id
stringlengths
1
8
text
stringlengths
6
1.05M
dataset_id
stringclasses
1 value
3282808
<filename>scheduler/forms.py from django import forms class AppointmentForm(forms.Form): AVAILABLE_TIMES = [ ('10am', '10am'), ('11am', '11am'), ('12pm', '12pm'), ('1pm', '1pm'), ('2pm', '2pm'), ] schedule_time = forms.CharField(label="Please select desired time.", widget=forms.RadioSelect(choices=AVAILABLE_TIMES)) def __init__(self, year=2020, month=1, day=1): super().__init__() AVAILABLE_TIMES = [ ('10:30am', '10:30am'), ('12pm', '12pm'), ('1pm', '1pm'), ('2pm', '2pm'), ] self.schedule_time = forms.CharField(label="Please desired time.", widget=forms.RadioSelect(choices=AVAILABLE_TIMES))
StarcoderdataPython
250437
<reponame>marsggbo/CovidNet3D from abc import ABC, abstractmethod __all__ = [ 'BaseTrainer', ] class BaseTrainer(ABC): @abstractmethod def train(self): raise NotImplementedError @abstractmethod def validate(self): raise NotImplementedError @abstractmethod def export(self, file): raise NotImplementedError @abstractmethod def checkpoint(self): raise NotImplementedError
StarcoderdataPython
111798
import random import pandas as pd # Columns in the dataset. my_columns = ['site', 'species', 'abundances'] # Fix the random seed to have reproducible results. random.seed(42) print("Generating a new dataset...") def generate_data(): """ Generate entries for the dataset. """ for site_no in range(1, 5): site = f"site_A{site_no}" for species_code in range(0, 11): subspecies = chr(97 + int(species_code)) species = f"genus sp.{subspecies}" abundance = random.randint(0, 42) print(f"Added observation: (site={site}, species={species}, abundance={abundance})") yield((site, species, abundance)) # Transform the generated data to a dataframe. species_site_data_frame = pd.DataFrame(generate_data(), columns=my_columns) # Dump the generated data to the output. species_site_data_frame.to_csv(snakemake.output[0], index=False) print("Completed saving dataset as CSV.")
StarcoderdataPython
258294
<reponame>rbbratta/yardstick # Copyright 2014: Mirantis Inc. # All Rights Reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); you may # not use this file except in compliance with the License. You may obtain # a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, WITHOUT # WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the # License for the specific language governing permissions and limitations # under the License. # yardstick comment: this is a modified copy of # rally/rally/benchmark/runners/base.py from __future__ import absolute_import import importlib import logging import multiprocessing import subprocess import time import traceback from oslo_config import cfg import yardstick.common.utils as utils from yardstick.benchmark.scenarios import base as base_scenario from yardstick.dispatcher.base import Base as DispatcherBase log = logging.getLogger(__name__) CONF = cfg.CONF def _output_serializer_main(filename, queue, config): """entrypoint for the singleton subprocess writing to outfile Use of this process enables multiple instances of a scenario without messing up the output file. """ out_type = config['yardstick'].get('DEFAULT', {}).get('dispatcher', 'file') conf = { 'type': out_type.capitalize(), 'file_path': filename } dispatcher = DispatcherBase.get(conf, config) while True: # blocks until data becomes available record = queue.get() if record == '_TERMINATE_': dispatcher.flush_result_data() break else: dispatcher.record_result_data(record) def _execute_shell_command(command): """execute shell script with error handling""" exitcode = 0 output = [] try: output = subprocess.check_output(command, shell=True) except Exception: exitcode = -1 output = traceback.format_exc() log.error("exec command '%s' error:\n ", command) log.error(traceback.format_exc()) return exitcode, output def _single_action(seconds, command, queue): """entrypoint for the single action process""" log.debug("single action, fires after %d seconds (from now)", seconds) time.sleep(seconds) log.debug("single action: executing command: '%s'", command) ret_code, data = _execute_shell_command(command) if ret_code < 0: log.error("single action error! command:%s", command) queue.put({'single-action-data': data}) return log.debug("single action data: \n%s", data) queue.put({'single-action-data': data}) def _periodic_action(interval, command, queue): """entrypoint for the periodic action process""" log.debug("periodic action, fires every: %d seconds", interval) time_spent = 0 while True: time.sleep(interval) time_spent += interval log.debug("periodic action, executing command: '%s'", command) ret_code, data = _execute_shell_command(command) if ret_code < 0: log.error("periodic action error! command:%s", command) queue.put({'periodic-action-data': data}) break log.debug("periodic action data: \n%s", data) queue.put({'periodic-action-data': data}) class Runner(object): queue = None dump_process = None runners = [] @staticmethod def get_cls(runner_type): """return class of specified type""" for runner in utils.itersubclasses(Runner): if runner_type == runner.__execution_type__: return runner raise RuntimeError("No such runner_type %s" % runner_type) @staticmethod def get_types(): """return a list of known runner type (class) names""" types = [] for runner in utils.itersubclasses(Runner): types.append(runner) return types @staticmethod def get(runner_cfg, config): """Returns instance of a scenario runner for execution type. """ # if there is no runner, start the output serializer subprocess if not Runner.runners: log.debug("Starting dump process file '%s'", runner_cfg["output_filename"]) Runner.queue = multiprocessing.Queue() Runner.dump_process = multiprocessing.Process( target=_output_serializer_main, name="Dumper", args=(runner_cfg["output_filename"], Runner.queue, config)) Runner.dump_process.start() return Runner.get_cls(runner_cfg["type"])(runner_cfg, Runner.queue) @staticmethod def release_dump_process(): """Release the dumper process""" log.debug("Stopping dump process") if Runner.dump_process: Runner.queue.put('_TERMINATE_') Runner.dump_process.join() Runner.dump_process = None @staticmethod def release(runner): """Release the runner""" if runner in Runner.runners: Runner.runners.remove(runner) # if this was the last runner, stop the output serializer subprocess if not Runner.runners: Runner.release_dump_process() @staticmethod def terminate(runner): """Terminate the runner""" if runner.process and runner.process.is_alive(): runner.process.terminate() @staticmethod def terminate_all(): """Terminate all runners (subprocesses)""" log.debug("Terminating all runners") # release dumper process as some errors before any runner is created if not Runner.runners: Runner.release_dump_process() return for runner in Runner.runners: log.debug("Terminating runner: %s", runner) if runner.process: runner.process.terminate() runner.process.join() if runner.periodic_action_process: log.debug("Terminating periodic action process") runner.periodic_action_process.terminate() runner.periodic_action_process = None Runner.release(runner) def __init__(self, config, queue): self.config = config self.periodic_action_process = None self.result_queue = queue self.process = None self.aborted = multiprocessing.Event() Runner.runners.append(self) def run_post_stop_action(self): """run a potentially configured post-stop action""" if "post-stop-action" in self.config: command = self.config["post-stop-action"]["command"] log.debug("post stop action: command: '%s'", command) ret_code, data = _execute_shell_command(command) if ret_code < 0: log.error("post action error! command:%s", command) self.result_queue.put({'post-stop-action-data': data}) return log.debug("post-stop data: \n%s", data) self.result_queue.put({'post-stop-action-data': data}) def run(self, scenario_cfg, context_cfg): scenario_type = scenario_cfg["type"] class_name = base_scenario.Scenario.get(scenario_type) path_split = class_name.split(".") module_path = ".".join(path_split[:-1]) module = importlib.import_module(module_path) cls = getattr(module, path_split[-1]) self.config['object'] = class_name self.aborted.clear() # run a potentially configured pre-start action if "pre-start-action" in self.config: command = self.config["pre-start-action"]["command"] log.debug("pre start action: command: '%s'", command) ret_code, data = _execute_shell_command(command) if ret_code < 0: log.error("pre-start action error! command:%s", command) self.result_queue.put({'pre-start-action-data': data}) return log.debug("pre-start data: \n%s", data) self.result_queue.put({'pre-start-action-data': data}) if "single-shot-action" in self.config: single_action_process = multiprocessing.Process( target=_single_action, name="single-shot-action", args=(self.config["single-shot-action"]["after"], self.config["single-shot-action"]["command"], self.result_queue)) single_action_process.start() if "periodic-action" in self.config: self.periodic_action_process = multiprocessing.Process( target=_periodic_action, name="periodic-action", args=(self.config["periodic-action"]["interval"], self.config["periodic-action"]["command"], self.result_queue)) self.periodic_action_process.start() self._run_benchmark(cls, "run", scenario_cfg, context_cfg) def abort(self): """Abort the execution of a scenario""" self.aborted.set() def join(self, timeout=None): self.process.join(timeout) if self.periodic_action_process: self.periodic_action_process.terminate() self.periodic_action_process = None self.run_post_stop_action() return self.process.exitcode
StarcoderdataPython
1911345
<filename>pyguetzli/guetzli.py """ This module contains functions binded from the Guetzli C++ API. """ from ._guetzli import lib, ffi #: Default quality for outputted JPEGs DEFAULT_JPEG_QUALITY = 95 def process_jpeg_bytes(bytes_in, quality=DEFAULT_JPEG_QUALITY): """Generates an optimized JPEG from JPEG-encoded bytes. :param bytes_in: the input image's bytes :param quality: the output JPEG quality (default 95) :returns: Optimized JPEG bytes :rtype: bytes :raises ValueError: Guetzli was not able to decode the image (the image is probably corrupted or is not a JPEG) .. code:: python import pyguetzli input_jpeg_bytes = open("./test/image.jpg", "rb").read() optimized_jpeg = pyguetzli.process_jpeg_bytes(input_jpeg_bytes) """ bytes_out_p = ffi.new("char**") bytes_out_p_gc = ffi.gc(bytes_out_p, lib.guetzli_free_bytes) length = lib.guetzli_process_jpeg_bytes( bytes_in, len(bytes_in), bytes_out_p_gc, quality ) if length == 0: raise ValueError("Invalid JPEG: Guetzli was not able to decode the image") # noqa bytes_out = ffi.cast("char*", bytes_out_p_gc[0]) return ffi.unpack(bytes_out, length) def process_rgb_bytes(bytes_in, width, height, quality=DEFAULT_JPEG_QUALITY): """Generates an optimized JPEG from RGB bytes. :param bytes bytes_in: the input image's bytes :param int width: the width of the input image :param int height: the height of the input image :param int quality: the output JPEG quality (default 95) :returns: Optimized JPEG bytes :rtype: bytes :raises ValueError: the given width and height is not coherent with the ``bytes_in`` length. .. code:: python import pyguetzli # 2x2px RGB image # | red | green | image_pixels = b"\\xFF\\x00\\x00\\x00\\xFF\\x00" image_pixels += b"\\x00\\x00\\xFF\\xFF\\xFF\\xFF" # | blue | white | optimized_jpeg = pyguetzli.process_rgb_bytes(image_pixels, 2, 2) """ if len(bytes_in) != width * height * 3: raise ValueError("bytes_in length is not coherent with given width and height") # noqa bytes_out_p = ffi.new("char**") bytes_out_p_gc = ffi.gc(bytes_out_p, lib.guetzli_free_bytes) length = lib.guetzli_process_rgb_bytes( bytes_in, width, height, bytes_out_p_gc, quality ) bytes_out = ffi.cast("char*", bytes_out_p_gc[0]) return ffi.unpack(bytes_out, length)
StarcoderdataPython
5141312
from gameplay import menus as m from NPC import npc as n from Items import items as i class Store(): def __init__(self,type): self.menu = "" self.npc = "" pass class GeneralStore(Store): def __init__(self): self.type = "General Store" super().__init__(self.type) def print_menu(self): menu = m.GeneralShopMenu().create_menu() print(menu) class Armory(Store): def __init__(self): self.type = "Armory" self.clerk = self._generate_clerk() super().__init__(self.type) def print_menu(self): menu = m.ArmoryMenu().create_menu() print(menu) def _generate_clerk(self): items = {"Silver Sword":i.Weapon(10, 4, 10, 2, True, "Silver Sword"),"Leather Armor":i.Armor(10, 4, 10, 2, True, 'Leather Armor')} clerk = n.Merchant(False, 1, items) return clerk class Apothecary(Store): def __init__(self): self.type = "Apothecary" super().__init__(self.type) def print_menu(self): menu = m.ApothecaryMenu().create_menu() print(menu) class Town(): def __init__(self): self.general = GeneralStore() self.apothecary = Apothecary() self.armory = Armory()
StarcoderdataPython
153333
<filename>py_dict/src/deleter.py #!/usr/bin/python3 import sys from PyQt5.QtWidgets import ( QWidget, QApplication, QHBoxLayout, QVBoxLayout, QRadioButton, QButtonGroup, QPushButton, QLineEdit, QLabel, QListWidget ) from PyQt5.QtGui import QIcon from .db import DbOperator from .show import ShowerUi from .function import * class DeleterUi(QWidget): def __init__(self, db_operator, icon): super().__init__() self.deleteType = 'word' self.db_operator = db_operator self.icon = icon self.shower_ui = ShowerUi(self.db_operator, icon, self) self.initUI() self.initAction() self.setFont(GLOBAL_FONT) self.results = None self.radioBtnWord.setChecked(True) def closeEvent(self, event): self.shower_ui.close() def searchRecords(self, key=None, clear_cache=False): self.resultList.clear() if key in (None, False): key = self.searchText.text().strip() self.key = key.lower() if self.deleteType == 'word': if self.key == '': self.results = self.db_operator.select_all_words(clear_cache) else: self.results = self.db_operator.select_like_word(self.key, clear_cache) else: if self.key == '': self.results = self.db_operator.select_all_article_titles(clear_cache) else: self.results = self.db_operator.select_like_article(self.key, clear_cache) self.resultList.addItems(self.results) def initAction(self): self.searchText.textChanged.connect(self.searchRecords) self.searchButton.clicked.connect(self.searchRecords) self.resultList.clicked.connect(self.resultListClicked) def initUI(self): hbox_1 = QHBoxLayout() self.radioBtnWord = QRadioButton('Word') self.radioBtnArticle = QRadioButton('Article') self.radioBtnGroup = QButtonGroup() self.radioBtnGroup.addButton(self.radioBtnWord) self.radioBtnGroup.addButton(self.radioBtnArticle) self.radioBtnWord.toggled.connect( lambda : self.btnState(self.radioBtnWord) ) self.radioBtnArticle.toggled.connect( lambda : self.btnState(self.radioBtnArticle) ) hbox_1.addWidget(self.radioBtnWord) hbox_1.addWidget(self.radioBtnArticle) hbox_2 = QHBoxLayout() self.searchText = QLineEdit(self) self.searchButton = QPushButton('Search') hbox_2.addWidget(self.searchText) hbox_2.addWidget(self.searchButton) vbox_i = QVBoxLayout() searchLabel = QLabel('Search Result:') self.resultList = QListWidget() vbox_i.addWidget(searchLabel) vbox_i.addWidget(self.resultList) vbox = QVBoxLayout() vbox.addLayout(hbox_1) vbox.addLayout(hbox_2) vbox.addLayout(vbox_i) self.setLayout(vbox) self.setGeometry(300, 300, 400, 600) self.setWindowTitle('Delete Records') self.setWindowIcon(self.icon) def btnState(self, button): if button.text() == 'Word' and self.deleteType != 'word': self.deleteType = 'word' self.searchText.setPlaceholderText('Word to search') elif button.text() == 'Article' and self.deleteType != 'article': self.deleteType = 'article' self.searchText.setPlaceholderText('Title of Article to search') self.resultList.clear() def clearResultList(self): self.resultList.clear() def resultListClicked(self, index): i = index.row() item = self.resultList.item(i).text() if self.deleteType == 'word': record = self.db_operator.select_word(item) usages = self.db_operator.select_usages(item) if None in (record, usages): content = None else: content = { 'word': item, 'meaning': record[0], 'sound': record[1], 'exchange': record[2], 'usage': combine_usage_str(usages) } self.shower_ui.initWebView('show_word', content) else: record = self.db_operator.select_article(item) if record is None: content = None else: content = { 'title': item, 'content': record } self.shower_ui.initWebView('show_article', content) if content is None: self.searchRecords(self.key, clear_cache=True) self.shower_ui.show() self.shower_ui.setFocus() self.shower_ui.activateWindow() if __name__ == '__main__': app = QApplication(sys.argv) db_operator = DbOperator() ex = DeleterUi(db_operator) ex.show() sys.exit(app.exec_())
StarcoderdataPython
1830791
<reponame>travisjwalter/PackHacks-Python-Flask-Backend from flask import Flask, request, jsonify from indeedScraper import getList from flask_cors import CORS ## This file is the Flask GET API endpoint for the Backend PackHacks workshop. ## We import flask and the getList function from the indeedScraper file we created. ## @author <NAME> - 3/16/2021 app = Flask(__name__) CORS(app) ## This is the API GET @ endpoint /retrieveJobs that returns the list of jobs to the caller. ## It uses the Indeed Scraper and returns the parsed information as JSON. @app.route('/retrieveJobs', methods=['GET']) ## This is the function that is run when the /retrieveJobs endpoint is called, which runs ## the Indeed API call and returns the JSON. def getJobs(): data = [] if request.method == 'GET': # Checks if it's a GET request ## This function scrapes the Indeed Job Search website for Software Engineering Jobs ## within 50 miles of Raleigh, NC. (This location and radius can be changed in the ## indeedScraper.py). getList returns a list of dictionaries, which is placed into the ## data list. data = getList() ## Transfer list of dictionary to JSON for returning to the front end (you can do anything ## here with formatting but our frontend team was more comfortable with JSON). response = jsonify(data); ## When jsonifying the dictionary list, there is a field for status_code, which we will use ## here for the HTTP request status returned with the dictionary. You can return any status ## code here to let your user know what's going on. We are using the 202 (Accepted) so the ## user knows that the GET action was accepted. response.status_code = 202 ## Return the JSON response to the user. return response
StarcoderdataPython
8040020
# coding:utf-8 from typing import Mapping, Any import os import functools import io import tempfile import pytest from itertools import chain, repeat from copy import deepcopy from sklearn.base import BaseEstimator from multipledispatch import dispatch from bourbaki.application.config import ( load_config, dump_config, allow_unsafe_yaml, LEGAL_CONFIG_EXTENSIONS, ) from bourbaki.application.typed_io.inflation import CLASSPATH_KEY, KWARGS_KEY from bourbaki.application.typed_io.config_decode import config_decoder # remove duplicate .yaml -> .yml LEGAL_CONFIG_EXTENSIONS = tuple(e for e in LEGAL_CONFIG_EXTENSIONS if e != ".yaml") NON_JSON_INI_EXTENSIONS = tuple( e for e in LEGAL_CONFIG_EXTENSIONS if e not in (".toml", ".json", ".ini") ) NON_JSON_EXTENSIONS = tuple( e for e in LEGAL_CONFIG_EXTENSIONS if e not in (".toml", ".json") ) NON_INI_EXTENSIONS = tuple(e for e in LEGAL_CONFIG_EXTENSIONS if e not in (".ini",)) ALLOW_INT_KEYS_EXTENSIONS = (".yml", ".py") construct_instances_recursively = config_decoder(Mapping[str, BaseEstimator]) sklearnconf = { "forest": { CLASSPATH_KEY: "sklearn.ensemble.RandomForestClassifier", KWARGS_KEY: {"min_samples_split": 5, "n_estimators": 100}, }, "isolation_forest_n192_s1024": { CLASSPATH_KEY: "sklearn.ensemble.iforest.IsolationForest", KWARGS_KEY: { "bootstrap": True, "max_samples": 1024, "n_estimators": 192, "n_jobs": 7, }, }, "logistic_l1": { CLASSPATH_KEY: "sklearn.linear_model.LogisticRegression", KWARGS_KEY: {"penalty": "l1"}, }, "logistic_l1_highreg": { CLASSPATH_KEY: "sklearn.linear_model.LogisticRegression", KWARGS_KEY: { "C": 0.1, # 'class_weight': {0: 0.01, 1: 0.99}, "penalty": "l1", }, }, "logistic_l2": { CLASSPATH_KEY: "sklearn.linear_model.LogisticRegression", KWARGS_KEY: {"penalty": "l2"}, }, "logistic_l2_highreg": { CLASSPATH_KEY: "sklearn.linear_model.LogisticRegression", KWARGS_KEY: { "C": 0.1, # 'class_weight': {0: 0.01, 1: 0.99}, "penalty": "l2", }, }, "svc": { CLASSPATH_KEY: "sklearn.svm.SVC", KWARGS_KEY: { "C": 1.0, "cache_size": 1024, # 'class_weight': {0: 0.01, 1: 0.99}, "coef0": 0.0, "degree": 2, "gamma": "auto", "kernel": "poly", "probability": True, }, }, } sklearnconf_w_int_keys = deepcopy(sklearnconf) sklearnconf_w_int_keys["svc"][KWARGS_KEY]["class_weight"] = {0: 0.01, 1: 0.99} fooconf = dict(foo="bar", baz=(1, 2, {3: 4, 5: [6, 7]}), qux=["foo", ("bar", "baz")]) # replace lists with tuples @dispatch(dict) def jsonify(obj, str_keys=True): f = str if str_keys else lambda x: x return {f(k): jsonify(v, str_keys=str_keys) for k, v in obj.items()} @dispatch((list, tuple)) def jsonify(obj, str_keys=True): return list(map(functools.partial(jsonify, str_keys=str_keys), obj)) @dispatch(object) def jsonify(obj, str_keys=True): return obj @pytest.fixture(scope="function") def tmp(): f = tempfile.mktemp() yield f def test_top_level_in_ini(): # values with no sections dump and load in .ini as we would expect in .toml s = """ value1 = "foo" [section] value2 = 1 """ f = io.StringIO(s) c = load_config(f, ext=".toml") newf = io.StringIO() dump_config(c, newf, ext=".ini") newf.seek(0) assert c == load_config(newf, ext=".ini") def test_inflate_instances(): models = construct_instances_recursively(sklearnconf_w_int_keys) for v in models.values(): assert isinstance(v, BaseEstimator) @pytest.mark.parametrize("ext", NON_JSON_INI_EXTENSIONS) @pytest.mark.parametrize("conf", [sklearnconf, fooconf]) def test_dump_load_python_yaml(conf, ext, tmp): if not os.path.exists(tmp): with open(tmp + ext, "w"): pass dump_config(conf, tmp, ext=ext) conf_ = load_config(tmp + ext, disambiguate=True) assert jsonify(conf, str_keys=False) == jsonify(conf_, str_keys=False) os.remove(tmp + ext) @pytest.mark.parametrize("conf", [sklearnconf, fooconf]) def test_dump_load_json(conf, tmp): ext = ".json" dump_config(conf, tmp, ext=ext) conf_ = load_config(tmp, disambiguate=True) assert jsonify(conf) == conf_ # os.remove(tmp + ext) @pytest.mark.parametrize( "ext,conf", chain( zip(NON_INI_EXTENSIONS, repeat(sklearnconf)), zip(ALLOW_INT_KEYS_EXTENSIONS, repeat(sklearnconf_w_int_keys)), ), ) def test_dump_load_class_instances(ext, conf, tmp): dump_config(conf, tmp, ext=ext) conf_ = load_config(tmp, disambiguate=True) models = construct_instances_recursively(conf) models_ = construct_instances_recursively(conf_) for m in (models, models_): for v in m.values(): assert isinstance(v, BaseEstimator) assert models_.keys() == models.keys() for k in models: m1 = models[k] m2 = models_[k] c = conf[k] for attr in c[KWARGS_KEY]: attr1 = getattr(m1, attr) if ext == ".json": attr1 = jsonify(attr1) assert attr1 == getattr(m2, attr)
StarcoderdataPython
91047
<filename>api/src/helper/image_utils.py import uuid import base64 import requests from PIL import Image from src import * def download(image_url): """ Downloads an image given an Internet accessible URL. :param image_url: Internet accessible URL. :return: Output path of the downloaded image. """ output_path = None response = requests.get(image_url, timeout=15) if response.ok: output_path = f'{DATA_FOLDER}/{uuid.uuid4()}.png' with open(output_path, 'wb') as f: f.write(response.content) return output_path def decode(image_base64): """ Decodes an encoded image in base64. :param image_base64: Encoded image. :return: Output path of the decoded image. """ image_data = base64.b64decode(image_base64) output_path = f'{DATA_FOLDER}/{uuid.uuid4()}.png' with open(output_path, 'wb') as f: f.write(image_data) with Image.open(output_path).convert('RGBA') as img: img.save(output_path, format='PNG', quality=95) return output_path def encode(output_image_path): """ Encodes an image in base64 given its path. :param output_image_path: Image path. :return: Encoded image. """ with open(output_image_path, 'rb') as image_file: encoded_string = base64.b64encode(image_file.read()).decode('utf-8') return encoded_string def is_white(r, g, b): """ Check if an RGB code is white. :param r: Red byte. :param g: Green byte. :param b: Blue byte. :return: True if the pixel is white, False otherwise. """ if r == 255 and g == 255 and b == 255: return True else: return False def remove_white(image_path): """ Remove the color white of an image given its path. :param image_path: Image path. :return: Image saved without white color. """ with Image.open(image_path) as img: img = img.convert('RGBA') new_data = [] for item in img.getdata(): if is_white(item[0], item[1], item[2]): new_data.append((255, 255, 255, 0)) else: new_data.append(item) img.putdata(new_data) img.save(image_path, format='PNG', quality=95) def get_resize_dimensions(original_size, dimensions): """ Gets the ideal resize dimensions given the original size. :param original_size: Original size. :param dimensions: Default target dimensions. :return: Ideal dimensions. """ dim_x, dim_y = dimensions img_x, img_y = original_size if img_x >= img_y: return int(dim_x), int(img_y * (dim_x / (img_x * 1.0))) else: return int(img_x * (dim_y / (img_y * 1.0))), int(dim_y) def resize_aspect(image, dimensions=IMAGE_DIMENSIONS_PIXELS, re_sample=Image.LANCZOS): """ Resizes an image given the opened Pillow version of it. :param image: Opened Pillow image. :param dimensions: Dimensions to resize. :param re_sample: Sample to resize. :return: Pillow image resized. """ new_dim = get_resize_dimensions(image.size, dimensions) if new_dim == image.size: return image.copy() else: return image.resize(size=new_dim, resample=re_sample)
StarcoderdataPython
3325519
<reponame>dolong2110/Algorithm-By-Problems-Python<gh_stars>0 from typing import List def longestOnes(self, nums: List[int], k: int) -> int: l, r = 0, 0 while r < len(nums): k -= 1 - nums[r] if k < 0: k += 1 - nums[l] l += 1 r += 1 return r - l
StarcoderdataPython
11382807
<reponame>shirtsgroup/analyze_foldamers """ Unit and regression test for the analyze_foldamers package. """ # Import package, test suite, and other packages as needed import analyze_foldamers import pytest import sys import os import pickle from cg_openmm.cg_model.cgmodel import CGModel from analyze_foldamers.ensembles.cluster import * current_path = os.path.dirname(os.path.abspath(__file__)) data_path = os.path.join(current_path, 'test_data') def test_clustering_kmedoids_pdb(tmpdir): """Test Kmeans clustering""" output_directory = tmpdir.mkdir("output") # Load in cgmodel cgmodel_path = os.path.join(data_path, "stored_cgmodel.pkl") cgmodel = pickle.load(open(cgmodel_path, "rb")) # Create list of trajectory files for clustering analysis number_replicas = 12 pdb_file_list = [] for i in range(number_replicas): pdb_file_list.append(f"{data_path}/replica_%s.pdb" %(i+1)) # Set clustering parameters n_clusters=2 frame_start=10 frame_stride=1 frame_end=-1 # Run KMeans clustering medoid_positions, cluster_size, cluster_rmsd, silhouette_avg, labels, original_indices = \ get_cluster_medoid_positions_KMedoids( pdb_file_list, cgmodel, n_clusters=n_clusters, frame_start=frame_start, frame_stride=frame_stride, frame_end=-1, output_dir=output_directory, plot_silhouette=True, plot_rmsd_hist=True, filter=True, filter_ratio=0.20, ) assert len(cluster_rmsd) == n_clusters assert len(labels) == len(original_indices) assert os.path.isfile(f"{output_directory}/medoid_1.pdb") assert os.path.isfile(f"{output_directory}/silhouette_kmedoids_ncluster_{n_clusters}.pdf") assert os.path.isfile(f"{output_directory}/distances_rmsd_hist.pdf") def test_clustering_kmedoids_pdb_no_cgmodel(tmpdir): """Test Kmeans clustering without a cgmodel""" output_directory = tmpdir.mkdir("output") # Create list of trajectory files for clustering analysis number_replicas = 12 pdb_file_list = [] for i in range(number_replicas): pdb_file_list.append(f"{data_path}/replica_%s.pdb" %(i+1)) # Set clustering parameters n_clusters=2 frame_start=10 frame_stride=1 frame_end=-1 # Run KMeans clustering medoid_positions, cluster_size, cluster_rmsd, silhouette_avg, labels, original_indices = \ get_cluster_medoid_positions_KMedoids( pdb_file_list, cgmodel=None, n_clusters=n_clusters, frame_start=frame_start, frame_stride=frame_stride, frame_end=-1, output_dir=output_directory, plot_silhouette=True, plot_rmsd_hist=True, filter=True, filter_ratio=0.20, ) assert len(cluster_rmsd) == n_clusters assert len(labels) == len(original_indices) assert os.path.isfile(f"{output_directory}/medoid_1.pdb") assert os.path.isfile(f"{output_directory}/silhouette_kmedoids_ncluster_{n_clusters}.pdf") assert os.path.isfile(f"{output_directory}/distances_rmsd_hist.pdf") def test_clustering_kmedoids_dcd(tmpdir): """Test KMedoids clustering""" output_directory = tmpdir.mkdir("output") # Load in cgmodel cgmodel_path = os.path.join(data_path, "stored_cgmodel.pkl") cgmodel = pickle.load(open(cgmodel_path, "rb")) # Create list of trajectory files for clustering analysis number_replicas = 12 dcd_file_list = [] for i in range(number_replicas): dcd_file_list.append(f"{data_path}/replica_%s.dcd" %(i+1)) # Set clustering parameters n_clusters=2 frame_start=10 frame_stride=1 frame_end=-1 # Run KMeans clustering medoid_positions, cluster_size, cluster_rmsd, silhouette_avg, labels, original_indices = \ get_cluster_medoid_positions_KMedoids( dcd_file_list, cgmodel, n_clusters=n_clusters, frame_start=frame_start, frame_stride=frame_stride, frame_end=-1, output_format="dcd", output_dir=output_directory, plot_silhouette=True, plot_rmsd_hist=True, filter=True, filter_ratio=0.20, ) assert len(cluster_rmsd) == n_clusters assert len(labels) == len(original_indices) assert os.path.isfile(f"{output_directory}/medoid_1.dcd") assert os.path.isfile(f"{output_directory}/silhouette_kmedoids_ncluster_{n_clusters}.pdf") assert os.path.isfile(f"{output_directory}/distances_rmsd_hist.pdf") def test_clustering_dbscan_pdb(tmpdir): """Test DBSCAN clustering""" output_directory = tmpdir.mkdir("output") # Load in cgmodel cgmodel_path = os.path.join(data_path, "stored_cgmodel.pkl") cgmodel = pickle.load(open(cgmodel_path, "rb")) # Create list of trajectory files for clustering analysis number_replicas = 12 pdb_file_list = [] for i in range(number_replicas): pdb_file_list.append(f"{data_path}/replica_%s.pdb" %(i+1)) # Set clustering parameters min_samples=3 eps=0.5 frame_start=10 frame_stride=1 frame_end=-1 # Run DBSCAN density-based clustering medoid_positions, cluster_sizes, cluster_rmsd, n_noise, silhouette_avg, labels, original_indices = \ get_cluster_medoid_positions_DBSCAN( pdb_file_list, cgmodel, min_samples=min_samples, eps=eps, frame_start=frame_start, frame_stride=frame_stride, frame_end=-1, output_dir=output_directory, plot_silhouette=True, plot_rmsd_hist=True, filter=True, filter_ratio=0.20, core_points_only=False, ) assert len(labels) == len(original_indices) assert os.path.isfile(f"{output_directory}/medoid_0.pdb") assert os.path.isfile(f"{output_directory}/distances_rmsd_hist.pdf") def test_clustering_dbscan_pdb_core_medoids(tmpdir): """Test DBSCAN clustering""" output_directory = tmpdir.mkdir("output") # Load in cgmodel cgmodel_path = os.path.join(data_path, "stored_cgmodel.pkl") cgmodel = pickle.load(open(cgmodel_path, "rb")) # Create list of trajectory files for clustering analysis number_replicas = 12 pdb_file_list = [] for i in range(number_replicas): pdb_file_list.append(f"{data_path}/replica_%s.pdb" %(i+1)) # Set clustering parameters min_samples=3 eps=0.5 frame_start=10 frame_stride=1 frame_end=-1 # Run DBSCAN density-based clustering medoid_positions, cluster_sizes, cluster_rmsd, n_noise, silhouette_avg, labels, original_indices = \ get_cluster_medoid_positions_DBSCAN( pdb_file_list, cgmodel, min_samples=min_samples, eps=eps, frame_start=frame_start, frame_stride=frame_stride, frame_end=-1, output_dir=output_directory, plot_silhouette=True, plot_rmsd_hist=True, filter=True, filter_ratio=0.20, core_points_only=True, ) assert len(labels) == len(original_indices) assert os.path.isfile(f"{output_directory}/medoid_0.pdb") assert os.path.isfile(f"{output_directory}/distances_rmsd_hist.pdf") def test_clustering_dbscan_pdb_no_cgmodel(tmpdir): """Test DBSCAN clustering without cgmodel object""" output_directory = tmpdir.mkdir("output") # Create list of trajectory files for clustering analysis number_replicas = 12 pdb_file_list = [] for i in range(number_replicas): pdb_file_list.append(f"{data_path}/replica_%s.pdb" %(i+1)) # Set clustering parameters min_samples=3 eps=0.5 frame_start=10 frame_stride=1 frame_end=-1 # Run DBSCAN density-based clustering medoid_positions, cluster_sizes, cluster_rmsd, n_noise, silhouette_avg, labels, original_indices = \ get_cluster_medoid_positions_DBSCAN( pdb_file_list, cgmodel = None, min_samples=min_samples, eps=eps, frame_start=frame_start, frame_stride=frame_stride, frame_end=-1, output_dir=output_directory, plot_silhouette=True, plot_rmsd_hist=True, filter=True, filter_ratio=0.20, core_points_only=False, ) assert len(labels) == len(original_indices) assert os.path.isfile(f"{output_directory}/medoid_0.pdb") assert os.path.isfile(f"{output_directory}/distances_rmsd_hist.pdf") def test_clustering_dbscan_dcd(tmpdir): """Test DBSCAN clustering""" output_directory = tmpdir.mkdir("output") # Load in cgmodel cgmodel_path = os.path.join(data_path, "stored_cgmodel.pkl") cgmodel = pickle.load(open(cgmodel_path, "rb")) # Create list of trajectory files for clustering analysis number_replicas = 12 dcd_file_list = [] for i in range(number_replicas): dcd_file_list.append(f"{data_path}/replica_%s.dcd" %(i+1)) # Set clustering parameters min_samples=3 eps=0.5 frame_start=10 frame_stride=1 frame_end=-1 # Run OPTICS density-based clustering medoid_positions, cluster_sizes, cluster_rmsd, n_noise, silhouette_avg, labels, original_indices = \ get_cluster_medoid_positions_DBSCAN( dcd_file_list, cgmodel, min_samples=min_samples, eps=eps, frame_start=frame_start, frame_stride=frame_stride, frame_end=-1, output_format="dcd", output_dir=output_directory, plot_silhouette=True, plot_rmsd_hist=True, filter=True, filter_ratio=0.20, core_points_only=False, ) assert len(labels) == len(original_indices) assert os.path.isfile(f"{output_directory}/medoid_0.dcd") assert os.path.isfile(f"{output_directory}/distances_rmsd_hist.pdf") def test_clustering_optics_pdb(tmpdir): """Test OPTICS clustering""" output_directory = tmpdir.mkdir("output") # Load in cgmodel cgmodel_path = os.path.join(data_path, "stored_cgmodel.pkl") cgmodel = pickle.load(open(cgmodel_path, "rb")) # Create list of trajectory files for clustering analysis number_replicas = 12 pdb_file_list = [] for i in range(number_replicas): pdb_file_list.append(f"{data_path}/replica_%s.pdb" %(i+1)) # Set clustering parameters min_samples=5 frame_start=10 frame_stride=1 frame_end=-1 # Run OPTICS density-based clustering medoid_positions, cluster_sizes, cluster_rmsd, n_noise, silhouette_avg, labels, original_indices = \ get_cluster_medoid_positions_OPTICS( pdb_file_list, cgmodel, min_samples=min_samples, frame_start=frame_start, frame_stride=frame_stride, frame_end=-1, output_dir=output_directory, plot_silhouette=True, plot_rmsd_hist=True, filter=True, filter_ratio=0.20, ) assert len(labels) == len(original_indices) assert os.path.isfile(f"{output_directory}/medoid_0.pdb") assert os.path.isfile(f"{output_directory}/distances_rmsd_hist.pdf") def test_clustering_optics_pdb_no_cgmodel(tmpdir): """Test OPTICS clustering without a cgmodel object""" output_directory = tmpdir.mkdir("output") # Create list of trajectory files for clustering analysis number_replicas = 12 pdb_file_list = [] for i in range(number_replicas): pdb_file_list.append(f"{data_path}/replica_%s.pdb" %(i+1)) # Set clustering parameters min_samples=5 frame_start=10 frame_stride=1 frame_end=-1 # Run OPTICS density-based clustering medoid_positions, cluster_sizes, cluster_rmsd, n_noise, silhouette_avg, labels, original_indices = \ get_cluster_medoid_positions_OPTICS( pdb_file_list, cgmodel = None, min_samples=min_samples, frame_start=frame_start, frame_stride=frame_stride, frame_end=-1, output_dir=output_directory, plot_silhouette=True, plot_rmsd_hist=True, filter=True, filter_ratio=0.20, ) assert len(labels) == len(original_indices) assert os.path.isfile(f"{output_directory}/medoid_0.pdb") assert os.path.isfile(f"{output_directory}/distances_rmsd_hist.pdf") def test_clustering_optics_dcd(tmpdir): """Test OPTICS clustering""" output_directory = tmpdir.mkdir("output") # Load in cgmodel cgmodel_path = os.path.join(data_path, "stored_cgmodel.pkl") cgmodel = pickle.load(open(cgmodel_path, "rb")) # Create list of trajectory files for clustering analysis number_replicas = 12 dcd_file_list = [] for i in range(number_replicas): dcd_file_list.append(f"{data_path}/replica_%s.dcd" %(i+1)) # Set clustering parameters min_samples=5 frame_start=10 frame_stride=1 frame_end=-1 # Run OPTICS density-based clustering medoid_positions, cluster_sizes, cluster_rmsd, n_noise, silhouette_avg, labels, original_indices = \ get_cluster_medoid_positions_OPTICS( dcd_file_list, cgmodel, min_samples=min_samples, frame_start=frame_start, frame_stride=frame_stride, frame_end=-1, output_format="dcd", output_dir=output_directory, plot_silhouette=True, plot_rmsd_hist=True, filter=True, filter_ratio=0.20, ) assert len(labels) == len(original_indices) assert os.path.isfile(f"{output_directory}/medoid_0.dcd") assert os.path.isfile(f"{output_directory}/distances_rmsd_hist.pdf") def test_clustering_dbscan_pdb_output_clusters(tmpdir): """Test DBSCAN clustering""" output_directory = tmpdir.mkdir("output") # Load in cgmodel cgmodel_path = os.path.join(data_path, "stored_cgmodel.pkl") cgmodel = pickle.load(open(cgmodel_path, "rb")) # Create list of trajectory files for clustering analysis number_replicas = 12 pdb_file_list = [] for i in range(number_replicas): pdb_file_list.append(f"{data_path}/replica_%s.pdb" %(i+1)) # Set clustering parameters min_samples=3 eps=0.5 frame_start=10 frame_stride=1 frame_end=-1 # Run DBSCAN density-based clustering medoid_positions, cluster_sizes, cluster_rmsd, n_noise, silhouette_avg, labels, original_indices = \ get_cluster_medoid_positions_DBSCAN( pdb_file_list, cgmodel, min_samples=min_samples, eps=eps, frame_start=frame_start, frame_stride=frame_stride, frame_end=-1, output_dir=output_directory, output_cluster_traj=True, plot_silhouette=True, plot_rmsd_hist=True, filter=True, filter_ratio=0.20, ) assert len(labels) == len(original_indices) assert os.path.isfile(f"{output_directory}/medoid_0.pdb") assert os.path.isfile(f"{output_directory}/cluster_0.pdb")
StarcoderdataPython
19425
import pytest from responses import RequestsMock from tests import loader def test_parameter_cannot_be_parsed(responses: RequestsMock, tmpdir): responses.add( responses.GET, url="http://test/", json={ "swagger": "2.0", "paths": { "/test": { "get": { "parameters": [ { "in": "query", "name": "param", "schema": {}, } ], "responses": { "200": { "description": "return value", "schema": {"type": "string"}, } }, } } }, }, match_querystring=True, ) with pytest.raises(Exception) as exception_info: loader.load( tmpdir, { "invalid": { "open_api": {"definition": "http://test/"}, "formulas": {"dynamic_array": {"lock_excel": True}}, } }, ) assert ( str(exception_info.value) == "Unable to extract parameters from {'in': 'query', 'name': 'param', 'schema': {}, 'server_param_name': 'param'}" ) def test_parameter_with_more_than_one_field_type(responses: RequestsMock, tmpdir): responses.add( responses.GET, url="http://test/", json={ "swagger": "2.0", "paths": { "/test": { "get": { "parameters": [ { "in": "query", "name": "param", "type": ["string", "integer"], } ], "responses": { "200": { "description": "return value", } }, } } }, }, match_querystring=True, ) with pytest.raises(Exception) as exception_info: loader.load( tmpdir, { "invalid": { "open_api": {"definition": "http://test/"}, "formulas": {"dynamic_array": {"lock_excel": True}}, } }, ) assert ( str(exception_info.value) == "Unable to guess field type amongst ['string', 'integer']" )
StarcoderdataPython
4894571
<reponame>RandolphCYG/husky_pywork<gh_stars>0 import os import re import numpy as np import pandas as pd FILE_ROOT_PATH = os.path.dirname(os.path.abspath(__file__)) source = os.path.join(FILE_ROOT_PATH, '9889.xlsx') output = os.path.join(FILE_ROOT_PATH, 'result_9889.xlsx') def merge_sheets(path: str) -> pd.DataFrame: '''将每个表格的sheet页中日期、期货成交汇总、期货持仓汇总聚集到一起 ''' df = pd.read_excel(path, sheet_name=None) print(len(list(df.keys()))) all_indexs = dict() all_sheet_df_res = pd.DataFrame() for sheet_index, sheet in enumerate(list(df.keys())): if sheet_index < len(list(df.keys())) + 1: # 测试时候控制前几个 print(sheet_index) df_sheet = pd.read_excel(path, sheet_name=sheet) row, col = df_sheet.shape child_indexs = [] child_table1_flag = 0 child_table2_flag = 0 for r in range(row): each_row_list = list(df_sheet.loc[r]) if "交易日期" in each_row_list: key_date = str(each_row_list[7]) date_row = r # print(key_date) elif "期货持仓汇总" in each_row_list: # print(each_row_list) # print("从此行开始截取数据", r) first_start = r child_indexs.append(first_start) child_table1_flag = 1 elif "合计" in each_row_list and child_table1_flag == 1: # print(each_row_list) # print("第一段结束", r) first_end = r child_indexs.append(first_end) # 跳出前总结数据 if key_date: all_indexs[key_date] = child_indexs elif "期权持仓汇总" in each_row_list: # print(each_row_list) # print("从此行开始截取数据", r) second_start = r child_indexs.append(second_start) child_table2_flag = 1 elif "合计" in each_row_list and child_table2_flag == 1: # print(each_row_list) # print("第二段结束", r) second_end = r if second_end not in child_indexs: child_indexs.append(second_end) # 跳出前总结数据 if key_date: all_indexs[key_date] = child_indexs each_sheet_res = [] # 每个sheet页的结果 # print(child_indexs) if len(child_indexs) == 2: df_sheet.loc[date_row][0] = df_sheet.loc[date_row][7] df_sheet.loc[date_row][1:] = np.nan each_sheet_res.append(df_sheet.loc[date_row]) # 日期行 # print(df_sheet.loc[date_row][0]) for i in range(child_indexs[0], child_indexs[1] + 1): # print(i) # print(df_sheet.loc[i]) each_sheet_res.append(df_sheet.loc[i]) elif len(child_indexs) == 4: df_sheet.loc[date_row][0] = df_sheet.loc[date_row][7] df_sheet.loc[date_row][1:] = np.nan each_sheet_res.append(df_sheet.loc[date_row]) # 日期行 # print(df_sheet.loc[date_row]) for i in range(child_indexs[0], child_indexs[1] + 1): # print(i) # print(df_sheet.loc[i]) each_sheet_res.append(df_sheet.loc[i]) for j in range(child_indexs[2], child_indexs[3] + 1): # print(j) # print(df_sheet.loc[j]) each_sheet_res.append(df_sheet.loc[j]) # print(each_sheet_res) each_sheet_res_df = pd.DataFrame(each_sheet_res).reset_index(drop=True) all_sheet_df_res = pd.concat([all_sheet_df_res, each_sheet_res_df], axis=0) # break return all_sheet_df_res if __name__ == "__main__": res = merge_sheets(source) res.to_excel(output, header=None, index=False)
StarcoderdataPython
5149442
import json from django import template register = template.Library() def json_encode_base(data, indent=None, ensure_ascii=True): try: return json.dumps(data, indent=indent, ensure_ascii=ensure_ascii) except: return '' @register.simple_tag(name='json_encode') def json_encode(data, indent=None, ensure_ascii=True): return json_encode_base(data, indent, ensure_ascii) @register.simple_tag(name='to_json') def to_json(data, indent=None, ensure_ascii=True): return json_encode_base(data, indent, ensure_ascii)
StarcoderdataPython
11383058
<reponame>cumulus27/bilibili_video #!/usr/bin/env python # -*- coding: utf-8 -*- """ Insert the av number to database from file. """ import time from selflib.MySQLCommand import MySQLCommand import config.parameter as param def insert_start(): file_path = param.list_file_path db1 = MySQLCommand(param.mysql_host, param.mysql_user, param.mysql_pass, param.mysql_database, param.mysql_charset, param.mysql_table1) db2 = MySQLCommand(param.mysql_host, param.mysql_user, param.mysql_pass, param.mysql_database, param.mysql_charset, param.mysql_table2) db1.create_table(param.mysql_table1, param.item_table1) db2.create_table(param.mysql_table2, param.item_table2) try: with open(file_path, "r") as f: line = f.readline() while line: time_now = time.strftime("%Y-%m-%d %H:%M", time.localtime(time.time())) db1.insert_item("aid, insert_time, download", "'{}', '{}', 0".format(line.strip(), time_now)) # db2.insert_item("aid, insert_time, download", "'{}', '{}', 0".format(line.strip(), time_now)) line = f.readline() except FileNotFoundError as e: print("File not find: {}".format(file_path)) print(e) except Exception as e: raise UserWarning if __name__ == "__main__": insert_start()
StarcoderdataPython
3499053
# -*- coding: utf-8 -*- class Yangming(object): def __init__(self): pass class ShouYangming(object): def __init__(self): pass class ZuYangming(object): def __init__(self): pass
StarcoderdataPython
360392
<reponame>Swall0w/clib import argparse import os def arg(): parser = argparse.ArgumentParser(description='Labeled Dataset Generator.') parser.add_argument('--input', '-i', type=str, help='input dataset that contains labeled dataset.') parser.add_argument('--labeled', '-l', default=True, help='Whether the dataset directories are named.') parser.add_argument('--names', '-n', type=str, default='', help='labeled list of names.') parser.add_argument('--output', '-o', type=str, default='output.txt', help='labeled output txt.') return parser.parse_args() def main(): args = arg() dir_list = os.listdir(args.input) print(dir_list) if args.names: with open(args.names, 'w') as f: for name in dir_list: f.write(str(name) + '\n') result_list = [] for n_class, dir_name in enumerate(dir_list): target_dir = os.path.abspath(args.input) + '/' + dir_name img_list = os.listdir(target_dir) for img in img_list: abs_path_to_img = target_dir + '/' + img result_list.append((abs_path_to_img, str(n_class))) with open(args.output, 'w') as fo: for abspath, n_class in result_list: fo.write('{} {}\n'.format(abspath, n_class)) if __name__ == '__main__': main()
StarcoderdataPython
309132
from .experiment import GEM
StarcoderdataPython
1783270
<filename>colored_shapes.py # Author: <NAME> # Date: 11/4/2020 # Same GUI as shape_gui.py to select 1 of 3 colored stars to search for in colored_stars.png image # # Findings: This program uses openCV template matching with TM_SQDIFF_NORMED instead of TM_CCOEFF # as the template matching method. SQDIFF uses minLoc instead of maxLoc for best results and detected the # different colored stars from tkinter import * from PIL import Image from PIL import ImageTk import cv2 import numpy as np def find_object(target_pic, puzzle_pic): global show_target, show_image target = cv2.imread(target_pic) puzzle = cv2.imread(puzzle_pic) (height, width) = target.shape[:2] result = cv2.matchTemplate(puzzle, target, cv2.TM_SQDIFF_NORMED) (_, _, minLoc, maxLoc) = cv2.minMaxLoc(result) top_left = minLoc bottom_right = (top_left[0] + width, top_left[1] + height) puzzle = cv2.rectangle(puzzle, top_left, bottom_right, (0, 255, 0), 3) target = cv2.cvtColor(target, cv2.COLOR_BGR2RGB) puzzle = cv2.cvtColor(puzzle, cv2.COLOR_BGR2RGB) # Resize both target and puzzle images to fit on screen target = resize_with_aspect_ratio(target, width=200) puzzle = resize_with_aspect_ratio(puzzle, width=600) # convert the images to PIL format... target = Image.fromarray(target) puzzle = Image.fromarray(puzzle) # ...and then to ImageTk format target = ImageTk.PhotoImage(target) puzzle = ImageTk.PhotoImage(puzzle) # if the panels are None, initialize them if show_target is None or show_image is None: # the first panel will store our target image show_target = Label(image=target) show_target.image = target show_target.pack(side="left", padx=10, pady=10) # while the second panel will store the image to search show_image = Label(image=puzzle) show_image.image = puzzle show_image.pack(side="right", padx=10, pady=10) # otherwise, update the image panels else: # update the panels show_target.configure(image=target) show_image.configure(image=puzzle) show_target.image = target show_image.image = puzzle def resize_with_aspect_ratio(image, width=None, height=None, inter=cv2.INTER_AREA): dim = None (h, w) = image.shape[:2] if width is None and height is None: return image if width is None: r = height / float(h) dim = (int(w * r), height) else: r = width / float(w) dim = (width, int(h * r)) return cv2.resize(image, dim, interpolation=inter) # Create tkinter GUI window = Tk() window.geometry('1000x700+10+10') window.title('Image Detection') show_target = None show_image = None target_dict = {'Red': 'Shape Templates/red_star.png', 'Green': 'Shape Templates/green_star.png', 'Blue': 'Shape Templates/blue_star.png'} target_label = Label(window, text='Select color to search for:') target_label.place(x=5, y=40) target_list_box = Listbox(window, height=4, selectmode='single', exportselection=0) for t in target_dict: target_list_box.insert(END, t) target_list_box.place(x=5, y=60) find_button = Button(window, text='Find', command=lambda: find_object(target_dict[target_list_box.get(ANCHOR)], 'Images to Search/colored_stars.png')) find_button.place(x=200, y=40) # target_list_box.selection_clear(0, 'end') window.mainloop()
StarcoderdataPython
6654256
import datetime import logging import os.path import random import sys from os import path from typing import List import pandas as pd from tqdm import tqdm from query_formulation.search import ElasticSearch, SibilsElastic random.seed(0) # Gets or creates a logger def get_logger(filename: str, name: str): logger = logging.getLogger(name) # set log level logger.setLevel(logging.INFO) # define file handler and set formatter file_handler = logging.FileHandler(filename) formatter = logging.Formatter("%(asctime)s : %(levelname)s : %(message)s") file_handler.setFormatter(formatter) # add file handler to logger logger.addHandler(file_handler) return logger logger = get_logger("queries.log", __name__) logger.info("logging initiated") current_path = path.abspath(path.dirname(__file__)) data_dir = path.join(current_path, 'data') if len(sys.argv) > 1 and sys.argv[1].lower() == 'sigir': dataset_type = 'SIGIR_' else: dataset_type = '' searcher = ElasticSearch(None) relevance_df: pd.DataFrame = pd.read_csv(f'{data_dir}/{dataset_type}results.csv') topics_df: pd.DataFrame = pd.read_csv(f"{data_dir}/{dataset_type}topics.csv") def evaluate_result(topic_id: str, query_result: List[str], recall_at_count=1000): int_query_result = [] for idx, r in enumerate(query_result): try: int_query_result.append(int(r) )# pubmed ids are returned as string, convert them to integer) except: continue relevant_pids = relevance_df[relevance_df["topic_id"] == topic_id]['pubmed_id'].tolist() assert len(relevant_pids) total_relevant = len(relevant_pids) total_found = len(int_query_result) recall = precision = f_score = recall_at = 0 if not total_found: return recall, precision, f_score, recall_at true_positives = set(relevant_pids).intersection(int_query_result) tp = len(true_positives) recall = round(tp / total_relevant, 4) if len(int_query_result) > recall_at_count: true_positives_at = set(relevant_pids).intersection( int_query_result[:recall_at_count] ) recall_at = round(len(true_positives_at) / total_relevant, 4) else: recall_at = recall precision = round(tp / total_found, 5) if not precision and not recall: f_score = 0 else: f_score = 2 * precision * recall / (precision + recall) return recall, precision, recall_at, f_score def search_and_eval(row): query = row["query"] topic_id = row["topic_id"] end_date, start_date = None, None if 'start_date' in row and row['start_date']: try: start_date = datetime.datetime.strptime(row['start_date'], '%Y-%m-%d') except Exception: start_date = None if 'end_date' in row and row['end_date']: try: end_date = datetime.datetime.strptime(row['end_date'], '%Y-%m-%d') except Exception: end_date = None try: results = searcher.search_pubmed(query, start_date=start_date, end_date=end_date) except Exception as e: logger.warning( f"ERROR: topic_id {topic_id} with query {query} error {e}" ) return pd.DataFrame() row["recall"], row["precision"], row["recall_at"], row["f_score"] = evaluate_result( topic_id, results, recall_at_count=1000 ) row["results_count"] = len(results) if row['recall']: logger.info(f"topic_id {topic_id} with query {query} done, recall was {row['recall']}") else: logger.info(f'topic_id {topic_id}, nah buddy') return row def get_already_searched_data(path: str): if os.path.isfile(path): temp_df = pd.read_csv(path) return temp_df return pd.DataFrame() if __name__ == "__main__": result_file = f'{data_dir}/{dataset_type}query_result.csv' queries = pd.read_csv(f"{data_dir}/{dataset_type}prepared_queries.csv") already_done_df = get_already_searched_data(result_file) if not already_done_df.empty: old_indexes = already_done_df['old_index'].unique().tolist() queries = queries[~queries.index.isin(old_indexes)] save_batch_size = 10 save_counter = 0 new_df = pd.DataFrame() pbar = tqdm(total=len(queries)) for index, row in queries.reset_index().rename(columns={'index': 'old_index'}).iterrows(): new_row = search_and_eval(row) if new_row.empty: continue new_df = new_df.append(new_row.drop('Unnamed: 0')) save_counter += 1 pbar.update(1) if save_counter == save_batch_size: new_df.to_csv(result_file, index=False) logger.info('saved.') save_counter = 0 new_df.to_csv(result_file) print("DONE")
StarcoderdataPython
1968618
# Generated by Django 3.0.1 on 2021-03-10 07:03 from django.db import migrations import tinymce.models class Migration(migrations.Migration): dependencies = [ ('jobs', '0026_remove_job_apply'), ] operations = [ migrations.AddField( model_name='job', name='apply', field=tinymce.models.HTMLField(blank=True, null=True), ), ]
StarcoderdataPython
68661
<gh_stars>10-100 # Goal: create a cPickle'd python dictionary # containing the strand of each ensembl gene #m mouse import csv import cPickle if __name__ == "__main__": mapping = {} with open('../gtex/gtex_mouse/refGene_mouse.txt', 'r') as csvfile: reader = csv.reader(csvfile, delimiter='\t') for row in reader: gene_name = row[1] print gene_name strand = row[3] mapping[gene_name] = strand cPickle.dump(mapping, open("strand_info_GRCm38.p", "wb"))
StarcoderdataPython
3522448
<filename>satella/coding/expect_exception.py from satella.coding.typing import ExceptionList import typing as tp class expect_exception: """ A context manager to use as following: >>> a = {'test': 2} >>> with expect_exception(KeyError, ValueError, 'KeyError not raised'): >>> a['test2'] If other exception than the expected is raised, it is passed through :param exc_to_except: a list of exceptions or a single exception to expect :param else_raise: raise a particular exception if no exception is raised. This should be a callable that accepts provided args and kwargs and returns an exception instance. :param args: args to provide to constructor :param kwargs: kwargs to provide to constructor """ __slots__ = 'exc_to_except', 'else_raise', 'else_raise_args', 'else_raise_kwargs' def __init__(self, exc_to_except: ExceptionList, else_raise: tp.Type[Exception], *args, **kwargs): self.exc_to_except = exc_to_except self.else_raise = else_raise self.else_raise_args = args self.else_raise_kwargs = kwargs def __enter__(self): return self def __exit__(self, exc_type, exc_val, exc_tb): if exc_type is None: raise self.else_raise(*self.else_raise_args, **self.else_raise_kwargs) elif not isinstance(exc_val, self.exc_to_except): return False return True
StarcoderdataPython
3467644
<reponame>JamesDougharty/aiorethink<gh_stars>1-10 import pytest import aiorethink """If these tests are run at all, they must run before any other. """ @pytest.mark.asyncio async def test_conn_fails_if_no_params_set(): with pytest.raises(aiorethink.IllegalAccessError): cn = await aiorethink.db_conn
StarcoderdataPython
343686
<reponame>Xam-Mlr/StegnHide<gh_stars>0 from PIL import Image import numpy as np import sys js_path = sys.argv[1] option = sys.argv[2] message = sys.argv[3] def encrypt_text(message): #message = "je m'appelle test" message = "|-|-|"+message+"|-|-|" BinMessage = [] for i in message: #transforme chaque lettre en octet BinMessage.append(format(ord(i), "08b")) #formatage BinMessage = ''.join(BinMessage)#transforme la liste des octets, en (une suite sans espaces) return BinMessage def encrypt_into_image(message): BinMessage = encrypt_text(message) if len(BinMessage) <= ImgArray.size: messageIndex = 0 #compteur messageSize = len(BinMessage) for dim in range(3): #parcours tableau for columns in range(width): #parcours tableau for lines in range(height): #parcours tableau value = ImgArray[lines, columns, dim] #récupère valeur du pixel value = format(int(value), "08b") #transforme en binaire value = (int(value[:-1] + BinMessage[messageIndex], 2)) #enlève dernier bit et remplace par celui de BinMessage #print(value) ImgArray[lines, columns, dim] = value if messageIndex == messageSize - 1: #quand tout texte caché dans image: print(ImgArray[0:16, 0, 0]) print("finished") pil_image=Image.fromarray(ImgArray) #transformer tableau en image new_path = js_path.split(".") new_path[0] += "_steg." new_path = "".join(new_path) pil_image.save(new_path) #save return "ok" #pour stopper boucle else: messageIndex += 1 #sinon ajoute un au compteur et recommence else: print("The text couldn't be hidden into the image because the image is too small to contain this text\n Please extend the image") def decrypt(): text = [] #print(ImgArray[0:16, 0, 0]) for dim in range(3): #parcours de la même façon qu'à l'encodage for columns in range(width): for lines in range(height): value = ImgArray[lines, columns, dim] #récupère valeur en chiffre value = format(int(value), "08b") #la met en bit last_bit = value[-1] #récupère dernier bit de l'octet text.append(last_bit) #les met à la suite dans text text = "".join(text) Count = 0 Message = [] BinSize = len(text) Times = BinSize / 8 - 1 for octet in range(int(Times)): octet = text[Count:Count+8] ascii = int(octet, 2) character = chr(ascii) #récupère caractère qui correspond au nombre Message.append(character) Count += 8 Message = "".join(Message) Message = Message.split("|-|-|")[1] print(Message) #path = input("What's the path of your image ?") img = Image.open(js_path) width, height = img.size ImgArray = np.zeros((height, width, 3), dtype=np.uint8) #initialise tableau de la taille de l'image for columns in range(width): #rempli tableau avec pixel image (1e plan pour r, 2e pour v, 3e pour b) for lines in range(height): r,v,b = img.getpixel((columns,lines)) #(x, y) ImgArray[lines, columns, 0] = r ImgArray[lines, columns, 1] = v ImgArray[lines, columns, 2] = b if int(option) == 0: encrypt_into_image(message) elif int(option) == 1: decrypt() """ i = 0 octet = [] finally_text = [] for num in range(len(text)): #pour trancher tout les 8 bits et faire des octets if i != 8: bit = text[num] octet.append(bit) i += 1 else: octet = "".join(octet) #print(octet) ascii = int(octet, 2) #met octet en int character = chr(ascii) #récupère caractère qui correspond au nombre finally_text.append(character) #ajoute à liste de caractère i = 0 # on remet le compteur de bit à 0 octet = [] #on retransforme octet en liste #transforme liste en str finally_text = "".join(finally_text) #print(finally_text) """
StarcoderdataPython
340079
<reponame>jepler/Adafruit_CircuitPython_Requests from unittest import mock import mocket import json import adafruit_requests ip = "1.2.3.4" host = "httpbin.org" response = {"Date": "July 25, 2019"} encoded = json.dumps(response).encode("utf-8") # Padding here tests the case where a header line is exactly 32 bytes buffered by # aligning the Content-Type header after it. headers = "HTTP/1.0 200 OK\r\npadding: 000\r\nContent-Type: application/json\r\nContent-Length: {}\r\n\r\n".format( len(encoded) ).encode( "utf-8" ) def test_json(): pool = mocket.MocketPool() pool.getaddrinfo.return_value = ((None, None, None, None, (ip, 80)),) sock = mocket.Mocket(headers + encoded) pool.socket.return_value = sock s = adafruit_requests.Session(pool) r = s.get("http://" + host + "/get") sock.connect.assert_called_once_with((ip, 80)) assert r.json() == response
StarcoderdataPython
379382
# - Stack() creates a new, empty stack # - push(item) adds the given item to the top of the stack and returns nothing # - pop() removes and returns the top item from the stack # - peek() returns the top item from the stack but doesn’t remove it(the stack isn’t modified) # - is_empty() returns a boolean representing whether the stack is empty # - size() returns the number of items on the stack as an integer # Stack Method One - top is the last item in stack - append/pop - O(1) class Stack: def __init__(self, items=[]): self._items = items def is_empty(self): return not bool(self._items) def push(self, item): self._items.append(item) def pop(self): return self._items.pop() def peek(self): return self._items[-1] @property def size(self): return len(self._items) books = Stack(["testing"]) print(books.peek()) # Stack Method Two - top is the first item in stack - insert/pop - O(n) class Stack_2: def __init__(self, items=[]): self._items = items def is_empty(self): return not bool(self._items) def push(self, item): self._items.insert(0, item) # O(n) def pop(self): return self._items.pop(0) # O(n) def peek(self): return self._items[0] @property def size(self): return len(self._items) books2 = Stack_2(["testing"]) print(books2.size)
StarcoderdataPython
3273017
<reponame>crusaderky/validators import decimal import math import re from typing import Any, Union from .fuzzyfield import FuzzyField from .errors import DomainError, FieldTypeError, MalformedFieldError from .tools import NA_VALUES try: import numpy CAN_CAST_TO_INT = str, numpy.integer except ImportError: CAN_CAST_TO_INT = str class Float(FuzzyField): """Convert a string representing a number, an int, or other numeric types (e.g. `numpy.float64`) to float. :param default: Default value. Unlike in all other FuzzyFields, if omitted it is NaN instead of None. :param min_value: Minimum allowable value. Omit for no minimum. :param max_value: Maximum allowable value. Omit for no maximum. :param bool allow_min: If True, test that value >= min_value, otherwise value > min_value :param bool allow_max: If True, test that value <= max_value, otherwise value < max_value :param bool allow_zero: If False, test that value != 0 :param dict kwargs: parameters to be passed to :class:`FuzzyField` """ min_value: Union[int, float] max_value: Union[int, float] allow_min: bool allow_max: bool allow_zero: bool def __init__(self, *, min_value: Union[int, float] = -math.inf, max_value: Union[int, float] = math.inf, allow_min: bool = True, allow_max: bool = True, allow_zero: bool = True, default: Any = math.nan, **kwargs): super().__init__(default=default, **kwargs) assert min_value <= max_value self.min_value = min_value self.max_value = max_value self.allow_min = allow_min self.allow_max = allow_max self.allow_zero = allow_zero def validate(self, value: Any) -> Union[float, int, decimal.Decimal, None]: """Convert a number or a string representation of a number to a validated number. :param value: string representing a number, possibly with thousands separator or in accounting negative format, e.g. (5,000.200) ==> -5000.2, or any number-like object :rtype: as returned by :meth:`Numeric.num_converter` :raises DomainError: Number out of allowed range :raises MalformedFieldError, FieldTypeError: Not a number """ if isinstance(value, str): # Preprocess strings before passing them to self._num_converter # Remove thousands separator value = value.replace(',', '') # Convert accounting-style negative numbers, e.g. '(1000)' if value.startswith('(') and value.endswith(')'): value = '-' + value[1:-1] # Convert negative numbers formatted by Excel in some cases # '- 1000 -' elif value.startswith('- ') and value.endswith(' -'): value = '-' + value[2:-2] value = self._num_converter(value) if value is None: return None # Decimal has problems comparing to float/int valuef = float(value) if ((not self.allow_zero and valuef == 0) or (self.allow_min and valuef < self.min_value) or (not self.allow_min and valuef <= self.min_value) or (self.allow_max and valuef > self.max_value) or (not self.allow_max and valuef >= self.max_value)): raise DomainError(self.name, value, choices=self.domain_str) return value @property def domain_str(self) -> str: """String representation of the allowed domain, e.g. "]-1, 1] non-zero" """ lbracket = '[' if self.allow_min else ']' rbracket = ']' if self.allow_max else '[' msg = f'{lbracket}{self.min_value}, {self.max_value}{rbracket}' if not self.allow_zero: msg += ' non-zero' return msg def _num_converter(self, value: Any) -> float: """Convert string, int, or other to float """ try: return float(value) except TypeError: raise FieldTypeError(self.name, value, "number") except ValueError: raise MalformedFieldError(self.name, value, "number") @property def sphinxdoc(self) -> str: return f"Any number in the domain {self.domain_str}" class Decimal(Float): """Convert a number or a string representation of a number to :class:`~decimal.Decimal`, which is much much slower and heavier than float but avoids converting 3.1 to 3.0999999. """ def __init__(self, *, default: Any = decimal.Decimal('nan'), **kwargs): super().__init__(default=default, **kwargs) def _num_converter(self, value: Any) -> decimal.Decimal: """Convert string, float, or int to decimal.Decimal """ # Performance shortcut if isinstance(value, decimal.Decimal): return value orig_value = value # Remove leading zeros after comma, as they confuse Decimal # e.g. Decimal('0.0000000000') -> Decimal("0E-10") # Do not accidentally drop leading zeros in the exponent. if isinstance(value, str): value = value.upper() if 'E' in value: # Scientific notation mantissa, _, exponent = value.partition('E') if '.' in mantissa: mantissa = re.sub(r'0*$', '', mantissa) value = f'{mantissa}E{exponent}' elif '.' in value: # Not scientific notation value = re.sub(r'0*$', '', value) try: return decimal.Decimal(value) except (TypeError, ValueError): raise FieldTypeError(self.name, orig_value, "number") except decimal.InvalidOperation: raise MalformedFieldError(self.name, orig_value, "number") class Integer(Float): """Whole number. Valid values are: - anything that is parsed by the `int` constructor. - floats with strictly trailing zeros (e.g. 1.0000) - scientific format as long as there are no digits below 10^0 (1.23e2) .. note:: inf and -inf are valid inputs, but in these cases the output will be of type float. To disable them you can use - ``min_value=-math.inf, allow_min=False`` - ``max_value=math.inf, allow_max=False`` NaN is treated as an empty cell, so it is accepted if required=False; in that case the validation will return whatever is set for default, which is math.nan unless overridden, which makes it a third case where the output value won't be int but float. :raises MalformedFieldError: if the number can't be cast to int without losing precision """ def _num_converter(self, value: Any) -> Union[int, float]: """Convert value to int """ # Quick exit if isinstance(value, int): return value # Attempt quick conversion. This won't work in case of the more # sophisticated cases we want to cover, e.g. '1.0e1'. # DO NOT blindly convert to int if value is a float, as int(3.5) = 3! # Not passing by float also prevents precision loss issues, e.g. # int('9999999999999999') != float('9999999999999999') if isinstance(value, CAN_CAST_TO_INT): try: return int(value) except ValueError: pass # float, np.float32/64, or string representation of a float try: valued = decimal.Decimal(value) except (TypeError, ValueError): raise FieldTypeError(self.name, value, "integer") except decimal.InvalidOperation: raise MalformedFieldError(self.name, value, "integer") # This should be already catered for by :meth:`FuzzyField.preprocess` assert not math.isnan(valued) if math.isinf(valued): return float(valued) valuei = int(valued) if valuei != valued: # Mantissa after the dot is not zero raise MalformedFieldError(self.name, value, "integer") return valuei @property def sphinxdoc(self) -> str: return f"Any whole number in the domain {self.domain_str}" class Percentage(Float): """Percentage, e.g. 5% or .05 .. warning:: There's nothing stopping somebody from writing "35" where it should have been either "35%" or "0.35". If this field receives "35", it will return 3500.0. You should use the min_value and max_value parameters of :class:`Float` to prevent this kind of incidents. Still, nothing will ever protect you from a "1", which will be converted to 1.00 but the author of the input may have wanted to say 0.01. """ def _num_converter(self, value: Any) -> Union[float, None]: """Convert string, int, or other to float """ try: if isinstance(value, str) and value[-1] == '%': value = value[:-1].strip() if value in NA_VALUES: return None return float(value) / 100 return float(value) except TypeError: raise FieldTypeError(self.name, value, "percentage") except ValueError: raise MalformedFieldError(self.name, value, "percentage") @property def sphinxdoc(self) -> str: return f"Percentage, e.g. 5% or 0.05, in the domain {self.domain_str}"
StarcoderdataPython
56968
import asyncio import json import logging from typing import List, Set import websockets class BrowserWebsocketServer: """ The BrowserWebsocketServer manages our connection to our browser extension, brokering messages between Google Meet and our plugin's EventHandler. We expect browser tabs (and our websockets) to come and go, and our plugin is long-lived, so we have a lot of exception handling to do here to keep the plugin running. Most actions are "best effort". We also have to handle the possibility of multiple browser websockets at the same time, e.g. in case the user refreshes their Meet window and we have stale websockets hanging around, or if we have multiple Meet tabs. """ def __init__(self): """ Remember to call start() before attempting to use your new instance! """ self._logger = logging.getLogger(__name__) """ Store all of the connected sockets we have open to the browser extension, so we can use them to send outbound messages from this plugin to the extension. """ self._ws_clients: Set[websockets.WebSocketServerProtocol] = set() """ Any EventHandlers registered to receive inbound events from the browser extension. """ self._handlers: List["EventHandler"] = [] def start(self, hostname: str, port: int) -> None: return websockets.serve(self._message_receive_loop, hostname, port) async def send_to_clients(self, message: str) -> None: """ Send a message from our plugin to the Chrome extension. We broadcast to any connections we have, in case the user has multiple Meet windows/tabs open. """ if self._ws_clients: self._logger.info( f"Broadcasting message to connected browser clients: {message}") await asyncio.wait([client.send(message) for client in self._ws_clients]) else: self._logger.warn( ("There were no active browser extension clients to send our" f" message to! Message: {message}")) def register_event_handler(self, handler: "EventHandler") -> None: """ Register your EventHandler to have it receive callbacks whenever we get an event over the wire from the browser extension. """ self._handlers.append(handler) def num_connected_clients(self) -> int: return len(self._ws_clients) def _register_client(self, ws: websockets.WebSocketServerProtocol) -> None: self._ws_clients.add(ws) self._logger.info( (f"{ws.remote_address} has connected to our browser websocket." f" We now have {len(self._ws_clients)} active connection(s).")) async def _unregister_client(self, ws: websockets.WebSocketServerProtocol) -> None: try: await ws.close() except: self._logger.exception( "Exception while closing browser webocket connection.") if ws in self._ws_clients: self._ws_clients.remove(ws) self._logger.info( (f"{ws.remote_address} has disconnected from our browser websocket." f" We now have {len(self._ws_clients)} active connection(s) remaining.")) async def _message_receive_loop(self, ws: websockets.WebSocketServerProtocol, uri: str) -> None: """ Loop of waiting for and processing inbound websocket messages, until the connection dies. Each connection will create one of these coroutines. """ self._register_client(ws) try: async for message in ws: self._logger.info( f"Received inbound message from browser extension. Message: {message}") await self._process_inbound_message(message) except: self._logger.exception( "BrowserWebsocketServer encountered an exception while waiting for inbound messages.") finally: await self._unregister_client(ws) if not self._ws_clients: for handler in self._handlers: try: await handler.on_all_browsers_disconnected() except: self._logger.exception( "Connection mananger received an exception from EventHandler!") async def _process_inbound_message(self, message: str) -> None: """ Process one individual inbound websocket message. """ try: parsed_event = json.loads(message) except: self._logger.exception( f"Failed to parse browser websocket message as JSON. Message: {message}") return for handler in self._handlers: try: await handler.on_browser_event(parsed_event) except: self._logger.exception( "Connection mananger received an exception from EventHandler!")
StarcoderdataPython
11385303
<gh_stars>0 #Copyright 2021 <NAME>, <NAME> Institute for Biomedical Research # #Licensed under the Apache License, Version 2.0 (the "License"); #you may not use this file except in compliance with the License. #You may obtain a copy of the License at # #http://www.apache.org/licenses/LICENSE-2.0 # #Unless required by applicable law or agreed to in writing, software #distributed under the License is distributed on an "AS IS" BASIS, #WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. #See the License for the specific language governing permissions and #limitations under the License. import re from pyparsing import ParseException, Word, printables, infixNotation, Group, alphas, nums, White, opAssoc class ResidueSelection: '''Compatible syntax: Residue name: resn Residue Index: resi Chain ID: chain -: from . to . and: and or: or ''' def __init__(self, selection_string): self.selection_string = selection_string print("Selection string") print(self.selection_string) self.ops = ['and', 'or'] self.selector_lst = [] self.converted_lst = [] self.remove_quotes() self.add_parantheses() self.selection_lst = self.parse_nested_expr() self.replace_name(self.selection_lst) self.replace_op(self.selection_lst) self.index_dict = {} def remove_quotes(self): if re.search('"', self.selection_string): print("removing quotes") self.selection_string = self.selection_string.replace('"', '') def add_parantheses(self): if not self.selection_string.startswith("("): self.selection_string = "({}".format(self.selection_string) if not self.selection_string.endswith(")"): self.selection_string = "{})".format(self.selection_string) def parse_nested_expr(self): varname = Word(alphas) integer = Word(nums + "-")#.setParseAction(lambda t: int(t[0])) comparisonOp = White(" ") term = varname | integer comparisonExpr = Group(term + comparisonOp + term) logicalExpr = infixNotation(comparisonExpr, [ ('and', 2, opAssoc.LEFT), ('or', 2, opAssoc.LEFT), ]) try: result = logicalExpr.parseString(self.selection_string).asList() except ParseException: print("exception parsing selection string") comparisonExpr = Group(term + comparisonOp + term + comparisonOp + term) logicalExpr = infixNotation(comparisonExpr, [ ('and', 2, opAssoc.LEFT), ('or', 2, opAssoc.LEFT), ]) result = logicalExpr.parseString(self.selection_string).asList() print("nested_expr") print(result) print(self.selection_string) return result def parse_hierachy(self, lst, indices=[], prev_i=-1): for i, item in enumerate(lst): if i == 0: indices.append(i) print("Item: {}, Index: {}".format(item, i)) if isinstance(item, list): indices[-1] = i print("new indices list: {}".format(indices)) hierachy(item, indices) else: indices[-1] = i if item in self.ops: print("True") new_indices = [x for x in indices] print("new indices ops: {}".format(new_indices)) l_i = [x for x in indices] l_i[-1] = i - 1 l_i = ''.join([str(x) for x in l_i]) r_i = [x for x in indices] r_i[-1] = i + 1 r_i = ''.join([str(x) for x in r_i]) self.index_dict[''.join([str(x) for x in indices])] = [l_i, r_i] else: print("indices list: {}".format(indices)) if i + 1 == len(lst): indices.pop() prev_i = i def replace_name(self, lst, indices=[], prev_i=-1): for i, item in enumerate(lst): if i == 0: indices.append(i) print("Item: {}, Index: {}".format(item, i)) if isinstance(item, list): indices[-1] = i print("new indices list: {}".format(indices)) self.replace_name(item, indices) else: if not item in self.ops and not item is None: if i == 0: print(lst) merged = ''.join([str(x) for x in lst]) print("merged") print(merged) selector_index = ''.join([str(x) for x in indices]) selector = self.name_parser(merged, selector_index) lst[:] = [selector] self.selector_lst.append(selector) else: print("delete {}".format(i)) #del lst[i] if i + 1 == len(lst): indices.pop() prev_i = i def replace_op(self, lst, indices=[]): for i, item in enumerate(lst): if i == 0: indices.append(i) print("Item: {}, Index: {}".format(item, i)) if isinstance(item, list): indices[-1] = i print("new indices list: {}".format(indices)) self.replace_op(item, indices) else: selector_index = ''.join([str(x) for x in indices]) + '0' indices[-1] = i if not item is None: if item.lower() in self.ops: l_i = [x for x in indices] l_i[-1] = i - 1 l_i = ''.join([str(x) for x in l_i]) + '0' r_i = [x for x in indices] r_i[-1] = i + 1 r_i = ''.join([str(x) for x in r_i]) + '0' if item.lower() == 'and': self.converted_lst.append( ("And", selector_index[:-1], "{},{}".format(l_i, r_i), False) #"<And selector=\"{},{}\">".format(l_i, r_i) ) elif item.lower() == 'or': self.converted_lst.append( ("Or", selector_index[:-1], "{},{}".format(l_i, r_i), False) #"<Or selector=\"{},{}\">".format(l_i, r_i) ) else: print("delete {}".format(i)) #del lst[i] if i + 1 == len(lst): indices.pop() prev_i = i def name_parser(self, name, selector_index): print("name parser") print(name) if re.match("\s*not\s{1}.*", name): invert = True else: invert = False if re.match(".*resi\s{1}\d+$", name): resi = re.match(".*resi\s{1}(\d+)$", name).group(1) #resi_selector = "<ResidueIndex name=\"{}\" resnums=\"{}\">".format(selector_index, resi) #print(self.resi_selector) self.converted_lst.append(("Index", selector_index, resi, invert)) #return resi_selector elif re.match(".*resi\s{1}\d+-\d+", name): g = re.match(".*resi\s{1}(\d+)-(\d+)", name) resi_1, resi_2 = g.group(1), g.group(2) #resi_selector = "<ResidueSpan name=\"{}\" resnums=\"{},{}\">".format( # selector_index, resi_1, resi_2) self.converted_lst.append(("Index", selector_index, "{}-{}".format(resi_1, resi_2), invert)) #print(resi_selector) #return resi_selector elif re.match(".*resn\s{1}\w+", name): resn = re.match(".*resn\s{1}(\w+)", name).group(1) #resn_selector = "<ResidueName name=\"{}\" residue_names=\"{}\">".format(selector_index, resn) #print(resn_selector) self.converted_lst.append(("ResidueName", selector_index, resn, invert)) #return resn_selector elif re.match(".*chain\s{1}\w+", name): chain = re.match(".*chain\s{1}(\w+)", name).group(1) #chain_selector = "<Chain name=\"{}\" chains=\"{}\">".format(selector_index, chain) #print(chain_selector) self.converted_lst.append(("Chain", selector_index, chain, invert)) #return chain_selector def get_list(self): print(self.converted_lst) return self.converted_lst # <RESIDUE_SELECTORS> # <ResidueName name="PTD_LYX" residue_names="PTD,LYX" /> # </RESIDUE_SELECTORS> # <MOVE_MAP_FACTORIES> # <MoveMapFactory name="fr_mm_factory" bb="0" chi="0"> # <Backbone residue_selector="PTD_LYX" /> # <Chi residue_selector="PTD_LYX" /> # </MoveMapFactory> # </MOVE_MAP_FACTORIES> #selection_string = "((a) and c)" #ResidueSelection(selection_string)
StarcoderdataPython
3446545
from django.test import TestCase # ,Client from django.urls import reverse from account.models import ( CashDeposit, CashWithrawal, Account, RefCredit, RefCreditTransfer, CashTransfer, ) from users.models import User from daru_wheel.models import Stake import random from mpesa_api.core.models import OnlineCheckoutResponse # MODEL TESTS class CashDepositWithrawalTestCase(TestCase): def setUp(self): self.usera = User.objects.create( username="0710001000", email="<EMAIL>", referer_code="ADMIN" ) self.userb = User.objects.create( username="0123456787", email="<EMAIL>", referer_code="ADMIN" ) def test_user_deposit(self): CashDeposit.objects.create(amount=1000, user=self.usera, confirmed=True) bal1a = Account.objects.get(user=self.usera).balance bal1b = Account.objects.get(user=self.userb).balance self.assertEqual(1000, bal1a) self.assertEqual(0, bal1b) CashDeposit.objects.create(amount=100000, user=self.usera, confirmed=True) CashDeposit.objects.create(amount=1000, user=self.userb, confirmed=True) bal2a = Account.objects.get(user=self.usera).balance bal2b = Account.objects.get(user=self.userb).balance self.assertEqual(101000, bal2a) self.assertEqual(1000, bal2b) def test_correct_no_negative_deposit(self): """test to ensure no negative deposit done""" CashDeposit.objects.create(amount=1000, user=self.usera, confirmed=True) n_amount = -random.randint(1, 10000) CashDeposit.objects.create(amount=n_amount, user=self.usera, confirmed=True) balla = Account.objects.get(user=self.usera).balance ballb = Account.objects.get(user=self.userb).balance depo_count = CashDeposit.objects.count() self.assertEqual(depo_count, 1) self.assertEqual(balla, 1000) self.assertEqual(ballb, 0) CashDeposit.objects.create(amount=100000, user=self.usera, confirmed=True) CashDeposit.objects.create(amount=1000, user=self.userb, confirmed=True) n_amount = -random.randint(1, 10000) CashDeposit.objects.create(amount=n_amount, user=self.userb, confirmed=True) bal2a = Account.objects.get(user=self.usera).balance bal2b = Account.objects.get(user=self.userb).balance self.assertEqual(101000, bal2a) self.assertEqual(1000, bal2b) def test_witrawable_update_correctly(self): CashDeposit.objects.create(amount=10000, user=self.usera, confirmed=True) self.assertEqual(Account.objects.get(user=self.usera).balance, 10000) self.assertEqual(Account.objects.get(user=self.usera).withraw_power, 0) Stake.objects.create(user=self.usera, amount=1000, bet_on_real_account=True) self.assertEqual(Account.objects.get(user=self.usera).balance, 9000) self.assertEqual(Account.objects.get(user=self.usera).withraw_power, 1000) CashWithrawal.objects.create(user=self.usera, amount=800) self.assertEqual(Account.objects.get(user=self.usera).balance, 9000) self.assertEqual(Account.objects.get(user=self.usera).withraw_power, 1000) self.assertEqual(CashWithrawal.objects.get(id=1).approved, False) CashWithrawal.objects.filter(id=1).update(approved=True) self.assertEqual(CashWithrawal.objects.get(id=1).approved, True) self.assertEqual(Account.objects.get(user=self.usera).balance, 9000) # self.assertEqual(Account.objects.get(user=self.usera).withraw_power , 200)#failin def test_pesa_account_update_deposit_correctrly(self): user = User.objects.create(username="0710000111", password="<PASSWORD>") OnlineCheckoutResponse.objects.create( amount=10000, mpesa_receipt_number="254710000111", phone="254710000111", result_code=0, ) OnlineCheckoutResponse.objects.create( amount=10000, mpesa_receipt_number="254710000111", phone="254710000111", result_code=23455, ) OnlineCheckoutResponse.objects.create( amount=5000, phone="254710000101", result_code=0 ) self.assertEqual(Account.objects.get(user=user).balance, 10000) def test_cu_deposit_update_correctly(self): CashDeposit.objects.create(amount=10000, user=self.usera, confirmed=True) self.assertEqual(Account.objects.get(user=self.usera).cum_deposit, 10000) CashDeposit.objects.create(amount=1000, user=self.usera, confirmed=True) self.assertEqual(Account.objects.get(user=self.usera).cum_deposit, 11000) def test_correct_cas_transfer(self): CashDeposit.objects.create(amount=1000, user=self.usera, confirmed=True) bal1a = Account.objects.get(user=self.usera).balance bal1b = Account.objects.get(user=self.userb).balance trans_obj = CashTransfer.objects.create( sender=self.usera, recipient=self.userb, amount=500 ) self.assertEqual(1000, bal1a) self.assertEqual(0, bal1b) trans_obj.approved = True trans_obj.approved = True trans_obj.save() self.assertEqual(500, Account.objects.get(user=self.usera).balance) self.assertEqual(500, Account.objects.get(user=self.userb).balance) CashTransfer.objects.create( sender=self.usera, recipient=self.userb, amount=200, approved=True ) self.assertEqual(300, Account.objects.get(user=self.usera).balance) self.assertEqual(700, Account.objects.get(user=self.userb).balance) CashTransfer.objects.create( sender=self.usera, recipient=self.userb, amount=301, approved=True ) self.assertEqual(300, Account.objects.get(user=self.usera).balance) self.assertEqual(700, Account.objects.get(user=self.userb).balance) CashTransfer.objects.create( sender=self.usera, recipient=self.usera, amount=100, approved=True ) self.assertEqual(300, Account.objects.get(user=self.usera).balance) self.assertEqual(700, Account.objects.get(user=self.userb).balance) CashTransfer.objects.create( sender=self.userb, recipient=self.usera, amount=-200, approved=True ) self.assertEqual(300, Account.objects.get(user=self.usera).balance) self.assertEqual(700, Account.objects.get(user=self.userb).balance) class RefCreditTestCase(TestCase): def setUp(self): self.usera = User.objects.create( username="0710001000", email="<EMAIL>", referer_code="ADMIN" ) self.userb = User.objects.create( username="0123456787", email="<EMAIL>", referer_code="ADMIN" ) def test_correct_user_cu_credit(self): RefCredit.objects.create(amount=10, user=self.usera) RefCredit.objects.create(amount=10, user=self.usera) balla = Account.objects.get(user=self.usera).refer_balance self.assertEqual(balla, 20) RefCredit.objects.create(amount=100, user=self.usera) ballb = Account.objects.get(user=self.userb).refer_balance ballc = Account.objects.get(user=self.usera).refer_balance self.assertEqual(ballb, 0) self.assertEqual(ballc, 120) RefCredit.objects.create(amount=800, user=self.userb) ballb = Account.objects.get(user=self.userb).refer_balance self.assertEqual(ballb, 800) RefCredit.objects.create(amount=500, user=self.userb) ballb = Account.objects.get(user=self.userb).refer_balance self.assertEqual(ballb, 1300) # def test_correct_user_cu_credit_after_witraw(self): RefCredit.objects.create(amount=800, user=self.userb) ballb = Account.objects.get(user=self.userb).refer_balance self.assertEqual(ballb, 800) RefCredit.objects.create(amount=500, user=self.userb) ballb = Account.objects.get(user=self.userb).refer_balance self.assertEqual(ballb, 1300) RefCreditTransfer.objects.create(user=self.userb, amount=2000) self.assertEqual(Account.objects.get(user=self.userb).refer_balance, 1300) self.assertEqual(Account.objects.get(user=self.userb).balance, 0) RefCreditTransfer.objects.create(user=self.userb, amount=1000) self.assertEqual(Account.objects.get(user=self.userb).refer_balance, 300) self.assertEqual(Account.objects.get(user=self.userb).balance, 1000) RefCredit.objects.create(amount=1700, user=self.userb) ballb = Account.objects.get(user=self.userb).refer_balance self.assertEqual(ballb, 2000) RefCreditTransfer.objects.create(user=self.userb, amount=-1000) self.assertEqual(Account.objects.get(user=self.userb).refer_balance, 2000) self.assertEqual(Account.objects.get(user=self.userb).balance, 1000) RefCreditTransfer.objects.create(user=self.userb, amount=3000) self.assertEqual(Account.objects.get(user=self.userb).refer_balance, 2000) self.assertEqual(Account.objects.get(user=self.userb).balance, 1000) RefCreditTransfer.objects.create(user=self.userb, amount=300) self.assertEqual(Account.objects.get(user=self.userb).refer_balance, 2000) self.assertEqual(Account.objects.get(user=self.userb).balance, 1000)
StarcoderdataPython
4989557
<gh_stars>0 from django.views import generic from django.views.decorators.csrf import csrf_exempt import json import requests import random from django.utils.decorators import method_decorator from django.http import HttpRequest from django.http.response import HttpResponse from django.db.models import F from telegrambot.models import Call, User def get_message_from_request(request): received_message = {} decoded_request = json.loads(request.body.decode('utf-8')) if 'message' in decoded_request: received_message = decoded_request['message'] received_message['chat_id'] = received_message['from']['id'] # simply for easier reference received_message['first_name'] = received_message['from']['first_name'] received_message['username'] = received_message['from']['username'] return received_message def insert_call(name): all_calls = Call.objects.all().filter(button_name=name) if all_calls.exists(): all_calls.update(count=F("count") + 1) else: call = Call(button_name=name,count=1) call.save() def insert_user(username, firstname): get_user = User.objects.all().filter(user_name=username) if get_user.exists(): get_user.update(calls=F("calls") + 1) else: user = User(user_name=username, first_name=firstname, calls=1) user.save() def send_messages(message, token): # Ideally process message in some way. For now, let's just respond jokes = { 'stupid': ["""Yo' Mama is so stupid, she needs a recipe to make ice cubes.""", """Yo' Mama is so stupid, she thinks DNA is the National Dyslexics Association."""], 'fat': ["""Yo' Mama is so fat, when she goes to a restaurant, instead of a menu, she gets an estimate.""", """ Yo' Mama is so fat, when the cops see her on a street corner, they yell, "Hey you guys, break it up!" """], 'dumb': ["""THis is fun""", """THis isn't fun"""] } reply_markup={"keyboard":[["stupid","fat","dumb"]],"one_time_keyboard":True} default_message = "I don't know any responses for that. If you're interested in yo mama jokes tell me fat, stupid or dumb." post_message_url = "https://api.telegram.org/bot{0}/sendMessage".format(token) chat_id = message['chat_id'] button_reply_data = {'chat_id': chat_id, 'text': default_message, 'reply_markup': json.dumps(reply_markup)} result_message = {} # the response needs to contain just a chat_id and text field for telegram to accept it result_message['chat_id'] = chat_id if 'fat' in message['text']: result_message['text'] = random.choice(jokes['fat']) elif 'stupid' in message['text']: result_message['text'] = random.choice(jokes['stupid']) elif 'dumb' in message['text']: result_message['text'] = random.choice(jokes['dumb']) else: requests.post(post_message_url, data=button_reply_data) response_msg = json.dumps(result_message) status = requests.post(post_message_url, headers={ "Content-Type": "application/json"}, data=response_msg) insert_user(message['username'], message['first_name']) if (jokes.get(message['text'])): insert_call(message['text']) class TelegramBotView(generic.View): # csrf_exempt is necessary because the request comes from the Telegram server. @method_decorator(csrf_exempt) def dispatch(self, request, *args, **kwargs): return generic.View.dispatch(self, request, *args, **kwargs) # Post function to handle messages in whatever format they come def post(self, request, *args, **kwargs): TELEGRAM_TOKEN = '<PASSWORD>' start_message = get_message_from_request(request) send_messages(start_message, TELEGRAM_TOKEN) return HttpResponse()
StarcoderdataPython
6580747
<gh_stars>1-10 class MultiHeadedAttention(nn.Module): def __init__(self, n_heads, n_units, dropout=0.1): """ n_heads: the number of attention heads n_units: the number of output units dropout: probability of DROPPING units """ super(MultiHeadedAttention, self).__init__() # This sets the size of the keys, values, and queries (self.d_k) to all # be equal to the number of output units divided by the number of heads. self.d_k = n_units // n_heads # This requires the number of n_heads to evenly divide n_units. assert n_units % n_heads == 0 self.n_units = n_units # TODO: create/initialize any necessary parameters or layers # Note: the only Pytorch modules you are allowed to use are nn.Linear # and nn.Dropout def forward(self, query, key, value, mask=None): # TODO: implement the masked multi-head attention. # query, key, and value all have size: (batch_size, seq_len, self.n_units) # mask has size: (batch_size, seq_len, seq_len) # As described in the .tex, apply input masking to the softmax # generating the "attention values" (i.e. A_i in the .tex) # Also apply dropout to the attention values. return # size: (batch_size, seq_len, self.n_units)
StarcoderdataPython
4910660
from rx.subject import Subject import arcade import imgui from imflo.node import Node from imflo.pin import Output class VolumeNode(Node): def __init__(self, page): super().__init__(page) self._value = 88 self.subject = Subject() self.output = Output(self, 'output', self.subject) self.add_pin(self.output) @property def value(self): return self._value @value.setter def value(self, value): self._value = value self.output.write(value) def draw(self): width = 20 height = 100 imgui.set_next_window_size(160, 160, imgui.ONCE) imgui.begin("Volume") changed, self.value = imgui.v_slider_int( "volume", width, height, self.value, min_value=0, max_value=100, format="%d" ) imgui.same_line(spacing=16) self.begin_output(self.output) imgui.button('output') self.end_output() imgui.end()
StarcoderdataPython
9742323
from gui import * from tkinter import * def main(): print("Starting Program") tk = Tk() my_gui = MyGui(tk, "Do stuff with pictures.") tk.mainloop() print("Ending Program") if __name__ == "__main__": main()
StarcoderdataPython
1891674
from logic_gates.gates import Circuit, nand from logic_gates.model import Model __all__ = ['Model', 'Circuit', 'nand']
StarcoderdataPython
9680667
from keeper_cnab240.file import File import os import unittest class TestItauReturn(unittest.TestCase): def setUp(self): pass def tearDown(self): pass @staticmethod def test_process_return_file(): file = open(os.path.join(os.path.dirname(os.path.abspath(__file__)), 'TEST.RET'), 'r') file_content = file.read() file.close() payment_file = File('Itau') payment_file.read_file_content(file_content) assert len(payment_file.payments) == 1 assert len(payment_file.payments[0].status()) == 1 assert payment_file.payments[0].status()[0].is_error is False assert payment_file.payments[0].status()[0].is_processed is True assert payment_file.payments[0].get_attribute('amount') == '0000102941' if __name__ == '__main__': unittest.main()
StarcoderdataPython
11344076
<reponame>YaroslavSchubert/knight_rider import time import serial import sys,tty,termios class _Getch: def __call__(self): fd = sys.stdin.fileno() old_settings = termios.tcgetattr(fd) try: tty.setraw(sys.stdin.fileno()) ch = sys.stdin.read(3) finally: termios.tcsetattr(fd, termios.TCSADRAIN, old_settings) return ch def getc(serial): inkey = _Getch() while(1): k=inkey() if k!='':break if k=='\x1b[A': print("up") serial.write('F'.encode()) elif k=='\x1b[B': print("down") serial.write('B'.encode()) elif k=='\x1b[C': print("right") serial.write('R'.encode()) elif k=='\x1b[D': print("left") serial.write('L'.encode()) elif k=='sss': print("Stop") serial.write('S'.encode()) elif k=='eee': print("Exit") return else: print("Key is:", k) print("Not an arrow key!") def main(): ser = serial.Serial("/dev/ttyUSB0", 9600) print("Knight rider initialized") for i in range(20): getc(ser) if __name__=='__main__': main()
StarcoderdataPython
146135
<filename>intermediate-Day15-to-Day32/Day_26-list_dict_comprehensions/dict_challenge/main.py<gh_stars>0 sentence = "What is the Airspeed Velocity of an Unladen Swallow?".split() count = {word:len(word) for word in sentence} print(count)
StarcoderdataPython
3528181
# Load required libraries import numpy as np import pandas as pd from KUtils.eda import data_preparation as dp from sklearn.preprocessing import MinMaxScaler def run_for_eternity(df, target_column_name, verbose=False): # Target column should be mapped to 0 and 1 (I cannot decide if it is str. So below code will raise error) df[target_column_name] = df[target_column_name].astype('int') df[target_column_name] = df[target_column_name].astype('category') # Step 1. Fix column names (df.query not comfortable with special chars) print(' Fixing column names bcoz df.query not comfortable with special chars in feature names') dp.fix_invalid_column_names(df) # Step 2: Convert all continuous variables to cut categorical bins after scaling print(' Converting all continuous variables to cut categorical bins after MinMaxScaling') no_of_bins=10 categorical_column_names = list(df.select_dtypes(include=['object', 'category']).columns) numerical_column_names = [i for i in df.columns if not i in categorical_column_names] categorical_column_names.remove(target_column_name) scaler = MinMaxScaler() df[numerical_column_names] = scaler.fit_transform(df[numerical_column_names]) for a_column in numerical_column_names: df[a_column+'_tmp_bin'] = pd.cut(df[a_column], no_of_bins, labels=False) del df[a_column] # drop original column df[a_column+'_tmp_bin']=df[a_column+'_tmp_bin'].astype('str') # Step 3. Separate the +ve and -ve target dataset rule_columns = list(df.columns) rule_columns.remove(target_column_name) negative_target_df = df.loc[df[target_column_name]==0] positive_target_df = df.loc[df[target_column_name]==1] iter = 0 query_iter_df = pd.DataFrame( columns = ['query_id', 'query', 'positive_record_Count', 'negative_record_Count','total_records', 'tp','tn','fp','fn']) print(' Has to go thru rows '+str(len(positive_target_df))) print(' Now wait...') while(len(positive_target_df)>0): selected_row = positive_target_df.iloc[0,:] filter_condition = '' for a_rule_column_name in rule_columns: if len(filter_condition)!=0: filter_condition = filter_condition + ' and ' filter_condition = filter_condition + a_rule_column_name+'==\'' + selected_row[a_rule_column_name] + '\'' filtered_positive_df = positive_target_df.query(filter_condition) filtered_negative_df = negative_target_df.query(filter_condition) positive_target_df = positive_target_df.drop(filtered_positive_df.index) negative_target_df = negative_target_df.drop(filtered_negative_df.index) tp=tn=fp=fn=0 if (len(filtered_positive_df)==1 and len(filtered_negative_df)==0): # Can't decide easily give 50% to both class tp = 0.5 fn = 0.5 elif (len(filtered_positive_df)==0 and len(filtered_negative_df)==1): # Can't decide easily give 50% to both class tn = 0.5 fp = 0.5 elif (len(filtered_positive_df)>len(filtered_negative_df)): # Majority belongs to positive class tp = len(filtered_positive_df) fp = len(filtered_negative_df) elif (len(filtered_positive_df)<len(filtered_negative_df)): # Majority belongs to negative class tn = len(filtered_negative_df) fn = len(filtered_positive_df) else: # Rare case of Equal sample size - Distinute equally to all group tn = len(filtered_negative_df)/2 tp = len(filtered_negative_df)/2 fp = len(filtered_negative_df)/2 fn = len(filtered_negative_df)/2 total_records = len(filtered_positive_df) + len(filtered_negative_df) query_iter_df.loc[iter] =[iter, filter_condition, len(filtered_positive_df), len(filtered_negative_df),total_records, tp,tn,fp,fn ] iter=iter+1 if verbose: if iter%500==0: print(' Remaining rows to process '+str(len(positive_target_df))) if len(negative_target_df)>0: # Leftover query_iter_df.loc[iter] =[iter, 'Leftover', 0, len(negative_target_df),len(negative_target_df), 0,len(negative_target_df),0,0 ] sum(query_iter_df['total_records']) total_tp=sum(query_iter_df['tp']) total_tn=sum(query_iter_df['tn']) total_fp=sum(query_iter_df['fp']) total_fn=sum(query_iter_df['fn']) accuracy = (total_tp+total_tn)/(total_tn+total_tp+total_fn+total_fp) sensitivity = total_tp/(total_tp+total_fn) specificity = total_tn/(total_tn+total_fp) precision = total_tp/(total_tp+total_fp) print('Done.') error_range=0.01 print('For this dataset max performance you can achieve is ') print(' Accuracy around {0:.3f}'.format(accuracy-error_range)) print(' Sensitivity around {0:.3f}'.format(sensitivity-error_range)) print(' Specificity around {0:.3f}'.format(specificity-error_range)) print(' Precision around {0:.3f}'.format(precision-error_range)) print(' Recall around {0:.3f}'.format(sensitivity-error_range)) return query_iter_df
StarcoderdataPython
1894755
from datetime import timedelta from unittest.mock import patch from mspray.apps.main.tests.test_base import TestBase from mspray.apps.main.models import SprayDay from mspray.apps.warehouse.tasks import stream_to_druid, reload_druid_data from mspray.apps.warehouse.tasks import reload_yesterday_druid_data from mspray.celery import app from django.utils import timezone class TestTasks(TestBase): def setUp(self): TestBase.setUp(self) app.conf.update(CELERY_ALWAYS_EAGER=True) self._load_fixtures() @patch('mspray.apps.warehouse.tasks.send_to_tranquility') @patch('mspray.apps.warehouse.stream.send_request') def test_stream_to_druid(self, mock, mock2): """ Test that stream_to_druid calls send_to_tranquility with the right arg """ sprayday = SprayDay.objects.first() stream_to_druid(sprayday.id) self.assertTrue(mock2.called) args, kwargs = mock2.call_args_list[0] self.assertEqual(args[0], sprayday) @patch('mspray.apps.warehouse.tasks.get_data') def test_reload_druid_data(self, mock): """ Test that reload_druid_data calls get_data with the right argument """ reload_druid_data(minutes=15) self.assertTrue(mock.called) args, kwargs = mock.call_args_list[0] self.assertEqual(15, kwargs['minutes']) @patch('mspray.apps.warehouse.tasks.get_historical_data') def test_reload_yesterday_druid_data(self, mock): """ Test that reload_yesterday_druid_data actually calls get_historical_data with the right args """ today = timezone.now() jana = today - timedelta(days=1) reload_yesterday_druid_data() self.assertTrue(mock.called) args, kwargs = mock.call_args_list[0] self.assertEqual(kwargs['day'], jana.day) self.assertEqual(kwargs['month'], jana.month) self.assertEqual(kwargs['year'], jana.year)
StarcoderdataPython
1823709
# Copyright 2016 The Chromium Authors. All rights reserved. # Use of this source code is governed by a BSD-style license that can be # found in the LICENSE file. { 'targets': [ { 'target_name': 'device_page', 'dependencies': [ '../settings_page/compiled_resources2.gyp:settings_animated_pages', ], 'includes': ['../../../../../third_party/closure_compiler/compile_js2.gypi'], }, { 'target_name': 'device_page_browser_proxy', 'dependencies': [ '<(DEPTH)/ui/webui/resources/js/compiled_resources2.gyp:cr', ], 'includes': ['../../../../../third_party/closure_compiler/compile_js2.gypi'], }, { 'target_name': 'touchpad', 'dependencies': [ 'device_page_browser_proxy' ], 'includes': ['../../../../../third_party/closure_compiler/compile_js2.gypi'], }, { 'target_name': 'keyboard', 'dependencies': [ '../prefs/compiled_resources2.gyp:prefs_behavior', '../prefs/compiled_resources2.gyp:prefs_types', '<(DEPTH)/ui/webui/resources/js/compiled_resources2.gyp:assert', '<(DEPTH)/ui/webui/resources/js/compiled_resources2.gyp:cr', '<(DEPTH)/ui/webui/resources/js/compiled_resources2.gyp:load_time_data', '<(EXTERNS_GYP):settings_private', 'device_page_browser_proxy' ], 'includes': ['../../../../../third_party/closure_compiler/compile_js2.gypi'], }, { 'target_name': 'display', 'dependencies': [ '<(DEPTH)/third_party/polymer/v1_0/components-chromium/paper-button/compiled_resources2.gyp:paper-button-extracted', '<(DEPTH)/third_party/polymer/v1_0/components-chromium/paper-slider/compiled_resources2.gyp:paper-slider-extracted', '<(DEPTH)/ui/webui/resources/js/compiled_resources2.gyp:cr', '<(DEPTH)/ui/webui/resources/js/compiled_resources2.gyp:i18n_behavior', '<(EXTERNS_GYP):system_display', '<(INTERFACES_GYP):system_display_interface', ], 'includes': ['../../../../../third_party/closure_compiler/compile_js2.gypi'], }, ], }
StarcoderdataPython
6634648
with open('ycb_adv.txt', 'w') as f: for scene_id in range(1, 41): for setting in ['B', 'D', 'D1', 'D2', 'O1', 'O2', 'O3']: f.write('exp{:0>3d}_{}/001\n'.format(scene_id, setting))
StarcoderdataPython
5026357
<filename>dataladmetadatamodel/mapper/gitmapper/tests/test_treeupdater.py import tempfile from collections import defaultdict from pathlib import Path from unittest.mock import patch from nose.tools import ( assert_equal, assert_in, ) from ..utils import create_git_repo from ..gitbackend.subprocess import ( git_ls_tree, git_ls_tree_recursive, ) from ..treeupdater import ( EntryType, PathInfo, _get_dir, _write_dir, add_paths ) default_repo = { "a": { "af1": "1234" }, "b": { "bf1": "aasdsd" }, "LICENSE": "license content" } def test_basic(): path_infos = [ PathInfo(["a", "b", "c"], "000000000000000000000000000000000000000c", EntryType.File), PathInfo(["a", "b", "d"], "000000000000000000000000000000000000000d", EntryType.File), PathInfo(["tools", "ttttc"], "000000000000000000000000000000000000000c", EntryType.File), PathInfo(["a", "d"], "000000000000000000000000000000000000000d", EntryType.File), PathInfo(["b", "a"], "000000000000000000000000000000000000000a", EntryType.File), PathInfo(["c", "b"], "000000000000000000000000000000000000000b", EntryType.File), PathInfo(["d"], "000000000000000000000000000000000000000d", EntryType.File), PathInfo(["LICENSE"], "00000000000000000000000000000000000000a0", EntryType.File) ] with tempfile.TemporaryDirectory() as td: repo_path = Path(td) tree_hash = create_git_repo(repo_path, default_repo) root_entries = _get_dir(repo_path, tree_hash) result = add_paths(repo_path, path_infos, root_entries) lines = git_ls_tree_recursive(str(repo_path), result) for path_info in path_infos: assert_in( f"100644 blob {path_info.object_hash}\t{'/'.join(path_info.elements)}", lines ) def test_dir_adding(): path_infos = [ PathInfo( ["a_dir"], "000000000000000000000000000000000000000c", EntryType.Directory ) ] with tempfile.TemporaryDirectory() as td: repo_path = Path(td) tree_hash = create_git_repo(repo_path, default_repo) root_entries = _get_dir(repo_path, tree_hash) result = add_paths(repo_path, path_infos, root_entries) lines = git_ls_tree(str(repo_path), result) for path_info in path_infos: assert_in( f"040000 tree {path_info.object_hash}\t{'/'.join(path_info.elements)}", lines ) def test_dir_overwrite_error(): path_infos = [ PathInfo( ["a"], "000000000000000000000000000000000000000c", EntryType.File ) ] with tempfile.TemporaryDirectory() as td: repo_path = Path(td) tree_hash = create_git_repo(repo_path, default_repo) root_entries = _get_dir(repo_path, tree_hash) try: add_paths(repo_path, path_infos, root_entries) raise RuntimeError("did not get expected ValueError") except ValueError as ve: assert_equal(ve.args[0], "cannot convert Directory to File: a") def test_file_overwrite_error(): path_infos = [ PathInfo( ["LICENSE"], "000000000000000000000000000000000000000c", EntryType.Directory ) ] with tempfile.TemporaryDirectory() as td: repo_path = Path(td) tree_hash = create_git_repo(repo_path, default_repo) root_entries = _get_dir(repo_path, tree_hash) try: add_paths(repo_path, path_infos, root_entries) raise RuntimeError("did not get expected ValueError") except ValueError as ve: assert_equal( ve.args[0], "cannot convert File to Directory: LICENSE") def test_minimal_invocation(): complex_repo = { "a": { "a_a": { "a_a_f1": "content of a_a_f1" }, "a_b": { "a_b_f1": "content of a_b_f1" } }, "b": { "b_a": { "b_a_f1": "content of b_a_f1" }, "b_b": { "b_b_f1": "content of b_b_f1" } }, "c": { "c_f1": "content of c_f1" } } path_infos = [ PathInfo( ["a", "a_a", "a_a_a", "a_a_a_f1"], "000000000000000000000000000000000000000c", EntryType.File ), PathInfo( ["a", "a_a", "a_a_a", "a_a_a_f2"], "000000000000000000000000000000000000000c", EntryType.File ), PathInfo( ["a", "a_a", "a_a_f1"], "000000000000000000000000000000000000000c", EntryType.File ), PathInfo( ["a", "a_b", "a_b_f2"], "000000000000000000000000000000000000000c", EntryType.File ), ] with \ tempfile.TemporaryDirectory() as td, \ patch("dataladmetadatamodel.mapper.gitmapper.treeupdater._get_dir") as gd_mock, \ patch("dataladmetadatamodel.mapper.gitmapper.treeupdater._write_dir") as wd_mock: def gd_counter(*args): get_calls[args[1]] += 1 return _get_dir(*args) def wd_counter(*args): write_calls[args] += 1 return _write_dir(*args) get_calls = defaultdict(int) write_calls = defaultdict(int) gd_mock.side_effect = gd_counter wd_mock.side_effect = wd_counter repo_path = Path(td) tree_hash = create_git_repo(repo_path, complex_repo) root_entries = _get_dir(repo_path, tree_hash) result = add_paths(repo_path, path_infos, root_entries) # Assert that a node is only read once assert all(map(lambda x: x == 1, get_calls.values())) assert len(get_calls) == 3 # Assert that a node is only written once assert all(map(lambda x: x == 1, write_calls.values())) assert len(write_calls) == 5 lines = git_ls_tree_recursive(str(repo_path), result) for path_info in path_infos: assert_in( f"100644 blob {path_info.object_hash}\t{'/'.join(path_info.elements)}", lines)
StarcoderdataPython
1907209
# coding=utf-8 import sys import time import datetime import logging import MySQLdb import MySQLdb.cursors logger = logging.getLogger("latest_active_user") logger.setLevel(logging.DEBUG) # user_tbl user_tbl = { "host": "10.10.10.10", "port": 3306, "user": "lsb", "passwd": "<PASSWORD>", "db": "db" } latest_active_user = { "host": "10.10.10.10", "port": 3306, "user": "lsb", "passwd": "<PASSWORD>", "db": "db" } # push_stat_{} push_stat = { "host": "10.10.10.10", "port": 4000, "user": "lsb", "passwd": "<PASSWORD>", "db": "db" } # user_register_{} user_register = { "host": "10.10.10.10", "port": 3306, "user": "lsb", "passwd": "<PASSWORD>", "db": "db" } # user_action_log_{} user_action_log = { "host": "10.10.10.10", "port": 3306, "user": "lsb", "passwd": "<PASSWORD>", "db": "db" } user_id_set = set() def format_date(diff_days): date_time = datetime.datetime.utcnow() + datetime.timedelta(hours=7) return (date_time + datetime.timedelta(days=diff_days)).strftime("%Y%m%d") def init_logger(log_module): handler = logging.FileHandler(filename="latest_active_user.log", mode='w') # handler.setLevel(logging.DEBUG) formatter = logging.Formatter("%(asctime)s - %(levelname)s - %(message)s") handler.setFormatter(formatter) log_module.addHandler(handler) def get_db_conn(mysql_config): db = MySQLdb.connect(host=mysql_config['host'], port=mysql_config['port'], user=mysql_config['user'], passwd=mysql_config['passwd'], db=mysql_config['db'], cursorclass=MySQLdb.cursors.DictCursor) db.set_character_set('utf8mb4') cursor = db.cursor() cursor.execute('SET NAMES utf8mb4;') return db, cursor def truncate_table_helper(): sql = "truncate table `db`.`latest_active_user_tbl`" logger.debug("database: %s, sql: %s", latest_active_user_tbl, sql) db, cursor = get_db_conn(latest_active_user) cursor.execute(sql) db.commit() cursor.close() db.close() def fetch_helper(conn, sql): logger.debug("database: %s, sql: %s", conn, sql) db, cursor = get_db_conn(conn) cursor.execute(sql) ret = cursor.fetchall() cursor.close() db.close() if not ret: logger.warn("sql not ret") return ret def batch_insert_helper(user_id_set): if len(user_id_set) == 0: return total = 0 try: db, cursor = get_db_conn(latest_active_user) batch = 100000 values = [] for i in user_id_set: values.append((i,)) # 批量插入 if len(values) == batch: total += batch logger.info("batch insert, count: %d", len(values)) cursor.executemany( 'INSERT INTO `db`.`latest_active_user_tbl` (user_id) VALUES (%s)', values) db.commit() values = [] if len(values) > 0: total += len(values) logger.info("final batch insert, count: %d", len(values)) cursor.executemany( 'INSERT INTO `db`.`latest_active_user_tbl` (user_id) VALUES (%s)', values) db.commit() values = [] cursor.close() db.close() except MySQLdb.Error as ex: logger.error("MySQL Error %d: %s", ex.args[0], ex.args[1]) return total def from_push_stat(): sql = """ select distinct(user_id) from `db`.`push_stat_{}` union select distinct(user_id) from `db`.`push_stat_{}` union select distinct(user_id) from `db`.`push_stat_{}` union select distinct(user_id) from `db`.`push_stat_{}` union select distinct(user_id) from `db`.`push_stat_{}` union select distinct(user_id) from `db`.`push_stat_{}` union select distinct(user_id) from `db`.`push_stat_{}` """.format(format_date(-1), format_date(-2), format_date(-3), format_date(-4), format_date(-5), format_date(-6), format_date(-7)) users = fetch_helper(push_stat, sql) if not users: logger.info("call fetch_helper(), no record") else: logger.info("call fetch_helper(), got %d record(s)", len(users)) for row in users: user_id_set.add(row['user_id']) def from_user(): sql = """ select id from `db`.`user_tbl` where create_time > date_add(now(), interval - 7 day) """ users = fetch_helper(user, sql) if not users: logger.info("call fetch_helper(), no record") else: logger.info("call fetch_helper(), got %d record(s)", len(users)) for row in users: user_id_set.add(row['id']) def from_user_register(): sql = """ select distinct(user_id) from `db`.`user_register_{}` union select distinct(user_id) from `db`.`user_register_{}` union select distinct(user_id) from `db`.`user_register_{}` """.format(format_date(-1), format_date(-2), format_date(-3)) users = fetch_helper(user_register, sql) if not users: logger.info("call fetch_helper(), no record") else: logger.info("call fetch_helper(), got %d record(s)", len(users)) for row in users: user_id_set.add(row['user_id']) def from_user_action_log(): sql = """ select distinct(user_id) from `db`.`user_action_log_{}` union select distinct(user_id) from `db`.`user_action_log_{}` union select distinct(user_id) from `db`.`user_action_log_{}` """.format(format_date(-1), format_date(-2), format_date(-3)) users = fetch_helper(user_action_log, sql) if not users: logger.info("call fetch_helper(), no record") else: logger.info("call fetch_helper(), got %d record(s)", len(users)) for row in users: user_id_set.add(row['user_id']) if __name__ == '__main__': init_logger(logger) logger.info("begin task") # 清空表 truncate_table_helper() # 清洗数据 from_push_stat() logger.info("after from_push_stat(), size: %d", len(user_id_set)) from_user() logger.info("after from_user(), size: %d", len(user_id_set)) from_user_register() logger.info("after from_user_register(), size: %d", len(user_id_set)) from_user_action_log() logger.info("after from_user_action_log(), size: %d", len(user_id_set)) # 批量插入数据 batch_insert_helper(user_id_set) logger.info("end task")
StarcoderdataPython
9799601
<reponame>pcaball71927/CheessMoves tablero = [ ['t', 'k', 'a', 'q', 'r', 'a', 'k', 't'], ['p', 'p', 'p', 'p', 'p', 'p', 'p', 'p'], [' ', ' ', ' ', ' ', ' ', ' ', ' ', ' '], [' ', ' ', ' ', ' ', ' ', ' ', ' ', ' '], [' ', ' ', ' ', ' ', ' ', ' ', ' ', ' '], [' ', ' ', ' ', ' ', ' ', ' ', ' ', ' '], ['P', 'P', 'P', 'P', 'P', 'P', 'P', 'P'], ['T', 'K', 'A', 'R', 'Q', 'A', 'K', 'T'] ] def tablero_a_cadena(tablero): """ (str) -> str convierte el tablero a una cadena >>>tablero_a_cadena(tablero) [ ['t', 'k', 'a', 'q', 'r', 'a', 'k', 't'], ['p', 'p', 'p', 'p', 'p', 'p', 'p', 'p'], [' ', ' ', ' ', ' ', ' ', ' ', ' ', ' '], [' ', ' ', ' ', ' ', ' ', ' ', ' ', ' '], [' ', ' ', ' ', ' ', ' ', ' ', ' ', ' '], [' ', ' ', ' ', ' ', ' ', ' ', ' ', ' '], ['P', 'P', 'P', 'P', 'P', 'P', 'P', 'P'], ['T', 'K', 'A', 'R', 'Q', 'A', 'K', 'T'] ] :param tablero: Representacion visual del juego en una (matriz) :return: cadena que representa las casillas del tablero """ cadena = "" for fila in tablero: cadena += str(fila) + "\n" return cadena def obtener_nombre_pieza(simbolo): """ (str) -> str >>> obtener_nombre_pieza('p') 'Peon blanco' >>> obtener_nombre_pieza('R') 'Rey Negro' Retorna el nombre de la pieza del ajedrez dado su simbolo :param simbolo: la representacion de la pieza segun el enunciado :return: El nombre y color de la pieza """ tipo = 'Negro' if simbolo.islower(): tipo = 'blanco' retorno = simbolo.lower() if retorno == 'p': return 'Peon '+tipo elif retorno == 't': return 'Torre ' + tipo elif retorno == 'k': return 'Caballo ' + tipo elif retorno == 'a': return 'Alfil ' + tipo elif retorno == 'q': return 'Reina ' + tipo elif retorno == 'r': return 'Rey ' + tipo else: return 'No es una pieza'
StarcoderdataPython
68002
<gh_stars>1-10 """Support for N26 bank account sensors.""" from homeassistant.helpers.entity import Entity from . import DEFAULT_SCAN_INTERVAL, DOMAIN, timestamp_ms_to_date from .const import DATA SCAN_INTERVAL = DEFAULT_SCAN_INTERVAL ATTR_IBAN = "account" ATTR_USABLE_BALANCE = "usable_balance" ATTR_BANK_BALANCE = "bank_balance" ATTR_ACC_OWNER_TITLE = "owner_title" ATTR_ACC_OWNER_FIRST_NAME = "owner_first_name" ATTR_ACC_OWNER_LAST_NAME = "owner_last_name" ATTR_ACC_OWNER_GENDER = "owner_gender" ATTR_ACC_OWNER_BIRTH_DATE = "owner_birth_date" ATTR_ACC_OWNER_EMAIL = "owner_email" ATTR_ACC_OWNER_PHONE_NUMBER = "owner_phone_number" ICON_ACCOUNT = "mdi:currency-eur" ICON_CARD = "mdi:credit-card" ICON_SPACE = "mdi:crop-square" def setup_platform(hass, config, add_entities, discovery_info=None): """Set up the N26 sensor platform.""" if discovery_info is None: return api_list = hass.data[DOMAIN][DATA] sensor_entities = [] for api_data in api_list: sensor_entities.append(N26Account(api_data)) for card in api_data.cards: sensor_entities.append(N26Card(api_data, card)) for space in api_data.spaces["spaces"]: sensor_entities.append(N26Space(api_data, space)) add_entities(sensor_entities) class N26Account(Entity): """Sensor for a N26 balance account. A balance account contains an amount of money (=balance). The amount may also be negative. """ def __init__(self, api_data) -> None: """Initialize a N26 balance account.""" self._data = api_data self._iban = self._data.balance["iban"] def update(self) -> None: """Get the current balance and currency for the account.""" self._data.update_account() @property def unique_id(self): """Return the unique ID of the entity.""" return self._iban[-4:] @property def name(self) -> str: """Friendly name of the sensor.""" return f"n26_{self._iban[-4:]}" @property def state(self) -> float: """Return the balance of the account as state.""" if self._data.balance is None: return None return self._data.balance.get("availableBalance") @property def unit_of_measurement(self) -> str: """Use the currency as unit of measurement.""" if self._data.balance is None: return None return self._data.balance.get("currency") @property def device_state_attributes(self) -> dict: """Additional attributes of the sensor.""" attributes = { ATTR_IBAN: self._data.balance.get("iban"), ATTR_BANK_BALANCE: self._data.balance.get("bankBalance"), ATTR_USABLE_BALANCE: self._data.balance.get("usableBalance"), ATTR_ACC_OWNER_TITLE: self._data.account_info.get("title"), ATTR_ACC_OWNER_FIRST_NAME: self._data.account_info.get("kycFirstName"), ATTR_ACC_OWNER_LAST_NAME: self._data.account_info.get("kycLastName"), ATTR_ACC_OWNER_GENDER: self._data.account_info.get("gender"), ATTR_ACC_OWNER_BIRTH_DATE: timestamp_ms_to_date( self._data.account_info.get("birthDate") ), ATTR_ACC_OWNER_EMAIL: self._data.account_info.get("email"), ATTR_ACC_OWNER_PHONE_NUMBER: self._data.account_info.get( "mobilePhoneNumber" ), } for limit in self._data.limits: limit_attr_name = f"limit_{limit['limit'].lower()}" attributes[limit_attr_name] = limit["amount"] return attributes @property def icon(self) -> str: """Set the icon for the sensor.""" return ICON_ACCOUNT class N26Card(Entity): """Sensor for a N26 card.""" def __init__(self, api_data, card) -> None: """Initialize a N26 card.""" self._data = api_data self._account_name = api_data.balance["iban"][-4:] self._card = card def update(self) -> None: """Get the current balance and currency for the account.""" self._data.update_cards() self._card = self._data.card(self._card["id"], self._card) @property def unique_id(self): """Return the unique ID of the entity.""" return self._card["id"] @property def name(self) -> str: """Friendly name of the sensor.""" return f"{self._account_name.lower()}_card_{self._card['id']}" @property def state(self) -> float: """Return the balance of the account as state.""" return self._card["status"] @property def device_state_attributes(self) -> dict: """Additional attributes of the sensor.""" attributes = { "apple_pay_eligible": self._card.get("applePayEligible"), "card_activated": timestamp_ms_to_date(self._card.get("cardActivated")), "card_product": self._card.get("cardProduct"), "card_product_type": self._card.get("cardProductType"), "card_settings_id": self._card.get("cardSettingsId"), "card_Type": self._card.get("cardType"), "design": self._card.get("design"), "exceet_actual_delivery_date": self._card.get("exceetActualDeliveryDate"), "exceet_card_status": self._card.get("exceetCardStatus"), "exceet_expected_delivery_date": self._card.get( "exceetExpectedDeliveryDate" ), "exceet_express_card_delivery": self._card.get("exceetExpressCardDelivery"), "exceet_express_card_delivery_email_sent": self._card.get( "exceetExpressCardDeliveryEmailSent" ), "exceet_express_card_delivery_tracking_id": self._card.get( "exceetExpressCardDeliveryTrackingId" ), "expiration_date": timestamp_ms_to_date(self._card.get("expirationDate")), "google_pay_eligible": self._card.get("googlePayEligible"), "masked_pan": self._card.get("maskedPan"), "membership": self._card.get("membership"), "mpts_card": self._card.get("mptsCard"), "pan": self._card.get("pan"), "pin_defined": timestamp_ms_to_date(self._card.get("pinDefined")), "username_on_card": self._card.get("usernameOnCard"), } return attributes @property def icon(self) -> str: """Set the icon for the sensor.""" return ICON_CARD class N26Space(Entity): """Sensor for a N26 space.""" def __init__(self, api_data, space) -> None: """Initialize a N26 space.""" self._data = api_data self._space = space def update(self) -> None: """Get the current balance and currency for the account.""" self._data.update_spaces() self._space = self._data.space(self._space["id"], self._space) @property def unique_id(self): """Return the unique ID of the entity.""" return f"space_{self._data.balance['iban'][-4:]}_{self._space['name'].lower()}" @property def name(self) -> str: """Friendly name of the sensor.""" return self._space["name"] @property def state(self) -> float: """Return the balance of the account as state.""" return self._space["balance"]["availableBalance"] @property def unit_of_measurement(self) -> str: """Use the currency as unit of measurement.""" return self._space["balance"]["currency"] @property def device_state_attributes(self) -> dict: """Additional attributes of the sensor.""" goal_value = "" if "goal" in self._space: goal_value = self._space.get("goal").get("amount") attributes = { "name": self._space.get("name"), "goal": goal_value, "background_image_url": self._space.get("backgroundImageUrl"), "image_url": self._space.get("imageUrl"), "is_card_attached": self._space.get("isCardAttached"), "is_hidden_from_balance": self._space.get("isHiddenFromBalance"), "is_locked": self._space.get("isLocked"), "is_primary": self._space.get("isPrimary"), } return attributes @property def icon(self) -> str: """Set the icon for the sensor.""" return ICON_SPACE
StarcoderdataPython
99985
<filename>tensorflow_probability/python/experimental/psd_kernels/additive_kernel_test.py # Copyright 2021 The TensorFlow Probability Authors. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. # ============================================================================ """Tests for AdditiveKernel.""" import itertools from absl.testing import parameterized import numpy as np import tensorflow.compat.v2 as tf import tensorflow_probability as tfp from tensorflow_probability.python import experimental as tfe from tensorflow_probability.python.internal import test_util @test_util.test_all_tf_execution_regimes class AdditiveKernelTest(test_util.TestCase): def testBatchShape(self): amplitudes = np.ones((4, 1, 1, 3), np.float32) additive_inner_kernel = tfp.math.psd_kernels.ExponentiatedQuadratic( amplitude=np.ones([2, 1, 1], np.float32), length_scale=np.ones([1, 3, 1], np.float32)) kernel = tfe.psd_kernels.AdditiveKernel( kernel=additive_inner_kernel, amplitudes=amplitudes) self.assertAllEqual(tf.TensorShape([4, 2, 3]), kernel.batch_shape) self.assertAllEqual([4, 2, 3], self.evaluate(kernel.batch_shape_tensor())) def _compute_additive_kernel( self, amplitudes, length_scale, dim, x, y, method='apply'): expected = 0. for i in range(amplitudes.shape[-1]): # Get all (ordered) combinations of indices of length `i + 1` ind = itertools.combinations(range(dim), i + 1) # Sum over all combinations of indices of the given length. sum_i = 0. for ind_i in ind: # Multiply the kernel values at the given indices together. prod_k = 1. for d in ind_i: kernel = tfp.math.psd_kernels.ExponentiatedQuadratic( amplitude=1., length_scale=length_scale[..., d]) if method == 'apply': prod_k *= kernel.apply( x[..., d, np.newaxis], y[..., d, np.newaxis]) elif method == 'matrix': prod_k *= kernel.matrix( x[..., d, np.newaxis], y[..., d, np.newaxis]) sum_i += prod_k expected += amplitudes[..., i]**2 * sum_i return expected @parameterized.parameters( {'x_batch': [1], 'y_batch': [1], 'dim': 2, 'amplitudes': [1., 2.]}, {'x_batch': [5], 'y_batch': [1], 'dim': 4, 'amplitudes': [1., 2., 3.]}, {'x_batch': [], 'y_batch': [], 'dim': 2, 'amplitudes': [3., 2.]}, {'x_batch': [4, 1], 'y_batch': [3], 'dim': 2, 'amplitudes': [1.]}, {'x_batch': [4, 1, 1], 'y_batch': [3, 1], 'dim': 2, 'amplitudes': [[2., 3.], [1., 2.]]}, {'x_batch': [5], 'y_batch': [1], 'dim': 17, 'amplitudes': [2., 2.]}, {'x_batch': [10], 'y_batch': [2, 1], 'dim': 16, 'amplitudes': [2., 1., 0.5]}, ) def testValuesAreCorrect(self, x_batch, y_batch, dim, amplitudes): amplitudes = np.array(amplitudes).astype(np.float32) length_scale = tf.random.stateless_uniform( [dim], seed=test_util.test_seed(sampler_type='stateless'), minval=0., maxval=2., dtype=tf.float32) inner_kernel = tfp.math.psd_kernels.ExponentiatedQuadratic( amplitude=1., length_scale=length_scale) kernel = tfe.psd_kernels.AdditiveKernel( kernel=inner_kernel, amplitudes=amplitudes) x = tf.random.stateless_uniform( x_batch + [dim], seed=test_util.test_seed(sampler_type='stateless'), minval=-2., maxval=2., dtype=tf.float32) y = tf.random.stateless_uniform( y_batch + [dim], seed=test_util.test_seed(sampler_type='stateless'), minval=-2., maxval=2., dtype=tf.float32) actual = kernel.apply(x, y) expected = self._compute_additive_kernel( amplitudes, length_scale, dim, x, y, method='apply') self.assertAllClose(self.evaluate(actual), self.evaluate(expected)) @parameterized.parameters( {'x_batch': [5], 'y_batch': [1], 'dim': 4, 'amplitudes': [1., 2., 3.]}, {'x_batch': [], 'y_batch': [], 'dim': 2, 'amplitudes': [3., 2.]}, {'x_batch': [4, 1], 'y_batch': [3], 'dim': 2, 'amplitudes': [1.]}, {'x_batch': [5], 'y_batch': [1], 'dim': 17, 'amplitudes': [2., 2.]}, {'x_batch': [10], 'y_batch': [2, 1], 'dim': 16, 'amplitudes': [2., 1., 0.5]}, ) def testMatrixValuesAreCorrect( self, x_batch, y_batch, dim, amplitudes): amplitudes = np.array(amplitudes).astype(np.float32) length_scale = tf.random.stateless_uniform( [dim], seed=test_util.test_seed(sampler_type='stateless'), minval=0., maxval=2., dtype=tf.float32) inner_kernel = tfp.math.psd_kernels.ExponentiatedQuadratic( amplitude=1., length_scale=length_scale) kernel = tfe.psd_kernels.AdditiveKernel( kernel=inner_kernel, amplitudes=amplitudes) x = tf.random.stateless_uniform( x_batch + [3, dim], seed=test_util.test_seed(sampler_type='stateless'), minval=-2., maxval=2., dtype=tf.float32) y = tf.random.stateless_uniform( y_batch + [5, dim], seed=test_util.test_seed(sampler_type='stateless'), minval=-2., maxval=2., dtype=tf.float32) actual = kernel.matrix(x, y) expected = self._compute_additive_kernel( amplitudes, length_scale, dim, x, y, method='matrix') self.assertAllClose( self.evaluate(actual), self.evaluate(expected), rtol=1e-5) @test_util.disable_test_for_backend( disable_numpy=True, disable_jax=True, reason='GradientTape not available for JAX/NumPy backend.') @parameterized.parameters( {'input_shape': [3, 4], 'amplitudes': [1., 2., 3.]}, {'input_shape': [10, 16], 'amplitudes': [2., 1., 0.5]}) def test_gradient(self, input_shape, amplitudes): length_scale = tf.Variable( tf.random.stateless_uniform( [input_shape[-1]], seed=test_util.test_seed(sampler_type='stateless'), minval=0., maxval=2., dtype=tf.float32)) inner_kernel = tfp.math.psd_kernels.ExponentiatedQuadratic( amplitude=1., length_scale=length_scale) kernel = tfe.psd_kernels.AdditiveKernel( kernel=inner_kernel, amplitudes=amplitudes) x = tf.random.stateless_uniform( input_shape, seed=test_util.test_seed(sampler_type='stateless'), minval=-2., maxval=2., dtype=tf.float32) y = tf.random.stateless_uniform( input_shape, seed=test_util.test_seed(sampler_type='stateless'), minval=-2., maxval=2., dtype=tf.float32) with tf.GradientTape() as tape: tape.watch(x) k = kernel.apply(x, y) self.evaluate([v.initializer for v in kernel.trainable_variables]) grads = tape.gradient(k, kernel.trainable_variables + (x,)) self.assertAllNotNone(grads) self.assertLen(grads, 2) if __name__ == '__main__': tf.test.main()
StarcoderdataPython
6588829
<filename>hknweb/events/models/event_type.py from django.db import models class EventType(models.Model): type = models.CharField(max_length=255) # Default color: CS61A blue color = models.CharField(max_length=7, default="#0072c1") def __repr__(self): return "EventType(type={})".format(self.type) def __str__(self): return str(self.type)
StarcoderdataPython
4883701
<filename>speedinfo/conditions/exclude_urls.py # coding: utf-8 import re from speedinfo.conditions.base import AbstractCondition from speedinfo.conf import speedinfo_settings class ExcludeURLCondition(AbstractCondition): """ Condition allows to exclude some urls from profiling by adding them to the SPEEDINFO_EXCLUDE_URLS list (default is empty). Each entry in SPEEDINFO_EXCLUDE_URLS is a regex compatible expression to test requested url. """ def __init__(self): self.patterns = None def get_patterns(self): if (self.patterns is None) or speedinfo_settings.SPEEDINFO_TESTS: self.patterns = [re.compile(pattern) for pattern in speedinfo_settings.SPEEDINFO_EXCLUDE_URLS] return self.patterns def process_request(self, request): """Checks requested url against the list of excluded urls. :type request: :class:`django.http.HttpRequest` :return: False if path matches to any of the exclude urls :rtype: bool """ for pattern in self.get_patterns(): if pattern.match(request.path): return False return True def process_response(self, response): return True
StarcoderdataPython
1812883
import numpy as np import pandas as pd import pytest from pandas.testing import assert_frame_equal # from http://imachordata.com/2016/02/05/you-complete-me/ @pytest.fixture def df1(): return pd.DataFrame( { "Year": [1999, 2000, 2004, 1999, 2004], "Taxon": [ "Saccharina", "Saccharina", "Saccharina", "Agarum", "Agarum", ], "Abundance": [4, 5, 2, 1, 8], } ) def test_empty_column(df1): """Return dataframe if `columns` is empty.""" assert_frame_equal(df1.complete(), df1) def test_MultiIndex_column(df1): """Raise ValueError if column is a MultiIndex.""" df = df1 df.columns = [["A", "B", "C"], list(df.columns)] with pytest.raises(ValueError): df1.complete(["Year", "Taxon"]) def test_column_duplicated(df1): """Raise ValueError if column is duplicated in `columns`""" with pytest.raises(ValueError): df1.complete( columns=[ "Year", "Taxon", {"Year": lambda x: range(x.Year.min().x.Year.max() + 1)}, ] ) def test_type_columns(df1): """Raise error if columns is not a list object.""" with pytest.raises(TypeError): df1.complete(columns="Year") def test_fill_value_is_a_dict(df1): """Raise error if fill_value is not a dictionary""" with pytest.raises(TypeError): df1.complete(columns=["Year", "Taxon"], fill_value=0) def test_wrong_column_fill_value(df1): """Raise ValueError if column in `fill_value` does not exist.""" with pytest.raises(ValueError): df1.complete(columns=["Taxon", "Year"], fill_value={"year": 0}) def test_wrong_data_type_dict(df1): """ Raise ValueError if value in dictionary is not a 1-dimensional object. """ with pytest.raises(ValueError): df1.complete(columns=[{"Year": pd.DataFrame([2005, 2006, 2007])}]) frame = pd.DataFrame( { "Year": [1999, 2000, 2004, 1999, 2004], "Taxon": [ "Saccharina", "Saccharina", "Saccharina", "Agarum", "Agarum", ], "Abundance": [4, 5, 2, 1, 8], } ) wrong_columns = ( (frame, ["b", "Year"]), (frame, [{"Yayay": range(7)}]), (frame, ["Year", ["Abundant", "Taxon"]]), (frame, ["Year", ("Abundant", "Taxon")]), ) empty_sub_columns = [ (frame, ["Year", []]), (frame, ["Year", {}]), (frame, ["Year", ()]), ] @pytest.mark.parametrize("frame,wrong_columns", wrong_columns) def test_wrong_columns(frame, wrong_columns): """Test that ValueError is raised if wrong column is supplied.""" with pytest.raises(ValueError): frame.complete(columns=wrong_columns) @pytest.mark.parametrize("frame,empty_sub_cols", empty_sub_columns) def test_empty_subcols(frame, empty_sub_cols): """Raise ValueError for an empty group in columns""" with pytest.raises(ValueError): frame.complete(columns=empty_sub_cols) def test_fill_value(df1): """Test fill_value argument.""" output1 = pd.DataFrame( { "Year": [1999, 1999, 2000, 2000, 2004, 2004], "Taxon": [ "Agarum", "Saccharina", "Agarum", "Saccharina", "Agarum", "Saccharina", ], "Abundance": [1, 4.0, 0, 5, 8, 2], } ) result = df1.complete( columns=["Year", "Taxon"], fill_value={"Abundance": 0} ) assert_frame_equal(result, output1) @pytest.fixture def df1_output(): return pd.DataFrame( { "Year": [ 1999, 1999, 2000, 2000, 2001, 2001, 2002, 2002, 2003, 2003, 2004, 2004, ], "Taxon": [ "Agarum", "Saccharina", "Agarum", "Saccharina", "Agarum", "Saccharina", "Agarum", "Saccharina", "Agarum", "Saccharina", "Agarum", "Saccharina", ], "Abundance": [1.0, 4, 0, 5, 0, 0, 0, 0, 0, 0, 8, 2], } ) def test_fill_value_all_years(df1, df1_output): """ Test the complete function accurately replicates for all the years from 1999 to 2004. """ result = df1.complete( columns=[ {"Year": lambda x: range(x.Year.min(), x.Year.max() + 1)}, "Taxon", ], fill_value={"Abundance": 0}, ) assert_frame_equal(result, df1_output) def test_dict_series(df1, df1_output): """ Test the complete function if a dictionary containing a Series is present in `columns`. """ result = df1.complete( columns=[ { "Year": lambda x: pd.Series( range(x.Year.min(), x.Year.max() + 1) ) }, "Taxon", ], fill_value={"Abundance": 0}, ) assert_frame_equal(result, df1_output) def test_dict_series_duplicates(df1, df1_output): """ Test the complete function if a dictionary containing a Series (with duplicates) is present in `columns`. """ result = df1.complete( columns=[ { "Year": pd.Series( [1999, 2000, 2000, 2001, 2002, 2002, 2002, 2003, 2004] ) }, "Taxon", ], fill_value={"Abundance": 0}, ) assert_frame_equal(result, df1_output) def test_dict_values_outside_range(df1): """ Test the output if a dictionary is present, and none of the values in the dataframe, for the corresponding label, is not present in the dictionary's values. """ result = df1.complete( columns=[("Taxon", "Abundance"), {"Year": np.arange(2005, 2007)}] ) expected = pd.DataFrame( [ {"Taxon": "Agarum", "Abundance": 1, "Year": 1999}, {"Taxon": "Agarum", "Abundance": 1, "Year": 2005}, {"Taxon": "Agarum", "Abundance": 1, "Year": 2006}, {"Taxon": "Agarum", "Abundance": 8, "Year": 2004}, {"Taxon": "Agarum", "Abundance": 8, "Year": 2005}, {"Taxon": "Agarum", "Abundance": 8, "Year": 2006}, {"Taxon": "Saccharina", "Abundance": 2, "Year": 2004}, {"Taxon": "Saccharina", "Abundance": 2, "Year": 2005}, {"Taxon": "Saccharina", "Abundance": 2, "Year": 2006}, {"Taxon": "Saccharina", "Abundance": 4, "Year": 1999}, {"Taxon": "Saccharina", "Abundance": 4, "Year": 2005}, {"Taxon": "Saccharina", "Abundance": 4, "Year": 2006}, {"Taxon": "Saccharina", "Abundance": 5, "Year": 2000}, {"Taxon": "Saccharina", "Abundance": 5, "Year": 2005}, {"Taxon": "Saccharina", "Abundance": 5, "Year": 2006}, ] ) assert_frame_equal(result, expected) # adapted from https://tidyr.tidyverse.org/reference/complete.html complete_parameters = [ ( pd.DataFrame( { "group": [1, 2, 1], "item_id": [1, 2, 2], "item_name": ["a", "b", "b"], "value1": [1, 2, 3], "value2": [4, 5, 6], } ), ["group", "item_id", "item_name"], pd.DataFrame( { "group": [1, 1, 1, 1, 2, 2, 2, 2], "item_id": [1, 1, 2, 2, 1, 1, 2, 2], "item_name": ["a", "b", "a", "b", "a", "b", "a", "b"], "value1": [ 1.0, np.nan, np.nan, 3.0, np.nan, np.nan, np.nan, 2.0, ], "value2": [ 4.0, np.nan, np.nan, 6.0, np.nan, np.nan, np.nan, 5.0, ], } ), ), ( pd.DataFrame( { "group": [1, 2, 1], "item_id": [1, 2, 2], "item_name": ["a", "b", "b"], "value1": [1, 2, 3], "value2": [4, 5, 6], } ), ["group", ("item_id", "item_name")], pd.DataFrame( { "group": [1, 1, 2, 2], "item_id": [1, 2, 1, 2], "item_name": ["a", "b", "a", "b"], "value1": [1.0, 3.0, np.nan, 2.0], "value2": [4.0, 6.0, np.nan, 5.0], } ), ), ] @pytest.mark.parametrize("df,columns,output", complete_parameters) def test_complete(df, columns, output): "Test the complete function, with and without groupings." assert_frame_equal(df.complete(columns), output) @pytest.fixture def duplicates(): return pd.DataFrame( { "row": [ "21.08.2020", "21.08.2020", "21.08.2020", "21.08.2020", "22.08.2020", "22.08.2020", "22.08.2020", "22.08.2020", ], "column": ["A", "A", "B", "C", "A", "B", "B", "C"], "value": [43.0, 36, 36, 28, 16, 40, 34, 0], } ) # https://stackoverflow.com/questions/63541729/ # pandas-how-to-include-all-columns-for-all-rows-although-value-is-missing-in-a-d # /63543164#63543164 def test_duplicates(duplicates): """Test that the complete function works for duplicate values.""" df = pd.DataFrame( { "row": { 0: "21.08.2020", 1: "21.08.2020", 2: "21.08.2020", 3: "21.08.2020", 4: "22.08.2020", 5: "22.08.2020", 6: "22.08.2020", }, "column": {0: "A", 1: "A", 2: "B", 3: "C", 4: "A", 5: "B", 6: "B"}, "value": {0: 43, 1: 36, 2: 36, 3: 28, 4: 16, 5: 40, 6: 34}, } ) result = df.complete(columns=["row", "column"], fill_value={"value": 0}) assert_frame_equal(result, duplicates) def test_unsorted_duplicates(duplicates): """Test output for unsorted duplicates.""" df = pd.DataFrame( { "row": { 0: "22.08.2020", 1: "22.08.2020", 2: "21.08.2020", 3: "21.08.2020", 4: "21.08.2020", 5: "21.08.2020", 6: "22.08.2020", }, "column": { 0: "B", 1: "B", 2: "A", 3: "A", 4: "B", 5: "C", 6: "A", }, "value": {0: 40, 1: 34, 2: 43, 3: 36, 4: 36, 5: 28, 6: 16}, } ) result = df.complete(columns=["row", "column"], fill_value={"value": 0}) assert_frame_equal(result, duplicates) # https://stackoverflow.com/questions/32874239/ # how-do-i-use-tidyr-to-fill-in-completed-rows-within-each-value-of-a-grouping-var def test_grouping_first_columns(): """ Test complete function when the first entry in columns is a grouping. """ df2 = pd.DataFrame( { "id": [1, 2, 3], "choice": [5, 6, 7], "c": [9.0, np.nan, 11.0], "d": [ pd.NaT, pd.Timestamp("2015-09-30 00:00:00"), pd.Timestamp("2015-09-29 00:00:00"), ], } ) output2 = pd.DataFrame( { "id": [1, 1, 1, 2, 2, 2, 3, 3, 3], "c": [9.0, 9.0, 9.0, np.nan, np.nan, np.nan, 11.0, 11.0, 11.0], "d": [ pd.NaT, pd.NaT, pd.NaT, pd.Timestamp("2015-09-30 00:00:00"), pd.Timestamp("2015-09-30 00:00:00"), pd.Timestamp("2015-09-30 00:00:00"), pd.Timestamp("2015-09-29 00:00:00"), pd.Timestamp("2015-09-29 00:00:00"), pd.Timestamp("2015-09-29 00:00:00"), ], "choice": [5, 6, 7, 5, 6, 7, 5, 6, 7], } ) result = df2.complete(columns=[("id", "c", "d"), "choice"]) assert_frame_equal(result, output2) # https://stackoverflow.com/questions/48914323/tidyr-complete-cases-nesting-misunderstanding def test_complete_multiple_groupings(): """Test that `complete` gets the correct output for multiple groupings.""" df3 = pd.DataFrame( { "project_id": [1, 1, 1, 1, 2, 2, 2], "meta": ["A", "A", "B", "B", "A", "B", "C"], "domain1": ["d", "e", "h", "i", "d", "i", "k"], "question_count": [3, 3, 3, 3, 2, 2, 2], "tag_count": [2, 1, 3, 2, 1, 1, 2], } ) output3 = pd.DataFrame( { "meta": ["A", "A", "A", "A", "B", "B", "B", "B", "C", "C"], "domain1": ["d", "d", "e", "e", "h", "h", "i", "i", "k", "k"], "project_id": [1, 2, 1, 2, 1, 2, 1, 2, 1, 2], "question_count": [3, 2, 3, 2, 3, 2, 3, 2, 3, 2], "tag_count": [2.0, 1.0, 1.0, 0.0, 3.0, 0.0, 2.0, 1.0, 0.0, 2.0], } ) result = df3.complete( columns=[("meta", "domain1"), ("project_id", "question_count")], fill_value={"tag_count": 0}, ) assert_frame_equal(result, output3) @pytest.fixture def output_dict_tuple(): return pd.DataFrame( [ {"Year": 1999, "Taxon": "Agarum", "Abundance": 1}, {"Year": 1999, "Taxon": "Agarum", "Abundance": 8}, {"Year": 1999, "Taxon": "Saccharina", "Abundance": 2}, {"Year": 1999, "Taxon": "Saccharina", "Abundance": 4}, {"Year": 1999, "Taxon": "Saccharina", "Abundance": 5}, {"Year": 2000, "Taxon": "Agarum", "Abundance": 1}, {"Year": 2000, "Taxon": "Agarum", "Abundance": 8}, {"Year": 2000, "Taxon": "Saccharina", "Abundance": 2}, {"Year": 2000, "Taxon": "Saccharina", "Abundance": 4}, {"Year": 2000, "Taxon": "Saccharina", "Abundance": 5}, {"Year": 2001, "Taxon": "Agarum", "Abundance": 1}, {"Year": 2001, "Taxon": "Agarum", "Abundance": 8}, {"Year": 2001, "Taxon": "Saccharina", "Abundance": 2}, {"Year": 2001, "Taxon": "Saccharina", "Abundance": 4}, {"Year": 2001, "Taxon": "Saccharina", "Abundance": 5}, {"Year": 2002, "Taxon": "Agarum", "Abundance": 1}, {"Year": 2002, "Taxon": "Agarum", "Abundance": 8}, {"Year": 2002, "Taxon": "Saccharina", "Abundance": 2}, {"Year": 2002, "Taxon": "Saccharina", "Abundance": 4}, {"Year": 2002, "Taxon": "Saccharina", "Abundance": 5}, {"Year": 2003, "Taxon": "Agarum", "Abundance": 1}, {"Year": 2003, "Taxon": "Agarum", "Abundance": 8}, {"Year": 2003, "Taxon": "Saccharina", "Abundance": 2}, {"Year": 2003, "Taxon": "Saccharina", "Abundance": 4}, {"Year": 2003, "Taxon": "Saccharina", "Abundance": 5}, {"Year": 2004, "Taxon": "Agarum", "Abundance": 1}, {"Year": 2004, "Taxon": "Agarum", "Abundance": 8}, {"Year": 2004, "Taxon": "Saccharina", "Abundance": 2}, {"Year": 2004, "Taxon": "Saccharina", "Abundance": 4}, {"Year": 2004, "Taxon": "Saccharina", "Abundance": 5}, ] ) def test_dict_tuple(df1, output_dict_tuple): """ Test if a dictionary and a tuple/list are included in the `columns` parameter. """ result = df1.complete( columns=[ {"Year": lambda x: range(x.Year.min(), x.Year.max() + 1)}, ("Taxon", "Abundance"), ] ) assert_frame_equal(result, output_dict_tuple) def test_complete_groupby(): """Test output in the presence of a groupby.""" df = pd.DataFrame( { "state": ["CA", "CA", "HI", "HI", "HI", "NY", "NY"], "year": [2010, 2013, 2010, 2012, 2016, 2009, 2013], "value": [1, 3, 1, 2, 3, 2, 5], } ) result = df.complete( columns=[{"year": lambda x: range(x.year.min(), x.year.max() + 1)}], by="state", ) expected = pd.DataFrame( [ {"state": "CA", "year": 2010, "value": 1.0}, {"state": "CA", "year": 2011, "value": np.nan}, {"state": "CA", "year": 2012, "value": np.nan}, {"state": "CA", "year": 2013, "value": 3.0}, {"state": "HI", "year": 2010, "value": 1.0}, {"state": "HI", "year": 2011, "value": np.nan}, {"state": "HI", "year": 2012, "value": 2.0}, {"state": "HI", "year": 2013, "value": np.nan}, {"state": "HI", "year": 2014, "value": np.nan}, {"state": "HI", "year": 2015, "value": np.nan}, {"state": "HI", "year": 2016, "value": 3.0}, {"state": "NY", "year": 2009, "value": 2.0}, {"state": "NY", "year": 2010, "value": np.nan}, {"state": "NY", "year": 2011, "value": np.nan}, {"state": "NY", "year": 2012, "value": np.nan}, {"state": "NY", "year": 2013, "value": 5.0}, ] ) assert_frame_equal(result, expected)
StarcoderdataPython
4963647
<filename>tests/base.py # -*- coding: utf-8 -*- import base64 import cherrypy import io import json import logging import os import shutil import signal import sys import unittest import urllib.parse import warnings from girder.utility._cache import cache, requestCache from girder.utility.server import setup as setupServer from girder.constants import AccessType, ROOT_DIR, ServerMode from girder.models import getDbConnection from girder.models.model_base import _modelSingletons from girder.models.assetstore import Assetstore from girder.models.file import File from girder.models.setting import Setting from girder.models.token import Token from girder.settings import SettingKey from . import mock_smtp from . import mock_s3 from . import mongo_replicaset with warnings.catch_warnings(): warnings.filterwarnings('ignore', 'setup_database.*') from . import setup_database local = cherrypy.lib.httputil.Host('127.0.0.1', 30000) remote = cherrypy.lib.httputil.Host('127.0.0.1', 30001) mockSmtp = mock_smtp.MockSmtpReceiver() mockS3Server = None enabledPlugins = [] usedDBs = {} def startServer(mock=True, mockS3=False): """ Test cases that communicate with the server should call this function in their setUpModule() function. """ # If the server starts, a database will exist and we can remove it later dbName = cherrypy.config['database']['uri'].split('/')[-1] usedDBs[dbName] = True # By default, this passes "[]" to "plugins", disabling any installed plugins server = setupServer(mode=ServerMode.TESTING, plugins=enabledPlugins) if mock: cherrypy.server.unsubscribe() cherrypy.engine.start() # Make server quiet (won't announce start/stop or requests) cherrypy.config.update({'environment': 'embedded'}) # Log all requests if we asked to do so if 'cherrypy' in os.environ.get('EXTRADEBUG', '').split(): cherrypy.config.update({'log.screen': True}) logHandler = logging.StreamHandler(sys.stdout) logHandler.setLevel(logging.DEBUG) cherrypy.log.error_log.addHandler(logHandler) # Tell CherryPy to throw exceptions in request handling code cherrypy.config.update({'request.throw_errors': True}) mockSmtp.start() if mockS3: global mockS3Server mockS3Server = mock_s3.startMockS3Server() return server def stopServer(): """ Test cases that communicate with the server should call this function in their tearDownModule() function. """ cherrypy.engine.exit() mockSmtp.stop() dropAllTestDatabases() def dropAllTestDatabases(): """ Unless otherwise requested, drop all test databases. """ if 'keepdb' not in os.environ.get('EXTRADEBUG', '').split(): db_connection = getDbConnection() for dbName in usedDBs: db_connection.drop_database(dbName) usedDBs.clear() def dropTestDatabase(dropModels=True): """ Call this to clear all contents from the test database. Also forces models to reload. """ db_connection = getDbConnection() dbName = cherrypy.config['database']['uri'].split('/')[-1] if 'girder_test_' not in dbName: raise Exception('Expected a testing database name, but got %s' % dbName) if dbName in db_connection.list_database_names(): if dbName not in usedDBs and 'newdb' in os.environ.get('EXTRADEBUG', '').split(): raise Exception('Warning: database %s already exists' % dbName) db_connection.drop_database(dbName) usedDBs[dbName] = True if dropModels: for model in _modelSingletons: model.reconnect() def dropGridFSDatabase(dbName): """ Clear all contents from a gridFS database used as an assetstore. :param dbName: the name of the database to drop. """ db_connection = getDbConnection() if dbName in db_connection.list_database_names(): if dbName not in usedDBs and 'newdb' in os.environ.get('EXTRADEBUG', '').split(): raise Exception('Warning: database %s already exists' % dbName) db_connection.drop_database(dbName) usedDBs[dbName] = True def dropFsAssetstore(path): """ Delete all of the files in a filesystem assetstore. This unlinks the path, which is potentially dangerous. :param path: the path to remove. """ if os.path.isdir(path): shutil.rmtree(path) class TestCase(unittest.TestCase): """ Test case base class for the application. Adds helpful utilities for database and HTTP communication. """ def setUp(self, assetstoreType=None, dropModels=True): """ We want to start with a clean database each time, so we drop the test database before each test. We then add an assetstore so the file model can be used without 500 errors. :param assetstoreType: if 'gridfs' or 's3', use that assetstore. 'gridfsrs' uses a GridFS assetstore with a replicaset. For any other value, use a filesystem assetstore. """ self.assetstoreType = assetstoreType dropTestDatabase(dropModels=dropModels) assetstoreName = os.environ.get('GIRDER_TEST_ASSETSTORE', 'test') assetstorePath = os.path.join( ROOT_DIR, 'tests', 'assetstore', assetstoreName) if assetstoreType == 'gridfs': # Name this as '_auto' to prevent conflict with assetstores created # within test methods gridfsDbName = 'girder_test_%s_assetstore_auto' % assetstoreName.replace('.', '_') dropGridFSDatabase(gridfsDbName) self.assetstore = Assetstore().createGridFsAssetstore(name='Test', db=gridfsDbName) elif assetstoreType == 'gridfsrs': gridfsDbName = 'girder_test_%s_rs_assetstore_auto' % assetstoreName self.replicaSetConfig = mongo_replicaset.makeConfig() mongo_replicaset.startMongoReplicaSet(self.replicaSetConfig) self.assetstore = Assetstore().createGridFsAssetstore( name='Test', db=gridfsDbName, mongohost='mongodb://127.0.0.1:27070,127.0.0.1:27071,' '127.0.0.1:27072', replicaset='replicaset') elif assetstoreType == 's3': self.assetstore = Assetstore().createS3Assetstore( name='Test', bucket='bucketname', accessKeyId='test', secret='test', service=mockS3Server.service) else: dropFsAssetstore(assetstorePath) self.assetstore = Assetstore().createFilesystemAssetstore( name='Test', root=assetstorePath) host, port = mockSmtp.address or ('localhost', 25) Setting().set(SettingKey.SMTP_HOST, host) Setting().set(SettingKey.SMTP_PORT, port) Setting().set(SettingKey.UPLOAD_MINIMUM_CHUNK_SIZE, 0) if os.environ.get('GIRDER_TEST_DATABASE_CONFIG'): setup_database.main(os.environ['GIRDER_TEST_DATABASE_CONFIG']) def tearDown(self): """ Stop any services that we started just for this test. """ # If "self.setUp" is overridden, "self.assetstoreType" may not be set if getattr(self, 'assetstoreType', None) == 'gridfsrs': mongo_replicaset.stopMongoReplicaSet(self.replicaSetConfig) # Invalidate cache regions which persist across tests cache.invalidate() requestCache.invalidate() def assertStatusOk(self, response): """ Call this to assert that the response yielded a 200 OK output_status. :param response: The response object. """ self.assertStatus(response, 200) def assertStatus(self, response, code): """ Call this to assert that a given HTTP status code was returned. :param response: The response object. :param code: The status code. :type code: int or str """ code = str(code) if not response.output_status.startswith(code.encode()): msg = 'Response status was %s, not %s.' % (response.output_status, code) if hasattr(response, 'json'): msg += ' Response body was:\n%s' % json.dumps( response.json, sort_keys=True, indent=4, separators=(',', ': ')) else: msg += 'Response body was:\n%s' % self.getBody(response) self.fail(msg) def assertDictContains(self, expected, actual, msg=''): """ Assert that an object is a subset of another. This test will fail under the following conditions: 1. ``actual`` is not a dictionary. 2. ``expected`` contains a key not in ``actual``. 3. for any key in ``expected``, ``expected[key] != actual[key]`` :param test: The expected key/value pairs :param actual: The actual object :param msg: An optional message to include with test failures """ self.assertIsInstance(actual, dict, msg + ' does not exist') for k, v in expected.items(): if k not in actual: self.fail('%s expected key "%s"' % (msg, k)) self.assertEqual(v, actual[k]) def assertHasKeys(self, obj, keys): """ Assert that the given object has the given list of keys. :param obj: The dictionary object. :param keys: The keys it must contain. :type keys: list or tuple """ for k in keys: self.assertTrue(k in obj, 'Object does not contain key "%s"' % k) def assertRedirect(self, resp, url=None): """ Assert that we were given an HTTP redirect response, and optionally assert that you were redirected to a specific URL. :param resp: The response object. :param url: If you know the URL you expect to be redirected to, you should pass it here. :type url: str """ self.assertStatus(resp, 303) self.assertTrue('Location' in resp.headers) if url: self.assertEqual(url, resp.headers['Location']) def assertNotHasKeys(self, obj, keys): """ Assert that the given object does not have any of the given list of keys. :param obj: The dictionary object. :param keys: The keys it must not contain. :type keys: list or tuple """ for k in keys: self.assertFalse(k in obj, 'Object contains key "%s"' % k) def assertValidationError(self, response, field=None): """ Assert that a ValidationException was thrown with the given field. :param response: The response object. :param field: The field that threw the validation exception. :type field: str """ self.assertStatus(response, 400) self.assertEqual(response.json['type'], 'validation') self.assertEqual(response.json.get('field', None), field) def assertAccessDenied(self, response, level, modelName, user=None): if level == AccessType.READ: ls = 'Read' elif level == AccessType.WRITE: ls = 'Write' else: ls = 'Admin' if user is None: self.assertStatus(response, 401) else: self.assertStatus(response, 403) self.assertEqual('%s access denied for %s.' % (ls, modelName), response.json['message']) def assertMissingParameter(self, response, param): """ Assert that the response was a "parameter missing" error response. :param response: The response object. :param param: The name of the missing parameter. :type param: str """ self.assertEqual('Parameter "%s" is required.' % param, response.json.get('message', '')) self.assertStatus(response, 400) def getSseMessages(self, resp): messages = self.getBody(resp).strip().split('\n\n') if not messages or messages == ['']: return () return [json.loads(m.replace('data: ', '')) for m in messages] def uploadFile(self, name, contents, user, parent, parentType='folder', mimeType=None): """ Upload a file. This is meant for small testing files, not very large files that should be sent in multiple chunks. :param name: The name of the file. :type name: str :param contents: The file contents :type contents: str :param user: The user performing the upload. :type user: dict :param parent: The parent document. :type parent: dict :param parentType: The type of the parent ("folder" or "item") :type parentType: str :param mimeType: Explicit MIME type to set on the file. :type mimeType: str :returns: The file that was created. :rtype: dict """ mimeType = mimeType or 'application/octet-stream' resp = self.request( path='/file', method='POST', user=user, params={ 'parentType': parentType, 'parentId': str(parent['_id']), 'name': name, 'size': len(contents), 'mimeType': mimeType }) self.assertStatusOk(resp) resp = self.request( path='/file/chunk', method='POST', user=user, body=contents, params={ 'uploadId': resp.json['_id'] }, type=mimeType) self.assertStatusOk(resp) file = resp.json self.assertHasKeys(file, ['itemId']) self.assertEqual(file['name'], name) self.assertEqual(file['size'], len(contents)) self.assertEqual(file['mimeType'], mimeType) return File().load(file['_id'], force=True) def ensureRequiredParams(self, path='/', method='GET', required=(), user=None): """ Ensure that a set of parameters is required by the endpoint. :param path: The endpoint path to test. :param method: The HTTP method of the endpoint. :param required: The required parameter set. :type required: sequence of str """ for exclude in required: params = dict.fromkeys([p for p in required if p != exclude], '') resp = self.request(path=path, method=method, params=params, user=user) self.assertMissingParameter(resp, exclude) def _genToken(self, user): """ Helper method for creating an authentication token for the user. """ token = Token().createToken(user) return str(token['_id']) def _buildHeaders(self, headers, cookie, user, token, basicAuth, authHeader): if cookie is not None: headers.append(('Cookie', cookie)) if user is not None: headers.append(('Girder-Token', self._genToken(user))) elif token is not None: if isinstance(token, dict): headers.append(('Girder-Token', token['_id'])) else: headers.append(('Girder-Token', token)) if basicAuth is not None: auth = base64.b64encode(basicAuth.encode('utf8')) headers.append((authHeader, 'Basic %s' % auth.decode())) def request(self, path='/', method='GET', params=None, user=None, prefix='/api/v1', isJson=True, basicAuth=None, body=None, type=None, exception=False, cookie=None, token=None, additionalHeaders=None, useHttps=False, authHeader='Authorization', appPrefix=''): """ Make an HTTP request. :param path: The path part of the URI. :type path: str :param method: The HTTP method. :type method: str :param params: The HTTP parameters. :type params: dict :param prefix: The prefix to use before the path. :param isJson: Whether the response is a JSON object. :param basicAuth: A string to pass with the Authorization: Basic header of the form 'login:password' :param exception: Set this to True if a 500 is expected from this call. :param cookie: A custom cookie value to set. :param token: If you want to use an existing token to login, pass the token ID. :type token: str :param additionalHeaders: A list of headers to add to the request. Each item is a tuple of the form (header-name, header-value). :param useHttps: If True, pretend to use HTTPS. :param authHeader: The HTTP request header to use for authentication. :type authHeader: str :param appPrefix: The CherryPy application prefix (mounted location without trailing slash) :type appPrefix: str :returns: The cherrypy response object from the request. """ headers = [('Host', '127.0.0.1'), ('Accept', 'application/json')] qs = fd = None if additionalHeaders: headers.extend(additionalHeaders) if isinstance(body, str): body = body.encode('utf8') if params: qs = urllib.parse.urlencode(params) if params and body: # In this case, we are forced to send params in query string fd = io.BytesIO(body) headers.append(('Content-Type', type)) headers.append(('Content-Length', '%d' % len(body))) elif method in ['POST', 'PUT', 'PATCH'] or body: if type: qs = body elif params: qs = qs.encode('utf8') headers.append(('Content-Type', type or 'application/x-www-form-urlencoded')) headers.append(('Content-Length', '%d' % len(qs or b''))) fd = io.BytesIO(qs or b'') qs = None app = cherrypy.tree.apps[appPrefix] request, response = app.get_serving( local, remote, 'http' if not useHttps else 'https', 'HTTP/1.1') request.show_tracebacks = True self._buildHeaders(headers, cookie, user, token, basicAuth, authHeader) url = prefix + path try: response = request.run(method, url, qs, 'HTTP/1.1', headers, fd) finally: if fd: fd.close() if isJson: body = self.getBody(response) try: response.json = json.loads(body) except ValueError: raise AssertionError('Received non-JSON response: ' + body) if not exception and response.output_status.startswith(b'500'): raise AssertionError('Internal server error: %s' % self.getBody(response)) return response def getBody(self, response, text=True): """ Returns the response body as a text type or binary string. :param response: The response object from the server. :param text: If true, treat the data as a text string, otherwise, treat as binary. """ data = '' if text else b'' for chunk in response.body: if text and isinstance(chunk, bytes): chunk = chunk.decode('utf8') elif not text and not isinstance(chunk, bytes): chunk = chunk.encode('utf8') data += chunk return data def _sigintHandler(*args): print('Received SIGINT, shutting down mock SMTP server...') mockSmtp.stop() sys.exit(1) signal.signal(signal.SIGINT, _sigintHandler) # If we insist on test databases not existing when we start, make sure we # check right away. if 'newdb' in os.environ.get('EXTRADEBUG', '').split(): dropTestDatabase(False)
StarcoderdataPython
4897773
from keycloakclient.mixins import WellKnownMixin try: from urllib.parse import urlencode # noqa: F041 except ImportError: from urllib import urlencode # noqa: F041 from jose import jwt PATH_WELL_KNOWN = "auth/realms/{}/.well-known/openid-configuration" class KeycloakOpenidConnect(WellKnownMixin): _well_known = None _client_id = None _client_secret = None _realm = None def __init__(self, realm, client_id, client_secret): """ :param keycloak.realm.KeycloakRealm realm: :param str client_id: :param str client_secret: """ self._client_id = client_id self._client_secret = client_secret self._realm = realm def get_path_well_known(self): return PATH_WELL_KNOWN def get_url(self, name): return self.well_known[name] def decode_token(self, token, key, algorithms=None, **kwargs): """ A JSON Web Key (JWK) is a JavaScript Object Notation (JSON) data structure that represents a cryptographic key. This specification also defines a JWK Set JSON data structure that represents a set of JWKs. Cryptographic algorithms and identifiers for use with this specification are described in the separate JSON Web Algorithms (JWA) specification and IANA registries established by that specification. https://tools.ietf.org/html/rfc7517 :param str token: A signed JWS to be verified. :param str key: A key to attempt to verify the payload with. :param str,list algorithms: (optional) Valid algorithms that should be used to verify the JWS. Defaults to `['RS256']` :param str audience: (optional) The intended audience of the token. If the "aud" claim is included in the claim set, then the audience must be included and must equal the provided claim. :param str,iterable issuer: (optional) Acceptable value(s) for the issuer of the token. If the "iss" claim is included in the claim set, then the issuer must be given and the claim in the token must be among the acceptable values. :param str subject: (optional) The subject of the token. If the "sub" claim is included in the claim set, then the subject must be included and must equal the provided claim. :param str access_token: (optional) An access token returned alongside the id_token during the authorization grant flow. If the "at_hash" claim is included in the claim set, then the access_token must be included, and it must match the "at_hash" claim. :param dict options: (optional) A dictionary of options for skipping validation steps. defaults: .. code-block:: python { 'verify_signature': True, 'verify_aud': True, 'verify_iat': True, 'verify_exp': True, 'verify_nbf': True, 'verify_iss': True, 'verify_sub': True, 'verify_jti': True, 'leeway': 0, } :return: The dict representation of the claims set, assuming the signature is valid and all requested data validation passes. :rtype: dict :raises jose.exceptions.JWTError: If the signature is invalid in any way. :raises jose.exceptions.ExpiredSignatureError: If the signature has expired. :raises jose.exceptions.JWTClaimsError: If any claim is invalid in any way. """ return jwt.decode( token, key, audience=kwargs.pop('audience', None) or self._client_id, algorithms=algorithms or ['RS256'], **kwargs ) def logout(self, refresh_token): """ The logout endpoint logs out the authenticated user. :param str refresh_token: """ return self._realm.client.post(self.get_url('end_session_endpoint'), data={ 'refresh_token': refresh_token, 'client_id': self._client_id, 'client_secret': self._client_secret }) def certs(self): """ The certificate endpoint returns the public keys enabled by the realm, encoded as a JSON Web Key (JWK). Depending on the realm settings there can be one or more keys enabled for verifying tokens. https://tools.ietf.org/html/rfc7517 :rtype: dict """ return self._realm.client.get(self.get_url('jwks_uri')) def userinfo(self, token): """ The UserInfo Endpoint is an OAuth 2.0 Protected Resource that returns Claims about the authenticated End-User. To obtain the requested Claims about the End-User, the Client makes a request to the UserInfo Endpoint using an Access Token obtained through OpenID Connect Authentication. These Claims are normally represented by a JSON object that contains a collection of name and value pairs for the Claims. http://openid.net/specs/openid-connect-core-1_0.html#UserInfo :param str token: :rtype: dict """ url = self.well_known['userinfo_endpoint'] return self._realm.client.get(url, headers={ "Authorization": "Bearer {}".format( token ) }) def uma_ticket(self, token, **kwargs): """ :param str audience: (optional) Client ID to get te permissions for. :rtype: dict """ payload = {"grant_type": "urn:ietf:params:oauth:grant-type:uma-ticket"} payload.update(**kwargs) return self._realm.client.post( self.get_url("token_endpoint"), payload, headers={"Authorization": "Bearer {}".format(token)} ) def authorization_url(self, **kwargs): """ Get authorization URL to redirect the resource owner to. https://tools.ietf.org/html/rfc6749#section-4.1.1 :param str redirect_uri: (optional) Absolute URL of the client where the user-agent will be redirected to. :param str scope: (optional) Space delimited list of strings. :param str state: (optional) An opaque value used by the client to maintain state between the request and callback :return: URL to redirect the resource owner to :rtype: str """ payload = {'response_type': 'code', 'client_id': self._client_id} for key in kwargs.keys(): # Add items in a sorted way for unittest purposes. payload[key] = kwargs[key] payload = sorted(payload.items(), key=lambda val: val[0]) params = urlencode(payload) url = self.get_url('authorization_endpoint') return '{}?{}'.format(url, params) def authorization_code(self, code, redirect_uri): """ Retrieve access token by `authorization_code` grant. https://tools.ietf.org/html/rfc6749#section-4.1.3 :param str code: The authorization code received from the authorization server. :param str redirect_uri: the identical value of the "redirect_uri" parameter in the authorization request. :rtype: dict :return: Access token response """ return self._token_request(grant_type='authorization_code', code=code, redirect_uri=redirect_uri) def password_credentials(self, username, password, **kwargs): """ Retrieve access token by 'password credentials' grant. https://tools.ietf.org/html/rfc6749#section-4.3 :param str username: The user name to obtain an access token for :param str password: <PASSWORD> :rtype: dict :return: Access token response """ return self._token_request(grant_type='password', username=username, password=password, **kwargs) def client_credentials(self, **kwargs): """ Retrieve access token by `client_credentials` grant. https://tools.ietf.org/html/rfc6749#section-4.4 :param str scope: (optional) Space delimited list of strings. :rtype: dict :return: Access token response """ return self._token_request(grant_type='client_credentials', **kwargs) def refresh_token(self, refresh_token, **kwargs): """ Refresh an access token https://tools.ietf.org/html/rfc6749#section-6 :param str refresh_token: :param str scope: (optional) Space delimited list of strings. :rtype: dict :return: Access token response """ return self._token_request(grant_type='refresh_token', refresh_token=refresh_token, **kwargs) def token_exchange(self, **kwargs): """ Token exchange is the process of using a set of credentials or token to obtain an entirely different token. http://www.keycloak.org/docs/latest/securing_apps/index.html #_token-exchange https://www.ietf.org/id/draft-ietf-oauth-token-exchange-12.txt :param subject_token: A security token that represents the identity of the party on behalf of whom the request is being made. It is required if you are exchanging an existing token for a new one. :param subject_issuer: Identifies the issuer of the subject_token. It can be left blank if the token comes from the current realm or if the issuer can be determined from the subject_token_type. Otherwise it is required to be specified. Valid values are the alias of an Identity Provider configured for your realm. Or an issuer claim identifier configured by a specific Identity Provider. :param subject_token_type: This parameter is the type of the token passed with the subject_token parameter. This defaults to urn:ietf:params:oauth:token-type:access_token if the subject_token comes from the realm and is an access token. If it is an external token, this parameter may or may not have to be specified depending on the requirements of the subject_issuer. :param requested_token_type: This parameter represents the type of token the client wants to exchange for. Currently only oauth and OpenID Connect token types are supported. The default value for this depends on whether the is urn:ietf:params:oauth:token-type:refresh_token in which case you will be returned both an access token and refresh token within the response. Other appropriate values are urn:ietf:params:oauth:token-type:access_token and urn:ietf:params:oauth:token-type:id_token :param audience: This parameter specifies the target client you want the new token minted for. :param requested_issuer: This parameter specifies that the client wants a token minted by an external provider. It must be the alias of an Identity Provider configured within the realm. :param requested_subject: This specifies a username or user id if your client wants to impersonate a different user. :rtype: dict :return: access_token, refresh_token and expires_in """ return self._token_request( grant_type='urn:ietf:params:oauth:grant-type:token-exchange', **kwargs ) def _token_request(self, grant_type, **kwargs): """ Do the actual call to the token end-point. :param grant_type: :param kwargs: See invoking methods. :return: """ payload = { 'grant_type': grant_type, 'client_id': self._client_id, 'client_secret': self._client_secret } payload.update(**kwargs) return self._realm.client.post(self.get_url('token_endpoint'), data=payload)
StarcoderdataPython
6492390
<reponame>Extreme-classification/ECLARE # Example to evaluate import sys import xclib.evaluation.xc_metrics as xc_metrics import xclib.data.data_utils as data_utils from scipy.sparse import load_npz import scipy.sparse as sparse import numpy as np import json import os def load_overlap(data_dir, filter_label_file='filter_labels.txt'): docs = np.asarray([]) lbs = np.asarray([]) if os.path.exists(os.path.join(data_dir, filter_label_file)): filter_lbs = np.loadtxt(os.path.join( data_dir, filter_label_file), dtype=np.int32) if filter_lbs.size > 0: docs = filter_lbs[:, 0] lbs = filter_lbs[:, 1] else: print("Overlap not found") print("Overlap is:", docs.size) return docs, lbs def _remove_overlap(score_mat, docs, lbs): score_mat[docs, lbs] = 0 score_mat = score_mat.tocsr() score_mat.eliminate_zeros() return score_mat def main(targets_label_file, train_label_file, predictions_file, A, B, docs, lbls): true_labels = _remove_overlap( data_utils.read_sparse_file( targets_label_file, force_header=True).tolil(), docs, lbls) trn_labels = data_utils.read_sparse_file( train_label_file, force_header=True) inv_propen = xc_metrics.compute_inv_propesity(trn_labels, A=A, B=B) acc = xc_metrics.Metrics( true_labels, inv_psp=inv_propen, remove_invalid=False) predicted_labels = _remove_overlap( load_npz(predictions_file+'.npz').tolil(), docs, lbls) rec = xc_metrics.recall(predicted_labels, true_labels, k=10)[-1]*100 print("R@10=%0.2f" % (rec)) args = acc.eval(predicted_labels, 5) print(xc_metrics.format(*args)) if __name__ == '__main__': train_label_file = sys.argv[1] targets_file = sys.argv[2] # Usually test data file predictions_file = sys.argv[3] # In mat format data_dir=sys.argv[4] configs = json.load(open(sys.argv[5]))["DEFAULT"] A = configs["A"] B = configs["B"] filter_data = configs["filter_labels"] docs, lbls = load_overlap(data_dir, filter_label_file=filter_data) main(targets_file, train_label_file, predictions_file, A, B, docs, lbls)
StarcoderdataPython
11357904
<reponame>cxiang26/mygluon_cv<gh_stars>10-100 # -*- coding: utf-8 -*- """Fully Convolutional One-Stage Object Detection.""" from __future__ import absolute_import import os import warnings import numpy as np import mxnet as mx from mxnet import autograd from mxnet.gluon import nn, HybridBlock from ...nn.bbox import BBoxClipToImage # from IPython import embed from .fcos_target import FCOSBoxConverter from ...nn.feature import RetinaFeatureExpander from ...nn.protomask import Protonet __all__ = ['MaskFCOS', 'get_maskfcos', 'maskfcos_resnet50_v1_740_coco', 'maskfcos_resnet50_v1b_740_coco', 'maskfcos_resnet101_v1d_740_coco', 'maskfcos_resnet50_v1_1024_coco'] class GroupNorm(nn.HybridBlock): """ If the batch size is small, it's better to use GroupNorm instead of BatchNorm. GroupNorm achieves good results even at small batch sizes. Reference: https://arxiv.org/pdf/1803.08494.pdf """ def __init__(self, num_channels, num_groups=32, eps=1e-5, multi_precision=False, prefix=None, **kwargs): super(GroupNorm, self).__init__(**kwargs) with self.name_scope(): self.weight = self.params.get('{}_weight'.format(prefix), grad_req='write', shape=(1, num_channels, 1, 1)) self.bias = self.params.get('{}_bias'.format(prefix), grad_req='write', shape=(1, num_channels, 1, 1)) self.C = num_channels self.G = num_groups self.eps = eps self.multi_precision = multi_precision assert self.C % self.G == 0 def hybrid_forward(self, F, x, weight, bias): # (N,C,H,W) -> (N,G,H*W*C//G) x_new = F.reshape(x, (0, self.G, -1)) if self.multi_precision: # (N,G,H*W*C//G) -> (N,G,1) mean = F.mean(F.cast(x_new, "float32"), axis=-1, keepdims=True) mean = F.cast(mean, "float16") else: mean = F.mean(x_new, axis=-1, keepdims=True) # (N,G,H*W*C//G) centered_x_new = F.broadcast_minus(x_new, mean) if self.multi_precision: # (N,G,H*W*C//G) -> (N,G,1) var = F.mean(F.cast(F.square(centered_x_new), "float32"), axis=-1, keepdims=True) var = F.cast(var, "float16") else: var = F.mean(F.square(centered_x_new), axis=-1, keepdims=True) # (N,G,H*W*C//G) -> (N,C,H,W) x_new = F.broadcast_div(centered_x_new, F.sqrt(var + self.eps)).reshape_like(x) x_new = F.broadcast_add(F.broadcast_mul(x_new, weight), bias) return x_new class ConvPredictor(nn.HybridBlock): def __init__(self, num_channels, share_params=None, bias_init=None, **kwargs): super(ConvPredictor, self).__init__(**kwargs) with self.name_scope(): if share_params is not None: self.conv = nn.Conv2D(num_channels, 3, 1, 1, params=share_params, bias_initializer=bias_init) else: self.conv = nn.Conv2D(num_channels, 3, 1, 1, weight_initializer=mx.init.Normal(sigma=0.01), bias_initializer=bias_init) def get_params(self): return self.conv.params def hybrid_forward(self, F, x): x = self.conv(x) return x class RetinaHead(nn.HybridBlock): def __init__(self, share_params=None, prefix=None, **kwargs): super(RetinaHead, self).__init__(**kwargs) with self.name_scope(): self.conv = nn.HybridSequential() for i in range(4): if share_params is not None: self.conv.add(nn.Conv2D(256, 3, 1, 1, activation='relu', params=share_params[i])) else: self.conv.add(nn.Conv2D(256, 3, 1, 1, activation='relu', weight_initializer=mx.init.Normal(sigma=0.01), bias_initializer='zeros')) self.conv.add(GroupNorm(num_channels=256, prefix=prefix)) def set_params(self, newconv): for b, nb in zip(self.conv, newconv): b.weight.set_data(nb.weight.data()) b.bias.set_data(nb.bias.data()) def get_params(self): param_list = [] for opr in self.conv: param_list.append(opr.params) return param_list def hybrid_forward(self, F, x): x = self.conv(x) return x @mx.init.register class ClsBiasInit(mx.init.Initializer): def __init__(self, num_class, cls_method="sigmoid", pi=0.01, **kwargs): super(ClsBiasInit, self).__init__(**kwargs) self._num_class = num_class self._cls_method = cls_method self._pi = pi def _init_weight(self, name, data): if self._cls_method == "sigmoid": arr = -1 * np.ones((data.size, )) arr = arr * np.log((1 - self._pi) / self._pi) data[:] = arr elif self._cls_method == "softmax": pass def cor_target(short, scale): h, w, = short, short fh = int(np.ceil(np.ceil(np.ceil(h / 2) / 2) / 2)) fw = int(np.ceil(np.ceil(np.ceil(w / 2) / 2) / 2)) # fm_list = [] for _ in range(len(scale)): fm_list.append((fh, fw)) fh = int(np.ceil(fh / 2)) fw = int(np.ceil(fw / 2)) fm_list = fm_list[::-1] # cor_targets = [] for i, stride in enumerate(scale): fh, fw = fm_list[i] cx = mx.nd.arange(0, fw).reshape((1, -1)) cy = mx.nd.arange(0, fh).reshape((-1, 1)) sx = mx.nd.tile(cx, reps=(fh, 1)) sy = mx.nd.tile(cy, reps=(1, fw)) syx = mx.nd.stack(sy.reshape(-1), sx.reshape(-1)).transpose() cor_targets.append(mx.nd.flip(syx, axis=1) * stride) cor_targets = mx.nd.concat(*cor_targets, dim=0) return cor_targets class MaskFCOS(HybridBlock): def __init__(self, network, features, classes, steps=None, short=600, valid_range=[(512, np.inf), (256, 512), (128, 256), (64, 128), (0, 64)], num_prototypes=32, use_p6_p7=True, pretrained_base=False, nms_thresh=0.45, nms_topk=400, post_nms=100, share_params = False, **kwargs): super(MaskFCOS, self).__init__(**kwargs) num_layers = len(features) + int(use_p6_p7)*2 self._num_layers = num_layers self.classes = classes self.nms_thresh = nms_thresh self.nms_topk = nms_topk self.post_nms = post_nms self.share_params = share_params self._scale = steps[::-1] self.short = short self.base_stride = steps[-1] self.valid_range = valid_range self.k = num_prototypes # input size are solid self.cor_targets = self.params.get_constant(name='cor_', value=cor_target(self.short, self._scale)) with self.name_scope(): bias_init = ClsBiasInit(len(self.classes)) self.box_converter = FCOSBoxConverter() self.cliper = BBoxClipToImage() self.features = RetinaFeatureExpander(network=network, pretrained=pretrained_base, outputs=features) self.protonet = Protonet([256, 256, 256, 256, self.k]) self.classes_head = nn.HybridSequential() self.box_head = nn.HybridSequential() self.class_predictors = nn.HybridSequential() self.box_predictors = nn.HybridSequential() # self.center_predictors = nn.HybridSequential() self.maskcoe_predictors = nn.HybridSequential() share_cls_params, share_box_params = None, None share_cls_pred_params, share_ctr_pred_params, \ share_box_pred_params, share_mask_pred_params = None, None, None, None for i in range(self._num_layers): # classes cls_head = RetinaHead(share_params=share_cls_params, prefix='cls_{}'.format(i)) self.classes_head.add(cls_head) share_cls_params = cls_head.get_params() # bbox box_head = RetinaHead(share_params=share_box_params, prefix='box_{}'.format(i)) self.box_head.add(box_head) share_box_params = box_head.get_params() # classes preds cls_pred = ConvPredictor(num_channels=len(self.classes), share_params=share_cls_pred_params, bias_init=bias_init) self.class_predictors.add(cls_pred) share_cls_pred_params = cls_pred.get_params() # center preds # center_pred = ConvPredictor(num_channels=1, # share_params=share_ctr_pred_params, bias_init='zeros') # self.center_predictors.add(center_pred) # share_ctr_pred_params = center_pred.get_params() # mask coefficient preds maskcoe_pred = ConvPredictor(num_channels=self.k, share_params=share_mask_pred_params, bias_init='zeros') self.maskcoe_predictors.add(maskcoe_pred) share_mask_pred_params = maskcoe_pred.get_params() # bbox_pred bbox_pred = ConvPredictor(num_channels=4, share_params=share_box_pred_params, bias_init='zeros') self.box_predictors.add(bbox_pred) share_box_pred_params = bbox_pred.get_params() if not self.share_params: share_cls_params, share_box_params = None, None share_cls_pred_params, share_ctr_pred_params, \ share_box_pred_params, share_mask_pred_params = None, None, None, None # trainable scales # self.s1 = self.params.get('scale_p1', shape=(1,), differentiable=True, # allow_deferred_init=True, init='ones') # self.s2 = self.params.get('scale_p2', shape=(1,), differentiable=True, # allow_deferred_init=True, init='ones') # self.s3 = self.params.get('scale_p3', shape=(1,), differentiable=True, # allow_deferred_init=True, init='ones') # self.s4 = self.params.get('scale_p4', shape=(1,), differentiable=True, # allow_deferred_init=True, init='ones') # self.s5 = self.params.get('scale_p5', shape=(1,), differentiable=True, # allow_deferred_init=True, init='ones') @property def num_classes(self): """Return number of foreground classes. Returns ------- int Number of foreground classes """ return len(self.classes) # pylint: disable=arguments-differ def hybrid_forward(self, F, x, cor_targets): """Hybrid forward""" features = self.features(x) masks = self.protonet(features[-1]) masks = F.relu(masks) cls_head_feat = [cp(feat) for feat, cp in zip(features, self.classes_head)] box_head_feat = [cp(feat) for feat, cp in zip(features, self.box_head)] cls_preds = [F.transpose(F.reshape(cp(feat), (0, 0, -1)), (0, 2, 1)) for feat, cp in zip(cls_head_feat, self.class_predictors)] # center_preds = [F.transpose(F.reshape(bp(feat), (0, 0, -1)), (0, 2, 1)) # for feat, bp in zip(cls_head_feat, self.center_predictors)] box_preds = [F.transpose(F.exp(F.reshape(bp(feat), (0, 0, -1))), (0, 2, 1)) * sc for feat, bp, sc in zip(box_head_feat, self.box_predictors, self._scale)] maskeoc_preds = [F.transpose(F.reshape(bp(feat), (0, 0, -1)), (0, 2, 1)) for feat, bp in zip(box_head_feat, self.maskcoe_predictors)] cls_preds = F.concat(*cls_preds, dim=1) # center_preds = F.concat(*center_preds, dim=1) box_preds = F.concat(*box_preds, dim=1) maskeoc_preds = F.concat(*maskeoc_preds, dim=1) maskeoc_preds = F.tanh(maskeoc_preds) center_preds = F.sum(maskeoc_preds, axis=-1, keepdims=True) # with autograd.pause(): # h, w, = self.short, self.short # fh = int(np.ceil(np.ceil(np.ceil(h / 2) / 2) / 2)) # fw = int(np.ceil(np.ceil(np.ceil(w / 2) / 2) / 2)) # # # fm_list = [] # for _ in range(len(self._scale)): # fm_list.append((fh, fw)) # fh = int(np.ceil(fh / 2)) # fw = int(np.ceil(fw / 2)) # fm_list = fm_list[::-1] # # # cor_targets = [] # for i, stride in enumerate(self._scale): # fh, fw = fm_list[i] # cx = F.arange(0, fw).reshape((1, -1)) # cy = F.arange(0, fh).reshape((-1, 1)) # sx = F.tile(cx, reps=(fh, 1)) # sy = F.tile(cy, reps=(1, fw)) # syx = F.stack(sy.reshape(-1), sx.reshape(-1)).transpose() # cor_targets.append(F.flip(syx, axis=1) * stride) # cor_targets = F.concat(*cor_targets, dim=0) box_preds = self.box_converter(box_preds, cor_targets) if autograd.is_training(): return [cls_preds, center_preds, box_preds, masks, maskeoc_preds] box_preds = self.cliper(box_preds, x) # box_preds: [B, N, 4] cls_prob = F.sigmoid(cls_preds) center_prob = F.sigmoid(center_preds) cls_prob = F.broadcast_mul(cls_prob, center_prob) cls_id = cls_prob.argmax(axis=-1) probs = F.pick(cls_prob, cls_id) result = F.concat(cls_id.expand_dims(axis=-1), probs.expand_dims(axis=-1), box_preds, maskeoc_preds, dim=-1) if self.nms_thresh > 0 and self.nms_thresh < 1: result = F.contrib.box_nms(result, overlap_thresh=self.nms_thresh, topk=self.nms_topk, valid_thresh=0.001, id_index=0, score_index=1, coord_start=2, force_suppress=False, in_format='corner', out_format='corner') if self.post_nms > 0: result = result.slice_axis(axis=1, begin=0, end=self.post_nms) ids = F.slice_axis(result, axis=2, begin=0, end=1) scores = F.slice_axis(result, axis=2, begin=1, end=2) bboxes = F.slice_axis(result, axis=2, begin=2, end=6) maskeoc = F.slice_axis(result, axis=2, begin=6, end=6 + self.k) return ids, scores, bboxes, maskeoc, masks def get_maskfcos(name, dataset, pretrained=False, ctx=mx.cpu(), root=os.path.join('~', '.mxnet', 'models'), **kwargs): "return FCOS network" base_name = name net = MaskFCOS(base_name, **kwargs) if pretrained: from ..model_store import get_model_file full_name = '_'.join(('fcos', name, dataset)) net.load_parameters(get_model_file(full_name, tag=pretrained, root=root), ctx=ctx) return net # def fcos_resnet50_v1_coco(pretrained=False, pretrained_base=True, **kwargs): # from ..resnet import resnet50_v1 # from ...data import COCODetection # classes = COCODetection.CLASSES # pretrained_base = False if pretrained else pretrained_base # base_network = resnet50_v1(pretrained=pretrained_base, **kwargs) # features = RetinaFeatureExpander(network=base_network, # pretrained=pretrained_base, # outputs=['stage2_activation3', # 'stage3_activation5', # 'stage4_activation2']) # return get_fcos(name="resnet50_v1", dataset="coco", pretrained=pretrained, # features=features, classes=classes, base_stride=128, short=800, # max_size=1333, norm_layer=None, norm_kwargs=None, # valid_range=[(512, np.inf), (256, 512), (128, 256), (64, 128), (0, 64)], # nms_thresh=0.6, nms_topk=1000, save_topk=100) def maskfcos_resnet50_v1_740_coco(pretrained=False, pretrained_base=True, **kwargs): from ...data import COCOInstance classes = COCOInstance.CLASSES return get_maskfcos('resnet50_v1', features=['stage2_activation3', 'stage3_activation5', 'stage4_activation2'], classes=classes, steps=[8, 16, 32, 64, 128], short = 740, valid_range=[(512, np.inf), (256, 512), (128, 256), (64, 128), (0, 64)], nms_thresh=0.45, nms_topk=1000, post_nms=100, dataset='coco', pretrained=pretrained, num_prototypes=32, pretrained_base=pretrained_base, share_params = True, **kwargs) def maskfcos_resnet50_v1b_740_coco(pretrained=False, pretrained_base=True, **kwargs): from ...data import COCOInstance classes = COCOInstance.CLASSES return get_maskfcos('resnet50_v1d', features=['layers2_relu11_fwd', 'layers3_relu17_fwd', 'layers4_relu8_fwd'], classes=classes, steps=[8, 16, 32, 64, 128], short = 740, valid_range=[(512, np.inf), (256, 512), (128, 256), (64, 128), (0, 64)], nms_thresh=0.45, nms_topk=1000, post_nms=100, dataset='coco', pretrained=pretrained, num_prototypes=32, pretrained_base=pretrained_base, share_params = True, **kwargs) def maskfcos_resnet101_v1d_740_coco(pretrained=False, pretrained_base=True, **kwargs): from ...data import COCOInstance classes = COCOInstance.CLASSES return get_maskfcos('resnet101_v1d', features=['layers2_relu11_fwd', 'layers3_relu68_fwd', 'layers4_relu8_fwd'], classes=classes, steps=[8, 16, 32, 64, 128], short = 740, valid_range=[(512, np.inf), (256, 512), (128, 256), (64, 128), (0, 64)], nms_thresh=0.45, nms_topk=1000, post_nms=100, dataset='coco', pretrained=pretrained, num_prototypes=32, pretrained_base=pretrained_base, share_params = True, **kwargs) def maskfcos_resnet50_v1_1024_coco(pretrained=False, pretrained_base=True, **kwargs): from ...data import COCOInstance classes = COCOInstance.CLASSES return get_maskfcos('resnet50_v1', features=['stage2_activation3', 'stage3_activation5', 'stage4_activation2'], classes=classes, steps=[8, 16, 32, 64, 128], short = 1024, valid_range=[(512, np.inf), (256, 512), (128, 256), (64, 128), (0, 64)], nms_thresh=0.45, nms_topk=1000, post_nms=100, dataset='coco', pretrained=pretrained, num_prototypes=32, pretrained_base=pretrained_base, share_params = True, **kwargs)
StarcoderdataPython
6569802
<reponame>craigxchen/LQR import numpy as np from lqr_control import control A = np.array([[1,1],[0,1]]) B = np.array([[0],[1]]) Q = np.array([[1,0],[0,0]]) R1 = np.array(1).reshape(1,1) R2 = np.array(10).reshape(1,1) x0 = np.array([[-1],[0]]) u0 = np.array([[0]]) #default to 0 # number of time steps to simulate T = 30 K_1, _, _ = control.dlqr(A,B,Q,R1) x_1, u_1 = control.simulate_discrete(A,B,K_1,x0,u0,T) K_2, _, _ = control.dlqr(A,B,Q,R2) x_2, u_2 = control.simulate_discrete(A,B,K_2,x0,u0,T) control.plot_paths(x_1[0],x_2[0],'Position',R1,R2) control.plot_paths(u_1.T,u_2.T,'Control Action',R1,R2)
StarcoderdataPython
5057332
from d7a.support.schema import Validatable, Types class Control(Validatable): SCHEMA = [{ "is_dialog_start": Types.BOOLEAN(), "is_dialog_end": Types.BOOLEAN(), "is_ack_return_template_requested": Types.BOOLEAN(), "is_ack_not_void": Types.BOOLEAN(), "is_ack_recorded": Types.BOOLEAN(), "has_ack_template": Types.BOOLEAN() }] def __init__(self, is_dialog_start, is_dialog_end, is_ack_return_template_requested, is_ack_not_void, is_ack_recorded): self.is_dialog_start = is_dialog_start self.is_dialog_end = is_dialog_end self.is_ack_return_template_requested = is_ack_return_template_requested self.is_ack_not_void = is_ack_not_void self.is_ack_recorded = is_ack_recorded super(Control, self).__init__() def __iter__(self): byte = 0 if self.is_dialog_start: byte |= 1 << 7 if self.is_dialog_end: byte |= 1 << 6 if self.is_ack_return_template_requested: byte |= 1 << 3 if self.is_ack_not_void: byte |= 1 << 2 if self.is_ack_recorded: byte |= 1 << 1 yield byte
StarcoderdataPython
1894105
<gh_stars>0 class Quantifier(object): def __init__(self): self.behaviour = {} self.latest_observation = None self.latest_behaviour = None def add(self, observation, behaviour): self.behaviour[observation] = behaviour self.latest_observation = observation self.latest_behaviour = behaviour def adjust_reward(self, found, knowledge): for observation in self.behaviour: behaviour = self.behaviour[observation] information = knowledge.get_information(observation) if found: information.adjust_behaviour(behaviour, 2) else: information.adjust_behaviour(behaviour, 0.9) return self.adjust_latest_behaviour(found, knowledge) def adjust_latest_behaviour(self, found, knowledge): if not found and self.latest_behaviour: behaviour = self.behaviour[self.latest_observation] information = knowledge.get_information(self.latest_behaviour) information.adjust_behaviour(behaviour, 0.5)
StarcoderdataPython
3494151
<gh_stars>0 ''' Authors : <NAME> <<EMAIL>> <NAME> <<EMAIL>> This code is part of assignment 7 of INF-552 Machine Learning for Data Science, Spring 2020 at Viterbi, USC ''' import math from collections import defaultdict _STATES_MATRIX, _STATES_DIC = defaultdict(list), defaultdict(list) _NOISY_MIN, _NOISY_MAX, _DEC_PRECISION = 0.7, 1.3, 1 _MAX_STEPS = 10 _INPUT_FILE = 'hmm-data.txt' _PREV, _PROB = 'prev', 'prob' TRANSITION_MATRIX = defaultdict(dict) TRANSITION_PROB = defaultdict(int) TRANS_PROB = defaultdict(dict) def load_data(file_name): out1, out2, out3 = [], [], [] fp = open(file_name) for i, line in enumerate(fp): if 2 <= i < 12: row = i - 2 out1.extend([[int(row), int(col)] for col, _x in enumerate(line.split()) if _x == '1']) elif 16 <= i < 20: out2.append([int(_x) for _x in line.split()[2:]]) # skip two label words. elif 24 <= i < 35: out3.append([float(_x) for _x in line.split()]) fp.close() return out1, out2, out3 def print_out(title, list): print(title) for i, value in enumerate(list): print(i+1, ":", value) def find_moves(loc, grid_size): moves = [] x, y = loc[0], loc[1] if x + 1 < grid_size: moves.append((x + 1, y)) if x - 1 > 0: moves.append((x - 1, y)) if y + 1 < grid_size: moves.append((x, y + 1)) if y - 1 > 0: moves.append((x, y - 1)) return moves def tower_distance_noisy(grids, tower_loc): out = [] for i, non_obstacle_cell in enumerate(grids): dist=[] for j, tower in enumerate(tower_loc): euclidean_dist = math.sqrt(pow(non_obstacle_cell[0]-tower[0],2) + pow(non_obstacle_cell[1]-tower[1],2)) dist.append([round(euclidean_dist * _NOISY_MIN, _DEC_PRECISION), round(euclidean_dist * _NOISY_MAX, _DEC_PRECISION)]) out.append(dist) return out def get_next_step_prob(node, noisy_dist, noisy_dists): prob_states=[] num_of_noisy = len(noisy_dist) for i in range(len(node)): loc = node[i] count = 0 for ii in range(len(noisy_dist)): if noisy_dists[i][ii][0] <= noisy_dist[ii] <= noisy_dists[i][ii][1]: count+=1 if count == num_of_noisy: prob_states.append(loc) return prob_states def transition_probability(states_dic, adj_moves): for cell in states_dic: TRANSITION_PROB[cell]= 0.0 possible_states = states_dic[cell] adj_cells = adj_moves[cell] for state_t in possible_states: state_t += 1 for _next in adj_cells: if _next in states_dic: if state_t in states_dic[_next]: if _next not in TRANSITION_MATRIX[cell]: TRANSITION_MATRIX[cell][_next] = 0.0 TRANSITION_MATRIX[cell][_next] += 1.0 TRANSITION_PROB[cell] += 1.0 for _next in TRANSITION_MATRIX[cell]: TRANS_PROB[cell][_next] = TRANSITION_MATRIX[cell][_next] / TRANSITION_PROB[cell] return TRANS_PROB def HMM(noisy_dist,probable_states,trans_prob): state_t = 0 paths = defaultdict(dict) paths[0] = defaultdict(dict) for element in probable_states[state_t]: tup = tuple(element) paths[state_t][tup] = dict() paths[state_t][tup][_PREV], paths[state_t][tup][_PROB] = '', (1.0 / len(probable_states[state_t])) for state_t in range(1, len(noisy_dist)): paths[state_t] = defaultdict(dict) for items in paths[state_t-1]: if items in trans_prob: for _next in trans_prob[items]: if list(_next) in probable_states[state_t]: crt, n_state = paths[state_t - 1][items][_PROB], trans_prob[items][_next] present_prob = crt * n_state if _next in paths[state_t] and present_prob > paths[state_t][_next][_PROB]: paths[state_t][_next][_PREV] = items paths[state_t][_next][_PROB] = present_prob if _next not in paths[state_t]: paths[state_t][_next] = dict() paths[state_t][_next][_PREV] = items paths[state_t][_next][_PROB] = present_prob return paths def backtracking(paths, max_state=_MAX_STEPS): max_prob, result = 0.0, [] temp_cell = None for c in paths[max_state]: if max_prob < paths[max_state][c][_PROB]: max_prob = paths[max_state][c][_PROB] temp_cell = c result.append(temp_cell) for max_state in range(_MAX_STEPS, 0, -1): parent_cell = paths[max_state][temp_cell][_PREV] result.append(parent_cell) temp_cell = parent_cell return result if __name__ == "__main__": grid_non_obstacle_cells, tower_loc, noisy_dist = load_data(_INPUT_FILE) # The file hmm-data.txt contains a map of a 10 - by - 10 2D grid world. # # 1) grid_non_obstacle_cells: The non-obstacle cells are represented as '1', otherwise, '0' # 2) tower_loc: There are four towers, one in each of the four corners # 3) noisy_dist: Robot records a noisy measurement chosen uniformly at random from the set of numbers in the interval [0.7d, 1.3d] with one decimal place. # These measurements for 11 time-steps are loaded from the hmm-data.txt data file. distance_noisy_matrix = tower_distance_noisy(grid_non_obstacle_cells, tower_loc) # The robot measures a true distance d (Euclidean distances), and records a noisy measurement based on noisy_dist # From grid_non_obstacle_cells and noisy_dist matrix, generate _STATES_MATRIX and TRANSITION_MATRIX through get_next_step_prob(). for i in range(0, len(noisy_dist)): _STATES_MATRIX[i] = get_next_step_prob(grid_non_obstacle_cells, noisy_dist[i], distance_noisy_matrix) for cell in _STATES_MATRIX[i]: _STATES_DIC[tuple(cell)].append(i) # find possible moves from all cell node moves = defaultdict(list) for cell in _STATES_DIC: moves[cell] = find_moves(cell, _MAX_STEPS) # Use the function HMM based on observation_sequences (trans_matrix) which implementing the Viterbi algorighm to calculate the maximum probability of state in the last time-step, # then backtrack the state provides the condition for getting this probability, until the starting state is determined. trans_matrix = transition_probability(_STATES_DIC, moves) possible_paths = HMM(noisy_dist, _STATES_MATRIX, trans_matrix) print_out("=== PATH ===", backtracking(possible_paths)[::-1])
StarcoderdataPython
4802729
<reponame>adriensade/Galeries from flask_thumbnails import utils from sqlalchemy import desc from .ResourceDAO import ResourceDAO from .. import app, db, thumb from ..file_helper import delete_file, is_video from ..filters import thumb_filter, category_thumb_filter from ..models import File, Gallery, FileTypeEnum, Year import os UPLOAD_FOLDER = app.config['MEDIA_ROOT'] THUMB_FOLDER = app.config['THUMBNAIL_MEDIA_THUMBNAIL_ROOT'] DEFAULT_SIZE_THUMB = "226x226" VIDEO_RESOLUTIONS = ["720", "480", "360"] # Default video is uploaded as 1080p def query_with_offset(query, page=None, page_size=None): if page_size is None: return query else: if page is None: page = 1 return query.offset((page - 1) * page_size).limit(page_size) class FileDAO(ResourceDAO): def __init__(self): super().__init__(File) @staticmethod def create_thumb(file: File, size=DEFAULT_SIZE_THUMB): return thumb_filter(file, size) @staticmethod def get_thumb_path(file: File, size=DEFAULT_SIZE_THUMB): return os.path.join(THUMB_FOLDER, file.gallery.slug, utils.generate_filename(file.filename, size, "fit", "90")) @staticmethod def get_video_path(file: File): return os.path.join(UPLOAD_FOLDER, file.filename) @classmethod def get_thumb_path_or_create_it(cls, file: File, size=DEFAULT_SIZE_THUMB): thumb_file_path = cls.get_thumb_path(file, size) try: thumbnail = open(thumb_file_path) thumbnail.close() except: cls.create_thumb(file, size) return thumb_file_path @classmethod def delete(cls, file: File): file_path = os.path.join(UPLOAD_FOLDER, file.file_path) thumb_file_path = cls.get_thumb_path(file) delete_file(file_path) delete_file(thumb_file_path) db.session.delete(file) db.session.commit() if is_video(file.filename): for resolution in VIDEO_RESOLUTIONS: delete_file(os.path.join(UPLOAD_FOLDER, file.file_path_resolution(resolution))) def delete_by_slug(self, slug: str): self.delete(self.find_by_slug(slug)) @staticmethod def find_all_moderated_sorted_by_date(page: int, page_size: int): return File.query.filter_by(pending=False).order_by(desc(File.created)).offset((page-1)*page_size).limit(page_size).all() @staticmethod def all_files_by_gallery(gallery: Gallery, page=None, page_size=None): files = File.query.filter_by(gallery=gallery) return query_with_offset(files, page, page_size) @staticmethod def find_all_files_by_gallery(gallery: Gallery, page=None, page_size=None): return FileDAO.all_files_by_gallery(gallery, page, page_size).all() @staticmethod def find_not_pending_files_by_gallery(gallery: Gallery, page=None, page_size=None): files = FileDAO.find_all_files_by_gallery(gallery, page, page_size) return list(filter(lambda file: not file.pending, files)) @staticmethod def get_number_of_files_by_gallery(gallery: Gallery): return FileDAO.all_files_by_gallery(gallery).count() @staticmethod def get_number_of_not_pending_files_by_gallery(gallery: Gallery): return len(FileDAO.find_not_pending_files_by_gallery(gallery)) # Videos @staticmethod def all_public_videos(page=None, page_size=None, starting_year=None, ending_year=None): if starting_year is None and ending_year is None: files = File.query.join(File.gallery).filter(File.type == FileTypeEnum.VIDEO.name, Gallery.private == False) elif starting_year is not None and ending_year is not None: files = File.query.join(File.gallery).join(Gallery.year).filter(File.type == FileTypeEnum.VIDEO.name, Gallery.private == False).filter(Year.slug >= starting_year, Year.slug <= ending_year) else : return [] return query_with_offset(files, page, page_size) @staticmethod def find_all_public_videos(page, page_size, starting_year=None, ending_year=None): return FileDAO().all_public_videos(page, page_size, starting_year, ending_year).all() @staticmethod def count_all_public_videos(starting_year=None, ending_year=None): return FileDAO().all_public_videos(starting_year=starting_year, ending_year=ending_year).count() @staticmethod def get_cover_image_of_video_gallery(gallery: Gallery): return File.query.filter_by(gallery=gallery, type=FileTypeEnum.IMAGE.name).first() @staticmethod def get_video_from_gallery_slug(gallery_slug: str): return File.query.join(File.gallery).filter(Gallery.slug == gallery_slug, File.type == FileTypeEnum.VIDEO.name).first()
StarcoderdataPython
4991929
<filename>pytest_djangoapp/fixtures/templates.py # -*- encoding: utf-8 -*- from __future__ import unicode_literals import re try: from unittest import mock except ImportError: import mock import pytest from django import VERSION from django.template.base import Template from django.template.context import Context, RenderContext from .utils import string_types if False: # pragma: nocover from django.contrib.auth.base_user import AbstractBaseUser from django.http import HttpRequest RE_TAG_VALUES = re.compile('>([^<]+)<') @pytest.fixture def template_strip_tags(): """Allows HTML tags strip from string. To be used with `template_render_tag` fixture to easy result assertions. Example:: def test_this(template_strip_tags): stripped = template_strip_tags('<b>some</b>') :param str|unicode html: HTML to strin tags from :param str|unicode joiner: String to join tags contents. Default: | """ def template_strip_tags_(html, joiner='|'): """ :rtype: str|unicode """ result = [] for match in RE_TAG_VALUES.findall(html): match = match.strip() if match: result.append(match) return joiner.join(result) return template_strip_tags_ @pytest.fixture def template_context(request_get, user_create): """Creates template context object. To be used with `template_render_tag` fixture. Example:: def test_this(template_context): context = template_context({'somevar': 'someval'}) :param dict context_dict: Template context. If not set empty context is used. :param str|unicode|HttpRequest request: Expects HttpRequest or string. String is used as a path for GET-request. :param str|unicode current_app: :param AbstractBaseUser|str|unicode user: User to associate request with. Defaults to anonymous user. """ def template_context_(context_dict=None, request=None, current_app='', user='anonymous'): """ :rtype: Context """ context_dict = context_dict or {} if user == 'anonymous': user = user_create(anonymous=True) if not request or isinstance(request, string_types): request = request_get(request, user=user) context_updater = { 'request': request, } if user: context_updater['user'] = user context_dict.update(context_updater) context = Context(context_dict) contribute_to_context(context, current_app) return context return template_context_ @pytest.fixture def template_render_tag(): """Renders a template tag from a given library by its name. Example:: def test_this(template_render_tag): rendered = template_render_tag('library_name', 'mytag arg1 arg2') :param str|unicode library: Template tags library name to load tag from. :param str|unicode tag_str: Tag string itself. As used in templates, but without {% %}. :param Context context: Template context object. If not set, empty context object is used. """ def template_render_tag_(library, tag_str, context=None): """ :rtype: str|unicode """ context = context or {} if not isinstance(context, Context): context = Context(context) string = '{%% load %s %%}{%% %s %%}' % (library, tag_str) template = Template(string) contribute_to_context(context, template=template) if VERSION >= (1, 11): # Prevent "TypeError: 'NoneType' object is not iterable" in get_exception_info template.nodelist[1].token.position = (0, 0) return template.render(context) return template_render_tag_ def contribute_to_context(context, current_app='', template=None): template = template or mock.MagicMock() if VERSION >= (1, 8): template.engine.string_if_invalid = '' context.template = template if VERSION >= (1, 11): context.render_context = RenderContext() if VERSION >= (1, 10): match = mock.MagicMock() match.app_name = current_app context.resolver_match = match else: context._current_app = current_app
StarcoderdataPython
1779442
#!/usr/bin/env python3 # friendly.py # https://github.com/Jelmerro/stagger # # Copyright (c) 2022-2022 <NAME> # Copyright (c) 2009-2011 <NAME> <<EMAIL>> # All rights reserved. # # Redistribution and use in source and binary forms, with or without # modification, are permitted provided that the following conditions # are met: # # - Redistributions of source code must retain the above copyright # notice, this list of conditions and the following disclaimer. # # - Redistributions in binary form must reproduce the above copyright # notice, this list of conditions and the following disclaimer in # the documentation and/or other materials provided with the # distribution. # # THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS # "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT # LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS # FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE # COPYRIGHT HOLDER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, # INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, # BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; # LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER # CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT # LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN # ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE # POSSIBILITY OF SUCH DAMAGE. import unittest import os.path import warnings from stagger.tags import Tag22, Tag23, Tag24 from stagger.id3 import TT2, TIT1, TIT2, TPE1, TPE2, TALB, TCOM, TCON, TSOT from stagger.id3 import TSOP, TSO2, TSOA, TSOC, TRCK, TPOS, TYE, TDA, TIM, TYER from stagger.id3 import TDAT, TIME, TDRC, PIC, APIC, COM, COMM from stagger.errors import Warning class FriendlyTestCase(unittest.TestCase): def testTitle22(self): tag = Tag22() tag[TT2] = "Foobar" self.assertEqual(tag.title, "Foobar") tag[TT2] = ("Foo", "Bar") self.assertEqual(tag.title, "Foo / Bar") tag.title = "Baz" self.assertEqual(tag[TT2], TT2(text=["Baz"])) self.assertEqual(tag.title, "Baz") tag.title = "Quux / Xyzzy" self.assertEqual(tag[TT2], TT2(text=["Quux", "Xyzzy"])) self.assertEqual(tag.title, "Quux / Xyzzy") def testTitle(self): for tagcls in Tag23, Tag24: tag = tagcls() tag[TIT2] = "Foobar" self.assertEqual(tag.title, "Foobar") tag[TIT2] = ("Foo", "Bar") self.assertEqual(tag.title, "Foo / Bar") tag.title = "Baz" self.assertEqual(tag[TIT2], TIT2(text=["Baz"])) self.assertEqual(tag.title, "Baz") tag.title = "Quux / Xyzzy" self.assertEqual(tag[TIT2], TIT2(text=["Quux", "Xyzzy"])) self.assertEqual(tag.title, "Quux / Xyzzy") def testTextFrames(self): for tagcls in Tag22, Tag23, Tag24: tag = tagcls() for attr, frame in (("title", TIT2), ("artist", TPE1), ("album_artist", TPE2), ("album", TALB), ("composer", TCOM), ("genre", TCON), ("grouping", TIT1), ("sort_title", TSOT), ("sort_artist", TSOP), ("sort_album_artist", TSO2), ("sort_album", TSOA), ("sort_composer", TSOC)): if tagcls == Tag22: frame = frame._v2_frame # No frame -> empty string self.assertEqual(getattr(tag, attr), "") # Set by frameid, check via friendly name tag[frame] = "Foobar" self.assertEqual(getattr(tag, attr), "Foobar") tag[frame] = ("Foo", "Bar") self.assertEqual(getattr(tag, attr), "Foo / Bar") # Set by friendly name, check via frame id setattr(tag, attr, "Baz") self.assertEqual(getattr(tag, attr), "Baz") self.assertEqual(tag[frame], frame(text=["Baz"])) setattr(tag, attr, "Quux / Xyzzy") self.assertEqual(getattr(tag, attr), "Quux / Xyzzy") self.assertEqual(tag[frame], frame(text=["Quux", "Xyzzy"])) # Set to empty string, check frame is gone setattr(tag, attr, "") self.assertTrue(frame not in tag) # Repeat, should not throw KeyError setattr(tag, attr, "") self.assertTrue(frame not in tag) def testTrackFrames(self): for tagcls in Tag22, Tag23, Tag24: tag = tagcls() for track, total, frame in (("track", "track_total", TRCK), ("disc", "disc_total", TPOS)): if tagcls == Tag22: frame = frame._v2_frame # No frame -> zero values self.assertEqual(getattr(tag, track), 0) self.assertEqual(getattr(tag, total), 0) # Set by frameid, check via friendly name tag[frame] = "12" self.assertEqual(getattr(tag, track), 12) self.assertEqual(getattr(tag, total), 0) tag[frame] = "12/24" self.assertEqual(getattr(tag, track), 12) self.assertEqual(getattr(tag, total), 24) tag[frame] = "Foobar" self.assertEqual(getattr(tag, track), 0) self.assertEqual(getattr(tag, total), 0) # Set by friendly name, check via frame id setattr(tag, track, 7) self.assertEqual(getattr(tag, track), 7) self.assertEqual(getattr(tag, total), 0) self.assertEqual(tag[frame], frame(text=["7"])) setattr(tag, total, 21) self.assertEqual(getattr(tag, track), 7) self.assertEqual(getattr(tag, total), 21) self.assertEqual(tag[frame], frame(text=["7/21"])) # Set to 0/0, check frame is gone setattr(tag, total, 0) self.assertEqual(getattr(tag, track), 7) self.assertEqual(getattr(tag, total), 0) self.assertEqual(tag[frame], frame(text=["7"])) setattr(tag, track, 0) self.assertEqual(getattr(tag, track), 0) self.assertEqual(getattr(tag, total), 0) self.assertTrue(frame not in tag) # Repeat, should not throw setattr(tag, track, 0) setattr(tag, total, 0) self.assertTrue(frame not in tag) # Set just the total setattr(tag, total, 13) self.assertEqual(tag[frame], frame(text=["0/13"])) def testDate22_23(self): for tagcls, yearframe, dateframe, timeframe in ( (Tag22, TYE, TDA, TIM), (Tag23, TYER, TDAT, TIME) ): tag = tagcls() # Check empty self.assertEqual(tag.date, "") # Set to empty tag.date = "" self.assertEqual(tag.date, "") # Set a year tag.date = "2009" self.assertEqual(tag.date, "2009") tag.date = " 2009 " self.assertEqual(tag.date, "2009") self.assertEqual(tag[yearframe], yearframe("2009")) self.assertTrue(dateframe not in tag) self.assertTrue(timeframe not in tag) # Partial date tag.date = "2009-07" self.assertEqual(tag.date, "2009") self.assertEqual(tag[yearframe], yearframe("2009")) self.assertTrue(dateframe not in tag) self.assertTrue(timeframe not in tag) # Full date tag.date = "2009-07-12" self.assertEqual(tag.date, "2009-07-12") self.assertEqual(tag[yearframe], yearframe("2009")) self.assertEqual(tag[dateframe], dateframe("0712")) self.assertTrue(timeframe not in tag) # Date + time tag.date = "2009-07-12 18:01" self.assertEqual(tag.date, "2009-07-12 18:01") self.assertEqual(tag[yearframe], yearframe("2009")) self.assertEqual(tag[dateframe], dateframe("0712")) self.assertEqual(tag[timeframe], timeframe("1801")) tag.date = "2009-07-12 18:01:23" self.assertEqual(tag.date, "2009-07-12 18:01") self.assertEqual(tag[yearframe], yearframe("2009")) self.assertEqual(tag[dateframe], dateframe("0712")) self.assertEqual(tag[timeframe], timeframe("1801")) tag.date = "2009-07-12T18:01:23" self.assertEqual(tag.date, "2009-07-12 18:01") self.assertEqual(tag[yearframe], yearframe("2009")) self.assertEqual(tag[dateframe], dateframe("0712")) self.assertEqual(tag[timeframe], timeframe("1801")) # Truncate to year only tag.date = "2009" self.assertEqual(tag[yearframe], yearframe("2009")) self.assertTrue(dateframe not in tag) self.assertTrue(timeframe not in tag) def testDate24(self): tag = Tag24() # Check empty self.assertEqual(tag.date, "") # Set to empty tag.date = "" self.assertEqual(tag.date, "") # Set a year tag.date = "2009" self.assertEqual(tag.date, "2009") self.assertEqual(tag[TDRC], TDRC(tag.date)) tag.date = " 2009 " self.assertEqual(tag.date, "2009") self.assertEqual(tag[TDRC], TDRC(tag.date)) tag.date = "2009-07" self.assertEqual(tag.date, "2009-07") self.assertEqual(tag[TDRC], TDRC(tag.date)) tag.date = "2009-07-12" self.assertEqual(tag.date, "2009-07-12") self.assertEqual(tag[TDRC], TDRC(tag.date)) tag.date = "2009-07-12 18:01" self.assertEqual(tag.date, "2009-07-12 18:01") self.assertEqual(tag[TDRC], TDRC(tag.date)) tag.date = "2009-07-12 18:01:23" self.assertEqual(tag.date, "2009-07-12 18:01:23") self.assertEqual(tag[TDRC], TDRC(tag.date)) tag.date = "2009-07-12T18:01:23" self.assertEqual(tag.date, "2009-07-12 18:01:23") self.assertEqual(tag[TDRC], TDRC(tag.date)) def testPicture22(self): tag = Tag22() # Check empty self.assertEqual(tag.picture, "") # Set to empty tag.picture = "" self.assertEqual(tag.picture, "") self.assertTrue(PIC not in tag) tag.picture = os.path.join(os.path.dirname( __file__), "samples", "cover.jpg") self.assertEqual(tag[PIC][0].type, 0) self.assertEqual(tag[PIC][0].desc, "") self.assertEqual(tag[PIC][0].format, "JPG") self.assertEqual(len(tag[PIC][0].data), 60511) self.assertEqual(tag.picture, "Other(0)::<60511 bytes of jpeg data>") # Set to empty tag.picture = "" self.assertEqual(tag.picture, "") self.assertTrue(PIC not in tag) def testPicture23_24(self): for tagcls in Tag23, Tag24: tag = tagcls() # Check empty self.assertEqual(tag.picture, "") # Set to empty tag.picture = "" self.assertEqual(tag.picture, "") self.assertTrue(APIC not in tag) # Set picture. tag.picture = os.path.join(os.path.dirname( __file__), "samples", "cover.jpg") self.assertEqual(tag[APIC][0].type, 0) self.assertEqual(tag[APIC][0].desc, "") self.assertEqual(tag[APIC][0].mime, "image/jpeg") self.assertEqual(len(tag[APIC][0].data), 60511) self.assertEqual( tag.picture, "Other(0)::<60511 bytes of jpeg data>") # Set to empty tag.picture = "" self.assertEqual(tag.picture, "") self.assertTrue(APIC not in tag) def testComment(self): for tagcls, frameid in ((Tag22, COM), (Tag23, COMM), (Tag24, COMM)): tag = tagcls() # Comment should be the empty string in an empty tag. self.assertEqual(tag.comment, "") # Try to delete non-existent comment. tag.comment = "" self.assertEqual(tag.comment, "") self.assertTrue(frameid not in tag) # Set comment. tag.comment = "Foobar" self.assertEqual(tag.comment, "Foobar") self.assertTrue(frameid in tag) self.assertEqual(len(tag[frameid]), 1) self.assertEqual(tag[frameid][0].lang, "eng") self.assertEqual(tag[frameid][0].desc, "") self.assertEqual(tag[frameid][0].text, "Foobar") # Override comment. tag.comment = "Baz" self.assertEqual(tag.comment, "Baz") self.assertTrue(frameid in tag) self.assertEqual(len(tag[frameid]), 1) self.assertEqual(tag[frameid][0].lang, "eng") self.assertEqual(tag[frameid][0].desc, "") self.assertEqual(tag[frameid][0].text, "Baz") # Delete comment. tag.comment = "" self.assertEqual(tag.comment, "") self.assertTrue(frameid not in tag) def testCommentWithExtraFrame(self): "Test getting/setting the comment when other comments are present." for tagcls, frameid in ((Tag22, COM), (Tag23, COMM), (Tag24, COMM)): tag = tagcls() frame = frameid(lan="eng", desc="foo", text="This is a text") tag[frameid] = [frame] # Comment should be the empty string. self.assertEqual(tag.comment, "") # Try to delete non-existent comment. tag.comment = "" self.assertEqual(tag.comment, "") self.assertEqual(len(tag[frameid]), 1) # Set comment. tag.comment = "Foobar" self.assertEqual(tag.comment, "Foobar") self.assertEqual(len(tag[frameid]), 2) self.assertEqual(tag[frameid][0], frame) self.assertEqual(tag[frameid][1].lang, "eng") self.assertEqual(tag[frameid][1].desc, "") self.assertEqual(tag[frameid][1].text, "Foobar") # Override comment. tag.comment = "Baz" self.assertEqual(tag.comment, "Baz") self.assertEqual(len(tag[frameid]), 2) self.assertEqual(tag[frameid][0], frame) self.assertEqual(tag[frameid][1].lang, "eng") self.assertEqual(tag[frameid][1].desc, "") self.assertEqual(tag[frameid][1].text, "Baz") # Delete comment. tag.comment = "" self.assertEqual(tag.comment, "") self.assertEqual(len(tag[frameid]), 1) self.assertEqual(tag[frameid][0], frame) suite = unittest.TestLoader().loadTestsFromTestCase(FriendlyTestCase) if __name__ == "__main__": warnings.simplefilter("always", Warning) unittest.main(defaultTest="suite")
StarcoderdataPython
6484516
from django.apps import AppConfig # import sqlite3 # from io import StringIO # from django.conf import settings # from django.db import connections class PcrdUnpackConfig(AppConfig): name = 'pcrd_unpack' # def ready(self): # self.init_sqlite_db() # # # def init_sqlite_db(self): # # Read database to tempfile # con = sqlite3.connect(settings.DATABASES["pcrd_db_indisk"]["NAME"]) # tempfile = StringIO() # for line in con.iterdump(): # tempfile.write('%s\n' % line) # con.close() # tempfile.seek(0) # # # Create a database in memory and import from tempfile # self.sqlite = sqlite3.connect(":memory:") # self.sqlite.cursor().executescript(tempfile.read()) # self.sqlite.commit() # self.sqlite.row_factory = sqlite3.Row
StarcoderdataPython
8018873
"""Add {PROJECT_ROOT}/lib. to PYTHONPATH Usage: import this module before import any modules under lib/ e.g import _init_paths from core.config import cfg """ import os.path as osp import sys def add_path(path): if path not in sys.path: sys.path.insert(0, path) this_dir = osp.abspath(osp.dirname(osp.dirname(__file__))) one_back = osp.abspath(osp.dirname(this_dir)) net_path = osp.join(one_back, 'network') # Add lib and net to PYTHONPATH lib_path = osp.join(net_path, 'lib') add_path(lib_path) add_path(net_path)
StarcoderdataPython
124602
<filename>src/core/search_service.py<gh_stars>0 """Define the abstract class for similarity search service controllers""" class SearchService: """Search Service handles all controllers in the search service""" def __init__(self): pass def load_index(self): pass def load_labels(self): pass def similar_search_vectors(self): pass def refresh_index(self): pass def health_check(self): pass
StarcoderdataPython
3270917
from typing import Tuple import numpy as np def change_ratio(image: np.ndarray, height: int, width: int, change_ratio=16/9) -> Tuple[np.ndarray, int, int]: image_ratio = width / height if image_ratio < change_ratio: # imageが縦長 canvas_height = height canvas_width = int(canvas_height * change_ratio) canvas = np.zeros( (canvas_height, canvas_width, 3), dtype=np.uint8) canvas[0:height, 0:width, :] = image elif image_ratio < change_ratio: # imageが横長 canvas_width = width canvas_height = int(canvas_width / change_ratio) canvas = np.zeros( (canvas_height, canvas_width, 3), dtype=np.uint8) canvas[0:height, 0:width, :] = image else: canvas = image return canvas, canvas_height, canvas_width
StarcoderdataPython
9754580
<gh_stars>1-10 from src.core.sync_listener import sync_listener if __name__=='__main__': sync_listener()
StarcoderdataPython
9655959
from IMLearn import BaseEstimator from challenge.agoda_cancellation_estimator import AgodaCancellationEstimator # from IMLearn.utils import split_train_test import sklearn import numpy as np import pandas as pd def _to_date_number(features: pd.DataFrame, keys: list) -> None: for field in keys: features[field] = pd.to_datetime(features[field]) features[field] = features[field].apply(lambda x: x.value) def _to_day_of_week(features, full_data, keys): for field in keys: new_key = field + "_dayofweek" features[new_key] = pd.to_datetime(full_data[field]) features[new_key] = features[new_key].apply(lambda x: x.dayofweek) def _add_new_cols(features, full_data): _to_day_of_week(features, full_data, ["checkin_date", "checkout_date", "booking_datetime"]) features['stay_days'] = (pd.to_datetime(full_data['checkout_date']) - pd.to_datetime(full_data['checkin_date'])) features['stay_days'] = features['stay_days'].apply(lambda x: x.days) features['days_till_vacation'] = (pd.to_datetime(full_data['checkin_date']) - pd.to_datetime(full_data['booking_datetime'])) features['days_till_vacation'] = features['days_till_vacation'].apply(lambda x: x.days) features['is_checkin_on_weekend'] = features['checkin_date_dayofweek'].apply(lambda x: x > 4) # for title in ['checkout_date']: # del features[title] def _add_categories(features, full_data, titles): for title in titles: features = pd.concat((features, pd.get_dummies(full_data[title], drop_first=True)), axis=1) return features def load_data(filename: str, isTest: bool): """ Load Agoda booking cancellation dataset Parameters ---------- filename: str Path to house prices dataset Returns ------- Design matrix and response vector in either of the following formats: 1) Single dataframe with last column representing the response 2) Tuple of pandas.DataFrame and Series 3) Tuple of ndarray of shape (n_samples, n_features) and ndarray of shape (n_samples,) """ full_data = pd.read_csv(filename) # .dropna().drop_duplicates() good_fields = ["hotel_star_rating", "is_first_booking", "is_user_logged_in", "hotel_live_date", "guest_is_not_the_customer", "no_of_adults", "no_of_children", "no_of_extra_bed", "no_of_room"] features = full_data[good_fields] _add_new_cols(features, full_data) # adding columns for the length of the stay, is weekend, day of week features = _add_categories(features, full_data, ['accommadation_type_name', 'customer_nationality', 'hotel_country_code', 'charge_option', 'original_payment_type', 'original_payment_currency']) features_true_false = ["is_first_booking", "is_user_logged_in"] for f in features_true_false: features[f] = np.where(features[f] == True, 1, 0) # features["cancellation_datetime"].replace(np.nan, "", inplace=True) _to_date_number(features, ["hotel_live_date"]) features = features.loc[:, ~features.columns.duplicated()] features.reset_index(inplace=True, drop=True) if not isTest: labels = pd.to_numeric(pd.to_datetime(full_data["cancellation_datetime"])) labels.reset_index(inplace=True, drop=True) return features, labels return features def evaluate_and_export(estimator: BaseEstimator, X: np.ndarray, filename: str): """ Export to specified file the prediction results of given estimator on given testset. File saved is in csv format with a single column named 'predicted_values' and n_samples rows containing predicted values. Parameters ---------- estimator: BaseEstimator or any object implementing predict() method as in BaseEstimator (for example sklearn) Fitted estimator to use for prediction X: ndarray of shape (n_samples, n_features) Test design matrix to predict its responses filename: path to store file at """ predictions = estimator.predict(X) prediction_dates = pd.to_datetime(predictions) # pred = estimator.predict(X) pd.DataFrame(prediction_dates, columns=["predicted_values"]).to_csv(filename, index=False) def expand_to_train_data(test_data, train_columns): cols_to_add = set(train_columns) - set(test_data.columns) cols_to_remove = set(test_data.columns) - set(train_columns) for col in cols_to_add: test_data[col] = 0 for col in cols_to_remove: del test_data[col] test_data = test_data[list(train_columns)] return test_data if __name__ == '__main__': np.random.seed(0) # Load data df, cancellation_labels = load_data("../datasets/agoda_cancellation_train.csv", isTest=False) train_X, test_X, train_y, test_y = sklearn.model_selection.train_test_split(df, cancellation_labels) training_features = df.columns # Fit model over data estimator = AgodaCancellationEstimator().fit(train_X, train_y) test_set = load_data("./testsets/test_set_week_1.csv", isTest=True) test_set = expand_to_train_data(test_set, training_features) # Store model predictions over test set # evaluate_and_export(estimator, test_set, "206996761_212059679_211689765.csv") evaluate_and_export(estimator, test_X, "predicted.csv") pd.DataFrame(pd.to_datetime(test_y)).to_csv("testy.csv", index=False) print(f"Percent wrong classifications: {estimator.loss(test_X, test_y)}")
StarcoderdataPython
4970158
<filename>basic/aos.py<gh_stars>1-10 print("Enter size:") s=int(input()) a=s*s print("Area of square:",a)
StarcoderdataPython
1937469
import sys import numpy as np import matplotlib.pyplot as plt def displayImage(image, transpose=False): fig = plt.imshow(image.transpose(1,0,2)) if transpose else plt.imshow(image) plt.show() if len(sys.argv) > 1 and int(sys.argv[1]) == 0: from minecart import Minecart # Generate minecart from configuration file (2 ores + 1 fuel objective, 5 mines) json_file = "mine_config.json" env = Minecart.from_json(json_file) # # Or alternatively, generate a random instance # env = Minecart(mine_cnt=5,ore_cnt=2,capacity=1) else: from deep_sea_treasure import DeepSeaTreasure env = DeepSeaTreasure() # Initial State o_t = env.reset() displayImage(o_t, False) # print(o_t.shape) # exit(0) # flag indicates termination terminal = False while not terminal: # randomly pick an action # a_t = np.random.randint(env.action_space.shape[0]) a_t = int(input()) # apply picked action in the environment o_t1, r_t, terminal, s_t1 = env.step(a_t) # update state o_t = o_t1 # displayImage(s_t1["pixels"]) # displayImage(s_t1["pixels"], False) displayImage(o_t, False) print("Taking action", a_t, "with reward", r_t) env.reset()
StarcoderdataPython
4843872
"""This module contains logic responsible for configuring the worker.""" from configparser import ConfigParser from logging import config from os import path from typing import Optional from celery import Celery # noqa: F401 Imported for type definition # Disable line too long warnings - configuration looks better in one line. # pylint: disable=line-too-long PATH_TO_DEFAULT_CONFIGURATION_FILE: str = path.join(path.dirname(path.abspath(__file__)), "../..", "config.ini") # noqa: E501 PATH_TO_OVERRIDE_CONFIGURATION_FILE: str = path.join(path.dirname(path.abspath(__file__)), "../..", "config-override.ini") # noqa: E501 PATH_TO_LOG_CONFIGURATION_FILE: str = path.join(path.dirname(path.abspath(__file__)), "../..", "logging.conf") # noqa: E501 CONFIGURATION_FILE: Optional[ConfigParser] = None def load_config_file() -> ConfigParser: """Load configuration file into ConfigParser instance.""" global CONFIGURATION_FILE # pylint: disable=global-statement if not CONFIGURATION_FILE: CONFIGURATION_FILE = ConfigParser() CONFIGURATION_FILE.read([ PATH_TO_DEFAULT_CONFIGURATION_FILE, PATH_TO_OVERRIDE_CONFIGURATION_FILE ], "utf-8") return CONFIGURATION_FILE def configure_logger() -> None: """Apply settings from configuration file to loggers.""" config.fileConfig(PATH_TO_LOG_CONFIGURATION_FILE) def configure_celery_app(celery_app: Celery) -> None: """Apply configuration settings to celery application instance.""" configuration: ConfigParser = load_config_file() celery_app.conf.update( broker_url=configuration.get(section="celery", option="broker_url", fallback="redis://localhost:6379/0"), # noqa: E501 enable_utc=configuration.getboolean(section="celery", option="enable_utc", fallback=True), # noqa: E501 imports=configuration.get(section="celery", option="imports", fallback="pipwatch_worker.celery_components.tasks").split(","), # noqa: E501 result_backend=configuration.get(section="celery", option="result_backend", fallback="redis://localhost:6379/0") # noqa: E501 )
StarcoderdataPython
8007748
# -*- coding: utf-8 -*- from __future__ import absolute_import from __future__ import division from __future__ import print_function from __future__ import unicode_literals range = getattr(__builtins__, 'xrange', range) # end of py2 compatability boilerplate # Third-party imports import numpy as np # Project imports from matrixprofile import core def validate_preprocess_kwargs(preprocessing_kwargs): """ Tests the arguments of preprocess function and raises errors for invalid arguments. Parameters ---------- preprocessing_kwargs : dict-like or None or False A dictionary object to store keyword arguments for the preprocess function. It can also be None/False/{}/"". Returns ------- valid_kwargs : dict-like or None The valid keyword arguments for the preprocess function. Returns None if the input preprocessing_kwargs is None/False/{}/"". Raises ------ ValueError If preprocessing_kwargs is not dict-like or None. If gets invalid key(s) for preprocessing_kwargs. If gets invalid value(s) for preprocessing_kwargs['window'], preprocessing_kwargs['impute_method'] preprocessing_kwargs['impute_direction'] and preprocessing_kwargs['add_noise']. """ if preprocessing_kwargs: valid_preprocessing_kwargs_keys = {'window', 'impute_method', 'impute_direction', 'add_noise'} if not isinstance(preprocessing_kwargs,dict): raise ValueError("The parameter 'preprocessing_kwargs' is not dict like!") elif set(preprocessing_kwargs.keys()).issubset(valid_preprocessing_kwargs_keys): window = 4 impute_method = 'mean' impute_direction = 'forward' add_noise = True methods = ['mean', 'median', 'min', 'max'] directions = ['forward', 'fwd', 'f', 'backward', 'bwd', 'b'] if 'window' in preprocessing_kwargs.keys(): if not isinstance(preprocessing_kwargs['window'],int): raise ValueError("The value for preprocessing_kwargs['window'] is not an integer!") window = preprocessing_kwargs['window'] if 'impute_method' in preprocessing_kwargs.keys(): if preprocessing_kwargs['impute_method'] not in methods: raise ValueError('invalid imputation method! valid include options: ' + ', '.join(methods)) impute_method = preprocessing_kwargs['impute_method'] if 'impute_direction' in preprocessing_kwargs.keys(): if preprocessing_kwargs['impute_direction'] not in directions: raise ValueError('invalid imputation direction! valid include options: ' + ', '.join(directions)) impute_direction = preprocessing_kwargs['impute_direction'] if 'add_noise' in preprocessing_kwargs.keys(): if not isinstance(preprocessing_kwargs['add_noise'],bool): raise ValueError("The value for preprocessing_kwargs['add_noise'] is not a boolean value!") add_noise = preprocessing_kwargs['add_noise'] valid_kwargs = { 'window': window, 'impute_method': impute_method, 'impute_direction': impute_direction, 'add_noise': add_noise } else: raise ValueError('invalid key(s) for preprocessing_kwargs! ' 'valid key(s) should include '+ str(valid_preprocessing_kwargs_keys)) else: valid_kwargs = None return valid_kwargs def is_subsequence_constant(subsequence): """ Determines whether the given time series subsequence is an array of constants. Parameters ---------- subsequence : array_like The time series subsequence to analyze. Returns ------- is_constant : bool A boolean value indicating whether the given subsequence is an array of constants. """ if not core.is_array_like(subsequence): raise ValueError('subsequence is not array like!') temp = core.to_np_array(subsequence) is_constant = np.all(temp == temp[0]) return is_constant def add_noise_to_series(series): """ Adds noise to the given time series. Parameters ---------- series : array_like The time series subsequence to be added noise. Returns ------- temp : array_like The time series subsequence after being added noise. """ if not core.is_array_like(series): raise ValueError('series is not array like!') temp = np.copy(core.to_np_array(series)) noise = np.random.uniform(0, 0.0000009, size=len(temp)) temp = temp + noise return temp def impute_missing(ts, window, method='mean', direction='forward'): """ Imputes missing data in time series. Parameters ---------- ts : array_like The time series to be handled. window : int The window size to compute the mean/median/minimum value/maximum value. method : string, Default = 'mean' A string indicating the data imputation method, which should be 'mean', 'median', 'min' or 'max'. direction : string, Default = 'forward' A string indicating the data imputation direction, which should be 'forward', 'fwd', 'f', 'backward', 'bwd', 'b'. If the direction is forward, we use previous data for imputation; if the direction is backward, we use subsequent data for imputation. Returns ------- temp : array_like The time series after being imputed missing data. """ method_map = { 'mean': np.mean, 'median': np.median, 'min': np.min, 'max': np.max } directions = ['forward', 'fwd', 'f', 'backward', 'bwd', 'b'] if not core.is_array_like(ts): raise ValueError('ts is not array like!') if method not in method_map: raise ValueError('invalid imputation method! valid include options: {}'.format(', '.join(method_map.keys()))) if direction not in directions: raise ValueError('invalid imputation direction! valid include options: ' + ', '.join(directions)) if not isinstance(window, int): raise ValueError("window is not an integer!") temp = np.copy(core.to_np_array(ts)) nan_infs = core.nan_inf_indices(temp) func = method_map[method] # Deal with missing data at the beginning and end of time series if np.isnan(temp[0]) or np.isinf(temp[0]): temp[0] = temp[~nan_infs][0] nan_infs = core.nan_inf_indices(temp) if np.isnan(temp[-1]) or np.isinf(temp[-1]): temp[-1] = temp[~nan_infs][-1] nan_infs = core.nan_inf_indices(temp) index_order = None if direction.startswith('f'): # Use previous data for imputation / fills in data in a forward direction index_order = range(len(temp) - window + 1) elif direction.startswith('b'): # Use subsequent data for imputation / fills in data in a backward direction index_order = range(len(temp) - window + 1, 0, -1) for index in index_order: start = index end = index + window has_missing = np.any(nan_infs[index:index + window]) if has_missing: subseq = temp[start:end] nan_infs_subseq = nan_infs[start:end] stat = func(temp[start:end][~nan_infs_subseq]) temp[start:end][nan_infs_subseq] = stat # Update nan_infs after array 'temp' is changed nan_infs = core.nan_inf_indices(temp) return temp def preprocess(ts, window, impute_method='mean', impute_direction='forward', add_noise=True): """ Preprocesses the given time series by adding noise and imputing missing data. Parameters ---------- ts : array_like The time series to be preprocessed. window : int The window size to compute the mean/median/minimum value/maximum value. method : string, Default = 'mean' A string indicating the data imputation method, which should be 'mean', 'median', 'min' or 'max'. direction : string, Default = 'forward' A string indicating the data imputation direction, which should be 'forward', 'fwd', 'f', 'backward', 'bwd', 'b'. If the direction is forward, we use previous data for imputation; if the direction is backward, we use subsequent data for imputation. add_noise : bool, Default = True A boolean value indicating whether noise needs to be added into the time series. Returns ------- temp : array_like The time series after being preprocessed. """ if not core.is_array_like(ts): raise ValueError('ts is not array like!') temp = np.copy(core.to_np_array(ts)) # impute missing temp = impute_missing(temp, window, method=impute_method, direction=impute_direction) # handle constant values if add_noise: for index in range(len(temp) - window + 1): start = index end = index + window subseq = temp[start:end] if is_subsequence_constant(subseq): temp[start:end] = add_noise_to_series(subseq) return temp
StarcoderdataPython
6413993
#!/usr/bin/env python from __future__ import print_function import codecs import argparse from doremi.doremi_parser import DoremiParser from doremi.lyric_parser import Lyric, LyricParser import os, uuid # set up argument parser and use it p = argparse.ArgumentParser() p.add_argument("infile", help="the Doremi file to process") p.add_argument("outfile", help="the Lilypond output file") p.add_argument("--key", "-k", help='the key for the output file (e.g. "A major", "c minor", "gis minor")') p.add_argument("--shapes", "-s", help='use shape notes (i.e. "round" (default), "aikin", "sacredharp", "southernharmony", "funk", "walker")') p.add_argument("--octaves", "-o", help="transpose up OCTAVES octaves") p.add_argument("--lyricfile", "-l", help="the file containing the lyrics") p.add_argument("--template", "-t", help='the output template name, e.g. "default", "sacred-harp"') args = p.parse_args() if args.octaves: octave_offset = int(args.octaves) else: octave_offset = 0 # try to load the lyric file; if none is specified, use an empty # Lyric lyric = Lyric() if args.lyricfile: try: text = codecs.open(args.lyricfile, "r", "utf-8").read() lyric = LyricParser(text).convert() except FileNotFoundError: raise Exception("Unable to open lyric file '%s'." % args.lyricfile) # correct a common misspelling if args.shapes and args.shapes.lower() == "aiken": args.shapes = "aikin" if not args.template: args.template = "default" # parse the Doremi file lc = DoremiParser(args.infile) # convert it to the internal representation tune = lc.convert() if not args.key: args.key = tune.key # convert it to lilypond and write to the output file ly = tune.to_lilypond(args.key.lower(), octave_offset=octave_offset, shapes=args.shapes, lyric=lyric, template=args.template) if args.outfile.endswith(".pdf"): fn = "%s.ly" % uuid.uuid4() lyfile = codecs.open("/tmp/%s" % fn, "w", "utf-8") lyfile.write(ly) lyfile.close() args.outfile = args.outfile[:-4] os.system("lilypond -o %s /tmp/%s" % (args.outfile, fn)) elif args.outfile.endswith(".ly"): with codecs.open(args.outfile, "w", "utf-8") as f: f.write(ly)
StarcoderdataPython
5127032
<gh_stars>1-10 #!/usr/bin/env python3 # Author : <NAME> # Edited : <NAME> # Date : 2018-03-23 # Aim : Aggregates duplicated compounds (tested at same concentration) of HTS assays and returns activity flags from Z-score or activity readout. # # 1/ Determines the most common concentration of an HTS assay # # 2/ Selects records with most common concentration +/- tolerance (default tolerance=0.05) # # 3/ Sets the "activity flag". # > Z_SCORE_RESULT_FLAG if defined # > RESULT_FLAG if Z_SCORE_RESULT_FLAG not defined. # > Discard record if none of the flags are defined # # 4/ Aggregates flags of duplicated records: most common flag (A for active, N for negative). # > A if count(N) = count(A). # # 5/ Prints "pre-processed" HTS assay files for HTS-FP generation: # > compound-id # > activity flag # > concentration # > flag source # # 6/ Prints counts relative to assays in stdout: # > assay file # > most common concentration # > tolerance (+/-) # > total number of record in the assay file # > number of records with most common concentration +/- tolerance # > number of unique compounds with most common concentration +/- tolerance # > time spent for processing the file import time import sys, os #import numpy as np #import pandas as pd if len(sys.argv) != 3: print ('Usage : python ' + sys.argv[0] + ' [ Raw hts data ] [ output folder ]') quit() output = sys.argv[2] if not os.path.isdir(output): print ('Usage : python ' + sys.argv[0] + ' [ Raw hts data ] [ output folder ]') sys.stderr.write("ERROR: can't find output folder at {}\n".format(output)) sys.exit() if output[-1] != '/': output=output+'/' # headers header = "CID\tflag\n" # READ the list of assay files assay_list = [] for file in os.listdir(sys.argv[1]): assay_list.append(file) #content = open(sys.argv[1]).read().splitlines() start = time.time() sys.stderr.write('assays:{}\n'.format(len(assay_list))) # loop through the assays K=0 for assay in assay_list: assay_path = sys.argv[1]+assay f_type = assay.split('.')[-1] f_string = list(assay) if f_type != 'tsv': print('file: {} ==> is not of type .tsv, moving to next file'.format(assay)) continue K+=1 sys.stderr.write('{}\t({}/{})\t\r'.format(assay,K,len(assay_list))) # check if file is already present: if present, can we skip => NO because the assay can be updated (there are some with more than one data). # if os.path.exists(assay_path) == True: # #print('Assay with name: {} already exists under this outpath, moving on to next assay. Change outpath or move/rename existing files'.format(assay)) # continue if not os.path.isfile(assay_path): sys.stderr.write("ERROR: can't find file {}\n".format(assay_path)) continue cmpd_data={} start_assay = time.time() assay_content = open(assay_path, encoding='latin-1').read().splitlines() n_cmpd_total = len(assay_content) n_cmpd_interest = 0 first_line = False n_head_rows = 0 for line in assay_content: if line[0] == '1': first_line = True; if line[0] + line[1] == '1\t': print('\nnumber of head rows: {}'.format(n_head_rows)) if first_line == True: linelist = line.split("\t") # Sid = linelist[1] Cid = linelist[2] flag = linelist[3] # no CID number => SKIP #use Sample ID: sid? if Cid=='': continue # FLAG SELECTION if flag == 'Inactive': flag = 'N' elif flag == 'Active': flag = 'A' elif flag == 'Inconclusive': continue elif flag == 'Unspecified': continue elif flag == '': print('{} No flag set for CID: {}'.format(assay, Cid)); continue else: print('{} unknown flag: {}'.format(assay, flag), end='\n'); continue n_cmpd_interest+=1 # APPEND COMPOUND RECORD(S) IN A DICTIONNARY if Cid not in cmpd_data: cmpd_data[Cid]={'flag':[],'assay':assay} cmpd_data[Cid]['flag'].append(flag) else: n_head_rows += 1 # SKIP IF NO COMPOUNDS - should never happen if len(cmpd_data)==0: end_assay = time.time() sys.stdout.write(assay+"\t"+str(n_cmpd_total)+"\t"+str(n_cmpd_interest)+"\t"+str(len(cmpd_data))+"\t"+str(round(end_assay-start_assay,5))+"\n") continue # AGGREGATION # flag : most common value, if equal number of As and Ns, select A. fout=open(output+assay.split('/')[-1],'w') fout.write(header) for cmpd in cmpd_data: # compound has multiple records if len(cmpd_data[cmpd]['flag']) > 1: flag = '//' n = [x for x in cmpd_data[cmpd]['flag'] if x=='N'] if len(n) > len(cmpd_data[cmpd]['flag'])/2: flag = 'N' # if there are more Ns than half of the total number of records for the compound, select N. else:flag='A' fout.write(cmpd+"\t"+flag+"\n") # compound has single record else: fout.write(cmpd+"\t"+cmpd_data[cmpd]['flag'][0]+"\n") fout.close() # log end_assay = time.time() sys.stdout.write(assay+"\t"+str(n_cmpd_total)+"\t"+str(n_cmpd_interest)+"\t"+str(len(cmpd_data))+"\t"+str(round(end_assay-start_assay,5))+"\n") # save compound set to file print("Elapsed time: {}".format(time.time()-start))
StarcoderdataPython
3498681
<reponame>sfu-arch/uir-lib #!/usr/bin/env python3 import argparse import json import sys import re import os.path from os import path def main(argv): parser = argparse.ArgumentParser(description='Short sample app') parser.add_argument('-s', '--scala-file', action='store', dest='input', required=True, help = 'input scala file') parser.add_argument('-c', '--config-file', action='store', dest='config', required=True, help = 'input config file') args = parser.parse_args(argv) if path.isfile(args.input) and args.input.lower().endswith('scala'): print("Input scala file: {}".format(args.input)) else: print("Input scala file is not valid!") return if path.isfile(args.config) and args.config.lower().endswith('json'): print("Input IR file: {}".format(args.config)) else: print("Input config file is not valid!") return with open(args.config) as json_file: config = json.load(json_file) new_file = args.input.replace('.scala', '-guardval.scala') guard_val_file = open(new_file,"w+") with open(args.input) as input_scala: for line in input_scala: if line.lstrip().startswith('val'): reg = re.findall(r'ID = (.+?), .* ', line.lstrip()) if reg: UID = reg[0] node_filter = list(filter(lambda n : n['UID'] == int(UID) ,config['module']['node'])) if(node_filter != []): for node in node_filter: guard_val_file.write(line.replace('))', ', GuardVal = ' + str(node['Value']) + ')')) else: guard_val_file.write(line) else: guard_val_file.write(line) guard_val_file.close() if __name__ == "__main__": main(sys.argv[1:])
StarcoderdataPython
5051831
from flask import Flask app = Flask(__name__) @app.route('/') def index(): return app.send_static_file('index.html') if __name__ == '__main__': app.run(port = 8765, threaded = True, debug = True)
StarcoderdataPython
1900148
<reponame>nullzero/wprobot #!/usr/bin/python # -*- coding: utf-8 -*- """Delete unnecessary redirect.""" __version__ = "1.0.0" __author__ = "<NAME>" import init import wp import pywikibot from pywikibot.tools import itergroup def glob(): pass def process(lst): exist = site.pagesexist([x.toggleTalkPage().title() for x in lst]) for i, page in enumerate(lst): if not exist[i][0]: if "/" in page.title(): if page.parentPage().toogleTalkPage().exists(): continue elif wp.handlearg("manual", args): continue if (page.botMayEdit() and (site.getcurrenttime() - page.editTime()).days >= 30): pywikibot.output("deleting " + page.title()) page.delete(reason=u"โรบอต: หน้าขึ้นกับหน้าว่าง", prompt=False) else: pywikibot.output("can't delete " + page.title()) def main(): namespaces = [x for x in range(1, 16, 2) if x not in [3, 5]] for ns in namespaces: gen = site.allpages(namespace=ns, filterredir=True) for i in gen: pywikibot.output("deleting " + i.title()) i.delete(reason=u"โรบอต: หน้าเปลี่ยนทางไม่จำเป็น", prompt=False) for ns in namespaces: pywikibot.output("ns " + str(ns)) gen = site.allpages(namespace=ns, content=True) for i, pages in enumerate(itergroup(gen, 5000)): pywikibot.output("processing bunch %d" % i) process(pages) args, site, conf = wp.pre(3, lock=True, main=__name__) try: glob() wp.run(main) except: wp.posterror() else: wp.post()
StarcoderdataPython
9798432
def _get_data_from_xml(doclist, fieldname, nohitreturn=None): """Get the fieldname (i.e. author, title etc) from minidom.parseString().childNodes[0].childNodes list """ result = [] for element in doclist: fieldlist = element.getElementsByTagName(fieldname) try: tmp = fieldlist[0] except IndexError: fields = [nohitreturn] fields = [] for field in fieldlist: # this is useful for e.g. author field fields.append(field.childNodes[0].data) result.append(fields) return result
StarcoderdataPython
3298971
""" Module with functions for working with videos for the TeamReel product. """ # ---------------------------------------------------------------------------- # Import libraries/modules/functions we will use: # External (third-party): import cv2 # import dlib # from imutils import paths import numpy as np import os # import tensorflow as tf # from tensorflow import keras # Internal for our project: # ---------------------------------------------------------------------------- def get_frames_from_video(video_filename:str): """ Saves all frames from the specified video in subdirectory 'video_frames'. """ # Start capturing the video from the video file: # cv2.VideoCapture(0): From first camera or webcam # cv2.VideoCapture(1): From second camera or webcam # cv2.VideoCapture("file name.mp4"): From video file vid = cv2.VideoCapture(video_filename) # Exit if the video capture did not start successfully: if not vid.isOpened(): print("Error: Cannot open video file.") exit() # Make temp directory 'video_frames' to put the frames in: dir_name = 'video_frames' if not os.path.exists('video_frames'): os.makedirs('video_frames') # Get frames: current_frame = 0 total_frames = vid.get(cv2.CAP_PROP_FRAME_COUNT) print(f"Total frames: {total_frames}") frame_width = vid.get(cv2.CAP_PROP_FRAME_WIDTH) frame_height = vid.get(cv2.CAP_PROP_FRAME_HEIGHT) print(f"Frame width x height: {frame_width} x {frame_height}") fps = vid.get(cv2.CAP_PROP_FPS) print(f"Frames per second (FPS): {fps}") while current_frame <= (total_frames - 1): # Get the next frame in the video: returned, frame = vid.read() if not returned: print("Video stream has ended (cannot receive next frame). Exiting.") break # # Resize the frame: # frame = cv2.resize(frame, # None, # fx = 0.80, # fy = 0.80, # interpolation = cv2.INTER_AREA) # # Convert frame from BGR color to grayscale: # frame_grayscale = cv2.cvtColor(frame, cv2.COLOR_BGR2GRAY) # Save frame as image in 'video_frames' directory: filename = f"./{dir_name}/frame_{str(current_frame)}.jpg" print(f"Creating {filename}") # [?? To do -- remove ??] cv2.imwrite(filename, frame) current_frame += 1 # Release the video capture object & close OpenCV windows: vid.release() cv2.destroyAllWindows() # ---------------------------------------------------------------------------- def play_video_file(video_filename:str): """ Plays the specified video file. """ # Start capturing the video from the video file: vid = cv2.VideoCapture(video_filename) # Exit if the video capture did not start successfully: if not vid.isOpened(): print("Error: Cannot open video file.") exit() while True: # Get the next frame in the video: returned, frame = vid.read() if not returned: print("Video stream has ended (cannot receive next frame). Exiting.") break # Display the frame: cv2.imshow('Frame', frame) # Use the "q" key as the quit command: # waitKey(0 or <= 0): waits for a key event infinitely # waitKey(x:int): waits for a key event for x milliseconds (when x > 0) if cv2.waitKey(1) & 0xFF == ord('q'): break # Release the video capture object & close OpenCV windows: vid.release() cv2.destroyAllWindows() # ----------------------------------------------------------------------------
StarcoderdataPython
9767122
import matplotlib.pyplot as plt import matplotlib.patches as patches plt.figure(figsize=(10,10)) plt.axis('off') cz2 = (0.7, 0.7, 0.7) cz = (0.3, 0.3, 0.3) cy = (0.7, 0.4, 0.12) ci = (0.1, 0.3, 0.5) ct = (0.7, 0.2, 0.1) def ln_func(text, x, y, color, mode=None): if mode is None: color_font = b_color = color alpha_bg = 0 elif mode == 'i': color_font = 'white' b_color = color alpha_bg = 1 elif mode == 'b': color_font = b_color = color color = 'white' alpha_bg = 1 plt.text(x, y, text, ha="left", va="top", color=color_font, bbox=dict(boxstyle="round", alpha=alpha_bg, ec=b_color, fc=color)) def ln_func2(text, x, y, color, mode=None): if mode is None: color_font = b_color = color alpha_bg = 0 elif mode == 'i': color_font = 'white' b_color = color alpha_bg = 1 elif mode == 'b': color_font = b_color = color color = 'white' alpha_bg = 1 plt.text(x, y, text, ha="center", va="top", fontsize=16, color=color_font, bbox=dict(boxstyle="round", alpha=alpha_bg, ec=b_color, fc=color)) ty = 0.8 tx = 0.2 plt.arrow(tx, ty, 0.48-tx, 0.85-ty, color=ci) ln_func('$\\bf{h}_{[cls]}$', tx, ty, ci, 'i') tx += 0.06 ln_func('...', tx, ty, cz) tx += 0.03 ln_func('$\\bf{h}_{-1}$', tx, ty, ct, 'b') tx += 0.05 plt.arrow(tx, ty, 0.48-tx, 0.85-ty, color=ct) ln_func('$\\bf{h}$', tx, ty, ct, 'i') tx += 0.03 plt.arrow(tx, ty, 0.48-tx, 0.85-ty, color=ct) ln_func('$\\bf{h}$', tx, ty, ct, 'i') tx += 0.03 plt.arrow(tx, ty, 0.48-tx, 0.85-ty, color=ct) ln_func('$\\bf{h}$', tx, ty, ct, 'i') tx += 0.03 ln_func('$\\bf{h}_{+1}$', tx, ty, ct, 'b') tx += 0.05 ln_func(' Pooling ', tx-0.08, ty+0.07, cz, 'b') plt.arrow(tx, ty+0.07, 0, 0.021, color=cz) ln_func(' Class Label ', tx-0.08, ty+0.12, cz, 'i') ln_func('...', tx, ty, cz) tx += 0.035 ln_func('$\\bf{h\'}_{-1}$', tx, ty, cy, 'b') tx += 0.06 plt.arrow(tx, ty, 0.48-tx, 0.85-ty, color=cy) ln_func('$\\bf{h\'}$', tx, ty, cy, 'i') tx += 0.035 plt.arrow(tx, ty, 0.48-tx, 0.85-ty, color=cy) ln_func('$\\bf{h\'}$', tx, ty, cy, 'i') tx += 0.035 plt.arrow(tx, ty, 0.48-tx, 0.85-ty, color=cy) ln_func('$\\bf{h\'}$', tx, ty, cy, 'i') tx += 0.035 ln_func('$\\bf{h\'}_{+1}$', tx, ty, cy, 'b') tx += 0.055 ln_func('...', tx, ty, cz) plt.text(0.27,0.70,'Encoder Model', fontsize=30, color=cz2) rect = patches.Rectangle((0.175,0.65),0.6,0.17,linewidth=2,edgecolor=cz2,facecolor='none') # Add the patch to the Axes plt.gca().add_patch(rect) #plt.show() plt.savefig('figuremask', dpi=1500)
StarcoderdataPython
4976469
<reponame>p7g/dd-trace-py<gh_stars>0 from ddtrace import tracer if __name__ == "__main__": assert tracer._tags.get("a") == "True" assert tracer._tags.get("b") == "0" assert tracer._tags.get("c") == "C" print("Test success")
StarcoderdataPython
6586348
from setuptools import setup import simple_irc setup( name = 'simple_irc', py_modules = ['simple_irc'], version = simple_irc.__version__, description = 'A simple, Pythonic IRC interface', author = '<NAME>', author_email = '<EMAIL>', url = 'https://github.com/maxrothman/' + simple_irc.__name__, download_url = 'https://github.com/maxrothman/simple_irc/tarball/' + simple_irc.__version__, keywords = 'simple IRC', classifiers = [ 'Development Status :: 4 - Beta', 'Intended Audience :: Developers', 'License :: OSI Approved :: MIT License', 'Topic :: Internet', 'Topic :: Software Development :: Libraries', 'Programming Language :: Python :: 2', 'Programming Language :: Python :: 3' ], )
StarcoderdataPython
99133
import unittest import os import numpy as np from phonopy.interface.phonopy_yaml import read_cell_yaml from phono3py.phonon3.triplets import (get_grid_point_from_address, get_grid_point_from_address_py) data_dir = os.path.dirname(os.path.abspath(__file__)) class TestTriplets(unittest.TestCase): def setUp(self): self._cell = read_cell_yaml(os.path.join(data_dir, "POSCAR.yaml")) def tearDown(self): pass def test_get_grid_point_from_address(self): self._mesh = (10, 10, 10) print("Compare get_grid_point_from_address from spglib and that " "written in python") print("with mesh numbers [%d %d %d]" % self._mesh) for address in list(np.ndindex(self._mesh)): gp_spglib = get_grid_point_from_address(address, self._mesh) gp_py = get_grid_point_from_address_py(address, self._mesh) # print("%s %d %d" % (address, gp_spglib, gp_py)) self.assertEqual(gp_spglib, gp_py) if __name__ == '__main__': suite = unittest.TestLoader().loadTestsFromTestCase(TestTriplets) unittest.TextTestRunner(verbosity=2).run(suite)
StarcoderdataPython
1630892
<gh_stars>100-1000 from django.utils.decorators import method_decorator from django.views.decorators.cache import never_cache from rest_framework import mixins, status, viewsets from rest_framework.response import Response from salesman.basket.models import Basket from .payment import PaymentError, payment_methods_pool from .serializers import CheckoutSerializer class CheckoutViewSet(mixins.CreateModelMixin, viewsets.GenericViewSet): """ Checkout API endpoint. """ serializer_class = CheckoutSerializer def get_view_name(self): name = super().get_view_name() if name == "Checkout List": return "Checkout" return name def get_queryset(self): pass def get_serializer_context(self): context = super().get_serializer_context() context['basket'], _ = Basket.objects.get_or_create_from_request(self.request) context['basket'].update(self.request) return context @method_decorator(never_cache) def dispatch(self, request, *args, **kwargs): return super().dispatch(request, *args, **kwargs) def create(self, request, *args, **kwargs): """ Process the checkout, handle ``PaymentError``. """ try: return super().create(request, *args, **kwargs) except PaymentError as e: return Response({'detail': str(e)}, status=status.HTTP_402_PAYMENT_REQUIRED) def list(self, request, *args, **kwargs): """ Show a list of payment methods with errors if they exist. """ instance = {'payment_methods': payment_methods_pool.get_payments('basket')} serializer = self.get_serializer(instance) return Response(serializer.data)
StarcoderdataPython
6568655
# -*- coding: utf-8 -*- ########################################################################### # Copyright (c), The AiiDA team. All rights reserved. # # This file is part of the AiiDA code. # # # # The code is hosted on GitHub at https://github.com/aiidateam/aiida_core # # For further information on the license, see the LICENSE.txt file # # For further information please visit http://www.aiida.net # ########################################################################### """ Tests for calculation nodes, attributes and links """ from aiida.common.exceptions import ModificationNotAllowed from aiida.backends.testbase import AiidaTestCase class TestCalcNode(AiidaTestCase): """ These tests check the features of Calculation nodes that differ from the base Node type """ boolval = True intval = 123 floatval = 4.56 stringval = "aaaa" # A recursive dictionary dictval = {'num': 3, 'something': 'else', 'emptydict': {}, 'recursive': {'a': 1, 'b': True, 'c': 1.2, 'd': [1, 2, None], 'e': {'z': 'z', 'x': None, 'xx': {}, 'yy': []}}} listval = [1, "s", True, None] emptydict = {} emptylist = [] def test_updatable_not_copied(self): """ Checks the versioning. """ from aiida.orm.test import myNodeWithFields # Has 'state' as updatable attribute a = myNodeWithFields() a._set_attr('state', 267) a.store() b = a.copy() # updatable attributes are not copied with self.assertRaises(AttributeError): b.get_attr('state') def test_delete_updatable_attributes(self): """ Checks the versioning. """ from aiida.orm.test import myNodeWithFields # Has 'state' as updatable attribute a = myNodeWithFields() attrs_to_set = { 'bool': self.boolval, 'integer': self.intval, 'float': self.floatval, 'string': self.stringval, 'dict': self.dictval, 'list': self.listval, 'state': 267, # updatable } for k, v in attrs_to_set.iteritems(): a._set_attr(k, v) # Check before storing self.assertEquals(267, a.get_attr('state')) a.store() # Check after storing self.assertEquals(267, a.get_attr('state')) # Even if I stored many attributes, this should stay at 1 self.assertEquals(a.dbnode.nodeversion, 1) # I should be able to delete the attribute a._del_attr('state') # I check increment on new version self.assertEquals(a.dbnode.nodeversion, 2) with self.assertRaises(AttributeError): # I check that I cannot modify this attribute _ = a.get_attr('state') def test_versioning_and_updatable_attributes(self): """ Checks the versioning. """ from aiida.orm.test import myNodeWithFields # Has 'state' as updatable attribute a = myNodeWithFields() attrs_to_set = { 'bool': self.boolval, 'integer': self.intval, 'float': self.floatval, 'string': self.stringval, 'dict': self.dictval, 'list': self.listval, 'state': 267, } expected_version = 1 for k, v in attrs_to_set.iteritems(): a._set_attr(k, v) # Check before storing self.assertEquals(267, a.get_attr('state')) a.store() # Even if I stored many attributes, this should stay at 1 self.assertEquals(a.dbnode.nodeversion, expected_version) # Sealing ups the version number a.seal() expected_version += 1 self.assertEquals(a.dbnode.nodeversion, expected_version) # Check after storing self.assertEquals(267, a.get_attr('state')) self.assertEquals(a.dbnode.nodeversion, expected_version) # I check increment on new version a.set_extra('a', 'b') expected_version += 1 self.assertEquals(a.dbnode.nodeversion, expected_version) # I check that I can set this attribute a._set_attr('state', 999) expected_version += 1 # I check increment on new version self.assertEquals(a.dbnode.nodeversion, expected_version) with self.assertRaises(ModificationNotAllowed): # I check that I cannot modify this attribute a._set_attr('otherattribute', 222) # I check that the counter was not incremented self.assertEquals(a.dbnode.nodeversion, expected_version) # In both cases, the node version must increase a.label = 'test' expected_version += 1 self.assertEquals(a.dbnode.nodeversion, expected_version) a.description = 'test description' expected_version += 1 self.assertEquals(a.dbnode.nodeversion, expected_version) b = a.copy() # updatable attributes are not copied with self.assertRaises(AttributeError): b.get_attr('state')
StarcoderdataPython
1649666
<gh_stars>1-10 #!/usr/bin/env python import sys, KismetRest, pprint if len(sys.argv) < 2: print "Expected server URI" sys.exit(1) kr = KismetRest.KismetConnector(sys.argv[1]) # Get sources sources = kr.old_sources() pprint.pprint(sources)
StarcoderdataPython
11265561
''' Common header for simple client/server example Copyright (C) <NAME> 2021 MIT License ''' ADDR = 'localhost' # Change for actual deployment PORT = 20000
StarcoderdataPython
9769418
<filename>src/bag/interface/server.py # SPDX-License-Identifier: BSD-3-Clause AND Apache-2.0 # Copyright 2018 Regents of the University of California # All rights reserved. # # Redistribution and use in source and binary forms, with or without # modification, are permitted provided that the following conditions are met: # # * Redistributions of source code must retain the above copyright notice, this # list of conditions and the following disclaimer. # # * Redistributions in binary form must reproduce the above copyright notice, # this list of conditions and the following disclaimer in the documentation # and/or other materials provided with the distribution. # # * Neither the name of the copyright holder nor the names of its # contributors may be used to endorse or promote products derived from # this software without specific prior written permission. # # THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" # AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE # IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE # DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE LIABLE # FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL # DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR # SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER # CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, # OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE # OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. # Copyright 2019 Blue Cheetah Analog Design Inc. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. """This class defines SkillOceanServer, a server that handles skill/ocean requests. The SkillOceanServer listens for skill/ocean requests from bag. Skill commands will be forwarded to Virtuoso for execution, and Ocean simulation requests will be handled by starting an Ocean subprocess. It also provides utility for bag to query simulation progress and allows parallel simulation. Client-side communication: the client will always send a request object, which is a python dictionary. This script processes the request and sends the appropriate commands to Virtuoso. Virtuoso side communication: To ensure this process receive all the data from Virtuoso properly, Virtuoso will print a single line of integer indicating the number of bytes to read. Then, virtuoso will print out exactly that many bytes of data, followed by a newline (to flush the standard input). This script handles that protcol and will strip the newline before sending result back to client. """ import traceback import bag.io def _object_to_skill_file_helper(py_obj, file_obj): """Recursive helper function for object_to_skill_file Parameters ---------- py_obj : any the object to convert. file_obj : file the file object to write to. Must be created with bag.io package so that encodings are handled correctly. """ # fix potential raw bytes py_obj = bag.io.fix_string(py_obj) if isinstance(py_obj, str): # string file_obj.write(py_obj) elif isinstance(py_obj, float): # prepend type flag file_obj.write('#float {:f}'.format(py_obj)) elif isinstance(py_obj, bool): bool_val = 1 if py_obj else 0 file_obj.write('#bool {:d}'.format(bool_val)) elif isinstance(py_obj, int): # prepend type flag file_obj.write('#int {:d}'.format(py_obj)) elif isinstance(py_obj, list) or isinstance(py_obj, tuple): # a list of other objects. file_obj.write('#list\n') for val in py_obj: _object_to_skill_file_helper(val, file_obj) file_obj.write('\n') file_obj.write('#end') elif isinstance(py_obj, dict): # disembodied property lists file_obj.write('#prop_list\n') for key, val in py_obj.items(): file_obj.write('{}\n'.format(key)) _object_to_skill_file_helper(val, file_obj) file_obj.write('\n') file_obj.write('#end') else: raise Exception('Unsupported python data type: %s' % type(py_obj)) def object_to_skill_file(py_obj, file_obj): """Write the given python object to a file readable by Skill. Write a Python object to file that can be parsed into equivalent skill object by Virtuoso. Currently only strings, lists, and dictionaries are supported. Parameters ---------- py_obj : any the object to convert. file_obj : file the file object to write to. Must be created with bag.io package so that encodings are handled correctly. """ _object_to_skill_file_helper(py_obj, file_obj) file_obj.write('\n') bag_proc_prompt = 'BAG_PROMPT>>> ' class SkillServer(object): """A server that handles skill commands. This server is started and ran by virtuoso. It listens for commands from bag from a ZMQ socket, then pass the command to virtuoso. It then gather the result and send it back to bag. Parameters ---------- router : :class:`bag.interface.ZMQRouter` the :class:`~bag.interface.ZMQRouter` object used for socket communication. virt_in : file the virtuoso input file. Must be created with bag.io package so that encodings are handled correctly. virt_out : file the virtuoso output file. Must be created with bag.io package so that encodings are handled correctly. tmpdir : str or None if given, will save all temporary files to this folder. """ def __init__(self, router, virt_in, virt_out, tmpdir=None): """Create a new SkillOceanServer instance. """ self.handler = router self.virt_in = virt_in self.virt_out = virt_out # create a directory for all temporary files self.dtmp = bag.io.make_temp_dir('skillTmp', parent_dir=tmpdir) def run(self): """Starts this server. """ while not self.handler.is_closed(): # check if socket received message if self.handler.poll_for_read(5): req = self.handler.recv_obj() if isinstance(req, dict) and 'type' in req: if req['type'] == 'exit': self.close() elif req['type'] == 'skill': expr, out_file = self.process_skill_request(req) if expr is not None: # send expression to virtuoso self.send_skill(expr) msg = self.recv_skill() self.process_skill_result(msg, out_file) else: msg = '*Error* bag server error: bag request:\n%s' % str(req) self.handler.send_obj(dict(type='error', data=msg)) else: msg = '*Error* bag server error: bag request:\n%s' % str(req) self.handler.send_obj(dict(type='error', data=msg)) def send_skill(self, expr): """Sends expr to virtuoso for evaluation. Parameters ---------- expr : string the skill expression. """ self.virt_in.write(expr) self.virt_in.flush() def recv_skill(self): """Receive response from virtuoso""" num_bytes = int(self.virt_out.readline()) msg = self.virt_out.read(num_bytes) if msg[-1] == '\n': msg = msg[:-1] return msg def close(self): """Close this server.""" self.handler.close() def process_skill_request(self, request): """Process the given skill request. Based on the given request object, returns the skill expression to be evaluated by Virtuoso. This method creates temporary files for long input arguments and long output. Parameters ---------- request : dict the request object. Returns ------- expr : str or None expression to be evaluated by Virtuoso. If None, an error occurred and nothing needs to be evaluated out_file : str or None if not None, the result will be written to this file. """ try: expr = request['expr'] input_files = request['input_files'] or {} out_file = request['out_file'] except KeyError as e: msg = '*Error* bag server error: %s' % str(e) self.handler.send_obj(dict(type='error', data=msg)) return None, None fname_dict = {} # write input parameters to files for key, val in input_files.items(): with bag.io.open_temp(prefix=key, delete=False, dir=self.dtmp) as file_obj: fname_dict[key] = '"%s"' % file_obj.name # noinspection PyBroadException try: object_to_skill_file(val, file_obj) except Exception: stack_trace = traceback.format_exc() msg = '*Error* bag server error: \n%s' % stack_trace self.handler.send_obj(dict(type='error', data=msg)) return None, None # generate output file if out_file: with bag.io.open_temp(prefix=out_file, delete=False, dir=self.dtmp) as file_obj: fname_dict[out_file] = '"%s"' % file_obj.name out_file = file_obj.name # fill in parameters to expression expr = expr.format(**fname_dict) return expr, out_file def process_skill_result(self, msg, out_file=None): """Process the given skill output, then send result to socket. Parameters ---------- msg : str skill expression evaluation output. out_file : str or None if not None, read result from this file. """ # read file if needed, and only if there are no errors. if msg.startswith('*Error*'): # an error occurred, forward error message directly self.handler.send_obj(dict(type='error', data=msg)) elif out_file: # read result from file. try: msg = bag.io.read_file(out_file) data = dict(type='str', data=msg) except IOError: stack_trace = traceback.format_exc() msg = '*Error* error reading file:\n%s' % stack_trace data = dict(type='error', data=msg) self.handler.send_obj(data) else: # return output from virtuoso directly self.handler.send_obj(dict(type='str', data=msg))
StarcoderdataPython
9640201
from django.urls import path from .views import Lista_Productos, Productos, Partidas_lista, Nueva_Partida, Eliminar_Partida, Editar_partida, Nuevo_Producto, Eliminar_Producto, Editar_Producto from .views import Inventario_lista, Añadir_inventario, Sacar_inventario app_name = 'inventario' app_name = 'inventario' urlpatterns = [ #Productos path('lista_productos/', Lista_Productos.as_view(), name='ListaProductos'), path('nuevoProducto/', Nuevo_Producto.as_view(), name='NuevoProducto'), path('eliminar_producto/<int:pk>', Eliminar_Producto.as_view(), name='EliminarProducto'), path('editar_producto/<int:pk>', Editar_Producto.as_view(), name='EditarProducto'), #Partidas path('lista_partida/', Partidas_lista.as_view(), name='Partidas_lista'), path('nuevaPartida/', Nueva_Partida.as_view(), name='NuevaPartida'), path('eliminar_partida/<int:pk>', Eliminar_Partida.as_view(), name='eliminacionDePartida'), path('editar_partida/<int:pk>', Editar_partida.as_view(), name='editarPartida'), #Inventario path('inventario_lista/', Inventario_lista.as_view(), name='inventarioLista'), path('añadir_inventario/', Añadir_inventario.as_view(), name='Añadir_Inventario'), path('inventario_salida/', Sacar_inventario.as_view(), name='Salida_Inventario'), ]
StarcoderdataPython
9780254
<filename>main.py<gh_stars>0 import os def main(path): files = os.listdir(path) for index, file in enumerate(files): names = os.path.join(path, file), os.path.join(path, ''.join([str(index + 1), '.', file.split('.')[-1]])) os.rename(*names) if __name__ == "__main__": main("/Applications/MAMP/htdocs/Image")
StarcoderdataPython
11312037
<gh_stars>0 from keras.preprocessing.text import Tokenizer from pickle import dump # load doc into memory def load_doc(filename): # open the file as read only file = open(filename, 'r') # read all text text = file.read() # close the file file.close() return text # load a pre-defined list of photo identifiers def load_set(filename): doc = load_doc(filename) dataset = list() # process line by line for line in doc.split('\n'): # skip empty lines if len(line) < 1: continue # get the image identifier identifier = line.split('.')[0] dataset.append(identifier) return set(dataset) # load clean descriptions into memory def load_clean_descriptions(filename, dataset): # load document doc = load_doc(filename) descriptions = dict() for line in doc.split('\n'): # split line by white space tokens = line.split() # split id from description image_id, image_desc = tokens[0], tokens[1:] # skip images not in the set if image_id in dataset: # create list if image_id not in descriptions: descriptions[image_id] = list() # wrap description in tokens desc = 'startseq ' + ' '.join(image_desc) + ' endseq' # store descriptions[image_id].append(desc) return descriptions # covert a dictionary of clean descriptions to a list of descriptions def to_lines(descriptions): all_desc = list() for key in descriptions.keys(): [all_desc.append(d) for d in descriptions[key]] return all_desc # fit a tokenizer given caption descriptions def create_tokenizer(descriptions): lines = to_lines(descriptions) tokenizer = Tokenizer() tokenizer.fit_on_texts(lines) return tokenizer # load training dataset filename = 'Flickr8k_text/Flickr_8k.trainImages.txt' train = load_set(filename) print('Dataset: %d' % len(train)) # descriptions train_descriptions = load_clean_descriptions('descriptions.txt', train) print('Descriptions: train=%d' % len(train_descriptions)) # prepare tokenizer tokenizer = create_tokenizer(train_descriptions) # save the tokenizer dump(tokenizer, open('tokenizer.pkl', 'wb'))
StarcoderdataPython
11356566
<reponame>yezooz/forex-server # The MIT License (MIT) # # Copyright (c) 2013 <NAME> # # Permission is hereby granted, free of charge, to any person obtaining a copy # of this software and associated documentation files (the "Software"), to deal # in the Software without restriction, including without limitation the rights # to use, copy, modify, merge, publish, distribute, sublicense, and/or sell # copies of the Software, and to permit persons to whom the Software is # furnished to do so, subject to the following conditions: # The above copyright notice and this permission notice shall be included in # all copies or substantial portions of the Software. # THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR # IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, # FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE # AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER # LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, # OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN # THE SOFTWARE. from django.conf.urls import patterns, url urlpatterns = patterns('panel.views', url(r'^$', 'index', name='panel'), url(r'^action$', 'action', name='signal_action'), url(r'^signal/(\d{1,})$', 'signal', name='signal'), url(r'^live$', 'live', name='live_trades'), url(r'^recent$', 'recent', name='recently_approved'), url(r'^trade/(\d{1,})$', 'trade', name='trade'), url(r'^chart$', 'chart'), url(r'^chart/(\S+)/(\S{2,4})$', 'chart'), url(r'^calc$', 'calculator', name='calculator'), url(r'^summary/$', 'summary', name='summary'), url(r'^summary/(?P<signal_id>\d+)$', 'signal_summary', name='signal_summary'), )
StarcoderdataPython
1614972
<reponame>joyofpw/voxgram #!/usr/bin/env python # -*- coding: utf-8 -*- # # Simple Bot to post voice message to Telegram # Made by <NAME> <<EMAIL>> # Change server = 'http://localhost:8888/voxgram/' telegram_key = 'my_token' # PW Basic Auth user = 'voxgrambot' password = '<PASSWORD>' # Do not change voices = server + 'voices/' auth = (user, password)
StarcoderdataPython
3315462
import serial class Probe(serial.Serial): def __init__(self, port="/dev/serial/by-id/usb-Omega_Engineering_RH-USB_N13012205-if00-port0"): super().__init__(port) self.write(b'C\r') self.readline() def get_temp_C(self): self.write(b'C\r') txt = self.readline() return float(txt.decode().split(' ')[0][1:]) def get_relative_humidity(self): self.write(b'H\r') txt = self.readline() return float(txt.decode().split(' ')[0][1:])
StarcoderdataPython
11224491
#!/usr/bin/env python NAME = 'BlockDoS' def is_waf(self): return self.match_header(('server', "BlockDos\.net"))
StarcoderdataPython
8181374
<reponame>santteegt/ucl-drl-msc<gh_stars>10-100 import gym import numpy as np import sys import os def load_action_set(filename, i, action_shape): actions = np.zeros((i, action_shape)) row = 0 with open(filename, mode='r') as f: for line in f: actions[row, ...] = line.split(',')[1:] row += 1 return actions def test(wolpertinger=False, k_prop=1): assert k_prop > 0, "Proportion for nearest neighbors must be non zero" env = gym.make('CollaborativeFiltering-v0') # env = gym.make('CartPole-v0') # env.monitor.start('/tmp/cf-1') # env.reset() # for _ in range(1000): # env.render() # env.step(env.action_space.sample()) # take a random action n_actions = 3883 policy = env.action_space.sample import wolpertinger as wp if wolpertinger: action_set = load_action_set("data/embeddings-movielens1m.csv", n_actions, 119) policy = wp.Wolpertinger(env, i=n_actions, nn_index_file="indexStorageTest", action_set=action_set).g k = round(n_actions * k_prop) if k_prop < 1 else k_prop R = [] for i_episode in range(2000): rew = 0. observation = env.reset() for t in range(100): env.render() # print(observation) # action = env.action_space.sample() action = policy(env.action_space.sample(), k=int(k)) if wolpertinger else policy() action = action[0] if wolpertinger else action observation, reward, done, info = env.step(action) rew += reward # print(info) if done: R.append(rew) # print("Episode finished after {} timesteps. Average Reward {}".format(t+1, np.mean(R))) with open("events.log", "a") as log: log.write("Episode finished after {} timesteps. Average Reward {}\n".format(t + 1, np.mean(R))) break # print "Episode {} Average Reward per user: {}".format(i_episode, rew) with open("events.log", "a") as log: log.write("Episode {} Average Reward per user: {}\n".format(i_episode, rew)) avr = np.mean(R) if env.spec.reward_threshold is not None and avr > env.spec.reward_threshold: # print "Threshold reached {} > {}".format(avr, env.spec.reward_threshold) with open("events.log", "a") as log: log.write("Threshold reached {} > {}\n".format(avr, env.spec.reward_threshold)) break env.monitor.close() if __name__ == "__main__": sys.path.append(os.path.dirname(__file__) + "/../") test(wolpertinger=True, k_prop=0.05)
StarcoderdataPython
1769241
<reponame>bitcraft/pyglet<filename>contrib/spryte/boom.py<gh_stars>10-100 import sys import random from pyglet import window from pyglet import image from pyglet import clock from pyglet import resource import spryte NUM_BOOMS = 20 if len(sys.argv) > 1: NUM_BOOMS = int(sys.argv[1]) win = window.Window(vsync=False) fps = clock.ClockDisplay(color=(1, 1, 1, 1)) explosions = spryte.SpriteBatch() explosion_images = resource.image('explosion.png') explosion_images = image.ImageGrid(explosion_images, 2, 8) explosion_animation = image.Animation.from_image_sequence(explosion_images, .001, loop=False) class EffectSprite(spryte.Sprite): def on_animation_end(self): self.delete() again() booms = spryte.SpriteBatch() def again(): EffectSprite(explosion_animation, win.width * random.random(), win.height * random.random(), batch=booms) again() while not win.has_exit: clock.tick() win.dispatch_events() if len(booms) < NUM_BOOMS: again() win.clear() booms.draw() fps.draw() win.flip() win.close()
StarcoderdataPython
1894752
# References: # # https://www.tensorflow.org/guide/low_level_intro # # only needed for python 2.7 # from __future__ import absolute_import # from __future__ import division # from __future__ import print_function # IDEAS: could work with the Jester data set, classifying jokes as good or bad, probably based on certain words # appearing in them? ... maybe hard to train with any reasonable success # or a variety of equations... possibly super boring, depending on equation combinations. import numpy as np from numpy import array from numpy import float32 # 16 bits # useful for training various sorts of data bin16 = array([ [0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1, 0], [0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1, 0, 0], [0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0], [0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0], [0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0], [0, 0, 0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0], [0, 0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0], [0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0, 0], [0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0], [0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0], [0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0], [0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0], [0, 0, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0], [0, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0], [1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0], [1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1], [0, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1, 0], [0, 0, 0, 0, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0], [0, 0, 0, 0, 0, 0, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0], [0, 0, 0, 0, 1, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0, 0], [0, 0, 1, 0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0], [0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1, 1, 0, 0], [0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0], [1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1, 0], [1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0], [0, 0, 0, 0, 1, 0, 1, 0, 1, 0, 0, 0, 0, 0, 0, 0], [0, 0, 0, 0, 0, 1, 0, 1, 0, 0, 0, 1, 0, 0, 0, 0], [0, 0, 1, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 1, 0, 0], [0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1], [0, 0, 1, 0, 0, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0], [0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1, 1, 0, 0, 1], [1, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 1, 0, 0], [0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 1, 0], [0, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0], [0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0], [0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0], [0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 0, 1], [0, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0], [0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0], [0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0], [0, 0, 0, 0, 0, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0], [0, 0, 1, 0, 1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0], [1, 1, 0, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1, 0, 0], [0, 0, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 0, 0], [0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0], [0, 0, 1, 0, 1, 0, 1, 0, 1, 0, 0, 0, 0, 0, 0, 0], [0, 0, 0, 0, 0, 0, 1, 0, 1, 0, 1, 1, 1, 0, 0, 0], [1, 1, 0, 1, 0, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0], [0, 0, 0, 0, 0, 0, 0, 1, 0, 1, 1, 0, 1, 0, 0, 1], [1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1, 0, 1], [1, 0, 0, 1, 0, 1, 1, 0, 1, 0, 1, 0, 0, 0, 0, 0], [0, 0, 0, 0, 0, 0, 0, 1, 0, 1, 1, 0, 1, 0, 1, 1], [0, 0, 1, 1, 1, 1, 1, 0, 1, 0, 0, 0, 0, 0, 0, 0], [1, 0, 0, 0, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 1, 1], [0, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 0, 1, 0, 1], [0, 1, 1, 1, 0, 1, 0, 1, 0, 0, 1, 0, 0, 0, 0, 0], [1, 1, 0, 1, 1, 0, 0, 0, 0, 0, 0, 0, 1, 1, 0, 0], [1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 1, 0, 0, 0, 0, 1], [0, 1, 0, 0, 0, 1, 0, 1, 0, 1, 0, 1, 0, 0, 1, 1], [1, 0, 1, 0, 1, 0, 1, 0, 1, 0, 1, 0, 1, 0, 0, 0], [1, 1, 1, 1, 0, 1, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0], [0, 0, 0, 1, 0, 1, 0, 1, 1, 1, 1, 1, 0, 0, 1, 0], [0, 1, 0, 1, 0, 1, 0, 1, 0, 1, 0, 1, 1, 0, 1, 0], [1, 0, 0, 0, 0, 0, 1, 0, 0, 1, 0, 1, 1, 1, 1, 1], [0, 1, 0, 0, 1, 1, 0, 1, 0, 1, 1, 0, 1, 1, 0, 0], [0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1], [1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0], [1, 0, 1, 0, 1, 1, 0, 1, 0, 1, 0, 1, 1, 1, 0, 0], [0, 1, 1, 0, 1, 0, 1, 1, 0, 1, 1, 0, 1, 0, 1, 1], [1, 1, 0, 1, 0, 1, 1, 1, 1, 1, 0, 1, 0, 1, 0, 1], [1, 1, 1, 0, 0, 1, 0, 1, 1, 1, 1, 0, 1, 1, 0, 1], [0, 0, 1, 1, 1, 1, 0, 1, 1, 1, 1, 0, 1, 1, 1, 1], [1, 1, 1, 1, 1, 0, 1, 1, 0, 1, 1, 0, 1, 1, 0, 0], [1, 1, 1, 0, 1, 1, 0, 1, 1, 0, 1, 0, 1, 1, 1, 1], [1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1, 0, 0, 1], [1, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1], [1, 0, 1, 1, 0, 0, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1], [1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 1, 0, 1, 1, 0, 1], [1, 1, 1, 1, 1, 0, 1, 0, 1, 0, 1, 0, 1, 1, 0, 1], [1, 1, 0, 0, 1, 1, 1, 0, 1, 1, 1, 1, 1, 0, 1, 1], [1, 0, 1, 0, 1, 1, 1, 1, 1, 1, 0, 1, 1, 0, 1, 1], [0, 1, 0, 1, 0, 1, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1], [0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0], [1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1, 0], [0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1], [1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1], [1, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1], [1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1], [1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1], [1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 1], [1, 0, 1, 1, 0, 0, 1, 1, 1, 0, 1, 0, 1, 0, 1, 0], [1, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1], [1, 0, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1], [1, 0, 1, 1, 0, 0, 1, 1, 1, 0, 0, 0, 0, 1, 0, 0], [1, 1, 0, 1, 0, 0, 0, 1, 1, 0, 1, 0, 0, 1, 1, 0], [0, 0, 1, 1, 0, 0, 1, 1, 1, 0, 1, 1, 1, 1, 1, 0], [0, 0, 1, 0, 0, 1, 1, 1, 1, 0, 0, 1, 1, 0, 1, 0], [0, 0, 1, 1, 0, 0, 1, 1, 1, 0, 1, 1, 1, 1, 1, 0], [1, 0, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 1, 0, 1, 0], [0, 0, 1, 1, 0, 0, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1], [0, 0, 1, 1, 0, 0, 1, 1, 1, 0, 1, 0, 0, 0, 1, 0], [0, 0, 1, 1, 0, 0, 1, 1, 1, 0, 1, 1, 0, 0, 0, 1], [0, 0, 1, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 1, 1, 0] ]) ''' Train network to recognize approx. how many bits are on. ''' count4 = array([ [1, 0, 0, 0], [1, 0, 0, 0], [1, 0, 0, 0], [1, 0, 0, 0], [1, 0, 0, 0], [1, 0, 0, 0], [1, 0, 0, 0], [1, 0, 0, 0], [1, 0, 0, 0], [1, 0, 0, 0], [1, 0, 0, 0], [1, 0, 0, 0], [1, 0, 0, 0], [1, 0, 0, 0], [1, 0, 0, 0], [1, 0, 0, 0], [1, 0, 0, 0], [1, 0, 0, 0], [1, 0, 0, 0], [1, 0, 0, 0], [1, 0, 0, 0], [1, 0, 0, 0], [1, 0, 0, 0], [1, 0, 0, 0], [1, 0, 0, 0], [1, 0, 0, 0], [1, 0, 0, 0], [1, 0, 0, 0], [1, 0, 0, 0], [1, 0, 0, 0], [1, 0, 0, 0], [1, 0, 0, 0], [1, 0, 0, 0], [1, 0, 0, 0], [0, 1, 0, 0], [0, 1, 0, 0], [1, 0, 0, 0], [0, 1, 0, 0], [0, 1, 0, 0], [1, 0, 0, 0], [1, 0, 0, 0], [0, 1, 0, 0], [0, 1, 0, 0], [0, 1, 0, 0], [0, 1, 0, 0], [1, 0, 0, 0], [0, 1, 0, 0], [0, 1, 0, 0], [0, 1, 0, 0], [0, 1, 0, 0], [0, 1, 0, 0], [0, 1, 0, 0], [0, 1, 0, 0], [0, 1, 0, 0], [0, 1, 0, 0], [0, 1, 0, 0], [0, 1, 0, 0], [0, 1, 0, 0], [0, 1, 0, 0], [0, 1, 0, 0], [0, 1, 0, 0], [0, 1, 0, 0], [0, 0, 1, 0], [0, 0, 1, 0], [0, 0, 1, 0], [0, 0, 1, 0], [0, 0, 1, 0], [0, 0, 1, 0], [0, 0, 1, 0], [0, 0, 1, 0], [0, 0, 1, 0], [0, 0, 1, 0], [0, 0, 0, 1], [0, 0, 1, 0], [0, 0, 0, 1], [0, 0, 0, 1], [0, 0, 0, 1], [0, 0, 0, 1], [0, 0, 0, 1], [0, 0, 1, 0], [0, 0, 0, 1], [0, 0, 0, 1], [0, 0, 0, 1], [0, 0, 0, 1], [0, 0, 0, 1], [0, 0, 0, 1], [0, 0, 0, 1], [0, 0, 0, 1], [0, 0, 0, 1], [0, 0, 0, 1], [0, 0, 0, 1], [0, 0, 1, 0], [0, 0, 0, 1], [0, 0, 0, 1], [0, 1, 0, 0], [0, 0, 1, 0], [0, 0, 1, 0], [0, 0, 1, 0], [0, 0, 1, 0], [0, 0, 1, 0], [0, 0, 1, 0], [0, 1, 0, 0], [0, 0, 1, 0], [0, 1, 0, 0], ]) samples2 = array([ [1, 1, 0, 1, 0, 1, 1, 1, 0, 1, 1, 0, 1, 0, 1, 0, 1, 1, 1, 1, 0, 1, 0, 0, 0, 1, 1, 0, 1, 0, 1, 0, 1, 1, 0, 1, 0, 0, 1, 0, 0, 0, 1, 0, 0, 1, 1, 0, 1, 1, 1, 1, 1, 0, 1, 0, 0, 1, 0, 0, 0, 0, 1, 1], [0, 1, 1, 0, 1, 1, 1, 0, 0, 1, 0, 0, 1, 0, 0, 0, 0, 1, 1, 0, 0, 1, 1, 1, 1, 1, 1, 0, 1, 1, 0, 1, 1, 0, 0, 0, 0, 0, 0, 1, 0, 0, 1, 1, 0, 1, 1, 0, 0, 0, 0, 1, 0, 0, 1, 0, 1, 1, 0, 1, 1, 1, 1, 0], [1, 1, 0, 0, 1, 0, 1, 1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 0, 1, 0, 1, 1, 1, 1, 0, 1, 1, 0, 0, 0, 0, 0, 1, 0, 1, 0, 0, 0, 1, 1, 0, 1, 0, 1, 1, 0, 0, 1, 0, 0, 0, 0, 1, 1, 0, 0, 1, 1, 1, 1, 1, 0, 0, 1], [0, 1, 0, 1, 1, 1, 1, 0, 1, 0, 0, 0, 1, 1, 1, 1, 1, 0, 1, 1, 0, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 1, 0, 1, 1, 0, 0, 0, 1, 0, 0, 0, 1, 1, 1, 0, 1, 0, 1, 1, 0, 1, 0, 1, 1, 0, 0, 1, 1, 0, 1, 0, 0, 0], [0, 0, 0, 0, 0, 0, 1, 0, 1, 0, 1, 0, 1, 0, 0, 0, 1, 0, 1, 1, 0, 0, 0, 1, 1, 1, 1, 1, 0, 1, 0, 0, 0, 1, 0, 0, 1, 1, 0, 1, 0, 1, 1, 0, 0, 0, 1, 0, 0, 0, 0, 0, 1, 1, 1, 1, 0, 0, 1, 1, 0, 1, 1, 1], [1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 1, 1, 1, 1, 1, 1, 0, 1, 1, 0, 1, 0, 1, 1, 1, 0, 1, 0, 0, 0, 0, 1, 1, 1, 1, 1, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 1, 0, 1, 1, 1, 0, 1, 0, 0, 1, 0, 1, 0], [0, 1, 0, 1, 1, 0, 1, 0, 1, 0, 0, 1, 1, 1, 0, 1, 1, 0, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 1, 1, 1, 1, 0, 0, 1, 0, 0, 1, 1, 0, 1, 1, 0, 0, 0, 1, 1, 1, 1, 0, 1, 1, 0, 0, 0, 1], [1, 0, 1, 0, 0, 1, 1, 1, 0, 1, 0, 1, 1, 0, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 1, 0, 1, 0, 1, 0, 0, 0, 1, 1, 1, 0, 0, 1, 0, 1, 1, 0, 1, 1, 0, 1, 0, 0, 1, 0, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1, 1, 0, 1, 1], [1, 1, 1, 1, 0, 1, 1, 0, 0, 0, 0, 1, 0, 0, 1, 0, 1, 1, 1, 1, 1, 1, 0, 0, 1, 0, 1, 0, 0, 0, 0, 1, 0, 0, 1, 0, 0, 1, 1, 1, 1, 0, 1, 1, 0, 1, 1, 1, 0, 0, 1, 1, 0, 0, 1, 0, 0, 1, 0, 1, 1, 0, 1, 1], [1, 0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 1, 0, 0, 1, 0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 0, 1, 1, 0, 0, 0, 1, 0, 0, 1, 1, 0, 0, 1, 1, 0, 0, 1, 0, 0, 0, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 1, 1, 1, 0, 0, 1, 1], [1, 1, 0, 1, 1, 0, 1, 1, 1, 1, 0, 0, 1, 1, 0, 1, 1, 1, 0, 0, 1, 1, 0, 1, 1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 1, 0, 1, 0, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 1, 1, 1, 0, 1, 0, 1], [1, 1, 1, 1, 0, 0, 1, 1, 1, 1, 1, 0, 0, 1, 0, 1, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 1, 0, 1, 1, 0, 0, 1, 1, 0, 1, 1, 0, 1, 0, 0, 0, 0, 1, 1, 1, 1, 0, 1, 1, 1, 0, 1, 0, 1, 1, 0, 1, 0, 0, 0], [1, 1, 0, 1, 0, 0, 0, 1, 1, 1, 0, 0, 0, 0, 1, 1, 0, 0, 1, 0, 1, 1, 1, 1, 0, 1, 1, 0, 1, 1, 0, 0, 0, 1, 1, 1, 0, 1, 0, 0, 0, 0, 1, 1, 1, 1, 0, 1, 0, 0, 1, 0, 0, 0, 0, 1, 0, 1, 0, 0, 0, 0, 0, 1], [1, 1, 0, 0, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1, 1, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1, 0, 0, 1, 0, 1, 1, 1, 1, 1, 0, 1, 1, 1, 0, 1, 0, 0, 0], [0, 0, 0, 1, 0, 0, 1, 1, 0, 1, 1, 0, 1, 0, 1, 1, 0, 1, 0, 1, 0, 1, 0, 0, 0, 0, 1, 0, 1, 0, 1, 0, 1, 0, 0, 1, 0, 0, 0, 1, 0, 1, 0, 1, 0, 1, 0, 0, 1, 1, 1, 1, 0, 0, 1, 0, 1, 0, 1, 1, 0, 0, 1, 0], [1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1, 0, 0, 0, 0, 0, 0, 1, 0, 1, 1, 0, 0, 1, 1, 0, 0, 0, 1, 1, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 0, 1, 0, 0, 1, 1, 0, 0, 1, 0, 1, 0, 0, 1, 0, 0, 0, 1], [1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 1, 1, 0, 1, 1, 0, 1, 1, 0, 0, 1, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 1, 0, 1, 1, 1, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 1, 0, 1, 0, 0, 1, 1, 1, 0, 1, 1], [1, 1, 1, 0, 0, 1, 0, 1, 0, 0, 0, 0, 1, 0, 1, 1, 1, 1, 0, 1, 0, 1, 1, 0, 0, 1, 1, 0, 0, 1, 0, 1, 1, 1, 0, 0, 1, 1, 1, 0, 0, 0, 1, 0, 1, 1, 1, 0, 1, 0, 1, 0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 0, 1, 0], [0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 0, 0, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 1, 1, 1, 1, 0, 1, 0, 1, 1, 1, 1, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 0, 0, 1, 0, 0, 1, 1, 0, 0, 1, 0, 0, 0, 0, 0], [0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 1, 0, 1, 0, 1, 1, 1, 1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 1, 1, 0, 0, 0, 1, 0, 1, 1, 1, 1, 0, 0, 0, 0, 1, 0, 1, 1, 0, 0, 0, 0, 0, 1, 1, 1, 1, 0, 1, 0, 0, 1, 1, 1, 0], [0, 0, 0, 1, 0, 0, 1, 0, 1, 1, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 0, 1, 0, 1, 0, 1, 0, 1, 1, 1, 0, 1, 1, 1, 0, 1, 0, 0, 0, 0, 1, 0, 1, 1, 0, 1, 1, 0, 1, 1, 0, 1, 1, 0, 0, 0, 0, 0, 1, 1, 1, 0, 0, 0], [0, 1, 1, 1, 1, 1, 0, 0, 1, 0, 0, 1, 1, 0, 0, 0, 1, 0, 0, 0, 1, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0, 1, 1, 1, 0, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 0, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 0, 1, 1, 1, 0, 1, 0], [1, 0, 1, 0, 1, 1, 0, 1, 0, 1, 1, 0, 0, 1, 0, 0, 0, 1, 0, 1, 0, 0, 0, 1, 0, 1, 1, 1, 1, 0, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 1, 0, 0, 0, 0, 1, 1, 1, 0, 1, 1, 0, 1, 1, 1, 1, 0, 0, 1, 1, 1, 1, 1, 1], [0, 0, 1, 1, 0, 0, 1, 1, 0, 0, 1, 1, 1, 0, 0, 1, 0, 1, 1, 1, 0, 0, 1, 0, 1, 0, 0, 1, 0, 1, 0, 0, 0, 1, 1, 0, 0, 0, 0, 0, 0, 1, 1, 0, 0, 1, 1, 1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 1, 0, 0, 1, 0, 1, 0], [1, 1, 0, 1, 0, 0, 1, 0, 0, 0, 1, 1, 0, 1, 0, 0, 1, 1, 1, 1, 1, 0, 0, 1, 1, 1, 1, 1, 0, 1, 0, 0, 0, 1, 0, 0, 1, 0, 1, 1, 0, 0, 1, 1, 1, 1, 0, 1, 1, 1, 1, 0, 1, 0, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1], [1, 0, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 0, 1, 1, 0, 1, 1, 0, 0, 1, 1, 0, 1, 1, 0, 0, 0, 0, 1, 0, 0, 1, 1, 0, 0, 1, 1, 0, 0, 0, 0, 0, 1, 1, 0, 0, 0, 1, 0, 0, 1, 1, 1, 0, 0, 0, 1, 0, 0, 0, 1, 0, 0], [1, 0, 0, 0, 1, 1, 0, 1, 0, 0, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 1, 0, 1, 1, 1, 1, 0, 0, 0, 1, 1, 1, 0, 0, 0, 0, 1, 1, 0, 1, 0, 1, 1, 1, 0, 0, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 1, 0, 0, 1, 0, 1, 1, 0], [1, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 0, 0, 0, 1, 1, 0, 1, 1, 1, 1, 0, 1, 0, 1, 1, 1, 0, 0, 0, 1, 0, 0, 1, 0, 0, 1, 0, 1, 1, 1, 1, 1, 1, 0, 1, 1, 0, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 1, 1, 1, 0, 1, 1], [0, 1, 0, 1, 0, 0, 0, 1, 1, 0, 1, 1, 1, 1, 0, 1, 1, 0, 0, 0, 0, 1, 1, 1, 0, 1, 0, 1, 1, 1, 0, 1, 0, 0, 0, 1, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0, 1, 0, 1, 1, 1, 0, 1, 0, 0, 1, 1, 0, 0, 1, 0, 1, 0], [1, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 0, 1, 1, 0, 1, 1, 1, 0, 0, 1, 1, 1, 0, 0, 0, 1, 0, 1, 1, 0, 0, 0, 1, 0, 0, 0, 1, 1, 0, 0, 0, 1, 1, 1, 0, 0, 1, 1, 1, 0, 0, 1, 0, 1, 0, 1, 0, 1, 1, 0, 1, 1, 0], [1, 0, 1, 0, 0, 1, 0, 0, 1, 0, 0, 1, 1, 0, 1, 0, 1, 0, 0, 0, 0, 1, 1, 1, 1, 0, 0, 1, 1, 0, 0, 0, 0, 1, 1, 1, 0, 0, 0, 0, 0, 1, 1, 1, 0, 1, 1, 1, 1, 1, 0, 0, 1, 1, 1, 0, 1, 1, 0, 0, 0, 0, 0, 0], [1, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1, 0, 1, 0, 0, 1, 1, 0, 1, 1, 0, 1, 0, 0, 0, 1, 0, 0, 1, 0, 1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 1, 1, 0, 1, 1, 1, 1, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 1], [0, 1, 1, 1, 0, 0, 0, 1, 0, 0, 1, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1, 0, 1, 0, 1, 1, 0, 0, 0, 0, 1, 0, 1, 1, 1, 0, 0, 1, 0, 0, 0, 1, 0, 0, 0, 1, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 1, 1, 0, 1, 1, 0, 1, 1], [0, 0, 1, 0, 1, 1, 0, 0, 1, 1, 0, 0, 1, 0, 0, 1, 1, 0, 0, 1, 0, 1, 0, 1, 1, 1, 0, 0, 1, 0, 1, 0, 0, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 1, 1, 0, 0, 0, 0, 0, 1, 0, 1, 0, 0, 0, 1, 1, 1, 0, 0, 0, 1, 1], [0, 1, 1, 1, 0, 1, 0, 0, 0, 1, 0, 0, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 1, 1, 0, 0, 0, 0, 1, 1, 1, 0, 0, 0, 1, 0, 0, 0, 1, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0, 0, 1, 1, 0, 0, 1, 1, 1, 0, 1, 1, 1, 0, 0, 0], [0, 1, 1, 0, 1, 0, 0, 1, 1, 0, 1, 1, 1, 1, 0, 0, 1, 1, 1, 1, 1, 0, 1, 0, 0, 1, 1, 0, 1, 1, 0, 0, 1, 0, 0, 1, 1, 0, 0, 1, 0, 0, 1, 1, 0, 1, 0, 1, 1, 1, 0, 0, 0, 0, 1, 1, 1, 1, 0, 1, 0, 1, 0, 1], [1, 1, 1, 0, 1, 1, 1, 0, 1, 0, 0, 1, 0, 1, 0, 1, 0, 0, 0, 0, 0, 0, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 1, 1, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0, 0, 1, 1, 0, 0, 1, 1, 1, 1, 0, 1, 0, 0, 0, 0, 1, 1, 1, 1, 1], [1, 1, 1, 0, 0, 0, 1, 0, 1, 0, 1, 0, 0, 1, 1, 1, 0, 1, 0, 1, 0, 1, 1, 0, 0, 1, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 0, 0, 1, 0, 1, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 1, 0], [1, 0, 1, 0, 1, 0, 1, 0, 1, 1, 0, 0, 1, 1, 0, 0, 0, 1, 0, 0, 1, 1, 1, 1, 0, 0, 1, 0, 0, 0, 0, 0, 0, 1, 1, 0, 1, 0, 1, 0, 0, 1, 0, 1, 1, 0, 0, 1, 1, 1, 1, 0, 1, 1, 1, 0, 0, 0, 0, 1, 0, 1, 1, 1], [1, 0, 0, 1, 0, 0, 1, 1, 0, 0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 1, 1, 0, 0, 0, 0, 1, 1, 1, 1, 1, 0, 1, 0, 1, 1, 1, 1, 1, 0, 0, 0, 1, 0, 0, 0, 1, 0, 0, 1, 1, 0, 0, 1, 0, 0, 0, 1, 0, 0, 1, 0, 0, 1, 0], [1, 1, 1, 1, 0, 1, 0, 1, 1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 1, 0, 1, 0, 1, 0, 1, 0, 0, 0, 0, 0, 1, 1, 0, 1, 1, 1, 0, 0, 1, 1, 1, 1, 1, 0, 0, 1, 0, 1, 0, 0, 0, 0, 1, 1, 1, 0, 0, 1, 0, 1, 0, 0, 0], [1, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 0, 1, 1, 1, 0, 0, 1, 1, 1, 1, 0, 1, 0, 0, 0, 0, 1, 1, 1, 0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 1, 0, 0, 1, 1, 1, 0, 0, 1, 1, 1, 1, 0, 1, 0, 1, 1], [1, 1, 1, 1, 0, 0, 0, 1, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 1, 0, 1, 0, 1, 0, 0, 1, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 0, 0, 0, 1, 1, 0, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0], [1, 1, 0, 1, 1, 0, 1, 1, 0, 1, 0, 0, 1, 1, 1, 1, 0, 0, 0, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 0, 0, 1, 0, 1, 1, 0, 0, 0, 0, 0, 1, 1, 1, 1, 0, 1, 0, 0, 0, 0, 1, 0, 0, 1, 1, 1, 0, 0, 1, 1, 1, 1, 0, 0], [1, 0, 0, 1, 0, 0, 0, 1, 0, 0, 1, 1, 1, 1, 1, 0, 1, 1, 0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 1, 0, 0, 0, 0, 1, 0, 1, 0, 0, 0, 0, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 0, 1, 1, 0, 0, 1, 1, 1, 0, 0, 1, 1, 1, 0], [1, 1, 1, 1, 0, 0, 1, 0, 0, 0, 0, 0, 1, 0, 0, 1, 0, 1, 0, 0, 1, 0, 1, 1, 1, 0, 1, 1, 0, 1, 1, 0, 0, 1, 0, 0, 0, 0, 1, 1, 0, 1, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 0, 0, 0, 1, 0, 0, 0, 1, 0, 0, 1, 1], [0, 0, 1, 0, 0, 0, 1, 0, 1, 0, 1, 0, 1, 0, 0, 1, 1, 1, 0, 1, 1, 1, 1, 0, 1, 0, 1, 1, 1, 0, 1, 0, 1, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 0, 0, 1], [1, 1, 1, 0, 1, 1, 1, 1, 0, 0, 1, 0, 1, 1, 1, 0, 0, 0, 1, 1, 1, 0, 1, 0, 1, 1, 0, 0, 0, 0, 0, 1, 1, 1, 1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 1, 1, 0, 1, 0, 0, 0, 1, 1, 1, 0, 0, 1, 1, 1, 1, 0, 0, 0], [0, 0, 1, 1, 0, 0, 0, 0, 1, 0, 0, 0, 1, 1, 1, 0, 1, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 1, 1, 0, 1, 0, 1, 0, 1, 1, 0, 0, 0, 1, 1, 1, 0, 1, 0, 0, 1, 0, 0, 0, 1, 1, 0, 1, 0, 1, 0, 1, 1, 1], [0, 1, 0, 0, 1, 0, 1, 0, 1, 0, 1, 0, 0, 1, 0, 1, 0, 0, 1, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 1, 0, 0, 0, 1, 0, 0, 1, 0, 1, 1, 1, 0, 1, 1, 1, 1, 1, 0, 0], [0, 1, 0, 1, 0, 0, 0, 0, 1, 0, 0, 1, 0, 1, 1, 1, 1, 0, 1, 1, 0, 0, 1, 1, 0, 0, 1, 0, 1, 0, 1, 0, 1, 1, 1, 1, 0, 0, 1, 0, 1, 0, 0, 0, 0, 1, 0, 1, 1, 0, 1, 1, 1, 0, 1, 0, 1, 1, 0, 0, 1, 1, 1, 1], [1, 1, 1, 0, 1, 0, 1, 0, 1, 1, 0, 0, 1, 0, 0, 0, 1, 0, 0, 0, 1, 1, 1, 0, 1, 1, 1, 1, 0, 1, 1, 0, 1, 1, 1, 0, 0, 0, 1, 1, 0, 0, 0, 1, 1, 1, 1, 0, 1, 1, 1, 0, 0, 0, 0, 1, 0, 1, 1, 0, 0, 0, 0, 0], [0, 1, 0, 0, 1, 0, 1, 1, 0, 0, 1, 0, 1, 0, 0, 1, 1, 1, 1, 0, 1, 0, 0, 0, 0, 1, 0, 0, 0, 1, 0, 1, 0, 0, 1, 0, 0, 1, 0, 0, 1, 1, 1, 1, 1, 0, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 0, 0, 1, 1, 1, 0, 1, 1], [0, 1, 0, 1, 1, 0, 0, 1, 1, 0, 1, 0, 0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 1, 0, 1, 1, 1, 1, 0, 1, 0, 0, 1, 1, 0, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 0, 0, 1, 0, 1, 0, 1, 0, 0, 0, 0, 1, 1, 0, 0, 1, 1, 0], [0, 0, 1, 0, 0, 1, 1, 1, 0, 1, 1, 0, 1, 0, 1, 1, 1, 1, 1, 0, 1, 1, 0, 1, 0, 0, 0, 0, 1, 0, 1, 1, 1, 0, 0, 1, 0, 0, 1, 1, 1, 0, 1, 0, 0, 1, 0, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 1, 1, 0, 1, 0, 0, 0], [0, 1, 1, 0, 0, 1, 0, 1, 0, 0, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 1, 0, 1, 0, 1, 0, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 0, 1, 0, 0, 0, 0, 1, 0, 1, 0, 0, 1, 0, 0, 1, 1, 1, 1, 0, 0, 1, 0, 0, 0], [0, 1, 1, 0, 1, 0, 1, 1, 0, 0, 1, 1, 0, 0, 1, 1, 1, 1, 0, 1, 1, 1, 0, 0, 0, 1, 1, 0, 0, 0, 0, 1, 0, 1, 0, 0, 0, 1, 1, 0, 0, 1, 1, 1, 0, 1, 0, 0, 0, 1, 1, 1, 0, 1, 1, 0, 1, 1, 0, 0, 1, 1, 1, 1], [0, 1, 0, 1, 0, 1, 0, 0, 1, 0, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 0, 0, 1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1, 0, 1, 0, 1, 1, 0, 1, 0, 0, 0, 0, 0, 0, 1, 0, 1, 1, 1, 1, 1, 0, 0], [0, 0, 1, 0, 1, 0, 0, 0, 0, 0, 0, 0, 1, 1, 0, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 1, 0, 0, 1, 0, 1, 0, 1, 0, 0, 0, 1, 0, 1, 0, 1, 0, 0, 0, 1, 0, 0, 1, 1, 0, 0, 1, 0, 0, 1, 1, 0, 1, 0, 1, 0, 1, 1], [0, 0, 1, 1, 1, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0, 1, 1, 0, 0, 0, 0, 0, 1, 0, 0, 1, 1, 1, 0, 1, 0, 0, 0, 1, 1, 1, 1, 1, 1, 1, 0, 0, 1, 1, 1, 0, 0, 0, 1, 0, 1, 0, 1, 0, 0, 0, 1, 1, 0, 1, 1, 1, 1, 0], [0, 0, 0, 1, 1, 1, 0, 0, 0, 1, 0, 0, 1, 1, 1, 1, 0, 1, 1, 1, 1, 0, 1, 1, 1, 1, 1, 0, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1, 0, 1, 0, 0, 1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 1, 0, 0, 0, 0, 1, 1, 0, 1, 0, 1, 0], [0, 0, 0, 0, 1, 0, 1, 0, 1, 1, 1, 0, 0, 1, 0, 0, 0, 1, 1, 0, 1, 0, 1, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 1, 0, 1, 1, 1, 0, 0, 1, 1, 0, 1, 1, 1, 1, 0, 0, 1, 0, 0, 1, 1, 0, 0, 0, 0, 1, 1], [1, 0, 0, 1, 0, 1, 1, 0, 0, 0, 0, 1, 1, 1, 0, 1, 1, 0, 1, 0, 1, 0, 1, 0, 1, 1, 0, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 1, 1, 1, 0, 1, 0, 1, 1, 1, 1, 0, 0, 0, 0, 1, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 1, 1], [1, 0, 0, 0, 0, 0, 0, 1, 0, 0, 1, 1, 1, 1, 1, 0, 0, 0, 0, 1, 0, 0, 0, 1, 0, 0, 0, 0, 1, 1, 1, 0, 0, 1, 1, 0, 0, 1, 0, 1, 0, 0, 1, 1, 1, 0, 1, 1, 0, 1, 0, 1, 0, 0, 1, 0, 1, 1, 1, 1, 0, 1, 1, 1], [0, 0, 1, 0, 1, 1, 0, 0, 1, 1, 0, 1, 1, 0, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 0, 0, 1, 0, 1, 0, 0, 0, 0, 0, 1, 0, 1, 0, 1, 0, 1, 0, 0, 0, 1, 1, 0, 0, 1, 0, 0, 1, 0, 1, 0, 0, 1, 0, 1, 0, 1, 0, 0, 1], [0, 0, 0, 0, 0, 1, 1, 1, 0, 0, 0, 1, 1, 1, 1, 0, 1, 1, 1, 0, 1, 1, 0, 0, 1, 0, 1, 0, 1, 0, 1, 1, 1, 1, 0, 0, 0, 0, 1, 1, 0, 1, 0, 1, 0, 0, 0, 0, 1, 1, 0, 1, 0, 1, 1, 0, 1, 0, 1, 0, 1, 1, 1, 1], [1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 0, 1, 0, 1, 0, 0, 0, 1, 1, 1, 0, 1, 0, 0, 1, 1, 1, 0, 0, 0, 1, 1, 1, 0, 0, 0, 1, 0, 1, 0, 1, 0, 0, 0, 1, 1, 1, 1, 0, 1, 1, 0, 1, 0, 0, 1, 1, 0, 0, 1, 0, 0, 1, 1], [1, 0, 1, 0, 1, 0, 0, 0, 1, 0, 1, 1, 1, 1, 0, 0, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 1, 0, 0, 0, 0, 1, 0, 0, 0, 1, 0, 0, 0, 1, 0, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 0, 1, 0, 1, 1, 0, 0], [0, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 0, 1, 1, 0, 1, 1, 1, 0, 1, 1, 0, 1, 1, 0, 1, 0, 0, 0, 1, 1, 0, 0, 0, 1, 0, 1, 0, 0, 0, 0, 0, 0, 1, 0, 0, 1, 1, 1, 1, 1, 1, 0, 1, 1, 0, 0, 1, 0, 1, 0, 1, 0], [0, 0, 1, 0, 1, 1, 0, 1, 1, 1, 0, 0, 1, 1, 0, 1, 0, 0, 1, 1, 1, 1, 1, 0, 0, 1, 0, 0, 1, 0, 0, 1, 1, 1, 1, 0, 1, 0, 0, 0, 0, 0, 1, 0, 0, 0, 1, 1, 0, 1, 0, 1, 1, 1, 0, 1, 0, 0, 0, 0, 0, 0, 0, 1], [0, 1, 1, 1, 0, 0, 0, 0, 0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 0, 1, 0, 1, 1, 0, 0, 1, 0, 1, 1, 1, 1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 1, 1, 0, 1, 1, 1, 1, 0, 0, 0, 0, 0, 1, 0, 0, 1, 1, 1, 1, 0, 0], [1, 0, 1, 1, 0, 1, 1, 0, 0, 1, 0, 0, 0, 1, 0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 1, 0, 0, 1, 1, 0, 1, 0, 1, 0, 1, 0, 0, 0, 1, 0, 0, 0, 1, 1, 1, 0, 1, 0, 1, 1, 1, 0, 1, 0, 1, 0, 1, 0, 0, 0, 0, 0, 0, 1], [1, 1, 0, 0, 0, 0, 1, 0, 1, 0, 0, 0, 1, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 0, 0, 0, 0, 1, 0, 1, 0, 1, 0, 0, 1, 0, 1, 1, 0, 1, 0, 1, 0, 1, 1, 0, 0, 1, 0, 1], [1, 0, 1, 0, 1, 1, 1, 0, 0, 0, 0, 1, 1, 0, 1, 1, 1, 0, 1, 0, 1, 1, 1, 1, 1, 0, 1, 0, 1, 0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1, 1, 0, 1, 0, 1, 1, 0, 0, 1, 0, 1, 1, 0, 0, 0, 0, 0, 1, 1, 1, 0, 0], [1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 0, 1, 1, 1, 0, 1, 1, 0, 1, 1, 0, 0, 1, 1, 0, 0, 0, 0, 0, 1, 0, 1, 1, 1, 0, 1, 1, 0, 0, 0, 0, 0, 1, 0, 1, 1, 0, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 1, 0, 1, 0, 1, 1, 1], [0, 0, 0, 0, 0, 1, 0, 1, 1, 1, 1, 0, 1, 0, 1, 0, 0, 0, 0, 1, 0, 0, 1, 1, 1, 1, 0, 0, 0, 1, 0, 0, 1, 1, 1, 0, 1, 1, 0, 1, 0, 0, 1, 1, 1, 0, 1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 1, 0, 0, 0, 1, 0, 1], [0, 1, 0, 1, 1, 0, 0, 1, 0, 0, 1, 1, 0, 1, 0, 0, 0, 1, 0, 1, 1, 0, 1, 1, 1, 0, 0, 1, 1, 0, 1, 1, 0, 0, 0, 1, 0, 0, 1, 1, 0, 1, 0, 0, 0, 1, 0, 0, 0, 1, 1, 0, 1, 1, 1, 0, 0, 1, 0, 1, 1, 1, 0, 0], [0, 0, 0, 1, 1, 0, 0, 0, 1, 0, 1, 0, 1, 0, 0, 0, 0, 1, 0, 0, 1, 1, 1, 1, 1, 0, 1, 1, 0, 1, 0, 1, 1, 1, 0, 0, 1, 1, 1, 0, 0, 0, 1, 1, 0, 1, 1, 1, 1, 0, 0, 1, 0, 1, 0, 0, 0, 0, 1, 1, 1, 1, 0, 0], [1, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 1, 1, 1, 0, 1, 1, 1, 0, 1, 0, 1, 0, 0, 1, 1, 0, 1, 1, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 0, 0, 0, 1, 0, 0, 1, 1, 1, 0, 0, 1, 0, 1, 1, 0], [0, 0, 0, 1, 1, 0, 1, 1, 1, 0, 1, 1, 0, 1, 1, 0, 1, 1, 1, 0, 0, 0, 0, 0, 1, 0, 1, 0, 0, 0, 1, 0, 0, 1, 1, 0, 0, 1, 0, 1, 0, 1, 0, 1, 1, 0, 0, 0, 0, 1, 1, 0, 0, 1, 1, 1, 0, 1, 0, 0, 0, 0, 1, 0], [1, 0, 1, 1, 1, 0, 1, 1, 1, 1, 0, 1, 1, 1, 0, 1, 1, 0, 1, 1, 0, 0, 0, 0, 1, 1, 1, 1, 0, 1, 1, 0, 1, 0, 0, 1, 0, 1, 1, 0, 0, 1, 0, 1, 0, 0, 0, 1, 1, 0, 1, 0, 1, 0, 0, 1, 0, 0, 1, 1, 1, 0, 1, 0], [0, 0, 0, 0, 1, 1, 0, 1, 0, 0, 1, 0, 1, 0, 0, 0, 1, 1, 0, 0, 1, 1, 1, 0, 1, 0, 0, 0, 1, 1, 0, 0, 0, 1, 0, 1, 0, 0, 0, 0, 1, 0, 1, 1, 0, 1, 0, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 1, 0, 1, 0, 1, 0, 1], [1, 0, 0, 0, 1, 0, 1, 1, 1, 1, 0, 1, 1, 0, 1, 0, 1, 0, 0, 1, 0, 1, 0, 0, 1, 0, 1, 0, 1, 1, 1, 0, 1, 1, 0, 0, 0, 0, 0, 1, 1, 0, 0, 0, 0, 0, 1, 0, 1, 1, 0, 0, 0, 0, 0, 0, 1, 1, 0, 0, 1, 1, 1, 0], [0, 0, 0, 1, 1, 1, 0, 1, 0, 1, 1, 0, 1, 0, 1, 1, 1, 1, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 0, 1, 1, 0, 0, 1, 1, 0, 1, 1, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1, 0, 0, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 1], [0, 1, 0, 0, 1, 1, 0, 1, 0, 1, 1, 0, 0, 1, 1, 1, 0, 1, 0, 1, 1, 0, 1, 1, 1, 1, 0, 0, 1, 1, 1, 0, 0, 0, 0, 0, 0, 1, 0, 1, 1, 1, 0, 0, 1, 1, 1, 0, 0, 1, 1, 1, 1, 1, 0, 1, 0, 0, 0, 0, 0, 1, 0, 0], [0, 1, 1, 0, 0, 1, 1, 1, 0, 0, 0, 1, 0, 1, 0, 1, 1, 0, 1, 1, 0, 1, 1, 1, 1, 0, 1, 1, 1, 1, 1, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 1, 0, 0, 0, 1, 0, 0, 0, 0, 1, 1, 0, 0, 1, 0, 0, 1, 0, 0, 0, 0, 0, 0], [1, 0, 1, 1, 1, 1, 1, 0, 1, 1, 0, 1, 0, 1, 0, 1, 1, 0, 0, 1, 1, 1, 0, 1, 0, 0, 0, 1, 0, 1, 1, 1, 1, 0, 1, 1, 1, 0, 0, 1, 1, 0, 0, 0, 0, 1, 0, 0, 1, 1, 1, 1, 1, 1, 0, 0, 1, 0, 1, 1, 1, 0, 0, 0], [1, 1, 0, 0, 1, 1, 0, 0, 1, 0, 0, 0, 1, 1, 0, 0, 0, 0, 1, 1, 1, 1, 1, 0, 0, 0, 1, 0, 1, 0, 0, 0, 0, 1, 0, 1, 1, 1, 0, 0, 0, 1, 0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 1, 0, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0], [0, 1, 1, 0, 0, 0, 1, 1, 1, 1, 1, 1, 0, 1, 0, 0, 0, 0, 0, 0, 1, 1, 0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 1, 0, 1, 0, 1, 0, 0, 1, 0, 1, 1, 0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 0, 0, 1, 0, 1, 1, 1, 1, 0, 1, 1], [0, 1, 0, 1, 0, 1, 0, 0, 1, 1, 1, 0, 1, 1, 1, 0, 1, 0, 1, 0, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 1, 1, 1, 1, 0, 1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 1, 0, 0, 1, 1, 0, 0, 0, 0, 1, 1, 1, 0], [0, 1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 0, 0, 1, 0, 0, 0, 1, 0, 1, 1, 1, 0, 1, 1, 1, 0, 0, 1, 1, 1, 0, 1, 0, 0, 1, 0, 1, 0, 1, 1, 0, 1, 0, 1, 1, 1, 0, 0, 0, 0, 1, 0, 1, 0, 1], [0, 1, 1, 0, 1, 1, 1, 1, 0, 1, 1, 1, 0, 1, 1, 0, 1, 0, 1, 0, 1, 1, 1, 0, 1, 0, 1, 1, 1, 0, 0, 1, 1, 0, 0, 1, 1, 1, 0, 0, 1, 1, 1, 0, 1, 0, 1, 1, 0, 0, 1, 1, 1, 1, 0, 1, 0, 1, 1, 0, 0, 1, 1, 1], [1, 1, 0, 0, 0, 1, 1, 1, 0, 1, 1, 0, 0, 1, 1, 0, 0, 1, 1, 1, 0, 0, 0, 0, 1, 1, 1, 1, 0, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 0, 0, 1, 1, 1, 1, 0, 0, 0, 0, 1, 1, 0, 0, 0, 0, 0, 1, 1, 1, 0, 1, 1, 1, 1], [1, 0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 1, 1, 0, 0, 1, 1, 0, 1, 0, 0, 1, 1, 0, 0, 0, 1, 1, 0, 1, 0, 1, 0, 0, 0, 0, 1, 1, 1, 0, 0, 0, 1, 0, 1, 1, 1, 0, 1, 0, 0, 0, 0, 1, 1, 1, 1, 0, 0, 1, 0, 0, 0, 1], [0, 1, 1, 0, 1, 1, 1, 1, 0, 0, 0, 1, 1, 1, 0, 0, 1, 0, 0, 1, 0, 0, 1, 1, 0, 0, 0, 1, 1, 1, 1, 1, 0, 0, 1, 0, 0, 0, 1, 0, 0, 0, 0, 1, 1, 0, 1, 1, 1, 0, 1, 0, 0, 1, 1, 0, 0, 0, 0, 0, 0, 0, 1, 1], [1, 1, 0, 1, 0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 0, 0, 0, 1, 0, 0, 0, 1, 1, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1, 0, 1, 1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 0, 1, 1, 1, 0, 1, 1, 0, 0, 0, 1, 0, 0, 1, 1, 0, 0], [1, 0, 1, 1, 0, 1, 1, 1, 0, 1, 1, 0, 1, 1, 1, 1, 0, 0, 0, 1, 1, 1, 0, 1, 0, 1, 0, 0, 0, 1, 1, 0, 0, 0, 0, 1, 0, 1, 1, 1, 0, 0, 1, 0, 0, 1, 1, 1, 1, 0, 0, 0, 1, 1, 1, 0, 0, 1, 0, 1, 1, 1, 0, 1], [1, 1, 0, 1, 0, 1, 1, 0, 1, 0, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 0, 0, 0, 0, 1, 1, 0, 1, 1, 1, 1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 0, 0, 1, 0, 0, 0, 0, 0, 1, 1, 1, 1, 0, 0, 1, 0, 1, 1, 1], [0, 1, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1, 1, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 0, 0, 0, 1, 0, 0, 0, 1, 0, 1, 1, 0, 0, 0, 0, 0, 1, 1, 1, 0, 1, 1, 1, 1, 0, 0, 1, 1, 0, 1, 0, 0, 0], [1, 0, 1, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 0, 1, 0, 0, 1, 0, 1, 0, 0, 0, 1, 0, 1, 0, 1, 0, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 0, 0, 1, 1, 1, 1, 1, 0, 0, 1, 0], [1, 1, 0, 0, 1, 0, 0, 1, 0, 0, 1, 0, 0, 1, 0, 1, 1, 1, 0, 0, 1, 1, 1, 0, 0, 0, 1, 1, 1, 1, 0, 0, 0, 0, 1, 0, 0, 1, 1, 0, 0, 1, 0, 0, 1, 0, 1, 0, 0, 1, 1, 1, 0, 1, 0, 0, 1, 0, 1, 1, 1, 1, 1, 1], [0, 1, 0, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 1, 0, 1, 1, 1, 1, 1, 0, 0, 1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 1, 0, 1, 0, 1, 0, 1, 0, 0, 0, 1, 1, 0, 0, 1, 1, 1, 0, 1, 1, 1, 1, 0, 1, 1, 1, 1, 1, 0, 0, 1, 1], [0, 1, 1, 0, 1, 0, 0, 1, 0, 1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 1, 1, 1, 0, 1, 0, 0, 1, 0, 0, 0, 1, 1, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 1, 1, 1, 0, 0, 1, 1, 0, 1, 0, 0, 1, 0, 0, 0, 1, 0, 0, 1, 1, 1, 0], [0, 0, 0, 1, 1, 0, 1, 1, 1, 1, 0, 0, 0, 1, 1, 1, 1, 0, 0, 0, 1, 1, 0, 1, 0, 0, 0, 0, 1, 1, 0, 0, 1, 0, 0, 1, 0, 0, 1, 0, 0, 1, 1, 0, 0, 0, 1, 1, 1, 0, 1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 0, 1, 1, 0], [0, 1, 0, 0, 0, 0, 0, 1, 0, 0, 1, 0, 0, 0, 0, 0, 1, 0, 0, 0, 1, 1, 1, 0, 1, 0, 0, 1, 0, 1, 0, 1, 1, 0, 0, 0, 1, 0, 0, 0, 1, 1, 1, 0, 0, 1, 0, 1, 1, 0, 1, 1, 0, 1, 0, 0, 1, 1, 0, 0, 1, 1, 1, 1], [1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 1, 1, 0, 0, 1, 0, 1, 1, 1, 1, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 1, 0, 1, 0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 0, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1, 0, 1, 1, 0, 1], [0, 1, 1, 1, 1, 1, 0, 0, 1, 1, 0, 0, 1, 1, 1, 0, 0, 0, 1, 0, 1, 1, 1, 0, 0, 1, 0, 0, 0, 0, 0, 1, 1, 0, 0, 0, 1, 1, 0, 1, 0, 0, 1, 0, 0, 0, 0, 0, 0, 1, 0, 0, 1, 1, 1, 0, 1, 1, 1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 1, 1, 1, 1, 1, 1, 0, 1, 0, 0, 1, 0, 0, 0, 0, 0, 1, 1, 1, 0, 1, 0, 1, 0, 1, 0, 0, 1, 0, 1, 0, 0, 1, 0, 0, 1, 1, 1, 0, 1, 0, 1, 0, 1, 1], [1, 0, 1, 0, 1, 1, 1, 0, 1, 1, 0, 1, 1, 1, 0, 1, 0, 1, 0, 0, 0, 0, 1, 0, 1, 1, 0, 1, 1, 0, 1, 1, 1, 0, 0, 1, 0, 0, 1, 1, 1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 1, 1, 0, 0, 1, 0, 1, 0, 0, 0, 1, 0, 0, 1], [1, 0, 1, 1, 1, 1, 1, 0, 1, 0, 1, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 1, 0, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 0, 0, 0, 1, 1, 1, 1, 0, 1, 1, 0, 0, 1, 1, 0, 1, 0, 0, 0, 1, 0, 0, 1, 1, 1, 1, 0, 0], [0, 1, 1, 0, 0, 1, 1, 0, 1, 1, 0, 0, 0, 0, 0, 0, 0, 1, 1, 0, 0, 1, 1, 1, 1, 1, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 1, 0, 1, 0, 1, 1, 0, 0, 0, 1, 0, 1, 0, 0, 0, 0, 1, 0, 1, 1, 0], [1, 0, 1, 0, 0, 1, 1, 0, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1, 1, 0, 0, 1, 0, 1, 1, 1, 0, 1, 1, 0, 1, 1, 0, 1, 0, 0, 1, 1, 0, 1, 1, 0, 1, 0, 1, 0, 0, 1, 1, 1, 1, 0, 0, 0, 1, 0, 1, 1, 0, 1, 1, 0, 0, 0], [1, 1, 1, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 0, 1, 0, 0, 1, 0, 0, 0, 1, 0, 0, 0, 0, 1, 1, 1, 1, 1, 1, 0, 1, 1, 0, 1, 1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1], [1, 1, 0, 1, 0, 1, 0, 0, 0, 0, 0, 1, 1, 1, 0, 1, 0, 1, 0, 1, 1, 1, 0, 1, 1, 1, 0, 1, 0, 0, 1, 0, 1, 0, 0, 0, 1, 1, 0, 1, 0, 0, 1, 1, 1, 1, 1, 1, 0, 1, 1, 0, 0, 0, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1], [1, 1, 1, 1, 0, 0, 0, 1, 0, 1, 0, 1, 0, 0, 1, 1, 1, 1, 1, 0, 0, 0, 1, 1, 1, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 1, 1, 0, 0, 1, 1, 0, 1, 1, 1, 0, 1, 0, 0, 0, 1, 1, 1, 0, 0, 1], [1, 1, 1, 0, 0, 0, 0, 0, 1, 0, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 1, 0, 1, 0, 1, 0, 1, 1, 0, 0, 1, 1, 1, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 1, 1, 1, 0, 1, 0, 0, 0, 1, 1, 0, 1, 1, 0, 1, 1, 1, 0, 0, 1], [0, 0, 0, 1, 1, 1, 0, 1, 0, 0, 0, 0, 0, 1, 0, 1, 0, 0, 0, 1, 1, 0, 1, 0, 0, 1, 1, 0, 1, 1, 0, 1, 1, 0, 0, 0, 1, 1, 1, 0, 0, 0, 1, 0, 1, 0, 0, 1, 0, 1, 1, 0, 1, 0, 1, 1, 0, 1, 1, 0, 0, 0, 0, 1], [0, 1, 0, 1, 1, 1, 1, 0, 1, 0, 0, 0, 0, 1, 1, 1, 1, 1, 1, 0, 0, 1, 1, 0, 0, 1, 1, 0, 1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 0, 0, 1, 0, 0, 1, 1, 1, 0, 1, 0, 1], [0, 1, 0, 1, 1, 0, 1, 1, 0, 0, 1, 0, 0, 0, 1, 1, 0, 1, 1, 1, 1, 1, 1, 0, 0, 1, 0, 0, 0, 0, 1, 0, 1, 0, 1, 0, 1, 0, 0, 0, 1, 1, 0, 0, 1, 1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 1, 1, 1, 0, 0, 1, 0, 1, 1], [0, 0, 0, 0, 1, 1, 0, 0, 1, 0, 0, 0, 1, 1, 0, 0, 0, 1, 1, 1, 0, 1, 1, 0, 1, 1, 0, 1, 1, 1, 0, 0, 0, 0, 1, 1, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 0, 1, 1, 0, 1, 0, 0, 0, 0, 1, 1, 0, 1, 0, 0, 1, 0, 0], [1, 1, 0, 1, 1, 0, 1, 1, 1, 0, 0, 1, 0, 0, 1, 1, 0, 1, 0, 1, 0, 1, 0, 1, 1, 1, 0, 1, 0, 1, 0, 1, 1, 0, 1, 1, 1, 0, 0, 0, 0, 1, 0, 1, 0, 1, 0, 1, 0, 0, 0, 1, 1, 1, 1, 0, 0, 1, 1, 1, 0, 0, 1, 0], [1, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1, 0, 1, 1, 0, 0, 0, 1, 0, 0, 0, 1, 1, 0, 0, 0, 1, 0, 0, 0, 0, 1, 1, 0, 0, 1, 0, 1, 1, 0, 1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 1, 1], [0, 1, 1, 0, 1, 0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 1, 0, 1, 0, 1, 0, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 0, 0, 1, 1, 0, 0, 0, 1, 1, 0, 1, 1, 1, 1, 1, 0, 0, 1, 1, 0, 0, 0], [1, 0, 0, 1, 0, 1, 0, 0, 0, 1, 0, 1, 0, 1, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0, 0, 1, 1, 0, 1, 0, 1, 0, 1, 1, 1, 0, 0, 0, 1, 0, 0, 0, 1, 0, 1, 1, 1, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 1, 1, 1, 1, 0, 0, 0], [0, 0, 0, 1, 1, 1, 0, 1, 1, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 1, 0, 0, 1, 0, 1, 1, 0, 0, 1, 1, 1, 0, 0, 0, 0, 1, 1, 0, 1, 0, 0, 1, 1, 1, 0, 1, 0, 1, 1, 1, 0, 1, 1, 0, 1, 1], [1, 0, 1, 1, 1, 1, 0, 0, 0, 0, 0, 1, 0, 1, 0, 0, 1, 0, 1, 1, 0, 0, 0, 0, 0, 1, 0, 1, 1, 1, 1, 0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 1, 1, 0, 1, 1, 1, 0, 1, 1, 0, 0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 1, 1, 0], [1, 0, 1, 0, 0, 0, 0, 1, 1, 0, 0, 1, 1, 0, 1, 1, 0, 1, 1, 0, 0, 1, 1, 1, 1, 0, 1, 0, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 1, 0, 0, 1, 0, 1, 0, 0, 1, 0], [0, 0, 1, 0, 1, 1, 1, 0, 1, 1, 1, 1, 1, 0, 0, 1, 0, 1, 0, 1, 0, 0, 0, 0, 0, 1, 1, 1, 0, 0, 0, 0, 0, 0, 1, 1, 1, 0, 0, 0, 1, 1, 1, 1, 1, 0, 1, 1, 1, 0, 1, 0, 1, 0, 0, 0, 0, 1, 1, 1, 0, 1, 0, 1], [1, 0, 0, 1, 1, 0, 1, 0, 0, 1, 0, 1, 0, 1, 0, 0, 0, 1, 0, 0, 0, 0, 0, 1, 1, 1, 0, 1, 1, 1, 1, 0, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 1, 0, 1, 0, 1, 1, 1, 1, 1, 0, 1, 1, 0, 0, 0, 0], [1, 1, 1, 1, 0, 1, 1, 0, 0, 1, 0, 1, 0, 1, 0, 0, 1, 0, 0, 0, 1, 1, 0, 1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 1, 0, 0, 1, 1, 0, 0, 1, 0, 1, 1, 1, 1, 0, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 0], [0, 1, 0, 0, 1, 0, 0, 0, 1, 0, 0, 1, 1, 1, 1, 0, 0, 0, 1, 0, 0, 1, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 0, 0, 1, 0, 1, 1, 1, 1, 1, 0, 0, 0, 0, 1, 1, 0, 1, 0], [1, 1, 1, 1, 0, 0, 1, 0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 0, 1, 0, 0, 1, 0, 1, 1, 1, 1, 0, 1, 0, 1, 0, 0, 0, 0, 0, 0, 1, 1, 0, 0, 1, 1, 1, 1, 1, 0, 1, 1, 0, 0, 1, 1, 0, 1, 0, 1, 1, 0, 1, 1, 0], [1, 1, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0, 0, 1, 0, 1, 0, 1, 0, 1, 1, 1, 1, 0, 0, 1, 0, 1, 0, 1, 0, 1, 0, 1, 0, 0, 1, 0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 0, 1, 1, 0, 0, 1, 1, 0, 0, 0, 1, 1, 1, 1, 1, 1, 1], [0, 0, 0, 0, 1, 0, 0, 0, 1, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 1, 0, 0, 0, 1, 0, 1, 1, 0, 1, 0, 1, 1, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 0, 0, 0, 1, 0, 1, 1, 1, 1, 0, 1, 0, 1, 1, 1, 0, 0, 0, 0, 0, 1, 1], [1, 0, 0, 1, 0, 1, 1, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 1, 0, 1, 1, 1, 1, 1, 0, 0, 0, 1, 1, 1, 0, 0, 1, 0, 0, 0, 1, 1, 0, 0, 1, 1, 0, 0, 1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1, 0], [1, 0, 1, 0, 1, 1, 1, 1, 1, 1, 0, 0, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 0, 1, 1, 1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 0, 0, 0, 0, 1, 1, 1, 0, 1, 0, 0, 0, 1, 1, 0, 0], [1, 1, 1, 1, 1, 1, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 1, 0, 1, 1, 0, 0, 1, 1, 1, 1, 0, 1, 1, 0, 0, 0, 0, 0, 1, 1, 1, 1, 0, 0, 1, 1, 1, 0, 1, 1, 1, 0, 1, 1, 0, 0, 1, 1, 0, 1, 0, 1, 1, 0, 0, 1, 0, 1], [1, 0, 1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0, 1, 1, 0, 1, 1, 1, 0, 1, 0, 0, 1, 1, 1, 0, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 1, 1, 1, 0, 1, 1, 1, 1], [0, 0, 0, 0, 1, 1, 0, 0, 0, 1, 1, 0, 1, 1, 0, 0, 1, 1, 1, 1, 1, 0, 1, 1, 0, 0, 1, 1, 0, 1, 1, 1, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 0, 1, 1, 1, 1, 1, 0, 1, 0, 0, 0, 0, 0, 1, 1, 1, 1, 1, 0, 0, 1, 1], [0, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 0, 1, 1, 0, 1, 1, 0, 0, 1, 0, 0, 0, 1, 1, 0, 0, 1, 0, 0, 1, 1, 0, 0, 0, 1, 1, 1, 1, 1, 1, 0, 0, 0, 1, 1, 0, 0, 0, 0, 1, 1, 1, 0, 1, 0, 0, 1, 1, 0, 0, 1, 1, 1], [0, 0, 1, 0, 0, 1, 1, 0, 1, 1, 0, 0, 1, 1, 1, 1, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 0, 0, 1, 0, 1, 0, 1, 0, 0, 0, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 1, 0, 0, 0, 1, 1, 0, 1, 0, 0, 1, 0], [1, 1, 0, 1, 1, 1, 1, 1, 1, 0, 0, 1, 0, 0, 0, 0, 1, 1, 1, 0, 1, 0, 1, 0, 0, 0, 1, 0, 0, 0, 1, 1, 0, 1, 0, 0, 1, 1, 0, 1, 1, 1, 0, 0, 0, 1, 1, 1, 1, 1, 0, 1, 1, 0, 1, 0, 1, 0, 1, 1, 0, 0, 0, 1], [1, 0, 1, 0, 1, 0, 0, 0, 1, 1, 0, 1, 1, 1, 1, 1, 1, 0, 1, 0, 0, 1, 1, 1, 0, 0, 1, 0, 0, 1, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1, 0, 1, 1, 0, 0, 1, 0, 0, 1, 0, 0, 0, 0, 1, 0, 1, 1, 0, 1, 0, 0, 1], [1, 1, 0, 1, 0, 0, 1, 1, 0, 1, 1, 0, 1, 1, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 1, 0, 1, 0, 1, 1, 1, 1, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 1, 1, 0, 0, 0, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1, 1, 0, 1, 1], [1, 0, 1, 1, 1, 0, 0, 0, 1, 1, 0, 1, 1, 1, 0, 0, 1, 1, 0, 1, 1, 1, 0, 0, 0, 0, 0, 1, 1, 0, 1, 0, 1, 1, 1, 0, 1, 1, 1, 1, 0, 0, 1, 0, 1, 0, 1, 0, 0, 1, 0, 0, 0, 1, 1, 1, 0, 1, 1, 1, 1, 1, 0, 0], [0, 0, 0, 0, 0, 1, 0, 1, 0, 1, 1, 1, 1, 1, 1, 0, 1, 0, 0, 0, 1, 0, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 0], [0, 1, 0, 1, 0, 1, 0, 0, 1, 0, 0, 1, 0, 0, 1, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 1, 1, 1, 0, 0, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 1, 1, 0, 1, 0, 1, 1, 1, 0, 1, 0, 0, 0, 0, 1, 0, 0, 1, 0, 0, 0], [1, 1, 0, 0, 1, 1, 0, 1, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 0, 1, 0, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 1, 1, 1, 0, 1, 1, 0, 0, 1, 1, 0, 1, 0, 0, 1, 0, 1, 0, 0, 0, 0, 1, 0, 1], [0, 1, 0, 1, 0, 1, 0, 1, 0, 1, 0, 0, 1, 0, 1, 0, 1, 0, 1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 0, 0, 1, 1, 1, 0, 1, 0, 0, 0, 1, 1, 1, 1, 1, 0, 1, 0, 0, 1, 0, 0, 0, 1, 1, 1, 0, 0, 0, 0, 1, 1], [0, 1, 1, 0, 1, 1, 1, 1, 1, 0, 1, 1, 1, 0, 1, 0, 1, 0, 0, 1, 0, 0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 0, 0, 1, 1, 0, 0, 1, 1, 1, 0, 0, 1, 1, 1, 1, 0, 0, 0, 0, 0, 1, 1, 0, 0, 1, 1, 0, 0, 1, 0, 0, 0, 0], [0, 0, 0, 1, 1, 1, 1, 1, 0, 1, 0, 0, 0, 1, 0, 0, 1, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 1, 0, 0, 1, 0, 0, 0, 0, 0, 1, 1, 0, 1, 0, 0, 1, 1, 1, 0, 1, 0, 0, 0, 0, 1, 0, 1, 1, 1], [1, 1, 1, 1, 1, 0, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 0, 1, 0, 1, 1, 1, 1, 0, 0, 1, 0, 0, 1, 1, 0, 1, 1, 0, 0, 1, 1, 0, 1, 0, 1, 0, 0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 0, 0, 0, 1, 0, 0, 1, 1], [0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 0, 1, 1, 1, 0, 1, 1, 1, 1, 0, 0, 0, 1, 0, 1, 1, 0, 1, 1, 1, 0, 0, 1, 0, 0, 0, 1, 0, 1, 1, 1, 1, 0, 0, 1, 1, 0, 0, 1, 1, 0, 0, 1, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 0], [1, 1, 1, 0, 1, 0, 1, 1, 1, 0, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 0, 1, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 0, 0, 0, 1, 0, 1, 1, 1, 0, 1, 1, 1, 1, 0, 1, 0, 1, 1, 0, 1, 1, 0, 1, 0, 0, 1, 0, 1], [1, 0, 1, 1, 0, 0, 0, 1, 1, 1, 1, 0, 1, 0, 0, 1, 0, 0, 0, 1, 0, 1, 1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 0, 1, 0, 0, 0, 0, 1, 0, 1, 0, 1, 1, 0, 1, 1, 1, 1, 0, 0, 0, 1, 1, 1, 1, 0, 0, 0, 1], [1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 0, 0, 1, 1, 0, 1, 1, 0, 1, 0, 0, 0, 1, 1, 0, 0, 1, 1, 0, 0, 0, 1, 1, 1, 0, 1, 1, 1, 1, 1, 0, 1, 0, 1, 0, 0, 0, 1, 0, 1, 1, 0, 1, 1, 0, 0, 0, 1, 0, 0, 1, 1, 1], [0, 0, 1, 0, 1, 0, 0, 0, 0, 0, 1, 0, 0, 1, 0, 0, 1, 0, 1, 1, 1, 0, 0, 0, 1, 1, 1, 1, 0, 0, 1, 0, 0, 1, 0, 1, 1, 1, 1, 1, 1, 0, 1, 0, 1, 0, 0, 1, 0, 0, 1, 1, 0, 0, 1, 0, 0, 1, 1, 0, 0, 1, 1, 0], [0, 0, 0, 0, 1, 1, 1, 0, 1, 1, 1, 1, 0, 0, 1, 1, 0, 0, 1, 0, 1, 1, 1, 0, 0, 1, 1, 0, 1, 1, 1, 0, 1, 0, 0, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 1, 1, 0, 0, 0, 0, 0, 1, 1, 1, 1, 0, 0, 0, 0, 1, 1, 0, 0], [1, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0, 0, 1, 0, 0, 0, 1, 0, 1, 0, 1, 1, 0, 0, 1, 0, 0, 1, 0, 0, 1, 0, 0, 1, 1, 1, 1, 0, 0, 0, 1, 1, 0, 1, 0, 1, 1, 0, 0, 1, 1, 0, 1, 0, 0, 0, 1, 1, 0, 0, 1, 1, 0, 0], [1, 1, 1, 0, 0, 1, 0, 0, 0, 0, 1, 1, 1, 0, 1, 0, 0, 0, 0, 0, 1, 1, 0, 1, 0, 0, 1, 0, 0, 0, 1, 0, 1, 0, 1, 0, 1, 0, 1, 1, 0, 0, 0, 1, 0, 0, 0, 1, 0, 0, 0, 1, 0, 0, 1, 0, 0, 1, 1, 0, 0, 1, 0, 1], [1, 1, 0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 0, 0, 1, 0, 0, 1, 1, 1, 1, 0, 1, 1, 0, 0, 1, 1, 0, 0, 0, 0, 0, 1, 0, 1, 1, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 1, 0, 0, 1, 1, 1, 0, 1, 0, 0, 0, 1, 0, 0], [0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 1, 1, 0, 0, 0, 0, 0, 1, 0, 1, 0, 1, 0, 0, 0, 1, 0, 1, 0, 1, 0, 1, 0, 1, 0, 0, 0, 1, 0, 1, 1, 1, 1, 1, 0, 0], [1, 1, 0, 0, 1, 1, 0, 0, 0, 0, 1, 0, 1, 0, 0, 0, 1, 1, 0, 1, 0, 1, 1, 0, 1, 0, 1, 1, 0, 0, 1, 1, 0, 0, 1, 0, 1, 1, 0, 0, 1, 0, 0, 1, 1, 0, 0, 1, 1, 0, 1, 0, 1, 0, 0, 0, 0, 1, 1, 0, 1, 0, 1, 0], [1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 1, 0, 1, 0, 1, 1, 0, 0, 1, 0, 0, 1, 0, 0, 1, 1, 1, 0, 0, 1, 1, 1, 1, 1, 0, 0, 1, 0, 1, 1, 0, 1, 0, 1, 0, 1, 0, 1, 0, 0, 1, 0, 0, 1, 0, 0, 1, 1, 1, 1, 1, 0, 1, 1], [0, 1, 0, 1, 1, 1, 1, 0, 0, 1, 0, 0, 1, 0, 0, 1, 1, 0, 1, 0, 1, 1, 1, 0, 1, 1, 0, 1, 1, 1, 0, 1, 1, 0, 0, 0, 1, 0, 0, 0, 1, 1, 0, 0, 0, 1, 0, 1, 0, 1, 0, 0, 1, 1, 1, 1, 0, 0, 0, 0, 1, 1, 1, 1], [1, 1, 1, 1, 0, 1, 1, 0, 1, 0, 0, 1, 1, 1, 1, 0, 1, 1, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 0, 0, 1, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0], [0, 0, 1, 0, 1, 0, 1, 0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 0, 0, 0, 1, 1, 1, 1, 1, 0, 1, 1, 0, 0, 0, 1, 1, 1, 0, 1, 0, 1, 1, 1, 0, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 0, 0, 0, 0, 1, 1, 1, 1], [1, 0, 1, 1, 1, 1, 0, 0, 1, 0, 1, 1, 0, 1, 1, 0, 0, 1, 1, 0, 1, 1, 0, 1, 0, 0, 1, 1, 1, 0, 0, 1, 0, 1, 1, 0, 1, 1, 1, 0, 1, 1, 0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 0, 1, 0, 0, 1, 1, 0, 0, 1, 1, 1, 1], [1, 0, 1, 1, 1, 0, 1, 1, 0, 0, 1, 1, 1, 0, 0, 0, 0, 0, 1, 0, 1, 1, 1, 0, 0, 1, 1, 0, 0, 0, 1, 0, 1, 0, 0, 0, 0, 0, 1, 1, 1, 0, 0, 0, 1, 0, 0, 0, 0, 0, 1, 1, 1, 1, 0, 1, 1, 0, 0, 0, 1, 1, 1, 0], [1, 0, 1, 0, 0, 0, 0, 0, 1, 0, 1, 0, 1, 1, 1, 0, 0, 1, 0, 0, 0, 0, 1, 1, 0, 0, 1, 1, 0, 1, 1, 1, 0, 0, 0, 0, 1, 1, 0, 0, 0, 1, 1, 0, 1, 1, 0, 1, 0, 1, 1, 1, 1, 1, 1, 0, 0, 1, 0, 1, 0, 1, 0, 1], [1, 1, 1, 1, 1, 0, 0, 0, 1, 1, 1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 0, 1, 1, 1, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 1, 0, 0, 1, 1, 1, 1, 1, 1, 0, 1, 0, 0, 0, 1, 1, 0, 0, 1, 0, 1, 1, 1, 0, 0, 0, 0, 0, 1, 1], [1, 1, 0, 0, 0, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 0, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 1, 0, 1, 0, 0, 1, 1, 1, 0, 0, 1, 1, 0, 1, 0, 0, 0, 1, 1, 0, 0, 1, 0, 0, 1, 1, 0, 0, 1, 0, 1, 0, 1, 1, 1, 0, 0, 0], [0, 0, 0, 1, 1, 1, 0, 0, 1, 0, 1, 1, 0, 1, 0, 0, 1, 1, 1, 0, 1, 1, 1, 0, 0, 0, 0, 1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 0, 1, 1, 0, 0, 1, 0, 1, 0, 1, 1, 1, 1, 0, 0, 0, 1, 0, 0, 1, 1, 1, 0, 1, 0, 0, 1], [1, 1, 0, 1, 1, 1, 0, 0, 1, 1, 1, 0, 1, 0, 1, 1, 1, 0, 1, 1, 1, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 0, 0, 0, 1, 1, 1, 0, 1, 0, 0, 1, 1, 1, 1, 1, 1, 0, 0, 0, 1, 0, 1, 0, 1, 1, 0, 0, 0, 1, 1, 1, 0, 1], [1, 0, 0, 0, 0, 0, 1, 0, 1, 1, 1, 1, 1, 0, 0, 0, 1, 1, 1, 1, 1, 0, 1, 0, 0, 1, 0, 0, 0, 1, 0, 0, 1, 1, 1, 1, 0, 1, 0, 1, 0, 0, 0, 1, 1, 0, 0, 1, 1, 1, 1, 1, 0, 1, 0, 1, 0, 1, 1, 0, 0, 0, 1, 1], [1, 1, 1, 1, 0, 1, 1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 1, 0, 1, 1, 1, 0, 0, 1, 1, 0, 0, 1, 0, 0, 0, 1, 0, 1, 0, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1, 1, 0, 1, 0, 0, 0, 1, 0, 0], [1, 1, 0, 0, 1, 1, 1, 0, 1, 1, 0, 1, 0, 1, 1, 0, 1, 0, 0, 1, 0, 0, 0, 1, 0, 1, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 1, 0, 1, 1, 1, 1, 1, 0, 1, 1, 0, 1, 0, 0, 1, 0, 1, 0, 0, 0, 1, 1, 1, 1, 0, 0, 0, 1], [0, 1, 0, 0, 0, 1, 1, 1, 0, 1, 0, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 1, 1, 0, 1, 0, 1, 0, 0, 1, 0, 0, 0, 1, 0, 0, 1, 1, 1, 1, 1, 1, 0, 0, 0, 1, 0, 1, 1, 1, 1, 1, 0, 1, 1, 0, 0, 0, 1], [0, 0, 1, 1, 1, 1, 0, 1, 1, 0, 1, 1, 0, 0, 1, 1, 0, 0, 1, 1, 0, 0, 0, 0, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 1, 1, 1, 0, 0, 0, 1, 0, 0, 0, 1, 1, 1, 0, 0, 1, 0, 1, 0, 1, 0, 1, 0, 0, 0, 0], [1, 0, 0, 1, 0, 0, 1, 0, 0, 1, 1, 1, 1, 0, 0, 1, 0, 1, 1, 0, 1, 0, 0, 0, 1, 0, 0, 1, 0, 1, 1, 1, 1, 0, 1, 1, 0, 1, 0, 1, 1, 1, 0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 1, 0, 0, 1, 1, 0, 1, 0, 1, 1, 1, 0], [1, 0, 1, 1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 1, 1, 0, 0, 1, 1, 1, 1, 0, 0, 1, 1, 0, 0, 0, 0, 1, 1, 0, 1, 1, 1, 0, 1, 0, 0, 1, 0, 0, 0, 0, 0, 0, 1, 0, 1, 1, 1, 0, 1, 0, 1, 0, 0, 1, 1, 1, 1, 0, 1, 0], [0, 0, 1, 1, 0, 0, 0, 1, 0, 0, 1, 1, 0, 0, 0, 0, 1, 0, 1, 0, 1, 0, 1, 1, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1, 0, 1, 0, 0, 0, 1, 1, 1, 0, 0, 0, 0, 0, 1, 0, 0, 0, 1], [1, 0, 1, 0, 0, 0, 0, 1, 1, 1, 0, 1, 0, 0, 0, 0, 0, 1, 0, 1, 1, 1, 0, 1, 1, 1, 0, 0, 0, 0, 1, 0, 1, 0, 1, 0, 0, 0, 1, 0, 0, 0, 0, 1, 1, 0, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 0, 1, 0], [0, 0, 1, 1, 1, 1, 1, 1, 0, 0, 1, 0, 1, 1, 1, 1, 0, 0, 1, 1, 0, 0, 1, 1, 0, 1, 1, 1, 0, 0, 0, 1, 1, 1, 0, 0, 1, 1, 0, 0, 0, 1, 0, 0, 0, 1, 1, 1, 0, 0, 0, 0, 1, 1, 1, 0, 1, 1, 0, 1, 1, 0, 0, 0], [1, 0, 1, 0, 1, 0, 1, 1, 1, 0, 0, 0, 1, 1, 0, 0, 0, 1, 0, 1, 0, 1, 1, 0, 1, 1, 0, 0, 1, 1, 0, 0, 0, 0, 1, 0, 0, 1, 1, 0, 1, 0, 1, 1, 1, 1, 1, 1, 0, 1, 1, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0, 1, 0], [1, 1, 1, 1, 0, 1, 0, 0, 1, 1, 1, 1, 0, 0, 1, 0, 1, 0, 0, 1, 0, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 1, 0, 0, 0, 1, 0, 1, 1, 0, 0, 1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 0, 0, 0, 1, 0, 1, 0, 1, 0, 1, 1, 1, 1], [1, 0, 1, 1, 1, 1, 1, 0, 0, 0, 1, 1, 1, 1, 1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 0, 1, 0, 0, 0, 0, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 1, 1, 0, 1, 0, 0, 1, 0, 1, 1, 1, 0, 0, 0, 0, 0, 1, 0, 0, 1, 0, 1, 0, 0], [0, 0, 0, 0, 0, 1, 0, 1, 0, 1, 0, 1, 1, 0, 1, 0, 1, 0, 0, 0, 1, 1, 0, 0, 1, 0, 0, 0, 1, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 1, 1, 1, 1, 0, 0, 0, 1, 1, 0, 1, 0, 1, 1, 0, 1, 1, 0, 0, 1, 1, 1, 1, 1, 1], [1, 1, 0, 1, 0, 1, 0, 0, 1, 1, 1, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0, 0, 1, 0, 1, 1, 0, 0, 1, 1, 0, 1, 1, 1, 1, 0, 1, 0, 0, 0, 1, 1, 1, 0, 0, 1, 1, 0, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1, 0, 1, 1, 1, 0, 1], [1, 0, 1, 1, 0, 1, 1, 1, 1, 0, 0, 1, 0, 0, 0, 1, 1, 0, 0, 0, 0, 1, 1, 1, 0, 0, 1, 1, 1, 0, 0, 0, 1, 0, 1, 1, 1, 1, 0, 0, 1, 1, 0, 0, 1, 0, 1, 1, 0, 0, 1, 0, 1, 0, 1, 1, 1, 0, 1, 1, 0, 0, 1, 1], [1, 1, 1, 0, 0, 1, 0, 1, 1, 0, 1, 0, 1, 1, 1, 0, 0, 1, 1, 1, 0, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 1, 0, 0, 1, 0, 0, 1, 0, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 1, 1, 0, 0, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1, 1, 0, 0, 1, 1, 0, 1, 1, 1, 0, 0, 0, 0, 1, 1, 0, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 0, 0, 0, 0, 0, 0, 1, 1, 1, 0, 0, 0, 0, 1, 1, 0, 1, 1, 0, 1, 1], [1, 1, 1, 0, 1, 1, 0, 0, 1, 0, 0, 1, 0, 0, 0, 0, 1, 1, 0, 1, 1, 1, 0, 0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 1, 0, 1, 1, 0, 0, 1, 1, 0, 1, 1, 0, 1, 0, 1, 0, 1, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 1, 1, 1, 0], [0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 1, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 0, 1, 0, 1, 1, 0, 1, 0, 1, 1, 0, 0, 0, 1, 0, 1, 0, 0, 1, 0, 0, 0, 0, 1, 0, 1, 1, 0, 1, 1, 1, 0, 0, 0, 0, 0, 0, 1, 1, 0, 0, 0, 1], [1, 1, 0, 1, 1, 1, 1, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 1, 1, 0, 1, 1, 1, 0, 0, 0, 1, 1, 0, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1, 1, 0, 1, 1, 0, 0, 1, 1, 0, 0, 0, 1, 1], [1, 0, 1, 0, 1, 0, 1, 1, 0, 1, 0, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 1, 1, 1, 0, 1, 0, 0, 1, 1, 1, 0, 1, 1, 0, 0, 1, 1, 1, 0, 0, 0, 0, 1, 0, 1, 0, 0, 1, 0, 0, 1, 0, 1, 0, 0, 0, 0, 0, 0, 0, 0, 1], [1, 1, 1, 1, 0, 1, 1, 0, 1, 1, 0, 1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 1, 1, 0, 1, 0, 0, 1, 1, 1, 0, 0, 0, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 0, 0, 1, 0, 0, 1, 0, 1, 0, 0, 0, 1, 1, 0, 1, 0, 1, 1, 1, 0, 0], [1, 0, 1, 1, 0, 1, 1, 0, 0, 1, 1, 1, 1, 0, 1, 0, 0, 1, 1, 1, 0, 1, 1, 0, 0, 0, 1, 1, 0, 1, 0, 0, 1, 0, 1, 1, 0, 0, 1, 1, 0, 1, 0, 0, 0, 0, 0, 1, 1, 1, 0, 1, 1, 1, 1, 1, 0, 1, 1, 0, 1, 0, 0, 0], [1, 0, 1, 0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 0, 0, 1, 1, 1, 0, 0, 1, 1, 1, 1, 1, 0, 1, 0, 1, 1, 0, 0, 1, 0, 0, 0, 1, 1, 0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 1, 1, 0, 0, 0, 0, 1], [1, 0, 1, 0, 0, 0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 0, 1, 0, 1, 1, 0, 1, 1, 0, 1, 0, 1, 1, 1, 1, 0, 0, 1, 1, 1, 1, 0, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 1, 1, 0, 1, 0, 1, 1, 0, 0, 1, 1, 0, 1, 1, 1, 1, 0], [0, 1, 1, 1, 1, 0, 0, 1, 0, 0, 0, 0, 1, 0, 1, 0, 1, 0, 0, 0, 1, 1, 0, 1, 1, 1, 0, 0, 0, 0, 0, 1, 1, 1, 1, 1, 0, 0, 0, 0, 1, 1, 1, 0, 0, 1, 0, 1, 0, 1, 0, 0, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 0, 0], [1, 0, 0, 0, 0, 1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 0, 1, 0, 1, 0, 1, 1, 1, 0, 1, 1, 0, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 0, 1, 1, 1, 0, 0, 0, 0, 0, 1, 1, 0, 0, 1, 0, 1, 1, 0, 1, 0, 1, 1, 0, 1, 0, 0, 0], [0, 1, 1, 1, 0, 0, 0, 1, 0, 0, 0, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 1, 0, 1, 1, 0, 0, 0, 1, 1, 1, 0, 1, 1, 0, 1, 1, 0, 0, 1, 1, 1, 1], [1, 1, 0, 0, 1, 0, 1, 1, 1, 0, 1, 1, 0, 1, 1, 0, 1, 1, 1, 1, 0, 0, 0, 0, 1, 1, 1, 0, 1, 0, 0, 1, 1, 1, 0, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1, 0, 1, 0, 0, 1, 0, 1, 0, 1, 1, 0, 0, 0, 0, 1, 1, 0, 1, 0], [1, 0, 1, 0, 0, 0, 0, 0, 1, 1, 0, 1, 1, 0, 1, 1, 1, 1, 0, 1, 1, 0, 1, 1, 0, 0, 1, 1, 1, 1, 1, 1, 0, 1, 0, 0, 1, 1, 0, 0, 1, 0, 1, 1, 0, 0, 0, 1, 1, 1, 1, 0, 0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 1, 0], [1, 1, 0, 0, 0, 0, 0, 1, 1, 1, 1, 1, 0, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 0, 0, 0, 0, 0, 1, 1, 1, 1, 0, 1, 1, 1, 0, 1, 0, 0, 1, 0, 1, 0, 0, 0, 1, 0, 1, 1, 0, 1, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0, 0], [0, 0, 0, 0, 0, 1, 1, 1, 0, 1, 1, 0, 0, 1, 0, 0, 0, 0, 1, 1, 1, 0, 0, 0, 1, 0, 0, 0, 1, 1, 1, 0, 0, 0, 1, 0, 1, 1, 0, 1, 1, 0, 0, 0, 0, 1, 0, 0, 1, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 1, 0, 1, 1, 1], [1, 1, 0, 0, 0, 1, 0, 0, 0, 1, 0, 0, 1, 0, 1, 0, 0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 0, 0, 0, 1, 0, 0, 1, 0, 1, 0, 0, 0, 0, 0, 1, 0, 0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 1, 0, 1, 1, 1, 1, 1, 0, 1, 0, 1], [1, 0, 0, 0, 0, 0, 0, 1, 1, 0, 0, 1, 0, 1, 0, 0, 0, 0, 1, 1, 0, 0, 1, 1, 0, 1, 1, 1, 0, 0, 1, 1, 1, 1, 1, 0, 0, 1, 0, 1, 1, 0, 0, 1, 1, 0, 1, 0, 0, 0, 0, 0, 1, 0, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1], [0, 1, 0, 1, 1, 1, 0, 1, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 1, 1, 0, 0, 0, 1, 1, 1, 0, 0, 1, 1, 0, 1, 1, 1, 1, 0, 1, 1, 1, 0, 0, 0, 0, 0, 1, 1, 0, 1, 0, 0, 0, 0, 0, 1, 1, 0, 1, 1, 1, 1, 0, 1, 1, 1], [0, 1, 0, 0, 1, 1, 0, 1, 0, 1, 0, 1, 0, 1, 1, 0, 1, 0, 1, 0, 1, 0, 0, 1, 0, 1, 1, 0, 0, 0, 1, 1, 1, 1, 0, 1, 1, 0, 1, 0, 1, 0, 1, 0, 1, 1, 1, 0, 1, 0, 1, 0, 0, 0, 1, 1, 0, 1, 1, 0, 1, 1, 1, 0], [1, 0, 0, 1, 0, 1, 0, 1, 1, 0, 0, 0, 1, 1, 1, 0, 0, 1, 1, 1, 1, 0, 1, 0, 1, 0, 0, 1, 0, 1, 1, 0, 0, 1, 1, 1, 0, 1, 1, 0, 0, 1, 1, 0, 0, 1, 0, 1, 0, 1, 1, 1, 1, 0, 0, 1, 1, 0, 1, 1, 1, 0, 1, 1], [0, 0, 0, 0, 0, 1, 1, 0, 0, 1, 0, 0, 1, 1, 1, 1, 0, 1, 0, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 1, 1, 1, 1, 0, 1, 0, 0, 1, 1, 0, 0, 1, 1, 1, 0, 1, 1, 0, 1, 1, 0, 0, 1, 0, 0, 1, 0, 0, 1, 1, 0, 1, 1, 1], [1, 0, 0, 1, 0, 0, 0, 0, 1, 0, 1, 1, 0, 1, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 1, 1, 0, 1, 1, 1, 0, 1, 0, 1, 0, 1, 0, 0, 0, 1, 0, 1, 1, 1, 0, 0, 0, 0, 0, 1, 0, 0], [0, 0, 1, 1, 0, 1, 1, 0, 1, 0, 0, 0, 0, 1, 0, 1, 1, 0, 1, 0, 0, 1, 1, 0, 0, 0, 1, 0, 1, 0, 0, 1, 0, 1, 0, 0, 0, 0, 1, 1, 1, 0, 0, 0, 0, 0, 0, 1, 1, 1, 0, 0, 0, 0, 0, 1, 0, 0, 1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 1, 0, 1, 1, 1, 0, 1, 1, 0, 0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 1, 0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 0, 1, 0, 0, 1, 0, 1, 0], [1, 1, 1, 0, 1, 1, 1, 0, 0, 0, 1, 1, 0, 1, 0, 1, 1, 0, 0, 0, 0, 0, 1, 0, 1, 0, 1, 0, 1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 1, 0, 0, 1, 1, 1, 1, 1, 0, 0, 0, 1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 1, 1, 0, 0], [0, 1, 1, 0, 1, 1, 0, 0, 1, 1, 1, 0, 1, 0, 1, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 0, 0, 1, 1, 0, 1, 1, 1, 1, 1, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 0, 0, 0, 1, 1, 1, 0, 1, 1], [0, 0, 0, 1, 1, 1, 1, 0, 0, 1, 1, 0, 0, 1, 0, 0, 1, 0, 0, 0, 0, 0, 0, 1, 0, 0, 1, 1, 1, 0, 1, 1, 0, 0, 0, 1, 0, 0, 1, 1, 1, 0, 1, 0, 1, 0, 0, 0, 0, 0, 1, 0, 0, 1, 1, 0, 1, 0, 0, 0, 0, 0, 0, 0], [0, 1, 1, 0, 0, 1, 0, 0, 0, 1, 0, 1, 0, 0, 0, 1, 1, 1, 1, 1, 0, 1, 1, 0, 0, 0, 0, 0, 1, 1, 0, 0, 1, 0, 1, 1, 1, 0, 0, 0, 0, 0, 0, 1, 0, 1, 0, 1, 1, 0, 1, 1, 0, 0, 0, 1, 1, 1, 0, 0, 0, 1, 1, 0], [1, 0, 0, 0, 1, 0, 1, 1, 0, 1, 0, 0, 0, 1, 0, 0, 1, 1, 0, 1, 0, 0, 0, 0, 0, 0, 0, 1, 1, 0, 1, 0, 1, 0, 0, 1, 0, 1, 0, 0, 1, 1, 0, 1, 1, 1, 1, 0, 0, 0, 1, 0, 0, 0, 0, 0, 1, 1, 0, 1, 0, 0, 0, 1], [1, 0, 0, 0, 1, 1, 0, 0, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 0, 1, 1, 1, 0, 0, 1, 0, 0, 1, 0, 1, 1, 0, 1, 0, 0, 1, 1, 1, 0, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 1, 1, 0, 0, 1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 0], [1, 1, 0, 1, 0, 1, 1, 1, 0, 1, 1, 0, 0, 1, 1, 0, 1, 1, 1, 1, 0, 1, 1, 0, 1, 1, 1, 1, 0, 1, 0, 0, 0, 0, 0, 1, 0, 0, 0, 1, 0, 1, 1, 1, 0, 0, 0, 1, 1, 1, 0, 0, 0, 1, 0, 1, 1, 1, 1, 1, 1, 0, 0, 0], [0, 1, 1, 0, 0, 1, 0, 0, 1, 0, 1, 1, 0, 0, 1, 0, 1, 0, 1, 1, 1, 1, 0, 0, 1, 0, 1, 0, 0, 0, 0, 1, 0, 1, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 1, 1, 0, 1, 1, 1, 0, 0, 1, 1, 0, 0, 0, 1, 1, 0, 1, 0, 1, 1], [1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 1, 1, 0, 1, 1, 1, 1, 0, 1, 1, 0, 1, 1, 0, 0, 0, 1, 1, 1, 1, 0, 1, 0, 1, 1, 1, 1, 0, 1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 1, 0, 0, 0, 0, 1, 1, 1, 0, 1, 1, 1, 1, 0], [1, 1, 0, 1, 0, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 1, 0, 1, 1, 0, 1, 1, 0, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 0, 1, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 0, 0, 1, 0, 0], [0, 0, 1, 0, 0, 0, 1, 1, 0, 0, 1, 0, 1, 1, 0, 0, 0, 0, 1, 0, 1, 0, 1, 1, 0, 1, 0, 1, 1, 0, 0, 1, 0, 1, 1, 0, 1, 0, 0, 1, 1, 0, 1, 1, 1, 0, 1, 1, 0, 1, 1, 0, 0, 1, 1, 0, 1, 0, 1, 0, 1, 0, 0, 0], [0, 0, 0, 1, 0, 0, 0, 0, 1, 1, 1, 1, 1, 0, 0, 0, 0, 1, 0, 1, 1, 1, 0, 0, 0, 0, 0, 1, 0, 0, 1, 1, 1, 1, 0, 1, 1, 1, 1, 0, 0, 1, 0, 1, 0, 0, 1, 1, 1, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 1], [0, 0, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 1, 0, 0, 1, 1, 0, 1, 0, 0, 0, 0, 1, 0, 1, 1, 0, 0, 0, 1, 0, 1, 0, 0, 0, 1, 0, 1, 1, 1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 1, 0, 1, 0, 0, 1, 0, 1, 0, 1, 1, 1, 1, 0], [0, 0, 0, 0, 0, 1, 1, 1, 0, 0, 1, 1, 0, 1, 0, 1, 1, 1, 1, 0, 0, 1, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 1, 1, 1, 1, 0, 0, 1, 0, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1, 0, 1, 1, 0, 1, 0, 1, 0, 1, 0, 1, 1], [0, 1, 0, 0, 1, 1, 0, 0, 0, 0, 1, 1, 1, 0, 0, 1, 0, 0, 0, 1, 0, 0, 0, 1, 1, 0, 0, 1, 1, 0, 1, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1, 0, 0, 0, 1, 0, 1, 0, 1, 0, 0, 1], [1, 1, 0, 1, 0, 0, 1, 1, 1, 0, 1, 0, 1, 1, 0, 0, 1, 1, 0, 0, 0, 0, 0, 0, 1, 1, 1, 0, 0, 1, 0, 0, 0, 1, 0, 0, 1, 0, 0, 0, 0, 1, 1, 1, 1, 1, 1, 0, 0, 1, 1, 0, 1, 0, 0, 0, 1, 0, 0, 1, 1, 1, 0, 0], [0, 0, 1, 0, 1, 0, 0, 0, 1, 1, 1, 0, 0, 0, 0, 1, 0, 0, 1, 1, 0, 1, 1, 0, 1, 1, 0, 0, 0, 1, 0, 0, 1, 0, 0, 0, 0, 1, 0, 1, 1, 0, 1, 1, 1, 0, 0, 0, 1, 1, 1, 1, 0, 0, 0, 1, 1, 0, 0, 0, 1, 0, 1, 0], [1, 1, 1, 1, 0, 0, 0, 1, 1, 0, 1, 0, 1, 1, 1, 1, 1, 0, 0, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 1, 0, 1, 1, 1, 1, 0, 0, 0, 0, 0, 1, 0, 1, 1, 0, 0], [1, 0, 0, 0, 1, 0, 0, 0, 0, 1, 1, 0, 1, 0, 0, 0, 1, 1, 0, 1, 0, 1, 1, 1, 0, 0, 1, 0, 1, 0, 1, 0, 1, 1, 1, 0, 1, 0, 0, 0, 1, 0, 0, 1, 1, 1, 0, 1, 1, 0, 0, 0, 1, 0, 0, 1, 0, 0, 0, 0, 0, 1, 0, 0], [1, 0, 1, 1, 0, 0, 1, 0, 1, 1, 0, 0, 0, 0, 1, 1, 1, 1, 0, 0, 0, 0, 0, 1, 1, 0, 0, 0, 0, 1, 1, 1, 0, 0, 1, 1, 0, 0, 1, 1, 1, 0, 0, 1, 0, 0, 1, 0, 0, 1, 0, 0, 1, 0, 0, 1, 0, 1, 1, 1, 1, 0, 1, 1], [0, 1, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 1, 0, 1, 1, 0, 1, 0, 1, 0, 1, 0, 0, 0, 0, 1, 0, 1, 0, 0, 1, 0, 1, 1, 1, 0, 0, 0, 0, 1, 1, 0, 0, 1, 1, 0, 0, 1, 0, 1, 1, 0, 1, 0, 0, 1, 1, 1, 0, 1, 0], [1, 1, 1, 0, 1, 1, 0, 0, 1, 1, 1, 1, 1, 0, 1, 1, 0, 0, 1, 0, 1, 0, 0, 1, 0, 1, 1, 1, 0, 0, 0, 1, 0, 1, 1, 0, 1, 0, 0, 0, 1, 0, 1, 1, 1, 1, 0, 1, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1, 1, 0, 0, 1, 0, 1], [0, 1, 0, 0, 1, 1, 0, 0, 1, 0, 0, 1, 1, 1, 1, 0, 1, 0, 1, 0, 1, 1, 1, 0, 0, 0, 0, 0, 1, 1, 1, 0, 0, 1, 1, 1, 1, 1, 0, 0, 1, 0, 0, 0, 1, 0, 1, 1, 0, 1, 0, 1, 0, 0, 1, 0, 0, 0, 0, 0, 0, 1, 1, 1], [1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 1, 0, 0, 1, 0, 0, 0, 0, 1, 0, 1, 0, 0, 0, 0, 0, 1, 1, 0, 0, 1, 0, 0, 1, 0, 0, 1, 1, 0, 1, 0, 1, 1, 0, 1, 0, 1, 1, 1, 0, 0, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 0, 1, 1], [0, 0, 1, 1, 0, 0, 0, 0, 1, 1, 0, 1, 1, 0, 0, 1, 1, 0, 0, 1, 1, 0, 1, 0, 1, 0, 1, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 1, 1, 1, 0, 0, 0, 0, 1, 1, 0, 1, 1, 0, 1, 0, 1, 1, 1, 1, 0, 0, 1, 1, 1, 0, 1, 1], [0, 0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 1, 1, 0, 1, 0, 0, 0, 1, 1, 0, 0, 0, 1, 1, 1, 0, 0, 1, 0, 1, 0, 0, 0, 0, 1, 0, 1, 1, 0, 1, 0, 1, 0, 0, 0, 1, 0, 0, 1, 0, 1, 1, 1, 0, 0, 0, 1, 0, 1, 0, 0, 0, 0], [1, 0, 0, 1, 1, 1, 0, 1, 1, 0, 1, 1, 0, 1, 0, 1, 1, 0, 1, 1, 0, 0, 0, 1, 0, 0, 1, 0, 1, 1, 1, 0, 1, 0, 1, 0, 1, 1, 0, 1, 1, 1, 0, 0, 0, 1, 0, 1, 1, 1, 0, 0, 0, 1, 1, 1, 0, 1, 0, 1, 1, 1, 0, 0], [1, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 1, 1, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 1, 1, 0, 1, 0, 1, 0, 0, 1, 1, 1, 0, 1, 0, 1, 1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 1, 0, 1, 1, 1, 1, 0, 1, 1, 0, 1, 0, 1, 1, 0, 0], [0, 1, 0, 0, 0, 1, 1, 0, 0, 1, 1, 1, 0, 0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 0, 0, 0, 1, 1, 1, 0, 1, 0, 1, 1, 0, 1, 0, 1, 1, 0, 1, 1, 1, 1, 0, 1, 1, 0, 0, 0, 0, 1, 1, 1, 1, 1, 0, 0, 1, 1, 0, 1, 0, 0], [0, 1, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1, 0, 0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 1, 0, 0, 1, 0, 0, 1, 1, 1, 1, 1, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 1, 0, 1, 1, 0, 1, 1], [0, 0, 1, 0, 1, 1, 0, 1, 1, 0, 1, 0, 0, 0, 1, 1, 1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 1, 1, 0, 1, 0, 0, 0, 0, 1, 1, 0, 0, 0, 0, 1, 0, 1, 1, 0, 1, 1, 0, 1, 0, 0, 1, 1, 0, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0], [0, 1, 1, 0, 1, 1, 1, 1, 1, 1, 0, 0, 1, 1, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 1, 0, 1, 1, 1, 1, 0, 0, 0, 0, 1, 1, 0, 1, 1, 0, 1, 1, 0, 1, 1, 1, 0, 0, 1, 1, 1, 0, 1, 0, 1, 1, 0, 0, 1, 0, 0, 1, 1, 0], [0, 1, 0, 0, 1, 0, 0, 0, 0, 1, 0, 1, 1, 1, 0, 1, 0, 1, 1, 0, 0, 0, 0, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 0, 1, 0, 1, 1, 0, 1, 1, 0, 0, 1, 0, 0, 0, 0, 1, 0, 1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 0, 1, 0], [0, 0, 0, 0, 0, 1, 1, 0, 0, 1, 1, 1, 1, 0, 1, 0, 1, 1, 1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 1, 0, 1, 1, 0, 0, 1, 1, 1, 1, 1, 0, 0, 0, 0, 1, 1, 1, 0, 1, 1, 0, 1, 0, 0, 0, 0, 0, 1, 0, 1, 1, 1, 1, 1, 1], [1, 1, 1, 1, 0, 0, 1, 1, 1, 1, 1, 1, 0, 1, 0, 1, 0, 1, 0, 0, 1, 0, 1, 1, 1, 1, 1, 0, 1, 0, 1, 0, 1, 1, 0, 1, 0, 0, 0, 1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 1, 1, 0, 1, 0, 1, 1, 1, 1, 0, 0, 1, 0, 1, 1], [0, 1, 0, 0, 1, 1, 0, 1, 0, 1, 1, 1, 1, 1, 0, 1, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 1, 1, 0, 0, 1, 1, 1, 1, 0, 1, 0, 1, 0, 1, 1, 0, 0, 0, 1, 1, 1, 1, 1, 0, 1, 0, 0, 0, 0, 0, 1, 1, 1, 0, 0, 1, 1, 0], [0, 0, 1, 1, 1, 1, 0, 0, 0, 1, 0, 0, 1, 1, 1, 0, 1, 0, 1, 0, 1, 1, 1, 1, 1, 0, 1, 0, 0, 0, 1, 0, 0, 1, 0, 0, 0, 0, 1, 1, 0, 1, 1, 0, 0, 0, 0, 0, 1, 0, 0, 1, 0, 1, 1, 1, 1, 0, 0, 1, 0, 1, 0, 0], [0, 1, 1, 0, 1, 0, 1, 0, 1, 1, 1, 1, 0, 1, 0, 0, 0, 0, 1, 0, 1, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1, 1, 0, 1, 0, 1, 0, 1, 0, 0, 1, 0, 0, 1, 0, 1, 0, 0, 0, 0, 0, 0, 1, 0, 1, 0, 0, 0, 0, 0, 0, 0, 0, 1], [1, 1, 0, 1, 1, 0, 1, 0, 1, 0, 1, 1, 0, 1, 1, 0, 0, 1, 0, 1, 1, 0, 0, 0, 0, 1, 1, 1, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 1, 0, 1, 0, 0, 1, 1, 1, 1, 0, 0, 0, 0, 0, 1, 1, 0, 1, 1, 1, 1, 0, 1, 1, 1, 1], [1, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 1, 0, 0, 0, 1, 0, 0, 1, 1, 0, 1, 1, 1, 1, 0, 1, 1, 1, 1, 1, 0, 1, 0, 0, 0, 1, 1, 0, 1, 1, 1, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 0, 1, 0, 1, 1, 0, 1, 1, 0, 0, 0, 1], [1, 1, 0, 0, 0, 1, 0, 0, 0, 1, 1, 0, 1, 1, 1, 0, 1, 0, 0, 0, 0, 1, 1, 1, 0, 1, 1, 1, 1, 1, 0, 1, 1, 0, 0, 0, 0, 1, 0, 0, 1, 1, 1, 0, 1, 0, 0, 0, 0, 1, 1, 1, 0, 0, 0, 1, 1, 0, 1, 0, 1, 1, 1, 0], [1, 0, 1, 1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 1, 1, 1, 1, 0, 1, 1, 0, 0, 0, 0, 1, 1, 1, 1, 1, 1, 0, 0, 1, 0, 1, 0, 1, 1, 1, 0, 1, 1, 1, 1, 1, 0, 1, 0, 1, 0, 0, 1, 1, 1, 0, 0, 1], [0, 0, 1, 1, 1, 0, 1, 1, 0, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 0, 1, 1, 0, 1, 1, 1, 0, 1, 1, 0, 0, 1, 1, 1, 0, 1, 0, 1, 1, 1, 1, 0, 1, 1, 1, 0, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 1, 1, 0, 1, 1, 1, 1, 0], [0, 1, 1, 1, 0, 1, 1, 1, 1, 0, 0, 1, 0, 1, 1, 1, 0, 1, 0, 0, 0, 0, 0, 1, 0, 1, 0, 1, 0, 0, 0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 0, 0, 1, 1, 0, 1, 1, 0, 1, 1, 1, 1, 0, 0, 1, 1, 0, 0, 1, 1, 1, 0, 1, 1], [1, 0, 0, 1, 0, 0, 1, 0, 0, 0, 0, 1, 1, 1, 0, 0, 1, 1, 1, 0, 1, 1, 0, 0, 1, 0, 0, 0, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1, 0, 0, 1, 1, 0, 1, 0, 1, 0, 1, 0, 0, 0, 1, 1, 1, 0, 0, 0, 1, 1, 0, 0, 0, 1, 1], [1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 0, 1, 1, 0, 0, 0, 0, 0, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 1, 0, 1, 0, 1, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 0, 0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 0, 0, 1], [0, 0, 1, 0, 1, 0, 1, 0, 0, 0, 0, 1, 0, 0, 0, 1, 0, 1, 0, 1, 0, 0, 1, 0, 0, 0, 0, 0, 1, 0, 1, 1, 0, 1, 0, 0, 1, 0, 0, 0, 1, 0, 0, 1, 1, 1, 1, 0, 0, 0, 0, 1, 1, 1, 1, 1, 1, 0, 0, 1, 1, 0, 1, 0], [1, 0, 1, 0, 1, 0, 0, 1, 0, 1, 1, 1, 0, 0, 0, 1, 1, 1, 1, 1, 1, 0, 1, 1, 0, 0, 1, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0, 1, 0, 1, 1, 0, 0, 0, 0, 1, 1, 0, 0, 0, 0, 0, 1, 0, 1, 0, 0, 0, 1, 1, 1, 0, 1, 1], [1, 1, 0, 1, 0, 1, 0, 0, 0, 0, 0, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 0, 1, 0, 0, 0, 0, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1, 0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 1, 0, 0, 1, 0, 1, 1, 0, 1, 0, 0, 0, 0], [1, 1, 0, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 0, 0, 0, 0, 0, 1, 1, 1, 1, 0, 1, 1, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 0, 1, 0, 1, 1, 0, 0, 1, 0, 1, 1, 1, 0, 1, 1, 1, 1, 0, 0], [0, 1, 0, 1, 1, 0, 0, 1, 1, 1, 1, 0, 0, 1, 0, 1, 0, 0, 1, 0, 1, 0, 0, 0, 0, 0, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 1, 1, 0, 1, 1, 1, 1, 1, 0, 0, 0, 1, 0, 1, 0], [0, 1, 1, 1, 0, 1, 1, 1, 0, 0, 0, 1, 0, 0, 1, 1, 1, 1, 0, 0, 0, 0, 1, 1, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0, 1, 0, 1, 0, 1, 1, 1, 0, 1, 0, 0, 1, 0, 1, 0, 0, 0, 1, 0, 0, 1, 0, 1, 0, 0, 0, 1, 0, 1, 1], [1, 1, 0, 0, 1, 1, 0, 0, 1, 0, 0, 1, 1, 1, 1, 0, 0, 1, 0, 1, 1, 1, 1, 1, 1, 0, 0, 0, 1, 1, 1, 0, 0, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 1, 1, 0, 0, 0, 1, 1, 0, 0, 0, 0, 1, 0, 0, 1, 1, 1, 1, 0, 1, 1], [0, 0, 0, 0, 1, 1, 0, 1, 1, 1, 1, 1, 0, 1, 1, 0, 0, 0, 0, 0, 0, 0, 1, 0, 1, 1, 1, 1, 0, 1, 0, 1, 0, 1, 0, 1, 0, 1, 1, 1, 1, 0, 0, 1, 0, 1, 1, 1, 1, 0, 0, 0, 1, 0, 0, 0, 0, 1, 1, 1, 0, 0, 1, 1], [0, 1, 0, 0, 1, 1, 1, 0, 1, 0, 1, 1, 0, 1, 0, 0, 1, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0, 0, 1, 0, 1, 0, 0, 0, 1, 1, 1, 0, 0, 1, 1, 0, 1, 0, 0, 1, 0, 1, 0, 0, 1, 0, 1, 0, 1, 1, 1, 1, 0, 0, 1, 0, 0], [1, 0, 0, 0, 1, 1, 1, 1, 0, 1, 1, 0, 1, 1, 0, 1, 1, 1, 0, 0, 1, 0, 0, 1, 0, 1, 1, 1, 0, 1, 0, 1, 1, 0, 1, 1, 0, 0, 0, 0, 1, 1, 0, 0, 0, 0, 0, 1, 1, 1, 0, 1, 0, 1, 1, 0, 0, 1, 1, 1, 1, 1, 0, 0], [0, 1, 0, 0, 1, 1, 0, 1, 0, 0, 0, 1, 1, 1, 1, 0, 0, 0, 0, 1, 1, 1, 0, 0, 0, 0, 1, 0, 1, 1, 1, 0, 0, 1, 1, 1, 0, 0, 1, 1, 0, 0, 0, 1, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 1, 0, 1, 0, 0, 1, 1, 1, 1, 1], [1, 1, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 0, 1, 1, 1, 1, 1, 1, 0, 0, 1, 1, 0, 1, 0, 1, 0, 1, 0, 1, 1, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 0, 0, 0, 1, 0, 1, 0, 1, 1, 1, 1, 1, 1, 1, 0, 0, 1], [1, 0, 0, 1, 1, 0, 1, 0, 0, 1, 0, 0, 0, 1, 1, 0, 1, 1, 1, 0, 0, 0, 1, 0, 0, 1, 1, 1, 1, 0, 0, 0, 0, 1, 0, 0, 1, 1, 0, 0, 0, 1, 1, 1, 0, 0, 1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 1, 1, 0, 0, 0, 1, 1, 1], [1, 0, 0, 1, 1, 0, 1, 0, 1, 0, 1, 0, 1, 0, 0, 1, 0, 0, 1, 0, 0, 0, 0, 1, 0, 1, 1, 0, 0, 1, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 1, 1, 1, 0, 0, 1, 0, 1, 0, 1, 0, 0, 0, 1, 0, 1, 1, 0, 0, 0, 0, 1, 0], [1, 1, 1, 0, 0, 0, 0, 0, 1, 1, 0, 1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 1, 0, 0, 1, 0, 0, 1, 0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 0, 1, 1, 1, 0, 1, 1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 1, 1, 0, 0, 0, 1, 0, 0, 0], [1, 1, 1, 0, 0, 1, 1, 0, 1, 1, 1, 0, 0, 0, 1, 0, 0, 0, 1, 0, 1, 1, 1, 1, 1, 0, 1, 1, 0, 1, 0, 1, 0, 1, 0, 0, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 1, 1, 1, 0, 0, 0, 1, 1, 1, 1, 1, 0, 0, 1, 0, 0, 1, 1], [1, 1, 0, 0, 1, 0, 0, 0, 1, 1, 0, 1, 0, 0, 1, 0, 0, 0, 1, 1, 0, 1, 0, 0, 0, 0, 0, 0, 1, 0, 1, 0, 1, 1, 0, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 1, 1, 1, 0, 0, 0], [0, 1, 0, 0, 0, 1, 1, 1, 0, 0, 0, 1, 1, 0, 1, 0, 0, 0, 1, 0, 1, 1, 1, 0, 0, 1, 1, 1, 1, 1, 0, 1, 1, 0, 0, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 0, 1, 1, 0, 1, 0, 0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1], [1, 1, 1, 1, 0, 1, 1, 0, 1, 0, 0, 0, 0, 0, 1, 0, 1, 1, 0, 1, 1, 0, 1, 1, 0, 0, 1, 1, 1, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1, 0, 0, 0, 1, 1, 1, 1, 0, 1, 1, 1, 0, 1, 0, 1], [0, 1, 1, 0, 0, 0, 0, 1, 0, 1, 1, 0, 1, 0, 0, 1, 0, 1, 0, 1, 1, 1, 0, 0, 1, 1, 0, 0, 1, 1, 0, 1, 0, 0, 1, 1, 0, 1, 1, 1, 0, 1, 1, 0, 1, 1, 0, 1, 0, 1, 1, 1, 0, 0, 0, 1, 0, 0, 0, 0, 1, 1, 1, 1], [0, 0, 0, 0, 1, 1, 0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 1, 0, 1, 0, 1, 0, 1, 1, 0, 0, 0, 1, 1, 1, 1, 0, 1, 1, 1, 0, 1, 0, 1, 0, 1, 0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 0, 1, 0, 1, 1, 1, 1, 0, 1, 0, 0, 0, 1], [0, 0, 1, 0, 0, 1, 1, 0, 1, 0, 1, 0, 0, 1, 1, 1, 1, 0, 0, 0, 1, 0, 0, 1, 1, 1, 0, 1, 0, 1, 0, 1, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1, 1, 0, 0, 1, 1, 1, 1, 0, 1, 0, 1, 1, 1, 0, 0, 0, 0, 1, 0, 1, 1, 0], [0, 0, 0, 1, 0, 1, 1, 1, 1, 0, 1, 0, 0, 1, 1, 0, 0, 0, 0, 1, 1, 0, 0, 0, 1, 1, 1, 1, 1, 0, 0, 1, 1, 1, 0, 1, 1, 0, 1, 0, 0, 0, 0, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1, 0, 1, 1, 0, 0, 1, 1, 1, 1, 0, 1], [0, 1, 0, 0, 0, 1, 1, 1, 1, 0, 0, 1, 0, 0, 1, 1, 1, 0, 0, 1, 0, 1, 0, 0, 0, 0, 1, 1, 1, 1, 0, 1, 0, 1, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1, 0, 1, 0, 1, 0, 1, 1, 0, 1, 1, 0, 1, 1, 1, 0, 0, 0, 0, 1, 1], [0, 0, 1, 1, 1, 0, 0, 0, 0, 1, 1, 0, 0, 0, 1, 0, 1, 0, 1, 1, 1, 1, 0, 1, 1, 0, 0, 1, 0, 1, 0, 1, 0, 1, 1, 1, 1, 0, 0, 1, 1, 0, 0, 1, 1, 1, 1, 1, 0, 1, 0, 1, 1, 1, 1, 0, 1, 0, 1, 0, 0, 1, 1, 0], [1, 0, 1, 0, 1, 0, 0, 0, 0, 1, 1, 0, 1, 0, 1, 1, 0, 0, 1, 1, 0, 1, 1, 0, 0, 1, 0, 0, 0, 1, 0, 1, 0, 1, 1, 0, 1, 0, 0, 0, 1, 1, 0, 1, 0, 0, 1, 1, 0, 1, 1, 0, 0, 0, 0, 1, 0, 1, 1, 1, 1, 0, 1, 0], [0, 1, 0, 1, 0, 1, 0, 0, 1, 0, 0, 0, 1, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 1, 1, 0, 1, 0, 1, 1, 0, 1, 1, 0, 0, 0, 1, 1, 0, 1, 1, 0, 0, 1, 0, 1, 0, 1, 1, 0, 0, 1, 1, 1, 0, 0, 0, 0, 0, 1, 0, 1, 1], [0, 1, 1, 0, 1, 0, 1, 0, 0, 0, 1, 0, 0, 1, 1, 1, 1, 0, 1, 1, 1, 0, 0, 0, 0, 1, 1, 0, 0, 0, 1, 0, 0, 0, 0, 0, 1, 1, 1, 0, 0, 1, 1, 0, 1, 0, 1, 1, 0, 0, 0, 1, 1, 0, 1, 0, 1, 0, 0, 0, 0, 1, 1, 0], [0, 0, 0, 1, 0, 1, 1, 0, 0, 0, 0, 1, 1, 1, 0, 1, 1, 0, 1, 1, 1, 1, 0, 0, 0, 1, 0, 1, 0, 1, 0, 0, 0, 1, 1, 1, 0, 0, 1, 0, 1, 0, 1, 0, 1, 0, 0, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 0, 0, 1, 0, 0, 1, 0], [1, 1, 0, 0, 0, 0, 0, 0, 1, 0, 1, 1, 1, 1, 1, 0, 0, 0, 0, 1, 0, 1, 0, 0, 1, 0, 1, 1, 1, 0, 1, 0, 1, 0, 0, 1, 0, 0, 1, 0, 0, 1, 1, 1, 0, 1, 1, 0, 0, 0, 1, 0, 0, 0, 1, 0, 1, 0, 0, 0, 1, 0, 1, 0], [0, 1, 0, 0, 0, 1, 0, 0, 0, 1, 0, 0, 1, 1, 1, 0, 0, 0, 0, 0, 1, 0, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 1, 1, 0, 1, 1, 1, 0, 0, 0, 1, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 1, 0, 1, 1, 0, 0, 1, 0, 1, 0], [1, 1, 1, 0, 0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 1, 0, 0, 0, 0, 0, 0, 1, 0, 1, 1, 0, 0, 1, 1, 0, 1, 0, 0, 0, 0, 1, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 1, 0, 1, 1, 0, 0, 1, 0, 1, 1, 1, 1, 1, 1], [0, 0, 1, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 1, 0, 1, 0, 1, 1, 1, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 1, 0, 0, 1, 0, 0, 0, 0, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1, 1, 0, 0, 1, 1, 1, 1, 1, 0, 1, 1, 0, 0, 1, 1, 1], [1, 0, 1, 0, 0, 0, 0, 0, 0, 1, 0, 1, 0, 1, 1, 1, 1, 1, 0, 0, 1, 1, 0, 1, 1, 1, 0, 0, 1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 1, 1, 0, 1, 1, 1, 0, 0, 0, 1, 0, 0, 1, 1, 1], [1, 0, 1, 0, 0, 1, 1, 1, 1, 0, 0, 1, 0, 0, 1, 1, 0, 0, 1, 0, 1, 1, 1, 0, 1, 0, 0, 0, 1, 1, 0, 1, 1, 0, 0, 1, 0, 0, 0, 1, 1, 0, 1, 1, 0, 1, 1, 0, 1, 0, 1, 1, 0, 1, 1, 0, 0, 0, 0, 1, 1, 0, 0, 1], [1, 0, 1, 0, 0, 0, 0, 1, 1, 0, 1, 1, 0, 0, 0, 0, 1, 0, 0, 0, 1, 0, 0, 0, 0, 1, 1, 1, 0, 0, 0, 0, 0, 0, 1, 1, 1, 0, 1, 1, 1, 1, 1, 0, 0, 1, 0, 1, 0, 1, 0, 1, 0, 1, 1, 1, 1, 1, 1, 0, 0, 0, 1, 1], [0, 1, 0, 0, 1, 1, 1, 1, 0, 0, 1, 1, 0, 1, 1, 1, 1, 1, 0, 1, 1, 0, 1, 1, 1, 0, 0, 0, 1, 1, 1, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 0, 0, 0, 0, 1, 0, 1, 1, 1, 0, 0, 1, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1, 0], [1, 0, 0, 1, 1, 0, 0, 1, 0, 0, 0, 1, 1, 0, 1, 1, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 1, 1, 0, 1, 0, 0, 1, 0, 1, 0, 1, 1, 0, 0, 0, 1, 1, 0, 1, 1, 1, 0, 0, 0, 1, 0, 1, 0, 1, 1, 0, 1, 1, 0, 1, 0, 1, 0], [1, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 0, 1, 1, 0, 1, 0, 1, 0, 0, 0, 0, 1, 0, 0, 1, 0, 1, 0, 0, 1, 0, 0, 0, 0, 1, 0, 1, 1, 0, 0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 0, 0, 1, 1, 1, 1, 0, 1, 1, 0, 1, 1, 0, 1], [0, 0, 0, 0, 0, 0, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 1, 1, 1, 0, 1, 0, 1, 1, 1, 0, 0, 1, 0, 1, 1, 1, 0, 1, 0, 1, 1, 0, 0, 0, 1, 1, 1, 0, 0, 0, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1], [1, 1, 1, 1, 0, 0, 1, 0, 0, 1, 1, 0, 1, 0, 0, 1, 1, 1, 1, 0, 0, 0, 0, 1, 1, 1, 1, 0, 1, 1, 0, 1, 0, 1, 0, 1, 1, 0, 1, 0, 0, 1, 1, 0, 0, 1, 0, 0, 1, 1, 0, 0, 1, 0, 1, 0, 0, 0, 0, 1, 0, 0, 0, 0], [0, 0, 0, 1, 1, 0, 1, 1, 0, 0, 0, 1, 0, 1, 0, 0, 0, 1, 1, 0, 1, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 1, 0, 0, 1, 0, 1, 1, 1, 1, 1, 0, 1, 0, 1, 1, 1, 0, 0, 1, 1, 1, 1, 0, 1, 0, 0, 0, 0, 0, 1, 0, 0, 1], [0, 0, 1, 0, 1, 1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 0, 1, 0, 0, 0, 0, 1, 1, 1, 0, 0, 1, 1, 1, 1, 0, 0, 0, 1, 1, 0, 1, 0, 1, 1, 1, 1, 1, 0, 0, 0, 1, 1, 0, 1, 1, 0, 0, 0, 1, 1, 0, 1, 1, 0, 0, 1, 0, 1], [1, 1, 0, 0, 1, 1, 0, 1, 0, 1, 0, 1, 1, 0, 0, 0, 0, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 1, 1, 1, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 0, 1, 1, 1, 0, 0, 0, 1, 1, 1, 1, 0, 1, 0], [1, 1, 1, 1, 1, 0, 0, 1, 0, 0, 0, 0, 0, 0, 1, 1, 0, 1, 0, 0, 0, 1, 1, 0, 1, 0, 1, 1, 0, 1, 1, 0, 0, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 1, 1, 1, 1, 0, 0, 1, 0, 1, 1, 1, 0, 1, 1, 1, 0, 1, 0, 0], [1, 1, 0, 1, 0, 1, 0, 1, 1, 0, 0, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 1, 1, 0, 1, 1, 0, 1, 0, 1, 0, 0, 1, 0, 1, 1, 1, 1, 0, 1, 0, 1, 1, 1, 0, 1, 1, 0, 0, 0, 0, 0, 0, 0, 1, 0], [1, 1, 0, 1, 1, 0, 1, 1, 0, 0, 0, 0, 0, 1, 0, 1, 1, 1, 1, 1, 1, 0, 0, 1, 0, 0, 1, 1, 1, 1, 1, 0, 1, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1], [1, 0, 0, 1, 1, 1, 1, 1, 0, 0, 0, 0, 1, 1, 0, 1, 1, 0, 1, 1, 1, 1, 0, 1, 1, 1, 0, 1, 0, 1, 0, 1, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 0, 1, 1, 1, 1, 0, 1, 1, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 1, 1, 1, 0], [0, 1, 0, 1, 0, 1, 1, 1, 1, 0, 1, 0, 0, 0, 0, 0, 0, 1, 1, 0, 0, 1, 0, 0, 0, 1, 1, 0, 0, 1, 0, 1, 1, 0, 0, 0, 1, 1, 0, 1, 0, 0, 0, 1, 0, 0, 0, 0, 1, 1, 0, 1, 1, 1, 0, 0, 1, 1, 1, 0, 0, 0, 1, 0], [1, 1, 1, 1, 1, 0, 0, 0, 1, 0, 0, 1, 1, 0, 1, 1, 0, 1, 0, 0, 1, 1, 1, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0, 1, 1, 0, 0, 1, 0, 1, 0, 0, 1, 0, 0, 1, 1], [0, 0, 0, 1, 0, 1, 0, 0, 0, 1, 0, 1, 1, 0, 1, 0, 1, 1, 1, 0, 0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 0, 1, 1, 0, 1, 0, 1, 0, 1, 1, 1, 0, 0, 0, 0, 0, 0, 1, 1, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 0, 1], [1, 1, 0, 1, 0, 0, 0, 0, 0, 1, 1, 0, 1, 0, 0, 1, 0, 0, 0, 1, 1, 0, 1, 0, 1, 0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 0, 1, 0, 1, 0, 1, 1, 1, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 1, 1, 0, 1, 1], [0, 0, 1, 1, 1, 0, 0, 1, 0, 1, 0, 0, 0, 1, 0, 1, 0, 1, 0, 0, 1, 0, 0, 1, 1, 0, 0, 0, 1, 1, 0, 1, 1, 1, 1, 0, 0, 0, 1, 1, 0, 1, 0, 1, 1, 1, 0, 1, 1, 0, 1, 1, 0, 1, 1, 1, 0, 0, 1, 1, 0, 1, 0, 0], [0, 1, 1, 1, 0, 1, 1, 0, 1, 1, 1, 0, 1, 0, 1, 1, 0, 1, 0, 0, 0, 1, 1, 1, 0, 0, 1, 1, 1, 0, 0, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 1, 0, 0, 0, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 1, 1, 1], [0, 0, 0, 0, 0, 1, 0, 0, 1, 0, 0, 1, 1, 1, 0, 0, 1, 0, 1, 1, 0, 1, 0, 1, 1, 0, 1, 0, 1, 1, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 1, 0, 1, 1, 1, 1, 0, 1, 0, 0, 1, 1, 1, 0, 1, 0, 1, 1, 0, 0, 1, 0, 0, 1], [1, 0, 0, 1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 1, 1, 1, 0, 0, 1, 0, 0, 0, 0, 0, 1, 1, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 1, 1, 1, 0, 1, 1, 1, 0, 1, 1, 0, 1, 1, 1, 1, 0, 0, 1, 0, 1, 1, 0, 0, 1, 1, 0, 0, 1], [0, 1, 1, 1, 1, 0, 0, 0, 0, 1, 0, 1, 1, 0, 1, 1, 1, 0, 0, 0, 1, 0, 0, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 1, 1, 0, 0, 1, 1, 1, 0, 1, 1, 1, 1, 0, 1, 0, 0, 0, 1, 0, 0, 1, 1, 1, 1, 0, 1, 1, 0], [0, 0, 0, 1, 1, 1, 1, 0, 0, 0, 0, 1, 1, 1, 1, 0, 0, 0, 0, 1, 1, 1, 1, 0, 1, 0, 1, 1, 0, 0, 0, 0, 1, 1, 0, 1, 1, 1, 1, 0, 0, 0, 0, 1, 0, 1, 0, 0, 0, 1, 0, 0, 1, 1, 0, 0, 1, 0, 0, 1, 0, 1, 1, 1], [1, 1, 1, 0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 0, 0, 0, 1, 0, 1, 0, 1, 0, 0, 1, 0, 1, 0, 0, 0, 1, 0, 0, 1, 1, 1, 0, 1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 1, 1, 1, 0, 1, 0, 0, 1, 1], [0, 1, 0, 1, 1, 0, 1, 0, 1, 1, 0, 0, 0, 0, 1, 0, 1, 0, 0, 0, 0, 1, 1, 0, 1, 0, 1, 0, 1, 0, 1, 1, 1, 0, 0, 1, 0, 1, 0, 1, 1, 1, 1, 0, 1, 1, 0, 0, 1, 1, 0, 1, 0, 0, 1, 1, 1, 0, 1, 1, 1, 0, 0, 0], [0, 0, 1, 1, 1, 1, 1, 0, 1, 0, 0, 1, 1, 1, 1, 0, 1, 1, 1, 0, 1, 0, 0, 0, 0, 1, 1, 1, 0, 0, 1, 1, 0, 1, 1, 0, 0, 1, 1, 1, 1, 1, 1, 0, 1, 0, 0, 1, 1, 1, 1, 0, 0, 0, 1, 0, 0, 1, 0, 0, 0, 0, 1, 0], [1, 0, 1, 1, 1, 0, 0, 0, 0, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 1, 0, 1, 0, 0, 1, 0, 1, 1, 1, 0, 0, 0, 0, 1, 0, 1, 0, 1, 1, 1, 0, 1, 1, 0, 0, 0, 0, 1, 0, 0, 1, 1, 0, 1, 1, 1, 1, 0, 1, 0], [0, 0, 1, 0, 0, 1, 1, 1, 0, 0, 1, 0, 1, 1, 0, 0, 1, 1, 0, 1, 1, 0, 1, 1, 0, 0, 0, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 0, 0, 1, 0, 0, 1, 0, 1, 1, 1, 0, 0, 1, 0, 0, 1, 1], [1, 1, 1, 0, 0, 0, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 0, 0, 1, 0, 0, 1, 1, 0, 1, 1, 1, 0, 0, 1, 0, 0, 1, 0, 0, 1, 1, 1, 1, 1, 0, 0, 1, 1, 1, 1, 0, 1, 0, 0, 0, 0, 1, 1, 1, 0, 0, 0, 1, 1, 0, 1, 1, 1], [1, 0, 0, 0, 0, 0, 1, 1, 0, 1, 0, 1, 1, 0, 0, 0, 1, 1, 0, 1, 0, 1, 0, 1, 1, 1, 1, 1, 1, 0, 0, 0, 1, 1, 1, 1, 1, 0, 1, 1, 0, 1, 0, 1, 0, 0, 0, 1, 0, 1, 0, 1, 0, 0, 1, 0, 1, 1, 1, 0, 0, 0, 0, 1], [0, 0, 1, 0, 1, 0, 0, 0, 1, 1, 1, 0, 1, 1, 0, 1, 0, 0, 0, 1, 0, 1, 1, 0, 0, 1, 1, 1, 0, 0, 0, 0, 1, 1, 0, 0, 0, 0, 0, 0, 0, 1, 0, 1, 0, 1, 0, 1, 0, 1, 1, 0, 1, 1, 0, 1, 1, 0, 0, 0, 0, 0, 0, 1], [0, 0, 1, 0, 1, 0, 1, 1, 0, 0, 0, 0, 1, 0, 1, 1, 0, 1, 0, 0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 1, 0, 0, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 1, 1, 1, 0, 0, 1, 1, 0, 1, 1, 0, 1, 1, 0, 0, 0, 1, 1, 1, 1, 0, 1], [0, 0, 0, 1, 1, 1, 1, 1, 0, 1, 0, 1, 0, 1, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0, 0, 1, 1, 0, 0, 0, 0, 0, 1, 1, 1, 1, 0, 1, 0, 1, 0, 0, 0, 0, 0, 1, 0, 1, 0, 1, 1, 0, 1, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1, 0], [0, 1, 0, 0, 1, 1, 1, 1, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 0, 0, 0, 1, 0, 0, 1, 0, 1, 0, 0, 0, 0, 1, 1, 0, 0, 0, 0, 1, 0, 1, 1, 0, 0, 1, 0, 1, 0, 0, 0, 0, 0, 0, 0, 0, 1, 0, 1, 1, 1, 1, 0], [0, 0, 0, 1, 0, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 0, 1, 1, 0, 0, 1, 0, 0, 0, 1, 0, 0, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 1, 0, 0, 1, 0, 0, 0, 0, 1, 1], [1, 0, 0, 1, 1, 0, 0, 0, 0, 0, 0, 0, 1, 0, 1, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 1, 0, 0, 1, 1, 1, 0, 0, 1, 1, 1, 1, 1, 0, 1, 1, 1, 0, 1, 0, 1, 0, 1, 0, 1, 1, 0, 0, 1, 0, 1, 0], [1, 1, 1, 1, 1, 0, 1, 0, 1, 0, 0, 0, 1, 0, 0, 1, 1, 1, 0, 1, 1, 1, 0, 1, 1, 0, 1, 0, 0, 1, 1, 1, 1, 1, 1, 0, 1, 0, 1, 0, 0, 1, 0, 0, 0, 0, 0, 0, 1, 1, 0, 1, 1, 0, 0, 0, 0, 1, 1, 1, 0, 0, 1, 0], [0, 0, 1, 1, 1, 0, 1, 1, 0, 0, 1, 1, 1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 0, 0, 1, 1, 1, 1, 0, 1, 1, 0, 0, 1, 1, 0, 1, 0, 1, 0, 1, 1, 1, 0, 1, 1, 1, 0, 1, 1, 0, 0, 0, 1, 1, 1, 1, 0, 1, 0, 1, 1, 0, 0], [1, 1, 1, 1, 0, 1, 0, 1, 0, 1, 0, 0, 0, 1, 0, 1, 0, 1, 0, 0, 1, 0, 0, 0, 1, 1, 0, 0, 1, 0, 1, 0, 0, 1, 0, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 1, 0, 1, 1, 0, 0, 0, 1, 1, 0, 1, 0, 0, 0, 1, 0, 1, 0], [1, 0, 0, 0, 1, 0, 1, 1, 0, 1, 0, 0, 1, 1, 0, 0, 1, 1, 0, 1, 1, 0, 0, 0, 1, 1, 1, 0, 1, 0, 1, 0, 1, 0, 0, 0, 0, 1, 1, 0, 1, 1, 0, 0, 1, 1, 0, 1, 0, 1, 0, 0, 1, 0, 1, 0, 1, 1, 1, 0, 1, 0, 0, 1], [0, 1, 1, 1, 0, 1, 0, 0, 0, 0, 0, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 1, 0, 1, 0, 0, 0, 0, 1, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 1, 1, 1, 0, 1, 0, 0, 1, 1, 0, 0, 0, 0, 0, 0, 1, 0, 0, 1, 1, 0, 1, 1, 1, 0], [0, 1, 1, 1, 0, 0, 0, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1, 0, 0, 1, 1, 1, 1, 0, 1, 0, 1, 1, 1, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 0, 0, 1, 0, 1, 0, 0, 0, 1, 0], [0, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 0, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 1, 1, 1, 0, 1, 1, 0, 0, 0, 1, 0, 0, 1, 1, 0, 0, 0, 0, 1, 0, 0, 1, 0, 1, 1, 0, 0, 0, 0, 1, 1], [1, 0, 1, 1, 0, 1, 1, 0, 1, 1, 0, 0, 1, 1, 0, 0, 0, 0, 1, 1, 0, 1, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 0, 1, 0, 1, 1, 1, 1, 0, 1, 1, 0, 1, 1, 1, 0, 1, 0, 0, 1, 0, 1, 0, 1, 0, 1, 1, 1, 0, 0, 0, 1], [1, 1, 1, 1, 0, 1, 1, 0, 1, 1, 1, 1, 0, 1, 1, 0, 1, 1, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 1, 0, 1, 0, 0, 0, 1, 1, 0, 1, 1, 1, 0, 1, 0, 1, 0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 0, 0, 1, 0, 1, 1, 1, 0, 0, 1], [1, 1, 1, 0, 1, 1, 0, 1, 1, 0, 0, 0, 0, 1, 1, 0, 1, 0, 1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 1, 0, 0, 1, 1, 0, 1, 0, 1, 0, 0, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 1, 1, 1, 0, 1, 1, 0, 1, 1, 1, 0, 0, 1, 1, 1], [1, 0, 1, 0, 1, 1, 0, 1, 0, 0, 1, 0, 0, 0, 1, 0, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 1, 0, 1, 1, 1, 1, 0, 1, 0, 0, 0, 0, 0, 0, 1, 1, 0, 0, 1, 0, 1, 1, 1, 1, 1, 0, 0, 0, 0, 1, 0, 0, 0, 1, 0, 0, 0, 0], [0, 0, 0, 1, 0, 1, 1, 0, 1, 0, 0, 1, 1, 0, 0, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 1, 0, 1, 0, 0, 1, 0, 0, 0, 1, 1, 1, 0, 1, 1, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 1, 0, 0], [1, 0, 1, 0, 0, 1, 0, 1, 0, 0, 1, 1, 1, 0, 1, 0, 1, 1, 1, 1, 0, 0, 0, 0, 0, 1, 0, 0, 1, 1, 0, 1, 1, 1, 0, 1, 0, 0, 0, 1, 1, 0, 1, 1, 1, 0, 0, 0, 1, 0, 1, 0, 1, 0, 0, 1, 0, 1, 0, 1, 0, 0, 0, 0], [1, 0, 0, 0, 1, 1, 0, 0, 1, 0, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 0, 1, 0, 0, 0, 1, 1, 1, 1, 1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 1, 1, 1, 1, 0, 1, 0, 0, 1, 0, 1, 0, 0, 1, 1, 1, 1, 1, 0, 0, 1, 0, 0, 0, 1], [1, 1, 1, 0, 1, 1, 1, 0, 1, 0, 1, 0, 0, 1, 1, 1, 1, 1, 1, 0, 1, 0, 0, 1, 1, 1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 0, 0, 1, 0, 1, 0, 1, 0, 1, 1, 1, 1, 1, 0, 1, 0, 1, 0, 1, 0, 0, 0, 1, 1, 0, 0, 1, 1, 1], [1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 0, 1, 0, 1, 1, 1, 0, 0, 1, 0, 0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 1, 0, 1, 0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 0, 1, 0, 1, 0, 0, 0, 1, 0, 1, 1, 0, 1, 0], [0, 0, 0, 0, 1, 0, 1, 0, 1, 0, 0, 1, 0, 0, 0, 0, 1, 1, 1, 0, 0, 0, 1, 1, 0, 1, 0, 1, 0, 1, 0, 1, 1, 1, 0, 1, 0, 1, 1, 0, 1, 0, 0, 1, 1, 1, 1, 0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 1, 1, 1, 0, 1, 1, 0], [1, 0, 0, 0, 1, 0, 0, 1, 1, 0, 0, 0, 0, 1, 1, 1, 0, 1, 0, 0, 1, 0, 1, 0, 1, 0, 1, 0, 1, 1, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 1, 1, 0, 1, 0, 1, 0, 0, 0, 0, 0, 1, 1, 0, 0, 0, 1, 1, 0, 1], [1, 0, 0, 1, 0, 0, 0, 1, 1, 0, 1, 1, 0, 1, 0, 1, 0, 1, 1, 0, 1, 0, 1, 0, 1, 1, 0, 0, 1, 0, 1, 0, 1, 0, 1, 0, 1, 0, 1, 1, 1, 0, 0, 0, 0, 1, 0, 1, 1, 0, 1, 0, 1, 0, 1, 0, 1, 0, 1, 1, 0, 0, 0, 1], [1, 0, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 0, 1, 1, 1, 0, 1, 0, 0, 0, 1, 1, 1, 0, 0, 0, 1, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 1, 0, 0, 0, 0, 1, 0, 0, 0, 1, 0, 1, 0, 1, 0, 0], [1, 1, 0, 1, 0, 1, 0, 0, 1, 1, 1, 0, 1, 0, 0, 1, 1, 1, 0, 0, 1, 0, 1, 0, 1, 1, 1, 1, 0, 0, 1, 1, 1, 1, 1, 1, 0, 0, 1, 1, 1, 1, 0, 1, 0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 0, 0, 0, 1, 0], [0, 1, 1, 0, 0, 0, 0, 0, 0, 1, 0, 0, 1, 0, 0, 0, 0, 1, 1, 0, 1, 0, 0, 1, 0, 1, 1, 1, 0, 0, 0, 1, 0, 1, 1, 0, 1, 1, 0, 1, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 1, 0, 0, 0, 0, 0, 1, 1, 1, 1, 1, 0, 1, 1], [0, 1, 0, 1, 0, 0, 0, 1, 0, 1, 1, 0, 0, 1, 1, 0, 0, 0, 1, 0, 0, 1, 0, 1, 0, 0, 0, 0, 1, 1, 1, 1, 1, 1, 0, 1, 0, 1, 1, 1, 1, 1, 1, 1, 0, 0, 1, 1, 1, 1, 1, 0, 1, 1, 0, 1, 1, 0, 1, 1, 0, 0, 1, 0], [1, 1, 0, 1, 1, 0, 0, 1, 1, 0, 1, 1, 0, 0, 0, 1, 1, 0, 1, 0, 0, 0, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 1, 1, 1, 0, 0, 1, 0, 0, 0, 1, 1, 1, 0, 0, 0, 0, 1, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0, 1], [0, 1, 1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 1, 0, 0, 1, 1, 1, 0, 0, 1, 1, 1, 1, 1, 0, 0, 0, 0, 1, 1, 0, 1, 1, 0, 0, 1, 0, 1, 1, 0, 1, 1, 0, 0, 1, 1, 0, 1, 1, 1, 1, 0, 0, 1, 1, 1, 0, 0, 1, 1, 0, 1, 1], [0, 1, 0, 0, 0, 1, 0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 1, 1, 0, 1, 1, 0, 0, 1, 0, 1, 0, 0, 0, 0, 0, 0, 0, 1, 1, 0, 0, 0, 0, 0, 0, 0, 1, 1, 0, 1, 0, 0, 0, 0, 1, 1, 0], [1, 0, 1, 0, 1, 0, 0, 1, 0, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 1, 1, 0, 0, 1, 0, 0, 1, 0, 0, 1, 1, 0, 1, 0, 0, 0, 0, 1, 1, 1, 0, 1, 1, 1, 0, 0, 1, 1, 0, 0, 1, 1, 1, 0, 1, 1, 0, 1, 0, 1, 1], [0, 1, 1, 0, 0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 0, 0, 0, 0, 1, 1, 0, 1, 0, 1, 0, 1, 1, 0, 1, 1, 1, 0, 0, 1, 0, 0, 0, 1, 1, 0, 1, 0, 0, 0, 1, 0, 1, 1, 0, 1, 0, 1, 1, 0, 1, 1, 1, 1, 0, 0, 1, 0, 0, 1], [1, 0, 1, 1, 1, 0, 0, 1, 0, 0, 0, 0, 1, 1, 1, 1, 0, 0, 1, 0, 0, 0, 1, 0, 1, 1, 1, 0, 0, 1, 0, 0, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1, 0, 0, 0, 1, 0, 1, 1, 0, 1], [0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 1, 1, 1, 1, 1, 0, 0, 1, 0, 1, 1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0, 1, 0, 1, 1, 1, 0, 1, 1, 0, 1, 0, 1, 0, 1, 1, 1, 1, 1, 1, 0, 0, 1], [1, 1, 1, 1, 0, 1, 0, 0, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 1, 0, 1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 1, 0, 1, 0, 1, 1, 1, 1, 0, 0, 0, 0, 0, 1, 0, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 1, 0, 1], [1, 0, 1, 1, 0, 1, 1, 0, 1, 0, 0, 0, 0, 1, 0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 0, 1, 0, 0, 0, 1, 1, 1, 1, 0, 1, 0, 0, 0, 1, 0, 1, 0, 1, 1, 0, 1, 0, 1, 1, 0, 0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 0, 1, 1, 0], [1, 1, 0, 1, 0, 0, 1, 0, 1, 1, 1, 1, 1, 1, 1, 0, 0, 1, 0, 1, 1, 0, 1, 0, 1, 0, 1, 1, 0, 1, 0, 1, 1, 1, 0, 0, 0, 0, 0, 0, 1, 0, 0, 1, 0, 1, 1, 1, 1, 0, 1, 0, 1, 1, 1, 1, 0, 0, 1, 0, 0, 0, 0, 1], [0, 1, 0, 0, 0, 0, 0, 1, 0, 0, 0, 1, 1, 0, 0, 1, 1, 1, 1, 1, 0, 1, 1, 0, 1, 0, 1, 1, 1, 1, 1, 1, 0, 0, 1, 1, 0, 0, 0, 0, 1, 0, 0, 1, 1, 0, 1, 0, 0, 1, 0, 0, 0, 1, 0, 0, 1, 1, 0, 1, 1, 1, 1, 1], [1, 0, 0, 0, 0, 0, 1, 1, 1, 0, 1, 0, 0, 0, 0, 1, 1, 0, 1, 0, 0, 0, 0, 0, 1, 1, 0, 0, 0, 0, 1, 1, 0, 1, 0, 0, 1, 1, 0, 0, 1, 1, 0, 0, 1, 0, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 1, 1], [1, 0, 1, 1, 0, 1, 0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 1, 0, 1, 1, 0, 0, 1, 0, 1, 1, 1, 0, 1, 1, 1, 1, 1, 0, 1, 1, 1, 0, 0, 1, 0, 1, 1, 1, 1, 0, 0, 0, 0, 1, 0, 1, 1, 0, 0, 0, 0, 0, 0, 1, 0, 1, 1, 0], [1, 1, 1, 0, 1, 0, 0, 1, 0, 1, 0, 0, 0, 1, 0, 1, 0, 0, 1, 0, 0, 1, 0, 0, 0, 0, 0, 0, 1, 1, 0, 1, 1, 0, 0, 0, 0, 1, 1, 0, 1, 1, 0, 0, 0, 0, 1, 1, 0, 1, 1, 0, 0, 1, 0, 1, 1, 1, 0, 0, 1, 1, 0, 0], [0, 0, 0, 1, 0, 0, 1, 0, 1, 0, 0, 0, 0, 0, 0, 0, 1, 1, 0, 1, 0, 0, 1, 0, 1, 0, 1, 0, 1, 1, 1, 1, 0, 1, 1, 1, 1, 0, 1, 0, 0, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 0, 0, 0, 1, 0, 1, 1, 0, 0, 0, 1, 1, 0], [0, 0, 1, 1, 0, 1, 1, 0, 0, 0, 1, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 1, 1, 1, 1, 0, 0, 1, 0, 0, 1, 1, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1, 1, 1, 0, 1], [1, 0, 0, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1, 0, 0, 1, 0, 0, 0, 1, 1, 1, 0, 0, 1, 1, 0, 1, 0, 1, 1, 1, 1, 0, 1, 1, 1, 1, 0, 0, 1, 0, 0, 0, 1, 1, 0, 1, 0, 1, 0, 0, 0, 0, 1, 0, 1, 1, 1, 1, 1, 0, 0, 0], [0, 1, 1, 0, 1, 0, 1, 0, 1, 1, 0, 1, 0, 1, 0, 0, 1, 1, 0, 1, 1, 0, 1, 1, 0, 0, 1, 1, 1, 0, 1, 0, 0, 0, 0, 0, 0, 1, 1, 1, 0, 1, 1, 1, 0, 0, 0, 1, 0, 1, 1, 1, 1, 0, 0, 0, 1, 1, 1, 1, 0, 0, 0, 1], [0, 1, 0, 0, 1, 1, 0, 0, 1, 0, 0, 1, 0, 0, 1, 1, 1, 0, 0, 0, 1, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 0, 1, 0, 1, 0, 1, 0, 1, 0, 0, 0, 0, 1, 0, 1, 1, 1, 0, 0, 0, 0, 0, 0, 1, 1, 1, 0, 0, 0, 1, 1, 1, 1], [1, 1, 1, 0, 1, 0, 0, 0, 0, 1, 1, 1, 1, 1, 0, 0, 0, 1, 1, 1, 1, 1, 0, 1, 1, 1, 0, 1, 1, 0, 1, 0, 1, 0, 0, 0, 0, 1, 1, 1, 0, 0, 1, 1, 1, 1, 0, 1, 1, 0, 1, 1, 0, 1, 1, 1, 0, 1, 0, 1, 1, 1, 1, 0], [0, 1, 1, 1, 1, 0, 0, 0, 0, 1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 1, 0, 0, 1, 1, 1, 1, 0, 0, 1, 1, 1, 1, 0, 1, 0, 0, 0, 0, 0, 0, 0, 1, 1, 0, 0, 0, 1, 0, 0, 1, 0, 1, 1, 0, 1, 0, 1], [0, 0, 0, 0, 0, 1, 0, 0, 1, 0, 1, 1, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1, 0, 0, 1, 1, 1, 1, 1, 1, 0, 0, 1, 1, 1, 0, 0, 1, 1, 0, 1, 0, 0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 0, 1, 1, 1, 0, 0, 0, 1, 1], [1, 1, 0, 1, 0, 0, 1, 1, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 1, 0, 0, 1, 1, 1, 1, 0, 0, 1, 1, 0, 0, 1, 1, 0, 0, 0, 0, 0, 0, 0, 1, 0, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1, 0, 0, 0, 0, 1, 1, 0, 1, 0, 1, 1, 0], [1, 0, 0, 0, 1, 0, 1, 0, 0, 0, 1, 1, 1, 0, 1, 0, 0, 1, 0, 1, 0, 1, 0, 0, 0, 0, 1, 0, 0, 1, 0, 0, 1, 0, 1, 1, 1, 0, 0, 1, 1, 0, 1, 1, 0, 1, 1, 0, 1, 1, 1, 1, 0, 0, 0, 0, 0, 1, 1, 0, 1, 1, 1, 0], [0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 0, 0, 1, 0, 1, 1, 1, 0, 1, 0, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1, 1, 0, 0, 0, 0, 1, 0, 1], [0, 0, 1, 0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 1, 0, 0, 1, 0, 1, 1, 0, 0, 0, 1, 1, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 0, 0, 0, 1, 1, 1, 1, 1, 1, 0, 0, 1, 0, 0, 0, 1, 0, 1, 1, 0, 1, 0, 0, 1, 1, 0, 1, 1, 1], [1, 0, 0, 1, 0, 1, 0, 1, 1, 1, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 1, 1, 1, 0, 1, 1, 0, 0, 1, 1, 0, 1, 0, 0, 0, 1, 0, 1, 1, 1, 0, 1, 0, 0, 0, 1, 1, 1, 1, 0, 1, 0, 1, 0, 0, 1, 0, 0, 1, 1, 0, 0], [1, 0, 0, 1, 1, 0, 0, 1, 1, 0, 0, 0, 0, 1, 0, 1, 1, 1, 1, 0, 1, 0, 1, 1, 1, 1, 0, 1, 0, 1, 0, 0, 0, 1, 0, 1, 0, 1, 0, 0, 0, 1, 0, 1, 1, 1, 0, 0, 1, 1, 0, 0, 1, 1, 1, 0, 1, 0, 1, 1, 1, 1, 1, 0], [0, 1, 0, 0, 1, 1, 1, 0, 0, 1, 0, 0, 1, 1, 1, 1, 1, 0, 0, 1, 0, 1, 0, 1, 0, 0, 0, 1, 0, 0, 0, 1, 1, 0, 1, 1, 1, 0, 0, 1, 1, 1, 0, 1, 1, 0, 1, 0, 1, 1, 1, 1, 0, 0, 0, 1, 1, 1, 1, 1, 0, 0, 0, 1], [0, 0, 1, 1, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 1, 1, 0, 0, 0, 1, 0, 1, 0, 0, 0, 1, 0, 0, 1, 1, 0, 0, 1, 1, 0, 1, 1, 0, 1, 1, 0, 0, 0, 1, 1, 0, 1, 1, 1, 1, 1, 0, 1, 0, 0, 1, 0, 1, 1, 1, 1, 0, 1, 1], [1, 1, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 1, 1, 1, 1, 0, 0, 0, 1, 0, 1, 1, 1, 1, 1, 1, 0, 1, 1, 0, 1, 0, 1, 0, 1, 1, 1, 1, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 0, 0, 0, 0, 1, 0, 1, 1, 1, 0, 1, 0, 0, 0], [0, 1, 1, 0, 0, 1, 1, 1, 0, 1, 0, 1, 0, 0, 0, 1, 0, 1, 0, 0, 0, 0, 1, 0, 1, 1, 0, 1, 1, 1, 0, 0, 0, 1, 0, 1, 1, 1, 1, 0, 0, 1, 0, 0, 1, 1, 1, 0, 1, 1, 1, 0, 0, 0, 0, 0, 0, 1, 0, 1, 0, 1, 0, 0], [0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 0, 0, 1, 1, 0, 1, 1, 1, 0, 0, 1, 0, 1, 1, 1, 1, 0, 0, 0, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 1, 0, 0, 0, 0, 0, 0, 0, 1, 0, 0], [1, 0, 0, 0, 1, 0, 0, 1, 1, 1, 0, 0, 1, 1, 1, 0, 1, 0, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 0, 1, 1, 0, 1, 1, 0, 1, 0, 1, 0, 0, 0, 1, 1, 0, 1, 1, 1, 0, 1, 0, 1, 0, 1, 0], [0, 1, 1, 0, 1, 0, 0, 1, 0, 0, 0, 1, 0, 0, 1, 1, 0, 1, 0, 0, 0, 0, 1, 0, 0, 0, 1, 1, 0, 1, 1, 1, 0, 0, 1, 1, 0, 0, 0, 1, 0, 1, 0, 1, 0, 1, 1, 1, 0, 1, 1, 0, 0, 1, 0, 0, 0, 0, 0, 0, 1, 0, 1, 0], [1, 1, 1, 0, 1, 0, 0, 1, 0, 1, 0, 0, 1, 0, 0, 0, 1, 1, 0, 1, 0, 0, 0, 0, 1, 1, 0, 0, 0, 0, 0, 1, 0, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 0, 1, 0, 1, 0, 0, 0, 0, 1, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1], [1, 0, 0, 0, 1, 0, 1, 0, 1, 1, 1, 1, 1, 1, 0, 1, 0, 0, 1, 1, 0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 1, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 1, 1, 1, 0, 1, 1, 0, 0, 0, 0, 1, 1, 0, 1, 0, 0, 1, 0, 1, 1, 0, 0, 0], [1, 1, 0, 1, 0, 0, 0, 0, 1, 1, 0, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 1, 0, 1, 0, 0, 0, 1, 0, 0, 0, 1, 1, 1, 0, 1, 1, 0, 0, 0, 0, 1, 0, 1, 0, 0, 1, 0, 1, 0, 1, 0, 0, 0, 1, 1, 0, 1, 0, 0, 1, 0, 0], [1, 1, 1, 0, 0, 1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 0, 0, 1, 1, 0, 0, 0, 1, 1, 1, 1, 1, 0, 0, 0, 1, 1, 1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 0, 1, 1, 0, 0, 1, 1, 1, 0, 0, 0, 1, 1, 0, 1, 0, 0, 1], [1, 1, 0, 1, 0, 0, 0, 0, 0, 1, 0, 0, 1, 1, 0, 0, 0, 0, 1, 0, 1, 1, 1, 0, 0, 0, 0, 1, 0, 0, 1, 0, 0, 1, 0, 0, 1, 0, 1, 1, 0, 0, 0, 0, 0, 1, 1, 1, 0, 1, 0, 0, 0, 0, 0, 1, 0, 1, 0, 0, 1, 0, 0, 1], [0, 0, 1, 0, 1, 0, 0, 1, 0, 1, 1, 0, 0, 0, 0, 1, 1, 0, 1, 0, 0, 0, 1, 0, 0, 0, 1, 1, 1, 0, 0, 1, 0, 0, 0, 0, 1, 1, 1, 1, 1, 1, 0, 1, 0, 0, 0, 1, 1, 0, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 1, 0, 1, 1], [1, 1, 1, 0, 0, 0, 0, 0, 1, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 1, 0, 0, 1, 1, 1, 1, 0, 1, 0, 1, 1, 0, 0, 1, 0, 1, 0, 1, 0, 0, 1, 1, 1, 0, 1, 1, 0, 0, 0, 0, 0, 0, 1, 1, 1, 0, 0, 0, 1], [0, 0, 1, 0, 1, 1, 0, 0, 0, 1, 1, 1, 0, 0, 0, 0, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 1, 0, 1, 1, 1, 1, 1, 1, 0, 0, 1, 0, 1, 0, 1, 0, 0, 1, 1, 1, 1, 0, 1, 1, 0, 1, 0, 0, 0, 0, 0, 1, 1, 1, 0, 1, 1, 0], [1, 1, 0, 0, 0, 1, 0, 0, 0, 1, 1, 0, 1, 1, 1, 1, 0, 1, 1, 1, 1, 0, 1, 1, 0, 0, 1, 0, 1, 0, 0, 1, 0, 0, 1, 1, 1, 0, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 0, 1, 1, 1, 0, 0, 0, 1, 0, 1, 1, 1, 1, 1, 0, 1], [0, 0, 1, 0, 1, 0, 1, 0, 0, 1, 1, 1, 0, 1, 0, 1, 1, 1, 0, 0, 0, 0, 0, 0, 1, 0, 1, 1, 0, 0, 0, 0, 1, 1, 0, 0, 1, 0, 0, 1, 0, 1, 0, 0, 0, 1, 0, 0, 1, 1, 0, 0, 0, 1, 0, 1, 0, 0, 0, 0, 1, 0, 0, 0], [1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 0, 0, 1, 0, 1, 1, 0, 1, 1, 0, 0, 0, 0, 1, 0, 0, 1, 1, 1, 1, 0, 1, 1, 0, 0, 1, 0, 0, 1, 1, 1, 0, 1, 0, 0, 0, 0, 1, 0, 1, 1, 0, 1, 1, 0, 1], [0, 0, 1, 1, 1, 0, 0, 0, 1, 0, 1, 1, 0, 0, 1, 1, 1, 1, 0, 0, 1, 0, 0, 0, 0, 1, 1, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1, 1, 0, 0, 1, 0, 0, 0, 0, 0, 0, 1, 0, 0, 1, 1, 0, 1, 1, 1, 0, 0, 1, 1, 0, 1, 1, 1], [1, 1, 1, 0, 1, 0, 0, 0, 0, 1, 0, 1, 1, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 1, 1, 0, 0, 1, 1, 0, 0, 1, 0, 0, 1, 1, 1, 0, 1, 0, 1, 0, 1, 1, 1, 1, 0, 1, 1, 1, 1, 0, 1, 0, 1, 1, 1, 0, 1, 0, 1, 0, 1, 0], [0, 1, 1, 1, 1, 1, 0, 0, 0, 1, 0, 1, 1, 1, 0, 0, 0, 1, 1, 1, 1, 1, 1, 1, 0, 0, 1, 1, 0, 0, 0, 0, 1, 1, 0, 0, 1, 0, 1, 1, 0, 0, 1, 1, 1, 1, 1, 0, 1, 0, 0, 1, 0, 1, 1, 0, 1, 0, 0, 0, 1, 0, 0, 0], [1, 1, 1, 0, 0, 0, 1, 0, 1, 0, 1, 1, 0, 0, 0, 0, 0, 0, 1, 0, 0, 1, 1, 0, 0, 1, 0, 0, 0, 1, 1, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 1, 0, 1, 1, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0, 0, 1, 0, 1, 1, 0], [1, 1, 1, 0, 1, 1, 0, 1, 1, 0, 1, 0, 1, 1, 0, 1, 1, 1, 1, 0, 1, 1, 1, 1, 0, 1, 0, 0, 1, 1, 0, 0, 1, 1, 0, 0, 0, 1, 1, 0, 1, 0, 1, 0, 1, 1, 0, 1, 1, 1, 0, 0, 1, 1, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1], [0, 1, 0, 0, 0, 1, 1, 1, 1, 0, 0, 0, 1, 0, 1, 1, 1, 1, 1, 1, 0, 0, 1, 1, 0, 1, 1, 1, 0, 1, 1, 0, 1, 0, 0, 1, 1, 1, 1, 1, 0, 0, 0, 0, 1, 0, 0, 1, 0, 0, 1, 0, 1, 1, 0, 0, 0, 1, 1, 1, 1, 1, 0, 1], [1, 1, 1, 0, 0, 1, 1, 0, 1, 1, 0, 0, 1, 1, 1, 1, 1, 1, 1, 0, 0, 1, 0, 0, 0, 1, 1, 0, 0, 1, 1, 0, 0, 1, 0, 0, 0, 0, 0, 1, 1, 1, 0, 1, 1, 1, 1, 1, 0, 1, 0, 0, 0, 1, 0, 0, 1, 1, 1, 0, 0, 1, 1, 1], [1, 0, 1, 1, 1, 0, 1, 1, 0, 0, 0, 0, 1, 0, 0, 1, 1, 0, 0, 0, 1, 0, 0, 1, 1, 0, 1, 1, 1, 1, 0, 1, 1, 0, 1, 0, 0, 1, 0, 1, 0, 0, 1, 1, 0, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 1, 1, 0, 0], [1, 1, 0, 1, 1, 1, 0, 0, 0, 1, 1, 0, 1, 0, 1, 0, 0, 1, 1, 1, 1, 1, 1, 0, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 0, 1, 0, 0, 1, 1, 1, 0, 1, 1, 1, 0, 0, 1, 0, 1, 1, 1, 0, 1, 0, 0, 0, 1, 0, 0, 0, 1, 1, 0], [1, 0, 0, 0, 1, 1, 0, 0, 0, 0, 0, 0, 1, 0, 1, 1, 1, 0, 1, 0, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1, 0, 1, 1, 1, 0, 0, 0, 0, 1, 1, 1, 0, 0, 1, 1, 1, 0, 0, 1, 1, 0, 0, 0, 1, 1, 1, 0], [0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 1, 0, 0, 0, 0, 1, 0, 1, 1, 1, 0, 1, 0, 1, 1, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 1, 0, 0, 0, 1, 0, 0, 1, 1, 0, 0, 0, 1, 1, 0, 1, 0, 1, 1, 1, 0, 1, 1, 0, 1, 1, 0, 1, 0], [1, 0, 0, 1, 1, 1, 1, 1, 1, 0, 1, 0, 1, 0, 1, 0, 1, 0, 0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 0, 0, 1, 0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 0, 0, 0, 1, 0, 1, 0, 1, 0, 0, 0, 0, 1, 1, 1, 0, 0, 0, 0, 1], [1, 0, 0, 1, 1, 0, 0, 0, 0, 1, 0, 1, 0, 0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 1, 0, 0, 0, 0, 1, 0, 1, 1, 0, 0, 0, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 1, 0, 0, 1], [1, 0, 0, 1, 0, 0, 1, 1, 1, 1, 0, 1, 1, 0, 0, 1, 1, 0, 0, 0, 0, 0, 1, 1, 1, 0, 1, 1, 1, 0, 1, 0, 0, 0, 1, 0, 1, 0, 1, 1, 0, 0, 0, 0, 0, 1, 1, 1, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0, 0, 1, 1, 1, 0], [1, 0, 1, 0, 1, 0, 0, 0, 1, 0, 0, 0, 1, 0, 1, 1, 1, 1, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 0, 1, 0, 0, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 1, 0, 1, 1, 0, 0, 1, 1, 1, 1, 0, 0, 0, 1, 1, 1, 0, 0, 0], [0, 0, 1, 1, 0, 1, 0, 1, 0, 1, 1, 0, 0, 1, 0, 1, 0, 1, 0, 1, 0, 0, 0, 0, 1, 1, 1, 0, 1, 0, 0, 0, 1, 0, 1, 0, 1, 1, 0, 1, 1, 0, 0, 1, 0, 1, 1, 1, 1, 1, 0, 0, 1, 0, 0, 0, 1, 0, 0, 0, 1, 0, 1, 1], [0, 0, 0, 1, 1, 1, 1, 0, 0, 1, 1, 1, 0, 0, 1, 0, 1, 1, 0, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 0, 1, 0, 1, 1, 1, 1, 1, 0, 0, 0, 0, 1, 0, 1, 0, 1, 0, 1, 0, 1, 0, 0, 1, 0, 1, 1, 0, 1, 0, 1, 1, 1, 1, 1], [1, 1, 0, 0, 0, 1, 1, 0, 1, 1, 1, 1, 0, 0, 0, 0, 0, 1, 1, 0, 0, 1, 0, 1, 1, 1, 1, 1, 0, 1, 0, 1, 1, 1, 1, 0, 1, 1, 0, 1, 1, 0, 1, 1, 0, 1, 0, 1, 0, 1, 0, 0, 1, 0, 1, 1, 1, 1, 0, 1, 1, 0, 0, 0], [1, 1, 0, 1, 0, 0, 1, 0, 0, 0, 1, 1, 0, 0, 1, 0, 0, 0, 0, 1, 0, 1, 0, 1, 0, 1, 0, 0, 1, 0, 1, 1, 1, 1, 0, 1, 1, 0, 1, 0, 1, 1, 0, 1, 0, 0, 1, 0, 1, 0, 1, 0, 0, 0, 1, 0, 0, 0, 1, 0, 0, 1, 1, 1], [1, 0, 1, 0, 1, 1, 0, 0, 1, 1, 0, 0, 1, 1, 1, 1, 0, 0, 1, 1, 1, 1, 1, 0, 0, 0, 0, 1, 0, 1, 1, 0, 0, 0, 0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 0, 0, 1, 0, 0, 0, 0, 0, 1, 0, 1, 1, 0, 0, 0, 0, 1, 0, 0], [0, 0, 0, 1, 0, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 0, 0, 1, 0, 1, 0, 0, 1, 1, 1, 1, 1, 0, 0, 1, 0, 0, 1, 1, 0, 0, 0, 1, 1, 1, 0, 0, 1, 1, 1, 1, 0, 0, 1, 0, 0, 0, 0, 1, 1, 1], [0, 0, 0, 1, 1, 1, 1, 0, 1, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 0, 1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 0, 0, 1, 1, 0, 0, 0, 0, 1, 0, 1, 0, 1, 0, 1, 0, 0, 0, 1, 1, 0, 1, 0, 1, 0], [0, 0, 1, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 0, 1, 1, 1, 1, 1, 0, 1, 0, 0, 1, 1, 0, 1, 1, 0, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 1, 0, 0, 0, 0, 1, 0, 0, 0, 1, 0, 1, 0, 0, 0, 1, 0, 1], [0, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 0, 1, 0, 0, 0, 0, 0, 1, 0, 1, 0, 0, 0, 1, 1, 0, 1, 0, 1, 1, 1, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 0, 0, 1, 1, 0, 1, 0, 0, 0, 0], [1, 0, 0, 0, 1, 1, 0, 1, 1, 0, 1, 0, 1, 0, 0, 1, 1, 1, 1, 0, 1, 0, 1, 1, 0, 1, 1, 1, 0, 0, 0, 0, 0, 1, 0, 1, 1, 1, 0, 1, 0, 1, 0, 0, 1, 1, 1, 0, 0, 1, 1, 0, 0, 0, 0, 0, 1, 0, 0, 0, 1, 0, 0, 1], [1, 1, 0, 1, 1, 1, 1, 0, 0, 1, 1, 1, 1, 0, 1, 1, 0, 1, 1, 0, 0, 1, 0, 0, 1, 1, 1, 0, 0, 0, 0, 1, 0, 0, 0, 1, 1, 1, 0, 1, 0, 0, 1, 1, 0, 0, 1, 0, 1, 1, 0, 0, 0, 1, 0, 0, 0, 0, 1, 1, 1, 1, 0, 0], [0, 0, 0, 0, 1, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 1, 0, 0, 1, 1, 1, 0, 1, 0, 0, 0, 0, 1, 0, 1, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 1, 1, 0, 0, 0, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 0], [1, 1, 1, 1, 0, 1, 1, 0, 0, 0, 1, 0, 1, 0, 0, 0, 1, 0, 1, 1, 0, 1, 1, 0, 0, 1, 1, 0, 1, 0, 1, 1, 1, 1, 0, 0, 0, 1, 0, 1, 0, 1, 1, 0, 0, 0, 1, 1, 1, 0, 0, 0, 0, 0, 1, 1, 0, 1, 0, 1, 0, 1, 1, 1], [0, 1, 0, 1, 0, 1, 1, 0, 0, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 0, 1, 0, 1, 0, 0, 1, 1, 1, 0, 1, 0, 1, 1, 1, 0, 0, 1, 1, 0, 0, 1, 1, 0, 1, 1, 1, 0, 0, 1, 1, 1, 0, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1, 1, 0], [0, 0, 1, 1, 1, 0, 0, 0, 1, 1, 1, 1, 1, 0, 1, 0, 1, 0, 1, 0, 0, 1, 0, 0, 0, 0, 0, 0, 1, 1, 0, 1, 0, 0, 1, 1, 1, 1, 0, 0, 0, 1, 1, 0, 1, 0, 0, 0, 0, 1, 1, 0, 0, 1, 0, 1, 1, 0, 0, 0, 1, 0, 0, 1], [0, 1, 0, 0, 1, 0, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1, 1, 0, 0, 1, 1, 1, 1, 0, 1, 0, 0, 0, 0, 0, 0, 1, 1, 0, 1, 0, 0, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1], [0, 0, 0, 1, 1, 1, 0, 1, 1, 1, 1, 0, 1, 1, 0, 1, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 1, 0, 1, 1, 1, 0, 1, 0, 1, 0, 1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1, 0, 0], [1, 0, 0, 1, 0, 1, 1, 0, 1, 1, 1, 1, 0, 0, 0, 1, 1, 0, 1, 0, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 1, 0, 1, 0, 0, 0, 0, 1, 1, 1, 1, 0, 0, 0, 0, 1, 0, 1, 0, 1, 0, 1, 1, 1, 0, 0, 1, 0, 1, 0], [1, 1, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 0, 1, 1, 1, 1, 0, 1, 1, 0, 1, 1, 0, 1, 1, 1, 0, 0, 1, 1, 0, 1, 1, 0, 1, 0, 0, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 1, 0, 1, 0, 1, 0, 1, 0, 0, 1, 0], [0, 1, 1, 1, 0, 0, 1, 1, 0, 1, 1, 1, 0, 0, 0, 1, 0, 0, 0, 1, 1, 0, 0, 1, 1, 1, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 1, 1, 0, 1, 0, 1, 0, 1, 0, 1, 0, 1, 1, 1, 1, 1, 1, 1], [1, 0, 1, 1, 0, 0, 0, 1, 0, 0, 1, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 1, 0, 0, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 0, 0, 0, 0, 1, 0, 1, 0, 1, 0, 1, 0, 0, 1, 0, 1, 1, 1, 1, 1], [1, 1, 1, 0, 1, 0, 0, 1, 1, 0, 0, 1, 0, 1, 1, 0, 1, 1, 0, 0, 1, 0, 0, 1, 0, 1, 0, 0, 0, 1, 1, 0, 1, 1, 0, 1, 0, 1, 0, 1, 0, 1, 0, 1, 1, 1, 1, 0, 1, 1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 1, 0, 0], [1, 1, 1, 0, 1, 0, 0, 1, 1, 0, 0, 0, 1, 1, 1, 0, 1, 1, 0, 1, 0, 0, 0, 1, 1, 1, 0, 0, 0, 1, 1, 1, 0, 1, 1, 0, 1, 1, 0, 0, 1, 0, 1, 1, 0, 1, 0, 0, 0, 1, 1, 1, 1, 1, 1, 0, 1, 1, 0, 0, 0, 0, 1, 1], [0, 1, 0, 0, 1, 1, 0, 1, 0, 1, 0, 1, 1, 0, 1, 1, 1, 0, 1, 0, 0, 0, 1, 0, 1, 0, 0, 0, 0, 0, 1, 1, 1, 1, 1, 0, 0, 1, 1, 1, 1, 1, 1, 0, 0, 1, 1, 1, 1, 1, 0, 0, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 0, 1], [1, 0, 0, 1, 0, 0, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 0, 1, 1, 1, 0, 1, 0, 1, 0, 1, 0, 1, 0, 1, 1, 1, 0, 0, 0, 1, 1, 0, 0, 0, 1, 1, 1, 0, 0, 1, 1, 1, 1, 0, 1, 0, 0], [0, 1, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0, 0, 1, 0, 1, 1, 1, 1, 1, 0, 0, 1, 0, 0, 0, 0, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 0, 1, 1, 0, 1, 1, 1, 1, 0, 1, 1, 0, 1, 1], [0, 0, 1, 0, 0, 0, 0, 0, 1, 0, 0, 1, 1, 0, 0, 1, 1, 0, 1, 0, 0, 0, 0, 1, 1, 1, 0, 0, 1, 1, 0, 0, 1, 0, 1, 1, 1, 0, 0, 0, 0, 1, 1, 0, 0, 1, 1, 0, 0, 1, 0, 1, 0, 1, 1, 0, 1, 1, 0, 1, 0, 0, 1, 1], [0, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 1, 0, 0, 1, 1, 1, 1, 0, 1, 0, 1, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 1, 0, 1, 0, 0, 0, 0, 0, 1, 1, 0, 0, 1, 0, 0, 0, 0, 1, 0, 1, 1, 1, 1, 1, 0, 0, 0, 1, 1, 0, 1, 1], [1, 0, 1, 0, 1, 1, 1, 1, 0, 0, 0, 0, 0, 1, 1, 1, 1, 0, 0, 0, 0, 1, 0, 1, 0, 0, 1, 0, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1, 1, 0, 0, 0, 0, 0, 0, 1, 1, 0, 1, 1, 1, 0, 0, 1, 0, 0, 1, 1, 1, 1, 1, 0], [0, 0, 0, 0, 1, 1, 1, 0, 1, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 1, 1, 1, 0, 1, 1, 0, 0, 0, 0, 1, 1, 1, 0, 1, 0, 0, 0, 0, 0, 1, 1, 0, 0, 0, 1, 1, 0, 1, 0, 0, 0, 1, 1, 1, 1, 1, 1, 1, 0, 0, 1, 1, 1, 1], [0, 1, 1, 0, 0, 0, 1, 0, 0, 1, 1, 1, 1, 0, 0, 1, 1, 0, 1, 1, 0, 0, 0, 1, 1, 0, 1, 1, 1, 0, 1, 0, 1, 0, 0, 1, 0, 1, 1, 0, 0, 0, 1, 1, 1, 1, 0, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 0, 1, 0, 1, 1, 1, 1], [1, 0, 0, 1, 1, 1, 1, 0, 0, 1, 1, 1, 0, 1, 0, 0, 1, 1, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 1, 1, 0, 1, 0, 0, 1, 1, 1, 0, 1, 0, 1, 0, 1, 0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 1, 1, 1, 1, 1, 0, 1], [1, 1, 0, 1, 0, 1, 0, 1, 0, 0, 0, 0, 1, 0, 1, 1, 1, 0, 1, 1, 0, 1, 1, 0, 0, 1, 1, 1, 1, 0, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1, 0, 1, 0, 1, 1, 0, 1, 0, 1, 1, 1, 0, 1, 1, 0, 1, 0, 1, 0, 1, 0, 0, 0, 0], [0, 1, 0, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 1, 0, 0, 1, 0, 1, 0, 0, 1, 0, 1, 1, 1, 1, 0, 1, 1, 0, 0, 1, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 1, 0, 1, 1, 1, 1, 1, 0, 1, 0, 1, 1, 1, 0, 1], [0, 0, 1, 0, 1, 0, 0, 0, 1, 0, 1, 1, 1, 0, 0, 0, 0, 0, 1, 1, 1, 0, 0, 0, 1, 1, 0, 1, 0, 0, 0, 0, 1, 0, 0, 1, 1, 0, 1, 0, 1, 0, 1, 0, 1, 1, 0, 0, 0, 0, 1, 1, 1, 0, 0, 1, 0, 0, 1, 1, 0, 1, 0, 0], [0, 1, 1, 1, 0, 0, 0, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 1, 0, 0, 1, 1, 0, 1, 1, 0, 1, 0, 1, 1, 0, 1, 0, 0, 1, 0, 1, 0, 1, 0, 0, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1, 0, 1, 1, 1, 0, 0, 1], [0, 1, 1, 1, 0, 0, 1, 1, 0, 1, 0, 0, 0, 1, 0, 0, 0, 1, 0, 0, 0, 1, 0, 1, 1, 0, 0, 0, 1, 1, 1, 0, 0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1, 1, 1, 0, 0, 0, 1, 1, 1, 1, 1, 0, 0, 0, 1, 0, 1, 1, 0, 1], [0, 0, 1, 1, 1, 0, 0, 1, 0, 1, 0, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 1, 0, 1, 0, 0, 0, 1, 1, 1, 1, 1, 0, 1, 1, 1, 0, 0, 0, 0, 1, 0, 1, 0, 1, 0, 0, 0, 0, 1, 0, 0, 1, 0, 1, 1, 0, 0, 1, 0, 0, 1, 1, 1], [0, 1, 1, 0, 1, 0, 0, 1, 1, 0, 1, 1, 0, 0, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 0, 1, 1, 1, 1, 1, 0, 0, 1, 0, 0, 1, 1, 0, 0, 0, 1, 0, 0, 1, 1, 1, 1, 0, 0, 1, 0, 1, 1, 0, 0, 1, 1, 1, 0, 0, 1, 0, 0, 1], [0, 1, 1, 0, 1, 0, 1, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 1, 1, 0, 0, 1, 1, 0, 1, 0, 0, 0, 1, 1, 1, 0, 0, 0, 0, 1, 0, 0, 1, 1, 1, 1, 1, 0, 1, 1, 1, 0, 0, 0, 1, 0, 0, 0, 1, 0, 0, 1, 0, 1, 1, 0, 0, 0], [0, 0, 1, 0, 1, 0, 0, 1, 0, 0, 1, 1, 0, 0, 1, 1, 0, 1, 1, 0, 0, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 0, 0, 1, 0, 0, 1, 1, 1, 1, 1, 0, 0, 0, 0, 1, 1, 1, 1, 1, 0, 0, 0, 1, 1, 1, 1, 0, 0, 0, 0, 1, 0, 0], [0, 1, 0, 1, 1, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 0, 1, 0, 0, 0, 1, 0, 1, 1, 0, 0, 0, 0, 1, 0, 0, 0, 1, 0, 1, 1, 1, 1, 1, 0, 1, 0, 1, 1, 0, 0, 0, 1, 0, 1, 0, 1, 1, 1, 0, 1, 1, 0, 1, 0, 0, 0], [1, 1, 1, 1, 1, 0, 1, 0, 1, 0, 1, 0, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 1, 0, 1, 0, 1, 0, 0, 0, 0, 1, 1, 0, 1, 0, 0, 0, 0, 0, 1, 1, 0, 1, 1, 0, 0, 0, 0, 0, 0, 1, 1, 0, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1], [0, 1, 1, 1, 1, 0, 1, 0, 1, 0, 1, 0, 0, 0, 1, 1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 1, 0, 0, 1, 0, 1, 1, 1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 1, 0, 0, 1, 1, 1, 1, 0, 1, 0, 1, 1, 1, 1, 0, 1, 1, 0, 0, 0], [1, 0, 0, 1, 1, 1, 1, 0, 0, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 0, 1, 1, 0, 1, 1, 1, 1, 0, 0, 1, 0, 0, 0, 1, 0, 1, 0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 0, 1, 0, 0, 0, 0], [1, 0, 0, 1, 1, 0, 0, 0, 0, 1, 0, 1, 0, 1, 0, 0, 0, 0, 0, 0, 1, 1, 1, 0, 1, 0, 0, 1, 1, 1, 1, 0, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 1, 0, 1, 0, 0, 0, 1, 0, 0, 1, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0], [0, 0, 1, 0, 1, 0, 1, 0, 1, 0, 1, 1, 1, 1, 1, 1, 0, 1, 0, 0, 0, 0, 1, 1, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 0, 0, 1, 1, 0, 0, 0, 0, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 1, 0, 1, 1, 0, 1, 1, 1], [0, 1, 1, 0, 1, 1, 1, 1, 0, 0, 0, 0, 1, 1, 1, 0, 0, 0, 1, 1, 1, 1, 1, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 1, 1, 0, 0, 0, 0, 0, 1, 0, 0, 0, 1, 0, 0, 1, 0, 0, 0, 0, 1, 0, 1, 1, 0, 1, 1, 1, 0, 0, 1, 1], [1, 0, 0, 0, 1, 1, 1, 0, 1, 0, 1, 1, 0, 1, 0, 0, 0, 0, 1, 0, 1, 1, 0, 0, 1, 1, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 1, 1, 0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 0, 1, 1, 1, 1, 1, 0, 1, 0, 1, 0, 0, 0, 1, 1, 0], [0, 0, 1, 1, 1, 0, 1, 0, 1, 0, 1, 0, 0, 0, 0, 1, 1, 0, 1, 1, 1, 1, 0, 0, 0, 1, 0, 0, 1, 1, 0, 0, 1, 1, 0, 1, 1, 0, 0, 1, 1, 1, 0, 0, 0, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 1, 0, 1, 1], [1, 0, 0, 0, 1, 1, 0, 0, 0, 0, 1, 0, 0, 1, 0, 0, 1, 0, 1, 1, 1, 0, 1, 0, 1, 0, 0, 1, 0, 0, 1, 0, 1, 0, 0, 0, 0, 0, 1, 1, 1, 1, 0, 0, 1, 0, 0, 0, 1, 1, 1, 0, 1, 0, 1, 0, 0, 1, 1, 0, 1, 1, 0, 0], [1, 0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 1, 0, 1, 0, 0, 0, 1, 0, 0, 1, 1, 1, 0, 0, 1, 0, 1, 0, 1, 1, 0, 1, 0, 1, 0, 1, 1, 0, 1, 0, 0, 0, 1, 1, 1, 1, 0, 1, 1, 0, 0], [1, 0, 0, 0, 0, 1, 1, 0, 0, 1, 0, 0, 0, 1, 0, 0, 0, 0, 1, 1, 0, 1, 1, 0, 1, 1, 1, 1, 0, 0, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 1, 1, 1, 0, 0, 1, 0, 0, 0, 1, 0, 0, 0, 1, 1, 1, 0, 1, 1, 0, 1, 1, 0, 1], [0, 0, 0, 0, 1, 0, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 1, 0, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 1, 1, 0, 0, 0, 0, 0, 1, 0, 0, 0, 1, 0, 0, 1, 0, 1, 1, 1, 0, 0, 0, 1, 0, 0, 1, 1, 1, 0, 1], [0, 0, 0, 1, 1, 1, 1, 0, 0, 0, 1, 0, 1, 0, 1, 0, 0, 0, 0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1, 1, 1, 0, 0, 0, 1, 0, 0, 1, 1, 1, 1, 1, 1, 0, 0, 1, 0, 1, 0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 0, 0, 0], [0, 1, 1, 0, 1, 1, 1, 0, 1, 0, 1, 0, 0, 1, 1, 1, 0, 1, 0, 0, 1, 1, 0, 0, 1, 1, 0, 0, 1, 0, 0, 1, 0, 1, 1, 0, 0, 0, 1, 1, 1, 1, 0, 1, 1, 0, 1, 0, 0, 0, 1, 1, 1, 1, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1], [1, 0, 1, 1, 1, 0, 0, 1, 1, 1, 1, 0, 0, 1, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0, 0, 1, 0, 1, 0, 1, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 1, 0, 1, 0, 1, 0, 1, 0], [1, 0, 1, 1, 0, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 0, 0, 1, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 0, 1, 1, 0, 0, 0, 1, 1, 1, 0, 1, 1], [1, 0, 0, 0, 0, 0, 1, 1, 0, 0, 0, 0, 1, 0, 0, 0, 1, 0, 0, 1, 0, 0, 1, 0, 0, 1, 1, 0, 0, 0, 1, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 1, 0, 0, 0, 0, 1, 1, 1, 1, 0, 0, 0, 1, 1, 1, 0, 1, 1, 0, 1, 0, 0, 0], [0, 1, 1, 0, 1, 0, 1, 0, 0, 0, 1, 1, 1, 1, 1, 1, 0, 1, 1, 0, 1, 1, 0, 1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 1, 1, 1, 0, 1, 1, 0, 0], [1, 1, 0, 1, 0, 0, 0, 0, 0, 1, 1, 1, 0, 1, 1, 0, 0, 1, 0, 0, 1, 0, 0, 1, 0, 0, 1, 1, 0, 1, 0, 0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 1, 1, 0, 0, 1, 0, 1, 1, 1, 1, 0, 0, 1, 1, 1, 0, 0, 1, 1, 0, 0, 1, 1], [0, 1, 1, 1, 0, 0, 1, 1, 0, 0, 0, 0, 1, 0, 1, 0, 1, 1, 0, 1, 1, 1, 0, 0, 1, 0, 0, 1, 0, 1, 0, 0, 0, 1, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 0, 1, 1, 0, 0, 1, 1, 0, 0, 0, 1, 0, 1, 0], [0, 1, 1, 1, 0, 1, 1, 1, 0, 1, 0, 1, 0, 1, 1, 1, 1, 0, 1, 1, 1, 1, 0, 1, 0, 1, 1, 0, 0, 1, 0, 0, 0, 0, 1, 1, 1, 0, 1, 1, 1, 0, 0, 1, 0, 1, 0, 1, 0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 1], [0, 0, 0, 0, 1, 0, 1, 1, 0, 0, 1, 1, 1, 0, 1, 1, 0, 0, 1, 0, 1, 0, 0, 1, 0, 0, 0, 1, 0, 0, 0, 1, 1, 0, 0, 1, 0, 0, 1, 0, 0, 1, 0, 0, 1, 1, 0, 1, 1, 0, 0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 1, 0, 0, 1], [0, 1, 0, 0, 1, 1, 0, 0, 0, 1, 0, 1, 0, 1, 1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 0, 1, 0, 0, 1, 0, 0, 1, 0, 0, 1, 1, 1, 1, 1, 0, 1, 1, 1, 0, 0, 1, 1, 0, 0, 1, 0, 1, 1, 1, 1, 1, 0, 1, 1, 1], [0, 1, 0, 0, 1, 1, 1, 1, 0, 1, 0, 1, 0, 1, 1, 1, 1, 0, 0, 0, 1, 1, 1, 0, 0, 0, 0, 1, 1, 0, 1, 1, 1, 0, 0, 1, 0, 1, 1, 0, 0, 1, 0, 1, 1, 0, 0, 1, 1, 1, 0, 0, 1, 1, 1, 1, 1, 1, 0, 1, 0, 1, 0, 1], [1, 1, 1, 1, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1, 0, 1, 0, 1, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0, 1, 0, 1, 1, 1, 0, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1, 1, 0, 0, 0, 0], [1, 1, 0, 1, 1, 0, 0, 1, 0, 0, 0, 0, 1, 1, 0, 1, 1, 0, 0, 0, 1, 0, 0, 1, 1, 0, 1, 1, 0, 0, 0, 0, 0, 1, 1, 1, 0, 0, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 1, 0, 1, 1, 1, 0, 1, 1, 0, 1], [0, 1, 0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 0, 0, 1, 0, 1, 0, 1, 1, 0, 1, 0, 0, 1, 1, 1, 1, 0, 1, 1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0, 1, 0, 1, 0, 1, 0, 1, 1, 1, 0, 1, 1, 0], [0, 0, 0, 0, 0, 1, 0, 0, 0, 1, 0, 0, 0, 0, 0, 1, 1, 0, 0, 1, 0, 0, 1, 1, 1, 0, 0, 0, 0, 0, 1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 0, 0, 1, 1, 1, 1, 1, 0, 0, 1, 0, 1, 1, 1, 0, 0, 1, 0, 1, 0], [0, 0, 1, 0, 0, 1, 1, 1, 1, 0, 1, 1, 0, 1, 1, 0, 1, 0, 1, 0, 0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 1, 0, 0, 0, 0, 0, 1, 0, 1, 0, 1, 1, 1, 0, 1, 1, 0, 1, 0, 0, 0, 0, 1, 0, 1, 1, 0, 0, 0, 1, 1, 1, 0, 0], [1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 1, 0, 1, 0, 1, 0, 1, 1, 1, 1, 1, 0, 0, 1, 1, 0, 1, 0, 1, 1, 0, 0, 0, 0, 0, 1, 0, 1, 0, 1, 0, 0, 1, 1, 1, 1, 1, 0, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 0, 1, 0, 0, 0], [1, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 1, 0, 1, 0, 1, 0, 1, 0, 1, 0, 1, 1, 0, 1, 0, 0, 0, 0, 1, 1, 0, 1, 0, 1, 0, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 0, 1, 1, 0, 1, 1, 0, 0, 1, 0, 1], [1, 0, 0, 0, 0, 1, 1, 1, 1, 1, 1, 1, 0, 0, 1, 1, 0, 1, 1, 0, 0, 1, 1, 1, 0, 1, 0, 0, 0, 1, 1, 0, 1, 0, 0, 0, 1, 1, 1, 0, 0, 1, 1, 1, 0, 0, 1, 0, 1, 1, 1, 0, 0, 0, 1, 1, 0, 1, 1, 1, 0, 0, 1, 1], [0, 0, 1, 0, 1, 0, 0, 1, 1, 1, 0, 0, 1, 1, 0, 1, 1, 0, 1, 1, 1, 0, 1, 1, 0, 1, 0, 0, 0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 0, 1, 0, 0, 0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 1, 0, 1, 1, 0, 0, 1, 0, 0, 1, 1], [1, 0, 0, 1, 1, 0, 1, 1, 0, 0, 1, 0, 0, 1, 0, 1, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 0, 1, 1, 0, 1, 1, 0, 1, 0, 0, 0, 1, 1, 0, 1, 0, 0, 1, 0, 1, 0, 0, 0], [0, 1, 0, 0, 1, 0, 0, 0, 1, 1, 0, 1, 1, 0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 1, 0, 0, 1, 1, 0, 1, 0, 1, 1, 0, 0, 1, 1, 0, 0, 1, 1, 1, 1, 0, 0, 0, 0, 1, 0, 1, 0, 1, 0, 0, 0, 1, 0, 1, 0, 0, 0, 1, 1, 0], [1, 1, 0, 1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 0, 1, 0, 1, 1, 1, 0, 1, 0, 0, 1, 0, 1, 1, 0, 0, 0, 0, 0, 1, 1, 0, 1, 0, 1, 1, 0, 0, 0, 0, 1, 0, 0, 0, 1, 0, 1, 1, 1, 0, 1, 0, 0, 1, 1, 1, 1, 1, 0, 1, 0], [1, 0, 1, 1, 0, 1, 1, 1, 0, 1, 0, 0, 0, 0, 1, 0, 1, 0, 0, 0, 1, 1, 0, 1, 0, 1, 0, 1, 1, 0, 0, 1, 0, 0, 1, 1, 1, 0, 0, 1, 0, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 1, 0, 1, 0, 1, 1, 1, 1], [0, 1, 0, 0, 1, 1, 1, 0, 0, 1, 0, 0, 0, 0, 0, 1, 1, 0, 0, 0, 0, 0, 1, 1, 0, 0, 0, 1, 0, 1, 0, 1, 0, 0, 0, 0, 0, 0, 0, 1, 0, 1, 0, 1, 0, 1, 0, 0, 0, 1, 1, 0, 0, 1, 1, 1, 0, 0, 0, 1, 0, 1, 1, 0], [0, 1, 0, 1, 0, 0, 1, 1, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 0, 1, 0, 1, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 1, 0, 1, 0], [0, 0, 0, 0, 0, 1, 0, 0, 1, 0, 0, 1, 1, 1, 0, 1, 0, 1, 1, 1, 0, 0, 1, 0, 1, 1, 0, 1, 1, 0, 0, 1, 0, 1, 0, 1, 1, 0, 0, 1, 0, 1, 0, 1, 0, 0, 1, 1, 1, 1, 0, 1, 0, 0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 1], [1, 1, 1, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 0, 0, 1, 0, 0, 0, 1, 0, 0, 0, 0, 1, 1, 1, 1, 1, 1, 1, 0, 0, 1, 1, 0, 1, 1, 0, 0, 1, 0, 0, 0, 1, 1, 1, 0, 0, 0, 0, 1, 0, 0, 1], [0, 0, 0, 1, 1, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 1, 0, 0, 1, 1, 1, 1, 0, 0, 1, 1, 0, 1, 0, 0, 0, 1, 1, 1, 0, 0, 1, 0, 0, 0, 0, 0, 0, 1, 1, 1, 0, 1, 0, 1, 1, 1, 1, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1, 0], [0, 0, 1, 0, 1, 0, 0, 0, 0, 0, 1, 0, 0, 1, 0, 1, 0, 0, 0, 1, 1, 0, 0, 1, 0, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 1, 0, 1, 1, 1, 0, 1, 1, 0, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1, 0, 1, 0, 1, 0, 0, 1, 1], [1, 0, 0, 0, 1, 1, 0, 1, 0, 0, 0, 1, 1, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 1, 0, 1, 0, 1, 1, 1, 1, 1, 0, 0, 1, 0, 1, 0, 0, 0, 0, 0, 1, 0, 1, 1, 0, 1, 1, 0, 1, 0, 1], [1, 0, 0, 0, 1, 1, 1, 0, 1, 0, 0, 1, 0, 1, 0, 0, 1, 0, 0, 1, 0, 0, 1, 1, 1, 1, 1, 1, 1, 0, 0, 1, 1, 1, 1, 1, 0, 0, 0, 0, 1, 1, 1, 0, 0, 1, 1, 0, 1, 1, 1, 0, 0, 0, 0, 1, 0, 0, 1, 1, 0, 0, 1, 1], [1, 0, 1, 0, 1, 0, 1, 1, 1, 1, 0, 0, 1, 1, 0, 1, 0, 1, 1, 0, 1, 1, 0, 1, 0, 1, 1, 1, 0, 0, 0, 0, 1, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0, 1, 1, 1, 1, 1, 0, 0, 1, 0, 1, 0, 0, 0, 1, 1, 0, 1, 0, 0, 1], [0, 0, 1, 1, 0, 1, 1, 1, 0, 0, 0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 1, 0, 0, 1, 1, 1, 1, 0, 1, 1, 0, 0, 1, 1, 1, 0, 0, 0, 1, 0, 1, 0, 0, 1, 0, 1, 0, 0, 1, 1, 1, 0, 0, 0, 0, 0, 1, 1, 0, 0, 0, 1, 0, 1], [1, 0, 1, 0, 0, 0, 1, 0, 0, 1, 0, 1, 1, 1, 0, 0, 0, 0, 1, 0, 1, 1, 0, 1, 0, 1, 0, 1, 0, 0, 1, 0, 0, 0, 1, 0, 1, 1, 0, 0, 0, 1, 0, 0, 1, 1, 0, 0, 1, 1, 0, 1, 0, 1, 0, 0, 1, 0, 1, 0, 1, 0, 0, 0], [0, 1, 0, 1, 1, 0, 0, 0, 0, 0, 0, 0, 1, 0, 1, 1, 0, 1, 0, 1, 1, 1, 0, 1, 0, 1, 1, 1, 0, 0, 1, 1, 0, 0, 0, 1, 1, 1, 0, 1, 1, 0, 1, 0, 0, 0, 0, 1, 1, 0, 0, 0, 0, 0, 0, 1, 0, 1, 1, 0, 0, 1, 0, 1], [1, 0, 1, 1, 0, 0, 0, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 0, 0, 1, 0, 0, 1, 0, 1, 0, 0, 0, 0, 0, 0, 1, 0, 0, 1, 1, 1, 0, 0, 0, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1, 0, 0, 0, 0, 1, 0, 1, 0], [1, 0, 0, 1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 0, 1, 0, 0, 0, 0, 1, 1, 1, 1, 0, 0, 0, 0, 1, 0, 1, 1, 1, 0, 1, 0, 1, 0, 1, 0, 0, 1, 1, 0, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 0, 0, 0, 1, 0, 1, 1, 1, 0, 1, 0], [1, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 1, 0, 1, 0, 0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 0, 0, 1, 1, 0, 1, 0, 1, 1, 0, 0, 1, 1, 0, 1, 1, 0, 1, 0, 0, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 1, 0, 0, 0], [1, 0, 0, 0, 1, 1, 1, 1, 1, 1, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0, 0, 1, 1, 0, 0, 0, 1, 0, 0, 0, 1, 0, 1, 0, 1, 1, 1, 0, 1, 1, 0, 0, 1, 1, 0, 1, 1, 0, 0, 0, 1, 1, 1, 0, 0, 0, 1, 0, 1, 0, 1, 1, 0, 0], [1, 1, 1, 0, 1, 0, 0, 0, 1, 0, 1, 0, 1, 0, 0, 1, 0, 1, 0, 1, 1, 1, 0, 1, 1, 1, 1, 0, 0, 0, 0, 0, 1, 0, 1, 0, 0, 0, 0, 0, 1, 1, 0, 0, 0, 1, 1, 0, 1, 1, 0, 0, 0, 0, 1, 1, 0, 1, 0, 1, 1, 1, 1, 0], [1, 0, 1, 0, 0, 1, 0, 1, 1, 1, 0, 0, 1, 1, 0, 1, 1, 1, 1, 0, 1, 1, 1, 0, 1, 0, 1, 0, 0, 1, 0, 0, 1, 1, 0, 0, 1, 0, 1, 0, 0, 0, 0, 1, 0, 1, 0, 0, 0, 0, 1, 0, 0, 1, 0, 1, 0, 0, 0, 0, 1, 1, 1, 1], [0, 0, 0, 1, 0, 1, 1, 1, 0, 0, 1, 1, 1, 0, 0, 1, 1, 1, 1, 1, 0, 0, 0, 1, 1, 0, 0, 0, 0, 1, 0, 0, 1, 0, 0, 1, 0, 1, 1, 0, 0, 1, 0, 0, 0, 0, 1, 0, 1, 1, 0, 1, 0, 1, 1, 0, 0, 1, 1, 0, 1, 0, 0, 0], [1, 0, 0, 0, 0, 1, 1, 1, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 1, 0, 0, 0, 1, 0, 0, 1, 0, 0, 0, 0, 0, 0, 1, 1, 0, 1, 0, 1, 0, 1, 0, 0, 0, 1, 1, 1, 1, 1, 0, 0, 1, 0, 0, 1, 0, 0], [0, 1, 0, 1, 0, 1, 1, 0, 1, 0, 0, 0, 1, 1, 0, 0, 0, 1, 1, 1, 1, 1, 0, 0, 1, 0, 1, 1, 0, 1, 0, 1, 1, 0, 0, 1, 0, 1, 1, 0, 1, 0, 0, 1, 1, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 0, 0, 1, 0, 1, 0, 0, 1, 1], [1, 0, 1, 1, 0, 0, 1, 1, 1, 0, 1, 1, 0, 1, 1, 0, 1, 0, 1, 0, 1, 1, 0, 1, 1, 1, 1, 0, 1, 0, 1, 0, 1, 0, 0, 0, 1, 1, 1, 1, 0, 1, 1, 0, 0, 0, 0, 0, 1, 1, 0, 0, 1, 0, 1, 1, 1, 0, 1, 1, 0, 1, 1, 0], [1, 0, 1, 0, 1, 0, 0, 1, 0, 1, 0, 0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 1, 0, 1, 0, 1, 1, 0, 1, 0, 0, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 1, 1, 0, 1, 0, 1, 1, 1, 1, 0, 0, 0, 0, 0, 1, 0, 0, 1], [0, 1, 1, 1, 0, 0, 1, 1, 1, 1, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 1, 1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 1, 0, 0, 1, 1, 0, 0, 0, 0, 1, 0, 1, 1, 0, 1, 0], [0, 0, 0, 1, 0, 0, 0, 1, 1, 1, 0, 0, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 1, 1, 1, 1, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1, 0, 0, 1, 0, 1, 1, 1, 1, 0, 0], [0, 0, 1, 1, 0, 0, 0, 0, 1, 1, 1, 0, 0, 0, 1, 0, 0, 1, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 0, 0, 0, 1, 0, 0, 1, 1, 1, 0, 0, 1, 1, 0, 0, 1, 0, 1, 0, 0, 1, 0, 0, 1, 0, 1, 1, 1, 0, 1, 0, 1, 1, 0, 0], [1, 0, 1, 0, 1, 1, 0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 1, 1, 1, 0, 1, 0, 1, 1, 1, 0, 1, 0, 0, 0, 1, 0, 1, 1, 1, 0, 1, 1, 1, 1, 1, 0, 1, 1, 0], [0, 0, 0, 0, 0, 0, 0, 1, 1, 0, 0, 1, 1, 1, 1, 0, 0, 1, 0, 1, 1, 1, 1, 0, 1, 1, 0, 0, 0, 0, 1, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 0, 0, 1, 1, 0, 1, 0, 0, 1, 1, 1, 0, 1, 0, 0, 0, 1, 1, 0, 1, 0, 0, 0], [0, 0, 1, 0, 0, 0, 1, 0, 1, 1, 1, 0, 1, 0, 1, 0, 1, 0, 1, 0, 1, 1, 0, 1, 0, 0, 0, 0, 1, 1, 0, 1, 1, 0, 0, 1, 1, 1, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 1, 1, 0, 1, 0, 1, 1, 0, 1, 0, 0, 1, 0, 1, 0, 1], [0, 0, 0, 1, 0, 1, 0, 1, 0, 0, 0, 1, 1, 0, 0, 1, 1, 1, 0, 0, 0, 1, 0, 1, 0, 1, 0, 1, 0, 0, 1, 0, 1, 1, 0, 0, 1, 0, 1, 1, 1, 1, 1, 1, 0, 1, 0, 0, 0, 1, 0, 0, 1, 0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 1], [1, 0, 0, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 1, 1, 0, 1, 0, 0, 1, 1, 1, 0, 0, 0, 1, 1, 1, 0, 1, 0, 0, 1, 1, 1, 0, 1, 1, 1, 0, 0, 1, 0, 0, 0, 0, 0, 1, 1, 0, 1, 0, 1, 1, 1, 1, 1, 0, 0, 1, 0, 1, 1], [1, 1, 0, 0, 1, 1, 0, 1, 1, 0, 1, 0, 1, 1, 0, 0, 1, 1, 1, 0, 1, 0, 0, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 1, 0, 0, 1, 0, 1, 1, 0, 0, 1, 1, 0, 0, 0, 0, 1, 0, 1, 1, 0, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1], [1, 1, 0, 1, 1, 1, 1, 0, 0, 0, 0, 1, 0, 1, 1, 1, 0, 1, 1, 1, 0, 1, 0, 0, 0, 1, 0, 0, 0, 1, 1, 0, 0, 1, 0, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 1, 1, 0, 1, 0, 0, 0, 0, 0, 1, 1, 1, 1, 0, 0, 1, 1, 1], [1, 1, 1, 0, 1, 1, 0, 1, 0, 1, 0, 1, 1, 0, 0, 0, 1, 0, 0, 1, 1, 0, 0, 1, 0, 0, 1, 1, 1, 1, 0, 0, 1, 0, 0, 1, 0, 0, 0, 0, 0, 1, 0, 0, 0, 1, 0, 1, 0, 0, 0, 1, 1, 1, 1, 1, 0, 0, 0, 1, 1, 0, 1, 0], [0, 1, 1, 1, 0, 0, 0, 0, 1, 1, 0, 0, 1, 0, 0, 1, 1, 0, 1, 1, 0, 0, 1, 0, 1, 0, 1, 1, 0, 0, 1, 0, 0, 1, 0, 0, 0, 0, 0, 1, 0, 0, 0, 1, 0, 1, 1, 1, 0, 1, 1, 1, 0, 1, 0, 1, 0, 0, 1, 1, 1, 0, 1, 0], [1, 1, 1, 0, 1, 1, 0, 1, 0, 0, 0, 1, 1, 0, 1, 1, 1, 0, 0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 0, 0, 0, 0, 1, 1, 0, 0, 0, 1, 1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 1, 0, 1, 1, 0, 0, 1, 0, 0, 0, 0], [1, 0, 0, 0, 0, 1, 1, 0, 1, 1, 0, 1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 1, 0, 1, 1, 0, 0, 0, 0, 1, 0, 1, 0, 0, 1, 0, 1, 0, 0, 1, 1, 1, 1, 0, 0, 0, 1, 1, 1, 0, 0, 1, 1, 0, 1, 0, 1, 1, 1, 1], [0, 1, 0, 1, 1, 0, 1, 0, 1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 0, 1, 1, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 1, 1, 1, 0, 0, 1, 1, 1, 1, 1, 0, 0, 1, 1, 0, 0, 0, 0, 0, 1, 0, 1, 0, 1, 1, 1, 0, 1, 1, 0], [1, 1, 0, 1, 1, 0, 0, 1, 0, 1, 1, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 0, 0, 0, 1, 1, 1, 0, 0, 0, 1, 0, 1, 0, 1, 1, 0, 1, 0, 1, 1, 1, 0, 0, 0, 0, 1, 1, 1, 0, 1, 1, 0, 0, 0, 0, 1, 0, 1, 1, 0, 0, 0, 1], [0, 0, 1, 0, 1, 0, 0, 0, 0, 1, 0, 1, 0, 1, 0, 0, 1, 1, 1, 0, 1, 1, 0, 1, 0, 1, 0, 1, 1, 1, 0, 1, 1, 0, 0, 0, 0, 0, 0, 1, 0, 0, 1, 0, 0, 1, 1, 1, 1, 1, 0, 0, 1, 1, 1, 0, 1, 0, 0, 1, 1, 1, 0, 0], [1, 0, 0, 1, 0, 1, 0, 1, 1, 1, 1, 0, 0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 0, 1, 1, 0, 0, 1, 0, 0, 1, 1, 1, 0, 1, 0, 1, 0, 1, 0, 1, 1, 0, 1, 1, 1, 1, 0, 1, 0, 1, 0, 0, 1, 0, 0, 1, 1, 1, 0, 0, 0], [1, 1, 0, 1, 0, 0, 1, 0, 1, 0, 0, 0, 0, 1, 1, 0, 0, 0, 0, 0, 1, 1, 0, 0, 0, 1, 0, 0, 0, 1, 1, 0, 0, 1, 0, 0, 1, 0, 1, 1, 1, 0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 1, 0, 1, 0, 1, 0, 0, 0, 1, 0, 0, 0, 0], [0, 0, 1, 0, 0, 0, 0, 0, 1, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 1, 1, 1, 1, 0, 0, 0, 1, 1, 0, 1, 0, 1, 0, 1, 1, 0, 0, 1, 1, 0, 1, 0, 0, 0, 0, 0, 0, 0, 0, 1, 0, 1, 0], [1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 1, 1, 0, 1, 1, 0, 1, 1, 1, 1, 0, 1, 1, 0, 0, 1, 0, 0, 1, 1, 1, 1, 0, 1, 0], [0, 0, 1, 0, 0, 0, 1, 0, 1, 1, 1, 0, 1, 1, 1, 0, 0, 0, 1, 1, 1, 1, 0, 1, 0, 1, 0, 1, 1, 0, 1, 0, 1, 0, 0, 1, 0, 0, 0, 1, 1, 0, 1, 0, 0, 1, 0, 0, 0, 0, 0, 1, 1, 1, 0, 1, 1, 1, 0, 0, 0, 1, 1, 0], [0, 0, 0, 1, 1, 0, 0, 0, 0, 1, 0, 0, 1, 0, 1, 0, 0, 0, 0, 0, 1, 1, 1, 1, 0, 1, 0, 0, 1, 0, 0, 0, 0, 1, 1, 1, 0, 1, 0, 0, 0, 0, 0, 1, 1, 1, 1, 0, 1, 0, 0, 1, 0, 0, 0, 1, 0, 1, 0, 0, 0, 1, 0, 1], [1, 1, 1, 1, 0, 1, 1, 0, 1, 1, 0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 0, 0, 1, 0, 1, 0, 1, 1, 0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 0, 0, 0, 1, 0, 1, 0, 1, 0, 1, 1, 0, 0, 1, 0, 1], [1, 1, 0, 0, 1, 1, 0, 1, 1, 1, 1, 1, 0, 1, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 1, 1, 1, 1, 0, 0, 1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 0, 1, 0, 0, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 0, 1, 0, 1, 1, 1, 1, 0], [0, 1, 0, 0, 1, 0, 1, 1, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 1, 0, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1, 0, 1, 0, 1, 0, 0, 1, 1, 1, 1, 1, 1, 0, 0, 1, 1, 0, 1, 1, 1, 0, 1, 1, 0, 0, 0, 1, 1, 1, 1, 0], [0, 1, 1, 0, 0, 1, 0, 1, 1, 1, 0, 1, 0, 0, 1, 1, 0, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 0, 0, 0, 0, 1, 0, 1, 0, 0, 0, 1, 0, 0, 1, 1, 1, 1, 1, 0, 1, 0, 1, 1, 0, 1, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 0, 0], [1, 1, 0, 1, 1, 1, 1, 1, 0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 0, 0, 1, 0, 1, 1, 1, 1, 1, 1, 0, 0, 1, 1, 1, 1, 0, 1, 0, 0, 1, 0, 1, 0, 1, 1, 0, 1, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 0, 0, 1, 1, 0, 1, 1, 1], [1, 1, 0, 0, 1, 0, 1, 1, 1, 1, 1, 0, 1, 0, 1, 1, 1, 0, 0, 0, 0, 0, 0, 1, 0, 0, 1, 1, 0, 1, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 1, 0, 1, 1, 0, 0, 0, 0, 1, 1, 0, 1, 1, 1, 1, 1, 0, 1, 1, 0, 1, 1, 1, 0], [1, 0, 1, 1, 1, 1, 0, 0, 1, 0, 0, 0, 1, 1, 0, 0, 1, 1, 0, 0, 1, 0, 0, 1, 0, 1, 1, 1, 0, 0, 1, 0, 1, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 1, 0, 0, 1, 0, 0, 1, 1, 0, 1, 0, 0, 1, 0, 1, 0, 1, 0], [0, 1, 1, 0, 0, 1, 0, 1, 1, 1, 0, 0, 0, 0, 0, 0, 1, 0, 1, 0, 0, 1, 0, 1, 0, 0, 0, 0, 1, 1, 1, 0, 0, 1, 1, 0, 1, 1, 1, 1, 0, 1, 1, 0, 1, 1, 1, 0, 0, 1, 0, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 1, 0, 1], [0, 1, 1, 1, 1, 0, 1, 1, 1, 0, 1, 0, 1, 1, 0, 0, 1, 1, 0, 1, 1, 1, 1, 1, 0, 0, 0, 0, 1, 0, 0, 1, 1, 1, 1, 1, 1, 0, 1, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 1, 0, 1, 1, 1, 1, 1, 0, 0, 0, 0], [1, 1, 0, 1, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 1, 1, 1, 0, 0, 1, 1, 1, 0, 0, 1, 0, 1, 1, 1, 1, 0, 1, 0, 0, 0, 0, 0, 0, 1, 1, 1, 0, 0, 1, 1, 1, 0, 1, 1, 1, 1, 0, 0, 0, 0, 1, 0, 1, 1, 0, 1, 1, 1, 1], [0, 0, 0, 0, 0, 1, 1, 1, 0, 1, 0, 1, 1, 1, 1, 0, 0, 1, 0, 1, 0, 1, 1, 0, 1, 0, 1, 0, 1, 1, 0, 0, 1, 0, 1, 0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 1, 0, 1, 1, 1, 0, 1, 0, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 1], [0, 0, 1, 0, 0, 0, 0, 1, 0, 1, 0, 0, 0, 0, 0, 0, 0, 1, 1, 0, 0, 0, 1, 1, 0, 1, 1, 0, 0, 0, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 1, 0, 1, 0, 1, 1, 0, 0, 1, 1, 1, 0, 0, 1, 1, 0, 0, 0, 0, 0, 1, 1, 0, 1], [0, 0, 1, 0, 1, 0, 0, 0, 0, 1, 0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 0, 0, 0, 0, 0, 1, 0, 0, 1, 1, 0, 1, 1, 1, 1, 0, 1, 1, 0, 1, 1, 1, 0, 1, 0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 1, 1, 0, 1, 1], [1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 0, 1, 1, 1, 1, 0, 0, 1, 1, 1, 1, 0, 1, 0, 1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 1, 1, 1, 1, 0, 0, 0, 1, 0, 1, 1, 0, 1, 0, 1, 0, 0, 0, 0, 0, 1, 1, 0, 1, 1, 1], [0, 1, 0, 1, 1, 0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 0, 1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 1, 0, 1, 1, 1, 0, 0, 1, 0, 1, 0, 0, 0, 1, 0, 0, 0, 1, 0, 1, 1, 1, 1, 0, 0, 1, 0, 0, 0, 0, 0, 1, 1, 0, 1, 1, 1, 0], [0, 0, 0, 1, 1, 0, 0, 1, 1, 0, 0, 0, 0, 0, 1, 1, 0, 0, 1, 1, 1, 1, 0, 0, 1, 0, 1, 0, 1, 1, 1, 0, 0, 1, 1, 1, 1, 0, 1, 1, 0, 1, 0, 0, 0, 1, 0, 1, 1, 0, 1, 0, 1, 0, 0, 1, 1, 1, 1, 1, 1, 0, 1, 1], [0, 0, 1, 0, 1, 1, 0, 1, 0, 1, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 1, 1, 1, 0, 1, 1, 0, 0, 1, 1, 0, 1, 1, 0, 0, 0, 1, 0, 0, 1, 0, 0, 1, 0, 1, 1, 1, 0, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1, 0, 0, 1, 0, 1, 1], [1, 1, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 0, 0, 1, 1, 1, 0, 0, 1, 1, 0, 0, 0, 0, 0, 0, 1, 1, 0, 0, 1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 0, 0, 1, 0, 0, 0, 1], [0, 1, 1, 0, 0, 1, 1, 1, 1, 1, 0, 1, 0, 0, 1, 1, 0, 0, 0, 1, 0, 1, 0, 0, 0, 1, 0, 1, 0, 1, 1, 0, 0, 0, 0, 0, 0, 1, 0, 0, 1, 1, 0, 1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 1, 1, 0, 1, 0, 1, 1], [0, 1, 0, 0, 1, 0, 0, 1, 1, 0, 0, 1, 0, 0, 1, 1, 1, 0, 0, 0, 1, 0, 0, 0, 0, 1, 1, 0, 1, 0, 0, 0, 1, 0, 1, 0, 1, 0, 0, 1, 1, 1, 1, 1, 1, 0, 1, 0, 0, 1, 0, 1, 1, 0, 1, 1, 1, 0, 0, 1, 0, 0, 1, 0], [0, 1, 1, 1, 1, 0, 0, 1, 1, 0, 1, 1, 0, 0, 1, 0, 1, 1, 0, 1, 0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1, 0, 1, 1, 1, 1, 1, 0, 1, 1, 1, 0, 1, 0, 0, 0, 0, 1, 1, 0, 0, 1, 0, 0, 1, 0, 1, 1, 0, 0], [1, 0, 1, 0, 1, 0, 0, 1, 0, 0, 0, 0, 0, 1, 1, 1, 0, 1, 0, 0, 1, 1, 1, 1, 1, 0, 0, 1, 0, 1, 0, 0, 0, 0, 1, 1, 1, 1, 1, 1, 0, 0, 0, 1, 1, 0, 1, 1, 0, 0, 0, 0, 0, 1, 1, 1, 1, 1, 1, 0, 1, 0, 1, 1], [0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 1, 1, 0, 0, 0, 0, 0, 1, 1, 0, 0, 0, 0, 1, 0, 0, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 0, 1, 0, 1, 0, 0, 0, 1, 1, 0, 0, 0, 0, 0, 1, 1, 0, 1, 1], [0, 1, 0, 1, 0, 1, 1, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 0, 1, 0, 0, 1, 0, 1, 0, 1, 0, 1, 1, 0, 1, 1, 0, 1, 1, 0, 1, 0, 1, 0, 0, 0, 0, 1, 1, 1, 0, 1, 1, 0, 0, 0, 1, 1, 1, 1, 0, 0, 0, 1, 0, 1, 0, 0], [0, 0, 1, 0, 0, 0, 1, 0, 0, 1, 0, 1, 1, 1, 1, 0, 1, 1, 1, 1, 1, 0, 0, 0, 1, 0, 1, 1, 1, 0, 1, 0, 0, 1, 1, 1, 1, 1, 0, 1, 1, 0, 1, 1, 1, 1, 0, 1, 1, 0, 1, 0, 0, 0, 1, 1, 1, 1, 0, 0, 0, 0, 1, 0], [0, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 0, 1, 1, 0, 0, 1, 1, 0, 1, 1, 1, 1, 0, 1, 0, 1, 0, 1, 0, 0, 1, 0, 1, 0, 0, 0, 1, 1, 1, 0, 0, 1, 1, 0, 1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 1, 0, 0, 0, 0], [1, 1, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 1, 0, 1, 1, 0, 0, 0, 0, 0, 1, 0, 0, 1, 1, 0, 1, 0, 0, 1, 0, 0, 0, 0, 1, 1, 1, 1, 0, 1, 0, 0, 0, 0, 1, 1, 1, 0, 1, 0, 0, 1, 0, 1, 1, 1, 0, 0, 0], [1, 0, 0, 1, 1, 1, 0, 1, 1, 1, 1, 0, 1, 0, 0, 1, 1, 0, 0, 1, 0, 1, 0, 1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 1, 0, 0, 0, 0, 1, 1, 1, 0, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 0, 0, 1, 0, 0, 0, 1, 1, 1, 0, 1, 0], [0, 1, 0, 0, 1, 1, 0, 0, 1, 0, 0, 1, 0, 1, 1, 0, 1, 1, 1, 0, 0, 0, 1, 0, 1, 0, 1, 1, 1, 1, 0, 0, 0, 1, 1, 1, 1, 0, 0, 1, 0, 1, 1, 0, 0, 1, 0, 1, 0, 1, 1, 0, 0, 1, 1, 1, 0, 0, 0, 1, 1, 0, 0, 0], [1, 0, 0, 1, 1, 1, 1, 0, 1, 1, 0, 1, 0, 1, 0, 1, 0, 1, 0, 1, 0, 1, 0, 1, 0, 1, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 1, 1, 0, 0, 1, 0, 0, 0, 0, 0, 0, 1, 0, 1, 1, 1, 0, 1, 0, 1, 1, 1, 0, 0, 1, 0, 0, 0], [1, 0, 0, 1, 1, 0, 0, 1, 1, 1, 0, 0, 0, 0, 0, 0, 1, 1, 0, 0, 1, 1, 0, 1, 0, 1, 0, 1, 0, 1, 1, 1, 1, 0, 1, 0, 1, 0, 1, 1, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 0, 0, 1, 1, 1, 1, 0, 0, 1, 1, 1, 1, 1, 1], [1, 0, 0, 0, 1, 1, 0, 1, 0, 1, 1, 0, 1, 0, 0, 1, 0, 1, 0, 1, 1, 1, 1, 0, 1, 1, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0, 1, 1, 1, 1, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 0, 1, 0, 0], [0, 1, 0, 1, 0, 1, 0, 0, 1, 0, 0, 0, 0, 0, 1, 1, 0, 1, 1, 0, 1, 1, 0, 1, 1, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 1, 0, 1, 0, 0, 0, 0, 1, 1, 1, 1, 1, 0, 1, 1, 0, 0, 1, 0, 0, 0, 0, 0, 0, 1, 1], [0, 0, 1, 0, 1, 1, 0, 0, 1, 1, 1, 0, 1, 1, 0, 0, 0, 0, 0, 1, 0, 1, 0, 1, 1, 0, 0, 0, 0, 1, 0, 0, 1, 1, 1, 0, 1, 0, 1, 1, 0, 1, 1, 0, 0, 1, 1, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 1, 0, 1, 0, 0, 0, 0], [1, 1, 0, 0, 1, 1, 0, 0, 1, 0, 1, 0, 0, 0, 0, 0, 1, 1, 0, 1, 0, 1, 0, 1, 1, 1, 0, 0, 1, 1, 1, 0, 0, 0, 1, 0, 1, 1, 1, 0, 0, 1, 1, 0, 1, 0, 0, 0, 1, 1, 1, 1, 0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 0, 1], [0, 0, 1, 1, 1, 1, 1, 0, 1, 0, 1, 0, 0, 0, 0, 1, 1, 0, 1, 0, 1, 1, 0, 1, 1, 1, 0, 0, 0, 0, 1, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1, 0, 1, 0, 1, 1, 0, 1, 0, 1, 1, 1, 0, 0, 0], [0, 0, 1, 1, 0, 0, 0, 1, 1, 1, 1, 0, 1, 0, 1, 0, 1, 1, 0, 1, 1, 1, 0, 1, 0, 1, 1, 1, 1, 0, 0, 0, 0, 1, 1, 0, 0, 1, 0, 0, 0, 1, 1, 0, 0, 1, 1, 1, 0, 1, 1, 0, 1, 0, 1, 1, 1, 0, 0, 1, 0, 1, 1, 0], [0, 1, 1, 1, 0, 1, 0, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 0, 1, 0, 0, 1, 1, 1, 0, 0, 0, 1, 0, 1, 1, 1, 0, 1, 0, 0, 1, 0, 0, 0, 1, 0, 0, 0, 0, 0, 1, 1, 1, 1, 1, 1, 0, 0, 1, 0, 1, 0, 1, 1, 1, 1, 0, 0], [0, 1, 0, 1, 1, 1, 0, 1, 0, 0, 1, 0, 1, 1, 1, 0, 0, 1, 1, 0, 0, 1, 1, 0, 0, 0, 0, 0, 0, 0, 1, 0, 1, 1, 1, 0, 0, 0, 1, 0, 0, 1, 1, 0, 0, 1, 0, 1, 1, 1, 0, 1, 0, 1, 0, 1, 1, 0, 0, 1, 0, 0, 0, 0], [1, 0, 1, 0, 0, 0, 0, 1, 0, 0, 1, 1, 0, 1, 0, 0, 1, 0, 1, 0, 1, 1, 1, 0, 1, 0, 0, 1, 1, 0, 0, 1, 0, 0, 0, 1, 1, 0, 1, 1, 0, 1, 1, 1, 1, 0, 1, 1, 1, 0, 0, 0, 1, 0, 0, 0, 0, 1, 1, 1, 1, 0, 0, 1], [0, 1, 1, 1, 1, 0, 0, 1, 0, 0, 1, 0, 1, 1, 0, 0, 1, 1, 1, 1, 0, 0, 1, 0, 1, 1, 0, 0, 0, 0, 1, 0, 0, 1, 1, 0, 1, 1, 0, 0, 1, 1, 0, 1, 0, 1, 0, 0, 0, 1, 0, 1, 0, 1, 1, 0, 1, 0, 1, 1, 1, 1, 1, 0], [1, 1, 0, 1, 1, 1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 1, 1, 0, 0, 1, 1, 0, 0, 1, 1, 1, 0, 1, 1, 1, 1, 0, 1, 0, 0, 1, 0, 0, 0, 0, 0, 0, 1, 1, 0, 1, 1, 0, 0, 0, 0, 0, 1, 0, 0, 1, 1, 0, 0, 0, 1, 0, 0], [1, 1, 0, 1, 1, 1, 0, 1, 0, 1, 1, 0, 1, 0, 0, 0, 0, 1, 1, 1, 0, 1, 1, 0, 0, 0, 1, 1, 1, 0, 1, 0, 1, 1, 1, 0, 0, 1, 1, 0, 0, 1, 0, 1, 0, 1, 1, 0, 1, 0, 1, 0, 1, 1, 1, 1, 0, 1, 0, 0, 1, 1, 1, 0], [1, 1, 1, 1, 1, 0, 1, 0, 0, 1, 0, 0, 0, 1, 0, 1, 0, 0, 0, 1, 1, 1, 0, 0, 0, 1, 1, 0, 1, 0, 0, 0, 1, 1, 1, 0, 1, 1, 1, 0, 0, 1, 0, 0, 1, 1, 0, 0, 0, 0, 0, 1, 1, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 0], [1, 1, 0, 0, 1, 1, 1, 1, 1, 0, 0, 0, 0, 1, 0, 0, 1, 1, 0, 1, 1, 0, 1, 1, 1, 1, 0, 0, 1, 0, 1, 0, 1, 1, 0, 1, 0, 1, 1, 0, 1, 1, 0, 1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0], [1, 0, 1, 1, 0, 1, 0, 0, 0, 0, 1, 0, 1, 0, 0, 0, 0, 1, 1, 0, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 1, 0, 0, 1, 1, 1, 0, 1, 1, 1, 1, 0, 1, 0, 0, 0, 1, 1, 1, 1, 1, 0, 1, 0, 1, 0, 0, 1, 1, 0, 1, 1, 0, 1], [1, 0, 1, 1, 0, 0, 1, 1, 0, 1, 1, 0, 1, 1, 0, 0, 1, 1, 1, 0, 0, 0, 0, 0, 1, 1, 0, 1, 0, 1, 1, 1, 1, 0, 1, 0, 0, 1, 1, 1, 1, 0, 1, 0, 1, 0, 1, 0, 0, 1, 0, 1, 1, 1, 1, 0, 1, 0, 1, 1, 1, 0, 1, 0], [0, 1, 1, 1, 1, 1, 1, 0, 1, 0, 0, 0, 1, 1, 1, 1, 1, 0, 1, 1, 0, 0, 0, 0, 0, 0, 0, 1, 0, 1, 1, 1, 1, 1, 1, 0, 1, 1, 0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 1, 1, 0, 1, 1, 1, 0, 0], [0, 0, 1, 0, 0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 1, 0, 1, 1, 0, 1, 0, 0, 1, 0, 0, 0, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 0, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 1, 0, 0, 0, 1, 1, 1, 0, 0, 1, 0, 0, 0, 1], [0, 0, 0, 1, 1, 0, 1, 1, 1, 0, 0, 1, 0, 0, 1, 0, 0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 1, 0, 1, 1, 0, 0, 1, 1, 0, 0, 1, 1, 0, 1, 0, 0, 1, 0, 0, 0, 0, 1, 1, 1, 1, 1, 0, 0, 1, 0, 0, 1, 1, 0, 0, 0, 0, 0], [1, 0, 1, 0, 0, 1, 1, 0, 1, 1, 0, 0, 1, 0, 1, 0, 0, 1, 1, 1, 0, 0, 0, 1, 0, 1, 0, 1, 0, 0, 0, 1, 1, 1, 0, 1, 0, 1, 1, 1, 1, 0, 0, 0, 1, 1, 0, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 1, 0, 1, 1], [0, 0, 1, 1, 0, 0, 1, 1, 1, 1, 1, 1, 0, 1, 0, 1, 1, 0, 1, 1, 0, 0, 0, 1, 1, 0, 1, 1, 1, 0, 1, 1, 0, 0, 0, 1, 1, 0, 1, 0, 1, 0, 0, 0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 0, 0, 0, 0, 0, 0, 1, 0, 1], [0, 1, 0, 0, 0, 1, 0, 1, 1, 1, 0, 1, 0, 0, 0, 0, 0, 0, 1, 0, 1, 1, 1, 1, 0, 0, 0, 0, 0, 1, 0, 1, 0, 0, 0, 0, 1, 1, 1, 0, 1, 0, 1, 0, 0, 0, 0, 0, 1, 1, 1, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0, 1, 1], [0, 0, 1, 1, 1, 0, 1, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 1, 1, 0, 1, 0, 1, 1, 1, 1, 1, 0, 0, 1, 0, 1, 1, 1, 0, 1, 1, 0, 0, 0, 1, 1, 0, 1, 1, 0, 1, 0, 0, 0, 1, 1, 0, 1, 1, 0, 0, 1, 1, 1, 0, 1, 0], [1, 0, 0, 1, 0, 1, 0, 1, 0, 0, 1, 0, 1, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 1, 0, 0, 0, 0, 0, 1, 0, 0, 1, 1, 0, 1, 0, 1, 1, 0, 0, 0, 1, 1, 0, 1, 1, 1, 1, 1, 1, 0, 1, 0, 1, 0, 1, 0, 0, 1, 0, 0, 1, 1], [0, 1, 0, 0, 0, 0, 1, 1, 1, 0, 0, 0, 0, 1, 1, 1, 1, 0, 0, 1, 0, 1, 0, 1, 0, 0, 0, 0, 1, 1, 0, 0, 1, 1, 1, 0, 0, 1, 1, 0, 0, 1, 1, 0, 1, 1, 0, 0, 1, 1, 1, 0, 0, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 0], [0, 1, 1, 1, 0, 0, 1, 1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 0, 1, 1, 1, 0, 1, 0, 1, 0, 0, 0, 1, 0, 1, 1, 0, 1, 0, 1, 0, 1, 1, 1, 1, 1, 1, 0, 0, 1, 0, 0, 0, 0, 1, 1, 1, 0, 0, 1, 0, 1, 1, 0, 0, 1, 1, 1], [0, 1, 0, 1, 1, 1, 0, 1, 1, 1, 0, 0, 1, 1, 1, 0, 1, 0, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 1, 0, 1, 0, 0, 0, 1, 0, 0, 0, 0, 0, 1, 1, 1, 1, 0, 0, 0, 0, 1, 0, 1, 0, 1, 0, 0, 0, 0, 0, 1], [1, 0, 1, 1, 0, 1, 0, 1, 0, 1, 1, 0, 1, 1, 1, 0, 0, 1, 1, 0, 0, 1, 1, 1, 1, 0, 0, 0, 1, 1, 1, 1, 0, 1, 0, 0, 0, 1, 1, 1, 0, 1, 0, 1, 1, 1, 0, 0, 0, 1, 1, 1, 1, 1, 0, 1, 0, 0, 1, 1, 0, 1, 1, 0], [0, 0, 1, 0, 1, 1, 0, 1, 1, 1, 1, 0, 1, 1, 0, 0, 1, 1, 0, 1, 1, 1, 0, 0, 0, 0, 1, 0, 1, 1, 1, 1, 0, 1, 0, 0, 0, 0, 0, 0, 1, 0, 1, 1, 1, 0, 1, 0, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 1, 1], [0, 1, 0, 0, 1, 1, 0, 1, 0, 1, 0, 1, 1, 0, 0, 1, 0, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 0, 1, 1, 0, 0, 0, 0, 1, 0, 1, 0, 1, 1, 1, 1, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 1, 0, 0, 1, 1, 1, 0, 0, 1, 0, 1, 0], [0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 0, 1, 1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 1, 1, 1, 1, 0, 0, 1, 0, 0, 0, 1, 1, 0, 1, 1, 1, 0, 0, 0, 0, 1, 1, 1, 0, 1, 0, 1, 0, 0, 0, 1, 1, 1, 0, 0, 1, 0], [0, 1, 1, 1, 0, 1, 1, 0, 0, 1, 0, 1, 0, 1, 0, 0, 0, 0, 0, 1, 1, 0, 0, 1, 0, 0, 0, 1, 0, 0, 1, 1, 0, 0, 1, 1, 0, 1, 0, 1, 1, 1, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0, 1, 1, 1, 0, 1, 1, 1, 0, 0, 1, 1], [0, 1, 1, 1, 0, 1, 0, 1, 0, 1, 1, 0, 1, 1, 0, 1, 0, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 1, 1, 0, 1, 1, 0, 1, 1, 0, 0, 1, 1, 1, 1, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 1, 0, 0, 0, 1, 0, 1, 0, 1, 0, 1, 1, 1], [0, 0, 0, 1, 0, 1, 1, 0, 1, 1, 0, 0, 1, 0, 1, 0, 0, 0, 1, 0, 0, 0, 1, 0, 1, 0, 1, 0, 0, 1, 1, 0, 1, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 1, 0, 1, 1, 1, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0, 0], [1, 1, 0, 0, 0, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 1, 0, 1, 1, 0, 0, 0, 0, 1, 1, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 0, 1, 0, 0, 1, 0, 1, 0, 0, 0, 0, 0, 0, 0, 1], [0, 1, 0, 0, 1, 1, 1, 1, 1, 0, 0, 0, 0, 1, 0, 1, 1, 1, 1, 1, 1, 1, 0, 0, 1, 0, 0, 0, 0, 1, 1, 1, 1, 1, 0, 1, 0, 1, 1, 1, 1, 0, 0, 0, 1, 1, 0, 0, 0, 1, 1, 0, 1, 0, 1, 0, 0, 0, 1, 0, 1, 1, 0, 1], [0, 1, 1, 1, 0, 0, 1, 0, 0, 0, 1, 0, 1, 1, 0, 1, 1, 0, 1, 0, 0, 1, 1, 0, 0, 1, 0, 0, 1, 1, 0, 1, 1, 1, 1, 1, 1, 0, 0, 1, 0, 1, 1, 1, 1, 1, 1, 0, 1, 0, 1, 0, 1, 1, 1, 1, 1, 0, 0, 1, 1, 0, 0, 0], [0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1, 0, 1, 0, 1, 0, 0, 0, 1, 1, 0, 0, 1, 1, 1, 1, 0, 1, 1, 0, 0, 0, 0, 0, 1, 0, 1, 1, 0, 0, 1, 0, 0, 0, 1, 0, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 1, 1, 0, 1, 0, 0], [0, 1, 1, 1, 0, 0, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 1, 1, 1, 1, 1, 1, 0, 0, 0, 1, 0, 0, 1, 1, 1, 1, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1, 1, 1, 0, 1, 0, 1, 0, 0, 0, 0, 1, 1, 0, 0, 1, 0, 0, 0, 0, 1, 0, 1], [1, 1, 0, 1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 1, 0, 0, 1, 0, 0, 1, 1, 0, 1, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0, 1, 0, 1, 1, 0, 1, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 0, 1, 1, 1, 1, 0, 1, 1, 0, 1, 1, 1, 0, 1], [0, 0, 0, 0, 1, 1, 1, 0, 1, 0, 0, 1, 0, 1, 0, 1, 0, 1, 0, 0, 1, 0, 1, 1, 0, 1, 1, 1, 0, 0, 1, 0, 0, 1, 0, 1, 1, 0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 1, 0, 0, 1, 0, 0, 0, 0, 0, 1, 1, 1, 1], [0, 0, 1, 1, 0, 0, 1, 0, 0, 1, 0, 0, 1, 1, 1, 1, 1, 0, 1, 1, 0, 0, 0, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 1, 1, 1, 0, 1, 1, 0, 1, 1, 0, 0, 0, 0, 0, 1, 1, 0, 0, 1, 0, 0, 0, 0, 0, 0, 1, 1, 0, 0, 1], [0, 0, 1, 0, 0, 1, 1, 0, 1, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 0, 1, 1, 1, 1, 0, 0, 0, 1, 0, 1, 1, 1, 0, 0, 1, 0, 1, 0, 1, 1, 0, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 0, 0, 1, 0, 1, 0, 0], [0, 1, 0, 0, 0, 1, 0, 1, 1, 0, 0, 0, 1, 0, 0, 0, 1, 1, 0, 0, 0, 0, 0, 0, 1, 0, 1, 0, 1, 0, 1, 1, 0, 1, 1, 1, 0, 0, 1, 0, 1, 0, 0, 1, 1, 0, 1, 1, 0, 1, 0, 1, 0, 0, 0, 0, 0, 1, 1, 1, 1, 1, 0, 1], [0, 0, 0, 1, 0, 0, 0, 0, 1, 1, 0, 1, 1, 1, 1, 0, 0, 1, 0, 0, 0, 1, 1, 1, 0, 0, 1, 0, 1, 1, 0, 1, 0, 0, 1, 0, 1, 1, 0, 0, 0, 0, 0, 1, 0, 0, 1, 1, 0, 0, 0, 0, 0, 0, 1, 1, 0, 0, 0, 1, 1, 1, 1, 0], [1, 0, 0, 0, 0, 0, 1, 1, 1, 0, 0, 0, 0, 0, 0, 1, 0, 1, 0, 1, 1, 0, 1, 1, 1, 0, 0, 1, 0, 0, 1, 0, 1, 0, 0, 0, 1, 1, 0, 0, 1, 0, 0, 0, 0, 0, 0, 1, 1, 0, 0, 0, 0, 0, 0, 0, 1, 1, 0, 0, 0, 1, 0, 1], [0, 0, 0, 0, 1, 1, 0, 0, 0, 1, 1, 1, 1, 0, 1, 0, 0, 0, 1, 0, 0, 0, 0, 1, 1, 0, 0, 1, 1, 0, 1, 0, 1, 1, 1, 1, 1, 0, 1, 0, 0, 1, 0, 0, 0, 0, 1, 1, 0, 1, 0, 0, 0, 0, 1, 1, 1, 0, 0, 0, 1, 1, 1, 0], [0, 1, 1, 0, 0, 0, 0, 1, 0, 1, 1, 0, 0, 1, 1, 0, 1, 1, 1, 0, 0, 1, 0, 1, 1, 0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 1, 1, 0, 1, 0, 1, 1, 1, 0, 0, 0, 0, 0, 1, 0, 0, 1, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 0, 1], [1, 0, 0, 1, 0, 0, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 1, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0, 0, 1, 0, 1, 0, 0, 0, 1, 0, 0, 1, 1, 1, 0, 0, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 1, 0, 0, 1, 1, 1, 1], [1, 1, 0, 1, 1, 1, 1, 0, 1, 0, 0, 0, 0, 1, 1, 0, 0, 0, 1, 1, 0, 1, 0, 1, 1, 0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 1, 1, 1, 0, 1, 1, 0, 1, 0, 1, 0, 1, 1, 1, 0, 1, 0, 1, 0, 1, 1, 0, 1, 1, 0, 0], [1, 1, 1, 0, 1, 1, 0, 0, 0, 1, 0, 1, 0, 0, 1, 0, 1, 0, 0, 1, 0, 1, 1, 1, 1, 0, 1, 0, 1, 0, 1, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 1, 0, 0, 1, 0, 0, 1, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 1, 0, 1], [1, 1, 1, 1, 1, 0, 1, 0, 0, 0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 1, 1, 0, 1, 0, 1, 0, 1, 1, 1, 1, 0, 0, 1, 0, 0, 0, 0, 1, 0, 1, 1, 0, 0, 0, 0, 1, 0, 1, 1, 0, 1, 1, 1, 1, 0, 0, 1, 1, 0, 0, 0, 1, 0, 1], [1, 0, 0, 1, 1, 0, 1, 0, 1, 0, 1, 0, 0, 1, 1, 0, 1, 1, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1, 0, 1, 1, 0, 0, 1, 1, 1, 0, 0, 0, 1, 0, 1, 1, 0, 1, 0, 1, 1, 1, 1, 0, 1, 1, 1, 1, 1], [0, 0, 1, 0, 1, 0, 0, 1, 1, 1, 1, 1, 0, 1, 0, 0, 1, 0, 1, 0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 0, 1, 0, 0, 0, 0, 1, 1, 0, 1, 1, 1, 1, 0, 1, 1, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 0, 1], [0, 1, 1, 1, 0, 0, 0, 1, 0, 1, 1, 1, 0, 0, 0, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 1, 1, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 1, 1, 1, 1, 0, 0, 0, 1, 0, 1, 0, 1, 0, 0, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 0], [0, 0, 0, 0, 0, 0, 1, 1, 0, 0, 0, 1, 0, 1, 0, 1, 1, 0, 0, 1, 0, 0, 1, 1, 1, 1, 1, 1, 0, 0, 1, 1, 1, 0, 0, 1, 1, 1, 0, 0, 1, 1, 0, 0, 0, 0, 1, 1, 1, 0, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 1, 0, 1, 1], [1, 1, 0, 1, 1, 0, 0, 0, 1, 1, 1, 0, 1, 1, 0, 1, 0, 1, 1, 0, 0, 0, 1, 0, 0, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 1, 0, 1, 0, 0, 0, 0, 1, 0, 1, 0, 0, 1, 0], [1, 1, 1, 1, 0, 0, 0, 1, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 1, 1, 0, 0, 1, 1, 0, 0, 1, 1, 0, 1, 1, 1, 0, 0, 1, 1, 0, 0, 0, 0, 1, 0, 1, 1, 1, 1, 1, 0, 1, 1, 1, 0, 1, 0, 1, 0, 1, 0, 1, 1, 0, 0, 0, 0], [1, 0, 0, 0, 1, 0, 0, 0, 1, 0, 0, 0, 0, 0, 1, 0, 0, 0, 1, 0, 0, 1, 1, 1, 1, 0, 0, 1, 0, 0, 1, 1, 0, 1, 1, 1, 1, 0, 1, 0, 1, 0, 0, 0, 1, 1, 1, 0, 1, 1, 1, 0, 1, 1, 0, 0, 0, 0, 1, 0, 0, 0, 1, 0], [1, 1, 1, 0, 0, 1, 1, 1, 1, 0, 0, 1, 1, 0, 1, 1, 1, 0, 1, 0, 0, 0, 1, 1, 0, 0, 0, 1, 0, 0, 0, 1, 1, 1, 0, 1, 0, 1, 0, 0, 1, 1, 0, 1, 1, 0, 0, 0, 0, 0, 1, 0, 0, 0, 1, 0, 0, 0, 1, 1, 1, 0, 0, 1], [1, 1, 0, 1, 0, 0, 1, 1, 1, 1, 1, 1, 0, 0, 1, 0, 0, 0, 0, 1, 1, 0, 0, 1, 0, 0, 1, 0, 1, 1, 0, 1, 0, 1, 0, 0, 1, 0, 1, 0, 0, 0, 0, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 1, 0, 1, 1, 1, 0, 1, 1, 0, 0, 1], [1, 1, 1, 1, 0, 1, 0, 0, 0, 1, 1, 0, 1, 1, 0, 1, 1, 0, 1, 0, 0, 0, 1, 0, 1, 1, 0, 1, 0, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 0, 1, 1, 0, 1, 1, 0, 1, 0, 1, 0, 1, 0, 0, 0, 1, 1, 1, 0, 1, 1, 0, 1, 1], [1, 0, 1, 1, 0, 1, 1, 1, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 1, 0, 0, 1, 1, 1, 1, 0, 1, 1, 0, 0, 1, 0, 1, 1, 1, 1, 1, 0, 0, 0, 0, 1, 0, 1, 0, 1, 0, 1, 1, 0, 1, 1, 0, 0, 0, 0, 1, 1, 1, 0, 1, 1, 1], [0, 0, 0, 0, 1, 1, 0, 0, 1, 1, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0, 0, 1, 0, 1, 0, 1, 1, 0, 0, 0, 1, 1, 0, 1, 1, 0, 1, 0, 0, 0, 0, 1, 1, 1, 1, 0, 1, 0, 1, 1, 1, 0, 1, 1, 0, 0, 0, 1, 1, 0, 1], [0, 0, 0, 1, 0, 1, 1, 1, 1, 0, 0, 0, 0, 1, 1, 0, 1, 0, 0, 0, 0, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 0, 0, 0, 1, 1, 1, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 0, 1, 1, 0, 1, 0, 0, 0, 1, 0, 1, 1, 0, 1], [1, 1, 1, 1, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 1, 1, 0, 1, 1, 1, 1, 0, 0, 0, 1, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 1, 0, 0, 1, 1, 0, 1, 1, 1, 1, 0, 0, 0, 1, 0, 1, 0, 1, 1, 1, 0, 1, 0, 0], [1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 1, 0, 1, 0, 1, 1, 1, 0, 0, 1, 1, 0, 1, 1, 1, 0, 0, 0, 1, 1, 1, 1, 0, 1, 0, 1, 1, 0, 0, 0, 1, 1, 0, 1, 1, 1, 1, 0, 0, 1, 1, 0, 0, 1, 1, 1, 1, 0, 0, 0], [0, 0, 0, 1, 1, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 1, 1, 1, 0, 1, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 1, 0, 1, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 0, 1, 1, 0, 1, 0, 0, 0, 1, 1, 0, 0, 1, 1, 1, 0, 1, 0, 1], [1, 0, 1, 0, 0, 0, 0, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 1, 0, 1, 1, 0, 1, 1, 1, 0, 1, 0, 0, 0, 0, 1, 0, 0, 1, 1, 1, 0, 0, 0, 1, 1, 1, 1, 1], [0, 1, 0, 0, 1, 1, 0, 1, 0, 0, 0, 0, 0, 1, 0, 0, 0, 1, 1, 0, 1, 1, 0, 1, 0, 1, 0, 1, 1, 1, 0, 0, 0, 1, 1, 1, 0, 0, 0, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 1, 0, 1, 1, 0, 0, 0, 0, 1, 1, 0, 0, 1, 0, 0], [0, 1, 1, 0, 1, 1, 0, 0, 1, 1, 0, 1, 0, 1, 1, 1, 0, 1, 1, 0, 1, 1, 0, 0, 1, 0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1, 0, 1, 0, 0, 0, 0, 1, 1, 1, 0, 1, 0, 1, 0, 1, 1, 0, 1, 0, 0, 1, 0], [0, 0, 0, 1, 0, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1, 0, 0, 0, 1, 0, 1, 1, 1, 0, 0, 0, 0, 0, 0, 1, 0, 0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 0, 1, 1, 0, 1, 1, 1, 0, 1, 0, 0, 1, 1, 1, 1, 0, 1, 1, 1, 0, 0, 1, 0], [1, 1, 1, 1, 0, 1, 0, 0, 1, 0, 1, 1, 0, 0, 1, 0, 1, 0, 0, 1, 1, 1, 1, 0, 1, 1, 1, 0, 0, 1, 1, 1, 0, 1, 1, 1, 0, 0, 0, 1, 0, 0, 1, 1, 0, 1, 0, 1, 1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 1, 0, 0, 1, 0, 1], [1, 0, 0, 1, 1, 0, 0, 1, 1, 0, 1, 1, 1, 1, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0, 1, 1, 1, 1, 1, 0, 0, 0, 1, 1, 1, 1, 0, 0, 0, 1, 0, 1, 1, 0, 1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 1, 0, 1, 1, 1, 1, 1, 0], [0, 0, 0, 0, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 0, 1, 1, 0, 1, 0, 1, 0, 1, 1, 0, 0, 1, 1, 0, 1, 0, 1, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 0, 0, 0, 1, 0, 1, 0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 0, 1, 1, 1, 1, 0], [0, 1, 1, 1, 1, 1, 0, 1, 1, 1, 0, 1, 0, 0, 1, 0, 0, 0, 1, 1, 0, 1, 1, 1, 0, 1, 0, 1, 1, 0, 1, 1, 0, 1, 1, 1, 0, 0, 1, 1, 1, 0, 1, 1, 1, 1, 1, 0, 0, 0, 1, 0, 0, 1, 0, 0, 1, 1, 1, 0, 0, 0, 1, 1], [1, 1, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 1, 1, 1, 0, 1, 1, 0, 1, 1, 0, 1, 1, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1, 0, 0, 0, 1, 0, 1, 0, 0, 0, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 0, 1], [0, 1, 1, 0, 1, 0, 1, 1, 1, 0, 0, 0, 1, 1, 1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 1, 0, 1, 0, 1, 0, 1, 1, 1, 1, 1, 0, 0, 0, 0, 1, 1, 1, 0, 1, 0, 1, 1, 0, 1, 0, 1, 0, 0, 1, 0, 0, 0, 0, 1, 1, 0, 1], [0, 1, 0, 1, 0, 0, 1, 1, 0, 1, 1, 1, 0, 0, 1, 0, 1, 1, 1, 0, 1, 1, 1, 0, 0, 0, 0, 0, 1, 0, 0, 0, 1, 0, 1, 0, 0, 0, 0, 1, 1, 1, 0, 1, 0, 1, 0, 0, 0, 1, 1, 1, 0, 0, 0, 0, 1, 1, 0, 0, 0, 1, 0, 0], [1, 1, 1, 1, 0, 1, 0, 0, 0, 0, 1, 0, 0, 1, 0, 1, 1, 0, 0, 1, 1, 1, 0, 1, 0, 0, 0, 1, 0, 1, 1, 0, 0, 0, 1, 0, 0, 1, 1, 1, 0, 0, 1, 0, 0, 1, 1, 1, 0, 0, 1, 0, 1, 1, 1, 1, 0, 1, 0, 1, 0, 1, 0, 0], [1, 1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 1, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 1, 0, 1, 1, 1, 1, 1, 0, 0, 1, 1, 1, 0, 1, 0, 1, 1, 0, 0, 1, 1, 1, 1, 1, 1, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 0, 0, 1, 1, 0, 0, 1], [1, 1, 1, 1, 0, 0, 0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 0, 0, 1, 1, 1, 0, 0, 0, 0, 1, 1, 1, 0, 0, 1, 0, 1, 0, 1, 0, 0, 0, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1], [1, 0, 0, 1, 0, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 0, 1, 0, 1, 1, 1, 0, 0, 1, 1, 1, 0, 0, 1, 0, 1, 0, 0, 1, 1, 1, 1, 0, 1, 1, 0, 1, 0, 1, 0, 0, 0, 1, 1, 1, 0, 0, 0, 1, 0, 1, 1, 0, 1, 0, 0], [0, 0, 0, 1, 1, 0, 1, 0, 1, 1, 0, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1, 1, 0, 0, 0, 1, 1, 0, 0, 0, 0, 1, 1, 0, 0, 0, 1, 1, 0, 1, 1, 0, 0, 1, 0, 0, 1, 1, 0, 1, 0, 0, 1, 1, 0, 0, 0, 0, 0, 0, 1, 1, 1, 1], [0, 0, 0, 0, 1, 1, 0, 0, 1, 0, 1, 0, 1, 1, 0, 1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 0, 0, 1, 1, 1, 1, 0, 1, 1, 1, 1, 0, 0, 0, 1, 0, 1, 1, 1, 0, 0, 0], [1, 0, 0, 0, 0, 1, 0, 0, 1, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 0, 0, 1, 0, 0, 1, 1, 1, 0, 1, 0, 0, 1, 1, 1, 0, 0, 0, 1, 1, 0, 1, 0, 0, 1, 1, 1, 0, 1, 1, 0, 1, 0, 1, 1, 1, 0, 0, 0, 0, 1, 0, 1, 1], [0, 1, 0, 0, 1, 0, 0, 1, 0, 1, 1, 0, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 0, 1, 1, 1, 0, 1, 1, 1, 0, 1, 0, 1, 0, 1, 0, 1, 1, 0, 1, 0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 1], [1, 1, 1, 1, 0, 1, 0, 0, 0, 0, 1, 1, 0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 1, 1, 0, 1, 0, 1, 1, 0, 0, 0, 0, 1, 0, 0, 1, 0, 1, 1, 0, 1, 1, 0, 1, 1, 0, 1, 1, 1, 0, 1, 1, 0, 1, 0, 0, 0, 0, 1, 0, 0, 1, 0], [1, 1, 0, 1, 0, 0, 1, 1, 1, 0, 0, 1, 1, 0, 0, 1, 0, 0, 1, 1, 0, 1, 0, 0, 0, 1, 1, 0, 0, 0, 0, 1, 1, 1, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1, 0, 1, 1, 1, 1, 0, 1, 1, 0, 0, 0, 1, 1, 0, 1, 1, 0, 0, 0, 0], [1, 1, 1, 0, 1, 1, 0, 0, 1, 0, 1, 0, 1, 1, 0, 0, 1, 0, 0, 0, 1, 1, 0, 1, 1, 1, 0, 0, 0, 0, 1, 0, 1, 1, 1, 1, 1, 1, 0, 0, 0, 1, 0, 1, 1, 0, 1, 1, 0, 1, 0, 0, 0, 0, 1, 0, 0, 1, 1, 0, 0, 0, 0, 1], [1, 0, 1, 0, 1, 0, 1, 0, 1, 0, 0, 0, 0, 0, 0, 1, 0, 1, 0, 1, 1, 1, 1, 0, 0, 1, 0, 0, 1, 1, 1, 1, 0, 1, 1, 0, 0, 0, 1, 1, 0, 1, 0, 0, 1, 0, 0, 0, 0, 0, 1, 0, 0, 1, 1, 1, 1, 0, 0, 0, 0, 1, 1, 0], [1, 1, 1, 1, 0, 1, 0, 1, 0, 1, 1, 0, 0, 0, 0, 1, 0, 1, 1, 1, 0, 0, 0, 0, 0, 1, 1, 1, 0, 1, 0, 1, 0, 0, 1, 0, 0, 1, 0, 1, 0, 0, 1, 0, 1, 1, 0, 0, 0, 0, 1, 0, 1, 1, 0, 0, 0, 0, 1, 1, 0, 1, 0, 0], [1, 0, 1, 1, 1, 0, 0, 0, 0, 1, 1, 1, 1, 0, 1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 1, 1, 1, 0, 0, 1, 0, 0, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 0, 1, 0, 1, 1, 1, 1, 1], [1, 0, 1, 1, 0, 0, 1, 0, 1, 0, 0, 1, 0, 1, 1, 0, 1, 0, 0, 0, 1, 1, 0, 0, 0, 1, 1, 1, 1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 1, 1, 0, 1, 0, 1, 0, 1, 0, 1, 0, 1, 0, 1, 0, 1, 0, 0, 0, 0, 0, 0, 0, 1, 0, 1], [0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 1, 1, 0, 1, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 0, 1, 1, 0, 1, 0, 0, 1, 1, 1, 1, 1, 0, 0, 1, 0, 1, 0, 0, 1, 0, 1, 1, 0, 1, 1, 1, 1, 0, 1, 1, 1, 0, 0, 0, 0, 0, 0, 1, 1], [0, 0, 0, 0, 0, 1, 1, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 0, 1, 0, 1, 0, 1, 1, 1, 0, 1, 1, 1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 0, 1, 1, 0, 1, 1, 0, 1, 1, 0, 1, 0, 1, 1, 1, 1, 1, 0, 1, 1], [1, 0, 0, 1, 1, 0, 1, 1, 0, 1, 1, 0, 1, 1, 1, 0, 0, 0, 1, 1, 1, 0, 1, 0, 1, 0, 1, 1, 0, 1, 1, 1, 0, 0, 0, 1, 0, 0, 1, 1, 0, 0, 1, 0, 1, 0, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 1, 1, 0, 1, 1, 1, 1], [1, 0, 0, 0, 0, 1, 0, 1, 1, 1, 0, 0, 1, 1, 0, 1, 1, 1, 0, 1, 0, 1, 0, 0, 1, 1, 1, 0, 1, 0, 0, 0, 1, 1, 1, 1, 0, 1, 1, 0, 0, 0, 0, 0, 1, 1, 1, 0, 1, 0, 1, 0, 0, 1, 0, 1, 0, 0, 1, 1, 1, 1, 1, 0], [1, 0, 1, 1, 0, 1, 1, 1, 0, 0, 1, 0, 1, 1, 0, 1, 1, 0, 0, 1, 0, 1, 0, 0, 0, 1, 1, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0, 0, 1, 1, 0, 0, 0, 0, 1, 0, 0, 1, 1, 1, 1, 0, 0, 0, 1, 0, 1, 0, 1, 1, 0, 0, 0], [0, 1, 1, 0, 1, 0, 1, 0, 1, 0, 0, 1, 1, 1, 1, 1, 0, 1, 1, 1, 0, 1, 1, 0, 0, 0, 0, 0, 1, 1, 0, 1, 1, 1, 1, 1, 1, 0, 0, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 0, 1, 1, 0, 1, 1, 0, 1, 0, 0, 1, 0, 1, 1], [0, 0, 1, 1, 0, 0, 1, 0, 0, 0, 1, 0, 1, 0, 0, 1, 0, 1, 1, 0, 0, 0, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1, 0, 1, 0, 0, 1, 0, 1, 0, 0, 1, 0], [1, 1, 0, 0, 1, 1, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 1, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 1, 1, 1, 0, 0, 0, 0, 1, 0, 0, 1, 1, 1, 1, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1], [0, 1, 0, 1, 1, 1, 1, 1, 0, 0, 0, 1, 0, 0, 1, 1, 1, 1, 1, 1, 0, 1, 1, 0, 1, 0, 1, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 1, 1, 0, 0, 0, 1, 0, 0, 1, 1, 0, 1, 0, 1, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0, 0, 1, 1], [1, 1, 0, 1, 1, 1, 0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 0, 0, 1, 1, 1, 0, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 1, 1, 0, 1, 0, 0, 0, 0, 0, 1, 1, 0, 1, 0, 0, 0, 1, 1, 0, 1, 0, 1, 1], [1, 1, 1, 1, 1, 1, 0, 0, 1, 0, 0, 1, 0, 1, 0, 0, 0, 1, 1, 0, 0, 1, 1, 0, 1, 0, 0, 0, 0, 0, 0, 1, 0, 1, 0, 1, 1, 0, 1, 1, 0, 0, 0, 0, 1, 0, 0, 1, 0, 1, 1, 0, 0, 1, 1, 1, 1, 0, 1, 1, 1, 1, 0, 1], [1, 0, 0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 1, 0, 1, 0, 1, 1, 1, 1, 1, 1, 0, 0, 1, 1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 1, 0, 1, 0, 1, 0, 0, 0, 0, 0, 0, 1, 1, 1, 0, 0, 1, 1, 0, 1, 1, 0, 1, 0, 1, 1], [0, 1, 0, 0, 1, 1, 1, 1, 0, 1, 0, 1, 0, 1, 0, 1, 1, 1, 0, 0, 1, 0, 1, 1, 1, 0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 0, 0, 1, 0, 0, 0, 1, 1, 0, 0, 1], [0, 1, 0, 1, 1, 0, 0, 1, 0, 1, 0, 1, 1, 1, 1, 1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 0, 0, 1, 1, 1, 1, 1, 1, 0, 1, 0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 1, 1, 1, 0, 1, 0, 0, 1, 0, 1, 0, 1, 0, 0, 1, 0], [0, 0, 1, 1, 0, 1, 1, 1, 0, 0, 0, 0, 1, 1, 1, 0, 0, 1, 0, 0, 0, 1, 0, 1, 0, 0, 0, 0, 0, 1, 1, 1, 1, 0, 1, 1, 1, 0, 0, 0, 0, 0, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 1, 1, 0, 0, 1], [0, 1, 0, 0, 0, 1, 1, 1, 0, 0, 0, 0, 0, 0, 1, 0, 1, 1, 1, 1, 0, 1, 1, 1, 0, 0, 0, 0, 1, 1, 0, 1, 0, 0, 1, 0, 0, 0, 0, 0, 0, 1, 1, 1, 0, 1, 0, 1, 1, 1, 1, 0, 1, 0, 1, 0, 0, 0, 1, 0, 0, 1, 0, 0], [1, 1, 1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 0, 0, 1, 1, 0, 0, 0, 1, 1, 1, 1, 1, 0, 0, 1, 1, 0, 1, 0, 0, 1, 0, 0, 0, 1, 0, 0, 0, 0, 0, 1, 1, 0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 1, 0, 1, 0, 1, 1, 0, 0, 1, 0], [1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 1, 0, 1, 1, 0, 0, 1, 0, 0, 1, 0, 0, 1, 1, 0, 1, 0, 1, 1, 0, 1, 0, 0, 1, 1, 1, 0, 1, 0, 0, 0, 0, 0, 1, 1, 1, 1, 0, 1, 0, 1, 0, 1, 1, 0, 0, 0, 1, 0, 1, 0, 1, 1, 0], [1, 0, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 0, 0, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 0, 0, 1, 1, 1, 0, 1, 1, 1, 0, 1, 0, 0, 0, 0, 1, 0, 0, 0, 1, 0, 0, 1, 0, 1, 0, 0, 0, 1, 0, 0, 0, 1, 1, 1, 0, 1, 1, 1, 1], [0, 1, 1, 1, 0, 0, 0, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 1, 0, 0, 1, 0, 1, 0, 1, 0, 1, 0, 0, 1, 1, 0, 1, 1, 0, 1, 1, 0, 0, 0, 1, 1, 0, 1, 0, 0, 0, 0, 0, 1, 1, 1, 0, 1, 1, 0, 0, 1, 1, 1, 0, 0, 1], [1, 1, 1, 0, 1, 1, 1, 0, 1, 0, 0, 1, 1, 1, 0, 1, 1, 1, 0, 0, 1, 0, 1, 1, 0, 0, 0, 0, 1, 0, 0, 1, 1, 1, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 1, 1, 1, 0, 0, 0, 0, 1, 0, 0, 1, 1, 1, 0, 1, 0, 1, 1, 0, 1], [1, 1, 1, 1, 0, 0, 0, 1, 1, 0, 1, 1, 0, 0, 1, 1, 0, 0, 1, 0, 0, 0, 1, 1, 0, 1, 0, 1, 1, 0, 1, 1, 0, 0, 1, 0, 1, 1, 0, 0, 0, 0, 1, 0, 1, 1, 1, 0, 1, 0, 0, 0, 0, 0, 1, 1, 0, 0, 1, 1, 1, 1, 0, 0], [0, 0, 0, 1, 0, 1, 0, 1, 0, 1, 0, 0, 1, 0, 0, 1, 0, 1, 1, 0, 1, 0, 0, 0, 1, 1, 0, 1, 0, 0, 1, 0, 1, 1, 0, 0, 0, 0, 1, 0, 1, 1, 1, 0, 1, 1, 0, 0, 1, 0, 0, 1, 0, 1, 1, 0, 1, 0, 0, 0, 0, 1, 0, 0], [0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 1, 1, 1, 1, 0, 0, 0, 1, 0, 1, 1, 0, 1, 1, 1, 0, 1, 0, 0, 0, 1, 1, 1, 0, 0, 1, 1, 1, 1, 0, 1, 0, 1, 0, 1, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 1, 1, 0, 1, 1], [0, 1, 0, 0, 0, 0, 1, 0, 1, 0, 1, 0, 1, 1, 0, 1, 1, 1, 0, 0, 0, 0, 1, 1, 1, 1, 0, 0, 1, 0, 1, 1, 0, 1, 1, 0, 1, 0, 0, 1, 0, 1, 1, 1, 0, 1, 0, 1, 1, 1, 1, 0, 0, 1, 1, 1, 1, 1, 1, 1, 0, 0, 1, 0], [1, 1, 0, 0, 0, 1, 0, 0, 1, 0, 0, 0, 0, 0, 1, 0, 1, 0, 1, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 1, 0, 0, 0, 1, 0, 1, 0, 1, 0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 0, 1, 1, 1, 0, 0, 1, 1, 1, 1, 1, 0, 0, 1, 0, 1], [0, 0, 1, 0, 1, 1, 0, 1, 0, 1, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 1, 1, 0, 0, 0, 1, 1, 1, 1, 1, 1, 0, 1, 0, 1, 1, 0, 0, 0, 0, 1, 1, 0, 0, 1, 1, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 1, 1, 0, 1, 0, 0, 0, 0], [1, 0, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 0, 0, 0, 0, 0, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 0, 0, 0, 0, 1, 1, 0, 1, 0, 1, 1, 1, 0, 1, 0, 0], [0, 1, 0, 1, 1, 0, 1, 1, 0, 0, 1, 1, 1, 1, 0, 0, 1, 1, 0, 0, 1, 0, 1, 0, 0, 1, 0, 1, 1, 1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 1, 1, 1, 0, 0, 1, 1, 1, 0, 0, 1, 0, 1, 1, 1, 1, 1, 0, 1, 1, 0, 1, 1, 0, 1], [0, 0, 0, 0, 0, 1, 0, 1, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0, 0, 1, 1, 0, 0, 1, 0, 0, 1, 0, 0, 1, 0, 1, 1, 1, 0, 0, 1, 1, 1, 0, 0, 0, 1, 0, 0, 1, 1, 1, 1, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 1, 0, 1, 0], [1, 1, 0, 0, 1, 1, 1, 1, 1, 1, 0, 1, 1, 0, 0, 1, 0, 1, 0, 0, 0, 0, 0, 1, 0, 0, 0, 1, 0, 0, 0, 1, 1, 1, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 0, 1, 0, 1, 0, 1, 0, 0, 1, 1, 1, 0, 1, 1, 0, 1, 0, 0, 0, 1], [0, 1, 0, 0, 0, 1, 1, 0, 1, 1, 0, 0, 1, 1, 0, 0, 1, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 1, 0, 0, 0, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 1, 0, 1, 0, 0, 0, 0, 1, 1, 1, 1, 1, 0, 0, 1, 0, 0, 1], [0, 0, 1, 1, 1, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 0, 0, 1, 0, 0, 1, 0, 1, 0, 0, 1, 0, 1, 1, 1, 0, 0, 1, 0, 0, 1, 0, 1, 1, 1, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 0, 1, 1, 1, 0, 0, 1, 0, 1, 0, 1, 1, 0, 0], [1, 0, 1, 0, 1, 1, 1, 0, 1, 0, 1, 1, 1, 1, 0, 0, 0, 1, 1, 1, 0, 0, 1, 1, 0, 0, 1, 1, 0, 1, 1, 1, 0, 0, 1, 1, 1, 0, 0, 0, 0, 1, 1, 0, 1, 1, 1, 0, 0, 0, 1, 0, 1, 1, 1, 0, 0, 1, 0, 0, 0, 0, 1, 1], [1, 1, 0, 1, 0, 1, 0, 1, 1, 1, 0, 1, 0, 1, 1, 1, 0, 1, 1, 0, 0, 1, 1, 1, 1, 0, 1, 1, 1, 0, 0, 1, 1, 0, 0, 0, 0, 0, 1, 0, 0, 0, 1, 0, 1, 0, 1, 1, 1, 1, 1, 0, 1, 0, 1, 0, 0, 0, 0, 1, 1, 0, 0, 0], [0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 0, 1, 0, 0, 0, 1, 0, 1, 0, 1, 1, 0, 1, 1, 0, 0, 0, 0, 1, 1, 1, 1, 0, 0, 1, 1, 1, 0, 0, 1, 0, 0, 0, 0, 0, 1, 0, 1, 1, 1, 0, 1, 0, 0, 0, 0, 0, 0], [1, 0, 1, 0, 0, 0, 1, 0, 1, 1, 0, 1, 1, 0, 1, 1, 0, 1, 0, 1, 0, 0, 1, 1, 1, 1, 0, 0, 0, 1, 1, 1, 1, 1, 0, 0, 1, 1, 0, 0, 1, 0, 1, 0, 1, 1, 1, 1, 0, 0, 1, 0, 1, 0, 0, 1, 0, 1, 0, 0, 1, 0, 1, 0], [1, 1, 1, 1, 0, 0, 1, 1, 1, 0, 0, 0, 1, 1, 1, 1, 0, 0, 1, 0, 1, 1, 0, 1, 0, 1, 1, 1, 1, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 0, 0, 0, 0, 1, 0, 0, 0, 1, 1, 1, 0, 0, 1, 0, 0, 1, 0, 1, 0, 0, 0, 1, 1, 1], [0, 1, 0, 0, 1, 0, 1, 0, 1, 0, 0, 0, 0, 1, 0, 0, 1, 1, 0, 1, 0, 1, 0, 0, 1, 1, 1, 0, 0, 1, 1, 1, 1, 1, 0, 1, 1, 0, 1, 0, 1, 1, 1, 0, 1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 1, 0, 1, 1, 1, 1, 1, 1, 0, 1], [0, 1, 1, 0, 1, 0, 0, 0, 1, 0, 1, 1, 0, 0, 1, 0, 1, 0, 0, 1, 0, 0, 1, 0, 0, 1, 1, 1, 0, 0, 1, 0, 1, 0, 0, 1, 1, 1, 0, 0, 0, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 1, 1, 0], [1, 1, 0, 1, 1, 0, 0, 1, 1, 1, 0, 1, 1, 1, 0, 0, 0, 0, 0, 1, 1, 0, 0, 1, 0, 1, 0, 0, 0, 1, 0, 1, 0, 1, 0, 0, 0, 0, 0, 1, 0, 1, 0, 1, 0, 0, 1, 0, 0, 0, 1, 0, 1, 0, 0, 0, 1, 0, 1, 0, 0, 0, 1, 1], [1, 0, 0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 1, 0, 1, 0, 1, 1, 0, 1, 1, 0, 0, 1, 1, 0, 0, 0, 0, 1, 0, 1, 1, 1, 0, 1, 1, 1, 0, 0, 1, 0, 1, 1, 0, 1, 0, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1], [1, 0, 1, 1, 1, 1, 1, 0, 1, 0, 0, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 0, 0, 0, 1, 0, 1, 1, 1, 1, 0, 1, 1, 1, 0, 1, 0, 0, 0, 1, 1, 0, 0, 0, 1, 0, 1, 0, 0, 1, 0, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 1, 0], [1, 1, 0, 0, 0, 1, 1, 1, 0, 0, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 0, 0, 1, 1, 0, 1, 1, 0, 0, 1, 0, 0, 1, 1, 0, 1, 0, 0, 0, 1, 0, 1, 1, 1, 1, 0, 0, 0, 0, 1, 1, 1, 0, 0, 1, 1, 0, 0, 0, 0, 1, 0, 1], [1, 0, 0, 0, 0, 1, 0, 0, 1, 1, 1, 1, 1, 0, 0, 1, 1, 1, 0, 1, 1, 1, 1, 0, 0, 0, 1, 0, 0, 1, 1, 1, 1, 1, 1, 1, 0, 0, 1, 0, 1, 1, 1, 1, 0, 0, 0, 0, 1, 1, 1, 1, 1, 0, 1, 0, 0, 0, 0, 1, 0, 1, 1, 0], [1, 0, 0, 0, 0, 0, 1, 1, 0, 1, 0, 1, 1, 1, 0, 0, 0, 1, 0, 0, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 1, 1, 1, 1, 0, 1, 1, 0, 0, 1, 1, 1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 1, 1, 0, 1, 1, 0, 0, 0, 0, 0, 1, 1], [1, 0, 1, 0, 1, 0, 1, 1, 0, 1, 0, 1, 0, 1, 1, 1, 1, 0, 1, 1, 1, 1, 0, 1, 0, 1, 1, 1, 1, 1, 0, 1, 1, 1, 0, 0, 1, 1, 1, 1, 1, 1, 0, 1, 1, 0, 1, 1, 0, 0, 1, 0, 1, 0, 1, 0, 0, 1, 0, 0, 1, 1, 1, 1], [1, 1, 1, 0, 0, 0, 1, 1, 1, 0, 0, 1, 1, 0, 0, 0, 1, 0, 0, 0, 1, 0, 1, 0, 1, 1, 1, 0, 1, 0, 1, 1, 0, 1, 0, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0, 1, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1], [1, 0, 1, 0, 1, 0, 1, 1, 0, 0, 1, 1, 0, 1, 1, 1, 1, 1, 0, 1, 0, 0, 0, 0, 1, 0, 0, 1, 0, 1, 1, 0, 1, 0, 1, 1, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 1, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 0, 1, 1, 1, 1, 1], [0, 0, 0, 1, 0, 1, 0, 0, 1, 0, 1, 1, 0, 0, 0, 0, 1, 1, 1, 1, 1, 0, 1, 0, 0, 0, 1, 0, 1, 0, 0, 0, 1, 1, 0, 1, 0, 1, 0, 0, 1, 1, 1, 1, 1, 0, 0, 1, 0, 1, 1, 1, 1, 0, 1, 1, 1, 1, 1, 0, 1, 0, 0, 1], [0, 1, 0, 1, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 0, 0, 0, 1, 0, 1, 0, 1, 0, 0, 1, 0, 1, 0, 0, 1, 0, 1, 1, 0, 1, 0, 0, 0, 1, 1, 0, 1, 1, 0, 1, 0, 1, 0, 0, 0, 1, 1, 0, 0, 1, 0, 0, 0, 0, 0, 1, 1, 0, 1], [0, 0, 0, 0, 1, 1, 1, 1, 0, 0, 1, 0, 0, 1, 1, 0, 0, 1, 1, 1, 0, 1, 0, 1, 0, 0, 1, 0, 0, 0, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 0, 1, 1, 1, 0, 0, 0, 1, 0, 1, 0, 1, 1, 1, 0, 1, 1], [1, 1, 0, 0, 0, 1, 1, 1, 0, 0, 0, 1, 0, 1, 0, 0, 1, 0, 0, 1, 1, 0, 0, 1, 1, 0, 1, 1, 0, 1, 1, 0, 1, 1, 0, 1, 0, 0, 1, 1, 1, 0, 0, 1, 0, 0, 1, 1, 1, 0, 1, 1, 0, 1, 0, 0, 1, 1, 1, 1, 0, 0, 0, 0], [1, 0, 1, 0, 0, 1, 0, 1, 1, 1, 0, 1, 0, 1, 0, 1, 1, 0, 1, 0, 1, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 1, 0, 0, 1, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1, 0, 1, 1, 0, 0, 0, 1, 0, 0, 1, 1, 0, 1, 0, 1], [1, 0, 1, 0, 1, 0, 1, 0, 1, 1, 1, 1, 0, 0, 0, 1, 1, 1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 1, 1, 0, 1, 1, 1, 0, 0, 0, 0, 0, 0, 1, 0, 1, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1, 0, 0, 0, 1, 0, 0, 1, 1, 0, 0, 0, 1], [1, 1, 0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 1, 1, 0, 0, 0, 0, 1, 0, 1, 0, 1, 0, 1, 0, 1, 0, 1, 0, 0, 1, 0, 1, 0, 1, 1, 0, 0, 0, 0, 1, 1, 1, 0, 0, 0, 1, 1, 0, 1], [1, 0, 1, 1, 0, 1, 1, 0, 0, 1, 1, 0, 0, 1, 1, 0, 0, 1, 0, 1, 0, 0, 1, 0, 1, 1, 0, 0, 1, 1, 1, 0, 0, 0, 0, 0, 1, 1, 0, 1, 1, 1, 1, 0, 1, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 1, 0, 0, 1, 0, 1, 0, 0, 0], [0, 1, 0, 1, 0, 1, 0, 0, 1, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 0, 0, 1, 1, 0, 1, 1, 1, 1, 0, 0, 1, 0, 1, 1, 0, 1, 0, 0, 0, 1, 0, 0, 1, 1, 1, 0, 0, 1, 1, 0, 0, 1, 0], [0, 1, 0, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 1, 0, 0, 1, 0, 0, 0, 0, 1, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 0, 1, 1, 1, 0, 1, 0, 0, 0, 0, 1, 0, 1, 1, 1, 1, 0, 1, 1, 0, 1, 0, 0], [1, 0, 0, 1, 1, 0, 1, 1, 0, 1, 1, 1, 0, 1, 0, 1, 1, 1, 1, 1, 1, 0, 1, 1, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1, 1, 0, 0, 0, 1, 0, 0, 0, 0, 1, 1, 1, 1, 0, 1, 0, 0, 1, 1, 0, 0, 0, 0, 0, 1, 0, 0, 1, 1, 1], [0, 1, 1, 0, 0, 1, 0, 0, 0, 0, 0, 0, 1, 1, 1, 0, 0, 1, 1, 1, 0, 1, 0, 1, 1, 0, 0, 1, 1, 1, 0, 0, 0, 0, 1, 0, 0, 0, 1, 0, 1, 0, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 0, 1, 0, 1, 1, 1, 1, 1, 1, 1, 1], [0, 1, 0, 0, 0, 0, 1, 1, 1, 0, 0, 0, 0, 1, 1, 1, 1, 1, 0, 0, 0, 1, 1, 0, 1, 0, 1, 1, 0, 1, 0, 1, 0, 0, 0, 0, 0, 0, 1, 0, 1, 1, 1, 1, 0, 1, 1, 0, 0, 0, 0, 1, 1, 0, 1, 1, 1, 1, 1, 0, 0, 0, 1, 0], [1, 1, 1, 1, 1, 0, 0, 1, 1, 0, 1, 1, 1, 0, 0, 1, 1, 0, 0, 0, 0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 1, 1, 0, 1, 1, 1, 1, 1, 0, 0, 1, 0, 0, 1, 0, 0, 0, 0, 1, 0, 1, 0, 1], [0, 1, 0, 0, 1, 0, 0, 1, 1, 0, 0, 0, 0, 0, 0, 0, 1, 0, 1, 1, 0, 0, 0, 0, 1, 0, 0, 0, 1, 1, 0, 1, 1, 1, 1, 0, 1, 0, 0, 1, 1, 0, 1, 1, 1, 1, 1, 0, 1, 0, 1, 0, 1, 1, 0, 1, 1, 0, 1, 0, 1, 0, 1, 1], [0, 1, 1, 0, 0, 0, 0, 0, 1, 1, 0, 0, 1, 1, 1, 0, 0, 1, 0, 1, 0, 1, 1, 1, 0, 1, 0, 1, 1, 1, 0, 0, 0, 1, 0, 0, 1, 0, 1, 0, 0, 1, 1, 1, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 0, 0, 1, 1, 0, 1, 1, 1, 1, 1], [0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 1, 1, 1, 0, 0, 1, 0, 0, 0, 0, 1, 1, 1, 1, 0, 1, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 1, 1, 1, 0, 1, 0, 0, 0, 0, 0, 1, 1, 0, 0, 1, 1, 1, 0, 1, 0, 1, 0, 1, 1, 1], [1, 0, 1, 0, 1, 1, 0, 0, 1, 1, 1, 0, 0, 0, 0, 1, 1, 0, 0, 1, 0, 1, 0, 0, 1, 1, 1, 0, 1, 0, 1, 0, 1, 0, 1, 0, 0, 0, 1, 1, 1, 0, 1, 0, 1, 0, 0, 1, 0, 0, 1, 0, 0, 0, 0, 0, 1, 1, 0, 0, 1, 1, 0, 0], [0, 1, 1, 0, 0, 0, 0, 1, 1, 1, 1, 1, 0, 0, 1, 1, 1, 1, 0, 0, 0, 1, 0, 1, 1, 1, 0, 1, 0, 0, 1, 1, 0, 0, 0, 1, 1, 1, 1, 0, 1, 0, 1, 1, 1, 0, 1, 1, 1, 0, 0, 1, 1, 0, 0, 1, 1, 0, 1, 0, 0, 1, 1, 1], [1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 1, 1, 0, 0, 1, 1, 1, 1, 1, 0, 1, 0, 1, 1, 0, 1, 0, 1, 1, 1, 0, 0, 0, 0, 0, 1, 1, 0, 1, 1, 1, 0, 0, 1, 1, 1, 0, 0, 1, 0, 1, 1, 0, 1, 1, 0, 0, 0, 1, 1, 1], [1, 0, 0, 0, 1, 0, 0, 0, 0, 0, 1, 0, 0, 1, 0, 1, 1, 1, 1, 0, 0, 0, 0, 1, 1, 1, 0, 1, 1, 0, 1, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 1, 1, 0, 1, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 1, 1, 0, 0, 1, 1], [1, 1, 1, 0, 0, 0, 1, 0, 1, 1, 0, 0, 1, 0, 0, 1, 1, 0, 0, 1, 1, 1, 0, 0, 0, 1, 1, 1, 1, 0, 0, 0, 1, 1, 0, 1, 0, 0, 1, 1, 1, 1, 0, 0, 0, 0, 1, 0, 1, 0, 1, 1, 0, 0, 1, 1, 0, 0, 0, 0, 0, 1, 0, 0], [1, 0, 1, 1, 1, 0, 1, 0, 0, 0, 0, 1, 1, 1, 0, 0, 1, 0, 1, 1, 0, 1, 0, 1, 0, 1, 0, 1, 0, 1, 1, 0, 0, 1, 1, 1, 1, 0, 1, 1, 1, 1, 1, 0, 0, 0, 0, 1, 0, 1, 1, 1, 1, 1, 0, 1, 0, 0, 1, 1, 1, 0, 0, 0], [0, 1, 1, 1, 1, 1, 1, 0, 0, 1, 0, 0, 0, 0, 0, 1, 0, 0, 0, 1, 0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 1, 1, 0, 1, 1, 1, 1, 0, 0, 0, 1, 0, 0, 0, 1, 1, 0, 1, 1, 0, 0, 1, 1, 0], [1, 1, 0, 0, 1, 1, 1, 1, 0, 0, 1, 0, 0, 0, 1, 0, 0, 0, 1, 0, 1, 1, 0, 0, 1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 0, 0, 1, 0, 0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 1, 0, 1, 0, 0, 1, 1, 0, 1, 1, 1, 1], [0, 1, 0, 0, 1, 0, 1, 1, 0, 1, 0, 0, 0, 0, 1, 1, 1, 1, 0, 1, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 1, 1, 0, 0, 0, 1, 1, 1, 1, 0, 0, 1, 1, 1, 1, 1, 0, 0, 1, 1, 0, 0, 0], [1, 0, 1, 0, 1, 0, 1, 0, 1, 1, 0, 0, 1, 0, 1, 1, 1, 0, 1, 0, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 1, 1, 1, 1, 1, 1, 0, 0, 1, 1, 0, 0, 0, 1, 0, 0, 0, 0, 0, 1, 1, 0, 1, 0, 1, 0, 0, 0, 0, 0, 1, 1, 1, 1], [0, 1, 0, 0, 0, 0, 1, 0, 1, 1, 0, 1, 1, 0, 1, 1, 1, 0, 1, 1, 0, 1, 1, 0, 1, 0, 1, 0, 1, 0, 1, 0, 1, 0, 1, 0, 1, 1, 1, 1, 1, 0, 0, 1, 1, 0, 1, 0, 1, 0, 1, 0, 0, 0, 1, 1, 1, 0, 1, 0, 0, 1, 1, 1], [0, 1, 1, 1, 1, 0, 0, 1, 1, 1, 1, 0, 0, 1, 1, 1, 0, 1, 1, 0, 1, 1, 0, 0, 1, 1, 0, 0, 1, 1, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 1, 1, 1, 0, 0, 0, 1, 1, 1, 0, 1, 0, 0, 0, 1, 0, 1, 0, 0, 1, 0, 1, 1, 0], [1, 1, 0, 1, 1, 0, 1, 1, 0, 1, 1, 0, 0, 1, 0, 0, 0, 1, 0, 1, 1, 0, 0, 1, 0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 1, 0, 1, 1, 0, 1, 0, 0, 1, 1, 1, 0, 0, 0, 1, 0, 0, 1, 1, 1, 0, 0, 0, 1, 1, 0, 1, 0, 0, 1], [0, 1, 0, 0, 1, 1, 0, 0, 1, 0, 0, 1, 0, 0, 1, 1, 0, 0, 1, 0, 1, 1, 1, 0, 0, 0, 1, 1, 0, 1, 1, 0, 1, 1, 0, 1, 0, 0, 1, 0, 0, 0, 0, 1, 0, 1, 0, 1, 0, 1, 0, 1, 0, 1, 1, 0, 0, 0, 1, 1, 0, 1, 0, 0], [0, 0, 1, 1, 1, 0, 0, 0, 1, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 0, 0, 1, 1, 0, 0, 0, 1, 1, 0, 1, 1, 1, 1, 0, 1, 1, 0, 0, 0, 1, 1, 1, 0, 1, 1, 0, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 1, 0, 0, 0, 0, 0], [1, 0, 1, 1, 1, 0, 0, 1, 1, 1, 0, 1, 0, 0, 1, 0, 1, 0, 0, 0, 0, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0, 1, 1, 0, 0, 0, 0, 1, 1, 0, 0, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 1, 0, 1], [0, 1, 0, 1, 0, 0, 1, 0, 0, 0, 1, 0, 0, 0, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1, 0, 0, 1, 0, 1, 0, 1, 0, 1, 0, 0, 1, 0, 0, 1, 0, 0, 1, 1, 0, 0, 0, 0, 0, 0, 1, 0, 1, 1, 0, 1, 0, 1, 0, 1, 1, 1, 1, 0, 1], [1, 0, 0, 1, 0, 1, 1, 1, 0, 1, 1, 0, 0, 0, 0, 1, 0, 0, 1, 0, 1, 1, 1, 1, 1, 0, 1, 1, 1, 0, 1, 0, 0, 0, 0, 1, 0, 0, 1, 1, 1, 1, 1, 0, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 0, 1, 1, 1, 0, 1, 0, 0, 1, 1], [1, 1, 1, 1, 1, 0, 0, 1, 1, 0, 1, 1, 1, 0, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 0, 0, 1, 1, 0, 1, 1, 0, 1, 0, 1, 1, 1, 0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 1, 0, 0, 1, 0, 0, 0, 1, 1, 1, 0, 1, 0, 0, 0, 0, 1], [0, 0, 0, 1, 1, 1, 0, 1, 1, 1, 0, 1, 0, 1, 1, 1, 0, 1, 0, 0, 0, 1, 0, 0, 0, 1, 0, 1, 1, 1, 1, 0, 1, 0, 1, 0, 1, 0, 1, 1, 1, 1, 1, 0, 1, 0, 0, 1, 0, 1, 0, 1, 1, 0, 1, 0, 1, 0, 1, 0, 0, 0, 0, 0], [0, 0, 0, 1, 0, 1, 0, 1, 1, 0, 0, 0, 1, 1, 1, 0, 1, 0, 1, 0, 0, 0, 0, 1, 1, 1, 1, 1, 1, 0, 0, 0, 1, 1, 1, 1, 0, 1, 1, 0, 1, 0, 1, 0, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 1, 1, 1, 1, 0, 0, 0, 0, 0, 1], [1, 1, 1, 1, 0, 1, 1, 0, 0, 0, 0, 1, 0, 1, 0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 0, 1, 0, 0, 0, 0, 0, 0, 1, 1, 0, 1, 0, 1, 1, 1, 0, 1, 1, 1, 1, 0, 1, 0, 0, 1, 1, 1, 0, 0, 1, 0, 0, 0, 1], [0, 1, 0, 0, 1, 0, 1, 1, 1, 1, 0, 0, 0, 0, 1, 0, 1, 0, 0, 0, 0, 0, 1, 0, 1, 0, 0, 0, 1, 1, 1, 0, 1, 1, 0, 1, 0, 0, 0, 1, 1, 1, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 1, 1, 1, 1, 1, 0, 1, 0, 0], [0, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1, 0, 0, 0, 1, 1, 0, 1, 0, 1, 1, 1, 1, 0, 0, 0, 0, 1, 1, 1, 0, 0, 1, 0, 0, 1, 0, 0, 1, 0, 1, 1, 1, 0, 1, 0, 1, 1, 1, 1, 0, 0, 1, 1, 0, 0, 0, 1, 1, 1], [0, 1, 0, 1, 1, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 1, 0, 0, 1, 1, 1, 0, 0, 0, 0, 1, 1, 0, 0, 0, 1, 0, 0, 0, 1, 0, 1, 1, 1, 0, 1, 0, 1, 1, 1, 1, 1, 0, 0, 0, 0, 1, 0, 0, 1, 1, 0, 1, 0, 1, 1, 0, 0, 0], [0, 1, 0, 1, 0, 1, 0, 1, 1, 0, 0, 1, 1, 0, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1, 0, 1, 0, 1, 0, 0, 0, 0, 0, 0, 1, 1, 0, 1, 1, 0, 0, 1, 0, 1, 1, 1, 1, 1, 0, 0, 0, 1, 0, 1, 0, 1, 1, 1, 1, 1, 0], [1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 1, 0, 1, 1, 1, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1, 0, 0, 0, 0, 0, 1, 0, 1, 1, 0, 1, 1, 1, 1, 0, 0, 0, 1, 0, 0, 0, 0, 0, 1, 0, 1, 1, 1, 0], [1, 0, 0, 0, 0, 1, 1, 1, 0, 1, 0, 1, 0, 0, 0, 0, 1, 0, 0, 1, 1, 0, 0, 0, 0, 1, 1, 0, 0, 1, 0, 1, 0, 0, 1, 0, 0, 0, 1, 0, 1, 1, 1, 0, 1, 1, 1, 1, 0, 1, 1, 0, 0, 0, 1, 0, 0, 1, 1, 1, 1, 1, 1, 0], [1, 1, 1, 1, 0, 0, 0, 1, 0, 1, 1, 1, 0, 0, 1, 0, 1, 1, 0, 0, 0, 1, 1, 0, 1, 1, 1, 0, 1, 1, 0, 1, 1, 0, 0, 0, 0, 1, 1, 0, 1, 0, 1, 0, 0, 1, 0, 1, 0, 1, 1, 1, 1, 1, 0, 1, 0, 1, 1, 1, 0, 0, 1, 0], [1, 0, 0, 0, 0, 0, 0, 0, 0, 1, 1, 0, 1, 0, 0, 0, 1, 1, 0, 0, 0, 1, 1, 1, 1, 0, 0, 0, 0, 1, 0, 1, 1, 0, 0, 1, 1, 0, 1, 0, 0, 1, 1, 0, 0, 0, 0, 1, 0, 1, 1, 1, 1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 0, 1], [1, 1, 0, 0, 0, 0, 0, 1, 1, 0, 1, 1, 0, 0, 1, 1, 1, 0, 0, 1, 1, 0, 1, 1, 1, 1, 1, 0, 0, 1, 1, 1, 0, 1, 1, 0, 1, 1, 1, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 1, 1, 0, 1, 1, 0, 1, 0, 1, 0, 1, 1, 0, 0, 1], [0, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 0, 0, 0, 0, 0, 0, 1, 1, 0, 0, 1, 1, 1, 0, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 0, 0, 1, 1, 1, 0, 1, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 1, 0, 0, 0, 1, 0, 1], [0, 0, 1, 0, 1, 1, 1, 0, 0, 1, 1, 1, 0, 1, 0, 1, 1, 0, 0, 0, 0, 1, 0, 1, 1, 0, 0, 0, 0, 1, 1, 0, 1, 0, 0, 1, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 1, 1, 1, 0, 0, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 1, 0], [0, 1, 1, 1, 0, 1, 0, 1, 1, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 0, 1, 1, 1, 1, 1, 1, 1, 0, 0, 1, 1, 0, 1, 0, 1, 0, 0, 0, 1, 1, 0, 0, 1, 1, 0, 1, 0, 0, 0, 1, 1, 0, 1, 0, 1, 0, 0, 1, 1, 1, 0, 1, 0, 0], [0, 0, 0, 0, 0, 1, 1, 1, 1, 0, 0, 0, 0, 0, 1, 1, 0, 1, 0, 0, 0, 0, 0, 1, 0, 1, 0, 1, 1, 0, 0, 0, 0, 0, 1, 0, 0, 0, 1, 1, 0, 1, 1, 0, 0, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 0, 1, 0, 0, 1, 1, 1, 1, 0], [1, 1, 1, 1, 0, 0, 1, 1, 0, 0, 1, 1, 1, 1, 1, 0, 1, 1, 0, 1, 0, 0, 0, 1, 0, 1, 0, 1, 1, 1, 1, 1, 0, 1, 1, 1, 0, 1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 0, 0, 0, 1, 0, 1, 0, 0, 0, 0, 0, 1, 1, 0, 1, 0, 1], [1, 1, 0, 0, 1, 1, 0, 0, 0, 0, 0, 1, 0, 1, 1, 1, 0, 0, 0, 0, 1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 1, 1, 1, 0, 1, 1, 0, 0, 0, 0, 1, 1, 0, 1, 1, 1, 1, 0, 1, 0, 1, 1, 1, 1, 0, 1, 0, 1, 1, 0, 0, 0, 1, 0], [0, 1, 1, 1, 1, 1, 0, 1, 0, 1, 0, 1, 1, 1, 1, 1, 0, 1, 0, 0, 1, 0, 1, 0, 1, 1, 0, 1, 1, 1, 1, 0, 1, 0, 1, 0, 0, 0, 1, 1, 1, 0, 1, 1, 1, 1, 0, 1, 1, 1, 0, 1, 0, 0, 1, 0, 1, 0, 1, 0, 0, 0, 0, 1], [0, 1, 1, 0, 1, 1, 1, 0, 0, 0, 1, 1, 0, 1, 1, 1, 0, 0, 0, 1, 0, 0, 0, 1, 0, 1, 1, 1, 1, 1, 0, 0, 1, 1, 1, 0, 0, 1, 0, 1, 0, 0, 1, 0, 0, 1, 0, 1, 1, 0, 0, 1, 0, 1, 0, 0, 0, 1, 0, 1, 0, 1, 1, 0], [1, 1, 0, 1, 0, 0, 0, 0, 0, 1, 1, 1, 1, 0, 1, 1, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 0, 1, 0, 1, 0, 1, 0, 1, 1, 0, 1, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 1, 1, 1, 1, 0, 1, 0, 1, 0, 1], [1, 0, 0, 0, 0, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 0, 1, 0, 0, 1, 1, 1, 0, 1, 0, 0, 1, 0, 0, 0, 1, 1, 1, 0, 0, 0, 0, 1, 1, 1, 0, 0, 1, 0, 0, 0, 1, 0, 1, 1, 1, 1, 1, 0, 0, 1, 1, 1, 0, 1], [1, 0, 1, 1, 0, 1, 0, 0, 1, 0, 0, 0, 0, 1, 1, 0, 1, 0, 1, 1, 1, 1, 1, 0, 1, 0, 1, 0, 0, 1, 0, 1, 0, 0, 1, 1, 1, 0, 1, 0, 0, 1, 0, 0, 0, 0, 1, 0, 1, 1, 1, 0, 0, 0, 1, 1, 1, 1, 1, 0, 0, 0, 1, 1], [1, 0, 1, 0, 0, 1, 0, 0, 1, 1, 0, 1, 0, 0, 1, 0, 0, 0, 0, 0, 1, 0, 0, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1, 0, 1, 1, 0, 0, 0, 1, 1, 0, 1, 0, 1, 0, 1, 0, 1, 0, 1, 0, 1, 1, 0, 0, 0, 0], [0, 1, 1, 1, 0, 1, 0, 1, 0, 1, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1, 1, 0, 1, 0, 0, 1, 1, 1, 1, 1, 0, 0, 1, 0, 1, 1, 0, 1, 0, 1, 1, 1, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 1, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 1], [1, 1, 1, 1, 1, 0, 1, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 0, 0, 1, 1, 1, 0, 1, 0, 1, 1, 1, 1, 1, 0, 0, 1, 1, 1, 1, 0, 0, 1, 0, 0, 0, 0, 0, 1, 0, 0, 1, 0, 0, 1], [1, 0, 1, 0, 0, 1, 1, 1, 0, 1, 1, 0, 0, 1, 1, 1, 0, 1, 1, 0, 0, 0, 0, 1, 0, 0, 0, 1, 1, 0, 1, 0, 1, 1, 0, 1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 1, 0, 1, 1, 1, 1, 0, 1, 1, 0, 0, 1, 1, 1, 1, 1, 1, 1, 0], [0, 1, 1, 0, 0, 0, 1, 1, 0, 1, 0, 0, 1, 0, 1, 0, 1, 0, 0, 0, 1, 1, 1, 0, 1, 1, 1, 0, 1, 0, 1, 0, 1, 1, 0, 1, 0, 1, 0, 0, 1, 1, 1, 1, 1, 0, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 1, 0], [1, 0, 1, 0, 1, 0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 1, 0, 0, 0, 1, 0, 1, 0, 1, 1, 1, 0, 0, 1, 1, 1, 0, 0, 0, 1, 1, 1, 0, 0, 0, 1, 1, 1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 0, 0, 1], [1, 1, 0, 1, 0, 0, 0, 1, 1, 1, 0, 1, 0, 1, 1, 1, 1, 1, 1, 0, 1, 0, 1, 1, 1, 0, 0, 0, 0, 0, 1, 1, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 1, 0, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 1, 1], [1, 0, 0, 1, 0, 0, 0, 1, 0, 1, 1, 0, 0, 1, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 0, 1, 0, 0, 1, 0, 1, 1, 0, 1, 0, 1, 0, 1, 1, 0, 0, 0, 1, 0, 1, 0, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 1, 1, 0, 0, 1, 0], [1, 0, 1, 1, 1, 1, 1, 0, 0, 1, 1, 0, 0, 0, 0, 0, 1, 1, 0, 0, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 0, 0, 0, 1, 0, 0, 1, 0, 1, 1, 1, 0, 0, 0, 0, 1, 0, 1, 0, 1, 0, 0, 0, 1, 1, 0, 0, 0, 0, 0, 0, 1, 1, 1], [1, 0, 1, 0, 0, 0, 1, 1, 1, 0, 0, 0, 1, 0, 1, 0, 0, 1, 0, 0, 1, 0, 0, 1, 0, 1, 1, 0, 0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 0, 1, 0, 1, 1, 0, 1, 0, 1, 1, 1, 0, 1, 1, 0, 1, 1, 0, 1, 1, 1, 0, 1, 1, 0, 0], [0, 0, 0, 1, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 1, 1, 0, 1, 1, 0, 0, 0, 0, 1, 0, 1, 1, 1, 1, 0, 0, 1, 1, 1, 1, 1, 1, 0, 1, 1, 0, 0, 1, 0, 0, 0, 1, 0, 1, 1, 1, 0], [0, 1, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 1, 0, 0, 1, 1, 1, 0, 0, 1, 1, 1, 1, 0, 1, 1, 1, 1, 0, 1, 0, 0, 0, 0, 1, 1, 0, 1, 0, 1, 1, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 1, 1, 1, 1, 0, 0, 0], [0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 0, 0, 0, 1, 1, 0, 1, 0, 1, 0, 1, 0, 0, 0, 1, 1, 1, 1, 0, 0, 1, 1, 0, 0, 0, 1, 1, 1, 1, 1, 1, 0, 1, 1, 0, 1, 1, 0, 0, 1, 1, 0, 1, 1, 1, 1, 1, 1, 0, 1, 0, 0, 1, 0], [1, 0, 1, 1, 1, 0, 0, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 1, 0, 0, 1, 1, 0, 1, 1, 0, 1, 0, 1, 0, 0, 0, 0, 1, 1, 0, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 1, 0, 0], [1, 0, 1, 0, 1, 1, 0, 0, 0, 0, 0, 0, 1, 1, 0, 1, 1, 0, 0, 0, 1, 0, 0, 0, 1, 1, 0, 0, 1, 1, 1, 0, 0, 0, 1, 0, 0, 1, 1, 0, 1, 1, 0, 1, 0, 0, 1, 1, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 1, 1, 1, 1, 1], [0, 0, 0, 0, 0, 0, 1, 1, 0, 1, 0, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 1, 1, 0, 1, 1, 1, 1, 1, 0, 0, 1, 1, 1, 0, 1, 1, 0, 1, 1, 0, 1, 1, 0, 1, 0, 0, 0, 1, 0, 1, 1, 0, 1, 1, 1, 0, 1], [1, 1, 0, 1, 1, 0, 0, 0, 1, 1, 0, 1, 0, 0, 0, 1, 0, 0, 0, 1, 1, 0, 1, 1, 0, 1, 1, 1, 0, 1, 1, 0, 1, 0, 1, 1, 0, 0, 1, 1, 0, 0, 0, 1, 1, 1, 0, 1, 1, 1, 0, 0, 0, 0, 0, 1, 1, 1, 1, 0, 1, 0, 1, 0], [1, 1, 0, 1, 0, 1, 1, 1, 0, 0, 0, 0, 1, 1, 0, 0, 0, 1, 1, 1, 0, 0, 0, 1, 0, 1, 1, 0, 1, 1, 1, 0, 1, 0, 0, 0, 0, 1, 1, 1, 1, 1, 1, 0, 0, 1, 0, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 0], [0, 0, 1, 0, 1, 0, 1, 1, 1, 0, 0, 0, 0, 1, 0, 0, 0, 1, 0, 1, 0, 1, 0, 0, 0, 1, 0, 1, 1, 1, 0, 1, 1, 1, 1, 0, 1, 0, 0, 0, 1, 0, 0, 0, 1, 0, 1, 0, 0, 0, 1, 0, 0, 0, 0, 1, 1, 0, 1, 1, 0, 1, 1, 0], [1, 1, 1, 1, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 0, 1, 0, 0, 0, 1, 0, 0, 0, 0, 0, 1, 1, 1, 0, 0, 0, 0, 1, 0, 0, 1, 1, 0, 0, 1, 0, 0, 0, 0, 1, 1, 0, 0, 0, 0, 1, 0, 1, 0, 1, 0, 0, 0, 0, 0, 0, 0, 1, 0], [1, 1, 1, 1, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 1, 1, 1, 0, 1, 1, 0, 1, 1, 0, 1, 1, 0, 1, 1, 0, 1, 0, 1, 1, 1, 1, 1, 1, 1, 0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 1, 0, 0, 1, 0, 1, 1, 0, 1, 0, 1, 0, 0, 0, 1], [1, 1, 0, 1, 0, 0, 0, 0, 0, 1, 0, 0, 0, 1, 1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 1, 1, 1, 0, 1, 0, 0, 1, 1, 1, 0, 0, 0, 1, 1, 1, 1, 1, 0, 1, 0, 1, 0, 0, 1, 0, 1, 0, 1, 0, 1, 1, 0, 0, 1, 1, 1, 1, 1], [1, 0, 0, 0, 0, 1, 1, 1, 1, 1, 0, 1, 0, 0, 1, 0, 1, 1, 0, 1, 0, 1, 0, 1, 1, 0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 1, 0, 1, 1, 1, 0, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1, 0, 1], [0, 1, 1, 0, 1, 1, 1, 1, 0, 1, 1, 0, 0, 1, 0, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 1, 1, 1, 0, 1, 0, 0, 1, 0, 0, 0, 1, 0, 1, 1, 1, 0, 0, 1, 0, 0, 1, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 1, 0, 1, 0, 0, 1, 0], [1, 0, 0, 1, 0, 1, 1, 0, 1, 0, 0, 0, 1, 0, 1, 1, 1, 1, 0, 0, 0, 0, 1, 0, 0, 1, 0, 0, 1, 0, 1, 1, 0, 0, 0, 0, 0, 0, 1, 1, 0, 0, 0, 0, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 1, 1, 1, 1, 0, 1, 0], [0, 1, 1, 1, 0, 1, 1, 0, 1, 0, 0, 0, 0, 1, 0, 1, 1, 0, 1, 1, 0, 0, 1, 1, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 0, 1, 1, 1, 1, 0, 1, 0, 0, 0, 1, 0, 1, 0, 0, 0, 1, 0, 0, 1], [0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 1, 0, 1, 1, 1, 1, 1, 0, 1, 1, 0, 1, 1, 1, 1, 0, 1, 0, 1, 1, 0, 0, 0, 0, 1, 0, 1, 0, 0, 1, 0, 1, 0, 0, 0, 1, 0, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 1, 1, 1], [1, 1, 0, 1, 0, 1, 1, 0, 1, 0, 0, 0, 1, 0, 0, 0, 0, 1, 1, 1, 0, 0, 1, 0, 1, 1, 0, 1, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 0, 0, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 1, 0, 0, 1, 1, 1, 1, 1, 1], [0, 0, 1, 1, 0, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 1, 1, 1, 0, 0, 1, 1, 0, 0, 1, 1, 1, 1, 0, 0, 1, 0, 0, 1, 1, 1, 0, 1, 0, 1, 1, 0, 1, 0, 1, 0, 1, 1, 0, 1, 1, 0, 1, 0, 0, 0, 0], [1, 0, 1, 1, 1, 0, 0, 1, 1, 1, 1, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0, 1, 1, 0, 0, 1, 1, 1, 0, 0, 1, 1, 1, 1, 0, 1, 0, 1, 1, 0, 0, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 1, 0, 0, 1, 0, 1, 0], [0, 0, 1, 0, 0, 1, 1, 1, 0, 0, 0, 0, 1, 1, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 0, 1, 1, 1, 1, 0, 0, 0, 0, 0, 1, 1, 0, 1, 0, 1, 1, 0, 1, 1, 0, 1, 1, 0, 1, 0, 0, 1, 1, 0, 0, 1, 0, 0, 0], [1, 1, 1, 1, 1, 1, 0, 0, 1, 0, 1, 1, 0, 0, 0, 0, 0, 1, 1, 1, 0, 0, 1, 0, 0, 0, 0, 1, 1, 1, 0, 1, 1, 0, 1, 0, 1, 0, 1, 0, 0, 0, 1, 0, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 1, 0, 1, 1, 0, 1, 1, 1, 0], [1, 1, 1, 0, 0, 0, 0, 0, 1, 1, 0, 1, 1, 1, 1, 0, 1, 1, 0, 1, 1, 1, 0, 1, 0, 1, 1, 1, 1, 1, 0, 1, 1, 0, 1, 0, 1, 1, 1, 1, 0, 1, 0, 0, 1, 1, 1, 0, 1, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 1, 1, 1, 0, 1], [0, 1, 1, 1, 0, 1, 1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 1, 1, 0, 1, 0, 1, 0, 1, 1, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0, 1, 0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 0, 1, 0, 1, 1, 1, 0, 0, 1, 1, 0, 0, 0, 1, 1, 0], [0, 0, 1, 1, 0, 0, 0, 0, 1, 1, 1, 0, 0, 0, 0, 1, 0, 1, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 1, 0, 0, 0, 0, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 1, 1, 1, 0, 1, 0, 0, 1, 0, 0, 0, 0, 1, 1, 1, 1, 0, 0, 1], [0, 0, 0, 1, 1, 0, 0, 1, 0, 1, 1, 0, 1, 0, 1, 0, 1, 0, 0, 1, 0, 0, 1, 1, 0, 0, 0, 0, 0, 0, 1, 0, 1, 1, 1, 1, 1, 1, 0, 1, 1, 0, 0, 1, 0, 1, 0, 0, 0, 0, 1, 1, 1, 0, 0, 0, 1, 0, 1, 1, 0, 0, 1, 0], [1, 0, 0, 0, 1, 0, 0, 1, 0, 1, 0, 0, 1, 1, 1, 0, 1, 0, 1, 0, 1, 1, 1, 1, 1, 0, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 1, 0, 0, 0, 1, 1, 1, 0, 1, 0, 0, 1, 0, 0, 0, 1, 0, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0], [1, 0, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 1, 0, 0, 0, 1, 0, 1, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0, 0, 1, 0, 1, 1, 0, 1, 0, 0, 0, 0, 1, 1, 0, 0, 0, 1, 1, 1, 1, 0, 1, 1, 1, 0, 1, 0, 0, 1, 0, 1, 1, 1, 1, 0], [0, 0, 0, 1, 1, 0, 1, 0, 0, 1, 1, 1, 0, 0, 1, 0, 0, 1, 1, 0, 0, 1, 1, 0, 0, 0, 0, 1, 0, 1, 1, 1, 0, 1, 0, 1, 0, 1, 0, 0, 1, 0, 1, 1, 0, 0, 0, 1, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1], [0, 0, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1, 0, 0, 0, 0, 1, 1, 0, 1, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 1, 0, 0, 1, 0, 0, 0, 0, 1, 1, 1, 0, 0, 1, 0, 0, 0, 1, 0, 1, 1, 0, 1, 0, 0, 1, 0, 0, 0, 1, 1], [0, 1, 0, 1, 0, 0, 1, 1, 1, 1, 0, 1, 0, 1, 1, 1, 0, 1, 1, 1, 0, 1, 1, 0, 1, 0, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 1, 0, 1, 0, 1, 0, 0, 1, 0, 1, 0, 0, 1, 0, 1, 1, 1, 0, 0, 1, 0, 1, 0, 0, 1, 1, 1], [1, 0, 1, 0, 1, 0, 0, 1, 0, 1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 0, 0, 1, 1, 0, 0, 0, 0, 0, 1, 1, 0, 0, 0, 1, 0, 0, 1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 0, 0, 1, 0, 0, 1, 0, 0, 1, 0, 1, 1, 0, 0, 0, 1, 0, 0], [0, 0, 1, 1, 0, 1, 1, 0, 0, 0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 1, 0, 0, 0, 0, 0, 1, 1, 1, 0, 1, 1, 0, 1, 0, 0, 1, 1, 0, 1, 1, 0, 1, 0, 1, 1, 1, 0, 1, 0, 1, 1, 0, 0, 1, 0, 1, 1, 1, 0, 0, 1, 0, 1, 1], [0, 1, 0, 0, 1, 0, 1, 1, 0, 1, 0, 1, 0, 0, 0, 0, 0, 1, 0, 0, 1, 1, 1, 0, 1, 0, 1, 1, 0, 1, 0, 0, 0, 0, 0, 1, 1, 0, 1, 1, 0, 0, 0, 0, 0, 0, 0, 1, 0, 1, 1, 1, 0, 0, 0, 1, 0, 0, 0, 1, 0, 1, 0, 1], [1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 0, 0, 1, 1, 1, 0, 1, 0, 1, 1, 0, 1, 1, 1, 1, 0, 1, 1, 1, 0, 0, 0, 0, 0, 1, 1, 1, 0, 0, 0, 0, 1, 1, 1, 1, 0, 1, 1, 0, 0, 1, 0, 0, 0, 1, 0, 0, 0, 1, 0, 0, 0, 1, 0], [1, 1, 1, 0, 0, 0, 1, 0, 0, 0, 0, 0, 1, 1, 1, 1, 0, 1, 0, 1, 0, 1, 0, 0, 1, 0, 1, 1, 1, 1, 1, 1, 0, 1, 0, 1, 0, 0, 0, 1, 1, 0, 1, 1, 1, 0, 0, 1, 1, 0, 0, 0, 0, 0, 1, 1, 0, 1, 0, 1, 0, 1, 0, 1], [0, 0, 1, 0, 1, 1, 0, 0, 1, 1, 0, 1, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1, 0, 1, 0, 1, 0, 0, 1, 0, 0, 1, 1, 1, 1, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 1, 1, 0, 0, 0, 0, 1, 1, 0, 0, 1, 1, 0, 1, 0], [0, 1, 0, 1, 0, 1, 1, 1, 0, 0, 0, 0, 1, 1, 1, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 0, 0, 1, 0, 0, 1, 0, 0, 0, 0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 0, 0, 0, 1, 1, 1, 0, 1, 0, 1, 0, 0, 0, 0, 1, 1], [0, 1, 0, 1, 0, 1, 1, 1, 0, 1, 0, 0, 0, 1, 0, 0, 1, 0, 1, 1, 0, 0, 1, 0, 1, 1, 1, 0, 0, 0, 0, 0, 1, 0, 1, 1, 1, 0, 0, 1, 1, 0, 1, 1, 0, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 1, 0, 0], [1, 0, 1, 0, 0, 0, 1, 1, 1, 0, 1, 1, 0, 0, 0, 1, 0, 0, 1, 0, 0, 1, 1, 0, 0, 0, 1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 1, 0, 1, 1, 1, 1, 0, 1, 0, 1, 0, 0, 1, 0, 0, 0, 0, 0, 0, 1, 1, 0, 1, 0, 0, 1, 1, 1], [0, 0, 0, 0, 0, 0, 1, 1, 0, 1, 0, 0, 0, 1, 1, 0, 1, 1, 1, 0, 1, 1, 0, 1, 0, 1, 1, 0, 1, 1, 1, 0, 1, 0, 0, 0, 0, 1, 1, 0, 0, 1, 0, 0, 0, 0, 0, 1, 0, 1, 1, 0, 0, 1, 1, 1, 0, 1, 0, 1, 1, 0, 1, 0], [0, 0, 1, 1, 0, 1, 0, 1, 1, 0, 1, 0, 0, 1, 1, 0, 0, 1, 0, 0, 0, 1, 0, 0, 0, 0, 1, 1, 0, 0, 0, 0, 1, 0, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 0, 0, 0, 1, 1, 1, 1, 1, 1, 0, 1, 0, 1, 1, 1, 0, 1], [1, 1, 1, 1, 1, 0, 1, 0, 1, 1, 0, 0, 1, 1, 0, 1, 1, 1, 1, 0, 1, 0, 1, 1, 1, 1, 1, 0, 1, 1, 0, 0, 0, 0, 0, 1, 1, 0, 0, 1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 1, 0, 0, 0, 0, 1, 1, 1, 1, 1, 0], [1, 0, 0, 1, 0, 1, 0, 1, 1, 0, 1, 0, 1, 1, 1, 0, 1, 0, 0, 0, 0, 0, 1, 0, 1, 1, 0, 0, 0, 1, 0, 1, 0, 1, 1, 1, 0, 1, 0, 1, 1, 1, 1, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 1, 0, 0, 0, 0, 1], [0, 1, 0, 1, 0, 1, 1, 0, 0, 0, 1, 1, 1, 0, 1, 1, 1, 1, 0, 0, 1, 1, 1, 1, 1, 0, 0, 1, 0, 1, 1, 1, 1, 1, 0, 0, 0, 1, 0, 0, 0, 1, 1, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0], [0, 1, 0, 0, 1, 1, 0, 0, 1, 1, 0, 0, 0, 1, 0, 1, 0, 1, 1, 0, 0, 1, 0, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 0, 1, 1, 0, 1, 1, 1, 0, 1, 0, 1, 0, 1, 0, 0, 0, 1, 1, 1, 0, 1, 1, 1, 1, 0, 0, 1, 0, 0, 0, 1], [0, 1, 0, 0, 0, 1, 0, 0, 1, 1, 1, 0, 1, 1, 0, 1, 1, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 1, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 0, 0, 0, 0, 0, 1, 1, 0, 1, 0, 1, 0, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 1], [0, 0, 1, 1, 1, 1, 1, 1, 0, 0, 1, 0, 1, 0, 0, 0, 0, 0, 0, 1, 0, 1, 0, 0, 0, 1, 1, 0, 0, 1, 0, 0, 1, 1, 1, 1, 1, 0, 1, 0, 1, 0, 0, 1, 0, 1, 1, 1, 1, 0, 1, 0, 1, 1, 1, 0, 0, 0, 0, 1, 1, 1, 0, 1], [1, 0, 0, 1, 1, 1, 1, 0, 0, 0, 1, 1, 1, 1, 0, 0, 0, 1, 1, 1, 0, 0, 1, 1, 1, 0, 0, 1, 1, 0, 0, 0, 1, 1, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1], [1, 1, 1, 1, 1, 1, 1, 0, 1, 0, 0, 0, 1, 1, 0, 0, 0, 0, 0, 0, 1, 1, 0, 1, 0, 0, 0, 1, 0, 0, 0, 0, 1, 1, 1, 1, 0, 1, 1, 0, 0, 1, 0, 0, 1, 0, 0, 0, 0, 1, 0, 1, 1, 1, 1, 1, 1, 0, 0, 1, 1, 1, 1, 0], [0, 0, 1, 0, 1, 0, 1, 0, 0, 0, 0, 1, 0, 0, 0, 1, 0, 1, 1, 0, 0, 0, 0, 1, 1, 0, 0, 1, 0, 1, 1, 0, 0, 1, 1, 1, 1, 0, 1, 0, 1, 1, 1, 0, 1, 1, 0, 0, 0, 1, 1, 0, 1, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1, 1], [0, 0, 1, 1, 0, 1, 0, 0, 1, 0, 1, 0, 1, 0, 1, 1, 1, 1, 0, 1, 1, 1, 1, 0, 0, 0, 1, 0, 1, 1, 1, 0, 0, 1, 1, 0, 1, 0, 1, 0, 1, 1, 1, 1, 0, 1, 0, 1, 0, 0, 1, 0, 0, 0, 1, 0, 0, 0, 0, 0, 1, 1, 1, 1], [1, 0, 0, 1, 1, 0, 1, 1, 1, 1, 0, 1, 1, 0, 0, 0, 1, 0, 1, 0, 1, 1, 1, 1, 1, 1, 0, 0, 0, 1, 0, 1, 1, 1, 0, 1, 0, 0, 1, 1, 1, 0, 1, 1, 1, 0, 0, 0, 1, 0, 1, 0, 0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 1, 0], [0, 0, 0, 0, 1, 1, 0, 0, 1, 0, 1, 0, 0, 1, 1, 1, 0, 0, 0, 0, 1, 1, 1, 1, 0, 0, 1, 1, 1, 1, 1, 0, 0, 1, 1, 1, 0, 1, 0, 1, 1, 0, 1, 0, 1, 0, 0, 1, 0, 1, 0, 0, 0, 1, 0, 1, 1, 1, 1, 0, 1, 0, 0, 1], [1, 0, 0, 0, 1, 0, 0, 1, 1, 0, 1, 1, 1, 1, 1, 0, 0, 0, 1, 1, 0, 0, 0, 0, 1, 1, 0, 0, 1, 1, 0, 0, 0, 1, 1, 1, 1, 0, 0, 0, 1, 0, 1, 0, 1, 0, 1, 0, 1, 1, 1, 1, 1, 1, 0, 1, 0, 1, 1, 1, 1, 0, 1, 0], [1, 0, 0, 1, 1, 0, 0, 1, 0, 1, 1, 0, 1, 0, 1, 1, 1, 1, 0, 0, 1, 1, 0, 1, 1, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 1, 1, 1, 0, 0, 0, 0, 1, 1, 0, 0, 1, 1, 0, 1, 1, 1, 0, 0, 1, 0, 0, 0], [1, 0, 1, 0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 1, 0, 1, 0, 1, 1, 0, 0, 0, 1, 1, 0, 1, 1, 1, 1, 0, 0, 1, 1, 1, 1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 0, 0, 1, 0, 0, 0, 0, 0, 1, 0, 0, 0], [0, 0, 0, 0, 1, 1, 1, 1, 0, 0, 0, 0, 0, 1, 1, 1, 0, 0, 1, 1, 0, 1, 0, 1, 1, 1, 1, 1, 0, 1, 1, 0, 0, 1, 1, 0, 1, 0, 0, 0, 1, 0, 0, 0, 1, 1, 1, 0, 0, 1, 1, 1, 1, 1, 0, 1, 0, 1, 0, 1, 1, 1, 1, 1], [0, 0, 0, 1, 0, 1, 1, 0, 1, 1, 1, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 0, 0, 1, 0, 1, 0, 0, 0, 1, 0, 1, 0, 1, 1, 0, 1, 1, 0, 0, 1, 0, 0, 1, 1, 1, 1, 0, 1, 0, 0, 1, 1, 1, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1], [0, 1, 0, 0, 1, 0, 0, 1, 1, 0, 0, 1, 0, 0, 0, 1, 0, 0, 1, 0, 1, 0, 0, 0, 1, 0, 0, 0, 1, 1, 1, 0, 0, 0, 0, 1, 1, 0, 0, 0, 0, 0, 1, 1, 0, 0, 1, 0, 1, 1, 0, 1, 1, 0, 1, 1, 0, 0, 1, 1, 0, 1, 0, 0], [1, 1, 1, 1, 1, 0, 1, 0, 0, 0, 0, 1, 1, 0, 0, 0, 0, 1, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 0, 1, 1, 0, 1, 0, 0, 1, 0, 1, 0, 0, 1, 0, 0, 0, 0, 1, 1, 0, 0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1], [1, 0, 0, 1, 0, 1, 0, 0, 0, 1, 0, 0, 0, 0, 1, 1, 0, 1, 0, 0, 1, 1, 0, 0, 0, 0, 1, 0, 1, 1, 0, 1, 0, 0, 1, 0, 1, 0, 0, 0, 1, 1, 1, 1, 1, 1, 0, 0, 0, 1, 1, 0, 1, 1, 0, 0, 0, 0, 1, 1, 0, 1, 1, 0], [1, 1, 1, 0, 1, 1, 1, 0, 0, 0, 1, 0, 0, 1, 1, 0, 1, 1, 0, 1, 1, 1, 1, 0, 0, 1, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 1, 1, 1, 1, 0, 0, 0, 0, 1, 1, 0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0, 0], [0, 1, 1, 0, 0, 0, 0, 0, 0, 1, 0, 1, 1, 0, 0, 1, 0, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 0, 0, 0, 1, 1, 0, 1, 0, 0, 1, 0, 1, 0, 1, 1, 1, 0, 1, 0, 0, 0, 0, 0, 0, 1, 0, 0, 1, 1, 0, 0, 0, 1, 1], [1, 1, 1, 1, 0, 1, 0, 1, 0, 0, 0, 1, 0, 0, 0, 1, 1, 0, 1, 1, 0, 0, 1, 1, 0, 1, 0, 1, 0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 1, 0, 0, 0, 1, 0, 1, 0, 1, 1, 1, 0, 1, 1, 0, 1, 1, 0, 0, 1, 1, 1, 0, 0, 0, 1], [0, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 0, 0, 1, 1, 1, 0, 1, 1, 0, 0, 0, 0, 0, 0, 1, 0, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 0, 1, 0, 1, 0, 1, 1, 1, 0, 0, 0, 0, 1, 1, 0, 1, 0], [1, 1, 0, 0, 0, 1, 0, 0, 1, 1, 1, 0, 1, 0, 0, 0, 0, 0, 0, 1, 0, 0, 1, 0, 1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 0, 0, 1, 0, 0, 1, 1, 1, 0, 0, 0, 1, 0, 0, 1, 0, 1, 0, 0, 0, 1, 1, 1, 1, 1, 0, 1, 0, 1, 1], [0, 1, 0, 1, 1, 0, 0, 1, 1, 1, 1, 0, 0, 0, 0, 0, 1, 0, 0, 1, 1, 1, 0, 0, 1, 1, 1, 0, 0, 1, 1, 1, 1, 0, 1, 1, 1, 0, 0, 1, 0, 0, 1, 0, 1, 1, 0, 1, 1, 0, 1, 1, 1, 0, 1, 1, 0, 1, 1, 1, 1, 0, 1, 0], [0, 1, 1, 0, 0, 1, 1, 0, 0, 1, 1, 0, 0, 0, 0, 1, 0, 0, 1, 1, 1, 1, 0, 1, 1, 1, 0, 0, 1, 1, 0, 0, 1, 1, 1, 0, 0, 1, 0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 1, 1, 1, 0, 1, 0, 1, 1, 1, 1, 1, 0, 1, 1, 0, 0], [0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 1, 1, 1, 0, 1, 1, 0, 1, 0, 1, 0, 1, 1, 1, 0, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 0, 1, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 0], [1, 1, 0, 1, 0, 0, 0, 1, 0, 1, 1, 0, 1, 1, 0, 1, 1, 0, 0, 1, 1, 0, 1, 0, 0, 1, 1, 1, 1, 1, 0, 0, 1, 1, 0, 0, 0, 1, 1, 0, 1, 1, 0, 0, 0, 0, 0, 0, 0, 1, 1, 0, 0, 1, 0, 1, 1, 1, 1, 1, 1, 0, 0, 0], [1, 0, 1, 0, 1, 0, 1, 1, 1, 1, 0, 1, 0, 1, 1, 1, 0, 0, 1, 0, 1, 0, 0, 1, 1, 1, 0, 0, 1, 1, 1, 0, 1, 1, 1, 0, 1, 0, 1, 1, 1, 1, 1, 0, 0, 1, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 1, 0, 1, 0, 0, 0, 1, 0], [1, 1, 0, 0, 0, 1, 1, 1, 0, 1, 1, 1, 1, 1, 0, 0, 0, 0, 1, 0, 0, 0, 1, 0, 0, 1, 0, 1, 1, 1, 0, 0, 1, 0, 1, 1, 1, 1, 1, 0, 1, 1, 0, 0, 1, 1, 0, 1, 0, 0, 1, 1, 1, 1, 0, 0, 1, 1, 1, 1, 0, 0, 0, 0], [0, 1, 1, 0, 0, 1, 0, 1, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 0, 1, 1, 0, 0, 1, 0, 0, 1, 0, 1, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 1, 1, 1, 0, 0, 0, 1, 1, 1, 0, 1, 1, 1, 1, 0, 0, 1, 1, 1, 1], [1, 0, 0, 1, 0, 1, 1, 1, 1, 0, 0, 1, 1, 0, 0, 0, 1, 0, 0, 1, 0, 1, 0, 0, 1, 0, 1, 1, 1, 1, 1, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 1, 1, 1, 1], [1, 1, 0, 0, 1, 1, 1, 1, 1, 1, 0, 1, 1, 0, 1, 1, 0, 0, 1, 1, 1, 1, 1, 0, 1, 1, 0, 0, 0, 0, 0, 1, 1, 1, 0, 1, 0, 0, 0, 0, 1, 1, 1, 1, 0, 0, 1, 0, 0, 1, 1, 0, 1, 1, 1, 1, 1, 0, 1, 1, 1, 0, 1, 1], [1, 0, 1, 1, 1, 0, 0, 1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 0, 1, 0, 0, 0, 0, 1, 0, 1, 0, 0, 1, 0, 1, 1, 0, 0, 1, 0, 1, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 1, 0, 1, 0, 0, 1, 0, 1], [0, 0, 1, 1, 0, 0, 1, 0, 1, 0, 0, 1, 0, 0, 0, 0, 1, 0, 1, 0, 0, 1, 0, 1, 1, 1, 0, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 1, 0, 0, 1, 0, 1, 1, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 1, 0, 1, 0, 0], [1, 0, 0, 0, 1, 1, 0, 1, 0, 0, 1, 0, 1, 0, 0, 0, 0, 1, 1, 0, 0, 1, 1, 0, 0, 0, 1, 1, 0, 1, 0, 1, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 0, 1, 0, 0, 0, 1, 0, 1, 0, 0, 0, 0], [0, 1, 1, 0, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 0, 1, 0, 0, 0, 1, 1, 0, 1, 1, 0, 0, 1, 1, 1, 1, 1, 0, 1, 0, 1, 1, 1, 1, 0, 1, 0, 0, 0, 1, 1, 1, 1, 0, 0, 1, 1, 1, 1, 1, 0, 0, 1, 1, 0, 1, 1, 1, 0, 1], [0, 1, 1, 1, 0, 1, 1, 0, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 1, 1, 0, 0, 0, 0, 0, 1, 1, 0, 0, 1, 0, 0, 1, 1, 1, 1, 0, 1, 0, 1, 0, 1, 0, 1, 1, 0, 0, 0, 0, 0, 1, 1, 0, 1, 0, 0, 0, 0, 1, 0, 1, 0, 0, 1], [1, 1, 0, 0, 0, 1, 0, 1, 1, 1, 1, 1, 1, 1, 0, 0, 1, 1, 0, 0, 0, 1, 1, 0, 1, 0, 1, 1, 1, 1, 1, 1, 0, 1, 0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 1, 0, 1, 0, 0, 0, 0, 0, 0, 0, 1, 1, 0, 1, 1, 0, 1, 0, 0, 0], [1, 1, 0, 0, 0, 1, 1, 0, 1, 0, 0, 0, 1, 0, 1, 1, 1, 1, 0, 1, 1, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 1, 1, 1, 1, 0, 0, 0, 0, 1, 1, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 1, 0, 0, 1, 1, 1, 1, 1, 0, 0, 1, 1], [0, 0, 0, 1, 0, 0, 0, 1, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0, 0, 1, 0, 1, 0, 1, 1, 1, 0, 0, 0, 1, 0, 1, 0, 1, 1, 0, 1, 1, 1, 0, 0, 1, 1, 0, 0, 1, 1, 0, 1, 0, 0, 1, 1, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0, 1], [0, 1, 1, 0, 0, 0, 0, 1, 1, 0, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 1, 0, 1, 1, 0, 1, 0, 1, 0, 0, 0, 1, 1, 1, 0, 1, 1, 0, 0, 0, 1, 1, 0, 1, 0, 1, 0, 0, 0, 0, 0, 0, 1], [1, 0, 1, 1, 1, 1, 0, 1, 1, 0, 1, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 1, 1, 0, 1, 1, 0, 0, 1, 0, 0, 1, 1, 1, 0, 0, 0, 0, 0, 0, 1, 1, 1, 0, 1, 1], [1, 0, 0, 1, 1, 1, 1, 0, 1, 0, 1, 1, 1, 1, 0, 1, 0, 0, 1, 0, 1, 0, 0, 0, 0, 1, 0, 0, 1, 1, 1, 1, 0, 0, 0, 0, 1, 0, 1, 0, 1, 1, 0, 0, 0, 0, 1, 0, 0, 0, 1, 0, 1, 0, 0, 0, 1, 1, 0, 1, 1, 0, 1, 0], [1, 1, 1, 0, 1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 0, 1, 0, 0, 0, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 0, 1, 0, 0, 0, 0, 1, 1, 0, 1, 1, 1, 1, 1, 0, 1, 0, 0, 0, 1, 0, 1, 1, 1, 0], [0, 1, 0, 0, 0, 0, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 1, 0, 1, 0, 0, 1, 0, 0, 1, 0, 1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 0, 1, 0, 0, 0, 1, 0, 0, 1, 0, 1, 1, 1, 1], [1, 0, 0, 1, 1, 0, 0, 0, 1, 1, 1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 1, 0, 1, 0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 1, 0, 0, 1, 1, 1, 0, 1, 1, 1, 1, 0, 0, 1, 1, 0, 1, 1, 0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 1, 0, 0], [0, 1, 0, 0, 0, 1, 0, 0, 1, 0, 0, 1, 1, 0, 0, 0, 0, 1, 0, 0, 1, 0, 0, 1, 1, 0, 1, 1, 0, 1, 0, 0, 0, 0, 0, 0, 0, 1, 1, 0, 0, 0, 0, 1, 1, 1, 0, 0, 0, 1, 1, 0, 0, 0, 0, 1, 1, 1, 0, 1, 1, 0, 1, 0], [0, 0, 1, 0, 0, 0, 1, 0, 0, 1, 0, 1, 1, 0, 1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 1, 0, 0, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 0, 0, 1, 0, 1, 0, 0, 0, 1, 1, 1, 1, 1, 0, 1, 0, 0, 1, 1, 1, 1], [1, 1, 1, 0, 0, 1, 0, 0, 1, 1, 0, 0, 0, 1, 1, 1, 1, 1, 0, 1, 0, 0, 1, 1, 1, 1, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 1, 0, 1, 0, 0, 0, 0, 1, 0, 0, 0, 1, 1, 1, 0, 0, 0, 0, 1, 1, 0, 0, 1, 1, 0, 0, 0, 1], [0, 0, 1, 0, 1, 1, 0, 1, 0, 1, 1, 0, 0, 1, 0, 0, 0, 1, 0, 0, 1, 0, 1, 1, 0, 0, 0, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 0, 1, 1, 1, 1, 1, 1, 0, 0, 1, 0, 1, 0, 1, 0, 1, 0, 1], [1, 1, 0, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1, 0, 1, 0, 1, 0, 0, 0, 0, 1, 0, 0, 0, 1, 1, 0, 0, 1, 0, 0, 1, 0, 0, 0, 0, 1, 1, 0, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 1, 0, 1, 0, 0, 0, 0, 1, 0], [1, 0, 0, 0, 1, 0, 1, 1, 0, 1, 1, 0, 0, 1, 1, 0, 1, 0, 0, 0, 0, 1, 0, 0, 0, 1, 1, 0, 1, 0, 1, 1, 0, 1, 1, 0, 1, 0, 0, 1, 0, 1, 0, 1, 1, 0, 1, 1, 0, 0, 1, 0, 1, 1, 0, 1, 0, 0, 0, 1, 1, 1, 1, 0], [1, 1, 0, 0, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 0, 0, 0, 1, 1, 1, 0, 0, 1, 0, 0, 0, 1, 1, 0, 1, 0, 1, 0, 1, 1, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 0, 0, 0, 1, 1, 0, 1, 1, 0, 1, 1, 0], [1, 0, 1, 0, 0, 0, 0, 1, 1, 0, 0, 0, 1, 0, 0, 0, 0, 1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 1, 0, 1, 1, 1, 1, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 1, 0, 1, 1, 1, 1, 1, 1, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 0, 1], [0, 1, 0, 1, 0, 0, 1, 0, 1, 0, 1, 1, 0, 0, 1, 1, 1, 0, 1, 0, 1, 0, 1, 0, 1, 1, 1, 1, 1, 0, 1, 0, 0, 0, 1, 1, 1, 1, 1, 1, 0, 0, 1, 0, 0, 1, 1, 1, 1, 0, 1, 0, 1, 0, 0, 1, 0, 0, 0, 1, 0, 0, 1, 0], [1, 1, 0, 0, 0, 0, 1, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 1, 1, 1, 0, 0, 1, 1, 0, 0, 0, 0, 0, 1, 0, 1, 1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 1, 1, 0, 0], [1, 0, 1, 0, 1, 1, 0, 0, 0, 0, 0, 0, 1, 1, 1, 0, 1, 1, 1, 0, 0, 1, 0, 0, 0, 1, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 0, 1, 1, 0, 0, 1, 1, 1], [1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 1, 1, 1, 1, 0, 0, 1, 1, 1, 1, 0, 1, 1, 1, 0, 1, 0, 0, 0, 0, 0, 1, 1, 0, 1, 0, 1, 0, 1, 0, 0, 0, 0, 0, 1, 0, 1, 0, 1, 1, 1, 0, 1, 1, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1], [0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 1, 0, 1, 0, 1, 1, 1, 0, 1, 0, 0, 0, 0, 1, 1, 1, 1, 1, 0, 1, 1, 0, 0, 1, 1, 0, 1, 1, 0, 1, 0, 0, 1, 1, 1, 0, 1, 0, 0, 1, 0, 0, 0], [0, 1, 1, 0, 1, 0, 0, 0, 1, 0, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 1, 0, 1, 1, 1, 0, 0, 0, 1, 1, 1, 0, 1, 1, 1, 0, 1, 0, 1, 1, 0, 1, 0, 1, 1, 1, 1, 0, 0, 0, 1, 0, 1, 0, 1, 1, 0, 1, 1, 0, 1, 1], [1, 1, 0, 1, 0, 1, 1, 1, 0, 0, 0, 1, 1, 1, 1, 0, 1, 0, 1, 0, 1, 0, 0, 1, 1, 1, 0, 1, 1, 0, 1, 1, 0, 1, 0, 1, 0, 0, 0, 1, 0, 0, 0, 0, 1, 1, 1, 0, 0, 1, 0, 0, 0, 0, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1], [1, 1, 1, 0, 0, 1, 0, 0, 1, 1, 0, 0, 1, 0, 0, 1, 1, 1, 0, 0, 1, 0, 1, 1, 1, 1, 1, 0, 0, 0, 1, 0, 0, 1, 0, 1, 0, 0, 1, 1, 1, 1, 0, 1, 0, 0, 0, 0, 1, 1, 1, 1, 1, 0, 0, 1, 0, 1, 0, 1, 0, 1, 1, 0], [1, 0, 0, 1, 0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1, 0, 1, 0, 1, 0, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1, 0, 0, 0, 1, 1, 0, 0, 0, 1, 1, 0, 1, 0, 1, 0, 1, 1, 1, 0, 0, 1, 0, 0, 1, 1, 1, 0, 0, 0, 0, 0, 0], [1, 0, 1, 1, 0, 0, 1, 1, 1, 1, 1, 0, 1, 0, 1, 1, 1, 0, 1, 1, 1, 0, 0, 1, 0, 0, 1, 1, 0, 1, 1, 0, 0, 1, 1, 0, 0, 1, 1, 1, 0, 1, 0, 1, 1, 0, 1, 0, 1, 1, 1, 0, 1, 1, 0, 0, 1, 1, 1, 1, 0, 1, 0, 0], [1, 0, 1, 0, 0, 0, 0, 0, 1, 1, 0, 0, 1, 1, 1, 1, 1, 0, 0, 1, 0, 1, 0, 0, 0, 1, 0, 1, 1, 0, 0, 0, 1, 1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 0, 1, 1, 1, 0, 1, 0, 1, 0, 1, 0, 0, 1, 0, 0, 1, 1, 1, 0, 1, 1], [0, 1, 0, 1, 0, 0, 0, 1, 0, 1, 1, 0, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 0, 0, 1, 1, 0, 0, 1, 0, 1, 0, 1, 0, 1, 1, 1, 0, 1, 1, 0, 0, 0, 0, 1, 1, 0, 1, 0, 1, 0, 1, 0, 0, 1, 1, 1, 1, 1, 1, 0], [0, 0, 1, 1, 1, 0, 1, 1, 0, 0, 0, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 1, 1, 1, 0, 0, 0, 1, 1, 0, 1, 1, 1, 0, 0, 0, 1, 1, 1, 0, 1, 0, 1, 1, 1, 0, 1, 0, 0, 1, 1, 1, 0, 1], [1, 1, 0, 0, 0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 0, 0, 1, 0, 1, 0, 0, 0, 0, 1, 0, 1, 0, 1, 1, 0, 0, 0, 0, 1, 0, 0, 0, 1, 1, 0, 1, 0, 1, 0, 0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 1, 1, 1, 0, 0, 0, 0, 1, 0, 0], [1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 1, 1, 1, 0, 0, 1, 0, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 1, 1, 1, 0, 0, 1, 1, 0, 1, 0, 1, 1, 0, 0, 1, 1, 0, 1, 1, 0, 0, 1, 1, 1, 1, 0, 0, 1, 0, 0, 1, 1, 0, 1, 1, 0, 0], [1, 0, 0, 0, 0, 1, 0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 1, 0, 1, 0, 1, 0, 0, 1, 0, 0, 1, 1, 1, 0, 1, 1, 1, 1, 1, 0, 0, 1, 1, 1, 0, 1, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0, 1, 1, 1, 1, 0, 1, 1, 0, 1, 1, 0, 1], [1, 1, 0, 1, 1, 0, 0, 1, 1, 0, 1, 0, 1, 1, 0, 0, 1, 0, 1, 0, 1, 0, 1, 1, 1, 1, 1, 0, 0, 1, 0, 0, 1, 1, 0, 0, 0, 1, 0, 0, 1, 0, 0, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1, 0, 1, 0, 0, 1, 0, 1, 0, 0], [1, 1, 1, 0, 1, 1, 0, 0, 0, 0, 0, 0, 1, 0, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 0, 1, 1, 0, 1, 0, 0, 0, 1, 0, 1, 1, 0, 0, 0, 0, 0, 1, 1, 1, 0, 0, 0, 0, 1, 0, 1, 1, 1, 1, 1, 0, 1, 0], [1, 1, 0, 0, 0, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 1, 1, 0, 0, 0, 1, 0, 0, 0, 1, 1, 0, 1, 1, 0, 1, 1, 0, 1, 0, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 0, 0, 1, 0, 0, 0, 1, 1, 1, 0, 1, 1, 1, 0, 1, 0, 0, 0, 0], [1, 0, 1, 0, 0, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 1, 1, 0, 0, 0, 0, 1, 1, 0, 0, 1, 0, 0, 0, 1, 0, 0, 0, 0, 1, 1, 0, 1, 1, 0, 1, 1, 1, 0, 1, 0, 1, 0, 0, 0, 1, 0, 0, 0, 1, 1, 0, 0, 0, 1, 1], [0, 0, 0, 1, 0, 1, 1, 1, 0, 0, 1, 0, 1, 0, 1, 0, 1, 0, 1, 1, 1, 1, 0, 0, 0, 1, 1, 1, 0, 1, 0, 0, 1, 1, 1, 0, 1, 1, 1, 1, 1, 0, 0, 1, 1, 1, 0, 1, 0, 0, 0, 1, 1, 0, 1, 1, 1, 0, 0, 0, 0, 1, 0, 0], [0, 0, 1, 1, 1, 0, 0, 0, 0, 1, 0, 1, 1, 0, 1, 1, 0, 1, 1, 1, 0, 1, 0, 0, 0, 1, 1, 1, 1, 1, 0, 0, 1, 0, 1, 1, 0, 0, 0, 1, 1, 1, 1, 1, 1, 0, 1, 1, 0, 1, 0, 0, 0, 1, 0, 0, 0, 0, 0, 1, 1, 0, 0, 0], [0, 0, 1, 0, 1, 0, 0, 0, 0, 1, 0, 1, 0, 0, 0, 1, 1, 0, 0, 0, 1, 0, 0, 0, 0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1, 0, 0, 1, 1, 1, 0, 0, 0, 0, 0, 0, 1, 0, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 0, 1, 1], [1, 0, 1, 1, 1, 1, 0, 0, 0, 1, 1, 1, 0, 0, 0, 1, 1, 1, 0, 0, 0, 1, 1, 0, 1, 0, 1, 0, 0, 1, 0, 0, 0, 1, 1, 0, 1, 0, 1, 0, 0, 0, 0, 0, 1, 0, 1, 1, 0, 0, 1, 1, 1, 0, 0, 1, 0, 1, 1, 0, 0, 0, 1, 0], [0, 0, 1, 1, 0, 0, 1, 1, 1, 1, 0, 0, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1, 0, 0, 1, 1, 1, 0, 0, 0, 1, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 1, 1, 0, 1, 1, 0, 1, 1, 0, 1, 0, 0, 1, 1, 1, 1, 0, 0, 0, 1, 1], [0, 0, 0, 0, 1, 0, 1, 0, 1, 0, 0, 0, 1, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 1, 0, 1, 0, 0, 0, 1, 0, 1, 1, 0, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 1, 0, 0], [0, 1, 0, 0, 1, 0, 0, 1, 1, 1, 0, 1, 1, 0, 1, 0, 1, 0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 0, 0, 0, 0, 0, 1, 1, 1, 0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 1, 0, 1, 0, 1, 1, 1, 1, 1, 0, 0, 0, 0, 1, 0, 0, 1, 1, 0], [0, 1, 0, 1, 1, 1, 0, 0, 1, 0, 0, 0, 1, 0, 1, 0, 0, 0, 0, 1, 1, 0, 0, 0, 0, 1, 1, 0, 1, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 0, 0, 1, 1, 0, 1, 1, 1, 0, 0, 1, 0, 0, 0, 0, 0, 1, 0, 1, 1, 1, 0, 0, 0, 1], [0, 1, 0, 0, 0, 0, 1, 1, 0, 0, 1, 0, 0, 0, 0, 0, 1, 1, 0, 1, 0, 1, 1, 0, 0, 1, 1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 1, 0, 1, 1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 1, 0, 1, 0, 1, 0, 0, 1, 0, 1, 1, 1, 0, 0], [1, 0, 0, 0, 0, 1, 1, 1, 1, 0, 1, 1, 0, 0, 0, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 1, 0, 0, 1, 1, 1, 0, 1, 1, 0, 0, 0, 1, 0, 1, 0, 1, 0, 0, 0, 0, 1, 0, 1, 0, 0, 0, 1, 0, 1, 0, 1, 0, 0, 0], [1, 1, 0, 0, 0, 1, 1, 1, 0, 1, 1, 1, 0, 1, 0, 0, 1, 0, 1, 0, 0, 1, 0, 1, 1, 0, 0, 1, 1, 0, 1, 0, 1, 1, 0, 0, 0, 0, 0, 0, 0, 1, 1, 0, 1, 0, 1, 1, 0, 1, 1, 1, 0, 1, 0, 0, 1, 0, 1, 0, 1, 0, 0, 0], [1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1, 1, 0, 1, 0, 0, 0, 0, 0, 0, 1, 0, 1, 0, 0, 1, 0, 1, 0, 0, 1, 0, 1, 0, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0, 1, 1, 0, 1, 1, 0, 0, 1], [1, 1, 0, 1, 0, 1, 0, 1, 1, 1, 1, 1, 0, 1, 0, 1, 1, 1, 1, 1, 0, 0, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 1, 1, 1, 1, 0, 1, 0, 0, 1, 1, 1, 1, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 1, 0, 0, 0, 0, 1, 0, 0, 0, 1], [1, 0, 1, 0, 0, 0, 0, 1, 0, 1, 1, 1, 0, 0, 0, 0, 1, 1, 0, 0, 1, 0, 0, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 1, 1, 0, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 1, 0], [0, 1, 1, 1, 0, 1, 1, 0, 1, 0, 1, 0, 0, 0, 0, 0, 1, 0, 1, 1, 0, 0, 0, 1, 0, 0, 0, 1, 1, 0, 0, 1, 1, 1, 0, 0, 0, 1, 1, 0, 1, 0, 0, 1, 1, 0, 0, 1, 1, 0, 0, 1, 1, 0, 1, 1, 1, 1, 0, 1, 0, 0, 0, 1], [1, 1, 0, 0, 1, 0, 1, 0, 0, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 1, 1, 0, 0, 0, 0, 0, 1, 1, 1, 1, 0, 1, 0, 0, 1, 1, 1, 1, 0, 0, 1, 1, 0, 0, 0, 1, 0, 0, 0, 0, 1, 1, 0, 1, 1, 1, 0, 1, 0, 0, 1, 0, 1, 0], [1, 1, 1, 1, 0, 1, 1, 1, 0, 0, 0, 1, 1, 1, 0, 0, 1, 0, 1, 0, 0, 1, 0, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 1, 0, 0, 1, 0, 1, 1, 0, 1, 0, 1, 1, 1, 0, 1, 0, 1, 0, 0, 0, 0, 1, 0, 0, 1, 1, 0, 0, 1, 0, 1], [0, 0, 0, 1, 0, 1, 0, 0, 1, 0, 1, 1, 0, 0, 0, 1, 1, 0, 1, 0, 1, 0, 1, 1, 1, 0, 1, 0, 1, 0, 0, 0, 1, 1, 0, 0, 1, 0, 0, 0, 1, 0, 0, 1, 0, 1, 0, 0, 0, 1, 0, 1, 1, 1, 1, 0, 0, 1, 1, 0, 1, 0, 1, 0], [1, 0, 0, 0, 0, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 1, 1, 1, 0, 0, 0, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 0, 0, 0, 0, 1, 1, 0, 1, 0, 1, 1, 0, 0, 1, 1, 1, 0, 0, 1, 1, 1, 0, 0, 1, 0, 1], [0, 1, 1, 1, 0, 1, 0, 0, 0, 0, 1, 1, 0, 0, 0, 1, 0, 1, 0, 1, 0, 0, 0, 1, 1, 1, 0, 0, 1, 0, 1, 1, 0, 1, 0, 1, 1, 0, 1, 0, 0, 0, 1, 1, 1, 0, 0, 1, 0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 0, 1, 0, 0], [0, 0, 1, 1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 1, 1, 0, 0, 0, 0, 0, 1, 0, 1, 0, 0, 1, 0, 0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 1, 1, 0, 1, 0, 0, 1, 1, 1, 1, 0, 0, 1, 0, 1, 1, 0, 1, 0, 0, 1, 1, 0, 0, 1, 0, 1], [0, 0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 0, 1, 0, 1, 1, 1, 0, 0, 0, 0, 1, 0, 0, 1, 1, 1, 0, 0, 0, 1, 0, 1, 0, 1, 0, 1, 1, 0, 1, 1, 0, 1, 0, 1, 0, 0, 0, 1, 0, 1, 0, 1, 1, 1, 0], [0, 0, 0, 0, 1, 1, 1, 1, 0, 0, 0, 1, 0, 1, 1, 1, 0, 1, 0, 1, 1, 0, 0, 1, 1, 0, 1, 0, 1, 1, 1, 0, 1, 0, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 0, 1, 0, 1, 0, 1, 1, 1, 1, 0, 1, 1, 0, 1, 0], [1, 0, 0, 1, 0, 0, 1, 1, 0, 1, 0, 1, 1, 1, 0, 1, 1, 0, 1, 0, 0, 1, 1, 1, 0, 1, 1, 1, 0, 0, 1, 1, 1, 1, 0, 1, 0, 1, 0, 0, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 0, 1, 0, 0, 1, 0, 0, 0, 1, 0, 1, 0, 1, 1], [0, 1, 1, 1, 1, 0, 0, 1, 0, 1, 0, 1, 0, 1, 0, 0, 1, 1, 1, 0, 1, 1, 1, 0, 0, 0, 0, 1, 0, 0, 1, 1, 0, 1, 0, 0, 1, 1, 1, 1, 0, 0, 0, 1, 0, 1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0], [1, 0, 1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0, 1, 1, 0, 1, 1, 0, 0, 1, 0, 0, 0, 1, 0, 0, 1, 0, 1, 1, 0, 0, 0, 0, 1, 0, 0, 0, 1, 0, 1, 0, 0, 1, 0, 1, 0, 1, 0, 1, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 0], [1, 1, 1, 0, 0, 1, 1, 0, 1, 1, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 1, 1, 1, 0, 0, 0, 1, 0, 0, 1, 0, 0, 1, 1, 1, 0, 0, 0, 0, 0, 1, 1, 0, 0, 0, 1, 1, 0, 1, 0, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 1, 1, 1], [1, 0, 0, 0, 1, 0, 0, 0, 0, 0, 1, 0, 1, 1, 0, 1, 0, 1, 0, 0, 0, 1, 1, 1, 1, 0, 0, 0, 1, 1, 0, 0, 0, 1, 0, 1, 0, 1, 0, 0, 1, 0, 1, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 0], [0, 0, 0, 1, 1, 0, 1, 0, 0, 1, 1, 1, 1, 1, 0, 1, 1, 0, 0, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1, 0, 0, 1, 1, 0, 1, 1, 0, 1, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 1, 0, 1, 1, 1, 1, 1, 0, 0, 1, 0, 1, 1, 0, 0, 0], [0, 0, 1, 0, 1, 0, 1, 0, 1, 0, 1, 1, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0, 1, 1, 0, 1, 0, 0, 0, 1, 1, 0, 0, 1, 0, 0, 0, 0, 0, 1, 0, 1, 0, 0, 1, 0, 1, 0, 1, 0, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0], [0, 0, 0, 0, 1, 1, 0, 1, 0, 1, 1, 1, 0, 0, 0, 0, 1, 1, 1, 1, 1, 1, 1, 0, 0, 1, 1, 1, 0, 0, 1, 0, 1, 1, 0, 1, 0, 1, 0, 1, 1, 1, 1, 0, 0, 1, 1, 0, 1, 1, 1, 1, 0, 0, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1], [0, 0, 1, 0, 0, 1, 1, 1, 0, 1, 1, 0, 0, 1, 0, 1, 0, 1, 0, 1, 0, 0, 1, 0, 0, 1, 1, 1, 0, 1, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 0, 1, 1, 0, 1, 1, 1, 1, 0, 1, 1, 0, 0, 0, 1, 0], [1, 0, 0, 1, 1, 1, 0, 0, 1, 0, 0, 1, 0, 0, 1, 0, 0, 0, 0, 1, 1, 1, 0, 1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 1, 1, 0, 0, 1, 1, 0, 0, 1, 0, 1, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 0, 1, 1, 1, 1, 1, 0, 1, 1, 1], [1, 0, 1, 1, 1, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 1, 0, 1, 0, 1, 0, 1, 0, 0, 0, 0, 0, 0, 0, 1, 1, 0, 1, 1, 1, 0, 1, 0, 1, 0, 1, 0, 1, 0, 0, 0, 1, 1, 0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 0, 1, 1, 0, 1], [0, 0, 1, 1, 1, 0, 1, 0, 0, 0, 1, 1, 1, 1, 0, 0, 1, 0, 1, 1, 1, 1, 1, 1, 0, 0, 1, 1, 0, 0, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 1, 0, 0, 1, 0, 0, 1, 0, 0, 0, 0, 0, 1, 0, 1, 1, 1, 1, 1, 0, 0, 1, 0, 1], [1, 0, 0, 1, 0, 1, 0, 1, 1, 0, 1, 0, 1, 0, 0, 0, 1, 0, 1, 1, 0, 0, 1, 1, 1, 0, 1, 1, 0, 0, 0, 1, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 0, 1, 0, 0, 0, 1, 1, 0, 1, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0], [1, 1, 1, 0, 0, 1, 1, 1, 1, 0, 1, 1, 1, 0, 1, 0, 0, 0, 0, 1, 1, 0, 1, 0, 1, 1, 1, 1, 1, 0, 0, 1, 1, 0, 1, 1, 1, 0, 0, 1, 1, 0, 1, 1, 0, 1, 0, 0, 1, 1, 1, 0, 0, 1, 0, 1, 1, 1, 1, 0, 1, 0, 1, 0], [0, 0, 1, 0, 1, 1, 1, 1, 0, 0, 0, 0, 1, 1, 1, 0, 1, 0, 0, 0, 0, 0, 1, 1, 0, 1, 1, 1, 0, 0, 1, 0, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 1, 1, 1, 1, 1, 1, 0, 1, 0, 1, 0, 1, 0, 1, 0, 1, 1, 0, 0, 1], [0, 0, 0, 1, 1, 1, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 1, 0, 1, 0, 0, 0, 1, 1, 1, 0, 0, 0, 0, 1, 0, 1, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 0, 0, 0, 1, 0, 0, 1, 0, 1, 1, 1, 0, 0, 0, 0, 1, 0], [0, 0, 1, 1, 1, 1, 0, 1, 0, 1, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0, 0, 1, 1, 1, 0, 1, 0, 0, 1, 0, 1, 0, 1, 1, 0, 1, 0, 1, 1, 1, 0, 0, 1, 0, 0, 0, 0, 0, 0, 1, 0, 0, 1, 0, 0, 0, 0, 1, 0, 1, 1, 0, 1], [0, 1, 1, 0, 1, 1, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1, 1, 0, 0, 0, 1, 0, 0, 0, 1, 0, 0, 1, 0, 1, 1, 0, 0, 0, 1, 0, 0, 1, 1, 0, 1, 0], [1, 1, 1, 1, 0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 0, 0, 1, 0, 0, 1, 0, 0, 1, 1, 0, 1, 1, 0, 0, 0, 1, 1, 0, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1, 0, 0, 0, 0, 0, 1, 1, 1, 1, 1, 0, 0, 1, 0, 1, 0, 1, 0, 1, 0, 0], [0, 1, 1, 0, 1, 0, 0, 1, 1, 1, 1, 0, 0, 1, 1, 0, 1, 0, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 1, 1, 0, 1, 0, 0, 0, 1, 0, 0, 1, 0, 1, 1, 0, 1, 0, 1, 0, 0, 1, 0, 0, 0, 0, 1, 1, 0, 1, 0, 0, 0, 0, 1, 1, 1], [1, 0, 0, 0, 0, 1, 0, 1, 1, 0, 1, 0, 1, 1, 0, 0, 0, 0, 0, 0, 1, 0, 1, 0, 0, 1, 0, 0, 1, 1, 1, 1, 0, 0, 1, 0, 0, 1, 0, 0, 0, 0, 0, 1, 0, 1, 1, 0, 1, 0, 0, 1, 0, 1, 1, 1, 0, 1, 0, 0, 0, 0, 0, 1], [0, 1, 0, 0, 1, 1, 0, 1, 1, 0, 0, 1, 1, 1, 0, 0, 1, 0, 1, 1, 0, 1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 1, 1, 0, 0, 0, 0, 1, 0, 1, 0, 0, 0, 1, 0, 1, 1, 0, 1, 1, 0, 1, 1, 0, 1, 1, 0, 0, 1, 1, 0, 0, 1], [1, 0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 0, 0, 0, 1, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 1, 0, 0, 1, 1, 1, 1, 0, 1, 0, 0, 0, 0, 0, 0, 1, 0, 0, 1, 0, 1, 1, 1, 0, 0, 1, 0, 0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 1, 0], [0, 0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 1, 0, 1, 1, 1, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 0, 1, 0, 0, 1, 1, 1, 0, 1, 1, 0, 0, 1, 0, 0, 1, 1, 0, 1, 1, 1, 1, 0, 1, 0, 1, 0, 1, 1, 0, 1, 0, 1, 1], [1, 1, 1, 0, 1, 0, 0, 0, 0, 0, 1, 0, 0, 1, 1, 1, 1, 1, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 1, 1, 1, 0, 0, 1, 0, 0, 0, 1, 0, 0, 1, 0, 1], [0, 1, 0, 0, 0, 0, 0, 1, 0, 0, 0, 1, 1, 0, 1, 1, 1, 0, 0, 1, 0, 0, 0, 1, 0, 1, 1, 0, 0, 0, 0, 1, 1, 1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 1, 0, 0, 0, 1, 1, 0, 1, 1, 1, 0, 0, 0, 1, 0, 0, 0, 1, 1, 0], [0, 0, 1, 0, 0, 0, 1, 0, 1, 0, 1, 0, 1, 0, 1, 0, 1, 1, 0, 1, 1, 0, 1, 0, 0, 0, 1, 1, 0, 0, 0, 0, 1, 1, 1, 0, 0, 1, 0, 0, 0, 1, 1, 0, 0, 1, 1, 1, 0, 1, 1, 0, 1, 1, 0, 1, 0, 0, 1, 0, 1, 1, 1, 0], [0, 0, 1, 0, 1, 0, 1, 0, 0, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 1, 1, 0, 1, 1, 0, 1, 1, 0, 1, 1, 0, 0, 1, 0, 1, 1, 0, 0, 1, 1, 0, 1, 1, 0, 0, 1, 0, 1, 0, 0, 1, 0, 1, 1, 0, 1, 0, 1, 0, 0, 0, 1, 0, 0], [0, 0, 0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 1, 0, 0, 1, 1, 0, 1, 0, 1, 1, 1, 1, 1, 1, 0, 0, 1, 1, 0, 1, 0, 1, 0, 1, 1, 1, 1, 0, 1, 0, 1, 1, 0, 1, 0, 0, 0, 1, 1, 0, 1, 1, 0, 1, 0, 0, 1, 0, 0, 0, 1, 1], [0, 0, 1, 1, 1, 0, 0, 1, 0, 1, 1, 0, 1, 0, 0, 1, 0, 0, 0, 1, 0, 1, 1, 1, 0, 0, 0, 0, 1, 0, 1, 1, 0, 1, 0, 0, 1, 0, 1, 1, 1, 0, 0, 0, 0, 1, 0, 0, 0, 1, 0, 1, 0, 0, 0, 0, 0, 1, 1, 1, 0, 1, 1, 0], [1, 1, 0, 0, 0, 1, 0, 0, 1, 1, 0, 1, 1, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1, 0, 1, 0, 1, 1, 1, 1, 0, 0, 0, 1, 0, 1, 0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 0, 1, 1, 1, 0, 1, 1, 1, 0, 0, 0, 0, 1, 0, 1], [1, 0, 0, 0, 0, 0, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 1, 1, 0, 1, 1, 1, 0, 0, 0, 1, 1, 1, 0, 1, 0, 1, 1, 1, 0, 0, 0, 0, 0, 1, 0, 0, 1, 0, 1, 1, 1, 1, 0, 1, 0, 0, 0, 0, 1, 1, 0, 0, 0, 1, 1, 0, 1, 0], [0, 0, 0, 0, 1, 0, 1, 0, 0, 0, 1, 1, 0, 0, 0, 0, 0, 1, 0, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1, 0, 1, 0, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 0, 0], [0, 1, 0, 1, 0, 0, 1, 1, 1, 0, 0, 1, 0, 0, 1, 0, 0, 1, 1, 1, 1, 0, 0, 1, 1, 0, 1, 1, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 0, 1, 1, 0, 1, 0, 0, 1, 1, 1, 1, 1, 1, 0, 1, 0, 1, 1, 1, 0, 0], [1, 1, 0, 0, 1, 0, 0, 0, 0, 0, 1, 1, 1, 0, 1, 1, 1, 0, 0, 1, 1, 0, 0, 1, 1, 1, 1, 0, 1, 1, 1, 1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 1, 1, 0, 0, 1, 1, 1, 1, 0, 1, 1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0], [1, 0, 1, 1, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 1, 1, 1, 1, 1, 0, 0, 0, 1, 1, 1, 0, 1, 0, 0, 1, 1, 1, 1, 1, 1, 0, 0, 1, 1, 1, 0, 0, 1, 0, 0, 1, 0, 0, 1], [1, 1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 1, 1, 0, 1, 1, 1, 1, 1, 0, 1, 1, 0, 1, 1, 0, 0, 0, 0, 1, 1, 1, 0, 0, 1, 1, 1, 1, 0, 1, 0, 1, 0, 0, 1, 1, 1, 1, 1, 1, 0, 0, 1, 0, 1, 1, 1, 1, 0, 1, 1, 0, 1, 1], [1, 0, 1, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1, 0, 0, 0, 0, 0, 1, 0, 1, 0, 0, 0, 0, 1, 0, 1, 1, 1, 0, 1, 0, 0, 1, 1, 1, 0, 0, 1, 0, 0, 1, 0, 0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 0, 0, 1], [1, 0, 0, 1, 0, 1, 0, 0, 1, 1, 1, 0, 1, 0, 0, 1, 0, 1, 0, 1, 1, 0, 0, 1, 1, 0, 0, 1, 1, 0, 1, 0, 0, 0, 1, 1, 0, 0, 0, 1, 1, 1, 0, 1, 0, 1, 1, 0, 0, 1, 1, 0, 0, 0, 0, 1, 1, 1, 1, 0, 1, 1, 1, 0], [0, 1, 0, 1, 1, 1, 1, 0, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 1, 1, 0, 1, 1, 0, 0, 1, 0, 1, 1, 1, 1, 1, 0, 1, 1, 0, 1, 0, 1, 1, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 1, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0], [0, 1, 0, 1, 1, 0, 1, 1, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 1, 0, 0, 1, 1, 1, 0, 0, 0, 1, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 1, 0, 1, 0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 0, 0, 1, 1, 1, 0, 1, 0, 1, 0], [0, 0, 1, 0, 0, 1, 1, 0, 0, 1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 1, 1, 1, 1, 0, 1, 0, 1, 0, 0, 1, 1, 1, 0, 1, 1, 0, 1, 1, 1, 0, 1, 1, 0, 1, 0, 0, 0, 1, 0, 1, 0, 1, 0, 1, 0, 1, 0, 0, 1, 0, 1, 1, 0, 1], [0, 1, 0, 1, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 0, 1, 1, 1, 0, 0, 1, 0, 0, 1, 1, 1, 1, 1, 0, 1, 1, 0, 1, 0, 0, 0, 0, 0, 1, 1, 0, 0, 0, 0, 1, 1, 0, 1, 0, 1, 0, 1, 0, 0, 1, 0, 1, 1, 0, 0, 1, 1, 0, 0], [1, 1, 1, 0, 1, 1, 1, 0, 0, 0, 1, 1, 0, 0, 0, 1, 0, 0, 1, 1, 0, 1, 0, 0, 0, 1, 1, 1, 0, 1, 1, 0, 0, 1, 1, 1, 1, 1, 0, 0, 1, 0, 0, 1, 1, 1, 1, 0, 1, 0, 0, 0, 1, 1, 0, 0, 0, 0, 0, 0, 1, 1, 0, 0], [0, 0, 1, 1, 1, 0, 1, 0, 0, 0, 1, 0, 1, 1, 0, 0, 0, 1, 1, 0, 1, 1, 0, 1, 0, 0, 0, 0, 1, 1, 1, 0, 1, 0, 0, 0, 1, 0, 0, 0, 1, 1, 1, 0, 0, 0, 0, 1, 1, 0, 1, 1, 0, 0, 1, 0, 1, 0, 1, 0, 1, 0, 1, 1], [1, 0, 1, 1, 1, 0, 0, 1, 0, 1, 1, 0, 0, 1, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1, 0, 1, 0, 0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 0, 0, 1, 0, 1, 0, 1, 0, 1, 0, 0, 1, 1, 1, 1, 1, 1, 1, 0, 0, 1, 1, 1, 0, 0, 0, 0], [0, 0, 1, 0, 1, 0, 0, 0, 1, 0, 1, 1, 1, 0, 0, 1, 0, 0, 1, 0, 0, 0, 0, 1, 1, 0, 1, 0, 0, 0, 1, 1, 0, 1, 1, 0, 1, 0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 0, 0, 0, 0, 0, 1, 1, 0, 0, 1, 0, 0, 1, 0, 1], [1, 0, 1, 0, 0, 1, 0, 1, 1, 1, 0, 0, 0, 0, 1, 1, 1, 0, 0, 1, 0, 1, 0, 0, 0, 1, 0, 0, 1, 0, 0, 1, 1, 1, 1, 0, 0, 1, 0, 1, 1, 0, 1, 1, 0, 0, 0, 1, 0, 0, 1, 1, 1, 0, 1, 1, 0, 1, 0, 1, 1, 0, 1, 0], [0, 1, 0, 1, 0, 1, 1, 1, 0, 0, 0, 0, 1, 0, 0, 0, 1, 0, 0, 1, 1, 1, 1, 0, 0, 0, 0, 1, 0, 0, 1, 1, 1, 0, 1, 0, 1, 1, 1, 1, 1, 0, 1, 0, 1, 0, 0, 0, 0, 1, 0, 0, 1, 1, 0, 1, 0, 1, 0, 1, 1, 1, 1, 1], [1, 0, 0, 1, 0, 0, 0, 1, 0, 1, 0, 0, 1, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 1, 1, 0, 1, 1, 1, 1, 0, 1, 0, 0, 1, 0, 1, 1, 1, 1, 0, 1, 0, 1, 0, 1, 1, 1, 0, 1, 0, 1, 1, 1, 0, 0, 1, 1, 1, 1, 0, 0, 0, 0], [0, 0, 0, 0, 0, 1, 1, 0, 0, 0, 1, 1, 1, 0, 1, 1, 0, 1, 0, 1, 1, 0, 1, 0, 1, 0, 1, 0, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1, 1, 0, 1, 0, 0, 1, 1, 1, 0, 0, 1, 1, 0, 0, 1, 0, 0, 1, 0, 1, 1, 1, 0, 1, 1], [1, 1, 0, 0, 1, 0, 1, 1, 0, 1, 0, 1, 1, 1, 0, 1, 1, 1, 1, 0, 0, 1, 1, 1, 0, 1, 1, 1, 0, 0, 1, 0, 0, 1, 0, 0, 1, 1, 1, 0, 0, 0, 0, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 0, 0, 0, 1, 1], [0, 0, 1, 0, 0, 1, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 0, 1, 0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 1, 0, 0, 1, 0, 0, 0, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 0], [0, 1, 0, 0, 0, 0, 1, 1, 1, 1, 0, 0, 1, 1, 1, 0, 1, 1, 0, 1, 1, 0, 1, 0, 1, 0, 0, 0, 0, 1, 1, 0, 0, 1, 0, 0, 0, 0, 0, 1, 0, 0, 0, 1, 1, 0, 1, 0, 1, 0, 1, 1, 0, 0, 0, 0, 1, 1, 0, 1, 1, 0, 0, 0], [1, 0, 0, 1, 1, 0, 0, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 0, 1, 0, 0, 0, 1, 0, 0, 1, 1, 0, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 1, 1, 0, 1, 0, 0, 0, 1, 0, 0, 1, 0, 1, 0, 0, 1, 0, 1, 0, 0], [0, 1, 0, 1, 1, 0, 0, 0, 1, 1, 0, 1, 1, 0, 0, 0, 1, 0, 1, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 0, 0, 1, 0, 1, 1, 0, 0, 0, 1, 1, 1, 0, 1, 0, 0, 0, 1, 1, 0, 1, 0, 1, 0, 1, 1, 1, 1, 1, 0, 0, 1, 0, 1], [1, 1, 0, 0, 1, 1, 1, 1, 0, 1, 1, 0, 1, 1, 1, 0, 1, 1, 0, 0, 1, 1, 0, 0, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 1, 1, 0, 1, 0, 0, 1, 1, 1, 0, 1, 0, 0, 1, 1, 0, 0, 1, 0, 1, 0, 1, 0, 0, 0, 1, 0, 0, 0, 0], [1, 0, 1, 1, 1, 0, 0, 0, 0, 1, 0, 0, 0, 1, 0, 0, 1, 1, 0, 0, 1, 1, 0, 0, 0, 0, 1, 1, 0, 1, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 0, 0, 0, 1, 0, 1, 0, 0, 0, 1, 1, 1, 0, 0, 1, 1, 0, 1, 0, 0, 1, 0, 1, 1], [0, 1, 0, 0, 1, 1, 0, 1, 1, 1, 1, 1, 1, 0, 1, 0, 1, 1, 1, 1, 0, 1, 0, 1, 1, 0, 1, 0, 0, 0, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 1, 0, 1, 0, 1, 1, 1, 1, 0, 1, 0, 0, 1, 1, 1, 0, 0, 1, 0, 0, 0, 1, 1, 1], [0, 1, 1, 0, 1, 1, 0, 1, 0, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 0, 1, 1, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 0, 0, 1, 0, 1, 1, 0, 0, 1, 0, 1, 1, 0, 0, 0, 1, 1, 1, 0, 0, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 0, 0], [0, 1, 1, 1, 0, 0, 0, 1, 1, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 0, 0, 0, 1, 0, 1, 1, 0, 1, 0, 1, 1, 0, 0, 0, 1, 0, 0, 0, 0, 1, 1, 0, 0, 0, 0, 0, 1, 1, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 1, 1, 1], [1, 0, 0, 1, 1, 0, 0, 1, 1, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 1, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 1, 0, 0, 1, 0, 1, 0, 0, 0, 0, 1, 0, 1, 0, 0, 0, 0, 1, 1, 0, 1, 1, 1, 1, 1, 1, 0, 1, 1], [1, 1, 1, 0, 0, 1, 1, 0, 1, 0, 0, 0, 1, 0, 1, 1, 0, 0, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 1, 0, 1, 0, 1, 1, 0, 0, 1, 1, 1, 1, 1, 1, 0, 0, 1], [0, 1, 0, 1, 0, 1, 1, 1, 0, 1, 1, 1, 0, 1, 0, 1, 1, 0, 0, 0, 0, 1, 0, 0, 0, 1, 0, 1, 1, 0, 0, 0, 0, 0, 0, 0, 1, 0, 1, 0, 1, 0, 0, 0, 1, 1, 0, 0, 1, 0, 1, 1, 1, 0, 1, 1, 1, 0, 0, 1, 0, 0, 1, 0], [1, 1, 0, 1, 0, 0, 0, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 0, 0, 1, 1, 0, 1, 1, 1, 0, 0, 1, 1, 1, 0, 0, 0, 1, 1, 1, 0, 0, 0, 0, 1, 1, 1, 1, 1, 1, 0, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 1, 1, 1, 0, 1, 0, 0], [1, 1, 0, 1, 1, 1, 1, 1, 0, 1, 0, 1, 0, 1, 0, 0, 1, 1, 1, 1, 1, 0, 1, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 0, 1, 0, 1, 1, 1, 1, 1, 0, 1, 1, 0, 0, 0, 1, 1, 1, 0, 1, 0, 1, 1, 1, 0, 1], [1, 0, 0, 0, 1, 1, 0, 0, 1, 1, 0, 1, 1, 0, 0, 1, 1, 0, 0, 1, 1, 1, 1, 1, 1, 0, 1, 0, 1, 0, 0, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 1, 0, 1, 0, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 1, 1, 0, 1, 1, 1, 0], [0, 1, 1, 1, 0, 0, 0, 0, 1, 1, 0, 0, 0, 0, 0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 1, 1, 0, 0, 1, 1, 1, 1, 1, 1, 1, 0, 0, 1, 0, 1, 1, 0, 0, 0, 1, 0, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 0, 0, 1, 1, 0, 0, 0, 1], [1, 0, 1, 1, 1, 1, 1, 0, 0, 1, 0, 1, 1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 0, 1, 1, 0, 1, 0, 0, 1, 1, 1, 0, 0, 0, 1, 0, 0, 1, 1, 0, 1, 1, 1, 0, 0, 0, 0, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 1], [0, 0, 1, 1, 1, 1, 1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 0, 0, 1, 0, 0, 0, 1, 0, 1, 1, 0, 0, 0, 0, 0, 1, 0, 1, 1, 0, 1, 0, 0, 0, 1, 1, 1, 1, 1, 0, 0, 1, 0, 0, 1, 1, 1, 0, 1], [0, 1, 1, 0, 1, 1, 0, 0, 0, 0, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 1, 0, 0, 1, 1, 1, 0, 1, 1, 1, 1, 1, 0, 1, 1, 1, 0, 1, 1, 0, 1, 1, 0, 0, 1, 0, 1, 1, 1, 0, 0, 1, 1, 1, 0, 0, 1, 0], [1, 1, 0, 1, 0, 0, 0, 0, 1, 1, 1, 0, 0, 1, 1, 0, 1, 0, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 1, 1, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 1, 1, 0, 1, 0, 0, 1, 1, 1, 0, 0, 1, 1, 0, 1, 0, 0, 1, 1, 1], [1, 1, 1, 1, 1, 0, 1, 1, 0, 0, 1, 0, 1, 1, 0, 0, 1, 1, 0, 1, 0, 1, 1, 1, 1, 1, 0, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 1, 1, 0, 1, 0, 1, 0, 1, 0, 0, 1, 1, 1, 0, 1, 1, 0, 1, 0, 0, 0, 1, 1, 0], [1, 0, 1, 0, 0, 1, 1, 0, 1, 1, 0, 1, 0, 1, 1, 1, 1, 0, 0, 0, 1, 0, 0, 0, 1, 0, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 1, 1, 1, 0, 1, 0, 0, 0, 0, 1, 1, 1, 0, 0, 0, 0, 1, 1, 0, 0, 1, 1, 0, 0, 1, 0, 1, 0], [1, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 1, 1, 0, 1, 1, 1, 1, 1, 1, 0, 0, 0, 1, 1, 0, 1, 1, 0, 0, 0, 0, 1, 0, 1, 1, 0, 1, 1, 1, 0, 0, 1, 0, 1, 1, 1, 1, 1, 1, 0, 1, 0, 1, 1, 1], [1, 0, 0, 1, 0, 1, 0, 1, 1, 0, 1, 1, 1, 0, 1, 1, 0, 0, 0, 0, 0, 0, 1, 1, 0, 1, 0, 1, 1, 0, 0, 0, 1, 0, 1, 0, 1, 0, 0, 1, 0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 0, 1, 1, 0, 0, 0, 1, 1, 0, 1, 0, 0, 1], [0, 0, 1, 0, 0, 0, 1, 1, 0, 0, 1, 0, 0, 0, 1, 1, 0, 0, 1, 0, 0, 1, 1, 0, 0, 1, 1, 1, 0, 0, 0, 1, 1, 0, 1, 0, 1, 0, 0, 0, 0, 0, 0, 0, 1, 1, 0, 0, 1, 0, 0, 0, 1, 1, 0, 0, 1, 0, 0, 1, 1, 1, 1, 0], [0, 0, 0, 1, 1, 1, 1, 0, 1, 1, 0, 1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 0, 1, 0, 0, 0, 0, 0, 1, 0, 1, 0, 1, 0, 0, 1, 0, 0, 1, 1, 1, 1, 0, 0, 1, 1, 0, 0, 1, 0, 0, 1, 1, 0, 1, 0, 1, 1, 0, 0, 0, 1, 1, 1], [1, 1, 1, 0, 0, 1, 0, 0, 0, 1, 1, 0, 1, 1, 0, 1, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 0, 1, 0, 1, 0, 0, 1, 1, 1, 0, 0, 1, 1, 0, 1, 0, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 0, 1, 0, 0, 0, 1, 1, 0], [1, 0, 0, 0, 1, 1, 1, 1, 0, 1, 1, 0, 0, 1, 0, 0, 1, 1, 1, 1, 1, 1, 0, 0, 1, 1, 0, 1, 1, 1, 1, 0, 1, 0, 1, 0, 0, 1, 0, 0, 1, 0, 0, 1, 0, 0, 1, 0, 1, 1, 1, 0, 1, 1, 0, 0, 1, 1, 0, 0, 1, 1, 1, 0], [1, 1, 0, 1, 0, 1, 0, 1, 0, 1, 0, 0, 0, 0, 1, 1, 1, 0, 0, 1, 0, 1, 0, 1, 0, 0, 1, 0, 1, 0, 0, 0, 0, 0, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1, 0, 0, 0, 1, 0, 0, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 0, 1, 1, 1], [1, 1, 0, 1, 1, 0, 1, 0, 0, 1, 1, 1, 0, 0, 1, 0, 1, 0, 1, 0, 1, 1, 0, 0, 0, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1, 0, 0, 1, 1, 0, 0, 0, 0, 1, 1, 1, 0, 1, 0, 1, 0, 1, 1, 0, 1, 1, 0, 0, 0, 0, 0, 0, 1, 1], [0, 0, 1, 1, 0, 0, 1, 0, 1, 0, 0, 1, 0, 1, 0, 0, 1, 1, 1, 0, 0, 0, 1, 1, 1, 1, 0, 0, 0, 1, 0, 1, 1, 0, 1, 0, 1, 0, 1, 0, 0, 1, 0, 0, 1, 0, 1, 1, 1, 1, 0, 0, 1, 0, 0, 1, 1, 0, 0, 0, 0, 1, 1, 1], [1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 1, 0, 1, 0, 1, 0, 0, 1, 0, 0, 1, 1, 0, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 1, 0, 0, 0, 1, 0, 1, 1, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 0, 0, 1, 0, 0, 1, 0, 0, 0, 0, 1, 0], [0, 1, 0, 0, 0, 0, 0, 1, 0, 1, 0, 1, 1, 0, 1, 0, 1, 1, 0, 1, 1, 0, 0, 0, 0, 1, 0, 0, 0, 1, 1, 0, 1, 0, 1, 0, 1, 0, 0, 0, 1, 0, 1, 1, 1, 1, 1, 1, 0, 1, 0, 1, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0, 0, 1], [0, 0, 0, 1, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 0, 1, 0, 1, 1, 0, 0, 0, 0, 1, 0, 0, 0, 1, 0, 0, 1, 0, 1, 0, 0, 1, 0, 1, 1, 1, 0, 0, 1, 1, 0, 1, 0, 1, 1, 1, 0, 1, 1, 1, 0, 0, 0, 0, 0, 1, 0, 0, 0], [1, 1, 1, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 1, 0, 0, 0, 1, 0, 0, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1, 1, 0, 0, 0, 0, 1, 0, 1, 0, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 1, 0, 1, 1, 0, 0, 1], [0, 0, 1, 1, 0, 0, 0, 0, 1, 1, 0, 1, 0, 0, 1, 0, 1, 0, 0, 1, 0, 1, 0, 0, 0, 1, 1, 0, 1, 0, 1, 1, 1, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 1, 1, 1, 1, 1, 1, 0, 1, 1, 0, 0, 1, 1, 1, 0, 1, 0, 1, 1, 0, 1], [1, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 0, 1, 0, 0, 0, 0, 1, 1, 1, 0, 1, 0, 1, 0, 1, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 0, 0, 0, 1, 1, 0, 1, 0, 1, 1, 0, 0, 0, 1, 0, 1, 0, 1, 0, 1, 0, 0, 0, 0, 0, 1, 0], [0, 1, 1, 0, 1, 0, 1, 1, 0, 0, 1, 1, 1, 0, 1, 1, 0, 1, 0, 1, 1, 0, 1, 0, 1, 0, 1, 1, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 0, 1, 1, 0, 1, 0, 0, 1, 0, 1, 1, 1, 1, 1, 1, 0, 0, 1, 1, 1, 1, 1, 1, 1, 0, 0], [0, 0, 1, 1, 1, 0, 0, 0, 0, 0, 1, 1, 1, 0, 1, 0, 1, 0, 1, 0, 0, 0, 1, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 0, 0, 0, 0, 1, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 0, 1, 1, 1, 0, 0, 1, 0, 0, 0, 0, 1, 1, 0, 1, 0], [0, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 0, 0, 1, 1, 0, 1, 1, 1, 0, 0, 0, 1, 0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 1, 0, 1, 0, 0, 1, 0, 0, 0, 1, 0, 1, 1, 1, 0, 1, 0, 0, 1, 0, 1, 1, 0, 0, 0, 1, 0, 1, 0, 0, 1], [1, 0, 1, 1, 1, 1, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0, 1, 0, 1, 1, 0, 0, 0, 0, 1, 1, 1, 0, 1, 1, 1, 0, 1, 0, 1, 0, 1, 1, 1, 0, 1, 0, 1, 0, 1, 1, 1, 1, 0, 1, 0, 0, 0, 1, 0, 0, 1, 1, 1, 0, 1, 0, 0, 1], [1, 1, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1, 0, 1, 1, 0, 1, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1, 0, 0, 0, 0, 0, 1, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 0, 1, 1, 0, 0], [0, 1, 1, 1, 0, 0, 0, 0, 1, 1, 0, 0, 0, 1, 0, 1, 0, 0, 1, 0, 0, 1, 1, 0, 1, 1, 0, 1, 1, 1, 1, 0, 1, 0, 1, 1, 1, 1, 1, 0, 0, 0, 1, 1, 1, 0, 1, 0, 1, 0, 1, 1, 1, 1, 0, 0, 1, 0, 1, 1, 1, 0, 0, 1], [0, 1, 0, 1, 1, 1, 0, 0, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 1, 1, 1, 1, 0, 1, 0, 0, 1, 1, 1, 1, 0, 1, 0, 1, 0, 1, 0, 1, 0, 0, 0, 0, 0, 0, 0, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 1, 1, 0, 0], [1, 1, 1, 0, 1, 0, 1, 1, 0, 1, 0, 0, 0, 0, 1, 1, 0, 0, 1, 1, 0, 0, 0, 0, 1, 1, 1, 0, 1, 1, 0, 1, 0, 0, 1, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 0, 0, 1, 0, 1, 1, 0, 0, 0, 0, 1, 1, 1, 1, 0, 1, 0, 1, 0], [0, 1, 1, 0, 1, 1, 1, 1, 0, 0, 1, 0, 0, 1, 0, 1, 1, 1, 1, 0, 1, 0, 1, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 1, 0, 1, 0, 1, 1, 1, 1, 0, 0, 1, 1, 0, 1, 1, 0, 0, 1, 0, 0, 0, 0, 1, 0], [0, 1, 1, 1, 1, 1, 1, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 1, 1, 0, 1, 1, 1, 1, 1, 0, 1, 1, 0, 1, 1, 0, 1, 1, 1, 1, 0, 1, 1, 0, 1, 1, 1, 0, 1, 0, 0, 0, 0, 1, 0, 1, 0, 0, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1], [0, 0, 0, 1, 1, 1, 0, 1, 1, 0, 1, 0, 1, 1, 1, 1, 0, 1, 1, 1, 1, 0, 1, 1, 0, 1, 0, 0, 0, 1, 0, 0, 0, 1, 1, 1, 0, 0, 1, 0, 1, 0, 0, 1, 1, 1, 0, 0, 0, 0, 0, 0, 1, 0, 1, 0, 0, 0, 0, 1, 0, 0, 1, 1], [1, 0, 1, 1, 0, 0, 1, 1, 1, 0, 0, 0, 1, 1, 1, 0, 1, 1, 0, 0, 0, 1, 1, 1, 1, 0, 0, 0, 1, 0, 0, 1, 1, 0, 1, 0, 0, 1, 1, 1, 0, 1, 1, 0, 1, 1, 0, 0, 1, 0, 0, 0, 1, 0, 1, 0, 0, 0, 0, 1, 1, 0, 1, 1], [0, 1, 1, 0, 1, 0, 0, 0, 0, 1, 1, 1, 0, 1, 1, 0, 1, 1, 1, 0, 0, 1, 0, 1, 0, 1, 0, 1, 1, 0, 1, 1, 0, 1, 1, 1, 0, 1, 0, 1, 1, 0, 0, 1, 0, 0, 1, 1, 1, 1, 1, 1, 0, 0, 1, 1, 0, 0, 1, 0, 0, 0, 1, 0], [0, 0, 0, 1, 1, 1, 0, 0, 0, 0, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 1, 1, 1, 0, 1, 1, 0, 1, 0, 1, 0, 1, 1, 0, 0, 1, 0, 1, 1, 0, 0, 1, 0, 1, 0, 1, 0, 1, 1, 0, 1, 1, 0, 0, 1, 0], [0, 0, 0, 1, 0, 0, 0, 0, 0, 1, 0, 0, 1, 0, 0, 1, 0, 1, 0, 0, 0, 1, 0, 0, 1, 0, 0, 0, 0, 0, 0, 1, 0, 1, 0, 1, 0, 1, 0, 0, 0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1, 0, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1], [0, 1, 0, 0, 0, 0, 1, 1, 1, 1, 1, 0, 1, 0, 1, 0, 1, 1, 0, 0, 1, 1, 0, 0, 1, 1, 1, 0, 1, 0, 0, 0, 1, 1, 0, 1, 1, 0, 0, 1, 1, 0, 1, 1, 1, 0, 0, 1, 1, 0, 1, 1, 0, 0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 0], [1, 1, 0, 1, 1, 0, 1, 1, 0, 1, 0, 0, 1, 1, 1, 1, 1, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 1, 0, 1, 0, 1, 1, 1, 1, 1, 0, 1, 0, 1, 1, 0, 0, 1, 1, 0, 0, 1, 0, 1, 0, 0, 1, 1, 0, 1, 1, 1, 0, 0, 0, 1, 0, 0], [0, 0, 0, 0, 0, 1, 1, 1, 1, 0, 0, 1, 1, 1, 0, 0, 0, 1, 1, 0, 0, 0, 1, 0, 1, 0, 0, 0, 0, 0, 0, 1, 0, 1, 0, 1, 0, 0, 0, 1, 0, 1, 1, 0, 0, 1, 0, 0, 0, 0, 0, 1, 0, 0, 0, 1, 1, 0, 1, 0, 1, 0, 1, 0], [1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 1, 1, 0, 1, 0, 0, 0, 0, 0, 0, 1, 1, 1, 0, 0, 1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 0, 1, 1, 1, 0, 0, 1, 1, 1, 1, 0, 1, 0, 1, 1, 1, 0, 0, 0, 1, 1, 1, 0, 0], [0, 0, 0, 1, 1, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 1, 0, 0, 0, 1, 1, 0, 1, 1, 1, 0, 0, 1, 1, 1, 0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 1, 0, 1, 1, 1, 0, 0, 1, 1, 0], [0, 0, 1, 1, 1, 1, 0, 1, 0, 1, 1, 1, 1, 0, 1, 0, 1, 0, 1, 1, 0, 1, 1, 1, 0, 1, 0, 1, 0, 1, 1, 1, 0, 1, 0, 0, 1, 0, 1, 1, 0, 0, 0, 0, 1, 1, 0, 0, 0, 0, 1, 1, 0, 1, 1, 1, 0, 1, 1, 0, 1, 0, 1, 1], [0, 0, 0, 0, 1, 1, 1, 1, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1, 0, 0, 1, 0, 1, 1, 1, 0, 0, 1, 1, 1, 1, 0, 0, 1, 1, 0, 1, 1, 1, 1, 1, 1, 0, 1, 0, 1, 1, 1, 1, 1, 0, 0, 0, 0, 1, 1, 1, 0], [1, 1, 0, 0, 1, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 0, 0, 0, 1, 0, 0, 1, 0, 1, 1, 0, 1, 0, 0, 0, 0, 1, 0, 1, 0, 1, 1, 0, 0, 1, 1, 1, 1, 0, 0, 0, 1, 1, 0, 1, 1, 1, 0, 1, 0, 1, 0, 0, 0], [1, 0, 1, 0, 0, 1, 0, 1, 0, 1, 1, 0, 1, 1, 0, 1, 1, 1, 0, 1, 1, 0, 0, 0, 0, 0, 1, 0, 1, 0, 1, 1, 1, 0, 0, 1, 0, 0, 0, 0, 1, 0, 1, 0, 0, 1, 0, 0, 1, 1, 1, 0, 0, 0, 0, 1, 1, 1, 0, 0, 1, 0, 1, 1], [0, 0, 1, 0, 0, 1, 1, 1, 0, 1, 0, 0, 0, 0, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 0, 1, 0, 1, 1, 1, 0, 0, 1, 1, 0, 0, 1, 1, 1, 0, 1, 1, 0, 1, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1, 0, 0, 1, 1, 0], [1, 0, 1, 0, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 0, 1, 0, 0, 0, 0, 0, 1, 0, 1, 0, 1, 0, 1, 0, 0, 1, 0, 1, 0, 1, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 1, 1, 1, 1, 0, 1, 1, 0, 0, 1, 1, 0], [0, 1, 0, 1, 0, 0, 0, 1, 1, 0, 1, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 1, 1, 0, 1, 0, 0, 1, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 1, 1, 0, 0, 1, 0, 1, 1, 1, 1, 0, 0, 0, 0, 1, 1, 1, 0, 1, 1], [1, 1, 1, 1, 0, 0, 1, 0, 1, 0, 0, 1, 0, 0, 0, 0, 1, 1, 0, 0, 1, 0, 1, 1, 0, 0, 1, 1, 0, 0, 1, 1, 1, 1, 0, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 1, 0, 0, 1, 0, 1, 1, 1, 0, 0, 1, 0, 0, 1, 1, 1, 0, 0, 0], [0, 1, 1, 0, 0, 1, 0, 1, 1, 0, 1, 0, 1, 0, 0, 0, 1, 1, 0, 1, 1, 0, 0, 1, 0, 1, 0, 1, 0, 1, 1, 0, 0, 1, 0, 1, 1, 1, 0, 0, 1, 0, 0, 0, 0, 0, 1, 1, 0, 1, 1, 1, 1, 1, 0, 0, 1, 1, 1, 1, 1, 0, 1, 1], [1, 1, 0, 0, 1, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 1, 1, 0, 0, 0, 1, 0, 1, 1, 0, 1, 1, 1, 1, 0, 1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 0, 1, 1, 0, 1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 1, 0], [0, 0, 0, 0, 1, 1, 1, 0, 0, 0, 0, 1, 1, 1, 1, 1, 0, 1, 1, 0, 1, 0, 1, 0, 0, 1, 1, 1, 1, 0, 0, 0, 0, 1, 0, 1, 1, 0, 1, 1, 0, 1, 1, 0, 0, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 0, 0, 0, 0, 0, 0, 1, 1, 1], [0, 0, 1, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 1, 1, 0, 0, 1, 0, 1, 1, 1, 0, 1, 0, 0, 0, 1, 0, 0, 0, 1, 0, 1, 0, 0, 1, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1, 1, 0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 0], [0, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 0, 1, 0, 0, 0, 1, 1, 0, 1, 0, 0, 0, 0, 0, 1, 1, 0, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 1, 1, 1, 0, 1, 0, 1, 1, 1, 1], [0, 0, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 1, 0, 0, 0, 1, 1, 0, 0, 0, 0, 0, 0, 1, 1, 1, 0, 0, 0, 0, 1, 0, 1, 0, 1, 0, 1, 1, 0, 1, 1, 1, 1, 0, 0, 0, 0, 0, 1, 0, 1, 0, 1, 0, 0, 0, 0, 0, 1, 1, 1, 0, 0], [0, 0, 0, 0, 1, 0, 0, 1, 1, 1, 1, 0, 0, 0, 1, 0, 1, 0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 1, 1, 1, 1, 0, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 1, 0, 1, 1, 0, 0, 1, 0, 0, 0, 1, 0, 0, 0, 0], [0, 1, 0, 0, 0, 0, 1, 0, 1, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0, 1, 0, 1, 0, 0, 0, 0, 0, 0, 1, 0, 1, 1, 0, 1, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 1, 0, 0, 0, 1, 1, 0, 1, 1, 1, 0, 1], [1, 1, 1, 0, 0, 0, 1, 0, 0, 1, 1, 1, 1, 0, 0, 1, 1, 0, 0, 1, 0, 0, 1, 0, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 1, 1, 0, 0, 0, 0, 0, 1, 0, 1, 1, 0, 1, 0, 0, 1, 1, 0, 1, 1, 0, 0, 1, 0, 1, 1, 1, 0, 0], [0, 0, 0, 0, 1, 0, 1, 0, 0, 0, 1, 0, 1, 0, 1, 0, 0, 1, 0, 1, 0, 0, 1, 0, 0, 1, 0, 1, 1, 0, 0, 1, 0, 1, 0, 1, 1, 1, 0, 1, 1, 1, 1, 1, 0, 0, 0, 0, 1, 1, 1, 0, 0, 0, 1, 0, 1, 1, 0, 0, 0, 1, 1, 0], [0, 0, 0, 0, 1, 1, 0, 0, 0, 0, 1, 0, 1, 1, 1, 0, 1, 0, 0, 0, 0, 1, 1, 1, 1, 0, 0, 1, 0, 1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 1, 0, 1, 0, 1, 0, 0, 1, 1, 1, 0, 1, 1, 1, 0, 0, 1, 1, 0, 0, 0, 1, 1, 1, 1], [0, 0, 1, 1, 1, 0, 1, 0, 0, 1, 0, 1, 0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 1, 0, 1, 0, 1, 1, 0, 0, 0, 1, 0, 0, 0, 0, 1, 1, 1, 0, 1, 0, 0, 1, 0, 0, 0, 0, 0, 0, 1, 1, 0, 0], [1, 0, 0, 1, 1, 1, 0, 1, 0, 1, 1, 0, 1, 0, 0, 0, 0, 0, 1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 0, 0, 0, 0, 0, 1, 0, 1, 1, 1, 0, 1, 0, 1, 1, 1, 0, 0, 0, 0, 0, 0, 1, 1, 0, 0, 0, 0, 1, 1, 1, 1, 0, 1, 0, 1], [0, 1, 1, 1, 0, 0, 1, 1, 0, 1, 1, 1, 1, 0, 1, 0, 1, 0, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 1, 0, 0, 1, 1, 1, 1, 0, 1, 0, 0, 0, 0, 1, 1, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 0, 1, 1, 1, 0, 0, 0, 0, 1, 0, 0], [0, 0, 1, 0, 1, 1, 1, 1, 1, 0, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 0, 0, 1, 1, 0, 0, 1, 0, 0, 0, 0, 1, 1, 1, 1, 0, 1, 1, 0, 1, 1, 0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 0, 1, 0], [0, 0, 1, 0, 1, 0, 0, 0, 1, 0, 1, 0, 0, 0, 1, 0, 0, 1, 1, 0, 1, 0, 1, 1, 0, 0, 0, 1, 0, 0, 1, 1, 1, 0, 0, 0, 0, 0, 0, 1, 1, 1, 0, 1, 1, 1, 0, 1, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 1, 0, 0, 0], [0, 0, 0, 1, 0, 1, 0, 0, 1, 0, 0, 0, 0, 1, 0, 1, 0, 0, 0, 0, 1, 0, 1, 1, 1, 0, 0, 0, 0, 1, 0, 1, 1, 0, 0, 1, 1, 0, 0, 1, 1, 1, 1, 1, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 0, 1, 0, 0, 0, 1, 1, 1, 1], [1, 1, 0, 1, 0, 0, 1, 0, 1, 0, 1, 0, 0, 1, 1, 1, 0, 1, 0, 0, 1, 1, 0, 0, 0, 1, 0, 1, 0, 1, 1, 0, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 0, 0, 0, 1, 0, 0, 1], [1, 1, 1, 1, 0, 0, 1, 0, 0, 0, 0, 0, 0, 1, 0, 1, 0, 1, 0, 0, 1, 0, 0, 1, 0, 1, 1, 0, 1, 1, 0, 1, 1, 0, 1, 0, 1, 1, 0, 0, 0, 1, 0, 0, 0, 0, 1, 1, 0, 0, 1, 0, 1, 1, 1, 0, 0, 1, 0, 1, 1, 0, 1, 0], [0, 0, 1, 1, 0, 1, 1, 1, 0, 0, 0, 0, 0, 0, 1, 0, 1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 1, 0, 0, 1, 0, 0, 1, 1, 1, 1, 0, 0, 0, 1, 0, 1, 0, 1, 1, 1, 0, 1, 0, 0, 1, 0, 1, 1, 0, 1, 0, 1, 1, 1, 1, 0, 1], [1, 1, 0, 0, 1, 0, 1, 1, 1, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0, 0, 1, 0, 0, 1, 0, 1, 1, 0, 0, 0, 1, 1, 1, 0, 0, 1, 1, 0, 0, 1, 1, 1, 0, 0, 1, 1, 0, 1, 0, 0, 0, 0, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 0], [1, 1, 1, 0, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 0, 1, 0, 1, 1, 0, 0, 1, 1, 0, 1, 0, 1, 0, 0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 1, 0, 0, 1, 0, 0, 0, 0, 1, 1, 1, 1, 0, 0, 1, 0, 0, 1, 1, 0, 0, 1, 1], [0, 1, 1, 1, 0, 0, 1, 1, 0, 1, 1, 1, 1, 0, 0, 0, 1, 0, 0, 0, 1, 0, 0, 0, 0, 0, 1, 1, 1, 0, 1, 0, 0, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 0, 0, 1, 1, 1, 1, 1, 0, 0, 0, 1, 1, 1, 1, 1, 1, 0], [1, 0, 0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 0, 0, 0, 1, 1, 0, 0, 1, 1, 1, 1, 1, 0, 0, 0, 0, 1, 0, 1, 1, 0, 0, 1, 0, 0, 0, 0, 1, 1, 0, 0, 1, 1, 0, 0, 0, 0, 1, 1, 1, 0, 0, 0, 1, 0, 0, 1, 1, 1, 0, 0, 1], [1, 0, 0, 0, 0, 1, 1, 1, 1, 0, 1, 1, 1, 0, 0, 0, 1, 0, 0, 1, 1, 0, 0, 0, 0, 0, 1, 0, 1, 0, 0, 1, 0, 0, 1, 1, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 0, 0, 1, 0, 0, 0, 1, 0, 0, 0, 0, 1, 1, 0, 1, 0, 1, 0], [1, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 0, 1, 0, 0, 0, 1, 1, 1, 0, 1, 1, 0, 1, 0, 0, 0, 1, 1, 1, 1, 1, 0, 0, 1, 0, 1, 1, 1, 1, 1, 1, 0, 1, 0, 0, 1, 1, 1, 0, 1, 0, 1, 0, 1, 1, 0, 0, 1, 1, 0, 1], [1, 1, 0, 1, 1, 1, 0, 0, 0, 1, 1, 1, 0, 0, 1, 0, 0, 0, 1, 1, 1, 0, 0, 1, 1, 0, 0, 0, 1, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 1, 0, 1, 0, 0, 0, 0, 1, 1, 1, 0, 0, 1, 1, 0, 1, 0, 0, 1, 1, 1, 1], [1, 1, 0, 0, 0, 1, 0, 1, 1, 0, 1, 1, 0, 0, 0, 0, 1, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 0, 1, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 1, 0, 1, 1, 0, 1, 1, 0, 1, 0, 0, 0, 1, 1, 0, 1, 0, 1, 0, 1, 1], [0, 1, 0, 1, 0, 1, 1, 0, 0, 1, 0, 1, 1, 1, 0, 0, 1, 1, 1, 1, 1, 0, 0, 0, 1, 1, 1, 1, 0, 0, 0, 0, 1, 1, 0, 0, 1, 0, 0, 0, 0, 0, 0, 1, 1, 0, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 1, 0, 0, 1, 0, 0, 0, 1], [1, 0, 1, 1, 1, 1, 0, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 0, 0, 1, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 0, 0, 0, 1, 0, 1, 1, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1, 0, 0, 0], [1, 1, 1, 0, 1, 0, 1, 1, 1, 1, 0, 1, 0, 1, 1, 0, 1, 0, 0, 0, 1, 1, 1, 0, 0, 0, 1, 1, 0, 1, 0, 1, 0, 1, 1, 1, 1, 1, 0, 0, 1, 0, 1, 0, 0, 1, 0, 0, 0, 1, 1, 0, 1, 1, 1, 0, 1, 0, 0, 0, 1, 1, 0, 1], [0, 0, 1, 1, 0, 0, 1, 1, 1, 1, 0, 1, 1, 0, 1, 0, 1, 1, 1, 1, 0, 0, 1, 1, 1, 1, 0, 1, 0, 0, 1, 1, 1, 0, 0, 1, 0, 1, 0, 0, 1, 0, 0, 1, 1, 0, 0, 1, 1, 0, 1, 0, 1, 1, 0, 0, 1, 0, 1, 1, 0, 1, 0, 1], [0, 1, 1, 0, 0, 1, 1, 0, 1, 0, 0, 0, 0, 1, 1, 0, 1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 1, 1, 0, 0, 1, 1, 1, 0, 1, 0, 1, 1, 1, 1, 1, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0], [1, 0, 1, 0, 0, 1, 0, 1, 1, 1, 1, 0, 1, 0, 1, 1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 0, 1, 1, 1, 1, 0, 0, 1, 1, 1, 0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 0, 1, 1, 0, 0, 0, 0, 1, 1, 1, 0, 0, 0, 1, 0], [1, 1, 0, 1, 0, 0, 0, 0, 0, 1, 0, 1, 0, 0, 1, 0, 0, 0, 1, 1, 0, 0, 0, 0, 1, 1, 1, 1, 0, 0, 1, 1, 1, 0, 0, 1, 1, 0, 0, 1, 0, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 1, 0], [1, 0, 1, 0, 0, 0, 1, 1, 0, 1, 1, 1, 0, 0, 1, 0, 1, 0, 1, 0, 1, 1, 1, 0, 1, 0, 0, 0, 0, 1, 0, 1, 1, 0, 1, 1, 0, 0, 1, 1, 0, 1, 1, 1, 1, 0, 0, 1, 0, 1, 0, 1, 0, 0, 0, 1, 1, 1, 1, 0, 1, 0, 0, 0], [1, 0, 0, 1, 1, 0, 1, 0, 1, 0, 0, 1, 0, 1, 0, 0, 1, 0, 1, 0, 0, 0, 0, 1, 0, 1, 0, 1, 1, 0, 0, 1, 0, 0, 0, 1, 1, 0, 0, 1, 0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 1, 1, 0, 0, 0, 0], [1, 0, 0, 1, 1, 1, 1, 1, 0, 1, 1, 0, 1, 1, 1, 0, 1, 1, 0, 1, 0, 1, 0, 0, 1, 0, 0, 1, 1, 1, 0, 0, 1, 0, 1, 0, 1, 1, 0, 1, 0, 1, 0, 1, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1], [1, 0, 0, 0, 0, 1, 1, 1, 0, 1, 0, 0, 1, 0, 1, 1, 0, 1, 0, 0, 1, 0, 1, 0, 0, 1, 0, 0, 1, 1, 1, 0, 0, 0, 1, 1, 0, 1, 0, 0, 0, 0, 1, 0, 1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 0, 0, 1, 0, 0, 1], [1, 1, 0, 0, 1, 1, 0, 0, 0, 0, 0, 0, 0, 1, 0, 1, 0, 0, 0, 0, 1, 1, 0, 0, 1, 0, 0, 0, 0, 1, 1, 0, 1, 0, 0, 1, 0, 0, 0, 0, 1, 0, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 0, 0, 0, 1, 0, 1, 1, 0, 0, 0, 1, 0], [1, 1, 1, 0, 1, 0, 0, 1, 0, 1, 1, 1, 1, 0, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 1, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 1, 0, 1, 1, 1, 1, 0, 0, 1, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 1, 1, 0, 1, 1, 0, 0], [0, 0, 0, 1, 1, 0, 1, 0, 1, 1, 0, 0, 0, 1, 1, 0, 1, 1, 0, 0, 1, 1, 0, 1, 1, 0, 0, 0, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 0, 1, 0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 1, 0, 1, 1, 1, 0, 1, 0, 0, 0, 0], [1, 0, 0, 1, 1, 1, 0, 0, 1, 0, 1, 1, 1, 0, 0, 0, 1, 0, 1, 1, 1, 1, 1, 0, 0, 0, 1, 1, 1, 1, 0, 1, 1, 0, 1, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 0, 0, 1, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1, 0, 0, 0, 1, 0, 0], [0, 0, 0, 0, 1, 1, 0, 0, 0, 1, 1, 0, 1, 0, 1, 1, 0, 0, 0, 1, 0, 0, 0, 0, 1, 1, 0, 0, 0, 1, 1, 0, 1, 1, 0, 0, 1, 1, 1, 0, 0, 1, 1, 0, 1, 1, 1, 1, 0, 1, 0, 0, 1, 0, 1, 0, 1, 0, 1, 0, 0, 1, 1, 0], [1, 0, 1, 1, 0, 1, 0, 1, 0, 1, 0, 1, 1, 1, 0, 0, 0, 1, 1, 0, 1, 1, 0, 0, 1, 1, 0, 0, 1, 0, 1, 0, 1, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 1, 0, 1, 1, 0, 0], [0, 0, 0, 1, 1, 0, 1, 0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 1, 1, 0, 1, 1, 1, 0, 1, 0, 0, 1, 0, 0, 0, 1, 0, 1, 1, 1, 1, 0, 1, 0, 0, 1, 0, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1, 0, 1, 0, 0, 1, 1, 1, 1, 0, 0, 0], [0, 1, 1, 1, 0, 1, 1, 0, 0, 0, 1, 0, 0, 1, 1, 0, 0, 0, 1, 0, 0, 1, 0, 1, 1, 1, 1, 0, 1, 0, 0, 1, 0, 0, 0, 1, 1, 0, 0, 1, 1, 0, 1, 0, 0, 1, 1, 1, 0, 0, 1, 0, 1, 0, 1, 1, 1, 1, 0, 0, 1, 1, 1, 1], [1, 1, 0, 0, 1, 1, 1, 0, 1, 0, 1, 1, 1, 1, 1, 1, 0, 0, 1, 1, 0, 0, 1, 0, 1, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 1, 0, 0, 0, 1, 0, 1, 0, 0, 0, 0, 1, 1, 1, 1, 1, 1, 0, 1, 0, 1, 1, 1, 0, 0], [1, 1, 0, 1, 1, 0, 1, 1, 0, 0, 1, 1, 0, 0, 1, 1, 1, 0, 0, 0, 1, 1, 1, 1, 0, 0, 1, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1, 1, 0, 1, 0, 0], [0, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 1, 1, 0, 1, 1, 1, 1, 1, 0, 1, 0, 1, 1, 1, 0, 0, 1, 0, 1, 1, 1, 1, 0, 1, 1, 1, 1, 0, 1, 1, 0, 1, 0, 0, 1, 0, 1, 1, 1, 0, 1, 1, 1, 0, 1, 1, 0, 1, 1, 1, 1, 0, 1], [1, 1, 1, 1, 0, 0, 1, 0, 1, 1, 0, 0, 0, 1, 0, 1, 0, 0, 0, 0, 0, 1, 1, 1, 0, 0, 1, 1, 0, 0, 0, 0, 1, 1, 0, 0, 0, 1, 0, 0, 1, 1, 1, 0, 1, 1, 1, 1, 0, 0, 0, 1, 0, 0, 0, 0, 1, 1, 1, 0, 1, 0, 0, 1], [0, 1, 1, 1, 1, 0, 1, 1, 0, 1, 1, 0, 0, 0, 1, 1, 1, 0, 0, 0, 1, 0, 0, 0, 1, 1, 0, 1, 1, 1, 0, 0, 1, 0, 0, 1, 0, 1, 1, 1, 0, 1, 1, 0, 1, 0, 1, 0, 1, 0, 1, 0, 1, 0, 0, 1, 0, 1, 0, 1, 1, 0, 1, 0], [0, 0, 1, 0, 0, 1, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 1, 1, 0, 0, 0, 0, 1, 0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 0, 0, 0, 0, 1, 1, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 1, 0, 1, 0, 0, 1, 1], [0, 1, 1, 0, 0, 1, 1, 1, 1, 0, 0, 0, 1, 1, 0, 1, 1, 0, 1, 0, 0, 0, 0, 1, 0, 1, 1, 0, 1, 0, 1, 1, 0, 1, 0, 0, 1, 0, 0, 0, 1, 1, 0, 0, 0, 0, 0, 1, 1, 0, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 0, 0, 1, 1], [1, 1, 0, 0, 1, 1, 0, 1, 0, 1, 1, 0, 1, 0, 1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 1, 0, 0, 0, 1, 1, 0, 1, 0, 0, 0, 0, 1, 0, 0, 0, 1, 1, 0, 1, 0, 1, 1, 1, 1, 1, 1, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 1, 0, 0], [1, 0, 1, 1, 0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 1, 1, 0, 1, 1, 1, 1, 1, 1, 0, 0, 1, 0, 1, 1, 0, 1, 0, 0, 1, 0, 1, 0, 1, 1, 1, 0, 0, 0, 0, 1, 1, 1, 1, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 1], [1, 0, 1, 1, 1, 1, 1, 0, 1, 0, 0, 1, 0, 1, 0, 0, 0, 0, 0, 1, 0, 1, 0, 1, 0, 1, 0, 1, 1, 1, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1, 1, 0, 1, 0, 0, 0, 1, 1, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 1, 0, 1, 1, 1, 1], [0, 0, 0, 0, 0, 0, 1, 1, 1, 0, 1, 1, 0, 0, 0, 1, 0, 1, 0, 1, 1, 0, 0, 1, 0, 1, 0, 1, 1, 1, 0, 1, 0, 0, 0, 0, 0, 1, 0, 1, 1, 0, 1, 1, 0, 1, 0, 1, 1, 1, 1, 0, 1, 1, 1, 0, 1, 0, 1, 0, 1, 1, 0, 1], [0, 0, 0, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1, 1, 1, 0, 0, 1, 1, 1, 1, 0, 1, 1, 0, 1, 0, 0, 0, 1, 0, 0, 1, 1, 1, 1, 0, 0, 1, 1, 1, 0, 1, 1, 0, 0, 1, 1, 0, 0, 0, 1, 1, 0, 1, 0, 0, 0, 1, 1, 1, 0, 1, 1], [0, 0, 1, 1, 1, 1, 0, 0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 1, 1, 1, 0, 0, 0, 1, 0, 1, 0, 0, 0, 0, 0, 0, 0, 1, 1, 0, 1, 0, 0, 1, 1, 1, 0, 1, 0, 0, 0, 0, 1, 1, 1, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 0, 0, 0], [0, 0, 1, 0, 0, 0, 0, 1, 1, 0, 1, 0, 0, 1, 1, 1, 0, 0, 1, 1, 0, 0, 0, 1, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 1, 1, 0, 1, 1, 1, 0, 1, 0, 0, 0, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 0, 1, 1, 0, 1, 1, 0, 1, 0], [1, 1, 0, 1, 0, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 0, 0, 1, 0, 1, 0, 1, 1, 0, 1, 0, 0, 0, 0, 1, 1, 0, 0, 1, 1, 0, 0, 0, 0, 1, 0, 1, 1, 1, 0, 1, 0, 1, 0, 0, 0, 0, 0, 1, 0, 0, 0, 1, 0, 1, 0, 0, 0], [0, 0, 0, 0, 1, 0, 0, 1, 0, 1, 1, 1, 0, 0, 1, 0, 1, 0, 1, 0, 0, 1, 0, 0, 1, 1, 1, 0, 1, 0, 0, 1, 0, 1, 1, 0, 1, 1, 1, 0, 0, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1, 0, 1, 0, 0, 1, 0, 1, 1, 0, 0, 0, 1, 1], [0, 1, 0, 0, 1, 1, 1, 0, 1, 0, 0, 0, 0, 1, 1, 1, 0, 0, 1, 1, 1, 1, 1, 0, 1, 0, 0, 0, 1, 1, 1, 1, 0, 1, 0, 1, 0, 1, 1, 0, 1, 0, 0, 0, 0, 1, 1, 0, 0, 0, 1, 1, 1, 1, 0, 0, 1, 0, 1, 1, 0, 0, 0, 1], [1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 1, 0, 1, 1, 1, 0, 1, 0, 1, 1, 1, 0, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 1, 1, 1], [1, 1, 1, 1, 0, 1, 1, 1, 0, 0, 0, 1, 0, 1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0, 1, 1, 0, 0, 1, 1, 0, 0, 0, 1, 0, 0, 1, 0, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 1, 1, 0, 1, 0, 1, 0, 0, 1, 0], [0, 1, 0, 1, 1, 1, 1, 1, 0, 0, 0, 0, 1, 1, 1, 1, 0, 0, 0, 0, 1, 1, 1, 1, 0, 0, 0, 1, 0, 1, 1, 1, 0, 1, 1, 1, 1, 1, 0, 1, 1, 0, 0, 0, 0, 1, 0, 1, 1, 1, 0, 1, 1, 1, 0, 1, 0, 0, 0, 1, 1, 1, 1, 0], [1, 0, 1, 0, 1, 1, 0, 0, 0, 0, 1, 0, 0, 1, 1, 1, 1, 0, 0, 1, 0, 1, 0, 0, 1, 1, 1, 1, 0, 1, 1, 0, 1, 0, 1, 0, 0, 0, 1, 1, 0, 0, 0, 0, 0, 0, 1, 1, 0, 0, 1, 0, 0, 0, 1, 0, 1, 0, 0, 1, 0, 1, 0, 1], [1, 0, 1, 1, 1, 0, 0, 0, 1, 1, 1, 0, 0, 1, 1, 1, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 1, 0, 0, 0, 0, 1, 1, 0, 1, 1, 1, 1, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0, 1, 1, 0, 0, 1, 1, 1, 0, 0, 1, 1, 0, 0, 1, 1, 1], [0, 1, 0, 1, 0, 1, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 0, 1, 0, 0, 1, 1, 1, 0, 0, 1, 1, 0, 1, 1, 0, 0, 0, 0, 1, 0, 0, 1, 1, 0, 1, 0, 0, 1, 1, 0, 0, 0, 1, 1, 0, 1, 1, 0, 1, 0, 1, 1, 0, 0, 1, 0, 0, 0], [1, 1, 0, 0, 0, 0, 1, 1, 0, 0, 1, 0, 1, 0, 0, 0, 0, 1, 1, 1, 0, 0, 1, 1, 1, 0, 1, 0, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 0, 1, 1, 1, 0, 1, 0, 0, 1, 0, 1, 0, 0, 1, 0, 0, 1, 1, 0, 1, 0, 1, 0, 1, 0, 0], [0, 1, 1, 0, 1, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1, 0, 1, 1, 0, 1, 0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 0, 0, 0, 1, 0, 0, 0, 1, 1, 1, 0, 0, 0, 0, 0, 0, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 1, 0], [1, 1, 1, 0, 1, 0, 0, 0, 0, 0, 0, 0, 1, 1, 0, 0, 1, 1, 0, 0, 1, 1, 1, 1, 1, 1, 0, 1, 0, 0, 1, 1, 0, 0, 0, 1, 0, 0, 1, 1, 1, 1, 1, 0, 1, 1, 0, 1, 1, 0, 1, 1, 0, 0, 0, 0, 1, 1, 1, 0, 0, 1, 0, 1], [0, 1, 0, 0, 1, 0, 0, 0, 1, 0, 0, 0, 1, 0, 1, 1, 1, 1, 0, 1, 0, 0, 1, 1, 0, 1, 1, 0, 0, 0, 1, 0, 0, 0, 0, 0, 1, 1, 0, 1, 0, 1, 0, 0, 1, 1, 0, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 1, 0, 1, 1, 0, 1, 1], [0, 0, 1, 1, 0, 1, 1, 0, 0, 0, 0, 1, 1, 0, 1, 0, 1, 0, 0, 0, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 1, 0, 0, 0, 0, 0, 1, 0, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 0, 1, 1, 1, 0, 0, 1, 1, 0, 0, 1], [0, 1, 1, 0, 1, 1, 0, 0, 0, 1, 1, 1, 0, 1, 1, 1, 1, 1, 0, 0, 1, 0, 1, 1, 1, 0, 0, 1, 0, 0, 0, 1, 0, 1, 1, 0, 1, 1, 0, 1, 1, 1, 1, 0, 0, 1, 1, 0, 0, 1, 0, 1, 0, 0, 1, 0, 0, 1, 1, 1, 1, 1, 0, 1], [1, 0, 0, 1, 1, 1, 0, 1, 0, 0, 1, 0, 1, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0, 1, 0, 1, 1, 1, 0, 0, 0, 1, 0, 1, 1, 0, 0, 1, 1, 1, 0, 0, 1, 1, 0, 1, 0, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 0, 1, 0, 1, 1, 0], [1, 0, 0, 1, 0, 0, 0, 1, 1, 1, 0, 1, 1, 0, 1, 0, 0, 1, 1, 1, 0, 0, 1, 1, 1, 1, 0, 0, 1, 0, 0, 1, 1, 0, 1, 1, 0, 0, 1, 0, 1, 0, 0, 0, 0, 1, 0, 0, 1, 1, 1, 0, 0, 1, 0, 1, 1, 0, 0, 0, 1, 1, 1, 0], [0, 1, 0, 1, 0, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 1, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 1, 0, 0, 0, 1, 1, 0, 0, 1, 0, 0, 1, 0, 0, 1, 1, 0, 0, 1, 1, 0, 0, 1, 1, 1, 0, 0, 0, 1, 1, 1, 1, 0, 0], [1, 0, 1, 0, 0, 0, 0, 0, 0, 0, 1, 0, 1, 1, 1, 1, 0, 1, 1, 0, 1, 1, 0, 0, 0, 0, 0, 0, 1, 1, 1, 0, 1, 0, 1, 1, 0, 0, 0, 0, 1, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 0, 1, 1, 0, 0, 1, 0, 1, 1, 1, 0, 1, 0], [0, 0, 1, 1, 0, 0, 0, 0, 1, 1, 1, 0, 1, 0, 1, 1, 0, 1, 1, 1, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1, 1, 1, 0, 1, 1, 0, 1, 0, 0, 0, 1, 1, 0, 1, 1, 1, 1, 1, 0, 1, 0, 1, 1, 0, 0, 1, 0, 0, 1], [1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 1, 0, 1, 0, 0, 1, 0, 1, 0, 0, 0, 0, 0, 1, 0, 1, 1, 0, 0, 1, 0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 1, 1, 0, 0, 1, 0, 1, 0, 0, 1, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0, 0, 1, 1, 1], [0, 0, 0, 1, 0, 0, 1, 0, 0, 1, 0, 1, 0, 0, 0, 0, 1, 1, 0, 0, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 1, 0, 1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 0, 0, 1, 1, 1, 1, 0, 1, 1, 1, 0, 0, 0, 0, 1, 0, 0, 1, 0, 1, 0, 0], [1, 0, 1, 1, 1, 1, 1, 0, 0, 0, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 0, 0, 0, 1, 0, 1, 0, 1, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 0, 0, 0, 1, 1, 0, 1, 0, 0, 0, 0, 0, 1, 0, 1, 0, 0, 0, 1, 0, 1, 0, 0, 1, 0, 1], [0, 1, 1, 0, 1, 1, 1, 1, 1, 0, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 1, 1, 0, 1, 1, 0, 1, 1, 1, 0, 0, 0, 1, 1, 1, 0, 0, 0, 0, 0, 0, 1, 1, 0, 1, 0, 1, 0, 0, 0, 0, 1, 0, 1, 1, 0, 0, 0], [0, 1, 0, 0, 0, 0, 1, 0, 0, 1, 0, 0, 1, 1, 1, 0, 0, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 0, 1, 0, 1, 0, 1, 1, 0, 1, 0, 1, 1, 0, 1, 1, 0, 1, 1, 0, 0, 1, 0, 1, 0, 1, 0, 1, 1, 1, 0, 0, 0], [1, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0, 1, 1, 1, 0, 0, 0, 0, 1, 1, 0, 1, 0, 0, 0, 0, 1, 1, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 0, 0, 0, 0, 1, 0, 1, 1, 1, 1, 0, 0, 1, 1, 0, 1, 1, 0, 1, 1, 1, 0, 1, 1, 1], [0, 1, 0, 0, 1, 0, 0, 1, 0, 0, 1, 0, 1, 1, 0, 0, 0, 1, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 0, 0, 0, 0, 0, 0, 1, 0, 1, 0, 1, 0, 1, 0, 0, 1, 1, 1, 0, 0, 0, 1, 1, 1, 1, 0, 0, 1, 1, 0, 1, 1, 0, 0, 1, 1], [0, 1, 0, 0, 0, 1, 1, 0, 0, 0, 1, 0, 0, 1, 1, 0, 1, 1, 1, 0, 0, 1, 1, 0, 0, 1, 1, 0, 0, 0, 1, 1, 1, 0, 0, 1, 1, 0, 1, 0, 1, 0, 1, 0, 0, 1, 0, 0, 0, 0, 1, 1, 0, 0, 1, 0, 1, 1, 0, 0, 1, 0, 0, 1], [1, 1, 0, 1, 0, 0, 0, 1, 1, 0, 1, 1, 1, 0, 1, 0, 0, 1, 0, 1, 1, 0, 1, 0, 0, 1, 0, 1, 1, 1, 0, 0, 0, 0, 1, 1, 0, 0, 1, 0, 1, 0, 0, 0, 0, 1, 1, 0, 1, 0, 0, 0, 1, 0, 1, 1, 1, 1, 0, 1, 1, 0, 0, 0], [1, 0, 0, 0, 0, 1, 1, 0, 0, 0, 0, 0, 1, 1, 0, 0, 0, 0, 1, 0, 1, 1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 1, 0, 1, 0, 1, 1, 0, 1, 1, 1, 1, 0, 0, 1, 0, 0, 0, 0, 1, 0, 1, 1, 1, 1, 0, 0, 0, 1, 0, 1, 0, 0], [1, 0, 1, 1, 1, 0, 0, 1, 1, 0, 1, 1, 0, 1, 0, 1, 0, 0, 0, 0, 1, 0, 0, 1, 0, 1, 1, 0, 1, 1, 1, 0, 0, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 1, 0, 1, 0, 1, 1, 1, 1, 0, 1, 0, 0], [0, 0, 0, 0, 0, 1, 0, 0, 0, 1, 0, 1, 1, 0, 1, 1, 0, 0, 1, 1, 0, 0, 1, 1, 0, 0, 0, 0, 1, 0, 1, 0, 1, 1, 1, 1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 1, 0, 0, 0, 1, 0, 1, 0, 1, 1, 0, 1, 1, 1, 0, 1, 0, 1, 1], [1, 1, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 0, 1, 0, 1, 0, 1, 0, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 0, 1, 1, 0, 1, 0, 0, 0, 0, 1, 1, 0, 1, 0, 0, 0, 1, 0, 1, 0, 0, 0, 1, 1, 1, 1, 1, 0, 0, 1, 0, 1, 0, 1, 0], [0, 1, 0, 0, 0, 0, 1, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 1, 1, 0, 1, 0, 1, 0, 1, 0, 0, 1, 0, 0, 0, 0, 1, 1, 0, 0, 1, 1, 1, 0, 1, 1, 0, 1, 1, 1, 0, 1, 0, 1, 1, 1, 1, 1], [1, 1, 0, 1, 0, 1, 0, 1, 0, 1, 0, 0, 0, 1, 1, 1, 0, 0, 0, 0, 1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 0, 0, 0, 1, 1, 1, 1, 0, 1, 0, 1, 1, 1, 1, 1, 0, 0, 1, 0, 0, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 1, 1, 1], [0, 1, 0, 0, 1, 0, 1, 0, 1, 1, 0, 0, 1, 0, 0, 1, 0, 1, 1, 1, 1, 0, 1, 1, 1, 0, 0, 0, 1, 0, 0, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 1, 1, 1, 0, 0, 1, 0, 1, 0, 1, 0, 1, 1, 1, 0, 0, 0, 1, 0, 0, 0, 1, 1], [1, 1, 0, 0, 0, 0, 1, 1, 1, 0, 0, 1, 0, 0, 1, 0, 1, 1, 0, 1, 0, 0, 0, 1, 0, 1, 1, 1, 0, 0, 1, 0, 1, 1, 0, 1, 0, 1, 1, 0, 0, 1, 1, 0, 0, 1, 1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0], [0, 1, 1, 0, 0, 0, 1, 1, 0, 1, 0, 1, 0, 1, 1, 1, 1, 1, 1, 0, 0, 1, 1, 1, 1, 0, 0, 1, 1, 0, 1, 0, 1, 0, 0, 1, 1, 0, 1, 1, 1, 0, 0, 0, 1, 0, 0, 0, 1, 0, 0, 1, 1, 0, 0, 0, 1, 1, 0, 1, 1, 1, 0, 1], [1, 0, 1, 1, 1, 0, 1, 0, 0, 0, 0, 0, 1, 1, 0, 1, 0, 1, 1, 0, 1, 1, 1, 0, 0, 0, 1, 1, 1, 1, 0, 1, 0, 0, 1, 0, 1, 0, 0, 0, 1, 0, 0, 1, 0, 0, 0, 0, 0, 1, 0, 1, 1, 1, 0, 1, 1, 0, 1, 0, 0, 0, 1, 0], [1, 1, 0, 0, 1, 0, 0, 1, 0, 1, 1, 1, 0, 0, 1, 0, 1, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0, 1, 1, 0, 0, 0, 1, 0, 1, 0, 1, 0, 0, 0, 1, 1, 0, 1, 1, 0, 1, 0, 1, 1, 0, 0, 0, 0, 1, 0, 1, 1, 0, 1, 1, 1, 0, 0], [0, 1, 1, 0, 1, 0, 1, 1, 1, 0, 1, 0, 1, 1, 0, 0, 1, 0, 1, 1, 0, 1, 1, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 0, 1, 1, 0, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1, 1, 0, 1, 0, 0, 1, 1, 0, 0, 0, 1, 0, 0, 1, 0, 0, 0], [0, 1, 1, 0, 0, 0, 0, 0, 0, 1, 0, 1, 1, 0, 1, 1, 1, 1, 0, 0, 1, 1, 1, 0, 1, 1, 0, 0, 0, 1, 1, 0, 1, 1, 1, 0, 1, 1, 0, 0, 1, 0, 0, 0, 1, 1, 1, 0, 0, 0, 1, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0], [0, 1, 0, 1, 0, 1, 0, 1, 0, 1, 0, 1, 0, 1, 0, 1, 0, 0, 1, 1, 1, 0, 1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 1, 0, 0, 0, 0, 0, 1, 1, 0, 0, 1, 0, 1, 1, 1, 1, 1, 0, 0, 0, 1, 0, 0, 0, 0, 0, 1, 1], [1, 0, 0, 1, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 1, 0, 1, 0, 1, 1, 0, 0, 1, 1, 0, 1, 0, 0, 0, 1, 1, 0, 0, 1, 0, 0, 1, 1, 1, 0, 1, 0, 0, 0, 1, 1, 1, 1, 1, 0, 1, 0, 0, 0, 1, 1, 0, 1, 0, 1, 1, 1, 1, 1], [1, 0, 0, 1, 1, 0, 1, 1, 1, 1, 0, 1, 0, 1, 1, 0, 1, 0, 0, 0, 1, 1, 0, 0, 0, 0, 0, 0, 0, 1, 1, 0, 0, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 1, 0, 1, 1, 1, 0, 1, 0, 1, 0, 0, 0, 0, 0, 1, 1, 1, 1, 1, 0, 1], [0, 1, 0, 1, 1, 0, 1, 0, 0, 1, 1, 1, 0, 1, 1, 0, 0, 1, 0, 1, 0, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 1, 0, 1, 0, 0, 0, 0, 1, 0, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 0, 0, 1, 1, 0, 1, 0, 0, 0, 1, 0], [0, 0, 0, 1, 0, 1, 0, 1, 0, 1, 1, 0, 0, 1, 0, 1, 1, 1, 0, 1, 1, 0, 1, 0, 1, 1, 0, 1, 0, 0, 0, 0, 1, 1, 0, 0, 1, 1, 0, 1, 0, 1, 1, 0, 0, 0, 0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 0, 1, 1, 1, 0, 0, 1, 1], [0, 0, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 1, 0, 1, 1, 0, 0, 1, 1, 1, 0, 1, 0, 0, 1, 0, 1, 1, 1, 1, 0, 0, 1, 1, 1, 1, 1, 0, 1, 1, 0, 1, 1, 0, 1, 0, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1], [0, 1, 1, 0, 0, 0, 0, 0, 1, 1, 1, 1, 1, 1, 0, 1, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 1, 0, 0, 0, 1, 1, 0, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 1, 1, 1, 1, 1, 0, 0, 1, 1, 0, 1, 1, 1, 0, 1, 0, 1, 1, 0, 0], [1, 0, 1, 1, 0, 1, 1, 0, 0, 1, 0, 1, 1, 1, 1, 0, 0, 1, 0, 1, 0, 1, 1, 0, 0, 1, 1, 0, 0, 0, 1, 1, 0, 1, 1, 0, 1, 0, 1, 1, 1, 0, 1, 0, 0, 0, 1, 1, 0, 0, 1, 1, 1, 0, 1, 1, 1, 0, 1, 0, 0, 1, 0, 0], [1, 0, 1, 0, 0, 1, 0, 1, 1, 1, 1, 0, 0, 0, 1, 1, 1, 0, 0, 1, 0, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 1, 0, 0, 1, 1, 0, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0, 1, 1, 1, 0, 1, 0, 0], [0, 0, 1, 0, 1, 1, 0, 1, 0, 0, 1, 0, 1, 1, 0, 0, 1, 1, 0, 1, 1, 1, 0, 0, 1, 0, 0, 0, 1, 1, 0, 1, 0, 1, 0, 1, 0, 0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 1, 0, 0], [0, 0, 1, 0, 1, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 1, 0, 0, 1, 1, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 0, 1, 1, 1, 0, 1, 1, 0, 1, 0, 0, 1, 0, 1, 0, 0, 1, 1, 1, 0, 1, 0, 1, 1, 0, 1, 1, 0, 0, 1, 0], [1, 0, 0, 0, 1, 1, 0, 0, 1, 0, 1, 0, 1, 0, 0, 0, 0, 0, 0, 1, 1, 1, 0, 0, 1, 0, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 1, 1, 0, 1, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1, 0, 1, 0, 1, 0, 0, 0], [0, 0, 1, 1, 1, 1, 0, 0, 1, 1, 0, 1, 1, 1, 0, 0, 1, 1, 1, 0, 0, 1, 1, 0, 1, 0, 0, 0, 0, 1, 1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 1, 0, 1, 0, 0, 0, 0, 0, 1, 0, 1, 1, 1, 0, 1, 1, 1, 1, 0, 1, 1, 0, 1], [1, 1, 0, 0, 1, 0, 1, 0, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1, 0, 1, 0, 0, 0, 0, 0, 1, 1, 1, 0, 0, 1, 0, 1, 0, 0, 1, 1, 0, 1, 1, 1, 0, 0, 1, 1, 1, 0, 1, 0, 1, 1, 0, 0, 1, 0, 0, 1, 0, 1, 1, 0, 0, 1, 1], [1, 0, 1, 1, 1, 0, 0, 1, 0, 1, 1, 1, 0, 0, 1, 0, 0, 0, 1, 0, 0, 0, 0, 1, 1, 0, 0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 1, 1, 0, 0, 0, 0, 1, 1, 0, 0, 1, 1, 1, 0, 1, 0, 0, 0, 1, 0, 0, 1, 1, 0, 1, 0, 1, 0], [0, 0, 1, 1, 1, 1, 0, 1, 1, 1, 0, 0, 1, 1, 1, 1, 0, 0, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 1, 1, 0, 1, 1, 1, 1, 0, 0, 1, 1, 0, 0, 1, 0, 0, 0, 1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 1, 0, 1, 1, 1, 1, 0, 1, 1], [1, 1, 0, 1, 0, 0, 0, 1, 0, 0, 0, 1, 1, 0, 0, 0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 0, 0, 0, 0, 1, 1, 1, 1, 1, 0, 1, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 0, 0, 1, 1, 0, 1, 0, 0, 1, 0, 1], [0, 1, 1, 0, 0, 0, 1, 0, 0, 1, 0, 1, 1, 1, 0, 1, 1, 0, 0, 1, 0, 1, 1, 1, 0, 1, 1, 0, 0, 1, 0, 0, 1, 0, 1, 1, 1, 0, 0, 0, 0, 0, 1, 0, 1, 0, 0, 0, 1, 0, 1, 1, 0, 0, 0, 0, 0, 1, 1, 1, 1, 0, 1, 0], [0, 0, 0, 0, 1, 1, 1, 1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 1, 1, 1, 0, 0, 0, 1, 0, 1, 0, 0, 1, 0, 1, 1, 1, 0, 1, 0, 1, 0, 0, 0, 0, 0, 1, 1, 1, 0, 0, 1, 1, 1, 0, 1, 1, 1, 1, 0, 0, 1, 1, 1, 1, 1, 1], [1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 1, 0, 0, 0, 0, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1, 0, 1, 0, 1, 1, 1, 0, 1, 1, 0, 0, 0, 0, 1, 1, 0, 0, 1, 0, 0, 1, 1, 0, 0, 0, 0, 1, 1, 1, 1, 0, 0, 1, 0, 1], [1, 1, 1, 0, 0, 0, 1, 0, 0, 0, 0, 0, 1, 0, 1, 1, 1, 1, 0, 1, 0, 1, 1, 0, 0, 1, 0, 1, 0, 0, 1, 1, 1, 0, 0, 1, 0, 0, 0, 0, 1, 1, 1, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0], [1, 0, 1, 1, 1, 1, 0, 1, 1, 0, 0, 0, 0, 1, 1, 1, 1, 1, 0, 0, 1, 1, 0, 1, 0, 0, 0, 0, 1, 1, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 0, 1, 0, 1, 0, 1, 1, 0, 0, 0, 1, 1, 0, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1], [0, 1, 0, 0, 0, 1, 1, 1, 0, 0, 1, 1, 0, 1, 0, 0, 0, 1, 1, 1, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 1, 0, 0, 0, 1, 0, 1, 1, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 0, 1, 0, 1, 0, 0, 1, 0, 0, 0, 1, 1, 1, 0], [1, 0, 0, 0, 1, 1, 1, 0, 1, 1, 1, 0, 0, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 0, 1, 1, 0, 0, 1, 1, 0, 1, 0, 1, 0, 0, 0, 1, 0, 0, 1, 1, 0, 0, 0, 1, 0, 0, 1, 0, 0, 1, 1, 0, 0, 1, 0], [0, 1, 0, 0, 1, 1, 1, 0, 1, 0, 1, 0, 1, 0, 1, 0, 0, 0, 0, 1, 1, 0, 1, 0, 1, 0, 1, 0, 1, 1, 1, 0, 1, 1, 1, 0, 1, 0, 1, 0, 1, 0, 0, 0, 1, 1, 0, 0, 0, 0, 0, 1, 1, 0, 1, 0, 1, 0, 0, 0, 0, 1, 0, 0], [0, 0, 0, 0, 0, 1, 0, 1, 0, 1, 1, 0, 0, 0, 1, 1, 0, 1, 1, 0, 1, 0, 1, 1, 0, 0, 1, 1, 1, 1, 0, 0, 0, 1, 1, 0, 0, 0, 1, 0, 0, 1, 1, 0, 1, 1, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 1, 0, 0, 1, 1, 0, 0, 0], [1, 0, 0, 1, 0, 1, 0, 1, 0, 0, 0, 1, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 0, 1, 0, 1, 0, 1, 0, 1, 0, 0, 1, 1, 1, 0, 0, 0, 0, 0, 1, 1, 0, 1, 0, 0, 1, 0, 1, 1, 1, 0, 1, 0, 1, 1, 1, 1, 0, 0, 0], [0, 0, 0, 1, 1, 0, 1, 0, 1, 1, 1, 0, 0, 1, 1, 1, 0, 0, 1, 0, 0, 1, 1, 1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 0, 0, 0, 0, 0, 1, 1, 1, 0, 0, 0, 0, 0, 1, 1, 0, 1, 0, 0, 1, 1, 1, 0, 0, 0, 1, 1, 0, 1, 0, 1], [0, 0, 0, 0, 1, 0, 0, 1, 1, 0, 0, 1, 0, 1, 0, 1, 1, 0, 1, 1, 1, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1, 0, 0, 1, 1, 0, 1, 1, 1, 0, 1, 0, 1, 1, 0, 1, 1, 1, 0, 1, 0, 0, 0, 0, 1, 0, 0, 0, 1, 0, 0, 0, 1, 1], [0, 1, 0, 0, 1, 1, 1, 0, 0, 0, 1, 1, 0, 0, 0, 1, 1, 0, 1, 0, 1, 1, 0, 1, 1, 0, 1, 0, 0, 1, 0, 0, 0, 0, 0, 1, 0, 1, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 1, 1, 0, 0, 1, 0, 1, 0, 1, 1, 0, 1, 0, 0, 0], [0, 0, 0, 0, 1, 1, 0, 1, 1, 1, 0, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 1, 0, 0, 1, 0, 0, 1, 1, 0, 1, 1, 0, 0, 0, 1, 1, 1, 1, 1, 0, 1, 1, 1, 0, 1, 0, 1, 0, 1, 1, 1, 1, 1, 0, 1, 0, 1, 1, 1, 1, 0, 0, 0], [1, 1, 1, 1, 0, 1, 0, 1, 0, 1, 0, 0, 0, 0, 1, 1, 0, 0, 1, 1, 0, 1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 1, 0, 0, 1, 1, 0, 0, 0, 0, 1, 1, 0, 0, 1, 1, 1, 0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 1, 0, 1, 0, 1, 1], [0, 1, 0, 0, 1, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0, 1, 1, 0, 0, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 1, 1, 0, 1, 1, 0, 1, 0, 0, 1, 1, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0, 0], [1, 1, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 1, 0, 0, 1, 0, 1, 1, 0, 0, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 1, 1, 0, 0, 1, 0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 1, 1, 0, 0, 1, 1, 1, 0, 0, 0, 1, 0, 1, 0, 1, 1, 1, 1], [0, 0, 1, 0, 0, 1, 1, 1, 1, 1, 0, 0, 0, 1, 0, 0, 1, 0, 1, 0, 0, 1, 0, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1, 1, 0, 0, 1, 1, 0, 1, 1, 1, 0, 0, 0, 0, 1, 1, 0, 1, 0, 1, 0, 1, 0, 0, 1, 0, 0, 1, 0, 0], [0, 0, 1, 1, 0, 0, 0, 1, 1, 1, 0, 1, 1, 0, 0, 1, 0, 1, 1, 0, 0, 0, 0, 1, 1, 0, 1, 1, 1, 1, 1, 0, 0, 1, 1, 1, 0, 1, 1, 0, 0, 0, 1, 1, 1, 0, 1, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 1, 0, 0, 1, 0, 0, 1], [1, 0, 1, 0, 0, 0, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 1, 0, 0, 0, 1, 0, 1, 0, 0, 0, 0, 1, 0, 0, 1, 0, 1, 1, 0, 0, 1, 1, 1, 0, 1, 1, 0, 1, 1, 0, 0, 0, 0, 1, 1, 1, 1, 1, 1], [0, 1, 0, 0, 1, 0, 0, 0, 0, 0, 1, 0, 1, 1, 1, 1, 1, 0, 1, 0, 0, 0, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 1, 1, 1, 0, 1, 1, 0, 0, 1, 1, 0, 1, 0, 0, 0, 0, 1, 1, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1, 1, 1, 1, 0], [0, 1, 1, 1, 0, 0, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 0, 1, 0, 1, 0, 1, 0, 0, 1, 1, 1, 0, 0, 0, 1, 1, 1, 1, 0, 1, 1, 0, 0, 1, 1, 1, 1, 0, 0, 1, 1, 1, 0, 0, 0, 1, 1, 0, 1, 1, 0, 0, 0, 0, 1, 0, 0, 1], [1, 1, 0, 1, 1, 0, 1, 0, 0, 1, 0, 1, 0, 1, 1, 0, 1, 1, 0, 0, 1, 0, 1, 1, 1, 1, 0, 1, 1, 1, 0, 0, 0, 0, 1, 0, 0, 1, 1, 1, 0, 1, 1, 1, 1, 0, 0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 0, 0, 0, 1, 0, 1, 0, 1], [0, 0, 0, 1, 1, 1, 0, 0, 1, 1, 0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 1, 0, 1, 1, 1, 1, 0, 0, 1, 0, 1, 0, 0, 0, 0, 1, 1, 0, 1, 0, 0, 1, 1, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1, 0, 1, 1, 1, 1, 0, 1, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1, 0, 1, 1, 1, 0, 0, 1, 0, 1, 1, 1, 0, 0, 1, 1, 1, 1, 0, 1, 1, 0, 1, 0, 1, 1, 1, 0, 0, 1, 0, 1, 0, 0, 0, 0, 0, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 0, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 1], [0, 1, 0, 0, 0, 0, 0, 0, 1, 1, 0, 1, 1, 1, 0, 1, 0, 1, 0, 0, 1, 0, 1, 0, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 0, 0, 0, 0, 0, 1, 0, 1, 1, 1, 1, 1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1, 0, 0], [1, 1, 1, 0, 1, 0, 1, 0, 1, 0, 0, 1, 1, 0, 1, 1, 1, 1, 0, 0, 1, 1, 1, 1, 0, 1, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 0, 1, 1, 1, 1, 0, 1, 0, 1, 0, 1, 0, 1, 1, 0, 1, 1, 1, 0, 0, 1, 0, 0, 1, 1, 0, 0, 0], [1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 1, 0, 0, 0, 1, 0, 1, 0, 0, 1, 0, 0, 1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 1, 0, 0, 0, 1, 1, 1, 1, 1, 1, 0, 1, 0, 0, 1, 0, 1, 0, 0, 0, 0, 0, 0, 0, 1, 0, 1, 0, 0, 0, 1, 1], [1, 1, 1, 1, 1, 0, 1, 0, 0, 1, 0, 1, 0, 0, 1, 0, 0, 1, 1, 1, 0, 1, 0, 0, 0, 1, 0, 1, 0, 0, 1, 0, 0, 1, 0, 0, 1, 0, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 0, 0, 1, 0, 1, 0, 1, 0, 1, 0, 1, 1, 1, 1, 0, 1], [1, 0, 0, 0, 0, 1, 1, 0, 1, 1, 0, 0, 0, 0, 1, 1, 1, 0, 1, 0, 1, 0, 1, 1, 0, 1, 1, 1, 1, 0, 0, 0, 0, 1, 1, 1, 1, 1, 0, 0, 1, 1, 1, 1, 0, 1, 1, 1, 0, 0, 0, 1, 0, 1, 1, 1, 0, 0, 0, 1, 1, 1, 1, 1], [0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 1, 1, 1, 1, 1, 0, 1, 0, 1, 0, 0, 1, 1, 1, 1, 0, 1, 0, 0, 1, 1, 1, 0, 1, 0, 1, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0, 1, 1, 0, 0, 0, 0, 0, 0, 0, 1, 0, 1, 1, 1, 0, 0, 1], [1, 0, 0, 1, 0, 0, 1, 0, 0, 1, 0, 1, 1, 1, 0, 0, 0, 0, 0, 1, 1, 0, 1, 1, 0, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 0, 0, 1, 0, 0, 1, 0, 0, 0, 0, 0, 1, 1, 1, 1, 1, 0, 1, 1, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1], [0, 0, 0, 1, 0, 0, 1, 0, 1, 1, 0, 0, 1, 0, 0, 1, 1, 0, 1, 1, 0, 0, 1, 0, 0, 1, 1, 0, 1, 1, 1, 0, 0, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1, 0, 0, 0, 0, 1, 0, 0, 1, 1, 1, 0, 1, 1, 0], [0, 1, 0, 0, 0, 0, 0, 0, 1, 0, 1, 1, 1, 1, 0, 1, 1, 0, 0, 0, 0, 0, 1, 1, 0, 1, 0, 0, 1, 0, 1, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 1, 0, 0, 1, 0, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 1, 0, 1, 1, 0, 0, 0], [1, 0, 0, 0, 1, 1, 0, 0, 1, 1, 0, 0, 1, 1, 1, 0, 1, 0, 0, 1, 1, 0, 0, 0, 0, 0, 0, 1, 1, 0, 0, 1, 0, 0, 0, 0, 0, 0, 1, 1, 0, 0, 1, 0, 1, 1, 1, 0, 0, 1, 0, 0, 1, 1, 1, 1, 0, 0, 0, 0, 1, 0, 0, 0], [1, 1, 1, 0, 0, 1, 1, 1, 0, 1, 0, 1, 1, 0, 0, 1, 0, 0, 0, 1, 0, 0, 0, 0, 1, 1, 1, 1, 1, 1, 0, 1, 1, 0, 0, 1, 0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 0, 1, 1, 0, 0, 0, 1, 1, 0, 1, 0, 1, 0, 1, 1, 1, 1, 0], [0, 1, 0, 0, 1, 0, 1, 0, 1, 1, 0, 1, 0, 0, 0, 0, 1, 1, 1, 1, 1, 0, 0, 0, 1, 0, 1, 1, 0, 1, 0, 0, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 1, 0, 0, 1, 1, 0, 0, 0, 1, 0, 0, 0, 0, 1, 1, 0, 0, 0, 0, 1, 1, 0], [0, 1, 0, 1, 0, 0, 0, 1, 0, 1, 1, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1, 1, 1, 0, 0, 1, 1, 1, 0, 1, 0, 0, 0, 0, 1, 1, 1, 1, 0, 1, 0, 0, 0, 0, 0, 1, 1, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 0], [1, 1, 1, 0, 0, 0, 1, 1, 0, 1, 0, 1, 1, 1, 1, 0, 0, 0, 1, 1, 1, 0, 0, 1, 0, 1, 1, 0, 0, 1, 0, 1, 0, 0, 1, 0, 1, 1, 0, 1, 1, 0, 1, 0, 1, 1, 1, 1, 1, 1, 0, 0, 1, 0, 1, 0, 1, 1, 0, 1, 1, 0, 0, 0], [0, 0, 1, 1, 0, 1, 0, 0, 0, 1, 1, 0, 1, 0, 1, 1, 1, 0, 1, 0, 1, 1, 1, 1, 0, 0, 0, 1, 1, 1, 0, 0, 0, 0, 1, 0, 0, 1, 1, 1, 1, 1, 1, 0, 0, 0, 1, 1, 0, 0, 0, 1, 1, 1, 0, 0, 1, 0, 0, 1, 1, 0, 0, 0], [1, 1, 1, 1, 0, 0, 0, 0, 1, 1, 0, 0, 0, 1, 1, 1, 0, 0, 0, 0, 0, 1, 0, 1, 0, 1, 0, 1, 0, 1, 0, 1, 1, 1, 1, 1, 0, 1, 0, 1, 0, 1, 1, 0, 0, 0, 1, 1, 1, 1, 0, 0, 0, 1, 1, 0, 0, 0, 1, 1, 1, 0, 0, 0], [0, 1, 1, 0, 1, 1, 0, 0, 1, 1, 1, 1, 0, 1, 1, 1, 1, 0, 0, 0, 1, 1, 0, 1, 1, 0, 1, 0, 1, 0, 0, 0, 0, 1, 1, 1, 0, 1, 0, 0, 1, 0, 1, 1, 0, 0, 1, 1, 0, 0, 1, 1, 0, 1, 1, 0, 1, 0, 0, 0, 0, 1, 0, 1], [1, 1, 1, 1, 0, 1, 1, 0, 1, 1, 1, 0, 0, 1, 1, 1, 1, 0, 1, 0, 1, 1, 1, 0, 0, 1, 0, 1, 0, 1, 0, 1, 1, 1, 0, 1, 0, 0, 0, 0, 1, 0, 0, 0, 1, 1, 0, 0, 0, 1, 1, 1, 0, 1, 1, 1, 1, 0, 0, 1, 0, 1, 0, 1], [1, 1, 0, 1, 0, 0, 0, 0, 1, 0, 1, 0, 1, 0, 0, 1, 0, 0, 1, 1, 0, 1, 0, 1, 1, 0, 1, 0, 0, 1, 1, 0, 0, 1, 0, 0, 0, 1, 0, 0, 1, 1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0, 1, 1, 1, 0, 1, 0, 1, 0, 1, 1], [1, 0, 0, 1, 1, 0, 1, 1, 0, 0, 0, 1, 0, 0, 1, 0, 1, 1, 1, 1, 0, 0, 0, 0, 1, 0, 0, 1, 0, 1, 1, 0, 0, 1, 0, 1, 1, 0, 0, 1, 1, 0, 0, 0, 0, 1, 1, 0, 1, 0, 0, 1, 1, 1, 0, 0, 1, 0, 0, 0, 1, 0, 0, 1], [0, 1, 0, 0, 1, 1, 1, 1, 0, 1, 1, 0, 1, 0, 1, 0, 1, 1, 1, 1, 0, 1, 0, 0, 1, 0, 1, 1, 1, 1, 0, 1, 1, 1, 0, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1, 0, 1, 1, 1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0], [0, 0, 0, 1, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 1, 1, 0, 0, 1, 0, 1, 1, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1, 0, 0, 1, 1, 0, 0, 1, 0, 0, 1, 0, 0, 0, 0, 0, 0, 1, 0, 0, 1, 0, 1, 0, 0, 0, 0, 0, 1, 0], [1, 0, 0, 0, 1, 0, 1, 0, 1, 0, 0, 0, 1, 0, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 0, 1, 0, 0, 0, 1, 1, 1, 1, 0, 0, 1, 1, 1, 0, 0, 0, 0, 1, 1, 0, 0, 1, 1, 0, 0, 1, 0, 1, 0, 0, 0, 0, 1, 0, 0, 0, 1, 1, 0], [0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0, 0, 1, 0, 1, 0, 0, 1, 0, 0, 0, 1, 1, 0, 0, 0, 1, 1, 0, 1, 0, 0, 0, 1, 1, 1, 1, 0, 0, 0, 1, 0, 1, 0, 1, 1, 0, 0, 0, 1, 0, 0, 0, 1, 1, 1, 0, 0, 1, 0, 0, 0], [0, 1, 0, 1, 0, 0, 1, 1, 1, 0, 0, 0, 1, 0, 0, 1, 1, 0, 1, 0, 1, 1, 1, 1, 0, 1, 1, 1, 0, 1, 0, 1, 0, 1, 0, 0, 1, 0, 0, 0, 1, 1, 0, 1, 0, 1, 1, 1, 1, 0, 0, 1, 0, 1, 1, 0, 1, 1, 1, 1, 0, 0, 1, 0], [0, 0, 0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 1, 1, 0, 0, 0, 0, 0, 1, 1, 0, 1, 1, 1, 1, 1, 0, 1, 1, 1, 0, 0, 1, 1, 0, 1, 0, 1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 0, 0, 1, 0, 1, 1, 0, 1, 0, 1, 1, 0, 1, 0, 1, 0], [1, 0, 1, 0, 1, 0, 1, 1, 1, 0, 1, 0, 0, 1, 0, 1, 1, 1, 1, 1, 1, 0, 0, 0, 1, 1, 0, 1, 1, 0, 0, 1, 1, 1, 0, 0, 0, 0, 0, 1, 0, 0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 0, 0, 1, 1, 1, 0, 1, 1, 0, 0, 0, 0, 1], [0, 0, 1, 0, 1, 1, 0, 0, 0, 0, 0, 1, 1, 0, 0, 0, 0, 1, 1, 1, 1, 1, 0, 1, 0, 0, 1, 1, 1, 0, 1, 0, 0, 1, 1, 0, 0, 0, 1, 0, 0, 0, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 0, 1, 1, 0, 1, 0, 0], [0, 0, 0, 1, 1, 1, 0, 1, 1, 0, 1, 1, 0, 1, 0, 1, 0, 0, 1, 1, 1, 0, 1, 1, 0, 0, 0, 0, 1, 0, 1, 0, 0, 0, 0, 0, 1, 1, 1, 1, 1, 1, 0, 1, 0, 1, 1, 1, 1, 1, 0, 1, 0, 0, 1, 0, 1, 0, 1, 1, 1, 1, 1, 0], [0, 1, 1, 0, 1, 1, 1, 0, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 0, 1, 1, 1, 0, 1, 0, 1, 0, 1, 1, 0, 0, 0, 1, 0, 0, 0, 1, 0, 1, 0, 0, 0, 0, 0, 1, 1, 0, 0, 1, 1, 1, 1, 1, 0, 0, 1, 1, 0, 1, 1, 1, 0, 0, 0], [1, 1, 1, 1, 0, 0, 0, 1, 1, 1, 0, 0, 1, 1, 1, 0, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 0, 1, 1, 0, 1, 0, 0, 0, 0, 0, 0, 1, 1, 1, 0, 0, 0, 1, 0, 1, 0, 0, 1, 0, 1, 1, 0, 0, 0], [0, 1, 0, 0, 1, 0, 0, 1, 0, 0, 1, 1, 0, 0, 0, 0, 1, 1, 0, 1, 0, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 1, 0, 0, 1, 0, 0, 1, 1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 1, 0, 0, 1, 0, 1, 1, 0, 0, 1, 0, 0, 1, 0, 1], [1, 1, 1, 0, 0, 0, 1, 1, 0, 1, 1, 1, 0, 1, 1, 0, 0, 0, 0, 1, 1, 1, 0, 0, 1, 0, 0, 0, 1, 0, 0, 0, 1, 0, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 0, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 0, 0, 1, 1, 0], [1, 0, 0, 0, 0, 1, 0, 1, 0, 1, 0, 1, 1, 0, 0, 0, 1, 1, 1, 0, 1, 1, 0, 0, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 1, 1, 1, 0, 1, 0, 0, 1, 1, 0, 0, 0, 0, 0, 1, 1, 1, 1, 0], [0, 0, 1, 1, 0, 1, 0, 1, 0, 0, 1, 0, 0, 0, 1, 0, 0, 1, 0, 0, 1, 1, 0, 0, 1, 0, 1, 1, 0, 1, 1, 0, 1, 1, 1, 0, 1, 0, 0, 0, 0, 1, 0, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 1, 0], [1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 1, 1, 1, 0, 1, 0, 0, 0, 0, 0, 1, 1, 0, 1, 1, 1, 1, 1, 0, 1, 1, 1, 0, 0, 1, 1, 0, 0, 1, 0, 1, 1, 0, 1, 1, 1, 0, 1, 0, 1, 0, 1, 0, 0, 0, 0, 0, 1, 1, 0, 1, 0, 0, 0], [1, 0, 1, 0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 0, 1, 0, 1, 1, 0, 1, 1, 0, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 1, 1, 0, 0, 1, 0, 1, 0, 0, 1, 0, 1, 1, 0, 1, 1, 1, 1, 0, 0, 1, 1], [1, 1, 0, 1, 1, 1, 0, 0, 1, 1, 0, 0, 0, 1, 1, 1, 0, 0, 0, 0, 1, 0, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 1, 0, 1, 0, 1, 0, 0, 0, 1, 1, 0, 0, 0, 0, 0, 1, 1, 1, 1, 0, 1, 0, 0, 1, 0, 1, 1, 0, 0, 0, 0, 0], [1, 1, 1, 0, 1, 1, 0, 1, 0, 0, 0, 0, 0, 0, 1, 0, 1, 0, 1, 1, 1, 1, 1, 0, 0, 1, 1, 1, 0, 0, 1, 1, 0, 0, 0, 0, 1, 1, 1, 0, 0, 1, 0, 0, 0, 1, 0, 0, 1, 0, 1, 1, 1, 0, 1, 0, 0, 0, 0, 0, 0, 1, 1, 0], [0, 0, 1, 1, 1, 1, 1, 0, 1, 0, 1, 1, 1, 0, 0, 1, 1, 1, 0, 0, 0, 0, 1, 1, 0, 1, 0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 1, 0, 0, 0, 1, 0, 1, 0, 1, 1, 0, 0, 1, 0, 1, 0, 0, 0, 1, 1, 0, 0], [0, 0, 1, 0, 1, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 1, 0, 0, 0, 1, 1, 1, 0, 0, 0, 1, 0, 1, 0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 0, 1, 0, 0, 0, 1, 0, 0, 1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 0, 0, 0, 1, 0, 0, 0], [0, 0, 0, 0, 1, 0, 0, 1, 1, 0, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 1, 0, 1, 0, 1, 0, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 0, 0, 0, 1, 1, 0, 1, 0, 0, 0, 1, 0, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 1, 1], [1, 1, 0, 1, 0, 0, 0, 0, 0, 1, 0, 0, 1, 1, 0, 1, 1, 0, 0, 1, 1, 0, 1, 0, 1, 1, 1, 0, 1, 0, 1, 0, 0, 1, 0, 0, 0, 0, 1, 1, 1, 1, 0, 1, 1, 0, 1, 1, 0, 1, 0, 1, 0, 1, 0, 1, 1, 0, 0, 0, 0, 0, 1, 1], [1, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 1, 0, 0, 0, 0, 1, 1, 1, 0, 1, 0, 1, 0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 1, 0, 0, 1, 0, 1, 0, 1, 1, 0, 0, 1, 0, 1, 0, 1, 0, 1, 1, 0, 0, 0, 0, 1, 0, 0, 1, 0, 1, 1, 0], [0, 1, 1, 1, 0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 1, 1, 0, 1, 0, 0, 0, 1, 1, 1, 0, 0, 0, 0, 0, 0, 1, 0, 1, 0, 1, 1, 0, 0, 1, 0, 0, 1, 1, 0, 1, 0, 0, 0, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 0, 0, 0, 1, 1, 1], [1, 1, 0, 1, 1, 1, 1, 0, 0, 1, 1, 1, 0, 1, 1, 0, 0, 0, 0, 0, 1, 1, 0, 0, 0, 0, 1, 0, 0, 0, 1, 0, 1, 0, 1, 1, 0, 0, 1, 0, 1, 1, 0, 0, 1, 0, 1, 0, 1, 1, 0, 0, 0, 1, 0, 0, 1, 0, 0, 0, 0, 1, 0, 1], [0, 1, 0, 0, 0, 0, 0, 1, 1, 1, 0, 1, 0, 1, 1, 1, 1, 0, 0, 1, 1, 1, 1, 0, 0, 1, 1, 1, 0, 1, 1, 0, 0, 1, 1, 1, 0, 0, 1, 0, 1, 1, 0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1, 0, 1, 1, 0, 0, 0, 1, 0, 1], [0, 1, 1, 1, 1, 0, 0, 0, 1, 1, 1, 0, 1, 1, 0, 1, 1, 0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 1, 1, 1, 0, 0, 1, 0, 1, 1, 0, 1, 0, 0, 1, 1, 1, 1, 0, 0, 0, 1, 1, 0, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 1, 0], [1, 0, 1, 1, 1, 0, 1, 1, 0, 1, 0, 1, 0, 0, 0, 0, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 0, 0, 0, 1, 0, 1, 1, 0, 1, 1, 1, 1, 0, 0, 0, 0, 0, 1, 1, 0, 0, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 1, 1, 0, 1, 0, 1], [1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 1, 0, 1, 0, 0, 1, 1, 1, 0, 0, 0, 1, 1, 1, 0, 1, 1, 0, 1, 0, 1, 0, 0, 0, 1, 0, 1, 1, 1, 0, 1, 1, 0, 0, 1, 0, 1, 1, 1, 1, 0, 1, 0], [1, 0, 0, 0, 0, 1, 1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1, 0, 1, 1, 0, 0, 1, 0, 1, 1, 1, 1, 0, 1, 0, 1, 0, 1, 1, 1, 0, 1, 0, 0, 0, 0, 1, 0, 1, 0, 0, 0, 1, 1, 1, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1, 0], [1, 1, 0, 0, 1, 0, 0, 1, 0, 1, 1, 1, 1, 0, 0, 0, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 0, 0, 1, 0, 0, 0, 0, 1, 1, 1, 0, 1, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 1, 0, 1, 1, 0, 0, 1, 1, 1, 1, 0, 0, 1, 1, 0, 1], [0, 1, 1, 0, 0, 1, 0, 0, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 1, 0, 1, 1, 0, 1, 0, 1, 0, 1, 0, 0, 0, 1, 1, 0, 0, 1, 1, 0, 1, 1, 0, 0, 0, 0, 1, 0, 0, 1, 1, 1, 0, 1, 0, 1, 1, 1, 0, 1, 1, 0, 0, 1], [1, 1, 1, 1, 1, 0, 1, 1, 0, 0, 1, 1, 1, 1, 1, 1, 1, 0, 0, 1, 1, 0, 0, 0, 1, 1, 1, 0, 1, 0, 0, 0, 1, 0, 1, 0, 1, 0, 0, 0, 1, 0, 1, 0, 1, 1, 0, 0, 1, 1, 0, 1, 0, 0, 0, 0, 0, 1, 0, 0, 1, 0, 0, 0], [1, 1, 0, 0, 0, 1, 1, 0, 1, 0, 1, 0, 0, 1, 1, 0, 1, 1, 0, 1, 0, 0, 0, 0, 1, 0, 1, 0, 1, 1, 1, 1, 1, 1, 1, 0, 0, 1, 0, 1, 1, 1, 0, 1, 0, 0, 1, 0, 1, 0, 0, 0, 0, 1, 1, 0, 1, 1, 0, 0, 0, 1, 0, 0], [1, 1, 1, 1, 0, 0, 1, 1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 0, 1, 0, 0, 1, 0, 1, 0, 1, 0, 1, 0, 1, 1, 0, 0, 0, 1, 1, 1, 0, 0, 0, 0, 0, 1, 1, 1, 0, 1, 1, 0, 1, 0, 1, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 1, 1], [0, 0, 1, 0, 1, 0, 0, 0, 1, 0, 1, 1, 1, 1, 1, 0, 0, 0, 0, 1, 1, 0, 1, 1, 1, 0, 1, 0, 0, 0, 0, 1, 1, 1, 0, 0, 1, 1, 0, 1, 0, 0, 0, 1, 0, 0, 1, 0, 1, 1, 1, 1, 0, 1, 1, 0, 0, 0, 1, 1, 1, 1, 0, 1], [1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 0, 0, 1, 1, 1, 0, 0, 1, 1, 1, 0, 0, 1, 1, 0, 0, 1, 1, 0, 1, 0, 1, 1, 0, 1, 0, 1, 1, 1, 1, 1, 1, 0, 0, 1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 0, 0, 1, 0], [1, 1, 1, 0, 0, 1, 1, 1, 0, 0, 1, 1, 0, 0, 0, 0, 0, 0, 1, 0, 0, 1, 1, 0, 1, 0, 0, 1, 0, 1, 1, 0, 0, 1, 1, 1, 0, 0, 0, 0, 1, 1, 1, 1, 1, 1, 0, 0, 1, 1, 0, 0, 0, 1, 0, 0, 1, 0, 1, 0, 0, 1, 1, 1], [1, 1, 1, 1, 1, 0, 0, 0, 0, 1, 1, 0, 0, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1, 0, 1, 0, 0, 1, 1, 0, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 1, 0, 0, 0, 1, 1, 0, 1, 1, 1, 1, 1, 0, 1, 0, 1, 1, 1, 1, 0, 1, 1, 1], [1, 1, 1, 1, 1, 0, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 0, 0, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 0, 0, 1, 1, 0, 1, 1, 1, 0, 1, 0, 1, 0, 1, 1, 0, 1, 1, 0, 0, 1, 0, 0, 1, 1, 1, 0, 0, 1, 1, 1, 0, 0, 0, 0, 0], [0, 0, 1, 1, 1, 0, 0, 1, 1, 0, 0, 1, 0, 1, 0, 0, 0, 1, 1, 1, 0, 1, 1, 0, 0, 1, 1, 1, 1, 1, 0, 1, 1, 0, 1, 1, 1, 0, 0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 1, 0, 1, 0, 0, 0, 0, 1, 1, 0, 0, 0, 0], [1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 1, 0, 1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 0, 0, 1, 1, 0, 0, 0, 0, 1, 0, 1, 0, 1, 0, 1, 1, 1, 1, 0, 1, 0, 0, 0, 0, 1, 0, 0, 1, 1, 1, 1, 1, 0, 1, 1, 1, 0, 1, 1, 0, 0, 1], [0, 0, 1, 0, 1, 1, 0, 1, 0, 1, 0, 1, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 0, 0, 0, 1, 1, 0, 1, 1, 0, 0, 0, 1, 1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 1, 1, 0, 0, 0, 1, 1, 0, 1, 0, 0, 0], [1, 1, 1, 0, 1, 0, 0, 1, 0, 1, 0, 1, 1, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 0, 0, 1, 0, 1, 1, 0, 0, 1, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1, 0, 1, 0, 1, 1, 1, 1, 0, 1, 0, 0, 0, 0, 0, 0, 1, 0, 1], [1, 1, 0, 1, 1, 0, 1, 1, 1, 1, 0, 1, 1, 1, 0, 0, 0, 1, 1, 1, 0, 0, 1, 1, 0, 1, 1, 0, 1, 1, 1, 1, 0, 0, 0, 0, 0, 1, 1, 1, 1, 1, 0, 1, 0, 0, 1, 1, 1, 1, 0, 0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 0, 0, 0], [0, 1, 0, 0, 1, 0, 1, 1, 1, 1, 1, 1, 0, 0, 1, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 0, 0, 1, 1, 1, 0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 1, 0, 1, 1, 1, 0, 1, 0, 1, 1, 1, 0, 1, 0, 0], [0, 1, 1, 1, 1, 1, 0, 0, 1, 0, 0, 1, 1, 0, 0, 0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 0, 1, 0, 1, 1, 1, 1, 1, 1, 0, 1, 0, 1, 1, 0, 1, 0, 1, 0, 0, 0, 1, 0, 0, 0, 0, 1, 1, 0, 1, 1, 0, 0, 1, 0, 1, 0, 0, 1], [0, 0, 0, 1, 0, 1, 1, 0, 0, 0, 0, 0, 1, 0, 0, 0, 1, 1, 1, 0, 1, 0, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1, 1, 0, 1, 0, 1, 0, 1, 0, 0, 1, 0, 1, 0, 1, 0, 0, 0, 1, 0, 1, 0, 0], [0, 1, 1, 1, 0, 1, 1, 1, 1, 0, 0, 0, 0, 0, 1, 1, 0, 0, 0, 1, 0, 1, 0, 1, 1, 0, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1, 0, 0, 1, 1, 0, 0, 1, 0, 1, 0, 0, 0, 1, 0, 1, 1, 1, 1, 0, 0, 0, 0, 1, 1], [0, 0, 0, 0, 0, 0, 1, 0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 0, 0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 1, 0, 0, 0, 1, 0, 0, 0, 1, 1, 0, 1, 0, 1, 1, 0, 0, 1, 0, 0, 0, 1, 0, 1, 1, 0, 1, 0, 1, 0, 0, 1, 0, 0, 1], [1, 1, 1, 0, 1, 1, 0, 0, 1, 1, 0, 0, 0, 1, 1, 0, 1, 0, 1, 1, 0, 1, 0, 0, 0, 1, 0, 0, 0, 1, 0, 0, 1, 0, 0, 0, 0, 1, 1, 0, 0, 0, 0, 1, 1, 0, 0, 0, 1, 1, 1, 0, 1, 1, 0, 0, 1, 0, 1, 0, 1, 0, 0, 1], [1, 0, 1, 1, 0, 1, 0, 0, 0, 1, 0, 1, 0, 0, 1, 0, 0, 1, 1, 0, 0, 0, 0, 1, 0, 0, 0, 1, 1, 1, 0, 1, 1, 1, 0, 0, 1, 0, 1, 1, 0, 1, 1, 0, 1, 1, 0, 0, 1, 1, 1, 1, 0, 0, 0, 1, 0, 0, 1, 0, 1, 1, 1, 1], [0, 0, 1, 0, 1, 1, 1, 1, 1, 0, 0, 1, 0, 0, 0, 1, 0, 0, 1, 1, 1, 0, 0, 1, 1, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 0, 1, 0, 0, 1, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 0, 0, 1, 0, 0, 1, 1, 0, 0, 0, 1, 1, 1], [0, 0, 0, 0, 1, 0, 0, 1, 1, 0, 1, 1, 0, 0, 1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 0, 0, 0, 0, 1, 0, 1, 0, 0, 0, 1, 1, 0, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 0, 0, 1, 1, 0, 1, 1, 1, 0], [0, 1, 1, 0, 1, 1, 0, 0, 0, 1, 1, 1, 0, 0, 1, 1, 1, 0, 1, 1, 1, 0, 0, 0, 1, 1, 0, 1, 1, 1, 1, 1, 1, 0, 1, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 1, 1, 1, 1, 1, 0, 1, 0, 1, 1, 1, 0, 0, 1, 1, 0, 1, 0, 0], [1, 0, 1, 1, 1, 1, 0, 1, 1, 0, 1, 1, 1, 1, 0, 0, 0, 1, 0, 1, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 1, 1, 0, 0, 1, 0, 1, 1, 1, 0, 0, 1, 1, 1, 0, 1, 0, 1, 1, 0, 1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 1, 0, 1], [1, 0, 1, 0, 0, 0, 1, 0, 1, 1, 1, 1, 0, 0, 1, 1, 0, 1, 0, 0, 0, 1, 1, 1, 0, 0, 1, 1, 1, 0, 0, 0, 0, 1, 0, 1, 1, 0, 0, 1, 0, 1, 1, 0, 1, 0, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1, 1, 0, 1], [1, 1, 1, 0, 0, 1, 1, 1, 0, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 1, 0, 1, 1, 0, 1, 0, 1, 0, 1, 0, 0, 1, 1, 1, 1, 0, 1, 1, 0, 1, 0, 0, 1, 0, 0, 0, 1, 1, 0, 0, 0, 0, 1, 0, 1, 0, 0, 1, 0, 0, 0, 1], [1, 1, 1, 1, 0, 0, 1, 1, 0, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1, 1, 0, 1, 0, 1, 1, 1, 1, 1, 0, 1, 0, 1, 1, 1, 0, 1, 0, 1, 1, 1, 1, 1, 1, 0, 1, 0, 1, 1, 0, 1, 1, 1, 0, 1, 1, 0, 0, 1, 0, 0, 1, 1], [0, 1, 1, 0, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 1, 1, 0, 0, 0, 1, 1, 0, 1, 0, 0, 0, 0, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 0, 1, 0, 0, 0, 0, 1, 1, 0], [0, 0, 1, 0, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1, 0, 1, 1, 1, 0, 1, 0, 0, 0, 1, 1, 0, 0, 1, 1, 0, 0, 1, 1, 1, 1, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1, 1, 0, 0, 0, 0, 1, 0, 0, 1, 0, 1, 1, 1], [0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 0, 1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 1, 1, 0, 1, 0, 0, 1, 0, 1, 0, 1, 0, 1, 1, 0, 1, 0, 0, 1, 1, 1, 1, 1, 0, 1, 0, 0, 1, 1], [1, 0, 1, 0, 0, 0, 0, 0, 0, 1, 1, 0, 0, 1, 1, 0, 1, 1, 0, 1, 1, 0, 1, 0, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 1, 0, 1, 0, 0, 1, 1, 1, 1, 0, 0, 0, 1, 1, 1, 1, 1, 1, 1, 0, 0, 1, 1], [0, 0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 1, 0, 0, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 1, 0, 1, 0, 0, 0, 1, 0, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 1, 1, 1, 0, 0, 1, 1, 0, 0, 0, 0, 1, 1, 1, 0, 1, 0, 1, 1, 0, 0], [1, 0, 0, 0, 1, 1, 1, 0, 0, 0, 0, 0, 1, 1, 0, 0, 1, 0, 1, 0, 0, 0, 1, 0, 0, 0, 1, 1, 1, 0, 0, 1, 0, 0, 0, 0, 0, 1, 1, 1, 1, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 0, 0, 0, 0, 0, 1, 0, 0, 1, 0, 1, 1, 0], [0, 1, 0, 1, 1, 0, 0, 1, 0, 1, 0, 1, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 0, 0, 0, 0, 0, 1, 1, 0, 0, 1, 0, 0, 0, 0, 1, 0, 1, 1, 1, 1, 1, 1, 0, 0, 0, 1, 1, 0, 1, 1, 0], [0, 1, 0, 1, 0, 1, 0, 0, 0, 1, 1, 0, 1, 0, 1, 1, 1, 0, 0, 1, 1, 1, 0, 0, 1, 1, 1, 0, 1, 0, 1, 0, 0, 1, 0, 0, 0, 1, 0, 0, 0, 1, 1, 0, 0, 0, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1, 0, 0, 0, 1], [1, 1, 1, 0, 1, 1, 1, 1, 0, 0, 0, 0, 1, 0, 1, 0, 1, 1, 0, 0, 1, 1, 1, 0, 1, 0, 0, 1, 1, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 1, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 0, 0, 0, 0], [1, 1, 0, 1, 1, 0, 1, 1, 0, 1, 0, 0, 0, 1, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0, 1, 1, 0, 1, 0, 0, 0, 0, 0, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 0, 0, 0, 1, 0, 1, 0, 1, 0, 0, 0, 1, 1, 0, 0, 1, 0, 0, 1, 1], [1, 0, 1, 1, 0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 0, 0, 1, 1, 0, 0, 0, 0, 1, 0, 1, 0, 1, 1, 1, 0, 1, 0, 1, 1, 0, 1, 1, 1, 0, 1, 0, 0, 1, 1, 1, 0, 0, 1, 0, 0, 0, 0, 0, 1, 0, 0, 0, 1, 0, 1, 1, 0, 1, 1], [0, 1, 1, 1, 1, 0, 0, 0, 1, 1, 1, 1, 1, 0, 0, 1, 1, 0, 0, 1, 1, 0, 0, 0, 1, 1, 1, 0, 1, 1, 1, 1, 0, 0, 0, 1, 0, 1, 0, 0, 1, 0, 0, 0, 0, 0, 1, 1, 0, 1, 1, 0, 0, 0, 0, 1, 0, 1, 0, 0, 0, 1, 1, 0], [1, 0, 0, 1, 0, 1, 0, 0, 0, 1, 1, 0, 1, 0, 0, 1, 1, 1, 0, 0, 0, 0, 0, 0, 1, 1, 0, 1, 1, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 0, 0, 1, 1, 0, 0, 1, 1, 1, 1, 0, 0, 1, 0, 0, 0, 0, 1, 1, 1, 1, 1, 1, 0, 1], [1, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0, 0, 1, 0, 1, 0, 1, 1, 0, 1, 1, 0, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 1, 0, 0, 0, 1, 1, 1, 0, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1, 0, 1, 0, 0, 0, 1, 1, 1, 1, 0], [0, 1, 0, 1, 0, 0, 1, 1, 1, 0, 0, 0, 1, 0, 0, 1, 1, 1, 0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 0, 0, 1, 1, 0, 0, 1, 1, 0, 1, 1, 0, 0, 1, 0, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0], [1, 0, 1, 1, 1, 1, 1, 0, 0, 1, 1, 0, 0, 1, 0, 1, 0, 1, 0, 1, 0, 1, 1, 1, 1, 1, 1, 0, 0, 1, 1, 1, 1, 1, 0, 1, 0, 1, 1, 0, 1, 0, 0, 0, 1, 1, 1, 1, 0, 1, 0, 1, 1, 1, 0, 0, 1, 0, 0, 0, 0, 1, 1, 0], [1, 0, 1, 1, 0, 1, 1, 1, 1, 0, 1, 1, 1, 1, 0, 1, 0, 0, 0, 0, 0, 1, 1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 0, 0, 1, 1, 0, 0, 1, 0, 1, 1, 0, 0, 0, 0, 1, 0, 0, 1, 1, 0, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 1, 0], [0, 1, 0, 1, 0, 0, 0, 0, 0, 1, 1, 1, 0, 0, 0, 0, 1, 0, 1, 1, 1, 0, 0, 1, 1, 0, 0, 1, 0, 0, 1, 1, 1, 1, 1, 0, 0, 0, 0, 1, 1, 0, 1, 1, 0, 1, 0, 0, 0, 0, 0, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1, 0, 0, 0], [1, 0, 1, 0, 0, 1, 1, 0, 0, 0, 1, 0, 0, 0, 1, 1, 0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 1, 0, 0, 1, 0, 1, 1, 1, 0, 1, 1, 0, 0, 1, 0, 0, 0, 1, 0, 1, 0, 0, 0, 1, 1, 0, 1, 0, 1, 1, 0, 0, 1, 1, 0], [1, 1, 0, 1, 1, 0, 1, 1, 1, 0, 1, 0, 0, 1, 1, 0, 0, 1, 1, 0, 1, 0, 0, 1, 1, 0, 1, 1, 1, 1, 1, 0, 0, 0, 1, 1, 0, 1, 1, 0, 0, 1, 1, 0, 1, 1, 1, 0, 0, 1, 0, 0, 1, 1, 0, 1, 1, 1, 1, 1, 0, 1, 1, 1], [1, 0, 1, 0, 0, 1, 1, 1, 1, 0, 1, 1, 0, 1, 0, 1, 1, 1, 0, 1, 0, 0, 1, 0, 1, 1, 1, 1, 0, 0, 1, 0, 1, 1, 0, 0, 1, 1, 1, 0, 0, 0, 1, 1, 1, 0, 0, 1, 0, 1, 1, 0, 0, 1, 0, 1, 1, 0, 1, 1, 0, 1, 1, 0], [0, 1, 0, 1, 0, 1, 1, 0, 0, 1, 0, 1, 0, 1, 0, 0, 1, 0, 1, 0, 1, 1, 1, 1, 1, 0, 1, 0, 1, 0, 0, 0, 1, 0, 0, 1, 1, 0, 1, 1, 0, 0, 1, 0, 1, 0, 1, 1, 0, 1, 0, 1, 0, 0, 0, 0, 1, 1, 1, 0, 0, 0, 0, 0], [0, 1, 1, 0, 1, 1, 1, 0, 1, 0, 1, 1, 1, 1, 1, 0, 1, 0, 0, 0, 1, 0, 0, 0, 0, 0, 1, 0, 1, 1, 0, 0, 1, 0, 0, 0, 1, 1, 0, 1, 1, 1, 0, 0, 0, 1, 1, 0, 1, 1, 1, 0, 1, 1, 0, 0, 0, 0, 1, 0, 1, 1, 1, 1], [1, 1, 0, 1, 0, 1, 1, 0, 0, 1, 0, 0, 0, 0, 0, 1, 0, 1, 1, 0, 1, 0, 1, 0, 1, 0, 1, 1, 1, 0, 0, 0, 1, 0, 1, 1, 1, 1, 1, 1, 1, 0, 0, 1, 0, 1, 1, 0, 1, 0, 1, 0, 0, 0, 0, 1, 1, 1, 1, 0, 0, 1, 1, 0], [1, 1, 0, 1, 1, 1, 1, 0, 1, 1, 0, 1, 0, 1, 0, 0, 0, 0, 1, 1, 0, 1, 0, 0, 0, 1, 0, 0, 1, 0, 1, 1, 1, 1, 1, 0, 0, 0, 1, 1, 0, 1, 1, 0, 1, 1, 0, 1, 0, 1, 1, 1, 0, 1, 0, 1, 0, 0, 0, 1, 0, 1, 1, 0], [0, 1, 1, 0, 1, 0, 0, 0, 1, 1, 0, 1, 0, 1, 1, 1, 0, 1, 0, 1, 1, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 0, 0, 0, 1, 1, 0, 1, 1, 1, 0, 0, 0, 0, 0, 1, 0, 0, 1, 1, 1, 0, 1, 0, 1, 0, 0, 1, 0, 0], [0, 1, 1, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 1, 1, 0, 1, 0, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 1, 1, 1, 0, 1, 0, 0, 0, 0, 0, 1, 1, 0, 0, 0, 0, 1, 1, 0, 1, 1, 1, 1], [0, 1, 0, 0, 0, 1, 1, 1, 0, 0, 1, 0, 0, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 1, 0, 0, 1, 1, 0, 0, 1, 1, 1, 0, 0, 1, 0, 1, 1, 0, 1, 1, 0, 1, 1, 0, 0, 0, 1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 1, 0, 0, 1, 1], [1, 0, 0, 0, 1, 1, 0, 0, 1, 1, 0, 1, 1, 1, 1, 1, 0, 0, 0, 1, 1, 0, 1, 0, 1, 1, 1, 1, 1, 1, 0, 0, 1, 1, 0, 1, 0, 0, 1, 0, 1, 0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1, 0, 1, 0, 1, 1, 1, 0, 0, 1, 0], [1, 0, 0, 0, 1, 1, 1, 0, 1, 0, 0, 1, 1, 1, 1, 1, 0, 0, 1, 1, 0, 1, 0, 1, 1, 1, 1, 0, 0, 0, 1, 0, 1, 1, 0, 0, 0, 0, 0, 1, 0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 0, 0, 0, 0, 1, 0, 1, 0, 1, 1, 0], [1, 1, 1, 0, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 0, 1, 1, 1, 0, 0, 0, 1, 0, 1, 1, 0, 1, 0, 1, 0, 1, 1, 1, 1, 0, 1, 1, 0, 0, 1, 1, 1, 1, 0, 1, 0, 1, 1, 1, 1, 0, 1, 1, 0, 1, 1, 0, 0, 1, 1, 0, 0], [0, 1, 0, 0, 0, 1, 0, 1, 0, 1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 0, 1, 0, 1, 0, 1, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 1, 1, 0, 1, 0, 1, 1, 1, 1, 0, 1, 1, 0, 0, 1, 1, 1, 0, 1, 1, 0, 0, 1, 0, 1, 1, 0, 1, 1], [1, 1, 1, 1, 1, 1, 0, 0, 0, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 1, 0, 1, 1, 1, 1, 0, 1, 0, 0, 1, 1, 0, 0, 0, 0, 1, 1, 1, 1, 0, 1, 0, 1, 0, 1, 1, 1, 0, 0, 1, 1, 0, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 0], [1, 0, 0, 0, 1, 0, 1, 0, 0, 1, 0, 0, 1, 1, 0, 1, 1, 0, 1, 0, 1, 0, 0, 1, 0, 0, 0, 0, 0, 1, 0, 1, 0, 1, 0, 0, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 1, 0, 1, 0, 1, 1, 0, 1, 1, 1, 0, 1, 1, 0, 0, 0, 1, 0], [1, 1, 1, 0, 0, 0, 1, 1, 1, 0, 1, 0, 1, 0, 0, 1, 1, 1, 0, 0, 0, 0, 1, 0, 0, 0, 1, 1, 1, 0, 1, 0, 0, 1, 1, 1, 1, 0, 0, 1, 1, 0, 0, 0, 0, 1, 0, 0, 0, 1, 1, 0, 1, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 0], [1, 1, 1, 0, 1, 1, 0, 1, 0, 1, 0, 0, 0, 0, 0, 0, 1, 0, 0, 1, 1, 0, 1, 1, 1, 1, 0, 0, 0, 1, 1, 1, 0, 1, 0, 0, 1, 0, 1, 1, 1, 1, 0, 0, 1, 0, 1, 1, 0, 1, 0, 1, 0, 1, 1, 1, 0, 0, 0, 1, 1, 1, 0, 1], [1, 0, 1, 0, 0, 0, 1, 0, 1, 0, 0, 0, 1, 0, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 1, 0, 1, 1, 1, 0, 0, 0, 0, 0, 1, 1, 1, 0, 1, 1, 0, 1, 0, 0, 0, 0, 1, 0, 1, 0, 0, 1, 0, 1, 1, 1, 1, 1, 1, 0, 1, 0, 0, 1], [0, 1, 1, 0, 0, 1, 1, 1, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 0, 0, 0, 1, 1, 1, 1, 1, 0, 1, 1, 0, 1, 0, 0, 1, 1, 1, 0, 1, 0, 0, 0, 1, 0, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 1], [0, 1, 0, 0, 1, 1, 0, 1, 1, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 0, 0, 1, 0, 0, 0, 1, 0, 1, 1, 0, 0, 0, 0, 0, 1, 0, 1, 0, 0, 0, 0, 1, 1, 0, 1, 1, 1, 0, 0, 0, 0, 1, 1, 1, 1, 0, 1, 0, 0, 1, 1, 1, 1, 0], [1, 1, 0, 0, 0, 1, 0, 0, 0, 1, 0, 0, 1, 1, 0, 1, 0, 1, 0, 0, 0, 1, 1, 0, 1, 1, 1, 1, 0, 1, 1, 1, 0, 0, 1, 1, 1, 1, 1, 0, 1, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1, 0, 0, 0, 0, 0, 0, 1, 0, 0, 1], [1, 1, 0, 0, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 1, 0, 0, 0, 0, 0, 1, 1, 1, 1, 1, 0, 0, 0, 1, 0, 1, 1, 1, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 1, 1, 0, 0, 1, 0, 1, 0, 1, 0, 1, 1, 1, 1, 0, 0, 1, 0, 0, 1, 1], [1, 0, 0, 1, 0, 1, 1, 0, 0, 0, 0, 0, 0, 1, 1, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 0, 1, 0, 0, 0, 1, 1, 0, 0, 1, 0, 1, 1, 1, 0, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 1, 1, 1, 0, 0, 1, 1, 0, 1, 0, 0, 1, 1, 1], [1, 1, 1, 1, 1, 0, 1, 0, 0, 0, 0, 0, 1, 0, 1, 1, 1, 0, 0, 1, 1, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 0, 1, 1, 0, 0, 1, 0, 0, 1, 1, 1, 0, 0, 1, 0, 1, 0, 0, 1], [0, 0, 1, 1, 1, 1, 1, 0, 0, 1, 0, 1, 1, 0, 0, 1, 0, 1, 1, 0, 1, 1, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1, 0, 1, 1, 0, 1, 0, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 0, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1, 0, 1], [1, 1, 1, 0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 1, 1, 0, 1, 1, 1, 0, 1, 0, 1, 0, 1, 1, 1, 0, 1, 0, 1, 1, 1, 1, 1, 0, 1, 1, 1, 0, 0, 0, 1, 1, 1, 1, 0, 1, 0, 0, 0, 1, 0, 1, 1, 0, 0, 1, 0, 0, 0, 0, 1, 0], [0, 1, 0, 1, 1, 1, 1, 0, 0, 0, 1, 1, 1, 1, 0, 0, 0, 0, 0, 1, 0, 0, 1, 0, 0, 1, 0, 0, 1, 1, 1, 1, 0, 1, 1, 1, 0, 0, 1, 0, 1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 0, 0, 1, 1, 1, 0, 1, 1, 1, 0, 0, 0, 1, 1], [0, 0, 0, 1, 0, 1, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 0, 1, 1, 1, 0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 0, 1, 1, 1, 0, 0, 0, 1, 1, 0, 1, 1, 0, 0, 0, 1, 0, 0, 1, 0, 0, 1, 1, 0, 1, 1, 1, 0, 0, 0, 0], [1, 1, 1, 0, 0, 0, 0, 1, 1, 1, 0, 0, 1, 0, 0, 0, 1, 1, 1, 0, 1, 1, 1, 1, 0, 0, 0, 1, 0, 0, 1, 1, 0, 1, 1, 1, 1, 1, 0, 1, 0, 0, 1, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 0, 1, 0, 0, 0, 1, 1, 1, 0, 1, 0], [1, 0, 0, 1, 0, 0, 1, 1, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 1, 1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 1, 0, 0, 1, 0, 1, 1, 0, 1, 0, 1, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 1, 0, 0, 0, 1, 1, 0, 1, 0, 0], [0, 1, 1, 1, 0, 1, 1, 1, 1, 0, 1, 0, 1, 1, 0, 1, 1, 0, 0, 1, 1, 0, 1, 1, 0, 0, 0, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 0, 0, 0, 0, 1, 1, 1, 1, 0, 1, 1, 0, 0, 1, 1, 0, 0, 1, 0, 1, 0], [0, 0, 1, 1, 1, 1, 0, 1, 0, 0, 1, 0, 1, 0, 0, 1, 1, 1, 1, 0, 0, 0, 0, 1, 0, 1, 0, 0, 0, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 1, 0, 1, 0, 1, 0, 0, 0, 1, 1, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0, 1, 0, 1, 1], [1, 0, 1, 1, 0, 1, 1, 1, 1, 0, 0, 0, 1, 0, 1, 1, 0, 0, 1, 0, 0, 1, 1, 0, 0, 1, 1, 0, 1, 1, 0, 1, 1, 1, 0, 0, 0, 1, 1, 0, 1, 1, 0, 0, 1, 0, 1, 0, 1, 0, 1, 1, 0, 0, 0, 1, 1, 1, 1, 1, 0, 1, 1, 0], [1, 0, 0, 0, 1, 1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 0, 1, 0, 0, 1, 1, 0, 0, 1, 1, 1, 0, 1, 0, 1, 1, 1, 0, 0, 0, 1, 0, 0, 0, 1, 0, 1, 0, 1, 1, 1, 1, 0, 0, 1, 0, 1, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 0], [0, 1, 1, 0, 0, 1, 0, 0, 0, 1, 1, 1, 0, 1, 0, 1, 0, 0, 0, 1, 1, 1, 0, 0, 0, 0, 1, 1, 0, 0, 0, 1, 1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 0, 0, 1, 0, 0, 0, 1, 1, 1, 0, 0, 0, 1, 1, 0, 1, 1, 0, 1, 1, 1, 0], [1, 0, 1, 0, 1, 1, 0, 0, 1, 1, 0, 1, 1, 1, 1, 0, 1, 0, 1, 0, 0, 1, 1, 1, 0, 0, 0, 1, 0, 1, 0, 1, 1, 0, 0, 0, 1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 0, 1, 0, 0, 0, 0, 1, 1, 0, 1, 0, 1, 0, 1], [0, 1, 1, 1, 0, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1, 0, 0, 1, 0, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 0, 1, 1, 0, 1, 0, 1, 0, 1, 0, 1, 1, 1, 1, 0, 0, 0, 1, 1, 0, 0, 0, 1, 1, 1, 1, 0, 0], [0, 1, 1, 1, 1, 1, 1, 1, 0, 0, 1, 1, 1, 0, 0, 1, 1, 1, 1, 1, 1, 0, 0, 1, 0, 1, 0, 0, 1, 1, 1, 1, 1, 0, 0, 1, 1, 0, 1, 1, 0, 1, 0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 1, 0, 0, 1, 1, 1, 1, 1, 0], [1, 1, 1, 0, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 0, 0, 1, 0, 0, 0, 0, 1, 1, 1, 0, 0, 1, 1, 0, 1, 0, 1, 0, 1, 1, 0, 1, 0, 1, 1, 0, 0, 1, 1, 1, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 0, 1, 0, 1, 0, 1, 1, 1, 0], [0, 0, 0, 1, 0, 0, 1, 0, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 0, 0, 0, 1, 1, 0, 1, 0, 0, 1, 1, 0, 0, 0, 0, 1, 0, 1, 1, 1, 0, 0, 0, 0, 0, 0, 1, 1, 0, 1, 0, 1, 0, 0, 0, 1, 0, 0, 0, 0, 0, 1, 0], [0, 0, 1, 1, 0, 1, 0, 0, 1, 0, 0, 0, 1, 1, 0, 0, 1, 1, 1, 1, 0, 1, 1, 0, 0, 1, 1, 1, 0, 0, 1, 1, 0, 1, 1, 1, 1, 0, 1, 0, 1, 1, 0, 1, 0, 1, 0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 1, 0, 0, 0, 1, 1, 0, 1], [0, 0, 0, 1, 1, 1, 0, 0, 1, 1, 1, 0, 1, 1, 1, 1, 1, 0, 1, 0, 1, 1, 0, 1, 1, 1, 0, 0, 1, 1, 1, 0, 0, 0, 1, 0, 1, 1, 0, 0, 0, 0, 0, 1, 0, 1, 0, 1, 0, 1, 1, 1, 0, 1, 0, 1, 0, 1, 1, 1, 0, 1, 0, 1], [1, 1, 0, 1, 1, 0, 1, 0, 1, 1, 0, 0, 1, 1, 0, 0, 1, 0, 1, 0, 1, 1, 0, 1, 1, 0, 1, 1, 1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0, 1, 1, 1, 1, 1, 1, 1, 0, 0, 1], [0, 0, 0, 0, 0, 1, 1, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 1, 1, 0, 0, 1, 0, 1, 1, 1, 0, 0, 1, 0, 1, 1, 1, 1, 0, 0, 1, 0, 1, 1, 0, 1, 1, 0, 1, 1, 0, 1, 1, 1, 0, 0, 1, 0, 0, 0, 0, 1, 1, 0, 1, 0, 1, 1], [1, 1, 0, 0, 1, 1, 0, 0, 1, 1, 1, 0, 1, 0, 0, 1, 0, 1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 0, 0, 1, 0, 1, 0, 0, 0, 0, 1, 1, 1, 1, 0, 0, 1, 0, 0, 0, 1, 0, 1, 0, 1, 1, 0, 0, 1, 1, 0, 1, 0, 0, 1, 1, 1, 1], [1, 0, 1, 1, 0, 0, 1, 0, 0, 1, 1, 0, 1, 0, 1, 0, 0, 0, 0, 1, 0, 0, 0, 1, 1, 0, 1, 0, 0, 1, 1, 1, 0, 0, 1, 0, 1, 0, 1, 0, 1, 0, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 0, 1, 1, 1, 0, 0, 1], [0, 0, 1, 1, 1, 1, 1, 0, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 0, 1, 1, 1, 1, 0, 0, 0, 1, 0, 1, 0, 0, 1, 0, 1, 1, 1, 1, 0, 0, 1, 0, 1, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1, 1, 0, 0, 1, 0, 1, 1, 1, 1, 1, 0, 1], [0, 0, 1, 0, 0, 0, 1, 0, 0, 1, 0, 0, 0, 0, 0, 0, 1, 1, 0, 1, 1, 1, 1, 0, 0, 1, 0, 1, 1, 1, 0, 0, 0, 1, 1, 1, 0, 1, 0, 0, 0, 1, 1, 0, 1, 1, 0, 0, 1, 0, 1, 1, 1, 1, 1, 0, 1, 0, 1, 0, 1, 0, 0, 1], [1, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 0, 0, 1, 0, 0, 1, 0, 1, 1, 0, 1, 0, 0, 1, 1, 0, 1, 1, 1, 1, 0, 1, 0, 0, 0, 0, 0, 1, 0, 0, 1, 1, 1, 1, 1, 1, 0, 1, 0, 1, 1, 1, 1, 0, 1, 0, 0, 0, 0, 1, 0, 1, 1], [0, 1, 1, 1, 0, 1, 0, 0, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 1, 1, 0, 1, 0, 1, 1, 0, 1, 0, 0, 1, 1, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 0, 1, 0, 1, 1, 1, 0, 0, 0, 1, 1, 0], [1, 1, 1, 1, 1, 0, 1, 0, 1, 1, 1, 1, 0, 0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 0, 1, 0, 1, 0, 1, 0, 1, 0, 1, 0, 0, 1, 0, 0, 1, 0, 1, 1, 0, 0, 1, 0, 1, 1, 1, 0, 0, 0, 1, 1, 0, 0, 0, 1, 1, 1, 0], [1, 1, 0, 0, 1, 1, 1, 0, 0, 0, 1, 0, 0, 0, 0, 0, 1, 0, 0, 1, 1, 1, 0, 1, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 1, 1, 1, 1, 1, 0, 1, 0, 1, 1, 1, 1, 1, 0, 1, 0, 0, 0, 1, 0, 1, 1, 1, 1, 1, 1, 0, 1, 0, 0], [0, 0, 1, 0, 0, 1, 1, 0, 1, 1, 1, 1, 0, 1, 0, 0, 0, 0, 1, 1, 1, 0, 0, 0, 0, 0, 1, 0, 0, 0, 1, 0, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1, 0, 1, 1, 1, 1, 1, 0, 0, 0, 0, 1, 0, 1, 1, 0, 1, 1, 0, 1, 0, 0], [1, 1, 1, 1, 0, 1, 0, 1, 1, 1, 0, 0, 1, 1, 1, 1, 1, 0, 0, 0, 0, 1, 1, 1, 1, 1, 1, 0, 1, 0, 0, 0, 0, 0, 0, 1, 1, 1, 0, 1, 0, 0, 1, 0, 1, 1, 0, 1, 1, 0, 0, 1, 1, 1, 1, 1, 0, 1, 1, 0, 0, 0, 1, 1], [1, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1, 0, 0, 1, 0, 1, 1, 1, 0, 0, 1, 0, 1, 0, 1, 1, 0, 1, 0, 0, 0, 1, 1, 0, 0, 1, 1, 1, 0, 0, 0, 0, 1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 1, 0, 0, 1, 0, 0, 1, 1], [1, 0, 0, 0, 0, 1, 0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 1, 0, 0, 0, 1, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 1, 0, 0, 1, 0, 1, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 1, 0, 0, 0, 1, 0, 0, 1, 1, 0, 1, 0, 1, 0, 0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 1, 1, 1, 0, 1, 1, 0, 1, 1, 0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 0, 1, 0, 1, 0, 1, 0, 0, 0, 1, 1, 1, 0, 0, 0, 0, 1], [0, 1, 1, 1, 0, 1, 1, 0, 0, 1, 1, 0, 1, 1, 0, 0, 1, 1, 0, 0, 1, 0, 1, 1, 0, 1, 0, 0, 1, 0, 0, 0, 0, 0, 0, 1, 0, 1, 0, 1, 0, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 1, 1, 0, 1, 1, 1, 1, 1, 1, 1, 1, 0], [0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 0, 0, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 1, 0, 1, 1, 0, 0, 0, 0, 0, 1, 1, 0, 1, 1, 1, 0, 0, 0, 0, 0, 0, 1, 0, 1, 1, 0, 1, 0, 1, 0, 0, 1, 0, 1, 1, 1, 1, 0, 0, 0, 0, 1], [1, 1, 1, 1, 0, 1, 0, 0, 1, 0, 1, 0, 0, 0, 0, 1, 1, 1, 0, 1, 1, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 1, 0, 1, 0, 0, 0, 1, 0, 0, 0, 1, 0, 0, 1, 1, 0, 0, 1, 1, 0, 1, 0, 0, 0, 1, 0, 0, 1, 1, 1, 0, 1, 1], [1, 1, 1, 0, 1, 0, 0, 1, 0, 1, 1, 0, 0, 0, 1, 1, 0, 1, 1, 1, 0, 1, 0, 0, 0, 1, 1, 1, 1, 1, 1, 0, 1, 1, 0, 0, 1, 0, 0, 0, 0, 1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 1, 1, 0, 1, 1, 0, 0, 1, 0, 1, 1, 1, 0], [0, 1, 1, 1, 0, 1, 0, 1, 1, 0, 1, 0, 0, 0, 0, 0, 1, 1, 0, 0, 0, 1, 1, 1, 0, 1, 1, 0, 0, 0, 0, 0, 1, 1, 0, 1, 1, 0, 0, 1, 1, 0, 1, 1, 0, 0, 1, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 1, 1, 0, 1], [1, 0, 1, 0, 0, 0, 1, 1, 0, 0, 1, 1, 1, 0, 1, 0, 1, 1, 0, 0, 1, 1, 1, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1, 0, 1, 0, 1, 1, 1, 0, 0, 0, 1, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 0, 0, 1, 0, 1, 0, 1], [1, 0, 1, 0, 1, 1, 0, 0, 1, 0, 1, 0, 1, 1, 1, 1, 0, 0, 0, 0, 1, 0, 1, 0, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 1, 1, 0, 1, 1, 0, 1, 1, 0, 0, 0, 1, 0, 0, 1, 0, 0, 1, 1, 0, 1, 0, 0, 1, 1, 1, 0, 0], [0, 0, 0, 0, 0, 1, 1, 0, 1, 1, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 1, 0, 0, 0, 1, 1, 1, 1, 1, 1, 1, 0, 0, 1, 0, 1, 1, 0, 1, 1, 0, 1, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 1, 1, 0, 1, 0, 0, 0], [0, 1, 0, 0, 0, 0, 0, 1, 0, 1, 1, 0, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 0, 0, 0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 1, 0, 1, 1, 1, 1, 1, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1, 0, 0, 0, 0, 1, 0, 0, 1, 1, 1, 1], [1, 0, 0, 1, 0, 0, 1, 1, 1, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 1, 0, 0, 0, 0, 1, 0, 1, 1, 1, 1, 1, 0, 0, 1, 0, 1, 1, 0, 1, 1, 0, 0, 1, 1, 1, 1, 0, 1, 0, 1, 0, 0, 0, 0, 1, 0, 1, 0, 1, 1, 0, 0, 1, 0], [0, 0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 1, 0, 1, 0, 0, 1, 0, 0, 1, 1, 1, 1, 0, 0, 0, 1, 0, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 1, 0, 0, 1, 1, 0, 1, 1, 1, 1, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 0], [0, 0, 0, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 0, 1, 1, 0, 1, 0, 1, 1, 0, 0, 1, 1, 1, 1, 1, 0, 1, 0, 0, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 1, 1, 1, 1, 0, 0, 0, 1, 0, 1, 1, 1, 1, 0, 1, 0, 1, 1], [1, 1, 0, 0, 1, 0, 0, 0, 1, 0, 0, 1, 1, 0, 1, 0, 1, 0, 0, 0, 1, 0, 1, 1, 0, 1, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 0, 1, 0, 1, 1, 0, 0, 1, 1, 0, 1, 1, 0, 1, 0, 0, 0, 0, 1, 1, 0, 1, 1, 0, 1, 0, 1, 0], [0, 1, 0, 1, 0, 1, 0, 1, 1, 1, 0, 0, 1, 1, 0, 0, 0, 1, 0, 0, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 1, 1, 0, 1, 1, 0, 0, 1, 1, 1, 1, 1, 0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 1, 0, 1, 0, 0], [0, 0, 0, 1, 1, 1, 1, 0, 0, 0, 1, 1, 1, 1, 0, 1, 1, 0, 0, 0, 1, 1, 1, 1, 1, 0, 1, 0, 0, 0, 0, 1, 0, 1, 1, 0, 0, 1, 0, 0, 1, 1, 0, 1, 0, 1, 0, 1, 0, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 1], [1, 1, 0, 1, 1, 0, 0, 1, 0, 0, 1, 1, 0, 1, 0, 1, 1, 1, 1, 1, 1, 0, 0, 1, 1, 0, 1, 1, 0, 1, 0, 1, 1, 1, 1, 1, 0, 0, 1, 0, 0, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 1, 0, 1, 0, 1, 0, 1], [1, 1, 0, 0, 0, 1, 0, 0, 1, 1, 0, 1, 1, 0, 0, 0, 0, 0, 0, 1, 0, 0, 1, 1, 1, 1, 0, 1, 1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 0, 1, 1, 0, 0, 1, 0, 1, 1, 1, 0, 0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 0, 0, 1, 0, 0], [0, 0, 0, 1, 1, 0, 1, 1, 1, 0, 0, 1, 1, 0, 0, 0, 0, 1, 0, 1, 1, 0, 1, 0, 1, 1, 0, 1, 1, 1, 0, 0, 1, 0, 0, 0, 1, 0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 0, 0, 1, 0, 1, 1, 1, 1], [0, 1, 1, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 0, 0, 0, 1, 1, 0, 0, 0, 1, 0, 0, 0, 0, 0, 1, 1, 0, 0, 0, 0, 0, 0, 0, 1, 1, 0, 0, 0, 0, 0, 1, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 0], [0, 0, 0, 1, 1, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 1, 0, 1, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 1, 1, 1, 0, 0, 0, 1, 0, 1, 0, 1, 1, 1, 0, 1, 1, 0, 0, 0, 0, 0, 0, 1, 1, 0, 1, 0, 0, 0, 0, 0, 1, 1, 1, 1, 1], [0, 1, 0, 0, 0, 0, 0, 1, 1, 1, 0, 0, 0, 1, 0, 0, 0, 0, 0, 1, 1, 0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 0, 1, 1, 0, 0, 1, 1, 0, 0, 1, 1, 0, 0, 1, 1, 1, 0, 0, 0, 0, 1, 0, 0, 0, 1, 1, 0, 1, 0, 0, 1, 1], [0, 0, 1, 0, 1, 1, 1, 0, 0, 0, 0, 0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 0, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 0, 0, 0, 1, 0, 0, 1, 0, 1, 1, 0, 1, 0, 0, 1, 1, 1, 0, 1, 0, 1, 0, 1, 1, 1, 0, 0, 0, 1, 1, 1, 1], [0, 1, 0, 1, 0, 0, 0, 0, 0, 0, 0, 0, 1, 0, 1, 0, 1, 0, 1, 0, 0, 0, 1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 0, 1, 1, 0, 1, 0, 0, 1, 0, 0, 0, 0, 1, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 0, 0, 0, 0, 1, 0, 1, 0, 1], [0, 1, 0, 1, 1, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 1, 0, 1, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 1, 0, 0, 1, 0, 0, 0, 1, 1, 0, 1, 1, 0, 0, 1, 1, 1, 1, 1, 0, 1], [0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 1, 1, 0, 1, 1, 0, 1, 1, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 0, 0, 1, 1, 1, 0, 0, 1, 0, 1, 1, 1, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 0, 1, 1, 1, 0, 1, 0, 0, 1, 1, 1, 0, 0, 0], [0, 1, 0, 1, 0, 1, 1, 1, 1, 1, 0, 0, 1, 0, 0, 1, 0, 0, 0, 0, 1, 1, 0, 0, 1, 1, 0, 0, 1, 1, 1, 1, 0, 1, 0, 1, 0, 0, 1, 0, 0, 1, 0, 0, 1, 1, 0, 0, 0, 0, 1, 1, 1, 1, 0, 0, 0, 1, 1, 0, 1, 1, 0, 0], [0, 1, 0, 0, 0, 1, 0, 0, 0, 1, 0, 1, 0, 1, 1, 0, 0, 0, 1, 1, 1, 1, 0, 1, 1, 1, 0, 0, 1, 0, 1, 1, 0, 1, 0, 0, 0, 1, 1, 0, 0, 0, 1, 0, 0, 1, 1, 0, 0, 1, 0, 0, 0, 1, 0, 0, 0, 0, 0, 1, 0, 1, 0, 1], [1, 1, 0, 0, 0, 1, 1, 1, 0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 0, 1, 1, 1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 1, 0, 0, 0, 1, 1, 0, 1, 0, 0, 1, 0, 1, 0, 1, 0, 0, 1, 1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 0, 1, 1, 0, 1], [1, 0, 1, 1, 1, 0, 1, 1, 0, 0, 1, 1, 1, 1, 0, 1, 1, 1, 1, 0, 0, 1, 1, 1, 0, 1, 0, 1, 1, 0, 0, 1, 0, 0, 1, 1, 0, 0, 0, 1, 0, 0, 1, 1, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 1, 0, 1, 0, 1, 1, 1, 1, 0], [1, 0, 1, 0, 1, 0, 1, 1, 0, 1, 1, 0, 0, 0, 1, 1, 1, 0, 0, 1, 0, 0, 0, 0, 0, 1, 1, 1, 0, 1, 0, 0, 0, 0, 1, 1, 1, 0, 1, 0, 1, 1, 1, 1, 0, 1, 0, 0, 1, 0, 1, 0, 1, 0, 0, 0, 0, 1, 0, 1, 0, 0, 0, 1], [0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 0, 0, 0, 0, 0, 1, 1, 1, 0, 0, 0, 1, 1, 1, 0, 0, 0, 1, 1, 1, 1, 0, 1, 0, 0, 0, 1, 0, 0, 1, 1, 0, 1, 1, 1, 1, 0, 0, 0, 1, 1, 1, 0, 0, 1, 1, 0, 0, 0, 0, 1, 1, 0, 1], [0, 0, 0, 0, 1, 0, 1, 1, 1, 1, 0, 0, 1, 1, 1, 0, 0, 0, 0, 0, 1, 0, 1, 0, 0, 0, 0, 1, 0, 1, 0, 0, 0, 1, 1, 1, 0, 1, 0, 0, 1, 0, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 1, 1, 1, 0, 0, 0, 1, 1, 0, 1, 1, 1], [0, 0, 1, 0, 0, 0, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 1, 0, 1, 1, 0, 0, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 0, 1, 0, 1, 0, 1, 0, 0, 0, 1, 1, 1, 1, 0, 0, 0, 0, 1, 0, 1, 0, 1, 0, 0, 1, 1, 1, 0, 1, 1], [1, 0, 0, 1, 1, 0, 1, 1, 0, 1, 1, 1, 0, 1, 0, 1, 0, 0, 0, 0, 1, 1, 0, 0, 1, 1, 0, 0, 1, 1, 1, 0, 1, 1, 0, 1, 0, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 0, 1, 1, 0, 1, 0, 0, 1, 1, 1, 0, 1, 0, 1, 1, 1], [1, 1, 1, 1, 0, 0, 1, 1, 1, 0, 1, 0, 0, 1, 0, 0, 0, 0, 0, 1, 1, 0, 0, 0, 0, 1, 1, 0, 0, 0, 0, 0, 1, 1, 1, 0, 0, 0, 0, 1, 1, 1, 0, 1, 1, 0, 0, 0, 0, 1, 0, 0, 1, 0, 0, 0, 0, 0, 0, 1, 0, 0, 1, 0], [0, 0, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 0, 1, 0, 0, 0, 1, 0, 1, 0, 0, 0, 1, 1, 1, 0, 1, 1, 1, 0, 1, 1, 0, 1, 0, 1, 1, 1, 1, 1, 0, 0, 1, 1, 1, 1, 0, 1, 0, 1, 0, 1, 0, 1, 0, 0, 0, 0, 0, 1, 1, 0, 0], [1, 1, 1, 1, 0, 0, 0, 1, 1, 1, 0, 0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 0, 0, 1, 1, 1, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1, 0, 0, 0, 1, 1, 1, 1, 1, 0, 0, 0, 1, 1, 0, 1, 1, 0, 1, 1], [0, 1, 0, 0, 1, 0, 1, 1, 1, 0, 0, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1, 0, 0, 0, 0, 0, 1, 1, 0, 1, 0, 1, 0, 0, 0, 0, 0, 1, 0, 1, 0, 1, 1, 0, 1, 0, 0, 1, 1, 1, 0, 1, 1, 0, 1, 1, 0, 1, 1, 0, 0, 0, 1, 0], [1, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 0, 1, 0, 1, 1, 0, 0, 1, 1, 1, 1, 0, 0, 0, 1, 0, 1, 1, 1, 1, 0, 0, 0, 1, 1, 0, 0, 0, 0, 1, 0, 1, 0, 1, 1, 1, 1, 0, 1, 1, 0, 0, 1, 1, 0, 1, 0, 1, 0, 0, 1, 1, 0], [1, 1, 0, 1, 1, 0, 0, 0, 0, 0, 1, 1, 1, 0, 0, 0, 0, 1, 0, 1, 1, 1, 1, 0, 0, 1, 0, 1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 1, 0, 1, 0, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 0, 1, 0, 1, 0, 1, 1], [0, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 1, 1, 0, 1, 1, 1, 0, 0, 0, 0, 1, 1, 0, 1, 1, 1, 1, 0, 1, 0, 0, 1, 1, 1, 1, 0, 1, 1, 0, 1, 0, 0, 1, 1, 0, 0, 1, 1, 0, 1, 1, 0, 0, 0, 1, 1, 0, 1, 0], [0, 1, 0, 1, 1, 0, 0, 1, 1, 1, 1, 0, 0, 1, 0, 0, 1, 1, 0, 1, 0, 1, 0, 0, 0, 0, 0, 1, 1, 1, 0, 1, 1, 1, 0, 1, 0, 0, 1, 1, 1, 1, 1, 0, 1, 1, 0, 0, 0, 0, 1, 0, 0, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0], [0, 0, 1, 1, 0, 0, 0, 0, 1, 1, 0, 0, 1, 0, 1, 0, 0, 0, 1, 1, 1, 1, 0, 1, 1, 0, 0, 1, 0, 0, 1, 0, 0, 1, 0, 0, 0, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 0, 0, 1, 1, 0, 0, 0, 0, 1, 0, 0, 0, 1, 0, 0, 0], [0, 1, 1, 0, 1, 0, 1, 0, 0, 1, 0, 0, 0, 0, 1, 1, 1, 1, 0, 1, 0, 1, 1, 0, 1, 0, 1, 0, 0, 0, 0, 1, 1, 1, 0, 0, 0, 0, 0, 1, 1, 1, 0, 1, 0, 1, 1, 1, 0, 1, 1, 1, 1, 0, 1, 0, 1, 0, 1, 1, 0, 1, 0, 1], [1, 0, 1, 0, 0, 1, 0, 1, 1, 1, 1, 0, 0, 1, 0, 1, 0, 0, 1, 1, 1, 1, 0, 1, 0, 0, 1, 0, 1, 0, 0, 0, 1, 1, 1, 1, 0, 0, 0, 0, 0, 1, 0, 0, 1, 0, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1, 1, 0, 0, 1, 1, 0, 1, 1], [0, 0, 0, 0, 0, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 1, 0, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 0, 1, 1, 1, 1, 1, 0, 1, 0, 0, 0, 1, 1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 0, 1, 0, 0, 0, 0, 0, 1], [0, 0, 1, 1, 0, 1, 1, 0, 0, 0, 1, 0, 1, 0, 0, 1, 0, 1, 0, 0, 0, 1, 1, 0, 1, 0, 0, 0, 1, 0, 1, 0, 0, 1, 0, 0, 1, 1, 1, 1, 0, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 0, 1, 1, 0, 0, 0, 1, 1, 1, 0, 1, 0, 1], [1, 0, 1, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 0, 0, 0, 1, 0, 1, 1, 0, 1, 0, 0, 0, 0, 0, 1, 1, 0, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1, 0, 1, 0, 0, 0, 0, 0, 1, 1, 0, 0, 1, 0, 1, 0, 1, 1, 1, 1, 0, 0], [1, 1, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 1, 0, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 0, 0, 0, 0, 1, 1, 1, 1, 0, 1, 0, 1, 0, 0, 1, 1, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 0, 0, 0, 1, 0, 1, 1, 1, 1, 1, 0, 1], [1, 1, 0, 0, 1, 0, 1, 1, 1, 1, 1, 1, 0, 0, 1, 0, 1, 1, 0, 0, 0, 1, 0, 0, 1, 1, 1, 1, 0, 1, 1, 1, 1, 1, 0, 1, 0, 0, 0, 1, 0, 1, 1, 1, 1, 0, 1, 1, 1, 0, 0, 0, 1, 0, 1, 0, 1, 0, 0, 1, 1, 1, 1, 1], [0, 0, 0, 1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 1, 0, 0, 1, 1, 0, 0, 1, 1, 0, 0, 1, 0, 1, 1, 1, 0, 1, 0, 1, 0, 1, 0, 1, 0, 0, 0, 0, 0, 1, 1, 0, 0, 1, 1, 0, 0, 1, 1, 1, 1, 1, 1, 0, 1, 0, 1, 1, 0, 1, 0], [1, 0, 1, 0, 1, 0, 0, 0, 0, 0, 1, 1, 0, 0, 1, 1, 0, 1, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 0, 0, 1, 0, 1, 0, 0, 0, 1, 0, 1, 1, 1, 0, 1, 1, 0, 0, 1, 0, 1, 0, 0, 0, 0, 1, 1, 0, 1, 0, 0, 1, 1, 0, 1], [1, 0, 0, 0, 0, 0, 1, 1, 0, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1, 0, 1, 1, 0, 0, 1, 1, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0, 0, 1, 0, 1, 1, 1, 1, 1, 0, 1, 0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 0], [1, 1, 0, 1, 0, 0, 0, 1, 0, 1, 1, 0, 0, 0, 1, 1, 0, 1, 1, 1, 1, 0, 1, 1, 1, 0, 0, 1, 0, 1, 0, 1, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 1, 0, 1, 1, 0, 0, 1, 0, 0, 0, 1, 0, 1, 1, 0, 0, 1, 0, 0, 1, 0, 1], [0, 0, 0, 1, 0, 0, 1, 0, 0, 1, 0, 0, 1, 1, 1, 1, 1, 1, 0, 0, 1, 1, 0, 0, 1, 1, 0, 0, 1, 1, 0, 1, 1, 1, 1, 0, 0, 0, 0, 1, 1, 1, 1, 1, 0, 0, 1, 0, 1, 1, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 0, 0, 0, 1], [0, 0, 0, 1, 1, 1, 1, 1, 0, 1, 1, 0, 1, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1, 0, 1, 0, 0, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 0, 1, 1, 0, 1, 0, 1, 1, 1, 0, 1, 0, 1, 0, 0, 1, 1], [0, 0, 1, 1, 1, 0, 1, 0, 0, 0, 1, 0, 1, 0, 0, 1, 0, 1, 1, 1, 0, 0, 0, 1, 1, 1, 0, 0, 0, 1, 0, 0, 0, 1, 1, 0, 0, 0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 0, 0, 1, 1, 1, 1, 1, 0, 1, 0, 1, 0, 0, 0, 0, 0], [0, 0, 0, 1, 0, 0, 0, 1, 1, 0, 0, 1, 0, 0, 1, 1, 1, 1, 1, 1, 0, 1, 0, 0, 1, 1, 1, 1, 0, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 0, 1, 1, 0, 1, 1, 1, 0, 1, 1, 0, 1, 1, 1, 0, 1, 1, 0, 0, 1, 1, 1, 1, 1, 0], [0, 1, 1, 1, 1, 0, 0, 1, 1, 0, 1, 1, 0, 0, 1, 0, 1, 1, 1, 0, 1, 1, 1, 0, 0, 1, 0, 1, 1, 0, 1, 1, 0, 1, 1, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 1, 0, 0, 0, 0, 0, 1, 1, 1, 1, 1, 0, 0, 1, 0, 1, 0, 0, 1], [1, 0, 1, 0, 0, 0, 0, 1, 1, 0, 0, 0, 1, 0, 0, 1, 1, 0, 0, 0, 0, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 0, 0, 0, 1, 0, 0, 0, 1, 0, 0, 0, 1, 1, 0, 1, 0, 0, 0, 1, 1, 0, 1, 1, 1, 1, 1, 0, 1, 1, 1, 0, 1, 0], [1, 1, 0, 0, 0, 1, 1, 1, 1, 0, 0, 1, 0, 0, 0, 0, 1, 1, 1, 1, 0, 1, 1, 0, 0, 1, 0, 1, 1, 0, 0, 0, 0, 1, 0, 1, 1, 1, 0, 1, 0, 1, 1, 0, 0, 0, 0, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 1, 1, 1, 1, 0, 1, 1], [1, 0, 0, 1, 0, 1, 0, 1, 1, 1, 0, 0, 0, 1, 1, 0, 1, 0, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1, 0, 0, 0, 1, 0, 0, 1, 0, 1, 1, 1, 1, 1, 0, 1, 0, 0, 0, 0, 0, 1, 0, 1, 1, 0, 0, 1, 1, 1, 1, 0, 1, 0, 0, 0, 0], [1, 0, 0, 1, 0, 0, 0, 1, 1, 0, 1, 1, 0, 0, 1, 0, 0, 1, 0, 1, 0, 0, 1, 1, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 0, 1, 0, 1, 0, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1, 0, 0, 1, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0], [1, 1, 1, 1, 0, 1, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 1, 1, 1, 1, 0, 0, 0, 1, 1, 1, 0, 0, 1, 0, 0, 1, 0, 0, 1, 1, 1, 0, 0, 1, 1, 0, 1, 1, 1, 0, 0, 1, 0, 0, 1, 1, 0, 0, 0, 0, 0], [0, 0, 0, 1, 0, 0, 0, 1, 1, 0, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1, 0, 1, 1, 0, 1, 0, 0, 0, 1, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 1, 1, 0, 0, 1, 1, 0, 1, 0, 1, 1, 0, 1, 0, 0, 1, 1, 0, 0, 1, 1, 1, 0], [1, 0, 0, 1, 1, 0, 1, 1, 1, 0, 0, 1, 0, 0, 0, 0, 1, 1, 0, 1, 0, 1, 1, 1, 1, 0, 0, 0, 1, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 0, 0, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 1, 0, 0, 0, 0, 0, 1, 0, 1, 1, 0, 0, 0], [0, 1, 0, 0, 0, 1, 1, 1, 1, 1, 0, 1, 1, 0, 0, 0, 1, 1, 0, 1, 0, 1, 1, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 1, 1, 1, 0, 1, 1, 0, 1, 1, 0, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 0, 1, 1, 0, 1, 0, 0, 0, 0, 0], [1, 0, 1, 1, 0, 0, 0, 1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 1, 0, 1, 0, 1, 0, 1, 1, 1, 0, 0, 1, 0, 1, 0, 1, 0, 0, 0, 1, 0, 1, 0, 1, 0, 1, 1, 0, 0, 1, 0, 1, 1, 1, 1, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 1, 1], [1, 1, 0, 0, 1, 1, 1, 1, 0, 1, 1, 0, 0, 1, 1, 1, 0, 1, 0, 1, 0, 0, 1, 0, 0, 0, 1, 1, 0, 1, 1, 0, 0, 0, 0, 0, 1, 0, 1, 1, 1, 1, 0, 0, 1, 0, 0, 1, 1, 1, 0, 1, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0], [0, 0, 1, 1, 0, 1, 0, 0, 1, 1, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0, 1, 1, 0, 1, 0, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 0, 1, 1, 1, 0, 1, 0, 1, 1, 0, 1, 0, 1, 0, 1, 0, 0, 1, 0, 0, 1, 0], [0, 0, 0, 0, 0, 0, 1, 1, 0, 1, 0, 1, 0, 0, 0, 1, 1, 0, 1, 1, 0, 1, 0, 0, 0, 0, 0, 0, 1, 1, 0, 0, 0, 1, 0, 1, 0, 0, 0, 0, 1, 1, 0, 0, 1, 0, 1, 0, 1, 0, 0, 1, 1, 0, 1, 1, 1, 1, 1, 1, 0, 1, 1, 0], [1, 0, 1, 1, 0, 0, 0, 0, 0, 1, 0, 0, 1, 1, 1, 1, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 1, 0, 1, 0, 1, 0, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 1, 1, 1, 1, 0, 0, 1, 1, 1, 1, 1, 0, 1], [0, 0, 0, 1, 1, 0, 0, 0, 0, 0, 0, 1, 1, 0, 1, 1, 1, 1, 0, 0, 1, 1, 0, 1, 0, 1, 1, 1, 1, 0, 1, 0, 0, 0, 1, 0, 1, 0, 0, 0, 1, 1, 1, 1, 0, 0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 1, 0, 0, 0, 1, 1, 1, 1, 1], [1, 1, 0, 0, 0, 0, 1, 0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 0, 0, 0, 1, 1, 1, 0, 0, 1, 1, 0, 0, 0, 1, 0, 1, 0, 1, 1, 0, 1, 0, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 0, 1, 1, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0], [0, 0, 1, 1, 1, 0, 0, 0, 1, 1, 1, 1, 0, 0, 1, 1, 0, 0, 1, 0, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 1, 0, 0, 0, 1, 1, 0, 1, 0, 0, 1, 0, 1, 1, 0, 0, 0, 1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 0, 0, 1], [1, 0, 1, 1, 1, 0, 0, 0, 1, 0, 1, 1, 0, 0, 1, 0, 0, 0, 1, 1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 0, 1, 1, 0, 1, 0, 1, 0, 1, 1, 0, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 0, 0, 0, 1, 1, 0], [0, 0, 0, 1, 1, 0, 1, 1, 0, 1, 0, 0, 0, 1, 1, 1, 1, 0, 1, 1, 1, 0, 0, 1, 1, 1, 1, 0, 1, 0, 0, 1, 1, 1, 1, 0, 1, 1, 0, 0, 0, 0, 0, 1, 1, 0, 1, 0, 0, 1, 0, 0, 0, 1, 0, 0, 1, 1, 1, 0, 1, 1, 0, 1], [1, 0, 0, 1, 1, 0, 0, 0, 1, 0, 1, 0, 1, 1, 1, 0, 1, 0, 1, 1, 0, 0, 0, 1, 0, 1, 0, 1, 0, 0, 1, 1, 1, 1, 1, 0, 1, 0, 1, 0, 0, 0, 1, 0, 0, 1, 0, 1, 0, 0, 1, 0, 0, 0, 1, 0, 1, 1, 0, 1, 1, 1, 0, 0], [1, 0, 0, 0, 0, 0, 0, 0, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 1, 0, 1, 1, 0, 1, 1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 0, 1, 1, 0, 0, 0, 1, 0, 0, 1, 0, 1, 0, 0, 0, 1, 1, 0, 0, 1, 1, 1, 1, 0, 1, 0, 1, 0, 1, 0], [0, 1, 1, 0, 0, 1, 1, 1, 0, 1, 1, 1, 0, 0, 0, 1, 0, 0, 1, 1, 0, 0, 1, 1, 1, 0, 0, 1, 1, 1, 0, 1, 1, 0, 0, 1, 1, 0, 1, 0, 1, 1, 0, 0, 0, 0, 0, 1, 0, 0, 0, 1, 0, 1, 1, 1, 1, 0, 1, 0, 0, 1, 0, 1], [1, 0, 1, 0, 0, 1, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0, 1, 0, 1, 1, 1, 0, 1, 1, 0, 1, 0, 0, 1, 1, 0, 0, 1, 1, 0, 1, 1, 0, 1, 0, 1, 0, 0, 1, 0, 0, 1, 1, 1, 0, 1, 1, 0, 1, 1, 0, 0, 1, 1, 0, 1], [1, 0, 0, 1, 1, 1, 1, 0, 1, 1, 0, 0, 1, 0, 1, 0, 1, 0, 0, 0, 1, 0, 1, 1, 0, 0, 0, 0, 1, 0, 1, 1, 0, 1, 1, 1, 1, 0, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 1, 0, 1, 0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 0], [0, 1, 0, 1, 0, 0, 1, 1, 1, 0, 1, 0, 0, 0, 1, 1, 0, 1, 1, 1, 0, 0, 0, 0, 0, 1, 1, 0, 1, 1, 1, 0, 1, 0, 0, 0, 0, 0, 1, 1, 1, 1, 0, 1, 0, 1, 0, 0, 1, 0, 0, 0, 0, 1, 1, 1, 0, 0, 0, 0, 1, 0, 1, 1], [0, 1, 0, 1, 0, 0, 0, 0, 0, 1, 0, 0, 0, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 0, 1, 1, 1, 1, 0, 0, 0, 0, 1, 1, 1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 1, 1, 0, 0, 1, 0, 1, 1, 1, 1, 1, 1, 0, 1, 0], [0, 0, 0, 1, 0, 1, 0, 1, 1, 1, 0, 1, 0, 1, 1, 1, 0, 0, 0, 1, 1, 0, 0, 0, 0, 1, 1, 0, 0, 0, 0, 0, 0, 1, 0, 1, 0, 0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 1, 1, 0, 1, 0, 0, 1, 1, 1, 1, 0, 1, 0, 0, 0, 1, 1], [0, 1, 0, 0, 0, 1, 1, 0, 1, 1, 1, 1, 0, 0, 0, 1, 0, 1, 1, 0, 0, 0, 0, 1, 0, 1, 0, 1, 1, 1, 1, 0, 1, 0, 0, 1, 1, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 1, 0, 0, 1, 0, 0, 0, 0, 1, 1, 0, 1], [1, 0, 1, 0, 0, 0, 0, 0, 1, 1, 1, 1, 0, 0, 1, 1, 1, 0, 0, 0, 0, 1, 1, 0, 0, 1, 1, 0, 1, 1, 0, 1, 0, 0, 1, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 1, 1, 0, 1, 1, 1, 0, 1, 1, 0, 0], [0, 0, 0, 0, 1, 1, 0, 1, 0, 1, 0, 0, 1, 1, 1, 0, 0, 1, 1, 1, 0, 0, 0, 1, 0, 0, 1, 1, 0, 1, 0, 1, 1, 1, 1, 0, 0, 0, 0, 1, 1, 0, 1, 0, 1, 1, 0, 1, 0, 1, 0, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1, 1, 1, 1], [0, 1, 0, 0, 1, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 1, 0, 0, 0, 1, 0, 1, 0, 0, 0, 1, 1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 1, 0, 0, 1, 1, 0, 0, 1, 1, 1, 0, 0, 1, 1, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 0, 1], [0, 1, 1, 1, 0, 0, 0, 1, 0, 0, 0, 1, 1, 1, 0, 1, 1, 0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0, 1, 0, 0, 1, 1, 0, 1, 1, 1, 0, 0, 0, 1, 0, 0, 1, 1, 0, 0, 1, 1, 1, 0, 1, 0, 0, 1, 1, 0, 1], [1, 0, 0, 1, 1, 1, 0, 0, 1, 1, 0, 1, 1, 1, 1, 1, 1, 0, 0, 1, 0, 1, 0, 0, 1, 0, 0, 0, 1, 0, 0, 0, 1, 1, 1, 0, 0, 1, 1, 0, 1, 0, 0, 1, 0, 1, 1, 1, 1, 1, 1, 1, 0, 0, 1, 1, 1, 0, 0, 1, 0, 1, 1, 0], [1, 1, 0, 0, 1, 1, 0, 1, 0, 1, 0, 0, 0, 0, 0, 0, 1, 1, 1, 0, 1, 0, 1, 1, 0, 1, 0, 0, 1, 0, 0, 0, 0, 1, 0, 1, 1, 1, 0, 1, 0, 0, 1, 0, 0, 0, 0, 0, 1, 0, 0, 1, 1, 1, 0, 0, 0, 0, 1, 1, 1, 0, 0, 1], [0, 1, 0, 0, 1, 1, 1, 1, 1, 1, 0, 1, 0, 0, 1, 0, 1, 1, 0, 1, 0, 1, 0, 1, 0, 0, 1, 0, 0, 0, 1, 0, 0, 0, 1, 0, 0, 1, 0, 0, 0, 0, 0, 1, 0, 1, 1, 0, 0, 1, 1, 1, 0, 0, 1, 1, 1, 1, 0, 1, 1, 1, 0, 0], [1, 1, 0, 0, 1, 1, 1, 1, 1, 0, 0, 1, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 0, 1, 0, 1, 1, 1, 1, 0, 1, 0, 0, 1, 0, 0, 0, 0, 1, 1, 0, 1, 1, 0, 1, 1, 0, 1, 0, 1, 0, 1, 0, 0, 0, 0, 0, 0, 1, 0, 1, 0, 1, 1], [0, 0, 1, 0, 1, 1, 1, 1, 0, 1, 1, 1, 1, 0, 1, 1, 0, 1, 0, 0, 0, 1, 0, 0, 0, 1, 1, 1, 0, 0, 1, 1, 1, 1, 1, 0, 1, 1, 0, 0, 1, 1, 1, 0, 1, 0, 1, 1, 1, 0, 0, 1, 1, 1, 0, 1, 0, 1, 0, 1, 0, 1, 1, 0], [0, 1, 0, 1, 1, 0, 1, 1, 0, 0, 1, 0, 0, 0, 1, 1, 0, 0, 0, 0, 0, 1, 1, 1, 0, 0, 0, 0, 1, 1, 0, 1, 1, 1, 1, 1, 0, 0, 0, 1, 0, 1, 0, 1, 1, 1, 1, 0, 0, 1, 1, 0, 0, 1, 0, 1, 0, 1, 1, 1, 1, 0, 0, 0], [0, 1, 1, 0, 1, 0, 1, 1, 0, 0, 1, 0, 0, 1, 1, 0, 1, 0, 0, 0, 1, 0, 0, 0, 1, 0, 0, 1, 1, 1, 1, 0, 1, 0, 0, 1, 1, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 1, 1, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0, 0, 1, 1], [1, 1, 1, 0, 0, 0, 0, 1, 1, 1, 0, 0, 0, 0, 1, 0, 0, 0, 1, 0, 1, 0, 0, 1, 0, 1, 1, 0, 1, 0, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1, 0, 1, 0, 0, 0, 1, 0, 1, 1, 0, 0, 1, 0, 0, 1, 1, 0, 1, 1, 0], [0, 0, 0, 0, 1, 1, 1, 0, 1, 1, 0, 0, 1, 0, 0, 0, 0, 1, 0, 1, 1, 0, 1, 0, 1, 1, 0, 1, 0, 0, 0, 1, 0, 0, 1, 0, 0, 1, 0, 1, 1, 1, 1, 0, 0, 1, 0, 0, 0, 0, 1, 1, 1, 0, 0, 0, 1, 1, 1, 1, 0, 0, 1, 1], [1, 1, 0, 1, 0, 0, 1, 0, 1, 1, 0, 0, 1, 1, 1, 1, 0, 1, 1, 0, 0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 0, 1, 1, 0, 1, 0, 1, 1, 0, 1, 1, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1, 0, 1, 1, 1, 0, 1, 0, 1, 0, 1, 0, 1, 0], [1, 0, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 0, 0, 0, 1, 0, 1, 1, 0, 0, 1, 1, 1, 1, 1, 0, 0, 0, 1, 1, 0, 0, 0, 1, 0, 1, 0, 1, 0, 1, 0, 1, 0, 1, 1, 0, 1, 1, 0, 1, 0, 1, 0, 1, 1, 1, 1, 1, 0, 1, 0, 1, 1], [1, 0, 1, 0, 1, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 1, 0, 1, 0, 0, 0, 1, 1, 0, 0, 1, 0, 0, 0, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 0, 1, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0, 1, 1, 0, 0, 1, 1], [1, 1, 0, 1, 1, 0, 0, 1, 1, 1, 1, 0, 0, 1, 1, 1, 0, 1, 1, 0, 1, 1, 0, 1, 0, 1, 1, 1, 1, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 1, 0, 0, 0, 1, 0, 1, 0, 1, 1, 1, 1, 1, 0, 0, 0, 0, 1, 1, 0, 1, 1, 0, 1, 0], [1, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 1, 1, 1, 0, 0, 1, 0, 1, 1, 1, 0, 0, 1, 1, 1, 1, 1, 0, 0, 1, 1, 0, 1, 0, 0, 1, 1, 0, 0, 0, 1, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 1, 0, 1, 0, 0, 1, 1], [0, 1, 1, 1, 1, 0, 0, 0, 0, 0, 1, 0, 1, 1, 1, 1, 1, 0, 0, 1, 0, 0, 1, 1, 1, 1, 1, 0, 1, 1, 1, 0, 1, 1, 0, 1, 1, 0, 1, 0, 0, 1, 0, 1, 0, 0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 1, 0, 0, 1, 1, 1], [1, 0, 1, 1, 0, 1, 0, 1, 1, 0, 0, 0, 0, 1, 1, 1, 0, 0, 1, 0, 0, 1, 0, 0, 0, 0, 1, 1, 0, 0, 0, 0, 0, 1, 1, 1, 1, 0, 1, 1, 1, 0, 0, 0, 0, 1, 1, 1, 1, 0, 1, 1, 0, 1, 1, 0, 1, 0, 0, 0, 0, 1, 0, 1], [0, 0, 1, 1, 0, 1, 0, 0, 0, 1, 1, 1, 1, 0, 0, 0, 0, 1, 1, 0, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1, 0, 1, 0, 0, 0, 1, 0, 1, 1, 1, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0, 0, 1, 1, 0, 1, 0, 0, 1, 0, 1, 1], [0, 0, 1, 0, 1, 1, 1, 1, 1, 0, 1, 1, 0, 0, 1, 0, 0, 1, 1, 1, 0, 0, 1, 1, 0, 1, 1, 0, 0, 0, 0, 0, 1, 0, 0, 1, 0, 1, 1, 1, 1, 1, 1, 0, 0, 0, 1, 0, 1, 1, 1, 1, 1, 0, 0, 1, 0, 1, 0, 0, 0, 0, 1, 1], [1, 1, 1, 1, 1, 0, 1, 1, 0, 1, 0, 1, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 1, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0, 1], [1, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 0, 0, 0, 1, 1, 0, 1, 0, 0, 1, 1, 1, 1, 1, 0, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 0, 1, 1, 1, 0, 1, 0, 0, 0, 1, 1, 1, 0, 1, 0, 0, 0, 1, 0, 0, 1, 1, 0], [0, 0, 1, 0, 0, 0, 0, 0, 0, 0, 1, 1, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0, 0, 1, 0, 1, 0, 0, 0, 1, 0, 0, 0, 0, 1, 1, 1, 0, 0, 0, 1, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1, 0, 1, 1, 1, 0, 1, 1, 0, 1, 0], [1, 1, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 1, 1, 0, 0, 0, 1, 1, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 1, 1, 0, 0, 0, 1, 1, 1, 1, 1, 1, 0, 1, 1, 0, 1, 0, 1, 1, 1, 0, 1, 1, 0, 0, 0, 0, 1, 0, 1, 0, 0, 0, 1], [1, 1, 0, 1, 0, 1, 0, 1, 0, 1, 0, 1, 1, 0, 0, 0, 1, 1, 0, 1, 0, 1, 0, 1, 1, 1, 1, 0, 1, 1, 0, 1, 0, 1, 1, 0, 0, 1, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 1, 0, 0, 0, 0, 1], [1, 1, 1, 1, 0, 0, 0, 1, 0, 1, 0, 1, 1, 1, 1, 0, 0, 1, 1, 0, 1, 1, 0, 1, 0, 0, 0, 1, 0, 0, 1, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 0, 0, 0, 1, 1, 0, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 1, 1, 0, 0], [0, 0, 1, 1, 1, 0, 1, 1, 1, 0, 1, 1, 0, 0, 1, 1, 0, 0, 0, 0, 1, 1, 1, 1, 0, 1, 1, 0, 0, 1, 1, 0, 1, 1, 0, 0, 1, 0, 1, 1, 0, 1, 1, 0, 1, 0, 0, 0, 0, 1, 1, 1, 0, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1], [0, 1, 1, 0, 1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0, 1, 1, 0, 0, 1, 0, 0, 0, 1, 1, 1, 0, 1, 0, 0, 1, 0, 1, 1, 0, 0, 1, 0, 0, 0, 1, 0, 1, 0, 1, 0, 1, 1, 0, 0, 1, 0, 1, 1, 1, 0, 0, 1, 0, 1, 0, 1], [0, 0, 1, 0, 1, 1, 1, 1, 0, 0, 1, 1, 0, 0, 0, 0, 1, 0, 0, 1, 1, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 1, 0, 0, 1, 1, 1, 0, 0, 1, 0, 0, 1, 0, 0, 1, 0, 0, 1, 0, 1, 1, 0, 0, 1, 0, 1, 0, 1, 1, 0, 1, 1, 0], [0, 0, 1, 1, 1, 0, 1, 0, 1, 1, 0, 0, 1, 1, 0, 0, 0, 1, 1, 1, 1, 0, 1, 1, 1, 1, 1, 0, 1, 0, 1, 1, 0, 1, 0, 1, 0, 0, 0, 1, 1, 0, 1, 0, 0, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1, 0, 1, 1, 0, 0, 0, 0, 1, 1], [0, 0, 1, 1, 0, 1, 1, 0, 0, 0, 0, 0, 1, 0, 1, 0, 0, 0, 0, 0, 0, 0, 0, 1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 1, 0, 0, 0, 1, 1, 1, 1, 0, 0, 1, 1, 1, 1, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 0, 0, 0, 1, 0, 1, 0], [1, 0, 0, 1, 0, 0, 0, 0, 1, 1, 1, 1, 1, 0, 1, 0, 0, 0, 0, 0, 1, 1, 0, 0, 0, 0, 0, 1, 0, 1, 1, 1, 1, 1, 0, 0, 0, 1, 0, 1, 1, 0, 0, 0, 1, 0, 0, 1, 0, 1, 1, 1, 0, 0, 1, 0, 0, 1, 1, 1, 0, 1, 0, 0], [1, 1, 0, 0, 1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 1, 0, 0, 1, 0, 1, 0, 1, 1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 0, 1, 1, 1, 0, 0, 1, 1, 0, 0, 1, 0, 1, 0, 1, 1, 0, 0, 0, 0, 1, 0, 0, 0, 1, 0, 1, 0, 1, 0, 0, 1], [0, 0, 1, 0, 1, 1, 0, 1, 0, 0, 0, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 0, 1, 0, 1, 0, 0, 0, 0, 1, 1, 0, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 1, 0, 1, 1, 0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 0, 0, 1, 0, 1, 0, 1, 1, 0, 0, 1, 1, 1, 0, 1, 0, 1, 1, 1, 0, 0, 0, 0, 1, 0, 1, 1, 0, 0, 1, 0, 0, 0, 1, 0, 0, 1, 1, 0, 0, 1, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 1, 0], [0, 0, 1, 0, 1, 1, 1, 0, 0, 0, 0, 1, 0, 0, 1, 1, 1, 0, 0, 1, 1, 1, 0, 1, 1, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 0, 1, 1, 1, 0, 1, 0, 1, 1, 1, 1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 0, 0, 1, 1, 1, 1, 0, 0], [1, 0, 0, 1, 1, 0, 0, 1, 1, 1, 0, 0, 0, 1, 1, 0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 1, 0, 1, 0, 0, 0, 1, 1, 1, 0, 0, 0, 1, 0, 1, 0, 0, 1, 0, 1, 1, 1, 0, 1, 1, 0, 0, 1, 1, 1, 0, 0, 1, 1, 0, 0, 0, 1], [1, 1, 0, 1, 0, 0, 0, 1, 1, 0, 1, 1, 1, 1, 0, 0, 0, 0, 1, 1, 0, 0, 0, 0, 0, 0, 1, 1, 0, 1, 1, 1, 1, 0, 1, 0, 0, 1, 1, 0, 0, 0, 0, 1, 0, 1, 1, 0, 1, 0, 0, 1, 1, 0, 1, 1, 1, 0, 1, 0, 1, 1, 0, 0], [0, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 1, 0, 1, 0, 0, 0, 0, 1, 0, 0, 1, 0, 1, 0, 1, 0, 0, 1, 0, 1, 1, 1, 1, 0, 1, 0, 1, 1, 0, 0, 1, 1, 1, 1, 1, 0, 0, 0, 1, 0, 0, 1, 0, 0, 1, 0], [0, 1, 1, 0, 0, 1, 0, 1, 0, 0, 1, 0, 0, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1, 1, 0, 1, 1, 0, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 0, 0, 1, 1, 1, 1, 1, 0, 1], [1, 1, 0, 1, 0, 0, 1, 0, 1, 0, 1, 1, 0, 1, 1, 1, 1, 0, 1, 1, 1, 1, 0, 0, 1, 1, 0, 1, 0, 0, 0, 0, 1, 1, 1, 0, 1, 0, 0, 1, 0, 1, 1, 1, 0, 1, 0, 1, 1, 1, 1, 1, 1, 0, 0, 1, 1, 1, 0, 0, 1, 0, 0, 1], [0, 1, 1, 1, 1, 0, 0, 0, 0, 1, 1, 0, 1, 0, 1, 1, 0, 0, 1, 1, 0, 1, 1, 1, 1, 0, 1, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0, 1, 1, 0, 1, 0, 0, 1, 0, 1, 1, 0, 0, 1, 1, 1, 1, 0, 0, 0, 1, 1, 1, 1, 0, 1, 1], [1, 1, 1, 1, 0, 0, 0, 0, 1, 0, 0, 1, 0, 1, 1, 0, 0, 1, 1, 0, 1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 0, 1, 0, 0, 1, 0, 1, 0, 1, 1, 1, 1, 1, 0, 0, 1, 0, 0, 1, 0, 0, 1, 0, 1, 0, 0, 0, 0, 0, 1, 0, 0, 1, 0], [1, 1, 1, 0, 0, 1, 0, 1, 1, 1, 0, 0, 1, 0, 0, 0, 1, 0, 1, 0, 1, 0, 0, 1, 0, 1, 0, 0, 0, 1, 1, 1, 0, 0, 0, 0, 1, 0, 1, 0, 1, 1, 0, 1, 0, 1, 1, 0, 1, 0, 0, 0, 0, 0, 1, 1, 1, 1, 1, 1, 0, 1, 1, 0], [0, 1, 1, 1, 1, 1, 0, 1, 0, 0, 0, 0, 1, 1, 0, 1, 1, 1, 0, 0, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0, 1, 0, 1, 1, 0, 1, 0, 0, 1, 0, 1, 0, 0, 0, 1, 1, 1, 0, 0], [0, 0, 1, 1, 0, 1, 0, 0, 1, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 1, 0, 1, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 1, 0, 1, 0, 0, 1, 0, 0, 0, 0, 1, 1, 0, 1, 1, 0, 1, 1, 0, 0, 1, 0, 0, 1, 0, 1, 1, 1, 1, 1], [0, 1, 1, 1, 1, 0, 0, 1, 1, 1, 1, 1, 1, 0, 0, 0, 1, 1, 0, 0, 0, 1, 0, 1, 0, 0, 0, 0, 0, 0, 1, 1, 0, 1, 1, 0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 1, 0, 1, 0, 0, 0, 1, 1, 0, 0, 1, 0, 0, 1, 1, 0, 1, 0, 1], [0, 1, 1, 1, 1, 0, 1, 0, 1, 0, 1, 1, 1, 1, 1, 0, 1, 0, 0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 1, 1, 0, 0, 0, 0, 0, 1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 0, 1, 1, 0, 1, 0, 1, 1, 1, 1, 0, 1, 0, 0, 1, 1, 1, 1, 1], [0, 0, 1, 1, 1, 1, 0, 1, 1, 1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1, 0, 1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 1, 1, 0, 1, 1, 0, 1, 0, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 1, 1, 0, 1, 1, 1, 0, 1, 0, 1], [1, 0, 0, 0, 0, 1, 1, 0, 1, 1, 1, 1, 0, 1, 1, 0, 0, 0, 0, 0, 1, 1, 0, 1, 0, 1, 0, 0, 1, 0, 0, 1, 1, 0, 1, 1, 0, 0, 1, 1, 0, 1, 0, 0, 0, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1, 0, 0, 1, 1, 0, 1, 1, 1, 1], [0, 1, 0, 1, 1, 0, 0, 1, 1, 1, 1, 1, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 0, 1, 1, 0, 1, 0, 1, 0, 1, 1, 0, 0, 1, 1, 0, 0, 0, 0, 1, 0, 1, 0, 1, 1, 0, 0, 0, 0, 0, 1, 1, 0, 1, 0, 1, 0, 1, 1, 0, 1, 1, 1], [0, 0, 1, 0, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 0, 1, 1, 1, 0, 0, 0, 0, 1, 1, 0, 0, 0, 0, 0, 0, 1, 0, 1, 1, 1, 0, 0, 1, 0, 0, 0, 1, 0, 1, 1, 0, 0, 0, 0, 1, 0, 1, 0, 1, 0, 0, 1, 1, 1, 1, 0, 0, 1, 1], [1, 0, 1, 1, 1, 0, 1, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 1, 0, 1, 0, 0, 0, 0, 1, 1, 0, 1, 1, 0, 0, 0, 0, 0, 0, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 1, 1, 0, 0, 0, 0, 1, 0, 1, 0, 0, 1, 1, 1, 1, 0, 1, 0, 0], [0, 0, 1, 0, 1, 1, 1, 0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 0, 1, 1, 0, 1, 1, 1, 1, 1, 0, 0, 1, 1, 1, 1, 1, 1, 0, 0, 1, 0, 1, 1, 0, 1, 0, 1, 0, 0, 1, 1, 0, 0, 0, 1, 1, 1, 0, 0, 1, 0, 1, 0, 0, 0, 1, 1], [1, 1, 1, 0, 0, 0, 1, 1, 0, 1, 0, 0, 0, 0, 0, 1, 1, 0, 1, 1, 1, 1, 0, 0, 0, 1, 0, 1, 1, 0, 1, 0, 1, 1, 0, 0, 0, 1, 0, 1, 0, 0, 0, 0, 1, 1, 1, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 0, 1, 1], [1, 0, 1, 1, 0, 1, 1, 1, 0, 1, 0, 1, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0, 1, 0, 1, 0, 0, 0, 1, 1, 1, 0, 0, 1, 0, 1, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 1, 1, 1, 0, 1, 0, 1, 1, 0, 0, 1, 0, 0, 1, 0, 0, 1], [1, 1, 1, 0, 1, 0, 1, 0, 1, 0, 1, 0, 0, 1, 1, 0, 1, 1, 1, 0, 1, 0, 1, 0, 1, 0, 0, 1, 1, 1, 0, 1, 1, 1, 1, 1, 0, 1, 1, 0, 0, 1, 1, 0, 0, 1, 0, 1, 1, 0, 0, 0, 1, 0, 1, 0, 0, 0, 0, 1, 1, 0, 0, 0], [0, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 1, 0, 0, 0, 1, 1, 0, 1, 1, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 1, 0, 1, 0, 1, 1, 1, 1, 0, 0, 1, 1, 0, 0, 0, 0, 0, 0, 1, 1, 0, 0, 1, 1, 0, 1, 1, 0, 1, 1, 0], [0, 1, 0, 0, 1, 1, 1, 1, 1, 0, 0, 0, 1, 0, 0, 1, 0, 0, 1, 1, 0, 0, 1, 1, 0, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 1, 1, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1, 0, 0, 1, 0, 0, 1], [1, 0, 1, 0, 0, 1, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 1, 1, 1, 0, 0, 0, 0, 1, 0, 0, 0, 1, 0, 0, 0, 0, 1, 1, 0, 1, 1, 0, 0, 1, 1, 0, 1, 1, 0, 1, 1, 0, 0, 0, 1, 0, 1, 1, 0, 0, 1, 0, 1, 1, 0, 0], [0, 1, 0, 0, 1, 1, 1, 0, 0, 1, 0, 0, 1, 1, 0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 1, 0, 0, 1, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0, 0, 1, 1, 0, 0, 1, 1, 0, 0, 1, 1, 1, 0, 0, 0, 0, 1, 0, 1, 1, 1, 1, 1], [0, 0, 0, 0, 1, 1, 1, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 1, 1, 0, 1, 0, 1, 1, 0, 0, 1, 1, 1, 0, 1, 1, 0, 1, 0, 1, 1, 1, 1, 0, 0, 1, 1, 0, 1, 0, 0, 0, 1, 0, 1, 1, 1, 1, 0, 0, 0, 1, 0, 1, 1, 1, 0, 1], [1, 0, 0, 0, 1, 0, 0, 0, 1, 0, 1, 1, 0, 0, 1, 0, 1, 1, 0, 1, 1, 0, 0, 0, 0, 1, 1, 0, 1, 0, 0, 1, 0, 1, 0, 1, 0, 1, 0, 0, 1, 1, 1, 0, 0, 1, 1, 1, 1, 0, 1, 0, 1, 0, 1, 1, 0, 0, 0, 0, 1, 1, 1, 0], [1, 1, 1, 0, 1, 0, 1, 0, 1, 1, 0, 1, 1, 1, 0, 1, 1, 1, 1, 1, 1, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1, 0, 1, 0, 0, 1, 1, 0, 0, 0, 1, 0, 0, 1, 1, 1, 1, 1, 1, 0, 1, 1, 0, 1, 0, 0, 1, 0, 1, 0, 1, 0, 0, 1], [1, 0, 1, 1, 0, 1, 0, 0, 0, 0, 1, 0, 1, 1, 1, 1, 0, 0, 0, 0, 1, 0, 0, 1, 0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 0, 1, 1, 1, 0, 0, 0, 1, 0, 0, 0, 0, 1, 1, 0, 1, 0, 0, 0, 1, 1, 0, 0, 1, 0, 1, 1, 1, 0, 0], [0, 0, 1, 0, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 1, 1, 0, 0, 0, 0, 0, 1, 1, 0, 1, 0, 0, 1, 0, 0, 1, 0, 1, 0, 0, 0, 0, 0, 1, 0, 0, 0, 1, 1, 0, 1, 0, 1, 0, 1, 1, 1, 0, 1, 1, 0, 1, 1, 1, 1, 0, 1, 0, 0], [0, 1, 1, 0, 0, 1, 0, 0, 0, 1, 0, 1, 0, 0, 0, 0, 1, 1, 0, 0, 1, 1, 0, 0, 1, 0, 0, 1, 1, 1, 1, 1, 0, 1, 0, 0, 1, 1, 0, 0, 0, 0, 0, 0, 0, 1, 0, 1, 0, 0, 0, 1, 0, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0], ]) sample2output = array([ [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [0, 1, 0, 0, 0, 0], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 1, 0], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [1, 0, 0, 1, 0, 0], [1, 1, 0, 0, 0, 0], [0, 0, 0, 1, 0, 0], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [1, 0, 1, 0, 0, 0], [0, 0, 1, 0, 0, 0], [0, 1, 0, 0, 0, 0], [0, 0, 1, 0, 0, 0], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 1, 0], [1, 0, 0, 0, 0, 1], [1, 1, 0, 0, 0, 0], [1, 1, 0, 0, 0, 0], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 1, 0], [1, 0, 1, 0, 0, 0], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [0, 0, 0, 1, 0, 0], [0, 0, 0, 1, 0, 0], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 1, 0], [1, 0, 0, 0, 1, 0], [1, 0, 1, 0, 0, 0], [1, 0, 0, 0, 0, 1], [1, 0, 1, 0, 0, 0], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [1, 0, 1, 0, 0, 0], [1, 0, 1, 0, 0, 0], [0, 0, 1, 0, 0, 0], [1, 0, 0, 0, 0, 1], [0, 1, 0, 0, 0, 0], [0, 0, 0, 1, 0, 0], [0, 0, 1, 0, 0, 0], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 1, 0], [0, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [0, 0, 0, 0, 1, 0], [0, 1, 0, 0, 0, 0], [0, 0, 1, 0, 0, 0], [0, 0, 0, 1, 0, 0], [0, 0, 0, 0, 1, 0], [1, 0, 1, 0, 0, 0], [1, 1, 0, 0, 0, 0], [0, 0, 0, 0, 1, 0], [0, 0, 1, 0, 0, 0], [1, 0, 0, 0, 1, 0], [1, 0, 0, 1, 0, 0], [0, 0, 1, 0, 0, 0], [0, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [1, 0, 0, 1, 0, 0], [1, 1, 0, 0, 0, 0], [1, 0, 0, 0, 1, 0], [1, 0, 0, 0, 1, 0], [0, 0, 0, 1, 0, 0], [0, 0, 0, 0, 0, 1], [0, 0, 1, 0, 0, 0], [1, 0, 0, 0, 1, 0], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [0, 0, 1, 0, 0, 0], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [1, 0, 1, 0, 0, 0], [0, 0, 0, 0, 0, 1], [0, 0, 0, 0, 1, 0], [0, 1, 0, 0, 0, 0], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [1, 0, 1, 0, 0, 0], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 1, 0], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 1, 0], [1, 0, 1, 0, 0, 0], [0, 0, 0, 0, 1, 0], [0, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [0, 1, 0, 0, 0, 0], [1, 0, 1, 0, 0, 0], [0, 0, 0, 0, 0, 1], [1, 1, 0, 0, 0, 0], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [1, 0, 1, 0, 0, 0], [1, 0, 0, 0, 0, 1], [1, 0, 1, 0, 0, 0], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 1, 0], [0, 0, 1, 0, 0, 0], [0, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [0, 1, 0, 0, 0, 0], [1, 0, 0, 0, 0, 1], [1, 0, 0, 1, 0, 0], [0, 0, 0, 0, 0, 1], [1, 0, 1, 0, 0, 0], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 1, 0], [1, 0, 1, 0, 0, 0], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 1, 0], [1, 0, 0, 0, 0, 1], [0, 0, 1, 0, 0, 0], [1, 0, 0, 0, 0, 1], [1, 1, 0, 0, 0, 0], [0, 1, 0, 0, 0, 0], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [1, 1, 0, 0, 0, 0], [0, 0, 0, 1, 0, 0], [0, 0, 1, 0, 0, 0], [0, 0, 0, 0, 1, 0], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 1, 0], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 1, 0], [0, 0, 0, 0, 1, 0], [1, 0, 0, 0, 1, 0], [0, 0, 0, 1, 0, 0], [0, 0, 0, 0, 0, 1], [0, 0, 0, 0, 1, 0], [1, 0, 0, 0, 1, 0], [0, 0, 1, 0, 0, 0], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [0, 1, 0, 0, 0, 0], [0, 0, 0, 0, 0, 1], [1, 1, 0, 0, 0, 0], [1, 0, 0, 1, 0, 0], [1, 0, 0, 0, 1, 0], [0, 0, 0, 0, 0, 1], [1, 0, 1, 0, 0, 0], [1, 1, 0, 0, 0, 0], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [1, 1, 0, 0, 0, 0], [1, 0, 0, 0, 0, 1], [1, 0, 1, 0, 0, 0], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 1, 0], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 1, 0], [1, 0, 0, 0, 1, 0], [0, 0, 0, 1, 0, 0], [1, 0, 0, 1, 0, 0], [0, 0, 0, 0, 0, 1], [1, 0, 0, 1, 0, 0], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [0, 0, 1, 0, 0, 0], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [1, 1, 0, 0, 0, 0], [1, 0, 0, 0, 0, 1], [0, 1, 0, 0, 0, 0], [1, 0, 0, 0, 1, 0], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [1, 1, 0, 0, 0, 0], [1, 1, 0, 0, 0, 0], [0, 0, 0, 1, 0, 0], [1, 0, 0, 0, 1, 0], [0, 0, 1, 0, 0, 0], [1, 0, 0, 0, 0, 1], [1, 0, 1, 0, 0, 0], [1, 0, 0, 0, 1, 0], [0, 0, 0, 1, 0, 0], [1, 1, 0, 0, 0, 0], [1, 1, 0, 0, 0, 0], [0, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [1, 0, 0, 1, 0, 0], [0, 1, 0, 0, 0, 0], [1, 0, 1, 0, 0, 0], [0, 0, 0, 1, 0, 0], [1, 1, 0, 0, 0, 0], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [0, 0, 0, 0, 1, 0], [0, 0, 0, 1, 0, 0], [1, 0, 1, 0, 0, 0], [1, 0, 1, 0, 0, 0], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [1, 1, 0, 0, 0, 0], [1, 0, 0, 1, 0, 0], [0, 0, 1, 0, 0, 0], [0, 0, 0, 1, 0, 0], [0, 0, 1, 0, 0, 0], [0, 0, 0, 0, 1, 0], [0, 0, 0, 1, 0, 0], [1, 0, 0, 0, 0, 1], [0, 0, 0, 1, 0, 0], [1, 0, 0, 0, 1, 0], [1, 1, 0, 0, 0, 0], [1, 0, 0, 1, 0, 0], [0, 1, 0, 0, 0, 0], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 1, 0], [1, 0, 0, 0, 1, 0], [0, 0, 0, 0, 1, 0], [0, 1, 0, 0, 0, 0], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [0, 1, 0, 0, 0, 0], [0, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [0, 0, 1, 0, 0, 0], [0, 0, 0, 0, 1, 0], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [0, 0, 0, 1, 0, 0], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 1, 0], [1, 0, 1, 0, 0, 0], [1, 1, 0, 0, 0, 0], [0, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [1, 1, 0, 0, 0, 0], [1, 0, 0, 0, 0, 1], [0, 0, 1, 0, 0, 0], [1, 0, 0, 0, 0, 1], [1, 1, 0, 0, 0, 0], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 1, 0], [0, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 1, 0], [1, 0, 0, 0, 0, 1], [1, 0, 1, 0, 0, 0], [1, 0, 0, 1, 0, 0], [1, 0, 0, 1, 0, 0], [1, 0, 0, 0, 0, 1], [1, 0, 0, 1, 0, 0], [0, 0, 0, 0, 1, 0], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 1, 0], [0, 0, 1, 0, 0, 0], [0, 0, 0, 0, 1, 0], [0, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [0, 0, 0, 0, 1, 0], [1, 0, 1, 0, 0, 0], [0, 0, 1, 0, 0, 0], [0, 0, 0, 1, 0, 0], [0, 0, 1, 0, 0, 0], [1, 0, 1, 0, 0, 0], [0, 1, 0, 0, 0, 0], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 1, 0], [1, 1, 0, 0, 0, 0], [1, 0, 0, 0, 0, 1], [1, 0, 0, 1, 0, 0], [0, 0, 0, 0, 0, 1], [1, 0, 1, 0, 0, 0], [1, 0, 1, 0, 0, 0], [0, 1, 0, 0, 0, 0], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 1, 0], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 1, 0], [1, 0, 0, 1, 0, 0], [1, 0, 0, 0, 1, 0], [1, 0, 0, 0, 1, 0], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 1, 0], [0, 0, 1, 0, 0, 0], [1, 0, 1, 0, 0, 0], [0, 0, 0, 0, 1, 0], [0, 0, 0, 0, 0, 1], [0, 1, 0, 0, 0, 0], [1, 0, 1, 0, 0, 0], [0, 0, 0, 0, 0, 1], [0, 0, 0, 0, 1, 0], [1, 0, 1, 0, 0, 0], [0, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 1, 0], [1, 0, 0, 0, 0, 1], [1, 0, 1, 0, 0, 0], [0, 0, 0, 1, 0, 0], [0, 0, 1, 0, 0, 0], [0, 0, 0, 0, 0, 1], [0, 0, 0, 0, 1, 0], [0, 0, 1, 0, 0, 0], [1, 1, 0, 0, 0, 0], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [1, 0, 1, 0, 0, 0], [0, 0, 1, 0, 0, 0], [0, 0, 0, 0, 1, 0], [0, 0, 1, 0, 0, 0], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [1, 0, 0, 1, 0, 0], [0, 0, 0, 1, 0, 0], [1, 0, 0, 1, 0, 0], [1, 1, 0, 0, 0, 0], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 1, 0], [0, 0, 1, 0, 0, 0], [1, 1, 0, 0, 0, 0], [1, 0, 0, 0, 1, 0], [1, 0, 0, 1, 0, 0], [1, 0, 0, 0, 0, 1], [0, 1, 0, 0, 0, 0], [0, 0, 0, 0, 1, 0], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [1, 1, 0, 0, 0, 0], [0, 0, 0, 0, 0, 1], [1, 0, 1, 0, 0, 0], [0, 0, 1, 0, 0, 0], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 1, 0], [1, 0, 0, 0, 0, 1], [0, 1, 0, 0, 0, 0], [1, 0, 1, 0, 0, 0], [1, 0, 0, 0, 1, 0], [1, 0, 0, 1, 0, 0], [0, 1, 0, 0, 0, 0], [0, 0, 0, 0, 1, 0], [1, 0, 1, 0, 0, 0], [0, 0, 0, 0, 0, 1], [0, 0, 0, 1, 0, 0], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [0, 0, 0, 1, 0, 0], [1, 0, 0, 0, 0, 1], [1, 0, 1, 0, 0, 0], [0, 0, 0, 0, 1, 0], [0, 0, 0, 0, 1, 0], [1, 0, 0, 1, 0, 0], [1, 0, 1, 0, 0, 0], [0, 0, 0, 0, 1, 0], [0, 1, 0, 0, 0, 0], [1, 0, 0, 0, 1, 0], [0, 0, 0, 0, 0, 1], [0, 1, 0, 0, 0, 0], [1, 0, 1, 0, 0, 0], [0, 0, 0, 1, 0, 0], [1, 0, 0, 0, 1, 0], [1, 0, 0, 0, 0, 1], [1, 0, 1, 0, 0, 0], [1, 0, 0, 0, 0, 1], [1, 1, 0, 0, 0, 0], [0, 0, 0, 1, 0, 0], [1, 1, 0, 0, 0, 0], [0, 0, 0, 0, 0, 1], [1, 0, 1, 0, 0, 0], [0, 0, 0, 0, 1, 0], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 1, 0], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 1, 0], [1, 0, 0, 0, 0, 1], [1, 0, 0, 1, 0, 0], [1, 0, 0, 0, 0, 1], [1, 1, 0, 0, 0, 0], [0, 0, 1, 0, 0, 0], [1, 0, 0, 0, 0, 1], [1, 0, 1, 0, 0, 0], [1, 0, 0, 0, 0, 1], [1, 1, 0, 0, 0, 0], [0, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [1, 0, 0, 1, 0, 0], [1, 0, 0, 0, 1, 0], [0, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [0, 0, 0, 1, 0, 0], [0, 0, 0, 0, 0, 1], [1, 0, 0, 1, 0, 0], [1, 0, 0, 0, 0, 1], [0, 0, 0, 1, 0, 0], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [0, 0, 1, 0, 0, 0], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [1, 0, 1, 0, 0, 0], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 1, 0], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [0, 1, 0, 0, 0, 0], [0, 1, 0, 0, 0, 0], [0, 0, 0, 1, 0, 0], [1, 0, 0, 1, 0, 0], [0, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [1, 0, 1, 0, 0, 0], [0, 0, 0, 0, 0, 1], [0, 0, 0, 1, 0, 0], [0, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [0, 0, 0, 0, 1, 0], [0, 0, 0, 1, 0, 0], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [1, 0, 1, 0, 0, 0], [0, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [1, 1, 0, 0, 0, 0], [1, 0, 1, 0, 0, 0], [1, 1, 0, 0, 0, 0], [0, 0, 0, 1, 0, 0], [0, 0, 0, 0, 1, 0], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [1, 0, 1, 0, 0, 0], [1, 1, 0, 0, 0, 0], [0, 0, 0, 0, 0, 1], [1, 0, 0, 1, 0, 0], [0, 0, 0, 0, 1, 0], [0, 0, 0, 0, 0, 1], [0, 0, 0, 1, 0, 0], [0, 0, 0, 0, 1, 0], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [1, 0, 1, 0, 0, 0], [0, 0, 0, 0, 0, 1], [0, 1, 0, 0, 0, 0], [0, 0, 0, 0, 0, 1], [1, 1, 0, 0, 0, 0], [1, 0, 0, 0, 1, 0], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 1, 0], [1, 0, 0, 1, 0, 0], [0, 0, 0, 1, 0, 0], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [0, 0, 0, 1, 0, 0], [0, 0, 0, 0, 1, 0], [0, 1, 0, 0, 0, 0], [1, 1, 0, 0, 0, 0], [0, 0, 0, 0, 0, 1], [0, 1, 0, 0, 0, 0], [1, 0, 1, 0, 0, 0], [1, 0, 0, 0, 1, 0], [1, 0, 0, 0, 0, 1], [0, 0, 0, 1, 0, 0], [1, 0, 1, 0, 0, 0], [0, 1, 0, 0, 0, 0], [1, 0, 0, 0, 0, 1], [1, 0, 1, 0, 0, 0], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [1, 0, 0, 1, 0, 0], [1, 0, 0, 1, 0, 0], [0, 0, 0, 0, 0, 1], [1, 0, 1, 0, 0, 0], [0, 0, 0, 0, 1, 0], [1, 0, 0, 0, 0, 1], [1, 0, 1, 0, 0, 0], [0, 0, 0, 0, 0, 1], [0, 0, 1, 0, 0, 0], [0, 0, 0, 1, 0, 0], [1, 1, 0, 0, 0, 0], [0, 1, 0, 0, 0, 0], [0, 0, 0, 0, 1, 0], [0, 0, 1, 0, 0, 0], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [0, 0, 0, 1, 0, 0], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 1, 0], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [0, 0, 1, 0, 0, 0], [1, 0, 0, 0, 0, 1], [1, 0, 1, 0, 0, 0], [0, 0, 0, 0, 1, 0], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 1, 0], [0, 1, 0, 0, 0, 0], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [0, 0, 1, 0, 0, 0], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 1, 0], [0, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [1, 1, 0, 0, 0, 0], [0, 0, 0, 0, 1, 0], [0, 1, 0, 0, 0, 0], [0, 1, 0, 0, 0, 0], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [0, 0, 1, 0, 0, 0], [0, 0, 0, 0, 0, 1], [1, 0, 0, 1, 0, 0], [0, 0, 0, 0, 0, 1], [0, 0, 0, 1, 0, 0], [0, 0, 0, 0, 0, 1], [1, 1, 0, 0, 0, 0], [0, 0, 0, 1, 0, 0], [0, 0, 0, 0, 0, 1], [0, 0, 0, 1, 0, 0], [0, 0, 0, 0, 1, 0], [1, 1, 0, 0, 0, 0], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 1, 0], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 1, 0], [1, 0, 0, 1, 0, 0], [0, 0, 1, 0, 0, 0], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 1, 0], [0, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [1, 0, 1, 0, 0, 0], [0, 0, 0, 0, 0, 1], [1, 0, 0, 1, 0, 0], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [1, 0, 1, 0, 0, 0], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 1, 0], [0, 0, 0, 0, 0, 1], [0, 0, 0, 0, 1, 0], [0, 0, 0, 0, 0, 1], [1, 0, 1, 0, 0, 0], [0, 0, 1, 0, 0, 0], [0, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [0, 0, 0, 0, 1, 0], [0, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [0, 0, 0, 1, 0, 0], [1, 1, 0, 0, 0, 0], [0, 0, 0, 0, 0, 1], [0, 0, 0, 0, 1, 0], [0, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [0, 0, 0, 1, 0, 0], [0, 0, 1, 0, 0, 0], [0, 0, 0, 0, 0, 1], [0, 0, 1, 0, 0, 0], [0, 0, 1, 0, 0, 0], [1, 1, 0, 0, 0, 0], [0, 0, 0, 1, 0, 0], [0, 0, 0, 1, 0, 0], [1, 0, 1, 0, 0, 0], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 1, 0], [0, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [0, 1, 0, 0, 0, 0], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [1, 1, 0, 0, 0, 0], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 1, 0], [0, 0, 1, 0, 0, 0], [0, 0, 0, 1, 0, 0], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [0, 0, 1, 0, 0, 0], [1, 1, 0, 0, 0, 0], [0, 0, 1, 0, 0, 0], [0, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [0, 1, 0, 0, 0, 0], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 1, 0], [0, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 1, 0], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [1, 0, 1, 0, 0, 0], [0, 0, 0, 1, 0, 0], [0, 0, 0, 1, 0, 0], [1, 0, 1, 0, 0, 0], [0, 0, 0, 1, 0, 0], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [1, 0, 1, 0, 0, 0], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [1, 0, 0, 1, 0, 0], [0, 1, 0, 0, 0, 0], [0, 0, 0, 0, 1, 0], [1, 0, 0, 0, 0, 1], [1, 0, 1, 0, 0, 0], [1, 0, 0, 0, 1, 0], [0, 0, 0, 0, 0, 1], [0, 0, 0, 1, 0, 0], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [1, 1, 0, 0, 0, 0], [0, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [0, 0, 0, 1, 0, 0], [0, 0, 1, 0, 0, 0], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 1, 0], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [0, 0, 1, 0, 0, 0], [0, 1, 0, 0, 0, 0], [0, 0, 0, 1, 0, 0], [1, 1, 0, 0, 0, 0], [0, 0, 0, 1, 0, 0], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [0, 1, 0, 0, 0, 0], [1, 0, 0, 0, 0, 1], [0, 0, 0, 1, 0, 0], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 1, 0], [1, 0, 0, 0, 0, 1], [0, 0, 0, 1, 0, 0], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [1, 1, 0, 0, 0, 0], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 1, 0], [1, 0, 1, 0, 0, 0], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 1, 0], [0, 0, 0, 0, 0, 1], [0, 0, 0, 0, 1, 0], [1, 0, 0, 0, 1, 0], [1, 0, 0, 0, 1, 0], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 1, 0], [0, 0, 0, 0, 1, 0], [0, 1, 0, 0, 0, 0], [1, 0, 0, 0, 0, 1], [0, 1, 0, 0, 0, 0], [0, 0, 1, 0, 0, 0], [1, 0, 0, 0, 0, 1], [0, 0, 1, 0, 0, 0], [0, 0, 1, 0, 0, 0], [0, 1, 0, 0, 0, 0], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [1, 1, 0, 0, 0, 0], [1, 1, 0, 0, 0, 0], [1, 0, 0, 1, 0, 0], [1, 0, 0, 0, 1, 0], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 1, 0], [1, 0, 0, 0, 1, 0], [0, 0, 0, 0, 1, 0], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [0, 0, 0, 1, 0, 0], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [0, 0, 1, 0, 0, 0], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [0, 0, 0, 1, 0, 0], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 1, 0], [0, 0, 0, 0, 0, 1], [0, 0, 1, 0, 0, 0], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [1, 0, 0, 1, 0, 0], [1, 0, 0, 0, 0, 1], [1, 1, 0, 0, 0, 0], [1, 0, 0, 0, 1, 0], [0, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [0, 0, 1, 0, 0, 0], [1, 0, 0, 0, 0, 1], [1, 0, 1, 0, 0, 0], [0, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [1, 0, 0, 1, 0, 0], [1, 0, 1, 0, 0, 0], [1, 0, 1, 0, 0, 0], [1, 0, 0, 0, 1, 0], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 1, 0], [1, 1, 0, 0, 0, 0], [1, 0, 0, 0, 0, 1], [1, 0, 1, 0, 0, 0], [1, 0, 0, 0, 0, 1], [1, 0, 1, 0, 0, 0], [0, 1, 0, 0, 0, 0], [0, 0, 0, 0, 0, 1], [0, 0, 1, 0, 0, 0], [1, 0, 0, 0, 0, 1], [1, 1, 0, 0, 0, 0], [0, 0, 0, 1, 0, 0], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 1, 0], [0, 0, 0, 1, 0, 0], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 1, 0], [1, 1, 0, 0, 0, 0], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [1, 0, 1, 0, 0, 0], [0, 0, 0, 0, 0, 1], [0, 1, 0, 0, 0, 0], [1, 0, 0, 0, 1, 0], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [0, 0, 1, 0, 0, 0], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 1, 0], [0, 0, 0, 0, 0, 1], [0, 0, 0, 1, 0, 0], [0, 0, 0, 1, 0, 0], [1, 1, 0, 0, 0, 0], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [0, 0, 0, 1, 0, 0], [0, 0, 0, 0, 0, 1], [1, 0, 0, 1, 0, 0], [0, 0, 0, 0, 1, 0], [0, 0, 0, 0, 1, 0], [1, 0, 0, 0, 0, 1], [1, 1, 0, 0, 0, 0], [0, 0, 0, 0, 0, 1], [0, 0, 0, 0, 1, 0], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [0, 1, 0, 0, 0, 0], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 1, 0], [0, 0, 0, 0, 0, 1], [0, 0, 0, 0, 1, 0], [0, 0, 0, 1, 0, 0], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [0, 0, 1, 0, 0, 0], [0, 0, 0, 0, 1, 0], [1, 0, 0, 0, 0, 1], [0, 0, 1, 0, 0, 0], [1, 0, 0, 0, 1, 0], [1, 0, 0, 1, 0, 0], [1, 0, 0, 1, 0, 0], [0, 0, 0, 1, 0, 0], [0, 0, 0, 0, 0, 1], [0, 0, 0, 1, 0, 0], [1, 0, 0, 0, 0, 1], [1, 1, 0, 0, 0, 0], [1, 0, 0, 0, 0, 1], [0, 0, 1, 0, 0, 0], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 1, 0], [0, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [0, 1, 0, 0, 0, 0], [1, 0, 0, 0, 1, 0], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 1, 0], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [0, 0, 0, 1, 0, 0], [1, 0, 1, 0, 0, 0], [0, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [1, 0, 0, 1, 0, 0], [0, 1, 0, 0, 0, 0], [0, 0, 0, 1, 0, 0], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [0, 0, 1, 0, 0, 0], [0, 0, 1, 0, 0, 0], [1, 0, 0, 0, 1, 0], [0, 0, 0, 0, 0, 1], [1, 1, 0, 0, 0, 0], [1, 0, 0, 0, 1, 0], [1, 0, 0, 0, 1, 0], [1, 1, 0, 0, 0, 0], [0, 0, 0, 0, 0, 1], [1, 1, 0, 0, 0, 0], [1, 1, 0, 0, 0, 0], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 1, 0], [1, 1, 0, 0, 0, 0], [1, 0, 0, 0, 0, 1], [1, 1, 0, 0, 0, 0], [0, 0, 0, 0, 1, 0], [0, 0, 0, 0, 1, 0], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [1, 1, 0, 0, 0, 0], [1, 0, 0, 0, 1, 0], [1, 0, 1, 0, 0, 0], [1, 0, 0, 0, 0, 1], [1, 1, 0, 0, 0, 0], [0, 0, 0, 0, 1, 0], [0, 0, 0, 0, 1, 0], [0, 0, 1, 0, 0, 0], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [0, 1, 0, 0, 0, 0], [0, 0, 0, 0, 0, 1], [0, 0, 0, 1, 0, 0], [0, 0, 1, 0, 0, 0], [1, 0, 0, 0, 1, 0], [1, 0, 0, 0, 0, 1], [1, 1, 0, 0, 0, 0], [1, 0, 0, 0, 0, 1], [1, 0, 0, 1, 0, 0], [0, 0, 0, 0, 0, 1], [1, 0, 0, 1, 0, 0], [1, 0, 0, 0, 0, 1], [0, 0, 0, 1, 0, 0], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [0, 0, 0, 1, 0, 0], [0, 0, 0, 0, 0, 1], [0, 0, 0, 0, 1, 0], [1, 0, 0, 0, 1, 0], [0, 0, 0, 0, 0, 1], [1, 1, 0, 0, 0, 0], [1, 0, 0, 0, 0, 1], [1, 1, 0, 0, 0, 0], [0, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 1, 0], [1, 0, 1, 0, 0, 0], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 1, 0], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 1, 0], [0, 1, 0, 0, 0, 0], [0, 0, 0, 0, 1, 0], [0, 0, 0, 1, 0, 0], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [1, 0, 1, 0, 0, 0], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [0, 1, 0, 0, 0, 0], [1, 0, 1, 0, 0, 0], [0, 1, 0, 0, 0, 0], [0, 0, 1, 0, 0, 0], [0, 0, 0, 0, 0, 1], [0, 1, 0, 0, 0, 0], [0, 0, 0, 0, 0, 1], [1, 0, 0, 1, 0, 0], [1, 0, 1, 0, 0, 0], [0, 1, 0, 0, 0, 0], [0, 0, 0, 0, 0, 1], [1, 0, 1, 0, 0, 0], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 1, 0], [0, 0, 0, 0, 0, 1], [0, 0, 0, 0, 1, 0], [0, 0, 0, 0, 1, 0], [0, 1, 0, 0, 0, 0], [1, 0, 0, 0, 0, 1], [0, 0, 0, 1, 0, 0], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 1, 0], [1, 0, 0, 0, 1, 0], [0, 0, 0, 0, 1, 0], [1, 1, 0, 0, 0, 0], [0, 0, 1, 0, 0, 0], [1, 0, 0, 0, 0, 1], [0, 0, 0, 1, 0, 0], [0, 0, 0, 1, 0, 0], [1, 0, 1, 0, 0, 0], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [1, 0, 1, 0, 0, 0], [0, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [0, 0, 0, 1, 0, 0], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 1, 0], [0, 0, 0, 0, 0, 1], [1, 0, 1, 0, 0, 0], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 1, 0], [0, 0, 0, 1, 0, 0], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [0, 0, 0, 0, 1, 0], [1, 0, 0, 1, 0, 0], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [0, 0, 1, 0, 0, 0], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 1, 0], [1, 0, 0, 0, 0, 1], [1, 0, 0, 1, 0, 0], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 1, 0], [1, 0, 0, 0, 0, 1], [0, 0, 1, 0, 0, 0], [0, 0, 0, 1, 0, 0], [1, 1, 0, 0, 0, 0], [0, 0, 0, 0, 1, 0], [1, 0, 1, 0, 0, 0], [0, 0, 0, 0, 0, 1], [0, 0, 0, 1, 0, 0], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 1, 0], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 1, 0], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 1, 0], [0, 0, 0, 0, 0, 1], [0, 0, 0, 1, 0, 0], [0, 1, 0, 0, 0, 0], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [0, 0, 0, 1, 0, 0], [1, 1, 0, 0, 0, 0], [0, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [0, 0, 0, 0, 1, 0], [1, 0, 0, 0, 0, 1], [1, 0, 0, 1, 0, 0], [0, 0, 0, 0, 1, 0], [1, 1, 0, 0, 0, 0], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 1, 0], [0, 0, 1, 0, 0, 0], [0, 0, 0, 1, 0, 0], [0, 0, 1, 0, 0, 0], [0, 0, 0, 0, 0, 1], [0, 0, 0, 1, 0, 0], [0, 0, 1, 0, 0, 0], [1, 0, 0, 0, 0, 1], [0, 1, 0, 0, 0, 0], [0, 1, 0, 0, 0, 0], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [0, 0, 1, 0, 0, 0], [0, 1, 0, 0, 0, 0], [1, 0, 0, 1, 0, 0], [1, 0, 1, 0, 0, 0], [0, 0, 0, 1, 0, 0], [1, 0, 0, 1, 0, 0], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 1, 0], [1, 0, 1, 0, 0, 0], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [0, 0, 0, 0, 1, 0], [1, 0, 0, 0, 0, 1], [1, 0, 1, 0, 0, 0], [1, 0, 0, 0, 0, 1], [1, 0, 0, 1, 0, 0], [1, 0, 0, 0, 0, 1], [1, 0, 1, 0, 0, 0], [1, 1, 0, 0, 0, 0], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 1, 0], [1, 0, 0, 0, 0, 1], [0, 0, 1, 0, 0, 0], [1, 0, 0, 0, 1, 0], [0, 0, 0, 0, 1, 0], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [0, 1, 0, 0, 0, 0], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [1, 1, 0, 0, 0, 0], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 1, 0], [0, 0, 1, 0, 0, 0], [0, 0, 0, 0, 0, 1], [0, 0, 1, 0, 0, 0], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 1, 0], [0, 0, 0, 0, 1, 0], [1, 0, 0, 1, 0, 0], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [1, 0, 1, 0, 0, 0], [1, 0, 0, 0, 0, 1], [0, 0, 0, 1, 0, 0], [1, 0, 1, 0, 0, 0], [0, 0, 0, 0, 0, 1], [1, 1, 0, 0, 0, 0], [0, 1, 0, 0, 0, 0], [0, 0, 0, 0, 1, 0], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 1, 0], [1, 0, 0, 0, 1, 0], [0, 0, 0, 0, 0, 1], [1, 1, 0, 0, 0, 0], [0, 0, 0, 0, 1, 0], [1, 0, 1, 0, 0, 0], [0, 0, 1, 0, 0, 0], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [0, 1, 0, 0, 0, 0], [1, 1, 0, 0, 0, 0], [0, 0, 1, 0, 0, 0], [0, 0, 1, 0, 0, 0], [1, 0, 0, 0, 0, 1], [1, 1, 0, 0, 0, 0], [1, 0, 0, 0, 0, 1], [0, 1, 0, 0, 0, 0], [1, 0, 0, 0, 1, 0], [0, 0, 1, 0, 0, 0], [1, 0, 0, 0, 1, 0], [0, 0, 0, 0, 1, 0], [1, 0, 0, 0, 1, 0], [0, 0, 0, 0, 0, 1], [1, 0, 1, 0, 0, 0], [1, 0, 0, 0, 1, 0], [0, 0, 0, 0, 0, 1], [0, 0, 1, 0, 0, 0], [0, 0, 0, 0, 0, 1], [1, 1, 0, 0, 0, 0], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [0, 0, 0, 1, 0, 0], [0, 0, 1, 0, 0, 0], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [0, 0, 0, 1, 0, 0], [0, 1, 0, 0, 0, 0], [1, 0, 1, 0, 0, 0], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [1, 0, 0, 1, 0, 0], [0, 0, 0, 1, 0, 0], [0, 0, 1, 0, 0, 0], [1, 0, 0, 0, 0, 1], [1, 1, 0, 0, 0, 0], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [0, 0, 1, 0, 0, 0], [1, 0, 1, 0, 0, 0], [0, 0, 0, 0, 0, 1], [0, 0, 1, 0, 0, 0], [0, 0, 0, 0, 0, 1], [0, 0, 0, 0, 1, 0], [1, 0, 0, 0, 0, 1], [0, 1, 0, 0, 0, 0], [1, 0, 0, 0, 1, 0], [0, 0, 0, 0, 1, 0], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [0, 1, 0, 0, 0, 0], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [0, 0, 1, 0, 0, 0], [0, 0, 1, 0, 0, 0], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [1, 0, 0, 1, 0, 0], [0, 1, 0, 0, 0, 0], [1, 0, 1, 0, 0, 0], [0, 0, 0, 1, 0, 0], [0, 0, 1, 0, 0, 0], [1, 0, 1, 0, 0, 0], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 1, 0], [0, 0, 0, 1, 0, 0], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 1, 0], [1, 0, 0, 0, 1, 0], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [1, 0, 1, 0, 0, 0], [1, 0, 0, 1, 0, 0], [0, 0, 0, 0, 0, 1], [0, 0, 1, 0, 0, 0], [1, 1, 0, 0, 0, 0], [0, 1, 0, 0, 0, 0], [0, 0, 0, 0, 1, 0], [0, 1, 0, 0, 0, 0], [1, 0, 0, 0, 0, 1], [0, 0, 1, 0, 0, 0], [0, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 1, 0], [0, 0, 0, 1, 0, 0], [1, 0, 0, 0, 0, 1], [1, 0, 1, 0, 0, 0], [0, 0, 0, 0, 1, 0], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 1, 0], [1, 0, 0, 0, 0, 1], [1, 0, 0, 1, 0, 0], [0, 0, 0, 0, 0, 1], [0, 0, 0, 1, 0, 0], [0, 0, 0, 1, 0, 0], [1, 1, 0, 0, 0, 0], [1, 0, 0, 0, 0, 1], [0, 0, 0, 1, 0, 0], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 1, 0], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 1, 0], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 1, 0], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [1, 1, 0, 0, 0, 0], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [0, 1, 0, 0, 0, 0], [0, 0, 0, 0, 0, 1], [0, 0, 0, 1, 0, 0], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 1, 0], [0, 0, 0, 0, 0, 1], [0, 0, 0, 0, 1, 0], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [0, 1, 0, 0, 0, 0], [1, 1, 0, 0, 0, 0], [0, 0, 0, 1, 0, 0], [1, 1, 0, 0, 0, 0], [0, 0, 0, 0, 0, 1], [0, 0, 0, 0, 1, 0], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [1, 0, 1, 0, 0, 0], [1, 1, 0, 0, 0, 0], [0, 0, 0, 1, 0, 0], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 1, 0], [1, 0, 1, 0, 0, 0], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 1, 0], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [0, 0, 0, 0, 1, 0], [0, 0, 0, 0, 1, 0], [1, 0, 0, 0, 1, 0], [1, 0, 0, 0, 1, 0], [1, 0, 1, 0, 0, 0], [0, 0, 0, 0, 1, 0], [1, 0, 0, 0, 0, 1], [1, 1, 0, 0, 0, 0], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [1, 1, 0, 0, 0, 0], [0, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [1, 1, 0, 0, 0, 0], [1, 0, 0, 1, 0, 0], [1, 1, 0, 0, 0, 0], [1, 0, 0, 0, 1, 0], [0, 0, 0, 0, 0, 1], [1, 0, 1, 0, 0, 0], [0, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 1, 0], [1, 1, 0, 0, 0, 0], [0, 0, 0, 0, 0, 1], [0, 0, 0, 0, 1, 0], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 1, 0], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [0, 0, 1, 0, 0, 0], [0, 0, 1, 0, 0, 0], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [0, 1, 0, 0, 0, 0], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 1, 0], [0, 0, 0, 0, 0, 1], [0, 1, 0, 0, 0, 0], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 1, 0], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [1, 1, 0, 0, 0, 0], [1, 1, 0, 0, 0, 0], [0, 1, 0, 0, 0, 0], [0, 0, 0, 0, 0, 1], [0, 0, 1, 0, 0, 0], [1, 0, 0, 0, 1, 0], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [1, 0, 0, 1, 0, 0], [1, 0, 0, 0, 1, 0], [0, 0, 0, 1, 0, 0], [0, 0, 1, 0, 0, 0], [1, 0, 0, 0, 0, 1], [0, 1, 0, 0, 0, 0], [0, 0, 0, 0, 0, 1], [1, 0, 1, 0, 0, 0], [0, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [1, 0, 0, 1, 0, 0], [0, 0, 0, 0, 0, 1], [0, 0, 0, 0, 1, 0], [0, 1, 0, 0, 0, 0], [0, 0, 1, 0, 0, 0], [0, 0, 1, 0, 0, 0], [0, 1, 0, 0, 0, 0], [0, 0, 1, 0, 0, 0], [0, 1, 0, 0, 0, 0], [0, 0, 0, 0, 0, 1], [0, 0, 1, 0, 0, 0], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [0, 1, 0, 0, 0, 0], [0, 0, 0, 0, 1, 0], [0, 1, 0, 0, 0, 0], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [0, 0, 0, 1, 0, 0], [1, 0, 1, 0, 0, 0], [1, 0, 0, 1, 0, 0], [0, 1, 0, 0, 0, 0], [0, 0, 0, 0, 0, 1], [0, 0, 1, 0, 0, 0], [0, 0, 0, 0, 1, 0], [1, 0, 0, 0, 0, 1], [0, 0, 1, 0, 0, 0], [0, 0, 0, 0, 1, 0], [1, 0, 0, 0, 1, 0], [1, 0, 1, 0, 0, 0], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [1, 0, 1, 0, 0, 0], [1, 0, 0, 0, 1, 0], [1, 0, 0, 0, 1, 0], [0, 1, 0, 0, 0, 0], [0, 0, 0, 0, 0, 1], [0, 0, 0, 0, 1, 0], [0, 0, 0, 1, 0, 0], [0, 0, 0, 0, 0, 1], [1, 1, 0, 0, 0, 0], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 1, 0], [1, 0, 0, 1, 0, 0], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 1, 0], [1, 0, 0, 0, 1, 0], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [0, 0, 0, 1, 0, 0], [0, 0, 1, 0, 0, 0], [1, 1, 0, 0, 0, 0], [0, 1, 0, 0, 0, 0], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 1, 0], [0, 0, 0, 0, 1, 0], [1, 0, 1, 0, 0, 0], [1, 1, 0, 0, 0, 0], [0, 0, 0, 0, 0, 1], [1, 1, 0, 0, 0, 0], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [0, 1, 0, 0, 0, 0], [0, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 1, 0], [0, 0, 1, 0, 0, 0], [0, 0, 1, 0, 0, 0], [0, 0, 0, 1, 0, 0], [1, 0, 0, 0, 0, 1], [1, 0, 0, 1, 0, 0], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [0, 0, 0, 0, 1, 0], [1, 0, 0, 0, 1, 0], [0, 0, 0, 1, 0, 0], [1, 0, 0, 0, 1, 0], [1, 0, 1, 0, 0, 0], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 1, 0], [1, 0, 0, 1, 0, 0], [0, 0, 0, 0, 1, 0], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [0, 1, 0, 0, 0, 0], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [0, 0, 1, 0, 0, 0], [0, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [0, 0, 1, 0, 0, 0], [1, 0, 0, 1, 0, 0], [1, 0, 0, 1, 0, 0], [0, 0, 0, 1, 0, 0], [0, 1, 0, 0, 0, 0], [0, 0, 0, 0, 1, 0], [1, 0, 0, 0, 1, 0], [1, 0, 0, 0, 0, 1], [0, 1, 0, 0, 0, 0], [0, 0, 0, 1, 0, 0], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [1, 0, 0, 1, 0, 0], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 1, 0], [0, 0, 1, 0, 0, 0], [0, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [0, 0, 1, 0, 0, 0], [1, 0, 1, 0, 0, 0], [0, 0, 1, 0, 0, 0], [1, 0, 0, 0, 1, 0], [1, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 1], [0, 0, 0, 1, 0, 0], [0, 0, 1, 0, 0, 0], [1, 0, 1, 0, 0, 0], [1, 0, 0, 0, 0, 1], [1, 0, 1, 0, 0, 0], [0, 0, 0, 0, 0, 1], [0, 0, 0, 1, 0, 0], ]) # this takes a looong time to index, and # python may crash several times before indexing is complete import tensorflow as tf from tensorflow import keras from tensorflow.keras.models import Sequential from tensorflow.keras.layers import Dense, Activation model1 = Sequential() model1.add(Dense(17, activation=keras.activations.sigmoid, )) model1.add(Dense(4, activation=keras.activations.sigmoid, )) model1.compile( optimizer=tf.train.AdamOptimizer(0.001), # loss=keras.losses.categorical_crossentropy, loss=keras.losses.mse, metrics=[keras.metrics.binary_accuracy] ) model2 = Sequential() model2.add(Dense(17, activation=keras.activations.sigmoid, )) model2.add(Dense(4, activation=keras.activations.sigmoid, )) model2.compile( optimizer=tf.train.AdamOptimizer(0.001), # loss=keras.losses.categorical_crossentropy, loss=keras.losses.mse, metrics=[keras.metrics.binary_accuracy] ) model3 = Sequential() model3.add(Dense(17, activation=keras.activations.sigmoid, )) model3.add(Dense(17, activation=keras.activations.sigmoid, )) model3.add(Dense(4, activation=keras.activations.sigmoid, )) model3.compile( optimizer=tf.train.AdamOptimizer(0.001), # loss=keras.losses.categorical_crossentropy, loss=keras.losses.mse, metrics=[keras.metrics.binary_accuracy] ) model4 = Sequential() model4.add(Dense(17, activation=keras.activations.sigmoid, )) model4.add(Dense(17, activation=keras.activations.sigmoid, )) model4.add(Dense(17, activation=keras.activations.sigmoid, )) model4.add(Dense(4, activation=keras.activations.sigmoid, )) model4.compile( optimizer=tf.train.AdamOptimizer(0.001), # loss=keras.losses.categorical_crossentropy, loss=keras.losses.mse, metrics=[keras.metrics.binary_accuracy] ) model5 = Sequential() model5.add(Dense(65, activation=keras.activations.sigmoid, )) model5.add(Dense(6, activation=keras.activations.sigmoid, )) model5.compile( optimizer=tf.train.AdamOptimizer(0.001), # loss=keras.losses.categorical_crossentropy, loss=keras.losses.mse, metrics=[keras.metrics.binary_accuracy] ) # This is the process I used to train my weights # model5.fit(samples2, sample2output, epochs=1) # myWeights5 = model5.get_weights() # np.set_printoptions(suppress=True) # np.set_printoptions(precision=2) # np.set_printoptions(threshold=np.nan) # print('myWeights =', myWeights5) # print() # for weight in myWeights5[0]: # print(str(weight) + ",") # My weights - run 1, dataset 1, 1 epoch: # Number of mislabeled points out of a total 416 points : 193 (54% correct) myWeights1 = [array([[-0.09, 0.03, -0.15, 0.32, -0.37, 0.14, 0.13, -0.31, -0.06, 0.21, -0.26, 0.07, 0.19, 0.36, -0.32, 0.11, 0.09], [ 0.19, 0.11, -0.01, 0.13, -0.3 , -0.19, 0.04, 0.25, -0.27, -0.11, -0.43, 0.33, -0.21, 0.3 , -0.28, -0.23, -0.19], [-0.09, -0.3 , -0.4 , 0.28, -0.29, -0.15, 0.17, -0.01, -0.11, -0.4 , 0.26, -0.13, 0.18, 0.08, -0.28, 0.12, 0.26], [ 0.26, 0.35, -0.27, -0.17, -0.01, -0.35, -0.18, 0.41, -0.07, 0.38, -0.14, 0.31, -0.08, 0.14, 0.09, 0.41, 0.07], [ 0.04, 0.05, -0.42, 0.1 , 0.23, 0.3 , -0.1 , 0.01, -0.26, 0.12, 0.3 , 0.42, -0.27, 0.25, -0.34, -0.31, -0.26], [ 0.4 , -0.11, -0.17, 0.36, 0.3 , -0.16, 0.37, 0.29, 0.28, 0.19, 0.29, -0.21, -0.17, 0.04, 0.1 , -0.43, 0.39], [-0.38, 0.28, -0. , 0.22, 0.2 , 0.3 , 0.18, -0.36, -0.13, -0.34, -0.05, 0.1 , -0.35, -0.12, 0.09, -0.21, 0.2 ], [ 0.19, 0.02, 0.08, -0.11, -0.32, -0.29, 0.12, 0.31, -0.35, -0.13, 0.28, 0.3 , 0.39, -0.39, -0.16, 0.29, 0.12], [ 0.02, -0.07, -0.39, 0.17, 0.39, -0.13, -0.18, 0.2 , 0.4 , -0.42, 0.27, 0.32, 0.18, 0.09, 0.04, -0.42, -0.08], [ 0.13, -0.27, -0.21, 0.4 , 0.14, 0.05, 0.2 , 0.38, 0.09, 0.12, 0.08, 0.37, 0.24, -0.1 , 0.01, -0.4 , 0.22], [ 0.05, 0.41, 0.04, -0.26, -0.26, 0.12, -0.05, 0.38, 0.37, 0.41, 0.11, 0.17, 0.26, -0.05, -0.23, 0.17, 0.36], [-0.34, 0.08, -0.06, -0.27, 0.12, 0.4 , -0.43, 0.03, -0.03, -0.25, -0.2 , -0.41, 0.39, 0.42, -0.35, -0.29, 0.17], [-0.37, -0.24, 0.22, -0.37, -0.1 , 0.06, -0.24, 0.05, -0.37, -0.22, -0.02, 0.39, -0.33, -0.37, 0. , 0.02, -0.3 ], [ 0.27, -0.19, 0.33, 0.38, 0.29, -0.31, 0.14, 0.25, -0.28, -0.23, 0.38, -0.1 , -0.14, -0. , 0.18, 0.21, -0.29], [-0.09, -0.2 , -0.25, -0.13, -0.42, 0.1 , -0.13, -0.3 , -0.19, -0.21, 0.2 , 0.25, -0.13, 0.41, -0.12, 0.29, 0.32], [-0.06, 0. , -0.27, -0.14, -0.42, -0.25, -0.27, -0.07, 0.16, 0.42, -0.33, -0.05, -0.06, 0.29, 0.01, -0.05, -0.28]], dtype=float32), array([ 0., -0., -0., 0., 0., -0., 0., -0., 0., -0., -0., 0., 0., -0., -0., -0., -0.], dtype=float32), array([[-0.2 , -0.15, -0.2 , -0.15], [-0.09, -0.42, 0.3 , 0.41], [-0.04, 0.45, -0.21, 0.36], [-0.04, -0.17, 0.01, -0.27], [-0.33, -0.42, -0.08, -0.12], [ 0.43, -0.02, -0.52, 0.18], [ 0.51, 0.25, -0.29, -0.26], [-0.18, 0.06, 0.46, 0.08], [-0.06, -0.45, -0.42, 0.29], [ 0.48, -0.39, 0.49, 0.44], [-0.05, -0.18, 0.41, 0.43], [-0.17, -0.47, -0.28, -0.41], [ 0.33, 0.23, -0.5 , -0.21], [ 0.16, -0.19, -0.33, 0.35], [-0.2 , -0.06, 0.37, 0.28], [ 0.19, 0.29, -0.02, -0.03], [-0.26, 0.53, 0.09, 0.42]], dtype=float32), array([-0., -0., -0., -0.], dtype=float32)] # My Weights - run two, two layers (same layers), but 2 epochs instead of 1. # Number of mislabeled points out of a total 416 points : 132 (68% correct) myWeights2 = [array([[ 0.31, -0.28, 0.28, -0.38, -0.15, -0.04, -0.25, 0.11, -0.19, -0.11, -0.43, -0.3 , 0.23, 0.07, -0.41, -0.3 , 0. ], [-0.02, 0.06, -0.2 , 0.42, 0.09, -0.12, 0.42, 0.31, -0.01, -0.04, -0.06, 0.41, 0.32, 0.32, -0.33, -0.23, -0.31], [-0.23, 0.15, 0.38, 0.42, -0.36, 0.04, -0.02, -0.27, -0.01, -0.16, -0.08, 0.35, -0.38, -0.13, 0.34, -0.34, 0.23], [-0.37, 0.37, 0.1 , -0.19, -0.37, -0.16, -0.35, -0.04, 0.22, -0.05, 0.11, -0.29, 0.36, -0.17, 0.26, 0.25, 0.16], [ 0.28, 0.07, -0.35, -0.39, -0.03, 0.08, -0.15, -0.02, -0.02, 0.37, 0.05, -0.38, -0.39, -0.1 , 0.14, 0.17, -0.15], [-0.36, -0.28, 0.21, 0.29, 0.36, -0.11, -0.31, 0.41, -0.29, -0.07, 0.15, 0.09, -0.39, -0.34, 0.24, -0.11, 0.41], [ 0.35, -0.31, -0.19, 0.06, 0.11, 0.26, -0.18, -0.1 , -0.29, -0.3 , 0.16, -0.37, -0.17, 0.1 , -0.31, 0.16, 0.26], [ 0.37, 0.34, -0.31, 0.24, 0.07, -0.08, -0.34, 0.37, -0.26, -0.35, 0.09, 0.38, 0.25, -0.37, -0.32, -0.29, -0.11], [-0.39, 0.07, 0.12, -0.32, -0.26, 0.37, 0.08, -0.03, -0.43, -0.13, -0.13, -0.01, 0.04, -0.43, -0.13, -0.12, 0.4 ], [ 0.15, -0.15, 0.19, 0.41, 0.19, -0.08, -0.22, -0.04, -0.38, -0.16, -0.4 , -0. , 0.29, -0.09, -0.24, -0.1 , -0.29], [ 0.12, 0.02, 0.42, 0.06, -0. , 0.33, 0.16, -0.06, -0.1 , -0.42, -0.43, -0.2 , 0.05, 0.15, 0.34, -0.1 , 0.11], [ 0.13, -0.18, 0.01, 0.23, -0.38, -0.16, 0.05, -0.23, 0.29, -0.29, -0.06, -0.39, 0.06, -0.39, -0.07, -0.09, 0. ], [ 0.36, 0.07, 0.37, -0.22, -0.16, -0.04, 0.26, -0.23, -0.16, 0.19, -0.37, 0.19, -0.3 , 0.24, 0.32, 0.39, 0.39], [ 0.04, -0.33, 0.39, 0.18, -0.26, -0.41, -0.06, 0.18, 0.26, -0.06, 0.16, 0.12, 0.15, 0.32, 0.18, -0.02, 0. ], [-0.35, 0.05, 0.13, -0.37, -0.05, -0.23, -0.24, -0.22, 0.27, -0.22, 0.03, -0.06, -0.32, 0.38, -0.19, -0.19, -0.37], [-0.29, 0.36, -0.35, -0.34, 0.2 , 0.17, 0.29, 0.19, -0.3 , 0.33, 0.24, -0.34, 0.11, 0.29, -0.38, -0.19, -0.43]], dtype=float32), array([-0.01, -0. , -0.01, 0.01, 0.01, -0. , -0.01, -0. , -0.01, -0.01, -0.01, -0.01, 0.01, -0.01, -0. , 0.01, -0.01], dtype=float32), array([[ 0.51, -0.41, -0.05, 0.24], [ 0.51, -0.16, -0.43, -0.48], [ 0.15, 0.11, 0.26, -0.17], [-0.19, 0.31, 0.02, -0.41], [ 0.13, -0.01, -0.1 , -0.48], [ 0.31, -0.2 , -0.34, -0.13], [ 0.42, -0.47, -0.02, 0.3 ], [ 0.24, -0.38, 0.18, -0.25], [ 0.44, 0.01, -0.44, -0.12], [ 0.42, 0.07, -0.03, 0.29], [ 0.25, 0.35, 0.12, 0.15], [ 0.26, -0.07, -0.09, 0.3 ], [-0.44, -0.18, -0.41, -0.01], [ 0.51, 0.28, 0.24, -0.28], [ 0.48, -0.26, -0.52, -0.26], [-0.23, 0.28, 0.14, -0.2 ], [ 0.36, -0.18, -0.19, 0. ]], dtype=float32), array([-0.01, -0.01, -0.01, -0.01], dtype=float32)] # My Weights - run three, three layers, 1 epoch # # Number of mislabeled points out of a total 416 points : 104 (75% correct) myWeights3 = [array([[-0.23, 0.03, -0.33, -0.01, 0.3 , 0.28, 0.17, 0.4 , 0.18, 0.08, 0.15, 0.21, 0.15, -0.27, 0.23, -0.36, -0.21], [-0.37, 0.04, -0.1 , -0.21, -0.34, 0.41, -0.1 , 0.16, -0.4 , 0.15, 0.36, -0.34, -0.28, 0.12, -0.29, -0.36, 0.16], [-0.34, -0.26, 0.21, -0.03, 0.38, -0. , -0.3 , 0.02, 0.26, -0.11, 0.24, 0.1 , -0.19, 0.2 , -0.22, -0.23, 0.09], [ 0.4 , 0.41, -0.28, -0.1 , 0.25, 0.09, -0.39, -0.22, -0.07, 0.31, -0.15, -0.3 , 0.15, 0.12, 0.15, -0.19, 0.24], [-0.13, 0.22, -0.42, 0.01, 0.22, -0.17, 0.25, 0.01, 0.41, 0.36, 0.11, 0.07, -0.01, 0.2 , -0.18, 0.05, 0.13], [-0.02, 0.29, -0.41, -0.42, 0.28, 0.18, 0.3 , -0.29, -0.08, 0.27, 0.39, -0.16, 0.16, -0.13, 0.01, -0.13, 0.24], [ 0.14, 0.28, -0.13, 0.1 , 0.21, -0.02, -0.21, -0.38, 0.19, 0.37, -0.39, -0.01, -0.21, 0.04, 0.05, 0.1 , -0.08], [ 0.08, -0.26, -0.22, -0.06, 0.14, 0.25, -0.14, -0.2 , 0.22, 0.04, -0.03, -0.05, -0.07, -0.26, -0.09, 0.21, 0.22], [-0.29, -0.09, -0.18, 0.34, -0.06, -0.2 , 0.2 , -0.05, 0.36, -0.3 , 0. , -0.03, 0.21, 0.19, -0.3 , 0.4 , -0.41], [-0.12, -0.04, 0.42, 0.32, 0.08, -0.22, 0.25, -0.39, -0.16, 0.2 , -0.33, -0.01, -0.08, 0.32, -0.16, -0.41, 0.2 ], [ 0.2 , -0.02, 0.28, -0.21, -0.34, 0. , -0.13, -0.13, -0.34, 0.34, -0.18, 0.09, 0.25, 0.2 , -0.24, 0.35, 0.24], [ 0.2 , -0.27, -0.13, -0.31, 0.38, 0.23, -0.37, 0.37, -0.16, 0.14, 0.42, -0.17, -0.04, 0.4 , -0.06, -0.03, -0.1 ], [-0.39, -0.22, -0.22, 0.34, -0.09, 0.3 , 0.17, -0.02, -0.25, -0.05, -0.11, -0.11, 0.23, -0.37, -0.15, 0.25, 0.2 ], [ 0.09, 0.27, 0.12, 0.29, -0.2 , 0.3 , 0.37, 0.39, 0.14, -0.39, -0.38, 0.28, 0.02, -0.21, 0.18, -0.37, -0.12], [ 0.24, -0.38, -0.33, 0.22, -0.36, -0.23, 0.4 , -0.37, 0.24, -0.08, -0.07, -0.29, -0.06, 0.22, 0.18, -0.32, 0.13], [ 0.19, -0.36, -0.03, 0.04, 0.01, -0.01, -0.21, 0.2 , 0.05, 0.25, -0.19, -0.41, 0.29, -0.29, -0.19, -0.27, -0.2 ]], dtype=float32), array([ 0., -0., -0., 0., 0., -0., 0., 0., -0., 0., 0., -0., -0., -0., 0., 0., 0.], dtype=float32), array([[ 0.04, 0.02, -0.33, 0.23, -0.03, 0.24, 0.18, 0.05, 0.39, -0.22, -0.14, 0.28, 0.29, -0.29, -0.13, -0.23, -0.31], [-0.14, -0.08, 0.21, 0.19, 0.17, 0.01, -0.32, 0.26, -0.08, 0.26, 0.02, -0.19, 0.39, 0.12, -0.4 , -0.09, -0.15], [ 0.36, -0.16, -0.03, -0.24, -0.01, 0.24, 0.12, 0.09, -0.41, 0.16, 0.02, -0.21, -0.27, -0.21, 0.18, -0.24, -0.25], [ 0.04, 0.29, 0.01, 0.21, 0.29, 0.36, -0.41, -0.26, -0.02, 0.29, -0.24, 0.35, 0.2 , -0.39, 0.41, -0.14, 0.14], [-0.41, -0.05, -0.02, 0.3 , -0.33, -0.35, 0. , -0.03, -0.3 , 0.35, -0.01, 0.24, -0.1 , 0.13, 0.1 , -0.24, 0.09], [ 0.01, 0.21, 0.4 , -0.15, -0.25, 0.07, 0.14, 0.22, 0.08, -0.15, -0.16, 0.23, -0.41, 0.06, -0.03, 0.12, -0.21], [ 0.22, 0.06, -0.08, 0.27, -0.21, -0.36, 0.28, 0.11, -0.39, 0.24, 0.36, 0.22, -0.23, 0.1 , 0.07, -0.18, 0.16], [ 0.27, 0.06, -0.28, 0.21, 0.18, 0.12, 0.12, -0.33, 0.09, -0.12, -0.29, 0.09, -0.28, -0.29, 0.04, -0.23, 0.18], [ 0.34, 0.1 , -0.18, 0.17, 0.08, 0.15, 0.39, 0.31, -0.19, 0.2 , -0.15, -0.15, 0.41, 0.35, -0.17, 0.28, 0.13], [-0.29, 0.36, 0.11, -0.21, 0.3 , 0.27, -0.31, -0.22, 0.15, 0.03, 0.32, -0.1 , -0.37, 0.09, 0.2 , -0.17, 0.19], [ 0.08, 0.29, 0.16, -0.13, -0.24, 0.4 , 0.09, 0.32, -0.07, 0.12, 0.41, 0. , 0.18, -0.02, 0.4 , -0.42, -0.04], [-0.29, -0.09, -0.15, -0.07, 0.06, 0.4 , -0.17, -0.25, 0.01, 0.2 , -0.17, -0.14, -0.24, 0.3 , 0.01, -0.29, -0.22], [-0.37, -0.38, -0.24, 0.25, -0.4 , 0.23, -0.23, 0.09, -0.27, 0.28, 0.18, 0.06, -0.41, 0.31, -0.38, 0.03, -0.07], [-0.12, 0.11, -0.12, 0.38, -0.24, -0.37, -0.27, 0.25, 0.02, 0.39, -0.23, -0.39, 0.18, 0.32, -0.38, 0.02, 0.32], [ 0.29, 0.34, -0.04, -0.34, 0.3 , 0.28, 0.2 , -0.26, 0.36, 0.2 , 0.17, 0.02, -0.3 , -0.38, 0.29, -0.36, 0.32], [ 0.1 , 0.12, -0.14, -0.21, 0.39, 0.12, -0.15, -0.37, -0.17, -0.36, 0.11, 0.33, -0.11, 0.07, -0.24, -0.37, 0.19], [-0.08, 0.06, 0.12, 0.1 , -0.26, 0.13, -0.15, 0.31, -0.25, -0.21, 0.11, 0.03, -0.15, 0.36, -0.22, 0.31, 0.4 ]], dtype=float32), array([ 0., 0., 0., 0., -0., 0., 0., -0., -0., -0., 0., 0., -0., 0., 0., -0., 0.], dtype=float32), array([[ 0.01, -0.44, -0.23, 0.17], [-0.1 , 0.38, -0.32, -0.04], [-0.24, 0.47, -0.16, -0.38], [-0.46, -0.5 , 0.15, -0.3 ], [-0.04, 0.29, -0.18, 0.11], [ 0.26, -0.34, -0.33, 0.41], [-0.36, 0.06, -0.26, -0.33], [-0.3 , 0.2 , -0.29, 0.48], [-0.31, -0.53, 0.48, -0.06], [ 0.16, 0.3 , 0.31, 0.31], [ 0.5 , -0.31, 0. , -0.09], [-0.37, -0.44, -0.09, 0.02], [-0.27, 0.35, 0.4 , -0.44], [-0.53, -0.15, 0.33, -0.51], [-0.49, -0.35, -0.27, 0.09], [ 0.31, 0.48, 0.49, 0.4 ], [ 0.52, -0.02, -0.12, -0.32]], dtype=float32), array([ 0., -0., -0., -0.], dtype=float32)] # My Weights - run four, four layers, 100 epochs # Number of mislabeled points out of a total 416 points : 75 (82% correct) myWeights4 = [array([[ 0.06, 0.32, 0.17, 0.56, 0.49, 0.16, -0.14, -0.44, -0.07, 0.28, 0.57, -0.49, -0.09, -0.08, -0.17, 0.08, -0.58], [-0.52, 0.08, 0.08, 0.47, 0.07, 0.18, -0.31, -0.38, -0.4 , 0.51, -0.04, -0.15, 0.25, -0.48, -0.63, 0.35, -0.09], [ 0.04, 0.53, -0.52, 0.46, 0.48, 0.68, -0.26, -0.51, -0.2 , 0.45, 0.5 , 0.02, 0.36, -0.1 , -0.47, 0.45, -0.01], [-0.1 , 0.12, -0.49, -0.07, 0.11, 0.04, 0.11, 0.04, -0.59, 0.66, -0.05, -0.25, 0.5 , -0.47, -0.77, 0.69, -0.03], [-0.41, 0.36, -0.01, 0.04, -0.15, 0.07, 0.05, 0.05, -0.54, -0.01, -0.07, -0.46, 0.33, -0.04, -0.23, 0.56, 0.09], [-0.4 , -0.16, -0.54, 0.54, -0.09, -0.1 , -0.36, -0.05, -0. , 0.21, 0.5 , -0.42, 0.54, -0.49, -0.22, 0.27, -0.23], [-0.06, 0.31, -0.09, 0.25, 0.21, -0.12, 0.26, -0.62, 0.01, 0.1 , -0.08, -0.4 , 0.51, -0.39, -0.07, 0.06, -0.02], [-0.67, 0.08, -0.68, 0.28, 0.61, 0.41, -0.54, -0.21, -0.5 , 0.05, 0.62, -0.41, 0. , -0.19, -0.01, 0.47, -0.17], [-0.6 , 0.71, -0.69, 0.16, 0.36, 0.29, -0.24, -0.22, -0.2 , 0.51, 0.68, -0.06, 0.11, -0.72, -0.51, 0.1 , -0.76], [-0.07, 0.46, 0.01, -0.04, 0.57, 0.36, 0.07, -0.45, -0.03, 0.08, 0.21, -0.44, 0.64, -0.16, -0.8 , 0.64, -0.17], [-0.05, 0.32, -0.46, 0.07, -0.09, 0.71, -0.34, -0.59, -0.07, 0.37, -0.01, -0.15, 0.45, -0.31, -0.07, 0.1 , -0.59], [-0.3 , 0.33, -0.33, -0.1 , 0.48, 0.06, -0.49, -0.38, -0.2 , 0.17, 0.63, -0.03, 0.2 , -0.25, -0.09, -0.02, -0.63], [-0.15, 0.08, -0.51, 0.33, 0.48, 0.14, -0.56, -0.45, -0.75, 0.59, 0.62, -0.03, 0.06, -0.19, 0.02, 0.5 , -0.39], [-0.05, -0.01, -0.28, 0.43, 0.31, 0.13, -0.47, -0.33, -0.52, -0.06, -0.06, -0.39, 0.44, -0.16, -0.25, 0.13, 0.01], [-0.17, 0.37, -0.1 , -0.05, 0.23, 0.41, 0.1 , 0.2 , -0.07, 0.34, 0.33, -0.11, 0.39, 0.09, -0.34, -0.07, -0.34], [-0.2 , 0.25, 0.24, 0.02, 0.12, 0.37, -0.56, -0.17, -0.46, 0.46, 0.1 , -0.4 , 0.52, -0.47, 0.06, 0.24, -0.39]], dtype=float32), array([ 0.24, -0.21, 0.39, -0.23, -0.39, -0.34, 0.17, 0.33, 0.4 , -0.35, -0.36, 0.32, -0.3 , 0.32, 0.4 , -0.3 , 0.28], dtype=float32), array([[ 0.32, 0.35, -0.27, -0.4 , 0.04, 0.29, 0.37, -0.06, -0.43, 0.35, 0.22, 0.14, -0.44, 0.14, 0.34, -0.09, 0.19], [-0.41, -0.32, 0.18, -0.03, -0.47, 0.31, -0.39, -0.42, 0.12, 0.3 , 0.09, -0.05, 0.46, 0.36, -0.42, 0.12, 0.13], [ 0.62, 0.07, -0.29, -0.37, 0.38, 0.14, 0.12, 0.25, -0.2 , 0.71, -0.27, 0.46, -0.17, 0.03, 0.19, 0.01, 0. ], [-0.4 , -0.23, 0.11, -0.08, 0.11, 0.28, -0.25, -0.3 , 0.41, -0.32, -0.41, -0.37, 0.07, 0.08, -0.3 , 0.26, -0.12], [-0.38, -0.23, 0.48, 0.43, -0.34, 0.51, -0.1 , -0.33, 0.36, -0.42, 0.15, -0.34, -0.09, 0.36, 0.1 , -0. , 0.05], [-0.35, -0.42, 0.22, 0.33, -0.47, 0.49, 0.18, 0.15, 0.36, -0.41, -0.29, -0.21, 0.44, 0.04, -0.44, -0.49, 0.14], [ 0.15, 0.03, -0.14, -0.62, 0.09, 0.05, 0.04, -0.07, -0.21, 0.04, 0.12, 0.56, -0.36, -0.53, 0.32, 0.16, -0.05], [-0.07, 0.19, -0.43, -0.23, 0.51, -0.28, 0.65, 0.03, -0.34, 0.18, -0.08, 0.09, -0.31, -0.2 , 0.08, 0.29, 0.37], [ 0.14, -0.08, -0.21, -0.47, 0.43, -0.4 , 0.51, 0.27, -0.37, 0.22, -0.06, 0.37, -0.47, -0.52, 0.08, 0.41, 0.22], [-0.06, -0.02, 0.08, -0.12, -0.15, -0.19, -0.28, -0.06, 0.5 , -0.24, 0.17, -0.17, 0.18, -0.17, -0.41, -0.3 , -0.1 ], [-0.13, -0.25, 0.48, -0.09, -0.07, 0.44, -0.35, -0.39, 0.32, -0.18, 0.06, -0.21, 0.32, 0.26, -0.28, -0.05, -0.23], [ 0.14, 0.05, -0.12, -0.42, 0.1 , 0.22, 0.45, 0.44, -0.33, 0.33, -0.32, 0.15, -0.48, -0.36, 0.31, 0.07, 0.05], [-0.44, -0.42, 0.43, 0.23, -0.41, -0.17, -0.46, -0.3 , -0.28, -0.45, -0.47, -0.06, 0.01, 0.37, -0.26, -0.21, -0.2 ], [ 0.13, -0.02, -0.26, -0.61, 0.69, -0.12, 0.73, 0.21, 0.07, 0.68, -0.17, 0.2 , -0.36, 0.1 , 0.54, 0.45, 0.37], [ 0.07, -0.19, -0.55, -0.49, -0. , 0.05, 0.03, 0.13, -0.54, 0.48, -0.42, 0.34, -0.37, -0.49, 0.71, 0.37, 0.12], [ 0.13, -0.09, 0.18, 0.29, -0.22, -0.03, -0.27, -0.21, 0.17, -0.39, -0.53, -0.02, 0.29, 0.45, -0.2 , -0.09, 0.38], [ 0.56, -0.06, -0.17, -0.49, 0.66, 0.03, -0.08, 0.04, -0.33, 0.22, 0.38, 0.66, 0.13, 0.03, 0.28, -0.15, 0.21]], dtype=float32), array([ 0.1 , -0.08, -0.09, 0.05, 0.11, 0.04, 0.14, -0.01, -0.12, 0.14, -0.07, 0.07, -0.05, -0.04, 0.19, 0.07, 0.06], dtype=float32), array([[ 0.06, 0.55, -0.12, 0.02, -0.36, -0.12, -0.09, 0.7 , -0.24, -0.27, 0.15, -0.02, -0.04, 0.17, -0.1 , -0.06, 0.22], [-0.22, -0.03, 0.21, -0.32, -0.02, 0.34, -0.45, 0.45, -0.24, -0.11, -0.13, 0.05, 0.05, -0.12, -0.13, -0.13, -0.2 ], [-0.15, -0.03, -0.4 , 0.21, -0.1 , 0.24, 0.35, -0.36, 0.37, 0.36, 0.08, -0.26, -0.01, -0.47, -0.11, 0.35, -0.21], [-0.38, -0.1 , -0.04, -0.15, 0.23, -0.1 , -0.07, -0.11, 0.38, 0.32, -0.25, 0.22, -0.53, -0.37, 0.5 , 0.2 , 0.31], [ 0.58, -0.22, 0.01, -0.01, -0.25, 0.02, -0.47, -0.12, -0.34, 0.23, -0.16, -0.52, 0.31, 0.45, -0.15, -0.57, 0.31], [-0.17, 0.35, -0.15, 0.39, -0.02, 0.5 , 0.11, -0.17, 0.15, 0.46, -0.35, 0.32, 0.1 , 0.01, 0.21, -0.13, -0.23], [ 0.23, -0.27, -0.17, 0.01, -0.53, 0.21, -0.29, 0.57, 0.21, 0.12, -0.08, 0.06, 0.13, 0.65, 0.07, -0.19, 0.1 ], [ 0.1 , 0.18, -0.24, 0.21, -0.32, -0.18, -0.08, -0.01, 0.14, 0.03, -0.19, 0.18, -0.01, 0.2 , -0.12, 0.06, 0.45], [-0.34, -0.27, -0.39, -0.04, 0.49, 0.2 , -0.06, -0.2 , -0.2 , 0.19, 0.07, 0.01, -0.33, -0.47, 0.29, -0.36, -0.45], [ 0.33, 0.37, 0.12, -0.02, -0.33, 0.32, -0.38, -0.2 , -0.34, 0.2 , 0.15, -0.61, -0.12, 0.66, -0.25, 0.05, 0.23], [ 0.11, -0.13, 0.02, -0.27, 0.01, -0.27, -0.43, -0.18, -0.2 , 0.03, 0.25, 0.16, 0.17, 0.2 , -0.27, 0.12, -0.25], [ 0.47, 0.21, -0.32, 0.31, -0.45, 0.07, 0.17, 0.57, 0.16, 0.12, -0.14, -0.46, 0.22, 0.04, 0.29, 0.13, -0.16], [-0.41, 0.08, -0.04, 0.08, 0.15, -0.04, 0.12, 0.25, 0.09, -0.1 , 0.44, 0.44, -0.33, -0.5 , 0.25, -0.34, 0.16], [ 0.33, -0.3 , 0.03, 0.36, 0.19, -0.16, 0.08, -0.05, -0.28, 0.26, 0.35, 0.32, -0.14, -0.37, -0.21, -0.35, 0.18], [-0.12, 0.35, -0.31, 0.44, -0.42, -0.06, -0.01, 0.47, -0.22, 0.3 , 0.17, -0.48, 0.47, 0.42, -0.39, -0.15, 0.53], [ 0.52, 0.24, 0.14, 0.49, -0.36, 0.37, -0.43, 0.25, 0.35, -0.29, -0.32, -0.06, 0.28, -0.03, -0.38, 0.28, -0.2 ], [ 0.22, -0.27, -0.4 , -0.07, -0.25, 0.42, 0.18, -0.37, 0.03, 0.25, -0.37, -0.44, -0.18, 0.44, 0.11, 0.15, 0.11]], dtype=float32), array([ 0.07, -0. , -0.08, 0.09, 0.04, 0.1 , -0.07, 0.02, 0.09, 0.09, 0.05, -0.04, -0.07, 0.06, 0.05, -0.04, 0. ], dtype=float32), array([[ 0.07, -0.04, -0.39, -0.6 ], [ 0.42, 0.22, -0.5 , 0.33], [-0.18, 0.24, 0.22, -0.32], [-0.26, -0.62, -0.45, -0.2 ], [-0.31, -0.01, 0.07, 0.05], [-0.3 , -0.34, -0.42, -0.05], [-0.48, 0.43, 0.28, -0.33], [ 0.29, 0.25, -0.1 , -0.43], [-0.44, -0.02, -0.44, -0.3 ], [-0.08, -0.55, -0.22, 0.07], [-0.43, 0.43, -0.38, -0.56], [-0.51, -0.47, 0.47, 0.31], [ 0.63, 0.13, 0.36, 0.03], [ 0.53, 0.06, -0.01, -0.59], [-0.12, -0.05, -0.27, 0.15], [-0.37, 0.02, 0.05, -0.31], [ 0.42, -0.52, 0.2 , 0.16]], dtype=float32), array([ 0.05, -0.09, -0.09, -0.09], dtype=float32)] # for the second sample set of data. myWeights5 = [array([[-0.13, -0.12, -0.14, 0.13, -0.08, 0.07, 0.06, -0.05, 0.12, 0.01, 0.12, 0.04, -0.15, -0.03, -0.14, 0.03, 0.12, -0.04, -0.24, 0.02, -0.11, -0.06, 0.1 , -0.12, 0.04, -0.15, 0.09, 0.04, 0.13, -0.16, 0.06, -0.06, 0.05, -0.12, 0.11, -0.02, 0.16, -0.16, -0.1 , -0.18, 0.21, 0.08, 0.13, -0.01, -0.17, 0.03, 0. , 0.14, -0.18, 0.13, -0.07, 0.05, 0.2 , -0.03, 0.11, -0.19, -0.19, 0.24, 0.08, -0.21, -0.23, 0.02, -0.11, 0.09, 0.1 ], [-0.1 , 0.03, 0.13, -0.08, 0. , -0.07, 0.15, 0.23, -0.23, -0.16, 0.11, -0.21, 0.17, -0.04, -0.07, 0.06, 0.14, 0.1 , -0.09, 0.17, -0.17, -0.04, 0.07, -0. , 0.01, 0.2 , 0.06, -0.02, -0.06, -0.08, -0.04, -0.11, 0.02, 0.21, 0.13, 0.22, -0.16, 0.11, -0.12, -0.21, 0.14, -0.01, 0.04, 0.22, -0.17, 0.22, -0.08, 0.05, 0.12, -0.08, -0.03, 0.18, -0.11, 0.17, -0.12, -0.2 , -0.02, -0.13, 0. , 0.05, -0.09, -0.13, -0.19, -0.04, -0.05], [-0.21, -0.07, -0.15, -0.09, 0.14, -0.18, -0.18, 0.08, -0.2 , -0.21, 0.23, 0.16, -0.09, 0.13, -0.12, -0.15, -0.15, 0.06, -0.19, -0.02, 0.16, 0.13, -0.07, -0.03, 0.06, 0.07, -0.12, 0.22, 0.01, -0.09, 0.2 , -0.11, 0.18, -0.2 , 0.15, 0.15, 0.05, 0.01, 0.05, 0.02, 0.06, -0.06, -0.1 , -0.16, 0.09, 0.07, -0.01, 0.13, 0.1 , 0.05, -0.19, 0.09, 0.09, 0.14, -0.06, 0.06, 0.13, 0.19, 0.05, -0.06, 0.18, 0.14, -0. , 0.01, -0.1 ], [ 0.13, 0.22, 0.19, 0.16, -0.08, -0.12, 0.09, 0.15, -0.03, -0.08, 0.11, 0.02, 0.08, 0.15, 0.01, 0.22, -0.14, -0.2 , 0.02, -0.09, 0.2 , -0.19, -0.15, 0.17, 0.08, 0.18, -0.13, -0.12, -0.08, -0.13, -0.17, -0.16, 0.1 , -0. , 0.15, 0.07, -0.2 , 0.11, 0.23, 0.02, 0.14, -0.01, 0.08, 0.18, -0.04, -0.07, -0.03, 0.18, 0.11, 0.08, 0.09, -0.17, 0.14, -0.18, 0.12, 0.16, 0.1 , 0.12, -0.09, -0.02, 0. , -0.03, 0.17, 0.12, 0.13], [ 0.08, 0.11, -0.12, -0.05, 0.08, 0.19, 0.01, 0.02, -0.07, -0.2 , -0.04, -0.16, -0.12, 0.04, -0.17, 0.16, -0.02, -0.04, -0.03, -0.15, -0.04, -0.22, 0.08, 0.03, -0.09, 0.03, 0.18, 0.18, 0.11, -0.12, -0.18, 0.15, 0.14, 0.2 , 0.06, -0.12, 0.09, 0.09, 0.11, -0.19, 0.22, 0.13, 0.1 , -0.15, 0.06, -0.17, 0.17, -0.17, -0.2 , -0.17, -0.02, 0.01, -0.11, 0.1 , 0.1 , 0.06, -0.17, 0.04, -0.1 , 0.17, 0.02, 0.15, 0.24, -0.13, -0.14], [-0.15, 0.04, -0.09, -0. , -0.13, 0.13, -0.15, 0.15, -0.08, -0.19, 0.12, -0.12, -0.06, 0.21, -0.14, 0.22, -0.1 , 0.22, -0.07, 0.02, 0.13, -0.09, -0.21, -0.12, 0.01, -0.15, -0.03, 0.22, -0.22, -0.12, 0.05, -0.21, 0.1 , -0.01, -0.07, -0.16, -0.16, -0.2 , -0.18, 0.05, 0.04, -0.01, 0.16, -0.04, -0.03, 0.2 , 0.19, 0.04, 0.16, -0.01, -0.24, 0.09, 0.07, 0.05, -0.07, 0.19, -0.19, 0.18, 0.1 , -0.01, -0.17, -0.1 , 0.16, 0.14, 0.18], [ 0.17, 0.16, 0.08, -0.15, 0.05, 0.16, -0.09, 0.1 , 0.11, -0.2 , 0.08, 0.04, 0.19, 0.14, 0.11, -0.13, 0.01, -0.15, 0.06, -0.11, 0.1 , -0.2 , -0.04, 0.06, -0.14, 0.06, -0.22, 0.15, -0.1 , -0.22, 0.17, 0.17, -0.1 , 0.08, 0.14, -0.16, 0.07, -0.03, -0.13, 0.09, 0.08, 0.19, 0.04, 0.07, -0.08, 0.15, 0. , 0.15, -0.12, 0.18, -0.19, 0.05, -0.22, -0.13, 0.11, 0.2 , -0.2 , -0.14, 0.18, 0.09, 0.14, -0.02, -0.01, -0.01, 0.06], [-0.08, -0.03, -0.11, 0.1 , 0.01, -0.12, 0.06, 0.11, -0.12, 0.14, 0.19, 0.19, 0.09, -0.2 , -0.08, -0.01, -0.18, -0.02, -0.19, 0.19, 0.02, 0.03, 0.06, 0.09, -0.2 , -0.12, 0.11, 0.22, 0.13, 0.16, 0.19, -0.2 , -0.11, -0.11, -0.1 , 0.05, 0.05, -0.1 , -0.19, 0.12, 0.14, -0.07, -0.21, 0.18, -0.24, -0.01, -0.06, 0.2 , -0.14, 0.17, 0.09, 0.09, -0.22, 0.2 , 0.02, -0.04, 0.04, 0.19, 0.02, 0.09, 0.09, 0.16, 0.04, -0.2 , -0.2 ], [-0.1 , -0.01, 0.09, 0.08, 0.05, 0.18, 0.08, 0.02, 0.12, -0.15, -0.01, -0.05, -0.1 , 0.05, 0.17, 0.16, 0.05, 0.18, 0.18, -0.18, 0.14, 0.12, 0.04, -0.18, 0.11, -0.08, -0.18, 0.07, -0.17, -0.07, -0.05, -0.08, 0.18, 0.11, 0.01, 0.14, 0.15, -0.09, -0.05, -0.21, -0.19, 0.1 , 0.04, -0.16, 0.09, 0.15, 0.12, -0.14, -0. , 0.15, 0.11, -0.03, -0.17, 0.1 , -0.19, -0.12, 0. , 0.15, 0.22, 0.11, -0.02, 0.18, -0.11, -0.19, -0.14], [-0.14, -0.17, 0.14, 0.11, 0.18, -0.07, 0.07, 0.15, -0.11, 0.05, 0.08, 0.15, 0.04, -0.03, 0.19, 0.03, -0.06, 0.13, 0.17, -0.11, 0.21, -0.09, -0.13, -0.02, -0.21, 0.23, 0.13, 0.09, -0.09, -0.01, 0.17, -0.02, 0.02, 0.22, 0.1 , -0.13, -0.06, 0.12, -0.13, 0.15, -0.11, -0.13, -0.21, 0.09, 0.11, 0.17, 0.07, 0.14, 0.06, -0.18, 0.03, -0.1 , -0.19, 0.03, -0.11, 0.16, 0.13, 0.02, -0.08, -0.13, 0.13, 0.09, 0.18, 0.19, 0.09], [-0.01, -0.05, 0.07, -0.01, 0.14, -0.08, 0.15, 0.1 , 0.17, 0.11, 0.18, 0.05, 0.05, -0.06, -0.01, -0.01, 0.07, 0.09, -0.07, 0.23, 0.04, -0.01, 0.01, -0.07, -0.01, 0.05, -0.01, 0.12, -0.07, -0.19, 0.23, -0.03, -0.13, 0.01, -0.03, -0.12, 0.11, -0.14, -0.04, 0.04, 0.18, -0.06, -0.1 , 0.24, -0.18, 0.09, -0.19, 0.09, 0. , -0.2 , -0.18, 0.18, -0.2 , 0.19, -0.03, -0.07, -0.2 , -0.17, 0.06, 0.01, -0.13, -0.14, 0.16, 0.11, -0.23], [ 0.06, 0.1 , -0.12, -0.1 , 0.04, 0.04, 0.12, 0.15, 0.05, -0.05, 0.11, -0.13, 0.21, 0.14, -0.18, 0.02, -0.11, -0.06, -0.2 , -0.13, -0.02, -0.22, 0.06, -0.14, 0.17, 0.24, -0.16, 0.17, 0.01, -0.04, 0.2 , -0.17, -0.23, -0.09, -0.14, 0.09, 0.09, -0.01, -0.08, -0.13, -0.01, -0.07, -0.03, -0.08, -0.13, 0.16, -0.17, 0.01, -0.18, -0.03, 0.01, 0.12, 0.18, -0.1 , 0.11, 0.13, 0.17, 0.02, 0.03, 0.05, -0.17, -0.04, 0.18, -0.13, 0.18], [-0.05, -0.01, 0.02, 0.1 , -0.18, -0.19, 0.22, 0.21, -0.07, 0.01, 0.02, -0.16, -0.1 , -0.14, 0.1 , 0.23, -0.11, 0.22, 0.02, 0.24, 0.22, -0.19, 0.12, -0.16, -0.18, -0.15, -0.09, 0.07, -0.16, -0.16, 0.19, 0.05, -0.24, 0.08, 0.04, -0.08, 0.03, -0.23, -0.14, 0.03, -0.04, 0.01, 0. , -0.19, -0.12, -0.05, -0.16, -0.06, 0.14, -0.05, 0.11, 0.17, -0.03, -0.01, -0.14, 0.1 , -0. , -0.11, -0.04, 0.04, -0.13, 0.04, -0. , 0.17, 0.04], [ 0.11, 0.07, 0.05, 0.12, -0.16, 0.04, -0.16, -0.09, -0.24, -0.08, -0.18, -0.13, -0.06, 0.05, -0.09, 0.07, 0.17, -0.05, -0.04, 0.02, -0.04, -0.05, 0.17, 0.14, -0.16, -0.18, -0. , 0.1 , -0.02, 0.14, 0.24, 0.17, 0.06, 0.2 , -0.17, -0.17, 0.04, 0.02, 0.04, 0.09, 0.1 , -0.01, -0.21, 0.03, -0.1 , -0.04, 0.21, 0.08, 0.05, 0.06, -0.2 , -0.03, 0.15, -0.15, 0.17, 0.1 , -0.1 , -0.16, 0.21, 0.07, -0.1 , 0.1 , -0.08, 0.07, -0.11], [ 0.17, 0.18, 0.11, -0.11, -0.17, -0.11, 0.14, -0.07, -0.21, -0.12, 0.05, -0.05, -0.04, 0.15, 0.13, -0.05, -0.16, 0.21, 0.08, 0.07, -0.12, 0.13, -0.04, -0.09, 0.1 , 0.09, 0.02, 0.13, -0.07, -0.14, 0.16, 0.11, 0.02, 0.07, 0.06, -0.13, -0.07, -0.17, 0.1 , 0.08, -0.12, 0.02, 0.1 , 0.14, -0.17, -0.01, -0.09, -0.14, 0.03, 0.13, -0.15, 0.13, -0.1 , 0.18, -0.21, -0.09, -0.08, 0.05, 0. , 0.17, -0.17, -0.15, -0.14, -0.13, -0.19], [ 0.13, 0.02, 0.01, -0.17, 0.13, 0.19, 0.23, 0.2 , -0.17, -0.01, 0.21, -0.15, 0.23, -0.05, -0.23, 0.16, -0.17, 0.18, -0.22, 0.06, 0.05, 0.13, 0.07, -0.23, 0.08, -0.01, 0.09, 0.09, 0.05, 0.06, 0.12, -0.17, 0.11, 0.02, 0.1 , 0.11, -0.06, 0.05, 0.06, 0.05, 0.07, 0.21, -0.08, 0.23, 0.03, -0.02, 0.13, 0.19, -0.1 , -0.05, 0.09, 0.03, -0.14, 0.05, 0.11, -0.19, -0.05, -0.11, 0.1 , 0.18, -0.04, 0.14, -0.03, 0.18, -0.07], [ 0.16, 0.24, -0.16, 0.06, 0.14, -0.17, 0.18, 0.14, 0.09, 0.06, -0.13, 0.07, -0.11, 0.07, -0.17, -0.08, -0.24, 0.15, 0.09, -0.15, -0.13, -0.11, 0.01, -0.06, -0.13, -0.19, -0.08, -0.06, -0.04, 0.18, -0.18, -0.16, 0.15, -0.16, 0.11, 0.07, -0.16, 0.09, -0.09, -0.12, 0.17, 0.2 , 0.07, 0.07, 0.03, 0.16, -0.18, 0.11, -0.03, 0.24, 0.11, -0.06, 0.05, -0.08, -0.07, -0.11, -0.18, -0.01, -0.09, 0.18, 0.13, -0.1 , 0.18, 0.07, -0.21], [ 0.19, 0.16, 0.09, -0.11, 0.18, 0.01, 0.12, 0.08, -0.19, 0.07, -0.02, -0.06, 0.06, -0.01, -0.04, -0.06, -0.15, 0.03, -0.15, -0.19, 0.21, -0.11, 0.2 , -0.1 , -0.04, -0.16, 0.01, -0.14, 0.05, -0.02, 0.1 , -0.21, 0.04, -0.17, 0.16, -0.1 , 0.04, -0.23, 0.2 , -0.18, -0.2 , 0.02, -0.21, -0.03, -0.1 , 0.15, 0.17, -0.14, -0.14, -0.17, 0.1 , 0.05, -0.17, -0. , -0.01, 0.08, 0.14, 0.13, 0. , 0.05, 0.03, 0.13, -0.09, 0.04, -0.17], [ 0.17, 0.18, 0. , 0.12, 0.16, 0.07, 0.01, -0.1 , -0.07, -0.14, 0.04, 0.12, 0.08, 0. , 0.19, 0.18, 0.04, -0.02, -0.02, -0.04, -0.13, -0.23, 0.05, -0.22, 0.2 , -0.13, 0.05, -0.03, -0.2 , -0.02, -0.14, 0.15, -0.2 , 0.06, -0.07, 0.08, -0.19, 0.01, -0.06, 0.03, 0.06, -0.14, -0.13, 0.13, -0.23, -0.12, -0.09, 0.18, -0.02, 0. , 0.1 , 0.01, -0.08, 0.14, 0.18, -0.14, -0.06, -0.03, 0.11, 0.23, -0.03, -0.02, -0.18, -0.07, -0.14], [-0.15, 0.14, -0.05, 0.19, -0.04, 0.19, 0.03, -0.15, 0.12, 0.06, -0.09, 0.03, 0.12, -0.2 , 0.12, -0.13, -0.23, -0.17, -0.01, 0.22, -0.12, -0.24, 0.13, 0.16, 0.21, -0.15, -0.17, 0.12, -0.2 , -0.19, -0.16, -0.14, 0.15, 0.18, 0.19, 0.14, -0.07, -0. , 0.04, -0.11, 0.03, -0.08, 0.11, 0.12, 0.03, -0.08, -0.15, 0.14, -0.1 , -0.17, -0.07, 0. , -0.12, 0.01, -0.09, 0.11, -0.21, -0.18, -0.17, -0. , 0.22, 0.06, 0.17, 0.07, 0.17], [-0.05, -0.13, 0.24, -0.1 , -0.18, 0.02, -0.08, 0.12, -0.06, -0.12, 0.02, 0.07, 0.11, 0.14, -0.01, 0.15, -0.01, 0.07, -0.15, 0.24, 0.19, -0.22, -0.22, -0.15, 0.06, -0.14, 0.06, 0.12, 0.15, 0.18, 0.02, 0.17, 0. , 0.14, -0.15, 0.2 , 0.1 , 0.08, -0.16, 0. , -0.2 , 0.07, 0.02, -0.18, -0.15, -0.03, 0.21, -0.05, -0.14, 0.11, 0.06, -0.14, 0.04, 0.14, 0.15, -0.1 , -0.06, -0.03, 0.15, 0.13, -0.03, -0. , -0.04, -0.18, 0.11], [ 0.15, 0.01, 0. , -0.01, 0.17, 0.02, -0.04, -0.11, 0.16, 0.02, 0.12, -0.12, 0.18, 0.08, -0.22, -0.07, 0.19, 0.01, -0.18, 0.12, 0.22, -0.02, 0.15, 0.14, 0.17, 0.15, -0. , 0.13, 0.19, -0.05, 0.09, -0.24, 0.11, 0.09, 0.02, 0.19, 0.1 , -0.11, 0.05, 0.06, 0.03, 0.02, 0.18, 0.03, 0.02, 0.16, 0.15, 0.22, -0.18, 0.09, -0.08, -0.11, -0.13, 0.21, -0.13, 0.01, -0.22, 0.17, -0.18, -0.18, -0.12, 0.23, 0.12, -0.15, 0.14], [-0.04, -0.08, -0.12, 0.22, -0.03, -0.11, -0.09, -0.09, 0.18, -0.06, 0.22, -0.12, -0.13, 0.07, -0.02, -0.11, 0.02, 0.11, -0.1 , 0.07, -0.15, -0.1 , -0. , 0.1 , -0.08, -0.19, 0.03, -0.11, -0.19, -0.06, -0.07, -0.12, -0.09, -0.05, 0.16, -0.11, -0.14, -0.15, 0.09, -0.19, 0.02, 0.2 , -0.08, 0.01, -0.16, -0.2 , -0.06, 0.09, 0. , 0.2 , -0.11, 0.07, 0.03, 0.15, -0.23, 0.15, -0.14, 0.2 , -0.12, -0.04, 0.2 , 0.11, 0.1 , -0.03, 0.1 ], [ 0.17, -0.19, 0.13, -0.04, -0.04, -0.13, -0.06, 0.1 , -0.05, -0.12, -0.21, 0.01, 0.06, -0.02, 0.04, 0.21, 0.19, -0.13, -0.2 , -0.01, 0. , -0.14, -0.06, -0.1 , -0.16, -0.13, -0.05, 0.15, 0.13, -0.23, 0.09, 0.18, -0.09, -0.17, 0.04, 0.23, -0.24, 0.18, 0.24, -0.22, 0.06, 0.05, 0.12, 0.19, 0.09, 0.07, 0.16, -0.07, -0.02, -0.12, 0.05, -0.09, -0.17, 0.18, -0.06, -0.06, 0.2 , -0.06, 0.06, -0.16, 0.04, 0.2 , -0.03, 0.11, -0.13], [-0.07, -0.16, 0. , 0.06, 0.13, -0.06, 0.06, 0.16, -0.19, -0.08, -0.18, 0.17, -0.02, 0.09, -0.05, 0.03, -0.23, -0.04, 0.05, 0. , 0.24, -0.14, -0.09, 0.05, -0.13, -0.07, 0.03, -0.05, 0.06, 0.15, -0.1 , -0.1 , -0.08, 0.13, 0.1 , -0.17, -0.03, -0.19, -0.12, 0.13, -0.11, 0.19, -0.21, 0.05, 0.13, -0.07, -0.12, 0.1 , -0. , 0.23, 0.06, 0.16, 0.18, -0.17, 0.14, -0. , 0.21, -0.12, 0. , 0.19, -0.07, -0.16, 0.23, 0.2 , -0.16], [-0.19, -0.02, 0.15, -0.03, 0.01, -0. , 0.2 , 0.05, -0.2 , -0.09, -0.03, -0.12, 0.22, -0.13, 0.15, 0.13, -0.23, -0.13, 0.17, -0.06, 0. , -0.05, 0.08, 0.19, -0.2 , 0.21, -0.16, -0.16, -0.03, -0.11, -0.04, -0.1 , -0.08, -0.12, 0.16, 0.08, -0.23, 0.07, -0.11, 0.01, -0.05, 0.02, 0.18, -0.09, 0.1 , 0.07, 0.23, -0.03, -0.01, -0.07, -0.03, 0.14, 0.14, 0.12, -0.12, 0.22, 0.01, -0.09, -0.15, 0.15, -0.19, 0.19, -0.15, -0.06, 0.1 ], [ 0.07, -0.13, 0.08, 0.02, 0.04, -0.17, 0.22, 0.1 , 0.18, 0.19, 0.09, 0.05, -0.09, -0.11, -0.15, 0.09, 0.09, -0.13, -0.17, 0.09, 0.02, -0.07, 0.04, -0.12, 0. , -0.02, -0.16, 0.19, -0.22, -0.16, 0.02, -0.1 , 0. , 0.16, -0.11, 0.14, -0.13, -0.17, -0.14, -0.13, 0.14, 0.09, -0.07, -0.05, -0.17, -0.13, -0.03, 0.11, -0.06, -0.1 , -0.11, -0.05, -0.01, -0. , 0.13, 0.15, -0.01, -0.18, 0.18, 0.06, -0.04, 0.13, -0.07, 0.16, -0.12], [-0.14, -0.12, 0.17, -0.1 , 0.08, -0.15, -0.08, 0.02, -0.11, -0. , 0.13, 0.19, 0.21, 0.14, 0.15, 0.23, 0.15, -0.11, -0.17, 0.02, -0.02, -0.04, 0.1 , 0.15, -0.03, -0.12, 0.11, -0.09, -0.05, -0.19, -0.07, -0.19, -0.09, 0.06, -0.14, -0.02, -0. , -0.11, -0.01, -0.21, 0.14, -0.07, 0.12, -0.06, 0.07, 0.15, 0.23, -0.18, 0.11, -0.09, -0.13, 0.21, 0.17, 0.18, -0.23, -0.17, -0.19, 0.12, -0.04, 0.08, -0.08, -0.13, -0.04, -0.16, -0.01], [-0.1 , -0.09, 0.04, 0.22, -0.05, -0.12, 0.02, 0.04, 0.01, 0.17, 0.2 , -0.06, 0.09, 0.05, -0.19, 0.09, 0.15, -0.06, 0.03, 0.1 , 0.01, 0.02, -0.17, 0.05, 0.03, 0.14, 0.14, -0.1 , 0.13, -0.21, -0.07, 0.17, 0.08, -0.13, -0.17, -0.12, -0.22, 0.13, 0.04, -0.19, 0.2 , 0.17, -0.1 , -0.13, -0.1 , -0.11, 0.08, 0.01, -0.08, 0.23, -0. , -0.19, -0.14, 0.1 , -0.08, 0.21, 0.2 , -0.13, -0.05, -0.14, 0.05, -0.15, 0.22, 0.02, -0.16], [ 0.08, 0.16, 0.16, 0.08, -0.09, 0.15, 0.02, -0.04, -0.2 , -0.05, -0.17, -0.18, 0.21, 0.07, 0.19, -0.06, 0.04, -0.18, 0.08, 0.13, 0.2 , -0.07, -0.02, 0.15, 0.06, 0.19, -0.05, 0.01, -0.1 , 0.04, -0.06, -0.16, 0.1 , -0.05, -0.13, 0.19, 0.05, -0.17, 0.22, -0.1 , 0.16, 0.19, 0.07, 0.07, 0.08, -0.12, 0.06, -0.14, 0.21, -0.17, -0.14, 0.24, 0.1 , 0.07, -0.02, -0.14, 0.14, 0.06, 0.02, 0.04, 0.05, 0.22, -0.02, 0.13, 0.18], [ 0.21, 0.18, 0.21, -0.1 , -0.11, -0.13, 0.07, -0.1 , -0.23, -0.01, 0.07, 0.04, 0.14, 0.1 , -0.04, -0.07, 0.04, 0.13, 0.07, 0.1 , 0.08, -0.14, -0.08, 0.11, -0.11, 0.17, -0.13, -0.08, -0.09, 0.14, -0.06, -0.17, -0.09, -0.08, -0.1 , 0.2 , 0.19, 0.18, 0.01, 0.03, -0.15, -0.01, 0.09, -0.09, 0.15, 0.05, -0.11, 0.04, 0.06, 0.08, 0.06, -0.03, 0.15, -0.05, -0.2 , -0.01, -0.13, -0.06, 0.15, -0.11, -0.17, 0.02, 0.02, -0.14, 0.15], [ 0.15, 0.17, 0.09, -0.04, 0.11, 0.09, -0.08, 0.07, -0.12, -0.18, 0.12, 0.13, 0.09, -0.22, -0.23, -0.13, -0.15, 0.12, 0.05, 0.16, 0.19, 0.08, -0.05, -0.13, -0.12, -0.14, -0. , 0.14, -0.14, 0.05, -0.02, 0.06, -0.19, -0.16, 0.11, 0.23, 0.18, 0.07, -0.03, 0.14, -0.2 , 0.18, -0.02, 0.04, 0.11, 0.12, 0.17, -0.06, -0.19, 0.23, -0.18, -0.19, 0.01, 0.18, -0.13, 0.05, -0.14, 0.2 , -0.06, -0.03, -0.08, 0.07, -0.05, 0.12, -0.02], [ 0.15, -0.05, 0.18, 0.05, 0.1 , -0.18, 0.03, -0.16, 0.03, -0.12, -0.17, 0.14, 0.04, 0.12, -0.05, -0.05, 0.14, -0.18, -0.15, -0.06, -0.16, -0.02, 0.04, -0.09, 0.02, -0.08, 0.16, -0.08, 0.16, -0.21, 0.09, 0.03, 0.08, -0.07, -0.06, 0.02, 0.16, -0.11, -0.02, -0.03, 0.06, -0.03, -0.11, 0.2 , -0.15, 0.18, -0.09, 0.12, -0.22, 0.17, -0.18, 0.12, -0.2 , 0.15, -0.17, 0.09, -0.03, -0.02, -0.18, -0.03, -0.18, -0.02, 0.12, 0.08, -0.24], [-0.22, -0.17, -0.14, -0.06, 0.09, 0.01, 0.04, -0.01, 0.08, -0.15, -0.01, 0.17, 0.1 , -0.17, 0.06, 0.05, -0.12, 0.08, 0.13, -0.06, 0.07, 0.07, 0.19, -0.17, -0.05, 0.1 , -0.15, 0.22, -0.08, -0.15, -0.05, 0.11, -0.04, 0.15, 0.04, -0.05, -0.18, 0.16, 0.13, -0.11, 0.04, 0.19, -0.21, 0.14, 0.17, -0.01, -0.16, 0.18, -0.1 , -0.1 , -0.2 , -0.07, -0.03, -0.06, 0.12, 0.01, -0.01, 0.18, 0.09, -0.07, 0.09, 0.16, -0.06, -0.15, -0.2 ], [ 0.09, -0.18, -0.12, 0.1 , -0.12, 0.04, 0.02, 0.04, -0.18, 0.12, -0.11, 0.22, -0.15, 0.19, 0.16, 0.12, 0.12, 0.19, -0.03, -0.02, 0. , -0. , -0.06, 0.17, 0.07, 0.07, -0.12, -0.02, 0.13, 0.12, 0.23, -0.22, 0.17, 0.18, 0.04, 0.17, 0.12, -0.04, 0.06, 0.13, 0.05, 0.2 , 0.15, 0.11, -0.23, 0.14, -0.11, 0.04, 0.11, 0.08, -0.04, 0.19, -0.02, 0.14, -0.11, 0.1 , -0.1 , -0.17, 0.12, 0.17, 0.05, 0.05, -0.14, 0.18, -0.03], [-0.01, 0.01, -0.18, 0.08, 0.03, 0.14, -0.06, -0.06, 0.07, -0.06, 0.08, -0.03, -0.18, -0.12, 0.09, -0.16, -0.22, 0.21, 0.04, 0.07, 0.15, -0.16, 0.17, -0.21, 0.03, 0.11, -0.1 , 0.01, -0.22, 0.13, -0.18, -0.23, -0.14, 0.19, 0.04, -0. , -0.13, -0.05, 0.08, -0.08, 0.17, 0.06, 0.01, -0.05, 0.17, 0.01, -0.1 , 0.01, 0.08, 0.05, -0.09, -0.16, 0.17, 0.07, -0.18, 0.03, 0.16, 0.11, 0. , -0.01, 0.22, 0.17, 0.13, -0.2 , -0.05], [-0.07, -0.09, -0.12, 0.08, -0.03, -0.19, 0.23, 0.18, -0.02, -0.03, -0.16, -0.19, 0.12, 0.2 , 0.14, 0.04, 0.13, 0.1 , -0.11, -0.04, 0.07, -0.14, -0.08, -0.2 , 0.02, 0. , 0.12, -0.12, -0.18, -0.09, -0.05, -0.06, -0.03, -0. , -0.13, 0.18, 0.09, -0.12, 0.05, -0.04, -0.13, 0.18, -0.22, 0.05, -0.03, 0.09, -0.1 , -0.03, -0.2 , -0.06, 0.17, 0.2 , -0.05, -0.04, -0.13, 0.23, -0.01, 0.1 , 0.07, 0.1 , -0.08, -0.07, 0.12, 0.07, -0.16], [-0.15, 0.16, 0.05, -0.12, 0.07, -0.09, -0.07, -0.12, -0.13, 0.12, -0.01, 0.15, 0.11, 0.01, 0.01, -0.16, -0.15, 0.03, 0.17, -0.11, -0.12, 0.06, 0.04, -0.11, -0.2 , -0.08, -0.16, -0.12, -0.23, -0.24, 0.2 , -0.12, 0.15, -0.13, 0.1 , -0.12, -0.07, 0.18, -0.03, -0.21, 0.15, -0.03, 0.08, -0.1 , 0.02, 0.21, -0.1 , 0.13, 0.11, 0.12, 0.02, 0.07, 0.08, 0.04, -0.06, -0.19, 0.17, 0.04, 0.23, -0.03, 0.19, -0.18, -0.01, 0.17, -0.15], [ 0.08, 0.18, 0.22, -0.02, 0.05, -0.04, 0.23, 0.16, 0.06, -0.12, 0.14, -0.05, -0.04, -0.08, -0.23, 0.07, 0.12, -0.09, -0.19, 0.18, 0.13, 0.14, 0.08, -0.2 , -0.05, 0.18, -0.08, -0.18, 0.16, -0.23, -0.07, 0.17, -0.19, 0.11, 0.1 , 0.12, 0.04, 0.1 , -0.08, 0.06, -0.17, 0.01, 0.03, -0.09, 0.18, 0.2 , -0.15, 0.11, -0.17, -0.15, 0.15, 0.19, -0.15, 0.14, 0.08, -0.03, -0.15, 0.16, 0.16, 0.1 , 0.05, -0.16, 0.07, -0.22, -0.14], [ 0.1 , 0.01, 0.1 , -0.08, -0.03, 0.18, -0.05, 0.21, 0.13, 0.15, -0.2 , -0.08, 0.15, 0.01, 0.14, -0.04, -0.06, 0.07, -0.21, 0.17, 0.14, -0. , -0.15, -0.11, -0.03, -0.19, 0.13, 0.01, -0.11, -0.24, 0.17, -0. , -0.04, -0.19, -0.13, -0.03, -0.2 , 0.17, 0.04, 0.15, 0.07, 0.14, 0.01, 0.02, 0.17, -0.06, 0.17, 0.2 , 0.11, 0.22, 0. , 0.06, -0.02, 0.21, -0.16, 0.03, 0.08, 0.18, 0.17, -0.13, 0.2 , 0.19, -0.02, -0.12, -0.08], [ 0.12, -0.08, 0.14, 0.08, -0.16, 0.14, -0.13, 0.18, 0.16, -0.16, 0.18, 0.01, 0.04, 0.13, -0.01, 0.01, 0.07, 0.15, -0.06, 0.11, 0.23, -0.02, -0.08, -0.1 , -0.18, 0.13, 0.12, -0.02, -0.14, -0.09, 0.12, -0.02, -0.23, 0.05, -0.11, 0.05, 0.02, -0.22, -0.02, 0.08, -0.11, -0.02, -0.03, 0.07, -0.03, -0.07, 0.06, -0.18, 0.09, 0.16, -0.21, -0.04, 0.19, -0.01, 0.16, 0.1 , 0.17, 0.17, 0.03, 0.22, 0.17, -0.19, 0.21, -0.1 , -0.09], [ 0.04, -0.13, 0.1 , 0.08, -0.07, -0.01, 0.23, 0.06, 0.03, -0.14, -0.14, 0.23, 0.09, 0.17, -0.02, -0.17, -0.17, -0.16, -0.1 , -0.17, -0.18, 0.04, 0.16, 0.18, -0.14, 0.04, 0.15, 0.21, -0.15, 0.01, 0.11, 0.17, -0.13, 0.04, -0.16, 0.23, 0.18, -0.21, -0.01, 0.03, -0.13, 0.16, -0.04, -0. , 0.07, 0.16, -0.09, 0.19, 0.16, 0.01, -0.03, 0.13, 0.05, 0.22, -0.14, 0.04, -0.13, 0.1 , 0.03, 0.1 , -0.09, -0.11, -0.09, 0.11, -0.09], [ 0.06, -0.15, -0.03, -0.17, -0.19, -0.14, 0.06, 0.22, -0.09, 0.04, 0. , -0.1 , 0.09, 0.07, 0.17, 0.04, 0.01, 0.18, -0.17, -0.03, 0.15, 0.01, 0.07, 0.02, -0.16, -0.06, -0.19, 0.15, 0.13, 0.19, -0.02, 0.18, -0.1 , -0.15, -0.02, -0.16, 0.02, -0.08, -0.04, 0.09, -0.07, -0.12, 0.04, -0.15, 0.17, -0.11, 0.04, -0.19, 0.12, 0.04, 0.05, -0.09, -0.1 , 0.04, -0.11, 0.21, -0.13, 0.05, 0.15, 0.24, -0.12, -0.08, 0.16, -0.02, -0.22], [-0.04, 0.12, -0.18, 0.07, 0.01, -0.01, 0.17, 0.12, -0.17, -0.1 , 0.2 , -0.04, -0.1 , 0.15, 0.15, -0.08, 0.03, 0.03, 0.06, -0.1 , 0.03, -0.23, -0. , 0.16, 0.11, 0.16, -0.17, 0.19, 0.15, 0.06, 0.01, -0.24, -0.01, -0.09, -0.12, -0.07, -0.01, 0.09, 0.2 , -0.2 , -0.11, -0. , 0.11, -0.13, -0.08, -0.21, -0.09, 0.23, -0.15, 0.16, 0.08, 0.2 , 0.21, 0.22, 0.16, -0.12, 0.04, 0.14, 0.12, 0.19, -0.12, -0.02, 0.12, 0.14, -0.04], [-0.04, 0.23, -0.17, -0.18, -0.09, -0.17, -0.15, 0.1 , -0.17, -0.12, -0.02, 0.09, 0.03, -0.18, -0.01, -0.05, 0.08, -0.16, -0.02, 0.04, 0.1 , -0.07, 0.09, -0.05, 0.14, 0.2 , -0.05, -0.13, -0.03, -0.19, 0.07, -0.23, -0.1 , 0.17, -0.08, -0.15, -0.16, -0.19, -0.03, -0.09, 0.03, 0.08, -0.16, -0.08, -0.15, -0.1 , -0.01, -0.13, 0.05, 0.09, 0.18, -0.14, 0.19, -0.06, -0.06, 0.23, -0.13, 0.02, -0.07, 0.04, -0.08, 0.09, 0.13, -0.23, -0.05], [ 0.03, 0.18, 0.06, -0.11, 0.01, -0.16, -0.03, -0.15, -0.15, -0.12, 0.15, -0.12, 0.06, -0.12, 0.07, 0.18, 0.07, -0.15, 0.02, -0.18, 0.03, -0.11, -0.11, 0.15, -0.02, -0.06, -0.07, -0.07, -0.11, -0.17, -0.05, -0.09, -0.23, 0.14, -0.03, 0.03, 0.07, -0.06, 0.03, -0.09, -0.09, 0.18, -0.22, -0.17, 0.11, -0.17, -0.16, -0.04, 0.16, 0.1 , -0.04, 0.14, 0.21, 0.22, 0.06, -0.08, 0.11, -0.12, 0.04, -0.07, 0.02, 0.17, 0.09, -0.17, -0.22], [-0.13, -0.15, -0.09, 0.07, -0.03, -0.1 , -0.06, -0.04, 0.14, 0.17, 0.08, 0. , -0.01, 0.07, -0.2 , 0.2 , 0.18, 0.16, 0.14, -0.08, 0.03, 0.1 , -0.08, 0.07, 0.18, 0.11, 0. , -0.09, 0.07, -0.05, 0.07, 0.06, -0.15, -0.04, 0.15, -0.08, 0.09, 0.08, -0.09, 0.14, 0.1 , 0.18, 0.09, -0.14, 0.13, 0.1 , -0.18, 0.11, -0.01, -0.04, -0.07, 0.16, -0.07, -0.12, -0.03, -0.12, 0.08, 0.24, -0.06, 0.15, -0.15, -0.15, 0.07, 0.17, 0.05], [ 0.2 , -0.12, -0.03, -0.17, -0.18, 0.09, 0.16, 0.12, 0.13, -0.12, 0.03, -0.17, 0.18, 0.01, 0.15, 0.04, 0.16, 0.02, 0.02, -0.14, -0.13, -0.08, 0.16, 0.02, 0.05, 0.19, -0.1 , 0.09, -0.07, -0.15, -0.13, 0.09, 0.1 , -0.19, 0.06, -0.02, -0.03, 0.07, 0.21, 0.19, 0.12, -0.11, -0.06, 0.02, -0.21, 0.16, 0.01, -0.1 , 0.12, -0.09, 0.18, 0.23, -0.05, -0.02, 0.01, 0.16, -0.22, 0.07, 0.09, -0.15, -0.16, 0.05, 0.02, 0.03, 0.07], [-0.15, 0.18, 0.21, 0.08, 0.04, -0.01, -0.08, -0.05, 0.19, 0.14, 0.07, 0.05, 0.11, -0.17, -0.12, -0.13, -0.14, 0. , -0.15, -0.07, 0.15, 0.03, -0.18, 0.13, 0.02, 0.04, -0.12, 0.03, 0.14, -0.02, 0.04, -0.18, 0.15, -0.14, -0.19, 0.19, -0.04, -0.08, -0.02, 0.05, -0.01, -0.12, -0.16, -0.09, 0.05, 0.14, -0.17, -0.01, -0.21, 0.01, -0.12, -0.04, -0.17, 0.22, -0.01, 0.1 , 0.01, -0.11, 0.15, 0.2 , -0.11, -0.19, -0. , 0.14, -0.18], [ 0.09, 0.05, 0.17, -0.03, 0.15, 0.1 , 0.23, 0.18, -0.01, -0.19, 0.21, -0.1 , -0.04, -0.08, 0.09, 0.19, -0.06, 0.15, -0.16, -0.03, 0.1 , -0.16, 0.11, 0.11, 0.06, -0.07, -0.17, 0.06, -0.04, 0.05, 0.19, 0.02, -0.09, -0.02, 0.19, 0.11, 0.13, -0.03, 0.12, -0.07, -0.19, 0.11, 0.15, 0.03, 0.01, -0.09, 0.19, -0.03, -0.09, -0.05, -0.18, 0.23, -0.05, 0. , 0.07, 0.23, 0.13, 0.21, -0.15, 0.12, 0.03, 0.19, 0.06, -0.18, 0.19], [ 0.02, -0.17, -0.03, 0.11, -0.19, -0.15, -0.04, 0.16, -0.2 , -0.18, -0.13, 0.19, -0.19, -0.01, -0.03, 0.02, -0.24, 0.05, 0.13, -0.08, 0.12, 0.04, -0.19, 0.05, -0.03, 0.16, -0.1 , 0.15, -0.09, 0.04, 0.14, -0. , 0.05, 0.08, 0.22, 0.22, -0.08, -0.08, -0.13, 0.18, 0.07, -0.02, -0.02, -0.14, -0.12, -0.11, 0.12, 0.03, -0.19, 0. , -0.07, -0.07, -0.06, -0.06, -0.12, 0.15, 0.12, 0.12, -0.05, 0.09, 0.09, -0.19, -0.01, 0.16, -0.08], [-0.18, 0.12, -0.09, -0.06, 0.17, -0.11, 0.13, 0.03, 0.16, -0.1 , -0.1 , -0.11, -0.15, -0.13, 0.07, 0.19, -0.07, 0.12, -0.12, 0.19, -0.16, -0.02, 0.2 , 0.02, 0.18, 0.21, -0.17, -0.18, 0.05, -0.14, 0.12, -0.11, 0.18, -0.07, 0.11, 0.02, -0.02, -0.06, 0.17, -0.14, -0.11, 0.17, 0.08, 0.15, 0.01, 0.11, -0.18, 0.12, -0.19, -0.12, -0.11, 0.17, -0.16, -0.17, -0.23, 0.09, 0.18, -0.01, -0.01, -0.13, 0.04, 0.2 , 0.06, 0.07, -0.1 ], [ 0.14, 0.07, 0.12, -0.08, -0.21, 0.06, 0.08, 0.19, -0.03, -0.1 , 0.09, 0.03, 0.03, 0.04, 0.03, 0.04, -0.23, 0.07, 0.18, -0.1 , -0.11, -0.13, -0.02, -0.02, -0.01, 0.17, -0.07, 0.09, -0.21, -0.14, -0.08, -0.12, -0.1 , -0.05, -0.01, -0.01, 0.05, 0.05, 0. , -0.08, -0.18, 0.18, -0.1 , -0.13, 0.17, -0.07, -0.14, -0.14, 0.2 , 0.23, -0.14, 0.01, 0.11, 0.15, -0.24, 0.02, 0.01, 0.23, 0.07, -0.09, -0.16, 0.15, -0.04, -0.11, 0.08], [-0.16, 0.16, 0.1 , 0.19, 0.18, 0.15, -0.04, 0.16, -0.14, 0.06, -0.15, 0.06, 0.14, -0.03, -0.1 , 0.14, -0.22, 0.09, 0.17, -0.15, -0.01, -0.13, 0.19, -0.16, 0.2 , 0.09, -0.23, -0.11, -0.11, -0.12, -0.05, 0.11, -0.03, 0.19, 0.09, -0.18, -0.11, 0.14, 0. , -0.21, 0.03, 0.05, -0.23, 0.2 , -0.06, 0.13, 0.06, 0.18, 0.02, 0.19, 0.05, -0.14, 0.14, -0.11, -0.03, -0.17, 0.07, -0.03, -0.14, 0.1 , -0.08, -0. , 0.02, 0.16, 0.08], [-0.21, 0.17, 0.16, 0.22, -0.18, 0.15, -0.13, -0.02, -0.12, -0.01, -0.03, 0.06, -0.02, -0.04, 0.18, 0.01, 0.12, 0.12, -0.08, -0.17, -0.18, 0.14, -0.04, 0.14, 0.11, 0.18, -0.12, 0.18, 0.01, -0.18, -0.14, 0.1 , 0.07, 0. , 0.03, -0.04, 0.12, 0.08, 0.14, -0.21, -0.06, 0.15, 0.15, 0.19, -0.03, -0.03, 0.14, 0.05, -0.1 , 0.05, -0.02, -0.02, 0.01, -0.07, 0.06, 0.02, 0.1 , -0.02, -0.16, -0. , 0.03, -0.11, 0.16, -0.15, 0.06], [-0.06, -0.02, -0.01, -0.06, -0.16, -0.09, -0.05, -0.16, 0.13, -0.13, 0.05, 0.02, 0.22, -0.1 , 0.16, 0.19, -0.04, 0.04, -0.11, 0.11, 0.08, -0.15, 0.12, -0.19, -0.09, 0.08, -0.23, 0.17, -0.23, -0.15, 0.03, 0.11, -0.02, 0.15, 0.12, -0.17, -0. , 0.1 , 0.16, -0.04, -0.11, 0.06, -0.14, -0.14, 0.15, -0.05, -0.03, -0.15, -0.01, 0.07, 0.01, -0.16, -0.06, 0.07, -0.18, -0.09, -0.14, 0.04, -0.1 , 0.17, 0.15, -0.17, 0.04, 0.02, -0.01], [-0.07, -0.11, -0.15, 0.1 , 0.02, -0.01, 0.09, 0.13, -0.12, -0.17, 0.09, -0.15, 0.1 , 0.08, -0.07, 0.06, -0.15, 0.1 , 0.07, -0.14, -0.14, 0.01, -0.23, -0.06, -0.08, 0.01, 0.1 , 0.08, -0.11, -0.21, -0.08, 0.15, 0.15, 0.09, 0.1 , 0.01, 0.18, 0.05, 0.09, 0.02, 0.03, -0.1 , -0.03, 0.09, 0.09, -0.04, 0.1 , 0.07, 0.05, 0.21, 0.05, 0.06, 0.02, 0.01, 0.08, 0.23, -0.04, -0.14, 0.18, 0.13, 0.04, -0.05, 0.11, -0.18, 0.14], [ 0.01, 0.06, 0.24, 0.15, 0.03, 0.06, 0.24, -0.12, -0.06, 0.15, -0.11, 0.21, -0.08, -0.21, 0.16, 0.19, -0.12, -0.08, -0.22, -0.14, -0. , -0.19, -0.18, -0.03, -0.03, 0.05, -0.22, -0.17, 0.07, 0.08, -0.13, -0.05, -0.16, 0.14, -0.15, 0.11, -0.24, 0.11, -0.13, 0.16, -0.14, 0.04, -0.19, -0.04, -0.04, -0.17, 0.2 , -0.03, 0.06, -0.1 , -0.01, -0.11, -0.18, -0.06, 0.03, 0.01, -0.21, 0.06, -0. , -0.06, -0.09, 0.1 , 0.21, -0.07, -0.19], [-0.15, 0.14, 0.14, -0.02, -0.13, -0.21, 0.1 , -0.06, 0.04, -0.05, 0.08, 0.17, -0. , 0.06, 0.19, 0.09, 0.12, -0.04, 0.12, 0.13, -0.12, -0.07, 0.03, 0.07, -0.16, 0.19, 0.03, 0.15, -0.04, -0.02, 0.06, 0.13, 0.02, 0.11, 0.06, 0. , 0.17, 0.08, 0.12, -0.09, 0.14, 0.16, -0.13, 0.06, 0.04, -0.15, 0.08, -0.01, -0.06, -0.05, -0.2 , 0.05, -0.1 , -0.06, -0. , -0.06, 0.18, 0.18, 0.18, -0.16, 0.01, 0.1 , 0.23, 0.03, 0.04], [-0.12, 0.04, -0.13, -0.13, 0.08, -0.11, 0.12, -0.15, -0.05, -0.1 , 0.02, 0.07, 0.15, 0.08, -0.05, 0.16, -0.22, 0.2 , 0.05, 0.03, -0.12, 0.01, -0.03, -0.05, 0.05, -0.11, -0.01, 0. , 0.1 , 0.15, -0.12, -0.06, -0.19, -0.17, 0.1 , 0.23, -0.06, -0.16, -0.09, 0.16, -0.07, 0.17, -0.03, -0.05, -0.23, -0.06, 0.1 , 0.16, -0.16, -0.1 , 0.14, -0.17, 0.08, 0.11, 0.1 , -0.17, 0.16, -0.1 , 0.17, -0.04, 0.02, -0.14, 0.04, 0.19, 0.01], [-0. , -0.02, 0. , 0.14, -0.14, -0.17, -0.06, -0.14, -0.12, 0.01, 0.18, -0.17, -0.09, 0.05, -0.13, 0.2 , -0.18, 0.02, -0.04, 0.15, -0.13, -0. , -0.08, -0.23, -0.19, -0.01, -0.02, -0.07, -0.06, -0.03, -0.04, -0.17, -0.02, 0.16, -0.2 , 0.13, 0. , -0.02, -0.01, 0.04, 0.01, 0.06, 0.14, 0.05, 0.18, -0.14, 0. , 0.03, -0.04, 0.01, 0.04, -0.02, -0.02, 0.23, -0.06, -0.08, 0.1 , -0.05, 0.01, -0.01, 0.24, 0.14, 0.15, 0.05, 0.03], [ 0.16, -0.18, 0.21, -0.09, 0.02, -0.23, -0.01, -0.08, 0.07, 0.18, 0.14, 0.09, -0.17, 0. , -0.03, 0.11, -0.09, -0.08, -0.1 , 0.21, -0.04, -0.1 , 0.02, -0.23, -0.11, -0.16, 0.09, -0.09, -0.02, -0.08, -0.05, -0.08, -0.21, -0.01, 0.01, 0.11, -0.13, 0.04, 0.24, 0.11, 0.19, -0.1 , 0.14, 0.08, -0.19, -0.17, -0.08, -0.02, 0.17, 0.13, -0.03, 0.08, -0.05, -0.09, -0.1 , -0.14, -0.04, 0.15, 0.13, 0.15, -0.09, -0.09, -0.12, -0.12, 0.01], [ 0.15, 0.19, 0.22, 0.17, -0.07, -0.06, -0. , -0.1 , -0.03, 0.07, -0.06, 0.15, -0.03, -0.22, -0.06, 0.14, -0.02, -0.12, -0.07, 0.13, 0.13, 0.17, 0.16, -0. , 0.17, 0.21, -0.15, 0.19, 0.13, -0.19, -0.18, -0.12, 0.03, 0.14, -0.02, -0.15, -0.12, -0.09, 0.2 , 0.13, 0.05, 0.01, 0.04, -0.16, 0.11, -0.09, 0.21, 0.01, 0.04, -0.18, -0.23, 0.08, 0.16, 0.12, 0.06, 0.01, 0.13, -0.14, 0.16, -0.11, 0.08, 0. , 0.11, 0.17, 0.17], [ 0.16, -0.07, 0.17, -0.11, -0.18, -0.07, 0.1 , -0.11, -0.04, -0.16, 0.13, 0.23, -0. , -0.21, 0.12, -0.18, 0.11, -0.14, -0.01, 0.19, 0.17, -0.14, -0.01, -0.11, -0.2 , 0.17, 0.08, -0.13, 0.13, -0.02, -0.04, -0.13, 0.02, 0.01, -0.08, 0.01, -0.07, -0.14, -0.08, -0.03, -0.14, 0.06, 0.01, 0.15, 0.02, -0.08, 0.05, -0.18, 0.03, -0.18, 0.11, -0.16, -0.02, 0.07, 0.1 , 0.22, -0.02, 0.2 , 0.11, -0.05, -0. , -0.08, -0. , -0.12, -0.11]], dtype=float32), array([-0. , 0.03, 0.03, 0.02, -0. , -0.03, 0.03, 0.03, -0.02, -0.03, 0. , 0.02, 0.02, -0.01, -0.02, 0.03, -0.03, -0. , -0.02, 0.03, 0.03, -0.03, -0.02, -0.03, 0.02, 0.01, -0.03, 0.03, -0.03, -0.02, 0.03, -0.03, -0.03, 0. , 0.01, 0.02, -0.03, -0.02, 0.03, -0.03, -0. , 0.03, -0.02, 0.03, -0.03, 0. , 0.03, 0.03, -0.01, 0.03, -0.02, 0.03, 0.02, 0.03, -0.03, 0.02, -0.01, 0.03, 0.03, 0.03, 0.03, 0.02, 0.03, -0.02, -0.02], dtype=float32), array([[ 0.16, 0.23, -0.23, -0.17, -0.2 , -0.2 ], [ 0.23, -0.26, -0.16, 0.12, -0.03, 0.13], [ 0.12, 0.03, -0.04, -0.18, -0.22, -0.07], [-0.12, 0.01, -0.25, -0.24, 0.14, -0.2 ], [-0.23, -0.12, 0.23, -0.01, 0.04, 0.19], [ 0.19, 0.23, -0.07, 0.21, -0.27, -0.1 ], [ 0.11, -0.18, -0.27, 0.12, -0.22, -0.01], [ 0.29, -0.19, 0.24, -0.03, -0.24, 0.14], [ 0.16, 0.02, 0.2 , -0.06, -0.07, -0.27], [ 0. , 0.18, 0.16, -0.15, 0.23, -0.14], [ 0.27, 0.09, 0.24, -0.29, -0.11, 0.21], [ 0.15, 0.08, 0.01, -0.29, -0.07, -0.12], [ 0.04, -0.19, 0.12, 0.02, 0.1 , 0.03], [-0.06, 0.19, -0.02, -0.19, -0.13, 0.22], [ 0.15, 0.01, 0.23, 0.11, -0.17, 0.1 ], [ 0.17, -0.26, -0.3 , 0.11, 0.17, -0.24], [ 0.19, 0.19, -0.2 , 0.1 , 0.25, -0.03], [-0.12, 0.19, -0.25, -0.25, 0.03, 0.3 ], [-0.18, 0.05, -0.24, 0.07, 0.23, -0.21], [-0.04, -0.27, -0.29, -0.28, 0.25, 0.09], [-0.09, -0.1 , -0.11, 0.04, -0.26, 0.14], [ 0.06, 0.21, -0.06, -0.26, 0.22, 0.11], [ 0.21, -0.1 , -0.08, 0.18, 0.05, -0.26], [-0.17, 0.26, 0.04, -0.15, -0.1 , 0.24], [-0.21, -0.11, -0.05, -0.07, 0.02, -0.26], [ 0.13, -0.03, -0.23, -0.09, 0.2 , 0.23], [ 0.15, 0.07, -0.09, -0.09, 0.12, 0.09], [ 0.08, -0.26, -0.22, 0.11, 0.07, -0.18], [-0.17, 0.08, -0.04, 0.18, 0.2 , 0.11], [-0.18, 0.2 , 0.24, -0.11, 0.16, -0.11], [-0.2 , -0.22, 0.05, 0.03, -0.21, -0.2 ], [ 0.15, 0.21, 0.1 , 0.05, -0. , -0.16], [-0.22, 0.08, -0.04, 0.16, -0.05, 0.04], [-0.13, -0.09, 0.15, 0.22, -0.26, 0.12], [-0.2 , -0.02, -0.26, 0.1 , -0.01, 0.28], [ 0.25, 0.06, -0.26, -0.26, 0.16, 0.25], [-0.13, 0.21, -0.05, 0.25, -0.19, -0.17], [ 0.12, -0.17, 0.15, 0.1 , 0.22, 0.24], [-0.24, -0.03, -0.29, -0.17, -0.29, -0.03], [ 0.1 , 0.23, 0.18, -0.23, 0.24, -0.15], [ 0.29, 0.05, -0.11, 0.15, -0.19, 0.29], [-0.12, -0.15, 0.11, 0.04, -0.32, -0.01], [ 0.16, -0.04, 0.13, 0.15, -0.1 , -0.06], [ 0.12, -0.05, 0.08, -0.22, -0.1 , 0.13], [ 0.04, 0.23, 0.14, 0.12, -0. , 0.2 ], [-0.06, -0.15, 0.17, -0.15, 0.23, 0.12], [ 0.01, 0.05, 0.02, -0.12, -0.27, -0.07], [-0.08, -0.05, 0.2 , -0.3 , -0.26, 0.31], [-0.12, -0.18, 0.02, 0.06, 0.24, -0.19], [-0.09, -0.12, -0.15, 0.16, -0.19, -0.21], [-0.05, 0.17, 0.23, -0.28, 0. , -0.03], [-0.22, -0.05, 0.18, -0.31, -0.31, -0.2 ], [ 0.28, -0.17, -0.04, 0.1 , 0.03, -0.23], [-0.11, -0.02, -0.03, -0.24, 0.01, -0.06], [ 0.07, 0.23, -0.14, -0.01, -0. , 0.07], [-0.19, -0.12, -0.09, -0.11, 0.07, -0.2 ], [-0.28, 0.21, -0.22, -0.27, -0.06, -0.18], [ 0.07, -0.25, 0.01, -0.24, -0.16, -0.26], [-0.16, -0.29, -0.31, -0.05, 0.22, 0. ], [-0.21, -0.22, -0.26, 0.19, -0.13, -0.11], [-0.3 , -0.32, -0.21, 0.01, -0.18, 0.14], [-0.05, 0.21, -0.21, -0.23, -0.27, 0.28], [ 0.07, -0.32, -0.31, -0.28, 0.1 , -0.24], [ 0.04, 0.01, 0.02, 0.05, -0.1 , -0.07], [ 0.23, -0.05, 0.18, 0.21, 0. , 0.05]], dtype=float32), array([ 0.01, -0.03, -0.02, -0.03, -0.03, 0.01], dtype=float32)] # test the model and your weights model1.fit(bin16, count4, epochs=1) model1.set_weights(myWeights1) # predict3 = model1.predict(bin16) np.set_printoptions(suppress=True) np.set_printoptions(precision=1) # print('prediction =', predict3) # model2.fit(bin16, count4, epochs=1) model2.set_weights(myWeights2) # predict3 = model2.predict(bin16) np.set_printoptions(suppress=True) np.set_printoptions(precision=1) # print('prediction =', predict3) # model3.fit(bin16, count4, epochs=1) model3.set_weights(myWeights3) # predict3 = model3.predict(bin16) np.set_printoptions(suppress=True) np.set_printoptions(precision=1) # print('prediction =', predict3) # model4.fit(bin16, count4, epochs=1) model4.set_weights(myWeights4) # predict3 = model4.predict(bin16) np.set_printoptions(suppress=True) np.set_printoptions(precision=1) # print('prediction =', predict3) model5.set_weights(myWeights5) # predict3 = model4.predict(bin16) np.set_printoptions(suppress=True) np.set_printoptions(precision=1) # print('prediction =', predict3) Examples = { 'CLevel' : [bin16, count4, model1, myWeights1], 'Bonus5' : [bin16, count4, model2, myWeights2], 'Bonus6' : [bin16, count4, model3, myWeights3], 'Bonus7' : [bin16, count4, model4, myWeights4], 'Bonus8' : [samples2, sample2output, model5, myWeights5] }
StarcoderdataPython
5105400
load(":spotbugs_config.bzl", "SpotBugsInfo") def _spotbugs_impl(ctx): # Preferred options: 1/ config on rule, 2/ config via attributes if ctx.attr.config != None: info = ctx.attr.config[SpotBugsInfo] effort = info.effort fail_on_warning = info.fail_on_warning exclude_filter = info.exclude_filter else: effort = ctx.attr.effort fail_on_warning = ctx.attr.fail_on_warning exclude_filter = None if ctx.attr.only_output_jars: deps = [] for target in ctx.attr.deps: if JavaInfo in target: # test targets do not include their own jars: # https://github.com/bazelbuild/bazel/issues/11705 # work around that. deps.extend([jar.class_jar for jar in target[JavaInfo].outputs.jars]) jars = depset(direct = deps).to_list() else: jars = depset(transitive = [target[JavaInfo].transitive_runtime_deps for target in ctx.attr.deps if JavaInfo in target]).to_list() flags = ["-textui", "-effort:%s" % effort] # flags = ["-textui", "-xml", "-effort:%s" % effort] if exclude_filter: flags.extend(["-exclude", exclude_filter.short_path]) test = [ "#!/usr/bin/env bash", "RES=`{lib} {flags} {jars} 2>/dev/null`".format( lib=ctx.executable._spotbugs_cli.short_path, flags=" ".join(flags), jars=" ".join([jar.short_path for jar in jars])), "echo \"$RES\"", ] if fail_on_warning: test.extend([ "if [ -n \"$RES\" ]; then", " exit 1", "fi" ]) out = ctx.actions.declare_file(ctx.label.name + "exec") ctx.actions.write( output = out, content = "\n".join(test), ) runfiles = ctx.runfiles( files = jars + [ctx.executable._spotbugs_cli], ) if (exclude_filter): runfiles = runfiles.merge(ctx.runfiles(files = [exclude_filter])) return [ DefaultInfo( executable = out, runfiles = runfiles.merge(ctx.attr._spotbugs_cli[DefaultInfo].default_runfiles) ) ] spotbugs_test = rule( implementation = _spotbugs_impl, attrs = { "deps": attr.label_list( mandatory = True, allow_files = False ), "config": attr.label( providers = [ SpotBugsInfo, ], ), "effort": attr.string( doc = "Effort can be min, less, default, more or max. Defaults to default", values = ["min", "less", "default", "more", "max"], default = "default" ), "only_output_jars": attr.bool( doc = "If set to true, only the output jar of the target will be analyzed. Otherwise all transitive runtime dependencies will be analyzed", default = True, ), "fail_on_warning": attr.bool( doc = "If set to true the test will fail on a warning, otherwise it will succeed but create a report. Defaults to True", default = True, ), "_spotbugs_cli": attr.label( cfg = "host", default = "//java/private:spotbugs_cli", executable = True, ), }, executable = True, test = True, )
StarcoderdataPython