repo_name stringlengths 4 116 | path stringlengths 4 379 | size stringlengths 1 7 | content stringlengths 3 1.05M | license stringclasses 15
values |
|---|---|---|---|---|
the-zebulan/CodeWars | tests/kyu_8_tests/test_remove_the_time.py | 823 | import unittest
from katas.kyu_8.remove_the_time import shorten_to_date
class ShortenToDateTestCase(unittest.TestCase):
def test_equals(self):
self.assertEqual(shorten_to_date('Monday February 2, 8pm'),
'Monday February 2')
def test_equals_2(self):
self.assertEqual(shorten_to_date('Tuesday May 29, 8pm'),
'Tuesday May 29')
def test_equals_3(self):
self.assertEqual(shorten_to_date('Wed September 1, 3am'),
'Wed September 1')
def test_equals_4(self):
self.assertEqual(shorten_to_date('Friday May 2, 9am'),
'Friday May 2')
def test_equals_5(self):
self.assertEqual(shorten_to_date('Tuesday January 29, 10pm'),
'Tuesday January 29')
| mit |
reallyalexpro/symphony-2.4-with-extentions | symphony/lib/toolkit/fields/field.textarea.php | 11115 | <?php
/**
* @package toolkit
*/
require_once FACE . '/interface.exportablefield.php';
require_once FACE . '/interface.importablefield.php';
/**
* A simple Textarea field that essentially maps to HTML's `<textarea/>`.
*/
Class fieldTextarea extends Field implements ExportableField, ImportableField {
public function __construct(){
parent::__construct();
$this->_name = __('Textarea');
$this->_required = true;
// Set default
$this->set('show_column', 'no');
$this->set('required', 'no');
}
/*-------------------------------------------------------------------------
Definition:
-------------------------------------------------------------------------*/
public function canFilter(){
return true;
}
/*-------------------------------------------------------------------------
Setup:
-------------------------------------------------------------------------*/
public function createTable(){
return Symphony::Database()->query("
CREATE TABLE IF NOT EXISTS `tbl_entries_data_" . $this->get('id') . "` (
`id` int(11) unsigned NOT NULL auto_increment,
`entry_id` int(11) unsigned NOT NULL,
`value` MEDIUMTEXT,
`value_formatted` MEDIUMTEXT,
PRIMARY KEY (`id`),
UNIQUE KEY `entry_id` (`entry_id`),
FULLTEXT KEY `value` (`value`)
) ENGINE=MyISAM DEFAULT CHARSET=utf8 COLLATE=utf8_unicode_ci;
");
}
/*-------------------------------------------------------------------------
Utilities:
-------------------------------------------------------------------------*/
protected function __applyFormatting($data, $validate=false, &$errors=NULL){
$result = '';
if($this->get('formatter')) {
$formatter = TextformatterManager::create($this->get('formatter'));
$result = $formatter->run($data);
}
if($validate === true) {
include_once(TOOLKIT . '/class.xsltprocess.php');
if(!General::validateXML($result, $errors, false, new XsltProcess)){
$result = html_entity_decode($result, ENT_QUOTES, 'UTF-8');
$result = $this->__replaceAmpersands($result);
if(!General::validateXML($result, $errors, false, new XsltProcess)){
return false;
}
}
}
return $result;
}
private function __replaceAmpersands($value) {
return preg_replace('/&(?!(#[0-9]+|#x[0-9a-f]+|amp|lt|gt);)/i', '&', trim($value));
}
/*-------------------------------------------------------------------------
Settings:
-------------------------------------------------------------------------*/
public function findDefaults(array &$settings){
if(!isset($settings['size'])) $settings['size'] = 15;
}
public function displaySettingsPanel(XMLElement &$wrapper, $errors = null) {
parent::displaySettingsPanel($wrapper, $errors);
// Textarea Size
$label = Widget::Label(__('Number of default rows'));
$label->setAttribute('class', 'column');
$input = Widget::Input('fields['.$this->get('sortorder').'][size]', (string)$this->get('size'));
$label->appendChild($input);
$div = new XMLElement('div', null, array('class' => 'two columns'));
$div->appendChild($label);
$div->appendChild($this->buildFormatterSelect($this->get('formatter'), 'fields['.$this->get('sortorder').'][formatter]', __('Text Formatter')));
$wrapper->appendChild($div);
// Requirements and table display
$this->appendStatusFooter($wrapper);
}
public function commit(){
if(!parent::commit()) return false;
$id = $this->get('id');
if($id === false) return false;
$fields = array();
if($this->get('formatter') != 'none') $fields['formatter'] = $this->get('formatter');
$fields['size'] = $this->get('size');
return FieldManager::saveSettings($id, $fields);
}
/*-------------------------------------------------------------------------
Publish:
-------------------------------------------------------------------------*/
public function displayPublishPanel(XMLElement &$wrapper, $data = null, $flagWithError = null, $fieldnamePrefix = null, $fieldnamePostfix = null, $entry_id = null){
$label = Widget::Label($this->get('label'));
if($this->get('required') != 'yes') $label->appendChild(new XMLElement('i', __('Optional')));
$value = isset($data['value']) ? $data['value'] : null;
$textarea = Widget::Textarea('fields'.$fieldnamePrefix.'['.$this->get('element_name').']'.$fieldnamePostfix, (int)$this->get('size'), 50, (strlen($value) != 0 ? General::sanitize($value) : null));
if($this->get('formatter') != 'none') $textarea->setAttribute('class', $this->get('formatter'));
/**
* Allows developers modify the textarea before it is rendered in the publish forms
*
* @delegate ModifyTextareaFieldPublishWidget
* @param string $context
* '/backend/'
* @param Field $field
* @param Widget $label
* @param Widget $textarea
*/
Symphony::ExtensionManager()->notifyMembers('ModifyTextareaFieldPublishWidget', '/backend/', array(
'field' => &$this,
'label' => &$label,
'textarea' => &$textarea
));
$label->appendChild($textarea);
if($flagWithError != NULL) $wrapper->appendChild(Widget::Error($label, $flagWithError));
else $wrapper->appendChild($label);
}
public function checkPostFieldData($data, &$message, $entry_id=NULL){
$message = NULL;
if($this->get('required') == 'yes' && strlen(trim($data)) == 0){
$message = __('‘%s’ is a required field.', array($this->get('label')));
return self::__MISSING_FIELDS__;
}
if($this->__applyFormatting($data, true, $errors) === false){
$message = __('‘%s’ contains invalid XML.', array($this->get('label'))) . ' ' . __('The following error was returned:') . ' <code>' . $errors[0]['message'] . '</code>';
return self::__INVALID_FIELDS__;
}
return self::__OK__;
}
public function processRawFieldData($data, &$status, &$message=null, $simulate = false, $entry_id = null) {
$status = self::__OK__;
$result = array(
'value' => $data
);
$result['value_formatted'] = $this->__applyFormatting($data, true, $errors);
if($result['value_formatted'] === false){
// Run the formatter again, but this time do not validate. We will sanitize the output
$result['value_formatted'] = General::sanitize($this->__applyFormatting($data));
}
return $result;
}
/*-------------------------------------------------------------------------
Output:
-------------------------------------------------------------------------*/
public function fetchIncludableElements() {
if ($this->get('formatter')) {
return array(
$this->get('element_name') . ': formatted',
$this->get('element_name') . ': unformatted'
);
}
return array(
$this->get('element_name')
);
}
public function appendFormattedElement(XMLElement &$wrapper, $data, $encode = false, $mode = null, $entry_id = null) {
$attributes = array();
if (!is_null($mode)) $attributes['mode'] = $mode;
if ($mode == 'formatted') {
if ($this->get('formatter') && isset($data['value_formatted'])) {
$value = $data['value_formatted'];
}
else {
$value = $this->__replaceAmpersands($data['value']);
}
$wrapper->appendChild(
new XMLElement(
$this->get('element_name'),
($encode ? General::sanitize($value) : $value),
$attributes
)
);
}
else if ($mode == null || $mode == 'unformatted') {
$wrapper->appendChild(
new XMLElement(
$this->get('element_name'),
sprintf('<![CDATA[%s]]>', str_replace(']]>',']]]]><![CDATA[>',$data['value'])),
$attributes
)
);
}
}
/*-------------------------------------------------------------------------
Import:
-------------------------------------------------------------------------*/
public function getImportModes() {
return array(
'getValue' => ImportableField::STRING_VALUE,
'getPostdata' => ImportableField::ARRAY_VALUE
);
}
public function prepareImportValue($data, $mode, $entry_id = null) {
$message = $status = null;
$modes = (object)$this->getImportModes();
if($mode === $modes->getValue) {
return $data;
}
else if($mode === $modes->getPostdata) {
return $this->processRawFieldData($data, $status, $message, true, $entry_id);
}
return null;
}
/*-------------------------------------------------------------------------
Export:
-------------------------------------------------------------------------*/
/**
* Return a list of supported export modes for use with `prepareExportValue`.
*
* @return array
*/
public function getExportModes() {
return array(
'getHandle' => ExportableField::HANDLE,
'getFormatted' => ExportableField::FORMATTED,
'getUnformatted' => ExportableField::UNFORMATTED,
'getPostdata' => ExportableField::POSTDATA
);
}
/**
* Give the field some data and ask it to return a value using one of many
* possible modes.
*
* @param mixed $data
* @param integer $mode
* @param integer $entry_id
* @return string|null
*/
public function prepareExportValue($data, $mode, $entry_id = null) {
$modes = (object)$this->getExportModes();
// Export handles:
if ($mode === $modes->getHandle) {
if (isset($data['handle'])) {
return $data['handle'];
}
else if (isset($data['value'])) {
return Lang::createHandle($data['value']);
}
}
// Export unformatted:
else if ($mode === $modes->getUnformatted || $mode === $modes->getPostdata) {
return isset($data['value'])
? $data['value']
: null;
}
// Export formatted:
else if ($mode === $modes->getFormatted) {
if (isset($data['value_formatted'])) {
return $data['value_formatted'];
}
else if (isset($data['value'])) {
return General::sanitize($data['value']);
}
}
return null;
}
/*-------------------------------------------------------------------------
Filtering:
-------------------------------------------------------------------------*/
public function buildDSRetrievalSQL($data, &$joins, &$where, $andOperation = false) {
$field_id = $this->get('id');
if (self::isFilterRegex($data[0])) {
$this->buildRegexSQL($data[0], array('value'), $joins, $where);
}
else {
if (is_array($data)) $data = $data[0];
$this->_key++;
$data = $this->cleanValue($data);
$joins .= "
LEFT JOIN
`tbl_entries_data_{$field_id}` AS t{$field_id}_{$this->_key}
ON (e.id = t{$field_id}_{$this->_key}.entry_id)
";
$where .= "
AND MATCH (t{$field_id}_{$this->_key}.value) AGAINST ('{$data}' IN BOOLEAN MODE)
";
}
return true;
}
/*-------------------------------------------------------------------------
Events:
-------------------------------------------------------------------------*/
public function getExampleFormMarkup(){
$label = Widget::Label($this->get('label'));
$label->appendChild(Widget::Textarea('fields['.$this->get('element_name').']', (int)$this->get('size'), 50));
return $label;
}
}
| mit |
rfprod/hubapp | app/controllers/userController.client.js | 1048 | 'use strict';
(function () {
var profileId = document.querySelector('#profile-id') || null;
var profileUsername = document.querySelector('#profile-username') || null;
var profileRepos = document.querySelector('#profile-repos') || null;
var displayName = document.querySelector('#display-name');
var apiUrl = appUrl + '/api/:id';
function updateHtmlElement (data, element, userProperty) {
if (element) element.innerHTML = data[userProperty];
}
ajaxFunctions.ready(ajaxFunctions.ajaxRequest('GET', apiUrl, function (data) {
var userObject = JSON.parse(data);
if (userObject.displayName !== null) updateHtmlElement(userObject, displayName, 'displayName');
else updateHtmlElement(userObject, displayName, 'username');
if (profileId !== null) updateHtmlElement(userObject, profileId, 'id');
if (profileUsername !== null) updateHtmlElement(userObject, profileUsername, 'username');
if (profileRepos !== null) updateHtmlElement(userObject, profileRepos, 'publicRepos');
}));
})(); | mit |
maurer/tiamat | samples/Juliet/testcases/CWE78_OS_Command_Injection/s07/CWE78_OS_Command_Injection__wchar_t_file_execl_83a.cpp | 2086 | /* TEMPLATE GENERATED TESTCASE FILE
Filename: CWE78_OS_Command_Injection__wchar_t_file_execl_83a.cpp
Label Definition File: CWE78_OS_Command_Injection.strings.label.xml
Template File: sources-sink-83a.tmpl.cpp
*/
/*
* @description
* CWE: 78 OS Command Injection
* BadSource: file Read input from a file
* GoodSource: Fixed string
* Sinks: execl
* BadSink : execute command with wexecl
* Flow Variant: 83 Data flow: data passed to class constructor and destructor by declaring the class object on the stack
*
* */
#include "std_testcase.h"
#include "CWE78_OS_Command_Injection__wchar_t_file_execl_83.h"
namespace CWE78_OS_Command_Injection__wchar_t_file_execl_83
{
#ifndef OMITBAD
void bad()
{
wchar_t * data;
wchar_t dataBuffer[100] = L"";
data = dataBuffer;
CWE78_OS_Command_Injection__wchar_t_file_execl_83_bad badObject(data);
}
#endif /* OMITBAD */
#ifndef OMITGOOD
/* goodG2B uses the GoodSource with the BadSink */
static void goodG2B()
{
wchar_t * data;
wchar_t dataBuffer[100] = L"";
data = dataBuffer;
CWE78_OS_Command_Injection__wchar_t_file_execl_83_goodG2B goodG2BObject(data);
}
void good()
{
goodG2B();
}
#endif /* OMITGOOD */
} /* close namespace */
/* Below is the main(). It is only used when building this testcase on
its own for testing or for building a binary to use in testing binary
analysis tools. It is not used when compiling all the testcases as one
application, which is how source code analysis tools are tested. */
#ifdef INCLUDEMAIN
using namespace CWE78_OS_Command_Injection__wchar_t_file_execl_83; /* so that we can use good and bad easily */
int main(int argc, char * argv[])
{
/* seed randomness */
srand( (unsigned)time(NULL) );
#ifndef OMITGOOD
printLine("Calling good()...");
good();
printLine("Finished good()");
#endif /* OMITGOOD */
#ifndef OMITBAD
printLine("Calling bad()...");
bad();
printLine("Finished bad()");
#endif /* OMITBAD */
return 0;
}
#endif
| mit |
Jovtcho/JavaFundamentals | JavaOOPBasics/01.DefiningClasses-Exercises/carSalesman/Engine.java | 1886 | package carSalesman;
public class Engine {
//<Model> <Power> <Displacement> <Efficiency> displacements and efficiency are optional
private static final int DEFAULT_DISPLACEMENT_VALUE = -1;
private static final String DEFAULT_EFFICIENCY_VALUE = "n/a";
private String model;
private int power;
private int displacement;
private String efficiency;
public Engine(String model, int power) {
this.model = model;
this.power = power;
this.displacement = DEFAULT_DISPLACEMENT_VALUE;
this.efficiency = DEFAULT_EFFICIENCY_VALUE;
}
public Engine(String model, int power, int displacement) {
this(model, power);
this.displacement = displacement;
this.efficiency = DEFAULT_EFFICIENCY_VALUE;
}
public Engine(String model, int power, String efficiency) {
this(model, power);
this.displacement = DEFAULT_DISPLACEMENT_VALUE;
this.efficiency = efficiency;
}
public Engine(String model, int power, int displacement, String efficiency) {
this(model, power);
this.displacement = displacement;
this.efficiency = efficiency;
}
@Override
public String toString() {
StringBuilder sb = new StringBuilder(" ")
.append(this.model)
.append(":")
.append(System.lineSeparator())
.append(" Power: ")
.append(this.power)
.append(System.lineSeparator());
if (this.displacement == -1) {
sb.append(" Displacement: n/a").append(System.lineSeparator());
} else {
sb.append(" Displacement: ").append(this.displacement).append(System.lineSeparator());
}
sb.append(" Efficiency: ").append(this.efficiency).append(System.lineSeparator());
return sb.toString();
}
} | mit |
hwndmaster/trip2print | TripToPrint.ReportTuning.Dto/MooiDocumentDto.cs | 236 | namespace TripToPrint.ReportTuning.Dto
{
public class MooiDocumentDto
{
public string Title { get; set; }
public string Description { get; set; }
public MooiSectionDto[] Sections { get; set; }
}
}
| mit |
slicebuild/sb | impl/mono/core/Slices/SliceDirectory.cs | 2956 | using System.Collections.Generic;
using System.IO;
using System.Linq;
using sb.Core.Utils;
namespace sb.Core.Slices
{
public class SliceDirectory
{
public SliceDirectory(DirectoryInfo rootDir, DirectoryInfo bunchDir, SemVerInfo bunchInfo)
{
RootDir = rootDir;
BunchDir = bunchDir;
OsDir = bunchDir.GetDirectories("_", SearchOption.TopDirectoryOnly).First();
BunchInfo = bunchInfo;
}
public DirectoryInfo RootDir { get; }
public DirectoryInfo BunchDir { get; }
public DirectoryInfo OsDir { get; }
public SemVerInfo BunchInfo { get; }
public IList<Slice> Scan(SemVerInfo osInfo)
{
// first find suitable os slices in the underscore dir
var list = FindOsSlices(osInfo);
if (list.Count != 0)
{
// now loop over subdirectories (bunch root directory is excluded now)
foreach (var dir in Directory.EnumerateDirectories(BunchDir.FullName, "*.*", SearchOption.AllDirectories))
{
// skip already processed underscore directory with os slices
// and skip hidden directories
if (dir == OsDir.FullName || dir.StartsWith("."))
continue;
LoadSlices(new DirectoryInfo(dir), list);
}
}
return list;
}
private IList<Slice> FindOsSlices(SemVerInfo osInfo)
{
var list = new List<Slice>();
foreach (var fi in OsDir.GetFiles())
{
var info = new SemVerInfo(fi.Name);
// load os slices with the higher or equal version that was requested
if (info.Name == osInfo.Name && info.CompareByNameSemVer(osInfo) >= 0)
{
var osSlice = LoadSlice(fi);
if (osSlice != null)
list.Add(osSlice);
}
}
return list;
}
private void LoadSlices(DirectoryInfo dir, IList<Slice> list)
{
foreach (var fi in dir.GetFiles())
{
var slice = LoadSlice(fi);
if (slice != null)
list.Add(slice);
}
}
private Slice LoadSlice(FileInfo fi)
{
if (fi.Name.StartsWith("."))
return null;
var ext = Path.GetExtension(fi.Name);
if (ext == ".md" || ext == ".txt")
return null;
var relPath = fi.FullName.Replace(RootDir.FullName + Path.DirectorySeparatorChar, "");
var sliceInfo = new SemVerInfo(BunchInfo.NameSemVer, fi.Name);
var lines = File.ReadAllLines(fi.FullName);
var slice = new Slice(relPath, sliceInfo, lines);
return slice;
}
}
} | mit |
Dooder07/DoodCore | src/main/java/net/doodcraft/dooder07/spigot/doodcore/lib/PacketMapChunk.java | 635 | package net.doodcraft.dooder07.spigot.doodcore.lib;
import net.minecraft.server.v1_10_R1.PacketPlayOutMapChunk;
import org.bukkit.craftbukkit.v1_10_R1.CraftChunk;
import org.bukkit.craftbukkit.v1_10_R1.entity.CraftPlayer;
import org.bukkit.entity.Player;
public class PacketMapChunk {
private final net.minecraft.server.v1_10_R1.Chunk chunk;
public PacketMapChunk(final org.bukkit.Chunk chunk) {
this.chunk = ((CraftChunk)chunk).getHandle();
}
public final void send(final Player player) {
((CraftPlayer)player).getHandle().playerConnection.sendPacket(new PacketPlayOutMapChunk(chunk, 20));
}
}
| mit |
seriesrover/differ | signature/encoding/properties.rb | 276 | require_relative '../../helper'
class Properties
def initialize(path)
@properties = FileIO.properties path
end
def get_size
@properties[:size]
end
def get_creation_time
@properties[:ctime]
end
def get_modification_time
@properties[:mtime]
end
end
| mit |
denbedilov/ATTENDER | server/attender-mobile/engine/DAL.py | 7978 | __author__ = 'olesya'
#This class is suppose to access to DB and transfer answers to other classes
from models.user import User
from models.event import Event
from models.attendings import Attendings
import json
from time import mktime
from facebook_logic import fb_logic
import logging
class DAL():
@staticmethod
def set_user_details(fb_id, name, last_name, email):
user1 = User()
qry = user1.check_fb_logged_in(fb_id)
if not qry:
user1.fb_id = fb_id
user1.first_name = name
user1.last_name = last_name
user1.email = email
id = user1.put()
return id.id()
else:
return qry.key.id()
@staticmethod
def get_user_details(user_id, fbf=None):
user_details = dict()
user = User.get_by_id(user_id)
if user is not None:
user_details['name'] = user.first_name
user_details['lastname'] = user.last_name
if fbf is not None:
user_details['fbf'] = fbf
user_details['id'] = user.fb_id
return user_details
else:
return 1
def get_user_by_token(self, token):
l = list()
res = self.get_user_details(token)
if res == 1:
return 1
else:
l.append(res)
return json.dumps(l)
@staticmethod
def user_login(email, password):
#check all credentials are right
qry = User.query(User.email == email, User.password == password).get()
if qry:
return qry.key.id()
else:
#check password wrong
q = User.query(User.email == email).get()
if q and q.password == "None":
return 2
elif q:
return 1
elif q is None:
return False
@staticmethod
def register(email, hashed_password, first, last):
user1 = User()
qry = User.query(User.email==email, User.password==hashed_password, User.first_name==first, User.last_name==last).get()
logging.info(qry)
if qry:
return 2
qry = user1.check_user_exist_by_email(email)
try:
qry.password = hashed_password
token = qry.put()
return token.id()
except:
user1.email = email
user1.password = hashed_password
user1.first_name = first
user1.last_name = last
token = user1.put()
return token.id()
@staticmethod
def google_login(email, first, last):
user1 = User()
qry = User.query(User.email == email, User.first_name == first, User.last_name == last).get()
logging.info(qry)
if qry:
return qry.key.id()
else:
user1.email = email
user1.first_name = first
user1.last_name = last
token = user1.put()
return token.id()
@staticmethod
def set_event_details(e_id, name, date, city, add, descr, host, url, attendees, price, category, source):
event1 = Event()
qry = event1.check_event_exist(e_id) or event1.check_event_exist_by_name(name)
if qry is False:
event1.id = e_id
event1.name = name
event1.date = date
event1.city = city
event1.address = add
event1.description = descr
event1.host = host
event1.event_url = url
event1.source = source
if (attendees != "Unknown"):
event1.attendees = attendees
event1.price = price
if category is not None:
event1.category = category
key = event1.put()
return key
else: # Update existing meetings! It could be changed or canceled!
qry.name = name
qry.date = date
qry.city = city
qry.address = add
qry.description = descr
qry.host = host
qry.event_url = url
qry.source = source
qry.price = price
if category is not None:
qry.category = category
results = Attendings.query(Attendings.event_id == qry.get_by_id(e_id))
if results is not None:
qry.attendees = attendees + results.count()
else:
qry.attendees = attendees
qry.put()
@staticmethod
def get_event_details(event_id):
res = Event.get_by_id(event_id)
if res is not None:
event = dict()
event['id'] = res.key.id()
event['name'] = res.name
date_time = int(mktime(res.date.utctimetuple()) * 1000)
event['date'] = date_time
event['city'] = res.city
event['address'] = res.address
event['description'] = res.description
event['host'] = res.host
event['event_url'] = res.event_url
event['attendees'] = res.attendees
event['price'] = res.price
return event
def get_attendings(self, ev_id, user_id, fb_token=None):
us = User.get_by_id(user_id)
token = None
fb_id = None
if us is not None:
fb_id = us.fb_id
if Event.get_by_id(ev_id) is None:
return 1
results = Attendings.query(Attendings.event_id == ev_id)
return self.json_format_attendees(results, fb_token, fb_id, user_id)
def json_format_attendees(self, query_res, token, fb_id, my_id):
users = list()
fb_friends = fb_logic.get_fb_friends(token)
if fb_friends is None:
fb_friends = []
for res in query_res:
fbf = "false"
for f in fb_friends:
qry = User.get_by_id(res.user_id)
if qry is not None:
if int(f) == qry.fb_id:
fbf = "true"
if res.user_id != my_id: #do not return myself!
user = self.get_user_details(res.user_id, fbf)
if user != 1:
users.append(user)
return json.dumps(users)
@staticmethod
def attend(u_key, e_key):
event1 = Event()
attendings1 = Attendings()
qry = User.get_by_id(u_key)
logging.info("query is : {}".format(qry))
if qry is None:
return 1
else:
attendings1.user_id = u_key
if Event.get_by_id(e_key) is None:
return 2
else:
attendings1.event_id = e_key
if attendings1.check_attend_exist(u_key, e_key) is False:
attendings1.put()
event1.update_attendees(e_key, action="add")
return 0
@staticmethod
def unattend(u_key, e_key):
event1 = Event()
qry = User.get_by_id(u_key)
if qry is None:
return 1
if Event.get_by_id(e_key) is None:
return 2
attendings1 = Attendings()
q = attendings1.check_attend_exist(u_key, e_key)
if q:
q.key.delete()
event1.update_attendees(e_key, action="sub")
return 0
def get_all_user_events(self, u_id):
events_list = []
results = Attendings.query(Attendings.user_id == u_id)
for res in results:
if self.get_event_details(res.event_id) is not None:
events_list.append(self.get_event_details(res.event_id))
return json.dumps(events_list)
def check_token(self, token):
if User.get_by_id(token) is None:
return False
else:
return True
| mit |
steveash/jopenfst | src/main/java/com/github/steveash/jopenfst/State.java | 1506 | /*
* Copyright 2016 Steve Ash
*
* Licensed under the Apache License, Version 2.0 (the "License");
* you may not use this file except in compliance with the License.
* You may obtain a copy of the License at
*
* http://www.apache.org/licenses/LICENSE-2.0
*
* Unless required by applicable law or agreed to in writing, software
* distributed under the License is distributed on an "AS IS" BASIS,
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
* See the License for the specific language governing permissions and
* limitations under the License.
*/
package com.github.steveash.jopenfst;
import java.util.List;
/**
* Abstract interface of a State in an FST.
* @author Steve Ash
*/
public interface State {
/**
* The final weight assigned to this state (note that this will depend on what semiring is being used to build the
* FST
* @return
*/
double getFinalWeight();
/**
* The id for this state; ids are internal and can change through transformations. If you need some stable labeling
* of states then use state labels (i.e. a state symbol table)
* @return
*/
int getId();
/**
* The outgoing arc count in this state (including self-loops)
* @return
*/
int getArcCount();
/**
* Get's the ith outgoing arc for this state
* @param index
* @return
*/
Arc getArc(int index);
/**
* Get's the entire list of outgoing arcs for this state
* @return
*/
List<? extends Arc> getArcs();
}
| mit |
SystemFriend/HoloLensUnityChan | Assets/MRTK/Core/Utilities/ScriptingUtilities.cs | 2959 | // Copyright (c) Microsoft Corporation. All rights reserved.
// Licensed under the MIT License. See LICENSE in the project root for license information.
#if UNITY_EDITOR
using System;
using System.IO;
using UnityEditor;
using UnityEngine;
namespace Microsoft.MixedReality.Toolkit.Utilities.Editor
{
/// <summary>
/// A set of utilities to configure script compilation.
/// </summary>
[Obsolete("The ScriptingUtilities class is obsolete and will be removed from a future version of MRTK. Please use the ScriptUtilities class.")]
public static class ScriptingUtilities
{
/// <summary>
/// Appends a set of symbolic constant definitions to Unity's Scripting Define Symbols for the
/// specified build target group.
/// </summary>
/// <param name="fileName">The name of an optional file locate before appending.</param>
/// <param name="targetGroup">The build target group for which the symbols are to be defined.</param>
/// <param name="symbols">Array of symbols to define.</param>
/// <remarks>
/// To always append the symbols, pass null (or the empty string) for the fileName parameter.
/// </remarks>
[Obsolete("ScriptingUtilities.AppendScriptingDefinitions is obsolete and will be removed from a future version of MRTK. Please use FileUtilities.FindFilesInAssets and ScriptUtilities.AppendScriptingDefinitions.")]
public static void AppendScriptingDefinitions(
string fileName,
BuildTargetGroup targetGroup,
string[] symbols)
{
// Note: Typically, obsolete methods are re-implemented using the replacement versions.
// In this instance, that is not possible as the replacement exists in a separate assembly that is
// not appropriate for referencing (the new assembly is editor only).
if (symbols == null || symbols.Length == 0) { return; }
bool appendSymbols = true;
if (!string.IsNullOrWhiteSpace(fileName))
{
DirectoryInfo assets = new DirectoryInfo(Application.dataPath);
FileInfo[] files = assets.GetFiles(fileName, SearchOption.AllDirectories);
appendSymbols = (files.Length > 0);
}
if (!appendSymbols) { return; }
string defines = PlayerSettings.GetScriptingDefineSymbolsForGroup(targetGroup);
foreach (string symbol in symbols)
{
if (string.IsNullOrWhiteSpace(defines))
{
defines = symbol;
continue;
}
if (!defines.Contains(symbol))
{
defines = string.Concat(defines, $";{symbol}");
}
}
PlayerSettings.SetScriptingDefineSymbolsForGroup(targetGroup, defines);
}
}
}
#endif // UNITY_EDITOR
| mit |
yogeshsaroya/new-cdnjs | ajax/libs/uikit/2.13.1/js/core/dropdown.js | 129 | version https://git-lfs.github.com/spec/v1
oid sha256:56d490b2513456873a3efa9bc7b40e81ea0637c259363edc2ac7ee394749a528
size 8176
| mit |
ascartabelli/lamb | src/math/modulo.js | 801 | /**
* Performs the modulo operation and should not be confused with the
* {@link module:lamb.remainder|remainder}.
* The function performs a floored division to calculate the result and not
* a truncated one, hence the sign of the dividend is not kept, unlike the
* {@link module:lamb.remainder|remainder}.
* @example
* _.modulo(5, 3) // => 2
* _.remainder(5, 3) // => 2
*
* _.modulo(-5, 3) // => 1
* _.remainder(-5, 3) // => -2
*
* @memberof module:lamb
* @category Math
* @see {@link module:lamb.remainder|remainder}
* @see [Modulo operation on Wikipedia]{@link http://en.wikipedia.org/wiki/Modulo_operation}
* @since 0.1.0
* @param {Number} a
* @param {Number} b
* @returns {Number}
*/
function modulo (a, b) {
return a - (b * Math.floor(a / b));
}
export default modulo;
| mit |
AndyDune/ok62.ru | !_dune/_views/default/bit/user/info/with_object_view_open.php | 780 | <dl id="saler-short-info">
<dt>
Ðàçìåñòèë ïîëüçîâàòåëü:
</dt>
<dd>
<a href="/user/<?php echo $this->user_info->id; ?>/" title="Ôîòî"><img src="<?php echo $this->view_folder; ?>/img/user/default.jpg" /></a>
</dd>
<dd>
<a href="/user/info/<?php echo $this->user_info->id; ?>/" title="Ïåðñîíàëüíàÿ ñòðàíèöà"><?php echo $this->user_info->contact_name; ?></a>
<?php
// Ïîêàç ôàìèëèè
if ($this->user_info_allow->contact_surname)
{
?> <?php echo $this->user_info->contact_surname;
} ?>
<?php
// Ïîêàç àäðåñà ýëåêòðîíîé ïî÷òû
if ($this->user_info_allow->phone) {?>
<dd>
Òåëåôîí: <?php echo $this->user_info->phone; ?>
</dd>
<?php } ?>
<?php
// Ïîêàç àäðåñà ýëåêòðîíîé ïî÷òû
if ($this->user_info_allow->mail) {?>
<dd>
e-mail: <?php echo $this->user_info->mail; ?>
</dd>
<?php } ?>
</dl> | mit |
bright-bogazici-universitesi/bright | public/js/app.js | 964569 | /******/ (function(modules) { // webpackBootstrap
/******/ // The module cache
/******/ var installedModules = {};
/******/ // The require function
/******/ function __webpack_require__(moduleId) {
/******/ // Check if module is in cache
/******/ if(installedModules[moduleId])
/******/ return installedModules[moduleId].exports;
/******/ // Create a new module (and put it into the cache)
/******/ var module = installedModules[moduleId] = {
/******/ i: moduleId,
/******/ l: false,
/******/ exports: {}
/******/ };
/******/ // Execute the module function
/******/ modules[moduleId].call(module.exports, module, module.exports, __webpack_require__);
/******/ // Flag the module as loaded
/******/ module.l = true;
/******/ // Return the exports of the module
/******/ return module.exports;
/******/ }
/******/ // expose the modules object (__webpack_modules__)
/******/ __webpack_require__.m = modules;
/******/ // expose the module cache
/******/ __webpack_require__.c = installedModules;
/******/ // identity function for calling harmony imports with the correct context
/******/ __webpack_require__.i = function(value) { return value; };
/******/ // define getter function for harmony exports
/******/ __webpack_require__.d = function(exports, name, getter) {
/******/ if(!__webpack_require__.o(exports, name)) {
/******/ Object.defineProperty(exports, name, {
/******/ configurable: false,
/******/ enumerable: true,
/******/ get: getter
/******/ });
/******/ }
/******/ };
/******/ // getDefaultExport function for compatibility with non-harmony modules
/******/ __webpack_require__.n = function(module) {
/******/ var getter = module && module.__esModule ?
/******/ function getDefault() { return module['default']; } :
/******/ function getModuleExports() { return module; };
/******/ __webpack_require__.d(getter, 'a', getter);
/******/ return getter;
/******/ };
/******/ // Object.prototype.hasOwnProperty.call
/******/ __webpack_require__.o = function(object, property) { return Object.prototype.hasOwnProperty.call(object, property); };
/******/ // __webpack_public_path__
/******/ __webpack_require__.p = "./";
/******/ // Load entry module and return exports
/******/ return __webpack_require__(__webpack_require__.s = 36);
/******/ })
/************************************************************************/
/******/ ([
/* 0 */
/***/ (function(module, exports, __webpack_require__) {
"use strict";
var bind = __webpack_require__(7);
/*global toString:true*/
// utils is a library of generic helper functions non-specific to axios
var toString = Object.prototype.toString;
/**
* Determine if a value is an Array
*
* @param {Object} val The value to test
* @returns {boolean} True if value is an Array, otherwise false
*/
function isArray(val) {
return toString.call(val) === '[object Array]';
}
/**
* Determine if a value is an ArrayBuffer
*
* @param {Object} val The value to test
* @returns {boolean} True if value is an ArrayBuffer, otherwise false
*/
function isArrayBuffer(val) {
return toString.call(val) === '[object ArrayBuffer]';
}
/**
* Determine if a value is a FormData
*
* @param {Object} val The value to test
* @returns {boolean} True if value is an FormData, otherwise false
*/
function isFormData(val) {
return (typeof FormData !== 'undefined') && (val instanceof FormData);
}
/**
* Determine if a value is a view on an ArrayBuffer
*
* @param {Object} val The value to test
* @returns {boolean} True if value is a view on an ArrayBuffer, otherwise false
*/
function isArrayBufferView(val) {
var result;
if ((typeof ArrayBuffer !== 'undefined') && (ArrayBuffer.isView)) {
result = ArrayBuffer.isView(val);
} else {
result = (val) && (val.buffer) && (val.buffer instanceof ArrayBuffer);
}
return result;
}
/**
* Determine if a value is a String
*
* @param {Object} val The value to test
* @returns {boolean} True if value is a String, otherwise false
*/
function isString(val) {
return typeof val === 'string';
}
/**
* Determine if a value is a Number
*
* @param {Object} val The value to test
* @returns {boolean} True if value is a Number, otherwise false
*/
function isNumber(val) {
return typeof val === 'number';
}
/**
* Determine if a value is undefined
*
* @param {Object} val The value to test
* @returns {boolean} True if the value is undefined, otherwise false
*/
function isUndefined(val) {
return typeof val === 'undefined';
}
/**
* Determine if a value is an Object
*
* @param {Object} val The value to test
* @returns {boolean} True if value is an Object, otherwise false
*/
function isObject(val) {
return val !== null && typeof val === 'object';
}
/**
* Determine if a value is a Date
*
* @param {Object} val The value to test
* @returns {boolean} True if value is a Date, otherwise false
*/
function isDate(val) {
return toString.call(val) === '[object Date]';
}
/**
* Determine if a value is a File
*
* @param {Object} val The value to test
* @returns {boolean} True if value is a File, otherwise false
*/
function isFile(val) {
return toString.call(val) === '[object File]';
}
/**
* Determine if a value is a Blob
*
* @param {Object} val The value to test
* @returns {boolean} True if value is a Blob, otherwise false
*/
function isBlob(val) {
return toString.call(val) === '[object Blob]';
}
/**
* Determine if a value is a Function
*
* @param {Object} val The value to test
* @returns {boolean} True if value is a Function, otherwise false
*/
function isFunction(val) {
return toString.call(val) === '[object Function]';
}
/**
* Determine if a value is a Stream
*
* @param {Object} val The value to test
* @returns {boolean} True if value is a Stream, otherwise false
*/
function isStream(val) {
return isObject(val) && isFunction(val.pipe);
}
/**
* Determine if a value is a URLSearchParams object
*
* @param {Object} val The value to test
* @returns {boolean} True if value is a URLSearchParams object, otherwise false
*/
function isURLSearchParams(val) {
return typeof URLSearchParams !== 'undefined' && val instanceof URLSearchParams;
}
/**
* Trim excess whitespace off the beginning and end of a string
*
* @param {String} str The String to trim
* @returns {String} The String freed of excess whitespace
*/
function trim(str) {
return str.replace(/^\s*/, '').replace(/\s*$/, '');
}
/**
* Determine if we're running in a standard browser environment
*
* This allows axios to run in a web worker, and react-native.
* Both environments support XMLHttpRequest, but not fully standard globals.
*
* web workers:
* typeof window -> undefined
* typeof document -> undefined
*
* react-native:
* typeof document.createElement -> undefined
*/
function isStandardBrowserEnv() {
return (
typeof window !== 'undefined' &&
typeof document !== 'undefined' &&
typeof document.createElement === 'function'
);
}
/**
* Iterate over an Array or an Object invoking a function for each item.
*
* If `obj` is an Array callback will be called passing
* the value, index, and complete array for each item.
*
* If 'obj' is an Object callback will be called passing
* the value, key, and complete object for each property.
*
* @param {Object|Array} obj The object to iterate
* @param {Function} fn The callback to invoke for each item
*/
function forEach(obj, fn) {
// Don't bother if no value provided
if (obj === null || typeof obj === 'undefined') {
return;
}
// Force an array if not already something iterable
if (typeof obj !== 'object' && !isArray(obj)) {
/*eslint no-param-reassign:0*/
obj = [obj];
}
if (isArray(obj)) {
// Iterate over array values
for (var i = 0, l = obj.length; i < l; i++) {
fn.call(null, obj[i], i, obj);
}
} else {
// Iterate over object keys
for (var key in obj) {
if (Object.prototype.hasOwnProperty.call(obj, key)) {
fn.call(null, obj[key], key, obj);
}
}
}
}
/**
* Accepts varargs expecting each argument to be an object, then
* immutably merges the properties of each object and returns result.
*
* When multiple objects contain the same key the later object in
* the arguments list will take precedence.
*
* Example:
*
* ```js
* var result = merge({foo: 123}, {foo: 456});
* console.log(result.foo); // outputs 456
* ```
*
* @param {Object} obj1 Object to merge
* @returns {Object} Result of all merge properties
*/
function merge(/* obj1, obj2, obj3, ... */) {
var result = {};
function assignValue(val, key) {
if (typeof result[key] === 'object' && typeof val === 'object') {
result[key] = merge(result[key], val);
} else {
result[key] = val;
}
}
for (var i = 0, l = arguments.length; i < l; i++) {
forEach(arguments[i], assignValue);
}
return result;
}
/**
* Extends object a by mutably adding to it the properties of object b.
*
* @param {Object} a The object to be extended
* @param {Object} b The object to copy properties from
* @param {Object} thisArg The object to bind function to
* @return {Object} The resulting value of object a
*/
function extend(a, b, thisArg) {
forEach(b, function assignValue(val, key) {
if (thisArg && typeof val === 'function') {
a[key] = bind(val, thisArg);
} else {
a[key] = val;
}
});
return a;
}
module.exports = {
isArray: isArray,
isArrayBuffer: isArrayBuffer,
isFormData: isFormData,
isArrayBufferView: isArrayBufferView,
isString: isString,
isNumber: isNumber,
isObject: isObject,
isUndefined: isUndefined,
isDate: isDate,
isFile: isFile,
isBlob: isBlob,
isFunction: isFunction,
isStream: isStream,
isURLSearchParams: isURLSearchParams,
isStandardBrowserEnv: isStandardBrowserEnv,
forEach: forEach,
merge: merge,
extend: extend,
trim: trim
};
/***/ }),
/* 1 */
/***/ (function(module, exports, __webpack_require__) {
var __WEBPACK_AMD_DEFINE_ARRAY__, __WEBPACK_AMD_DEFINE_RESULT__;/*!
* jQuery JavaScript Library v3.1.1
* https://jquery.com/
*
* Includes Sizzle.js
* https://sizzlejs.com/
*
* Copyright jQuery Foundation and other contributors
* Released under the MIT license
* https://jquery.org/license
*
* Date: 2016-09-22T22:30Z
*/
( function( global, factory ) {
"use strict";
if ( typeof module === "object" && typeof module.exports === "object" ) {
// For CommonJS and CommonJS-like environments where a proper `window`
// is present, execute the factory and get jQuery.
// For environments that do not have a `window` with a `document`
// (such as Node.js), expose a factory as module.exports.
// This accentuates the need for the creation of a real `window`.
// e.g. var jQuery = require("jquery")(window);
// See ticket #14549 for more info.
module.exports = global.document ?
factory( global, true ) :
function( w ) {
if ( !w.document ) {
throw new Error( "jQuery requires a window with a document" );
}
return factory( w );
};
} else {
factory( global );
}
// Pass this if window is not defined yet
} )( typeof window !== "undefined" ? window : this, function( window, noGlobal ) {
// Edge <= 12 - 13+, Firefox <=18 - 45+, IE 10 - 11, Safari 5.1 - 9+, iOS 6 - 9.1
// throw exceptions when non-strict code (e.g., ASP.NET 4.5) accesses strict mode
// arguments.callee.caller (trac-13335). But as of jQuery 3.0 (2016), strict mode should be common
// enough that all such attempts are guarded in a try block.
"use strict";
var arr = [];
var document = window.document;
var getProto = Object.getPrototypeOf;
var slice = arr.slice;
var concat = arr.concat;
var push = arr.push;
var indexOf = arr.indexOf;
var class2type = {};
var toString = class2type.toString;
var hasOwn = class2type.hasOwnProperty;
var fnToString = hasOwn.toString;
var ObjectFunctionString = fnToString.call( Object );
var support = {};
function DOMEval( code, doc ) {
doc = doc || document;
var script = doc.createElement( "script" );
script.text = code;
doc.head.appendChild( script ).parentNode.removeChild( script );
}
/* global Symbol */
// Defining this global in .eslintrc.json would create a danger of using the global
// unguarded in another place, it seems safer to define global only for this module
var
version = "3.1.1",
// Define a local copy of jQuery
jQuery = function( selector, context ) {
// The jQuery object is actually just the init constructor 'enhanced'
// Need init if jQuery is called (just allow error to be thrown if not included)
return new jQuery.fn.init( selector, context );
},
// Support: Android <=4.0 only
// Make sure we trim BOM and NBSP
rtrim = /^[\s\uFEFF\xA0]+|[\s\uFEFF\xA0]+$/g,
// Matches dashed string for camelizing
rmsPrefix = /^-ms-/,
rdashAlpha = /-([a-z])/g,
// Used by jQuery.camelCase as callback to replace()
fcamelCase = function( all, letter ) {
return letter.toUpperCase();
};
jQuery.fn = jQuery.prototype = {
// The current version of jQuery being used
jquery: version,
constructor: jQuery,
// The default length of a jQuery object is 0
length: 0,
toArray: function() {
return slice.call( this );
},
// Get the Nth element in the matched element set OR
// Get the whole matched element set as a clean array
get: function( num ) {
// Return all the elements in a clean array
if ( num == null ) {
return slice.call( this );
}
// Return just the one element from the set
return num < 0 ? this[ num + this.length ] : this[ num ];
},
// Take an array of elements and push it onto the stack
// (returning the new matched element set)
pushStack: function( elems ) {
// Build a new jQuery matched element set
var ret = jQuery.merge( this.constructor(), elems );
// Add the old object onto the stack (as a reference)
ret.prevObject = this;
// Return the newly-formed element set
return ret;
},
// Execute a callback for every element in the matched set.
each: function( callback ) {
return jQuery.each( this, callback );
},
map: function( callback ) {
return this.pushStack( jQuery.map( this, function( elem, i ) {
return callback.call( elem, i, elem );
} ) );
},
slice: function() {
return this.pushStack( slice.apply( this, arguments ) );
},
first: function() {
return this.eq( 0 );
},
last: function() {
return this.eq( -1 );
},
eq: function( i ) {
var len = this.length,
j = +i + ( i < 0 ? len : 0 );
return this.pushStack( j >= 0 && j < len ? [ this[ j ] ] : [] );
},
end: function() {
return this.prevObject || this.constructor();
},
// For internal use only.
// Behaves like an Array's method, not like a jQuery method.
push: push,
sort: arr.sort,
splice: arr.splice
};
jQuery.extend = jQuery.fn.extend = function() {
var options, name, src, copy, copyIsArray, clone,
target = arguments[ 0 ] || {},
i = 1,
length = arguments.length,
deep = false;
// Handle a deep copy situation
if ( typeof target === "boolean" ) {
deep = target;
// Skip the boolean and the target
target = arguments[ i ] || {};
i++;
}
// Handle case when target is a string or something (possible in deep copy)
if ( typeof target !== "object" && !jQuery.isFunction( target ) ) {
target = {};
}
// Extend jQuery itself if only one argument is passed
if ( i === length ) {
target = this;
i--;
}
for ( ; i < length; i++ ) {
// Only deal with non-null/undefined values
if ( ( options = arguments[ i ] ) != null ) {
// Extend the base object
for ( name in options ) {
src = target[ name ];
copy = options[ name ];
// Prevent never-ending loop
if ( target === copy ) {
continue;
}
// Recurse if we're merging plain objects or arrays
if ( deep && copy && ( jQuery.isPlainObject( copy ) ||
( copyIsArray = jQuery.isArray( copy ) ) ) ) {
if ( copyIsArray ) {
copyIsArray = false;
clone = src && jQuery.isArray( src ) ? src : [];
} else {
clone = src && jQuery.isPlainObject( src ) ? src : {};
}
// Never move original objects, clone them
target[ name ] = jQuery.extend( deep, clone, copy );
// Don't bring in undefined values
} else if ( copy !== undefined ) {
target[ name ] = copy;
}
}
}
}
// Return the modified object
return target;
};
jQuery.extend( {
// Unique for each copy of jQuery on the page
expando: "jQuery" + ( version + Math.random() ).replace( /\D/g, "" ),
// Assume jQuery is ready without the ready module
isReady: true,
error: function( msg ) {
throw new Error( msg );
},
noop: function() {},
isFunction: function( obj ) {
return jQuery.type( obj ) === "function";
},
isArray: Array.isArray,
isWindow: function( obj ) {
return obj != null && obj === obj.window;
},
isNumeric: function( obj ) {
// As of jQuery 3.0, isNumeric is limited to
// strings and numbers (primitives or objects)
// that can be coerced to finite numbers (gh-2662)
var type = jQuery.type( obj );
return ( type === "number" || type === "string" ) &&
// parseFloat NaNs numeric-cast false positives ("")
// ...but misinterprets leading-number strings, particularly hex literals ("0x...")
// subtraction forces infinities to NaN
!isNaN( obj - parseFloat( obj ) );
},
isPlainObject: function( obj ) {
var proto, Ctor;
// Detect obvious negatives
// Use toString instead of jQuery.type to catch host objects
if ( !obj || toString.call( obj ) !== "[object Object]" ) {
return false;
}
proto = getProto( obj );
// Objects with no prototype (e.g., `Object.create( null )`) are plain
if ( !proto ) {
return true;
}
// Objects with prototype are plain iff they were constructed by a global Object function
Ctor = hasOwn.call( proto, "constructor" ) && proto.constructor;
return typeof Ctor === "function" && fnToString.call( Ctor ) === ObjectFunctionString;
},
isEmptyObject: function( obj ) {
/* eslint-disable no-unused-vars */
// See https://github.com/eslint/eslint/issues/6125
var name;
for ( name in obj ) {
return false;
}
return true;
},
type: function( obj ) {
if ( obj == null ) {
return obj + "";
}
// Support: Android <=2.3 only (functionish RegExp)
return typeof obj === "object" || typeof obj === "function" ?
class2type[ toString.call( obj ) ] || "object" :
typeof obj;
},
// Evaluates a script in a global context
globalEval: function( code ) {
DOMEval( code );
},
// Convert dashed to camelCase; used by the css and data modules
// Support: IE <=9 - 11, Edge 12 - 13
// Microsoft forgot to hump their vendor prefix (#9572)
camelCase: function( string ) {
return string.replace( rmsPrefix, "ms-" ).replace( rdashAlpha, fcamelCase );
},
nodeName: function( elem, name ) {
return elem.nodeName && elem.nodeName.toLowerCase() === name.toLowerCase();
},
each: function( obj, callback ) {
var length, i = 0;
if ( isArrayLike( obj ) ) {
length = obj.length;
for ( ; i < length; i++ ) {
if ( callback.call( obj[ i ], i, obj[ i ] ) === false ) {
break;
}
}
} else {
for ( i in obj ) {
if ( callback.call( obj[ i ], i, obj[ i ] ) === false ) {
break;
}
}
}
return obj;
},
// Support: Android <=4.0 only
trim: function( text ) {
return text == null ?
"" :
( text + "" ).replace( rtrim, "" );
},
// results is for internal usage only
makeArray: function( arr, results ) {
var ret = results || [];
if ( arr != null ) {
if ( isArrayLike( Object( arr ) ) ) {
jQuery.merge( ret,
typeof arr === "string" ?
[ arr ] : arr
);
} else {
push.call( ret, arr );
}
}
return ret;
},
inArray: function( elem, arr, i ) {
return arr == null ? -1 : indexOf.call( arr, elem, i );
},
// Support: Android <=4.0 only, PhantomJS 1 only
// push.apply(_, arraylike) throws on ancient WebKit
merge: function( first, second ) {
var len = +second.length,
j = 0,
i = first.length;
for ( ; j < len; j++ ) {
first[ i++ ] = second[ j ];
}
first.length = i;
return first;
},
grep: function( elems, callback, invert ) {
var callbackInverse,
matches = [],
i = 0,
length = elems.length,
callbackExpect = !invert;
// Go through the array, only saving the items
// that pass the validator function
for ( ; i < length; i++ ) {
callbackInverse = !callback( elems[ i ], i );
if ( callbackInverse !== callbackExpect ) {
matches.push( elems[ i ] );
}
}
return matches;
},
// arg is for internal usage only
map: function( elems, callback, arg ) {
var length, value,
i = 0,
ret = [];
// Go through the array, translating each of the items to their new values
if ( isArrayLike( elems ) ) {
length = elems.length;
for ( ; i < length; i++ ) {
value = callback( elems[ i ], i, arg );
if ( value != null ) {
ret.push( value );
}
}
// Go through every key on the object,
} else {
for ( i in elems ) {
value = callback( elems[ i ], i, arg );
if ( value != null ) {
ret.push( value );
}
}
}
// Flatten any nested arrays
return concat.apply( [], ret );
},
// A global GUID counter for objects
guid: 1,
// Bind a function to a context, optionally partially applying any
// arguments.
proxy: function( fn, context ) {
var tmp, args, proxy;
if ( typeof context === "string" ) {
tmp = fn[ context ];
context = fn;
fn = tmp;
}
// Quick check to determine if target is callable, in the spec
// this throws a TypeError, but we will just return undefined.
if ( !jQuery.isFunction( fn ) ) {
return undefined;
}
// Simulated bind
args = slice.call( arguments, 2 );
proxy = function() {
return fn.apply( context || this, args.concat( slice.call( arguments ) ) );
};
// Set the guid of unique handler to the same of original handler, so it can be removed
proxy.guid = fn.guid = fn.guid || jQuery.guid++;
return proxy;
},
now: Date.now,
// jQuery.support is not used in Core but other projects attach their
// properties to it so it needs to exist.
support: support
} );
if ( typeof Symbol === "function" ) {
jQuery.fn[ Symbol.iterator ] = arr[ Symbol.iterator ];
}
// Populate the class2type map
jQuery.each( "Boolean Number String Function Array Date RegExp Object Error Symbol".split( " " ),
function( i, name ) {
class2type[ "[object " + name + "]" ] = name.toLowerCase();
} );
function isArrayLike( obj ) {
// Support: real iOS 8.2 only (not reproducible in simulator)
// `in` check used to prevent JIT error (gh-2145)
// hasOwn isn't used here due to false negatives
// regarding Nodelist length in IE
var length = !!obj && "length" in obj && obj.length,
type = jQuery.type( obj );
if ( type === "function" || jQuery.isWindow( obj ) ) {
return false;
}
return type === "array" || length === 0 ||
typeof length === "number" && length > 0 && ( length - 1 ) in obj;
}
var Sizzle =
/*!
* Sizzle CSS Selector Engine v2.3.3
* https://sizzlejs.com/
*
* Copyright jQuery Foundation and other contributors
* Released under the MIT license
* http://jquery.org/license
*
* Date: 2016-08-08
*/
(function( window ) {
var i,
support,
Expr,
getText,
isXML,
tokenize,
compile,
select,
outermostContext,
sortInput,
hasDuplicate,
// Local document vars
setDocument,
document,
docElem,
documentIsHTML,
rbuggyQSA,
rbuggyMatches,
matches,
contains,
// Instance-specific data
expando = "sizzle" + 1 * new Date(),
preferredDoc = window.document,
dirruns = 0,
done = 0,
classCache = createCache(),
tokenCache = createCache(),
compilerCache = createCache(),
sortOrder = function( a, b ) {
if ( a === b ) {
hasDuplicate = true;
}
return 0;
},
// Instance methods
hasOwn = ({}).hasOwnProperty,
arr = [],
pop = arr.pop,
push_native = arr.push,
push = arr.push,
slice = arr.slice,
// Use a stripped-down indexOf as it's faster than native
// https://jsperf.com/thor-indexof-vs-for/5
indexOf = function( list, elem ) {
var i = 0,
len = list.length;
for ( ; i < len; i++ ) {
if ( list[i] === elem ) {
return i;
}
}
return -1;
},
booleans = "checked|selected|async|autofocus|autoplay|controls|defer|disabled|hidden|ismap|loop|multiple|open|readonly|required|scoped",
// Regular expressions
// http://www.w3.org/TR/css3-selectors/#whitespace
whitespace = "[\\x20\\t\\r\\n\\f]",
// http://www.w3.org/TR/CSS21/syndata.html#value-def-identifier
identifier = "(?:\\\\.|[\\w-]|[^\0-\\xa0])+",
// Attribute selectors: http://www.w3.org/TR/selectors/#attribute-selectors
attributes = "\\[" + whitespace + "*(" + identifier + ")(?:" + whitespace +
// Operator (capture 2)
"*([*^$|!~]?=)" + whitespace +
// "Attribute values must be CSS identifiers [capture 5] or strings [capture 3 or capture 4]"
"*(?:'((?:\\\\.|[^\\\\'])*)'|\"((?:\\\\.|[^\\\\\"])*)\"|(" + identifier + "))|)" + whitespace +
"*\\]",
pseudos = ":(" + identifier + ")(?:\\((" +
// To reduce the number of selectors needing tokenize in the preFilter, prefer arguments:
// 1. quoted (capture 3; capture 4 or capture 5)
"('((?:\\\\.|[^\\\\'])*)'|\"((?:\\\\.|[^\\\\\"])*)\")|" +
// 2. simple (capture 6)
"((?:\\\\.|[^\\\\()[\\]]|" + attributes + ")*)|" +
// 3. anything else (capture 2)
".*" +
")\\)|)",
// Leading and non-escaped trailing whitespace, capturing some non-whitespace characters preceding the latter
rwhitespace = new RegExp( whitespace + "+", "g" ),
rtrim = new RegExp( "^" + whitespace + "+|((?:^|[^\\\\])(?:\\\\.)*)" + whitespace + "+$", "g" ),
rcomma = new RegExp( "^" + whitespace + "*," + whitespace + "*" ),
rcombinators = new RegExp( "^" + whitespace + "*([>+~]|" + whitespace + ")" + whitespace + "*" ),
rattributeQuotes = new RegExp( "=" + whitespace + "*([^\\]'\"]*?)" + whitespace + "*\\]", "g" ),
rpseudo = new RegExp( pseudos ),
ridentifier = new RegExp( "^" + identifier + "$" ),
matchExpr = {
"ID": new RegExp( "^#(" + identifier + ")" ),
"CLASS": new RegExp( "^\\.(" + identifier + ")" ),
"TAG": new RegExp( "^(" + identifier + "|[*])" ),
"ATTR": new RegExp( "^" + attributes ),
"PSEUDO": new RegExp( "^" + pseudos ),
"CHILD": new RegExp( "^:(only|first|last|nth|nth-last)-(child|of-type)(?:\\(" + whitespace +
"*(even|odd|(([+-]|)(\\d*)n|)" + whitespace + "*(?:([+-]|)" + whitespace +
"*(\\d+)|))" + whitespace + "*\\)|)", "i" ),
"bool": new RegExp( "^(?:" + booleans + ")$", "i" ),
// For use in libraries implementing .is()
// We use this for POS matching in `select`
"needsContext": new RegExp( "^" + whitespace + "*[>+~]|:(even|odd|eq|gt|lt|nth|first|last)(?:\\(" +
whitespace + "*((?:-\\d)?\\d*)" + whitespace + "*\\)|)(?=[^-]|$)", "i" )
},
rinputs = /^(?:input|select|textarea|button)$/i,
rheader = /^h\d$/i,
rnative = /^[^{]+\{\s*\[native \w/,
// Easily-parseable/retrievable ID or TAG or CLASS selectors
rquickExpr = /^(?:#([\w-]+)|(\w+)|\.([\w-]+))$/,
rsibling = /[+~]/,
// CSS escapes
// http://www.w3.org/TR/CSS21/syndata.html#escaped-characters
runescape = new RegExp( "\\\\([\\da-f]{1,6}" + whitespace + "?|(" + whitespace + ")|.)", "ig" ),
funescape = function( _, escaped, escapedWhitespace ) {
var high = "0x" + escaped - 0x10000;
// NaN means non-codepoint
// Support: Firefox<24
// Workaround erroneous numeric interpretation of +"0x"
return high !== high || escapedWhitespace ?
escaped :
high < 0 ?
// BMP codepoint
String.fromCharCode( high + 0x10000 ) :
// Supplemental Plane codepoint (surrogate pair)
String.fromCharCode( high >> 10 | 0xD800, high & 0x3FF | 0xDC00 );
},
// CSS string/identifier serialization
// https://drafts.csswg.org/cssom/#common-serializing-idioms
rcssescape = /([\0-\x1f\x7f]|^-?\d)|^-$|[^\0-\x1f\x7f-\uFFFF\w-]/g,
fcssescape = function( ch, asCodePoint ) {
if ( asCodePoint ) {
// U+0000 NULL becomes U+FFFD REPLACEMENT CHARACTER
if ( ch === "\0" ) {
return "\uFFFD";
}
// Control characters and (dependent upon position) numbers get escaped as code points
return ch.slice( 0, -1 ) + "\\" + ch.charCodeAt( ch.length - 1 ).toString( 16 ) + " ";
}
// Other potentially-special ASCII characters get backslash-escaped
return "\\" + ch;
},
// Used for iframes
// See setDocument()
// Removing the function wrapper causes a "Permission Denied"
// error in IE
unloadHandler = function() {
setDocument();
},
disabledAncestor = addCombinator(
function( elem ) {
return elem.disabled === true && ("form" in elem || "label" in elem);
},
{ dir: "parentNode", next: "legend" }
);
// Optimize for push.apply( _, NodeList )
try {
push.apply(
(arr = slice.call( preferredDoc.childNodes )),
preferredDoc.childNodes
);
// Support: Android<4.0
// Detect silently failing push.apply
arr[ preferredDoc.childNodes.length ].nodeType;
} catch ( e ) {
push = { apply: arr.length ?
// Leverage slice if possible
function( target, els ) {
push_native.apply( target, slice.call(els) );
} :
// Support: IE<9
// Otherwise append directly
function( target, els ) {
var j = target.length,
i = 0;
// Can't trust NodeList.length
while ( (target[j++] = els[i++]) ) {}
target.length = j - 1;
}
};
}
function Sizzle( selector, context, results, seed ) {
var m, i, elem, nid, match, groups, newSelector,
newContext = context && context.ownerDocument,
// nodeType defaults to 9, since context defaults to document
nodeType = context ? context.nodeType : 9;
results = results || [];
// Return early from calls with invalid selector or context
if ( typeof selector !== "string" || !selector ||
nodeType !== 1 && nodeType !== 9 && nodeType !== 11 ) {
return results;
}
// Try to shortcut find operations (as opposed to filters) in HTML documents
if ( !seed ) {
if ( ( context ? context.ownerDocument || context : preferredDoc ) !== document ) {
setDocument( context );
}
context = context || document;
if ( documentIsHTML ) {
// If the selector is sufficiently simple, try using a "get*By*" DOM method
// (excepting DocumentFragment context, where the methods don't exist)
if ( nodeType !== 11 && (match = rquickExpr.exec( selector )) ) {
// ID selector
if ( (m = match[1]) ) {
// Document context
if ( nodeType === 9 ) {
if ( (elem = context.getElementById( m )) ) {
// Support: IE, Opera, Webkit
// TODO: identify versions
// getElementById can match elements by name instead of ID
if ( elem.id === m ) {
results.push( elem );
return results;
}
} else {
return results;
}
// Element context
} else {
// Support: IE, Opera, Webkit
// TODO: identify versions
// getElementById can match elements by name instead of ID
if ( newContext && (elem = newContext.getElementById( m )) &&
contains( context, elem ) &&
elem.id === m ) {
results.push( elem );
return results;
}
}
// Type selector
} else if ( match[2] ) {
push.apply( results, context.getElementsByTagName( selector ) );
return results;
// Class selector
} else if ( (m = match[3]) && support.getElementsByClassName &&
context.getElementsByClassName ) {
push.apply( results, context.getElementsByClassName( m ) );
return results;
}
}
// Take advantage of querySelectorAll
if ( support.qsa &&
!compilerCache[ selector + " " ] &&
(!rbuggyQSA || !rbuggyQSA.test( selector )) ) {
if ( nodeType !== 1 ) {
newContext = context;
newSelector = selector;
// qSA looks outside Element context, which is not what we want
// Thanks to Andrew Dupont for this workaround technique
// Support: IE <=8
// Exclude object elements
} else if ( context.nodeName.toLowerCase() !== "object" ) {
// Capture the context ID, setting it first if necessary
if ( (nid = context.getAttribute( "id" )) ) {
nid = nid.replace( rcssescape, fcssescape );
} else {
context.setAttribute( "id", (nid = expando) );
}
// Prefix every selector in the list
groups = tokenize( selector );
i = groups.length;
while ( i-- ) {
groups[i] = "#" + nid + " " + toSelector( groups[i] );
}
newSelector = groups.join( "," );
// Expand context for sibling selectors
newContext = rsibling.test( selector ) && testContext( context.parentNode ) ||
context;
}
if ( newSelector ) {
try {
push.apply( results,
newContext.querySelectorAll( newSelector )
);
return results;
} catch ( qsaError ) {
} finally {
if ( nid === expando ) {
context.removeAttribute( "id" );
}
}
}
}
}
}
// All others
return select( selector.replace( rtrim, "$1" ), context, results, seed );
}
/**
* Create key-value caches of limited size
* @returns {function(string, object)} Returns the Object data after storing it on itself with
* property name the (space-suffixed) string and (if the cache is larger than Expr.cacheLength)
* deleting the oldest entry
*/
function createCache() {
var keys = [];
function cache( key, value ) {
// Use (key + " ") to avoid collision with native prototype properties (see Issue #157)
if ( keys.push( key + " " ) > Expr.cacheLength ) {
// Only keep the most recent entries
delete cache[ keys.shift() ];
}
return (cache[ key + " " ] = value);
}
return cache;
}
/**
* Mark a function for special use by Sizzle
* @param {Function} fn The function to mark
*/
function markFunction( fn ) {
fn[ expando ] = true;
return fn;
}
/**
* Support testing using an element
* @param {Function} fn Passed the created element and returns a boolean result
*/
function assert( fn ) {
var el = document.createElement("fieldset");
try {
return !!fn( el );
} catch (e) {
return false;
} finally {
// Remove from its parent by default
if ( el.parentNode ) {
el.parentNode.removeChild( el );
}
// release memory in IE
el = null;
}
}
/**
* Adds the same handler for all of the specified attrs
* @param {String} attrs Pipe-separated list of attributes
* @param {Function} handler The method that will be applied
*/
function addHandle( attrs, handler ) {
var arr = attrs.split("|"),
i = arr.length;
while ( i-- ) {
Expr.attrHandle[ arr[i] ] = handler;
}
}
/**
* Checks document order of two siblings
* @param {Element} a
* @param {Element} b
* @returns {Number} Returns less than 0 if a precedes b, greater than 0 if a follows b
*/
function siblingCheck( a, b ) {
var cur = b && a,
diff = cur && a.nodeType === 1 && b.nodeType === 1 &&
a.sourceIndex - b.sourceIndex;
// Use IE sourceIndex if available on both nodes
if ( diff ) {
return diff;
}
// Check if b follows a
if ( cur ) {
while ( (cur = cur.nextSibling) ) {
if ( cur === b ) {
return -1;
}
}
}
return a ? 1 : -1;
}
/**
* Returns a function to use in pseudos for input types
* @param {String} type
*/
function createInputPseudo( type ) {
return function( elem ) {
var name = elem.nodeName.toLowerCase();
return name === "input" && elem.type === type;
};
}
/**
* Returns a function to use in pseudos for buttons
* @param {String} type
*/
function createButtonPseudo( type ) {
return function( elem ) {
var name = elem.nodeName.toLowerCase();
return (name === "input" || name === "button") && elem.type === type;
};
}
/**
* Returns a function to use in pseudos for :enabled/:disabled
* @param {Boolean} disabled true for :disabled; false for :enabled
*/
function createDisabledPseudo( disabled ) {
// Known :disabled false positives: fieldset[disabled] > legend:nth-of-type(n+2) :can-disable
return function( elem ) {
// Only certain elements can match :enabled or :disabled
// https://html.spec.whatwg.org/multipage/scripting.html#selector-enabled
// https://html.spec.whatwg.org/multipage/scripting.html#selector-disabled
if ( "form" in elem ) {
// Check for inherited disabledness on relevant non-disabled elements:
// * listed form-associated elements in a disabled fieldset
// https://html.spec.whatwg.org/multipage/forms.html#category-listed
// https://html.spec.whatwg.org/multipage/forms.html#concept-fe-disabled
// * option elements in a disabled optgroup
// https://html.spec.whatwg.org/multipage/forms.html#concept-option-disabled
// All such elements have a "form" property.
if ( elem.parentNode && elem.disabled === false ) {
// Option elements defer to a parent optgroup if present
if ( "label" in elem ) {
if ( "label" in elem.parentNode ) {
return elem.parentNode.disabled === disabled;
} else {
return elem.disabled === disabled;
}
}
// Support: IE 6 - 11
// Use the isDisabled shortcut property to check for disabled fieldset ancestors
return elem.isDisabled === disabled ||
// Where there is no isDisabled, check manually
/* jshint -W018 */
elem.isDisabled !== !disabled &&
disabledAncestor( elem ) === disabled;
}
return elem.disabled === disabled;
// Try to winnow out elements that can't be disabled before trusting the disabled property.
// Some victims get caught in our net (label, legend, menu, track), but it shouldn't
// even exist on them, let alone have a boolean value.
} else if ( "label" in elem ) {
return elem.disabled === disabled;
}
// Remaining elements are neither :enabled nor :disabled
return false;
};
}
/**
* Returns a function to use in pseudos for positionals
* @param {Function} fn
*/
function createPositionalPseudo( fn ) {
return markFunction(function( argument ) {
argument = +argument;
return markFunction(function( seed, matches ) {
var j,
matchIndexes = fn( [], seed.length, argument ),
i = matchIndexes.length;
// Match elements found at the specified indexes
while ( i-- ) {
if ( seed[ (j = matchIndexes[i]) ] ) {
seed[j] = !(matches[j] = seed[j]);
}
}
});
});
}
/**
* Checks a node for validity as a Sizzle context
* @param {Element|Object=} context
* @returns {Element|Object|Boolean} The input node if acceptable, otherwise a falsy value
*/
function testContext( context ) {
return context && typeof context.getElementsByTagName !== "undefined" && context;
}
// Expose support vars for convenience
support = Sizzle.support = {};
/**
* Detects XML nodes
* @param {Element|Object} elem An element or a document
* @returns {Boolean} True iff elem is a non-HTML XML node
*/
isXML = Sizzle.isXML = function( elem ) {
// documentElement is verified for cases where it doesn't yet exist
// (such as loading iframes in IE - #4833)
var documentElement = elem && (elem.ownerDocument || elem).documentElement;
return documentElement ? documentElement.nodeName !== "HTML" : false;
};
/**
* Sets document-related variables once based on the current document
* @param {Element|Object} [doc] An element or document object to use to set the document
* @returns {Object} Returns the current document
*/
setDocument = Sizzle.setDocument = function( node ) {
var hasCompare, subWindow,
doc = node ? node.ownerDocument || node : preferredDoc;
// Return early if doc is invalid or already selected
if ( doc === document || doc.nodeType !== 9 || !doc.documentElement ) {
return document;
}
// Update global variables
document = doc;
docElem = document.documentElement;
documentIsHTML = !isXML( document );
// Support: IE 9-11, Edge
// Accessing iframe documents after unload throws "permission denied" errors (jQuery #13936)
if ( preferredDoc !== document &&
(subWindow = document.defaultView) && subWindow.top !== subWindow ) {
// Support: IE 11, Edge
if ( subWindow.addEventListener ) {
subWindow.addEventListener( "unload", unloadHandler, false );
// Support: IE 9 - 10 only
} else if ( subWindow.attachEvent ) {
subWindow.attachEvent( "onunload", unloadHandler );
}
}
/* Attributes
---------------------------------------------------------------------- */
// Support: IE<8
// Verify that getAttribute really returns attributes and not properties
// (excepting IE8 booleans)
support.attributes = assert(function( el ) {
el.className = "i";
return !el.getAttribute("className");
});
/* getElement(s)By*
---------------------------------------------------------------------- */
// Check if getElementsByTagName("*") returns only elements
support.getElementsByTagName = assert(function( el ) {
el.appendChild( document.createComment("") );
return !el.getElementsByTagName("*").length;
});
// Support: IE<9
support.getElementsByClassName = rnative.test( document.getElementsByClassName );
// Support: IE<10
// Check if getElementById returns elements by name
// The broken getElementById methods don't pick up programmatically-set names,
// so use a roundabout getElementsByName test
support.getById = assert(function( el ) {
docElem.appendChild( el ).id = expando;
return !document.getElementsByName || !document.getElementsByName( expando ).length;
});
// ID filter and find
if ( support.getById ) {
Expr.filter["ID"] = function( id ) {
var attrId = id.replace( runescape, funescape );
return function( elem ) {
return elem.getAttribute("id") === attrId;
};
};
Expr.find["ID"] = function( id, context ) {
if ( typeof context.getElementById !== "undefined" && documentIsHTML ) {
var elem = context.getElementById( id );
return elem ? [ elem ] : [];
}
};
} else {
Expr.filter["ID"] = function( id ) {
var attrId = id.replace( runescape, funescape );
return function( elem ) {
var node = typeof elem.getAttributeNode !== "undefined" &&
elem.getAttributeNode("id");
return node && node.value === attrId;
};
};
// Support: IE 6 - 7 only
// getElementById is not reliable as a find shortcut
Expr.find["ID"] = function( id, context ) {
if ( typeof context.getElementById !== "undefined" && documentIsHTML ) {
var node, i, elems,
elem = context.getElementById( id );
if ( elem ) {
// Verify the id attribute
node = elem.getAttributeNode("id");
if ( node && node.value === id ) {
return [ elem ];
}
// Fall back on getElementsByName
elems = context.getElementsByName( id );
i = 0;
while ( (elem = elems[i++]) ) {
node = elem.getAttributeNode("id");
if ( node && node.value === id ) {
return [ elem ];
}
}
}
return [];
}
};
}
// Tag
Expr.find["TAG"] = support.getElementsByTagName ?
function( tag, context ) {
if ( typeof context.getElementsByTagName !== "undefined" ) {
return context.getElementsByTagName( tag );
// DocumentFragment nodes don't have gEBTN
} else if ( support.qsa ) {
return context.querySelectorAll( tag );
}
} :
function( tag, context ) {
var elem,
tmp = [],
i = 0,
// By happy coincidence, a (broken) gEBTN appears on DocumentFragment nodes too
results = context.getElementsByTagName( tag );
// Filter out possible comments
if ( tag === "*" ) {
while ( (elem = results[i++]) ) {
if ( elem.nodeType === 1 ) {
tmp.push( elem );
}
}
return tmp;
}
return results;
};
// Class
Expr.find["CLASS"] = support.getElementsByClassName && function( className, context ) {
if ( typeof context.getElementsByClassName !== "undefined" && documentIsHTML ) {
return context.getElementsByClassName( className );
}
};
/* QSA/matchesSelector
---------------------------------------------------------------------- */
// QSA and matchesSelector support
// matchesSelector(:active) reports false when true (IE9/Opera 11.5)
rbuggyMatches = [];
// qSa(:focus) reports false when true (Chrome 21)
// We allow this because of a bug in IE8/9 that throws an error
// whenever `document.activeElement` is accessed on an iframe
// So, we allow :focus to pass through QSA all the time to avoid the IE error
// See https://bugs.jquery.com/ticket/13378
rbuggyQSA = [];
if ( (support.qsa = rnative.test( document.querySelectorAll )) ) {
// Build QSA regex
// Regex strategy adopted from Diego Perini
assert(function( el ) {
// Select is set to empty string on purpose
// This is to test IE's treatment of not explicitly
// setting a boolean content attribute,
// since its presence should be enough
// https://bugs.jquery.com/ticket/12359
docElem.appendChild( el ).innerHTML = "<a id='" + expando + "'></a>" +
"<select id='" + expando + "-\r\\' msallowcapture=''>" +
"<option selected=''></option></select>";
// Support: IE8, Opera 11-12.16
// Nothing should be selected when empty strings follow ^= or $= or *=
// The test attribute must be unknown in Opera but "safe" for WinRT
// https://msdn.microsoft.com/en-us/library/ie/hh465388.aspx#attribute_section
if ( el.querySelectorAll("[msallowcapture^='']").length ) {
rbuggyQSA.push( "[*^$]=" + whitespace + "*(?:''|\"\")" );
}
// Support: IE8
// Boolean attributes and "value" are not treated correctly
if ( !el.querySelectorAll("[selected]").length ) {
rbuggyQSA.push( "\\[" + whitespace + "*(?:value|" + booleans + ")" );
}
// Support: Chrome<29, Android<4.4, Safari<7.0+, iOS<7.0+, PhantomJS<1.9.8+
if ( !el.querySelectorAll( "[id~=" + expando + "-]" ).length ) {
rbuggyQSA.push("~=");
}
// Webkit/Opera - :checked should return selected option elements
// http://www.w3.org/TR/2011/REC-css3-selectors-20110929/#checked
// IE8 throws error here and will not see later tests
if ( !el.querySelectorAll(":checked").length ) {
rbuggyQSA.push(":checked");
}
// Support: Safari 8+, iOS 8+
// https://bugs.webkit.org/show_bug.cgi?id=136851
// In-page `selector#id sibling-combinator selector` fails
if ( !el.querySelectorAll( "a#" + expando + "+*" ).length ) {
rbuggyQSA.push(".#.+[+~]");
}
});
assert(function( el ) {
el.innerHTML = "<a href='' disabled='disabled'></a>" +
"<select disabled='disabled'><option/></select>";
// Support: Windows 8 Native Apps
// The type and name attributes are restricted during .innerHTML assignment
var input = document.createElement("input");
input.setAttribute( "type", "hidden" );
el.appendChild( input ).setAttribute( "name", "D" );
// Support: IE8
// Enforce case-sensitivity of name attribute
if ( el.querySelectorAll("[name=d]").length ) {
rbuggyQSA.push( "name" + whitespace + "*[*^$|!~]?=" );
}
// FF 3.5 - :enabled/:disabled and hidden elements (hidden elements are still enabled)
// IE8 throws error here and will not see later tests
if ( el.querySelectorAll(":enabled").length !== 2 ) {
rbuggyQSA.push( ":enabled", ":disabled" );
}
// Support: IE9-11+
// IE's :disabled selector does not pick up the children of disabled fieldsets
docElem.appendChild( el ).disabled = true;
if ( el.querySelectorAll(":disabled").length !== 2 ) {
rbuggyQSA.push( ":enabled", ":disabled" );
}
// Opera 10-11 does not throw on post-comma invalid pseudos
el.querySelectorAll("*,:x");
rbuggyQSA.push(",.*:");
});
}
if ( (support.matchesSelector = rnative.test( (matches = docElem.matches ||
docElem.webkitMatchesSelector ||
docElem.mozMatchesSelector ||
docElem.oMatchesSelector ||
docElem.msMatchesSelector) )) ) {
assert(function( el ) {
// Check to see if it's possible to do matchesSelector
// on a disconnected node (IE 9)
support.disconnectedMatch = matches.call( el, "*" );
// This should fail with an exception
// Gecko does not error, returns false instead
matches.call( el, "[s!='']:x" );
rbuggyMatches.push( "!=", pseudos );
});
}
rbuggyQSA = rbuggyQSA.length && new RegExp( rbuggyQSA.join("|") );
rbuggyMatches = rbuggyMatches.length && new RegExp( rbuggyMatches.join("|") );
/* Contains
---------------------------------------------------------------------- */
hasCompare = rnative.test( docElem.compareDocumentPosition );
// Element contains another
// Purposefully self-exclusive
// As in, an element does not contain itself
contains = hasCompare || rnative.test( docElem.contains ) ?
function( a, b ) {
var adown = a.nodeType === 9 ? a.documentElement : a,
bup = b && b.parentNode;
return a === bup || !!( bup && bup.nodeType === 1 && (
adown.contains ?
adown.contains( bup ) :
a.compareDocumentPosition && a.compareDocumentPosition( bup ) & 16
));
} :
function( a, b ) {
if ( b ) {
while ( (b = b.parentNode) ) {
if ( b === a ) {
return true;
}
}
}
return false;
};
/* Sorting
---------------------------------------------------------------------- */
// Document order sorting
sortOrder = hasCompare ?
function( a, b ) {
// Flag for duplicate removal
if ( a === b ) {
hasDuplicate = true;
return 0;
}
// Sort on method existence if only one input has compareDocumentPosition
var compare = !a.compareDocumentPosition - !b.compareDocumentPosition;
if ( compare ) {
return compare;
}
// Calculate position if both inputs belong to the same document
compare = ( a.ownerDocument || a ) === ( b.ownerDocument || b ) ?
a.compareDocumentPosition( b ) :
// Otherwise we know they are disconnected
1;
// Disconnected nodes
if ( compare & 1 ||
(!support.sortDetached && b.compareDocumentPosition( a ) === compare) ) {
// Choose the first element that is related to our preferred document
if ( a === document || a.ownerDocument === preferredDoc && contains(preferredDoc, a) ) {
return -1;
}
if ( b === document || b.ownerDocument === preferredDoc && contains(preferredDoc, b) ) {
return 1;
}
// Maintain original order
return sortInput ?
( indexOf( sortInput, a ) - indexOf( sortInput, b ) ) :
0;
}
return compare & 4 ? -1 : 1;
} :
function( a, b ) {
// Exit early if the nodes are identical
if ( a === b ) {
hasDuplicate = true;
return 0;
}
var cur,
i = 0,
aup = a.parentNode,
bup = b.parentNode,
ap = [ a ],
bp = [ b ];
// Parentless nodes are either documents or disconnected
if ( !aup || !bup ) {
return a === document ? -1 :
b === document ? 1 :
aup ? -1 :
bup ? 1 :
sortInput ?
( indexOf( sortInput, a ) - indexOf( sortInput, b ) ) :
0;
// If the nodes are siblings, we can do a quick check
} else if ( aup === bup ) {
return siblingCheck( a, b );
}
// Otherwise we need full lists of their ancestors for comparison
cur = a;
while ( (cur = cur.parentNode) ) {
ap.unshift( cur );
}
cur = b;
while ( (cur = cur.parentNode) ) {
bp.unshift( cur );
}
// Walk down the tree looking for a discrepancy
while ( ap[i] === bp[i] ) {
i++;
}
return i ?
// Do a sibling check if the nodes have a common ancestor
siblingCheck( ap[i], bp[i] ) :
// Otherwise nodes in our document sort first
ap[i] === preferredDoc ? -1 :
bp[i] === preferredDoc ? 1 :
0;
};
return document;
};
Sizzle.matches = function( expr, elements ) {
return Sizzle( expr, null, null, elements );
};
Sizzle.matchesSelector = function( elem, expr ) {
// Set document vars if needed
if ( ( elem.ownerDocument || elem ) !== document ) {
setDocument( elem );
}
// Make sure that attribute selectors are quoted
expr = expr.replace( rattributeQuotes, "='$1']" );
if ( support.matchesSelector && documentIsHTML &&
!compilerCache[ expr + " " ] &&
( !rbuggyMatches || !rbuggyMatches.test( expr ) ) &&
( !rbuggyQSA || !rbuggyQSA.test( expr ) ) ) {
try {
var ret = matches.call( elem, expr );
// IE 9's matchesSelector returns false on disconnected nodes
if ( ret || support.disconnectedMatch ||
// As well, disconnected nodes are said to be in a document
// fragment in IE 9
elem.document && elem.document.nodeType !== 11 ) {
return ret;
}
} catch (e) {}
}
return Sizzle( expr, document, null, [ elem ] ).length > 0;
};
Sizzle.contains = function( context, elem ) {
// Set document vars if needed
if ( ( context.ownerDocument || context ) !== document ) {
setDocument( context );
}
return contains( context, elem );
};
Sizzle.attr = function( elem, name ) {
// Set document vars if needed
if ( ( elem.ownerDocument || elem ) !== document ) {
setDocument( elem );
}
var fn = Expr.attrHandle[ name.toLowerCase() ],
// Don't get fooled by Object.prototype properties (jQuery #13807)
val = fn && hasOwn.call( Expr.attrHandle, name.toLowerCase() ) ?
fn( elem, name, !documentIsHTML ) :
undefined;
return val !== undefined ?
val :
support.attributes || !documentIsHTML ?
elem.getAttribute( name ) :
(val = elem.getAttributeNode(name)) && val.specified ?
val.value :
null;
};
Sizzle.escape = function( sel ) {
return (sel + "").replace( rcssescape, fcssescape );
};
Sizzle.error = function( msg ) {
throw new Error( "Syntax error, unrecognized expression: " + msg );
};
/**
* Document sorting and removing duplicates
* @param {ArrayLike} results
*/
Sizzle.uniqueSort = function( results ) {
var elem,
duplicates = [],
j = 0,
i = 0;
// Unless we *know* we can detect duplicates, assume their presence
hasDuplicate = !support.detectDuplicates;
sortInput = !support.sortStable && results.slice( 0 );
results.sort( sortOrder );
if ( hasDuplicate ) {
while ( (elem = results[i++]) ) {
if ( elem === results[ i ] ) {
j = duplicates.push( i );
}
}
while ( j-- ) {
results.splice( duplicates[ j ], 1 );
}
}
// Clear input after sorting to release objects
// See https://github.com/jquery/sizzle/pull/225
sortInput = null;
return results;
};
/**
* Utility function for retrieving the text value of an array of DOM nodes
* @param {Array|Element} elem
*/
getText = Sizzle.getText = function( elem ) {
var node,
ret = "",
i = 0,
nodeType = elem.nodeType;
if ( !nodeType ) {
// If no nodeType, this is expected to be an array
while ( (node = elem[i++]) ) {
// Do not traverse comment nodes
ret += getText( node );
}
} else if ( nodeType === 1 || nodeType === 9 || nodeType === 11 ) {
// Use textContent for elements
// innerText usage removed for consistency of new lines (jQuery #11153)
if ( typeof elem.textContent === "string" ) {
return elem.textContent;
} else {
// Traverse its children
for ( elem = elem.firstChild; elem; elem = elem.nextSibling ) {
ret += getText( elem );
}
}
} else if ( nodeType === 3 || nodeType === 4 ) {
return elem.nodeValue;
}
// Do not include comment or processing instruction nodes
return ret;
};
Expr = Sizzle.selectors = {
// Can be adjusted by the user
cacheLength: 50,
createPseudo: markFunction,
match: matchExpr,
attrHandle: {},
find: {},
relative: {
">": { dir: "parentNode", first: true },
" ": { dir: "parentNode" },
"+": { dir: "previousSibling", first: true },
"~": { dir: "previousSibling" }
},
preFilter: {
"ATTR": function( match ) {
match[1] = match[1].replace( runescape, funescape );
// Move the given value to match[3] whether quoted or unquoted
match[3] = ( match[3] || match[4] || match[5] || "" ).replace( runescape, funescape );
if ( match[2] === "~=" ) {
match[3] = " " + match[3] + " ";
}
return match.slice( 0, 4 );
},
"CHILD": function( match ) {
/* matches from matchExpr["CHILD"]
1 type (only|nth|...)
2 what (child|of-type)
3 argument (even|odd|\d*|\d*n([+-]\d+)?|...)
4 xn-component of xn+y argument ([+-]?\d*n|)
5 sign of xn-component
6 x of xn-component
7 sign of y-component
8 y of y-component
*/
match[1] = match[1].toLowerCase();
if ( match[1].slice( 0, 3 ) === "nth" ) {
// nth-* requires argument
if ( !match[3] ) {
Sizzle.error( match[0] );
}
// numeric x and y parameters for Expr.filter.CHILD
// remember that false/true cast respectively to 0/1
match[4] = +( match[4] ? match[5] + (match[6] || 1) : 2 * ( match[3] === "even" || match[3] === "odd" ) );
match[5] = +( ( match[7] + match[8] ) || match[3] === "odd" );
// other types prohibit arguments
} else if ( match[3] ) {
Sizzle.error( match[0] );
}
return match;
},
"PSEUDO": function( match ) {
var excess,
unquoted = !match[6] && match[2];
if ( matchExpr["CHILD"].test( match[0] ) ) {
return null;
}
// Accept quoted arguments as-is
if ( match[3] ) {
match[2] = match[4] || match[5] || "";
// Strip excess characters from unquoted arguments
} else if ( unquoted && rpseudo.test( unquoted ) &&
// Get excess from tokenize (recursively)
(excess = tokenize( unquoted, true )) &&
// advance to the next closing parenthesis
(excess = unquoted.indexOf( ")", unquoted.length - excess ) - unquoted.length) ) {
// excess is a negative index
match[0] = match[0].slice( 0, excess );
match[2] = unquoted.slice( 0, excess );
}
// Return only captures needed by the pseudo filter method (type and argument)
return match.slice( 0, 3 );
}
},
filter: {
"TAG": function( nodeNameSelector ) {
var nodeName = nodeNameSelector.replace( runescape, funescape ).toLowerCase();
return nodeNameSelector === "*" ?
function() { return true; } :
function( elem ) {
return elem.nodeName && elem.nodeName.toLowerCase() === nodeName;
};
},
"CLASS": function( className ) {
var pattern = classCache[ className + " " ];
return pattern ||
(pattern = new RegExp( "(^|" + whitespace + ")" + className + "(" + whitespace + "|$)" )) &&
classCache( className, function( elem ) {
return pattern.test( typeof elem.className === "string" && elem.className || typeof elem.getAttribute !== "undefined" && elem.getAttribute("class") || "" );
});
},
"ATTR": function( name, operator, check ) {
return function( elem ) {
var result = Sizzle.attr( elem, name );
if ( result == null ) {
return operator === "!=";
}
if ( !operator ) {
return true;
}
result += "";
return operator === "=" ? result === check :
operator === "!=" ? result !== check :
operator === "^=" ? check && result.indexOf( check ) === 0 :
operator === "*=" ? check && result.indexOf( check ) > -1 :
operator === "$=" ? check && result.slice( -check.length ) === check :
operator === "~=" ? ( " " + result.replace( rwhitespace, " " ) + " " ).indexOf( check ) > -1 :
operator === "|=" ? result === check || result.slice( 0, check.length + 1 ) === check + "-" :
false;
};
},
"CHILD": function( type, what, argument, first, last ) {
var simple = type.slice( 0, 3 ) !== "nth",
forward = type.slice( -4 ) !== "last",
ofType = what === "of-type";
return first === 1 && last === 0 ?
// Shortcut for :nth-*(n)
function( elem ) {
return !!elem.parentNode;
} :
function( elem, context, xml ) {
var cache, uniqueCache, outerCache, node, nodeIndex, start,
dir = simple !== forward ? "nextSibling" : "previousSibling",
parent = elem.parentNode,
name = ofType && elem.nodeName.toLowerCase(),
useCache = !xml && !ofType,
diff = false;
if ( parent ) {
// :(first|last|only)-(child|of-type)
if ( simple ) {
while ( dir ) {
node = elem;
while ( (node = node[ dir ]) ) {
if ( ofType ?
node.nodeName.toLowerCase() === name :
node.nodeType === 1 ) {
return false;
}
}
// Reverse direction for :only-* (if we haven't yet done so)
start = dir = type === "only" && !start && "nextSibling";
}
return true;
}
start = [ forward ? parent.firstChild : parent.lastChild ];
// non-xml :nth-child(...) stores cache data on `parent`
if ( forward && useCache ) {
// Seek `elem` from a previously-cached index
// ...in a gzip-friendly way
node = parent;
outerCache = node[ expando ] || (node[ expando ] = {});
// Support: IE <9 only
// Defend against cloned attroperties (jQuery gh-1709)
uniqueCache = outerCache[ node.uniqueID ] ||
(outerCache[ node.uniqueID ] = {});
cache = uniqueCache[ type ] || [];
nodeIndex = cache[ 0 ] === dirruns && cache[ 1 ];
diff = nodeIndex && cache[ 2 ];
node = nodeIndex && parent.childNodes[ nodeIndex ];
while ( (node = ++nodeIndex && node && node[ dir ] ||
// Fallback to seeking `elem` from the start
(diff = nodeIndex = 0) || start.pop()) ) {
// When found, cache indexes on `parent` and break
if ( node.nodeType === 1 && ++diff && node === elem ) {
uniqueCache[ type ] = [ dirruns, nodeIndex, diff ];
break;
}
}
} else {
// Use previously-cached element index if available
if ( useCache ) {
// ...in a gzip-friendly way
node = elem;
outerCache = node[ expando ] || (node[ expando ] = {});
// Support: IE <9 only
// Defend against cloned attroperties (jQuery gh-1709)
uniqueCache = outerCache[ node.uniqueID ] ||
(outerCache[ node.uniqueID ] = {});
cache = uniqueCache[ type ] || [];
nodeIndex = cache[ 0 ] === dirruns && cache[ 1 ];
diff = nodeIndex;
}
// xml :nth-child(...)
// or :nth-last-child(...) or :nth(-last)?-of-type(...)
if ( diff === false ) {
// Use the same loop as above to seek `elem` from the start
while ( (node = ++nodeIndex && node && node[ dir ] ||
(diff = nodeIndex = 0) || start.pop()) ) {
if ( ( ofType ?
node.nodeName.toLowerCase() === name :
node.nodeType === 1 ) &&
++diff ) {
// Cache the index of each encountered element
if ( useCache ) {
outerCache = node[ expando ] || (node[ expando ] = {});
// Support: IE <9 only
// Defend against cloned attroperties (jQuery gh-1709)
uniqueCache = outerCache[ node.uniqueID ] ||
(outerCache[ node.uniqueID ] = {});
uniqueCache[ type ] = [ dirruns, diff ];
}
if ( node === elem ) {
break;
}
}
}
}
}
// Incorporate the offset, then check against cycle size
diff -= last;
return diff === first || ( diff % first === 0 && diff / first >= 0 );
}
};
},
"PSEUDO": function( pseudo, argument ) {
// pseudo-class names are case-insensitive
// http://www.w3.org/TR/selectors/#pseudo-classes
// Prioritize by case sensitivity in case custom pseudos are added with uppercase letters
// Remember that setFilters inherits from pseudos
var args,
fn = Expr.pseudos[ pseudo ] || Expr.setFilters[ pseudo.toLowerCase() ] ||
Sizzle.error( "unsupported pseudo: " + pseudo );
// The user may use createPseudo to indicate that
// arguments are needed to create the filter function
// just as Sizzle does
if ( fn[ expando ] ) {
return fn( argument );
}
// But maintain support for old signatures
if ( fn.length > 1 ) {
args = [ pseudo, pseudo, "", argument ];
return Expr.setFilters.hasOwnProperty( pseudo.toLowerCase() ) ?
markFunction(function( seed, matches ) {
var idx,
matched = fn( seed, argument ),
i = matched.length;
while ( i-- ) {
idx = indexOf( seed, matched[i] );
seed[ idx ] = !( matches[ idx ] = matched[i] );
}
}) :
function( elem ) {
return fn( elem, 0, args );
};
}
return fn;
}
},
pseudos: {
// Potentially complex pseudos
"not": markFunction(function( selector ) {
// Trim the selector passed to compile
// to avoid treating leading and trailing
// spaces as combinators
var input = [],
results = [],
matcher = compile( selector.replace( rtrim, "$1" ) );
return matcher[ expando ] ?
markFunction(function( seed, matches, context, xml ) {
var elem,
unmatched = matcher( seed, null, xml, [] ),
i = seed.length;
// Match elements unmatched by `matcher`
while ( i-- ) {
if ( (elem = unmatched[i]) ) {
seed[i] = !(matches[i] = elem);
}
}
}) :
function( elem, context, xml ) {
input[0] = elem;
matcher( input, null, xml, results );
// Don't keep the element (issue #299)
input[0] = null;
return !results.pop();
};
}),
"has": markFunction(function( selector ) {
return function( elem ) {
return Sizzle( selector, elem ).length > 0;
};
}),
"contains": markFunction(function( text ) {
text = text.replace( runescape, funescape );
return function( elem ) {
return ( elem.textContent || elem.innerText || getText( elem ) ).indexOf( text ) > -1;
};
}),
// "Whether an element is represented by a :lang() selector
// is based solely on the element's language value
// being equal to the identifier C,
// or beginning with the identifier C immediately followed by "-".
// The matching of C against the element's language value is performed case-insensitively.
// The identifier C does not have to be a valid language name."
// http://www.w3.org/TR/selectors/#lang-pseudo
"lang": markFunction( function( lang ) {
// lang value must be a valid identifier
if ( !ridentifier.test(lang || "") ) {
Sizzle.error( "unsupported lang: " + lang );
}
lang = lang.replace( runescape, funescape ).toLowerCase();
return function( elem ) {
var elemLang;
do {
if ( (elemLang = documentIsHTML ?
elem.lang :
elem.getAttribute("xml:lang") || elem.getAttribute("lang")) ) {
elemLang = elemLang.toLowerCase();
return elemLang === lang || elemLang.indexOf( lang + "-" ) === 0;
}
} while ( (elem = elem.parentNode) && elem.nodeType === 1 );
return false;
};
}),
// Miscellaneous
"target": function( elem ) {
var hash = window.location && window.location.hash;
return hash && hash.slice( 1 ) === elem.id;
},
"root": function( elem ) {
return elem === docElem;
},
"focus": function( elem ) {
return elem === document.activeElement && (!document.hasFocus || document.hasFocus()) && !!(elem.type || elem.href || ~elem.tabIndex);
},
// Boolean properties
"enabled": createDisabledPseudo( false ),
"disabled": createDisabledPseudo( true ),
"checked": function( elem ) {
// In CSS3, :checked should return both checked and selected elements
// http://www.w3.org/TR/2011/REC-css3-selectors-20110929/#checked
var nodeName = elem.nodeName.toLowerCase();
return (nodeName === "input" && !!elem.checked) || (nodeName === "option" && !!elem.selected);
},
"selected": function( elem ) {
// Accessing this property makes selected-by-default
// options in Safari work properly
if ( elem.parentNode ) {
elem.parentNode.selectedIndex;
}
return elem.selected === true;
},
// Contents
"empty": function( elem ) {
// http://www.w3.org/TR/selectors/#empty-pseudo
// :empty is negated by element (1) or content nodes (text: 3; cdata: 4; entity ref: 5),
// but not by others (comment: 8; processing instruction: 7; etc.)
// nodeType < 6 works because attributes (2) do not appear as children
for ( elem = elem.firstChild; elem; elem = elem.nextSibling ) {
if ( elem.nodeType < 6 ) {
return false;
}
}
return true;
},
"parent": function( elem ) {
return !Expr.pseudos["empty"]( elem );
},
// Element/input types
"header": function( elem ) {
return rheader.test( elem.nodeName );
},
"input": function( elem ) {
return rinputs.test( elem.nodeName );
},
"button": function( elem ) {
var name = elem.nodeName.toLowerCase();
return name === "input" && elem.type === "button" || name === "button";
},
"text": function( elem ) {
var attr;
return elem.nodeName.toLowerCase() === "input" &&
elem.type === "text" &&
// Support: IE<8
// New HTML5 attribute values (e.g., "search") appear with elem.type === "text"
( (attr = elem.getAttribute("type")) == null || attr.toLowerCase() === "text" );
},
// Position-in-collection
"first": createPositionalPseudo(function() {
return [ 0 ];
}),
"last": createPositionalPseudo(function( matchIndexes, length ) {
return [ length - 1 ];
}),
"eq": createPositionalPseudo(function( matchIndexes, length, argument ) {
return [ argument < 0 ? argument + length : argument ];
}),
"even": createPositionalPseudo(function( matchIndexes, length ) {
var i = 0;
for ( ; i < length; i += 2 ) {
matchIndexes.push( i );
}
return matchIndexes;
}),
"odd": createPositionalPseudo(function( matchIndexes, length ) {
var i = 1;
for ( ; i < length; i += 2 ) {
matchIndexes.push( i );
}
return matchIndexes;
}),
"lt": createPositionalPseudo(function( matchIndexes, length, argument ) {
var i = argument < 0 ? argument + length : argument;
for ( ; --i >= 0; ) {
matchIndexes.push( i );
}
return matchIndexes;
}),
"gt": createPositionalPseudo(function( matchIndexes, length, argument ) {
var i = argument < 0 ? argument + length : argument;
for ( ; ++i < length; ) {
matchIndexes.push( i );
}
return matchIndexes;
})
}
};
Expr.pseudos["nth"] = Expr.pseudos["eq"];
// Add button/input type pseudos
for ( i in { radio: true, checkbox: true, file: true, password: true, image: true } ) {
Expr.pseudos[ i ] = createInputPseudo( i );
}
for ( i in { submit: true, reset: true } ) {
Expr.pseudos[ i ] = createButtonPseudo( i );
}
// Easy API for creating new setFilters
function setFilters() {}
setFilters.prototype = Expr.filters = Expr.pseudos;
Expr.setFilters = new setFilters();
tokenize = Sizzle.tokenize = function( selector, parseOnly ) {
var matched, match, tokens, type,
soFar, groups, preFilters,
cached = tokenCache[ selector + " " ];
if ( cached ) {
return parseOnly ? 0 : cached.slice( 0 );
}
soFar = selector;
groups = [];
preFilters = Expr.preFilter;
while ( soFar ) {
// Comma and first run
if ( !matched || (match = rcomma.exec( soFar )) ) {
if ( match ) {
// Don't consume trailing commas as valid
soFar = soFar.slice( match[0].length ) || soFar;
}
groups.push( (tokens = []) );
}
matched = false;
// Combinators
if ( (match = rcombinators.exec( soFar )) ) {
matched = match.shift();
tokens.push({
value: matched,
// Cast descendant combinators to space
type: match[0].replace( rtrim, " " )
});
soFar = soFar.slice( matched.length );
}
// Filters
for ( type in Expr.filter ) {
if ( (match = matchExpr[ type ].exec( soFar )) && (!preFilters[ type ] ||
(match = preFilters[ type ]( match ))) ) {
matched = match.shift();
tokens.push({
value: matched,
type: type,
matches: match
});
soFar = soFar.slice( matched.length );
}
}
if ( !matched ) {
break;
}
}
// Return the length of the invalid excess
// if we're just parsing
// Otherwise, throw an error or return tokens
return parseOnly ?
soFar.length :
soFar ?
Sizzle.error( selector ) :
// Cache the tokens
tokenCache( selector, groups ).slice( 0 );
};
function toSelector( tokens ) {
var i = 0,
len = tokens.length,
selector = "";
for ( ; i < len; i++ ) {
selector += tokens[i].value;
}
return selector;
}
function addCombinator( matcher, combinator, base ) {
var dir = combinator.dir,
skip = combinator.next,
key = skip || dir,
checkNonElements = base && key === "parentNode",
doneName = done++;
return combinator.first ?
// Check against closest ancestor/preceding element
function( elem, context, xml ) {
while ( (elem = elem[ dir ]) ) {
if ( elem.nodeType === 1 || checkNonElements ) {
return matcher( elem, context, xml );
}
}
return false;
} :
// Check against all ancestor/preceding elements
function( elem, context, xml ) {
var oldCache, uniqueCache, outerCache,
newCache = [ dirruns, doneName ];
// We can't set arbitrary data on XML nodes, so they don't benefit from combinator caching
if ( xml ) {
while ( (elem = elem[ dir ]) ) {
if ( elem.nodeType === 1 || checkNonElements ) {
if ( matcher( elem, context, xml ) ) {
return true;
}
}
}
} else {
while ( (elem = elem[ dir ]) ) {
if ( elem.nodeType === 1 || checkNonElements ) {
outerCache = elem[ expando ] || (elem[ expando ] = {});
// Support: IE <9 only
// Defend against cloned attroperties (jQuery gh-1709)
uniqueCache = outerCache[ elem.uniqueID ] || (outerCache[ elem.uniqueID ] = {});
if ( skip && skip === elem.nodeName.toLowerCase() ) {
elem = elem[ dir ] || elem;
} else if ( (oldCache = uniqueCache[ key ]) &&
oldCache[ 0 ] === dirruns && oldCache[ 1 ] === doneName ) {
// Assign to newCache so results back-propagate to previous elements
return (newCache[ 2 ] = oldCache[ 2 ]);
} else {
// Reuse newcache so results back-propagate to previous elements
uniqueCache[ key ] = newCache;
// A match means we're done; a fail means we have to keep checking
if ( (newCache[ 2 ] = matcher( elem, context, xml )) ) {
return true;
}
}
}
}
}
return false;
};
}
function elementMatcher( matchers ) {
return matchers.length > 1 ?
function( elem, context, xml ) {
var i = matchers.length;
while ( i-- ) {
if ( !matchers[i]( elem, context, xml ) ) {
return false;
}
}
return true;
} :
matchers[0];
}
function multipleContexts( selector, contexts, results ) {
var i = 0,
len = contexts.length;
for ( ; i < len; i++ ) {
Sizzle( selector, contexts[i], results );
}
return results;
}
function condense( unmatched, map, filter, context, xml ) {
var elem,
newUnmatched = [],
i = 0,
len = unmatched.length,
mapped = map != null;
for ( ; i < len; i++ ) {
if ( (elem = unmatched[i]) ) {
if ( !filter || filter( elem, context, xml ) ) {
newUnmatched.push( elem );
if ( mapped ) {
map.push( i );
}
}
}
}
return newUnmatched;
}
function setMatcher( preFilter, selector, matcher, postFilter, postFinder, postSelector ) {
if ( postFilter && !postFilter[ expando ] ) {
postFilter = setMatcher( postFilter );
}
if ( postFinder && !postFinder[ expando ] ) {
postFinder = setMatcher( postFinder, postSelector );
}
return markFunction(function( seed, results, context, xml ) {
var temp, i, elem,
preMap = [],
postMap = [],
preexisting = results.length,
// Get initial elements from seed or context
elems = seed || multipleContexts( selector || "*", context.nodeType ? [ context ] : context, [] ),
// Prefilter to get matcher input, preserving a map for seed-results synchronization
matcherIn = preFilter && ( seed || !selector ) ?
condense( elems, preMap, preFilter, context, xml ) :
elems,
matcherOut = matcher ?
// If we have a postFinder, or filtered seed, or non-seed postFilter or preexisting results,
postFinder || ( seed ? preFilter : preexisting || postFilter ) ?
// ...intermediate processing is necessary
[] :
// ...otherwise use results directly
results :
matcherIn;
// Find primary matches
if ( matcher ) {
matcher( matcherIn, matcherOut, context, xml );
}
// Apply postFilter
if ( postFilter ) {
temp = condense( matcherOut, postMap );
postFilter( temp, [], context, xml );
// Un-match failing elements by moving them back to matcherIn
i = temp.length;
while ( i-- ) {
if ( (elem = temp[i]) ) {
matcherOut[ postMap[i] ] = !(matcherIn[ postMap[i] ] = elem);
}
}
}
if ( seed ) {
if ( postFinder || preFilter ) {
if ( postFinder ) {
// Get the final matcherOut by condensing this intermediate into postFinder contexts
temp = [];
i = matcherOut.length;
while ( i-- ) {
if ( (elem = matcherOut[i]) ) {
// Restore matcherIn since elem is not yet a final match
temp.push( (matcherIn[i] = elem) );
}
}
postFinder( null, (matcherOut = []), temp, xml );
}
// Move matched elements from seed to results to keep them synchronized
i = matcherOut.length;
while ( i-- ) {
if ( (elem = matcherOut[i]) &&
(temp = postFinder ? indexOf( seed, elem ) : preMap[i]) > -1 ) {
seed[temp] = !(results[temp] = elem);
}
}
}
// Add elements to results, through postFinder if defined
} else {
matcherOut = condense(
matcherOut === results ?
matcherOut.splice( preexisting, matcherOut.length ) :
matcherOut
);
if ( postFinder ) {
postFinder( null, results, matcherOut, xml );
} else {
push.apply( results, matcherOut );
}
}
});
}
function matcherFromTokens( tokens ) {
var checkContext, matcher, j,
len = tokens.length,
leadingRelative = Expr.relative[ tokens[0].type ],
implicitRelative = leadingRelative || Expr.relative[" "],
i = leadingRelative ? 1 : 0,
// The foundational matcher ensures that elements are reachable from top-level context(s)
matchContext = addCombinator( function( elem ) {
return elem === checkContext;
}, implicitRelative, true ),
matchAnyContext = addCombinator( function( elem ) {
return indexOf( checkContext, elem ) > -1;
}, implicitRelative, true ),
matchers = [ function( elem, context, xml ) {
var ret = ( !leadingRelative && ( xml || context !== outermostContext ) ) || (
(checkContext = context).nodeType ?
matchContext( elem, context, xml ) :
matchAnyContext( elem, context, xml ) );
// Avoid hanging onto element (issue #299)
checkContext = null;
return ret;
} ];
for ( ; i < len; i++ ) {
if ( (matcher = Expr.relative[ tokens[i].type ]) ) {
matchers = [ addCombinator(elementMatcher( matchers ), matcher) ];
} else {
matcher = Expr.filter[ tokens[i].type ].apply( null, tokens[i].matches );
// Return special upon seeing a positional matcher
if ( matcher[ expando ] ) {
// Find the next relative operator (if any) for proper handling
j = ++i;
for ( ; j < len; j++ ) {
if ( Expr.relative[ tokens[j].type ] ) {
break;
}
}
return setMatcher(
i > 1 && elementMatcher( matchers ),
i > 1 && toSelector(
// If the preceding token was a descendant combinator, insert an implicit any-element `*`
tokens.slice( 0, i - 1 ).concat({ value: tokens[ i - 2 ].type === " " ? "*" : "" })
).replace( rtrim, "$1" ),
matcher,
i < j && matcherFromTokens( tokens.slice( i, j ) ),
j < len && matcherFromTokens( (tokens = tokens.slice( j )) ),
j < len && toSelector( tokens )
);
}
matchers.push( matcher );
}
}
return elementMatcher( matchers );
}
function matcherFromGroupMatchers( elementMatchers, setMatchers ) {
var bySet = setMatchers.length > 0,
byElement = elementMatchers.length > 0,
superMatcher = function( seed, context, xml, results, outermost ) {
var elem, j, matcher,
matchedCount = 0,
i = "0",
unmatched = seed && [],
setMatched = [],
contextBackup = outermostContext,
// We must always have either seed elements or outermost context
elems = seed || byElement && Expr.find["TAG"]( "*", outermost ),
// Use integer dirruns iff this is the outermost matcher
dirrunsUnique = (dirruns += contextBackup == null ? 1 : Math.random() || 0.1),
len = elems.length;
if ( outermost ) {
outermostContext = context === document || context || outermost;
}
// Add elements passing elementMatchers directly to results
// Support: IE<9, Safari
// Tolerate NodeList properties (IE: "length"; Safari: <number>) matching elements by id
for ( ; i !== len && (elem = elems[i]) != null; i++ ) {
if ( byElement && elem ) {
j = 0;
if ( !context && elem.ownerDocument !== document ) {
setDocument( elem );
xml = !documentIsHTML;
}
while ( (matcher = elementMatchers[j++]) ) {
if ( matcher( elem, context || document, xml) ) {
results.push( elem );
break;
}
}
if ( outermost ) {
dirruns = dirrunsUnique;
}
}
// Track unmatched elements for set filters
if ( bySet ) {
// They will have gone through all possible matchers
if ( (elem = !matcher && elem) ) {
matchedCount--;
}
// Lengthen the array for every element, matched or not
if ( seed ) {
unmatched.push( elem );
}
}
}
// `i` is now the count of elements visited above, and adding it to `matchedCount`
// makes the latter nonnegative.
matchedCount += i;
// Apply set filters to unmatched elements
// NOTE: This can be skipped if there are no unmatched elements (i.e., `matchedCount`
// equals `i`), unless we didn't visit _any_ elements in the above loop because we have
// no element matchers and no seed.
// Incrementing an initially-string "0" `i` allows `i` to remain a string only in that
// case, which will result in a "00" `matchedCount` that differs from `i` but is also
// numerically zero.
if ( bySet && i !== matchedCount ) {
j = 0;
while ( (matcher = setMatchers[j++]) ) {
matcher( unmatched, setMatched, context, xml );
}
if ( seed ) {
// Reintegrate element matches to eliminate the need for sorting
if ( matchedCount > 0 ) {
while ( i-- ) {
if ( !(unmatched[i] || setMatched[i]) ) {
setMatched[i] = pop.call( results );
}
}
}
// Discard index placeholder values to get only actual matches
setMatched = condense( setMatched );
}
// Add matches to results
push.apply( results, setMatched );
// Seedless set matches succeeding multiple successful matchers stipulate sorting
if ( outermost && !seed && setMatched.length > 0 &&
( matchedCount + setMatchers.length ) > 1 ) {
Sizzle.uniqueSort( results );
}
}
// Override manipulation of globals by nested matchers
if ( outermost ) {
dirruns = dirrunsUnique;
outermostContext = contextBackup;
}
return unmatched;
};
return bySet ?
markFunction( superMatcher ) :
superMatcher;
}
compile = Sizzle.compile = function( selector, match /* Internal Use Only */ ) {
var i,
setMatchers = [],
elementMatchers = [],
cached = compilerCache[ selector + " " ];
if ( !cached ) {
// Generate a function of recursive functions that can be used to check each element
if ( !match ) {
match = tokenize( selector );
}
i = match.length;
while ( i-- ) {
cached = matcherFromTokens( match[i] );
if ( cached[ expando ] ) {
setMatchers.push( cached );
} else {
elementMatchers.push( cached );
}
}
// Cache the compiled function
cached = compilerCache( selector, matcherFromGroupMatchers( elementMatchers, setMatchers ) );
// Save selector and tokenization
cached.selector = selector;
}
return cached;
};
/**
* A low-level selection function that works with Sizzle's compiled
* selector functions
* @param {String|Function} selector A selector or a pre-compiled
* selector function built with Sizzle.compile
* @param {Element} context
* @param {Array} [results]
* @param {Array} [seed] A set of elements to match against
*/
select = Sizzle.select = function( selector, context, results, seed ) {
var i, tokens, token, type, find,
compiled = typeof selector === "function" && selector,
match = !seed && tokenize( (selector = compiled.selector || selector) );
results = results || [];
// Try to minimize operations if there is only one selector in the list and no seed
// (the latter of which guarantees us context)
if ( match.length === 1 ) {
// Reduce context if the leading compound selector is an ID
tokens = match[0] = match[0].slice( 0 );
if ( tokens.length > 2 && (token = tokens[0]).type === "ID" &&
context.nodeType === 9 && documentIsHTML && Expr.relative[ tokens[1].type ] ) {
context = ( Expr.find["ID"]( token.matches[0].replace(runescape, funescape), context ) || [] )[0];
if ( !context ) {
return results;
// Precompiled matchers will still verify ancestry, so step up a level
} else if ( compiled ) {
context = context.parentNode;
}
selector = selector.slice( tokens.shift().value.length );
}
// Fetch a seed set for right-to-left matching
i = matchExpr["needsContext"].test( selector ) ? 0 : tokens.length;
while ( i-- ) {
token = tokens[i];
// Abort if we hit a combinator
if ( Expr.relative[ (type = token.type) ] ) {
break;
}
if ( (find = Expr.find[ type ]) ) {
// Search, expanding context for leading sibling combinators
if ( (seed = find(
token.matches[0].replace( runescape, funescape ),
rsibling.test( tokens[0].type ) && testContext( context.parentNode ) || context
)) ) {
// If seed is empty or no tokens remain, we can return early
tokens.splice( i, 1 );
selector = seed.length && toSelector( tokens );
if ( !selector ) {
push.apply( results, seed );
return results;
}
break;
}
}
}
}
// Compile and execute a filtering function if one is not provided
// Provide `match` to avoid retokenization if we modified the selector above
( compiled || compile( selector, match ) )(
seed,
context,
!documentIsHTML,
results,
!context || rsibling.test( selector ) && testContext( context.parentNode ) || context
);
return results;
};
// One-time assignments
// Sort stability
support.sortStable = expando.split("").sort( sortOrder ).join("") === expando;
// Support: Chrome 14-35+
// Always assume duplicates if they aren't passed to the comparison function
support.detectDuplicates = !!hasDuplicate;
// Initialize against the default document
setDocument();
// Support: Webkit<537.32 - Safari 6.0.3/Chrome 25 (fixed in Chrome 27)
// Detached nodes confoundingly follow *each other*
support.sortDetached = assert(function( el ) {
// Should return 1, but returns 4 (following)
return el.compareDocumentPosition( document.createElement("fieldset") ) & 1;
});
// Support: IE<8
// Prevent attribute/property "interpolation"
// https://msdn.microsoft.com/en-us/library/ms536429%28VS.85%29.aspx
if ( !assert(function( el ) {
el.innerHTML = "<a href='#'></a>";
return el.firstChild.getAttribute("href") === "#" ;
}) ) {
addHandle( "type|href|height|width", function( elem, name, isXML ) {
if ( !isXML ) {
return elem.getAttribute( name, name.toLowerCase() === "type" ? 1 : 2 );
}
});
}
// Support: IE<9
// Use defaultValue in place of getAttribute("value")
if ( !support.attributes || !assert(function( el ) {
el.innerHTML = "<input/>";
el.firstChild.setAttribute( "value", "" );
return el.firstChild.getAttribute( "value" ) === "";
}) ) {
addHandle( "value", function( elem, name, isXML ) {
if ( !isXML && elem.nodeName.toLowerCase() === "input" ) {
return elem.defaultValue;
}
});
}
// Support: IE<9
// Use getAttributeNode to fetch booleans when getAttribute lies
if ( !assert(function( el ) {
return el.getAttribute("disabled") == null;
}) ) {
addHandle( booleans, function( elem, name, isXML ) {
var val;
if ( !isXML ) {
return elem[ name ] === true ? name.toLowerCase() :
(val = elem.getAttributeNode( name )) && val.specified ?
val.value :
null;
}
});
}
return Sizzle;
})( window );
jQuery.find = Sizzle;
jQuery.expr = Sizzle.selectors;
// Deprecated
jQuery.expr[ ":" ] = jQuery.expr.pseudos;
jQuery.uniqueSort = jQuery.unique = Sizzle.uniqueSort;
jQuery.text = Sizzle.getText;
jQuery.isXMLDoc = Sizzle.isXML;
jQuery.contains = Sizzle.contains;
jQuery.escapeSelector = Sizzle.escape;
var dir = function( elem, dir, until ) {
var matched = [],
truncate = until !== undefined;
while ( ( elem = elem[ dir ] ) && elem.nodeType !== 9 ) {
if ( elem.nodeType === 1 ) {
if ( truncate && jQuery( elem ).is( until ) ) {
break;
}
matched.push( elem );
}
}
return matched;
};
var siblings = function( n, elem ) {
var matched = [];
for ( ; n; n = n.nextSibling ) {
if ( n.nodeType === 1 && n !== elem ) {
matched.push( n );
}
}
return matched;
};
var rneedsContext = jQuery.expr.match.needsContext;
var rsingleTag = ( /^<([a-z][^\/\0>:\x20\t\r\n\f]*)[\x20\t\r\n\f]*\/?>(?:<\/\1>|)$/i );
var risSimple = /^.[^:#\[\.,]*$/;
// Implement the identical functionality for filter and not
function winnow( elements, qualifier, not ) {
if ( jQuery.isFunction( qualifier ) ) {
return jQuery.grep( elements, function( elem, i ) {
return !!qualifier.call( elem, i, elem ) !== not;
} );
}
// Single element
if ( qualifier.nodeType ) {
return jQuery.grep( elements, function( elem ) {
return ( elem === qualifier ) !== not;
} );
}
// Arraylike of elements (jQuery, arguments, Array)
if ( typeof qualifier !== "string" ) {
return jQuery.grep( elements, function( elem ) {
return ( indexOf.call( qualifier, elem ) > -1 ) !== not;
} );
}
// Simple selector that can be filtered directly, removing non-Elements
if ( risSimple.test( qualifier ) ) {
return jQuery.filter( qualifier, elements, not );
}
// Complex selector, compare the two sets, removing non-Elements
qualifier = jQuery.filter( qualifier, elements );
return jQuery.grep( elements, function( elem ) {
return ( indexOf.call( qualifier, elem ) > -1 ) !== not && elem.nodeType === 1;
} );
}
jQuery.filter = function( expr, elems, not ) {
var elem = elems[ 0 ];
if ( not ) {
expr = ":not(" + expr + ")";
}
if ( elems.length === 1 && elem.nodeType === 1 ) {
return jQuery.find.matchesSelector( elem, expr ) ? [ elem ] : [];
}
return jQuery.find.matches( expr, jQuery.grep( elems, function( elem ) {
return elem.nodeType === 1;
} ) );
};
jQuery.fn.extend( {
find: function( selector ) {
var i, ret,
len = this.length,
self = this;
if ( typeof selector !== "string" ) {
return this.pushStack( jQuery( selector ).filter( function() {
for ( i = 0; i < len; i++ ) {
if ( jQuery.contains( self[ i ], this ) ) {
return true;
}
}
} ) );
}
ret = this.pushStack( [] );
for ( i = 0; i < len; i++ ) {
jQuery.find( selector, self[ i ], ret );
}
return len > 1 ? jQuery.uniqueSort( ret ) : ret;
},
filter: function( selector ) {
return this.pushStack( winnow( this, selector || [], false ) );
},
not: function( selector ) {
return this.pushStack( winnow( this, selector || [], true ) );
},
is: function( selector ) {
return !!winnow(
this,
// If this is a positional/relative selector, check membership in the returned set
// so $("p:first").is("p:last") won't return true for a doc with two "p".
typeof selector === "string" && rneedsContext.test( selector ) ?
jQuery( selector ) :
selector || [],
false
).length;
}
} );
// Initialize a jQuery object
// A central reference to the root jQuery(document)
var rootjQuery,
// A simple way to check for HTML strings
// Prioritize #id over <tag> to avoid XSS via location.hash (#9521)
// Strict HTML recognition (#11290: must start with <)
// Shortcut simple #id case for speed
rquickExpr = /^(?:\s*(<[\w\W]+>)[^>]*|#([\w-]+))$/,
init = jQuery.fn.init = function( selector, context, root ) {
var match, elem;
// HANDLE: $(""), $(null), $(undefined), $(false)
if ( !selector ) {
return this;
}
// Method init() accepts an alternate rootjQuery
// so migrate can support jQuery.sub (gh-2101)
root = root || rootjQuery;
// Handle HTML strings
if ( typeof selector === "string" ) {
if ( selector[ 0 ] === "<" &&
selector[ selector.length - 1 ] === ">" &&
selector.length >= 3 ) {
// Assume that strings that start and end with <> are HTML and skip the regex check
match = [ null, selector, null ];
} else {
match = rquickExpr.exec( selector );
}
// Match html or make sure no context is specified for #id
if ( match && ( match[ 1 ] || !context ) ) {
// HANDLE: $(html) -> $(array)
if ( match[ 1 ] ) {
context = context instanceof jQuery ? context[ 0 ] : context;
// Option to run scripts is true for back-compat
// Intentionally let the error be thrown if parseHTML is not present
jQuery.merge( this, jQuery.parseHTML(
match[ 1 ],
context && context.nodeType ? context.ownerDocument || context : document,
true
) );
// HANDLE: $(html, props)
if ( rsingleTag.test( match[ 1 ] ) && jQuery.isPlainObject( context ) ) {
for ( match in context ) {
// Properties of context are called as methods if possible
if ( jQuery.isFunction( this[ match ] ) ) {
this[ match ]( context[ match ] );
// ...and otherwise set as attributes
} else {
this.attr( match, context[ match ] );
}
}
}
return this;
// HANDLE: $(#id)
} else {
elem = document.getElementById( match[ 2 ] );
if ( elem ) {
// Inject the element directly into the jQuery object
this[ 0 ] = elem;
this.length = 1;
}
return this;
}
// HANDLE: $(expr, $(...))
} else if ( !context || context.jquery ) {
return ( context || root ).find( selector );
// HANDLE: $(expr, context)
// (which is just equivalent to: $(context).find(expr)
} else {
return this.constructor( context ).find( selector );
}
// HANDLE: $(DOMElement)
} else if ( selector.nodeType ) {
this[ 0 ] = selector;
this.length = 1;
return this;
// HANDLE: $(function)
// Shortcut for document ready
} else if ( jQuery.isFunction( selector ) ) {
return root.ready !== undefined ?
root.ready( selector ) :
// Execute immediately if ready is not present
selector( jQuery );
}
return jQuery.makeArray( selector, this );
};
// Give the init function the jQuery prototype for later instantiation
init.prototype = jQuery.fn;
// Initialize central reference
rootjQuery = jQuery( document );
var rparentsprev = /^(?:parents|prev(?:Until|All))/,
// Methods guaranteed to produce a unique set when starting from a unique set
guaranteedUnique = {
children: true,
contents: true,
next: true,
prev: true
};
jQuery.fn.extend( {
has: function( target ) {
var targets = jQuery( target, this ),
l = targets.length;
return this.filter( function() {
var i = 0;
for ( ; i < l; i++ ) {
if ( jQuery.contains( this, targets[ i ] ) ) {
return true;
}
}
} );
},
closest: function( selectors, context ) {
var cur,
i = 0,
l = this.length,
matched = [],
targets = typeof selectors !== "string" && jQuery( selectors );
// Positional selectors never match, since there's no _selection_ context
if ( !rneedsContext.test( selectors ) ) {
for ( ; i < l; i++ ) {
for ( cur = this[ i ]; cur && cur !== context; cur = cur.parentNode ) {
// Always skip document fragments
if ( cur.nodeType < 11 && ( targets ?
targets.index( cur ) > -1 :
// Don't pass non-elements to Sizzle
cur.nodeType === 1 &&
jQuery.find.matchesSelector( cur, selectors ) ) ) {
matched.push( cur );
break;
}
}
}
}
return this.pushStack( matched.length > 1 ? jQuery.uniqueSort( matched ) : matched );
},
// Determine the position of an element within the set
index: function( elem ) {
// No argument, return index in parent
if ( !elem ) {
return ( this[ 0 ] && this[ 0 ].parentNode ) ? this.first().prevAll().length : -1;
}
// Index in selector
if ( typeof elem === "string" ) {
return indexOf.call( jQuery( elem ), this[ 0 ] );
}
// Locate the position of the desired element
return indexOf.call( this,
// If it receives a jQuery object, the first element is used
elem.jquery ? elem[ 0 ] : elem
);
},
add: function( selector, context ) {
return this.pushStack(
jQuery.uniqueSort(
jQuery.merge( this.get(), jQuery( selector, context ) )
)
);
},
addBack: function( selector ) {
return this.add( selector == null ?
this.prevObject : this.prevObject.filter( selector )
);
}
} );
function sibling( cur, dir ) {
while ( ( cur = cur[ dir ] ) && cur.nodeType !== 1 ) {}
return cur;
}
jQuery.each( {
parent: function( elem ) {
var parent = elem.parentNode;
return parent && parent.nodeType !== 11 ? parent : null;
},
parents: function( elem ) {
return dir( elem, "parentNode" );
},
parentsUntil: function( elem, i, until ) {
return dir( elem, "parentNode", until );
},
next: function( elem ) {
return sibling( elem, "nextSibling" );
},
prev: function( elem ) {
return sibling( elem, "previousSibling" );
},
nextAll: function( elem ) {
return dir( elem, "nextSibling" );
},
prevAll: function( elem ) {
return dir( elem, "previousSibling" );
},
nextUntil: function( elem, i, until ) {
return dir( elem, "nextSibling", until );
},
prevUntil: function( elem, i, until ) {
return dir( elem, "previousSibling", until );
},
siblings: function( elem ) {
return siblings( ( elem.parentNode || {} ).firstChild, elem );
},
children: function( elem ) {
return siblings( elem.firstChild );
},
contents: function( elem ) {
return elem.contentDocument || jQuery.merge( [], elem.childNodes );
}
}, function( name, fn ) {
jQuery.fn[ name ] = function( until, selector ) {
var matched = jQuery.map( this, fn, until );
if ( name.slice( -5 ) !== "Until" ) {
selector = until;
}
if ( selector && typeof selector === "string" ) {
matched = jQuery.filter( selector, matched );
}
if ( this.length > 1 ) {
// Remove duplicates
if ( !guaranteedUnique[ name ] ) {
jQuery.uniqueSort( matched );
}
// Reverse order for parents* and prev-derivatives
if ( rparentsprev.test( name ) ) {
matched.reverse();
}
}
return this.pushStack( matched );
};
} );
var rnothtmlwhite = ( /[^\x20\t\r\n\f]+/g );
// Convert String-formatted options into Object-formatted ones
function createOptions( options ) {
var object = {};
jQuery.each( options.match( rnothtmlwhite ) || [], function( _, flag ) {
object[ flag ] = true;
} );
return object;
}
/*
* Create a callback list using the following parameters:
*
* options: an optional list of space-separated options that will change how
* the callback list behaves or a more traditional option object
*
* By default a callback list will act like an event callback list and can be
* "fired" multiple times.
*
* Possible options:
*
* once: will ensure the callback list can only be fired once (like a Deferred)
*
* memory: will keep track of previous values and will call any callback added
* after the list has been fired right away with the latest "memorized"
* values (like a Deferred)
*
* unique: will ensure a callback can only be added once (no duplicate in the list)
*
* stopOnFalse: interrupt callings when a callback returns false
*
*/
jQuery.Callbacks = function( options ) {
// Convert options from String-formatted to Object-formatted if needed
// (we check in cache first)
options = typeof options === "string" ?
createOptions( options ) :
jQuery.extend( {}, options );
var // Flag to know if list is currently firing
firing,
// Last fire value for non-forgettable lists
memory,
// Flag to know if list was already fired
fired,
// Flag to prevent firing
locked,
// Actual callback list
list = [],
// Queue of execution data for repeatable lists
queue = [],
// Index of currently firing callback (modified by add/remove as needed)
firingIndex = -1,
// Fire callbacks
fire = function() {
// Enforce single-firing
locked = options.once;
// Execute callbacks for all pending executions,
// respecting firingIndex overrides and runtime changes
fired = firing = true;
for ( ; queue.length; firingIndex = -1 ) {
memory = queue.shift();
while ( ++firingIndex < list.length ) {
// Run callback and check for early termination
if ( list[ firingIndex ].apply( memory[ 0 ], memory[ 1 ] ) === false &&
options.stopOnFalse ) {
// Jump to end and forget the data so .add doesn't re-fire
firingIndex = list.length;
memory = false;
}
}
}
// Forget the data if we're done with it
if ( !options.memory ) {
memory = false;
}
firing = false;
// Clean up if we're done firing for good
if ( locked ) {
// Keep an empty list if we have data for future add calls
if ( memory ) {
list = [];
// Otherwise, this object is spent
} else {
list = "";
}
}
},
// Actual Callbacks object
self = {
// Add a callback or a collection of callbacks to the list
add: function() {
if ( list ) {
// If we have memory from a past run, we should fire after adding
if ( memory && !firing ) {
firingIndex = list.length - 1;
queue.push( memory );
}
( function add( args ) {
jQuery.each( args, function( _, arg ) {
if ( jQuery.isFunction( arg ) ) {
if ( !options.unique || !self.has( arg ) ) {
list.push( arg );
}
} else if ( arg && arg.length && jQuery.type( arg ) !== "string" ) {
// Inspect recursively
add( arg );
}
} );
} )( arguments );
if ( memory && !firing ) {
fire();
}
}
return this;
},
// Remove a callback from the list
remove: function() {
jQuery.each( arguments, function( _, arg ) {
var index;
while ( ( index = jQuery.inArray( arg, list, index ) ) > -1 ) {
list.splice( index, 1 );
// Handle firing indexes
if ( index <= firingIndex ) {
firingIndex--;
}
}
} );
return this;
},
// Check if a given callback is in the list.
// If no argument is given, return whether or not list has callbacks attached.
has: function( fn ) {
return fn ?
jQuery.inArray( fn, list ) > -1 :
list.length > 0;
},
// Remove all callbacks from the list
empty: function() {
if ( list ) {
list = [];
}
return this;
},
// Disable .fire and .add
// Abort any current/pending executions
// Clear all callbacks and values
disable: function() {
locked = queue = [];
list = memory = "";
return this;
},
disabled: function() {
return !list;
},
// Disable .fire
// Also disable .add unless we have memory (since it would have no effect)
// Abort any pending executions
lock: function() {
locked = queue = [];
if ( !memory && !firing ) {
list = memory = "";
}
return this;
},
locked: function() {
return !!locked;
},
// Call all callbacks with the given context and arguments
fireWith: function( context, args ) {
if ( !locked ) {
args = args || [];
args = [ context, args.slice ? args.slice() : args ];
queue.push( args );
if ( !firing ) {
fire();
}
}
return this;
},
// Call all the callbacks with the given arguments
fire: function() {
self.fireWith( this, arguments );
return this;
},
// To know if the callbacks have already been called at least once
fired: function() {
return !!fired;
}
};
return self;
};
function Identity( v ) {
return v;
}
function Thrower( ex ) {
throw ex;
}
function adoptValue( value, resolve, reject ) {
var method;
try {
// Check for promise aspect first to privilege synchronous behavior
if ( value && jQuery.isFunction( ( method = value.promise ) ) ) {
method.call( value ).done( resolve ).fail( reject );
// Other thenables
} else if ( value && jQuery.isFunction( ( method = value.then ) ) ) {
method.call( value, resolve, reject );
// Other non-thenables
} else {
// Support: Android 4.0 only
// Strict mode functions invoked without .call/.apply get global-object context
resolve.call( undefined, value );
}
// For Promises/A+, convert exceptions into rejections
// Since jQuery.when doesn't unwrap thenables, we can skip the extra checks appearing in
// Deferred#then to conditionally suppress rejection.
} catch ( value ) {
// Support: Android 4.0 only
// Strict mode functions invoked without .call/.apply get global-object context
reject.call( undefined, value );
}
}
jQuery.extend( {
Deferred: function( func ) {
var tuples = [
// action, add listener, callbacks,
// ... .then handlers, argument index, [final state]
[ "notify", "progress", jQuery.Callbacks( "memory" ),
jQuery.Callbacks( "memory" ), 2 ],
[ "resolve", "done", jQuery.Callbacks( "once memory" ),
jQuery.Callbacks( "once memory" ), 0, "resolved" ],
[ "reject", "fail", jQuery.Callbacks( "once memory" ),
jQuery.Callbacks( "once memory" ), 1, "rejected" ]
],
state = "pending",
promise = {
state: function() {
return state;
},
always: function() {
deferred.done( arguments ).fail( arguments );
return this;
},
"catch": function( fn ) {
return promise.then( null, fn );
},
// Keep pipe for back-compat
pipe: function( /* fnDone, fnFail, fnProgress */ ) {
var fns = arguments;
return jQuery.Deferred( function( newDefer ) {
jQuery.each( tuples, function( i, tuple ) {
// Map tuples (progress, done, fail) to arguments (done, fail, progress)
var fn = jQuery.isFunction( fns[ tuple[ 4 ] ] ) && fns[ tuple[ 4 ] ];
// deferred.progress(function() { bind to newDefer or newDefer.notify })
// deferred.done(function() { bind to newDefer or newDefer.resolve })
// deferred.fail(function() { bind to newDefer or newDefer.reject })
deferred[ tuple[ 1 ] ]( function() {
var returned = fn && fn.apply( this, arguments );
if ( returned && jQuery.isFunction( returned.promise ) ) {
returned.promise()
.progress( newDefer.notify )
.done( newDefer.resolve )
.fail( newDefer.reject );
} else {
newDefer[ tuple[ 0 ] + "With" ](
this,
fn ? [ returned ] : arguments
);
}
} );
} );
fns = null;
} ).promise();
},
then: function( onFulfilled, onRejected, onProgress ) {
var maxDepth = 0;
function resolve( depth, deferred, handler, special ) {
return function() {
var that = this,
args = arguments,
mightThrow = function() {
var returned, then;
// Support: Promises/A+ section 2.3.3.3.3
// https://promisesaplus.com/#point-59
// Ignore double-resolution attempts
if ( depth < maxDepth ) {
return;
}
returned = handler.apply( that, args );
// Support: Promises/A+ section 2.3.1
// https://promisesaplus.com/#point-48
if ( returned === deferred.promise() ) {
throw new TypeError( "Thenable self-resolution" );
}
// Support: Promises/A+ sections 2.3.3.1, 3.5
// https://promisesaplus.com/#point-54
// https://promisesaplus.com/#point-75
// Retrieve `then` only once
then = returned &&
// Support: Promises/A+ section 2.3.4
// https://promisesaplus.com/#point-64
// Only check objects and functions for thenability
( typeof returned === "object" ||
typeof returned === "function" ) &&
returned.then;
// Handle a returned thenable
if ( jQuery.isFunction( then ) ) {
// Special processors (notify) just wait for resolution
if ( special ) {
then.call(
returned,
resolve( maxDepth, deferred, Identity, special ),
resolve( maxDepth, deferred, Thrower, special )
);
// Normal processors (resolve) also hook into progress
} else {
// ...and disregard older resolution values
maxDepth++;
then.call(
returned,
resolve( maxDepth, deferred, Identity, special ),
resolve( maxDepth, deferred, Thrower, special ),
resolve( maxDepth, deferred, Identity,
deferred.notifyWith )
);
}
// Handle all other returned values
} else {
// Only substitute handlers pass on context
// and multiple values (non-spec behavior)
if ( handler !== Identity ) {
that = undefined;
args = [ returned ];
}
// Process the value(s)
// Default process is resolve
( special || deferred.resolveWith )( that, args );
}
},
// Only normal processors (resolve) catch and reject exceptions
process = special ?
mightThrow :
function() {
try {
mightThrow();
} catch ( e ) {
if ( jQuery.Deferred.exceptionHook ) {
jQuery.Deferred.exceptionHook( e,
process.stackTrace );
}
// Support: Promises/A+ section 2.3.3.3.4.1
// https://promisesaplus.com/#point-61
// Ignore post-resolution exceptions
if ( depth + 1 >= maxDepth ) {
// Only substitute handlers pass on context
// and multiple values (non-spec behavior)
if ( handler !== Thrower ) {
that = undefined;
args = [ e ];
}
deferred.rejectWith( that, args );
}
}
};
// Support: Promises/A+ section 2.3.3.3.1
// https://promisesaplus.com/#point-57
// Re-resolve promises immediately to dodge false rejection from
// subsequent errors
if ( depth ) {
process();
} else {
// Call an optional hook to record the stack, in case of exception
// since it's otherwise lost when execution goes async
if ( jQuery.Deferred.getStackHook ) {
process.stackTrace = jQuery.Deferred.getStackHook();
}
window.setTimeout( process );
}
};
}
return jQuery.Deferred( function( newDefer ) {
// progress_handlers.add( ... )
tuples[ 0 ][ 3 ].add(
resolve(
0,
newDefer,
jQuery.isFunction( onProgress ) ?
onProgress :
Identity,
newDefer.notifyWith
)
);
// fulfilled_handlers.add( ... )
tuples[ 1 ][ 3 ].add(
resolve(
0,
newDefer,
jQuery.isFunction( onFulfilled ) ?
onFulfilled :
Identity
)
);
// rejected_handlers.add( ... )
tuples[ 2 ][ 3 ].add(
resolve(
0,
newDefer,
jQuery.isFunction( onRejected ) ?
onRejected :
Thrower
)
);
} ).promise();
},
// Get a promise for this deferred
// If obj is provided, the promise aspect is added to the object
promise: function( obj ) {
return obj != null ? jQuery.extend( obj, promise ) : promise;
}
},
deferred = {};
// Add list-specific methods
jQuery.each( tuples, function( i, tuple ) {
var list = tuple[ 2 ],
stateString = tuple[ 5 ];
// promise.progress = list.add
// promise.done = list.add
// promise.fail = list.add
promise[ tuple[ 1 ] ] = list.add;
// Handle state
if ( stateString ) {
list.add(
function() {
// state = "resolved" (i.e., fulfilled)
// state = "rejected"
state = stateString;
},
// rejected_callbacks.disable
// fulfilled_callbacks.disable
tuples[ 3 - i ][ 2 ].disable,
// progress_callbacks.lock
tuples[ 0 ][ 2 ].lock
);
}
// progress_handlers.fire
// fulfilled_handlers.fire
// rejected_handlers.fire
list.add( tuple[ 3 ].fire );
// deferred.notify = function() { deferred.notifyWith(...) }
// deferred.resolve = function() { deferred.resolveWith(...) }
// deferred.reject = function() { deferred.rejectWith(...) }
deferred[ tuple[ 0 ] ] = function() {
deferred[ tuple[ 0 ] + "With" ]( this === deferred ? undefined : this, arguments );
return this;
};
// deferred.notifyWith = list.fireWith
// deferred.resolveWith = list.fireWith
// deferred.rejectWith = list.fireWith
deferred[ tuple[ 0 ] + "With" ] = list.fireWith;
} );
// Make the deferred a promise
promise.promise( deferred );
// Call given func if any
if ( func ) {
func.call( deferred, deferred );
}
// All done!
return deferred;
},
// Deferred helper
when: function( singleValue ) {
var
// count of uncompleted subordinates
remaining = arguments.length,
// count of unprocessed arguments
i = remaining,
// subordinate fulfillment data
resolveContexts = Array( i ),
resolveValues = slice.call( arguments ),
// the master Deferred
master = jQuery.Deferred(),
// subordinate callback factory
updateFunc = function( i ) {
return function( value ) {
resolveContexts[ i ] = this;
resolveValues[ i ] = arguments.length > 1 ? slice.call( arguments ) : value;
if ( !( --remaining ) ) {
master.resolveWith( resolveContexts, resolveValues );
}
};
};
// Single- and empty arguments are adopted like Promise.resolve
if ( remaining <= 1 ) {
adoptValue( singleValue, master.done( updateFunc( i ) ).resolve, master.reject );
// Use .then() to unwrap secondary thenables (cf. gh-3000)
if ( master.state() === "pending" ||
jQuery.isFunction( resolveValues[ i ] && resolveValues[ i ].then ) ) {
return master.then();
}
}
// Multiple arguments are aggregated like Promise.all array elements
while ( i-- ) {
adoptValue( resolveValues[ i ], updateFunc( i ), master.reject );
}
return master.promise();
}
} );
// These usually indicate a programmer mistake during development,
// warn about them ASAP rather than swallowing them by default.
var rerrorNames = /^(Eval|Internal|Range|Reference|Syntax|Type|URI)Error$/;
jQuery.Deferred.exceptionHook = function( error, stack ) {
// Support: IE 8 - 9 only
// Console exists when dev tools are open, which can happen at any time
if ( window.console && window.console.warn && error && rerrorNames.test( error.name ) ) {
window.console.warn( "jQuery.Deferred exception: " + error.message, error.stack, stack );
}
};
jQuery.readyException = function( error ) {
window.setTimeout( function() {
throw error;
} );
};
// The deferred used on DOM ready
var readyList = jQuery.Deferred();
jQuery.fn.ready = function( fn ) {
readyList
.then( fn )
// Wrap jQuery.readyException in a function so that the lookup
// happens at the time of error handling instead of callback
// registration.
.catch( function( error ) {
jQuery.readyException( error );
} );
return this;
};
jQuery.extend( {
// Is the DOM ready to be used? Set to true once it occurs.
isReady: false,
// A counter to track how many items to wait for before
// the ready event fires. See #6781
readyWait: 1,
// Hold (or release) the ready event
holdReady: function( hold ) {
if ( hold ) {
jQuery.readyWait++;
} else {
jQuery.ready( true );
}
},
// Handle when the DOM is ready
ready: function( wait ) {
// Abort if there are pending holds or we're already ready
if ( wait === true ? --jQuery.readyWait : jQuery.isReady ) {
return;
}
// Remember that the DOM is ready
jQuery.isReady = true;
// If a normal DOM Ready event fired, decrement, and wait if need be
if ( wait !== true && --jQuery.readyWait > 0 ) {
return;
}
// If there are functions bound, to execute
readyList.resolveWith( document, [ jQuery ] );
}
} );
jQuery.ready.then = readyList.then;
// The ready event handler and self cleanup method
function completed() {
document.removeEventListener( "DOMContentLoaded", completed );
window.removeEventListener( "load", completed );
jQuery.ready();
}
// Catch cases where $(document).ready() is called
// after the browser event has already occurred.
// Support: IE <=9 - 10 only
// Older IE sometimes signals "interactive" too soon
if ( document.readyState === "complete" ||
( document.readyState !== "loading" && !document.documentElement.doScroll ) ) {
// Handle it asynchronously to allow scripts the opportunity to delay ready
window.setTimeout( jQuery.ready );
} else {
// Use the handy event callback
document.addEventListener( "DOMContentLoaded", completed );
// A fallback to window.onload, that will always work
window.addEventListener( "load", completed );
}
// Multifunctional method to get and set values of a collection
// The value/s can optionally be executed if it's a function
var access = function( elems, fn, key, value, chainable, emptyGet, raw ) {
var i = 0,
len = elems.length,
bulk = key == null;
// Sets many values
if ( jQuery.type( key ) === "object" ) {
chainable = true;
for ( i in key ) {
access( elems, fn, i, key[ i ], true, emptyGet, raw );
}
// Sets one value
} else if ( value !== undefined ) {
chainable = true;
if ( !jQuery.isFunction( value ) ) {
raw = true;
}
if ( bulk ) {
// Bulk operations run against the entire set
if ( raw ) {
fn.call( elems, value );
fn = null;
// ...except when executing function values
} else {
bulk = fn;
fn = function( elem, key, value ) {
return bulk.call( jQuery( elem ), value );
};
}
}
if ( fn ) {
for ( ; i < len; i++ ) {
fn(
elems[ i ], key, raw ?
value :
value.call( elems[ i ], i, fn( elems[ i ], key ) )
);
}
}
}
if ( chainable ) {
return elems;
}
// Gets
if ( bulk ) {
return fn.call( elems );
}
return len ? fn( elems[ 0 ], key ) : emptyGet;
};
var acceptData = function( owner ) {
// Accepts only:
// - Node
// - Node.ELEMENT_NODE
// - Node.DOCUMENT_NODE
// - Object
// - Any
return owner.nodeType === 1 || owner.nodeType === 9 || !( +owner.nodeType );
};
function Data() {
this.expando = jQuery.expando + Data.uid++;
}
Data.uid = 1;
Data.prototype = {
cache: function( owner ) {
// Check if the owner object already has a cache
var value = owner[ this.expando ];
// If not, create one
if ( !value ) {
value = {};
// We can accept data for non-element nodes in modern browsers,
// but we should not, see #8335.
// Always return an empty object.
if ( acceptData( owner ) ) {
// If it is a node unlikely to be stringify-ed or looped over
// use plain assignment
if ( owner.nodeType ) {
owner[ this.expando ] = value;
// Otherwise secure it in a non-enumerable property
// configurable must be true to allow the property to be
// deleted when data is removed
} else {
Object.defineProperty( owner, this.expando, {
value: value,
configurable: true
} );
}
}
}
return value;
},
set: function( owner, data, value ) {
var prop,
cache = this.cache( owner );
// Handle: [ owner, key, value ] args
// Always use camelCase key (gh-2257)
if ( typeof data === "string" ) {
cache[ jQuery.camelCase( data ) ] = value;
// Handle: [ owner, { properties } ] args
} else {
// Copy the properties one-by-one to the cache object
for ( prop in data ) {
cache[ jQuery.camelCase( prop ) ] = data[ prop ];
}
}
return cache;
},
get: function( owner, key ) {
return key === undefined ?
this.cache( owner ) :
// Always use camelCase key (gh-2257)
owner[ this.expando ] && owner[ this.expando ][ jQuery.camelCase( key ) ];
},
access: function( owner, key, value ) {
// In cases where either:
//
// 1. No key was specified
// 2. A string key was specified, but no value provided
//
// Take the "read" path and allow the get method to determine
// which value to return, respectively either:
//
// 1. The entire cache object
// 2. The data stored at the key
//
if ( key === undefined ||
( ( key && typeof key === "string" ) && value === undefined ) ) {
return this.get( owner, key );
}
// When the key is not a string, or both a key and value
// are specified, set or extend (existing objects) with either:
//
// 1. An object of properties
// 2. A key and value
//
this.set( owner, key, value );
// Since the "set" path can have two possible entry points
// return the expected data based on which path was taken[*]
return value !== undefined ? value : key;
},
remove: function( owner, key ) {
var i,
cache = owner[ this.expando ];
if ( cache === undefined ) {
return;
}
if ( key !== undefined ) {
// Support array or space separated string of keys
if ( jQuery.isArray( key ) ) {
// If key is an array of keys...
// We always set camelCase keys, so remove that.
key = key.map( jQuery.camelCase );
} else {
key = jQuery.camelCase( key );
// If a key with the spaces exists, use it.
// Otherwise, create an array by matching non-whitespace
key = key in cache ?
[ key ] :
( key.match( rnothtmlwhite ) || [] );
}
i = key.length;
while ( i-- ) {
delete cache[ key[ i ] ];
}
}
// Remove the expando if there's no more data
if ( key === undefined || jQuery.isEmptyObject( cache ) ) {
// Support: Chrome <=35 - 45
// Webkit & Blink performance suffers when deleting properties
// from DOM nodes, so set to undefined instead
// https://bugs.chromium.org/p/chromium/issues/detail?id=378607 (bug restricted)
if ( owner.nodeType ) {
owner[ this.expando ] = undefined;
} else {
delete owner[ this.expando ];
}
}
},
hasData: function( owner ) {
var cache = owner[ this.expando ];
return cache !== undefined && !jQuery.isEmptyObject( cache );
}
};
var dataPriv = new Data();
var dataUser = new Data();
// Implementation Summary
//
// 1. Enforce API surface and semantic compatibility with 1.9.x branch
// 2. Improve the module's maintainability by reducing the storage
// paths to a single mechanism.
// 3. Use the same single mechanism to support "private" and "user" data.
// 4. _Never_ expose "private" data to user code (TODO: Drop _data, _removeData)
// 5. Avoid exposing implementation details on user objects (eg. expando properties)
// 6. Provide a clear path for implementation upgrade to WeakMap in 2014
var rbrace = /^(?:\{[\w\W]*\}|\[[\w\W]*\])$/,
rmultiDash = /[A-Z]/g;
function getData( data ) {
if ( data === "true" ) {
return true;
}
if ( data === "false" ) {
return false;
}
if ( data === "null" ) {
return null;
}
// Only convert to a number if it doesn't change the string
if ( data === +data + "" ) {
return +data;
}
if ( rbrace.test( data ) ) {
return JSON.parse( data );
}
return data;
}
function dataAttr( elem, key, data ) {
var name;
// If nothing was found internally, try to fetch any
// data from the HTML5 data-* attribute
if ( data === undefined && elem.nodeType === 1 ) {
name = "data-" + key.replace( rmultiDash, "-$&" ).toLowerCase();
data = elem.getAttribute( name );
if ( typeof data === "string" ) {
try {
data = getData( data );
} catch ( e ) {}
// Make sure we set the data so it isn't changed later
dataUser.set( elem, key, data );
} else {
data = undefined;
}
}
return data;
}
jQuery.extend( {
hasData: function( elem ) {
return dataUser.hasData( elem ) || dataPriv.hasData( elem );
},
data: function( elem, name, data ) {
return dataUser.access( elem, name, data );
},
removeData: function( elem, name ) {
dataUser.remove( elem, name );
},
// TODO: Now that all calls to _data and _removeData have been replaced
// with direct calls to dataPriv methods, these can be deprecated.
_data: function( elem, name, data ) {
return dataPriv.access( elem, name, data );
},
_removeData: function( elem, name ) {
dataPriv.remove( elem, name );
}
} );
jQuery.fn.extend( {
data: function( key, value ) {
var i, name, data,
elem = this[ 0 ],
attrs = elem && elem.attributes;
// Gets all values
if ( key === undefined ) {
if ( this.length ) {
data = dataUser.get( elem );
if ( elem.nodeType === 1 && !dataPriv.get( elem, "hasDataAttrs" ) ) {
i = attrs.length;
while ( i-- ) {
// Support: IE 11 only
// The attrs elements can be null (#14894)
if ( attrs[ i ] ) {
name = attrs[ i ].name;
if ( name.indexOf( "data-" ) === 0 ) {
name = jQuery.camelCase( name.slice( 5 ) );
dataAttr( elem, name, data[ name ] );
}
}
}
dataPriv.set( elem, "hasDataAttrs", true );
}
}
return data;
}
// Sets multiple values
if ( typeof key === "object" ) {
return this.each( function() {
dataUser.set( this, key );
} );
}
return access( this, function( value ) {
var data;
// The calling jQuery object (element matches) is not empty
// (and therefore has an element appears at this[ 0 ]) and the
// `value` parameter was not undefined. An empty jQuery object
// will result in `undefined` for elem = this[ 0 ] which will
// throw an exception if an attempt to read a data cache is made.
if ( elem && value === undefined ) {
// Attempt to get data from the cache
// The key will always be camelCased in Data
data = dataUser.get( elem, key );
if ( data !== undefined ) {
return data;
}
// Attempt to "discover" the data in
// HTML5 custom data-* attrs
data = dataAttr( elem, key );
if ( data !== undefined ) {
return data;
}
// We tried really hard, but the data doesn't exist.
return;
}
// Set the data...
this.each( function() {
// We always store the camelCased key
dataUser.set( this, key, value );
} );
}, null, value, arguments.length > 1, null, true );
},
removeData: function( key ) {
return this.each( function() {
dataUser.remove( this, key );
} );
}
} );
jQuery.extend( {
queue: function( elem, type, data ) {
var queue;
if ( elem ) {
type = ( type || "fx" ) + "queue";
queue = dataPriv.get( elem, type );
// Speed up dequeue by getting out quickly if this is just a lookup
if ( data ) {
if ( !queue || jQuery.isArray( data ) ) {
queue = dataPriv.access( elem, type, jQuery.makeArray( data ) );
} else {
queue.push( data );
}
}
return queue || [];
}
},
dequeue: function( elem, type ) {
type = type || "fx";
var queue = jQuery.queue( elem, type ),
startLength = queue.length,
fn = queue.shift(),
hooks = jQuery._queueHooks( elem, type ),
next = function() {
jQuery.dequeue( elem, type );
};
// If the fx queue is dequeued, always remove the progress sentinel
if ( fn === "inprogress" ) {
fn = queue.shift();
startLength--;
}
if ( fn ) {
// Add a progress sentinel to prevent the fx queue from being
// automatically dequeued
if ( type === "fx" ) {
queue.unshift( "inprogress" );
}
// Clear up the last queue stop function
delete hooks.stop;
fn.call( elem, next, hooks );
}
if ( !startLength && hooks ) {
hooks.empty.fire();
}
},
// Not public - generate a queueHooks object, or return the current one
_queueHooks: function( elem, type ) {
var key = type + "queueHooks";
return dataPriv.get( elem, key ) || dataPriv.access( elem, key, {
empty: jQuery.Callbacks( "once memory" ).add( function() {
dataPriv.remove( elem, [ type + "queue", key ] );
} )
} );
}
} );
jQuery.fn.extend( {
queue: function( type, data ) {
var setter = 2;
if ( typeof type !== "string" ) {
data = type;
type = "fx";
setter--;
}
if ( arguments.length < setter ) {
return jQuery.queue( this[ 0 ], type );
}
return data === undefined ?
this :
this.each( function() {
var queue = jQuery.queue( this, type, data );
// Ensure a hooks for this queue
jQuery._queueHooks( this, type );
if ( type === "fx" && queue[ 0 ] !== "inprogress" ) {
jQuery.dequeue( this, type );
}
} );
},
dequeue: function( type ) {
return this.each( function() {
jQuery.dequeue( this, type );
} );
},
clearQueue: function( type ) {
return this.queue( type || "fx", [] );
},
// Get a promise resolved when queues of a certain type
// are emptied (fx is the type by default)
promise: function( type, obj ) {
var tmp,
count = 1,
defer = jQuery.Deferred(),
elements = this,
i = this.length,
resolve = function() {
if ( !( --count ) ) {
defer.resolveWith( elements, [ elements ] );
}
};
if ( typeof type !== "string" ) {
obj = type;
type = undefined;
}
type = type || "fx";
while ( i-- ) {
tmp = dataPriv.get( elements[ i ], type + "queueHooks" );
if ( tmp && tmp.empty ) {
count++;
tmp.empty.add( resolve );
}
}
resolve();
return defer.promise( obj );
}
} );
var pnum = ( /[+-]?(?:\d*\.|)\d+(?:[eE][+-]?\d+|)/ ).source;
var rcssNum = new RegExp( "^(?:([+-])=|)(" + pnum + ")([a-z%]*)$", "i" );
var cssExpand = [ "Top", "Right", "Bottom", "Left" ];
var isHiddenWithinTree = function( elem, el ) {
// isHiddenWithinTree might be called from jQuery#filter function;
// in that case, element will be second argument
elem = el || elem;
// Inline style trumps all
return elem.style.display === "none" ||
elem.style.display === "" &&
// Otherwise, check computed style
// Support: Firefox <=43 - 45
// Disconnected elements can have computed display: none, so first confirm that elem is
// in the document.
jQuery.contains( elem.ownerDocument, elem ) &&
jQuery.css( elem, "display" ) === "none";
};
var swap = function( elem, options, callback, args ) {
var ret, name,
old = {};
// Remember the old values, and insert the new ones
for ( name in options ) {
old[ name ] = elem.style[ name ];
elem.style[ name ] = options[ name ];
}
ret = callback.apply( elem, args || [] );
// Revert the old values
for ( name in options ) {
elem.style[ name ] = old[ name ];
}
return ret;
};
function adjustCSS( elem, prop, valueParts, tween ) {
var adjusted,
scale = 1,
maxIterations = 20,
currentValue = tween ?
function() {
return tween.cur();
} :
function() {
return jQuery.css( elem, prop, "" );
},
initial = currentValue(),
unit = valueParts && valueParts[ 3 ] || ( jQuery.cssNumber[ prop ] ? "" : "px" ),
// Starting value computation is required for potential unit mismatches
initialInUnit = ( jQuery.cssNumber[ prop ] || unit !== "px" && +initial ) &&
rcssNum.exec( jQuery.css( elem, prop ) );
if ( initialInUnit && initialInUnit[ 3 ] !== unit ) {
// Trust units reported by jQuery.css
unit = unit || initialInUnit[ 3 ];
// Make sure we update the tween properties later on
valueParts = valueParts || [];
// Iteratively approximate from a nonzero starting point
initialInUnit = +initial || 1;
do {
// If previous iteration zeroed out, double until we get *something*.
// Use string for doubling so we don't accidentally see scale as unchanged below
scale = scale || ".5";
// Adjust and apply
initialInUnit = initialInUnit / scale;
jQuery.style( elem, prop, initialInUnit + unit );
// Update scale, tolerating zero or NaN from tween.cur()
// Break the loop if scale is unchanged or perfect, or if we've just had enough.
} while (
scale !== ( scale = currentValue() / initial ) && scale !== 1 && --maxIterations
);
}
if ( valueParts ) {
initialInUnit = +initialInUnit || +initial || 0;
// Apply relative offset (+=/-=) if specified
adjusted = valueParts[ 1 ] ?
initialInUnit + ( valueParts[ 1 ] + 1 ) * valueParts[ 2 ] :
+valueParts[ 2 ];
if ( tween ) {
tween.unit = unit;
tween.start = initialInUnit;
tween.end = adjusted;
}
}
return adjusted;
}
var defaultDisplayMap = {};
function getDefaultDisplay( elem ) {
var temp,
doc = elem.ownerDocument,
nodeName = elem.nodeName,
display = defaultDisplayMap[ nodeName ];
if ( display ) {
return display;
}
temp = doc.body.appendChild( doc.createElement( nodeName ) );
display = jQuery.css( temp, "display" );
temp.parentNode.removeChild( temp );
if ( display === "none" ) {
display = "block";
}
defaultDisplayMap[ nodeName ] = display;
return display;
}
function showHide( elements, show ) {
var display, elem,
values = [],
index = 0,
length = elements.length;
// Determine new display value for elements that need to change
for ( ; index < length; index++ ) {
elem = elements[ index ];
if ( !elem.style ) {
continue;
}
display = elem.style.display;
if ( show ) {
// Since we force visibility upon cascade-hidden elements, an immediate (and slow)
// check is required in this first loop unless we have a nonempty display value (either
// inline or about-to-be-restored)
if ( display === "none" ) {
values[ index ] = dataPriv.get( elem, "display" ) || null;
if ( !values[ index ] ) {
elem.style.display = "";
}
}
if ( elem.style.display === "" && isHiddenWithinTree( elem ) ) {
values[ index ] = getDefaultDisplay( elem );
}
} else {
if ( display !== "none" ) {
values[ index ] = "none";
// Remember what we're overwriting
dataPriv.set( elem, "display", display );
}
}
}
// Set the display of the elements in a second loop to avoid constant reflow
for ( index = 0; index < length; index++ ) {
if ( values[ index ] != null ) {
elements[ index ].style.display = values[ index ];
}
}
return elements;
}
jQuery.fn.extend( {
show: function() {
return showHide( this, true );
},
hide: function() {
return showHide( this );
},
toggle: function( state ) {
if ( typeof state === "boolean" ) {
return state ? this.show() : this.hide();
}
return this.each( function() {
if ( isHiddenWithinTree( this ) ) {
jQuery( this ).show();
} else {
jQuery( this ).hide();
}
} );
}
} );
var rcheckableType = ( /^(?:checkbox|radio)$/i );
var rtagName = ( /<([a-z][^\/\0>\x20\t\r\n\f]+)/i );
var rscriptType = ( /^$|\/(?:java|ecma)script/i );
// We have to close these tags to support XHTML (#13200)
var wrapMap = {
// Support: IE <=9 only
option: [ 1, "<select multiple='multiple'>", "</select>" ],
// XHTML parsers do not magically insert elements in the
// same way that tag soup parsers do. So we cannot shorten
// this by omitting <tbody> or other required elements.
thead: [ 1, "<table>", "</table>" ],
col: [ 2, "<table><colgroup>", "</colgroup></table>" ],
tr: [ 2, "<table><tbody>", "</tbody></table>" ],
td: [ 3, "<table><tbody><tr>", "</tr></tbody></table>" ],
_default: [ 0, "", "" ]
};
// Support: IE <=9 only
wrapMap.optgroup = wrapMap.option;
wrapMap.tbody = wrapMap.tfoot = wrapMap.colgroup = wrapMap.caption = wrapMap.thead;
wrapMap.th = wrapMap.td;
function getAll( context, tag ) {
// Support: IE <=9 - 11 only
// Use typeof to avoid zero-argument method invocation on host objects (#15151)
var ret;
if ( typeof context.getElementsByTagName !== "undefined" ) {
ret = context.getElementsByTagName( tag || "*" );
} else if ( typeof context.querySelectorAll !== "undefined" ) {
ret = context.querySelectorAll( tag || "*" );
} else {
ret = [];
}
if ( tag === undefined || tag && jQuery.nodeName( context, tag ) ) {
return jQuery.merge( [ context ], ret );
}
return ret;
}
// Mark scripts as having already been evaluated
function setGlobalEval( elems, refElements ) {
var i = 0,
l = elems.length;
for ( ; i < l; i++ ) {
dataPriv.set(
elems[ i ],
"globalEval",
!refElements || dataPriv.get( refElements[ i ], "globalEval" )
);
}
}
var rhtml = /<|&#?\w+;/;
function buildFragment( elems, context, scripts, selection, ignored ) {
var elem, tmp, tag, wrap, contains, j,
fragment = context.createDocumentFragment(),
nodes = [],
i = 0,
l = elems.length;
for ( ; i < l; i++ ) {
elem = elems[ i ];
if ( elem || elem === 0 ) {
// Add nodes directly
if ( jQuery.type( elem ) === "object" ) {
// Support: Android <=4.0 only, PhantomJS 1 only
// push.apply(_, arraylike) throws on ancient WebKit
jQuery.merge( nodes, elem.nodeType ? [ elem ] : elem );
// Convert non-html into a text node
} else if ( !rhtml.test( elem ) ) {
nodes.push( context.createTextNode( elem ) );
// Convert html into DOM nodes
} else {
tmp = tmp || fragment.appendChild( context.createElement( "div" ) );
// Deserialize a standard representation
tag = ( rtagName.exec( elem ) || [ "", "" ] )[ 1 ].toLowerCase();
wrap = wrapMap[ tag ] || wrapMap._default;
tmp.innerHTML = wrap[ 1 ] + jQuery.htmlPrefilter( elem ) + wrap[ 2 ];
// Descend through wrappers to the right content
j = wrap[ 0 ];
while ( j-- ) {
tmp = tmp.lastChild;
}
// Support: Android <=4.0 only, PhantomJS 1 only
// push.apply(_, arraylike) throws on ancient WebKit
jQuery.merge( nodes, tmp.childNodes );
// Remember the top-level container
tmp = fragment.firstChild;
// Ensure the created nodes are orphaned (#12392)
tmp.textContent = "";
}
}
}
// Remove wrapper from fragment
fragment.textContent = "";
i = 0;
while ( ( elem = nodes[ i++ ] ) ) {
// Skip elements already in the context collection (trac-4087)
if ( selection && jQuery.inArray( elem, selection ) > -1 ) {
if ( ignored ) {
ignored.push( elem );
}
continue;
}
contains = jQuery.contains( elem.ownerDocument, elem );
// Append to fragment
tmp = getAll( fragment.appendChild( elem ), "script" );
// Preserve script evaluation history
if ( contains ) {
setGlobalEval( tmp );
}
// Capture executables
if ( scripts ) {
j = 0;
while ( ( elem = tmp[ j++ ] ) ) {
if ( rscriptType.test( elem.type || "" ) ) {
scripts.push( elem );
}
}
}
}
return fragment;
}
( function() {
var fragment = document.createDocumentFragment(),
div = fragment.appendChild( document.createElement( "div" ) ),
input = document.createElement( "input" );
// Support: Android 4.0 - 4.3 only
// Check state lost if the name is set (#11217)
// Support: Windows Web Apps (WWA)
// `name` and `type` must use .setAttribute for WWA (#14901)
input.setAttribute( "type", "radio" );
input.setAttribute( "checked", "checked" );
input.setAttribute( "name", "t" );
div.appendChild( input );
// Support: Android <=4.1 only
// Older WebKit doesn't clone checked state correctly in fragments
support.checkClone = div.cloneNode( true ).cloneNode( true ).lastChild.checked;
// Support: IE <=11 only
// Make sure textarea (and checkbox) defaultValue is properly cloned
div.innerHTML = "<textarea>x</textarea>";
support.noCloneChecked = !!div.cloneNode( true ).lastChild.defaultValue;
} )();
var documentElement = document.documentElement;
var
rkeyEvent = /^key/,
rmouseEvent = /^(?:mouse|pointer|contextmenu|drag|drop)|click/,
rtypenamespace = /^([^.]*)(?:\.(.+)|)/;
function returnTrue() {
return true;
}
function returnFalse() {
return false;
}
// Support: IE <=9 only
// See #13393 for more info
function safeActiveElement() {
try {
return document.activeElement;
} catch ( err ) { }
}
function on( elem, types, selector, data, fn, one ) {
var origFn, type;
// Types can be a map of types/handlers
if ( typeof types === "object" ) {
// ( types-Object, selector, data )
if ( typeof selector !== "string" ) {
// ( types-Object, data )
data = data || selector;
selector = undefined;
}
for ( type in types ) {
on( elem, type, selector, data, types[ type ], one );
}
return elem;
}
if ( data == null && fn == null ) {
// ( types, fn )
fn = selector;
data = selector = undefined;
} else if ( fn == null ) {
if ( typeof selector === "string" ) {
// ( types, selector, fn )
fn = data;
data = undefined;
} else {
// ( types, data, fn )
fn = data;
data = selector;
selector = undefined;
}
}
if ( fn === false ) {
fn = returnFalse;
} else if ( !fn ) {
return elem;
}
if ( one === 1 ) {
origFn = fn;
fn = function( event ) {
// Can use an empty set, since event contains the info
jQuery().off( event );
return origFn.apply( this, arguments );
};
// Use same guid so caller can remove using origFn
fn.guid = origFn.guid || ( origFn.guid = jQuery.guid++ );
}
return elem.each( function() {
jQuery.event.add( this, types, fn, data, selector );
} );
}
/*
* Helper functions for managing events -- not part of the public interface.
* Props to Dean Edwards' addEvent library for many of the ideas.
*/
jQuery.event = {
global: {},
add: function( elem, types, handler, data, selector ) {
var handleObjIn, eventHandle, tmp,
events, t, handleObj,
special, handlers, type, namespaces, origType,
elemData = dataPriv.get( elem );
// Don't attach events to noData or text/comment nodes (but allow plain objects)
if ( !elemData ) {
return;
}
// Caller can pass in an object of custom data in lieu of the handler
if ( handler.handler ) {
handleObjIn = handler;
handler = handleObjIn.handler;
selector = handleObjIn.selector;
}
// Ensure that invalid selectors throw exceptions at attach time
// Evaluate against documentElement in case elem is a non-element node (e.g., document)
if ( selector ) {
jQuery.find.matchesSelector( documentElement, selector );
}
// Make sure that the handler has a unique ID, used to find/remove it later
if ( !handler.guid ) {
handler.guid = jQuery.guid++;
}
// Init the element's event structure and main handler, if this is the first
if ( !( events = elemData.events ) ) {
events = elemData.events = {};
}
if ( !( eventHandle = elemData.handle ) ) {
eventHandle = elemData.handle = function( e ) {
// Discard the second event of a jQuery.event.trigger() and
// when an event is called after a page has unloaded
return typeof jQuery !== "undefined" && jQuery.event.triggered !== e.type ?
jQuery.event.dispatch.apply( elem, arguments ) : undefined;
};
}
// Handle multiple events separated by a space
types = ( types || "" ).match( rnothtmlwhite ) || [ "" ];
t = types.length;
while ( t-- ) {
tmp = rtypenamespace.exec( types[ t ] ) || [];
type = origType = tmp[ 1 ];
namespaces = ( tmp[ 2 ] || "" ).split( "." ).sort();
// There *must* be a type, no attaching namespace-only handlers
if ( !type ) {
continue;
}
// If event changes its type, use the special event handlers for the changed type
special = jQuery.event.special[ type ] || {};
// If selector defined, determine special event api type, otherwise given type
type = ( selector ? special.delegateType : special.bindType ) || type;
// Update special based on newly reset type
special = jQuery.event.special[ type ] || {};
// handleObj is passed to all event handlers
handleObj = jQuery.extend( {
type: type,
origType: origType,
data: data,
handler: handler,
guid: handler.guid,
selector: selector,
needsContext: selector && jQuery.expr.match.needsContext.test( selector ),
namespace: namespaces.join( "." )
}, handleObjIn );
// Init the event handler queue if we're the first
if ( !( handlers = events[ type ] ) ) {
handlers = events[ type ] = [];
handlers.delegateCount = 0;
// Only use addEventListener if the special events handler returns false
if ( !special.setup ||
special.setup.call( elem, data, namespaces, eventHandle ) === false ) {
if ( elem.addEventListener ) {
elem.addEventListener( type, eventHandle );
}
}
}
if ( special.add ) {
special.add.call( elem, handleObj );
if ( !handleObj.handler.guid ) {
handleObj.handler.guid = handler.guid;
}
}
// Add to the element's handler list, delegates in front
if ( selector ) {
handlers.splice( handlers.delegateCount++, 0, handleObj );
} else {
handlers.push( handleObj );
}
// Keep track of which events have ever been used, for event optimization
jQuery.event.global[ type ] = true;
}
},
// Detach an event or set of events from an element
remove: function( elem, types, handler, selector, mappedTypes ) {
var j, origCount, tmp,
events, t, handleObj,
special, handlers, type, namespaces, origType,
elemData = dataPriv.hasData( elem ) && dataPriv.get( elem );
if ( !elemData || !( events = elemData.events ) ) {
return;
}
// Once for each type.namespace in types; type may be omitted
types = ( types || "" ).match( rnothtmlwhite ) || [ "" ];
t = types.length;
while ( t-- ) {
tmp = rtypenamespace.exec( types[ t ] ) || [];
type = origType = tmp[ 1 ];
namespaces = ( tmp[ 2 ] || "" ).split( "." ).sort();
// Unbind all events (on this namespace, if provided) for the element
if ( !type ) {
for ( type in events ) {
jQuery.event.remove( elem, type + types[ t ], handler, selector, true );
}
continue;
}
special = jQuery.event.special[ type ] || {};
type = ( selector ? special.delegateType : special.bindType ) || type;
handlers = events[ type ] || [];
tmp = tmp[ 2 ] &&
new RegExp( "(^|\\.)" + namespaces.join( "\\.(?:.*\\.|)" ) + "(\\.|$)" );
// Remove matching events
origCount = j = handlers.length;
while ( j-- ) {
handleObj = handlers[ j ];
if ( ( mappedTypes || origType === handleObj.origType ) &&
( !handler || handler.guid === handleObj.guid ) &&
( !tmp || tmp.test( handleObj.namespace ) ) &&
( !selector || selector === handleObj.selector ||
selector === "**" && handleObj.selector ) ) {
handlers.splice( j, 1 );
if ( handleObj.selector ) {
handlers.delegateCount--;
}
if ( special.remove ) {
special.remove.call( elem, handleObj );
}
}
}
// Remove generic event handler if we removed something and no more handlers exist
// (avoids potential for endless recursion during removal of special event handlers)
if ( origCount && !handlers.length ) {
if ( !special.teardown ||
special.teardown.call( elem, namespaces, elemData.handle ) === false ) {
jQuery.removeEvent( elem, type, elemData.handle );
}
delete events[ type ];
}
}
// Remove data and the expando if it's no longer used
if ( jQuery.isEmptyObject( events ) ) {
dataPriv.remove( elem, "handle events" );
}
},
dispatch: function( nativeEvent ) {
// Make a writable jQuery.Event from the native event object
var event = jQuery.event.fix( nativeEvent );
var i, j, ret, matched, handleObj, handlerQueue,
args = new Array( arguments.length ),
handlers = ( dataPriv.get( this, "events" ) || {} )[ event.type ] || [],
special = jQuery.event.special[ event.type ] || {};
// Use the fix-ed jQuery.Event rather than the (read-only) native event
args[ 0 ] = event;
for ( i = 1; i < arguments.length; i++ ) {
args[ i ] = arguments[ i ];
}
event.delegateTarget = this;
// Call the preDispatch hook for the mapped type, and let it bail if desired
if ( special.preDispatch && special.preDispatch.call( this, event ) === false ) {
return;
}
// Determine handlers
handlerQueue = jQuery.event.handlers.call( this, event, handlers );
// Run delegates first; they may want to stop propagation beneath us
i = 0;
while ( ( matched = handlerQueue[ i++ ] ) && !event.isPropagationStopped() ) {
event.currentTarget = matched.elem;
j = 0;
while ( ( handleObj = matched.handlers[ j++ ] ) &&
!event.isImmediatePropagationStopped() ) {
// Triggered event must either 1) have no namespace, or 2) have namespace(s)
// a subset or equal to those in the bound event (both can have no namespace).
if ( !event.rnamespace || event.rnamespace.test( handleObj.namespace ) ) {
event.handleObj = handleObj;
event.data = handleObj.data;
ret = ( ( jQuery.event.special[ handleObj.origType ] || {} ).handle ||
handleObj.handler ).apply( matched.elem, args );
if ( ret !== undefined ) {
if ( ( event.result = ret ) === false ) {
event.preventDefault();
event.stopPropagation();
}
}
}
}
}
// Call the postDispatch hook for the mapped type
if ( special.postDispatch ) {
special.postDispatch.call( this, event );
}
return event.result;
},
handlers: function( event, handlers ) {
var i, handleObj, sel, matchedHandlers, matchedSelectors,
handlerQueue = [],
delegateCount = handlers.delegateCount,
cur = event.target;
// Find delegate handlers
if ( delegateCount &&
// Support: IE <=9
// Black-hole SVG <use> instance trees (trac-13180)
cur.nodeType &&
// Support: Firefox <=42
// Suppress spec-violating clicks indicating a non-primary pointer button (trac-3861)
// https://www.w3.org/TR/DOM-Level-3-Events/#event-type-click
// Support: IE 11 only
// ...but not arrow key "clicks" of radio inputs, which can have `button` -1 (gh-2343)
!( event.type === "click" && event.button >= 1 ) ) {
for ( ; cur !== this; cur = cur.parentNode || this ) {
// Don't check non-elements (#13208)
// Don't process clicks on disabled elements (#6911, #8165, #11382, #11764)
if ( cur.nodeType === 1 && !( event.type === "click" && cur.disabled === true ) ) {
matchedHandlers = [];
matchedSelectors = {};
for ( i = 0; i < delegateCount; i++ ) {
handleObj = handlers[ i ];
// Don't conflict with Object.prototype properties (#13203)
sel = handleObj.selector + " ";
if ( matchedSelectors[ sel ] === undefined ) {
matchedSelectors[ sel ] = handleObj.needsContext ?
jQuery( sel, this ).index( cur ) > -1 :
jQuery.find( sel, this, null, [ cur ] ).length;
}
if ( matchedSelectors[ sel ] ) {
matchedHandlers.push( handleObj );
}
}
if ( matchedHandlers.length ) {
handlerQueue.push( { elem: cur, handlers: matchedHandlers } );
}
}
}
}
// Add the remaining (directly-bound) handlers
cur = this;
if ( delegateCount < handlers.length ) {
handlerQueue.push( { elem: cur, handlers: handlers.slice( delegateCount ) } );
}
return handlerQueue;
},
addProp: function( name, hook ) {
Object.defineProperty( jQuery.Event.prototype, name, {
enumerable: true,
configurable: true,
get: jQuery.isFunction( hook ) ?
function() {
if ( this.originalEvent ) {
return hook( this.originalEvent );
}
} :
function() {
if ( this.originalEvent ) {
return this.originalEvent[ name ];
}
},
set: function( value ) {
Object.defineProperty( this, name, {
enumerable: true,
configurable: true,
writable: true,
value: value
} );
}
} );
},
fix: function( originalEvent ) {
return originalEvent[ jQuery.expando ] ?
originalEvent :
new jQuery.Event( originalEvent );
},
special: {
load: {
// Prevent triggered image.load events from bubbling to window.load
noBubble: true
},
focus: {
// Fire native event if possible so blur/focus sequence is correct
trigger: function() {
if ( this !== safeActiveElement() && this.focus ) {
this.focus();
return false;
}
},
delegateType: "focusin"
},
blur: {
trigger: function() {
if ( this === safeActiveElement() && this.blur ) {
this.blur();
return false;
}
},
delegateType: "focusout"
},
click: {
// For checkbox, fire native event so checked state will be right
trigger: function() {
if ( this.type === "checkbox" && this.click && jQuery.nodeName( this, "input" ) ) {
this.click();
return false;
}
},
// For cross-browser consistency, don't fire native .click() on links
_default: function( event ) {
return jQuery.nodeName( event.target, "a" );
}
},
beforeunload: {
postDispatch: function( event ) {
// Support: Firefox 20+
// Firefox doesn't alert if the returnValue field is not set.
if ( event.result !== undefined && event.originalEvent ) {
event.originalEvent.returnValue = event.result;
}
}
}
}
};
jQuery.removeEvent = function( elem, type, handle ) {
// This "if" is needed for plain objects
if ( elem.removeEventListener ) {
elem.removeEventListener( type, handle );
}
};
jQuery.Event = function( src, props ) {
// Allow instantiation without the 'new' keyword
if ( !( this instanceof jQuery.Event ) ) {
return new jQuery.Event( src, props );
}
// Event object
if ( src && src.type ) {
this.originalEvent = src;
this.type = src.type;
// Events bubbling up the document may have been marked as prevented
// by a handler lower down the tree; reflect the correct value.
this.isDefaultPrevented = src.defaultPrevented ||
src.defaultPrevented === undefined &&
// Support: Android <=2.3 only
src.returnValue === false ?
returnTrue :
returnFalse;
// Create target properties
// Support: Safari <=6 - 7 only
// Target should not be a text node (#504, #13143)
this.target = ( src.target && src.target.nodeType === 3 ) ?
src.target.parentNode :
src.target;
this.currentTarget = src.currentTarget;
this.relatedTarget = src.relatedTarget;
// Event type
} else {
this.type = src;
}
// Put explicitly provided properties onto the event object
if ( props ) {
jQuery.extend( this, props );
}
// Create a timestamp if incoming event doesn't have one
this.timeStamp = src && src.timeStamp || jQuery.now();
// Mark it as fixed
this[ jQuery.expando ] = true;
};
// jQuery.Event is based on DOM3 Events as specified by the ECMAScript Language Binding
// https://www.w3.org/TR/2003/WD-DOM-Level-3-Events-20030331/ecma-script-binding.html
jQuery.Event.prototype = {
constructor: jQuery.Event,
isDefaultPrevented: returnFalse,
isPropagationStopped: returnFalse,
isImmediatePropagationStopped: returnFalse,
isSimulated: false,
preventDefault: function() {
var e = this.originalEvent;
this.isDefaultPrevented = returnTrue;
if ( e && !this.isSimulated ) {
e.preventDefault();
}
},
stopPropagation: function() {
var e = this.originalEvent;
this.isPropagationStopped = returnTrue;
if ( e && !this.isSimulated ) {
e.stopPropagation();
}
},
stopImmediatePropagation: function() {
var e = this.originalEvent;
this.isImmediatePropagationStopped = returnTrue;
if ( e && !this.isSimulated ) {
e.stopImmediatePropagation();
}
this.stopPropagation();
}
};
// Includes all common event props including KeyEvent and MouseEvent specific props
jQuery.each( {
altKey: true,
bubbles: true,
cancelable: true,
changedTouches: true,
ctrlKey: true,
detail: true,
eventPhase: true,
metaKey: true,
pageX: true,
pageY: true,
shiftKey: true,
view: true,
"char": true,
charCode: true,
key: true,
keyCode: true,
button: true,
buttons: true,
clientX: true,
clientY: true,
offsetX: true,
offsetY: true,
pointerId: true,
pointerType: true,
screenX: true,
screenY: true,
targetTouches: true,
toElement: true,
touches: true,
which: function( event ) {
var button = event.button;
// Add which for key events
if ( event.which == null && rkeyEvent.test( event.type ) ) {
return event.charCode != null ? event.charCode : event.keyCode;
}
// Add which for click: 1 === left; 2 === middle; 3 === right
if ( !event.which && button !== undefined && rmouseEvent.test( event.type ) ) {
if ( button & 1 ) {
return 1;
}
if ( button & 2 ) {
return 3;
}
if ( button & 4 ) {
return 2;
}
return 0;
}
return event.which;
}
}, jQuery.event.addProp );
// Create mouseenter/leave events using mouseover/out and event-time checks
// so that event delegation works in jQuery.
// Do the same for pointerenter/pointerleave and pointerover/pointerout
//
// Support: Safari 7 only
// Safari sends mouseenter too often; see:
// https://bugs.chromium.org/p/chromium/issues/detail?id=470258
// for the description of the bug (it existed in older Chrome versions as well).
jQuery.each( {
mouseenter: "mouseover",
mouseleave: "mouseout",
pointerenter: "pointerover",
pointerleave: "pointerout"
}, function( orig, fix ) {
jQuery.event.special[ orig ] = {
delegateType: fix,
bindType: fix,
handle: function( event ) {
var ret,
target = this,
related = event.relatedTarget,
handleObj = event.handleObj;
// For mouseenter/leave call the handler if related is outside the target.
// NB: No relatedTarget if the mouse left/entered the browser window
if ( !related || ( related !== target && !jQuery.contains( target, related ) ) ) {
event.type = handleObj.origType;
ret = handleObj.handler.apply( this, arguments );
event.type = fix;
}
return ret;
}
};
} );
jQuery.fn.extend( {
on: function( types, selector, data, fn ) {
return on( this, types, selector, data, fn );
},
one: function( types, selector, data, fn ) {
return on( this, types, selector, data, fn, 1 );
},
off: function( types, selector, fn ) {
var handleObj, type;
if ( types && types.preventDefault && types.handleObj ) {
// ( event ) dispatched jQuery.Event
handleObj = types.handleObj;
jQuery( types.delegateTarget ).off(
handleObj.namespace ?
handleObj.origType + "." + handleObj.namespace :
handleObj.origType,
handleObj.selector,
handleObj.handler
);
return this;
}
if ( typeof types === "object" ) {
// ( types-object [, selector] )
for ( type in types ) {
this.off( type, selector, types[ type ] );
}
return this;
}
if ( selector === false || typeof selector === "function" ) {
// ( types [, fn] )
fn = selector;
selector = undefined;
}
if ( fn === false ) {
fn = returnFalse;
}
return this.each( function() {
jQuery.event.remove( this, types, fn, selector );
} );
}
} );
var
/* eslint-disable max-len */
// See https://github.com/eslint/eslint/issues/3229
rxhtmlTag = /<(?!area|br|col|embed|hr|img|input|link|meta|param)(([a-z][^\/\0>\x20\t\r\n\f]*)[^>]*)\/>/gi,
/* eslint-enable */
// Support: IE <=10 - 11, Edge 12 - 13
// In IE/Edge using regex groups here causes severe slowdowns.
// See https://connect.microsoft.com/IE/feedback/details/1736512/
rnoInnerhtml = /<script|<style|<link/i,
// checked="checked" or checked
rchecked = /checked\s*(?:[^=]|=\s*.checked.)/i,
rscriptTypeMasked = /^true\/(.*)/,
rcleanScript = /^\s*<!(?:\[CDATA\[|--)|(?:\]\]|--)>\s*$/g;
function manipulationTarget( elem, content ) {
if ( jQuery.nodeName( elem, "table" ) &&
jQuery.nodeName( content.nodeType !== 11 ? content : content.firstChild, "tr" ) ) {
return elem.getElementsByTagName( "tbody" )[ 0 ] || elem;
}
return elem;
}
// Replace/restore the type attribute of script elements for safe DOM manipulation
function disableScript( elem ) {
elem.type = ( elem.getAttribute( "type" ) !== null ) + "/" + elem.type;
return elem;
}
function restoreScript( elem ) {
var match = rscriptTypeMasked.exec( elem.type );
if ( match ) {
elem.type = match[ 1 ];
} else {
elem.removeAttribute( "type" );
}
return elem;
}
function cloneCopyEvent( src, dest ) {
var i, l, type, pdataOld, pdataCur, udataOld, udataCur, events;
if ( dest.nodeType !== 1 ) {
return;
}
// 1. Copy private data: events, handlers, etc.
if ( dataPriv.hasData( src ) ) {
pdataOld = dataPriv.access( src );
pdataCur = dataPriv.set( dest, pdataOld );
events = pdataOld.events;
if ( events ) {
delete pdataCur.handle;
pdataCur.events = {};
for ( type in events ) {
for ( i = 0, l = events[ type ].length; i < l; i++ ) {
jQuery.event.add( dest, type, events[ type ][ i ] );
}
}
}
}
// 2. Copy user data
if ( dataUser.hasData( src ) ) {
udataOld = dataUser.access( src );
udataCur = jQuery.extend( {}, udataOld );
dataUser.set( dest, udataCur );
}
}
// Fix IE bugs, see support tests
function fixInput( src, dest ) {
var nodeName = dest.nodeName.toLowerCase();
// Fails to persist the checked state of a cloned checkbox or radio button.
if ( nodeName === "input" && rcheckableType.test( src.type ) ) {
dest.checked = src.checked;
// Fails to return the selected option to the default selected state when cloning options
} else if ( nodeName === "input" || nodeName === "textarea" ) {
dest.defaultValue = src.defaultValue;
}
}
function domManip( collection, args, callback, ignored ) {
// Flatten any nested arrays
args = concat.apply( [], args );
var fragment, first, scripts, hasScripts, node, doc,
i = 0,
l = collection.length,
iNoClone = l - 1,
value = args[ 0 ],
isFunction = jQuery.isFunction( value );
// We can't cloneNode fragments that contain checked, in WebKit
if ( isFunction ||
( l > 1 && typeof value === "string" &&
!support.checkClone && rchecked.test( value ) ) ) {
return collection.each( function( index ) {
var self = collection.eq( index );
if ( isFunction ) {
args[ 0 ] = value.call( this, index, self.html() );
}
domManip( self, args, callback, ignored );
} );
}
if ( l ) {
fragment = buildFragment( args, collection[ 0 ].ownerDocument, false, collection, ignored );
first = fragment.firstChild;
if ( fragment.childNodes.length === 1 ) {
fragment = first;
}
// Require either new content or an interest in ignored elements to invoke the callback
if ( first || ignored ) {
scripts = jQuery.map( getAll( fragment, "script" ), disableScript );
hasScripts = scripts.length;
// Use the original fragment for the last item
// instead of the first because it can end up
// being emptied incorrectly in certain situations (#8070).
for ( ; i < l; i++ ) {
node = fragment;
if ( i !== iNoClone ) {
node = jQuery.clone( node, true, true );
// Keep references to cloned scripts for later restoration
if ( hasScripts ) {
// Support: Android <=4.0 only, PhantomJS 1 only
// push.apply(_, arraylike) throws on ancient WebKit
jQuery.merge( scripts, getAll( node, "script" ) );
}
}
callback.call( collection[ i ], node, i );
}
if ( hasScripts ) {
doc = scripts[ scripts.length - 1 ].ownerDocument;
// Reenable scripts
jQuery.map( scripts, restoreScript );
// Evaluate executable scripts on first document insertion
for ( i = 0; i < hasScripts; i++ ) {
node = scripts[ i ];
if ( rscriptType.test( node.type || "" ) &&
!dataPriv.access( node, "globalEval" ) &&
jQuery.contains( doc, node ) ) {
if ( node.src ) {
// Optional AJAX dependency, but won't run scripts if not present
if ( jQuery._evalUrl ) {
jQuery._evalUrl( node.src );
}
} else {
DOMEval( node.textContent.replace( rcleanScript, "" ), doc );
}
}
}
}
}
}
return collection;
}
function remove( elem, selector, keepData ) {
var node,
nodes = selector ? jQuery.filter( selector, elem ) : elem,
i = 0;
for ( ; ( node = nodes[ i ] ) != null; i++ ) {
if ( !keepData && node.nodeType === 1 ) {
jQuery.cleanData( getAll( node ) );
}
if ( node.parentNode ) {
if ( keepData && jQuery.contains( node.ownerDocument, node ) ) {
setGlobalEval( getAll( node, "script" ) );
}
node.parentNode.removeChild( node );
}
}
return elem;
}
jQuery.extend( {
htmlPrefilter: function( html ) {
return html.replace( rxhtmlTag, "<$1></$2>" );
},
clone: function( elem, dataAndEvents, deepDataAndEvents ) {
var i, l, srcElements, destElements,
clone = elem.cloneNode( true ),
inPage = jQuery.contains( elem.ownerDocument, elem );
// Fix IE cloning issues
if ( !support.noCloneChecked && ( elem.nodeType === 1 || elem.nodeType === 11 ) &&
!jQuery.isXMLDoc( elem ) ) {
// We eschew Sizzle here for performance reasons: https://jsperf.com/getall-vs-sizzle/2
destElements = getAll( clone );
srcElements = getAll( elem );
for ( i = 0, l = srcElements.length; i < l; i++ ) {
fixInput( srcElements[ i ], destElements[ i ] );
}
}
// Copy the events from the original to the clone
if ( dataAndEvents ) {
if ( deepDataAndEvents ) {
srcElements = srcElements || getAll( elem );
destElements = destElements || getAll( clone );
for ( i = 0, l = srcElements.length; i < l; i++ ) {
cloneCopyEvent( srcElements[ i ], destElements[ i ] );
}
} else {
cloneCopyEvent( elem, clone );
}
}
// Preserve script evaluation history
destElements = getAll( clone, "script" );
if ( destElements.length > 0 ) {
setGlobalEval( destElements, !inPage && getAll( elem, "script" ) );
}
// Return the cloned set
return clone;
},
cleanData: function( elems ) {
var data, elem, type,
special = jQuery.event.special,
i = 0;
for ( ; ( elem = elems[ i ] ) !== undefined; i++ ) {
if ( acceptData( elem ) ) {
if ( ( data = elem[ dataPriv.expando ] ) ) {
if ( data.events ) {
for ( type in data.events ) {
if ( special[ type ] ) {
jQuery.event.remove( elem, type );
// This is a shortcut to avoid jQuery.event.remove's overhead
} else {
jQuery.removeEvent( elem, type, data.handle );
}
}
}
// Support: Chrome <=35 - 45+
// Assign undefined instead of using delete, see Data#remove
elem[ dataPriv.expando ] = undefined;
}
if ( elem[ dataUser.expando ] ) {
// Support: Chrome <=35 - 45+
// Assign undefined instead of using delete, see Data#remove
elem[ dataUser.expando ] = undefined;
}
}
}
}
} );
jQuery.fn.extend( {
detach: function( selector ) {
return remove( this, selector, true );
},
remove: function( selector ) {
return remove( this, selector );
},
text: function( value ) {
return access( this, function( value ) {
return value === undefined ?
jQuery.text( this ) :
this.empty().each( function() {
if ( this.nodeType === 1 || this.nodeType === 11 || this.nodeType === 9 ) {
this.textContent = value;
}
} );
}, null, value, arguments.length );
},
append: function() {
return domManip( this, arguments, function( elem ) {
if ( this.nodeType === 1 || this.nodeType === 11 || this.nodeType === 9 ) {
var target = manipulationTarget( this, elem );
target.appendChild( elem );
}
} );
},
prepend: function() {
return domManip( this, arguments, function( elem ) {
if ( this.nodeType === 1 || this.nodeType === 11 || this.nodeType === 9 ) {
var target = manipulationTarget( this, elem );
target.insertBefore( elem, target.firstChild );
}
} );
},
before: function() {
return domManip( this, arguments, function( elem ) {
if ( this.parentNode ) {
this.parentNode.insertBefore( elem, this );
}
} );
},
after: function() {
return domManip( this, arguments, function( elem ) {
if ( this.parentNode ) {
this.parentNode.insertBefore( elem, this.nextSibling );
}
} );
},
empty: function() {
var elem,
i = 0;
for ( ; ( elem = this[ i ] ) != null; i++ ) {
if ( elem.nodeType === 1 ) {
// Prevent memory leaks
jQuery.cleanData( getAll( elem, false ) );
// Remove any remaining nodes
elem.textContent = "";
}
}
return this;
},
clone: function( dataAndEvents, deepDataAndEvents ) {
dataAndEvents = dataAndEvents == null ? false : dataAndEvents;
deepDataAndEvents = deepDataAndEvents == null ? dataAndEvents : deepDataAndEvents;
return this.map( function() {
return jQuery.clone( this, dataAndEvents, deepDataAndEvents );
} );
},
html: function( value ) {
return access( this, function( value ) {
var elem = this[ 0 ] || {},
i = 0,
l = this.length;
if ( value === undefined && elem.nodeType === 1 ) {
return elem.innerHTML;
}
// See if we can take a shortcut and just use innerHTML
if ( typeof value === "string" && !rnoInnerhtml.test( value ) &&
!wrapMap[ ( rtagName.exec( value ) || [ "", "" ] )[ 1 ].toLowerCase() ] ) {
value = jQuery.htmlPrefilter( value );
try {
for ( ; i < l; i++ ) {
elem = this[ i ] || {};
// Remove element nodes and prevent memory leaks
if ( elem.nodeType === 1 ) {
jQuery.cleanData( getAll( elem, false ) );
elem.innerHTML = value;
}
}
elem = 0;
// If using innerHTML throws an exception, use the fallback method
} catch ( e ) {}
}
if ( elem ) {
this.empty().append( value );
}
}, null, value, arguments.length );
},
replaceWith: function() {
var ignored = [];
// Make the changes, replacing each non-ignored context element with the new content
return domManip( this, arguments, function( elem ) {
var parent = this.parentNode;
if ( jQuery.inArray( this, ignored ) < 0 ) {
jQuery.cleanData( getAll( this ) );
if ( parent ) {
parent.replaceChild( elem, this );
}
}
// Force callback invocation
}, ignored );
}
} );
jQuery.each( {
appendTo: "append",
prependTo: "prepend",
insertBefore: "before",
insertAfter: "after",
replaceAll: "replaceWith"
}, function( name, original ) {
jQuery.fn[ name ] = function( selector ) {
var elems,
ret = [],
insert = jQuery( selector ),
last = insert.length - 1,
i = 0;
for ( ; i <= last; i++ ) {
elems = i === last ? this : this.clone( true );
jQuery( insert[ i ] )[ original ]( elems );
// Support: Android <=4.0 only, PhantomJS 1 only
// .get() because push.apply(_, arraylike) throws on ancient WebKit
push.apply( ret, elems.get() );
}
return this.pushStack( ret );
};
} );
var rmargin = ( /^margin/ );
var rnumnonpx = new RegExp( "^(" + pnum + ")(?!px)[a-z%]+$", "i" );
var getStyles = function( elem ) {
// Support: IE <=11 only, Firefox <=30 (#15098, #14150)
// IE throws on elements created in popups
// FF meanwhile throws on frame elements through "defaultView.getComputedStyle"
var view = elem.ownerDocument.defaultView;
if ( !view || !view.opener ) {
view = window;
}
return view.getComputedStyle( elem );
};
( function() {
// Executing both pixelPosition & boxSizingReliable tests require only one layout
// so they're executed at the same time to save the second computation.
function computeStyleTests() {
// This is a singleton, we need to execute it only once
if ( !div ) {
return;
}
div.style.cssText =
"box-sizing:border-box;" +
"position:relative;display:block;" +
"margin:auto;border:1px;padding:1px;" +
"top:1%;width:50%";
div.innerHTML = "";
documentElement.appendChild( container );
var divStyle = window.getComputedStyle( div );
pixelPositionVal = divStyle.top !== "1%";
// Support: Android 4.0 - 4.3 only, Firefox <=3 - 44
reliableMarginLeftVal = divStyle.marginLeft === "2px";
boxSizingReliableVal = divStyle.width === "4px";
// Support: Android 4.0 - 4.3 only
// Some styles come back with percentage values, even though they shouldn't
div.style.marginRight = "50%";
pixelMarginRightVal = divStyle.marginRight === "4px";
documentElement.removeChild( container );
// Nullify the div so it wouldn't be stored in the memory and
// it will also be a sign that checks already performed
div = null;
}
var pixelPositionVal, boxSizingReliableVal, pixelMarginRightVal, reliableMarginLeftVal,
container = document.createElement( "div" ),
div = document.createElement( "div" );
// Finish early in limited (non-browser) environments
if ( !div.style ) {
return;
}
// Support: IE <=9 - 11 only
// Style of cloned element affects source element cloned (#8908)
div.style.backgroundClip = "content-box";
div.cloneNode( true ).style.backgroundClip = "";
support.clearCloneStyle = div.style.backgroundClip === "content-box";
container.style.cssText = "border:0;width:8px;height:0;top:0;left:-9999px;" +
"padding:0;margin-top:1px;position:absolute";
container.appendChild( div );
jQuery.extend( support, {
pixelPosition: function() {
computeStyleTests();
return pixelPositionVal;
},
boxSizingReliable: function() {
computeStyleTests();
return boxSizingReliableVal;
},
pixelMarginRight: function() {
computeStyleTests();
return pixelMarginRightVal;
},
reliableMarginLeft: function() {
computeStyleTests();
return reliableMarginLeftVal;
}
} );
} )();
function curCSS( elem, name, computed ) {
var width, minWidth, maxWidth, ret,
style = elem.style;
computed = computed || getStyles( elem );
// Support: IE <=9 only
// getPropertyValue is only needed for .css('filter') (#12537)
if ( computed ) {
ret = computed.getPropertyValue( name ) || computed[ name ];
if ( ret === "" && !jQuery.contains( elem.ownerDocument, elem ) ) {
ret = jQuery.style( elem, name );
}
// A tribute to the "awesome hack by Dean Edwards"
// Android Browser returns percentage for some values,
// but width seems to be reliably pixels.
// This is against the CSSOM draft spec:
// https://drafts.csswg.org/cssom/#resolved-values
if ( !support.pixelMarginRight() && rnumnonpx.test( ret ) && rmargin.test( name ) ) {
// Remember the original values
width = style.width;
minWidth = style.minWidth;
maxWidth = style.maxWidth;
// Put in the new values to get a computed value out
style.minWidth = style.maxWidth = style.width = ret;
ret = computed.width;
// Revert the changed values
style.width = width;
style.minWidth = minWidth;
style.maxWidth = maxWidth;
}
}
return ret !== undefined ?
// Support: IE <=9 - 11 only
// IE returns zIndex value as an integer.
ret + "" :
ret;
}
function addGetHookIf( conditionFn, hookFn ) {
// Define the hook, we'll check on the first run if it's really needed.
return {
get: function() {
if ( conditionFn() ) {
// Hook not needed (or it's not possible to use it due
// to missing dependency), remove it.
delete this.get;
return;
}
// Hook needed; redefine it so that the support test is not executed again.
return ( this.get = hookFn ).apply( this, arguments );
}
};
}
var
// Swappable if display is none or starts with table
// except "table", "table-cell", or "table-caption"
// See here for display values: https://developer.mozilla.org/en-US/docs/CSS/display
rdisplayswap = /^(none|table(?!-c[ea]).+)/,
cssShow = { position: "absolute", visibility: "hidden", display: "block" },
cssNormalTransform = {
letterSpacing: "0",
fontWeight: "400"
},
cssPrefixes = [ "Webkit", "Moz", "ms" ],
emptyStyle = document.createElement( "div" ).style;
// Return a css property mapped to a potentially vendor prefixed property
function vendorPropName( name ) {
// Shortcut for names that are not vendor prefixed
if ( name in emptyStyle ) {
return name;
}
// Check for vendor prefixed names
var capName = name[ 0 ].toUpperCase() + name.slice( 1 ),
i = cssPrefixes.length;
while ( i-- ) {
name = cssPrefixes[ i ] + capName;
if ( name in emptyStyle ) {
return name;
}
}
}
function setPositiveNumber( elem, value, subtract ) {
// Any relative (+/-) values have already been
// normalized at this point
var matches = rcssNum.exec( value );
return matches ?
// Guard against undefined "subtract", e.g., when used as in cssHooks
Math.max( 0, matches[ 2 ] - ( subtract || 0 ) ) + ( matches[ 3 ] || "px" ) :
value;
}
function augmentWidthOrHeight( elem, name, extra, isBorderBox, styles ) {
var i,
val = 0;
// If we already have the right measurement, avoid augmentation
if ( extra === ( isBorderBox ? "border" : "content" ) ) {
i = 4;
// Otherwise initialize for horizontal or vertical properties
} else {
i = name === "width" ? 1 : 0;
}
for ( ; i < 4; i += 2 ) {
// Both box models exclude margin, so add it if we want it
if ( extra === "margin" ) {
val += jQuery.css( elem, extra + cssExpand[ i ], true, styles );
}
if ( isBorderBox ) {
// border-box includes padding, so remove it if we want content
if ( extra === "content" ) {
val -= jQuery.css( elem, "padding" + cssExpand[ i ], true, styles );
}
// At this point, extra isn't border nor margin, so remove border
if ( extra !== "margin" ) {
val -= jQuery.css( elem, "border" + cssExpand[ i ] + "Width", true, styles );
}
} else {
// At this point, extra isn't content, so add padding
val += jQuery.css( elem, "padding" + cssExpand[ i ], true, styles );
// At this point, extra isn't content nor padding, so add border
if ( extra !== "padding" ) {
val += jQuery.css( elem, "border" + cssExpand[ i ] + "Width", true, styles );
}
}
}
return val;
}
function getWidthOrHeight( elem, name, extra ) {
// Start with offset property, which is equivalent to the border-box value
var val,
valueIsBorderBox = true,
styles = getStyles( elem ),
isBorderBox = jQuery.css( elem, "boxSizing", false, styles ) === "border-box";
// Support: IE <=11 only
// Running getBoundingClientRect on a disconnected node
// in IE throws an error.
if ( elem.getClientRects().length ) {
val = elem.getBoundingClientRect()[ name ];
}
// Some non-html elements return undefined for offsetWidth, so check for null/undefined
// svg - https://bugzilla.mozilla.org/show_bug.cgi?id=649285
// MathML - https://bugzilla.mozilla.org/show_bug.cgi?id=491668
if ( val <= 0 || val == null ) {
// Fall back to computed then uncomputed css if necessary
val = curCSS( elem, name, styles );
if ( val < 0 || val == null ) {
val = elem.style[ name ];
}
// Computed unit is not pixels. Stop here and return.
if ( rnumnonpx.test( val ) ) {
return val;
}
// Check for style in case a browser which returns unreliable values
// for getComputedStyle silently falls back to the reliable elem.style
valueIsBorderBox = isBorderBox &&
( support.boxSizingReliable() || val === elem.style[ name ] );
// Normalize "", auto, and prepare for extra
val = parseFloat( val ) || 0;
}
// Use the active box-sizing model to add/subtract irrelevant styles
return ( val +
augmentWidthOrHeight(
elem,
name,
extra || ( isBorderBox ? "border" : "content" ),
valueIsBorderBox,
styles
)
) + "px";
}
jQuery.extend( {
// Add in style property hooks for overriding the default
// behavior of getting and setting a style property
cssHooks: {
opacity: {
get: function( elem, computed ) {
if ( computed ) {
// We should always get a number back from opacity
var ret = curCSS( elem, "opacity" );
return ret === "" ? "1" : ret;
}
}
}
},
// Don't automatically add "px" to these possibly-unitless properties
cssNumber: {
"animationIterationCount": true,
"columnCount": true,
"fillOpacity": true,
"flexGrow": true,
"flexShrink": true,
"fontWeight": true,
"lineHeight": true,
"opacity": true,
"order": true,
"orphans": true,
"widows": true,
"zIndex": true,
"zoom": true
},
// Add in properties whose names you wish to fix before
// setting or getting the value
cssProps: {
"float": "cssFloat"
},
// Get and set the style property on a DOM Node
style: function( elem, name, value, extra ) {
// Don't set styles on text and comment nodes
if ( !elem || elem.nodeType === 3 || elem.nodeType === 8 || !elem.style ) {
return;
}
// Make sure that we're working with the right name
var ret, type, hooks,
origName = jQuery.camelCase( name ),
style = elem.style;
name = jQuery.cssProps[ origName ] ||
( jQuery.cssProps[ origName ] = vendorPropName( origName ) || origName );
// Gets hook for the prefixed version, then unprefixed version
hooks = jQuery.cssHooks[ name ] || jQuery.cssHooks[ origName ];
// Check if we're setting a value
if ( value !== undefined ) {
type = typeof value;
// Convert "+=" or "-=" to relative numbers (#7345)
if ( type === "string" && ( ret = rcssNum.exec( value ) ) && ret[ 1 ] ) {
value = adjustCSS( elem, name, ret );
// Fixes bug #9237
type = "number";
}
// Make sure that null and NaN values aren't set (#7116)
if ( value == null || value !== value ) {
return;
}
// If a number was passed in, add the unit (except for certain CSS properties)
if ( type === "number" ) {
value += ret && ret[ 3 ] || ( jQuery.cssNumber[ origName ] ? "" : "px" );
}
// background-* props affect original clone's values
if ( !support.clearCloneStyle && value === "" && name.indexOf( "background" ) === 0 ) {
style[ name ] = "inherit";
}
// If a hook was provided, use that value, otherwise just set the specified value
if ( !hooks || !( "set" in hooks ) ||
( value = hooks.set( elem, value, extra ) ) !== undefined ) {
style[ name ] = value;
}
} else {
// If a hook was provided get the non-computed value from there
if ( hooks && "get" in hooks &&
( ret = hooks.get( elem, false, extra ) ) !== undefined ) {
return ret;
}
// Otherwise just get the value from the style object
return style[ name ];
}
},
css: function( elem, name, extra, styles ) {
var val, num, hooks,
origName = jQuery.camelCase( name );
// Make sure that we're working with the right name
name = jQuery.cssProps[ origName ] ||
( jQuery.cssProps[ origName ] = vendorPropName( origName ) || origName );
// Try prefixed name followed by the unprefixed name
hooks = jQuery.cssHooks[ name ] || jQuery.cssHooks[ origName ];
// If a hook was provided get the computed value from there
if ( hooks && "get" in hooks ) {
val = hooks.get( elem, true, extra );
}
// Otherwise, if a way to get the computed value exists, use that
if ( val === undefined ) {
val = curCSS( elem, name, styles );
}
// Convert "normal" to computed value
if ( val === "normal" && name in cssNormalTransform ) {
val = cssNormalTransform[ name ];
}
// Make numeric if forced or a qualifier was provided and val looks numeric
if ( extra === "" || extra ) {
num = parseFloat( val );
return extra === true || isFinite( num ) ? num || 0 : val;
}
return val;
}
} );
jQuery.each( [ "height", "width" ], function( i, name ) {
jQuery.cssHooks[ name ] = {
get: function( elem, computed, extra ) {
if ( computed ) {
// Certain elements can have dimension info if we invisibly show them
// but it must have a current display style that would benefit
return rdisplayswap.test( jQuery.css( elem, "display" ) ) &&
// Support: Safari 8+
// Table columns in Safari have non-zero offsetWidth & zero
// getBoundingClientRect().width unless display is changed.
// Support: IE <=11 only
// Running getBoundingClientRect on a disconnected node
// in IE throws an error.
( !elem.getClientRects().length || !elem.getBoundingClientRect().width ) ?
swap( elem, cssShow, function() {
return getWidthOrHeight( elem, name, extra );
} ) :
getWidthOrHeight( elem, name, extra );
}
},
set: function( elem, value, extra ) {
var matches,
styles = extra && getStyles( elem ),
subtract = extra && augmentWidthOrHeight(
elem,
name,
extra,
jQuery.css( elem, "boxSizing", false, styles ) === "border-box",
styles
);
// Convert to pixels if value adjustment is needed
if ( subtract && ( matches = rcssNum.exec( value ) ) &&
( matches[ 3 ] || "px" ) !== "px" ) {
elem.style[ name ] = value;
value = jQuery.css( elem, name );
}
return setPositiveNumber( elem, value, subtract );
}
};
} );
jQuery.cssHooks.marginLeft = addGetHookIf( support.reliableMarginLeft,
function( elem, computed ) {
if ( computed ) {
return ( parseFloat( curCSS( elem, "marginLeft" ) ) ||
elem.getBoundingClientRect().left -
swap( elem, { marginLeft: 0 }, function() {
return elem.getBoundingClientRect().left;
} )
) + "px";
}
}
);
// These hooks are used by animate to expand properties
jQuery.each( {
margin: "",
padding: "",
border: "Width"
}, function( prefix, suffix ) {
jQuery.cssHooks[ prefix + suffix ] = {
expand: function( value ) {
var i = 0,
expanded = {},
// Assumes a single number if not a string
parts = typeof value === "string" ? value.split( " " ) : [ value ];
for ( ; i < 4; i++ ) {
expanded[ prefix + cssExpand[ i ] + suffix ] =
parts[ i ] || parts[ i - 2 ] || parts[ 0 ];
}
return expanded;
}
};
if ( !rmargin.test( prefix ) ) {
jQuery.cssHooks[ prefix + suffix ].set = setPositiveNumber;
}
} );
jQuery.fn.extend( {
css: function( name, value ) {
return access( this, function( elem, name, value ) {
var styles, len,
map = {},
i = 0;
if ( jQuery.isArray( name ) ) {
styles = getStyles( elem );
len = name.length;
for ( ; i < len; i++ ) {
map[ name[ i ] ] = jQuery.css( elem, name[ i ], false, styles );
}
return map;
}
return value !== undefined ?
jQuery.style( elem, name, value ) :
jQuery.css( elem, name );
}, name, value, arguments.length > 1 );
}
} );
function Tween( elem, options, prop, end, easing ) {
return new Tween.prototype.init( elem, options, prop, end, easing );
}
jQuery.Tween = Tween;
Tween.prototype = {
constructor: Tween,
init: function( elem, options, prop, end, easing, unit ) {
this.elem = elem;
this.prop = prop;
this.easing = easing || jQuery.easing._default;
this.options = options;
this.start = this.now = this.cur();
this.end = end;
this.unit = unit || ( jQuery.cssNumber[ prop ] ? "" : "px" );
},
cur: function() {
var hooks = Tween.propHooks[ this.prop ];
return hooks && hooks.get ?
hooks.get( this ) :
Tween.propHooks._default.get( this );
},
run: function( percent ) {
var eased,
hooks = Tween.propHooks[ this.prop ];
if ( this.options.duration ) {
this.pos = eased = jQuery.easing[ this.easing ](
percent, this.options.duration * percent, 0, 1, this.options.duration
);
} else {
this.pos = eased = percent;
}
this.now = ( this.end - this.start ) * eased + this.start;
if ( this.options.step ) {
this.options.step.call( this.elem, this.now, this );
}
if ( hooks && hooks.set ) {
hooks.set( this );
} else {
Tween.propHooks._default.set( this );
}
return this;
}
};
Tween.prototype.init.prototype = Tween.prototype;
Tween.propHooks = {
_default: {
get: function( tween ) {
var result;
// Use a property on the element directly when it is not a DOM element,
// or when there is no matching style property that exists.
if ( tween.elem.nodeType !== 1 ||
tween.elem[ tween.prop ] != null && tween.elem.style[ tween.prop ] == null ) {
return tween.elem[ tween.prop ];
}
// Passing an empty string as a 3rd parameter to .css will automatically
// attempt a parseFloat and fallback to a string if the parse fails.
// Simple values such as "10px" are parsed to Float;
// complex values such as "rotate(1rad)" are returned as-is.
result = jQuery.css( tween.elem, tween.prop, "" );
// Empty strings, null, undefined and "auto" are converted to 0.
return !result || result === "auto" ? 0 : result;
},
set: function( tween ) {
// Use step hook for back compat.
// Use cssHook if its there.
// Use .style if available and use plain properties where available.
if ( jQuery.fx.step[ tween.prop ] ) {
jQuery.fx.step[ tween.prop ]( tween );
} else if ( tween.elem.nodeType === 1 &&
( tween.elem.style[ jQuery.cssProps[ tween.prop ] ] != null ||
jQuery.cssHooks[ tween.prop ] ) ) {
jQuery.style( tween.elem, tween.prop, tween.now + tween.unit );
} else {
tween.elem[ tween.prop ] = tween.now;
}
}
}
};
// Support: IE <=9 only
// Panic based approach to setting things on disconnected nodes
Tween.propHooks.scrollTop = Tween.propHooks.scrollLeft = {
set: function( tween ) {
if ( tween.elem.nodeType && tween.elem.parentNode ) {
tween.elem[ tween.prop ] = tween.now;
}
}
};
jQuery.easing = {
linear: function( p ) {
return p;
},
swing: function( p ) {
return 0.5 - Math.cos( p * Math.PI ) / 2;
},
_default: "swing"
};
jQuery.fx = Tween.prototype.init;
// Back compat <1.8 extension point
jQuery.fx.step = {};
var
fxNow, timerId,
rfxtypes = /^(?:toggle|show|hide)$/,
rrun = /queueHooks$/;
function raf() {
if ( timerId ) {
window.requestAnimationFrame( raf );
jQuery.fx.tick();
}
}
// Animations created synchronously will run synchronously
function createFxNow() {
window.setTimeout( function() {
fxNow = undefined;
} );
return ( fxNow = jQuery.now() );
}
// Generate parameters to create a standard animation
function genFx( type, includeWidth ) {
var which,
i = 0,
attrs = { height: type };
// If we include width, step value is 1 to do all cssExpand values,
// otherwise step value is 2 to skip over Left and Right
includeWidth = includeWidth ? 1 : 0;
for ( ; i < 4; i += 2 - includeWidth ) {
which = cssExpand[ i ];
attrs[ "margin" + which ] = attrs[ "padding" + which ] = type;
}
if ( includeWidth ) {
attrs.opacity = attrs.width = type;
}
return attrs;
}
function createTween( value, prop, animation ) {
var tween,
collection = ( Animation.tweeners[ prop ] || [] ).concat( Animation.tweeners[ "*" ] ),
index = 0,
length = collection.length;
for ( ; index < length; index++ ) {
if ( ( tween = collection[ index ].call( animation, prop, value ) ) ) {
// We're done with this property
return tween;
}
}
}
function defaultPrefilter( elem, props, opts ) {
var prop, value, toggle, hooks, oldfire, propTween, restoreDisplay, display,
isBox = "width" in props || "height" in props,
anim = this,
orig = {},
style = elem.style,
hidden = elem.nodeType && isHiddenWithinTree( elem ),
dataShow = dataPriv.get( elem, "fxshow" );
// Queue-skipping animations hijack the fx hooks
if ( !opts.queue ) {
hooks = jQuery._queueHooks( elem, "fx" );
if ( hooks.unqueued == null ) {
hooks.unqueued = 0;
oldfire = hooks.empty.fire;
hooks.empty.fire = function() {
if ( !hooks.unqueued ) {
oldfire();
}
};
}
hooks.unqueued++;
anim.always( function() {
// Ensure the complete handler is called before this completes
anim.always( function() {
hooks.unqueued--;
if ( !jQuery.queue( elem, "fx" ).length ) {
hooks.empty.fire();
}
} );
} );
}
// Detect show/hide animations
for ( prop in props ) {
value = props[ prop ];
if ( rfxtypes.test( value ) ) {
delete props[ prop ];
toggle = toggle || value === "toggle";
if ( value === ( hidden ? "hide" : "show" ) ) {
// Pretend to be hidden if this is a "show" and
// there is still data from a stopped show/hide
if ( value === "show" && dataShow && dataShow[ prop ] !== undefined ) {
hidden = true;
// Ignore all other no-op show/hide data
} else {
continue;
}
}
orig[ prop ] = dataShow && dataShow[ prop ] || jQuery.style( elem, prop );
}
}
// Bail out if this is a no-op like .hide().hide()
propTween = !jQuery.isEmptyObject( props );
if ( !propTween && jQuery.isEmptyObject( orig ) ) {
return;
}
// Restrict "overflow" and "display" styles during box animations
if ( isBox && elem.nodeType === 1 ) {
// Support: IE <=9 - 11, Edge 12 - 13
// Record all 3 overflow attributes because IE does not infer the shorthand
// from identically-valued overflowX and overflowY
opts.overflow = [ style.overflow, style.overflowX, style.overflowY ];
// Identify a display type, preferring old show/hide data over the CSS cascade
restoreDisplay = dataShow && dataShow.display;
if ( restoreDisplay == null ) {
restoreDisplay = dataPriv.get( elem, "display" );
}
display = jQuery.css( elem, "display" );
if ( display === "none" ) {
if ( restoreDisplay ) {
display = restoreDisplay;
} else {
// Get nonempty value(s) by temporarily forcing visibility
showHide( [ elem ], true );
restoreDisplay = elem.style.display || restoreDisplay;
display = jQuery.css( elem, "display" );
showHide( [ elem ] );
}
}
// Animate inline elements as inline-block
if ( display === "inline" || display === "inline-block" && restoreDisplay != null ) {
if ( jQuery.css( elem, "float" ) === "none" ) {
// Restore the original display value at the end of pure show/hide animations
if ( !propTween ) {
anim.done( function() {
style.display = restoreDisplay;
} );
if ( restoreDisplay == null ) {
display = style.display;
restoreDisplay = display === "none" ? "" : display;
}
}
style.display = "inline-block";
}
}
}
if ( opts.overflow ) {
style.overflow = "hidden";
anim.always( function() {
style.overflow = opts.overflow[ 0 ];
style.overflowX = opts.overflow[ 1 ];
style.overflowY = opts.overflow[ 2 ];
} );
}
// Implement show/hide animations
propTween = false;
for ( prop in orig ) {
// General show/hide setup for this element animation
if ( !propTween ) {
if ( dataShow ) {
if ( "hidden" in dataShow ) {
hidden = dataShow.hidden;
}
} else {
dataShow = dataPriv.access( elem, "fxshow", { display: restoreDisplay } );
}
// Store hidden/visible for toggle so `.stop().toggle()` "reverses"
if ( toggle ) {
dataShow.hidden = !hidden;
}
// Show elements before animating them
if ( hidden ) {
showHide( [ elem ], true );
}
/* eslint-disable no-loop-func */
anim.done( function() {
/* eslint-enable no-loop-func */
// The final step of a "hide" animation is actually hiding the element
if ( !hidden ) {
showHide( [ elem ] );
}
dataPriv.remove( elem, "fxshow" );
for ( prop in orig ) {
jQuery.style( elem, prop, orig[ prop ] );
}
} );
}
// Per-property setup
propTween = createTween( hidden ? dataShow[ prop ] : 0, prop, anim );
if ( !( prop in dataShow ) ) {
dataShow[ prop ] = propTween.start;
if ( hidden ) {
propTween.end = propTween.start;
propTween.start = 0;
}
}
}
}
function propFilter( props, specialEasing ) {
var index, name, easing, value, hooks;
// camelCase, specialEasing and expand cssHook pass
for ( index in props ) {
name = jQuery.camelCase( index );
easing = specialEasing[ name ];
value = props[ index ];
if ( jQuery.isArray( value ) ) {
easing = value[ 1 ];
value = props[ index ] = value[ 0 ];
}
if ( index !== name ) {
props[ name ] = value;
delete props[ index ];
}
hooks = jQuery.cssHooks[ name ];
if ( hooks && "expand" in hooks ) {
value = hooks.expand( value );
delete props[ name ];
// Not quite $.extend, this won't overwrite existing keys.
// Reusing 'index' because we have the correct "name"
for ( index in value ) {
if ( !( index in props ) ) {
props[ index ] = value[ index ];
specialEasing[ index ] = easing;
}
}
} else {
specialEasing[ name ] = easing;
}
}
}
function Animation( elem, properties, options ) {
var result,
stopped,
index = 0,
length = Animation.prefilters.length,
deferred = jQuery.Deferred().always( function() {
// Don't match elem in the :animated selector
delete tick.elem;
} ),
tick = function() {
if ( stopped ) {
return false;
}
var currentTime = fxNow || createFxNow(),
remaining = Math.max( 0, animation.startTime + animation.duration - currentTime ),
// Support: Android 2.3 only
// Archaic crash bug won't allow us to use `1 - ( 0.5 || 0 )` (#12497)
temp = remaining / animation.duration || 0,
percent = 1 - temp,
index = 0,
length = animation.tweens.length;
for ( ; index < length; index++ ) {
animation.tweens[ index ].run( percent );
}
deferred.notifyWith( elem, [ animation, percent, remaining ] );
if ( percent < 1 && length ) {
return remaining;
} else {
deferred.resolveWith( elem, [ animation ] );
return false;
}
},
animation = deferred.promise( {
elem: elem,
props: jQuery.extend( {}, properties ),
opts: jQuery.extend( true, {
specialEasing: {},
easing: jQuery.easing._default
}, options ),
originalProperties: properties,
originalOptions: options,
startTime: fxNow || createFxNow(),
duration: options.duration,
tweens: [],
createTween: function( prop, end ) {
var tween = jQuery.Tween( elem, animation.opts, prop, end,
animation.opts.specialEasing[ prop ] || animation.opts.easing );
animation.tweens.push( tween );
return tween;
},
stop: function( gotoEnd ) {
var index = 0,
// If we are going to the end, we want to run all the tweens
// otherwise we skip this part
length = gotoEnd ? animation.tweens.length : 0;
if ( stopped ) {
return this;
}
stopped = true;
for ( ; index < length; index++ ) {
animation.tweens[ index ].run( 1 );
}
// Resolve when we played the last frame; otherwise, reject
if ( gotoEnd ) {
deferred.notifyWith( elem, [ animation, 1, 0 ] );
deferred.resolveWith( elem, [ animation, gotoEnd ] );
} else {
deferred.rejectWith( elem, [ animation, gotoEnd ] );
}
return this;
}
} ),
props = animation.props;
propFilter( props, animation.opts.specialEasing );
for ( ; index < length; index++ ) {
result = Animation.prefilters[ index ].call( animation, elem, props, animation.opts );
if ( result ) {
if ( jQuery.isFunction( result.stop ) ) {
jQuery._queueHooks( animation.elem, animation.opts.queue ).stop =
jQuery.proxy( result.stop, result );
}
return result;
}
}
jQuery.map( props, createTween, animation );
if ( jQuery.isFunction( animation.opts.start ) ) {
animation.opts.start.call( elem, animation );
}
jQuery.fx.timer(
jQuery.extend( tick, {
elem: elem,
anim: animation,
queue: animation.opts.queue
} )
);
// attach callbacks from options
return animation.progress( animation.opts.progress )
.done( animation.opts.done, animation.opts.complete )
.fail( animation.opts.fail )
.always( animation.opts.always );
}
jQuery.Animation = jQuery.extend( Animation, {
tweeners: {
"*": [ function( prop, value ) {
var tween = this.createTween( prop, value );
adjustCSS( tween.elem, prop, rcssNum.exec( value ), tween );
return tween;
} ]
},
tweener: function( props, callback ) {
if ( jQuery.isFunction( props ) ) {
callback = props;
props = [ "*" ];
} else {
props = props.match( rnothtmlwhite );
}
var prop,
index = 0,
length = props.length;
for ( ; index < length; index++ ) {
prop = props[ index ];
Animation.tweeners[ prop ] = Animation.tweeners[ prop ] || [];
Animation.tweeners[ prop ].unshift( callback );
}
},
prefilters: [ defaultPrefilter ],
prefilter: function( callback, prepend ) {
if ( prepend ) {
Animation.prefilters.unshift( callback );
} else {
Animation.prefilters.push( callback );
}
}
} );
jQuery.speed = function( speed, easing, fn ) {
var opt = speed && typeof speed === "object" ? jQuery.extend( {}, speed ) : {
complete: fn || !fn && easing ||
jQuery.isFunction( speed ) && speed,
duration: speed,
easing: fn && easing || easing && !jQuery.isFunction( easing ) && easing
};
// Go to the end state if fx are off or if document is hidden
if ( jQuery.fx.off || document.hidden ) {
opt.duration = 0;
} else {
if ( typeof opt.duration !== "number" ) {
if ( opt.duration in jQuery.fx.speeds ) {
opt.duration = jQuery.fx.speeds[ opt.duration ];
} else {
opt.duration = jQuery.fx.speeds._default;
}
}
}
// Normalize opt.queue - true/undefined/null -> "fx"
if ( opt.queue == null || opt.queue === true ) {
opt.queue = "fx";
}
// Queueing
opt.old = opt.complete;
opt.complete = function() {
if ( jQuery.isFunction( opt.old ) ) {
opt.old.call( this );
}
if ( opt.queue ) {
jQuery.dequeue( this, opt.queue );
}
};
return opt;
};
jQuery.fn.extend( {
fadeTo: function( speed, to, easing, callback ) {
// Show any hidden elements after setting opacity to 0
return this.filter( isHiddenWithinTree ).css( "opacity", 0 ).show()
// Animate to the value specified
.end().animate( { opacity: to }, speed, easing, callback );
},
animate: function( prop, speed, easing, callback ) {
var empty = jQuery.isEmptyObject( prop ),
optall = jQuery.speed( speed, easing, callback ),
doAnimation = function() {
// Operate on a copy of prop so per-property easing won't be lost
var anim = Animation( this, jQuery.extend( {}, prop ), optall );
// Empty animations, or finishing resolves immediately
if ( empty || dataPriv.get( this, "finish" ) ) {
anim.stop( true );
}
};
doAnimation.finish = doAnimation;
return empty || optall.queue === false ?
this.each( doAnimation ) :
this.queue( optall.queue, doAnimation );
},
stop: function( type, clearQueue, gotoEnd ) {
var stopQueue = function( hooks ) {
var stop = hooks.stop;
delete hooks.stop;
stop( gotoEnd );
};
if ( typeof type !== "string" ) {
gotoEnd = clearQueue;
clearQueue = type;
type = undefined;
}
if ( clearQueue && type !== false ) {
this.queue( type || "fx", [] );
}
return this.each( function() {
var dequeue = true,
index = type != null && type + "queueHooks",
timers = jQuery.timers,
data = dataPriv.get( this );
if ( index ) {
if ( data[ index ] && data[ index ].stop ) {
stopQueue( data[ index ] );
}
} else {
for ( index in data ) {
if ( data[ index ] && data[ index ].stop && rrun.test( index ) ) {
stopQueue( data[ index ] );
}
}
}
for ( index = timers.length; index--; ) {
if ( timers[ index ].elem === this &&
( type == null || timers[ index ].queue === type ) ) {
timers[ index ].anim.stop( gotoEnd );
dequeue = false;
timers.splice( index, 1 );
}
}
// Start the next in the queue if the last step wasn't forced.
// Timers currently will call their complete callbacks, which
// will dequeue but only if they were gotoEnd.
if ( dequeue || !gotoEnd ) {
jQuery.dequeue( this, type );
}
} );
},
finish: function( type ) {
if ( type !== false ) {
type = type || "fx";
}
return this.each( function() {
var index,
data = dataPriv.get( this ),
queue = data[ type + "queue" ],
hooks = data[ type + "queueHooks" ],
timers = jQuery.timers,
length = queue ? queue.length : 0;
// Enable finishing flag on private data
data.finish = true;
// Empty the queue first
jQuery.queue( this, type, [] );
if ( hooks && hooks.stop ) {
hooks.stop.call( this, true );
}
// Look for any active animations, and finish them
for ( index = timers.length; index--; ) {
if ( timers[ index ].elem === this && timers[ index ].queue === type ) {
timers[ index ].anim.stop( true );
timers.splice( index, 1 );
}
}
// Look for any animations in the old queue and finish them
for ( index = 0; index < length; index++ ) {
if ( queue[ index ] && queue[ index ].finish ) {
queue[ index ].finish.call( this );
}
}
// Turn off finishing flag
delete data.finish;
} );
}
} );
jQuery.each( [ "toggle", "show", "hide" ], function( i, name ) {
var cssFn = jQuery.fn[ name ];
jQuery.fn[ name ] = function( speed, easing, callback ) {
return speed == null || typeof speed === "boolean" ?
cssFn.apply( this, arguments ) :
this.animate( genFx( name, true ), speed, easing, callback );
};
} );
// Generate shortcuts for custom animations
jQuery.each( {
slideDown: genFx( "show" ),
slideUp: genFx( "hide" ),
slideToggle: genFx( "toggle" ),
fadeIn: { opacity: "show" },
fadeOut: { opacity: "hide" },
fadeToggle: { opacity: "toggle" }
}, function( name, props ) {
jQuery.fn[ name ] = function( speed, easing, callback ) {
return this.animate( props, speed, easing, callback );
};
} );
jQuery.timers = [];
jQuery.fx.tick = function() {
var timer,
i = 0,
timers = jQuery.timers;
fxNow = jQuery.now();
for ( ; i < timers.length; i++ ) {
timer = timers[ i ];
// Checks the timer has not already been removed
if ( !timer() && timers[ i ] === timer ) {
timers.splice( i--, 1 );
}
}
if ( !timers.length ) {
jQuery.fx.stop();
}
fxNow = undefined;
};
jQuery.fx.timer = function( timer ) {
jQuery.timers.push( timer );
if ( timer() ) {
jQuery.fx.start();
} else {
jQuery.timers.pop();
}
};
jQuery.fx.interval = 13;
jQuery.fx.start = function() {
if ( !timerId ) {
timerId = window.requestAnimationFrame ?
window.requestAnimationFrame( raf ) :
window.setInterval( jQuery.fx.tick, jQuery.fx.interval );
}
};
jQuery.fx.stop = function() {
if ( window.cancelAnimationFrame ) {
window.cancelAnimationFrame( timerId );
} else {
window.clearInterval( timerId );
}
timerId = null;
};
jQuery.fx.speeds = {
slow: 600,
fast: 200,
// Default speed
_default: 400
};
// Based off of the plugin by Clint Helfers, with permission.
// https://web.archive.org/web/20100324014747/http://blindsignals.com/index.php/2009/07/jquery-delay/
jQuery.fn.delay = function( time, type ) {
time = jQuery.fx ? jQuery.fx.speeds[ time ] || time : time;
type = type || "fx";
return this.queue( type, function( next, hooks ) {
var timeout = window.setTimeout( next, time );
hooks.stop = function() {
window.clearTimeout( timeout );
};
} );
};
( function() {
var input = document.createElement( "input" ),
select = document.createElement( "select" ),
opt = select.appendChild( document.createElement( "option" ) );
input.type = "checkbox";
// Support: Android <=4.3 only
// Default value for a checkbox should be "on"
support.checkOn = input.value !== "";
// Support: IE <=11 only
// Must access selectedIndex to make default options select
support.optSelected = opt.selected;
// Support: IE <=11 only
// An input loses its value after becoming a radio
input = document.createElement( "input" );
input.value = "t";
input.type = "radio";
support.radioValue = input.value === "t";
} )();
var boolHook,
attrHandle = jQuery.expr.attrHandle;
jQuery.fn.extend( {
attr: function( name, value ) {
return access( this, jQuery.attr, name, value, arguments.length > 1 );
},
removeAttr: function( name ) {
return this.each( function() {
jQuery.removeAttr( this, name );
} );
}
} );
jQuery.extend( {
attr: function( elem, name, value ) {
var ret, hooks,
nType = elem.nodeType;
// Don't get/set attributes on text, comment and attribute nodes
if ( nType === 3 || nType === 8 || nType === 2 ) {
return;
}
// Fallback to prop when attributes are not supported
if ( typeof elem.getAttribute === "undefined" ) {
return jQuery.prop( elem, name, value );
}
// Attribute hooks are determined by the lowercase version
// Grab necessary hook if one is defined
if ( nType !== 1 || !jQuery.isXMLDoc( elem ) ) {
hooks = jQuery.attrHooks[ name.toLowerCase() ] ||
( jQuery.expr.match.bool.test( name ) ? boolHook : undefined );
}
if ( value !== undefined ) {
if ( value === null ) {
jQuery.removeAttr( elem, name );
return;
}
if ( hooks && "set" in hooks &&
( ret = hooks.set( elem, value, name ) ) !== undefined ) {
return ret;
}
elem.setAttribute( name, value + "" );
return value;
}
if ( hooks && "get" in hooks && ( ret = hooks.get( elem, name ) ) !== null ) {
return ret;
}
ret = jQuery.find.attr( elem, name );
// Non-existent attributes return null, we normalize to undefined
return ret == null ? undefined : ret;
},
attrHooks: {
type: {
set: function( elem, value ) {
if ( !support.radioValue && value === "radio" &&
jQuery.nodeName( elem, "input" ) ) {
var val = elem.value;
elem.setAttribute( "type", value );
if ( val ) {
elem.value = val;
}
return value;
}
}
}
},
removeAttr: function( elem, value ) {
var name,
i = 0,
// Attribute names can contain non-HTML whitespace characters
// https://html.spec.whatwg.org/multipage/syntax.html#attributes-2
attrNames = value && value.match( rnothtmlwhite );
if ( attrNames && elem.nodeType === 1 ) {
while ( ( name = attrNames[ i++ ] ) ) {
elem.removeAttribute( name );
}
}
}
} );
// Hooks for boolean attributes
boolHook = {
set: function( elem, value, name ) {
if ( value === false ) {
// Remove boolean attributes when set to false
jQuery.removeAttr( elem, name );
} else {
elem.setAttribute( name, name );
}
return name;
}
};
jQuery.each( jQuery.expr.match.bool.source.match( /\w+/g ), function( i, name ) {
var getter = attrHandle[ name ] || jQuery.find.attr;
attrHandle[ name ] = function( elem, name, isXML ) {
var ret, handle,
lowercaseName = name.toLowerCase();
if ( !isXML ) {
// Avoid an infinite loop by temporarily removing this function from the getter
handle = attrHandle[ lowercaseName ];
attrHandle[ lowercaseName ] = ret;
ret = getter( elem, name, isXML ) != null ?
lowercaseName :
null;
attrHandle[ lowercaseName ] = handle;
}
return ret;
};
} );
var rfocusable = /^(?:input|select|textarea|button)$/i,
rclickable = /^(?:a|area)$/i;
jQuery.fn.extend( {
prop: function( name, value ) {
return access( this, jQuery.prop, name, value, arguments.length > 1 );
},
removeProp: function( name ) {
return this.each( function() {
delete this[ jQuery.propFix[ name ] || name ];
} );
}
} );
jQuery.extend( {
prop: function( elem, name, value ) {
var ret, hooks,
nType = elem.nodeType;
// Don't get/set properties on text, comment and attribute nodes
if ( nType === 3 || nType === 8 || nType === 2 ) {
return;
}
if ( nType !== 1 || !jQuery.isXMLDoc( elem ) ) {
// Fix name and attach hooks
name = jQuery.propFix[ name ] || name;
hooks = jQuery.propHooks[ name ];
}
if ( value !== undefined ) {
if ( hooks && "set" in hooks &&
( ret = hooks.set( elem, value, name ) ) !== undefined ) {
return ret;
}
return ( elem[ name ] = value );
}
if ( hooks && "get" in hooks && ( ret = hooks.get( elem, name ) ) !== null ) {
return ret;
}
return elem[ name ];
},
propHooks: {
tabIndex: {
get: function( elem ) {
// Support: IE <=9 - 11 only
// elem.tabIndex doesn't always return the
// correct value when it hasn't been explicitly set
// https://web.archive.org/web/20141116233347/http://fluidproject.org/blog/2008/01/09/getting-setting-and-removing-tabindex-values-with-javascript/
// Use proper attribute retrieval(#12072)
var tabindex = jQuery.find.attr( elem, "tabindex" );
if ( tabindex ) {
return parseInt( tabindex, 10 );
}
if (
rfocusable.test( elem.nodeName ) ||
rclickable.test( elem.nodeName ) &&
elem.href
) {
return 0;
}
return -1;
}
}
},
propFix: {
"for": "htmlFor",
"class": "className"
}
} );
// Support: IE <=11 only
// Accessing the selectedIndex property
// forces the browser to respect setting selected
// on the option
// The getter ensures a default option is selected
// when in an optgroup
// eslint rule "no-unused-expressions" is disabled for this code
// since it considers such accessions noop
if ( !support.optSelected ) {
jQuery.propHooks.selected = {
get: function( elem ) {
/* eslint no-unused-expressions: "off" */
var parent = elem.parentNode;
if ( parent && parent.parentNode ) {
parent.parentNode.selectedIndex;
}
return null;
},
set: function( elem ) {
/* eslint no-unused-expressions: "off" */
var parent = elem.parentNode;
if ( parent ) {
parent.selectedIndex;
if ( parent.parentNode ) {
parent.parentNode.selectedIndex;
}
}
}
};
}
jQuery.each( [
"tabIndex",
"readOnly",
"maxLength",
"cellSpacing",
"cellPadding",
"rowSpan",
"colSpan",
"useMap",
"frameBorder",
"contentEditable"
], function() {
jQuery.propFix[ this.toLowerCase() ] = this;
} );
// Strip and collapse whitespace according to HTML spec
// https://html.spec.whatwg.org/multipage/infrastructure.html#strip-and-collapse-whitespace
function stripAndCollapse( value ) {
var tokens = value.match( rnothtmlwhite ) || [];
return tokens.join( " " );
}
function getClass( elem ) {
return elem.getAttribute && elem.getAttribute( "class" ) || "";
}
jQuery.fn.extend( {
addClass: function( value ) {
var classes, elem, cur, curValue, clazz, j, finalValue,
i = 0;
if ( jQuery.isFunction( value ) ) {
return this.each( function( j ) {
jQuery( this ).addClass( value.call( this, j, getClass( this ) ) );
} );
}
if ( typeof value === "string" && value ) {
classes = value.match( rnothtmlwhite ) || [];
while ( ( elem = this[ i++ ] ) ) {
curValue = getClass( elem );
cur = elem.nodeType === 1 && ( " " + stripAndCollapse( curValue ) + " " );
if ( cur ) {
j = 0;
while ( ( clazz = classes[ j++ ] ) ) {
if ( cur.indexOf( " " + clazz + " " ) < 0 ) {
cur += clazz + " ";
}
}
// Only assign if different to avoid unneeded rendering.
finalValue = stripAndCollapse( cur );
if ( curValue !== finalValue ) {
elem.setAttribute( "class", finalValue );
}
}
}
}
return this;
},
removeClass: function( value ) {
var classes, elem, cur, curValue, clazz, j, finalValue,
i = 0;
if ( jQuery.isFunction( value ) ) {
return this.each( function( j ) {
jQuery( this ).removeClass( value.call( this, j, getClass( this ) ) );
} );
}
if ( !arguments.length ) {
return this.attr( "class", "" );
}
if ( typeof value === "string" && value ) {
classes = value.match( rnothtmlwhite ) || [];
while ( ( elem = this[ i++ ] ) ) {
curValue = getClass( elem );
// This expression is here for better compressibility (see addClass)
cur = elem.nodeType === 1 && ( " " + stripAndCollapse( curValue ) + " " );
if ( cur ) {
j = 0;
while ( ( clazz = classes[ j++ ] ) ) {
// Remove *all* instances
while ( cur.indexOf( " " + clazz + " " ) > -1 ) {
cur = cur.replace( " " + clazz + " ", " " );
}
}
// Only assign if different to avoid unneeded rendering.
finalValue = stripAndCollapse( cur );
if ( curValue !== finalValue ) {
elem.setAttribute( "class", finalValue );
}
}
}
}
return this;
},
toggleClass: function( value, stateVal ) {
var type = typeof value;
if ( typeof stateVal === "boolean" && type === "string" ) {
return stateVal ? this.addClass( value ) : this.removeClass( value );
}
if ( jQuery.isFunction( value ) ) {
return this.each( function( i ) {
jQuery( this ).toggleClass(
value.call( this, i, getClass( this ), stateVal ),
stateVal
);
} );
}
return this.each( function() {
var className, i, self, classNames;
if ( type === "string" ) {
// Toggle individual class names
i = 0;
self = jQuery( this );
classNames = value.match( rnothtmlwhite ) || [];
while ( ( className = classNames[ i++ ] ) ) {
// Check each className given, space separated list
if ( self.hasClass( className ) ) {
self.removeClass( className );
} else {
self.addClass( className );
}
}
// Toggle whole class name
} else if ( value === undefined || type === "boolean" ) {
className = getClass( this );
if ( className ) {
// Store className if set
dataPriv.set( this, "__className__", className );
}
// If the element has a class name or if we're passed `false`,
// then remove the whole classname (if there was one, the above saved it).
// Otherwise bring back whatever was previously saved (if anything),
// falling back to the empty string if nothing was stored.
if ( this.setAttribute ) {
this.setAttribute( "class",
className || value === false ?
"" :
dataPriv.get( this, "__className__" ) || ""
);
}
}
} );
},
hasClass: function( selector ) {
var className, elem,
i = 0;
className = " " + selector + " ";
while ( ( elem = this[ i++ ] ) ) {
if ( elem.nodeType === 1 &&
( " " + stripAndCollapse( getClass( elem ) ) + " " ).indexOf( className ) > -1 ) {
return true;
}
}
return false;
}
} );
var rreturn = /\r/g;
jQuery.fn.extend( {
val: function( value ) {
var hooks, ret, isFunction,
elem = this[ 0 ];
if ( !arguments.length ) {
if ( elem ) {
hooks = jQuery.valHooks[ elem.type ] ||
jQuery.valHooks[ elem.nodeName.toLowerCase() ];
if ( hooks &&
"get" in hooks &&
( ret = hooks.get( elem, "value" ) ) !== undefined
) {
return ret;
}
ret = elem.value;
// Handle most common string cases
if ( typeof ret === "string" ) {
return ret.replace( rreturn, "" );
}
// Handle cases where value is null/undef or number
return ret == null ? "" : ret;
}
return;
}
isFunction = jQuery.isFunction( value );
return this.each( function( i ) {
var val;
if ( this.nodeType !== 1 ) {
return;
}
if ( isFunction ) {
val = value.call( this, i, jQuery( this ).val() );
} else {
val = value;
}
// Treat null/undefined as ""; convert numbers to string
if ( val == null ) {
val = "";
} else if ( typeof val === "number" ) {
val += "";
} else if ( jQuery.isArray( val ) ) {
val = jQuery.map( val, function( value ) {
return value == null ? "" : value + "";
} );
}
hooks = jQuery.valHooks[ this.type ] || jQuery.valHooks[ this.nodeName.toLowerCase() ];
// If set returns undefined, fall back to normal setting
if ( !hooks || !( "set" in hooks ) || hooks.set( this, val, "value" ) === undefined ) {
this.value = val;
}
} );
}
} );
jQuery.extend( {
valHooks: {
option: {
get: function( elem ) {
var val = jQuery.find.attr( elem, "value" );
return val != null ?
val :
// Support: IE <=10 - 11 only
// option.text throws exceptions (#14686, #14858)
// Strip and collapse whitespace
// https://html.spec.whatwg.org/#strip-and-collapse-whitespace
stripAndCollapse( jQuery.text( elem ) );
}
},
select: {
get: function( elem ) {
var value, option, i,
options = elem.options,
index = elem.selectedIndex,
one = elem.type === "select-one",
values = one ? null : [],
max = one ? index + 1 : options.length;
if ( index < 0 ) {
i = max;
} else {
i = one ? index : 0;
}
// Loop through all the selected options
for ( ; i < max; i++ ) {
option = options[ i ];
// Support: IE <=9 only
// IE8-9 doesn't update selected after form reset (#2551)
if ( ( option.selected || i === index ) &&
// Don't return options that are disabled or in a disabled optgroup
!option.disabled &&
( !option.parentNode.disabled ||
!jQuery.nodeName( option.parentNode, "optgroup" ) ) ) {
// Get the specific value for the option
value = jQuery( option ).val();
// We don't need an array for one selects
if ( one ) {
return value;
}
// Multi-Selects return an array
values.push( value );
}
}
return values;
},
set: function( elem, value ) {
var optionSet, option,
options = elem.options,
values = jQuery.makeArray( value ),
i = options.length;
while ( i-- ) {
option = options[ i ];
/* eslint-disable no-cond-assign */
if ( option.selected =
jQuery.inArray( jQuery.valHooks.option.get( option ), values ) > -1
) {
optionSet = true;
}
/* eslint-enable no-cond-assign */
}
// Force browsers to behave consistently when non-matching value is set
if ( !optionSet ) {
elem.selectedIndex = -1;
}
return values;
}
}
}
} );
// Radios and checkboxes getter/setter
jQuery.each( [ "radio", "checkbox" ], function() {
jQuery.valHooks[ this ] = {
set: function( elem, value ) {
if ( jQuery.isArray( value ) ) {
return ( elem.checked = jQuery.inArray( jQuery( elem ).val(), value ) > -1 );
}
}
};
if ( !support.checkOn ) {
jQuery.valHooks[ this ].get = function( elem ) {
return elem.getAttribute( "value" ) === null ? "on" : elem.value;
};
}
} );
// Return jQuery for attributes-only inclusion
var rfocusMorph = /^(?:focusinfocus|focusoutblur)$/;
jQuery.extend( jQuery.event, {
trigger: function( event, data, elem, onlyHandlers ) {
var i, cur, tmp, bubbleType, ontype, handle, special,
eventPath = [ elem || document ],
type = hasOwn.call( event, "type" ) ? event.type : event,
namespaces = hasOwn.call( event, "namespace" ) ? event.namespace.split( "." ) : [];
cur = tmp = elem = elem || document;
// Don't do events on text and comment nodes
if ( elem.nodeType === 3 || elem.nodeType === 8 ) {
return;
}
// focus/blur morphs to focusin/out; ensure we're not firing them right now
if ( rfocusMorph.test( type + jQuery.event.triggered ) ) {
return;
}
if ( type.indexOf( "." ) > -1 ) {
// Namespaced trigger; create a regexp to match event type in handle()
namespaces = type.split( "." );
type = namespaces.shift();
namespaces.sort();
}
ontype = type.indexOf( ":" ) < 0 && "on" + type;
// Caller can pass in a jQuery.Event object, Object, or just an event type string
event = event[ jQuery.expando ] ?
event :
new jQuery.Event( type, typeof event === "object" && event );
// Trigger bitmask: & 1 for native handlers; & 2 for jQuery (always true)
event.isTrigger = onlyHandlers ? 2 : 3;
event.namespace = namespaces.join( "." );
event.rnamespace = event.namespace ?
new RegExp( "(^|\\.)" + namespaces.join( "\\.(?:.*\\.|)" ) + "(\\.|$)" ) :
null;
// Clean up the event in case it is being reused
event.result = undefined;
if ( !event.target ) {
event.target = elem;
}
// Clone any incoming data and prepend the event, creating the handler arg list
data = data == null ?
[ event ] :
jQuery.makeArray( data, [ event ] );
// Allow special events to draw outside the lines
special = jQuery.event.special[ type ] || {};
if ( !onlyHandlers && special.trigger && special.trigger.apply( elem, data ) === false ) {
return;
}
// Determine event propagation path in advance, per W3C events spec (#9951)
// Bubble up to document, then to window; watch for a global ownerDocument var (#9724)
if ( !onlyHandlers && !special.noBubble && !jQuery.isWindow( elem ) ) {
bubbleType = special.delegateType || type;
if ( !rfocusMorph.test( bubbleType + type ) ) {
cur = cur.parentNode;
}
for ( ; cur; cur = cur.parentNode ) {
eventPath.push( cur );
tmp = cur;
}
// Only add window if we got to document (e.g., not plain obj or detached DOM)
if ( tmp === ( elem.ownerDocument || document ) ) {
eventPath.push( tmp.defaultView || tmp.parentWindow || window );
}
}
// Fire handlers on the event path
i = 0;
while ( ( cur = eventPath[ i++ ] ) && !event.isPropagationStopped() ) {
event.type = i > 1 ?
bubbleType :
special.bindType || type;
// jQuery handler
handle = ( dataPriv.get( cur, "events" ) || {} )[ event.type ] &&
dataPriv.get( cur, "handle" );
if ( handle ) {
handle.apply( cur, data );
}
// Native handler
handle = ontype && cur[ ontype ];
if ( handle && handle.apply && acceptData( cur ) ) {
event.result = handle.apply( cur, data );
if ( event.result === false ) {
event.preventDefault();
}
}
}
event.type = type;
// If nobody prevented the default action, do it now
if ( !onlyHandlers && !event.isDefaultPrevented() ) {
if ( ( !special._default ||
special._default.apply( eventPath.pop(), data ) === false ) &&
acceptData( elem ) ) {
// Call a native DOM method on the target with the same name as the event.
// Don't do default actions on window, that's where global variables be (#6170)
if ( ontype && jQuery.isFunction( elem[ type ] ) && !jQuery.isWindow( elem ) ) {
// Don't re-trigger an onFOO event when we call its FOO() method
tmp = elem[ ontype ];
if ( tmp ) {
elem[ ontype ] = null;
}
// Prevent re-triggering of the same event, since we already bubbled it above
jQuery.event.triggered = type;
elem[ type ]();
jQuery.event.triggered = undefined;
if ( tmp ) {
elem[ ontype ] = tmp;
}
}
}
}
return event.result;
},
// Piggyback on a donor event to simulate a different one
// Used only for `focus(in | out)` events
simulate: function( type, elem, event ) {
var e = jQuery.extend(
new jQuery.Event(),
event,
{
type: type,
isSimulated: true
}
);
jQuery.event.trigger( e, null, elem );
}
} );
jQuery.fn.extend( {
trigger: function( type, data ) {
return this.each( function() {
jQuery.event.trigger( type, data, this );
} );
},
triggerHandler: function( type, data ) {
var elem = this[ 0 ];
if ( elem ) {
return jQuery.event.trigger( type, data, elem, true );
}
}
} );
jQuery.each( ( "blur focus focusin focusout resize scroll click dblclick " +
"mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave " +
"change select submit keydown keypress keyup contextmenu" ).split( " " ),
function( i, name ) {
// Handle event binding
jQuery.fn[ name ] = function( data, fn ) {
return arguments.length > 0 ?
this.on( name, null, data, fn ) :
this.trigger( name );
};
} );
jQuery.fn.extend( {
hover: function( fnOver, fnOut ) {
return this.mouseenter( fnOver ).mouseleave( fnOut || fnOver );
}
} );
support.focusin = "onfocusin" in window;
// Support: Firefox <=44
// Firefox doesn't have focus(in | out) events
// Related ticket - https://bugzilla.mozilla.org/show_bug.cgi?id=687787
//
// Support: Chrome <=48 - 49, Safari <=9.0 - 9.1
// focus(in | out) events fire after focus & blur events,
// which is spec violation - http://www.w3.org/TR/DOM-Level-3-Events/#events-focusevent-event-order
// Related ticket - https://bugs.chromium.org/p/chromium/issues/detail?id=449857
if ( !support.focusin ) {
jQuery.each( { focus: "focusin", blur: "focusout" }, function( orig, fix ) {
// Attach a single capturing handler on the document while someone wants focusin/focusout
var handler = function( event ) {
jQuery.event.simulate( fix, event.target, jQuery.event.fix( event ) );
};
jQuery.event.special[ fix ] = {
setup: function() {
var doc = this.ownerDocument || this,
attaches = dataPriv.access( doc, fix );
if ( !attaches ) {
doc.addEventListener( orig, handler, true );
}
dataPriv.access( doc, fix, ( attaches || 0 ) + 1 );
},
teardown: function() {
var doc = this.ownerDocument || this,
attaches = dataPriv.access( doc, fix ) - 1;
if ( !attaches ) {
doc.removeEventListener( orig, handler, true );
dataPriv.remove( doc, fix );
} else {
dataPriv.access( doc, fix, attaches );
}
}
};
} );
}
var location = window.location;
var nonce = jQuery.now();
var rquery = ( /\?/ );
// Cross-browser xml parsing
jQuery.parseXML = function( data ) {
var xml;
if ( !data || typeof data !== "string" ) {
return null;
}
// Support: IE 9 - 11 only
// IE throws on parseFromString with invalid input.
try {
xml = ( new window.DOMParser() ).parseFromString( data, "text/xml" );
} catch ( e ) {
xml = undefined;
}
if ( !xml || xml.getElementsByTagName( "parsererror" ).length ) {
jQuery.error( "Invalid XML: " + data );
}
return xml;
};
var
rbracket = /\[\]$/,
rCRLF = /\r?\n/g,
rsubmitterTypes = /^(?:submit|button|image|reset|file)$/i,
rsubmittable = /^(?:input|select|textarea|keygen)/i;
function buildParams( prefix, obj, traditional, add ) {
var name;
if ( jQuery.isArray( obj ) ) {
// Serialize array item.
jQuery.each( obj, function( i, v ) {
if ( traditional || rbracket.test( prefix ) ) {
// Treat each array item as a scalar.
add( prefix, v );
} else {
// Item is non-scalar (array or object), encode its numeric index.
buildParams(
prefix + "[" + ( typeof v === "object" && v != null ? i : "" ) + "]",
v,
traditional,
add
);
}
} );
} else if ( !traditional && jQuery.type( obj ) === "object" ) {
// Serialize object item.
for ( name in obj ) {
buildParams( prefix + "[" + name + "]", obj[ name ], traditional, add );
}
} else {
// Serialize scalar item.
add( prefix, obj );
}
}
// Serialize an array of form elements or a set of
// key/values into a query string
jQuery.param = function( a, traditional ) {
var prefix,
s = [],
add = function( key, valueOrFunction ) {
// If value is a function, invoke it and use its return value
var value = jQuery.isFunction( valueOrFunction ) ?
valueOrFunction() :
valueOrFunction;
s[ s.length ] = encodeURIComponent( key ) + "=" +
encodeURIComponent( value == null ? "" : value );
};
// If an array was passed in, assume that it is an array of form elements.
if ( jQuery.isArray( a ) || ( a.jquery && !jQuery.isPlainObject( a ) ) ) {
// Serialize the form elements
jQuery.each( a, function() {
add( this.name, this.value );
} );
} else {
// If traditional, encode the "old" way (the way 1.3.2 or older
// did it), otherwise encode params recursively.
for ( prefix in a ) {
buildParams( prefix, a[ prefix ], traditional, add );
}
}
// Return the resulting serialization
return s.join( "&" );
};
jQuery.fn.extend( {
serialize: function() {
return jQuery.param( this.serializeArray() );
},
serializeArray: function() {
return this.map( function() {
// Can add propHook for "elements" to filter or add form elements
var elements = jQuery.prop( this, "elements" );
return elements ? jQuery.makeArray( elements ) : this;
} )
.filter( function() {
var type = this.type;
// Use .is( ":disabled" ) so that fieldset[disabled] works
return this.name && !jQuery( this ).is( ":disabled" ) &&
rsubmittable.test( this.nodeName ) && !rsubmitterTypes.test( type ) &&
( this.checked || !rcheckableType.test( type ) );
} )
.map( function( i, elem ) {
var val = jQuery( this ).val();
if ( val == null ) {
return null;
}
if ( jQuery.isArray( val ) ) {
return jQuery.map( val, function( val ) {
return { name: elem.name, value: val.replace( rCRLF, "\r\n" ) };
} );
}
return { name: elem.name, value: val.replace( rCRLF, "\r\n" ) };
} ).get();
}
} );
var
r20 = /%20/g,
rhash = /#.*$/,
rantiCache = /([?&])_=[^&]*/,
rheaders = /^(.*?):[ \t]*([^\r\n]*)$/mg,
// #7653, #8125, #8152: local protocol detection
rlocalProtocol = /^(?:about|app|app-storage|.+-extension|file|res|widget):$/,
rnoContent = /^(?:GET|HEAD)$/,
rprotocol = /^\/\//,
/* Prefilters
* 1) They are useful to introduce custom dataTypes (see ajax/jsonp.js for an example)
* 2) These are called:
* - BEFORE asking for a transport
* - AFTER param serialization (s.data is a string if s.processData is true)
* 3) key is the dataType
* 4) the catchall symbol "*" can be used
* 5) execution will start with transport dataType and THEN continue down to "*" if needed
*/
prefilters = {},
/* Transports bindings
* 1) key is the dataType
* 2) the catchall symbol "*" can be used
* 3) selection will start with transport dataType and THEN go to "*" if needed
*/
transports = {},
// Avoid comment-prolog char sequence (#10098); must appease lint and evade compression
allTypes = "*/".concat( "*" ),
// Anchor tag for parsing the document origin
originAnchor = document.createElement( "a" );
originAnchor.href = location.href;
// Base "constructor" for jQuery.ajaxPrefilter and jQuery.ajaxTransport
function addToPrefiltersOrTransports( structure ) {
// dataTypeExpression is optional and defaults to "*"
return function( dataTypeExpression, func ) {
if ( typeof dataTypeExpression !== "string" ) {
func = dataTypeExpression;
dataTypeExpression = "*";
}
var dataType,
i = 0,
dataTypes = dataTypeExpression.toLowerCase().match( rnothtmlwhite ) || [];
if ( jQuery.isFunction( func ) ) {
// For each dataType in the dataTypeExpression
while ( ( dataType = dataTypes[ i++ ] ) ) {
// Prepend if requested
if ( dataType[ 0 ] === "+" ) {
dataType = dataType.slice( 1 ) || "*";
( structure[ dataType ] = structure[ dataType ] || [] ).unshift( func );
// Otherwise append
} else {
( structure[ dataType ] = structure[ dataType ] || [] ).push( func );
}
}
}
};
}
// Base inspection function for prefilters and transports
function inspectPrefiltersOrTransports( structure, options, originalOptions, jqXHR ) {
var inspected = {},
seekingTransport = ( structure === transports );
function inspect( dataType ) {
var selected;
inspected[ dataType ] = true;
jQuery.each( structure[ dataType ] || [], function( _, prefilterOrFactory ) {
var dataTypeOrTransport = prefilterOrFactory( options, originalOptions, jqXHR );
if ( typeof dataTypeOrTransport === "string" &&
!seekingTransport && !inspected[ dataTypeOrTransport ] ) {
options.dataTypes.unshift( dataTypeOrTransport );
inspect( dataTypeOrTransport );
return false;
} else if ( seekingTransport ) {
return !( selected = dataTypeOrTransport );
}
} );
return selected;
}
return inspect( options.dataTypes[ 0 ] ) || !inspected[ "*" ] && inspect( "*" );
}
// A special extend for ajax options
// that takes "flat" options (not to be deep extended)
// Fixes #9887
function ajaxExtend( target, src ) {
var key, deep,
flatOptions = jQuery.ajaxSettings.flatOptions || {};
for ( key in src ) {
if ( src[ key ] !== undefined ) {
( flatOptions[ key ] ? target : ( deep || ( deep = {} ) ) )[ key ] = src[ key ];
}
}
if ( deep ) {
jQuery.extend( true, target, deep );
}
return target;
}
/* Handles responses to an ajax request:
* - finds the right dataType (mediates between content-type and expected dataType)
* - returns the corresponding response
*/
function ajaxHandleResponses( s, jqXHR, responses ) {
var ct, type, finalDataType, firstDataType,
contents = s.contents,
dataTypes = s.dataTypes;
// Remove auto dataType and get content-type in the process
while ( dataTypes[ 0 ] === "*" ) {
dataTypes.shift();
if ( ct === undefined ) {
ct = s.mimeType || jqXHR.getResponseHeader( "Content-Type" );
}
}
// Check if we're dealing with a known content-type
if ( ct ) {
for ( type in contents ) {
if ( contents[ type ] && contents[ type ].test( ct ) ) {
dataTypes.unshift( type );
break;
}
}
}
// Check to see if we have a response for the expected dataType
if ( dataTypes[ 0 ] in responses ) {
finalDataType = dataTypes[ 0 ];
} else {
// Try convertible dataTypes
for ( type in responses ) {
if ( !dataTypes[ 0 ] || s.converters[ type + " " + dataTypes[ 0 ] ] ) {
finalDataType = type;
break;
}
if ( !firstDataType ) {
firstDataType = type;
}
}
// Or just use first one
finalDataType = finalDataType || firstDataType;
}
// If we found a dataType
// We add the dataType to the list if needed
// and return the corresponding response
if ( finalDataType ) {
if ( finalDataType !== dataTypes[ 0 ] ) {
dataTypes.unshift( finalDataType );
}
return responses[ finalDataType ];
}
}
/* Chain conversions given the request and the original response
* Also sets the responseXXX fields on the jqXHR instance
*/
function ajaxConvert( s, response, jqXHR, isSuccess ) {
var conv2, current, conv, tmp, prev,
converters = {},
// Work with a copy of dataTypes in case we need to modify it for conversion
dataTypes = s.dataTypes.slice();
// Create converters map with lowercased keys
if ( dataTypes[ 1 ] ) {
for ( conv in s.converters ) {
converters[ conv.toLowerCase() ] = s.converters[ conv ];
}
}
current = dataTypes.shift();
// Convert to each sequential dataType
while ( current ) {
if ( s.responseFields[ current ] ) {
jqXHR[ s.responseFields[ current ] ] = response;
}
// Apply the dataFilter if provided
if ( !prev && isSuccess && s.dataFilter ) {
response = s.dataFilter( response, s.dataType );
}
prev = current;
current = dataTypes.shift();
if ( current ) {
// There's only work to do if current dataType is non-auto
if ( current === "*" ) {
current = prev;
// Convert response if prev dataType is non-auto and differs from current
} else if ( prev !== "*" && prev !== current ) {
// Seek a direct converter
conv = converters[ prev + " " + current ] || converters[ "* " + current ];
// If none found, seek a pair
if ( !conv ) {
for ( conv2 in converters ) {
// If conv2 outputs current
tmp = conv2.split( " " );
if ( tmp[ 1 ] === current ) {
// If prev can be converted to accepted input
conv = converters[ prev + " " + tmp[ 0 ] ] ||
converters[ "* " + tmp[ 0 ] ];
if ( conv ) {
// Condense equivalence converters
if ( conv === true ) {
conv = converters[ conv2 ];
// Otherwise, insert the intermediate dataType
} else if ( converters[ conv2 ] !== true ) {
current = tmp[ 0 ];
dataTypes.unshift( tmp[ 1 ] );
}
break;
}
}
}
}
// Apply converter (if not an equivalence)
if ( conv !== true ) {
// Unless errors are allowed to bubble, catch and return them
if ( conv && s.throws ) {
response = conv( response );
} else {
try {
response = conv( response );
} catch ( e ) {
return {
state: "parsererror",
error: conv ? e : "No conversion from " + prev + " to " + current
};
}
}
}
}
}
}
return { state: "success", data: response };
}
jQuery.extend( {
// Counter for holding the number of active queries
active: 0,
// Last-Modified header cache for next request
lastModified: {},
etag: {},
ajaxSettings: {
url: location.href,
type: "GET",
isLocal: rlocalProtocol.test( location.protocol ),
global: true,
processData: true,
async: true,
contentType: "application/x-www-form-urlencoded; charset=UTF-8",
/*
timeout: 0,
data: null,
dataType: null,
username: null,
password: null,
cache: null,
throws: false,
traditional: false,
headers: {},
*/
accepts: {
"*": allTypes,
text: "text/plain",
html: "text/html",
xml: "application/xml, text/xml",
json: "application/json, text/javascript"
},
contents: {
xml: /\bxml\b/,
html: /\bhtml/,
json: /\bjson\b/
},
responseFields: {
xml: "responseXML",
text: "responseText",
json: "responseJSON"
},
// Data converters
// Keys separate source (or catchall "*") and destination types with a single space
converters: {
// Convert anything to text
"* text": String,
// Text to html (true = no transformation)
"text html": true,
// Evaluate text as a json expression
"text json": JSON.parse,
// Parse text as xml
"text xml": jQuery.parseXML
},
// For options that shouldn't be deep extended:
// you can add your own custom options here if
// and when you create one that shouldn't be
// deep extended (see ajaxExtend)
flatOptions: {
url: true,
context: true
}
},
// Creates a full fledged settings object into target
// with both ajaxSettings and settings fields.
// If target is omitted, writes into ajaxSettings.
ajaxSetup: function( target, settings ) {
return settings ?
// Building a settings object
ajaxExtend( ajaxExtend( target, jQuery.ajaxSettings ), settings ) :
// Extending ajaxSettings
ajaxExtend( jQuery.ajaxSettings, target );
},
ajaxPrefilter: addToPrefiltersOrTransports( prefilters ),
ajaxTransport: addToPrefiltersOrTransports( transports ),
// Main method
ajax: function( url, options ) {
// If url is an object, simulate pre-1.5 signature
if ( typeof url === "object" ) {
options = url;
url = undefined;
}
// Force options to be an object
options = options || {};
var transport,
// URL without anti-cache param
cacheURL,
// Response headers
responseHeadersString,
responseHeaders,
// timeout handle
timeoutTimer,
// Url cleanup var
urlAnchor,
// Request state (becomes false upon send and true upon completion)
completed,
// To know if global events are to be dispatched
fireGlobals,
// Loop variable
i,
// uncached part of the url
uncached,
// Create the final options object
s = jQuery.ajaxSetup( {}, options ),
// Callbacks context
callbackContext = s.context || s,
// Context for global events is callbackContext if it is a DOM node or jQuery collection
globalEventContext = s.context &&
( callbackContext.nodeType || callbackContext.jquery ) ?
jQuery( callbackContext ) :
jQuery.event,
// Deferreds
deferred = jQuery.Deferred(),
completeDeferred = jQuery.Callbacks( "once memory" ),
// Status-dependent callbacks
statusCode = s.statusCode || {},
// Headers (they are sent all at once)
requestHeaders = {},
requestHeadersNames = {},
// Default abort message
strAbort = "canceled",
// Fake xhr
jqXHR = {
readyState: 0,
// Builds headers hashtable if needed
getResponseHeader: function( key ) {
var match;
if ( completed ) {
if ( !responseHeaders ) {
responseHeaders = {};
while ( ( match = rheaders.exec( responseHeadersString ) ) ) {
responseHeaders[ match[ 1 ].toLowerCase() ] = match[ 2 ];
}
}
match = responseHeaders[ key.toLowerCase() ];
}
return match == null ? null : match;
},
// Raw string
getAllResponseHeaders: function() {
return completed ? responseHeadersString : null;
},
// Caches the header
setRequestHeader: function( name, value ) {
if ( completed == null ) {
name = requestHeadersNames[ name.toLowerCase() ] =
requestHeadersNames[ name.toLowerCase() ] || name;
requestHeaders[ name ] = value;
}
return this;
},
// Overrides response content-type header
overrideMimeType: function( type ) {
if ( completed == null ) {
s.mimeType = type;
}
return this;
},
// Status-dependent callbacks
statusCode: function( map ) {
var code;
if ( map ) {
if ( completed ) {
// Execute the appropriate callbacks
jqXHR.always( map[ jqXHR.status ] );
} else {
// Lazy-add the new callbacks in a way that preserves old ones
for ( code in map ) {
statusCode[ code ] = [ statusCode[ code ], map[ code ] ];
}
}
}
return this;
},
// Cancel the request
abort: function( statusText ) {
var finalText = statusText || strAbort;
if ( transport ) {
transport.abort( finalText );
}
done( 0, finalText );
return this;
}
};
// Attach deferreds
deferred.promise( jqXHR );
// Add protocol if not provided (prefilters might expect it)
// Handle falsy url in the settings object (#10093: consistency with old signature)
// We also use the url parameter if available
s.url = ( ( url || s.url || location.href ) + "" )
.replace( rprotocol, location.protocol + "//" );
// Alias method option to type as per ticket #12004
s.type = options.method || options.type || s.method || s.type;
// Extract dataTypes list
s.dataTypes = ( s.dataType || "*" ).toLowerCase().match( rnothtmlwhite ) || [ "" ];
// A cross-domain request is in order when the origin doesn't match the current origin.
if ( s.crossDomain == null ) {
urlAnchor = document.createElement( "a" );
// Support: IE <=8 - 11, Edge 12 - 13
// IE throws exception on accessing the href property if url is malformed,
// e.g. http://example.com:80x/
try {
urlAnchor.href = s.url;
// Support: IE <=8 - 11 only
// Anchor's host property isn't correctly set when s.url is relative
urlAnchor.href = urlAnchor.href;
s.crossDomain = originAnchor.protocol + "//" + originAnchor.host !==
urlAnchor.protocol + "//" + urlAnchor.host;
} catch ( e ) {
// If there is an error parsing the URL, assume it is crossDomain,
// it can be rejected by the transport if it is invalid
s.crossDomain = true;
}
}
// Convert data if not already a string
if ( s.data && s.processData && typeof s.data !== "string" ) {
s.data = jQuery.param( s.data, s.traditional );
}
// Apply prefilters
inspectPrefiltersOrTransports( prefilters, s, options, jqXHR );
// If request was aborted inside a prefilter, stop there
if ( completed ) {
return jqXHR;
}
// We can fire global events as of now if asked to
// Don't fire events if jQuery.event is undefined in an AMD-usage scenario (#15118)
fireGlobals = jQuery.event && s.global;
// Watch for a new set of requests
if ( fireGlobals && jQuery.active++ === 0 ) {
jQuery.event.trigger( "ajaxStart" );
}
// Uppercase the type
s.type = s.type.toUpperCase();
// Determine if request has content
s.hasContent = !rnoContent.test( s.type );
// Save the URL in case we're toying with the If-Modified-Since
// and/or If-None-Match header later on
// Remove hash to simplify url manipulation
cacheURL = s.url.replace( rhash, "" );
// More options handling for requests with no content
if ( !s.hasContent ) {
// Remember the hash so we can put it back
uncached = s.url.slice( cacheURL.length );
// If data is available, append data to url
if ( s.data ) {
cacheURL += ( rquery.test( cacheURL ) ? "&" : "?" ) + s.data;
// #9682: remove data so that it's not used in an eventual retry
delete s.data;
}
// Add or update anti-cache param if needed
if ( s.cache === false ) {
cacheURL = cacheURL.replace( rantiCache, "$1" );
uncached = ( rquery.test( cacheURL ) ? "&" : "?" ) + "_=" + ( nonce++ ) + uncached;
}
// Put hash and anti-cache on the URL that will be requested (gh-1732)
s.url = cacheURL + uncached;
// Change '%20' to '+' if this is encoded form body content (gh-2658)
} else if ( s.data && s.processData &&
( s.contentType || "" ).indexOf( "application/x-www-form-urlencoded" ) === 0 ) {
s.data = s.data.replace( r20, "+" );
}
// Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode.
if ( s.ifModified ) {
if ( jQuery.lastModified[ cacheURL ] ) {
jqXHR.setRequestHeader( "If-Modified-Since", jQuery.lastModified[ cacheURL ] );
}
if ( jQuery.etag[ cacheURL ] ) {
jqXHR.setRequestHeader( "If-None-Match", jQuery.etag[ cacheURL ] );
}
}
// Set the correct header, if data is being sent
if ( s.data && s.hasContent && s.contentType !== false || options.contentType ) {
jqXHR.setRequestHeader( "Content-Type", s.contentType );
}
// Set the Accepts header for the server, depending on the dataType
jqXHR.setRequestHeader(
"Accept",
s.dataTypes[ 0 ] && s.accepts[ s.dataTypes[ 0 ] ] ?
s.accepts[ s.dataTypes[ 0 ] ] +
( s.dataTypes[ 0 ] !== "*" ? ", " + allTypes + "; q=0.01" : "" ) :
s.accepts[ "*" ]
);
// Check for headers option
for ( i in s.headers ) {
jqXHR.setRequestHeader( i, s.headers[ i ] );
}
// Allow custom headers/mimetypes and early abort
if ( s.beforeSend &&
( s.beforeSend.call( callbackContext, jqXHR, s ) === false || completed ) ) {
// Abort if not done already and return
return jqXHR.abort();
}
// Aborting is no longer a cancellation
strAbort = "abort";
// Install callbacks on deferreds
completeDeferred.add( s.complete );
jqXHR.done( s.success );
jqXHR.fail( s.error );
// Get transport
transport = inspectPrefiltersOrTransports( transports, s, options, jqXHR );
// If no transport, we auto-abort
if ( !transport ) {
done( -1, "No Transport" );
} else {
jqXHR.readyState = 1;
// Send global event
if ( fireGlobals ) {
globalEventContext.trigger( "ajaxSend", [ jqXHR, s ] );
}
// If request was aborted inside ajaxSend, stop there
if ( completed ) {
return jqXHR;
}
// Timeout
if ( s.async && s.timeout > 0 ) {
timeoutTimer = window.setTimeout( function() {
jqXHR.abort( "timeout" );
}, s.timeout );
}
try {
completed = false;
transport.send( requestHeaders, done );
} catch ( e ) {
// Rethrow post-completion exceptions
if ( completed ) {
throw e;
}
// Propagate others as results
done( -1, e );
}
}
// Callback for when everything is done
function done( status, nativeStatusText, responses, headers ) {
var isSuccess, success, error, response, modified,
statusText = nativeStatusText;
// Ignore repeat invocations
if ( completed ) {
return;
}
completed = true;
// Clear timeout if it exists
if ( timeoutTimer ) {
window.clearTimeout( timeoutTimer );
}
// Dereference transport for early garbage collection
// (no matter how long the jqXHR object will be used)
transport = undefined;
// Cache response headers
responseHeadersString = headers || "";
// Set readyState
jqXHR.readyState = status > 0 ? 4 : 0;
// Determine if successful
isSuccess = status >= 200 && status < 300 || status === 304;
// Get response data
if ( responses ) {
response = ajaxHandleResponses( s, jqXHR, responses );
}
// Convert no matter what (that way responseXXX fields are always set)
response = ajaxConvert( s, response, jqXHR, isSuccess );
// If successful, handle type chaining
if ( isSuccess ) {
// Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode.
if ( s.ifModified ) {
modified = jqXHR.getResponseHeader( "Last-Modified" );
if ( modified ) {
jQuery.lastModified[ cacheURL ] = modified;
}
modified = jqXHR.getResponseHeader( "etag" );
if ( modified ) {
jQuery.etag[ cacheURL ] = modified;
}
}
// if no content
if ( status === 204 || s.type === "HEAD" ) {
statusText = "nocontent";
// if not modified
} else if ( status === 304 ) {
statusText = "notmodified";
// If we have data, let's convert it
} else {
statusText = response.state;
success = response.data;
error = response.error;
isSuccess = !error;
}
} else {
// Extract error from statusText and normalize for non-aborts
error = statusText;
if ( status || !statusText ) {
statusText = "error";
if ( status < 0 ) {
status = 0;
}
}
}
// Set data for the fake xhr object
jqXHR.status = status;
jqXHR.statusText = ( nativeStatusText || statusText ) + "";
// Success/Error
if ( isSuccess ) {
deferred.resolveWith( callbackContext, [ success, statusText, jqXHR ] );
} else {
deferred.rejectWith( callbackContext, [ jqXHR, statusText, error ] );
}
// Status-dependent callbacks
jqXHR.statusCode( statusCode );
statusCode = undefined;
if ( fireGlobals ) {
globalEventContext.trigger( isSuccess ? "ajaxSuccess" : "ajaxError",
[ jqXHR, s, isSuccess ? success : error ] );
}
// Complete
completeDeferred.fireWith( callbackContext, [ jqXHR, statusText ] );
if ( fireGlobals ) {
globalEventContext.trigger( "ajaxComplete", [ jqXHR, s ] );
// Handle the global AJAX counter
if ( !( --jQuery.active ) ) {
jQuery.event.trigger( "ajaxStop" );
}
}
}
return jqXHR;
},
getJSON: function( url, data, callback ) {
return jQuery.get( url, data, callback, "json" );
},
getScript: function( url, callback ) {
return jQuery.get( url, undefined, callback, "script" );
}
} );
jQuery.each( [ "get", "post" ], function( i, method ) {
jQuery[ method ] = function( url, data, callback, type ) {
// Shift arguments if data argument was omitted
if ( jQuery.isFunction( data ) ) {
type = type || callback;
callback = data;
data = undefined;
}
// The url can be an options object (which then must have .url)
return jQuery.ajax( jQuery.extend( {
url: url,
type: method,
dataType: type,
data: data,
success: callback
}, jQuery.isPlainObject( url ) && url ) );
};
} );
jQuery._evalUrl = function( url ) {
return jQuery.ajax( {
url: url,
// Make this explicit, since user can override this through ajaxSetup (#11264)
type: "GET",
dataType: "script",
cache: true,
async: false,
global: false,
"throws": true
} );
};
jQuery.fn.extend( {
wrapAll: function( html ) {
var wrap;
if ( this[ 0 ] ) {
if ( jQuery.isFunction( html ) ) {
html = html.call( this[ 0 ] );
}
// The elements to wrap the target around
wrap = jQuery( html, this[ 0 ].ownerDocument ).eq( 0 ).clone( true );
if ( this[ 0 ].parentNode ) {
wrap.insertBefore( this[ 0 ] );
}
wrap.map( function() {
var elem = this;
while ( elem.firstElementChild ) {
elem = elem.firstElementChild;
}
return elem;
} ).append( this );
}
return this;
},
wrapInner: function( html ) {
if ( jQuery.isFunction( html ) ) {
return this.each( function( i ) {
jQuery( this ).wrapInner( html.call( this, i ) );
} );
}
return this.each( function() {
var self = jQuery( this ),
contents = self.contents();
if ( contents.length ) {
contents.wrapAll( html );
} else {
self.append( html );
}
} );
},
wrap: function( html ) {
var isFunction = jQuery.isFunction( html );
return this.each( function( i ) {
jQuery( this ).wrapAll( isFunction ? html.call( this, i ) : html );
} );
},
unwrap: function( selector ) {
this.parent( selector ).not( "body" ).each( function() {
jQuery( this ).replaceWith( this.childNodes );
} );
return this;
}
} );
jQuery.expr.pseudos.hidden = function( elem ) {
return !jQuery.expr.pseudos.visible( elem );
};
jQuery.expr.pseudos.visible = function( elem ) {
return !!( elem.offsetWidth || elem.offsetHeight || elem.getClientRects().length );
};
jQuery.ajaxSettings.xhr = function() {
try {
return new window.XMLHttpRequest();
} catch ( e ) {}
};
var xhrSuccessStatus = {
// File protocol always yields status code 0, assume 200
0: 200,
// Support: IE <=9 only
// #1450: sometimes IE returns 1223 when it should be 204
1223: 204
},
xhrSupported = jQuery.ajaxSettings.xhr();
support.cors = !!xhrSupported && ( "withCredentials" in xhrSupported );
support.ajax = xhrSupported = !!xhrSupported;
jQuery.ajaxTransport( function( options ) {
var callback, errorCallback;
// Cross domain only allowed if supported through XMLHttpRequest
if ( support.cors || xhrSupported && !options.crossDomain ) {
return {
send: function( headers, complete ) {
var i,
xhr = options.xhr();
xhr.open(
options.type,
options.url,
options.async,
options.username,
options.password
);
// Apply custom fields if provided
if ( options.xhrFields ) {
for ( i in options.xhrFields ) {
xhr[ i ] = options.xhrFields[ i ];
}
}
// Override mime type if needed
if ( options.mimeType && xhr.overrideMimeType ) {
xhr.overrideMimeType( options.mimeType );
}
// X-Requested-With header
// For cross-domain requests, seeing as conditions for a preflight are
// akin to a jigsaw puzzle, we simply never set it to be sure.
// (it can always be set on a per-request basis or even using ajaxSetup)
// For same-domain requests, won't change header if already provided.
if ( !options.crossDomain && !headers[ "X-Requested-With" ] ) {
headers[ "X-Requested-With" ] = "XMLHttpRequest";
}
// Set headers
for ( i in headers ) {
xhr.setRequestHeader( i, headers[ i ] );
}
// Callback
callback = function( type ) {
return function() {
if ( callback ) {
callback = errorCallback = xhr.onload =
xhr.onerror = xhr.onabort = xhr.onreadystatechange = null;
if ( type === "abort" ) {
xhr.abort();
} else if ( type === "error" ) {
// Support: IE <=9 only
// On a manual native abort, IE9 throws
// errors on any property access that is not readyState
if ( typeof xhr.status !== "number" ) {
complete( 0, "error" );
} else {
complete(
// File: protocol always yields status 0; see #8605, #14207
xhr.status,
xhr.statusText
);
}
} else {
complete(
xhrSuccessStatus[ xhr.status ] || xhr.status,
xhr.statusText,
// Support: IE <=9 only
// IE9 has no XHR2 but throws on binary (trac-11426)
// For XHR2 non-text, let the caller handle it (gh-2498)
( xhr.responseType || "text" ) !== "text" ||
typeof xhr.responseText !== "string" ?
{ binary: xhr.response } :
{ text: xhr.responseText },
xhr.getAllResponseHeaders()
);
}
}
};
};
// Listen to events
xhr.onload = callback();
errorCallback = xhr.onerror = callback( "error" );
// Support: IE 9 only
// Use onreadystatechange to replace onabort
// to handle uncaught aborts
if ( xhr.onabort !== undefined ) {
xhr.onabort = errorCallback;
} else {
xhr.onreadystatechange = function() {
// Check readyState before timeout as it changes
if ( xhr.readyState === 4 ) {
// Allow onerror to be called first,
// but that will not handle a native abort
// Also, save errorCallback to a variable
// as xhr.onerror cannot be accessed
window.setTimeout( function() {
if ( callback ) {
errorCallback();
}
} );
}
};
}
// Create the abort callback
callback = callback( "abort" );
try {
// Do send the request (this may raise an exception)
xhr.send( options.hasContent && options.data || null );
} catch ( e ) {
// #14683: Only rethrow if this hasn't been notified as an error yet
if ( callback ) {
throw e;
}
}
},
abort: function() {
if ( callback ) {
callback();
}
}
};
}
} );
// Prevent auto-execution of scripts when no explicit dataType was provided (See gh-2432)
jQuery.ajaxPrefilter( function( s ) {
if ( s.crossDomain ) {
s.contents.script = false;
}
} );
// Install script dataType
jQuery.ajaxSetup( {
accepts: {
script: "text/javascript, application/javascript, " +
"application/ecmascript, application/x-ecmascript"
},
contents: {
script: /\b(?:java|ecma)script\b/
},
converters: {
"text script": function( text ) {
jQuery.globalEval( text );
return text;
}
}
} );
// Handle cache's special case and crossDomain
jQuery.ajaxPrefilter( "script", function( s ) {
if ( s.cache === undefined ) {
s.cache = false;
}
if ( s.crossDomain ) {
s.type = "GET";
}
} );
// Bind script tag hack transport
jQuery.ajaxTransport( "script", function( s ) {
// This transport only deals with cross domain requests
if ( s.crossDomain ) {
var script, callback;
return {
send: function( _, complete ) {
script = jQuery( "<script>" ).prop( {
charset: s.scriptCharset,
src: s.url
} ).on(
"load error",
callback = function( evt ) {
script.remove();
callback = null;
if ( evt ) {
complete( evt.type === "error" ? 404 : 200, evt.type );
}
}
);
// Use native DOM manipulation to avoid our domManip AJAX trickery
document.head.appendChild( script[ 0 ] );
},
abort: function() {
if ( callback ) {
callback();
}
}
};
}
} );
var oldCallbacks = [],
rjsonp = /(=)\?(?=&|$)|\?\?/;
// Default jsonp settings
jQuery.ajaxSetup( {
jsonp: "callback",
jsonpCallback: function() {
var callback = oldCallbacks.pop() || ( jQuery.expando + "_" + ( nonce++ ) );
this[ callback ] = true;
return callback;
}
} );
// Detect, normalize options and install callbacks for jsonp requests
jQuery.ajaxPrefilter( "json jsonp", function( s, originalSettings, jqXHR ) {
var callbackName, overwritten, responseContainer,
jsonProp = s.jsonp !== false && ( rjsonp.test( s.url ) ?
"url" :
typeof s.data === "string" &&
( s.contentType || "" )
.indexOf( "application/x-www-form-urlencoded" ) === 0 &&
rjsonp.test( s.data ) && "data"
);
// Handle iff the expected data type is "jsonp" or we have a parameter to set
if ( jsonProp || s.dataTypes[ 0 ] === "jsonp" ) {
// Get callback name, remembering preexisting value associated with it
callbackName = s.jsonpCallback = jQuery.isFunction( s.jsonpCallback ) ?
s.jsonpCallback() :
s.jsonpCallback;
// Insert callback into url or form data
if ( jsonProp ) {
s[ jsonProp ] = s[ jsonProp ].replace( rjsonp, "$1" + callbackName );
} else if ( s.jsonp !== false ) {
s.url += ( rquery.test( s.url ) ? "&" : "?" ) + s.jsonp + "=" + callbackName;
}
// Use data converter to retrieve json after script execution
s.converters[ "script json" ] = function() {
if ( !responseContainer ) {
jQuery.error( callbackName + " was not called" );
}
return responseContainer[ 0 ];
};
// Force json dataType
s.dataTypes[ 0 ] = "json";
// Install callback
overwritten = window[ callbackName ];
window[ callbackName ] = function() {
responseContainer = arguments;
};
// Clean-up function (fires after converters)
jqXHR.always( function() {
// If previous value didn't exist - remove it
if ( overwritten === undefined ) {
jQuery( window ).removeProp( callbackName );
// Otherwise restore preexisting value
} else {
window[ callbackName ] = overwritten;
}
// Save back as free
if ( s[ callbackName ] ) {
// Make sure that re-using the options doesn't screw things around
s.jsonpCallback = originalSettings.jsonpCallback;
// Save the callback name for future use
oldCallbacks.push( callbackName );
}
// Call if it was a function and we have a response
if ( responseContainer && jQuery.isFunction( overwritten ) ) {
overwritten( responseContainer[ 0 ] );
}
responseContainer = overwritten = undefined;
} );
// Delegate to script
return "script";
}
} );
// Support: Safari 8 only
// In Safari 8 documents created via document.implementation.createHTMLDocument
// collapse sibling forms: the second one becomes a child of the first one.
// Because of that, this security measure has to be disabled in Safari 8.
// https://bugs.webkit.org/show_bug.cgi?id=137337
support.createHTMLDocument = ( function() {
var body = document.implementation.createHTMLDocument( "" ).body;
body.innerHTML = "<form></form><form></form>";
return body.childNodes.length === 2;
} )();
// Argument "data" should be string of html
// context (optional): If specified, the fragment will be created in this context,
// defaults to document
// keepScripts (optional): If true, will include scripts passed in the html string
jQuery.parseHTML = function( data, context, keepScripts ) {
if ( typeof data !== "string" ) {
return [];
}
if ( typeof context === "boolean" ) {
keepScripts = context;
context = false;
}
var base, parsed, scripts;
if ( !context ) {
// Stop scripts or inline event handlers from being executed immediately
// by using document.implementation
if ( support.createHTMLDocument ) {
context = document.implementation.createHTMLDocument( "" );
// Set the base href for the created document
// so any parsed elements with URLs
// are based on the document's URL (gh-2965)
base = context.createElement( "base" );
base.href = document.location.href;
context.head.appendChild( base );
} else {
context = document;
}
}
parsed = rsingleTag.exec( data );
scripts = !keepScripts && [];
// Single tag
if ( parsed ) {
return [ context.createElement( parsed[ 1 ] ) ];
}
parsed = buildFragment( [ data ], context, scripts );
if ( scripts && scripts.length ) {
jQuery( scripts ).remove();
}
return jQuery.merge( [], parsed.childNodes );
};
/**
* Load a url into a page
*/
jQuery.fn.load = function( url, params, callback ) {
var selector, type, response,
self = this,
off = url.indexOf( " " );
if ( off > -1 ) {
selector = stripAndCollapse( url.slice( off ) );
url = url.slice( 0, off );
}
// If it's a function
if ( jQuery.isFunction( params ) ) {
// We assume that it's the callback
callback = params;
params = undefined;
// Otherwise, build a param string
} else if ( params && typeof params === "object" ) {
type = "POST";
}
// If we have elements to modify, make the request
if ( self.length > 0 ) {
jQuery.ajax( {
url: url,
// If "type" variable is undefined, then "GET" method will be used.
// Make value of this field explicit since
// user can override it through ajaxSetup method
type: type || "GET",
dataType: "html",
data: params
} ).done( function( responseText ) {
// Save response for use in complete callback
response = arguments;
self.html( selector ?
// If a selector was specified, locate the right elements in a dummy div
// Exclude scripts to avoid IE 'Permission Denied' errors
jQuery( "<div>" ).append( jQuery.parseHTML( responseText ) ).find( selector ) :
// Otherwise use the full result
responseText );
// If the request succeeds, this function gets "data", "status", "jqXHR"
// but they are ignored because response was set above.
// If it fails, this function gets "jqXHR", "status", "error"
} ).always( callback && function( jqXHR, status ) {
self.each( function() {
callback.apply( this, response || [ jqXHR.responseText, status, jqXHR ] );
} );
} );
}
return this;
};
// Attach a bunch of functions for handling common AJAX events
jQuery.each( [
"ajaxStart",
"ajaxStop",
"ajaxComplete",
"ajaxError",
"ajaxSuccess",
"ajaxSend"
], function( i, type ) {
jQuery.fn[ type ] = function( fn ) {
return this.on( type, fn );
};
} );
jQuery.expr.pseudos.animated = function( elem ) {
return jQuery.grep( jQuery.timers, function( fn ) {
return elem === fn.elem;
} ).length;
};
/**
* Gets a window from an element
*/
function getWindow( elem ) {
return jQuery.isWindow( elem ) ? elem : elem.nodeType === 9 && elem.defaultView;
}
jQuery.offset = {
setOffset: function( elem, options, i ) {
var curPosition, curLeft, curCSSTop, curTop, curOffset, curCSSLeft, calculatePosition,
position = jQuery.css( elem, "position" ),
curElem = jQuery( elem ),
props = {};
// Set position first, in-case top/left are set even on static elem
if ( position === "static" ) {
elem.style.position = "relative";
}
curOffset = curElem.offset();
curCSSTop = jQuery.css( elem, "top" );
curCSSLeft = jQuery.css( elem, "left" );
calculatePosition = ( position === "absolute" || position === "fixed" ) &&
( curCSSTop + curCSSLeft ).indexOf( "auto" ) > -1;
// Need to be able to calculate position if either
// top or left is auto and position is either absolute or fixed
if ( calculatePosition ) {
curPosition = curElem.position();
curTop = curPosition.top;
curLeft = curPosition.left;
} else {
curTop = parseFloat( curCSSTop ) || 0;
curLeft = parseFloat( curCSSLeft ) || 0;
}
if ( jQuery.isFunction( options ) ) {
// Use jQuery.extend here to allow modification of coordinates argument (gh-1848)
options = options.call( elem, i, jQuery.extend( {}, curOffset ) );
}
if ( options.top != null ) {
props.top = ( options.top - curOffset.top ) + curTop;
}
if ( options.left != null ) {
props.left = ( options.left - curOffset.left ) + curLeft;
}
if ( "using" in options ) {
options.using.call( elem, props );
} else {
curElem.css( props );
}
}
};
jQuery.fn.extend( {
offset: function( options ) {
// Preserve chaining for setter
if ( arguments.length ) {
return options === undefined ?
this :
this.each( function( i ) {
jQuery.offset.setOffset( this, options, i );
} );
}
var docElem, win, rect, doc,
elem = this[ 0 ];
if ( !elem ) {
return;
}
// Support: IE <=11 only
// Running getBoundingClientRect on a
// disconnected node in IE throws an error
if ( !elem.getClientRects().length ) {
return { top: 0, left: 0 };
}
rect = elem.getBoundingClientRect();
// Make sure element is not hidden (display: none)
if ( rect.width || rect.height ) {
doc = elem.ownerDocument;
win = getWindow( doc );
docElem = doc.documentElement;
return {
top: rect.top + win.pageYOffset - docElem.clientTop,
left: rect.left + win.pageXOffset - docElem.clientLeft
};
}
// Return zeros for disconnected and hidden elements (gh-2310)
return rect;
},
position: function() {
if ( !this[ 0 ] ) {
return;
}
var offsetParent, offset,
elem = this[ 0 ],
parentOffset = { top: 0, left: 0 };
// Fixed elements are offset from window (parentOffset = {top:0, left: 0},
// because it is its only offset parent
if ( jQuery.css( elem, "position" ) === "fixed" ) {
// Assume getBoundingClientRect is there when computed position is fixed
offset = elem.getBoundingClientRect();
} else {
// Get *real* offsetParent
offsetParent = this.offsetParent();
// Get correct offsets
offset = this.offset();
if ( !jQuery.nodeName( offsetParent[ 0 ], "html" ) ) {
parentOffset = offsetParent.offset();
}
// Add offsetParent borders
parentOffset = {
top: parentOffset.top + jQuery.css( offsetParent[ 0 ], "borderTopWidth", true ),
left: parentOffset.left + jQuery.css( offsetParent[ 0 ], "borderLeftWidth", true )
};
}
// Subtract parent offsets and element margins
return {
top: offset.top - parentOffset.top - jQuery.css( elem, "marginTop", true ),
left: offset.left - parentOffset.left - jQuery.css( elem, "marginLeft", true )
};
},
// This method will return documentElement in the following cases:
// 1) For the element inside the iframe without offsetParent, this method will return
// documentElement of the parent window
// 2) For the hidden or detached element
// 3) For body or html element, i.e. in case of the html node - it will return itself
//
// but those exceptions were never presented as a real life use-cases
// and might be considered as more preferable results.
//
// This logic, however, is not guaranteed and can change at any point in the future
offsetParent: function() {
return this.map( function() {
var offsetParent = this.offsetParent;
while ( offsetParent && jQuery.css( offsetParent, "position" ) === "static" ) {
offsetParent = offsetParent.offsetParent;
}
return offsetParent || documentElement;
} );
}
} );
// Create scrollLeft and scrollTop methods
jQuery.each( { scrollLeft: "pageXOffset", scrollTop: "pageYOffset" }, function( method, prop ) {
var top = "pageYOffset" === prop;
jQuery.fn[ method ] = function( val ) {
return access( this, function( elem, method, val ) {
var win = getWindow( elem );
if ( val === undefined ) {
return win ? win[ prop ] : elem[ method ];
}
if ( win ) {
win.scrollTo(
!top ? val : win.pageXOffset,
top ? val : win.pageYOffset
);
} else {
elem[ method ] = val;
}
}, method, val, arguments.length );
};
} );
// Support: Safari <=7 - 9.1, Chrome <=37 - 49
// Add the top/left cssHooks using jQuery.fn.position
// Webkit bug: https://bugs.webkit.org/show_bug.cgi?id=29084
// Blink bug: https://bugs.chromium.org/p/chromium/issues/detail?id=589347
// getComputedStyle returns percent when specified for top/left/bottom/right;
// rather than make the css module depend on the offset module, just check for it here
jQuery.each( [ "top", "left" ], function( i, prop ) {
jQuery.cssHooks[ prop ] = addGetHookIf( support.pixelPosition,
function( elem, computed ) {
if ( computed ) {
computed = curCSS( elem, prop );
// If curCSS returns percentage, fallback to offset
return rnumnonpx.test( computed ) ?
jQuery( elem ).position()[ prop ] + "px" :
computed;
}
}
);
} );
// Create innerHeight, innerWidth, height, width, outerHeight and outerWidth methods
jQuery.each( { Height: "height", Width: "width" }, function( name, type ) {
jQuery.each( { padding: "inner" + name, content: type, "": "outer" + name },
function( defaultExtra, funcName ) {
// Margin is only for outerHeight, outerWidth
jQuery.fn[ funcName ] = function( margin, value ) {
var chainable = arguments.length && ( defaultExtra || typeof margin !== "boolean" ),
extra = defaultExtra || ( margin === true || value === true ? "margin" : "border" );
return access( this, function( elem, type, value ) {
var doc;
if ( jQuery.isWindow( elem ) ) {
// $( window ).outerWidth/Height return w/h including scrollbars (gh-1729)
return funcName.indexOf( "outer" ) === 0 ?
elem[ "inner" + name ] :
elem.document.documentElement[ "client" + name ];
}
// Get document width or height
if ( elem.nodeType === 9 ) {
doc = elem.documentElement;
// Either scroll[Width/Height] or offset[Width/Height] or client[Width/Height],
// whichever is greatest
return Math.max(
elem.body[ "scroll" + name ], doc[ "scroll" + name ],
elem.body[ "offset" + name ], doc[ "offset" + name ],
doc[ "client" + name ]
);
}
return value === undefined ?
// Get width or height on the element, requesting but not forcing parseFloat
jQuery.css( elem, type, extra ) :
// Set width or height on the element
jQuery.style( elem, type, value, extra );
}, type, chainable ? margin : undefined, chainable );
};
} );
} );
jQuery.fn.extend( {
bind: function( types, data, fn ) {
return this.on( types, null, data, fn );
},
unbind: function( types, fn ) {
return this.off( types, null, fn );
},
delegate: function( selector, types, data, fn ) {
return this.on( types, selector, data, fn );
},
undelegate: function( selector, types, fn ) {
// ( namespace ) or ( selector, types [, fn] )
return arguments.length === 1 ?
this.off( selector, "**" ) :
this.off( types, selector || "**", fn );
}
} );
jQuery.parseJSON = JSON.parse;
// Register as a named AMD module, since jQuery can be concatenated with other
// files that may use define, but not via a proper concatenation script that
// understands anonymous AMD modules. A named AMD is safest and most robust
// way to register. Lowercase jquery is used because AMD module names are
// derived from file names, and jQuery is normally delivered in a lowercase
// file name. Do this after creating the global so that if an AMD module wants
// to call noConflict to hide this version of jQuery, it will work.
// Note that for maximum portability, libraries that are not jQuery should
// declare themselves as anonymous modules, and avoid setting a global if an
// AMD loader is present. jQuery is a special case. For more information, see
// https://github.com/jrburke/requirejs/wiki/Updating-existing-libraries#wiki-anon
if ( true ) {
!(__WEBPACK_AMD_DEFINE_ARRAY__ = [], __WEBPACK_AMD_DEFINE_RESULT__ = function() {
return jQuery;
}.apply(exports, __WEBPACK_AMD_DEFINE_ARRAY__),
__WEBPACK_AMD_DEFINE_RESULT__ !== undefined && (module.exports = __WEBPACK_AMD_DEFINE_RESULT__));
}
var
// Map over jQuery in case of overwrite
_jQuery = window.jQuery,
// Map over the $ in case of overwrite
_$ = window.$;
jQuery.noConflict = function( deep ) {
if ( window.$ === jQuery ) {
window.$ = _$;
}
if ( deep && window.jQuery === jQuery ) {
window.jQuery = _jQuery;
}
return jQuery;
};
// Expose jQuery and $ identifiers, even in AMD
// (#7102#comment:10, https://github.com/jquery/jquery/pull/557)
// and CommonJS for browser emulators (#13566)
if ( !noGlobal ) {
window.jQuery = window.$ = jQuery;
}
return jQuery;
} );
/***/ }),
/* 2 */
/***/ (function(module, exports, __webpack_require__) {
"use strict";
/* WEBPACK VAR INJECTION */(function(process) {
var utils = __webpack_require__(0);
var normalizeHeaderName = __webpack_require__(26);
var PROTECTION_PREFIX = /^\)\]\}',?\n/;
var DEFAULT_CONTENT_TYPE = {
'Content-Type': 'application/x-www-form-urlencoded'
};
function setContentTypeIfUnset(headers, value) {
if (!utils.isUndefined(headers) && utils.isUndefined(headers['Content-Type'])) {
headers['Content-Type'] = value;
}
}
function getDefaultAdapter() {
var adapter;
if (typeof XMLHttpRequest !== 'undefined') {
// For browsers use XHR adapter
adapter = __webpack_require__(3);
} else if (typeof process !== 'undefined') {
// For node use HTTP adapter
adapter = __webpack_require__(3);
}
return adapter;
}
var defaults = {
adapter: getDefaultAdapter(),
transformRequest: [function transformRequest(data, headers) {
normalizeHeaderName(headers, 'Content-Type');
if (utils.isFormData(data) ||
utils.isArrayBuffer(data) ||
utils.isStream(data) ||
utils.isFile(data) ||
utils.isBlob(data)
) {
return data;
}
if (utils.isArrayBufferView(data)) {
return data.buffer;
}
if (utils.isURLSearchParams(data)) {
setContentTypeIfUnset(headers, 'application/x-www-form-urlencoded;charset=utf-8');
return data.toString();
}
if (utils.isObject(data)) {
setContentTypeIfUnset(headers, 'application/json;charset=utf-8');
return JSON.stringify(data);
}
return data;
}],
transformResponse: [function transformResponse(data) {
/*eslint no-param-reassign:0*/
if (typeof data === 'string') {
data = data.replace(PROTECTION_PREFIX, '');
try {
data = JSON.parse(data);
} catch (e) { /* Ignore */ }
}
return data;
}],
timeout: 0,
xsrfCookieName: 'XSRF-TOKEN',
xsrfHeaderName: 'X-XSRF-TOKEN',
maxContentLength: -1,
validateStatus: function validateStatus(status) {
return status >= 200 && status < 300;
}
};
defaults.headers = {
common: {
'Accept': 'application/json, text/plain, */*'
}
};
utils.forEach(['delete', 'get', 'head'], function forEachMehtodNoData(method) {
defaults.headers[method] = {};
});
utils.forEach(['post', 'put', 'patch'], function forEachMethodWithData(method) {
defaults.headers[method] = utils.merge(DEFAULT_CONTENT_TYPE);
});
module.exports = defaults;
/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(8)))
/***/ }),
/* 3 */
/***/ (function(module, exports, __webpack_require__) {
"use strict";
/* WEBPACK VAR INJECTION */(function(process) {
var utils = __webpack_require__(0);
var settle = __webpack_require__(18);
var buildURL = __webpack_require__(21);
var parseHeaders = __webpack_require__(27);
var isURLSameOrigin = __webpack_require__(25);
var createError = __webpack_require__(6);
var btoa = (typeof window !== 'undefined' && window.btoa && window.btoa.bind(window)) || __webpack_require__(20);
module.exports = function xhrAdapter(config) {
return new Promise(function dispatchXhrRequest(resolve, reject) {
var requestData = config.data;
var requestHeaders = config.headers;
if (utils.isFormData(requestData)) {
delete requestHeaders['Content-Type']; // Let the browser set it
}
var request = new XMLHttpRequest();
var loadEvent = 'onreadystatechange';
var xDomain = false;
// For IE 8/9 CORS support
// Only supports POST and GET calls and doesn't returns the response headers.
// DON'T do this for testing b/c XMLHttpRequest is mocked, not XDomainRequest.
if (process.env.NODE_ENV !== 'test' &&
typeof window !== 'undefined' &&
window.XDomainRequest && !('withCredentials' in request) &&
!isURLSameOrigin(config.url)) {
request = new window.XDomainRequest();
loadEvent = 'onload';
xDomain = true;
request.onprogress = function handleProgress() {};
request.ontimeout = function handleTimeout() {};
}
// HTTP basic authentication
if (config.auth) {
var username = config.auth.username || '';
var password = config.auth.password || '';
requestHeaders.Authorization = 'Basic ' + btoa(username + ':' + password);
}
request.open(config.method.toUpperCase(), buildURL(config.url, config.params, config.paramsSerializer), true);
// Set the request timeout in MS
request.timeout = config.timeout;
// Listen for ready state
request[loadEvent] = function handleLoad() {
if (!request || (request.readyState !== 4 && !xDomain)) {
return;
}
// The request errored out and we didn't get a response, this will be
// handled by onerror instead
// With one exception: request that using file: protocol, most browsers
// will return status as 0 even though it's a successful request
if (request.status === 0 && !(request.responseURL && request.responseURL.indexOf('file:') === 0)) {
return;
}
// Prepare the response
var responseHeaders = 'getAllResponseHeaders' in request ? parseHeaders(request.getAllResponseHeaders()) : null;
var responseData = !config.responseType || config.responseType === 'text' ? request.responseText : request.response;
var response = {
data: responseData,
// IE sends 1223 instead of 204 (https://github.com/mzabriskie/axios/issues/201)
status: request.status === 1223 ? 204 : request.status,
statusText: request.status === 1223 ? 'No Content' : request.statusText,
headers: responseHeaders,
config: config,
request: request
};
settle(resolve, reject, response);
// Clean up request
request = null;
};
// Handle low level network errors
request.onerror = function handleError() {
// Real errors are hidden from us by the browser
// onerror should only fire if it's a network error
reject(createError('Network Error', config));
// Clean up request
request = null;
};
// Handle timeout
request.ontimeout = function handleTimeout() {
reject(createError('timeout of ' + config.timeout + 'ms exceeded', config, 'ECONNABORTED'));
// Clean up request
request = null;
};
// Add xsrf header
// This is only done if running in a standard browser environment.
// Specifically not if we're in a web worker, or react-native.
if (utils.isStandardBrowserEnv()) {
var cookies = __webpack_require__(23);
// Add xsrf header
var xsrfValue = (config.withCredentials || isURLSameOrigin(config.url)) && config.xsrfCookieName ?
cookies.read(config.xsrfCookieName) :
undefined;
if (xsrfValue) {
requestHeaders[config.xsrfHeaderName] = xsrfValue;
}
}
// Add headers to the request
if ('setRequestHeader' in request) {
utils.forEach(requestHeaders, function setRequestHeader(val, key) {
if (typeof requestData === 'undefined' && key.toLowerCase() === 'content-type') {
// Remove Content-Type if data is undefined
delete requestHeaders[key];
} else {
// Otherwise add header to the request
request.setRequestHeader(key, val);
}
});
}
// Add withCredentials to request if needed
if (config.withCredentials) {
request.withCredentials = true;
}
// Add responseType to request if needed
if (config.responseType) {
try {
request.responseType = config.responseType;
} catch (e) {
if (request.responseType !== 'json') {
throw e;
}
}
}
// Handle progress if needed
if (typeof config.onDownloadProgress === 'function') {
request.addEventListener('progress', config.onDownloadProgress);
}
// Not all browsers support upload events
if (typeof config.onUploadProgress === 'function' && request.upload) {
request.upload.addEventListener('progress', config.onUploadProgress);
}
if (config.cancelToken) {
// Handle cancellation
config.cancelToken.promise.then(function onCanceled(cancel) {
if (!request) {
return;
}
request.abort();
reject(cancel);
// Clean up request
request = null;
});
}
if (requestData === undefined) {
requestData = null;
}
// Send the request
request.send(requestData);
});
};
/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(8)))
/***/ }),
/* 4 */
/***/ (function(module, exports, __webpack_require__) {
"use strict";
/**
* A `Cancel` is an object that is thrown when an operation is canceled.
*
* @class
* @param {string=} message The message.
*/
function Cancel(message) {
this.message = message;
}
Cancel.prototype.toString = function toString() {
return 'Cancel' + (this.message ? ': ' + this.message : '');
};
Cancel.prototype.__CANCEL__ = true;
module.exports = Cancel;
/***/ }),
/* 5 */
/***/ (function(module, exports, __webpack_require__) {
"use strict";
module.exports = function isCancel(value) {
return !!(value && value.__CANCEL__);
};
/***/ }),
/* 6 */
/***/ (function(module, exports, __webpack_require__) {
"use strict";
var enhanceError = __webpack_require__(17);
/**
* Create an Error with the specified message, config, error code, and response.
*
* @param {string} message The error message.
* @param {Object} config The config.
* @param {string} [code] The error code (for example, 'ECONNABORTED').
@ @param {Object} [response] The response.
* @returns {Error} The created error.
*/
module.exports = function createError(message, config, code, response) {
var error = new Error(message);
return enhanceError(error, config, code, response);
};
/***/ }),
/* 7 */
/***/ (function(module, exports, __webpack_require__) {
"use strict";
module.exports = function bind(fn, thisArg) {
return function wrap() {
var args = new Array(arguments.length);
for (var i = 0; i < args.length; i++) {
args[i] = arguments[i];
}
return fn.apply(thisArg, args);
};
};
/***/ }),
/* 8 */
/***/ (function(module, exports) {
// shim for using process in browser
var process = module.exports = {};
// cached from whatever global is present so that test runners that stub it
// don't break things. But we need to wrap it in a try catch in case it is
// wrapped in strict mode code which doesn't define any globals. It's inside a
// function because try/catches deoptimize in certain engines.
var cachedSetTimeout;
var cachedClearTimeout;
function defaultSetTimout() {
throw new Error('setTimeout has not been defined');
}
function defaultClearTimeout () {
throw new Error('clearTimeout has not been defined');
}
(function () {
try {
if (typeof setTimeout === 'function') {
cachedSetTimeout = setTimeout;
} else {
cachedSetTimeout = defaultSetTimout;
}
} catch (e) {
cachedSetTimeout = defaultSetTimout;
}
try {
if (typeof clearTimeout === 'function') {
cachedClearTimeout = clearTimeout;
} else {
cachedClearTimeout = defaultClearTimeout;
}
} catch (e) {
cachedClearTimeout = defaultClearTimeout;
}
} ())
function runTimeout(fun) {
if (cachedSetTimeout === setTimeout) {
//normal enviroments in sane situations
return setTimeout(fun, 0);
}
// if setTimeout wasn't available but was latter defined
if ((cachedSetTimeout === defaultSetTimout || !cachedSetTimeout) && setTimeout) {
cachedSetTimeout = setTimeout;
return setTimeout(fun, 0);
}
try {
// when when somebody has screwed with setTimeout but no I.E. maddness
return cachedSetTimeout(fun, 0);
} catch(e){
try {
// When we are in I.E. but the script has been evaled so I.E. doesn't trust the global object when called normally
return cachedSetTimeout.call(null, fun, 0);
} catch(e){
// same as above but when it's a version of I.E. that must have the global object for 'this', hopfully our context correct otherwise it will throw a global error
return cachedSetTimeout.call(this, fun, 0);
}
}
}
function runClearTimeout(marker) {
if (cachedClearTimeout === clearTimeout) {
//normal enviroments in sane situations
return clearTimeout(marker);
}
// if clearTimeout wasn't available but was latter defined
if ((cachedClearTimeout === defaultClearTimeout || !cachedClearTimeout) && clearTimeout) {
cachedClearTimeout = clearTimeout;
return clearTimeout(marker);
}
try {
// when when somebody has screwed with setTimeout but no I.E. maddness
return cachedClearTimeout(marker);
} catch (e){
try {
// When we are in I.E. but the script has been evaled so I.E. doesn't trust the global object when called normally
return cachedClearTimeout.call(null, marker);
} catch (e){
// same as above but when it's a version of I.E. that must have the global object for 'this', hopfully our context correct otherwise it will throw a global error.
// Some versions of I.E. have different rules for clearTimeout vs setTimeout
return cachedClearTimeout.call(this, marker);
}
}
}
var queue = [];
var draining = false;
var currentQueue;
var queueIndex = -1;
function cleanUpNextTick() {
if (!draining || !currentQueue) {
return;
}
draining = false;
if (currentQueue.length) {
queue = currentQueue.concat(queue);
} else {
queueIndex = -1;
}
if (queue.length) {
drainQueue();
}
}
function drainQueue() {
if (draining) {
return;
}
var timeout = runTimeout(cleanUpNextTick);
draining = true;
var len = queue.length;
while(len) {
currentQueue = queue;
queue = [];
while (++queueIndex < len) {
if (currentQueue) {
currentQueue[queueIndex].run();
}
}
queueIndex = -1;
len = queue.length;
}
currentQueue = null;
draining = false;
runClearTimeout(timeout);
}
process.nextTick = function (fun) {
var args = new Array(arguments.length - 1);
if (arguments.length > 1) {
for (var i = 1; i < arguments.length; i++) {
args[i - 1] = arguments[i];
}
}
queue.push(new Item(fun, args));
if (queue.length === 1 && !draining) {
runTimeout(drainQueue);
}
};
// v8 likes predictible objects
function Item(fun, array) {
this.fun = fun;
this.array = array;
}
Item.prototype.run = function () {
this.fun.apply(null, this.array);
};
process.title = 'browser';
process.browser = true;
process.env = {};
process.argv = [];
process.version = ''; // empty string to avoid regexp issues
process.versions = {};
function noop() {}
process.on = noop;
process.addListener = noop;
process.once = noop;
process.off = noop;
process.removeListener = noop;
process.removeAllListeners = noop;
process.emit = noop;
process.binding = function (name) {
throw new Error('process.binding is not supported');
};
process.cwd = function () { return '/' };
process.chdir = function (dir) {
throw new Error('process.chdir is not supported');
};
process.umask = function() { return 0; };
/***/ }),
/* 9 */
/***/ (function(module, exports, __webpack_require__) {
/**
* First we will load all of this project's JavaScript dependencies which
* includes Vue and other libraries. It is a great starting point when
* building robust, powerful web applications using Vue and Laravel.
*/
__webpack_require__(29);
__webpack_require__(31);
__webpack_require__(30);
/***/ }),
/* 10 */
/***/ (function(module, exports) {
// removed by extract-text-webpack-plugin
/***/ }),
/* 11 */
/***/ (function(module, exports, __webpack_require__) {
module.exports = __webpack_require__(12);
/***/ }),
/* 12 */
/***/ (function(module, exports, __webpack_require__) {
"use strict";
var utils = __webpack_require__(0);
var bind = __webpack_require__(7);
var Axios = __webpack_require__(14);
var defaults = __webpack_require__(2);
/**
* Create an instance of Axios
*
* @param {Object} defaultConfig The default config for the instance
* @return {Axios} A new instance of Axios
*/
function createInstance(defaultConfig) {
var context = new Axios(defaultConfig);
var instance = bind(Axios.prototype.request, context);
// Copy axios.prototype to instance
utils.extend(instance, Axios.prototype, context);
// Copy context to instance
utils.extend(instance, context);
return instance;
}
// Create the default instance to be exported
var axios = createInstance(defaults);
// Expose Axios class to allow class inheritance
axios.Axios = Axios;
// Factory for creating new instances
axios.create = function create(instanceConfig) {
return createInstance(utils.merge(defaults, instanceConfig));
};
// Expose Cancel & CancelToken
axios.Cancel = __webpack_require__(4);
axios.CancelToken = __webpack_require__(13);
axios.isCancel = __webpack_require__(5);
// Expose all/spread
axios.all = function all(promises) {
return Promise.all(promises);
};
axios.spread = __webpack_require__(28);
module.exports = axios;
// Allow use of default import syntax in TypeScript
module.exports.default = axios;
/***/ }),
/* 13 */
/***/ (function(module, exports, __webpack_require__) {
"use strict";
var Cancel = __webpack_require__(4);
/**
* A `CancelToken` is an object that can be used to request cancellation of an operation.
*
* @class
* @param {Function} executor The executor function.
*/
function CancelToken(executor) {
if (typeof executor !== 'function') {
throw new TypeError('executor must be a function.');
}
var resolvePromise;
this.promise = new Promise(function promiseExecutor(resolve) {
resolvePromise = resolve;
});
var token = this;
executor(function cancel(message) {
if (token.reason) {
// Cancellation has already been requested
return;
}
token.reason = new Cancel(message);
resolvePromise(token.reason);
});
}
/**
* Throws a `Cancel` if cancellation has been requested.
*/
CancelToken.prototype.throwIfRequested = function throwIfRequested() {
if (this.reason) {
throw this.reason;
}
};
/**
* Returns an object that contains a new `CancelToken` and a function that, when called,
* cancels the `CancelToken`.
*/
CancelToken.source = function source() {
var cancel;
var token = new CancelToken(function executor(c) {
cancel = c;
});
return {
token: token,
cancel: cancel
};
};
module.exports = CancelToken;
/***/ }),
/* 14 */
/***/ (function(module, exports, __webpack_require__) {
"use strict";
var defaults = __webpack_require__(2);
var utils = __webpack_require__(0);
var InterceptorManager = __webpack_require__(15);
var dispatchRequest = __webpack_require__(16);
var isAbsoluteURL = __webpack_require__(24);
var combineURLs = __webpack_require__(22);
/**
* Create a new instance of Axios
*
* @param {Object} instanceConfig The default config for the instance
*/
function Axios(instanceConfig) {
this.defaults = instanceConfig;
this.interceptors = {
request: new InterceptorManager(),
response: new InterceptorManager()
};
}
/**
* Dispatch a request
*
* @param {Object} config The config specific for this request (merged with this.defaults)
*/
Axios.prototype.request = function request(config) {
/*eslint no-param-reassign:0*/
// Allow for axios('example/url'[, config]) a la fetch API
if (typeof config === 'string') {
config = utils.merge({
url: arguments[0]
}, arguments[1]);
}
config = utils.merge(defaults, this.defaults, { method: 'get' }, config);
// Support baseURL config
if (config.baseURL && !isAbsoluteURL(config.url)) {
config.url = combineURLs(config.baseURL, config.url);
}
// Hook up interceptors middleware
var chain = [dispatchRequest, undefined];
var promise = Promise.resolve(config);
this.interceptors.request.forEach(function unshiftRequestInterceptors(interceptor) {
chain.unshift(interceptor.fulfilled, interceptor.rejected);
});
this.interceptors.response.forEach(function pushResponseInterceptors(interceptor) {
chain.push(interceptor.fulfilled, interceptor.rejected);
});
while (chain.length) {
promise = promise.then(chain.shift(), chain.shift());
}
return promise;
};
// Provide aliases for supported request methods
utils.forEach(['delete', 'get', 'head'], function forEachMethodNoData(method) {
/*eslint func-names:0*/
Axios.prototype[method] = function(url, config) {
return this.request(utils.merge(config || {}, {
method: method,
url: url
}));
};
});
utils.forEach(['post', 'put', 'patch'], function forEachMethodWithData(method) {
/*eslint func-names:0*/
Axios.prototype[method] = function(url, data, config) {
return this.request(utils.merge(config || {}, {
method: method,
url: url,
data: data
}));
};
});
module.exports = Axios;
/***/ }),
/* 15 */
/***/ (function(module, exports, __webpack_require__) {
"use strict";
var utils = __webpack_require__(0);
function InterceptorManager() {
this.handlers = [];
}
/**
* Add a new interceptor to the stack
*
* @param {Function} fulfilled The function to handle `then` for a `Promise`
* @param {Function} rejected The function to handle `reject` for a `Promise`
*
* @return {Number} An ID used to remove interceptor later
*/
InterceptorManager.prototype.use = function use(fulfilled, rejected) {
this.handlers.push({
fulfilled: fulfilled,
rejected: rejected
});
return this.handlers.length - 1;
};
/**
* Remove an interceptor from the stack
*
* @param {Number} id The ID that was returned by `use`
*/
InterceptorManager.prototype.eject = function eject(id) {
if (this.handlers[id]) {
this.handlers[id] = null;
}
};
/**
* Iterate over all the registered interceptors
*
* This method is particularly useful for skipping over any
* interceptors that may have become `null` calling `eject`.
*
* @param {Function} fn The function to call for each interceptor
*/
InterceptorManager.prototype.forEach = function forEach(fn) {
utils.forEach(this.handlers, function forEachHandler(h) {
if (h !== null) {
fn(h);
}
});
};
module.exports = InterceptorManager;
/***/ }),
/* 16 */
/***/ (function(module, exports, __webpack_require__) {
"use strict";
var utils = __webpack_require__(0);
var transformData = __webpack_require__(19);
var isCancel = __webpack_require__(5);
var defaults = __webpack_require__(2);
/**
* Throws a `Cancel` if cancellation has been requested.
*/
function throwIfCancellationRequested(config) {
if (config.cancelToken) {
config.cancelToken.throwIfRequested();
}
}
/**
* Dispatch a request to the server using the configured adapter.
*
* @param {object} config The config that is to be used for the request
* @returns {Promise} The Promise to be fulfilled
*/
module.exports = function dispatchRequest(config) {
throwIfCancellationRequested(config);
// Ensure headers exist
config.headers = config.headers || {};
// Transform request data
config.data = transformData(
config.data,
config.headers,
config.transformRequest
);
// Flatten headers
config.headers = utils.merge(
config.headers.common || {},
config.headers[config.method] || {},
config.headers || {}
);
utils.forEach(
['delete', 'get', 'head', 'post', 'put', 'patch', 'common'],
function cleanHeaderConfig(method) {
delete config.headers[method];
}
);
var adapter = config.adapter || defaults.adapter;
return adapter(config).then(function onAdapterResolution(response) {
throwIfCancellationRequested(config);
// Transform response data
response.data = transformData(
response.data,
response.headers,
config.transformResponse
);
return response;
}, function onAdapterRejection(reason) {
if (!isCancel(reason)) {
throwIfCancellationRequested(config);
// Transform response data
if (reason && reason.response) {
reason.response.data = transformData(
reason.response.data,
reason.response.headers,
config.transformResponse
);
}
}
return Promise.reject(reason);
});
};
/***/ }),
/* 17 */
/***/ (function(module, exports, __webpack_require__) {
"use strict";
/**
* Update an Error with the specified config, error code, and response.
*
* @param {Error} error The error to update.
* @param {Object} config The config.
* @param {string} [code] The error code (for example, 'ECONNABORTED').
@ @param {Object} [response] The response.
* @returns {Error} The error.
*/
module.exports = function enhanceError(error, config, code, response) {
error.config = config;
if (code) {
error.code = code;
}
error.response = response;
return error;
};
/***/ }),
/* 18 */
/***/ (function(module, exports, __webpack_require__) {
"use strict";
var createError = __webpack_require__(6);
/**
* Resolve or reject a Promise based on response status.
*
* @param {Function} resolve A function that resolves the promise.
* @param {Function} reject A function that rejects the promise.
* @param {object} response The response.
*/
module.exports = function settle(resolve, reject, response) {
var validateStatus = response.config.validateStatus;
// Note: status is not exposed by XDomainRequest
if (!response.status || !validateStatus || validateStatus(response.status)) {
resolve(response);
} else {
reject(createError(
'Request failed with status code ' + response.status,
response.config,
null,
response
));
}
};
/***/ }),
/* 19 */
/***/ (function(module, exports, __webpack_require__) {
"use strict";
var utils = __webpack_require__(0);
/**
* Transform the data for a request or a response
*
* @param {Object|String} data The data to be transformed
* @param {Array} headers The headers for the request or response
* @param {Array|Function} fns A single function or Array of functions
* @returns {*} The resulting transformed data
*/
module.exports = function transformData(data, headers, fns) {
/*eslint no-param-reassign:0*/
utils.forEach(fns, function transform(fn) {
data = fn(data, headers);
});
return data;
};
/***/ }),
/* 20 */
/***/ (function(module, exports, __webpack_require__) {
"use strict";
// btoa polyfill for IE<10 courtesy https://github.com/davidchambers/Base64.js
var chars = 'ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/=';
function E() {
this.message = 'String contains an invalid character';
}
E.prototype = new Error;
E.prototype.code = 5;
E.prototype.name = 'InvalidCharacterError';
function btoa(input) {
var str = String(input);
var output = '';
for (
// initialize result and counter
var block, charCode, idx = 0, map = chars;
// if the next str index does not exist:
// change the mapping table to "="
// check if d has no fractional digits
str.charAt(idx | 0) || (map = '=', idx % 1);
// "8 - idx % 1 * 8" generates the sequence 2, 4, 6, 8
output += map.charAt(63 & block >> 8 - idx % 1 * 8)
) {
charCode = str.charCodeAt(idx += 3 / 4);
if (charCode > 0xFF) {
throw new E();
}
block = block << 8 | charCode;
}
return output;
}
module.exports = btoa;
/***/ }),
/* 21 */
/***/ (function(module, exports, __webpack_require__) {
"use strict";
var utils = __webpack_require__(0);
function encode(val) {
return encodeURIComponent(val).
replace(/%40/gi, '@').
replace(/%3A/gi, ':').
replace(/%24/g, '$').
replace(/%2C/gi, ',').
replace(/%20/g, '+').
replace(/%5B/gi, '[').
replace(/%5D/gi, ']');
}
/**
* Build a URL by appending params to the end
*
* @param {string} url The base of the url (e.g., http://www.google.com)
* @param {object} [params] The params to be appended
* @returns {string} The formatted url
*/
module.exports = function buildURL(url, params, paramsSerializer) {
/*eslint no-param-reassign:0*/
if (!params) {
return url;
}
var serializedParams;
if (paramsSerializer) {
serializedParams = paramsSerializer(params);
} else if (utils.isURLSearchParams(params)) {
serializedParams = params.toString();
} else {
var parts = [];
utils.forEach(params, function serialize(val, key) {
if (val === null || typeof val === 'undefined') {
return;
}
if (utils.isArray(val)) {
key = key + '[]';
}
if (!utils.isArray(val)) {
val = [val];
}
utils.forEach(val, function parseValue(v) {
if (utils.isDate(v)) {
v = v.toISOString();
} else if (utils.isObject(v)) {
v = JSON.stringify(v);
}
parts.push(encode(key) + '=' + encode(v));
});
});
serializedParams = parts.join('&');
}
if (serializedParams) {
url += (url.indexOf('?') === -1 ? '?' : '&') + serializedParams;
}
return url;
};
/***/ }),
/* 22 */
/***/ (function(module, exports, __webpack_require__) {
"use strict";
/**
* Creates a new URL by combining the specified URLs
*
* @param {string} baseURL The base URL
* @param {string} relativeURL The relative URL
* @returns {string} The combined URL
*/
module.exports = function combineURLs(baseURL, relativeURL) {
return baseURL.replace(/\/+$/, '') + '/' + relativeURL.replace(/^\/+/, '');
};
/***/ }),
/* 23 */
/***/ (function(module, exports, __webpack_require__) {
"use strict";
var utils = __webpack_require__(0);
module.exports = (
utils.isStandardBrowserEnv() ?
// Standard browser envs support document.cookie
(function standardBrowserEnv() {
return {
write: function write(name, value, expires, path, domain, secure) {
var cookie = [];
cookie.push(name + '=' + encodeURIComponent(value));
if (utils.isNumber(expires)) {
cookie.push('expires=' + new Date(expires).toGMTString());
}
if (utils.isString(path)) {
cookie.push('path=' + path);
}
if (utils.isString(domain)) {
cookie.push('domain=' + domain);
}
if (secure === true) {
cookie.push('secure');
}
document.cookie = cookie.join('; ');
},
read: function read(name) {
var match = document.cookie.match(new RegExp('(^|;\\s*)(' + name + ')=([^;]*)'));
return (match ? decodeURIComponent(match[3]) : null);
},
remove: function remove(name) {
this.write(name, '', Date.now() - 86400000);
}
};
})() :
// Non standard browser env (web workers, react-native) lack needed support.
(function nonStandardBrowserEnv() {
return {
write: function write() {},
read: function read() { return null; },
remove: function remove() {}
};
})()
);
/***/ }),
/* 24 */
/***/ (function(module, exports, __webpack_require__) {
"use strict";
/**
* Determines whether the specified URL is absolute
*
* @param {string} url The URL to test
* @returns {boolean} True if the specified URL is absolute, otherwise false
*/
module.exports = function isAbsoluteURL(url) {
// A URL is considered absolute if it begins with "<scheme>://" or "//" (protocol-relative URL).
// RFC 3986 defines scheme name as a sequence of characters beginning with a letter and followed
// by any combination of letters, digits, plus, period, or hyphen.
return /^([a-z][a-z\d\+\-\.]*:)?\/\//i.test(url);
};
/***/ }),
/* 25 */
/***/ (function(module, exports, __webpack_require__) {
"use strict";
var utils = __webpack_require__(0);
module.exports = (
utils.isStandardBrowserEnv() ?
// Standard browser envs have full support of the APIs needed to test
// whether the request URL is of the same origin as current location.
(function standardBrowserEnv() {
var msie = /(msie|trident)/i.test(navigator.userAgent);
var urlParsingNode = document.createElement('a');
var originURL;
/**
* Parse a URL to discover it's components
*
* @param {String} url The URL to be parsed
* @returns {Object}
*/
function resolveURL(url) {
var href = url;
if (msie) {
// IE needs attribute set twice to normalize properties
urlParsingNode.setAttribute('href', href);
href = urlParsingNode.href;
}
urlParsingNode.setAttribute('href', href);
// urlParsingNode provides the UrlUtils interface - http://url.spec.whatwg.org/#urlutils
return {
href: urlParsingNode.href,
protocol: urlParsingNode.protocol ? urlParsingNode.protocol.replace(/:$/, '') : '',
host: urlParsingNode.host,
search: urlParsingNode.search ? urlParsingNode.search.replace(/^\?/, '') : '',
hash: urlParsingNode.hash ? urlParsingNode.hash.replace(/^#/, '') : '',
hostname: urlParsingNode.hostname,
port: urlParsingNode.port,
pathname: (urlParsingNode.pathname.charAt(0) === '/') ?
urlParsingNode.pathname :
'/' + urlParsingNode.pathname
};
}
originURL = resolveURL(window.location.href);
/**
* Determine if a URL shares the same origin as the current location
*
* @param {String} requestURL The URL to test
* @returns {boolean} True if URL shares the same origin, otherwise false
*/
return function isURLSameOrigin(requestURL) {
var parsed = (utils.isString(requestURL)) ? resolveURL(requestURL) : requestURL;
return (parsed.protocol === originURL.protocol &&
parsed.host === originURL.host);
};
})() :
// Non standard browser envs (web workers, react-native) lack needed support.
(function nonStandardBrowserEnv() {
return function isURLSameOrigin() {
return true;
};
})()
);
/***/ }),
/* 26 */
/***/ (function(module, exports, __webpack_require__) {
"use strict";
var utils = __webpack_require__(0);
module.exports = function normalizeHeaderName(headers, normalizedName) {
utils.forEach(headers, function processHeader(value, name) {
if (name !== normalizedName && name.toUpperCase() === normalizedName.toUpperCase()) {
headers[normalizedName] = value;
delete headers[name];
}
});
};
/***/ }),
/* 27 */
/***/ (function(module, exports, __webpack_require__) {
"use strict";
var utils = __webpack_require__(0);
/**
* Parse headers into an object
*
* ```
* Date: Wed, 27 Aug 2014 08:58:49 GMT
* Content-Type: application/json
* Connection: keep-alive
* Transfer-Encoding: chunked
* ```
*
* @param {String} headers Headers needing to be parsed
* @returns {Object} Headers parsed into an object
*/
module.exports = function parseHeaders(headers) {
var parsed = {};
var key;
var val;
var i;
if (!headers) { return parsed; }
utils.forEach(headers.split('\n'), function parser(line) {
i = line.indexOf(':');
key = utils.trim(line.substr(0, i)).toLowerCase();
val = utils.trim(line.substr(i + 1));
if (key) {
parsed[key] = parsed[key] ? parsed[key] + ', ' + val : val;
}
});
return parsed;
};
/***/ }),
/* 28 */
/***/ (function(module, exports, __webpack_require__) {
"use strict";
/**
* Syntactic sugar for invoking a function and expanding an array for arguments.
*
* Common use case would be to use `Function.prototype.apply`.
*
* ```js
* function f(x, y, z) {}
* var args = [1, 2, 3];
* f.apply(null, args);
* ```
*
* With `spread` this example can be re-written.
*
* ```js
* spread(function(x, y, z) {})([1, 2, 3]);
* ```
*
* @param {Function} callback
* @returns {Function}
*/
module.exports = function spread(callback) {
return function wrap(arr) {
return callback.apply(null, arr);
};
};
/***/ }),
/* 29 */
/***/ (function(module, exports, __webpack_require__) {
/* WEBPACK VAR INJECTION */(function(__webpack_provided_window_dot_jQuery) {
window._ = __webpack_require__(33);
/**
* We'll load jQuery and the Bootstrap jQuery plugin which provides support
* for JavaScript based Bootstrap features such as modals and tabs. This
* code may be modified to fit the specific needs of your application.
*/
window.$ = __webpack_provided_window_dot_jQuery = __webpack_require__(1);
__webpack_require__(32);
/**
* We'll load the axios HTTP library which allows us to easily issue requests
* to our Laravel back-end. This library automatically handles sending the
* CSRF token as a header based on the value of the "XSRF" token cookie.
*/
window.axios = __webpack_require__(11);
window.axios.defaults.headers.common = {
'X-CSRF-TOKEN': document.querySelector('meta[name="csrf-token"]').content,
'X-Requested-With': 'XMLHttpRequest'
};
/**
* Echo exposes an expressive API for subscribing to channels and listening
* for events that are broadcast by Laravel. Echo and event broadcasting
* allows your team to easily build robust real-time web applications.
*/
// import Echo from "laravel-echo"
// window.Echo = new Echo({
// broadcaster: 'pusher',
// key: 'your-pusher-key'
// });
/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(1)))
/***/ }),
/* 30 */
/***/ (function(module, exports, __webpack_require__) {
/* WEBPACK VAR INJECTION */(function(jQuery) {var _typeof = typeof Symbol === "function" && typeof Symbol.iterator === "symbol" ? function (obj) { return typeof obj; } : function (obj) { return obj && typeof Symbol === "function" && obj.constructor === Symbol && obj !== Symbol.prototype ? "symbol" : typeof obj; };
/* jqBootstrapValidation
* A plugin for automating validation on Twitter Bootstrap formatted forms.
*
* v1.3.6
*
* License: MIT <http://opensource.org/licenses/mit-license.php> - see LICENSE file
*
* http://ReactiveRaven.github.com/jqBootstrapValidation/
*/
(function ($) {
var createdElements = [];
var defaults = {
options: {
prependExistingHelpBlock: false,
sniffHtml: true, // sniff for 'required', 'maxlength', etc
preventSubmit: true, // stop the form submit event from firing if validation fails
submitError: false, // function called if there is an error when trying to submit
submitSuccess: false, // function called just before a successful submit event is sent to the server
semanticallyStrict: false, // set to true to tidy up generated HTML output
autoAdd: {
helpBlocks: true
},
filter: function filter() {
// return $(this).is(":visible"); // only validate elements you can see
return true; // validate everything
}
},
methods: {
init: function init(options) {
var settings = $.extend(true, {}, defaults);
settings.options = $.extend(true, settings.options, options);
var $siblingElements = this;
var uniqueForms = $.unique($siblingElements.map(function () {
return $(this).parents("form")[0];
}).toArray());
$(uniqueForms).bind("submit", function (e) {
var $form = $(this);
var warningsFound = 0;
var $inputs = $form.find("input,textarea,select").not("[type=submit],[type=image]").filter(settings.options.filter);
$inputs.trigger("submit.validation").trigger("validationLostFocus.validation");
$inputs.each(function (i, el) {
var $this = $(el),
$controlGroup = $this.parents(".form-group").first();
if ($controlGroup.hasClass("warning")) {
$controlGroup.removeClass("warning").addClass("error");
warningsFound++;
}
});
$inputs.trigger("validationLostFocus.validation");
if (warningsFound) {
if (settings.options.preventSubmit) {
e.preventDefault();
}
$form.addClass("error");
if ($.isFunction(settings.options.submitError)) {
settings.options.submitError($form, e, $inputs.jqBootstrapValidation("collectErrors", true));
}
} else {
$form.removeClass("error");
if ($.isFunction(settings.options.submitSuccess)) {
settings.options.submitSuccess($form, e);
}
}
});
return this.each(function () {
// Get references to everything we're interested in
var $this = $(this),
$controlGroup = $this.parents(".form-group").first(),
$helpBlock = $controlGroup.find(".help-block").first(),
$form = $this.parents("form").first(),
validatorNames = [];
// create message container if not exists
if (!$helpBlock.length && settings.options.autoAdd && settings.options.autoAdd.helpBlocks) {
$helpBlock = $('<div class="help-block" />');
$controlGroup.find('.controls').append($helpBlock);
createdElements.push($helpBlock[0]);
}
// =============================================================
// SNIFF HTML FOR VALIDATORS
// =============================================================
// *snort sniff snuffle*
if (settings.options.sniffHtml) {
var message = "";
// ---------------------------------------------------------
// PATTERN
// ---------------------------------------------------------
if ($this.attr("pattern") !== undefined) {
message = "Not in the expected format<!-- data-validation-pattern-message to override -->";
if ($this.data("validationPatternMessage")) {
message = $this.data("validationPatternMessage");
}
$this.data("validationPatternMessage", message);
$this.data("validationPatternRegex", $this.attr("pattern"));
}
// ---------------------------------------------------------
// MAX
// ---------------------------------------------------------
if ($this.attr("max") !== undefined || $this.attr("aria-valuemax") !== undefined) {
var max = $this.attr("max") !== undefined ? $this.attr("max") : $this.attr("aria-valuemax");
message = "Too high: Maximum of '" + max + "'<!-- data-validation-max-message to override -->";
if ($this.data("validationMaxMessage")) {
message = $this.data("validationMaxMessage");
}
$this.data("validationMaxMessage", message);
$this.data("validationMaxMax", max);
}
// ---------------------------------------------------------
// MIN
// ---------------------------------------------------------
if ($this.attr("min") !== undefined || $this.attr("aria-valuemin") !== undefined) {
var min = $this.attr("min") !== undefined ? $this.attr("min") : $this.attr("aria-valuemin");
message = "Too low: Minimum of '" + min + "'<!-- data-validation-min-message to override -->";
if ($this.data("validationMinMessage")) {
message = $this.data("validationMinMessage");
}
$this.data("validationMinMessage", message);
$this.data("validationMinMin", min);
}
// ---------------------------------------------------------
// MAXLENGTH
// ---------------------------------------------------------
if ($this.attr("maxlength") !== undefined) {
message = "Too long: Maximum of '" + $this.attr("maxlength") + "' characters<!-- data-validation-maxlength-message to override -->";
if ($this.data("validationMaxlengthMessage")) {
message = $this.data("validationMaxlengthMessage");
}
$this.data("validationMaxlengthMessage", message);
$this.data("validationMaxlengthMaxlength", $this.attr("maxlength"));
}
// ---------------------------------------------------------
// MINLENGTH
// ---------------------------------------------------------
if ($this.attr("minlength") !== undefined) {
message = "Too short: Minimum of '" + $this.attr("minlength") + "' characters<!-- data-validation-minlength-message to override -->";
if ($this.data("validationMinlengthMessage")) {
message = $this.data("validationMinlengthMessage");
}
$this.data("validationMinlengthMessage", message);
$this.data("validationMinlengthMinlength", $this.attr("minlength"));
}
// ---------------------------------------------------------
// REQUIRED
// ---------------------------------------------------------
if ($this.attr("required") !== undefined || $this.attr("aria-required") !== undefined) {
message = settings.builtInValidators.required.message;
if ($this.data("validationRequiredMessage")) {
message = $this.data("validationRequiredMessage");
}
$this.data("validationRequiredMessage", message);
}
// ---------------------------------------------------------
// NUMBER
// ---------------------------------------------------------
if ($this.attr("type") !== undefined && $this.attr("type").toLowerCase() === "number") {
message = settings.builtInValidators.number.message;
if ($this.data("validationNumberMessage")) {
message = $this.data("validationNumberMessage");
}
$this.data("validationNumberMessage", message);
}
// ---------------------------------------------------------
// EMAIL
// ---------------------------------------------------------
if ($this.attr("type") !== undefined && $this.attr("type").toLowerCase() === "email") {
message = "Not a valid email address<!-- data-validator-validemail-message to override -->";
if ($this.data("validationValidemailMessage")) {
message = $this.data("validationValidemailMessage");
} else if ($this.data("validationEmailMessage")) {
message = $this.data("validationEmailMessage");
}
$this.data("validationValidemailMessage", message);
}
// ---------------------------------------------------------
// MINCHECKED
// ---------------------------------------------------------
if ($this.attr("minchecked") !== undefined) {
message = "Not enough options checked; Minimum of '" + $this.attr("minchecked") + "' required<!-- data-validation-minchecked-message to override -->";
if ($this.data("validationMincheckedMessage")) {
message = $this.data("validationMincheckedMessage");
}
$this.data("validationMincheckedMessage", message);
$this.data("validationMincheckedMinchecked", $this.attr("minchecked"));
}
// ---------------------------------------------------------
// MAXCHECKED
// ---------------------------------------------------------
if ($this.attr("maxchecked") !== undefined) {
message = "Too many options checked; Maximum of '" + $this.attr("maxchecked") + "' required<!-- data-validation-maxchecked-message to override -->";
if ($this.data("validationMaxcheckedMessage")) {
message = $this.data("validationMaxcheckedMessage");
}
$this.data("validationMaxcheckedMessage", message);
$this.data("validationMaxcheckedMaxchecked", $this.attr("maxchecked"));
}
}
// =============================================================
// COLLECT VALIDATOR NAMES
// =============================================================
// Get named validators
if ($this.data("validation") !== undefined) {
validatorNames = $this.data("validation").split(",");
}
// Get extra ones defined on the element's data attributes
$.each($this.data(), function (i, el) {
var parts = i.replace(/([A-Z])/g, ",$1").split(",");
if (parts[0] === "validation" && parts[1]) {
validatorNames.push(parts[1]);
}
});
// =============================================================
// NORMALISE VALIDATOR NAMES
// =============================================================
var validatorNamesToInspect = validatorNames;
var newValidatorNamesToInspect = [];
do // repeatedly expand 'shortcut' validators into their real validators
{
// Uppercase only the first letter of each name
$.each(validatorNames, function (i, el) {
validatorNames[i] = formatValidatorName(el);
});
// Remove duplicate validator names
validatorNames = $.unique(validatorNames);
// Pull out the new validator names from each shortcut
newValidatorNamesToInspect = [];
$.each(validatorNamesToInspect, function (i, el) {
if ($this.data("validation" + el + "Shortcut") !== undefined) {
// Are these custom validators?
// Pull them out!
$.each($this.data("validation" + el + "Shortcut").split(","), function (i2, el2) {
newValidatorNamesToInspect.push(el2);
});
} else if (settings.builtInValidators[el.toLowerCase()]) {
// Is this a recognised built-in?
// Pull it out!
var validator = settings.builtInValidators[el.toLowerCase()];
if (validator.type.toLowerCase() === "shortcut") {
$.each(validator.shortcut.split(","), function (i, el) {
el = formatValidatorName(el);
newValidatorNamesToInspect.push(el);
validatorNames.push(el);
});
}
}
});
validatorNamesToInspect = newValidatorNamesToInspect;
} while (validatorNamesToInspect.length > 0);
// =============================================================
// SET UP VALIDATOR ARRAYS
// =============================================================
var validators = {};
$.each(validatorNames, function (i, el) {
// Set up the 'override' message
var message = $this.data("validation" + el + "Message");
var hasOverrideMessage = message !== undefined;
var foundValidator = false;
message = message ? message : "'" + el + "' validation failed <!-- Add attribute 'data-validation-" + el.toLowerCase() + "-message' to input to change this message -->";
$.each(settings.validatorTypes, function (validatorType, validatorTemplate) {
if (validators[validatorType] === undefined) {
validators[validatorType] = [];
}
if (!foundValidator && $this.data("validation" + el + formatValidatorName(validatorTemplate.name)) !== undefined) {
validators[validatorType].push($.extend(true, {
name: formatValidatorName(validatorTemplate.name),
message: message
}, validatorTemplate.init($this, el)));
foundValidator = true;
}
});
if (!foundValidator && settings.builtInValidators[el.toLowerCase()]) {
var validator = $.extend(true, {}, settings.builtInValidators[el.toLowerCase()]);
if (hasOverrideMessage) {
validator.message = message;
}
var validatorType = validator.type.toLowerCase();
if (validatorType === "shortcut") {
foundValidator = true;
} else {
$.each(settings.validatorTypes, function (validatorTemplateType, validatorTemplate) {
if (validators[validatorTemplateType] === undefined) {
validators[validatorTemplateType] = [];
}
if (!foundValidator && validatorType === validatorTemplateType.toLowerCase()) {
$this.data("validation" + el + formatValidatorName(validatorTemplate.name), validator[validatorTemplate.name.toLowerCase()]);
validators[validatorType].push($.extend(validator, validatorTemplate.init($this, el)));
foundValidator = true;
}
});
}
}
if (!foundValidator) {
$.error("Cannot find validation info for '" + el + "'");
}
});
// =============================================================
// STORE FALLBACK VALUES
// =============================================================
$helpBlock.data("original-contents", $helpBlock.data("original-contents") ? $helpBlock.data("original-contents") : $helpBlock.html());
$helpBlock.data("original-role", $helpBlock.data("original-role") ? $helpBlock.data("original-role") : $helpBlock.attr("role"));
$controlGroup.data("original-classes", $controlGroup.data("original-clases") ? $controlGroup.data("original-classes") : $controlGroup.attr("class"));
$this.data("original-aria-invalid", $this.data("original-aria-invalid") ? $this.data("original-aria-invalid") : $this.attr("aria-invalid"));
// =============================================================
// VALIDATION
// =============================================================
$this.bind("validation.validation", function (event, params) {
var value = getValue($this);
// Get a list of the errors to apply
var errorsFound = [];
$.each(validators, function (validatorType, validatorTypeArray) {
if (value || value.length || params && params.includeEmpty || !!settings.validatorTypes[validatorType].blockSubmit && params && !!params.submitting) {
$.each(validatorTypeArray, function (i, validator) {
if (settings.validatorTypes[validatorType].validate($this, value, validator)) {
errorsFound.push(validator.message);
}
});
}
});
return errorsFound;
});
$this.bind("getValidators.validation", function () {
return validators;
});
// =============================================================
// WATCH FOR CHANGES
// =============================================================
$this.bind("submit.validation", function () {
return $this.triggerHandler("change.validation", { submitting: true });
});
$this.bind(["keyup", "focus", "blur", "click", "keydown", "keypress", "change"].join(".validation ") + ".validation", function (e, params) {
var value = getValue($this);
var errorsFound = [];
$controlGroup.find("input,textarea,select").each(function (i, el) {
var oldCount = errorsFound.length;
$.each($(el).triggerHandler("validation.validation", params), function (j, message) {
errorsFound.push(message);
});
if (errorsFound.length > oldCount) {
$(el).attr("aria-invalid", "true");
} else {
var original = $this.data("original-aria-invalid");
$(el).attr("aria-invalid", original !== undefined ? original : false);
}
});
$form.find("input,select,textarea").not($this).not("[name=\"" + $this.attr("name") + "\"]").trigger("validationLostFocus.validation");
errorsFound = $.unique(errorsFound.sort());
// Were there any errors?
if (errorsFound.length) {
// Better flag it up as a warning.
$controlGroup.removeClass("success error").addClass("warning");
// How many errors did we find?
if (settings.options.semanticallyStrict && errorsFound.length === 1) {
// Only one? Being strict? Just output it.
$helpBlock.html(errorsFound[0] + (settings.options.prependExistingHelpBlock ? $helpBlock.data("original-contents") : ""));
} else {
// Multiple? Being sloppy? Glue them together into an UL.
$helpBlock.html("<ul role=\"alert\"><li>" + errorsFound.join("</li><li>") + "</li></ul>" + (settings.options.prependExistingHelpBlock ? $helpBlock.data("original-contents") : ""));
}
} else {
$controlGroup.removeClass("warning error success");
if (value.length > 0) {
$controlGroup.addClass("success");
}
$helpBlock.html($helpBlock.data("original-contents"));
}
if (e.type === "blur") {
$controlGroup.removeClass("success");
}
});
$this.bind("validationLostFocus.validation", function () {
$controlGroup.removeClass("success");
});
});
},
destroy: function destroy() {
return this.each(function () {
var $this = $(this),
$controlGroup = $this.parents(".form-group").first(),
$helpBlock = $controlGroup.find(".help-block").first();
// remove our events
$this.unbind('.validation'); // events are namespaced.
// reset help text
$helpBlock.html($helpBlock.data("original-contents"));
// reset classes
$controlGroup.attr("class", $controlGroup.data("original-classes"));
// reset aria
$this.attr("aria-invalid", $this.data("original-aria-invalid"));
// reset role
$helpBlock.attr("role", $this.data("original-role"));
// remove all elements we created
if (createdElements.indexOf($helpBlock[0]) > -1) {
$helpBlock.remove();
}
});
},
collectErrors: function collectErrors(includeEmpty) {
var errorMessages = {};
this.each(function (i, el) {
var $el = $(el);
var name = $el.attr("name");
var errors = $el.triggerHandler("validation.validation", { includeEmpty: true });
errorMessages[name] = $.extend(true, errors, errorMessages[name]);
});
$.each(errorMessages, function (i, el) {
if (el.length === 0) {
delete errorMessages[i];
}
});
return errorMessages;
},
hasErrors: function hasErrors() {
var errorMessages = [];
this.each(function (i, el) {
errorMessages = errorMessages.concat($(el).triggerHandler("getValidators.validation") ? $(el).triggerHandler("validation.validation", { submitting: true }) : []);
});
return errorMessages.length > 0;
},
override: function override(newDefaults) {
defaults = $.extend(true, defaults, newDefaults);
}
},
validatorTypes: {
callback: {
name: "callback",
init: function init($this, name) {
return {
validatorName: name,
callback: $this.data("validation" + name + "Callback"),
lastValue: $this.val(),
lastValid: true,
lastFinished: true
};
},
validate: function validate($this, value, validator) {
if (validator.lastValue === value && validator.lastFinished) {
return !validator.lastValid;
}
if (validator.lastFinished === true) {
validator.lastValue = value;
validator.lastValid = true;
validator.lastFinished = false;
var rrjqbvValidator = validator;
var rrjqbvThis = $this;
executeFunctionByName(validator.callback, window, $this, value, function (data) {
if (rrjqbvValidator.lastValue === data.value) {
rrjqbvValidator.lastValid = data.valid;
if (data.message) {
rrjqbvValidator.message = data.message;
}
rrjqbvValidator.lastFinished = true;
rrjqbvThis.data("validation" + rrjqbvValidator.validatorName + "Message", rrjqbvValidator.message);
// Timeout is set to avoid problems with the events being considered 'already fired'
setTimeout(function () {
rrjqbvThis.trigger("change.validation");
}, 1); // doesn't need a long timeout, just long enough for the event bubble to burst
}
});
}
return false;
}
},
ajax: {
name: "ajax",
init: function init($this, name) {
return {
validatorName: name,
url: $this.data("validation" + name + "Ajax"),
lastValue: $this.val(),
lastValid: true,
lastFinished: true
};
},
validate: function validate($this, value, validator) {
if ("" + validator.lastValue === "" + value && validator.lastFinished === true) {
return validator.lastValid === false;
}
if (validator.lastFinished === true) {
validator.lastValue = value;
validator.lastValid = true;
validator.lastFinished = false;
$.ajax({
url: validator.url,
data: "value=" + value + "&field=" + $this.attr("name"),
dataType: "json",
success: function success(data) {
if ("" + validator.lastValue === "" + data.value) {
validator.lastValid = !!data.valid;
if (data.message) {
validator.message = data.message;
}
validator.lastFinished = true;
$this.data("validation" + validator.validatorName + "Message", validator.message);
// Timeout is set to avoid problems with the events being considered 'already fired'
setTimeout(function () {
$this.trigger("change.validation");
}, 1); // doesn't need a long timeout, just long enough for the event bubble to burst
}
},
failure: function failure() {
validator.lastValid = true;
validator.message = "ajax call failed";
validator.lastFinished = true;
$this.data("validation" + validator.validatorName + "Message", validator.message);
// Timeout is set to avoid problems with the events being considered 'already fired'
setTimeout(function () {
$this.trigger("change.validation");
}, 1); // doesn't need a long timeout, just long enough for the event bubble to burst
}
});
}
return false;
}
},
regex: {
name: "regex",
init: function init($this, name) {
return { regex: regexFromString($this.data("validation" + name + "Regex")) };
},
validate: function validate($this, value, validator) {
return !validator.regex.test(value) && !validator.negative || validator.regex.test(value) && validator.negative;
}
},
required: {
name: "required",
init: function init($this, name) {
return {};
},
validate: function validate($this, value, validator) {
return !!(value.length === 0 && !validator.negative) || !!(value.length > 0 && validator.negative);
},
blockSubmit: true
},
match: {
name: "match",
init: function init($this, name) {
var element = $this.parents("form").first().find("[name=\"" + $this.data("validation" + name + "Match") + "\"]").first();
element.bind("validation.validation", function () {
$this.trigger("change.validation", { submitting: true });
});
return { "element": element };
},
validate: function validate($this, value, validator) {
return value !== validator.element.val() && !validator.negative || value === validator.element.val() && validator.negative;
},
blockSubmit: true
},
max: {
name: "max",
init: function init($this, name) {
return { max: $this.data("validation" + name + "Max") };
},
validate: function validate($this, value, validator) {
return parseFloat(value, 10) > parseFloat(validator.max, 10) && !validator.negative || parseFloat(value, 10) <= parseFloat(validator.max, 10) && validator.negative;
}
},
min: {
name: "min",
init: function init($this, name) {
return { min: $this.data("validation" + name + "Min") };
},
validate: function validate($this, value, validator) {
return parseFloat(value) < parseFloat(validator.min) && !validator.negative || parseFloat(value) >= parseFloat(validator.min) && validator.negative;
}
},
maxlength: {
name: "maxlength",
init: function init($this, name) {
return { maxlength: $this.data("validation" + name + "Maxlength") };
},
validate: function validate($this, value, validator) {
return value.length > validator.maxlength && !validator.negative || value.length <= validator.maxlength && validator.negative;
}
},
minlength: {
name: "minlength",
init: function init($this, name) {
return { minlength: $this.data("validation" + name + "Minlength") };
},
validate: function validate($this, value, validator) {
return value.length < validator.minlength && !validator.negative || value.length >= validator.minlength && validator.negative;
}
},
maxchecked: {
name: "maxchecked",
init: function init($this, name) {
var elements = $this.parents("form").first().find("[name=\"" + $this.attr("name") + "\"]");
elements.bind("click.validation", function () {
$this.trigger("change.validation", { includeEmpty: true });
});
return { maxchecked: $this.data("validation" + name + "Maxchecked"), elements: elements };
},
validate: function validate($this, value, validator) {
return validator.elements.filter(":checked").length > validator.maxchecked && !validator.negative || validator.elements.filter(":checked").length <= validator.maxchecked && validator.negative;
},
blockSubmit: true
},
minchecked: {
name: "minchecked",
init: function init($this, name) {
var elements = $this.parents("form").first().find("[name=\"" + $this.attr("name") + "\"]");
elements.bind("click.validation", function () {
$this.trigger("change.validation", { includeEmpty: true });
});
return { minchecked: $this.data("validation" + name + "Minchecked"), elements: elements };
},
validate: function validate($this, value, validator) {
return validator.elements.filter(":checked").length < validator.minchecked && !validator.negative || validator.elements.filter(":checked").length >= validator.minchecked && validator.negative;
},
blockSubmit: true
}
},
builtInValidators: {
email: {
name: "Email",
type: "shortcut",
shortcut: "validemail"
},
validemail: {
name: "Validemail",
type: "regex",
regex: "[A-Za-z0-9._%+-]+@[A-Za-z0-9.-]+\\\.[A-Za-z]{2,4}",
message: "Not a valid email address<!-- data-validator-validemail-message to override -->"
},
passwordagain: {
name: "Passwordagain",
type: "match",
match: "password",
message: "Does not match the given password<!-- data-validator-paswordagain-message to override -->"
},
positive: {
name: "Positive",
type: "shortcut",
shortcut: "number,positivenumber"
},
negative: {
name: "Negative",
type: "shortcut",
shortcut: "number,negativenumber"
},
number: {
name: "Number",
type: "regex",
regex: "([+-]?\\\d+(\\\.\\\d*)?([eE][+-]?[0-9]+)?)?",
message: "Must be a number<!-- data-validator-number-message to override -->"
},
integer: {
name: "Integer",
type: "regex",
regex: "[+-]?\\\d+",
message: "No decimal places allowed<!-- data-validator-integer-message to override -->"
},
positivenumber: {
name: "Positivenumber",
type: "min",
min: 0,
message: "Must be a positive number<!-- data-validator-positivenumber-message to override -->"
},
negativenumber: {
name: "Negativenumber",
type: "max",
max: 0,
message: "Must be a negative number<!-- data-validator-negativenumber-message to override -->"
},
required: {
name: "Required",
type: "required",
message: "This is required<!-- data-validator-required-message to override -->"
},
checkone: {
name: "Checkone",
type: "minchecked",
minchecked: 1,
message: "Check at least one option<!-- data-validation-checkone-message to override -->"
}
}
};
var formatValidatorName = function formatValidatorName(name) {
return name.toLowerCase().replace(/(^|\s)([a-z])/g, function (m, p1, p2) {
return p1 + p2.toUpperCase();
});
};
var getValue = function getValue($this) {
// Extract the value we're talking about
var value = $this.val();
var type = $this.attr("type");
if (type === "checkbox") {
value = $this.is(":checked") ? value : "";
}
if (type === "radio") {
value = $('input[name="' + $this.attr("name") + '"]:checked').length > 0 ? value : "";
}
return value;
};
function regexFromString(inputstring) {
return new RegExp("^" + inputstring + "$");
}
/**
* Thanks to Jason Bunting via StackOverflow.com
*
* http://stackoverflow.com/questions/359788/how-to-execute-a-javascript-function-when-i-have-its-name-as-a-string#answer-359910
* Short link: http://tinyurl.com/executeFunctionByName
**/
function executeFunctionByName(functionName, context /*, args*/) {
var args = Array.prototype.slice.call(arguments).splice(2);
var namespaces = functionName.split(".");
var func = namespaces.pop();
for (var i = 0; i < namespaces.length; i++) {
context = context[namespaces[i]];
}
return context[func].apply(this, args);
}
$.fn.jqBootstrapValidation = function (method) {
if (defaults.methods[method]) {
return defaults.methods[method].apply(this, Array.prototype.slice.call(arguments, 1));
} else if ((typeof method === "undefined" ? "undefined" : _typeof(method)) === 'object' || !method) {
return defaults.methods.init.apply(this, arguments);
} else {
$.error('Method ' + method + ' does not exist on jQuery.jqBootstrapValidation');
return null;
}
};
$.jqBootstrapValidation = function (options) {
$(":input").not("[type=image],[type=submit]").jqBootstrapValidation.apply(this, arguments);
};
})(jQuery);
/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(1)))
/***/ }),
/* 31 */
/***/ (function(module, exports, __webpack_require__) {
/* WEBPACK VAR INJECTION */(function($, jQuery) {// Floating label headings for the contact form
$(function () {
$("body").on("input propertychange", ".floating-label-form-group", function (e) {
$(this).toggleClass("floating-label-form-group-with-value", !!$(e.target).val());
}).on("focus", ".floating-label-form-group", function () {
$(this).addClass("floating-label-form-group-with-focus");
}).on("blur", ".floating-label-form-group", function () {
$(this).removeClass("floating-label-form-group-with-focus");
});
});
// Navigation Scripts to Show Header on Scroll-Up
jQuery(document).ready(function ($) {
var MQL = 1170;
//primary navigation slide-in effect
if ($(window).width() > MQL) {
var headerHeight = $('.navbar-custom').height();
$(window).on('scroll', {
previousTop: 0
}, function () {
var currentTop = $(window).scrollTop();
//check if user is scrolling up
if (currentTop < this.previousTop) {
//if scrolling up...
if (currentTop > 0 && $('.navbar-custom').hasClass('is-fixed')) {
$('.navbar-custom').addClass('is-visible');
} else {
$('.navbar-custom').removeClass('is-visible is-fixed');
}
} else if (currentTop > this.previousTop) {
//if scrolling down...
$('.navbar-custom').removeClass('is-visible');
if (currentTop > headerHeight && !$('.navbar-custom').hasClass('is-fixed')) $('.navbar-custom').addClass('is-fixed');
}
this.previousTop = currentTop;
});
}
});
// Smooth scroll for all hash hyperlinks
$(function () {
$('a[href*="#"]:not([href="#"])').click(function () {
if (location.pathname.replace(/^\//, '') == this.pathname.replace(/^\//, '') && location.hostname == this.hostname) {
var target = $(this.hash);
target = target.length ? target : $('[name=' + this.hash.slice(1) + ']');
if (target.length) {
$('html, body').animate({
scrollTop: target.offset().top
}, 1000);
return false;
}
}
});
});
/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(1), __webpack_require__(1)))
/***/ }),
/* 32 */
/***/ (function(module, exports, __webpack_require__) {
/* WEBPACK VAR INJECTION */(function(jQuery) {/*!
* Bootstrap v3.3.7 (http://getbootstrap.com)
* Copyright 2011-2016 Twitter, Inc.
* Licensed under the MIT license
*/
if (typeof jQuery === 'undefined') {
throw new Error('Bootstrap\'s JavaScript requires jQuery')
}
+function ($) {
'use strict';
var version = $.fn.jquery.split(' ')[0].split('.')
if ((version[0] < 2 && version[1] < 9) || (version[0] == 1 && version[1] == 9 && version[2] < 1) || (version[0] > 3)) {
throw new Error('Bootstrap\'s JavaScript requires jQuery version 1.9.1 or higher, but lower than version 4')
}
}(jQuery);
/* ========================================================================
* Bootstrap: transition.js v3.3.7
* http://getbootstrap.com/javascript/#transitions
* ========================================================================
* Copyright 2011-2016 Twitter, Inc.
* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
* ======================================================================== */
+function ($) {
'use strict';
// CSS TRANSITION SUPPORT (Shoutout: http://www.modernizr.com/)
// ============================================================
function transitionEnd() {
var el = document.createElement('bootstrap')
var transEndEventNames = {
WebkitTransition : 'webkitTransitionEnd',
MozTransition : 'transitionend',
OTransition : 'oTransitionEnd otransitionend',
transition : 'transitionend'
}
for (var name in transEndEventNames) {
if (el.style[name] !== undefined) {
return { end: transEndEventNames[name] }
}
}
return false // explicit for ie8 ( ._.)
}
// http://blog.alexmaccaw.com/css-transitions
$.fn.emulateTransitionEnd = function (duration) {
var called = false
var $el = this
$(this).one('bsTransitionEnd', function () { called = true })
var callback = function () { if (!called) $($el).trigger($.support.transition.end) }
setTimeout(callback, duration)
return this
}
$(function () {
$.support.transition = transitionEnd()
if (!$.support.transition) return
$.event.special.bsTransitionEnd = {
bindType: $.support.transition.end,
delegateType: $.support.transition.end,
handle: function (e) {
if ($(e.target).is(this)) return e.handleObj.handler.apply(this, arguments)
}
}
})
}(jQuery);
/* ========================================================================
* Bootstrap: alert.js v3.3.7
* http://getbootstrap.com/javascript/#alerts
* ========================================================================
* Copyright 2011-2016 Twitter, Inc.
* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
* ======================================================================== */
+function ($) {
'use strict';
// ALERT CLASS DEFINITION
// ======================
var dismiss = '[data-dismiss="alert"]'
var Alert = function (el) {
$(el).on('click', dismiss, this.close)
}
Alert.VERSION = '3.3.7'
Alert.TRANSITION_DURATION = 150
Alert.prototype.close = function (e) {
var $this = $(this)
var selector = $this.attr('data-target')
if (!selector) {
selector = $this.attr('href')
selector = selector && selector.replace(/.*(?=#[^\s]*$)/, '') // strip for ie7
}
var $parent = $(selector === '#' ? [] : selector)
if (e) e.preventDefault()
if (!$parent.length) {
$parent = $this.closest('.alert')
}
$parent.trigger(e = $.Event('close.bs.alert'))
if (e.isDefaultPrevented()) return
$parent.removeClass('in')
function removeElement() {
// detach from parent, fire event then clean up data
$parent.detach().trigger('closed.bs.alert').remove()
}
$.support.transition && $parent.hasClass('fade') ?
$parent
.one('bsTransitionEnd', removeElement)
.emulateTransitionEnd(Alert.TRANSITION_DURATION) :
removeElement()
}
// ALERT PLUGIN DEFINITION
// =======================
function Plugin(option) {
return this.each(function () {
var $this = $(this)
var data = $this.data('bs.alert')
if (!data) $this.data('bs.alert', (data = new Alert(this)))
if (typeof option == 'string') data[option].call($this)
})
}
var old = $.fn.alert
$.fn.alert = Plugin
$.fn.alert.Constructor = Alert
// ALERT NO CONFLICT
// =================
$.fn.alert.noConflict = function () {
$.fn.alert = old
return this
}
// ALERT DATA-API
// ==============
$(document).on('click.bs.alert.data-api', dismiss, Alert.prototype.close)
}(jQuery);
/* ========================================================================
* Bootstrap: button.js v3.3.7
* http://getbootstrap.com/javascript/#buttons
* ========================================================================
* Copyright 2011-2016 Twitter, Inc.
* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
* ======================================================================== */
+function ($) {
'use strict';
// BUTTON PUBLIC CLASS DEFINITION
// ==============================
var Button = function (element, options) {
this.$element = $(element)
this.options = $.extend({}, Button.DEFAULTS, options)
this.isLoading = false
}
Button.VERSION = '3.3.7'
Button.DEFAULTS = {
loadingText: 'loading...'
}
Button.prototype.setState = function (state) {
var d = 'disabled'
var $el = this.$element
var val = $el.is('input') ? 'val' : 'html'
var data = $el.data()
state += 'Text'
if (data.resetText == null) $el.data('resetText', $el[val]())
// push to event loop to allow forms to submit
setTimeout($.proxy(function () {
$el[val](data[state] == null ? this.options[state] : data[state])
if (state == 'loadingText') {
this.isLoading = true
$el.addClass(d).attr(d, d).prop(d, true)
} else if (this.isLoading) {
this.isLoading = false
$el.removeClass(d).removeAttr(d).prop(d, false)
}
}, this), 0)
}
Button.prototype.toggle = function () {
var changed = true
var $parent = this.$element.closest('[data-toggle="buttons"]')
if ($parent.length) {
var $input = this.$element.find('input')
if ($input.prop('type') == 'radio') {
if ($input.prop('checked')) changed = false
$parent.find('.active').removeClass('active')
this.$element.addClass('active')
} else if ($input.prop('type') == 'checkbox') {
if (($input.prop('checked')) !== this.$element.hasClass('active')) changed = false
this.$element.toggleClass('active')
}
$input.prop('checked', this.$element.hasClass('active'))
if (changed) $input.trigger('change')
} else {
this.$element.attr('aria-pressed', !this.$element.hasClass('active'))
this.$element.toggleClass('active')
}
}
// BUTTON PLUGIN DEFINITION
// ========================
function Plugin(option) {
return this.each(function () {
var $this = $(this)
var data = $this.data('bs.button')
var options = typeof option == 'object' && option
if (!data) $this.data('bs.button', (data = new Button(this, options)))
if (option == 'toggle') data.toggle()
else if (option) data.setState(option)
})
}
var old = $.fn.button
$.fn.button = Plugin
$.fn.button.Constructor = Button
// BUTTON NO CONFLICT
// ==================
$.fn.button.noConflict = function () {
$.fn.button = old
return this
}
// BUTTON DATA-API
// ===============
$(document)
.on('click.bs.button.data-api', '[data-toggle^="button"]', function (e) {
var $btn = $(e.target).closest('.btn')
Plugin.call($btn, 'toggle')
if (!($(e.target).is('input[type="radio"], input[type="checkbox"]'))) {
// Prevent double click on radios, and the double selections (so cancellation) on checkboxes
e.preventDefault()
// The target component still receive the focus
if ($btn.is('input,button')) $btn.trigger('focus')
else $btn.find('input:visible,button:visible').first().trigger('focus')
}
})
.on('focus.bs.button.data-api blur.bs.button.data-api', '[data-toggle^="button"]', function (e) {
$(e.target).closest('.btn').toggleClass('focus', /^focus(in)?$/.test(e.type))
})
}(jQuery);
/* ========================================================================
* Bootstrap: carousel.js v3.3.7
* http://getbootstrap.com/javascript/#carousel
* ========================================================================
* Copyright 2011-2016 Twitter, Inc.
* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
* ======================================================================== */
+function ($) {
'use strict';
// CAROUSEL CLASS DEFINITION
// =========================
var Carousel = function (element, options) {
this.$element = $(element)
this.$indicators = this.$element.find('.carousel-indicators')
this.options = options
this.paused = null
this.sliding = null
this.interval = null
this.$active = null
this.$items = null
this.options.keyboard && this.$element.on('keydown.bs.carousel', $.proxy(this.keydown, this))
this.options.pause == 'hover' && !('ontouchstart' in document.documentElement) && this.$element
.on('mouseenter.bs.carousel', $.proxy(this.pause, this))
.on('mouseleave.bs.carousel', $.proxy(this.cycle, this))
}
Carousel.VERSION = '3.3.7'
Carousel.TRANSITION_DURATION = 600
Carousel.DEFAULTS = {
interval: 5000,
pause: 'hover',
wrap: true,
keyboard: true
}
Carousel.prototype.keydown = function (e) {
if (/input|textarea/i.test(e.target.tagName)) return
switch (e.which) {
case 37: this.prev(); break
case 39: this.next(); break
default: return
}
e.preventDefault()
}
Carousel.prototype.cycle = function (e) {
e || (this.paused = false)
this.interval && clearInterval(this.interval)
this.options.interval
&& !this.paused
&& (this.interval = setInterval($.proxy(this.next, this), this.options.interval))
return this
}
Carousel.prototype.getItemIndex = function (item) {
this.$items = item.parent().children('.item')
return this.$items.index(item || this.$active)
}
Carousel.prototype.getItemForDirection = function (direction, active) {
var activeIndex = this.getItemIndex(active)
var willWrap = (direction == 'prev' && activeIndex === 0)
|| (direction == 'next' && activeIndex == (this.$items.length - 1))
if (willWrap && !this.options.wrap) return active
var delta = direction == 'prev' ? -1 : 1
var itemIndex = (activeIndex + delta) % this.$items.length
return this.$items.eq(itemIndex)
}
Carousel.prototype.to = function (pos) {
var that = this
var activeIndex = this.getItemIndex(this.$active = this.$element.find('.item.active'))
if (pos > (this.$items.length - 1) || pos < 0) return
if (this.sliding) return this.$element.one('slid.bs.carousel', function () { that.to(pos) }) // yes, "slid"
if (activeIndex == pos) return this.pause().cycle()
return this.slide(pos > activeIndex ? 'next' : 'prev', this.$items.eq(pos))
}
Carousel.prototype.pause = function (e) {
e || (this.paused = true)
if (this.$element.find('.next, .prev').length && $.support.transition) {
this.$element.trigger($.support.transition.end)
this.cycle(true)
}
this.interval = clearInterval(this.interval)
return this
}
Carousel.prototype.next = function () {
if (this.sliding) return
return this.slide('next')
}
Carousel.prototype.prev = function () {
if (this.sliding) return
return this.slide('prev')
}
Carousel.prototype.slide = function (type, next) {
var $active = this.$element.find('.item.active')
var $next = next || this.getItemForDirection(type, $active)
var isCycling = this.interval
var direction = type == 'next' ? 'left' : 'right'
var that = this
if ($next.hasClass('active')) return (this.sliding = false)
var relatedTarget = $next[0]
var slideEvent = $.Event('slide.bs.carousel', {
relatedTarget: relatedTarget,
direction: direction
})
this.$element.trigger(slideEvent)
if (slideEvent.isDefaultPrevented()) return
this.sliding = true
isCycling && this.pause()
if (this.$indicators.length) {
this.$indicators.find('.active').removeClass('active')
var $nextIndicator = $(this.$indicators.children()[this.getItemIndex($next)])
$nextIndicator && $nextIndicator.addClass('active')
}
var slidEvent = $.Event('slid.bs.carousel', { relatedTarget: relatedTarget, direction: direction }) // yes, "slid"
if ($.support.transition && this.$element.hasClass('slide')) {
$next.addClass(type)
$next[0].offsetWidth // force reflow
$active.addClass(direction)
$next.addClass(direction)
$active
.one('bsTransitionEnd', function () {
$next.removeClass([type, direction].join(' ')).addClass('active')
$active.removeClass(['active', direction].join(' '))
that.sliding = false
setTimeout(function () {
that.$element.trigger(slidEvent)
}, 0)
})
.emulateTransitionEnd(Carousel.TRANSITION_DURATION)
} else {
$active.removeClass('active')
$next.addClass('active')
this.sliding = false
this.$element.trigger(slidEvent)
}
isCycling && this.cycle()
return this
}
// CAROUSEL PLUGIN DEFINITION
// ==========================
function Plugin(option) {
return this.each(function () {
var $this = $(this)
var data = $this.data('bs.carousel')
var options = $.extend({}, Carousel.DEFAULTS, $this.data(), typeof option == 'object' && option)
var action = typeof option == 'string' ? option : options.slide
if (!data) $this.data('bs.carousel', (data = new Carousel(this, options)))
if (typeof option == 'number') data.to(option)
else if (action) data[action]()
else if (options.interval) data.pause().cycle()
})
}
var old = $.fn.carousel
$.fn.carousel = Plugin
$.fn.carousel.Constructor = Carousel
// CAROUSEL NO CONFLICT
// ====================
$.fn.carousel.noConflict = function () {
$.fn.carousel = old
return this
}
// CAROUSEL DATA-API
// =================
var clickHandler = function (e) {
var href
var $this = $(this)
var $target = $($this.attr('data-target') || (href = $this.attr('href')) && href.replace(/.*(?=#[^\s]+$)/, '')) // strip for ie7
if (!$target.hasClass('carousel')) return
var options = $.extend({}, $target.data(), $this.data())
var slideIndex = $this.attr('data-slide-to')
if (slideIndex) options.interval = false
Plugin.call($target, options)
if (slideIndex) {
$target.data('bs.carousel').to(slideIndex)
}
e.preventDefault()
}
$(document)
.on('click.bs.carousel.data-api', '[data-slide]', clickHandler)
.on('click.bs.carousel.data-api', '[data-slide-to]', clickHandler)
$(window).on('load', function () {
$('[data-ride="carousel"]').each(function () {
var $carousel = $(this)
Plugin.call($carousel, $carousel.data())
})
})
}(jQuery);
/* ========================================================================
* Bootstrap: collapse.js v3.3.7
* http://getbootstrap.com/javascript/#collapse
* ========================================================================
* Copyright 2011-2016 Twitter, Inc.
* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
* ======================================================================== */
/* jshint latedef: false */
+function ($) {
'use strict';
// COLLAPSE PUBLIC CLASS DEFINITION
// ================================
var Collapse = function (element, options) {
this.$element = $(element)
this.options = $.extend({}, Collapse.DEFAULTS, options)
this.$trigger = $('[data-toggle="collapse"][href="#' + element.id + '"],' +
'[data-toggle="collapse"][data-target="#' + element.id + '"]')
this.transitioning = null
if (this.options.parent) {
this.$parent = this.getParent()
} else {
this.addAriaAndCollapsedClass(this.$element, this.$trigger)
}
if (this.options.toggle) this.toggle()
}
Collapse.VERSION = '3.3.7'
Collapse.TRANSITION_DURATION = 350
Collapse.DEFAULTS = {
toggle: true
}
Collapse.prototype.dimension = function () {
var hasWidth = this.$element.hasClass('width')
return hasWidth ? 'width' : 'height'
}
Collapse.prototype.show = function () {
if (this.transitioning || this.$element.hasClass('in')) return
var activesData
var actives = this.$parent && this.$parent.children('.panel').children('.in, .collapsing')
if (actives && actives.length) {
activesData = actives.data('bs.collapse')
if (activesData && activesData.transitioning) return
}
var startEvent = $.Event('show.bs.collapse')
this.$element.trigger(startEvent)
if (startEvent.isDefaultPrevented()) return
if (actives && actives.length) {
Plugin.call(actives, 'hide')
activesData || actives.data('bs.collapse', null)
}
var dimension = this.dimension()
this.$element
.removeClass('collapse')
.addClass('collapsing')[dimension](0)
.attr('aria-expanded', true)
this.$trigger
.removeClass('collapsed')
.attr('aria-expanded', true)
this.transitioning = 1
var complete = function () {
this.$element
.removeClass('collapsing')
.addClass('collapse in')[dimension]('')
this.transitioning = 0
this.$element
.trigger('shown.bs.collapse')
}
if (!$.support.transition) return complete.call(this)
var scrollSize = $.camelCase(['scroll', dimension].join('-'))
this.$element
.one('bsTransitionEnd', $.proxy(complete, this))
.emulateTransitionEnd(Collapse.TRANSITION_DURATION)[dimension](this.$element[0][scrollSize])
}
Collapse.prototype.hide = function () {
if (this.transitioning || !this.$element.hasClass('in')) return
var startEvent = $.Event('hide.bs.collapse')
this.$element.trigger(startEvent)
if (startEvent.isDefaultPrevented()) return
var dimension = this.dimension()
this.$element[dimension](this.$element[dimension]())[0].offsetHeight
this.$element
.addClass('collapsing')
.removeClass('collapse in')
.attr('aria-expanded', false)
this.$trigger
.addClass('collapsed')
.attr('aria-expanded', false)
this.transitioning = 1
var complete = function () {
this.transitioning = 0
this.$element
.removeClass('collapsing')
.addClass('collapse')
.trigger('hidden.bs.collapse')
}
if (!$.support.transition) return complete.call(this)
this.$element
[dimension](0)
.one('bsTransitionEnd', $.proxy(complete, this))
.emulateTransitionEnd(Collapse.TRANSITION_DURATION)
}
Collapse.prototype.toggle = function () {
this[this.$element.hasClass('in') ? 'hide' : 'show']()
}
Collapse.prototype.getParent = function () {
return $(this.options.parent)
.find('[data-toggle="collapse"][data-parent="' + this.options.parent + '"]')
.each($.proxy(function (i, element) {
var $element = $(element)
this.addAriaAndCollapsedClass(getTargetFromTrigger($element), $element)
}, this))
.end()
}
Collapse.prototype.addAriaAndCollapsedClass = function ($element, $trigger) {
var isOpen = $element.hasClass('in')
$element.attr('aria-expanded', isOpen)
$trigger
.toggleClass('collapsed', !isOpen)
.attr('aria-expanded', isOpen)
}
function getTargetFromTrigger($trigger) {
var href
var target = $trigger.attr('data-target')
|| (href = $trigger.attr('href')) && href.replace(/.*(?=#[^\s]+$)/, '') // strip for ie7
return $(target)
}
// COLLAPSE PLUGIN DEFINITION
// ==========================
function Plugin(option) {
return this.each(function () {
var $this = $(this)
var data = $this.data('bs.collapse')
var options = $.extend({}, Collapse.DEFAULTS, $this.data(), typeof option == 'object' && option)
if (!data && options.toggle && /show|hide/.test(option)) options.toggle = false
if (!data) $this.data('bs.collapse', (data = new Collapse(this, options)))
if (typeof option == 'string') data[option]()
})
}
var old = $.fn.collapse
$.fn.collapse = Plugin
$.fn.collapse.Constructor = Collapse
// COLLAPSE NO CONFLICT
// ====================
$.fn.collapse.noConflict = function () {
$.fn.collapse = old
return this
}
// COLLAPSE DATA-API
// =================
$(document).on('click.bs.collapse.data-api', '[data-toggle="collapse"]', function (e) {
var $this = $(this)
if (!$this.attr('data-target')) e.preventDefault()
var $target = getTargetFromTrigger($this)
var data = $target.data('bs.collapse')
var option = data ? 'toggle' : $this.data()
Plugin.call($target, option)
})
}(jQuery);
/* ========================================================================
* Bootstrap: dropdown.js v3.3.7
* http://getbootstrap.com/javascript/#dropdowns
* ========================================================================
* Copyright 2011-2016 Twitter, Inc.
* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
* ======================================================================== */
+function ($) {
'use strict';
// DROPDOWN CLASS DEFINITION
// =========================
var backdrop = '.dropdown-backdrop'
var toggle = '[data-toggle="dropdown"]'
var Dropdown = function (element) {
$(element).on('click.bs.dropdown', this.toggle)
}
Dropdown.VERSION = '3.3.7'
function getParent($this) {
var selector = $this.attr('data-target')
if (!selector) {
selector = $this.attr('href')
selector = selector && /#[A-Za-z]/.test(selector) && selector.replace(/.*(?=#[^\s]*$)/, '') // strip for ie7
}
var $parent = selector && $(selector)
return $parent && $parent.length ? $parent : $this.parent()
}
function clearMenus(e) {
if (e && e.which === 3) return
$(backdrop).remove()
$(toggle).each(function () {
var $this = $(this)
var $parent = getParent($this)
var relatedTarget = { relatedTarget: this }
if (!$parent.hasClass('open')) return
if (e && e.type == 'click' && /input|textarea/i.test(e.target.tagName) && $.contains($parent[0], e.target)) return
$parent.trigger(e = $.Event('hide.bs.dropdown', relatedTarget))
if (e.isDefaultPrevented()) return
$this.attr('aria-expanded', 'false')
$parent.removeClass('open').trigger($.Event('hidden.bs.dropdown', relatedTarget))
})
}
Dropdown.prototype.toggle = function (e) {
var $this = $(this)
if ($this.is('.disabled, :disabled')) return
var $parent = getParent($this)
var isActive = $parent.hasClass('open')
clearMenus()
if (!isActive) {
if ('ontouchstart' in document.documentElement && !$parent.closest('.navbar-nav').length) {
// if mobile we use a backdrop because click events don't delegate
$(document.createElement('div'))
.addClass('dropdown-backdrop')
.insertAfter($(this))
.on('click', clearMenus)
}
var relatedTarget = { relatedTarget: this }
$parent.trigger(e = $.Event('show.bs.dropdown', relatedTarget))
if (e.isDefaultPrevented()) return
$this
.trigger('focus')
.attr('aria-expanded', 'true')
$parent
.toggleClass('open')
.trigger($.Event('shown.bs.dropdown', relatedTarget))
}
return false
}
Dropdown.prototype.keydown = function (e) {
if (!/(38|40|27|32)/.test(e.which) || /input|textarea/i.test(e.target.tagName)) return
var $this = $(this)
e.preventDefault()
e.stopPropagation()
if ($this.is('.disabled, :disabled')) return
var $parent = getParent($this)
var isActive = $parent.hasClass('open')
if (!isActive && e.which != 27 || isActive && e.which == 27) {
if (e.which == 27) $parent.find(toggle).trigger('focus')
return $this.trigger('click')
}
var desc = ' li:not(.disabled):visible a'
var $items = $parent.find('.dropdown-menu' + desc)
if (!$items.length) return
var index = $items.index(e.target)
if (e.which == 38 && index > 0) index-- // up
if (e.which == 40 && index < $items.length - 1) index++ // down
if (!~index) index = 0
$items.eq(index).trigger('focus')
}
// DROPDOWN PLUGIN DEFINITION
// ==========================
function Plugin(option) {
return this.each(function () {
var $this = $(this)
var data = $this.data('bs.dropdown')
if (!data) $this.data('bs.dropdown', (data = new Dropdown(this)))
if (typeof option == 'string') data[option].call($this)
})
}
var old = $.fn.dropdown
$.fn.dropdown = Plugin
$.fn.dropdown.Constructor = Dropdown
// DROPDOWN NO CONFLICT
// ====================
$.fn.dropdown.noConflict = function () {
$.fn.dropdown = old
return this
}
// APPLY TO STANDARD DROPDOWN ELEMENTS
// ===================================
$(document)
.on('click.bs.dropdown.data-api', clearMenus)
.on('click.bs.dropdown.data-api', '.dropdown form', function (e) { e.stopPropagation() })
.on('click.bs.dropdown.data-api', toggle, Dropdown.prototype.toggle)
.on('keydown.bs.dropdown.data-api', toggle, Dropdown.prototype.keydown)
.on('keydown.bs.dropdown.data-api', '.dropdown-menu', Dropdown.prototype.keydown)
}(jQuery);
/* ========================================================================
* Bootstrap: modal.js v3.3.7
* http://getbootstrap.com/javascript/#modals
* ========================================================================
* Copyright 2011-2016 Twitter, Inc.
* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
* ======================================================================== */
+function ($) {
'use strict';
// MODAL CLASS DEFINITION
// ======================
var Modal = function (element, options) {
this.options = options
this.$body = $(document.body)
this.$element = $(element)
this.$dialog = this.$element.find('.modal-dialog')
this.$backdrop = null
this.isShown = null
this.originalBodyPad = null
this.scrollbarWidth = 0
this.ignoreBackdropClick = false
if (this.options.remote) {
this.$element
.find('.modal-content')
.load(this.options.remote, $.proxy(function () {
this.$element.trigger('loaded.bs.modal')
}, this))
}
}
Modal.VERSION = '3.3.7'
Modal.TRANSITION_DURATION = 300
Modal.BACKDROP_TRANSITION_DURATION = 150
Modal.DEFAULTS = {
backdrop: true,
keyboard: true,
show: true
}
Modal.prototype.toggle = function (_relatedTarget) {
return this.isShown ? this.hide() : this.show(_relatedTarget)
}
Modal.prototype.show = function (_relatedTarget) {
var that = this
var e = $.Event('show.bs.modal', { relatedTarget: _relatedTarget })
this.$element.trigger(e)
if (this.isShown || e.isDefaultPrevented()) return
this.isShown = true
this.checkScrollbar()
this.setScrollbar()
this.$body.addClass('modal-open')
this.escape()
this.resize()
this.$element.on('click.dismiss.bs.modal', '[data-dismiss="modal"]', $.proxy(this.hide, this))
this.$dialog.on('mousedown.dismiss.bs.modal', function () {
that.$element.one('mouseup.dismiss.bs.modal', function (e) {
if ($(e.target).is(that.$element)) that.ignoreBackdropClick = true
})
})
this.backdrop(function () {
var transition = $.support.transition && that.$element.hasClass('fade')
if (!that.$element.parent().length) {
that.$element.appendTo(that.$body) // don't move modals dom position
}
that.$element
.show()
.scrollTop(0)
that.adjustDialog()
if (transition) {
that.$element[0].offsetWidth // force reflow
}
that.$element.addClass('in')
that.enforceFocus()
var e = $.Event('shown.bs.modal', { relatedTarget: _relatedTarget })
transition ?
that.$dialog // wait for modal to slide in
.one('bsTransitionEnd', function () {
that.$element.trigger('focus').trigger(e)
})
.emulateTransitionEnd(Modal.TRANSITION_DURATION) :
that.$element.trigger('focus').trigger(e)
})
}
Modal.prototype.hide = function (e) {
if (e) e.preventDefault()
e = $.Event('hide.bs.modal')
this.$element.trigger(e)
if (!this.isShown || e.isDefaultPrevented()) return
this.isShown = false
this.escape()
this.resize()
$(document).off('focusin.bs.modal')
this.$element
.removeClass('in')
.off('click.dismiss.bs.modal')
.off('mouseup.dismiss.bs.modal')
this.$dialog.off('mousedown.dismiss.bs.modal')
$.support.transition && this.$element.hasClass('fade') ?
this.$element
.one('bsTransitionEnd', $.proxy(this.hideModal, this))
.emulateTransitionEnd(Modal.TRANSITION_DURATION) :
this.hideModal()
}
Modal.prototype.enforceFocus = function () {
$(document)
.off('focusin.bs.modal') // guard against infinite focus loop
.on('focusin.bs.modal', $.proxy(function (e) {
if (document !== e.target &&
this.$element[0] !== e.target &&
!this.$element.has(e.target).length) {
this.$element.trigger('focus')
}
}, this))
}
Modal.prototype.escape = function () {
if (this.isShown && this.options.keyboard) {
this.$element.on('keydown.dismiss.bs.modal', $.proxy(function (e) {
e.which == 27 && this.hide()
}, this))
} else if (!this.isShown) {
this.$element.off('keydown.dismiss.bs.modal')
}
}
Modal.prototype.resize = function () {
if (this.isShown) {
$(window).on('resize.bs.modal', $.proxy(this.handleUpdate, this))
} else {
$(window).off('resize.bs.modal')
}
}
Modal.prototype.hideModal = function () {
var that = this
this.$element.hide()
this.backdrop(function () {
that.$body.removeClass('modal-open')
that.resetAdjustments()
that.resetScrollbar()
that.$element.trigger('hidden.bs.modal')
})
}
Modal.prototype.removeBackdrop = function () {
this.$backdrop && this.$backdrop.remove()
this.$backdrop = null
}
Modal.prototype.backdrop = function (callback) {
var that = this
var animate = this.$element.hasClass('fade') ? 'fade' : ''
if (this.isShown && this.options.backdrop) {
var doAnimate = $.support.transition && animate
this.$backdrop = $(document.createElement('div'))
.addClass('modal-backdrop ' + animate)
.appendTo(this.$body)
this.$element.on('click.dismiss.bs.modal', $.proxy(function (e) {
if (this.ignoreBackdropClick) {
this.ignoreBackdropClick = false
return
}
if (e.target !== e.currentTarget) return
this.options.backdrop == 'static'
? this.$element[0].focus()
: this.hide()
}, this))
if (doAnimate) this.$backdrop[0].offsetWidth // force reflow
this.$backdrop.addClass('in')
if (!callback) return
doAnimate ?
this.$backdrop
.one('bsTransitionEnd', callback)
.emulateTransitionEnd(Modal.BACKDROP_TRANSITION_DURATION) :
callback()
} else if (!this.isShown && this.$backdrop) {
this.$backdrop.removeClass('in')
var callbackRemove = function () {
that.removeBackdrop()
callback && callback()
}
$.support.transition && this.$element.hasClass('fade') ?
this.$backdrop
.one('bsTransitionEnd', callbackRemove)
.emulateTransitionEnd(Modal.BACKDROP_TRANSITION_DURATION) :
callbackRemove()
} else if (callback) {
callback()
}
}
// these following methods are used to handle overflowing modals
Modal.prototype.handleUpdate = function () {
this.adjustDialog()
}
Modal.prototype.adjustDialog = function () {
var modalIsOverflowing = this.$element[0].scrollHeight > document.documentElement.clientHeight
this.$element.css({
paddingLeft: !this.bodyIsOverflowing && modalIsOverflowing ? this.scrollbarWidth : '',
paddingRight: this.bodyIsOverflowing && !modalIsOverflowing ? this.scrollbarWidth : ''
})
}
Modal.prototype.resetAdjustments = function () {
this.$element.css({
paddingLeft: '',
paddingRight: ''
})
}
Modal.prototype.checkScrollbar = function () {
var fullWindowWidth = window.innerWidth
if (!fullWindowWidth) { // workaround for missing window.innerWidth in IE8
var documentElementRect = document.documentElement.getBoundingClientRect()
fullWindowWidth = documentElementRect.right - Math.abs(documentElementRect.left)
}
this.bodyIsOverflowing = document.body.clientWidth < fullWindowWidth
this.scrollbarWidth = this.measureScrollbar()
}
Modal.prototype.setScrollbar = function () {
var bodyPad = parseInt((this.$body.css('padding-right') || 0), 10)
this.originalBodyPad = document.body.style.paddingRight || ''
if (this.bodyIsOverflowing) this.$body.css('padding-right', bodyPad + this.scrollbarWidth)
}
Modal.prototype.resetScrollbar = function () {
this.$body.css('padding-right', this.originalBodyPad)
}
Modal.prototype.measureScrollbar = function () { // thx walsh
var scrollDiv = document.createElement('div')
scrollDiv.className = 'modal-scrollbar-measure'
this.$body.append(scrollDiv)
var scrollbarWidth = scrollDiv.offsetWidth - scrollDiv.clientWidth
this.$body[0].removeChild(scrollDiv)
return scrollbarWidth
}
// MODAL PLUGIN DEFINITION
// =======================
function Plugin(option, _relatedTarget) {
return this.each(function () {
var $this = $(this)
var data = $this.data('bs.modal')
var options = $.extend({}, Modal.DEFAULTS, $this.data(), typeof option == 'object' && option)
if (!data) $this.data('bs.modal', (data = new Modal(this, options)))
if (typeof option == 'string') data[option](_relatedTarget)
else if (options.show) data.show(_relatedTarget)
})
}
var old = $.fn.modal
$.fn.modal = Plugin
$.fn.modal.Constructor = Modal
// MODAL NO CONFLICT
// =================
$.fn.modal.noConflict = function () {
$.fn.modal = old
return this
}
// MODAL DATA-API
// ==============
$(document).on('click.bs.modal.data-api', '[data-toggle="modal"]', function (e) {
var $this = $(this)
var href = $this.attr('href')
var $target = $($this.attr('data-target') || (href && href.replace(/.*(?=#[^\s]+$)/, ''))) // strip for ie7
var option = $target.data('bs.modal') ? 'toggle' : $.extend({ remote: !/#/.test(href) && href }, $target.data(), $this.data())
if ($this.is('a')) e.preventDefault()
$target.one('show.bs.modal', function (showEvent) {
if (showEvent.isDefaultPrevented()) return // only register focus restorer if modal will actually get shown
$target.one('hidden.bs.modal', function () {
$this.is(':visible') && $this.trigger('focus')
})
})
Plugin.call($target, option, this)
})
}(jQuery);
/* ========================================================================
* Bootstrap: tooltip.js v3.3.7
* http://getbootstrap.com/javascript/#tooltip
* Inspired by the original jQuery.tipsy by Jason Frame
* ========================================================================
* Copyright 2011-2016 Twitter, Inc.
* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
* ======================================================================== */
+function ($) {
'use strict';
// TOOLTIP PUBLIC CLASS DEFINITION
// ===============================
var Tooltip = function (element, options) {
this.type = null
this.options = null
this.enabled = null
this.timeout = null
this.hoverState = null
this.$element = null
this.inState = null
this.init('tooltip', element, options)
}
Tooltip.VERSION = '3.3.7'
Tooltip.TRANSITION_DURATION = 150
Tooltip.DEFAULTS = {
animation: true,
placement: 'top',
selector: false,
template: '<div class="tooltip" role="tooltip"><div class="tooltip-arrow"></div><div class="tooltip-inner"></div></div>',
trigger: 'hover focus',
title: '',
delay: 0,
html: false,
container: false,
viewport: {
selector: 'body',
padding: 0
}
}
Tooltip.prototype.init = function (type, element, options) {
this.enabled = true
this.type = type
this.$element = $(element)
this.options = this.getOptions(options)
this.$viewport = this.options.viewport && $($.isFunction(this.options.viewport) ? this.options.viewport.call(this, this.$element) : (this.options.viewport.selector || this.options.viewport))
this.inState = { click: false, hover: false, focus: false }
if (this.$element[0] instanceof document.constructor && !this.options.selector) {
throw new Error('`selector` option must be specified when initializing ' + this.type + ' on the window.document object!')
}
var triggers = this.options.trigger.split(' ')
for (var i = triggers.length; i--;) {
var trigger = triggers[i]
if (trigger == 'click') {
this.$element.on('click.' + this.type, this.options.selector, $.proxy(this.toggle, this))
} else if (trigger != 'manual') {
var eventIn = trigger == 'hover' ? 'mouseenter' : 'focusin'
var eventOut = trigger == 'hover' ? 'mouseleave' : 'focusout'
this.$element.on(eventIn + '.' + this.type, this.options.selector, $.proxy(this.enter, this))
this.$element.on(eventOut + '.' + this.type, this.options.selector, $.proxy(this.leave, this))
}
}
this.options.selector ?
(this._options = $.extend({}, this.options, { trigger: 'manual', selector: '' })) :
this.fixTitle()
}
Tooltip.prototype.getDefaults = function () {
return Tooltip.DEFAULTS
}
Tooltip.prototype.getOptions = function (options) {
options = $.extend({}, this.getDefaults(), this.$element.data(), options)
if (options.delay && typeof options.delay == 'number') {
options.delay = {
show: options.delay,
hide: options.delay
}
}
return options
}
Tooltip.prototype.getDelegateOptions = function () {
var options = {}
var defaults = this.getDefaults()
this._options && $.each(this._options, function (key, value) {
if (defaults[key] != value) options[key] = value
})
return options
}
Tooltip.prototype.enter = function (obj) {
var self = obj instanceof this.constructor ?
obj : $(obj.currentTarget).data('bs.' + this.type)
if (!self) {
self = new this.constructor(obj.currentTarget, this.getDelegateOptions())
$(obj.currentTarget).data('bs.' + this.type, self)
}
if (obj instanceof $.Event) {
self.inState[obj.type == 'focusin' ? 'focus' : 'hover'] = true
}
if (self.tip().hasClass('in') || self.hoverState == 'in') {
self.hoverState = 'in'
return
}
clearTimeout(self.timeout)
self.hoverState = 'in'
if (!self.options.delay || !self.options.delay.show) return self.show()
self.timeout = setTimeout(function () {
if (self.hoverState == 'in') self.show()
}, self.options.delay.show)
}
Tooltip.prototype.isInStateTrue = function () {
for (var key in this.inState) {
if (this.inState[key]) return true
}
return false
}
Tooltip.prototype.leave = function (obj) {
var self = obj instanceof this.constructor ?
obj : $(obj.currentTarget).data('bs.' + this.type)
if (!self) {
self = new this.constructor(obj.currentTarget, this.getDelegateOptions())
$(obj.currentTarget).data('bs.' + this.type, self)
}
if (obj instanceof $.Event) {
self.inState[obj.type == 'focusout' ? 'focus' : 'hover'] = false
}
if (self.isInStateTrue()) return
clearTimeout(self.timeout)
self.hoverState = 'out'
if (!self.options.delay || !self.options.delay.hide) return self.hide()
self.timeout = setTimeout(function () {
if (self.hoverState == 'out') self.hide()
}, self.options.delay.hide)
}
Tooltip.prototype.show = function () {
var e = $.Event('show.bs.' + this.type)
if (this.hasContent() && this.enabled) {
this.$element.trigger(e)
var inDom = $.contains(this.$element[0].ownerDocument.documentElement, this.$element[0])
if (e.isDefaultPrevented() || !inDom) return
var that = this
var $tip = this.tip()
var tipId = this.getUID(this.type)
this.setContent()
$tip.attr('id', tipId)
this.$element.attr('aria-describedby', tipId)
if (this.options.animation) $tip.addClass('fade')
var placement = typeof this.options.placement == 'function' ?
this.options.placement.call(this, $tip[0], this.$element[0]) :
this.options.placement
var autoToken = /\s?auto?\s?/i
var autoPlace = autoToken.test(placement)
if (autoPlace) placement = placement.replace(autoToken, '') || 'top'
$tip
.detach()
.css({ top: 0, left: 0, display: 'block' })
.addClass(placement)
.data('bs.' + this.type, this)
this.options.container ? $tip.appendTo(this.options.container) : $tip.insertAfter(this.$element)
this.$element.trigger('inserted.bs.' + this.type)
var pos = this.getPosition()
var actualWidth = $tip[0].offsetWidth
var actualHeight = $tip[0].offsetHeight
if (autoPlace) {
var orgPlacement = placement
var viewportDim = this.getPosition(this.$viewport)
placement = placement == 'bottom' && pos.bottom + actualHeight > viewportDim.bottom ? 'top' :
placement == 'top' && pos.top - actualHeight < viewportDim.top ? 'bottom' :
placement == 'right' && pos.right + actualWidth > viewportDim.width ? 'left' :
placement == 'left' && pos.left - actualWidth < viewportDim.left ? 'right' :
placement
$tip
.removeClass(orgPlacement)
.addClass(placement)
}
var calculatedOffset = this.getCalculatedOffset(placement, pos, actualWidth, actualHeight)
this.applyPlacement(calculatedOffset, placement)
var complete = function () {
var prevHoverState = that.hoverState
that.$element.trigger('shown.bs.' + that.type)
that.hoverState = null
if (prevHoverState == 'out') that.leave(that)
}
$.support.transition && this.$tip.hasClass('fade') ?
$tip
.one('bsTransitionEnd', complete)
.emulateTransitionEnd(Tooltip.TRANSITION_DURATION) :
complete()
}
}
Tooltip.prototype.applyPlacement = function (offset, placement) {
var $tip = this.tip()
var width = $tip[0].offsetWidth
var height = $tip[0].offsetHeight
// manually read margins because getBoundingClientRect includes difference
var marginTop = parseInt($tip.css('margin-top'), 10)
var marginLeft = parseInt($tip.css('margin-left'), 10)
// we must check for NaN for ie 8/9
if (isNaN(marginTop)) marginTop = 0
if (isNaN(marginLeft)) marginLeft = 0
offset.top += marginTop
offset.left += marginLeft
// $.fn.offset doesn't round pixel values
// so we use setOffset directly with our own function B-0
$.offset.setOffset($tip[0], $.extend({
using: function (props) {
$tip.css({
top: Math.round(props.top),
left: Math.round(props.left)
})
}
}, offset), 0)
$tip.addClass('in')
// check to see if placing tip in new offset caused the tip to resize itself
var actualWidth = $tip[0].offsetWidth
var actualHeight = $tip[0].offsetHeight
if (placement == 'top' && actualHeight != height) {
offset.top = offset.top + height - actualHeight
}
var delta = this.getViewportAdjustedDelta(placement, offset, actualWidth, actualHeight)
if (delta.left) offset.left += delta.left
else offset.top += delta.top
var isVertical = /top|bottom/.test(placement)
var arrowDelta = isVertical ? delta.left * 2 - width + actualWidth : delta.top * 2 - height + actualHeight
var arrowOffsetPosition = isVertical ? 'offsetWidth' : 'offsetHeight'
$tip.offset(offset)
this.replaceArrow(arrowDelta, $tip[0][arrowOffsetPosition], isVertical)
}
Tooltip.prototype.replaceArrow = function (delta, dimension, isVertical) {
this.arrow()
.css(isVertical ? 'left' : 'top', 50 * (1 - delta / dimension) + '%')
.css(isVertical ? 'top' : 'left', '')
}
Tooltip.prototype.setContent = function () {
var $tip = this.tip()
var title = this.getTitle()
$tip.find('.tooltip-inner')[this.options.html ? 'html' : 'text'](title)
$tip.removeClass('fade in top bottom left right')
}
Tooltip.prototype.hide = function (callback) {
var that = this
var $tip = $(this.$tip)
var e = $.Event('hide.bs.' + this.type)
function complete() {
if (that.hoverState != 'in') $tip.detach()
if (that.$element) { // TODO: Check whether guarding this code with this `if` is really necessary.
that.$element
.removeAttr('aria-describedby')
.trigger('hidden.bs.' + that.type)
}
callback && callback()
}
this.$element.trigger(e)
if (e.isDefaultPrevented()) return
$tip.removeClass('in')
$.support.transition && $tip.hasClass('fade') ?
$tip
.one('bsTransitionEnd', complete)
.emulateTransitionEnd(Tooltip.TRANSITION_DURATION) :
complete()
this.hoverState = null
return this
}
Tooltip.prototype.fixTitle = function () {
var $e = this.$element
if ($e.attr('title') || typeof $e.attr('data-original-title') != 'string') {
$e.attr('data-original-title', $e.attr('title') || '').attr('title', '')
}
}
Tooltip.prototype.hasContent = function () {
return this.getTitle()
}
Tooltip.prototype.getPosition = function ($element) {
$element = $element || this.$element
var el = $element[0]
var isBody = el.tagName == 'BODY'
var elRect = el.getBoundingClientRect()
if (elRect.width == null) {
// width and height are missing in IE8, so compute them manually; see https://github.com/twbs/bootstrap/issues/14093
elRect = $.extend({}, elRect, { width: elRect.right - elRect.left, height: elRect.bottom - elRect.top })
}
var isSvg = window.SVGElement && el instanceof window.SVGElement
// Avoid using $.offset() on SVGs since it gives incorrect results in jQuery 3.
// See https://github.com/twbs/bootstrap/issues/20280
var elOffset = isBody ? { top: 0, left: 0 } : (isSvg ? null : $element.offset())
var scroll = { scroll: isBody ? document.documentElement.scrollTop || document.body.scrollTop : $element.scrollTop() }
var outerDims = isBody ? { width: $(window).width(), height: $(window).height() } : null
return $.extend({}, elRect, scroll, outerDims, elOffset)
}
Tooltip.prototype.getCalculatedOffset = function (placement, pos, actualWidth, actualHeight) {
return placement == 'bottom' ? { top: pos.top + pos.height, left: pos.left + pos.width / 2 - actualWidth / 2 } :
placement == 'top' ? { top: pos.top - actualHeight, left: pos.left + pos.width / 2 - actualWidth / 2 } :
placement == 'left' ? { top: pos.top + pos.height / 2 - actualHeight / 2, left: pos.left - actualWidth } :
/* placement == 'right' */ { top: pos.top + pos.height / 2 - actualHeight / 2, left: pos.left + pos.width }
}
Tooltip.prototype.getViewportAdjustedDelta = function (placement, pos, actualWidth, actualHeight) {
var delta = { top: 0, left: 0 }
if (!this.$viewport) return delta
var viewportPadding = this.options.viewport && this.options.viewport.padding || 0
var viewportDimensions = this.getPosition(this.$viewport)
if (/right|left/.test(placement)) {
var topEdgeOffset = pos.top - viewportPadding - viewportDimensions.scroll
var bottomEdgeOffset = pos.top + viewportPadding - viewportDimensions.scroll + actualHeight
if (topEdgeOffset < viewportDimensions.top) { // top overflow
delta.top = viewportDimensions.top - topEdgeOffset
} else if (bottomEdgeOffset > viewportDimensions.top + viewportDimensions.height) { // bottom overflow
delta.top = viewportDimensions.top + viewportDimensions.height - bottomEdgeOffset
}
} else {
var leftEdgeOffset = pos.left - viewportPadding
var rightEdgeOffset = pos.left + viewportPadding + actualWidth
if (leftEdgeOffset < viewportDimensions.left) { // left overflow
delta.left = viewportDimensions.left - leftEdgeOffset
} else if (rightEdgeOffset > viewportDimensions.right) { // right overflow
delta.left = viewportDimensions.left + viewportDimensions.width - rightEdgeOffset
}
}
return delta
}
Tooltip.prototype.getTitle = function () {
var title
var $e = this.$element
var o = this.options
title = $e.attr('data-original-title')
|| (typeof o.title == 'function' ? o.title.call($e[0]) : o.title)
return title
}
Tooltip.prototype.getUID = function (prefix) {
do prefix += ~~(Math.random() * 1000000)
while (document.getElementById(prefix))
return prefix
}
Tooltip.prototype.tip = function () {
if (!this.$tip) {
this.$tip = $(this.options.template)
if (this.$tip.length != 1) {
throw new Error(this.type + ' `template` option must consist of exactly 1 top-level element!')
}
}
return this.$tip
}
Tooltip.prototype.arrow = function () {
return (this.$arrow = this.$arrow || this.tip().find('.tooltip-arrow'))
}
Tooltip.prototype.enable = function () {
this.enabled = true
}
Tooltip.prototype.disable = function () {
this.enabled = false
}
Tooltip.prototype.toggleEnabled = function () {
this.enabled = !this.enabled
}
Tooltip.prototype.toggle = function (e) {
var self = this
if (e) {
self = $(e.currentTarget).data('bs.' + this.type)
if (!self) {
self = new this.constructor(e.currentTarget, this.getDelegateOptions())
$(e.currentTarget).data('bs.' + this.type, self)
}
}
if (e) {
self.inState.click = !self.inState.click
if (self.isInStateTrue()) self.enter(self)
else self.leave(self)
} else {
self.tip().hasClass('in') ? self.leave(self) : self.enter(self)
}
}
Tooltip.prototype.destroy = function () {
var that = this
clearTimeout(this.timeout)
this.hide(function () {
that.$element.off('.' + that.type).removeData('bs.' + that.type)
if (that.$tip) {
that.$tip.detach()
}
that.$tip = null
that.$arrow = null
that.$viewport = null
that.$element = null
})
}
// TOOLTIP PLUGIN DEFINITION
// =========================
function Plugin(option) {
return this.each(function () {
var $this = $(this)
var data = $this.data('bs.tooltip')
var options = typeof option == 'object' && option
if (!data && /destroy|hide/.test(option)) return
if (!data) $this.data('bs.tooltip', (data = new Tooltip(this, options)))
if (typeof option == 'string') data[option]()
})
}
var old = $.fn.tooltip
$.fn.tooltip = Plugin
$.fn.tooltip.Constructor = Tooltip
// TOOLTIP NO CONFLICT
// ===================
$.fn.tooltip.noConflict = function () {
$.fn.tooltip = old
return this
}
}(jQuery);
/* ========================================================================
* Bootstrap: popover.js v3.3.7
* http://getbootstrap.com/javascript/#popovers
* ========================================================================
* Copyright 2011-2016 Twitter, Inc.
* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
* ======================================================================== */
+function ($) {
'use strict';
// POPOVER PUBLIC CLASS DEFINITION
// ===============================
var Popover = function (element, options) {
this.init('popover', element, options)
}
if (!$.fn.tooltip) throw new Error('Popover requires tooltip.js')
Popover.VERSION = '3.3.7'
Popover.DEFAULTS = $.extend({}, $.fn.tooltip.Constructor.DEFAULTS, {
placement: 'right',
trigger: 'click',
content: '',
template: '<div class="popover" role="tooltip"><div class="arrow"></div><h3 class="popover-title"></h3><div class="popover-content"></div></div>'
})
// NOTE: POPOVER EXTENDS tooltip.js
// ================================
Popover.prototype = $.extend({}, $.fn.tooltip.Constructor.prototype)
Popover.prototype.constructor = Popover
Popover.prototype.getDefaults = function () {
return Popover.DEFAULTS
}
Popover.prototype.setContent = function () {
var $tip = this.tip()
var title = this.getTitle()
var content = this.getContent()
$tip.find('.popover-title')[this.options.html ? 'html' : 'text'](title)
$tip.find('.popover-content').children().detach().end()[ // we use append for html objects to maintain js events
this.options.html ? (typeof content == 'string' ? 'html' : 'append') : 'text'
](content)
$tip.removeClass('fade top bottom left right in')
// IE8 doesn't accept hiding via the `:empty` pseudo selector, we have to do
// this manually by checking the contents.
if (!$tip.find('.popover-title').html()) $tip.find('.popover-title').hide()
}
Popover.prototype.hasContent = function () {
return this.getTitle() || this.getContent()
}
Popover.prototype.getContent = function () {
var $e = this.$element
var o = this.options
return $e.attr('data-content')
|| (typeof o.content == 'function' ?
o.content.call($e[0]) :
o.content)
}
Popover.prototype.arrow = function () {
return (this.$arrow = this.$arrow || this.tip().find('.arrow'))
}
// POPOVER PLUGIN DEFINITION
// =========================
function Plugin(option) {
return this.each(function () {
var $this = $(this)
var data = $this.data('bs.popover')
var options = typeof option == 'object' && option
if (!data && /destroy|hide/.test(option)) return
if (!data) $this.data('bs.popover', (data = new Popover(this, options)))
if (typeof option == 'string') data[option]()
})
}
var old = $.fn.popover
$.fn.popover = Plugin
$.fn.popover.Constructor = Popover
// POPOVER NO CONFLICT
// ===================
$.fn.popover.noConflict = function () {
$.fn.popover = old
return this
}
}(jQuery);
/* ========================================================================
* Bootstrap: scrollspy.js v3.3.7
* http://getbootstrap.com/javascript/#scrollspy
* ========================================================================
* Copyright 2011-2016 Twitter, Inc.
* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
* ======================================================================== */
+function ($) {
'use strict';
// SCROLLSPY CLASS DEFINITION
// ==========================
function ScrollSpy(element, options) {
this.$body = $(document.body)
this.$scrollElement = $(element).is(document.body) ? $(window) : $(element)
this.options = $.extend({}, ScrollSpy.DEFAULTS, options)
this.selector = (this.options.target || '') + ' .nav li > a'
this.offsets = []
this.targets = []
this.activeTarget = null
this.scrollHeight = 0
this.$scrollElement.on('scroll.bs.scrollspy', $.proxy(this.process, this))
this.refresh()
this.process()
}
ScrollSpy.VERSION = '3.3.7'
ScrollSpy.DEFAULTS = {
offset: 10
}
ScrollSpy.prototype.getScrollHeight = function () {
return this.$scrollElement[0].scrollHeight || Math.max(this.$body[0].scrollHeight, document.documentElement.scrollHeight)
}
ScrollSpy.prototype.refresh = function () {
var that = this
var offsetMethod = 'offset'
var offsetBase = 0
this.offsets = []
this.targets = []
this.scrollHeight = this.getScrollHeight()
if (!$.isWindow(this.$scrollElement[0])) {
offsetMethod = 'position'
offsetBase = this.$scrollElement.scrollTop()
}
this.$body
.find(this.selector)
.map(function () {
var $el = $(this)
var href = $el.data('target') || $el.attr('href')
var $href = /^#./.test(href) && $(href)
return ($href
&& $href.length
&& $href.is(':visible')
&& [[$href[offsetMethod]().top + offsetBase, href]]) || null
})
.sort(function (a, b) { return a[0] - b[0] })
.each(function () {
that.offsets.push(this[0])
that.targets.push(this[1])
})
}
ScrollSpy.prototype.process = function () {
var scrollTop = this.$scrollElement.scrollTop() + this.options.offset
var scrollHeight = this.getScrollHeight()
var maxScroll = this.options.offset + scrollHeight - this.$scrollElement.height()
var offsets = this.offsets
var targets = this.targets
var activeTarget = this.activeTarget
var i
if (this.scrollHeight != scrollHeight) {
this.refresh()
}
if (scrollTop >= maxScroll) {
return activeTarget != (i = targets[targets.length - 1]) && this.activate(i)
}
if (activeTarget && scrollTop < offsets[0]) {
this.activeTarget = null
return this.clear()
}
for (i = offsets.length; i--;) {
activeTarget != targets[i]
&& scrollTop >= offsets[i]
&& (offsets[i + 1] === undefined || scrollTop < offsets[i + 1])
&& this.activate(targets[i])
}
}
ScrollSpy.prototype.activate = function (target) {
this.activeTarget = target
this.clear()
var selector = this.selector +
'[data-target="' + target + '"],' +
this.selector + '[href="' + target + '"]'
var active = $(selector)
.parents('li')
.addClass('active')
if (active.parent('.dropdown-menu').length) {
active = active
.closest('li.dropdown')
.addClass('active')
}
active.trigger('activate.bs.scrollspy')
}
ScrollSpy.prototype.clear = function () {
$(this.selector)
.parentsUntil(this.options.target, '.active')
.removeClass('active')
}
// SCROLLSPY PLUGIN DEFINITION
// ===========================
function Plugin(option) {
return this.each(function () {
var $this = $(this)
var data = $this.data('bs.scrollspy')
var options = typeof option == 'object' && option
if (!data) $this.data('bs.scrollspy', (data = new ScrollSpy(this, options)))
if (typeof option == 'string') data[option]()
})
}
var old = $.fn.scrollspy
$.fn.scrollspy = Plugin
$.fn.scrollspy.Constructor = ScrollSpy
// SCROLLSPY NO CONFLICT
// =====================
$.fn.scrollspy.noConflict = function () {
$.fn.scrollspy = old
return this
}
// SCROLLSPY DATA-API
// ==================
$(window).on('load.bs.scrollspy.data-api', function () {
$('[data-spy="scroll"]').each(function () {
var $spy = $(this)
Plugin.call($spy, $spy.data())
})
})
}(jQuery);
/* ========================================================================
* Bootstrap: tab.js v3.3.7
* http://getbootstrap.com/javascript/#tabs
* ========================================================================
* Copyright 2011-2016 Twitter, Inc.
* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
* ======================================================================== */
+function ($) {
'use strict';
// TAB CLASS DEFINITION
// ====================
var Tab = function (element) {
// jscs:disable requireDollarBeforejQueryAssignment
this.element = $(element)
// jscs:enable requireDollarBeforejQueryAssignment
}
Tab.VERSION = '3.3.7'
Tab.TRANSITION_DURATION = 150
Tab.prototype.show = function () {
var $this = this.element
var $ul = $this.closest('ul:not(.dropdown-menu)')
var selector = $this.data('target')
if (!selector) {
selector = $this.attr('href')
selector = selector && selector.replace(/.*(?=#[^\s]*$)/, '') // strip for ie7
}
if ($this.parent('li').hasClass('active')) return
var $previous = $ul.find('.active:last a')
var hideEvent = $.Event('hide.bs.tab', {
relatedTarget: $this[0]
})
var showEvent = $.Event('show.bs.tab', {
relatedTarget: $previous[0]
})
$previous.trigger(hideEvent)
$this.trigger(showEvent)
if (showEvent.isDefaultPrevented() || hideEvent.isDefaultPrevented()) return
var $target = $(selector)
this.activate($this.closest('li'), $ul)
this.activate($target, $target.parent(), function () {
$previous.trigger({
type: 'hidden.bs.tab',
relatedTarget: $this[0]
})
$this.trigger({
type: 'shown.bs.tab',
relatedTarget: $previous[0]
})
})
}
Tab.prototype.activate = function (element, container, callback) {
var $active = container.find('> .active')
var transition = callback
&& $.support.transition
&& ($active.length && $active.hasClass('fade') || !!container.find('> .fade').length)
function next() {
$active
.removeClass('active')
.find('> .dropdown-menu > .active')
.removeClass('active')
.end()
.find('[data-toggle="tab"]')
.attr('aria-expanded', false)
element
.addClass('active')
.find('[data-toggle="tab"]')
.attr('aria-expanded', true)
if (transition) {
element[0].offsetWidth // reflow for transition
element.addClass('in')
} else {
element.removeClass('fade')
}
if (element.parent('.dropdown-menu').length) {
element
.closest('li.dropdown')
.addClass('active')
.end()
.find('[data-toggle="tab"]')
.attr('aria-expanded', true)
}
callback && callback()
}
$active.length && transition ?
$active
.one('bsTransitionEnd', next)
.emulateTransitionEnd(Tab.TRANSITION_DURATION) :
next()
$active.removeClass('in')
}
// TAB PLUGIN DEFINITION
// =====================
function Plugin(option) {
return this.each(function () {
var $this = $(this)
var data = $this.data('bs.tab')
if (!data) $this.data('bs.tab', (data = new Tab(this)))
if (typeof option == 'string') data[option]()
})
}
var old = $.fn.tab
$.fn.tab = Plugin
$.fn.tab.Constructor = Tab
// TAB NO CONFLICT
// ===============
$.fn.tab.noConflict = function () {
$.fn.tab = old
return this
}
// TAB DATA-API
// ============
var clickHandler = function (e) {
e.preventDefault()
Plugin.call($(this), 'show')
}
$(document)
.on('click.bs.tab.data-api', '[data-toggle="tab"]', clickHandler)
.on('click.bs.tab.data-api', '[data-toggle="pill"]', clickHandler)
}(jQuery);
/* ========================================================================
* Bootstrap: affix.js v3.3.7
* http://getbootstrap.com/javascript/#affix
* ========================================================================
* Copyright 2011-2016 Twitter, Inc.
* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
* ======================================================================== */
+function ($) {
'use strict';
// AFFIX CLASS DEFINITION
// ======================
var Affix = function (element, options) {
this.options = $.extend({}, Affix.DEFAULTS, options)
this.$target = $(this.options.target)
.on('scroll.bs.affix.data-api', $.proxy(this.checkPosition, this))
.on('click.bs.affix.data-api', $.proxy(this.checkPositionWithEventLoop, this))
this.$element = $(element)
this.affixed = null
this.unpin = null
this.pinnedOffset = null
this.checkPosition()
}
Affix.VERSION = '3.3.7'
Affix.RESET = 'affix affix-top affix-bottom'
Affix.DEFAULTS = {
offset: 0,
target: window
}
Affix.prototype.getState = function (scrollHeight, height, offsetTop, offsetBottom) {
var scrollTop = this.$target.scrollTop()
var position = this.$element.offset()
var targetHeight = this.$target.height()
if (offsetTop != null && this.affixed == 'top') return scrollTop < offsetTop ? 'top' : false
if (this.affixed == 'bottom') {
if (offsetTop != null) return (scrollTop + this.unpin <= position.top) ? false : 'bottom'
return (scrollTop + targetHeight <= scrollHeight - offsetBottom) ? false : 'bottom'
}
var initializing = this.affixed == null
var colliderTop = initializing ? scrollTop : position.top
var colliderHeight = initializing ? targetHeight : height
if (offsetTop != null && scrollTop <= offsetTop) return 'top'
if (offsetBottom != null && (colliderTop + colliderHeight >= scrollHeight - offsetBottom)) return 'bottom'
return false
}
Affix.prototype.getPinnedOffset = function () {
if (this.pinnedOffset) return this.pinnedOffset
this.$element.removeClass(Affix.RESET).addClass('affix')
var scrollTop = this.$target.scrollTop()
var position = this.$element.offset()
return (this.pinnedOffset = position.top - scrollTop)
}
Affix.prototype.checkPositionWithEventLoop = function () {
setTimeout($.proxy(this.checkPosition, this), 1)
}
Affix.prototype.checkPosition = function () {
if (!this.$element.is(':visible')) return
var height = this.$element.height()
var offset = this.options.offset
var offsetTop = offset.top
var offsetBottom = offset.bottom
var scrollHeight = Math.max($(document).height(), $(document.body).height())
if (typeof offset != 'object') offsetBottom = offsetTop = offset
if (typeof offsetTop == 'function') offsetTop = offset.top(this.$element)
if (typeof offsetBottom == 'function') offsetBottom = offset.bottom(this.$element)
var affix = this.getState(scrollHeight, height, offsetTop, offsetBottom)
if (this.affixed != affix) {
if (this.unpin != null) this.$element.css('top', '')
var affixType = 'affix' + (affix ? '-' + affix : '')
var e = $.Event(affixType + '.bs.affix')
this.$element.trigger(e)
if (e.isDefaultPrevented()) return
this.affixed = affix
this.unpin = affix == 'bottom' ? this.getPinnedOffset() : null
this.$element
.removeClass(Affix.RESET)
.addClass(affixType)
.trigger(affixType.replace('affix', 'affixed') + '.bs.affix')
}
if (affix == 'bottom') {
this.$element.offset({
top: scrollHeight - height - offsetBottom
})
}
}
// AFFIX PLUGIN DEFINITION
// =======================
function Plugin(option) {
return this.each(function () {
var $this = $(this)
var data = $this.data('bs.affix')
var options = typeof option == 'object' && option
if (!data) $this.data('bs.affix', (data = new Affix(this, options)))
if (typeof option == 'string') data[option]()
})
}
var old = $.fn.affix
$.fn.affix = Plugin
$.fn.affix.Constructor = Affix
// AFFIX NO CONFLICT
// =================
$.fn.affix.noConflict = function () {
$.fn.affix = old
return this
}
// AFFIX DATA-API
// ==============
$(window).on('load', function () {
$('[data-spy="affix"]').each(function () {
var $spy = $(this)
var data = $spy.data()
data.offset = data.offset || {}
if (data.offsetBottom != null) data.offset.bottom = data.offsetBottom
if (data.offsetTop != null) data.offset.top = data.offsetTop
Plugin.call($spy, data)
})
})
}(jQuery);
/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(1)))
/***/ }),
/* 33 */
/***/ (function(module, exports, __webpack_require__) {
/* WEBPACK VAR INJECTION */(function(global, module) {var __WEBPACK_AMD_DEFINE_RESULT__;/**
* @license
* Lodash <https://lodash.com/>
* Copyright JS Foundation and other contributors <https://js.foundation/>
* Released under MIT license <https://lodash.com/license>
* Based on Underscore.js 1.8.3 <http://underscorejs.org/LICENSE>
* Copyright Jeremy Ashkenas, DocumentCloud and Investigative Reporters & Editors
*/
;(function() {
/** Used as a safe reference for `undefined` in pre-ES5 environments. */
var undefined;
/** Used as the semantic version number. */
var VERSION = '4.17.4';
/** Used as the size to enable large array optimizations. */
var LARGE_ARRAY_SIZE = 200;
/** Error message constants. */
var CORE_ERROR_TEXT = 'Unsupported core-js use. Try https://npms.io/search?q=ponyfill.',
FUNC_ERROR_TEXT = 'Expected a function';
/** Used to stand-in for `undefined` hash values. */
var HASH_UNDEFINED = '__lodash_hash_undefined__';
/** Used as the maximum memoize cache size. */
var MAX_MEMOIZE_SIZE = 500;
/** Used as the internal argument placeholder. */
var PLACEHOLDER = '__lodash_placeholder__';
/** Used to compose bitmasks for cloning. */
var CLONE_DEEP_FLAG = 1,
CLONE_FLAT_FLAG = 2,
CLONE_SYMBOLS_FLAG = 4;
/** Used to compose bitmasks for value comparisons. */
var COMPARE_PARTIAL_FLAG = 1,
COMPARE_UNORDERED_FLAG = 2;
/** Used to compose bitmasks for function metadata. */
var WRAP_BIND_FLAG = 1,
WRAP_BIND_KEY_FLAG = 2,
WRAP_CURRY_BOUND_FLAG = 4,
WRAP_CURRY_FLAG = 8,
WRAP_CURRY_RIGHT_FLAG = 16,
WRAP_PARTIAL_FLAG = 32,
WRAP_PARTIAL_RIGHT_FLAG = 64,
WRAP_ARY_FLAG = 128,
WRAP_REARG_FLAG = 256,
WRAP_FLIP_FLAG = 512;
/** Used as default options for `_.truncate`. */
var DEFAULT_TRUNC_LENGTH = 30,
DEFAULT_TRUNC_OMISSION = '...';
/** Used to detect hot functions by number of calls within a span of milliseconds. */
var HOT_COUNT = 800,
HOT_SPAN = 16;
/** Used to indicate the type of lazy iteratees. */
var LAZY_FILTER_FLAG = 1,
LAZY_MAP_FLAG = 2,
LAZY_WHILE_FLAG = 3;
/** Used as references for various `Number` constants. */
var INFINITY = 1 / 0,
MAX_SAFE_INTEGER = 9007199254740991,
MAX_INTEGER = 1.7976931348623157e+308,
NAN = 0 / 0;
/** Used as references for the maximum length and index of an array. */
var MAX_ARRAY_LENGTH = 4294967295,
MAX_ARRAY_INDEX = MAX_ARRAY_LENGTH - 1,
HALF_MAX_ARRAY_LENGTH = MAX_ARRAY_LENGTH >>> 1;
/** Used to associate wrap methods with their bit flags. */
var wrapFlags = [
['ary', WRAP_ARY_FLAG],
['bind', WRAP_BIND_FLAG],
['bindKey', WRAP_BIND_KEY_FLAG],
['curry', WRAP_CURRY_FLAG],
['curryRight', WRAP_CURRY_RIGHT_FLAG],
['flip', WRAP_FLIP_FLAG],
['partial', WRAP_PARTIAL_FLAG],
['partialRight', WRAP_PARTIAL_RIGHT_FLAG],
['rearg', WRAP_REARG_FLAG]
];
/** `Object#toString` result references. */
var argsTag = '[object Arguments]',
arrayTag = '[object Array]',
asyncTag = '[object AsyncFunction]',
boolTag = '[object Boolean]',
dateTag = '[object Date]',
domExcTag = '[object DOMException]',
errorTag = '[object Error]',
funcTag = '[object Function]',
genTag = '[object GeneratorFunction]',
mapTag = '[object Map]',
numberTag = '[object Number]',
nullTag = '[object Null]',
objectTag = '[object Object]',
promiseTag = '[object Promise]',
proxyTag = '[object Proxy]',
regexpTag = '[object RegExp]',
setTag = '[object Set]',
stringTag = '[object String]',
symbolTag = '[object Symbol]',
undefinedTag = '[object Undefined]',
weakMapTag = '[object WeakMap]',
weakSetTag = '[object WeakSet]';
var arrayBufferTag = '[object ArrayBuffer]',
dataViewTag = '[object DataView]',
float32Tag = '[object Float32Array]',
float64Tag = '[object Float64Array]',
int8Tag = '[object Int8Array]',
int16Tag = '[object Int16Array]',
int32Tag = '[object Int32Array]',
uint8Tag = '[object Uint8Array]',
uint8ClampedTag = '[object Uint8ClampedArray]',
uint16Tag = '[object Uint16Array]',
uint32Tag = '[object Uint32Array]';
/** Used to match empty string literals in compiled template source. */
var reEmptyStringLeading = /\b__p \+= '';/g,
reEmptyStringMiddle = /\b(__p \+=) '' \+/g,
reEmptyStringTrailing = /(__e\(.*?\)|\b__t\)) \+\n'';/g;
/** Used to match HTML entities and HTML characters. */
var reEscapedHtml = /&(?:amp|lt|gt|quot|#39);/g,
reUnescapedHtml = /[&<>"']/g,
reHasEscapedHtml = RegExp(reEscapedHtml.source),
reHasUnescapedHtml = RegExp(reUnescapedHtml.source);
/** Used to match template delimiters. */
var reEscape = /<%-([\s\S]+?)%>/g,
reEvaluate = /<%([\s\S]+?)%>/g,
reInterpolate = /<%=([\s\S]+?)%>/g;
/** Used to match property names within property paths. */
var reIsDeepProp = /\.|\[(?:[^[\]]*|(["'])(?:(?!\1)[^\\]|\\.)*?\1)\]/,
reIsPlainProp = /^\w*$/,
reLeadingDot = /^\./,
rePropName = /[^.[\]]+|\[(?:(-?\d+(?:\.\d+)?)|(["'])((?:(?!\2)[^\\]|\\.)*?)\2)\]|(?=(?:\.|\[\])(?:\.|\[\]|$))/g;
/**
* Used to match `RegExp`
* [syntax characters](http://ecma-international.org/ecma-262/7.0/#sec-patterns).
*/
var reRegExpChar = /[\\^$.*+?()[\]{}|]/g,
reHasRegExpChar = RegExp(reRegExpChar.source);
/** Used to match leading and trailing whitespace. */
var reTrim = /^\s+|\s+$/g,
reTrimStart = /^\s+/,
reTrimEnd = /\s+$/;
/** Used to match wrap detail comments. */
var reWrapComment = /\{(?:\n\/\* \[wrapped with .+\] \*\/)?\n?/,
reWrapDetails = /\{\n\/\* \[wrapped with (.+)\] \*/,
reSplitDetails = /,? & /;
/** Used to match words composed of alphanumeric characters. */
var reAsciiWord = /[^\x00-\x2f\x3a-\x40\x5b-\x60\x7b-\x7f]+/g;
/** Used to match backslashes in property paths. */
var reEscapeChar = /\\(\\)?/g;
/**
* Used to match
* [ES template delimiters](http://ecma-international.org/ecma-262/7.0/#sec-template-literal-lexical-components).
*/
var reEsTemplate = /\$\{([^\\}]*(?:\\.[^\\}]*)*)\}/g;
/** Used to match `RegExp` flags from their coerced string values. */
var reFlags = /\w*$/;
/** Used to detect bad signed hexadecimal string values. */
var reIsBadHex = /^[-+]0x[0-9a-f]+$/i;
/** Used to detect binary string values. */
var reIsBinary = /^0b[01]+$/i;
/** Used to detect host constructors (Safari). */
var reIsHostCtor = /^\[object .+?Constructor\]$/;
/** Used to detect octal string values. */
var reIsOctal = /^0o[0-7]+$/i;
/** Used to detect unsigned integer values. */
var reIsUint = /^(?:0|[1-9]\d*)$/;
/** Used to match Latin Unicode letters (excluding mathematical operators). */
var reLatin = /[\xc0-\xd6\xd8-\xf6\xf8-\xff\u0100-\u017f]/g;
/** Used to ensure capturing order of template delimiters. */
var reNoMatch = /($^)/;
/** Used to match unescaped characters in compiled string literals. */
var reUnescapedString = /['\n\r\u2028\u2029\\]/g;
/** Used to compose unicode character classes. */
var rsAstralRange = '\\ud800-\\udfff',
rsComboMarksRange = '\\u0300-\\u036f',
reComboHalfMarksRange = '\\ufe20-\\ufe2f',
rsComboSymbolsRange = '\\u20d0-\\u20ff',
rsComboRange = rsComboMarksRange + reComboHalfMarksRange + rsComboSymbolsRange,
rsDingbatRange = '\\u2700-\\u27bf',
rsLowerRange = 'a-z\\xdf-\\xf6\\xf8-\\xff',
rsMathOpRange = '\\xac\\xb1\\xd7\\xf7',
rsNonCharRange = '\\x00-\\x2f\\x3a-\\x40\\x5b-\\x60\\x7b-\\xbf',
rsPunctuationRange = '\\u2000-\\u206f',
rsSpaceRange = ' \\t\\x0b\\f\\xa0\\ufeff\\n\\r\\u2028\\u2029\\u1680\\u180e\\u2000\\u2001\\u2002\\u2003\\u2004\\u2005\\u2006\\u2007\\u2008\\u2009\\u200a\\u202f\\u205f\\u3000',
rsUpperRange = 'A-Z\\xc0-\\xd6\\xd8-\\xde',
rsVarRange = '\\ufe0e\\ufe0f',
rsBreakRange = rsMathOpRange + rsNonCharRange + rsPunctuationRange + rsSpaceRange;
/** Used to compose unicode capture groups. */
var rsApos = "['\u2019]",
rsAstral = '[' + rsAstralRange + ']',
rsBreak = '[' + rsBreakRange + ']',
rsCombo = '[' + rsComboRange + ']',
rsDigits = '\\d+',
rsDingbat = '[' + rsDingbatRange + ']',
rsLower = '[' + rsLowerRange + ']',
rsMisc = '[^' + rsAstralRange + rsBreakRange + rsDigits + rsDingbatRange + rsLowerRange + rsUpperRange + ']',
rsFitz = '\\ud83c[\\udffb-\\udfff]',
rsModifier = '(?:' + rsCombo + '|' + rsFitz + ')',
rsNonAstral = '[^' + rsAstralRange + ']',
rsRegional = '(?:\\ud83c[\\udde6-\\uddff]){2}',
rsSurrPair = '[\\ud800-\\udbff][\\udc00-\\udfff]',
rsUpper = '[' + rsUpperRange + ']',
rsZWJ = '\\u200d';
/** Used to compose unicode regexes. */
var rsMiscLower = '(?:' + rsLower + '|' + rsMisc + ')',
rsMiscUpper = '(?:' + rsUpper + '|' + rsMisc + ')',
rsOptContrLower = '(?:' + rsApos + '(?:d|ll|m|re|s|t|ve))?',
rsOptContrUpper = '(?:' + rsApos + '(?:D|LL|M|RE|S|T|VE))?',
reOptMod = rsModifier + '?',
rsOptVar = '[' + rsVarRange + ']?',
rsOptJoin = '(?:' + rsZWJ + '(?:' + [rsNonAstral, rsRegional, rsSurrPair].join('|') + ')' + rsOptVar + reOptMod + ')*',
rsOrdLower = '\\d*(?:(?:1st|2nd|3rd|(?![123])\\dth)\\b)',
rsOrdUpper = '\\d*(?:(?:1ST|2ND|3RD|(?![123])\\dTH)\\b)',
rsSeq = rsOptVar + reOptMod + rsOptJoin,
rsEmoji = '(?:' + [rsDingbat, rsRegional, rsSurrPair].join('|') + ')' + rsSeq,
rsSymbol = '(?:' + [rsNonAstral + rsCombo + '?', rsCombo, rsRegional, rsSurrPair, rsAstral].join('|') + ')';
/** Used to match apostrophes. */
var reApos = RegExp(rsApos, 'g');
/**
* Used to match [combining diacritical marks](https://en.wikipedia.org/wiki/Combining_Diacritical_Marks) and
* [combining diacritical marks for symbols](https://en.wikipedia.org/wiki/Combining_Diacritical_Marks_for_Symbols).
*/
var reComboMark = RegExp(rsCombo, 'g');
/** Used to match [string symbols](https://mathiasbynens.be/notes/javascript-unicode). */
var reUnicode = RegExp(rsFitz + '(?=' + rsFitz + ')|' + rsSymbol + rsSeq, 'g');
/** Used to match complex or compound words. */
var reUnicodeWord = RegExp([
rsUpper + '?' + rsLower + '+' + rsOptContrLower + '(?=' + [rsBreak, rsUpper, '$'].join('|') + ')',
rsMiscUpper + '+' + rsOptContrUpper + '(?=' + [rsBreak, rsUpper + rsMiscLower, '$'].join('|') + ')',
rsUpper + '?' + rsMiscLower + '+' + rsOptContrLower,
rsUpper + '+' + rsOptContrUpper,
rsOrdUpper,
rsOrdLower,
rsDigits,
rsEmoji
].join('|'), 'g');
/** Used to detect strings with [zero-width joiners or code points from the astral planes](http://eev.ee/blog/2015/09/12/dark-corners-of-unicode/). */
var reHasUnicode = RegExp('[' + rsZWJ + rsAstralRange + rsComboRange + rsVarRange + ']');
/** Used to detect strings that need a more robust regexp to match words. */
var reHasUnicodeWord = /[a-z][A-Z]|[A-Z]{2,}[a-z]|[0-9][a-zA-Z]|[a-zA-Z][0-9]|[^a-zA-Z0-9 ]/;
/** Used to assign default `context` object properties. */
var contextProps = [
'Array', 'Buffer', 'DataView', 'Date', 'Error', 'Float32Array', 'Float64Array',
'Function', 'Int8Array', 'Int16Array', 'Int32Array', 'Map', 'Math', 'Object',
'Promise', 'RegExp', 'Set', 'String', 'Symbol', 'TypeError', 'Uint8Array',
'Uint8ClampedArray', 'Uint16Array', 'Uint32Array', 'WeakMap',
'_', 'clearTimeout', 'isFinite', 'parseInt', 'setTimeout'
];
/** Used to make template sourceURLs easier to identify. */
var templateCounter = -1;
/** Used to identify `toStringTag` values of typed arrays. */
var typedArrayTags = {};
typedArrayTags[float32Tag] = typedArrayTags[float64Tag] =
typedArrayTags[int8Tag] = typedArrayTags[int16Tag] =
typedArrayTags[int32Tag] = typedArrayTags[uint8Tag] =
typedArrayTags[uint8ClampedTag] = typedArrayTags[uint16Tag] =
typedArrayTags[uint32Tag] = true;
typedArrayTags[argsTag] = typedArrayTags[arrayTag] =
typedArrayTags[arrayBufferTag] = typedArrayTags[boolTag] =
typedArrayTags[dataViewTag] = typedArrayTags[dateTag] =
typedArrayTags[errorTag] = typedArrayTags[funcTag] =
typedArrayTags[mapTag] = typedArrayTags[numberTag] =
typedArrayTags[objectTag] = typedArrayTags[regexpTag] =
typedArrayTags[setTag] = typedArrayTags[stringTag] =
typedArrayTags[weakMapTag] = false;
/** Used to identify `toStringTag` values supported by `_.clone`. */
var cloneableTags = {};
cloneableTags[argsTag] = cloneableTags[arrayTag] =
cloneableTags[arrayBufferTag] = cloneableTags[dataViewTag] =
cloneableTags[boolTag] = cloneableTags[dateTag] =
cloneableTags[float32Tag] = cloneableTags[float64Tag] =
cloneableTags[int8Tag] = cloneableTags[int16Tag] =
cloneableTags[int32Tag] = cloneableTags[mapTag] =
cloneableTags[numberTag] = cloneableTags[objectTag] =
cloneableTags[regexpTag] = cloneableTags[setTag] =
cloneableTags[stringTag] = cloneableTags[symbolTag] =
cloneableTags[uint8Tag] = cloneableTags[uint8ClampedTag] =
cloneableTags[uint16Tag] = cloneableTags[uint32Tag] = true;
cloneableTags[errorTag] = cloneableTags[funcTag] =
cloneableTags[weakMapTag] = false;
/** Used to map Latin Unicode letters to basic Latin letters. */
var deburredLetters = {
// Latin-1 Supplement block.
'\xc0': 'A', '\xc1': 'A', '\xc2': 'A', '\xc3': 'A', '\xc4': 'A', '\xc5': 'A',
'\xe0': 'a', '\xe1': 'a', '\xe2': 'a', '\xe3': 'a', '\xe4': 'a', '\xe5': 'a',
'\xc7': 'C', '\xe7': 'c',
'\xd0': 'D', '\xf0': 'd',
'\xc8': 'E', '\xc9': 'E', '\xca': 'E', '\xcb': 'E',
'\xe8': 'e', '\xe9': 'e', '\xea': 'e', '\xeb': 'e',
'\xcc': 'I', '\xcd': 'I', '\xce': 'I', '\xcf': 'I',
'\xec': 'i', '\xed': 'i', '\xee': 'i', '\xef': 'i',
'\xd1': 'N', '\xf1': 'n',
'\xd2': 'O', '\xd3': 'O', '\xd4': 'O', '\xd5': 'O', '\xd6': 'O', '\xd8': 'O',
'\xf2': 'o', '\xf3': 'o', '\xf4': 'o', '\xf5': 'o', '\xf6': 'o', '\xf8': 'o',
'\xd9': 'U', '\xda': 'U', '\xdb': 'U', '\xdc': 'U',
'\xf9': 'u', '\xfa': 'u', '\xfb': 'u', '\xfc': 'u',
'\xdd': 'Y', '\xfd': 'y', '\xff': 'y',
'\xc6': 'Ae', '\xe6': 'ae',
'\xde': 'Th', '\xfe': 'th',
'\xdf': 'ss',
// Latin Extended-A block.
'\u0100': 'A', '\u0102': 'A', '\u0104': 'A',
'\u0101': 'a', '\u0103': 'a', '\u0105': 'a',
'\u0106': 'C', '\u0108': 'C', '\u010a': 'C', '\u010c': 'C',
'\u0107': 'c', '\u0109': 'c', '\u010b': 'c', '\u010d': 'c',
'\u010e': 'D', '\u0110': 'D', '\u010f': 'd', '\u0111': 'd',
'\u0112': 'E', '\u0114': 'E', '\u0116': 'E', '\u0118': 'E', '\u011a': 'E',
'\u0113': 'e', '\u0115': 'e', '\u0117': 'e', '\u0119': 'e', '\u011b': 'e',
'\u011c': 'G', '\u011e': 'G', '\u0120': 'G', '\u0122': 'G',
'\u011d': 'g', '\u011f': 'g', '\u0121': 'g', '\u0123': 'g',
'\u0124': 'H', '\u0126': 'H', '\u0125': 'h', '\u0127': 'h',
'\u0128': 'I', '\u012a': 'I', '\u012c': 'I', '\u012e': 'I', '\u0130': 'I',
'\u0129': 'i', '\u012b': 'i', '\u012d': 'i', '\u012f': 'i', '\u0131': 'i',
'\u0134': 'J', '\u0135': 'j',
'\u0136': 'K', '\u0137': 'k', '\u0138': 'k',
'\u0139': 'L', '\u013b': 'L', '\u013d': 'L', '\u013f': 'L', '\u0141': 'L',
'\u013a': 'l', '\u013c': 'l', '\u013e': 'l', '\u0140': 'l', '\u0142': 'l',
'\u0143': 'N', '\u0145': 'N', '\u0147': 'N', '\u014a': 'N',
'\u0144': 'n', '\u0146': 'n', '\u0148': 'n', '\u014b': 'n',
'\u014c': 'O', '\u014e': 'O', '\u0150': 'O',
'\u014d': 'o', '\u014f': 'o', '\u0151': 'o',
'\u0154': 'R', '\u0156': 'R', '\u0158': 'R',
'\u0155': 'r', '\u0157': 'r', '\u0159': 'r',
'\u015a': 'S', '\u015c': 'S', '\u015e': 'S', '\u0160': 'S',
'\u015b': 's', '\u015d': 's', '\u015f': 's', '\u0161': 's',
'\u0162': 'T', '\u0164': 'T', '\u0166': 'T',
'\u0163': 't', '\u0165': 't', '\u0167': 't',
'\u0168': 'U', '\u016a': 'U', '\u016c': 'U', '\u016e': 'U', '\u0170': 'U', '\u0172': 'U',
'\u0169': 'u', '\u016b': 'u', '\u016d': 'u', '\u016f': 'u', '\u0171': 'u', '\u0173': 'u',
'\u0174': 'W', '\u0175': 'w',
'\u0176': 'Y', '\u0177': 'y', '\u0178': 'Y',
'\u0179': 'Z', '\u017b': 'Z', '\u017d': 'Z',
'\u017a': 'z', '\u017c': 'z', '\u017e': 'z',
'\u0132': 'IJ', '\u0133': 'ij',
'\u0152': 'Oe', '\u0153': 'oe',
'\u0149': "'n", '\u017f': 's'
};
/** Used to map characters to HTML entities. */
var htmlEscapes = {
'&': '&',
'<': '<',
'>': '>',
'"': '"',
"'": '''
};
/** Used to map HTML entities to characters. */
var htmlUnescapes = {
'&': '&',
'<': '<',
'>': '>',
'"': '"',
''': "'"
};
/** Used to escape characters for inclusion in compiled string literals. */
var stringEscapes = {
'\\': '\\',
"'": "'",
'\n': 'n',
'\r': 'r',
'\u2028': 'u2028',
'\u2029': 'u2029'
};
/** Built-in method references without a dependency on `root`. */
var freeParseFloat = parseFloat,
freeParseInt = parseInt;
/** Detect free variable `global` from Node.js. */
var freeGlobal = typeof global == 'object' && global && global.Object === Object && global;
/** Detect free variable `self`. */
var freeSelf = typeof self == 'object' && self && self.Object === Object && self;
/** Used as a reference to the global object. */
var root = freeGlobal || freeSelf || Function('return this')();
/** Detect free variable `exports`. */
var freeExports = typeof exports == 'object' && exports && !exports.nodeType && exports;
/** Detect free variable `module`. */
var freeModule = freeExports && typeof module == 'object' && module && !module.nodeType && module;
/** Detect the popular CommonJS extension `module.exports`. */
var moduleExports = freeModule && freeModule.exports === freeExports;
/** Detect free variable `process` from Node.js. */
var freeProcess = moduleExports && freeGlobal.process;
/** Used to access faster Node.js helpers. */
var nodeUtil = (function() {
try {
return freeProcess && freeProcess.binding && freeProcess.binding('util');
} catch (e) {}
}());
/* Node.js helper references. */
var nodeIsArrayBuffer = nodeUtil && nodeUtil.isArrayBuffer,
nodeIsDate = nodeUtil && nodeUtil.isDate,
nodeIsMap = nodeUtil && nodeUtil.isMap,
nodeIsRegExp = nodeUtil && nodeUtil.isRegExp,
nodeIsSet = nodeUtil && nodeUtil.isSet,
nodeIsTypedArray = nodeUtil && nodeUtil.isTypedArray;
/*--------------------------------------------------------------------------*/
/**
* Adds the key-value `pair` to `map`.
*
* @private
* @param {Object} map The map to modify.
* @param {Array} pair The key-value pair to add.
* @returns {Object} Returns `map`.
*/
function addMapEntry(map, pair) {
// Don't return `map.set` because it's not chainable in IE 11.
map.set(pair[0], pair[1]);
return map;
}
/**
* Adds `value` to `set`.
*
* @private
* @param {Object} set The set to modify.
* @param {*} value The value to add.
* @returns {Object} Returns `set`.
*/
function addSetEntry(set, value) {
// Don't return `set.add` because it's not chainable in IE 11.
set.add(value);
return set;
}
/**
* A faster alternative to `Function#apply`, this function invokes `func`
* with the `this` binding of `thisArg` and the arguments of `args`.
*
* @private
* @param {Function} func The function to invoke.
* @param {*} thisArg The `this` binding of `func`.
* @param {Array} args The arguments to invoke `func` with.
* @returns {*} Returns the result of `func`.
*/
function apply(func, thisArg, args) {
switch (args.length) {
case 0: return func.call(thisArg);
case 1: return func.call(thisArg, args[0]);
case 2: return func.call(thisArg, args[0], args[1]);
case 3: return func.call(thisArg, args[0], args[1], args[2]);
}
return func.apply(thisArg, args);
}
/**
* A specialized version of `baseAggregator` for arrays.
*
* @private
* @param {Array} [array] The array to iterate over.
* @param {Function} setter The function to set `accumulator` values.
* @param {Function} iteratee The iteratee to transform keys.
* @param {Object} accumulator The initial aggregated object.
* @returns {Function} Returns `accumulator`.
*/
function arrayAggregator(array, setter, iteratee, accumulator) {
var index = -1,
length = array == null ? 0 : array.length;
while (++index < length) {
var value = array[index];
setter(accumulator, value, iteratee(value), array);
}
return accumulator;
}
/**
* A specialized version of `_.forEach` for arrays without support for
* iteratee shorthands.
*
* @private
* @param {Array} [array] The array to iterate over.
* @param {Function} iteratee The function invoked per iteration.
* @returns {Array} Returns `array`.
*/
function arrayEach(array, iteratee) {
var index = -1,
length = array == null ? 0 : array.length;
while (++index < length) {
if (iteratee(array[index], index, array) === false) {
break;
}
}
return array;
}
/**
* A specialized version of `_.forEachRight` for arrays without support for
* iteratee shorthands.
*
* @private
* @param {Array} [array] The array to iterate over.
* @param {Function} iteratee The function invoked per iteration.
* @returns {Array} Returns `array`.
*/
function arrayEachRight(array, iteratee) {
var length = array == null ? 0 : array.length;
while (length--) {
if (iteratee(array[length], length, array) === false) {
break;
}
}
return array;
}
/**
* A specialized version of `_.every` for arrays without support for
* iteratee shorthands.
*
* @private
* @param {Array} [array] The array to iterate over.
* @param {Function} predicate The function invoked per iteration.
* @returns {boolean} Returns `true` if all elements pass the predicate check,
* else `false`.
*/
function arrayEvery(array, predicate) {
var index = -1,
length = array == null ? 0 : array.length;
while (++index < length) {
if (!predicate(array[index], index, array)) {
return false;
}
}
return true;
}
/**
* A specialized version of `_.filter` for arrays without support for
* iteratee shorthands.
*
* @private
* @param {Array} [array] The array to iterate over.
* @param {Function} predicate The function invoked per iteration.
* @returns {Array} Returns the new filtered array.
*/
function arrayFilter(array, predicate) {
var index = -1,
length = array == null ? 0 : array.length,
resIndex = 0,
result = [];
while (++index < length) {
var value = array[index];
if (predicate(value, index, array)) {
result[resIndex++] = value;
}
}
return result;
}
/**
* A specialized version of `_.includes` for arrays without support for
* specifying an index to search from.
*
* @private
* @param {Array} [array] The array to inspect.
* @param {*} target The value to search for.
* @returns {boolean} Returns `true` if `target` is found, else `false`.
*/
function arrayIncludes(array, value) {
var length = array == null ? 0 : array.length;
return !!length && baseIndexOf(array, value, 0) > -1;
}
/**
* This function is like `arrayIncludes` except that it accepts a comparator.
*
* @private
* @param {Array} [array] The array to inspect.
* @param {*} target The value to search for.
* @param {Function} comparator The comparator invoked per element.
* @returns {boolean} Returns `true` if `target` is found, else `false`.
*/
function arrayIncludesWith(array, value, comparator) {
var index = -1,
length = array == null ? 0 : array.length;
while (++index < length) {
if (comparator(value, array[index])) {
return true;
}
}
return false;
}
/**
* A specialized version of `_.map` for arrays without support for iteratee
* shorthands.
*
* @private
* @param {Array} [array] The array to iterate over.
* @param {Function} iteratee The function invoked per iteration.
* @returns {Array} Returns the new mapped array.
*/
function arrayMap(array, iteratee) {
var index = -1,
length = array == null ? 0 : array.length,
result = Array(length);
while (++index < length) {
result[index] = iteratee(array[index], index, array);
}
return result;
}
/**
* Appends the elements of `values` to `array`.
*
* @private
* @param {Array} array The array to modify.
* @param {Array} values The values to append.
* @returns {Array} Returns `array`.
*/
function arrayPush(array, values) {
var index = -1,
length = values.length,
offset = array.length;
while (++index < length) {
array[offset + index] = values[index];
}
return array;
}
/**
* A specialized version of `_.reduce` for arrays without support for
* iteratee shorthands.
*
* @private
* @param {Array} [array] The array to iterate over.
* @param {Function} iteratee The function invoked per iteration.
* @param {*} [accumulator] The initial value.
* @param {boolean} [initAccum] Specify using the first element of `array` as
* the initial value.
* @returns {*} Returns the accumulated value.
*/
function arrayReduce(array, iteratee, accumulator, initAccum) {
var index = -1,
length = array == null ? 0 : array.length;
if (initAccum && length) {
accumulator = array[++index];
}
while (++index < length) {
accumulator = iteratee(accumulator, array[index], index, array);
}
return accumulator;
}
/**
* A specialized version of `_.reduceRight` for arrays without support for
* iteratee shorthands.
*
* @private
* @param {Array} [array] The array to iterate over.
* @param {Function} iteratee The function invoked per iteration.
* @param {*} [accumulator] The initial value.
* @param {boolean} [initAccum] Specify using the last element of `array` as
* the initial value.
* @returns {*} Returns the accumulated value.
*/
function arrayReduceRight(array, iteratee, accumulator, initAccum) {
var length = array == null ? 0 : array.length;
if (initAccum && length) {
accumulator = array[--length];
}
while (length--) {
accumulator = iteratee(accumulator, array[length], length, array);
}
return accumulator;
}
/**
* A specialized version of `_.some` for arrays without support for iteratee
* shorthands.
*
* @private
* @param {Array} [array] The array to iterate over.
* @param {Function} predicate The function invoked per iteration.
* @returns {boolean} Returns `true` if any element passes the predicate check,
* else `false`.
*/
function arraySome(array, predicate) {
var index = -1,
length = array == null ? 0 : array.length;
while (++index < length) {
if (predicate(array[index], index, array)) {
return true;
}
}
return false;
}
/**
* Gets the size of an ASCII `string`.
*
* @private
* @param {string} string The string inspect.
* @returns {number} Returns the string size.
*/
var asciiSize = baseProperty('length');
/**
* Converts an ASCII `string` to an array.
*
* @private
* @param {string} string The string to convert.
* @returns {Array} Returns the converted array.
*/
function asciiToArray(string) {
return string.split('');
}
/**
* Splits an ASCII `string` into an array of its words.
*
* @private
* @param {string} The string to inspect.
* @returns {Array} Returns the words of `string`.
*/
function asciiWords(string) {
return string.match(reAsciiWord) || [];
}
/**
* The base implementation of methods like `_.findKey` and `_.findLastKey`,
* without support for iteratee shorthands, which iterates over `collection`
* using `eachFunc`.
*
* @private
* @param {Array|Object} collection The collection to inspect.
* @param {Function} predicate The function invoked per iteration.
* @param {Function} eachFunc The function to iterate over `collection`.
* @returns {*} Returns the found element or its key, else `undefined`.
*/
function baseFindKey(collection, predicate, eachFunc) {
var result;
eachFunc(collection, function(value, key, collection) {
if (predicate(value, key, collection)) {
result = key;
return false;
}
});
return result;
}
/**
* The base implementation of `_.findIndex` and `_.findLastIndex` without
* support for iteratee shorthands.
*
* @private
* @param {Array} array The array to inspect.
* @param {Function} predicate The function invoked per iteration.
* @param {number} fromIndex The index to search from.
* @param {boolean} [fromRight] Specify iterating from right to left.
* @returns {number} Returns the index of the matched value, else `-1`.
*/
function baseFindIndex(array, predicate, fromIndex, fromRight) {
var length = array.length,
index = fromIndex + (fromRight ? 1 : -1);
while ((fromRight ? index-- : ++index < length)) {
if (predicate(array[index], index, array)) {
return index;
}
}
return -1;
}
/**
* The base implementation of `_.indexOf` without `fromIndex` bounds checks.
*
* @private
* @param {Array} array The array to inspect.
* @param {*} value The value to search for.
* @param {number} fromIndex The index to search from.
* @returns {number} Returns the index of the matched value, else `-1`.
*/
function baseIndexOf(array, value, fromIndex) {
return value === value
? strictIndexOf(array, value, fromIndex)
: baseFindIndex(array, baseIsNaN, fromIndex);
}
/**
* This function is like `baseIndexOf` except that it accepts a comparator.
*
* @private
* @param {Array} array The array to inspect.
* @param {*} value The value to search for.
* @param {number} fromIndex The index to search from.
* @param {Function} comparator The comparator invoked per element.
* @returns {number} Returns the index of the matched value, else `-1`.
*/
function baseIndexOfWith(array, value, fromIndex, comparator) {
var index = fromIndex - 1,
length = array.length;
while (++index < length) {
if (comparator(array[index], value)) {
return index;
}
}
return -1;
}
/**
* The base implementation of `_.isNaN` without support for number objects.
*
* @private
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is `NaN`, else `false`.
*/
function baseIsNaN(value) {
return value !== value;
}
/**
* The base implementation of `_.mean` and `_.meanBy` without support for
* iteratee shorthands.
*
* @private
* @param {Array} array The array to iterate over.
* @param {Function} iteratee The function invoked per iteration.
* @returns {number} Returns the mean.
*/
function baseMean(array, iteratee) {
var length = array == null ? 0 : array.length;
return length ? (baseSum(array, iteratee) / length) : NAN;
}
/**
* The base implementation of `_.property` without support for deep paths.
*
* @private
* @param {string} key The key of the property to get.
* @returns {Function} Returns the new accessor function.
*/
function baseProperty(key) {
return function(object) {
return object == null ? undefined : object[key];
};
}
/**
* The base implementation of `_.propertyOf` without support for deep paths.
*
* @private
* @param {Object} object The object to query.
* @returns {Function} Returns the new accessor function.
*/
function basePropertyOf(object) {
return function(key) {
return object == null ? undefined : object[key];
};
}
/**
* The base implementation of `_.reduce` and `_.reduceRight`, without support
* for iteratee shorthands, which iterates over `collection` using `eachFunc`.
*
* @private
* @param {Array|Object} collection The collection to iterate over.
* @param {Function} iteratee The function invoked per iteration.
* @param {*} accumulator The initial value.
* @param {boolean} initAccum Specify using the first or last element of
* `collection` as the initial value.
* @param {Function} eachFunc The function to iterate over `collection`.
* @returns {*} Returns the accumulated value.
*/
function baseReduce(collection, iteratee, accumulator, initAccum, eachFunc) {
eachFunc(collection, function(value, index, collection) {
accumulator = initAccum
? (initAccum = false, value)
: iteratee(accumulator, value, index, collection);
});
return accumulator;
}
/**
* The base implementation of `_.sortBy` which uses `comparer` to define the
* sort order of `array` and replaces criteria objects with their corresponding
* values.
*
* @private
* @param {Array} array The array to sort.
* @param {Function} comparer The function to define sort order.
* @returns {Array} Returns `array`.
*/
function baseSortBy(array, comparer) {
var length = array.length;
array.sort(comparer);
while (length--) {
array[length] = array[length].value;
}
return array;
}
/**
* The base implementation of `_.sum` and `_.sumBy` without support for
* iteratee shorthands.
*
* @private
* @param {Array} array The array to iterate over.
* @param {Function} iteratee The function invoked per iteration.
* @returns {number} Returns the sum.
*/
function baseSum(array, iteratee) {
var result,
index = -1,
length = array.length;
while (++index < length) {
var current = iteratee(array[index]);
if (current !== undefined) {
result = result === undefined ? current : (result + current);
}
}
return result;
}
/**
* The base implementation of `_.times` without support for iteratee shorthands
* or max array length checks.
*
* @private
* @param {number} n The number of times to invoke `iteratee`.
* @param {Function} iteratee The function invoked per iteration.
* @returns {Array} Returns the array of results.
*/
function baseTimes(n, iteratee) {
var index = -1,
result = Array(n);
while (++index < n) {
result[index] = iteratee(index);
}
return result;
}
/**
* The base implementation of `_.toPairs` and `_.toPairsIn` which creates an array
* of key-value pairs for `object` corresponding to the property names of `props`.
*
* @private
* @param {Object} object The object to query.
* @param {Array} props The property names to get values for.
* @returns {Object} Returns the key-value pairs.
*/
function baseToPairs(object, props) {
return arrayMap(props, function(key) {
return [key, object[key]];
});
}
/**
* The base implementation of `_.unary` without support for storing metadata.
*
* @private
* @param {Function} func The function to cap arguments for.
* @returns {Function} Returns the new capped function.
*/
function baseUnary(func) {
return function(value) {
return func(value);
};
}
/**
* The base implementation of `_.values` and `_.valuesIn` which creates an
* array of `object` property values corresponding to the property names
* of `props`.
*
* @private
* @param {Object} object The object to query.
* @param {Array} props The property names to get values for.
* @returns {Object} Returns the array of property values.
*/
function baseValues(object, props) {
return arrayMap(props, function(key) {
return object[key];
});
}
/**
* Checks if a `cache` value for `key` exists.
*
* @private
* @param {Object} cache The cache to query.
* @param {string} key The key of the entry to check.
* @returns {boolean} Returns `true` if an entry for `key` exists, else `false`.
*/
function cacheHas(cache, key) {
return cache.has(key);
}
/**
* Used by `_.trim` and `_.trimStart` to get the index of the first string symbol
* that is not found in the character symbols.
*
* @private
* @param {Array} strSymbols The string symbols to inspect.
* @param {Array} chrSymbols The character symbols to find.
* @returns {number} Returns the index of the first unmatched string symbol.
*/
function charsStartIndex(strSymbols, chrSymbols) {
var index = -1,
length = strSymbols.length;
while (++index < length && baseIndexOf(chrSymbols, strSymbols[index], 0) > -1) {}
return index;
}
/**
* Used by `_.trim` and `_.trimEnd` to get the index of the last string symbol
* that is not found in the character symbols.
*
* @private
* @param {Array} strSymbols The string symbols to inspect.
* @param {Array} chrSymbols The character symbols to find.
* @returns {number} Returns the index of the last unmatched string symbol.
*/
function charsEndIndex(strSymbols, chrSymbols) {
var index = strSymbols.length;
while (index-- && baseIndexOf(chrSymbols, strSymbols[index], 0) > -1) {}
return index;
}
/**
* Gets the number of `placeholder` occurrences in `array`.
*
* @private
* @param {Array} array The array to inspect.
* @param {*} placeholder The placeholder to search for.
* @returns {number} Returns the placeholder count.
*/
function countHolders(array, placeholder) {
var length = array.length,
result = 0;
while (length--) {
if (array[length] === placeholder) {
++result;
}
}
return result;
}
/**
* Used by `_.deburr` to convert Latin-1 Supplement and Latin Extended-A
* letters to basic Latin letters.
*
* @private
* @param {string} letter The matched letter to deburr.
* @returns {string} Returns the deburred letter.
*/
var deburrLetter = basePropertyOf(deburredLetters);
/**
* Used by `_.escape` to convert characters to HTML entities.
*
* @private
* @param {string} chr The matched character to escape.
* @returns {string} Returns the escaped character.
*/
var escapeHtmlChar = basePropertyOf(htmlEscapes);
/**
* Used by `_.template` to escape characters for inclusion in compiled string literals.
*
* @private
* @param {string} chr The matched character to escape.
* @returns {string} Returns the escaped character.
*/
function escapeStringChar(chr) {
return '\\' + stringEscapes[chr];
}
/**
* Gets the value at `key` of `object`.
*
* @private
* @param {Object} [object] The object to query.
* @param {string} key The key of the property to get.
* @returns {*} Returns the property value.
*/
function getValue(object, key) {
return object == null ? undefined : object[key];
}
/**
* Checks if `string` contains Unicode symbols.
*
* @private
* @param {string} string The string to inspect.
* @returns {boolean} Returns `true` if a symbol is found, else `false`.
*/
function hasUnicode(string) {
return reHasUnicode.test(string);
}
/**
* Checks if `string` contains a word composed of Unicode symbols.
*
* @private
* @param {string} string The string to inspect.
* @returns {boolean} Returns `true` if a word is found, else `false`.
*/
function hasUnicodeWord(string) {
return reHasUnicodeWord.test(string);
}
/**
* Converts `iterator` to an array.
*
* @private
* @param {Object} iterator The iterator to convert.
* @returns {Array} Returns the converted array.
*/
function iteratorToArray(iterator) {
var data,
result = [];
while (!(data = iterator.next()).done) {
result.push(data.value);
}
return result;
}
/**
* Converts `map` to its key-value pairs.
*
* @private
* @param {Object} map The map to convert.
* @returns {Array} Returns the key-value pairs.
*/
function mapToArray(map) {
var index = -1,
result = Array(map.size);
map.forEach(function(value, key) {
result[++index] = [key, value];
});
return result;
}
/**
* Creates a unary function that invokes `func` with its argument transformed.
*
* @private
* @param {Function} func The function to wrap.
* @param {Function} transform The argument transform.
* @returns {Function} Returns the new function.
*/
function overArg(func, transform) {
return function(arg) {
return func(transform(arg));
};
}
/**
* Replaces all `placeholder` elements in `array` with an internal placeholder
* and returns an array of their indexes.
*
* @private
* @param {Array} array The array to modify.
* @param {*} placeholder The placeholder to replace.
* @returns {Array} Returns the new array of placeholder indexes.
*/
function replaceHolders(array, placeholder) {
var index = -1,
length = array.length,
resIndex = 0,
result = [];
while (++index < length) {
var value = array[index];
if (value === placeholder || value === PLACEHOLDER) {
array[index] = PLACEHOLDER;
result[resIndex++] = index;
}
}
return result;
}
/**
* Converts `set` to an array of its values.
*
* @private
* @param {Object} set The set to convert.
* @returns {Array} Returns the values.
*/
function setToArray(set) {
var index = -1,
result = Array(set.size);
set.forEach(function(value) {
result[++index] = value;
});
return result;
}
/**
* Converts `set` to its value-value pairs.
*
* @private
* @param {Object} set The set to convert.
* @returns {Array} Returns the value-value pairs.
*/
function setToPairs(set) {
var index = -1,
result = Array(set.size);
set.forEach(function(value) {
result[++index] = [value, value];
});
return result;
}
/**
* A specialized version of `_.indexOf` which performs strict equality
* comparisons of values, i.e. `===`.
*
* @private
* @param {Array} array The array to inspect.
* @param {*} value The value to search for.
* @param {number} fromIndex The index to search from.
* @returns {number} Returns the index of the matched value, else `-1`.
*/
function strictIndexOf(array, value, fromIndex) {
var index = fromIndex - 1,
length = array.length;
while (++index < length) {
if (array[index] === value) {
return index;
}
}
return -1;
}
/**
* A specialized version of `_.lastIndexOf` which performs strict equality
* comparisons of values, i.e. `===`.
*
* @private
* @param {Array} array The array to inspect.
* @param {*} value The value to search for.
* @param {number} fromIndex The index to search from.
* @returns {number} Returns the index of the matched value, else `-1`.
*/
function strictLastIndexOf(array, value, fromIndex) {
var index = fromIndex + 1;
while (index--) {
if (array[index] === value) {
return index;
}
}
return index;
}
/**
* Gets the number of symbols in `string`.
*
* @private
* @param {string} string The string to inspect.
* @returns {number} Returns the string size.
*/
function stringSize(string) {
return hasUnicode(string)
? unicodeSize(string)
: asciiSize(string);
}
/**
* Converts `string` to an array.
*
* @private
* @param {string} string The string to convert.
* @returns {Array} Returns the converted array.
*/
function stringToArray(string) {
return hasUnicode(string)
? unicodeToArray(string)
: asciiToArray(string);
}
/**
* Used by `_.unescape` to convert HTML entities to characters.
*
* @private
* @param {string} chr The matched character to unescape.
* @returns {string} Returns the unescaped character.
*/
var unescapeHtmlChar = basePropertyOf(htmlUnescapes);
/**
* Gets the size of a Unicode `string`.
*
* @private
* @param {string} string The string inspect.
* @returns {number} Returns the string size.
*/
function unicodeSize(string) {
var result = reUnicode.lastIndex = 0;
while (reUnicode.test(string)) {
++result;
}
return result;
}
/**
* Converts a Unicode `string` to an array.
*
* @private
* @param {string} string The string to convert.
* @returns {Array} Returns the converted array.
*/
function unicodeToArray(string) {
return string.match(reUnicode) || [];
}
/**
* Splits a Unicode `string` into an array of its words.
*
* @private
* @param {string} The string to inspect.
* @returns {Array} Returns the words of `string`.
*/
function unicodeWords(string) {
return string.match(reUnicodeWord) || [];
}
/*--------------------------------------------------------------------------*/
/**
* Create a new pristine `lodash` function using the `context` object.
*
* @static
* @memberOf _
* @since 1.1.0
* @category Util
* @param {Object} [context=root] The context object.
* @returns {Function} Returns a new `lodash` function.
* @example
*
* _.mixin({ 'foo': _.constant('foo') });
*
* var lodash = _.runInContext();
* lodash.mixin({ 'bar': lodash.constant('bar') });
*
* _.isFunction(_.foo);
* // => true
* _.isFunction(_.bar);
* // => false
*
* lodash.isFunction(lodash.foo);
* // => false
* lodash.isFunction(lodash.bar);
* // => true
*
* // Create a suped-up `defer` in Node.js.
* var defer = _.runInContext({ 'setTimeout': setImmediate }).defer;
*/
var runInContext = (function runInContext(context) {
context = context == null ? root : _.defaults(root.Object(), context, _.pick(root, contextProps));
/** Built-in constructor references. */
var Array = context.Array,
Date = context.Date,
Error = context.Error,
Function = context.Function,
Math = context.Math,
Object = context.Object,
RegExp = context.RegExp,
String = context.String,
TypeError = context.TypeError;
/** Used for built-in method references. */
var arrayProto = Array.prototype,
funcProto = Function.prototype,
objectProto = Object.prototype;
/** Used to detect overreaching core-js shims. */
var coreJsData = context['__core-js_shared__'];
/** Used to resolve the decompiled source of functions. */
var funcToString = funcProto.toString;
/** Used to check objects for own properties. */
var hasOwnProperty = objectProto.hasOwnProperty;
/** Used to generate unique IDs. */
var idCounter = 0;
/** Used to detect methods masquerading as native. */
var maskSrcKey = (function() {
var uid = /[^.]+$/.exec(coreJsData && coreJsData.keys && coreJsData.keys.IE_PROTO || '');
return uid ? ('Symbol(src)_1.' + uid) : '';
}());
/**
* Used to resolve the
* [`toStringTag`](http://ecma-international.org/ecma-262/7.0/#sec-object.prototype.tostring)
* of values.
*/
var nativeObjectToString = objectProto.toString;
/** Used to infer the `Object` constructor. */
var objectCtorString = funcToString.call(Object);
/** Used to restore the original `_` reference in `_.noConflict`. */
var oldDash = root._;
/** Used to detect if a method is native. */
var reIsNative = RegExp('^' +
funcToString.call(hasOwnProperty).replace(reRegExpChar, '\\$&')
.replace(/hasOwnProperty|(function).*?(?=\\\()| for .+?(?=\\\])/g, '$1.*?') + '$'
);
/** Built-in value references. */
var Buffer = moduleExports ? context.Buffer : undefined,
Symbol = context.Symbol,
Uint8Array = context.Uint8Array,
allocUnsafe = Buffer ? Buffer.allocUnsafe : undefined,
getPrototype = overArg(Object.getPrototypeOf, Object),
objectCreate = Object.create,
propertyIsEnumerable = objectProto.propertyIsEnumerable,
splice = arrayProto.splice,
spreadableSymbol = Symbol ? Symbol.isConcatSpreadable : undefined,
symIterator = Symbol ? Symbol.iterator : undefined,
symToStringTag = Symbol ? Symbol.toStringTag : undefined;
var defineProperty = (function() {
try {
var func = getNative(Object, 'defineProperty');
func({}, '', {});
return func;
} catch (e) {}
}());
/** Mocked built-ins. */
var ctxClearTimeout = context.clearTimeout !== root.clearTimeout && context.clearTimeout,
ctxNow = Date && Date.now !== root.Date.now && Date.now,
ctxSetTimeout = context.setTimeout !== root.setTimeout && context.setTimeout;
/* Built-in method references for those with the same name as other `lodash` methods. */
var nativeCeil = Math.ceil,
nativeFloor = Math.floor,
nativeGetSymbols = Object.getOwnPropertySymbols,
nativeIsBuffer = Buffer ? Buffer.isBuffer : undefined,
nativeIsFinite = context.isFinite,
nativeJoin = arrayProto.join,
nativeKeys = overArg(Object.keys, Object),
nativeMax = Math.max,
nativeMin = Math.min,
nativeNow = Date.now,
nativeParseInt = context.parseInt,
nativeRandom = Math.random,
nativeReverse = arrayProto.reverse;
/* Built-in method references that are verified to be native. */
var DataView = getNative(context, 'DataView'),
Map = getNative(context, 'Map'),
Promise = getNative(context, 'Promise'),
Set = getNative(context, 'Set'),
WeakMap = getNative(context, 'WeakMap'),
nativeCreate = getNative(Object, 'create');
/** Used to store function metadata. */
var metaMap = WeakMap && new WeakMap;
/** Used to lookup unminified function names. */
var realNames = {};
/** Used to detect maps, sets, and weakmaps. */
var dataViewCtorString = toSource(DataView),
mapCtorString = toSource(Map),
promiseCtorString = toSource(Promise),
setCtorString = toSource(Set),
weakMapCtorString = toSource(WeakMap);
/** Used to convert symbols to primitives and strings. */
var symbolProto = Symbol ? Symbol.prototype : undefined,
symbolValueOf = symbolProto ? symbolProto.valueOf : undefined,
symbolToString = symbolProto ? symbolProto.toString : undefined;
/*------------------------------------------------------------------------*/
/**
* Creates a `lodash` object which wraps `value` to enable implicit method
* chain sequences. Methods that operate on and return arrays, collections,
* and functions can be chained together. Methods that retrieve a single value
* or may return a primitive value will automatically end the chain sequence
* and return the unwrapped value. Otherwise, the value must be unwrapped
* with `_#value`.
*
* Explicit chain sequences, which must be unwrapped with `_#value`, may be
* enabled using `_.chain`.
*
* The execution of chained methods is lazy, that is, it's deferred until
* `_#value` is implicitly or explicitly called.
*
* Lazy evaluation allows several methods to support shortcut fusion.
* Shortcut fusion is an optimization to merge iteratee calls; this avoids
* the creation of intermediate arrays and can greatly reduce the number of
* iteratee executions. Sections of a chain sequence qualify for shortcut
* fusion if the section is applied to an array and iteratees accept only
* one argument. The heuristic for whether a section qualifies for shortcut
* fusion is subject to change.
*
* Chaining is supported in custom builds as long as the `_#value` method is
* directly or indirectly included in the build.
*
* In addition to lodash methods, wrappers have `Array` and `String` methods.
*
* The wrapper `Array` methods are:
* `concat`, `join`, `pop`, `push`, `shift`, `sort`, `splice`, and `unshift`
*
* The wrapper `String` methods are:
* `replace` and `split`
*
* The wrapper methods that support shortcut fusion are:
* `at`, `compact`, `drop`, `dropRight`, `dropWhile`, `filter`, `find`,
* `findLast`, `head`, `initial`, `last`, `map`, `reject`, `reverse`, `slice`,
* `tail`, `take`, `takeRight`, `takeRightWhile`, `takeWhile`, and `toArray`
*
* The chainable wrapper methods are:
* `after`, `ary`, `assign`, `assignIn`, `assignInWith`, `assignWith`, `at`,
* `before`, `bind`, `bindAll`, `bindKey`, `castArray`, `chain`, `chunk`,
* `commit`, `compact`, `concat`, `conforms`, `constant`, `countBy`, `create`,
* `curry`, `debounce`, `defaults`, `defaultsDeep`, `defer`, `delay`,
* `difference`, `differenceBy`, `differenceWith`, `drop`, `dropRight`,
* `dropRightWhile`, `dropWhile`, `extend`, `extendWith`, `fill`, `filter`,
* `flatMap`, `flatMapDeep`, `flatMapDepth`, `flatten`, `flattenDeep`,
* `flattenDepth`, `flip`, `flow`, `flowRight`, `fromPairs`, `functions`,
* `functionsIn`, `groupBy`, `initial`, `intersection`, `intersectionBy`,
* `intersectionWith`, `invert`, `invertBy`, `invokeMap`, `iteratee`, `keyBy`,
* `keys`, `keysIn`, `map`, `mapKeys`, `mapValues`, `matches`, `matchesProperty`,
* `memoize`, `merge`, `mergeWith`, `method`, `methodOf`, `mixin`, `negate`,
* `nthArg`, `omit`, `omitBy`, `once`, `orderBy`, `over`, `overArgs`,
* `overEvery`, `overSome`, `partial`, `partialRight`, `partition`, `pick`,
* `pickBy`, `plant`, `property`, `propertyOf`, `pull`, `pullAll`, `pullAllBy`,
* `pullAllWith`, `pullAt`, `push`, `range`, `rangeRight`, `rearg`, `reject`,
* `remove`, `rest`, `reverse`, `sampleSize`, `set`, `setWith`, `shuffle`,
* `slice`, `sort`, `sortBy`, `splice`, `spread`, `tail`, `take`, `takeRight`,
* `takeRightWhile`, `takeWhile`, `tap`, `throttle`, `thru`, `toArray`,
* `toPairs`, `toPairsIn`, `toPath`, `toPlainObject`, `transform`, `unary`,
* `union`, `unionBy`, `unionWith`, `uniq`, `uniqBy`, `uniqWith`, `unset`,
* `unshift`, `unzip`, `unzipWith`, `update`, `updateWith`, `values`,
* `valuesIn`, `without`, `wrap`, `xor`, `xorBy`, `xorWith`, `zip`,
* `zipObject`, `zipObjectDeep`, and `zipWith`
*
* The wrapper methods that are **not** chainable by default are:
* `add`, `attempt`, `camelCase`, `capitalize`, `ceil`, `clamp`, `clone`,
* `cloneDeep`, `cloneDeepWith`, `cloneWith`, `conformsTo`, `deburr`,
* `defaultTo`, `divide`, `each`, `eachRight`, `endsWith`, `eq`, `escape`,
* `escapeRegExp`, `every`, `find`, `findIndex`, `findKey`, `findLast`,
* `findLastIndex`, `findLastKey`, `first`, `floor`, `forEach`, `forEachRight`,
* `forIn`, `forInRight`, `forOwn`, `forOwnRight`, `get`, `gt`, `gte`, `has`,
* `hasIn`, `head`, `identity`, `includes`, `indexOf`, `inRange`, `invoke`,
* `isArguments`, `isArray`, `isArrayBuffer`, `isArrayLike`, `isArrayLikeObject`,
* `isBoolean`, `isBuffer`, `isDate`, `isElement`, `isEmpty`, `isEqual`,
* `isEqualWith`, `isError`, `isFinite`, `isFunction`, `isInteger`, `isLength`,
* `isMap`, `isMatch`, `isMatchWith`, `isNaN`, `isNative`, `isNil`, `isNull`,
* `isNumber`, `isObject`, `isObjectLike`, `isPlainObject`, `isRegExp`,
* `isSafeInteger`, `isSet`, `isString`, `isUndefined`, `isTypedArray`,
* `isWeakMap`, `isWeakSet`, `join`, `kebabCase`, `last`, `lastIndexOf`,
* `lowerCase`, `lowerFirst`, `lt`, `lte`, `max`, `maxBy`, `mean`, `meanBy`,
* `min`, `minBy`, `multiply`, `noConflict`, `noop`, `now`, `nth`, `pad`,
* `padEnd`, `padStart`, `parseInt`, `pop`, `random`, `reduce`, `reduceRight`,
* `repeat`, `result`, `round`, `runInContext`, `sample`, `shift`, `size`,
* `snakeCase`, `some`, `sortedIndex`, `sortedIndexBy`, `sortedLastIndex`,
* `sortedLastIndexBy`, `startCase`, `startsWith`, `stubArray`, `stubFalse`,
* `stubObject`, `stubString`, `stubTrue`, `subtract`, `sum`, `sumBy`,
* `template`, `times`, `toFinite`, `toInteger`, `toJSON`, `toLength`,
* `toLower`, `toNumber`, `toSafeInteger`, `toString`, `toUpper`, `trim`,
* `trimEnd`, `trimStart`, `truncate`, `unescape`, `uniqueId`, `upperCase`,
* `upperFirst`, `value`, and `words`
*
* @name _
* @constructor
* @category Seq
* @param {*} value The value to wrap in a `lodash` instance.
* @returns {Object} Returns the new `lodash` wrapper instance.
* @example
*
* function square(n) {
* return n * n;
* }
*
* var wrapped = _([1, 2, 3]);
*
* // Returns an unwrapped value.
* wrapped.reduce(_.add);
* // => 6
*
* // Returns a wrapped value.
* var squares = wrapped.map(square);
*
* _.isArray(squares);
* // => false
*
* _.isArray(squares.value());
* // => true
*/
function lodash(value) {
if (isObjectLike(value) && !isArray(value) && !(value instanceof LazyWrapper)) {
if (value instanceof LodashWrapper) {
return value;
}
if (hasOwnProperty.call(value, '__wrapped__')) {
return wrapperClone(value);
}
}
return new LodashWrapper(value);
}
/**
* The base implementation of `_.create` without support for assigning
* properties to the created object.
*
* @private
* @param {Object} proto The object to inherit from.
* @returns {Object} Returns the new object.
*/
var baseCreate = (function() {
function object() {}
return function(proto) {
if (!isObject(proto)) {
return {};
}
if (objectCreate) {
return objectCreate(proto);
}
object.prototype = proto;
var result = new object;
object.prototype = undefined;
return result;
};
}());
/**
* The function whose prototype chain sequence wrappers inherit from.
*
* @private
*/
function baseLodash() {
// No operation performed.
}
/**
* The base constructor for creating `lodash` wrapper objects.
*
* @private
* @param {*} value The value to wrap.
* @param {boolean} [chainAll] Enable explicit method chain sequences.
*/
function LodashWrapper(value, chainAll) {
this.__wrapped__ = value;
this.__actions__ = [];
this.__chain__ = !!chainAll;
this.__index__ = 0;
this.__values__ = undefined;
}
/**
* By default, the template delimiters used by lodash are like those in
* embedded Ruby (ERB) as well as ES2015 template strings. Change the
* following template settings to use alternative delimiters.
*
* @static
* @memberOf _
* @type {Object}
*/
lodash.templateSettings = {
/**
* Used to detect `data` property values to be HTML-escaped.
*
* @memberOf _.templateSettings
* @type {RegExp}
*/
'escape': reEscape,
/**
* Used to detect code to be evaluated.
*
* @memberOf _.templateSettings
* @type {RegExp}
*/
'evaluate': reEvaluate,
/**
* Used to detect `data` property values to inject.
*
* @memberOf _.templateSettings
* @type {RegExp}
*/
'interpolate': reInterpolate,
/**
* Used to reference the data object in the template text.
*
* @memberOf _.templateSettings
* @type {string}
*/
'variable': '',
/**
* Used to import variables into the compiled template.
*
* @memberOf _.templateSettings
* @type {Object}
*/
'imports': {
/**
* A reference to the `lodash` function.
*
* @memberOf _.templateSettings.imports
* @type {Function}
*/
'_': lodash
}
};
// Ensure wrappers are instances of `baseLodash`.
lodash.prototype = baseLodash.prototype;
lodash.prototype.constructor = lodash;
LodashWrapper.prototype = baseCreate(baseLodash.prototype);
LodashWrapper.prototype.constructor = LodashWrapper;
/*------------------------------------------------------------------------*/
/**
* Creates a lazy wrapper object which wraps `value` to enable lazy evaluation.
*
* @private
* @constructor
* @param {*} value The value to wrap.
*/
function LazyWrapper(value) {
this.__wrapped__ = value;
this.__actions__ = [];
this.__dir__ = 1;
this.__filtered__ = false;
this.__iteratees__ = [];
this.__takeCount__ = MAX_ARRAY_LENGTH;
this.__views__ = [];
}
/**
* Creates a clone of the lazy wrapper object.
*
* @private
* @name clone
* @memberOf LazyWrapper
* @returns {Object} Returns the cloned `LazyWrapper` object.
*/
function lazyClone() {
var result = new LazyWrapper(this.__wrapped__);
result.__actions__ = copyArray(this.__actions__);
result.__dir__ = this.__dir__;
result.__filtered__ = this.__filtered__;
result.__iteratees__ = copyArray(this.__iteratees__);
result.__takeCount__ = this.__takeCount__;
result.__views__ = copyArray(this.__views__);
return result;
}
/**
* Reverses the direction of lazy iteration.
*
* @private
* @name reverse
* @memberOf LazyWrapper
* @returns {Object} Returns the new reversed `LazyWrapper` object.
*/
function lazyReverse() {
if (this.__filtered__) {
var result = new LazyWrapper(this);
result.__dir__ = -1;
result.__filtered__ = true;
} else {
result = this.clone();
result.__dir__ *= -1;
}
return result;
}
/**
* Extracts the unwrapped value from its lazy wrapper.
*
* @private
* @name value
* @memberOf LazyWrapper
* @returns {*} Returns the unwrapped value.
*/
function lazyValue() {
var array = this.__wrapped__.value(),
dir = this.__dir__,
isArr = isArray(array),
isRight = dir < 0,
arrLength = isArr ? array.length : 0,
view = getView(0, arrLength, this.__views__),
start = view.start,
end = view.end,
length = end - start,
index = isRight ? end : (start - 1),
iteratees = this.__iteratees__,
iterLength = iteratees.length,
resIndex = 0,
takeCount = nativeMin(length, this.__takeCount__);
if (!isArr || (!isRight && arrLength == length && takeCount == length)) {
return baseWrapperValue(array, this.__actions__);
}
var result = [];
outer:
while (length-- && resIndex < takeCount) {
index += dir;
var iterIndex = -1,
value = array[index];
while (++iterIndex < iterLength) {
var data = iteratees[iterIndex],
iteratee = data.iteratee,
type = data.type,
computed = iteratee(value);
if (type == LAZY_MAP_FLAG) {
value = computed;
} else if (!computed) {
if (type == LAZY_FILTER_FLAG) {
continue outer;
} else {
break outer;
}
}
}
result[resIndex++] = value;
}
return result;
}
// Ensure `LazyWrapper` is an instance of `baseLodash`.
LazyWrapper.prototype = baseCreate(baseLodash.prototype);
LazyWrapper.prototype.constructor = LazyWrapper;
/*------------------------------------------------------------------------*/
/**
* Creates a hash object.
*
* @private
* @constructor
* @param {Array} [entries] The key-value pairs to cache.
*/
function Hash(entries) {
var index = -1,
length = entries == null ? 0 : entries.length;
this.clear();
while (++index < length) {
var entry = entries[index];
this.set(entry[0], entry[1]);
}
}
/**
* Removes all key-value entries from the hash.
*
* @private
* @name clear
* @memberOf Hash
*/
function hashClear() {
this.__data__ = nativeCreate ? nativeCreate(null) : {};
this.size = 0;
}
/**
* Removes `key` and its value from the hash.
*
* @private
* @name delete
* @memberOf Hash
* @param {Object} hash The hash to modify.
* @param {string} key The key of the value to remove.
* @returns {boolean} Returns `true` if the entry was removed, else `false`.
*/
function hashDelete(key) {
var result = this.has(key) && delete this.__data__[key];
this.size -= result ? 1 : 0;
return result;
}
/**
* Gets the hash value for `key`.
*
* @private
* @name get
* @memberOf Hash
* @param {string} key The key of the value to get.
* @returns {*} Returns the entry value.
*/
function hashGet(key) {
var data = this.__data__;
if (nativeCreate) {
var result = data[key];
return result === HASH_UNDEFINED ? undefined : result;
}
return hasOwnProperty.call(data, key) ? data[key] : undefined;
}
/**
* Checks if a hash value for `key` exists.
*
* @private
* @name has
* @memberOf Hash
* @param {string} key The key of the entry to check.
* @returns {boolean} Returns `true` if an entry for `key` exists, else `false`.
*/
function hashHas(key) {
var data = this.__data__;
return nativeCreate ? (data[key] !== undefined) : hasOwnProperty.call(data, key);
}
/**
* Sets the hash `key` to `value`.
*
* @private
* @name set
* @memberOf Hash
* @param {string} key The key of the value to set.
* @param {*} value The value to set.
* @returns {Object} Returns the hash instance.
*/
function hashSet(key, value) {
var data = this.__data__;
this.size += this.has(key) ? 0 : 1;
data[key] = (nativeCreate && value === undefined) ? HASH_UNDEFINED : value;
return this;
}
// Add methods to `Hash`.
Hash.prototype.clear = hashClear;
Hash.prototype['delete'] = hashDelete;
Hash.prototype.get = hashGet;
Hash.prototype.has = hashHas;
Hash.prototype.set = hashSet;
/*------------------------------------------------------------------------*/
/**
* Creates an list cache object.
*
* @private
* @constructor
* @param {Array} [entries] The key-value pairs to cache.
*/
function ListCache(entries) {
var index = -1,
length = entries == null ? 0 : entries.length;
this.clear();
while (++index < length) {
var entry = entries[index];
this.set(entry[0], entry[1]);
}
}
/**
* Removes all key-value entries from the list cache.
*
* @private
* @name clear
* @memberOf ListCache
*/
function listCacheClear() {
this.__data__ = [];
this.size = 0;
}
/**
* Removes `key` and its value from the list cache.
*
* @private
* @name delete
* @memberOf ListCache
* @param {string} key The key of the value to remove.
* @returns {boolean} Returns `true` if the entry was removed, else `false`.
*/
function listCacheDelete(key) {
var data = this.__data__,
index = assocIndexOf(data, key);
if (index < 0) {
return false;
}
var lastIndex = data.length - 1;
if (index == lastIndex) {
data.pop();
} else {
splice.call(data, index, 1);
}
--this.size;
return true;
}
/**
* Gets the list cache value for `key`.
*
* @private
* @name get
* @memberOf ListCache
* @param {string} key The key of the value to get.
* @returns {*} Returns the entry value.
*/
function listCacheGet(key) {
var data = this.__data__,
index = assocIndexOf(data, key);
return index < 0 ? undefined : data[index][1];
}
/**
* Checks if a list cache value for `key` exists.
*
* @private
* @name has
* @memberOf ListCache
* @param {string} key The key of the entry to check.
* @returns {boolean} Returns `true` if an entry for `key` exists, else `false`.
*/
function listCacheHas(key) {
return assocIndexOf(this.__data__, key) > -1;
}
/**
* Sets the list cache `key` to `value`.
*
* @private
* @name set
* @memberOf ListCache
* @param {string} key The key of the value to set.
* @param {*} value The value to set.
* @returns {Object} Returns the list cache instance.
*/
function listCacheSet(key, value) {
var data = this.__data__,
index = assocIndexOf(data, key);
if (index < 0) {
++this.size;
data.push([key, value]);
} else {
data[index][1] = value;
}
return this;
}
// Add methods to `ListCache`.
ListCache.prototype.clear = listCacheClear;
ListCache.prototype['delete'] = listCacheDelete;
ListCache.prototype.get = listCacheGet;
ListCache.prototype.has = listCacheHas;
ListCache.prototype.set = listCacheSet;
/*------------------------------------------------------------------------*/
/**
* Creates a map cache object to store key-value pairs.
*
* @private
* @constructor
* @param {Array} [entries] The key-value pairs to cache.
*/
function MapCache(entries) {
var index = -1,
length = entries == null ? 0 : entries.length;
this.clear();
while (++index < length) {
var entry = entries[index];
this.set(entry[0], entry[1]);
}
}
/**
* Removes all key-value entries from the map.
*
* @private
* @name clear
* @memberOf MapCache
*/
function mapCacheClear() {
this.size = 0;
this.__data__ = {
'hash': new Hash,
'map': new (Map || ListCache),
'string': new Hash
};
}
/**
* Removes `key` and its value from the map.
*
* @private
* @name delete
* @memberOf MapCache
* @param {string} key The key of the value to remove.
* @returns {boolean} Returns `true` if the entry was removed, else `false`.
*/
function mapCacheDelete(key) {
var result = getMapData(this, key)['delete'](key);
this.size -= result ? 1 : 0;
return result;
}
/**
* Gets the map value for `key`.
*
* @private
* @name get
* @memberOf MapCache
* @param {string} key The key of the value to get.
* @returns {*} Returns the entry value.
*/
function mapCacheGet(key) {
return getMapData(this, key).get(key);
}
/**
* Checks if a map value for `key` exists.
*
* @private
* @name has
* @memberOf MapCache
* @param {string} key The key of the entry to check.
* @returns {boolean} Returns `true` if an entry for `key` exists, else `false`.
*/
function mapCacheHas(key) {
return getMapData(this, key).has(key);
}
/**
* Sets the map `key` to `value`.
*
* @private
* @name set
* @memberOf MapCache
* @param {string} key The key of the value to set.
* @param {*} value The value to set.
* @returns {Object} Returns the map cache instance.
*/
function mapCacheSet(key, value) {
var data = getMapData(this, key),
size = data.size;
data.set(key, value);
this.size += data.size == size ? 0 : 1;
return this;
}
// Add methods to `MapCache`.
MapCache.prototype.clear = mapCacheClear;
MapCache.prototype['delete'] = mapCacheDelete;
MapCache.prototype.get = mapCacheGet;
MapCache.prototype.has = mapCacheHas;
MapCache.prototype.set = mapCacheSet;
/*------------------------------------------------------------------------*/
/**
*
* Creates an array cache object to store unique values.
*
* @private
* @constructor
* @param {Array} [values] The values to cache.
*/
function SetCache(values) {
var index = -1,
length = values == null ? 0 : values.length;
this.__data__ = new MapCache;
while (++index < length) {
this.add(values[index]);
}
}
/**
* Adds `value` to the array cache.
*
* @private
* @name add
* @memberOf SetCache
* @alias push
* @param {*} value The value to cache.
* @returns {Object} Returns the cache instance.
*/
function setCacheAdd(value) {
this.__data__.set(value, HASH_UNDEFINED);
return this;
}
/**
* Checks if `value` is in the array cache.
*
* @private
* @name has
* @memberOf SetCache
* @param {*} value The value to search for.
* @returns {number} Returns `true` if `value` is found, else `false`.
*/
function setCacheHas(value) {
return this.__data__.has(value);
}
// Add methods to `SetCache`.
SetCache.prototype.add = SetCache.prototype.push = setCacheAdd;
SetCache.prototype.has = setCacheHas;
/*------------------------------------------------------------------------*/
/**
* Creates a stack cache object to store key-value pairs.
*
* @private
* @constructor
* @param {Array} [entries] The key-value pairs to cache.
*/
function Stack(entries) {
var data = this.__data__ = new ListCache(entries);
this.size = data.size;
}
/**
* Removes all key-value entries from the stack.
*
* @private
* @name clear
* @memberOf Stack
*/
function stackClear() {
this.__data__ = new ListCache;
this.size = 0;
}
/**
* Removes `key` and its value from the stack.
*
* @private
* @name delete
* @memberOf Stack
* @param {string} key The key of the value to remove.
* @returns {boolean} Returns `true` if the entry was removed, else `false`.
*/
function stackDelete(key) {
var data = this.__data__,
result = data['delete'](key);
this.size = data.size;
return result;
}
/**
* Gets the stack value for `key`.
*
* @private
* @name get
* @memberOf Stack
* @param {string} key The key of the value to get.
* @returns {*} Returns the entry value.
*/
function stackGet(key) {
return this.__data__.get(key);
}
/**
* Checks if a stack value for `key` exists.
*
* @private
* @name has
* @memberOf Stack
* @param {string} key The key of the entry to check.
* @returns {boolean} Returns `true` if an entry for `key` exists, else `false`.
*/
function stackHas(key) {
return this.__data__.has(key);
}
/**
* Sets the stack `key` to `value`.
*
* @private
* @name set
* @memberOf Stack
* @param {string} key The key of the value to set.
* @param {*} value The value to set.
* @returns {Object} Returns the stack cache instance.
*/
function stackSet(key, value) {
var data = this.__data__;
if (data instanceof ListCache) {
var pairs = data.__data__;
if (!Map || (pairs.length < LARGE_ARRAY_SIZE - 1)) {
pairs.push([key, value]);
this.size = ++data.size;
return this;
}
data = this.__data__ = new MapCache(pairs);
}
data.set(key, value);
this.size = data.size;
return this;
}
// Add methods to `Stack`.
Stack.prototype.clear = stackClear;
Stack.prototype['delete'] = stackDelete;
Stack.prototype.get = stackGet;
Stack.prototype.has = stackHas;
Stack.prototype.set = stackSet;
/*------------------------------------------------------------------------*/
/**
* Creates an array of the enumerable property names of the array-like `value`.
*
* @private
* @param {*} value The value to query.
* @param {boolean} inherited Specify returning inherited property names.
* @returns {Array} Returns the array of property names.
*/
function arrayLikeKeys(value, inherited) {
var isArr = isArray(value),
isArg = !isArr && isArguments(value),
isBuff = !isArr && !isArg && isBuffer(value),
isType = !isArr && !isArg && !isBuff && isTypedArray(value),
skipIndexes = isArr || isArg || isBuff || isType,
result = skipIndexes ? baseTimes(value.length, String) : [],
length = result.length;
for (var key in value) {
if ((inherited || hasOwnProperty.call(value, key)) &&
!(skipIndexes && (
// Safari 9 has enumerable `arguments.length` in strict mode.
key == 'length' ||
// Node.js 0.10 has enumerable non-index properties on buffers.
(isBuff && (key == 'offset' || key == 'parent')) ||
// PhantomJS 2 has enumerable non-index properties on typed arrays.
(isType && (key == 'buffer' || key == 'byteLength' || key == 'byteOffset')) ||
// Skip index properties.
isIndex(key, length)
))) {
result.push(key);
}
}
return result;
}
/**
* A specialized version of `_.sample` for arrays.
*
* @private
* @param {Array} array The array to sample.
* @returns {*} Returns the random element.
*/
function arraySample(array) {
var length = array.length;
return length ? array[baseRandom(0, length - 1)] : undefined;
}
/**
* A specialized version of `_.sampleSize` for arrays.
*
* @private
* @param {Array} array The array to sample.
* @param {number} n The number of elements to sample.
* @returns {Array} Returns the random elements.
*/
function arraySampleSize(array, n) {
return shuffleSelf(copyArray(array), baseClamp(n, 0, array.length));
}
/**
* A specialized version of `_.shuffle` for arrays.
*
* @private
* @param {Array} array The array to shuffle.
* @returns {Array} Returns the new shuffled array.
*/
function arrayShuffle(array) {
return shuffleSelf(copyArray(array));
}
/**
* This function is like `assignValue` except that it doesn't assign
* `undefined` values.
*
* @private
* @param {Object} object The object to modify.
* @param {string} key The key of the property to assign.
* @param {*} value The value to assign.
*/
function assignMergeValue(object, key, value) {
if ((value !== undefined && !eq(object[key], value)) ||
(value === undefined && !(key in object))) {
baseAssignValue(object, key, value);
}
}
/**
* Assigns `value` to `key` of `object` if the existing value is not equivalent
* using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)
* for equality comparisons.
*
* @private
* @param {Object} object The object to modify.
* @param {string} key The key of the property to assign.
* @param {*} value The value to assign.
*/
function assignValue(object, key, value) {
var objValue = object[key];
if (!(hasOwnProperty.call(object, key) && eq(objValue, value)) ||
(value === undefined && !(key in object))) {
baseAssignValue(object, key, value);
}
}
/**
* Gets the index at which the `key` is found in `array` of key-value pairs.
*
* @private
* @param {Array} array The array to inspect.
* @param {*} key The key to search for.
* @returns {number} Returns the index of the matched value, else `-1`.
*/
function assocIndexOf(array, key) {
var length = array.length;
while (length--) {
if (eq(array[length][0], key)) {
return length;
}
}
return -1;
}
/**
* Aggregates elements of `collection` on `accumulator` with keys transformed
* by `iteratee` and values set by `setter`.
*
* @private
* @param {Array|Object} collection The collection to iterate over.
* @param {Function} setter The function to set `accumulator` values.
* @param {Function} iteratee The iteratee to transform keys.
* @param {Object} accumulator The initial aggregated object.
* @returns {Function} Returns `accumulator`.
*/
function baseAggregator(collection, setter, iteratee, accumulator) {
baseEach(collection, function(value, key, collection) {
setter(accumulator, value, iteratee(value), collection);
});
return accumulator;
}
/**
* The base implementation of `_.assign` without support for multiple sources
* or `customizer` functions.
*
* @private
* @param {Object} object The destination object.
* @param {Object} source The source object.
* @returns {Object} Returns `object`.
*/
function baseAssign(object, source) {
return object && copyObject(source, keys(source), object);
}
/**
* The base implementation of `_.assignIn` without support for multiple sources
* or `customizer` functions.
*
* @private
* @param {Object} object The destination object.
* @param {Object} source The source object.
* @returns {Object} Returns `object`.
*/
function baseAssignIn(object, source) {
return object && copyObject(source, keysIn(source), object);
}
/**
* The base implementation of `assignValue` and `assignMergeValue` without
* value checks.
*
* @private
* @param {Object} object The object to modify.
* @param {string} key The key of the property to assign.
* @param {*} value The value to assign.
*/
function baseAssignValue(object, key, value) {
if (key == '__proto__' && defineProperty) {
defineProperty(object, key, {
'configurable': true,
'enumerable': true,
'value': value,
'writable': true
});
} else {
object[key] = value;
}
}
/**
* The base implementation of `_.at` without support for individual paths.
*
* @private
* @param {Object} object The object to iterate over.
* @param {string[]} paths The property paths to pick.
* @returns {Array} Returns the picked elements.
*/
function baseAt(object, paths) {
var index = -1,
length = paths.length,
result = Array(length),
skip = object == null;
while (++index < length) {
result[index] = skip ? undefined : get(object, paths[index]);
}
return result;
}
/**
* The base implementation of `_.clamp` which doesn't coerce arguments.
*
* @private
* @param {number} number The number to clamp.
* @param {number} [lower] The lower bound.
* @param {number} upper The upper bound.
* @returns {number} Returns the clamped number.
*/
function baseClamp(number, lower, upper) {
if (number === number) {
if (upper !== undefined) {
number = number <= upper ? number : upper;
}
if (lower !== undefined) {
number = number >= lower ? number : lower;
}
}
return number;
}
/**
* The base implementation of `_.clone` and `_.cloneDeep` which tracks
* traversed objects.
*
* @private
* @param {*} value The value to clone.
* @param {boolean} bitmask The bitmask flags.
* 1 - Deep clone
* 2 - Flatten inherited properties
* 4 - Clone symbols
* @param {Function} [customizer] The function to customize cloning.
* @param {string} [key] The key of `value`.
* @param {Object} [object] The parent object of `value`.
* @param {Object} [stack] Tracks traversed objects and their clone counterparts.
* @returns {*} Returns the cloned value.
*/
function baseClone(value, bitmask, customizer, key, object, stack) {
var result,
isDeep = bitmask & CLONE_DEEP_FLAG,
isFlat = bitmask & CLONE_FLAT_FLAG,
isFull = bitmask & CLONE_SYMBOLS_FLAG;
if (customizer) {
result = object ? customizer(value, key, object, stack) : customizer(value);
}
if (result !== undefined) {
return result;
}
if (!isObject(value)) {
return value;
}
var isArr = isArray(value);
if (isArr) {
result = initCloneArray(value);
if (!isDeep) {
return copyArray(value, result);
}
} else {
var tag = getTag(value),
isFunc = tag == funcTag || tag == genTag;
if (isBuffer(value)) {
return cloneBuffer(value, isDeep);
}
if (tag == objectTag || tag == argsTag || (isFunc && !object)) {
result = (isFlat || isFunc) ? {} : initCloneObject(value);
if (!isDeep) {
return isFlat
? copySymbolsIn(value, baseAssignIn(result, value))
: copySymbols(value, baseAssign(result, value));
}
} else {
if (!cloneableTags[tag]) {
return object ? value : {};
}
result = initCloneByTag(value, tag, baseClone, isDeep);
}
}
// Check for circular references and return its corresponding clone.
stack || (stack = new Stack);
var stacked = stack.get(value);
if (stacked) {
return stacked;
}
stack.set(value, result);
var keysFunc = isFull
? (isFlat ? getAllKeysIn : getAllKeys)
: (isFlat ? keysIn : keys);
var props = isArr ? undefined : keysFunc(value);
arrayEach(props || value, function(subValue, key) {
if (props) {
key = subValue;
subValue = value[key];
}
// Recursively populate clone (susceptible to call stack limits).
assignValue(result, key, baseClone(subValue, bitmask, customizer, key, value, stack));
});
return result;
}
/**
* The base implementation of `_.conforms` which doesn't clone `source`.
*
* @private
* @param {Object} source The object of property predicates to conform to.
* @returns {Function} Returns the new spec function.
*/
function baseConforms(source) {
var props = keys(source);
return function(object) {
return baseConformsTo(object, source, props);
};
}
/**
* The base implementation of `_.conformsTo` which accepts `props` to check.
*
* @private
* @param {Object} object The object to inspect.
* @param {Object} source The object of property predicates to conform to.
* @returns {boolean} Returns `true` if `object` conforms, else `false`.
*/
function baseConformsTo(object, source, props) {
var length = props.length;
if (object == null) {
return !length;
}
object = Object(object);
while (length--) {
var key = props[length],
predicate = source[key],
value = object[key];
if ((value === undefined && !(key in object)) || !predicate(value)) {
return false;
}
}
return true;
}
/**
* The base implementation of `_.delay` and `_.defer` which accepts `args`
* to provide to `func`.
*
* @private
* @param {Function} func The function to delay.
* @param {number} wait The number of milliseconds to delay invocation.
* @param {Array} args The arguments to provide to `func`.
* @returns {number|Object} Returns the timer id or timeout object.
*/
function baseDelay(func, wait, args) {
if (typeof func != 'function') {
throw new TypeError(FUNC_ERROR_TEXT);
}
return setTimeout(function() { func.apply(undefined, args); }, wait);
}
/**
* The base implementation of methods like `_.difference` without support
* for excluding multiple arrays or iteratee shorthands.
*
* @private
* @param {Array} array The array to inspect.
* @param {Array} values The values to exclude.
* @param {Function} [iteratee] The iteratee invoked per element.
* @param {Function} [comparator] The comparator invoked per element.
* @returns {Array} Returns the new array of filtered values.
*/
function baseDifference(array, values, iteratee, comparator) {
var index = -1,
includes = arrayIncludes,
isCommon = true,
length = array.length,
result = [],
valuesLength = values.length;
if (!length) {
return result;
}
if (iteratee) {
values = arrayMap(values, baseUnary(iteratee));
}
if (comparator) {
includes = arrayIncludesWith;
isCommon = false;
}
else if (values.length >= LARGE_ARRAY_SIZE) {
includes = cacheHas;
isCommon = false;
values = new SetCache(values);
}
outer:
while (++index < length) {
var value = array[index],
computed = iteratee == null ? value : iteratee(value);
value = (comparator || value !== 0) ? value : 0;
if (isCommon && computed === computed) {
var valuesIndex = valuesLength;
while (valuesIndex--) {
if (values[valuesIndex] === computed) {
continue outer;
}
}
result.push(value);
}
else if (!includes(values, computed, comparator)) {
result.push(value);
}
}
return result;
}
/**
* The base implementation of `_.forEach` without support for iteratee shorthands.
*
* @private
* @param {Array|Object} collection The collection to iterate over.
* @param {Function} iteratee The function invoked per iteration.
* @returns {Array|Object} Returns `collection`.
*/
var baseEach = createBaseEach(baseForOwn);
/**
* The base implementation of `_.forEachRight` without support for iteratee shorthands.
*
* @private
* @param {Array|Object} collection The collection to iterate over.
* @param {Function} iteratee The function invoked per iteration.
* @returns {Array|Object} Returns `collection`.
*/
var baseEachRight = createBaseEach(baseForOwnRight, true);
/**
* The base implementation of `_.every` without support for iteratee shorthands.
*
* @private
* @param {Array|Object} collection The collection to iterate over.
* @param {Function} predicate The function invoked per iteration.
* @returns {boolean} Returns `true` if all elements pass the predicate check,
* else `false`
*/
function baseEvery(collection, predicate) {
var result = true;
baseEach(collection, function(value, index, collection) {
result = !!predicate(value, index, collection);
return result;
});
return result;
}
/**
* The base implementation of methods like `_.max` and `_.min` which accepts a
* `comparator` to determine the extremum value.
*
* @private
* @param {Array} array The array to iterate over.
* @param {Function} iteratee The iteratee invoked per iteration.
* @param {Function} comparator The comparator used to compare values.
* @returns {*} Returns the extremum value.
*/
function baseExtremum(array, iteratee, comparator) {
var index = -1,
length = array.length;
while (++index < length) {
var value = array[index],
current = iteratee(value);
if (current != null && (computed === undefined
? (current === current && !isSymbol(current))
: comparator(current, computed)
)) {
var computed = current,
result = value;
}
}
return result;
}
/**
* The base implementation of `_.fill` without an iteratee call guard.
*
* @private
* @param {Array} array The array to fill.
* @param {*} value The value to fill `array` with.
* @param {number} [start=0] The start position.
* @param {number} [end=array.length] The end position.
* @returns {Array} Returns `array`.
*/
function baseFill(array, value, start, end) {
var length = array.length;
start = toInteger(start);
if (start < 0) {
start = -start > length ? 0 : (length + start);
}
end = (end === undefined || end > length) ? length : toInteger(end);
if (end < 0) {
end += length;
}
end = start > end ? 0 : toLength(end);
while (start < end) {
array[start++] = value;
}
return array;
}
/**
* The base implementation of `_.filter` without support for iteratee shorthands.
*
* @private
* @param {Array|Object} collection The collection to iterate over.
* @param {Function} predicate The function invoked per iteration.
* @returns {Array} Returns the new filtered array.
*/
function baseFilter(collection, predicate) {
var result = [];
baseEach(collection, function(value, index, collection) {
if (predicate(value, index, collection)) {
result.push(value);
}
});
return result;
}
/**
* The base implementation of `_.flatten` with support for restricting flattening.
*
* @private
* @param {Array} array The array to flatten.
* @param {number} depth The maximum recursion depth.
* @param {boolean} [predicate=isFlattenable] The function invoked per iteration.
* @param {boolean} [isStrict] Restrict to values that pass `predicate` checks.
* @param {Array} [result=[]] The initial result value.
* @returns {Array} Returns the new flattened array.
*/
function baseFlatten(array, depth, predicate, isStrict, result) {
var index = -1,
length = array.length;
predicate || (predicate = isFlattenable);
result || (result = []);
while (++index < length) {
var value = array[index];
if (depth > 0 && predicate(value)) {
if (depth > 1) {
// Recursively flatten arrays (susceptible to call stack limits).
baseFlatten(value, depth - 1, predicate, isStrict, result);
} else {
arrayPush(result, value);
}
} else if (!isStrict) {
result[result.length] = value;
}
}
return result;
}
/**
* The base implementation of `baseForOwn` which iterates over `object`
* properties returned by `keysFunc` and invokes `iteratee` for each property.
* Iteratee functions may exit iteration early by explicitly returning `false`.
*
* @private
* @param {Object} object The object to iterate over.
* @param {Function} iteratee The function invoked per iteration.
* @param {Function} keysFunc The function to get the keys of `object`.
* @returns {Object} Returns `object`.
*/
var baseFor = createBaseFor();
/**
* This function is like `baseFor` except that it iterates over properties
* in the opposite order.
*
* @private
* @param {Object} object The object to iterate over.
* @param {Function} iteratee The function invoked per iteration.
* @param {Function} keysFunc The function to get the keys of `object`.
* @returns {Object} Returns `object`.
*/
var baseForRight = createBaseFor(true);
/**
* The base implementation of `_.forOwn` without support for iteratee shorthands.
*
* @private
* @param {Object} object The object to iterate over.
* @param {Function} iteratee The function invoked per iteration.
* @returns {Object} Returns `object`.
*/
function baseForOwn(object, iteratee) {
return object && baseFor(object, iteratee, keys);
}
/**
* The base implementation of `_.forOwnRight` without support for iteratee shorthands.
*
* @private
* @param {Object} object The object to iterate over.
* @param {Function} iteratee The function invoked per iteration.
* @returns {Object} Returns `object`.
*/
function baseForOwnRight(object, iteratee) {
return object && baseForRight(object, iteratee, keys);
}
/**
* The base implementation of `_.functions` which creates an array of
* `object` function property names filtered from `props`.
*
* @private
* @param {Object} object The object to inspect.
* @param {Array} props The property names to filter.
* @returns {Array} Returns the function names.
*/
function baseFunctions(object, props) {
return arrayFilter(props, function(key) {
return isFunction(object[key]);
});
}
/**
* The base implementation of `_.get` without support for default values.
*
* @private
* @param {Object} object The object to query.
* @param {Array|string} path The path of the property to get.
* @returns {*} Returns the resolved value.
*/
function baseGet(object, path) {
path = castPath(path, object);
var index = 0,
length = path.length;
while (object != null && index < length) {
object = object[toKey(path[index++])];
}
return (index && index == length) ? object : undefined;
}
/**
* The base implementation of `getAllKeys` and `getAllKeysIn` which uses
* `keysFunc` and `symbolsFunc` to get the enumerable property names and
* symbols of `object`.
*
* @private
* @param {Object} object The object to query.
* @param {Function} keysFunc The function to get the keys of `object`.
* @param {Function} symbolsFunc The function to get the symbols of `object`.
* @returns {Array} Returns the array of property names and symbols.
*/
function baseGetAllKeys(object, keysFunc, symbolsFunc) {
var result = keysFunc(object);
return isArray(object) ? result : arrayPush(result, symbolsFunc(object));
}
/**
* The base implementation of `getTag` without fallbacks for buggy environments.
*
* @private
* @param {*} value The value to query.
* @returns {string} Returns the `toStringTag`.
*/
function baseGetTag(value) {
if (value == null) {
return value === undefined ? undefinedTag : nullTag;
}
return (symToStringTag && symToStringTag in Object(value))
? getRawTag(value)
: objectToString(value);
}
/**
* The base implementation of `_.gt` which doesn't coerce arguments.
*
* @private
* @param {*} value The value to compare.
* @param {*} other The other value to compare.
* @returns {boolean} Returns `true` if `value` is greater than `other`,
* else `false`.
*/
function baseGt(value, other) {
return value > other;
}
/**
* The base implementation of `_.has` without support for deep paths.
*
* @private
* @param {Object} [object] The object to query.
* @param {Array|string} key The key to check.
* @returns {boolean} Returns `true` if `key` exists, else `false`.
*/
function baseHas(object, key) {
return object != null && hasOwnProperty.call(object, key);
}
/**
* The base implementation of `_.hasIn` without support for deep paths.
*
* @private
* @param {Object} [object] The object to query.
* @param {Array|string} key The key to check.
* @returns {boolean} Returns `true` if `key` exists, else `false`.
*/
function baseHasIn(object, key) {
return object != null && key in Object(object);
}
/**
* The base implementation of `_.inRange` which doesn't coerce arguments.
*
* @private
* @param {number} number The number to check.
* @param {number} start The start of the range.
* @param {number} end The end of the range.
* @returns {boolean} Returns `true` if `number` is in the range, else `false`.
*/
function baseInRange(number, start, end) {
return number >= nativeMin(start, end) && number < nativeMax(start, end);
}
/**
* The base implementation of methods like `_.intersection`, without support
* for iteratee shorthands, that accepts an array of arrays to inspect.
*
* @private
* @param {Array} arrays The arrays to inspect.
* @param {Function} [iteratee] The iteratee invoked per element.
* @param {Function} [comparator] The comparator invoked per element.
* @returns {Array} Returns the new array of shared values.
*/
function baseIntersection(arrays, iteratee, comparator) {
var includes = comparator ? arrayIncludesWith : arrayIncludes,
length = arrays[0].length,
othLength = arrays.length,
othIndex = othLength,
caches = Array(othLength),
maxLength = Infinity,
result = [];
while (othIndex--) {
var array = arrays[othIndex];
if (othIndex && iteratee) {
array = arrayMap(array, baseUnary(iteratee));
}
maxLength = nativeMin(array.length, maxLength);
caches[othIndex] = !comparator && (iteratee || (length >= 120 && array.length >= 120))
? new SetCache(othIndex && array)
: undefined;
}
array = arrays[0];
var index = -1,
seen = caches[0];
outer:
while (++index < length && result.length < maxLength) {
var value = array[index],
computed = iteratee ? iteratee(value) : value;
value = (comparator || value !== 0) ? value : 0;
if (!(seen
? cacheHas(seen, computed)
: includes(result, computed, comparator)
)) {
othIndex = othLength;
while (--othIndex) {
var cache = caches[othIndex];
if (!(cache
? cacheHas(cache, computed)
: includes(arrays[othIndex], computed, comparator))
) {
continue outer;
}
}
if (seen) {
seen.push(computed);
}
result.push(value);
}
}
return result;
}
/**
* The base implementation of `_.invert` and `_.invertBy` which inverts
* `object` with values transformed by `iteratee` and set by `setter`.
*
* @private
* @param {Object} object The object to iterate over.
* @param {Function} setter The function to set `accumulator` values.
* @param {Function} iteratee The iteratee to transform values.
* @param {Object} accumulator The initial inverted object.
* @returns {Function} Returns `accumulator`.
*/
function baseInverter(object, setter, iteratee, accumulator) {
baseForOwn(object, function(value, key, object) {
setter(accumulator, iteratee(value), key, object);
});
return accumulator;
}
/**
* The base implementation of `_.invoke` without support for individual
* method arguments.
*
* @private
* @param {Object} object The object to query.
* @param {Array|string} path The path of the method to invoke.
* @param {Array} args The arguments to invoke the method with.
* @returns {*} Returns the result of the invoked method.
*/
function baseInvoke(object, path, args) {
path = castPath(path, object);
object = parent(object, path);
var func = object == null ? object : object[toKey(last(path))];
return func == null ? undefined : apply(func, object, args);
}
/**
* The base implementation of `_.isArguments`.
*
* @private
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is an `arguments` object,
*/
function baseIsArguments(value) {
return isObjectLike(value) && baseGetTag(value) == argsTag;
}
/**
* The base implementation of `_.isArrayBuffer` without Node.js optimizations.
*
* @private
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is an array buffer, else `false`.
*/
function baseIsArrayBuffer(value) {
return isObjectLike(value) && baseGetTag(value) == arrayBufferTag;
}
/**
* The base implementation of `_.isDate` without Node.js optimizations.
*
* @private
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is a date object, else `false`.
*/
function baseIsDate(value) {
return isObjectLike(value) && baseGetTag(value) == dateTag;
}
/**
* The base implementation of `_.isEqual` which supports partial comparisons
* and tracks traversed objects.
*
* @private
* @param {*} value The value to compare.
* @param {*} other The other value to compare.
* @param {boolean} bitmask The bitmask flags.
* 1 - Unordered comparison
* 2 - Partial comparison
* @param {Function} [customizer] The function to customize comparisons.
* @param {Object} [stack] Tracks traversed `value` and `other` objects.
* @returns {boolean} Returns `true` if the values are equivalent, else `false`.
*/
function baseIsEqual(value, other, bitmask, customizer, stack) {
if (value === other) {
return true;
}
if (value == null || other == null || (!isObjectLike(value) && !isObjectLike(other))) {
return value !== value && other !== other;
}
return baseIsEqualDeep(value, other, bitmask, customizer, baseIsEqual, stack);
}
/**
* A specialized version of `baseIsEqual` for arrays and objects which performs
* deep comparisons and tracks traversed objects enabling objects with circular
* references to be compared.
*
* @private
* @param {Object} object The object to compare.
* @param {Object} other The other object to compare.
* @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details.
* @param {Function} customizer The function to customize comparisons.
* @param {Function} equalFunc The function to determine equivalents of values.
* @param {Object} [stack] Tracks traversed `object` and `other` objects.
* @returns {boolean} Returns `true` if the objects are equivalent, else `false`.
*/
function baseIsEqualDeep(object, other, bitmask, customizer, equalFunc, stack) {
var objIsArr = isArray(object),
othIsArr = isArray(other),
objTag = objIsArr ? arrayTag : getTag(object),
othTag = othIsArr ? arrayTag : getTag(other);
objTag = objTag == argsTag ? objectTag : objTag;
othTag = othTag == argsTag ? objectTag : othTag;
var objIsObj = objTag == objectTag,
othIsObj = othTag == objectTag,
isSameTag = objTag == othTag;
if (isSameTag && isBuffer(object)) {
if (!isBuffer(other)) {
return false;
}
objIsArr = true;
objIsObj = false;
}
if (isSameTag && !objIsObj) {
stack || (stack = new Stack);
return (objIsArr || isTypedArray(object))
? equalArrays(object, other, bitmask, customizer, equalFunc, stack)
: equalByTag(object, other, objTag, bitmask, customizer, equalFunc, stack);
}
if (!(bitmask & COMPARE_PARTIAL_FLAG)) {
var objIsWrapped = objIsObj && hasOwnProperty.call(object, '__wrapped__'),
othIsWrapped = othIsObj && hasOwnProperty.call(other, '__wrapped__');
if (objIsWrapped || othIsWrapped) {
var objUnwrapped = objIsWrapped ? object.value() : object,
othUnwrapped = othIsWrapped ? other.value() : other;
stack || (stack = new Stack);
return equalFunc(objUnwrapped, othUnwrapped, bitmask, customizer, stack);
}
}
if (!isSameTag) {
return false;
}
stack || (stack = new Stack);
return equalObjects(object, other, bitmask, customizer, equalFunc, stack);
}
/**
* The base implementation of `_.isMap` without Node.js optimizations.
*
* @private
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is a map, else `false`.
*/
function baseIsMap(value) {
return isObjectLike(value) && getTag(value) == mapTag;
}
/**
* The base implementation of `_.isMatch` without support for iteratee shorthands.
*
* @private
* @param {Object} object The object to inspect.
* @param {Object} source The object of property values to match.
* @param {Array} matchData The property names, values, and compare flags to match.
* @param {Function} [customizer] The function to customize comparisons.
* @returns {boolean} Returns `true` if `object` is a match, else `false`.
*/
function baseIsMatch(object, source, matchData, customizer) {
var index = matchData.length,
length = index,
noCustomizer = !customizer;
if (object == null) {
return !length;
}
object = Object(object);
while (index--) {
var data = matchData[index];
if ((noCustomizer && data[2])
? data[1] !== object[data[0]]
: !(data[0] in object)
) {
return false;
}
}
while (++index < length) {
data = matchData[index];
var key = data[0],
objValue = object[key],
srcValue = data[1];
if (noCustomizer && data[2]) {
if (objValue === undefined && !(key in object)) {
return false;
}
} else {
var stack = new Stack;
if (customizer) {
var result = customizer(objValue, srcValue, key, object, source, stack);
}
if (!(result === undefined
? baseIsEqual(srcValue, objValue, COMPARE_PARTIAL_FLAG | COMPARE_UNORDERED_FLAG, customizer, stack)
: result
)) {
return false;
}
}
}
return true;
}
/**
* The base implementation of `_.isNative` without bad shim checks.
*
* @private
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is a native function,
* else `false`.
*/
function baseIsNative(value) {
if (!isObject(value) || isMasked(value)) {
return false;
}
var pattern = isFunction(value) ? reIsNative : reIsHostCtor;
return pattern.test(toSource(value));
}
/**
* The base implementation of `_.isRegExp` without Node.js optimizations.
*
* @private
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is a regexp, else `false`.
*/
function baseIsRegExp(value) {
return isObjectLike(value) && baseGetTag(value) == regexpTag;
}
/**
* The base implementation of `_.isSet` without Node.js optimizations.
*
* @private
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is a set, else `false`.
*/
function baseIsSet(value) {
return isObjectLike(value) && getTag(value) == setTag;
}
/**
* The base implementation of `_.isTypedArray` without Node.js optimizations.
*
* @private
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is a typed array, else `false`.
*/
function baseIsTypedArray(value) {
return isObjectLike(value) &&
isLength(value.length) && !!typedArrayTags[baseGetTag(value)];
}
/**
* The base implementation of `_.iteratee`.
*
* @private
* @param {*} [value=_.identity] The value to convert to an iteratee.
* @returns {Function} Returns the iteratee.
*/
function baseIteratee(value) {
// Don't store the `typeof` result in a variable to avoid a JIT bug in Safari 9.
// See https://bugs.webkit.org/show_bug.cgi?id=156034 for more details.
if (typeof value == 'function') {
return value;
}
if (value == null) {
return identity;
}
if (typeof value == 'object') {
return isArray(value)
? baseMatchesProperty(value[0], value[1])
: baseMatches(value);
}
return property(value);
}
/**
* The base implementation of `_.keys` which doesn't treat sparse arrays as dense.
*
* @private
* @param {Object} object The object to query.
* @returns {Array} Returns the array of property names.
*/
function baseKeys(object) {
if (!isPrototype(object)) {
return nativeKeys(object);
}
var result = [];
for (var key in Object(object)) {
if (hasOwnProperty.call(object, key) && key != 'constructor') {
result.push(key);
}
}
return result;
}
/**
* The base implementation of `_.keysIn` which doesn't treat sparse arrays as dense.
*
* @private
* @param {Object} object The object to query.
* @returns {Array} Returns the array of property names.
*/
function baseKeysIn(object) {
if (!isObject(object)) {
return nativeKeysIn(object);
}
var isProto = isPrototype(object),
result = [];
for (var key in object) {
if (!(key == 'constructor' && (isProto || !hasOwnProperty.call(object, key)))) {
result.push(key);
}
}
return result;
}
/**
* The base implementation of `_.lt` which doesn't coerce arguments.
*
* @private
* @param {*} value The value to compare.
* @param {*} other The other value to compare.
* @returns {boolean} Returns `true` if `value` is less than `other`,
* else `false`.
*/
function baseLt(value, other) {
return value < other;
}
/**
* The base implementation of `_.map` without support for iteratee shorthands.
*
* @private
* @param {Array|Object} collection The collection to iterate over.
* @param {Function} iteratee The function invoked per iteration.
* @returns {Array} Returns the new mapped array.
*/
function baseMap(collection, iteratee) {
var index = -1,
result = isArrayLike(collection) ? Array(collection.length) : [];
baseEach(collection, function(value, key, collection) {
result[++index] = iteratee(value, key, collection);
});
return result;
}
/**
* The base implementation of `_.matches` which doesn't clone `source`.
*
* @private
* @param {Object} source The object of property values to match.
* @returns {Function} Returns the new spec function.
*/
function baseMatches(source) {
var matchData = getMatchData(source);
if (matchData.length == 1 && matchData[0][2]) {
return matchesStrictComparable(matchData[0][0], matchData[0][1]);
}
return function(object) {
return object === source || baseIsMatch(object, source, matchData);
};
}
/**
* The base implementation of `_.matchesProperty` which doesn't clone `srcValue`.
*
* @private
* @param {string} path The path of the property to get.
* @param {*} srcValue The value to match.
* @returns {Function} Returns the new spec function.
*/
function baseMatchesProperty(path, srcValue) {
if (isKey(path) && isStrictComparable(srcValue)) {
return matchesStrictComparable(toKey(path), srcValue);
}
return function(object) {
var objValue = get(object, path);
return (objValue === undefined && objValue === srcValue)
? hasIn(object, path)
: baseIsEqual(srcValue, objValue, COMPARE_PARTIAL_FLAG | COMPARE_UNORDERED_FLAG);
};
}
/**
* The base implementation of `_.merge` without support for multiple sources.
*
* @private
* @param {Object} object The destination object.
* @param {Object} source The source object.
* @param {number} srcIndex The index of `source`.
* @param {Function} [customizer] The function to customize merged values.
* @param {Object} [stack] Tracks traversed source values and their merged
* counterparts.
*/
function baseMerge(object, source, srcIndex, customizer, stack) {
if (object === source) {
return;
}
baseFor(source, function(srcValue, key) {
if (isObject(srcValue)) {
stack || (stack = new Stack);
baseMergeDeep(object, source, key, srcIndex, baseMerge, customizer, stack);
}
else {
var newValue = customizer
? customizer(object[key], srcValue, (key + ''), object, source, stack)
: undefined;
if (newValue === undefined) {
newValue = srcValue;
}
assignMergeValue(object, key, newValue);
}
}, keysIn);
}
/**
* A specialized version of `baseMerge` for arrays and objects which performs
* deep merges and tracks traversed objects enabling objects with circular
* references to be merged.
*
* @private
* @param {Object} object The destination object.
* @param {Object} source The source object.
* @param {string} key The key of the value to merge.
* @param {number} srcIndex The index of `source`.
* @param {Function} mergeFunc The function to merge values.
* @param {Function} [customizer] The function to customize assigned values.
* @param {Object} [stack] Tracks traversed source values and their merged
* counterparts.
*/
function baseMergeDeep(object, source, key, srcIndex, mergeFunc, customizer, stack) {
var objValue = object[key],
srcValue = source[key],
stacked = stack.get(srcValue);
if (stacked) {
assignMergeValue(object, key, stacked);
return;
}
var newValue = customizer
? customizer(objValue, srcValue, (key + ''), object, source, stack)
: undefined;
var isCommon = newValue === undefined;
if (isCommon) {
var isArr = isArray(srcValue),
isBuff = !isArr && isBuffer(srcValue),
isTyped = !isArr && !isBuff && isTypedArray(srcValue);
newValue = srcValue;
if (isArr || isBuff || isTyped) {
if (isArray(objValue)) {
newValue = objValue;
}
else if (isArrayLikeObject(objValue)) {
newValue = copyArray(objValue);
}
else if (isBuff) {
isCommon = false;
newValue = cloneBuffer(srcValue, true);
}
else if (isTyped) {
isCommon = false;
newValue = cloneTypedArray(srcValue, true);
}
else {
newValue = [];
}
}
else if (isPlainObject(srcValue) || isArguments(srcValue)) {
newValue = objValue;
if (isArguments(objValue)) {
newValue = toPlainObject(objValue);
}
else if (!isObject(objValue) || (srcIndex && isFunction(objValue))) {
newValue = initCloneObject(srcValue);
}
}
else {
isCommon = false;
}
}
if (isCommon) {
// Recursively merge objects and arrays (susceptible to call stack limits).
stack.set(srcValue, newValue);
mergeFunc(newValue, srcValue, srcIndex, customizer, stack);
stack['delete'](srcValue);
}
assignMergeValue(object, key, newValue);
}
/**
* The base implementation of `_.nth` which doesn't coerce arguments.
*
* @private
* @param {Array} array The array to query.
* @param {number} n The index of the element to return.
* @returns {*} Returns the nth element of `array`.
*/
function baseNth(array, n) {
var length = array.length;
if (!length) {
return;
}
n += n < 0 ? length : 0;
return isIndex(n, length) ? array[n] : undefined;
}
/**
* The base implementation of `_.orderBy` without param guards.
*
* @private
* @param {Array|Object} collection The collection to iterate over.
* @param {Function[]|Object[]|string[]} iteratees The iteratees to sort by.
* @param {string[]} orders The sort orders of `iteratees`.
* @returns {Array} Returns the new sorted array.
*/
function baseOrderBy(collection, iteratees, orders) {
var index = -1;
iteratees = arrayMap(iteratees.length ? iteratees : [identity], baseUnary(getIteratee()));
var result = baseMap(collection, function(value, key, collection) {
var criteria = arrayMap(iteratees, function(iteratee) {
return iteratee(value);
});
return { 'criteria': criteria, 'index': ++index, 'value': value };
});
return baseSortBy(result, function(object, other) {
return compareMultiple(object, other, orders);
});
}
/**
* The base implementation of `_.pick` without support for individual
* property identifiers.
*
* @private
* @param {Object} object The source object.
* @param {string[]} paths The property paths to pick.
* @returns {Object} Returns the new object.
*/
function basePick(object, paths) {
return basePickBy(object, paths, function(value, path) {
return hasIn(object, path);
});
}
/**
* The base implementation of `_.pickBy` without support for iteratee shorthands.
*
* @private
* @param {Object} object The source object.
* @param {string[]} paths The property paths to pick.
* @param {Function} predicate The function invoked per property.
* @returns {Object} Returns the new object.
*/
function basePickBy(object, paths, predicate) {
var index = -1,
length = paths.length,
result = {};
while (++index < length) {
var path = paths[index],
value = baseGet(object, path);
if (predicate(value, path)) {
baseSet(result, castPath(path, object), value);
}
}
return result;
}
/**
* A specialized version of `baseProperty` which supports deep paths.
*
* @private
* @param {Array|string} path The path of the property to get.
* @returns {Function} Returns the new accessor function.
*/
function basePropertyDeep(path) {
return function(object) {
return baseGet(object, path);
};
}
/**
* The base implementation of `_.pullAllBy` without support for iteratee
* shorthands.
*
* @private
* @param {Array} array The array to modify.
* @param {Array} values The values to remove.
* @param {Function} [iteratee] The iteratee invoked per element.
* @param {Function} [comparator] The comparator invoked per element.
* @returns {Array} Returns `array`.
*/
function basePullAll(array, values, iteratee, comparator) {
var indexOf = comparator ? baseIndexOfWith : baseIndexOf,
index = -1,
length = values.length,
seen = array;
if (array === values) {
values = copyArray(values);
}
if (iteratee) {
seen = arrayMap(array, baseUnary(iteratee));
}
while (++index < length) {
var fromIndex = 0,
value = values[index],
computed = iteratee ? iteratee(value) : value;
while ((fromIndex = indexOf(seen, computed, fromIndex, comparator)) > -1) {
if (seen !== array) {
splice.call(seen, fromIndex, 1);
}
splice.call(array, fromIndex, 1);
}
}
return array;
}
/**
* The base implementation of `_.pullAt` without support for individual
* indexes or capturing the removed elements.
*
* @private
* @param {Array} array The array to modify.
* @param {number[]} indexes The indexes of elements to remove.
* @returns {Array} Returns `array`.
*/
function basePullAt(array, indexes) {
var length = array ? indexes.length : 0,
lastIndex = length - 1;
while (length--) {
var index = indexes[length];
if (length == lastIndex || index !== previous) {
var previous = index;
if (isIndex(index)) {
splice.call(array, index, 1);
} else {
baseUnset(array, index);
}
}
}
return array;
}
/**
* The base implementation of `_.random` without support for returning
* floating-point numbers.
*
* @private
* @param {number} lower The lower bound.
* @param {number} upper The upper bound.
* @returns {number} Returns the random number.
*/
function baseRandom(lower, upper) {
return lower + nativeFloor(nativeRandom() * (upper - lower + 1));
}
/**
* The base implementation of `_.range` and `_.rangeRight` which doesn't
* coerce arguments.
*
* @private
* @param {number} start The start of the range.
* @param {number} end The end of the range.
* @param {number} step The value to increment or decrement by.
* @param {boolean} [fromRight] Specify iterating from right to left.
* @returns {Array} Returns the range of numbers.
*/
function baseRange(start, end, step, fromRight) {
var index = -1,
length = nativeMax(nativeCeil((end - start) / (step || 1)), 0),
result = Array(length);
while (length--) {
result[fromRight ? length : ++index] = start;
start += step;
}
return result;
}
/**
* The base implementation of `_.repeat` which doesn't coerce arguments.
*
* @private
* @param {string} string The string to repeat.
* @param {number} n The number of times to repeat the string.
* @returns {string} Returns the repeated string.
*/
function baseRepeat(string, n) {
var result = '';
if (!string || n < 1 || n > MAX_SAFE_INTEGER) {
return result;
}
// Leverage the exponentiation by squaring algorithm for a faster repeat.
// See https://en.wikipedia.org/wiki/Exponentiation_by_squaring for more details.
do {
if (n % 2) {
result += string;
}
n = nativeFloor(n / 2);
if (n) {
string += string;
}
} while (n);
return result;
}
/**
* The base implementation of `_.rest` which doesn't validate or coerce arguments.
*
* @private
* @param {Function} func The function to apply a rest parameter to.
* @param {number} [start=func.length-1] The start position of the rest parameter.
* @returns {Function} Returns the new function.
*/
function baseRest(func, start) {
return setToString(overRest(func, start, identity), func + '');
}
/**
* The base implementation of `_.sample`.
*
* @private
* @param {Array|Object} collection The collection to sample.
* @returns {*} Returns the random element.
*/
function baseSample(collection) {
return arraySample(values(collection));
}
/**
* The base implementation of `_.sampleSize` without param guards.
*
* @private
* @param {Array|Object} collection The collection to sample.
* @param {number} n The number of elements to sample.
* @returns {Array} Returns the random elements.
*/
function baseSampleSize(collection, n) {
var array = values(collection);
return shuffleSelf(array, baseClamp(n, 0, array.length));
}
/**
* The base implementation of `_.set`.
*
* @private
* @param {Object} object The object to modify.
* @param {Array|string} path The path of the property to set.
* @param {*} value The value to set.
* @param {Function} [customizer] The function to customize path creation.
* @returns {Object} Returns `object`.
*/
function baseSet(object, path, value, customizer) {
if (!isObject(object)) {
return object;
}
path = castPath(path, object);
var index = -1,
length = path.length,
lastIndex = length - 1,
nested = object;
while (nested != null && ++index < length) {
var key = toKey(path[index]),
newValue = value;
if (index != lastIndex) {
var objValue = nested[key];
newValue = customizer ? customizer(objValue, key, nested) : undefined;
if (newValue === undefined) {
newValue = isObject(objValue)
? objValue
: (isIndex(path[index + 1]) ? [] : {});
}
}
assignValue(nested, key, newValue);
nested = nested[key];
}
return object;
}
/**
* The base implementation of `setData` without support for hot loop shorting.
*
* @private
* @param {Function} func The function to associate metadata with.
* @param {*} data The metadata.
* @returns {Function} Returns `func`.
*/
var baseSetData = !metaMap ? identity : function(func, data) {
metaMap.set(func, data);
return func;
};
/**
* The base implementation of `setToString` without support for hot loop shorting.
*
* @private
* @param {Function} func The function to modify.
* @param {Function} string The `toString` result.
* @returns {Function} Returns `func`.
*/
var baseSetToString = !defineProperty ? identity : function(func, string) {
return defineProperty(func, 'toString', {
'configurable': true,
'enumerable': false,
'value': constant(string),
'writable': true
});
};
/**
* The base implementation of `_.shuffle`.
*
* @private
* @param {Array|Object} collection The collection to shuffle.
* @returns {Array} Returns the new shuffled array.
*/
function baseShuffle(collection) {
return shuffleSelf(values(collection));
}
/**
* The base implementation of `_.slice` without an iteratee call guard.
*
* @private
* @param {Array} array The array to slice.
* @param {number} [start=0] The start position.
* @param {number} [end=array.length] The end position.
* @returns {Array} Returns the slice of `array`.
*/
function baseSlice(array, start, end) {
var index = -1,
length = array.length;
if (start < 0) {
start = -start > length ? 0 : (length + start);
}
end = end > length ? length : end;
if (end < 0) {
end += length;
}
length = start > end ? 0 : ((end - start) >>> 0);
start >>>= 0;
var result = Array(length);
while (++index < length) {
result[index] = array[index + start];
}
return result;
}
/**
* The base implementation of `_.some` without support for iteratee shorthands.
*
* @private
* @param {Array|Object} collection The collection to iterate over.
* @param {Function} predicate The function invoked per iteration.
* @returns {boolean} Returns `true` if any element passes the predicate check,
* else `false`.
*/
function baseSome(collection, predicate) {
var result;
baseEach(collection, function(value, index, collection) {
result = predicate(value, index, collection);
return !result;
});
return !!result;
}
/**
* The base implementation of `_.sortedIndex` and `_.sortedLastIndex` which
* performs a binary search of `array` to determine the index at which `value`
* should be inserted into `array` in order to maintain its sort order.
*
* @private
* @param {Array} array The sorted array to inspect.
* @param {*} value The value to evaluate.
* @param {boolean} [retHighest] Specify returning the highest qualified index.
* @returns {number} Returns the index at which `value` should be inserted
* into `array`.
*/
function baseSortedIndex(array, value, retHighest) {
var low = 0,
high = array == null ? low : array.length;
if (typeof value == 'number' && value === value && high <= HALF_MAX_ARRAY_LENGTH) {
while (low < high) {
var mid = (low + high) >>> 1,
computed = array[mid];
if (computed !== null && !isSymbol(computed) &&
(retHighest ? (computed <= value) : (computed < value))) {
low = mid + 1;
} else {
high = mid;
}
}
return high;
}
return baseSortedIndexBy(array, value, identity, retHighest);
}
/**
* The base implementation of `_.sortedIndexBy` and `_.sortedLastIndexBy`
* which invokes `iteratee` for `value` and each element of `array` to compute
* their sort ranking. The iteratee is invoked with one argument; (value).
*
* @private
* @param {Array} array The sorted array to inspect.
* @param {*} value The value to evaluate.
* @param {Function} iteratee The iteratee invoked per element.
* @param {boolean} [retHighest] Specify returning the highest qualified index.
* @returns {number} Returns the index at which `value` should be inserted
* into `array`.
*/
function baseSortedIndexBy(array, value, iteratee, retHighest) {
value = iteratee(value);
var low = 0,
high = array == null ? 0 : array.length,
valIsNaN = value !== value,
valIsNull = value === null,
valIsSymbol = isSymbol(value),
valIsUndefined = value === undefined;
while (low < high) {
var mid = nativeFloor((low + high) / 2),
computed = iteratee(array[mid]),
othIsDefined = computed !== undefined,
othIsNull = computed === null,
othIsReflexive = computed === computed,
othIsSymbol = isSymbol(computed);
if (valIsNaN) {
var setLow = retHighest || othIsReflexive;
} else if (valIsUndefined) {
setLow = othIsReflexive && (retHighest || othIsDefined);
} else if (valIsNull) {
setLow = othIsReflexive && othIsDefined && (retHighest || !othIsNull);
} else if (valIsSymbol) {
setLow = othIsReflexive && othIsDefined && !othIsNull && (retHighest || !othIsSymbol);
} else if (othIsNull || othIsSymbol) {
setLow = false;
} else {
setLow = retHighest ? (computed <= value) : (computed < value);
}
if (setLow) {
low = mid + 1;
} else {
high = mid;
}
}
return nativeMin(high, MAX_ARRAY_INDEX);
}
/**
* The base implementation of `_.sortedUniq` and `_.sortedUniqBy` without
* support for iteratee shorthands.
*
* @private
* @param {Array} array The array to inspect.
* @param {Function} [iteratee] The iteratee invoked per element.
* @returns {Array} Returns the new duplicate free array.
*/
function baseSortedUniq(array, iteratee) {
var index = -1,
length = array.length,
resIndex = 0,
result = [];
while (++index < length) {
var value = array[index],
computed = iteratee ? iteratee(value) : value;
if (!index || !eq(computed, seen)) {
var seen = computed;
result[resIndex++] = value === 0 ? 0 : value;
}
}
return result;
}
/**
* The base implementation of `_.toNumber` which doesn't ensure correct
* conversions of binary, hexadecimal, or octal string values.
*
* @private
* @param {*} value The value to process.
* @returns {number} Returns the number.
*/
function baseToNumber(value) {
if (typeof value == 'number') {
return value;
}
if (isSymbol(value)) {
return NAN;
}
return +value;
}
/**
* The base implementation of `_.toString` which doesn't convert nullish
* values to empty strings.
*
* @private
* @param {*} value The value to process.
* @returns {string} Returns the string.
*/
function baseToString(value) {
// Exit early for strings to avoid a performance hit in some environments.
if (typeof value == 'string') {
return value;
}
if (isArray(value)) {
// Recursively convert values (susceptible to call stack limits).
return arrayMap(value, baseToString) + '';
}
if (isSymbol(value)) {
return symbolToString ? symbolToString.call(value) : '';
}
var result = (value + '');
return (result == '0' && (1 / value) == -INFINITY) ? '-0' : result;
}
/**
* The base implementation of `_.uniqBy` without support for iteratee shorthands.
*
* @private
* @param {Array} array The array to inspect.
* @param {Function} [iteratee] The iteratee invoked per element.
* @param {Function} [comparator] The comparator invoked per element.
* @returns {Array} Returns the new duplicate free array.
*/
function baseUniq(array, iteratee, comparator) {
var index = -1,
includes = arrayIncludes,
length = array.length,
isCommon = true,
result = [],
seen = result;
if (comparator) {
isCommon = false;
includes = arrayIncludesWith;
}
else if (length >= LARGE_ARRAY_SIZE) {
var set = iteratee ? null : createSet(array);
if (set) {
return setToArray(set);
}
isCommon = false;
includes = cacheHas;
seen = new SetCache;
}
else {
seen = iteratee ? [] : result;
}
outer:
while (++index < length) {
var value = array[index],
computed = iteratee ? iteratee(value) : value;
value = (comparator || value !== 0) ? value : 0;
if (isCommon && computed === computed) {
var seenIndex = seen.length;
while (seenIndex--) {
if (seen[seenIndex] === computed) {
continue outer;
}
}
if (iteratee) {
seen.push(computed);
}
result.push(value);
}
else if (!includes(seen, computed, comparator)) {
if (seen !== result) {
seen.push(computed);
}
result.push(value);
}
}
return result;
}
/**
* The base implementation of `_.unset`.
*
* @private
* @param {Object} object The object to modify.
* @param {Array|string} path The property path to unset.
* @returns {boolean} Returns `true` if the property is deleted, else `false`.
*/
function baseUnset(object, path) {
path = castPath(path, object);
object = parent(object, path);
return object == null || delete object[toKey(last(path))];
}
/**
* The base implementation of `_.update`.
*
* @private
* @param {Object} object The object to modify.
* @param {Array|string} path The path of the property to update.
* @param {Function} updater The function to produce the updated value.
* @param {Function} [customizer] The function to customize path creation.
* @returns {Object} Returns `object`.
*/
function baseUpdate(object, path, updater, customizer) {
return baseSet(object, path, updater(baseGet(object, path)), customizer);
}
/**
* The base implementation of methods like `_.dropWhile` and `_.takeWhile`
* without support for iteratee shorthands.
*
* @private
* @param {Array} array The array to query.
* @param {Function} predicate The function invoked per iteration.
* @param {boolean} [isDrop] Specify dropping elements instead of taking them.
* @param {boolean} [fromRight] Specify iterating from right to left.
* @returns {Array} Returns the slice of `array`.
*/
function baseWhile(array, predicate, isDrop, fromRight) {
var length = array.length,
index = fromRight ? length : -1;
while ((fromRight ? index-- : ++index < length) &&
predicate(array[index], index, array)) {}
return isDrop
? baseSlice(array, (fromRight ? 0 : index), (fromRight ? index + 1 : length))
: baseSlice(array, (fromRight ? index + 1 : 0), (fromRight ? length : index));
}
/**
* The base implementation of `wrapperValue` which returns the result of
* performing a sequence of actions on the unwrapped `value`, where each
* successive action is supplied the return value of the previous.
*
* @private
* @param {*} value The unwrapped value.
* @param {Array} actions Actions to perform to resolve the unwrapped value.
* @returns {*} Returns the resolved value.
*/
function baseWrapperValue(value, actions) {
var result = value;
if (result instanceof LazyWrapper) {
result = result.value();
}
return arrayReduce(actions, function(result, action) {
return action.func.apply(action.thisArg, arrayPush([result], action.args));
}, result);
}
/**
* The base implementation of methods like `_.xor`, without support for
* iteratee shorthands, that accepts an array of arrays to inspect.
*
* @private
* @param {Array} arrays The arrays to inspect.
* @param {Function} [iteratee] The iteratee invoked per element.
* @param {Function} [comparator] The comparator invoked per element.
* @returns {Array} Returns the new array of values.
*/
function baseXor(arrays, iteratee, comparator) {
var length = arrays.length;
if (length < 2) {
return length ? baseUniq(arrays[0]) : [];
}
var index = -1,
result = Array(length);
while (++index < length) {
var array = arrays[index],
othIndex = -1;
while (++othIndex < length) {
if (othIndex != index) {
result[index] = baseDifference(result[index] || array, arrays[othIndex], iteratee, comparator);
}
}
}
return baseUniq(baseFlatten(result, 1), iteratee, comparator);
}
/**
* This base implementation of `_.zipObject` which assigns values using `assignFunc`.
*
* @private
* @param {Array} props The property identifiers.
* @param {Array} values The property values.
* @param {Function} assignFunc The function to assign values.
* @returns {Object} Returns the new object.
*/
function baseZipObject(props, values, assignFunc) {
var index = -1,
length = props.length,
valsLength = values.length,
result = {};
while (++index < length) {
var value = index < valsLength ? values[index] : undefined;
assignFunc(result, props[index], value);
}
return result;
}
/**
* Casts `value` to an empty array if it's not an array like object.
*
* @private
* @param {*} value The value to inspect.
* @returns {Array|Object} Returns the cast array-like object.
*/
function castArrayLikeObject(value) {
return isArrayLikeObject(value) ? value : [];
}
/**
* Casts `value` to `identity` if it's not a function.
*
* @private
* @param {*} value The value to inspect.
* @returns {Function} Returns cast function.
*/
function castFunction(value) {
return typeof value == 'function' ? value : identity;
}
/**
* Casts `value` to a path array if it's not one.
*
* @private
* @param {*} value The value to inspect.
* @param {Object} [object] The object to query keys on.
* @returns {Array} Returns the cast property path array.
*/
function castPath(value, object) {
if (isArray(value)) {
return value;
}
return isKey(value, object) ? [value] : stringToPath(toString(value));
}
/**
* A `baseRest` alias which can be replaced with `identity` by module
* replacement plugins.
*
* @private
* @type {Function}
* @param {Function} func The function to apply a rest parameter to.
* @returns {Function} Returns the new function.
*/
var castRest = baseRest;
/**
* Casts `array` to a slice if it's needed.
*
* @private
* @param {Array} array The array to inspect.
* @param {number} start The start position.
* @param {number} [end=array.length] The end position.
* @returns {Array} Returns the cast slice.
*/
function castSlice(array, start, end) {
var length = array.length;
end = end === undefined ? length : end;
return (!start && end >= length) ? array : baseSlice(array, start, end);
}
/**
* A simple wrapper around the global [`clearTimeout`](https://mdn.io/clearTimeout).
*
* @private
* @param {number|Object} id The timer id or timeout object of the timer to clear.
*/
var clearTimeout = ctxClearTimeout || function(id) {
return root.clearTimeout(id);
};
/**
* Creates a clone of `buffer`.
*
* @private
* @param {Buffer} buffer The buffer to clone.
* @param {boolean} [isDeep] Specify a deep clone.
* @returns {Buffer} Returns the cloned buffer.
*/
function cloneBuffer(buffer, isDeep) {
if (isDeep) {
return buffer.slice();
}
var length = buffer.length,
result = allocUnsafe ? allocUnsafe(length) : new buffer.constructor(length);
buffer.copy(result);
return result;
}
/**
* Creates a clone of `arrayBuffer`.
*
* @private
* @param {ArrayBuffer} arrayBuffer The array buffer to clone.
* @returns {ArrayBuffer} Returns the cloned array buffer.
*/
function cloneArrayBuffer(arrayBuffer) {
var result = new arrayBuffer.constructor(arrayBuffer.byteLength);
new Uint8Array(result).set(new Uint8Array(arrayBuffer));
return result;
}
/**
* Creates a clone of `dataView`.
*
* @private
* @param {Object} dataView The data view to clone.
* @param {boolean} [isDeep] Specify a deep clone.
* @returns {Object} Returns the cloned data view.
*/
function cloneDataView(dataView, isDeep) {
var buffer = isDeep ? cloneArrayBuffer(dataView.buffer) : dataView.buffer;
return new dataView.constructor(buffer, dataView.byteOffset, dataView.byteLength);
}
/**
* Creates a clone of `map`.
*
* @private
* @param {Object} map The map to clone.
* @param {Function} cloneFunc The function to clone values.
* @param {boolean} [isDeep] Specify a deep clone.
* @returns {Object} Returns the cloned map.
*/
function cloneMap(map, isDeep, cloneFunc) {
var array = isDeep ? cloneFunc(mapToArray(map), CLONE_DEEP_FLAG) : mapToArray(map);
return arrayReduce(array, addMapEntry, new map.constructor);
}
/**
* Creates a clone of `regexp`.
*
* @private
* @param {Object} regexp The regexp to clone.
* @returns {Object} Returns the cloned regexp.
*/
function cloneRegExp(regexp) {
var result = new regexp.constructor(regexp.source, reFlags.exec(regexp));
result.lastIndex = regexp.lastIndex;
return result;
}
/**
* Creates a clone of `set`.
*
* @private
* @param {Object} set The set to clone.
* @param {Function} cloneFunc The function to clone values.
* @param {boolean} [isDeep] Specify a deep clone.
* @returns {Object} Returns the cloned set.
*/
function cloneSet(set, isDeep, cloneFunc) {
var array = isDeep ? cloneFunc(setToArray(set), CLONE_DEEP_FLAG) : setToArray(set);
return arrayReduce(array, addSetEntry, new set.constructor);
}
/**
* Creates a clone of the `symbol` object.
*
* @private
* @param {Object} symbol The symbol object to clone.
* @returns {Object} Returns the cloned symbol object.
*/
function cloneSymbol(symbol) {
return symbolValueOf ? Object(symbolValueOf.call(symbol)) : {};
}
/**
* Creates a clone of `typedArray`.
*
* @private
* @param {Object} typedArray The typed array to clone.
* @param {boolean} [isDeep] Specify a deep clone.
* @returns {Object} Returns the cloned typed array.
*/
function cloneTypedArray(typedArray, isDeep) {
var buffer = isDeep ? cloneArrayBuffer(typedArray.buffer) : typedArray.buffer;
return new typedArray.constructor(buffer, typedArray.byteOffset, typedArray.length);
}
/**
* Compares values to sort them in ascending order.
*
* @private
* @param {*} value The value to compare.
* @param {*} other The other value to compare.
* @returns {number} Returns the sort order indicator for `value`.
*/
function compareAscending(value, other) {
if (value !== other) {
var valIsDefined = value !== undefined,
valIsNull = value === null,
valIsReflexive = value === value,
valIsSymbol = isSymbol(value);
var othIsDefined = other !== undefined,
othIsNull = other === null,
othIsReflexive = other === other,
othIsSymbol = isSymbol(other);
if ((!othIsNull && !othIsSymbol && !valIsSymbol && value > other) ||
(valIsSymbol && othIsDefined && othIsReflexive && !othIsNull && !othIsSymbol) ||
(valIsNull && othIsDefined && othIsReflexive) ||
(!valIsDefined && othIsReflexive) ||
!valIsReflexive) {
return 1;
}
if ((!valIsNull && !valIsSymbol && !othIsSymbol && value < other) ||
(othIsSymbol && valIsDefined && valIsReflexive && !valIsNull && !valIsSymbol) ||
(othIsNull && valIsDefined && valIsReflexive) ||
(!othIsDefined && valIsReflexive) ||
!othIsReflexive) {
return -1;
}
}
return 0;
}
/**
* Used by `_.orderBy` to compare multiple properties of a value to another
* and stable sort them.
*
* If `orders` is unspecified, all values are sorted in ascending order. Otherwise,
* specify an order of "desc" for descending or "asc" for ascending sort order
* of corresponding values.
*
* @private
* @param {Object} object The object to compare.
* @param {Object} other The other object to compare.
* @param {boolean[]|string[]} orders The order to sort by for each property.
* @returns {number} Returns the sort order indicator for `object`.
*/
function compareMultiple(object, other, orders) {
var index = -1,
objCriteria = object.criteria,
othCriteria = other.criteria,
length = objCriteria.length,
ordersLength = orders.length;
while (++index < length) {
var result = compareAscending(objCriteria[index], othCriteria[index]);
if (result) {
if (index >= ordersLength) {
return result;
}
var order = orders[index];
return result * (order == 'desc' ? -1 : 1);
}
}
// Fixes an `Array#sort` bug in the JS engine embedded in Adobe applications
// that causes it, under certain circumstances, to provide the same value for
// `object` and `other`. See https://github.com/jashkenas/underscore/pull/1247
// for more details.
//
// This also ensures a stable sort in V8 and other engines.
// See https://bugs.chromium.org/p/v8/issues/detail?id=90 for more details.
return object.index - other.index;
}
/**
* Creates an array that is the composition of partially applied arguments,
* placeholders, and provided arguments into a single array of arguments.
*
* @private
* @param {Array} args The provided arguments.
* @param {Array} partials The arguments to prepend to those provided.
* @param {Array} holders The `partials` placeholder indexes.
* @params {boolean} [isCurried] Specify composing for a curried function.
* @returns {Array} Returns the new array of composed arguments.
*/
function composeArgs(args, partials, holders, isCurried) {
var argsIndex = -1,
argsLength = args.length,
holdersLength = holders.length,
leftIndex = -1,
leftLength = partials.length,
rangeLength = nativeMax(argsLength - holdersLength, 0),
result = Array(leftLength + rangeLength),
isUncurried = !isCurried;
while (++leftIndex < leftLength) {
result[leftIndex] = partials[leftIndex];
}
while (++argsIndex < holdersLength) {
if (isUncurried || argsIndex < argsLength) {
result[holders[argsIndex]] = args[argsIndex];
}
}
while (rangeLength--) {
result[leftIndex++] = args[argsIndex++];
}
return result;
}
/**
* This function is like `composeArgs` except that the arguments composition
* is tailored for `_.partialRight`.
*
* @private
* @param {Array} args The provided arguments.
* @param {Array} partials The arguments to append to those provided.
* @param {Array} holders The `partials` placeholder indexes.
* @params {boolean} [isCurried] Specify composing for a curried function.
* @returns {Array} Returns the new array of composed arguments.
*/
function composeArgsRight(args, partials, holders, isCurried) {
var argsIndex = -1,
argsLength = args.length,
holdersIndex = -1,
holdersLength = holders.length,
rightIndex = -1,
rightLength = partials.length,
rangeLength = nativeMax(argsLength - holdersLength, 0),
result = Array(rangeLength + rightLength),
isUncurried = !isCurried;
while (++argsIndex < rangeLength) {
result[argsIndex] = args[argsIndex];
}
var offset = argsIndex;
while (++rightIndex < rightLength) {
result[offset + rightIndex] = partials[rightIndex];
}
while (++holdersIndex < holdersLength) {
if (isUncurried || argsIndex < argsLength) {
result[offset + holders[holdersIndex]] = args[argsIndex++];
}
}
return result;
}
/**
* Copies the values of `source` to `array`.
*
* @private
* @param {Array} source The array to copy values from.
* @param {Array} [array=[]] The array to copy values to.
* @returns {Array} Returns `array`.
*/
function copyArray(source, array) {
var index = -1,
length = source.length;
array || (array = Array(length));
while (++index < length) {
array[index] = source[index];
}
return array;
}
/**
* Copies properties of `source` to `object`.
*
* @private
* @param {Object} source The object to copy properties from.
* @param {Array} props The property identifiers to copy.
* @param {Object} [object={}] The object to copy properties to.
* @param {Function} [customizer] The function to customize copied values.
* @returns {Object} Returns `object`.
*/
function copyObject(source, props, object, customizer) {
var isNew = !object;
object || (object = {});
var index = -1,
length = props.length;
while (++index < length) {
var key = props[index];
var newValue = customizer
? customizer(object[key], source[key], key, object, source)
: undefined;
if (newValue === undefined) {
newValue = source[key];
}
if (isNew) {
baseAssignValue(object, key, newValue);
} else {
assignValue(object, key, newValue);
}
}
return object;
}
/**
* Copies own symbols of `source` to `object`.
*
* @private
* @param {Object} source The object to copy symbols from.
* @param {Object} [object={}] The object to copy symbols to.
* @returns {Object} Returns `object`.
*/
function copySymbols(source, object) {
return copyObject(source, getSymbols(source), object);
}
/**
* Copies own and inherited symbols of `source` to `object`.
*
* @private
* @param {Object} source The object to copy symbols from.
* @param {Object} [object={}] The object to copy symbols to.
* @returns {Object} Returns `object`.
*/
function copySymbolsIn(source, object) {
return copyObject(source, getSymbolsIn(source), object);
}
/**
* Creates a function like `_.groupBy`.
*
* @private
* @param {Function} setter The function to set accumulator values.
* @param {Function} [initializer] The accumulator object initializer.
* @returns {Function} Returns the new aggregator function.
*/
function createAggregator(setter, initializer) {
return function(collection, iteratee) {
var func = isArray(collection) ? arrayAggregator : baseAggregator,
accumulator = initializer ? initializer() : {};
return func(collection, setter, getIteratee(iteratee, 2), accumulator);
};
}
/**
* Creates a function like `_.assign`.
*
* @private
* @param {Function} assigner The function to assign values.
* @returns {Function} Returns the new assigner function.
*/
function createAssigner(assigner) {
return baseRest(function(object, sources) {
var index = -1,
length = sources.length,
customizer = length > 1 ? sources[length - 1] : undefined,
guard = length > 2 ? sources[2] : undefined;
customizer = (assigner.length > 3 && typeof customizer == 'function')
? (length--, customizer)
: undefined;
if (guard && isIterateeCall(sources[0], sources[1], guard)) {
customizer = length < 3 ? undefined : customizer;
length = 1;
}
object = Object(object);
while (++index < length) {
var source = sources[index];
if (source) {
assigner(object, source, index, customizer);
}
}
return object;
});
}
/**
* Creates a `baseEach` or `baseEachRight` function.
*
* @private
* @param {Function} eachFunc The function to iterate over a collection.
* @param {boolean} [fromRight] Specify iterating from right to left.
* @returns {Function} Returns the new base function.
*/
function createBaseEach(eachFunc, fromRight) {
return function(collection, iteratee) {
if (collection == null) {
return collection;
}
if (!isArrayLike(collection)) {
return eachFunc(collection, iteratee);
}
var length = collection.length,
index = fromRight ? length : -1,
iterable = Object(collection);
while ((fromRight ? index-- : ++index < length)) {
if (iteratee(iterable[index], index, iterable) === false) {
break;
}
}
return collection;
};
}
/**
* Creates a base function for methods like `_.forIn` and `_.forOwn`.
*
* @private
* @param {boolean} [fromRight] Specify iterating from right to left.
* @returns {Function} Returns the new base function.
*/
function createBaseFor(fromRight) {
return function(object, iteratee, keysFunc) {
var index = -1,
iterable = Object(object),
props = keysFunc(object),
length = props.length;
while (length--) {
var key = props[fromRight ? length : ++index];
if (iteratee(iterable[key], key, iterable) === false) {
break;
}
}
return object;
};
}
/**
* Creates a function that wraps `func` to invoke it with the optional `this`
* binding of `thisArg`.
*
* @private
* @param {Function} func The function to wrap.
* @param {number} bitmask The bitmask flags. See `createWrap` for more details.
* @param {*} [thisArg] The `this` binding of `func`.
* @returns {Function} Returns the new wrapped function.
*/
function createBind(func, bitmask, thisArg) {
var isBind = bitmask & WRAP_BIND_FLAG,
Ctor = createCtor(func);
function wrapper() {
var fn = (this && this !== root && this instanceof wrapper) ? Ctor : func;
return fn.apply(isBind ? thisArg : this, arguments);
}
return wrapper;
}
/**
* Creates a function like `_.lowerFirst`.
*
* @private
* @param {string} methodName The name of the `String` case method to use.
* @returns {Function} Returns the new case function.
*/
function createCaseFirst(methodName) {
return function(string) {
string = toString(string);
var strSymbols = hasUnicode(string)
? stringToArray(string)
: undefined;
var chr = strSymbols
? strSymbols[0]
: string.charAt(0);
var trailing = strSymbols
? castSlice(strSymbols, 1).join('')
: string.slice(1);
return chr[methodName]() + trailing;
};
}
/**
* Creates a function like `_.camelCase`.
*
* @private
* @param {Function} callback The function to combine each word.
* @returns {Function} Returns the new compounder function.
*/
function createCompounder(callback) {
return function(string) {
return arrayReduce(words(deburr(string).replace(reApos, '')), callback, '');
};
}
/**
* Creates a function that produces an instance of `Ctor` regardless of
* whether it was invoked as part of a `new` expression or by `call` or `apply`.
*
* @private
* @param {Function} Ctor The constructor to wrap.
* @returns {Function} Returns the new wrapped function.
*/
function createCtor(Ctor) {
return function() {
// Use a `switch` statement to work with class constructors. See
// http://ecma-international.org/ecma-262/7.0/#sec-ecmascript-function-objects-call-thisargument-argumentslist
// for more details.
var args = arguments;
switch (args.length) {
case 0: return new Ctor;
case 1: return new Ctor(args[0]);
case 2: return new Ctor(args[0], args[1]);
case 3: return new Ctor(args[0], args[1], args[2]);
case 4: return new Ctor(args[0], args[1], args[2], args[3]);
case 5: return new Ctor(args[0], args[1], args[2], args[3], args[4]);
case 6: return new Ctor(args[0], args[1], args[2], args[3], args[4], args[5]);
case 7: return new Ctor(args[0], args[1], args[2], args[3], args[4], args[5], args[6]);
}
var thisBinding = baseCreate(Ctor.prototype),
result = Ctor.apply(thisBinding, args);
// Mimic the constructor's `return` behavior.
// See https://es5.github.io/#x13.2.2 for more details.
return isObject(result) ? result : thisBinding;
};
}
/**
* Creates a function that wraps `func` to enable currying.
*
* @private
* @param {Function} func The function to wrap.
* @param {number} bitmask The bitmask flags. See `createWrap` for more details.
* @param {number} arity The arity of `func`.
* @returns {Function} Returns the new wrapped function.
*/
function createCurry(func, bitmask, arity) {
var Ctor = createCtor(func);
function wrapper() {
var length = arguments.length,
args = Array(length),
index = length,
placeholder = getHolder(wrapper);
while (index--) {
args[index] = arguments[index];
}
var holders = (length < 3 && args[0] !== placeholder && args[length - 1] !== placeholder)
? []
: replaceHolders(args, placeholder);
length -= holders.length;
if (length < arity) {
return createRecurry(
func, bitmask, createHybrid, wrapper.placeholder, undefined,
args, holders, undefined, undefined, arity - length);
}
var fn = (this && this !== root && this instanceof wrapper) ? Ctor : func;
return apply(fn, this, args);
}
return wrapper;
}
/**
* Creates a `_.find` or `_.findLast` function.
*
* @private
* @param {Function} findIndexFunc The function to find the collection index.
* @returns {Function} Returns the new find function.
*/
function createFind(findIndexFunc) {
return function(collection, predicate, fromIndex) {
var iterable = Object(collection);
if (!isArrayLike(collection)) {
var iteratee = getIteratee(predicate, 3);
collection = keys(collection);
predicate = function(key) { return iteratee(iterable[key], key, iterable); };
}
var index = findIndexFunc(collection, predicate, fromIndex);
return index > -1 ? iterable[iteratee ? collection[index] : index] : undefined;
};
}
/**
* Creates a `_.flow` or `_.flowRight` function.
*
* @private
* @param {boolean} [fromRight] Specify iterating from right to left.
* @returns {Function} Returns the new flow function.
*/
function createFlow(fromRight) {
return flatRest(function(funcs) {
var length = funcs.length,
index = length,
prereq = LodashWrapper.prototype.thru;
if (fromRight) {
funcs.reverse();
}
while (index--) {
var func = funcs[index];
if (typeof func != 'function') {
throw new TypeError(FUNC_ERROR_TEXT);
}
if (prereq && !wrapper && getFuncName(func) == 'wrapper') {
var wrapper = new LodashWrapper([], true);
}
}
index = wrapper ? index : length;
while (++index < length) {
func = funcs[index];
var funcName = getFuncName(func),
data = funcName == 'wrapper' ? getData(func) : undefined;
if (data && isLaziable(data[0]) &&
data[1] == (WRAP_ARY_FLAG | WRAP_CURRY_FLAG | WRAP_PARTIAL_FLAG | WRAP_REARG_FLAG) &&
!data[4].length && data[9] == 1
) {
wrapper = wrapper[getFuncName(data[0])].apply(wrapper, data[3]);
} else {
wrapper = (func.length == 1 && isLaziable(func))
? wrapper[funcName]()
: wrapper.thru(func);
}
}
return function() {
var args = arguments,
value = args[0];
if (wrapper && args.length == 1 && isArray(value)) {
return wrapper.plant(value).value();
}
var index = 0,
result = length ? funcs[index].apply(this, args) : value;
while (++index < length) {
result = funcs[index].call(this, result);
}
return result;
};
});
}
/**
* Creates a function that wraps `func` to invoke it with optional `this`
* binding of `thisArg`, partial application, and currying.
*
* @private
* @param {Function|string} func The function or method name to wrap.
* @param {number} bitmask The bitmask flags. See `createWrap` for more details.
* @param {*} [thisArg] The `this` binding of `func`.
* @param {Array} [partials] The arguments to prepend to those provided to
* the new function.
* @param {Array} [holders] The `partials` placeholder indexes.
* @param {Array} [partialsRight] The arguments to append to those provided
* to the new function.
* @param {Array} [holdersRight] The `partialsRight` placeholder indexes.
* @param {Array} [argPos] The argument positions of the new function.
* @param {number} [ary] The arity cap of `func`.
* @param {number} [arity] The arity of `func`.
* @returns {Function} Returns the new wrapped function.
*/
function createHybrid(func, bitmask, thisArg, partials, holders, partialsRight, holdersRight, argPos, ary, arity) {
var isAry = bitmask & WRAP_ARY_FLAG,
isBind = bitmask & WRAP_BIND_FLAG,
isBindKey = bitmask & WRAP_BIND_KEY_FLAG,
isCurried = bitmask & (WRAP_CURRY_FLAG | WRAP_CURRY_RIGHT_FLAG),
isFlip = bitmask & WRAP_FLIP_FLAG,
Ctor = isBindKey ? undefined : createCtor(func);
function wrapper() {
var length = arguments.length,
args = Array(length),
index = length;
while (index--) {
args[index] = arguments[index];
}
if (isCurried) {
var placeholder = getHolder(wrapper),
holdersCount = countHolders(args, placeholder);
}
if (partials) {
args = composeArgs(args, partials, holders, isCurried);
}
if (partialsRight) {
args = composeArgsRight(args, partialsRight, holdersRight, isCurried);
}
length -= holdersCount;
if (isCurried && length < arity) {
var newHolders = replaceHolders(args, placeholder);
return createRecurry(
func, bitmask, createHybrid, wrapper.placeholder, thisArg,
args, newHolders, argPos, ary, arity - length
);
}
var thisBinding = isBind ? thisArg : this,
fn = isBindKey ? thisBinding[func] : func;
length = args.length;
if (argPos) {
args = reorder(args, argPos);
} else if (isFlip && length > 1) {
args.reverse();
}
if (isAry && ary < length) {
args.length = ary;
}
if (this && this !== root && this instanceof wrapper) {
fn = Ctor || createCtor(fn);
}
return fn.apply(thisBinding, args);
}
return wrapper;
}
/**
* Creates a function like `_.invertBy`.
*
* @private
* @param {Function} setter The function to set accumulator values.
* @param {Function} toIteratee The function to resolve iteratees.
* @returns {Function} Returns the new inverter function.
*/
function createInverter(setter, toIteratee) {
return function(object, iteratee) {
return baseInverter(object, setter, toIteratee(iteratee), {});
};
}
/**
* Creates a function that performs a mathematical operation on two values.
*
* @private
* @param {Function} operator The function to perform the operation.
* @param {number} [defaultValue] The value used for `undefined` arguments.
* @returns {Function} Returns the new mathematical operation function.
*/
function createMathOperation(operator, defaultValue) {
return function(value, other) {
var result;
if (value === undefined && other === undefined) {
return defaultValue;
}
if (value !== undefined) {
result = value;
}
if (other !== undefined) {
if (result === undefined) {
return other;
}
if (typeof value == 'string' || typeof other == 'string') {
value = baseToString(value);
other = baseToString(other);
} else {
value = baseToNumber(value);
other = baseToNumber(other);
}
result = operator(value, other);
}
return result;
};
}
/**
* Creates a function like `_.over`.
*
* @private
* @param {Function} arrayFunc The function to iterate over iteratees.
* @returns {Function} Returns the new over function.
*/
function createOver(arrayFunc) {
return flatRest(function(iteratees) {
iteratees = arrayMap(iteratees, baseUnary(getIteratee()));
return baseRest(function(args) {
var thisArg = this;
return arrayFunc(iteratees, function(iteratee) {
return apply(iteratee, thisArg, args);
});
});
});
}
/**
* Creates the padding for `string` based on `length`. The `chars` string
* is truncated if the number of characters exceeds `length`.
*
* @private
* @param {number} length The padding length.
* @param {string} [chars=' '] The string used as padding.
* @returns {string} Returns the padding for `string`.
*/
function createPadding(length, chars) {
chars = chars === undefined ? ' ' : baseToString(chars);
var charsLength = chars.length;
if (charsLength < 2) {
return charsLength ? baseRepeat(chars, length) : chars;
}
var result = baseRepeat(chars, nativeCeil(length / stringSize(chars)));
return hasUnicode(chars)
? castSlice(stringToArray(result), 0, length).join('')
: result.slice(0, length);
}
/**
* Creates a function that wraps `func` to invoke it with the `this` binding
* of `thisArg` and `partials` prepended to the arguments it receives.
*
* @private
* @param {Function} func The function to wrap.
* @param {number} bitmask The bitmask flags. See `createWrap` for more details.
* @param {*} thisArg The `this` binding of `func`.
* @param {Array} partials The arguments to prepend to those provided to
* the new function.
* @returns {Function} Returns the new wrapped function.
*/
function createPartial(func, bitmask, thisArg, partials) {
var isBind = bitmask & WRAP_BIND_FLAG,
Ctor = createCtor(func);
function wrapper() {
var argsIndex = -1,
argsLength = arguments.length,
leftIndex = -1,
leftLength = partials.length,
args = Array(leftLength + argsLength),
fn = (this && this !== root && this instanceof wrapper) ? Ctor : func;
while (++leftIndex < leftLength) {
args[leftIndex] = partials[leftIndex];
}
while (argsLength--) {
args[leftIndex++] = arguments[++argsIndex];
}
return apply(fn, isBind ? thisArg : this, args);
}
return wrapper;
}
/**
* Creates a `_.range` or `_.rangeRight` function.
*
* @private
* @param {boolean} [fromRight] Specify iterating from right to left.
* @returns {Function} Returns the new range function.
*/
function createRange(fromRight) {
return function(start, end, step) {
if (step && typeof step != 'number' && isIterateeCall(start, end, step)) {
end = step = undefined;
}
// Ensure the sign of `-0` is preserved.
start = toFinite(start);
if (end === undefined) {
end = start;
start = 0;
} else {
end = toFinite(end);
}
step = step === undefined ? (start < end ? 1 : -1) : toFinite(step);
return baseRange(start, end, step, fromRight);
};
}
/**
* Creates a function that performs a relational operation on two values.
*
* @private
* @param {Function} operator The function to perform the operation.
* @returns {Function} Returns the new relational operation function.
*/
function createRelationalOperation(operator) {
return function(value, other) {
if (!(typeof value == 'string' && typeof other == 'string')) {
value = toNumber(value);
other = toNumber(other);
}
return operator(value, other);
};
}
/**
* Creates a function that wraps `func` to continue currying.
*
* @private
* @param {Function} func The function to wrap.
* @param {number} bitmask The bitmask flags. See `createWrap` for more details.
* @param {Function} wrapFunc The function to create the `func` wrapper.
* @param {*} placeholder The placeholder value.
* @param {*} [thisArg] The `this` binding of `func`.
* @param {Array} [partials] The arguments to prepend to those provided to
* the new function.
* @param {Array} [holders] The `partials` placeholder indexes.
* @param {Array} [argPos] The argument positions of the new function.
* @param {number} [ary] The arity cap of `func`.
* @param {number} [arity] The arity of `func`.
* @returns {Function} Returns the new wrapped function.
*/
function createRecurry(func, bitmask, wrapFunc, placeholder, thisArg, partials, holders, argPos, ary, arity) {
var isCurry = bitmask & WRAP_CURRY_FLAG,
newHolders = isCurry ? holders : undefined,
newHoldersRight = isCurry ? undefined : holders,
newPartials = isCurry ? partials : undefined,
newPartialsRight = isCurry ? undefined : partials;
bitmask |= (isCurry ? WRAP_PARTIAL_FLAG : WRAP_PARTIAL_RIGHT_FLAG);
bitmask &= ~(isCurry ? WRAP_PARTIAL_RIGHT_FLAG : WRAP_PARTIAL_FLAG);
if (!(bitmask & WRAP_CURRY_BOUND_FLAG)) {
bitmask &= ~(WRAP_BIND_FLAG | WRAP_BIND_KEY_FLAG);
}
var newData = [
func, bitmask, thisArg, newPartials, newHolders, newPartialsRight,
newHoldersRight, argPos, ary, arity
];
var result = wrapFunc.apply(undefined, newData);
if (isLaziable(func)) {
setData(result, newData);
}
result.placeholder = placeholder;
return setWrapToString(result, func, bitmask);
}
/**
* Creates a function like `_.round`.
*
* @private
* @param {string} methodName The name of the `Math` method to use when rounding.
* @returns {Function} Returns the new round function.
*/
function createRound(methodName) {
var func = Math[methodName];
return function(number, precision) {
number = toNumber(number);
precision = precision == null ? 0 : nativeMin(toInteger(precision), 292);
if (precision) {
// Shift with exponential notation to avoid floating-point issues.
// See [MDN](https://mdn.io/round#Examples) for more details.
var pair = (toString(number) + 'e').split('e'),
value = func(pair[0] + 'e' + (+pair[1] + precision));
pair = (toString(value) + 'e').split('e');
return +(pair[0] + 'e' + (+pair[1] - precision));
}
return func(number);
};
}
/**
* Creates a set object of `values`.
*
* @private
* @param {Array} values The values to add to the set.
* @returns {Object} Returns the new set.
*/
var createSet = !(Set && (1 / setToArray(new Set([,-0]))[1]) == INFINITY) ? noop : function(values) {
return new Set(values);
};
/**
* Creates a `_.toPairs` or `_.toPairsIn` function.
*
* @private
* @param {Function} keysFunc The function to get the keys of a given object.
* @returns {Function} Returns the new pairs function.
*/
function createToPairs(keysFunc) {
return function(object) {
var tag = getTag(object);
if (tag == mapTag) {
return mapToArray(object);
}
if (tag == setTag) {
return setToPairs(object);
}
return baseToPairs(object, keysFunc(object));
};
}
/**
* Creates a function that either curries or invokes `func` with optional
* `this` binding and partially applied arguments.
*
* @private
* @param {Function|string} func The function or method name to wrap.
* @param {number} bitmask The bitmask flags.
* 1 - `_.bind`
* 2 - `_.bindKey`
* 4 - `_.curry` or `_.curryRight` of a bound function
* 8 - `_.curry`
* 16 - `_.curryRight`
* 32 - `_.partial`
* 64 - `_.partialRight`
* 128 - `_.rearg`
* 256 - `_.ary`
* 512 - `_.flip`
* @param {*} [thisArg] The `this` binding of `func`.
* @param {Array} [partials] The arguments to be partially applied.
* @param {Array} [holders] The `partials` placeholder indexes.
* @param {Array} [argPos] The argument positions of the new function.
* @param {number} [ary] The arity cap of `func`.
* @param {number} [arity] The arity of `func`.
* @returns {Function} Returns the new wrapped function.
*/
function createWrap(func, bitmask, thisArg, partials, holders, argPos, ary, arity) {
var isBindKey = bitmask & WRAP_BIND_KEY_FLAG;
if (!isBindKey && typeof func != 'function') {
throw new TypeError(FUNC_ERROR_TEXT);
}
var length = partials ? partials.length : 0;
if (!length) {
bitmask &= ~(WRAP_PARTIAL_FLAG | WRAP_PARTIAL_RIGHT_FLAG);
partials = holders = undefined;
}
ary = ary === undefined ? ary : nativeMax(toInteger(ary), 0);
arity = arity === undefined ? arity : toInteger(arity);
length -= holders ? holders.length : 0;
if (bitmask & WRAP_PARTIAL_RIGHT_FLAG) {
var partialsRight = partials,
holdersRight = holders;
partials = holders = undefined;
}
var data = isBindKey ? undefined : getData(func);
var newData = [
func, bitmask, thisArg, partials, holders, partialsRight, holdersRight,
argPos, ary, arity
];
if (data) {
mergeData(newData, data);
}
func = newData[0];
bitmask = newData[1];
thisArg = newData[2];
partials = newData[3];
holders = newData[4];
arity = newData[9] = newData[9] === undefined
? (isBindKey ? 0 : func.length)
: nativeMax(newData[9] - length, 0);
if (!arity && bitmask & (WRAP_CURRY_FLAG | WRAP_CURRY_RIGHT_FLAG)) {
bitmask &= ~(WRAP_CURRY_FLAG | WRAP_CURRY_RIGHT_FLAG);
}
if (!bitmask || bitmask == WRAP_BIND_FLAG) {
var result = createBind(func, bitmask, thisArg);
} else if (bitmask == WRAP_CURRY_FLAG || bitmask == WRAP_CURRY_RIGHT_FLAG) {
result = createCurry(func, bitmask, arity);
} else if ((bitmask == WRAP_PARTIAL_FLAG || bitmask == (WRAP_BIND_FLAG | WRAP_PARTIAL_FLAG)) && !holders.length) {
result = createPartial(func, bitmask, thisArg, partials);
} else {
result = createHybrid.apply(undefined, newData);
}
var setter = data ? baseSetData : setData;
return setWrapToString(setter(result, newData), func, bitmask);
}
/**
* Used by `_.defaults` to customize its `_.assignIn` use to assign properties
* of source objects to the destination object for all destination properties
* that resolve to `undefined`.
*
* @private
* @param {*} objValue The destination value.
* @param {*} srcValue The source value.
* @param {string} key The key of the property to assign.
* @param {Object} object The parent object of `objValue`.
* @returns {*} Returns the value to assign.
*/
function customDefaultsAssignIn(objValue, srcValue, key, object) {
if (objValue === undefined ||
(eq(objValue, objectProto[key]) && !hasOwnProperty.call(object, key))) {
return srcValue;
}
return objValue;
}
/**
* Used by `_.defaultsDeep` to customize its `_.merge` use to merge source
* objects into destination objects that are passed thru.
*
* @private
* @param {*} objValue The destination value.
* @param {*} srcValue The source value.
* @param {string} key The key of the property to merge.
* @param {Object} object The parent object of `objValue`.
* @param {Object} source The parent object of `srcValue`.
* @param {Object} [stack] Tracks traversed source values and their merged
* counterparts.
* @returns {*} Returns the value to assign.
*/
function customDefaultsMerge(objValue, srcValue, key, object, source, stack) {
if (isObject(objValue) && isObject(srcValue)) {
// Recursively merge objects and arrays (susceptible to call stack limits).
stack.set(srcValue, objValue);
baseMerge(objValue, srcValue, undefined, customDefaultsMerge, stack);
stack['delete'](srcValue);
}
return objValue;
}
/**
* Used by `_.omit` to customize its `_.cloneDeep` use to only clone plain
* objects.
*
* @private
* @param {*} value The value to inspect.
* @param {string} key The key of the property to inspect.
* @returns {*} Returns the uncloned value or `undefined` to defer cloning to `_.cloneDeep`.
*/
function customOmitClone(value) {
return isPlainObject(value) ? undefined : value;
}
/**
* A specialized version of `baseIsEqualDeep` for arrays with support for
* partial deep comparisons.
*
* @private
* @param {Array} array The array to compare.
* @param {Array} other The other array to compare.
* @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details.
* @param {Function} customizer The function to customize comparisons.
* @param {Function} equalFunc The function to determine equivalents of values.
* @param {Object} stack Tracks traversed `array` and `other` objects.
* @returns {boolean} Returns `true` if the arrays are equivalent, else `false`.
*/
function equalArrays(array, other, bitmask, customizer, equalFunc, stack) {
var isPartial = bitmask & COMPARE_PARTIAL_FLAG,
arrLength = array.length,
othLength = other.length;
if (arrLength != othLength && !(isPartial && othLength > arrLength)) {
return false;
}
// Assume cyclic values are equal.
var stacked = stack.get(array);
if (stacked && stack.get(other)) {
return stacked == other;
}
var index = -1,
result = true,
seen = (bitmask & COMPARE_UNORDERED_FLAG) ? new SetCache : undefined;
stack.set(array, other);
stack.set(other, array);
// Ignore non-index properties.
while (++index < arrLength) {
var arrValue = array[index],
othValue = other[index];
if (customizer) {
var compared = isPartial
? customizer(othValue, arrValue, index, other, array, stack)
: customizer(arrValue, othValue, index, array, other, stack);
}
if (compared !== undefined) {
if (compared) {
continue;
}
result = false;
break;
}
// Recursively compare arrays (susceptible to call stack limits).
if (seen) {
if (!arraySome(other, function(othValue, othIndex) {
if (!cacheHas(seen, othIndex) &&
(arrValue === othValue || equalFunc(arrValue, othValue, bitmask, customizer, stack))) {
return seen.push(othIndex);
}
})) {
result = false;
break;
}
} else if (!(
arrValue === othValue ||
equalFunc(arrValue, othValue, bitmask, customizer, stack)
)) {
result = false;
break;
}
}
stack['delete'](array);
stack['delete'](other);
return result;
}
/**
* A specialized version of `baseIsEqualDeep` for comparing objects of
* the same `toStringTag`.
*
* **Note:** This function only supports comparing values with tags of
* `Boolean`, `Date`, `Error`, `Number`, `RegExp`, or `String`.
*
* @private
* @param {Object} object The object to compare.
* @param {Object} other The other object to compare.
* @param {string} tag The `toStringTag` of the objects to compare.
* @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details.
* @param {Function} customizer The function to customize comparisons.
* @param {Function} equalFunc The function to determine equivalents of values.
* @param {Object} stack Tracks traversed `object` and `other` objects.
* @returns {boolean} Returns `true` if the objects are equivalent, else `false`.
*/
function equalByTag(object, other, tag, bitmask, customizer, equalFunc, stack) {
switch (tag) {
case dataViewTag:
if ((object.byteLength != other.byteLength) ||
(object.byteOffset != other.byteOffset)) {
return false;
}
object = object.buffer;
other = other.buffer;
case arrayBufferTag:
if ((object.byteLength != other.byteLength) ||
!equalFunc(new Uint8Array(object), new Uint8Array(other))) {
return false;
}
return true;
case boolTag:
case dateTag:
case numberTag:
// Coerce booleans to `1` or `0` and dates to milliseconds.
// Invalid dates are coerced to `NaN`.
return eq(+object, +other);
case errorTag:
return object.name == other.name && object.message == other.message;
case regexpTag:
case stringTag:
// Coerce regexes to strings and treat strings, primitives and objects,
// as equal. See http://www.ecma-international.org/ecma-262/7.0/#sec-regexp.prototype.tostring
// for more details.
return object == (other + '');
case mapTag:
var convert = mapToArray;
case setTag:
var isPartial = bitmask & COMPARE_PARTIAL_FLAG;
convert || (convert = setToArray);
if (object.size != other.size && !isPartial) {
return false;
}
// Assume cyclic values are equal.
var stacked = stack.get(object);
if (stacked) {
return stacked == other;
}
bitmask |= COMPARE_UNORDERED_FLAG;
// Recursively compare objects (susceptible to call stack limits).
stack.set(object, other);
var result = equalArrays(convert(object), convert(other), bitmask, customizer, equalFunc, stack);
stack['delete'](object);
return result;
case symbolTag:
if (symbolValueOf) {
return symbolValueOf.call(object) == symbolValueOf.call(other);
}
}
return false;
}
/**
* A specialized version of `baseIsEqualDeep` for objects with support for
* partial deep comparisons.
*
* @private
* @param {Object} object The object to compare.
* @param {Object} other The other object to compare.
* @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details.
* @param {Function} customizer The function to customize comparisons.
* @param {Function} equalFunc The function to determine equivalents of values.
* @param {Object} stack Tracks traversed `object` and `other` objects.
* @returns {boolean} Returns `true` if the objects are equivalent, else `false`.
*/
function equalObjects(object, other, bitmask, customizer, equalFunc, stack) {
var isPartial = bitmask & COMPARE_PARTIAL_FLAG,
objProps = getAllKeys(object),
objLength = objProps.length,
othProps = getAllKeys(other),
othLength = othProps.length;
if (objLength != othLength && !isPartial) {
return false;
}
var index = objLength;
while (index--) {
var key = objProps[index];
if (!(isPartial ? key in other : hasOwnProperty.call(other, key))) {
return false;
}
}
// Assume cyclic values are equal.
var stacked = stack.get(object);
if (stacked && stack.get(other)) {
return stacked == other;
}
var result = true;
stack.set(object, other);
stack.set(other, object);
var skipCtor = isPartial;
while (++index < objLength) {
key = objProps[index];
var objValue = object[key],
othValue = other[key];
if (customizer) {
var compared = isPartial
? customizer(othValue, objValue, key, other, object, stack)
: customizer(objValue, othValue, key, object, other, stack);
}
// Recursively compare objects (susceptible to call stack limits).
if (!(compared === undefined
? (objValue === othValue || equalFunc(objValue, othValue, bitmask, customizer, stack))
: compared
)) {
result = false;
break;
}
skipCtor || (skipCtor = key == 'constructor');
}
if (result && !skipCtor) {
var objCtor = object.constructor,
othCtor = other.constructor;
// Non `Object` object instances with different constructors are not equal.
if (objCtor != othCtor &&
('constructor' in object && 'constructor' in other) &&
!(typeof objCtor == 'function' && objCtor instanceof objCtor &&
typeof othCtor == 'function' && othCtor instanceof othCtor)) {
result = false;
}
}
stack['delete'](object);
stack['delete'](other);
return result;
}
/**
* A specialized version of `baseRest` which flattens the rest array.
*
* @private
* @param {Function} func The function to apply a rest parameter to.
* @returns {Function} Returns the new function.
*/
function flatRest(func) {
return setToString(overRest(func, undefined, flatten), func + '');
}
/**
* Creates an array of own enumerable property names and symbols of `object`.
*
* @private
* @param {Object} object The object to query.
* @returns {Array} Returns the array of property names and symbols.
*/
function getAllKeys(object) {
return baseGetAllKeys(object, keys, getSymbols);
}
/**
* Creates an array of own and inherited enumerable property names and
* symbols of `object`.
*
* @private
* @param {Object} object The object to query.
* @returns {Array} Returns the array of property names and symbols.
*/
function getAllKeysIn(object) {
return baseGetAllKeys(object, keysIn, getSymbolsIn);
}
/**
* Gets metadata for `func`.
*
* @private
* @param {Function} func The function to query.
* @returns {*} Returns the metadata for `func`.
*/
var getData = !metaMap ? noop : function(func) {
return metaMap.get(func);
};
/**
* Gets the name of `func`.
*
* @private
* @param {Function} func The function to query.
* @returns {string} Returns the function name.
*/
function getFuncName(func) {
var result = (func.name + ''),
array = realNames[result],
length = hasOwnProperty.call(realNames, result) ? array.length : 0;
while (length--) {
var data = array[length],
otherFunc = data.func;
if (otherFunc == null || otherFunc == func) {
return data.name;
}
}
return result;
}
/**
* Gets the argument placeholder value for `func`.
*
* @private
* @param {Function} func The function to inspect.
* @returns {*} Returns the placeholder value.
*/
function getHolder(func) {
var object = hasOwnProperty.call(lodash, 'placeholder') ? lodash : func;
return object.placeholder;
}
/**
* Gets the appropriate "iteratee" function. If `_.iteratee` is customized,
* this function returns the custom method, otherwise it returns `baseIteratee`.
* If arguments are provided, the chosen function is invoked with them and
* its result is returned.
*
* @private
* @param {*} [value] The value to convert to an iteratee.
* @param {number} [arity] The arity of the created iteratee.
* @returns {Function} Returns the chosen function or its result.
*/
function getIteratee() {
var result = lodash.iteratee || iteratee;
result = result === iteratee ? baseIteratee : result;
return arguments.length ? result(arguments[0], arguments[1]) : result;
}
/**
* Gets the data for `map`.
*
* @private
* @param {Object} map The map to query.
* @param {string} key The reference key.
* @returns {*} Returns the map data.
*/
function getMapData(map, key) {
var data = map.__data__;
return isKeyable(key)
? data[typeof key == 'string' ? 'string' : 'hash']
: data.map;
}
/**
* Gets the property names, values, and compare flags of `object`.
*
* @private
* @param {Object} object The object to query.
* @returns {Array} Returns the match data of `object`.
*/
function getMatchData(object) {
var result = keys(object),
length = result.length;
while (length--) {
var key = result[length],
value = object[key];
result[length] = [key, value, isStrictComparable(value)];
}
return result;
}
/**
* Gets the native function at `key` of `object`.
*
* @private
* @param {Object} object The object to query.
* @param {string} key The key of the method to get.
* @returns {*} Returns the function if it's native, else `undefined`.
*/
function getNative(object, key) {
var value = getValue(object, key);
return baseIsNative(value) ? value : undefined;
}
/**
* A specialized version of `baseGetTag` which ignores `Symbol.toStringTag` values.
*
* @private
* @param {*} value The value to query.
* @returns {string} Returns the raw `toStringTag`.
*/
function getRawTag(value) {
var isOwn = hasOwnProperty.call(value, symToStringTag),
tag = value[symToStringTag];
try {
value[symToStringTag] = undefined;
var unmasked = true;
} catch (e) {}
var result = nativeObjectToString.call(value);
if (unmasked) {
if (isOwn) {
value[symToStringTag] = tag;
} else {
delete value[symToStringTag];
}
}
return result;
}
/**
* Creates an array of the own enumerable symbols of `object`.
*
* @private
* @param {Object} object The object to query.
* @returns {Array} Returns the array of symbols.
*/
var getSymbols = !nativeGetSymbols ? stubArray : function(object) {
if (object == null) {
return [];
}
object = Object(object);
return arrayFilter(nativeGetSymbols(object), function(symbol) {
return propertyIsEnumerable.call(object, symbol);
});
};
/**
* Creates an array of the own and inherited enumerable symbols of `object`.
*
* @private
* @param {Object} object The object to query.
* @returns {Array} Returns the array of symbols.
*/
var getSymbolsIn = !nativeGetSymbols ? stubArray : function(object) {
var result = [];
while (object) {
arrayPush(result, getSymbols(object));
object = getPrototype(object);
}
return result;
};
/**
* Gets the `toStringTag` of `value`.
*
* @private
* @param {*} value The value to query.
* @returns {string} Returns the `toStringTag`.
*/
var getTag = baseGetTag;
// Fallback for data views, maps, sets, and weak maps in IE 11 and promises in Node.js < 6.
if ((DataView && getTag(new DataView(new ArrayBuffer(1))) != dataViewTag) ||
(Map && getTag(new Map) != mapTag) ||
(Promise && getTag(Promise.resolve()) != promiseTag) ||
(Set && getTag(new Set) != setTag) ||
(WeakMap && getTag(new WeakMap) != weakMapTag)) {
getTag = function(value) {
var result = baseGetTag(value),
Ctor = result == objectTag ? value.constructor : undefined,
ctorString = Ctor ? toSource(Ctor) : '';
if (ctorString) {
switch (ctorString) {
case dataViewCtorString: return dataViewTag;
case mapCtorString: return mapTag;
case promiseCtorString: return promiseTag;
case setCtorString: return setTag;
case weakMapCtorString: return weakMapTag;
}
}
return result;
};
}
/**
* Gets the view, applying any `transforms` to the `start` and `end` positions.
*
* @private
* @param {number} start The start of the view.
* @param {number} end The end of the view.
* @param {Array} transforms The transformations to apply to the view.
* @returns {Object} Returns an object containing the `start` and `end`
* positions of the view.
*/
function getView(start, end, transforms) {
var index = -1,
length = transforms.length;
while (++index < length) {
var data = transforms[index],
size = data.size;
switch (data.type) {
case 'drop': start += size; break;
case 'dropRight': end -= size; break;
case 'take': end = nativeMin(end, start + size); break;
case 'takeRight': start = nativeMax(start, end - size); break;
}
}
return { 'start': start, 'end': end };
}
/**
* Extracts wrapper details from the `source` body comment.
*
* @private
* @param {string} source The source to inspect.
* @returns {Array} Returns the wrapper details.
*/
function getWrapDetails(source) {
var match = source.match(reWrapDetails);
return match ? match[1].split(reSplitDetails) : [];
}
/**
* Checks if `path` exists on `object`.
*
* @private
* @param {Object} object The object to query.
* @param {Array|string} path The path to check.
* @param {Function} hasFunc The function to check properties.
* @returns {boolean} Returns `true` if `path` exists, else `false`.
*/
function hasPath(object, path, hasFunc) {
path = castPath(path, object);
var index = -1,
length = path.length,
result = false;
while (++index < length) {
var key = toKey(path[index]);
if (!(result = object != null && hasFunc(object, key))) {
break;
}
object = object[key];
}
if (result || ++index != length) {
return result;
}
length = object == null ? 0 : object.length;
return !!length && isLength(length) && isIndex(key, length) &&
(isArray(object) || isArguments(object));
}
/**
* Initializes an array clone.
*
* @private
* @param {Array} array The array to clone.
* @returns {Array} Returns the initialized clone.
*/
function initCloneArray(array) {
var length = array.length,
result = array.constructor(length);
// Add properties assigned by `RegExp#exec`.
if (length && typeof array[0] == 'string' && hasOwnProperty.call(array, 'index')) {
result.index = array.index;
result.input = array.input;
}
return result;
}
/**
* Initializes an object clone.
*
* @private
* @param {Object} object The object to clone.
* @returns {Object} Returns the initialized clone.
*/
function initCloneObject(object) {
return (typeof object.constructor == 'function' && !isPrototype(object))
? baseCreate(getPrototype(object))
: {};
}
/**
* Initializes an object clone based on its `toStringTag`.
*
* **Note:** This function only supports cloning values with tags of
* `Boolean`, `Date`, `Error`, `Number`, `RegExp`, or `String`.
*
* @private
* @param {Object} object The object to clone.
* @param {string} tag The `toStringTag` of the object to clone.
* @param {Function} cloneFunc The function to clone values.
* @param {boolean} [isDeep] Specify a deep clone.
* @returns {Object} Returns the initialized clone.
*/
function initCloneByTag(object, tag, cloneFunc, isDeep) {
var Ctor = object.constructor;
switch (tag) {
case arrayBufferTag:
return cloneArrayBuffer(object);
case boolTag:
case dateTag:
return new Ctor(+object);
case dataViewTag:
return cloneDataView(object, isDeep);
case float32Tag: case float64Tag:
case int8Tag: case int16Tag: case int32Tag:
case uint8Tag: case uint8ClampedTag: case uint16Tag: case uint32Tag:
return cloneTypedArray(object, isDeep);
case mapTag:
return cloneMap(object, isDeep, cloneFunc);
case numberTag:
case stringTag:
return new Ctor(object);
case regexpTag:
return cloneRegExp(object);
case setTag:
return cloneSet(object, isDeep, cloneFunc);
case symbolTag:
return cloneSymbol(object);
}
}
/**
* Inserts wrapper `details` in a comment at the top of the `source` body.
*
* @private
* @param {string} source The source to modify.
* @returns {Array} details The details to insert.
* @returns {string} Returns the modified source.
*/
function insertWrapDetails(source, details) {
var length = details.length;
if (!length) {
return source;
}
var lastIndex = length - 1;
details[lastIndex] = (length > 1 ? '& ' : '') + details[lastIndex];
details = details.join(length > 2 ? ', ' : ' ');
return source.replace(reWrapComment, '{\n/* [wrapped with ' + details + '] */\n');
}
/**
* Checks if `value` is a flattenable `arguments` object or array.
*
* @private
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is flattenable, else `false`.
*/
function isFlattenable(value) {
return isArray(value) || isArguments(value) ||
!!(spreadableSymbol && value && value[spreadableSymbol]);
}
/**
* Checks if `value` is a valid array-like index.
*
* @private
* @param {*} value The value to check.
* @param {number} [length=MAX_SAFE_INTEGER] The upper bounds of a valid index.
* @returns {boolean} Returns `true` if `value` is a valid index, else `false`.
*/
function isIndex(value, length) {
length = length == null ? MAX_SAFE_INTEGER : length;
return !!length &&
(typeof value == 'number' || reIsUint.test(value)) &&
(value > -1 && value % 1 == 0 && value < length);
}
/**
* Checks if the given arguments are from an iteratee call.
*
* @private
* @param {*} value The potential iteratee value argument.
* @param {*} index The potential iteratee index or key argument.
* @param {*} object The potential iteratee object argument.
* @returns {boolean} Returns `true` if the arguments are from an iteratee call,
* else `false`.
*/
function isIterateeCall(value, index, object) {
if (!isObject(object)) {
return false;
}
var type = typeof index;
if (type == 'number'
? (isArrayLike(object) && isIndex(index, object.length))
: (type == 'string' && index in object)
) {
return eq(object[index], value);
}
return false;
}
/**
* Checks if `value` is a property name and not a property path.
*
* @private
* @param {*} value The value to check.
* @param {Object} [object] The object to query keys on.
* @returns {boolean} Returns `true` if `value` is a property name, else `false`.
*/
function isKey(value, object) {
if (isArray(value)) {
return false;
}
var type = typeof value;
if (type == 'number' || type == 'symbol' || type == 'boolean' ||
value == null || isSymbol(value)) {
return true;
}
return reIsPlainProp.test(value) || !reIsDeepProp.test(value) ||
(object != null && value in Object(object));
}
/**
* Checks if `value` is suitable for use as unique object key.
*
* @private
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is suitable, else `false`.
*/
function isKeyable(value) {
var type = typeof value;
return (type == 'string' || type == 'number' || type == 'symbol' || type == 'boolean')
? (value !== '__proto__')
: (value === null);
}
/**
* Checks if `func` has a lazy counterpart.
*
* @private
* @param {Function} func The function to check.
* @returns {boolean} Returns `true` if `func` has a lazy counterpart,
* else `false`.
*/
function isLaziable(func) {
var funcName = getFuncName(func),
other = lodash[funcName];
if (typeof other != 'function' || !(funcName in LazyWrapper.prototype)) {
return false;
}
if (func === other) {
return true;
}
var data = getData(other);
return !!data && func === data[0];
}
/**
* Checks if `func` has its source masked.
*
* @private
* @param {Function} func The function to check.
* @returns {boolean} Returns `true` if `func` is masked, else `false`.
*/
function isMasked(func) {
return !!maskSrcKey && (maskSrcKey in func);
}
/**
* Checks if `func` is capable of being masked.
*
* @private
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `func` is maskable, else `false`.
*/
var isMaskable = coreJsData ? isFunction : stubFalse;
/**
* Checks if `value` is likely a prototype object.
*
* @private
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is a prototype, else `false`.
*/
function isPrototype(value) {
var Ctor = value && value.constructor,
proto = (typeof Ctor == 'function' && Ctor.prototype) || objectProto;
return value === proto;
}
/**
* Checks if `value` is suitable for strict equality comparisons, i.e. `===`.
*
* @private
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` if suitable for strict
* equality comparisons, else `false`.
*/
function isStrictComparable(value) {
return value === value && !isObject(value);
}
/**
* A specialized version of `matchesProperty` for source values suitable
* for strict equality comparisons, i.e. `===`.
*
* @private
* @param {string} key The key of the property to get.
* @param {*} srcValue The value to match.
* @returns {Function} Returns the new spec function.
*/
function matchesStrictComparable(key, srcValue) {
return function(object) {
if (object == null) {
return false;
}
return object[key] === srcValue &&
(srcValue !== undefined || (key in Object(object)));
};
}
/**
* A specialized version of `_.memoize` which clears the memoized function's
* cache when it exceeds `MAX_MEMOIZE_SIZE`.
*
* @private
* @param {Function} func The function to have its output memoized.
* @returns {Function} Returns the new memoized function.
*/
function memoizeCapped(func) {
var result = memoize(func, function(key) {
if (cache.size === MAX_MEMOIZE_SIZE) {
cache.clear();
}
return key;
});
var cache = result.cache;
return result;
}
/**
* Merges the function metadata of `source` into `data`.
*
* Merging metadata reduces the number of wrappers used to invoke a function.
* This is possible because methods like `_.bind`, `_.curry`, and `_.partial`
* may be applied regardless of execution order. Methods like `_.ary` and
* `_.rearg` modify function arguments, making the order in which they are
* executed important, preventing the merging of metadata. However, we make
* an exception for a safe combined case where curried functions have `_.ary`
* and or `_.rearg` applied.
*
* @private
* @param {Array} data The destination metadata.
* @param {Array} source The source metadata.
* @returns {Array} Returns `data`.
*/
function mergeData(data, source) {
var bitmask = data[1],
srcBitmask = source[1],
newBitmask = bitmask | srcBitmask,
isCommon = newBitmask < (WRAP_BIND_FLAG | WRAP_BIND_KEY_FLAG | WRAP_ARY_FLAG);
var isCombo =
((srcBitmask == WRAP_ARY_FLAG) && (bitmask == WRAP_CURRY_FLAG)) ||
((srcBitmask == WRAP_ARY_FLAG) && (bitmask == WRAP_REARG_FLAG) && (data[7].length <= source[8])) ||
((srcBitmask == (WRAP_ARY_FLAG | WRAP_REARG_FLAG)) && (source[7].length <= source[8]) && (bitmask == WRAP_CURRY_FLAG));
// Exit early if metadata can't be merged.
if (!(isCommon || isCombo)) {
return data;
}
// Use source `thisArg` if available.
if (srcBitmask & WRAP_BIND_FLAG) {
data[2] = source[2];
// Set when currying a bound function.
newBitmask |= bitmask & WRAP_BIND_FLAG ? 0 : WRAP_CURRY_BOUND_FLAG;
}
// Compose partial arguments.
var value = source[3];
if (value) {
var partials = data[3];
data[3] = partials ? composeArgs(partials, value, source[4]) : value;
data[4] = partials ? replaceHolders(data[3], PLACEHOLDER) : source[4];
}
// Compose partial right arguments.
value = source[5];
if (value) {
partials = data[5];
data[5] = partials ? composeArgsRight(partials, value, source[6]) : value;
data[6] = partials ? replaceHolders(data[5], PLACEHOLDER) : source[6];
}
// Use source `argPos` if available.
value = source[7];
if (value) {
data[7] = value;
}
// Use source `ary` if it's smaller.
if (srcBitmask & WRAP_ARY_FLAG) {
data[8] = data[8] == null ? source[8] : nativeMin(data[8], source[8]);
}
// Use source `arity` if one is not provided.
if (data[9] == null) {
data[9] = source[9];
}
// Use source `func` and merge bitmasks.
data[0] = source[0];
data[1] = newBitmask;
return data;
}
/**
* This function is like
* [`Object.keys`](http://ecma-international.org/ecma-262/7.0/#sec-object.keys)
* except that it includes inherited enumerable properties.
*
* @private
* @param {Object} object The object to query.
* @returns {Array} Returns the array of property names.
*/
function nativeKeysIn(object) {
var result = [];
if (object != null) {
for (var key in Object(object)) {
result.push(key);
}
}
return result;
}
/**
* Converts `value` to a string using `Object.prototype.toString`.
*
* @private
* @param {*} value The value to convert.
* @returns {string} Returns the converted string.
*/
function objectToString(value) {
return nativeObjectToString.call(value);
}
/**
* A specialized version of `baseRest` which transforms the rest array.
*
* @private
* @param {Function} func The function to apply a rest parameter to.
* @param {number} [start=func.length-1] The start position of the rest parameter.
* @param {Function} transform The rest array transform.
* @returns {Function} Returns the new function.
*/
function overRest(func, start, transform) {
start = nativeMax(start === undefined ? (func.length - 1) : start, 0);
return function() {
var args = arguments,
index = -1,
length = nativeMax(args.length - start, 0),
array = Array(length);
while (++index < length) {
array[index] = args[start + index];
}
index = -1;
var otherArgs = Array(start + 1);
while (++index < start) {
otherArgs[index] = args[index];
}
otherArgs[start] = transform(array);
return apply(func, this, otherArgs);
};
}
/**
* Gets the parent value at `path` of `object`.
*
* @private
* @param {Object} object The object to query.
* @param {Array} path The path to get the parent value of.
* @returns {*} Returns the parent value.
*/
function parent(object, path) {
return path.length < 2 ? object : baseGet(object, baseSlice(path, 0, -1));
}
/**
* Reorder `array` according to the specified indexes where the element at
* the first index is assigned as the first element, the element at
* the second index is assigned as the second element, and so on.
*
* @private
* @param {Array} array The array to reorder.
* @param {Array} indexes The arranged array indexes.
* @returns {Array} Returns `array`.
*/
function reorder(array, indexes) {
var arrLength = array.length,
length = nativeMin(indexes.length, arrLength),
oldArray = copyArray(array);
while (length--) {
var index = indexes[length];
array[length] = isIndex(index, arrLength) ? oldArray[index] : undefined;
}
return array;
}
/**
* Sets metadata for `func`.
*
* **Note:** If this function becomes hot, i.e. is invoked a lot in a short
* period of time, it will trip its breaker and transition to an identity
* function to avoid garbage collection pauses in V8. See
* [V8 issue 2070](https://bugs.chromium.org/p/v8/issues/detail?id=2070)
* for more details.
*
* @private
* @param {Function} func The function to associate metadata with.
* @param {*} data The metadata.
* @returns {Function} Returns `func`.
*/
var setData = shortOut(baseSetData);
/**
* A simple wrapper around the global [`setTimeout`](https://mdn.io/setTimeout).
*
* @private
* @param {Function} func The function to delay.
* @param {number} wait The number of milliseconds to delay invocation.
* @returns {number|Object} Returns the timer id or timeout object.
*/
var setTimeout = ctxSetTimeout || function(func, wait) {
return root.setTimeout(func, wait);
};
/**
* Sets the `toString` method of `func` to return `string`.
*
* @private
* @param {Function} func The function to modify.
* @param {Function} string The `toString` result.
* @returns {Function} Returns `func`.
*/
var setToString = shortOut(baseSetToString);
/**
* Sets the `toString` method of `wrapper` to mimic the source of `reference`
* with wrapper details in a comment at the top of the source body.
*
* @private
* @param {Function} wrapper The function to modify.
* @param {Function} reference The reference function.
* @param {number} bitmask The bitmask flags. See `createWrap` for more details.
* @returns {Function} Returns `wrapper`.
*/
function setWrapToString(wrapper, reference, bitmask) {
var source = (reference + '');
return setToString(wrapper, insertWrapDetails(source, updateWrapDetails(getWrapDetails(source), bitmask)));
}
/**
* Creates a function that'll short out and invoke `identity` instead
* of `func` when it's called `HOT_COUNT` or more times in `HOT_SPAN`
* milliseconds.
*
* @private
* @param {Function} func The function to restrict.
* @returns {Function} Returns the new shortable function.
*/
function shortOut(func) {
var count = 0,
lastCalled = 0;
return function() {
var stamp = nativeNow(),
remaining = HOT_SPAN - (stamp - lastCalled);
lastCalled = stamp;
if (remaining > 0) {
if (++count >= HOT_COUNT) {
return arguments[0];
}
} else {
count = 0;
}
return func.apply(undefined, arguments);
};
}
/**
* A specialized version of `_.shuffle` which mutates and sets the size of `array`.
*
* @private
* @param {Array} array The array to shuffle.
* @param {number} [size=array.length] The size of `array`.
* @returns {Array} Returns `array`.
*/
function shuffleSelf(array, size) {
var index = -1,
length = array.length,
lastIndex = length - 1;
size = size === undefined ? length : size;
while (++index < size) {
var rand = baseRandom(index, lastIndex),
value = array[rand];
array[rand] = array[index];
array[index] = value;
}
array.length = size;
return array;
}
/**
* Converts `string` to a property path array.
*
* @private
* @param {string} string The string to convert.
* @returns {Array} Returns the property path array.
*/
var stringToPath = memoizeCapped(function(string) {
var result = [];
if (reLeadingDot.test(string)) {
result.push('');
}
string.replace(rePropName, function(match, number, quote, string) {
result.push(quote ? string.replace(reEscapeChar, '$1') : (number || match));
});
return result;
});
/**
* Converts `value` to a string key if it's not a string or symbol.
*
* @private
* @param {*} value The value to inspect.
* @returns {string|symbol} Returns the key.
*/
function toKey(value) {
if (typeof value == 'string' || isSymbol(value)) {
return value;
}
var result = (value + '');
return (result == '0' && (1 / value) == -INFINITY) ? '-0' : result;
}
/**
* Converts `func` to its source code.
*
* @private
* @param {Function} func The function to convert.
* @returns {string} Returns the source code.
*/
function toSource(func) {
if (func != null) {
try {
return funcToString.call(func);
} catch (e) {}
try {
return (func + '');
} catch (e) {}
}
return '';
}
/**
* Updates wrapper `details` based on `bitmask` flags.
*
* @private
* @returns {Array} details The details to modify.
* @param {number} bitmask The bitmask flags. See `createWrap` for more details.
* @returns {Array} Returns `details`.
*/
function updateWrapDetails(details, bitmask) {
arrayEach(wrapFlags, function(pair) {
var value = '_.' + pair[0];
if ((bitmask & pair[1]) && !arrayIncludes(details, value)) {
details.push(value);
}
});
return details.sort();
}
/**
* Creates a clone of `wrapper`.
*
* @private
* @param {Object} wrapper The wrapper to clone.
* @returns {Object} Returns the cloned wrapper.
*/
function wrapperClone(wrapper) {
if (wrapper instanceof LazyWrapper) {
return wrapper.clone();
}
var result = new LodashWrapper(wrapper.__wrapped__, wrapper.__chain__);
result.__actions__ = copyArray(wrapper.__actions__);
result.__index__ = wrapper.__index__;
result.__values__ = wrapper.__values__;
return result;
}
/*------------------------------------------------------------------------*/
/**
* Creates an array of elements split into groups the length of `size`.
* If `array` can't be split evenly, the final chunk will be the remaining
* elements.
*
* @static
* @memberOf _
* @since 3.0.0
* @category Array
* @param {Array} array The array to process.
* @param {number} [size=1] The length of each chunk
* @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.
* @returns {Array} Returns the new array of chunks.
* @example
*
* _.chunk(['a', 'b', 'c', 'd'], 2);
* // => [['a', 'b'], ['c', 'd']]
*
* _.chunk(['a', 'b', 'c', 'd'], 3);
* // => [['a', 'b', 'c'], ['d']]
*/
function chunk(array, size, guard) {
if ((guard ? isIterateeCall(array, size, guard) : size === undefined)) {
size = 1;
} else {
size = nativeMax(toInteger(size), 0);
}
var length = array == null ? 0 : array.length;
if (!length || size < 1) {
return [];
}
var index = 0,
resIndex = 0,
result = Array(nativeCeil(length / size));
while (index < length) {
result[resIndex++] = baseSlice(array, index, (index += size));
}
return result;
}
/**
* Creates an array with all falsey values removed. The values `false`, `null`,
* `0`, `""`, `undefined`, and `NaN` are falsey.
*
* @static
* @memberOf _
* @since 0.1.0
* @category Array
* @param {Array} array The array to compact.
* @returns {Array} Returns the new array of filtered values.
* @example
*
* _.compact([0, 1, false, 2, '', 3]);
* // => [1, 2, 3]
*/
function compact(array) {
var index = -1,
length = array == null ? 0 : array.length,
resIndex = 0,
result = [];
while (++index < length) {
var value = array[index];
if (value) {
result[resIndex++] = value;
}
}
return result;
}
/**
* Creates a new array concatenating `array` with any additional arrays
* and/or values.
*
* @static
* @memberOf _
* @since 4.0.0
* @category Array
* @param {Array} array The array to concatenate.
* @param {...*} [values] The values to concatenate.
* @returns {Array} Returns the new concatenated array.
* @example
*
* var array = [1];
* var other = _.concat(array, 2, [3], [[4]]);
*
* console.log(other);
* // => [1, 2, 3, [4]]
*
* console.log(array);
* // => [1]
*/
function concat() {
var length = arguments.length;
if (!length) {
return [];
}
var args = Array(length - 1),
array = arguments[0],
index = length;
while (index--) {
args[index - 1] = arguments[index];
}
return arrayPush(isArray(array) ? copyArray(array) : [array], baseFlatten(args, 1));
}
/**
* Creates an array of `array` values not included in the other given arrays
* using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)
* for equality comparisons. The order and references of result values are
* determined by the first array.
*
* **Note:** Unlike `_.pullAll`, this method returns a new array.
*
* @static
* @memberOf _
* @since 0.1.0
* @category Array
* @param {Array} array The array to inspect.
* @param {...Array} [values] The values to exclude.
* @returns {Array} Returns the new array of filtered values.
* @see _.without, _.xor
* @example
*
* _.difference([2, 1], [2, 3]);
* // => [1]
*/
var difference = baseRest(function(array, values) {
return isArrayLikeObject(array)
? baseDifference(array, baseFlatten(values, 1, isArrayLikeObject, true))
: [];
});
/**
* This method is like `_.difference` except that it accepts `iteratee` which
* is invoked for each element of `array` and `values` to generate the criterion
* by which they're compared. The order and references of result values are
* determined by the first array. The iteratee is invoked with one argument:
* (value).
*
* **Note:** Unlike `_.pullAllBy`, this method returns a new array.
*
* @static
* @memberOf _
* @since 4.0.0
* @category Array
* @param {Array} array The array to inspect.
* @param {...Array} [values] The values to exclude.
* @param {Function} [iteratee=_.identity] The iteratee invoked per element.
* @returns {Array} Returns the new array of filtered values.
* @example
*
* _.differenceBy([2.1, 1.2], [2.3, 3.4], Math.floor);
* // => [1.2]
*
* // The `_.property` iteratee shorthand.
* _.differenceBy([{ 'x': 2 }, { 'x': 1 }], [{ 'x': 1 }], 'x');
* // => [{ 'x': 2 }]
*/
var differenceBy = baseRest(function(array, values) {
var iteratee = last(values);
if (isArrayLikeObject(iteratee)) {
iteratee = undefined;
}
return isArrayLikeObject(array)
? baseDifference(array, baseFlatten(values, 1, isArrayLikeObject, true), getIteratee(iteratee, 2))
: [];
});
/**
* This method is like `_.difference` except that it accepts `comparator`
* which is invoked to compare elements of `array` to `values`. The order and
* references of result values are determined by the first array. The comparator
* is invoked with two arguments: (arrVal, othVal).
*
* **Note:** Unlike `_.pullAllWith`, this method returns a new array.
*
* @static
* @memberOf _
* @since 4.0.0
* @category Array
* @param {Array} array The array to inspect.
* @param {...Array} [values] The values to exclude.
* @param {Function} [comparator] The comparator invoked per element.
* @returns {Array} Returns the new array of filtered values.
* @example
*
* var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }];
*
* _.differenceWith(objects, [{ 'x': 1, 'y': 2 }], _.isEqual);
* // => [{ 'x': 2, 'y': 1 }]
*/
var differenceWith = baseRest(function(array, values) {
var comparator = last(values);
if (isArrayLikeObject(comparator)) {
comparator = undefined;
}
return isArrayLikeObject(array)
? baseDifference(array, baseFlatten(values, 1, isArrayLikeObject, true), undefined, comparator)
: [];
});
/**
* Creates a slice of `array` with `n` elements dropped from the beginning.
*
* @static
* @memberOf _
* @since 0.5.0
* @category Array
* @param {Array} array The array to query.
* @param {number} [n=1] The number of elements to drop.
* @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.
* @returns {Array} Returns the slice of `array`.
* @example
*
* _.drop([1, 2, 3]);
* // => [2, 3]
*
* _.drop([1, 2, 3], 2);
* // => [3]
*
* _.drop([1, 2, 3], 5);
* // => []
*
* _.drop([1, 2, 3], 0);
* // => [1, 2, 3]
*/
function drop(array, n, guard) {
var length = array == null ? 0 : array.length;
if (!length) {
return [];
}
n = (guard || n === undefined) ? 1 : toInteger(n);
return baseSlice(array, n < 0 ? 0 : n, length);
}
/**
* Creates a slice of `array` with `n` elements dropped from the end.
*
* @static
* @memberOf _
* @since 3.0.0
* @category Array
* @param {Array} array The array to query.
* @param {number} [n=1] The number of elements to drop.
* @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.
* @returns {Array} Returns the slice of `array`.
* @example
*
* _.dropRight([1, 2, 3]);
* // => [1, 2]
*
* _.dropRight([1, 2, 3], 2);
* // => [1]
*
* _.dropRight([1, 2, 3], 5);
* // => []
*
* _.dropRight([1, 2, 3], 0);
* // => [1, 2, 3]
*/
function dropRight(array, n, guard) {
var length = array == null ? 0 : array.length;
if (!length) {
return [];
}
n = (guard || n === undefined) ? 1 : toInteger(n);
n = length - n;
return baseSlice(array, 0, n < 0 ? 0 : n);
}
/**
* Creates a slice of `array` excluding elements dropped from the end.
* Elements are dropped until `predicate` returns falsey. The predicate is
* invoked with three arguments: (value, index, array).
*
* @static
* @memberOf _
* @since 3.0.0
* @category Array
* @param {Array} array The array to query.
* @param {Function} [predicate=_.identity] The function invoked per iteration.
* @returns {Array} Returns the slice of `array`.
* @example
*
* var users = [
* { 'user': 'barney', 'active': true },
* { 'user': 'fred', 'active': false },
* { 'user': 'pebbles', 'active': false }
* ];
*
* _.dropRightWhile(users, function(o) { return !o.active; });
* // => objects for ['barney']
*
* // The `_.matches` iteratee shorthand.
* _.dropRightWhile(users, { 'user': 'pebbles', 'active': false });
* // => objects for ['barney', 'fred']
*
* // The `_.matchesProperty` iteratee shorthand.
* _.dropRightWhile(users, ['active', false]);
* // => objects for ['barney']
*
* // The `_.property` iteratee shorthand.
* _.dropRightWhile(users, 'active');
* // => objects for ['barney', 'fred', 'pebbles']
*/
function dropRightWhile(array, predicate) {
return (array && array.length)
? baseWhile(array, getIteratee(predicate, 3), true, true)
: [];
}
/**
* Creates a slice of `array` excluding elements dropped from the beginning.
* Elements are dropped until `predicate` returns falsey. The predicate is
* invoked with three arguments: (value, index, array).
*
* @static
* @memberOf _
* @since 3.0.0
* @category Array
* @param {Array} array The array to query.
* @param {Function} [predicate=_.identity] The function invoked per iteration.
* @returns {Array} Returns the slice of `array`.
* @example
*
* var users = [
* { 'user': 'barney', 'active': false },
* { 'user': 'fred', 'active': false },
* { 'user': 'pebbles', 'active': true }
* ];
*
* _.dropWhile(users, function(o) { return !o.active; });
* // => objects for ['pebbles']
*
* // The `_.matches` iteratee shorthand.
* _.dropWhile(users, { 'user': 'barney', 'active': false });
* // => objects for ['fred', 'pebbles']
*
* // The `_.matchesProperty` iteratee shorthand.
* _.dropWhile(users, ['active', false]);
* // => objects for ['pebbles']
*
* // The `_.property` iteratee shorthand.
* _.dropWhile(users, 'active');
* // => objects for ['barney', 'fred', 'pebbles']
*/
function dropWhile(array, predicate) {
return (array && array.length)
? baseWhile(array, getIteratee(predicate, 3), true)
: [];
}
/**
* Fills elements of `array` with `value` from `start` up to, but not
* including, `end`.
*
* **Note:** This method mutates `array`.
*
* @static
* @memberOf _
* @since 3.2.0
* @category Array
* @param {Array} array The array to fill.
* @param {*} value The value to fill `array` with.
* @param {number} [start=0] The start position.
* @param {number} [end=array.length] The end position.
* @returns {Array} Returns `array`.
* @example
*
* var array = [1, 2, 3];
*
* _.fill(array, 'a');
* console.log(array);
* // => ['a', 'a', 'a']
*
* _.fill(Array(3), 2);
* // => [2, 2, 2]
*
* _.fill([4, 6, 8, 10], '*', 1, 3);
* // => [4, '*', '*', 10]
*/
function fill(array, value, start, end) {
var length = array == null ? 0 : array.length;
if (!length) {
return [];
}
if (start && typeof start != 'number' && isIterateeCall(array, value, start)) {
start = 0;
end = length;
}
return baseFill(array, value, start, end);
}
/**
* This method is like `_.find` except that it returns the index of the first
* element `predicate` returns truthy for instead of the element itself.
*
* @static
* @memberOf _
* @since 1.1.0
* @category Array
* @param {Array} array The array to inspect.
* @param {Function} [predicate=_.identity] The function invoked per iteration.
* @param {number} [fromIndex=0] The index to search from.
* @returns {number} Returns the index of the found element, else `-1`.
* @example
*
* var users = [
* { 'user': 'barney', 'active': false },
* { 'user': 'fred', 'active': false },
* { 'user': 'pebbles', 'active': true }
* ];
*
* _.findIndex(users, function(o) { return o.user == 'barney'; });
* // => 0
*
* // The `_.matches` iteratee shorthand.
* _.findIndex(users, { 'user': 'fred', 'active': false });
* // => 1
*
* // The `_.matchesProperty` iteratee shorthand.
* _.findIndex(users, ['active', false]);
* // => 0
*
* // The `_.property` iteratee shorthand.
* _.findIndex(users, 'active');
* // => 2
*/
function findIndex(array, predicate, fromIndex) {
var length = array == null ? 0 : array.length;
if (!length) {
return -1;
}
var index = fromIndex == null ? 0 : toInteger(fromIndex);
if (index < 0) {
index = nativeMax(length + index, 0);
}
return baseFindIndex(array, getIteratee(predicate, 3), index);
}
/**
* This method is like `_.findIndex` except that it iterates over elements
* of `collection` from right to left.
*
* @static
* @memberOf _
* @since 2.0.0
* @category Array
* @param {Array} array The array to inspect.
* @param {Function} [predicate=_.identity] The function invoked per iteration.
* @param {number} [fromIndex=array.length-1] The index to search from.
* @returns {number} Returns the index of the found element, else `-1`.
* @example
*
* var users = [
* { 'user': 'barney', 'active': true },
* { 'user': 'fred', 'active': false },
* { 'user': 'pebbles', 'active': false }
* ];
*
* _.findLastIndex(users, function(o) { return o.user == 'pebbles'; });
* // => 2
*
* // The `_.matches` iteratee shorthand.
* _.findLastIndex(users, { 'user': 'barney', 'active': true });
* // => 0
*
* // The `_.matchesProperty` iteratee shorthand.
* _.findLastIndex(users, ['active', false]);
* // => 2
*
* // The `_.property` iteratee shorthand.
* _.findLastIndex(users, 'active');
* // => 0
*/
function findLastIndex(array, predicate, fromIndex) {
var length = array == null ? 0 : array.length;
if (!length) {
return -1;
}
var index = length - 1;
if (fromIndex !== undefined) {
index = toInteger(fromIndex);
index = fromIndex < 0
? nativeMax(length + index, 0)
: nativeMin(index, length - 1);
}
return baseFindIndex(array, getIteratee(predicate, 3), index, true);
}
/**
* Flattens `array` a single level deep.
*
* @static
* @memberOf _
* @since 0.1.0
* @category Array
* @param {Array} array The array to flatten.
* @returns {Array} Returns the new flattened array.
* @example
*
* _.flatten([1, [2, [3, [4]], 5]]);
* // => [1, 2, [3, [4]], 5]
*/
function flatten(array) {
var length = array == null ? 0 : array.length;
return length ? baseFlatten(array, 1) : [];
}
/**
* Recursively flattens `array`.
*
* @static
* @memberOf _
* @since 3.0.0
* @category Array
* @param {Array} array The array to flatten.
* @returns {Array} Returns the new flattened array.
* @example
*
* _.flattenDeep([1, [2, [3, [4]], 5]]);
* // => [1, 2, 3, 4, 5]
*/
function flattenDeep(array) {
var length = array == null ? 0 : array.length;
return length ? baseFlatten(array, INFINITY) : [];
}
/**
* Recursively flatten `array` up to `depth` times.
*
* @static
* @memberOf _
* @since 4.4.0
* @category Array
* @param {Array} array The array to flatten.
* @param {number} [depth=1] The maximum recursion depth.
* @returns {Array} Returns the new flattened array.
* @example
*
* var array = [1, [2, [3, [4]], 5]];
*
* _.flattenDepth(array, 1);
* // => [1, 2, [3, [4]], 5]
*
* _.flattenDepth(array, 2);
* // => [1, 2, 3, [4], 5]
*/
function flattenDepth(array, depth) {
var length = array == null ? 0 : array.length;
if (!length) {
return [];
}
depth = depth === undefined ? 1 : toInteger(depth);
return baseFlatten(array, depth);
}
/**
* The inverse of `_.toPairs`; this method returns an object composed
* from key-value `pairs`.
*
* @static
* @memberOf _
* @since 4.0.0
* @category Array
* @param {Array} pairs The key-value pairs.
* @returns {Object} Returns the new object.
* @example
*
* _.fromPairs([['a', 1], ['b', 2]]);
* // => { 'a': 1, 'b': 2 }
*/
function fromPairs(pairs) {
var index = -1,
length = pairs == null ? 0 : pairs.length,
result = {};
while (++index < length) {
var pair = pairs[index];
result[pair[0]] = pair[1];
}
return result;
}
/**
* Gets the first element of `array`.
*
* @static
* @memberOf _
* @since 0.1.0
* @alias first
* @category Array
* @param {Array} array The array to query.
* @returns {*} Returns the first element of `array`.
* @example
*
* _.head([1, 2, 3]);
* // => 1
*
* _.head([]);
* // => undefined
*/
function head(array) {
return (array && array.length) ? array[0] : undefined;
}
/**
* Gets the index at which the first occurrence of `value` is found in `array`
* using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)
* for equality comparisons. If `fromIndex` is negative, it's used as the
* offset from the end of `array`.
*
* @static
* @memberOf _
* @since 0.1.0
* @category Array
* @param {Array} array The array to inspect.
* @param {*} value The value to search for.
* @param {number} [fromIndex=0] The index to search from.
* @returns {number} Returns the index of the matched value, else `-1`.
* @example
*
* _.indexOf([1, 2, 1, 2], 2);
* // => 1
*
* // Search from the `fromIndex`.
* _.indexOf([1, 2, 1, 2], 2, 2);
* // => 3
*/
function indexOf(array, value, fromIndex) {
var length = array == null ? 0 : array.length;
if (!length) {
return -1;
}
var index = fromIndex == null ? 0 : toInteger(fromIndex);
if (index < 0) {
index = nativeMax(length + index, 0);
}
return baseIndexOf(array, value, index);
}
/**
* Gets all but the last element of `array`.
*
* @static
* @memberOf _
* @since 0.1.0
* @category Array
* @param {Array} array The array to query.
* @returns {Array} Returns the slice of `array`.
* @example
*
* _.initial([1, 2, 3]);
* // => [1, 2]
*/
function initial(array) {
var length = array == null ? 0 : array.length;
return length ? baseSlice(array, 0, -1) : [];
}
/**
* Creates an array of unique values that are included in all given arrays
* using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)
* for equality comparisons. The order and references of result values are
* determined by the first array.
*
* @static
* @memberOf _
* @since 0.1.0
* @category Array
* @param {...Array} [arrays] The arrays to inspect.
* @returns {Array} Returns the new array of intersecting values.
* @example
*
* _.intersection([2, 1], [2, 3]);
* // => [2]
*/
var intersection = baseRest(function(arrays) {
var mapped = arrayMap(arrays, castArrayLikeObject);
return (mapped.length && mapped[0] === arrays[0])
? baseIntersection(mapped)
: [];
});
/**
* This method is like `_.intersection` except that it accepts `iteratee`
* which is invoked for each element of each `arrays` to generate the criterion
* by which they're compared. The order and references of result values are
* determined by the first array. The iteratee is invoked with one argument:
* (value).
*
* @static
* @memberOf _
* @since 4.0.0
* @category Array
* @param {...Array} [arrays] The arrays to inspect.
* @param {Function} [iteratee=_.identity] The iteratee invoked per element.
* @returns {Array} Returns the new array of intersecting values.
* @example
*
* _.intersectionBy([2.1, 1.2], [2.3, 3.4], Math.floor);
* // => [2.1]
*
* // The `_.property` iteratee shorthand.
* _.intersectionBy([{ 'x': 1 }], [{ 'x': 2 }, { 'x': 1 }], 'x');
* // => [{ 'x': 1 }]
*/
var intersectionBy = baseRest(function(arrays) {
var iteratee = last(arrays),
mapped = arrayMap(arrays, castArrayLikeObject);
if (iteratee === last(mapped)) {
iteratee = undefined;
} else {
mapped.pop();
}
return (mapped.length && mapped[0] === arrays[0])
? baseIntersection(mapped, getIteratee(iteratee, 2))
: [];
});
/**
* This method is like `_.intersection` except that it accepts `comparator`
* which is invoked to compare elements of `arrays`. The order and references
* of result values are determined by the first array. The comparator is
* invoked with two arguments: (arrVal, othVal).
*
* @static
* @memberOf _
* @since 4.0.0
* @category Array
* @param {...Array} [arrays] The arrays to inspect.
* @param {Function} [comparator] The comparator invoked per element.
* @returns {Array} Returns the new array of intersecting values.
* @example
*
* var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }];
* var others = [{ 'x': 1, 'y': 1 }, { 'x': 1, 'y': 2 }];
*
* _.intersectionWith(objects, others, _.isEqual);
* // => [{ 'x': 1, 'y': 2 }]
*/
var intersectionWith = baseRest(function(arrays) {
var comparator = last(arrays),
mapped = arrayMap(arrays, castArrayLikeObject);
comparator = typeof comparator == 'function' ? comparator : undefined;
if (comparator) {
mapped.pop();
}
return (mapped.length && mapped[0] === arrays[0])
? baseIntersection(mapped, undefined, comparator)
: [];
});
/**
* Converts all elements in `array` into a string separated by `separator`.
*
* @static
* @memberOf _
* @since 4.0.0
* @category Array
* @param {Array} array The array to convert.
* @param {string} [separator=','] The element separator.
* @returns {string} Returns the joined string.
* @example
*
* _.join(['a', 'b', 'c'], '~');
* // => 'a~b~c'
*/
function join(array, separator) {
return array == null ? '' : nativeJoin.call(array, separator);
}
/**
* Gets the last element of `array`.
*
* @static
* @memberOf _
* @since 0.1.0
* @category Array
* @param {Array} array The array to query.
* @returns {*} Returns the last element of `array`.
* @example
*
* _.last([1, 2, 3]);
* // => 3
*/
function last(array) {
var length = array == null ? 0 : array.length;
return length ? array[length - 1] : undefined;
}
/**
* This method is like `_.indexOf` except that it iterates over elements of
* `array` from right to left.
*
* @static
* @memberOf _
* @since 0.1.0
* @category Array
* @param {Array} array The array to inspect.
* @param {*} value The value to search for.
* @param {number} [fromIndex=array.length-1] The index to search from.
* @returns {number} Returns the index of the matched value, else `-1`.
* @example
*
* _.lastIndexOf([1, 2, 1, 2], 2);
* // => 3
*
* // Search from the `fromIndex`.
* _.lastIndexOf([1, 2, 1, 2], 2, 2);
* // => 1
*/
function lastIndexOf(array, value, fromIndex) {
var length = array == null ? 0 : array.length;
if (!length) {
return -1;
}
var index = length;
if (fromIndex !== undefined) {
index = toInteger(fromIndex);
index = index < 0 ? nativeMax(length + index, 0) : nativeMin(index, length - 1);
}
return value === value
? strictLastIndexOf(array, value, index)
: baseFindIndex(array, baseIsNaN, index, true);
}
/**
* Gets the element at index `n` of `array`. If `n` is negative, the nth
* element from the end is returned.
*
* @static
* @memberOf _
* @since 4.11.0
* @category Array
* @param {Array} array The array to query.
* @param {number} [n=0] The index of the element to return.
* @returns {*} Returns the nth element of `array`.
* @example
*
* var array = ['a', 'b', 'c', 'd'];
*
* _.nth(array, 1);
* // => 'b'
*
* _.nth(array, -2);
* // => 'c';
*/
function nth(array, n) {
return (array && array.length) ? baseNth(array, toInteger(n)) : undefined;
}
/**
* Removes all given values from `array` using
* [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)
* for equality comparisons.
*
* **Note:** Unlike `_.without`, this method mutates `array`. Use `_.remove`
* to remove elements from an array by predicate.
*
* @static
* @memberOf _
* @since 2.0.0
* @category Array
* @param {Array} array The array to modify.
* @param {...*} [values] The values to remove.
* @returns {Array} Returns `array`.
* @example
*
* var array = ['a', 'b', 'c', 'a', 'b', 'c'];
*
* _.pull(array, 'a', 'c');
* console.log(array);
* // => ['b', 'b']
*/
var pull = baseRest(pullAll);
/**
* This method is like `_.pull` except that it accepts an array of values to remove.
*
* **Note:** Unlike `_.difference`, this method mutates `array`.
*
* @static
* @memberOf _
* @since 4.0.0
* @category Array
* @param {Array} array The array to modify.
* @param {Array} values The values to remove.
* @returns {Array} Returns `array`.
* @example
*
* var array = ['a', 'b', 'c', 'a', 'b', 'c'];
*
* _.pullAll(array, ['a', 'c']);
* console.log(array);
* // => ['b', 'b']
*/
function pullAll(array, values) {
return (array && array.length && values && values.length)
? basePullAll(array, values)
: array;
}
/**
* This method is like `_.pullAll` except that it accepts `iteratee` which is
* invoked for each element of `array` and `values` to generate the criterion
* by which they're compared. The iteratee is invoked with one argument: (value).
*
* **Note:** Unlike `_.differenceBy`, this method mutates `array`.
*
* @static
* @memberOf _
* @since 4.0.0
* @category Array
* @param {Array} array The array to modify.
* @param {Array} values The values to remove.
* @param {Function} [iteratee=_.identity] The iteratee invoked per element.
* @returns {Array} Returns `array`.
* @example
*
* var array = [{ 'x': 1 }, { 'x': 2 }, { 'x': 3 }, { 'x': 1 }];
*
* _.pullAllBy(array, [{ 'x': 1 }, { 'x': 3 }], 'x');
* console.log(array);
* // => [{ 'x': 2 }]
*/
function pullAllBy(array, values, iteratee) {
return (array && array.length && values && values.length)
? basePullAll(array, values, getIteratee(iteratee, 2))
: array;
}
/**
* This method is like `_.pullAll` except that it accepts `comparator` which
* is invoked to compare elements of `array` to `values`. The comparator is
* invoked with two arguments: (arrVal, othVal).
*
* **Note:** Unlike `_.differenceWith`, this method mutates `array`.
*
* @static
* @memberOf _
* @since 4.6.0
* @category Array
* @param {Array} array The array to modify.
* @param {Array} values The values to remove.
* @param {Function} [comparator] The comparator invoked per element.
* @returns {Array} Returns `array`.
* @example
*
* var array = [{ 'x': 1, 'y': 2 }, { 'x': 3, 'y': 4 }, { 'x': 5, 'y': 6 }];
*
* _.pullAllWith(array, [{ 'x': 3, 'y': 4 }], _.isEqual);
* console.log(array);
* // => [{ 'x': 1, 'y': 2 }, { 'x': 5, 'y': 6 }]
*/
function pullAllWith(array, values, comparator) {
return (array && array.length && values && values.length)
? basePullAll(array, values, undefined, comparator)
: array;
}
/**
* Removes elements from `array` corresponding to `indexes` and returns an
* array of removed elements.
*
* **Note:** Unlike `_.at`, this method mutates `array`.
*
* @static
* @memberOf _
* @since 3.0.0
* @category Array
* @param {Array} array The array to modify.
* @param {...(number|number[])} [indexes] The indexes of elements to remove.
* @returns {Array} Returns the new array of removed elements.
* @example
*
* var array = ['a', 'b', 'c', 'd'];
* var pulled = _.pullAt(array, [1, 3]);
*
* console.log(array);
* // => ['a', 'c']
*
* console.log(pulled);
* // => ['b', 'd']
*/
var pullAt = flatRest(function(array, indexes) {
var length = array == null ? 0 : array.length,
result = baseAt(array, indexes);
basePullAt(array, arrayMap(indexes, function(index) {
return isIndex(index, length) ? +index : index;
}).sort(compareAscending));
return result;
});
/**
* Removes all elements from `array` that `predicate` returns truthy for
* and returns an array of the removed elements. The predicate is invoked
* with three arguments: (value, index, array).
*
* **Note:** Unlike `_.filter`, this method mutates `array`. Use `_.pull`
* to pull elements from an array by value.
*
* @static
* @memberOf _
* @since 2.0.0
* @category Array
* @param {Array} array The array to modify.
* @param {Function} [predicate=_.identity] The function invoked per iteration.
* @returns {Array} Returns the new array of removed elements.
* @example
*
* var array = [1, 2, 3, 4];
* var evens = _.remove(array, function(n) {
* return n % 2 == 0;
* });
*
* console.log(array);
* // => [1, 3]
*
* console.log(evens);
* // => [2, 4]
*/
function remove(array, predicate) {
var result = [];
if (!(array && array.length)) {
return result;
}
var index = -1,
indexes = [],
length = array.length;
predicate = getIteratee(predicate, 3);
while (++index < length) {
var value = array[index];
if (predicate(value, index, array)) {
result.push(value);
indexes.push(index);
}
}
basePullAt(array, indexes);
return result;
}
/**
* Reverses `array` so that the first element becomes the last, the second
* element becomes the second to last, and so on.
*
* **Note:** This method mutates `array` and is based on
* [`Array#reverse`](https://mdn.io/Array/reverse).
*
* @static
* @memberOf _
* @since 4.0.0
* @category Array
* @param {Array} array The array to modify.
* @returns {Array} Returns `array`.
* @example
*
* var array = [1, 2, 3];
*
* _.reverse(array);
* // => [3, 2, 1]
*
* console.log(array);
* // => [3, 2, 1]
*/
function reverse(array) {
return array == null ? array : nativeReverse.call(array);
}
/**
* Creates a slice of `array` from `start` up to, but not including, `end`.
*
* **Note:** This method is used instead of
* [`Array#slice`](https://mdn.io/Array/slice) to ensure dense arrays are
* returned.
*
* @static
* @memberOf _
* @since 3.0.0
* @category Array
* @param {Array} array The array to slice.
* @param {number} [start=0] The start position.
* @param {number} [end=array.length] The end position.
* @returns {Array} Returns the slice of `array`.
*/
function slice(array, start, end) {
var length = array == null ? 0 : array.length;
if (!length) {
return [];
}
if (end && typeof end != 'number' && isIterateeCall(array, start, end)) {
start = 0;
end = length;
}
else {
start = start == null ? 0 : toInteger(start);
end = end === undefined ? length : toInteger(end);
}
return baseSlice(array, start, end);
}
/**
* Uses a binary search to determine the lowest index at which `value`
* should be inserted into `array` in order to maintain its sort order.
*
* @static
* @memberOf _
* @since 0.1.0
* @category Array
* @param {Array} array The sorted array to inspect.
* @param {*} value The value to evaluate.
* @returns {number} Returns the index at which `value` should be inserted
* into `array`.
* @example
*
* _.sortedIndex([30, 50], 40);
* // => 1
*/
function sortedIndex(array, value) {
return baseSortedIndex(array, value);
}
/**
* This method is like `_.sortedIndex` except that it accepts `iteratee`
* which is invoked for `value` and each element of `array` to compute their
* sort ranking. The iteratee is invoked with one argument: (value).
*
* @static
* @memberOf _
* @since 4.0.0
* @category Array
* @param {Array} array The sorted array to inspect.
* @param {*} value The value to evaluate.
* @param {Function} [iteratee=_.identity] The iteratee invoked per element.
* @returns {number} Returns the index at which `value` should be inserted
* into `array`.
* @example
*
* var objects = [{ 'x': 4 }, { 'x': 5 }];
*
* _.sortedIndexBy(objects, { 'x': 4 }, function(o) { return o.x; });
* // => 0
*
* // The `_.property` iteratee shorthand.
* _.sortedIndexBy(objects, { 'x': 4 }, 'x');
* // => 0
*/
function sortedIndexBy(array, value, iteratee) {
return baseSortedIndexBy(array, value, getIteratee(iteratee, 2));
}
/**
* This method is like `_.indexOf` except that it performs a binary
* search on a sorted `array`.
*
* @static
* @memberOf _
* @since 4.0.0
* @category Array
* @param {Array} array The array to inspect.
* @param {*} value The value to search for.
* @returns {number} Returns the index of the matched value, else `-1`.
* @example
*
* _.sortedIndexOf([4, 5, 5, 5, 6], 5);
* // => 1
*/
function sortedIndexOf(array, value) {
var length = array == null ? 0 : array.length;
if (length) {
var index = baseSortedIndex(array, value);
if (index < length && eq(array[index], value)) {
return index;
}
}
return -1;
}
/**
* This method is like `_.sortedIndex` except that it returns the highest
* index at which `value` should be inserted into `array` in order to
* maintain its sort order.
*
* @static
* @memberOf _
* @since 3.0.0
* @category Array
* @param {Array} array The sorted array to inspect.
* @param {*} value The value to evaluate.
* @returns {number} Returns the index at which `value` should be inserted
* into `array`.
* @example
*
* _.sortedLastIndex([4, 5, 5, 5, 6], 5);
* // => 4
*/
function sortedLastIndex(array, value) {
return baseSortedIndex(array, value, true);
}
/**
* This method is like `_.sortedLastIndex` except that it accepts `iteratee`
* which is invoked for `value` and each element of `array` to compute their
* sort ranking. The iteratee is invoked with one argument: (value).
*
* @static
* @memberOf _
* @since 4.0.0
* @category Array
* @param {Array} array The sorted array to inspect.
* @param {*} value The value to evaluate.
* @param {Function} [iteratee=_.identity] The iteratee invoked per element.
* @returns {number} Returns the index at which `value` should be inserted
* into `array`.
* @example
*
* var objects = [{ 'x': 4 }, { 'x': 5 }];
*
* _.sortedLastIndexBy(objects, { 'x': 4 }, function(o) { return o.x; });
* // => 1
*
* // The `_.property` iteratee shorthand.
* _.sortedLastIndexBy(objects, { 'x': 4 }, 'x');
* // => 1
*/
function sortedLastIndexBy(array, value, iteratee) {
return baseSortedIndexBy(array, value, getIteratee(iteratee, 2), true);
}
/**
* This method is like `_.lastIndexOf` except that it performs a binary
* search on a sorted `array`.
*
* @static
* @memberOf _
* @since 4.0.0
* @category Array
* @param {Array} array The array to inspect.
* @param {*} value The value to search for.
* @returns {number} Returns the index of the matched value, else `-1`.
* @example
*
* _.sortedLastIndexOf([4, 5, 5, 5, 6], 5);
* // => 3
*/
function sortedLastIndexOf(array, value) {
var length = array == null ? 0 : array.length;
if (length) {
var index = baseSortedIndex(array, value, true) - 1;
if (eq(array[index], value)) {
return index;
}
}
return -1;
}
/**
* This method is like `_.uniq` except that it's designed and optimized
* for sorted arrays.
*
* @static
* @memberOf _
* @since 4.0.0
* @category Array
* @param {Array} array The array to inspect.
* @returns {Array} Returns the new duplicate free array.
* @example
*
* _.sortedUniq([1, 1, 2]);
* // => [1, 2]
*/
function sortedUniq(array) {
return (array && array.length)
? baseSortedUniq(array)
: [];
}
/**
* This method is like `_.uniqBy` except that it's designed and optimized
* for sorted arrays.
*
* @static
* @memberOf _
* @since 4.0.0
* @category Array
* @param {Array} array The array to inspect.
* @param {Function} [iteratee] The iteratee invoked per element.
* @returns {Array} Returns the new duplicate free array.
* @example
*
* _.sortedUniqBy([1.1, 1.2, 2.3, 2.4], Math.floor);
* // => [1.1, 2.3]
*/
function sortedUniqBy(array, iteratee) {
return (array && array.length)
? baseSortedUniq(array, getIteratee(iteratee, 2))
: [];
}
/**
* Gets all but the first element of `array`.
*
* @static
* @memberOf _
* @since 4.0.0
* @category Array
* @param {Array} array The array to query.
* @returns {Array} Returns the slice of `array`.
* @example
*
* _.tail([1, 2, 3]);
* // => [2, 3]
*/
function tail(array) {
var length = array == null ? 0 : array.length;
return length ? baseSlice(array, 1, length) : [];
}
/**
* Creates a slice of `array` with `n` elements taken from the beginning.
*
* @static
* @memberOf _
* @since 0.1.0
* @category Array
* @param {Array} array The array to query.
* @param {number} [n=1] The number of elements to take.
* @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.
* @returns {Array} Returns the slice of `array`.
* @example
*
* _.take([1, 2, 3]);
* // => [1]
*
* _.take([1, 2, 3], 2);
* // => [1, 2]
*
* _.take([1, 2, 3], 5);
* // => [1, 2, 3]
*
* _.take([1, 2, 3], 0);
* // => []
*/
function take(array, n, guard) {
if (!(array && array.length)) {
return [];
}
n = (guard || n === undefined) ? 1 : toInteger(n);
return baseSlice(array, 0, n < 0 ? 0 : n);
}
/**
* Creates a slice of `array` with `n` elements taken from the end.
*
* @static
* @memberOf _
* @since 3.0.0
* @category Array
* @param {Array} array The array to query.
* @param {number} [n=1] The number of elements to take.
* @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.
* @returns {Array} Returns the slice of `array`.
* @example
*
* _.takeRight([1, 2, 3]);
* // => [3]
*
* _.takeRight([1, 2, 3], 2);
* // => [2, 3]
*
* _.takeRight([1, 2, 3], 5);
* // => [1, 2, 3]
*
* _.takeRight([1, 2, 3], 0);
* // => []
*/
function takeRight(array, n, guard) {
var length = array == null ? 0 : array.length;
if (!length) {
return [];
}
n = (guard || n === undefined) ? 1 : toInteger(n);
n = length - n;
return baseSlice(array, n < 0 ? 0 : n, length);
}
/**
* Creates a slice of `array` with elements taken from the end. Elements are
* taken until `predicate` returns falsey. The predicate is invoked with
* three arguments: (value, index, array).
*
* @static
* @memberOf _
* @since 3.0.0
* @category Array
* @param {Array} array The array to query.
* @param {Function} [predicate=_.identity] The function invoked per iteration.
* @returns {Array} Returns the slice of `array`.
* @example
*
* var users = [
* { 'user': 'barney', 'active': true },
* { 'user': 'fred', 'active': false },
* { 'user': 'pebbles', 'active': false }
* ];
*
* _.takeRightWhile(users, function(o) { return !o.active; });
* // => objects for ['fred', 'pebbles']
*
* // The `_.matches` iteratee shorthand.
* _.takeRightWhile(users, { 'user': 'pebbles', 'active': false });
* // => objects for ['pebbles']
*
* // The `_.matchesProperty` iteratee shorthand.
* _.takeRightWhile(users, ['active', false]);
* // => objects for ['fred', 'pebbles']
*
* // The `_.property` iteratee shorthand.
* _.takeRightWhile(users, 'active');
* // => []
*/
function takeRightWhile(array, predicate) {
return (array && array.length)
? baseWhile(array, getIteratee(predicate, 3), false, true)
: [];
}
/**
* Creates a slice of `array` with elements taken from the beginning. Elements
* are taken until `predicate` returns falsey. The predicate is invoked with
* three arguments: (value, index, array).
*
* @static
* @memberOf _
* @since 3.0.0
* @category Array
* @param {Array} array The array to query.
* @param {Function} [predicate=_.identity] The function invoked per iteration.
* @returns {Array} Returns the slice of `array`.
* @example
*
* var users = [
* { 'user': 'barney', 'active': false },
* { 'user': 'fred', 'active': false },
* { 'user': 'pebbles', 'active': true }
* ];
*
* _.takeWhile(users, function(o) { return !o.active; });
* // => objects for ['barney', 'fred']
*
* // The `_.matches` iteratee shorthand.
* _.takeWhile(users, { 'user': 'barney', 'active': false });
* // => objects for ['barney']
*
* // The `_.matchesProperty` iteratee shorthand.
* _.takeWhile(users, ['active', false]);
* // => objects for ['barney', 'fred']
*
* // The `_.property` iteratee shorthand.
* _.takeWhile(users, 'active');
* // => []
*/
function takeWhile(array, predicate) {
return (array && array.length)
? baseWhile(array, getIteratee(predicate, 3))
: [];
}
/**
* Creates an array of unique values, in order, from all given arrays using
* [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)
* for equality comparisons.
*
* @static
* @memberOf _
* @since 0.1.0
* @category Array
* @param {...Array} [arrays] The arrays to inspect.
* @returns {Array} Returns the new array of combined values.
* @example
*
* _.union([2], [1, 2]);
* // => [2, 1]
*/
var union = baseRest(function(arrays) {
return baseUniq(baseFlatten(arrays, 1, isArrayLikeObject, true));
});
/**
* This method is like `_.union` except that it accepts `iteratee` which is
* invoked for each element of each `arrays` to generate the criterion by
* which uniqueness is computed. Result values are chosen from the first
* array in which the value occurs. The iteratee is invoked with one argument:
* (value).
*
* @static
* @memberOf _
* @since 4.0.0
* @category Array
* @param {...Array} [arrays] The arrays to inspect.
* @param {Function} [iteratee=_.identity] The iteratee invoked per element.
* @returns {Array} Returns the new array of combined values.
* @example
*
* _.unionBy([2.1], [1.2, 2.3], Math.floor);
* // => [2.1, 1.2]
*
* // The `_.property` iteratee shorthand.
* _.unionBy([{ 'x': 1 }], [{ 'x': 2 }, { 'x': 1 }], 'x');
* // => [{ 'x': 1 }, { 'x': 2 }]
*/
var unionBy = baseRest(function(arrays) {
var iteratee = last(arrays);
if (isArrayLikeObject(iteratee)) {
iteratee = undefined;
}
return baseUniq(baseFlatten(arrays, 1, isArrayLikeObject, true), getIteratee(iteratee, 2));
});
/**
* This method is like `_.union` except that it accepts `comparator` which
* is invoked to compare elements of `arrays`. Result values are chosen from
* the first array in which the value occurs. The comparator is invoked
* with two arguments: (arrVal, othVal).
*
* @static
* @memberOf _
* @since 4.0.0
* @category Array
* @param {...Array} [arrays] The arrays to inspect.
* @param {Function} [comparator] The comparator invoked per element.
* @returns {Array} Returns the new array of combined values.
* @example
*
* var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }];
* var others = [{ 'x': 1, 'y': 1 }, { 'x': 1, 'y': 2 }];
*
* _.unionWith(objects, others, _.isEqual);
* // => [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }, { 'x': 1, 'y': 1 }]
*/
var unionWith = baseRest(function(arrays) {
var comparator = last(arrays);
comparator = typeof comparator == 'function' ? comparator : undefined;
return baseUniq(baseFlatten(arrays, 1, isArrayLikeObject, true), undefined, comparator);
});
/**
* Creates a duplicate-free version of an array, using
* [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)
* for equality comparisons, in which only the first occurrence of each element
* is kept. The order of result values is determined by the order they occur
* in the array.
*
* @static
* @memberOf _
* @since 0.1.0
* @category Array
* @param {Array} array The array to inspect.
* @returns {Array} Returns the new duplicate free array.
* @example
*
* _.uniq([2, 1, 2]);
* // => [2, 1]
*/
function uniq(array) {
return (array && array.length) ? baseUniq(array) : [];
}
/**
* This method is like `_.uniq` except that it accepts `iteratee` which is
* invoked for each element in `array` to generate the criterion by which
* uniqueness is computed. The order of result values is determined by the
* order they occur in the array. The iteratee is invoked with one argument:
* (value).
*
* @static
* @memberOf _
* @since 4.0.0
* @category Array
* @param {Array} array The array to inspect.
* @param {Function} [iteratee=_.identity] The iteratee invoked per element.
* @returns {Array} Returns the new duplicate free array.
* @example
*
* _.uniqBy([2.1, 1.2, 2.3], Math.floor);
* // => [2.1, 1.2]
*
* // The `_.property` iteratee shorthand.
* _.uniqBy([{ 'x': 1 }, { 'x': 2 }, { 'x': 1 }], 'x');
* // => [{ 'x': 1 }, { 'x': 2 }]
*/
function uniqBy(array, iteratee) {
return (array && array.length) ? baseUniq(array, getIteratee(iteratee, 2)) : [];
}
/**
* This method is like `_.uniq` except that it accepts `comparator` which
* is invoked to compare elements of `array`. The order of result values is
* determined by the order they occur in the array.The comparator is invoked
* with two arguments: (arrVal, othVal).
*
* @static
* @memberOf _
* @since 4.0.0
* @category Array
* @param {Array} array The array to inspect.
* @param {Function} [comparator] The comparator invoked per element.
* @returns {Array} Returns the new duplicate free array.
* @example
*
* var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }, { 'x': 1, 'y': 2 }];
*
* _.uniqWith(objects, _.isEqual);
* // => [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }]
*/
function uniqWith(array, comparator) {
comparator = typeof comparator == 'function' ? comparator : undefined;
return (array && array.length) ? baseUniq(array, undefined, comparator) : [];
}
/**
* This method is like `_.zip` except that it accepts an array of grouped
* elements and creates an array regrouping the elements to their pre-zip
* configuration.
*
* @static
* @memberOf _
* @since 1.2.0
* @category Array
* @param {Array} array The array of grouped elements to process.
* @returns {Array} Returns the new array of regrouped elements.
* @example
*
* var zipped = _.zip(['a', 'b'], [1, 2], [true, false]);
* // => [['a', 1, true], ['b', 2, false]]
*
* _.unzip(zipped);
* // => [['a', 'b'], [1, 2], [true, false]]
*/
function unzip(array) {
if (!(array && array.length)) {
return [];
}
var length = 0;
array = arrayFilter(array, function(group) {
if (isArrayLikeObject(group)) {
length = nativeMax(group.length, length);
return true;
}
});
return baseTimes(length, function(index) {
return arrayMap(array, baseProperty(index));
});
}
/**
* This method is like `_.unzip` except that it accepts `iteratee` to specify
* how regrouped values should be combined. The iteratee is invoked with the
* elements of each group: (...group).
*
* @static
* @memberOf _
* @since 3.8.0
* @category Array
* @param {Array} array The array of grouped elements to process.
* @param {Function} [iteratee=_.identity] The function to combine
* regrouped values.
* @returns {Array} Returns the new array of regrouped elements.
* @example
*
* var zipped = _.zip([1, 2], [10, 20], [100, 200]);
* // => [[1, 10, 100], [2, 20, 200]]
*
* _.unzipWith(zipped, _.add);
* // => [3, 30, 300]
*/
function unzipWith(array, iteratee) {
if (!(array && array.length)) {
return [];
}
var result = unzip(array);
if (iteratee == null) {
return result;
}
return arrayMap(result, function(group) {
return apply(iteratee, undefined, group);
});
}
/**
* Creates an array excluding all given values using
* [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)
* for equality comparisons.
*
* **Note:** Unlike `_.pull`, this method returns a new array.
*
* @static
* @memberOf _
* @since 0.1.0
* @category Array
* @param {Array} array The array to inspect.
* @param {...*} [values] The values to exclude.
* @returns {Array} Returns the new array of filtered values.
* @see _.difference, _.xor
* @example
*
* _.without([2, 1, 2, 3], 1, 2);
* // => [3]
*/
var without = baseRest(function(array, values) {
return isArrayLikeObject(array)
? baseDifference(array, values)
: [];
});
/**
* Creates an array of unique values that is the
* [symmetric difference](https://en.wikipedia.org/wiki/Symmetric_difference)
* of the given arrays. The order of result values is determined by the order
* they occur in the arrays.
*
* @static
* @memberOf _
* @since 2.4.0
* @category Array
* @param {...Array} [arrays] The arrays to inspect.
* @returns {Array} Returns the new array of filtered values.
* @see _.difference, _.without
* @example
*
* _.xor([2, 1], [2, 3]);
* // => [1, 3]
*/
var xor = baseRest(function(arrays) {
return baseXor(arrayFilter(arrays, isArrayLikeObject));
});
/**
* This method is like `_.xor` except that it accepts `iteratee` which is
* invoked for each element of each `arrays` to generate the criterion by
* which by which they're compared. The order of result values is determined
* by the order they occur in the arrays. The iteratee is invoked with one
* argument: (value).
*
* @static
* @memberOf _
* @since 4.0.0
* @category Array
* @param {...Array} [arrays] The arrays to inspect.
* @param {Function} [iteratee=_.identity] The iteratee invoked per element.
* @returns {Array} Returns the new array of filtered values.
* @example
*
* _.xorBy([2.1, 1.2], [2.3, 3.4], Math.floor);
* // => [1.2, 3.4]
*
* // The `_.property` iteratee shorthand.
* _.xorBy([{ 'x': 1 }], [{ 'x': 2 }, { 'x': 1 }], 'x');
* // => [{ 'x': 2 }]
*/
var xorBy = baseRest(function(arrays) {
var iteratee = last(arrays);
if (isArrayLikeObject(iteratee)) {
iteratee = undefined;
}
return baseXor(arrayFilter(arrays, isArrayLikeObject), getIteratee(iteratee, 2));
});
/**
* This method is like `_.xor` except that it accepts `comparator` which is
* invoked to compare elements of `arrays`. The order of result values is
* determined by the order they occur in the arrays. The comparator is invoked
* with two arguments: (arrVal, othVal).
*
* @static
* @memberOf _
* @since 4.0.0
* @category Array
* @param {...Array} [arrays] The arrays to inspect.
* @param {Function} [comparator] The comparator invoked per element.
* @returns {Array} Returns the new array of filtered values.
* @example
*
* var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }];
* var others = [{ 'x': 1, 'y': 1 }, { 'x': 1, 'y': 2 }];
*
* _.xorWith(objects, others, _.isEqual);
* // => [{ 'x': 2, 'y': 1 }, { 'x': 1, 'y': 1 }]
*/
var xorWith = baseRest(function(arrays) {
var comparator = last(arrays);
comparator = typeof comparator == 'function' ? comparator : undefined;
return baseXor(arrayFilter(arrays, isArrayLikeObject), undefined, comparator);
});
/**
* Creates an array of grouped elements, the first of which contains the
* first elements of the given arrays, the second of which contains the
* second elements of the given arrays, and so on.
*
* @static
* @memberOf _
* @since 0.1.0
* @category Array
* @param {...Array} [arrays] The arrays to process.
* @returns {Array} Returns the new array of grouped elements.
* @example
*
* _.zip(['a', 'b'], [1, 2], [true, false]);
* // => [['a', 1, true], ['b', 2, false]]
*/
var zip = baseRest(unzip);
/**
* This method is like `_.fromPairs` except that it accepts two arrays,
* one of property identifiers and one of corresponding values.
*
* @static
* @memberOf _
* @since 0.4.0
* @category Array
* @param {Array} [props=[]] The property identifiers.
* @param {Array} [values=[]] The property values.
* @returns {Object} Returns the new object.
* @example
*
* _.zipObject(['a', 'b'], [1, 2]);
* // => { 'a': 1, 'b': 2 }
*/
function zipObject(props, values) {
return baseZipObject(props || [], values || [], assignValue);
}
/**
* This method is like `_.zipObject` except that it supports property paths.
*
* @static
* @memberOf _
* @since 4.1.0
* @category Array
* @param {Array} [props=[]] The property identifiers.
* @param {Array} [values=[]] The property values.
* @returns {Object} Returns the new object.
* @example
*
* _.zipObjectDeep(['a.b[0].c', 'a.b[1].d'], [1, 2]);
* // => { 'a': { 'b': [{ 'c': 1 }, { 'd': 2 }] } }
*/
function zipObjectDeep(props, values) {
return baseZipObject(props || [], values || [], baseSet);
}
/**
* This method is like `_.zip` except that it accepts `iteratee` to specify
* how grouped values should be combined. The iteratee is invoked with the
* elements of each group: (...group).
*
* @static
* @memberOf _
* @since 3.8.0
* @category Array
* @param {...Array} [arrays] The arrays to process.
* @param {Function} [iteratee=_.identity] The function to combine
* grouped values.
* @returns {Array} Returns the new array of grouped elements.
* @example
*
* _.zipWith([1, 2], [10, 20], [100, 200], function(a, b, c) {
* return a + b + c;
* });
* // => [111, 222]
*/
var zipWith = baseRest(function(arrays) {
var length = arrays.length,
iteratee = length > 1 ? arrays[length - 1] : undefined;
iteratee = typeof iteratee == 'function' ? (arrays.pop(), iteratee) : undefined;
return unzipWith(arrays, iteratee);
});
/*------------------------------------------------------------------------*/
/**
* Creates a `lodash` wrapper instance that wraps `value` with explicit method
* chain sequences enabled. The result of such sequences must be unwrapped
* with `_#value`.
*
* @static
* @memberOf _
* @since 1.3.0
* @category Seq
* @param {*} value The value to wrap.
* @returns {Object} Returns the new `lodash` wrapper instance.
* @example
*
* var users = [
* { 'user': 'barney', 'age': 36 },
* { 'user': 'fred', 'age': 40 },
* { 'user': 'pebbles', 'age': 1 }
* ];
*
* var youngest = _
* .chain(users)
* .sortBy('age')
* .map(function(o) {
* return o.user + ' is ' + o.age;
* })
* .head()
* .value();
* // => 'pebbles is 1'
*/
function chain(value) {
var result = lodash(value);
result.__chain__ = true;
return result;
}
/**
* This method invokes `interceptor` and returns `value`. The interceptor
* is invoked with one argument; (value). The purpose of this method is to
* "tap into" a method chain sequence in order to modify intermediate results.
*
* @static
* @memberOf _
* @since 0.1.0
* @category Seq
* @param {*} value The value to provide to `interceptor`.
* @param {Function} interceptor The function to invoke.
* @returns {*} Returns `value`.
* @example
*
* _([1, 2, 3])
* .tap(function(array) {
* // Mutate input array.
* array.pop();
* })
* .reverse()
* .value();
* // => [2, 1]
*/
function tap(value, interceptor) {
interceptor(value);
return value;
}
/**
* This method is like `_.tap` except that it returns the result of `interceptor`.
* The purpose of this method is to "pass thru" values replacing intermediate
* results in a method chain sequence.
*
* @static
* @memberOf _
* @since 3.0.0
* @category Seq
* @param {*} value The value to provide to `interceptor`.
* @param {Function} interceptor The function to invoke.
* @returns {*} Returns the result of `interceptor`.
* @example
*
* _(' abc ')
* .chain()
* .trim()
* .thru(function(value) {
* return [value];
* })
* .value();
* // => ['abc']
*/
function thru(value, interceptor) {
return interceptor(value);
}
/**
* This method is the wrapper version of `_.at`.
*
* @name at
* @memberOf _
* @since 1.0.0
* @category Seq
* @param {...(string|string[])} [paths] The property paths to pick.
* @returns {Object} Returns the new `lodash` wrapper instance.
* @example
*
* var object = { 'a': [{ 'b': { 'c': 3 } }, 4] };
*
* _(object).at(['a[0].b.c', 'a[1]']).value();
* // => [3, 4]
*/
var wrapperAt = flatRest(function(paths) {
var length = paths.length,
start = length ? paths[0] : 0,
value = this.__wrapped__,
interceptor = function(object) { return baseAt(object, paths); };
if (length > 1 || this.__actions__.length ||
!(value instanceof LazyWrapper) || !isIndex(start)) {
return this.thru(interceptor);
}
value = value.slice(start, +start + (length ? 1 : 0));
value.__actions__.push({
'func': thru,
'args': [interceptor],
'thisArg': undefined
});
return new LodashWrapper(value, this.__chain__).thru(function(array) {
if (length && !array.length) {
array.push(undefined);
}
return array;
});
});
/**
* Creates a `lodash` wrapper instance with explicit method chain sequences enabled.
*
* @name chain
* @memberOf _
* @since 0.1.0
* @category Seq
* @returns {Object} Returns the new `lodash` wrapper instance.
* @example
*
* var users = [
* { 'user': 'barney', 'age': 36 },
* { 'user': 'fred', 'age': 40 }
* ];
*
* // A sequence without explicit chaining.
* _(users).head();
* // => { 'user': 'barney', 'age': 36 }
*
* // A sequence with explicit chaining.
* _(users)
* .chain()
* .head()
* .pick('user')
* .value();
* // => { 'user': 'barney' }
*/
function wrapperChain() {
return chain(this);
}
/**
* Executes the chain sequence and returns the wrapped result.
*
* @name commit
* @memberOf _
* @since 3.2.0
* @category Seq
* @returns {Object} Returns the new `lodash` wrapper instance.
* @example
*
* var array = [1, 2];
* var wrapped = _(array).push(3);
*
* console.log(array);
* // => [1, 2]
*
* wrapped = wrapped.commit();
* console.log(array);
* // => [1, 2, 3]
*
* wrapped.last();
* // => 3
*
* console.log(array);
* // => [1, 2, 3]
*/
function wrapperCommit() {
return new LodashWrapper(this.value(), this.__chain__);
}
/**
* Gets the next value on a wrapped object following the
* [iterator protocol](https://mdn.io/iteration_protocols#iterator).
*
* @name next
* @memberOf _
* @since 4.0.0
* @category Seq
* @returns {Object} Returns the next iterator value.
* @example
*
* var wrapped = _([1, 2]);
*
* wrapped.next();
* // => { 'done': false, 'value': 1 }
*
* wrapped.next();
* // => { 'done': false, 'value': 2 }
*
* wrapped.next();
* // => { 'done': true, 'value': undefined }
*/
function wrapperNext() {
if (this.__values__ === undefined) {
this.__values__ = toArray(this.value());
}
var done = this.__index__ >= this.__values__.length,
value = done ? undefined : this.__values__[this.__index__++];
return { 'done': done, 'value': value };
}
/**
* Enables the wrapper to be iterable.
*
* @name Symbol.iterator
* @memberOf _
* @since 4.0.0
* @category Seq
* @returns {Object} Returns the wrapper object.
* @example
*
* var wrapped = _([1, 2]);
*
* wrapped[Symbol.iterator]() === wrapped;
* // => true
*
* Array.from(wrapped);
* // => [1, 2]
*/
function wrapperToIterator() {
return this;
}
/**
* Creates a clone of the chain sequence planting `value` as the wrapped value.
*
* @name plant
* @memberOf _
* @since 3.2.0
* @category Seq
* @param {*} value The value to plant.
* @returns {Object} Returns the new `lodash` wrapper instance.
* @example
*
* function square(n) {
* return n * n;
* }
*
* var wrapped = _([1, 2]).map(square);
* var other = wrapped.plant([3, 4]);
*
* other.value();
* // => [9, 16]
*
* wrapped.value();
* // => [1, 4]
*/
function wrapperPlant(value) {
var result,
parent = this;
while (parent instanceof baseLodash) {
var clone = wrapperClone(parent);
clone.__index__ = 0;
clone.__values__ = undefined;
if (result) {
previous.__wrapped__ = clone;
} else {
result = clone;
}
var previous = clone;
parent = parent.__wrapped__;
}
previous.__wrapped__ = value;
return result;
}
/**
* This method is the wrapper version of `_.reverse`.
*
* **Note:** This method mutates the wrapped array.
*
* @name reverse
* @memberOf _
* @since 0.1.0
* @category Seq
* @returns {Object} Returns the new `lodash` wrapper instance.
* @example
*
* var array = [1, 2, 3];
*
* _(array).reverse().value()
* // => [3, 2, 1]
*
* console.log(array);
* // => [3, 2, 1]
*/
function wrapperReverse() {
var value = this.__wrapped__;
if (value instanceof LazyWrapper) {
var wrapped = value;
if (this.__actions__.length) {
wrapped = new LazyWrapper(this);
}
wrapped = wrapped.reverse();
wrapped.__actions__.push({
'func': thru,
'args': [reverse],
'thisArg': undefined
});
return new LodashWrapper(wrapped, this.__chain__);
}
return this.thru(reverse);
}
/**
* Executes the chain sequence to resolve the unwrapped value.
*
* @name value
* @memberOf _
* @since 0.1.0
* @alias toJSON, valueOf
* @category Seq
* @returns {*} Returns the resolved unwrapped value.
* @example
*
* _([1, 2, 3]).value();
* // => [1, 2, 3]
*/
function wrapperValue() {
return baseWrapperValue(this.__wrapped__, this.__actions__);
}
/*------------------------------------------------------------------------*/
/**
* Creates an object composed of keys generated from the results of running
* each element of `collection` thru `iteratee`. The corresponding value of
* each key is the number of times the key was returned by `iteratee`. The
* iteratee is invoked with one argument: (value).
*
* @static
* @memberOf _
* @since 0.5.0
* @category Collection
* @param {Array|Object} collection The collection to iterate over.
* @param {Function} [iteratee=_.identity] The iteratee to transform keys.
* @returns {Object} Returns the composed aggregate object.
* @example
*
* _.countBy([6.1, 4.2, 6.3], Math.floor);
* // => { '4': 1, '6': 2 }
*
* // The `_.property` iteratee shorthand.
* _.countBy(['one', 'two', 'three'], 'length');
* // => { '3': 2, '5': 1 }
*/
var countBy = createAggregator(function(result, value, key) {
if (hasOwnProperty.call(result, key)) {
++result[key];
} else {
baseAssignValue(result, key, 1);
}
});
/**
* Checks if `predicate` returns truthy for **all** elements of `collection`.
* Iteration is stopped once `predicate` returns falsey. The predicate is
* invoked with three arguments: (value, index|key, collection).
*
* **Note:** This method returns `true` for
* [empty collections](https://en.wikipedia.org/wiki/Empty_set) because
* [everything is true](https://en.wikipedia.org/wiki/Vacuous_truth) of
* elements of empty collections.
*
* @static
* @memberOf _
* @since 0.1.0
* @category Collection
* @param {Array|Object} collection The collection to iterate over.
* @param {Function} [predicate=_.identity] The function invoked per iteration.
* @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.
* @returns {boolean} Returns `true` if all elements pass the predicate check,
* else `false`.
* @example
*
* _.every([true, 1, null, 'yes'], Boolean);
* // => false
*
* var users = [
* { 'user': 'barney', 'age': 36, 'active': false },
* { 'user': 'fred', 'age': 40, 'active': false }
* ];
*
* // The `_.matches` iteratee shorthand.
* _.every(users, { 'user': 'barney', 'active': false });
* // => false
*
* // The `_.matchesProperty` iteratee shorthand.
* _.every(users, ['active', false]);
* // => true
*
* // The `_.property` iteratee shorthand.
* _.every(users, 'active');
* // => false
*/
function every(collection, predicate, guard) {
var func = isArray(collection) ? arrayEvery : baseEvery;
if (guard && isIterateeCall(collection, predicate, guard)) {
predicate = undefined;
}
return func(collection, getIteratee(predicate, 3));
}
/**
* Iterates over elements of `collection`, returning an array of all elements
* `predicate` returns truthy for. The predicate is invoked with three
* arguments: (value, index|key, collection).
*
* **Note:** Unlike `_.remove`, this method returns a new array.
*
* @static
* @memberOf _
* @since 0.1.0
* @category Collection
* @param {Array|Object} collection The collection to iterate over.
* @param {Function} [predicate=_.identity] The function invoked per iteration.
* @returns {Array} Returns the new filtered array.
* @see _.reject
* @example
*
* var users = [
* { 'user': 'barney', 'age': 36, 'active': true },
* { 'user': 'fred', 'age': 40, 'active': false }
* ];
*
* _.filter(users, function(o) { return !o.active; });
* // => objects for ['fred']
*
* // The `_.matches` iteratee shorthand.
* _.filter(users, { 'age': 36, 'active': true });
* // => objects for ['barney']
*
* // The `_.matchesProperty` iteratee shorthand.
* _.filter(users, ['active', false]);
* // => objects for ['fred']
*
* // The `_.property` iteratee shorthand.
* _.filter(users, 'active');
* // => objects for ['barney']
*/
function filter(collection, predicate) {
var func = isArray(collection) ? arrayFilter : baseFilter;
return func(collection, getIteratee(predicate, 3));
}
/**
* Iterates over elements of `collection`, returning the first element
* `predicate` returns truthy for. The predicate is invoked with three
* arguments: (value, index|key, collection).
*
* @static
* @memberOf _
* @since 0.1.0
* @category Collection
* @param {Array|Object} collection The collection to inspect.
* @param {Function} [predicate=_.identity] The function invoked per iteration.
* @param {number} [fromIndex=0] The index to search from.
* @returns {*} Returns the matched element, else `undefined`.
* @example
*
* var users = [
* { 'user': 'barney', 'age': 36, 'active': true },
* { 'user': 'fred', 'age': 40, 'active': false },
* { 'user': 'pebbles', 'age': 1, 'active': true }
* ];
*
* _.find(users, function(o) { return o.age < 40; });
* // => object for 'barney'
*
* // The `_.matches` iteratee shorthand.
* _.find(users, { 'age': 1, 'active': true });
* // => object for 'pebbles'
*
* // The `_.matchesProperty` iteratee shorthand.
* _.find(users, ['active', false]);
* // => object for 'fred'
*
* // The `_.property` iteratee shorthand.
* _.find(users, 'active');
* // => object for 'barney'
*/
var find = createFind(findIndex);
/**
* This method is like `_.find` except that it iterates over elements of
* `collection` from right to left.
*
* @static
* @memberOf _
* @since 2.0.0
* @category Collection
* @param {Array|Object} collection The collection to inspect.
* @param {Function} [predicate=_.identity] The function invoked per iteration.
* @param {number} [fromIndex=collection.length-1] The index to search from.
* @returns {*} Returns the matched element, else `undefined`.
* @example
*
* _.findLast([1, 2, 3, 4], function(n) {
* return n % 2 == 1;
* });
* // => 3
*/
var findLast = createFind(findLastIndex);
/**
* Creates a flattened array of values by running each element in `collection`
* thru `iteratee` and flattening the mapped results. The iteratee is invoked
* with three arguments: (value, index|key, collection).
*
* @static
* @memberOf _
* @since 4.0.0
* @category Collection
* @param {Array|Object} collection The collection to iterate over.
* @param {Function} [iteratee=_.identity] The function invoked per iteration.
* @returns {Array} Returns the new flattened array.
* @example
*
* function duplicate(n) {
* return [n, n];
* }
*
* _.flatMap([1, 2], duplicate);
* // => [1, 1, 2, 2]
*/
function flatMap(collection, iteratee) {
return baseFlatten(map(collection, iteratee), 1);
}
/**
* This method is like `_.flatMap` except that it recursively flattens the
* mapped results.
*
* @static
* @memberOf _
* @since 4.7.0
* @category Collection
* @param {Array|Object} collection The collection to iterate over.
* @param {Function} [iteratee=_.identity] The function invoked per iteration.
* @returns {Array} Returns the new flattened array.
* @example
*
* function duplicate(n) {
* return [[[n, n]]];
* }
*
* _.flatMapDeep([1, 2], duplicate);
* // => [1, 1, 2, 2]
*/
function flatMapDeep(collection, iteratee) {
return baseFlatten(map(collection, iteratee), INFINITY);
}
/**
* This method is like `_.flatMap` except that it recursively flattens the
* mapped results up to `depth` times.
*
* @static
* @memberOf _
* @since 4.7.0
* @category Collection
* @param {Array|Object} collection The collection to iterate over.
* @param {Function} [iteratee=_.identity] The function invoked per iteration.
* @param {number} [depth=1] The maximum recursion depth.
* @returns {Array} Returns the new flattened array.
* @example
*
* function duplicate(n) {
* return [[[n, n]]];
* }
*
* _.flatMapDepth([1, 2], duplicate, 2);
* // => [[1, 1], [2, 2]]
*/
function flatMapDepth(collection, iteratee, depth) {
depth = depth === undefined ? 1 : toInteger(depth);
return baseFlatten(map(collection, iteratee), depth);
}
/**
* Iterates over elements of `collection` and invokes `iteratee` for each element.
* The iteratee is invoked with three arguments: (value, index|key, collection).
* Iteratee functions may exit iteration early by explicitly returning `false`.
*
* **Note:** As with other "Collections" methods, objects with a "length"
* property are iterated like arrays. To avoid this behavior use `_.forIn`
* or `_.forOwn` for object iteration.
*
* @static
* @memberOf _
* @since 0.1.0
* @alias each
* @category Collection
* @param {Array|Object} collection The collection to iterate over.
* @param {Function} [iteratee=_.identity] The function invoked per iteration.
* @returns {Array|Object} Returns `collection`.
* @see _.forEachRight
* @example
*
* _.forEach([1, 2], function(value) {
* console.log(value);
* });
* // => Logs `1` then `2`.
*
* _.forEach({ 'a': 1, 'b': 2 }, function(value, key) {
* console.log(key);
* });
* // => Logs 'a' then 'b' (iteration order is not guaranteed).
*/
function forEach(collection, iteratee) {
var func = isArray(collection) ? arrayEach : baseEach;
return func(collection, getIteratee(iteratee, 3));
}
/**
* This method is like `_.forEach` except that it iterates over elements of
* `collection` from right to left.
*
* @static
* @memberOf _
* @since 2.0.0
* @alias eachRight
* @category Collection
* @param {Array|Object} collection The collection to iterate over.
* @param {Function} [iteratee=_.identity] The function invoked per iteration.
* @returns {Array|Object} Returns `collection`.
* @see _.forEach
* @example
*
* _.forEachRight([1, 2], function(value) {
* console.log(value);
* });
* // => Logs `2` then `1`.
*/
function forEachRight(collection, iteratee) {
var func = isArray(collection) ? arrayEachRight : baseEachRight;
return func(collection, getIteratee(iteratee, 3));
}
/**
* Creates an object composed of keys generated from the results of running
* each element of `collection` thru `iteratee`. The order of grouped values
* is determined by the order they occur in `collection`. The corresponding
* value of each key is an array of elements responsible for generating the
* key. The iteratee is invoked with one argument: (value).
*
* @static
* @memberOf _
* @since 0.1.0
* @category Collection
* @param {Array|Object} collection The collection to iterate over.
* @param {Function} [iteratee=_.identity] The iteratee to transform keys.
* @returns {Object} Returns the composed aggregate object.
* @example
*
* _.groupBy([6.1, 4.2, 6.3], Math.floor);
* // => { '4': [4.2], '6': [6.1, 6.3] }
*
* // The `_.property` iteratee shorthand.
* _.groupBy(['one', 'two', 'three'], 'length');
* // => { '3': ['one', 'two'], '5': ['three'] }
*/
var groupBy = createAggregator(function(result, value, key) {
if (hasOwnProperty.call(result, key)) {
result[key].push(value);
} else {
baseAssignValue(result, key, [value]);
}
});
/**
* Checks if `value` is in `collection`. If `collection` is a string, it's
* checked for a substring of `value`, otherwise
* [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)
* is used for equality comparisons. If `fromIndex` is negative, it's used as
* the offset from the end of `collection`.
*
* @static
* @memberOf _
* @since 0.1.0
* @category Collection
* @param {Array|Object|string} collection The collection to inspect.
* @param {*} value The value to search for.
* @param {number} [fromIndex=0] The index to search from.
* @param- {Object} [guard] Enables use as an iteratee for methods like `_.reduce`.
* @returns {boolean} Returns `true` if `value` is found, else `false`.
* @example
*
* _.includes([1, 2, 3], 1);
* // => true
*
* _.includes([1, 2, 3], 1, 2);
* // => false
*
* _.includes({ 'a': 1, 'b': 2 }, 1);
* // => true
*
* _.includes('abcd', 'bc');
* // => true
*/
function includes(collection, value, fromIndex, guard) {
collection = isArrayLike(collection) ? collection : values(collection);
fromIndex = (fromIndex && !guard) ? toInteger(fromIndex) : 0;
var length = collection.length;
if (fromIndex < 0) {
fromIndex = nativeMax(length + fromIndex, 0);
}
return isString(collection)
? (fromIndex <= length && collection.indexOf(value, fromIndex) > -1)
: (!!length && baseIndexOf(collection, value, fromIndex) > -1);
}
/**
* Invokes the method at `path` of each element in `collection`, returning
* an array of the results of each invoked method. Any additional arguments
* are provided to each invoked method. If `path` is a function, it's invoked
* for, and `this` bound to, each element in `collection`.
*
* @static
* @memberOf _
* @since 4.0.0
* @category Collection
* @param {Array|Object} collection The collection to iterate over.
* @param {Array|Function|string} path The path of the method to invoke or
* the function invoked per iteration.
* @param {...*} [args] The arguments to invoke each method with.
* @returns {Array} Returns the array of results.
* @example
*
* _.invokeMap([[5, 1, 7], [3, 2, 1]], 'sort');
* // => [[1, 5, 7], [1, 2, 3]]
*
* _.invokeMap([123, 456], String.prototype.split, '');
* // => [['1', '2', '3'], ['4', '5', '6']]
*/
var invokeMap = baseRest(function(collection, path, args) {
var index = -1,
isFunc = typeof path == 'function',
result = isArrayLike(collection) ? Array(collection.length) : [];
baseEach(collection, function(value) {
result[++index] = isFunc ? apply(path, value, args) : baseInvoke(value, path, args);
});
return result;
});
/**
* Creates an object composed of keys generated from the results of running
* each element of `collection` thru `iteratee`. The corresponding value of
* each key is the last element responsible for generating the key. The
* iteratee is invoked with one argument: (value).
*
* @static
* @memberOf _
* @since 4.0.0
* @category Collection
* @param {Array|Object} collection The collection to iterate over.
* @param {Function} [iteratee=_.identity] The iteratee to transform keys.
* @returns {Object} Returns the composed aggregate object.
* @example
*
* var array = [
* { 'dir': 'left', 'code': 97 },
* { 'dir': 'right', 'code': 100 }
* ];
*
* _.keyBy(array, function(o) {
* return String.fromCharCode(o.code);
* });
* // => { 'a': { 'dir': 'left', 'code': 97 }, 'd': { 'dir': 'right', 'code': 100 } }
*
* _.keyBy(array, 'dir');
* // => { 'left': { 'dir': 'left', 'code': 97 }, 'right': { 'dir': 'right', 'code': 100 } }
*/
var keyBy = createAggregator(function(result, value, key) {
baseAssignValue(result, key, value);
});
/**
* Creates an array of values by running each element in `collection` thru
* `iteratee`. The iteratee is invoked with three arguments:
* (value, index|key, collection).
*
* Many lodash methods are guarded to work as iteratees for methods like
* `_.every`, `_.filter`, `_.map`, `_.mapValues`, `_.reject`, and `_.some`.
*
* The guarded methods are:
* `ary`, `chunk`, `curry`, `curryRight`, `drop`, `dropRight`, `every`,
* `fill`, `invert`, `parseInt`, `random`, `range`, `rangeRight`, `repeat`,
* `sampleSize`, `slice`, `some`, `sortBy`, `split`, `take`, `takeRight`,
* `template`, `trim`, `trimEnd`, `trimStart`, and `words`
*
* @static
* @memberOf _
* @since 0.1.0
* @category Collection
* @param {Array|Object} collection The collection to iterate over.
* @param {Function} [iteratee=_.identity] The function invoked per iteration.
* @returns {Array} Returns the new mapped array.
* @example
*
* function square(n) {
* return n * n;
* }
*
* _.map([4, 8], square);
* // => [16, 64]
*
* _.map({ 'a': 4, 'b': 8 }, square);
* // => [16, 64] (iteration order is not guaranteed)
*
* var users = [
* { 'user': 'barney' },
* { 'user': 'fred' }
* ];
*
* // The `_.property` iteratee shorthand.
* _.map(users, 'user');
* // => ['barney', 'fred']
*/
function map(collection, iteratee) {
var func = isArray(collection) ? arrayMap : baseMap;
return func(collection, getIteratee(iteratee, 3));
}
/**
* This method is like `_.sortBy` except that it allows specifying the sort
* orders of the iteratees to sort by. If `orders` is unspecified, all values
* are sorted in ascending order. Otherwise, specify an order of "desc" for
* descending or "asc" for ascending sort order of corresponding values.
*
* @static
* @memberOf _
* @since 4.0.0
* @category Collection
* @param {Array|Object} collection The collection to iterate over.
* @param {Array[]|Function[]|Object[]|string[]} [iteratees=[_.identity]]
* The iteratees to sort by.
* @param {string[]} [orders] The sort orders of `iteratees`.
* @param- {Object} [guard] Enables use as an iteratee for methods like `_.reduce`.
* @returns {Array} Returns the new sorted array.
* @example
*
* var users = [
* { 'user': 'fred', 'age': 48 },
* { 'user': 'barney', 'age': 34 },
* { 'user': 'fred', 'age': 40 },
* { 'user': 'barney', 'age': 36 }
* ];
*
* // Sort by `user` in ascending order and by `age` in descending order.
* _.orderBy(users, ['user', 'age'], ['asc', 'desc']);
* // => objects for [['barney', 36], ['barney', 34], ['fred', 48], ['fred', 40]]
*/
function orderBy(collection, iteratees, orders, guard) {
if (collection == null) {
return [];
}
if (!isArray(iteratees)) {
iteratees = iteratees == null ? [] : [iteratees];
}
orders = guard ? undefined : orders;
if (!isArray(orders)) {
orders = orders == null ? [] : [orders];
}
return baseOrderBy(collection, iteratees, orders);
}
/**
* Creates an array of elements split into two groups, the first of which
* contains elements `predicate` returns truthy for, the second of which
* contains elements `predicate` returns falsey for. The predicate is
* invoked with one argument: (value).
*
* @static
* @memberOf _
* @since 3.0.0
* @category Collection
* @param {Array|Object} collection The collection to iterate over.
* @param {Function} [predicate=_.identity] The function invoked per iteration.
* @returns {Array} Returns the array of grouped elements.
* @example
*
* var users = [
* { 'user': 'barney', 'age': 36, 'active': false },
* { 'user': 'fred', 'age': 40, 'active': true },
* { 'user': 'pebbles', 'age': 1, 'active': false }
* ];
*
* _.partition(users, function(o) { return o.active; });
* // => objects for [['fred'], ['barney', 'pebbles']]
*
* // The `_.matches` iteratee shorthand.
* _.partition(users, { 'age': 1, 'active': false });
* // => objects for [['pebbles'], ['barney', 'fred']]
*
* // The `_.matchesProperty` iteratee shorthand.
* _.partition(users, ['active', false]);
* // => objects for [['barney', 'pebbles'], ['fred']]
*
* // The `_.property` iteratee shorthand.
* _.partition(users, 'active');
* // => objects for [['fred'], ['barney', 'pebbles']]
*/
var partition = createAggregator(function(result, value, key) {
result[key ? 0 : 1].push(value);
}, function() { return [[], []]; });
/**
* Reduces `collection` to a value which is the accumulated result of running
* each element in `collection` thru `iteratee`, where each successive
* invocation is supplied the return value of the previous. If `accumulator`
* is not given, the first element of `collection` is used as the initial
* value. The iteratee is invoked with four arguments:
* (accumulator, value, index|key, collection).
*
* Many lodash methods are guarded to work as iteratees for methods like
* `_.reduce`, `_.reduceRight`, and `_.transform`.
*
* The guarded methods are:
* `assign`, `defaults`, `defaultsDeep`, `includes`, `merge`, `orderBy`,
* and `sortBy`
*
* @static
* @memberOf _
* @since 0.1.0
* @category Collection
* @param {Array|Object} collection The collection to iterate over.
* @param {Function} [iteratee=_.identity] The function invoked per iteration.
* @param {*} [accumulator] The initial value.
* @returns {*} Returns the accumulated value.
* @see _.reduceRight
* @example
*
* _.reduce([1, 2], function(sum, n) {
* return sum + n;
* }, 0);
* // => 3
*
* _.reduce({ 'a': 1, 'b': 2, 'c': 1 }, function(result, value, key) {
* (result[value] || (result[value] = [])).push(key);
* return result;
* }, {});
* // => { '1': ['a', 'c'], '2': ['b'] } (iteration order is not guaranteed)
*/
function reduce(collection, iteratee, accumulator) {
var func = isArray(collection) ? arrayReduce : baseReduce,
initAccum = arguments.length < 3;
return func(collection, getIteratee(iteratee, 4), accumulator, initAccum, baseEach);
}
/**
* This method is like `_.reduce` except that it iterates over elements of
* `collection` from right to left.
*
* @static
* @memberOf _
* @since 0.1.0
* @category Collection
* @param {Array|Object} collection The collection to iterate over.
* @param {Function} [iteratee=_.identity] The function invoked per iteration.
* @param {*} [accumulator] The initial value.
* @returns {*} Returns the accumulated value.
* @see _.reduce
* @example
*
* var array = [[0, 1], [2, 3], [4, 5]];
*
* _.reduceRight(array, function(flattened, other) {
* return flattened.concat(other);
* }, []);
* // => [4, 5, 2, 3, 0, 1]
*/
function reduceRight(collection, iteratee, accumulator) {
var func = isArray(collection) ? arrayReduceRight : baseReduce,
initAccum = arguments.length < 3;
return func(collection, getIteratee(iteratee, 4), accumulator, initAccum, baseEachRight);
}
/**
* The opposite of `_.filter`; this method returns the elements of `collection`
* that `predicate` does **not** return truthy for.
*
* @static
* @memberOf _
* @since 0.1.0
* @category Collection
* @param {Array|Object} collection The collection to iterate over.
* @param {Function} [predicate=_.identity] The function invoked per iteration.
* @returns {Array} Returns the new filtered array.
* @see _.filter
* @example
*
* var users = [
* { 'user': 'barney', 'age': 36, 'active': false },
* { 'user': 'fred', 'age': 40, 'active': true }
* ];
*
* _.reject(users, function(o) { return !o.active; });
* // => objects for ['fred']
*
* // The `_.matches` iteratee shorthand.
* _.reject(users, { 'age': 40, 'active': true });
* // => objects for ['barney']
*
* // The `_.matchesProperty` iteratee shorthand.
* _.reject(users, ['active', false]);
* // => objects for ['fred']
*
* // The `_.property` iteratee shorthand.
* _.reject(users, 'active');
* // => objects for ['barney']
*/
function reject(collection, predicate) {
var func = isArray(collection) ? arrayFilter : baseFilter;
return func(collection, negate(getIteratee(predicate, 3)));
}
/**
* Gets a random element from `collection`.
*
* @static
* @memberOf _
* @since 2.0.0
* @category Collection
* @param {Array|Object} collection The collection to sample.
* @returns {*} Returns the random element.
* @example
*
* _.sample([1, 2, 3, 4]);
* // => 2
*/
function sample(collection) {
var func = isArray(collection) ? arraySample : baseSample;
return func(collection);
}
/**
* Gets `n` random elements at unique keys from `collection` up to the
* size of `collection`.
*
* @static
* @memberOf _
* @since 4.0.0
* @category Collection
* @param {Array|Object} collection The collection to sample.
* @param {number} [n=1] The number of elements to sample.
* @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.
* @returns {Array} Returns the random elements.
* @example
*
* _.sampleSize([1, 2, 3], 2);
* // => [3, 1]
*
* _.sampleSize([1, 2, 3], 4);
* // => [2, 3, 1]
*/
function sampleSize(collection, n, guard) {
if ((guard ? isIterateeCall(collection, n, guard) : n === undefined)) {
n = 1;
} else {
n = toInteger(n);
}
var func = isArray(collection) ? arraySampleSize : baseSampleSize;
return func(collection, n);
}
/**
* Creates an array of shuffled values, using a version of the
* [Fisher-Yates shuffle](https://en.wikipedia.org/wiki/Fisher-Yates_shuffle).
*
* @static
* @memberOf _
* @since 0.1.0
* @category Collection
* @param {Array|Object} collection The collection to shuffle.
* @returns {Array} Returns the new shuffled array.
* @example
*
* _.shuffle([1, 2, 3, 4]);
* // => [4, 1, 3, 2]
*/
function shuffle(collection) {
var func = isArray(collection) ? arrayShuffle : baseShuffle;
return func(collection);
}
/**
* Gets the size of `collection` by returning its length for array-like
* values or the number of own enumerable string keyed properties for objects.
*
* @static
* @memberOf _
* @since 0.1.0
* @category Collection
* @param {Array|Object|string} collection The collection to inspect.
* @returns {number} Returns the collection size.
* @example
*
* _.size([1, 2, 3]);
* // => 3
*
* _.size({ 'a': 1, 'b': 2 });
* // => 2
*
* _.size('pebbles');
* // => 7
*/
function size(collection) {
if (collection == null) {
return 0;
}
if (isArrayLike(collection)) {
return isString(collection) ? stringSize(collection) : collection.length;
}
var tag = getTag(collection);
if (tag == mapTag || tag == setTag) {
return collection.size;
}
return baseKeys(collection).length;
}
/**
* Checks if `predicate` returns truthy for **any** element of `collection`.
* Iteration is stopped once `predicate` returns truthy. The predicate is
* invoked with three arguments: (value, index|key, collection).
*
* @static
* @memberOf _
* @since 0.1.0
* @category Collection
* @param {Array|Object} collection The collection to iterate over.
* @param {Function} [predicate=_.identity] The function invoked per iteration.
* @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.
* @returns {boolean} Returns `true` if any element passes the predicate check,
* else `false`.
* @example
*
* _.some([null, 0, 'yes', false], Boolean);
* // => true
*
* var users = [
* { 'user': 'barney', 'active': true },
* { 'user': 'fred', 'active': false }
* ];
*
* // The `_.matches` iteratee shorthand.
* _.some(users, { 'user': 'barney', 'active': false });
* // => false
*
* // The `_.matchesProperty` iteratee shorthand.
* _.some(users, ['active', false]);
* // => true
*
* // The `_.property` iteratee shorthand.
* _.some(users, 'active');
* // => true
*/
function some(collection, predicate, guard) {
var func = isArray(collection) ? arraySome : baseSome;
if (guard && isIterateeCall(collection, predicate, guard)) {
predicate = undefined;
}
return func(collection, getIteratee(predicate, 3));
}
/**
* Creates an array of elements, sorted in ascending order by the results of
* running each element in a collection thru each iteratee. This method
* performs a stable sort, that is, it preserves the original sort order of
* equal elements. The iteratees are invoked with one argument: (value).
*
* @static
* @memberOf _
* @since 0.1.0
* @category Collection
* @param {Array|Object} collection The collection to iterate over.
* @param {...(Function|Function[])} [iteratees=[_.identity]]
* The iteratees to sort by.
* @returns {Array} Returns the new sorted array.
* @example
*
* var users = [
* { 'user': 'fred', 'age': 48 },
* { 'user': 'barney', 'age': 36 },
* { 'user': 'fred', 'age': 40 },
* { 'user': 'barney', 'age': 34 }
* ];
*
* _.sortBy(users, [function(o) { return o.user; }]);
* // => objects for [['barney', 36], ['barney', 34], ['fred', 48], ['fred', 40]]
*
* _.sortBy(users, ['user', 'age']);
* // => objects for [['barney', 34], ['barney', 36], ['fred', 40], ['fred', 48]]
*/
var sortBy = baseRest(function(collection, iteratees) {
if (collection == null) {
return [];
}
var length = iteratees.length;
if (length > 1 && isIterateeCall(collection, iteratees[0], iteratees[1])) {
iteratees = [];
} else if (length > 2 && isIterateeCall(iteratees[0], iteratees[1], iteratees[2])) {
iteratees = [iteratees[0]];
}
return baseOrderBy(collection, baseFlatten(iteratees, 1), []);
});
/*------------------------------------------------------------------------*/
/**
* Gets the timestamp of the number of milliseconds that have elapsed since
* the Unix epoch (1 January 1970 00:00:00 UTC).
*
* @static
* @memberOf _
* @since 2.4.0
* @category Date
* @returns {number} Returns the timestamp.
* @example
*
* _.defer(function(stamp) {
* console.log(_.now() - stamp);
* }, _.now());
* // => Logs the number of milliseconds it took for the deferred invocation.
*/
var now = ctxNow || function() {
return root.Date.now();
};
/*------------------------------------------------------------------------*/
/**
* The opposite of `_.before`; this method creates a function that invokes
* `func` once it's called `n` or more times.
*
* @static
* @memberOf _
* @since 0.1.0
* @category Function
* @param {number} n The number of calls before `func` is invoked.
* @param {Function} func The function to restrict.
* @returns {Function} Returns the new restricted function.
* @example
*
* var saves = ['profile', 'settings'];
*
* var done = _.after(saves.length, function() {
* console.log('done saving!');
* });
*
* _.forEach(saves, function(type) {
* asyncSave({ 'type': type, 'complete': done });
* });
* // => Logs 'done saving!' after the two async saves have completed.
*/
function after(n, func) {
if (typeof func != 'function') {
throw new TypeError(FUNC_ERROR_TEXT);
}
n = toInteger(n);
return function() {
if (--n < 1) {
return func.apply(this, arguments);
}
};
}
/**
* Creates a function that invokes `func`, with up to `n` arguments,
* ignoring any additional arguments.
*
* @static
* @memberOf _
* @since 3.0.0
* @category Function
* @param {Function} func The function to cap arguments for.
* @param {number} [n=func.length] The arity cap.
* @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.
* @returns {Function} Returns the new capped function.
* @example
*
* _.map(['6', '8', '10'], _.ary(parseInt, 1));
* // => [6, 8, 10]
*/
function ary(func, n, guard) {
n = guard ? undefined : n;
n = (func && n == null) ? func.length : n;
return createWrap(func, WRAP_ARY_FLAG, undefined, undefined, undefined, undefined, n);
}
/**
* Creates a function that invokes `func`, with the `this` binding and arguments
* of the created function, while it's called less than `n` times. Subsequent
* calls to the created function return the result of the last `func` invocation.
*
* @static
* @memberOf _
* @since 3.0.0
* @category Function
* @param {number} n The number of calls at which `func` is no longer invoked.
* @param {Function} func The function to restrict.
* @returns {Function} Returns the new restricted function.
* @example
*
* jQuery(element).on('click', _.before(5, addContactToList));
* // => Allows adding up to 4 contacts to the list.
*/
function before(n, func) {
var result;
if (typeof func != 'function') {
throw new TypeError(FUNC_ERROR_TEXT);
}
n = toInteger(n);
return function() {
if (--n > 0) {
result = func.apply(this, arguments);
}
if (n <= 1) {
func = undefined;
}
return result;
};
}
/**
* Creates a function that invokes `func` with the `this` binding of `thisArg`
* and `partials` prepended to the arguments it receives.
*
* The `_.bind.placeholder` value, which defaults to `_` in monolithic builds,
* may be used as a placeholder for partially applied arguments.
*
* **Note:** Unlike native `Function#bind`, this method doesn't set the "length"
* property of bound functions.
*
* @static
* @memberOf _
* @since 0.1.0
* @category Function
* @param {Function} func The function to bind.
* @param {*} thisArg The `this` binding of `func`.
* @param {...*} [partials] The arguments to be partially applied.
* @returns {Function} Returns the new bound function.
* @example
*
* function greet(greeting, punctuation) {
* return greeting + ' ' + this.user + punctuation;
* }
*
* var object = { 'user': 'fred' };
*
* var bound = _.bind(greet, object, 'hi');
* bound('!');
* // => 'hi fred!'
*
* // Bound with placeholders.
* var bound = _.bind(greet, object, _, '!');
* bound('hi');
* // => 'hi fred!'
*/
var bind = baseRest(function(func, thisArg, partials) {
var bitmask = WRAP_BIND_FLAG;
if (partials.length) {
var holders = replaceHolders(partials, getHolder(bind));
bitmask |= WRAP_PARTIAL_FLAG;
}
return createWrap(func, bitmask, thisArg, partials, holders);
});
/**
* Creates a function that invokes the method at `object[key]` with `partials`
* prepended to the arguments it receives.
*
* This method differs from `_.bind` by allowing bound functions to reference
* methods that may be redefined or don't yet exist. See
* [Peter Michaux's article](http://peter.michaux.ca/articles/lazy-function-definition-pattern)
* for more details.
*
* The `_.bindKey.placeholder` value, which defaults to `_` in monolithic
* builds, may be used as a placeholder for partially applied arguments.
*
* @static
* @memberOf _
* @since 0.10.0
* @category Function
* @param {Object} object The object to invoke the method on.
* @param {string} key The key of the method.
* @param {...*} [partials] The arguments to be partially applied.
* @returns {Function} Returns the new bound function.
* @example
*
* var object = {
* 'user': 'fred',
* 'greet': function(greeting, punctuation) {
* return greeting + ' ' + this.user + punctuation;
* }
* };
*
* var bound = _.bindKey(object, 'greet', 'hi');
* bound('!');
* // => 'hi fred!'
*
* object.greet = function(greeting, punctuation) {
* return greeting + 'ya ' + this.user + punctuation;
* };
*
* bound('!');
* // => 'hiya fred!'
*
* // Bound with placeholders.
* var bound = _.bindKey(object, 'greet', _, '!');
* bound('hi');
* // => 'hiya fred!'
*/
var bindKey = baseRest(function(object, key, partials) {
var bitmask = WRAP_BIND_FLAG | WRAP_BIND_KEY_FLAG;
if (partials.length) {
var holders = replaceHolders(partials, getHolder(bindKey));
bitmask |= WRAP_PARTIAL_FLAG;
}
return createWrap(key, bitmask, object, partials, holders);
});
/**
* Creates a function that accepts arguments of `func` and either invokes
* `func` returning its result, if at least `arity` number of arguments have
* been provided, or returns a function that accepts the remaining `func`
* arguments, and so on. The arity of `func` may be specified if `func.length`
* is not sufficient.
*
* The `_.curry.placeholder` value, which defaults to `_` in monolithic builds,
* may be used as a placeholder for provided arguments.
*
* **Note:** This method doesn't set the "length" property of curried functions.
*
* @static
* @memberOf _
* @since 2.0.0
* @category Function
* @param {Function} func The function to curry.
* @param {number} [arity=func.length] The arity of `func`.
* @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.
* @returns {Function} Returns the new curried function.
* @example
*
* var abc = function(a, b, c) {
* return [a, b, c];
* };
*
* var curried = _.curry(abc);
*
* curried(1)(2)(3);
* // => [1, 2, 3]
*
* curried(1, 2)(3);
* // => [1, 2, 3]
*
* curried(1, 2, 3);
* // => [1, 2, 3]
*
* // Curried with placeholders.
* curried(1)(_, 3)(2);
* // => [1, 2, 3]
*/
function curry(func, arity, guard) {
arity = guard ? undefined : arity;
var result = createWrap(func, WRAP_CURRY_FLAG, undefined, undefined, undefined, undefined, undefined, arity);
result.placeholder = curry.placeholder;
return result;
}
/**
* This method is like `_.curry` except that arguments are applied to `func`
* in the manner of `_.partialRight` instead of `_.partial`.
*
* The `_.curryRight.placeholder` value, which defaults to `_` in monolithic
* builds, may be used as a placeholder for provided arguments.
*
* **Note:** This method doesn't set the "length" property of curried functions.
*
* @static
* @memberOf _
* @since 3.0.0
* @category Function
* @param {Function} func The function to curry.
* @param {number} [arity=func.length] The arity of `func`.
* @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.
* @returns {Function} Returns the new curried function.
* @example
*
* var abc = function(a, b, c) {
* return [a, b, c];
* };
*
* var curried = _.curryRight(abc);
*
* curried(3)(2)(1);
* // => [1, 2, 3]
*
* curried(2, 3)(1);
* // => [1, 2, 3]
*
* curried(1, 2, 3);
* // => [1, 2, 3]
*
* // Curried with placeholders.
* curried(3)(1, _)(2);
* // => [1, 2, 3]
*/
function curryRight(func, arity, guard) {
arity = guard ? undefined : arity;
var result = createWrap(func, WRAP_CURRY_RIGHT_FLAG, undefined, undefined, undefined, undefined, undefined, arity);
result.placeholder = curryRight.placeholder;
return result;
}
/**
* Creates a debounced function that delays invoking `func` until after `wait`
* milliseconds have elapsed since the last time the debounced function was
* invoked. The debounced function comes with a `cancel` method to cancel
* delayed `func` invocations and a `flush` method to immediately invoke them.
* Provide `options` to indicate whether `func` should be invoked on the
* leading and/or trailing edge of the `wait` timeout. The `func` is invoked
* with the last arguments provided to the debounced function. Subsequent
* calls to the debounced function return the result of the last `func`
* invocation.
*
* **Note:** If `leading` and `trailing` options are `true`, `func` is
* invoked on the trailing edge of the timeout only if the debounced function
* is invoked more than once during the `wait` timeout.
*
* If `wait` is `0` and `leading` is `false`, `func` invocation is deferred
* until to the next tick, similar to `setTimeout` with a timeout of `0`.
*
* See [David Corbacho's article](https://css-tricks.com/debouncing-throttling-explained-examples/)
* for details over the differences between `_.debounce` and `_.throttle`.
*
* @static
* @memberOf _
* @since 0.1.0
* @category Function
* @param {Function} func The function to debounce.
* @param {number} [wait=0] The number of milliseconds to delay.
* @param {Object} [options={}] The options object.
* @param {boolean} [options.leading=false]
* Specify invoking on the leading edge of the timeout.
* @param {number} [options.maxWait]
* The maximum time `func` is allowed to be delayed before it's invoked.
* @param {boolean} [options.trailing=true]
* Specify invoking on the trailing edge of the timeout.
* @returns {Function} Returns the new debounced function.
* @example
*
* // Avoid costly calculations while the window size is in flux.
* jQuery(window).on('resize', _.debounce(calculateLayout, 150));
*
* // Invoke `sendMail` when clicked, debouncing subsequent calls.
* jQuery(element).on('click', _.debounce(sendMail, 300, {
* 'leading': true,
* 'trailing': false
* }));
*
* // Ensure `batchLog` is invoked once after 1 second of debounced calls.
* var debounced = _.debounce(batchLog, 250, { 'maxWait': 1000 });
* var source = new EventSource('/stream');
* jQuery(source).on('message', debounced);
*
* // Cancel the trailing debounced invocation.
* jQuery(window).on('popstate', debounced.cancel);
*/
function debounce(func, wait, options) {
var lastArgs,
lastThis,
maxWait,
result,
timerId,
lastCallTime,
lastInvokeTime = 0,
leading = false,
maxing = false,
trailing = true;
if (typeof func != 'function') {
throw new TypeError(FUNC_ERROR_TEXT);
}
wait = toNumber(wait) || 0;
if (isObject(options)) {
leading = !!options.leading;
maxing = 'maxWait' in options;
maxWait = maxing ? nativeMax(toNumber(options.maxWait) || 0, wait) : maxWait;
trailing = 'trailing' in options ? !!options.trailing : trailing;
}
function invokeFunc(time) {
var args = lastArgs,
thisArg = lastThis;
lastArgs = lastThis = undefined;
lastInvokeTime = time;
result = func.apply(thisArg, args);
return result;
}
function leadingEdge(time) {
// Reset any `maxWait` timer.
lastInvokeTime = time;
// Start the timer for the trailing edge.
timerId = setTimeout(timerExpired, wait);
// Invoke the leading edge.
return leading ? invokeFunc(time) : result;
}
function remainingWait(time) {
var timeSinceLastCall = time - lastCallTime,
timeSinceLastInvoke = time - lastInvokeTime,
result = wait - timeSinceLastCall;
return maxing ? nativeMin(result, maxWait - timeSinceLastInvoke) : result;
}
function shouldInvoke(time) {
var timeSinceLastCall = time - lastCallTime,
timeSinceLastInvoke = time - lastInvokeTime;
// Either this is the first call, activity has stopped and we're at the
// trailing edge, the system time has gone backwards and we're treating
// it as the trailing edge, or we've hit the `maxWait` limit.
return (lastCallTime === undefined || (timeSinceLastCall >= wait) ||
(timeSinceLastCall < 0) || (maxing && timeSinceLastInvoke >= maxWait));
}
function timerExpired() {
var time = now();
if (shouldInvoke(time)) {
return trailingEdge(time);
}
// Restart the timer.
timerId = setTimeout(timerExpired, remainingWait(time));
}
function trailingEdge(time) {
timerId = undefined;
// Only invoke if we have `lastArgs` which means `func` has been
// debounced at least once.
if (trailing && lastArgs) {
return invokeFunc(time);
}
lastArgs = lastThis = undefined;
return result;
}
function cancel() {
if (timerId !== undefined) {
clearTimeout(timerId);
}
lastInvokeTime = 0;
lastArgs = lastCallTime = lastThis = timerId = undefined;
}
function flush() {
return timerId === undefined ? result : trailingEdge(now());
}
function debounced() {
var time = now(),
isInvoking = shouldInvoke(time);
lastArgs = arguments;
lastThis = this;
lastCallTime = time;
if (isInvoking) {
if (timerId === undefined) {
return leadingEdge(lastCallTime);
}
if (maxing) {
// Handle invocations in a tight loop.
timerId = setTimeout(timerExpired, wait);
return invokeFunc(lastCallTime);
}
}
if (timerId === undefined) {
timerId = setTimeout(timerExpired, wait);
}
return result;
}
debounced.cancel = cancel;
debounced.flush = flush;
return debounced;
}
/**
* Defers invoking the `func` until the current call stack has cleared. Any
* additional arguments are provided to `func` when it's invoked.
*
* @static
* @memberOf _
* @since 0.1.0
* @category Function
* @param {Function} func The function to defer.
* @param {...*} [args] The arguments to invoke `func` with.
* @returns {number} Returns the timer id.
* @example
*
* _.defer(function(text) {
* console.log(text);
* }, 'deferred');
* // => Logs 'deferred' after one millisecond.
*/
var defer = baseRest(function(func, args) {
return baseDelay(func, 1, args);
});
/**
* Invokes `func` after `wait` milliseconds. Any additional arguments are
* provided to `func` when it's invoked.
*
* @static
* @memberOf _
* @since 0.1.0
* @category Function
* @param {Function} func The function to delay.
* @param {number} wait The number of milliseconds to delay invocation.
* @param {...*} [args] The arguments to invoke `func` with.
* @returns {number} Returns the timer id.
* @example
*
* _.delay(function(text) {
* console.log(text);
* }, 1000, 'later');
* // => Logs 'later' after one second.
*/
var delay = baseRest(function(func, wait, args) {
return baseDelay(func, toNumber(wait) || 0, args);
});
/**
* Creates a function that invokes `func` with arguments reversed.
*
* @static
* @memberOf _
* @since 4.0.0
* @category Function
* @param {Function} func The function to flip arguments for.
* @returns {Function} Returns the new flipped function.
* @example
*
* var flipped = _.flip(function() {
* return _.toArray(arguments);
* });
*
* flipped('a', 'b', 'c', 'd');
* // => ['d', 'c', 'b', 'a']
*/
function flip(func) {
return createWrap(func, WRAP_FLIP_FLAG);
}
/**
* Creates a function that memoizes the result of `func`. If `resolver` is
* provided, it determines the cache key for storing the result based on the
* arguments provided to the memoized function. By default, the first argument
* provided to the memoized function is used as the map cache key. The `func`
* is invoked with the `this` binding of the memoized function.
*
* **Note:** The cache is exposed as the `cache` property on the memoized
* function. Its creation may be customized by replacing the `_.memoize.Cache`
* constructor with one whose instances implement the
* [`Map`](http://ecma-international.org/ecma-262/7.0/#sec-properties-of-the-map-prototype-object)
* method interface of `clear`, `delete`, `get`, `has`, and `set`.
*
* @static
* @memberOf _
* @since 0.1.0
* @category Function
* @param {Function} func The function to have its output memoized.
* @param {Function} [resolver] The function to resolve the cache key.
* @returns {Function} Returns the new memoized function.
* @example
*
* var object = { 'a': 1, 'b': 2 };
* var other = { 'c': 3, 'd': 4 };
*
* var values = _.memoize(_.values);
* values(object);
* // => [1, 2]
*
* values(other);
* // => [3, 4]
*
* object.a = 2;
* values(object);
* // => [1, 2]
*
* // Modify the result cache.
* values.cache.set(object, ['a', 'b']);
* values(object);
* // => ['a', 'b']
*
* // Replace `_.memoize.Cache`.
* _.memoize.Cache = WeakMap;
*/
function memoize(func, resolver) {
if (typeof func != 'function' || (resolver != null && typeof resolver != 'function')) {
throw new TypeError(FUNC_ERROR_TEXT);
}
var memoized = function() {
var args = arguments,
key = resolver ? resolver.apply(this, args) : args[0],
cache = memoized.cache;
if (cache.has(key)) {
return cache.get(key);
}
var result = func.apply(this, args);
memoized.cache = cache.set(key, result) || cache;
return result;
};
memoized.cache = new (memoize.Cache || MapCache);
return memoized;
}
// Expose `MapCache`.
memoize.Cache = MapCache;
/**
* Creates a function that negates the result of the predicate `func`. The
* `func` predicate is invoked with the `this` binding and arguments of the
* created function.
*
* @static
* @memberOf _
* @since 3.0.0
* @category Function
* @param {Function} predicate The predicate to negate.
* @returns {Function} Returns the new negated function.
* @example
*
* function isEven(n) {
* return n % 2 == 0;
* }
*
* _.filter([1, 2, 3, 4, 5, 6], _.negate(isEven));
* // => [1, 3, 5]
*/
function negate(predicate) {
if (typeof predicate != 'function') {
throw new TypeError(FUNC_ERROR_TEXT);
}
return function() {
var args = arguments;
switch (args.length) {
case 0: return !predicate.call(this);
case 1: return !predicate.call(this, args[0]);
case 2: return !predicate.call(this, args[0], args[1]);
case 3: return !predicate.call(this, args[0], args[1], args[2]);
}
return !predicate.apply(this, args);
};
}
/**
* Creates a function that is restricted to invoking `func` once. Repeat calls
* to the function return the value of the first invocation. The `func` is
* invoked with the `this` binding and arguments of the created function.
*
* @static
* @memberOf _
* @since 0.1.0
* @category Function
* @param {Function} func The function to restrict.
* @returns {Function} Returns the new restricted function.
* @example
*
* var initialize = _.once(createApplication);
* initialize();
* initialize();
* // => `createApplication` is invoked once
*/
function once(func) {
return before(2, func);
}
/**
* Creates a function that invokes `func` with its arguments transformed.
*
* @static
* @since 4.0.0
* @memberOf _
* @category Function
* @param {Function} func The function to wrap.
* @param {...(Function|Function[])} [transforms=[_.identity]]
* The argument transforms.
* @returns {Function} Returns the new function.
* @example
*
* function doubled(n) {
* return n * 2;
* }
*
* function square(n) {
* return n * n;
* }
*
* var func = _.overArgs(function(x, y) {
* return [x, y];
* }, [square, doubled]);
*
* func(9, 3);
* // => [81, 6]
*
* func(10, 5);
* // => [100, 10]
*/
var overArgs = castRest(function(func, transforms) {
transforms = (transforms.length == 1 && isArray(transforms[0]))
? arrayMap(transforms[0], baseUnary(getIteratee()))
: arrayMap(baseFlatten(transforms, 1), baseUnary(getIteratee()));
var funcsLength = transforms.length;
return baseRest(function(args) {
var index = -1,
length = nativeMin(args.length, funcsLength);
while (++index < length) {
args[index] = transforms[index].call(this, args[index]);
}
return apply(func, this, args);
});
});
/**
* Creates a function that invokes `func` with `partials` prepended to the
* arguments it receives. This method is like `_.bind` except it does **not**
* alter the `this` binding.
*
* The `_.partial.placeholder` value, which defaults to `_` in monolithic
* builds, may be used as a placeholder for partially applied arguments.
*
* **Note:** This method doesn't set the "length" property of partially
* applied functions.
*
* @static
* @memberOf _
* @since 0.2.0
* @category Function
* @param {Function} func The function to partially apply arguments to.
* @param {...*} [partials] The arguments to be partially applied.
* @returns {Function} Returns the new partially applied function.
* @example
*
* function greet(greeting, name) {
* return greeting + ' ' + name;
* }
*
* var sayHelloTo = _.partial(greet, 'hello');
* sayHelloTo('fred');
* // => 'hello fred'
*
* // Partially applied with placeholders.
* var greetFred = _.partial(greet, _, 'fred');
* greetFred('hi');
* // => 'hi fred'
*/
var partial = baseRest(function(func, partials) {
var holders = replaceHolders(partials, getHolder(partial));
return createWrap(func, WRAP_PARTIAL_FLAG, undefined, partials, holders);
});
/**
* This method is like `_.partial` except that partially applied arguments
* are appended to the arguments it receives.
*
* The `_.partialRight.placeholder` value, which defaults to `_` in monolithic
* builds, may be used as a placeholder for partially applied arguments.
*
* **Note:** This method doesn't set the "length" property of partially
* applied functions.
*
* @static
* @memberOf _
* @since 1.0.0
* @category Function
* @param {Function} func The function to partially apply arguments to.
* @param {...*} [partials] The arguments to be partially applied.
* @returns {Function} Returns the new partially applied function.
* @example
*
* function greet(greeting, name) {
* return greeting + ' ' + name;
* }
*
* var greetFred = _.partialRight(greet, 'fred');
* greetFred('hi');
* // => 'hi fred'
*
* // Partially applied with placeholders.
* var sayHelloTo = _.partialRight(greet, 'hello', _);
* sayHelloTo('fred');
* // => 'hello fred'
*/
var partialRight = baseRest(function(func, partials) {
var holders = replaceHolders(partials, getHolder(partialRight));
return createWrap(func, WRAP_PARTIAL_RIGHT_FLAG, undefined, partials, holders);
});
/**
* Creates a function that invokes `func` with arguments arranged according
* to the specified `indexes` where the argument value at the first index is
* provided as the first argument, the argument value at the second index is
* provided as the second argument, and so on.
*
* @static
* @memberOf _
* @since 3.0.0
* @category Function
* @param {Function} func The function to rearrange arguments for.
* @param {...(number|number[])} indexes The arranged argument indexes.
* @returns {Function} Returns the new function.
* @example
*
* var rearged = _.rearg(function(a, b, c) {
* return [a, b, c];
* }, [2, 0, 1]);
*
* rearged('b', 'c', 'a')
* // => ['a', 'b', 'c']
*/
var rearg = flatRest(function(func, indexes) {
return createWrap(func, WRAP_REARG_FLAG, undefined, undefined, undefined, indexes);
});
/**
* Creates a function that invokes `func` with the `this` binding of the
* created function and arguments from `start` and beyond provided as
* an array.
*
* **Note:** This method is based on the
* [rest parameter](https://mdn.io/rest_parameters).
*
* @static
* @memberOf _
* @since 4.0.0
* @category Function
* @param {Function} func The function to apply a rest parameter to.
* @param {number} [start=func.length-1] The start position of the rest parameter.
* @returns {Function} Returns the new function.
* @example
*
* var say = _.rest(function(what, names) {
* return what + ' ' + _.initial(names).join(', ') +
* (_.size(names) > 1 ? ', & ' : '') + _.last(names);
* });
*
* say('hello', 'fred', 'barney', 'pebbles');
* // => 'hello fred, barney, & pebbles'
*/
function rest(func, start) {
if (typeof func != 'function') {
throw new TypeError(FUNC_ERROR_TEXT);
}
start = start === undefined ? start : toInteger(start);
return baseRest(func, start);
}
/**
* Creates a function that invokes `func` with the `this` binding of the
* create function and an array of arguments much like
* [`Function#apply`](http://www.ecma-international.org/ecma-262/7.0/#sec-function.prototype.apply).
*
* **Note:** This method is based on the
* [spread operator](https://mdn.io/spread_operator).
*
* @static
* @memberOf _
* @since 3.2.0
* @category Function
* @param {Function} func The function to spread arguments over.
* @param {number} [start=0] The start position of the spread.
* @returns {Function} Returns the new function.
* @example
*
* var say = _.spread(function(who, what) {
* return who + ' says ' + what;
* });
*
* say(['fred', 'hello']);
* // => 'fred says hello'
*
* var numbers = Promise.all([
* Promise.resolve(40),
* Promise.resolve(36)
* ]);
*
* numbers.then(_.spread(function(x, y) {
* return x + y;
* }));
* // => a Promise of 76
*/
function spread(func, start) {
if (typeof func != 'function') {
throw new TypeError(FUNC_ERROR_TEXT);
}
start = start == null ? 0 : nativeMax(toInteger(start), 0);
return baseRest(function(args) {
var array = args[start],
otherArgs = castSlice(args, 0, start);
if (array) {
arrayPush(otherArgs, array);
}
return apply(func, this, otherArgs);
});
}
/**
* Creates a throttled function that only invokes `func` at most once per
* every `wait` milliseconds. The throttled function comes with a `cancel`
* method to cancel delayed `func` invocations and a `flush` method to
* immediately invoke them. Provide `options` to indicate whether `func`
* should be invoked on the leading and/or trailing edge of the `wait`
* timeout. The `func` is invoked with the last arguments provided to the
* throttled function. Subsequent calls to the throttled function return the
* result of the last `func` invocation.
*
* **Note:** If `leading` and `trailing` options are `true`, `func` is
* invoked on the trailing edge of the timeout only if the throttled function
* is invoked more than once during the `wait` timeout.
*
* If `wait` is `0` and `leading` is `false`, `func` invocation is deferred
* until to the next tick, similar to `setTimeout` with a timeout of `0`.
*
* See [David Corbacho's article](https://css-tricks.com/debouncing-throttling-explained-examples/)
* for details over the differences between `_.throttle` and `_.debounce`.
*
* @static
* @memberOf _
* @since 0.1.0
* @category Function
* @param {Function} func The function to throttle.
* @param {number} [wait=0] The number of milliseconds to throttle invocations to.
* @param {Object} [options={}] The options object.
* @param {boolean} [options.leading=true]
* Specify invoking on the leading edge of the timeout.
* @param {boolean} [options.trailing=true]
* Specify invoking on the trailing edge of the timeout.
* @returns {Function} Returns the new throttled function.
* @example
*
* // Avoid excessively updating the position while scrolling.
* jQuery(window).on('scroll', _.throttle(updatePosition, 100));
*
* // Invoke `renewToken` when the click event is fired, but not more than once every 5 minutes.
* var throttled = _.throttle(renewToken, 300000, { 'trailing': false });
* jQuery(element).on('click', throttled);
*
* // Cancel the trailing throttled invocation.
* jQuery(window).on('popstate', throttled.cancel);
*/
function throttle(func, wait, options) {
var leading = true,
trailing = true;
if (typeof func != 'function') {
throw new TypeError(FUNC_ERROR_TEXT);
}
if (isObject(options)) {
leading = 'leading' in options ? !!options.leading : leading;
trailing = 'trailing' in options ? !!options.trailing : trailing;
}
return debounce(func, wait, {
'leading': leading,
'maxWait': wait,
'trailing': trailing
});
}
/**
* Creates a function that accepts up to one argument, ignoring any
* additional arguments.
*
* @static
* @memberOf _
* @since 4.0.0
* @category Function
* @param {Function} func The function to cap arguments for.
* @returns {Function} Returns the new capped function.
* @example
*
* _.map(['6', '8', '10'], _.unary(parseInt));
* // => [6, 8, 10]
*/
function unary(func) {
return ary(func, 1);
}
/**
* Creates a function that provides `value` to `wrapper` as its first
* argument. Any additional arguments provided to the function are appended
* to those provided to the `wrapper`. The wrapper is invoked with the `this`
* binding of the created function.
*
* @static
* @memberOf _
* @since 0.1.0
* @category Function
* @param {*} value The value to wrap.
* @param {Function} [wrapper=identity] The wrapper function.
* @returns {Function} Returns the new function.
* @example
*
* var p = _.wrap(_.escape, function(func, text) {
* return '<p>' + func(text) + '</p>';
* });
*
* p('fred, barney, & pebbles');
* // => '<p>fred, barney, & pebbles</p>'
*/
function wrap(value, wrapper) {
return partial(castFunction(wrapper), value);
}
/*------------------------------------------------------------------------*/
/**
* Casts `value` as an array if it's not one.
*
* @static
* @memberOf _
* @since 4.4.0
* @category Lang
* @param {*} value The value to inspect.
* @returns {Array} Returns the cast array.
* @example
*
* _.castArray(1);
* // => [1]
*
* _.castArray({ 'a': 1 });
* // => [{ 'a': 1 }]
*
* _.castArray('abc');
* // => ['abc']
*
* _.castArray(null);
* // => [null]
*
* _.castArray(undefined);
* // => [undefined]
*
* _.castArray();
* // => []
*
* var array = [1, 2, 3];
* console.log(_.castArray(array) === array);
* // => true
*/
function castArray() {
if (!arguments.length) {
return [];
}
var value = arguments[0];
return isArray(value) ? value : [value];
}
/**
* Creates a shallow clone of `value`.
*
* **Note:** This method is loosely based on the
* [structured clone algorithm](https://mdn.io/Structured_clone_algorithm)
* and supports cloning arrays, array buffers, booleans, date objects, maps,
* numbers, `Object` objects, regexes, sets, strings, symbols, and typed
* arrays. The own enumerable properties of `arguments` objects are cloned
* as plain objects. An empty object is returned for uncloneable values such
* as error objects, functions, DOM nodes, and WeakMaps.
*
* @static
* @memberOf _
* @since 0.1.0
* @category Lang
* @param {*} value The value to clone.
* @returns {*} Returns the cloned value.
* @see _.cloneDeep
* @example
*
* var objects = [{ 'a': 1 }, { 'b': 2 }];
*
* var shallow = _.clone(objects);
* console.log(shallow[0] === objects[0]);
* // => true
*/
function clone(value) {
return baseClone(value, CLONE_SYMBOLS_FLAG);
}
/**
* This method is like `_.clone` except that it accepts `customizer` which
* is invoked to produce the cloned value. If `customizer` returns `undefined`,
* cloning is handled by the method instead. The `customizer` is invoked with
* up to four arguments; (value [, index|key, object, stack]).
*
* @static
* @memberOf _
* @since 4.0.0
* @category Lang
* @param {*} value The value to clone.
* @param {Function} [customizer] The function to customize cloning.
* @returns {*} Returns the cloned value.
* @see _.cloneDeepWith
* @example
*
* function customizer(value) {
* if (_.isElement(value)) {
* return value.cloneNode(false);
* }
* }
*
* var el = _.cloneWith(document.body, customizer);
*
* console.log(el === document.body);
* // => false
* console.log(el.nodeName);
* // => 'BODY'
* console.log(el.childNodes.length);
* // => 0
*/
function cloneWith(value, customizer) {
customizer = typeof customizer == 'function' ? customizer : undefined;
return baseClone(value, CLONE_SYMBOLS_FLAG, customizer);
}
/**
* This method is like `_.clone` except that it recursively clones `value`.
*
* @static
* @memberOf _
* @since 1.0.0
* @category Lang
* @param {*} value The value to recursively clone.
* @returns {*} Returns the deep cloned value.
* @see _.clone
* @example
*
* var objects = [{ 'a': 1 }, { 'b': 2 }];
*
* var deep = _.cloneDeep(objects);
* console.log(deep[0] === objects[0]);
* // => false
*/
function cloneDeep(value) {
return baseClone(value, CLONE_DEEP_FLAG | CLONE_SYMBOLS_FLAG);
}
/**
* This method is like `_.cloneWith` except that it recursively clones `value`.
*
* @static
* @memberOf _
* @since 4.0.0
* @category Lang
* @param {*} value The value to recursively clone.
* @param {Function} [customizer] The function to customize cloning.
* @returns {*} Returns the deep cloned value.
* @see _.cloneWith
* @example
*
* function customizer(value) {
* if (_.isElement(value)) {
* return value.cloneNode(true);
* }
* }
*
* var el = _.cloneDeepWith(document.body, customizer);
*
* console.log(el === document.body);
* // => false
* console.log(el.nodeName);
* // => 'BODY'
* console.log(el.childNodes.length);
* // => 20
*/
function cloneDeepWith(value, customizer) {
customizer = typeof customizer == 'function' ? customizer : undefined;
return baseClone(value, CLONE_DEEP_FLAG | CLONE_SYMBOLS_FLAG, customizer);
}
/**
* Checks if `object` conforms to `source` by invoking the predicate
* properties of `source` with the corresponding property values of `object`.
*
* **Note:** This method is equivalent to `_.conforms` when `source` is
* partially applied.
*
* @static
* @memberOf _
* @since 4.14.0
* @category Lang
* @param {Object} object The object to inspect.
* @param {Object} source The object of property predicates to conform to.
* @returns {boolean} Returns `true` if `object` conforms, else `false`.
* @example
*
* var object = { 'a': 1, 'b': 2 };
*
* _.conformsTo(object, { 'b': function(n) { return n > 1; } });
* // => true
*
* _.conformsTo(object, { 'b': function(n) { return n > 2; } });
* // => false
*/
function conformsTo(object, source) {
return source == null || baseConformsTo(object, source, keys(source));
}
/**
* Performs a
* [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)
* comparison between two values to determine if they are equivalent.
*
* @static
* @memberOf _
* @since 4.0.0
* @category Lang
* @param {*} value The value to compare.
* @param {*} other The other value to compare.
* @returns {boolean} Returns `true` if the values are equivalent, else `false`.
* @example
*
* var object = { 'a': 1 };
* var other = { 'a': 1 };
*
* _.eq(object, object);
* // => true
*
* _.eq(object, other);
* // => false
*
* _.eq('a', 'a');
* // => true
*
* _.eq('a', Object('a'));
* // => false
*
* _.eq(NaN, NaN);
* // => true
*/
function eq(value, other) {
return value === other || (value !== value && other !== other);
}
/**
* Checks if `value` is greater than `other`.
*
* @static
* @memberOf _
* @since 3.9.0
* @category Lang
* @param {*} value The value to compare.
* @param {*} other The other value to compare.
* @returns {boolean} Returns `true` if `value` is greater than `other`,
* else `false`.
* @see _.lt
* @example
*
* _.gt(3, 1);
* // => true
*
* _.gt(3, 3);
* // => false
*
* _.gt(1, 3);
* // => false
*/
var gt = createRelationalOperation(baseGt);
/**
* Checks if `value` is greater than or equal to `other`.
*
* @static
* @memberOf _
* @since 3.9.0
* @category Lang
* @param {*} value The value to compare.
* @param {*} other The other value to compare.
* @returns {boolean} Returns `true` if `value` is greater than or equal to
* `other`, else `false`.
* @see _.lte
* @example
*
* _.gte(3, 1);
* // => true
*
* _.gte(3, 3);
* // => true
*
* _.gte(1, 3);
* // => false
*/
var gte = createRelationalOperation(function(value, other) {
return value >= other;
});
/**
* Checks if `value` is likely an `arguments` object.
*
* @static
* @memberOf _
* @since 0.1.0
* @category Lang
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is an `arguments` object,
* else `false`.
* @example
*
* _.isArguments(function() { return arguments; }());
* // => true
*
* _.isArguments([1, 2, 3]);
* // => false
*/
var isArguments = baseIsArguments(function() { return arguments; }()) ? baseIsArguments : function(value) {
return isObjectLike(value) && hasOwnProperty.call(value, 'callee') &&
!propertyIsEnumerable.call(value, 'callee');
};
/**
* Checks if `value` is classified as an `Array` object.
*
* @static
* @memberOf _
* @since 0.1.0
* @category Lang
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is an array, else `false`.
* @example
*
* _.isArray([1, 2, 3]);
* // => true
*
* _.isArray(document.body.children);
* // => false
*
* _.isArray('abc');
* // => false
*
* _.isArray(_.noop);
* // => false
*/
var isArray = Array.isArray;
/**
* Checks if `value` is classified as an `ArrayBuffer` object.
*
* @static
* @memberOf _
* @since 4.3.0
* @category Lang
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is an array buffer, else `false`.
* @example
*
* _.isArrayBuffer(new ArrayBuffer(2));
* // => true
*
* _.isArrayBuffer(new Array(2));
* // => false
*/
var isArrayBuffer = nodeIsArrayBuffer ? baseUnary(nodeIsArrayBuffer) : baseIsArrayBuffer;
/**
* Checks if `value` is array-like. A value is considered array-like if it's
* not a function and has a `value.length` that's an integer greater than or
* equal to `0` and less than or equal to `Number.MAX_SAFE_INTEGER`.
*
* @static
* @memberOf _
* @since 4.0.0
* @category Lang
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is array-like, else `false`.
* @example
*
* _.isArrayLike([1, 2, 3]);
* // => true
*
* _.isArrayLike(document.body.children);
* // => true
*
* _.isArrayLike('abc');
* // => true
*
* _.isArrayLike(_.noop);
* // => false
*/
function isArrayLike(value) {
return value != null && isLength(value.length) && !isFunction(value);
}
/**
* This method is like `_.isArrayLike` except that it also checks if `value`
* is an object.
*
* @static
* @memberOf _
* @since 4.0.0
* @category Lang
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is an array-like object,
* else `false`.
* @example
*
* _.isArrayLikeObject([1, 2, 3]);
* // => true
*
* _.isArrayLikeObject(document.body.children);
* // => true
*
* _.isArrayLikeObject('abc');
* // => false
*
* _.isArrayLikeObject(_.noop);
* // => false
*/
function isArrayLikeObject(value) {
return isObjectLike(value) && isArrayLike(value);
}
/**
* Checks if `value` is classified as a boolean primitive or object.
*
* @static
* @memberOf _
* @since 0.1.0
* @category Lang
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is a boolean, else `false`.
* @example
*
* _.isBoolean(false);
* // => true
*
* _.isBoolean(null);
* // => false
*/
function isBoolean(value) {
return value === true || value === false ||
(isObjectLike(value) && baseGetTag(value) == boolTag);
}
/**
* Checks if `value` is a buffer.
*
* @static
* @memberOf _
* @since 4.3.0
* @category Lang
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is a buffer, else `false`.
* @example
*
* _.isBuffer(new Buffer(2));
* // => true
*
* _.isBuffer(new Uint8Array(2));
* // => false
*/
var isBuffer = nativeIsBuffer || stubFalse;
/**
* Checks if `value` is classified as a `Date` object.
*
* @static
* @memberOf _
* @since 0.1.0
* @category Lang
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is a date object, else `false`.
* @example
*
* _.isDate(new Date);
* // => true
*
* _.isDate('Mon April 23 2012');
* // => false
*/
var isDate = nodeIsDate ? baseUnary(nodeIsDate) : baseIsDate;
/**
* Checks if `value` is likely a DOM element.
*
* @static
* @memberOf _
* @since 0.1.0
* @category Lang
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is a DOM element, else `false`.
* @example
*
* _.isElement(document.body);
* // => true
*
* _.isElement('<body>');
* // => false
*/
function isElement(value) {
return isObjectLike(value) && value.nodeType === 1 && !isPlainObject(value);
}
/**
* Checks if `value` is an empty object, collection, map, or set.
*
* Objects are considered empty if they have no own enumerable string keyed
* properties.
*
* Array-like values such as `arguments` objects, arrays, buffers, strings, or
* jQuery-like collections are considered empty if they have a `length` of `0`.
* Similarly, maps and sets are considered empty if they have a `size` of `0`.
*
* @static
* @memberOf _
* @since 0.1.0
* @category Lang
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is empty, else `false`.
* @example
*
* _.isEmpty(null);
* // => true
*
* _.isEmpty(true);
* // => true
*
* _.isEmpty(1);
* // => true
*
* _.isEmpty([1, 2, 3]);
* // => false
*
* _.isEmpty({ 'a': 1 });
* // => false
*/
function isEmpty(value) {
if (value == null) {
return true;
}
if (isArrayLike(value) &&
(isArray(value) || typeof value == 'string' || typeof value.splice == 'function' ||
isBuffer(value) || isTypedArray(value) || isArguments(value))) {
return !value.length;
}
var tag = getTag(value);
if (tag == mapTag || tag == setTag) {
return !value.size;
}
if (isPrototype(value)) {
return !baseKeys(value).length;
}
for (var key in value) {
if (hasOwnProperty.call(value, key)) {
return false;
}
}
return true;
}
/**
* Performs a deep comparison between two values to determine if they are
* equivalent.
*
* **Note:** This method supports comparing arrays, array buffers, booleans,
* date objects, error objects, maps, numbers, `Object` objects, regexes,
* sets, strings, symbols, and typed arrays. `Object` objects are compared
* by their own, not inherited, enumerable properties. Functions and DOM
* nodes are compared by strict equality, i.e. `===`.
*
* @static
* @memberOf _
* @since 0.1.0
* @category Lang
* @param {*} value The value to compare.
* @param {*} other The other value to compare.
* @returns {boolean} Returns `true` if the values are equivalent, else `false`.
* @example
*
* var object = { 'a': 1 };
* var other = { 'a': 1 };
*
* _.isEqual(object, other);
* // => true
*
* object === other;
* // => false
*/
function isEqual(value, other) {
return baseIsEqual(value, other);
}
/**
* This method is like `_.isEqual` except that it accepts `customizer` which
* is invoked to compare values. If `customizer` returns `undefined`, comparisons
* are handled by the method instead. The `customizer` is invoked with up to
* six arguments: (objValue, othValue [, index|key, object, other, stack]).
*
* @static
* @memberOf _
* @since 4.0.0
* @category Lang
* @param {*} value The value to compare.
* @param {*} other The other value to compare.
* @param {Function} [customizer] The function to customize comparisons.
* @returns {boolean} Returns `true` if the values are equivalent, else `false`.
* @example
*
* function isGreeting(value) {
* return /^h(?:i|ello)$/.test(value);
* }
*
* function customizer(objValue, othValue) {
* if (isGreeting(objValue) && isGreeting(othValue)) {
* return true;
* }
* }
*
* var array = ['hello', 'goodbye'];
* var other = ['hi', 'goodbye'];
*
* _.isEqualWith(array, other, customizer);
* // => true
*/
function isEqualWith(value, other, customizer) {
customizer = typeof customizer == 'function' ? customizer : undefined;
var result = customizer ? customizer(value, other) : undefined;
return result === undefined ? baseIsEqual(value, other, undefined, customizer) : !!result;
}
/**
* Checks if `value` is an `Error`, `EvalError`, `RangeError`, `ReferenceError`,
* `SyntaxError`, `TypeError`, or `URIError` object.
*
* @static
* @memberOf _
* @since 3.0.0
* @category Lang
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is an error object, else `false`.
* @example
*
* _.isError(new Error);
* // => true
*
* _.isError(Error);
* // => false
*/
function isError(value) {
if (!isObjectLike(value)) {
return false;
}
var tag = baseGetTag(value);
return tag == errorTag || tag == domExcTag ||
(typeof value.message == 'string' && typeof value.name == 'string' && !isPlainObject(value));
}
/**
* Checks if `value` is a finite primitive number.
*
* **Note:** This method is based on
* [`Number.isFinite`](https://mdn.io/Number/isFinite).
*
* @static
* @memberOf _
* @since 0.1.0
* @category Lang
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is a finite number, else `false`.
* @example
*
* _.isFinite(3);
* // => true
*
* _.isFinite(Number.MIN_VALUE);
* // => true
*
* _.isFinite(Infinity);
* // => false
*
* _.isFinite('3');
* // => false
*/
function isFinite(value) {
return typeof value == 'number' && nativeIsFinite(value);
}
/**
* Checks if `value` is classified as a `Function` object.
*
* @static
* @memberOf _
* @since 0.1.0
* @category Lang
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is a function, else `false`.
* @example
*
* _.isFunction(_);
* // => true
*
* _.isFunction(/abc/);
* // => false
*/
function isFunction(value) {
if (!isObject(value)) {
return false;
}
// The use of `Object#toString` avoids issues with the `typeof` operator
// in Safari 9 which returns 'object' for typed arrays and other constructors.
var tag = baseGetTag(value);
return tag == funcTag || tag == genTag || tag == asyncTag || tag == proxyTag;
}
/**
* Checks if `value` is an integer.
*
* **Note:** This method is based on
* [`Number.isInteger`](https://mdn.io/Number/isInteger).
*
* @static
* @memberOf _
* @since 4.0.0
* @category Lang
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is an integer, else `false`.
* @example
*
* _.isInteger(3);
* // => true
*
* _.isInteger(Number.MIN_VALUE);
* // => false
*
* _.isInteger(Infinity);
* // => false
*
* _.isInteger('3');
* // => false
*/
function isInteger(value) {
return typeof value == 'number' && value == toInteger(value);
}
/**
* Checks if `value` is a valid array-like length.
*
* **Note:** This method is loosely based on
* [`ToLength`](http://ecma-international.org/ecma-262/7.0/#sec-tolength).
*
* @static
* @memberOf _
* @since 4.0.0
* @category Lang
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is a valid length, else `false`.
* @example
*
* _.isLength(3);
* // => true
*
* _.isLength(Number.MIN_VALUE);
* // => false
*
* _.isLength(Infinity);
* // => false
*
* _.isLength('3');
* // => false
*/
function isLength(value) {
return typeof value == 'number' &&
value > -1 && value % 1 == 0 && value <= MAX_SAFE_INTEGER;
}
/**
* Checks if `value` is the
* [language type](http://www.ecma-international.org/ecma-262/7.0/#sec-ecmascript-language-types)
* of `Object`. (e.g. arrays, functions, objects, regexes, `new Number(0)`, and `new String('')`)
*
* @static
* @memberOf _
* @since 0.1.0
* @category Lang
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is an object, else `false`.
* @example
*
* _.isObject({});
* // => true
*
* _.isObject([1, 2, 3]);
* // => true
*
* _.isObject(_.noop);
* // => true
*
* _.isObject(null);
* // => false
*/
function isObject(value) {
var type = typeof value;
return value != null && (type == 'object' || type == 'function');
}
/**
* Checks if `value` is object-like. A value is object-like if it's not `null`
* and has a `typeof` result of "object".
*
* @static
* @memberOf _
* @since 4.0.0
* @category Lang
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is object-like, else `false`.
* @example
*
* _.isObjectLike({});
* // => true
*
* _.isObjectLike([1, 2, 3]);
* // => true
*
* _.isObjectLike(_.noop);
* // => false
*
* _.isObjectLike(null);
* // => false
*/
function isObjectLike(value) {
return value != null && typeof value == 'object';
}
/**
* Checks if `value` is classified as a `Map` object.
*
* @static
* @memberOf _
* @since 4.3.0
* @category Lang
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is a map, else `false`.
* @example
*
* _.isMap(new Map);
* // => true
*
* _.isMap(new WeakMap);
* // => false
*/
var isMap = nodeIsMap ? baseUnary(nodeIsMap) : baseIsMap;
/**
* Performs a partial deep comparison between `object` and `source` to
* determine if `object` contains equivalent property values.
*
* **Note:** This method is equivalent to `_.matches` when `source` is
* partially applied.
*
* Partial comparisons will match empty array and empty object `source`
* values against any array or object value, respectively. See `_.isEqual`
* for a list of supported value comparisons.
*
* @static
* @memberOf _
* @since 3.0.0
* @category Lang
* @param {Object} object The object to inspect.
* @param {Object} source The object of property values to match.
* @returns {boolean} Returns `true` if `object` is a match, else `false`.
* @example
*
* var object = { 'a': 1, 'b': 2 };
*
* _.isMatch(object, { 'b': 2 });
* // => true
*
* _.isMatch(object, { 'b': 1 });
* // => false
*/
function isMatch(object, source) {
return object === source || baseIsMatch(object, source, getMatchData(source));
}
/**
* This method is like `_.isMatch` except that it accepts `customizer` which
* is invoked to compare values. If `customizer` returns `undefined`, comparisons
* are handled by the method instead. The `customizer` is invoked with five
* arguments: (objValue, srcValue, index|key, object, source).
*
* @static
* @memberOf _
* @since 4.0.0
* @category Lang
* @param {Object} object The object to inspect.
* @param {Object} source The object of property values to match.
* @param {Function} [customizer] The function to customize comparisons.
* @returns {boolean} Returns `true` if `object` is a match, else `false`.
* @example
*
* function isGreeting(value) {
* return /^h(?:i|ello)$/.test(value);
* }
*
* function customizer(objValue, srcValue) {
* if (isGreeting(objValue) && isGreeting(srcValue)) {
* return true;
* }
* }
*
* var object = { 'greeting': 'hello' };
* var source = { 'greeting': 'hi' };
*
* _.isMatchWith(object, source, customizer);
* // => true
*/
function isMatchWith(object, source, customizer) {
customizer = typeof customizer == 'function' ? customizer : undefined;
return baseIsMatch(object, source, getMatchData(source), customizer);
}
/**
* Checks if `value` is `NaN`.
*
* **Note:** This method is based on
* [`Number.isNaN`](https://mdn.io/Number/isNaN) and is not the same as
* global [`isNaN`](https://mdn.io/isNaN) which returns `true` for
* `undefined` and other non-number values.
*
* @static
* @memberOf _
* @since 0.1.0
* @category Lang
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is `NaN`, else `false`.
* @example
*
* _.isNaN(NaN);
* // => true
*
* _.isNaN(new Number(NaN));
* // => true
*
* isNaN(undefined);
* // => true
*
* _.isNaN(undefined);
* // => false
*/
function isNaN(value) {
// An `NaN` primitive is the only value that is not equal to itself.
// Perform the `toStringTag` check first to avoid errors with some
// ActiveX objects in IE.
return isNumber(value) && value != +value;
}
/**
* Checks if `value` is a pristine native function.
*
* **Note:** This method can't reliably detect native functions in the presence
* of the core-js package because core-js circumvents this kind of detection.
* Despite multiple requests, the core-js maintainer has made it clear: any
* attempt to fix the detection will be obstructed. As a result, we're left
* with little choice but to throw an error. Unfortunately, this also affects
* packages, like [babel-polyfill](https://www.npmjs.com/package/babel-polyfill),
* which rely on core-js.
*
* @static
* @memberOf _
* @since 3.0.0
* @category Lang
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is a native function,
* else `false`.
* @example
*
* _.isNative(Array.prototype.push);
* // => true
*
* _.isNative(_);
* // => false
*/
function isNative(value) {
if (isMaskable(value)) {
throw new Error(CORE_ERROR_TEXT);
}
return baseIsNative(value);
}
/**
* Checks if `value` is `null`.
*
* @static
* @memberOf _
* @since 0.1.0
* @category Lang
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is `null`, else `false`.
* @example
*
* _.isNull(null);
* // => true
*
* _.isNull(void 0);
* // => false
*/
function isNull(value) {
return value === null;
}
/**
* Checks if `value` is `null` or `undefined`.
*
* @static
* @memberOf _
* @since 4.0.0
* @category Lang
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is nullish, else `false`.
* @example
*
* _.isNil(null);
* // => true
*
* _.isNil(void 0);
* // => true
*
* _.isNil(NaN);
* // => false
*/
function isNil(value) {
return value == null;
}
/**
* Checks if `value` is classified as a `Number` primitive or object.
*
* **Note:** To exclude `Infinity`, `-Infinity`, and `NaN`, which are
* classified as numbers, use the `_.isFinite` method.
*
* @static
* @memberOf _
* @since 0.1.0
* @category Lang
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is a number, else `false`.
* @example
*
* _.isNumber(3);
* // => true
*
* _.isNumber(Number.MIN_VALUE);
* // => true
*
* _.isNumber(Infinity);
* // => true
*
* _.isNumber('3');
* // => false
*/
function isNumber(value) {
return typeof value == 'number' ||
(isObjectLike(value) && baseGetTag(value) == numberTag);
}
/**
* Checks if `value` is a plain object, that is, an object created by the
* `Object` constructor or one with a `[[Prototype]]` of `null`.
*
* @static
* @memberOf _
* @since 0.8.0
* @category Lang
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is a plain object, else `false`.
* @example
*
* function Foo() {
* this.a = 1;
* }
*
* _.isPlainObject(new Foo);
* // => false
*
* _.isPlainObject([1, 2, 3]);
* // => false
*
* _.isPlainObject({ 'x': 0, 'y': 0 });
* // => true
*
* _.isPlainObject(Object.create(null));
* // => true
*/
function isPlainObject(value) {
if (!isObjectLike(value) || baseGetTag(value) != objectTag) {
return false;
}
var proto = getPrototype(value);
if (proto === null) {
return true;
}
var Ctor = hasOwnProperty.call(proto, 'constructor') && proto.constructor;
return typeof Ctor == 'function' && Ctor instanceof Ctor &&
funcToString.call(Ctor) == objectCtorString;
}
/**
* Checks if `value` is classified as a `RegExp` object.
*
* @static
* @memberOf _
* @since 0.1.0
* @category Lang
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is a regexp, else `false`.
* @example
*
* _.isRegExp(/abc/);
* // => true
*
* _.isRegExp('/abc/');
* // => false
*/
var isRegExp = nodeIsRegExp ? baseUnary(nodeIsRegExp) : baseIsRegExp;
/**
* Checks if `value` is a safe integer. An integer is safe if it's an IEEE-754
* double precision number which isn't the result of a rounded unsafe integer.
*
* **Note:** This method is based on
* [`Number.isSafeInteger`](https://mdn.io/Number/isSafeInteger).
*
* @static
* @memberOf _
* @since 4.0.0
* @category Lang
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is a safe integer, else `false`.
* @example
*
* _.isSafeInteger(3);
* // => true
*
* _.isSafeInteger(Number.MIN_VALUE);
* // => false
*
* _.isSafeInteger(Infinity);
* // => false
*
* _.isSafeInteger('3');
* // => false
*/
function isSafeInteger(value) {
return isInteger(value) && value >= -MAX_SAFE_INTEGER && value <= MAX_SAFE_INTEGER;
}
/**
* Checks if `value` is classified as a `Set` object.
*
* @static
* @memberOf _
* @since 4.3.0
* @category Lang
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is a set, else `false`.
* @example
*
* _.isSet(new Set);
* // => true
*
* _.isSet(new WeakSet);
* // => false
*/
var isSet = nodeIsSet ? baseUnary(nodeIsSet) : baseIsSet;
/**
* Checks if `value` is classified as a `String` primitive or object.
*
* @static
* @since 0.1.0
* @memberOf _
* @category Lang
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is a string, else `false`.
* @example
*
* _.isString('abc');
* // => true
*
* _.isString(1);
* // => false
*/
function isString(value) {
return typeof value == 'string' ||
(!isArray(value) && isObjectLike(value) && baseGetTag(value) == stringTag);
}
/**
* Checks if `value` is classified as a `Symbol` primitive or object.
*
* @static
* @memberOf _
* @since 4.0.0
* @category Lang
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is a symbol, else `false`.
* @example
*
* _.isSymbol(Symbol.iterator);
* // => true
*
* _.isSymbol('abc');
* // => false
*/
function isSymbol(value) {
return typeof value == 'symbol' ||
(isObjectLike(value) && baseGetTag(value) == symbolTag);
}
/**
* Checks if `value` is classified as a typed array.
*
* @static
* @memberOf _
* @since 3.0.0
* @category Lang
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is a typed array, else `false`.
* @example
*
* _.isTypedArray(new Uint8Array);
* // => true
*
* _.isTypedArray([]);
* // => false
*/
var isTypedArray = nodeIsTypedArray ? baseUnary(nodeIsTypedArray) : baseIsTypedArray;
/**
* Checks if `value` is `undefined`.
*
* @static
* @since 0.1.0
* @memberOf _
* @category Lang
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is `undefined`, else `false`.
* @example
*
* _.isUndefined(void 0);
* // => true
*
* _.isUndefined(null);
* // => false
*/
function isUndefined(value) {
return value === undefined;
}
/**
* Checks if `value` is classified as a `WeakMap` object.
*
* @static
* @memberOf _
* @since 4.3.0
* @category Lang
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is a weak map, else `false`.
* @example
*
* _.isWeakMap(new WeakMap);
* // => true
*
* _.isWeakMap(new Map);
* // => false
*/
function isWeakMap(value) {
return isObjectLike(value) && getTag(value) == weakMapTag;
}
/**
* Checks if `value` is classified as a `WeakSet` object.
*
* @static
* @memberOf _
* @since 4.3.0
* @category Lang
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is a weak set, else `false`.
* @example
*
* _.isWeakSet(new WeakSet);
* // => true
*
* _.isWeakSet(new Set);
* // => false
*/
function isWeakSet(value) {
return isObjectLike(value) && baseGetTag(value) == weakSetTag;
}
/**
* Checks if `value` is less than `other`.
*
* @static
* @memberOf _
* @since 3.9.0
* @category Lang
* @param {*} value The value to compare.
* @param {*} other The other value to compare.
* @returns {boolean} Returns `true` if `value` is less than `other`,
* else `false`.
* @see _.gt
* @example
*
* _.lt(1, 3);
* // => true
*
* _.lt(3, 3);
* // => false
*
* _.lt(3, 1);
* // => false
*/
var lt = createRelationalOperation(baseLt);
/**
* Checks if `value` is less than or equal to `other`.
*
* @static
* @memberOf _
* @since 3.9.0
* @category Lang
* @param {*} value The value to compare.
* @param {*} other The other value to compare.
* @returns {boolean} Returns `true` if `value` is less than or equal to
* `other`, else `false`.
* @see _.gte
* @example
*
* _.lte(1, 3);
* // => true
*
* _.lte(3, 3);
* // => true
*
* _.lte(3, 1);
* // => false
*/
var lte = createRelationalOperation(function(value, other) {
return value <= other;
});
/**
* Converts `value` to an array.
*
* @static
* @since 0.1.0
* @memberOf _
* @category Lang
* @param {*} value The value to convert.
* @returns {Array} Returns the converted array.
* @example
*
* _.toArray({ 'a': 1, 'b': 2 });
* // => [1, 2]
*
* _.toArray('abc');
* // => ['a', 'b', 'c']
*
* _.toArray(1);
* // => []
*
* _.toArray(null);
* // => []
*/
function toArray(value) {
if (!value) {
return [];
}
if (isArrayLike(value)) {
return isString(value) ? stringToArray(value) : copyArray(value);
}
if (symIterator && value[symIterator]) {
return iteratorToArray(value[symIterator]());
}
var tag = getTag(value),
func = tag == mapTag ? mapToArray : (tag == setTag ? setToArray : values);
return func(value);
}
/**
* Converts `value` to a finite number.
*
* @static
* @memberOf _
* @since 4.12.0
* @category Lang
* @param {*} value The value to convert.
* @returns {number} Returns the converted number.
* @example
*
* _.toFinite(3.2);
* // => 3.2
*
* _.toFinite(Number.MIN_VALUE);
* // => 5e-324
*
* _.toFinite(Infinity);
* // => 1.7976931348623157e+308
*
* _.toFinite('3.2');
* // => 3.2
*/
function toFinite(value) {
if (!value) {
return value === 0 ? value : 0;
}
value = toNumber(value);
if (value === INFINITY || value === -INFINITY) {
var sign = (value < 0 ? -1 : 1);
return sign * MAX_INTEGER;
}
return value === value ? value : 0;
}
/**
* Converts `value` to an integer.
*
* **Note:** This method is loosely based on
* [`ToInteger`](http://www.ecma-international.org/ecma-262/7.0/#sec-tointeger).
*
* @static
* @memberOf _
* @since 4.0.0
* @category Lang
* @param {*} value The value to convert.
* @returns {number} Returns the converted integer.
* @example
*
* _.toInteger(3.2);
* // => 3
*
* _.toInteger(Number.MIN_VALUE);
* // => 0
*
* _.toInteger(Infinity);
* // => 1.7976931348623157e+308
*
* _.toInteger('3.2');
* // => 3
*/
function toInteger(value) {
var result = toFinite(value),
remainder = result % 1;
return result === result ? (remainder ? result - remainder : result) : 0;
}
/**
* Converts `value` to an integer suitable for use as the length of an
* array-like object.
*
* **Note:** This method is based on
* [`ToLength`](http://ecma-international.org/ecma-262/7.0/#sec-tolength).
*
* @static
* @memberOf _
* @since 4.0.0
* @category Lang
* @param {*} value The value to convert.
* @returns {number} Returns the converted integer.
* @example
*
* _.toLength(3.2);
* // => 3
*
* _.toLength(Number.MIN_VALUE);
* // => 0
*
* _.toLength(Infinity);
* // => 4294967295
*
* _.toLength('3.2');
* // => 3
*/
function toLength(value) {
return value ? baseClamp(toInteger(value), 0, MAX_ARRAY_LENGTH) : 0;
}
/**
* Converts `value` to a number.
*
* @static
* @memberOf _
* @since 4.0.0
* @category Lang
* @param {*} value The value to process.
* @returns {number} Returns the number.
* @example
*
* _.toNumber(3.2);
* // => 3.2
*
* _.toNumber(Number.MIN_VALUE);
* // => 5e-324
*
* _.toNumber(Infinity);
* // => Infinity
*
* _.toNumber('3.2');
* // => 3.2
*/
function toNumber(value) {
if (typeof value == 'number') {
return value;
}
if (isSymbol(value)) {
return NAN;
}
if (isObject(value)) {
var other = typeof value.valueOf == 'function' ? value.valueOf() : value;
value = isObject(other) ? (other + '') : other;
}
if (typeof value != 'string') {
return value === 0 ? value : +value;
}
value = value.replace(reTrim, '');
var isBinary = reIsBinary.test(value);
return (isBinary || reIsOctal.test(value))
? freeParseInt(value.slice(2), isBinary ? 2 : 8)
: (reIsBadHex.test(value) ? NAN : +value);
}
/**
* Converts `value` to a plain object flattening inherited enumerable string
* keyed properties of `value` to own properties of the plain object.
*
* @static
* @memberOf _
* @since 3.0.0
* @category Lang
* @param {*} value The value to convert.
* @returns {Object} Returns the converted plain object.
* @example
*
* function Foo() {
* this.b = 2;
* }
*
* Foo.prototype.c = 3;
*
* _.assign({ 'a': 1 }, new Foo);
* // => { 'a': 1, 'b': 2 }
*
* _.assign({ 'a': 1 }, _.toPlainObject(new Foo));
* // => { 'a': 1, 'b': 2, 'c': 3 }
*/
function toPlainObject(value) {
return copyObject(value, keysIn(value));
}
/**
* Converts `value` to a safe integer. A safe integer can be compared and
* represented correctly.
*
* @static
* @memberOf _
* @since 4.0.0
* @category Lang
* @param {*} value The value to convert.
* @returns {number} Returns the converted integer.
* @example
*
* _.toSafeInteger(3.2);
* // => 3
*
* _.toSafeInteger(Number.MIN_VALUE);
* // => 0
*
* _.toSafeInteger(Infinity);
* // => 9007199254740991
*
* _.toSafeInteger('3.2');
* // => 3
*/
function toSafeInteger(value) {
return value
? baseClamp(toInteger(value), -MAX_SAFE_INTEGER, MAX_SAFE_INTEGER)
: (value === 0 ? value : 0);
}
/**
* Converts `value` to a string. An empty string is returned for `null`
* and `undefined` values. The sign of `-0` is preserved.
*
* @static
* @memberOf _
* @since 4.0.0
* @category Lang
* @param {*} value The value to convert.
* @returns {string} Returns the converted string.
* @example
*
* _.toString(null);
* // => ''
*
* _.toString(-0);
* // => '-0'
*
* _.toString([1, 2, 3]);
* // => '1,2,3'
*/
function toString(value) {
return value == null ? '' : baseToString(value);
}
/*------------------------------------------------------------------------*/
/**
* Assigns own enumerable string keyed properties of source objects to the
* destination object. Source objects are applied from left to right.
* Subsequent sources overwrite property assignments of previous sources.
*
* **Note:** This method mutates `object` and is loosely based on
* [`Object.assign`](https://mdn.io/Object/assign).
*
* @static
* @memberOf _
* @since 0.10.0
* @category Object
* @param {Object} object The destination object.
* @param {...Object} [sources] The source objects.
* @returns {Object} Returns `object`.
* @see _.assignIn
* @example
*
* function Foo() {
* this.a = 1;
* }
*
* function Bar() {
* this.c = 3;
* }
*
* Foo.prototype.b = 2;
* Bar.prototype.d = 4;
*
* _.assign({ 'a': 0 }, new Foo, new Bar);
* // => { 'a': 1, 'c': 3 }
*/
var assign = createAssigner(function(object, source) {
if (isPrototype(source) || isArrayLike(source)) {
copyObject(source, keys(source), object);
return;
}
for (var key in source) {
if (hasOwnProperty.call(source, key)) {
assignValue(object, key, source[key]);
}
}
});
/**
* This method is like `_.assign` except that it iterates over own and
* inherited source properties.
*
* **Note:** This method mutates `object`.
*
* @static
* @memberOf _
* @since 4.0.0
* @alias extend
* @category Object
* @param {Object} object The destination object.
* @param {...Object} [sources] The source objects.
* @returns {Object} Returns `object`.
* @see _.assign
* @example
*
* function Foo() {
* this.a = 1;
* }
*
* function Bar() {
* this.c = 3;
* }
*
* Foo.prototype.b = 2;
* Bar.prototype.d = 4;
*
* _.assignIn({ 'a': 0 }, new Foo, new Bar);
* // => { 'a': 1, 'b': 2, 'c': 3, 'd': 4 }
*/
var assignIn = createAssigner(function(object, source) {
copyObject(source, keysIn(source), object);
});
/**
* This method is like `_.assignIn` except that it accepts `customizer`
* which is invoked to produce the assigned values. If `customizer` returns
* `undefined`, assignment is handled by the method instead. The `customizer`
* is invoked with five arguments: (objValue, srcValue, key, object, source).
*
* **Note:** This method mutates `object`.
*
* @static
* @memberOf _
* @since 4.0.0
* @alias extendWith
* @category Object
* @param {Object} object The destination object.
* @param {...Object} sources The source objects.
* @param {Function} [customizer] The function to customize assigned values.
* @returns {Object} Returns `object`.
* @see _.assignWith
* @example
*
* function customizer(objValue, srcValue) {
* return _.isUndefined(objValue) ? srcValue : objValue;
* }
*
* var defaults = _.partialRight(_.assignInWith, customizer);
*
* defaults({ 'a': 1 }, { 'b': 2 }, { 'a': 3 });
* // => { 'a': 1, 'b': 2 }
*/
var assignInWith = createAssigner(function(object, source, srcIndex, customizer) {
copyObject(source, keysIn(source), object, customizer);
});
/**
* This method is like `_.assign` except that it accepts `customizer`
* which is invoked to produce the assigned values. If `customizer` returns
* `undefined`, assignment is handled by the method instead. The `customizer`
* is invoked with five arguments: (objValue, srcValue, key, object, source).
*
* **Note:** This method mutates `object`.
*
* @static
* @memberOf _
* @since 4.0.0
* @category Object
* @param {Object} object The destination object.
* @param {...Object} sources The source objects.
* @param {Function} [customizer] The function to customize assigned values.
* @returns {Object} Returns `object`.
* @see _.assignInWith
* @example
*
* function customizer(objValue, srcValue) {
* return _.isUndefined(objValue) ? srcValue : objValue;
* }
*
* var defaults = _.partialRight(_.assignWith, customizer);
*
* defaults({ 'a': 1 }, { 'b': 2 }, { 'a': 3 });
* // => { 'a': 1, 'b': 2 }
*/
var assignWith = createAssigner(function(object, source, srcIndex, customizer) {
copyObject(source, keys(source), object, customizer);
});
/**
* Creates an array of values corresponding to `paths` of `object`.
*
* @static
* @memberOf _
* @since 1.0.0
* @category Object
* @param {Object} object The object to iterate over.
* @param {...(string|string[])} [paths] The property paths to pick.
* @returns {Array} Returns the picked values.
* @example
*
* var object = { 'a': [{ 'b': { 'c': 3 } }, 4] };
*
* _.at(object, ['a[0].b.c', 'a[1]']);
* // => [3, 4]
*/
var at = flatRest(baseAt);
/**
* Creates an object that inherits from the `prototype` object. If a
* `properties` object is given, its own enumerable string keyed properties
* are assigned to the created object.
*
* @static
* @memberOf _
* @since 2.3.0
* @category Object
* @param {Object} prototype The object to inherit from.
* @param {Object} [properties] The properties to assign to the object.
* @returns {Object} Returns the new object.
* @example
*
* function Shape() {
* this.x = 0;
* this.y = 0;
* }
*
* function Circle() {
* Shape.call(this);
* }
*
* Circle.prototype = _.create(Shape.prototype, {
* 'constructor': Circle
* });
*
* var circle = new Circle;
* circle instanceof Circle;
* // => true
*
* circle instanceof Shape;
* // => true
*/
function create(prototype, properties) {
var result = baseCreate(prototype);
return properties == null ? result : baseAssign(result, properties);
}
/**
* Assigns own and inherited enumerable string keyed properties of source
* objects to the destination object for all destination properties that
* resolve to `undefined`. Source objects are applied from left to right.
* Once a property is set, additional values of the same property are ignored.
*
* **Note:** This method mutates `object`.
*
* @static
* @since 0.1.0
* @memberOf _
* @category Object
* @param {Object} object The destination object.
* @param {...Object} [sources] The source objects.
* @returns {Object} Returns `object`.
* @see _.defaultsDeep
* @example
*
* _.defaults({ 'a': 1 }, { 'b': 2 }, { 'a': 3 });
* // => { 'a': 1, 'b': 2 }
*/
var defaults = baseRest(function(args) {
args.push(undefined, customDefaultsAssignIn);
return apply(assignInWith, undefined, args);
});
/**
* This method is like `_.defaults` except that it recursively assigns
* default properties.
*
* **Note:** This method mutates `object`.
*
* @static
* @memberOf _
* @since 3.10.0
* @category Object
* @param {Object} object The destination object.
* @param {...Object} [sources] The source objects.
* @returns {Object} Returns `object`.
* @see _.defaults
* @example
*
* _.defaultsDeep({ 'a': { 'b': 2 } }, { 'a': { 'b': 1, 'c': 3 } });
* // => { 'a': { 'b': 2, 'c': 3 } }
*/
var defaultsDeep = baseRest(function(args) {
args.push(undefined, customDefaultsMerge);
return apply(mergeWith, undefined, args);
});
/**
* This method is like `_.find` except that it returns the key of the first
* element `predicate` returns truthy for instead of the element itself.
*
* @static
* @memberOf _
* @since 1.1.0
* @category Object
* @param {Object} object The object to inspect.
* @param {Function} [predicate=_.identity] The function invoked per iteration.
* @returns {string|undefined} Returns the key of the matched element,
* else `undefined`.
* @example
*
* var users = {
* 'barney': { 'age': 36, 'active': true },
* 'fred': { 'age': 40, 'active': false },
* 'pebbles': { 'age': 1, 'active': true }
* };
*
* _.findKey(users, function(o) { return o.age < 40; });
* // => 'barney' (iteration order is not guaranteed)
*
* // The `_.matches` iteratee shorthand.
* _.findKey(users, { 'age': 1, 'active': true });
* // => 'pebbles'
*
* // The `_.matchesProperty` iteratee shorthand.
* _.findKey(users, ['active', false]);
* // => 'fred'
*
* // The `_.property` iteratee shorthand.
* _.findKey(users, 'active');
* // => 'barney'
*/
function findKey(object, predicate) {
return baseFindKey(object, getIteratee(predicate, 3), baseForOwn);
}
/**
* This method is like `_.findKey` except that it iterates over elements of
* a collection in the opposite order.
*
* @static
* @memberOf _
* @since 2.0.0
* @category Object
* @param {Object} object The object to inspect.
* @param {Function} [predicate=_.identity] The function invoked per iteration.
* @returns {string|undefined} Returns the key of the matched element,
* else `undefined`.
* @example
*
* var users = {
* 'barney': { 'age': 36, 'active': true },
* 'fred': { 'age': 40, 'active': false },
* 'pebbles': { 'age': 1, 'active': true }
* };
*
* _.findLastKey(users, function(o) { return o.age < 40; });
* // => returns 'pebbles' assuming `_.findKey` returns 'barney'
*
* // The `_.matches` iteratee shorthand.
* _.findLastKey(users, { 'age': 36, 'active': true });
* // => 'barney'
*
* // The `_.matchesProperty` iteratee shorthand.
* _.findLastKey(users, ['active', false]);
* // => 'fred'
*
* // The `_.property` iteratee shorthand.
* _.findLastKey(users, 'active');
* // => 'pebbles'
*/
function findLastKey(object, predicate) {
return baseFindKey(object, getIteratee(predicate, 3), baseForOwnRight);
}
/**
* Iterates over own and inherited enumerable string keyed properties of an
* object and invokes `iteratee` for each property. The iteratee is invoked
* with three arguments: (value, key, object). Iteratee functions may exit
* iteration early by explicitly returning `false`.
*
* @static
* @memberOf _
* @since 0.3.0
* @category Object
* @param {Object} object The object to iterate over.
* @param {Function} [iteratee=_.identity] The function invoked per iteration.
* @returns {Object} Returns `object`.
* @see _.forInRight
* @example
*
* function Foo() {
* this.a = 1;
* this.b = 2;
* }
*
* Foo.prototype.c = 3;
*
* _.forIn(new Foo, function(value, key) {
* console.log(key);
* });
* // => Logs 'a', 'b', then 'c' (iteration order is not guaranteed).
*/
function forIn(object, iteratee) {
return object == null
? object
: baseFor(object, getIteratee(iteratee, 3), keysIn);
}
/**
* This method is like `_.forIn` except that it iterates over properties of
* `object` in the opposite order.
*
* @static
* @memberOf _
* @since 2.0.0
* @category Object
* @param {Object} object The object to iterate over.
* @param {Function} [iteratee=_.identity] The function invoked per iteration.
* @returns {Object} Returns `object`.
* @see _.forIn
* @example
*
* function Foo() {
* this.a = 1;
* this.b = 2;
* }
*
* Foo.prototype.c = 3;
*
* _.forInRight(new Foo, function(value, key) {
* console.log(key);
* });
* // => Logs 'c', 'b', then 'a' assuming `_.forIn` logs 'a', 'b', then 'c'.
*/
function forInRight(object, iteratee) {
return object == null
? object
: baseForRight(object, getIteratee(iteratee, 3), keysIn);
}
/**
* Iterates over own enumerable string keyed properties of an object and
* invokes `iteratee` for each property. The iteratee is invoked with three
* arguments: (value, key, object). Iteratee functions may exit iteration
* early by explicitly returning `false`.
*
* @static
* @memberOf _
* @since 0.3.0
* @category Object
* @param {Object} object The object to iterate over.
* @param {Function} [iteratee=_.identity] The function invoked per iteration.
* @returns {Object} Returns `object`.
* @see _.forOwnRight
* @example
*
* function Foo() {
* this.a = 1;
* this.b = 2;
* }
*
* Foo.prototype.c = 3;
*
* _.forOwn(new Foo, function(value, key) {
* console.log(key);
* });
* // => Logs 'a' then 'b' (iteration order is not guaranteed).
*/
function forOwn(object, iteratee) {
return object && baseForOwn(object, getIteratee(iteratee, 3));
}
/**
* This method is like `_.forOwn` except that it iterates over properties of
* `object` in the opposite order.
*
* @static
* @memberOf _
* @since 2.0.0
* @category Object
* @param {Object} object The object to iterate over.
* @param {Function} [iteratee=_.identity] The function invoked per iteration.
* @returns {Object} Returns `object`.
* @see _.forOwn
* @example
*
* function Foo() {
* this.a = 1;
* this.b = 2;
* }
*
* Foo.prototype.c = 3;
*
* _.forOwnRight(new Foo, function(value, key) {
* console.log(key);
* });
* // => Logs 'b' then 'a' assuming `_.forOwn` logs 'a' then 'b'.
*/
function forOwnRight(object, iteratee) {
return object && baseForOwnRight(object, getIteratee(iteratee, 3));
}
/**
* Creates an array of function property names from own enumerable properties
* of `object`.
*
* @static
* @since 0.1.0
* @memberOf _
* @category Object
* @param {Object} object The object to inspect.
* @returns {Array} Returns the function names.
* @see _.functionsIn
* @example
*
* function Foo() {
* this.a = _.constant('a');
* this.b = _.constant('b');
* }
*
* Foo.prototype.c = _.constant('c');
*
* _.functions(new Foo);
* // => ['a', 'b']
*/
function functions(object) {
return object == null ? [] : baseFunctions(object, keys(object));
}
/**
* Creates an array of function property names from own and inherited
* enumerable properties of `object`.
*
* @static
* @memberOf _
* @since 4.0.0
* @category Object
* @param {Object} object The object to inspect.
* @returns {Array} Returns the function names.
* @see _.functions
* @example
*
* function Foo() {
* this.a = _.constant('a');
* this.b = _.constant('b');
* }
*
* Foo.prototype.c = _.constant('c');
*
* _.functionsIn(new Foo);
* // => ['a', 'b', 'c']
*/
function functionsIn(object) {
return object == null ? [] : baseFunctions(object, keysIn(object));
}
/**
* Gets the value at `path` of `object`. If the resolved value is
* `undefined`, the `defaultValue` is returned in its place.
*
* @static
* @memberOf _
* @since 3.7.0
* @category Object
* @param {Object} object The object to query.
* @param {Array|string} path The path of the property to get.
* @param {*} [defaultValue] The value returned for `undefined` resolved values.
* @returns {*} Returns the resolved value.
* @example
*
* var object = { 'a': [{ 'b': { 'c': 3 } }] };
*
* _.get(object, 'a[0].b.c');
* // => 3
*
* _.get(object, ['a', '0', 'b', 'c']);
* // => 3
*
* _.get(object, 'a.b.c', 'default');
* // => 'default'
*/
function get(object, path, defaultValue) {
var result = object == null ? undefined : baseGet(object, path);
return result === undefined ? defaultValue : result;
}
/**
* Checks if `path` is a direct property of `object`.
*
* @static
* @since 0.1.0
* @memberOf _
* @category Object
* @param {Object} object The object to query.
* @param {Array|string} path The path to check.
* @returns {boolean} Returns `true` if `path` exists, else `false`.
* @example
*
* var object = { 'a': { 'b': 2 } };
* var other = _.create({ 'a': _.create({ 'b': 2 }) });
*
* _.has(object, 'a');
* // => true
*
* _.has(object, 'a.b');
* // => true
*
* _.has(object, ['a', 'b']);
* // => true
*
* _.has(other, 'a');
* // => false
*/
function has(object, path) {
return object != null && hasPath(object, path, baseHas);
}
/**
* Checks if `path` is a direct or inherited property of `object`.
*
* @static
* @memberOf _
* @since 4.0.0
* @category Object
* @param {Object} object The object to query.
* @param {Array|string} path The path to check.
* @returns {boolean} Returns `true` if `path` exists, else `false`.
* @example
*
* var object = _.create({ 'a': _.create({ 'b': 2 }) });
*
* _.hasIn(object, 'a');
* // => true
*
* _.hasIn(object, 'a.b');
* // => true
*
* _.hasIn(object, ['a', 'b']);
* // => true
*
* _.hasIn(object, 'b');
* // => false
*/
function hasIn(object, path) {
return object != null && hasPath(object, path, baseHasIn);
}
/**
* Creates an object composed of the inverted keys and values of `object`.
* If `object` contains duplicate values, subsequent values overwrite
* property assignments of previous values.
*
* @static
* @memberOf _
* @since 0.7.0
* @category Object
* @param {Object} object The object to invert.
* @returns {Object} Returns the new inverted object.
* @example
*
* var object = { 'a': 1, 'b': 2, 'c': 1 };
*
* _.invert(object);
* // => { '1': 'c', '2': 'b' }
*/
var invert = createInverter(function(result, value, key) {
result[value] = key;
}, constant(identity));
/**
* This method is like `_.invert` except that the inverted object is generated
* from the results of running each element of `object` thru `iteratee`. The
* corresponding inverted value of each inverted key is an array of keys
* responsible for generating the inverted value. The iteratee is invoked
* with one argument: (value).
*
* @static
* @memberOf _
* @since 4.1.0
* @category Object
* @param {Object} object The object to invert.
* @param {Function} [iteratee=_.identity] The iteratee invoked per element.
* @returns {Object} Returns the new inverted object.
* @example
*
* var object = { 'a': 1, 'b': 2, 'c': 1 };
*
* _.invertBy(object);
* // => { '1': ['a', 'c'], '2': ['b'] }
*
* _.invertBy(object, function(value) {
* return 'group' + value;
* });
* // => { 'group1': ['a', 'c'], 'group2': ['b'] }
*/
var invertBy = createInverter(function(result, value, key) {
if (hasOwnProperty.call(result, value)) {
result[value].push(key);
} else {
result[value] = [key];
}
}, getIteratee);
/**
* Invokes the method at `path` of `object`.
*
* @static
* @memberOf _
* @since 4.0.0
* @category Object
* @param {Object} object The object to query.
* @param {Array|string} path The path of the method to invoke.
* @param {...*} [args] The arguments to invoke the method with.
* @returns {*} Returns the result of the invoked method.
* @example
*
* var object = { 'a': [{ 'b': { 'c': [1, 2, 3, 4] } }] };
*
* _.invoke(object, 'a[0].b.c.slice', 1, 3);
* // => [2, 3]
*/
var invoke = baseRest(baseInvoke);
/**
* Creates an array of the own enumerable property names of `object`.
*
* **Note:** Non-object values are coerced to objects. See the
* [ES spec](http://ecma-international.org/ecma-262/7.0/#sec-object.keys)
* for more details.
*
* @static
* @since 0.1.0
* @memberOf _
* @category Object
* @param {Object} object The object to query.
* @returns {Array} Returns the array of property names.
* @example
*
* function Foo() {
* this.a = 1;
* this.b = 2;
* }
*
* Foo.prototype.c = 3;
*
* _.keys(new Foo);
* // => ['a', 'b'] (iteration order is not guaranteed)
*
* _.keys('hi');
* // => ['0', '1']
*/
function keys(object) {
return isArrayLike(object) ? arrayLikeKeys(object) : baseKeys(object);
}
/**
* Creates an array of the own and inherited enumerable property names of `object`.
*
* **Note:** Non-object values are coerced to objects.
*
* @static
* @memberOf _
* @since 3.0.0
* @category Object
* @param {Object} object The object to query.
* @returns {Array} Returns the array of property names.
* @example
*
* function Foo() {
* this.a = 1;
* this.b = 2;
* }
*
* Foo.prototype.c = 3;
*
* _.keysIn(new Foo);
* // => ['a', 'b', 'c'] (iteration order is not guaranteed)
*/
function keysIn(object) {
return isArrayLike(object) ? arrayLikeKeys(object, true) : baseKeysIn(object);
}
/**
* The opposite of `_.mapValues`; this method creates an object with the
* same values as `object` and keys generated by running each own enumerable
* string keyed property of `object` thru `iteratee`. The iteratee is invoked
* with three arguments: (value, key, object).
*
* @static
* @memberOf _
* @since 3.8.0
* @category Object
* @param {Object} object The object to iterate over.
* @param {Function} [iteratee=_.identity] The function invoked per iteration.
* @returns {Object} Returns the new mapped object.
* @see _.mapValues
* @example
*
* _.mapKeys({ 'a': 1, 'b': 2 }, function(value, key) {
* return key + value;
* });
* // => { 'a1': 1, 'b2': 2 }
*/
function mapKeys(object, iteratee) {
var result = {};
iteratee = getIteratee(iteratee, 3);
baseForOwn(object, function(value, key, object) {
baseAssignValue(result, iteratee(value, key, object), value);
});
return result;
}
/**
* Creates an object with the same keys as `object` and values generated
* by running each own enumerable string keyed property of `object` thru
* `iteratee`. The iteratee is invoked with three arguments:
* (value, key, object).
*
* @static
* @memberOf _
* @since 2.4.0
* @category Object
* @param {Object} object The object to iterate over.
* @param {Function} [iteratee=_.identity] The function invoked per iteration.
* @returns {Object} Returns the new mapped object.
* @see _.mapKeys
* @example
*
* var users = {
* 'fred': { 'user': 'fred', 'age': 40 },
* 'pebbles': { 'user': 'pebbles', 'age': 1 }
* };
*
* _.mapValues(users, function(o) { return o.age; });
* // => { 'fred': 40, 'pebbles': 1 } (iteration order is not guaranteed)
*
* // The `_.property` iteratee shorthand.
* _.mapValues(users, 'age');
* // => { 'fred': 40, 'pebbles': 1 } (iteration order is not guaranteed)
*/
function mapValues(object, iteratee) {
var result = {};
iteratee = getIteratee(iteratee, 3);
baseForOwn(object, function(value, key, object) {
baseAssignValue(result, key, iteratee(value, key, object));
});
return result;
}
/**
* This method is like `_.assign` except that it recursively merges own and
* inherited enumerable string keyed properties of source objects into the
* destination object. Source properties that resolve to `undefined` are
* skipped if a destination value exists. Array and plain object properties
* are merged recursively. Other objects and value types are overridden by
* assignment. Source objects are applied from left to right. Subsequent
* sources overwrite property assignments of previous sources.
*
* **Note:** This method mutates `object`.
*
* @static
* @memberOf _
* @since 0.5.0
* @category Object
* @param {Object} object The destination object.
* @param {...Object} [sources] The source objects.
* @returns {Object} Returns `object`.
* @example
*
* var object = {
* 'a': [{ 'b': 2 }, { 'd': 4 }]
* };
*
* var other = {
* 'a': [{ 'c': 3 }, { 'e': 5 }]
* };
*
* _.merge(object, other);
* // => { 'a': [{ 'b': 2, 'c': 3 }, { 'd': 4, 'e': 5 }] }
*/
var merge = createAssigner(function(object, source, srcIndex) {
baseMerge(object, source, srcIndex);
});
/**
* This method is like `_.merge` except that it accepts `customizer` which
* is invoked to produce the merged values of the destination and source
* properties. If `customizer` returns `undefined`, merging is handled by the
* method instead. The `customizer` is invoked with six arguments:
* (objValue, srcValue, key, object, source, stack).
*
* **Note:** This method mutates `object`.
*
* @static
* @memberOf _
* @since 4.0.0
* @category Object
* @param {Object} object The destination object.
* @param {...Object} sources The source objects.
* @param {Function} customizer The function to customize assigned values.
* @returns {Object} Returns `object`.
* @example
*
* function customizer(objValue, srcValue) {
* if (_.isArray(objValue)) {
* return objValue.concat(srcValue);
* }
* }
*
* var object = { 'a': [1], 'b': [2] };
* var other = { 'a': [3], 'b': [4] };
*
* _.mergeWith(object, other, customizer);
* // => { 'a': [1, 3], 'b': [2, 4] }
*/
var mergeWith = createAssigner(function(object, source, srcIndex, customizer) {
baseMerge(object, source, srcIndex, customizer);
});
/**
* The opposite of `_.pick`; this method creates an object composed of the
* own and inherited enumerable property paths of `object` that are not omitted.
*
* **Note:** This method is considerably slower than `_.pick`.
*
* @static
* @since 0.1.0
* @memberOf _
* @category Object
* @param {Object} object The source object.
* @param {...(string|string[])} [paths] The property paths to omit.
* @returns {Object} Returns the new object.
* @example
*
* var object = { 'a': 1, 'b': '2', 'c': 3 };
*
* _.omit(object, ['a', 'c']);
* // => { 'b': '2' }
*/
var omit = flatRest(function(object, paths) {
var result = {};
if (object == null) {
return result;
}
var isDeep = false;
paths = arrayMap(paths, function(path) {
path = castPath(path, object);
isDeep || (isDeep = path.length > 1);
return path;
});
copyObject(object, getAllKeysIn(object), result);
if (isDeep) {
result = baseClone(result, CLONE_DEEP_FLAG | CLONE_FLAT_FLAG | CLONE_SYMBOLS_FLAG, customOmitClone);
}
var length = paths.length;
while (length--) {
baseUnset(result, paths[length]);
}
return result;
});
/**
* The opposite of `_.pickBy`; this method creates an object composed of
* the own and inherited enumerable string keyed properties of `object` that
* `predicate` doesn't return truthy for. The predicate is invoked with two
* arguments: (value, key).
*
* @static
* @memberOf _
* @since 4.0.0
* @category Object
* @param {Object} object The source object.
* @param {Function} [predicate=_.identity] The function invoked per property.
* @returns {Object} Returns the new object.
* @example
*
* var object = { 'a': 1, 'b': '2', 'c': 3 };
*
* _.omitBy(object, _.isNumber);
* // => { 'b': '2' }
*/
function omitBy(object, predicate) {
return pickBy(object, negate(getIteratee(predicate)));
}
/**
* Creates an object composed of the picked `object` properties.
*
* @static
* @since 0.1.0
* @memberOf _
* @category Object
* @param {Object} object The source object.
* @param {...(string|string[])} [paths] The property paths to pick.
* @returns {Object} Returns the new object.
* @example
*
* var object = { 'a': 1, 'b': '2', 'c': 3 };
*
* _.pick(object, ['a', 'c']);
* // => { 'a': 1, 'c': 3 }
*/
var pick = flatRest(function(object, paths) {
return object == null ? {} : basePick(object, paths);
});
/**
* Creates an object composed of the `object` properties `predicate` returns
* truthy for. The predicate is invoked with two arguments: (value, key).
*
* @static
* @memberOf _
* @since 4.0.0
* @category Object
* @param {Object} object The source object.
* @param {Function} [predicate=_.identity] The function invoked per property.
* @returns {Object} Returns the new object.
* @example
*
* var object = { 'a': 1, 'b': '2', 'c': 3 };
*
* _.pickBy(object, _.isNumber);
* // => { 'a': 1, 'c': 3 }
*/
function pickBy(object, predicate) {
if (object == null) {
return {};
}
var props = arrayMap(getAllKeysIn(object), function(prop) {
return [prop];
});
predicate = getIteratee(predicate);
return basePickBy(object, props, function(value, path) {
return predicate(value, path[0]);
});
}
/**
* This method is like `_.get` except that if the resolved value is a
* function it's invoked with the `this` binding of its parent object and
* its result is returned.
*
* @static
* @since 0.1.0
* @memberOf _
* @category Object
* @param {Object} object The object to query.
* @param {Array|string} path The path of the property to resolve.
* @param {*} [defaultValue] The value returned for `undefined` resolved values.
* @returns {*} Returns the resolved value.
* @example
*
* var object = { 'a': [{ 'b': { 'c1': 3, 'c2': _.constant(4) } }] };
*
* _.result(object, 'a[0].b.c1');
* // => 3
*
* _.result(object, 'a[0].b.c2');
* // => 4
*
* _.result(object, 'a[0].b.c3', 'default');
* // => 'default'
*
* _.result(object, 'a[0].b.c3', _.constant('default'));
* // => 'default'
*/
function result(object, path, defaultValue) {
path = castPath(path, object);
var index = -1,
length = path.length;
// Ensure the loop is entered when path is empty.
if (!length) {
length = 1;
object = undefined;
}
while (++index < length) {
var value = object == null ? undefined : object[toKey(path[index])];
if (value === undefined) {
index = length;
value = defaultValue;
}
object = isFunction(value) ? value.call(object) : value;
}
return object;
}
/**
* Sets the value at `path` of `object`. If a portion of `path` doesn't exist,
* it's created. Arrays are created for missing index properties while objects
* are created for all other missing properties. Use `_.setWith` to customize
* `path` creation.
*
* **Note:** This method mutates `object`.
*
* @static
* @memberOf _
* @since 3.7.0
* @category Object
* @param {Object} object The object to modify.
* @param {Array|string} path The path of the property to set.
* @param {*} value The value to set.
* @returns {Object} Returns `object`.
* @example
*
* var object = { 'a': [{ 'b': { 'c': 3 } }] };
*
* _.set(object, 'a[0].b.c', 4);
* console.log(object.a[0].b.c);
* // => 4
*
* _.set(object, ['x', '0', 'y', 'z'], 5);
* console.log(object.x[0].y.z);
* // => 5
*/
function set(object, path, value) {
return object == null ? object : baseSet(object, path, value);
}
/**
* This method is like `_.set` except that it accepts `customizer` which is
* invoked to produce the objects of `path`. If `customizer` returns `undefined`
* path creation is handled by the method instead. The `customizer` is invoked
* with three arguments: (nsValue, key, nsObject).
*
* **Note:** This method mutates `object`.
*
* @static
* @memberOf _
* @since 4.0.0
* @category Object
* @param {Object} object The object to modify.
* @param {Array|string} path The path of the property to set.
* @param {*} value The value to set.
* @param {Function} [customizer] The function to customize assigned values.
* @returns {Object} Returns `object`.
* @example
*
* var object = {};
*
* _.setWith(object, '[0][1]', 'a', Object);
* // => { '0': { '1': 'a' } }
*/
function setWith(object, path, value, customizer) {
customizer = typeof customizer == 'function' ? customizer : undefined;
return object == null ? object : baseSet(object, path, value, customizer);
}
/**
* Creates an array of own enumerable string keyed-value pairs for `object`
* which can be consumed by `_.fromPairs`. If `object` is a map or set, its
* entries are returned.
*
* @static
* @memberOf _
* @since 4.0.0
* @alias entries
* @category Object
* @param {Object} object The object to query.
* @returns {Array} Returns the key-value pairs.
* @example
*
* function Foo() {
* this.a = 1;
* this.b = 2;
* }
*
* Foo.prototype.c = 3;
*
* _.toPairs(new Foo);
* // => [['a', 1], ['b', 2]] (iteration order is not guaranteed)
*/
var toPairs = createToPairs(keys);
/**
* Creates an array of own and inherited enumerable string keyed-value pairs
* for `object` which can be consumed by `_.fromPairs`. If `object` is a map
* or set, its entries are returned.
*
* @static
* @memberOf _
* @since 4.0.0
* @alias entriesIn
* @category Object
* @param {Object} object The object to query.
* @returns {Array} Returns the key-value pairs.
* @example
*
* function Foo() {
* this.a = 1;
* this.b = 2;
* }
*
* Foo.prototype.c = 3;
*
* _.toPairsIn(new Foo);
* // => [['a', 1], ['b', 2], ['c', 3]] (iteration order is not guaranteed)
*/
var toPairsIn = createToPairs(keysIn);
/**
* An alternative to `_.reduce`; this method transforms `object` to a new
* `accumulator` object which is the result of running each of its own
* enumerable string keyed properties thru `iteratee`, with each invocation
* potentially mutating the `accumulator` object. If `accumulator` is not
* provided, a new object with the same `[[Prototype]]` will be used. The
* iteratee is invoked with four arguments: (accumulator, value, key, object).
* Iteratee functions may exit iteration early by explicitly returning `false`.
*
* @static
* @memberOf _
* @since 1.3.0
* @category Object
* @param {Object} object The object to iterate over.
* @param {Function} [iteratee=_.identity] The function invoked per iteration.
* @param {*} [accumulator] The custom accumulator value.
* @returns {*} Returns the accumulated value.
* @example
*
* _.transform([2, 3, 4], function(result, n) {
* result.push(n *= n);
* return n % 2 == 0;
* }, []);
* // => [4, 9]
*
* _.transform({ 'a': 1, 'b': 2, 'c': 1 }, function(result, value, key) {
* (result[value] || (result[value] = [])).push(key);
* }, {});
* // => { '1': ['a', 'c'], '2': ['b'] }
*/
function transform(object, iteratee, accumulator) {
var isArr = isArray(object),
isArrLike = isArr || isBuffer(object) || isTypedArray(object);
iteratee = getIteratee(iteratee, 4);
if (accumulator == null) {
var Ctor = object && object.constructor;
if (isArrLike) {
accumulator = isArr ? new Ctor : [];
}
else if (isObject(object)) {
accumulator = isFunction(Ctor) ? baseCreate(getPrototype(object)) : {};
}
else {
accumulator = {};
}
}
(isArrLike ? arrayEach : baseForOwn)(object, function(value, index, object) {
return iteratee(accumulator, value, index, object);
});
return accumulator;
}
/**
* Removes the property at `path` of `object`.
*
* **Note:** This method mutates `object`.
*
* @static
* @memberOf _
* @since 4.0.0
* @category Object
* @param {Object} object The object to modify.
* @param {Array|string} path The path of the property to unset.
* @returns {boolean} Returns `true` if the property is deleted, else `false`.
* @example
*
* var object = { 'a': [{ 'b': { 'c': 7 } }] };
* _.unset(object, 'a[0].b.c');
* // => true
*
* console.log(object);
* // => { 'a': [{ 'b': {} }] };
*
* _.unset(object, ['a', '0', 'b', 'c']);
* // => true
*
* console.log(object);
* // => { 'a': [{ 'b': {} }] };
*/
function unset(object, path) {
return object == null ? true : baseUnset(object, path);
}
/**
* This method is like `_.set` except that accepts `updater` to produce the
* value to set. Use `_.updateWith` to customize `path` creation. The `updater`
* is invoked with one argument: (value).
*
* **Note:** This method mutates `object`.
*
* @static
* @memberOf _
* @since 4.6.0
* @category Object
* @param {Object} object The object to modify.
* @param {Array|string} path The path of the property to set.
* @param {Function} updater The function to produce the updated value.
* @returns {Object} Returns `object`.
* @example
*
* var object = { 'a': [{ 'b': { 'c': 3 } }] };
*
* _.update(object, 'a[0].b.c', function(n) { return n * n; });
* console.log(object.a[0].b.c);
* // => 9
*
* _.update(object, 'x[0].y.z', function(n) { return n ? n + 1 : 0; });
* console.log(object.x[0].y.z);
* // => 0
*/
function update(object, path, updater) {
return object == null ? object : baseUpdate(object, path, castFunction(updater));
}
/**
* This method is like `_.update` except that it accepts `customizer` which is
* invoked to produce the objects of `path`. If `customizer` returns `undefined`
* path creation is handled by the method instead. The `customizer` is invoked
* with three arguments: (nsValue, key, nsObject).
*
* **Note:** This method mutates `object`.
*
* @static
* @memberOf _
* @since 4.6.0
* @category Object
* @param {Object} object The object to modify.
* @param {Array|string} path The path of the property to set.
* @param {Function} updater The function to produce the updated value.
* @param {Function} [customizer] The function to customize assigned values.
* @returns {Object} Returns `object`.
* @example
*
* var object = {};
*
* _.updateWith(object, '[0][1]', _.constant('a'), Object);
* // => { '0': { '1': 'a' } }
*/
function updateWith(object, path, updater, customizer) {
customizer = typeof customizer == 'function' ? customizer : undefined;
return object == null ? object : baseUpdate(object, path, castFunction(updater), customizer);
}
/**
* Creates an array of the own enumerable string keyed property values of `object`.
*
* **Note:** Non-object values are coerced to objects.
*
* @static
* @since 0.1.0
* @memberOf _
* @category Object
* @param {Object} object The object to query.
* @returns {Array} Returns the array of property values.
* @example
*
* function Foo() {
* this.a = 1;
* this.b = 2;
* }
*
* Foo.prototype.c = 3;
*
* _.values(new Foo);
* // => [1, 2] (iteration order is not guaranteed)
*
* _.values('hi');
* // => ['h', 'i']
*/
function values(object) {
return object == null ? [] : baseValues(object, keys(object));
}
/**
* Creates an array of the own and inherited enumerable string keyed property
* values of `object`.
*
* **Note:** Non-object values are coerced to objects.
*
* @static
* @memberOf _
* @since 3.0.0
* @category Object
* @param {Object} object The object to query.
* @returns {Array} Returns the array of property values.
* @example
*
* function Foo() {
* this.a = 1;
* this.b = 2;
* }
*
* Foo.prototype.c = 3;
*
* _.valuesIn(new Foo);
* // => [1, 2, 3] (iteration order is not guaranteed)
*/
function valuesIn(object) {
return object == null ? [] : baseValues(object, keysIn(object));
}
/*------------------------------------------------------------------------*/
/**
* Clamps `number` within the inclusive `lower` and `upper` bounds.
*
* @static
* @memberOf _
* @since 4.0.0
* @category Number
* @param {number} number The number to clamp.
* @param {number} [lower] The lower bound.
* @param {number} upper The upper bound.
* @returns {number} Returns the clamped number.
* @example
*
* _.clamp(-10, -5, 5);
* // => -5
*
* _.clamp(10, -5, 5);
* // => 5
*/
function clamp(number, lower, upper) {
if (upper === undefined) {
upper = lower;
lower = undefined;
}
if (upper !== undefined) {
upper = toNumber(upper);
upper = upper === upper ? upper : 0;
}
if (lower !== undefined) {
lower = toNumber(lower);
lower = lower === lower ? lower : 0;
}
return baseClamp(toNumber(number), lower, upper);
}
/**
* Checks if `n` is between `start` and up to, but not including, `end`. If
* `end` is not specified, it's set to `start` with `start` then set to `0`.
* If `start` is greater than `end` the params are swapped to support
* negative ranges.
*
* @static
* @memberOf _
* @since 3.3.0
* @category Number
* @param {number} number The number to check.
* @param {number} [start=0] The start of the range.
* @param {number} end The end of the range.
* @returns {boolean} Returns `true` if `number` is in the range, else `false`.
* @see _.range, _.rangeRight
* @example
*
* _.inRange(3, 2, 4);
* // => true
*
* _.inRange(4, 8);
* // => true
*
* _.inRange(4, 2);
* // => false
*
* _.inRange(2, 2);
* // => false
*
* _.inRange(1.2, 2);
* // => true
*
* _.inRange(5.2, 4);
* // => false
*
* _.inRange(-3, -2, -6);
* // => true
*/
function inRange(number, start, end) {
start = toFinite(start);
if (end === undefined) {
end = start;
start = 0;
} else {
end = toFinite(end);
}
number = toNumber(number);
return baseInRange(number, start, end);
}
/**
* Produces a random number between the inclusive `lower` and `upper` bounds.
* If only one argument is provided a number between `0` and the given number
* is returned. If `floating` is `true`, or either `lower` or `upper` are
* floats, a floating-point number is returned instead of an integer.
*
* **Note:** JavaScript follows the IEEE-754 standard for resolving
* floating-point values which can produce unexpected results.
*
* @static
* @memberOf _
* @since 0.7.0
* @category Number
* @param {number} [lower=0] The lower bound.
* @param {number} [upper=1] The upper bound.
* @param {boolean} [floating] Specify returning a floating-point number.
* @returns {number} Returns the random number.
* @example
*
* _.random(0, 5);
* // => an integer between 0 and 5
*
* _.random(5);
* // => also an integer between 0 and 5
*
* _.random(5, true);
* // => a floating-point number between 0 and 5
*
* _.random(1.2, 5.2);
* // => a floating-point number between 1.2 and 5.2
*/
function random(lower, upper, floating) {
if (floating && typeof floating != 'boolean' && isIterateeCall(lower, upper, floating)) {
upper = floating = undefined;
}
if (floating === undefined) {
if (typeof upper == 'boolean') {
floating = upper;
upper = undefined;
}
else if (typeof lower == 'boolean') {
floating = lower;
lower = undefined;
}
}
if (lower === undefined && upper === undefined) {
lower = 0;
upper = 1;
}
else {
lower = toFinite(lower);
if (upper === undefined) {
upper = lower;
lower = 0;
} else {
upper = toFinite(upper);
}
}
if (lower > upper) {
var temp = lower;
lower = upper;
upper = temp;
}
if (floating || lower % 1 || upper % 1) {
var rand = nativeRandom();
return nativeMin(lower + (rand * (upper - lower + freeParseFloat('1e-' + ((rand + '').length - 1)))), upper);
}
return baseRandom(lower, upper);
}
/*------------------------------------------------------------------------*/
/**
* Converts `string` to [camel case](https://en.wikipedia.org/wiki/CamelCase).
*
* @static
* @memberOf _
* @since 3.0.0
* @category String
* @param {string} [string=''] The string to convert.
* @returns {string} Returns the camel cased string.
* @example
*
* _.camelCase('Foo Bar');
* // => 'fooBar'
*
* _.camelCase('--foo-bar--');
* // => 'fooBar'
*
* _.camelCase('__FOO_BAR__');
* // => 'fooBar'
*/
var camelCase = createCompounder(function(result, word, index) {
word = word.toLowerCase();
return result + (index ? capitalize(word) : word);
});
/**
* Converts the first character of `string` to upper case and the remaining
* to lower case.
*
* @static
* @memberOf _
* @since 3.0.0
* @category String
* @param {string} [string=''] The string to capitalize.
* @returns {string} Returns the capitalized string.
* @example
*
* _.capitalize('FRED');
* // => 'Fred'
*/
function capitalize(string) {
return upperFirst(toString(string).toLowerCase());
}
/**
* Deburrs `string` by converting
* [Latin-1 Supplement](https://en.wikipedia.org/wiki/Latin-1_Supplement_(Unicode_block)#Character_table)
* and [Latin Extended-A](https://en.wikipedia.org/wiki/Latin_Extended-A)
* letters to basic Latin letters and removing
* [combining diacritical marks](https://en.wikipedia.org/wiki/Combining_Diacritical_Marks).
*
* @static
* @memberOf _
* @since 3.0.0
* @category String
* @param {string} [string=''] The string to deburr.
* @returns {string} Returns the deburred string.
* @example
*
* _.deburr('déjà vu');
* // => 'deja vu'
*/
function deburr(string) {
string = toString(string);
return string && string.replace(reLatin, deburrLetter).replace(reComboMark, '');
}
/**
* Checks if `string` ends with the given target string.
*
* @static
* @memberOf _
* @since 3.0.0
* @category String
* @param {string} [string=''] The string to inspect.
* @param {string} [target] The string to search for.
* @param {number} [position=string.length] The position to search up to.
* @returns {boolean} Returns `true` if `string` ends with `target`,
* else `false`.
* @example
*
* _.endsWith('abc', 'c');
* // => true
*
* _.endsWith('abc', 'b');
* // => false
*
* _.endsWith('abc', 'b', 2);
* // => true
*/
function endsWith(string, target, position) {
string = toString(string);
target = baseToString(target);
var length = string.length;
position = position === undefined
? length
: baseClamp(toInteger(position), 0, length);
var end = position;
position -= target.length;
return position >= 0 && string.slice(position, end) == target;
}
/**
* Converts the characters "&", "<", ">", '"', and "'" in `string` to their
* corresponding HTML entities.
*
* **Note:** No other characters are escaped. To escape additional
* characters use a third-party library like [_he_](https://mths.be/he).
*
* Though the ">" character is escaped for symmetry, characters like
* ">" and "/" don't need escaping in HTML and have no special meaning
* unless they're part of a tag or unquoted attribute value. See
* [Mathias Bynens's article](https://mathiasbynens.be/notes/ambiguous-ampersands)
* (under "semi-related fun fact") for more details.
*
* When working with HTML you should always
* [quote attribute values](http://wonko.com/post/html-escaping) to reduce
* XSS vectors.
*
* @static
* @since 0.1.0
* @memberOf _
* @category String
* @param {string} [string=''] The string to escape.
* @returns {string} Returns the escaped string.
* @example
*
* _.escape('fred, barney, & pebbles');
* // => 'fred, barney, & pebbles'
*/
function escape(string) {
string = toString(string);
return (string && reHasUnescapedHtml.test(string))
? string.replace(reUnescapedHtml, escapeHtmlChar)
: string;
}
/**
* Escapes the `RegExp` special characters "^", "$", "\", ".", "*", "+",
* "?", "(", ")", "[", "]", "{", "}", and "|" in `string`.
*
* @static
* @memberOf _
* @since 3.0.0
* @category String
* @param {string} [string=''] The string to escape.
* @returns {string} Returns the escaped string.
* @example
*
* _.escapeRegExp('[lodash](https://lodash.com/)');
* // => '\[lodash\]\(https://lodash\.com/\)'
*/
function escapeRegExp(string) {
string = toString(string);
return (string && reHasRegExpChar.test(string))
? string.replace(reRegExpChar, '\\$&')
: string;
}
/**
* Converts `string` to
* [kebab case](https://en.wikipedia.org/wiki/Letter_case#Special_case_styles).
*
* @static
* @memberOf _
* @since 3.0.0
* @category String
* @param {string} [string=''] The string to convert.
* @returns {string} Returns the kebab cased string.
* @example
*
* _.kebabCase('Foo Bar');
* // => 'foo-bar'
*
* _.kebabCase('fooBar');
* // => 'foo-bar'
*
* _.kebabCase('__FOO_BAR__');
* // => 'foo-bar'
*/
var kebabCase = createCompounder(function(result, word, index) {
return result + (index ? '-' : '') + word.toLowerCase();
});
/**
* Converts `string`, as space separated words, to lower case.
*
* @static
* @memberOf _
* @since 4.0.0
* @category String
* @param {string} [string=''] The string to convert.
* @returns {string} Returns the lower cased string.
* @example
*
* _.lowerCase('--Foo-Bar--');
* // => 'foo bar'
*
* _.lowerCase('fooBar');
* // => 'foo bar'
*
* _.lowerCase('__FOO_BAR__');
* // => 'foo bar'
*/
var lowerCase = createCompounder(function(result, word, index) {
return result + (index ? ' ' : '') + word.toLowerCase();
});
/**
* Converts the first character of `string` to lower case.
*
* @static
* @memberOf _
* @since 4.0.0
* @category String
* @param {string} [string=''] The string to convert.
* @returns {string} Returns the converted string.
* @example
*
* _.lowerFirst('Fred');
* // => 'fred'
*
* _.lowerFirst('FRED');
* // => 'fRED'
*/
var lowerFirst = createCaseFirst('toLowerCase');
/**
* Pads `string` on the left and right sides if it's shorter than `length`.
* Padding characters are truncated if they can't be evenly divided by `length`.
*
* @static
* @memberOf _
* @since 3.0.0
* @category String
* @param {string} [string=''] The string to pad.
* @param {number} [length=0] The padding length.
* @param {string} [chars=' '] The string used as padding.
* @returns {string} Returns the padded string.
* @example
*
* _.pad('abc', 8);
* // => ' abc '
*
* _.pad('abc', 8, '_-');
* // => '_-abc_-_'
*
* _.pad('abc', 3);
* // => 'abc'
*/
function pad(string, length, chars) {
string = toString(string);
length = toInteger(length);
var strLength = length ? stringSize(string) : 0;
if (!length || strLength >= length) {
return string;
}
var mid = (length - strLength) / 2;
return (
createPadding(nativeFloor(mid), chars) +
string +
createPadding(nativeCeil(mid), chars)
);
}
/**
* Pads `string` on the right side if it's shorter than `length`. Padding
* characters are truncated if they exceed `length`.
*
* @static
* @memberOf _
* @since 4.0.0
* @category String
* @param {string} [string=''] The string to pad.
* @param {number} [length=0] The padding length.
* @param {string} [chars=' '] The string used as padding.
* @returns {string} Returns the padded string.
* @example
*
* _.padEnd('abc', 6);
* // => 'abc '
*
* _.padEnd('abc', 6, '_-');
* // => 'abc_-_'
*
* _.padEnd('abc', 3);
* // => 'abc'
*/
function padEnd(string, length, chars) {
string = toString(string);
length = toInteger(length);
var strLength = length ? stringSize(string) : 0;
return (length && strLength < length)
? (string + createPadding(length - strLength, chars))
: string;
}
/**
* Pads `string` on the left side if it's shorter than `length`. Padding
* characters are truncated if they exceed `length`.
*
* @static
* @memberOf _
* @since 4.0.0
* @category String
* @param {string} [string=''] The string to pad.
* @param {number} [length=0] The padding length.
* @param {string} [chars=' '] The string used as padding.
* @returns {string} Returns the padded string.
* @example
*
* _.padStart('abc', 6);
* // => ' abc'
*
* _.padStart('abc', 6, '_-');
* // => '_-_abc'
*
* _.padStart('abc', 3);
* // => 'abc'
*/
function padStart(string, length, chars) {
string = toString(string);
length = toInteger(length);
var strLength = length ? stringSize(string) : 0;
return (length && strLength < length)
? (createPadding(length - strLength, chars) + string)
: string;
}
/**
* Converts `string` to an integer of the specified radix. If `radix` is
* `undefined` or `0`, a `radix` of `10` is used unless `value` is a
* hexadecimal, in which case a `radix` of `16` is used.
*
* **Note:** This method aligns with the
* [ES5 implementation](https://es5.github.io/#x15.1.2.2) of `parseInt`.
*
* @static
* @memberOf _
* @since 1.1.0
* @category String
* @param {string} string The string to convert.
* @param {number} [radix=10] The radix to interpret `value` by.
* @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.
* @returns {number} Returns the converted integer.
* @example
*
* _.parseInt('08');
* // => 8
*
* _.map(['6', '08', '10'], _.parseInt);
* // => [6, 8, 10]
*/
function parseInt(string, radix, guard) {
if (guard || radix == null) {
radix = 0;
} else if (radix) {
radix = +radix;
}
return nativeParseInt(toString(string).replace(reTrimStart, ''), radix || 0);
}
/**
* Repeats the given string `n` times.
*
* @static
* @memberOf _
* @since 3.0.0
* @category String
* @param {string} [string=''] The string to repeat.
* @param {number} [n=1] The number of times to repeat the string.
* @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.
* @returns {string} Returns the repeated string.
* @example
*
* _.repeat('*', 3);
* // => '***'
*
* _.repeat('abc', 2);
* // => 'abcabc'
*
* _.repeat('abc', 0);
* // => ''
*/
function repeat(string, n, guard) {
if ((guard ? isIterateeCall(string, n, guard) : n === undefined)) {
n = 1;
} else {
n = toInteger(n);
}
return baseRepeat(toString(string), n);
}
/**
* Replaces matches for `pattern` in `string` with `replacement`.
*
* **Note:** This method is based on
* [`String#replace`](https://mdn.io/String/replace).
*
* @static
* @memberOf _
* @since 4.0.0
* @category String
* @param {string} [string=''] The string to modify.
* @param {RegExp|string} pattern The pattern to replace.
* @param {Function|string} replacement The match replacement.
* @returns {string} Returns the modified string.
* @example
*
* _.replace('Hi Fred', 'Fred', 'Barney');
* // => 'Hi Barney'
*/
function replace() {
var args = arguments,
string = toString(args[0]);
return args.length < 3 ? string : string.replace(args[1], args[2]);
}
/**
* Converts `string` to
* [snake case](https://en.wikipedia.org/wiki/Snake_case).
*
* @static
* @memberOf _
* @since 3.0.0
* @category String
* @param {string} [string=''] The string to convert.
* @returns {string} Returns the snake cased string.
* @example
*
* _.snakeCase('Foo Bar');
* // => 'foo_bar'
*
* _.snakeCase('fooBar');
* // => 'foo_bar'
*
* _.snakeCase('--FOO-BAR--');
* // => 'foo_bar'
*/
var snakeCase = createCompounder(function(result, word, index) {
return result + (index ? '_' : '') + word.toLowerCase();
});
/**
* Splits `string` by `separator`.
*
* **Note:** This method is based on
* [`String#split`](https://mdn.io/String/split).
*
* @static
* @memberOf _
* @since 4.0.0
* @category String
* @param {string} [string=''] The string to split.
* @param {RegExp|string} separator The separator pattern to split by.
* @param {number} [limit] The length to truncate results to.
* @returns {Array} Returns the string segments.
* @example
*
* _.split('a-b-c', '-', 2);
* // => ['a', 'b']
*/
function split(string, separator, limit) {
if (limit && typeof limit != 'number' && isIterateeCall(string, separator, limit)) {
separator = limit = undefined;
}
limit = limit === undefined ? MAX_ARRAY_LENGTH : limit >>> 0;
if (!limit) {
return [];
}
string = toString(string);
if (string && (
typeof separator == 'string' ||
(separator != null && !isRegExp(separator))
)) {
separator = baseToString(separator);
if (!separator && hasUnicode(string)) {
return castSlice(stringToArray(string), 0, limit);
}
}
return string.split(separator, limit);
}
/**
* Converts `string` to
* [start case](https://en.wikipedia.org/wiki/Letter_case#Stylistic_or_specialised_usage).
*
* @static
* @memberOf _
* @since 3.1.0
* @category String
* @param {string} [string=''] The string to convert.
* @returns {string} Returns the start cased string.
* @example
*
* _.startCase('--foo-bar--');
* // => 'Foo Bar'
*
* _.startCase('fooBar');
* // => 'Foo Bar'
*
* _.startCase('__FOO_BAR__');
* // => 'FOO BAR'
*/
var startCase = createCompounder(function(result, word, index) {
return result + (index ? ' ' : '') + upperFirst(word);
});
/**
* Checks if `string` starts with the given target string.
*
* @static
* @memberOf _
* @since 3.0.0
* @category String
* @param {string} [string=''] The string to inspect.
* @param {string} [target] The string to search for.
* @param {number} [position=0] The position to search from.
* @returns {boolean} Returns `true` if `string` starts with `target`,
* else `false`.
* @example
*
* _.startsWith('abc', 'a');
* // => true
*
* _.startsWith('abc', 'b');
* // => false
*
* _.startsWith('abc', 'b', 1);
* // => true
*/
function startsWith(string, target, position) {
string = toString(string);
position = position == null
? 0
: baseClamp(toInteger(position), 0, string.length);
target = baseToString(target);
return string.slice(position, position + target.length) == target;
}
/**
* Creates a compiled template function that can interpolate data properties
* in "interpolate" delimiters, HTML-escape interpolated data properties in
* "escape" delimiters, and execute JavaScript in "evaluate" delimiters. Data
* properties may be accessed as free variables in the template. If a setting
* object is given, it takes precedence over `_.templateSettings` values.
*
* **Note:** In the development build `_.template` utilizes
* [sourceURLs](http://www.html5rocks.com/en/tutorials/developertools/sourcemaps/#toc-sourceurl)
* for easier debugging.
*
* For more information on precompiling templates see
* [lodash's custom builds documentation](https://lodash.com/custom-builds).
*
* For more information on Chrome extension sandboxes see
* [Chrome's extensions documentation](https://developer.chrome.com/extensions/sandboxingEval).
*
* @static
* @since 0.1.0
* @memberOf _
* @category String
* @param {string} [string=''] The template string.
* @param {Object} [options={}] The options object.
* @param {RegExp} [options.escape=_.templateSettings.escape]
* The HTML "escape" delimiter.
* @param {RegExp} [options.evaluate=_.templateSettings.evaluate]
* The "evaluate" delimiter.
* @param {Object} [options.imports=_.templateSettings.imports]
* An object to import into the template as free variables.
* @param {RegExp} [options.interpolate=_.templateSettings.interpolate]
* The "interpolate" delimiter.
* @param {string} [options.sourceURL='lodash.templateSources[n]']
* The sourceURL of the compiled template.
* @param {string} [options.variable='obj']
* The data object variable name.
* @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.
* @returns {Function} Returns the compiled template function.
* @example
*
* // Use the "interpolate" delimiter to create a compiled template.
* var compiled = _.template('hello <%= user %>!');
* compiled({ 'user': 'fred' });
* // => 'hello fred!'
*
* // Use the HTML "escape" delimiter to escape data property values.
* var compiled = _.template('<b><%- value %></b>');
* compiled({ 'value': '<script>' });
* // => '<b><script></b>'
*
* // Use the "evaluate" delimiter to execute JavaScript and generate HTML.
* var compiled = _.template('<% _.forEach(users, function(user) { %><li><%- user %></li><% }); %>');
* compiled({ 'users': ['fred', 'barney'] });
* // => '<li>fred</li><li>barney</li>'
*
* // Use the internal `print` function in "evaluate" delimiters.
* var compiled = _.template('<% print("hello " + user); %>!');
* compiled({ 'user': 'barney' });
* // => 'hello barney!'
*
* // Use the ES template literal delimiter as an "interpolate" delimiter.
* // Disable support by replacing the "interpolate" delimiter.
* var compiled = _.template('hello ${ user }!');
* compiled({ 'user': 'pebbles' });
* // => 'hello pebbles!'
*
* // Use backslashes to treat delimiters as plain text.
* var compiled = _.template('<%= "\\<%- value %\\>" %>');
* compiled({ 'value': 'ignored' });
* // => '<%- value %>'
*
* // Use the `imports` option to import `jQuery` as `jq`.
* var text = '<% jq.each(users, function(user) { %><li><%- user %></li><% }); %>';
* var compiled = _.template(text, { 'imports': { 'jq': jQuery } });
* compiled({ 'users': ['fred', 'barney'] });
* // => '<li>fred</li><li>barney</li>'
*
* // Use the `sourceURL` option to specify a custom sourceURL for the template.
* var compiled = _.template('hello <%= user %>!', { 'sourceURL': '/basic/greeting.jst' });
* compiled(data);
* // => Find the source of "greeting.jst" under the Sources tab or Resources panel of the web inspector.
*
* // Use the `variable` option to ensure a with-statement isn't used in the compiled template.
* var compiled = _.template('hi <%= data.user %>!', { 'variable': 'data' });
* compiled.source;
* // => function(data) {
* // var __t, __p = '';
* // __p += 'hi ' + ((__t = ( data.user )) == null ? '' : __t) + '!';
* // return __p;
* // }
*
* // Use custom template delimiters.
* _.templateSettings.interpolate = /{{([\s\S]+?)}}/g;
* var compiled = _.template('hello {{ user }}!');
* compiled({ 'user': 'mustache' });
* // => 'hello mustache!'
*
* // Use the `source` property to inline compiled templates for meaningful
* // line numbers in error messages and stack traces.
* fs.writeFileSync(path.join(process.cwd(), 'jst.js'), '\
* var JST = {\
* "main": ' + _.template(mainText).source + '\
* };\
* ');
*/
function template(string, options, guard) {
// Based on John Resig's `tmpl` implementation
// (http://ejohn.org/blog/javascript-micro-templating/)
// and Laura Doktorova's doT.js (https://github.com/olado/doT).
var settings = lodash.templateSettings;
if (guard && isIterateeCall(string, options, guard)) {
options = undefined;
}
string = toString(string);
options = assignInWith({}, options, settings, customDefaultsAssignIn);
var imports = assignInWith({}, options.imports, settings.imports, customDefaultsAssignIn),
importsKeys = keys(imports),
importsValues = baseValues(imports, importsKeys);
var isEscaping,
isEvaluating,
index = 0,
interpolate = options.interpolate || reNoMatch,
source = "__p += '";
// Compile the regexp to match each delimiter.
var reDelimiters = RegExp(
(options.escape || reNoMatch).source + '|' +
interpolate.source + '|' +
(interpolate === reInterpolate ? reEsTemplate : reNoMatch).source + '|' +
(options.evaluate || reNoMatch).source + '|$'
, 'g');
// Use a sourceURL for easier debugging.
var sourceURL = '//# sourceURL=' +
('sourceURL' in options
? options.sourceURL
: ('lodash.templateSources[' + (++templateCounter) + ']')
) + '\n';
string.replace(reDelimiters, function(match, escapeValue, interpolateValue, esTemplateValue, evaluateValue, offset) {
interpolateValue || (interpolateValue = esTemplateValue);
// Escape characters that can't be included in string literals.
source += string.slice(index, offset).replace(reUnescapedString, escapeStringChar);
// Replace delimiters with snippets.
if (escapeValue) {
isEscaping = true;
source += "' +\n__e(" + escapeValue + ") +\n'";
}
if (evaluateValue) {
isEvaluating = true;
source += "';\n" + evaluateValue + ";\n__p += '";
}
if (interpolateValue) {
source += "' +\n((__t = (" + interpolateValue + ")) == null ? '' : __t) +\n'";
}
index = offset + match.length;
// The JS engine embedded in Adobe products needs `match` returned in
// order to produce the correct `offset` value.
return match;
});
source += "';\n";
// If `variable` is not specified wrap a with-statement around the generated
// code to add the data object to the top of the scope chain.
var variable = options.variable;
if (!variable) {
source = 'with (obj) {\n' + source + '\n}\n';
}
// Cleanup code by stripping empty strings.
source = (isEvaluating ? source.replace(reEmptyStringLeading, '') : source)
.replace(reEmptyStringMiddle, '$1')
.replace(reEmptyStringTrailing, '$1;');
// Frame code as the function body.
source = 'function(' + (variable || 'obj') + ') {\n' +
(variable
? ''
: 'obj || (obj = {});\n'
) +
"var __t, __p = ''" +
(isEscaping
? ', __e = _.escape'
: ''
) +
(isEvaluating
? ', __j = Array.prototype.join;\n' +
"function print() { __p += __j.call(arguments, '') }\n"
: ';\n'
) +
source +
'return __p\n}';
var result = attempt(function() {
return Function(importsKeys, sourceURL + 'return ' + source)
.apply(undefined, importsValues);
});
// Provide the compiled function's source by its `toString` method or
// the `source` property as a convenience for inlining compiled templates.
result.source = source;
if (isError(result)) {
throw result;
}
return result;
}
/**
* Converts `string`, as a whole, to lower case just like
* [String#toLowerCase](https://mdn.io/toLowerCase).
*
* @static
* @memberOf _
* @since 4.0.0
* @category String
* @param {string} [string=''] The string to convert.
* @returns {string} Returns the lower cased string.
* @example
*
* _.toLower('--Foo-Bar--');
* // => '--foo-bar--'
*
* _.toLower('fooBar');
* // => 'foobar'
*
* _.toLower('__FOO_BAR__');
* // => '__foo_bar__'
*/
function toLower(value) {
return toString(value).toLowerCase();
}
/**
* Converts `string`, as a whole, to upper case just like
* [String#toUpperCase](https://mdn.io/toUpperCase).
*
* @static
* @memberOf _
* @since 4.0.0
* @category String
* @param {string} [string=''] The string to convert.
* @returns {string} Returns the upper cased string.
* @example
*
* _.toUpper('--foo-bar--');
* // => '--FOO-BAR--'
*
* _.toUpper('fooBar');
* // => 'FOOBAR'
*
* _.toUpper('__foo_bar__');
* // => '__FOO_BAR__'
*/
function toUpper(value) {
return toString(value).toUpperCase();
}
/**
* Removes leading and trailing whitespace or specified characters from `string`.
*
* @static
* @memberOf _
* @since 3.0.0
* @category String
* @param {string} [string=''] The string to trim.
* @param {string} [chars=whitespace] The characters to trim.
* @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.
* @returns {string} Returns the trimmed string.
* @example
*
* _.trim(' abc ');
* // => 'abc'
*
* _.trim('-_-abc-_-', '_-');
* // => 'abc'
*
* _.map([' foo ', ' bar '], _.trim);
* // => ['foo', 'bar']
*/
function trim(string, chars, guard) {
string = toString(string);
if (string && (guard || chars === undefined)) {
return string.replace(reTrim, '');
}
if (!string || !(chars = baseToString(chars))) {
return string;
}
var strSymbols = stringToArray(string),
chrSymbols = stringToArray(chars),
start = charsStartIndex(strSymbols, chrSymbols),
end = charsEndIndex(strSymbols, chrSymbols) + 1;
return castSlice(strSymbols, start, end).join('');
}
/**
* Removes trailing whitespace or specified characters from `string`.
*
* @static
* @memberOf _
* @since 4.0.0
* @category String
* @param {string} [string=''] The string to trim.
* @param {string} [chars=whitespace] The characters to trim.
* @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.
* @returns {string} Returns the trimmed string.
* @example
*
* _.trimEnd(' abc ');
* // => ' abc'
*
* _.trimEnd('-_-abc-_-', '_-');
* // => '-_-abc'
*/
function trimEnd(string, chars, guard) {
string = toString(string);
if (string && (guard || chars === undefined)) {
return string.replace(reTrimEnd, '');
}
if (!string || !(chars = baseToString(chars))) {
return string;
}
var strSymbols = stringToArray(string),
end = charsEndIndex(strSymbols, stringToArray(chars)) + 1;
return castSlice(strSymbols, 0, end).join('');
}
/**
* Removes leading whitespace or specified characters from `string`.
*
* @static
* @memberOf _
* @since 4.0.0
* @category String
* @param {string} [string=''] The string to trim.
* @param {string} [chars=whitespace] The characters to trim.
* @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.
* @returns {string} Returns the trimmed string.
* @example
*
* _.trimStart(' abc ');
* // => 'abc '
*
* _.trimStart('-_-abc-_-', '_-');
* // => 'abc-_-'
*/
function trimStart(string, chars, guard) {
string = toString(string);
if (string && (guard || chars === undefined)) {
return string.replace(reTrimStart, '');
}
if (!string || !(chars = baseToString(chars))) {
return string;
}
var strSymbols = stringToArray(string),
start = charsStartIndex(strSymbols, stringToArray(chars));
return castSlice(strSymbols, start).join('');
}
/**
* Truncates `string` if it's longer than the given maximum string length.
* The last characters of the truncated string are replaced with the omission
* string which defaults to "...".
*
* @static
* @memberOf _
* @since 4.0.0
* @category String
* @param {string} [string=''] The string to truncate.
* @param {Object} [options={}] The options object.
* @param {number} [options.length=30] The maximum string length.
* @param {string} [options.omission='...'] The string to indicate text is omitted.
* @param {RegExp|string} [options.separator] The separator pattern to truncate to.
* @returns {string} Returns the truncated string.
* @example
*
* _.truncate('hi-diddly-ho there, neighborino');
* // => 'hi-diddly-ho there, neighbo...'
*
* _.truncate('hi-diddly-ho there, neighborino', {
* 'length': 24,
* 'separator': ' '
* });
* // => 'hi-diddly-ho there,...'
*
* _.truncate('hi-diddly-ho there, neighborino', {
* 'length': 24,
* 'separator': /,? +/
* });
* // => 'hi-diddly-ho there...'
*
* _.truncate('hi-diddly-ho there, neighborino', {
* 'omission': ' [...]'
* });
* // => 'hi-diddly-ho there, neig [...]'
*/
function truncate(string, options) {
var length = DEFAULT_TRUNC_LENGTH,
omission = DEFAULT_TRUNC_OMISSION;
if (isObject(options)) {
var separator = 'separator' in options ? options.separator : separator;
length = 'length' in options ? toInteger(options.length) : length;
omission = 'omission' in options ? baseToString(options.omission) : omission;
}
string = toString(string);
var strLength = string.length;
if (hasUnicode(string)) {
var strSymbols = stringToArray(string);
strLength = strSymbols.length;
}
if (length >= strLength) {
return string;
}
var end = length - stringSize(omission);
if (end < 1) {
return omission;
}
var result = strSymbols
? castSlice(strSymbols, 0, end).join('')
: string.slice(0, end);
if (separator === undefined) {
return result + omission;
}
if (strSymbols) {
end += (result.length - end);
}
if (isRegExp(separator)) {
if (string.slice(end).search(separator)) {
var match,
substring = result;
if (!separator.global) {
separator = RegExp(separator.source, toString(reFlags.exec(separator)) + 'g');
}
separator.lastIndex = 0;
while ((match = separator.exec(substring))) {
var newEnd = match.index;
}
result = result.slice(0, newEnd === undefined ? end : newEnd);
}
} else if (string.indexOf(baseToString(separator), end) != end) {
var index = result.lastIndexOf(separator);
if (index > -1) {
result = result.slice(0, index);
}
}
return result + omission;
}
/**
* The inverse of `_.escape`; this method converts the HTML entities
* `&`, `<`, `>`, `"`, and `'` in `string` to
* their corresponding characters.
*
* **Note:** No other HTML entities are unescaped. To unescape additional
* HTML entities use a third-party library like [_he_](https://mths.be/he).
*
* @static
* @memberOf _
* @since 0.6.0
* @category String
* @param {string} [string=''] The string to unescape.
* @returns {string} Returns the unescaped string.
* @example
*
* _.unescape('fred, barney, & pebbles');
* // => 'fred, barney, & pebbles'
*/
function unescape(string) {
string = toString(string);
return (string && reHasEscapedHtml.test(string))
? string.replace(reEscapedHtml, unescapeHtmlChar)
: string;
}
/**
* Converts `string`, as space separated words, to upper case.
*
* @static
* @memberOf _
* @since 4.0.0
* @category String
* @param {string} [string=''] The string to convert.
* @returns {string} Returns the upper cased string.
* @example
*
* _.upperCase('--foo-bar');
* // => 'FOO BAR'
*
* _.upperCase('fooBar');
* // => 'FOO BAR'
*
* _.upperCase('__foo_bar__');
* // => 'FOO BAR'
*/
var upperCase = createCompounder(function(result, word, index) {
return result + (index ? ' ' : '') + word.toUpperCase();
});
/**
* Converts the first character of `string` to upper case.
*
* @static
* @memberOf _
* @since 4.0.0
* @category String
* @param {string} [string=''] The string to convert.
* @returns {string} Returns the converted string.
* @example
*
* _.upperFirst('fred');
* // => 'Fred'
*
* _.upperFirst('FRED');
* // => 'FRED'
*/
var upperFirst = createCaseFirst('toUpperCase');
/**
* Splits `string` into an array of its words.
*
* @static
* @memberOf _
* @since 3.0.0
* @category String
* @param {string} [string=''] The string to inspect.
* @param {RegExp|string} [pattern] The pattern to match words.
* @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.
* @returns {Array} Returns the words of `string`.
* @example
*
* _.words('fred, barney, & pebbles');
* // => ['fred', 'barney', 'pebbles']
*
* _.words('fred, barney, & pebbles', /[^, ]+/g);
* // => ['fred', 'barney', '&', 'pebbles']
*/
function words(string, pattern, guard) {
string = toString(string);
pattern = guard ? undefined : pattern;
if (pattern === undefined) {
return hasUnicodeWord(string) ? unicodeWords(string) : asciiWords(string);
}
return string.match(pattern) || [];
}
/*------------------------------------------------------------------------*/
/**
* Attempts to invoke `func`, returning either the result or the caught error
* object. Any additional arguments are provided to `func` when it's invoked.
*
* @static
* @memberOf _
* @since 3.0.0
* @category Util
* @param {Function} func The function to attempt.
* @param {...*} [args] The arguments to invoke `func` with.
* @returns {*} Returns the `func` result or error object.
* @example
*
* // Avoid throwing errors for invalid selectors.
* var elements = _.attempt(function(selector) {
* return document.querySelectorAll(selector);
* }, '>_>');
*
* if (_.isError(elements)) {
* elements = [];
* }
*/
var attempt = baseRest(function(func, args) {
try {
return apply(func, undefined, args);
} catch (e) {
return isError(e) ? e : new Error(e);
}
});
/**
* Binds methods of an object to the object itself, overwriting the existing
* method.
*
* **Note:** This method doesn't set the "length" property of bound functions.
*
* @static
* @since 0.1.0
* @memberOf _
* @category Util
* @param {Object} object The object to bind and assign the bound methods to.
* @param {...(string|string[])} methodNames The object method names to bind.
* @returns {Object} Returns `object`.
* @example
*
* var view = {
* 'label': 'docs',
* 'click': function() {
* console.log('clicked ' + this.label);
* }
* };
*
* _.bindAll(view, ['click']);
* jQuery(element).on('click', view.click);
* // => Logs 'clicked docs' when clicked.
*/
var bindAll = flatRest(function(object, methodNames) {
arrayEach(methodNames, function(key) {
key = toKey(key);
baseAssignValue(object, key, bind(object[key], object));
});
return object;
});
/**
* Creates a function that iterates over `pairs` and invokes the corresponding
* function of the first predicate to return truthy. The predicate-function
* pairs are invoked with the `this` binding and arguments of the created
* function.
*
* @static
* @memberOf _
* @since 4.0.0
* @category Util
* @param {Array} pairs The predicate-function pairs.
* @returns {Function} Returns the new composite function.
* @example
*
* var func = _.cond([
* [_.matches({ 'a': 1 }), _.constant('matches A')],
* [_.conforms({ 'b': _.isNumber }), _.constant('matches B')],
* [_.stubTrue, _.constant('no match')]
* ]);
*
* func({ 'a': 1, 'b': 2 });
* // => 'matches A'
*
* func({ 'a': 0, 'b': 1 });
* // => 'matches B'
*
* func({ 'a': '1', 'b': '2' });
* // => 'no match'
*/
function cond(pairs) {
var length = pairs == null ? 0 : pairs.length,
toIteratee = getIteratee();
pairs = !length ? [] : arrayMap(pairs, function(pair) {
if (typeof pair[1] != 'function') {
throw new TypeError(FUNC_ERROR_TEXT);
}
return [toIteratee(pair[0]), pair[1]];
});
return baseRest(function(args) {
var index = -1;
while (++index < length) {
var pair = pairs[index];
if (apply(pair[0], this, args)) {
return apply(pair[1], this, args);
}
}
});
}
/**
* Creates a function that invokes the predicate properties of `source` with
* the corresponding property values of a given object, returning `true` if
* all predicates return truthy, else `false`.
*
* **Note:** The created function is equivalent to `_.conformsTo` with
* `source` partially applied.
*
* @static
* @memberOf _
* @since 4.0.0
* @category Util
* @param {Object} source The object of property predicates to conform to.
* @returns {Function} Returns the new spec function.
* @example
*
* var objects = [
* { 'a': 2, 'b': 1 },
* { 'a': 1, 'b': 2 }
* ];
*
* _.filter(objects, _.conforms({ 'b': function(n) { return n > 1; } }));
* // => [{ 'a': 1, 'b': 2 }]
*/
function conforms(source) {
return baseConforms(baseClone(source, CLONE_DEEP_FLAG));
}
/**
* Creates a function that returns `value`.
*
* @static
* @memberOf _
* @since 2.4.0
* @category Util
* @param {*} value The value to return from the new function.
* @returns {Function} Returns the new constant function.
* @example
*
* var objects = _.times(2, _.constant({ 'a': 1 }));
*
* console.log(objects);
* // => [{ 'a': 1 }, { 'a': 1 }]
*
* console.log(objects[0] === objects[1]);
* // => true
*/
function constant(value) {
return function() {
return value;
};
}
/**
* Checks `value` to determine whether a default value should be returned in
* its place. The `defaultValue` is returned if `value` is `NaN`, `null`,
* or `undefined`.
*
* @static
* @memberOf _
* @since 4.14.0
* @category Util
* @param {*} value The value to check.
* @param {*} defaultValue The default value.
* @returns {*} Returns the resolved value.
* @example
*
* _.defaultTo(1, 10);
* // => 1
*
* _.defaultTo(undefined, 10);
* // => 10
*/
function defaultTo(value, defaultValue) {
return (value == null || value !== value) ? defaultValue : value;
}
/**
* Creates a function that returns the result of invoking the given functions
* with the `this` binding of the created function, where each successive
* invocation is supplied the return value of the previous.
*
* @static
* @memberOf _
* @since 3.0.0
* @category Util
* @param {...(Function|Function[])} [funcs] The functions to invoke.
* @returns {Function} Returns the new composite function.
* @see _.flowRight
* @example
*
* function square(n) {
* return n * n;
* }
*
* var addSquare = _.flow([_.add, square]);
* addSquare(1, 2);
* // => 9
*/
var flow = createFlow();
/**
* This method is like `_.flow` except that it creates a function that
* invokes the given functions from right to left.
*
* @static
* @since 3.0.0
* @memberOf _
* @category Util
* @param {...(Function|Function[])} [funcs] The functions to invoke.
* @returns {Function} Returns the new composite function.
* @see _.flow
* @example
*
* function square(n) {
* return n * n;
* }
*
* var addSquare = _.flowRight([square, _.add]);
* addSquare(1, 2);
* // => 9
*/
var flowRight = createFlow(true);
/**
* This method returns the first argument it receives.
*
* @static
* @since 0.1.0
* @memberOf _
* @category Util
* @param {*} value Any value.
* @returns {*} Returns `value`.
* @example
*
* var object = { 'a': 1 };
*
* console.log(_.identity(object) === object);
* // => true
*/
function identity(value) {
return value;
}
/**
* Creates a function that invokes `func` with the arguments of the created
* function. If `func` is a property name, the created function returns the
* property value for a given element. If `func` is an array or object, the
* created function returns `true` for elements that contain the equivalent
* source properties, otherwise it returns `false`.
*
* @static
* @since 4.0.0
* @memberOf _
* @category Util
* @param {*} [func=_.identity] The value to convert to a callback.
* @returns {Function} Returns the callback.
* @example
*
* var users = [
* { 'user': 'barney', 'age': 36, 'active': true },
* { 'user': 'fred', 'age': 40, 'active': false }
* ];
*
* // The `_.matches` iteratee shorthand.
* _.filter(users, _.iteratee({ 'user': 'barney', 'active': true }));
* // => [{ 'user': 'barney', 'age': 36, 'active': true }]
*
* // The `_.matchesProperty` iteratee shorthand.
* _.filter(users, _.iteratee(['user', 'fred']));
* // => [{ 'user': 'fred', 'age': 40 }]
*
* // The `_.property` iteratee shorthand.
* _.map(users, _.iteratee('user'));
* // => ['barney', 'fred']
*
* // Create custom iteratee shorthands.
* _.iteratee = _.wrap(_.iteratee, function(iteratee, func) {
* return !_.isRegExp(func) ? iteratee(func) : function(string) {
* return func.test(string);
* };
* });
*
* _.filter(['abc', 'def'], /ef/);
* // => ['def']
*/
function iteratee(func) {
return baseIteratee(typeof func == 'function' ? func : baseClone(func, CLONE_DEEP_FLAG));
}
/**
* Creates a function that performs a partial deep comparison between a given
* object and `source`, returning `true` if the given object has equivalent
* property values, else `false`.
*
* **Note:** The created function is equivalent to `_.isMatch` with `source`
* partially applied.
*
* Partial comparisons will match empty array and empty object `source`
* values against any array or object value, respectively. See `_.isEqual`
* for a list of supported value comparisons.
*
* @static
* @memberOf _
* @since 3.0.0
* @category Util
* @param {Object} source The object of property values to match.
* @returns {Function} Returns the new spec function.
* @example
*
* var objects = [
* { 'a': 1, 'b': 2, 'c': 3 },
* { 'a': 4, 'b': 5, 'c': 6 }
* ];
*
* _.filter(objects, _.matches({ 'a': 4, 'c': 6 }));
* // => [{ 'a': 4, 'b': 5, 'c': 6 }]
*/
function matches(source) {
return baseMatches(baseClone(source, CLONE_DEEP_FLAG));
}
/**
* Creates a function that performs a partial deep comparison between the
* value at `path` of a given object to `srcValue`, returning `true` if the
* object value is equivalent, else `false`.
*
* **Note:** Partial comparisons will match empty array and empty object
* `srcValue` values against any array or object value, respectively. See
* `_.isEqual` for a list of supported value comparisons.
*
* @static
* @memberOf _
* @since 3.2.0
* @category Util
* @param {Array|string} path The path of the property to get.
* @param {*} srcValue The value to match.
* @returns {Function} Returns the new spec function.
* @example
*
* var objects = [
* { 'a': 1, 'b': 2, 'c': 3 },
* { 'a': 4, 'b': 5, 'c': 6 }
* ];
*
* _.find(objects, _.matchesProperty('a', 4));
* // => { 'a': 4, 'b': 5, 'c': 6 }
*/
function matchesProperty(path, srcValue) {
return baseMatchesProperty(path, baseClone(srcValue, CLONE_DEEP_FLAG));
}
/**
* Creates a function that invokes the method at `path` of a given object.
* Any additional arguments are provided to the invoked method.
*
* @static
* @memberOf _
* @since 3.7.0
* @category Util
* @param {Array|string} path The path of the method to invoke.
* @param {...*} [args] The arguments to invoke the method with.
* @returns {Function} Returns the new invoker function.
* @example
*
* var objects = [
* { 'a': { 'b': _.constant(2) } },
* { 'a': { 'b': _.constant(1) } }
* ];
*
* _.map(objects, _.method('a.b'));
* // => [2, 1]
*
* _.map(objects, _.method(['a', 'b']));
* // => [2, 1]
*/
var method = baseRest(function(path, args) {
return function(object) {
return baseInvoke(object, path, args);
};
});
/**
* The opposite of `_.method`; this method creates a function that invokes
* the method at a given path of `object`. Any additional arguments are
* provided to the invoked method.
*
* @static
* @memberOf _
* @since 3.7.0
* @category Util
* @param {Object} object The object to query.
* @param {...*} [args] The arguments to invoke the method with.
* @returns {Function} Returns the new invoker function.
* @example
*
* var array = _.times(3, _.constant),
* object = { 'a': array, 'b': array, 'c': array };
*
* _.map(['a[2]', 'c[0]'], _.methodOf(object));
* // => [2, 0]
*
* _.map([['a', '2'], ['c', '0']], _.methodOf(object));
* // => [2, 0]
*/
var methodOf = baseRest(function(object, args) {
return function(path) {
return baseInvoke(object, path, args);
};
});
/**
* Adds all own enumerable string keyed function properties of a source
* object to the destination object. If `object` is a function, then methods
* are added to its prototype as well.
*
* **Note:** Use `_.runInContext` to create a pristine `lodash` function to
* avoid conflicts caused by modifying the original.
*
* @static
* @since 0.1.0
* @memberOf _
* @category Util
* @param {Function|Object} [object=lodash] The destination object.
* @param {Object} source The object of functions to add.
* @param {Object} [options={}] The options object.
* @param {boolean} [options.chain=true] Specify whether mixins are chainable.
* @returns {Function|Object} Returns `object`.
* @example
*
* function vowels(string) {
* return _.filter(string, function(v) {
* return /[aeiou]/i.test(v);
* });
* }
*
* _.mixin({ 'vowels': vowels });
* _.vowels('fred');
* // => ['e']
*
* _('fred').vowels().value();
* // => ['e']
*
* _.mixin({ 'vowels': vowels }, { 'chain': false });
* _('fred').vowels();
* // => ['e']
*/
function mixin(object, source, options) {
var props = keys(source),
methodNames = baseFunctions(source, props);
if (options == null &&
!(isObject(source) && (methodNames.length || !props.length))) {
options = source;
source = object;
object = this;
methodNames = baseFunctions(source, keys(source));
}
var chain = !(isObject(options) && 'chain' in options) || !!options.chain,
isFunc = isFunction(object);
arrayEach(methodNames, function(methodName) {
var func = source[methodName];
object[methodName] = func;
if (isFunc) {
object.prototype[methodName] = function() {
var chainAll = this.__chain__;
if (chain || chainAll) {
var result = object(this.__wrapped__),
actions = result.__actions__ = copyArray(this.__actions__);
actions.push({ 'func': func, 'args': arguments, 'thisArg': object });
result.__chain__ = chainAll;
return result;
}
return func.apply(object, arrayPush([this.value()], arguments));
};
}
});
return object;
}
/**
* Reverts the `_` variable to its previous value and returns a reference to
* the `lodash` function.
*
* @static
* @since 0.1.0
* @memberOf _
* @category Util
* @returns {Function} Returns the `lodash` function.
* @example
*
* var lodash = _.noConflict();
*/
function noConflict() {
if (root._ === this) {
root._ = oldDash;
}
return this;
}
/**
* This method returns `undefined`.
*
* @static
* @memberOf _
* @since 2.3.0
* @category Util
* @example
*
* _.times(2, _.noop);
* // => [undefined, undefined]
*/
function noop() {
// No operation performed.
}
/**
* Creates a function that gets the argument at index `n`. If `n` is negative,
* the nth argument from the end is returned.
*
* @static
* @memberOf _
* @since 4.0.0
* @category Util
* @param {number} [n=0] The index of the argument to return.
* @returns {Function} Returns the new pass-thru function.
* @example
*
* var func = _.nthArg(1);
* func('a', 'b', 'c', 'd');
* // => 'b'
*
* var func = _.nthArg(-2);
* func('a', 'b', 'c', 'd');
* // => 'c'
*/
function nthArg(n) {
n = toInteger(n);
return baseRest(function(args) {
return baseNth(args, n);
});
}
/**
* Creates a function that invokes `iteratees` with the arguments it receives
* and returns their results.
*
* @static
* @memberOf _
* @since 4.0.0
* @category Util
* @param {...(Function|Function[])} [iteratees=[_.identity]]
* The iteratees to invoke.
* @returns {Function} Returns the new function.
* @example
*
* var func = _.over([Math.max, Math.min]);
*
* func(1, 2, 3, 4);
* // => [4, 1]
*/
var over = createOver(arrayMap);
/**
* Creates a function that checks if **all** of the `predicates` return
* truthy when invoked with the arguments it receives.
*
* @static
* @memberOf _
* @since 4.0.0
* @category Util
* @param {...(Function|Function[])} [predicates=[_.identity]]
* The predicates to check.
* @returns {Function} Returns the new function.
* @example
*
* var func = _.overEvery([Boolean, isFinite]);
*
* func('1');
* // => true
*
* func(null);
* // => false
*
* func(NaN);
* // => false
*/
var overEvery = createOver(arrayEvery);
/**
* Creates a function that checks if **any** of the `predicates` return
* truthy when invoked with the arguments it receives.
*
* @static
* @memberOf _
* @since 4.0.0
* @category Util
* @param {...(Function|Function[])} [predicates=[_.identity]]
* The predicates to check.
* @returns {Function} Returns the new function.
* @example
*
* var func = _.overSome([Boolean, isFinite]);
*
* func('1');
* // => true
*
* func(null);
* // => true
*
* func(NaN);
* // => false
*/
var overSome = createOver(arraySome);
/**
* Creates a function that returns the value at `path` of a given object.
*
* @static
* @memberOf _
* @since 2.4.0
* @category Util
* @param {Array|string} path The path of the property to get.
* @returns {Function} Returns the new accessor function.
* @example
*
* var objects = [
* { 'a': { 'b': 2 } },
* { 'a': { 'b': 1 } }
* ];
*
* _.map(objects, _.property('a.b'));
* // => [2, 1]
*
* _.map(_.sortBy(objects, _.property(['a', 'b'])), 'a.b');
* // => [1, 2]
*/
function property(path) {
return isKey(path) ? baseProperty(toKey(path)) : basePropertyDeep(path);
}
/**
* The opposite of `_.property`; this method creates a function that returns
* the value at a given path of `object`.
*
* @static
* @memberOf _
* @since 3.0.0
* @category Util
* @param {Object} object The object to query.
* @returns {Function} Returns the new accessor function.
* @example
*
* var array = [0, 1, 2],
* object = { 'a': array, 'b': array, 'c': array };
*
* _.map(['a[2]', 'c[0]'], _.propertyOf(object));
* // => [2, 0]
*
* _.map([['a', '2'], ['c', '0']], _.propertyOf(object));
* // => [2, 0]
*/
function propertyOf(object) {
return function(path) {
return object == null ? undefined : baseGet(object, path);
};
}
/**
* Creates an array of numbers (positive and/or negative) progressing from
* `start` up to, but not including, `end`. A step of `-1` is used if a negative
* `start` is specified without an `end` or `step`. If `end` is not specified,
* it's set to `start` with `start` then set to `0`.
*
* **Note:** JavaScript follows the IEEE-754 standard for resolving
* floating-point values which can produce unexpected results.
*
* @static
* @since 0.1.0
* @memberOf _
* @category Util
* @param {number} [start=0] The start of the range.
* @param {number} end The end of the range.
* @param {number} [step=1] The value to increment or decrement by.
* @returns {Array} Returns the range of numbers.
* @see _.inRange, _.rangeRight
* @example
*
* _.range(4);
* // => [0, 1, 2, 3]
*
* _.range(-4);
* // => [0, -1, -2, -3]
*
* _.range(1, 5);
* // => [1, 2, 3, 4]
*
* _.range(0, 20, 5);
* // => [0, 5, 10, 15]
*
* _.range(0, -4, -1);
* // => [0, -1, -2, -3]
*
* _.range(1, 4, 0);
* // => [1, 1, 1]
*
* _.range(0);
* // => []
*/
var range = createRange();
/**
* This method is like `_.range` except that it populates values in
* descending order.
*
* @static
* @memberOf _
* @since 4.0.0
* @category Util
* @param {number} [start=0] The start of the range.
* @param {number} end The end of the range.
* @param {number} [step=1] The value to increment or decrement by.
* @returns {Array} Returns the range of numbers.
* @see _.inRange, _.range
* @example
*
* _.rangeRight(4);
* // => [3, 2, 1, 0]
*
* _.rangeRight(-4);
* // => [-3, -2, -1, 0]
*
* _.rangeRight(1, 5);
* // => [4, 3, 2, 1]
*
* _.rangeRight(0, 20, 5);
* // => [15, 10, 5, 0]
*
* _.rangeRight(0, -4, -1);
* // => [-3, -2, -1, 0]
*
* _.rangeRight(1, 4, 0);
* // => [1, 1, 1]
*
* _.rangeRight(0);
* // => []
*/
var rangeRight = createRange(true);
/**
* This method returns a new empty array.
*
* @static
* @memberOf _
* @since 4.13.0
* @category Util
* @returns {Array} Returns the new empty array.
* @example
*
* var arrays = _.times(2, _.stubArray);
*
* console.log(arrays);
* // => [[], []]
*
* console.log(arrays[0] === arrays[1]);
* // => false
*/
function stubArray() {
return [];
}
/**
* This method returns `false`.
*
* @static
* @memberOf _
* @since 4.13.0
* @category Util
* @returns {boolean} Returns `false`.
* @example
*
* _.times(2, _.stubFalse);
* // => [false, false]
*/
function stubFalse() {
return false;
}
/**
* This method returns a new empty object.
*
* @static
* @memberOf _
* @since 4.13.0
* @category Util
* @returns {Object} Returns the new empty object.
* @example
*
* var objects = _.times(2, _.stubObject);
*
* console.log(objects);
* // => [{}, {}]
*
* console.log(objects[0] === objects[1]);
* // => false
*/
function stubObject() {
return {};
}
/**
* This method returns an empty string.
*
* @static
* @memberOf _
* @since 4.13.0
* @category Util
* @returns {string} Returns the empty string.
* @example
*
* _.times(2, _.stubString);
* // => ['', '']
*/
function stubString() {
return '';
}
/**
* This method returns `true`.
*
* @static
* @memberOf _
* @since 4.13.0
* @category Util
* @returns {boolean} Returns `true`.
* @example
*
* _.times(2, _.stubTrue);
* // => [true, true]
*/
function stubTrue() {
return true;
}
/**
* Invokes the iteratee `n` times, returning an array of the results of
* each invocation. The iteratee is invoked with one argument; (index).
*
* @static
* @since 0.1.0
* @memberOf _
* @category Util
* @param {number} n The number of times to invoke `iteratee`.
* @param {Function} [iteratee=_.identity] The function invoked per iteration.
* @returns {Array} Returns the array of results.
* @example
*
* _.times(3, String);
* // => ['0', '1', '2']
*
* _.times(4, _.constant(0));
* // => [0, 0, 0, 0]
*/
function times(n, iteratee) {
n = toInteger(n);
if (n < 1 || n > MAX_SAFE_INTEGER) {
return [];
}
var index = MAX_ARRAY_LENGTH,
length = nativeMin(n, MAX_ARRAY_LENGTH);
iteratee = getIteratee(iteratee);
n -= MAX_ARRAY_LENGTH;
var result = baseTimes(length, iteratee);
while (++index < n) {
iteratee(index);
}
return result;
}
/**
* Converts `value` to a property path array.
*
* @static
* @memberOf _
* @since 4.0.0
* @category Util
* @param {*} value The value to convert.
* @returns {Array} Returns the new property path array.
* @example
*
* _.toPath('a.b.c');
* // => ['a', 'b', 'c']
*
* _.toPath('a[0].b.c');
* // => ['a', '0', 'b', 'c']
*/
function toPath(value) {
if (isArray(value)) {
return arrayMap(value, toKey);
}
return isSymbol(value) ? [value] : copyArray(stringToPath(toString(value)));
}
/**
* Generates a unique ID. If `prefix` is given, the ID is appended to it.
*
* @static
* @since 0.1.0
* @memberOf _
* @category Util
* @param {string} [prefix=''] The value to prefix the ID with.
* @returns {string} Returns the unique ID.
* @example
*
* _.uniqueId('contact_');
* // => 'contact_104'
*
* _.uniqueId();
* // => '105'
*/
function uniqueId(prefix) {
var id = ++idCounter;
return toString(prefix) + id;
}
/*------------------------------------------------------------------------*/
/**
* Adds two numbers.
*
* @static
* @memberOf _
* @since 3.4.0
* @category Math
* @param {number} augend The first number in an addition.
* @param {number} addend The second number in an addition.
* @returns {number} Returns the total.
* @example
*
* _.add(6, 4);
* // => 10
*/
var add = createMathOperation(function(augend, addend) {
return augend + addend;
}, 0);
/**
* Computes `number` rounded up to `precision`.
*
* @static
* @memberOf _
* @since 3.10.0
* @category Math
* @param {number} number The number to round up.
* @param {number} [precision=0] The precision to round up to.
* @returns {number} Returns the rounded up number.
* @example
*
* _.ceil(4.006);
* // => 5
*
* _.ceil(6.004, 2);
* // => 6.01
*
* _.ceil(6040, -2);
* // => 6100
*/
var ceil = createRound('ceil');
/**
* Divide two numbers.
*
* @static
* @memberOf _
* @since 4.7.0
* @category Math
* @param {number} dividend The first number in a division.
* @param {number} divisor The second number in a division.
* @returns {number} Returns the quotient.
* @example
*
* _.divide(6, 4);
* // => 1.5
*/
var divide = createMathOperation(function(dividend, divisor) {
return dividend / divisor;
}, 1);
/**
* Computes `number` rounded down to `precision`.
*
* @static
* @memberOf _
* @since 3.10.0
* @category Math
* @param {number} number The number to round down.
* @param {number} [precision=0] The precision to round down to.
* @returns {number} Returns the rounded down number.
* @example
*
* _.floor(4.006);
* // => 4
*
* _.floor(0.046, 2);
* // => 0.04
*
* _.floor(4060, -2);
* // => 4000
*/
var floor = createRound('floor');
/**
* Computes the maximum value of `array`. If `array` is empty or falsey,
* `undefined` is returned.
*
* @static
* @since 0.1.0
* @memberOf _
* @category Math
* @param {Array} array The array to iterate over.
* @returns {*} Returns the maximum value.
* @example
*
* _.max([4, 2, 8, 6]);
* // => 8
*
* _.max([]);
* // => undefined
*/
function max(array) {
return (array && array.length)
? baseExtremum(array, identity, baseGt)
: undefined;
}
/**
* This method is like `_.max` except that it accepts `iteratee` which is
* invoked for each element in `array` to generate the criterion by which
* the value is ranked. The iteratee is invoked with one argument: (value).
*
* @static
* @memberOf _
* @since 4.0.0
* @category Math
* @param {Array} array The array to iterate over.
* @param {Function} [iteratee=_.identity] The iteratee invoked per element.
* @returns {*} Returns the maximum value.
* @example
*
* var objects = [{ 'n': 1 }, { 'n': 2 }];
*
* _.maxBy(objects, function(o) { return o.n; });
* // => { 'n': 2 }
*
* // The `_.property` iteratee shorthand.
* _.maxBy(objects, 'n');
* // => { 'n': 2 }
*/
function maxBy(array, iteratee) {
return (array && array.length)
? baseExtremum(array, getIteratee(iteratee, 2), baseGt)
: undefined;
}
/**
* Computes the mean of the values in `array`.
*
* @static
* @memberOf _
* @since 4.0.0
* @category Math
* @param {Array} array The array to iterate over.
* @returns {number} Returns the mean.
* @example
*
* _.mean([4, 2, 8, 6]);
* // => 5
*/
function mean(array) {
return baseMean(array, identity);
}
/**
* This method is like `_.mean` except that it accepts `iteratee` which is
* invoked for each element in `array` to generate the value to be averaged.
* The iteratee is invoked with one argument: (value).
*
* @static
* @memberOf _
* @since 4.7.0
* @category Math
* @param {Array} array The array to iterate over.
* @param {Function} [iteratee=_.identity] The iteratee invoked per element.
* @returns {number} Returns the mean.
* @example
*
* var objects = [{ 'n': 4 }, { 'n': 2 }, { 'n': 8 }, { 'n': 6 }];
*
* _.meanBy(objects, function(o) { return o.n; });
* // => 5
*
* // The `_.property` iteratee shorthand.
* _.meanBy(objects, 'n');
* // => 5
*/
function meanBy(array, iteratee) {
return baseMean(array, getIteratee(iteratee, 2));
}
/**
* Computes the minimum value of `array`. If `array` is empty or falsey,
* `undefined` is returned.
*
* @static
* @since 0.1.0
* @memberOf _
* @category Math
* @param {Array} array The array to iterate over.
* @returns {*} Returns the minimum value.
* @example
*
* _.min([4, 2, 8, 6]);
* // => 2
*
* _.min([]);
* // => undefined
*/
function min(array) {
return (array && array.length)
? baseExtremum(array, identity, baseLt)
: undefined;
}
/**
* This method is like `_.min` except that it accepts `iteratee` which is
* invoked for each element in `array` to generate the criterion by which
* the value is ranked. The iteratee is invoked with one argument: (value).
*
* @static
* @memberOf _
* @since 4.0.0
* @category Math
* @param {Array} array The array to iterate over.
* @param {Function} [iteratee=_.identity] The iteratee invoked per element.
* @returns {*} Returns the minimum value.
* @example
*
* var objects = [{ 'n': 1 }, { 'n': 2 }];
*
* _.minBy(objects, function(o) { return o.n; });
* // => { 'n': 1 }
*
* // The `_.property` iteratee shorthand.
* _.minBy(objects, 'n');
* // => { 'n': 1 }
*/
function minBy(array, iteratee) {
return (array && array.length)
? baseExtremum(array, getIteratee(iteratee, 2), baseLt)
: undefined;
}
/**
* Multiply two numbers.
*
* @static
* @memberOf _
* @since 4.7.0
* @category Math
* @param {number} multiplier The first number in a multiplication.
* @param {number} multiplicand The second number in a multiplication.
* @returns {number} Returns the product.
* @example
*
* _.multiply(6, 4);
* // => 24
*/
var multiply = createMathOperation(function(multiplier, multiplicand) {
return multiplier * multiplicand;
}, 1);
/**
* Computes `number` rounded to `precision`.
*
* @static
* @memberOf _
* @since 3.10.0
* @category Math
* @param {number} number The number to round.
* @param {number} [precision=0] The precision to round to.
* @returns {number} Returns the rounded number.
* @example
*
* _.round(4.006);
* // => 4
*
* _.round(4.006, 2);
* // => 4.01
*
* _.round(4060, -2);
* // => 4100
*/
var round = createRound('round');
/**
* Subtract two numbers.
*
* @static
* @memberOf _
* @since 4.0.0
* @category Math
* @param {number} minuend The first number in a subtraction.
* @param {number} subtrahend The second number in a subtraction.
* @returns {number} Returns the difference.
* @example
*
* _.subtract(6, 4);
* // => 2
*/
var subtract = createMathOperation(function(minuend, subtrahend) {
return minuend - subtrahend;
}, 0);
/**
* Computes the sum of the values in `array`.
*
* @static
* @memberOf _
* @since 3.4.0
* @category Math
* @param {Array} array The array to iterate over.
* @returns {number} Returns the sum.
* @example
*
* _.sum([4, 2, 8, 6]);
* // => 20
*/
function sum(array) {
return (array && array.length)
? baseSum(array, identity)
: 0;
}
/**
* This method is like `_.sum` except that it accepts `iteratee` which is
* invoked for each element in `array` to generate the value to be summed.
* The iteratee is invoked with one argument: (value).
*
* @static
* @memberOf _
* @since 4.0.0
* @category Math
* @param {Array} array The array to iterate over.
* @param {Function} [iteratee=_.identity] The iteratee invoked per element.
* @returns {number} Returns the sum.
* @example
*
* var objects = [{ 'n': 4 }, { 'n': 2 }, { 'n': 8 }, { 'n': 6 }];
*
* _.sumBy(objects, function(o) { return o.n; });
* // => 20
*
* // The `_.property` iteratee shorthand.
* _.sumBy(objects, 'n');
* // => 20
*/
function sumBy(array, iteratee) {
return (array && array.length)
? baseSum(array, getIteratee(iteratee, 2))
: 0;
}
/*------------------------------------------------------------------------*/
// Add methods that return wrapped values in chain sequences.
lodash.after = after;
lodash.ary = ary;
lodash.assign = assign;
lodash.assignIn = assignIn;
lodash.assignInWith = assignInWith;
lodash.assignWith = assignWith;
lodash.at = at;
lodash.before = before;
lodash.bind = bind;
lodash.bindAll = bindAll;
lodash.bindKey = bindKey;
lodash.castArray = castArray;
lodash.chain = chain;
lodash.chunk = chunk;
lodash.compact = compact;
lodash.concat = concat;
lodash.cond = cond;
lodash.conforms = conforms;
lodash.constant = constant;
lodash.countBy = countBy;
lodash.create = create;
lodash.curry = curry;
lodash.curryRight = curryRight;
lodash.debounce = debounce;
lodash.defaults = defaults;
lodash.defaultsDeep = defaultsDeep;
lodash.defer = defer;
lodash.delay = delay;
lodash.difference = difference;
lodash.differenceBy = differenceBy;
lodash.differenceWith = differenceWith;
lodash.drop = drop;
lodash.dropRight = dropRight;
lodash.dropRightWhile = dropRightWhile;
lodash.dropWhile = dropWhile;
lodash.fill = fill;
lodash.filter = filter;
lodash.flatMap = flatMap;
lodash.flatMapDeep = flatMapDeep;
lodash.flatMapDepth = flatMapDepth;
lodash.flatten = flatten;
lodash.flattenDeep = flattenDeep;
lodash.flattenDepth = flattenDepth;
lodash.flip = flip;
lodash.flow = flow;
lodash.flowRight = flowRight;
lodash.fromPairs = fromPairs;
lodash.functions = functions;
lodash.functionsIn = functionsIn;
lodash.groupBy = groupBy;
lodash.initial = initial;
lodash.intersection = intersection;
lodash.intersectionBy = intersectionBy;
lodash.intersectionWith = intersectionWith;
lodash.invert = invert;
lodash.invertBy = invertBy;
lodash.invokeMap = invokeMap;
lodash.iteratee = iteratee;
lodash.keyBy = keyBy;
lodash.keys = keys;
lodash.keysIn = keysIn;
lodash.map = map;
lodash.mapKeys = mapKeys;
lodash.mapValues = mapValues;
lodash.matches = matches;
lodash.matchesProperty = matchesProperty;
lodash.memoize = memoize;
lodash.merge = merge;
lodash.mergeWith = mergeWith;
lodash.method = method;
lodash.methodOf = methodOf;
lodash.mixin = mixin;
lodash.negate = negate;
lodash.nthArg = nthArg;
lodash.omit = omit;
lodash.omitBy = omitBy;
lodash.once = once;
lodash.orderBy = orderBy;
lodash.over = over;
lodash.overArgs = overArgs;
lodash.overEvery = overEvery;
lodash.overSome = overSome;
lodash.partial = partial;
lodash.partialRight = partialRight;
lodash.partition = partition;
lodash.pick = pick;
lodash.pickBy = pickBy;
lodash.property = property;
lodash.propertyOf = propertyOf;
lodash.pull = pull;
lodash.pullAll = pullAll;
lodash.pullAllBy = pullAllBy;
lodash.pullAllWith = pullAllWith;
lodash.pullAt = pullAt;
lodash.range = range;
lodash.rangeRight = rangeRight;
lodash.rearg = rearg;
lodash.reject = reject;
lodash.remove = remove;
lodash.rest = rest;
lodash.reverse = reverse;
lodash.sampleSize = sampleSize;
lodash.set = set;
lodash.setWith = setWith;
lodash.shuffle = shuffle;
lodash.slice = slice;
lodash.sortBy = sortBy;
lodash.sortedUniq = sortedUniq;
lodash.sortedUniqBy = sortedUniqBy;
lodash.split = split;
lodash.spread = spread;
lodash.tail = tail;
lodash.take = take;
lodash.takeRight = takeRight;
lodash.takeRightWhile = takeRightWhile;
lodash.takeWhile = takeWhile;
lodash.tap = tap;
lodash.throttle = throttle;
lodash.thru = thru;
lodash.toArray = toArray;
lodash.toPairs = toPairs;
lodash.toPairsIn = toPairsIn;
lodash.toPath = toPath;
lodash.toPlainObject = toPlainObject;
lodash.transform = transform;
lodash.unary = unary;
lodash.union = union;
lodash.unionBy = unionBy;
lodash.unionWith = unionWith;
lodash.uniq = uniq;
lodash.uniqBy = uniqBy;
lodash.uniqWith = uniqWith;
lodash.unset = unset;
lodash.unzip = unzip;
lodash.unzipWith = unzipWith;
lodash.update = update;
lodash.updateWith = updateWith;
lodash.values = values;
lodash.valuesIn = valuesIn;
lodash.without = without;
lodash.words = words;
lodash.wrap = wrap;
lodash.xor = xor;
lodash.xorBy = xorBy;
lodash.xorWith = xorWith;
lodash.zip = zip;
lodash.zipObject = zipObject;
lodash.zipObjectDeep = zipObjectDeep;
lodash.zipWith = zipWith;
// Add aliases.
lodash.entries = toPairs;
lodash.entriesIn = toPairsIn;
lodash.extend = assignIn;
lodash.extendWith = assignInWith;
// Add methods to `lodash.prototype`.
mixin(lodash, lodash);
/*------------------------------------------------------------------------*/
// Add methods that return unwrapped values in chain sequences.
lodash.add = add;
lodash.attempt = attempt;
lodash.camelCase = camelCase;
lodash.capitalize = capitalize;
lodash.ceil = ceil;
lodash.clamp = clamp;
lodash.clone = clone;
lodash.cloneDeep = cloneDeep;
lodash.cloneDeepWith = cloneDeepWith;
lodash.cloneWith = cloneWith;
lodash.conformsTo = conformsTo;
lodash.deburr = deburr;
lodash.defaultTo = defaultTo;
lodash.divide = divide;
lodash.endsWith = endsWith;
lodash.eq = eq;
lodash.escape = escape;
lodash.escapeRegExp = escapeRegExp;
lodash.every = every;
lodash.find = find;
lodash.findIndex = findIndex;
lodash.findKey = findKey;
lodash.findLast = findLast;
lodash.findLastIndex = findLastIndex;
lodash.findLastKey = findLastKey;
lodash.floor = floor;
lodash.forEach = forEach;
lodash.forEachRight = forEachRight;
lodash.forIn = forIn;
lodash.forInRight = forInRight;
lodash.forOwn = forOwn;
lodash.forOwnRight = forOwnRight;
lodash.get = get;
lodash.gt = gt;
lodash.gte = gte;
lodash.has = has;
lodash.hasIn = hasIn;
lodash.head = head;
lodash.identity = identity;
lodash.includes = includes;
lodash.indexOf = indexOf;
lodash.inRange = inRange;
lodash.invoke = invoke;
lodash.isArguments = isArguments;
lodash.isArray = isArray;
lodash.isArrayBuffer = isArrayBuffer;
lodash.isArrayLike = isArrayLike;
lodash.isArrayLikeObject = isArrayLikeObject;
lodash.isBoolean = isBoolean;
lodash.isBuffer = isBuffer;
lodash.isDate = isDate;
lodash.isElement = isElement;
lodash.isEmpty = isEmpty;
lodash.isEqual = isEqual;
lodash.isEqualWith = isEqualWith;
lodash.isError = isError;
lodash.isFinite = isFinite;
lodash.isFunction = isFunction;
lodash.isInteger = isInteger;
lodash.isLength = isLength;
lodash.isMap = isMap;
lodash.isMatch = isMatch;
lodash.isMatchWith = isMatchWith;
lodash.isNaN = isNaN;
lodash.isNative = isNative;
lodash.isNil = isNil;
lodash.isNull = isNull;
lodash.isNumber = isNumber;
lodash.isObject = isObject;
lodash.isObjectLike = isObjectLike;
lodash.isPlainObject = isPlainObject;
lodash.isRegExp = isRegExp;
lodash.isSafeInteger = isSafeInteger;
lodash.isSet = isSet;
lodash.isString = isString;
lodash.isSymbol = isSymbol;
lodash.isTypedArray = isTypedArray;
lodash.isUndefined = isUndefined;
lodash.isWeakMap = isWeakMap;
lodash.isWeakSet = isWeakSet;
lodash.join = join;
lodash.kebabCase = kebabCase;
lodash.last = last;
lodash.lastIndexOf = lastIndexOf;
lodash.lowerCase = lowerCase;
lodash.lowerFirst = lowerFirst;
lodash.lt = lt;
lodash.lte = lte;
lodash.max = max;
lodash.maxBy = maxBy;
lodash.mean = mean;
lodash.meanBy = meanBy;
lodash.min = min;
lodash.minBy = minBy;
lodash.stubArray = stubArray;
lodash.stubFalse = stubFalse;
lodash.stubObject = stubObject;
lodash.stubString = stubString;
lodash.stubTrue = stubTrue;
lodash.multiply = multiply;
lodash.nth = nth;
lodash.noConflict = noConflict;
lodash.noop = noop;
lodash.now = now;
lodash.pad = pad;
lodash.padEnd = padEnd;
lodash.padStart = padStart;
lodash.parseInt = parseInt;
lodash.random = random;
lodash.reduce = reduce;
lodash.reduceRight = reduceRight;
lodash.repeat = repeat;
lodash.replace = replace;
lodash.result = result;
lodash.round = round;
lodash.runInContext = runInContext;
lodash.sample = sample;
lodash.size = size;
lodash.snakeCase = snakeCase;
lodash.some = some;
lodash.sortedIndex = sortedIndex;
lodash.sortedIndexBy = sortedIndexBy;
lodash.sortedIndexOf = sortedIndexOf;
lodash.sortedLastIndex = sortedLastIndex;
lodash.sortedLastIndexBy = sortedLastIndexBy;
lodash.sortedLastIndexOf = sortedLastIndexOf;
lodash.startCase = startCase;
lodash.startsWith = startsWith;
lodash.subtract = subtract;
lodash.sum = sum;
lodash.sumBy = sumBy;
lodash.template = template;
lodash.times = times;
lodash.toFinite = toFinite;
lodash.toInteger = toInteger;
lodash.toLength = toLength;
lodash.toLower = toLower;
lodash.toNumber = toNumber;
lodash.toSafeInteger = toSafeInteger;
lodash.toString = toString;
lodash.toUpper = toUpper;
lodash.trim = trim;
lodash.trimEnd = trimEnd;
lodash.trimStart = trimStart;
lodash.truncate = truncate;
lodash.unescape = unescape;
lodash.uniqueId = uniqueId;
lodash.upperCase = upperCase;
lodash.upperFirst = upperFirst;
// Add aliases.
lodash.each = forEach;
lodash.eachRight = forEachRight;
lodash.first = head;
mixin(lodash, (function() {
var source = {};
baseForOwn(lodash, function(func, methodName) {
if (!hasOwnProperty.call(lodash.prototype, methodName)) {
source[methodName] = func;
}
});
return source;
}()), { 'chain': false });
/*------------------------------------------------------------------------*/
/**
* The semantic version number.
*
* @static
* @memberOf _
* @type {string}
*/
lodash.VERSION = VERSION;
// Assign default placeholders.
arrayEach(['bind', 'bindKey', 'curry', 'curryRight', 'partial', 'partialRight'], function(methodName) {
lodash[methodName].placeholder = lodash;
});
// Add `LazyWrapper` methods for `_.drop` and `_.take` variants.
arrayEach(['drop', 'take'], function(methodName, index) {
LazyWrapper.prototype[methodName] = function(n) {
n = n === undefined ? 1 : nativeMax(toInteger(n), 0);
var result = (this.__filtered__ && !index)
? new LazyWrapper(this)
: this.clone();
if (result.__filtered__) {
result.__takeCount__ = nativeMin(n, result.__takeCount__);
} else {
result.__views__.push({
'size': nativeMin(n, MAX_ARRAY_LENGTH),
'type': methodName + (result.__dir__ < 0 ? 'Right' : '')
});
}
return result;
};
LazyWrapper.prototype[methodName + 'Right'] = function(n) {
return this.reverse()[methodName](n).reverse();
};
});
// Add `LazyWrapper` methods that accept an `iteratee` value.
arrayEach(['filter', 'map', 'takeWhile'], function(methodName, index) {
var type = index + 1,
isFilter = type == LAZY_FILTER_FLAG || type == LAZY_WHILE_FLAG;
LazyWrapper.prototype[methodName] = function(iteratee) {
var result = this.clone();
result.__iteratees__.push({
'iteratee': getIteratee(iteratee, 3),
'type': type
});
result.__filtered__ = result.__filtered__ || isFilter;
return result;
};
});
// Add `LazyWrapper` methods for `_.head` and `_.last`.
arrayEach(['head', 'last'], function(methodName, index) {
var takeName = 'take' + (index ? 'Right' : '');
LazyWrapper.prototype[methodName] = function() {
return this[takeName](1).value()[0];
};
});
// Add `LazyWrapper` methods for `_.initial` and `_.tail`.
arrayEach(['initial', 'tail'], function(methodName, index) {
var dropName = 'drop' + (index ? '' : 'Right');
LazyWrapper.prototype[methodName] = function() {
return this.__filtered__ ? new LazyWrapper(this) : this[dropName](1);
};
});
LazyWrapper.prototype.compact = function() {
return this.filter(identity);
};
LazyWrapper.prototype.find = function(predicate) {
return this.filter(predicate).head();
};
LazyWrapper.prototype.findLast = function(predicate) {
return this.reverse().find(predicate);
};
LazyWrapper.prototype.invokeMap = baseRest(function(path, args) {
if (typeof path == 'function') {
return new LazyWrapper(this);
}
return this.map(function(value) {
return baseInvoke(value, path, args);
});
});
LazyWrapper.prototype.reject = function(predicate) {
return this.filter(negate(getIteratee(predicate)));
};
LazyWrapper.prototype.slice = function(start, end) {
start = toInteger(start);
var result = this;
if (result.__filtered__ && (start > 0 || end < 0)) {
return new LazyWrapper(result);
}
if (start < 0) {
result = result.takeRight(-start);
} else if (start) {
result = result.drop(start);
}
if (end !== undefined) {
end = toInteger(end);
result = end < 0 ? result.dropRight(-end) : result.take(end - start);
}
return result;
};
LazyWrapper.prototype.takeRightWhile = function(predicate) {
return this.reverse().takeWhile(predicate).reverse();
};
LazyWrapper.prototype.toArray = function() {
return this.take(MAX_ARRAY_LENGTH);
};
// Add `LazyWrapper` methods to `lodash.prototype`.
baseForOwn(LazyWrapper.prototype, function(func, methodName) {
var checkIteratee = /^(?:filter|find|map|reject)|While$/.test(methodName),
isTaker = /^(?:head|last)$/.test(methodName),
lodashFunc = lodash[isTaker ? ('take' + (methodName == 'last' ? 'Right' : '')) : methodName],
retUnwrapped = isTaker || /^find/.test(methodName);
if (!lodashFunc) {
return;
}
lodash.prototype[methodName] = function() {
var value = this.__wrapped__,
args = isTaker ? [1] : arguments,
isLazy = value instanceof LazyWrapper,
iteratee = args[0],
useLazy = isLazy || isArray(value);
var interceptor = function(value) {
var result = lodashFunc.apply(lodash, arrayPush([value], args));
return (isTaker && chainAll) ? result[0] : result;
};
if (useLazy && checkIteratee && typeof iteratee == 'function' && iteratee.length != 1) {
// Avoid lazy use if the iteratee has a "length" value other than `1`.
isLazy = useLazy = false;
}
var chainAll = this.__chain__,
isHybrid = !!this.__actions__.length,
isUnwrapped = retUnwrapped && !chainAll,
onlyLazy = isLazy && !isHybrid;
if (!retUnwrapped && useLazy) {
value = onlyLazy ? value : new LazyWrapper(this);
var result = func.apply(value, args);
result.__actions__.push({ 'func': thru, 'args': [interceptor], 'thisArg': undefined });
return new LodashWrapper(result, chainAll);
}
if (isUnwrapped && onlyLazy) {
return func.apply(this, args);
}
result = this.thru(interceptor);
return isUnwrapped ? (isTaker ? result.value()[0] : result.value()) : result;
};
});
// Add `Array` methods to `lodash.prototype`.
arrayEach(['pop', 'push', 'shift', 'sort', 'splice', 'unshift'], function(methodName) {
var func = arrayProto[methodName],
chainName = /^(?:push|sort|unshift)$/.test(methodName) ? 'tap' : 'thru',
retUnwrapped = /^(?:pop|shift)$/.test(methodName);
lodash.prototype[methodName] = function() {
var args = arguments;
if (retUnwrapped && !this.__chain__) {
var value = this.value();
return func.apply(isArray(value) ? value : [], args);
}
return this[chainName](function(value) {
return func.apply(isArray(value) ? value : [], args);
});
};
});
// Map minified method names to their real names.
baseForOwn(LazyWrapper.prototype, function(func, methodName) {
var lodashFunc = lodash[methodName];
if (lodashFunc) {
var key = (lodashFunc.name + ''),
names = realNames[key] || (realNames[key] = []);
names.push({ 'name': methodName, 'func': lodashFunc });
}
});
realNames[createHybrid(undefined, WRAP_BIND_KEY_FLAG).name] = [{
'name': 'wrapper',
'func': undefined
}];
// Add methods to `LazyWrapper`.
LazyWrapper.prototype.clone = lazyClone;
LazyWrapper.prototype.reverse = lazyReverse;
LazyWrapper.prototype.value = lazyValue;
// Add chain sequence methods to the `lodash` wrapper.
lodash.prototype.at = wrapperAt;
lodash.prototype.chain = wrapperChain;
lodash.prototype.commit = wrapperCommit;
lodash.prototype.next = wrapperNext;
lodash.prototype.plant = wrapperPlant;
lodash.prototype.reverse = wrapperReverse;
lodash.prototype.toJSON = lodash.prototype.valueOf = lodash.prototype.value = wrapperValue;
// Add lazy aliases.
lodash.prototype.first = lodash.prototype.head;
if (symIterator) {
lodash.prototype[symIterator] = wrapperToIterator;
}
return lodash;
});
/*--------------------------------------------------------------------------*/
// Export lodash.
var _ = runInContext();
// Some AMD build optimizers, like r.js, check for condition patterns like:
if (true) {
// Expose Lodash on the global object to prevent errors when Lodash is
// loaded by a script tag in the presence of an AMD loader.
// See http://requirejs.org/docs/errors.html#mismatch for more details.
// Use `_.noConflict` to remove Lodash from the global object.
root._ = _;
// Define as an anonymous module so, through path mapping, it can be
// referenced as the "underscore" module.
!(__WEBPACK_AMD_DEFINE_RESULT__ = function() {
return _;
}.call(exports, __webpack_require__, exports, module),
__WEBPACK_AMD_DEFINE_RESULT__ !== undefined && (module.exports = __WEBPACK_AMD_DEFINE_RESULT__));
}
// Check for `exports` after `define` in case a build optimizer adds it.
else if (freeModule) {
// Export for Node.js.
(freeModule.exports = _)._ = _;
// Export for CommonJS support.
freeExports._ = _;
}
else {
// Export to the global object.
root._ = _;
}
}.call(this));
/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(34), __webpack_require__(35)(module)))
/***/ }),
/* 34 */
/***/ (function(module, exports) {
var g;
// This works in non-strict mode
g = (function() {
return this;
})();
try {
// This works if eval is allowed (see CSP)
g = g || Function("return this")() || (1,eval)("this");
} catch(e) {
// This works if the window reference is available
if(typeof window === "object")
g = window;
}
// g can still be undefined, but nothing to do about it...
// We return undefined, instead of nothing here, so it's
// easier to handle this case. if(!global) { ...}
module.exports = g;
/***/ }),
/* 35 */
/***/ (function(module, exports) {
module.exports = function(module) {
if(!module.webpackPolyfill) {
module.deprecate = function() {};
module.paths = [];
// module.parent = undefined by default
if(!module.children) module.children = [];
Object.defineProperty(module, "loaded", {
enumerable: true,
get: function() {
return module.l;
}
});
Object.defineProperty(module, "id", {
enumerable: true,
get: function() {
return module.i;
}
});
module.webpackPolyfill = 1;
}
return module;
};
/***/ }),
/* 36 */
/***/ (function(module, exports, __webpack_require__) {
__webpack_require__(9);
module.exports = __webpack_require__(10);
/***/ })
/******/ ]); | mit |
apo-j/Projects_Working | Bivi/src/Bivi.FrontOffice/Bivi.FrontOffice.Web.ViewModels/Helpers/ArticleHelper.cs | 1358 | using System;
using System.Linq;
using System.Collections.Generic;
using System.Threading;
using System.Web.Mvc;
using System.Web.Routing;
using Bivi.Data.Context;
using Bivi.Domaine;
using Bivi.Infrastructure.Constant;
using Bivi.Infrastructure.Extensions;
using AutoMapper;
using System.Text;
using System.Text.RegularExpressions;
namespace Bivi.FrontOffice.Web.ViewModels.Helpers
{
public class ArticleHelper
{
public static string GetPrestationAdresse1(ArticleListeResult result)
{
var adresse = string.Empty;
adresse += string.IsNullOrEmpty(result.LigneAdresse1) ? string.Empty : result.LigneAdresse1 + " ";
adresse += string.IsNullOrEmpty(result.LigneAdresse2) ? string.Empty : result.LigneAdresse2 + " ";
adresse += string.IsNullOrEmpty(result.LigneAdresse3) ? string.Empty : result.LigneAdresse3 + " ";
return adresse.Trim();
}
public static string GetPrestationAdresse2(ArticleListeResult result)
{
var adresse = string.Empty;
adresse += string.IsNullOrEmpty(result.CodePostal) ? string.Empty : result.CodePostal + " ";
adresse += string.IsNullOrEmpty(result.Ville) ? string.Empty : result.Ville + " ";
return adresse.Trim();
}
}
}
| mit |
ekonor/hokeyapp | net47/HockeyApp/HockeyApp.Contracts/Dto/Arenas/ArenaViewItemDto.cs | 483 | using HockeyApp.Contracts.Dto.Geo;
namespace HockeyApp.Contracts.Dto.Arenas
{
public sealed class ArenaViewItemDto : ArenaItemDtoBase
{
public string FullName { get; set; }
public string Contacts { get; set; }
public CoordinatesDto Coordinates { get; set; }
public string About { get; set; }
public short? StartYear { get; set; }
public CityDto City { get; set; }
public byte? ArenaTypeId { get; set; }
}
}
| mit |
uhray/gets | index.js | 863 | ;(function() {
var root = this;
function gets() {
var args = Array.prototype.slice.call(arguments, 0),
f = function(d) {
args.forEach(function(x) { d = d && d[x]; });
return d;
};
function m(f) {
f.or = function(x) { return m(function(d) { return f(d) || x; }); };
f.map = function(fn) { return m(function(d) { return fn(f(d)); }); };
return f;
}
return m(f);
}
// ======================================================================== //
if (typeof exports !== 'undefined') { // nodejs
if (typeof module !== 'undefined' && module.exports) {
exports = module.exports = gets;
}
exports.gets = gets
} else if (typeof define !== 'undefined') { // requirejs
define([], function() { return gets; });
} else { // global
root.gets = gets;
}
}());
| mit |
zachdimitrov/Homework | CSharp-Part-2/01.Arrays/15.PrimeNumbers/Properties/AssemblyInfo.cs | 1406 | using System.Reflection;
using System.Runtime.CompilerServices;
using System.Runtime.InteropServices;
// General Information about an assembly is controlled through the following
// set of attributes. Change these attribute values to modify the information
// associated with an assembly.
[assembly: AssemblyTitle("15.PrimeNumbers")]
[assembly: AssemblyDescription("")]
[assembly: AssemblyConfiguration("")]
[assembly: AssemblyCompany("")]
[assembly: AssemblyProduct("15.PrimeNumbers")]
[assembly: AssemblyCopyright("Copyright © 2016")]
[assembly: AssemblyTrademark("")]
[assembly: AssemblyCulture("")]
// Setting ComVisible to false makes the types in this assembly not visible
// to COM components. If you need to access a type in this assembly from
// COM, set the ComVisible attribute to true on that type.
[assembly: ComVisible(false)]
// The following GUID is for the ID of the typelib if this project is exposed to COM
[assembly: Guid("d6777afa-85d8-48b5-83ab-7fc64a0177ec")]
// Version information for an assembly consists of the following four values:
//
// Major Version
// Minor Version
// Build Number
// Revision
//
// You can specify all the values or you can default the Build and Revision Numbers
// by using the '*' as shown below:
// [assembly: AssemblyVersion("1.0.*")]
[assembly: AssemblyVersion("1.0.0.0")]
[assembly: AssemblyFileVersion("1.0.0.0")]
| mit |
chyno/chynosurf | src/services/http.js | 1949 | // A-> $http function is implemented in order to follow the standard Adapter pattern
var $http = function(url){
// A small example of object
var core = {
// Method that performs the ajax request
ajax : function(method, url, args){
// Establishing a promise in return
return new Promise(function(resolve, reject) {
// Instantiates the XMLHttpRequest
var client = new XMLHttpRequest();
var uri = '';
if((args != undefined) && (method == 'POST' || method == 'PUT')) {
for (key in args) {
uri += encodeURIComponent(key) + '=' + encodeURIComponent(escape(args[key])) + '&';
}
client.open(method, url + '?' + uri, true);
} else {
client.open(method, url, true);
}
client.setRequestHeader("Content-type", "application/x-www-form-urlencoded");
client.setRequestHeader("Cache-Control", "no-cache");
client.onreadystatechange = function(){
if(this.readyState == 4){
if(this.status == 200){
// Performs the function "resolve" the case this.status is equal to 200
resolve(JSON.parse(this.response));
} else{
// Performs the function "reject" the case is different this.status 200
reject({"error":this.statusText});
}
}
};
client.send(uri);
});
}
};
// Adapter pattern
return {
'get' : function(args) {
return core.ajax('GET', url, args);
},
'post' : function(args) {
return core.ajax('POST', url, args);
},
'put' : function(args) {
return core.ajax('PUT', url, args);
},
'delete' : function(args) {
return core.ajax('DELETE', url, args);
}
};
};
// End A | mit |
max-barry/generator-jumpstart-static | generators/gulp/templates/gulp/fonts.js | 367 | // Load general packages
var gulp = require('gulp'),
pkg = require('../package.json'),
path = require('path');
// Fonts variables
var src = path.join(pkg.src.fonts, '**/*.{eot,woff,woff2,svg,ttf}');
var dest = pkg.build.fonts;
// Copy font files to dest directory
gulp.task('fonts', function() {
return gulp.src(src)
.pipe(gulp.dest(dest));
});
| mit |
knordman/getflags | index.d.ts | 973 | // Type definitions for getflags 1.3.0
// Project: getflags
// Definitions by: Kristian Nordman knordman.github@cxz.fi
export = getflags;
declare function getflags(args: string[], configuration: getflags.Configuration): getflags.Flags;
declare namespace getflags {
interface ConfigurationEntry {
/** Short flag alternative */
short?: string;
/** Long flag alternative */
long: string;
/** Whether flag requires a value */
withValue?: boolean;
/** When same flag is given multiple times, each value is pushed to an array, otherwise the last given value will set the flag value */
collectInArray?: boolean;
/** Whether flag is required */
required?: boolean;
/** Default value given the flag when not specified */
default?: string;
}
export type Configuration = ConfigurationEntry[];
export interface Flags {
[flag: string]: string | boolean;
}
}
| mit |
JosefFriedrich-nodejs/baldr | src/mgmt/cli/dist/node/commands/downloader/action.js | 1788 | "use strict";
var __awaiter = (this && this.__awaiter) || function (thisArg, _arguments, P, generator) {
function adopt(value) { return value instanceof P ? value : new P(function (resolve) { resolve(value); }); }
return new (P || (P = Promise))(function (resolve, reject) {
function fulfilled(value) { try { step(generator.next(value)); } catch (e) { reject(e); } }
function rejected(value) { try { step(generator["throw"](value)); } catch (e) { reject(e); } }
function step(result) { result.done ? resolve(result.value) : adopt(result.value).then(fulfilled, rejected); }
step((generator = generator.apply(thisArg, _arguments || [])).next());
});
};
const media_manager_1 = require("@bldr/media-manager");
const core_node_1 = require("@bldr/core-node");
/**
* Download a media asset.
*
* @param url - The source URL.
* @param id - The ID of the destination file.
* @param extension - The extension of the destination file.
*/
function action(url, id, extension) {
return __awaiter(this, void 0, void 0, function* () {
if (extension == null) {
extension = url.substring(url.lastIndexOf('.') + 1);
}
if (id == null) {
id = url.substring(url.lastIndexOf('/') + 1);
id = id.replace(/\.\w+$/, '');
}
const destFile = `${id}.${extension}`;
yield core_node_1.fetchFile(url, destFile);
// Make images smaller.
const convertedDestFile = yield media_manager_1.operations.convertAsset(destFile);
if (convertedDestFile != null) {
const metaData = { source: url };
const meta = metaData;
yield media_manager_1.operations.initializeMetaYaml(destFile, meta);
}
});
}
module.exports = action;
| mit |
viejalospelos/proyectoCupon | src/Cupon/BackendBundle/Form/CiudadType.php | 897 | <?php
namespace Cupon\BackendBundle\Form;
use Symfony\Component\Form\AbstractType;
use Symfony\Component\Form\FormBuilderInterface;
use Symfony\Component\OptionsResolver\OptionsResolverInterface;
class CiudadType extends AbstractType
{
/**
* @param FormBuilderInterface $builder
* @param array $options
*/
public function buildForm(FormBuilderInterface $builder, array $options)
{
$builder
->add('nombre')
//->add('slug')
;
}
/**
* @param OptionsResolverInterface $resolver
*/
public function setDefaultOptions(OptionsResolverInterface $resolver)
{
$resolver->setDefaults(array(
'data_class' => 'Cupon\CiudadBundle\Entity\Ciudad'
));
}
/**
* @return string
*/
public function getName()
{
return 'cupon_backendbundle_ciudad';
}
}
| mit |
manuSrep/fast_science | scr/generic/input_output/reader.cpp | 3034 | //
// reader.cpp
// fast_science
//
//
// Created by Manuel on 12.06.15.
//
//
#include "reader.h"
template <class T>
fs::Reader<T>::Reader(std::string const & file, std::string const & path) {
_suffix = new std::string;
_file = new std::string;
_path = new std::string;
std::string tmp_str = file;
// look for the suffix in the filename
std::size_t found = tmp_str.find_last_of('.');
if (found != std::string::npos) {
*_suffix = tmp_str.substr(found);
*_file = tmp_str.substr(0, found);
} else {
*_file = file;
}
// make sure the file does not start with a '/'
if (_file->front() == '/') {
*_file = _file->substr(1);
}
*_path = path;
// make sure the path ends with a '/'
if (! path.empty()) {
if (_path->back() != '/') {
_path->push_back('/');
}
}
_comment = new std::vector<std::string> {"#", "//" ,"/*", "%"};
}
template <class T>
fs::Reader<T>::Reader(std::string const & fileWithPath) {
_suffix = new std::string;
_file = new std::string;
_path = new std::string;
std::string tmp_str = fileWithPath;
// first set the path correctly
std::size_t found = tmp_str.find_last_of("/");
if (found != std::string::npos) {
*_path = tmp_str.substr(0,found);
if (_path->back() != '/') {
_path->push_back('/');
}
} else {
*_path = "";
}
// now set the suffix and filename
if (found != std::string::npos) {
tmp_str = tmp_str.substr(found);
}
// look for the suffix in the filename
found = tmp_str.find_last_of('.');
if (found != std::string::npos) {
*_suffix = tmp_str.substr(found);
*_file = tmp_str.substr(0, found);
} else {
*_file = tmp_str;
*_suffix = "";
}
// make sure the file does not start with a '/'
if (_file->front() == '/') {
*_file = _file->substr(1);
}
_comment = new std::vector<std::string> {"#", "//" ,"/*", "%"};
}
template <class T>
fs::Reader<T>::~Reader() {
delete _suffix;
_suffix = nullptr;
delete _file;
_file = nullptr;
delete _path;
_path = nullptr;
delete _comment;
_comment = nullptr;
}
template <class T>
std::string const & fs::Reader<T>::path() const {
return *this->_path;
}
template <class T>
std::string const & fs::Reader<T>::file() const {
return *this->_file;
}
template <class T>
std::string const & fs::Reader<T>::suffix() const {
return *this->_suffix;
}
// instantiate those types which can be used
template class fs::Reader<fs::CsvFormat<unsigned short>>;
template class fs::Reader<fs::CsvFormat<short>>;
template class fs::Reader<fs::CsvFormat<unsigned int>>;
template class fs::Reader<fs::CsvFormat<int>>;
template class fs::Reader<fs::CsvFormat<unsigned long>>;
template class fs::Reader<fs::CsvFormat<long>>;
template class fs::Reader<fs::CsvFormat<float>>;
template class fs::Reader<fs::CsvFormat<double>>;
template class fs::Reader<fs::CsvFormat<std::string>>;
template class fs::Reader<fs::GffFormat>;
template class fs::Reader<fs::BedgraphFormat>;
| mit |
saroad2/units | units_java/src/unitsLib/java/com/units/frequency/Megahertz.java | 1576 | /* This file is auto generated.
* DO NOT EDIT IT MANUALLY!
*/
package com.units.frequency;
import com.units.internal.Multipliers;
public class Megahertz extends Frequency {
public static final double _scale =
Multipliers.mega * Hertz._scale;
public Megahertz(double value) {
super(value);
}
@Override
public String pluralName() {
return "megahertz";
}
@Override
public double scale() {
return _scale;
}
public static Megahertz zero() {
return new Megahertz(0);
}
public static Megahertz one() {
return new Megahertz(1);
}
public Megahertz plus(Megahertz other) {
return new Megahertz(value() + other.value());
}
public Megahertz minus(Megahertz other) {
return new Megahertz(value() - other.value());
}
public Megahertz opposite() {
return new Megahertz(-value());
}
public Megahertz multiplyByScalar(double scalar) {
return new Megahertz(scalar * value());
}
public Megahertz divideByScalar(double scalar) {
return new Megahertz(value() / scalar);
}
public double scalarRatio(Megahertz other) {
return value() / other.value();
}
public boolean equals(Megahertz other) {
if (other == null)
return false;
return almostEqualsValue(other.value());
}
public boolean lessThan(Megahertz other) {
return value() < other.value();
}
public boolean lessThanOrEquals(Megahertz other) {
return !other.lessThan(this);
}
public boolean greaterThan(Megahertz other) {
return other.lessThan(this);
}
public boolean greaterThanOrEquals(Megahertz other) {
return !lessThan(other);
}
} | mit |
IQReserve/react-contextmenu | examples/multiple-targets/target.js | 461 | "use strict";
import React from "react";
import { ContextMenuLayer } from "../../src";
import MenuTypes from "./constants";
const MenuTarget = React.createClass({
displayName: "MenuTarget",
render() {
return (
<div className="well">
{this.props.name}
</div>
);
}
});
export default ContextMenuLayer(MenuTypes.multi, (props) => {
return {
name: props.name
};
})(MenuTarget);
| mit |
creative2020/homespotchoice | wp-content/plugins/groups/lib/core/class-groups-capability.php | 8597 | <?php
/**
* class-groups-capability.php
*
* Copyright (c) "kento" Karim Rahimpur www.itthinx.com
*
* This code is released under the GNU General Public License.
* See COPYRIGHT.txt and LICENSE.txt.
*
* This code is distributed in the hope that it will be useful,
* but WITHOUT ANY WARRANTY; without even the implied warranty of
* MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
* GNU General Public License for more details.
*
* This header and all notices must be kept intact.
*
* @author Karim Rahimpur
* @package groups
* @since groups 1.0.0
*/
if ( !defined( 'ABSPATH' ) ) {
exit;
}
/**
* Capability OPM
*/
class Groups_Capability {
const CACHE_GROUP = 'groups';
const READ_BY_CAPABILITY = 'read_by_capability';
/**
* @var persisted capability object
*/
var $capability = null;
/**
* Create by capability id.
* Must have been persisted.
* @param int $capability_id
*/
public function __construct( $capability_id ) {
$this->capability = self::read( $capability_id );
}
/**
* Retrieve a property by name.
*
* Possible properties:
* - capability_id
* - capability
* - class
* - object
* - name
* - description
*
* - group_ids groups that have the capability
*
* @param string $name property's name
* @return property value, will return null if property does not exist
*/
public function __get( $name ) {
global $wpdb;
$result = null;
if ( $this->capability !== null ) {
switch( $name ) {
case "capability_id" :
case "capability" :
case "class" :
case "object" :
case "name" :
case "description" :
$result = $this->capability->$name;
break;
case 'group_ids' :
$group_capability_table = _groups_get_tablename( "group_capability" );
$rows = $wpdb->get_results( $wpdb->prepare(
"SELECT group_id FROM $group_capability_table WHERE capability_id = %d",
Groups_Utility::id( $this->capability->capability_id )
) );
if ( $rows ) {
$result = array();
foreach( $rows as $row ) {
$result[] = $row->group_id;
}
}
break;
case 'groups' :
$group_capability_table = _groups_get_tablename( "group_capability" );
$rows = $wpdb->get_results( $wpdb->prepare(
"SELECT group_id FROM $group_capability_table WHERE capability_id = %d",
Groups_Utility::id( $this->capability->capability_id )
) );
if ( $rows ) {
$result = array();
foreach( $rows as $row ) {
$result[] = new Groups_Group( $row->group_id );
}
}
break;
}
}
return $result;
}
/**
* Persist a capability.
*
* Possible keys in $map:
*
* - "capability" (required) - unique capability label, max 20 characters
* - "class" (optional) - class the capability applies to, max 100 chars
* - "object" (optional) - identifies object of that class, max 100 chars
* - "name" (optional) - name it if you have to
* - "description" (optional) - dito
*
* @param array $map attributes, requires at least: "capability"
* @return capability_id on success, otherwise false
*/
public static function create( $map ) {
global $wpdb;
extract( $map );
$result = false;
if ( !empty( $capability ) ) {
if ( self::read_by_capability( $capability ) === false ) {
$data = array(
'capability' => $capability
);
$formats = array( '%s' );
if ( !empty( $class ) ) {
$data['class'] = $class;
$formats[] = '%s';
}
if ( !empty( $object ) ) {
$data['object'] = $object;
$formats[] = '%s';
}
if ( !empty( $name ) ) {
$data['name'] = $name;
$formats[] = '%s';
}
if ( !empty( $description ) ) {
$data['description'] = $description;
$formats[] = '%s';
}
$capability_table = _groups_get_tablename( 'capability' );
if ( $wpdb->insert( $capability_table, $data, $formats ) ) {
if ( $result = $wpdb->get_var( "SELECT LAST_INSERT_ID()" ) ) {
// read_by_capability above created a cache entry which needs to be reset
wp_cache_delete( self::READ_BY_CAPABILITY . '_' . $capability, self::CACHE_GROUP );
do_action( "groups_created_capability", $result );
}
}
}
}
return $result;
}
/**
* Retrieve a capability.
*
* Use Groups_Capability::read_capability() if you are trying to retrieve a capability by its unique label.
*
* @see Groups_Capability::read_by_capability()
* @param int $capability_id capability's id
* @return object upon success, otherwise false
*/
public static function read( $capability_id ) {
global $wpdb;
$result = false;
$capability_table = _groups_get_tablename( 'capability' );
$capability = $wpdb->get_row( $wpdb->prepare(
"SELECT * FROM $capability_table WHERE capability_id = %d",
Groups_Utility::id( $capability_id )
) );
if ( isset( $capability->capability_id ) ) {
$result = $capability;
}
return $result;
}
/**
* Retrieve a capability by its unique label.
*
* @param string $capability capability's unique label
* @return object upon success, otherwise false
*/
public static function read_by_capability( $capability ) {
global $wpdb;
$_capability = $capability;
$found = false;
$result = wp_cache_get( self::READ_BY_CAPABILITY . '_' . $_capability, self::CACHE_GROUP, false, $found );
if ( $found === false ) {
$result = false;
$capability_table = _groups_get_tablename( 'capability' );
$capability = $wpdb->get_row( $wpdb->prepare(
"SELECT * FROM $capability_table WHERE capability = %s",
$capability
) );
if ( isset( $capability->capability_id ) ) {
$result = $capability;
}
wp_cache_set( self::READ_BY_CAPABILITY . '_' . $_capability, $result, self::CACHE_GROUP );
}
return $result;
}
/**
* Update capability.
*
* @param array $map capability attribute, must contain capability_id
* @return capability_id on success, otherwise false
*/
public static function update( $map ) {
global $wpdb;
extract( $map );
$result = false;
if ( isset( $capability_id ) && !empty( $capability ) ) {
$capability_table = _groups_get_tablename( 'capability' );
$old_capability = Groups_Capability::read( $capability_id );
if ( $old_capability ) {
if ( isset( $capability ) ) {
$old_capability_capability = $old_capability->capability;
$old_capability->capability = $capability;
}
if ( isset( $class ) ) {
$old_capability->class = $class;
}
if ( isset( $object ) ) {
$old_capability->object = $object;
}
if ( isset( $name ) ) {
$old_name = $old_capability->name;
$old_capability->name = $name;
}
if ( isset( $description ) ) {
$old_capability->description = $description;
}
$rows = $wpdb->query( $wpdb->prepare(
"UPDATE $capability_table SET capability = %s, class = %s, object = %s, name = %s, description = %s WHERE capability_id = %d",
$old_capability->capability,
$old_capability->class,
$old_capability->object,
$old_capability->name,
$old_capability->description,
Groups_Utility::id( $capability_id )
) );
if ( ( $rows !== false ) ) {
$result = $capability_id;
if ( !empty( $old_capability ) && !empty( $old_capability->capability ) ) {
wp_cache_delete( self::READ_BY_CAPABILITY . '_' . $old_capability->capability, self::CACHE_GROUP );
}
if ( !empty( $old_capability_capability ) ) {
wp_cache_delete( self::READ_BY_CAPABILITY . '_' . $old_capability_capability, self::CACHE_GROUP );
}
do_action( "groups_updated_capability", $result );
}
}
}
return $result;
}
/**
* Remove capability and its relations.
*
* @param int $capability_id
* @return capability_id if successful, false otherwise
*/
public static function delete( $capability_id ) {
global $wpdb;
$result = false;
// avoid nonsense requests
if ( $capability = Groups_Capability::read( $capability_id ) ) {
$capability_table = _groups_get_tablename( 'capability' );
// get rid of it
if ( $rows = $wpdb->query( $wpdb->prepare(
"DELETE FROM $capability_table WHERE capability_id = %d",
Groups_Utility::id( $capability_id )
) ) ) {
$result = $capability_id;
if ( !empty( $capability->capability ) ) {
wp_cache_delete( self::READ_BY_CAPABILITY . '_' . $capability->capability, self::CACHE_GROUP );
do_action( 'groups_deleted_capability_capability', $capability->capability );
}
do_action( "groups_deleted_capability", $result );
}
}
return $result;
}
} | mit |
sapphiredev/twitter-archiver | src/client/reducers/StatsReducer.ts | 415 | import {
StatsKeys,
StatsAction,
} from '~/client/actions/types';
export interface StatsState {
queueCount: number;
}
const initialState: StatsState = {
'queueCount': 0,
};
export function stats(state = initialState, action: StatsAction): StatsState {
switch (action.type) {
case StatsKeys.UPDATE_QUEUE_COUNT:
return {
...state,
'queueCount': action.queueCount,
};
default:
return state;
}
}
| mit |
Azure/azure-sdk-for-go | services/network/mgmt/2018-02-01/network/availableendpointservices.go | 5901 | package network
// Copyright (c) Microsoft Corporation. All rights reserved.
// Licensed under the MIT License. See License.txt in the project root for license information.
//
// Code generated by Microsoft (R) AutoRest Code Generator.
// Changes may cause incorrect behavior and will be lost if the code is regenerated.
import (
"context"
"github.com/Azure/go-autorest/autorest"
"github.com/Azure/go-autorest/autorest/azure"
"github.com/Azure/go-autorest/tracing"
"net/http"
)
// AvailableEndpointServicesClient is the network Client
type AvailableEndpointServicesClient struct {
BaseClient
}
// NewAvailableEndpointServicesClient creates an instance of the AvailableEndpointServicesClient client.
func NewAvailableEndpointServicesClient(subscriptionID string) AvailableEndpointServicesClient {
return NewAvailableEndpointServicesClientWithBaseURI(DefaultBaseURI, subscriptionID)
}
// NewAvailableEndpointServicesClientWithBaseURI creates an instance of the AvailableEndpointServicesClient client
// using a custom endpoint. Use this when interacting with an Azure cloud that uses a non-standard base URI (sovereign
// clouds, Azure stack).
func NewAvailableEndpointServicesClientWithBaseURI(baseURI string, subscriptionID string) AvailableEndpointServicesClient {
return AvailableEndpointServicesClient{NewWithBaseURI(baseURI, subscriptionID)}
}
// List list what values of endpoint services are available for use.
// Parameters:
// location - the location to check available endpoint services.
func (client AvailableEndpointServicesClient) List(ctx context.Context, location string) (result EndpointServicesListResultPage, err error) {
if tracing.IsEnabled() {
ctx = tracing.StartSpan(ctx, fqdn+"/AvailableEndpointServicesClient.List")
defer func() {
sc := -1
if result.eslr.Response.Response != nil {
sc = result.eslr.Response.Response.StatusCode
}
tracing.EndSpan(ctx, sc, err)
}()
}
result.fn = client.listNextResults
req, err := client.ListPreparer(ctx, location)
if err != nil {
err = autorest.NewErrorWithError(err, "network.AvailableEndpointServicesClient", "List", nil, "Failure preparing request")
return
}
resp, err := client.ListSender(req)
if err != nil {
result.eslr.Response = autorest.Response{Response: resp}
err = autorest.NewErrorWithError(err, "network.AvailableEndpointServicesClient", "List", resp, "Failure sending request")
return
}
result.eslr, err = client.ListResponder(resp)
if err != nil {
err = autorest.NewErrorWithError(err, "network.AvailableEndpointServicesClient", "List", resp, "Failure responding to request")
return
}
if result.eslr.hasNextLink() && result.eslr.IsEmpty() {
err = result.NextWithContext(ctx)
return
}
return
}
// ListPreparer prepares the List request.
func (client AvailableEndpointServicesClient) ListPreparer(ctx context.Context, location string) (*http.Request, error) {
pathParameters := map[string]interface{}{
"location": autorest.Encode("path", location),
"subscriptionId": autorest.Encode("path", client.SubscriptionID),
}
const APIVersion = "2018-02-01"
queryParameters := map[string]interface{}{
"api-version": APIVersion,
}
preparer := autorest.CreatePreparer(
autorest.AsGet(),
autorest.WithBaseURL(client.BaseURI),
autorest.WithPathParameters("/subscriptions/{subscriptionId}/providers/Microsoft.Network/locations/{location}/virtualNetworkAvailableEndpointServices", pathParameters),
autorest.WithQueryParameters(queryParameters))
return preparer.Prepare((&http.Request{}).WithContext(ctx))
}
// ListSender sends the List request. The method will close the
// http.Response Body if it receives an error.
func (client AvailableEndpointServicesClient) ListSender(req *http.Request) (*http.Response, error) {
return client.Send(req, azure.DoRetryWithRegistration(client.Client))
}
// ListResponder handles the response to the List request. The method always
// closes the http.Response Body.
func (client AvailableEndpointServicesClient) ListResponder(resp *http.Response) (result EndpointServicesListResult, err error) {
err = autorest.Respond(
resp,
azure.WithErrorUnlessStatusCode(http.StatusOK),
autorest.ByUnmarshallingJSON(&result),
autorest.ByClosing())
result.Response = autorest.Response{Response: resp}
return
}
// listNextResults retrieves the next set of results, if any.
func (client AvailableEndpointServicesClient) listNextResults(ctx context.Context, lastResults EndpointServicesListResult) (result EndpointServicesListResult, err error) {
req, err := lastResults.endpointServicesListResultPreparer(ctx)
if err != nil {
return result, autorest.NewErrorWithError(err, "network.AvailableEndpointServicesClient", "listNextResults", nil, "Failure preparing next results request")
}
if req == nil {
return
}
resp, err := client.ListSender(req)
if err != nil {
result.Response = autorest.Response{Response: resp}
return result, autorest.NewErrorWithError(err, "network.AvailableEndpointServicesClient", "listNextResults", resp, "Failure sending next results request")
}
result, err = client.ListResponder(resp)
if err != nil {
err = autorest.NewErrorWithError(err, "network.AvailableEndpointServicesClient", "listNextResults", resp, "Failure responding to next results request")
}
return
}
// ListComplete enumerates all values, automatically crossing page boundaries as required.
func (client AvailableEndpointServicesClient) ListComplete(ctx context.Context, location string) (result EndpointServicesListResultIterator, err error) {
if tracing.IsEnabled() {
ctx = tracing.StartSpan(ctx, fqdn+"/AvailableEndpointServicesClient.List")
defer func() {
sc := -1
if result.Response().Response.Response != nil {
sc = result.page.Response().Response.Response.StatusCode
}
tracing.EndSpan(ctx, sc, err)
}()
}
result.page, err = client.List(ctx, location)
return
}
| mit |
mesh0000/poolui | app/user/payments/payments.js | 450 | 'use strict';
app.controller('PaymentsCtrl', function($scope, dataService) {
$scope.payments = {};
$scope.selected = [];
$scope.options = {
page: 1,
limit: 15
}
$scope.loadPayments = function () {
var params = angular.copy($scope.options);
params.page -= 1;
var urlParams = $.param(params)
dataService.getData("/pool/payments?"+urlParams, function(data){
$scope.payments.global = data;
});
}
$scope.loadPayments();
}); | mit |
kinkome/pipe2me | config/metric_system.rb | 131 | require "metric_system"
METRIC_SYSTEM_SOCKET = "var/metric_system.socket"
METRIC_SYSTEM_DATABASE = "var/metric_system.sqlite"
| mit |
davidsbond/brock | container/siblings_test.go | 2012 | package container_test
import (
"fmt"
"testing"
"github.com/davidsbond/brock/container"
"github.com/stretchr/testify/assert"
)
func TestSibling_Add(t *testing.T) {
siblings := container.NewSiblingContainer()
tt := []struct {
Location string
ExpectedError string
ExpectedCount int
}{
{Location: "localhost:9090", ExpectedCount: 1},
{Location: "localhost:9090", ExpectedCount: 1, ExpectedError: "broker is already connected to a sibling at localhost:9090"},
{Location: "localhost:9091", ExpectedCount: 2},
}
for _, tc := range tt {
id, err := siblings.Add(tc.Location)
if err != nil {
assert.Equal(t, tc.ExpectedError, err.Error())
continue
}
assert.NotEmpty(t, id)
assert.Equal(t, tc.ExpectedCount, siblings.Count())
}
}
func TestSibling_Delete(t *testing.T) {
siblings := container.NewSiblingContainer()
tt := []struct {
Location string
ExpectedError string
ExpectedCount int
SkipAdd bool
}{
{Location: "localhost:9090", ExpectedCount: 0},
{Location: "localhost:9091", ExpectedCount: 0, ExpectedError: "failed to find a sibling broker with id '%v'", SkipAdd: true},
}
for _, tc := range tt {
var id string
var err error
if !tc.SkipAdd {
id, err = siblings.Add(tc.Location)
if err != nil {
assert.Equal(t, tc.ExpectedError, err.Error())
continue
}
assert.NotEmpty(t, id)
}
err = siblings.Delete(id)
if err != nil {
assert.Equal(t, fmt.Sprintf(tc.ExpectedError, id), err.Error())
}
assert.Equal(t, tc.ExpectedCount, siblings.Count())
}
}
func TestSibling_Has(t *testing.T) {
siblings := container.NewSiblingContainer()
tt := []struct {
Location string
ExpectedResult bool
SkipAdd bool
}{
{Location: "localhost:9090", ExpectedResult: true},
{Location: "localhost:9091", ExpectedResult: false, SkipAdd: true},
}
for _, tc := range tt {
if !tc.SkipAdd {
siblings.Add(tc.Location)
}
assert.Equal(t, tc.ExpectedResult, siblings.Has(tc.Location))
}
}
| mit |
sporchia/alttp_vt_randomizer | app/Console/Commands/JsonToCsv.php | 1946 | <?php
namespace ALttP\Console\Commands;
use Illuminate\Console\Command;
use ALttP\Item;
use ALttP\Randomizer;
use ALttP\World;
/**
* This converts json files to csv.
*/
class JsonToCsv extends Command
{
/**
* The name and signature of the console command.
*
* @var string
*/
protected $signature = 'alttp:jsontocsv {file}';
/**
* The console command description.
*
* @var string
*/
protected $description = 'convert json file to csv.';
/**
* Execute the console command.
*
* @return mixed
*/
public function handle()
{
if (!is_string($this->argument('file')) || !is_readable($this->argument('file'))) {
$this->error("json not readable");
return 1;
}
$file_contents = file_get_contents($this->argument('file'));
if ($file_contents === false) {
$this->error('could not read file');
return 3;
}
$locations = $this->_assureColumnsExist(json_decode($file_contents, true));
ksortr($locations);
$out = fopen('php://output', 'w');
if ($out === false) {
$this->error('could not open output');
return 2;
}
fputcsv($out, array_merge(['location'], array_keys(reset($locations))));
foreach ($locations as $name => $location) {
fputcsv($out, array_merge([$name], $location));
}
fclose($out);
}
private function _assureColumnsExist($array): array
{
$keys = [];
foreach ($array as $part) {
$keys = array_merge($keys, array_keys($part));
}
$keys = array_unique($keys);
foreach ($array as $k => $part) {
foreach ($keys as $key) {
if (!isset($part[$key])) {
$array[$k][$key] = 0;
}
}
}
return $array;
}
}
| mit |
Senither/ShareX-Media-Server | database/migrations/2014_10_12_000000_create_users_table.php | 833 | <?php
use Illuminate\Database\Migrations\Migration;
use Illuminate\Database\Schema\Blueprint;
use Illuminate\Support\Facades\Schema;
class CreateUsersTable extends Migration
{
public function up()
{
Schema::create('users', function (Blueprint $table) {
$table->id();
$table->boolean('is_admin')->default(false);
$table->string('name');
$table->string('email')->unique();
$table->timestamp('email_verified_at')->nullable();
$table->string('password');
$table->rememberToken();
$table->foreignId('current_team_id')->nullable();
$table->text('profile_photo_path')->nullable();
$table->timestamps();
});
}
public function down()
{
Schema::dropIfExists('users');
}
}
| mit |
randy-girard/app_perf_rpm | lib/app_perf_rpm/introspector.rb | 1093 | # frozen_string_literal: true
module AppPerfRpm
class Introspector
VALID_RUNNERS = [
:PhusionPassenger,
:Puma,
:Rainbows,
:Resque,
:Sidekiq,
:Sinatra,
:Unicorn,
:Webrick
]
class << self
def agentable?
if raking? || rspecing?
AppPerfRpm.logger.info("Detected rake, not initializing agent")
return false
end
AppPerfRpm.logger.info("Detecting runner...")
VALID_RUNNERS.each do |runner|
if const_defined?(runner.to_s)
AppPerfRpm.logger.info("#{runner} detected. You're valid")
return true
end
end
AppPerfRpm.logger.info("No valid runner detected!")
false
end
def rspecing?
(File.basename($0) =~ /\Arspec/) == 0
end
def raking?
(File.basename($0) =~ /\Arake/) == 0
end
def const_defined?(string_const)
begin
Object.const_get(string_const)
true
rescue NameError
false
end
end
end
end
end
| mit |
karim/adila | database/src/main/java/adila/db/hwc8600.java | 191 | // This file is automatically generated.
package adila.db;
/*
* Huawei
*
* DEVICE: hwc8600
* MODEL: C8600
*/
final class hwc8600 {
public static final String DATA = "Huawei||";
}
| mit |
frig-neutron/PIPE | pipe-gui/src/main/java/pipe/controllers/application/PipeApplicationController.java | 9414 | package pipe.controllers.application;
import pipe.actions.gui.PipeApplicationModel;
import pipe.controllers.*;
import pipe.gui.PetriNetTab;
import pipe.historyActions.AnimationHistoryImpl;
import uk.ac.imperial.pipe.animation.PetriNetAnimator;
import uk.ac.imperial.pipe.models.manager.PetriNetManager;
import uk.ac.imperial.pipe.models.manager.PetriNetManagerImpl;
import uk.ac.imperial.pipe.models.petrinet.*;
import uk.ac.imperial.pipe.parsers.UnparsableException;
import javax.swing.event.UndoableEditListener;
import javax.xml.bind.JAXBException;
import javax.xml.parsers.ParserConfigurationException;
import javax.xml.transform.TransformerException;
import java.beans.PropertyChangeEvent;
import java.beans.PropertyChangeListener;
import java.io.File;
import java.io.FileNotFoundException;
import java.lang.reflect.InvocationTargetException;
import java.util.*;
/**
* Pipes main application controller.
* It houses the Petri net controllers of open tabs and is responsible for the creation of Petri nets
*/
public class PipeApplicationController {
/**
* Controllers for each tab
*/
private final Map<PetriNetTab, PetriNetController> netControllers = new HashMap<>();
/**
* Main PIPE application model
*/
private final PipeApplicationModel applicationModel;
/**
* Manages creation/deletion of Petri net models
*/
private final PetriNetManager manager = new PetriNetManagerImpl();
/**
* The current tab displayed in the view
*/
private PetriNetTab activeTab;
/**
* Constructor
* @param applicationModel Main PIPE application model
*/
public PipeApplicationController(PipeApplicationModel applicationModel) {
this.applicationModel = applicationModel;
}
/**
*
* @param listener to listen for change events in the petri net manager
*/
public void registerToManager(PropertyChangeListener listener) {
manager.addPropertyChangeListener(listener);
}
/**
* Creates an empty Petri net with a default token
*/
public void createEmptyPetriNet() {
manager.createNewPetriNet();
}
/**
* Register the tab to the Petri net
* @param net Petri net
* @param tab tab which houses the graphical petri net components
* @param historyObserver listener for stepback/forward events in animation
* @param undoListener listener for undo/redo events
* @param zoomListener listener for zoom events
*/
//TODO: THIS IS RATHER UGLY, too many params but better than what was here before
public void registerTab(PetriNet net, PetriNetTab tab, Observer historyObserver, UndoableEditListener undoListener,
PropertyChangeListener zoomListener) {
AnimationHistoryImpl animationHistory = new AnimationHistoryImpl();
animationHistory.addObserver(historyObserver);
GUIAnimator animator = new GUIAnimator(new PetriNetAnimator(net), animationHistory, this);
CopyPasteManager copyPasteManager = new CopyPasteManager(undoListener, tab, net, this);
ZoomController zoomController = new ZoomController(100);
tab.addZoomListener(zoomController);
PetriNetController petriNetController =
new PetriNetController(net, undoListener, animator, copyPasteManager, zoomController, tab);
netControllers.put(tab, petriNetController);
tab.updatePreferredSize();
PropertyChangeListener changeListener =
new PetriNetChangeListener(applicationModel, tab, petriNetController);
net.addPropertyChangeListener(changeListener);
setActiveTab(tab);
initialiseNet(net, changeListener);
}
/**
*
* @param tab the active tab - this is the tab that is currently being displayed in the view
*/
public void setActiveTab(PetriNetTab tab) {
this.activeTab = tab;
}
/**
* This is a little hacky, I'm not sure how to make this better when it's so late
* If a better implementation is clear please re-write
* <p/>
* This method invokes the change listener which will create the view objects on the
* petri net tab
*
* @param propertyChangeListener
*/
private void initialiseNet(PetriNet net, PropertyChangeListener propertyChangeListener) {
for (Token token : net.getTokens()) {
PropertyChangeEvent changeEvent =
new PropertyChangeEvent(net, PetriNet.NEW_TOKEN_CHANGE_MESSAGE, null, token);
propertyChangeListener.propertyChange(changeEvent);
}
for (Place place : net.getPlaces()) {
PropertyChangeEvent changeEvent =
new PropertyChangeEvent(net, PetriNet.NEW_PLACE_CHANGE_MESSAGE, null, place);
propertyChangeListener.propertyChange(changeEvent);
}
for (Transition transition : net.getTransitions()) {
PropertyChangeEvent changeEvent =
new PropertyChangeEvent(net, PetriNet.NEW_TRANSITION_CHANGE_MESSAGE, null, transition);
propertyChangeListener.propertyChange(changeEvent);
}
for (Arc<? extends Connectable, ? extends Connectable> arc : net.getArcs()) {
PropertyChangeEvent changeEvent = new PropertyChangeEvent(net, PetriNet.NEW_ARC_CHANGE_MESSAGE, null, arc);
propertyChangeListener.propertyChange(changeEvent);
}
for (Annotation annotation : net.getAnnotations()) {
PropertyChangeEvent changeEvent =
new PropertyChangeEvent(net, PetriNet.NEW_ANNOTATION_CHANGE_MESSAGE, null, annotation);
propertyChangeListener.propertyChange(changeEvent);
}
for (RateParameter rateParameter : net.getRateParameters()) {
PropertyChangeEvent changeEvent =
new PropertyChangeEvent(net, PetriNet.NEW_RATE_PARAMETER_CHANGE_MESSAGE, null, rateParameter);
propertyChangeListener.propertyChange(changeEvent);
}
}
/**
* Loads and creates a Petri net located at the given file
* @param file location of the XML file which contains a PNML representation of a Petri net
* @throws UnparsableException
*/
public void createNewTabFromFile(File file) throws UnparsableException {
try {
manager.createFromFile(file);
} catch (FileNotFoundException | JAXBException e) {
throw new UnparsableException("Could not initialise Petri net reader!", e);
}
}
/**
* Save the currently displayed petri net to the specified file
* @param outFile location to save the Petri net
* @throws ParserConfigurationException
* @throws TransformerException
* @throws IllegalAccessException
* @throws NoSuchMethodException
* @throws InvocationTargetException
*/
public void saveAsCurrentPetriNet(File outFile)
throws ParserConfigurationException, TransformerException, IllegalAccessException, NoSuchMethodException,
InvocationTargetException {
PetriNetController petriNetController = getActivePetriNetController();
PetriNet petriNet = petriNetController.getPetriNet();
try {
manager.savePetriNet(petriNet, outFile);
} catch (JAXBException e) {
throw new RuntimeException("Failed to write!", e);
}
petriNetController.save();
}
/**
*
* @return the active Petri net controller
*/
public PetriNetController getActivePetriNetController() {
return netControllers.get(activeTab);
}
/**
* @return true if the current petri net has changed
*/
public boolean hasCurrentPetriNetChanged() {
PetriNetController activeController = getActivePetriNetController();
return activeController != null && activeController.hasChanged();
}
public boolean anyNetsChanged() {
return !getNetsChanged().isEmpty();
}
/**
* @return the names of the petri nets that have changed
*/
public Set<String> getNetsChanged() {
Set<String> changed = new HashSet<>();
for (PetriNetController controller : netControllers.values()) {
if (controller.hasChanged()) {
changed.add(controller.getPetriNet().getNameValue());
}
}
return changed;
}
/**
* Removes the active tab from display if it exists.
* Note active tab must be removed from netControllers before the petri net is removed
* from the manager because the manager will fire a message which causes the active tab
* to be swapped to the new open tab
*/
public void removeActiveTab() {
if (activeTab != null) {
PetriNetController controller = netControllers.get(activeTab);
netControllers.remove(activeTab);
PetriNet petriNet = controller.getPetriNet();
manager.remove(petriNet);
}
}
/**
*
* @return the current active tab
*/
public PetriNetTab getActiveTab() {
return activeTab;
}
}
| mit |
konvajs/site | react-demos/image-label-tool/src/components/App.js | 866 | import React from "react";
import Canvas from "./Canvas";
import RegionsList from "./RegionsList";
import useStore from "../store";
export default () => {
const { setBrightness } = useStore();
return (
<React.Fragment>
<h2>Image annotate prototype</h2>
<p className="description">Draw objects conturs on top of the image</p>
<div className="App">
<div className="left-panel">
Brigthess
<input
id="slider"
type="range"
min="-1"
max="1"
step="0.05"
defaultValue="0"
onChange={e => {
setBrightness(parseFloat(e.target.value));
}}
/>
<RegionsList />
</div>
<div className="right-panel">
<Canvas />
</div>
</div>
</React.Fragment>
);
};
| mit |
mogria/void.php | lib/Asset/Asset.php | 6148 | <?php
namespace Void;
/**
* Represents an Asset (a .css or a .js file or similiar which is not directly in the html
* Inside this file you can use certain statements like in the following example:
*
* -- application.css --
* //= require style.css
* //= require_tree modules
*
*
* if the directory structure is something like this
*
* stylesheets/
* |- modules/
* | |- menu.css
* | `- footer.css
* |- application.css
* |- randomcssfile.css
* `- style.css
*
* the following output will be generated:
* /** style.css ** /
*
* .some-selector {
* font-size: 15px;
* }
*
*
* /** modules/menu.css ** /
* .menu {
* list-style-type: none;
* }
*
* /** modules/footer.css ** /
* footer {
* font-size: 12px;
* }
*
*/
class Asset extends VoidBase {
/**
* @var string $extension - the extension of the asset file
* @access protected
*/
protected $extension;
/**
* @var string $directory - the directory where these asset files are in
* @access protected
*/
protected $directory;
/**
* @var string $main_file - the file which contains "require" statements
* @access protected
*/
protected $main_file;
/**
* the commands you can use in a Asset file
* @var Array $directives
* @access public
*/
static protected $directives = Array(
'require',
'require_dir',
'require_tree',
'require_self',
);
/**
* Simple Constructor.
* Initializes the three protected properties $extension, $directory and $main_file
*
* @param string $directory
* @param string $extension
* @param string $main_file
* @access public
*/
public function __construct($directory, $extension, $main_file = "application") {
$this->directory = $directory;
$this->extension = $extension;
$this->main_file = $main_file;
}
/**
* Loads the given $main_file executes the commands in it
*
* @access public
* @return string - the $main_file & the composed content
*/
public function load() {
$content = "";
foreach($this->getFileList() as $file) {
$content .= $this->require_single_file($file);
}
return $content;
}
/**
* returns a list of files which are included by the main_file
*
* @access public
* @return Array
*/
public function getFileList() {
// read the main file
$content = file_get_contents($this->directory. DS . $this->main_file . "." . $this->extension);
// search for all the three commands inside of the file
// we are using a regular expression to do this
$ok = preg_match_all(
'/^\/\/=[^\S\\n]*(' . implode("|", array_map('preg_quote', self::$directives)) . ')[^\S\\n]+([^\\n$]*)/mi',
$content,
$matches, PREG_SET_ORDER);
$list = Array();
if($ok) {
// iterate all the results and build an array of all the files
foreach($matches as $match) {
$method = "handler_" . $match[1];
$list = array_merge($list, $this->$method(trim($match[2])));
}
} else {
$list = array_merge($list, $this->handler_require_self());
}
return $list;
}
/**
* This reads a single file and puts the filename in comments at the beginning of the file
*
* Throws an BadMethodCallException if the file doesn't exist.
*
* @access public
* @param string $file - the filename
* @return string - the file read with the filename on top
*/
public function require_single_file($file) {
if(!is_file($this->directory . DS . $file)) {
throw new \BadMethodCallException("Asset file '{$this->directory}" . DS . "$file' does not exist!");
}
return "/** $file **/\n" .
file_get_contents($this->directory . DS . $file)
. "\n";
}
/**
* This method gets called if a single file is included from the main file
*
* @access public
* @param string $file
* @return Array - list of files
*/
public function handler_require($file) {
$str = "";
$cwd = getcwd(); // get the current directory
chdir($this->directory); // change to the assets directory
$files = glob($file . "." . $this->extension); // returns all the files that matched the pattern
chdir($cwd); // change back to the original directory
return $files;
}
/**
* This method gets called if the main_file includes itself by calling require_self
*
* @access public
* @return Array - list of files
*/
public function handler_require_self() {
return $this->handler_require($this->main_file);
}
/**
* This includes all the files from a directory (but not the files in the subdirectories of the directory)
*
* @access public
* @param string $dir - the directory
* @return Array - list of files
*/
public function handler_require_dir($dir) {
return $this->handler_require_tree($dir, 1);
}
/**
* This includes all the files in the given directory (and subdirectories) until the $depth (-1 => unlimited) is reached
*
* @access public
* @param $dir - the directory
* @param $depth
* @return Array - list of files
*/
public function handler_require_tree($dir, $depth = -1) {
$list = Array();
// scan the given directory for files
$cwd = getcwd();
chdir($this->directory);
if(!is_dir($dir)) {
throw new \BadMethodCallException("The directory '$this->directory/$dir' does not exist!");
}
$files = array_diff(scandir($dir), array(".", ".."));
chdir($cwd);
// iterate through each file
foreach($files as $file) {
$filename = $dir . DS . $file;
// is it a file or a directory?
if(is_file($this->directory . DS . $filename)) {
// append it to the list if it is a file
$list[] = $filename;
} else if(is_dir($this->directory . DS . $filename)) {
// do a recursive call if it is a directory until the $depth limit is reached
if($depth == -1 || (--$depth > 0)) {
$list = array_merge($list, $this->handler_require_tree($filename, $depth));
}
}
}
return $list;
}
public function getDirectory() {
return $this->directory;
}
}
| mit |
longze/vue2-study-together | element-ui-project/build/webpack.base.conf.js | 1626 | var path = require('path')
var utils = require('./utils')
var config = require('../config')
var vueLoaderConfig = require('./vue-loader.conf')
function resolve (dir) {
return path.join(__dirname, '..', dir)
}
module.exports = {
entry: {
app: './src/main.js'
},
output: {
path: config.build.assetsRoot,
filename: '[name].js',
publicPath: process.env.NODE_ENV === 'production'
? config.build.assetsPublicPath
: config.dev.assetsPublicPath
},
resolve: {
extensions: ['.js', '.vue', '.json'],
alias: {
'vue$': 'vue/dist/vue.esm.js',
'@': resolve('src')
},
modules: [
'node_modules'
],
modulesDirectories: [
'node_modules'
]
},
module: {
rules: [
{
test: /\.vue$/,
loader: 'vue-loader',
options: vueLoaderConfig
},
{
test: /\.js$/,
loader: 'babel-loader',
include: [resolve('src'), resolve('test')]
},
{
test: /\.(png|jpe?g|gif|svg)(\?.*)?$/,
loader: 'url-loader',
options: {
limit: 10000,
name: utils.assetsPath('img/[name].[hash:7].[ext]')
}
},
{
test: /\.(mp4|webm|ogg|mp3|wav|flac|aac)(\?.*)?$/,
loader: 'url-loader',
options: {
limit: 10000,
name: utils.assetsPath('media/[name].[hash:7].[ext]')
}
},
{
test: /\.(woff2?|eot|ttf|otf)(\?.*)?$/,
loader: 'url-loader',
options: {
limit: 10000,
name: utils.assetsPath('fonts/[name].[hash:7].[ext]')
}
}
]
}
}
| mit |
DominikWiesend/wiesend-dll | projects/Wiesend.Media/Media/ExtensionMethods/ScreenExtensions.cs | 8571 | #region Project Description [About this]
// =================================================================================
// The whole Project is Licensed under the MIT License
// =================================================================================
// =================================================================================
// Wiesend's Dynamic Link Library is a collection of reusable code that
// I've written, or found throughout my programming career.
//
// I tried my very best to mention all of the original copyright holders.
// I hope that all code which I've copied from others is mentioned and all
// their copyrights are given. The copied code (or code snippets) could
// already be modified by me or others.
// =================================================================================
#endregion of Project Description
#region Original Source Code [Links to all original source code]
// =================================================================================
// Original Source Code [Links to all original source code]
// =================================================================================
// https://github.com/JaCraig/Craig-s-Utility-Library
// =================================================================================
// I didn't wrote this source totally on my own, this class could be nearly a
// clone of the project of James Craig, I did highly get inspired by him, so
// this piece of code isn't totally mine, shame on me, I'm not the best!
// =================================================================================
#endregion of where is the original source code
#region Licenses [MIT Licenses]
#region MIT License [James Craig]
// =================================================================================
// Copyright(c) 2014 <a href="http://www.gutgames.com">James Craig</a>
//
// Permission is hereby granted, free of charge, to any person obtaining a copy
// of this software and associated documentation files (the "Software"), to deal
// in the Software without restriction, including without limitation the rights
// to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
// copies of the Software, and to permit persons to whom the Software is
// furnished to do so, subject to the following conditions:
//
// The above copyright notice and this permission notice shall be included in all
// copies or substantial portions of the Software.
//
// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
// IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
// FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
// AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
// LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
// OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
// SOFTWARE.
// =================================================================================
#endregion of MIT License [James Craig]
#region MIT License [Dominik Wiesend]
// =================================================================================
// Copyright(c) 2016 Dominik Wiesend. All rights reserved.
//
// Permission is hereby granted, free of charge, to any person obtaining a copy
// of this software and associated documentation files (the "Software"), to deal
// in the Software without restriction, including without limitation the rights
// to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
// copies of the Software, and to permit persons to whom the Software is
// furnished to do so, subject to the following conditions:
//
// The above copyright notice and this permission notice shall be included in all
// copies or substantial portions of the Software.
//
// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
// IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
// FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
// AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
// LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
// OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
// SOFTWARE.
// =================================================================================
#endregion of MIT License [Dominik Wiesend]
#endregion of Licenses [MIT Licenses]
using System;
using System.Collections.Generic;
using System.ComponentModel;
using System.Diagnostics.Contracts;
using System.Drawing;
using System.Drawing.Imaging;
using System.Windows.Forms;
namespace Wiesend.Media
{
/// <summary>
/// Screen extensions
/// </summary>
[EditorBrowsable(EditorBrowsableState.Never)]
public static class ScreenExtensions
{
/// <summary>
/// Takes a screenshot of the screen as a whole (if multiple screens are attached, it takes
/// an image containing them all)
/// </summary>
/// <param name="Screen">Screen to get the screenshot from</param>
/// <param name="FileName">Name of the file to save the screenshot (optional)</param>
/// <returns>Returns a SwiftBitmap containing the screen shot</returns>
[System.Diagnostics.CodeAnalysis.SuppressMessage("Microsoft.Reliability", "CA2000:Dispose objects before losing scope"), System.Diagnostics.CodeAnalysis.SuppressMessage("Microsoft.Design", "CA1031:DoNotCatchGeneralExceptionTypes")]
public static Bitmap TakeScreenShot(this Screen Screen, string FileName = "")
{
Contract.Requires<ArgumentNullException>(Screen != null, "Screen");
var TempSwiftBitmap = new Bitmap(Screen.Bounds.Width > 1 ? Screen.Bounds.Width : 1, Screen.Bounds.Height > 1 ? Screen.Bounds.Height : 1, PixelFormat.Format32bppArgb);
try
{
if (Screen.Bounds.Width > 1 && Screen.Bounds.Height > 1)
{
using (Graphics TempGraphics = Graphics.FromImage(TempSwiftBitmap))
{
TempGraphics.CopyFromScreen(Screen.Bounds.X, Screen.Bounds.Y, 0, 0, Screen.Bounds.Size, CopyPixelOperation.SourceCopy);
}
}
}
catch { }
if (!string.IsNullOrEmpty(FileName))
TempSwiftBitmap.Save(FileName);
return TempSwiftBitmap;
}
/// <summary>
/// Takes a screenshot of the screen as a whole (if multiple screens are attached, it takes
/// an image containing them all)
/// </summary>
/// <param name="Screens">Screens to get the screenshot from</param>
/// <param name="FileName">Name of the file to save the screenshot (optional)</param>
/// <returns>Returns a SwiftBitmap containing the screen shot</returns>
[System.Diagnostics.CodeAnalysis.SuppressMessage("Microsoft.Reliability", "CA2000:Dispose objects before losing scope"), System.Diagnostics.CodeAnalysis.SuppressMessage("Microsoft.Design", "CA1031:DoNotCatchGeneralExceptionTypes")]
public static Bitmap TakeScreenShot(this IEnumerable<Screen> Screens, string FileName = "")
{
Contract.Requires<ArgumentNullException>(Screens != null, "Screens");
Rectangle TotalScreenRect = Rectangle.Empty;
foreach (Screen CurrentScreen in Screen.AllScreens)
TotalScreenRect = Rectangle.Union(TotalScreenRect, CurrentScreen.Bounds);
var TempSwiftBitmap = new Bitmap(TotalScreenRect.Width > 1 ? TotalScreenRect.Width : 1, TotalScreenRect.Height > 1 ? TotalScreenRect.Width : 1, PixelFormat.Format32bppArgb);
try
{
if (TotalScreenRect.Width > 1 && TotalScreenRect.Height > 1)
{
using (Graphics TempGraphics = Graphics.FromImage(TempSwiftBitmap))
{
TempGraphics.CopyFromScreen(TotalScreenRect.X, TotalScreenRect.Y, 0, 0, TotalScreenRect.Size, CopyPixelOperation.SourceCopy);
}
}
}
catch { }
if (!string.IsNullOrEmpty(FileName))
TempSwiftBitmap.Save(FileName);
return TempSwiftBitmap;
}
}
} | mit |
sooth-sayer/Rubeque | lib/rubeque/baby_got_stacks.rb | 582 | module Rubeque
module BabyGotStacks
class Stack
def initialize(initial_array)
@stack = (initial_array.is_a? Array) ? initial_array : Array.try_convert(initial_array)
end
def pop(count = 0)
if (count == 0)
@stack.pop
else
@stack.pop(count).reverse
end
end
def push(items)
if items.is_a? Array
@stack += items
else
@stack.push(items)
end
true
end
def to_a
@stack
end
end
end
end
| mit |
PAlexcom/Spider4Schema | dist/type/landform.php | 525 | <?php
/**
* A landform or physical feature. Landform elements include mountains, plains, lakes, rivers, seascape and oceanic waterbody interface features such as bays, peninsulas, seas and so forth, including sub-aqueous terrain features such as submersed mountain ranges, volcanoes, and the great ocean basins.
*
* @see http://schema.org/Landform
*/
abstract class TypeLandform extends TypePlace
{
/**
* The Schema.org Type Scope
*
* @var string
*/
protected static $scope = 'https://schema.org/Landform';
}
| mit |
vernonzheng/scala-for-the-Impatient | src/Chapter07/exercise07.scala | 572 | /**
* 在前一个练习中,将所有引入语句移动到尽可能小的作用域里
*/
object Q7 extends App{
import java.util.{HashMap => JavaHashMap}
val javaMap = new JavaHashMap[Int,String]
javaMap.put(1, "One");
javaMap.put(2, "Two");
javaMap.put(3, "Three");
javaMap.put(4, "Four");
import collection.mutable.{HashMap => ScalaHashMap, Map => ScalaMap}
val scalaMap = new ScalaHashMap[Int,String]
for(key <- javaMap.keySet().toArray()){
scalaMap += (key.asInstanceOf[Int] -> javaMap.get(key))
}
println(scalaMap.mkString(" "))
} | mit |
rossedlin/cryslo-php | src/Core/Str.php | 2209 | <?php
namespace Cryslo\Core;
/**
* Created by PhpStorm.
*
* @author Ross Edlin <contact@rossedlin.com>
*
* Date: 15/03/18
* Time: 16:52
*
* Class Str
* @package Cryslo\Core
*/
class Str
{
/**
* @param $key
* @return string
*/
public static function cacheFriendlyKey($key)
{
return trim(preg_replace('/[^a-zA-Z0-9.]+/', '-', $key), '-');
}
/**
* @param $str
*
* @return string
*/
public static function codify($str)
{
return strtolower(trim(preg_replace('/[^a-zA-Z0-9]+/', '-', $str), '-'));
}
/**
* @param $haystack
* @param $needle
*
* @return bool
*/
public static function endsWith($haystack, $needle)
{
return $needle === "" || (
($temp = strlen($haystack) - strlen($needle)) >= 0 && strpos($haystack, $needle, $temp) !== false
);
}
/**
* @param string $str
*
* @return string
*/
public static function getOnlyLetters($str)
{
return preg_replace('/[^a-zA-Z]+/', '', $str);
}
/**
* @param string $str
*
* @return string
*/
public static function getOnlyNumbers($str)
{
return preg_replace('/[^0-9]+/', '', $str);
}
/**
* @param string $str
* @param string $multiple
* @param string $one
*
* @return mixed
* @throws \Exception
*/
public static function replaceMultipleWithOne($str, $multiple, $one)
{
/**
* Special Case
*/
switch ((string)$multiple) {
case ' ':
return preg_replace('/\s+/', $one, $str);
case '+':
return preg_replace('/\++/', $one, $str);
default:
return preg_replace('!' . $multiple . '+!', $one, $str);
}
}
/**
* @param $haystack
* @param $needle
*
* @return bool
*/
public static function startsWith($haystack, $needle)
{
// search backwards starting from haystack length characters from the end
return $needle === "" || strrpos($haystack, $needle, -strlen($haystack)) !== false;
}
}
| mit |
Hyperspaces/Hyperspace.DotLua | src/Irony.Interpreter/InterpretedLanguageGrammar.cs | 2532 | using System;
using System.Collections.Generic;
using System.Linq;
using System.Text;
using Irony.Ast;
using Irony.Parsing;
using Irony.Interpreter.Ast;
namespace Irony.Interpreter
{
/// <summary> Base class for languages that use Irony Interpreter to execute scripts. </summary>
public abstract class InterpretedLanguageGrammar : Grammar, ICanRunSample
{
// making the class abstract so it won't load into Grammar Explorer
public InterpretedLanguageGrammar(bool caseSensitive)
: base(caseSensitive)
{
this.LanguageFlags = LanguageFlags.CreateAst;
}
// This method allows custom implementation of running a sample in Grammar Explorer
// By default it evaluates a parse tree using default interpreter.
// Irony's interpeter has one restriction: once a script (represented by AST node) is evaluated in ScriptApp,
// its internal fields in AST nodes become tied to this particular instance of ScriptApp (more precisely DataMap).
// If you want to evaluate the AST tree again, you have to do it in the context of the same DataMap.
// Grammar Explorer may call RunSample method repeatedly for evaluation of the same parsed script. So we keep ScriptApp instance in
// the field, and if we get the same script node, then we reuse the ScriptApp thus satisfying the requirement.
private ScriptApp _app;
private ParseTree _prevSample;
public virtual string RunSample(RunSampleArgs args)
{
if (_app == null || args.ParsedSample != _prevSample)
_app = new ScriptApp(args.Language);
_prevSample = args.ParsedSample;
//for (int i = 0; i < 1000; i++) //for perf measurements, to execute 1000 times
_app.Evaluate(args.ParsedSample);
return _app.OutputBuffer.ToString();
}
public virtual LanguageRuntime CreateRuntime(LanguageData language)
{
return new LanguageRuntime(language);
}
public override void BuildAst(LanguageData language, ParseTree parseTree)
{
var opHandler = new OperatorHandler(language.Grammar.CaseSensitive);
Util.Check(!parseTree.HasErrors(), "ParseTree has errors, cannot build AST.");
var astContext = new InterpreterAstContext(language, opHandler);
var astBuilder = new AstBuilder(astContext);
astBuilder.BuildAst(parseTree);
}
} //grammar class
}
| mit |
SequencingDOTcom/Weather-My-Way-RTP-App | Android/app/src/main/java/com/sequencing/weather/dagger/EventBusModule.java | 150 | package com.sequencing.weather.dagger;
import dagger.Module;
/**
* Created by omazurova on 5/16/2017.
*/
@Module
public class EventBusModule {
}
| mit |
ddierschow/bamca | bin/ehelps.py | 1639 | #!/usr/local/bin/python
from sprint import sprint as print
import sys
import mbdata
jsfun = '''<SCRIPT LANGUAGE="JavaScript">
<!--
function pick(symbol) {
if (window.opener && !window.opener.closed)
window.opener.document.%s.value = symbol;
window.close();
}
// -->
</SCRIPT>
'''
def countries_help():
if len(sys.argv) > 1:
print(jsfun % sys.argv[1])
print("<table>")
cols = 5
rows = ((len(mbdata.countries) - 1) / cols) + 1
while rows:
print("<tr>")
for col in range(0, cols):
cc = mbdata.countries.pop(0)
if len(sys.argv) > 1:
print('''<td><a href="javascript:pick('%s')">%s</a></td>''' % cc)
else:
print('''<td>%s</td>''' % cc[1])
if not mbdata.countries:
break
print("</tr>")
rows -= 1
print("</table>")
"""
makes_help = '''<SCRIPT LANGUAGE="JavaScript">
<!--
function pick(symbol) {
if (window.opener && !window.opener.closed)
window.opener.document.%s.value = symbol;
window.close();
}
// -->
</SCRIPT>
''' % sys.argv[1]
"""
print("<table>")
cols = 5
rows = ((len(mbdata.countries) - 1) / cols) + 1
while rows:
print("<tr>")
for col in range(0, cols):
cc = mbdata.countries.pop(0)
if len(sys.argv) > 1:
print('''<td><a href="javascript:pick('%s')">%s</a></td>''' % cc)
else:
print('''<td>%s</td>''' % cc[1])
if not mbdata.countries:
break
print("</tr>")
rows -= 1
print("</table>")
| mit |
Avit22/proposal | application/views/kaprodi_ptik/lihat_proposal.php | 2981 | <!DOCTYPE html>
<html lang="en">
<?php $this->view('template/head'); ?>
<body class="nav-md">
<div class="container body">
<div class="main_container">
<?php $this->view('template/sidebar'); ?>
<?php $this->view('template/top'); ?>
<!-- page content -->
<div class="right_col" role="main">
<div class="text-center" style="font-size:30px;">Proposal Terkirim</div><br />
<table id="example" class="table table-bordered table-striped header-fixed ">
<thead>
<tr>
<th>No.</th>
<th>Jenis Proposal</th>
<th>Judul Proposal</th>
<th>Nama PJK</th>
<th>Tanggal Terkirim</th>
<th>View Proposal</th>
<th>Edit Proposal</th>
<th>Hapus Proposal</th>
</tr>
</thead>
<tbody>
<?php $i =1; if(!empty($proposale)) {
foreach($proposale as $proposal) : { ?>
<tr data-toggle="modal" data-target="myModal" class="noExl">
<td><?php echo $i++; ?></td>
<td><?php echo $proposal->urusan; ?></td>
<td><?php echo $proposal->judul; ?></td>
<td><?php echo $proposal->nama_pjk; ?></td>
<td><?php echo $proposal->tgl_input; ?></td>
<td><?php echo anchor("kaprodi_ptik/detail_proposal/detail/$proposal->id_proposal",'<span class="glyphicon glyphicon-file text-primary fa-lg" aria-hidden="true" title="View Proposal"></span>'); ?>
</td>
<td><?php echo anchor("kaprodi_ptik/edit_proposal/edit/".$proposal->id_proposal,'<span class="glyphicon glyphicon-edit text-primary fa-lg" aria-hidden="true" title="Edit Proposal"></span>'); ?>
</td>
<td>
<?php echo anchor("kaprodi_ptik/input/hapus/$proposal->id_proposal",'<span class="glyphicon glyphicon-trash text-danger fa-lg" aria-hidden="true" title="Hapus Proposal"></span>',array('onClick' => "return confirm('Anda yakin data ini akan di HAPUS ?')")); ?>
</td>
</tr>
<?php } endforeach; } ?>
</table>
</div>
<!-- /page content -->
<?php $this->view('template/footer'); ?>
</div>
</div>
<?php $this->view('template/js'); ?>
<script src="<?=base_url()?>asset/datatable/js/jquery-1.11.1.min.js"></script>
<script src="<?=base_url()?>asset/datatable/js/bootstrap.min.js"></script>
<script src="<?=base_url()?>asset/datatable/js/jquery.dataTables.min.js"></script>
<script src="<?=base_url()?>asset/datatable/js/dataTables.bootstrap.js"></script>
<script type="text/javascript">
$(document).ready( function () {
$('#example').dataTable();
} );
</script>
</body>
</html>
| mit |
javulorg/javul | database/migrations/2016_10_06_091902_forum_topic.php | 944 | <?php
use Illuminate\Database\Schema\Blueprint;
use Illuminate\Database\Migrations\Migration;
class ForumTopic extends Migration
{
/**
* Run the migrations.
*
* @return void
*/
public function up()
{
//
Schema::create('forum_topic', function (Blueprint $table) {
$table->increments('topic_id');
$table->string('title',255);
$table->text('desc');
$table->integer('user_id')->unsigned();
$table->integer('unit_id')->unsigned();
$table->string('slug',255);
$table->integer('section_id')->unsigned();
$table->integer('object_id')->unsigned();
$table->dateTime('created_time');
$table->dateTime('modify_time');
});
}
/**
* Reverse the migrations.
*
* @return void
*/
public function down()
{
Schema::drop('forum_topic');
}
}
| mit |
bblais/plasticity | plasticity/dialogs/waxy/demos/FileDialog.py | 2539 | #!/usr/bin/env python
from waxy import *
wildcard = "Python source (*.py)|*.py|" \
"Compiled Python (*.pyc)|*.pyc|" \
"SPAM files (*.spam)|*.spam|" \
"Egg file (*.egg)|*.egg|" \
"All files (*.*)|*.*"
class MainFrame(Frame): # frame has a sizer built in
def Body(self):
self.CenterOnScreen()
self.CreateStatusBar()
self.SetStatusText("This is the statusbar")
menubar = MenuBar(self)
menu1 = Menu(self)
menu1.Append("E&xit", self.CloseWindow, "Exit demo",hotkey="Ctrl+Q")
menubar.Append(menu1, "&File")
b = Button(self, "File OPEN Dialog",self.File1,default=True)
self.AddComponent(b,border=10)
b = Button(self, "File SAVE Dialog",self.File2)
self.AddComponent(b,border=10)
b = Button(self, "File MULTIPLE OPEN Dialog",self.File3)
self.AddComponent(b,border=10)
b = Button(self, "File Dialog (default?)",self.File0)
self.AddComponent(b,border=10)
self.Pack()
self.SetSize((640, 480))
def File1(self,event):
dlg=FileDialog(self,wildcard=wildcard,open=True)
res=dlg.ShowModal()
if res=='ok':
print "Ok: ",dlg.GetChosenFile()
else:
print "Canceled!"
dlg.Destroy()
def File2(self,event):
dlg=FileDialog(self,wildcard=wildcard,save=True)
res=dlg.ShowModal()
if res=='ok':
print "Ok: ",dlg.GetChosenFile()
else:
print "Canceled!"
dlg.Destroy()
def File3(self,event):
dlg=FileDialog(self,wildcard=wildcard,open=True,multiple=True)
res=dlg.ShowModal()
if res=='ok':
print "Ok: ",dlg.GetChosenFile()
else:
print "Canceled!"
dlg.Destroy()
def File0(self,event):
dlg=FileDialog(self,wildcard=wildcard)
res=dlg.ShowModal()
if res=='ok':
print "Ok: ",dlg.GetChosenFile()
else:
print "Canceled!"
dlg.Destroy()
def CloseWindow(self,event):
self.Close()
if __name__=="__main__":
app = Application(MainFrame, title="FileDialog")
app.Run()
| mit |
takuya-takeuchi/Demo | Xamarin.Forms.Portable8/Xamarin.Forms.Portable8/Xamarin.Forms.Portable8.UWP/App.xaml.cs | 4136 | using System;
using System.Collections.Generic;
using System.IO;
using System.Linq;
using System.Runtime.InteropServices.WindowsRuntime;
using Windows.ApplicationModel;
using Windows.ApplicationModel.Activation;
using Windows.Foundation;
using Windows.Foundation.Collections;
using Windows.UI.Xaml;
using Windows.UI.Xaml.Controls;
using Windows.UI.Xaml.Controls.Primitives;
using Windows.UI.Xaml.Data;
using Windows.UI.Xaml.Input;
using Windows.UI.Xaml.Media;
using Windows.UI.Xaml.Navigation;
namespace Xamarin.Forms.Portable8.UWP
{
/// <summary>
/// Provides application-specific behavior to supplement the default Application class.
/// </summary>
sealed partial class App : Windows.UI.Xaml.Application
{
/// <summary>
/// Initializes the singleton application object. This is the first line of authored code
/// executed, and as such is the logical equivalent of main() or WinMain().
/// </summary>
public App()
{
this.InitializeComponent();
this.Suspending += OnSuspending;
}
/// <summary>
/// Invoked when the application is launched normally by the end user. Other entry points
/// will be used such as when the application is launched to open a specific file.
/// </summary>
/// <param name="e">Details about the launch request and process.</param>
protected override void OnLaunched(LaunchActivatedEventArgs e)
{
#if DEBUG
if (System.Diagnostics.Debugger.IsAttached)
{
this.DebugSettings.EnableFrameRateCounter = true;
}
#endif
Windows.UI.Xaml.Controls.Frame rootFrame = Window.Current.Content as Windows.UI.Xaml.Controls.Frame;
// Do not repeat app initialization when the Window already has content,
// just ensure that the window is active
if (rootFrame == null)
{
// Create a Frame to act as the navigation context and navigate to the first page
rootFrame = new Windows.UI.Xaml.Controls.Frame();
rootFrame.NavigationFailed += OnNavigationFailed;
Xamarin.Forms.Forms.Init(e);
if (e.PreviousExecutionState == ApplicationExecutionState.Terminated)
{
//TODO: Load state from previously suspended application
}
// Place the frame in the current Window
Window.Current.Content = rootFrame;
}
if (rootFrame.Content == null)
{
// When the navigation stack isn't restored navigate to the first page,
// configuring the new page by passing required information as a navigation
// parameter
rootFrame.Navigate(typeof(MainPage), e.Arguments);
}
// Ensure the current window is active
Window.Current.Activate();
}
/// <summary>
/// Invoked when Navigation to a certain page fails
/// </summary>
/// <param name="sender">The Frame which failed navigation</param>
/// <param name="e">Details about the navigation failure</param>
void OnNavigationFailed(object sender, NavigationFailedEventArgs e)
{
throw new Exception("Failed to load Page " + e.SourcePageType.FullName);
}
/// <summary>
/// Invoked when application execution is being suspended. Application state is saved
/// without knowing whether the application will be terminated or resumed with the contents
/// of memory still intact.
/// </summary>
/// <param name="sender">The source of the suspend request.</param>
/// <param name="e">Details about the suspend request.</param>
private void OnSuspending(object sender, SuspendingEventArgs e)
{
var deferral = e.SuspendingOperation.GetDeferral();
//TODO: Save application state and stop any background activity
deferral.Complete();
}
}
}
| mit |
Shkyrockett/engine | Engine.Experimental/Physics/Enums/Area.cs | 1229 | // <copyright file="Areas.cs" company="Shkyrockett" >
// Copyright © 2005 - 2020 Shkyrockett. All rights reserved.
// </copyright>
// <author id="shkyrockett">Shkyrockett</author>
// <license>
// Licensed under the MIT License. See LICENSE file in the project root for full license information.
// </license>
// <summary></summary>
// <remarks></remarks>
namespace Engine
{
/// <summary>
/// The areas enum.
/// </summary>
public enum Area
{
/// <summary>
/// The SquareKilometer.
/// </summary>
SquareKilometer,
/// <summary>
/// The Hectare.
/// </summary>
Hectare,
/// <summary>
/// The SquareMeter.
/// </summary>
SquareMeter,
/// <summary>
/// The SquareMile.
/// </summary>
SquareMile,
/// <summary>
/// The Acre.
/// </summary>
Acre,
/// <summary>
/// The SquareYard.
/// </summary>
SquareYard,
/// <summary>
/// The SquaareFoot.
/// </summary>
SquaareFoot,
/// <summary>
/// The SquareInch.
/// </summary>
SquareInch
}
}
| mit |
mipengine/mip-extensions-platform | mip-showcase-icon/mip-showcase-icon.js | 573 | /**
* @file mip-showcase-icon 组件
* @author zhuguoxi
* @description 此组件只为showcase,请勿在正式产品使用。
*/
define(function (require) {
'use strict';
var customElement = require('customElement').create();
// 需要提前显示占位
customElement.prototype.firstInviewCallback = function () {
var me = this;
var ele = me.element;
var type = ele.getAttribute('type');
ele.innerHTML = '<svg class=\'rt-svg-icon\'> <use xlink:href=\'#' + type + '\' /></svg>';
};
return customElement;
});
| mit |
keepkey/device-client | src/transport.ts | 3940 | import ByteBuffer = require('bytebuffer');
const OLD_MESSAGE_HEADER_START = '##';
const MESSAGE_HEADER_START = String.fromCharCode(0x3f) + '##';
export abstract class Transport {
public static MSG_HEADER_LENGTH = 6;
public deviceInUse: boolean = false;
private messageMaps = {};
private messageMap;
private protoBuf;
private pendingWriteQueue = Promise.resolve();
public get deviceId() {
return this.deviceData.deviceId || this.deviceData.device;
}
public get vendorId() {
return this.deviceData.vendorId;
}
public get productId() {
return this.deviceData.productId;
}
protected get hasReportId(): boolean {
return this.deviceData.maxInputReportSize !== 63;
}
protected get reportId() {
return this.hasReportId ? 0 : 63;
}
protected get messageHeaderStart(): string {
return this.hasReportId ? MESSAGE_HEADER_START : OLD_MESSAGE_HEADER_START;
}
constructor(private deviceData) {}
protected abstract _write(message: ByteBuffer): Promise<any>;
protected abstract _read(): Promise<any>;
public setMessageMap(deviceType, proto) {
var msgClass = '', currentMsgClass = '';
if (!this.messageMaps.hasOwnProperty(deviceType)) {
this.messageMaps[deviceType] = {
msgTypeToClass: {},
msgClassToType: {}
};
// cache message maps
for (msgClass in proto.MessageType) {
if (proto.MessageType.hasOwnProperty(msgClass)) {
currentMsgClass = msgClass.replace('MessageType_', '');
this.messageMaps[deviceType].msgClassToType[currentMsgClass] =
proto.MessageType[msgClass];
this.messageMaps[deviceType].msgTypeToClass[proto.MessageType[msgClass]] =
currentMsgClass;
}
}
}
this.messageMap = this.messageMaps[deviceType];
this.protoBuf = proto;
}
public write(txProtoMsg) {
var msgAB = txProtoMsg.encodeAB();
const hash = '#'.charCodeAt(0);
var msgBB = new ByteBuffer(8 + msgAB.byteLength)
.writeByte(hash)
.writeByte(hash)
.writeUint16(this.getMsgType(txProtoMsg.$type.name))
.writeUint32(msgAB.byteLength)
.append(msgAB)
.reset();
console.log('adding message to the queue');
return this.pendingWriteQueue
.then(() => {
console.log('sending message');
return this._write(msgBB);
});
}
public read() {
return this._read()
.then((rxMsg) => {
var trimmedBuffer = ByteBuffer.wrap(
rxMsg.bufferBB.toArrayBuffer().slice(0, rxMsg.header.msgLength));
return this.parseMsg(rxMsg.header.msgType, trimmedBuffer);
});
}
protected parseMsgHeader(msgBB) {
// check for header message start
for (var i = 0,
iMax = this.messageHeaderStart.length; i < iMax; i += 1) {
var next = String.fromCharCode(msgBB.readByte());
if (next !== this.messageHeaderStart[i]) {
throw {
name : 'Error',
message: 'Message header not found'
};
}
}
// unpack header
var msgType = msgBB.readUint16();
var msgLength = msgBB.readUint32();
// reset msg bytebuffer
msgBB.reset();
return {
msgType : msgType,
msgLength: msgLength
};
}
private parseMsg(msgType, msgBB) {
var msgClass = this.getMsgClass(msgType);
return this.protoBuf[msgClass].decode(msgBB);
}
private getMsgType(msgClass) {
if (!this.messageMap.msgClassToType.hasOwnProperty(msgClass)) {
throw {
name : 'Error',
message: 'Cannot find message name.'
};
} else {
return this.messageMap.msgClassToType[msgClass];
}
}
private getMsgClass(msgType) {
if (!this.messageMap.msgTypeToClass.hasOwnProperty(msgType)) {
throw {
name : 'Error',
message: 'Cannot find message id.'
};
} else {
return this.messageMap.msgTypeToClass[msgType];
}
}
}
| mit |
Azure/azure-sdk-for-ruby | management/azure_mgmt_batchai/lib/2018-03-01/generated/azure_mgmt_batchai/models/image_source_registry.rb | 1953 | # encoding: utf-8
# Code generated by Microsoft (R) AutoRest Code Generator.
# Changes may cause incorrect behavior and will be lost if the code is
# regenerated.
module Azure::BatchAI::Mgmt::V2018_03_01
module Models
#
# Details of the container image such as name, URL and credentials.
#
class ImageSourceRegistry
include MsRestAzure
# @return [String] URL for image repository.
attr_accessor :server_url
# @return [String] The name of the image in image repository.
attr_accessor :image
# @return [PrivateRegistryCredentials] Information to access the private
# Docker repository.
attr_accessor :credentials
#
# Mapper for ImageSourceRegistry class as Ruby Hash.
# This will be used for serialization/deserialization.
#
def self.mapper()
{
client_side_validation: true,
required: false,
serialized_name: 'ImageSourceRegistry',
type: {
name: 'Composite',
class_name: 'ImageSourceRegistry',
model_properties: {
server_url: {
client_side_validation: true,
required: false,
serialized_name: 'serverUrl',
type: {
name: 'String'
}
},
image: {
client_side_validation: true,
required: true,
serialized_name: 'image',
type: {
name: 'String'
}
},
credentials: {
client_side_validation: true,
required: false,
serialized_name: 'credentials',
type: {
name: 'Composite',
class_name: 'PrivateRegistryCredentials'
}
}
}
}
}
end
end
end
end
| mit |
waltersoto/brief | Brief/Query.cs | 835 |
using System.Data;
using System.Data.SqlClient;
namespace Brief {
public class Query : Command {
private int timeOut = -1;
public Query() { }
public Query(string queryTxt) {
SqlCommand = new SqlCommand(queryTxt) { CommandType = CommandType.Text };
}
public string Text {
set {
SqlCommand = new SqlCommand(value) { CommandType = CommandType.Text };
if (timeOut > 0) {
SqlCommand.CommandTimeout = timeOut;
}
}
}
public int TimeOut {
set {
if (SqlCommand != null) {
SqlCommand.CommandTimeout = value;
} else {
timeOut = value;
}
}
}
}
}
| mit |
Adrymne/KC3Kai | src/pages/strategy/tabs/lscs/lscs.js | 2537 | (function(){
"use strict";
KC3StrategyTabs.lscs = new KC3StrategyTab("lscs");
KC3StrategyTabs.lscs.definition = {
tabSelf: KC3StrategyTabs.lscs,
/* INIT
Prepares all data needed
---------------------------------*/
init :function(){
},
/* EXECUTE
Places data onto the interface
---------------------------------*/
execute :function(){
var self = this;
// Get pagination
KC3Database.count_lscs(function(NumRecords){
var itemsPerPage = 30;
var numPages = Math.ceil(NumRecords/itemsPerPage);
if(numPages > 0){
$('.pagination').twbsPagination({
totalPages: numPages,
visiblePages: 9,
onPageClick: function (event, page) {
self.tabSelf.definition.showPage( page );
}
});
$('.pagination').show();
}else{
$('.pagination').hide();
$(".tab_lscs .build_list").empty();
}
});
},
showPage :function(pageNumber){
KC3Database.get_lscs(pageNumber, function(response){
$(".tab_lscs .build_list").empty();
var ctr, thisBuild, buildbox;
var shipClickFunc = function(e){
KC3StrategyTabs.gotoTab("mstship", $(this).attr("alt"));
};
for(ctr in response){
thisBuild = response[ctr];
buildbox = $(".tab_lscs .factory .build_item").clone().appendTo(".tab_lscs .build_list");
$(".build_id", buildbox).text( thisBuild.id );
$(".build_ficon img", buildbox).attr("src", KC3Meta.shipIcon(thisBuild.flag) );
$(".build_ficon img", buildbox).attr("alt", thisBuild.flag );
$(".build_ficon img", buildbox).click(shipClickFunc);
$(".build_flag", buildbox).text( KC3Meta.shipName( KC3Master.ship(thisBuild.flag).api_name ) );
$(".build_rsc1", buildbox).text( thisBuild.rsc1 );
$(".build_rsc2", buildbox).text( thisBuild.rsc2 );
$(".build_rsc3", buildbox).text( thisBuild.rsc3 );
$(".build_rsc4", buildbox).text( thisBuild.rsc4 );
$(".build_devmat", buildbox).text( thisBuild.devmat );
$(".build_ricon img", buildbox).attr("src", KC3Meta.shipIcon(thisBuild.result) );
$(".build_ricon img", buildbox).attr("alt", thisBuild.result );
$(".build_ricon img", buildbox).click(shipClickFunc);
$(".build_result", buildbox).text( KC3Meta.shipName( KC3Master.ship(thisBuild.result).api_name ) );
$(".build_time", buildbox).text( (new Date(thisBuild.time*1000)).format("mmm dd, yy - hh:MM tt") );
}
});
}
};
})();
| mit |
davidaq/aq-web-front-node | lib/set.js | 388 | module.exports = set;
function set(arr) {
this.map = {};
if (Array.isArray(arr)) {
for (var i = 0; i < arr.length; i++)
this.add(arr[i]);
}
}
set.prototype.have = function(id) {
return this.map['$$' + id];
};
set.prototype.add = function(id) {
this.map['$$' + id] = 1;
};
set.prototype.remove = function(id) {
delete this.map['$$' + id];
}; | mit |
Patrick-Vogt/bookery | app/Http/Requests/PasswordUpdateRequest.php | 1202 | <?php
namespace App\Http\Requests;
use Illuminate\Foundation\Http\FormRequest;
use Illuminate\Support\Facades\Hash;
use Illuminate\Validation\Validator;
class PasswordUpdateRequest extends FormRequest
{
/**
* Determine if the user is authorized to make this request.
*
* @return bool
*/
public function authorize()
{
return true;
}
/**
* Get the validation rules that apply to the request.
*
* @return array
*/
public function rules()
{
return [
'password_current' => 'required',
'password' => 'required|min:8|confirmed'
];
}
/**
* Configure the validator instance.
*
* @param Validator $validator
* @return void
*/
public function withValidator( Validator $validator)
{
// checks user's current password
// before making password update
$validator->after(function ($validator) {
if ( !Hash::check($this->password_current, $this->user()->password) ) {
$validator->errors()->add('password_current', 'Your current password is incorrect.');
}
});
return;
}
}
| mit |
GKotfis/csharp | generators/Output/TestMethodBodyData.cs | 4035 | using System;
using System.Collections.Generic;
using System.Linq;
using Generators.Input;
namespace Generators.Output
{
public class TestMethodBodyData
{
private const string SutVariableName = "sut";
private const string TestedVariableName = "actual";
private const string ExpectedVariableName = "expected";
private readonly TestMethodBody _testMethodBody;
public TestMethodBodyData(TestMethodBody testMethodBody)
{
_testMethodBody = testMethodBody;
}
public object TestedValue => _testMethodBody.UseVariableForTested ? TestedVariableName : TestedMethodInvocation;
public object InputParameters => _testMethodBody.UseVariablesForInput ? string.Join(", ", CanonicalDataCase.Input.Keys.Select(key => key.ToVariableName())) : Input;
public object ExpectedParameter => _testMethodBody.UseVariableForExpected ? ExpectedVariableName : Expected;
public object ConstructorParameters => _testMethodBody.UseVariablesForConstructorParameters ? string.Join(", ", CanonicalDataCase.ConstructorInput.Keys.Select(key => key.ToVariableName())) : ConstructorInput;
private CanonicalDataCase CanonicalDataCase => _testMethodBody.CanonicalDataCase;
private CanonicalData CanonicalData => _testMethodBody.CanonicalData;
private string TestedClassName => CanonicalData.Exercise.ToTestedClassName();
private string TestedMethodName => CanonicalDataCase.Property.ToTestedMethodName();
private object Input => ValueFormatter.Format(CanonicalDataCase.Input);
private object Expected => ValueFormatter.Format(CanonicalDataCase.Expected);
private object ConstructorInput => ValueFormatter.Format(CanonicalDataCase.ConstructorInput);
private IEnumerable<string> InputVariablesDeclaration => ValueFormatter.FormatVariables(CanonicalDataCase.Input);
private IEnumerable<string> ExpectedVariableDeclaration => ValueFormatter.FormatVariable(CanonicalDataCase.Expected, ExpectedVariableName);
private IEnumerable<string> ConstructorVariablesDeclaration => ValueFormatter.FormatVariables(CanonicalDataCase.ConstructorInput);
private IEnumerable<string> SutVariableDeclaration => new[] { $"var {SutVariableName} = new {TestedClassName}({ConstructorParameters});" };
private IEnumerable<string> ActualVariableDeclaration => new[] { $"var {TestedVariableName} = {TestedMethodInvocation};" };
public IEnumerable<string> Variables
{
get
{
var lines = new List<string>();
if (_testMethodBody.UseVariablesForInput)
lines.AddRange(InputVariablesDeclaration);
if (_testMethodBody.UseVariablesForConstructorParameters)
lines.AddRange(ConstructorVariablesDeclaration);
if (CanonicalDataCase.TestedMethodType == TestedMethodType.Instance)
lines.AddRange(SutVariableDeclaration);
if (_testMethodBody.UseVariableForTested)
lines.AddRange(ActualVariableDeclaration);
if (_testMethodBody.UseVariableForExpected)
lines.AddRange(ExpectedVariableDeclaration);
return lines;
}
}
public string TestedMethodInvocation
{
get
{
switch (CanonicalDataCase.TestedMethodType)
{
case TestedMethodType.Static:
return $"{TestedClassName}.{TestedMethodName}({InputParameters})";
case TestedMethodType.Instance:
return $"{SutVariableName}.{TestedMethodName}({InputParameters})";
case TestedMethodType.Extension:
return $"{InputParameters}.{TestedMethodName}()";
default:
throw new ArgumentOutOfRangeException();
}
}
}
}
} | mit |
codekuangben/Android | Test/TestLibs/Libs/src/main/java/Libs/FrameWork/GlobalEventCmd.java | 192 | package Libs.FrameWork;
/**
* @brief 全局性的事件
*/
public class GlobalEventCmd
{
static public void onSample()
{
}
static public void onEnterWorld()
{
}
} | mit |
Iliyan7/SoftUni-Training | ProgrammingFundamentals/Arrays-Lab/Tripple_Sum/Tripple_Sum.cs | 920 | using System;
using System.Linq;
namespace Tripple_Sum
{
public class Tripple_Sum
{
public static void Main()
{
//long[] numbers = Console.ReadLine().Split(' ').Select(long.Parse).ToArray();
string[] strNumbers = Console.ReadLine().Split(' ');
long[] numbers = strNumbers.Select(long.Parse).ToArray();
bool isNo = true;
for (int a = 0; a < numbers.Length; a++)
{
for (int b = a + 1; b < numbers.Length; b++)
{
long sum = numbers[a] + numbers[b];
if (numbers.Contains(sum))
{
Console.WriteLine("{0} + {1} == {2}", numbers[a], numbers[b], sum);
isNo = false;
}
}
}
if (isNo) Console.WriteLine("No");
}
}
}
| mit |
JadeBuhler/CodeIgniterBlog | application/controllers/Posts.php | 4224 | <?php
/*
* Posts controller
*/
class Posts extends CI_Controller
{
//Handles the display of the posts page.
public function index()
{
$data['title'] = "Latest Posts";
//Retrieves posts from the database using the get_posts() method.
$data['posts'] = $this->Post_model->get_posts();
//Loads the header, index and footer views.
$this->load->view('templates/header');
$this->load->view('posts/index', $data);
$this->load->view('templates/footer');
}
//This function is called when the "Read More" link is clicked.
//In short, this function displays a singular post.
//$Slug: A url to the spceific post.
public function view($slug = null)
{
//Retreives the slug relating to the specified post from the database.
$data['post'] = $this->Post_model->get_posts($slug);
//If the post is empty, IE does not exist...
if(empty($data['post']))
{
//Show a 404 error.
show_404();
}
$data['title'] = $data['post']['title'];
//Loads the header, view and footer views.
$this->load->view('templates/header');
$this->load->view('posts/view', $data);
$this->load->view('templates/footer');
}
//Handles the creation of new posts.
public function create()
{
$data['title'] = "Create Post";
//Retreives the categoires fro the database using the get_categories method.
$data['categories'] = $this->Post_model->get_categories();
//Enforces validation rules on the title and body, making them required fields.
$this->form_validation->set_rules('title', 'Title', 'required');
$this->form_validation->set_rules('post-body', 'Body', 'required');
//If the form validations have not run IE a post has not been submitted yet...
if($this->form_validation->run()=== false)
{
//Loads the header, create and footer views.
$this->load->view('templates/header');
$this->load->view('posts/create', $data);
$this->load->view('templates/footer');
}
else
{
//config settings needed to upload images.
$config['upload_path'] = './assets/images/posts';
$config['allowed_types'] = 'gif|jpg|png';
$config['max_size'] = '2048';
$config['max_width'] = '500';
$config['max_height'] = '500';
//Loads the specified config settings.
$this->load->library('upload', $config);
//If the image was not uploaded...
if (!$this->upload->do_upload())
{
//Capture the error message in the $errors array.
$errors = array('error' => $this->upload->display_errors());
//Set the post image to noimage.png
//noimage.png is a placeholder image for posts without an image.
$post_image = 'noimage.png';
}
else
{
$data = array('upload_data' => $this->upload->data());
//In order for image uploading to work in CodeIgniter the name attribute must be "userfile"
$post_image = $_FILES['userfile']['name'];
}
//Creates the new post using the create_post method.
$this->Post_model->create_post($post_image);
//Redirects the user to the posts page.
redirect('posts');
}
}
//Handles the deletion of posts.
//$id: The id of the post being deleted.
public function delete($id)
{
//Deletes the specified post using the delete_post method.
$this->Post_model->delete_post($id);
//Redirects the user to the posts page.
redirect('posts');
}
//Handles the editing of posts
//$slug: A url to the post being edited.
public function edit($slug)
{
//Loads the specified post.
$data['post'] = $this->Post_model->get_posts($slug);
//Loads the categories.
$data['categories'] = $this->Post_model->get_categories();
//If the specified post does not exist...
if(empty($data['post']))
{
//Show a 404 error.
show_404();
}
$data['title'] = "Edit Post";
//Loads the header, edit and footer views.
$this->load->view('templates/header');
$this->load->view('posts/edit', $data);
$this->load->view('templates/footer');
}
//Handles the submission of an edited post.
public function update()
{
//Updates the post using the update_post method.
$this->Post_model->update_post();
//Redirects the user to the posts page.
redirect('posts');
}
}
?>
| mit |
cgx9/evoflux | src/dispatcher.js | 940 | "use strict";
//source code from:bleeding-edge-sample-app
var Dispatcher = function(){
this.handlers = [];
this.isDispatching = false;
this.pendingPayload = null;
}
Dispatcher.prototype.register = function(cb) {
this.handlers.push({
isPending:false,
isHandled:false,
callback:cb
});
};
Dispatcher.prototype.dispatch = function(payload) {
if(this.isDispatching){
throw new Error("cannot dispatch");
}
this.handlers.forEach(function(handler){
handler.isPending = false,
handler.isHandled = false
})
this.pendingPayload = payload;
this.isDispatching = true;//准备开始调度
try{
this.handlers.forEach(function(handler){
if(!handler.isPending){
handler.isPending = true;
handler.callback(payload);
handler.isHandled = true;
}
})
}finally{
this.isDispatching = false;
this.pendingPayload = null;
}
};
module.exports = new Dispatcher(); | mit |
omeganetresearch/SoNetCMS | assets/core/resources/javascript/ckeditor/plugins/sonet_ajaxsaveas/plugin.js | 678 | /*
Copyright (c) 2003-2010, CKSource - Frederico Knabben. All rights reserved.
For licensing, see LICENSE.html or http://ckeditor.com/license
*/
/**
* @ajaxSaveAs plugin.
*/
CKEDITOR.plugins.add('sonet_ajaxsaveas', {
init: function(editor) {
var pluginName = 'sonet_ajaxsaveas';
editor.addCommand( pluginName, {
exec : function( editor ) {
ajaxSaveAs();
},
canUndo : true
});
editor.ui.addButton('AjaxSaveAs', {
label : "Save As New",
command : pluginName,
icon : "/assets/core/resources/javascript/ckeditor/plugins/sonet_ajaxsaveas/saveas.png"
});
}
}); | mit |
adrilo/headek | app/app.js | 274 | import React from 'react';
import Router from 'react-router';
import routes from './routes';
Router.run(routes, Router.HistoryLocation, function (Root, state) {
var params = state.params;
React.render(<Root params={params} />, document.getElementById('app'));
});
| mit |
interarticle/ssctp | SSCTP.test.cs.cs | 2476 | //
// SimpleSerialCommandTransferProtocol
//
// Copyright (c) 2013 赵迤晨 (Zhao, Yichen) <max.zhaoyichen@gmail.com>
//
// Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions:
//
// The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software.
//
// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
/**
* @file
* Sample SSCTP Test
*
* @author Zhao Yichen <max.zhaoyichen@gmail.com>
* @copyright Copyright (c) 2013 赵迤晨 (Zhao, Yichen) <max.zhaoyichen@gmail.com>
* @license MIT License
*/
using System;
using System.IO;
using System.Diagnostics;
using SimpleSerialCommandTransferProtocol;
using System.Threading;
public class m{
private static Process p;
public static void Main() {
ProcessStartInfo psi = new ProcessStartInfo("ssctp.exe");
psi.RedirectStandardInput = true;
psi.RedirectStandardOutput = true;
psi.UseShellExecute = false;
p = Process.Start(psi);
SSCTP prot = new SSCTP(p.StandardOutput.BaseStream);
prot.CustomCommand += (sender, e) => {
Console.Write(e.CommandID);
foreach (object o in e.Parameters)
{
Console.Write("\t");
Console.Write(o);
}
Console.WriteLine();
};
prot.Error += (sender, e) => {
Console.Write("Error: {0}\n", e.Error);
};
Thread ts = new Thread(Reader);
ts.Start();
prot.RunReadByte();
}
public static void Reader() {
SSCTP prot = new SSCTP(p.StandardInput.BaseStream);
for(;;) {
prot.SendCommand(20, 3.0f, 2.5f);
prot.SendCommand(22, (short) 3, (short) 5);
prot.SendCommand(220, 3.0f, 5.0f);
Thread.Sleep(500);
}
}
} | mit |
bosondata/bosonnlp.py | bosonnlp/exceptions.py | 344 | # -*- coding: utf-8 -*-
from __future__ import absolute_import, division, print_function, unicode_literals
from requests.exceptions import HTTPError
class TaskNotFoundError(HTTPError):
"""任务不存在。"""
class TaskError(HTTPError):
"""分析任务出错。"""
class TimeoutError(Exception):
"""分析任务超时。"""
| mit |
giv2giv/giv2giv-rails | db/migrate/20130921022322_remove_token_pin_from_payment_accounts.rb | 322 | class RemoveTokenPinFromPaymentAccounts < ActiveRecord::Migration
def change
remove_column :payment_accounts, :token if ActiveRecord::Base.connection.column_exists?(:payment_accounts, :token)
remove_column :payment_accounts, :pin if ActiveRecord::Base.connection.column_exists?(:payment_accounts, :pin)
end
end | mit |
Spiddekauga/common-utils | src/main/java/net/_01001111/text/LoremIpsum.java | 5057 | package net._01001111.text;
import java.util.Random;
/*
* Copyright 2010 Oliver C Dodd http://01001111.net Licensed under the MIT license:
* http://www.opensource.org/licenses/mit-license.php
*/
@SuppressWarnings("javadoc")
public class LoremIpsum {
/*
* The Lorem Ipsum Standard Paragraph
*/
protected final String standard = "Lorem ipsum dolor sit amet, consectetur adipisicing elit, sed do eiusmod tempor incididunt ut labore et dolore magna aliqua. Ut enim ad minim veniam, quis nostrud exercitation ullamco laboris nisi ut aliquip ex ea commodo consequat. Duis aute irure dolor in reprehenderit in voluptate velit esse cillum dolore eu fugiat nulla pariatur. Excepteur sint occaecat cupidatat non proident, sunt in culpa qui officia deserunt mollit anim id est laborum.";
private final String[] words = { "a", "ac", "accumsan", "ad", "adipiscing", "aenean", "aliquam", "aliquet", "amet", "ante", "aptent", "arcu",
"at", "auctor", "augue", "bibendum", "blandit", "class", "commodo", "condimentum", "congue", "consectetur", "consequat", "conubia",
"convallis", "cras", "cubilia", "cum", "curabitur", "curae", "cursus", "dapibus", "diam", "dictum", "dictumst", "dignissim", "dis",
"dolor", "donec", "dui", "duis", "egestas", "eget", "eleifend", "elementum", "elit", "enim", "erat", "eros", "est", "et", "etiam", "eu",
"euismod", "facilisi", "facilisis", "fames", "faucibus", "felis", "fermentum", "feugiat", "fringilla", "fusce", "gravida", "habitant",
"habitasse", "hac", "hendrerit", "himenaeos", "iaculis", "id", "imperdiet", "in", "inceptos", "integer", "interdum", "ipsum", "justo",
"lacinia", "lacus", "laoreet", "lectus", "leo", "libero", "ligula", "litora", "lobortis", "lorem", "luctus", "maecenas", "magna",
"magnis", "malesuada", "massa", "mattis", "mauris", "metus", "mi", "molestie", "mollis", "montes", "morbi", "mus", "nam", "nascetur",
"natoque", "nec", "neque", "netus", "nibh", "nisi", "nisl", "non", "nostra", "nulla", "nullam", "nunc", "odio", "orci", "ornare",
"parturient", "pellentesque", "penatibus", "per", "pharetra", "phasellus", "placerat", "platea", "porta", "porttitor", "posuere",
"potenti", "praesent", "pretium", "primis", "proin", "pulvinar", "purus", "quam", "quis", "quisque", "rhoncus", "ridiculus", "risus",
"rutrum", "sagittis", "sapien", "scelerisque", "sed", "sem", "semper", "senectus", "sit", "sociis", "sociosqu", "sodales",
"sollicitudin", "suscipit", "suspendisse", "taciti", "tellus", "tempor", "tempus", "tincidunt", "torquent", "tortor", "tristique",
"turpis", "ullamcorper", "ultrices", "ultricies", "urna", "ut", "varius", "vehicula", "vel", "velit", "venenatis", "vestibulum", "vitae",
"vivamus", "viverra", "volutpat", "vulputate" };
private final String[] punctuation = { ".", "?" };
private final String _n = System.getProperty("line.separator");
private Random random = new Random();
public LoremIpsum() {
}
/**
* Get a random word
*/
public String randomWord() {
return words[random.nextInt(words.length - 1)];
}
/**
* Get a random punctuation mark
*/
public String randomPunctuation() {
return punctuation[random.nextInt(punctuation.length - 1)];
}
/**
* Get a string of words
* @param count - the number of words to fetch
*/
public String words(int count) {
StringBuilder s = new StringBuilder();
while (count-- > 0) {
s.append(randomWord()).append(" ");
}
return s.toString().trim();
}
/**
* Get a sentence fragment
*/
public String sentenceFragment() {
return words(random.nextInt(10) + 3);
}
/**
* Get a sentence
*/
public String sentence() {
// first word
String w = randomWord();
StringBuilder s = new StringBuilder(w.substring(0, 1).toUpperCase()).append(w.substring(1)).append(" ");
// commas?
if (random.nextBoolean()) {
int r = random.nextInt(3) + 1;
for (int i = 0; i < r; i++) {
s.append(sentenceFragment()).append(", ");
}
}
// last fragment + punctuation
return s.append(sentenceFragment()).append(randomPunctuation()).toString();
}
/**
* Get multiple sentences
* @param count - the number of sentences
*/
public String sentences(int count) {
StringBuilder s = new StringBuilder();
while (count-- > 0) {
s.append(sentence()).append(" ");
}
return s.toString().trim();
}
/**
* Get a paragraph
* @useStandard - get the standard Lorem Ipsum paragraph?
*/
public String paragraph(boolean useStandard) {
return useStandard ? standard : sentences(random.nextInt(3) + 2);
}
public String paragraph() {
return paragraph(false);
}
/**
* Get multiple paragraphs
* @param count - the number of paragraphs
* @useStandard - begin with the standard Lorem Ipsum paragraph?
*/
public String paragraphs(int count, boolean useStandard) {
StringBuilder s = new StringBuilder();
while (count-- > 0) {
s.append(paragraph(useStandard)).append(_n).append(_n);
useStandard = false;
}
return s.toString().trim();
}
public String paragraphs(int count) {
return paragraphs(count, false);
}
} | mit |
skipify/vitexframework | vitex/service/model/exception/NotFoundConfigException.php | 128 | <?php
namespace vitex\service\model\exception;
use vitex\core\Exception;
class NotFoundConfigException extends Exception
{
} | mit |
oscarw3/Springies | src/Viscosity.java | 378 | import org.jbox2d.common.Vec2;
public class Viscosity {
double myK =0.4;
public Viscosity(Double k){
this.myK =k;
}
public void setViscosity(double K){
myK = K;
}
@SuppressWarnings("static-access")
protected void applyViscosity(Mass gMass){
gMass.applyForce(new Vec2((float)-myK*(float)gMass.gamespeed, (float)-myK*(float)gMass.gamespeed));
}
}
| mit |
karunasagark/ps | hourRank2/p2.cpp | 362 | #include <iostream>
#include <algorithm>
#define MOD 1000000009
using namespace std;
int main()
{
int n, s = 0, ans = 0; cin >> n;
int f[100000] = {};
for (int m = 3; m < n; m++)
{
s = 0;
for (int i = 1; i < m; i++)
{
s += ( f[i] + f[m - i + 1] ) % MOD;
}
f[m] = s;
ans += s;
}
cout << ans; cin >> n;
return 0;
} | mit |
spazzarama/Direct3D-Rendering-Cookbook | Ch06_01DisplacementMapping_TangentSpace/ConstantBuffers.cs | 3500 | using System;
using System.Collections.Generic;
using System.Linq;
using System.Text;
using System.Threading.Tasks;
using System.Runtime.InteropServices;
using SharpDX;
namespace Ch06_01DisplacementMapping
{
public static class ConstantBuffers
{
/// <summary>
/// Per Object constant buffer (matrices)
/// </summary>
[StructLayout(LayoutKind.Sequential)]
public struct PerObject
{
// WorldViewProjection matrix
public Matrix WorldViewProjection;
// We need the world matrix so that we can
// calculate the lighting in world space
public Matrix World;
// Inverse transpose of World
public Matrix WorldInverseTranspose;
// ViewProjection matrix
public Matrix ViewProjection;
// Inverse of World
public Matrix WorldInverse;
/// <summary>
/// Transpose the matrices so that they are in row major order for HLSL
/// </summary>
internal void Transpose()
{
this.WorldInverse = Matrix.Invert(World);
this.World.Transpose();
this.WorldInverseTranspose.Transpose();
this.WorldViewProjection.Transpose();
this.ViewProjection.Transpose();
this.WorldInverse.Transpose();
}
}
/// <summary>
/// Directional light
/// </summary>
[StructLayout(LayoutKind.Sequential, Pack = 1)]
public struct DirectionalLight
{
public SharpDX.Color4 Color;
public SharpDX.Vector3 Direction;
float _padding0;
}
/// <summary>
/// Per frame constant buffer (camera position)
/// </summary>
[StructLayout(LayoutKind.Sequential, Pack = 1)]
public struct PerFrame
{
public DirectionalLight Light;
public SharpDX.Vector3 CameraPosition;
public float TessellationFactor;
}
/// <summary>
/// Per material constant buffer
/// </summary>
[StructLayout(LayoutKind.Sequential, Pack = 1)]
public struct PerMaterial
{
public Color4 Ambient;
public Color4 Diffuse;
public Color4 Specular;
public float SpecularPower;
public uint HasTexture; // Does the current material have a texture (0 false, 1 true)
public uint HasNormalMap; // Does the current material have a normal map (0 false, 1 true)
public float DisplaceScale;// Scale to apply to displacement map (if there is one)
public Color4 Emissive;
public Matrix UVTransform; // Support UV coordinate transformations
public float DisplaceMidLevel; // Mid-level of displacement/height map
Vector3 _padding0;
}
/// <summary>
/// Per armature/skeleton constant buffer
/// </summary>
public class PerArmature
{
// The maximum number of bones supported
public const int MaxBones = 1024;
public Matrix[] Bones;
public PerArmature()
{
Bones = new Matrix[MaxBones];
}
public static int Size()
{
return Utilities.SizeOf<Matrix>() * MaxBones;
}
}
}
}
| mit |
Nappa9693/elfenben | lib/elfenben.js | 5353 | // Generated by Elfenben v1.0.16
require("./require");
var fs = require("fs"),
path = require("path"),
ls = require("./ls"),
repl = require("./repl"),
watcher = require("./watcher"),
isValidFlag = /-h\b|-r\b|-v\b|-b\b|-s\b/,
error = function(err) {
console.error(err.message);
return process.exit(1);
};
var opt = ((((require('node-getopt')).create([['h', 'help', 'display this help'],
['v', 'version', 'show version'],
['r', 'run', 'run .elf files directly'],
['w', 'watch', 'watch and compile changed files beneath current directory'],
['m', 'map', 'generate source map files'],
['i', 'include-dir=ARG+', 'add directory to include search path']])).setHelp(("elfenben [OPTION] [<infile>] [<outfile>]\n\n" + "<outfile> will default to <infile> with '.js' extension\n\n" + "Also compile stdin to stdout\n" + "eg. $ echo '(console.log \"hello\")' | elfenben\n\n" + "[[OPTIONS]]\n\n"))).bindHelp()).parseSystem();
(function(___monad) {
var mBind = ___monad.mBind,
mResult = ___monad.mResult,
mZero = ___monad.mZero,
mPlus = ___monad.mPlus;
var ____mResult = function(___arg) {
return (((typeof(___arg) === "undefined") && (!(typeof(mZero) === "undefined"))) ?
mZero :
mResult(___arg));
};
return mBind((((opt.argv.length === 0) && ((Object.keys(opt.options)).length === 0)) ?
(function() {
var input = process.stdin;
var output = process.stdout;
input.resume();
input.setEncoding("utf8");
var source = "";
input.on("data",function(chunck) {
source = (source + chunck.toString());
});
input.on("end",function() {
return (function() {
try {
return output.write(ls._compile(source,process.cwd));
} catch (e) {
return (error)(e);
}
})();
});
input.on("error",error);
output.on("error",error);
setTimeout(function() {
return ((input.bytesRead === 0) ?
(function() {
input.removeAllListeners("data");
return repl.runrepl();
})() :
undefined);
},20);
return null;
})() :
undefined),function(noargs) {
return mBind(((true === opt.options['version']) ?
(function() {
console.log(("Version " + ls.version));
return null;
})() :
((true === opt.options['run']) ?
(function() {
var infile = (opt.argv[0] ?
(((opt.argv[0].indexOf('.elf') === -1) && (opt.argv[0].indexOf('.js') === -1)) ?
error(new Error("Error: Input file must have extension '.elf' or '.js'")) :
opt.argv[0]) :
error(new Error("Error: No Input file given")));
require(infile);
return null;
})() :
((true === opt.options['watch']) ?
(function() {
watcher.createAndStartWatcher();
console.log("Watching current directory for changes...");
return null;
})() :
(true ?
true :
undefined)))),function(compile) {
return mBind((opt.argv[0] ?
opt.argv[0] :
error(new Error("Error: No Input file given"))),function(infile) {
return mBind((function() {
var outfile = opt.argv[1];
((!outfile) ?
(function() {
return (function() {
outfile = infile.replace(/\.elf$/,".js");
return ((outfile === infile) ?
error(new Error("Error: Input file must have extension '.elf'")) :
undefined);
})();
})() :
undefined);
return outfile;
})(),function(outfile) {
return (function() {
return ____mResult((function() {
try {
console.log('Elfenben: compiling',infile,'to',outfile);
return fs.writeFileSync(outfile,ls._compile(fs.readFileSync(infile,"utf8"),infile,(true === opt.options['map']),opt.options['include-dir']),"utf8");
} catch (e) {
return (function(err) {
error(err);
return null;
})(e);
}
})());
})();
});
});
});
});
})({
mBind: function(mv,mf) {
return ((mv === null) ?
null :
mf(mv));
},
mResult: function(v) {
return v;
},
mZero: null
});
| mit |
rjurado01/rails_jwt_auth | spec/controllers/invitations_controller_spec.rb | 5628 | require 'rails_helper'
RSpec.describe RailsJwtAuth::InvitationsController do
%w[ActiveRecord Mongoid].each do |orm|
context "Using #{orm}" do
before(:all) { initialize_orm(orm) }
let(:invited_user) { RailsJwtAuth.model.invite email: 'valid@example.com' }
let(:json) { JSON.parse(response.body) }
describe 'GET #show' do
context 'when token is valid' do
it 'returns 204 http status code' do
get :show, params: {id: invited_user.invitation_token}
expect(response).to have_http_status(204)
end
end
context 'when token is invalid' do
it 'returns 404 http status code' do
get :show, params: {id: 'invalid'}
expect(response).to have_http_status(404)
end
end
context 'when token is expired' do
it 'returns 410 http status code' do
travel_to(RailsJwtAuth.invitation_expiration_time.ago - 1.second) do
invited_user
end
get :show, params: {id: invited_user.invitation_token}
expect(response).to have_http_status(410)
end
end
end
describe 'POST #create' do
context 'when user is authenticated' do
before do
allow(subject).to receive(:authenticate!).and_return(true)
end
context 'without passing email as param' do
it 'raises ActiveRecord::ParameterMissing' do
expect { post :create, params: {} }.to raise_error ActionController::ParameterMissing
end
end
let(:email) { 'valid@example.com' }
context 'passing email as param' do
context 'without existing user' do
it 'returns HTTP 201 Created' do
post :create, params: {invitation: {email: 'test@example.com'}}
expect(response).to have_http_status(:no_content)
end
end
context 'with already invited user' do
it 'returns HTTP 201 Created' do
post :create, params: {invitation: {email: invited_user.email}}
expect(response).to have_http_status(:no_content)
end
end
context 'with already registered user' do
let(:registered_user) { FactoryBot.create "#{orm.underscore}_user" }
it 'returns HTTP 422 Unprocessable Entity' do
post :create, params: {invitation: {email: registered_user.email}}
expect(response).to have_http_status(:unprocessable_entity)
end
end
end
end
context 'when user is not authenticated' do
it 'raises RailsJwtAuth::NotAuthorized' do
expect { post :create, params: {} }.to raise_error RailsJwtAuth::NotAuthorized
end
end
end
describe 'PUT #update' do
context 'when invited user' do
context 'with all params' do
before do
put :update, params: {
id: invited_user.invitation_token,
invitation: {password: 'abcdef', password_confirmation: 'abcdef'}
}
end
it 'returns HTTP 204 No content' do
expect(response).to have_http_status(:no_content)
end
it 'updates users password' do
expect(invited_user.password_digest).to_not eq(invited_user.reload.password_digest)
end
it 'deletes the token of the user' do
expect(invited_user.reload.invitation_token).to be_nil
end
end
context 'with invalid token' do
before do
put :update, params: {
id: 'invalid_token',
invitation: {password: 'abcdef', password_confirmation: 'abcdef'}
}
end
it 'returns HTTP 404' do
expect(response).to have_http_status(404)
end
end
context 'without password' do
before do
put :update, params: {
id: invited_user.invitation_token,
invitation: {password: ''}
}
end
it 'returns HTTP 422 with password error' do
expect(response).to have_http_status(422)
expect(json['errors']['password'].first['error']).to eq 'blank'
end
end
context 'with expired invitation' do
it 'returns HTTP 422 Unprocessable Entity' do
id = invited_user.invitation_token
travel_to(3.days.from_now) do
put :update, params: {
id: id,
invitation: {password: 'abcdef', password_confirmation: 'abcdef'}
}
end
expect(response).to have_http_status(:unprocessable_entity)
end
end
context 'with mismatching passwords' do
before do
put :update, params: {
id: invited_user.invitation_token,
invitation: {password: 'abcdef', password_confirmation: ''}
}
end
it 'returns HTTP 422 Unprocessable Entity' do
expect(response).to have_http_status(:unprocessable_entity)
end
it 'the token keeps in the user' do
expect(invited_user.invitation_token).to eq(invited_user.reload.invitation_token)
end
end
end
end
end
end
end
| mit |
Keyang/notebox | tests/nb-u.js | 1335 | var assert = require("assert");
var db = require("../db");
var fs = require("fs");
var dbFile = __dirname + "/testdb";
var d;
var c = require("../core/config");
var note = require("../core/note");
var spawn = require("child_process").spawn;
describe("CLI: update note", function() {
before(function(done) {
d = db.get(dbFile);
db.init(d, function(err) {
done();
});
})
after(function() {
fs.unlinkSync(dbFile);
});
it("should update a note attributes", function(done) {
cli(["n", "-d", dbFile, "-t", "tt,mm", "hello world"], function(buf) {
cli(["u", "1","-d", dbFile, "-t", "ss,dd,mm", "--title", "hi notebox","--nodata"], function(buf) {
var c = cli(["s", "-d", dbFile, "notebox"], function(data) {
assert(data.indexOf("hello") > -1);
assert(data.indexOf("tt") === -1);
assert(data.indexOf("mm") > -1);
assert(data.indexOf("dd") > -1);
done();
})
})
});
});
});
function cli(args, cb) {
var c = spawn(__dirname + "/../cli/nb.js",
args);
var buffer = "";
var e="";
c.stdout.on("data", function(d) {
buffer += d.toString();
});
c.on("exit", function() {
if (e){
console.log(e);
}
cb(buffer);
});
c.stderr.on("data",function(d){
e+=d.toString();
})
return c;
}
| mit |
kevin-montrose/stacman-java | src/com/stackexchange/stacman/FilterType.java | 97 | package com.stackexchange.stacman;
public enum FilterType {
Safe,
Unsafe,
Invalid
}
| mit |
3pillarlabs/hailstorm-sdk | hailstorm-client-exchange/src/main/java/com/tpg/labs/hailstorm/clientexchange/LogEvent.java | 1447 | package com.tpg.labs.hailstorm.clientexchange;
import com.fasterxml.jackson.annotation.JsonIgnore;
import java.time.Duration;
public class LogEvent {
private String projectCode;
private long timestamp;
private int priority;
private String level;
private String message;
private long id;
public String getProjectCode() {
return projectCode;
}
public void setProjectCode(String projectCode) {
this.projectCode = projectCode;
}
public long getTimestamp() {
return timestamp;
}
public void setTimestamp(long timestamp) {
this.timestamp = timestamp;
}
public int getPriority() {
return priority;
}
public void setPriority(int priority) {
this.priority = priority;
}
public String getLevel() {
return level;
}
public void setLevel(String level) {
this.level = level;
}
public String getMessage() {
return message;
}
public void setMessage(String message) {
this.message = message;
}
public long getId() {
return id;
}
public void setId(long id) {
this.id = id;
}
@JsonIgnore
public static LogEvent build(LogEvent original) {
original.setId(original.getTimestamp() * new Double(Math.ceil(Math.random() * 10000)).longValue() +
original.message.hashCode());
return original;
}
}
| mit |
czukowski/CodeGenerator | tests/CodeGenerator/Framework/Testcase.php | 3167 | <?php
/**
* Base testcase class for PHPUnit
*
* @package CodeGenerator
* @category Framework
* @author Korney Czukowski
* @copyright (c) 2012 Korney Czukowski
* @license MIT License
*/
namespace CodeGenerator\Framework;
abstract class Testcase extends \PHPUnit_Framework_TestCase
{
/**
* @var \CodeGenerator\Config
*/
protected $config;
/**
* @var object Tested object instance
*/
protected $object;
/**
* @var \CodeGenerator\Samples
*/
protected $samples;
protected function set_expected_exception_from_argument($expected)
{
if ($expected instanceof \Exception)
{
$this->setExpectedException(get_class($expected));
}
}
/**
* Setup config
*/
protected function setup_config()
{
$this->config = new \CodeGenerator\Config;
}
protected function setup_object($options = array())
{
$options = $this->get_setup_options($options);
$class = $this->get_class_reflection($options['classname']);
$this->object = $class->newInstanceArgs($options['arguments']);
}
protected function setup_mock($options = array())
{
$this->object = $this->get_mock($options);
}
/**
* @return \CodeGenerator\Config
*/
protected function get_config()
{
if ($this->config === NULL)
{
$this->setup_config();
}
return $this->config;
}
protected function get_mock($options = array())
{
$options = $this->get_setup_options($options);
return $this->getMock($options['classname'], $options['methods'], $options['arguments'], $options['mock_classname']);
}
private function get_setup_options($options = array())
{
$options['classname'] = isset($options['classname']) ? $options['classname'] : $this->get_class_name();
$options['methods'] = isset($options['methods']) ? $options['methods'] : $this->get_class_abstract_methods($options['classname']);
$options['arguments'] = isset($options['arguments']) ? $options['arguments'] : $this->get_class_constructor_arguments();
$options['mock_classname'] = isset($options['mock_classname']) ? $options['mock_classname'] : '';
return $options;
}
protected function get_class_abstract_methods($classname)
{
$methods = array();
foreach ($this->get_class_reflection($classname)->getMethods(\ReflectionMethod::IS_ABSTRACT) as $method)
{
$methods[] = $method->getName();
}
return $methods;
}
protected function get_class_constructor_arguments()
{
// No arguments by default
return array();
}
protected function get_class_name()
{
return preg_replace('#Test$#', '', get_class($this));
}
protected function get_class_reflection($classname)
{
return new \ReflectionClass($classname);
}
protected function get_object_method($object, $name)
{
$method = new \ReflectionMethod($object, $name);
$method->setAccessible(TRUE);
return $method;
}
protected function get_object_property($object, $name)
{
$property = new \ReflectionProperty($object, $name);
$property->setAccessible(TRUE);
return $property;
}
protected function get_sample_factory()
{
if ($this->samples === NULL)
{
$this->samples = new \CodeGenerator\Samples($this->get_config());
}
return $this->samples;
}
} | mit |
iplo/Specter | specter/envirementcontroller.py | 119 | import os
def appname():
cwd = os.getcwd()
array = cwd.split('/')
arraylen = len(array)
return array[arraylen - 1] | mit |
christophla/Angular2Skeleton.Node | src/tools/get-webpack-assets.js | 1205 | 'use strict';
/**
* Gathers the web assets from build generated webpack-assets.json
*/
var config = require('./../config/variables');
var path = require('path');
var assetsJsonPath = path.resolve(config.webpack.assetsPath, config.webpack.assetsFilename);
/**
* @type {function}
* @returns {object}
*/
var getWebpackAssets;
var assets;
if (process.env.NODE_ENV === 'production') {
// Require the file only once for efficiency
// Note: like with any other require, you need to restart the server when that file changes
assets = require(assetsJsonPath);
getWebpackAssets = () => {
return assets;
};
} else {
var fs = require('fs');
var chalk = require('chalk');
getWebpackAssets = () => {
// On dev we read the file every time we need it. Not efficient, but easy to work with.
var fileContents = fs.readFileSync(assetsJsonPath).toString();
try {
return JSON.parse(fileContents);
} catch (err) {
console.log(chalk.red('ERROR: Could not parse ' + config.webpack.assetsFilename + ' - maybe webpack is still processing?'));
throw err;
}
};
}
module.exports = getWebpackAssets;
| mit |
reimagined/resolve | examples/ts/personal-data/common/aggregates/blog-post.projection.ts | 439 | import { AggregateProjection } from '@resolve-js/core'
import { BLOG_POST_CREATED, BLOG_POST_DELETED } from '../blog-post.events'
const projection: AggregateProjection = {
Init: () => ({
isExist: false,
}),
[BLOG_POST_CREATED]: (state, { payload: { authorId } }) => ({
...state,
authorId,
isExist: true,
}),
[BLOG_POST_DELETED]: (state) => ({
...state,
isExist: false,
}),
}
export default projection
| mit |
busbud/pongdome | chat/index.js | 9852 | const Table = require('cli-table2')
const fs = require('fs')
const numeral = require('numeral')
const io = require('socket.io-client')
const Stdbot = require('stdbot')
const uuid = require('uuid')
const makeConfig = require('../config')
const debug = require('../debug')('pongdome:chat')
const defaults = require('./config')
const actions = require('./actions')
function getAdapterConfig (config) {
if (config.ADAPTER_CONFIG) return JSON.parse(config.ADAPTER_CONFIG)
if (config.ADAPTER === 'stdbot-flowdock') {
const adapterConfig = { token: config.FLOWDOCK_TOKEN }
if (config.FLOWDOCK_FLOWS) adapterConfig.flows = config.FLOWDOCK_FLOWS.split(',')
if (config.FLOWDOCK_USER === 'true') adapterConfig.streamConfig = { user: true }
return adapterConfig
}
if (config.ADAPTER === 'stdbot-slack') {
const adapterConfig = { token: config.SLACK_TOKEN, threaded: true, asUser: true }
if (config.SLACK_CHANNELS) adapterConfig.channels = config.SLACK_CHANNELS.split(',')
if (config.SLACK_DIRECT) adapterConfig.direct = true
return adapterConfig
}
}
function makeBot (config) {
const adapterConfig = getAdapterConfig(config)
const adapter = require(config.ADAPTER)(adapterConfig)
return Stdbot(adapter)
}
exports.run = function chat (config) {
config = makeConfig(defaults, config)
const bot = makeBot(config)
const api = io(config.API_URL)
// const admins = config.ADMINS ? config.ADMINS.split(',') : []
const challenges = {}
const matchesById = {}
const matchesByThread = {}
function saveState () {
const state = Object.keys(matchesById).map(key => matchesById[key])
fs.writeFileSync(`${__dirname}/state.json`, JSON.stringify(state, null, 2))
}
try {
require('./state')
.map(request => Object.assign({}, request, { message: bot.formatMessage(request.message) }))
.forEach(addRequest)
} catch (e) {}
function findRequestThread (message) {
const request = matchesByThread[message.thread]
if (!request) {
message.send('Could not find a challenge here.')
throw new Error('Could not find a challenge here.')
}
return request
}
function findRequestUser (message) {
const user = message.mentions()[0]
const requests = Object.keys(matchesById)
.map(id => matchesById[id])
.filter(request => {
const isAuthor = request.challenger.id === message.author.id ||
(request.challengee && request.challengee.id === message.author.id)
if (!user) return isAuthor
return isAuthor ||
request.challenger.id === user.id ||
(request.challengee && request.challengee.id === user.id)
})
if (!requests || !requests.length) {
message.send('Could not find a challenge here.')
throw new Error('Could not find a challenge here.')
}
if (user) {
return requests.find(request => {
return (request.challenger.id === user.id && (!request.challenge || request.challengee.id === message.author.id)) ||
((!request.challengee || request.challengee.id === user.id) && request.challenger.id === message.author.id)
})
}
if (requests.length > 1) {
message.send('Multiple possible challenges, please mention your partner.')
throw new Error('Multiple possible challenges, please mention your partner.')
}
return requests.pop()
}
function findRequest (message) {
if (message.thread) return findRequestThread(message)
else return findRequestUser(message)
}
function addRequest (request) {
if (!request.id) request = Object.assign({ id: uuid.v4() }, request)
if (matchesByThread[request.message.thread]) {
request.message.send('There\'s already a challenge here.')
throw new Error('There\'s already a challenge here.')
}
challenges[request.challenger.id] = challenges[request.challenger.id] || []
challenges[request.challenger.id].push(request)
if (request.challengee) {
challenges[request.challengee.id] = challenges[request.challengee.id] || []
challenges[request.challengee.id].push(request)
}
matchesById[request.id] = request
if (request.message.thread) {
matchesByThread[request.message.thread] = request
}
saveState()
return request
}
function removeRequest ({ id, challenger, challengee }) {
if (challenges[challenger.id]) {
challenges[challenger.id] = challenges[challenger.id]
.filter(request => request.id !== id)
}
if (challenges[challengee.id]) {
challenges[challengee.id] = challenges[challengee.id]
.filter(request => request.id !== id)
}
const request = matchesById[id]
delete matchesById[id]
delete matchesByThread[request.message.thread]
saveState()
}
function matchAll (regex, string) {
let match
const results = []
while ((match = regex.exec(string)) != null) results.push(match)
return results
}
const wordBoundary = /[ \n\r\t.,'"+!?-]/
let botState
bot.on('load', state => {
botState = state
})
bot.on('message', message => {
if (message.author.id === botState.self.id) {
return
}
let results = matchAll(/(?:^|[^\w])#(\w+)/g, message.text)
message.mentions = function mentions () {
return bot.mentions(message)
}
// Flowdock specific code: in a flow.
if (message.raw.thread_id) {
// Keep only tags that are actual Flowdock tags (will not match tags
// inside code blocks and alike). Do it only in a flow because those
// are never present in private messages.
results = results.filter(match => message.raw.tags.includes(match[1]))
}
// Flowdock specific code: in a private conversation.
if (message.raw.to) {
// In a private conversation, we can't mention persons, so we need
// an alternative way to find users.
message.mentions = function mentions () {
const matches = message.text.split(wordBoundary)
.filter(word => word.startsWith('@'))
.map(name => name.substr(1))
if (!matches.length) return []
const usersByName = {}
Object.keys(botState.usersById)
.map(id => botState.usersById[id])
.forEach(user => {
usersByName[user.name.toLowerCase()] = user
})
return matches
.map(name => usersByName[name.toLowerCase()])
.filter(user => user)
}
}
if (!results.length) return
const action = results[0][1].toLowerCase()
if (!actions[action]) return
const flags = results.slice(1).map(match => match[1])
const flagsObject = flags.reduce((object, flag) => {
object[flag] = true
return object
}, {})
// Allow everybody to execute admin commands.
const isAdmin = () => true
// const isAdmin = admins
// .map(name => name.toLowerCase())
// .find(name => name === message.author.name.toLowerCase())
debug(`@${message.author.name}: #${action}${message.mentions().map(x => ` @${x.name}`).join('')}${flags.map(x => ` #${x}`).join('')} [${message.thread || 'dm'}]`)
try {
actions[action]({ api, bot, saveState, findRequest, addRequest, removeRequest, challenges, matchesById, matchesByThread, message, flags: flagsObject, isAdmin })
} catch (err) {
debug(err)
}
})
bot.on('error', debug)
api.on('match', ({ match }) => {
if (!matchesById[match.id]) return
const { challenger, challengee, message } = matchesById[match.id]
message.send(`${bot.mention(challenger)} ${bot.mention(challengee)} Game on!`)
})
api.on('queue', ({ match, position }) => {
if (!matchesById[match.id]) return
const { challenger, challengee, message } = matchesById[match.id]
message.send(`${bot.mention(challenger)} ${bot.mention(challengee)} Queued Up! You're ${numeral(position).format('0o')} in the queue.`)
})
api.on('progress', match => {
const request = matchesById[match.id]
if (!request) return
if (!request.message.edit) return
if (match.unranked) return
const table = new Table({
style: { head: [], border: [] }
})
const p1 = match.playerOne
const p2 = match.playerTwo
table.push(
[p1.name, ...p1.games, p1.current],
[p2.name, ...p2.games, p2.current]
)
const liveScore = '```\n' + table.toString() + '\n```'
if (request.progress) {
if (request.progress.then) {
// Most cases, we posted the first live score and can piggy back on
// that promise to make sure we edit the message after it's really
// posted.
request.progress = request.progress.then(message => message.edit(liveScore)).catch(debug)
} else {
// The promise was JSON stringified in the state as empty object, more
// likely PongDome was restarted. This means that we can assume the
// message to be already be posted and just edit it directly without
// checking on the promise.
request.message.edit(liveScore).catch(debug)
}
} else {
request.progress = request.message.send(liveScore).catch(debug)
}
})
api.on('end', ({ match, winner, loser }) => {
if (!matchesById[match.id]) return
const request = matchesById[match.id]
const winnerTotal = winner.games.reduce((a, b) => a + b, 0)
const loserTotal = loser.games.reduce((a, b) => a + b, 0)
request.message.send(`${bot.mention(winner.meta)} beat ${bot.mention(loser.meta)}! ${winnerTotal} points to ${loserTotal} points.`)
removeRequest(request)
})
api.on('cancel', ({ match }) => {
if (!matchesById[match.id]) return
const request = matchesById[match.id]
request.message.send('Game cancelled.')
removeRequest(request)
})
}
if (require.main === module) {
exports.run()
}
| mit |
impraise/omniauth-saml | lib/omniauth-saml/version.rb | 62 | module OmniAuth
module SAML
VERSION = '1.5.0'
end
end
| mit |
ruche7/VoiceroidUtil | VoiceroidUtil/ViewModel/ViewModelBase.cs | 13657 | using System;
using System.ComponentModel;
using System.Linq.Expressions;
using System.Reactive.Disposables;
using System.Reactive.Linq;
using System.Threading.Tasks;
using System.Windows.Input;
using Reactive.Bindings;
using Reactive.Bindings.Extensions;
using RucheHome.Util;
using VoiceroidUtil.Extensions;
using static RucheHome.Util.ArgumentValidater;
namespace VoiceroidUtil.ViewModel
{
/// <summary>
/// ViewModel のベースクラス。
/// </summary>
public abstract class ViewModelBase : IDisposable
{
/// <summary>
/// コンストラクタ。
/// </summary>
protected ViewModelBase()
{
}
/// <summary>
/// デストラクタ。
/// </summary>
~ViewModelBase() => this.Dispose(false);
/// <summary>
/// IDisposable.Dispose をまとめて呼び出すためのコンテナを取得する。
/// </summary>
protected CompositeDisposable CompositeDisposable { get; } =
new CompositeDisposable();
/// <summary>
/// IReactiveProperty{T} オブジェクトの内包オブジェクトのプロパティを対象とする
/// ReactiveProperty{TProperty} オブジェクトを作成する。
/// </summary>
/// <typeparam name="T">
/// 内包オブジェクト。 INotifyPropertyChanged を実装している必要がある。
/// </typeparam>
/// <typeparam name="TProperty">内包オブジェクト内プロパティの型。</typeparam>
/// <param name="owner">IReactiveProperty{T} オブジェクト。</param>
/// <param name="selector">内包オブジェクト内プロパティセレクタ。</param>
/// <param name="canModifyNotifier">
/// 値変更可能状態プッシュ通知。 null を指定すると常に可能となる。
/// </param>
/// <param name="notifyOnSameValue">
/// 同値への変更時にも通知を行うならば true 。
/// </param>
/// <returns>ReactiveProperty{TProperty} オブジェクト。</returns>
protected ReactiveProperty<TProperty> MakeInnerPropertyOf<T, TProperty>(
IReactiveProperty<T> owner,
Expression<Func<T, TProperty>> selector,
IReadOnlyReactiveProperty<bool> canModifyNotifier = null,
bool notifyOnSameValue = false)
where T : INotifyPropertyChanged
=>
owner
.MakeInnerReactiveProperty(selector, canModifyNotifier, notifyOnSameValue)
.AddTo(this.CompositeDisposable);
/// <summary>
/// IReadOnlyReactiveProperty{T} オブジェクトの内包オブジェクトのプロパティを
/// 対象とする ReactiveProperty{TProperty} オブジェクトを作成する。
/// </summary>
/// <typeparam name="T">
/// 内包オブジェクト。 INotifyPropertyChanged を実装している必要がある。
/// </typeparam>
/// <typeparam name="TProperty">内包オブジェクト内プロパティの型。</typeparam>
/// <param name="owner">IReadOnlyReactiveProperty{T} オブジェクト。</param>
/// <param name="selector">内包オブジェクト内プロパティセレクタ。</param>
/// <param name="canModifyNotifier">
/// 値変更可能状態プッシュ通知。 null を指定すると常に可能となる。
/// </param>
/// <param name="notifyOnSameValue">
/// 同値への変更時にも通知を行うならば true 。
/// </param>
/// <returns>ReactiveProperty{TProperty} オブジェクト。</returns>
protected ReactiveProperty<TProperty> MakeInnerPropertyOf<T, TProperty>(
IReadOnlyReactiveProperty<T> owner,
Expression<Func<T, TProperty>> selector,
IReadOnlyReactiveProperty<bool> canModifyNotifier = null,
bool notifyOnSameValue = false)
where T : INotifyPropertyChanged
=>
owner
.MakeInnerReactiveProperty(selector, canModifyNotifier, notifyOnSameValue)
.AddTo(this.CompositeDisposable);
/// <summary>
/// IObservable{T} オブジェクトの内包オブジェクトのプロパティを対象とする
/// ReadOnlyReactiveProperty{TProperty} オブジェクトを作成する。
/// </summary>
/// <typeparam name="T">
/// 内包オブジェクト。 INotifyPropertyChanged を実装している必要がある。
/// </typeparam>
/// <typeparam name="TProperty">内包オブジェクト内プロパティの型。</typeparam>
/// <param name="owner">IObservable{T} オブジェクト。</param>
/// <param name="selector">内包オブジェクト内プロパティセレクタ。</param>
/// <param name="notifyOnSameValue">
/// 同値への変更時にも通知を行うならば true 。
/// </param>
/// <returns>ReadOnlyReactiveProperty{TProperty} オブジェクト。</returns>
protected ReadOnlyReactiveProperty<TProperty>
MakeInnerReadOnlyPropertyOf<T, TProperty>(
IObservable<T> owner,
Expression<Func<T, TProperty>> selector,
bool notifyOnSameValue = false)
where T : INotifyPropertyChanged
=>
owner
.MakeInnerReadOnlyReactiveProperty(selector, notifyOnSameValue)
.AddTo(this.CompositeDisposable);
/// <summary>
/// コマンドを作成する。
/// </summary>
/// <param name="executer">処理デリゲート。</param>
/// <param name="executables">実行可能状態プッシュ通知配列。</param>
/// <returns>コマンド。</returns>
protected ICommand MakeCommand(
Action executer,
params IObservable<bool>[] executables)
=>
this.MakeCommandCore(
(executer == null) ? (Action<object>)null : (_ => executer()),
executables,
e => e.ToReactiveCommand());
/// <summary>
/// コマンドを作成する。
/// </summary>
/// <typeparam name="T">コマンドパラメータ型。</typeparam>
/// <param name="executer">処理デリゲート。</param>
/// <param name="executables">実行可能状態プッシュ通知配列。</param>
/// <returns>コマンド。</returns>
protected ICommand MakeCommand<T>(
Action<T> executer,
params IObservable<bool>[] executables)
=>
this.MakeCommandCore(
executer,
executables,
e => e.ToReactiveCommand<T>());
/// <summary>
/// 非同期実行コマンドを作成する。
/// </summary>
/// <param name="executer">非同期処理デリゲート。</param>
/// <param name="executables">実行可能状態プッシュ通知配列。</param>
/// <returns>非同期実行コマンド。</returns>
protected ICommand MakeAsyncCommand(
Func<Task> executer,
params IObservable<bool>[] executables)
=>
this.MakeAsyncCommandCore(
(executer == null) ? (Func<object, Task>)null : (async _ => await executer()),
executables,
e => e.ToAsyncReactiveCommand());
/// <summary>
/// 非同期実行コマンドを作成する。
/// </summary>
/// <typeparam name="T">コマンドパラメータ型。</typeparam>
/// <param name="executer">非同期処理デリゲート。</param>
/// <param name="executables">実行可能状態プッシュ通知配列。</param>
/// <returns>非同期実行コマンド。</returns>
protected ICommand MakeAsyncCommand<T>(
Func<T, Task> executer,
params IObservable<bool>[] executables)
=>
this.MakeAsyncCommandCore(
executer,
executables,
e => e.ToAsyncReactiveCommand<T>());
/// <summary>
/// 実施可能状態を共有する非同期実行コマンドを作成する。
/// </summary>
/// <param name="sharedExecutable">実行可能状態共有オブジェクト。</param>
/// <param name="executer">非同期処理デリゲート。</param>
/// <returns>非同期実行コマンド。</returns>
protected ICommand MakeSharedAsyncCommand(
IReactiveProperty<bool> sharedExecutable,
Func<Task> executer)
{
ValidateArgumentNull(sharedExecutable, nameof(sharedExecutable));
return
this.MakeAsyncCommandCore(
(executer == null) ?
(Func<object, Task>)null : (async _ => await executer()),
null,
_ => sharedExecutable.ToAsyncReactiveCommand());
}
/// <summary>
/// 実施可能状態を共有する非同期実行コマンドを作成する。
/// </summary>
/// <typeparam name="T">コマンドパラメータ型。</typeparam>
/// <param name="sharedExecutable">実行可能状態共有オブジェクト。</param>
/// <param name="executer">非同期処理デリゲート。</param>
/// <returns>非同期実行コマンド。</returns>
protected ICommand MakeSharedAsyncCommand<T>(
IReactiveProperty<bool> sharedExecutable,
Func<T, Task> executer)
{
ValidateArgumentNull(sharedExecutable, nameof(sharedExecutable));
return
this.MakeAsyncCommandCore(
executer,
null,
_ => sharedExecutable.ToAsyncReactiveCommand<T>());
}
/// <summary>
/// コマンド作成の実処理を行う。
/// </summary>
/// <typeparam name="T">コマンドパラメータ型。</typeparam>
/// <param name="executer">処理デリゲート。</param>
/// <param name="executables">実行可能状態プッシュ通知配列。</param>
/// <param name="commandMaker">コマンド作成デリゲート。</param>
/// <returns>コマンド。</returns>
private ICommand MakeCommandCore<T>(
Action<T> executer,
IObservable<bool>[] executables,
Func<IObservable<bool>, ReactiveCommand<T>> commandMaker)
{
ValidateArgumentNull(executer, nameof(executer));
ValidateArgumentNull(commandMaker, nameof(commandMaker));
var commandExecutable =
(executables == null || executables.Length <= 0) ?
Observable.Return(true) :
executables
.CombineLatestValuesAreAllTrue()
.DistinctUntilChanged()
.ObserveOnUIDispatcher();
var command = commandMaker(commandExecutable).AddTo(this.CompositeDisposable);
command.Subscribe(executer).AddTo(this.CompositeDisposable);
return command;
}
/// <summary>
/// 非同期実行コマンド作成の実処理を行う。
/// </summary>
/// <typeparam name="T">コマンドパラメータ型。</typeparam>
/// <param name="executer">非同期処理デリゲート。</param>
/// <param name="executables">実行可能状態プッシュ通知配列。</param>
/// <param name="commandMaker">コマンド作成デリゲート。</param>
/// <returns>コマンド。</returns>
private ICommand MakeAsyncCommandCore<T>(
Func<T, Task> executer,
IObservable<bool>[] executables,
Func<IObservable<bool>, AsyncReactiveCommand<T>> commandMaker)
{
ValidateArgumentNull(executer, nameof(executer));
ValidateArgumentNull(commandMaker, nameof(commandMaker));
var commandExecutable =
(executables == null || executables.Length <= 0) ?
Observable.Return(true) :
executables
.CombineLatestValuesAreAllTrue()
.DistinctUntilChanged()
.ObserveOnUIDispatcher();
var command = commandMaker(commandExecutable).AddTo(this.CompositeDisposable);
command.Subscribe(executer).AddTo(this.CompositeDisposable);
return command;
}
#region IDisposable の実装
/// <summary>
/// リソースを破棄する。
/// </summary>
public void Dispose()
{
this.Dispose(true);
GC.SuppressFinalize(this);
}
/// <summary>
/// リソース破棄の実処理を行う。
/// </summary>
/// <param name="disposing">
/// Dispose メソッドから呼び出された場合は true 。
/// </param>
protected virtual void Dispose(bool disposing)
{
if (disposing)
{
try
{
this.CompositeDisposable.Dispose();
}
catch (Exception ex)
{
ThreadTrace.WriteException(ex);
}
}
}
#endregion
}
}
| mit |
chvillap/LAComp | src/test/LACompTest.java | 1367 | package test;
import org.junit.AfterClass;
import org.junit.BeforeClass;
import org.junit.Rule;
import org.junit.Test;
import org.junit.rules.ExpectedException;
import org.junit.runner.JUnitCore;
import static org.junit.Assert.assertEquals;
import java.io.IOException;
import comp.LAComp;
/**
* Unit tests for the comp.LAComp class.
*/
public class LACompTest
{
@BeforeClass
public static void init()
{
System.out.println("================================================");
System.out.println("TEST CLASS: comp.LACompTest");
System.out.println("================================================");
}
@Test
public void testReadFile()
{
LAComp compiler = new LAComp();
String path = "testcases/comp/testReadFile.txt";
assertEquals("Line 1\nLine 2\n", compiler.readFile(path));
}
@Test
public void testWriteFile()
{
LAComp compiler = new LAComp();
String path = "testcases/comp/testWriteFile.txt";
compiler.writeFile(path, "Line 1\nLine 2\n");
assertEquals("Line 1\nLine 2\n", compiler.readFile(path));
}
@Test
public void testCompilationSuccess()
{
}
@Test
public void testCompilationFail()
{
}
public static void main(String[] args)
{
JUnitCore.main("test.LACompTest");
}
}
| mit |
kairera0467/TJAP2fPC | FDK17プロジェクト/コード/02.入力/CInput管理.cs | 7517 | using System;
using System.Collections.Generic;
using System.Text;
using System.Diagnostics;
using System.Runtime.InteropServices;
using SlimDX;
using SlimDX.DirectInput;
namespace FDK
{
public class CInput管理 : IDisposable
{
// 定数
public static int n通常音量 = 110;
// プロパティ
public List<IInputDevice> list入力デバイス
{
get;
private set;
}
public IInputDevice Keyboard
{
get
{
if( this._Keyboard != null )
{
return this._Keyboard;
}
foreach( IInputDevice device in this.list入力デバイス )
{
if( device.e入力デバイス種別 == E入力デバイス種別.Keyboard )
{
this._Keyboard = device;
return device;
}
}
return null;
}
}
public IInputDevice Mouse
{
get
{
if( this._Mouse != null )
{
return this._Mouse;
}
foreach( IInputDevice device in this.list入力デバイス )
{
if( device.e入力デバイス種別 == E入力デバイス種別.Mouse )
{
this._Mouse = device;
return device;
}
}
return null;
}
}
// コンストラクタ
public CInput管理( IntPtr hWnd )
{
CInput管理初期化( hWnd, true );
}
public CInput管理( IntPtr hWnd, bool bUseMidiIn )
{
CInput管理初期化( hWnd, bUseMidiIn );
}
public void CInput管理初期化( IntPtr hWnd, bool bUseMidiIn )
{
this.directInput = new DirectInput();
// this.timer = new CTimer( CTimer.E種別.MultiMedia );
this.list入力デバイス = new List<IInputDevice>( 10 );
this.list入力デバイス.Add( new CInputKeyboard( hWnd, directInput ) );
this.list入力デバイス.Add( new CInputMouse( hWnd, directInput ) );
foreach( DeviceInstance instance in this.directInput.GetDevices( DeviceClass.GameController, DeviceEnumerationFlags.AttachedOnly ) )
{
this.list入力デバイス.Add( new CInputJoystick( hWnd, instance, directInput ) );
}
if ( bUseMidiIn )
{
this.proc = new CWin32.MidiInProc( this.MidiInCallback );
uint nMidiDevices = CWin32.midiInGetNumDevs();
Trace.TraceInformation( "MIDI入力デバイス数: {0}", nMidiDevices );
for ( uint i = 0; i < nMidiDevices; i++ )
{
CInputMIDI item = new CInputMIDI( i );
this.list入力デバイス.Add( item );
CWin32.MIDIINCAPS lpMidiInCaps = new CWin32.MIDIINCAPS();
uint num3 = CWin32.midiInGetDevCaps( i, ref lpMidiInCaps, (uint) Marshal.SizeOf( lpMidiInCaps ) );
if ( num3 != 0 )
{
Trace.TraceError( "MIDI In: Device{0}: midiInDevCaps(): {1:X2}: ", i, num3 );
}
else if ( ( CWin32.midiInOpen( ref item.hMidiIn, i, this.proc, 0, 0x30000 ) == 0 ) && ( item.hMidiIn != 0 ) )
{
CWin32.midiInStart( item.hMidiIn );
Trace.TraceInformation( "MIDI In: [{0}] \"{1}\" の入力受付を開始しました。", i, lpMidiInCaps.szPname );
}
else
{
Trace.TraceError( "MIDI In: [{0}] \"{1}\" の入力受付の開始に失敗しました。", i, lpMidiInCaps.szPname );
}
}
}
else
{
Trace.TraceInformation( "DTXVモードのため、MIDI入力は使用しません。" );
}
}
// メソッド
public IInputDevice Joystick( int ID )
{
foreach( IInputDevice device in this.list入力デバイス )
{
if( ( device.e入力デバイス種別 == E入力デバイス種別.Joystick ) && ( device.ID == ID ) )
{
return device;
}
}
return null;
}
public IInputDevice Joystick( string GUID )
{
foreach( IInputDevice device in this.list入力デバイス )
{
if( ( device.e入力デバイス種別 == E入力デバイス種別.Joystick ) && device.GUID.Equals( GUID ) )
{
return device;
}
}
return null;
}
public IInputDevice MidiIn( int ID )
{
foreach( IInputDevice device in this.list入力デバイス )
{
if( ( device.e入力デバイス種別 == E入力デバイス種別.MidiIn ) && ( device.ID == ID ) )
{
return device;
}
}
return null;
}
public void tポーリング( bool bWindowがアクティブ中, bool bバッファ入力を使用する )
{
lock( this.objMidiIn排他用 )
{
// foreach( IInputDevice device in this.list入力デバイス )
for (int i = this.list入力デバイス.Count - 1; i >= 0; i--) // #24016 2011.1.6 yyagi: change not to use "foreach" to avoid InvalidOperation exception by Remove().
{
IInputDevice device = this.list入力デバイス[i];
try
{
device.tポーリング(bWindowがアクティブ中, bバッファ入力を使用する);
}
catch (DirectInputException) // #24016 2011.1.6 yyagi: catch exception for unplugging USB joystick, and remove the device object from the polling items.
{
this.list入力デバイス.Remove(device);
device.Dispose();
Trace.TraceError("tポーリング時に対象deviceが抜かれており例外発生。同deviceをポーリング対象からRemoveしました。");
}
}
}
}
#region [ IDisposable+α ]
//-----------------
public void Dispose()
{
this.Dispose( true );
}
public void Dispose( bool disposeManagedObjects )
{
if( !this.bDisposed済み )
{
if( disposeManagedObjects )
{
foreach( IInputDevice device in this.list入力デバイス )
{
CInputMIDI tmidi = device as CInputMIDI;
if( tmidi != null )
{
CWin32.midiInStop( tmidi.hMidiIn );
CWin32.midiInReset( tmidi.hMidiIn );
CWin32.midiInClose( tmidi.hMidiIn );
Trace.TraceInformation( "MIDI In: [{0}] を停止しました。", new object[] { tmidi.ID } );
}
}
foreach( IInputDevice device2 in this.list入力デバイス )
{
device2.Dispose();
}
lock( this.objMidiIn排他用 )
{
this.list入力デバイス.Clear();
}
this.directInput.Dispose();
//if( this.timer != null )
//{
// this.timer.Dispose();
// this.timer = null;
//}
}
this.bDisposed済み = true;
}
}
~CInput管理()
{
this.Dispose( false );
GC.KeepAlive( this );
}
//-----------------
#endregion
// その他
#region [ private ]
//-----------------
private DirectInput directInput;
private IInputDevice _Keyboard;
private IInputDevice _Mouse;
private bool bDisposed済み;
private List<uint> listHMIDIIN = new List<uint>( 8 );
private object objMidiIn排他用 = new object();
private CWin32.MidiInProc proc;
// private CTimer timer;
private void MidiInCallback( uint hMidiIn, uint wMsg, int dwInstance, int dwParam1, int dwParam2 )
{
int p = dwParam1 & 0xF0;
if( wMsg != CWin32.MIM_DATA || ( p != 0x80 && p != 0x90 ) )
return;
long time = CSound管理.rc演奏用タイマ.nシステム時刻; // lock前に取得。演奏用タイマと同じタイマを使うことで、BGMと譜面、入力ずれを防ぐ。
lock( this.objMidiIn排他用 )
{
if( ( this.list入力デバイス != null ) && ( this.list入力デバイス.Count != 0 ) )
{
foreach( IInputDevice device in this.list入力デバイス )
{
CInputMIDI tmidi = device as CInputMIDI;
if( ( tmidi != null ) && ( tmidi.hMidiIn == hMidiIn ) )
{
tmidi.tメッセージからMIDI信号のみ受信( wMsg, dwInstance, dwParam1, dwParam2, time );
break;
}
}
}
}
}
//-----------------
#endregion
}
}
| mit |
crafn/clover | code/source/physics/world.cpp | 12274 | #include "box2d.hpp"
#include "chunk_util.hpp"
#include "debug/draw.hpp"
#include "draw.hpp"
#include "fluid_mgr.hpp"
#include "global/cfg_mgr.hpp"
#include "ghostlydynamics.hpp"
#include "material.hpp"
#include "object_rigid.hpp"
#include "collision/baseshape_circle.hpp"
#include "collision/baseshape_polygon.hpp"
#include "collision/query.hpp"
#include "util/profiling.hpp"
#include "world.hpp"
namespace clover {
namespace physics {
static constexpr real64 breakImprecision= 0.2;
static util::DynArray<RigidObject*> objectsByRadialField(
util::Vec2d center, real64 mag, real64 hvd){
constexpr real64 min_impulse= 0.1;
real64 rad= hvd*log(mag/min_impulse)/log(2.0);
constexpr real64 max_rad= 20.0;
rad= util::limited(rad, 0.0, max_rad);
collision::CircleBaseShape shape(center, rad);
util::DynArray<RigidObject*> objects;
collision::Query::rigidFixture.potentialRect(
center,
util::Vec2d(rad),
[&](RigidFixture& f) -> bool {
if (f.overlaps(shape))
objects.pushBack(&f.getObject());
return true;
});
return util::duplicatesRemoved(objects);
}
World::World(GridDef grid_def, util::Vec2d gravity, FluidMgr* fluid_mgr)
: grid(grid_def)
, gravity(gravity)
, fluidMgr(fluid_mgr){
box2dWorld= new b2World(toB2(gravity));
box2dWorld->SetContactListener(&contactListener);
}
World::~World(){
delete staticRigidObject; staticRigidObject= nullptr;
delete box2dWorld; box2dWorld= nullptr;
}
void World::init(){
RigidObjectDef def;
def.setStatic(true);
staticRigidObject= new RigidObject(def);
box2dWorld->SetDebugDraw(&global::g_env.debugDraw->getPhysicsDraw());
}
void World::step(real64 dt, int32 vel_iterations, int32 pos_iterations){
PROFILE();
processGhostlyInteractions(contactListener.getGhostlyContacts(), dt);
RigidObject::preStepUpdateForAll();
{ PROFILE();
box2dWorld->Step(dt, vel_iterations, pos_iterations);
}
RigidObject::postStepUpdateForAll();
processBreakingContacts();
}
void World::applyRadialImpulseField(
util::Vec2d center, real64 mag, real64 hvd){
// Impulse formula: I = M*2^(-r/halfvaluedistance)
// Apply field to objects
/// @todo Impulse/damage calculation to take object/field shape into account
for (RigidObject* obj : objectsByRadialField(center, mag, hvd)){
util::Vec2d r= obj->getPosition() - center;
real64 r_len= r.length();
obj->applyImpulse(r.normalized()*mag*pow(2, -r_len/hvd));
}
}
void World::applyRadialStressField(
util::Vec2d center, real64 mag, real64 hvd){
// Stress formula: S = |d/dr I| = M/halfvaluedistance*2^(-r/halfvaluedistance)*log(2)
// Apply field to objects
/// @todo Impulse/damage calculation to take object shape into account
for (RigidObject* obj : objectsByRadialField(center, mag, hvd)){
util::Vec2d r= obj->getPosition() - center;
real64 r_len= r.length();
real64 obj_breakstress= obj->getBreakStress();
if (obj_breakstress < 0.0)
continue;
if (obj->isPartiallyBreakable()){
real64 stress_rad=
hvd*(1 - log(hvd*obj_breakstress/mag)/log(2));
if (stress_rad > 0.01){
collision::Shape break_shp;
break_shp.add(
collision::CircleBaseShape(center, stress_rad));
obj->breakSome(break_shp);
}
}
else {
real64 stress= mag*pow(2, -r_len/hvd)*log(2)/hvd;
if (stress >= obj_breakstress)
obj->setFullyBroken();
}
}
}
void World::addChunk(util::Vec2i chunk_pos, uint32 chunk_width){
ensure(chunk_width == grid.getChunkWidth());
grid.addChunk(chunk_pos);
if (fluidMgr){
util::Vec2i fluid_ch_pos= chunkToFluidChunkPos(chunk_pos);
auto& counter= fluidChunkCounters[fluid_ch_pos];
if (counter == 0)
fluidMgr->addChunk(fluid_ch_pos);
++counter;
}
}
void World::removeChunk(util::Vec2i chunk_pos, uint32 chunk_width){
ensure(chunk_width == grid.getChunkWidth());
grid.removeChunk(chunk_pos);
if (fluidMgr){
util::Vec2i fluid_ch_pos= chunkToFluidChunkPos(chunk_pos);
auto& counter= fluidChunkCounters[fluid_ch_pos];
--counter;
ensure(counter >= 0);
if (counter == 0){
fluidChunkCounters.erase(fluidChunkCounters.find(fluid_ch_pos));
fluidMgr->removeChunk(fluid_ch_pos);
}
}
}
util::DynArray<World::BreakingCollision> World::getBreakingCollisions(
const util::DynArray<PostSolveContact>& contacts){
PROFILE();
/// @todo Solution which works when both are partially breaking
const SizeType max_collisions_for_object= global::g_env.cfg->get("physics::maxBreakingCollisionsForObject", 1);
util::Map<Object*, SizeType> collisions_for_object;
util::DynArray<BreakingCollision> breaking_collisions;
for (const auto& c : contacts){
for (SizeType i= 0; i < 2; ++i){
auto& side= c.getSide(i);
RigidObject& ob= *static_cast<RigidObject*>(NONULL(side.object));
Fixture& fix= *NONULL(side.fixture);
Fixture& other_fix= *NONULL(c.getSide(!i).fixture);
ensure(&fix != &other_fix);
if (ob.isPartiallyBreakable())
continue;
const collision::Shape* shp=
static_cast<RigidFixture*>(&fix)->
getShape();
if (!shp)
continue;
// Could also check for impulse if this is not enough
if (!ob.isAwake())
continue;
SizeType& collisions= collisions_for_object[&ob];
if (collisions > max_collisions_for_object)
continue;
++collisions;
const ContactManifold& mfold= c.getManifold(i);
util::DynArray<util::Polygon> polys=
shp->asUnionPolygons(breakImprecision);
real64 max_poly_rad= 0.0;
for (auto& p : polys){
p.transform(fix.getTransform());
util::Vec2d rad= p.getBoundingRadius();
if (rad.x > max_poly_rad)
max_poly_rad= rad.x;
if (rad.y > max_poly_rad)
max_poly_rad= rad.y;
}
// Obtusion is measured by calculating area inside circle near
// collision point
real64 collision_a= 0.0;
real64 circle_a= 0.0;
real64 circle_rad= 0.0;
{
util::Vec2d center= mfold.averagePoint;
circle_rad= util::limited(max_poly_rad, 0.05, 1.0);
circle_a= util::pi*circle_rad*circle_rad;
util::PolyClipper circle_clip;
circle_clip.addCircleClipper(
center, circle_rad, 1.0/breakImprecision);
circle_clip.addSubjects(polys);
auto clipped_polys= circle_clip.execute(
util::PolyClipper::Intersection);
for (auto& p : clipped_polys)
collision_a += p.getArea();
}
real64 collider_obtusion= collision_a/circle_a;
collider_obtusion= util::limited(collider_obtusion, 0.01, 1.0);
BreakingCollision collision;
collision.collider= &ob;
collision.material= other_fix.getMaterial();
collision.normal= mfold.normal;
// std::min of object impulse and contact impulse solves
// the following problems:
// - Omnisolve-like behavior when stacking objects
// (object impulse ~ zero)
// - ghostly collisions when momentum is changed by e.g. joint
// (contact impulse ~ zero)
/// @todo Take angular impulse into account
collision.impulse=
std::min( ob.getImpulse().translation.length(),
side.totalImpulse.length());
collision.hitPoint= mfold.averagePoint;
collision.obtusionCircleRadius= circle_rad;
collision.colliderObtusion= collider_obtusion;
collision.colliderPolys= std::move(polys);
collision.maxPolyRadius= max_poly_rad;
breaking_collisions.pushBack(collision);
break;
}
}
return breaking_collisions;
}
void World::processBreakingContacts(){
PROFILE();
SizeType max_breaking_collisions= global::g_env.cfg->get<SizeType>("physics::maxBreakingCollisions", 10);
util::DynArray<BreakingCollision> cols=
getBreakingCollisions(contactListener.popBreakingContacts());
if (cols.size() > max_breaking_collisions){
print(debug::Ch::Phys, debug::Vb::Moderate,
"Simultaneous breaking collisions exceeded maximum: %i > %i",
(int32)cols.size(),
(int32)max_breaking_collisions);
}
SizeType i= 0;
for (auto& col : cols){
breakByCollision(col);
++i;
if (i >= max_breaking_collisions)
break;
}
}
void World::breakByCollision(const BreakingCollision& col){
PROFILE();
ensure_msg( !NONULL(col.collider)->isPartiallyBreakable(),
"@todo partially breaking stuff colliding together");
/// @todo Early return if impulse is too small
// Find neighbours with the same material (thinking blocks here)
util::DynArray<RigidFixture*> fixtures;
util::DynArray<RigidObject*> objects;
{ PROFILE();
collision::Query::rigidFixture.potentialRect(
col.hitPoint,
util::Vec2d(col.maxPolyRadius*2.0),
[&](RigidFixture& f) -> bool {
// Can only break fixture if object is ok with that
if ( f.getObject().getBreakStress() <=
col.material->getToughness() &&
f.getMaterial() == col.material){
fixtures.pushBack(&f);
objects.pushBack(&f.getObject());
}
return true;
});
fixtures= util::duplicatesRemoved(fixtures);
objects= util::duplicatesRemoved(objects);
if (objects.empty() || fixtures.empty())
return;
}
// Calculate obtusion from total area covered near hitPoint
real64 obtusion= 0.0;
real64 circle_a= util::pi*pow(col.obtusionCircleRadius, 2);
{ PROFILE();
util::DynArray<util::Polygon> material_polys;
for (const auto& fix : fixtures){
PROFILE();
auto shp_polys= NONULL(fix->getShape())->
asUnionPolygons(breakImprecision);
for (auto& poly : shp_polys){
poly.transform(fix->getTransform());
material_polys.pushBack(std::move(poly));
}
}
util::PolyClipper clipper;
util::Polygon circle=
collision::CircleBaseShape(
col.hitPoint, col.obtusionCircleRadius).
asPolygon(breakImprecision);
clipper.addClipper(circle);
clipper.addSubjects(material_polys);
real64 material_area= 0.0;
auto clipped_polys= clipper.execute(util::PolyClipper::Intersection);
for (auto& p : clipped_polys)
material_area += p.getArea();
real64 material_obtusion= material_area/circle_a;
obtusion= std::min(material_obtusion, col.colliderObtusion);
obtusion= util::limited(obtusion*2.0, 0.01, 1.0);
if (material_obtusion <= util::epsilon)
return;
}
// Calculate penetration of the collider
real64 penetration= 0.0;
{ PROFILE();
/// @todo Add other properties like density and restitution to the mix
// util::Map obstusion [0, 1] -> col_area [0, inf)
real64 col_area= obtusion*sqrt(circle_a)/(1.0 - obtusion);
real64 impulse_grad= col.impulse/col_area;
if (impulse_grad < col.material->getToughness())
return;
penetration= pow(impulse_grad/col.material->getToughness(), 0.2) - 1.0;
penetration= std::min(penetration, col.obtusionCircleRadius*0.5);
}
// Cut from breaking material
{ PROFILE();
// Cut hole
collision::Shape cut_shp;
util::DynArray<util::Polygon> cutters= col.colliderPolys;
for (auto& p : cutters){
p.translate(col.normal*penetration);
cut_shp.add(collision::PolygonBaseShape(p.getVertices()));
}
for (auto& obj : objects){
obj->breakSome(cut_shp);
}
// Smooth surroundings
/// @todo Should depend on toughness
real64 smooth_amount= 0.7;
real64 simplify_amount= 0.2;
real64 smooth_radius= col.obtusionCircleRadius*1.5;
global::g_env.debugDraw->addFilledCircle(col.hitPoint, smooth_radius);
util::PolyClipper clipper;
for (auto& obj : objects){
for (auto& fix : obj->getRigidFixtures()){
const collision::Shape* shp= fix->getShape();
if (!shp)
continue;
auto polys= shp->asPolygons(breakImprecision);
for (auto& p : polys){
p.transform(obj->getTransform());
// Make sure that neighbouring blocks really overlap
p.offset(0.01);
}
clipper.addSubjects(polys);
}
}
auto material_polys= clipper.execute(util::PolyClipper::Union);
for (auto& p : material_polys){
p.simplify(col.hitPoint, smooth_radius, simplify_amount*simplify_amount);
p.smooth(col.hitPoint, smooth_radius, smooth_amount);
}
collision::Shape smoothed;
for (auto& p : material_polys){
smoothed.add(collision::PolygonBaseShape(p.getVertices()));
}
for (auto& obj : objects){
obj->breakSome(smoothed, true);
}
}
/// @todo Collider should have some of its momentum back
}
util::Vec2i World::chunkToFluidChunkPos(util::Vec2i chunk_pos) const {
if (!fluidMgr)
return util::Vec2i{};
util::Vec2d world_pos= (chunk_pos*grid.getChunkWidth()).casted<util::Vec2d>();
return chunkVec(world_pos, fluidMgr->getChunkSize());
}
} // physics
} // clover
| mit |
abecede753/trax | website/events/pitassistant_views.py | 1474 | import os
from django.conf import settings
from django.contrib import messages
from django import forms
from django.contrib.auth.decorators import login_required
from django.http import Http404
from django.http import HttpResponseRedirect
from django.http import JsonResponse
from django.urls import reverse
from django.utils.decorators import method_decorator
from django.shortcuts import get_object_or_404, render
from django.views.decorators.cache import never_cache
from django.views.generic import CreateView, DetailView
from trax.choices import RACE_STATES
from .models import PitAssistant
class PitACreateForm(forms.ModelForm):
class Meta:
model = PitAssistant
fields = ['title', 'description', 'pitstop_seconds']
@method_decorator(login_required, name='dispatch')
class PitAssistantCreator(CreateView):
model = PitAssistant
form_class = PitACreateForm
def form_valid(self, form):
form.instance.owner = self.request.user
form.instance.save()
self.init_filesystem(form.instance)
return super().form_valid(form)
def init_filesystem(self, instance):
dirname = os.path.abspath(
os.path.join(
settings.MEDIA_ROOT, 'pitassistant',
'{0}'.format(instance.pk)
))
os.makedirs(dirname, mode=0o755, exist_ok=True)
@method_decorator(login_required, name='dispatch')
class PitAssistantDetail(DetailView):
model = PitAssistant
| mit |
bSchnepp/PathToolKit | PathToolKit/event/event.cpp | 568 | /*
* event.cpp
*
* Created on: Feb 19, 2017
* Author: Brian Schnepp
* License: See 'LICENSE' in root of this repository.
*/
#include "event.h"
#include "../component.h"
#include "xcb/xcb.h"
namespace PathEvent
{
Event::Event() :
Event::Event(nullptr)
{
}
Event::Event(PathDraw::Component* source)
{
this->source = source;
PF_KeyDown_t* keys = new PF_KeyDown_t; //TODO
this->keysDown = keys;
}
Event::~Event()
{
delete this->keysDown;
/* We do NOT delete the component, because it could still be in use. */
}
} /* namespace Pathfinder */
| mit |
danmayer/travel_calculator | db/migrate/20150125192515_rename_destination_options.rb | 176 | class RenameDestinationOptions < ActiveRecord::Migration
def change
add_column :destinations, :default_options, :text
remove_column :destinations, :options
end
end
| mit |
AlgusDark/bloomer | test/components/Panel/Panel.test.tsx | 868 | import * as React from 'react';
import { shallow } from 'enzyme';
import { Panel } from './../../../src/components/Panel/Panel';
describe('Panel', () => {
it('should render a nav with .panel', () => {
const component = shallow(<Panel>My Panel</Panel>);
expect(component.contains(<nav className='panel'>My Panel</nav>)).toBe(true);
});
it('should render a div with .panel', () => {
const component = shallow(<Panel tag='div'>My Panel</Panel>);
expect(component.contains(<div className='panel'>My Panel</div>)).toBe(true);
});
it('should render a nav with .panel and custom classNames', () => {
const component = shallow(<Panel className='custom'><span>Any Content</span></Panel>);
expect(component.hasClass('panel')).toBe(true);
expect(component.hasClass('custom')).toBe(true);
});
}); | mit |
codequest-eu/busy_bunny | spec/subscriber_spec.rb | 1683 | require 'spec_helper'
module BusyBunny # rubocop:disable Style/Documentation
describe Subscriber do
let(:channel) { double('channel') }
let(:queue) { double('queue') }
let(:thread) { double('thread') }
subject { MockSubscriber.new(channel, queue, thread) }
describe '#run_forever' do
before { expect(Thread).to receive(:new).and_return(thread) }
it 'succeeds' do
expect { subject.run_forever }.not_to raise_error
end
end # describe '#run_forever'
describe '#join' do
before { expect(thread).to receive(:join) }
it 'works' do
expect { subject.join }.not_to raise_error
end
end # describe '#join'
describe '#handle' do
it 'raises NotImplementedError' do
expect { subject.handle(nil) }.to raise_error NotImplementedError
end
end # describe '#handle'
describe '#run' do # NOTE: testing private method
before { expect(queue).to receive(:subscribe).with(instance_of(Hash)) }
it 'works' do
expect { subject.send(:run) }.not_to raise_error
end
end # describe '#run'
describe '#run_one' do # # NOTE: testing private method
let(:delivery_tag) { 'tag' }
let(:delivery_info) { double('del_info', delivery_tag: delivery_tag) }
let(:request) { 'request' }
before do
expect(subject).to receive(:handle).with(request)
expect(channel).to receive(:ack).with(delivery_tag)
end
it 'works' do
expect { subject.send(:run_one, delivery_info, nil, request) }
.to_not raise_error
end
end # describe '#run_one'
end # describe Subscriber
end # module BusyBunny
| mit |
vishaltelangre/hygien | lib/hygien/config_validator.rb | 3114 | class Hygien::ConfigValidator
def initialize(config = {})
@config = config
validate
end
def verified
@config
end
private
def validate
# check root-level keys
validate_root_level_keys(@config.keys)
# check keys under db_config
validate_db_config_keys(@config[:db_config].keys)
# check connection section
validate_connection_section(@config[:db_config][:connection])
# check columns section
validate_columns_section(@config[:db_config][:columns])
end
def validate_root_level_keys(keys)
must_keys = [:db_config]
raise Hygien::InvalidConfigError, "#{must_keys} key(s) are required to specify in config file" if compare_keys(must_keys, keys).any?
end
def validate_db_config_keys(keys)
must_keys = [:connection, :tables, :columns]
raise Hygien::InvalidConfigError, "'#{must_keys}' key(s) are required to specify in config file under `db_config` section" if compare_keys(must_keys, keys).any?
end
def validate_connection_section(connection_config)
must_keys = [:kind]
raise Hygien::InvalidConfigError, "'#{must_keys.join(', ')}' key(s) are required to specify in config file under `db_config -> connection` section" if compare_keys(must_keys, connection_config.keys).any?
assign_adapter!(connection_config)
validate_adapter_keys(connection_config)
end
def validate_columns_section(columns_config)
allowed_column_types = %w{ mobile_number phone_number email }
raise Hygien::InvalidConfigError, "column names are required along with type keys in config file under `db_config` section" unless columns_config.keys.any?
types = columns_config.values.map(&:values).flatten.uniq
unknown_column_types = compare_keys(types, allowed_column_types)
if unknown_column_types.any?
raise Hygien::UnknownColumnTypeError, "unknown column types: #{unknown_column_types}"
end
end
def assign_adapter!(connection_config)
db_kind = connection_config.delete(:kind)
adapter = Hygien::ConnectionManager
.supported_adapters
.select { |adptr| adptr[:identifiers].include? db_kind }
.first
raise Hygien::UnsupportedDatabaseError, "database kind '#{db_kind}' is currently not supported" if adapter.nil?
connection_config.merge!({ adapter: adapter[:name] })
end
def validate_adapter_keys(connection_config)
adapter_name = connection_config[:adapter]
adapter_keys = connection_config.except(:adapter).keys
adapter_must_keys = Hygien::ConnectionManager
.supported_adapters
.select { |adptr| adptr[:name].include? adapter_name }
.first[:must_keys]
if compare_keys(adapter_must_keys, adapter_keys).any?
raise Hygien::InsufficientConnectionSettingsError, "'#{adapter_must_keys.join(', ')}' key(s) are required to specify in config file under `db_config -> connection` section for #{adapter_name} database"
end
end
# Returns elements from `arr1` which are not present in `arr2`
def compare_keys(arr1, arr2)
arr1 - arr2
end
end
| mit |
diasks2/confidential_info_redactor | lib/confidential_info_redactor/extractor.rb | 3325 | require 'confidential_info_redactor/word_lists'
module ConfidentialInfoRedactor
# This class extracts proper nouns from a text
class Extractor
# Rubular: http://rubular.com/r/qE0g4r9zR7
EXTRACT_REGEX = /(?<=\s|^|\s\"|\s\“|\s\«|\s\‹|\s\”|\s\»|\s\›)([A-Z]\S*\s)*[A-Z]\S*(?=(\s|\.|\z))|(?<=\s|^|\s\"|\s\”|\s\»|\s\›|\s\“|\s\«|\s\‹)[i][A-Z][a-z]+/
PUNCTUATION_REGEX = /[\?\)\(\!\\\/\"\:\;\,\”\“\«\»\‹\›]/
attr_reader :language, :corpus
def initialize(**args)
@language = args[:language] || 'en'
case @language
when 'en'
@corpus = ConfidentialInfoRedactor::WordLists::EN_WORDS
when 'de'
@corpus = ConfidentialInfoRedactor::WordLists::DE_WORDS
else
@corpus = ConfidentialInfoRedactor::WordLists::EN_WORDS
end
end
def extract(text)
extracted_terms = []
PragmaticSegmenter::Segmenter.new(text: text.gsub(/[’‘]/, "'"), language: language).segment.each do |segment|
initial_extracted_terms = extract_preliminary_terms(segment)
search_ngrams(initial_extracted_terms, extracted_terms)
end
extracted_terms.map { |t| t.gsub(/\{\}/, '') }.delete_if { |t| t.length == 1 }.uniq.reject(&:empty?)
end
private
def extract_preliminary_terms(segment)
segment.to_s.gsub(EXTRACT_REGEX).map { |match| match unless corpus.include?(match.downcase.gsub(PUNCTUATION_REGEX, '').gsub(/\'$/, '')) }.compact
end
def clean_token(token)
token.gsub(PUNCTUATION_REGEX, '').gsub(/\'$/, '').gsub(/\.\z/, '').strip
end
def non_confidential_token?(token, includes_confidential)
corpus.include?(token) || !includes_confidential || singular_in_corpus?(token)
end
def singular_in_corpus?(token)
corpus.include?(token[0...-1]) &&
token[-1].eql?('s') ||
corpus.include?(token[0...-2]) && token[-2..-1].eql?('en') ||
corpus.include?(token[0...-2]) && token[-2..-1].eql?('es') ||
corpus.include?(token[0...-2]) && token[-2..-1].eql?('er') ||
corpus.include?(token[0...-1]) && token[-1].eql?('n')
end
def includes_confidential?(token)
token.split(' ').map { |t| return false if corpus.include?(t.downcase) } unless token.split(' ').length.eql?(2) && token.split(' ')[1].downcase.eql?('bank')
true
end
def matching_first_token?(tokens)
corpus.include?(tokens[0]) &&
tokens[0] != 'the' &&
tokens[0] != 'deutsche' &&
tokens.length.eql?(2)
end
def find_extracted_terms(string, extracted_terms)
cleaned_token_downcased = clean_token(string.downcase)
cleaned_token = clean_token(string)
tokens = cleaned_token_downcased.split(' ')
if matching_first_token?(tokens)
extracted_terms << cleaned_token.split(' ')[1] unless corpus.include?(tokens[1])
else
extracted_terms << cleaned_token unless non_confidential_token?(cleaned_token_downcased, includes_confidential?(cleaned_token))
end
extracted_terms
end
def search_ngrams(tokens, extracted_terms)
tokens.each do |ngram|
ngram.split(PUNCTUATION_REGEX).each do |t|
next if !(t !~ /.*\d+.*/)
extracted_terms = find_extracted_terms(t, extracted_terms)
end
end
end
end
end
| mit |
aserg-ufmg/RefDiff | refdiff-java/src/main/java/refdiff/parsers/java/Visibility.java | 230 | package refdiff.parsers.java;
public enum Visibility {
PUBLIC,
PRIVATE,
PROTECTED,
PACKAGE;
@Override
public String toString() {
return this.name().toLowerCase();
}
}
| mit |