>>
>>> st.pydeck_chart(pdk.Deck(
... map_style='mapbox://styles/mapbox/light-v9',
... initial_view_state=pdk.ViewState(
... latitude=37.76,
... longitude=-122.4,
... zoom=11,
... pitch=50,
... ),
... layers=[
... pdk.Layer(
... 'HexagonLayer',
... data=df,
... get_position='[lon, lat]',
... radius=200,
... elevation_scale=4,
... elevation_range=[0, 1000],
... pickable=True,
... extruded=True,
... ),
... pdk.Layer(
... 'ScatterplotLayer',
... data=df,
... get_position='[lon, lat]',
... get_color='[200, 30, 0, 160]',
... get_radius=200,
... ),
... ],
... ))
.. output::
https://share.streamlit.io/0.25.0-2JkNY/index.html?id=ASTdExBpJ1WxbGceneKN1i
height: 530px
Display a matplotlib.pyplot figure.
Parameters
----------
fig : Matplotlib Figure
The figure to plot. When this argument isn't specified, which is
the usual case, this function will render the global plot.
clear_figure : bool
If True, the figure will be cleared after being rendered.
If False, the figure will not be cleared after being rendered.
If left unspecified, we pick a default based on the value of `fig`.
* If `fig` is set, defaults to `False`.
* If `fig` is not set, defaults to `True`. This simulates Jupyter's
approach to matplotlib rendering.
**kwargs : any
Arguments to pass to Matplotlib's savefig function.
Example
-------
>>> import matplotlib.pyplot as plt
>>> import numpy as np
>>>
>>> arr = np.random.normal(1, 1, size=100)
>>> plt.hist(arr, bins=20)
>>>
>>> st.pyplot()
.. output::
https://share.streamlit.io/0.25.0-2JkNY/index.html?id=PwzFN7oLZsvb6HDdwdjkRB
height: 530px
Notes
-----
Matplotlib support several different types of "backends". If you're
getting an error using Matplotlib with Streamlit, try setting your
backend to "TkAgg"::
echo "backend: TkAgg" >> ~/.matplotlib/matplotlibrc
For more information, see https://matplotlib.org/faq/usage_faq.html.
Display a radio button widget.
Parameters
----------
label : str
A short label explaining to the user what this radio group is for.
options : list, tuple, numpy.ndarray, or pandas.Series
Labels for the radio options. This will be cast to str internally
by default.
index : int
The index of the preselected option on first render.
format_func : function
Function to modify the display of radio options. It receives
the raw option as an argument and should output the label to be
shown for that option. This has no impact on the return value of
the radio.
key : str
An optional string to use as the unique key for the widget.
If this is omitted, a key will be generated for the widget
based on its content. Multiple widgets of the same type may
not share the same key.
Returns
-------
any
The selected option.
Example
-------
>>> genre = st.radio(
... "What's your favorite movie genre",
... ('Comedy', 'Drama', 'Documentary'))
>>>
>>> if genre == 'Comedy':
... st.write('You selected comedy.')
... else:
... st.write("You didn't select comedy.")
Display a select widget.
Parameters
----------
label : str
A short label explaining to the user what this select widget is for.
options : list, tuple, numpy.ndarray, or pandas.Series
Labels for the select options. This will be cast to str internally
by default.
index : int
The index of the preselected option on first render.
format_func : function
Function to modify the display of the labels. It receives the option
as an argument and its output will be cast to str.
key : str
An optional string to use as the unique key for the widget.
If this is omitted, a key will be generated for the widget
based on its content. Multiple widgets of the same type may
not share the same key.
Returns
-------
any
The selected option
Example
-------
>>> option = st.selectbox(
... 'How would you like to be contacted?',
... ('Email', 'Home phone', 'Mobile phone'))
>>>
>>> st.write('You selected:', option)
Display a slider widget.
This also allows you to render a range slider by passing a two-element tuple or list as the `value`.
Parameters
----------
label : str or None
A short label explaining to the user what this slider is for.
min_value : int/float or None
The minimum permitted value.
Defaults to 0 if the value is an int, 0.0 otherwise.
max_value : int/float or None
The maximum permitted value.
Defaults 100 if the value is an int, 1.0 otherwise.
value : int/float or a tuple/list of int/float or None
The value of the slider when it first renders. If a tuple/list
of two values is passed here, then a range slider with those lower
and upper bounds is rendered. For example, if set to `(1, 10)` the
slider will have a selectable range between 1 and 10.
Defaults to min_value.
step : int/float or None
The stepping interval.
Defaults to 1 if the value is an int, 0.01 otherwise.
format : str or None
A printf-style format string controlling how the interface should
display numbers. This does not impact the return value.
Valid formatters: %d %e %f %g %i
key : str
An optional string to use as the unique key for the widget.
If this is omitted, a key will be generated for the widget
based on its content. Multiple widgets of the same type may
not share the same key.
Returns
-------
int/float or tuple of int/float
The current value of the slider widget. The return type will match
the data type of the value parameter.
Examples
--------
>>> age = st.slider('How old are you?', 0, 130, 25)
>>> st.write("I'm ", age, 'years old')
And here's an example of a range slider:
>>> values = st.slider(
... 'Select a range of values',
... 0.0, 100.0, (25.0, 75.0))
>>> st.write('Values:', values)
Display text in subheader formatting.
Parameters
----------
body : str
The text to display.
Example
-------
>>> st.subheader('This is a subheader')
.. output::
https://share.streamlit.io/0.25.0-2JkNY/index.html?id=LBKJTfFUwudrbWENSHV6cJ
height: 100px
Display a success message.
Parameters
----------
body : str
The success text to display.
Example
-------
>>> st.success('This is a success message!')
Display a static table.
This differs from `st.dataframe` in that the table in this case is
static: its entire contents are just laid out directly on the page.
Parameters
----------
data : pandas.DataFrame, pandas.Styler, numpy.ndarray, Iterable, dict,
or None
The table data.
Example
-------
>>> df = pd.DataFrame(
... np.random.randn(10, 5),
... columns=('col %d' % i for i in range(5)))
...
>>> st.table(df)
.. output::
https://share.streamlit.io/0.25.0-2JkNY/index.html?id=KfZvDMprL4JFKXbpjD3fpq
height: 480px
Write fixed-width and preformatted text.
Parameters
----------
body : str
The string to display.
Example
-------
>>> st.text('This is some text.')
.. output::
https://share.streamlit.io/0.25.0-2JkNY/index.html?id=PYxU1kee5ubuhGR11NsnT1
height: 50px
Display a multi-line text input widget.
Parameters
----------
label : str
A short label explaining to the user what this input is for.
value : any
The text value of this widget when it first renders. This will be
cast to str internally.
height : int or None
Desired height of the UI element expressed in pixels. If None, a
default height is used.
max_chars : int or None
Maximum number of characters allowed in text area.
key : str
An optional string to use as the unique key for the widget.
If this is omitted, a key will be generated for the widget
based on its content. Multiple widgets of the same type may
not share the same key.
Returns
-------
str
The current value of the text input widget.
Example
-------
>>> txt = st.text_area('Text to analyze', '''
... It was the best of times, it was the worst of times, it was
... the age of wisdom, it was the age of foolishness, it was
... the epoch of belief, it was the epoch of incredulity, it
... was the season of Light, it was the season of Darkness, it
... was the spring of hope, it was the winter of despair, (...)
... ''')
>>> st.write('Sentiment:', run_sentiment_analysis(txt))
Display a single-line text input widget.
Parameters
----------
label : str
A short label explaining to the user what this input is for.
value : any
The text value of this widget when it first renders. This will be
cast to str internally.
max_chars : int or None
Max number of characters allowed in text input.
key : str
An optional string to use as the unique key for the widget.
If this is omitted, a key will be generated for the widget
based on its content. Multiple widgets of the same type may
not share the same key.
type : str
The type of the text input. This can be either "default" (for
a regular text input), or "password" (for a text input that
masks the user's typed value). Defaults to "default".
Returns
-------
str
The current value of the text input widget.
Example
-------
>>> title = st.text_input('Movie title', 'Life of Brian')
>>> st.write('The current movie title is', title)
Display a time input widget.
Parameters
----------
label : str
A short label explaining to the user what this time input is for.
value : datetime.time/datetime.datetime
The value of this widget when it first renders. This will be
cast to str internally. Defaults to the current time.
key : str
An optional string to use as the unique key for the widget.
If this is omitted, a key will be generated for the widget
based on its content. Multiple widgets of the same type may
not share the same key.
Returns
-------
datetime.time
The current value of the time input widget.
Example
-------
>>> t = st.time_input('Set an alarm for', datetime.time(8, 45))
>>> st.write('Alarm is set for', t)
Display text in title formatting.
Each document should have a single `st.title()`, although this is not
enforced.
Parameters
----------
body : str
The text to display.
Example
-------
>>> st.title('This is a title')
.. output::
https://share.streamlit.io/0.25.0-2JkNY/index.html?id=SFcBGANWd8kWXF28XnaEZj
height: 100px
Display a chart using the Vega-Lite library.
Parameters
----------
data : pandas.DataFrame, pandas.Styler, numpy.ndarray, Iterable, dict,
or None
Either the data to be plotted or a Vega-Lite spec containing the
data (which more closely follows the Vega-Lite API).
spec : dict or None
The Vega-Lite spec for the chart. If the spec was already passed in
the previous argument, this must be set to None. See
https://vega.github.io/vega-lite/docs/ for more info.
width : number
Deprecated. If != 0 (default), will show an alert.
From now on you should set the width directly in the Vega-Lite
spec. Please refer to the Vega-Lite documentation for details.
use_container_width : bool
If True, set the chart width to the column width. This takes
precedence over Vega-Lite's native `width` value.
**kwargs : any
Same as spec, but as keywords.
Example
-------
>>> import pandas as pd
>>> import numpy as np
>>>
>>> df = pd.DataFrame(
... np.random.randn(200, 3),
... columns=['a', 'b', 'c'])
>>>
>>> st.vega_lite_chart(df, {
... 'mark': {'type': 'circle', 'tooltip': True},
... 'encoding': {
... 'x': {'field': 'a', 'type': 'quantitative'},
... 'y': {'field': 'b', 'type': 'quantitative'},
... 'size': {'field': 'c', 'type': 'quantitative'},
... 'color': {'field': 'c', 'type': 'quantitative'},
... },
... })
.. output::
https://share.streamlit.io/0.25.0-2JkNY/index.html?id=8jmmXR8iKoZGV4kXaKGYV5
height: 200px
Examples of Vega-Lite usage without Streamlit can be found at
https://vega.github.io/vega-lite/examples/. Most of those can be easily
translated to the syntax shown above.
Display a video player.
Parameters
----------
data : str, bytes, BytesIO, numpy.ndarray, or file opened with
io.open().
Raw video data, filename, or URL pointing to a video to load.
Includes support for YouTube URLs.
Numpy arrays and raw data formats must include all necessary file
headers to match specified file format.
format : str
The mime type for the video file. Defaults to 'video/mp4'.
See https://tools.ietf.org/html/rfc4281 for more info.
start_time: int
The time from which this element should start playing.
Example
-------
>>> video_file = open('myvideo.mp4', 'rb')
>>> video_bytes = video_file.read()
>>>
>>> st.video(video_bytes)
.. output::
https://share.streamlit.io/0.25.0-2JkNY/index.html?id=Wba9sZELKfKwXH4nDCCbMv
height: 600px
.. note::
Some videos may not display if they are encoded using MP4V (which is an export option in OpenCV), as this codec is
not widely supported by browsers. Converting your video to H.264 will allow the video to be displayed in Streamlit.
See this `StackOverflow post <https://stackoverflow.com/a/49535220/2394542>`_ or this
`Streamlit forum post <https://discuss.streamlit.io/t/st-video-doesnt-show-opencv-generated-mp4/3193/2>`_
for more information.
Display warning message.
Parameters
----------
body : str
The warning text to display.
Example
-------
>>> st.warning('This is a warning')
Allows us to create and absorb changes (aka Deltas) to elements.
Copyright 2018-2020 Streamlit Inc. Licensed under the Apache License, Version 2.0 (the "License"); you may not use this file except in compliance with the License. You may obtain a copy of the License at http://www.apache.org/licenses/LICENSE-2.0 Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the specific language governing permissions and limitations under the License. Save the type built-in for when we override the name "type". 14MB List of Streamlit commands that perform a Pandas "melt" operation on input dataframes. By passing (None, ...), we're removing (arg1, ...) from *args type: ignore[attr-defined] Remove self and element from sig. Warn if we're called from within an @st.cache function The pydoc below is for user consumption, so it doesn't talk about DeltaGenerator constructor parameters (which users should never use). For those, see above. This is either: - None: if this is the running DeltaGenerator for a top-level container. - RunningCursor: if this is the running DeltaGenerator for a non-top-level container (created with dg._block()) - LockedCursor: if this is a locked DeltaGenerator returned by some other DeltaGenerator method. E.g. the dg returned in dg = st.text("foo"). You should never use this! Instead use self._cursor, which is a computed property that fetches the right cursor. Proto index of container (e.g. MAIN=1) [uint, uint] - "breadcrumbs" w/ ancestor positions index - element's own position Case in which we have started up in headless mode. Always call marshall_element() so users can run their script without Streamlit. Only enqueue message if there's a container. Get a DeltaGenerator that is locked to the current element position. If the message was not enqueued, just return self since it's a no-op from the point of view of the app. Normally we'd return a new DeltaGenerator that uses the locked cursor below. But in this case we want to return a DeltaGenerator that uses a brand new cursor for this new block we're creating. Must be called to increment this cursor's index. This docstring needs to be "raw" because of the backslashes in the example below. NOTE: "figure_or_data" is the name used in Plotly's .plot() method for their main parameter. I don't like the name, but it's best to keep it in sync with what Plotly calls it. Perform validation checks and return indices base on the default values. This if is done before others because calling if not x (done right below) when x is of type pd.Series() or np.array() throws a ValueError exception. Set value default. Ensure that the value is either a single value or a range of values. Ensure that the value is either an int/float or a list/tuple of ints/floats. Set corresponding defaults. Ensure that all arguments are of the same type. Ensure that the value matches arguments' types. Ensure that min <= value <= max. Bounds checks. JSNumber produces human-readable exceptions that we simply re-package as StreamlitAPIExceptions. (We check `min_value` and `max_value` here; `value` and `step` are already known to be in the [min_value, max_value] range.) Set format default. It would be great if we could guess the number of decimal places from the `step` argument, but this would only be meaningful if step were a decimal. As a possible improvement we could make this function accept decimals and/or use some heuristics for floats. Convert the current value to the appropriate type. Cast ui_value to the same type as the input arguments Convert float array into int array if the rest of the arguments are ints If there is only one value in the array destructure it into a single variable Don't release this just yet. (When ready to release, turn test back on at file_uploader_test.py) set value default make sure the value is a string validate the value and expects a hex string Set value default. Ensure that the value is either datetime/time Convert datetime to time Set value default. We set a float as default Warn user to check if displaying float as int was really intended. Ensure that all arguments are of the same type. Ensure that the value matches arguments' types. Bounds checks. JSNumber produces human-readable exceptions that we simply re-package as StreamlitAPIExceptions. TODO: standardize numerical type checking across st.* functions. The protobuf needs something to be set Accept syntax st.add_rows(df). Accept syntax st.add_rows(foo=df). Raise error otherwise. When doing add_rows on an element that does not already have data (for example, st.line_chart() without any args), call the original st.foo() element with new data instead of doing an add_rows(). IMPORTANT: This assumes delta types and st method names always match! For some delta types we have to reshape the data structure otherwise the input data and the actual data used by vega_lite will be different and it will throw an error. We have to drop the predefined index | 56,211 | en | 0.639757 |
from collections import OrderedDict
import numpy as np
from gym.spaces import Box, Dict
from multiworld.envs.env_util import get_stat_in_paths, \
create_stats_ordered_dict, get_asset_full_path
from multiworld.core.multitask_env import MultitaskEnv
from multiworld.envs.mujoco.sawyer_xyz.push.sawyer_push import SawyerPushEnv
from pyquaternion import Quaternion
def zangle_to_quat(zangle):
"""
:param zangle in rad
:return: quaternion
"""
#return (Quaternion(axis=[0,1,0], angle=np.pi) * Quaternion(axis=[0, 0, -1], angle= zangle)).elements
return (Quaternion(axis=[0,0,1], angle=np.pi) * Quaternion(axis=[-1, 0, 0], angle= zangle)).elements
#return (Quaternion(axis=[1,0,0], angle=np.pi) * Quaternion(axis=[0, -1, 0], angle= zangle)).elements
#return (Quaternion(axis=[1,0,0], angle=np.pi) * Quaternion(axis=[-1, 0, 0], angle= zangle)).elements #fail
#return (Quaternion(axis=[0,0,1], angle=np.pi) * Quaternion(axis=[0, -1, 0], angle= zangle)).elements
class SawyerCoffeeEnv( SawyerPushEnv):
def __init__(
self,
tasks = [{'goal': np.array([0, 1.0, 0.05]), 'height': 0.06, 'obj_init_pos':np.array([0, 0.6, 0.04])}] ,
hand_type = 'weiss_v2',
rewMode = 'orig',
**kwargs
):
self.quick_init(locals())
self.hand_type = hand_type
SawyerPushEnv.__init__(
self,
tasks = tasks,
hand_type = hand_type,
**kwargs
)
#self.hand_init_pos = [-0.00434313 , 0.76608467 , 0.26081535]
self.demo = False
self.max_path_length = 120
self.camera_name = 'angled_cam'
self.info_logKeys = ['placingDist' , 'pickRew' , 'reachRew' , 'placeRew']
self.rewMode = rewMode
self.action_space = Box(
np.array([-1, -1, -1, -1]),
np.array([1, 1, 1, 1]),
)
@property
def model_name(self):
#return get_asset_full_path('sawyer_xyz/sawyer_pickPlace.xml')
#self.reset_mocap_quat = zangle_to_quat(np.pi/2) #this is the reset_mocap_quat for wsg grippers
#self.reset_mocap_quat = zangle_to_quat(-np.pi/2)
init_quat = [1,0,0,1]
self.reset_mocap_quat = (Quaternion(axis= [1,0,0] , angle = -np.pi/2)*Quaternion(init_quat)).elements
return get_asset_full_path('sawyer_xyz/sawyer_wsg_coffee.xml')
def _reset_hand(self):
for _ in range(10):
self.data.set_mocap_pos('mocap', self.hand_init_pos)
self.data.set_mocap_quat('mocap', self.reset_mocap_quat)
self.do_simulation([-1,1], self.frame_skip)
def step(self, action):
#action = [0,0,0,1]
if self.demo:
if self.curr_path_length <=20:
action = [0 , 1, -1, -1]
elif self.curr_path_length <=40:
action = [0,1,1,1]
elif self.curr_path_length <=70:
action = [0,0.9,-0.25,1]
elif self.curr_path_length<=100:
action = [0,-1 ,1 , -1]
noise = 5*1e-1*np.random.uniform(-1,1 , size= 3)
noise_4d = np.concatenate([noise , [0]])
action = np.array(action) + noise_4d
#object position after picking and placing coffe : [-0.00434313 0.76608467 0.26081535]
self.set_xyz_action(action[:3])
self.do_simulation([ action[-1], -action[-1]])
self._set_goal_marker(self._state_goal)
ob = self._get_obs()
reward , reachReward , pickReward , placeReward , placingDist = self.compute_reward(action, ob)
self.curr_path_length +=1
if self.curr_path_length == self.max_path_length:
done = True
else:
done = False
return ob, reward, done, OrderedDict({ 'epRew' : reward , 'reachRew': reachReward , 'pickRew': pickReward , 'placeRew': placeReward , 'placingDist': placingDist})
def change_task(self, task):
task = {'goal': np.array([0, 1.0, 0.05]), 'height': 0.06, 'obj_init_pos':np.array([0, 0.6, 0.04])}
self.grasp = False
self.pickCompleted = False
if len(task['goal']) == 3:
self._state_goal = task['goal']
else:
self._state_goal = np.concatenate([task['goal'] , [0.02]])
self._set_goal_marker(self._state_goal)
if len(task['obj_init_pos']) == 3:
self.obj_init_pos = task['obj_init_pos']
else:
self.obj_init_pos = np.concatenate([task['obj_init_pos'] , [0.02]])
#self.maxPlacingDist = np.linalg.norm(np.array([self.obj_init_pos[0], self.obj_init_pos[1], self.heightTarget]) - np.array(self._state_goal)) + self.heightTarget
def render(self, mode = 'human'):
if mode == 'human':
im_size = 500 ; norm = 1.0
self.set_goal_visibility(visible = True)
elif mode == 'nn':
im_size = self.image_dim ; norm = 255.0
elif mode == 'vis_nn':
im_size = self.image_dim ; norm = 1.0
else:
raise AssertionError('Mode must be human, nn , or vis_nn')
if self.camera_name == 'angled_cam':
image = self.get_image(width= im_size , height = im_size , camera_name = 'angled_cam').transpose()/norm
image = image.reshape((3, im_size, im_size))
image = np.rot90(image, axes = (-2,-1))
final_image = np.transpose(image , [1,2,0])
if 'nn' in mode:
final_image = final_image[:48 ,10 : 74,:]
# elif 'human' in mode:
# final_image = final_image[:285, 60: 440,:]
if self.hide_goal:
self.set_goal_visibility(visible = False)
return final_image
def compute_reward(self, actions, obs):
if isinstance(obs, dict):
obs = obs['state_observation']
objPos = obs[3:6]
rightFinger, leftFinger = self.get_site_pos('rightEndEffector'), self.get_site_pos('leftEndEffector')
fingerCOM = (rightFinger + leftFinger)/2
placingGoal = self._state_goal
graspDist = np.linalg.norm(objPos - fingerCOM)
placingDist = np.linalg.norm(objPos - placingGoal)
def reachReward():
graspRew = -graspDist
if np.linalg.norm(objPos[:2] - fingerCOM[:2]) < 0.02 and fingerCOM[2]<0.05:
self.grasp = True
return graspRew
def pickRew():
if self.pickCompleted:
return 10
elif self.grasp:
if abs(0.07 - objPos[2])<0.1:
self.pickCompleted = True
return 1/(abs(0.07 - objPos[2])+1e-1)
else:
return 0
def placeRew():
if self.pickCompleted:
return np.exp(-placingDist)
else:
return 0
reachReward = reachReward()
pickReward = pickRew()
placeReward = placeRew()
reward = reachReward + pickReward + placeReward
return [reward , reachReward , pickReward , placeReward, placingDist]
def log_diagnostics(self, paths = None, prefix = '', logger = None):
from rllab.misc import logger
#if type(paths[0]) == dict:
# if isinstance(paths[0]['env_infos'][0] , OrderedDict):
# #For SAC
# for key in self.info_logKeys:
# nested_list = [[i[key] for i in paths[j]['env_infos']] for j in range(len(paths))]
# logger.record_tabular(prefix + 'max_'+key, np.mean([max(_list) for _list in nested_list]) )
# logger.record_tabular(prefix + 'last_'+key, np.mean([_list[-1] for _list in nested_list]) )
#For TRPO
for key in self.info_logKeys:
#logger.record_tabular(prefix+ 'sum_'+key, np.mean([sum(path['env_infos'][key]) for path in paths]) )
logger.record_tabular(prefix+'max_'+key, np.mean([max(path['env_infos'][key]) for path in paths]) )
#logger.record_tabular(prefix+'min_'+key, np.mean([min(path['env_infos'][key]) for path in paths]) )
logger.record_tabular(prefix + 'last_'+key, np.mean([path['env_infos'][key][-1] for path in paths]) )
logger.record_tabular(prefix + 'mean_'+key, np.mean([np.mean(path['env_infos'][key]) for path in paths]) )
| multiworld/envs/mujoco/sawyer_xyz/pickPlace/sawyer_coffee.py | 7,279 | :param zangle in rad
:return: quaternion
return (Quaternion(axis=[0,1,0], angle=np.pi) * Quaternion(axis=[0, 0, -1], angle= zangle)).elementsreturn (Quaternion(axis=[1,0,0], angle=np.pi) * Quaternion(axis=[0, -1, 0], angle= zangle)).elementsreturn (Quaternion(axis=[1,0,0], angle=np.pi) * Quaternion(axis=[-1, 0, 0], angle= zangle)).elements failreturn (Quaternion(axis=[0,0,1], angle=np.pi) * Quaternion(axis=[0, -1, 0], angle= zangle)).elementsself.hand_init_pos = [-0.00434313 , 0.76608467 , 0.26081535]return get_asset_full_path('sawyer_xyz/sawyer_pickPlace.xml')self.reset_mocap_quat = zangle_to_quat(np.pi/2) this is the reset_mocap_quat for wsg grippersself.reset_mocap_quat = zangle_to_quat(-np.pi/2)action = [0,0,0,1]object position after picking and placing coffe : [-0.00434313 0.76608467 0.26081535]self.maxPlacingDist = np.linalg.norm(np.array([self.obj_init_pos[0], self.obj_init_pos[1], self.heightTarget]) - np.array(self._state_goal)) + self.heightTarget elif 'human' in mode: final_image = final_image[:285, 60: 440,:]if type(paths[0]) == dict: if isinstance(paths[0]['env_infos'][0] , OrderedDict): For SAC for key in self.info_logKeys: nested_list = [[i[key] for i in paths[j]['env_infos']] for j in range(len(paths))] logger.record_tabular(prefix + 'max_'+key, np.mean([max(_list) for _list in nested_list]) ) logger.record_tabular(prefix + 'last_'+key, np.mean([_list[-1] for _list in nested_list]) )For TRPOlogger.record_tabular(prefix+ 'sum_'+key, np.mean([sum(path['env_infos'][key]) for path in paths]) )logger.record_tabular(prefix+'min_'+key, np.mean([min(path['env_infos'][key]) for path in paths]) ) | 1,668 | en | 0.255103 |
"""
Evolutionary optimization of something
"""
import random
import multiprocessing
import numpy as np
import numpy.random as npr
import matplotlib.pylab as plt
from tqdm import tqdm
from automata import SnowDrift
class EvolutionaryOptimizer(object):
""" Optimize!
"""
def __init__(self):
""" Set some parameters
"""
self.mutation_probability = 0.02
def init(self, size):
""" Generate initial population
"""
raise NotImplementedError
def get_fitness(self, obj):
""" Compute fitness of individual of population
"""
raise NotImplementedError
def mutate(self, obj):
""" Mutate single individual
"""
raise NotImplementedError
def crossover(self, mom, dad):
""" Generate offspring from parents
"""
raise NotImplementedError
def run(self, size, max_iter=100):
""" Let life begin
"""
population = self.init(size)
res = []
for _ in tqdm(range(max_iter)):
pop_fitness = [self.get_fitness(o) for o in population]
# crossover best individuals and replace worst with child
best_indiv = np.argpartition(pop_fitness, -2)[-2:]
mom, dad = population[best_indiv]
child = self.crossover(mom, dad)
worst_indiv = np.argmin(pop_fitness)
population[worst_indiv] = child
# apply mutations
mut = lambda o: \
self.mutate(o) if random.random() < self.mutation_probability \
else o
population = np.array([mut(o) for o in population])
res.append(
(np.mean(population, axis=0), np.var(population, axis=0)))
return res
class SnowdriftOptimizer(EvolutionaryOptimizer):
""" Optimize snowdrift game by assuming each individual to be the pair of
benefit and cost floats
"""
def init(self, size):
pop = []
for _ in range(size):
pop.append((random.uniform(0, 1), random.uniform(0, 1)))
return np.array(pop)
def crossover(self, mom, dad):
return np.mean([mom, dad], axis=0)
def mutate(self, obj):
sigma = 0.05
return (obj[0] * random.gauss(1, sigma), obj[1] * random.gauss(1, sigma))
def get_fitness(self, obj):
# setup system
lattice = npr.random_integers(0, 1, size=(2, 1))
model = SnowDrift(lattice)
# generate dynamics
iter_num = 100
benefit, cost = obj
res = list(model.iterate(iter_num, benefit=benefit, cost=cost))
# cut off transient
ss = res[-int(iter_num/10):]
# compute fitness
fit = -np.sum(ss)
return fit
def plot_runs(runs):
""" Plot population evolutions
"""
ts = range(len(runs[0]))
cmap = plt.get_cmap('viridis')
for i, r in enumerate(runs):
mean, var = zip(*r)
bm, cm = zip(*mean)
bv, cv = zip(*var)
color = cmap(float(i)/len(runs))
plt.errorbar(ts, bm, fmt='-', yerr=bv, c=color)
plt.errorbar(ts, cm, fmt='--', yerr=cv, c=color)
plt.title('population evolution overview')
plt.xlabel('time')
plt.ylabel('value')
plt.ylim((0, 1))
plt.plot(0, 0, '-', c='black', label='benefit value')
plt.plot(0, 0, '--', c='black', label='cost value')
plt.legend(loc='best')
plt.savefig('result.pdf')
plt.show()
def work(i):
""" Handle one optimization case
"""
opti = SnowdriftOptimizer()
return opti.run(20)
def main():
""" Setup environment
"""
core_num = int(multiprocessing.cpu_count() * 4/5)
print('Using %d cores' % core_num)
with multiprocessing.Pool(core_num) as p:
runs = [i for i in p.imap_unordered(work, range(10))]
plot_runs(runs)
if __name__ == '__main__':
main()
| evolutionary_optimization.py | 3,905 | Optimize!
Optimize snowdrift game by assuming each individual to be the pair of
benefit and cost floats
Set some parameters
Generate offspring from parents
Compute fitness of individual of population
Generate initial population
Setup environment
Mutate single individual
Plot population evolutions
Let life begin
Handle one optimization case
Evolutionary optimization of something
crossover best individuals and replace worst with child apply mutations setup system generate dynamics cut off transient compute fitness | 593 | en | 0.733882 |
"""Define SetConfig message."""
# System imports
# Third-party imports
# Local imports
from pyof.v0x01.common.header import Type
from pyof.v0x01.controller2switch.common import SwitchConfig
__all__ = ('SetConfig',)
class SetConfig(SwitchConfig):
"""Set config message."""
def __init__(self, xid=None, flags=None, miss_send_len=None):
"""Create a SetConfig with the optional parameters below.
Args:
xid (int): xid to be used on the message header.
flags (~pyof.v0x01.controller2switch.common.ConfigFlag):
OFPC_* flags.
miss_send_len (int): UBInt16 max bytes of new flow that the
datapath should send to the controller.
"""
super().__init__(xid, flags, miss_send_len)
self.header.message_type = Type.OFPT_SET_CONFIG
| pyof/v0x01/controller2switch/set_config.py | 838 | Set config message.
Create a SetConfig with the optional parameters below.
Args:
xid (int): xid to be used on the message header.
flags (~pyof.v0x01.controller2switch.common.ConfigFlag):
OFPC_* flags.
miss_send_len (int): UBInt16 max bytes of new flow that the
datapath should send to the controller.
Define SetConfig message.
System imports Third-party imports Local imports | 406 | en | 0.375165 |
import numpy as np
import scipy.interpolate
from numpy import polyint, polymul, polyval
from scipy.interpolate import BSpline as SciBSpline, PPoly
from ..._utils import _domain_range
from ._basis import Basis
class BSpline(Basis):
r"""BSpline basis.
BSpline basis elements are defined recursively as:
.. math::
B_{i, 1}(x) = 1 \quad \text{if } t_i \le x < t_{i+1},
\quad 0 \text{ otherwise}
.. math::
B_{i, k}(x) = \frac{x - t_i}{t_{i+k} - t_i} B_{i, k-1}(x)
+ \frac{t_{i+k+1} - x}{t_{i+k+1} - t_{i+1}} B_{i+1, k-1}(x)
Where k indicates the order of the spline.
Implementation details: In order to allow a discontinuous behaviour at
the boundaries of the domain it is necessary to placing m knots at the
boundaries [RS05]_. This is automatically done so that the user only has to
specify a single knot at the boundaries.
Attributes:
domain_range (tuple): A tuple of length 2 containing the initial and
end values of the interval over which the basis can be evaluated.
n_basis (int): Number of functions in the basis.
order (int): Order of the splines. One greather than their degree.
knots (list): List of knots of the spline functions.
Examples:
Constructs specifying number of basis and order.
>>> bss = BSpline(n_basis=8, order=4)
If no order is specified defaults to 4 because cubic splines are
the most used. So the previous example is the same as:
>>> bss = BSpline(n_basis=8)
It is also possible to create a BSpline basis specifying the knots.
>>> bss = BSpline(knots=[0, 0.2, 0.4, 0.6, 0.8, 1])
Once we create a basis we can evaluate each of its functions at a
set of points.
>>> bss = BSpline(n_basis=3, order=3)
>>> bss([0, 0.5, 1])
array([[[ 1. ],
[ 0.25],
[ 0. ]],
[[ 0. ],
[ 0.5 ],
[ 0. ]],
[[ 0. ],
[ 0.25],
[ 1. ]]])
And evaluates first derivative
>>> deriv = bss.derivative()
>>> deriv([0, 0.5, 1])
array([[[-2.],
[-1.],
[ 0.]],
[[ 2.],
[ 0.],
[-2.]],
[[ 0.],
[ 1.],
[ 2.]]])
References:
.. [RS05] Ramsay, J., Silverman, B. W. (2005). *Functional Data
Analysis*. Springer. 50-51.
"""
def __init__(self, domain_range=None, n_basis=None, order=4, knots=None):
"""Bspline basis constructor.
Args:
domain_range (tuple, optional): Definition of the interval where
the basis defines a space. Defaults to (0,1) if knots are not
specified. If knots are specified defaults to the first and
last element of the knots.
n_basis (int, optional): Number of splines that form the basis.
order (int, optional): Order of the splines. One greater that
their degree. Defaults to 4 which mean cubic splines.
knots (array_like): List of knots of the splines. If domain_range
is specified the first and last elements of the knots have to
match with it.
"""
if domain_range is not None:
domain_range = _domain_range(domain_range)
if len(domain_range) != 1:
raise ValueError("Domain range should be unidimensional.")
domain_range = domain_range[0]
# Knots default to equally space points in the domain_range
if knots is None:
if n_basis is None:
raise ValueError("Must provide either a list of knots or the"
"number of basis.")
else:
knots = tuple(knots)
knots = sorted(knots)
if domain_range is None:
domain_range = (knots[0], knots[-1])
else:
if domain_range[0] != knots[0] or domain_range[1] != knots[-1]:
raise ValueError("The ends of the knots must be the same "
"as the domain_range.")
# n_basis default to number of knots + order of the splines - 2
if n_basis is None:
n_basis = len(knots) + order - 2
if (n_basis - order + 2) < 2:
raise ValueError(f"The number of basis ({n_basis}) minus the "
f"order of the bspline ({order}) should be "
f"greater than 3.")
self._order = order
self._knots = None if knots is None else tuple(knots)
super().__init__(domain_range=domain_range, n_basis=n_basis)
# Checks
if self.n_basis != self.order + len(self.knots) - 2:
raise ValueError(f"The number of basis ({self.n_basis}) has to "
f"equal the order ({self.order}) plus the "
f"number of knots ({len(self.knots)}) minus 2.")
@property
def knots(self):
if self._knots is None:
return tuple(np.linspace(*self.domain_range[0],
self.n_basis - self.order + 2))
else:
return self._knots
@property
def order(self):
return self._order
def _evaluation_knots(self):
"""
Get the knots adding m knots to the boundary in order to allow a
discontinuous behaviour at the boundaries of the domain [RS05]_.
References:
.. [RS05] Ramsay, J., Silverman, B. W. (2005). *Functional Data
Analysis*. Springer. 50-51.
"""
return np.array((self.knots[0],) * (self.order - 1) + self.knots +
(self.knots[-1],) * (self.order - 1))
def _evaluate(self, eval_points):
# Input is scalar
eval_points = eval_points[..., 0]
# Places m knots at the boundaries
knots = self._evaluation_knots()
# c is used the select which spline the function splev below computes
c = np.zeros(len(knots))
# Initialise empty matrix
mat = np.empty((self.n_basis, len(eval_points)))
# For each basis computes its value for each evaluation point
for i in range(self.n_basis):
# write a 1 in c in the position of the spline calculated in each
# iteration
c[i] = 1
# compute the spline
mat[i] = scipy.interpolate.splev(eval_points,
(knots, c, self.order - 1))
c[i] = 0
return mat
def _derivative_basis_and_coefs(self, coefs, order=1):
if order >= self.order:
return (
BSpline(n_basis=1, domain_range=self.domain_range, order=1),
np.zeros((len(coefs), 1)))
deriv_splines = [self._to_scipy_BSpline(coefs[i]).derivative(order)
for i in range(coefs.shape[0])]
deriv_coefs = [BSpline._from_scipy_BSpline(spline)[1]
for spline in deriv_splines]
deriv_basis = BSpline._from_scipy_BSpline(deriv_splines[0])[0]
return deriv_basis, np.array(deriv_coefs)[:, 0:deriv_basis.n_basis]
def rescale(self, domain_range=None):
r"""Return a copy of the basis with a new domain range, with the
corresponding values rescaled to the new bounds.
The knots of the BSpline will be rescaled in the new interval.
Args:
domain_range (tuple, optional): Definition of the interval
where the basis defines a space. Defaults uses the same as
the original basis.
"""
knots = np.array(self.knots, dtype=np.dtype('float'))
if domain_range is not None: # Rescales the knots
knots -= knots[0]
knots *= ((domain_range[1] - domain_range[0]
) / (self.knots[-1] - self.knots[0]))
knots += domain_range[0]
# Fix possible round error
knots[0] = domain_range[0]
knots[-1] = domain_range[1]
else:
# TODO: Allow multiple dimensions
domain_range = self.domain_range[0]
return BSpline(domain_range, self.n_basis, self.order, knots)
def __repr__(self):
"""Representation of a BSpline basis."""
return (f"{self.__class__.__name__}(domain_range={self.domain_range}, "
f"n_basis={self.n_basis}, order={self.order}, "
f"knots={self.knots})")
def _gram_matrix(self):
# Places m knots at the boundaries
knots = self._evaluation_knots()
# c is used the select which spline the function
# PPoly.from_spline below computes
c = np.zeros(len(knots))
# Initialise empty list to store the piecewise polynomials
ppoly_lst = []
no_0_intervals = np.where(np.diff(knots) > 0)[0]
# For each basis gets its piecewise polynomial representation
for i in range(self.n_basis):
# Write a 1 in c in the position of the spline
# transformed in each iteration
c[i] = 1
# Gets the piecewise polynomial representation and gets
# only the positions for no zero length intervals
# This polynomial are defined relatively to the knots
# meaning that the column i corresponds to the ith knot.
# Let the ith knot be a
# Then f(x) = pp(x - a)
pp = PPoly.from_spline((knots, c, self.order - 1))
pp_coefs = pp.c[:, no_0_intervals]
# We have the coefficients for each interval in coordinates
# (x - a), so we will need to subtract a when computing the
# definite integral
ppoly_lst.append(pp_coefs)
c[i] = 0
# Now for each pair of basis computes the inner product after
# applying the linear differential operator
matrix = np.zeros((self.n_basis, self.n_basis))
for interval in range(len(no_0_intervals)):
for i in range(self.n_basis):
poly_i = np.trim_zeros(ppoly_lst[i][:,
interval], 'f')
# Indefinite integral
square = polymul(poly_i, poly_i)
integral = polyint(square)
# Definite integral
matrix[i, i] += np.diff(polyval(
integral, self.knots[interval: interval + 2]
- self.knots[interval]))[0]
# The Gram matrix is banded, so not all intervals are used
for j in range(i + 1, min(i + self.order, self.n_basis)):
poly_j = np.trim_zeros(ppoly_lst[j][:, interval], 'f')
# Indefinite integral
integral = polyint(polymul(poly_i, poly_j))
# Definite integral
matrix[i, j] += np.diff(polyval(
integral, self.knots[interval: interval + 2]
- self.knots[interval])
)[0]
# The matrix is symmetric
matrix[j, i] = matrix[i, j]
return matrix
def _to_scipy_BSpline(self, coefs):
knots = np.concatenate((
np.repeat(self.knots[0], self.order - 1),
self.knots,
np.repeat(self.knots[-1], self.order - 1)))
return SciBSpline(knots, coefs, self.order - 1)
@staticmethod
def _from_scipy_BSpline(bspline):
order = bspline.k
knots = bspline.t
# Remove additional knots at the borders
if order != 0:
knots = knots[order: -order]
coefs = bspline.c
domain_range = [knots[0], knots[-1]]
return BSpline(domain_range, order=order + 1, knots=knots), coefs
@property
def inknots(self):
"""Return number of basis."""
return self.knots[1:len(self.knots) - 1]
def __eq__(self, other):
return (super().__eq__(other)
and self.order == other.order
and self.knots == other.knots)
def __hash__(self):
return hash((super().__hash__(), self.order, self.knots))
| skfda/representation/basis/_bspline.py | 12,484 | BSpline basis.
BSpline basis elements are defined recursively as:
.. math::
B_{i, 1}(x) = 1 \quad \text{if } t_i \le x < t_{i+1},
\quad 0 \text{ otherwise}
.. math::
B_{i, k}(x) = \frac{x - t_i}{t_{i+k} - t_i} B_{i, k-1}(x)
+ \frac{t_{i+k+1} - x}{t_{i+k+1} - t_{i+1}} B_{i+1, k-1}(x)
Where k indicates the order of the spline.
Implementation details: In order to allow a discontinuous behaviour at
the boundaries of the domain it is necessary to placing m knots at the
boundaries [RS05]_. This is automatically done so that the user only has to
specify a single knot at the boundaries.
Attributes:
domain_range (tuple): A tuple of length 2 containing the initial and
end values of the interval over which the basis can be evaluated.
n_basis (int): Number of functions in the basis.
order (int): Order of the splines. One greather than their degree.
knots (list): List of knots of the spline functions.
Examples:
Constructs specifying number of basis and order.
>>> bss = BSpline(n_basis=8, order=4)
If no order is specified defaults to 4 because cubic splines are
the most used. So the previous example is the same as:
>>> bss = BSpline(n_basis=8)
It is also possible to create a BSpline basis specifying the knots.
>>> bss = BSpline(knots=[0, 0.2, 0.4, 0.6, 0.8, 1])
Once we create a basis we can evaluate each of its functions at a
set of points.
>>> bss = BSpline(n_basis=3, order=3)
>>> bss([0, 0.5, 1])
array([[[ 1. ],
[ 0.25],
[ 0. ]],
[[ 0. ],
[ 0.5 ],
[ 0. ]],
[[ 0. ],
[ 0.25],
[ 1. ]]])
And evaluates first derivative
>>> deriv = bss.derivative()
>>> deriv([0, 0.5, 1])
array([[[-2.],
[-1.],
[ 0.]],
[[ 2.],
[ 0.],
[-2.]],
[[ 0.],
[ 1.],
[ 2.]]])
References:
.. [RS05] Ramsay, J., Silverman, B. W. (2005). *Functional Data
Analysis*. Springer. 50-51.
Bspline basis constructor.
Args:
domain_range (tuple, optional): Definition of the interval where
the basis defines a space. Defaults to (0,1) if knots are not
specified. If knots are specified defaults to the first and
last element of the knots.
n_basis (int, optional): Number of splines that form the basis.
order (int, optional): Order of the splines. One greater that
their degree. Defaults to 4 which mean cubic splines.
knots (array_like): List of knots of the splines. If domain_range
is specified the first and last elements of the knots have to
match with it.
Representation of a BSpline basis.
Get the knots adding m knots to the boundary in order to allow a
discontinuous behaviour at the boundaries of the domain [RS05]_.
References:
.. [RS05] Ramsay, J., Silverman, B. W. (2005). *Functional Data
Analysis*. Springer. 50-51.
Return number of basis.
Return a copy of the basis with a new domain range, with the
corresponding values rescaled to the new bounds.
The knots of the BSpline will be rescaled in the new interval.
Args:
domain_range (tuple, optional): Definition of the interval
where the basis defines a space. Defaults uses the same as
the original basis.
Knots default to equally space points in the domain_range n_basis default to number of knots + order of the splines - 2 Checks Input is scalar Places m knots at the boundaries c is used the select which spline the function splev below computes Initialise empty matrix For each basis computes its value for each evaluation point write a 1 in c in the position of the spline calculated in each iteration compute the spline Rescales the knots Fix possible round error TODO: Allow multiple dimensions Places m knots at the boundaries c is used the select which spline the function PPoly.from_spline below computes Initialise empty list to store the piecewise polynomials For each basis gets its piecewise polynomial representation Write a 1 in c in the position of the spline transformed in each iteration Gets the piecewise polynomial representation and gets only the positions for no zero length intervals This polynomial are defined relatively to the knots meaning that the column i corresponds to the ith knot. Let the ith knot be a Then f(x) = pp(x - a) We have the coefficients for each interval in coordinates (x - a), so we will need to subtract a when computing the definite integral Now for each pair of basis computes the inner product after applying the linear differential operator Indefinite integral Definite integral The Gram matrix is banded, so not all intervals are used Indefinite integral Definite integral The matrix is symmetric Remove additional knots at the borders | 4,855 | en | 0.752205 |
import json
import logging
import traceback
from google.appengine.api import taskqueue
from google.appengine.ext import ndb
from helpers.cache_clearer import CacheClearer
from helpers.firebase.firebase_pusher import FirebasePusher
from helpers.notification_helper import NotificationHelper
from helpers.manipulator_base import ManipulatorBase
class MatchManipulator(ManipulatorBase):
"""
Handle Match database writes.
"""
@classmethod
def getCacheKeysAndControllers(cls, affected_refs):
return CacheClearer.get_match_cache_keys_and_controllers(affected_refs)
@classmethod
def postDeleteHook(cls, matches):
'''
To run after the match has been deleted.
'''
for match in matches:
try:
FirebasePusher.delete_match(match)
except Exception:
logging.warning("Enqueuing Firebase delete failed!")
@classmethod
def postUpdateHook(cls, matches, updated_attr_list, is_new_list):
'''
To run after the match has been updated.
Send push notifications to subscribed users
Only if the match is part of an active event
'''
unplayed_match_events = []
for (match, updated_attrs, is_new) in zip(matches, updated_attr_list, is_new_list):
event = match.event.get()
# Only continue if the event is currently happening
if event.within_a_day:
if match.has_been_played:
if is_new or 'alliances_json' in updated_attrs:
# There is a score update for this match, push a notification
logging.info("Sending push notifications for {}".format(match.key_name))
try:
NotificationHelper.send_match_score_update(match)
except Exception, exception:
logging.error("Error sending match updates: {}".format(exception))
logging.error(traceback.format_exc())
else:
if is_new or (set(['alliances_json', 'time', 'time_string']).symmetric_difference(set(updated_attrs)) != set()):
# The match has not been played and we're changing a property that affects the event's schedule
# So send a schedule update notification for the parent event
if event not in unplayed_match_events:
unplayed_match_events.append(event)
'''
If we have an unplayed match during an event within a day, send out a schedule update notification
'''
for event in unplayed_match_events:
try:
logging.info("Sending schedule updates for: {}".format(event.key_name))
NotificationHelper.send_schedule_update(event)
except Exception, exception:
logging.error("Eror sending schedule updates for: {}".format(event.key_name))
'''
Enqueue firebase push
'''
event_keys = set()
for match in matches:
event_keys.add(match.event.id())
try:
FirebasePusher.update_match(match)
except Exception:
logging.warning("Enqueuing Firebase push failed!")
# Enqueue task to calculate matchstats
for event_key in event_keys:
taskqueue.add(
url='/tasks/math/do/event_matchstats/' + event_key,
method='GET')
@classmethod
def updateMerge(self, new_match, old_match, auto_union=True):
"""
Given an "old" and a "new" Match object, replace the fields in the
"old" team that are present in the "new" team, but keep fields from
the "old" team that are null in the "new" team.
"""
immutable_attrs = [
"comp_level",
"event",
"set_number",
"match_number",
] # These build key_name, and cannot be changed without deleting the model.
attrs = [
"year",
"no_auto_update",
"time",
"time_string",
]
json_attrs = [
"alliances_json",
"score_breakdown_json",
]
list_attrs = [
"team_key_names"
]
auto_union_attrs = [
"tba_videos",
"youtube_videos"
]
old_match._updated_attrs = []
# if not auto_union, treat auto_union_attrs as list_attrs
if not auto_union:
list_attrs += auto_union_attrs
auto_union_attrs = []
for attr in attrs:
if getattr(new_match, attr) is not None:
if getattr(new_match, attr) != getattr(old_match, attr):
setattr(old_match, attr, getattr(new_match, attr))
old_match._updated_attrs.append(attr)
old_match.dirty = True
for attr in json_attrs:
if getattr(new_match, attr) is not None:
if (getattr(old_match, attr) is None) or (json.loads(getattr(new_match, attr)) != json.loads(getattr(old_match, attr))):
setattr(old_match, attr, getattr(new_match, attr))
# changinging 'attr_json' doesn't clear lazy-loaded '_attr'
setattr(old_match, '_{}'.format(attr.replace('_json', '')), None)
old_match._updated_attrs.append(attr)
old_match.dirty = True
for attr in list_attrs:
if len(getattr(new_match, attr)) > 0:
if set(getattr(new_match, attr)) != set(getattr(old_match, attr)): # lists are treated as sets
setattr(old_match, attr, getattr(new_match, attr))
old_match._updated_attrs.append(attr)
old_match.dirty = True
for attr in auto_union_attrs:
old_set = set(getattr(old_match, attr))
new_set = set(getattr(new_match, attr))
unioned = old_set.union(new_set)
if unioned != old_set:
setattr(old_match, attr, list(unioned))
old_match._updated_attrs.append(attr)
old_match.dirty = True
return old_match
| helpers/match_manipulator.py | 6,335 | Only continue if the event is currently happening There is a score update for this match, push a notification The match has not been played and we're changing a property that affects the event's schedule So send a schedule update notification for the parent event Enqueue task to calculate matchstats These build key_name, and cannot be changed without deleting the model. if not auto_union, treat auto_union_attrs as list_attrs changinging 'attr_json' doesn't clear lazy-loaded '_attr' lists are treated as sets | 512 | en | 0.905675 |
"""Test config validators."""
from datetime import timedelta, datetime, date
import enum
import os
from socket import _GLOBAL_DEFAULT_TIMEOUT
from unittest.mock import Mock, patch
import pytest
import voluptuous as vol
import homeassistant.helpers.config_validation as cv
def test_boolean():
"""Test boolean validation."""
schema = vol.Schema(cv.boolean)
for value in ('T', 'negative', 'lock'):
with pytest.raises(vol.MultipleInvalid):
schema(value)
for value in ('true', 'On', '1', 'YES', 'enable', 1, True):
assert schema(value)
for value in ('false', 'Off', '0', 'NO', 'disable', 0, False):
assert not schema(value)
def test_latitude():
"""Test latitude validation."""
schema = vol.Schema(cv.latitude)
for value in ('invalid', None, -91, 91, '-91', '91', '123.01A'):
with pytest.raises(vol.MultipleInvalid):
schema(value)
for value in ('-89', 89, '12.34'):
schema(value)
def test_longitude():
"""Test longitude validation."""
schema = vol.Schema(cv.longitude)
for value in ('invalid', None, -181, 181, '-181', '181', '123.01A'):
with pytest.raises(vol.MultipleInvalid):
schema(value)
for value in ('-179', 179, '12.34'):
schema(value)
def test_port():
"""Test TCP/UDP network port."""
schema = vol.Schema(cv.port)
for value in ('invalid', None, -1, 0, 80000, '81000'):
with pytest.raises(vol.MultipleInvalid):
schema(value)
for value in ('1000', 21, 24574):
schema(value)
def test_isfile():
"""Validate that the value is an existing file."""
schema = vol.Schema(cv.isfile)
fake_file = 'this-file-does-not.exist'
assert not os.path.isfile(fake_file)
for value in ('invalid', None, -1, 0, 80000, fake_file):
with pytest.raises(vol.Invalid):
schema(value)
# patching methods that allow us to fake a file existing
# with write access
with patch('os.path.isfile', Mock(return_value=True)), \
patch('os.access', Mock(return_value=True)):
schema('test.txt')
def test_url():
"""Test URL."""
schema = vol.Schema(cv.url)
for value in ('invalid', None, 100, 'htp://ha.io', 'http//ha.io',
'http://??,**', 'https://??,**'):
with pytest.raises(vol.MultipleInvalid):
schema(value)
for value in ('http://localhost', 'https://localhost/test/index.html',
'http://home-assistant.io', 'http://home-assistant.io/test/',
'https://community.home-assistant.io/'):
assert schema(value)
def test_platform_config():
"""Test platform config validation."""
options = (
{},
{'hello': 'world'},
)
for value in options:
with pytest.raises(vol.MultipleInvalid):
cv.PLATFORM_SCHEMA(value)
options = (
{'platform': 'mqtt'},
{'platform': 'mqtt', 'beer': 'yes'},
)
for value in options:
cv.PLATFORM_SCHEMA(value)
def test_ensure_list():
"""Test ensure_list."""
schema = vol.Schema(cv.ensure_list)
assert [] == schema(None)
assert [1] == schema(1)
assert [1] == schema([1])
assert ['1'] == schema('1')
assert ['1'] == schema(['1'])
assert [{'1': '2'}] == schema({'1': '2'})
def test_entity_id():
"""Test entity ID validation."""
schema = vol.Schema(cv.entity_id)
with pytest.raises(vol.MultipleInvalid):
schema('invalid_entity')
assert schema('sensor.LIGHT') == 'sensor.light'
def test_entity_ids():
"""Test entity ID validation."""
schema = vol.Schema(cv.entity_ids)
options = (
'invalid_entity',
'sensor.light,sensor_invalid',
['invalid_entity'],
['sensor.light', 'sensor_invalid'],
['sensor.light,sensor_invalid'],
)
for value in options:
with pytest.raises(vol.MultipleInvalid):
schema(value)
options = (
[],
['sensor.light'],
'sensor.light'
)
for value in options:
schema(value)
assert schema('sensor.LIGHT, light.kitchen ') == [
'sensor.light', 'light.kitchen'
]
def test_entity_domain():
"""Test entity domain validation."""
schema = vol.Schema(cv.entity_domain('sensor'))
options = (
'invalid_entity',
'cover.demo',
)
for value in options:
with pytest.raises(vol.MultipleInvalid):
print(value)
schema(value)
assert schema('sensor.LIGHT') == 'sensor.light'
def test_entities_domain():
"""Test entities domain validation."""
schema = vol.Schema(cv.entities_domain('sensor'))
options = (
None,
'',
'invalid_entity',
['sensor.light', 'cover.demo'],
['sensor.light', 'sensor_invalid'],
)
for value in options:
with pytest.raises(vol.MultipleInvalid):
schema(value)
options = (
'sensor.light',
['SENSOR.light'],
['sensor.light', 'sensor.demo']
)
for value in options:
schema(value)
assert schema('sensor.LIGHT, sensor.demo ') == [
'sensor.light', 'sensor.demo'
]
assert schema(['sensor.light', 'SENSOR.demo']) == [
'sensor.light', 'sensor.demo'
]
def test_ensure_list_csv():
"""Test ensure_list_csv."""
schema = vol.Schema(cv.ensure_list_csv)
options = (
None,
12,
[],
['string'],
'string1,string2'
)
for value in options:
schema(value)
assert schema('string1, string2 ') == [
'string1', 'string2'
]
def test_event_schema():
"""Test event_schema validation."""
options = (
{}, None,
{
'event_data': {},
},
{
'event': 'state_changed',
'event_data': 1,
},
)
for value in options:
with pytest.raises(vol.MultipleInvalid):
cv.EVENT_SCHEMA(value)
options = (
{'event': 'state_changed'},
{'event': 'state_changed', 'event_data': {'hello': 'world'}},
)
for value in options:
cv.EVENT_SCHEMA(value)
def test_icon():
"""Test icon validation."""
schema = vol.Schema(cv.icon)
for value in (False, 'work'):
with pytest.raises(vol.MultipleInvalid):
schema(value)
schema('mdi:work')
schema('custom:prefix')
def test_time_period():
"""Test time_period validation."""
schema = vol.Schema(cv.time_period)
options = (
None, '', 'hello:world', '12:', '12:34:56:78',
{}, {'wrong_key': -10}
)
for value in options:
with pytest.raises(vol.MultipleInvalid):
schema(value)
options = (
'8:20', '23:59', '-8:20', '-23:59:59', '-48:00', {'minutes': 5}, 1, '5'
)
for value in options:
schema(value)
assert timedelta(seconds=180) == schema('180')
assert timedelta(hours=23, minutes=59) == schema('23:59')
assert -1 * timedelta(hours=1, minutes=15) == schema('-1:15')
def test_service():
"""Test service validation."""
schema = vol.Schema(cv.service)
with pytest.raises(vol.MultipleInvalid):
schema('invalid_turn_on')
schema('homeassistant.turn_on')
def test_service_schema():
"""Test service_schema validation."""
options = (
{}, None,
{
'service': 'homeassistant.turn_on',
'service_template': 'homeassistant.turn_on'
},
{
'data': {'entity_id': 'light.kitchen'},
},
{
'service': 'homeassistant.turn_on',
'data': None
},
{
'service': 'homeassistant.turn_on',
'data_template': {
'brightness': '{{ no_end'
}
},
)
for value in options:
with pytest.raises(vol.MultipleInvalid):
cv.SERVICE_SCHEMA(value)
options = (
{'service': 'homeassistant.turn_on'},
{
'service': 'homeassistant.turn_on',
'entity_id': 'light.kitchen',
},
{
'service': 'homeassistant.turn_on',
'entity_id': ['light.kitchen', 'light.ceiling'],
},
)
for value in options:
cv.SERVICE_SCHEMA(value)
def test_slug():
"""Test slug validation."""
schema = vol.Schema(cv.slug)
for value in (None, 'hello world'):
with pytest.raises(vol.MultipleInvalid):
schema(value)
for value in (12345, 'hello'):
schema(value)
def test_string():
"""Test string validation."""
schema = vol.Schema(cv.string)
with pytest.raises(vol.Invalid):
schema(None)
with pytest.raises(vol.Invalid):
schema([])
with pytest.raises(vol.Invalid):
schema({})
for value in (True, 1, 'hello'):
schema(value)
def test_temperature_unit():
"""Test temperature unit validation."""
schema = vol.Schema(cv.temperature_unit)
with pytest.raises(vol.MultipleInvalid):
schema('K')
schema('C')
schema('F')
def test_x10_address():
"""Test x10 addr validator."""
schema = vol.Schema(cv.x10_address)
with pytest.raises(vol.Invalid):
schema('Q1')
schema('q55')
schema('garbage_addr')
schema('a1')
schema('C11')
def test_template():
"""Test template validator."""
schema = vol.Schema(cv.template)
for value in (None, '{{ partial_print }', '{% if True %}Hello', ['test']):
with pytest.raises(vol.Invalid,
message='{} not considered invalid'.format(value)):
schema(value)
options = (
1, 'Hello',
'{{ beer }}',
'{% if 1 == 1 %}Hello{% else %}World{% endif %}',
)
for value in options:
schema(value)
def test_template_complex():
"""Test template_complex validator."""
schema = vol.Schema(cv.template_complex)
for value in (None, '{{ partial_print }', '{% if True %}Hello'):
with pytest.raises(vol.MultipleInvalid):
schema(value)
options = (
1, 'Hello',
'{{ beer }}',
'{% if 1 == 1 %}Hello{% else %}World{% endif %}',
{'test': 1, 'test2': '{{ beer }}'},
['{{ beer }}', 1]
)
for value in options:
schema(value)
def test_time_zone():
"""Test time zone validation."""
schema = vol.Schema(cv.time_zone)
with pytest.raises(vol.MultipleInvalid):
schema('America/Do_Not_Exist')
schema('America/Los_Angeles')
schema('UTC')
def test_date():
"""Test date validation."""
schema = vol.Schema(cv.date)
for value in ['Not a date', '23:42', '2016-11-23T18:59:08']:
with pytest.raises(vol.Invalid):
schema(value)
schema(datetime.now().date())
schema('2016-11-23')
def test_time():
"""Test date validation."""
schema = vol.Schema(cv.time)
for value in ['Not a time', '2016-11-23', '2016-11-23T18:59:08']:
with pytest.raises(vol.Invalid):
schema(value)
schema(datetime.now().time())
schema('23:42:00')
schema('23:42')
def test_datetime():
"""Test date time validation."""
schema = vol.Schema(cv.datetime)
for value in [date.today(), 'Wrong DateTime', '2016-11-23']:
with pytest.raises(vol.MultipleInvalid):
schema(value)
schema(datetime.now())
schema('2016-11-23T18:59:08')
def test_deprecated(caplog):
"""Test deprecation log."""
schema = vol.Schema({
'venus': cv.boolean,
'mars': cv.boolean
})
deprecated_schema = vol.All(
cv.deprecated('mars'),
schema
)
deprecated_schema({'venus': True})
# pylint: disable=len-as-condition
assert len(caplog.records) == 0
deprecated_schema({'mars': True})
assert len(caplog.records) == 1
assert caplog.records[0].name == __name__
assert ("The 'mars' option (with value 'True') is deprecated, "
"please remove it from your configuration.") in caplog.text
def test_key_dependency():
"""Test key_dependency validator."""
schema = vol.Schema(cv.key_dependency('beer', 'soda'))
options = (
{'beer': None}
)
for value in options:
with pytest.raises(vol.MultipleInvalid):
schema(value)
options = (
{'beer': None, 'soda': None},
{'soda': None}, {}
)
for value in options:
schema(value)
def test_has_at_least_one_key():
"""Test has_at_least_one_key validator."""
schema = vol.Schema(cv.has_at_least_one_key('beer', 'soda'))
for value in (None, [], {}, {'wine': None}):
with pytest.raises(vol.MultipleInvalid):
schema(value)
for value in ({'beer': None}, {'soda': None}):
schema(value)
def test_enum():
"""Test enum validator."""
class TestEnum(enum.Enum):
"""Test enum."""
value1 = "Value 1"
value2 = "Value 2"
schema = vol.Schema(cv.enum(TestEnum))
with pytest.raises(vol.Invalid):
schema('value3')
def test_socket_timeout(): # pylint: disable=invalid-name
"""Test socket timeout validator."""
schema = vol.Schema(cv.socket_timeout)
with pytest.raises(vol.Invalid):
schema(0.0)
with pytest.raises(vol.Invalid):
schema(-1)
assert _GLOBAL_DEFAULT_TIMEOUT == schema(None)
assert schema(1) == 1.0
def test_matches_regex():
"""Test matches_regex validator."""
schema = vol.Schema(cv.matches_regex('.*uiae.*'))
with pytest.raises(vol.Invalid):
schema(1.0)
with pytest.raises(vol.Invalid):
schema(" nrtd ")
test_str = "This is a test including uiae."
assert(schema(test_str) == test_str)
def test_is_regex():
"""Test the is_regex validator."""
schema = vol.Schema(cv.is_regex)
with pytest.raises(vol.Invalid):
schema("(")
with pytest.raises(vol.Invalid):
schema({"a dict": "is not a regex"})
valid_re = ".*"
schema(valid_re)
def test_comp_entity_ids():
"""Test config validation for component entity IDs."""
schema = vol.Schema(cv.comp_entity_ids)
for valid in ('ALL', 'all', 'AlL', 'light.kitchen', ['light.kitchen'],
['light.kitchen', 'light.ceiling'], []):
schema(valid)
for invalid in (['light.kitchen', 'not-entity-id'], '*', ''):
with pytest.raises(vol.Invalid):
schema(invalid)
| tests/helpers/test_config_validation.py | 14,544 | Test enum.
Test boolean validation.
Test config validation for component entity IDs.
Test date validation.
Test date time validation.
Test deprecation log.
Test ensure_list.
Test ensure_list_csv.
Test entities domain validation.
Test entity domain validation.
Test entity ID validation.
Test entity ID validation.
Test enum validator.
Test event_schema validation.
Test has_at_least_one_key validator.
Test icon validation.
Test the is_regex validator.
Validate that the value is an existing file.
Test key_dependency validator.
Test latitude validation.
Test longitude validation.
Test matches_regex validator.
Test platform config validation.
Test TCP/UDP network port.
Test service validation.
Test service_schema validation.
Test slug validation.
Test socket timeout validator.
Test string validation.
Test temperature unit validation.
Test template validator.
Test template_complex validator.
Test date validation.
Test time_period validation.
Test time zone validation.
Test URL.
Test x10 addr validator.
Test config validators.
patching methods that allow us to fake a file existing with write access pylint: disable=len-as-condition pylint: disable=invalid-name | 1,171 | en | 0.386413 |
#!/usr/bin/env python
from wsgiref.simple_server import make_server
import sys
import os
import json
import urlparse
import json
EXTRA_DIR = os.path.realpath(os.path.join(os.path.dirname(__file__)))
if EXTRA_DIR not in sys.path:
sys.path.append(EXTRA_DIR)
import dao
try:
import requests
except ImportError:
print("requests not found - please run: pip install requests")
sys.exit()
def get_tags(image_keys):
mysql = dao.MySQLDAO()
tag_dao = dao.TagDAO(mysql)
return tag_dao.get_tags_for_image_keys(image_keys)
def application(environ, start_response):
# the environment variable CONTENT_LENGTH may be empty or missing
try:
request_body_size = int(environ.get('CONTENT_LENGTH', 0))
except (ValueError):
request_body_size = 0
response_body = ""
request_body = environ['wsgi.input'].read(request_body_size)
keys = json.loads(request_body)
tags = get_tags(keys)
response_body = json.dumps(tags)
status = '200 OK'
response_headers = [
('Content-Type', 'text/json'),
('Content-Length', str(len(response_body)))
]
start_response(status, response_headers)
return [response_body]
if __name__ == '__main__':
image_key = 'YqfCPKsmgXh40NPmI_wuEQ'
print str(get_tags([image_key]))
| api/getTags.py | 1,330 | !/usr/bin/env python the environment variable CONTENT_LENGTH may be empty or missing | 84 | en | 0.361576 |
import io
import os
import ssl
import boto3
import gzip
import json
import time
import uuid
import unittest
import datetime
import requests
from io import BytesIO
from pytz import timezone
from botocore.exceptions import ClientError
from six.moves.urllib.request import Request, urlopen
from localstack import config
from localstack.utils import testutil
from localstack.constants import TEST_AWS_ACCESS_KEY_ID, TEST_AWS_SECRET_ACCESS_KEY
from localstack.utils.aws import aws_stack
from localstack.services.s3 import s3_listener
from localstack.utils.common import (
short_uid, retry, get_service_protocol, to_bytes, safe_requests, to_str, new_tmp_file, rm_rf, load_file)
from localstack.services.awslambda.lambda_utils import LAMBDA_RUNTIME_PYTHON36
TEST_BUCKET_NAME_WITH_POLICY = 'test-bucket-policy-1'
TEST_QUEUE_FOR_BUCKET_WITH_NOTIFICATION = 'test_queue_for_bucket_notification_1'
TEST_BUCKET_WITH_VERSIONING = 'test-bucket-versioning-1'
TEST_BUCKET_NAME_2 = 'test-bucket-2'
TEST_KEY_2 = 'test-key-2'
TEST_GET_OBJECT_RANGE = 17
THIS_FOLDER = os.path.dirname(os.path.realpath(__file__))
TEST_LAMBDA_PYTHON_ECHO = os.path.join(THIS_FOLDER, 'lambdas', 'lambda_triggered_by_s3.py')
TEST_LAMBDA_PYTHON_DOWNLOAD_FROM_S3 = os.path.join(THIS_FOLDER, 'lambdas',
'lambda_triggered_by_sqs_download_s3_file.py')
BATCH_DELETE_BODY = """
<Delete xmlns="http://s3.amazonaws.com/doc/2006-03-01/">
<Object>
<Key>%s</Key>
</Object>
<Object>
<Key>%s</Key>
</Object>
</Delete>
"""
class PutRequest(Request):
""" Class to handle putting with urllib """
def __init__(self, *args, **kwargs):
return Request.__init__(self, *args, **kwargs)
def get_method(self, *args, **kwargs):
return 'PUT'
class TestS3(unittest.TestCase):
def setUp(self):
self.s3_client = aws_stack.connect_to_service('s3')
self.sqs_client = aws_stack.connect_to_service('sqs')
def test_create_bucket_via_host_name(self):
body = """<?xml version="1.0" encoding="UTF-8"?>
<CreateBucketConfiguration xmlns="http://s3.amazonaws.com/doc/2006-03-01/">
<LocationConstraint>eu-central-1</LocationConstraint>
</CreateBucketConfiguration>"""
headers = aws_stack.mock_aws_request_headers('s3')
bucket_name = 'test-%s' % short_uid()
headers['Host'] = '%s.s3.amazonaws.com' % bucket_name
response = requests.put(config.TEST_S3_URL, data=body, headers=headers, verify=False)
self.assertEquals(response.status_code, 200)
response = self.s3_client.get_bucket_location(Bucket=bucket_name)
self.assertEqual(response['ResponseMetadata']['HTTPStatusCode'], 200)
self.assertIn('LocationConstraint', response)
def test_bucket_policy(self):
# create test bucket
self.s3_client.create_bucket(Bucket=TEST_BUCKET_NAME_WITH_POLICY)
# put bucket policy
policy = {
'Version': '2012-10-17',
'Statement': {
'Action': ['s3:GetObject'],
'Effect': 'Allow',
'Resource': 'arn:aws:s3:::bucketName/*',
'Principal': {
'AWS': ['*']
}
}
}
response = self.s3_client.put_bucket_policy(
Bucket=TEST_BUCKET_NAME_WITH_POLICY,
Policy=json.dumps(policy)
)
self.assertEqual(response['ResponseMetadata']['HTTPStatusCode'], 204)
# retrieve and check policy config
saved_policy = self.s3_client.get_bucket_policy(Bucket=TEST_BUCKET_NAME_WITH_POLICY)['Policy']
self.assertEqual(json.loads(saved_policy), policy)
def test_s3_put_object_notification(self):
bucket_name = 'notif-%s' % short_uid()
key_by_path = 'key-by-hostname'
key_by_host = 'key-by-host'
queue_url, queue_attributes = self._create_test_queue()
self._create_test_notification_bucket(queue_attributes, bucket_name=bucket_name)
self.s3_client.put_bucket_versioning(Bucket=bucket_name, VersioningConfiguration={'Status': 'Enabled'})
# put an object where the bucket_name is in the path
obj = self.s3_client.put_object(Bucket=bucket_name, Key=key_by_path, Body='something')
# put an object where the bucket_name is in the host
# it doesn't care about the authorization header as long as it's present
headers = {'Host': '{}.s3.amazonaws.com'.format(bucket_name), 'authorization': 'some_token'}
url = '{}/{}'.format(config.TEST_S3_URL, key_by_host)
# verify=False must be set as this test fails on travis because of an SSL error non-existent locally
response = requests.put(url, data='something else', headers=headers, verify=False)
self.assertTrue(response.ok)
self.assertEqual(self._get_test_queue_message_count(queue_url), '2')
response = self.sqs_client.receive_message(QueueUrl=queue_url)
messages = [json.loads(to_str(m['Body'])) for m in response['Messages']]
record = messages[0]['Records'][0]
self.assertIsNotNone(record['s3']['object']['versionId'])
self.assertEquals(record['s3']['object']['versionId'], obj['VersionId'])
# clean up
self.s3_client.put_bucket_versioning(Bucket=bucket_name, VersioningConfiguration={'Status': 'Disabled'})
self.sqs_client.delete_queue(QueueUrl=queue_url)
self._delete_bucket(bucket_name, [key_by_path, key_by_host])
def test_s3_upload_fileobj_with_large_file_notification(self):
bucket_name = 'notif-large-%s' % short_uid()
queue_url, queue_attributes = self._create_test_queue()
self._create_test_notification_bucket(queue_attributes, bucket_name=bucket_name)
# has to be larger than 64MB to be broken up into a multipart upload
file_size = 75000000
large_file = self.generate_large_file(file_size)
download_file = new_tmp_file()
try:
self.s3_client.upload_file(Bucket=bucket_name, Key=large_file.name, Filename=large_file.name)
self.assertEqual(self._get_test_queue_message_count(queue_url), '1')
# ensure that the first message's eventName is ObjectCreated:CompleteMultipartUpload
messages = self.sqs_client.receive_message(QueueUrl=queue_url, AttributeNames=['All'])
message = json.loads(messages['Messages'][0]['Body'])
self.assertEqual(message['Records'][0]['eventName'], 'ObjectCreated:CompleteMultipartUpload')
# download the file, check file size
self.s3_client.download_file(Bucket=bucket_name, Key=large_file.name, Filename=download_file)
self.assertEqual(os.path.getsize(download_file), file_size)
# clean up
self.sqs_client.delete_queue(QueueUrl=queue_url)
self._delete_bucket(bucket_name, large_file.name)
finally:
# clean up large files
large_file.close()
rm_rf(large_file.name)
rm_rf(download_file)
def test_s3_multipart_upload_with_small_single_part(self):
# In a multipart upload "Each part must be at least 5 MB in size, except the last part."
# https://docs.aws.amazon.com/AmazonS3/latest/API/mpUploadComplete.html
bucket_name = 'notif-large-%s' % short_uid()
key_by_path = 'key-by-hostname'
queue_url, queue_attributes = self._create_test_queue()
self._create_test_notification_bucket(queue_attributes, bucket_name=bucket_name)
# perform upload
self._perform_multipart_upload(bucket=bucket_name, key=key_by_path, zip=True)
self.assertEqual(self._get_test_queue_message_count(queue_url), '1')
# clean up
self.sqs_client.delete_queue(QueueUrl=queue_url)
self._delete_bucket(bucket_name, [key_by_path])
def test_invalid_range_error(self):
bucket_name = 'range-%s' % short_uid()
self.s3_client.create_bucket(Bucket=bucket_name)
self.s3_client.create_bucket(Bucket=bucket_name)
self.s3_client.put_object(Bucket=bucket_name, Key='steve', Body=b'is awesome')
try:
self.s3_client.get_object(Bucket=bucket_name, Key='steve', Range='bytes=1024-4096')
except ClientError as e:
self.assertEqual(e.response['Error']['Code'], 'InvalidRange')
# clean up
self._delete_bucket(bucket_name, ['steve'])
def test_range_key_not_exists(self):
bucket_name = 'range-%s' % short_uid()
self.s3_client.create_bucket(Bucket=bucket_name)
self.s3_client.create_bucket(Bucket=bucket_name)
with self.assertRaises(ClientError) as ctx:
self.s3_client.get_object(Bucket=bucket_name, Key='key', Range='bytes=1024-4096')
self.assertIn('NoSuchKey', str(ctx.exception))
# clean up
self._delete_bucket(bucket_name)
def test_upload_key_with_hash_prefix(self):
bucket_name = 'hash-%s' % short_uid()
self.s3_client.create_bucket(Bucket=bucket_name)
key_name = '#key-with-hash-prefix'
content = b'test 123'
self.s3_client.put_object(Bucket=bucket_name, Key=key_name, Body=content)
downloaded_object = self.s3_client.get_object(Bucket=bucket_name, Key=key_name)
downloaded_content = to_str(downloaded_object['Body'].read())
self.assertEqual(to_str(downloaded_content), to_str(content))
# clean up
self._delete_bucket(bucket_name, [key_name])
with self.assertRaises(Exception):
self.s3_client.head_object(Bucket=bucket_name, Key=key_name)
def test_s3_multipart_upload_acls(self):
bucket_name = 'test-bucket-%s' % short_uid()
self.s3_client.create_bucket(Bucket=bucket_name, ACL='public-read')
def check_permissions(key, expected_perms):
grants = self.s3_client.get_object_acl(Bucket=bucket_name, Key=key)['Grants']
grants = [g for g in grants if 'AllUsers' in g.get('Grantee', {}).get('URI', '')]
self.assertEquals(len(grants), 1)
permissions = grants[0]['Permission']
permissions = permissions if isinstance(permissions, list) else [permissions]
self.assertEquals(len(permissions), expected_perms)
# perform uploads (multipart and regular) and check ACLs
self.s3_client.put_object(Bucket=bucket_name, Key='acl-key0', Body='something')
check_permissions('acl-key0', 1)
self._perform_multipart_upload(bucket=bucket_name, key='acl-key1')
check_permissions('acl-key1', 1)
self._perform_multipart_upload(bucket=bucket_name, key='acl-key2', acl='public-read-write')
check_permissions('acl-key2', 2)
def test_s3_presigned_url_upload(self):
key_by_path = 'key-by-hostname'
bucket_name = 'notif-large-%s' % short_uid()
queue_url, queue_attributes = self._create_test_queue()
self._create_test_notification_bucket(queue_attributes, bucket_name=bucket_name)
self._perform_presigned_url_upload(bucket=bucket_name, key=key_by_path)
self.assertEqual(self._get_test_queue_message_count(queue_url), '1')
# clean up
self.sqs_client.delete_queue(QueueUrl=queue_url)
self._delete_bucket(bucket_name, [key_by_path])
def test_s3_get_response_default_content_type(self):
# When no content type is provided by a PUT request
# 'binary/octet-stream' should be used
# src: https://docs.aws.amazon.com/AmazonS3/latest/API/RESTObjectPUT.html
bucket_name = 'test-bucket-%s' % short_uid()
client = self._get_test_client()
client.create_bucket(Bucket=bucket_name)
# put object
object_key = 'key-by-hostname'
client.put_object(Bucket=bucket_name, Key=object_key, Body='something')
url = client.generate_presigned_url(
'get_object', Params={'Bucket': bucket_name, 'Key': object_key})
# get object and assert headers
response = requests.get(url, verify=False)
self.assertEqual(response.headers['content-type'], 'binary/octet-stream')
# clean up
self._delete_bucket(bucket_name, [object_key])
def test_s3_put_presigned_url_metadata(self):
# Object metadata should be passed as query params via presigned URL
# https://github.com/localstack/localstack/issues/544
bucket_name = 'test-bucket-%s' % short_uid()
client = self._get_test_client()
client.create_bucket(Bucket=bucket_name)
metadata = {
'foo': 'bar'
}
# put object
object_key = 'key-by-hostname'
url = client.generate_presigned_url(
'put_object', Params={'Bucket': bucket_name, 'Key': object_key, 'Metadata': metadata})
# append metadata manually to URL (this is not easily possible with boto3, as "Metadata" cannot
# be passed to generate_presigned_url, and generate_presigned_post works differently)
# get object and assert metadata is present
response = requests.put(url, data='content 123', verify=False)
self.assertLess(response.status_code, 400)
# response body should be empty, see https://github.com/localstack/localstack/issues/1317
self.assertEqual('', to_str(response.content))
response = client.head_object(Bucket=bucket_name, Key=object_key)
self.assertEquals('bar', response.get('Metadata', {}).get('foo'))
# clean up
self._delete_bucket(bucket_name, [object_key])
def test_s3_put_metadata_underscores(self):
# Object metadata keys should accept keys with underscores
# https://github.com/localstack/localstack/issues/1790
bucket_name = 'test-%s' % short_uid()
self.s3_client.create_bucket(Bucket=bucket_name)
# put object
object_key = 'key-with-metadata'
metadata = {'test_meta_1': 'foo', '__meta_2': 'bar'}
self.s3_client.put_object(Bucket=bucket_name, Key=object_key, Metadata=metadata, Body='foo')
metadata_saved = self.s3_client.head_object(Bucket=bucket_name, Key=object_key)['Metadata']
self.assertEqual(metadata, metadata_saved)
# clean up
self._delete_bucket(bucket_name, [object_key])
def test_s3_object_expiry(self):
# handle s3 object expiry
# https://github.com/localstack/localstack/issues/1685
bucket_name = 'test-%s' % short_uid()
self.s3_client.create_bucket(Bucket=bucket_name)
# put object
object_key = 'key-with-metadata'
metadata = {'test_meta_1': 'foo', '__meta_2': 'bar'}
self.s3_client.put_object(Bucket=bucket_name, Key=object_key, Metadata=metadata, Body='foo',
Expires=datetime.datetime.now(timezone('GMT')) - datetime.timedelta(hours=1))
# try to fetch an object which is already expired
self.assertRaises(Exception, self.s3_client.get_object, Bucket=bucket_name, Key=object_key.lower())
self.s3_client.put_object(Bucket=bucket_name, Key=object_key, Metadata=metadata, Body='foo',
Expires=datetime.datetime.now(timezone('GMT')) + datetime.timedelta(hours=1))
# try to fetch has not been expired yet.
resp = self.s3_client.get_object(Bucket=bucket_name, Key=object_key)
self.assertIn('Expires', resp)
# clean up
self._delete_bucket(bucket_name, [object_key])
def test_s3_presigned_url_expired(self):
bucket_name = 'test-bucket-%s' % short_uid()
client = self._get_test_client()
client.create_bucket(Bucket=bucket_name)
# put object and CORS configuration
object_key = 'key-by-hostname'
client.put_object(Bucket=bucket_name, Key=object_key, Body='something')
# get object and assert headers
url = client.generate_presigned_url(
'get_object', Params={'Bucket': bucket_name, 'Key': object_key}, ExpiresIn=2
)
# retrieving it before expiry
resp = requests.get(url, verify=False)
self.assertEqual(resp.status_code, 200)
self.assertEqual(to_str(resp.content), 'something')
# waiting for the url to expire
time.sleep(3)
resp = requests.get(url, verify=False)
self.assertEqual(resp.status_code, 403)
url = client.generate_presigned_url(
'get_object', Params={'Bucket': bucket_name, 'Key': object_key}, ExpiresIn=120
)
resp = requests.get(url, verify=False)
self.assertEqual(resp.status_code, 200)
self.assertEqual(to_str(resp.content), 'something')
# clean up
self._delete_bucket(bucket_name, [object_key])
def test_bucket_availability(self):
bucket_name = 'test_bucket_lifecycle'
returned_empty_lifecycle = s3_listener.get_lifecycle(bucket_name)
self.assertRegexpMatches(returned_empty_lifecycle._content, r'The bucket does not exist')
response = s3_listener.get_replication(bucket_name)
self.assertRegexpMatches(response._content, r'The bucket does not exist')
response = s3_listener.get_encryption(bucket_name)
self.assertRegexpMatches(response._content, r'The bucket does not exist')
response = s3_listener.get_object_lock(bucket_name)
self.assertRegexpMatches(response._content, r'The bucket does not exist')
def test_range_header_body_length(self):
# Test for https://github.com/localstack/localstack/issues/1952
object_key = 'sample.bin'
bucket_name = 'test-%s' % short_uid()
self.s3_client.create_bucket(Bucket=bucket_name)
chunk_size = 1024
with io.BytesIO() as data:
data.write(os.urandom(chunk_size * 2))
data.seek(0)
self.s3_client.upload_fileobj(data, bucket_name, object_key)
range_header = 'bytes=0-%s' % (chunk_size - 1)
resp = self.s3_client.get_object(Bucket=bucket_name, Key=object_key, Range=range_header)
content = resp['Body'].read()
self.assertEquals(len(content), chunk_size)
# clean up
self._delete_bucket(bucket_name, [object_key])
def test_s3_get_response_content_type_same_as_upload_and_range(self):
bucket_name = 'test-bucket-%s' % short_uid()
client = self._get_test_client()
client.create_bucket(Bucket=bucket_name)
# put object
object_key = '/foo/bar/key-by-hostname'
content_type = 'foo/bar; charset=utf-8'
client.put_object(Bucket=bucket_name,
Key=object_key,
Body='something ' * 20,
ContentType=content_type)
url = client.generate_presigned_url(
'get_object', Params={'Bucket': bucket_name, 'Key': object_key}
)
# get object and assert headers
response = requests.get(url, verify=False)
self.assertEqual(response.headers['content-type'], content_type)
# get object using range query and assert headers
response = requests.get(url, headers={'Range': 'bytes=0-18'}, verify=False)
self.assertEqual(response.headers['content-type'], content_type)
self.assertEqual(to_str(response.content), 'something something')
# clean up
self._delete_bucket(bucket_name, [object_key])
def test_s3_get_get_object_headers(self):
object_key = 'sample.bin'
bucket_name = 'test-%s' % short_uid()
self.s3_client.create_bucket(Bucket=bucket_name)
chunk_size = 1024
with io.BytesIO() as data:
data.write(os.urandom(chunk_size * 2))
data.seek(0)
self.s3_client.upload_fileobj(data, bucket_name, object_key)
range_header = 'bytes=0-%s' % (chunk_size - 1)
resp = self.s3_client.get_object(Bucket=bucket_name, Key=object_key, Range=range_header)
self.assertEqual(resp.get('AcceptRanges'), 'bytes')
self.assertIn('x-amz-request-id', resp['ResponseMetadata']['HTTPHeaders'])
self.assertIn('x-amz-id-2', resp['ResponseMetadata']['HTTPHeaders'])
self.assertIn('content-language', resp['ResponseMetadata']['HTTPHeaders'])
self.assertIn('cache-control', resp['ResponseMetadata']['HTTPHeaders'])
self.assertIn('content-encoding', resp['ResponseMetadata']['HTTPHeaders'])
# clean up
self._delete_bucket(bucket_name, [object_key])
def test_s3_head_response_content_length_same_as_upload(self):
bucket_name = 'test-bucket-%s' % short_uid()
client = self._get_test_client()
client.create_bucket(Bucket=bucket_name)
body = 'something body \n \n\r'
# put object
object_key = 'key-by-hostname'
client.put_object(Bucket=bucket_name, Key=object_key, Body=body, ContentType='text/html; charset=utf-8')
url = client.generate_presigned_url(
'head_object', Params={'Bucket': bucket_name, 'Key': object_key}
)
# get object and assert headers
response = requests.head(url, verify=False)
self.assertEqual(response.headers['content-length'], str(len(body)))
# clean up
self._delete_bucket(bucket_name, [object_key])
def test_s3_put_object_chunked_newlines(self):
# Test for https://github.com/localstack/localstack/issues/1571
bucket_name = 'test-bucket-%s' % short_uid()
object_key = 'data'
self.s3_client.create_bucket(Bucket=bucket_name)
body = 'Hello\r\n\r\n\r\n\r\n'
headers = """
Authorization: %s
Content-Type: audio/mpeg
X-Amz-Content-Sha256: STREAMING-AWS4-HMAC-SHA256-PAYLOAD
X-Amz-Date: 20190918T051509Z
X-Amz-Decoded-Content-Length: %s
""" % (aws_stack.mock_aws_request_headers('s3')['Authorization'], len(body))
headers = dict([[field.strip() for field in pair.strip().split(':', 1)]
for pair in headers.strip().split('\n')])
data = ('d;chunk-signature=af5e6c0a698b0192e9aa5d9083553d4d241d81f69ec62b184d05c509ad5166af\r\n' +
'%s\r\n0;chunk-signature=f2a50a8c0ad4d212b579c2489c6d122db88d8a0d0b987ea1f3e9d081074a5937\r\n') % body
# put object
url = '%s/%s/%s' % (config.TEST_S3_URL, bucket_name, object_key)
req = PutRequest(url, to_bytes(data), headers)
urlopen(req, context=ssl.SSLContext()).read()
# get object and assert content length
downloaded_object = self.s3_client.get_object(Bucket=bucket_name, Key=object_key)
download_file_object = to_str(downloaded_object['Body'].read())
self.assertEqual(len(str(download_file_object)), len(body))
self.assertEqual(str(download_file_object), body)
# clean up
self._delete_bucket(bucket_name, [object_key])
def test_s3_put_object_on_presigned_url(self):
bucket_name = 'test-bucket-%s' % short_uid()
client = self._get_test_client()
client.create_bucket(Bucket=bucket_name)
body = 'something body'
# get presigned URL
object_key = 'test-presigned-key'
url = client.generate_presigned_url(
'put_object', Params={'Bucket': bucket_name, 'Key': object_key}
)
# put object
response = requests.put(url, data=body, verify=False)
self.assertEqual(response.status_code, 200)
# get object and compare results
downloaded_object = client.get_object(Bucket=bucket_name, Key=object_key)
download_object = downloaded_object['Body'].read()
self.assertEqual(to_str(body), to_str(download_object))
# clean up
self._delete_bucket(bucket_name, [object_key])
def test_s3_post_object_on_presigned_post(self):
bucket_name = 'test-presigned-%s' % short_uid()
client = self._get_test_client()
client.create_bucket(Bucket=bucket_name)
body = 'something body'
# get presigned URL
object_key = 'test-presigned-post-key'
presigned_request = client.generate_presigned_post(
Bucket=bucket_name, Key=object_key, ExpiresIn=60)
# put object
files = {'file': body}
response = requests.post(presigned_request['url'], data=presigned_request['fields'], files=files, verify=False)
self.assertIn(response.status_code, [200, 204])
# get object and compare results
downloaded_object = client.get_object(Bucket=bucket_name, Key=object_key)
download_object = downloaded_object['Body'].read()
self.assertEqual(to_str(body), to_str(download_object))
# clean up
self._delete_bucket(bucket_name, [object_key])
def test_s3_presigned_post_success_action_status_201_response(self):
bucket_name = 'test-presigned-%s' % short_uid()
client = self._get_test_client()
client.create_bucket(Bucket=bucket_name)
body = 'something body'
# get presigned URL
object_key = 'key-${filename}'
presigned_request = client.generate_presigned_post(
Bucket=bucket_name,
Key=object_key,
Fields={'success_action_status': 201},
ExpiresIn=60
)
files = {'file': ('my-file', body)}
response = requests.post(presigned_request['url'], data=presigned_request['fields'], files=files, verify=False)
# test
expected_response_content = """
<PostResponse>
<Location>{location}</Location>
<Bucket>{bucket}</Bucket>
<Key>{key}</Key>
<ETag>{etag}</ETag>
</PostResponse>
""".format(
location='http://localhost/key-my-file',
bucket=bucket_name,
key='key-my-file',
etag='d41d8cd98f00b204e9800998ecf8427f'
)
self.assertEqual(response.status_code, 201)
self.assertEqual(response.text, expected_response_content)
# clean up
self._delete_bucket(bucket_name, ['key-my-file'])
def test_s3_presigned_post_expires(self):
bucket_name = 'test-bucket-%s' % short_uid()
client = self._get_test_client()
client.create_bucket(Bucket=bucket_name)
# presign a post with a short expiry time
object_key = 'test-presigned-post-key'
presigned_request = client.generate_presigned_post(
Bucket=bucket_name,
Key=object_key,
ExpiresIn=2
)
# sleep so it expires
time.sleep(3)
# attempt to use the presigned request
files = {'file': 'file content'}
response = requests.post(presigned_request['url'], data=presigned_request['fields'], files=files, verify=False)
self.assertEqual(response.status_code, 400)
self.assertTrue('ExpiredToken' in response.text)
# clean up
self._delete_bucket(bucket_name)
def test_s3_delete_response_content_length_zero(self):
bucket_name = 'test-bucket-%s' % short_uid()
client = self._get_test_client()
client.create_bucket(Bucket=bucket_name)
for encoding in None, 'gzip':
# put object
object_key = 'key-by-hostname'
client.put_object(Bucket=bucket_name,
Key=object_key,
Body='something',
ContentType='text/html; charset=utf-8')
url = client.generate_presigned_url(
'delete_object',
Params={'Bucket': bucket_name, 'Key': object_key}
)
# get object and assert headers
headers = {}
if encoding:
headers['Accept-Encoding'] = encoding
response = requests.delete(url, headers=headers, verify=False)
self.assertEqual(response.headers['content-length'],
'0',
f'Unexpected response Content-Length for encoding {encoding}')
# clean up
self._delete_bucket(bucket_name, [object_key])
def test_delete_object_tagging(self):
bucket_name = 'test-%s' % short_uid()
self.s3_client.create_bucket(Bucket=bucket_name, ACL='public-read')
object_key = 'test-key-tagging'
self.s3_client.put_object(Bucket=bucket_name, Key=object_key, Body='something')
# get object and assert response
url = '%s/%s/%s' % (config.TEST_S3_URL, bucket_name, object_key)
response = requests.get(url, verify=False)
self.assertEqual(response.status_code, 200)
# delete object tagging
self.s3_client.delete_object_tagging(Bucket=bucket_name, Key=object_key)
# assert that the object still exists
response = requests.get(url, verify=False)
self.assertEqual(response.status_code, 200)
# clean up
self._delete_bucket(bucket_name, [object_key])
def test_delete_non_existing_keys(self):
bucket_name = 'test-%s' % short_uid()
self.s3_client.create_bucket(Bucket=bucket_name)
object_key = 'test-key-nonexistent'
self.s3_client.put_object(Bucket=bucket_name, Key=object_key, Body='something')
response = self.s3_client.delete_objects(Bucket=bucket_name,
Delete={'Objects': [{'Key': object_key}, {'Key': 'dummy1'}, {'Key': 'dummy2'}]})
self.assertEqual(len(response['Deleted']), 3)
self.assertNotIn('Errors', response)
# clean up
self._delete_bucket(bucket_name)
def test_bucket_exists(self):
# Test setup
bucket = 'test-bucket-%s' % short_uid()
s3_client = aws_stack.connect_to_service('s3')
s3_client.create_bucket(Bucket=bucket)
s3_client.put_bucket_cors(
Bucket=bucket,
CORSConfiguration={
'CORSRules': [{'AllowedMethods': ['GET', 'POST', 'PUT', 'DELETE'],
'AllowedOrigins': ['localhost']}]
}
)
response = s3_client.get_bucket_cors(Bucket=bucket)
self.assertEqual(response['ResponseMetadata']['HTTPStatusCode'], 200)
# Cleanup
s3_client.delete_bucket(Bucket=bucket)
def test_s3_uppercase_names(self):
# bucket name should be case-insensitive
bucket_name = 'TestUpperCase-%s' % short_uid()
self.s3_client.create_bucket(Bucket=bucket_name)
# key name should be case-sensitive
object_key = 'camelCaseKey'
self.s3_client.put_object(Bucket=bucket_name, Key=object_key, Body='something')
self.s3_client.get_object(Bucket=bucket_name, Key=object_key)
self.assertRaises(Exception, self.s3_client.get_object, Bucket=bucket_name, Key=object_key.lower())
def test_s3_get_response_headers(self):
bucket_name = 'test-bucket-%s' % short_uid()
client = self._get_test_client()
client.create_bucket(Bucket=bucket_name)
# put object and CORS configuration
object_key = 'key-by-hostname'
client.put_object(Bucket=bucket_name, Key=object_key, Body='something')
client.put_bucket_cors(Bucket=bucket_name,
CORSConfiguration={
'CORSRules': [{
'AllowedMethods': ['GET', 'PUT', 'POST'],
'AllowedOrigins': ['*'],
'ExposeHeaders': [
'ETag', 'x-amz-version-id'
]
}]
},
)
# get object and assert headers
url = client.generate_presigned_url(
'get_object', Params={'Bucket': bucket_name, 'Key': object_key}
)
response = requests.get(url, verify=False)
self.assertEquals(response.headers['Access-Control-Expose-Headers'], 'ETag,x-amz-version-id')
# clean up
self._delete_bucket(bucket_name, [object_key])
def test_s3_get_response_header_overrides(self):
# Signed requests may include certain header overrides in the querystring
# https://docs.aws.amazon.com/AmazonS3/latest/API/RESTObjectGET.html
bucket_name = 'test-bucket-%s' % short_uid()
client = self._get_test_client()
client.create_bucket(Bucket=bucket_name)
# put object
object_key = 'key-by-hostname'
client.put_object(Bucket=bucket_name, Key=object_key, Body='something')
# get object and assert headers
expiry_date = 'Wed, 21 Oct 2015 07:28:00 GMT'
url = client.generate_presigned_url(
'get_object', Params={
'Bucket': bucket_name,
'Key': object_key,
'ResponseCacheControl': 'max-age=74',
'ResponseContentDisposition': 'attachment; filename="foo.jpg"',
'ResponseContentEncoding': 'identity',
'ResponseContentLanguage': 'de-DE',
'ResponseContentType': 'image/jpeg',
'ResponseExpires': expiry_date}
)
response = requests.get(url, verify=False)
self.assertEqual(response.headers['cache-control'], 'max-age=74')
self.assertEqual(response.headers['content-disposition'], 'attachment; filename="foo.jpg"')
self.assertEqual(response.headers['content-encoding'], 'identity')
self.assertEqual(response.headers['content-language'], 'de-DE')
self.assertEqual(response.headers['content-type'], 'image/jpeg')
# Note: looks like depending on the environment/libraries, we can get different date formats...
possible_date_formats = ['2015-10-21T07:28:00Z', expiry_date]
self.assertIn(response.headers['expires'], possible_date_formats)
# clean up
self._delete_bucket(bucket_name, [object_key])
def test_s3_copy_md5(self):
bucket_name = 'test-bucket-%s' % short_uid()
client = self._get_test_client()
client.create_bucket(Bucket=bucket_name)
# put object
src_key = 'src'
client.put_object(Bucket=bucket_name, Key=src_key, Body='something')
# copy object
dest_key = 'dest'
response = client.copy_object(
Bucket=bucket_name,
CopySource={
'Bucket': bucket_name,
'Key': src_key
},
Key=dest_key
)
self.assertEqual(response['ResponseMetadata']['HTTPStatusCode'], 200)
# Create copy object to try to match s3a setting Content-MD5
dest_key2 = 'dest'
url = client.generate_presigned_url(
'copy_object', Params={'Bucket': bucket_name, 'CopySource': {'Bucket': bucket_name, 'Key': src_key},
'Key': dest_key2}
)
request_response = requests.put(url, verify=False)
self.assertEqual(request_response.status_code, 200)
# Cleanup
self._delete_bucket(bucket_name, [src_key, dest_key, dest_key2])
def test_s3_invalid_content_md5(self):
bucket_name = 'test-bucket-%s' % short_uid()
self.s3_client.create_bucket(Bucket=bucket_name)
# put object with invalid content MD5
hashes = {
'__invalid__': 'InvalidDigest',
'000': 'InvalidDigest',
'not base64 encoded checksum': 'InvalidDigest', # InvalidDigest
'MTIz': 'BadDigest' # "123" base64 encoded
}
for hash, error in hashes.items():
with self.assertRaises(Exception) as ctx:
self.s3_client.put_object(Bucket=bucket_name, Key='test-key',
Body='something', ContentMD5=hash)
self.assertIn(error, str(ctx.exception))
# Cleanup
self.s3_client.delete_bucket(Bucket=bucket_name)
def test_s3_upload_download_gzip(self):
bucket_name = 'test-bucket-%s' % short_uid()
self.s3_client.create_bucket(Bucket=bucket_name)
data = '1234567890 ' * 100
# Write contents to memory rather than a file.
upload_file_object = BytesIO()
with gzip.GzipFile(fileobj=upload_file_object, mode='w') as filestream:
filestream.write(data.encode('utf-8'))
# Upload gzip
self.s3_client.put_object(Bucket=bucket_name, Key='test.gz',
ContentEncoding='gzip', Body=upload_file_object.getvalue())
# Download gzip
downloaded_object = self.s3_client.get_object(Bucket=bucket_name, Key='test.gz')
download_file_object = BytesIO(downloaded_object['Body'].read())
with gzip.GzipFile(fileobj=download_file_object, mode='rb') as filestream:
downloaded_data = filestream.read().decode('utf-8')
self.assertEqual(downloaded_data, data)
def test_set_external_hostname(self):
bucket_name = 'test-bucket-%s' % short_uid()
key = 'test.file'
hostname_before = config.HOSTNAME_EXTERNAL
config.HOSTNAME_EXTERNAL = 'foobar'
try:
content = 'test content 123'
acl = 'public-read'
self.s3_client.create_bucket(Bucket=bucket_name)
# upload file
response = self._perform_multipart_upload(bucket=bucket_name, key=key, data=content, acl=acl)
expected_url = '%s://%s:%s/%s/%s' % (get_service_protocol(), config.HOSTNAME_EXTERNAL,
config.PORT_S3, bucket_name, key)
self.assertEqual(expected_url, response['Location'])
# fix object ACL - currently not directly support for multipart uploads
self.s3_client.put_object_acl(Bucket=bucket_name, Key=key, ACL=acl)
# download object via API
downloaded_object = self.s3_client.get_object(Bucket=bucket_name, Key=key)
self.assertEqual(to_str(downloaded_object['Body'].read()), content)
# download object directly from download link
download_url = response['Location'].replace('%s:' % config.HOSTNAME_EXTERNAL, 'localhost:')
response = safe_requests.get(download_url)
self.assertEqual(response.status_code, 200)
self.assertEqual(to_str(response.content), content)
finally:
config.HOSTNAME_EXTERNAL = hostname_before
def test_s3_website_errordocument(self):
# check that the error document is returned when configured
bucket_name = 'test-bucket-%s' % short_uid()
client = self._get_test_client()
client.create_bucket(Bucket=bucket_name)
client.put_object(Bucket=bucket_name, Key='error.html', Body='This is the error document')
client.put_bucket_website(
Bucket=bucket_name,
WebsiteConfiguration={'ErrorDocument': {'Key': 'error.html'}}
)
url = client.generate_presigned_url(
'get_object', Params={'Bucket': bucket_name, 'Key': 'nonexistent'}
)
response = requests.get(url, verify=False)
self.assertEqual(response.status_code, 200)
self.assertEqual(response.text, 'This is the error document')
# cleanup
client.delete_object(Bucket=bucket_name, Key='error.html')
client.delete_bucket(Bucket=bucket_name)
# check that normal responses are returned for bucket with index configuration, but not error document
bucket_name = 'test-bucket-%s' % short_uid()
client.create_bucket(Bucket=bucket_name)
client.put_bucket_website(
Bucket=bucket_name,
WebsiteConfiguration={'IndexDocument': {'Suffix': 'index.html'}}
)
url = client.generate_presigned_url(
'get_object', Params={'Bucket': bucket_name, 'Key': 'nonexistent'}
)
response = requests.get(url, verify=False)
self.assertEqual(response.status_code, 404)
# cleanup
client.delete_bucket(Bucket=bucket_name)
# check that normal responses are returned for bucket without configuration
bucket_name = 'test-bucket-%s' % short_uid()
client.create_bucket(Bucket=bucket_name)
url = client.generate_presigned_url(
'get_object', Params={'Bucket': bucket_name, 'Key': 'nonexistent'}
)
response = requests.get(url, verify=False)
self.assertEqual(response.status_code, 404)
# cleanup
client.delete_bucket(Bucket=bucket_name)
def test_s3_website_errordocument_missing(self):
# check that 404 is returned when error document is configured but missing
bucket_name = 'test-bucket-%s' % short_uid()
client = self._get_test_client()
client.create_bucket(Bucket=bucket_name)
client.put_bucket_website(
Bucket=bucket_name,
WebsiteConfiguration={'ErrorDocument': {'Key': 'error.html'}}
)
url = client.generate_presigned_url(
'get_object', Params={'Bucket': bucket_name, 'Key': 'nonexistent'}
)
response = requests.get(url, verify=False)
self.assertEqual(response.status_code, 404)
client.delete_bucket(Bucket=bucket_name)
def test_s3_event_notification_with_sqs(self):
key_by_path = 'aws/bucket=2020/test1.txt'
bucket_name = 'notif-sqs-%s' % short_uid()
queue_url, queue_attributes = self._create_test_queue()
self._create_test_notification_bucket(queue_attributes, bucket_name=bucket_name)
self.s3_client.put_bucket_versioning(Bucket=bucket_name, VersioningConfiguration={'Status': 'Enabled'})
body = 'Lorem ipsum dolor sit amet, ... ' * 30
# put an object
self.s3_client.put_object(Bucket=bucket_name, Key=key_by_path, Body=body)
self.assertEqual(self._get_test_queue_message_count(queue_url), '1')
rs = self.sqs_client.receive_message(QueueUrl=queue_url)
record = [json.loads(to_str(m['Body'])) for m in rs['Messages']][0]['Records'][0]
download_file = new_tmp_file()
self.s3_client.download_file(Bucket=bucket_name, Key=key_by_path, Filename=download_file)
self.assertEqual(record['s3']['object']['size'], os.path.getsize(download_file))
# clean up
self.s3_client.put_bucket_versioning(Bucket=bucket_name, VersioningConfiguration={'Status': 'Disabled'})
self.sqs_client.delete_queue(QueueUrl=queue_url)
self._delete_bucket(bucket_name, [key_by_path])
def test_s3_delete_object_with_version_id(self):
test_1st_key = 'aws/s3/testkey1.txt'
test_2nd_key = 'aws/s3/testkey2.txt'
body = 'Lorem ipsum dolor sit amet, ... ' * 30
self.s3_client.create_bucket(Bucket=TEST_BUCKET_WITH_VERSIONING)
self.s3_client.put_bucket_versioning(Bucket=TEST_BUCKET_WITH_VERSIONING,
VersioningConfiguration={'Status': 'Enabled'})
# put 2 objects
rs = self.s3_client.put_object(Bucket=TEST_BUCKET_WITH_VERSIONING, Key=test_1st_key, Body=body)
self.s3_client.put_object(Bucket=TEST_BUCKET_WITH_VERSIONING, Key=test_2nd_key, Body=body)
version_id = rs['VersionId']
# delete 1st object with version
rs = self.s3_client.delete_objects(Bucket=TEST_BUCKET_WITH_VERSIONING,
Delete={'Objects': [{'Key': test_1st_key, 'VersionId': version_id}]})
deleted = rs['Deleted'][0]
self.assertEqual(deleted['Key'], test_1st_key)
self.assertEqual(deleted['VersionId'], version_id)
rs = self.s3_client.list_object_versions(Bucket=TEST_BUCKET_WITH_VERSIONING)
object_versions = [object['VersionId'] for object in rs['Versions']]
self.assertNotIn(version_id, object_versions)
# clean up
self.s3_client.put_bucket_versioning(Bucket=TEST_BUCKET_WITH_VERSIONING,
VersioningConfiguration={'Status': 'Disabled'})
self._delete_bucket(TEST_BUCKET_WITH_VERSIONING, [test_1st_key, test_2nd_key])
def test_etag_on_get_object_call(self):
self.s3_client.create_bucket(Bucket=TEST_BUCKET_NAME_2)
body = 'Lorem ipsum dolor sit amet, ... ' * 30
rs = self.s3_client.put_object(Bucket=TEST_BUCKET_NAME_2, Key=TEST_KEY_2, Body=body)
etag = rs['ETag']
rs = self.s3_client.get_object(
Bucket=TEST_BUCKET_NAME_2,
Key=TEST_KEY_2
)
self.assertIn('ETag', rs)
self.assertEqual(etag, rs['ETag'])
self.assertEqual(rs['ContentLength'], len(body))
rs = self.s3_client.get_object(
Bucket=TEST_BUCKET_NAME_2,
Key=TEST_KEY_2,
Range='bytes=0-{}'.format(TEST_GET_OBJECT_RANGE - 1)
)
self.assertIn('ETag', rs)
self.assertEqual(etag, rs['ETag'])
self.assertEqual(rs['ContentLength'], TEST_GET_OBJECT_RANGE)
# clean up
self._delete_bucket(TEST_BUCKET_NAME_2, [TEST_KEY_2])
def test_get_object_versioning(self):
bucket_name = 'bucket-%s' % short_uid()
self.s3_client.create_bucket(Bucket=bucket_name)
rs = self.s3_client.list_object_versions(
Bucket=bucket_name,
EncodingType='url'
)
self.assertEqual(rs['ResponseMetadata']['HTTPStatusCode'], 200)
self.assertEqual(rs['Name'], bucket_name)
# clean up
self._delete_bucket(bucket_name, [])
def test_bucket_versioning(self):
self.s3_client.create_bucket(Bucket=TEST_BUCKET_WITH_VERSIONING)
self.s3_client.put_bucket_versioning(Bucket=TEST_BUCKET_WITH_VERSIONING,
VersioningConfiguration={'Status': 'Enabled'})
result = self.s3_client.get_bucket_versioning(Bucket=TEST_BUCKET_WITH_VERSIONING)
self.assertEqual(result['Status'], 'Enabled')
def test_get_bucket_versioning_order(self):
bucket_name = 'version-order-%s' % short_uid()
self.s3_client.create_bucket(Bucket=bucket_name)
self.s3_client.put_bucket_versioning(Bucket=bucket_name,
VersioningConfiguration={'Status': 'Enabled'})
self.s3_client.put_object(Bucket=bucket_name, Key='test', Body='body')
self.s3_client.put_object(Bucket=bucket_name, Key='test', Body='body')
self.s3_client.put_object(Bucket=bucket_name, Key='test2', Body='body')
rs = self.s3_client.list_object_versions(
Bucket=bucket_name,
)
self.assertEqual(rs['ResponseMetadata']['HTTPStatusCode'], 200)
self.assertEqual(rs['Name'], bucket_name)
self.assertEqual(rs['Versions'][0]['IsLatest'], True)
self.assertEqual(rs['Versions'][2]['IsLatest'], True)
def test_upload_big_file(self):
bucket_name = 'bucket-big-file-%s' % short_uid()
key1 = 'test_key1'
key2 = 'test_key1'
self.s3_client.create_bucket(Bucket=bucket_name)
body1 = '\x01' * 10000000
rs = self.s3_client.put_object(Bucket=bucket_name, Key=key1, Body=body1)
self.assertEqual(rs['ResponseMetadata']['HTTPStatusCode'], 200)
body2 = 'a' * 10000000
rs = self.s3_client.put_object(Bucket=bucket_name, Key=key2, Body=body2)
self.assertEqual(rs['ResponseMetadata']['HTTPStatusCode'], 200)
rs = self.s3_client.head_object(Bucket=bucket_name, Key=key1)
self.assertEqual(rs['ContentLength'], len(body1))
rs = self.s3_client.head_object(Bucket=bucket_name, Key=key2)
self.assertEqual(rs['ContentLength'], len(body2))
# clean up
self._delete_bucket(bucket_name, [key1, key2])
def test_s3_put_more_than_1000_items(self):
self.s3_client.create_bucket(Bucket=TEST_BUCKET_NAME_2)
for i in range(0, 1010, 1):
body = 'test-' + str(i)
key = 'test-key-' + str(i)
self.s3_client.put_object(Bucket=TEST_BUCKET_NAME_2, Key=key, Body=body)
# trying to get the last item of 1010 items added.
resp = self.s3_client.get_object(Bucket=TEST_BUCKET_NAME_2, Key='test-key-1009')
self.assertEqual(to_str(resp['Body'].read()), 'test-1009')
# trying to get the first item of 1010 items added.
resp = self.s3_client.get_object(Bucket=TEST_BUCKET_NAME_2, Key='test-key-0')
self.assertEqual(to_str(resp['Body'].read()), 'test-0')
resp = self.s3_client.list_objects(Bucket=TEST_BUCKET_NAME_2, MaxKeys=1010)
self.assertEqual(len(resp['Contents']), 1010)
resp = self.s3_client.list_objects(Bucket=TEST_BUCKET_NAME_2)
self.assertEqual(len(resp['Contents']), 1000)
next_marker = resp['NextMarker']
# Second list
resp = self.s3_client.list_objects(Bucket=TEST_BUCKET_NAME_2, Marker=next_marker)
self.assertEqual(len(resp['Contents']), 10)
def test_s3_multipart_upload_file(self):
def upload(size_in_mb, bucket):
file_name = '{}.tmp'.format(short_uid())
path = '{}'.format(file_name)
with open(path, 'wb') as f:
f.seek(int(size_in_mb * 1e6))
f.write(b'\0')
f.flush()
self.s3_client.upload_file(
path,
bucket,
f'{file_name}',
ExtraArgs={'StorageClass': 'DEEP_ARCHIVE'}
)
os.remove(path)
bucket_name = 'bucket-%s' % short_uid()
self.s3_client.create_bucket(Bucket=bucket_name)
upload(1, bucket_name)
upload(9, bucket_name)
upload(15, bucket_name)
s3_resource = aws_stack.connect_to_resource('s3')
objects = s3_resource.Bucket(bucket_name).objects.all()
keys = []
for obj in objects:
keys.append(obj.key)
self.assertEqual(obj.storage_class, 'DEEP_ARCHIVE')
self._delete_bucket(bucket_name, keys)
def test_cors_with_single_origin_error(self):
client = self._get_test_client()
BUCKET_CORS_CONFIG = {
'CORSRules': [{
'AllowedOrigins': ['https://localhost:4200'],
'AllowedMethods': ['GET', 'PUT'],
'MaxAgeSeconds': 3000,
'AllowedHeaders': ['*'],
}]
}
client.create_bucket(Bucket='my-s3-bucket')
client.put_bucket_cors(Bucket='my-s3-bucket', CORSConfiguration=BUCKET_CORS_CONFIG)
# create signed url
url = client.generate_presigned_url(
ClientMethod='put_object',
Params={
'Bucket': 'my-s3-bucket',
'Key': '424f6bae-c48f-42d8-9e25-52046aecc64d/document.pdf',
'ContentType': 'application/pdf',
'ACL': 'bucket-owner-full-control'
},
ExpiresIn=3600
)
result = requests.put(url, data='something', verify=False,
headers={'Origin': 'https://localhost:4200', 'Content-Type': 'application/pdf'})
self.assertEqual(result.status_code, 200)
BUCKET_CORS_CONFIG = {
'CORSRules': [{
'AllowedOrigins': ['https://localhost:4200', 'https://localhost:4201'],
'AllowedMethods': ['GET', 'PUT'],
'MaxAgeSeconds': 3000,
'AllowedHeaders': ['*'],
}]
}
client.put_bucket_cors(Bucket='my-s3-bucket', CORSConfiguration=BUCKET_CORS_CONFIG)
# create signed url
url = client.generate_presigned_url(
ClientMethod='put_object',
Params={
'Bucket': 'my-s3-bucket',
'Key': '424f6bae-c48f-42d8-9e25-52046aecc64d/document.pdf',
'ContentType': 'application/pdf',
'ACL': 'bucket-owner-full-control'
},
ExpiresIn=3600
)
result = requests.put(url, data='something', verify=False,
headers={'Origin': 'https://localhost:4200', 'Content-Type': 'application/pdf'})
self.assertEqual(result.status_code, 200)
result = requests.put(url, data='something', verify=False,
headers={'Origin': 'https://localhost:4201', 'Content-Type': 'application/pdf'})
self.assertEqual(result.status_code, 200)
def test_s3_put_object_notification_with_lambda(self):
bucket_name = 'bucket-%s' % short_uid()
function_name = 'func-%s' % short_uid()
table_name = 'table-%s' % short_uid()
self.s3_client.create_bucket(Bucket=bucket_name)
testutil.create_lambda_function(
handler_file=TEST_LAMBDA_PYTHON_ECHO,
func_name=function_name,
runtime=LAMBDA_RUNTIME_PYTHON36
)
aws_stack.create_dynamodb_table(
table_name=table_name,
partition_key='uuid'
)
self.s3_client.put_bucket_notification_configuration(
Bucket=bucket_name,
NotificationConfiguration={
'LambdaFunctionConfigurations': [
{
'LambdaFunctionArn': aws_stack.lambda_function_arn(function_name),
'Events': ['s3:ObjectCreated:*']
}
]
}
)
# put an object
obj = self.s3_client.put_object(Bucket=bucket_name, Key=table_name, Body='something..')
etag = obj['ETag']
time.sleep(2)
table = aws_stack.connect_to_resource('dynamodb').Table(table_name)
def check_table():
rs = table.scan()
self.assertEqual(len(rs['Items']), 1)
return rs
rs = retry(check_table, retries=4, sleep=3)
record = rs['Items'][0]
self.assertEqual(record['data']['s3']['bucket']['name'], bucket_name)
self.assertEqual(record['data']['s3']['object']['eTag'], etag)
# clean up
self._delete_bucket(bucket_name, [table_name])
lambda_client = aws_stack.connect_to_service('lambda')
lambda_client.delete_function(FunctionName=function_name)
dynamodb_client = aws_stack.connect_to_service('dynamodb')
dynamodb_client.delete_table(TableName=table_name)
def test_s3_put_object_notification_with_sns_topic(self):
bucket_name = 'bucket-%s' % short_uid()
topic_name = 'topic-%s' % short_uid()
queue_name = 'queue-%s' % short_uid()
key_name = 'bucket-key-%s' % short_uid()
sns_client = aws_stack.connect_to_service('sns')
self.s3_client.create_bucket(Bucket=bucket_name)
queue_url = self.sqs_client.create_queue(QueueName=queue_name)['QueueUrl']
topic_arn = sns_client.create_topic(Name=topic_name)['TopicArn']
sns_client.subscribe(TopicArn=topic_arn, Protocol='sqs', Endpoint=aws_stack.sqs_queue_arn(queue_name))
self.s3_client.put_bucket_notification_configuration(
Bucket=bucket_name,
NotificationConfiguration={
'TopicConfigurations': [
{
'TopicArn': topic_arn,
'Events': ['s3:ObjectCreated:*']
}
]
}
)
# Put an object
# This will trigger an event to sns topic, sqs queue will get a message since it's a subscriber of topic
self.s3_client.put_object(Bucket=bucket_name, Key=key_name, Body='body content...')
time.sleep(2)
def get_message(q_url):
resp = self.sqs_client.receive_message(QueueUrl=q_url)
m = resp['Messages'][0]
self.sqs_client.delete_message(
QueueUrl=q_url,
ReceiptHandle=m['ReceiptHandle']
)
return json.loads(m['Body'])
message = retry(get_message, retries=3, sleep=2, q_url=queue_url)
# We got a notification message in sqs queue (from s3 source)
self.assertEqual(message['Type'], 'Notification')
self.assertEqual(message['TopicArn'], topic_arn)
self.assertEqual(message['Subject'], 'Amazon S3 Notification')
r = json.loads(message['Message'])['Records'][0]
self.assertEqual(r['eventSource'], 'aws:s3')
self.assertEqual(r['s3']['bucket']['name'], bucket_name)
self.assertEqual(r['s3']['object']['key'], key_name)
# clean up
self._delete_bucket(bucket_name, [key_name])
self.sqs_client.delete_queue(QueueUrl=queue_url)
sns_client.delete_topic(TopicArn=topic_arn)
def test_s3_get_deep_archive_object(self):
bucket_name = 'bucket-%s' % short_uid()
object_key = 'key-%s' % short_uid()
self.s3_client.create_bucket(Bucket=bucket_name)
# put DEEP_ARCHIVE object
self.s3_client.put_object(
Bucket=bucket_name,
Key=object_key,
Body='body data',
StorageClass='DEEP_ARCHIVE'
)
with self.assertRaises(ClientError) as ctx:
self.s3_client.get_object(
Bucket=bucket_name,
Key=object_key
)
self.assertIn('InvalidObjectState', str(ctx.exception))
# clean up
self._delete_bucket(bucket_name, [object_key])
def test_s3_get_deep_archive_object_restore(self):
bucket_name = 'bucket-%s' % short_uid()
object_key = 'key-%s' % short_uid()
self.s3_client.create_bucket(Bucket=bucket_name)
# put DEEP_ARCHIVE object
self.s3_client.put_object(
Bucket=bucket_name,
Key=object_key,
Body='body data',
StorageClass='DEEP_ARCHIVE'
)
with self.assertRaises(ClientError) as ctx:
self.s3_client.get_object(
Bucket=bucket_name,
Key=object_key
)
self.assertIn('InvalidObjectState', str(ctx.exception))
# put DEEP_ARCHIVE object
self.s3_client.restore_object(
Bucket=bucket_name,
Key=object_key,
RestoreRequest={
'Days': 30,
'GlacierJobParameters': {
'Tier': 'Bulk'
},
'Tier': 'Bulk',
},
)
response = self.s3_client.get_object(
Bucket=bucket_name,
Key=object_key
)
self.assertIn('etag', response.get('ResponseMetadata').get('HTTPHeaders'))
# clean up
self._delete_bucket(bucket_name, [object_key])
def test_encoding_notification_messages(self):
key = 'a@b'
bucket_name = 'notif-enc-%s' % short_uid()
queue_url = self.sqs_client.create_queue(QueueName='testQueue')['QueueUrl']
queue_attributes = self.sqs_client.get_queue_attributes(QueueUrl=queue_url, AttributeNames=['QueueArn'])
self._create_test_notification_bucket(queue_attributes, bucket_name=bucket_name)
# put an object where the bucket_name is in the path
self.s3_client.put_object(Bucket=bucket_name, Key=key, Body='something')
response = self.sqs_client.receive_message(QueueUrl=queue_url)
self.assertEqual(json.loads(response['Messages'][0]['Body'])['Records'][0]['s3']['object']['key'], 'a%40b')
# clean up
self.s3_client.delete_objects(Bucket=bucket_name, Delete={'Objects': [{'Key': key}]})
def test_s3_batch_delete_objects_using_requests(self):
bucket_name = 'bucket-%s' % short_uid()
object_key_1 = 'key-%s' % short_uid()
object_key_2 = 'key-%s' % short_uid()
self.s3_client.create_bucket(Bucket=bucket_name)
self.s3_client.put_object(Bucket=bucket_name, Key=object_key_1, Body='This body document')
self.s3_client.put_object(Bucket=bucket_name, Key=object_key_2, Body='This body document')
base_url = '{}://{}:{}'.format(get_service_protocol(), config.LOCALSTACK_HOSTNAME, config.PORT_S3)
url = '{}/{}?delete='.format(base_url, bucket_name)
r = requests.post(url=url, data=BATCH_DELETE_BODY % (object_key_1, object_key_2))
self.assertEqual(r.status_code, 200)
s3_resource = aws_stack.connect_to_resource('s3')
bucket = s3_resource.Bucket(bucket_name)
total_keys = sum(1 for _ in bucket.objects.all())
self.assertEqual(total_keys, 0)
# clean up
self._delete_bucket(bucket_name, [])
def test_presigned_url_signature_authentication(self):
client = self._get_test_client()
OBJECT_KEY = 'test.txt'
OBJECT_DATA = 'this should be found in when you download {}.'.format(OBJECT_KEY)
BUCKET = 'presign-testing'
client.create_bucket(Bucket=BUCKET)
presign_url = client.generate_presigned_url(
'put_object',
Params={'Bucket': BUCKET, 'Key': OBJECT_KEY},
ExpiresIn=3
)
# Valid request
response = requests.put(presign_url, data=OBJECT_DATA)
self.assertEqual(response.status_code, 200)
# Invalid request
response = requests.put(presign_url, data=OBJECT_DATA, headers={'Content-Type': 'my-fake-content/type'})
self.assertEqual(response.status_code, 403)
# Expired request
time.sleep(3)
response = requests.put(presign_url, data=OBJECT_DATA)
self.assertEqual(response.status_code, 403)
client.delete_object(Bucket=BUCKET, Key=OBJECT_KEY)
client.delete_bucket(Bucket=BUCKET)
def test_precondition_failed_error(self):
bucket = 'bucket-%s' % short_uid()
client = self._get_test_client()
client.create_bucket(Bucket=bucket)
client.put_object(Bucket=bucket, Key='foo', Body=b'{"foo": "bar"}')
# this line makes localstack crash:
try:
client.get_object(Bucket=bucket, Key='foo', IfMatch='"not good etag"')
except ClientError as e:
self.assertEqual(e.response['Error']['Code'], 'PreconditionFailed')
self.assertEqual(e.response['Error']['Message'], 'At least one of the pre-conditions you '
'specified did not hold')
client.delete_object(Bucket=bucket, Key='foo')
client.delete_bucket(Bucket=bucket)
def test_cors_configurtaions(self):
client = self._get_test_client()
bucket = 'test-cors'
object_key = 'index.html'
url = '{}/{}/{}'.format(config.get_edge_url(), bucket, object_key)
BUCKET_CORS_CONFIG = {
'CORSRules': [{
'AllowedOrigins': [config.get_edge_url()],
'AllowedMethods': ['GET', 'PUT'],
'MaxAgeSeconds': 3000,
'AllowedHeaders': ['x-amz-tagging'],
}]
}
client.create_bucket(Bucket=bucket)
client.put_bucket_cors(Bucket=bucket, CORSConfiguration=BUCKET_CORS_CONFIG)
client.put_object(Bucket=bucket, Key=object_key, Body='<h1>Index</html>')
response = requests.get(url,
headers={'Origin': config.get_edge_url(), 'Content-Type': 'text/html'})
self.assertEqual(response.status_code, 200)
self.assertIn('Access-Control-Allow-Origin'.lower(), response.headers)
self.assertEqual(response.headers['Access-Control-Allow-Origin'], config.get_edge_url())
self.assertIn('Access-Control-Allow-Methods'.lower(), response.headers)
self.assertIn('GET', response.headers['Access-Control-Allow-Methods'])
self.assertIn('Access-Control-Allow-Headers', response.headers)
self.assertEqual(response.headers['Access-Control-Allow-Headers'], 'x-amz-tagging')
self.assertIn('Access-Control-Max-Age'.lower(), response.headers)
self.assertEqual(response.headers['Access-Control-Max-Age'], '3000')
self.assertIn('Access-Control-Allow-Credentials'.lower(), response.headers)
self.assertEqual(response.headers['Access-Control-Allow-Credentials'].lower(), 'true')
BUCKET_CORS_CONFIG = {
'CORSRules': [{
'AllowedOrigins': ['https://anydomain.com'],
'AllowedMethods': ['GET', 'PUT'],
'MaxAgeSeconds': 3000,
'AllowedHeaders': ['x-amz-tagging'],
}]
}
client.put_bucket_cors(Bucket=bucket, CORSConfiguration=BUCKET_CORS_CONFIG)
response = requests.get(url,
headers={'Origin': config.get_edge_url(), 'Content-Type': 'text/html'})
self.assertEqual(response.status_code, 200)
self.assertNotIn('Access-Control-Allow-Origin'.lower(), response.headers)
self.assertNotIn('Access-Control-Allow-Methods'.lower(), response.headers)
self.assertNotIn('Access-Control-Allow-Headers', response.headers)
self.assertNotIn('Access-Control-MaxAge', response.headers)
# cleaning
client.delete_object(Bucket=bucket, Key=object_key)
client.delete_bucket(Bucket=bucket)
def test_s3_download_object_with_lambda(self):
bucket_name = 'bucket-%s' % short_uid()
function_name = 'func-%s' % short_uid()
key = 'key-%s' % short_uid()
self.s3_client.create_bucket(Bucket=bucket_name)
self.s3_client.put_object(Bucket=bucket_name, Key=key, Body='something..')
testutil.create_lambda_function(
handler_file=TEST_LAMBDA_PYTHON_DOWNLOAD_FROM_S3,
func_name=function_name,
runtime=LAMBDA_RUNTIME_PYTHON36,
envvars=dict({
'BUCKET_NAME': bucket_name,
'OBJECT_NAME': key,
'LOCAL_FILE_NAME': '/tmp/' + key,
})
)
lambda_client = aws_stack.connect_to_service('lambda')
lambda_client.invoke(FunctionName=function_name, InvocationType='Event')
retry(testutil.check_expected_lambda_log_events_length, retries=10,
sleep=3, function_name=function_name, expected_length=1)
# clean up
self._delete_bucket(bucket_name, [key])
lambda_client.delete_function(FunctionName=function_name)
def test_putobject_with_multiple_keys(self):
client = self._get_test_client()
bucket = 'bucket-%s' % short_uid()
key_by_path = 'aws/key1/key2/key3'
client.create_bucket(Bucket=bucket)
client.put_object(
Body=b'test',
Bucket=bucket,
Key=key_by_path
)
# Cleanup
self._delete_bucket(bucket, key_by_path)
def test_terraform_request_sequence(self):
reqs = load_file(os.path.join(os.path.dirname(__file__), 'files', 's3.requests.txt'))
reqs = reqs.split('---')
for req in reqs:
header, _, body = req.strip().partition('\n\n')
req, _, headers = header.strip().partition('\n')
headers = {h.split(':')[0]: h.partition(':')[2].strip() for h in headers.split('\n')}
method, path, _ = req.split(' ')
url = '%s%s' % (config.get_edge_url(), path)
result = getattr(requests, method.lower())(url, data=body, headers=headers)
self.assertLess(result.status_code, 400)
# ---------------
# HELPER METHODS
# ---------------
@staticmethod
def generate_large_file(size):
# https://stackoverflow.com/questions/8816059/create-file-of-particular-size-in-python
filename = 'large_file_%s' % uuid.uuid4()
f = open(filename, 'wb')
f.seek(size - 1)
f.write(b'\0')
f.close()
return open(filename, 'r')
def _create_test_queue(self):
queue_url = self.sqs_client.create_queue(QueueName=TEST_QUEUE_FOR_BUCKET_WITH_NOTIFICATION)['QueueUrl']
queue_attributes = self.sqs_client.get_queue_attributes(QueueUrl=queue_url, AttributeNames=['QueueArn'])
return queue_url, queue_attributes
def _create_test_notification_bucket(self, queue_attributes, bucket_name):
self.s3_client.create_bucket(Bucket=bucket_name)
self.s3_client.put_bucket_notification_configuration(
Bucket=bucket_name,
NotificationConfiguration={
'QueueConfigurations': [
{
'QueueArn': queue_attributes['Attributes']['QueueArn'],
'Events': ['s3:ObjectCreated:*']
}
]
}
)
def _get_test_queue_message_count(self, queue_url):
queue_attributes = self.sqs_client.get_queue_attributes(
QueueUrl=queue_url, AttributeNames=['ApproximateNumberOfMessages']
)
return queue_attributes['Attributes']['ApproximateNumberOfMessages']
def _delete_bucket(self, bucket_name, keys=[]):
keys = keys if isinstance(keys, list) else [keys]
objects = [{'Key': k} for k in keys]
if objects:
self.s3_client.delete_objects(Bucket=bucket_name, Delete={'Objects': objects})
self.s3_client.delete_bucket(Bucket=bucket_name)
def _perform_multipart_upload(self, bucket, key, data=None, zip=False, acl=None):
kwargs = {'ACL': acl} if acl else {}
multipart_upload_dict = self.s3_client.create_multipart_upload(Bucket=bucket, Key=key, **kwargs)
upload_id = multipart_upload_dict['UploadId']
# Write contents to memory rather than a file.
data = data or (5 * short_uid())
data = to_bytes(data)
upload_file_object = BytesIO(data)
if zip:
upload_file_object = BytesIO()
with gzip.GzipFile(fileobj=upload_file_object, mode='w') as filestream:
filestream.write(data)
response = self.s3_client.upload_part(Bucket=bucket, Key=key,
Body=upload_file_object, PartNumber=1, UploadId=upload_id)
multipart_upload_parts = [{'ETag': response['ETag'], 'PartNumber': 1}]
return self.s3_client.complete_multipart_upload(
Bucket=bucket, Key=key, MultipartUpload={'Parts': multipart_upload_parts}, UploadId=upload_id
)
def _perform_presigned_url_upload(self, bucket, key):
client = self._get_test_client()
url = client.generate_presigned_url(
'put_object', Params={'Bucket': bucket, 'Key': key}
)
url = url + '&X-Amz-Credential=x&X-Amz-Signature=y'
requests.put(url, data='something', verify=False)
def _get_test_client(self):
return boto3.client(
's3',
endpoint_url=config.get_edge_url(),
aws_access_key_id=TEST_AWS_ACCESS_KEY_ID,
aws_secret_access_key=TEST_AWS_SECRET_ACCESS_KEY
)
| tests/integration/test_s3.py | 70,713 | Class to handle putting with urllib
create test bucket put bucket policy retrieve and check policy config put an object where the bucket_name is in the path put an object where the bucket_name is in the host it doesn't care about the authorization header as long as it's present verify=False must be set as this test fails on travis because of an SSL error non-existent locally clean up has to be larger than 64MB to be broken up into a multipart upload ensure that the first message's eventName is ObjectCreated:CompleteMultipartUpload download the file, check file size clean up clean up large files In a multipart upload "Each part must be at least 5 MB in size, except the last part." https://docs.aws.amazon.com/AmazonS3/latest/API/mpUploadComplete.html perform upload clean up clean up clean up clean up perform uploads (multipart and regular) and check ACLs clean up When no content type is provided by a PUT request 'binary/octet-stream' should be used src: https://docs.aws.amazon.com/AmazonS3/latest/API/RESTObjectPUT.html put object get object and assert headers clean up Object metadata should be passed as query params via presigned URL https://github.com/localstack/localstack/issues/544 put object append metadata manually to URL (this is not easily possible with boto3, as "Metadata" cannot be passed to generate_presigned_url, and generate_presigned_post works differently) get object and assert metadata is present response body should be empty, see https://github.com/localstack/localstack/issues/1317 clean up Object metadata keys should accept keys with underscores https://github.com/localstack/localstack/issues/1790 put object clean up handle s3 object expiry https://github.com/localstack/localstack/issues/1685 put object try to fetch an object which is already expired try to fetch has not been expired yet. clean up put object and CORS configuration get object and assert headers retrieving it before expiry waiting for the url to expire clean up Test for https://github.com/localstack/localstack/issues/1952 clean up put object get object and assert headers get object using range query and assert headers clean up clean up put object get object and assert headers clean up Test for https://github.com/localstack/localstack/issues/1571 put object get object and assert content length clean up get presigned URL put object get object and compare results clean up get presigned URL put object get object and compare results clean up get presigned URL test clean up presign a post with a short expiry time sleep so it expires attempt to use the presigned request clean up put object get object and assert headers clean up get object and assert response delete object tagging assert that the object still exists clean up clean up Test setup Cleanup bucket name should be case-insensitive key name should be case-sensitive put object and CORS configuration get object and assert headers clean up Signed requests may include certain header overrides in the querystring https://docs.aws.amazon.com/AmazonS3/latest/API/RESTObjectGET.html put object get object and assert headers Note: looks like depending on the environment/libraries, we can get different date formats... clean up put object copy object Create copy object to try to match s3a setting Content-MD5 Cleanup put object with invalid content MD5 InvalidDigest "123" base64 encoded Cleanup Write contents to memory rather than a file. Upload gzip Download gzip upload file fix object ACL - currently not directly support for multipart uploads download object via API download object directly from download link check that the error document is returned when configured cleanup check that normal responses are returned for bucket with index configuration, but not error document cleanup check that normal responses are returned for bucket without configuration cleanup check that 404 is returned when error document is configured but missing put an object clean up put 2 objects delete 1st object with version clean up clean up clean up clean up trying to get the last item of 1010 items added. trying to get the first item of 1010 items added. Second list create signed url create signed url put an object clean up Put an object This will trigger an event to sns topic, sqs queue will get a message since it's a subscriber of topic We got a notification message in sqs queue (from s3 source) clean up put DEEP_ARCHIVE object clean up put DEEP_ARCHIVE object put DEEP_ARCHIVE object clean up put an object where the bucket_name is in the path clean up clean up Valid request Invalid request Expired request this line makes localstack crash: cleaning clean up Cleanup --------------- HELPER METHODS --------------- https://stackoverflow.com/questions/8816059/create-file-of-particular-size-in-python Write contents to memory rather than a file. | 4,827 | en | 0.850412 |
# Generated by Django 2.2.1 on 2019-11-18 10:44
from django.db import migrations
class Migration(migrations.Migration):
dependencies = [
('core', '0020_auto_20191112_1048'),
]
operations = [
migrations.AlterModelOptions(
name='payment',
options={'ordering': ('date',), 'verbose_name': 'betaling', 'verbose_name_plural': 'betalinger'},
),
]
| backend/core/migrations/0021_auto_20191118_1144.py | 409 | Generated by Django 2.2.1 on 2019-11-18 10:44 | 45 | en | 0.574809 |
#!/usr/bin/env python3
# -*- coding: utf-8 -*-
"""
Created on Wed Jan 10 19:37:19 2018
@author: kaustabh
"""
#making a single list representing all sides in a serial fashion
r = ['w1','w2','w3','w4','w5','w6','w7','w8','w9','b1','b2','b3','r1','r2','r3','g1','g2','g3','o1','o2','o3','b4','b5','b6','r4','r5','r6','g4','g5','g6','o4','o5','o6','b7','b8','b9','r7','r8','r9','g7','g8','g9','o7','o8','o9', 'y1','y2','y3','y4','y5','y6','y7','y8','y9']
real = r[:]
# cube is the list and we can't use random.shuffle because certain colors stay together
def shift(r,L): #r is cube list ; L is 12 element array to be shifted
t1 = r[L[0]]
t2 = r[L[1]]
t3 = r[L[2]]
r[L[0]] , r[L[3]] = r[L[3]] , r[L[0]]
r[L[1]] , r[L[4]] = r[L[4]] , r[L[1]]
r[L[2]] , r[L[5]] = r[L[5]] , r[L[2]]
r[L[3]] , r[L[6]] = r[L[6]] , r[L[3]]
r[L[4]] , r[L[7]] = r[L[7]] , r[L[4]]
r[L[5]] , r[L[8]] = r[L[8]] , r[L[5]]
r[L[6]] , r[L[9]] = r[L[9]] , r[L[6]]
r[L[7]] , r[L[10]] = r[L[10]] , r[L[7]]
r[L[8]] , r[L[11]] = r[L[11]] , r[L[8]]
r[L[9]] = t1
r[L[10]] = t2
r[L[11]] = t3
return r
def rotate(r, L): #a face will also rotate
t1 = r[L[0]]
t2 = r[L[7]]
r[L[0]] , r[L[6]] = r[L[6]] , r[L[0]]
r[L[7]] , r[L[5]] = r[L[5]] , r[L[7]]
r[L[6]] , r[L[4]] = r[L[4]] , r[L[6]]
r[L[3]] , r[L[5]] = r[L[5]] , r[L[3]]
r[L[2]] , r[L[4]] = r[L[4]] , r[L[2]]
r[L[1]] , r[L[3]] = r[L[3]] , r[L[1]]
r[L[2]] = t1
r[L[1]] = t2
return
def right_c(r):
L = [33,34,35,36,37,38,39,40,41,42,43,44]
rt = [45,48,51,52,53,50,47,46]
rotate(r,rt)
return shift(r, L)
def right_ac(r):
L = [33,34,35,36,37,38,39,40,41,42,43,44]
L.reverse()
rt = [45,48,51,52,53,50,47,46]
rt.reverse()
rotate(r,rt)
return shift(r, L)
def left_ac(r):
rt = [0,1,2,5,8,7,6,3]
rotate(r,rt)
L = [9,10,11,12,13,14,15,16,17,18,19,20]
return shift(r, L)
def left_c(r):
rt = [0,1,2,5,8,7,6,3]
rt.reverse()
rotate(r,rt)
L = [9,10,11,12,13,14,15,16,17,18,19,20]
L.reverse()
return shift(r, L)
def up_c(r):
rt = [9,21,33,34,35,23,11,10]
rotate(r, rt)
L = [0,3,6,12,24,36,45,48,51,18,30,42]
return shift(r, L)
def up_ac(r):
rt = [9,21,33,34,35,23,11,10]
rt.reverse()
rotate(r, rt)
L = [0,3,6,12,24,36,45,48,51,18,30,42]
L.reverse()
return shift(r, L)
def down_ac(r):
rt = [15,16,17,29,41,40,39,27]
rotate(r,rt)
L = [2,5,8,14,26,38,47,50,53,20,32,44]
return shift(r, L)
def down_c(r):
rt = [15,16,17,29,41,40,39,27]
rt.reverse()
rotate(r,rt)
L = [2,5,8,14,26,38,47,50,53,20,32,44]
L.reverse()
return shift(r, L)
def front_c(r):
rt = [12,24,36,37,38,26,14,13]
rotate(r,rt)
L = [11,23,35,45,46,47,39,27,15,8,7,6]
return shift(r, L)
def front_ac(r):
rt = [12,24,36,37,38,26,14,13]
rt.reverse()
rotate(r,rt)
L = [11,23,35,45,46,47,39,27,15,8,7,6]
L.reverse()
return shift(r, L)
def back_c(r):
rt= [18,30,42,43,44,32,20,19]
rotate(r,rt)
L = [0,3,6,9,21,33,45,48,51,15,27,39]
return shift(r, L)
def back_ac(r):
rt= [18,30,42,43,44,32,20,19]
rt.reverse()
rotate(r,rt)
L = [0,3,6,9,21,33,45,48,51,15,27,39]
L.reverse()
return shift(r, L)
def shuffle(r):
import random
for i in range(random.randint(17,32)):
random.choice([right_c(r),left_c(r),up_c(r),down_c(r),front_c(r),back_c(r),back_ac(r),right_ac(r),left_ac(r),up_ac(r),front_ac(r),down_ac(r)])
return r
def reset():
return real[:]
def display(r):
for j in range(15):
for i in range(9):
if j == 0 :
if i == 0 :
print(" ")
while i<4:
print(" ", end='')
i += 1
if i == 5:
print(r[9]+" "+r[21]+" "+r[33],end='\n')
if j == 1 :
while i<4:
print(" ", end='')
i += 1
if i == 5:
print(r[10]+" "+r[22]+" "+r[34],end='\n')
if j == 2 :
while i<4:
print(" ", end='')
i += 1
if i == 5:
print(r[11]+" "+r[23]+" "+r[35],end='\n')
if j == 3 :
if i == 0:
print(" ")
if j == 4 :
if i==0 :
print(r[0]+" "+r[3]+" "+r[6]+" ",end='')
if i==3 :
print(r[12]+" "+r[24]+" "+r[36]+" ",end='')
if i==6 :
print(" "+r[45]+" "+r[48]+" "+r[51],end='\n')
if j == 5 :
if i==0 :
print(r[1]+" "+r[4]+" "+r[7]+" ",end='')
if i==3 :
print(r[13]+" "+r[25]+" "+r[37]+" ",end='')
if i==6 :
print(" "+r[46]+" "+r[49]+" "+r[52],end='\n')
if j == 6 :
if i==0 :
print(r[2]+" "+r[5]+" "+r[8]+" ",end='')
if i==3 :
print(r[15]+" "+r[26]+" "+r[38]+" ",end='')
if i==6 :
print(" "+r[47]+" "+r[50]+" "+r[53],end='\n')
if j == 7 :
if i==0:
print(" ")
if j == 8 :
while i<4:
print(" ", end='')
i += 1
if i == 5:
print(r[15]+" "+r[27]+" "+r[39],end='\n')
if j == 9 :
while i<4:
print(" ", end='')
i += 1
if i == 5:
print(r[16]+" "+r[28]+" "+r[40],end='\n')
if j == 10 :
while i<4:
print(" ", end='')
i += 1
if i == 5:
print(r[17]+" "+r[29]+" "+r[41],end='\n')
if j == 11 :
if i==0 :
print(" ")
if j == 12 :
while i<4:
print(" ", end='')
i += 1
if i == 5:
print(r[18]+" "+r[30]+" "+r[42],end='\n')
if j == 13 :
while i<4:
print(" ", end='')
i += 1
if i == 5:
print(r[19]+" "+r[31]+" "+r[43],end='\n')
if j == 14 :
while i<4:
print(" ", end='')
i += 1
if i == 5:
print(r[20]+" "+r[32]+" "+r[44],end='\n')
if i == 8:
print(" ")
print(" ------------------------------------- ")
return ' '.join(r)
print(r)
display(r)
left_ac(r)
left_ac(r)
display(r)
left_ac(r)
left_ac(r)
display(r)
| Rubikmovement.py | 7,534 | Created on Wed Jan 10 19:37:19 2018
@author: kaustabh
!/usr/bin/env python3 -*- coding: utf-8 -*-making a single list representing all sides in a serial fashion cube is the list and we can't use random.shuffle because certain colors stay togetherr is cube list ; L is 12 element array to be shifteda face will also rotate | 323 | en | 0.849661 |
from pavilion import result_parsers
import yaml_config as yc
import re
import sre_constants
class Regex(result_parsers.ResultParser):
"""Find matches to the given regex in the given file. The matched string
or strings are returned as the result."""
def __init__(self):
super().__init__(name='regex',
description="Find data using a basic regular "
"expression.")
self.range_re = re.compile('(-?[0-9]*\.?[0-9]*):(-?.*)')
def get_config_items(self):
config_items = super().get_config_items()
config_items.extend([
yc.StrElem(
'regex', required=True,
help_text="The python regex to use to search the given file. "
"See: 'https://docs.python.org/3/library/re.html' "
"You can use single quotes in YAML to have the "
"string interpreted literally. IE '\\n' is a '\\' "
"and an 'n'."
),
# Use the built-in matches element.
result_parsers.MATCHES_ELEM,
yc.StrElem(
'threshold', default="",
help_text="If a threshold is defined, 'True' will be returned "
"if greater than or equal to that many instances "
"of the specified word are found. If fewer "
"instances are found, 'False' is returned. The "
"value must be an integer greater than zero."
),
yc.ListElem(
'expected', sub_elem=yc.StrElem(),
help_text="Expected value(s) and/or range(s). If provided, "
"the result will be 'True' if all of the found "
"values (determined by the 'results' value) are "
"within the expected range(s) or value(s). "
"Otherwise, the result is 'False'. Supports "
"integers and floats."
)
])
return config_items
def _check_args(self, regex=None, match_type=None, threshold=None,
expected=None):
try:
re.compile(regex)
except (ValueError, sre_constants.error) as err:
raise result_parsers.ResultParserError(
"Invalid regular expression: {}".format(err))
if not isinstance(expected, list):
raise result_parsers.ResultParserError(
"Expected should be a list.")
if threshold:
try:
int(threshold)
except ValueError as err:
raise result_parsers.ResultParserError(
"Non-integer value provided for 'threshold'.")
if int(threshold) < 0:
raise result_parsers.ResultParserError(
"'threshold' must be a non-negative integer.")
if expected:
raise result_parsers.ResultParserError(
"'threshold' and 'expected' cannot be used at the same "
"time.")
for item in expected:
test_list = []
if ':' in item:
test_list = list(self.range_re.search(item).groups())
else:
test_list = [ item ]
none_used = False
for test_item in test_list:
if test_item is '':
if not none_used:
none_used = True
else:
raise result_parsers.ResultParserError(
"No values provided in range: {}"
.format(test_list))
else:
try:
# If the value is an int, it seems to work better to
# cast it as a float first, just in case it is a float.
float(test_item)
except ValueError as err:
raise result_parsers.ResultParserError(
"Invalid value: {}".format(test_item)
)
if len(test_list) > 1:
if '.' in test_list[0]:
low = float(test_list[0])
elif test_list[0] != '':
low = int(test_list[0])
if '.' in test_list[1]:
high = float(test_list[1])
elif test_list[1] != '':
high = int(test_list[1])
# Check for range specification as
# (<lesser value>:<greater value>)
if '' not in test_list and high < low:
raise result_parsers.ResultParserError(
"Invalid range: {}".format(item))
def __call__(self, test, file, regex=None, match_type=None, threshold=None,
expected=None):
regex = re.compile(regex)
matches = []
for line in file.readlines():
# Find all non-overlapping matches and return them as a list.
# if more than one capture is used, list contains tuples of
# captured strings.
matches.extend(regex.findall(line))
# Test if the number of matches meets the specified threshold
if threshold and int(threshold) > 0:
return len(matches) >= int(threshold)
elif match_type == result_parsers.MATCH_FIRST:
matches = None if not matches else matches[0]
elif match_type == result_parsers.MATCH_LAST:
matches = None if not matches else matches[-1]
elif match_type == result_parsers.MATCH_ALL:
pass
else:
raise result_parsers.ResultParserError(
"Invalid 'matches' value '{}'".format('matches')
)
# Test if the found values are within any of the specified expected
# ranges.
if not expected:
return matches# if matches else None
else:
if not isinstance(matches, list):
matches = [matches]
ret_vals = []
for i in range(0,len(matches)):
match = matches[i]
if '.' in match:
match = float(match)
elif match != '':
match = int(match)
for j in range(0,len(expected)):
# Not a range, checking for exact match.
if ':' not in expected[j]:
expect = expected[j]
if '.' in expect:
expect = float(expect)
elif expect != '':
expect = int(expect)
if match == expect:
ret_vals.append(True)
# Checking if found value is in this range.
elif ':' in expected[j]:
low, high = self.range_re.search(expected[j]).groups()
if '.' in low:
low = float(low)
elif low != '':
low = int(low)
if '.' in high:
high = float(high)
elif high != '':
high = int(high)
if low is '' and match <= high:
ret_vals.append(True)
elif high is '' and match >= low:
ret_vals.append(True)
elif low <= match <= high:
ret_vals.append(True)
return ret_vals
| lib/pavilion/plugins/results/regex.py | 7,812 | Find matches to the given regex in the given file. The matched string
or strings are returned as the result.
Use the built-in matches element. If the value is an int, it seems to work better to cast it as a float first, just in case it is a float. Check for range specification as (<lesser value>:<greater value>) Find all non-overlapping matches and return them as a list. if more than one capture is used, list contains tuples of captured strings. Test if the number of matches meets the specified threshold Test if the found values are within any of the specified expected ranges. if matches else None Not a range, checking for exact match. Checking if found value is in this range. | 687 | en | 0.881832 |
#define functions that will extract the data from SDSS based on an input RA/DEC
from astroquery.sdss import SDSS
from astropy import coordinates as coords
import pandas as pd
from astroquery.ned import Ned
import matplotlib.pyplot as plt
from astropy.convolution import convolve, Box1DKernel
import numpy as np
from astropy import units as u
def ra_dec_format(val):
""" Ra/Dec string formatting
Converts the input string format of a right ascension/ declination coordinate
to one recognizable by astroquery
Args:
val (str): string; an ra/dec expression formatted as "005313.81 +130955.0".
Returns:
string: the ra/dec coordinates re-formatted as "00h53m13.81s +13d09m55.0s"
"""
#ra
hour = val[0:2]
min_ = val[2:4]
sec = val[4:9]
ra = hour+'h'+min_+'m'+sec+'s'
#dec
deg = val[9:13]
min_d = val[13:15]
sec_d = val[15:]
dec = deg+'d'+min_d+'m'+sec_d+'s'
return ra+" "+dec
def extractor(position):
"""
This function extracts the information from the SDSS database and returns
a pandas dataframe with the query region. Please ensure that the 'position'
input is formatted as '005313.81 +130955.0
extractor(str) --> pd.DataFrame
"""
# convert the input position argument to the format recognized by astroquery.SDSS
# position=ra_dec_format(position)
# query the region and get the data
position = ra_dec_format(position)
pos = coords.SkyCoord(position, frame='icrs')
data = SDSS.query_region(pos, spectro=True)
return data.to_pandas()
def downloader(data):
"""
This function uses extracted information in order to dwonaload spectra,
separating the data from th SDSS and BOSS.
downloader(pd.Dataframe) --> [list(fits)]
"""
#create a empty list
spec_list=[]
# iteration over the pandas
for i in range(len(data)):
results = SDSS.query_specobj(plate = data['plate'][i],
mjd = data['mjd'][i],
fiberID = data['fiberID'][i])
# try if it can download the data (SDSS)
try:
spec = SDSS.get_spectra(matches=results)[0]
spec_list.append(spec)
# if it cant download, is because is from (BOSS)
except:
results.remove_column("instrument")
results.add_column(name="instrument", col="eboss") # replace the instrument column
spec = SDSS.get_spectra(matches=results)[0]
spec_list.append(spec)
return spec_list
# test=downloader(result)
# print(test)
# define a function which grabs the object's redshift from the Ned database (better calibration)- needed for plotting in the object's rest-frame
def redshift(position):
# make sure to format the input position argument such that it is recognizable by astroquery.Ned
# position=ra_dec_format(position)
position = ra_dec_format(position)
pos=coords.SkyCoord(position, frame='icrs') # create a position object
ned_results=Ned.query_region(pos,equinox="J2000", radius=2*u.arcsecond) # query the database
z=ned_results[0][6] # grab the redshift value from the query results
return z
# define a function that transforms an objects wavelength array into the object's rest-frame
def redshift_correct(z, wavelengths): # takes as input the redshift and the array of wavelengths
wavelengths_corrected = wavelengths/(z+1)
return wavelengths_corrected
# define a function that transforms the results of downloader() into an array of data which will be plotted
def transform_data(spec_list, z): # takes as input a list of (I think?) fits files results and the redshift of the object
# iterate over each file and grab the important data
#fluxes={} # containers for each of the data arrays to be plotted ( will be lists of lists/arrays)
#wavelengths={}
#inverse_variances={} # <- dictionaries!
dict={}
for spec in spec_list:
flux_array=[]
wavelength_array=[]
sigma_array=[]
data=spec[1].data # this is the data part of the file
#print(data.shape[0])
#print(data)
# store the appropriate columns in the designated containers- each row is a single spectrum?
# SOFIA- try a nested dictionary?!?!
for j in range(data.shape[0]):
#print(data[j][0])
#smoothedFlux=convolve(data[0],Box1DKernel(9)) # smooth the fluxes using a boxcar
#print(smoothedFlux)
flux_data = data[j][0]
flux_array.append(flux_data)
wavelengths_uncorrected=10**data[j][1] # the wavelengths (transformed from the log scale)
#print(wavelengths_uncorrected)
wavelengths_corrected=redshift_correct(z, wavelengths_uncorrected) # save the wavelengths after they have been scaled to the rest-frame
#print(wavelengths_corrected)
wavelength_array.append(wavelengths_corrected)
inverse_variance=data[j][2] # the inverse variance of the flux
one_over_sigma=inverse_variance**0.5
sigma=1/one_over_sigma # the one-sigma uncertainty associated with the flux array
sigma_array.append(sigma)
smoothedFlux = convolve(flux_array,Box1DKernel(9))
if 'flux' in dict:
dict['flux'].append([smoothedFlux])
else:
dict['flux'] = [smoothedFlux]
if 'wavelength' in dict:
dict['wavelength'].append([wavelength_array])
else:
dict['wavelength'] = [wavelength_array]
if '1sigma' in dict:
dict['1sigma'].append([sigma_array])
else:
dict['1sigma'] = [sigma_array]
# now return the nested dictionary with three keys:(flux, wavelength and sigma)
# each key should have data.shape[0] number of arrays with all fluxes, wavelength and sigmas for every spec in spec_list
return dict
def plot_spec(dict, radec, z): # takes as input the dictionary holding the data, the radec, and the redshift
for i in range(len(dict['wavelength'])):
#extract data
wavelength = dict['wavelength'][i]
sigma = dict['1sigma'][i]
flux = dict['flux'][i]
# instantiate a figure object
fig=plt.figure()
plt.title(str(radec)+str('; ')+'z={}'.format(z))
plt.xlabel("Rest-frame Wavelength [$\AA$]")
plt.ylabel("Flux [$10^{-17}$ erg$^{-1}$s$^{-1}$cm$^{-2}$$\AA^{-1}$]")
plt.plot(wavelength, flux) # plot the actual data
# now create upper and lower bounds on the uncertainty regions
sigmaUpper=np.add(flux,sigma)
sigmaLower=np.subtract(flux,sigma)
plt.fill_between(wavelength, sigmaLower, sigmaUpper, color='grey', alpha=0.5)
plt.show()
#TEST
radec='223812.39 +213203.4'
z=redshift(radec)
data=extractor(radec)
spec_list=downloader(data)
dic = transform_data(spec_list,z)
plot_spec(dic, radec, z) | exampledoc/Extractor.py | 6,875 | This function uses extracted information in order to dwonaload spectra,
separating the data from th SDSS and BOSS.
downloader(pd.Dataframe) --> [list(fits)]
This function extracts the information from the SDSS database and returns
a pandas dataframe with the query region. Please ensure that the 'position'
input is formatted as '005313.81 +130955.0
extractor(str) --> pd.DataFrame
Ra/Dec string formatting
Converts the input string format of a right ascension/ declination coordinate
to one recognizable by astroquery
Args:
val (str): string; an ra/dec expression formatted as "005313.81 +130955.0".
Returns:
string: the ra/dec coordinates re-formatted as "00h53m13.81s +13d09m55.0s"
define functions that will extract the data from SDSS based on an input RA/DECradec convert the input position argument to the format recognized by astroquery.SDSS position=ra_dec_format(position) query the region and get the datacreate a empty list iteration over the pandas try if it can download the data (SDSS) if it cant download, is because is from (BOSS) replace the instrument column test=downloader(result) print(test) define a function which grabs the object's redshift from the Ned database (better calibration)- needed for plotting in the object's rest-frame make sure to format the input position argument such that it is recognizable by astroquery.Ned position=ra_dec_format(position) create a position object query the database grab the redshift value from the query results define a function that transforms an objects wavelength array into the object's rest-frame takes as input the redshift and the array of wavelengths define a function that transforms the results of downloader() into an array of data which will be plotted takes as input a list of (I think?) fits files results and the redshift of the object iterate over each file and grab the important datafluxes={} containers for each of the data arrays to be plotted ( will be lists of lists/arrays)wavelengths={}inverse_variances={} <- dictionaries! this is the data part of the fileprint(data.shape[0])print(data) store the appropriate columns in the designated containers- each row is a single spectrum? SOFIA- try a nested dictionary?!?! print(data[j][0])smoothedFlux=convolve(data[0],Box1DKernel(9)) smooth the fluxes using a boxcarprint(smoothedFlux) the wavelengths (transformed from the log scale)print(wavelengths_uncorrected) save the wavelengths after they have been scaled to the rest-frameprint(wavelengths_corrected) the inverse variance of the flux the one-sigma uncertainty associated with the flux array now return the nested dictionary with three keys:(flux, wavelength and sigma) each key should have data.shape[0] number of arrays with all fluxes, wavelength and sigmas for every spec in spec_list takes as input the dictionary holding the data, the radec, and the redshiftextract data instantiate a figure object plot the actual data now create upper and lower bounds on the uncertainty regionsTEST | 2,997 | en | 0.740858 |
import re
import types
import logging
from banal import ensure_list
from normality import stringify
from balkhash.utils import safe_fragment
from email.utils import parsedate_to_datetime, getaddresses
from normality import safe_filename, ascii_text
from followthemoney.types import registry
from ingestors.support.html import HTMLSupport
from ingestors.support.cache import CacheSupport
from ingestors.support.temp import TempFileSupport
log = logging.getLogger(__name__)
class EmailIdentity(object):
def __init__(self, manager, name, email):
self.email = ascii_text(stringify(email))
self.name = stringify(name)
if not registry.email.validate(self.email):
self.email = None
if registry.email.validate(self.name):
self.email = self.email or ascii_text(self.name)
self.name = None
# This should be using formataddr, but I cannot figure out how
# to use that without encoding the name.
self.label = None
if self.name is not None and self.email is not None:
self.label = '%s <%s>' % (self.name, self.email)
elif self.name is None and self.email is not None:
self.label = self.email
elif self.email is None and self.name is not None:
self.label = self.name
self.entity = None
if self.email is not None:
key = self.email.lower().strip()
fragment = safe_fragment(self.label)
self.entity = manager.make_entity('LegalEntity')
self.entity.make_id(key)
self.entity.add('name', self.name)
self.entity.add('email', self.email)
manager.emit_entity(self.entity, fragment=fragment)
class EmailSupport(TempFileSupport, HTMLSupport, CacheSupport):
"""Extract metadata from email messages."""
MID_RE = re.compile(r'<([^>]*)>')
def ingest_attachment(self, entity, name, mime_type, body):
has_body = body is not None and len(body)
if stringify(name) is None and not has_body:
# Hello, Outlook.
return
file_name = safe_filename(name, default='attachment')
file_path = self.make_work_file(file_name)
with open(file_path, 'wb') as fh:
if isinstance(body, str):
body = body.encode('utf-8')
if body is not None:
fh.write(body)
checksum = self.manager.store(file_path, mime_type=mime_type)
file_path.unlink()
child = self.manager.make_entity('Document', parent=entity)
child.make_id(name, checksum)
child.add('contentHash', checksum)
child.add('fileName', name)
child.add('mimeType', mime_type)
self.manager.queue_entity(child)
def get_header(self, msg, *headers):
values = []
for header in headers:
try:
for value in ensure_list(msg.get_all(header)):
values.append(value)
except (TypeError, IndexError, AttributeError, ValueError) as exc:
log.warning("Failed to parse [%s]: %s", header, exc)
return values
def get_dates(self, msg, *headers):
dates = []
for value in self.get_header(msg, *headers):
try:
dates.append(parsedate_to_datetime(value))
except Exception:
log.warning("Failed to parse: %s", value)
return dates
def get_identities(self, values):
values = [v for v in ensure_list(values) if v is not None]
for (name, email) in getaddresses(values):
yield EmailIdentity(self.manager, name, email)
def get_header_identities(self, msg, *headers):
yield from self.get_identities(self.get_header(msg, *headers))
def apply_identities(self, entity, identities, eprop=None, lprop=None):
if isinstance(identities, types.GeneratorType):
identities = list(identities)
for identity in ensure_list(identities):
if eprop is not None:
entity.add(eprop, identity.entity)
if lprop is not None:
entity.add(lprop, identity.label)
entity.add('namesMentioned', identity.name)
entity.add('emailMentioned', identity.email)
def parse_message_ids(self, values):
message_ids = []
for value in ensure_list(values):
value = stringify(value)
if value is None:
continue
for message_id in self.MID_RE.findall(value):
message_id = message_id.strip()
if len(message_id) <= 4:
continue
message_ids.append(message_id)
return message_ids
def parse_references(self, references, in_reply_to):
references = self.parse_message_ids(references)
if len(references):
return references[-1]
in_reply_to = self.parse_message_ids(in_reply_to)
if len(in_reply_to):
return in_reply_to[0]
def resolve_message_ids(self, entity):
# https://cr.yp.to/immhf/thread.html
ctx = self.manager.stage.job.dataset.name
for message_id in entity.get('messageId'):
key = self.cache_key('mid-ent', ctx, message_id)
self.add_cache_set(key, entity.id)
rev_key = self.cache_key('ent-mid', ctx, message_id)
for response_id in self.get_cache_set(rev_key):
if response_id == entity.id:
continue
email = self.manager.make_entity('Email')
email.id = response_id
email.add('inReplyToEmail', entity.id)
fragment = safe_fragment(message_id)
self.manager.emit_entity(email, fragment=fragment)
for message_id in entity.get('inReplyTo'):
# forward linking: from message ID to entity ID
key = self.cache_key('mid-ent', ctx, message_id)
for email_id in self.get_cache_set(key):
if email_id != entity.id:
entity.add('inReplyToEmail', email_id)
# backward linking: prepare entity ID for message to come
rev_key = self.cache_key('ent-mid', ctx, message_id)
self.add_cache_set(rev_key, entity.id)
def extract_msg_headers(self, entity, msg):
"""Parse E-Mail headers into FtM properties."""
try:
entity.add('indexText', msg.values())
except Exception as ex:
log.warning("Cannot parse all headers: %r", ex)
entity.add('subject', self.get_header(msg, 'Subject'))
entity.add('date', self.get_dates(msg, 'Date'))
entity.add('mimeType', self.get_header(msg, 'Content-Type'))
entity.add('threadTopic', self.get_header(msg, 'Thread-Topic'))
entity.add('generator', self.get_header(msg, 'X-Mailer'))
entity.add('language', self.get_header(msg, 'Content-Language'))
entity.add('keywords', self.get_header(msg, 'Keywords'))
entity.add('summary', self.get_header(msg, 'Comments'))
message_id = self.get_header(msg, 'Message-ID')
entity.add('messageId', self.parse_message_ids(message_id))
references = self.get_header(msg, 'References')
in_reply_to = self.get_header(msg, 'In-Reply-To')
entity.add('inReplyTo', self.parse_references(references, in_reply_to))
return_path = self.get_header_identities(msg, 'Return-Path')
self.apply_identities(entity, return_path)
reply_to = self.get_header_identities(msg, 'Reply-To')
self.apply_identities(entity, reply_to)
sender = self.get_header_identities(msg, 'Sender', 'X-Sender')
self.apply_identities(entity, sender, 'emitters', 'sender')
froms = self.get_header_identities(msg, 'From', 'X-From')
self.apply_identities(entity, froms, 'emitters', 'from')
tos = self.get_header_identities(msg, 'To', 'Resent-To')
self.apply_identities(entity, tos, 'recipients', 'to')
ccs = self.get_header_identities(msg, 'CC', 'Cc', 'Resent-Cc')
self.apply_identities(entity, ccs, 'recipients', 'cc')
bccs = self.get_header_identities(msg, 'Bcc', 'BCC', 'Resent-Bcc')
self.apply_identities(entity, bccs, 'recipients', 'bcc')
| services/ingest-file/ingestors/support/email.py | 8,352 | Extract metadata from email messages.
Parse E-Mail headers into FtM properties.
This should be using formataddr, but I cannot figure out how to use that without encoding the name. Hello, Outlook. https://cr.yp.to/immhf/thread.html forward linking: from message ID to entity ID backward linking: prepare entity ID for message to come | 334 | en | 0.691491 |
import setuptools
with open("../README.md", "r", encoding="utf-8") as fh:
long_description = fh.read()
setuptools.setup(
name="cog",
version="0.0.1",
author_email="team@replicate.com",
description="Containers for machine learning",
long_description=long_description,
long_description_content_type="text/markdown",
url="https://github.com/replicate/cog",
license="Apache License 2.0",
python_requires=">=3.6.0",
install_requires=[
# intionally loose. perhaps these should be vendored to not collide with user code?
"flask>=2,<3",
"redis>=3,<4",
"requests>=2,<3",
"PyYAML",
],
packages=setuptools.find_packages(),
)
| python/setup.py | 709 | intionally loose. perhaps these should be vendored to not collide with user code? | 81 | en | 0.984239 |
from handlers.kbeServer.Editor.Interface import interface_workmark
from methods.DBManager import DBManager
#点赞
def Transactions_Code_2008( self_uid , self_username , json_data):
# 回调json
json_back = {
"code": 0,
"msg": "",
"pam": ""
}
# json_data 结构
uid = int(json_data["uid"])
wid = int(json_data["wid"])
lid = int(json_data["lid"])
siscid = json_data["siscid"]
tid = int(json_data["tid"])
dian = int(json_data["dian"])
ctype = int(json_data["ctype"])
#uid ,wid ,lid ,siscid ,tid ,dian ,ctype
# 获取下db的句柄,如果需要操作数据库的话
DB = DBManager()
json_back["code"] = interface_workmark.DoMsg_Dianzan(DB,self_uid,uid,wid,lid ,siscid ,tid ,dian ,ctype)
DB.destroy()
return json_back
#评分/评论
def Transactions_Code_2009( self_uid , self_username , json_data):
# 回调json
json_back = {
"code": 0,
"msg": "",
"pam": ""
}
# json_data 结构
uid = int(json_data["uid"])
s_wid = int(json_data["s_wid"])
s_lid = int(json_data["s_lid"])
log = json_data["log"]
score = int(json_data["score"])
P_UID = int(json_data["P_UID"])
ctype = int(json_data["ctype"])
#uid ,wid ,lid ,siscid ,tid ,dian ,ctype
# 获取下db的句柄,如果需要操作数据库的话
DB = DBManager()
json_back["code"] = interface_workmark.DoWorkMark(DB,self_uid,s_wid,s_lid,uid,score,log,P_UID,ctype)
DB.destroy()
return json_back
#获取评分数据
def Transactions_Code_2010( self_uid , self_username , json_data):
# 回调json
json_back = {
"code": 0,
"msg": "",
"pam": ""
}
# json_data 结构
uid = int(json_data["uid"])
wid = int(json_data["wid"])
lid = int(json_data["lid"])
sis_cid = json_data["sis_cid"]
ctype = int(json_data["ctype"])
#uid ,wid ,lid ,siscid ,tid ,dian ,ctype
# 获取下db的句柄,如果需要操作数据库的话
DB = DBManager()
json_back["code"] = 1
json_back["pam"] = interface_workmark.DoWorkScoreData(DB,self_uid,wid,lid,uid,sis_cid,ctype)
DB.destroy()
return json_back
#获取评论数据
def Transactions_Code_2011( self_uid , self_username , json_data):
# 回调json
json_back = {
"code": 0,
"msg": "",
"pam": ""
}
# json_data 结构
uid = int(json_data["uid"])
wid = int(json_data["wid"])
lid = int(json_data["lid"])
sis_cid = json_data["sis_cid"]
ctype = int(json_data["ctype"])
PID = int(json_data["PID"])
ipage = int(json_data["ipage"])
ilenght = int(json_data["ilenght"])
# 获取下db的句柄,如果需要操作数据库的话
DB = DBManager()
json_back["code"] = 1
json_back["pam"] = interface_workmark.DoWorkLogData(DB,self_uid,wid,lid, uid, sis_cid, PID , ipage , ilenght,ctype)
DB.destroy()
return json_back | handlers/kbeServer/Editor/response/response_workmark.py | 2,954 | 点赞 回调json json_data 结构uid ,wid ,lid ,siscid ,tid ,dian ,ctype 获取下db的句柄,如果需要操作数据库的话评分/评论 回调json json_data 结构uid ,wid ,lid ,siscid ,tid ,dian ,ctype 获取下db的句柄,如果需要操作数据库的话获取评分数据 回调json json_data 结构uid ,wid ,lid ,siscid ,tid ,dian ,ctype 获取下db的句柄,如果需要操作数据库的话获取评论数据 回调json json_data 结构 获取下db的句柄,如果需要操作数据库的话 | 300 | zh | 0.69952 |
# Copyright 2019-2021 Wingify Software Pvt. Ltd.
#
# Licensed under the Apache License, Version 2.0 (the "License");
# you may not use this file except in compliance with the License.
# You may obtain a copy of the License at
#
# http://www.apache.org/licenses/LICENSE-2.0
#
# Unless required by applicable law or agreed to in writing, software
# distributed under the License is distributed on an "AS IS" BASIS,
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
# See the License for the specific language governing permissions and
# limitations under the License.
from ...enums.file_name_enum import FileNameEnum
from .operand_evaluator import OperandEvaluator
from ...enums.segments import OperandTypes, OperatorTypes
from ...helpers.generic_util import get_key_value
FILE = FileNameEnum.Services.SegmentEvaluator
class SegmentEvaluator:
""" Class to evaluate segments defined in VWO app """
def __init__(self):
""" Initializes this class with VWOLogger and OperandEvaluator """
self.operand_evaluator = OperandEvaluator()
def evaluate(self, segments, custom_variables):
"""A parser which recursively evaluates the custom_variables passed against
the expression tree represented by segments, and returns the result.
Args:
segments(dict): The segments representing the expression tree
custom_variables(dict): Key/value pair of variables
Returns:
bool(result): True or False
"""
operator, sub_segments = get_key_value(segments)
if operator == OperatorTypes.NOT:
return not self.evaluate(sub_segments, custom_variables)
elif operator == OperatorTypes.AND:
return all(self.evaluate(y, custom_variables) for y in sub_segments)
elif operator == OperatorTypes.OR:
return any(self.evaluate(y, custom_variables) for y in sub_segments)
elif operator == OperandTypes.CUSTOM_VARIABLE:
return self.operand_evaluator.evaluate_custom_variable(sub_segments, custom_variables)
elif operator == OperandTypes.USER:
return self.operand_evaluator.evaluate_user(sub_segments, custom_variables)
| vwo/services/segmentor/segment_evaluator.py | 2,225 | Class to evaluate segments defined in VWO app
Initializes this class with VWOLogger and OperandEvaluator
A parser which recursively evaluates the custom_variables passed against
the expression tree represented by segments, and returns the result.
Args:
segments(dict): The segments representing the expression tree
custom_variables(dict): Key/value pair of variables
Returns:
bool(result): True or False
Copyright 2019-2021 Wingify Software Pvt. Ltd. Licensed under the Apache License, Version 2.0 (the "License"); you may not use this file except in compliance with the License. You may obtain a copy of the License at http://www.apache.org/licenses/LICENSE-2.0 Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the specific language governing permissions and limitations under the License. | 989 | en | 0.809164 |
"""
Given an array nums and a value val, remove all instances of that value in-place and return the new length.
Do not allocate extra space for another array, you must do this by modifying the input array in-place with O(1) extra memory.
The order of elements can be changed. It doesn't matter what you leave beyond the new length.
Ex_1:
Given nums = [3,2,2,3], val = 3,
Your function should return length = 2, with the first two elements of nums being 2.
It doesn't matter what you leave beyond the returned length.
Ex_2:
Given nums = [0,1,2,2,3,0,4,2], val = 2,
Your function should return length = 5, with the first five elements of nums containing 0, 1, 3, 0, and 4.
Note that the order of those five elements can be arbitrary.
It doesn't matter what values are set beyond the returned length.
Clarification:
Confused why the returned value is an integer but your answer is an array?
Note that the input array is passed in by reference, which means modification to the input array will be known to the caller as well.
Internally you can think of this:
// nums is passed in by reference. (i.e., without making a copy)
int len = removeElement(nums, val);
// any modification to nums in your function would be known by the caller.
// using the length returned by your function, it prints the first len elements.
for (int i = 0; i < len; i++) {
print(nums[i]);
}
"""
class Solution(object):
def removeElement(self, nums, val):
"""
:type nums: List[int]
:type val: int
:rtype: int
"""
#My code starts here
j=0
for i in range(len(nums)):
if nums[i]!=val:
nums[j]=nums[i]
j+=1
return j
"""
My thinking: Use two pointers.
"""
| 1-50/27_remove-element.py | 1,748 | :type nums: List[int]
:type val: int
:rtype: int
Given an array nums and a value val, remove all instances of that value in-place and return the new length.
Do not allocate extra space for another array, you must do this by modifying the input array in-place with O(1) extra memory.
The order of elements can be changed. It doesn't matter what you leave beyond the new length.
Ex_1:
Given nums = [3,2,2,3], val = 3,
Your function should return length = 2, with the first two elements of nums being 2.
It doesn't matter what you leave beyond the returned length.
Ex_2:
Given nums = [0,1,2,2,3,0,4,2], val = 2,
Your function should return length = 5, with the first five elements of nums containing 0, 1, 3, 0, and 4.
Note that the order of those five elements can be arbitrary.
It doesn't matter what values are set beyond the returned length.
Clarification:
Confused why the returned value is an integer but your answer is an array?
Note that the input array is passed in by reference, which means modification to the input array will be known to the caller as well.
Internally you can think of this:
// nums is passed in by reference. (i.e., without making a copy)
int len = removeElement(nums, val);
// any modification to nums in your function would be known by the caller.
// using the length returned by your function, it prints the first len elements.
for (int i = 0; i < len; i++) {
print(nums[i]);
}
My code starts here | 1,433 | en | 0.884086 |
#!/usr/bin/env python
"""Django's command-line utility for administrative tasks."""
import os
import sys
def main():
"""Run administrative tasks."""
os.environ.setdefault('DJANGO_SETTINGS_MODULE', 'uofthacksemergencyfunds.settings')
try:
from django.core.management import execute_from_command_line
except ImportError as exc:
raise ImportError(
"Couldn't import Django. Are you sure it's installed and "
"available on your PYTHONPATH environment variable? Did you "
"forget to activate a virtual environment?"
) from exc
execute_from_command_line(sys.argv)
if __name__ == '__main__':
main()
| manage.py | 679 | Run administrative tasks.
Django's command-line utility for administrative tasks.
!/usr/bin/env python | 103 | en | 0.725633 |
# MINLP written by GAMS Convert at 08/20/20 01:30:53
#
# Equation counts
# Total E G L N X C B
# 3360 1353 785 1222 0 0 0 0
#
# Variable counts
# x b i s1s s2s sc si
# Total cont binary integer sos1 sos2 scont sint
# 1537 1453 84 0 0 0 0 0
# FX 0 0 0 0 0 0 0 0
#
# Nonzero counts
# Total const NL DLL
# 15691 13339 2352 0
#
# Reformulation has removed 1 variable and 1 equation
from pyomo.environ import *
model = m = ConcreteModel()
m.b2 = Var(within=Binary,bounds=(0,1))
m.b3 = Var(within=Binary,bounds=(0,1))
m.b4 = Var(within=Binary,bounds=(0,1))
m.b5 = Var(within=Binary,bounds=(0,1))
m.b6 = Var(within=Binary,bounds=(0,1))
m.b7 = Var(within=Binary,bounds=(0,1))
m.b8 = Var(within=Binary,bounds=(0,1))
m.b9 = Var(within=Binary,bounds=(0,1))
m.b10 = Var(within=Binary,bounds=(0,1))
m.b11 = Var(within=Binary,bounds=(0,1))
m.b12 = Var(within=Binary,bounds=(0,1))
m.b13 = Var(within=Binary,bounds=(0,1))
m.b14 = Var(within=Binary,bounds=(0,1))
m.b15 = Var(within=Binary,bounds=(0,1))
m.b16 = Var(within=Binary,bounds=(0,1))
m.b17 = Var(within=Binary,bounds=(0,1))
m.b18 = Var(within=Binary,bounds=(0,1))
m.b19 = Var(within=Binary,bounds=(0,1))
m.b20 = Var(within=Binary,bounds=(0,1))
m.b21 = Var(within=Binary,bounds=(0,1))
m.b22 = Var(within=Binary,bounds=(0,1))
m.b23 = Var(within=Binary,bounds=(0,1))
m.b24 = Var(within=Binary,bounds=(0,1))
m.b25 = Var(within=Binary,bounds=(0,1))
m.b26 = Var(within=Binary,bounds=(0,1))
m.b27 = Var(within=Binary,bounds=(0,1))
m.b28 = Var(within=Binary,bounds=(0,1))
m.b29 = Var(within=Binary,bounds=(0,1))
m.b30 = Var(within=Binary,bounds=(0,1))
m.b31 = Var(within=Binary,bounds=(0,1))
m.b32 = Var(within=Binary,bounds=(0,1))
m.b33 = Var(within=Binary,bounds=(0,1))
m.b34 = Var(within=Binary,bounds=(0,1))
m.b35 = Var(within=Binary,bounds=(0,1))
m.b36 = Var(within=Binary,bounds=(0,1))
m.b37 = Var(within=Binary,bounds=(0,1))
m.b38 = Var(within=Binary,bounds=(0,1))
m.b39 = Var(within=Binary,bounds=(0,1))
m.b40 = Var(within=Binary,bounds=(0,1))
m.b41 = Var(within=Binary,bounds=(0,1))
m.b42 = Var(within=Binary,bounds=(0,1))
m.b43 = Var(within=Binary,bounds=(0,1))
m.b44 = Var(within=Binary,bounds=(0,1))
m.b45 = Var(within=Binary,bounds=(0,1))
m.b46 = Var(within=Binary,bounds=(0,1))
m.b47 = Var(within=Binary,bounds=(0,1))
m.b48 = Var(within=Binary,bounds=(0,1))
m.b49 = Var(within=Binary,bounds=(0,1))
m.b50 = Var(within=Binary,bounds=(0,1))
m.b51 = Var(within=Binary,bounds=(0,1))
m.b52 = Var(within=Binary,bounds=(0,1))
m.b53 = Var(within=Binary,bounds=(0,1))
m.b54 = Var(within=Binary,bounds=(0,1))
m.b55 = Var(within=Binary,bounds=(0,1))
m.b56 = Var(within=Binary,bounds=(0,1))
m.b57 = Var(within=Binary,bounds=(0,1))
m.b58 = Var(within=Binary,bounds=(0,1))
m.b59 = Var(within=Binary,bounds=(0,1))
m.b60 = Var(within=Binary,bounds=(0,1))
m.b61 = Var(within=Binary,bounds=(0,1))
m.b62 = Var(within=Binary,bounds=(0,1))
m.b63 = Var(within=Binary,bounds=(0,1))
m.b64 = Var(within=Binary,bounds=(0,1))
m.b65 = Var(within=Binary,bounds=(0,1))
m.b66 = Var(within=Binary,bounds=(0,1))
m.b67 = Var(within=Binary,bounds=(0,1))
m.b68 = Var(within=Binary,bounds=(0,1))
m.b69 = Var(within=Binary,bounds=(0,1))
m.b70 = Var(within=Binary,bounds=(0,1))
m.b71 = Var(within=Binary,bounds=(0,1))
m.b72 = Var(within=Binary,bounds=(0,1))
m.b73 = Var(within=Binary,bounds=(0,1))
m.b74 = Var(within=Binary,bounds=(0,1))
m.b75 = Var(within=Binary,bounds=(0,1))
m.b76 = Var(within=Binary,bounds=(0,1))
m.b77 = Var(within=Binary,bounds=(0,1))
m.b78 = Var(within=Binary,bounds=(0,1))
m.b79 = Var(within=Binary,bounds=(0,1))
m.b80 = Var(within=Binary,bounds=(0,1))
m.b81 = Var(within=Binary,bounds=(0,1))
m.b82 = Var(within=Binary,bounds=(0,1))
m.b83 = Var(within=Binary,bounds=(0,1))
m.b84 = Var(within=Binary,bounds=(0,1))
m.b85 = Var(within=Binary,bounds=(0,1))
m.x86 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x87 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x88 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x89 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x90 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x91 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x92 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x93 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x94 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x95 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x96 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x97 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x98 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x99 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x100 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x101 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x102 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x103 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x104 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x105 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x106 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x107 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x108 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x109 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x110 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x111 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x112 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x113 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x114 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x115 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x116 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x117 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x118 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x119 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x120 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x121 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x122 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x123 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x124 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x125 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x126 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x127 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x128 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x129 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x130 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x131 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x132 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x133 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x134 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x135 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x136 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x137 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x138 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x139 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x140 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x141 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x142 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x143 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x144 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x145 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x146 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x147 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x148 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x149 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x150 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x151 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x152 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x153 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x154 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x155 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x156 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x157 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x158 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x159 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x160 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x161 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x162 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x163 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x164 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x165 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x166 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x167 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x168 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x169 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x170 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x171 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x172 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x173 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x174 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x175 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x176 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x177 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x178 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x179 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x180 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x181 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x182 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x183 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x184 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x185 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x186 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x187 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x188 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x189 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x190 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x191 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x192 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x193 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x194 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x195 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x196 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x197 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x198 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x199 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x200 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x201 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x202 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x203 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x204 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x205 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x206 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x207 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x208 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x209 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x210 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x211 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x212 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x213 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x214 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x215 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x216 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x217 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x218 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x219 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x220 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x221 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x222 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x223 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x224 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x225 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x226 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x227 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x228 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x229 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x230 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x231 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x232 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x233 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x234 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x235 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x236 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x237 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x238 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x239 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x240 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x241 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x242 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x243 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x244 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x245 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x246 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x247 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x248 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x249 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x250 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x251 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x252 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x253 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x254 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x255 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x256 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x257 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x258 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x259 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x260 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x261 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x262 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x263 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x264 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x265 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x266 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x267 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x268 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x269 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x270 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x271 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x272 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x273 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x274 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x275 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x276 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x277 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x278 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x279 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x280 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x281 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x282 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x283 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x284 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x285 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x286 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x287 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x288 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x289 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x290 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x291 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x292 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x293 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x294 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x295 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x296 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x297 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x298 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x299 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x300 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x301 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x302 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x303 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x304 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x305 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x306 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x307 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x308 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x309 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x310 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x311 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x312 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x313 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x314 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x315 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x316 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x317 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x318 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x319 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x320 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x321 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x322 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x323 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x324 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x325 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x326 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x327 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x328 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x329 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x330 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x331 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x332 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x333 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x334 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x335 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x336 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x337 = Var(within=Reals,bounds=(0,None),initialize=4)
m.x338 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x339 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x340 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x341 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x342 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x343 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x344 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x345 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x346 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x347 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x348 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x349 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x350 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x351 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x352 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x353 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x354 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x355 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x356 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x357 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x358 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x359 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x360 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x361 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x362 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x363 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x364 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x365 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x366 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x367 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x368 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x369 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x370 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x371 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x372 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x373 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x374 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x375 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x376 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x377 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x378 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x379 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x380 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x381 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x382 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x383 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x384 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x385 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x386 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x387 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x388 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x389 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x390 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x391 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x392 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x393 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x394 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x395 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x396 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x397 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x398 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x399 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x400 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x401 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x402 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x403 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x404 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x405 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x406 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x407 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x408 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x409 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x410 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x411 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x412 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x413 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x414 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x415 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x416 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x417 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x418 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x419 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x420 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x421 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x422 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x423 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x424 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x425 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x426 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x427 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x428 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x429 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x430 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x431 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x432 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x433 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x434 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x435 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x436 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x437 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x438 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x439 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x440 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x441 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x442 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x443 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x444 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x445 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x446 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x447 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x448 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x449 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x450 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x451 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x452 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x453 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x454 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x455 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x456 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x457 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x458 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x459 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x460 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x461 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x462 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x463 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x464 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x465 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x466 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x467 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x468 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x469 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x470 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x471 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x472 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x473 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x474 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x475 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x476 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x477 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x478 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x479 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x480 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x481 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x482 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x483 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x484 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x485 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x486 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x487 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x488 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x489 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x490 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x491 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x492 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x493 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x494 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x495 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x496 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x497 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x498 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x499 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x500 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x501 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x502 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x503 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x504 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x505 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x506 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x507 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x508 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x509 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x510 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x511 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x512 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x513 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x514 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x515 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x516 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x517 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x518 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x519 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x520 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x521 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x522 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x523 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x524 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x525 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x526 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x527 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x528 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x529 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x530 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x531 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x532 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x533 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x534 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x535 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x536 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x537 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x538 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x539 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x540 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x541 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x542 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x543 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x544 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x545 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x546 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x547 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x548 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x549 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x550 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x551 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x552 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x553 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x554 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x555 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x556 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x557 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x558 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x559 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x560 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x561 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x562 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x563 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x564 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x565 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x566 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x567 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x568 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x569 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x570 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x571 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x572 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x573 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x574 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x575 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x576 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x577 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x578 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x579 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x580 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x581 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x582 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x583 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x584 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x585 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x586 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x587 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x588 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x589 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x590 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x591 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x592 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x593 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x594 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x595 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x596 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x597 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x598 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x599 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x600 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x601 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x602 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x603 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x604 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x605 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x606 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x607 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x608 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x609 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x610 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x611 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x612 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x613 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x614 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x615 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x616 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x617 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x618 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x619 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x620 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x621 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x622 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x623 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x624 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x625 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x626 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x627 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x628 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x629 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x630 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x631 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x632 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x633 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x634 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x635 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x636 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x637 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x638 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x639 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x640 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x641 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x642 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x643 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x644 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x645 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x646 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x647 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x648 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x649 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x650 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x651 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x652 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x653 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x654 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x655 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x656 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x657 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x658 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x659 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x660 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x661 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x662 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x663 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x664 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x665 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x666 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x667 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x668 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x669 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x670 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x671 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x672 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x673 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x674 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x675 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x676 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x677 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x678 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x679 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x680 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x681 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x682 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x683 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x684 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x685 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x686 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x687 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x688 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x689 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x690 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x691 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x692 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x693 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x694 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x695 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x696 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x697 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x698 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x699 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x700 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x701 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x702 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x703 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x704 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x705 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x706 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x707 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x708 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x709 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x710 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x711 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x712 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x713 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x714 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x715 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x716 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x717 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x718 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x719 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x720 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x721 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x722 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x723 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x724 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x725 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x726 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x727 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x728 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x729 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x730 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x731 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x732 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x733 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x734 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x735 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x736 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x737 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x738 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x739 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x740 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x741 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x742 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x743 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x744 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x745 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x746 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x747 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x748 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x749 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x750 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x751 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x752 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x753 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x754 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x755 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x756 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x757 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x758 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x759 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x760 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x761 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x762 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x763 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x764 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x765 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x766 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x767 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x768 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x769 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x770 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x771 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x772 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x773 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x774 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x775 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x776 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x777 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x778 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x779 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x780 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x781 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x782 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x783 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x784 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x785 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x786 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x787 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x788 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x789 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x790 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x791 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x792 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x793 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x794 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x795 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x796 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x797 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x798 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x799 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x800 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x801 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x802 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x803 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x804 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x805 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x806 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x807 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x808 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x809 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x810 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x811 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x812 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x813 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x814 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x815 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x816 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x817 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x818 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x819 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x820 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x821 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x822 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x823 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x824 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x825 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x826 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x827 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x828 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x829 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x830 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x831 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x832 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x833 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x834 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x835 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x836 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x837 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x838 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x839 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x840 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x841 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x842 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x843 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x844 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x845 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x846 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x847 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x848 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x849 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x850 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x851 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x852 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x853 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x854 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x855 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x856 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x857 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x858 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x859 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x860 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x861 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x862 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x863 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x864 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x865 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x866 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x867 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x868 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x869 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x870 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x871 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x872 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x873 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x874 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x875 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x876 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x877 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x878 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x879 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x880 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x881 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x882 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x883 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x884 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x885 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x886 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x887 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x888 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x889 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x890 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x891 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x892 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x893 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x894 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x895 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x896 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x897 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x898 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x899 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x900 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x901 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x902 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x903 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x904 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x905 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x906 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x907 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x908 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x909 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x910 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x911 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x912 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x913 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x914 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x915 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x916 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x917 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x918 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x919 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x920 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x921 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x922 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x923 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x924 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x925 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x926 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x927 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x928 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x929 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x930 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x931 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x932 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x933 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x934 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x935 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x936 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x937 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x938 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x939 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x940 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x941 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x942 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x943 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x944 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x945 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x946 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x947 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x948 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x949 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x950 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x951 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x952 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x953 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x954 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x955 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x956 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x957 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x958 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x959 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x960 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x961 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x962 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x963 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x964 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x965 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x966 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x967 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x968 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x969 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x970 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x971 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x972 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x973 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x974 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x975 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x976 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x977 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x978 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x979 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x980 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x981 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x982 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x983 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x984 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x985 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x986 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x987 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x988 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x989 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x990 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x991 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x992 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x993 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x994 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x995 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x996 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x997 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x998 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x999 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1000 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1001 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1002 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1003 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1004 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1005 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1006 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1007 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1008 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1009 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1010 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x1011 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x1012 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x1013 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x1014 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x1015 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x1016 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x1017 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x1018 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x1019 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x1020 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x1021 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x1022 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x1023 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x1024 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x1025 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x1026 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x1027 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x1028 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x1029 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x1030 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x1031 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x1032 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x1033 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x1034 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x1035 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x1036 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x1037 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x1038 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x1039 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x1040 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x1041 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x1042 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x1043 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x1044 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x1045 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x1046 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x1047 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x1048 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x1049 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x1050 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x1051 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x1052 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x1053 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x1054 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x1055 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x1056 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x1057 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x1058 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x1059 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x1060 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x1061 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x1062 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x1063 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x1064 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x1065 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x1066 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x1067 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x1068 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x1069 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x1070 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x1071 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x1072 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x1073 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x1074 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x1075 = Var(within=Reals,bounds=(0,None),initialize=10)
m.x1076 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1077 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1078 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1079 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1080 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1081 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1082 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1083 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1084 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1085 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1086 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1087 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1088 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1089 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1090 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1091 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1092 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1093 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1094 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1095 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1096 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1097 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1098 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1099 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1100 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1101 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1102 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1103 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1104 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1105 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1106 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1107 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1108 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1109 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1110 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1111 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1112 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1113 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1114 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1115 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1116 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1117 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1118 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1119 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1120 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1121 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1122 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1123 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1124 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1125 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1126 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1127 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1128 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1129 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1130 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1131 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1132 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1133 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1134 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1135 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1136 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1137 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1138 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1139 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1140 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1141 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1142 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1143 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1144 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1145 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1146 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1147 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1148 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1149 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1150 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1151 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1152 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1153 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1154 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1155 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1156 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1157 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1158 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1159 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1160 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1161 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1162 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1163 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1164 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1165 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1166 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1167 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1168 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1169 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1170 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1171 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1172 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1173 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1174 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1175 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1176 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1177 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1178 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1179 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1180 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1181 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1182 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1183 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1184 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1185 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1186 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1187 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1188 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1189 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1190 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1191 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1192 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1193 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1194 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1195 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1196 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1197 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1198 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1199 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1200 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1201 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1202 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1203 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1204 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1205 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1206 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1207 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1208 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1209 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1210 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1211 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1212 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1213 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1214 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1215 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1216 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1217 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1218 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1219 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1220 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1221 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1222 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1223 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1224 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1225 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1226 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1227 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1228 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1229 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1230 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1231 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1232 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1233 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1234 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1235 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1236 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1237 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1238 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1239 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1240 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1241 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1242 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1243 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1244 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1245 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1246 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1247 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1248 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1249 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1250 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1251 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1252 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1253 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1254 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1255 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1256 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1257 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1258 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1259 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1260 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1261 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1262 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1263 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1264 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1265 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1266 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1267 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1268 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1269 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1270 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1271 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1272 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1273 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1274 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1275 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1276 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1277 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1278 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1279 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1280 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1281 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1282 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1283 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1284 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1285 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1286 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1287 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1288 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1289 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1290 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1291 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1292 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1293 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1294 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1295 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1296 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1297 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1298 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1299 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1300 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1301 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1302 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1303 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1304 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1305 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1306 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1307 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1308 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1309 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1310 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1311 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1312 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1313 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1314 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1315 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1316 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1317 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1318 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1319 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1320 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1321 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1322 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1323 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1324 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1325 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1326 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1327 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1328 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1329 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1330 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1331 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1332 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1333 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1334 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1335 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1336 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1337 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1338 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1339 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1340 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1341 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1342 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1343 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1344 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1345 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1346 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1347 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1348 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1349 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1350 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1351 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1352 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1353 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1354 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1355 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1356 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1357 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1358 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1359 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1360 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1361 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1362 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1363 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1364 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1365 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1366 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1367 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1368 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1369 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1370 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1371 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1372 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1373 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1374 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1375 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1376 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1377 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1378 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1379 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1380 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1381 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1382 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1383 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1384 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1385 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1386 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1387 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1388 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1389 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1390 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1391 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1392 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1393 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1394 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1395 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1396 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1397 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1398 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1399 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1400 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1401 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1402 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1403 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1404 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1405 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1406 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1407 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1408 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1409 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1410 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1411 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1412 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1413 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1414 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1415 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1416 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1417 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1418 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1419 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1420 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1421 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1422 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1423 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1424 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1425 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1426 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1427 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1428 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1429 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1430 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1431 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1432 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1433 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1434 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1435 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1436 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1437 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1438 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1439 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1440 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1441 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1442 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1443 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1444 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1445 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1446 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1447 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1448 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1449 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1450 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1451 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1452 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1453 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1454 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1455 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1456 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1457 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1458 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1459 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1460 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1461 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1462 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1463 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1464 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1465 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1466 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1467 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1468 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1469 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1470 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1471 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1472 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1473 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1474 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1475 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1476 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1477 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1478 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1479 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1480 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1481 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1482 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1483 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1484 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1485 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1486 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1487 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1488 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1489 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1490 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1491 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1492 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1493 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1494 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1495 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1496 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1497 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1498 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1499 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1500 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1501 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1502 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1503 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1504 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1505 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1506 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1507 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1508 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1509 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1510 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1511 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1512 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1513 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1514 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1515 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1516 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1517 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1518 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1519 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1520 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1521 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1522 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1523 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1524 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1525 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1526 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1527 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1528 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1529 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1530 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1531 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1532 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1533 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1534 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1535 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1536 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.x1537 = Var(within=Reals,bounds=(0,None),initialize=1.42857142857143)
m.obj = Objective(expr= 0.1*m.x492 + 0.6*m.x493 + 0.85*m.x494 + 0.2*m.x495 + 0.5*m.x496 + 0.8*m.x497 + 0.3*m.x498
+ 0.1*m.x499 + 0.6*m.x500 + 0.85*m.x501 + 0.2*m.x502 + 0.5*m.x503 + 0.8*m.x504 + 0.3*m.x505
+ 0.1*m.x506 + 0.6*m.x507 + 0.85*m.x508 + 0.2*m.x509 + 0.5*m.x510 + 0.8*m.x511 + 0.3*m.x512
+ 0.1*m.x513 + 0.6*m.x514 + 0.85*m.x515 + 0.2*m.x516 + 0.5*m.x517 + 0.8*m.x518 + 0.3*m.x519
+ 0.1*m.x590 + 0.6*m.x591 + 0.85*m.x592 + 0.2*m.x593 + 0.5*m.x594 + 0.8*m.x595 + 0.3*m.x596
+ 0.1*m.x597 + 0.6*m.x598 + 0.85*m.x599 + 0.2*m.x600 + 0.5*m.x601 + 0.8*m.x602 + 0.3*m.x603
+ 0.1*m.x604 + 0.6*m.x605 + 0.85*m.x606 + 0.2*m.x607 + 0.5*m.x608 + 0.8*m.x609 + 0.3*m.x610
+ 0.1*m.x611 + 0.6*m.x612 + 0.85*m.x613 + 0.2*m.x614 + 0.5*m.x615 + 0.8*m.x616 + 0.3*m.x617
+ 0.1*m.x688 + 0.6*m.x689 + 0.85*m.x690 + 0.2*m.x691 + 0.5*m.x692 + 0.8*m.x693 + 0.3*m.x694
+ 0.1*m.x695 + 0.6*m.x696 + 0.85*m.x697 + 0.2*m.x698 + 0.5*m.x699 + 0.8*m.x700 + 0.3*m.x701
+ 0.1*m.x702 + 0.6*m.x703 + 0.85*m.x704 + 0.2*m.x705 + 0.5*m.x706 + 0.8*m.x707 + 0.3*m.x708
+ 0.1*m.x709 + 0.6*m.x710 + 0.85*m.x711 + 0.2*m.x712 + 0.5*m.x713 + 0.8*m.x714 + 0.3*m.x715
+ 0.1*m.x786 + 0.6*m.x787 + 0.85*m.x788 + 0.2*m.x789 + 0.5*m.x790 + 0.8*m.x791 + 0.3*m.x792
+ 0.1*m.x793 + 0.6*m.x794 + 0.85*m.x795 + 0.2*m.x796 + 0.5*m.x797 + 0.8*m.x798 + 0.3*m.x799
+ 0.1*m.x800 + 0.6*m.x801 + 0.85*m.x802 + 0.2*m.x803 + 0.5*m.x804 + 0.8*m.x805 + 0.3*m.x806
+ 0.1*m.x807 + 0.6*m.x808 + 0.85*m.x809 + 0.2*m.x810 + 0.5*m.x811 + 0.8*m.x812 + 0.3*m.x813
+ 0.1*m.x884 + 0.6*m.x885 + 0.85*m.x886 + 0.2*m.x887 + 0.5*m.x888 + 0.8*m.x889 + 0.3*m.x890
+ 0.1*m.x891 + 0.6*m.x892 + 0.85*m.x893 + 0.2*m.x894 + 0.5*m.x895 + 0.8*m.x896 + 0.3*m.x897
+ 0.1*m.x898 + 0.6*m.x899 + 0.85*m.x900 + 0.2*m.x901 + 0.5*m.x902 + 0.8*m.x903 + 0.3*m.x904
+ 0.1*m.x905 + 0.6*m.x906 + 0.85*m.x907 + 0.2*m.x908 + 0.5*m.x909 + 0.8*m.x910 + 0.3*m.x911
+ 0.1*m.x982 + 0.6*m.x983 + 0.85*m.x984 + 0.2*m.x985 + 0.5*m.x986 + 0.8*m.x987 + 0.3*m.x988
+ 0.1*m.x989 + 0.6*m.x990 + 0.85*m.x991 + 0.2*m.x992 + 0.5*m.x993 + 0.8*m.x994 + 0.3*m.x995
+ 0.1*m.x996 + 0.6*m.x997 + 0.85*m.x998 + 0.2*m.x999 + 0.5*m.x1000 + 0.8*m.x1001 + 0.3*m.x1002
+ 0.1*m.x1003 + 0.6*m.x1004 + 0.85*m.x1005 + 0.2*m.x1006 + 0.5*m.x1007 + 0.8*m.x1008
+ 0.3*m.x1009, sense=maximize)
m.c2 = Constraint(expr= m.b2 + m.b5 <= 1)
m.c3 = Constraint(expr= m.b2 + m.b6 <= 1)
m.c4 = Constraint(expr= m.b3 + m.b7 <= 1)
m.c5 = Constraint(expr= m.b3 + m.b8 <= 1)
m.c6 = Constraint(expr= m.b3 + m.b9 <= 1)
m.c7 = Constraint(expr= m.b4 + m.b10 <= 1)
m.c8 = Constraint(expr= m.b4 + m.b11 <= 1)
m.c9 = Constraint(expr= m.b5 + m.b12 <= 1)
m.c10 = Constraint(expr= m.b7 + m.b12 <= 1)
m.c11 = Constraint(expr= m.b9 + m.b15 <= 1)
m.c12 = Constraint(expr= m.b11 + m.b15 <= 1)
m.c13 = Constraint(expr= m.b12 + m.b13 <= 1)
m.c14 = Constraint(expr= m.b14 + m.b15 <= 1)
m.c15 = Constraint(expr= m.b2 + m.b3 + m.b4 <= 1)
m.c16 = Constraint(expr= m.b6 + m.b13 + m.b14 <= 1)
m.c17 = Constraint(expr= m.b8 + m.b13 + m.b14 <= 1)
m.c18 = Constraint(expr= m.b10 + m.b13 + m.b14 <= 1)
m.c19 = Constraint(expr= m.b16 + m.b19 <= 1)
m.c20 = Constraint(expr= m.b16 + m.b20 <= 1)
m.c21 = Constraint(expr= m.b17 + m.b21 <= 1)
m.c22 = Constraint(expr= m.b17 + m.b22 <= 1)
m.c23 = Constraint(expr= m.b17 + m.b23 <= 1)
m.c24 = Constraint(expr= m.b18 + m.b24 <= 1)
m.c25 = Constraint(expr= m.b18 + m.b25 <= 1)
m.c26 = Constraint(expr= m.b19 + m.b26 <= 1)
m.c27 = Constraint(expr= m.b21 + m.b26 <= 1)
m.c28 = Constraint(expr= m.b23 + m.b29 <= 1)
m.c29 = Constraint(expr= m.b25 + m.b29 <= 1)
m.c30 = Constraint(expr= m.b26 + m.b27 <= 1)
m.c31 = Constraint(expr= m.b28 + m.b29 <= 1)
m.c32 = Constraint(expr= m.b16 + m.b17 + m.b18 <= 1)
m.c33 = Constraint(expr= m.b20 + m.b27 + m.b28 <= 1)
m.c34 = Constraint(expr= m.b22 + m.b27 + m.b28 <= 1)
m.c35 = Constraint(expr= m.b24 + m.b27 + m.b28 <= 1)
m.c36 = Constraint(expr= m.b30 + m.b33 <= 1)
m.c37 = Constraint(expr= m.b30 + m.b34 <= 1)
m.c38 = Constraint(expr= m.b31 + m.b35 <= 1)
m.c39 = Constraint(expr= m.b31 + m.b36 <= 1)
m.c40 = Constraint(expr= m.b31 + m.b37 <= 1)
m.c41 = Constraint(expr= m.b32 + m.b38 <= 1)
m.c42 = Constraint(expr= m.b32 + m.b39 <= 1)
m.c43 = Constraint(expr= m.b33 + m.b40 <= 1)
m.c44 = Constraint(expr= m.b35 + m.b40 <= 1)
m.c45 = Constraint(expr= m.b37 + m.b43 <= 1)
m.c46 = Constraint(expr= m.b39 + m.b43 <= 1)
m.c47 = Constraint(expr= m.b40 + m.b41 <= 1)
m.c48 = Constraint(expr= m.b42 + m.b43 <= 1)
m.c49 = Constraint(expr= m.b30 + m.b31 + m.b32 <= 1)
m.c50 = Constraint(expr= m.b34 + m.b41 + m.b42 <= 1)
m.c51 = Constraint(expr= m.b36 + m.b41 + m.b42 <= 1)
m.c52 = Constraint(expr= m.b38 + m.b41 + m.b42 <= 1)
m.c53 = Constraint(expr= m.b44 + m.b47 <= 1)
m.c54 = Constraint(expr= m.b44 + m.b48 <= 1)
m.c55 = Constraint(expr= m.b45 + m.b49 <= 1)
m.c56 = Constraint(expr= m.b45 + m.b50 <= 1)
m.c57 = Constraint(expr= m.b45 + m.b51 <= 1)
m.c58 = Constraint(expr= m.b46 + m.b52 <= 1)
m.c59 = Constraint(expr= m.b46 + m.b53 <= 1)
m.c60 = Constraint(expr= m.b47 + m.b54 <= 1)
m.c61 = Constraint(expr= m.b49 + m.b54 <= 1)
m.c62 = Constraint(expr= m.b51 + m.b57 <= 1)
m.c63 = Constraint(expr= m.b53 + m.b57 <= 1)
m.c64 = Constraint(expr= m.b54 + m.b55 <= 1)
m.c65 = Constraint(expr= m.b56 + m.b57 <= 1)
m.c66 = Constraint(expr= m.b44 + m.b45 + m.b46 <= 1)
m.c67 = Constraint(expr= m.b48 + m.b55 + m.b56 <= 1)
m.c68 = Constraint(expr= m.b50 + m.b55 + m.b56 <= 1)
m.c69 = Constraint(expr= m.b52 + m.b55 + m.b56 <= 1)
m.c70 = Constraint(expr= m.b58 + m.b61 <= 1)
m.c71 = Constraint(expr= m.b58 + m.b62 <= 1)
m.c72 = Constraint(expr= m.b59 + m.b63 <= 1)
m.c73 = Constraint(expr= m.b59 + m.b64 <= 1)
m.c74 = Constraint(expr= m.b59 + m.b65 <= 1)
m.c75 = Constraint(expr= m.b60 + m.b66 <= 1)
m.c76 = Constraint(expr= m.b60 + m.b67 <= 1)
m.c77 = Constraint(expr= m.b61 + m.b68 <= 1)
m.c78 = Constraint(expr= m.b63 + m.b68 <= 1)
m.c79 = Constraint(expr= m.b65 + m.b71 <= 1)
m.c80 = Constraint(expr= m.b67 + m.b71 <= 1)
m.c81 = Constraint(expr= m.b68 + m.b69 <= 1)
m.c82 = Constraint(expr= m.b70 + m.b71 <= 1)
m.c83 = Constraint(expr= m.b58 + m.b59 + m.b60 <= 1)
m.c84 = Constraint(expr= m.b62 + m.b69 + m.b70 <= 1)
m.c85 = Constraint(expr= m.b64 + m.b69 + m.b70 <= 1)
m.c86 = Constraint(expr= m.b66 + m.b69 + m.b70 <= 1)
m.c87 = Constraint(expr= m.b72 + m.b75 <= 1)
m.c88 = Constraint(expr= m.b72 + m.b76 <= 1)
m.c89 = Constraint(expr= m.b73 + m.b77 <= 1)
m.c90 = Constraint(expr= m.b73 + m.b78 <= 1)
m.c91 = Constraint(expr= m.b73 + m.b79 <= 1)
m.c92 = Constraint(expr= m.b74 + m.b80 <= 1)
m.c93 = Constraint(expr= m.b74 + m.b81 <= 1)
m.c94 = Constraint(expr= m.b75 + m.b82 <= 1)
m.c95 = Constraint(expr= m.b77 + m.b82 <= 1)
m.c96 = Constraint(expr= m.b79 + m.b85 <= 1)
m.c97 = Constraint(expr= m.b81 + m.b85 <= 1)
m.c98 = Constraint(expr= m.b82 + m.b83 <= 1)
m.c99 = Constraint(expr= m.b84 + m.b85 <= 1)
m.c100 = Constraint(expr= m.b72 + m.b73 + m.b74 <= 1)
m.c101 = Constraint(expr= m.b76 + m.b83 + m.b84 <= 1)
m.c102 = Constraint(expr= m.b78 + m.b83 + m.b84 <= 1)
m.c103 = Constraint(expr= m.b80 + m.b83 + m.b84 <= 1)
m.c104 = Constraint(expr= m.b2 + m.b16 + m.b30 + m.b44 + m.b58 + m.b72 >= 1)
m.c105 = Constraint(expr= m.b3 + m.b17 + m.b31 + m.b45 + m.b59 + m.b73 >= 1)
m.c106 = Constraint(expr= m.b4 + m.b18 + m.b32 + m.b46 + m.b60 + m.b74 >= 1)
m.c107 = Constraint(expr= m.b12 + m.b26 + m.b40 + m.b54 + m.b68 + m.b82 >= 1)
m.c108 = Constraint(expr= m.b13 + m.b27 + m.b41 + m.b55 + m.b69 + m.b83 >= 1)
m.c109 = Constraint(expr= m.b14 + m.b28 + m.b42 + m.b56 + m.b70 + m.b84 >= 1)
m.c110 = Constraint(expr= m.b15 + m.b29 + m.b43 + m.b57 + m.b71 + m.b85 >= 1)
m.c111 = Constraint(expr= m.b12 + m.b13 + m.b14 + m.b15 + m.b26 + m.b27 + m.b28 + m.b29 + m.b40 + m.b41 + m.b42
+ m.b43 + m.b54 + m.b55 + m.b56 + m.b57 + m.b68 + m.b69 + m.b70 + m.b71 + m.b82 + m.b83
+ m.b84 + m.b85 >= 5)
m.c112 = Constraint(expr= m.b2 + m.b16 + m.b30 + m.b44 + m.b58 + m.b72 <= 1)
m.c113 = Constraint(expr= m.b3 + m.b17 + m.b31 + m.b45 + m.b59 + m.b73 <= 1)
m.c114 = Constraint(expr= m.b4 + m.b18 + m.b32 + m.b46 + m.b60 + m.b74 <= 1)
m.c115 = Constraint(expr= m.b12 + m.b26 + m.b40 + m.b54 + m.b68 + m.b82 <= 2)
m.c116 = Constraint(expr= m.b13 + m.b27 + m.b41 + m.b55 + m.b69 + m.b83 <= 1)
m.c117 = Constraint(expr= m.b14 + m.b28 + m.b42 + m.b56 + m.b70 + m.b84 <= 1)
m.c118 = Constraint(expr= m.b15 + m.b29 + m.b43 + m.b57 + m.b71 + m.b85 <= 2)
m.c119 = Constraint(expr= m.b12 + m.b13 + m.b14 + m.b15 + m.b26 + m.b27 + m.b28 + m.b29 + m.b40 + m.b41 + m.b42
+ m.b43 + m.b54 + m.b55 + m.b56 + m.b57 + m.b68 + m.b69 + m.b70 + m.b71 + m.b82 + m.b83
+ m.b84 + m.b85 <= 5)
m.c120 = Constraint(expr= m.b12 + m.b13 >= 1)
m.c121 = Constraint(expr= m.b14 + m.b15 >= 1)
m.c122 = Constraint(expr= m.b12 + m.b13 <= 1)
m.c123 = Constraint(expr= m.b14 + m.b15 <= 1)
m.c124 = Constraint(expr= - m.x87 - m.x101 - m.x115 - m.x129 - m.x143 - m.x157 + m.x254 + m.x268 + m.x282 + m.x296
+ m.x310 + m.x324 <= 0)
m.c125 = Constraint(expr= - m.x88 - m.x102 - m.x116 - m.x130 - m.x144 - m.x158 + m.x255 + m.x269 + m.x283 + m.x297
+ m.x311 + m.x325 <= 0)
m.c126 = Constraint(expr= - m.b3 >= 0)
m.c127 = Constraint(expr= - m.b4 >= 0)
m.c128 = Constraint(expr= m.b2 - m.b3 - m.b17 >= 0)
m.c129 = Constraint(expr= m.b3 - m.b4 - m.b18 >= 0)
m.c130 = Constraint(expr= m.b2 - m.b3 + m.b16 - m.b17 - m.b31 >= 0)
m.c131 = Constraint(expr= m.b3 - m.b4 + m.b17 - m.b18 - m.b32 >= 0)
m.c132 = Constraint(expr= m.b2 - m.b3 + m.b16 - m.b17 + m.b30 - m.b31 - m.b45 >= 0)
m.c133 = Constraint(expr= m.b3 - m.b4 + m.b17 - m.b18 + m.b31 - m.b32 - m.b46 >= 0)
m.c134 = Constraint(expr= m.b2 - m.b3 + m.b16 - m.b17 + m.b30 - m.b31 + m.b44 - m.b45 - m.b59 >= 0)
m.c135 = Constraint(expr= m.b3 - m.b4 + m.b17 - m.b18 + m.b31 - m.b32 + m.b45 - m.b46 - m.b60 >= 0)
m.c136 = Constraint(expr= m.b2 - m.b3 + m.b16 - m.b17 + m.b30 - m.b31 + m.b44 - m.b45 + m.b58 - m.b59 - m.b73 >= 0)
m.c137 = Constraint(expr= m.b3 - m.b4 + m.b17 - m.b18 + m.b31 - m.b32 + m.b45 - m.b46 + m.b59 - m.b60 - m.b74 >= 0)
m.c138 = Constraint(expr= - m.x86 - m.x170 + m.x254 == 0)
m.c139 = Constraint(expr= - m.x87 - m.x171 + m.x255 == 0)
m.c140 = Constraint(expr= - m.x88 - m.x172 + m.x256 == 0)
m.c141 = Constraint(expr= - m.x89 - m.x173 + m.x257 == 0)
m.c142 = Constraint(expr= - m.x90 - m.x174 + m.x258 == 0)
m.c143 = Constraint(expr= - m.x91 - m.x175 + m.x259 == 0)
m.c144 = Constraint(expr= - m.x92 - m.x176 + m.x260 == 0)
m.c145 = Constraint(expr= - m.x93 - m.x177 + m.x261 == 0)
m.c146 = Constraint(expr= - m.x94 - m.x178 + m.x262 == 0)
m.c147 = Constraint(expr= - m.x95 - m.x179 + m.x263 == 0)
m.c148 = Constraint(expr= - m.x96 - m.x180 + m.x264 == 0)
m.c149 = Constraint(expr= - m.x97 - m.x181 + m.x265 == 0)
m.c150 = Constraint(expr= - m.x98 - m.x182 + m.x266 == 0)
m.c151 = Constraint(expr= - m.x99 - m.x183 + m.x267 == 0)
m.c152 = Constraint(expr= - m.x100 - m.x184 + m.x268 == 0)
m.c153 = Constraint(expr= - m.x101 - m.x185 + m.x269 == 0)
m.c154 = Constraint(expr= - m.x102 - m.x186 + m.x270 == 0)
m.c155 = Constraint(expr= - m.x103 - m.x187 + m.x271 == 0)
m.c156 = Constraint(expr= - m.x104 - m.x188 + m.x272 == 0)
m.c157 = Constraint(expr= - m.x105 - m.x189 + m.x273 == 0)
m.c158 = Constraint(expr= - m.x106 - m.x190 + m.x274 == 0)
m.c159 = Constraint(expr= - m.x107 - m.x191 + m.x275 == 0)
m.c160 = Constraint(expr= - m.x108 - m.x192 + m.x276 == 0)
m.c161 = Constraint(expr= - m.x109 - m.x193 + m.x277 == 0)
m.c162 = Constraint(expr= - m.x110 - m.x194 + m.x278 == 0)
m.c163 = Constraint(expr= - m.x111 - m.x195 + m.x279 == 0)
m.c164 = Constraint(expr= - m.x112 - m.x196 + m.x280 == 0)
m.c165 = Constraint(expr= - m.x113 - m.x197 + m.x281 == 0)
m.c166 = Constraint(expr= - m.x114 - m.x198 + m.x282 == 0)
m.c167 = Constraint(expr= - m.x115 - m.x199 + m.x283 == 0)
m.c168 = Constraint(expr= - m.x116 - m.x200 + m.x284 == 0)
m.c169 = Constraint(expr= - m.x117 - m.x201 + m.x285 == 0)
m.c170 = Constraint(expr= - m.x118 - m.x202 + m.x286 == 0)
m.c171 = Constraint(expr= - m.x119 - m.x203 + m.x287 == 0)
m.c172 = Constraint(expr= - m.x120 - m.x204 + m.x288 == 0)
m.c173 = Constraint(expr= - m.x121 - m.x205 + m.x289 == 0)
m.c174 = Constraint(expr= - m.x122 - m.x206 + m.x290 == 0)
m.c175 = Constraint(expr= - m.x123 - m.x207 + m.x291 == 0)
m.c176 = Constraint(expr= - m.x124 - m.x208 + m.x292 == 0)
m.c177 = Constraint(expr= - m.x125 - m.x209 + m.x293 == 0)
m.c178 = Constraint(expr= - m.x126 - m.x210 + m.x294 == 0)
m.c179 = Constraint(expr= - m.x127 - m.x211 + m.x295 == 0)
m.c180 = Constraint(expr= - m.x128 - m.x212 + m.x296 == 0)
m.c181 = Constraint(expr= - m.x129 - m.x213 + m.x297 == 0)
m.c182 = Constraint(expr= - m.x130 - m.x214 + m.x298 == 0)
m.c183 = Constraint(expr= - m.x131 - m.x215 + m.x299 == 0)
m.c184 = Constraint(expr= - m.x132 - m.x216 + m.x300 == 0)
m.c185 = Constraint(expr= - m.x133 - m.x217 + m.x301 == 0)
m.c186 = Constraint(expr= - m.x134 - m.x218 + m.x302 == 0)
m.c187 = Constraint(expr= - m.x135 - m.x219 + m.x303 == 0)
m.c188 = Constraint(expr= - m.x136 - m.x220 + m.x304 == 0)
m.c189 = Constraint(expr= - m.x137 - m.x221 + m.x305 == 0)
m.c190 = Constraint(expr= - m.x138 - m.x222 + m.x306 == 0)
m.c191 = Constraint(expr= - m.x139 - m.x223 + m.x307 == 0)
m.c192 = Constraint(expr= - m.x140 - m.x224 + m.x308 == 0)
m.c193 = Constraint(expr= - m.x141 - m.x225 + m.x309 == 0)
m.c194 = Constraint(expr= - m.x142 - m.x226 + m.x310 == 0)
m.c195 = Constraint(expr= - m.x143 - m.x227 + m.x311 == 0)
m.c196 = Constraint(expr= - m.x144 - m.x228 + m.x312 == 0)
m.c197 = Constraint(expr= - m.x145 - m.x229 + m.x313 == 0)
m.c198 = Constraint(expr= - m.x146 - m.x230 + m.x314 == 0)
m.c199 = Constraint(expr= - m.x147 - m.x231 + m.x315 == 0)
m.c200 = Constraint(expr= - m.x148 - m.x232 + m.x316 == 0)
m.c201 = Constraint(expr= - m.x149 - m.x233 + m.x317 == 0)
m.c202 = Constraint(expr= - m.x150 - m.x234 + m.x318 == 0)
m.c203 = Constraint(expr= - m.x151 - m.x235 + m.x319 == 0)
m.c204 = Constraint(expr= - m.x152 - m.x236 + m.x320 == 0)
m.c205 = Constraint(expr= - m.x153 - m.x237 + m.x321 == 0)
m.c206 = Constraint(expr= - m.x154 - m.x238 + m.x322 == 0)
m.c207 = Constraint(expr= - m.x155 - m.x239 + m.x323 == 0)
m.c208 = Constraint(expr= - m.x156 - m.x240 + m.x324 == 0)
m.c209 = Constraint(expr= - m.x157 - m.x241 + m.x325 == 0)
m.c210 = Constraint(expr= - m.x158 - m.x242 + m.x326 == 0)
m.c211 = Constraint(expr= - m.x159 - m.x243 + m.x327 == 0)
m.c212 = Constraint(expr= - m.x160 - m.x244 + m.x328 == 0)
m.c213 = Constraint(expr= - m.x161 - m.x245 + m.x329 == 0)
m.c214 = Constraint(expr= - m.x162 - m.x246 + m.x330 == 0)
m.c215 = Constraint(expr= - m.x163 - m.x247 + m.x331 == 0)
m.c216 = Constraint(expr= - m.x164 - m.x248 + m.x332 == 0)
m.c217 = Constraint(expr= - m.x165 - m.x249 + m.x333 == 0)
m.c218 = Constraint(expr= - m.x166 - m.x250 + m.x334 == 0)
m.c219 = Constraint(expr= - m.x167 - m.x251 + m.x335 == 0)
m.c220 = Constraint(expr= - m.x168 - m.x252 + m.x336 == 0)
m.c221 = Constraint(expr= - m.x169 - m.x253 + m.x337 == 0)
m.c222 = Constraint(expr= - 0.001*m.b2 + m.x86 >= 0)
m.c223 = Constraint(expr= - 4.001*m.b3 + m.x87 >= 0)
m.c224 = Constraint(expr= - 8.001*m.b4 + m.x88 >= 0)
m.c225 = Constraint(expr= m.x89 >= 0)
m.c226 = Constraint(expr= m.x90 >= 0)
m.c227 = Constraint(expr= m.x91 >= 0)
m.c228 = Constraint(expr= m.x92 >= 0)
m.c229 = Constraint(expr= m.x93 >= 0)
m.c230 = Constraint(expr= m.x94 >= 0)
m.c231 = Constraint(expr= m.x95 >= 0)
m.c232 = Constraint(expr= m.x96 >= 0)
m.c233 = Constraint(expr= m.x97 >= 0)
m.c234 = Constraint(expr= m.x98 >= 0)
m.c235 = Constraint(expr= m.x99 >= 0)
m.c236 = Constraint(expr= - 0.001*m.b16 + m.x100 >= 0)
m.c237 = Constraint(expr= - 4.001*m.b17 + m.x101 >= 0)
m.c238 = Constraint(expr= - 8.001*m.b18 + m.x102 >= 0)
m.c239 = Constraint(expr= m.x103 >= 0)
m.c240 = Constraint(expr= m.x104 >= 0)
m.c241 = Constraint(expr= m.x105 >= 0)
m.c242 = Constraint(expr= m.x106 >= 0)
m.c243 = Constraint(expr= m.x107 >= 0)
m.c244 = Constraint(expr= m.x108 >= 0)
m.c245 = Constraint(expr= m.x109 >= 0)
m.c246 = Constraint(expr= m.x110 >= 0)
m.c247 = Constraint(expr= m.x111 >= 0)
m.c248 = Constraint(expr= m.x112 >= 0)
m.c249 = Constraint(expr= m.x113 >= 0)
m.c250 = Constraint(expr= - 0.001*m.b30 + m.x114 >= 0)
m.c251 = Constraint(expr= - 4.001*m.b31 + m.x115 >= 0)
m.c252 = Constraint(expr= - 8.001*m.b32 + m.x116 >= 0)
m.c253 = Constraint(expr= m.x117 >= 0)
m.c254 = Constraint(expr= m.x118 >= 0)
m.c255 = Constraint(expr= m.x119 >= 0)
m.c256 = Constraint(expr= m.x120 >= 0)
m.c257 = Constraint(expr= m.x121 >= 0)
m.c258 = Constraint(expr= m.x122 >= 0)
m.c259 = Constraint(expr= m.x123 >= 0)
m.c260 = Constraint(expr= m.x124 >= 0)
m.c261 = Constraint(expr= m.x125 >= 0)
m.c262 = Constraint(expr= m.x126 >= 0)
m.c263 = Constraint(expr= m.x127 >= 0)
m.c264 = Constraint(expr= - 0.001*m.b44 + m.x128 >= 0)
m.c265 = Constraint(expr= - 4.001*m.b45 + m.x129 >= 0)
m.c266 = Constraint(expr= - 8.001*m.b46 + m.x130 >= 0)
m.c267 = Constraint(expr= m.x131 >= 0)
m.c268 = Constraint(expr= m.x132 >= 0)
m.c269 = Constraint(expr= m.x133 >= 0)
m.c270 = Constraint(expr= m.x134 >= 0)
m.c271 = Constraint(expr= m.x135 >= 0)
m.c272 = Constraint(expr= m.x136 >= 0)
m.c273 = Constraint(expr= m.x137 >= 0)
m.c274 = Constraint(expr= m.x138 >= 0)
m.c275 = Constraint(expr= m.x139 >= 0)
m.c276 = Constraint(expr= m.x140 >= 0)
m.c277 = Constraint(expr= m.x141 >= 0)
m.c278 = Constraint(expr= - 0.001*m.b58 + m.x142 >= 0)
m.c279 = Constraint(expr= - 4.001*m.b59 + m.x143 >= 0)
m.c280 = Constraint(expr= - 8.001*m.b60 + m.x144 >= 0)
m.c281 = Constraint(expr= m.x145 >= 0)
m.c282 = Constraint(expr= m.x146 >= 0)
m.c283 = Constraint(expr= m.x147 >= 0)
m.c284 = Constraint(expr= m.x148 >= 0)
m.c285 = Constraint(expr= m.x149 >= 0)
m.c286 = Constraint(expr= m.x150 >= 0)
m.c287 = Constraint(expr= m.x151 >= 0)
m.c288 = Constraint(expr= m.x152 >= 0)
m.c289 = Constraint(expr= m.x153 >= 0)
m.c290 = Constraint(expr= m.x154 >= 0)
m.c291 = Constraint(expr= m.x155 >= 0)
m.c292 = Constraint(expr= - 0.001*m.b72 + m.x156 >= 0)
m.c293 = Constraint(expr= - 4.001*m.b73 + m.x157 >= 0)
m.c294 = Constraint(expr= - 8.001*m.b74 + m.x158 >= 0)
m.c295 = Constraint(expr= m.x159 >= 0)
m.c296 = Constraint(expr= m.x160 >= 0)
m.c297 = Constraint(expr= m.x161 >= 0)
m.c298 = Constraint(expr= m.x162 >= 0)
m.c299 = Constraint(expr= m.x163 >= 0)
m.c300 = Constraint(expr= m.x164 >= 0)
m.c301 = Constraint(expr= m.x165 >= 0)
m.c302 = Constraint(expr= m.x166 >= 0)
m.c303 = Constraint(expr= m.x167 >= 0)
m.c304 = Constraint(expr= m.x168 >= 0)
m.c305 = Constraint(expr= m.x169 >= 0)
m.c306 = Constraint(expr= - 12*m.b2 + m.x254 <= 0)
m.c307 = Constraint(expr= - 12*m.b3 + m.x255 <= 0)
m.c308 = Constraint(expr= - 12*m.b4 + m.x256 <= 0)
m.c309 = Constraint(expr= - 12*m.b5 + m.x257 <= 0)
m.c310 = Constraint(expr= - 12*m.b6 + m.x258 <= 0)
m.c311 = Constraint(expr= - 12*m.b7 + m.x259 <= 0)
m.c312 = Constraint(expr= - 12*m.b8 + m.x260 <= 0)
m.c313 = Constraint(expr= - 12*m.b9 + m.x261 <= 0)
m.c314 = Constraint(expr= - 12*m.b10 + m.x262 <= 0)
m.c315 = Constraint(expr= - 12*m.b11 + m.x263 <= 0)
m.c316 = Constraint(expr= - 12*m.b12 + m.x264 <= 0)
m.c317 = Constraint(expr= - 12*m.b13 + m.x265 <= 0)
m.c318 = Constraint(expr= - 12*m.b14 + m.x266 <= 0)
m.c319 = Constraint(expr= - 12*m.b15 + m.x267 <= 0)
m.c320 = Constraint(expr= - 12*m.b16 + m.x268 <= 0)
m.c321 = Constraint(expr= - 12*m.b17 + m.x269 <= 0)
m.c322 = Constraint(expr= - 12*m.b18 + m.x270 <= 0)
m.c323 = Constraint(expr= - 12*m.b19 + m.x271 <= 0)
m.c324 = Constraint(expr= - 12*m.b20 + m.x272 <= 0)
m.c325 = Constraint(expr= - 12*m.b21 + m.x273 <= 0)
m.c326 = Constraint(expr= - 12*m.b22 + m.x274 <= 0)
m.c327 = Constraint(expr= - 12*m.b23 + m.x275 <= 0)
m.c328 = Constraint(expr= - 12*m.b24 + m.x276 <= 0)
m.c329 = Constraint(expr= - 12*m.b25 + m.x277 <= 0)
m.c330 = Constraint(expr= - 12*m.b26 + m.x278 <= 0)
m.c331 = Constraint(expr= - 12*m.b27 + m.x279 <= 0)
m.c332 = Constraint(expr= - 12*m.b28 + m.x280 <= 0)
m.c333 = Constraint(expr= - 12*m.b29 + m.x281 <= 0)
m.c334 = Constraint(expr= - 12*m.b30 + m.x282 <= 0)
m.c335 = Constraint(expr= - 12*m.b31 + m.x283 <= 0)
m.c336 = Constraint(expr= - 12*m.b32 + m.x284 <= 0)
m.c337 = Constraint(expr= - 12*m.b33 + m.x285 <= 0)
m.c338 = Constraint(expr= - 12*m.b34 + m.x286 <= 0)
m.c339 = Constraint(expr= - 12*m.b35 + m.x287 <= 0)
m.c340 = Constraint(expr= - 12*m.b36 + m.x288 <= 0)
m.c341 = Constraint(expr= - 12*m.b37 + m.x289 <= 0)
m.c342 = Constraint(expr= - 12*m.b38 + m.x290 <= 0)
m.c343 = Constraint(expr= - 12*m.b39 + m.x291 <= 0)
m.c344 = Constraint(expr= - 12*m.b40 + m.x292 <= 0)
m.c345 = Constraint(expr= - 12*m.b41 + m.x293 <= 0)
m.c346 = Constraint(expr= - 12*m.b42 + m.x294 <= 0)
m.c347 = Constraint(expr= - 12*m.b43 + m.x295 <= 0)
m.c348 = Constraint(expr= - 12*m.b44 + m.x296 <= 0)
m.c349 = Constraint(expr= - 12*m.b45 + m.x297 <= 0)
m.c350 = Constraint(expr= - 12*m.b46 + m.x298 <= 0)
m.c351 = Constraint(expr= - 12*m.b47 + m.x299 <= 0)
m.c352 = Constraint(expr= - 12*m.b48 + m.x300 <= 0)
m.c353 = Constraint(expr= - 12*m.b49 + m.x301 <= 0)
m.c354 = Constraint(expr= - 12*m.b50 + m.x302 <= 0)
m.c355 = Constraint(expr= - 12*m.b51 + m.x303 <= 0)
m.c356 = Constraint(expr= - 12*m.b52 + m.x304 <= 0)
m.c357 = Constraint(expr= - 12*m.b53 + m.x305 <= 0)
m.c358 = Constraint(expr= - 12*m.b54 + m.x306 <= 0)
m.c359 = Constraint(expr= - 12*m.b55 + m.x307 <= 0)
m.c360 = Constraint(expr= - 12*m.b56 + m.x308 <= 0)
m.c361 = Constraint(expr= - 12*m.b57 + m.x309 <= 0)
m.c362 = Constraint(expr= - 12*m.b58 + m.x310 <= 0)
m.c363 = Constraint(expr= - 12*m.b59 + m.x311 <= 0)
m.c364 = Constraint(expr= - 12*m.b60 + m.x312 <= 0)
m.c365 = Constraint(expr= - 12*m.b61 + m.x313 <= 0)
m.c366 = Constraint(expr= - 12*m.b62 + m.x314 <= 0)
m.c367 = Constraint(expr= - 12*m.b63 + m.x315 <= 0)
m.c368 = Constraint(expr= - 12*m.b64 + m.x316 <= 0)
m.c369 = Constraint(expr= - 12*m.b65 + m.x317 <= 0)
m.c370 = Constraint(expr= - 12*m.b66 + m.x318 <= 0)
m.c371 = Constraint(expr= - 12*m.b67 + m.x319 <= 0)
m.c372 = Constraint(expr= - 12*m.b68 + m.x320 <= 0)
m.c373 = Constraint(expr= - 12*m.b69 + m.x321 <= 0)
m.c374 = Constraint(expr= - 12*m.b70 + m.x322 <= 0)
m.c375 = Constraint(expr= - 12*m.b71 + m.x323 <= 0)
m.c376 = Constraint(expr= - 12*m.b72 + m.x324 <= 0)
m.c377 = Constraint(expr= - 12*m.b73 + m.x325 <= 0)
m.c378 = Constraint(expr= - 12*m.b74 + m.x326 <= 0)
m.c379 = Constraint(expr= - 12*m.b75 + m.x327 <= 0)
m.c380 = Constraint(expr= - 12*m.b76 + m.x328 <= 0)
m.c381 = Constraint(expr= - 12*m.b77 + m.x329 <= 0)
m.c382 = Constraint(expr= - 12*m.b78 + m.x330 <= 0)
m.c383 = Constraint(expr= - 12*m.b79 + m.x331 <= 0)
m.c384 = Constraint(expr= - 12*m.b80 + m.x332 <= 0)
m.c385 = Constraint(expr= - 12*m.b81 + m.x333 <= 0)
m.c386 = Constraint(expr= - 12*m.b82 + m.x334 <= 0)
m.c387 = Constraint(expr= - 12*m.b83 + m.x335 <= 0)
m.c388 = Constraint(expr= - 12*m.b84 + m.x336 <= 0)
m.c389 = Constraint(expr= - 12*m.b85 + m.x337 <= 0)
m.c390 = Constraint(expr= - 50*m.b2 + m.x338 >= 0)
m.c391 = Constraint(expr= - 50*m.b3 + m.x339 >= 0)
m.c392 = Constraint(expr= - 50*m.b4 + m.x340 >= 0)
m.c393 = Constraint(expr= - 50*m.b16 + m.x352 >= 0)
m.c394 = Constraint(expr= - 50*m.b17 + m.x353 >= 0)
m.c395 = Constraint(expr= - 50*m.b18 + m.x354 >= 0)
m.c396 = Constraint(expr= - 50*m.b30 + m.x366 >= 0)
m.c397 = Constraint(expr= - 50*m.b31 + m.x367 >= 0)
m.c398 = Constraint(expr= - 50*m.b32 + m.x368 >= 0)
m.c399 = Constraint(expr= - 50*m.b44 + m.x380 >= 0)
m.c400 = Constraint(expr= - 50*m.b45 + m.x381 >= 0)
m.c401 = Constraint(expr= - 50*m.b46 + m.x382 >= 0)
m.c402 = Constraint(expr= - 50*m.b58 + m.x394 >= 0)
m.c403 = Constraint(expr= - 50*m.b59 + m.x395 >= 0)
m.c404 = Constraint(expr= - 50*m.b60 + m.x396 >= 0)
m.c405 = Constraint(expr= - 50*m.b72 + m.x408 >= 0)
m.c406 = Constraint(expr= - 50*m.b73 + m.x409 >= 0)
m.c407 = Constraint(expr= - 50*m.b74 + m.x410 >= 0)
m.c408 = Constraint(expr= - 50*m.b2 + m.x338 <= 0)
m.c409 = Constraint(expr= - 50*m.b3 + m.x339 <= 0)
m.c410 = Constraint(expr= - 50*m.b4 + m.x340 <= 0)
m.c411 = Constraint(expr= - 100*m.b5 + m.x341 <= 0)
m.c412 = Constraint(expr= - 100*m.b6 + m.x342 <= 0)
m.c413 = Constraint(expr= - 100*m.b7 + m.x343 <= 0)
m.c414 = Constraint(expr= - 100*m.b8 + m.x344 <= 0)
m.c415 = Constraint(expr= - 100*m.b9 + m.x345 <= 0)
m.c416 = Constraint(expr= - 100*m.b10 + m.x346 <= 0)
m.c417 = Constraint(expr= - 100*m.b11 + m.x347 <= 0)
m.c418 = Constraint(expr= - 50*m.b12 + m.x348 <= 0)
m.c419 = Constraint(expr= - 50*m.b13 + m.x349 <= 0)
m.c420 = Constraint(expr= - 50*m.b14 + m.x350 <= 0)
m.c421 = Constraint(expr= - 50*m.b15 + m.x351 <= 0)
m.c422 = Constraint(expr= - 50*m.b16 + m.x352 <= 0)
m.c423 = Constraint(expr= - 50*m.b17 + m.x353 <= 0)
m.c424 = Constraint(expr= - 50*m.b18 + m.x354 <= 0)
m.c425 = Constraint(expr= - 100*m.b19 + m.x355 <= 0)
m.c426 = Constraint(expr= - 100*m.b20 + m.x356 <= 0)
m.c427 = Constraint(expr= - 100*m.b21 + m.x357 <= 0)
m.c428 = Constraint(expr= - 100*m.b22 + m.x358 <= 0)
m.c429 = Constraint(expr= - 100*m.b23 + m.x359 <= 0)
m.c430 = Constraint(expr= - 100*m.b24 + m.x360 <= 0)
m.c431 = Constraint(expr= - 100*m.b25 + m.x361 <= 0)
m.c432 = Constraint(expr= - 50*m.b26 + m.x362 <= 0)
m.c433 = Constraint(expr= - 50*m.b27 + m.x363 <= 0)
m.c434 = Constraint(expr= - 50*m.b28 + m.x364 <= 0)
m.c435 = Constraint(expr= - 50*m.b29 + m.x365 <= 0)
m.c436 = Constraint(expr= - 50*m.b30 + m.x366 <= 0)
m.c437 = Constraint(expr= - 50*m.b31 + m.x367 <= 0)
m.c438 = Constraint(expr= - 50*m.b32 + m.x368 <= 0)
m.c439 = Constraint(expr= - 100*m.b33 + m.x369 <= 0)
m.c440 = Constraint(expr= - 100*m.b34 + m.x370 <= 0)
m.c441 = Constraint(expr= - 100*m.b35 + m.x371 <= 0)
m.c442 = Constraint(expr= - 100*m.b36 + m.x372 <= 0)
m.c443 = Constraint(expr= - 100*m.b37 + m.x373 <= 0)
m.c444 = Constraint(expr= - 100*m.b38 + m.x374 <= 0)
m.c445 = Constraint(expr= - 100*m.b39 + m.x375 <= 0)
m.c446 = Constraint(expr= - 50*m.b40 + m.x376 <= 0)
m.c447 = Constraint(expr= - 50*m.b41 + m.x377 <= 0)
m.c448 = Constraint(expr= - 50*m.b42 + m.x378 <= 0)
m.c449 = Constraint(expr= - 50*m.b43 + m.x379 <= 0)
m.c450 = Constraint(expr= - 50*m.b44 + m.x380 <= 0)
m.c451 = Constraint(expr= - 50*m.b45 + m.x381 <= 0)
m.c452 = Constraint(expr= - 50*m.b46 + m.x382 <= 0)
m.c453 = Constraint(expr= - 100*m.b47 + m.x383 <= 0)
m.c454 = Constraint(expr= - 100*m.b48 + m.x384 <= 0)
m.c455 = Constraint(expr= - 100*m.b49 + m.x385 <= 0)
m.c456 = Constraint(expr= - 100*m.b50 + m.x386 <= 0)
m.c457 = Constraint(expr= - 100*m.b51 + m.x387 <= 0)
m.c458 = Constraint(expr= - 100*m.b52 + m.x388 <= 0)
m.c459 = Constraint(expr= - 100*m.b53 + m.x389 <= 0)
m.c460 = Constraint(expr= - 50*m.b54 + m.x390 <= 0)
m.c461 = Constraint(expr= - 50*m.b55 + m.x391 <= 0)
m.c462 = Constraint(expr= - 50*m.b56 + m.x392 <= 0)
m.c463 = Constraint(expr= - 50*m.b57 + m.x393 <= 0)
m.c464 = Constraint(expr= - 50*m.b58 + m.x394 <= 0)
m.c465 = Constraint(expr= - 50*m.b59 + m.x395 <= 0)
m.c466 = Constraint(expr= - 50*m.b60 + m.x396 <= 0)
m.c467 = Constraint(expr= - 100*m.b61 + m.x397 <= 0)
m.c468 = Constraint(expr= - 100*m.b62 + m.x398 <= 0)
m.c469 = Constraint(expr= - 100*m.b63 + m.x399 <= 0)
m.c470 = Constraint(expr= - 100*m.b64 + m.x400 <= 0)
m.c471 = Constraint(expr= - 100*m.b65 + m.x401 <= 0)
m.c472 = Constraint(expr= - 100*m.b66 + m.x402 <= 0)
m.c473 = Constraint(expr= - 100*m.b67 + m.x403 <= 0)
m.c474 = Constraint(expr= - 50*m.b68 + m.x404 <= 0)
m.c475 = Constraint(expr= - 50*m.b69 + m.x405 <= 0)
m.c476 = Constraint(expr= - 50*m.b70 + m.x406 <= 0)
m.c477 = Constraint(expr= - 50*m.b71 + m.x407 <= 0)
m.c478 = Constraint(expr= - 50*m.b72 + m.x408 <= 0)
m.c479 = Constraint(expr= - 50*m.b73 + m.x409 <= 0)
m.c480 = Constraint(expr= - 50*m.b74 + m.x410 <= 0)
m.c481 = Constraint(expr= - 100*m.b75 + m.x411 <= 0)
m.c482 = Constraint(expr= - 100*m.b76 + m.x412 <= 0)
m.c483 = Constraint(expr= - 100*m.b77 + m.x413 <= 0)
m.c484 = Constraint(expr= - 100*m.b78 + m.x414 <= 0)
m.c485 = Constraint(expr= - 100*m.b79 + m.x415 <= 0)
m.c486 = Constraint(expr= - 100*m.b80 + m.x416 <= 0)
m.c487 = Constraint(expr= - 100*m.b81 + m.x417 <= 0)
m.c488 = Constraint(expr= - 50*m.b82 + m.x418 <= 0)
m.c489 = Constraint(expr= - 50*m.b83 + m.x419 <= 0)
m.c490 = Constraint(expr= - 50*m.b84 + m.x420 <= 0)
m.c491 = Constraint(expr= - 50*m.b85 + m.x421 <= 0)
m.c492 = Constraint(expr= m.x338 - m.x422 - m.x423 - m.x424 - m.x425 - m.x426 - m.x427 - m.x428 == 0)
m.c493 = Constraint(expr= m.x339 - m.x429 - m.x430 - m.x431 - m.x432 - m.x433 - m.x434 - m.x435 == 0)
m.c494 = Constraint(expr= m.x340 - m.x436 - m.x437 - m.x438 - m.x439 - m.x440 - m.x441 - m.x442 == 0)
m.c495 = Constraint(expr= m.x341 - m.x443 - m.x444 - m.x445 - m.x446 - m.x447 - m.x448 - m.x449 == 0)
m.c496 = Constraint(expr= m.x342 - m.x450 - m.x451 - m.x452 - m.x453 - m.x454 - m.x455 - m.x456 == 0)
m.c497 = Constraint(expr= m.x343 - m.x457 - m.x458 - m.x459 - m.x460 - m.x461 - m.x462 - m.x463 == 0)
m.c498 = Constraint(expr= m.x344 - m.x464 - m.x465 - m.x466 - m.x467 - m.x468 - m.x469 - m.x470 == 0)
m.c499 = Constraint(expr= m.x345 - m.x471 - m.x472 - m.x473 - m.x474 - m.x475 - m.x476 - m.x477 == 0)
m.c500 = Constraint(expr= m.x346 - m.x478 - m.x479 - m.x480 - m.x481 - m.x482 - m.x483 - m.x484 == 0)
m.c501 = Constraint(expr= m.x347 - m.x485 - m.x486 - m.x487 - m.x488 - m.x489 - m.x490 - m.x491 == 0)
m.c502 = Constraint(expr= m.x348 - m.x492 - m.x493 - m.x494 - m.x495 - m.x496 - m.x497 - m.x498 == 0)
m.c503 = Constraint(expr= m.x349 - m.x499 - m.x500 - m.x501 - m.x502 - m.x503 - m.x504 - m.x505 == 0)
m.c504 = Constraint(expr= m.x350 - m.x506 - m.x507 - m.x508 - m.x509 - m.x510 - m.x511 - m.x512 == 0)
m.c505 = Constraint(expr= m.x351 - m.x513 - m.x514 - m.x515 - m.x516 - m.x517 - m.x518 - m.x519 == 0)
m.c506 = Constraint(expr= m.x352 - m.x520 - m.x521 - m.x522 - m.x523 - m.x524 - m.x525 - m.x526 == 0)
m.c507 = Constraint(expr= m.x353 - m.x527 - m.x528 - m.x529 - m.x530 - m.x531 - m.x532 - m.x533 == 0)
m.c508 = Constraint(expr= m.x354 - m.x534 - m.x535 - m.x536 - m.x537 - m.x538 - m.x539 - m.x540 == 0)
m.c509 = Constraint(expr= m.x355 - m.x541 - m.x542 - m.x543 - m.x544 - m.x545 - m.x546 - m.x547 == 0)
m.c510 = Constraint(expr= m.x356 - m.x548 - m.x549 - m.x550 - m.x551 - m.x552 - m.x553 - m.x554 == 0)
m.c511 = Constraint(expr= m.x357 - m.x555 - m.x556 - m.x557 - m.x558 - m.x559 - m.x560 - m.x561 == 0)
m.c512 = Constraint(expr= m.x358 - m.x562 - m.x563 - m.x564 - m.x565 - m.x566 - m.x567 - m.x568 == 0)
m.c513 = Constraint(expr= m.x359 - m.x569 - m.x570 - m.x571 - m.x572 - m.x573 - m.x574 - m.x575 == 0)
m.c514 = Constraint(expr= m.x360 - m.x576 - m.x577 - m.x578 - m.x579 - m.x580 - m.x581 - m.x582 == 0)
m.c515 = Constraint(expr= m.x361 - m.x583 - m.x584 - m.x585 - m.x586 - m.x587 - m.x588 - m.x589 == 0)
m.c516 = Constraint(expr= m.x362 - m.x590 - m.x591 - m.x592 - m.x593 - m.x594 - m.x595 - m.x596 == 0)
m.c517 = Constraint(expr= m.x363 - m.x597 - m.x598 - m.x599 - m.x600 - m.x601 - m.x602 - m.x603 == 0)
m.c518 = Constraint(expr= m.x364 - m.x604 - m.x605 - m.x606 - m.x607 - m.x608 - m.x609 - m.x610 == 0)
m.c519 = Constraint(expr= m.x365 - m.x611 - m.x612 - m.x613 - m.x614 - m.x615 - m.x616 - m.x617 == 0)
m.c520 = Constraint(expr= m.x366 - m.x618 - m.x619 - m.x620 - m.x621 - m.x622 - m.x623 - m.x624 == 0)
m.c521 = Constraint(expr= m.x367 - m.x625 - m.x626 - m.x627 - m.x628 - m.x629 - m.x630 - m.x631 == 0)
m.c522 = Constraint(expr= m.x368 - m.x632 - m.x633 - m.x634 - m.x635 - m.x636 - m.x637 - m.x638 == 0)
m.c523 = Constraint(expr= m.x369 - m.x639 - m.x640 - m.x641 - m.x642 - m.x643 - m.x644 - m.x645 == 0)
m.c524 = Constraint(expr= m.x370 - m.x646 - m.x647 - m.x648 - m.x649 - m.x650 - m.x651 - m.x652 == 0)
m.c525 = Constraint(expr= m.x371 - m.x653 - m.x654 - m.x655 - m.x656 - m.x657 - m.x658 - m.x659 == 0)
m.c526 = Constraint(expr= m.x372 - m.x660 - m.x661 - m.x662 - m.x663 - m.x664 - m.x665 - m.x666 == 0)
m.c527 = Constraint(expr= m.x373 - m.x667 - m.x668 - m.x669 - m.x670 - m.x671 - m.x672 - m.x673 == 0)
m.c528 = Constraint(expr= m.x374 - m.x674 - m.x675 - m.x676 - m.x677 - m.x678 - m.x679 - m.x680 == 0)
m.c529 = Constraint(expr= m.x375 - m.x681 - m.x682 - m.x683 - m.x684 - m.x685 - m.x686 - m.x687 == 0)
m.c530 = Constraint(expr= m.x376 - m.x688 - m.x689 - m.x690 - m.x691 - m.x692 - m.x693 - m.x694 == 0)
m.c531 = Constraint(expr= m.x377 - m.x695 - m.x696 - m.x697 - m.x698 - m.x699 - m.x700 - m.x701 == 0)
m.c532 = Constraint(expr= m.x378 - m.x702 - m.x703 - m.x704 - m.x705 - m.x706 - m.x707 - m.x708 == 0)
m.c533 = Constraint(expr= m.x379 - m.x709 - m.x710 - m.x711 - m.x712 - m.x713 - m.x714 - m.x715 == 0)
m.c534 = Constraint(expr= m.x380 - m.x716 - m.x717 - m.x718 - m.x719 - m.x720 - m.x721 - m.x722 == 0)
m.c535 = Constraint(expr= m.x381 - m.x723 - m.x724 - m.x725 - m.x726 - m.x727 - m.x728 - m.x729 == 0)
m.c536 = Constraint(expr= m.x382 - m.x730 - m.x731 - m.x732 - m.x733 - m.x734 - m.x735 - m.x736 == 0)
m.c537 = Constraint(expr= m.x383 - m.x737 - m.x738 - m.x739 - m.x740 - m.x741 - m.x742 - m.x743 == 0)
m.c538 = Constraint(expr= m.x384 - m.x744 - m.x745 - m.x746 - m.x747 - m.x748 - m.x749 - m.x750 == 0)
m.c539 = Constraint(expr= m.x385 - m.x751 - m.x752 - m.x753 - m.x754 - m.x755 - m.x756 - m.x757 == 0)
m.c540 = Constraint(expr= m.x386 - m.x758 - m.x759 - m.x760 - m.x761 - m.x762 - m.x763 - m.x764 == 0)
m.c541 = Constraint(expr= m.x387 - m.x765 - m.x766 - m.x767 - m.x768 - m.x769 - m.x770 - m.x771 == 0)
m.c542 = Constraint(expr= m.x388 - m.x772 - m.x773 - m.x774 - m.x775 - m.x776 - m.x777 - m.x778 == 0)
m.c543 = Constraint(expr= m.x389 - m.x779 - m.x780 - m.x781 - m.x782 - m.x783 - m.x784 - m.x785 == 0)
m.c544 = Constraint(expr= m.x390 - m.x786 - m.x787 - m.x788 - m.x789 - m.x790 - m.x791 - m.x792 == 0)
m.c545 = Constraint(expr= m.x391 - m.x793 - m.x794 - m.x795 - m.x796 - m.x797 - m.x798 - m.x799 == 0)
m.c546 = Constraint(expr= m.x392 - m.x800 - m.x801 - m.x802 - m.x803 - m.x804 - m.x805 - m.x806 == 0)
m.c547 = Constraint(expr= m.x393 - m.x807 - m.x808 - m.x809 - m.x810 - m.x811 - m.x812 - m.x813 == 0)
m.c548 = Constraint(expr= m.x394 - m.x814 - m.x815 - m.x816 - m.x817 - m.x818 - m.x819 - m.x820 == 0)
m.c549 = Constraint(expr= m.x395 - m.x821 - m.x822 - m.x823 - m.x824 - m.x825 - m.x826 - m.x827 == 0)
m.c550 = Constraint(expr= m.x396 - m.x828 - m.x829 - m.x830 - m.x831 - m.x832 - m.x833 - m.x834 == 0)
m.c551 = Constraint(expr= m.x397 - m.x835 - m.x836 - m.x837 - m.x838 - m.x839 - m.x840 - m.x841 == 0)
m.c552 = Constraint(expr= m.x398 - m.x842 - m.x843 - m.x844 - m.x845 - m.x846 - m.x847 - m.x848 == 0)
m.c553 = Constraint(expr= m.x399 - m.x849 - m.x850 - m.x851 - m.x852 - m.x853 - m.x854 - m.x855 == 0)
m.c554 = Constraint(expr= m.x400 - m.x856 - m.x857 - m.x858 - m.x859 - m.x860 - m.x861 - m.x862 == 0)
m.c555 = Constraint(expr= m.x401 - m.x863 - m.x864 - m.x865 - m.x866 - m.x867 - m.x868 - m.x869 == 0)
m.c556 = Constraint(expr= m.x402 - m.x870 - m.x871 - m.x872 - m.x873 - m.x874 - m.x875 - m.x876 == 0)
m.c557 = Constraint(expr= m.x403 - m.x877 - m.x878 - m.x879 - m.x880 - m.x881 - m.x882 - m.x883 == 0)
m.c558 = Constraint(expr= m.x404 - m.x884 - m.x885 - m.x886 - m.x887 - m.x888 - m.x889 - m.x890 == 0)
m.c559 = Constraint(expr= m.x405 - m.x891 - m.x892 - m.x893 - m.x894 - m.x895 - m.x896 - m.x897 == 0)
m.c560 = Constraint(expr= m.x406 - m.x898 - m.x899 - m.x900 - m.x901 - m.x902 - m.x903 - m.x904 == 0)
m.c561 = Constraint(expr= m.x407 - m.x905 - m.x906 - m.x907 - m.x908 - m.x909 - m.x910 - m.x911 == 0)
m.c562 = Constraint(expr= m.x408 - m.x912 - m.x913 - m.x914 - m.x915 - m.x916 - m.x917 - m.x918 == 0)
m.c563 = Constraint(expr= m.x409 - m.x919 - m.x920 - m.x921 - m.x922 - m.x923 - m.x924 - m.x925 == 0)
m.c564 = Constraint(expr= m.x410 - m.x926 - m.x927 - m.x928 - m.x929 - m.x930 - m.x931 - m.x932 == 0)
m.c565 = Constraint(expr= m.x411 - m.x933 - m.x934 - m.x935 - m.x936 - m.x937 - m.x938 - m.x939 == 0)
m.c566 = Constraint(expr= m.x412 - m.x940 - m.x941 - m.x942 - m.x943 - m.x944 - m.x945 - m.x946 == 0)
m.c567 = Constraint(expr= m.x413 - m.x947 - m.x948 - m.x949 - m.x950 - m.x951 - m.x952 - m.x953 == 0)
m.c568 = Constraint(expr= m.x414 - m.x954 - m.x955 - m.x956 - m.x957 - m.x958 - m.x959 - m.x960 == 0)
m.c569 = Constraint(expr= m.x415 - m.x961 - m.x962 - m.x963 - m.x964 - m.x965 - m.x966 - m.x967 == 0)
m.c570 = Constraint(expr= m.x416 - m.x968 - m.x969 - m.x970 - m.x971 - m.x972 - m.x973 - m.x974 == 0)
m.c571 = Constraint(expr= m.x417 - m.x975 - m.x976 - m.x977 - m.x978 - m.x979 - m.x980 - m.x981 == 0)
m.c572 = Constraint(expr= m.x418 - m.x982 - m.x983 - m.x984 - m.x985 - m.x986 - m.x987 - m.x988 == 0)
m.c573 = Constraint(expr= m.x419 - m.x989 - m.x990 - m.x991 - m.x992 - m.x993 - m.x994 - m.x995 == 0)
m.c574 = Constraint(expr= m.x420 - m.x996 - m.x997 - m.x998 - m.x999 - m.x1000 - m.x1001 - m.x1002 == 0)
m.c575 = Constraint(expr= m.x421 - m.x1003 - m.x1004 - m.x1005 - m.x1006 - m.x1007 - m.x1008 - m.x1009 == 0)
m.c576 = Constraint(expr= m.x1010 <= 50)
m.c577 = Constraint(expr= m.x1011 <= 50)
m.c578 = Constraint(expr= m.x1012 <= 50)
m.c579 = Constraint(expr= m.x1013 <= 100)
m.c580 = Constraint(expr= m.x1014 <= 100)
m.c581 = Constraint(expr= m.x1015 <= 100)
m.c582 = Constraint(expr= m.x1016 <= 100)
m.c583 = Constraint(expr= m.x1017 <= 100)
m.c584 = Constraint(expr= m.x1018 <= 100)
m.c585 = Constraint(expr= m.x1021 <= 50)
m.c586 = Constraint(expr= m.x1022 <= 50)
m.c587 = Constraint(expr= m.x1023 <= 50)
m.c588 = Constraint(expr= m.x1024 <= 100)
m.c589 = Constraint(expr= m.x1025 <= 100)
m.c590 = Constraint(expr= m.x1026 <= 100)
m.c591 = Constraint(expr= m.x1027 <= 100)
m.c592 = Constraint(expr= m.x1028 <= 100)
m.c593 = Constraint(expr= m.x1029 <= 100)
m.c594 = Constraint(expr= m.x1032 <= 50)
m.c595 = Constraint(expr= m.x1033 <= 50)
m.c596 = Constraint(expr= m.x1034 <= 50)
m.c597 = Constraint(expr= m.x1035 <= 100)
m.c598 = Constraint(expr= m.x1036 <= 100)
m.c599 = Constraint(expr= m.x1037 <= 100)
m.c600 = Constraint(expr= m.x1038 <= 100)
m.c601 = Constraint(expr= m.x1039 <= 100)
m.c602 = Constraint(expr= m.x1040 <= 100)
m.c603 = Constraint(expr= m.x1043 <= 50)
m.c604 = Constraint(expr= m.x1044 <= 50)
m.c605 = Constraint(expr= m.x1045 <= 50)
m.c606 = Constraint(expr= m.x1046 <= 100)
m.c607 = Constraint(expr= m.x1047 <= 100)
m.c608 = Constraint(expr= m.x1048 <= 100)
m.c609 = Constraint(expr= m.x1049 <= 100)
m.c610 = Constraint(expr= m.x1050 <= 100)
m.c611 = Constraint(expr= m.x1051 <= 100)
m.c612 = Constraint(expr= m.x1054 <= 50)
m.c613 = Constraint(expr= m.x1055 <= 50)
m.c614 = Constraint(expr= m.x1056 <= 50)
m.c615 = Constraint(expr= m.x1057 <= 100)
m.c616 = Constraint(expr= m.x1058 <= 100)
m.c617 = Constraint(expr= m.x1059 <= 100)
m.c618 = Constraint(expr= m.x1060 <= 100)
m.c619 = Constraint(expr= m.x1061 <= 100)
m.c620 = Constraint(expr= m.x1062 <= 100)
m.c621 = Constraint(expr= m.x1065 <= 50)
m.c622 = Constraint(expr= m.x1066 <= 50)
m.c623 = Constraint(expr= m.x1067 <= 50)
m.c624 = Constraint(expr= m.x1068 <= 100)
m.c625 = Constraint(expr= m.x1069 <= 100)
m.c626 = Constraint(expr= m.x1070 <= 100)
m.c627 = Constraint(expr= m.x1071 <= 100)
m.c628 = Constraint(expr= m.x1072 <= 100)
m.c629 = Constraint(expr= m.x1073 <= 100)
m.c630 = Constraint(expr= m.x1076 >= 0)
m.c631 = Constraint(expr= m.x1077 >= 0)
m.c632 = Constraint(expr= m.x1078 >= 0)
m.c633 = Constraint(expr= m.x1079 >= 0)
m.c634 = Constraint(expr= m.x1080 >= 0)
m.c635 = Constraint(expr= m.x1081 >= 0)
m.c636 = Constraint(expr= m.x1082 >= 0)
m.c637 = Constraint(expr= m.x1083 >= 0)
m.c638 = Constraint(expr= m.x1084 >= 0)
m.c639 = Constraint(expr= m.x1085 >= 0)
m.c640 = Constraint(expr= m.x1086 >= 0)
m.c641 = Constraint(expr= m.x1087 >= 0)
m.c642 = Constraint(expr= m.x1088 >= 0)
m.c643 = Constraint(expr= m.x1089 >= 0)
m.c644 = Constraint(expr= m.x1090 >= 0)
m.c645 = Constraint(expr= m.x1091 >= 0)
m.c646 = Constraint(expr= m.x1092 >= 0)
m.c647 = Constraint(expr= m.x1093 >= 0)
m.c648 = Constraint(expr= m.x1094 >= 0)
m.c649 = Constraint(expr= m.x1095 >= 0)
m.c650 = Constraint(expr= m.x1096 >= 0)
m.c651 = Constraint(expr= m.x1097 >= 0)
m.c652 = Constraint(expr= m.x1098 >= 0)
m.c653 = Constraint(expr= m.x1099 >= 0)
m.c654 = Constraint(expr= m.x1100 >= 0)
m.c655 = Constraint(expr= m.x1101 >= 0)
m.c656 = Constraint(expr= m.x1102 >= 0)
m.c657 = Constraint(expr= m.x1103 >= 0)
m.c658 = Constraint(expr= m.x1104 >= 0)
m.c659 = Constraint(expr= m.x1105 >= 0)
m.c660 = Constraint(expr= m.x1106 >= 0)
m.c661 = Constraint(expr= m.x1107 >= 0)
m.c662 = Constraint(expr= m.x1108 >= 0)
m.c663 = Constraint(expr= m.x1109 >= 0)
m.c664 = Constraint(expr= m.x1110 >= 0)
m.c665 = Constraint(expr= m.x1111 >= 0)
m.c666 = Constraint(expr= m.x1112 >= 0)
m.c667 = Constraint(expr= m.x1113 >= 0)
m.c668 = Constraint(expr= m.x1114 >= 0)
m.c669 = Constraint(expr= m.x1115 >= 0)
m.c670 = Constraint(expr= m.x1116 >= 0)
m.c671 = Constraint(expr= m.x1117 >= 0)
m.c672 = Constraint(expr= m.x1118 >= 0)
m.c673 = Constraint(expr= m.x1119 >= 0)
m.c674 = Constraint(expr= m.x1120 >= 0)
m.c675 = Constraint(expr= m.x1121 >= 0)
m.c676 = Constraint(expr= m.x1122 >= 0)
m.c677 = Constraint(expr= m.x1123 >= 0)
m.c678 = Constraint(expr= m.x1124 >= 0)
m.c679 = Constraint(expr= m.x1125 >= 0)
m.c680 = Constraint(expr= m.x1126 >= 0)
m.c681 = Constraint(expr= m.x1127 >= 0)
m.c682 = Constraint(expr= m.x1128 >= 0)
m.c683 = Constraint(expr= m.x1129 >= 0)
m.c684 = Constraint(expr= m.x1130 >= 0)
m.c685 = Constraint(expr= m.x1131 >= 0)
m.c686 = Constraint(expr= m.x1132 >= 0)
m.c687 = Constraint(expr= m.x1133 >= 0)
m.c688 = Constraint(expr= m.x1134 >= 0)
m.c689 = Constraint(expr= m.x1135 >= 0)
m.c690 = Constraint(expr= m.x1136 >= 0)
m.c691 = Constraint(expr= m.x1137 >= 0)
m.c692 = Constraint(expr= m.x1138 >= 0)
m.c693 = Constraint(expr= m.x1139 >= 0)
m.c694 = Constraint(expr= m.x1140 >= 0)
m.c695 = Constraint(expr= m.x1141 >= 0)
m.c696 = Constraint(expr= m.x1142 >= 0)
m.c697 = Constraint(expr= m.x1143 >= 0)
m.c698 = Constraint(expr= m.x1144 >= 0)
m.c699 = Constraint(expr= m.x1145 >= 0)
m.c700 = Constraint(expr= m.x1146 >= 0)
m.c701 = Constraint(expr= m.x1147 >= 0)
m.c702 = Constraint(expr= m.x1148 >= 0)
m.c703 = Constraint(expr= m.x1149 >= 0)
m.c704 = Constraint(expr= m.x1150 >= 0)
m.c705 = Constraint(expr= m.x1151 >= 0)
m.c706 = Constraint(expr= m.x1152 >= 0)
m.c707 = Constraint(expr= m.x1153 >= 0)
m.c708 = Constraint(expr= m.x1154 >= 0)
m.c709 = Constraint(expr= m.x1155 >= 0)
m.c710 = Constraint(expr= m.x1156 >= 0)
m.c711 = Constraint(expr= m.x1157 >= 0)
m.c712 = Constraint(expr= m.x1158 >= 0)
m.c713 = Constraint(expr= m.x1159 >= 0)
m.c714 = Constraint(expr= m.x1160 >= 0)
m.c715 = Constraint(expr= m.x1161 >= 0)
m.c716 = Constraint(expr= m.x1162 >= 0)
m.c717 = Constraint(expr= m.x1163 >= 0)
m.c718 = Constraint(expr= m.x1164 >= 0)
m.c719 = Constraint(expr= m.x1165 >= 0)
m.c720 = Constraint(expr= m.x1166 >= 0)
m.c721 = Constraint(expr= m.x1167 >= 0)
m.c722 = Constraint(expr= m.x1168 >= 0)
m.c723 = Constraint(expr= m.x1169 >= 0)
m.c724 = Constraint(expr= m.x1170 >= 0)
m.c725 = Constraint(expr= m.x1171 >= 0)
m.c726 = Constraint(expr= m.x1172 >= 0)
m.c727 = Constraint(expr= m.x1173 >= 0)
m.c728 = Constraint(expr= m.x1174 >= 0)
m.c729 = Constraint(expr= m.x1175 >= 0)
m.c730 = Constraint(expr= m.x1176 >= 0)
m.c731 = Constraint(expr= m.x1177 >= 0)
m.c732 = Constraint(expr= m.x1178 >= 0)
m.c733 = Constraint(expr= m.x1179 >= 0)
m.c734 = Constraint(expr= m.x1180 >= 0)
m.c735 = Constraint(expr= m.x1181 >= 0)
m.c736 = Constraint(expr= m.x1182 >= 0)
m.c737 = Constraint(expr= m.x1183 >= 0)
m.c738 = Constraint(expr= m.x1184 >= 0)
m.c739 = Constraint(expr= m.x1185 >= 0)
m.c740 = Constraint(expr= m.x1186 >= 0)
m.c741 = Constraint(expr= m.x1187 >= 0)
m.c742 = Constraint(expr= m.x1188 >= 0)
m.c743 = Constraint(expr= m.x1189 >= 0)
m.c744 = Constraint(expr= m.x1190 >= 0)
m.c745 = Constraint(expr= m.x1191 >= 0)
m.c746 = Constraint(expr= m.x1192 >= 0)
m.c747 = Constraint(expr= m.x1193 >= 0)
m.c748 = Constraint(expr= m.x1194 >= 0)
m.c749 = Constraint(expr= m.x1195 >= 0)
m.c750 = Constraint(expr= m.x1196 >= 0)
m.c751 = Constraint(expr= m.x1197 >= 0)
m.c752 = Constraint(expr= m.x1198 >= 0)
m.c753 = Constraint(expr= m.x1199 >= 0)
m.c754 = Constraint(expr= m.x1200 >= 0)
m.c755 = Constraint(expr= m.x1201 >= 0)
m.c756 = Constraint(expr= m.x1202 >= 0)
m.c757 = Constraint(expr= m.x1203 >= 0)
m.c758 = Constraint(expr= m.x1204 >= 0)
m.c759 = Constraint(expr= m.x1205 >= 0)
m.c760 = Constraint(expr= m.x1206 >= 0)
m.c761 = Constraint(expr= m.x1207 >= 0)
m.c762 = Constraint(expr= m.x1208 >= 0)
m.c763 = Constraint(expr= m.x1209 >= 0)
m.c764 = Constraint(expr= m.x1210 >= 0)
m.c765 = Constraint(expr= m.x1211 >= 0)
m.c766 = Constraint(expr= m.x1212 >= 0)
m.c767 = Constraint(expr= m.x1213 >= 0)
m.c768 = Constraint(expr= m.x1214 >= 0)
m.c769 = Constraint(expr= m.x1215 >= 0)
m.c770 = Constraint(expr= m.x1216 >= 0)
m.c771 = Constraint(expr= m.x1217 >= 0)
m.c772 = Constraint(expr= m.x1218 >= 0)
m.c773 = Constraint(expr= m.x1219 >= 0)
m.c774 = Constraint(expr= m.x1220 >= 0)
m.c775 = Constraint(expr= m.x1221 >= 0)
m.c776 = Constraint(expr= m.x1222 >= 0)
m.c777 = Constraint(expr= m.x1223 >= 0)
m.c778 = Constraint(expr= m.x1224 >= 0)
m.c779 = Constraint(expr= m.x1225 >= 0)
m.c780 = Constraint(expr= m.x1226 >= 0)
m.c781 = Constraint(expr= m.x1227 >= 0)
m.c782 = Constraint(expr= m.x1228 >= 0)
m.c783 = Constraint(expr= m.x1229 >= 0)
m.c784 = Constraint(expr= m.x1230 >= 0)
m.c785 = Constraint(expr= m.x1231 >= 0)
m.c786 = Constraint(expr= m.x1232 >= 0)
m.c787 = Constraint(expr= m.x1233 >= 0)
m.c788 = Constraint(expr= m.x1234 >= 0)
m.c789 = Constraint(expr= m.x1235 >= 0)
m.c790 = Constraint(expr= m.x1236 >= 0)
m.c791 = Constraint(expr= m.x1237 >= 0)
m.c792 = Constraint(expr= m.x1238 >= 0)
m.c793 = Constraint(expr= m.x1239 >= 0)
m.c794 = Constraint(expr= m.x1240 >= 0)
m.c795 = Constraint(expr= m.x1241 >= 0)
m.c796 = Constraint(expr= m.x1242 >= 0)
m.c797 = Constraint(expr= m.x1243 >= 0)
m.c798 = Constraint(expr= m.x1244 >= 0)
m.c799 = Constraint(expr= m.x1245 >= 0)
m.c800 = Constraint(expr= m.x1246 >= 0)
m.c801 = Constraint(expr= m.x1247 >= 0)
m.c802 = Constraint(expr= m.x1248 >= 0)
m.c803 = Constraint(expr= m.x1249 >= 0)
m.c804 = Constraint(expr= m.x1250 >= 0)
m.c805 = Constraint(expr= m.x1251 >= 0)
m.c806 = Constraint(expr= m.x1252 >= 0)
m.c807 = Constraint(expr= m.x1253 >= 0)
m.c808 = Constraint(expr= m.x1254 >= 0)
m.c809 = Constraint(expr= m.x1255 >= 0)
m.c810 = Constraint(expr= m.x1256 >= 0)
m.c811 = Constraint(expr= m.x1257 >= 0)
m.c812 = Constraint(expr= m.x1258 >= 0)
m.c813 = Constraint(expr= m.x1259 >= 0)
m.c814 = Constraint(expr= m.x1260 >= 0)
m.c815 = Constraint(expr= m.x1261 >= 0)
m.c816 = Constraint(expr= m.x1262 >= 0)
m.c817 = Constraint(expr= m.x1263 >= 0)
m.c818 = Constraint(expr= m.x1264 >= 0)
m.c819 = Constraint(expr= m.x1265 >= 0)
m.c820 = Constraint(expr= m.x1266 >= 0)
m.c821 = Constraint(expr= m.x1267 >= 0)
m.c822 = Constraint(expr= m.x1268 >= 0)
m.c823 = Constraint(expr= m.x1269 >= 0)
m.c824 = Constraint(expr= m.x1270 >= 0)
m.c825 = Constraint(expr= m.x1271 >= 0)
m.c826 = Constraint(expr= m.x1272 >= 0)
m.c827 = Constraint(expr= m.x1273 >= 0)
m.c828 = Constraint(expr= m.x1274 >= 0)
m.c829 = Constraint(expr= m.x1275 >= 0)
m.c830 = Constraint(expr= m.x1276 >= 0)
m.c831 = Constraint(expr= m.x1277 >= 0)
m.c832 = Constraint(expr= m.x1278 >= 0)
m.c833 = Constraint(expr= m.x1279 >= 0)
m.c834 = Constraint(expr= m.x1280 >= 0)
m.c835 = Constraint(expr= m.x1281 >= 0)
m.c836 = Constraint(expr= m.x1282 >= 0)
m.c837 = Constraint(expr= m.x1283 >= 0)
m.c838 = Constraint(expr= m.x1284 >= 0)
m.c839 = Constraint(expr= m.x1285 >= 0)
m.c840 = Constraint(expr= m.x1286 >= 0)
m.c841 = Constraint(expr= m.x1287 >= 0)
m.c842 = Constraint(expr= m.x1288 >= 0)
m.c843 = Constraint(expr= m.x1289 >= 0)
m.c844 = Constraint(expr= m.x1290 >= 0)
m.c845 = Constraint(expr= m.x1291 >= 0)
m.c846 = Constraint(expr= m.x1292 >= 0)
m.c847 = Constraint(expr= m.x1293 >= 0)
m.c848 = Constraint(expr= m.x1294 >= 0)
m.c849 = Constraint(expr= m.x1295 >= 0)
m.c850 = Constraint(expr= m.x1296 >= 0)
m.c851 = Constraint(expr= m.x1297 >= 0)
m.c852 = Constraint(expr= m.x1298 >= 0)
m.c853 = Constraint(expr= m.x1299 >= 0)
m.c854 = Constraint(expr= m.x1300 >= 0)
m.c855 = Constraint(expr= m.x1301 >= 0)
m.c856 = Constraint(expr= m.x1302 >= 0)
m.c857 = Constraint(expr= m.x1303 >= 0)
m.c858 = Constraint(expr= m.x1304 >= 0)
m.c859 = Constraint(expr= m.x1305 >= 0)
m.c860 = Constraint(expr= m.x1306 >= 0)
m.c861 = Constraint(expr= m.x1307 >= 0)
m.c862 = Constraint(expr= m.x1308 >= 0)
m.c863 = Constraint(expr= m.x1309 >= 0)
m.c864 = Constraint(expr= m.x1310 >= 0)
m.c865 = Constraint(expr= m.x1311 >= 0)
m.c866 = Constraint(expr= m.x1312 >= 0)
m.c867 = Constraint(expr= m.x1313 >= 0)
m.c868 = Constraint(expr= m.x1314 >= 0)
m.c869 = Constraint(expr= m.x1315 >= 0)
m.c870 = Constraint(expr= m.x1316 >= 0)
m.c871 = Constraint(expr= m.x1317 >= 0)
m.c872 = Constraint(expr= m.x1318 >= 0)
m.c873 = Constraint(expr= m.x1319 >= 0)
m.c874 = Constraint(expr= m.x1320 >= 0)
m.c875 = Constraint(expr= m.x1321 >= 0)
m.c876 = Constraint(expr= m.x1322 >= 0)
m.c877 = Constraint(expr= m.x1323 >= 0)
m.c878 = Constraint(expr= m.x1324 >= 0)
m.c879 = Constraint(expr= m.x1325 >= 0)
m.c880 = Constraint(expr= m.x1326 >= 0)
m.c881 = Constraint(expr= m.x1327 >= 0)
m.c882 = Constraint(expr= m.x1328 >= 0)
m.c883 = Constraint(expr= m.x1329 >= 0)
m.c884 = Constraint(expr= m.x1330 >= 0)
m.c885 = Constraint(expr= m.x1331 >= 0)
m.c886 = Constraint(expr= m.x1332 >= 0)
m.c887 = Constraint(expr= m.x1333 >= 0)
m.c888 = Constraint(expr= m.x1334 >= 0)
m.c889 = Constraint(expr= m.x1335 >= 0)
m.c890 = Constraint(expr= m.x1336 >= 0)
m.c891 = Constraint(expr= m.x1337 >= 0)
m.c892 = Constraint(expr= m.x1338 >= 0)
m.c893 = Constraint(expr= m.x1339 >= 0)
m.c894 = Constraint(expr= m.x1340 >= 0)
m.c895 = Constraint(expr= m.x1341 >= 0)
m.c896 = Constraint(expr= m.x1342 >= 0)
m.c897 = Constraint(expr= m.x1343 >= 0)
m.c898 = Constraint(expr= m.x1344 >= 0)
m.c899 = Constraint(expr= m.x1345 >= 0)
m.c900 = Constraint(expr= m.x1346 >= 0)
m.c901 = Constraint(expr= m.x1347 >= 0)
m.c902 = Constraint(expr= m.x1348 >= 0)
m.c903 = Constraint(expr= m.x1349 >= 0)
m.c904 = Constraint(expr= m.x1350 >= 0)
m.c905 = Constraint(expr= m.x1351 >= 0)
m.c906 = Constraint(expr= m.x1352 >= 0)
m.c907 = Constraint(expr= m.x1353 >= 0)
m.c908 = Constraint(expr= m.x1354 >= 0)
m.c909 = Constraint(expr= m.x1355 >= 0)
m.c910 = Constraint(expr= m.x1356 >= 0)
m.c911 = Constraint(expr= m.x1357 >= 0)
m.c912 = Constraint(expr= m.x1358 >= 0)
m.c913 = Constraint(expr= m.x1359 >= 0)
m.c914 = Constraint(expr= m.x1360 >= 0)
m.c915 = Constraint(expr= m.x1361 >= 0)
m.c916 = Constraint(expr= m.x1362 >= 0)
m.c917 = Constraint(expr= m.x1363 >= 0)
m.c918 = Constraint(expr= m.x1364 >= 0)
m.c919 = Constraint(expr= m.x1365 >= 0)
m.c920 = Constraint(expr= m.x1366 >= 0)
m.c921 = Constraint(expr= m.x1367 >= 0)
m.c922 = Constraint(expr= m.x1368 >= 0)
m.c923 = Constraint(expr= m.x1369 >= 0)
m.c924 = Constraint(expr= m.x1370 >= 0)
m.c925 = Constraint(expr= m.x1371 >= 0)
m.c926 = Constraint(expr= m.x1372 >= 0)
m.c927 = Constraint(expr= m.x1373 >= 0)
m.c928 = Constraint(expr= m.x1374 >= 0)
m.c929 = Constraint(expr= m.x1375 >= 0)
m.c930 = Constraint(expr= m.x1376 >= 0)
m.c931 = Constraint(expr= m.x1377 >= 0)
m.c932 = Constraint(expr= m.x1378 >= 0)
m.c933 = Constraint(expr= m.x1379 >= 0)
m.c934 = Constraint(expr= m.x1380 >= 0)
m.c935 = Constraint(expr= m.x1381 >= 0)
m.c936 = Constraint(expr= m.x1382 >= 0)
m.c937 = Constraint(expr= m.x1383 >= 0)
m.c938 = Constraint(expr= m.x1384 >= 0)
m.c939 = Constraint(expr= m.x1385 >= 0)
m.c940 = Constraint(expr= m.x1386 >= 0)
m.c941 = Constraint(expr= m.x1387 >= 0)
m.c942 = Constraint(expr= m.x1388 >= 0)
m.c943 = Constraint(expr= m.x1389 >= 0)
m.c944 = Constraint(expr= m.x1390 >= 0)
m.c945 = Constraint(expr= m.x1391 >= 0)
m.c946 = Constraint(expr= m.x1392 >= 0)
m.c947 = Constraint(expr= m.x1393 >= 0)
m.c948 = Constraint(expr= m.x1394 >= 0)
m.c949 = Constraint(expr= m.x1395 >= 0)
m.c950 = Constraint(expr= m.x1396 >= 0)
m.c951 = Constraint(expr= m.x1397 >= 0)
m.c952 = Constraint(expr= m.x1398 >= 0)
m.c953 = Constraint(expr= m.x1399 >= 0)
m.c954 = Constraint(expr= m.x1400 >= 0)
m.c955 = Constraint(expr= m.x1401 >= 0)
m.c956 = Constraint(expr= m.x1402 >= 0)
m.c957 = Constraint(expr= m.x1403 >= 0)
m.c958 = Constraint(expr= m.x1404 >= 0)
m.c959 = Constraint(expr= m.x1405 >= 0)
m.c960 = Constraint(expr= m.x1406 >= 0)
m.c961 = Constraint(expr= m.x1407 >= 0)
m.c962 = Constraint(expr= m.x1408 >= 0)
m.c963 = Constraint(expr= m.x1409 >= 0)
m.c964 = Constraint(expr= m.x1410 >= 0)
m.c965 = Constraint(expr= m.x1411 >= 0)
m.c966 = Constraint(expr= m.x1412 >= 0)
m.c967 = Constraint(expr= m.x1413 >= 0)
m.c968 = Constraint(expr= m.x1414 >= 0)
m.c969 = Constraint(expr= m.x1415 >= 0)
m.c970 = Constraint(expr= m.x1416 >= 0)
m.c971 = Constraint(expr= m.x1417 >= 0)
m.c972 = Constraint(expr= m.x1418 >= 0)
m.c973 = Constraint(expr= m.x1419 >= 0)
m.c974 = Constraint(expr= m.x1420 >= 0)
m.c975 = Constraint(expr= m.x1421 >= 0)
m.c976 = Constraint(expr= m.x1422 >= 0)
m.c977 = Constraint(expr= m.x1423 >= 0)
m.c978 = Constraint(expr= m.x1424 >= 0)
m.c979 = Constraint(expr= m.x1425 >= 0)
m.c980 = Constraint(expr= m.x1426 >= 0)
m.c981 = Constraint(expr= m.x1427 >= 0)
m.c982 = Constraint(expr= m.x1428 >= 0)
m.c983 = Constraint(expr= m.x1429 >= 0)
m.c984 = Constraint(expr= m.x1430 >= 0)
m.c985 = Constraint(expr= m.x1431 >= 0)
m.c986 = Constraint(expr= m.x1432 >= 0)
m.c987 = Constraint(expr= m.x1433 >= 0)
m.c988 = Constraint(expr= m.x1434 >= 0)
m.c989 = Constraint(expr= m.x1435 >= 0)
m.c990 = Constraint(expr= m.x1436 >= 0)
m.c991 = Constraint(expr= m.x1437 >= 0)
m.c992 = Constraint(expr= m.x1438 >= 0)
m.c993 = Constraint(expr= m.x1439 >= 0)
m.c994 = Constraint(expr= m.x1440 >= 0)
m.c995 = Constraint(expr= m.x1441 >= 0)
m.c996 = Constraint(expr= m.x1442 >= 0)
m.c997 = Constraint(expr= m.x1443 >= 0)
m.c998 = Constraint(expr= m.x1444 >= 0)
m.c999 = Constraint(expr= m.x1445 >= 0)
m.c1000 = Constraint(expr= m.x1446 >= 0)
m.c1001 = Constraint(expr= m.x1447 >= 0)
m.c1002 = Constraint(expr= m.x1448 >= 0)
m.c1003 = Constraint(expr= m.x1449 >= 0)
m.c1004 = Constraint(expr= m.x1450 >= 0)
m.c1005 = Constraint(expr= m.x1451 >= 0)
m.c1006 = Constraint(expr= m.x1452 >= 0)
m.c1007 = Constraint(expr= m.x1453 >= 0)
m.c1008 = Constraint(expr= m.x1454 >= 0)
m.c1009 = Constraint(expr= m.x1455 >= 0)
m.c1010 = Constraint(expr= m.x1456 >= 0)
m.c1011 = Constraint(expr= m.x1457 >= 0)
m.c1012 = Constraint(expr= m.x1458 >= 0)
m.c1013 = Constraint(expr= m.x1459 >= 0)
m.c1014 = Constraint(expr= m.x1460 >= 0)
m.c1015 = Constraint(expr= m.x1461 >= 0)
m.c1016 = Constraint(expr= m.x1462 >= 0)
m.c1017 = Constraint(expr= m.x1463 >= 0)
m.c1018 = Constraint(expr= m.x1464 >= 0)
m.c1019 = Constraint(expr= m.x1465 >= 0)
m.c1020 = Constraint(expr= m.x1466 >= 0)
m.c1021 = Constraint(expr= m.x1467 >= 0)
m.c1022 = Constraint(expr= m.x1468 >= 0)
m.c1023 = Constraint(expr= m.x1469 >= 0)
m.c1024 = Constraint(expr= m.x1470 >= 0)
m.c1025 = Constraint(expr= m.x1471 >= 0)
m.c1026 = Constraint(expr= m.x1472 >= 0)
m.c1027 = Constraint(expr= m.x1473 >= 0)
m.c1028 = Constraint(expr= m.x1474 >= 0)
m.c1029 = Constraint(expr= m.x1475 >= 0)
m.c1030 = Constraint(expr= m.x1476 >= 0)
m.c1031 = Constraint(expr= m.x1477 >= 0)
m.c1032 = Constraint(expr= m.x1478 >= 0)
m.c1033 = Constraint(expr= m.x1479 >= 0)
m.c1034 = Constraint(expr= m.x1480 >= 0)
m.c1035 = Constraint(expr= m.x1481 >= 0)
m.c1036 = Constraint(expr= m.x1482 >= 0)
m.c1037 = Constraint(expr= m.x1483 >= 0)
m.c1038 = Constraint(expr= m.x1484 >= 0)
m.c1039 = Constraint(expr= m.x1485 >= 0)
m.c1040 = Constraint(expr= m.x1486 >= 0)
m.c1041 = Constraint(expr= m.x1487 >= 0)
m.c1042 = Constraint(expr= m.x1488 >= 0)
m.c1043 = Constraint(expr= m.x1489 >= 0)
m.c1044 = Constraint(expr= m.x1490 >= 0)
m.c1045 = Constraint(expr= m.x1491 >= 0)
m.c1046 = Constraint(expr= m.x1492 >= 0)
m.c1047 = Constraint(expr= m.x1493 >= 0)
m.c1048 = Constraint(expr= m.x1494 >= 0)
m.c1049 = Constraint(expr= m.x1495 >= 0)
m.c1050 = Constraint(expr= m.x1496 >= 0)
m.c1051 = Constraint(expr= m.x1497 >= 0)
m.c1052 = Constraint(expr= m.x1498 >= 0)
m.c1053 = Constraint(expr= m.x1499 >= 0)
m.c1054 = Constraint(expr= m.x1500 >= 0)
m.c1055 = Constraint(expr= m.x1501 >= 0)
m.c1056 = Constraint(expr= m.x1502 >= 0)
m.c1057 = Constraint(expr= m.x1503 >= 0)
m.c1058 = Constraint(expr= m.x1504 >= 0)
m.c1059 = Constraint(expr= m.x1505 >= 0)
m.c1060 = Constraint(expr= m.x1506 >= 0)
m.c1061 = Constraint(expr= m.x1507 >= 0)
m.c1062 = Constraint(expr= m.x1508 >= 0)
m.c1063 = Constraint(expr= m.x1509 >= 0)
m.c1064 = Constraint(expr= m.x1510 >= 0)
m.c1065 = Constraint(expr= m.x1511 >= 0)
m.c1066 = Constraint(expr= m.x1512 >= 0)
m.c1067 = Constraint(expr= m.x1513 >= 0)
m.c1068 = Constraint(expr= m.x1514 >= 0)
m.c1069 = Constraint(expr= m.x1515 >= 0)
m.c1070 = Constraint(expr= m.x1516 >= 0)
m.c1071 = Constraint(expr= m.x1517 >= 0)
m.c1072 = Constraint(expr= m.x1518 >= 0)
m.c1073 = Constraint(expr= m.x1519 >= 0)
m.c1074 = Constraint(expr= m.x1520 >= 0)
m.c1075 = Constraint(expr= m.x1521 >= 0)
m.c1076 = Constraint(expr= m.x1522 >= 0)
m.c1077 = Constraint(expr= m.x1523 >= 0)
m.c1078 = Constraint(expr= m.x1524 >= 0)
m.c1079 = Constraint(expr= m.x1525 >= 0)
m.c1080 = Constraint(expr= m.x1526 >= 0)
m.c1081 = Constraint(expr= m.x1527 >= 0)
m.c1082 = Constraint(expr= m.x1528 >= 0)
m.c1083 = Constraint(expr= m.x1529 >= 0)
m.c1084 = Constraint(expr= m.x1530 >= 0)
m.c1085 = Constraint(expr= m.x1531 >= 0)
m.c1086 = Constraint(expr= m.x1532 >= 0)
m.c1087 = Constraint(expr= m.x1533 >= 0)
m.c1088 = Constraint(expr= m.x1534 >= 0)
m.c1089 = Constraint(expr= m.x1535 >= 0)
m.c1090 = Constraint(expr= m.x1536 >= 0)
m.c1091 = Constraint(expr= m.x1537 >= 0)
m.c1092 = Constraint(expr= m.x1076 <= 50)
m.c1093 = Constraint(expr= m.x1077 <= 50)
m.c1094 = Constraint(expr= m.x1078 <= 50)
m.c1095 = Constraint(expr= m.x1079 <= 50)
m.c1096 = Constraint(expr= m.x1080 <= 50)
m.c1097 = Constraint(expr= m.x1081 <= 50)
m.c1098 = Constraint(expr= m.x1082 <= 50)
m.c1099 = Constraint(expr= m.x1083 <= 50)
m.c1100 = Constraint(expr= m.x1084 <= 50)
m.c1101 = Constraint(expr= m.x1085 <= 50)
m.c1102 = Constraint(expr= m.x1086 <= 50)
m.c1103 = Constraint(expr= m.x1087 <= 50)
m.c1104 = Constraint(expr= m.x1088 <= 50)
m.c1105 = Constraint(expr= m.x1089 <= 50)
m.c1106 = Constraint(expr= m.x1090 <= 50)
m.c1107 = Constraint(expr= m.x1091 <= 50)
m.c1108 = Constraint(expr= m.x1092 <= 50)
m.c1109 = Constraint(expr= m.x1093 <= 50)
m.c1110 = Constraint(expr= m.x1094 <= 50)
m.c1111 = Constraint(expr= m.x1095 <= 50)
m.c1112 = Constraint(expr= m.x1096 <= 50)
m.c1113 = Constraint(expr= m.x1097 <= 100)
m.c1114 = Constraint(expr= m.x1098 <= 100)
m.c1115 = Constraint(expr= m.x1099 <= 100)
m.c1116 = Constraint(expr= m.x1100 <= 100)
m.c1117 = Constraint(expr= m.x1101 <= 100)
m.c1118 = Constraint(expr= m.x1102 <= 100)
m.c1119 = Constraint(expr= m.x1103 <= 100)
m.c1120 = Constraint(expr= m.x1104 <= 100)
m.c1121 = Constraint(expr= m.x1105 <= 100)
m.c1122 = Constraint(expr= m.x1106 <= 100)
m.c1123 = Constraint(expr= m.x1107 <= 100)
m.c1124 = Constraint(expr= m.x1108 <= 100)
m.c1125 = Constraint(expr= m.x1109 <= 100)
m.c1126 = Constraint(expr= m.x1110 <= 100)
m.c1127 = Constraint(expr= m.x1111 <= 100)
m.c1128 = Constraint(expr= m.x1112 <= 100)
m.c1129 = Constraint(expr= m.x1113 <= 100)
m.c1130 = Constraint(expr= m.x1114 <= 100)
m.c1131 = Constraint(expr= m.x1115 <= 100)
m.c1132 = Constraint(expr= m.x1116 <= 100)
m.c1133 = Constraint(expr= m.x1117 <= 100)
m.c1134 = Constraint(expr= m.x1118 <= 100)
m.c1135 = Constraint(expr= m.x1119 <= 100)
m.c1136 = Constraint(expr= m.x1120 <= 100)
m.c1137 = Constraint(expr= m.x1121 <= 100)
m.c1138 = Constraint(expr= m.x1122 <= 100)
m.c1139 = Constraint(expr= m.x1123 <= 100)
m.c1140 = Constraint(expr= m.x1124 <= 100)
m.c1141 = Constraint(expr= m.x1125 <= 100)
m.c1142 = Constraint(expr= m.x1126 <= 100)
m.c1143 = Constraint(expr= m.x1127 <= 100)
m.c1144 = Constraint(expr= m.x1128 <= 100)
m.c1145 = Constraint(expr= m.x1129 <= 100)
m.c1146 = Constraint(expr= m.x1130 <= 100)
m.c1147 = Constraint(expr= m.x1131 <= 100)
m.c1148 = Constraint(expr= m.x1132 <= 100)
m.c1149 = Constraint(expr= m.x1133 <= 100)
m.c1150 = Constraint(expr= m.x1134 <= 100)
m.c1151 = Constraint(expr= m.x1135 <= 100)
m.c1152 = Constraint(expr= m.x1136 <= 100)
m.c1153 = Constraint(expr= m.x1137 <= 100)
m.c1154 = Constraint(expr= m.x1138 <= 100)
m.c1155 = Constraint(expr= m.x1153 <= 50)
m.c1156 = Constraint(expr= m.x1154 <= 50)
m.c1157 = Constraint(expr= m.x1155 <= 50)
m.c1158 = Constraint(expr= m.x1156 <= 50)
m.c1159 = Constraint(expr= m.x1157 <= 50)
m.c1160 = Constraint(expr= m.x1158 <= 50)
m.c1161 = Constraint(expr= m.x1159 <= 50)
m.c1162 = Constraint(expr= m.x1160 <= 50)
m.c1163 = Constraint(expr= m.x1161 <= 50)
m.c1164 = Constraint(expr= m.x1162 <= 50)
m.c1165 = Constraint(expr= m.x1163 <= 50)
m.c1166 = Constraint(expr= m.x1164 <= 50)
m.c1167 = Constraint(expr= m.x1165 <= 50)
m.c1168 = Constraint(expr= m.x1166 <= 50)
m.c1169 = Constraint(expr= m.x1167 <= 50)
m.c1170 = Constraint(expr= m.x1168 <= 50)
m.c1171 = Constraint(expr= m.x1169 <= 50)
m.c1172 = Constraint(expr= m.x1170 <= 50)
m.c1173 = Constraint(expr= m.x1171 <= 50)
m.c1174 = Constraint(expr= m.x1172 <= 50)
m.c1175 = Constraint(expr= m.x1173 <= 50)
m.c1176 = Constraint(expr= m.x1174 <= 100)
m.c1177 = Constraint(expr= m.x1175 <= 100)
m.c1178 = Constraint(expr= m.x1176 <= 100)
m.c1179 = Constraint(expr= m.x1177 <= 100)
m.c1180 = Constraint(expr= m.x1178 <= 100)
m.c1181 = Constraint(expr= m.x1179 <= 100)
m.c1182 = Constraint(expr= m.x1180 <= 100)
m.c1183 = Constraint(expr= m.x1181 <= 100)
m.c1184 = Constraint(expr= m.x1182 <= 100)
m.c1185 = Constraint(expr= m.x1183 <= 100)
m.c1186 = Constraint(expr= m.x1184 <= 100)
m.c1187 = Constraint(expr= m.x1185 <= 100)
m.c1188 = Constraint(expr= m.x1186 <= 100)
m.c1189 = Constraint(expr= m.x1187 <= 100)
m.c1190 = Constraint(expr= m.x1188 <= 100)
m.c1191 = Constraint(expr= m.x1189 <= 100)
m.c1192 = Constraint(expr= m.x1190 <= 100)
m.c1193 = Constraint(expr= m.x1191 <= 100)
m.c1194 = Constraint(expr= m.x1192 <= 100)
m.c1195 = Constraint(expr= m.x1193 <= 100)
m.c1196 = Constraint(expr= m.x1194 <= 100)
m.c1197 = Constraint(expr= m.x1195 <= 100)
m.c1198 = Constraint(expr= m.x1196 <= 100)
m.c1199 = Constraint(expr= m.x1197 <= 100)
m.c1200 = Constraint(expr= m.x1198 <= 100)
m.c1201 = Constraint(expr= m.x1199 <= 100)
m.c1202 = Constraint(expr= m.x1200 <= 100)
m.c1203 = Constraint(expr= m.x1201 <= 100)
m.c1204 = Constraint(expr= m.x1202 <= 100)
m.c1205 = Constraint(expr= m.x1203 <= 100)
m.c1206 = Constraint(expr= m.x1204 <= 100)
m.c1207 = Constraint(expr= m.x1205 <= 100)
m.c1208 = Constraint(expr= m.x1206 <= 100)
m.c1209 = Constraint(expr= m.x1207 <= 100)
m.c1210 = Constraint(expr= m.x1208 <= 100)
m.c1211 = Constraint(expr= m.x1209 <= 100)
m.c1212 = Constraint(expr= m.x1210 <= 100)
m.c1213 = Constraint(expr= m.x1211 <= 100)
m.c1214 = Constraint(expr= m.x1212 <= 100)
m.c1215 = Constraint(expr= m.x1213 <= 100)
m.c1216 = Constraint(expr= m.x1214 <= 100)
m.c1217 = Constraint(expr= m.x1215 <= 100)
m.c1218 = Constraint(expr= m.x1230 <= 50)
m.c1219 = Constraint(expr= m.x1231 <= 50)
m.c1220 = Constraint(expr= m.x1232 <= 50)
m.c1221 = Constraint(expr= m.x1233 <= 50)
m.c1222 = Constraint(expr= m.x1234 <= 50)
m.c1223 = Constraint(expr= m.x1235 <= 50)
m.c1224 = Constraint(expr= m.x1236 <= 50)
m.c1225 = Constraint(expr= m.x1237 <= 50)
m.c1226 = Constraint(expr= m.x1238 <= 50)
m.c1227 = Constraint(expr= m.x1239 <= 50)
m.c1228 = Constraint(expr= m.x1240 <= 50)
m.c1229 = Constraint(expr= m.x1241 <= 50)
m.c1230 = Constraint(expr= m.x1242 <= 50)
m.c1231 = Constraint(expr= m.x1243 <= 50)
m.c1232 = Constraint(expr= m.x1244 <= 50)
m.c1233 = Constraint(expr= m.x1245 <= 50)
m.c1234 = Constraint(expr= m.x1246 <= 50)
m.c1235 = Constraint(expr= m.x1247 <= 50)
m.c1236 = Constraint(expr= m.x1248 <= 50)
m.c1237 = Constraint(expr= m.x1249 <= 50)
m.c1238 = Constraint(expr= m.x1250 <= 50)
m.c1239 = Constraint(expr= m.x1251 <= 100)
m.c1240 = Constraint(expr= m.x1252 <= 100)
m.c1241 = Constraint(expr= m.x1253 <= 100)
m.c1242 = Constraint(expr= m.x1254 <= 100)
m.c1243 = Constraint(expr= m.x1255 <= 100)
m.c1244 = Constraint(expr= m.x1256 <= 100)
m.c1245 = Constraint(expr= m.x1257 <= 100)
m.c1246 = Constraint(expr= m.x1258 <= 100)
m.c1247 = Constraint(expr= m.x1259 <= 100)
m.c1248 = Constraint(expr= m.x1260 <= 100)
m.c1249 = Constraint(expr= m.x1261 <= 100)
m.c1250 = Constraint(expr= m.x1262 <= 100)
m.c1251 = Constraint(expr= m.x1263 <= 100)
m.c1252 = Constraint(expr= m.x1264 <= 100)
m.c1253 = Constraint(expr= m.x1265 <= 100)
m.c1254 = Constraint(expr= m.x1266 <= 100)
m.c1255 = Constraint(expr= m.x1267 <= 100)
m.c1256 = Constraint(expr= m.x1268 <= 100)
m.c1257 = Constraint(expr= m.x1269 <= 100)
m.c1258 = Constraint(expr= m.x1270 <= 100)
m.c1259 = Constraint(expr= m.x1271 <= 100)
m.c1260 = Constraint(expr= m.x1272 <= 100)
m.c1261 = Constraint(expr= m.x1273 <= 100)
m.c1262 = Constraint(expr= m.x1274 <= 100)
m.c1263 = Constraint(expr= m.x1275 <= 100)
m.c1264 = Constraint(expr= m.x1276 <= 100)
m.c1265 = Constraint(expr= m.x1277 <= 100)
m.c1266 = Constraint(expr= m.x1278 <= 100)
m.c1267 = Constraint(expr= m.x1279 <= 100)
m.c1268 = Constraint(expr= m.x1280 <= 100)
m.c1269 = Constraint(expr= m.x1281 <= 100)
m.c1270 = Constraint(expr= m.x1282 <= 100)
m.c1271 = Constraint(expr= m.x1283 <= 100)
m.c1272 = Constraint(expr= m.x1284 <= 100)
m.c1273 = Constraint(expr= m.x1285 <= 100)
m.c1274 = Constraint(expr= m.x1286 <= 100)
m.c1275 = Constraint(expr= m.x1287 <= 100)
m.c1276 = Constraint(expr= m.x1288 <= 100)
m.c1277 = Constraint(expr= m.x1289 <= 100)
m.c1278 = Constraint(expr= m.x1290 <= 100)
m.c1279 = Constraint(expr= m.x1291 <= 100)
m.c1280 = Constraint(expr= m.x1292 <= 100)
m.c1281 = Constraint(expr= m.x1307 <= 50)
m.c1282 = Constraint(expr= m.x1308 <= 50)
m.c1283 = Constraint(expr= m.x1309 <= 50)
m.c1284 = Constraint(expr= m.x1310 <= 50)
m.c1285 = Constraint(expr= m.x1311 <= 50)
m.c1286 = Constraint(expr= m.x1312 <= 50)
m.c1287 = Constraint(expr= m.x1313 <= 50)
m.c1288 = Constraint(expr= m.x1314 <= 50)
m.c1289 = Constraint(expr= m.x1315 <= 50)
m.c1290 = Constraint(expr= m.x1316 <= 50)
m.c1291 = Constraint(expr= m.x1317 <= 50)
m.c1292 = Constraint(expr= m.x1318 <= 50)
m.c1293 = Constraint(expr= m.x1319 <= 50)
m.c1294 = Constraint(expr= m.x1320 <= 50)
m.c1295 = Constraint(expr= m.x1321 <= 50)
m.c1296 = Constraint(expr= m.x1322 <= 50)
m.c1297 = Constraint(expr= m.x1323 <= 50)
m.c1298 = Constraint(expr= m.x1324 <= 50)
m.c1299 = Constraint(expr= m.x1325 <= 50)
m.c1300 = Constraint(expr= m.x1326 <= 50)
m.c1301 = Constraint(expr= m.x1327 <= 50)
m.c1302 = Constraint(expr= m.x1328 <= 100)
m.c1303 = Constraint(expr= m.x1329 <= 100)
m.c1304 = Constraint(expr= m.x1330 <= 100)
m.c1305 = Constraint(expr= m.x1331 <= 100)
m.c1306 = Constraint(expr= m.x1332 <= 100)
m.c1307 = Constraint(expr= m.x1333 <= 100)
m.c1308 = Constraint(expr= m.x1334 <= 100)
m.c1309 = Constraint(expr= m.x1335 <= 100)
m.c1310 = Constraint(expr= m.x1336 <= 100)
m.c1311 = Constraint(expr= m.x1337 <= 100)
m.c1312 = Constraint(expr= m.x1338 <= 100)
m.c1313 = Constraint(expr= m.x1339 <= 100)
m.c1314 = Constraint(expr= m.x1340 <= 100)
m.c1315 = Constraint(expr= m.x1341 <= 100)
m.c1316 = Constraint(expr= m.x1342 <= 100)
m.c1317 = Constraint(expr= m.x1343 <= 100)
m.c1318 = Constraint(expr= m.x1344 <= 100)
m.c1319 = Constraint(expr= m.x1345 <= 100)
m.c1320 = Constraint(expr= m.x1346 <= 100)
m.c1321 = Constraint(expr= m.x1347 <= 100)
m.c1322 = Constraint(expr= m.x1348 <= 100)
m.c1323 = Constraint(expr= m.x1349 <= 100)
m.c1324 = Constraint(expr= m.x1350 <= 100)
m.c1325 = Constraint(expr= m.x1351 <= 100)
m.c1326 = Constraint(expr= m.x1352 <= 100)
m.c1327 = Constraint(expr= m.x1353 <= 100)
m.c1328 = Constraint(expr= m.x1354 <= 100)
m.c1329 = Constraint(expr= m.x1355 <= 100)
m.c1330 = Constraint(expr= m.x1356 <= 100)
m.c1331 = Constraint(expr= m.x1357 <= 100)
m.c1332 = Constraint(expr= m.x1358 <= 100)
m.c1333 = Constraint(expr= m.x1359 <= 100)
m.c1334 = Constraint(expr= m.x1360 <= 100)
m.c1335 = Constraint(expr= m.x1361 <= 100)
m.c1336 = Constraint(expr= m.x1362 <= 100)
m.c1337 = Constraint(expr= m.x1363 <= 100)
m.c1338 = Constraint(expr= m.x1364 <= 100)
m.c1339 = Constraint(expr= m.x1365 <= 100)
m.c1340 = Constraint(expr= m.x1366 <= 100)
m.c1341 = Constraint(expr= m.x1367 <= 100)
m.c1342 = Constraint(expr= m.x1368 <= 100)
m.c1343 = Constraint(expr= m.x1369 <= 100)
m.c1344 = Constraint(expr= m.x1384 <= 50)
m.c1345 = Constraint(expr= m.x1385 <= 50)
m.c1346 = Constraint(expr= m.x1386 <= 50)
m.c1347 = Constraint(expr= m.x1387 <= 50)
m.c1348 = Constraint(expr= m.x1388 <= 50)
m.c1349 = Constraint(expr= m.x1389 <= 50)
m.c1350 = Constraint(expr= m.x1390 <= 50)
m.c1351 = Constraint(expr= m.x1391 <= 50)
m.c1352 = Constraint(expr= m.x1392 <= 50)
m.c1353 = Constraint(expr= m.x1393 <= 50)
m.c1354 = Constraint(expr= m.x1394 <= 50)
m.c1355 = Constraint(expr= m.x1395 <= 50)
m.c1356 = Constraint(expr= m.x1396 <= 50)
m.c1357 = Constraint(expr= m.x1397 <= 50)
m.c1358 = Constraint(expr= m.x1398 <= 50)
m.c1359 = Constraint(expr= m.x1399 <= 50)
m.c1360 = Constraint(expr= m.x1400 <= 50)
m.c1361 = Constraint(expr= m.x1401 <= 50)
m.c1362 = Constraint(expr= m.x1402 <= 50)
m.c1363 = Constraint(expr= m.x1403 <= 50)
m.c1364 = Constraint(expr= m.x1404 <= 50)
m.c1365 = Constraint(expr= m.x1405 <= 100)
m.c1366 = Constraint(expr= m.x1406 <= 100)
m.c1367 = Constraint(expr= m.x1407 <= 100)
m.c1368 = Constraint(expr= m.x1408 <= 100)
m.c1369 = Constraint(expr= m.x1409 <= 100)
m.c1370 = Constraint(expr= m.x1410 <= 100)
m.c1371 = Constraint(expr= m.x1411 <= 100)
m.c1372 = Constraint(expr= m.x1412 <= 100)
m.c1373 = Constraint(expr= m.x1413 <= 100)
m.c1374 = Constraint(expr= m.x1414 <= 100)
m.c1375 = Constraint(expr= m.x1415 <= 100)
m.c1376 = Constraint(expr= m.x1416 <= 100)
m.c1377 = Constraint(expr= m.x1417 <= 100)
m.c1378 = Constraint(expr= m.x1418 <= 100)
m.c1379 = Constraint(expr= m.x1419 <= 100)
m.c1380 = Constraint(expr= m.x1420 <= 100)
m.c1381 = Constraint(expr= m.x1421 <= 100)
m.c1382 = Constraint(expr= m.x1422 <= 100)
m.c1383 = Constraint(expr= m.x1423 <= 100)
m.c1384 = Constraint(expr= m.x1424 <= 100)
m.c1385 = Constraint(expr= m.x1425 <= 100)
m.c1386 = Constraint(expr= m.x1426 <= 100)
m.c1387 = Constraint(expr= m.x1427 <= 100)
m.c1388 = Constraint(expr= m.x1428 <= 100)
m.c1389 = Constraint(expr= m.x1429 <= 100)
m.c1390 = Constraint(expr= m.x1430 <= 100)
m.c1391 = Constraint(expr= m.x1431 <= 100)
m.c1392 = Constraint(expr= m.x1432 <= 100)
m.c1393 = Constraint(expr= m.x1433 <= 100)
m.c1394 = Constraint(expr= m.x1434 <= 100)
m.c1395 = Constraint(expr= m.x1435 <= 100)
m.c1396 = Constraint(expr= m.x1436 <= 100)
m.c1397 = Constraint(expr= m.x1437 <= 100)
m.c1398 = Constraint(expr= m.x1438 <= 100)
m.c1399 = Constraint(expr= m.x1439 <= 100)
m.c1400 = Constraint(expr= m.x1440 <= 100)
m.c1401 = Constraint(expr= m.x1441 <= 100)
m.c1402 = Constraint(expr= m.x1442 <= 100)
m.c1403 = Constraint(expr= m.x1443 <= 100)
m.c1404 = Constraint(expr= m.x1444 <= 100)
m.c1405 = Constraint(expr= m.x1445 <= 100)
m.c1406 = Constraint(expr= m.x1446 <= 100)
m.c1407 = Constraint(expr= m.x1461 <= 50)
m.c1408 = Constraint(expr= m.x1462 <= 50)
m.c1409 = Constraint(expr= m.x1463 <= 50)
m.c1410 = Constraint(expr= m.x1464 <= 50)
m.c1411 = Constraint(expr= m.x1465 <= 50)
m.c1412 = Constraint(expr= m.x1466 <= 50)
m.c1413 = Constraint(expr= m.x1467 <= 50)
m.c1414 = Constraint(expr= m.x1468 <= 50)
m.c1415 = Constraint(expr= m.x1469 <= 50)
m.c1416 = Constraint(expr= m.x1470 <= 50)
m.c1417 = Constraint(expr= m.x1471 <= 50)
m.c1418 = Constraint(expr= m.x1472 <= 50)
m.c1419 = Constraint(expr= m.x1473 <= 50)
m.c1420 = Constraint(expr= m.x1474 <= 50)
m.c1421 = Constraint(expr= m.x1475 <= 50)
m.c1422 = Constraint(expr= m.x1476 <= 50)
m.c1423 = Constraint(expr= m.x1477 <= 50)
m.c1424 = Constraint(expr= m.x1478 <= 50)
m.c1425 = Constraint(expr= m.x1479 <= 50)
m.c1426 = Constraint(expr= m.x1480 <= 50)
m.c1427 = Constraint(expr= m.x1481 <= 50)
m.c1428 = Constraint(expr= m.x1482 <= 100)
m.c1429 = Constraint(expr= m.x1483 <= 100)
m.c1430 = Constraint(expr= m.x1484 <= 100)
m.c1431 = Constraint(expr= m.x1485 <= 100)
m.c1432 = Constraint(expr= m.x1486 <= 100)
m.c1433 = Constraint(expr= m.x1487 <= 100)
m.c1434 = Constraint(expr= m.x1488 <= 100)
m.c1435 = Constraint(expr= m.x1489 <= 100)
m.c1436 = Constraint(expr= m.x1490 <= 100)
m.c1437 = Constraint(expr= m.x1491 <= 100)
m.c1438 = Constraint(expr= m.x1492 <= 100)
m.c1439 = Constraint(expr= m.x1493 <= 100)
m.c1440 = Constraint(expr= m.x1494 <= 100)
m.c1441 = Constraint(expr= m.x1495 <= 100)
m.c1442 = Constraint(expr= m.x1496 <= 100)
m.c1443 = Constraint(expr= m.x1497 <= 100)
m.c1444 = Constraint(expr= m.x1498 <= 100)
m.c1445 = Constraint(expr= m.x1499 <= 100)
m.c1446 = Constraint(expr= m.x1500 <= 100)
m.c1447 = Constraint(expr= m.x1501 <= 100)
m.c1448 = Constraint(expr= m.x1502 <= 100)
m.c1449 = Constraint(expr= m.x1503 <= 100)
m.c1450 = Constraint(expr= m.x1504 <= 100)
m.c1451 = Constraint(expr= m.x1505 <= 100)
m.c1452 = Constraint(expr= m.x1506 <= 100)
m.c1453 = Constraint(expr= m.x1507 <= 100)
m.c1454 = Constraint(expr= m.x1508 <= 100)
m.c1455 = Constraint(expr= m.x1509 <= 100)
m.c1456 = Constraint(expr= m.x1510 <= 100)
m.c1457 = Constraint(expr= m.x1511 <= 100)
m.c1458 = Constraint(expr= m.x1512 <= 100)
m.c1459 = Constraint(expr= m.x1513 <= 100)
m.c1460 = Constraint(expr= m.x1514 <= 100)
m.c1461 = Constraint(expr= m.x1515 <= 100)
m.c1462 = Constraint(expr= m.x1516 <= 100)
m.c1463 = Constraint(expr= m.x1517 <= 100)
m.c1464 = Constraint(expr= m.x1518 <= 100)
m.c1465 = Constraint(expr= m.x1519 <= 100)
m.c1466 = Constraint(expr= m.x1520 <= 100)
m.c1467 = Constraint(expr= m.x1521 <= 100)
m.c1468 = Constraint(expr= m.x1522 <= 100)
m.c1469 = Constraint(expr= m.x1523 <= 100)
m.c1470 = Constraint(expr= m.x1010 - m.x1076 - m.x1077 - m.x1078 - m.x1079 - m.x1080 - m.x1081 - m.x1082 == 0)
m.c1471 = Constraint(expr= m.x1011 - m.x1083 - m.x1084 - m.x1085 - m.x1086 - m.x1087 - m.x1088 - m.x1089 == 0)
m.c1472 = Constraint(expr= m.x1012 - m.x1090 - m.x1091 - m.x1092 - m.x1093 - m.x1094 - m.x1095 - m.x1096 == 0)
m.c1473 = Constraint(expr= m.x1013 - m.x1097 - m.x1098 - m.x1099 - m.x1100 - m.x1101 - m.x1102 - m.x1103 == 0)
m.c1474 = Constraint(expr= m.x1014 - m.x1104 - m.x1105 - m.x1106 - m.x1107 - m.x1108 - m.x1109 - m.x1110 == 0)
m.c1475 = Constraint(expr= m.x1015 - m.x1111 - m.x1112 - m.x1113 - m.x1114 - m.x1115 - m.x1116 - m.x1117 == 0)
m.c1476 = Constraint(expr= m.x1016 - m.x1118 - m.x1119 - m.x1120 - m.x1121 - m.x1122 - m.x1123 - m.x1124 == 0)
m.c1477 = Constraint(expr= m.x1017 - m.x1125 - m.x1126 - m.x1127 - m.x1128 - m.x1129 - m.x1130 - m.x1131 == 0)
m.c1478 = Constraint(expr= m.x1018 - m.x1132 - m.x1133 - m.x1134 - m.x1135 - m.x1136 - m.x1137 - m.x1138 == 0)
m.c1479 = Constraint(expr= m.x1019 - m.x1139 - m.x1140 - m.x1141 - m.x1142 - m.x1143 - m.x1144 - m.x1145 == 0)
m.c1480 = Constraint(expr= m.x1020 - m.x1146 - m.x1147 - m.x1148 - m.x1149 - m.x1150 - m.x1151 - m.x1152 == 0)
m.c1481 = Constraint(expr= m.x1021 - m.x1153 - m.x1154 - m.x1155 - m.x1156 - m.x1157 - m.x1158 - m.x1159 == 0)
m.c1482 = Constraint(expr= m.x1022 - m.x1160 - m.x1161 - m.x1162 - m.x1163 - m.x1164 - m.x1165 - m.x1166 == 0)
m.c1483 = Constraint(expr= m.x1023 - m.x1167 - m.x1168 - m.x1169 - m.x1170 - m.x1171 - m.x1172 - m.x1173 == 0)
m.c1484 = Constraint(expr= m.x1024 - m.x1174 - m.x1175 - m.x1176 - m.x1177 - m.x1178 - m.x1179 - m.x1180 == 0)
m.c1485 = Constraint(expr= m.x1025 - m.x1181 - m.x1182 - m.x1183 - m.x1184 - m.x1185 - m.x1186 - m.x1187 == 0)
m.c1486 = Constraint(expr= m.x1026 - m.x1188 - m.x1189 - m.x1190 - m.x1191 - m.x1192 - m.x1193 - m.x1194 == 0)
m.c1487 = Constraint(expr= m.x1027 - m.x1195 - m.x1196 - m.x1197 - m.x1198 - m.x1199 - m.x1200 - m.x1201 == 0)
m.c1488 = Constraint(expr= m.x1028 - m.x1202 - m.x1203 - m.x1204 - m.x1205 - m.x1206 - m.x1207 - m.x1208 == 0)
m.c1489 = Constraint(expr= m.x1029 - m.x1209 - m.x1210 - m.x1211 - m.x1212 - m.x1213 - m.x1214 - m.x1215 == 0)
m.c1490 = Constraint(expr= m.x1030 - m.x1216 - m.x1217 - m.x1218 - m.x1219 - m.x1220 - m.x1221 - m.x1222 == 0)
m.c1491 = Constraint(expr= m.x1031 - m.x1223 - m.x1224 - m.x1225 - m.x1226 - m.x1227 - m.x1228 - m.x1229 == 0)
m.c1492 = Constraint(expr= m.x1032 - m.x1230 - m.x1231 - m.x1232 - m.x1233 - m.x1234 - m.x1235 - m.x1236 == 0)
m.c1493 = Constraint(expr= m.x1033 - m.x1237 - m.x1238 - m.x1239 - m.x1240 - m.x1241 - m.x1242 - m.x1243 == 0)
m.c1494 = Constraint(expr= m.x1034 - m.x1244 - m.x1245 - m.x1246 - m.x1247 - m.x1248 - m.x1249 - m.x1250 == 0)
m.c1495 = Constraint(expr= m.x1035 - m.x1251 - m.x1252 - m.x1253 - m.x1254 - m.x1255 - m.x1256 - m.x1257 == 0)
m.c1496 = Constraint(expr= m.x1036 - m.x1258 - m.x1259 - m.x1260 - m.x1261 - m.x1262 - m.x1263 - m.x1264 == 0)
m.c1497 = Constraint(expr= m.x1037 - m.x1265 - m.x1266 - m.x1267 - m.x1268 - m.x1269 - m.x1270 - m.x1271 == 0)
m.c1498 = Constraint(expr= m.x1038 - m.x1272 - m.x1273 - m.x1274 - m.x1275 - m.x1276 - m.x1277 - m.x1278 == 0)
m.c1499 = Constraint(expr= m.x1039 - m.x1279 - m.x1280 - m.x1281 - m.x1282 - m.x1283 - m.x1284 - m.x1285 == 0)
m.c1500 = Constraint(expr= m.x1040 - m.x1286 - m.x1287 - m.x1288 - m.x1289 - m.x1290 - m.x1291 - m.x1292 == 0)
m.c1501 = Constraint(expr= m.x1041 - m.x1293 - m.x1294 - m.x1295 - m.x1296 - m.x1297 - m.x1298 - m.x1299 == 0)
m.c1502 = Constraint(expr= m.x1042 - m.x1300 - m.x1301 - m.x1302 - m.x1303 - m.x1304 - m.x1305 - m.x1306 == 0)
m.c1503 = Constraint(expr= m.x1043 - m.x1307 - m.x1308 - m.x1309 - m.x1310 - m.x1311 - m.x1312 - m.x1313 == 0)
m.c1504 = Constraint(expr= m.x1044 - m.x1314 - m.x1315 - m.x1316 - m.x1317 - m.x1318 - m.x1319 - m.x1320 == 0)
m.c1505 = Constraint(expr= m.x1045 - m.x1321 - m.x1322 - m.x1323 - m.x1324 - m.x1325 - m.x1326 - m.x1327 == 0)
m.c1506 = Constraint(expr= m.x1046 - m.x1328 - m.x1329 - m.x1330 - m.x1331 - m.x1332 - m.x1333 - m.x1334 == 0)
m.c1507 = Constraint(expr= m.x1047 - m.x1335 - m.x1336 - m.x1337 - m.x1338 - m.x1339 - m.x1340 - m.x1341 == 0)
m.c1508 = Constraint(expr= m.x1048 - m.x1342 - m.x1343 - m.x1344 - m.x1345 - m.x1346 - m.x1347 - m.x1348 == 0)
m.c1509 = Constraint(expr= m.x1049 - m.x1349 - m.x1350 - m.x1351 - m.x1352 - m.x1353 - m.x1354 - m.x1355 == 0)
m.c1510 = Constraint(expr= m.x1050 - m.x1356 - m.x1357 - m.x1358 - m.x1359 - m.x1360 - m.x1361 - m.x1362 == 0)
m.c1511 = Constraint(expr= m.x1051 - m.x1363 - m.x1364 - m.x1365 - m.x1366 - m.x1367 - m.x1368 - m.x1369 == 0)
m.c1512 = Constraint(expr= m.x1052 - m.x1370 - m.x1371 - m.x1372 - m.x1373 - m.x1374 - m.x1375 - m.x1376 == 0)
m.c1513 = Constraint(expr= m.x1053 - m.x1377 - m.x1378 - m.x1379 - m.x1380 - m.x1381 - m.x1382 - m.x1383 == 0)
m.c1514 = Constraint(expr= m.x1054 - m.x1384 - m.x1385 - m.x1386 - m.x1387 - m.x1388 - m.x1389 - m.x1390 == 0)
m.c1515 = Constraint(expr= m.x1055 - m.x1391 - m.x1392 - m.x1393 - m.x1394 - m.x1395 - m.x1396 - m.x1397 == 0)
m.c1516 = Constraint(expr= m.x1056 - m.x1398 - m.x1399 - m.x1400 - m.x1401 - m.x1402 - m.x1403 - m.x1404 == 0)
m.c1517 = Constraint(expr= m.x1057 - m.x1405 - m.x1406 - m.x1407 - m.x1408 - m.x1409 - m.x1410 - m.x1411 == 0)
m.c1518 = Constraint(expr= m.x1058 - m.x1412 - m.x1413 - m.x1414 - m.x1415 - m.x1416 - m.x1417 - m.x1418 == 0)
m.c1519 = Constraint(expr= m.x1059 - m.x1419 - m.x1420 - m.x1421 - m.x1422 - m.x1423 - m.x1424 - m.x1425 == 0)
m.c1520 = Constraint(expr= m.x1060 - m.x1426 - m.x1427 - m.x1428 - m.x1429 - m.x1430 - m.x1431 - m.x1432 == 0)
m.c1521 = Constraint(expr= m.x1061 - m.x1433 - m.x1434 - m.x1435 - m.x1436 - m.x1437 - m.x1438 - m.x1439 == 0)
m.c1522 = Constraint(expr= m.x1062 - m.x1440 - m.x1441 - m.x1442 - m.x1443 - m.x1444 - m.x1445 - m.x1446 == 0)
m.c1523 = Constraint(expr= m.x1063 - m.x1447 - m.x1448 - m.x1449 - m.x1450 - m.x1451 - m.x1452 - m.x1453 == 0)
m.c1524 = Constraint(expr= m.x1064 - m.x1454 - m.x1455 - m.x1456 - m.x1457 - m.x1458 - m.x1459 - m.x1460 == 0)
m.c1525 = Constraint(expr= m.x1065 - m.x1461 - m.x1462 - m.x1463 - m.x1464 - m.x1465 - m.x1466 - m.x1467 == 0)
m.c1526 = Constraint(expr= m.x1066 - m.x1468 - m.x1469 - m.x1470 - m.x1471 - m.x1472 - m.x1473 - m.x1474 == 0)
m.c1527 = Constraint(expr= m.x1067 - m.x1475 - m.x1476 - m.x1477 - m.x1478 - m.x1479 - m.x1480 - m.x1481 == 0)
m.c1528 = Constraint(expr= m.x1068 - m.x1482 - m.x1483 - m.x1484 - m.x1485 - m.x1486 - m.x1487 - m.x1488 == 0)
m.c1529 = Constraint(expr= m.x1069 - m.x1489 - m.x1490 - m.x1491 - m.x1492 - m.x1493 - m.x1494 - m.x1495 == 0)
m.c1530 = Constraint(expr= m.x1070 - m.x1496 - m.x1497 - m.x1498 - m.x1499 - m.x1500 - m.x1501 - m.x1502 == 0)
m.c1531 = Constraint(expr= m.x1071 - m.x1503 - m.x1504 - m.x1505 - m.x1506 - m.x1507 - m.x1508 - m.x1509 == 0)
m.c1532 = Constraint(expr= m.x1072 - m.x1510 - m.x1511 - m.x1512 - m.x1513 - m.x1514 - m.x1515 - m.x1516 == 0)
m.c1533 = Constraint(expr= m.x1073 - m.x1517 - m.x1518 - m.x1519 - m.x1520 - m.x1521 - m.x1522 - m.x1523 == 0)
m.c1534 = Constraint(expr= m.x1074 - m.x1524 - m.x1525 - m.x1526 - m.x1527 - m.x1528 - m.x1529 - m.x1530 == 0)
m.c1535 = Constraint(expr= m.x1075 - m.x1531 - m.x1532 - m.x1533 - m.x1534 - m.x1535 - m.x1536 - m.x1537 == 0)
m.c1536 = Constraint(expr= m.x1010 == 50)
m.c1537 = Constraint(expr= m.x1011 == 50)
m.c1538 = Constraint(expr= m.x1012 == 50)
m.c1539 = Constraint(expr= m.x1013 == 20)
m.c1540 = Constraint(expr= m.x1014 == 20)
m.c1541 = Constraint(expr= m.x1015 == 20)
m.c1542 = Constraint(expr= m.x1016 == 30)
m.c1543 = Constraint(expr= m.x1017 == 50)
m.c1544 = Constraint(expr= m.x1018 == 30)
m.c1545 = Constraint(expr= m.x1019 == 0)
m.c1546 = Constraint(expr= m.x1020 == 0)
m.c1547 = Constraint(expr= m.x338 + m.x1021 == 50)
m.c1548 = Constraint(expr= m.x339 + m.x1022 == 50)
m.c1549 = Constraint(expr= m.x340 + m.x1023 == 50)
m.c1550 = Constraint(expr= - m.x338 + m.x341 + m.x342 + m.x1024 == 20)
m.c1551 = Constraint(expr= - m.x339 + m.x343 + m.x344 + m.x345 + m.x1025 == 20)
m.c1552 = Constraint(expr= - m.x340 + m.x346 + m.x347 + m.x1026 == 20)
m.c1553 = Constraint(expr= - m.x341 - m.x343 + m.x348 + m.x1027 == 30)
m.c1554 = Constraint(expr= - m.x342 - m.x344 - m.x346 + m.x349 + m.x350 + m.x1028 == 50)
m.c1555 = Constraint(expr= - m.x345 - m.x347 + m.x351 + m.x1029 == 30)
m.c1556 = Constraint(expr= - m.x348 - m.x349 + m.x1030 == 0)
m.c1557 = Constraint(expr= - m.x350 - m.x351 + m.x1031 == 0)
m.c1558 = Constraint(expr= m.x338 + m.x352 + m.x1032 == 50)
m.c1559 = Constraint(expr= m.x339 + m.x353 + m.x1033 == 50)
m.c1560 = Constraint(expr= m.x340 + m.x354 + m.x1034 == 50)
m.c1561 = Constraint(expr= - m.x338 + m.x341 + m.x342 - m.x352 + m.x355 + m.x356 + m.x1035 == 20)
m.c1562 = Constraint(expr= - m.x339 + m.x343 + m.x344 + m.x345 - m.x353 + m.x357 + m.x358 + m.x359 + m.x1036 == 20)
m.c1563 = Constraint(expr= - m.x340 + m.x346 + m.x347 - m.x354 + m.x360 + m.x361 + m.x1037 == 20)
m.c1564 = Constraint(expr= - m.x341 - m.x343 + m.x348 - m.x355 - m.x357 + m.x362 + m.x1038 == 30)
m.c1565 = Constraint(expr= - m.x342 - m.x344 - m.x346 + m.x349 + m.x350 - m.x356 - m.x358 - m.x360 + m.x363 + m.x364
+ m.x1039 == 50)
m.c1566 = Constraint(expr= - m.x345 - m.x347 + m.x351 - m.x359 - m.x361 + m.x365 + m.x1040 == 30)
m.c1567 = Constraint(expr= - m.x348 - m.x349 - m.x362 - m.x363 + m.x1041 == 0)
m.c1568 = Constraint(expr= - m.x350 - m.x351 - m.x364 - m.x365 + m.x1042 == 0)
m.c1569 = Constraint(expr= m.x338 + m.x352 + m.x366 + m.x1043 == 50)
m.c1570 = Constraint(expr= m.x339 + m.x353 + m.x367 + m.x1044 == 50)
m.c1571 = Constraint(expr= m.x340 + m.x354 + m.x368 + m.x1045 == 50)
m.c1572 = Constraint(expr= - m.x338 + m.x341 + m.x342 - m.x352 + m.x355 + m.x356 - m.x366 + m.x369 + m.x370 + m.x1046
== 20)
m.c1573 = Constraint(expr= - m.x339 + m.x343 + m.x344 + m.x345 - m.x353 + m.x357 + m.x358 + m.x359 - m.x367 + m.x371
+ m.x372 + m.x373 + m.x1047 == 20)
m.c1574 = Constraint(expr= - m.x340 + m.x346 + m.x347 - m.x354 + m.x360 + m.x361 - m.x368 + m.x374 + m.x375 + m.x1048
== 20)
m.c1575 = Constraint(expr= - m.x341 - m.x343 + m.x348 - m.x355 - m.x357 + m.x362 - m.x369 - m.x371 + m.x376 + m.x1049
== 30)
m.c1576 = Constraint(expr= - m.x342 - m.x344 - m.x346 + m.x349 + m.x350 - m.x356 - m.x358 - m.x360 + m.x363 + m.x364
- m.x370 - m.x372 - m.x374 + m.x377 + m.x378 + m.x1050 == 50)
m.c1577 = Constraint(expr= - m.x345 - m.x347 + m.x351 - m.x359 - m.x361 + m.x365 - m.x373 - m.x375 + m.x379 + m.x1051
== 30)
m.c1578 = Constraint(expr= - m.x348 - m.x349 - m.x362 - m.x363 - m.x376 - m.x377 + m.x1052 == 0)
m.c1579 = Constraint(expr= - m.x350 - m.x351 - m.x364 - m.x365 - m.x378 - m.x379 + m.x1053 == 0)
m.c1580 = Constraint(expr= m.x338 + m.x352 + m.x366 + m.x380 + m.x1054 == 50)
m.c1581 = Constraint(expr= m.x339 + m.x353 + m.x367 + m.x381 + m.x1055 == 50)
m.c1582 = Constraint(expr= m.x340 + m.x354 + m.x368 + m.x382 + m.x1056 == 50)
m.c1583 = Constraint(expr= - m.x338 + m.x341 + m.x342 - m.x352 + m.x355 + m.x356 - m.x366 + m.x369 + m.x370 - m.x380
+ m.x383 + m.x384 + m.x1057 == 20)
m.c1584 = Constraint(expr= - m.x339 + m.x343 + m.x344 + m.x345 - m.x353 + m.x357 + m.x358 + m.x359 - m.x367 + m.x371
+ m.x372 + m.x373 - m.x381 + m.x385 + m.x386 + m.x387 + m.x1058 == 20)
m.c1585 = Constraint(expr= - m.x340 + m.x346 + m.x347 - m.x354 + m.x360 + m.x361 - m.x368 + m.x374 + m.x375 - m.x382
+ m.x388 + m.x389 + m.x1059 == 20)
m.c1586 = Constraint(expr= - m.x341 - m.x343 + m.x348 - m.x355 - m.x357 + m.x362 - m.x369 - m.x371 + m.x376 - m.x383
- m.x385 + m.x390 + m.x1060 == 30)
m.c1587 = Constraint(expr= - m.x342 - m.x344 - m.x346 + m.x349 + m.x350 - m.x356 - m.x358 - m.x360 + m.x363 + m.x364
- m.x370 - m.x372 - m.x374 + m.x377 + m.x378 - m.x384 - m.x386 - m.x388 + m.x391 + m.x392
+ m.x1061 == 50)
m.c1588 = Constraint(expr= - m.x345 - m.x347 + m.x351 - m.x359 - m.x361 + m.x365 - m.x373 - m.x375 + m.x379 - m.x387
- m.x389 + m.x393 + m.x1062 == 30)
m.c1589 = Constraint(expr= - m.x348 - m.x349 - m.x362 - m.x363 - m.x376 - m.x377 - m.x390 - m.x391 + m.x1063 == 0)
m.c1590 = Constraint(expr= - m.x350 - m.x351 - m.x364 - m.x365 - m.x378 - m.x379 - m.x392 - m.x393 + m.x1064 == 0)
m.c1591 = Constraint(expr= m.x338 + m.x352 + m.x366 + m.x380 + m.x394 + m.x1065 == 50)
m.c1592 = Constraint(expr= m.x339 + m.x353 + m.x367 + m.x381 + m.x395 + m.x1066 == 50)
m.c1593 = Constraint(expr= m.x340 + m.x354 + m.x368 + m.x382 + m.x396 + m.x1067 == 50)
m.c1594 = Constraint(expr= - m.x338 + m.x341 + m.x342 - m.x352 + m.x355 + m.x356 - m.x366 + m.x369 + m.x370 - m.x380
+ m.x383 + m.x384 - m.x394 + m.x397 + m.x398 + m.x1068 == 20)
m.c1595 = Constraint(expr= - m.x339 + m.x343 + m.x344 + m.x345 - m.x353 + m.x357 + m.x358 + m.x359 - m.x367 + m.x371
+ m.x372 + m.x373 - m.x381 + m.x385 + m.x386 + m.x387 - m.x395 + m.x399 + m.x400 + m.x401
+ m.x1069 == 20)
m.c1596 = Constraint(expr= - m.x340 + m.x346 + m.x347 - m.x354 + m.x360 + m.x361 - m.x368 + m.x374 + m.x375 - m.x382
+ m.x388 + m.x389 - m.x396 + m.x402 + m.x403 + m.x1070 == 20)
m.c1597 = Constraint(expr= - m.x341 - m.x343 + m.x348 - m.x355 - m.x357 + m.x362 - m.x369 - m.x371 + m.x376 - m.x383
- m.x385 + m.x390 - m.x397 - m.x399 + m.x404 + m.x1071 == 30)
m.c1598 = Constraint(expr= - m.x342 - m.x344 - m.x346 + m.x349 + m.x350 - m.x356 - m.x358 - m.x360 + m.x363 + m.x364
- m.x370 - m.x372 - m.x374 + m.x377 + m.x378 - m.x384 - m.x386 - m.x388 + m.x391 + m.x392
- m.x398 - m.x400 - m.x402 + m.x405 + m.x406 + m.x1072 == 50)
m.c1599 = Constraint(expr= - m.x345 - m.x347 + m.x351 - m.x359 - m.x361 + m.x365 - m.x373 - m.x375 + m.x379 - m.x387
- m.x389 + m.x393 - m.x401 - m.x403 + m.x407 + m.x1073 == 30)
m.c1600 = Constraint(expr= - m.x348 - m.x349 - m.x362 - m.x363 - m.x376 - m.x377 - m.x390 - m.x391 - m.x404 - m.x405
+ m.x1074 == 0)
m.c1601 = Constraint(expr= - m.x350 - m.x351 - m.x364 - m.x365 - m.x378 - m.x379 - m.x392 - m.x393 - m.x406 - m.x407
+ m.x1075 == 0)
m.c1602 = Constraint(expr= m.x1076 == 50)
m.c1603 = Constraint(expr= m.x1077 == 0)
m.c1604 = Constraint(expr= m.x1078 == 0)
m.c1605 = Constraint(expr= m.x1079 == 0)
m.c1606 = Constraint(expr= m.x1080 == 0)
m.c1607 = Constraint(expr= m.x1081 == 0)
m.c1608 = Constraint(expr= m.x1082 == 0)
m.c1609 = Constraint(expr= m.x1083 == 0)
m.c1610 = Constraint(expr= m.x1084 == 50)
m.c1611 = Constraint(expr= m.x1085 == 0)
m.c1612 = Constraint(expr= m.x1086 == 0)
m.c1613 = Constraint(expr= m.x1087 == 0)
m.c1614 = Constraint(expr= m.x1088 == 0)
m.c1615 = Constraint(expr= m.x1089 == 0)
m.c1616 = Constraint(expr= m.x1090 == 0)
m.c1617 = Constraint(expr= m.x1091 == 0)
m.c1618 = Constraint(expr= m.x1092 == 50)
m.c1619 = Constraint(expr= m.x1093 == 0)
m.c1620 = Constraint(expr= m.x1094 == 0)
m.c1621 = Constraint(expr= m.x1095 == 0)
m.c1622 = Constraint(expr= m.x1096 == 0)
m.c1623 = Constraint(expr= m.x1097 == 0)
m.c1624 = Constraint(expr= m.x1098 == 0)
m.c1625 = Constraint(expr= m.x1099 == 0)
m.c1626 = Constraint(expr= m.x1100 == 20)
m.c1627 = Constraint(expr= m.x1101 == 0)
m.c1628 = Constraint(expr= m.x1102 == 0)
m.c1629 = Constraint(expr= m.x1103 == 0)
m.c1630 = Constraint(expr= m.x1104 == 0)
m.c1631 = Constraint(expr= m.x1105 == 0)
m.c1632 = Constraint(expr= m.x1106 == 0)
m.c1633 = Constraint(expr= m.x1107 == 0)
m.c1634 = Constraint(expr= m.x1108 == 20)
m.c1635 = Constraint(expr= m.x1109 == 0)
m.c1636 = Constraint(expr= m.x1110 == 0)
m.c1637 = Constraint(expr= m.x1111 == 0)
m.c1638 = Constraint(expr= m.x1112 == 0)
m.c1639 = Constraint(expr= m.x1113 == 0)
m.c1640 = Constraint(expr= m.x1114 == 0)
m.c1641 = Constraint(expr= m.x1115 == 0)
m.c1642 = Constraint(expr= m.x1116 == 20)
m.c1643 = Constraint(expr= m.x1117 == 0)
m.c1644 = Constraint(expr= m.x1118 == 0)
m.c1645 = Constraint(expr= m.x1119 == 0)
m.c1646 = Constraint(expr= m.x1120 == 0)
m.c1647 = Constraint(expr= m.x1121 == 0)
m.c1648 = Constraint(expr= m.x1122 == 0)
m.c1649 = Constraint(expr= m.x1123 == 0)
m.c1650 = Constraint(expr= m.x1124 == 30)
m.c1651 = Constraint(expr= m.x1125 == 0)
m.c1652 = Constraint(expr= m.x1126 == 0)
m.c1653 = Constraint(expr= m.x1127 == 0)
m.c1654 = Constraint(expr= m.x1128 == 0)
m.c1655 = Constraint(expr= m.x1129 == 50)
m.c1656 = Constraint(expr= m.x1130 == 0)
m.c1657 = Constraint(expr= m.x1131 == 0)
m.c1658 = Constraint(expr= m.x1132 == 0)
m.c1659 = Constraint(expr= m.x1133 == 0)
m.c1660 = Constraint(expr= m.x1134 == 0)
m.c1661 = Constraint(expr= m.x1135 == 0)
m.c1662 = Constraint(expr= m.x1136 == 0)
m.c1663 = Constraint(expr= m.x1137 == 30)
m.c1664 = Constraint(expr= m.x1138 == 0)
m.c1665 = Constraint(expr= m.x1139 == 0)
m.c1666 = Constraint(expr= m.x1140 == 0)
m.c1667 = Constraint(expr= m.x1141 == 0)
m.c1668 = Constraint(expr= m.x1142 == 0)
m.c1669 = Constraint(expr= m.x1143 == 0)
m.c1670 = Constraint(expr= m.x1144 == 0)
m.c1671 = Constraint(expr= m.x1145 == 0)
m.c1672 = Constraint(expr= m.x1146 == 0)
m.c1673 = Constraint(expr= m.x1147 == 0)
m.c1674 = Constraint(expr= m.x1148 == 0)
m.c1675 = Constraint(expr= m.x1149 == 0)
m.c1676 = Constraint(expr= m.x1150 == 0)
m.c1677 = Constraint(expr= m.x1151 == 0)
m.c1678 = Constraint(expr= m.x1152 == 0)
m.c1679 = Constraint(expr= m.x422 + m.x1153 == 50)
m.c1680 = Constraint(expr= m.x423 + m.x1154 == 0)
m.c1681 = Constraint(expr= m.x424 + m.x1155 == 0)
m.c1682 = Constraint(expr= m.x425 + m.x1156 == 0)
m.c1683 = Constraint(expr= m.x426 + m.x1157 == 0)
m.c1684 = Constraint(expr= m.x427 + m.x1158 == 0)
m.c1685 = Constraint(expr= m.x428 + m.x1159 == 0)
m.c1686 = Constraint(expr= m.x429 + m.x1160 == 0)
m.c1687 = Constraint(expr= m.x430 + m.x1161 == 50)
m.c1688 = Constraint(expr= m.x431 + m.x1162 == 0)
m.c1689 = Constraint(expr= m.x432 + m.x1163 == 0)
m.c1690 = Constraint(expr= m.x433 + m.x1164 == 0)
m.c1691 = Constraint(expr= m.x434 + m.x1165 == 0)
m.c1692 = Constraint(expr= m.x435 + m.x1166 == 0)
m.c1693 = Constraint(expr= m.x436 + m.x1167 == 0)
m.c1694 = Constraint(expr= m.x437 + m.x1168 == 0)
m.c1695 = Constraint(expr= m.x438 + m.x1169 == 50)
m.c1696 = Constraint(expr= m.x439 + m.x1170 == 0)
m.c1697 = Constraint(expr= m.x440 + m.x1171 == 0)
m.c1698 = Constraint(expr= m.x441 + m.x1172 == 0)
m.c1699 = Constraint(expr= m.x442 + m.x1173 == 0)
m.c1700 = Constraint(expr= - m.x422 + m.x443 + m.x450 + m.x1174 == 0)
m.c1701 = Constraint(expr= - m.x423 + m.x444 + m.x451 + m.x1175 == 0)
m.c1702 = Constraint(expr= - m.x424 + m.x445 + m.x452 + m.x1176 == 0)
m.c1703 = Constraint(expr= - m.x425 + m.x446 + m.x453 + m.x1177 == 20)
m.c1704 = Constraint(expr= - m.x426 + m.x447 + m.x454 + m.x1178 == 0)
m.c1705 = Constraint(expr= - m.x427 + m.x448 + m.x455 + m.x1179 == 0)
m.c1706 = Constraint(expr= - m.x428 + m.x449 + m.x456 + m.x1180 == 0)
m.c1707 = Constraint(expr= - m.x429 + m.x457 + m.x464 + m.x471 + m.x1181 == 0)
m.c1708 = Constraint(expr= - m.x430 + m.x458 + m.x465 + m.x472 + m.x1182 == 0)
m.c1709 = Constraint(expr= - m.x431 + m.x459 + m.x466 + m.x473 + m.x1183 == 0)
m.c1710 = Constraint(expr= - m.x432 + m.x460 + m.x467 + m.x474 + m.x1184 == 0)
m.c1711 = Constraint(expr= - m.x433 + m.x461 + m.x468 + m.x475 + m.x1185 == 20)
m.c1712 = Constraint(expr= - m.x434 + m.x462 + m.x469 + m.x476 + m.x1186 == 0)
m.c1713 = Constraint(expr= - m.x435 + m.x463 + m.x470 + m.x477 + m.x1187 == 0)
m.c1714 = Constraint(expr= - m.x436 + m.x478 + m.x485 + m.x1188 == 0)
m.c1715 = Constraint(expr= - m.x437 + m.x479 + m.x486 + m.x1189 == 0)
m.c1716 = Constraint(expr= - m.x438 + m.x480 + m.x487 + m.x1190 == 0)
m.c1717 = Constraint(expr= - m.x439 + m.x481 + m.x488 + m.x1191 == 0)
m.c1718 = Constraint(expr= - m.x440 + m.x482 + m.x489 + m.x1192 == 0)
m.c1719 = Constraint(expr= - m.x441 + m.x483 + m.x490 + m.x1193 == 20)
m.c1720 = Constraint(expr= - m.x442 + m.x484 + m.x491 + m.x1194 == 0)
m.c1721 = Constraint(expr= - m.x443 - m.x457 + m.x492 + m.x1195 == 0)
m.c1722 = Constraint(expr= - m.x444 - m.x458 + m.x493 + m.x1196 == 0)
m.c1723 = Constraint(expr= - m.x445 - m.x459 + m.x494 + m.x1197 == 0)
m.c1724 = Constraint(expr= - m.x446 - m.x460 + m.x495 + m.x1198 == 0)
m.c1725 = Constraint(expr= - m.x447 - m.x461 + m.x496 + m.x1199 == 0)
m.c1726 = Constraint(expr= - m.x448 - m.x462 + m.x497 + m.x1200 == 0)
m.c1727 = Constraint(expr= - m.x449 - m.x463 + m.x498 + m.x1201 == 30)
m.c1728 = Constraint(expr= - m.x450 - m.x464 - m.x478 + m.x499 + m.x506 + m.x1202 == 0)
m.c1729 = Constraint(expr= - m.x451 - m.x465 - m.x479 + m.x500 + m.x507 + m.x1203 == 0)
m.c1730 = Constraint(expr= - m.x452 - m.x466 - m.x480 + m.x501 + m.x508 + m.x1204 == 0)
m.c1731 = Constraint(expr= - m.x453 - m.x467 - m.x481 + m.x502 + m.x509 + m.x1205 == 0)
m.c1732 = Constraint(expr= - m.x454 - m.x468 - m.x482 + m.x503 + m.x510 + m.x1206 == 50)
m.c1733 = Constraint(expr= - m.x455 - m.x469 - m.x483 + m.x504 + m.x511 + m.x1207 == 0)
m.c1734 = Constraint(expr= - m.x456 - m.x470 - m.x484 + m.x505 + m.x512 + m.x1208 == 0)
m.c1735 = Constraint(expr= - m.x471 - m.x485 + m.x513 + m.x1209 == 0)
m.c1736 = Constraint(expr= - m.x472 - m.x486 + m.x514 + m.x1210 == 0)
m.c1737 = Constraint(expr= - m.x473 - m.x487 + m.x515 + m.x1211 == 0)
m.c1738 = Constraint(expr= - m.x474 - m.x488 + m.x516 + m.x1212 == 0)
m.c1739 = Constraint(expr= - m.x475 - m.x489 + m.x517 + m.x1213 == 0)
m.c1740 = Constraint(expr= - m.x476 - m.x490 + m.x518 + m.x1214 == 30)
m.c1741 = Constraint(expr= - m.x477 - m.x491 + m.x519 + m.x1215 == 0)
m.c1742 = Constraint(expr= - m.x492 - m.x499 + m.x1216 == 0)
m.c1743 = Constraint(expr= - m.x493 - m.x500 + m.x1217 == 0)
m.c1744 = Constraint(expr= - m.x494 - m.x501 + m.x1218 == 0)
m.c1745 = Constraint(expr= - m.x495 - m.x502 + m.x1219 == 0)
m.c1746 = Constraint(expr= - m.x496 - m.x503 + m.x1220 == 0)
m.c1747 = Constraint(expr= - m.x497 - m.x504 + m.x1221 == 0)
m.c1748 = Constraint(expr= - m.x498 - m.x505 + m.x1222 == 0)
m.c1749 = Constraint(expr= - m.x506 - m.x513 + m.x1223 == 0)
m.c1750 = Constraint(expr= - m.x507 - m.x514 + m.x1224 == 0)
m.c1751 = Constraint(expr= - m.x508 - m.x515 + m.x1225 == 0)
m.c1752 = Constraint(expr= - m.x509 - m.x516 + m.x1226 == 0)
m.c1753 = Constraint(expr= - m.x510 - m.x517 + m.x1227 == 0)
m.c1754 = Constraint(expr= - m.x511 - m.x518 + m.x1228 == 0)
m.c1755 = Constraint(expr= - m.x512 - m.x519 + m.x1229 == 0)
m.c1756 = Constraint(expr= m.x422 + m.x520 + m.x1230 == 50)
m.c1757 = Constraint(expr= m.x423 + m.x521 + m.x1231 == 0)
m.c1758 = Constraint(expr= m.x424 + m.x522 + m.x1232 == 0)
m.c1759 = Constraint(expr= m.x425 + m.x523 + m.x1233 == 0)
m.c1760 = Constraint(expr= m.x426 + m.x524 + m.x1234 == 0)
m.c1761 = Constraint(expr= m.x427 + m.x525 + m.x1235 == 0)
m.c1762 = Constraint(expr= m.x428 + m.x526 + m.x1236 == 0)
m.c1763 = Constraint(expr= m.x429 + m.x527 + m.x1237 == 0)
m.c1764 = Constraint(expr= m.x430 + m.x528 + m.x1238 == 50)
m.c1765 = Constraint(expr= m.x431 + m.x529 + m.x1239 == 0)
m.c1766 = Constraint(expr= m.x432 + m.x530 + m.x1240 == 0)
m.c1767 = Constraint(expr= m.x433 + m.x531 + m.x1241 == 0)
m.c1768 = Constraint(expr= m.x434 + m.x532 + m.x1242 == 0)
m.c1769 = Constraint(expr= m.x435 + m.x533 + m.x1243 == 0)
m.c1770 = Constraint(expr= m.x436 + m.x534 + m.x1244 == 0)
m.c1771 = Constraint(expr= m.x437 + m.x535 + m.x1245 == 0)
m.c1772 = Constraint(expr= m.x438 + m.x536 + m.x1246 == 50)
m.c1773 = Constraint(expr= m.x439 + m.x537 + m.x1247 == 0)
m.c1774 = Constraint(expr= m.x440 + m.x538 + m.x1248 == 0)
m.c1775 = Constraint(expr= m.x441 + m.x539 + m.x1249 == 0)
m.c1776 = Constraint(expr= m.x442 + m.x540 + m.x1250 == 0)
m.c1777 = Constraint(expr= - m.x422 + m.x443 + m.x450 - m.x520 + m.x541 + m.x548 + m.x1251 == 0)
m.c1778 = Constraint(expr= - m.x423 + m.x444 + m.x451 - m.x521 + m.x542 + m.x549 + m.x1252 == 0)
m.c1779 = Constraint(expr= - m.x424 + m.x445 + m.x452 - m.x522 + m.x543 + m.x550 + m.x1253 == 0)
m.c1780 = Constraint(expr= - m.x425 + m.x446 + m.x453 - m.x523 + m.x544 + m.x551 + m.x1254 == 20)
m.c1781 = Constraint(expr= - m.x426 + m.x447 + m.x454 - m.x524 + m.x545 + m.x552 + m.x1255 == 0)
m.c1782 = Constraint(expr= - m.x427 + m.x448 + m.x455 - m.x525 + m.x546 + m.x553 + m.x1256 == 0)
m.c1783 = Constraint(expr= - m.x428 + m.x449 + m.x456 - m.x526 + m.x547 + m.x554 + m.x1257 == 0)
m.c1784 = Constraint(expr= - m.x429 + m.x457 + m.x464 + m.x471 - m.x527 + m.x555 + m.x562 + m.x569 + m.x1258 == 0)
m.c1785 = Constraint(expr= - m.x430 + m.x458 + m.x465 + m.x472 - m.x528 + m.x556 + m.x563 + m.x570 + m.x1259 == 0)
m.c1786 = Constraint(expr= - m.x431 + m.x459 + m.x466 + m.x473 - m.x529 + m.x557 + m.x564 + m.x571 + m.x1260 == 0)
m.c1787 = Constraint(expr= - m.x432 + m.x460 + m.x467 + m.x474 - m.x530 + m.x558 + m.x565 + m.x572 + m.x1261 == 0)
m.c1788 = Constraint(expr= - m.x433 + m.x461 + m.x468 + m.x475 - m.x531 + m.x559 + m.x566 + m.x573 + m.x1262 == 20)
m.c1789 = Constraint(expr= - m.x434 + m.x462 + m.x469 + m.x476 - m.x532 + m.x560 + m.x567 + m.x574 + m.x1263 == 0)
m.c1790 = Constraint(expr= - m.x435 + m.x463 + m.x470 + m.x477 - m.x533 + m.x561 + m.x568 + m.x575 + m.x1264 == 0)
m.c1791 = Constraint(expr= - m.x436 + m.x478 + m.x485 - m.x534 + m.x576 + m.x583 + m.x1265 == 0)
m.c1792 = Constraint(expr= - m.x437 + m.x479 + m.x486 - m.x535 + m.x577 + m.x584 + m.x1266 == 0)
m.c1793 = Constraint(expr= - m.x438 + m.x480 + m.x487 - m.x536 + m.x578 + m.x585 + m.x1267 == 0)
m.c1794 = Constraint(expr= - m.x439 + m.x481 + m.x488 - m.x537 + m.x579 + m.x586 + m.x1268 == 0)
m.c1795 = Constraint(expr= - m.x440 + m.x482 + m.x489 - m.x538 + m.x580 + m.x587 + m.x1269 == 0)
m.c1796 = Constraint(expr= - m.x441 + m.x483 + m.x490 - m.x539 + m.x581 + m.x588 + m.x1270 == 20)
m.c1797 = Constraint(expr= - m.x442 + m.x484 + m.x491 - m.x540 + m.x582 + m.x589 + m.x1271 == 0)
m.c1798 = Constraint(expr= - m.x443 - m.x457 + m.x492 - m.x541 - m.x555 + m.x590 + m.x1272 == 0)
m.c1799 = Constraint(expr= - m.x444 - m.x458 + m.x493 - m.x542 - m.x556 + m.x591 + m.x1273 == 0)
m.c1800 = Constraint(expr= - m.x445 - m.x459 + m.x494 - m.x543 - m.x557 + m.x592 + m.x1274 == 0)
m.c1801 = Constraint(expr= - m.x446 - m.x460 + m.x495 - m.x544 - m.x558 + m.x593 + m.x1275 == 0)
m.c1802 = Constraint(expr= - m.x447 - m.x461 + m.x496 - m.x545 - m.x559 + m.x594 + m.x1276 == 0)
m.c1803 = Constraint(expr= - m.x448 - m.x462 + m.x497 - m.x546 - m.x560 + m.x595 + m.x1277 == 0)
m.c1804 = Constraint(expr= - m.x449 - m.x463 + m.x498 - m.x547 - m.x561 + m.x596 + m.x1278 == 30)
m.c1805 = Constraint(expr= - m.x450 - m.x464 - m.x478 + m.x499 + m.x506 - m.x548 - m.x562 - m.x576 + m.x597 + m.x604
+ m.x1279 == 0)
m.c1806 = Constraint(expr= - m.x451 - m.x465 - m.x479 + m.x500 + m.x507 - m.x549 - m.x563 - m.x577 + m.x598 + m.x605
+ m.x1280 == 0)
m.c1807 = Constraint(expr= - m.x452 - m.x466 - m.x480 + m.x501 + m.x508 - m.x550 - m.x564 - m.x578 + m.x599 + m.x606
+ m.x1281 == 0)
m.c1808 = Constraint(expr= - m.x453 - m.x467 - m.x481 + m.x502 + m.x509 - m.x551 - m.x565 - m.x579 + m.x600 + m.x607
+ m.x1282 == 0)
m.c1809 = Constraint(expr= - m.x454 - m.x468 - m.x482 + m.x503 + m.x510 - m.x552 - m.x566 - m.x580 + m.x601 + m.x608
+ m.x1283 == 50)
m.c1810 = Constraint(expr= - m.x455 - m.x469 - m.x483 + m.x504 + m.x511 - m.x553 - m.x567 - m.x581 + m.x602 + m.x609
+ m.x1284 == 0)
m.c1811 = Constraint(expr= - m.x456 - m.x470 - m.x484 + m.x505 + m.x512 - m.x554 - m.x568 - m.x582 + m.x603 + m.x610
+ m.x1285 == 0)
m.c1812 = Constraint(expr= - m.x471 - m.x485 + m.x513 - m.x569 - m.x583 + m.x611 + m.x1286 == 0)
m.c1813 = Constraint(expr= - m.x472 - m.x486 + m.x514 - m.x570 - m.x584 + m.x612 + m.x1287 == 0)
m.c1814 = Constraint(expr= - m.x473 - m.x487 + m.x515 - m.x571 - m.x585 + m.x613 + m.x1288 == 0)
m.c1815 = Constraint(expr= - m.x474 - m.x488 + m.x516 - m.x572 - m.x586 + m.x614 + m.x1289 == 0)
m.c1816 = Constraint(expr= - m.x475 - m.x489 + m.x517 - m.x573 - m.x587 + m.x615 + m.x1290 == 0)
m.c1817 = Constraint(expr= - m.x476 - m.x490 + m.x518 - m.x574 - m.x588 + m.x616 + m.x1291 == 30)
m.c1818 = Constraint(expr= - m.x477 - m.x491 + m.x519 - m.x575 - m.x589 + m.x617 + m.x1292 == 0)
m.c1819 = Constraint(expr= - m.x492 - m.x499 - m.x590 - m.x597 + m.x1293 == 0)
m.c1820 = Constraint(expr= - m.x493 - m.x500 - m.x591 - m.x598 + m.x1294 == 0)
m.c1821 = Constraint(expr= - m.x494 - m.x501 - m.x592 - m.x599 + m.x1295 == 0)
m.c1822 = Constraint(expr= - m.x495 - m.x502 - m.x593 - m.x600 + m.x1296 == 0)
m.c1823 = Constraint(expr= - m.x496 - m.x503 - m.x594 - m.x601 + m.x1297 == 0)
m.c1824 = Constraint(expr= - m.x497 - m.x504 - m.x595 - m.x602 + m.x1298 == 0)
m.c1825 = Constraint(expr= - m.x498 - m.x505 - m.x596 - m.x603 + m.x1299 == 0)
m.c1826 = Constraint(expr= - m.x506 - m.x513 - m.x604 - m.x611 + m.x1300 == 0)
m.c1827 = Constraint(expr= - m.x507 - m.x514 - m.x605 - m.x612 + m.x1301 == 0)
m.c1828 = Constraint(expr= - m.x508 - m.x515 - m.x606 - m.x613 + m.x1302 == 0)
m.c1829 = Constraint(expr= - m.x509 - m.x516 - m.x607 - m.x614 + m.x1303 == 0)
m.c1830 = Constraint(expr= - m.x510 - m.x517 - m.x608 - m.x615 + m.x1304 == 0)
m.c1831 = Constraint(expr= - m.x511 - m.x518 - m.x609 - m.x616 + m.x1305 == 0)
m.c1832 = Constraint(expr= - m.x512 - m.x519 - m.x610 - m.x617 + m.x1306 == 0)
m.c1833 = Constraint(expr= m.x422 + m.x520 + m.x618 + m.x1307 == 50)
m.c1834 = Constraint(expr= m.x423 + m.x521 + m.x619 + m.x1308 == 0)
m.c1835 = Constraint(expr= m.x424 + m.x522 + m.x620 + m.x1309 == 0)
m.c1836 = Constraint(expr= m.x425 + m.x523 + m.x621 + m.x1310 == 0)
m.c1837 = Constraint(expr= m.x426 + m.x524 + m.x622 + m.x1311 == 0)
m.c1838 = Constraint(expr= m.x427 + m.x525 + m.x623 + m.x1312 == 0)
m.c1839 = Constraint(expr= m.x428 + m.x526 + m.x624 + m.x1313 == 0)
m.c1840 = Constraint(expr= m.x429 + m.x527 + m.x625 + m.x1314 == 0)
m.c1841 = Constraint(expr= m.x430 + m.x528 + m.x626 + m.x1315 == 50)
m.c1842 = Constraint(expr= m.x431 + m.x529 + m.x627 + m.x1316 == 0)
m.c1843 = Constraint(expr= m.x432 + m.x530 + m.x628 + m.x1317 == 0)
m.c1844 = Constraint(expr= m.x433 + m.x531 + m.x629 + m.x1318 == 0)
m.c1845 = Constraint(expr= m.x434 + m.x532 + m.x630 + m.x1319 == 0)
m.c1846 = Constraint(expr= m.x435 + m.x533 + m.x631 + m.x1320 == 0)
m.c1847 = Constraint(expr= m.x436 + m.x534 + m.x632 + m.x1321 == 0)
m.c1848 = Constraint(expr= m.x437 + m.x535 + m.x633 + m.x1322 == 0)
m.c1849 = Constraint(expr= m.x438 + m.x536 + m.x634 + m.x1323 == 50)
m.c1850 = Constraint(expr= m.x439 + m.x537 + m.x635 + m.x1324 == 0)
m.c1851 = Constraint(expr= m.x440 + m.x538 + m.x636 + m.x1325 == 0)
m.c1852 = Constraint(expr= m.x441 + m.x539 + m.x637 + m.x1326 == 0)
m.c1853 = Constraint(expr= m.x442 + m.x540 + m.x638 + m.x1327 == 0)
m.c1854 = Constraint(expr= - m.x422 + m.x443 + m.x450 - m.x520 + m.x541 + m.x548 - m.x618 + m.x639 + m.x646 + m.x1328
== 0)
m.c1855 = Constraint(expr= - m.x423 + m.x444 + m.x451 - m.x521 + m.x542 + m.x549 - m.x619 + m.x640 + m.x647 + m.x1329
== 0)
m.c1856 = Constraint(expr= - m.x424 + m.x445 + m.x452 - m.x522 + m.x543 + m.x550 - m.x620 + m.x641 + m.x648 + m.x1330
== 0)
m.c1857 = Constraint(expr= - m.x425 + m.x446 + m.x453 - m.x523 + m.x544 + m.x551 - m.x621 + m.x642 + m.x649 + m.x1331
== 20)
m.c1858 = Constraint(expr= - m.x426 + m.x447 + m.x454 - m.x524 + m.x545 + m.x552 - m.x622 + m.x643 + m.x650 + m.x1332
== 0)
m.c1859 = Constraint(expr= - m.x427 + m.x448 + m.x455 - m.x525 + m.x546 + m.x553 - m.x623 + m.x644 + m.x651 + m.x1333
== 0)
m.c1860 = Constraint(expr= - m.x428 + m.x449 + m.x456 - m.x526 + m.x547 + m.x554 - m.x624 + m.x645 + m.x652 + m.x1334
== 0)
m.c1861 = Constraint(expr= - m.x429 + m.x457 + m.x464 + m.x471 - m.x527 + m.x555 + m.x562 + m.x569 - m.x625 + m.x653
+ m.x660 + m.x667 + m.x1335 == 0)
m.c1862 = Constraint(expr= - m.x430 + m.x458 + m.x465 + m.x472 - m.x528 + m.x556 + m.x563 + m.x570 - m.x626 + m.x654
+ m.x661 + m.x668 + m.x1336 == 0)
m.c1863 = Constraint(expr= - m.x431 + m.x459 + m.x466 + m.x473 - m.x529 + m.x557 + m.x564 + m.x571 - m.x627 + m.x655
+ m.x662 + m.x669 + m.x1337 == 0)
m.c1864 = Constraint(expr= - m.x432 + m.x460 + m.x467 + m.x474 - m.x530 + m.x558 + m.x565 + m.x572 - m.x628 + m.x656
+ m.x663 + m.x670 + m.x1338 == 0)
m.c1865 = Constraint(expr= - m.x433 + m.x461 + m.x468 + m.x475 - m.x531 + m.x559 + m.x566 + m.x573 - m.x629 + m.x657
+ m.x664 + m.x671 + m.x1339 == 20)
m.c1866 = Constraint(expr= - m.x434 + m.x462 + m.x469 + m.x476 - m.x532 + m.x560 + m.x567 + m.x574 - m.x630 + m.x658
+ m.x665 + m.x672 + m.x1340 == 0)
m.c1867 = Constraint(expr= - m.x435 + m.x463 + m.x470 + m.x477 - m.x533 + m.x561 + m.x568 + m.x575 - m.x631 + m.x659
+ m.x666 + m.x673 + m.x1341 == 0)
m.c1868 = Constraint(expr= - m.x436 + m.x478 + m.x485 - m.x534 + m.x576 + m.x583 - m.x632 + m.x674 + m.x681 + m.x1342
== 0)
m.c1869 = Constraint(expr= - m.x437 + m.x479 + m.x486 - m.x535 + m.x577 + m.x584 - m.x633 + m.x675 + m.x682 + m.x1343
== 0)
m.c1870 = Constraint(expr= - m.x438 + m.x480 + m.x487 - m.x536 + m.x578 + m.x585 - m.x634 + m.x676 + m.x683 + m.x1344
== 0)
m.c1871 = Constraint(expr= - m.x439 + m.x481 + m.x488 - m.x537 + m.x579 + m.x586 - m.x635 + m.x677 + m.x684 + m.x1345
== 0)
m.c1872 = Constraint(expr= - m.x440 + m.x482 + m.x489 - m.x538 + m.x580 + m.x587 - m.x636 + m.x678 + m.x685 + m.x1346
== 0)
m.c1873 = Constraint(expr= - m.x441 + m.x483 + m.x490 - m.x539 + m.x581 + m.x588 - m.x637 + m.x679 + m.x686 + m.x1347
== 20)
m.c1874 = Constraint(expr= - m.x442 + m.x484 + m.x491 - m.x540 + m.x582 + m.x589 - m.x638 + m.x680 + m.x687 + m.x1348
== 0)
m.c1875 = Constraint(expr= - m.x443 - m.x457 + m.x492 - m.x541 - m.x555 + m.x590 - m.x639 - m.x653 + m.x688 + m.x1349
== 0)
m.c1876 = Constraint(expr= - m.x444 - m.x458 + m.x493 - m.x542 - m.x556 + m.x591 - m.x640 - m.x654 + m.x689 + m.x1350
== 0)
m.c1877 = Constraint(expr= - m.x445 - m.x459 + m.x494 - m.x543 - m.x557 + m.x592 - m.x641 - m.x655 + m.x690 + m.x1351
== 0)
m.c1878 = Constraint(expr= - m.x446 - m.x460 + m.x495 - m.x544 - m.x558 + m.x593 - m.x642 - m.x656 + m.x691 + m.x1352
== 0)
m.c1879 = Constraint(expr= - m.x447 - m.x461 + m.x496 - m.x545 - m.x559 + m.x594 - m.x643 - m.x657 + m.x692 + m.x1353
== 0)
m.c1880 = Constraint(expr= - m.x448 - m.x462 + m.x497 - m.x546 - m.x560 + m.x595 - m.x644 - m.x658 + m.x693 + m.x1354
== 0)
m.c1881 = Constraint(expr= - m.x449 - m.x463 + m.x498 - m.x547 - m.x561 + m.x596 - m.x645 - m.x659 + m.x694 + m.x1355
== 30)
m.c1882 = Constraint(expr= - m.x450 - m.x464 - m.x478 + m.x499 + m.x506 - m.x548 - m.x562 - m.x576 + m.x597 + m.x604
- m.x646 - m.x660 - m.x674 + m.x695 + m.x702 + m.x1356 == 0)
m.c1883 = Constraint(expr= - m.x451 - m.x465 - m.x479 + m.x500 + m.x507 - m.x549 - m.x563 - m.x577 + m.x598 + m.x605
- m.x647 - m.x661 - m.x675 + m.x696 + m.x703 + m.x1357 == 0)
m.c1884 = Constraint(expr= - m.x452 - m.x466 - m.x480 + m.x501 + m.x508 - m.x550 - m.x564 - m.x578 + m.x599 + m.x606
- m.x648 - m.x662 - m.x676 + m.x697 + m.x704 + m.x1358 == 0)
m.c1885 = Constraint(expr= - m.x453 - m.x467 - m.x481 + m.x502 + m.x509 - m.x551 - m.x565 - m.x579 + m.x600 + m.x607
- m.x649 - m.x663 - m.x677 + m.x698 + m.x705 + m.x1359 == 0)
m.c1886 = Constraint(expr= - m.x454 - m.x468 - m.x482 + m.x503 + m.x510 - m.x552 - m.x566 - m.x580 + m.x601 + m.x608
- m.x650 - m.x664 - m.x678 + m.x699 + m.x706 + m.x1360 == 50)
m.c1887 = Constraint(expr= - m.x455 - m.x469 - m.x483 + m.x504 + m.x511 - m.x553 - m.x567 - m.x581 + m.x602 + m.x609
- m.x651 - m.x665 - m.x679 + m.x700 + m.x707 + m.x1361 == 0)
m.c1888 = Constraint(expr= - m.x456 - m.x470 - m.x484 + m.x505 + m.x512 - m.x554 - m.x568 - m.x582 + m.x603 + m.x610
- m.x652 - m.x666 - m.x680 + m.x701 + m.x708 + m.x1362 == 0)
m.c1889 = Constraint(expr= - m.x471 - m.x485 + m.x513 - m.x569 - m.x583 + m.x611 - m.x667 - m.x681 + m.x709 + m.x1363
== 0)
m.c1890 = Constraint(expr= - m.x472 - m.x486 + m.x514 - m.x570 - m.x584 + m.x612 - m.x668 - m.x682 + m.x710 + m.x1364
== 0)
m.c1891 = Constraint(expr= - m.x473 - m.x487 + m.x515 - m.x571 - m.x585 + m.x613 - m.x669 - m.x683 + m.x711 + m.x1365
== 0)
m.c1892 = Constraint(expr= - m.x474 - m.x488 + m.x516 - m.x572 - m.x586 + m.x614 - m.x670 - m.x684 + m.x712 + m.x1366
== 0)
m.c1893 = Constraint(expr= - m.x475 - m.x489 + m.x517 - m.x573 - m.x587 + m.x615 - m.x671 - m.x685 + m.x713 + m.x1367
== 0)
m.c1894 = Constraint(expr= - m.x476 - m.x490 + m.x518 - m.x574 - m.x588 + m.x616 - m.x672 - m.x686 + m.x714 + m.x1368
== 30)
m.c1895 = Constraint(expr= - m.x477 - m.x491 + m.x519 - m.x575 - m.x589 + m.x617 - m.x673 - m.x687 + m.x715 + m.x1369
== 0)
m.c1896 = Constraint(expr= - m.x492 - m.x499 - m.x590 - m.x597 - m.x688 - m.x695 + m.x1370 == 0)
m.c1897 = Constraint(expr= - m.x493 - m.x500 - m.x591 - m.x598 - m.x689 - m.x696 + m.x1371 == 0)
m.c1898 = Constraint(expr= - m.x494 - m.x501 - m.x592 - m.x599 - m.x690 - m.x697 + m.x1372 == 0)
m.c1899 = Constraint(expr= - m.x495 - m.x502 - m.x593 - m.x600 - m.x691 - m.x698 + m.x1373 == 0)
m.c1900 = Constraint(expr= - m.x496 - m.x503 - m.x594 - m.x601 - m.x692 - m.x699 + m.x1374 == 0)
m.c1901 = Constraint(expr= - m.x497 - m.x504 - m.x595 - m.x602 - m.x693 - m.x700 + m.x1375 == 0)
m.c1902 = Constraint(expr= - m.x498 - m.x505 - m.x596 - m.x603 - m.x694 - m.x701 + m.x1376 == 0)
m.c1903 = Constraint(expr= - m.x506 - m.x513 - m.x604 - m.x611 - m.x702 - m.x709 + m.x1377 == 0)
m.c1904 = Constraint(expr= - m.x507 - m.x514 - m.x605 - m.x612 - m.x703 - m.x710 + m.x1378 == 0)
m.c1905 = Constraint(expr= - m.x508 - m.x515 - m.x606 - m.x613 - m.x704 - m.x711 + m.x1379 == 0)
m.c1906 = Constraint(expr= - m.x509 - m.x516 - m.x607 - m.x614 - m.x705 - m.x712 + m.x1380 == 0)
m.c1907 = Constraint(expr= - m.x510 - m.x517 - m.x608 - m.x615 - m.x706 - m.x713 + m.x1381 == 0)
m.c1908 = Constraint(expr= - m.x511 - m.x518 - m.x609 - m.x616 - m.x707 - m.x714 + m.x1382 == 0)
m.c1909 = Constraint(expr= - m.x512 - m.x519 - m.x610 - m.x617 - m.x708 - m.x715 + m.x1383 == 0)
m.c1910 = Constraint(expr= m.x422 + m.x520 + m.x618 + m.x716 + m.x1384 == 50)
m.c1911 = Constraint(expr= m.x423 + m.x521 + m.x619 + m.x717 + m.x1385 == 0)
m.c1912 = Constraint(expr= m.x424 + m.x522 + m.x620 + m.x718 + m.x1386 == 0)
m.c1913 = Constraint(expr= m.x425 + m.x523 + m.x621 + m.x719 + m.x1387 == 0)
m.c1914 = Constraint(expr= m.x426 + m.x524 + m.x622 + m.x720 + m.x1388 == 0)
m.c1915 = Constraint(expr= m.x427 + m.x525 + m.x623 + m.x721 + m.x1389 == 0)
m.c1916 = Constraint(expr= m.x428 + m.x526 + m.x624 + m.x722 + m.x1390 == 0)
m.c1917 = Constraint(expr= m.x429 + m.x527 + m.x625 + m.x723 + m.x1391 == 0)
m.c1918 = Constraint(expr= m.x430 + m.x528 + m.x626 + m.x724 + m.x1392 == 50)
m.c1919 = Constraint(expr= m.x431 + m.x529 + m.x627 + m.x725 + m.x1393 == 0)
m.c1920 = Constraint(expr= m.x432 + m.x530 + m.x628 + m.x726 + m.x1394 == 0)
m.c1921 = Constraint(expr= m.x433 + m.x531 + m.x629 + m.x727 + m.x1395 == 0)
m.c1922 = Constraint(expr= m.x434 + m.x532 + m.x630 + m.x728 + m.x1396 == 0)
m.c1923 = Constraint(expr= m.x435 + m.x533 + m.x631 + m.x729 + m.x1397 == 0)
m.c1924 = Constraint(expr= m.x436 + m.x534 + m.x632 + m.x730 + m.x1398 == 0)
m.c1925 = Constraint(expr= m.x437 + m.x535 + m.x633 + m.x731 + m.x1399 == 0)
m.c1926 = Constraint(expr= m.x438 + m.x536 + m.x634 + m.x732 + m.x1400 == 50)
m.c1927 = Constraint(expr= m.x439 + m.x537 + m.x635 + m.x733 + m.x1401 == 0)
m.c1928 = Constraint(expr= m.x440 + m.x538 + m.x636 + m.x734 + m.x1402 == 0)
m.c1929 = Constraint(expr= m.x441 + m.x539 + m.x637 + m.x735 + m.x1403 == 0)
m.c1930 = Constraint(expr= m.x442 + m.x540 + m.x638 + m.x736 + m.x1404 == 0)
m.c1931 = Constraint(expr= - m.x422 + m.x443 + m.x450 - m.x520 + m.x541 + m.x548 - m.x618 + m.x639 + m.x646 - m.x716
+ m.x737 + m.x744 + m.x1405 == 0)
m.c1932 = Constraint(expr= - m.x423 + m.x444 + m.x451 - m.x521 + m.x542 + m.x549 - m.x619 + m.x640 + m.x647 - m.x717
+ m.x738 + m.x745 + m.x1406 == 0)
m.c1933 = Constraint(expr= - m.x424 + m.x445 + m.x452 - m.x522 + m.x543 + m.x550 - m.x620 + m.x641 + m.x648 - m.x718
+ m.x739 + m.x746 + m.x1407 == 0)
m.c1934 = Constraint(expr= - m.x425 + m.x446 + m.x453 - m.x523 + m.x544 + m.x551 - m.x621 + m.x642 + m.x649 - m.x719
+ m.x740 + m.x747 + m.x1408 == 20)
m.c1935 = Constraint(expr= - m.x426 + m.x447 + m.x454 - m.x524 + m.x545 + m.x552 - m.x622 + m.x643 + m.x650 - m.x720
+ m.x741 + m.x748 + m.x1409 == 0)
m.c1936 = Constraint(expr= - m.x427 + m.x448 + m.x455 - m.x525 + m.x546 + m.x553 - m.x623 + m.x644 + m.x651 - m.x721
+ m.x742 + m.x749 + m.x1410 == 0)
m.c1937 = Constraint(expr= - m.x428 + m.x449 + m.x456 - m.x526 + m.x547 + m.x554 - m.x624 + m.x645 + m.x652 - m.x722
+ m.x743 + m.x750 + m.x1411 == 0)
m.c1938 = Constraint(expr= - m.x429 + m.x457 + m.x464 + m.x471 - m.x527 + m.x555 + m.x562 + m.x569 - m.x625 + m.x653
+ m.x660 + m.x667 - m.x723 + m.x751 + m.x758 + m.x765 + m.x1412 == 0)
m.c1939 = Constraint(expr= - m.x430 + m.x458 + m.x465 + m.x472 - m.x528 + m.x556 + m.x563 + m.x570 - m.x626 + m.x654
+ m.x661 + m.x668 - m.x724 + m.x752 + m.x759 + m.x766 + m.x1413 == 0)
m.c1940 = Constraint(expr= - m.x431 + m.x459 + m.x466 + m.x473 - m.x529 + m.x557 + m.x564 + m.x571 - m.x627 + m.x655
+ m.x662 + m.x669 - m.x725 + m.x753 + m.x760 + m.x767 + m.x1414 == 0)
m.c1941 = Constraint(expr= - m.x432 + m.x460 + m.x467 + m.x474 - m.x530 + m.x558 + m.x565 + m.x572 - m.x628 + m.x656
+ m.x663 + m.x670 - m.x726 + m.x754 + m.x761 + m.x768 + m.x1415 == 0)
m.c1942 = Constraint(expr= - m.x433 + m.x461 + m.x468 + m.x475 - m.x531 + m.x559 + m.x566 + m.x573 - m.x629 + m.x657
+ m.x664 + m.x671 - m.x727 + m.x755 + m.x762 + m.x769 + m.x1416 == 20)
m.c1943 = Constraint(expr= - m.x434 + m.x462 + m.x469 + m.x476 - m.x532 + m.x560 + m.x567 + m.x574 - m.x630 + m.x658
+ m.x665 + m.x672 - m.x728 + m.x756 + m.x763 + m.x770 + m.x1417 == 0)
m.c1944 = Constraint(expr= - m.x435 + m.x463 + m.x470 + m.x477 - m.x533 + m.x561 + m.x568 + m.x575 - m.x631 + m.x659
+ m.x666 + m.x673 - m.x729 + m.x757 + m.x764 + m.x771 + m.x1418 == 0)
m.c1945 = Constraint(expr= - m.x436 + m.x478 + m.x485 - m.x534 + m.x576 + m.x583 - m.x632 + m.x674 + m.x681 - m.x730
+ m.x772 + m.x779 + m.x1419 == 0)
m.c1946 = Constraint(expr= - m.x437 + m.x479 + m.x486 - m.x535 + m.x577 + m.x584 - m.x633 + m.x675 + m.x682 - m.x731
+ m.x773 + m.x780 + m.x1420 == 0)
m.c1947 = Constraint(expr= - m.x438 + m.x480 + m.x487 - m.x536 + m.x578 + m.x585 - m.x634 + m.x676 + m.x683 - m.x732
+ m.x774 + m.x781 + m.x1421 == 0)
m.c1948 = Constraint(expr= - m.x439 + m.x481 + m.x488 - m.x537 + m.x579 + m.x586 - m.x635 + m.x677 + m.x684 - m.x733
+ m.x775 + m.x782 + m.x1422 == 0)
m.c1949 = Constraint(expr= - m.x440 + m.x482 + m.x489 - m.x538 + m.x580 + m.x587 - m.x636 + m.x678 + m.x685 - m.x734
+ m.x776 + m.x783 + m.x1423 == 0)
m.c1950 = Constraint(expr= - m.x441 + m.x483 + m.x490 - m.x539 + m.x581 + m.x588 - m.x637 + m.x679 + m.x686 - m.x735
+ m.x777 + m.x784 + m.x1424 == 20)
m.c1951 = Constraint(expr= - m.x442 + m.x484 + m.x491 - m.x540 + m.x582 + m.x589 - m.x638 + m.x680 + m.x687 - m.x736
+ m.x778 + m.x785 + m.x1425 == 0)
m.c1952 = Constraint(expr= - m.x443 - m.x457 + m.x492 - m.x541 - m.x555 + m.x590 - m.x639 - m.x653 + m.x688 - m.x737
- m.x751 + m.x786 + m.x1426 == 0)
m.c1953 = Constraint(expr= - m.x444 - m.x458 + m.x493 - m.x542 - m.x556 + m.x591 - m.x640 - m.x654 + m.x689 - m.x738
- m.x752 + m.x787 + m.x1427 == 0)
m.c1954 = Constraint(expr= - m.x445 - m.x459 + m.x494 - m.x543 - m.x557 + m.x592 - m.x641 - m.x655 + m.x690 - m.x739
- m.x753 + m.x788 + m.x1428 == 0)
m.c1955 = Constraint(expr= - m.x446 - m.x460 + m.x495 - m.x544 - m.x558 + m.x593 - m.x642 - m.x656 + m.x691 - m.x740
- m.x754 + m.x789 + m.x1429 == 0)
m.c1956 = Constraint(expr= - m.x447 - m.x461 + m.x496 - m.x545 - m.x559 + m.x594 - m.x643 - m.x657 + m.x692 - m.x741
- m.x755 + m.x790 + m.x1430 == 0)
m.c1957 = Constraint(expr= - m.x448 - m.x462 + m.x497 - m.x546 - m.x560 + m.x595 - m.x644 - m.x658 + m.x693 - m.x742
- m.x756 + m.x791 + m.x1431 == 0)
m.c1958 = Constraint(expr= - m.x449 - m.x463 + m.x498 - m.x547 - m.x561 + m.x596 - m.x645 - m.x659 + m.x694 - m.x743
- m.x757 + m.x792 + m.x1432 == 30)
m.c1959 = Constraint(expr= - m.x450 - m.x464 - m.x478 + m.x499 + m.x506 - m.x548 - m.x562 - m.x576 + m.x597 + m.x604
- m.x646 - m.x660 - m.x674 + m.x695 + m.x702 - m.x744 - m.x758 - m.x772 + m.x793 + m.x800
+ m.x1433 == 0)
m.c1960 = Constraint(expr= - m.x451 - m.x465 - m.x479 + m.x500 + m.x507 - m.x549 - m.x563 - m.x577 + m.x598 + m.x605
- m.x647 - m.x661 - m.x675 + m.x696 + m.x703 - m.x745 - m.x759 - m.x773 + m.x794 + m.x801
+ m.x1434 == 0)
m.c1961 = Constraint(expr= - m.x452 - m.x466 - m.x480 + m.x501 + m.x508 - m.x550 - m.x564 - m.x578 + m.x599 + m.x606
- m.x648 - m.x662 - m.x676 + m.x697 + m.x704 - m.x746 - m.x760 - m.x774 + m.x795 + m.x802
+ m.x1435 == 0)
m.c1962 = Constraint(expr= - m.x453 - m.x467 - m.x481 + m.x502 + m.x509 - m.x551 - m.x565 - m.x579 + m.x600 + m.x607
- m.x649 - m.x663 - m.x677 + m.x698 + m.x705 - m.x747 - m.x761 - m.x775 + m.x796 + m.x803
+ m.x1436 == 0)
m.c1963 = Constraint(expr= - m.x454 - m.x468 - m.x482 + m.x503 + m.x510 - m.x552 - m.x566 - m.x580 + m.x601 + m.x608
- m.x650 - m.x664 - m.x678 + m.x699 + m.x706 - m.x748 - m.x762 - m.x776 + m.x797 + m.x804
+ m.x1437 == 50)
m.c1964 = Constraint(expr= - m.x455 - m.x469 - m.x483 + m.x504 + m.x511 - m.x553 - m.x567 - m.x581 + m.x602 + m.x609
- m.x651 - m.x665 - m.x679 + m.x700 + m.x707 - m.x749 - m.x763 - m.x777 + m.x798 + m.x805
+ m.x1438 == 0)
m.c1965 = Constraint(expr= - m.x456 - m.x470 - m.x484 + m.x505 + m.x512 - m.x554 - m.x568 - m.x582 + m.x603 + m.x610
- m.x652 - m.x666 - m.x680 + m.x701 + m.x708 - m.x750 - m.x764 - m.x778 + m.x799 + m.x806
+ m.x1439 == 0)
m.c1966 = Constraint(expr= - m.x471 - m.x485 + m.x513 - m.x569 - m.x583 + m.x611 - m.x667 - m.x681 + m.x709 - m.x765
- m.x779 + m.x807 + m.x1440 == 0)
m.c1967 = Constraint(expr= - m.x472 - m.x486 + m.x514 - m.x570 - m.x584 + m.x612 - m.x668 - m.x682 + m.x710 - m.x766
- m.x780 + m.x808 + m.x1441 == 0)
m.c1968 = Constraint(expr= - m.x473 - m.x487 + m.x515 - m.x571 - m.x585 + m.x613 - m.x669 - m.x683 + m.x711 - m.x767
- m.x781 + m.x809 + m.x1442 == 0)
m.c1969 = Constraint(expr= - m.x474 - m.x488 + m.x516 - m.x572 - m.x586 + m.x614 - m.x670 - m.x684 + m.x712 - m.x768
- m.x782 + m.x810 + m.x1443 == 0)
m.c1970 = Constraint(expr= - m.x475 - m.x489 + m.x517 - m.x573 - m.x587 + m.x615 - m.x671 - m.x685 + m.x713 - m.x769
- m.x783 + m.x811 + m.x1444 == 0)
m.c1971 = Constraint(expr= - m.x476 - m.x490 + m.x518 - m.x574 - m.x588 + m.x616 - m.x672 - m.x686 + m.x714 - m.x770
- m.x784 + m.x812 + m.x1445 == 30)
m.c1972 = Constraint(expr= - m.x477 - m.x491 + m.x519 - m.x575 - m.x589 + m.x617 - m.x673 - m.x687 + m.x715 - m.x771
- m.x785 + m.x813 + m.x1446 == 0)
m.c1973 = Constraint(expr= - m.x492 - m.x499 - m.x590 - m.x597 - m.x688 - m.x695 - m.x786 - m.x793 + m.x1447 == 0)
m.c1974 = Constraint(expr= - m.x493 - m.x500 - m.x591 - m.x598 - m.x689 - m.x696 - m.x787 - m.x794 + m.x1448 == 0)
m.c1975 = Constraint(expr= - m.x494 - m.x501 - m.x592 - m.x599 - m.x690 - m.x697 - m.x788 - m.x795 + m.x1449 == 0)
m.c1976 = Constraint(expr= - m.x495 - m.x502 - m.x593 - m.x600 - m.x691 - m.x698 - m.x789 - m.x796 + m.x1450 == 0)
m.c1977 = Constraint(expr= - m.x496 - m.x503 - m.x594 - m.x601 - m.x692 - m.x699 - m.x790 - m.x797 + m.x1451 == 0)
m.c1978 = Constraint(expr= - m.x497 - m.x504 - m.x595 - m.x602 - m.x693 - m.x700 - m.x791 - m.x798 + m.x1452 == 0)
m.c1979 = Constraint(expr= - m.x498 - m.x505 - m.x596 - m.x603 - m.x694 - m.x701 - m.x792 - m.x799 + m.x1453 == 0)
m.c1980 = Constraint(expr= - m.x506 - m.x513 - m.x604 - m.x611 - m.x702 - m.x709 - m.x800 - m.x807 + m.x1454 == 0)
m.c1981 = Constraint(expr= - m.x507 - m.x514 - m.x605 - m.x612 - m.x703 - m.x710 - m.x801 - m.x808 + m.x1455 == 0)
m.c1982 = Constraint(expr= - m.x508 - m.x515 - m.x606 - m.x613 - m.x704 - m.x711 - m.x802 - m.x809 + m.x1456 == 0)
m.c1983 = Constraint(expr= - m.x509 - m.x516 - m.x607 - m.x614 - m.x705 - m.x712 - m.x803 - m.x810 + m.x1457 == 0)
m.c1984 = Constraint(expr= - m.x510 - m.x517 - m.x608 - m.x615 - m.x706 - m.x713 - m.x804 - m.x811 + m.x1458 == 0)
m.c1985 = Constraint(expr= - m.x511 - m.x518 - m.x609 - m.x616 - m.x707 - m.x714 - m.x805 - m.x812 + m.x1459 == 0)
m.c1986 = Constraint(expr= - m.x512 - m.x519 - m.x610 - m.x617 - m.x708 - m.x715 - m.x806 - m.x813 + m.x1460 == 0)
m.c1987 = Constraint(expr= m.x422 + m.x520 + m.x618 + m.x716 + m.x814 + m.x1461 == 50)
m.c1988 = Constraint(expr= m.x423 + m.x521 + m.x619 + m.x717 + m.x815 + m.x1462 == 0)
m.c1989 = Constraint(expr= m.x424 + m.x522 + m.x620 + m.x718 + m.x816 + m.x1463 == 0)
m.c1990 = Constraint(expr= m.x425 + m.x523 + m.x621 + m.x719 + m.x817 + m.x1464 == 0)
m.c1991 = Constraint(expr= m.x426 + m.x524 + m.x622 + m.x720 + m.x818 + m.x1465 == 0)
m.c1992 = Constraint(expr= m.x427 + m.x525 + m.x623 + m.x721 + m.x819 + m.x1466 == 0)
m.c1993 = Constraint(expr= m.x428 + m.x526 + m.x624 + m.x722 + m.x820 + m.x1467 == 0)
m.c1994 = Constraint(expr= m.x429 + m.x527 + m.x625 + m.x723 + m.x821 + m.x1468 == 0)
m.c1995 = Constraint(expr= m.x430 + m.x528 + m.x626 + m.x724 + m.x822 + m.x1469 == 50)
m.c1996 = Constraint(expr= m.x431 + m.x529 + m.x627 + m.x725 + m.x823 + m.x1470 == 0)
m.c1997 = Constraint(expr= m.x432 + m.x530 + m.x628 + m.x726 + m.x824 + m.x1471 == 0)
m.c1998 = Constraint(expr= m.x433 + m.x531 + m.x629 + m.x727 + m.x825 + m.x1472 == 0)
m.c1999 = Constraint(expr= m.x434 + m.x532 + m.x630 + m.x728 + m.x826 + m.x1473 == 0)
m.c2000 = Constraint(expr= m.x435 + m.x533 + m.x631 + m.x729 + m.x827 + m.x1474 == 0)
m.c2001 = Constraint(expr= m.x436 + m.x534 + m.x632 + m.x730 + m.x828 + m.x1475 == 0)
m.c2002 = Constraint(expr= m.x437 + m.x535 + m.x633 + m.x731 + m.x829 + m.x1476 == 0)
m.c2003 = Constraint(expr= m.x438 + m.x536 + m.x634 + m.x732 + m.x830 + m.x1477 == 50)
m.c2004 = Constraint(expr= m.x439 + m.x537 + m.x635 + m.x733 + m.x831 + m.x1478 == 0)
m.c2005 = Constraint(expr= m.x440 + m.x538 + m.x636 + m.x734 + m.x832 + m.x1479 == 0)
m.c2006 = Constraint(expr= m.x441 + m.x539 + m.x637 + m.x735 + m.x833 + m.x1480 == 0)
m.c2007 = Constraint(expr= m.x442 + m.x540 + m.x638 + m.x736 + m.x834 + m.x1481 == 0)
m.c2008 = Constraint(expr= - m.x422 + m.x443 + m.x450 - m.x520 + m.x541 + m.x548 - m.x618 + m.x639 + m.x646 - m.x716
+ m.x737 + m.x744 - m.x814 + m.x835 + m.x842 + m.x1482 == 0)
m.c2009 = Constraint(expr= - m.x423 + m.x444 + m.x451 - m.x521 + m.x542 + m.x549 - m.x619 + m.x640 + m.x647 - m.x717
+ m.x738 + m.x745 - m.x815 + m.x836 + m.x843 + m.x1483 == 0)
m.c2010 = Constraint(expr= - m.x424 + m.x445 + m.x452 - m.x522 + m.x543 + m.x550 - m.x620 + m.x641 + m.x648 - m.x718
+ m.x739 + m.x746 - m.x816 + m.x837 + m.x844 + m.x1484 == 0)
m.c2011 = Constraint(expr= - m.x425 + m.x446 + m.x453 - m.x523 + m.x544 + m.x551 - m.x621 + m.x642 + m.x649 - m.x719
+ m.x740 + m.x747 - m.x817 + m.x838 + m.x845 + m.x1485 == 20)
m.c2012 = Constraint(expr= - m.x426 + m.x447 + m.x454 - m.x524 + m.x545 + m.x552 - m.x622 + m.x643 + m.x650 - m.x720
+ m.x741 + m.x748 - m.x818 + m.x839 + m.x846 + m.x1486 == 0)
m.c2013 = Constraint(expr= - m.x427 + m.x448 + m.x455 - m.x525 + m.x546 + m.x553 - m.x623 + m.x644 + m.x651 - m.x721
+ m.x742 + m.x749 - m.x819 + m.x840 + m.x847 + m.x1487 == 0)
m.c2014 = Constraint(expr= - m.x428 + m.x449 + m.x456 - m.x526 + m.x547 + m.x554 - m.x624 + m.x645 + m.x652 - m.x722
+ m.x743 + m.x750 - m.x820 + m.x841 + m.x848 + m.x1488 == 0)
m.c2015 = Constraint(expr= - m.x429 + m.x457 + m.x464 + m.x471 - m.x527 + m.x555 + m.x562 + m.x569 - m.x625 + m.x653
+ m.x660 + m.x667 - m.x723 + m.x751 + m.x758 + m.x765 - m.x821 + m.x849 + m.x856 + m.x863
+ m.x1489 == 0)
m.c2016 = Constraint(expr= - m.x430 + m.x458 + m.x465 + m.x472 - m.x528 + m.x556 + m.x563 + m.x570 - m.x626 + m.x654
+ m.x661 + m.x668 - m.x724 + m.x752 + m.x759 + m.x766 - m.x822 + m.x850 + m.x857 + m.x864
+ m.x1490 == 0)
m.c2017 = Constraint(expr= - m.x431 + m.x459 + m.x466 + m.x473 - m.x529 + m.x557 + m.x564 + m.x571 - m.x627 + m.x655
+ m.x662 + m.x669 - m.x725 + m.x753 + m.x760 + m.x767 - m.x823 + m.x851 + m.x858 + m.x865
+ m.x1491 == 0)
m.c2018 = Constraint(expr= - m.x432 + m.x460 + m.x467 + m.x474 - m.x530 + m.x558 + m.x565 + m.x572 - m.x628 + m.x656
+ m.x663 + m.x670 - m.x726 + m.x754 + m.x761 + m.x768 - m.x824 + m.x852 + m.x859 + m.x866
+ m.x1492 == 0)
m.c2019 = Constraint(expr= - m.x433 + m.x461 + m.x468 + m.x475 - m.x531 + m.x559 + m.x566 + m.x573 - m.x629 + m.x657
+ m.x664 + m.x671 - m.x727 + m.x755 + m.x762 + m.x769 - m.x825 + m.x853 + m.x860 + m.x867
+ m.x1493 == 20)
m.c2020 = Constraint(expr= - m.x434 + m.x462 + m.x469 + m.x476 - m.x532 + m.x560 + m.x567 + m.x574 - m.x630 + m.x658
+ m.x665 + m.x672 - m.x728 + m.x756 + m.x763 + m.x770 - m.x826 + m.x854 + m.x861 + m.x868
+ m.x1494 == 0)
m.c2021 = Constraint(expr= - m.x435 + m.x463 + m.x470 + m.x477 - m.x533 + m.x561 + m.x568 + m.x575 - m.x631 + m.x659
+ m.x666 + m.x673 - m.x729 + m.x757 + m.x764 + m.x771 - m.x827 + m.x855 + m.x862 + m.x869
+ m.x1495 == 0)
m.c2022 = Constraint(expr= - m.x436 + m.x478 + m.x485 - m.x534 + m.x576 + m.x583 - m.x632 + m.x674 + m.x681 - m.x730
+ m.x772 + m.x779 - m.x828 + m.x870 + m.x877 + m.x1496 == 0)
m.c2023 = Constraint(expr= - m.x437 + m.x479 + m.x486 - m.x535 + m.x577 + m.x584 - m.x633 + m.x675 + m.x682 - m.x731
+ m.x773 + m.x780 - m.x829 + m.x871 + m.x878 + m.x1497 == 0)
m.c2024 = Constraint(expr= - m.x438 + m.x480 + m.x487 - m.x536 + m.x578 + m.x585 - m.x634 + m.x676 + m.x683 - m.x732
+ m.x774 + m.x781 - m.x830 + m.x872 + m.x879 + m.x1498 == 0)
m.c2025 = Constraint(expr= - m.x439 + m.x481 + m.x488 - m.x537 + m.x579 + m.x586 - m.x635 + m.x677 + m.x684 - m.x733
+ m.x775 + m.x782 - m.x831 + m.x873 + m.x880 + m.x1499 == 0)
m.c2026 = Constraint(expr= - m.x440 + m.x482 + m.x489 - m.x538 + m.x580 + m.x587 - m.x636 + m.x678 + m.x685 - m.x734
+ m.x776 + m.x783 - m.x832 + m.x874 + m.x881 + m.x1500 == 0)
m.c2027 = Constraint(expr= - m.x441 + m.x483 + m.x490 - m.x539 + m.x581 + m.x588 - m.x637 + m.x679 + m.x686 - m.x735
+ m.x777 + m.x784 - m.x833 + m.x875 + m.x882 + m.x1501 == 20)
m.c2028 = Constraint(expr= - m.x442 + m.x484 + m.x491 - m.x540 + m.x582 + m.x589 - m.x638 + m.x680 + m.x687 - m.x736
+ m.x778 + m.x785 - m.x834 + m.x876 + m.x883 + m.x1502 == 0)
m.c2029 = Constraint(expr= - m.x443 - m.x457 + m.x492 - m.x541 - m.x555 + m.x590 - m.x639 - m.x653 + m.x688 - m.x737
- m.x751 + m.x786 - m.x835 - m.x849 + m.x884 + m.x1503 == 0)
m.c2030 = Constraint(expr= - m.x444 - m.x458 + m.x493 - m.x542 - m.x556 + m.x591 - m.x640 - m.x654 + m.x689 - m.x738
- m.x752 + m.x787 - m.x836 - m.x850 + m.x885 + m.x1504 == 0)
m.c2031 = Constraint(expr= - m.x445 - m.x459 + m.x494 - m.x543 - m.x557 + m.x592 - m.x641 - m.x655 + m.x690 - m.x739
- m.x753 + m.x788 - m.x837 - m.x851 + m.x886 + m.x1505 == 0)
m.c2032 = Constraint(expr= - m.x446 - m.x460 + m.x495 - m.x544 - m.x558 + m.x593 - m.x642 - m.x656 + m.x691 - m.x740
- m.x754 + m.x789 - m.x838 - m.x852 + m.x887 + m.x1506 == 0)
m.c2033 = Constraint(expr= - m.x447 - m.x461 + m.x496 - m.x545 - m.x559 + m.x594 - m.x643 - m.x657 + m.x692 - m.x741
- m.x755 + m.x790 - m.x839 - m.x853 + m.x888 + m.x1507 == 0)
m.c2034 = Constraint(expr= - m.x448 - m.x462 + m.x497 - m.x546 - m.x560 + m.x595 - m.x644 - m.x658 + m.x693 - m.x742
- m.x756 + m.x791 - m.x840 - m.x854 + m.x889 + m.x1508 == 0)
m.c2035 = Constraint(expr= - m.x449 - m.x463 + m.x498 - m.x547 - m.x561 + m.x596 - m.x645 - m.x659 + m.x694 - m.x743
- m.x757 + m.x792 - m.x841 - m.x855 + m.x890 + m.x1509 == 30)
m.c2036 = Constraint(expr= - m.x450 - m.x464 - m.x478 + m.x499 + m.x506 - m.x548 - m.x562 - m.x576 + m.x597 + m.x604
- m.x646 - m.x660 - m.x674 + m.x695 + m.x702 - m.x744 - m.x758 - m.x772 + m.x793 + m.x800
- m.x842 - m.x856 - m.x870 + m.x891 + m.x898 + m.x1510 == 0)
m.c2037 = Constraint(expr= - m.x451 - m.x465 - m.x479 + m.x500 + m.x507 - m.x549 - m.x563 - m.x577 + m.x598 + m.x605
- m.x647 - m.x661 - m.x675 + m.x696 + m.x703 - m.x745 - m.x759 - m.x773 + m.x794 + m.x801
- m.x843 - m.x857 - m.x871 + m.x892 + m.x899 + m.x1511 == 0)
m.c2038 = Constraint(expr= - m.x452 - m.x466 - m.x480 + m.x501 + m.x508 - m.x550 - m.x564 - m.x578 + m.x599 + m.x606
- m.x648 - m.x662 - m.x676 + m.x697 + m.x704 - m.x746 - m.x760 - m.x774 + m.x795 + m.x802
- m.x844 - m.x858 - m.x872 + m.x893 + m.x900 + m.x1512 == 0)
m.c2039 = Constraint(expr= - m.x453 - m.x467 - m.x481 + m.x502 + m.x509 - m.x551 - m.x565 - m.x579 + m.x600 + m.x607
- m.x649 - m.x663 - m.x677 + m.x698 + m.x705 - m.x747 - m.x761 - m.x775 + m.x796 + m.x803
- m.x845 - m.x859 - m.x873 + m.x894 + m.x901 + m.x1513 == 0)
m.c2040 = Constraint(expr= - m.x454 - m.x468 - m.x482 + m.x503 + m.x510 - m.x552 - m.x566 - m.x580 + m.x601 + m.x608
- m.x650 - m.x664 - m.x678 + m.x699 + m.x706 - m.x748 - m.x762 - m.x776 + m.x797 + m.x804
- m.x846 - m.x860 - m.x874 + m.x895 + m.x902 + m.x1514 == 50)
m.c2041 = Constraint(expr= - m.x455 - m.x469 - m.x483 + m.x504 + m.x511 - m.x553 - m.x567 - m.x581 + m.x602 + m.x609
- m.x651 - m.x665 - m.x679 + m.x700 + m.x707 - m.x749 - m.x763 - m.x777 + m.x798 + m.x805
- m.x847 - m.x861 - m.x875 + m.x896 + m.x903 + m.x1515 == 0)
m.c2042 = Constraint(expr= - m.x456 - m.x470 - m.x484 + m.x505 + m.x512 - m.x554 - m.x568 - m.x582 + m.x603 + m.x610
- m.x652 - m.x666 - m.x680 + m.x701 + m.x708 - m.x750 - m.x764 - m.x778 + m.x799 + m.x806
- m.x848 - m.x862 - m.x876 + m.x897 + m.x904 + m.x1516 == 0)
m.c2043 = Constraint(expr= - m.x471 - m.x485 + m.x513 - m.x569 - m.x583 + m.x611 - m.x667 - m.x681 + m.x709 - m.x765
- m.x779 + m.x807 - m.x863 - m.x877 + m.x905 + m.x1517 == 0)
m.c2044 = Constraint(expr= - m.x472 - m.x486 + m.x514 - m.x570 - m.x584 + m.x612 - m.x668 - m.x682 + m.x710 - m.x766
- m.x780 + m.x808 - m.x864 - m.x878 + m.x906 + m.x1518 == 0)
m.c2045 = Constraint(expr= - m.x473 - m.x487 + m.x515 - m.x571 - m.x585 + m.x613 - m.x669 - m.x683 + m.x711 - m.x767
- m.x781 + m.x809 - m.x865 - m.x879 + m.x907 + m.x1519 == 0)
m.c2046 = Constraint(expr= - m.x474 - m.x488 + m.x516 - m.x572 - m.x586 + m.x614 - m.x670 - m.x684 + m.x712 - m.x768
- m.x782 + m.x810 - m.x866 - m.x880 + m.x908 + m.x1520 == 0)
m.c2047 = Constraint(expr= - m.x475 - m.x489 + m.x517 - m.x573 - m.x587 + m.x615 - m.x671 - m.x685 + m.x713 - m.x769
- m.x783 + m.x811 - m.x867 - m.x881 + m.x909 + m.x1521 == 0)
m.c2048 = Constraint(expr= - m.x476 - m.x490 + m.x518 - m.x574 - m.x588 + m.x616 - m.x672 - m.x686 + m.x714 - m.x770
- m.x784 + m.x812 - m.x868 - m.x882 + m.x910 + m.x1522 == 30)
m.c2049 = Constraint(expr= - m.x477 - m.x491 + m.x519 - m.x575 - m.x589 + m.x617 - m.x673 - m.x687 + m.x715 - m.x771
- m.x785 + m.x813 - m.x869 - m.x883 + m.x911 + m.x1523 == 0)
m.c2050 = Constraint(expr= - m.x492 - m.x499 - m.x590 - m.x597 - m.x688 - m.x695 - m.x786 - m.x793 - m.x884 - m.x891
+ m.x1524 == 0)
m.c2051 = Constraint(expr= - m.x493 - m.x500 - m.x591 - m.x598 - m.x689 - m.x696 - m.x787 - m.x794 - m.x885 - m.x892
+ m.x1525 == 0)
m.c2052 = Constraint(expr= - m.x494 - m.x501 - m.x592 - m.x599 - m.x690 - m.x697 - m.x788 - m.x795 - m.x886 - m.x893
+ m.x1526 == 0)
m.c2053 = Constraint(expr= - m.x495 - m.x502 - m.x593 - m.x600 - m.x691 - m.x698 - m.x789 - m.x796 - m.x887 - m.x894
+ m.x1527 == 0)
m.c2054 = Constraint(expr= - m.x496 - m.x503 - m.x594 - m.x601 - m.x692 - m.x699 - m.x790 - m.x797 - m.x888 - m.x895
+ m.x1528 == 0)
m.c2055 = Constraint(expr= - m.x497 - m.x504 - m.x595 - m.x602 - m.x693 - m.x700 - m.x791 - m.x798 - m.x889 - m.x896
+ m.x1529 == 0)
m.c2056 = Constraint(expr= - m.x498 - m.x505 - m.x596 - m.x603 - m.x694 - m.x701 - m.x792 - m.x799 - m.x890 - m.x897
+ m.x1530 == 0)
m.c2057 = Constraint(expr= - m.x506 - m.x513 - m.x604 - m.x611 - m.x702 - m.x709 - m.x800 - m.x807 - m.x898 - m.x905
+ m.x1531 == 0)
m.c2058 = Constraint(expr= - m.x507 - m.x514 - m.x605 - m.x612 - m.x703 - m.x710 - m.x801 - m.x808 - m.x899 - m.x906
+ m.x1532 == 0)
m.c2059 = Constraint(expr= - m.x508 - m.x515 - m.x606 - m.x613 - m.x704 - m.x711 - m.x802 - m.x809 - m.x900 - m.x907
+ m.x1533 == 0)
m.c2060 = Constraint(expr= - m.x509 - m.x516 - m.x607 - m.x614 - m.x705 - m.x712 - m.x803 - m.x810 - m.x901 - m.x908
+ m.x1534 == 0)
m.c2061 = Constraint(expr= - m.x510 - m.x517 - m.x608 - m.x615 - m.x706 - m.x713 - m.x804 - m.x811 - m.x902 - m.x909
+ m.x1535 == 0)
m.c2062 = Constraint(expr= - m.x511 - m.x518 - m.x609 - m.x616 - m.x707 - m.x714 - m.x805 - m.x812 - m.x903 - m.x910
+ m.x1536 == 0)
m.c2063 = Constraint(expr= - m.x512 - m.x519 - m.x610 - m.x617 - m.x708 - m.x715 - m.x806 - m.x813 - m.x904 - m.x911
+ m.x1537 == 0)
m.c2064 = Constraint(expr=m.x338*m.x1076 - m.x422*m.x1010 == 0)
m.c2065 = Constraint(expr=m.x338*m.x1077 - m.x423*m.x1010 == 0)
m.c2066 = Constraint(expr=m.x338*m.x1078 - m.x424*m.x1010 == 0)
m.c2067 = Constraint(expr=m.x338*m.x1079 - m.x425*m.x1010 == 0)
m.c2068 = Constraint(expr=m.x338*m.x1080 - m.x426*m.x1010 == 0)
m.c2069 = Constraint(expr=m.x338*m.x1081 - m.x427*m.x1010 == 0)
m.c2070 = Constraint(expr=m.x338*m.x1082 - m.x428*m.x1010 == 0)
m.c2071 = Constraint(expr=m.x339*m.x1083 - m.x429*m.x1011 == 0)
m.c2072 = Constraint(expr=m.x339*m.x1084 - m.x430*m.x1011 == 0)
m.c2073 = Constraint(expr=m.x339*m.x1085 - m.x431*m.x1011 == 0)
m.c2074 = Constraint(expr=m.x339*m.x1086 - m.x432*m.x1011 == 0)
m.c2075 = Constraint(expr=m.x339*m.x1087 - m.x433*m.x1011 == 0)
m.c2076 = Constraint(expr=m.x339*m.x1088 - m.x434*m.x1011 == 0)
m.c2077 = Constraint(expr=m.x339*m.x1089 - m.x435*m.x1011 == 0)
m.c2078 = Constraint(expr=m.x340*m.x1090 - m.x436*m.x1012 == 0)
m.c2079 = Constraint(expr=m.x340*m.x1091 - m.x437*m.x1012 == 0)
m.c2080 = Constraint(expr=m.x340*m.x1092 - m.x438*m.x1012 == 0)
m.c2081 = Constraint(expr=m.x340*m.x1093 - m.x439*m.x1012 == 0)
m.c2082 = Constraint(expr=m.x340*m.x1094 - m.x440*m.x1012 == 0)
m.c2083 = Constraint(expr=m.x340*m.x1095 - m.x441*m.x1012 == 0)
m.c2084 = Constraint(expr=m.x340*m.x1096 - m.x442*m.x1012 == 0)
m.c2085 = Constraint(expr=m.x341*m.x1097 - m.x443*m.x1013 == 0)
m.c2086 = Constraint(expr=m.x341*m.x1098 - m.x444*m.x1013 == 0)
m.c2087 = Constraint(expr=m.x341*m.x1099 - m.x445*m.x1013 == 0)
m.c2088 = Constraint(expr=m.x341*m.x1100 - m.x446*m.x1013 == 0)
m.c2089 = Constraint(expr=m.x341*m.x1101 - m.x447*m.x1013 == 0)
m.c2090 = Constraint(expr=m.x341*m.x1102 - m.x448*m.x1013 == 0)
m.c2091 = Constraint(expr=m.x341*m.x1103 - m.x449*m.x1013 == 0)
m.c2092 = Constraint(expr=m.x342*m.x1097 - m.x450*m.x1013 == 0)
m.c2093 = Constraint(expr=m.x342*m.x1098 - m.x451*m.x1013 == 0)
m.c2094 = Constraint(expr=m.x342*m.x1099 - m.x452*m.x1013 == 0)
m.c2095 = Constraint(expr=m.x342*m.x1100 - m.x453*m.x1013 == 0)
m.c2096 = Constraint(expr=m.x342*m.x1101 - m.x454*m.x1013 == 0)
m.c2097 = Constraint(expr=m.x342*m.x1102 - m.x455*m.x1013 == 0)
m.c2098 = Constraint(expr=m.x342*m.x1103 - m.x456*m.x1013 == 0)
m.c2099 = Constraint(expr=m.x343*m.x1104 - m.x457*m.x1014 == 0)
m.c2100 = Constraint(expr=m.x343*m.x1105 - m.x458*m.x1014 == 0)
m.c2101 = Constraint(expr=m.x343*m.x1106 - m.x459*m.x1014 == 0)
m.c2102 = Constraint(expr=m.x343*m.x1107 - m.x460*m.x1014 == 0)
m.c2103 = Constraint(expr=m.x343*m.x1108 - m.x461*m.x1014 == 0)
m.c2104 = Constraint(expr=m.x343*m.x1109 - m.x462*m.x1014 == 0)
m.c2105 = Constraint(expr=m.x343*m.x1110 - m.x463*m.x1014 == 0)
m.c2106 = Constraint(expr=m.x344*m.x1104 - m.x464*m.x1014 == 0)
m.c2107 = Constraint(expr=m.x344*m.x1105 - m.x465*m.x1014 == 0)
m.c2108 = Constraint(expr=m.x344*m.x1106 - m.x466*m.x1014 == 0)
m.c2109 = Constraint(expr=m.x344*m.x1107 - m.x467*m.x1014 == 0)
m.c2110 = Constraint(expr=m.x344*m.x1108 - m.x468*m.x1014 == 0)
m.c2111 = Constraint(expr=m.x344*m.x1109 - m.x469*m.x1014 == 0)
m.c2112 = Constraint(expr=m.x344*m.x1110 - m.x470*m.x1014 == 0)
m.c2113 = Constraint(expr=m.x345*m.x1104 - m.x471*m.x1014 == 0)
m.c2114 = Constraint(expr=m.x345*m.x1105 - m.x472*m.x1014 == 0)
m.c2115 = Constraint(expr=m.x345*m.x1106 - m.x473*m.x1014 == 0)
m.c2116 = Constraint(expr=m.x345*m.x1107 - m.x474*m.x1014 == 0)
m.c2117 = Constraint(expr=m.x345*m.x1108 - m.x475*m.x1014 == 0)
m.c2118 = Constraint(expr=m.x345*m.x1109 - m.x476*m.x1014 == 0)
m.c2119 = Constraint(expr=m.x345*m.x1110 - m.x477*m.x1014 == 0)
m.c2120 = Constraint(expr=m.x346*m.x1111 - m.x478*m.x1015 == 0)
m.c2121 = Constraint(expr=m.x346*m.x1112 - m.x479*m.x1015 == 0)
m.c2122 = Constraint(expr=m.x346*m.x1113 - m.x480*m.x1015 == 0)
m.c2123 = Constraint(expr=m.x346*m.x1114 - m.x481*m.x1015 == 0)
m.c2124 = Constraint(expr=m.x346*m.x1115 - m.x482*m.x1015 == 0)
m.c2125 = Constraint(expr=m.x346*m.x1116 - m.x483*m.x1015 == 0)
m.c2126 = Constraint(expr=m.x346*m.x1117 - m.x484*m.x1015 == 0)
m.c2127 = Constraint(expr=m.x347*m.x1111 - m.x485*m.x1015 == 0)
m.c2128 = Constraint(expr=m.x347*m.x1112 - m.x486*m.x1015 == 0)
m.c2129 = Constraint(expr=m.x347*m.x1113 - m.x487*m.x1015 == 0)
m.c2130 = Constraint(expr=m.x347*m.x1114 - m.x488*m.x1015 == 0)
m.c2131 = Constraint(expr=m.x347*m.x1115 - m.x489*m.x1015 == 0)
m.c2132 = Constraint(expr=m.x347*m.x1116 - m.x490*m.x1015 == 0)
m.c2133 = Constraint(expr=m.x347*m.x1117 - m.x491*m.x1015 == 0)
m.c2134 = Constraint(expr=m.x348*m.x1118 - m.x492*m.x1016 == 0)
m.c2135 = Constraint(expr=m.x348*m.x1119 - m.x493*m.x1016 == 0)
m.c2136 = Constraint(expr=m.x348*m.x1120 - m.x494*m.x1016 == 0)
m.c2137 = Constraint(expr=m.x348*m.x1121 - m.x495*m.x1016 == 0)
m.c2138 = Constraint(expr=m.x348*m.x1122 - m.x496*m.x1016 == 0)
m.c2139 = Constraint(expr=m.x348*m.x1123 - m.x497*m.x1016 == 0)
m.c2140 = Constraint(expr=m.x348*m.x1124 - m.x498*m.x1016 == 0)
m.c2141 = Constraint(expr=m.x349*m.x1125 - m.x499*m.x1017 == 0)
m.c2142 = Constraint(expr=m.x349*m.x1126 - m.x500*m.x1017 == 0)
m.c2143 = Constraint(expr=m.x349*m.x1127 - m.x501*m.x1017 == 0)
m.c2144 = Constraint(expr=m.x349*m.x1128 - m.x502*m.x1017 == 0)
m.c2145 = Constraint(expr=m.x349*m.x1129 - m.x503*m.x1017 == 0)
m.c2146 = Constraint(expr=m.x349*m.x1130 - m.x504*m.x1017 == 0)
m.c2147 = Constraint(expr=m.x349*m.x1131 - m.x505*m.x1017 == 0)
m.c2148 = Constraint(expr=m.x350*m.x1125 - m.x506*m.x1017 == 0)
m.c2149 = Constraint(expr=m.x350*m.x1126 - m.x507*m.x1017 == 0)
m.c2150 = Constraint(expr=m.x350*m.x1127 - m.x508*m.x1017 == 0)
m.c2151 = Constraint(expr=m.x350*m.x1128 - m.x509*m.x1017 == 0)
m.c2152 = Constraint(expr=m.x350*m.x1129 - m.x510*m.x1017 == 0)
m.c2153 = Constraint(expr=m.x350*m.x1130 - m.x511*m.x1017 == 0)
m.c2154 = Constraint(expr=m.x350*m.x1131 - m.x512*m.x1017 == 0)
m.c2155 = Constraint(expr=m.x351*m.x1132 - m.x513*m.x1018 == 0)
m.c2156 = Constraint(expr=m.x351*m.x1133 - m.x514*m.x1018 == 0)
m.c2157 = Constraint(expr=m.x351*m.x1134 - m.x515*m.x1018 == 0)
m.c2158 = Constraint(expr=m.x351*m.x1135 - m.x516*m.x1018 == 0)
m.c2159 = Constraint(expr=m.x351*m.x1136 - m.x517*m.x1018 == 0)
m.c2160 = Constraint(expr=m.x351*m.x1137 - m.x518*m.x1018 == 0)
m.c2161 = Constraint(expr=m.x351*m.x1138 - m.x519*m.x1018 == 0)
m.c2162 = Constraint(expr=m.x352*m.x1153 - m.x520*m.x1021 == 0)
m.c2163 = Constraint(expr=m.x352*m.x1154 - m.x521*m.x1021 == 0)
m.c2164 = Constraint(expr=m.x352*m.x1155 - m.x522*m.x1021 == 0)
m.c2165 = Constraint(expr=m.x352*m.x1156 - m.x523*m.x1021 == 0)
m.c2166 = Constraint(expr=m.x352*m.x1157 - m.x524*m.x1021 == 0)
m.c2167 = Constraint(expr=m.x352*m.x1158 - m.x525*m.x1021 == 0)
m.c2168 = Constraint(expr=m.x352*m.x1159 - m.x526*m.x1021 == 0)
m.c2169 = Constraint(expr=m.x353*m.x1160 - m.x527*m.x1022 == 0)
m.c2170 = Constraint(expr=m.x353*m.x1161 - m.x528*m.x1022 == 0)
m.c2171 = Constraint(expr=m.x353*m.x1162 - m.x529*m.x1022 == 0)
m.c2172 = Constraint(expr=m.x353*m.x1163 - m.x530*m.x1022 == 0)
m.c2173 = Constraint(expr=m.x353*m.x1164 - m.x531*m.x1022 == 0)
m.c2174 = Constraint(expr=m.x353*m.x1165 - m.x532*m.x1022 == 0)
m.c2175 = Constraint(expr=m.x353*m.x1166 - m.x533*m.x1022 == 0)
m.c2176 = Constraint(expr=m.x354*m.x1167 - m.x534*m.x1023 == 0)
m.c2177 = Constraint(expr=m.x354*m.x1168 - m.x535*m.x1023 == 0)
m.c2178 = Constraint(expr=m.x354*m.x1169 - m.x536*m.x1023 == 0)
m.c2179 = Constraint(expr=m.x354*m.x1170 - m.x537*m.x1023 == 0)
m.c2180 = Constraint(expr=m.x354*m.x1171 - m.x538*m.x1023 == 0)
m.c2181 = Constraint(expr=m.x354*m.x1172 - m.x539*m.x1023 == 0)
m.c2182 = Constraint(expr=m.x354*m.x1173 - m.x540*m.x1023 == 0)
m.c2183 = Constraint(expr=m.x355*m.x1174 - m.x541*m.x1024 == 0)
m.c2184 = Constraint(expr=m.x355*m.x1175 - m.x542*m.x1024 == 0)
m.c2185 = Constraint(expr=m.x355*m.x1176 - m.x543*m.x1024 == 0)
m.c2186 = Constraint(expr=m.x355*m.x1177 - m.x544*m.x1024 == 0)
m.c2187 = Constraint(expr=m.x355*m.x1178 - m.x545*m.x1024 == 0)
m.c2188 = Constraint(expr=m.x355*m.x1179 - m.x546*m.x1024 == 0)
m.c2189 = Constraint(expr=m.x355*m.x1180 - m.x547*m.x1024 == 0)
m.c2190 = Constraint(expr=m.x356*m.x1174 - m.x548*m.x1024 == 0)
m.c2191 = Constraint(expr=m.x356*m.x1175 - m.x549*m.x1024 == 0)
m.c2192 = Constraint(expr=m.x356*m.x1176 - m.x550*m.x1024 == 0)
m.c2193 = Constraint(expr=m.x356*m.x1177 - m.x551*m.x1024 == 0)
m.c2194 = Constraint(expr=m.x356*m.x1178 - m.x552*m.x1024 == 0)
m.c2195 = Constraint(expr=m.x356*m.x1179 - m.x553*m.x1024 == 0)
m.c2196 = Constraint(expr=m.x356*m.x1180 - m.x554*m.x1024 == 0)
m.c2197 = Constraint(expr=m.x357*m.x1181 - m.x555*m.x1025 == 0)
m.c2198 = Constraint(expr=m.x357*m.x1182 - m.x556*m.x1025 == 0)
m.c2199 = Constraint(expr=m.x357*m.x1183 - m.x557*m.x1025 == 0)
m.c2200 = Constraint(expr=m.x357*m.x1184 - m.x558*m.x1025 == 0)
m.c2201 = Constraint(expr=m.x357*m.x1185 - m.x559*m.x1025 == 0)
m.c2202 = Constraint(expr=m.x357*m.x1186 - m.x560*m.x1025 == 0)
m.c2203 = Constraint(expr=m.x357*m.x1187 - m.x561*m.x1025 == 0)
m.c2204 = Constraint(expr=m.x358*m.x1181 - m.x562*m.x1025 == 0)
m.c2205 = Constraint(expr=m.x358*m.x1182 - m.x563*m.x1025 == 0)
m.c2206 = Constraint(expr=m.x358*m.x1183 - m.x564*m.x1025 == 0)
m.c2207 = Constraint(expr=m.x358*m.x1184 - m.x565*m.x1025 == 0)
m.c2208 = Constraint(expr=m.x358*m.x1185 - m.x566*m.x1025 == 0)
m.c2209 = Constraint(expr=m.x358*m.x1186 - m.x567*m.x1025 == 0)
m.c2210 = Constraint(expr=m.x358*m.x1187 - m.x568*m.x1025 == 0)
m.c2211 = Constraint(expr=m.x359*m.x1181 - m.x569*m.x1025 == 0)
m.c2212 = Constraint(expr=m.x359*m.x1182 - m.x570*m.x1025 == 0)
m.c2213 = Constraint(expr=m.x359*m.x1183 - m.x571*m.x1025 == 0)
m.c2214 = Constraint(expr=m.x359*m.x1184 - m.x572*m.x1025 == 0)
m.c2215 = Constraint(expr=m.x359*m.x1185 - m.x573*m.x1025 == 0)
m.c2216 = Constraint(expr=m.x359*m.x1186 - m.x574*m.x1025 == 0)
m.c2217 = Constraint(expr=m.x359*m.x1187 - m.x575*m.x1025 == 0)
m.c2218 = Constraint(expr=m.x360*m.x1188 - m.x576*m.x1026 == 0)
m.c2219 = Constraint(expr=m.x360*m.x1189 - m.x577*m.x1026 == 0)
m.c2220 = Constraint(expr=m.x360*m.x1190 - m.x578*m.x1026 == 0)
m.c2221 = Constraint(expr=m.x360*m.x1191 - m.x579*m.x1026 == 0)
m.c2222 = Constraint(expr=m.x360*m.x1192 - m.x580*m.x1026 == 0)
m.c2223 = Constraint(expr=m.x360*m.x1193 - m.x581*m.x1026 == 0)
m.c2224 = Constraint(expr=m.x360*m.x1194 - m.x582*m.x1026 == 0)
m.c2225 = Constraint(expr=m.x361*m.x1188 - m.x583*m.x1026 == 0)
m.c2226 = Constraint(expr=m.x361*m.x1189 - m.x584*m.x1026 == 0)
m.c2227 = Constraint(expr=m.x361*m.x1190 - m.x585*m.x1026 == 0)
m.c2228 = Constraint(expr=m.x361*m.x1191 - m.x586*m.x1026 == 0)
m.c2229 = Constraint(expr=m.x361*m.x1192 - m.x587*m.x1026 == 0)
m.c2230 = Constraint(expr=m.x361*m.x1193 - m.x588*m.x1026 == 0)
m.c2231 = Constraint(expr=m.x361*m.x1194 - m.x589*m.x1026 == 0)
m.c2232 = Constraint(expr=m.x362*m.x1195 - m.x590*m.x1027 == 0)
m.c2233 = Constraint(expr=m.x362*m.x1196 - m.x591*m.x1027 == 0)
m.c2234 = Constraint(expr=m.x362*m.x1197 - m.x592*m.x1027 == 0)
m.c2235 = Constraint(expr=m.x362*m.x1198 - m.x593*m.x1027 == 0)
m.c2236 = Constraint(expr=m.x362*m.x1199 - m.x594*m.x1027 == 0)
m.c2237 = Constraint(expr=m.x362*m.x1200 - m.x595*m.x1027 == 0)
m.c2238 = Constraint(expr=m.x362*m.x1201 - m.x596*m.x1027 == 0)
m.c2239 = Constraint(expr=m.x363*m.x1202 - m.x597*m.x1028 == 0)
m.c2240 = Constraint(expr=m.x363*m.x1203 - m.x598*m.x1028 == 0)
m.c2241 = Constraint(expr=m.x363*m.x1204 - m.x599*m.x1028 == 0)
m.c2242 = Constraint(expr=m.x363*m.x1205 - m.x600*m.x1028 == 0)
m.c2243 = Constraint(expr=m.x363*m.x1206 - m.x601*m.x1028 == 0)
m.c2244 = Constraint(expr=m.x363*m.x1207 - m.x602*m.x1028 == 0)
m.c2245 = Constraint(expr=m.x363*m.x1208 - m.x603*m.x1028 == 0)
m.c2246 = Constraint(expr=m.x364*m.x1202 - m.x604*m.x1028 == 0)
m.c2247 = Constraint(expr=m.x364*m.x1203 - m.x605*m.x1028 == 0)
m.c2248 = Constraint(expr=m.x364*m.x1204 - m.x606*m.x1028 == 0)
m.c2249 = Constraint(expr=m.x364*m.x1205 - m.x607*m.x1028 == 0)
m.c2250 = Constraint(expr=m.x364*m.x1206 - m.x608*m.x1028 == 0)
m.c2251 = Constraint(expr=m.x364*m.x1207 - m.x609*m.x1028 == 0)
m.c2252 = Constraint(expr=m.x364*m.x1208 - m.x610*m.x1028 == 0)
m.c2253 = Constraint(expr=m.x365*m.x1209 - m.x611*m.x1029 == 0)
m.c2254 = Constraint(expr=m.x365*m.x1210 - m.x612*m.x1029 == 0)
m.c2255 = Constraint(expr=m.x365*m.x1211 - m.x613*m.x1029 == 0)
m.c2256 = Constraint(expr=m.x365*m.x1212 - m.x614*m.x1029 == 0)
m.c2257 = Constraint(expr=m.x365*m.x1213 - m.x615*m.x1029 == 0)
m.c2258 = Constraint(expr=m.x365*m.x1214 - m.x616*m.x1029 == 0)
m.c2259 = Constraint(expr=m.x365*m.x1215 - m.x617*m.x1029 == 0)
m.c2260 = Constraint(expr=m.x366*m.x1230 - m.x618*m.x1032 == 0)
m.c2261 = Constraint(expr=m.x366*m.x1231 - m.x619*m.x1032 == 0)
m.c2262 = Constraint(expr=m.x366*m.x1232 - m.x620*m.x1032 == 0)
m.c2263 = Constraint(expr=m.x366*m.x1233 - m.x621*m.x1032 == 0)
m.c2264 = Constraint(expr=m.x366*m.x1234 - m.x622*m.x1032 == 0)
m.c2265 = Constraint(expr=m.x366*m.x1235 - m.x623*m.x1032 == 0)
m.c2266 = Constraint(expr=m.x366*m.x1236 - m.x624*m.x1032 == 0)
m.c2267 = Constraint(expr=m.x367*m.x1237 - m.x625*m.x1033 == 0)
m.c2268 = Constraint(expr=m.x367*m.x1238 - m.x626*m.x1033 == 0)
m.c2269 = Constraint(expr=m.x367*m.x1239 - m.x627*m.x1033 == 0)
m.c2270 = Constraint(expr=m.x367*m.x1240 - m.x628*m.x1033 == 0)
m.c2271 = Constraint(expr=m.x367*m.x1241 - m.x629*m.x1033 == 0)
m.c2272 = Constraint(expr=m.x367*m.x1242 - m.x630*m.x1033 == 0)
m.c2273 = Constraint(expr=m.x367*m.x1243 - m.x631*m.x1033 == 0)
m.c2274 = Constraint(expr=m.x368*m.x1244 - m.x632*m.x1034 == 0)
m.c2275 = Constraint(expr=m.x368*m.x1245 - m.x633*m.x1034 == 0)
m.c2276 = Constraint(expr=m.x368*m.x1246 - m.x634*m.x1034 == 0)
m.c2277 = Constraint(expr=m.x368*m.x1247 - m.x635*m.x1034 == 0)
m.c2278 = Constraint(expr=m.x368*m.x1248 - m.x636*m.x1034 == 0)
m.c2279 = Constraint(expr=m.x368*m.x1249 - m.x637*m.x1034 == 0)
m.c2280 = Constraint(expr=m.x368*m.x1250 - m.x638*m.x1034 == 0)
m.c2281 = Constraint(expr=m.x369*m.x1251 - m.x639*m.x1035 == 0)
m.c2282 = Constraint(expr=m.x369*m.x1252 - m.x640*m.x1035 == 0)
m.c2283 = Constraint(expr=m.x369*m.x1253 - m.x641*m.x1035 == 0)
m.c2284 = Constraint(expr=m.x369*m.x1254 - m.x642*m.x1035 == 0)
m.c2285 = Constraint(expr=m.x369*m.x1255 - m.x643*m.x1035 == 0)
m.c2286 = Constraint(expr=m.x369*m.x1256 - m.x644*m.x1035 == 0)
m.c2287 = Constraint(expr=m.x369*m.x1257 - m.x645*m.x1035 == 0)
m.c2288 = Constraint(expr=m.x370*m.x1251 - m.x646*m.x1035 == 0)
m.c2289 = Constraint(expr=m.x370*m.x1252 - m.x647*m.x1035 == 0)
m.c2290 = Constraint(expr=m.x370*m.x1253 - m.x648*m.x1035 == 0)
m.c2291 = Constraint(expr=m.x370*m.x1254 - m.x649*m.x1035 == 0)
m.c2292 = Constraint(expr=m.x370*m.x1255 - m.x650*m.x1035 == 0)
m.c2293 = Constraint(expr=m.x370*m.x1256 - m.x651*m.x1035 == 0)
m.c2294 = Constraint(expr=m.x370*m.x1257 - m.x652*m.x1035 == 0)
m.c2295 = Constraint(expr=m.x371*m.x1258 - m.x653*m.x1036 == 0)
m.c2296 = Constraint(expr=m.x371*m.x1259 - m.x654*m.x1036 == 0)
m.c2297 = Constraint(expr=m.x371*m.x1260 - m.x655*m.x1036 == 0)
m.c2298 = Constraint(expr=m.x371*m.x1261 - m.x656*m.x1036 == 0)
m.c2299 = Constraint(expr=m.x371*m.x1262 - m.x657*m.x1036 == 0)
m.c2300 = Constraint(expr=m.x371*m.x1263 - m.x658*m.x1036 == 0)
m.c2301 = Constraint(expr=m.x371*m.x1264 - m.x659*m.x1036 == 0)
m.c2302 = Constraint(expr=m.x372*m.x1258 - m.x660*m.x1036 == 0)
m.c2303 = Constraint(expr=m.x372*m.x1259 - m.x661*m.x1036 == 0)
m.c2304 = Constraint(expr=m.x372*m.x1260 - m.x662*m.x1036 == 0)
m.c2305 = Constraint(expr=m.x372*m.x1261 - m.x663*m.x1036 == 0)
m.c2306 = Constraint(expr=m.x372*m.x1262 - m.x664*m.x1036 == 0)
m.c2307 = Constraint(expr=m.x372*m.x1263 - m.x665*m.x1036 == 0)
m.c2308 = Constraint(expr=m.x372*m.x1264 - m.x666*m.x1036 == 0)
m.c2309 = Constraint(expr=m.x373*m.x1258 - m.x667*m.x1036 == 0)
m.c2310 = Constraint(expr=m.x373*m.x1259 - m.x668*m.x1036 == 0)
m.c2311 = Constraint(expr=m.x373*m.x1260 - m.x669*m.x1036 == 0)
m.c2312 = Constraint(expr=m.x373*m.x1261 - m.x670*m.x1036 == 0)
m.c2313 = Constraint(expr=m.x373*m.x1262 - m.x671*m.x1036 == 0)
m.c2314 = Constraint(expr=m.x373*m.x1263 - m.x672*m.x1036 == 0)
m.c2315 = Constraint(expr=m.x373*m.x1264 - m.x673*m.x1036 == 0)
m.c2316 = Constraint(expr=m.x374*m.x1265 - m.x674*m.x1037 == 0)
m.c2317 = Constraint(expr=m.x374*m.x1266 - m.x675*m.x1037 == 0)
m.c2318 = Constraint(expr=m.x374*m.x1267 - m.x676*m.x1037 == 0)
m.c2319 = Constraint(expr=m.x374*m.x1268 - m.x677*m.x1037 == 0)
m.c2320 = Constraint(expr=m.x374*m.x1269 - m.x678*m.x1037 == 0)
m.c2321 = Constraint(expr=m.x374*m.x1270 - m.x679*m.x1037 == 0)
m.c2322 = Constraint(expr=m.x374*m.x1271 - m.x680*m.x1037 == 0)
m.c2323 = Constraint(expr=m.x375*m.x1265 - m.x681*m.x1037 == 0)
m.c2324 = Constraint(expr=m.x375*m.x1266 - m.x682*m.x1037 == 0)
m.c2325 = Constraint(expr=m.x375*m.x1267 - m.x683*m.x1037 == 0)
m.c2326 = Constraint(expr=m.x375*m.x1268 - m.x684*m.x1037 == 0)
m.c2327 = Constraint(expr=m.x375*m.x1269 - m.x685*m.x1037 == 0)
m.c2328 = Constraint(expr=m.x375*m.x1270 - m.x686*m.x1037 == 0)
m.c2329 = Constraint(expr=m.x375*m.x1271 - m.x687*m.x1037 == 0)
m.c2330 = Constraint(expr=m.x376*m.x1272 - m.x688*m.x1038 == 0)
m.c2331 = Constraint(expr=m.x376*m.x1273 - m.x689*m.x1038 == 0)
m.c2332 = Constraint(expr=m.x376*m.x1274 - m.x690*m.x1038 == 0)
m.c2333 = Constraint(expr=m.x376*m.x1275 - m.x691*m.x1038 == 0)
m.c2334 = Constraint(expr=m.x376*m.x1276 - m.x692*m.x1038 == 0)
m.c2335 = Constraint(expr=m.x376*m.x1277 - m.x693*m.x1038 == 0)
m.c2336 = Constraint(expr=m.x376*m.x1278 - m.x694*m.x1038 == 0)
m.c2337 = Constraint(expr=m.x377*m.x1279 - m.x695*m.x1039 == 0)
m.c2338 = Constraint(expr=m.x377*m.x1280 - m.x696*m.x1039 == 0)
m.c2339 = Constraint(expr=m.x377*m.x1281 - m.x697*m.x1039 == 0)
m.c2340 = Constraint(expr=m.x377*m.x1282 - m.x698*m.x1039 == 0)
m.c2341 = Constraint(expr=m.x377*m.x1283 - m.x699*m.x1039 == 0)
m.c2342 = Constraint(expr=m.x377*m.x1284 - m.x700*m.x1039 == 0)
m.c2343 = Constraint(expr=m.x377*m.x1285 - m.x701*m.x1039 == 0)
m.c2344 = Constraint(expr=m.x378*m.x1279 - m.x702*m.x1039 == 0)
m.c2345 = Constraint(expr=m.x378*m.x1280 - m.x703*m.x1039 == 0)
m.c2346 = Constraint(expr=m.x378*m.x1281 - m.x704*m.x1039 == 0)
m.c2347 = Constraint(expr=m.x378*m.x1282 - m.x705*m.x1039 == 0)
m.c2348 = Constraint(expr=m.x378*m.x1283 - m.x706*m.x1039 == 0)
m.c2349 = Constraint(expr=m.x378*m.x1284 - m.x707*m.x1039 == 0)
m.c2350 = Constraint(expr=m.x378*m.x1285 - m.x708*m.x1039 == 0)
m.c2351 = Constraint(expr=m.x379*m.x1286 - m.x709*m.x1040 == 0)
m.c2352 = Constraint(expr=m.x379*m.x1287 - m.x710*m.x1040 == 0)
m.c2353 = Constraint(expr=m.x379*m.x1288 - m.x711*m.x1040 == 0)
m.c2354 = Constraint(expr=m.x379*m.x1289 - m.x712*m.x1040 == 0)
m.c2355 = Constraint(expr=m.x379*m.x1290 - m.x713*m.x1040 == 0)
m.c2356 = Constraint(expr=m.x379*m.x1291 - m.x714*m.x1040 == 0)
m.c2357 = Constraint(expr=m.x379*m.x1292 - m.x715*m.x1040 == 0)
m.c2358 = Constraint(expr=m.x380*m.x1307 - m.x716*m.x1043 == 0)
m.c2359 = Constraint(expr=m.x380*m.x1308 - m.x717*m.x1043 == 0)
m.c2360 = Constraint(expr=m.x380*m.x1309 - m.x718*m.x1043 == 0)
m.c2361 = Constraint(expr=m.x380*m.x1310 - m.x719*m.x1043 == 0)
m.c2362 = Constraint(expr=m.x380*m.x1311 - m.x720*m.x1043 == 0)
m.c2363 = Constraint(expr=m.x380*m.x1312 - m.x721*m.x1043 == 0)
m.c2364 = Constraint(expr=m.x380*m.x1313 - m.x722*m.x1043 == 0)
m.c2365 = Constraint(expr=m.x381*m.x1314 - m.x723*m.x1044 == 0)
m.c2366 = Constraint(expr=m.x381*m.x1315 - m.x724*m.x1044 == 0)
m.c2367 = Constraint(expr=m.x381*m.x1316 - m.x725*m.x1044 == 0)
m.c2368 = Constraint(expr=m.x381*m.x1317 - m.x726*m.x1044 == 0)
m.c2369 = Constraint(expr=m.x381*m.x1318 - m.x727*m.x1044 == 0)
m.c2370 = Constraint(expr=m.x381*m.x1319 - m.x728*m.x1044 == 0)
m.c2371 = Constraint(expr=m.x381*m.x1320 - m.x729*m.x1044 == 0)
m.c2372 = Constraint(expr=m.x382*m.x1321 - m.x730*m.x1045 == 0)
m.c2373 = Constraint(expr=m.x382*m.x1322 - m.x731*m.x1045 == 0)
m.c2374 = Constraint(expr=m.x382*m.x1323 - m.x732*m.x1045 == 0)
m.c2375 = Constraint(expr=m.x382*m.x1324 - m.x733*m.x1045 == 0)
m.c2376 = Constraint(expr=m.x382*m.x1325 - m.x734*m.x1045 == 0)
m.c2377 = Constraint(expr=m.x382*m.x1326 - m.x735*m.x1045 == 0)
m.c2378 = Constraint(expr=m.x382*m.x1327 - m.x736*m.x1045 == 0)
m.c2379 = Constraint(expr=m.x383*m.x1328 - m.x737*m.x1046 == 0)
m.c2380 = Constraint(expr=m.x383*m.x1329 - m.x738*m.x1046 == 0)
m.c2381 = Constraint(expr=m.x383*m.x1330 - m.x739*m.x1046 == 0)
m.c2382 = Constraint(expr=m.x383*m.x1331 - m.x740*m.x1046 == 0)
m.c2383 = Constraint(expr=m.x383*m.x1332 - m.x741*m.x1046 == 0)
m.c2384 = Constraint(expr=m.x383*m.x1333 - m.x742*m.x1046 == 0)
m.c2385 = Constraint(expr=m.x383*m.x1334 - m.x743*m.x1046 == 0)
m.c2386 = Constraint(expr=m.x384*m.x1328 - m.x744*m.x1046 == 0)
m.c2387 = Constraint(expr=m.x384*m.x1329 - m.x745*m.x1046 == 0)
m.c2388 = Constraint(expr=m.x384*m.x1330 - m.x746*m.x1046 == 0)
m.c2389 = Constraint(expr=m.x384*m.x1331 - m.x747*m.x1046 == 0)
m.c2390 = Constraint(expr=m.x384*m.x1332 - m.x748*m.x1046 == 0)
m.c2391 = Constraint(expr=m.x384*m.x1333 - m.x749*m.x1046 == 0)
m.c2392 = Constraint(expr=m.x384*m.x1334 - m.x750*m.x1046 == 0)
m.c2393 = Constraint(expr=m.x385*m.x1335 - m.x751*m.x1047 == 0)
m.c2394 = Constraint(expr=m.x385*m.x1336 - m.x752*m.x1047 == 0)
m.c2395 = Constraint(expr=m.x385*m.x1337 - m.x753*m.x1047 == 0)
m.c2396 = Constraint(expr=m.x385*m.x1338 - m.x754*m.x1047 == 0)
m.c2397 = Constraint(expr=m.x385*m.x1339 - m.x755*m.x1047 == 0)
m.c2398 = Constraint(expr=m.x385*m.x1340 - m.x756*m.x1047 == 0)
m.c2399 = Constraint(expr=m.x385*m.x1341 - m.x757*m.x1047 == 0)
m.c2400 = Constraint(expr=m.x386*m.x1335 - m.x758*m.x1047 == 0)
m.c2401 = Constraint(expr=m.x386*m.x1336 - m.x759*m.x1047 == 0)
m.c2402 = Constraint(expr=m.x386*m.x1337 - m.x760*m.x1047 == 0)
m.c2403 = Constraint(expr=m.x386*m.x1338 - m.x761*m.x1047 == 0)
m.c2404 = Constraint(expr=m.x386*m.x1339 - m.x762*m.x1047 == 0)
m.c2405 = Constraint(expr=m.x386*m.x1340 - m.x763*m.x1047 == 0)
m.c2406 = Constraint(expr=m.x386*m.x1341 - m.x764*m.x1047 == 0)
m.c2407 = Constraint(expr=m.x387*m.x1335 - m.x765*m.x1047 == 0)
m.c2408 = Constraint(expr=m.x387*m.x1336 - m.x766*m.x1047 == 0)
m.c2409 = Constraint(expr=m.x387*m.x1337 - m.x767*m.x1047 == 0)
m.c2410 = Constraint(expr=m.x387*m.x1338 - m.x768*m.x1047 == 0)
m.c2411 = Constraint(expr=m.x387*m.x1339 - m.x769*m.x1047 == 0)
m.c2412 = Constraint(expr=m.x387*m.x1340 - m.x770*m.x1047 == 0)
m.c2413 = Constraint(expr=m.x387*m.x1341 - m.x771*m.x1047 == 0)
m.c2414 = Constraint(expr=m.x388*m.x1342 - m.x772*m.x1048 == 0)
m.c2415 = Constraint(expr=m.x388*m.x1343 - m.x773*m.x1048 == 0)
m.c2416 = Constraint(expr=m.x388*m.x1344 - m.x774*m.x1048 == 0)
m.c2417 = Constraint(expr=m.x388*m.x1345 - m.x775*m.x1048 == 0)
m.c2418 = Constraint(expr=m.x388*m.x1346 - m.x776*m.x1048 == 0)
m.c2419 = Constraint(expr=m.x388*m.x1347 - m.x777*m.x1048 == 0)
m.c2420 = Constraint(expr=m.x388*m.x1348 - m.x778*m.x1048 == 0)
m.c2421 = Constraint(expr=m.x389*m.x1342 - m.x779*m.x1048 == 0)
m.c2422 = Constraint(expr=m.x389*m.x1343 - m.x780*m.x1048 == 0)
m.c2423 = Constraint(expr=m.x389*m.x1344 - m.x781*m.x1048 == 0)
m.c2424 = Constraint(expr=m.x389*m.x1345 - m.x782*m.x1048 == 0)
m.c2425 = Constraint(expr=m.x389*m.x1346 - m.x783*m.x1048 == 0)
m.c2426 = Constraint(expr=m.x389*m.x1347 - m.x784*m.x1048 == 0)
m.c2427 = Constraint(expr=m.x389*m.x1348 - m.x785*m.x1048 == 0)
m.c2428 = Constraint(expr=m.x390*m.x1349 - m.x786*m.x1049 == 0)
m.c2429 = Constraint(expr=m.x390*m.x1350 - m.x787*m.x1049 == 0)
m.c2430 = Constraint(expr=m.x390*m.x1351 - m.x788*m.x1049 == 0)
m.c2431 = Constraint(expr=m.x390*m.x1352 - m.x789*m.x1049 == 0)
m.c2432 = Constraint(expr=m.x390*m.x1353 - m.x790*m.x1049 == 0)
m.c2433 = Constraint(expr=m.x390*m.x1354 - m.x791*m.x1049 == 0)
m.c2434 = Constraint(expr=m.x390*m.x1355 - m.x792*m.x1049 == 0)
m.c2435 = Constraint(expr=m.x391*m.x1356 - m.x793*m.x1050 == 0)
m.c2436 = Constraint(expr=m.x391*m.x1357 - m.x794*m.x1050 == 0)
m.c2437 = Constraint(expr=m.x391*m.x1358 - m.x795*m.x1050 == 0)
m.c2438 = Constraint(expr=m.x391*m.x1359 - m.x796*m.x1050 == 0)
m.c2439 = Constraint(expr=m.x391*m.x1360 - m.x797*m.x1050 == 0)
m.c2440 = Constraint(expr=m.x391*m.x1361 - m.x798*m.x1050 == 0)
m.c2441 = Constraint(expr=m.x391*m.x1362 - m.x799*m.x1050 == 0)
m.c2442 = Constraint(expr=m.x392*m.x1356 - m.x800*m.x1050 == 0)
m.c2443 = Constraint(expr=m.x392*m.x1357 - m.x801*m.x1050 == 0)
m.c2444 = Constraint(expr=m.x392*m.x1358 - m.x802*m.x1050 == 0)
m.c2445 = Constraint(expr=m.x392*m.x1359 - m.x803*m.x1050 == 0)
m.c2446 = Constraint(expr=m.x392*m.x1360 - m.x804*m.x1050 == 0)
m.c2447 = Constraint(expr=m.x392*m.x1361 - m.x805*m.x1050 == 0)
m.c2448 = Constraint(expr=m.x392*m.x1362 - m.x806*m.x1050 == 0)
m.c2449 = Constraint(expr=m.x393*m.x1363 - m.x807*m.x1051 == 0)
m.c2450 = Constraint(expr=m.x393*m.x1364 - m.x808*m.x1051 == 0)
m.c2451 = Constraint(expr=m.x393*m.x1365 - m.x809*m.x1051 == 0)
m.c2452 = Constraint(expr=m.x393*m.x1366 - m.x810*m.x1051 == 0)
m.c2453 = Constraint(expr=m.x393*m.x1367 - m.x811*m.x1051 == 0)
m.c2454 = Constraint(expr=m.x393*m.x1368 - m.x812*m.x1051 == 0)
m.c2455 = Constraint(expr=m.x393*m.x1369 - m.x813*m.x1051 == 0)
m.c2456 = Constraint(expr=m.x394*m.x1384 - m.x814*m.x1054 == 0)
m.c2457 = Constraint(expr=m.x394*m.x1385 - m.x815*m.x1054 == 0)
m.c2458 = Constraint(expr=m.x394*m.x1386 - m.x816*m.x1054 == 0)
m.c2459 = Constraint(expr=m.x394*m.x1387 - m.x817*m.x1054 == 0)
m.c2460 = Constraint(expr=m.x394*m.x1388 - m.x818*m.x1054 == 0)
m.c2461 = Constraint(expr=m.x394*m.x1389 - m.x819*m.x1054 == 0)
m.c2462 = Constraint(expr=m.x394*m.x1390 - m.x820*m.x1054 == 0)
m.c2463 = Constraint(expr=m.x395*m.x1391 - m.x821*m.x1055 == 0)
m.c2464 = Constraint(expr=m.x395*m.x1392 - m.x822*m.x1055 == 0)
m.c2465 = Constraint(expr=m.x395*m.x1393 - m.x823*m.x1055 == 0)
m.c2466 = Constraint(expr=m.x395*m.x1394 - m.x824*m.x1055 == 0)
m.c2467 = Constraint(expr=m.x395*m.x1395 - m.x825*m.x1055 == 0)
m.c2468 = Constraint(expr=m.x395*m.x1396 - m.x826*m.x1055 == 0)
m.c2469 = Constraint(expr=m.x395*m.x1397 - m.x827*m.x1055 == 0)
m.c2470 = Constraint(expr=m.x396*m.x1398 - m.x828*m.x1056 == 0)
m.c2471 = Constraint(expr=m.x396*m.x1399 - m.x829*m.x1056 == 0)
m.c2472 = Constraint(expr=m.x396*m.x1400 - m.x830*m.x1056 == 0)
m.c2473 = Constraint(expr=m.x396*m.x1401 - m.x831*m.x1056 == 0)
m.c2474 = Constraint(expr=m.x396*m.x1402 - m.x832*m.x1056 == 0)
m.c2475 = Constraint(expr=m.x396*m.x1403 - m.x833*m.x1056 == 0)
m.c2476 = Constraint(expr=m.x396*m.x1404 - m.x834*m.x1056 == 0)
m.c2477 = Constraint(expr=m.x397*m.x1405 - m.x835*m.x1057 == 0)
m.c2478 = Constraint(expr=m.x397*m.x1406 - m.x836*m.x1057 == 0)
m.c2479 = Constraint(expr=m.x397*m.x1407 - m.x837*m.x1057 == 0)
m.c2480 = Constraint(expr=m.x397*m.x1408 - m.x838*m.x1057 == 0)
m.c2481 = Constraint(expr=m.x397*m.x1409 - m.x839*m.x1057 == 0)
m.c2482 = Constraint(expr=m.x397*m.x1410 - m.x840*m.x1057 == 0)
m.c2483 = Constraint(expr=m.x397*m.x1411 - m.x841*m.x1057 == 0)
m.c2484 = Constraint(expr=m.x398*m.x1405 - m.x842*m.x1057 == 0)
m.c2485 = Constraint(expr=m.x398*m.x1406 - m.x843*m.x1057 == 0)
m.c2486 = Constraint(expr=m.x398*m.x1407 - m.x844*m.x1057 == 0)
m.c2487 = Constraint(expr=m.x398*m.x1408 - m.x845*m.x1057 == 0)
m.c2488 = Constraint(expr=m.x398*m.x1409 - m.x846*m.x1057 == 0)
m.c2489 = Constraint(expr=m.x398*m.x1410 - m.x847*m.x1057 == 0)
m.c2490 = Constraint(expr=m.x398*m.x1411 - m.x848*m.x1057 == 0)
m.c2491 = Constraint(expr=m.x399*m.x1412 - m.x849*m.x1058 == 0)
m.c2492 = Constraint(expr=m.x399*m.x1413 - m.x850*m.x1058 == 0)
m.c2493 = Constraint(expr=m.x399*m.x1414 - m.x851*m.x1058 == 0)
m.c2494 = Constraint(expr=m.x399*m.x1415 - m.x852*m.x1058 == 0)
m.c2495 = Constraint(expr=m.x399*m.x1416 - m.x853*m.x1058 == 0)
m.c2496 = Constraint(expr=m.x399*m.x1417 - m.x854*m.x1058 == 0)
m.c2497 = Constraint(expr=m.x399*m.x1418 - m.x855*m.x1058 == 0)
m.c2498 = Constraint(expr=m.x400*m.x1412 - m.x856*m.x1058 == 0)
m.c2499 = Constraint(expr=m.x400*m.x1413 - m.x857*m.x1058 == 0)
m.c2500 = Constraint(expr=m.x400*m.x1414 - m.x858*m.x1058 == 0)
m.c2501 = Constraint(expr=m.x400*m.x1415 - m.x859*m.x1058 == 0)
m.c2502 = Constraint(expr=m.x400*m.x1416 - m.x860*m.x1058 == 0)
m.c2503 = Constraint(expr=m.x400*m.x1417 - m.x861*m.x1058 == 0)
m.c2504 = Constraint(expr=m.x400*m.x1418 - m.x862*m.x1058 == 0)
m.c2505 = Constraint(expr=m.x401*m.x1412 - m.x863*m.x1058 == 0)
m.c2506 = Constraint(expr=m.x401*m.x1413 - m.x864*m.x1058 == 0)
m.c2507 = Constraint(expr=m.x401*m.x1414 - m.x865*m.x1058 == 0)
m.c2508 = Constraint(expr=m.x401*m.x1415 - m.x866*m.x1058 == 0)
m.c2509 = Constraint(expr=m.x401*m.x1416 - m.x867*m.x1058 == 0)
m.c2510 = Constraint(expr=m.x401*m.x1417 - m.x868*m.x1058 == 0)
m.c2511 = Constraint(expr=m.x401*m.x1418 - m.x869*m.x1058 == 0)
m.c2512 = Constraint(expr=m.x402*m.x1419 - m.x870*m.x1059 == 0)
m.c2513 = Constraint(expr=m.x402*m.x1420 - m.x871*m.x1059 == 0)
m.c2514 = Constraint(expr=m.x402*m.x1421 - m.x872*m.x1059 == 0)
m.c2515 = Constraint(expr=m.x402*m.x1422 - m.x873*m.x1059 == 0)
m.c2516 = Constraint(expr=m.x402*m.x1423 - m.x874*m.x1059 == 0)
m.c2517 = Constraint(expr=m.x402*m.x1424 - m.x875*m.x1059 == 0)
m.c2518 = Constraint(expr=m.x402*m.x1425 - m.x876*m.x1059 == 0)
m.c2519 = Constraint(expr=m.x403*m.x1419 - m.x877*m.x1059 == 0)
m.c2520 = Constraint(expr=m.x403*m.x1420 - m.x878*m.x1059 == 0)
m.c2521 = Constraint(expr=m.x403*m.x1421 - m.x879*m.x1059 == 0)
m.c2522 = Constraint(expr=m.x403*m.x1422 - m.x880*m.x1059 == 0)
m.c2523 = Constraint(expr=m.x403*m.x1423 - m.x881*m.x1059 == 0)
m.c2524 = Constraint(expr=m.x403*m.x1424 - m.x882*m.x1059 == 0)
m.c2525 = Constraint(expr=m.x403*m.x1425 - m.x883*m.x1059 == 0)
m.c2526 = Constraint(expr=m.x404*m.x1426 - m.x884*m.x1060 == 0)
m.c2527 = Constraint(expr=m.x404*m.x1427 - m.x885*m.x1060 == 0)
m.c2528 = Constraint(expr=m.x404*m.x1428 - m.x886*m.x1060 == 0)
m.c2529 = Constraint(expr=m.x404*m.x1429 - m.x887*m.x1060 == 0)
m.c2530 = Constraint(expr=m.x404*m.x1430 - m.x888*m.x1060 == 0)
m.c2531 = Constraint(expr=m.x404*m.x1431 - m.x889*m.x1060 == 0)
m.c2532 = Constraint(expr=m.x404*m.x1432 - m.x890*m.x1060 == 0)
m.c2533 = Constraint(expr=m.x405*m.x1433 - m.x891*m.x1061 == 0)
m.c2534 = Constraint(expr=m.x405*m.x1434 - m.x892*m.x1061 == 0)
m.c2535 = Constraint(expr=m.x405*m.x1435 - m.x893*m.x1061 == 0)
m.c2536 = Constraint(expr=m.x405*m.x1436 - m.x894*m.x1061 == 0)
m.c2537 = Constraint(expr=m.x405*m.x1437 - m.x895*m.x1061 == 0)
m.c2538 = Constraint(expr=m.x405*m.x1438 - m.x896*m.x1061 == 0)
m.c2539 = Constraint(expr=m.x405*m.x1439 - m.x897*m.x1061 == 0)
m.c2540 = Constraint(expr=m.x406*m.x1433 - m.x898*m.x1061 == 0)
m.c2541 = Constraint(expr=m.x406*m.x1434 - m.x899*m.x1061 == 0)
m.c2542 = Constraint(expr=m.x406*m.x1435 - m.x900*m.x1061 == 0)
m.c2543 = Constraint(expr=m.x406*m.x1436 - m.x901*m.x1061 == 0)
m.c2544 = Constraint(expr=m.x406*m.x1437 - m.x902*m.x1061 == 0)
m.c2545 = Constraint(expr=m.x406*m.x1438 - m.x903*m.x1061 == 0)
m.c2546 = Constraint(expr=m.x406*m.x1439 - m.x904*m.x1061 == 0)
m.c2547 = Constraint(expr=m.x407*m.x1440 - m.x905*m.x1062 == 0)
m.c2548 = Constraint(expr=m.x407*m.x1441 - m.x906*m.x1062 == 0)
m.c2549 = Constraint(expr=m.x407*m.x1442 - m.x907*m.x1062 == 0)
m.c2550 = Constraint(expr=m.x407*m.x1443 - m.x908*m.x1062 == 0)
m.c2551 = Constraint(expr=m.x407*m.x1444 - m.x909*m.x1062 == 0)
m.c2552 = Constraint(expr=m.x407*m.x1445 - m.x910*m.x1062 == 0)
m.c2553 = Constraint(expr=m.x407*m.x1446 - m.x911*m.x1062 == 0)
m.c2554 = Constraint(expr=m.x408*m.x1461 - m.x912*m.x1065 == 0)
m.c2555 = Constraint(expr=m.x408*m.x1462 - m.x913*m.x1065 == 0)
m.c2556 = Constraint(expr=m.x408*m.x1463 - m.x914*m.x1065 == 0)
m.c2557 = Constraint(expr=m.x408*m.x1464 - m.x915*m.x1065 == 0)
m.c2558 = Constraint(expr=m.x408*m.x1465 - m.x916*m.x1065 == 0)
m.c2559 = Constraint(expr=m.x408*m.x1466 - m.x917*m.x1065 == 0)
m.c2560 = Constraint(expr=m.x408*m.x1467 - m.x918*m.x1065 == 0)
m.c2561 = Constraint(expr=m.x409*m.x1468 - m.x919*m.x1066 == 0)
m.c2562 = Constraint(expr=m.x409*m.x1469 - m.x920*m.x1066 == 0)
m.c2563 = Constraint(expr=m.x409*m.x1470 - m.x921*m.x1066 == 0)
m.c2564 = Constraint(expr=m.x409*m.x1471 - m.x922*m.x1066 == 0)
m.c2565 = Constraint(expr=m.x409*m.x1472 - m.x923*m.x1066 == 0)
m.c2566 = Constraint(expr=m.x409*m.x1473 - m.x924*m.x1066 == 0)
m.c2567 = Constraint(expr=m.x409*m.x1474 - m.x925*m.x1066 == 0)
m.c2568 = Constraint(expr=m.x410*m.x1475 - m.x926*m.x1067 == 0)
m.c2569 = Constraint(expr=m.x410*m.x1476 - m.x927*m.x1067 == 0)
m.c2570 = Constraint(expr=m.x410*m.x1477 - m.x928*m.x1067 == 0)
m.c2571 = Constraint(expr=m.x410*m.x1478 - m.x929*m.x1067 == 0)
m.c2572 = Constraint(expr=m.x410*m.x1479 - m.x930*m.x1067 == 0)
m.c2573 = Constraint(expr=m.x410*m.x1480 - m.x931*m.x1067 == 0)
m.c2574 = Constraint(expr=m.x410*m.x1481 - m.x932*m.x1067 == 0)
m.c2575 = Constraint(expr=m.x411*m.x1482 - m.x933*m.x1068 == 0)
m.c2576 = Constraint(expr=m.x411*m.x1483 - m.x934*m.x1068 == 0)
m.c2577 = Constraint(expr=m.x411*m.x1484 - m.x935*m.x1068 == 0)
m.c2578 = Constraint(expr=m.x411*m.x1485 - m.x936*m.x1068 == 0)
m.c2579 = Constraint(expr=m.x411*m.x1486 - m.x937*m.x1068 == 0)
m.c2580 = Constraint(expr=m.x411*m.x1487 - m.x938*m.x1068 == 0)
m.c2581 = Constraint(expr=m.x411*m.x1488 - m.x939*m.x1068 == 0)
m.c2582 = Constraint(expr=m.x412*m.x1482 - m.x940*m.x1068 == 0)
m.c2583 = Constraint(expr=m.x412*m.x1483 - m.x941*m.x1068 == 0)
m.c2584 = Constraint(expr=m.x412*m.x1484 - m.x942*m.x1068 == 0)
m.c2585 = Constraint(expr=m.x412*m.x1485 - m.x943*m.x1068 == 0)
m.c2586 = Constraint(expr=m.x412*m.x1486 - m.x944*m.x1068 == 0)
m.c2587 = Constraint(expr=m.x412*m.x1487 - m.x945*m.x1068 == 0)
m.c2588 = Constraint(expr=m.x412*m.x1488 - m.x946*m.x1068 == 0)
m.c2589 = Constraint(expr=m.x413*m.x1489 - m.x947*m.x1069 == 0)
m.c2590 = Constraint(expr=m.x413*m.x1490 - m.x948*m.x1069 == 0)
m.c2591 = Constraint(expr=m.x413*m.x1491 - m.x949*m.x1069 == 0)
m.c2592 = Constraint(expr=m.x413*m.x1492 - m.x950*m.x1069 == 0)
m.c2593 = Constraint(expr=m.x413*m.x1493 - m.x951*m.x1069 == 0)
m.c2594 = Constraint(expr=m.x413*m.x1494 - m.x952*m.x1069 == 0)
m.c2595 = Constraint(expr=m.x413*m.x1495 - m.x953*m.x1069 == 0)
m.c2596 = Constraint(expr=m.x414*m.x1489 - m.x954*m.x1069 == 0)
m.c2597 = Constraint(expr=m.x414*m.x1490 - m.x955*m.x1069 == 0)
m.c2598 = Constraint(expr=m.x414*m.x1491 - m.x956*m.x1069 == 0)
m.c2599 = Constraint(expr=m.x414*m.x1492 - m.x957*m.x1069 == 0)
m.c2600 = Constraint(expr=m.x414*m.x1493 - m.x958*m.x1069 == 0)
m.c2601 = Constraint(expr=m.x414*m.x1494 - m.x959*m.x1069 == 0)
m.c2602 = Constraint(expr=m.x414*m.x1495 - m.x960*m.x1069 == 0)
m.c2603 = Constraint(expr=m.x415*m.x1489 - m.x961*m.x1069 == 0)
m.c2604 = Constraint(expr=m.x415*m.x1490 - m.x962*m.x1069 == 0)
m.c2605 = Constraint(expr=m.x415*m.x1491 - m.x963*m.x1069 == 0)
m.c2606 = Constraint(expr=m.x415*m.x1492 - m.x964*m.x1069 == 0)
m.c2607 = Constraint(expr=m.x415*m.x1493 - m.x965*m.x1069 == 0)
m.c2608 = Constraint(expr=m.x415*m.x1494 - m.x966*m.x1069 == 0)
m.c2609 = Constraint(expr=m.x415*m.x1495 - m.x967*m.x1069 == 0)
m.c2610 = Constraint(expr=m.x416*m.x1496 - m.x968*m.x1070 == 0)
m.c2611 = Constraint(expr=m.x416*m.x1497 - m.x969*m.x1070 == 0)
m.c2612 = Constraint(expr=m.x416*m.x1498 - m.x970*m.x1070 == 0)
m.c2613 = Constraint(expr=m.x416*m.x1499 - m.x971*m.x1070 == 0)
m.c2614 = Constraint(expr=m.x416*m.x1500 - m.x972*m.x1070 == 0)
m.c2615 = Constraint(expr=m.x416*m.x1501 - m.x973*m.x1070 == 0)
m.c2616 = Constraint(expr=m.x416*m.x1502 - m.x974*m.x1070 == 0)
m.c2617 = Constraint(expr=m.x417*m.x1496 - m.x975*m.x1070 == 0)
m.c2618 = Constraint(expr=m.x417*m.x1497 - m.x976*m.x1070 == 0)
m.c2619 = Constraint(expr=m.x417*m.x1498 - m.x977*m.x1070 == 0)
m.c2620 = Constraint(expr=m.x417*m.x1499 - m.x978*m.x1070 == 0)
m.c2621 = Constraint(expr=m.x417*m.x1500 - m.x979*m.x1070 == 0)
m.c2622 = Constraint(expr=m.x417*m.x1501 - m.x980*m.x1070 == 0)
m.c2623 = Constraint(expr=m.x417*m.x1502 - m.x981*m.x1070 == 0)
m.c2624 = Constraint(expr=m.x418*m.x1503 - m.x982*m.x1071 == 0)
m.c2625 = Constraint(expr=m.x418*m.x1504 - m.x983*m.x1071 == 0)
m.c2626 = Constraint(expr=m.x418*m.x1505 - m.x984*m.x1071 == 0)
m.c2627 = Constraint(expr=m.x418*m.x1506 - m.x985*m.x1071 == 0)
m.c2628 = Constraint(expr=m.x418*m.x1507 - m.x986*m.x1071 == 0)
m.c2629 = Constraint(expr=m.x418*m.x1508 - m.x987*m.x1071 == 0)
m.c2630 = Constraint(expr=m.x418*m.x1509 - m.x988*m.x1071 == 0)
m.c2631 = Constraint(expr=m.x419*m.x1510 - m.x989*m.x1072 == 0)
m.c2632 = Constraint(expr=m.x419*m.x1511 - m.x990*m.x1072 == 0)
m.c2633 = Constraint(expr=m.x419*m.x1512 - m.x991*m.x1072 == 0)
m.c2634 = Constraint(expr=m.x419*m.x1513 - m.x992*m.x1072 == 0)
m.c2635 = Constraint(expr=m.x419*m.x1514 - m.x993*m.x1072 == 0)
m.c2636 = Constraint(expr=m.x419*m.x1515 - m.x994*m.x1072 == 0)
m.c2637 = Constraint(expr=m.x419*m.x1516 - m.x995*m.x1072 == 0)
m.c2638 = Constraint(expr=m.x420*m.x1510 - m.x996*m.x1072 == 0)
m.c2639 = Constraint(expr=m.x420*m.x1511 - m.x997*m.x1072 == 0)
m.c2640 = Constraint(expr=m.x420*m.x1512 - m.x998*m.x1072 == 0)
m.c2641 = Constraint(expr=m.x420*m.x1513 - m.x999*m.x1072 == 0)
m.c2642 = Constraint(expr=m.x420*m.x1514 - m.x1000*m.x1072 == 0)
m.c2643 = Constraint(expr=m.x420*m.x1515 - m.x1001*m.x1072 == 0)
m.c2644 = Constraint(expr=m.x420*m.x1516 - m.x1002*m.x1072 == 0)
m.c2645 = Constraint(expr=m.x421*m.x1517 - m.x1003*m.x1073 == 0)
m.c2646 = Constraint(expr=m.x421*m.x1518 - m.x1004*m.x1073 == 0)
m.c2647 = Constraint(expr=m.x421*m.x1519 - m.x1005*m.x1073 == 0)
m.c2648 = Constraint(expr=m.x421*m.x1520 - m.x1006*m.x1073 == 0)
m.c2649 = Constraint(expr=m.x421*m.x1521 - m.x1007*m.x1073 == 0)
m.c2650 = Constraint(expr=m.x421*m.x1522 - m.x1008*m.x1073 == 0)
m.c2651 = Constraint(expr=m.x421*m.x1523 - m.x1009*m.x1073 == 0)
m.c2652 = Constraint(expr= m.x338 >= 0)
m.c2653 = Constraint(expr= m.x339 >= 0)
m.c2654 = Constraint(expr= m.x340 >= 0)
m.c2655 = Constraint(expr= m.x341 >= 0)
m.c2656 = Constraint(expr= m.x342 >= 0)
m.c2657 = Constraint(expr= m.x343 >= 0)
m.c2658 = Constraint(expr= m.x344 >= 0)
m.c2659 = Constraint(expr= m.x345 >= 0)
m.c2660 = Constraint(expr= m.x346 >= 0)
m.c2661 = Constraint(expr= m.x347 >= 0)
m.c2662 = Constraint(expr= - 5*m.x180 + m.x348 >= 0)
m.c2663 = Constraint(expr= - 5*m.x181 + m.x349 >= 0)
m.c2664 = Constraint(expr= - 5*m.x182 + m.x350 >= 0)
m.c2665 = Constraint(expr= - 5*m.x183 + m.x351 >= 0)
m.c2666 = Constraint(expr= m.x352 >= 0)
m.c2667 = Constraint(expr= m.x353 >= 0)
m.c2668 = Constraint(expr= m.x354 >= 0)
m.c2669 = Constraint(expr= m.x355 >= 0)
m.c2670 = Constraint(expr= m.x356 >= 0)
m.c2671 = Constraint(expr= m.x357 >= 0)
m.c2672 = Constraint(expr= m.x358 >= 0)
m.c2673 = Constraint(expr= m.x359 >= 0)
m.c2674 = Constraint(expr= m.x360 >= 0)
m.c2675 = Constraint(expr= m.x361 >= 0)
m.c2676 = Constraint(expr= - 5*m.x194 + m.x362 >= 0)
m.c2677 = Constraint(expr= - 5*m.x195 + m.x363 >= 0)
m.c2678 = Constraint(expr= - 5*m.x196 + m.x364 >= 0)
m.c2679 = Constraint(expr= - 5*m.x197 + m.x365 >= 0)
m.c2680 = Constraint(expr= m.x366 >= 0)
m.c2681 = Constraint(expr= m.x367 >= 0)
m.c2682 = Constraint(expr= m.x368 >= 0)
m.c2683 = Constraint(expr= m.x369 >= 0)
m.c2684 = Constraint(expr= m.x370 >= 0)
m.c2685 = Constraint(expr= m.x371 >= 0)
m.c2686 = Constraint(expr= m.x372 >= 0)
m.c2687 = Constraint(expr= m.x373 >= 0)
m.c2688 = Constraint(expr= m.x374 >= 0)
m.c2689 = Constraint(expr= m.x375 >= 0)
m.c2690 = Constraint(expr= - 5*m.x208 + m.x376 >= 0)
m.c2691 = Constraint(expr= - 5*m.x209 + m.x377 >= 0)
m.c2692 = Constraint(expr= - 5*m.x210 + m.x378 >= 0)
m.c2693 = Constraint(expr= - 5*m.x211 + m.x379 >= 0)
m.c2694 = Constraint(expr= m.x380 >= 0)
m.c2695 = Constraint(expr= m.x381 >= 0)
m.c2696 = Constraint(expr= m.x382 >= 0)
m.c2697 = Constraint(expr= m.x383 >= 0)
m.c2698 = Constraint(expr= m.x384 >= 0)
m.c2699 = Constraint(expr= m.x385 >= 0)
m.c2700 = Constraint(expr= m.x386 >= 0)
m.c2701 = Constraint(expr= m.x387 >= 0)
m.c2702 = Constraint(expr= m.x388 >= 0)
m.c2703 = Constraint(expr= m.x389 >= 0)
m.c2704 = Constraint(expr= - 5*m.x222 + m.x390 >= 0)
m.c2705 = Constraint(expr= - 5*m.x223 + m.x391 >= 0)
m.c2706 = Constraint(expr= - 5*m.x224 + m.x392 >= 0)
m.c2707 = Constraint(expr= - 5*m.x225 + m.x393 >= 0)
m.c2708 = Constraint(expr= m.x394 >= 0)
m.c2709 = Constraint(expr= m.x395 >= 0)
m.c2710 = Constraint(expr= m.x396 >= 0)
m.c2711 = Constraint(expr= m.x397 >= 0)
m.c2712 = Constraint(expr= m.x398 >= 0)
m.c2713 = Constraint(expr= m.x399 >= 0)
m.c2714 = Constraint(expr= m.x400 >= 0)
m.c2715 = Constraint(expr= m.x401 >= 0)
m.c2716 = Constraint(expr= m.x402 >= 0)
m.c2717 = Constraint(expr= m.x403 >= 0)
m.c2718 = Constraint(expr= - 5*m.x236 + m.x404 >= 0)
m.c2719 = Constraint(expr= - 5*m.x237 + m.x405 >= 0)
m.c2720 = Constraint(expr= - 5*m.x238 + m.x406 >= 0)
m.c2721 = Constraint(expr= - 5*m.x239 + m.x407 >= 0)
m.c2722 = Constraint(expr= m.x408 >= 0)
m.c2723 = Constraint(expr= m.x409 >= 0)
m.c2724 = Constraint(expr= m.x410 >= 0)
m.c2725 = Constraint(expr= m.x411 >= 0)
m.c2726 = Constraint(expr= m.x412 >= 0)
m.c2727 = Constraint(expr= m.x413 >= 0)
m.c2728 = Constraint(expr= m.x414 >= 0)
m.c2729 = Constraint(expr= m.x415 >= 0)
m.c2730 = Constraint(expr= m.x416 >= 0)
m.c2731 = Constraint(expr= m.x417 >= 0)
m.c2732 = Constraint(expr= - 5*m.x250 + m.x418 >= 0)
m.c2733 = Constraint(expr= - 5*m.x251 + m.x419 >= 0)
m.c2734 = Constraint(expr= - 5*m.x252 + m.x420 >= 0)
m.c2735 = Constraint(expr= - 5*m.x253 + m.x421 >= 0)
m.c2736 = Constraint(expr= - 50*m.x170 + m.x338 <= 0)
m.c2737 = Constraint(expr= - 50*m.x171 + m.x339 <= 0)
m.c2738 = Constraint(expr= - 50*m.x172 + m.x340 <= 0)
m.c2739 = Constraint(expr= - 50*m.x173 + m.x341 <= 0)
m.c2740 = Constraint(expr= - 50*m.x174 + m.x342 <= 0)
m.c2741 = Constraint(expr= - 50*m.x175 + m.x343 <= 0)
m.c2742 = Constraint(expr= - 50*m.x176 + m.x344 <= 0)
m.c2743 = Constraint(expr= - 50*m.x177 + m.x345 <= 0)
m.c2744 = Constraint(expr= - 50*m.x178 + m.x346 <= 0)
m.c2745 = Constraint(expr= - 50*m.x179 + m.x347 <= 0)
m.c2746 = Constraint(expr= - 50*m.x180 + m.x348 <= 0)
m.c2747 = Constraint(expr= - 50*m.x181 + m.x349 <= 0)
m.c2748 = Constraint(expr= - 50*m.x182 + m.x350 <= 0)
m.c2749 = Constraint(expr= - 50*m.x183 + m.x351 <= 0)
m.c2750 = Constraint(expr= - 50*m.x184 + m.x352 <= 0)
m.c2751 = Constraint(expr= - 50*m.x185 + m.x353 <= 0)
m.c2752 = Constraint(expr= - 50*m.x186 + m.x354 <= 0)
m.c2753 = Constraint(expr= - 50*m.x187 + m.x355 <= 0)
m.c2754 = Constraint(expr= - 50*m.x188 + m.x356 <= 0)
m.c2755 = Constraint(expr= - 50*m.x189 + m.x357 <= 0)
m.c2756 = Constraint(expr= - 50*m.x190 + m.x358 <= 0)
m.c2757 = Constraint(expr= - 50*m.x191 + m.x359 <= 0)
m.c2758 = Constraint(expr= - 50*m.x192 + m.x360 <= 0)
m.c2759 = Constraint(expr= - 50*m.x193 + m.x361 <= 0)
m.c2760 = Constraint(expr= - 50*m.x194 + m.x362 <= 0)
m.c2761 = Constraint(expr= - 50*m.x195 + m.x363 <= 0)
m.c2762 = Constraint(expr= - 50*m.x196 + m.x364 <= 0)
m.c2763 = Constraint(expr= - 50*m.x197 + m.x365 <= 0)
m.c2764 = Constraint(expr= - 50*m.x198 + m.x366 <= 0)
m.c2765 = Constraint(expr= - 50*m.x199 + m.x367 <= 0)
m.c2766 = Constraint(expr= - 50*m.x200 + m.x368 <= 0)
m.c2767 = Constraint(expr= - 50*m.x201 + m.x369 <= 0)
m.c2768 = Constraint(expr= - 50*m.x202 + m.x370 <= 0)
m.c2769 = Constraint(expr= - 50*m.x203 + m.x371 <= 0)
m.c2770 = Constraint(expr= - 50*m.x204 + m.x372 <= 0)
m.c2771 = Constraint(expr= - 50*m.x205 + m.x373 <= 0)
m.c2772 = Constraint(expr= - 50*m.x206 + m.x374 <= 0)
m.c2773 = Constraint(expr= - 50*m.x207 + m.x375 <= 0)
m.c2774 = Constraint(expr= - 50*m.x208 + m.x376 <= 0)
m.c2775 = Constraint(expr= - 50*m.x209 + m.x377 <= 0)
m.c2776 = Constraint(expr= - 50*m.x210 + m.x378 <= 0)
m.c2777 = Constraint(expr= - 50*m.x211 + m.x379 <= 0)
m.c2778 = Constraint(expr= - 50*m.x212 + m.x380 <= 0)
m.c2779 = Constraint(expr= - 50*m.x213 + m.x381 <= 0)
m.c2780 = Constraint(expr= - 50*m.x214 + m.x382 <= 0)
m.c2781 = Constraint(expr= - 50*m.x215 + m.x383 <= 0)
m.c2782 = Constraint(expr= - 50*m.x216 + m.x384 <= 0)
m.c2783 = Constraint(expr= - 50*m.x217 + m.x385 <= 0)
m.c2784 = Constraint(expr= - 50*m.x218 + m.x386 <= 0)
m.c2785 = Constraint(expr= - 50*m.x219 + m.x387 <= 0)
m.c2786 = Constraint(expr= - 50*m.x220 + m.x388 <= 0)
m.c2787 = Constraint(expr= - 50*m.x221 + m.x389 <= 0)
m.c2788 = Constraint(expr= - 50*m.x222 + m.x390 <= 0)
m.c2789 = Constraint(expr= - 50*m.x223 + m.x391 <= 0)
m.c2790 = Constraint(expr= - 50*m.x224 + m.x392 <= 0)
m.c2791 = Constraint(expr= - 50*m.x225 + m.x393 <= 0)
m.c2792 = Constraint(expr= - 50*m.x226 + m.x394 <= 0)
m.c2793 = Constraint(expr= - 50*m.x227 + m.x395 <= 0)
m.c2794 = Constraint(expr= - 50*m.x228 + m.x396 <= 0)
m.c2795 = Constraint(expr= - 50*m.x229 + m.x397 <= 0)
m.c2796 = Constraint(expr= - 50*m.x230 + m.x398 <= 0)
m.c2797 = Constraint(expr= - 50*m.x231 + m.x399 <= 0)
m.c2798 = Constraint(expr= - 50*m.x232 + m.x400 <= 0)
m.c2799 = Constraint(expr= - 50*m.x233 + m.x401 <= 0)
m.c2800 = Constraint(expr= - 50*m.x234 + m.x402 <= 0)
m.c2801 = Constraint(expr= - 50*m.x235 + m.x403 <= 0)
m.c2802 = Constraint(expr= - 50*m.x236 + m.x404 <= 0)
m.c2803 = Constraint(expr= - 50*m.x237 + m.x405 <= 0)
m.c2804 = Constraint(expr= - 50*m.x238 + m.x406 <= 0)
m.c2805 = Constraint(expr= - 50*m.x239 + m.x407 <= 0)
m.c2806 = Constraint(expr= - 50*m.x240 + m.x408 <= 0)
m.c2807 = Constraint(expr= - 50*m.x241 + m.x409 <= 0)
m.c2808 = Constraint(expr= - 50*m.x242 + m.x410 <= 0)
m.c2809 = Constraint(expr= - 50*m.x243 + m.x411 <= 0)
m.c2810 = Constraint(expr= - 50*m.x244 + m.x412 <= 0)
m.c2811 = Constraint(expr= - 50*m.x245 + m.x413 <= 0)
m.c2812 = Constraint(expr= - 50*m.x246 + m.x414 <= 0)
m.c2813 = Constraint(expr= - 50*m.x247 + m.x415 <= 0)
m.c2814 = Constraint(expr= - 50*m.x248 + m.x416 <= 0)
m.c2815 = Constraint(expr= - 50*m.x249 + m.x417 <= 0)
m.c2816 = Constraint(expr= - 50*m.x250 + m.x418 <= 0)
m.c2817 = Constraint(expr= - 50*m.x251 + m.x419 <= 0)
m.c2818 = Constraint(expr= - 50*m.x252 + m.x420 <= 0)
m.c2819 = Constraint(expr= - 50*m.x253 + m.x421 <= 0)
m.c2820 = Constraint(expr= m.x180 + m.x181 + m.x194 + m.x195 + m.x208 + m.x209 + m.x222 + m.x223 + m.x236 + m.x237
+ m.x250 + m.x251 == 12)
m.c2821 = Constraint(expr= m.x182 + m.x183 + m.x196 + m.x197 + m.x210 + m.x211 + m.x224 + m.x225 + m.x238 + m.x239
+ m.x252 + m.x253 == 12)
m.c2822 = Constraint(expr= m.x348 + m.x362 + m.x376 + m.x390 + m.x404 + m.x418 >= 50)
m.c2823 = Constraint(expr= m.x351 + m.x365 + m.x379 + m.x393 + m.x407 + m.x421 >= 50)
m.c2824 = Constraint(expr= m.x349 + m.x350 + m.x363 + m.x364 + m.x377 + m.x378 + m.x391 + m.x392 + m.x405 + m.x406
+ m.x419 + m.x420 >= 50)
m.c2825 = Constraint(expr= m.x348 + m.x362 + m.x376 + m.x390 + m.x404 + m.x418 <= 50)
m.c2826 = Constraint(expr= m.x351 + m.x365 + m.x379 + m.x393 + m.x407 + m.x421 <= 50)
m.c2827 = Constraint(expr= m.x349 + m.x350 + m.x363 + m.x364 + m.x377 + m.x378 + m.x391 + m.x392 + m.x405 + m.x406
+ m.x419 + m.x420 <= 50)
m.c2828 = Constraint(expr= - 0.25*m.x348 + 0.1*m.x492 + 0.85*m.x493 + 0.6*m.x494 + 0.2*m.x495 + 0.5*m.x496 + 0.8*m.x497
+ 0.3*m.x498 >= 0)
m.c2829 = Constraint(expr= - 0.45*m.x349 + 0.1*m.x499 + 0.85*m.x500 + 0.6*m.x501 + 0.2*m.x502 + 0.5*m.x503 + 0.8*m.x504
+ 0.3*m.x505 >= 0)
m.c2830 = Constraint(expr= - 0.45*m.x350 + 0.1*m.x506 + 0.85*m.x507 + 0.6*m.x508 + 0.2*m.x509 + 0.5*m.x510 + 0.8*m.x511
+ 0.3*m.x512 >= 0)
m.c2831 = Constraint(expr= - 0.75*m.x351 + 0.1*m.x513 + 0.85*m.x514 + 0.6*m.x515 + 0.2*m.x516 + 0.5*m.x517 + 0.8*m.x518
+ 0.3*m.x519 >= 0)
m.c2832 = Constraint(expr= - 0.25*m.x362 + 0.1*m.x590 + 0.85*m.x591 + 0.6*m.x592 + 0.2*m.x593 + 0.5*m.x594 + 0.8*m.x595
+ 0.3*m.x596 >= 0)
m.c2833 = Constraint(expr= - 0.45*m.x363 + 0.1*m.x597 + 0.85*m.x598 + 0.6*m.x599 + 0.2*m.x600 + 0.5*m.x601 + 0.8*m.x602
+ 0.3*m.x603 >= 0)
m.c2834 = Constraint(expr= - 0.45*m.x364 + 0.1*m.x604 + 0.85*m.x605 + 0.6*m.x606 + 0.2*m.x607 + 0.5*m.x608 + 0.8*m.x609
+ 0.3*m.x610 >= 0)
m.c2835 = Constraint(expr= - 0.75*m.x365 + 0.1*m.x611 + 0.85*m.x612 + 0.6*m.x613 + 0.2*m.x614 + 0.5*m.x615 + 0.8*m.x616
+ 0.3*m.x617 >= 0)
m.c2836 = Constraint(expr= - 0.25*m.x376 + 0.1*m.x688 + 0.85*m.x689 + 0.6*m.x690 + 0.2*m.x691 + 0.5*m.x692 + 0.8*m.x693
+ 0.3*m.x694 >= 0)
m.c2837 = Constraint(expr= - 0.45*m.x377 + 0.1*m.x695 + 0.85*m.x696 + 0.6*m.x697 + 0.2*m.x698 + 0.5*m.x699 + 0.8*m.x700
+ 0.3*m.x701 >= 0)
m.c2838 = Constraint(expr= - 0.45*m.x378 + 0.1*m.x702 + 0.85*m.x703 + 0.6*m.x704 + 0.2*m.x705 + 0.5*m.x706 + 0.8*m.x707
+ 0.3*m.x708 >= 0)
m.c2839 = Constraint(expr= - 0.75*m.x379 + 0.1*m.x709 + 0.85*m.x710 + 0.6*m.x711 + 0.2*m.x712 + 0.5*m.x713 + 0.8*m.x714
+ 0.3*m.x715 >= 0)
m.c2840 = Constraint(expr= - 0.25*m.x390 + 0.1*m.x786 + 0.85*m.x787 + 0.6*m.x788 + 0.2*m.x789 + 0.5*m.x790 + 0.8*m.x791
+ 0.3*m.x792 >= 0)
m.c2841 = Constraint(expr= - 0.45*m.x391 + 0.1*m.x793 + 0.85*m.x794 + 0.6*m.x795 + 0.2*m.x796 + 0.5*m.x797 + 0.8*m.x798
+ 0.3*m.x799 >= 0)
m.c2842 = Constraint(expr= - 0.45*m.x392 + 0.1*m.x800 + 0.85*m.x801 + 0.6*m.x802 + 0.2*m.x803 + 0.5*m.x804 + 0.8*m.x805
+ 0.3*m.x806 >= 0)
m.c2843 = Constraint(expr= - 0.75*m.x393 + 0.1*m.x807 + 0.85*m.x808 + 0.6*m.x809 + 0.2*m.x810 + 0.5*m.x811 + 0.8*m.x812
+ 0.3*m.x813 >= 0)
m.c2844 = Constraint(expr= - 0.25*m.x404 + 0.1*m.x884 + 0.85*m.x885 + 0.6*m.x886 + 0.2*m.x887 + 0.5*m.x888 + 0.8*m.x889
+ 0.3*m.x890 >= 0)
m.c2845 = Constraint(expr= - 0.45*m.x405 + 0.1*m.x891 + 0.85*m.x892 + 0.6*m.x893 + 0.2*m.x894 + 0.5*m.x895 + 0.8*m.x896
+ 0.3*m.x897 >= 0)
m.c2846 = Constraint(expr= - 0.45*m.x406 + 0.1*m.x898 + 0.85*m.x899 + 0.6*m.x900 + 0.2*m.x901 + 0.5*m.x902 + 0.8*m.x903
+ 0.3*m.x904 >= 0)
m.c2847 = Constraint(expr= - 0.75*m.x407 + 0.1*m.x905 + 0.85*m.x906 + 0.6*m.x907 + 0.2*m.x908 + 0.5*m.x909 + 0.8*m.x910
+ 0.3*m.x911 >= 0)
m.c2848 = Constraint(expr= - 0.25*m.x418 + 0.1*m.x982 + 0.85*m.x983 + 0.6*m.x984 + 0.2*m.x985 + 0.5*m.x986 + 0.8*m.x987
+ 0.3*m.x988 >= 0)
m.c2849 = Constraint(expr= - 0.45*m.x419 + 0.1*m.x989 + 0.85*m.x990 + 0.6*m.x991 + 0.2*m.x992 + 0.5*m.x993 + 0.8*m.x994
+ 0.3*m.x995 >= 0)
m.c2850 = Constraint(expr= - 0.45*m.x420 + 0.1*m.x996 + 0.85*m.x997 + 0.6*m.x998 + 0.2*m.x999 + 0.5*m.x1000
+ 0.8*m.x1001 + 0.3*m.x1002 >= 0)
m.c2851 = Constraint(expr= - 0.75*m.x421 + 0.1*m.x1003 + 0.85*m.x1004 + 0.6*m.x1005 + 0.2*m.x1006 + 0.5*m.x1007
+ 0.8*m.x1008 + 0.3*m.x1009 >= 0)
m.c2852 = Constraint(expr= - 0.35*m.x348 + 0.1*m.x492 + 0.85*m.x493 + 0.6*m.x494 + 0.2*m.x495 + 0.5*m.x496 + 0.8*m.x497
+ 0.3*m.x498 <= 0)
m.c2853 = Constraint(expr= - 0.65*m.x349 + 0.1*m.x499 + 0.85*m.x500 + 0.6*m.x501 + 0.2*m.x502 + 0.5*m.x503 + 0.8*m.x504
+ 0.3*m.x505 <= 0)
m.c2854 = Constraint(expr= - 0.65*m.x350 + 0.1*m.x506 + 0.85*m.x507 + 0.6*m.x508 + 0.2*m.x509 + 0.5*m.x510 + 0.8*m.x511
+ 0.3*m.x512 <= 0)
m.c2855 = Constraint(expr= - 0.85*m.x351 + 0.1*m.x513 + 0.85*m.x514 + 0.6*m.x515 + 0.2*m.x516 + 0.5*m.x517 + 0.8*m.x518
+ 0.3*m.x519 <= 0)
m.c2856 = Constraint(expr= - 0.35*m.x362 + 0.1*m.x590 + 0.85*m.x591 + 0.6*m.x592 + 0.2*m.x593 + 0.5*m.x594 + 0.8*m.x595
+ 0.3*m.x596 <= 0)
m.c2857 = Constraint(expr= - 0.65*m.x363 + 0.1*m.x597 + 0.85*m.x598 + 0.6*m.x599 + 0.2*m.x600 + 0.5*m.x601 + 0.8*m.x602
+ 0.3*m.x603 <= 0)
m.c2858 = Constraint(expr= - 0.65*m.x364 + 0.1*m.x604 + 0.85*m.x605 + 0.6*m.x606 + 0.2*m.x607 + 0.5*m.x608 + 0.8*m.x609
+ 0.3*m.x610 <= 0)
m.c2859 = Constraint(expr= - 0.85*m.x365 + 0.1*m.x611 + 0.85*m.x612 + 0.6*m.x613 + 0.2*m.x614 + 0.5*m.x615 + 0.8*m.x616
+ 0.3*m.x617 <= 0)
m.c2860 = Constraint(expr= - 0.35*m.x376 + 0.1*m.x688 + 0.85*m.x689 + 0.6*m.x690 + 0.2*m.x691 + 0.5*m.x692 + 0.8*m.x693
+ 0.3*m.x694 <= 0)
m.c2861 = Constraint(expr= - 0.65*m.x377 + 0.1*m.x695 + 0.85*m.x696 + 0.6*m.x697 + 0.2*m.x698 + 0.5*m.x699 + 0.8*m.x700
+ 0.3*m.x701 <= 0)
m.c2862 = Constraint(expr= - 0.65*m.x378 + 0.1*m.x702 + 0.85*m.x703 + 0.6*m.x704 + 0.2*m.x705 + 0.5*m.x706 + 0.8*m.x707
+ 0.3*m.x708 <= 0)
m.c2863 = Constraint(expr= - 0.85*m.x379 + 0.1*m.x709 + 0.85*m.x710 + 0.6*m.x711 + 0.2*m.x712 + 0.5*m.x713 + 0.8*m.x714
+ 0.3*m.x715 <= 0)
m.c2864 = Constraint(expr= - 0.35*m.x390 + 0.1*m.x786 + 0.85*m.x787 + 0.6*m.x788 + 0.2*m.x789 + 0.5*m.x790 + 0.8*m.x791
+ 0.3*m.x792 <= 0)
m.c2865 = Constraint(expr= - 0.65*m.x391 + 0.1*m.x793 + 0.85*m.x794 + 0.6*m.x795 + 0.2*m.x796 + 0.5*m.x797 + 0.8*m.x798
+ 0.3*m.x799 <= 0)
m.c2866 = Constraint(expr= - 0.65*m.x392 + 0.1*m.x800 + 0.85*m.x801 + 0.6*m.x802 + 0.2*m.x803 + 0.5*m.x804 + 0.8*m.x805
+ 0.3*m.x806 <= 0)
m.c2867 = Constraint(expr= - 0.85*m.x393 + 0.1*m.x807 + 0.85*m.x808 + 0.6*m.x809 + 0.2*m.x810 + 0.5*m.x811 + 0.8*m.x812
+ 0.3*m.x813 <= 0)
m.c2868 = Constraint(expr= - 0.35*m.x404 + 0.1*m.x884 + 0.85*m.x885 + 0.6*m.x886 + 0.2*m.x887 + 0.5*m.x888 + 0.8*m.x889
+ 0.3*m.x890 <= 0)
m.c2869 = Constraint(expr= - 0.65*m.x405 + 0.1*m.x891 + 0.85*m.x892 + 0.6*m.x893 + 0.2*m.x894 + 0.5*m.x895 + 0.8*m.x896
+ 0.3*m.x897 <= 0)
m.c2870 = Constraint(expr= - 0.65*m.x406 + 0.1*m.x898 + 0.85*m.x899 + 0.6*m.x900 + 0.2*m.x901 + 0.5*m.x902 + 0.8*m.x903
+ 0.3*m.x904 <= 0)
m.c2871 = Constraint(expr= - 0.85*m.x407 + 0.1*m.x905 + 0.85*m.x906 + 0.6*m.x907 + 0.2*m.x908 + 0.5*m.x909 + 0.8*m.x910
+ 0.3*m.x911 <= 0)
m.c2872 = Constraint(expr= - 0.35*m.x418 + 0.1*m.x982 + 0.85*m.x983 + 0.6*m.x984 + 0.2*m.x985 + 0.5*m.x986 + 0.8*m.x987
+ 0.3*m.x988 <= 0)
m.c2873 = Constraint(expr= - 0.65*m.x419 + 0.1*m.x989 + 0.85*m.x990 + 0.6*m.x991 + 0.2*m.x992 + 0.5*m.x993 + 0.8*m.x994
+ 0.3*m.x995 <= 0)
m.c2874 = Constraint(expr= - 0.65*m.x420 + 0.1*m.x996 + 0.85*m.x997 + 0.6*m.x998 + 0.2*m.x999 + 0.5*m.x1000
+ 0.8*m.x1001 + 0.3*m.x1002 <= 0)
m.c2875 = Constraint(expr= - 0.85*m.x421 + 0.1*m.x1003 + 0.85*m.x1004 + 0.6*m.x1005 + 0.2*m.x1006 + 0.5*m.x1007
+ 0.8*m.x1008 + 0.3*m.x1009 <= 0)
m.c2876 = Constraint(expr= - m.x338 - m.x352 - m.x366 - m.x380 - m.x394 - m.x408 >= -50)
m.c2877 = Constraint(expr= - m.x339 - m.x353 - m.x367 - m.x381 - m.x395 - m.x409 >= -50)
m.c2878 = Constraint(expr= - m.x340 - m.x354 - m.x368 - m.x382 - m.x396 - m.x410 >= -50)
m.c2879 = Constraint(expr= m.x338 - m.x341 - m.x342 + m.x352 - m.x355 - m.x356 + m.x366 - m.x369 - m.x370 + m.x380
- m.x383 - m.x384 + m.x394 - m.x397 - m.x398 + m.x408 - m.x411 - m.x412 >= -20)
m.c2880 = Constraint(expr= m.x339 - m.x343 - m.x344 - m.x345 + m.x353 - m.x357 - m.x358 - m.x359 + m.x367 - m.x371
- m.x372 - m.x373 + m.x381 - m.x385 - m.x386 - m.x387 + m.x395 - m.x399 - m.x400 - m.x401
+ m.x409 - m.x413 - m.x414 - m.x415 >= -20)
m.c2881 = Constraint(expr= m.x340 - m.x346 - m.x347 + m.x354 - m.x360 - m.x361 + m.x368 - m.x374 - m.x375 + m.x382
- m.x388 - m.x389 + m.x396 - m.x402 - m.x403 + m.x410 - m.x416 - m.x417 >= -20)
m.c2882 = Constraint(expr= m.x341 + m.x343 - m.x348 + m.x355 + m.x357 - m.x362 + m.x369 + m.x371 - m.x376 + m.x383
+ m.x385 - m.x390 + m.x397 + m.x399 - m.x404 + m.x411 + m.x413 - m.x418 >= -30)
m.c2883 = Constraint(expr= m.x342 + m.x344 + m.x346 - m.x349 - m.x350 + m.x356 + m.x358 + m.x360 - m.x363 - m.x364
+ m.x370 + m.x372 + m.x374 - m.x377 - m.x378 + m.x384 + m.x386 + m.x388 - m.x391 - m.x392
+ m.x398 + m.x400 + m.x402 - m.x405 - m.x406 + m.x412 + m.x414 + m.x416 - m.x419 - m.x420
>= -50)
m.c2884 = Constraint(expr= m.x345 + m.x347 - m.x351 + m.x359 + m.x361 - m.x365 + m.x373 + m.x375 - m.x379 + m.x387
+ m.x389 - m.x393 + m.x401 + m.x403 - m.x407 + m.x415 + m.x417 - m.x421 >= -30)
m.c2885 = Constraint(expr= m.x348 + m.x349 + m.x362 + m.x363 + m.x376 + m.x377 + m.x390 + m.x391 + m.x404 + m.x405
+ m.x418 + m.x419 >= 0)
m.c2886 = Constraint(expr= m.x350 + m.x351 + m.x364 + m.x365 + m.x378 + m.x379 + m.x392 + m.x393 + m.x406 + m.x407
+ m.x420 + m.x421 >= 0)
m.c2887 = Constraint(expr= - m.x338 - m.x352 - m.x366 - m.x380 - m.x394 - m.x408 <= 0)
m.c2888 = Constraint(expr= - m.x339 - m.x353 - m.x367 - m.x381 - m.x395 - m.x409 <= 0)
m.c2889 = Constraint(expr= - m.x340 - m.x354 - m.x368 - m.x382 - m.x396 - m.x410 <= 0)
m.c2890 = Constraint(expr= m.x338 - m.x341 - m.x342 + m.x352 - m.x355 - m.x356 + m.x366 - m.x369 - m.x370 + m.x380
- m.x383 - m.x384 + m.x394 - m.x397 - m.x398 + m.x408 - m.x411 - m.x412 <= 80)
m.c2891 = Constraint(expr= m.x339 - m.x343 - m.x344 - m.x345 + m.x353 - m.x357 - m.x358 - m.x359 + m.x367 - m.x371
- m.x372 - m.x373 + m.x381 - m.x385 - m.x386 - m.x387 + m.x395 - m.x399 - m.x400 - m.x401
+ m.x409 - m.x413 - m.x414 - m.x415 <= 80)
m.c2892 = Constraint(expr= m.x340 - m.x346 - m.x347 + m.x354 - m.x360 - m.x361 + m.x368 - m.x374 - m.x375 + m.x382
- m.x388 - m.x389 + m.x396 - m.x402 - m.x403 + m.x410 - m.x416 - m.x417 <= 80)
m.c2893 = Constraint(expr= m.x341 + m.x343 - m.x348 + m.x355 + m.x357 - m.x362 + m.x369 + m.x371 - m.x376 + m.x383
+ m.x385 - m.x390 + m.x397 + m.x399 - m.x404 + m.x411 + m.x413 - m.x418 <= 70)
m.c2894 = Constraint(expr= m.x342 + m.x344 + m.x346 - m.x349 - m.x350 + m.x356 + m.x358 + m.x360 - m.x363 - m.x364
+ m.x370 + m.x372 + m.x374 - m.x377 - m.x378 + m.x384 + m.x386 + m.x388 - m.x391 - m.x392
+ m.x398 + m.x400 + m.x402 - m.x405 - m.x406 + m.x412 + m.x414 + m.x416 - m.x419 - m.x420
<= 50)
m.c2895 = Constraint(expr= m.x345 + m.x347 - m.x351 + m.x359 + m.x361 - m.x365 + m.x373 + m.x375 - m.x379 + m.x387
+ m.x389 - m.x393 + m.x401 + m.x403 - m.x407 + m.x415 + m.x417 - m.x421 <= 70)
m.c2896 = Constraint(expr= - m.x422 - m.x520 - m.x618 - m.x716 - m.x814 - m.x912 >= -50)
m.c2897 = Constraint(expr= - m.x423 - m.x521 - m.x619 - m.x717 - m.x815 - m.x913 >= 0)
m.c2898 = Constraint(expr= - m.x424 - m.x522 - m.x620 - m.x718 - m.x816 - m.x914 >= 0)
m.c2899 = Constraint(expr= - m.x425 - m.x523 - m.x621 - m.x719 - m.x817 - m.x915 >= 0)
m.c2900 = Constraint(expr= - m.x426 - m.x524 - m.x622 - m.x720 - m.x818 - m.x916 >= 0)
m.c2901 = Constraint(expr= - m.x427 - m.x525 - m.x623 - m.x721 - m.x819 - m.x917 >= 0)
m.c2902 = Constraint(expr= - m.x428 - m.x526 - m.x624 - m.x722 - m.x820 - m.x918 >= 0)
m.c2903 = Constraint(expr= - m.x429 - m.x527 - m.x625 - m.x723 - m.x821 - m.x919 >= 0)
m.c2904 = Constraint(expr= - m.x430 - m.x528 - m.x626 - m.x724 - m.x822 - m.x920 >= -50)
m.c2905 = Constraint(expr= - m.x431 - m.x529 - m.x627 - m.x725 - m.x823 - m.x921 >= 0)
m.c2906 = Constraint(expr= - m.x432 - m.x530 - m.x628 - m.x726 - m.x824 - m.x922 >= 0)
m.c2907 = Constraint(expr= - m.x433 - m.x531 - m.x629 - m.x727 - m.x825 - m.x923 >= 0)
m.c2908 = Constraint(expr= - m.x434 - m.x532 - m.x630 - m.x728 - m.x826 - m.x924 >= 0)
m.c2909 = Constraint(expr= - m.x435 - m.x533 - m.x631 - m.x729 - m.x827 - m.x925 >= 0)
m.c2910 = Constraint(expr= - m.x436 - m.x534 - m.x632 - m.x730 - m.x828 - m.x926 >= 0)
m.c2911 = Constraint(expr= - m.x437 - m.x535 - m.x633 - m.x731 - m.x829 - m.x927 >= 0)
m.c2912 = Constraint(expr= - m.x438 - m.x536 - m.x634 - m.x732 - m.x830 - m.x928 >= -50)
m.c2913 = Constraint(expr= - m.x439 - m.x537 - m.x635 - m.x733 - m.x831 - m.x929 >= 0)
m.c2914 = Constraint(expr= - m.x440 - m.x538 - m.x636 - m.x734 - m.x832 - m.x930 >= 0)
m.c2915 = Constraint(expr= - m.x441 - m.x539 - m.x637 - m.x735 - m.x833 - m.x931 >= 0)
m.c2916 = Constraint(expr= - m.x442 - m.x540 - m.x638 - m.x736 - m.x834 - m.x932 >= 0)
m.c2917 = Constraint(expr= m.x422 - m.x443 - m.x450 + m.x520 - m.x541 - m.x548 + m.x618 - m.x639 - m.x646 + m.x716
- m.x737 - m.x744 + m.x814 - m.x835 - m.x842 + m.x912 - m.x933 - m.x940 >= 0)
m.c2918 = Constraint(expr= m.x423 - m.x444 - m.x451 + m.x521 - m.x542 - m.x549 + m.x619 - m.x640 - m.x647 + m.x717
- m.x738 - m.x745 + m.x815 - m.x836 - m.x843 + m.x913 - m.x934 - m.x941 >= 0)
m.c2919 = Constraint(expr= m.x424 - m.x445 - m.x452 + m.x522 - m.x543 - m.x550 + m.x620 - m.x641 - m.x648 + m.x718
- m.x739 - m.x746 + m.x816 - m.x837 - m.x844 + m.x914 - m.x935 - m.x942 >= 0)
m.c2920 = Constraint(expr= m.x425 - m.x446 - m.x453 + m.x523 - m.x544 - m.x551 + m.x621 - m.x642 - m.x649 + m.x719
- m.x740 - m.x747 + m.x817 - m.x838 - m.x845 + m.x915 - m.x936 - m.x943 >= -20)
m.c2921 = Constraint(expr= m.x426 - m.x447 - m.x454 + m.x524 - m.x545 - m.x552 + m.x622 - m.x643 - m.x650 + m.x720
- m.x741 - m.x748 + m.x818 - m.x839 - m.x846 + m.x916 - m.x937 - m.x944 >= 0)
m.c2922 = Constraint(expr= m.x427 - m.x448 - m.x455 + m.x525 - m.x546 - m.x553 + m.x623 - m.x644 - m.x651 + m.x721
- m.x742 - m.x749 + m.x819 - m.x840 - m.x847 + m.x917 - m.x938 - m.x945 >= 0)
m.c2923 = Constraint(expr= m.x428 - m.x449 - m.x456 + m.x526 - m.x547 - m.x554 + m.x624 - m.x645 - m.x652 + m.x722
- m.x743 - m.x750 + m.x820 - m.x841 - m.x848 + m.x918 - m.x939 - m.x946 >= 0)
m.c2924 = Constraint(expr= m.x429 - m.x457 - m.x464 - m.x471 + m.x527 - m.x555 - m.x562 - m.x569 + m.x625 - m.x653
- m.x660 - m.x667 + m.x723 - m.x751 - m.x758 - m.x765 + m.x821 - m.x849 - m.x856 - m.x863
+ m.x919 - m.x947 - m.x954 - m.x961 >= 0)
m.c2925 = Constraint(expr= m.x430 - m.x458 - m.x465 - m.x472 + m.x528 - m.x556 - m.x563 - m.x570 + m.x626 - m.x654
- m.x661 - m.x668 + m.x724 - m.x752 - m.x759 - m.x766 + m.x822 - m.x850 - m.x857 - m.x864
+ m.x920 - m.x948 - m.x955 - m.x962 >= 0)
m.c2926 = Constraint(expr= m.x431 - m.x459 - m.x466 - m.x473 + m.x529 - m.x557 - m.x564 - m.x571 + m.x627 - m.x655
- m.x662 - m.x669 + m.x725 - m.x753 - m.x760 - m.x767 + m.x823 - m.x851 - m.x858 - m.x865
+ m.x921 - m.x949 - m.x956 - m.x963 >= 0)
m.c2927 = Constraint(expr= m.x432 - m.x460 - m.x467 - m.x474 + m.x530 - m.x558 - m.x565 - m.x572 + m.x628 - m.x656
- m.x663 - m.x670 + m.x726 - m.x754 - m.x761 - m.x768 + m.x824 - m.x852 - m.x859 - m.x866
+ m.x922 - m.x950 - m.x957 - m.x964 >= 0)
m.c2928 = Constraint(expr= m.x433 - m.x461 - m.x468 - m.x475 + m.x531 - m.x559 - m.x566 - m.x573 + m.x629 - m.x657
- m.x664 - m.x671 + m.x727 - m.x755 - m.x762 - m.x769 + m.x825 - m.x853 - m.x860 - m.x867
+ m.x923 - m.x951 - m.x958 - m.x965 >= -20)
m.c2929 = Constraint(expr= m.x434 - m.x462 - m.x469 - m.x476 + m.x532 - m.x560 - m.x567 - m.x574 + m.x630 - m.x658
- m.x665 - m.x672 + m.x728 - m.x756 - m.x763 - m.x770 + m.x826 - m.x854 - m.x861 - m.x868
+ m.x924 - m.x952 - m.x959 - m.x966 >= 0)
m.c2930 = Constraint(expr= m.x435 - m.x463 - m.x470 - m.x477 + m.x533 - m.x561 - m.x568 - m.x575 + m.x631 - m.x659
- m.x666 - m.x673 + m.x729 - m.x757 - m.x764 - m.x771 + m.x827 - m.x855 - m.x862 - m.x869
+ m.x925 - m.x953 - m.x960 - m.x967 >= 0)
m.c2931 = Constraint(expr= m.x436 - m.x478 - m.x485 + m.x534 - m.x576 - m.x583 + m.x632 - m.x674 - m.x681 + m.x730
- m.x772 - m.x779 + m.x828 - m.x870 - m.x877 + m.x926 - m.x968 - m.x975 >= 0)
m.c2932 = Constraint(expr= m.x437 - m.x479 - m.x486 + m.x535 - m.x577 - m.x584 + m.x633 - m.x675 - m.x682 + m.x731
- m.x773 - m.x780 + m.x829 - m.x871 - m.x878 + m.x927 - m.x969 - m.x976 >= 0)
m.c2933 = Constraint(expr= m.x438 - m.x480 - m.x487 + m.x536 - m.x578 - m.x585 + m.x634 - m.x676 - m.x683 + m.x732
- m.x774 - m.x781 + m.x830 - m.x872 - m.x879 + m.x928 - m.x970 - m.x977 >= 0)
m.c2934 = Constraint(expr= m.x439 - m.x481 - m.x488 + m.x537 - m.x579 - m.x586 + m.x635 - m.x677 - m.x684 + m.x733
- m.x775 - m.x782 + m.x831 - m.x873 - m.x880 + m.x929 - m.x971 - m.x978 >= 0)
m.c2935 = Constraint(expr= m.x440 - m.x482 - m.x489 + m.x538 - m.x580 - m.x587 + m.x636 - m.x678 - m.x685 + m.x734
- m.x776 - m.x783 + m.x832 - m.x874 - m.x881 + m.x930 - m.x972 - m.x979 >= 0)
m.c2936 = Constraint(expr= m.x441 - m.x483 - m.x490 + m.x539 - m.x581 - m.x588 + m.x637 - m.x679 - m.x686 + m.x735
- m.x777 - m.x784 + m.x833 - m.x875 - m.x882 + m.x931 - m.x973 - m.x980 >= -20)
m.c2937 = Constraint(expr= m.x442 - m.x484 - m.x491 + m.x540 - m.x582 - m.x589 + m.x638 - m.x680 - m.x687 + m.x736
- m.x778 - m.x785 + m.x834 - m.x876 - m.x883 + m.x932 - m.x974 - m.x981 >= 0)
m.c2938 = Constraint(expr= m.x443 + m.x457 - m.x492 + m.x541 + m.x555 - m.x590 + m.x639 + m.x653 - m.x688 + m.x737
+ m.x751 - m.x786 + m.x835 + m.x849 - m.x884 + m.x933 + m.x947 - m.x982 >= 0)
m.c2939 = Constraint(expr= m.x444 + m.x458 - m.x493 + m.x542 + m.x556 - m.x591 + m.x640 + m.x654 - m.x689 + m.x738
+ m.x752 - m.x787 + m.x836 + m.x850 - m.x885 + m.x934 + m.x948 - m.x983 >= 0)
m.c2940 = Constraint(expr= m.x445 + m.x459 - m.x494 + m.x543 + m.x557 - m.x592 + m.x641 + m.x655 - m.x690 + m.x739
+ m.x753 - m.x788 + m.x837 + m.x851 - m.x886 + m.x935 + m.x949 - m.x984 >= 0)
m.c2941 = Constraint(expr= m.x446 + m.x460 - m.x495 + m.x544 + m.x558 - m.x593 + m.x642 + m.x656 - m.x691 + m.x740
+ m.x754 - m.x789 + m.x838 + m.x852 - m.x887 + m.x936 + m.x950 - m.x985 >= 0)
m.c2942 = Constraint(expr= m.x447 + m.x461 - m.x496 + m.x545 + m.x559 - m.x594 + m.x643 + m.x657 - m.x692 + m.x741
+ m.x755 - m.x790 + m.x839 + m.x853 - m.x888 + m.x937 + m.x951 - m.x986 >= 0)
m.c2943 = Constraint(expr= m.x448 + m.x462 - m.x497 + m.x546 + m.x560 - m.x595 + m.x644 + m.x658 - m.x693 + m.x742
+ m.x756 - m.x791 + m.x840 + m.x854 - m.x889 + m.x938 + m.x952 - m.x987 >= 0)
m.c2944 = Constraint(expr= m.x449 + m.x463 - m.x498 + m.x547 + m.x561 - m.x596 + m.x645 + m.x659 - m.x694 + m.x743
+ m.x757 - m.x792 + m.x841 + m.x855 - m.x890 + m.x939 + m.x953 - m.x988 >= -30)
m.c2945 = Constraint(expr= m.x450 + m.x464 + m.x478 - m.x499 - m.x506 + m.x548 + m.x562 + m.x576 - m.x597 - m.x604
+ m.x646 + m.x660 + m.x674 - m.x695 - m.x702 + m.x744 + m.x758 + m.x772 - m.x793 - m.x800
+ m.x842 + m.x856 + m.x870 - m.x891 - m.x898 + m.x940 + m.x954 + m.x968 - m.x989 - m.x996
>= 0)
m.c2946 = Constraint(expr= m.x451 + m.x465 + m.x479 - m.x500 - m.x507 + m.x549 + m.x563 + m.x577 - m.x598 - m.x605
+ m.x647 + m.x661 + m.x675 - m.x696 - m.x703 + m.x745 + m.x759 + m.x773 - m.x794 - m.x801
+ m.x843 + m.x857 + m.x871 - m.x892 - m.x899 + m.x941 + m.x955 + m.x969 - m.x990 - m.x997
>= 0)
m.c2947 = Constraint(expr= m.x452 + m.x466 + m.x480 - m.x501 - m.x508 + m.x550 + m.x564 + m.x578 - m.x599 - m.x606
+ m.x648 + m.x662 + m.x676 - m.x697 - m.x704 + m.x746 + m.x760 + m.x774 - m.x795 - m.x802
+ m.x844 + m.x858 + m.x872 - m.x893 - m.x900 + m.x942 + m.x956 + m.x970 - m.x991 - m.x998
>= 0)
m.c2948 = Constraint(expr= m.x453 + m.x467 + m.x481 - m.x502 - m.x509 + m.x551 + m.x565 + m.x579 - m.x600 - m.x607
+ m.x649 + m.x663 + m.x677 - m.x698 - m.x705 + m.x747 + m.x761 + m.x775 - m.x796 - m.x803
+ m.x845 + m.x859 + m.x873 - m.x894 - m.x901 + m.x943 + m.x957 + m.x971 - m.x992 - m.x999
>= 0)
m.c2949 = Constraint(expr= m.x454 + m.x468 + m.x482 - m.x503 - m.x510 + m.x552 + m.x566 + m.x580 - m.x601 - m.x608
+ m.x650 + m.x664 + m.x678 - m.x699 - m.x706 + m.x748 + m.x762 + m.x776 - m.x797 - m.x804
+ m.x846 + m.x860 + m.x874 - m.x895 - m.x902 + m.x944 + m.x958 + m.x972 - m.x993 - m.x1000
>= -50)
m.c2950 = Constraint(expr= m.x455 + m.x469 + m.x483 - m.x504 - m.x511 + m.x553 + m.x567 + m.x581 - m.x602 - m.x609
+ m.x651 + m.x665 + m.x679 - m.x700 - m.x707 + m.x749 + m.x763 + m.x777 - m.x798 - m.x805
+ m.x847 + m.x861 + m.x875 - m.x896 - m.x903 + m.x945 + m.x959 + m.x973 - m.x994 - m.x1001
>= 0)
m.c2951 = Constraint(expr= m.x456 + m.x470 + m.x484 - m.x505 - m.x512 + m.x554 + m.x568 + m.x582 - m.x603 - m.x610
+ m.x652 + m.x666 + m.x680 - m.x701 - m.x708 + m.x750 + m.x764 + m.x778 - m.x799 - m.x806
+ m.x848 + m.x862 + m.x876 - m.x897 - m.x904 + m.x946 + m.x960 + m.x974 - m.x995 - m.x1002
>= 0)
m.c2952 = Constraint(expr= m.x471 + m.x485 - m.x513 + m.x569 + m.x583 - m.x611 + m.x667 + m.x681 - m.x709 + m.x765
+ m.x779 - m.x807 + m.x863 + m.x877 - m.x905 + m.x961 + m.x975 - m.x1003 >= 0)
m.c2953 = Constraint(expr= m.x472 + m.x486 - m.x514 + m.x570 + m.x584 - m.x612 + m.x668 + m.x682 - m.x710 + m.x766
+ m.x780 - m.x808 + m.x864 + m.x878 - m.x906 + m.x962 + m.x976 - m.x1004 >= 0)
m.c2954 = Constraint(expr= m.x473 + m.x487 - m.x515 + m.x571 + m.x585 - m.x613 + m.x669 + m.x683 - m.x711 + m.x767
+ m.x781 - m.x809 + m.x865 + m.x879 - m.x907 + m.x963 + m.x977 - m.x1005 >= 0)
m.c2955 = Constraint(expr= m.x474 + m.x488 - m.x516 + m.x572 + m.x586 - m.x614 + m.x670 + m.x684 - m.x712 + m.x768
+ m.x782 - m.x810 + m.x866 + m.x880 - m.x908 + m.x964 + m.x978 - m.x1006 >= 0)
m.c2956 = Constraint(expr= m.x475 + m.x489 - m.x517 + m.x573 + m.x587 - m.x615 + m.x671 + m.x685 - m.x713 + m.x769
+ m.x783 - m.x811 + m.x867 + m.x881 - m.x909 + m.x965 + m.x979 - m.x1007 >= 0)
m.c2957 = Constraint(expr= m.x476 + m.x490 - m.x518 + m.x574 + m.x588 - m.x616 + m.x672 + m.x686 - m.x714 + m.x770
+ m.x784 - m.x812 + m.x868 + m.x882 - m.x910 + m.x966 + m.x980 - m.x1008 >= -30)
m.c2958 = Constraint(expr= m.x477 + m.x491 - m.x519 + m.x575 + m.x589 - m.x617 + m.x673 + m.x687 - m.x715 + m.x771
+ m.x785 - m.x813 + m.x869 + m.x883 - m.x911 + m.x967 + m.x981 - m.x1009 >= 0)
m.c2959 = Constraint(expr= m.x492 + m.x499 + m.x590 + m.x597 + m.x688 + m.x695 + m.x786 + m.x793 + m.x884 + m.x891
+ m.x982 + m.x989 >= 0)
m.c2960 = Constraint(expr= m.x493 + m.x500 + m.x591 + m.x598 + m.x689 + m.x696 + m.x787 + m.x794 + m.x885 + m.x892
+ m.x983 + m.x990 >= 0)
m.c2961 = Constraint(expr= m.x494 + m.x501 + m.x592 + m.x599 + m.x690 + m.x697 + m.x788 + m.x795 + m.x886 + m.x893
+ m.x984 + m.x991 >= 0)
m.c2962 = Constraint(expr= m.x495 + m.x502 + m.x593 + m.x600 + m.x691 + m.x698 + m.x789 + m.x796 + m.x887 + m.x894
+ m.x985 + m.x992 >= 0)
m.c2963 = Constraint(expr= m.x496 + m.x503 + m.x594 + m.x601 + m.x692 + m.x699 + m.x790 + m.x797 + m.x888 + m.x895
+ m.x986 + m.x993 >= 0)
m.c2964 = Constraint(expr= m.x497 + m.x504 + m.x595 + m.x602 + m.x693 + m.x700 + m.x791 + m.x798 + m.x889 + m.x896
+ m.x987 + m.x994 >= 0)
m.c2965 = Constraint(expr= m.x498 + m.x505 + m.x596 + m.x603 + m.x694 + m.x701 + m.x792 + m.x799 + m.x890 + m.x897
+ m.x988 + m.x995 >= 0)
m.c2966 = Constraint(expr= m.x506 + m.x513 + m.x604 + m.x611 + m.x702 + m.x709 + m.x800 + m.x807 + m.x898 + m.x905
+ m.x996 + m.x1003 >= 0)
m.c2967 = Constraint(expr= m.x507 + m.x514 + m.x605 + m.x612 + m.x703 + m.x710 + m.x801 + m.x808 + m.x899 + m.x906
+ m.x997 + m.x1004 >= 0)
m.c2968 = Constraint(expr= m.x508 + m.x515 + m.x606 + m.x613 + m.x704 + m.x711 + m.x802 + m.x809 + m.x900 + m.x907
+ m.x998 + m.x1005 >= 0)
m.c2969 = Constraint(expr= m.x509 + m.x516 + m.x607 + m.x614 + m.x705 + m.x712 + m.x803 + m.x810 + m.x901 + m.x908
+ m.x999 + m.x1006 >= 0)
m.c2970 = Constraint(expr= m.x510 + m.x517 + m.x608 + m.x615 + m.x706 + m.x713 + m.x804 + m.x811 + m.x902 + m.x909
+ m.x1000 + m.x1007 >= 0)
m.c2971 = Constraint(expr= m.x511 + m.x518 + m.x609 + m.x616 + m.x707 + m.x714 + m.x805 + m.x812 + m.x903 + m.x910
+ m.x1001 + m.x1008 >= 0)
m.c2972 = Constraint(expr= m.x512 + m.x519 + m.x610 + m.x617 + m.x708 + m.x715 + m.x806 + m.x813 + m.x904 + m.x911
+ m.x1002 + m.x1009 >= 0)
m.c2973 = Constraint(expr= - m.x422 - m.x520 - m.x618 - m.x716 - m.x814 - m.x912 <= 0)
m.c2974 = Constraint(expr= - m.x423 - m.x521 - m.x619 - m.x717 - m.x815 - m.x913 <= 50)
m.c2975 = Constraint(expr= - m.x424 - m.x522 - m.x620 - m.x718 - m.x816 - m.x914 <= 50)
m.c2976 = Constraint(expr= - m.x425 - m.x523 - m.x621 - m.x719 - m.x817 - m.x915 <= 50)
m.c2977 = Constraint(expr= - m.x426 - m.x524 - m.x622 - m.x720 - m.x818 - m.x916 <= 50)
m.c2978 = Constraint(expr= - m.x427 - m.x525 - m.x623 - m.x721 - m.x819 - m.x917 <= 50)
m.c2979 = Constraint(expr= - m.x428 - m.x526 - m.x624 - m.x722 - m.x820 - m.x918 <= 50)
m.c2980 = Constraint(expr= - m.x429 - m.x527 - m.x625 - m.x723 - m.x821 - m.x919 <= 50)
m.c2981 = Constraint(expr= - m.x430 - m.x528 - m.x626 - m.x724 - m.x822 - m.x920 <= 0)
m.c2982 = Constraint(expr= - m.x431 - m.x529 - m.x627 - m.x725 - m.x823 - m.x921 <= 50)
m.c2983 = Constraint(expr= - m.x432 - m.x530 - m.x628 - m.x726 - m.x824 - m.x922 <= 50)
m.c2984 = Constraint(expr= - m.x433 - m.x531 - m.x629 - m.x727 - m.x825 - m.x923 <= 50)
m.c2985 = Constraint(expr= - m.x434 - m.x532 - m.x630 - m.x728 - m.x826 - m.x924 <= 50)
m.c2986 = Constraint(expr= - m.x435 - m.x533 - m.x631 - m.x729 - m.x827 - m.x925 <= 50)
m.c2987 = Constraint(expr= - m.x436 - m.x534 - m.x632 - m.x730 - m.x828 - m.x926 <= 50)
m.c2988 = Constraint(expr= - m.x437 - m.x535 - m.x633 - m.x731 - m.x829 - m.x927 <= 50)
m.c2989 = Constraint(expr= - m.x438 - m.x536 - m.x634 - m.x732 - m.x830 - m.x928 <= 0)
m.c2990 = Constraint(expr= - m.x439 - m.x537 - m.x635 - m.x733 - m.x831 - m.x929 <= 50)
m.c2991 = Constraint(expr= - m.x440 - m.x538 - m.x636 - m.x734 - m.x832 - m.x930 <= 50)
m.c2992 = Constraint(expr= - m.x441 - m.x539 - m.x637 - m.x735 - m.x833 - m.x931 <= 50)
m.c2993 = Constraint(expr= - m.x442 - m.x540 - m.x638 - m.x736 - m.x834 - m.x932 <= 50)
m.c2994 = Constraint(expr= m.x422 - m.x443 - m.x450 + m.x520 - m.x541 - m.x548 + m.x618 - m.x639 - m.x646 + m.x716
- m.x737 - m.x744 + m.x814 - m.x835 - m.x842 + m.x912 - m.x933 - m.x940 <= 100)
m.c2995 = Constraint(expr= m.x423 - m.x444 - m.x451 + m.x521 - m.x542 - m.x549 + m.x619 - m.x640 - m.x647 + m.x717
- m.x738 - m.x745 + m.x815 - m.x836 - m.x843 + m.x913 - m.x934 - m.x941 <= 100)
m.c2996 = Constraint(expr= m.x424 - m.x445 - m.x452 + m.x522 - m.x543 - m.x550 + m.x620 - m.x641 - m.x648 + m.x718
- m.x739 - m.x746 + m.x816 - m.x837 - m.x844 + m.x914 - m.x935 - m.x942 <= 100)
m.c2997 = Constraint(expr= m.x425 - m.x446 - m.x453 + m.x523 - m.x544 - m.x551 + m.x621 - m.x642 - m.x649 + m.x719
- m.x740 - m.x747 + m.x817 - m.x838 - m.x845 + m.x915 - m.x936 - m.x943 <= 80)
m.c2998 = Constraint(expr= m.x426 - m.x447 - m.x454 + m.x524 - m.x545 - m.x552 + m.x622 - m.x643 - m.x650 + m.x720
- m.x741 - m.x748 + m.x818 - m.x839 - m.x846 + m.x916 - m.x937 - m.x944 <= 100)
m.c2999 = Constraint(expr= m.x427 - m.x448 - m.x455 + m.x525 - m.x546 - m.x553 + m.x623 - m.x644 - m.x651 + m.x721
- m.x742 - m.x749 + m.x819 - m.x840 - m.x847 + m.x917 - m.x938 - m.x945 <= 100)
m.c3000 = Constraint(expr= m.x428 - m.x449 - m.x456 + m.x526 - m.x547 - m.x554 + m.x624 - m.x645 - m.x652 + m.x722
- m.x743 - m.x750 + m.x820 - m.x841 - m.x848 + m.x918 - m.x939 - m.x946 <= 100)
m.c3001 = Constraint(expr= m.x429 - m.x457 - m.x464 - m.x471 + m.x527 - m.x555 - m.x562 - m.x569 + m.x625 - m.x653
- m.x660 - m.x667 + m.x723 - m.x751 - m.x758 - m.x765 + m.x821 - m.x849 - m.x856 - m.x863
+ m.x919 - m.x947 - m.x954 - m.x961 <= 100)
m.c3002 = Constraint(expr= m.x430 - m.x458 - m.x465 - m.x472 + m.x528 - m.x556 - m.x563 - m.x570 + m.x626 - m.x654
- m.x661 - m.x668 + m.x724 - m.x752 - m.x759 - m.x766 + m.x822 - m.x850 - m.x857 - m.x864
+ m.x920 - m.x948 - m.x955 - m.x962 <= 100)
m.c3003 = Constraint(expr= m.x431 - m.x459 - m.x466 - m.x473 + m.x529 - m.x557 - m.x564 - m.x571 + m.x627 - m.x655
- m.x662 - m.x669 + m.x725 - m.x753 - m.x760 - m.x767 + m.x823 - m.x851 - m.x858 - m.x865
+ m.x921 - m.x949 - m.x956 - m.x963 <= 100)
m.c3004 = Constraint(expr= m.x432 - m.x460 - m.x467 - m.x474 + m.x530 - m.x558 - m.x565 - m.x572 + m.x628 - m.x656
- m.x663 - m.x670 + m.x726 - m.x754 - m.x761 - m.x768 + m.x824 - m.x852 - m.x859 - m.x866
+ m.x922 - m.x950 - m.x957 - m.x964 <= 100)
m.c3005 = Constraint(expr= m.x433 - m.x461 - m.x468 - m.x475 + m.x531 - m.x559 - m.x566 - m.x573 + m.x629 - m.x657
- m.x664 - m.x671 + m.x727 - m.x755 - m.x762 - m.x769 + m.x825 - m.x853 - m.x860 - m.x867
+ m.x923 - m.x951 - m.x958 - m.x965 <= 80)
m.c3006 = Constraint(expr= m.x434 - m.x462 - m.x469 - m.x476 + m.x532 - m.x560 - m.x567 - m.x574 + m.x630 - m.x658
- m.x665 - m.x672 + m.x728 - m.x756 - m.x763 - m.x770 + m.x826 - m.x854 - m.x861 - m.x868
+ m.x924 - m.x952 - m.x959 - m.x966 <= 100)
m.c3007 = Constraint(expr= m.x435 - m.x463 - m.x470 - m.x477 + m.x533 - m.x561 - m.x568 - m.x575 + m.x631 - m.x659
- m.x666 - m.x673 + m.x729 - m.x757 - m.x764 - m.x771 + m.x827 - m.x855 - m.x862 - m.x869
+ m.x925 - m.x953 - m.x960 - m.x967 <= 100)
m.c3008 = Constraint(expr= m.x436 - m.x478 - m.x485 + m.x534 - m.x576 - m.x583 + m.x632 - m.x674 - m.x681 + m.x730
- m.x772 - m.x779 + m.x828 - m.x870 - m.x877 + m.x926 - m.x968 - m.x975 <= 100)
m.c3009 = Constraint(expr= m.x437 - m.x479 - m.x486 + m.x535 - m.x577 - m.x584 + m.x633 - m.x675 - m.x682 + m.x731
- m.x773 - m.x780 + m.x829 - m.x871 - m.x878 + m.x927 - m.x969 - m.x976 <= 100)
m.c3010 = Constraint(expr= m.x438 - m.x480 - m.x487 + m.x536 - m.x578 - m.x585 + m.x634 - m.x676 - m.x683 + m.x732
- m.x774 - m.x781 + m.x830 - m.x872 - m.x879 + m.x928 - m.x970 - m.x977 <= 100)
m.c3011 = Constraint(expr= m.x439 - m.x481 - m.x488 + m.x537 - m.x579 - m.x586 + m.x635 - m.x677 - m.x684 + m.x733
- m.x775 - m.x782 + m.x831 - m.x873 - m.x880 + m.x929 - m.x971 - m.x978 <= 100)
m.c3012 = Constraint(expr= m.x440 - m.x482 - m.x489 + m.x538 - m.x580 - m.x587 + m.x636 - m.x678 - m.x685 + m.x734
- m.x776 - m.x783 + m.x832 - m.x874 - m.x881 + m.x930 - m.x972 - m.x979 <= 100)
m.c3013 = Constraint(expr= m.x441 - m.x483 - m.x490 + m.x539 - m.x581 - m.x588 + m.x637 - m.x679 - m.x686 + m.x735
- m.x777 - m.x784 + m.x833 - m.x875 - m.x882 + m.x931 - m.x973 - m.x980 <= 80)
m.c3014 = Constraint(expr= m.x442 - m.x484 - m.x491 + m.x540 - m.x582 - m.x589 + m.x638 - m.x680 - m.x687 + m.x736
- m.x778 - m.x785 + m.x834 - m.x876 - m.x883 + m.x932 - m.x974 - m.x981 <= 100)
m.c3015 = Constraint(expr= m.x443 + m.x457 - m.x492 + m.x541 + m.x555 - m.x590 + m.x639 + m.x653 - m.x688 + m.x737
+ m.x751 - m.x786 + m.x835 + m.x849 - m.x884 + m.x933 + m.x947 - m.x982 <= 100)
m.c3016 = Constraint(expr= m.x444 + m.x458 - m.x493 + m.x542 + m.x556 - m.x591 + m.x640 + m.x654 - m.x689 + m.x738
+ m.x752 - m.x787 + m.x836 + m.x850 - m.x885 + m.x934 + m.x948 - m.x983 <= 100)
m.c3017 = Constraint(expr= m.x445 + m.x459 - m.x494 + m.x543 + m.x557 - m.x592 + m.x641 + m.x655 - m.x690 + m.x739
+ m.x753 - m.x788 + m.x837 + m.x851 - m.x886 + m.x935 + m.x949 - m.x984 <= 100)
m.c3018 = Constraint(expr= m.x446 + m.x460 - m.x495 + m.x544 + m.x558 - m.x593 + m.x642 + m.x656 - m.x691 + m.x740
+ m.x754 - m.x789 + m.x838 + m.x852 - m.x887 + m.x936 + m.x950 - m.x985 <= 100)
m.c3019 = Constraint(expr= m.x447 + m.x461 - m.x496 + m.x545 + m.x559 - m.x594 + m.x643 + m.x657 - m.x692 + m.x741
+ m.x755 - m.x790 + m.x839 + m.x853 - m.x888 + m.x937 + m.x951 - m.x986 <= 100)
m.c3020 = Constraint(expr= m.x448 + m.x462 - m.x497 + m.x546 + m.x560 - m.x595 + m.x644 + m.x658 - m.x693 + m.x742
+ m.x756 - m.x791 + m.x840 + m.x854 - m.x889 + m.x938 + m.x952 - m.x987 <= 100)
m.c3021 = Constraint(expr= m.x449 + m.x463 - m.x498 + m.x547 + m.x561 - m.x596 + m.x645 + m.x659 - m.x694 + m.x743
+ m.x757 - m.x792 + m.x841 + m.x855 - m.x890 + m.x939 + m.x953 - m.x988 <= 70)
m.c3022 = Constraint(expr= m.x450 + m.x464 + m.x478 - m.x499 - m.x506 + m.x548 + m.x562 + m.x576 - m.x597 - m.x604
+ m.x646 + m.x660 + m.x674 - m.x695 - m.x702 + m.x744 + m.x758 + m.x772 - m.x793 - m.x800
+ m.x842 + m.x856 + m.x870 - m.x891 - m.x898 + m.x940 + m.x954 + m.x968 - m.x989 - m.x996
<= 100)
m.c3023 = Constraint(expr= m.x451 + m.x465 + m.x479 - m.x500 - m.x507 + m.x549 + m.x563 + m.x577 - m.x598 - m.x605
+ m.x647 + m.x661 + m.x675 - m.x696 - m.x703 + m.x745 + m.x759 + m.x773 - m.x794 - m.x801
+ m.x843 + m.x857 + m.x871 - m.x892 - m.x899 + m.x941 + m.x955 + m.x969 - m.x990 - m.x997
<= 100)
m.c3024 = Constraint(expr= m.x452 + m.x466 + m.x480 - m.x501 - m.x508 + m.x550 + m.x564 + m.x578 - m.x599 - m.x606
+ m.x648 + m.x662 + m.x676 - m.x697 - m.x704 + m.x746 + m.x760 + m.x774 - m.x795 - m.x802
+ m.x844 + m.x858 + m.x872 - m.x893 - m.x900 + m.x942 + m.x956 + m.x970 - m.x991 - m.x998
<= 100)
m.c3025 = Constraint(expr= m.x453 + m.x467 + m.x481 - m.x502 - m.x509 + m.x551 + m.x565 + m.x579 - m.x600 - m.x607
+ m.x649 + m.x663 + m.x677 - m.x698 - m.x705 + m.x747 + m.x761 + m.x775 - m.x796 - m.x803
+ m.x845 + m.x859 + m.x873 - m.x894 - m.x901 + m.x943 + m.x957 + m.x971 - m.x992 - m.x999
<= 100)
m.c3026 = Constraint(expr= m.x454 + m.x468 + m.x482 - m.x503 - m.x510 + m.x552 + m.x566 + m.x580 - m.x601 - m.x608
+ m.x650 + m.x664 + m.x678 - m.x699 - m.x706 + m.x748 + m.x762 + m.x776 - m.x797 - m.x804
+ m.x846 + m.x860 + m.x874 - m.x895 - m.x902 + m.x944 + m.x958 + m.x972 - m.x993 - m.x1000
<= 50)
m.c3027 = Constraint(expr= m.x455 + m.x469 + m.x483 - m.x504 - m.x511 + m.x553 + m.x567 + m.x581 - m.x602 - m.x609
+ m.x651 + m.x665 + m.x679 - m.x700 - m.x707 + m.x749 + m.x763 + m.x777 - m.x798 - m.x805
+ m.x847 + m.x861 + m.x875 - m.x896 - m.x903 + m.x945 + m.x959 + m.x973 - m.x994 - m.x1001
<= 100)
m.c3028 = Constraint(expr= m.x456 + m.x470 + m.x484 - m.x505 - m.x512 + m.x554 + m.x568 + m.x582 - m.x603 - m.x610
+ m.x652 + m.x666 + m.x680 - m.x701 - m.x708 + m.x750 + m.x764 + m.x778 - m.x799 - m.x806
+ m.x848 + m.x862 + m.x876 - m.x897 - m.x904 + m.x946 + m.x960 + m.x974 - m.x995 - m.x1002
<= 100)
m.c3029 = Constraint(expr= m.x471 + m.x485 - m.x513 + m.x569 + m.x583 - m.x611 + m.x667 + m.x681 - m.x709 + m.x765
+ m.x779 - m.x807 + m.x863 + m.x877 - m.x905 + m.x961 + m.x975 - m.x1003 <= 100)
m.c3030 = Constraint(expr= m.x472 + m.x486 - m.x514 + m.x570 + m.x584 - m.x612 + m.x668 + m.x682 - m.x710 + m.x766
+ m.x780 - m.x808 + m.x864 + m.x878 - m.x906 + m.x962 + m.x976 - m.x1004 <= 100)
m.c3031 = Constraint(expr= m.x473 + m.x487 - m.x515 + m.x571 + m.x585 - m.x613 + m.x669 + m.x683 - m.x711 + m.x767
+ m.x781 - m.x809 + m.x865 + m.x879 - m.x907 + m.x963 + m.x977 - m.x1005 <= 100)
m.c3032 = Constraint(expr= m.x474 + m.x488 - m.x516 + m.x572 + m.x586 - m.x614 + m.x670 + m.x684 - m.x712 + m.x768
+ m.x782 - m.x810 + m.x866 + m.x880 - m.x908 + m.x964 + m.x978 - m.x1006 <= 100)
m.c3033 = Constraint(expr= m.x475 + m.x489 - m.x517 + m.x573 + m.x587 - m.x615 + m.x671 + m.x685 - m.x713 + m.x769
+ m.x783 - m.x811 + m.x867 + m.x881 - m.x909 + m.x965 + m.x979 - m.x1007 <= 100)
m.c3034 = Constraint(expr= m.x476 + m.x490 - m.x518 + m.x574 + m.x588 - m.x616 + m.x672 + m.x686 - m.x714 + m.x770
+ m.x784 - m.x812 + m.x868 + m.x882 - m.x910 + m.x966 + m.x980 - m.x1008 <= 70)
m.c3035 = Constraint(expr= m.x477 + m.x491 - m.x519 + m.x575 + m.x589 - m.x617 + m.x673 + m.x687 - m.x715 + m.x771
+ m.x785 - m.x813 + m.x869 + m.x883 - m.x911 + m.x967 + m.x981 - m.x1009 <= 100)
m.c3036 = Constraint(expr= 12*m.b16 + 12*m.b19 - m.x100 - m.x103 + m.x254 + m.x257 <= 12)
m.c3037 = Constraint(expr= 12*m.b16 + 12*m.b20 - m.x100 - m.x104 + m.x254 + m.x258 <= 12)
m.c3038 = Constraint(expr= 12*m.b17 + 12*m.b21 - m.x101 - m.x105 + m.x255 + m.x259 <= 12)
m.c3039 = Constraint(expr= 12*m.b17 + 12*m.b22 - m.x101 - m.x106 + m.x255 + m.x260 <= 12)
m.c3040 = Constraint(expr= 12*m.b17 + 12*m.b23 - m.x101 - m.x107 + m.x255 + m.x261 <= 12)
m.c3041 = Constraint(expr= 12*m.b18 + 12*m.b24 - m.x102 - m.x108 + m.x256 + m.x262 <= 12)
m.c3042 = Constraint(expr= 12*m.b18 + 12*m.b25 - m.x102 - m.x109 + m.x256 + m.x263 <= 12)
m.c3043 = Constraint(expr= 12*m.b19 + 12*m.b26 - m.x103 - m.x110 + m.x257 + m.x264 <= 12)
m.c3044 = Constraint(expr= 12*m.b21 + 12*m.b26 - m.x105 - m.x110 + m.x259 + m.x264 <= 12)
m.c3045 = Constraint(expr= 12*m.b23 + 12*m.b29 - m.x107 - m.x113 + m.x261 + m.x267 <= 12)
m.c3046 = Constraint(expr= 12*m.b25 + 12*m.b29 - m.x109 - m.x113 + m.x263 + m.x267 <= 12)
m.c3047 = Constraint(expr= 12*m.b26 + 12*m.b27 - m.x110 - m.x111 + m.x264 + m.x265 <= 12)
m.c3048 = Constraint(expr= 12*m.b28 + 12*m.b29 - m.x112 - m.x113 + m.x266 + m.x267 <= 12)
m.c3049 = Constraint(expr= 12*m.b16 + 12*m.b17 + 12*m.b18 - m.x100 - m.x101 - m.x102 + m.x254 + m.x255 + m.x256 <= 12)
m.c3050 = Constraint(expr= 12*m.b20 + 12*m.b27 + 12*m.b28 - m.x104 - m.x111 - m.x112 + m.x258 + m.x265 + m.x266 <= 12)
m.c3051 = Constraint(expr= 12*m.b22 + 12*m.b27 + 12*m.b28 - m.x106 - m.x111 - m.x112 + m.x260 + m.x265 + m.x266 <= 12)
m.c3052 = Constraint(expr= 12*m.b24 + 12*m.b27 + 12*m.b28 - m.x108 - m.x111 - m.x112 + m.x262 + m.x265 + m.x266 <= 12)
m.c3053 = Constraint(expr= 12*m.b30 + 12*m.b33 - m.x114 - m.x117 + m.x184 + m.x187 + m.x254 + m.x257 <= 12)
m.c3054 = Constraint(expr= 12*m.b30 + 12*m.b34 - m.x114 - m.x118 + m.x184 + m.x188 + m.x254 + m.x258 <= 12)
m.c3055 = Constraint(expr= 12*m.b31 + 12*m.b35 - m.x115 - m.x119 + m.x185 + m.x189 + m.x255 + m.x259 <= 12)
m.c3056 = Constraint(expr= 12*m.b31 + 12*m.b36 - m.x115 - m.x120 + m.x185 + m.x190 + m.x255 + m.x260 <= 12)
m.c3057 = Constraint(expr= 12*m.b31 + 12*m.b37 - m.x115 - m.x121 + m.x185 + m.x191 + m.x255 + m.x261 <= 12)
m.c3058 = Constraint(expr= 12*m.b32 + 12*m.b38 - m.x116 - m.x122 + m.x186 + m.x192 + m.x256 + m.x262 <= 12)
m.c3059 = Constraint(expr= 12*m.b32 + 12*m.b39 - m.x116 - m.x123 + m.x186 + m.x193 + m.x256 + m.x263 <= 12)
m.c3060 = Constraint(expr= 12*m.b33 + 12*m.b40 - m.x117 - m.x124 + m.x187 + m.x194 + m.x257 + m.x264 <= 12)
m.c3061 = Constraint(expr= 12*m.b35 + 12*m.b40 - m.x119 - m.x124 + m.x189 + m.x194 + m.x259 + m.x264 <= 12)
m.c3062 = Constraint(expr= 12*m.b37 + 12*m.b43 - m.x121 - m.x127 + m.x191 + m.x197 + m.x261 + m.x267 <= 12)
m.c3063 = Constraint(expr= 12*m.b39 + 12*m.b43 - m.x123 - m.x127 + m.x193 + m.x197 + m.x263 + m.x267 <= 12)
m.c3064 = Constraint(expr= 12*m.b40 + 12*m.b41 - m.x124 - m.x125 + m.x194 + m.x195 + m.x264 + m.x265 <= 12)
m.c3065 = Constraint(expr= 12*m.b42 + 12*m.b43 - m.x126 - m.x127 + m.x196 + m.x197 + m.x266 + m.x267 <= 12)
m.c3066 = Constraint(expr= 12*m.b30 + 12*m.b31 + 12*m.b32 - m.x114 - m.x115 - m.x116 + m.x184 + m.x185 + m.x186
+ m.x254 + m.x255 + m.x256 <= 12)
m.c3067 = Constraint(expr= 12*m.b34 + 12*m.b41 + 12*m.b42 - m.x118 - m.x125 - m.x126 + m.x188 + m.x195 + m.x196
+ m.x258 + m.x265 + m.x266 <= 12)
m.c3068 = Constraint(expr= 12*m.b36 + 12*m.b41 + 12*m.b42 - m.x120 - m.x125 - m.x126 + m.x190 + m.x195 + m.x196
+ m.x260 + m.x265 + m.x266 <= 12)
m.c3069 = Constraint(expr= 12*m.b38 + 12*m.b41 + 12*m.b42 - m.x122 - m.x125 - m.x126 + m.x192 + m.x195 + m.x196
+ m.x262 + m.x265 + m.x266 <= 12)
m.c3070 = Constraint(expr= 12*m.b44 + 12*m.b47 - m.x128 - m.x131 + m.x184 + m.x187 + m.x198 + m.x201 + m.x254 + m.x257
<= 12)
m.c3071 = Constraint(expr= 12*m.b44 + 12*m.b48 - m.x128 - m.x132 + m.x184 + m.x188 + m.x198 + m.x202 + m.x254 + m.x258
<= 12)
m.c3072 = Constraint(expr= 12*m.b45 + 12*m.b49 - m.x129 - m.x133 + m.x185 + m.x189 + m.x199 + m.x203 + m.x255 + m.x259
<= 12)
m.c3073 = Constraint(expr= 12*m.b45 + 12*m.b50 - m.x129 - m.x134 + m.x185 + m.x190 + m.x199 + m.x204 + m.x255 + m.x260
<= 12)
m.c3074 = Constraint(expr= 12*m.b45 + 12*m.b51 - m.x129 - m.x135 + m.x185 + m.x191 + m.x199 + m.x205 + m.x255 + m.x261
<= 12)
m.c3075 = Constraint(expr= 12*m.b46 + 12*m.b52 - m.x130 - m.x136 + m.x186 + m.x192 + m.x200 + m.x206 + m.x256 + m.x262
<= 12)
m.c3076 = Constraint(expr= 12*m.b46 + 12*m.b53 - m.x130 - m.x137 + m.x186 + m.x193 + m.x200 + m.x207 + m.x256 + m.x263
<= 12)
m.c3077 = Constraint(expr= 12*m.b47 + 12*m.b54 - m.x131 - m.x138 + m.x187 + m.x194 + m.x201 + m.x208 + m.x257 + m.x264
<= 12)
m.c3078 = Constraint(expr= 12*m.b49 + 12*m.b54 - m.x133 - m.x138 + m.x189 + m.x194 + m.x203 + m.x208 + m.x259 + m.x264
<= 12)
m.c3079 = Constraint(expr= 12*m.b51 + 12*m.b57 - m.x135 - m.x141 + m.x191 + m.x197 + m.x205 + m.x211 + m.x261 + m.x267
<= 12)
m.c3080 = Constraint(expr= 12*m.b53 + 12*m.b57 - m.x137 - m.x141 + m.x193 + m.x197 + m.x207 + m.x211 + m.x263 + m.x267
<= 12)
m.c3081 = Constraint(expr= 12*m.b54 + 12*m.b55 - m.x138 - m.x139 + m.x194 + m.x195 + m.x208 + m.x209 + m.x264 + m.x265
<= 12)
m.c3082 = Constraint(expr= 12*m.b56 + 12*m.b57 - m.x140 - m.x141 + m.x196 + m.x197 + m.x210 + m.x211 + m.x266 + m.x267
<= 12)
m.c3083 = Constraint(expr= 12*m.b44 + 12*m.b45 + 12*m.b46 - m.x128 - m.x129 - m.x130 + m.x184 + m.x185 + m.x186
+ m.x198 + m.x199 + m.x200 + m.x254 + m.x255 + m.x256 <= 12)
m.c3084 = Constraint(expr= 12*m.b48 + 12*m.b55 + 12*m.b56 - m.x132 - m.x139 - m.x140 + m.x188 + m.x195 + m.x196
+ m.x202 + m.x209 + m.x210 + m.x258 + m.x265 + m.x266 <= 12)
m.c3085 = Constraint(expr= 12*m.b50 + 12*m.b55 + 12*m.b56 - m.x134 - m.x139 - m.x140 + m.x190 + m.x195 + m.x196
+ m.x204 + m.x209 + m.x210 + m.x260 + m.x265 + m.x266 <= 12)
m.c3086 = Constraint(expr= 12*m.b52 + 12*m.b55 + 12*m.b56 - m.x136 - m.x139 - m.x140 + m.x192 + m.x195 + m.x196
+ m.x206 + m.x209 + m.x210 + m.x262 + m.x265 + m.x266 <= 12)
m.c3087 = Constraint(expr= 12*m.b58 + 12*m.b61 - m.x142 - m.x145 + m.x184 + m.x187 + m.x198 + m.x201 + m.x212 + m.x215
+ m.x254 + m.x257 <= 12)
m.c3088 = Constraint(expr= 12*m.b58 + 12*m.b62 - m.x142 - m.x146 + m.x184 + m.x188 + m.x198 + m.x202 + m.x212 + m.x216
+ m.x254 + m.x258 <= 12)
m.c3089 = Constraint(expr= 12*m.b59 + 12*m.b63 - m.x143 - m.x147 + m.x185 + m.x189 + m.x199 + m.x203 + m.x213 + m.x217
+ m.x255 + m.x259 <= 12)
m.c3090 = Constraint(expr= 12*m.b59 + 12*m.b64 - m.x143 - m.x148 + m.x185 + m.x190 + m.x199 + m.x204 + m.x213 + m.x218
+ m.x255 + m.x260 <= 12)
m.c3091 = Constraint(expr= 12*m.b59 + 12*m.b65 - m.x143 - m.x149 + m.x185 + m.x191 + m.x199 + m.x205 + m.x213 + m.x219
+ m.x255 + m.x261 <= 12)
m.c3092 = Constraint(expr= 12*m.b60 + 12*m.b66 - m.x144 - m.x150 + m.x186 + m.x192 + m.x200 + m.x206 + m.x214 + m.x220
+ m.x256 + m.x262 <= 12)
m.c3093 = Constraint(expr= 12*m.b60 + 12*m.b67 - m.x144 - m.x151 + m.x186 + m.x193 + m.x200 + m.x207 + m.x214 + m.x221
+ m.x256 + m.x263 <= 12)
m.c3094 = Constraint(expr= 12*m.b61 + 12*m.b68 - m.x145 - m.x152 + m.x187 + m.x194 + m.x201 + m.x208 + m.x215 + m.x222
+ m.x257 + m.x264 <= 12)
m.c3095 = Constraint(expr= 12*m.b63 + 12*m.b68 - m.x147 - m.x152 + m.x189 + m.x194 + m.x203 + m.x208 + m.x217 + m.x222
+ m.x259 + m.x264 <= 12)
m.c3096 = Constraint(expr= 12*m.b65 + 12*m.b71 - m.x149 - m.x155 + m.x191 + m.x197 + m.x205 + m.x211 + m.x219 + m.x225
+ m.x261 + m.x267 <= 12)
m.c3097 = Constraint(expr= 12*m.b67 + 12*m.b71 - m.x151 - m.x155 + m.x193 + m.x197 + m.x207 + m.x211 + m.x221 + m.x225
+ m.x263 + m.x267 <= 12)
m.c3098 = Constraint(expr= 12*m.b68 + 12*m.b69 - m.x152 - m.x153 + m.x194 + m.x195 + m.x208 + m.x209 + m.x222 + m.x223
+ m.x264 + m.x265 <= 12)
m.c3099 = Constraint(expr= 12*m.b70 + 12*m.b71 - m.x154 - m.x155 + m.x196 + m.x197 + m.x210 + m.x211 + m.x224 + m.x225
+ m.x266 + m.x267 <= 12)
m.c3100 = Constraint(expr= 12*m.b58 + 12*m.b59 + 12*m.b60 - m.x142 - m.x143 - m.x144 + m.x184 + m.x185 + m.x186
+ m.x198 + m.x199 + m.x200 + m.x212 + m.x213 + m.x214 + m.x254 + m.x255 + m.x256 <= 12)
m.c3101 = Constraint(expr= 12*m.b62 + 12*m.b69 + 12*m.b70 - m.x146 - m.x153 - m.x154 + m.x188 + m.x195 + m.x196
+ m.x202 + m.x209 + m.x210 + m.x216 + m.x223 + m.x224 + m.x258 + m.x265 + m.x266 <= 12)
m.c3102 = Constraint(expr= 12*m.b64 + 12*m.b69 + 12*m.b70 - m.x148 - m.x153 - m.x154 + m.x190 + m.x195 + m.x196
+ m.x204 + m.x209 + m.x210 + m.x218 + m.x223 + m.x224 + m.x260 + m.x265 + m.x266 <= 12)
m.c3103 = Constraint(expr= 12*m.b66 + 12*m.b69 + 12*m.b70 - m.x150 - m.x153 - m.x154 + m.x192 + m.x195 + m.x196
+ m.x206 + m.x209 + m.x210 + m.x220 + m.x223 + m.x224 + m.x262 + m.x265 + m.x266 <= 12)
m.c3104 = Constraint(expr= 12*m.b72 + 12*m.b75 - m.x156 - m.x159 + m.x184 + m.x187 + m.x198 + m.x201 + m.x212 + m.x215
+ m.x226 + m.x229 + m.x254 + m.x257 <= 12)
m.c3105 = Constraint(expr= 12*m.b72 + 12*m.b76 - m.x156 - m.x160 + m.x184 + m.x188 + m.x198 + m.x202 + m.x212 + m.x216
+ m.x226 + m.x230 + m.x254 + m.x258 <= 12)
m.c3106 = Constraint(expr= 12*m.b73 + 12*m.b77 - m.x157 - m.x161 + m.x185 + m.x189 + m.x199 + m.x203 + m.x213 + m.x217
+ m.x227 + m.x231 + m.x255 + m.x259 <= 12)
m.c3107 = Constraint(expr= 12*m.b73 + 12*m.b78 - m.x157 - m.x162 + m.x185 + m.x190 + m.x199 + m.x204 + m.x213 + m.x218
+ m.x227 + m.x232 + m.x255 + m.x260 <= 12)
m.c3108 = Constraint(expr= 12*m.b73 + 12*m.b79 - m.x157 - m.x163 + m.x185 + m.x191 + m.x199 + m.x205 + m.x213 + m.x219
+ m.x227 + m.x233 + m.x255 + m.x261 <= 12)
m.c3109 = Constraint(expr= 12*m.b74 + 12*m.b80 - m.x158 - m.x164 + m.x186 + m.x192 + m.x200 + m.x206 + m.x214 + m.x220
+ m.x228 + m.x234 + m.x256 + m.x262 <= 12)
m.c3110 = Constraint(expr= 12*m.b74 + 12*m.b81 - m.x158 - m.x165 + m.x186 + m.x193 + m.x200 + m.x207 + m.x214 + m.x221
+ m.x228 + m.x235 + m.x256 + m.x263 <= 12)
m.c3111 = Constraint(expr= 12*m.b75 + 12*m.b82 - m.x159 - m.x166 + m.x187 + m.x194 + m.x201 + m.x208 + m.x215 + m.x222
+ m.x229 + m.x236 + m.x257 + m.x264 <= 12)
m.c3112 = Constraint(expr= 12*m.b77 + 12*m.b82 - m.x161 - m.x166 + m.x189 + m.x194 + m.x203 + m.x208 + m.x217 + m.x222
+ m.x231 + m.x236 + m.x259 + m.x264 <= 12)
m.c3113 = Constraint(expr= 12*m.b79 + 12*m.b85 - m.x163 - m.x169 + m.x191 + m.x197 + m.x205 + m.x211 + m.x219 + m.x225
+ m.x233 + m.x239 + m.x261 + m.x267 <= 12)
m.c3114 = Constraint(expr= 12*m.b81 + 12*m.b85 - m.x165 - m.x169 + m.x193 + m.x197 + m.x207 + m.x211 + m.x221 + m.x225
+ m.x235 + m.x239 + m.x263 + m.x267 <= 12)
m.c3115 = Constraint(expr= 12*m.b82 + 12*m.b83 - m.x166 - m.x167 + m.x194 + m.x195 + m.x208 + m.x209 + m.x222 + m.x223
+ m.x236 + m.x237 + m.x264 + m.x265 <= 12)
m.c3116 = Constraint(expr= 12*m.b84 + 12*m.b85 - m.x168 - m.x169 + m.x196 + m.x197 + m.x210 + m.x211 + m.x224 + m.x225
+ m.x238 + m.x239 + m.x266 + m.x267 <= 12)
m.c3117 = Constraint(expr= 12*m.b72 + 12*m.b73 + 12*m.b74 - m.x156 - m.x157 - m.x158 + m.x184 + m.x185 + m.x186
+ m.x198 + m.x199 + m.x200 + m.x212 + m.x213 + m.x214 + m.x226 + m.x227 + m.x228 + m.x254
+ m.x255 + m.x256 <= 12)
m.c3118 = Constraint(expr= 12*m.b76 + 12*m.b83 + 12*m.b84 - m.x160 - m.x167 - m.x168 + m.x188 + m.x195 + m.x196
+ m.x202 + m.x209 + m.x210 + m.x216 + m.x223 + m.x224 + m.x230 + m.x237 + m.x238 + m.x258
+ m.x265 + m.x266 <= 12)
m.c3119 = Constraint(expr= 12*m.b78 + 12*m.b83 + 12*m.b84 - m.x162 - m.x167 - m.x168 + m.x190 + m.x195 + m.x196
+ m.x204 + m.x209 + m.x210 + m.x218 + m.x223 + m.x224 + m.x232 + m.x237 + m.x238 + m.x260
+ m.x265 + m.x266 <= 12)
m.c3120 = Constraint(expr= 12*m.b80 + 12*m.b83 + 12*m.b84 - m.x164 - m.x167 - m.x168 + m.x192 + m.x195 + m.x196
+ m.x206 + m.x209 + m.x210 + m.x220 + m.x223 + m.x224 + m.x234 + m.x237 + m.x238 + m.x262
+ m.x265 + m.x266 <= 12)
m.c3121 = Constraint(expr= 12*m.b30 + 12*m.b33 - m.x114 - m.x117 + m.x268 + m.x271 <= 12)
m.c3122 = Constraint(expr= 12*m.b30 + 12*m.b34 - m.x114 - m.x118 + m.x268 + m.x272 <= 12)
m.c3123 = Constraint(expr= 12*m.b31 + 12*m.b35 - m.x115 - m.x119 + m.x269 + m.x273 <= 12)
m.c3124 = Constraint(expr= 12*m.b31 + 12*m.b36 - m.x115 - m.x120 + m.x269 + m.x274 <= 12)
m.c3125 = Constraint(expr= 12*m.b31 + 12*m.b37 - m.x115 - m.x121 + m.x269 + m.x275 <= 12)
m.c3126 = Constraint(expr= 12*m.b32 + 12*m.b38 - m.x116 - m.x122 + m.x270 + m.x276 <= 12)
m.c3127 = Constraint(expr= 12*m.b32 + 12*m.b39 - m.x116 - m.x123 + m.x270 + m.x277 <= 12)
m.c3128 = Constraint(expr= 12*m.b33 + 12*m.b40 - m.x117 - m.x124 + m.x271 + m.x278 <= 12)
m.c3129 = Constraint(expr= 12*m.b35 + 12*m.b40 - m.x119 - m.x124 + m.x273 + m.x278 <= 12)
m.c3130 = Constraint(expr= 12*m.b37 + 12*m.b43 - m.x121 - m.x127 + m.x275 + m.x281 <= 12)
m.c3131 = Constraint(expr= 12*m.b39 + 12*m.b43 - m.x123 - m.x127 + m.x277 + m.x281 <= 12)
m.c3132 = Constraint(expr= 12*m.b40 + 12*m.b41 - m.x124 - m.x125 + m.x278 + m.x279 <= 12)
m.c3133 = Constraint(expr= 12*m.b42 + 12*m.b43 - m.x126 - m.x127 + m.x280 + m.x281 <= 12)
m.c3134 = Constraint(expr= 12*m.b30 + 12*m.b31 + 12*m.b32 - m.x114 - m.x115 - m.x116 + m.x268 + m.x269 + m.x270 <= 12)
m.c3135 = Constraint(expr= 12*m.b34 + 12*m.b41 + 12*m.b42 - m.x118 - m.x125 - m.x126 + m.x272 + m.x279 + m.x280 <= 12)
m.c3136 = Constraint(expr= 12*m.b36 + 12*m.b41 + 12*m.b42 - m.x120 - m.x125 - m.x126 + m.x274 + m.x279 + m.x280 <= 12)
m.c3137 = Constraint(expr= 12*m.b38 + 12*m.b41 + 12*m.b42 - m.x122 - m.x125 - m.x126 + m.x276 + m.x279 + m.x280 <= 12)
m.c3138 = Constraint(expr= 12*m.b44 + 12*m.b47 - m.x128 - m.x131 + m.x198 + m.x201 + m.x268 + m.x271 <= 12)
m.c3139 = Constraint(expr= 12*m.b44 + 12*m.b48 - m.x128 - m.x132 + m.x198 + m.x202 + m.x268 + m.x272 <= 12)
m.c3140 = Constraint(expr= 12*m.b45 + 12*m.b49 - m.x129 - m.x133 + m.x199 + m.x203 + m.x269 + m.x273 <= 12)
m.c3141 = Constraint(expr= 12*m.b45 + 12*m.b50 - m.x129 - m.x134 + m.x199 + m.x204 + m.x269 + m.x274 <= 12)
m.c3142 = Constraint(expr= 12*m.b45 + 12*m.b51 - m.x129 - m.x135 + m.x199 + m.x205 + m.x269 + m.x275 <= 12)
m.c3143 = Constraint(expr= 12*m.b46 + 12*m.b52 - m.x130 - m.x136 + m.x200 + m.x206 + m.x270 + m.x276 <= 12)
m.c3144 = Constraint(expr= 12*m.b46 + 12*m.b53 - m.x130 - m.x137 + m.x200 + m.x207 + m.x270 + m.x277 <= 12)
m.c3145 = Constraint(expr= 12*m.b47 + 12*m.b54 - m.x131 - m.x138 + m.x201 + m.x208 + m.x271 + m.x278 <= 12)
m.c3146 = Constraint(expr= 12*m.b49 + 12*m.b54 - m.x133 - m.x138 + m.x203 + m.x208 + m.x273 + m.x278 <= 12)
m.c3147 = Constraint(expr= 12*m.b51 + 12*m.b57 - m.x135 - m.x141 + m.x205 + m.x211 + m.x275 + m.x281 <= 12)
m.c3148 = Constraint(expr= 12*m.b53 + 12*m.b57 - m.x137 - m.x141 + m.x207 + m.x211 + m.x277 + m.x281 <= 12)
m.c3149 = Constraint(expr= 12*m.b54 + 12*m.b55 - m.x138 - m.x139 + m.x208 + m.x209 + m.x278 + m.x279 <= 12)
m.c3150 = Constraint(expr= 12*m.b56 + 12*m.b57 - m.x140 - m.x141 + m.x210 + m.x211 + m.x280 + m.x281 <= 12)
m.c3151 = Constraint(expr= 12*m.b44 + 12*m.b45 + 12*m.b46 - m.x128 - m.x129 - m.x130 + m.x198 + m.x199 + m.x200
+ m.x268 + m.x269 + m.x270 <= 12)
m.c3152 = Constraint(expr= 12*m.b48 + 12*m.b55 + 12*m.b56 - m.x132 - m.x139 - m.x140 + m.x202 + m.x209 + m.x210
+ m.x272 + m.x279 + m.x280 <= 12)
m.c3153 = Constraint(expr= 12*m.b50 + 12*m.b55 + 12*m.b56 - m.x134 - m.x139 - m.x140 + m.x204 + m.x209 + m.x210
+ m.x274 + m.x279 + m.x280 <= 12)
m.c3154 = Constraint(expr= 12*m.b52 + 12*m.b55 + 12*m.b56 - m.x136 - m.x139 - m.x140 + m.x206 + m.x209 + m.x210
+ m.x276 + m.x279 + m.x280 <= 12)
m.c3155 = Constraint(expr= 12*m.b58 + 12*m.b61 - m.x142 - m.x145 + m.x198 + m.x201 + m.x212 + m.x215 + m.x268 + m.x271
<= 12)
m.c3156 = Constraint(expr= 12*m.b58 + 12*m.b62 - m.x142 - m.x146 + m.x198 + m.x202 + m.x212 + m.x216 + m.x268 + m.x272
<= 12)
m.c3157 = Constraint(expr= 12*m.b59 + 12*m.b63 - m.x143 - m.x147 + m.x199 + m.x203 + m.x213 + m.x217 + m.x269 + m.x273
<= 12)
m.c3158 = Constraint(expr= 12*m.b59 + 12*m.b64 - m.x143 - m.x148 + m.x199 + m.x204 + m.x213 + m.x218 + m.x269 + m.x274
<= 12)
m.c3159 = Constraint(expr= 12*m.b59 + 12*m.b65 - m.x143 - m.x149 + m.x199 + m.x205 + m.x213 + m.x219 + m.x269 + m.x275
<= 12)
m.c3160 = Constraint(expr= 12*m.b60 + 12*m.b66 - m.x144 - m.x150 + m.x200 + m.x206 + m.x214 + m.x220 + m.x270 + m.x276
<= 12)
m.c3161 = Constraint(expr= 12*m.b60 + 12*m.b67 - m.x144 - m.x151 + m.x200 + m.x207 + m.x214 + m.x221 + m.x270 + m.x277
<= 12)
m.c3162 = Constraint(expr= 12*m.b61 + 12*m.b68 - m.x145 - m.x152 + m.x201 + m.x208 + m.x215 + m.x222 + m.x271 + m.x278
<= 12)
m.c3163 = Constraint(expr= 12*m.b63 + 12*m.b68 - m.x147 - m.x152 + m.x203 + m.x208 + m.x217 + m.x222 + m.x273 + m.x278
<= 12)
m.c3164 = Constraint(expr= 12*m.b65 + 12*m.b71 - m.x149 - m.x155 + m.x205 + m.x211 + m.x219 + m.x225 + m.x275 + m.x281
<= 12)
m.c3165 = Constraint(expr= 12*m.b67 + 12*m.b71 - m.x151 - m.x155 + m.x207 + m.x211 + m.x221 + m.x225 + m.x277 + m.x281
<= 12)
m.c3166 = Constraint(expr= 12*m.b68 + 12*m.b69 - m.x152 - m.x153 + m.x208 + m.x209 + m.x222 + m.x223 + m.x278 + m.x279
<= 12)
m.c3167 = Constraint(expr= 12*m.b70 + 12*m.b71 - m.x154 - m.x155 + m.x210 + m.x211 + m.x224 + m.x225 + m.x280 + m.x281
<= 12)
m.c3168 = Constraint(expr= 12*m.b58 + 12*m.b59 + 12*m.b60 - m.x142 - m.x143 - m.x144 + m.x198 + m.x199 + m.x200
+ m.x212 + m.x213 + m.x214 + m.x268 + m.x269 + m.x270 <= 12)
m.c3169 = Constraint(expr= 12*m.b62 + 12*m.b69 + 12*m.b70 - m.x146 - m.x153 - m.x154 + m.x202 + m.x209 + m.x210
+ m.x216 + m.x223 + m.x224 + m.x272 + m.x279 + m.x280 <= 12)
m.c3170 = Constraint(expr= 12*m.b64 + 12*m.b69 + 12*m.b70 - m.x148 - m.x153 - m.x154 + m.x204 + m.x209 + m.x210
+ m.x218 + m.x223 + m.x224 + m.x274 + m.x279 + m.x280 <= 12)
m.c3171 = Constraint(expr= 12*m.b66 + 12*m.b69 + 12*m.b70 - m.x150 - m.x153 - m.x154 + m.x206 + m.x209 + m.x210
+ m.x220 + m.x223 + m.x224 + m.x276 + m.x279 + m.x280 <= 12)
m.c3172 = Constraint(expr= 12*m.b72 + 12*m.b75 - m.x156 - m.x159 + m.x198 + m.x201 + m.x212 + m.x215 + m.x226 + m.x229
+ m.x268 + m.x271 <= 12)
m.c3173 = Constraint(expr= 12*m.b72 + 12*m.b76 - m.x156 - m.x160 + m.x198 + m.x202 + m.x212 + m.x216 + m.x226 + m.x230
+ m.x268 + m.x272 <= 12)
m.c3174 = Constraint(expr= 12*m.b73 + 12*m.b77 - m.x157 - m.x161 + m.x199 + m.x203 + m.x213 + m.x217 + m.x227 + m.x231
+ m.x269 + m.x273 <= 12)
m.c3175 = Constraint(expr= 12*m.b73 + 12*m.b78 - m.x157 - m.x162 + m.x199 + m.x204 + m.x213 + m.x218 + m.x227 + m.x232
+ m.x269 + m.x274 <= 12)
m.c3176 = Constraint(expr= 12*m.b73 + 12*m.b79 - m.x157 - m.x163 + m.x199 + m.x205 + m.x213 + m.x219 + m.x227 + m.x233
+ m.x269 + m.x275 <= 12)
m.c3177 = Constraint(expr= 12*m.b74 + 12*m.b80 - m.x158 - m.x164 + m.x200 + m.x206 + m.x214 + m.x220 + m.x228 + m.x234
+ m.x270 + m.x276 <= 12)
m.c3178 = Constraint(expr= 12*m.b74 + 12*m.b81 - m.x158 - m.x165 + m.x200 + m.x207 + m.x214 + m.x221 + m.x228 + m.x235
+ m.x270 + m.x277 <= 12)
m.c3179 = Constraint(expr= 12*m.b75 + 12*m.b82 - m.x159 - m.x166 + m.x201 + m.x208 + m.x215 + m.x222 + m.x229 + m.x236
+ m.x271 + m.x278 <= 12)
m.c3180 = Constraint(expr= 12*m.b77 + 12*m.b82 - m.x161 - m.x166 + m.x203 + m.x208 + m.x217 + m.x222 + m.x231 + m.x236
+ m.x273 + m.x278 <= 12)
m.c3181 = Constraint(expr= 12*m.b79 + 12*m.b85 - m.x163 - m.x169 + m.x205 + m.x211 + m.x219 + m.x225 + m.x233 + m.x239
+ m.x275 + m.x281 <= 12)
m.c3182 = Constraint(expr= 12*m.b81 + 12*m.b85 - m.x165 - m.x169 + m.x207 + m.x211 + m.x221 + m.x225 + m.x235 + m.x239
+ m.x277 + m.x281 <= 12)
m.c3183 = Constraint(expr= 12*m.b82 + 12*m.b83 - m.x166 - m.x167 + m.x208 + m.x209 + m.x222 + m.x223 + m.x236 + m.x237
+ m.x278 + m.x279 <= 12)
m.c3184 = Constraint(expr= 12*m.b84 + 12*m.b85 - m.x168 - m.x169 + m.x210 + m.x211 + m.x224 + m.x225 + m.x238 + m.x239
+ m.x280 + m.x281 <= 12)
m.c3185 = Constraint(expr= 12*m.b72 + 12*m.b73 + 12*m.b74 - m.x156 - m.x157 - m.x158 + m.x198 + m.x199 + m.x200
+ m.x212 + m.x213 + m.x214 + m.x226 + m.x227 + m.x228 + m.x268 + m.x269 + m.x270 <= 12)
m.c3186 = Constraint(expr= 12*m.b76 + 12*m.b83 + 12*m.b84 - m.x160 - m.x167 - m.x168 + m.x202 + m.x209 + m.x210
+ m.x216 + m.x223 + m.x224 + m.x230 + m.x237 + m.x238 + m.x272 + m.x279 + m.x280 <= 12)
m.c3187 = Constraint(expr= 12*m.b78 + 12*m.b83 + 12*m.b84 - m.x162 - m.x167 - m.x168 + m.x204 + m.x209 + m.x210
+ m.x218 + m.x223 + m.x224 + m.x232 + m.x237 + m.x238 + m.x274 + m.x279 + m.x280 <= 12)
m.c3188 = Constraint(expr= 12*m.b80 + 12*m.b83 + 12*m.b84 - m.x164 - m.x167 - m.x168 + m.x206 + m.x209 + m.x210
+ m.x220 + m.x223 + m.x224 + m.x234 + m.x237 + m.x238 + m.x276 + m.x279 + m.x280 <= 12)
m.c3189 = Constraint(expr= 12*m.b44 + 12*m.b47 - m.x128 - m.x131 + m.x282 + m.x285 <= 12)
m.c3190 = Constraint(expr= 12*m.b44 + 12*m.b48 - m.x128 - m.x132 + m.x282 + m.x286 <= 12)
m.c3191 = Constraint(expr= 12*m.b45 + 12*m.b49 - m.x129 - m.x133 + m.x283 + m.x287 <= 12)
m.c3192 = Constraint(expr= 12*m.b45 + 12*m.b50 - m.x129 - m.x134 + m.x283 + m.x288 <= 12)
m.c3193 = Constraint(expr= 12*m.b45 + 12*m.b51 - m.x129 - m.x135 + m.x283 + m.x289 <= 12)
m.c3194 = Constraint(expr= 12*m.b46 + 12*m.b52 - m.x130 - m.x136 + m.x284 + m.x290 <= 12)
m.c3195 = Constraint(expr= 12*m.b46 + 12*m.b53 - m.x130 - m.x137 + m.x284 + m.x291 <= 12)
m.c3196 = Constraint(expr= 12*m.b47 + 12*m.b54 - m.x131 - m.x138 + m.x285 + m.x292 <= 12)
m.c3197 = Constraint(expr= 12*m.b49 + 12*m.b54 - m.x133 - m.x138 + m.x287 + m.x292 <= 12)
m.c3198 = Constraint(expr= 12*m.b51 + 12*m.b57 - m.x135 - m.x141 + m.x289 + m.x295 <= 12)
m.c3199 = Constraint(expr= 12*m.b53 + 12*m.b57 - m.x137 - m.x141 + m.x291 + m.x295 <= 12)
m.c3200 = Constraint(expr= 12*m.b54 + 12*m.b55 - m.x138 - m.x139 + m.x292 + m.x293 <= 12)
m.c3201 = Constraint(expr= 12*m.b56 + 12*m.b57 - m.x140 - m.x141 + m.x294 + m.x295 <= 12)
m.c3202 = Constraint(expr= 12*m.b44 + 12*m.b45 + 12*m.b46 - m.x128 - m.x129 - m.x130 + m.x282 + m.x283 + m.x284 <= 12)
m.c3203 = Constraint(expr= 12*m.b48 + 12*m.b55 + 12*m.b56 - m.x132 - m.x139 - m.x140 + m.x286 + m.x293 + m.x294 <= 12)
m.c3204 = Constraint(expr= 12*m.b50 + 12*m.b55 + 12*m.b56 - m.x134 - m.x139 - m.x140 + m.x288 + m.x293 + m.x294 <= 12)
m.c3205 = Constraint(expr= 12*m.b52 + 12*m.b55 + 12*m.b56 - m.x136 - m.x139 - m.x140 + m.x290 + m.x293 + m.x294 <= 12)
m.c3206 = Constraint(expr= 12*m.b58 + 12*m.b61 - m.x142 - m.x145 + m.x212 + m.x215 + m.x282 + m.x285 <= 12)
m.c3207 = Constraint(expr= 12*m.b58 + 12*m.b62 - m.x142 - m.x146 + m.x212 + m.x216 + m.x282 + m.x286 <= 12)
m.c3208 = Constraint(expr= 12*m.b59 + 12*m.b63 - m.x143 - m.x147 + m.x213 + m.x217 + m.x283 + m.x287 <= 12)
m.c3209 = Constraint(expr= 12*m.b59 + 12*m.b64 - m.x143 - m.x148 + m.x213 + m.x218 + m.x283 + m.x288 <= 12)
m.c3210 = Constraint(expr= 12*m.b59 + 12*m.b65 - m.x143 - m.x149 + m.x213 + m.x219 + m.x283 + m.x289 <= 12)
m.c3211 = Constraint(expr= 12*m.b60 + 12*m.b66 - m.x144 - m.x150 + m.x214 + m.x220 + m.x284 + m.x290 <= 12)
m.c3212 = Constraint(expr= 12*m.b60 + 12*m.b67 - m.x144 - m.x151 + m.x214 + m.x221 + m.x284 + m.x291 <= 12)
m.c3213 = Constraint(expr= 12*m.b61 + 12*m.b68 - m.x145 - m.x152 + m.x215 + m.x222 + m.x285 + m.x292 <= 12)
m.c3214 = Constraint(expr= 12*m.b63 + 12*m.b68 - m.x147 - m.x152 + m.x217 + m.x222 + m.x287 + m.x292 <= 12)
m.c3215 = Constraint(expr= 12*m.b65 + 12*m.b71 - m.x149 - m.x155 + m.x219 + m.x225 + m.x289 + m.x295 <= 12)
m.c3216 = Constraint(expr= 12*m.b67 + 12*m.b71 - m.x151 - m.x155 + m.x221 + m.x225 + m.x291 + m.x295 <= 12)
m.c3217 = Constraint(expr= 12*m.b68 + 12*m.b69 - m.x152 - m.x153 + m.x222 + m.x223 + m.x292 + m.x293 <= 12)
m.c3218 = Constraint(expr= 12*m.b70 + 12*m.b71 - m.x154 - m.x155 + m.x224 + m.x225 + m.x294 + m.x295 <= 12)
m.c3219 = Constraint(expr= 12*m.b58 + 12*m.b59 + 12*m.b60 - m.x142 - m.x143 - m.x144 + m.x212 + m.x213 + m.x214
+ m.x282 + m.x283 + m.x284 <= 12)
m.c3220 = Constraint(expr= 12*m.b62 + 12*m.b69 + 12*m.b70 - m.x146 - m.x153 - m.x154 + m.x216 + m.x223 + m.x224
+ m.x286 + m.x293 + m.x294 <= 12)
m.c3221 = Constraint(expr= 12*m.b64 + 12*m.b69 + 12*m.b70 - m.x148 - m.x153 - m.x154 + m.x218 + m.x223 + m.x224
+ m.x288 + m.x293 + m.x294 <= 12)
m.c3222 = Constraint(expr= 12*m.b66 + 12*m.b69 + 12*m.b70 - m.x150 - m.x153 - m.x154 + m.x220 + m.x223 + m.x224
+ m.x290 + m.x293 + m.x294 <= 12)
m.c3223 = Constraint(expr= 12*m.b72 + 12*m.b75 - m.x156 - m.x159 + m.x212 + m.x215 + m.x226 + m.x229 + m.x282 + m.x285
<= 12)
m.c3224 = Constraint(expr= 12*m.b72 + 12*m.b76 - m.x156 - m.x160 + m.x212 + m.x216 + m.x226 + m.x230 + m.x282 + m.x286
<= 12)
m.c3225 = Constraint(expr= 12*m.b73 + 12*m.b77 - m.x157 - m.x161 + m.x213 + m.x217 + m.x227 + m.x231 + m.x283 + m.x287
<= 12)
m.c3226 = Constraint(expr= 12*m.b73 + 12*m.b78 - m.x157 - m.x162 + m.x213 + m.x218 + m.x227 + m.x232 + m.x283 + m.x288
<= 12)
m.c3227 = Constraint(expr= 12*m.b73 + 12*m.b79 - m.x157 - m.x163 + m.x213 + m.x219 + m.x227 + m.x233 + m.x283 + m.x289
<= 12)
m.c3228 = Constraint(expr= 12*m.b74 + 12*m.b80 - m.x158 - m.x164 + m.x214 + m.x220 + m.x228 + m.x234 + m.x284 + m.x290
<= 12)
m.c3229 = Constraint(expr= 12*m.b74 + 12*m.b81 - m.x158 - m.x165 + m.x214 + m.x221 + m.x228 + m.x235 + m.x284 + m.x291
<= 12)
m.c3230 = Constraint(expr= 12*m.b75 + 12*m.b82 - m.x159 - m.x166 + m.x215 + m.x222 + m.x229 + m.x236 + m.x285 + m.x292
<= 12)
m.c3231 = Constraint(expr= 12*m.b77 + 12*m.b82 - m.x161 - m.x166 + m.x217 + m.x222 + m.x231 + m.x236 + m.x287 + m.x292
<= 12)
m.c3232 = Constraint(expr= 12*m.b79 + 12*m.b85 - m.x163 - m.x169 + m.x219 + m.x225 + m.x233 + m.x239 + m.x289 + m.x295
<= 12)
m.c3233 = Constraint(expr= 12*m.b81 + 12*m.b85 - m.x165 - m.x169 + m.x221 + m.x225 + m.x235 + m.x239 + m.x291 + m.x295
<= 12)
m.c3234 = Constraint(expr= 12*m.b82 + 12*m.b83 - m.x166 - m.x167 + m.x222 + m.x223 + m.x236 + m.x237 + m.x292 + m.x293
<= 12)
m.c3235 = Constraint(expr= 12*m.b84 + 12*m.b85 - m.x168 - m.x169 + m.x224 + m.x225 + m.x238 + m.x239 + m.x294 + m.x295
<= 12)
m.c3236 = Constraint(expr= 12*m.b72 + 12*m.b73 + 12*m.b74 - m.x156 - m.x157 - m.x158 + m.x212 + m.x213 + m.x214
+ m.x226 + m.x227 + m.x228 + m.x282 + m.x283 + m.x284 <= 12)
m.c3237 = Constraint(expr= 12*m.b76 + 12*m.b83 + 12*m.b84 - m.x160 - m.x167 - m.x168 + m.x216 + m.x223 + m.x224
+ m.x230 + m.x237 + m.x238 + m.x286 + m.x293 + m.x294 <= 12)
m.c3238 = Constraint(expr= 12*m.b78 + 12*m.b83 + 12*m.b84 - m.x162 - m.x167 - m.x168 + m.x218 + m.x223 + m.x224
+ m.x232 + m.x237 + m.x238 + m.x288 + m.x293 + m.x294 <= 12)
m.c3239 = Constraint(expr= 12*m.b80 + 12*m.b83 + 12*m.b84 - m.x164 - m.x167 - m.x168 + m.x220 + m.x223 + m.x224
+ m.x234 + m.x237 + m.x238 + m.x290 + m.x293 + m.x294 <= 12)
m.c3240 = Constraint(expr= 12*m.b58 + 12*m.b61 - m.x142 - m.x145 + m.x296 + m.x299 <= 12)
m.c3241 = Constraint(expr= 12*m.b58 + 12*m.b62 - m.x142 - m.x146 + m.x296 + m.x300 <= 12)
m.c3242 = Constraint(expr= 12*m.b59 + 12*m.b63 - m.x143 - m.x147 + m.x297 + m.x301 <= 12)
m.c3243 = Constraint(expr= 12*m.b59 + 12*m.b64 - m.x143 - m.x148 + m.x297 + m.x302 <= 12)
m.c3244 = Constraint(expr= 12*m.b59 + 12*m.b65 - m.x143 - m.x149 + m.x297 + m.x303 <= 12)
m.c3245 = Constraint(expr= 12*m.b60 + 12*m.b66 - m.x144 - m.x150 + m.x298 + m.x304 <= 12)
m.c3246 = Constraint(expr= 12*m.b60 + 12*m.b67 - m.x144 - m.x151 + m.x298 + m.x305 <= 12)
m.c3247 = Constraint(expr= 12*m.b61 + 12*m.b68 - m.x145 - m.x152 + m.x299 + m.x306 <= 12)
m.c3248 = Constraint(expr= 12*m.b63 + 12*m.b68 - m.x147 - m.x152 + m.x301 + m.x306 <= 12)
m.c3249 = Constraint(expr= 12*m.b65 + 12*m.b71 - m.x149 - m.x155 + m.x303 + m.x309 <= 12)
m.c3250 = Constraint(expr= 12*m.b67 + 12*m.b71 - m.x151 - m.x155 + m.x305 + m.x309 <= 12)
m.c3251 = Constraint(expr= 12*m.b68 + 12*m.b69 - m.x152 - m.x153 + m.x306 + m.x307 <= 12)
m.c3252 = Constraint(expr= 12*m.b70 + 12*m.b71 - m.x154 - m.x155 + m.x308 + m.x309 <= 12)
m.c3253 = Constraint(expr= 12*m.b58 + 12*m.b59 + 12*m.b60 - m.x142 - m.x143 - m.x144 + m.x296 + m.x297 + m.x298 <= 12)
m.c3254 = Constraint(expr= 12*m.b62 + 12*m.b69 + 12*m.b70 - m.x146 - m.x153 - m.x154 + m.x300 + m.x307 + m.x308 <= 12)
m.c3255 = Constraint(expr= 12*m.b64 + 12*m.b69 + 12*m.b70 - m.x148 - m.x153 - m.x154 + m.x302 + m.x307 + m.x308 <= 12)
m.c3256 = Constraint(expr= 12*m.b66 + 12*m.b69 + 12*m.b70 - m.x150 - m.x153 - m.x154 + m.x304 + m.x307 + m.x308 <= 12)
m.c3257 = Constraint(expr= 12*m.b72 + 12*m.b75 - m.x156 - m.x159 + m.x226 + m.x229 + m.x296 + m.x299 <= 12)
m.c3258 = Constraint(expr= 12*m.b72 + 12*m.b76 - m.x156 - m.x160 + m.x226 + m.x230 + m.x296 + m.x300 <= 12)
m.c3259 = Constraint(expr= 12*m.b73 + 12*m.b77 - m.x157 - m.x161 + m.x227 + m.x231 + m.x297 + m.x301 <= 12)
m.c3260 = Constraint(expr= 12*m.b73 + 12*m.b78 - m.x157 - m.x162 + m.x227 + m.x232 + m.x297 + m.x302 <= 12)
m.c3261 = Constraint(expr= 12*m.b73 + 12*m.b79 - m.x157 - m.x163 + m.x227 + m.x233 + m.x297 + m.x303 <= 12)
m.c3262 = Constraint(expr= 12*m.b74 + 12*m.b80 - m.x158 - m.x164 + m.x228 + m.x234 + m.x298 + m.x304 <= 12)
m.c3263 = Constraint(expr= 12*m.b74 + 12*m.b81 - m.x158 - m.x165 + m.x228 + m.x235 + m.x298 + m.x305 <= 12)
m.c3264 = Constraint(expr= 12*m.b75 + 12*m.b82 - m.x159 - m.x166 + m.x229 + m.x236 + m.x299 + m.x306 <= 12)
m.c3265 = Constraint(expr= 12*m.b77 + 12*m.b82 - m.x161 - m.x166 + m.x231 + m.x236 + m.x301 + m.x306 <= 12)
m.c3266 = Constraint(expr= 12*m.b79 + 12*m.b85 - m.x163 - m.x169 + m.x233 + m.x239 + m.x303 + m.x309 <= 12)
m.c3267 = Constraint(expr= 12*m.b81 + 12*m.b85 - m.x165 - m.x169 + m.x235 + m.x239 + m.x305 + m.x309 <= 12)
m.c3268 = Constraint(expr= 12*m.b82 + 12*m.b83 - m.x166 - m.x167 + m.x236 + m.x237 + m.x306 + m.x307 <= 12)
m.c3269 = Constraint(expr= 12*m.b84 + 12*m.b85 - m.x168 - m.x169 + m.x238 + m.x239 + m.x308 + m.x309 <= 12)
m.c3270 = Constraint(expr= 12*m.b72 + 12*m.b73 + 12*m.b74 - m.x156 - m.x157 - m.x158 + m.x226 + m.x227 + m.x228
+ m.x296 + m.x297 + m.x298 <= 12)
m.c3271 = Constraint(expr= 12*m.b76 + 12*m.b83 + 12*m.b84 - m.x160 - m.x167 - m.x168 + m.x230 + m.x237 + m.x238
+ m.x300 + m.x307 + m.x308 <= 12)
m.c3272 = Constraint(expr= 12*m.b78 + 12*m.b83 + 12*m.b84 - m.x162 - m.x167 - m.x168 + m.x232 + m.x237 + m.x238
+ m.x302 + m.x307 + m.x308 <= 12)
m.c3273 = Constraint(expr= 12*m.b80 + 12*m.b83 + 12*m.b84 - m.x164 - m.x167 - m.x168 + m.x234 + m.x237 + m.x238
+ m.x304 + m.x307 + m.x308 <= 12)
m.c3274 = Constraint(expr= 12*m.b72 + 12*m.b75 - m.x156 - m.x159 + m.x310 + m.x313 <= 12)
m.c3275 = Constraint(expr= 12*m.b72 + 12*m.b76 - m.x156 - m.x160 + m.x310 + m.x314 <= 12)
m.c3276 = Constraint(expr= 12*m.b73 + 12*m.b77 - m.x157 - m.x161 + m.x311 + m.x315 <= 12)
m.c3277 = Constraint(expr= 12*m.b73 + 12*m.b78 - m.x157 - m.x162 + m.x311 + m.x316 <= 12)
m.c3278 = Constraint(expr= 12*m.b73 + 12*m.b79 - m.x157 - m.x163 + m.x311 + m.x317 <= 12)
m.c3279 = Constraint(expr= 12*m.b74 + 12*m.b80 - m.x158 - m.x164 + m.x312 + m.x318 <= 12)
m.c3280 = Constraint(expr= 12*m.b74 + 12*m.b81 - m.x158 - m.x165 + m.x312 + m.x319 <= 12)
m.c3281 = Constraint(expr= 12*m.b75 + 12*m.b82 - m.x159 - m.x166 + m.x313 + m.x320 <= 12)
m.c3282 = Constraint(expr= 12*m.b77 + 12*m.b82 - m.x161 - m.x166 + m.x315 + m.x320 <= 12)
m.c3283 = Constraint(expr= 12*m.b79 + 12*m.b85 - m.x163 - m.x169 + m.x317 + m.x323 <= 12)
m.c3284 = Constraint(expr= 12*m.b81 + 12*m.b85 - m.x165 - m.x169 + m.x319 + m.x323 <= 12)
m.c3285 = Constraint(expr= 12*m.b82 + 12*m.b83 - m.x166 - m.x167 + m.x320 + m.x321 <= 12)
m.c3286 = Constraint(expr= 12*m.b84 + 12*m.b85 - m.x168 - m.x169 + m.x322 + m.x323 <= 12)
m.c3287 = Constraint(expr= 12*m.b72 + 12*m.b73 + 12*m.b74 - m.x156 - m.x157 - m.x158 + m.x310 + m.x311 + m.x312 <= 12)
m.c3288 = Constraint(expr= 12*m.b76 + 12*m.b83 + 12*m.b84 - m.x160 - m.x167 - m.x168 + m.x314 + m.x321 + m.x322 <= 12)
m.c3289 = Constraint(expr= 12*m.b78 + 12*m.b83 + 12*m.b84 - m.x162 - m.x167 - m.x168 + m.x316 + m.x321 + m.x322 <= 12)
m.c3290 = Constraint(expr= 12*m.b80 + 12*m.b83 + 12*m.b84 - m.x164 - m.x167 - m.x168 + m.x318 + m.x321 + m.x322 <= 12)
m.c3291 = Constraint(expr= - m.b3 - m.b4 - m.b5 - m.b6 + m.b16 <= 0)
m.c3292 = Constraint(expr= - m.b2 - m.b4 - m.b7 - m.b8 - m.b9 + m.b17 <= 0)
m.c3293 = Constraint(expr= - m.b2 - m.b3 - m.b10 - m.b11 + m.b18 <= 0)
m.c3294 = Constraint(expr= - m.b2 - m.b12 + m.b19 <= 0)
m.c3295 = Constraint(expr= - m.b2 - m.b13 - m.b14 + m.b20 <= 0)
m.c3296 = Constraint(expr= - m.b3 - m.b12 + m.b21 <= 0)
m.c3297 = Constraint(expr= - m.b3 - m.b13 - m.b14 + m.b22 <= 0)
m.c3298 = Constraint(expr= - m.b3 - m.b15 + m.b23 <= 0)
m.c3299 = Constraint(expr= - m.b4 - m.b13 - m.b14 + m.b24 <= 0)
m.c3300 = Constraint(expr= - m.b4 - m.b15 + m.b25 <= 0)
m.c3301 = Constraint(expr= - m.b5 - m.b7 - m.b13 + m.b26 <= 0)
m.c3302 = Constraint(expr= - m.b6 - m.b8 - m.b10 - m.b12 - m.b14 + m.b27 <= 0)
m.c3303 = Constraint(expr= - m.b6 - m.b8 - m.b10 - m.b13 - m.b15 + m.b28 <= 0)
m.c3304 = Constraint(expr= - m.b9 - m.b11 - m.b14 + m.b29 <= 0)
m.c3305 = Constraint(expr= - m.b17 - m.b18 - m.b19 - m.b20 + m.b30 <= 0)
m.c3306 = Constraint(expr= - m.b16 - m.b18 - m.b21 - m.b22 - m.b23 + m.b31 <= 0)
m.c3307 = Constraint(expr= - m.b16 - m.b17 - m.b24 - m.b25 + m.b32 <= 0)
m.c3308 = Constraint(expr= - m.b16 - m.b26 + m.b33 <= 0)
m.c3309 = Constraint(expr= - m.b16 - m.b27 - m.b28 + m.b34 <= 0)
m.c3310 = Constraint(expr= - m.b17 - m.b26 + m.b35 <= 0)
m.c3311 = Constraint(expr= - m.b17 - m.b27 - m.b28 + m.b36 <= 0)
m.c3312 = Constraint(expr= - m.b17 - m.b29 + m.b37 <= 0)
m.c3313 = Constraint(expr= - m.b18 - m.b27 - m.b28 + m.b38 <= 0)
m.c3314 = Constraint(expr= - m.b18 - m.b29 + m.b39 <= 0)
m.c3315 = Constraint(expr= - m.b19 - m.b21 - m.b27 + m.b40 <= 0)
m.c3316 = Constraint(expr= - m.b20 - m.b22 - m.b24 - m.b26 - m.b28 + m.b41 <= 0)
m.c3317 = Constraint(expr= - m.b20 - m.b22 - m.b24 - m.b27 - m.b29 + m.b42 <= 0)
m.c3318 = Constraint(expr= - m.b23 - m.b25 - m.b28 + m.b43 <= 0)
m.c3319 = Constraint(expr= - m.b31 - m.b32 - m.b33 - m.b34 + m.b44 <= 0)
m.c3320 = Constraint(expr= - m.b30 - m.b32 - m.b35 - m.b36 - m.b37 + m.b45 <= 0)
m.c3321 = Constraint(expr= - m.b30 - m.b31 - m.b38 - m.b39 + m.b46 <= 0)
m.c3322 = Constraint(expr= - m.b30 - m.b40 + m.b47 <= 0)
m.c3323 = Constraint(expr= - m.b30 - m.b41 - m.b42 + m.b48 <= 0)
m.c3324 = Constraint(expr= - m.b31 - m.b40 + m.b49 <= 0)
m.c3325 = Constraint(expr= - m.b31 - m.b41 - m.b42 + m.b50 <= 0)
m.c3326 = Constraint(expr= - m.b31 - m.b43 + m.b51 <= 0)
m.c3327 = Constraint(expr= - m.b32 - m.b41 - m.b42 + m.b52 <= 0)
m.c3328 = Constraint(expr= - m.b32 - m.b43 + m.b53 <= 0)
m.c3329 = Constraint(expr= - m.b33 - m.b35 - m.b41 + m.b54 <= 0)
m.c3330 = Constraint(expr= - m.b34 - m.b36 - m.b38 - m.b40 - m.b42 + m.b55 <= 0)
m.c3331 = Constraint(expr= - m.b34 - m.b36 - m.b38 - m.b41 - m.b43 + m.b56 <= 0)
m.c3332 = Constraint(expr= - m.b37 - m.b39 - m.b42 + m.b57 <= 0)
m.c3333 = Constraint(expr= - m.b45 - m.b46 - m.b47 - m.b48 + m.b58 <= 0)
m.c3334 = Constraint(expr= - m.b44 - m.b46 - m.b49 - m.b50 - m.b51 + m.b59 <= 0)
m.c3335 = Constraint(expr= - m.b44 - m.b45 - m.b52 - m.b53 + m.b60 <= 0)
m.c3336 = Constraint(expr= - m.b44 - m.b54 + m.b61 <= 0)
m.c3337 = Constraint(expr= - m.b44 - m.b55 - m.b56 + m.b62 <= 0)
m.c3338 = Constraint(expr= - m.b45 - m.b54 + m.b63 <= 0)
m.c3339 = Constraint(expr= - m.b45 - m.b55 - m.b56 + m.b64 <= 0)
m.c3340 = Constraint(expr= - m.b45 - m.b57 + m.b65 <= 0)
m.c3341 = Constraint(expr= - m.b46 - m.b55 - m.b56 + m.b66 <= 0)
m.c3342 = Constraint(expr= - m.b46 - m.b57 + m.b67 <= 0)
m.c3343 = Constraint(expr= - m.b47 - m.b49 - m.b55 + m.b68 <= 0)
m.c3344 = Constraint(expr= - m.b48 - m.b50 - m.b52 - m.b54 - m.b56 + m.b69 <= 0)
m.c3345 = Constraint(expr= - m.b48 - m.b50 - m.b52 - m.b55 - m.b57 + m.b70 <= 0)
m.c3346 = Constraint(expr= - m.b51 - m.b53 - m.b56 + m.b71 <= 0)
m.c3347 = Constraint(expr= - m.b59 - m.b60 - m.b61 - m.b62 + m.b72 <= 0)
m.c3348 = Constraint(expr= - m.b58 - m.b60 - m.b63 - m.b64 - m.b65 + m.b73 <= 0)
m.c3349 = Constraint(expr= - m.b58 - m.b59 - m.b66 - m.b67 + m.b74 <= 0)
m.c3350 = Constraint(expr= - m.b58 - m.b68 + m.b75 <= 0)
m.c3351 = Constraint(expr= - m.b58 - m.b69 - m.b70 + m.b76 <= 0)
m.c3352 = Constraint(expr= - m.b59 - m.b68 + m.b77 <= 0)
m.c3353 = Constraint(expr= - m.b59 - m.b69 - m.b70 + m.b78 <= 0)
m.c3354 = Constraint(expr= - m.b59 - m.b71 + m.b79 <= 0)
m.c3355 = Constraint(expr= - m.b60 - m.b69 - m.b70 + m.b80 <= 0)
m.c3356 = Constraint(expr= - m.b60 - m.b71 + m.b81 <= 0)
m.c3357 = Constraint(expr= - m.b61 - m.b63 - m.b69 + m.b82 <= 0)
m.c3358 = Constraint(expr= - m.b62 - m.b64 - m.b66 - m.b68 - m.b70 + m.b83 <= 0)
m.c3359 = Constraint(expr= - m.b62 - m.b64 - m.b66 - m.b69 - m.b71 + m.b84 <= 0)
m.c3360 = Constraint(expr= - m.b65 - m.b67 - m.b70 + m.b85 <= 0)
| models_nonconvex_simple2/crudeoil_lee3_06.py | 374,879 | MINLP written by GAMS Convert at 08/20/20 01:30:53 Equation counts Total E G L N X C B 3360 1353 785 1222 0 0 0 0 Variable counts x b i s1s s2s sc si Total cont binary integer sos1 sos2 scont sint 1537 1453 84 0 0 0 0 0 FX 0 0 0 0 0 0 0 0 Nonzero counts Total const NL DLL 15691 13339 2352 0 Reformulation has removed 1 variable and 1 equation | 680 | en | 0.679479 |
#!/usr/bin/env python2
# Copyright (c) 2014-2015 The Bitcoin Core developers
# Distributed under the MIT software license, see the accompanying
# file COPYING or http://www.opensource.org/licenses/mit-license.php.
# Test mempool limiting together/eviction with the wallet
from test_framework.test_framework import BitcoinTestFramework
from test_framework.util import *
class MempoolLimitTest(BitcoinTestFramework):
def __init__(self):
self.txouts = gen_return_txouts()
def setup_network(self):
self.nodes = []
self.nodes.append(start_node(0, self.options.tmpdir, ["-maxmempool=5", "-spendzeroconfchange=0", "-debug"]))
self.is_network_split = False
self.sync_all()
self.relayfee = self.nodes[0].getnetworkinfo()['relayfee']
def setup_chain(self):
print("Initializing test directory "+self.options.tmpdir)
initialize_chain_clean(self.options.tmpdir, 2)
def run_test(self):
txids = []
utxos = create_confirmed_utxos(self.relayfee, self.nodes[0], 90)
#create a mempool tx that will be evicted
us0 = utxos.pop()
inputs = [{ "txid" : us0["txid"], "vout" : us0["vout"]}]
outputs = {self.nodes[0].getnewaddress() : 0.0001}
tx = self.nodes[0].createrawtransaction(inputs, outputs)
self.nodes[0].settxfee(self.relayfee) # specifically fund this tx with low fee
txF = self.nodes[0].fundrawtransaction(tx)
self.nodes[0].settxfee(0) # return to automatic fee selection
txFS = self.nodes[0].signrawtransaction(txF['hex'])
txid = self.nodes[0].sendrawtransaction(txFS['hex'])
self.nodes[0].lockunspent(True, [us0])
relayfee = self.nodes[0].getnetworkinfo()['relayfee']
base_fee = relayfee*100
for i in xrange (4):
txids.append([])
txids[i] = create_lots_of_big_transactions(self.nodes[0], self.txouts, utxos[30*i:30*i+30], (i+1)*base_fee)
# by now, the tx should be evicted, check confirmation state
assert(txid not in self.nodes[0].getrawmempool())
txdata = self.nodes[0].gettransaction(txid)
assert(txdata['confirmations'] == 0) #confirmation should still be 0
if __name__ == '__main__':
MempoolLimitTest().main()
| qa/rpc-tests/mempool_limit.py | 2,282 | !/usr/bin/env python2 Copyright (c) 2014-2015 The Bitcoin Core developers Distributed under the MIT software license, see the accompanying file COPYING or http://www.opensource.org/licenses/mit-license.php. Test mempool limiting together/eviction with the walletcreate a mempool tx that will be evicted specifically fund this tx with low fee return to automatic fee selection by now, the tx should be evicted, check confirmation stateconfirmation should still be 0 | 464 | en | 0.732659 |
import json
import time, asyncio
from smsgateway import sink_sms
from smsgateway.config import *
from smsgateway.sources.utils import *
from slackclient import SlackClient
def init():
global IDENTIFIER, app_log
IDENTIFIER = "SL"
app_log = setup_logging("slack")
def main():
init()
sc = SlackClient(SL_TOKEN)
data = sc.api_call("users.list")
users = {}
app_log.info("Getting users..")
if not data['ok']:
app_log.error("Could not get user information!")
app_log.error(f"Token: {SL_TOKEN}")
app_log.error(data)
return
for u in data['members']:
uID = u['id']
uName = None
if 'real_name' in u:
uName = u['real_name']
else:
if 'profile' in u:
p = u['profile']
if 'real_name' in p:
uName = p['real_name']
if not uName:
app_log.warning(f'Could not get real_name of {uID}:')
app_log.warning(json.dumps(u, indent=2))
continue
app_log.debug(f"{uID}: {uName}")
users[uID] = uName
app_log.info(f"Got {len(users)} users")
app_log.info("Getting channels..")
data = sc.api_call("channels.list")
channels = {}
if not data['ok']:
app_log.error("Could not get channel information!")
app_log.error(f"Token: {SL_TOKEN}")
app_log.error(data)
return
for u in data['channels']:
uID = u['id']
uName = u['name']
app_log.debug(f"{uID}: {uName}")
channels[uID] = uName
app_log.info(f"Got {len(channels)} channels")
if not sc.rtm_connect(auto_reconnect=True):
app_log.error("Could not connect to Slack!")
return False
while True:
data = sc.rtm_read()
if data:
for entry in data:
app_log.debug(entry)
type = entry['type']
if type == 'message':
text = None
if 'message' in entry:
msg = entry['message']
isInChannel = True
app_log.info("Got a message in a channel!")
elif 'text' in entry:
msg = entry
isInChannel = False
app_log.info("Got a message from a user/bot!")
else:
app_log.warning("Could not parse this:\n" + entry)
continue
if not msg['text']:
print("Has no message!")
continue
else:
text = msg['text']
user = users[msg['user']]
chat_info = {
'date': str(int(float(msg['ts']))),
'from': user
}
if 'client_msg_id' in msg:
chat_info['ID'] = msg['client_msg_id']
if isInChannel:
channel = channels[entry['channel']]
chat_info.update({
'type': 'Group',
'to': channel,
})
sink_sms.send_dict(IDENTIFIER, text, chat_info)
time.sleep(1)
if __name__ == '__main__':
main()
# loop = asyncio.get_event_loop()
# loop.run_until_complete(main())
| smsgateway/sources/slack.py | 3,534 | loop = asyncio.get_event_loop() loop.run_until_complete(main()) | 63 | en | 0.253612 |
#!/usr/bin/env python
#
# pyLearn documentation build configuration file, created by
# sphinx-quickstart on Fri Jun 9 13:47:02 2017.
#
# This file is execfile()d with the current directory set to its
# containing dir.
#
# Note that not all possible configuration values are present in this
# autogenerated file.
#
# All configuration values have a default; values that are commented out
# serve to show the default.
# If extensions (or modules to document with autodoc) are in another
# directory, add these directories to sys.path here. If the directory is
# relative to the documentation root, use os.path.abspath to make it
# absolute, like shown here.
#
import os
import sys
sys.path.insert(0, os.path.abspath('..'))
import pyLearn
# -- General configuration ---------------------------------------------
# If your documentation needs a minimal Sphinx version, state it here.
#
# needs_sphinx = '1.0'
# Add any Sphinx extension module names here, as strings. They can be
# extensions coming with Sphinx (named 'sphinx.ext.*') or your custom ones.
extensions = ['sphinx.ext.autodoc', 'sphinx.ext.viewcode']
# Add any paths that contain templates here, relative to this directory.
templates_path = ['_templates']
# The suffix(es) of source filenames.
# You can specify multiple suffix as a list of string:
#
# source_suffix = ['.rst', '.md']
source_suffix = '.rst'
# The master toctree document.
master_doc = 'index'
# General information about the project.
project = 'pyLearn'
copyright = "2020, Sravan Kumar Rekandar"
author = "Sravan Kumar Rekandar"
# The version info for the project you're documenting, acts as replacement
# for |version| and |release|, also used in various other places throughout
# the built documents.
#
# The short X.Y version.
version = pyLearn.__version__
# The full version, including alpha/beta/rc tags.
release = pyLearn.__version__
# The language for content autogenerated by Sphinx. Refer to documentation
# for a list of supported languages.
#
# This is also used if you do content translation via gettext catalogs.
# Usually you set "language" from the command line for these cases.
language = None
# List of patterns, relative to source directory, that match files and
# directories to ignore when looking for source files.
# This patterns also effect to html_static_path and html_extra_path
exclude_patterns = ['_build', 'Thumbs.db', '.DS_Store']
# The name of the Pygments (syntax highlighting) style to use.
pygments_style = 'sphinx'
# If true, `todo` and `todoList` produce output, else they produce nothing.
todo_include_todos = False
# -- Options for HTML output -------------------------------------------
# The theme to use for HTML and HTML Help pages. See the documentation for
# a list of builtin themes.
#
html_theme = 'alabaster'
# Theme options are theme-specific and customize the look and feel of a
# theme further. For a list of options available for each theme, see the
# documentation.
#
# html_theme_options = {}
# Add any paths that contain custom static files (such as style sheets) here,
# relative to this directory. They are copied after the builtin static files,
# so a file named "default.css" will overwrite the builtin "default.css".
html_static_path = ['_static']
# -- Options for HTMLHelp output ---------------------------------------
# Output file base name for HTML help builder.
htmlhelp_basename = 'pyLearndoc'
# -- Options for LaTeX output ------------------------------------------
latex_elements = {
# The paper size ('letterpaper' or 'a4paper').
#
# 'papersize': 'letterpaper',
# The font size ('10pt', '11pt' or '12pt').
#
# 'pointsize': '10pt',
# Additional stuff for the LaTeX preamble.
#
# 'preamble': '',
# Latex figure (float) alignment
#
# 'figure_align': 'htbp',
}
# Grouping the document tree into LaTeX files. List of tuples
# (source start file, target name, title, author, documentclass
# [howto, manual, or own class]).
latex_documents = [
(master_doc, 'pyLearn.tex',
'pyLearn Documentation',
'Sravan Kumar Rekandar', 'manual'),
]
# -- Options for manual page output ------------------------------------
# One entry per manual page. List of tuples
# (source start file, name, description, authors, manual section).
man_pages = [
(master_doc, 'pyLearn',
'pyLearn Documentation',
[author], 1)
]
# -- Options for Texinfo output ----------------------------------------
# Grouping the document tree into Texinfo files. List of tuples
# (source start file, target name, title, author,
# dir menu entry, description, category)
texinfo_documents = [
(master_doc, 'pyLearn',
'pyLearn Documentation',
author,
'pyLearn',
'One line description of project.',
'Miscellaneous'),
]
| docs/conf.py | 4,805 | !/usr/bin/env python pyLearn documentation build configuration file, created by sphinx-quickstart on Fri Jun 9 13:47:02 2017. This file is execfile()d with the current directory set to its containing dir. Note that not all possible configuration values are present in this autogenerated file. All configuration values have a default; values that are commented out serve to show the default. If extensions (or modules to document with autodoc) are in another directory, add these directories to sys.path here. If the directory is relative to the documentation root, use os.path.abspath to make it absolute, like shown here. -- General configuration --------------------------------------------- If your documentation needs a minimal Sphinx version, state it here. needs_sphinx = '1.0' Add any Sphinx extension module names here, as strings. They can be extensions coming with Sphinx (named 'sphinx.ext.*') or your custom ones. Add any paths that contain templates here, relative to this directory. The suffix(es) of source filenames. You can specify multiple suffix as a list of string: source_suffix = ['.rst', '.md'] The master toctree document. General information about the project. The version info for the project you're documenting, acts as replacement for |version| and |release|, also used in various other places throughout the built documents. The short X.Y version. The full version, including alpha/beta/rc tags. The language for content autogenerated by Sphinx. Refer to documentation for a list of supported languages. This is also used if you do content translation via gettext catalogs. Usually you set "language" from the command line for these cases. List of patterns, relative to source directory, that match files and directories to ignore when looking for source files. This patterns also effect to html_static_path and html_extra_path The name of the Pygments (syntax highlighting) style to use. If true, `todo` and `todoList` produce output, else they produce nothing. -- Options for HTML output ------------------------------------------- The theme to use for HTML and HTML Help pages. See the documentation for a list of builtin themes. Theme options are theme-specific and customize the look and feel of a theme further. For a list of options available for each theme, see the documentation. html_theme_options = {} Add any paths that contain custom static files (such as style sheets) here, relative to this directory. They are copied after the builtin static files, so a file named "default.css" will overwrite the builtin "default.css". -- Options for HTMLHelp output --------------------------------------- Output file base name for HTML help builder. -- Options for LaTeX output ------------------------------------------ The paper size ('letterpaper' or 'a4paper'). 'papersize': 'letterpaper', The font size ('10pt', '11pt' or '12pt'). 'pointsize': '10pt', Additional stuff for the LaTeX preamble. 'preamble': '', Latex figure (float) alignment 'figure_align': 'htbp', Grouping the document tree into LaTeX files. List of tuples (source start file, target name, title, author, documentclass [howto, manual, or own class]). -- Options for manual page output ------------------------------------ One entry per manual page. List of tuples (source start file, name, description, authors, manual section). -- Options for Texinfo output ---------------------------------------- Grouping the document tree into Texinfo files. List of tuples (source start file, target name, title, author, dir menu entry, description, category) | 3,556 | en | 0.699765 |
"""
Base settings for Mad Taxi project.
For more information on this file, see
https://docs.djangoproject.com/en/dev/topics/settings/
For the full list of settings and their values, see
https://docs.djangoproject.com/en/dev/ref/settings/
"""
import environ
ROOT_DIR = environ.Path(__file__) - 3 # (mad_taxi/config/settings/base.py - 3 = mad_taxi/)
APPS_DIR = ROOT_DIR.path('mad_taxi')
# Load operating system environment variables and then prepare to use them
env = environ.Env()
# .env file, should load only in development environment
READ_DOT_ENV_FILE = env.bool('DJANGO_READ_DOT_ENV_FILE', default=False)
if READ_DOT_ENV_FILE:
# Operating System Environment variables have precedence over variables defined in the .env file,
# that is to say variables from the .env files will only be used if not defined
# as environment variables.
env_file = str(ROOT_DIR.path('.env'))
print('Loading : {}'.format(env_file))
env.read_env(env_file)
print('The .env file has been loaded. See base.py for more information')
# APP CONFIGURATION
# ------------------------------------------------------------------------------
DJANGO_APPS = [
# Default Django apps:
'django.contrib.auth',
'django.contrib.contenttypes',
'django.contrib.sessions',
'django.contrib.sites',
'django.contrib.messages',
'django.contrib.staticfiles',
# Useful template tags:
# 'django.contrib.humanize',
# Admin
'django.contrib.admin',
]
THIRD_PARTY_APPS = [
'crispy_forms', # Form layouts
'allauth', # registration
'allauth.account', # registration
'allauth.socialaccount', # registration
]
# Apps specific for this project go here.
LOCAL_APPS = [
# custom users app
'mad_taxi.users.apps.UsersConfig',
# Your stuff: custom apps go here
]
# See: https://docs.djangoproject.com/en/dev/ref/settings/#installed-apps
INSTALLED_APPS = DJANGO_APPS + THIRD_PARTY_APPS + LOCAL_APPS
# MIDDLEWARE CONFIGURATION
# ------------------------------------------------------------------------------
MIDDLEWARE = [
'django.middleware.security.SecurityMiddleware',
'django.contrib.sessions.middleware.SessionMiddleware',
'django.middleware.common.CommonMiddleware',
'django.middleware.csrf.CsrfViewMiddleware',
'django.contrib.auth.middleware.AuthenticationMiddleware',
'django.contrib.messages.middleware.MessageMiddleware',
'django.middleware.clickjacking.XFrameOptionsMiddleware',
]
# MIGRATIONS CONFIGURATION
# ------------------------------------------------------------------------------
MIGRATION_MODULES = {
'sites': 'mad_taxi.contrib.sites.migrations'
}
# DEBUG
# ------------------------------------------------------------------------------
# See: https://docs.djangoproject.com/en/dev/ref/settings/#debug
DEBUG = env.bool('DJANGO_DEBUG', False)
# FIXTURE CONFIGURATION
# ------------------------------------------------------------------------------
# See: https://docs.djangoproject.com/en/dev/ref/settings/#std:setting-FIXTURE_DIRS
FIXTURE_DIRS = (
str(APPS_DIR.path('fixtures')),
)
# EMAIL CONFIGURATION
# ------------------------------------------------------------------------------
EMAIL_BACKEND = env('DJANGO_EMAIL_BACKEND', default='django.core.mail.backends.smtp.EmailBackend')
# MANAGER CONFIGURATION
# ------------------------------------------------------------------------------
# See: https://docs.djangoproject.com/en/dev/ref/settings/#admins
ADMINS = [
("""Starcraft""", 'madtaxiapp@gmail.com'),
]
# See: https://docs.djangoproject.com/en/dev/ref/settings/#managers
MANAGERS = ADMINS
# DATABASE CONFIGURATION
# ------------------------------------------------------------------------------
# See: https://docs.djangoproject.com/en/dev/ref/settings/#databases
# Uses django-environ to accept uri format
# See: https://django-environ.readthedocs.io/en/latest/#supported-types
DATABASES = {
'default': env.db('DATABASE_URL', default='postgres:///mad_taxi'),
}
DATABASES['default']['ATOMIC_REQUESTS'] = True
# GENERAL CONFIGURATION
# ------------------------------------------------------------------------------
# Local time zone for this installation. Choices can be found here:
# http://en.wikipedia.org/wiki/List_of_tz_zones_by_name
# although not all choices may be available on all operating systems.
# In a Windows environment this must be set to your system time zone.
TIME_ZONE = 'UTC'
# See: https://docs.djangoproject.com/en/dev/ref/settings/#language-code
LANGUAGE_CODE = 'en-us'
# See: https://docs.djangoproject.com/en/dev/ref/settings/#site-id
SITE_ID = 1
# See: https://docs.djangoproject.com/en/dev/ref/settings/#use-i18n
USE_I18N = True
# See: https://docs.djangoproject.com/en/dev/ref/settings/#use-l10n
USE_L10N = True
# See: https://docs.djangoproject.com/en/dev/ref/settings/#use-tz
USE_TZ = True
# TEMPLATE CONFIGURATION
# ------------------------------------------------------------------------------
# See: https://docs.djangoproject.com/en/dev/ref/settings/#templates
TEMPLATES = [
{
# See: https://docs.djangoproject.com/en/dev/ref/settings/#std:setting-TEMPLATES-BACKEND
'BACKEND': 'django.template.backends.django.DjangoTemplates',
# See: https://docs.djangoproject.com/en/dev/ref/settings/#template-dirs
'DIRS': [
str(APPS_DIR.path('templates')),
],
'OPTIONS': {
# See: https://docs.djangoproject.com/en/dev/ref/settings/#template-debug
'debug': DEBUG,
# See: https://docs.djangoproject.com/en/dev/ref/settings/#template-loaders
# https://docs.djangoproject.com/en/dev/ref/templates/api/#loader-types
'loaders': [
'django.template.loaders.filesystem.Loader',
'django.template.loaders.app_directories.Loader',
],
# See: https://docs.djangoproject.com/en/dev/ref/settings/#template-context-processors
'context_processors': [
'django.template.context_processors.debug',
'django.template.context_processors.request',
'django.contrib.auth.context_processors.auth',
'django.template.context_processors.i18n',
'django.template.context_processors.media',
'django.template.context_processors.static',
'django.template.context_processors.tz',
'django.contrib.messages.context_processors.messages',
# Your stuff: custom template context processors go here
],
},
},
]
# See: http://django-crispy-forms.readthedocs.io/en/latest/install.html#template-packs
CRISPY_TEMPLATE_PACK = 'bootstrap4'
# STATIC FILE CONFIGURATION
# ------------------------------------------------------------------------------
# See: https://docs.djangoproject.com/en/dev/ref/settings/#static-root
STATIC_ROOT = str(ROOT_DIR('staticfiles'))
# See: https://docs.djangoproject.com/en/dev/ref/settings/#static-url
STATIC_URL = '/static/'
# See: https://docs.djangoproject.com/en/dev/ref/contrib/staticfiles/#std:setting-STATICFILES_DIRS
STATICFILES_DIRS = [
str(APPS_DIR.path('static')),
]
# See: https://docs.djangoproject.com/en/dev/ref/contrib/staticfiles/#staticfiles-finders
STATICFILES_FINDERS = [
'django.contrib.staticfiles.finders.FileSystemFinder',
'django.contrib.staticfiles.finders.AppDirectoriesFinder',
]
# MEDIA CONFIGURATION
# ------------------------------------------------------------------------------
# See: https://docs.djangoproject.com/en/dev/ref/settings/#media-root
MEDIA_ROOT = str(APPS_DIR('media'))
# See: https://docs.djangoproject.com/en/dev/ref/settings/#media-url
MEDIA_URL = '/media/'
# URL Configuration
# ------------------------------------------------------------------------------
ROOT_URLCONF = 'config.urls'
# See: https://docs.djangoproject.com/en/dev/ref/settings/#wsgi-application
WSGI_APPLICATION = 'config.wsgi.application'
# PASSWORD STORAGE SETTINGS
# ------------------------------------------------------------------------------
# See https://docs.djangoproject.com/en/dev/topics/auth/passwords/#using-argon2-with-django
PASSWORD_HASHERS = [
'django.contrib.auth.hashers.Argon2PasswordHasher',
'django.contrib.auth.hashers.PBKDF2PasswordHasher',
'django.contrib.auth.hashers.PBKDF2SHA1PasswordHasher',
'django.contrib.auth.hashers.BCryptSHA256PasswordHasher',
'django.contrib.auth.hashers.BCryptPasswordHasher',
]
# PASSWORD VALIDATION
# https://docs.djangoproject.com/en/dev/ref/settings/#auth-password-validators
# ------------------------------------------------------------------------------
AUTH_PASSWORD_VALIDATORS = [
{
'NAME': 'django.contrib.auth.password_validation.UserAttributeSimilarityValidator',
},
{
'NAME': 'django.contrib.auth.password_validation.MinimumLengthValidator',
},
{
'NAME': 'django.contrib.auth.password_validation.CommonPasswordValidator',
},
{
'NAME': 'django.contrib.auth.password_validation.NumericPasswordValidator',
},
]
# AUTHENTICATION CONFIGURATION
# ------------------------------------------------------------------------------
AUTHENTICATION_BACKENDS = [
'django.contrib.auth.backends.ModelBackend',
'allauth.account.auth_backends.AuthenticationBackend',
]
# Some really nice defaults
ACCOUNT_AUTHENTICATION_METHOD = 'username'
ACCOUNT_EMAIL_REQUIRED = True
ACCOUNT_EMAIL_VERIFICATION = 'mandatory'
ACCOUNT_ALLOW_REGISTRATION = env.bool('DJANGO_ACCOUNT_ALLOW_REGISTRATION', True)
ACCOUNT_ADAPTER = 'mad_taxi.users.adapters.AccountAdapter'
SOCIALACCOUNT_ADAPTER = 'mad_taxi.users.adapters.SocialAccountAdapter'
# Custom user app defaults
# Select the correct user model
AUTH_USER_MODEL = 'users.User'
LOGIN_REDIRECT_URL = 'users:redirect'
LOGIN_URL = 'account_login'
# SLUGLIFIER
AUTOSLUG_SLUGIFY_FUNCTION = 'slugify.slugify'
########## CELERY
INSTALLED_APPS += ['mad_taxi.taskapp.celery.CeleryConfig']
CELERY_BROKER_URL = env('CELERY_BROKER_URL', default='django://')
if CELERY_BROKER_URL == 'django://':
CELERY_RESULT_BACKEND = 'redis://'
else:
CELERY_RESULT_BACKEND = CELERY_BROKER_URL
# default to json serialization only
CELERY_ACCEPT_CONTENT = ['json']
CELERY_TASK_SERIALIZER = 'json'
CELERY_RESULT_SERIALIZER = 'json'
########## END CELERY
# Location of root django.contrib.admin URL, use {% url 'admin:index' %}
ADMIN_URL = r'^admin/'
# Your common stuff: Below this line define 3rd party library settings
# ------------------------------------------------------------------------------
| config/settings/base.py | 10,609 | Base settings for Mad Taxi project.
For more information on this file, see
https://docs.djangoproject.com/en/dev/topics/settings/
For the full list of settings and their values, see
https://docs.djangoproject.com/en/dev/ref/settings/
(mad_taxi/config/settings/base.py - 3 = mad_taxi/) Load operating system environment variables and then prepare to use them .env file, should load only in development environment Operating System Environment variables have precedence over variables defined in the .env file, that is to say variables from the .env files will only be used if not defined as environment variables. APP CONFIGURATION ------------------------------------------------------------------------------ Default Django apps: Useful template tags: 'django.contrib.humanize', Admin Form layouts registration registration registration Apps specific for this project go here. custom users app Your stuff: custom apps go here See: https://docs.djangoproject.com/en/dev/ref/settings/installed-apps MIDDLEWARE CONFIGURATION ------------------------------------------------------------------------------ MIGRATIONS CONFIGURATION ------------------------------------------------------------------------------ DEBUG ------------------------------------------------------------------------------ See: https://docs.djangoproject.com/en/dev/ref/settings/debug FIXTURE CONFIGURATION ------------------------------------------------------------------------------ See: https://docs.djangoproject.com/en/dev/ref/settings/std:setting-FIXTURE_DIRS EMAIL CONFIGURATION ------------------------------------------------------------------------------ MANAGER CONFIGURATION ------------------------------------------------------------------------------ See: https://docs.djangoproject.com/en/dev/ref/settings/admins See: https://docs.djangoproject.com/en/dev/ref/settings/managers DATABASE CONFIGURATION ------------------------------------------------------------------------------ See: https://docs.djangoproject.com/en/dev/ref/settings/databases Uses django-environ to accept uri format See: https://django-environ.readthedocs.io/en/latest/supported-types GENERAL CONFIGURATION ------------------------------------------------------------------------------ Local time zone for this installation. Choices can be found here: http://en.wikipedia.org/wiki/List_of_tz_zones_by_name although not all choices may be available on all operating systems. In a Windows environment this must be set to your system time zone. See: https://docs.djangoproject.com/en/dev/ref/settings/language-code See: https://docs.djangoproject.com/en/dev/ref/settings/site-id See: https://docs.djangoproject.com/en/dev/ref/settings/use-i18n See: https://docs.djangoproject.com/en/dev/ref/settings/use-l10n See: https://docs.djangoproject.com/en/dev/ref/settings/use-tz TEMPLATE CONFIGURATION ------------------------------------------------------------------------------ See: https://docs.djangoproject.com/en/dev/ref/settings/templates See: https://docs.djangoproject.com/en/dev/ref/settings/std:setting-TEMPLATES-BACKEND See: https://docs.djangoproject.com/en/dev/ref/settings/template-dirs See: https://docs.djangoproject.com/en/dev/ref/settings/template-debug See: https://docs.djangoproject.com/en/dev/ref/settings/template-loaders https://docs.djangoproject.com/en/dev/ref/templates/api/loader-types See: https://docs.djangoproject.com/en/dev/ref/settings/template-context-processors Your stuff: custom template context processors go here See: http://django-crispy-forms.readthedocs.io/en/latest/install.htmltemplate-packs STATIC FILE CONFIGURATION ------------------------------------------------------------------------------ See: https://docs.djangoproject.com/en/dev/ref/settings/static-root See: https://docs.djangoproject.com/en/dev/ref/settings/static-url See: https://docs.djangoproject.com/en/dev/ref/contrib/staticfiles/std:setting-STATICFILES_DIRS See: https://docs.djangoproject.com/en/dev/ref/contrib/staticfiles/staticfiles-finders MEDIA CONFIGURATION ------------------------------------------------------------------------------ See: https://docs.djangoproject.com/en/dev/ref/settings/media-root See: https://docs.djangoproject.com/en/dev/ref/settings/media-url URL Configuration ------------------------------------------------------------------------------ See: https://docs.djangoproject.com/en/dev/ref/settings/wsgi-application PASSWORD STORAGE SETTINGS ------------------------------------------------------------------------------ See https://docs.djangoproject.com/en/dev/topics/auth/passwords/using-argon2-with-django PASSWORD VALIDATION https://docs.djangoproject.com/en/dev/ref/settings/auth-password-validators ------------------------------------------------------------------------------ AUTHENTICATION CONFIGURATION ------------------------------------------------------------------------------ Some really nice defaults Custom user app defaults Select the correct user model SLUGLIFIER CELERY default to json serialization only END CELERY Location of root django.contrib.admin URL, use {% url 'admin:index' %} Your common stuff: Below this line define 3rd party library settings ------------------------------------------------------------------------------ | 5,254 | en | 0.529893 |
'''cleanup intermediary files '''
import os
def run(c): # run something at terminal and wait to finish
print(c)
a = os.system(c)
run('rm *.png') # remove figures
run('rm test* truth*') # wipe test and truth data
run('rm -rf test truth') # wipe test and truth data segment files
| presentations/20210526_simple_character_recognition/cleanup.py | 291 | cleanup intermediary files
run something at terminal and wait to finish remove figures wipe test and truth data wipe test and truth data segment files | 153 | en | 0.776297 |
#
# Copyright 2021 IBM All Rights Reserved.
#
# Licensed under the Apache License, Version 2.0 (the "License");
# you may not use this file except in compliance with the License.
# You may obtain a copy of the License at
#
# http://www.apache.org/licenses/LICENSE-2.0
#
# Unless required by applicable law or agreed to in writing, software
# distributed under the License is distributed on an "AS IS" BASIS,
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
# See the License for the specific language governing permissions and
# limitations under the License.
"""
Version of ibm-appconfiguration-python-sdk
"""
__version__ = '0.1.2'
| ibm_appconfiguration/version.py | 664 | Version of ibm-appconfiguration-python-sdk
Copyright 2021 IBM All Rights Reserved. Licensed under the Apache License, Version 2.0 (the "License"); you may not use this file except in compliance with the License. You may obtain a copy of the License at http://www.apache.org/licenses/LICENSE-2.0 Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the specific language governing permissions and limitations under the License. | 607 | en | 0.857021 |
# -*- coding: utf-8 -*-
from __future__ import unicode_literals
import pytest
from rest_framework.test import APIRequestFactory
from elasticsearch_dsl import Q
from rest_framework_elasticsearch.es_filters import (
ESFieldFilter, ElasticOrderingFilter, ElasticFieldsFilter,
ElasticFieldsRangeFilter, ElasticSearchFilter)
from rest_framework_elasticsearch.es_views import ElasticAPIView
from .test_data import DataDocType, DATA
from .utils import get_search_ids
rf = APIRequestFactory()
@pytest.mark.parametrize('dataset, expected', [
(
('label', 'name', 'description'),
('label', 'name', 'description')
),
(
('label', None, 'description'),
('label', 'label', 'description')
),
(
('label', None, None),
('label', 'label', None)
)
])
def test_es_field_filters(dataset, expected):
ffilter = ESFieldFilter(dataset[0],
name=dataset[1],
description=dataset[2])
assert expected == (ffilter.label, ffilter.name, ffilter.description)
class TestElasticOrderingFilter:
def setup_method(self):
self.backend = ElasticOrderingFilter()
def create_view(self, es_ordering_fields):
"""Create and return test view class instance
Args:
es_ordering_fields (tuple): ordering fields
Returns:
ElasticAPIView: test view instance
"""
view = ElasticAPIView()
view.es_ordering_fields = es_ordering_fields
return view
@pytest.mark.parametrize('es_ordering_fields, expected', [
(
("first_name", ("is_active", "active")),
("first_name", ("is_active", "active")),
),
(
"first_name",
("first_name",)
)
])
def test_get_es_ordering_fields(self, es_ordering_fields, expected):
view = self.create_view(es_ordering_fields)
result = self.backend.get_es_ordering_fields(view)
assert expected == result
@pytest.mark.parametrize('es_ordering_fields, expected', [
(
("is_active", "active"),
("is_active", "active")
),
(
"first_name",
("first_name", "first_name")
)
])
def test_validation(self, es_ordering_fields, expected):
result = ElasticOrderingFilter.validation(es_ordering_fields)
assert expected == result
def test_get_valid_fields_with_es_ordering_fields(self):
es_ordering_fields = (
"first_name",
"last_name",
("is_active", "active")
)
view = self.create_view(es_ordering_fields)
expected = [
("first_name", "first_name"),
("last_name", "last_name"),
("is_active", "active")
]
result = self.backend.get_valid_fields([], view)
assert result == expected
def test_get_valid_fields_without_es_ordering_fields(self):
view = self.create_view(None)
valid_fields = []
self.backend.get_default_valid_fields = lambda q, v: valid_fields
result = self.backend.get_valid_fields([], view)
assert result == valid_fields
@pytest.mark.parametrize('fields, expected', [
(
['first_name', 'last_name', '-active'],
['first_name', '-is_active']
),
(
['+first_name', 'last_name', '#active'],
['+first_name']
),
(
['+first_name', '-active'],
['+first_name', '-is_active']
)
])
def test_remove_invalid_fields(self, fields, expected):
es_ordering_fields = (
"first_name",
("is_active", "active")
)
view = self.create_view(es_ordering_fields)
request = rf.get('/test/')
result = self.backend.remove_invalid_fields([], fields, view, request)
assert result == expected
def test_filter_search(self, search):
def get_expected():
"""Return expected data items sorted by id"""
items = [
(
item['_id'],
item['_source']['first_name'],
item['_source']['is_active']
)
for item in DATA
]
items = sorted(items, key=lambda tup: (tup[1], not tup[2]))
return items
es_ordering_fields = (
("first_name", "first_name"),
("is_active", "-active")
)
view = self.create_view(es_ordering_fields)
request = rf.get('/test/')
request.query_params = {'ordering': 'first_name,active'}
search = self.backend.filter_search(request, search, view)
result = [
(item.meta.id, item.first_name, item.is_active)
for item in search[:len(DATA)].execute()
]
assert result == get_expected()
class TestElasticFieldsFilter:
def setup_method(self):
self.backend = ElasticFieldsFilter()
def create_view(self, es_filter_fields):
"""Create and return test view class instance
Args:
es_filter_fields ([ESFieldFilter]): filtering fields
Returns:
ElasticAPIView: test view instance
"""
view = ElasticAPIView()
view.es_model = DataDocType
view.es_filter_fields = es_filter_fields
return view
def test_get_es_filter_fields(self):
es_filter_fields = (
ESFieldFilter('skills'),
ESFieldFilter('active', 'is_active')
)
view = self.create_view(es_filter_fields)
result = self.backend.get_es_filter_fields(view)
assert result == es_filter_fields
@pytest.mark.parametrize('es_filter_fields, query_params, expected', [
(
[ESFieldFilter('active', 'is_active')],
{'active': 'False'},
[3, 6, 8, 10]
),
(
[
ESFieldFilter('birthday')
],
{'birthday': '1985-03-17T12:20:09'},
[1]
),
(
[ESFieldFilter('skills')],
{'skills': 'python'},
[1, 4, 5, 10]
),
(
[ESFieldFilter('skills')],
{'skills': 'python,ruby'},
[1, 4, 5, 6, 10]
),
(
[ESFieldFilter('active', 'is_active')],
{'active': 'False', 'skills': 'python'},
[3, 6, 8, 10]
),
(
[ESFieldFilter('active', 'is_active')],
{'active': 'False', 'skills': 'python'},
[3, 6, 8, 10]
),
(
[ESFieldFilter('score')],
{'score': '200'},
[2, 13]
),
])
def test_filter_search(self, search, es_filter_fields,
query_params, expected):
view = self.create_view(es_filter_fields)
request = rf.get('/test/')
request.query_params = query_params
search = self.backend.filter_search(request, search, view)
result = get_search_ids(search)
assert sorted(result) == sorted(expected)
class TestElasticFieldsRangeFilter:
def setup_method(self):
self.backend = ElasticFieldsRangeFilter()
def create_view(self, es_range_filter_fields):
"""Create and return test view class instance
Args:
es_range_filter_fields ([ESFieldFilter]): filtering range fields
Returns:
ElasticAPIView: test view instance
"""
view = ElasticAPIView()
view.es_model = DataDocType
view.es_range_filter_fields = es_range_filter_fields
return view
def test_get_es_filter_fields(self):
es_range_filter_fields = (
ESFieldFilter('skills'),
ESFieldFilter('active', 'is_active')
)
view = self.create_view(es_range_filter_fields)
result = self.backend.get_es_range_filter_fields(view)
assert result == es_range_filter_fields
@pytest.mark.parametrize('es_filter_fields, query_params, expected', [
(
[ESFieldFilter('score')],
{'from_score': '500'},
[6, 7, 8, 10, 11]
),
(
[ESFieldFilter('score')],
{'to_score': '100'},
[1, 3, 5, 9, 12, 14]
),
(
[ESFieldFilter('score')],
{'from_score': '500', 'to_score': '600'},
[7, 8, 10]
),
(
[ESFieldFilter('score')], {}, [int(item['_id']) for item in DATA]
),
])
def test_filter_search(self, search, es_filter_fields,
query_params, expected):
view = self.create_view(es_filter_fields)
request = rf.get('/test/')
request.query_params = query_params
search = self.backend.filter_search(request, search, view)
result = get_search_ids(search)
assert sorted(result) == sorted(expected)
class TestElasticSearchFilter:
def setup_method(self):
self.backend = ElasticSearchFilter()
def create_view(self, es_search_fields):
"""Create and return test view class instance
Args:
es_search_fields ([ESFieldFilter]): search fields
Returns:
ElasticAPIView: test view instance
"""
view = ElasticAPIView()
view.es_model = DataDocType
view.es_search_fields = es_search_fields
return view
@pytest.mark.parametrize('search_param, query_params, expected', [
(
None, {'search': 'test'}, 'test'
),
(
'search', {'search': 'test'}, 'test'
),
(
'q', {'q': 'test'}, 'test'
),
(
'search', {'q': 'test'}, ''
),
])
def test_get_search_query(self, search_param, query_params, expected):
request = rf.get('/test/')
request.query_params = query_params
if search_param:
self.backend.search_param = search_param
result = self.backend.get_search_query(request)
assert result == expected
def test_get_es_query(self):
class TestElasticSearchFilter(ElasticSearchFilter):
def get_es_query(self, s_query, s_fields, **kwargs):
return Q("match", query=s_query, field=s_fields)
s_query = "test"
s_fields = "first_name"
backend = TestElasticSearchFilter()
result = backend.get_es_query(s_query, s_fields)
expected = Q("match", query=s_query, field=s_fields)
assert result == expected
@pytest.mark.parametrize('es_search_fields, query_params, expected', [
(
('first_name',),
{'search': 'Zofia'},
[1]
),
(
('first_name', 'last_name', 'city'),
{'search': 'Zofia'},
[1]
),
(
('first_name', 'last_name', 'city'),
{'search': 'Zofia Rome'},
[4, 7]
),
(
('description'),
{'search': 'information'},
[2]
),
(
('description'),
{'search': 'Ford Prefect'},
[2, 8, 10, 5, 6, 12]
),
(
('description'),
{'search': 'Earth'},
[5, 3, 14]
),
(
('description'),
{'search': 'The Hitchhiker’s Guide'},
[8]
),
])
def test_filter_search(self, search, es_search_fields,
query_params, expected):
view = self.create_view(es_search_fields)
request = rf.get('/test/')
request.query_params = query_params
search = self.backend.filter_search(request, search, view)
result = get_search_ids(search)
assert result == expected
| tests/test_filters.py | 11,940 | Create and return test view class instance
Args:
es_ordering_fields (tuple): ordering fields
Returns:
ElasticAPIView: test view instance
Create and return test view class instance
Args:
es_filter_fields ([ESFieldFilter]): filtering fields
Returns:
ElasticAPIView: test view instance
Create and return test view class instance
Args:
es_range_filter_fields ([ESFieldFilter]): filtering range fields
Returns:
ElasticAPIView: test view instance
Create and return test view class instance
Args:
es_search_fields ([ESFieldFilter]): search fields
Returns:
ElasticAPIView: test view instance
Return expected data items sorted by id
-*- coding: utf-8 -*- | 683 | en | 0.569665 |
from __future__ import absolute_import
from datetime import datetime
from enum import Enum
from checkout_sdk.common.common import Address, Phone, CustomerRequest
from checkout_sdk.common.enums import Currency, PaymentSourceType, ChallengeIndicator, Country
class Exemption(str, Enum):
LOW_VALUE = 'low_value'
SECURE_CORPORATE_PAYMENT = 'secure_corporate_payment'
TRUSTED_LISTING = 'trusted_listing'
TRANSACTION_RISK_ASSESSMENT = 'transaction_risk_assessment'
class PaymentDestinationType(str, Enum):
BANK_ACCOUNT = 'bank_account'
CARD = 'card'
ID = 'id'
TOKEN = 'token'
class PaymentType(str, Enum):
REGULAR = 'Regular'
RECURRING = 'Recurring'
MOTO = 'MOTO'
INSTALLMENT = 'Installment'
class Purpose(str, Enum):
DONATIONS = 'donations'
EDUCATION = 'education'
EMERGENCY_NEED = 'emergency_need'
EXPATRIATION = 'expatriation'
FAMILY_SUPPORT = 'family_support'
GIFTS = 'gifts'
INCOME = 'income'
INSURANCE = 'insurance'
INVESTMENT = 'investment'
IT_SERVICES = 'it_services'
LEISURE = 'leisure'
LOAN_PAYMENT = 'loan_payment'
OTHER = 'other'
PENSION = 'pension'
ROYALTIES = 'royalties'
SAVINGS = 'savings'
TRAVEL_AND_TOURISM = 'travel_and_tourism'
FINANCIAL_SERVICES = 'financial_services'
MEDICAL_TREATMENT = 'medical_treatment'
class FundTransferType(str, Enum):
AA = 'AA'
PP = 'PP'
FT = 'FT'
FD = 'FD'
PD = 'PD'
LO = 'LO'
OG = 'OG'
class BillingDescriptor:
name: str
city: str
class BillingInformation:
address: Address
phone: Phone
class PaymentRecipient:
dob: str
account_number: str
zip: str
first_name: str
last_name: str
country: Country
class ShippingDetails:
address: Address
phone: Phone
class RiskRequest:
enabled: bool
class ThreeDsRequest:
enabled: bool
attempt_n3d: bool
eci: str
cryptogram: str
xid: str
version: str
exemption: Exemption
challenge_indicator: ChallengeIndicator
class ProcessingSettings:
aft: bool
tax_amount: int
shipping_amount: int
# Request Source
class RequestSource:
type: PaymentSourceType
def __init__(self, type_p: PaymentSourceType):
self.type = type_p
class RequestCardSource(RequestSource):
number: str
expiry_month: int
expiry_year: int
name: str
cvv: str
stored: bool
billing_address: Address
phone: Phone
def __init__(self):
super().__init__(PaymentSourceType.CARD)
class RequestCustomerSource(RequestSource):
id: str
def __init__(self):
super().__init__(PaymentSourceType.ID)
class RequestDLocalSource(RequestSource):
number: str
expiry_month: int
expiry_year: int
name: str
cvv: str
stored: bool
billing_address: Address
phone: Phone
def __init__(self):
super().__init__(PaymentSourceType.D_LOCAL)
class RequestIdSource(RequestSource):
id: str
cvv: str
def __init__(self):
super().__init__(PaymentSourceType.ID)
class RequestNetworkTokenSource(RequestSource):
token: str
expiry_month: int
expiry_year: int
token_type: str
cryptogram: str
eci: str
stored: bool
name: str
cvv: str
billing_address: Address
phone: Phone
def __init__(self):
super().__init__(PaymentSourceType.NETWORK_TOKEN)
class RequestTokenSource(RequestSource):
token: str
billing_address: Address
phone: Phone
def __init__(self):
super().__init__(PaymentSourceType.TOKEN)
# Request Destination
class RequestDestination:
type: PaymentDestinationType
first_name: str
last_name: str
def __init__(self, type_p: PaymentDestinationType):
self.type = type_p
class PaymentRequestCardDestination(RequestDestination):
number: str
expiry_month: int
expiry_year: int
name: str
billing_address: Address
phone: Phone
def __init__(self):
super().__init__(PaymentDestinationType.CARD)
class PaymentRequestIdDestination(RequestDestination):
id: str
def __init__(self):
super().__init__(PaymentDestinationType.ID)
class PaymentRequestTokenDestination(RequestDestination):
token: str
billing_address: Address
phone: Phone
def __init__(self):
super().__init__(PaymentDestinationType.TOKEN)
# Request
class PaymentRequest:
source: RequestSource
amount: int
currency: Currency
payment_type: PaymentType
merchant_initiated: bool
reference: str
description: str
capture: bool
capture_on: datetime
customer: CustomerRequest
billing_descriptor: BillingDescriptor
shipping: ShippingDetails
previous_payment_id: str
risk: RiskRequest
success_url: str
failure_url: str
payment_ip: str
three_ds: ThreeDsRequest
recipient: PaymentRecipient
metadata: dict
processing: ProcessingSettings
class PayoutRequest:
destination: RequestDestination
amount: int
fund_transfer_type: FundTransferType
currency: Currency
payment_type: PaymentType
reference: str
description: str
capture: bool
capture_on: datetime
customer: CustomerRequest
billing_descriptor: BillingDescriptor
shipping: ShippingDetails
three_ds: ThreeDsRequest
previous_payment_id: str
risk: RiskRequest
success_url: str
failure_url: str
payment_ip: str
recipient: PaymentRecipient
metadata: dict
processing: dict
# Captures
class CaptureRequest:
amount: int
reference: str
metadata: dict
# Refunds
class RefundRequest:
amount: int
reference: str
metadata: dict
# Voids
class VoidRequest:
reference: str
metadata: dict
| checkout_sdk/payments/payments.py | 5,789 | Request Source Request Destination Request Captures Refunds Voids | 65 | en | 0.583717 |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.