repo_name
stringlengths
4
116
path
stringlengths
4
379
size
stringlengths
1
7
content
stringlengths
3
1.05M
license
stringclasses
15 values
dibu13/TxAndpu_Engine
TxAndpu_Engine/TxAndpu_Engine/ModuleCamera3D.cpp
4109
#include "Globals.h" #include "Application.h" #include "ModuleCamera3D.h" #include "ModuleInput.h" ModuleCamera3D::ModuleCamera3D(bool startEnabled) : Module(startEnabled) { LOG("Camera3D: Creation."); calculateViewMatrix(); X = vec3(1.0f, 0.0f, 0.0f); Y = vec3(0.0f, 1.0f, 0.0f); Z = vec3(0.0f, 0.0f, 1.0f); position = vec3(1.0f, 1.0f, 0.0f); reference = vec3(0.0f, 0.0f, 0.0f); } ModuleCamera3D::~ModuleCamera3D() { LOG("Camera3D: Destroying."); } // ----------------------------------------------------------------- bool ModuleCamera3D::start() { LOG("Camera3D: Start."); LOG("Setting up the camera"); bool ret = true; X = vec3(1.0f, 0.0f, 0.0f); Y = vec3(0.0f, 1.0f, 0.0f); Z = vec3(0.0f, 0.0f, 1.0f); position = vec3(2.0f, 3.0f, 2.0f); reference = vec3(0.0f, 0.0f, 0.0f); //TMP app->camera->move(vec3(5.0f, 1.0f, 0.0f)); app->camera->lookAt(vec3(0, 0, 0)); return ret; } // ----------------------------------------------------------------- bool ModuleCamera3D::cleanUp() { LOG("Camera3D: CleanUp."); return true; } // ----------------------------------------------------------------- update_status ModuleCamera3D::update(float dt) { vec3 newPos(0, 0, 0); float speed = 25.0f * dt; if (app->input->getKey(SDL_SCANCODE_LSHIFT) == KEY_REPEAT) speed = 8.0f * dt; if (app->input->getKey(SDL_SCANCODE_R) == KEY_REPEAT) newPos.y += speed; if (app->input->getKey(SDL_SCANCODE_F) == KEY_REPEAT) newPos.y -= speed; if (app->input->getKey(SDL_SCANCODE_W) == KEY_REPEAT) newPos -= Z * speed; if (app->input->getKey(SDL_SCANCODE_S) == KEY_REPEAT) newPos += Z * speed; if (app->input->getKey(SDL_SCANCODE_A) == KEY_REPEAT) newPos -= X * speed; if (app->input->getKey(SDL_SCANCODE_D) == KEY_REPEAT) newPos += X * speed; position += newPos; reference += newPos; // Mouse motion ---------------- if (app->input->getMouseButton(SDL_BUTTON_RIGHT) == KEY_REPEAT) { int dx = -app->input->getMouseXMotion(); int dy = -app->input->getMouseYMotion(); float Sensitivity = 0.25f; position -= reference; if (dx != 0) { float DeltaX = (float)dx * Sensitivity; X = rotate(X, DeltaX, vec3(0.0f, 1.0f, 0.0f)); Y = rotate(Y, DeltaX, vec3(0.0f, 1.0f, 0.0f)); Z = rotate(Z, DeltaX, vec3(0.0f, 1.0f, 0.0f)); } if (dy != 0) { float DeltaY = (float)dy * Sensitivity; Y = rotate(Y, DeltaY, X); Z = rotate(Z, DeltaY, X); if (Y.y < 0.0f) { Z = vec3(0.0f, Z.y > 0.0f ? 1.0f : -1.0f, 0.0f); Y = cross(Z, X); } } position = reference + Z * length(position); } // Recalculate matrix ------------- calculateViewMatrix(); return UPDATE_CONTINUE; } // ----------------------------------------------------------------- void ModuleCamera3D::look(const vec3 &_position, const vec3 &_reference, bool rotateAroundReference) { this->position = _position; this->reference = _reference; Z = normalize(position - reference); X = normalize(cross(vec3(0.0f, 1.0f, 0.0f), Z)); Y = cross(Z, X); if (!rotateAroundReference) { this->reference = this->position; this->position += Z * 0.05f; } calculateViewMatrix(); } // ----------------------------------------------------------------- void ModuleCamera3D::lookAt( const vec3 &_spot) { reference = _spot; Z = normalize(position - reference); X = normalize(cross(vec3(0.0f, 1.0f, 0.0f), Z)); Y = cross(Z, X); calculateViewMatrix(); } // ----------------------------------------------------------------- void ModuleCamera3D::move(const vec3 &_movement) { position += _movement; reference += _movement; calculateViewMatrix(); } void ModuleCamera3D::setPos(const vec3 &_pos) { position = _pos; lookAt(reference); } // ----------------------------------------------------------------- float* ModuleCamera3D::getViewMatrix() { return &viewMatrix; } // ----------------------------------------------------------------- void ModuleCamera3D::calculateViewMatrix() { viewMatrix = mat4x4(X.x, Y.x, Z.x, 0.0f, X.y, Y.y, Z.y, 0.0f, X.z, Y.z, Z.z, 0.0f, -dot(X, position), -dot(Y, position), -dot(Z, position), 1.0f); viewMatrixInverse = inverse(viewMatrix); }
mit
DkoSoftware/WebPlataform
FamintusApi/Areas/HelpPage/SampleGeneration/TextSample.cs
887
using System; namespace FamintusApi.Areas.HelpPage { /// <summary> /// This represents a preformatted text sample on the help page. There's a display template named TextSample associated with this class. /// </summary> public class TextSample { public TextSample(string text) { if (text == null) { throw new ArgumentNullException("text"); } Text = text; } public string Text { get; private set; } public override bool Equals(object obj) { TextSample other = obj as TextSample; return other != null && Text == other.Text; } public override int GetHashCode() { return Text.GetHashCode(); } public override string ToString() { return Text; } } }
mit
willdurand/Propilex
src/Propilex/View/Endpoint.php
58
<?php namespace Propilex\View; final class Endpoint { }
mit
GerMarS/gmk-user-role-test
application/models/users_model.php
3897
<?php if ( ! defined('BASEPATH')) exit('No direct script access allowed'); class users_model extends CI_Model { function __construct() { // Call the Model constructor parent::__construct(); } function get_users_and_roles() { $query = $this->db->query("select * from users"); $user_list = []; foreach ($query->result() as $row) { $query_roles = $this->db->query("select * from user_role where user_id =".$row->user_id); $roles_list = []; foreach ($query_roles->result() as $row_role) $roles_list[] = $row_role->role_id; $user_list[] = [ 'user_id' => $row->user_id, 'name' => $row->name, 'email' => $row->email, 'phone' => $row->phone, 'age' => $row->age, 'roles' => $roles_list, ]; } return $user_list; } function get_roles() { $query = $this->db->query("select * from roles"); $roles = []; foreach ($query->result() as $row) $roles[$row->role_id] = $row->role; return $roles; } function get_user_list() { $query = $this->db->query("select email from users"); $users = []; foreach ($query->result() as $row) $users[] = $row->email; return $users; } function get_user_id($email) { $sql = "select user_id from users where email = " . $this->db->escape($email); $query = $this->db->query($sql); $row = $query->row(); if (!empty($row->user_id)) return $row->user_id; return 0; } function can_read($email) { $sql = "select * from users as u inner join user_role as ur using (user_id) inner join roles as r using (role_id) where r.r = 1 and email = ". $this->db->escape($email); $query = $this->db->query($sql); if (!empty($query->num_rows())) return true; return false; } function can_create($email) { $sql = "select * from users as u inner join user_role as ur using (user_id) inner join roles as r using (role_id) where r.c = 1 and email = ". $this->db->escape($email); $query = $this->db->query($sql); if (!empty($query->num_rows())) return true; return false; } function can_update($email) { $sql = "select * from users as u inner join user_role as ur using (user_id) inner join roles as r using (role_id) where r.u = 1 and email = ". $this->db->escape($email); $query = $this->db->query($sql); if (!empty($query->num_rows())) return true; return false; } function can_delete($email) { $sql = "select * from users as u inner join user_role as ur using (user_id) inner join roles as r using (role_id) where r.d = 1 and email = ". $this->db->escape($email); $query = $this->db->query($sql); if (!empty($query->num_rows())) return true; return false; } function create_user($user, $roles) { try { $this->db->insert('users', $user); $user_id = $this->db->insert_id(); foreach ($roles as $role) { $data_roles = [ 'user_id' => $user_id, 'role_id' => $role, ]; $this->db->insert('user_role', $data_roles); } } catch (Exception $e) { return false; } return true; } function update_user($user, $roles) { try { $user_data = [ 'name' => $user['name'], 'phone' => $user['phone'], 'age' => $user['age'], ]; $user_id = $this->get_user_id($user['email']); $this->db->where('user_id', $user_id); $this->db->update('users', $user_data); $this->db->where('user_id', $user_id); $this->db->delete('user_role'); foreach ($roles as $role) { $data_roles = [ 'user_id' => $user_id, 'role_id' => $role, ]; $this->db->insert('user_role', $data_roles); } } catch (Exception $e) { return false; } return true; } function delete_user($email) { try { $user_id = $this->get_user_id($email); $this->db->where('user_id', $user_id); $this->db->delete('users'); } catch (Exception $e) { return false; } return true; } }
mit
netodeolino/curso-angular-2
diretivas/src/app/app.module.ts
669
import { BrowserModule } from '@angular/platform-browser'; import { NgModule } from '@angular/core'; import { FormsModule } from '@angular/forms'; import { HttpModule } from '@angular/http'; import { AppComponent } from './app.component'; import { DiretivaNgifComponent } from './diretiva-ngif/diretiva-ngif.component'; import { DiretivaNgswitchComponent } from './diretiva-ngswitch/diretiva-ngswitch.component'; @NgModule({ declarations: [ AppComponent, DiretivaNgifComponent, DiretivaNgswitchComponent ], imports: [ BrowserModule, FormsModule, HttpModule ], providers: [], bootstrap: [AppComponent] }) export class AppModule { }
mit
Aurelsicoko/prestashop-14
themes/default-bootstrap/modules/blockbestsellers/translations/fr.php
2304
<?php global $_MODULE; $_MODULE = array(); $_MODULE['<{blockbestsellers}default-bootstrap>blockbestsellers_9862f1949f776f69155b6e6b330c7ee1'] = 'Bloc meilleures ventes'; $_MODULE['<{blockbestsellers}default-bootstrap>blockbestsellers_ed6476843a865d9daf92e409082b76e1'] = 'Ajoute un bloc qui affiche les meilleures ventes de la boutique.'; $_MODULE['<{blockbestsellers}default-bootstrap>blockbestsellers_c888438d14855d7d96a2724ee9c306bd'] = 'Mise à jour réussie'; $_MODULE['<{blockbestsellers}default-bootstrap>blockbestsellers_f4f70727dc34561dfde1a3c529b6205c'] = 'Paramètres'; $_MODULE['<{blockbestsellers}default-bootstrap>blockbestsellers_26986c3388870d4148b1b5375368a83d'] = 'Produits à afficher'; $_MODULE['<{blockbestsellers}default-bootstrap>blockbestsellers_2b21378492166b0e5a855e2da611659c'] = 'Définit le nombre de produits à afficher dans ce bloc'; $_MODULE['<{blockbestsellers}default-bootstrap>blockbestsellers_24ff4e4d39bb7811f6bdf0c189462272'] = 'Toujours afficher ce bloc'; $_MODULE['<{blockbestsellers}default-bootstrap>blockbestsellers_84b0c5fdef19ab8ef61cd809f9250d85'] = 'Afficher le bloc même si il n\'y a aucune meilleure vente à afficher.'; $_MODULE['<{blockbestsellers}default-bootstrap>blockbestsellers_00d23a76e43b46dae9ec7aa9dcbebb32'] = 'Activé'; $_MODULE['<{blockbestsellers}default-bootstrap>blockbestsellers_b9f5c797ebbf55adccdd8539a65a0241'] = 'Désactivé'; $_MODULE['<{blockbestsellers}default-bootstrap>blockbestsellers_c9cc8cce247e49bae79f15173ce97354'] = 'Enregistrer'; $_MODULE['<{blockbestsellers}default-bootstrap>blockbestsellers-home_09a5fe24fe0fc9ce90efc4aa507c66e7'] = 'Aucune meilleure vente à l\'heure actuelle.'; $_MODULE['<{blockbestsellers}default-bootstrap>blockbestsellers_1d0a2e1f62ccf460d604ccbc9e09da95'] = 'Voir une des meilleures ventes'; $_MODULE['<{blockbestsellers}default-bootstrap>blockbestsellers_3cb29f0ccc5fd220a97df89dafe46290'] = 'Meilleures ventes'; $_MODULE['<{blockbestsellers}default-bootstrap>blockbestsellers_eae99cd6a931f3553123420b16383812'] = 'Toutes les meilleures ventes'; $_MODULE['<{blockbestsellers}default-bootstrap>blockbestsellers_f7be84d6809317a6eb0ff3823a936800'] = 'Pas encore de meilleure vente'; $_MODULE['<{blockbestsellers}default-bootstrap>tab_d7b2933ba512ada478c97fa43dd7ebe6'] = 'Meilleures Ventes';
mit
joserochadocarmo/sau
app/view1/view1.js
4969
//'use strict'; angular.module('myApp.view1', ['ngRoute', 'ui.bootstrap']) .config(['$routeProvider', function ($routeProvider) { $routeProvider .when('/view1', { templateUrl: 'view1/view1.html', controller: 'View1Ctrl' }) .when('/detail/:cpf', { controller: 'DetailCtrl', templateUrl: 'view1/detail.html' }); }]) .factory('Pessoas', function () { var Pessoas = {}; Pessoas.cast = [ { nome: "josé rocha do carmo", login_unico: "joserocha", emails: ["tom.jrc@gmail.com", "tom.jrc1@gmail.com"], cpf: 1161061150, id: 1 }, {nome: "pablo leonardo", login_unico: "pablo", emails: {email: "pablo@gmail.com"}, cpf: 1161061150, id: 2}, { nome: "ricardo borges", login_unico: "ricardo", emails: {email: "ricardo@gmail.com"}, cpf: 1161061150, id: 3 }, {nome: "maria da penha", login_unico: "maria", emails: {email: ""}, cpf: 1161061151, id: 4}, {nome: "frodo bolseiro", login_unico: "frodo", emails: {email: "frodo@gmail.com"}, cpf: 1161061150, id: 6}, {nome: "bilbo bolseiro", login_unico: "bilbo", emails: {email: "bilbo@gmail.com"}, cpf: 1161061150, id: 7} ]; return Pessoas; } ) .controller('View1Ctrl', function ($scope, Pessoas, $modal) { console.log("View1Ctrl - search:" + search.value); $scope.pessoas = Pessoas; $scope.findByType = function (search) { var type = ''; if (!search) return "..."; switch (defineType(search)) { case "email": type = "e-mail: "; break; case "nome": type = "nome: "; break; case "loginunico": type = "login único: "; break; case "cpf": type = "cpf: "; break; case "cd_pessoa": type = "identificador pessoa: "; break; } return type + search; } $scope.open = function (size,cpf) { var modalInstance = $modal.open({ templateUrl: 'view1/detail.html', controller: 'DetailCtrl', size: size, resolve: { cpf: function () { return cpf; } } }); modalInstance.result.then(function (selectedItem) { $scope.selected = selectedItem; }); }; }) .controller('DetailCtrl', function ($scope, $modalInstance, cpf) { console.log("cpf:" + cpf); $scope.cpf=cpf; $scope.cancel = function () { $modalInstance.dismiss('cancel'); }; }); var defineType = function (search) { if (isNaN(search)) { if (isEmail(search)) return "email"; else if (isNome(search)) return "nome"; else return "loginunico"; } else { if (validarCPF(search)) return "cpf"; else return "cd_pessoa"; } console.log("returning void..." + search) return ''; } function isEmail(email) { return email.indexOf("@") != -1; } function isNome(nome) { return ( nome.indexOf(" ") != -1 ); } function validarCPF(cpf) { cpf = cpf.replace(/[^\d]+/g, ''); if (cpf == '') return false; // Elimina CPFs invalidos conhecidos    cpf = cpf.lpad('0', 11); //console.log(cpf); if (cpf.length != 11 || cpf == "00000000000" || cpf == "11111111111" || cpf == "22222222222" || cpf == "33333333333" || cpf == "44444444444" || cpf == "55555555555" || cpf == "66666666666" || cpf == "77777777777" || cpf == "88888888888" || cpf == "99999999999") return false; // Valida 1o digito add = 0; for (i = 0; i < 9; i++) add += parseInt(cpf.charAt(i)) * (10 - i); rev = 11 - (add % 11); if (rev == 10 || rev == 11) rev = 0; if (rev != parseInt(cpf.charAt(9))) return false; // Valida 2o digito add = 0; for (i = 0; i < 10; i++) add += parseInt(cpf.charAt(i)) * (11 - i); rev = 11 - (add % 11); if (rev == 10 || rev == 11) rev = 0; if (rev != parseInt(cpf.charAt(10))) return false; return true; } //pads left String.prototype.lpad = function (padString, length) { var str = this; while (str.length < length) str = padString + str; return str; }
mit
ICJIA/icjia-tvpp
statamic/core/Search/Algolia/Index.php
3392
<?php namespace Statamic\Search\Algolia; use Statamic\API\Str; use AlgoliaSearch\Client; use Statamic\Search\ItemResolver; use AlgoliaSearch\AlgoliaException; use Statamic\Events\SearchQueryPerformed; use Statamic\Search\Index as AbstractIndex; use Statamic\Search\IndexNotFoundException; class Index extends AbstractIndex { /** * @var Client */ protected $client; /** * @var \AlgoliaSearch\Index */ protected $index; /** * @param ItemResolver $itemResolver * @param Client $client */ public function __construct(ItemResolver $itemResolver, Client $client) { parent::__construct($itemResolver); $this->client = $client; } /** * @inheritdoc */ public function insert($id, $fields) { $fields['objectID'] = $id; $this->getIndex()->saveObject($fields); } /** * @inheritdoc */ public function insertMultiple($documents) { $this->getIndex()->deleteObjects(array_keys($documents)); $objects = collect($documents)->map(function ($item, $id) { $item['objectID'] = $id; return $item; })->values(); $this->getIndex()->saveObjects($objects); } /** * @inheritdoc */ public function delete($id) { $this->getIndex()->deleteObject($id); } /** * @inheritdoc */ public function search($query, $fields = null) { event(new SearchQueryPerformed($query)); $arguments = [ 'restrictSearchableAttributes' => implode(',', is_array($fields) ? $fields : array($fields)) ]; try { $response = $this->getIndex()->search($query, $arguments); } catch (AlgoliaException $e) { $this->handleAlgoliaException($e); \Log::error($e); return []; } return collect($response['hits'])->map(function ($hit) { $hit['id'] = $hit['objectID']; return $hit; }); } /** * @inheritdoc */ public function deleteIndex() { $this->getIndex()->clearIndex(); } /** * Get the Algolia index. * * @return \AlgoliaSearch\Index */ public function getIndex() { if (! $this->index) { $name = str_replace('/', '_', $this->name()); $this->index = $this->client->initIndex($name); } return $this->index; } /** * Throws a more user friendly exception. * * @param AlgoliaException $e * @throws \Exception */ private function handleAlgoliaException($e) { if (Str::contains($e->getMessage(), "Index {$this->name} does not exist")) { throw new IndexNotFoundException("Index [{$this->name}] does not exist."); } if (preg_match('/attribute (.*) is not in searchableAttributes/', $e->getMessage(), $matches)) { throw new \Exception( "Field [{$matches[1]}] does not exist in this index's searchableAttributes list." ); } } /** * @inheritdoc */ public function exists() { return null !== collect($this->client->listIndexes()['items'])->first(function ($i, $index) { return $index['name'] == str_replace('/', '_', $this->name); }); } }
mit
haystack/eyebrowse-server
notifications/models.py
7781
from __future__ import unicode_literals from __future__ import print_function import base64 import datetime from django.db import models from django.db.models.query import QuerySet from django.core.exceptions import ImproperlyConfigured from django.contrib.contenttypes.models import ContentType from django.contrib.auth.models import User from django.utils.translation import ugettext_lazy as _ from django.utils.translation import get_language, activate from django.utils.encoding import python_2_unicode_compatible from django.utils.six.moves import cPickle as pickle # pylint: disable-msg=F from notifications.compat import AUTH_USER_MODEL, GenericForeignKey from notifications.conf import settings from notifications.utils import load_media_defaults, notice_setting_for_user, my_import from notifications.backends.email import EmailBackend NOTICE_MEDIA, NOTICE_MEDIA_DEFAULTS = load_media_defaults() class LanguageStoreNotAvailable(Exception): pass @python_2_unicode_compatible class NoticeType(models.Model): label = models.CharField(_("label"), max_length=40, unique=True) display = models.CharField(_("display"), max_length=50) description = models.CharField(_("description"), max_length=100) # by default only on for media with sensitivity less than or equal to this # number default = models.IntegerField(_("default")) def __str__(self): return self.label class Meta: verbose_name = _("notice type") verbose_name_plural = _("notice types") @classmethod def create(cls, label, display, description, default=2, verbosity=1): """ Creates a new NoticeType. This is intended to be used by other apps as a post_syncdb manangement step. """ try: notice_type = cls._default_manager.get(label=label) updated = False if display != notice_type.display: notice_type.display = display updated = True if description != notice_type.description: notice_type.description = description updated = True if default != notice_type.default: notice_type.default = default updated = True if updated: notice_type.save() if verbosity > 1: print("Updated %s NoticeType" % label) except cls.DoesNotExist: cls(label=label, display=display, description=description, default=default).save() if verbosity > 1: print("Created %s NoticeType" % label) class Notification(models.Model): recipient = models.ForeignKey(User, related_name="notification_recipient") sender = models.ForeignKey(User, related_name="notification_sender") date_created = models.DateTimeField(default=datetime.datetime.utcnow()) notice_type = models.ForeignKey(NoticeType) seen = models.BooleanField(default=False) url = models.URLField(max_length=300, blank=False, null=True) message = models.CharField(max_length=2000, blank=False, null=True) class NoticeSetting(models.Model): """ Indicates, for a given user, whether to send notifications of a given type to a given medium. """ user = models.ForeignKey(AUTH_USER_MODEL, verbose_name=_("user")) notice_type = models.ForeignKey(NoticeType, verbose_name=_("notice type")) medium = models.CharField(_("medium"), max_length=1, choices=NOTICE_MEDIA) send = models.BooleanField(_("send"), default=False) scoping_content_type = models.ForeignKey( ContentType, null=True, blank=True) scoping_object_id = models.PositiveIntegerField(null=True, blank=True) scoping = GenericForeignKey("scoping_content_type", "scoping_object_id") @classmethod def for_user(cls, user, notice_type, medium, scoping=None): """ Kept for backwards compatibilty but isn't used anywhere within this app @@@ consider deprecating """ return notice_setting_for_user(user, notice_type, medium, scoping) class Meta: verbose_name = _("notice setting") verbose_name_plural = _("notice settings") unique_together = ( "user", "notice_type", "medium", "scoping_content_type", "scoping_object_id") class NoticeQueueBatch(models.Model): """ A queued notice. Denormalized data for a notice. """ pickled_data = models.TextField() def get_notification_language(user): """ Returns site-specific notification language for this user. Raises LanguageStoreNotAvailable if this site does not use translated notifications. """ if settings.PINAX_NOTIFICATIONS_LANGUAGE_MODEL: model = settings.PINAX_NOTIFICATIONS_GET_LANGUAGE_MODEL() try: language = model._default_manager.get(user__id__exact=user.id) if hasattr(language, "language"): return language.language except (ImportError, ImproperlyConfigured, model.DoesNotExist): raise LanguageStoreNotAvailable raise LanguageStoreNotAvailable def send_now(users, label, extra=None, sender=None, scoping=None): """ Creates a new notice. This is intended to be how other apps create new notices. notification.send(user, "friends_invite_sent", { "spam": "eggs", "foo": "bar", ) """ sent = False if extra is None: extra = {} notice_type = NoticeType.objects.get(label=label) current_language = get_language() for user in users: # get user language for user from language store defined in # NOTIFICATION_LANGUAGE_MODULE setting try: language = get_notification_language(user) except LanguageStoreNotAvailable: language = None if language is not None: # activate the user's language activate(language) # Since we only have 1 medium, just hardcode it in (was getting some weird # 'module' object is not callable error) backend = EmailBackend(0) if backend.can_send(user, notice_type, scoping=scoping): backend.deliver(user, sender, notice_type, extra) sent = True # reset environment to original language activate(current_language) return sent def send(*args, **kwargs): """ A basic interface around both queue and send_now. This honors a global flag NOTIFICATION_QUEUE_ALL that helps determine whether all calls should be queued or not. A per call ``queue`` or ``now`` keyword argument can be used to always override the default global behavior. """ queue_flag = kwargs.pop("queue", False) now_flag = kwargs.pop("now", False) assert not ( queue_flag and now_flag), "'queue' and 'now' cannot both be True." if queue_flag: return queue(*args, **kwargs) elif now_flag: return send_now(*args, **kwargs) else: if settings.PINAX_NOTIFICATIONS_QUEUE_ALL: return queue(*args, **kwargs) else: return send_now(*args, **kwargs) def queue(users, label, extra=None, sender=None): """ Queue the notification in NoticeQueueBatch. This allows for large amounts of user notifications to be deferred to a seperate process running outside the webserver. """ if extra is None: extra = {} if isinstance(users, QuerySet): users = [row["pk"] for row in users.values("pk")] else: users = [user.pk for user in users] notices = [] for user in users: notices.append((user, label, extra, sender)) NoticeQueueBatch( pickled_data=base64.b64encode(pickle.dumps(notices))).save()
mit
ksaluja24/scratch-bench
src/scratchbench/KController.java
3835
/* * To change this license header, choose License Headers in Project Properties. * To change this template file, choose Tools | Templates * and open the template in the editor. */ package scratchbench; import java.io.IOException; import java.net.URL; import java.util.ResourceBundle; import java.util.logging.Level; import java.util.logging.Logger; import javafx.event.ActionEvent; import javafx.fxml.FXML; import javafx.fxml.Initializable; import javafx.scene.control.Button; import javafx.scene.control.Label; import javafx.scene.control.TextField; import javafx.scene.input.KeyEvent; import javafx.scene.layout.AnchorPane; import static scratchbench.Login.serverAddress; import static scratchbench.ScratchBench.test; /** * FXML Controller class * * @author Kp Saluja */ public class KController extends AnchorPane implements Initializable { @FXML private Button loginButton; @FXML private TextField userNameTF; @FXML private Button testUserButton; @FXML private Label validateTrueLabel; @FXML private Label validateFalseLabel; @FXML private AnchorPane content; public static MainMenu kmm; public static String email=""; public static String password; private boolean b; private boolean emailExists; /** * Initializes the controller class. */ @Override public void initialize(URL url, ResourceBundle rb) { b=false; } @FXML public void processLogin(ActionEvent event) throws InterruptedException { login(); } @FXML private void continueAsTest() throws IOException { kmm=new MainMenu(); kmm.setVisible(true); test.dispose(); callThreads(); } private void continueAsRegistered() throws IOException { callThreads(); if(b==true) { String email=userNameTF.getText(); if(serverAddress.existsByEmail(email)==true) { id.id=serverAddress.getID(); test.loadSecondFxml("enter.fxml"); System.out.println("KController: "+id.id); password=serverAddress.getPassword(); } else { test.loadSecondFxml("login.fxml"); } } } @FXML private void emailcheck(KeyEvent k) { String c=k.getCharacter(); if(c.equals(" ")) { k.consume(); } String EMAIL_REGEX = "^[\\w-_\\.+]*[\\w-_\\.]\\@([\\w]+\\.)+[\\w]+[\\w]$"; if(userNameTF.getText().matches(EMAIL_REGEX)) { validateFalseLabel.setVisible(false); validateTrueLabel.setVisible(true); validateTrueLabel.setText("Kindly click on Login"); b=true; } else { validateTrueLabel.setVisible(false); validateFalseLabel.setVisible(true); validateFalseLabel.setText("Invalid E-Mail Format"); b=false; } } @FXML private void login() { email=userNameTF.getText(); if(email.length()==0) { try { continueAsTest(); } catch (IOException ex) { Logger.getLogger(KController.class.getName()).log(Level.SEVERE, null, ex); } } else { try { continueAsRegistered(); } catch (IOException ex) { Logger.getLogger(KController.class.getName()).log(Level.SEVERE, null, ex); } } } private void callThreads() { Thread t1=new Thread(new Runnable(){ @Override public void run() { new MyTimerTask(); } }); Thread t2=new Thread(new Runnable(){ @Override public void run() { new AutoSave(); } }); t1.start(); t2.start(); } }
mit
carbon/Amazon
src/Amazon.Sqs.Tests/Requests/RecieveMessagesRequestTests.cs
388
namespace Amazon.Sqs.Tests { public class RecieveMessagesRequestTests { [Fact] public void CanConstruct() { var request = new RecieveMessagesRequest(5, TimeSpan.FromSeconds(10), TimeSpan.FromSeconds(20)); Assert.Null(request.AttributeNames); Assert.Null(request.MessageAttributeNames); } } }
mit
zhangqiang110/my4j
pms/src/main/java/com/swfarm/biz/product/dao/StockKeepingUnitGroupDao.java
248
package com.swfarm.biz.product.dao; import com.swfarm.biz.product.bo.StockKeepingUnitGroup; import com.swfarm.pub.framework.dao.GenericDao; public interface StockKeepingUnitGroupDao extends GenericDao<StockKeepingUnitGroup, Long> { }
mit
TeleSign/node_telesign
examples/phoneid/2_cleansing_updated_number.js
1428
// note change this to the following if using npm package: require('telesignsdk); const TeleSignSDK = require('../../src/TeleSign'); //var TeleSignSDK = require('telesignsdk'); const customerId = "customer_id"; // Todo: find in portal.telesign.com const apiKey = "dGVzdCBhcGkga2V5IGZvciBzZGsgZXhhbXBsZXM="; // Todo: find in portal.telesign.com const rest_endpoint = "https://rest-api.telesign.com"; // Todo: Enterprise customer, change this! const timeout = 10*1000; // 10 secs const client = new TeleSignSDK( customerId, apiKey, rest_endpoint, timeout // optional // userAgent ); const phoneNumber = "phone_number"; console.log("## PhoneIDClient.phoneID ##"); function messageCallback(error, responseBody) { if (error === null) { console.log(`PhoneID response for phone number: ${phoneNumber} ` + `=> code: ${responseBody['status']['code']}, ` + `description: ${responseBody['status']['description']}`); if (responseBody['status']['code'] === 200) { const cc = responseBody['numbering']['cleansing']['call']['country_code']; const pn = responseBody['numbering']['cleansing']['call']['phone_number']; console.log("Cleansed phone number has country code $cc and phone number is $pn.") } } else { console.error("Unable to get PhoneID. $error"); } } client.phoneid.phoneID(messageCallback, phoneNumber);
mit
ezrondre/bootstrap_forms
lib/bootstrap_forms/bootstrap_form_helper.rb
1586
module BootstrapForms module BootstrapFormHelper ALERT_TYPES = [:danger, :info, :success, :warning] unless const_defined?(:ALERT_TYPES) def bootstrap_flash(messages = nil) flash_messages = [] (messages || flash).each do |type, message| # Skip empty messages, e.g. for devise messages set to nothing in a locale file. next if message.blank? type = type.to_sym type = :info if type == :notice type = :danger if type == :error next unless ALERT_TYPES.include?(type) Array(message).each do |msg| text = content_tag(:div, content_tag(:button, raw("&times;"), :class => "close", "data-dismiss" => "alert") + msg, :class => "alert fade in alert-#{type} alert-dismissible") flash_messages << text if msg end end flash_messages.join("\n").html_safe end def error_messages_for(record) return unless record messages = {error: []} errors_obj = record.is_a?(ActiveModel::Errors) ? record : record.errors errors_obj.full_messages.each do |message| messages[:error] << message end bootstrap_flash(messages) end def bootstrap_form_for(*args, &block) args << {} unless args.last.is_a?(Hash) options = args.last options[:html] ||= {} options[:html].merge!(:class => "bootsrap_form"){|key,val1,val2| val1.to_s+' '+val2 } options.merge!({:builder => Youmix::BootstrapFormBuilder}) form_for(*args, &block) end end end
mit
nudesign/media_magick
spec/dummy/app/uploaders/post_uploader.rb
479
# encoding: utf-8 require "media_magick/image/dimensions" class PostUploader < CarrierWave::Uploader::Base include CarrierWave::MiniMagick include MediaMagick::Image::Dimensions storage :file def store_dir "uploads/#{model.class.to_s.underscore}/#{mounted_as}/#{model.id}" end # process :resize_to_fill => [960, 544] version :thumb do process :resize_to_fit => [250, 136] end version :big do process :resize_to_limit => [864, 489] end end
mit
concord-consortium/energy3d
src/main/java/org/concord/energy3d/undo/ChangeFoundationSolarReflectorOpticalEfficiencyCommand.java
1654
package org.concord.energy3d.undo; import java.util.List; import javax.swing.undo.CannotRedoException; import javax.swing.undo.CannotUndoException; import org.concord.energy3d.model.Foundation; import org.concord.energy3d.model.SolarReflector; public class ChangeFoundationSolarReflectorOpticalEfficiencyCommand extends MyAbstractUndoableEdit { private static final long serialVersionUID = 1L; private final double[] oldValues; private double[] newValues; private final Foundation foundation; private final List<SolarReflector> reflectors; public ChangeFoundationSolarReflectorOpticalEfficiencyCommand(final Foundation foundation, final Class<?> c) { this.foundation = foundation; reflectors = foundation.getSolarReflectors(c); final int n = reflectors.size(); oldValues = new double[n]; for (int i = 0; i < n; i++) { oldValues[i] = reflectors.get(i).getOpticalEfficiency(); } } public Foundation getFoundation() { return foundation; } @Override public void undo() throws CannotUndoException { super.undo(); final int n = reflectors.size(); newValues = new double[n]; for (int i = 0; i < n; i++) { newValues[i] = reflectors.get(i).getOpticalEfficiency(); reflectors.get(i).setOpticalEfficiency(oldValues[i]); } } @Override public void redo() throws CannotRedoException { super.redo(); final int n = reflectors.size(); for (int i = 0; i < n; i++) { reflectors.get(i).setOpticalEfficiency(newValues[i]); } } @Override public String getPresentationName() { return "Optical Efficiency Change for All " + reflectors.get(0).getClass().getSimpleName() + "s on Selected Foundation"; } }
mit
fredericcormier/WesternMusicElements
WesternMusicElements/Ruby/WMRubyData.rb
3782
module WMRubyData FILE_HEADER = <<HEADER // // WMData.h // WesternMusicElements // // Created by Cormier Frederic on 06/03/12. // Copyright (c) 2012 International MicrOondes. All rights reserved. // HEADER CHORDS = { "Major" => [0,4,7], "Major 6" => [0,4,7,9 ], "Major 7" => [0,4,7,11], "Major 9" => [0,4,7,11,14], "Major 69"=> [0,4,7,9,14], "Major 11" => [0,4,7,11,14,17], "Major 13" => [0,4,7,11,14,17,21], "Minor" => [0,3,7], "Minor 6" => [0,3,7,9], "Minor 7" => [0,3,7,10], "Minor 9" => [0,3,7,10,14], "Minor 69" => [0,3,7,9,14], "Minor 11" => [0,3,7,10,14,17], "Minor 13" => [0,3,7,10,14,17,21], "Dominant 7"=> [0,4,7,10], "Ninth" => [0,4,7,10,14], "Eleventh" => [0,4,7,10,14,17], "Thirteenth" => [0,4,7,10,14,17,21], "Diminished" => [0,3,6], "Half Diminished 7" => [0,3,6,10], "Diminished 7" => [0,3,6,9], "Augmented" => [0,4,8], "Augmented 7" => [0,4,8,10], "Sus4" => [0,5,7], "Seventh sus4" => [0,5,7,10], "Minor major" => [0,3,7,11] } SCALES = { "Chromatic" => [0,1,2,3,4,5,6,7,8,9,10,11,12], "Major" => [0,2,4,5,7,9,11,12], "Natural Minor" => [0,2,3,5,7,8,10,12], "Harmonic Minor" => [0,2,3,5,7,8,11,12], "Melodic Minor" => [0,2,3,5,7,9,11,12], "Ionian" => [0,2,4,5,7,9,11,12], "Dorian" => [0,2,3,5,7,9,10,12], "Phrygian" => [0,1,3,5,7,8,10,12], "Lydian" => [0,2,4,6,7,9,11,12], "Mixolydian" => [0,2,4,5,7,9,10,12], "Aeolian" => [0,2,3,5,7,8,10,12], "Locrian" => [0,1,3,5,6,8,10,12], "Gypsy Minor" => [0,2,3,6,7,8,11,12], "Whole Tone" => [0,2,4,6,8,10,12], "Major Pentatonic" => [0,2,4,7,9,12], "Minor Pentatonic" => [0,3,5,7,10,12], "Major Bebop" => [0,2,4,5,7,8,9,11,12], "Altered Scale" => [0,1,3,4,6,8,10,12], "Dorian Bebop"=> [0,2,3,4,5,7,9,10,12], "Mixolydian Bebop"=> [0,2,4,5,7,9,10,11,12], "Blues Scale"=> [0,3,5,6,7,10,12], "Diminished Whole Half"=>[0,2,3,5,6,8,9,11,12], "Diminished Half Whole" =>[0,1,3,4,6,7,9,10,12], "Neapolitan Major" => [0,1,3,5,7,9,11,12], "Hungarian Major" => [0,3,4,6,7,9,10,12], "Harmonic Major" => [0,2,4,5,7,8,11,12], "Hungarian Minor" => [0,2,3,6,7,8,11,12], "Lydian Minor" => [0,2,4,6,7,8,10,12], "Neapolitan Minor" => [0,1,3,5,7,8,11,12], "Major Locrian" => [0,2,4,5,6,8,10,12], "Leading Whole Tone" => [0,2,4,6,8,10,11,12], "Six Tone Symmetrical" => [0,1,4,5,8,9,11,12], "Arabian" => [0,2,4,5,6,8,10,12], "Balinese" => [0,1,3,7,8,12], "Byzantine" => [0,1,3,5,7,8,11,12], "Hungarian Gypsy"=> [0,2,4,6,7,8,10,12], "Persian" => [0,1,4,5,6,8,11,12], "East Indian Purvi" => [0,1,4,6,7,8,11,12], "Oriental" => [0,1,4,5,6,9,10,12], "Double Harmonic" => [0,1,4,5,7,8,11,12], "Enigmatic" => [0,1,4,6,8,10,11,12], "Overtone" => [0,2,4,6,7,9,10,12], "Eight Tone Spanish" => [0,1,3,4,5,6,8,10,12], "Prometheus" => [0,2,4,6,9,10,12], "GAGAKU Rittsu Sen Pou" => [0,2,5,7,9,10,12], "GAGAKU Ryo Sen Pou" => [0,2,4,7,9,12], "ZOKUGAKU Yo Sen Pou" => [0,3,5,7,10,12], "In Sen Pou" => [0,1,5,2,8,12], "Okinawa" => [0,4,5,7,11,12] } end
mit
nfqakademija/indigo
src/Indigo/MainBundle/Resources/public/js/demo.js
18484
// Polyfills // (function() { // Array indexOf if (!Array.prototype.indexOf) { Array.prototype.indexOf = function (searchElement, fromIndex) { if ( this === undefined || this === null ) { throw new TypeError( '"this" is null or not defined' ); } var length = this.length >>> 0; // Hack to convert object.length to a UInt32 fromIndex = +fromIndex || 0; if (Math.abs(fromIndex) === Infinity) { fromIndex = 0; } if (fromIndex < 0) { fromIndex += length; if (fromIndex < 0) { fromIndex = 0; } } for (;fromIndex < length; fromIndex++) { if (this[fromIndex] === searchElement) { return fromIndex; } } return -1; }; } // Event listener if (!Event.prototype.preventDefault) { Event.prototype.preventDefault=function() { this.returnValue=false; }; } if (!Event.prototype.stopPropagation) { Event.prototype.stopPropagation=function() { this.cancelBubble=true; }; } if (!Element.prototype.addEventListener) { var eventListeners=[]; var addEventListener=function(type,listener /*, useCapture (will be ignored) */) { var self=this; var wrapper=function(e) { e.target=e.srcElement; e.currentTarget=self; if (listener.handleEvent) { listener.handleEvent(e); } else { listener.call(self,e); } }; if (type=="DOMContentLoaded") { var wrapper2=function(e) { if (document.readyState=="complete") { wrapper(e); } }; document.attachEvent("onreadystatechange",wrapper2); eventListeners.push({object:this,type:type,listener:listener,wrapper:wrapper2}); if (document.readyState=="complete") { var e=new Event(); e.srcElement=window; wrapper2(e); } } else { this.attachEvent("on"+type,wrapper); eventListeners.push({object:this,type:type,listener:listener,wrapper:wrapper}); } }; var removeEventListener=function(type,listener /*, useCapture (will be ignored) */) { var counter=0; while (counter<eventListeners.length) { var eventListener=eventListeners[counter]; if (eventListener.object==this && eventListener.type==type && eventListener.listener==listener) { if (type=="DOMContentLoaded") { this.detachEvent("onreadystatechange",eventListener.wrapper); } else { this.detachEvent("on"+type,eventListener.wrapper); } break; } ++counter; } }; Element.prototype.addEventListener=addEventListener; Element.prototype.removeEventListener=removeEventListener; if (HTMLDocument) { HTMLDocument.prototype.addEventListener=addEventListener; HTMLDocument.prototype.removeEventListener=removeEventListener; } if (Window) { Window.prototype.addEventListener=addEventListener; Window.prototype.removeEventListener=removeEventListener; } } })(); // Demo // (function() { var storageSupported = (typeof(window.Storage)!=="undefined"); // Functions // var reloadPage = function () { location.reload(); } var testTheme = function (name) { for (var j=0; j<demo_themes.length; j++) { if (demo_themes[j].name === name) { return demo_themes[j].name; } } return 'default'; } var loadDemoSettings = function () { var result = { fixed_navbar: false, fixed_menu: false, rtl: false, menu_right: false, theme: 'default' }; if (storageSupported) { try { result.fixed_navbar = (window.localStorage.demo_fixed_navbar && window.localStorage.demo_fixed_navbar === '1'); result.fixed_menu = (window.localStorage.demo_fixed_menu && window.localStorage.demo_fixed_menu === '1'); result.rtl = (window.localStorage.demo_rtl && window.localStorage.demo_rtl === '1'); result.menu_right = (window.localStorage.demo_menu_right && window.localStorage.demo_menu_right === '1'); result.theme = testTheme((window.localStorage.demo_theme) ? window.localStorage.demo_theme : ''); return result; } catch (e) {} } var key, val, pos, demo_cookies = document.cookie.split(';'); for (var i=0, l=demo_cookies.length; i < l; i++) { pos = demo_cookies[i].indexOf('='); key = demo_cookies[i].substr(0, pos).replace(/^\s+|\s+$/g, ''); val = demo_cookies[i].substr(pos + 1).replace(/^\s+|\s+$/g, ''); if (key === 'demo_fixed_navbar') { result.fixed_navbar = (val === '1') ? true : false; } else if (key === 'demo_fixed_menu') { result.fixed_menu = (val === '1') ? true : false; } else if (key === 'demo_rtl') { result.rtl = (val === '1') ? true : false; } else if (key === 'demo_menu_right') { result.menu_right = (val === '1') ? true : false; } else if (key === 'demo_theme') { result.theme = testTheme(val); } } return result; } var saveDemoSettings = function () { if (storageSupported) { try { window.localStorage.demo_fixed_navbar = escape((demo_settings.fixed_navbar) ? '1' : '0'); window.localStorage.demo_fixed_menu = escape((demo_settings.fixed_menu) ? '1' : '0'); window.localStorage.demo_rtl = escape((demo_settings.rtl) ? '1' : '0'); window.localStorage.demo_menu_right = escape((demo_settings.menu_right) ? '1' : '0'); window.localStorage.demo_theme = escape(demo_settings.theme); return; } catch (e) {} } document.cookie = 'demo_fixed_navbar=' + escape((demo_settings.fixed_navbar) ? '1' : '0'); document.cookie = 'demo_fixed_menu=' + escape((demo_settings.fixed_menu) ? '1' : '0'); document.cookie = 'demo_rtl=' + escape((demo_settings.rtl) ? '1' : '0'); document.cookie = 'demo_menu_right=' + escape((demo_settings.menu_right) ? '1' : '0'); document.cookie = 'demo_theme=' + escape(demo_settings.theme); } var getThemesTemplate = function () { result = ''; for (var i=0, l=demo_themes.length-1; i <= l; i++) { if (i % 2 == 0) { result = result + '<div class="demo-themes-row">'; result = result + '<a href="#" class="demo-theme" data-theme="' + demo_themes[i].name + '"><div class="theme-preview"><img src="' + demo_themes[i].img + '" alt=""></div><div class="overlay"></div><span>' + demo_themes[i].title + '</span></a>'; } else { result = result + '<a href="#" class="demo-theme" data-theme="' + demo_themes[i].name + '"><div class="theme-preview"><img src="' + demo_themes[i].img + '" alt=""></div><div class="overlay"></div><span>' + demo_themes[i].title + '</span></a>'; result = result + '</div>'; } if (i == l && i % 2 == 0) { result = result + '<div class="demo-theme"></div></div>'; } } return result; } var activateTheme = function (btns) { document.body.className = document.body.className.replace(/theme\-[a-z0-9\-\_]+/ig, 'theme-' + demo_settings.theme); if (! btns) return; btns.removeClass('dark'); if (demo_settings.theme != 'clean' && demo_settings.theme != 'white') { btns.addClass('dark'); } } // Load and apply settings // var panel_width = 260; var demo_themes = [ { name: 'default', title: 'Default', img: '/bundles/indigomain/images/demo/themes/default.png' }, { name: 'asphalt', title: 'Asphalt', img: '/bundles/indigomain/images/demo/themes/asphalt.png' }, { name: 'purple-hills', title: 'Purple Hills', img: '/bundles/indigomain/images/demo/themes/purple-hills.png' }, { name: 'adminflare', title: 'Adminflare', img: '/bundles/indigomain/images/demo/themes/adminflare.png' }, { name: 'dust', title: 'Dust', img: '/bundles/indigomain/images/demo/themes/dust.png' }, { name: 'frost', title: 'Frost', img: '/bundles/indigomain/images/demo/themes/frost.png' }, { name: 'fresh', title: 'Fresh', img: '/bundles/indigomain/images/demo/themes/fresh.png' }, { name: 'silver', title: 'Silver', img: '/bundles/indigomain/images/demo/themes/silver.png' }, { name: 'clean', title: 'Clean', img: '/bundles/indigomain/images/demo/themes/clean.png' }, { name: 'white', title: 'White', img: '/bundles/indigomain/images/demo/themes/white.png' } ]; var demo_settings = loadDemoSettings(); if (demo_settings.fixed_navbar) { document.body.className = document.body.className + ' main-navbar-fixed'; } if (demo_settings.fixed_menu) { document.body.className = document.body.className + ' main-menu-fixed'; } if (demo_settings.rtl) { document.body.className = document.body.className + ' right-to-left'; } if (demo_settings.menu_right) { document.body.className = document.body.className + ' main-menu-right'; } activateTheme(); // Templates // var demo_styles = [ '#demo-themes {', ' display: table;', ' table-layout: fixed;', ' width: 100%;', ' border-bottom-left-radius: 5px;', ' overflow: hidden;', '}', '#demo-themes .demo-themes-row {', ' display: block;', '}', '#demo-themes .demo-theme {', ' display: block;', ' float: left;', ' text-align: center;', ' width: 50%;', ' padding: 25px 0;', ' color: #888;', ' position: relative;', ' overflow: hidden;', '}', '#demo-themes .demo-theme:hover {', ' color: #fff;', '}', '#demo-themes .theme-preview {', ' width: 100%;', ' position: absolute;', ' top: 0;', ' left: 0;', ' bottom: 0;', ' overflow: hidden !important;', '}', '#demo-themes .theme-preview img {', ' width: 100%;', ' position: absolute;', ' display: block;', ' top: 0;', ' left: 0;', '}', '#demo-themes .demo-theme .overlay {', ' background: #1d1d1d;', ' background: rgba(0,0,0,.8);', ' position: absolute;', ' top: 0;', ' bottom: 0;', ' left: -100%;', ' width: 100%;', '}', '#demo-themes .demo-theme span {', ' position: relative;', ' color: #fff;', ' color: rgba(255,255,255,0);', '}', '#demo-themes .demo-theme span,', '#demo-themes .demo-theme .overlay {', ' -webkit-transition: all .3s;', ' -moz-transition: all .3s;', ' -ms-transition: all .3s;', ' -o-transition: all .3s;', ' transition: all .3s;', '}', '#demo-themes .demo-theme.active span,', '#demo-themes .demo-theme:hover span {', ' color: #fff;', ' color: rgba(255,255,255,1);', '}', '#demo-themes .demo-theme.active .overlay,', '#demo-themes .demo-theme:hover .overlay {', ' left: 0;', '}', '#demo-settings {', ' position: fixed;', ' right: -' + (panel_width + 10) + 'px;', ' width: ' + (panel_width + 10) + 'px;', ' top: 70px;', ' padding-right: 10px; ', ' background: #333;', ' border-radius: 5px;', ' -webkit-transition: all .3s;', ' -moz-transition: all .3s;', ' -ms-transition: all .3s;', ' -o-transition: all .3s;', ' transition: all .3s;', ' -webkit-touch-callout: none;', ' -webkit-user-select: none;', ' -khtml-user-select: none;', ' -moz-user-select: none;', ' -ms-user-select: none;', ' user-select: none;', ' z-index: 999998;', '}', '#demo-settings.open {', ' right: -10px;', '}', '#demo-settings > .header {', ' position: relative;', ' z-index: 100000;', ' line-height: 20px;', ' background: #444;', ' color: #fff;', ' font-size: 11px;', ' font-weight: 600;', ' padding: 10px 20px;', ' margin: 0;', '}', '#demo-settings > div {', ' position: relative;', ' z-index: 100000;', ' background: #282828;', ' border-bottom-right-radius: 5px;', ' border-bottom-left-radius: 5px;', '}', '#demo-settings-toggler {', ' font-size: 21px;', ' width: 50px;', ' height: 40px;', ' padding-right: 10px;', ' position: absolute;', ' left: -40px;', ' top: 0;', ' background: #444;', ' text-align: center;', ' line-height: 40px;', ' color: #fff;', ' border-radius: 5px;', ' z-index: 99999;', ' text-decoration: none !important;', ' -webkit-transition: color .3s;', ' -moz-transition: color .3s;', ' -ms-transition: color .3s;', ' -o-transition: color .3s;', ' transition: color .3s;', '}', '#demo-settings.open #demo-settings-toggler {', ' font-size: 16px;', ' color: #888;', '}', '#demo-settings.open #demo-settings-toggler:hover {', ' color: #fff;', '}', '#demo-settings.open #demo-settings-toggler:before {', ' content: "\\f00d";', '}', '#demo-settings-list {', ' padding: 0;', ' margin: 0;', '}', '#demo-settings-list li {', ' padding: 0;', ' margin: 0;', ' list-style: none;', ' position: relative;', '}', '#demo-settings-list li > span {', ' line-height: 20px;', ' color: #fff;', ' display: block;', ' padding: 12px 20px;', ' cursor: pointer;', '}', '#demo-settings-list li + li {', ' border-top: 1px solid #333;', '}', '#demo-settings .demo-checkbox {', ' position: absolute;', ' right: 20px;', ' top: 12px;', '}', '.right-to-left #demo-settings {', ' left: -270px;', ' right: auto;', ' padding-right: 0;', ' padding-left: 10px;', '}', '.right-to-left #demo-settings.open {', ' left: -10px;', ' right: auto;', '}', '.right-to-left #demo-settings-toggler {', ' padding-left: 10px;', ' padding-right: 0;', ' left: auto;', ' right: -40px;', '}', '.right-to-left #demo-settings .demo-checkbox {', ' right: auto;', ' left: 20px;', '}' ]; var demo_template = [ '<div id="demo-settings">', ' <a href="#" id="demo-settings-toggler" class="fa fa-cogs"></a>', ' <h5 class="header">SETTINGS</h5>', ' <div>', ' <ul id="demo-settings-list">', ' <li class="clearfix">', ' <span>Fixed navbar</span>', ' <div class="demo-checkbox"><input type="checkbox" id="demo-fixed-navbar" class="demo-settings-switcher" data-class="switcher-sm"' + ((demo_settings.fixed_navbar) ? ' checked="checked"' : '' ) + '></div>', ' </li>', ' <li class="clearfix">', ' <span>Fixed main menu</span>', ' <div class="demo-checkbox"><input type="checkbox" id="demo-fixed-menu" class="demo-settings-switcher" data-class="switcher-sm"' + ((demo_settings.fixed_menu) ? ' checked="checked"' : '' ) + '></div>', ' </li>', ' <li class="clearfix">', ' <span>Right-to-left direction</span>', ' <div class="demo-checkbox"><input type="checkbox" id="demo-rtl" class="demo-settings-switcher" data-class="switcher-sm"' + ((demo_settings.rtl) ? ' checked="checked"' : '' ) + '></div>', ' </li>', ' <li class="clearfix">', ' <span>Main menu on the right</span>', ' <div class="demo-checkbox"><input type="checkbox" id="demo-menu-rigth" class="demo-settings-switcher" data-class="switcher-sm"' + ((demo_settings.menu_right) ? ' checked="checked"' : '' ) + '></div>', ' </li>', ' <li class="clearfix">', ' <span>Hide main menu</span>', ' <div class="demo-checkbox"><input type="checkbox" id="demo-no-menu" class="demo-settings-switcher" data-class="switcher-sm"></div>', ' </li>', ' </ul>', ' </div>', ' <h5 class="header">THEMES</h5>', ' <div id="demo-themes">', getThemesTemplate(), ' </div>', '</div>' ]; // Initialize // window.addEventListener("load", function () { activateTheme($('#main-menu .btn-outline')); $('head').append($('<style>\n' + demo_styles.join('\n') + '\n</style>')); $('body').append($(demo_template.join('\n'))); // Activate theme $('#demo-themes .demo-theme[data-theme="' + demo_settings.theme + '"]').addClass('active'); // Add callbacks // // Initialize switchers $('.demo-settings-switcher').switcher({ theme: 'square', on_state_content: '<span class="fa fa-check" style="font-size:11px;"></span>', off_state_content: '<span class="fa fa-times" style="font-size:11px;"></span>' }); // Demo panel toggle $('#demo-settings-toggler').click(function () { $('#demo-settings').toggleClass('open'); return false; }); // Toggle switchers on label click $('#demo-settings-list li > span').click(function () { $(this).parents('li').find('.switcher').click(); }); // Fix/unfix main navbar $('#demo-fixed-navbar').on($('html').hasClass('ie8') ? "propertychange" : "change", function () { var uncheck_menu_chk = (! $(this).is(':checked') && $('#demo-fixed-menu').is(':checked')) ? true : false; demo_settings.fixed_navbar = $(this).is(':checked'); if (uncheck_menu_chk) { $('#demo-fixed-menu').switcher('off'); } else { saveDemoSettings(); reloadPage(); } }); // Fix/unfix main menu $('#demo-fixed-menu').on($('html').hasClass('ie8') ? "propertychange" : "change", function () { var check_navbar_chk = ($(this).is(':checked') && ! $('#demo-fixed-navbar').is(':checked')) ? true : false; demo_settings.fixed_menu = $(this).is(':checked'); if (check_navbar_chk) { $('#demo-fixed-navbar').switcher('on'); } else { saveDemoSettings(); reloadPage(); } }); // RTL $('#demo-rtl').on($('html').hasClass('ie8') ? "propertychange" : "change", function () { demo_settings.rtl = $(this).is(':checked'); saveDemoSettings(); reloadPage(); }); // Fix/unfix main menu $('#demo-menu-rigth').on($('html').hasClass('ie8') ? "propertychange" : "change", function () { demo_settings.menu_right = $(this).is(':checked'); saveDemoSettings(); reloadPage(); }); // Hide/show main menu $('#demo-no-menu').on($('html').hasClass('ie8') ? "propertychange" : "change", function () { if ($(this).is(':checked')) { $('body').addClass('no-main-menu'); } else { $('body').removeClass('no-main-menu'); } }); // Change theme $('#demo-themes .demo-theme').on('click', function () { if ($(this).hasClass('active')) return; $('#demo-themes .active').removeClass('active'); $(this).addClass('active'); demo_settings.theme = $(this).attr('data-theme'); saveDemoSettings(); activateTheme($('#main-menu .btn-outline')); return false; }); // Custom menu content demo // $('#menu-content-demo .close').click(function () { var $p = $(this).parents('.menu-content'); $p.addClass('fadeOut'); setTimeout(function () { $p.css({ height: $p.outerHeight(), overflow: 'hidden' }).animate({'padding-top': 0, height: $('#main-navbar').outerHeight()}, 500, function () { $p.remove(); }); }, 300); return false; }); }); })();
mit
ChangFeng2015/leetcode
src/main/java/leetCode/designPattern/state/OpenningState.java
350
package leetCode.designPattern.state; /** * @Author:Dave * @Description: * @Date: 2017/9/12 17:22 */ public class OpenningState extends LiftState{ public void open() { System.out.println("the lift is opening!"); } public void close() { // supe } public void run() { } public void stop() { } }
mit
pushbullet/engineer
vendor/google.golang.org/genproto/googleapis/ads/googleads/v2/enums/tracking_code_type.pb.go
6436
// Code generated by protoc-gen-go. DO NOT EDIT. // source: google/ads/googleads/v2/enums/tracking_code_type.proto package enums import ( fmt "fmt" math "math" proto "github.com/golang/protobuf/proto" _ "google.golang.org/genproto/googleapis/api/annotations" ) // Reference imports to suppress errors if they are not otherwise used. var _ = proto.Marshal var _ = fmt.Errorf var _ = math.Inf // This is a compile-time assertion to ensure that this generated file // is compatible with the proto package it is being compiled against. // A compilation error at this line likely means your copy of the // proto package needs to be updated. const _ = proto.ProtoPackageIsVersion3 // please upgrade the proto package // The type of the generated tag snippets for tracking conversions. type TrackingCodeTypeEnum_TrackingCodeType int32 const ( // Not specified. TrackingCodeTypeEnum_UNSPECIFIED TrackingCodeTypeEnum_TrackingCodeType = 0 // Used for return value only. Represents value unknown in this version. TrackingCodeTypeEnum_UNKNOWN TrackingCodeTypeEnum_TrackingCodeType = 1 // The snippet that is fired as a result of a website page loading. TrackingCodeTypeEnum_WEBPAGE TrackingCodeTypeEnum_TrackingCodeType = 2 // The snippet contains a JavaScript function which fires the tag. This // function is typically called from an onClick handler added to a link or // button element on the page. TrackingCodeTypeEnum_WEBPAGE_ONCLICK TrackingCodeTypeEnum_TrackingCodeType = 3 // For embedding on a mobile webpage. The snippet contains a JavaScript // function which fires the tag. TrackingCodeTypeEnum_CLICK_TO_CALL TrackingCodeTypeEnum_TrackingCodeType = 4 // The snippet that is used to replace the phone number on your website with // a Google forwarding number for call tracking purposes. TrackingCodeTypeEnum_WEBSITE_CALL TrackingCodeTypeEnum_TrackingCodeType = 5 ) var TrackingCodeTypeEnum_TrackingCodeType_name = map[int32]string{ 0: "UNSPECIFIED", 1: "UNKNOWN", 2: "WEBPAGE", 3: "WEBPAGE_ONCLICK", 4: "CLICK_TO_CALL", 5: "WEBSITE_CALL", } var TrackingCodeTypeEnum_TrackingCodeType_value = map[string]int32{ "UNSPECIFIED": 0, "UNKNOWN": 1, "WEBPAGE": 2, "WEBPAGE_ONCLICK": 3, "CLICK_TO_CALL": 4, "WEBSITE_CALL": 5, } func (x TrackingCodeTypeEnum_TrackingCodeType) String() string { return proto.EnumName(TrackingCodeTypeEnum_TrackingCodeType_name, int32(x)) } func (TrackingCodeTypeEnum_TrackingCodeType) EnumDescriptor() ([]byte, []int) { return fileDescriptor_bc3aa75f0cf51f59, []int{0, 0} } // Container for enum describing the type of the generated tag snippets for // tracking conversions. type TrackingCodeTypeEnum struct { XXX_NoUnkeyedLiteral struct{} `json:"-"` XXX_unrecognized []byte `json:"-"` XXX_sizecache int32 `json:"-"` } func (m *TrackingCodeTypeEnum) Reset() { *m = TrackingCodeTypeEnum{} } func (m *TrackingCodeTypeEnum) String() string { return proto.CompactTextString(m) } func (*TrackingCodeTypeEnum) ProtoMessage() {} func (*TrackingCodeTypeEnum) Descriptor() ([]byte, []int) { return fileDescriptor_bc3aa75f0cf51f59, []int{0} } func (m *TrackingCodeTypeEnum) XXX_Unmarshal(b []byte) error { return xxx_messageInfo_TrackingCodeTypeEnum.Unmarshal(m, b) } func (m *TrackingCodeTypeEnum) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { return xxx_messageInfo_TrackingCodeTypeEnum.Marshal(b, m, deterministic) } func (m *TrackingCodeTypeEnum) XXX_Merge(src proto.Message) { xxx_messageInfo_TrackingCodeTypeEnum.Merge(m, src) } func (m *TrackingCodeTypeEnum) XXX_Size() int { return xxx_messageInfo_TrackingCodeTypeEnum.Size(m) } func (m *TrackingCodeTypeEnum) XXX_DiscardUnknown() { xxx_messageInfo_TrackingCodeTypeEnum.DiscardUnknown(m) } var xxx_messageInfo_TrackingCodeTypeEnum proto.InternalMessageInfo func init() { proto.RegisterEnum("google.ads.googleads.v2.enums.TrackingCodeTypeEnum_TrackingCodeType", TrackingCodeTypeEnum_TrackingCodeType_name, TrackingCodeTypeEnum_TrackingCodeType_value) proto.RegisterType((*TrackingCodeTypeEnum)(nil), "google.ads.googleads.v2.enums.TrackingCodeTypeEnum") } func init() { proto.RegisterFile("google/ads/googleads/v2/enums/tracking_code_type.proto", fileDescriptor_bc3aa75f0cf51f59) } var fileDescriptor_bc3aa75f0cf51f59 = []byte{ // 340 bytes of a gzipped FileDescriptorProto 0x1f, 0x8b, 0x08, 0x00, 0x00, 0x00, 0x00, 0x00, 0x02, 0xff, 0x7c, 0x50, 0xd1, 0x4a, 0xf3, 0x30, 0x18, 0xfd, 0xdb, 0xfd, 0x2a, 0x64, 0xca, 0x6a, 0xd5, 0x1b, 0x71, 0x17, 0xdb, 0x03, 0xa4, 0x50, 0xc1, 0x8b, 0x78, 0xd5, 0xd6, 0x38, 0xca, 0x46, 0x57, 0x58, 0xb7, 0x81, 0x14, 0x4a, 0x5d, 0x42, 0x28, 0x6e, 0x49, 0x59, 0xba, 0xc9, 0x9e, 0xc2, 0x77, 0xf0, 0xd2, 0x47, 0xf1, 0x51, 0xf6, 0x14, 0xd2, 0x64, 0xdb, 0xc5, 0x40, 0x6f, 0xc2, 0xc9, 0xf7, 0x9d, 0x73, 0xf8, 0xce, 0x01, 0x0f, 0x4c, 0x08, 0x36, 0xa7, 0x4e, 0x4e, 0xa4, 0xa3, 0x61, 0x8d, 0xd6, 0xae, 0x43, 0xf9, 0x6a, 0x21, 0x9d, 0x6a, 0x99, 0xcf, 0xde, 0x0a, 0xce, 0xb2, 0x99, 0x20, 0x34, 0xab, 0x36, 0x25, 0x85, 0xe5, 0x52, 0x54, 0xc2, 0x6e, 0x6b, 0x32, 0xcc, 0x89, 0x84, 0x07, 0x1d, 0x5c, 0xbb, 0x50, 0xe9, 0x6e, 0xef, 0xf6, 0xb6, 0x65, 0xe1, 0xe4, 0x9c, 0x8b, 0x2a, 0xaf, 0x0a, 0xc1, 0xa5, 0x16, 0x77, 0x3f, 0x0c, 0x70, 0x9d, 0xec, 0x9c, 0x03, 0x41, 0x68, 0xb2, 0x29, 0x29, 0xe6, 0xab, 0x45, 0xf7, 0x1d, 0x58, 0xc7, 0x73, 0xbb, 0x05, 0x9a, 0xe3, 0x68, 0x14, 0xe3, 0x20, 0x7c, 0x0e, 0xf1, 0x93, 0xf5, 0xcf, 0x6e, 0x82, 0xb3, 0x71, 0xd4, 0x8f, 0x86, 0xd3, 0xc8, 0x32, 0xea, 0xcf, 0x14, 0xfb, 0xb1, 0xd7, 0xc3, 0x96, 0x69, 0x5f, 0x81, 0xd6, 0xee, 0x93, 0x0d, 0xa3, 0x60, 0x10, 0x06, 0x7d, 0xab, 0x61, 0x5f, 0x82, 0x0b, 0x05, 0xb3, 0x64, 0x98, 0x05, 0xde, 0x60, 0x60, 0xfd, 0xb7, 0x2d, 0x70, 0x3e, 0xc5, 0xfe, 0x28, 0x4c, 0xb0, 0x9e, 0x9c, 0xf8, 0x5b, 0x03, 0x74, 0x66, 0x62, 0x01, 0xff, 0x4c, 0xe5, 0xdf, 0x1c, 0x1f, 0x17, 0xd7, 0x71, 0x62, 0xe3, 0xc5, 0xdf, 0xe9, 0x98, 0x98, 0xe7, 0x9c, 0x41, 0xb1, 0x64, 0x0e, 0xa3, 0x5c, 0x85, 0xdd, 0xb7, 0x5a, 0x16, 0xf2, 0x97, 0x92, 0x1f, 0xd5, 0xfb, 0x69, 0x36, 0x7a, 0x9e, 0xf7, 0x65, 0xb6, 0x7b, 0xda, 0xca, 0x23, 0x12, 0x6a, 0x58, 0xa3, 0x89, 0x0b, 0xeb, 0x82, 0xe4, 0xf7, 0x7e, 0x9f, 0x7a, 0x44, 0xa6, 0x87, 0x7d, 0x3a, 0x71, 0x53, 0xb5, 0xdf, 0x9a, 0x1d, 0x3d, 0x44, 0xc8, 0x23, 0x12, 0xa1, 0x03, 0x03, 0xa1, 0x89, 0x8b, 0x90, 0xe2, 0xbc, 0x9e, 0xaa, 0xc3, 0xee, 0x7f, 0x02, 0x00, 0x00, 0xff, 0xff, 0xf1, 0xf8, 0x40, 0x53, 0xfc, 0x01, 0x00, 0x00, }
mit
rs/rest-layer
schema/dict_example_test.go
524
package schema_test import "github.com/rs/rest-layer/schema" func ExampleDict() { _ = schema.Schema{ Fields: schema.Fields{ "dict": schema.Field{ Validator: &schema.Dict{ // Limit dict keys to foo and bar keys only KeysValidator: &schema.String{ Allowed: []string{"foo", "bar"}, }, // Allow either string or integer as dict value Values: schema.Field{ Validator: &schema.AnyOf{ 0: &schema.String{}, 1: &schema.Integer{}, }, }, }, }, }, } }
mit
allForMoney/SysMng
frontsrc/src/configs/index.js
114
// AJAX 请求超时时间,单位秒 export const REQUEST_TIMEOUT = 20; export ERROR_CODE from './ERROR_CODE';
mit
robin-solutions/spree-refinery
app/decorators/refinery_user_decorator.rb
657
Refinery::User.class_eval do class DestroyWithOrdersError < StandardError; end include Spree::UserAddress include Spree::UserPaymentSource before_validation :copy_username_from_email before_destroy :check_completed_orders has_many :orders, class_name: 'Spree::Order' def store_admin? has_spree_role?('admin') end def add_spree_role(role_name) role = Spree::Role.find_by(name: role_name) self.spree_roles << role if role end private def copy_username_from_email self.username ||= self.email if self.email end def check_completed_orders raise DestroyWithOrdersError if orders.complete.present? end end
mit
Karasiq/scalajs-highcharts
src/main/scala/com/highcharts/config/PlotOptionsBubbleStatesHoverMarkerStates.scala
2076
/** * Automatically generated file. Please do not edit. * @author Highcharts Config Generator by Karasiq * @see [[http://api.highcharts.com/highcharts]] */ package com.highcharts.config import scalajs.js, js.`|` import com.highcharts.CleanJsObject import com.highcharts.HighchartsUtils._ /** * @note JavaScript name: <code>plotOptions-bubble-states-hover-marker-states</code> */ @js.annotation.ScalaJSDefined class PlotOptionsBubbleStatesHoverMarkerStates extends com.highcharts.HighchartsGenericObject { /** * <p>The normal state of a single point marker. Currently only used * for setting animation when returning to normal state from hover.</p> */ val normal: js.Any = js.undefined /** * <p>The hover state for a single point marker.</p> */ val hover: js.Any = js.undefined /** * <p>The appearance of the point marker when selected. In order to * allow a point to be selected, set the <code>series.allowPointSelect</code> * option to true.</p> */ val select: js.Any = js.undefined } object PlotOptionsBubbleStatesHoverMarkerStates { /** * @param normal <p>The normal state of a single point marker. Currently only used. for setting animation when returning to normal state from hover.</p> * @param hover <p>The hover state for a single point marker.</p> * @param select <p>The appearance of the point marker when selected. In order to. allow a point to be selected, set the <code>series.allowPointSelect</code>. option to true.</p> */ def apply(normal: js.UndefOr[js.Any] = js.undefined, hover: js.UndefOr[js.Any] = js.undefined, select: js.UndefOr[js.Any] = js.undefined): PlotOptionsBubbleStatesHoverMarkerStates = { val normalOuter: js.Any = normal val hoverOuter: js.Any = hover val selectOuter: js.Any = select com.highcharts.HighchartsGenericObject.toCleanObject(new PlotOptionsBubbleStatesHoverMarkerStates { override val normal: js.Any = normalOuter override val hover: js.Any = hoverOuter override val select: js.Any = selectOuter }) } }
mit
bkahlert/seqan-research
raw/pmsb13/pmsb13-data-20130530/sources/130wu1dgzoqmxyu2/2013-04-11T10-12-03.179+0200/sandbox/my_sandbox/apps/first_app/first_app.cpp
863
#include <iostream> #include <seqan/align.h> #include <seqan/sequence.h> #include <seqan/seq_io.h> #include <seqan/index.h> using namespace seqan; using namespace std; void assignmentIndex2(){ String<char> text = "TTATTAAGCGTATAGCCCTATAAATATAA"; StringSet<char> set; String<char> pattern1 = "TA"; String<char> pattern2 = "GCG"; String<char> pattern3 = "GCC"; appendValue(set, pattern1); appendValue(set, pattern2); appendValue(set, pattern3); Index<String<char>, IndexEsa<> > esaIndex(text); Finder<Index<String<char>, IndexEsa<> > > esaFinder(esaIndex); typedef Iterator<StringSet<char> >::Type TStringSetIterator; for (TStringSetIterator it = begin(set); it != end(set); ++it){ clear(esaFinder); while(find(esaFinder, getValue(it))){ std::cout<<position(esaFinder)<<std::endl; } } } int main(){ assignmentIndex2(); return 0; }
mit
jeanklann/M3PlusMicrocontrollerSimulator
CircuitSimulator/Components/Digital/Gates/XnorGate.cs
323
namespace CircuitSimulator { public class XnorGate : Gate { public XnorGate(int inputQuantity = 2, string name = "Xnor Gate") : base(name, inputQuantity + 1) { } protected internal override float Operation(Pin pin) { return Output.Xnor(pin); } } }
mit
tenpercent/gauss-invert
multiplication.cpp
2986
int simpleMatrixMultiply(double* const a, double* const b, double* const out, int p, int q, int r) { //умножение двух блоков PxQ * QxR int m, i, j; double *pc, *pb, *pa; double s10, s11, s00, s01; for (m = 0; m < p * r; ++m) { out[m] = 0.; } if ( !(p&1) ) { if ( !(r&1) ) { for (m = 0, pc = out; m < r; m += 2, pc += 2) { for(i = 0, pb = b + m; i < p; i += 2) { pa = a + i * q; //s00=s01=s10=s11=0.; s00 = 0.; s01 = 0.; s10 = 0.; s11 = 0.; for (j = 0; j < q; ++j, ++pa) { s00 += pa[0] * pb[j * r]; s01 += pa[0] * pb[j * r + 1]; s10 += pa[q] * pb[j * r]; s11 += pa[q] * pb[j * r + 1]; } pc[i * r] += s00; pc[i * r + 1] += s01; pc[(i + 1) * r] += s10; pc[(i + 1) * r + 1] += s11; }//for i }//for m } else {//p чётно, r нечётно for (m = 0, pc = out; m < r - 1; m += 2, pc += 2) { for(i = 0, pb = b + m; i < p; i += 2) { pa = a + i * q; //s00=s01=s10=s11=0.; s00 = 0.; s01 = 0.; s10 = 0.; s11 = 0.; for (j = 0; j < q; j++, pa++){ s00+=pa[0]*pb[j*r]; s01+=pa[0]*pb[j*r+1]; s10+=pa[q]*pb[j*r]; s11+=pa[q]*pb[j*r+1]; } pc[i*r]+=s00; pc[i*r+1]+=s01; pc[(i+1)*r]+=s10; pc[(i+1)*r+1]+=s11; }//for i }//for m for (i=0; i<p; i++){ for (j=0; j<q; j++){ out[i*r+r-1]+=a[i*q+j]*b[j*r+r-1]; } } } } else{ if(!(r&1)){//p нечетно, r четно for (m=0, pc=out; m<r; m+=2, pc+=2){ for(i=0, pb=b+m; i<p-1; i+=2){ pa = a+i*q; //s00=s01=s10=s11=0.; s00=0.; s10=0.; s01=0.; s11=0.; for (j=0; j<q; j++, pa++){ s00+=pa[0]*pb[j*r]; s01+=pa[0]*pb[j*r+1]; s10+=pa[q]*pb[j*r]; s11+=pa[q]*pb[j*r+1]; } pc[i*r]+=s00; pc[i*r+1]+=s01; pc[(i+1)*r]+=s10; pc[(i+1)*r+1]+=s11; }//for i }//for m for (i=0; i<r; i++){ for(j=0; j<q; j++){ out[(p-1)*r+i]+=a[(p-1)*q+j]*b[j*r+i]; } } } else{//p нечётно, r нечётно for (m=0, pc=out; m<r-1; m+=2, pc+=2){ for(i=0, pb=b+m; i<p-1; i+=2){ pa = a+i*q; //s00=s01=s10=s11=0.; s00=0.; s01=0.; s10=0.; s11=0.; for (j=0; j<q; j++, pa++){ s00+=pa[0]*pb[j*r]; s01+=pa[0]*pb[j*r+1]; s10+=pa[q]*pb[j*r]; s11+=pa[q]*pb[j*r+1]; } pc[i*r]+=s00; pc[i*r+1]+=s01; pc[(i+1)*r]+=s10; pc[(i+1)*r+1]+=s11; }//for i }//for m for (i=0; i<r; i++){ for(j=0; j<q; j++){ out[(p-1)*r+i]+=a[(p-1)*q+j]*b[j*r+i]; } } for (i=0; i<p-1; i++){ for (j=0; j<q; j++){ out[i*r+r-1]+=a[i*q+j]*b[j*r+r-1]; } } } } return 0; }
mit
brainless/intown
intown/apps/institutions/urls.py
153
from django.conf.urls import url from .views import RegisterInstitutionView urlpatterns = [ url(r'^register/$', RegisterInstitutionView.as_view()) ]
mit
yun90/hrs
manage.py
345
import os from app import create_app, db import app.models from flask_script import Manager, Shell from flask_migrate import Migrate, MigrateCommand app = create_app(os.getenv('FLASK_CONFIG') or 'default') migrate = Migrate(app, db) manager = Manager(app) manager.add_command('db', MigrateCommand) if __name__ == '__main__': manager.run()
mit
project-sothis/project-sothis
app/shared/helpers/selectors/logAnalyzerSelectors.js
349
import _ from 'lodash' export function getLogHeader (state) { return state.logAnalyzer.data.header } export function getLogFilename (state) { return state.logAnalyzer.data.filename } export function getLogEntries (state) { const entries = state.logAnalyzer.data.entries const entriesKey = _.keys(entries) return [entries, entriesKey] }
mit
ekoeppen/gdcl
nsof/nsof.go
12418
package nsof import ( "fmt" "io" "strconv" "unicode/utf16" ) type Data []byte type Writer interface { WriteNSOF(*Data) } type Reader interface { ReadNSOF(*Data, *ObjectStream) Object } type Object interface { fmt.Stringer Reader Writer } type ObjectStream []Object func (data Data) PeekXLong() int32 { var r int32 r = int32(data[0]) if r > 254 { r = ((int32(data[1])<<8+int32(data[2]))<<8+int32(data[3]))<<8 + int32(data[4]) } return r } func (data *Data) SkipXLong() { if (*data)[0] < 255 { *data = (*data)[1:] } else { *data = (*data)[5:] } } func (data *Data) DecodeXLong() int32 { r := data.PeekXLong() data.SkipXLong() return r } func (data *Data) EncodeXLong(value int32) { nsof := *data if value < 255 && value >= 0 { nsof = append(nsof, byte(value)) } else { nsof = append(nsof, 255, byte(value>>24), byte(value>>16), byte(value>>8), byte(value)) } *data = nsof } const ( IMMEDIATE = 0 CHARACTER = 1 UNICODECHARACTER = 2 BINARYOBJECT = 3 ARRAY = 4 PLAINARRAY = 5 FRAME = 6 SYMBOL = 7 STRING = 8 PRECEDENT = 9 NIL = 10 SMALLRECT = 11 LARGEBINARY = 12 ) type Character struct { value uint16 } func NewCharacter() *Character { return &Character{value: 0} } func (character *Character) ReadNSOF(data *Data, objectStream *ObjectStream) Object { value := data.PeekXLong() if value&0xf == 6 { character.value = uint16(value >> 4) data.SkipXLong() *objectStream = append(*objectStream, character) } else { character = nil } return character } func (character *Character) WriteNSOF(data *Data) { *data = append(*data, IMMEDIATE) data.EncodeXLong((int32(character.value) << 4) | 6) } func (character *Character) String() string { return fmt.Sprintf("%c", character.value) } type True struct { } func (t *True) ReadNSOF(data *Data, objectStream *ObjectStream) Object { value := data.PeekXLong() if value == 0x1a { data.SkipXLong() *objectStream = append(*objectStream, t) } else { t = nil } return t } func (t *True) String() string { return "true" } func (t *True) WriteNSOF(data *Data) { *data = append(*data, IMMEDIATE) data.EncodeXLong(0x1a) } type Nil struct { } func NewNil() *Nil { return &Nil{} } func (n *Nil) ReadNSOF(data *Data, objectStream *ObjectStream) Object { value := data.PeekXLong() if value == 0x2 { data.SkipXLong() *objectStream = append(*objectStream, n) } else { n = nil } return n } func (n *Nil) String() string { return "NIL" } func (n *Nil) WriteNSOF(data *Data) { data.EncodeXLong(NIL) } type MagicPointer struct { value int32 } func (pointer *MagicPointer) ReadNSOF(data *Data, objectStream *ObjectStream) Object { value := data.PeekXLong() if value&0x3 == 3 { pointer.value = (value >> 4) & 0xffff data.SkipXLong() *objectStream = append(*objectStream, pointer) } else { pointer = nil } return pointer } func (pointer *MagicPointer) String() string { return fmt.Sprintf("@%d", pointer.value) } func (pointer *MagicPointer) WriteNSOF(data *Data) { *data = append(*data, IMMEDIATE) data.EncodeXLong((pointer.value << 4) | 6) } type Integer struct { value int32 } func NewInteger() *Integer { return &Integer{} } func (integer *Integer) ReadNSOF(data *Data, objectStream *ObjectStream) Object { value := data.PeekXLong() if value&0x3 == 0 { integer.value = value >> 2 data.SkipXLong() *objectStream = append(*objectStream, integer) } else { integer = nil } return integer } func (integer *Integer) WriteNSOF(data *Data) { *data = append(*data, IMMEDIATE) data.EncodeXLong(integer.value << 2) } func (integer *Integer) String() string { return strconv.Itoa(int(integer.value)) } func NewImmediate(data *Data, objectStream *ObjectStream) Object { var r Object value := data.PeekXLong() if value&0x3 == 0 { r = &Integer{value >> 2} } else if value&0x3 == 3 { r = &MagicPointer{(value >> 4) & 0xffff} } else if value&0xf == 6 { r = &Character{uint16(value >> 4)} } else if value == 0x1a { r = &True{} } else if value == 0x2 { r = &Nil{} } if r != nil { data.SkipXLong() *objectStream = append(*objectStream, r) } else { panic(fmt.Sprintf("Parsing immediate %d not implemented. Data: %x\n", value, (*data)[:10])) } return r } type Slot struct { key Object value Object } type Frame struct { slots []Slot } func NewFrame() *Frame { return &Frame{} } func (frame *Frame) ReadNSOF(data *Data, objectStream *ObjectStream) Object { *objectStream = append(*objectStream, frame) elements := data.DecodeXLong() frame.slots = make([]Slot, elements) for i, _ := range frame.slots { frame.slots[i] = Slot{data.DecodeObject(objectStream), nil} } for i, _ := range frame.slots { frame.slots[i].value = data.DecodeObject(objectStream) } return frame } func (frame *Frame) WriteNSOF(data *Data) { *data = append(*data, FRAME) data.EncodeXLong(int32(len(frame.slots))) for _, slot := range frame.slots { slot.key.WriteNSOF(data) } for _, slot := range frame.slots { slot.value.WriteNSOF(data) } } func (frame *Frame) String() string { return "{}" } func (frame *Frame) WriteTo(writer io.Writer) (n int64, err error) { var n0 int var err0 error n0, err0 = writer.Write([]byte{'{'}) return int64(n0), err0 } type Symbol struct { value string } func (symbol *Symbol) ReadNSOF(data *Data, objectStream *ObjectStream) Object { *objectStream = append(*objectStream, symbol) length := data.DecodeXLong() symbol.value = string((*data)[:length]) *data = (*data)[length:] return symbol } func (symbol *Symbol) WriteNSOF(data *Data) { *data = append(*data, SYMBOL) data.EncodeXLong(int32(len(symbol.value))) *data = append(*data, symbol.value...) } func (symbol *Symbol) String() string { return symbol.value } func NewSymbol() *Symbol { return &Symbol{} } type PlainArray struct { objects []Object } func (plainArray *PlainArray) ReadNSOF(data *Data, objectStream *ObjectStream) Object { *objectStream = append(*objectStream, plainArray) for length := data.DecodeXLong(); length > 0; length-- { plainArray.objects = append(plainArray.objects, data.DecodeObject(objectStream)) } return plainArray } func (plainArray *PlainArray) WriteNSOF(data *Data) { *data = append(*data, PLAINARRAY) data.EncodeXLong(int32(len(plainArray.objects))) for _, object := range plainArray.objects { object.WriteNSOF(data) } } func (plainArray *PlainArray) String() string { return fmt.Sprintf("%v", plainArray.objects) } func NewPlainArray() *PlainArray { return &PlainArray{} } type Precedent struct { reference int32 } func (precedent *Precedent) ReadNSOF(data *Data, objectStream *ObjectStream) Object { precedent.reference = data.DecodeXLong() return precedent } func (precedent *Precedent) WriteNSOF(data *Data) { *data = append(*data, PRECEDENT) data.EncodeXLong(precedent.reference) } func (precedent *Precedent) String() string { return fmt.Sprintf("%d", precedent.reference) } func NewPrecedent() *Precedent { return &Precedent{} } type String struct { value []rune } func (str *String) ReadNSOF(data *Data, objectStream *ObjectStream) Object { var i int32 *objectStream = append(*objectStream, str) length := data.DecodeXLong() chars := make([]uint16, length/2) for i = 0; i < length/2; i++ { chars[i] = uint16((*data)[i*2])*256 + uint16((*data)[i*2+1]) } str.value = utf16.Decode(chars) *data = (*data)[length:] return str } func (str *String) WriteNSOF(data *Data) { *data = append(*data, STRING) data.EncodeXLong(int32(len(str.value) * 2)) s := utf16.Encode(str.value) for i := 0; i < len(s); i++ { *data = append(*data, byte(s[i]>>8), byte(s[i])) } } func (str *String) String() string { return string(str.value) } func NewString() *String { return &String{} } type BinaryObject struct { value []byte class Object } func (binaryObject *BinaryObject) ReadNSOF(data *Data, objectStream *ObjectStream) Object { *objectStream = append(*objectStream, binaryObject) length := data.DecodeXLong() binaryObject.class = data.DecodeObject(objectStream) binaryObject.value = (*data)[:length] *data = (*data)[length:] return binaryObject } func (binaryObject *BinaryObject) WriteNSOF(data *Data) { *data = append(*data, BINARYOBJECT) data.EncodeXLong(int32(len(binaryObject.value))) binaryObject.class.WriteNSOF(data) *data = append(*data, binaryObject.value...) } func (binaryObject *BinaryObject) String() string { return fmt.Sprintf("%x", binaryObject.value) } func NewBinaryObject() *BinaryObject { return &BinaryObject{} } type UnicodeCharacter struct { value uint16 } func NewUnicodeCharacter() *UnicodeCharacter { return &UnicodeCharacter{value: 0} } func (character *UnicodeCharacter) ReadNSOF(data *Data, objectStream *ObjectStream) Object { character.value = uint16((*data)[0])<<8 + uint16((*data)[1]) *data = (*data)[2:] return character } func (character *UnicodeCharacter) WriteNSOF(data *Data) { *data = append(*data, UNICODECHARACTER) *data = append(*data, byte(character.value>>8), byte(character.value)) } func (character *UnicodeCharacter) String() string { return fmt.Sprintf("%c", character.value) } type Array struct { objects []Object class Object } func NewArray() *Array { return &Array{} } func (array *Array) ReadNSOF(data *Data, objectStream *ObjectStream) Object { *objectStream = append(*objectStream, array) length := int(data.DecodeXLong()) array.class = data.DecodeObject(objectStream) for i := 0; i < length; i++ { array.objects = append(array.objects, data.DecodeObject(objectStream)) } return array } func (array *Array) WriteNSOF(data *Data) { *data = append(*data, ARRAY) data.EncodeXLong(int32(len(array.objects))) array.class.WriteNSOF(data) for _, object := range array.objects { object.WriteNSOF(data) } } func (array *Array) String() string { return fmt.Sprintf("%v", array.objects) } type SmallRect struct { left byte top byte right byte bottom byte } func NewSmallRect() *SmallRect { return &SmallRect{} } func (smallRect *SmallRect) ReadNSOF(data *Data, objectStream *ObjectStream) Object { *objectStream = append(*objectStream, smallRect) smallRect.top = (*data)[0] smallRect.left = (*data)[1] smallRect.bottom = (*data)[2] smallRect.right = (*data)[3] *data = (*data)[4:] return smallRect } func (smallRect *SmallRect) WriteNSOF(data *Data) { *data = append(*data, SMALLRECT, smallRect.top, smallRect.left, smallRect.bottom, smallRect.right) } func (smallRect *SmallRect) String() string { return fmt.Sprintf("%d %d %d %d", smallRect.top, smallRect.left, smallRect.bottom, smallRect.right) } type LargeBinary struct { class Object compressed bool compander string companderParameters string data []byte } func NewLargeBinary() *LargeBinary { return &LargeBinary{} } func (largeBinary *LargeBinary) ReadNSOF(data *Data, objectStream *ObjectStream) Object { return largeBinary } func (largeBinary *LargeBinary) WriteNSOF(data *Data) { } func (largeBinary *LargeBinary) String() string { return fmt.Sprintf("<binary, %d bytes>", len(largeBinary.data)) } func (data *Data) DecodeObject(stream *ObjectStream) Object { var object Object objtype := (*data)[0] *data = (*data)[1:] if objtype == IMMEDIATE { object = NewImmediate(data, stream) } else { switch objtype { case FRAME: object = NewFrame() case SYMBOL: object = NewSymbol() case PLAINARRAY: object = NewPlainArray() case PRECEDENT: object = NewPrecedent() case STRING: object = NewString() case NIL: object = NewNil() case BINARYOBJECT: object = NewBinaryObject() case CHARACTER: object = NewCharacter() case UNICODECHARACTER: object = NewUnicodeCharacter() case ARRAY: object = NewArray() case SMALLRECT: object = NewSmallRect() case LARGEBINARY: object = NewLargeBinary() default: panic(fmt.Sprintf("Parsing type %d not implemented. Data: %x\n", objtype, (*data)[:10])) } object.ReadNSOF(data, stream) } return object } func (data Data) Factory() ObjectStream { objects := make(ObjectStream, 0, 100) for len(data) > 0 { data.DecodeObject(&objects) } return objects } func (stream ObjectStream) Print() { for i := 0; i < len(stream); i++ { fmt.Printf("%d: %s\n", i, stream[i].(Object).String()) } }
mit
apihackers/wapps
wapps/gallery/models.py
7069
from django.db import models from django.utils.translation import ugettext_lazy as _ from wagtail.wagtailcore.fields import RichTextField from wagtail.wagtailcore.models import Page, Orderable from wagtail.wagtailadmin.edit_handlers import FieldPanel, MultiFieldPanel, InlinePanel from wagtail.wagtailimages.edit_handlers import ImageChooserPanel from wagtail.wagtailimages import get_image_model, get_image_model_string from wagtail.wagtailsearch import index from modelcluster.fields import ParentalKey from modelcluster.tags import ClusterTaggableManager from taggit.models import TaggedItemBase from wapps.utils import get_image_url ImageModel = get_image_model_string() class Gallery(Page): intro = RichTextField(_('Introduction'), blank=True, help_text=_('A text to be displayed before albums')) search_fields = Page.search_fields + [ index.SearchField('intro'), ] feed_image = models.ForeignKey( ImageModel, null=True, blank=True, on_delete=models.SET_NULL, related_name='+' ) @property def children(self): return self.get_children().live().specific() def get_context(self, request): # Get list of live Gallery pages that are descendants of this page pages = Album.objects.live().descendant_of(self) # Update template context context = super(Gallery, self).get_context(request) context['pages'] = pages context['albums'] = pages return context class Meta: verbose_name = _('Gallery') type_icon = 'fa-picture-o' subpage_types = [ 'gallery.Album', 'gallery.ManualAlbum' ] content_panels = [ FieldPanel('title', classname="full title"), FieldPanel('intro', classname="full") ] promote_panels = [ MultiFieldPanel(Page.promote_panels, _('SEO and metadata')), ImageChooserPanel('feed_image'), ] def __jsonld__(self, context): request = context['request'] data = { '@type': 'CollectionPage', '@id': self.full_url, 'url': self.full_url, 'name': self.seo_title or self.title, } if self.first_published_at: # Prevent pre wagtail 1.11 pages to fail date_modified = self.last_published_at or self.first_published_at data.update({ 'datePublished': self.first_published_at.isoformat(), 'dateModified': date_modified.isoformat(), }) if self.feed_image: data['image'] = request.site.root_url + self.feed_image.get_rendition('original').url data['hasPart'] = [album.__jsonld__(context) for album in self.children] return data class AlbumTag(TaggedItemBase): content_object = ParentalKey( 'gallery.Album', related_name='tagged_items' ) class Album(Page): tags = ClusterTaggableManager(through=AlbumTag, blank=True) intro = RichTextField(_('Introduction'), blank=True, help_text=_('A text to be displayed before images')) show_details = models.BooleanField(_('Display details'), default=True, help_text=_('Display image title and details')) ANIMATIONS_TYPES = [ ('slide', _('Slide')), ('fade', _('Fade')), ] animation = models.CharField(_('Animation'), max_length=8, choices=ANIMATIONS_TYPES, default='slide') image = models.ForeignKey( ImageModel, null=True, blank=True, on_delete=models.SET_NULL, related_name='+', verbose_name=_('Image'), help_text=_('The image seen on gallery browser and when sharing this album') ) @property def gallery(self): # Find closest ancestor which is a Gallery index return self.get_ancestors().type(Gallery).specific().last() def get_context(self, request): context = super(Album, self).get_context(request) context['images'] = self.get_images(request) return context def get_images(self, request): tags = self.tags.all() # Be compatible with swappable image model model = get_image_model() # Creating empty Queryset from Wagtail image model return model.objects.filter(tags__in=tags).distinct() class Meta: verbose_name = _('Album') content_panels = [ FieldPanel('title', classname="full title"), FieldPanel('intro'), FieldPanel('tags'), MultiFieldPanel([ FieldPanel('show_details'), FieldPanel('animation'), ], _('Options')), ] promote_panels = [ MultiFieldPanel(Page.promote_panels, _('SEO and metadata')), ImageChooserPanel('image'), ] search_fields = Page.search_fields + [ index.SearchField('intro'), ] # parent_page_types = [] subpage_types = [] type_icon = 'fa-picture-o' def __jsonld__(self, context): request = context['request'] data = { '@type': 'ImageGallery', '@id': self.full_url, 'url': self.full_url, 'name': self.seo_title or self.title, 'associatedMedia': [] } if self.first_published_at: # Prevent pre wagtail 1.11 pages to fail date_modified = self.last_published_at or self.first_published_at data.update({ 'datePublished': self.first_published_at.isoformat(), 'dateModified': date_modified.isoformat(), }) if self.image: data['image'] = request.site.root_url + self.image.get_rendition('original').url for image in self.get_images(request): image = getattr(image, 'image', image) media = { '@type': 'ImageObject', 'name': image.title, 'contentUrl': get_image_url(image, 'original'), 'thumbnail': { '@type': 'ImageObject', 'contentUrl': get_image_url(image, 'fill-300x300'), 'width': 300, 'height': 300, } } if image.details: media['description'] = image.details data['associatedMedia'].append(media) return data class ManualAlbumImage(Orderable, models.Model): page = ParentalKey('gallery.ManualAlbum', related_name='images') image = models.ForeignKey( ImageModel, null=False, blank=False, on_delete=models.CASCADE, related_name='+' ) panels = [ ImageChooserPanel('image'), ] class ManualAlbum(Album): def get_images(self, request): return [i.image for i in self.images.all()] class Meta: verbose_name = _('Manual album') template = 'gallery/album.html' content_panels = Album.content_panels + [ InlinePanel('images', label=_('Images')), ]
mit
Pomona/Pomona
tests/Pomona.UnitTests/TestResources/TestResourcePostForm.cs
3133
#region License // Pomona is open source software released under the terms of the LICENSE specified in the // project's repository, or alternatively at http://pomona.io/ #endregion using System.Collections.Generic; using Pomona.Common.Proxies; namespace Pomona.UnitTests.TestResources { public class TestResourcePostForm : PostResourceBase, ITestResource { private static readonly PropertyWrapper<ITestResource, IList<ITestResource>> childrenPropWrapper = new PropertyWrapper<ITestResource, IList<ITestResource>>("Children"); private static readonly PropertyWrapper<ITestResource, IDictionary<string, string>> dictionaryPropWrapper = new PropertyWrapper<ITestResource, IDictionary<string, string>>("Dictionary"); private static readonly PropertyWrapper<ITestResource, IDictionary<string, object>> attributesPropWrapper = new PropertyWrapper<ITestResource, IDictionary<string, object>>("Attributes"); private static readonly PropertyWrapper<ITestResource, ITestResource> friendPropWrapper = new PropertyWrapper<ITestResource, ITestResource>("Friend"); private static readonly PropertyWrapper<ITestResource, int> idPropWrapper = new PropertyWrapper<ITestResource, int>("Id"); private static readonly PropertyWrapper<ITestResource, string> infoPropWrapper = new PropertyWrapper<ITestResource, string>("Info"); private static readonly PropertyWrapper<ITestResource, ITestResource> spousePropWrapper = new PropertyWrapper<ITestResource, ITestResource>("Spouse"); private static readonly PropertyWrapper<ITestResource, ISet<ITestResource>> setPropWrapper = new PropertyWrapper<ITestResource, ISet<ITestResource>>("Set"); public IDictionary<string, object> Attributes { get { return OnGet(attributesPropWrapper); } set { OnSet(attributesPropWrapper, value); } } public IList<ITestResource> Children { get { return OnGet(childrenPropWrapper); } set { OnSet(childrenPropWrapper, value); } } public IDictionary<string, string> Dictionary { get { return OnGet(dictionaryPropWrapper); } set { OnSet(dictionaryPropWrapper, value); } } public ITestResource Friend { get { return OnGet(friendPropWrapper); } set { OnSet(friendPropWrapper, value); } } public int Id { get { return OnGet(idPropWrapper); } set { OnSet(idPropWrapper, value); } } public string Info { get { return OnGet(infoPropWrapper); } set { OnSet(infoPropWrapper, value); } } public ISet<ITestResource> Set { get { return OnGet(setPropWrapper); } set { OnSet(setPropWrapper, value); } } public ITestResource Spouse { get { return OnGet(spousePropWrapper); } set { OnSet(spousePropWrapper, value); } } } }
mit
paulfitz/sheetsite
sheetsite/destination/csv_ss.py
373
import csv def write_destination_csv(params, state): workbook = state['workbook'] output_file = params['output_file'] for sheet in workbook.worksheets(): title = sheet.title rows = sheet.get_all_values() with open(output_file, 'w') as csvfile: writer = csv.writer(csvfile) writer.writerows(rows) return True
mit
Bitblade-org/mgsim
cli/lookup.cpp
1415
#include "commands.h" #include <sstream> using namespace std; bool DoCommand(vector<string>& args, cli_context& ctx) { bool match = false; bool quit = false; stringstream backup; backup.copyfmt(cout); for (const command_descriptor *p = &command_table[0]; p->prefix[0] != 0; ++p) { // First check that the start of the command matches. size_t i; match = true; for (i = 0; p->prefix[i] != 0; ++i) { if (i >= args.size() || args[i] != p->prefix[i]) { match = false; break; } } if (!match) continue; // We have a match. Check the number of arguments. // here i points to the first non-command argument size_t n_remaining_args = args.size() - i; if ((int)n_remaining_args < p->min_args) continue; if (p->max_args >= 0 && (int)n_remaining_args > p->max_args) continue; // We have a match for both the command and the arguments. // Get the command separately. vector<string> command(args.begin(), args.begin() + i); args.erase(args.begin(), args.begin() + i); quit = p->handler(command, args, ctx); cout << endl; break; } cout.copyfmt(backup); if (!match) cout << "Unknown command." << endl; return quit; }
mit
axelpale/tresdb
client/components/Entry/CommentFormAdmin/index.js
2068
/* eslint-disable max-statements */ // Form for comment creation and edit var ui = require('georap-ui'); var emitter = require('component-emitter'); var RemoveView = require('../Remove'); var ErrorView = require('../Error'); var template = require('./template.ejs'); var entryApi = tresdb.stores.entries; module.exports = function (entry, comment) { // Parameters // entry // entry object // comment // comment object. The comment must be created. // // Setup var $mount = null; var children = {}; var $elems = {}; var self = this; emitter(self); // Short alias var entryId = entry._id; self.bind = function ($mountEl) { $mount = $mountEl; $mount.html(template()); // Cancel button $elems.cancel = $mount.find('.comment-form-cancel'); $elems.cancel.click(function () { self.emit('exit'); }); // Init error view $elems.error = $mount.find('.comment-form-error'); children.error = new ErrorView(); children.error.bind($elems.error); // Comment deletion button and form $elems.remove = $mount.find('.comment-remove-container'); $elems.removeOpen = $mount.find('.comment-remove-open'); $elems.removeOpen.click(function () { ui.toggleHidden($elems.remove); }); children.remove = new RemoveView({ info: 'This will delete the comment and its attachments if any.', }); children.remove.bind($elems.remove); children.remove.on('submit', function () { entryApi.removeComment({ entryId: entryId, commentId: comment.id, }, function (err) { if (err) { children.remove.reset(); // hide progress children.error.update(err.message); return; } // Global location_entry_comment_removed will cause unbind // and $mount removal. }); }); }; self.unbind = function () { if ($mount) { ui.unbindAll(children); children = {}; ui.offAll($elems); $elems = {}; $mount.empty(); $mount = null; } }; };
mit
adrn/gary
gala/dynamics/mockstream/tests/test_df.py
3276
# Third-party import astropy.units as u import numpy as np import pytest # Custom from ....integrate import DOPRI853Integrator from ....potential import (Hamiltonian, HernquistPotential, MilkyWayPotential, ConstantRotatingFrame) from ....units import galactic from ...core import PhaseSpacePosition # Project from ..df import StreaklineStreamDF, FardalStreamDF, LagrangeCloudStreamDF _DF_CLASSES = [StreaklineStreamDF, FardalStreamDF, LagrangeCloudStreamDF] _DF_KWARGS = [{}, {}, {'v_disp': 1*u.km/u.s}] _TEST_POTENTIALS = [HernquistPotential(m=1e12, c=5, units=galactic), MilkyWayPotential()] @pytest.mark.parametrize('DF,DF_kwargs', zip(_DF_CLASSES, _DF_KWARGS)) @pytest.mark.parametrize('pot', _TEST_POTENTIALS) def test_init_sample(DF, DF_kwargs, pot): H = Hamiltonian(pot) orbit = H.integrate_orbit([10., 0, 0, 0, 0.2, 0], dt=1., n_steps=100) n_times = len(orbit.t) # Different ways to initialize successfully: df = DF(**DF_kwargs) o = df.sample(orbit, 1e4*u.Msun) assert len(o.x) == 2 * n_times df = DF(lead=False, **DF_kwargs) o = df.sample(orbit, 1e4*u.Msun) assert len(o.x) == n_times df = DF(trail=False, **DF_kwargs) o = df.sample(orbit, 1e4*u.Msun) assert len(o.x) == n_times df1 = DF(random_state=np.random.RandomState(42), **DF_kwargs) o1 = df1.sample(orbit, 1e4*u.Msun) df2 = DF(random_state=np.random.RandomState(42), **DF_kwargs) o2 = df2.sample(orbit, 1e4*u.Msun) assert u.allclose(o1.xyz, o2.xyz) assert u.allclose(o1.v_xyz, o2.v_xyz) assert len(o1.x) == 2 * n_times @pytest.mark.parametrize('DF,DF_kwargs', zip(_DF_CLASSES, _DF_KWARGS)) def test_expected_failure(DF, DF_kwargs): # Expected failure: with pytest.raises(ValueError): DF(lead=False, trail=False, **DF_kwargs) def test_rotating_frame(): DF = _DF_CLASSES[0] H_static = Hamiltonian(_TEST_POTENTIALS[0]) w0 = PhaseSpacePosition(pos=[10., 0, 0]*u.kpc, vel=[0, 220, 0.]*u.km/u.s, frame=H_static.frame) int_kwargs = dict(w0=w0, dt=1, n_steps=100, Integrator=DOPRI853Integrator) orbit_static = H_static.integrate_orbit(**int_kwargs) rframe = ConstantRotatingFrame([0, 0, -40] * u.km/u.s/u.kpc, units=galactic) H_rotating = Hamiltonian(_TEST_POTENTIALS[0], frame=rframe) orbit_rotating = H_rotating.integrate_orbit(**int_kwargs) _o = orbit_rotating.to_frame(H_static.frame) assert u.allclose(_o.xyz, orbit_static.xyz, atol=1e-13*u.kpc) assert u.allclose(_o.v_xyz, orbit_static.v_xyz, atol=1e-13*u.km/u.s) df_static = DF(trail=False) xvt_static = df_static.sample(orbit_static, 1e6*u.Msun) df_rotating = DF(trail=False) xvt_rotating = df_rotating.sample(orbit_rotating, 1e6*u.Msun) xvt_rotating_static = xvt_rotating.to_frame(H_static.frame, t=xvt_rotating.release_time) assert u.allclose(xvt_static.xyz, xvt_rotating_static.xyz, atol=1e-9*u.kpc) assert u.allclose(xvt_static.v_xyz, xvt_rotating_static.v_xyz, atol=1e-9*u.kpc/u.Myr)
mit
Papipo/locomotivecms-search
lib/locomotive/search/engine.rb
678
module Locomotive::Search class Engine < ::Rails::Engine initializer "locomotive.search.concerns", before: "locomotive.content_types" do |app| require "locomotive/search/content_type_reindexer" require "locomotive/search/concerns" app.config.autoload_paths += %W(#{config.root}/app/services/locomotive) Locomotive::PartialsCell.add_template(:custom_fields_form, "searchable") Locomotive::PartialsCell.add_template(:page_form, "searchable") end initializer "locomotive.search.assets.precompile", group: :all do |app| app.config.assets.precompile += ['locomotive/search_bar.css', 'locomotive/search_bar.js'] end end end
mit
KlusterKite/KlusterKite
Docs/Doxygen/html/dir_44a57085ea6129e28033f3819d38a708.js
632
var dir_44a57085ea6129e28033f3819d38a708 = [ [ "Installer.cs", "_kluster_kite_8_security_2_kluster_kite_8_security_8_session_redis_2_installer_8cs.html", [ [ "Installer", "class_kluster_kite_1_1_security_1_1_session_redis_1_1_installer.html", "class_kluster_kite_1_1_security_1_1_session_redis_1_1_installer" ] ] ], [ "RedisSessionTokenManager.cs", "_redis_session_token_manager_8cs.html", [ [ "RedisSessionTokenManager", "class_kluster_kite_1_1_security_1_1_session_redis_1_1_redis_session_token_manager.html", "class_kluster_kite_1_1_security_1_1_session_redis_1_1_redis_session_token_manager" ] ] ] ];
mit
BathHacked/wheelmap-stats
grab_counts.php
1125
<?php //This should be run on cron. include_once('config.php'); $mysqli = new mysqli($dbhost, $dbuser, $dbpass, $dbname); if ($mysqli->connect_errno) { echo "Failed to connect to MySQL: (" . $mysqli->connect_errno . ") " . $mysqli->connect_error; } $timeNow = gmdate("Y-m-d H:i:s"); $saved = 0; for( $categoryId = 0; $categoryId <= 12; $categoryId++ ){ foreach( ['yes','limited','no','unknown'] as $wheelchair_filter ){ $categoriesUrlFragment = ($categoryId >= 1) ? "categories/".$categoryId."/" : ""; $json = json_decode(file_get_contents("https://wheelmap.org/api/".$categoriesUrlFragment."nodes?api_key=$wheelmap_api_key&bbox=-2.413769,51.363902,-2.310473,51.415048&wheelchair=$wheelchair_filter"), true); $item_count = $json['meta']['item_count_total']; $success = $mysqli->query("INSERT INTO venue_counts (`category`,`wheelchair`,`time`,`count`) VALUES ('$categoryId','$wheelchair_filter','$timeNow','$item_count')"); if( !$success ){ die( $mysqli->error ); } else{ $saved++; } } } echo "Saved $saved rows to DB.";
mit
rainforestapp/circlemator
spec/spec_helper.rb
1009
# frozen_string_literal: true require 'vcr' require 'simplecov' require 'simplecov-lcov' SimpleCov::Formatter::LcovFormatter.config.report_with_single_file = true SimpleCov.formatter = SimpleCov::Formatter::MultiFormatter.new( [SimpleCov::Formatter::LcovFormatter, SimpleCov::Formatter::HTMLFormatter] ) SimpleCov.start do add_filter(%r{/spec/}) end RSpec.configure do |config| config.expect_with :rspec do |expectations| expectations.include_chain_clauses_in_custom_matcher_descriptions = true end config.mock_with :rspec do |mocks| mocks.verify_partial_doubles = true end config.filter_run :focus config.run_all_when_everything_filtered = true config.disable_monkey_patching! config.warnings = true if config.files_to_run.one? config.default_formatter = 'doc' end config.profile_examples = 10 config.order = :random Kernel.srand config.seed end VCR.configure do |config| config.cassette_library_dir = 'fixtures/vcr_cassettes' config.hook_into :webmock end
mit
ZhouHengYi/https---github.com-ZhouHengYi-RenRen_react-starter-kit
src/components/Banner/USA/Banner/Banner.js
6335
/*! React Starter Kit | MIT License | http://www.reactstarterkit.com/ */ import React, { PropTypes } from 'react'; import styles from './Banner.less'; import withStyles from '../../../../decorators/withStyles'; import Link from '../../../../utils/Link'; import $ from 'jquery'; var CSlider = require('react-slick'); var Select = require('rc-select'); var Option = Select.Option; @withStyles(styles) class Banner { render() { var settings = { dots: true, infinite: true, speed: 500, slidesToShow: 1, slidesToScroll: 1, autoplay: false, }; return ( <section className="banner"> <div id="da-slider" className="slideshow da-slider"> <CSlider {...settings}> <div className="da-slide usa-banner1"> <h2> <img src="http://new.rrliuxue.com/WebResources/Default/images/banner/USA/statue-of-liberty.png" /></h2> <div className="da-img"> <img src="http://new.rrliuxue.com/WebResources/Default/images/banner/USA/text.png" /> </div> </div> <div className="da-slide usa-banner1"> <h2> <img src="http://new.rrliuxue.com/WebResources/Default/images/banner/USA/statue-of-liberty.png" /></h2> <div className="da-img"> <img src="http://new.rrliuxue.com/WebResources/Default/images/banner/USA/text.png" /> </div> </div> <div className="da-slide usa-banner1"> <h2> <img src="http://new.rrliuxue.com/WebResources/Default/images/banner/USA/statue-of-liberty.png" /></h2> <div className="da-img"> <img src="http://new.rrliuxue.com/WebResources/Default/images/banner/USA/text.png" /> </div> </div> </CSlider> <div className="bgShadow"></div> </div> <div className="plan-box"> <form id="planForm" method="post" action="#" autocomplete="off"> <h1>免费获取美国留学方案</h1> <input type="hidden" id="planCountry" data-country="USA" /> <ul> <li> <Select value="计划出国时间" style={{width:270,height:45}} optionFilterProp="desc" renderDropdownToBody={true} onChange={this.handleChange}> <Option value="计划出国时间" desc="计划出国时间">计划出国时间</Option> <Option value="2015" desc="2015 ">2015</Option> <Option value="2014" desc="2014">2014</Option> <Option value="2013" desc="2013">2013</Option> </Select> </li> <li> <Select value="目前就读年级" style={{width:270,height:45}} optionFilterProp="desc" renderDropdownToBody={true} onChange={this.handleChange}> <Option value="目前就读年级" desc="目前就读年级">目前就读年级</Option> <Option selected="selected" value="本科大四">本科大四</Option> <Option value="本科大三">本科大三</Option> <Option value="本科大二">本科大二</Option> <Option value="本科大一">本科大一</Option> <Option value="大专大三">大专大三</Option> <Option value="大专大二">大专大二</Option> <Option value="大专大一">大专大一</Option> <Option value="高三">高三</Option> <Option value="高二">高二</Option> <Option value="高一">高一</Option> <Option value="初三">初三</Option> <Option value="初二">初二</Option> <Option value="初一">初一</Option> <Option value="硕士毕业已工作">硕士毕业已工作</Option> <Option value="硕士在读">硕士在读</Option> <Option value="本科毕业已工作">本科毕业已工作</Option> <Option value="大专毕业三年以上">大专毕业三年以上</Option> <Option value="大专毕业三年以下">大专毕业三年以下</Option> <Option value="高三毕业已工作">高三毕业已工作</Option> </Select> </li> <li> <button className="btn-plan" type="submit">获取留学方案</button> </li> </ul> <div className="bottom"> <p>人人留学为什么免费? </p> <div className="message"> 已有<span>2036</span>位小伙伴加入<br /> 人人留学, <a href="/register.aspx">我要加入</a> </div> </div> </form> </div> </section> ); } componentDidMount() { $(".bgShadow").hide(); } } export default Banner; /** * Created by XiaoKangZheng on 2015/7/28. */
mit
pranavmaneriker/template-creator
db/migrate/20141125165935_add_resume_filename_to_resume_relations.rb
198
class AddResumeFilenameToResumeRelations < ActiveRecord::Migration def change add_column :resume_relations, :resume_filename, :string add_index :resume_relations, :resume_filename end end
mit
dispyfree/xhstt
constraint/ClusterBusyTimesConstraint.cpp
812
/* * File: ClusterBusyTimesConstraint.cpp * */ #include "ClusterBusyTimesConstraint.h" #include "Instance.h" #include "CostFunction.h" #include "ObjectCreation.h" using namespace khe; using cbtc = ClusterBusyTimesConstraint; cbtc::ClusterBusyTimesConstraint(Instance inst, const std::string &id, const std::string &name, bool required, int weight, const CostFunction &cf, int min, int max){ if(!KheClusterBusyTimesConstraintMake(inst, Util::sTc(id), Util::sTc(name), required, weight, cf, min, max, &constr)) throw ObjectCreation("Unable to create ClusterBusyTimesConstraint"); } int cbtc::getMinimum() const{ return KheClusterBusyTimesConstraintMinimum(constr); } int cbtc::getMaximum() const{ return KheClusterBusyTimesConstraintMaximum(constr); }
mit
ArekkuusuJerii/Solar
src/main/java/arekkuusu/implom/common/theorem/ModTheorems.java
894
/* * Arekkuusu / Improbable plot machine. 2018 * * This project is licensed under the MIT. * The source code is available on github: * https://github.com/ArekkuusuJerii/Improbable-plot-machine */ package arekkuusu.implom.common.theorem; import arekkuusu.implom.api.research.Theorem; import arekkuusu.implom.common.lib.LibMod; import net.minecraft.util.ResourceLocation; import net.minecraftforge.registries.ForgeRegistry; import net.minecraftforge.registries.RegistryBuilder; /** * Created by <Arekkuusu> on 19/03/2018. * It's distributed as part of Improbable plot machine. */ public final class ModTheorems { public static final ForgeRegistry<Theorem> REGISTRY = (ForgeRegistry<Theorem>) new RegistryBuilder<Theorem>() .setName(new ResourceLocation(LibMod.MOD_ID, "theorem")) .setType(Theorem.class) .setIDRange(0, 255) .create(); public static void init() { } }
mit
RononDex/Sun.Plasma
Sun.Plasma/Sun.Plasma/Settings.xaml.cs
1563
using System; using System.Collections.Generic; using System.Linq; using System.Text; using System.Threading.Tasks; using System.Windows; using System.Windows.Controls; using System.Windows.Data; using System.Windows.Documents; using System.Windows.Input; using System.Windows.Media; using System.Windows.Media.Imaging; using System.Windows.Shapes; namespace Sun.Plasma { /// <summary> /// Interaction logic for Settings.xaml /// </summary> public partial class Settings : Window { FrameworkElement CtlMoveable; public Settings() { this.Loaded += OnLoaded; InitializeComponent(); this.DataContext = new Sun.Plasma.ViewModel.ViewModelSettings(); } public void OnLoaded(object sender, EventArgs e) { // Enable moving the window when clicking on the control CtlMoveable this.CtlMoveable = (FrameworkElement)this.Template.FindName("CtlMoveable", this); if (null != this.CtlMoveable) { this.CtlMoveable.MouseLeftButtonDown += new MouseButtonEventHandler(OnMoveableClick); } // Make this window resizable ResizableWindow.MakeWindowResizable(this); } public void OnMoveableClick(object sender, MouseButtonEventArgs e) { // Make window moveable when clicking on it if (e.LeftButton == MouseButtonState.Pressed) DragMove(); } } }
mit
QoboLtd/cakephp-search
webroot/js/exporter.js
2083
;(function ($, document, window) { 'use strict'; /** * Exporter plugin. */ function Exporter(element, options) { this.element = element; this.options = options; var pages = Math.ceil(this.options.count / this.options.limit); this.init(1, pages); } Exporter.prototype = { /** * Initialize method * * @return {undefined} */ init: function (page, pages) { var that = this; $.ajax({ url: this.options.url, type: 'get', data: { page: page, limit: this.options.limit }, dataType: 'json', contentType: 'application/json', headers: { 'Authorization': 'Bearer ' + this.options.token }, success: function (data) { if (data.success) { // next page page++; if (page <= pages) { $.event.trigger({ type: "progress.search.export", percent: (page / pages) * 100 }); that.init(page, pages); } else { $.event.trigger({ type: "completed.search.export", link: data.data.path }); } } }, error: function (jqXHR, textStatus, errorThrown) { console.log(jqXHR); console.log(textStatus); console.log(errorThrown); } }); } }; $.fn.exporter = function (options) { return this.each(function () { new Exporter(this, options); }); }; })(jQuery, document, window);
mit
lanyudhy/Halite-II
environment/networking/Networking.cpp
25652
#include "Networking.hpp" #include "BotInputError.hpp" #include <exception> #include <sstream> #include <thread> #include <core/hlt.hpp> std::mutex coutMutex; std::string serializeMapSize(const hlt::Map& map) { std::string returnString = ""; std::ostringstream oss; oss << map.map_width << ' ' << map.map_height << ' '; returnString = oss.str(); return returnString; } std::string Networking::serialize_map(const hlt::Map& map) { std::string returnString = ""; std::ostringstream oss; // Encode individual ships oss << ' ' << player_count(); oss << std::setprecision(SERIALIZATION_PRECISION); oss << std::fixed; for (hlt::PlayerId player_id = 0; player_id < player_count(); player_id++) { oss << ' ' << (int) player_id; auto num_ships = map.ships[player_id].size(); oss << ' ' << num_ships; auto player_ships = std::vector<std::pair<hlt::EntityIndex, hlt::Ship>>( map.ships[player_id].begin(), map.ships[player_id].end()); std::sort(player_ships.begin(), player_ships.end(), [](const std::pair<hlt::EntityIndex, hlt::Ship> s1, const std::pair<hlt::EntityIndex, hlt::Ship> s2) -> bool { return s1.first < s2.first; }); for (const auto& pair : player_ships) { const auto& ship = pair.second; oss << ' ' << pair.first; oss << ' ' << ship.location.pos_x; oss << ' ' << ship.location.pos_y; oss << ' ' << ship.health; oss << ' ' << ship.velocity.vel_x; oss << ' ' << ship.velocity.vel_y; oss << ' ' << static_cast<int>(ship.docking_status); oss << ' ' << static_cast<int>(ship.docked_planet); oss << ' ' << ship.docking_progress; oss << ' ' << ship.weapon_cooldown; } } auto num_planets = std::count_if( map.planets.begin(), map.planets.end(), [](const hlt::Planet& planet) -> bool { return planet.is_alive(); } ); oss << ' ' << num_planets; for (hlt::EntityIndex planet_id = 0; planet_id < map.planets.size(); planet_id++) { const auto& planet = map.planets[planet_id]; if (!planet.is_alive()) continue; oss << ' ' << planet_id; oss << ' ' << planet.location.pos_x; oss << ' ' << planet.location.pos_y; oss << ' ' << planet.health; oss << ' ' << planet.radius; oss << ' ' << planet.docking_spots; oss << ' ' << planet.current_production; oss << ' ' << planet.remaining_production; if (planet.owned) { oss << ' ' << 1 << ' ' << (int) planet.owner; } else { oss << ' ' << 0 << ' ' << 0; } oss << ' ' << planet.docked_ships.size(); for (const auto docked : planet.docked_ships) { oss << ' ' << docked; } } returnString = oss.str(); return returnString; } auto is_valid_move_character(const char& c) -> bool { return (c >= '0' && c <= '9') || c == ' ' || c == '-' || c == 't' || c == 'u' || c == 'd' || c == 'q'; } auto eject_bot(std::string message) -> std::string { if (!quiet_output) { std::lock_guard<std::mutex> guard(coutMutex); std::cout << message; } return message; } void Networking::deserialize_move_set(hlt::PlayerId player_tag, std::string& inputString, const hlt::Map& m, hlt::PlayerMoveQueue& moves) { const auto position = std::find_if( inputString.begin(), inputString.end(), [](const char& c) -> bool { return !is_valid_move_character(c); }); if (position != inputString.end()) { const auto index = std::distance(inputString.begin(), position); std::string message("Received invalid character '"); message += inputString; message += *position; message += "'."; throw BotInputError(player_tag, inputString, message, index); } std::stringstream iss(inputString); hlt::Move move; // Keep track of how many queued commands each ship has hlt::entity_map<int> queue_depth; char command; while (iss >> command) { switch (command) { case 't': { move.type = hlt::MoveType::Thrust; iss >> move.shipId; iss >> move.move.thrust.thrust; iss >> move.move.thrust.angle; const auto thrust = move.move.thrust.thrust; const auto max_accel = hlt::GameConstants::get().MAX_ACCELERATION; if (thrust > max_accel) { std::stringstream message; message << "Invalid thrust " << move.move.thrust.thrust << " for ship " << move.shipId << " (maximum is " << max_accel << ")."; throw BotInputError(player_tag, inputString, message.str(), iss.tellg()); } break; } case 'd': { move.type = hlt::MoveType::Dock; iss >> move.shipId; iss >> move.move.dock_to; break; } case 'u': { move.type = hlt::MoveType::Undock; iss >> move.shipId; break; } case 'q': { if (is_single_player()) { // allow early abort in single-player mode // (used for evaluating partial games for tutorial mode) throw hlt::GameAbort { 0 }; } // fall through to default } default: std::stringstream message; message << "Unknown command " << command << " for ship " << move.shipId; throw BotInputError(player_tag, inputString, message.str(), iss.tellg()); } if (queue_depth.count(move.shipId) == 0) { queue_depth[move.shipId] = 0; } auto queue_index = queue_depth.at(move.shipId); if (queue_index < hlt::MAX_QUEUED_MOVES) { moves.at(queue_index)[move.shipId] = move; queue_depth.at(move.shipId)++; } else { std::stringstream message; message << "Tried to queue too many commands for ship " << move.shipId; throw BotInputError(player_tag, inputString, message.str(), iss.tellg()); } move = {}; } } void Networking::send_string(hlt::PlayerId player_tag, std::string& sendString) { // End message with newline character sendString += '\n'; #ifdef _WIN32 WinConnection connection = connections[player_tag]; DWORD charsWritten; bool success; success = WriteFile(connection.write, sendString.c_str(), sendString.length(), &charsWritten, NULL); if(!success || charsWritten == 0) { if(!quiet_output) std::cout << "Problem writing to pipe\n"; throw 1; } #else UniConnection connection = connections[player_tag]; ssize_t charsWritten = write(connection.write, sendString.c_str(), sendString.length()); if (charsWritten == -1) { std::stringstream error_msg; if (errno == EWOULDBLOCK || errno == EAGAIN) { error_msg << "Could not send map to bot: blocked writing to pipe.\n" << "This usually happens if the bot is not reading STDIN,\n" << "or is accidentally putting all commands on newlines."; } else { error_msg << "Encountered an error while writing to pipe: " << errno; } throw BotInputError(player_tag, "", error_msg.str(), 0); } else if (charsWritten < sendString.length()) { if (!quiet_output) std::cout << "Problem writing to pipe\n"; throw 1; } #endif } std::string Networking::get_string(hlt::PlayerId player_tag, unsigned int timeout_millis) { std::string newString; int timeoutMillisRemaining = timeout_millis; std::chrono::high_resolution_clock::time_point tp = std::chrono::high_resolution_clock::now(); #ifdef _WIN32 WinConnection connection = connections[player_tag]; DWORD charsRead; bool success; char buffer; // Keep reading char by char until a newline while(true) { timeoutMillisRemaining = timeout_millis - std::chrono::duration_cast<std::chrono::milliseconds>(std::chrono::high_resolution_clock::now() - tp).count(); if(timeoutMillisRemaining < 0) throw newString; // Check to see that there are bytes in the pipe before reading // Throw error if no bytes in alloted time // Check for bytes before sampling clock, because reduces latency (vast majority the pipe is alread full) DWORD bytesAvailable = 0; PeekNamedPipe(connection.read, NULL, 0, NULL, &bytesAvailable, NULL); if(bytesAvailable < 1) { std::chrono::high_resolution_clock::time_point initialTime = std::chrono::high_resolution_clock::now(); while (bytesAvailable < 1) { if(std::chrono::duration_cast<std::chrono::milliseconds>(std::chrono::high_resolution_clock::now() - initialTime).count() > timeoutMillisRemaining) throw newString; PeekNamedPipe(connection.read, NULL, 0, NULL, &bytesAvailable, NULL); } } success = ReadFile(connection.read, &buffer, 1, &charsRead, NULL); if(!success || charsRead < 1) { if(!quiet_output) { std::string errorMessage = "Bot #" + std::to_string(player_tag) + " timed out or errored (Windows)\n"; std::lock_guard<std::mutex> guard(coutMutex); std::cout << errorMessage; } throw newString; } if(buffer == '\n') break; else newString += buffer; } #else UniConnection connection = connections[player_tag]; fd_set set; FD_ZERO(&set); /* clear the set */ if (connection.read > FD_SETSIZE) assert(false); FD_SET(connection.read, &set); /* add our file descriptor to the set */ char buffer; // Keep reading char by char until a newline while (true) { // Check if there are bytes in the pipe timeoutMillisRemaining = timeout_millis - std::chrono::duration_cast<std::chrono::milliseconds>( std::chrono::high_resolution_clock::now() - tp).count(); if (timeoutMillisRemaining < 0) throw newString; struct timeval timeout; timeout.tv_sec = timeoutMillisRemaining / 1000.0; timeout.tv_usec = (timeoutMillisRemaining % 1000) * 1000; int selectionResult = select(connection.read + 1, &set, NULL, NULL, &timeout); if (selectionResult > 0) { const size_t bytes_read = read(connection.read, &buffer, 1); if (bytes_read != 1) { throw BotInputError(player_tag, newString, std::string( "Panic: select() was positive but read() for 1 byte did not return 1."), 0); } if (buffer == '\n') break; else newString += buffer; } else { std::stringstream error_msg; error_msg << "Timeout reading commands for bot; select() result: " << selectionResult << " (max time: " << timeout_millis << " milliseconds)."; throw BotInputError(player_tag, newString, error_msg.str(), 0); } } #endif // Python turns \n into \r\n if (newString.back() == '\r') newString.pop_back(); return newString; } std::string Networking::read_trailing_input(hlt::PlayerId player_tag, long max_lines) { std::string error_string = ""; for(int line = 0; line < max_lines; line++) { try { error_string += get_string(player_tag, 0); } catch (const BotInputError& exc) { break; } catch (const std::string& s) { error_string += s; break; } catch (...) { break; } } return error_string; } void Networking::launch_bot(std::string command) { #ifdef _WIN32 command = "/C " + command; WinConnection parentConnection, childConnection; SECURITY_ATTRIBUTES saAttr; saAttr.nLength = sizeof(SECURITY_ATTRIBUTES); saAttr.bInheritHandle = TRUE; saAttr.lpSecurityDescriptor = NULL; // Child stdout pipe if(!CreatePipe(&parentConnection.read, &childConnection.write, &saAttr, 0)) { if(!quiet_output) std::cout << "Could not create pipe\n"; throw 1; } if(!SetHandleInformation(parentConnection.read, HANDLE_FLAG_INHERIT, 0)) throw 1; // Child stdin pipe if(!CreatePipe(&childConnection.read, &parentConnection.write, &saAttr, 0)) { if(!quiet_output) std::cout << "Could not create pipe\n"; throw 1; } if(!SetHandleInformation(parentConnection.write, HANDLE_FLAG_INHERIT, 0)) throw 1; // MAKE SURE THIS MEMORY IS ERASED PROCESS_INFORMATION piProcInfo; ZeroMemory(&piProcInfo, sizeof(PROCESS_INFORMATION)); STARTUPINFO siStartInfo; ZeroMemory(&siStartInfo, sizeof(STARTUPINFO)); siStartInfo.cb = sizeof(STARTUPINFO); siStartInfo.hStdError = childConnection.write; siStartInfo.hStdOutput = childConnection.write; siStartInfo.hStdInput = childConnection.read; siStartInfo.dwFlags |= STARTF_USESTDHANDLES; // C:/xampp/htdocs/Halite/Halite/Debug/ExampleBot.exe // C:/Users/Michael/Anaconda3/python.exe // C:/Program Files/Java/jre7/bin/java.exe -cp C:/xampp/htdocs/Halite/AIResources/Java MyBot bool success = CreateProcess( "C:\\windows\\system32\\cmd.exe", LPSTR(command.c_str()), // command line NULL, // process security attributes NULL, // primary thread security attributes TRUE, // handles are inherited 0, // creation flags NULL, // use parent's environment NULL, // use parent's current directory &siStartInfo, // STARTUPINFO pointer &piProcInfo ); // receives PROCESS_INFORMATION if(!success) { if(!quiet_output) std::cout << "Could not start process\n"; throw 1; } else { CloseHandle(piProcInfo.hProcess); CloseHandle(piProcInfo.hThread); processes.push_back(piProcInfo.hProcess); connections.push_back(parentConnection); } #else if (!quiet_output) std::cout << command << std::endl; pid_t pid; int writePipe[2]; int readPipe[2]; if (pipe(writePipe)) { if (!quiet_output) std::cout << "Error creating pipe\n"; throw 1; } if (pipe(readPipe)) { if (!quiet_output) std::cout << "Error creating pipe\n"; throw 1; } // Make the write pipe nonblocking fcntl(writePipe[1], F_SETFL, O_NONBLOCK); pid_t ppid_before_fork = getpid(); // Fork a child process pid = fork(); if (pid == 0) { // This is the child setpgid(getpid(), getpid()); #ifdef __linux__ // install a parent death signal // http://stackoverflow.com/a/36945270 int r = prctl(PR_SET_PDEATHSIG, SIGTERM); if (r == -1) { if(!quiet_output) std::cout << "Error installing parent death signal\n"; throw 1; } if (getppid() != ppid_before_fork) exit(1); #endif dup2(writePipe[0], STDIN_FILENO); dup2(readPipe[1], STDOUT_FILENO); dup2(readPipe[1], STDERR_FILENO); execl("/bin/sh", "sh", "-c", command.c_str(), (char*) NULL); //Nothing past the execl should be run exit(1); } else if (pid < 0) { if (!quiet_output) std::cout << "Fork failed\n"; throw 1; } UniConnection connection; connection.read = readPipe[0]; connection.write = writePipe[1]; connections.push_back(connection); processes.push_back(pid); #endif player_logs.push_back(std::string()); } int Networking::handle_init_networking(hlt::PlayerId player_tag, const hlt::Map& m, bool ignoreTimeout, std::string* playerName) { const int ALLOTTED_MILLIS = ignoreTimeout ? 2147483647 : 60000; std::string response; nlohmann::json init_log_json; try { std::string playerTagString = std::to_string(player_tag), mapSizeString = serializeMapSize(m), mapString = serialize_map(m); send_string(player_tag, playerTagString); send_string(player_tag, mapSizeString); send_string(player_tag, mapString); std::string outMessage = "Init Message sent to player " + std::to_string(int(player_tag)) + ".\n"; if (!quiet_output) std::cout << outMessage; std::chrono::high_resolution_clock::time_point initialTime = std::chrono::high_resolution_clock::now(); response = get_string(player_tag, ALLOTTED_MILLIS); unsigned int millisTaken = std::chrono::duration_cast<std::chrono::milliseconds>( std::chrono::high_resolution_clock::now() - initialTime).count(); init_log_json["Time"] = millisTaken; init_log_json["Turn"] = 0; *playerName = response.substr(0, 30); if (!quiet_output) { std::string inMessage = "Init Message received from player " + std::to_string(int(player_tag)) + ", " + *playerName + ".\n"; std::cout << inMessage; } player_logs_json[player_tag]["Frames"] += init_log_json; player_logs_json[player_tag]["PlayerID"] = player_tag; player_logs_json[player_tag]["PlayerName"] = *playerName; return millisTaken; } catch (BotInputError err) { if (!quiet_output) { std::lock_guard<std::mutex> guard(coutMutex); std::cout << err.what() << std::endl; } player_logs_json[player_tag]["Error"]["Message"] = err.what(); player_logs_json[player_tag]["Error"]["Turn"] = 0; *playerName = "Bot #" + std::to_string(player_tag) + "; timed out during Init"; } catch (std::string s) { player_logs_json[player_tag]["Error"]["Message"] = "ERRORED! Response received (if any): " + s; player_logs_json[player_tag]["Error"]["Turn"] = 0; *playerName = "Bot #" + std::to_string(player_tag) + "; timed out during Init"; } catch (...) { player_logs_json[player_tag]["Error"]["Message"] = "ERRORED! Response received (if any): " + response; player_logs_json[player_tag]["Error"]["Turn"] = 0; *playerName = "Bot #" + std::to_string(player_tag) + "; timed out during Init"; } player_logs_json[player_tag]["Frames"] += init_log_json; return -1; } int Networking::handle_frame_networking(hlt::PlayerId player_tag, const unsigned short& turnNumber, const hlt::Map& m, bool ignoreTimeout, hlt::PlayerMoveQueue& moves) { const int ALLOTTED_MILLIS = ignoreTimeout ? 2147483647 : 2000; std::string response; nlohmann::json log_json; try { if (is_process_dead(player_tag)) { return -1; } //Send this bot the game map and the messages addressed to this bot std::string mapString = serialize_map(m); send_string(player_tag, mapString); std::chrono::high_resolution_clock::time_point initialTime = std::chrono::high_resolution_clock::now(); response = get_string(player_tag, ALLOTTED_MILLIS); const auto millisTaken = std::chrono::duration_cast<std::chrono::milliseconds>( std::chrono::high_resolution_clock::now() - initialTime).count(); log_json["Time"] = millisTaken; deserialize_move_set(player_tag, response, m, moves); player_logs_json[player_tag]["Frames"] += log_json; return millisTaken; } catch (BotInputError err) { if (!quiet_output) { std::lock_guard<std::mutex> guard(coutMutex); std::cout << err.what() << std::endl; } std::string error_string = response + read_trailing_input(player_tag); player_logs_json[player_tag]["Error"]["Message"] = "ERRORED! Got Exception (if any): " + std::string(err.what()) + "; Response received (if any): " + error_string; player_logs_json[player_tag]["Error"]["Turn"] = turnNumber; } catch (std::string s) { player_logs_json[player_tag]["Error"]["Message"] = "ERRORED! Response received (if any): " + s; player_logs_json[player_tag]["Error"]["Turn"] = turnNumber; } catch (hlt::GameAbort) { throw; // propogate early termination } catch (...) { player_logs_json[player_tag]["Error"]["Message"] = "ERRORED! Response received (if any): " + response; player_logs_json[player_tag]["Error"]["Turn"] = turnNumber; } player_logs_json[player_tag]["Frames"] += log_json; return -1; } void Networking::kill_player(hlt::PlayerId player_tag) { if (is_process_dead(player_tag)) return; std::string newString; const int PER_CHAR_WAIT = 10; // millis const int MAX_READ_TIME = 1000; // millis #ifdef _WIN32 // Try to read entire contents of pipe. WinConnection connection = connections[player_tag]; DWORD charsRead; bool success; char buffer; std::chrono::high_resolution_clock::time_point tp = std::chrono::high_resolution_clock::now(); while(std::chrono::duration_cast<std::chrono::milliseconds>(std::chrono::high_resolution_clock::now() - tp).count() < MAX_READ_TIME) { DWORD bytesAvailable = 0; PeekNamedPipe(connection.read, NULL, 0, NULL, &bytesAvailable, NULL); if(bytesAvailable < 1) { std::chrono::high_resolution_clock::time_point initialTime = std::chrono::high_resolution_clock::now(); while(bytesAvailable < 1) { if(std::chrono::duration_cast<std::chrono::milliseconds>(std::chrono::high_resolution_clock::now() - initialTime).count() > PER_CHAR_WAIT) break; PeekNamedPipe(connection.read, NULL, 0, NULL, &bytesAvailable, NULL); } if(bytesAvailable < 1) break; // Took too long to get a character; breaking. } success = ReadFile(connection.read, &buffer, 1, &charsRead, NULL); if(!success || charsRead < 1) { if(!quiet_output) { std::string errorMessage = "Bot #" + std::to_string(player_tag) + " timed out or errored (Windows)\n"; std::lock_guard<std::mutex> guard(coutMutex); std::cout << errorMessage; } break; } newString += buffer; } HANDLE process = processes[player_tag]; TerminateProcess(process, 0); processes[player_tag] = NULL; connections[player_tag].read = NULL; connections[player_tag].write = NULL; std::string deadMessage = "Player " + std::to_string(player_tag) + " is dead\n"; if(!quiet_output) std::cout << deadMessage; #else // Try to read entire contents of pipe. UniConnection connection = connections[player_tag]; fd_set set; FD_ZERO(&set); /* clear the set */ FD_SET(connection.read, &set); /* add our file descriptor to the set */ char buffer; std::chrono::high_resolution_clock::time_point tp = std::chrono::high_resolution_clock::now(); while (std::chrono::duration_cast<std::chrono::milliseconds>( std::chrono::high_resolution_clock::now() - tp).count() < MAX_READ_TIME) { struct timeval timeout; timeout.tv_sec = PER_CHAR_WAIT / 1000; timeout.tv_usec = (PER_CHAR_WAIT % 1000) * 1000; int selectionResult = select(connection.read + 1, &set, NULL, NULL, &timeout); if (selectionResult > 0) { const size_t bytes_read = read(connection.read, &buffer, 1); if (bytes_read != 1) { break; } newString += buffer; } else break; } kill(-processes[player_tag], SIGKILL); processes[player_tag] = -1; connections[player_tag].read = -1; connections[player_tag].write = -1; #endif if (!newString.empty()) { if (!quiet_output) { std::cout << "Bot " << (int) player_tag << " was killed.\n"; std::cout << "Here is the rest of its output (if any):\n"; std::cout << newString; if (newString.back() != '\n') { std::cout << '\n'; } std::cout << "--- End bot output ---\n"; } } } bool Networking::is_process_dead(hlt::PlayerId player_tag) { #ifdef _WIN32 return processes[player_tag] == NULL; #else return processes.at(player_tag) == -1; #endif } int Networking::player_count() { #ifdef _WIN32 return connections.size(); #else return connections.size(); #endif }
mit
marcosgambeta/Qt5xHb
codegen/QtSerialPort/QtSerialPortVersion.cpp
934
%% %% Qt5xHb - Bindings libraries for Harbour/xHarbour and Qt Framework 5 %% %% Copyright (C) 2020 Marcos Antonio Gambeta <marcosgambeta AT outlook DOT com> %% $project=Qt5xHb $module=QtSerialPort $header #include <QtCore/Qt> #ifndef __XHARBOUR__ #if (QT_VERSION >= QT_VERSION_CHECK(5,1,0)) #include <QtSerialPort/QtSerialPortVersion> #endif #endif #include "qt5xhb_common.h" #include "qt5xhb_macros.h" #include "qt5xhb_utils.h" #ifdef __XHARBOUR__ #if (QT_VERSION >= QT_VERSION_CHECK(5,1,0)) #include <QtSerialPort/QtSerialPortVersion> #endif #endif HB_FUNC( QTSERIALPORT_VERSION_STR ) { #if (QT_VERSION >= QT_VERSION_CHECK(5,1,0)) hb_retc( (const char *) QTSERIALPORT_VERSION_STR ); #else hb_retc( (const char *) "" ); #endif } HB_FUNC( QTSERIALPORT_VERSION ) { #if (QT_VERSION >= QT_VERSION_CHECK(5,1,0)) hb_retni( QTSERIALPORT_VERSION ); #else hb_retni( 0 ); #endif }
mit
l33tdaima/l33tdaima
pr1220h/count_vowel_permutation.py
416
class Solution: def countVowelPermutation(self, n: int) -> int: a, e, i, o, u = 1, 1, 1, 1, 1 for _ in range(n - 1): a, e, i, o, u = e + i + u, a + i, e + o, i, i + o return (a + e + i + o + u) % (10 ** 9 + 7) # TESTS for n, expected in [ (1, 5), (2, 10), (5, 68), ]: sol = Solution() actual = sol.countVowelPermutation(n) assert actual == expected
mit
flyelmos/Software-University
04. C# Advanced/03. Matrices Exercises/07. Lego Blocks/LegoBlocks.cs
3216
namespace _07.Lego_Blocks { using System; using System.Linq; public class LegoBlocks { public static void Main() { /* This program recieves two jagged arrays. Each array represents a Lego block containing integers. After that it reverses the second jagged array and then checks if it would fit perfectly in the first jagged array. */ int rows = int.Parse(Console.ReadLine()); int[][] firstMatrix = new int[rows][]; int[][] secondMatrix = new int[rows][]; for (int currRow = 0; currRow < rows; currRow++) { int[] elements = Console.ReadLine() .Split(new[] { ' ' }, StringSplitOptions.RemoveEmptyEntries) .Select(int.Parse) .ToArray(); firstMatrix[currRow] = new int[elements.Length]; for (int currCol = 0; currCol < elements.Length; currCol++) { firstMatrix[currRow][currCol] = elements[currCol]; } } for (int currRow = 0; currRow < rows; currRow++) { int[] elements = Console.ReadLine() .Split(new[] { ' ' }, StringSplitOptions.RemoveEmptyEntries) .Select(int.Parse) .ToArray(); secondMatrix[currRow] = new int[elements.Length]; for (int currCol = 0; currCol < elements.Length; currCol++) { secondMatrix[currRow][currCol] = elements[currCol]; } } int[][] combinedMatrix = new int[rows][]; int totalCols = 0; for (int currRow = 0; currRow < rows; currRow++) { combinedMatrix[currRow] = new int[firstMatrix[currRow].Length + secondMatrix[currRow].Length]; for (int mFirstCol = 0; mFirstCol < firstMatrix[currRow].Length; mFirstCol++) { combinedMatrix[currRow][mFirstCol] = firstMatrix[currRow][mFirstCol]; } int reversedIndex = secondMatrix[currRow].Length - 1; for (int mSecondCol = 0; mSecondCol < secondMatrix[currRow].Length; mSecondCol++) { int continueIndex = firstMatrix[currRow].Length + mSecondCol; combinedMatrix[currRow][continueIndex] = secondMatrix[currRow][reversedIndex]; reversedIndex--; } totalCols += combinedMatrix[currRow].Length; } if (totalCols % combinedMatrix[0].Length == 0) { for (int currRow = 0; currRow < combinedMatrix.Length; currRow++) { Console.Write("["); Console.Write(string.Join(", ", combinedMatrix[currRow])); Console.Write("]"); Console.WriteLine(); } } else { Console.WriteLine($"The total number of cells is: {totalCols}"); } } } }
mit
AspectCore/Abstractions
src/AspectCore.Abstractions/DependencyInjection/IManyEnumerable.cs
254
using System.Collections; using System.Collections.Generic; using AspectCore.DynamicProxy; namespace AspectCore.DependencyInjection { [NonAspect, NonCallback] public interface IManyEnumerable<out T> : IEnumerable<T>, IEnumerable { } }
mit
cinhtau/kaffee-pelion
lang/src/test/java/net/cinhtau/demo/MathDemoTest.java
2364
package net.cinhtau.demo; import org.junit.Before; import org.junit.Test; import java.util.ArrayList; import java.util.List; import static java.util.stream.Collectors.toList; import static org.hamcrest.CoreMatchers.is; import static org.junit.Assert.*; public class MathDemoTest { private MathDemo mathDemo; @Before public void setUp() { this.mathDemo = new MathDemo(); } @Test public void testGetEvenNumbers() throws Exception { List<Integer> numbers = new ArrayList<>(); for (int i = 0; i < 100; i++) { numbers.add(i); } List<Integer> resultList = mathDemo.getEvenNumbers(numbers); assertThat("only even numbers", resultList.size(), is(50)); } @Test public void testSimple() { List<Integer> numbers = new ArrayList<>(); for (int i = 0; i < 10_000_000; i++) { numbers.add((int) Math.round(Math.random() * 100)); } //This will use just a single thread for (int i = 0; i < 100; i++) { long start = System.currentTimeMillis(); List<Integer> even = numbers.stream() .mapToInt(n -> n) .filter(n -> n % 2 == 0) .sorted() .boxed() .collect(toList()); System.out.printf("%d elements computed in %5d msecs with %d threads\n", even.size(), System.currentTimeMillis() - start, Thread.activeCount()); } } @Test public void testParallel() { List<Integer> numbers = new ArrayList<>(); for (int i = 0; i < 10_000_000; i++) { numbers.add((int) Math.round(Math.random() * 100)); } //Automatically select the optimum number of threads for (int i = 0; i < 100; i++) { long start = System.currentTimeMillis(); List<Integer> even = numbers.parallelStream() .mapToInt(n -> n) .filter(n -> n % 2 == 0) .sorted() .boxed() .collect(toList()); System.out.printf("%d elements computed in %5d msecs with %d threads\n", even.size(), System.currentTimeMillis() - start, Thread.activeCount()); } } }
mit
Telerik-Homework-ValentinRangelov/Homework
C#/C# 2/Homework Numeral Systems/Problem 7. One system to any other/Program.cs
2994
using System; using System.Linq; //Write a program to convert from any numeral system of given base s to any other numeral system of base d (2 ≤ s, d ≤ 16). class OneSystemToAnyOther { static void Main() { Console.Write("Number's base X: "); int baseX = int.Parse(Console.ReadLine()); if (baseX < 2) throw new ArgumentOutOfRangeException(); Console.Write("\nEnter a non-negative integer number [base {0}]: ", baseX); string number = StringParse(); Console.Write("\nConvert to base Y: "); int baseY = int.Parse(Console.ReadLine()); if (baseY < 2 || baseY > 16) throw new ArgumentOutOfRangeException(); string result = ConvertFromDecimalToBaseY(ConvertToDecimal(number.ToArray(), baseX), baseY); if (IsValidInput(number, result, baseX, baseY)) { Console.Write("\nResult -> {0} [base {1}] converted to [base {2}] => {3}\n\n", number, baseX, baseY, result); } else { Console.WriteLine("\n-> You have entered an invalid number!\n"); } } static string StringParse() { string number = Console.ReadLine(); // Check for incorrect number if (number.Any(t => t < 'A' && t > 'Z' && t < 'a' && t > 'z' && t < '0' && t > '9')) { throw new ArgumentException(); } number = MakeAllLettersLarge(number); return number; } // aff == AFF => valid input number static string MakeAllLettersLarge(string number) { char[] digits = number.ToArray(); for (int i = 0; i < digits.Length; i++) digits[i] = char.ToUpper(number[i]); return string.Join("", digits); } #region [Essential Part - Conversion] // Convert number [base X] to number [base 10] static int ConvertToDecimal(char[] number, int baseX) { int result = 0; for (int i = number.Length - 1, pow = 1; i >= 0; i--, pow *= baseX) result += (number[i] >= 'A') ? (number[i] - 'A' + 10) * pow : (number[i] - '0') * pow; return result; } // Convert number [base 10] to number [base Y] static string ConvertFromDecimalToBaseY(int number, int baseY) { string result = string.Empty; while (number > 0) { int remainder = number % baseY; result = remainder >= 10 ? (char)('A' + remainder - 10) + result : remainder + result; number /= baseY; } return result; } #endregion // Convert the result from BaseY to baseX and compare the new result with the old result (baseX to baseY) static bool IsValidInput(string number, string result, int baseX, int baseY) { return String.CompareOrdinal(ConvertFromDecimalToBaseY(ConvertToDecimal(result.ToArray(), baseY), baseX), number) == 0; } }
mit
liruqi/bigfoot
Interface/AddOns/Collector/Widget/PlanItem.lua
3690
BuildEnv(...) local PlanItem = Addon:NewClass('PlanItem', GUI:GetClass('ItemButton')) function PlanItem:Constructor() local Icon = self:CreateTexture(nil, 'ARTWORK') do Icon:SetPoint('LEFT', 4, 0) Icon:SetSize(38, 38) Icon:SetTexture([[Interface\ICONS\Achievement_BG_winbyten]]) end local Bg = self:CreateTexture(nil, 'BACKGROUND') do Bg:SetPoint('LEFT', Icon, 'RIGHT', 4, 0) Bg:SetPoint('TOPRIGHT') Bg:SetPoint('BOTTOMRIGHT') Bg:SetAtlas('PetList-ButtonBackground') end local Highlight = self:CreateTexture(nil, 'HIGHLIGHT') do Highlight:SetAllPoints(Bg) Highlight:SetAtlas('PetList-ButtonHighlight') end local Checked = self:CreateTexture(nil, 'OVERLAY') do Checked:SetAllPoints(Bg) Checked:SetAtlas('PetList-ButtonSelect') self:SetCheckedTexture(Checked) end local State = self:CreateFontString(nil, 'ARTWORK', 'GameFontNormalRight') do State:SetPoint('RIGHT', Bg, 'RIGHT', -10, 0) end local Text = self:CreateFontString(nil, 'ARTWORK', 'GameFontNormalLeft') do Text:SetPoint('LEFT', Bg, 'LEFT', 10, 0) Text:SetPoint('RIGHT', State, 'LEFT', -5, 0) Text:SetWordWrap(false) self:SetFontString(Text) end local ExtraIcon = self:CreateTexture(nil, 'BORDER') do ExtraIcon:SetSize(46, 44) ExtraIcon:SetPoint('BOTTOMRIGHT', -1, 1) end local Track = self:CreateTexture(nil, 'BORDER') do Track:Hide() Track:SetSize(16, 16) Track:SetPoint('TOPRIGHT', Bg) Track:SetTexture([[Interface\BUTTONS\UI-CheckBox-Check]]) end -- local StatusBar = CreateFrame('StatusBar', nil, self) do -- StatusBar:SetPoint('BOTTOMLEFT', Bg, 'BOTTOMLEFT', 2, 0) -- StatusBar:SetPoint('BOTTOMRIGHT', Bg, 'BOTTOMRIGHT', -2, 0) -- StatusBar:SetHeight(3) -- StatusBar:SetMinMaxValues(0, 100) -- StatusBar:SetValue(50) -- StatusBar:SetStatusBarTexture([[Interface\TargetingFrame\UI-StatusBar]], 'BACKGROUND') -- end -- local StatusBarText = StatusBar:CreateFontString(nil, 'ARTWORK') do -- StatusBarText:SetPoint('BOTTOMRIGHT', 0, 3) -- StatusBarText:SetFont(ChatFontNormal:GetFont(), 12) -- end self.Icon = Icon self.State = State self.StatusBar = StatusBar self.StatusBarText = StatusBarText self.ExtraIcon = ExtraIcon self.Track = Track self:SetScript('OnSizeChanged', self.OnSizeChanged) end function PlanItem:SetIcon(icon) self.Icon:SetTexture(icon) end function PlanItem:SetExtraTexture(texture, l, r, t, b) if not texture then self.ExtraIcon:Hide() else self.ExtraIcon:SetTexture(texture) self.ExtraIcon:SetTexCoord(l or 0, r or 1, t or 0, b or 1) self.ExtraIcon:Show() end end function PlanItem:SetExtraSize(w, h) self.ExtraIcon:SetSize(w, h) end function PlanItem:SetPlan(plan) local item = plan:GetObject() self:SetText(item:GetName()) self:SetIcon(item:GetIcon()) self:SetExtraTexture(item:GetTypeTexture()) self:SetExtraSize(item:GetTypeSize()) self.Track:SetShown(item:IsInTrack()) local state = item:IsCanKill() local text local color if state == true then text = BOSS_ALIVE color = GREEN_FONT_COLOR elseif state == false then text = BOSS_DEAD color = RED_FONT_COLOR end self.State:SetText(text) if color then self.State:SetTextColor(color.r, color.g, color.b) end end
mit
DemSquirrel/Le_Coinflip
www/js/admin/stathandler.js
1432
var socket = io() var statHandler = { getToken: function () { swal({ title: "The token i gave you, I need", text: "", type: "input", imageUrl: "https://monomythic.files.wordpress.com/2015/12/yoda-main-clean.jpg", showCancelButton: false, closeOnConfirm: false, animation: "slide-from-top", inputPlaceholder: "Yoda" }, function(inputValue){ if (inputValue === false) return false; if (inputValue === "") { swal.showInputError("You need to write something!"); return false } var myToken = statHandler.validateToken(inputValue) socket.on('validToken', function (token) { if(token == myToken){ swal.close() }else { window.location.replace("http://localhost:3000/") } }) }) }, validateToken: function (token) { var tokenChecked = token socket.emit('checkToken', token) return tokenChecked }, sortUserser: function (users) { var swapped; do { swapped = false; for (var i=0; i < users.length-1; i++) { if (users[i] > users[i+1]) { var temp = users[i]; users[i] = users[i+1]; users[i+1] = temp; swapped = true; } } } while (swapped); return users } } window.onload = function () { statHandler.getToken() }
mit
thekosmix/interview-street
oprp/_php/init_student.php
662
<?php require_once("config.php"); require_once("functions.php"); require_once("database.php"); require_once("session.php"); require_once("user.php"); require_once("branch.php"); require_once("student.php"); require_once("announcement.php"); require_once("acad_be.php"); require_once("acad_me.php"); require_once("acad_mba.php"); require_once("proj.php"); require_once("recruiter.php"); require_once("company.php"); require_once("application.php"); require_once("forum_topic.php"); require_once("forum_comment.php"); require_once("forum_subs.php"); $session->moveNotStudent(); date_default_timezone_set('Asia/Calcutta'); ?>
mit
david-driscoll/bike-computer
services/PathService.ts
771
import {Observable} from 'rxjs'; import {Injectable} from '@angular/core'; import _ from 'lodash'; import angles from 'angles'; import {DistanceService} from './DistanceService'; import {LocationService, LngLatArray} from './LocationService'; @Injectable() export class PathService { private _trip: Observable<LngLatArray[]>; constructor(distanceService: DistanceService, locationService: LocationService) { this._trip = distanceService.trip .auditTime(2000) .withLatestFrom(locationService.current) .scan<LngLatArray[]>((acc, [, lngLat]) => { acc.push([lngLat[0], lngLat[1]]); return acc; }, []) .share(); } public get trip() { return this._trip; } }
mit
mipmip/rspec_testlink_formatters
lib/rspec_testlink_formatters.rb
211
require "rspec_testlink_formatters/version" require File.expand_path(File.dirname(__FILE__) + "/rspec_testlink_export_cases") require File.expand_path(File.dirname(__FILE__) + "/rspec_testlink_junit_formatter")
mit
StevenUpForever/LeetCode_Java
src/bit_operation/Q751IPToCIDR.java
3877
package bit_operation; import java.util.ArrayList; import java.util.List; public class Q751IPToCIDR { //Difficulty: easy //TAG: Airbnb //TAG: bit operation /** * 751. IP to CIDR * Given a start IP address ip and a number of ips we need to cover n, return a representation of the range as a list (of smallest possible length) of CIDR blocks. * * A CIDR block is a string consisting of an IP, followed by a slash, and then the prefix length. For example: "123.45.67.89/20". That prefix length "20" represents the number of common prefix bits in the specified range. * * Example 1: * Input: ip = "255.0.0.7", n = 10 * Output: ["255.0.0.7/32","255.0.0.8/29","255.0.0.16/32"] * Explanation: * The initial ip address, when converted to binary, looks like this (spaces added for clarity): * 255.0.0.7 -> 11111111 00000000 00000000 00000111 * The address "255.0.0.7/32" specifies all addresses with a common prefix of 32 bits to the given address, * ie. just this one address. * * The address "255.0.0.8/29" specifies all addresses with a common prefix of 29 bits to the given address: * 255.0.0.8 -> 11111111 00000000 00000000 00001000 * Addresses with common prefix of 29 bits are: * 11111111 00000000 00000000 00001000 * 11111111 00000000 00000000 00001001 * 11111111 00000000 00000000 00001010 * 11111111 00000000 00000000 00001011 * 11111111 00000000 00000000 00001100 * 11111111 00000000 00000000 00001101 * 11111111 00000000 00000000 00001110 * 11111111 00000000 00000000 00001111 * * The address "255.0.0.16/32" specifies all addresses with a common prefix of 32 bits to the given address, * ie. just 11111111 00000000 00000000 00010000. * * In total, the answer specifies the range of 10 ips starting with the address 255.0.0.7 . * * There were other representations, such as: * ["255.0.0.7/32","255.0.0.8/30", "255.0.0.12/30", "255.0.0.16/32"], * but our answer was the shortest possible. * * Also note that a representation beginning with say, "255.0.0.7/30" would be incorrect, * because it includes addresses like 255.0.0.4 = 11111111 00000000 00000000 00000100 * that are outside the specified range. * Note: * ip will be a valid IPv4 address. * Every implied address ip + x (for x < n) will be a valid IPv4 address. * n will be an integer in the range [1, 1000]. */ /* Solution: 1. combine ip address to an integer 2. loop until range is filled 2.1 find the rightmost 1 by x & -x 2.2 right shift the 1 to <= current range, means fill with shortest prefix as much as possible 2.3 convert current x append with length to res 2.4 increase x by step to next possible shortest prefix 2.5 minus steps in range so that we know how much range left */ public List<String> ipToCIDR(String ip, int range) { long x = 0; String[] ips = ip.split("\\."); for (int i = 0; i < ips.length; ++i) { x = Integer.parseInt(ips[i]) + x * 256; } List<String> ans = new ArrayList<>(); while (range > 0) { long step = x & -x; while (step > range) step >>= 1; ans.add(longToIP(x, (int)step)); x += step; range -= step; } return ans; } String longToIP(long x, int step) { int[] ans = new int[4]; ans[0] = (int) (x & 255); x >>= 8; ans[1] = (int) (x & 255); x >>= 8; ans[2] = (int) (x & 255); x >>= 8; ans[3] = (int) x; int len = 33; while (step > 0) { len--; step >>= 2; } return ans[3] + "." + ans[2] + "." + ans[1] + "." + ans[0] + "/" + len; } }
mit
piiswrong/dec
caffe/src/caffe/test/test_entropy_t_loss_layer.cpp
6205
#include <cmath> #include <cstdlib> #include <cstring> #include <vector> #include "gtest/gtest.h" #include "caffe/blob.hpp" #include "caffe/common.hpp" #include "caffe/filler.hpp" #include "caffe/vision_layers.hpp" #include "caffe/test/test_caffe_main.hpp" #include "caffe/test/test_gradient_check_util.hpp" namespace caffe { const int M_ = 10; const int K_ = 10; const int N_ = 4; template <typename TypeParam> class EntropyTLossLayerTest : public MultiDeviceTest<TypeParam> { typedef typename TypeParam::Dtype Dtype; protected: EntropyTLossLayerTest() : blob_bottom_data_(new Blob<Dtype>(M_, 1, 1, K_)), blob_bottom_label_(new Blob<Dtype>(M_, 1, 1, N_)), blob_top_loss_(new Blob<Dtype>()), blob_top_std_(new Blob<Dtype>()), blob_top_ind_(new Blob<Dtype>()), blob_top_dist_(new Blob<Dtype>()) { // fill the values FillerParameter filler_param; filler_param.set_value(0); GaussianFiller<Dtype> filler(filler_param); filler.Fill(this->blob_bottom_data_); Dtype *cpu_label = blob_bottom_label_->mutable_cpu_data(); caffe_rng_uniform(blob_bottom_label_->count(), Dtype(0), Dtype(1), cpu_label); for (int i = 0; i < M_; i++) { Dtype norm = Dtype(0); for (int j = 0; j < N_; j++) { norm += cpu_label[i*N_+j]; } for (int j = 0; j < N_; j++) { cpu_label[i*N_+j] /= norm; } } blob_bottom_vec_.push_back(blob_bottom_data_); blob_bottom_vec_.push_back(blob_bottom_label_); blob_top_vec_.push_back(blob_top_loss_); blob_top_vec_.push_back(blob_top_std_); blob_top_vec_.push_back(blob_top_ind_); blob_top_vec_.push_back(blob_top_dist_); } virtual ~EntropyTLossLayerTest() { delete blob_bottom_data_; delete blob_bottom_label_; delete blob_top_loss_; delete blob_top_ind_; delete blob_top_std_; delete blob_top_dist_; } void TestForward() { // Get the loss without a specified objective weight -- should be // equivalent to explicitly specifiying a weight of 1. LayerParameter layer_param; layer_param.mutable_multi_t_loss_param()->set_num_center(N_); EntropyTLossLayer<Dtype> layer_weight_1(layer_param); layer_weight_1.SetUp(this->blob_bottom_vec_, &this->blob_top_vec_); layer_weight_1.Forward(this->blob_bottom_vec_, &this->blob_top_vec_); FillerParameter filler_param; GaussianFiller<Dtype> filler2(filler_param); filler2.Fill(layer_weight_1.blobs()[0].get()); caffe_rng_uniform(layer_weight_1.blobs()[1]->count(), Dtype(0.9), Dtype(1.1), layer_weight_1.blobs()[1]->mutable_cpu_data()); layer_weight_1.SetUp(this->blob_bottom_vec_, &this->blob_top_vec_); const Dtype loss_weight_1 = layer_weight_1.Forward(this->blob_bottom_vec_, &this->blob_top_vec_); // Get the loss again with a different objective weight; check that it is // scaled appropriately. const Dtype kLossWeight = 3.7; LayerParameter layer_param2; layer_param2.mutable_multi_t_loss_param()->set_num_center(N_); layer_param2.add_loss_weight(kLossWeight); EntropyTLossLayer<Dtype> layer_weight_2(layer_param2); layer_weight_2.SetUp(this->blob_bottom_vec_, &this->blob_top_vec_); layer_weight_2.Forward(this->blob_bottom_vec_, &this->blob_top_vec_); caffe_copy(layer_weight_2.blobs()[0]->count(), layer_weight_1.blobs()[0]->cpu_data(), layer_weight_2.blobs()[0]->mutable_cpu_data()); caffe_copy(layer_weight_2.blobs()[1]->count(), layer_weight_1.blobs()[1]->cpu_data(), layer_weight_2.blobs()[1]->mutable_cpu_data()); layer_weight_2.SetUp(this->blob_bottom_vec_, &this->blob_top_vec_); const Dtype loss_weight_2 = layer_weight_2.Forward(this->blob_bottom_vec_, &this->blob_top_vec_); const Dtype kErrorMargin = 1e-3; EXPECT_NEAR(loss_weight_1 * kLossWeight, loss_weight_2, kErrorMargin); // Make sure the loss is non-trivial. const Dtype kNonTrivialAbsThresh = 1e-1; EXPECT_GE(fabs(loss_weight_1), kNonTrivialAbsThresh); int m = M_, n = layer_param.multi_t_loss_param().num_center(), p = K_; Blob<Dtype> *distance = layer_weight_1.distance(); const Dtype *cpu_data = blob_bottom_data_->cpu_data(); const Dtype *cpu_dist = distance->cpu_data(); const Dtype *cpu_center = layer_weight_1.blobs()[0]->cpu_data(); const Dtype *cpu_sigma = layer_weight_1.blobs()[1]->cpu_data(); for (int i = 0; i < m; ++i) { for (int j = 0; j < n; ++j) { Dtype acc = Dtype(0); for (int k = 0; k < p; ++k) { acc += (cpu_data[i*p + k] - cpu_center[k*n + j])*(cpu_data[i*p + k] - cpu_center[k*n + j])*cpu_sigma[k*n+j]; } EXPECT_NEAR(acc, cpu_dist[i*n + j], kErrorMargin) << i << " " << j; } } } Blob<Dtype>* const blob_bottom_data_; Blob<Dtype>* const blob_bottom_label_; Blob<Dtype>* const blob_top_loss_; Blob<Dtype>* const blob_top_std_; Blob<Dtype>* const blob_top_ind_; Blob<Dtype>* const blob_top_dist_; vector<Blob<Dtype>*> blob_bottom_vec_; vector<Blob<Dtype>*> blob_top_vec_; }; TYPED_TEST_CASE(EntropyTLossLayerTest, TestDtypesAndDevices); TYPED_TEST(EntropyTLossLayerTest, TestForward) { this->TestForward(); } TYPED_TEST(EntropyTLossLayerTest, TestGradient) { typedef typename TypeParam::Dtype Dtype; LayerParameter layer_param; const Dtype kLossWeight = 1.0; layer_param.add_loss_weight(kLossWeight); layer_param.mutable_multi_t_loss_param()->set_num_center(N_); EntropyTLossLayer<Dtype> layer(layer_param); layer.SetUp(this->blob_bottom_vec_, &this->blob_top_vec_); layer.Forward(this->blob_bottom_vec_, &this->blob_top_vec_); FillerParameter filler_param; filler_param.set_value(0); GaussianFiller<Dtype> filler(filler_param); filler.Fill(this->blob_bottom_data_); filler.Fill(layer.blobs()[0].get()); //caffe_rng_uniform(layer.blobs()[1]->count(), Dtype(0.9), Dtype(1.1), layer.blobs()[1]->mutable_cpu_data()); //layer.SetUp(this->blob_bottom_vec_, &this->blob_top_vec_); GradientChecker<Dtype> checker(1e-2, 1e-2, 1701); checker.CheckGradientSingle(&layer, &(this->blob_bottom_vec_), &(this->blob_top_vec_), 0, 0, 0); } } // namespace caffe
mit
zekewang918/QuitSmoking
bbs/source/class/extend/extend_thread_rushreply.php
5555
<?php /** * [Discuz!] (C)2001-2099 Comsenz Inc. * This is NOT a freeware, use is subject to license terms * * $Id: extend_thread_rushreply.php 33048 2013-04-12 08:50:27Z zhangjie $ */ if(!defined('IN_DISCUZ')) { exit('Access Denied'); } class extend_thread_rushreply extends extend_thread_base { public function before_newthread($parameters) { if($this->group['allowpostrushreply']) { $_GET['rushreplyfrom'] = strtotime($_GET['rushreplyfrom']); $_GET['rushreplyto'] = strtotime($_GET['rushreplyto']); $_GET['rewardfloor'] = trim($_GET['rewardfloor']); $_GET['stopfloor'] = intval($_GET['stopfloor']); $_GET['replylimit'] = intval($_GET['replylimit']); $_GET['creditlimit'] = $_GET['creditlimit'] == '' ? '-996' : intval($_GET['creditlimit']); if($_GET['rushreplyfrom'] > $_GET['rushreplyto'] && !empty($_GET['rushreplyto'])) { showmessage('post_rushreply_timewrong'); } if(($_GET['rushreplyfrom'] > TIMESTAMP) || (!empty($_GET['rushreplyto']) && $_GET['rushreplyto'] < TIMESTAMP) || ($_GET['stopfloor'] == 1) ) { $this->param['closed'] = true; } if(!empty($_GET['rewardfloor']) && !empty($_GET['stopfloor'])) { $floors = explode(',', $_GET['rewardfloor']); if(!empty($floors) && is_array($floors)) { foreach($floors AS $key => $floor) { if(strpos($floor, '*') === false) { if(intval($floor) == 0) { unset($floors[$key]); } elseif($floor > $_GET['stopfloor']) { unset($floors[$key]); } } } $_GET['rewardfloor'] = implode(',', $floors); } } $parameters['tstatus'] = setstatus(3, 1, $parameters['tstatus']); $parameters['tstatus'] = setstatus(1, 1, $parameters['tstatus']); $this->param['tstatus'] = $parameters['tstatus']; } } public function after_newthread() { if($this->group['allowpostrushreply']) { $rushdata = array('tid' => $this->tid, 'stopfloor' => $_GET['stopfloor'], 'starttimefrom' => $_GET['rushreplyfrom'], 'starttimeto' => $_GET['rushreplyto'], 'rewardfloor' => $_GET['rewardfloor'], 'creditlimit' => $_GET['creditlimit'], 'replylimit' => $_GET['replylimit']); C::t('forum_threadrush')->insert($rushdata); } } public function before_newreply() { global $_G, $rushinfo; if(getstatus($this->thread['status'], 3) && $rushinfo['replylimit'] > 0) { $replycount = C::t('forum_post')->count_by_tid_invisible_authorid($this->thread['tid'], $_G['uid']); if($replycount >= $rushinfo['replylimit']) { showmessage('noreply_replynum_error'); } } } public function after_newreply() { global $rushinfo; if(getstatus($this->thread['status'], 3) && $this->param['maxposition']) { $rushstopfloor = $rushinfo['stopfloor']; if($rushstopfloor > 0 && $this->thread['closed'] == 0 && $this->param['maxposition'] >= $rushstopfloor) { $this->param['updatethreaddata'] = array_merge((array)$this->param['updatethreaddata'], array('closed' => 1)); } } } public function before_editpost($parameters) { global $_G, $rushreply; $isfirstpost = $this->post['first'] ? 1 : 0; if($isfirstpost) { if($rushreply) { $_GET['rushreplyfrom'] = strtotime($_GET['rushreplyfrom']); $_GET['rushreplyto'] = strtotime($_GET['rushreplyto']); $_GET['rewardfloor'] = trim($_GET['rewardfloor']); $_GET['stopfloor'] = intval($_GET['stopfloor']); $_GET['replylimit'] = intval($_GET['replylimit']); $_GET['creditlimit'] = $_GET['creditlimit'] == '' ? '-996' : intval($_GET['creditlimit']); if($_GET['rushreplyfrom'] > $_GET['rushreplyto'] && !empty($_GET['rushreplyto'])) { showmessage('post_rushreply_timewrong'); } $maxposition = C::t('forum_post')->fetch_maxposition_by_tid($this->thread['posttableid'], $this->thread['tid']); if($this->thread['closed'] == 1 && ((!$_GET['rushreplyfrom'] && !$_GET['rushreplyto']) || ($_GET['rushreplyfrom'] < $_G['timestamp'] && $_GET['rushreplyto'] > $_G['timestamp']) || (!$_GET['rushreplyfrom'] && $_GET['rushreplyto'] > $_G['timestamp']) || ($_GET['stopfloor'] && $_GET['stopfloor'] > $maxposition) )) { $this->param['threadupdatearr']['closed'] = 0; } elseif($this->thread['closed'] == 0 && (($_GET['rushreplyfrom'] && $_GET['rushreplyfrom'] > $_G['timestamp']) || ($_GET['rushreplyto'] && $_GET['rushreplyto'] && $_GET['rushreplyto'] < $_G['timestamp']) || ($_GET['stopfloor'] && $_GET['stopfloor'] <= $maxposition) )) { $this->param['threadupdatearr']['closed'] = 1; } if(!empty($_GET['rewardfloor']) && !empty($_GET['stopfloor'])) { $floors = explode(',', $_GET['rewardfloor']); if(!empty($floors)) { foreach($floors AS $key => $floor) { if(strpos($floor, '*') === false) { if(intval($floor) == 0) { unset($floors[$key]); } elseif($floor > $_GET['stopfloor']) { unset($floors[$key]); } } } } $_GET['rewardfloor'] = implode(',', $floors); } $rushdata = array('stopfloor' => $_GET['stopfloor'], 'starttimefrom' => $_GET['rushreplyfrom'], 'starttimeto' => $_GET['rushreplyto'], 'rewardfloor' => $_GET['rewardfloor'], 'creditlimit' => $_GET['creditlimit'], 'replylimit' => $_GET['replylimit']); C::t('forum_threadrush')->update($this->thread['tid'], $rushdata); } } } public function before_deletepost() { global $rushreply; if($rushreply) { showmessage('post_edit_delete_rushreply_nopermission', NULL); } } } ?>
mit
drem-darios/heartbeat
src/main/java/com/drem/heartbeat/common/EventListenerList.java
10080
/* * %W% %E% * * Copyright (c) 2006, Oracle and/or its affiliates. All rights reserved. * ORACLE PROPRIETARY/CONFIDENTIAL. Use is subject to license terms. */ package com.drem.heartbeat.common; import java.io.IOException; import java.io.ObjectInputStream; import java.io.ObjectOutputStream; import java.io.Serializable; import java.lang.reflect.Array; import java.util.EventListener; /** * A class that holds a list of EventListeners. A single instance can be used to * hold all listeners (of all types) for the instance using the list. It is the * responsiblity of the class using the EventListenerList to provide type-safe * API (preferably conforming to the JavaBeans spec) and methods which dispatch * event notification methods to appropriate Event Listeners on the list. The * main benefits that this class provides are that it is relatively cheap in the * case of no listeners, and it provides serialization for event-listener lists * in a single place, as well as a degree of MT safety (when used correctly). * Usage example: Say one is defining a class that sends out FooEvents, and one * wants to allow users of the class to register FooListeners and receive * notification when FooEvents occur. The following should be added to the class * definition: * * <pre> * EventListenerList listenerList = new EventListenerList(); * FooEvent fooEvent = null; * * public void addFooListener(FooListener l) { * listenerList.add(FooListener.class, l); * } * * public void removeFooListener(FooListener l) { * listenerList.remove(FooListener.class, l); * } * * // Notify all listeners that have registered interest for * // notification on this event type. The event instance * // is lazily created using the parameters passed into * // the fire method. * * protected void fireFooXXX() { * // Guaranteed to return a non-null array * Object[] listeners = listenerList.getListenerList(); * // Process the listeners last to first, notifying * // those that are interested in this event * for (int i = listeners.length - 2; i &gt;= 0; i -= 2) { * if (listeners[i] == FooListener.class) { * // Lazily create the event: * if (fooEvent == null) * fooEvent = new FooEvent(this); * ((FooListener) listeners[i + 1]).fooXXX(fooEvent); * } * } * } * </pre> * * foo should be changed to the appropriate name, and fireFooXxx to the * appropriate method name. One fire method should exist for each notification * method in the FooListener interface. * <p> * <strong>Warning:</strong> Serialized objects of this class will not be * compatible with future Swing releases. The current serialization support is * appropriate for short term storage or RMI between applications running the * same version of Swing. As of 1.4, support for long term storage of all * JavaBeans<sup><font size="-2">TM</font></sup> has been added to the * <code>java.beans</code> package. Please see {@link java.beans.XMLEncoder}. * * @version %I% %G% * @author Georges Saab * @author Hans Muller * @author James Gosling */ public class EventListenerList implements Serializable { private static final long serialVersionUID = -374845298068852567L; /* A null array to be shared by all empty listener lists */ private final static Object[] NULL_ARRAY = new Object[0]; /* The list of ListenerType - Listener pairs */ protected transient Object[] listenerList = NULL_ARRAY; /** * Passes back the event listener list as an array of ListenerType-listener * pairs. Note that for performance reasons, this implementation passes back * the actual data structure in which the listener data is stored * internally! This method is guaranteed to pass back a non-null array, so * that no null-checking is required in fire methods. A zero-length array of * Object should be returned if there are currently no listeners. WARNING!!! * Absolutely NO modification of the data contained in this array should be * made -- if any such manipulation is necessary, it should be done on a * copy of the array returned rather than the array itself. */ public Object[] getListenerList() { return listenerList; } /** * Return an array of all the listeners of the given type. * * @return all of the listeners of the specified type. * @exception ClassCastException if the supplied class is not assignable to * EventListener * @since 1.3 */ @SuppressWarnings("unchecked") public <T extends EventListener> T[] getListeners(Class<T> t) { Object[] lList = listenerList; int n = getListenerCount(lList, t); T[] result = (T[]) Array.newInstance(t, n); int j = 0; for (int i = lList.length - 2; i >= 0; i -= 2) { if (lList[i] == t) { result[j++] = (T) lList[i + 1]; } } return result; } /** * Returns the total number of listeners for this listener list. */ public int getListenerCount() { return listenerList.length / 2; } /** * Returns the total number of listeners of the supplied type for this * listener list. */ public int getListenerCount(Class<?> t) { Object[] lList = listenerList; return getListenerCount(lList, t); } @SuppressWarnings("rawtypes") private int getListenerCount(Object[] list, Class t) { int count = 0; for (int i = 0; i < list.length; i += 2) { if (t == (Class) list[i]) count++; } return count; } /** * Adds the listener as a listener of the specified type. * * @param t the type of the listener to be added * @param l the listener to be added */ public synchronized <T extends EventListener> void add(Class<T> t, T l) { if (l == null) { // In an ideal world, we would do an assertion here // to help developers know they are probably doing // something wrong return; } if (!t.isInstance(l)) { throw new IllegalArgumentException("Listener " + l + " is not of type " + t); } if (listenerList == NULL_ARRAY) { // if this is the first listener added, // initialize the lists listenerList = new Object[] { t, l }; } else { // Otherwise copy the array and add the new listener int i = listenerList.length; Object[] tmp = new Object[i + 2]; System.arraycopy(listenerList, 0, tmp, 0, i); tmp[i] = t; tmp[i + 1] = l; listenerList = tmp; } } /** * Removes the listener as a listener of the specified type. * * @param t the type of the listener to be removed * @param l the listener to be removed */ public synchronized <T extends EventListener> void remove(Class<T> t, T l) { if (l == null) { // In an ideal world, we would do an assertion here // to help developers know they are probably doing // something wrong return; } if (!t.isInstance(l)) { throw new IllegalArgumentException("Listener " + l + " is not of type " + t); } // Is l on the list? int index = -1; for (int i = listenerList.length - 2; i >= 0; i -= 2) { if ((listenerList[i] == t) && (listenerList[i + 1].equals(l) == true)) { index = i; break; } } // If so, remove it if (index != -1) { Object[] tmp = new Object[listenerList.length - 2]; // Copy the list up to index System.arraycopy(listenerList, 0, tmp, 0, index); // Copy from two past the index, up to // the end of tmp (which is two elements // shorter than the old list) if (index < tmp.length) System.arraycopy(listenerList, index + 2, tmp, index, tmp.length - index); // set the listener array to the new array or null listenerList = (tmp.length == 0) ? NULL_ARRAY : tmp; } } // Serialization support. @SuppressWarnings("rawtypes") private void writeObject(ObjectOutputStream s) throws IOException { Object[] lList = listenerList; s.defaultWriteObject(); // Save the non-null event listeners: for (int i = 0; i < lList.length; i += 2) { Class t = (Class) lList[i]; EventListener l = (EventListener) lList[i + 1]; if ((l != null) && (l instanceof Serializable)) { s.writeObject(t.getName()); s.writeObject(l); } } s.writeObject(null); } @SuppressWarnings("unchecked") private void readObject(ObjectInputStream s) throws IOException, ClassNotFoundException { listenerList = NULL_ARRAY; s.defaultReadObject(); Object listenerTypeOrNull; while (null != (listenerTypeOrNull = s.readObject())) { ClassLoader cl = Thread.currentThread().getContextClassLoader(); EventListener l = (EventListener) s.readObject(); add((Class<EventListener>) Class.forName((String) listenerTypeOrNull, true, cl), l); } } /** * Returns a string representation of the EventListenerList. */ @SuppressWarnings("rawtypes") public String toString() { Object[] lList = listenerList; String s = "EventListenerList: "; s += lList.length / 2 + " listeners: "; for (int i = 0; i <= lList.length - 2; i += 2) { s += " type " + ((Class) lList[i]).getName(); s += " listener " + lList[i + 1]; } return s; } }
mit
pwnbus/scoring_engine
tests/scoring_engine/web/web_test.py
2286
import importlib from flask import render_template as render_template_orig from scoring_engine.web import app from scoring_engine.models.team import Team from scoring_engine.models.user import User from tests.scoring_engine.unit_test import UnitTest from mock import MagicMock, call class WebTest(UnitTest): def setup(self): super(WebTest, self).setup() self.app = app self.app.config['TESTING'] = True self.app.config['WTF_CSRF_ENABLED'] = False self.client = self.app.test_client() self.ctx = self.app.app_context() self.ctx.push() view_name = self.__class__.__name__[4:] self.view_module = importlib.import_module('scoring_engine.web.views.' + view_name.lower(), '*') self.view_module.render_template = MagicMock() self.mock_obj = self.view_module.render_template self.mock_obj.side_effect = lambda *args, **kwargs: render_template_orig(*args, **kwargs) def teardown(self): self.ctx.pop() super(WebTest, self).teardown() def build_args(self, *args, **kwargs): return call(*args, **kwargs) def verify_auth_required(self, path): resp = self.client.get(path) assert resp.status_code == 302 assert '/login?' in resp.location def verify_auth_required_post(self, path): resp = self.client.post(path) assert resp.status_code == 302 assert '/login?' in resp.location def login(self, username, password): return self.client.post("/login", data={ "username": username, "password": password, }, follow_redirects=True) def logout(self): return self.get("/logout", follow_redirects=True) def auth_and_get_path(self, path): self.client.post("/login", data={ "username": 'testuser', "password": 'testpass', }) return self.client.get(path) def create_default_user(self): team1 = Team(name="Team 1", color="White") self.session.add(team1) user1 = User(username='testuser', password='testpass', team=team1) self.session.add(user1) self.session.commit() return user1 def test_debug(self): assert type(self.app.debug) is bool
mit
nuzzio/grunt-strip-code
test/fixtures/legacy_start_end.js
174
/* start-test-block */ // call a func that does something /* end-test-block */ function free(a, b, c /* start-test-block */ , d /* end-test-block */) { // do something }
mit
wizawu/1c
@types/jdk/java.net.SocketOption.d.ts
153
declare namespace java { namespace net { interface SocketOption<T> { name(): java.lang.String type(): java.lang.Class<T> } } }
mit
EffectHub/effecthub
application/views/mail/mailboxsend.php
6502
<?php $this->load->view('header') ?> <div id="content" class="group"> <div class="notice-alert"> <h3><!-- message goes here --></h3> <a href="http://effecthub.com/#" class="close"> <img alt="Icon-x-30-white" src="<?=base_url()?>images/icon-x-30-white.png" width="15"> </a> </div> <div id="main" class="main"> <?php if (!$this->session->userdata('id')){ ?> <div class="full full-pitch group"> <h1 class="compact"> <strong>EffectHub is connecting the world's gaming designers and developers.</strong> <a href="<?=site_url('register')?>" class="form-sub tagline-action">Sign up</a> <a rel="tipsy" original-title="Sign up with your Twitter account" class="auth-twitter tagline-action" href="<?=site_url('login/twitter')?>"></a> <a rel="tipsy" original-title="Sign up with your Facebook account" class="auth-facebook tagline-action" href="<?=site_url('login/facebook')?>"></a> <a rel="tipsy" original-title="Sign up with your Weibo account" class="auth-weibo tagline-action" href="<?=site_url('login/sina')?>"></a> </h1> </div> <?php }?> <ul class="tabs"> <li class="<?php echo $feature=='Profile'?'active':'' ?>"> <a href="<?=site_url('user/'.$this->session->userdata('id'))?>" class="has-dd">My Profile</a> </li> <li class="<?php echo $feature=='Mailbox'?'active':'' ?>"> <a href="<?=site_url('user/checkmail/'.$this->session->userdata('id'))?>" class="has-dd">My Mail Box</a> </li> <li class="<?php echo $feature=='Notification'?'active':'' ?>"> <a href="<?=site_url('user/notice/'.$this->session->userdata('id'))?>" class="has-dd">Notification</a> </li> </ul> <ol class="effecthubs group" style="margin-top:30px"> <form method="post" action="<?=site_url('user/operatechosedmail/0')?>"> <div class="mailstyle" name="<?php echo $this->session->userdata('id')?>"> <div class="aside" style="width:100%"> <a class="form-sub" href="<?=site_url('user/choosefollowing/'.$this->session->userdata('id'))?>">Write letter to my following</a> <a class="form-sub" href="<?=site_url('user/showfollowing/'.$this->session->userdata('id'))?>">Go to list of my following</a> </div> <div class="mailmain" style="margin-top:30px"> <div class="tabs"> <a href="<?=site_url('user/checkmail/'.$this->session->userdata('id'))?>" class="junkmailstyle">Inbox(<?php echo $unreadcount; ?> unread)</a> <a href="<?=site_url('user/checkjunkmail/'.$this->session->userdata('id'))?>" class="junkmailstyle">Junk mail(<?php echo $unreadjunkcount; ?> unread)</a> <a href="<?=site_url('user/checksendmail/'.$this->session->userdata('id'))?>" class="inboxstyle">Outbox</a> <!--<div style="float: right;position: relative;"> Select: <select id="mailcatagory" name="mailcatagory"> <option value="all" selected="selected">All Mail</option> <option value="Unread">Unread Mail</option> <option value="read">Read Mail</option> </select> </div>--> </div> <div class="mailcontent"> <ul> <?php foreach($mail_list as $_mail): ?> <li id="<?php echo $_mail['id']; ?>"> <div class="picture"> <a href="<?=site_url('user/'.$_mail['sender_id'])?>"><img src="<?php echo $_mail['author_pic']; ?>" width="45px" height="45px"></a> </div> <div class="title"> <div class="sender"> <span class="time"><?php echo tranTime(strtotime($_mail['timestamp'])); ?></span> <span class="from"><a href="<?=site_url('user/readmail/'.$_mail['id'].'/receiver_id')?>" style="color:#A1A1A1"><?php echo $_mail['author_name']; ?></a></span> </div> <div class="sender"> <span class="time"> <!--<a rel="direct" title="Move to Junk Mail?" class="operate_link" href="<?=site_url('user/movesendmail/'.$_mail['id'])?>">Move to Junk Mail</a>--> <a title="Are you sure to delete this mail?" class="operate_link" href="<?=site_url('user/deletesendmail/'.$_mail['id'])?>" >Delete</a> <input type="checkbox" name="choosemail[]" value="<?php echo $_mail['id']; ?>"> </span> <span class="from"><a href="<?=site_url('user/readmail/'.$_mail['id'].'/receiver_id')?>" class="url"><?php echo $_mail['content']; ?></a></span> </div> </div> </li> <?php endforeach; ?> </ul> <div class='paragraphstyle' style='font-weight: bold;font-size:16px;padding:10px;margin-bottom:20px'><?php echo $this->pagination->create_links();?></div> </div> <div class="mailoperate"> <input type="submit" name="deletechosedmail" onclick="return confirm('Are you sure to delete choosed mail?')" value="Delete"> <!--<input type="submit" name="movechosedmail" value="Move to Junk Mail">--> <!--<a href="<?=site_url('user/markallread/1')?>" style="margin-left:22px;">Mark all as Read</a>--> </div> </div> </div> </form> </ol> <div class="page"> </div> </div> <!-- /main --> <div class="secondary"> <div class="what-is-pro-search"> <h3>Search <span class="meta">Authors</span></h3> <form name="author_search_form" class="gen-form" action="<?=site_url('author/authorSearch')?>" method="post" onkeydown="if(event.keyCode==13){document.author_search_form.submit();}"> <div id='main-search' class='clearfix'> <div id='main-search-box' class='clearfix'> <fieldset> <input type="text" style="background: rgba(255, 255, 255, 1);" id='particle_search_field' name="search" onblur="if (this.value == '') {this.value = 'Search author';}" onfocus="if (this.value == 'Search author') {this.value = '';}" value="Search author" x-webkit-speech="" speech=""> </fieldset> </div> </div> </form> </div> </div> </div> <!-- /content --> </div></div> <!-- /wrap --> <?php $this->load->view('footer') ?>
mit
billhj/Etoile-java
OdeApp/src/org/etoile/animation/ode/JointType.java
1430
/* * The MIT License * * Copyright 2014 Jing Huang <gabriel.jing.huang@gmail.com or jing.huang@telecom-paristech.fr>. * * Permission is hereby granted, free of charge, to any person obtaining a copy * of this software and associated documentation files (the "Software"), to deal * in the Software without restriction, including without limitation the rights * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell * copies of the Software, and to permit persons to whom the Software is * furnished to do so, subject to the following conditions: * * The above copyright notice and this permission notice shall be included in * all copies or substantial portions of the Software. * * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN * THE SOFTWARE. */ package org.etoile.animation.ode; /** * * @author Jing Huang * <gabriel.jing.huang@gmail.com or jing.huang@telecom-paristech.fr> */ public enum JointType { FIXED, HINGE, UNIVERSAL, BALL; }
mit
rocktavious/DevToolsLib
DTL/api/decorators.py
6338
import sys import time import cProfile import pstats import datetime from functools import wraps from DTL.api import loggingUtils, threadlib, Path #------------------------------------------------------------ #------------------------------------------------------------ class PreAndPost(object): __metaclass__ = loggingUtils.LoggingMetaclass def __init__(self, func): self.func = func wraps(func)(self) def __get__(self, obj, type=None): return self.__class__(self.func.__get__(obj, type)) def __call__(self, *args, **kwds): return self.call(*args, **kwds) def pre_call(self, *args, **kwds): pass def call(self, *args, **kwds): return self.func(*args, **kwds) def post_call(self, *args, **kwds): pass def error(self, retval, *args, **kwds): self.log.exception("") #------------------------------------------------------------ #------------------------------------------------------------ class Safe(PreAndPost): def __init__(self, func): super(Safe, self).__init__(func) def __call__(self, *args, **kwds): retval = None try: self.pre_call(*args, **kwds) retval = self.call(*args, **kwds) except KeyboardInterrupt: raise Exception("Keyboard interruption detected") except: self.error(retval, *args, **kwds) finally: try: self.post_call(retval, *args, **kwds) except: try: self.error(retval, *args, **kwds) except: pass return retval def error(self, retval, *args, **kwds): if self.log.handlers : self.log.exception("") #------------------------------------------------------------ #------------------------------------------------------------ class Timer(Safe): """A decorator which times a callable but also provides some timing functions to the func through itself being passed as a param to the function call""" def __init__(self, func): super(Timer, self).__init__(func) self._name = str(self.func.__name__) self.reset() def reset(self): self._starttime = datetime.datetime.now() self._lapStack = [] self._records = [] self._laps = [] def recordLap(self, elapsed, message): self._records.append('\tlap: {0} | {1}'.format(elapsed, message)) def startLap(self, message): self._lapStack.append((message,datetime.datetime.now())) return True def stopLap(self): if not self._lapStack: return False curr = datetime.datetime.now() message, start = self._lapStack.pop() #process the elapsed time elapsed = str(curr - start) if not '.' in elapsed: elapsed += '.' while len(elapsed) < 14 : elapsed += '0' self.recordLap(elapsed, message) def newLap(self, message): """ Convenience method to stop the current lap and create a new lap """ self.stopLap() self.startLap(message) def stop(self): #stop all the laps if not stopped while self._lapStack: self.stopLap() total = str(datetime.datetime.now() - self._starttime) #output the logs self.log.info('Time:{0} | {1} Stopwatch'.format(total,self._name)) for record in self._records : self.log.info(record) return True def pre_call(self, *args, **kwds): self.startLap(self.func.__name__) def call(self, *args, **kwds): return self.func(timer=self, *args, **kwds) def post_call(self, *args, **kwds): self.stop() #------------------------------------------------------------ #------------------------------------------------------------ class CommandTicker(Safe): TICKS = ['[. ]', '[.. ]', '[...]', '[ ..]', '[ .]', '[ ]'] def __init__(self, func, *args, **kwds): """A decorater that shows a command line progress bar for commandline operations that will take a long time""" super(CommandTicker, self).__init__(func, *args, **kwds) self.ticker_thread = threadlib.ThreadedProcess(*args, **kwds) self.ticker_thread.run = self.run def run(self): i = 0 first = True while self.ticker_thread.isMainloopAlive: time.sleep(.25) if i == len(self.TICKS): first = False i = 0 if not first: sys.stderr.write("\r{0}\r".format(self.TICKS[i])) sys.stderr.flush() i += 1 sys.stderr.flush() def pre_call(self, *args, **kwds): self.ticker_thread.start() def post_call(self, retval, *args, **kwds): self.ticker_thread.stop() sys.stderr.flush() sys.stderr.write(" ") sys.stderr.flush() #------------------------------------------------------------ class Profile(Safe): """A decorator which profiles a callable.""" def __init__(self, func, sort='cumulative', strip_dirs=False): super(Profile, self).__init__(func) self.sort = sort self.strip_dirs = strip_dirs base_path = Path.getTempPath().join('profile') base_path.makedirs() self.profile_path = base_path.join('{0}.{1}.profile'.format(func.__module__, func.__name__)) self.stats_path = base_path.join('{0}.{1}.log'.format(func.__module__, func.__name__)) self.profile = cProfile.Profile() def call(self, *args, **kwds): return self.profile.runcall(self.func, *args, **kwds) def post_call(self, retval, *args, **kwds): stream = open(self.stats_path, 'w') self.profile.dump_stats(self.profile_path) stats = pstats.Stats(self.profile_path, stream=stream) if self.strip_dirs: stats.strip_dirs() if isinstance(self.sort, (tuple, list)): stats.sort_stats(*self.sort) else: stats.sort_stats(self.sort) stats.print_stats() self.profile_path.remove()
mit
VAGAScom/basquiat
lib/basquiat/adapters/rabbitmq/requeue_strategies/dead_lettering.rb
1630
# frozen_string_literal: true module Basquiat module Adapters class RabbitMq class DeadLettering < BaseStrategy class << self attr_reader :options def setup(opts) @options = { session: { queue: { options: { 'x-dead-letter-exchange' => opts.fetch(:exchange, 'basquiat.dlx') } } }, dlx: { ttl: opts.fetch(:ttl, 1_000) } } end def session_options options.fetch :session end end def initialize(session) super setup_dead_lettering end def run(message) catch :skip_processing do check_incoming_messages(message.props.headers) yield end public_send(message.action, message) end private def check_incoming_messages(headers) headers && headers['x-death'][1]['queue'] != session.queue.name && throw(:skip_processing) end def options self.class.options end def setup_dead_lettering dlx = session.channel.topic('basquiat.dlx') queue = session.channel.queue('basquiat.dlq', arguments: { 'x-dead-letter-exchange' => session.exchange.name, 'x-message-ttl' => options[:dlx][:ttl] }) queue.bind(dlx, routing_key: '#') end end end end end
mit
bredele/drag
test/drag.js
397
/** * Test dependencies. */ var assert = require('assert'); var drag = require('..'); var round = require('round'); describe("drag forces", function() { describe('dry air', function() { describe("ball", function() { var area = 0.0001 * Math.PI * 15 * 15; it('velocity 10 m.s-2', function() { assert.equal(round(drag(10, 0.47, area), 6), 2.000126); }); }); }); });
mit
mjrasobarnett/ucnsim
geom/source_tube/sourcetube_gaps.C
8275
// This is a model of the 'Real' cryoEDM sourcetube - 25/01/2010 #include "TGeoManager.h" #include "TGLViewer.h" #include "TGLCamera.h" #include "TGLPerspectiveCamera.h" #include "../../include/Units.h" #include "../../include/Constants.h" #include "../../include/Materials.h" #include "../../include/GeomParameters.h" Bool_t Build_Geom(const TGeoManager* geoManager); Bool_t Draw_Geom(const TGeoManager* geoManager); using namespace GeomParameters; //__________________________________________________________________________ Int_t sourcetube_gaps() { // Create the geoManager TGeoManager* geoManager = new TGeoManager("GeoManager","Geometry Manager"); // Build and write to file the simulation and visualisation geoms Build_Geom(geoManager); Draw_Geom(geoManager); return 0; } //__________________________________________________________________________ Bool_t Build_Geom(const TGeoManager* geoManager) { // ------------------------------------- // BUILDING GEOMETRY // Materials - Define the materials used. Leave the neutron properties // to be defined on a run-by-run basis Materials::BuildMaterials(geoManager); TGeoMedium* beryllium = geoManager->GetMedium("Beryllium"); TGeoMedium* blackhole = geoManager->GetMedium("BlackHole"); TGeoMedium* heliumII = geoManager->GetMedium("HeliumII"); // ------------------------------------- // -- Making Top Volume Box* topShape = new Box("Top",100,100,100); BlackHole* top = new BlackHole("Top", topShape, blackhole); geoManager->SetTopVolume(top); top->SetVisibility(kFALSE); // -- Make the boundary volume in which all the others sit // -- This is what we will be reflecting off all the time Double_t surfaceRoughness = 0.1; Box* chamberShape = new Box("Chamber",10,10,10); Boundary* chamber = new Boundary("Chamber", chamberShape, beryllium, surfaceRoughness); chamber->SetLineColor(kOrange-7); chamber->SetLineWidth(1); chamber->SetVisibility(kFALSE); chamber->SetTransparency(80); // Add to geom top->AddNode(chamber,1); // ------------------------------------- // -- SOURCE TUBE // -- Source tube has 13 segments, all of which are identical // -- (except one which has a hole in the top) Double_t segmentYPosition = sourceSegHalfLength; for (Int_t segNum = 1; segNum <= 13; segNum++) { // -- Make a SourceTube Segment Char_t sourceMatrixName[20], sourceSegName[20], sourceGapMatrixName[20]; sprintf(sourceSegName, "SourceSeg%d", segNum); Tube *sourceSegShape = new Tube(sourceSegName, sourceSegRMin, sourceSegRMax, sourceSegHalfLength); TrackingVolume* sourceSeg = new TrackingVolume(sourceSegName, sourceSegShape, heliumII); sourceSeg->SetLineColor(kAzure-4); sourceSeg->SetLineWidth(1); sourceSeg->SetVisibility(kTRUE); sourceSeg->SetTransparency(20); // -- Define SourceTube matrix TGeoRotation segmentRot("SegmentRot",0,sourceSegAngle,0); // phi, theta, psi TGeoTranslation segmentTra("SegmentTra",0.,segmentYPosition,0.); // x, y, z TGeoCombiTrans segmentCom(segmentTra,segmentRot); TGeoHMatrix segmentMat = segmentCom; sprintf(sourceMatrixName, "SourceMatrix%d", segNum); segmentMat.SetName(sourceMatrixName); // Add SourceTube segment to geometry chamber->AddNode(sourceSeg, segNum, new TGeoHMatrix(segmentMat)); // Shift next segment along by length of segment segmentYPosition += 2.0*sourceSegHalfLength; } // ------------------------------------- // -- SOURCE TUBE GAPS // -- Create 12 gaps between each source tube segment Double_t gapYPosition = 2.0*sourceSegHalfLength; for (Int_t segNum = 1; segNum <= 13; segNum++) { // -- Make a Gap between Segments Char_t sourceGapMatrixName[20], sourceSegGapName[20]; sprintf(sourceSegGapName, "SourceSegGap%d", segNum); Tube *sourceSegGapShape = new Tube(sourceSegGapName, sourceSegGapRMin, sourceSegGapRMax, sourceSegGapHalfLength); BlackHole* sourceSegGap = new BlackHole(sourceSegGapName, sourceSegGapShape, blackhole); sourceSegGap->SetLineColor(kGray); sourceSegGap->SetLineWidth(1); sourceSegGap->SetVisibility(kTRUE); sourceSegGap->SetTransparency(20); // -- Define SourceTube matrix TGeoRotation segmentGapRot("SegmentGapRot",0,sourceSegGapAngle,0); // phi, theta, psi TGeoTranslation segmentGapTra("SegmentGapTra",0.,gapYPosition,0.); // x, y, z TGeoCombiTrans segmentGapCom(segmentGapTra,segmentGapRot); TGeoHMatrix segmentGapMat = segmentGapCom; sprintf(sourceGapMatrixName, "SourceGapMatrix%d", segNum); segmentGapMat.SetName(sourceGapMatrixName); // Add SourceTube Gap segment to geometry chamber->AddNode(sourceSegGap, segNum, new TGeoHMatrix(segmentGapMat)); // Shift next segment along by length of segment gapYPosition += 2.0*sourceSegHalfLength; } // ------------------------------------- // -- SOURCE VALVE // Valve entrance volume is a shorter source-tube segment-like that connects // the valve volume to the source Tube *valveVolEntranceShape = new Tube("ValveVolEntrance", valveVolEntranceRMin, valveVolEntranceRMax, valveVolEntranceHalfLength); TrackingVolume* valveVolEntrance = new TrackingVolume("ValveVolEntrance", valveVolEntranceShape, heliumII); valveVolEntrance->SetLineColor(kTeal-3); valveVolEntrance->SetLineWidth(1); valveVolEntrance->SetVisibility(kTRUE); valveVolEntrance->SetTransparency(20); // -- Define the Valve volume entrance TGeoRotation valveVolEntranceRot("ValveVolEntranceRot",0,valveVolEntranceAngle,0); TGeoTranslation valveVolEntranceTra("ValveVolEntranceTra",0.,valveVolEntranceYDisplacement,0.); TGeoCombiTrans valveVolEntranceCom(valveVolEntranceTra,valveVolEntranceRot); TGeoHMatrix valveVolEntranceMat = valveVolEntranceCom; chamber->AddNode(valveVolEntrance, 1, new TGeoHMatrix(valveVolEntranceMat)); // ------------------------------------- // -- Close Geometry geoManager->CloseGeometry(); // ------------------------------------- // -- Write out geometry to file const char *fileName = "$(UCN_GEOM)/sourcetube/sourcetube_gaps.root"; cerr << "Simulation Geometry Built... Writing to file: " << fileName << endl; geoManager->Export(fileName); return kTRUE; } //__________________________________________________________________________ Bool_t Draw_Geom(const TGeoManager* geoManager) { // ------------------------------------- // -- Draw the vis-geometry in OpenGLViewer TCanvas* canvas = new TCanvas("GeomCanvas","Canvas for visualisation of EDM Geom",60,40,600,600); canvas->cd(); geoManager->GetTopVolume()->Draw("ogl"); geoManager->SetVisLevel(4); // Default draws 4 levels down volume heirarchy geoManager->SetVisOption(0); // Default is 1, but 0 draws all the intermediate volumes not just the final bottom layer geoManager->ViewLeaves(kTRUE); // -- Get the GLViewer so we can manipulate the camera TGLViewer * glViewer = dynamic_cast<TGLViewer*>(gPad->GetViewer3D()); // -- Select Draw style glViewer->SetStyle(TGLRnrCtx::kFill); // TGLRnrCtx::kFill, TGLRnrCtx::kOutline, TGLRnrCtx::kWireFrame // -- Set Background colour glViewer->SetClearColor(TColor::kWhite); // -- Set Lights - turn some off if you wish // TGLLightSet* lightSet = glViewer->GetLightSet(); // lightSet->SetLight(TGLLightSet::kLightLeft, kFALSE); // -- Set Camera type // kCameraPerspXOZ, kCameraPerspYOZ, kCameraPerspXOY, kCameraOrthoXOY // kCameraOrthoXOZ, kCameraOrthoZOY, kCameraOrthoXnOY, kCameraOrthoXnOZ, kCameraOrthoZnOY TGLViewer::ECameraType camera = 2; glViewer->SetCurrentCamera(camera); glViewer->CurrentCamera().SetExternalCenter(kTRUE); Double_t cameraCentre[3] = {0., 0., 0.}; glViewer->SetPerspectiveCamera(camera,4,100,&cameraCentre[0],0,0); // -- Draw Reference Point, Axes Double_t refPoint[3] = {0.,0.,0.}; // Int_t axesType = 0(Off), 1(EDGE), 2(ORIGIN), Bool_t axesDepthTest, Bool_t referenceOn, const Double_t referencePos[3] glViewer->SetGuideState(0, kFALSE, kFALSE, refPoint); glViewer->UpdateScene(); return kTRUE; }
mit
certong0507/shoppingu
public/js/controllers/users/userprofilemain.js
943
'use strict'; angular.module('mean.articles') .controller('UserProfileMainController', ['$scope', 'Global', '$stateParams', '$state', 'fileReader', function($scope, Global, $stateParams, $state, fileReader){ $scope.global = Global; $scope.accountMenu = [{accId: 'a1',accName: 'Profiles', accLink: "userprofile", accIcon: "icon-head"}, {accId: 'a2',accName: 'Addresses', accLink: "address", accIcon: "icon-map"}, {accId: 'a3',accName: 'Orders', accLink: "order", accIcon: "icon-bag"}, {accId: 'a4',accName: 'Posts', accLink: "post", accIcon: "icon-bag"}]; $scope.selectedMenu = function (index) { $('#' + $scope.accountMenu[index].accId).addClass("active"); }; $scope.imageSrc = null; $scope.$on("fileProgress", function(e, progress) { $scope.progress = progress.loaded / progress.total; }); }]);
mit
thilina01/kpi-client
src/app/pages/absenteeism/components/absenteeismTable/index.ts
46
export * from './absenteeismTable.component';
mit
danshapir/ember-bootstrap-components
app/components/bs-component.js
77
export { default } from 'ember-bootstrap-components/components/bs-component';
mit
vvlad/lita-capistrano
lib/lita/capistrano/application.rb
1087
require 'net/ssh' module Lita # :nodoc: module Capistrano # :nodoc: class Application attr_reader :name, :environment, :ssh def initialize(name:, environment:, ssh: ) @name = name @ssh = ssh @environment = environment end def deploy(bot) bot.reply "Deploying application #{name} on #{environment}" Net::SSH.start(ssh[:server], ssh[:user], ssh[:ssh_options]) do |connection| connection.open_channel do |ch| ch.exec "#{name} #{environment}" do |_ch, success| return bot.reply('could not execute command') unless success ch.on_data do |_c, data| Lita.logger.debug(data) bot.reply data.force_encoding("utf-8") end ch.on_extended_data do |_c, _type, data| Lita.logger.error(data) bot.reply data.force_encoding("utf-8") end end end.wait end bot.reply "Finished deploying #{name} on #{environment}" end end end end
mit
adam4813/Sigma
src/components/GLMesh.cpp
20443
#include "components/GLMesh.h" #ifndef __APPLE__ #include "GL/glew.h" #endif #include "strutils.h" #include <algorithm> #include <stdexcept> #include <fstream> #include <iostream> #include <sstream> #include "resources/GLTexture.h" #include "systems/OpenGLSystem.h" namespace Sigma{ // static member initialization const std::string GLMesh::DEFAULT_SHADER = "shaders/mesh_deferred"; GLMesh::GLMesh(const id_t entityID) : IGLComponent(entityID) { memset(&this->buffers, 0, sizeof(this->buffers)); this->vao = 0; this->drawMode = GL_TRIANGLES; this->ElemBufIndex = 2; this->ColorBufIndex = 1; this->VertBufIndex = 0; this->NormalBufIndex = 3; this->UVBufIndex = 4; } void GLMesh::InitializeBuffers() { if(!this->shader) { assert(0 && "Shader must be loaded before buffers can be initialized."); } // We must create a vao and then store it in our GLMesh. if (this->vao == 0) { glGenVertexArrays(1, &this->vao); // Generate the VAO } glBindVertexArray(this->vao); // Bind the VAO if (this->verts.size() > 0) { if (this->buffers[this->VertBufIndex] == 0) { glGenBuffers(1, &this->buffers[this->VertBufIndex]); // Generate the vertex buffer. } glBindBuffer(GL_ARRAY_BUFFER, this->buffers[this->VertBufIndex]); // Bind the vertex buffer. glBufferData(GL_ARRAY_BUFFER, sizeof(Vertex) * this->verts.size(), &this->verts.front(), GL_STATIC_DRAW); // Stores the verts in the vertex buffer. GLint posLocation = glGetAttribLocation((*shader).GetProgram(), "in_Position"); // Find the location in the shader where the vertex buffer data will be placed. glVertexAttribPointer(posLocation, 3, GL_FLOAT, GL_FALSE, 0, 0); // Tell the VAO the vertex data will be stored at the location we just found. glEnableVertexAttribArray(posLocation); // Enable the VAO line for vertex data. } if (this->texCoords.size() > 0) { if (this->buffers[this->UVBufIndex] == 0) { glGenBuffers(1, &this->buffers[this->UVBufIndex]); // Generate the vertex buffer. } glBindBuffer(GL_ARRAY_BUFFER, this->buffers[this->UVBufIndex]); // Bind the vertex buffer. glBufferData(GL_ARRAY_BUFFER, sizeof(TexCoord) * this->texCoords.size(), &this->texCoords.front(), GL_STATIC_DRAW); // Stores the verts in the vertex buffer. GLint uvLocation = glGetAttribLocation((*shader).GetProgram(), "in_UV"); // Find the location in the shader where the vertex buffer data will be placed. glVertexAttribPointer(uvLocation, 2, GL_FLOAT, GL_FALSE, 0, 0); // Tell the VAO the vertex data will be stored at the location we just found. glEnableVertexAttribArray(uvLocation); // Enable the VAO line for vertex data. } if (this->colors.size() > 0) { if (this->buffers[this->ColorBufIndex] == 0) { glGenBuffers(1, &this->buffers[this->ColorBufIndex]); } glBindBuffer(GL_ARRAY_BUFFER, this->buffers[this->ColorBufIndex]); glBufferData(GL_ARRAY_BUFFER, sizeof(Color) * this->colors.size(), &this->colors.front(), GL_STATIC_DRAW); GLint colLocation = glGetAttribLocation((*shader).GetProgram(), "in_Color"); glVertexAttribPointer(colLocation, 3, GL_FLOAT, GL_FALSE, 0, 0); glEnableVertexAttribArray(colLocation); } if (this->faces.size() > 0) { if (this->buffers[this->ElemBufIndex] == 0) { glGenBuffers(1, &this->buffers[this->ElemBufIndex]); // Generate the element buffer. } glBindBuffer(GL_ELEMENT_ARRAY_BUFFER, this->buffers[this->ElemBufIndex]); // Bind the element buffer. glBufferData(GL_ELEMENT_ARRAY_BUFFER, sizeof(Face) * this->faces.size(), &this->faces.front(), GL_STATIC_DRAW); // Store the faces in the element buffer. } if (this->vertNorms.size() > 0) { if (this->buffers[this->NormalBufIndex] == 0) { glGenBuffers(1, &this->buffers[this->NormalBufIndex]); } glBindBuffer(GL_ARRAY_BUFFER, this->buffers[this->NormalBufIndex]); glBufferData(GL_ARRAY_BUFFER, sizeof(Vertex)*this->vertNorms.size(), &this->vertNorms[0], GL_STATIC_DRAW); GLint normalLocation = glGetAttribLocation((*shader).GetProgram(), "in_Normal"); glVertexAttribPointer(normalLocation, 3, GL_FLOAT, GL_FALSE, 0, 0); glEnableVertexAttribArray(normalLocation); } glBindVertexArray(0); // Reset the buffer binding because we are good programmers. this->shader->Use(); this->shader->AddUniform("in_Model"); this->shader->AddUniform("in_View"); this->shader->AddUniform("in_Proj"); this->shader->AddUniform("texEnabled"); this->shader->AddUniform("ambientTexEnabled"); this->shader->AddUniform("diffuseTexEnabled"); this->shader->AddUniform("texAmb"); this->shader->AddUniform("texDiff"); this->shader->AddUniform("specularHardness"); this->shader->UnUse(); } void GLMesh::Render(glm::mediump_float *view, glm::mediump_float *proj) { glm::mat4 modelMatrix = this->Transform()->GetMatrix(); //if(this->parentTransform != 0) { // modelMatrix = this->parentTransform->GetMatrix() * modelMatrix; //} this->shader->Use(); glUniformMatrix4fv((*this->shader)("in_Model"), 1, GL_FALSE, &modelMatrix[0][0]); glUniformMatrix4fv((*this->shader)("in_View"), 1, GL_FALSE, view); glUniformMatrix4fv((*this->shader)("in_Proj"), 1, GL_FALSE, proj); glBindVertexArray(this->Vao()); glBindBuffer(GL_ELEMENT_ARRAY_BUFFER, this->GetBuffer(this->ElemBufIndex)); if(this->cull_face == 0) { glDisable(GL_CULL_FACE); } else { glCullFace(this->cull_face); } glActiveTexture(GL_TEXTURE0); size_t prev = 0; for (int i = 0, cur = this->MeshGroup_ElementCount(0); cur != 0; prev = cur, cur = this->MeshGroup_ElementCount(++i)) { if (this->faceGroups.size() > 0) { Material& mat = this->mats[this->faceGroups[prev]]; if (mat.ambientMap) { glUniform1i((*this->shader)("texEnabled"), 1); glUniform1i((*this->shader)("ambientTexEnabled"), 1); glUniform1i((*this->shader)("texAmb"), 1); glActiveTexture(GL_TEXTURE1); glBindTexture(GL_TEXTURE_2D, mat.ambientMap); } else { glUniform1i((*this->shader)("ambientTexEnabled"), 0); } if (mat.diffuseMap) { glUniform1i((*this->shader)("texEnabled"), 1); glUniform1i((*this->shader)("diffuseTexEnabled"), 1); glUniform1i((*this->shader)("texDiff"), 0); glActiveTexture(GL_TEXTURE0); glBindTexture(GL_TEXTURE_2D, mat.diffuseMap); } else { glUniform1i((*this->shader)("diffuseTexEnabled"), 0); } glUniform1f((*this->shader)("specularHardness"), mat.hardness); } else { glUniform1i((*this->shader)("texEnabled"), 0); glUniform1i((*this->shader)("diffuseTexEnabled"), 0); glUniform1i((*this->shader)("ambientTexEnabled"), 0); } glDrawElements(this->DrawMode(), cur, GL_UNSIGNED_INT, (void*)prev); } // reset defaults glEnable(GL_CULL_FACE); glCullFace(GL_BACK); glBindBuffer(GL_ELEMENT_ARRAY_BUFFER,0); glBindVertexArray(0); glBindTexture(GL_TEXTURE_2D, 0); this->shader->UnUse(); } // function Render bool operator ==(const VertexIndices &lhs, const VertexIndices &rhs) { return (lhs.vertex==rhs.vertex && lhs.normal==rhs.normal && lhs.uv==rhs.uv && lhs.color==rhs.color); } bool GLMesh::LoadMesh(std::string fname) { // Extract the path from the filename. std::string path; if (fname.find("/") != std::string::npos) { path = fname.substr(0, fname.find_last_of("/") + 1); // Keep the separator. } else { path = fname.substr(0, fname.find_last_of("\\") + 1); // Keep the separator. } unsigned int current_color = 0; std::vector<FaceIndices> temp_face_indices; std::vector<VertexIndices> unique_vertices; std::vector<Vertex> temp_verts; std::vector<TexCoord> temp_uvs; std::vector<Vertex> temp_normals; std::vector<Color> temp_colors; std::string currentMtlGroup = ""; std::string line; // Attempt to load file std::ifstream in(fname, std::ios::in); if (!in) { LOG_WARN << "Cannot open mesh " << fname; return false; } // Default color if no material is provided is white temp_colors.push_back(Color(1.0f, 1.0f, 1.0f)); // Parse line by line while (getline(in, line)) { // strip whitespace (strutils.h) line = trim(line); if (line.substr(0,2) == "v ") { // Vertex position float x,y,z; std::istringstream s(line.substr(2)); s >> x; s >> y; s >> z; temp_verts.push_back(Vertex(x, y, z)); } else if (line.substr(0,2) == "vt") { // Vertex tex coord float u, v = 0.0f; std::istringstream s(line.substr(2)); s >> u; s >> v; temp_uvs.push_back(TexCoord(u,v)); } else if (line.substr(0,2) == "vn") { // Vertex normal float x, y, z; std::istringstream s(line.substr(2)); s >> x; s >> y; s >> z; temp_normals.push_back(Vertex(x,y,z)); } else if (line.substr(0,2) == "f ") { // Face FaceIndices current_face; bool has_vert_indices=false, has_uv_indices=false, has_normal_indices=false; short indicies[3][3]; std::string cur = line.substr(2, line.find(' ', 2) - 2); std::string left = line.substr(line.find(' ', 2) + 1); for (int i = 0; i < 3; ++i) { // Each face contains 3 sets of indicies. Each set is 3 indicies v/t/n. std::string first = cur.substr(0, cur.find('/')); // Substring for the v portion indicies[i][0] = atoi(first.c_str()); has_vert_indices=true; if ((cur.find('/') + 1) != cur.find('/', cur.find('/') + 1)) { // Check if we have a t portion std::string second = cur.substr(cur.find('/') + 1, cur.find('/', cur.find('/') + 1)); // Substring for the t portion indicies[i][1] = atoi(second.c_str()); has_uv_indices=true; } else { indicies[i][1] = 0; } if (cur.find('/', cur.find('/')) != cur.find_last_of('/')) { // Check if we have an n portion std::string third = cur.substr(cur.find_last_of('/') + 1); // Substring for the n portion indicies[i][2] = atoi(third.c_str()); has_normal_indices=true; } else { indicies[i][2] = 0; } cur = left.substr(0, left.find(' ')); left = left.substr(left.find(' ') + 1); } if(has_vert_indices) { GLushort a,b,c; a = indicies[0][0] - 1; b = indicies[1][0] - 1; c = indicies[2][0] - 1; current_face.v[0].vertex = a; current_face.v[1].vertex = b; current_face.v[2].vertex = c; } if(has_uv_indices) { GLushort ta,tb,tc; ta = indicies[0][1] - 1; tb = indicies[1][1] - 1; tc = indicies[2][1] - 1; current_face.v[0].uv = ta; current_face.v[1].uv = tb; current_face.v[2].uv = tc; } if(has_normal_indices) { GLushort na,nb,nc; na = indicies[0][2] - 1; nb = indicies[1][2] - 1; nc = indicies[2][2] - 1; current_face.v[0].normal = na; current_face.v[1].normal = nb; current_face.v[2].normal = nc; } // Add index to currently active color current_face.v[0].color = current_color; current_face.v[1].color = current_color; current_face.v[2].color = current_color; // Store the face temp_face_indices.push_back(current_face); } else if (line.substr(0,1) == "g") { // Face group this->groupIndex.push_back(temp_face_indices.size()); } else if (line.substr(0, line.find(' ')) == "mtllib") { // Material library // Add the path to the filename to load it relative to the obj file. ParseMTL(path + line.substr(line.find(' ') + 1)); } else if (line.substr(0, line.find(' ')) == "usemtl") { // Use material std::string mtlname = line.substr(line.find(' ') + 1); // Set as current material group currentMtlGroup = mtlname; // Push back color (for now) Material m = this->mats[mtlname]; glm::vec3 amb(m.ka[0], m.ka[1], m.ka[2]); glm::vec3 spec(m.ks[0], m.ks[1], m.ks[2]); glm::vec3 dif(m.kd[0], m.kd[1], m.kd[2]); glm::vec3 color = amb + dif + spec; temp_colors.push_back(Color(color.r, color.g, color.b)); this->faceGroups[temp_face_indices.size()] = currentMtlGroup; current_color++; } else if ((line.substr(0,1) == "#") || (line.size() == 0)) { // Comment or blank line /* ignoring this line comment or blank*/ } else { // Unknown /* ignoring this line */ std::string test = line.substr(0, line.find(' ')); LOG_WARN << "Unrecognized line " << line; } } // Now we have all raw attributes stored in the temp vectors, // and the set of indicies for each face. Opengl only supports // one index buffer, so we must duplicate vertices until // all the data lines up. for(unsigned int i=0; i < temp_face_indices.size(); i++) { std::vector<VertexIndices>::iterator result; unsigned int v[3]; for(int j=0; j<3; j++) { result = std::find(unique_vertices.begin(), unique_vertices.end(), temp_face_indices[i].v[j]); // if this combination of indicies doesn't exist, // add the data to the attribute arrays if (result == unique_vertices.end()) { v[j] = this->verts.size(); this->verts.push_back(temp_verts[temp_face_indices[i].v[j].vertex]); if (temp_uvs.size() > 0) { this->texCoords.push_back(temp_uvs[temp_face_indices[i].v[j].uv]); } if (temp_normals.size() > 0) { this->vertNorms.push_back(temp_normals[temp_face_indices[i].v[j].normal]); } if (temp_colors.size() > 0) { this->colors.push_back(temp_colors[temp_face_indices[i].v[j].color]); } unique_vertices.push_back(temp_face_indices[i].v[j]); } else { // calculate the correct offset unsigned int unique_vertex_index = std::distance(unique_vertices.begin(), result); v[j] = unique_vertex_index; } } // Push it back this->faces.push_back(Face(v[0], v[1], v[2])); } // Check if vertex normals exist if(vertNorms.size() == 0) { std::vector<Vertex> surfaceNorms; // compute surface normals for(size_t i = 0; i < faces.size(); i++) { glm::vec3 vector1, vector2, cross, normal; Vertex vert1(verts[faces[i].v1]), vert2(verts[faces[i].v2]), vert3(verts[faces[i].v3]); vector1 = glm::normalize(glm::vec3(vert2.x-vert1.x, vert2.y-vert1.y, vert2.z-vert1.z)); vector2 = glm::normalize(glm::vec3(vert3.x-vert1.x, vert3.y-vert1.y, vert3.z-vert1.z)); cross = glm::cross(vector1, vector2); normal = glm::normalize(cross); surfaceNorms.push_back(Vertex(normal.x, normal.y, normal.z)); } // compute vertex normals // should probably compute adjacency first, this could be slow for(size_t i = 0; i < verts.size(); i++) { Vertex total_normals(0.0f, 0.0f, 0.0f); for(size_t j = 0; j < faces.size(); j++) { if (faces[j].v1 == i || faces[j].v2 == i || faces[j].v3 == i) { total_normals.x += surfaceNorms[j].x; total_normals.y += surfaceNorms[j].y; total_normals.z += surfaceNorms[j].z; } } if(!(total_normals.x == 0.0f && total_normals.y == 0.0f && total_normals.z == 0.0f)) { glm::vec3 final_normal(total_normals.x, total_normals.y, total_normals.z); final_normal = glm::normalize(final_normal); vertNorms.push_back(Vertex(final_normal.x, final_normal.y, final_normal.z)); } else { vertNorms.push_back(Vertex(total_normals.x, total_normals.y, total_normals.z)); } } surfaceNorms.clear(); } return true; } // function LoadMesh void GLMesh::LoadShader() { IGLComponent::LoadShader(GLMesh::DEFAULT_SHADER); } void GLMesh::ParseMTL(std::string fname) { // Extract the path from the filename. std::string path; if (fname.find("/") != std::string::npos) { path = fname.substr(0, fname.find_last_of("/") + 1); // Keep the separator. } else { path = fname.substr(0, fname.find_last_of("\\") + 1); // Keep the separator. } std::ifstream in(fname, std::ios::in); if (!in) { LOG_WARN << "Cannot open material " << fname; return; } std::string line; while (getline(in, line)) { line = trim(line); std::stringstream s(line); std::string label; s >> label; if (label == "newmtl") { std::string name; s >> name; Material m; getline(in, line); s.clear(); s.str(line); s.seekg(0); s >> label; while (label != "newmtl") { if (label == "Ka") { float r,g,b; s >> r; s >> g; s >> b; m.ka[0] = r; m.ka[1] = g; m.ka[2] = b; } else if (label == "Kd") { float r,g,b; s >> r; s >> g; s >> b; m.kd[0] = r; m.kd[1] = g; m.kd[2] = b; } else if (label == "Ks") { float r,g,b; s >> r; s >> g; s >> b; m.ks[0] = r; m.ks[1] = g; m.ks[2] = b; } else if ((label == "Tr") || (label == "d")) { float tr; s >> tr; m.tr = tr; } else if (label == "Ns") { float ns; s >> ns; m.hardness = ns; } else if (label == "illum") { int i; s >> i; m.illum = i; } else if (label == "map_Kd") { std::string filename; s >> filename; filename = trim(filename); if(filename.length() > 0 && texReplaceWith.length() > 0 && texReplace == filename) { if (OpenGLSystem::textures.find(texReplaceWith) != OpenGLSystem::textures.end()) { std::cerr << "Using diffuse texture: " << texReplaceWith << std::endl; m.diffuseMap = Sigma::OpenGLSystem::textures[texReplaceWith].GetID(); } } else { filename = convert_path(filename); LOG << "Loading diffuse texture: " << path + filename; resource::GLTexture texture; if (OpenGLSystem::textures.find(filename) == OpenGLSystem::textures.end()) { texture.LoadDataFromFile(path + filename); if (texture.GetID() != 0) { OpenGLSystem::textures[filename] = texture; } } // Add the path to the filename to load it relative to the mtl file if (OpenGLSystem::textures.find(filename) != OpenGLSystem::textures.end()) { m.diffuseMap = Sigma::OpenGLSystem::textures[filename].GetID(); } } if (m.diffuseMap == 0) { LOG_WARN << "Error loading diffuse texture: " << path + filename; } } else if (label == "map_Ka") { std::string filename; s >> filename; filename = trim(filename); filename = convert_path(filename); LOG << "Loading ambient texture: " << path + filename; // Add the path to the filename to load it relative to the mtl file resource::GLTexture texture; if (OpenGLSystem::textures.find(filename) == OpenGLSystem::textures.end()) { texture.LoadDataFromFile(path + filename); if (texture.GetID() != 0) { OpenGLSystem::textures[filename] = texture; } } // It should be loaded, but in case an error occurred double check for it. if (OpenGLSystem::textures.find(filename) != OpenGLSystem::textures.end()) { m.ambientMap = Sigma::OpenGLSystem::textures[filename].GetID(); } // Add the path to the filename to load it relative to the mtl file if (m.ambientMap == 0) { LOG_WARN << "Error loading ambient texture: " << path + filename; } } else if (label == "map_Bump") { std::string filename; s >> filename; filename = trim(filename); filename = convert_path(filename); LOG << "Loading normal or bump texture: " << path + filename; // Add the path to the filename to load it relative to the mtl file resource::GLTexture texture; if (OpenGLSystem::textures.find(filename) == OpenGLSystem::textures.end()) { texture.LoadDataFromFile(path + filename); if (texture.GetID() != 0) { OpenGLSystem::textures[filename] = texture; } } // It should be loaded, but in case an error occurred double check for it. if (OpenGLSystem::textures.find(filename) != OpenGLSystem::textures.end()) { m.normalMap = Sigma::OpenGLSystem::textures[filename].GetID(); } // Add the path to the filename to load it relative to the mtl file if (m.normalMap == 0) { LOG_WARN << "Error loading normal texture: " << path + filename; } } else { // Blank line } std::streamoff pre = in.tellg(); getline(in, line); if (in.eof()) { break; } s.clear(); s.str(line); s.seekg(0); s >> label; std::string newlabel; if (s.str().find("newmtl") != std::string::npos) { in.seekg(pre); break; } } this->mats[name] = m; } } } // function ParseMTL } // namespace Sigma
mit
konradovsky/KNWDHackYeahFront
src/views/VolunteerProfile/Volunteer_styles.js
1485
import styled from 'styled-components'; import { Container } from '../../utils/styledComponents'; import { colorPalette } from '../../utils/constants/styles'; export const Wrapper = styled.div` display: flex; justify-content: center; width: 100%; height: 100%; background-color: ${colorPalette.primary1Color}; `; export const StyledContainer = Container.extend` margin-top: 60px; box-shadow: rgba(0, 0, 0, 0.16) 0 3px 10px, rgba(0, 0, 0, 0.23) 0 3px 10px; `; export const Header = styled.div` width: 100%; height: 185px; background-color: red; position: relative; `; export const Profile = styled.div` height: 100%; width: 30%; float: left; text-align: center; background-color: ${colorPalette.primary2Color}; img { margin-top: 60px; margin-bottom: 10px; width: 50px; height: 50px; } p { color: white; font-size: 20px; } `; export const Name = styled.div` width: 70%; height: 100%; float: left; background-color: ${colorPalette.primary2Color}; color: white; text-align: center; h1 { font-size: 40px; padding: 5px; font-weight: 200; margin-top: 55px; margin-bottom: 10px; } `; export const GameSection = styled.div` width: 100%; height: 265px; background-color: white; color: ${colorPalette.primary2Color}; position: relative; `; export const UpdateSection = styled.div` width: 100%; height: 370px; background-color: ${colorPalette.primary1Color}; color: white; `;
mit
kinpa200296/FollowTheTask
FollowTheTask.Web/App_Start/FilterConfig.cs
253
using System.Web.Mvc; namespace FollowTheTask.Web { public class FilterConfig { public static void RegisterGlobalFilters(GlobalFilterCollection filters) { filters.Add(new HandleErrorAttribute()); } } }
mit
markpad/markpad
src/json-to-params.js
180
const JSONToParams = (object) => { return Object.keys(object).map((k) => encodeURIComponent(k) + '=' + encodeURIComponent(object[k])).join('&'); }; export default JSONToParams;
mit
godosou/smaroute
src/PathGeneration/Enumeration/patEnumeratePaths.cc
2858
/* * patEnumeratePaths.cc * * Created on: May 25, 2012 * Author: jchen */ #include "patEnumeratePaths.h" #include <tr1/unordered_map> #include <set> #include "patRoadBase.h" #include "patMultiModalPath.h" #include "patException.h" using namespace std; using namespace std::tr1; patEnumeratePaths::patEnumeratePaths() { // TODO Auto-generated constructor stub } void patEnumeratePaths::setNetwork(const patNetworkBase* network_environment) { m_network = network_environment; } void patEnumeratePaths::setPathWriter(patPathWriter* path_writer) { m_path_writer = path_writer; } void patEnumeratePaths::depth_first_enumerate( const unordered_map<const patNode*, set<const patRoadBase*> >* outgoing_incidents ,const patNode* up_node, const patNode* end_node , patMultiModalPath& tmp_path, set<patMultiModalPath>& found_path) const{ const unordered_map<const patNode*, set<const patRoadBase*> >::const_iterator find_outgoing = outgoing_incidents->find(up_node); if (find_outgoing == outgoing_incidents->end()) { DEBUG_MESSAGE(up_node->getUserId()); return; } else { for (set<const patRoadBase*>::const_iterator road_iter = find_outgoing->second.begin(); road_iter != find_outgoing->second.end(); ++road_iter) { if (tmp_path.addRoadTravelToBack(*road_iter)) { if (tmp_path.containLoop() != NULL) { // contain loop, do nothing //tmp_path.removeRoadTravelToBack(); } else if ((*road_iter)->getDownNode() == end_node) { found_path.insert(tmp_path); } else { depth_first_enumerate(outgoing_incidents, (*road_iter)->getDownNode(), end_node, tmp_path, found_path); } tmp_path.removeRoadTravelToBack(); } else { throw RuntimeException("road append error"); } } } } void patEnumeratePaths::run(const patNode* origin, const patNode* destination) { const unordered_map<const patNode*, set<const patRoadBase*> >* outgoing_incidents = m_network->getOutgoingIncidents(); // DEBUG_MESSAGE("ougoing nodes"<<outgoing_incidents->size()); // for(unordered_map<const patNode*, set<const patRoadBase*> >::const_iterator oi_iter = outgoing_incidents->begin(); // oi_iter!=outgoing_incidents->end();++oi_iter){ // DEBUG_MESSAGE(oi_iter->first->getUserId()<<":"<<oi_iter->second.size()); // } set<patMultiModalPath> found_path; patMultiModalPath tmp_path; depth_first_enumerate(outgoing_incidents,origin,destination,tmp_path,found_path); DEBUG_MESSAGE("Enumerates "<<found_path.size()<<" paths"); map<string, string> attrs; attrs["count"]="1"; attrs["logweight"]="0.0"; for(set<patMultiModalPath>::const_iterator path_iter = found_path.begin(); path_iter!=found_path.end(); ++path_iter){ m_path_writer->writePath(*path_iter,attrs); } //m_path_writer->close(); } patEnumeratePaths::~patEnumeratePaths() { // TODO Auto-generated destructor stub }
mit
MrPIvanov/SoftUni
04-Csharp Advanced/03-STACKS AND QUEUES/03-StacksAndQueuesLab/04-MatchingBrackets/StartUp.cs
659
namespace _04_MatchingBrackets { using System; using System.Collections.Generic; class StartUp { static void Main(string[] args) { var str = Console.ReadLine(); var input = str.ToCharArray(); var stack = new Stack<int>(); for (int i = 0; i < input.Length; i++) { if (input[i]=='(') { stack.Push(i); } if (input[i]==')') { Console.WriteLine(str.Substring(stack.Peek(),i-stack.Pop()+1)); } } } } }
mit
dplummer/services_test_server
lib/services_test_server/db_controller.rb
768
require 'drb' require 'thread' module ServicesTestServer class DbController def self.only_one_connection ActiveRecord::ConnectionAdapters::ConnectionPool.class_eval do alias_method :old_checkout, :checkout def checkout @cached_connection ||= old_checkout end end end def initialize @mutex = Mutex.new end def begin_transaction @mutex.lock ServicesTestServer.logger.debug "Beginning remote transaction" ActiveRecord::Base.connection.begin_transaction(joinable: false) end def rollback_transaction ServicesTestServer.logger.debug "Rolling back remote transaction" ActiveRecord::Base.connection.rollback_transaction @mutex.unlock end end end
mit
Arasz/Optimization-techniques
Travelling salesman problem/Algorithms/RandomPathAlgorithm.cs
1280
using ConsoleApplication.Graphs; using System; using System.Collections.Generic; using System.Linq; namespace ConsoleApplication.Algorithms { public class RandomPathAlgorithm : AlgorithmBase { private readonly Random _randomGenerator; public RandomPathAlgorithm(int steps, IEdgeFinder edgeFinder) : base(steps, edgeFinder) { _randomGenerator = new Random(); } public override Path Solve(int startNode, IGraph completeGraph, Path precalculatedPath = null) { var iterator = completeGraph.Iterator; var nodes = new List<int>(startNode); var unvisitedNodes = completeGraph.Nodes.Where(node => node != startNode).ToList(); var steps = _steps; while (--steps > 0) { var edgeToNearestNode = _edgeFinder.RandomNodeEdge(iterator.Edges, unvisitedNodes, _randomGenerator); iterator.MoveAlongEdge(edgeToNearestNode); unvisitedNodes.Remove(iterator.CurrentNode); nodes.Add(iterator.CurrentNode); } nodes.Add(startNode); return new Path(nodes, new DefaultCostCalculationStrategy(completeGraph)); } } }
mit
UCSB-CS56-W14/CS56-W14-lab06
src/edu/ucsb/cs56/W14/drawings/buzdar/advanced/WritePictureToFile.java
3182
package edu.ucsb.cs56.w14.drawings.buzdar.advanced; import java.awt.image.BufferedImage; import java.awt.Graphics2D; import java.awt.Color; import java.io.File; import javax.imageio.ImageIO; import java.io.IOException; import edu.ucsb.cs56.w14.drawings.utilities.ShapeTransforms; import edu.ucsb.cs56.w14.drawings.utilities.GeneralPathWrapper; /** * A class with a main method that can write a drawing to a graphics file. * * @author P. Conrad, * @version for CS56, W11 UCSB */ public class WritePictureToFile { public static void usage() { System.out.println("Usage: java WritePictureToFile whichImage mypic"); // @@@ modify the next line to describe your picture System.out.println(" whichImage should be 1,2 or 3"); System.out.println(" whichImage chooses from drawPicture1, 2 or 3"); System.out.println(" .png gets added to the filename"); System.out.println(" e.g. if you pass mypic, filename is mypic.png"); System.out.println("Example: java WritePictureToFile 3 foo"); System.out.println(" produces foo.png from drawPicture3"); } /** Write the drawFourCoffeeCups picture to a file. * * @param args The first command line argument is the file to write to. We leave off the extension * because that gets put on automatically. */ public static void main(String[] args) { // make sure we have exactly one command line argument if (args.length != 2) { usage(); System.exit(1); } String whichPicture = args[0]; // first command line arg is 1, 2, 3 String outputfileName = args[1]; // second command line arg is which pic final int WIDTH = 640; final int HEIGHT = 480; // create a new image // TYPE_INT_ARGB is "RGB image" with transparency (A = alpha channel) BufferedImage bi = new BufferedImage(WIDTH, HEIGHT, BufferedImage.TYPE_INT_ARGB); // g2 is a Graphics2D object that will draw into the BufferedImage object Graphics2D g2 = bi.createGraphics(); if (whichPicture.equals("1")) { AllMyDrawings.drawPicture1(g2); } else if (whichPicture.equals("2")) { AllMyDrawings.drawPicture2(g2); } else if (whichPicture.equals("3")) { AllMyDrawings.drawPicture2(g2); } final String imageType = "png"; // choices: "gif", "png", "jpg" // We must declare this variable outside the try block, // so we can see it inside the catch block String fullFileName = ""; try { fullFileName = outputfileName + "." + imageType; // make the file name File outputfile = new File(fullFileName); // the file we will try to write ImageIO.write(bi, imageType, outputfile); // actually write it System.out.println("I created " + fullFileName); // tell the user } catch (IOException e) { System.err.println("Sorry, an error occurred--I could not create "+ fullFileName +"\n The error was: "+ e.toString()); } } }
mit
chrissorchard/malucrawl
demo/classifier.py
1745
from __future__ import division from pebl.util import levenshtein from malware_crawl.models import Malicouse_sites _mal_list = [] def read_from_database_to_dict(): """ Reads the malwares from the database and returns a mal_dict """ malwares = Malicouse_sites.objects.all() mal_dict = {} for m in malwares: mal_dict[m.url] = m.malware return mal_dict def classify_is_sus(new_url): sus_sum = 0 notsus_sum = 0 sind = 1 nind = 1 database = read_from_database_to_dict() if new_url in database: return database[new_url], 1.0 for item in database: dist = levenshtein(new_url, item["url"]) if item["malware"]: sus_sum = sus_sum + dist sind = sind + 1 else: notsus_sum = notsus_sum + dist nind = nind + 1 avg_sus = sus_sum // sind avg_notsus = notsus_sum // nind total_len = avg_sus + avg_notsus if avg_sus > avg_notsus: return False, 1.0 - avg_notsus / total_len else: return True, 1.0 - avg_sus / total_len def add_url(url, is_mal): """ Gets url and if it is a malware and fills the _mal_list which is used for the classification task url -- the url which is classified as malware or not is_mal -- true or false """ global _mal_list _mal_list.append({"url": url, "malware": is_mal}) if __name__ == '__main__': import json import pkgutil """ mal_dict = json.loads(pkgutil.get_data("classifier", "mal_test_data.json")) malwares = Malicouse_sites.objects.all() print classify_is_sus(mal_dict, url) """ url = 'http://uk.movies.yahoo.com/features/sdfasf' print classify_is_sus(url)
mit
laerciosb/fractal_test
db/migrate/20170421125241_create_products.rb
282
# frozen_string_literal: true class CreateProducts < ActiveRecord::Migration[5.0] def change create_table :products do |t| t.string :name t.references :supplier, foreign_key: true t.references :place, foreign_key: true t.timestamps end end end
mit
larsth/go-rmsggpsbinmsg
misc_test.go
1409
package binmsg import ( "strconv" "testing" ) func TestFloat32MarshalBinary(t *testing.T) { want := []byte{0x42, 0x5e, 0xc4, 0x11} got := float32MarshalBinary(float32(55.69147)) if s, ok := byteSliceCheck(0, got, want); ok == false { t.Fatal(s) } } func TestFloat32MarshalBinaryValues(t *testing.T) { want := []byte{0x42, 0x5e, 0xc4, 0x11} gotV1, gotV2, gotV3, gotV4 := float32MarshalBinaryValues(float32(55.69147)) got := make([]byte, 4) got[0] = gotV1 got[1] = gotV2 got[2] = gotV3 got[3] = gotV4 if s, ok := byteSliceCheck(0, got, want); ok == false { t.Fatal(s) } } func TestFloat32UnmarshalBinary(t *testing.T) { p := []byte{0x42, 0x5e, 0xc4, 0x11} want := float32(55.69147) got := float32UnmarshalBinary(p) if want != got { gotStr := strconv.FormatFloat(float64(got), 'f', -1, 32) wantStr := strconv.FormatFloat(float64(got), 'f', -1, 32) s := mkStrErrString("", gotStr, wantStr) t.Fatal(s) } } func BenchmarkMiscFloat32MarshalBinary(b *testing.B) { var f = float32(123.45) for i := 0; i < b.N; i++ { _ = float32MarshalBinary(f) } } func BenchmarkMiscFloat32MarshalBinaryValues(b *testing.B) { var f = float32(123.45) for i := 0; i < b.N; i++ { _, _, _, _ = float32MarshalBinaryValues(f) } } func BenchmarkMiscFloat32UnmarshalBinary(b *testing.B) { var p = []byte{0x01, 0x23, 0x45, 0x67} for i := 0; i < b.N; i++ { _ = float32UnmarshalBinary(p) } }
mit
anycmd/anycmd
src/Anycmd/Engine/Ac/Groups/GroupRemovedEvent.cs
504
 namespace Anycmd.Engine.Ac.Groups { using Events; public sealed class GroupRemovedEvent : DomainEvent { public GroupRemovedEvent(IAcSession acSession, GroupBase source) : base(acSession, source) { } internal GroupRemovedEvent(IAcSession acSession, GroupBase source, bool isPrivate) : this(acSession, source) { this.IsPrivate = isPrivate; } internal bool IsPrivate { get; private set; } } }
mit
Aprogiena/StratisBitcoinFullNode
src/Stratis.SmartContracts.Tools.Sct/Program.cs
798
using McMaster.Extensions.CommandLineUtils; using Stratis.SmartContracts.Tools.Sct.Build; using Stratis.SmartContracts.Tools.Sct.Deployment; using Stratis.SmartContracts.Tools.Sct.Validation; namespace Stratis.SmartContracts.Tools.Sct { [Command(ThrowOnUnexpectedArgument = false)] [Subcommand("validate", typeof(Validator))] [Subcommand("build", typeof(Builder))] [Subcommand("deploy", typeof(Deployer))] [Subcommand("base58", typeof(Base58Converter))] [HelpOption] [VersionOption("-v|--version", "v0.0.2")] class Program { public static int Main(string[] args) => CommandLineApplication.Execute<Program>(args); private int OnExecute(CommandLineApplication app) { app.ShowHelp(); return 1; } } }
mit
lukasz-jakub-adamczuk/sapi
src/AppBundle/Entity/UserPermission.php
1210
<?php namespace AppBundle\Entity; /** * UserPermission */ class UserPermission { /** * @var integer */ private $idUser; /** * @var boolean */ private $idPermission; /** * @var integer */ private $idUserPermission; /** * Set idUser * * @param integer $idUser * * @return UserPermission */ public function setIdUser($idUser) { $this->idUser = $idUser; return $this; } /** * Get idUser * * @return integer */ public function getIdUser() { return $this->idUser; } /** * Set idPermission * * @param boolean $idPermission * * @return UserPermission */ public function setIdPermission($idPermission) { $this->idPermission = $idPermission; return $this; } /** * Get idPermission * * @return boolean */ public function getIdPermission() { return $this->idPermission; } /** * Get idUserPermission * * @return integer */ public function getIdUserPermission() { return $this->idUserPermission; } }
mit
zwippie/trailblazer
test/rails/fake_app/song/operations.rb
2227
class Song < ActiveRecord::Base class Create < Trailblazer::Operation include CRUD include Responder model Song, :create contract do property :title, validates: {presence: true} property :length end def process(params) validate(params[:song]) do contract.save end end end class Delete < Create action :find def process(params) model.destroy self end end end class Band < ActiveRecord::Base class Create < Trailblazer::Operation include CRUD, Responder, Representer model Band, :create contract do include Reform::Form::ActiveModel model Band property :name, validates: {presence: true} property :locality # class: Song #=> always create new song # instance: { Song.find(params[:id]) or Song.new } # same as find_or_create ? # this is what i want: # maybe make populate_if_empty a representable feature? collection :songs, populate_if_empty: Song do property :title end end def process(params) validate(params[:band]) do contract.save end end class JSON < self require "reform/form/json" contract do include Reform::Form::JSON # this allows deserialising JSON. end representer do collection :songs, inherit: true, render_empty: false # tested in ControllerPresentTest. end end class Admin < self def process(params) res = super model.update_attribute :name, "#{model.name} [ADMIN]" res end end # TODO: wait for uber 0.0.10 and @dutow. # builds -> (params) # return JSON if params[:format] == "json" # return Admin if params[:admin] # end builds do |params| if params[:format] == "json" JSON elsif params[:admin] Admin end end end class Update < Create action :update # TODO: infer stuff per default. class JSON < self self.contract_class = Create::JSON.contract_class self.representer_class = Create::JSON.representer_class end builds do |params| JSON if params[:format] == "json" end end end
mit
nicklasjepsen/GravatarSharp
GravatarSharp/GravatarModels/Name.cs
355
using Newtonsoft.Json; namespace GravatarSharp.GravatarModels { internal class Name { [JsonProperty("givenName")] public string GivenName { get; set; } [JsonProperty("familyName")] public string FamilyName { get; set; } [JsonProperty("formatted")] public string Formatted { get; set; } } }
mit
tomru/switchmon
test/swm.tests.js
5847
'use strict'; const sinon = require('sinon'); const assert = require('assert'); const proxyquire = require('proxyquire'); describe('swm', () => { let sandbox; beforeEach(() => { sandbox = sinon.sandbox.create(); }); afterEach(() => { sandbox.restore(); }); describe('getDevices', () => { let execStub; let xrandrParseStub; let swm; beforeEach(() => { execStub = sandbox.stub(); xrandrParseStub = sandbox.stub(); swm = proxyquire('../swm.js', { child_process: { exec: execStub }, 'xrandr-parse': xrandrParseStub }); }); it('calls exec', () => { swm.getDevices(sandbox.stub()); assert.equal(execStub.callCount, 1); assert.equal(execStub.args[0][0], 'xrandr'); }); it('passes error when exec passes error', (done) => { const devices = swm.getDevices((err, devices) => { assert.equal(xrandrParseStub.callCount, 0); assert.equal(err, 'some error'); done(); }); const cb = execStub.args[0][1]; cb('some error'); }); it('parses result', (done) => { xrandrParseStub.returns('[some result]'); swm.getDevices((err, devices) => { assert.equal(xrandrParseStub.args[0][0], '[some stdout]'); assert.equal(xrandrParseStub.callCount, 1); assert.equal(devices, '[some result]'); done(); }); const cb = execStub.args[0][1]; cb(null, '[some stdout]'); }); }); describe('generateXrandrOptions', () => { let swm; let devices; beforeEach(() => { devices = { 'HDMI1': { connected: true }, 'HDMI2': { connected: true, }, 'LVDS1': { connected: false }, 'DP1': { connected: true, } } swm = require('../swm.js'); }); describe('activation of monitor', () => { it('for connected monitors if non is selected', () => { const result = swm.generateXrandrOptions([], devices); assert(result.indexOf('--output HDMI1 --auto') > -1); assert(result.indexOf('--output HDMI2 --auto') > -1); assert(result.indexOf('--output LVDS1 --off') > -1); }); it('for connected selected monitors', () => { const result = swm.generateXrandrOptions(['HDMI2'], devices); assert(result.indexOf('--output HDMI1 --off') > -1); assert(result.indexOf('--output HDMI2 --auto') > -1); assert(result.indexOf('--output LVDS1 --off') > -1); }); it('skipps selected monitors that are not connected', () => { const result = swm.generateXrandrOptions(['LVDS1', 'HDMI2'], devices); assert(result.indexOf('--output HDMI2 --auto') > -1); assert(result.indexOf('--output LVDS1 --off') > -1); }); }); it('aligns monitor n to the right of monitor n-1', () => { const result = swm.generateXrandrOptions(['HDMI1', 'HDMI2', 'DP1'], devices); assert(result.indexOf('--output HDMI1 --auto') > -1); assert(result.indexOf('--output HDMI2 --auto --right-of HDMI1') > -1); assert(result.indexOf('--output DP1 --auto --right-of HDMI2') > -1); }); it('throws when no selected monitor is connected', () => { assert.throws(() => {swm.generateXrandrOptions(['LVDS1'], devices)}); assert.throws(() => {swm.generateXrandrOptions(['BOGUS'], devices)}); devices = {}; assert.throws(() => {swm.generateXrandrOptions([], devices)}); }); }); describe('switchDevices', () => { let execStub; let swm; beforeEach(() => { execStub = sandbox.stub(); swm = proxyquire('../swm.js', { child_process: { exec: execStub } }); }); it('calls exec with xrandr and opitons', () => { swm.switchDevices('[some options]', sandbox.stub()); assert.equal(execStub.callCount, 1); assert.equal(execStub.args[0][0], 'xrandr [some options]'); }); it('passes error when exec passes error', (done) => { swm.switchDevices('[some options]', (err, devices) => { assert.equal(err, 'some error'); done(); }); const cb = execStub.args[0][1]; cb('some error'); }); }); describe('executePostCmd', () => { let execStub; let swm; beforeEach(() => { execStub = sandbox.stub(); swm = proxyquire('../swm.js', { child_process: { exec: execStub } }); }); it('calls postCmd', () => { swm.executePostCmd('[some cmd]'); assert.equal(execStub.callCount, 1); assert.equal(execStub.args[0][0], '[some cmd]'); }); it('passes error when exec passes error', (done) => { swm.executePostCmd('[some cmd]', (err, devices) => { assert.equal(err, '[some error]'); done(); }); const cb = execStub.args[0][1]; cb('[some error]'); }); }); });
mit
giorgosbarkos2/sysAdmin
src/projectAdmin/principalBundle/Controller/DefaultController.php
10348
<?php namespace projectAdmin\principalBundle\Controller; use Symfony\Bundle\FrameworkBundle\Controller\Controller; use projectAdmin\loginBundle\Entity\Categoria; use projectAdmin\loginBundle\Entity\Producto; use Symfony\Component\HttpFoundation\Response; use Symfony\Component\HttpFoundation\Request; class DefaultController extends Controller { public function principalAction() { $session = $this->getRequest()->getSession(); $idioma = $session->get('idioma'); $em = $this->getDoctrine()->getManager(); if ($idioma == 'ingles') { $idioma = 'ingles'; // Lo mismo de abajo pero con ingles } else { $idioma = 'español'; } $queryCategorias = $em->createQuery('SELECT u from projectAdminloginBundle:Categoria u WHERE u.idioma=:idioma order by u.id desc ') ->setParameter('idioma', $idioma); $query = $em->createQuery('SELECT u from projectAdminloginBundle:Producto u WHERE u.idioma=:idioma order by u.id desc ') ->setParameter('idioma', $idioma) ->setMaxResults(6); $queryBanner = $em->createQuery('SELECT u from projectAdminloginBundle:Banner u WHERE u.idioma=:idioma order by u.id desc ')->setParameter('idioma', $idioma); $queryArticulos = $em->createQuery('SELECT u from projectAdminloginBundle:Articulo u WHERE u.idioma=:idioma order by u.id desc ')->setParameter('idioma', $idioma); $queryCaluga = $em->createQuery('SELECT u from projectAdminloginBundle:Caluga u WHERE u.idioma=:idioma order by u.id desc ')->setParameter('idioma', $idioma); $queryBannerAd = $em->createQuery('SELECT u from projectAdminloginBundle:Banner2 u WHERE u.idioma=:idioma order by u.id desc ')->setParameter('idioma', $idioma)->setMaxResults(1); ; $categorias = $queryCategorias->getResult(); $productos = $query->getResult(); $banner = $queryBanner->getResult(); $caluga = $queryCaluga->getResult(); $banner2 = $queryBannerAd->getResult(); $articulos = $queryArticulos->getResult(); return $this->render('projectAdminprincipalBundle:Default:principal.html.twig', array('categoria' => $categorias, 'producto' => $productos, 'banner' => $banner, 'caluga' => $caluga, 'banner2' => $banner2, 'articulos' => $articulos, 'idioma' => $idioma)); } public function vistaProductosAction($id) { $em = $this->getDoctrine()->getManager(); $session = $this->getRequest()->getSession(); $idioma = $session->get('idioma'); if ($idioma == 'ingles') { $idioma = 'ingles'; } else { $idioma = 'español'; } $productos = $em->getRepository('projectAdminloginBundle:Producto')->findBy(array('categoria' => $id)); $queryCategorias = $em->createQuery('SELECT u from projectAdminloginBundle:Categoria u WHERE u.idioma=:idioma order by u.id desc ') ->setParameter('idioma', $idioma); $categoriaP = $em->getRepository('projectAdminloginBundle:Categoria')->findOneBy(array('id' => $id)); $queryArticulos = $em->createQuery('SELECT u from projectAdminloginBundle:Articulo u WHERE u.idioma=:idioma order by u.id desc ') ->setParameter('idioma', $idioma); $articulos = $queryArticulos->getResult(); $categoria = $queryCategorias->getResult(); return $this->render('projectAdminprincipalBundle:Default:productos.html.twig', array('productos' => $productos, 'categoria' => $categoria, 'categoriaP' => $categoriaP, 'articulos' => $articulos, 'idioma' => $idioma)); } public function detalleProductoAction($id) { $em = $this->getDoctrine()->getManager(); $session = $this->getRequest()->getSession(); $idioma = $session->get('idioma'); if ($idioma == 'ingles') { $idioma = 'ingles'; } else { $idioma = 'español'; } $producto = $em->getRepository('projectAdminloginBundle:Producto')->findOneBy(array('id' => $id)); $idCat = $producto->getCategoria()->getId(); $productoAsoc = $em->getRepository('projectAdminloginBundle:Producto')->findBy(array('categoria' => $idCat)); $queryCategorias = $em->createQuery('SELECT u from projectAdminloginBundle:Categoria u WHERE u.idioma=:idioma order by u.id desc ') ->setParameter('idioma', $idioma); $queryArticulos = $em->createQuery('SELECT u from projectAdminloginBundle:Articulo u WHERE u.idioma=:idioma order by u.id desc ') ->setParameter('idioma', $idioma); $categorias = $queryCategorias->getResult(); $articulos = $queryArticulos->getResult(); return $this->render('projectAdminprincipalBundle:Default:productoDetalle.html.twig', array('categoria' => $categorias, 'producto' => $producto, 'productoAsoc' => $productoAsoc, 'articulos' => $articulos , 'idioma' => $idioma)); } public function formularioContactoAction() { $em = $this->getDoctrine()->getManager(); $session = $this->getRequest()->getSession(); $idioma = $session->get('idioma'); if ($idioma == 'ingles') { $idioma = 'ingles'; } else { $idioma = 'español'; } $queryCategorias = $em->createQuery('SELECT u from projectAdminloginBundle:Categoria u WHERE u.idioma=:idioma order by u.id desc ') ->setParameter('idioma', $idioma); $queryArticulos = $em->createQuery('SELECT u from projectAdminloginBundle:Articulo u WHERE u.idioma=:idioma order by u.id desc ') ->setParameter('idioma', $idioma); $categorias = $queryCategorias->getResult(); $articulos = $queryArticulos->getResult(); return $this->render('projectAdminprincipalBundle:Default:formularioContacto.html.twig', array('categoria' => $categorias, 'articulos' => $articulos , 'idioma' => $idioma )); } public function vistaArticuloAction() { $em = $this->getDoctrine()->getManager(); $categorias = $em->getRepository('projectAdminloginBundle:Categoria')->findAll(); return $this->render('projectAdminprincipalBundle:Default:Articulo.html.twig', array('categoria' => $categorias)); } public function functionDetalleCalugaAction($id) { $em = $this->getDoctrine()->getManager(); $session = $this->getRequest()->getSession(); $idioma = $session->get('idioma'); if ($idioma == 'ingles') { $idioma = 'ingles'; } else { $idioma = 'español'; } $queryArticulos = $em->createQuery('SELECT u from projectAdminloginBundle:Articulo u WHERE u.idioma=:idioma order by u.id desc ')->setParameter('idioma', $idioma); $queryCategorias = $em->createQuery('SELECT u from projectAdminloginBundle:Categoria u WHERE u.idioma=:idioma order by u.id desc ')->setParameter('idioma', $idioma); $articulos = $queryArticulos->getResult(); $categorias = $queryCategorias->getResult(); $caluga = $em->getRepository('projectAdminloginBundle:Caluga')->findOneBy(array('id' => $id)); return $this->render('projectAdminprincipalBundle:Default:articuloCaluga.html.twig', array('caluga' => $caluga, 'categoria' => $categorias, 'articulos' => $articulos, 'idioma' => $idioma)); } public function sendContactoAction(Request $request) { $nombre = $request->request->get('nombre'); $email = $request->request->get('email'); $mesanje = $request->request->get('mensaje'); if ($nombre == '' or $email == '' or $mesanje == '') { return new Response('100'); } else { $message = \Swift_Message::newInstance() ->setSubject('Contacto') ->setFrom('giorgosbarkos@gmail.com') ->setTo('giorgosbarkos@gmail.com') ->setBody( $this->renderView( 'projectAdminprincipalBundle:Default:contacto.html.twig', array('nombre' => $nombre, 'email' => $email, 'mensaje' => $mesanje) ) ) ; $this->get('mailer')->send($message); return new Response('200'); } } public function cargarArticuloAction($id) { $em = $this->getDoctrine()->getManager(); $session = $this->getRequest()->getSession(); $idioma = $session->get('idioma'); if ($idioma == 'ingles') { $idioma = 'ingles'; } else { $idioma = 'español'; } $em = $this->getDoctrine()->getManager(); $articulo = $em->getRepository('projectAdminloginBundle:Articulo')->findOneBy(array('id' => $id)); $queryArticulos = $em->createQuery('SELECT u from projectAdminloginBundle:Articulo u WHERE u.idioma=:idioma order by u.id desc ')->setParameter('idioma', $idioma); $queryCategorias = $em->createQuery('SELECT u from projectAdminloginBundle:Categoria u WHERE u.idioma=:idioma order by u.id desc ')->setParameter('idioma', $idioma); $articulos = $queryArticulos->getResult(); $categorias = $queryCategorias->getResult(); return $this->render('projectAdminprincipalBundle:Default:Articulo.html.twig', array('articulo' => $articulo, 'categoria' => $categorias, 'articulos' => $articulos, 'idioma' => $idioma)); } public function IdiomasAction() { $em = $this->getDoctrine()->getManager(); return new Response('100'); } public function ingles2Action() { $em = $this->getDoctrine()->getManager(); $session = $this->getRequest()->getSession(); $session->set('idioma', 'ingles'); return $this->redirect('../home'); } public function espanolAction() { $em = $this->getDoctrine()->getManager(); $session = $this->getRequest()->getSession(); $session->set('idioma', 'español'); return $this->redirect('../home'); } }
mit
the-ress/vscode
src/vs/platform/list/browser/listService.ts
44339
/*--------------------------------------------------------------------------------------------- * Copyright (c) Microsoft Corporation. All rights reserved. * Licensed under the MIT License. See License.txt in the project root for license information. *--------------------------------------------------------------------------------------------*/ import { createStyleSheet } from 'vs/base/browser/dom'; import { IListMouseEvent, IListTouchEvent, IListRenderer, IListVirtualDelegate } from 'vs/base/browser/ui/list/list'; import { IPagedRenderer, PagedList, IPagedListOptions } from 'vs/base/browser/ui/list/listPaging'; import { DefaultStyleController, IListOptions, IMultipleSelectionController, IOpenController, isSelectionRangeChangeEvent, isSelectionSingleChangeEvent, List, IListAccessibilityProvider, IListOptionsUpdate } from 'vs/base/browser/ui/list/listWidget'; import { Emitter, Event } from 'vs/base/common/event'; import { Disposable, dispose, IDisposable, toDisposable, DisposableStore, combinedDisposable } from 'vs/base/common/lifecycle'; import { localize } from 'vs/nls'; import { IConfigurationService, getMigratedSettingValue } from 'vs/platform/configuration/common/configuration'; import { Extensions as ConfigurationExtensions, IConfigurationRegistry } from 'vs/platform/configuration/common/configurationRegistry'; import { ContextKeyExpr, IContextKey, IContextKeyService, RawContextKey } from 'vs/platform/contextkey/common/contextkey'; import { IEditorOptions } from 'vs/platform/editor/common/editor'; import { createDecorator } from 'vs/platform/instantiation/common/instantiation'; import { IKeybindingService } from 'vs/platform/keybinding/common/keybinding'; import { Registry } from 'vs/platform/registry/common/platform'; import { attachListStyler, computeStyles, defaultListStyles, IColorMapping } from 'vs/platform/theme/common/styler'; import { IThemeService } from 'vs/platform/theme/common/themeService'; import { InputFocusedContextKey } from 'vs/platform/contextkey/common/contextkeys'; import { ObjectTree, IObjectTreeOptions, ICompressibleTreeRenderer, CompressibleObjectTree, ICompressibleObjectTreeOptions, ICompressibleObjectTreeOptionsUpdate } from 'vs/base/browser/ui/tree/objectTree'; import { ITreeRenderer, IAsyncDataSource, IDataSource } from 'vs/base/browser/ui/tree/tree'; import { AsyncDataTree, IAsyncDataTreeOptions, CompressibleAsyncDataTree, ITreeCompressionDelegate, ICompressibleAsyncDataTreeOptions, IAsyncDataTreeOptionsUpdate } from 'vs/base/browser/ui/tree/asyncDataTree'; import { DataTree, IDataTreeOptions } from 'vs/base/browser/ui/tree/dataTree'; import { IKeyboardNavigationEventFilter, IAbstractTreeOptions, RenderIndentGuides, IAbstractTreeOptionsUpdate } from 'vs/base/browser/ui/tree/abstractTree'; import { IAccessibilityService } from 'vs/platform/accessibility/common/accessibility'; export type ListWidget = List<any> | PagedList<any> | ObjectTree<any, any> | DataTree<any, any, any> | AsyncDataTree<any, any, any>; export const IListService = createDecorator<IListService>('listService'); export interface IListService { _serviceBrand: undefined; /** * Returns the currently focused list widget if any. */ readonly lastFocusedList: ListWidget | undefined; } interface IRegisteredList { widget: ListWidget; extraContextKeys?: (IContextKey<boolean>)[]; } export class ListService implements IListService { _serviceBrand: undefined; private disposables = new DisposableStore(); private lists: IRegisteredList[] = []; private _lastFocusedWidget: ListWidget | undefined = undefined; private _hasCreatedStyleController: boolean = false; get lastFocusedList(): ListWidget | undefined { return this._lastFocusedWidget; } constructor(@IThemeService private readonly _themeService: IThemeService) { } register(widget: ListWidget, extraContextKeys?: (IContextKey<boolean>)[]): IDisposable { if (!this._hasCreatedStyleController) { this._hasCreatedStyleController = true; // create a shared default tree style sheet for performance reasons const styleController = new DefaultStyleController(createStyleSheet(), ''); this.disposables.add(attachListStyler(styleController, this._themeService)); } if (this.lists.some(l => l.widget === widget)) { throw new Error('Cannot register the same widget multiple times'); } // Keep in our lists list const registeredList: IRegisteredList = { widget, extraContextKeys }; this.lists.push(registeredList); // Check for currently being focused if (widget.getHTMLElement() === document.activeElement) { this._lastFocusedWidget = widget; } return combinedDisposable( widget.onDidFocus(() => this._lastFocusedWidget = widget), toDisposable(() => this.lists.splice(this.lists.indexOf(registeredList), 1)), widget.onDidDispose(() => { this.lists = this.lists.filter(l => l !== registeredList); if (this._lastFocusedWidget === widget) { this._lastFocusedWidget = undefined; } }) ); } dispose(): void { this.disposables.dispose(); } } const RawWorkbenchListFocusContextKey = new RawContextKey<boolean>('listFocus', true); export const WorkbenchListSupportsMultiSelectContextKey = new RawContextKey<boolean>('listSupportsMultiselect', true); export const WorkbenchListFocusContextKey = ContextKeyExpr.and(RawWorkbenchListFocusContextKey, ContextKeyExpr.not(InputFocusedContextKey)); export const WorkbenchListHasSelectionOrFocus = new RawContextKey<boolean>('listHasSelectionOrFocus', false); export const WorkbenchListDoubleSelection = new RawContextKey<boolean>('listDoubleSelection', false); export const WorkbenchListMultiSelection = new RawContextKey<boolean>('listMultiSelection', false); export const WorkbenchListSupportsKeyboardNavigation = new RawContextKey<boolean>('listSupportsKeyboardNavigation', true); export const WorkbenchListAutomaticKeyboardNavigationKey = 'listAutomaticKeyboardNavigation'; export const WorkbenchListAutomaticKeyboardNavigation = new RawContextKey<boolean>(WorkbenchListAutomaticKeyboardNavigationKey, true); export let didBindWorkbenchListAutomaticKeyboardNavigation = false; function createScopedContextKeyService(contextKeyService: IContextKeyService, widget: ListWidget): IContextKeyService { const result = contextKeyService.createScoped(widget.getHTMLElement()); RawWorkbenchListFocusContextKey.bindTo(result); return result; } export const multiSelectModifierSettingKey = 'workbench.list.multiSelectModifier'; export const openModeSettingKey = 'workbench.list.openMode'; export const horizontalScrollingKey = 'workbench.list.horizontalScrolling'; export const keyboardNavigationSettingKey = 'workbench.list.keyboardNavigation'; export const automaticKeyboardNavigationSettingKey = 'workbench.list.automaticKeyboardNavigation'; const treeIndentKey = 'workbench.tree.indent'; const treeRenderIndentGuidesKey = 'workbench.tree.renderIndentGuides'; function getHorizontalScrollingSetting(configurationService: IConfigurationService): boolean { return getMigratedSettingValue<boolean>(configurationService, horizontalScrollingKey, 'workbench.tree.horizontalScrolling'); } function useAltAsMultipleSelectionModifier(configurationService: IConfigurationService): boolean { return configurationService.getValue(multiSelectModifierSettingKey) === 'alt'; } function useSingleClickToOpen(configurationService: IConfigurationService): boolean { return configurationService.getValue(openModeSettingKey) !== 'doubleClick'; } class MultipleSelectionController<T> extends Disposable implements IMultipleSelectionController<T> { private useAltAsMultipleSelectionModifier: boolean; constructor(private configurationService: IConfigurationService) { super(); this.useAltAsMultipleSelectionModifier = useAltAsMultipleSelectionModifier(configurationService); this.registerListeners(); } private registerListeners(): void { this._register(this.configurationService.onDidChangeConfiguration(e => { if (e.affectsConfiguration(multiSelectModifierSettingKey)) { this.useAltAsMultipleSelectionModifier = useAltAsMultipleSelectionModifier(this.configurationService); } })); } isSelectionSingleChangeEvent(event: IListMouseEvent<T> | IListTouchEvent<T>): boolean { if (this.useAltAsMultipleSelectionModifier) { return event.browserEvent.altKey; } return isSelectionSingleChangeEvent(event); } isSelectionRangeChangeEvent(event: IListMouseEvent<T> | IListTouchEvent<T>): boolean { return isSelectionRangeChangeEvent(event); } } class WorkbenchOpenController extends Disposable implements IOpenController { private openOnSingleClick: boolean; constructor(private configurationService: IConfigurationService, private existingOpenController?: IOpenController) { super(); this.openOnSingleClick = useSingleClickToOpen(configurationService); this.registerListeners(); } private registerListeners(): void { this._register(this.configurationService.onDidChangeConfiguration(e => { if (e.affectsConfiguration(openModeSettingKey)) { this.openOnSingleClick = useSingleClickToOpen(this.configurationService); } })); } shouldOpen(event: UIEvent): boolean { if (event instanceof MouseEvent) { const isLeftButton = event.button === 0; const isDoubleClick = event.detail === 2; if (isLeftButton && !this.openOnSingleClick && !isDoubleClick) { return false; } if (isLeftButton /* left mouse button */ || event.button === 1 /* middle mouse button */) { return this.existingOpenController ? this.existingOpenController.shouldOpen(event) : true; } return false; } return this.existingOpenController ? this.existingOpenController.shouldOpen(event) : true; } } function toWorkbenchListOptions<T>(options: IListOptions<T>, configurationService: IConfigurationService, keybindingService: IKeybindingService): [IListOptions<T>, IDisposable] { const disposables = new DisposableStore(); const result = { ...options }; if (options.multipleSelectionSupport !== false && !options.multipleSelectionController) { const multipleSelectionController = new MultipleSelectionController(configurationService); result.multipleSelectionController = multipleSelectionController; disposables.add(multipleSelectionController); } const openController = new WorkbenchOpenController(configurationService, options.openController); result.openController = openController; disposables.add(openController); result.keyboardNavigationDelegate = { mightProducePrintableCharacter(e) { return keybindingService.mightProducePrintableCharacter(e); } }; return [result, disposables]; } export interface IWorkbenchListOptionsUpdate extends IListOptionsUpdate { readonly overrideStyles?: IColorMapping; } export interface IWorkbenchListOptions<T> extends IWorkbenchListOptionsUpdate, IListOptions<T> { readonly accessibilityProvider: IListAccessibilityProvider<T>; } export class WorkbenchList<T> extends List<T> { readonly contextKeyService: IContextKeyService; private readonly configurationService: IConfigurationService; private readonly themeService: IThemeService; private listHasSelectionOrFocus: IContextKey<boolean>; private listDoubleSelection: IContextKey<boolean>; private listMultiSelection: IContextKey<boolean>; private _styler: IDisposable | undefined; private _useAltAsMultipleSelectionModifier: boolean; constructor( user: string, container: HTMLElement, delegate: IListVirtualDelegate<T>, renderers: IListRenderer<T, any>[], options: IWorkbenchListOptions<T>, @IContextKeyService contextKeyService: IContextKeyService, @IListService listService: IListService, @IThemeService themeService: IThemeService, @IConfigurationService configurationService: IConfigurationService, @IKeybindingService keybindingService: IKeybindingService ) { const horizontalScrolling = typeof options.horizontalScrolling !== 'undefined' ? options.horizontalScrolling : getHorizontalScrollingSetting(configurationService); const [workbenchListOptions, workbenchListOptionsDisposable] = toWorkbenchListOptions(options, configurationService, keybindingService); super(user, container, delegate, renderers, { keyboardSupport: false, ...computeStyles(themeService.getColorTheme(), defaultListStyles), ...workbenchListOptions, horizontalScrolling } ); this.disposables.add(workbenchListOptionsDisposable); this.contextKeyService = createScopedContextKeyService(contextKeyService, this); this.configurationService = configurationService; this.themeService = themeService; const listSupportsMultiSelect = WorkbenchListSupportsMultiSelectContextKey.bindTo(this.contextKeyService); listSupportsMultiSelect.set(!(options.multipleSelectionSupport === false)); this.listHasSelectionOrFocus = WorkbenchListHasSelectionOrFocus.bindTo(this.contextKeyService); this.listDoubleSelection = WorkbenchListDoubleSelection.bindTo(this.contextKeyService); this.listMultiSelection = WorkbenchListMultiSelection.bindTo(this.contextKeyService); this._useAltAsMultipleSelectionModifier = useAltAsMultipleSelectionModifier(configurationService); this.disposables.add(this.contextKeyService); this.disposables.add((listService as ListService).register(this)); if (options.overrideStyles) { this.updateStyles(options.overrideStyles); } this.disposables.add(this.onDidChangeSelection(() => { const selection = this.getSelection(); const focus = this.getFocus(); this.listHasSelectionOrFocus.set(selection.length > 0 || focus.length > 0); this.listMultiSelection.set(selection.length > 1); this.listDoubleSelection.set(selection.length === 2); })); this.disposables.add(this.onDidChangeFocus(() => { const selection = this.getSelection(); const focus = this.getFocus(); this.listHasSelectionOrFocus.set(selection.length > 0 || focus.length > 0); })); this.registerListeners(); } updateOptions(options: IWorkbenchListOptionsUpdate): void { super.updateOptions(options); if (options.overrideStyles) { this.updateStyles(options.overrideStyles); } } dispose(): void { super.dispose(); if (this._styler) { this._styler.dispose(); } } private updateStyles(styles: IColorMapping): void { if (this._styler) { this._styler.dispose(); } this._styler = attachListStyler(this, this.themeService, styles); } private registerListeners(): void { this.disposables.add(this.configurationService.onDidChangeConfiguration(e => { if (e.affectsConfiguration(multiSelectModifierSettingKey)) { this._useAltAsMultipleSelectionModifier = useAltAsMultipleSelectionModifier(this.configurationService); } })); } get useAltAsMultipleSelectionModifier(): boolean { return this._useAltAsMultipleSelectionModifier; } } export interface IWorkbenchPagedListOptions<T> extends IWorkbenchListOptionsUpdate, IPagedListOptions<T> { readonly accessibilityProvider: IListAccessibilityProvider<T>; } export class WorkbenchPagedList<T> extends PagedList<T> { readonly contextKeyService: IContextKeyService; private readonly configurationService: IConfigurationService; private readonly disposables: DisposableStore; private _useAltAsMultipleSelectionModifier: boolean; constructor( user: string, container: HTMLElement, delegate: IListVirtualDelegate<number>, renderers: IPagedRenderer<T, any>[], options: IWorkbenchPagedListOptions<T>, @IContextKeyService contextKeyService: IContextKeyService, @IListService listService: IListService, @IThemeService themeService: IThemeService, @IConfigurationService configurationService: IConfigurationService, @IKeybindingService keybindingService: IKeybindingService ) { const horizontalScrolling = typeof options.horizontalScrolling !== 'undefined' ? options.horizontalScrolling : getHorizontalScrollingSetting(configurationService); const [workbenchListOptions, workbenchListOptionsDisposable] = toWorkbenchListOptions(options, configurationService, keybindingService); super(user, container, delegate, renderers, { keyboardSupport: false, ...computeStyles(themeService.getColorTheme(), defaultListStyles), ...workbenchListOptions, horizontalScrolling } ); this.disposables = new DisposableStore(); this.disposables.add(workbenchListOptionsDisposable); this.contextKeyService = createScopedContextKeyService(contextKeyService, this); this.configurationService = configurationService; const listSupportsMultiSelect = WorkbenchListSupportsMultiSelectContextKey.bindTo(this.contextKeyService); listSupportsMultiSelect.set(!(options.multipleSelectionSupport === false)); this._useAltAsMultipleSelectionModifier = useAltAsMultipleSelectionModifier(configurationService); this.disposables.add(this.contextKeyService); this.disposables.add((listService as ListService).register(this)); if (options.overrideStyles) { this.disposables.add(attachListStyler(this, themeService, options.overrideStyles)); } this.registerListeners(); } private registerListeners(): void { this.disposables.add(this.configurationService.onDidChangeConfiguration(e => { if (e.affectsConfiguration(multiSelectModifierSettingKey)) { this._useAltAsMultipleSelectionModifier = useAltAsMultipleSelectionModifier(this.configurationService); } })); } get useAltAsMultipleSelectionModifier(): boolean { return this._useAltAsMultipleSelectionModifier; } dispose(): void { super.dispose(); this.disposables.dispose(); } } export interface IOpenResourceOptions { editorOptions: IEditorOptions; sideBySide: boolean; element: any; payload: any; } export interface IResourceResultsNavigationOptions { openOnFocus: boolean; } export interface IOpenEvent<T> { editorOptions: IEditorOptions; sideBySide: boolean; element: T; browserEvent?: UIEvent; } export interface IResourceNavigatorOptions { readonly openOnFocus?: boolean; readonly openOnSelection?: boolean; readonly openOnSingleClick?: boolean; } export interface SelectionKeyboardEvent extends KeyboardEvent { preserveFocus?: boolean; } export function getSelectionKeyboardEvent(typeArg = 'keydown', preserveFocus?: boolean): SelectionKeyboardEvent { const e = new KeyboardEvent(typeArg); (<SelectionKeyboardEvent>e).preserveFocus = preserveFocus; return e; } abstract class ResourceNavigator<T> extends Disposable { private readonly options: IResourceNavigatorOptions; private readonly _onDidOpenResource = new Emitter<IOpenEvent<T | null>>(); readonly onDidOpenResource: Event<IOpenEvent<T | null>> = this._onDidOpenResource.event; constructor( private readonly treeOrList: { getFocus(): (T | null)[], getSelection(): (T | null)[], setSelection(elements: (T | null)[], browserEvent?: UIEvent): void, onDidChangeFocus: Event<{ browserEvent?: UIEvent }>, onDidChangeSelection: Event<{ browserEvent?: UIEvent }>, onDidOpen: Event<{ browserEvent?: UIEvent }>, readonly openOnSingleClick?: boolean }, options?: IResourceNavigatorOptions ) { super(); this.options = { openOnSelection: true, ...(options || {}) }; this.registerListeners(); } private registerListeners(): void { if (this.options && this.options.openOnFocus) { this._register(this.treeOrList.onDidChangeFocus(e => this.onFocus(e.browserEvent))); } if (this.options && this.options.openOnSelection) { this._register(this.treeOrList.onDidChangeSelection(e => this.onSelection(e.browserEvent))); } this._register(this.treeOrList.onDidOpen(e => this.onSelection(e.browserEvent))); } private onFocus(browserEvent?: UIEvent): void { const focus = this.treeOrList.getFocus(); this.treeOrList.setSelection(focus, browserEvent); if (!browserEvent) { return; } const isMouseEvent = browserEvent && browserEvent instanceof MouseEvent; if (!isMouseEvent) { const preserveFocus = (browserEvent instanceof KeyboardEvent && typeof (<SelectionKeyboardEvent>browserEvent).preserveFocus === 'boolean') ? !!(<SelectionKeyboardEvent>browserEvent).preserveFocus : true; this.open(preserveFocus, false, false, browserEvent); } } private onSelection(browserEvent?: MouseEvent | UIEvent): void { if (!browserEvent || browserEvent.type === 'contextmenu') { return; } const isKeyboardEvent = browserEvent instanceof KeyboardEvent; const isMiddleClick = browserEvent instanceof MouseEvent ? browserEvent.button === 1 : false; const isDoubleClick = browserEvent.detail === 2; const preserveFocus = (browserEvent instanceof KeyboardEvent && typeof (<SelectionKeyboardEvent>browserEvent).preserveFocus === 'boolean') ? !!(<SelectionKeyboardEvent>browserEvent).preserveFocus : !isDoubleClick; if (this.options.openOnSingleClick || this.treeOrList.openOnSingleClick || isDoubleClick || isKeyboardEvent) { const sideBySide = browserEvent instanceof MouseEvent && (browserEvent.ctrlKey || browserEvent.metaKey || browserEvent.altKey); this.open(preserveFocus, isDoubleClick || isMiddleClick, sideBySide, browserEvent); } } private open(preserveFocus: boolean, pinned: boolean, sideBySide: boolean, browserEvent?: UIEvent): void { this._onDidOpenResource.fire({ editorOptions: { preserveFocus, pinned, revealIfVisible: true }, sideBySide, element: this.treeOrList.getSelection()[0], browserEvent }); } } export class ListResourceNavigator<T> extends ResourceNavigator<number> { constructor(list: WorkbenchList<T> | WorkbenchPagedList<T>, options?: IResourceNavigatorOptions) { super(list, options); } } export class TreeResourceNavigator<T, TFilterData> extends ResourceNavigator<T> { constructor(tree: WorkbenchObjectTree<T, TFilterData> | WorkbenchCompressibleObjectTree<T, TFilterData> | WorkbenchDataTree<any, T, TFilterData> | WorkbenchAsyncDataTree<any, T, TFilterData> | WorkbenchCompressibleAsyncDataTree<any, T, TFilterData>, options: IResourceNavigatorOptions = {}) { super(tree, options); } } function createKeyboardNavigationEventFilter(container: HTMLElement, keybindingService: IKeybindingService): IKeyboardNavigationEventFilter { let inChord = false; return event => { if (inChord) { inChord = false; return false; } const result = keybindingService.softDispatch(event, container); if (result && result.enterChord) { inChord = true; return false; } inChord = false; return true; }; } export interface IWorkbenchObjectTreeOptions<T, TFilterData> extends IObjectTreeOptions<T, TFilterData> { readonly accessibilityProvider: IListAccessibilityProvider<T>; readonly overrideStyles?: IColorMapping; } export class WorkbenchObjectTree<T extends NonNullable<any>, TFilterData = void> extends ObjectTree<T, TFilterData> { private internals: WorkbenchTreeInternals<any, T, TFilterData>; get contextKeyService(): IContextKeyService { return this.internals.contextKeyService; } get useAltAsMultipleSelectionModifier(): boolean { return this.internals.useAltAsMultipleSelectionModifier; } constructor( user: string, container: HTMLElement, delegate: IListVirtualDelegate<T>, renderers: ITreeRenderer<T, TFilterData, any>[], options: IWorkbenchObjectTreeOptions<T, TFilterData>, @IContextKeyService contextKeyService: IContextKeyService, @IListService listService: IListService, @IThemeService themeService: IThemeService, @IConfigurationService configurationService: IConfigurationService, @IKeybindingService keybindingService: IKeybindingService, @IAccessibilityService accessibilityService: IAccessibilityService ) { const { options: treeOptions, getAutomaticKeyboardNavigation, disposable } = workbenchTreeDataPreamble<T, TFilterData, IWorkbenchObjectTreeOptions<T, TFilterData>>(container, options, contextKeyService, configurationService, keybindingService, accessibilityService); super(user, container, delegate, renderers, treeOptions); this.disposables.add(disposable); this.internals = new WorkbenchTreeInternals(this, treeOptions, getAutomaticKeyboardNavigation, options.overrideStyles, contextKeyService, listService, themeService, configurationService, accessibilityService); this.disposables.add(this.internals); } } export interface IWorkbenchCompressibleObjectTreeOptionsUpdate extends ICompressibleObjectTreeOptionsUpdate { readonly overrideStyles?: IColorMapping; } export interface IWorkbenchCompressibleObjectTreeOptions<T, TFilterData> extends IWorkbenchCompressibleObjectTreeOptionsUpdate, ICompressibleObjectTreeOptions<T, TFilterData> { readonly accessibilityProvider: IListAccessibilityProvider<T>; } export class WorkbenchCompressibleObjectTree<T extends NonNullable<any>, TFilterData = void> extends CompressibleObjectTree<T, TFilterData> { private internals: WorkbenchTreeInternals<any, T, TFilterData>; get contextKeyService(): IContextKeyService { return this.internals.contextKeyService; } get useAltAsMultipleSelectionModifier(): boolean { return this.internals.useAltAsMultipleSelectionModifier; } constructor( user: string, container: HTMLElement, delegate: IListVirtualDelegate<T>, renderers: ICompressibleTreeRenderer<T, TFilterData, any>[], options: IWorkbenchCompressibleObjectTreeOptions<T, TFilterData>, @IContextKeyService contextKeyService: IContextKeyService, @IListService listService: IListService, @IThemeService themeService: IThemeService, @IConfigurationService configurationService: IConfigurationService, @IKeybindingService keybindingService: IKeybindingService, @IAccessibilityService accessibilityService: IAccessibilityService ) { const { options: treeOptions, getAutomaticKeyboardNavigation, disposable } = workbenchTreeDataPreamble<T, TFilterData, IWorkbenchCompressibleObjectTreeOptions<T, TFilterData>>(container, options, contextKeyService, configurationService, keybindingService, accessibilityService); super(user, container, delegate, renderers, treeOptions); this.disposables.add(disposable); this.internals = new WorkbenchTreeInternals(this, treeOptions, getAutomaticKeyboardNavigation, options.overrideStyles, contextKeyService, listService, themeService, configurationService, accessibilityService); this.disposables.add(this.internals); } updateOptions(options: IWorkbenchCompressibleObjectTreeOptionsUpdate = {}): void { super.updateOptions(options); if (options.overrideStyles) { this.internals.updateStyleOverrides(options.overrideStyles); } } } export interface IWorkbenchDataTreeOptionsUpdate extends IAbstractTreeOptionsUpdate { readonly overrideStyles?: IColorMapping; } export interface IWorkbenchDataTreeOptions<T, TFilterData> extends IWorkbenchDataTreeOptionsUpdate, IDataTreeOptions<T, TFilterData> { readonly accessibilityProvider: IListAccessibilityProvider<T>; } export class WorkbenchDataTree<TInput, T, TFilterData = void> extends DataTree<TInput, T, TFilterData> { private internals: WorkbenchTreeInternals<TInput, T, TFilterData>; get contextKeyService(): IContextKeyService { return this.internals.contextKeyService; } get useAltAsMultipleSelectionModifier(): boolean { return this.internals.useAltAsMultipleSelectionModifier; } constructor( user: string, container: HTMLElement, delegate: IListVirtualDelegate<T>, renderers: ITreeRenderer<T, TFilterData, any>[], dataSource: IDataSource<TInput, T>, options: IWorkbenchDataTreeOptions<T, TFilterData>, @IContextKeyService contextKeyService: IContextKeyService, @IListService listService: IListService, @IThemeService themeService: IThemeService, @IConfigurationService configurationService: IConfigurationService, @IKeybindingService keybindingService: IKeybindingService, @IAccessibilityService accessibilityService: IAccessibilityService ) { const { options: treeOptions, getAutomaticKeyboardNavigation, disposable } = workbenchTreeDataPreamble<T, TFilterData, IWorkbenchDataTreeOptions<T, TFilterData>>(container, options, contextKeyService, configurationService, keybindingService, accessibilityService); super(user, container, delegate, renderers, dataSource, treeOptions); this.disposables.add(disposable); this.internals = new WorkbenchTreeInternals(this, treeOptions, getAutomaticKeyboardNavigation, options.overrideStyles, contextKeyService, listService, themeService, configurationService, accessibilityService); this.disposables.add(this.internals); } updateOptions(options: IWorkbenchDataTreeOptionsUpdate = {}): void { super.updateOptions(options); if (options.overrideStyles) { this.internals.updateStyleOverrides(options.overrideStyles); } } } export interface IWorkbenchAsyncDataTreeOptionsUpdate extends IAsyncDataTreeOptionsUpdate { readonly overrideStyles?: IColorMapping; } export interface IWorkbenchAsyncDataTreeOptions<T, TFilterData> extends IWorkbenchAsyncDataTreeOptionsUpdate, IAsyncDataTreeOptions<T, TFilterData> { readonly accessibilityProvider: IListAccessibilityProvider<T>; } export class WorkbenchAsyncDataTree<TInput, T, TFilterData = void> extends AsyncDataTree<TInput, T, TFilterData> { private internals: WorkbenchTreeInternals<TInput, T, TFilterData>; get contextKeyService(): IContextKeyService { return this.internals.contextKeyService; } get useAltAsMultipleSelectionModifier(): boolean { return this.internals.useAltAsMultipleSelectionModifier; } constructor( user: string, container: HTMLElement, delegate: IListVirtualDelegate<T>, renderers: ITreeRenderer<T, TFilterData, any>[], dataSource: IAsyncDataSource<TInput, T>, options: IWorkbenchAsyncDataTreeOptions<T, TFilterData>, @IContextKeyService contextKeyService: IContextKeyService, @IListService listService: IListService, @IThemeService themeService: IThemeService, @IConfigurationService configurationService: IConfigurationService, @IKeybindingService keybindingService: IKeybindingService, @IAccessibilityService accessibilityService: IAccessibilityService ) { const { options: treeOptions, getAutomaticKeyboardNavigation, disposable } = workbenchTreeDataPreamble<T, TFilterData, IWorkbenchAsyncDataTreeOptions<T, TFilterData>>(container, options, contextKeyService, configurationService, keybindingService, accessibilityService); super(user, container, delegate, renderers, dataSource, treeOptions); this.disposables.add(disposable); this.internals = new WorkbenchTreeInternals(this, treeOptions, getAutomaticKeyboardNavigation, options.overrideStyles, contextKeyService, listService, themeService, configurationService, accessibilityService); this.disposables.add(this.internals); } updateOptions(options: IWorkbenchAsyncDataTreeOptionsUpdate = {}): void { super.updateOptions(options); if (options.overrideStyles) { this.internals.updateStyleOverrides(options.overrideStyles); } } } export interface IWorkbenchCompressibleAsyncDataTreeOptions<T, TFilterData> extends ICompressibleAsyncDataTreeOptions<T, TFilterData> { readonly accessibilityProvider: IListAccessibilityProvider<T>; readonly overrideStyles?: IColorMapping; } export class WorkbenchCompressibleAsyncDataTree<TInput, T, TFilterData = void> extends CompressibleAsyncDataTree<TInput, T, TFilterData> { private internals: WorkbenchTreeInternals<TInput, T, TFilterData>; get contextKeyService(): IContextKeyService { return this.internals.contextKeyService; } get useAltAsMultipleSelectionModifier(): boolean { return this.internals.useAltAsMultipleSelectionModifier; } constructor( user: string, container: HTMLElement, virtualDelegate: IListVirtualDelegate<T>, compressionDelegate: ITreeCompressionDelegate<T>, renderers: ICompressibleTreeRenderer<T, TFilterData, any>[], dataSource: IAsyncDataSource<TInput, T>, options: IWorkbenchCompressibleAsyncDataTreeOptions<T, TFilterData>, @IContextKeyService contextKeyService: IContextKeyService, @IListService listService: IListService, @IThemeService themeService: IThemeService, @IConfigurationService configurationService: IConfigurationService, @IKeybindingService keybindingService: IKeybindingService, @IAccessibilityService accessibilityService: IAccessibilityService ) { const { options: treeOptions, getAutomaticKeyboardNavigation, disposable } = workbenchTreeDataPreamble<T, TFilterData, IWorkbenchCompressibleAsyncDataTreeOptions<T, TFilterData>>(container, options, contextKeyService, configurationService, keybindingService, accessibilityService); super(user, container, virtualDelegate, compressionDelegate, renderers, dataSource, treeOptions); this.disposables.add(disposable); this.internals = new WorkbenchTreeInternals(this, treeOptions, getAutomaticKeyboardNavigation, options.overrideStyles, contextKeyService, listService, themeService, configurationService, accessibilityService); this.disposables.add(this.internals); } } function workbenchTreeDataPreamble<T, TFilterData, TOptions extends IAbstractTreeOptions<T, TFilterData> | IAsyncDataTreeOptions<T, TFilterData>>( container: HTMLElement, options: TOptions, contextKeyService: IContextKeyService, configurationService: IConfigurationService, keybindingService: IKeybindingService, accessibilityService: IAccessibilityService, ): { options: TOptions, getAutomaticKeyboardNavigation: () => boolean | undefined, disposable: IDisposable } { WorkbenchListSupportsKeyboardNavigation.bindTo(contextKeyService); if (!didBindWorkbenchListAutomaticKeyboardNavigation) { WorkbenchListAutomaticKeyboardNavigation.bindTo(contextKeyService); didBindWorkbenchListAutomaticKeyboardNavigation = true; } const getAutomaticKeyboardNavigation = () => { // give priority to the context key value to disable this completely let automaticKeyboardNavigation = contextKeyService.getContextKeyValue<boolean>(WorkbenchListAutomaticKeyboardNavigationKey); if (automaticKeyboardNavigation) { automaticKeyboardNavigation = configurationService.getValue<boolean>(automaticKeyboardNavigationSettingKey); } return automaticKeyboardNavigation; }; const accessibilityOn = accessibilityService.isScreenReaderOptimized(); const keyboardNavigation = accessibilityOn ? 'simple' : configurationService.getValue<string>(keyboardNavigationSettingKey); const horizontalScrolling = typeof options.horizontalScrolling !== 'undefined' ? options.horizontalScrolling : getHorizontalScrollingSetting(configurationService); const openOnSingleClick = useSingleClickToOpen(configurationService); const [workbenchListOptions, disposable] = toWorkbenchListOptions(options, configurationService, keybindingService); const additionalScrollHeight = options.additionalScrollHeight; return { getAutomaticKeyboardNavigation, disposable, options: { // ...options, // TODO@Joao why is this not splatted here? keyboardSupport: false, ...workbenchListOptions, indent: configurationService.getValue<number>(treeIndentKey), renderIndentGuides: configurationService.getValue<RenderIndentGuides>(treeRenderIndentGuidesKey), automaticKeyboardNavigation: getAutomaticKeyboardNavigation(), simpleKeyboardNavigation: keyboardNavigation === 'simple', filterOnType: keyboardNavigation === 'filter', horizontalScrolling, openOnSingleClick, keyboardNavigationEventFilter: createKeyboardNavigationEventFilter(container, keybindingService), additionalScrollHeight, hideTwistiesOfChildlessElements: options.hideTwistiesOfChildlessElements } as TOptions }; } class WorkbenchTreeInternals<TInput, T, TFilterData> { readonly contextKeyService: IContextKeyService; private hasSelectionOrFocus: IContextKey<boolean>; private hasDoubleSelection: IContextKey<boolean>; private hasMultiSelection: IContextKey<boolean>; private _useAltAsMultipleSelectionModifier: boolean; private disposables: IDisposable[] = []; private styler: IDisposable | undefined; constructor( private tree: WorkbenchObjectTree<T, TFilterData> | CompressibleObjectTree<T, TFilterData> | WorkbenchDataTree<TInput, T, TFilterData> | WorkbenchAsyncDataTree<TInput, T, TFilterData> | WorkbenchCompressibleAsyncDataTree<TInput, T, TFilterData>, options: IAbstractTreeOptions<T, TFilterData> | IAsyncDataTreeOptions<T, TFilterData>, getAutomaticKeyboardNavigation: () => boolean | undefined, overrideStyles: IColorMapping | undefined, @IContextKeyService contextKeyService: IContextKeyService, @IListService listService: IListService, @IThemeService private themeService: IThemeService, @IConfigurationService configurationService: IConfigurationService, @IAccessibilityService accessibilityService: IAccessibilityService, ) { this.contextKeyService = createScopedContextKeyService(contextKeyService, tree); const listSupportsMultiSelect = WorkbenchListSupportsMultiSelectContextKey.bindTo(this.contextKeyService); listSupportsMultiSelect.set(!(options.multipleSelectionSupport === false)); this.hasSelectionOrFocus = WorkbenchListHasSelectionOrFocus.bindTo(this.contextKeyService); this.hasDoubleSelection = WorkbenchListDoubleSelection.bindTo(this.contextKeyService); this.hasMultiSelection = WorkbenchListMultiSelection.bindTo(this.contextKeyService); this._useAltAsMultipleSelectionModifier = useAltAsMultipleSelectionModifier(configurationService); const interestingContextKeys = new Set(); interestingContextKeys.add(WorkbenchListAutomaticKeyboardNavigationKey); const updateKeyboardNavigation = () => { const accessibilityOn = accessibilityService.isScreenReaderOptimized(); const keyboardNavigation = accessibilityOn ? 'simple' : configurationService.getValue<string>(keyboardNavigationSettingKey); tree.updateOptions({ simpleKeyboardNavigation: keyboardNavigation === 'simple', filterOnType: keyboardNavigation === 'filter' }); }; this.updateStyleOverrides(overrideStyles); this.disposables.push( this.contextKeyService, (listService as ListService).register(tree), tree.onDidChangeSelection(() => { const selection = tree.getSelection(); const focus = tree.getFocus(); this.hasSelectionOrFocus.set(selection.length > 0 || focus.length > 0); this.hasMultiSelection.set(selection.length > 1); this.hasDoubleSelection.set(selection.length === 2); }), tree.onDidChangeFocus(() => { const selection = tree.getSelection(); const focus = tree.getFocus(); this.hasSelectionOrFocus.set(selection.length > 0 || focus.length > 0); }), configurationService.onDidChangeConfiguration(e => { if (e.affectsConfiguration(openModeSettingKey)) { tree.updateOptions({ openOnSingleClick: useSingleClickToOpen(configurationService) }); } if (e.affectsConfiguration(multiSelectModifierSettingKey)) { this._useAltAsMultipleSelectionModifier = useAltAsMultipleSelectionModifier(configurationService); } if (e.affectsConfiguration(treeIndentKey)) { const indent = configurationService.getValue<number>(treeIndentKey); tree.updateOptions({ indent }); } if (e.affectsConfiguration(treeRenderIndentGuidesKey)) { const renderIndentGuides = configurationService.getValue<RenderIndentGuides>(treeRenderIndentGuidesKey); tree.updateOptions({ renderIndentGuides }); } if (e.affectsConfiguration(keyboardNavigationSettingKey)) { updateKeyboardNavigation(); } if (e.affectsConfiguration(automaticKeyboardNavigationSettingKey)) { tree.updateOptions({ automaticKeyboardNavigation: getAutomaticKeyboardNavigation() }); } }), this.contextKeyService.onDidChangeContext(e => { if (e.affectsSome(interestingContextKeys)) { tree.updateOptions({ automaticKeyboardNavigation: getAutomaticKeyboardNavigation() }); } }), accessibilityService.onDidChangeScreenReaderOptimized(() => updateKeyboardNavigation()) ); } get useAltAsMultipleSelectionModifier(): boolean { return this._useAltAsMultipleSelectionModifier; } updateStyleOverrides(overrideStyles?: IColorMapping): void { dispose(this.styler); this.styler = overrideStyles ? attachListStyler(this.tree, this.themeService, overrideStyles) : Disposable.None; } dispose(): void { this.disposables = dispose(this.disposables); dispose(this.styler); this.styler = undefined; } } const configurationRegistry = Registry.as<IConfigurationRegistry>(ConfigurationExtensions.Configuration); configurationRegistry.registerConfiguration({ 'id': 'workbench', 'order': 7, 'title': localize('workbenchConfigurationTitle', "Workbench"), 'type': 'object', 'properties': { [multiSelectModifierSettingKey]: { 'type': 'string', 'enum': ['ctrlCmd', 'alt'], 'enumDescriptions': [ localize('multiSelectModifier.ctrlCmd', "Maps to `Control` on Windows and Linux and to `Command` on macOS."), localize('multiSelectModifier.alt', "Maps to `Alt` on Windows and Linux and to `Option` on macOS.") ], 'default': 'ctrlCmd', 'description': localize({ key: 'multiSelectModifier', comment: [ '- `ctrlCmd` refers to a value the setting can take and should not be localized.', '- `Control` and `Command` refer to the modifier keys Ctrl or Cmd on the keyboard and can be localized.' ] }, "The modifier to be used to add an item in trees and lists to a multi-selection with the mouse (for example in the explorer, open editors and scm view). The 'Open to Side' mouse gestures - if supported - will adapt such that they do not conflict with the multiselect modifier.") }, [openModeSettingKey]: { 'type': 'string', 'enum': ['singleClick', 'doubleClick'], 'default': 'singleClick', 'description': localize({ key: 'openModeModifier', comment: ['`singleClick` and `doubleClick` refers to a value the setting can take and should not be localized.'] }, "Controls how to open items in trees and lists using the mouse (if supported). For parents with children in trees, this setting will control if a single click expands the parent or a double click. Note that some trees and lists might choose to ignore this setting if it is not applicable. ") }, [horizontalScrollingKey]: { 'type': 'boolean', 'default': false, 'description': localize('horizontalScrolling setting', "Controls whether lists and trees support horizontal scrolling in the workbench. Warning: turning on this setting has a performance implication.") }, 'workbench.tree.horizontalScrolling': { 'type': 'boolean', 'default': false, 'description': localize('tree horizontalScrolling setting', "Controls whether trees support horizontal scrolling in the workbench."), 'deprecationMessage': localize('deprecated', "This setting is deprecated, please use '{0}' instead.", horizontalScrollingKey) }, [treeIndentKey]: { 'type': 'number', 'default': 8, minimum: 0, maximum: 40, 'description': localize('tree indent setting', "Controls tree indentation in pixels.") }, [treeRenderIndentGuidesKey]: { type: 'string', enum: ['none', 'onHover', 'always'], default: 'onHover', description: localize('render tree indent guides', "Controls whether the tree should render indent guides.") }, [keyboardNavigationSettingKey]: { 'type': 'string', 'enum': ['simple', 'highlight', 'filter'], 'enumDescriptions': [ localize('keyboardNavigationSettingKey.simple', "Simple keyboard navigation focuses elements which match the keyboard input. Matching is done only on prefixes."), localize('keyboardNavigationSettingKey.highlight', "Highlight keyboard navigation highlights elements which match the keyboard input. Further up and down navigation will traverse only the highlighted elements."), localize('keyboardNavigationSettingKey.filter', "Filter keyboard navigation will filter out and hide all the elements which do not match the keyboard input.") ], 'default': 'highlight', 'description': localize('keyboardNavigationSettingKey', "Controls the keyboard navigation style for lists and trees in the workbench. Can be simple, highlight and filter.") }, [automaticKeyboardNavigationSettingKey]: { 'type': 'boolean', 'default': true, markdownDescription: localize('automatic keyboard navigation setting', "Controls whether keyboard navigation in lists and trees is automatically triggered simply by typing. If set to `false`, keyboard navigation is only triggered when executing the `list.toggleKeyboardNavigation` command, for which you can assign a keyboard shortcut.") } } });
mit
wind-rider/nuimo-client.ts
examples/serialise.ts
816
import "source-map-support/register"; import { withNuimo } from "../src"; import { Update, ClickUpdate, TurnUpdate, SwipeUpdate } from "../src/update/update"; /** * a serialiser implemented using the update's visitor API */ const Serialiser = { serialise(update: Update) { return { type: update.type, time: update.time, repr: update.accept(this) }; }, withClick (clickUpdate: ClickUpdate) { return { down: clickUpdate.down }; }, withSwipe (swipeUpdate: SwipeUpdate) { return { direction: swipeUpdate.direction }; }, withTurn (turnUpdate: TurnUpdate) { return { offset: turnUpdate.offset }; } }; withNuimo().then(nuimo => { nuimo.listen(data => { const serialised = Serialiser.serialise(data); console.log(JSON.stringify(serialised)); }); });
mit
smylydon/msc-project
src/app/models/updateAttempt.js
469
'use strict'; import mongoose from 'mongoose'; // create new schema const schema = new mongoose.Schema({ type: String, data: { cell_id: String, formula: String, user_id: String, browserTimestamp: Boolean, timestamp: Number, type: {type:String}, transaction_id: Number } }, { strict: false }); // virtual date attribute schema.virtual('date') .get(() => this._id.getTimestamp()); // assign schema to 'Sheet' mongoose.model('UpdateAttempt', schema);
mit
QuinntyneBrown/virtual-for
examples/filter/filter.ts
1188
var app = angular.module("filterApp", ["virtualFor"]); module Filter { export class AppController { public movies: Array<any> = [ { "name": "Matrix" }, { "name": "This the End" }, { "name": "Ghostbusters" }, { "name": "300" }, { "name": "Top Five" }, { "name": "Wedding Crashers" }, { "name": "Mission Impossible 2" }, { "name": "Despicable Me" }, { "name": "Her" }, { "name": "Argo" }, { "name": "The Two" }, { "name": "Pain and No Gain" }, { "name": "The Wedding Ringer" }, { "name": "The Town" }, { "name": "Hangover" }, { "name": "Terminator" }, { "name": "Avengers" }, { "name": "The Transporter" }, { "name": "X-Men 3" }, { "name": "Fast 7" }, { "name": "Coming To America" }]; public filterTerm: string; public filterFn = (item: any, searchTerm: string) => { return item.name.indexOf(searchTerm) > -1; } } } app.controller("appController", [Filter.AppController]);
mit
tony19760619/PHPRunnerProjects
Finance/output/LoanStatements_print.php
3036
<?php @ini_set("display_errors","1"); @ini_set("display_startup_errors","1"); require_once("include/dbcommon.php"); require_once("classes/searchclause.php"); require_once('include/xtempl.php'); require_once('classes/printpage.php'); require_once('classes/printpage_details.php'); require_once('classes/reportpage.php'); require_once('classes/reportprintpage.php'); add_nocache_headers(); require_once("include/LoanStatements_variables.php"); if( !Security::processPageSecurity( $strtablename, 'P' ) ) return; $layout = new TLayout("print", "RoundedOffice", "MobileOffice"); $layout->version = 2; $layout->blocks["center"] = array(); $layout->containers["pageheader"] = array(); $layout->container_properties["pageheader"] = array( "print" => "repeat" ); $layout->containers["pageheader"][] = array("name"=>"printheader", "block"=>"printheader", "substyle"=>1 ); $layout->containers["pageheader"][] = array("name"=>"page_of_print", "block"=>"page_number", "substyle"=>1 ); $layout->skins["pageheader"] = "empty"; $layout->blocks["center"][] = "pageheader"; $layout->containers["grid"] = array(); $layout->container_properties["grid"] = array( ); $layout->containers["grid"][] = array("name"=>"printgridnext", "block"=>"grid_block", "substyle"=>1 ); $layout->skins["grid"] = "grid"; $layout->blocks["center"][] = "grid"; $layout->blocks["top"] = array(); $layout->containers["pdf"] = array(); $layout->container_properties["pdf"] = array( "print" => "none" ); $layout->containers["pdf"][] = array("name"=>"printbuttons", "block"=>"printbuttons", "substyle"=>1 ); $layout->skins["pdf"] = "empty"; $layout->blocks["top"][] = "pdf"; $layout->skins["master"] = "empty"; $layout->blocks["top"][] = "master"; $page_layouts["LoanStatements_print"] = $layout; $layout->skinsparams = array(); $layout->skinsparams["empty"] = array("button"=>"button2"); $layout->skinsparams["menu"] = array("button"=>"button1"); $layout->skinsparams["hmenu"] = array("button"=>"button1"); $layout->skinsparams["undermenu"] = array("button"=>"button1"); $layout->skinsparams["fields"] = array("button"=>"button1"); $layout->skinsparams["form"] = array("button"=>"button1"); $layout->skinsparams["1"] = array("button"=>"button1"); $layout->skinsparams["2"] = array("button"=>"button1"); $layout->skinsparams["3"] = array("button"=>"button1"); $xt = new Xtempl(); $id = postvalue("id"); $id = $id != "" ? $id : 1; //array of params for classes $params = array(); $params["id"] = $id; $params["xt"] = &$xt; $params["pageType"] = PAGE_PRINT; $params["tName"] = $strTableName; $params["selectedRecords"] = PrintPage::readSelectedRecordsFromRequest( "LoanStatements" ); $params["allPagesMode"] = postvalue("all"); $params["pdfMode"] = postvalue("pdf"); $params["pdfContent"] = postvalue("htmlPdfContent"); $params["pdfWidth"] = postvalue("width"); $params["detailTables"] = postvalue("details"); $params["splitByRecords"] = postvalue("records"); $pageObject = new PrintPage($params); $pageObject->init(); $pageObject->process(); ?>
mit