id
stringlengths
1
7
text
stringlengths
6
1.03M
dataset_id
stringclasses
1 value
52083
def obfuscate(utils_path, project_path): import subprocess print('Running obfuscator ...') subprocess.run(f'{utils_path}/confuser/Confuser.CLI.exe {project_path} -n')
StarcoderdataPython
3336769
# # pv_ifc.py # # Created on: Aug 16, 2008 # Author: dcoates PV_ACTION_INIT=1 PV_ACTION_ADD_LAYER=2 PV_ACTION_SET_LAYER_PARAMS=3 PV_ACTION_ADD_CONNECTION=4 PV_ACTION_RUN=5 PV_ACTION_SET_PARAMS=6 PV_ACTION_SET_INPUT_FILENAME=7 PV_ACTION_INJECT=8 PV_ACTION_MEASURE=9 PV_ACTION_FINALIZE=10 PV_ACTION_SETUP=11 PV_HANDLER_LIF=1 PV_HANDLER_READFILE=2 PV_HANDLER_GAUSS2D=3 PV_HANDLER_THRU=4 PV_HANDLER_COCIRC1D=5 PV_HANDLER_COCIRC_K=6 PV_HANDLER_CENTER_SURR=7 PV_HANDLER_PROB_FIRE=8 PV_HANDLER_LIF2=9 PV_HANDLER_GAUSS2DX=10 PV_HANDLER_COCIRC_K2=11 PV_BUFFER_V=0 PV_BUFFER_PHI=1 PV_BUFFER_G_I=2 PV_BUFFER_G_E=3 PV_BUFFER_F=4 PV_CONNECTION_FLAG=100
StarcoderdataPython
3329207
from dna_functions import dseq_from_both_overhangs, both_overhangs_from_dseq, \ format_sequence_genbank, read_dsrecord_from_json import unittest from pydna.dseqrecord import Dseqrecord from pydna.dseq import Dseq from Bio.SeqFeature import FeatureLocation from pydna.seqfeature import SeqFeature from typing import OrderedDict class DseqFromBothOverhangsTest(unittest.TestCase): def test_conversion(self): # Here we try both with longer watson and longer crick for watson, crick in [('AAAAAA', 'TTTT'), ('TTTT', 'AAAAAA')]: for ovhg in [-2, 0, 3]: with self.subTest(ovhg=ovhg): dseq_original = Dseq(watson, crick=crick, ovhg=ovhg) crick_overhang_3p, watson_overhang_3p = both_overhangs_from_dseq( dseq_original) dseq_2 = dseq_from_both_overhangs( str(dseq_original), crick_overhang_3p, watson_overhang_3p) # We check that the elements of Dseq are transferred properly self.assertEqual(dseq_original.watson, dseq_2.watson) self.assertEqual(dseq_original.crick, dseq_2.crick) self.assertEqual(dseq_original.ovhg, dseq_2.ovhg) # Now we check for the features dseq_original = Dseqrecord(dseq_original) dseq_2 = Dseqrecord(dseq_2) # We add some features: # TODO document somewhere the fact that the strand must # be specified. The file readers assume +1 strand for # all features when reading from GenBank files for a, start, end in [('a', 0, 2), ('b', 1, 2), ('c', 4, 7)]: dseq_original.features.append( SeqFeature( location=FeatureLocation(start, end), type="misc_feature", qualifiers=OrderedDict({"label": [a]}), strand=1) ) dseq_2.features = dseq_original.features # We check that the features are transferred normally for i in range(len(dseq_2.features)): feature_original: SeqFeature = dseq_original.features[i] feature_2: SeqFeature = dseq_2.features[i] self.assertEqual( feature_original.extract(dseq_original), feature_2.extract(dseq_2)) # Finally we test with pydantic models seq_entity = format_sequence_genbank(dseq_original) dseq_3 = read_dsrecord_from_json(seq_entity) self.assertEqual(dseq_original.seq.watson, dseq_3.seq.watson) self.assertEqual(dseq_original.seq.crick, dseq_3.seq.crick) self.assertEqual(dseq_original.seq.ovhg, dseq_3.seq.ovhg) # We check that the features are transferred normally for i in range(len(dseq_3.features)): feature_original: SeqFeature = dseq_original.features[i] feature_3: SeqFeature = dseq_3.features[i] self.assertEqual( feature_original.extract(dseq_original), feature_3.extract(dseq_3))
StarcoderdataPython
4829429
# Generated by Django 2.0.2 on 2018-03-09 18:14 import app.teams.models from django.db import migrations, models import django.db.models.deletion class Migration(migrations.Migration): dependencies = [ ('auth', '0009_alter_user_last_name_max_length'), ('teams', '0002_team_members'), ] operations = [ migrations.AlterModelOptions( name='team', options={'permissions': (('view_team', 'View team'),)}, ), migrations.AddField( model_name='team', name='group', field=models.OneToOneField(default=None, on_delete=django.db.models.deletion.CASCADE, related_name='team', to='auth.Group'), preserve_default=False, ), migrations.AlterField( model_name='team', name='name', field=models.CharField(max_length=80, unique=True, validators=[app.teams.models.validate_team_name]), ), ]
StarcoderdataPython
1699319
'''Main setup and run loop for xcffibaer. ''' import asyncio import os import sys import xcffib import xcffib.render import xcffib.randr from xcffib.randr import NotifyMask, ScreenChangeNotifyEvent import i3ipc from . import Bar, Store, Window, XSetup from .atoms import initAtoms from .timers import addDelay from .utils import QuitApplication, inspect, printError, printInfo DEFAULT_SCREEN_INDEX = 0 HANDLE_SCREEN_CHANGE_DELAY = 0.5 awaitingScreenChange = False def handleWindowEvent(event): printInfo(f'Incoming {event.__class__.__name__}:') inspect(event) windowID = event.window if hasattr(event, 'window') else event.event Window.windowsByID[windowID].handleEvent(event) def charListToString(charList): return ''.join(chr(c) for c in charList) def setupX(theme, screenIndex=DEFAULT_SCREEN_INDEX): conn = xcffib.connect(display=os.getenv('DISPLAY')) conn.randr = conn(xcffib.randr.key) conn.render = conn(xcffib.render.key) screens = conn.get_screen_pointers() root = conn.get_setup().roots.list[screenIndex] initAtoms(conn) depthInfo = [ d for d in root.allowed_depths.list if d.depth == 32 ][0] printInfo('depthInfo:') inspect(depthInfo) visualType = [ v for v in depthInfo.visuals.list if v._class == xcffib.xproto.VisualClass.TrueColor # pylint: disable=protected-access ][0] printInfo('visualType:') inspect(visualType) xSetup = XSetup(conn, screens[screenIndex], depthInfo, visualType, root, theme) return conn, xSetup def wrapI3Command(i3conn): wrappedI3Command = i3conn.command def i3Command(command): print(f'Sending i3 command: {repr(command)}') sys.stdout.flush() wrappedI3Command(command) i3conn.command = i3Command return i3conn def run(theme, setupBar, setupStore, onInit=None, screenIndex=DEFAULT_SCREEN_INDEX): conn, xSetup = setupX(theme, screenIndex) if onInit: onInit() i3conn = wrapI3Command(i3ipc.Connection()) bars = [] def paintBars(): for bar in bars: bar.paint() store = Store(paintBars) setupStore(store, i3conn) def setupBars(): dummy = Window(xSetup) screenResources = conn.randr.GetScreenResources(dummy.id).reply() printInfo('GetScreenResources:') inspect(screenResources) crtcInfoCookies = [(crtc, conn.randr.GetCrtcInfo(crtc, 0)) for crtc in screenResources.crtcs] for crtc, crtcInfoCookie in crtcInfoCookies: crtcInfo = crtcInfoCookie.reply() if crtcInfo.num_outputs: printInfo(f'Creating bar for crtc {crtc}.') outputs = [ charListToString(conn.randr.GetOutputInfo(output, 0).reply().name) for output in crtcInfo.outputs ] printInfo('outputs:', outputs) bar = Bar(xSetup, height=21, screenExtents=crtcInfo, name=outputs[0]) setupBar(bar, store, outputs, i3conn) bars.append(bar) else: print(f'(crtc {crtc} disabled)') dummy.close() setupBars() conn.randr.SelectInput(xSetup.root.root, NotifyMask.ScreenChange) loop = asyncio.get_event_loop() def handleScreenChange(): printInfo(f'Incoming screen change event; closing and re-creating bars.') while bars: try: bars.pop().close() except Exception as error: # pylint: disable=broad-except printError(f'Unexpected {error.__class__.__name__} received while closing bar:', error) inspect(error) setupBars() globals()['awaitingScreenChange'] = False def shutdown(): printInfo('Shutting down.') loop.stop() def xcbPoll(): while True: try: #event = conn.wait_for_event() event = conn.poll_for_event() except xcffib.ProtocolException as error: printError(f'Protocol error {error.__class__.__name__} received!') shutdown() break except Exception as error: # pylint: disable=broad-except printError(f'Unexpected {error.__class__.__name__} received:', error) inspect(error) #shutdown() break if conn.has_error(): printError('Connection error received!') shutdown() break if not event: break try: if isinstance(event, ScreenChangeNotifyEvent): if not awaitingScreenChange: printInfo(f'Incoming {event.__class__.__name__}; scheduling bar re-creation.') globals()['awaitingScreenChange'] = True addDelay(HANDLE_SCREEN_CHANGE_DELAY, handleScreenChange) else: printInfo(f'Ignoring {event.__class__.__name__}; bar re-creation already scheduled.') else: handleWindowEvent(event) except QuitApplication: shutdown() break try: i3conn.event_socket_setup() loop.add_reader(conn.get_file_descriptor(), xcbPoll) loop.add_reader(i3conn.sub_socket, i3conn.event_socket_poll) loop.run_forever() finally: i3conn.event_socket_teardown() loop.run_until_complete(loop.shutdown_asyncgens()) loop.close() for window in Window.windowsByID.values(): if hasattr(window, 'cleanUp') and callable(window.cleanUp): window.cleanUp() conn.disconnect()
StarcoderdataPython
3283242
#65 - maior ou menor,varios numeros e mostrar a media, #perguntar ao usuarios se quer ou nao continuar maior = menor = media = cont = 0 laco = 'S' while laco == 'S': n1 = int(input('Digite os valores: ')) cont +=1 if cont == 1: #se contador for igual a 1, ou seja a primeira vez q ele conta o primeiro numero maior = n1 menor = n1 else: # se o segundo numero for maior q o primeiro if n1 > maior: maior = n1 if n1 < menor: menor = n1 media = n1 + media laco = ' ' while laco != 'S' and laco != 'N': laco = str(input('Deseja continuar [S|N]: ')).upper().strip() if laco != 'S': print('Programa finalizado.') print('-'*100) print('A média foi de: {:.2f}'.format(media/cont)) print('Maior número foi: {}'.format(maior)) print('Menor número foi: {}'.format(menor))
StarcoderdataPython
106942
import pytest pytestmark = [ pytest.mark.requires_salt_states("echo.text"), ] def test_echoed(salt_call_cli): echo_str = "Echoed!" ret = salt_call_cli.run("state.single", "echo.echoed", echo_str) assert ret.exitcode == 0 assert ret.json assert ret.json == echo_str def test_reversed(salt_call_cli): echo_str = "Echoed!" expected = echo_str[::-1] ret = salt_call_cli.run("state.single", "echo.reversed", echo_str) assert ret.exitcode == 0 assert ret.json assert ret.json == expected
StarcoderdataPython
1712745
<reponame>Mouedrhiri/get-running-processes-with-ram-usage import psutil import wmi from tqdm import tqdm from time import sleep def progress(range): for i in tqdm(range, desc ="Progress : "): sleep(.1) f = wmi.WMI() l = [] #To Scan How Much Processing Tasks for process in f.Win32_Process(): l.append(process.ProcessId) # gives an object with many fields ram1 = psutil.virtual_memory() print("Scanning Ram : \n") progress(ram1) print() # you can convert that object to a dictionary dict(psutil.virtual_memory()._asdict()) # you can have the percentage of used RAM ram = psutil.virtual_memory().percent #You Can Have The Available Ram avram = psutil.virtual_memory().available * 100 / psutil.virtual_memory().total print(f"Hold On We've Found {len(l)} Running Process !! \n") print(f"Those Processes Only Left For You "+"{:.1f}".format(avram)+"%"+" available Of Your RAM !!\n") print(f"The Used ram is : {ram}%\n") print("We Will Load Your Running Processes Please Wait \n") progress(l) print() print("ID: Process name:\n") for process in f.Win32_Process(): print(f"{process.ProcessId:<10} {process.Name}") print(f"\nThe Number Of Actively Running Tasks {len(l)} \n") input()
StarcoderdataPython
3241316
# -*- coding: utf-8 -*- '''Chemical Engineering Design Library (ChEDL). Utilities for process modeling. Copyright (C) 2017, <NAME> <<EMAIL>> Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions: The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software. THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.''' import os import pytest from fluids.numerics import assert_close, assert_close1d from thermo.joback import * from thermo.joback import J_BIGGS_JOBACK_SMARTS_id_dict from chemicals.identifiers import pubchem_db folder = os.path.join(os.path.dirname(__file__), 'Data') try: import rdkit from rdkit import Chem except: rdkit = None @pytest.mark.rdkit @pytest.mark.skipif(rdkit is None, reason="requires rdkit") def test_Joback_acetone(): from rdkit import Chem from rdkit.Chem import Descriptors from rdkit.Chem import AllChem from rdkit.Chem import rdMolDescriptors for i in [Chem.MolFromSmiles('CC(=O)C'), 'CC(=O)C']: ex = Joback(i) # Acetone example assert_close(ex.Tb(ex.counts), 322.11) assert_close(ex.Tm(ex.counts), 173.5) assert_close(ex.Tc(ex.counts), 500.5590049525365) assert_close(ex.Tc(ex.counts, 322.11), 500.5590049525365) assert_close(ex.Pc(ex.counts, ex.atom_count), 4802499.604994407) assert_close(ex.Vc(ex.counts), 0.0002095) assert_close(ex.Hf(ex.counts), -217830) assert_close(ex.Gf(ex.counts), -154540) assert_close(ex.Hfus(ex.counts), 5125) assert_close(ex.Hvap(ex.counts), 29018) assert_close1d(ex.Cpig_coeffs(ex.counts),[7.52, 0.26084, -0.0001207, 1.546e-08] ) assert_close(ex.Cpig(300.0), 75.32642000000001) assert_close1d(ex.mul_coeffs(ex.counts), [839.11, -14.99]) assert_close(ex.mul(300.0), 0.0002940378347162687) with pytest.raises(ValueError): # Raise an error if there are no groups matched obj = Joback('[Fe]') obj.estimate() # Test we can handle missing groups nitrobenzene = 'C1=CC=C(C=C1)[N+](=O)[O-]' obj = Joback(nitrobenzene) res = obj.estimate() assert res['mul_coeffs'] is None @pytest.mark.fuzz @pytest.mark.slow @pytest.mark.rdkit @pytest.mark.skipif(rdkit is None, reason="requires rdkit") def test_Joback_database(): pubchem_db.autoload_main_db() f = open(os.path.join(folder, 'joback_log.txt'), 'w') from rdkit import Chem catalog = unifac_smarts = {i: Chem.MolFromSmarts(j) for i, j in J_BIGGS_JOBACK_SMARTS_id_dict.items()} lines = [] for key in sorted(pubchem_db.CAS_index): chem_info = pubchem_db.CAS_index[key] try: mol = Chem.MolFromSmiles(chem_info.smiles) parsed = smarts_fragment(rdkitmol=mol, catalog=catalog, deduplicate=False) line = '%s\t%s\t%s\t%s\n' %(parsed[2], chem_info.CASs, chem_info.smiles, parsed[0]) except Exception as e: line = '%s\t%s\t%s\n' %(chem_info.CASs, chem_info.smiles, e) lines.append(line) [f.write(line) for line in sorted(lines)] f.close() # Maybe use this again if more work is done on Joback del test_Joback_database
StarcoderdataPython
1743027
<filename>st2common/st2common/models/db/sensor.py # Licensed to the StackStorm, Inc ('StackStorm') under one or more # contributor license agreements. See the NOTICE file distributed with # this work for additional information regarding copyright ownership. # The ASF licenses this file to You under the Apache License, Version 2.0 # (the "License"); you may not use this file except in compliance with # the License. You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. import mongoengine as me from st2common.models.db import MongoDBAccess from st2common.models.db import stormbase from st2common.constants.types import ResourceType __all__ = [ 'SensorTypeDB' ] class SensorTypeDB(stormbase.StormBaseDB, stormbase.ContentPackResourceMixin, stormbase.UIDFieldMixin): """ Description of a specific type of a sensor (think of it as a sensor template). Attribute: pack - Name of the content pack this sensor belongs to. artifact_uri - URI to the artifact file. entry_point - Full path to the sensor entry point (e.g. module.foo.ClassSensor). trigger_type - A list of references to the TriggerTypeDB objects exposed by this sensor. poll_interval - Poll interval for this sensor. """ RESOURCE_TYPE = ResourceType.SENSOR_TYPE UID_FIELDS = ['pack', 'name'] name = me.StringField(required=True) pack = me.StringField(required=True, unique_with='name') artifact_uri = me.StringField() entry_point = me.StringField() trigger_types = me.ListField(field=me.StringField()) poll_interval = me.IntField() enabled = me.BooleanField(default=True, help_text=u'Flag indicating whether the sensor is enabled.') meta = { 'indexes': stormbase.UIDFieldMixin.get_indexes() } def __init__(self, *args, **values): super(SensorTypeDB, self).__init__(*args, **values) self.ref = self.get_reference().ref self.uid = self.get_uid() sensor_type_access = MongoDBAccess(SensorTypeDB) MODELS = [SensorTypeDB]
StarcoderdataPython
1636519
#!/usr/bin/env python3 # -*- coding:utf8 -*- import PyQt5,sys,traceback from PyQt5.QtGui import * from PyQt5.QtWidgets import * from PyQt5.QtCore import * from tkinter import Tk from tkinter.messagebox import showinfo import RC_tray import os,sys from googletrans import Translator def showbug(message): Tk().withdraw() info = showinfo('提示信息',str(message)) version = "1.0.2" log = "1.0.2 2018年4月16日 仅使用translate.google.cn服务器" class Form(QDialog): def __init__(self,parent=None): super(Form,self).__init__(parent) self.createTrayIcon() self.trayIcon.show() self.processing = False msgIcon = QSystemTrayIcon.MessageIcon(QSystemTrayIcon.Information) self.trayIcon.showMessage("Coursera 字幕中文翻译助手","请复制字幕文件(txt格式)到剪贴板并直接点击图标即可翻译。",msgIcon) # self.trayIcon.messageClicked.connect(self.traymesageClicked) self.setWindowTitle("Coursera字幕中文翻译助手") def createTrayIcon(self): self.trayMenu = QMenu() trans = self.trayMenu.addAction("处理剪贴板中的文件") trans.triggered.connect(self.transProcess) self.trayMenu.addSeparator() about = self.trayMenu.addAction("使用说明") about.triggered.connect(self.aboutBox) self.trayMenu.addSeparator() quit = self.trayMenu.addAction("退出") quit.triggered.connect(self.fullClose) self.trayIcon = QSystemTrayIcon(self) self.trayIcon.setIcon(QIcon(":/Main/Media/normal.png")) self.trayIcon.setContextMenu(self.trayMenu) self.trayIcon.activated.connect(self.iconActived) self.trayIcon.setToolTip("Coursera 字幕中文翻译助手") def fullClose(self): self.trayIcon.hide() app.setQuitOnLastWindowClosed(True) self.close() def showMenu(self): self.trayMenu.exec_() def iconActived(self,reason): mouse = QCursor() if self.processing: return 0 if reason == QSystemTrayIcon.DoubleClick: self.trayMenu.exec_(mouse.pos()) if reason == QSystemTrayIcon.Trigger: self.transProcess() def transProcess(self): clipboard = QGuiApplication.clipboard() if str(clipboard.text()).startswith("file:///"): if not str(clipboard.text()).endswith(".txt"): self.showInfo("剪贴板文件并非TXT格式文本。") return 0 else: self.uri = clipboard.text()[8:] print(self.uri) if self.processing == False: self.processing = True self.changeIcon() self.transGo(self.uri) self.processing = False self.changeIcon() else: self.showInfo("没有文件需要处理,请复制文本文件到剪贴板。") def changeIcon(self): if self.processing: self.trayIcon.setIcon(QIcon(":/Main/Media/working.png")) self.trayIcon.setToolTip("Coursera 字幕中文翻译助手 - 正在翻译中") else: self.trayIcon.setIcon(QIcon(":/Main/Media/normal.png")) self.trayIcon.setToolTip("Coursera 字幕中文翻译助手") def transIt_free(self,f): translator = Translator(service_urls=[ 'translate.google.cn' ]) translations = translator.translate(f,dest="zh-CN",src="en") r = [] for t in translations: r.append(t.text) return r def transGo(self,uri): try: print("START...") file = open(uri,"r",encoding="utf-8",errors="ignore") f = file.read() f= f.replace("\n"," ") f = f.replace("?","?\n").replace(".",".\n") f = f.split("\n") data = self.transIt_free(f) of = "" for x in data: of += x of = of.replace("?","?\n").replace("。","。\n") open(uri,"a+",encoding="utf-8",errors="ignore").write("\n\n\n"+of) en_list = f cn_list = [] for x in of.split("\n"): cn_list.append(x) out = "" i = 0 for en in en_list: link = str(i) + en + "\n" + cn_list[i] + "\n\n" i = i + 1 out += link open(uri,"a+",encoding="utf-8",errors="ignore").write("\n\n\n"+out) print("DONE!") try: os.startfile(self.uri) except Exception as e2: self.showInfo("翻译完毕,但是无法打开目标文件。"+str(e2)) except Exception as e: self.showInfo("翻译出错,可能是文件格式错误或者连接故障。"+str(e)) print(traceback.format_exc()) def showInfo(self,info): msgIcon = QSystemTrayIcon.MessageIcon(QSystemTrayIcon.Information) self.trayIcon.showMessage("Coursera 字幕中文翻译助手",info,msgIcon) def aboutBox(self): msg = QMessageBox() msg.information(self,"关于本程序","Coursera 字幕中文翻译助手 %s\nWriten by Corkine Ma\n\n本程序基于PyQt5和googletrans包。\n\n将txt格式字幕文件复制到剪贴板,点击托盘图标会调用Google翻译API,将其余语言翻译为中文,文件会被自动写入,使用默认打开方式自动打开。当程序正在运行时,变为红色,此时正在连接服务器并进行翻译,当完毕后图标变为蓝色。\n"%version) if __name__ == "__main__": app = QApplication(sys.argv) app.setQuitOnLastWindowClosed(False) app.setWindowIcon(QIcon(":/Main/Media/normal.png")) if QSystemTrayIcon.isSystemTrayAvailable() != True: showbug("系统不支持托盘图标") form = Form() app.exec_()
StarcoderdataPython
4820324
<gh_stars>1-10 import setuptools with open("asent/about.py") as f: v = f.read() for l in v.split("\n"): if l.startswith("__version__"): __version__ = l.split('"')[-2] with open("README.md", "r") as f: long_description = f.read() setuptools.setup(version=__version__)
StarcoderdataPython
1709366
import tensorflow as tf import numpy as np import tensorflow_datasets as tfds (ds_train, ds_test), ds_info = tfds.load('HorsesOrHumans', split=['train', 'test'], with_info=True, as_supervised=True, shuffle_files=True) def normalize_img(image, label): """Normalizes images: `uint8` -> `float32`.""" return tf.cast(image, tf.float32) / 255., label ds_train = ds_train.map( normalize_img, num_parallel_calls=tf.data.experimental.AUTOTUNE) ds_train = ds_train.cache() ds_train = ds_train.shuffle(ds_info.splits['train'].num_examples) ds_train = ds_train.batch(128) ds_train = ds_train.prefetch(tf.data.experimental.AUTOTUNE) ds_test = ds_test.map( normalize_img, num_parallel_calls=tf.data.experimental.AUTOTUNE) ds_test = ds_test.cache() ds_test = ds_test.batch(128) ds_test = ds_test.prefetch(tf.data.experimental.AUTOTUNE) !rm -rf logs logdir = "logs/scalars/" tensorboard_callback = tf.keras.callbacks.TensorBoard(log_dir=logdir) model = tf.keras.models.Sequential([ tf.keras.layers.Conv2D(16, (3,3), activation='relu', input_shape=(300,300,3)), tf.keras.layers.MaxPool2D(2,2), tf.keras.layers.Conv2D(32, (3,3), activation='relu'), tf.keras.layers.MaxPool2D(2,2), tf.keras.layers.Conv2D(64, (3,3), activation='relu'), tf.keras.layers.MaxPool2D(2,2), tf.keras.layers.Conv2D(64, (3,3), activation='relu'), tf.keras.layers.MaxPool2D(2,2), tf.keras.layers.Conv2D(64, (3,3), activation='relu'), tf.keras.layers.MaxPool2D(2,2), tf.keras.layers.Flatten(), tf.keras.layers.Dense(512, activation='relu'), tf.keras.layers.Dense(1, activation='sigmoid') ]) model.compile(loss='binary_crossentropy', optimizer=tf.keras.optimizers.Adam(lr=1e-3), metrics=['accuracy']) model.fit( ds_train, epochs = 15, callbacks=[tensorboard_callback] )
StarcoderdataPython
134379
import sys import os import asyncio import dscframework import json import keras from keras.models import load_model from data import build_dataset import numpy as np version = 1 os.environ["TF_CPP_MIN_LOG_LEVEL"] = "2" model = load_model(("export/mdl_v%d.h5")%(version)) async def on_facedetect(head, data): print("got sub data", flush=True) print(json.dumps(head), flush=True) print(data, flush=True) # Batch predict #X, y = build_dataset() #batch = np.asarray([X[0]]) #result = model.predict(batch, batch_size=1, verbose=1) #print(result) #print(y[0]) async def on_connect(cli): await cli.subscribe("facebuffer", on_facedetect) async def main(): cli = dscframework.Client("ws://localhost:8080") await cli.start(on_connect) if __name__ == "__main__": loop = asyncio.get_event_loop() loop.run_until_complete(main())
StarcoderdataPython
3265259
<filename>data/data.py import numpy as np from functools import partial from paddle.io import DataLoader from paddlenlp.data import Vocab, Pad, Stack from paddlenlp.datasets import load_dataset from .sampler import DistributedDynamicBatchSampler def read(src_path, tgt_path, is_test=False, has_target=False): if is_test and not has_target: with open(src_path, 'r', encoding='utf-8') as src_f: for sample_id, src_line in enumerate(src_f.readlines()): src_line = src_line.strip() if not src_line: continue yield {'id': sample_id, 'src': src_line, 'tgt': ''} else: with open(src_path, 'r', encoding='utf-8') as src_f, open(tgt_path, 'r', encoding='utf-8') as tgt_f: for sample_id, (src_line, tgt_line) in enumerate(zip(src_f.readlines(), tgt_f.readlines())): src_line, tgt_line = src_line.strip(), tgt_line.strip() if not src_line or not tgt_line: continue yield {'id': sample_id, 'src': src_line, 'tgt': tgt_line} def merge_pref_lang(pref, lang): return f"{pref.strip()}.{lang.strip()}" def prep_dataset(conf, mode='train'): assert mode in ['train', 'dev', 'test'] data_args = conf.data src_lang = data_args.src_lang tgt_lang = data_args.tgt_lang if mode == 'train': src_path = merge_pref_lang(data_args.train_pref, src_lang) tgt_path = merge_pref_lang(data_args.train_pref, tgt_lang) elif mode == 'dev': src_path = merge_pref_lang(data_args.valid_pref, src_lang) tgt_path = merge_pref_lang(data_args.valid_pref, tgt_lang) else: src_path = merge_pref_lang(data_args.test_pref, src_lang) tgt_path = merge_pref_lang(data_args.test_pref, tgt_lang) dataset = load_dataset(read, src_path=src_path, tgt_path=tgt_path, is_test=(mode == 'test'), has_target=conf.data.has_target,lazy=False) return dataset def prep_vocab(conf): data_args = conf.data src_vocab_fpath = merge_pref_lang(data_args.vocab_pref, data_args.src_lang) tgt_vocab_fpath = merge_pref_lang(data_args.vocab_pref, data_args.tgt_lang) src_vocab = Vocab.load_vocabulary( src_vocab_fpath, bos_token=data_args.special_token[0], pad_token=data_args.special_token[1], eos_token=data_args.special_token[2], unk_token=data_args.special_token[3] ) tgt_vocab = Vocab.load_vocabulary( tgt_vocab_fpath, bos_token=data_args.special_token[0], pad_token=data_args.special_token[1], eos_token=data_args.special_token[2], unk_token=data_args.special_token[3] ) # 是否把vocab词数pad到factor倍数,可以加速训练 conf.defrost() if data_args.pad_vocab: padding_vocab = ( lambda x: (x + data_args.pad_factor - 1) // data_args.pad_factor * data_args.pad_factor ) conf.model.src_vocab_size = padding_vocab(len(src_vocab)) conf.model.tgt_vocab_size = padding_vocab(len(tgt_vocab)) else: conf.model.src_vocab_size = len(src_vocab) conf.model.tgt_vocab_size = len(tgt_vocab) conf.freeze() return src_vocab, tgt_vocab def convert_samples(sample, src_vocab, tgt_vocab): sample_id = sample['id'] source = sample['src'].split() target = sample['tgt'].split() source = src_vocab.to_indices(source) target = tgt_vocab.to_indices(target) return source, target, sample_id # 过滤掉长度 ≤min_len或者≥max_len 的数据 def min_max_filer(data, max_len, min_len=0): data_min_len = min(len(data[0]), len(data[1])) + 1 data_max_len = max(len(data[0]), len(data[1])) + 1 return (data_min_len >= min_len) and (data_max_len <= max_len) def batchify(insts, bos_idx, eos_idx, pad_idx, is_test=False, has_target=False): """ Put all padded data needed by training into a list. # insts是含batch个元素的list,每个batch含src和tgt,和id元素[([],[]),([],[]),...] """ # ★sort by descending source length neg_src_len = list(map(lambda inst: -len(inst[0]), insts)) sorted_src_idx = np.argsort(neg_src_len, kind='mergsort') # 不能用[::-1],假设在长度全相等时,会从1-n变成n-1;且默认quicksort不稳定 insts = np.array(insts)[sorted_src_idx].tolist() # pad data to full sentence length left_pad = Pad(pad_idx, pad_right=False) right_pad = Pad(pad_idx, pad_right=True, dtype='int64') src_word = left_pad([inst[0] + [eos_idx] for inst in insts]) # src+</s> samples_id = Stack()([inst[2] for inst in insts]) if not is_test: prev_word = right_pad([[bos_idx] + inst[1] for inst in insts]) # <s>+tgt tgt_word = np.expand_dims(right_pad([inst[1] + [eos_idx] for inst in insts]), axis=2) # lbl+</s> # pad时候加了bos或eos,导致size突变,*bsz倍 data_inputs = [samples_id, src_word, prev_word, tgt_word] else: if not has_target: data_inputs = [samples_id, src_word] else: tgt_word = right_pad([inst[0] for inst in insts]) data_inputs = [samples_id, src_word, tgt_word] return data_inputs def prep_loader(conf, dataset, mode='train', multi_process=False): assert mode in ['train', 'dev', 'test'] data_args, model_args, strategy_args, train_args, gen_args = conf.data, conf.model, conf.learning_strategy, conf.train, conf.generate # load vocab src_vocab, tgt_vocab = prep_vocab(conf) # dataset trans_fn = partial(convert_samples, src_vocab=src_vocab, tgt_vocab=tgt_vocab) dataset = dataset.map(trans_fn, lazy=False) if mode != 'test': filt_fn = partial(min_max_filer, max_len=model_args.max_length) dataset = dataset.filter(filt_fn) batchify_fn = partial(batchify, bos_idx=model_args.eos_idx, eos_idx=model_args.eos_idx, pad_idx=model_args.pad_idx, is_test=mode == 'test', has_target=data_args.has_target) # samplerv2 max_tokens = train_args.max_tokens if mode != 'test' else gen_args.max_tokens max_sentences = train_args.max_sentences if mode != 'test' else gen_args.max_sentences batch_sampler = DistributedDynamicBatchSampler(dataset, mode=mode, has_target=data_args.has_target, max_tokens=max_tokens, max_sentences=eval(str(max_sentences)), bsz_factor=train_args.batch_size_factor, seed=conf.seed, num_replicas=None if multi_process == True else 1, rank=None if multi_process == True else 0, drop_last=False) if conf.train.resume and mode == 'train': # resume应该bool,路径由init来决定 batch_sampler.set_epoch(conf.train.last_epoch + 1) print(f"----- Resume Training: set sampler's epoch to {conf.train.last_epoch + 1} as a random seed") # dataloader dataloader = DataLoader( dataset=dataset, batch_sampler=batch_sampler, collate_fn=batchify_fn, num_workers=train_args.num_workers, ) return dataloader
StarcoderdataPython
1761213
<reponame>wckdouglas/tgirt-dna-seq<gh_stars>1-10 #!/bin/env python import argparse import subprocess import os import sys def getOpt(): parser = argparse.ArgumentParser(description='Pipeline for trimming, mapping paired end plasma DNA') parser.add_argument('-1','--fq1',required=True, help='read1 fastqfile [string]') parser.add_argument('-o','--outdir',required=True, help='output directory') parser.add_argument('-x','--index',required=True, help='bwa index or hisat2 index') parser.add_argument('-a','--adaptor', default='adaptor.fa', help='Fasta file containing adaptor sequneces (default: adaptor.fa)') parser.add_argument('-t','--threads',default=1, type=int, help='Threads to be used (default=: 1)') args = parser.parse_args() return args # running in shell def runProcess(command, samplename): sys.stderr.write('[%s] %s\n' %(samplename, command)) result = subprocess.call('time ' + command, shell=True) return 0 #Trimming def trimming(fq1, threads, trim_path, samplename, adaptor): sys.stderr.write('Running trim process with %s\n' %samplename) ## ILLUMINACLIP:<fastaWithAdaptersEtc>:<seed mismatches>:<palindrome clip ## threshold>:<simple clip threshold>:<minAdapterLength>:<keepBothReads> options='ILLUMINACLIP:%s:2:10:10:1:true ' %(adaptor) +\ 'LEADING:15 TRAILING:15 SLIDINGWINDOW:4:15 MINLEN:25' command = 'time trimmomatic ' +\ 'PE -threads %i ' %(threads)+\ '-phred33 '+\ '-basein %s ' %(fq1) + \ '-baseout %s/%s.fq.gz ' %(trim_path, samplename) + \ options runProcess(command,samplename) return 0 #MAPPING def mapping(samplename, trim_path, index, threads, bam_path): sys.stderr.write('Running mapping with %s\n' %samplename) file1 = trim_path + '/' + samplename + '_1P.fq.gz' file2 = file1.replace('1P','2P') bam_file = '%s/%s.bam' %(bam_path, samplename) command = 'bwa mem -t%i ' %(threads)+\ '%s %s %s ' %(index, file1, file2 ) +\ '| samtools sort -@ %i -O bam -T %s ' %(threads, bam_file.replace('.bam','')) +\ '> %s' %bam_file runProcess(command, samplename) return bam_file def makedir(directory): if not os.path.isdir(directory): os.mkdir(directory) sys.stderr.write('Make directory %s\n' %directory) return 0 def main(args): fq1 = args.fq1 outdir = args.outdir index = args.index adaptor = args.adaptor threads = args.threads # set up variables suffix = '.'.join(fq1.split('.')[-2:]) if fq1.split('.')[-1] == 'gz' else fq1.split('.')[-1] samplename = os.path.basename(fq1).replace('_R1_001','').split('.')[0] #makedir trim_path= outdir + '/trimmedFiles' bam_path= outdir + '/bamFiles' map(makedir,[trim_path, bam_path]) #trim trim = trimming(fq1, threads, trim_path, samplename, adaptor) #map bam_file = mapping(samplename, trim_path, index, threads, bam_path) sys.stderr.write('Finished mapping %s\n' %samplename) return 0 if __name__ == '__main__': args = getOpt() main(args)
StarcoderdataPython
8026
# last edited: 10/08/2017, 10:25 import os, sys, glob, subprocess from datetime import datetime from PyQt4 import QtGui, QtCore import math #from XChemUtils import mtztools import XChemDB import XChemRefine import XChemUtils import XChemLog import XChemToolTips import csv try: import gemmi import pandas except ImportError: pass #def get_names_of_current_clusters(xce_logfile,panddas_directory): # Logfile=XChemLog.updateLog(xce_logfile) # Logfile.insert('parsing {0!s}/cluster_analysis'.format(panddas_directory)) # os.chdir('{0!s}/cluster_analysis'.format(panddas_directory)) # cluster_dict={} # for out_dir in sorted(glob.glob('*')): # if os.path.isdir(out_dir): # cluster_dict[out_dir]=[] # found_first_pdb=False # for folder in glob.glob(os.path.join(out_dir,'pdbs','*')): # xtal=folder[folder.rfind('/')+1:] # if not found_first_pdb: # if os.path.isfile(os.path.join(panddas_directory,'cluster_analysis',out_dir,'pdbs',xtal,xtal+'.pdb') ): # cluster_dict[out_dir].append(os.path.join(panddas_directory,'cluster_analysis',out_dir,'pdbs',xtal,xtal+'.pdb')) # found_first_pdb=True # cluster_dict[out_dir].append(xtal) # return cluster_dict class export_and_refine_ligand_bound_models(QtCore.QThread): def __init__(self,PanDDA_directory,datasource,project_directory,xce_logfile,which_models): QtCore.QThread.__init__(self) self.PanDDA_directory = PanDDA_directory self.datasource = datasource self.db = XChemDB.data_source(self.datasource) self.Logfile = XChemLog.updateLog(xce_logfile) self.xce_logfile = xce_logfile self.project_directory = project_directory self.which_models=which_models self.external_software=XChemUtils.external_software(xce_logfile).check() # self.initial_model_directory=initial_model_directory # self.db.create_missing_columns() # self.db_list=self.db.get_empty_db_dict() # self.external_software=XChemUtils.external_software(xce_logfile).check() # self.xce_logfile=xce_logfile # self.already_exported_models=[] def run(self): self.Logfile.warning(XChemToolTips.pandda_export_ligand_bound_models_only_disclaimer()) # find all folders with *-pandda-model.pdb modelsDict = self.find_modeled_structures_and_timestamps() # if only NEW models shall be exported, check timestamps if not self.which_models.startswith('all'): modelsDict = self.find_new_models(modelsDict) # find pandda_inspect_events.csv and read in as pandas dataframe inspect_csv = None if os.path.isfile(os.path.join(self.PanDDA_directory,'analyses','pandda_inspect_events.csv')): inspect_csv = pandas.read_csv(os.path.join(self.PanDDA_directory,'analyses','pandda_inspect_events.csv')) progress = 0 try: progress_step = float(1/len(modelsDict)) except TypeError: self.Logfile.error('DID NOT FIND ANY MODELS TO EXPORT') return None for xtal in sorted(modelsDict): os.chdir(os.path.join(self.PanDDA_directory,'processed_datasets',xtal)) pandda_model = os.path.join('modelled_structures',xtal + '-pandda-model.pdb') pdb = gemmi.read_structure(pandda_model) # find out ligand event map relationship ligandDict = XChemUtils.pdbtools_gemmi(pandda_model).center_of_mass_ligand_dict('LIG') if ligandDict == {}: self.Logfile.error(xtal + ': cannot find ligand of type LIG; skipping...') continue self.show_ligands_in_model(xtal,ligandDict) emapLigandDict = self.find_ligands_matching_event_map(inspect_csv,xtal,ligandDict) self.Logfile.warning('emapLigandDict' + str(emapLigandDict)) # convert event map to SF self.event_map_to_sf(pdb.resolution,emapLigandDict) # move existing event maps in project directory to old folder self.move_old_event_to_backup_folder(xtal) # copy event MTZ to project directory self.copy_event_mtz_to_project_directory(xtal) # copy pandda-model to project directory self.copy_pandda_model_to_project_directory(xtal) # make map from MTZ and cut around ligand self.make_and_cut_map(xtal,emapLigandDict) # update database self.update_database(xtal,modelsDict) # refine models self.refine_exported_model(xtal) progress += progress_step self.emit(QtCore.SIGNAL('update_progress_bar'), progress) def update_database(self,xtal,modelsDict): db_dict = {} timestamp_file = modelsDict[xtal] db_dict['DatePanDDAModelCreated'] = timestamp_file db_dict['RefinementOutcome'] = '3 - In Refinement' self.Logfile.insert('updating database for '+xtal+' setting time model was created to '+db_dict['DatePanDDAModelCreated']) self.db.update_data_source(xtal,db_dict) def make_and_cut_map(self,xtal,emapLigandDict): self.Logfile.insert('changing directory to ' + os.path.join(self.project_directory,xtal)) os.chdir(os.path.join(self.project_directory,xtal)) XChemUtils.pdbtools_gemmi(xtal + '-pandda-model.pdb').save_ligands_to_pdb('LIG') for ligID in emapLigandDict: m = emapLigandDict[ligID] emtz = m.replace('.ccp4','_' + ligID + '.mtz') emap = m.replace('.ccp4','_' + ligID + '.ccp4') XChemUtils.maptools().calculate_map(emtz,'FWT','PHWT') XChemUtils.maptools().cut_map_around_ligand(emap,ligID+'.pdb','7') if os.path.isfile(emap.replace('.ccp4','_mapmask.ccp4')): os.system('/bin/mv %s %s_%s_event.ccp4' %(emap.replace('.ccp4','_mapmask.ccp4'),xtal,ligID)) os.system('ln -s %s_%s_event.ccp4 %s_%s_event_cut.ccp4' %(xtal,ligID,xtal,ligID)) def copy_pandda_model_to_project_directory(self,xtal): os.chdir(os.path.join(self.project_directory,xtal)) model = os.path.join(self.PanDDA_directory,'processed_datasets',xtal,'modelled_structures',xtal+'-pandda-model.pdb') self.Logfile.insert('copying %s to project directory' %model) os.system('/bin/cp %s .' %model) def copy_event_mtz_to_project_directory(self,xtal): self.Logfile.insert('changing directory to ' + os.path.join(self.PanDDA_directory,'processed_datasets',xtal)) os.chdir(os.path.join(self.PanDDA_directory,'processed_datasets',xtal)) for emap in glob.glob('*-BDC_*.mtz'): self.Logfile.insert('copying %s to %s...' %(emap,os.path.join(self.project_directory,xtal))) os.system('/bin/cp %s %s' %(emap,os.path.join(self.project_directory,xtal))) def move_old_event_to_backup_folder(self,xtal): self.Logfile.insert('changing directory to ' + os.path.join(self.project_directory,xtal)) os.chdir(os.path.join(self.project_directory,xtal)) if not os.path.isdir('event_map_backup'): os.mkdir('event_map_backup') self.Logfile.insert('moving existing event maps to event_map_backup') for emap in glob.glob('*-BDC_*.ccp4'): os.system('/bin/mv %s event_map_backup/%s' %(emap,emap+'.'+str(datetime.now()).replace(' ','_').replace(':','-'))) def show_ligands_in_model(self,xtal,ligandDict): self.Logfile.insert(xtal + ': found the following ligands...') for lig in ligandDict: self.Logfile.insert(lig + ' -> coordinates ' + str(ligandDict[lig])) def find_modeled_structures_and_timestamps(self): self.Logfile.insert('finding out modelled structures in ' + self.PanDDA_directory) modelsDict={} for model in sorted(glob.glob(os.path.join(self.PanDDA_directory,'processed_datasets','*','modelled_structures','*-pandda-model.pdb'))): sample=model[model.rfind('/')+1:].replace('-pandda-model.pdb','') timestamp=datetime.fromtimestamp(os.path.getmtime(model)).strftime('%Y-%m-%d %H:%M:%S') self.Logfile.insert(sample+'-pandda-model.pdb was created on '+str(timestamp)) modelsDict[sample]=timestamp return modelsDict def find_new_models(self,modelsDict): samples_to_export = {} self.Logfile.hint('XCE will never export/ refine models that are "5-deposition ready" or "6-deposited"') self.Logfile.hint('Please change the RefinementOutcome flag in the Refinement table if you wish to re-export them') self.Logfile.insert('checking timestamps of models in database...') for xtal in modelsDict: timestamp_file = modelsDict[xtal] db_query=self.db.execute_statement("select DatePanDDAModelCreated from mainTable where CrystalName is '"+xtal+"' and (RefinementOutcome like '3%' or RefinementOutcome like '4%')") try: timestamp_db=str(db_query[0][0]) except IndexError: self.Logfile.warning('%s: database query gave no results for DatePanDDAModelCreated; skipping...' %xtal) self.Logfile.warning('%s: this might be a brand new model; will continue with export!' %xtal) samples_to_export[xtal]=timestamp_file timestamp_db = "2100-01-01 00:00:00" # some time in the future... try: difference=(datetime.strptime(timestamp_file,'%Y-%m-%d %H:%M:%S') - datetime.strptime(timestamp_db,'%Y-%m-%d %H:%M:%S') ) if difference.seconds != 0: self.Logfile.insert('exporting '+xtal+' -> was already refined, but newer PanDDA model available') samples_to_export[xtal]=timestamp_file else: self.Logfile.insert('%s: model has not changed since it was created on %s' %(xtal,timestamp_db)) except (ValueError, IndexError), e: self.Logfile.error(str(e)) return samples_to_export def event_map_to_sf(self,resolution,emapLigandDict): for lig in emapLigandDict: emap = emapLigandDict[lig] emtz = emap.replace('.ccp4','.mtz') emtz_ligand = emap.replace('.ccp4','_' + lig + '.mtz') self.Logfile.insert('trying to convert %s to SF -> %s' %(emap,emtz_ligand)) self.Logfile.insert('>>> ' + emtz) XChemUtils.maptools_gemmi(emap).map_to_sf(resolution) if os.path.isfile(emtz): os.system('/bin/mv %s %s' %(emtz,emtz_ligand)) self.Logfile.insert('success; %s exists' %emtz_ligand) else: self.Logfile.warning('something went wrong; %s could not be created...' %emtz_ligand) def find_ligands_matching_event_map(self,inspect_csv,xtal,ligandDict): emapLigandDict = {} for index, row in inspect_csv.iterrows(): if row['dtag'] == xtal: for emap in glob.glob('*-BDC_*.ccp4'): self.Logfile.insert('checking if event and ligand are within 7A of each other') x = float(row['x']) y = float(row['y']) z = float(row['z']) matching_ligand = self.calculate_distance_to_ligands(ligandDict,x,y,z) if matching_ligand is not None: emapLigandDict[matching_ligand] = emap self.Logfile.insert('found matching ligand (%s) for %s' %(matching_ligand,emap)) break else: self.Logfile.warning('current ligand not close to event...') if emapLigandDict == {}: self.Logfile.error('could not find ligands within 7A of PanDDA events') return emapLigandDict def calculate_distance_to_ligands(self,ligandDict,x,y,z): matching_ligand = None p_event = gemmi.Position(x, y, z) for ligand in ligandDict: c = ligandDict[ligand] p_ligand = gemmi.Position(c[0], c[1], c[2]) self.Logfile.insert('coordinates ligand: ' + str(c[0])+' '+ str(c[1])+' '+str(c[2])) self.Logfile.insert('coordinates event: ' + str(x)+' '+ str(y)+' '+str(z)) distance = p_event.dist(p_ligand) self.Logfile.insert('distance between ligand and event: %s A' %str(distance)) if distance < 7: matching_ligand = ligand break return matching_ligand def refine_exported_model(self,xtal): RefmacParams={ 'HKLIN': '', 'HKLOUT': '', 'XYZIN': '', 'XYZOUT': '', 'LIBIN': '', 'LIBOUT': '', 'TLSIN': '', 'TLSOUT': '', 'TLSADD': '', 'NCYCLES': '10', 'MATRIX_WEIGHT': 'AUTO', 'BREF': ' bref ISOT\n', 'TLS': '', 'NCS': '', 'TWIN': '', 'WATER': '', 'LIGOCC': '', 'SANITY': '' } if 'nocheck' in self.which_models: RefmacParams['SANITY'] = 'off' self.Logfile.insert('trying to refine ' + xtal + '...') self.Logfile.insert('%s: getting compound code from database' %xtal) query=self.db.execute_statement("select CompoundCode from mainTable where CrystalName='%s';" %xtal) compoundID=str(query[0][0]) self.Logfile.insert('%s: compounds code = %s' %(xtal,compoundID)) if os.path.isfile(os.path.join(self.project_directory,xtal,xtal+'.free.mtz')): if os.path.isfile(os.path.join(self.project_directory,xtal,xtal+'-pandda-model.pdb')): self.Logfile.insert('running inital refinement on PANDDA model of '+xtal) Serial=XChemRefine.GetSerial(self.project_directory,xtal) if not os.path.isdir(os.path.join(self.project_directory,xtal,'cootOut')): os.mkdir(os.path.join(self.project_directory,xtal,'cootOut')) # create folder for new refinement cycle if os.path.isdir(os.path.join(self.project_directory,xtal,'cootOut','Refine_'+str(Serial))): os.chdir(os.path.join(self.project_directory,xtal,'cootOut','Refine_'+str(Serial))) else: os.mkdir(os.path.join(self.project_directory,xtal,'cootOut','Refine_'+str(Serial))) os.chdir(os.path.join(self.project_directory,xtal,'cootOut','Refine_'+str(Serial))) os.system('/bin/cp %s in.pdb' %os.path.join(self.project_directory,xtal,xtal+'-pandda-model.pdb')) Refine=XChemRefine.Refine(self.project_directory,xtal,compoundID,self.datasource) Refine.RunBuster(str(Serial),RefmacParams,self.external_software,self.xce_logfile,None) else: self.Logfile.error('%s: cannot find %s-pandda-model.pdb; cannot start refinement...' %(xtal,xtal)) else: self.Logfile.error('%s: cannot start refinement because %s.free.mtz is missing in %s' % ( xtal, xtal, os.path.join(self.project_directory, xtal))) class refine_bound_state_with_buster(QtCore.QThread): def __init__(self,panddas_directory,datasource,initial_model_directory,xce_logfile,which_models): QtCore.QThread.__init__(self) self.panddas_directory=panddas_directory self.datasource=datasource self.initial_model_directory=initial_model_directory self.db=XChemDB.data_source(self.datasource) self.db.create_missing_columns() self.db_list=self.db.get_empty_db_dict() self.external_software=XChemUtils.external_software(xce_logfile).check() self.xce_logfile=xce_logfile self.Logfile=XChemLog.updateLog(xce_logfile) self.which_models=which_models self.already_exported_models=[] def run(self): samples_to_export=self.export_models() self.refine_exported_models(samples_to_export) def refine_exported_models(self,samples_to_export): self.Logfile.insert('will try to refine the following crystals:') for xtal in sorted(samples_to_export): self.Logfile.insert(xtal) for xtal in sorted(samples_to_export): self.Logfile.insert('%s: getting compound code from database' %xtal) query=self.db.execute_statement("select CompoundCode from mainTable where CrystalName='%s';" %xtal) compoundID=str(query[0][0]) self.Logfile.insert('%s: compounds code = %s' %(xtal,compoundID)) # compoundID=str(item[1]) if os.path.isfile(os.path.join(self.initial_model_directory,xtal,xtal+'.free.mtz')): if os.path.isfile(os.path.join(self.initial_model_directory,xtal,xtal+'-pandda-model.pdb')): self.Logfile.insert('running inital refinement on PANDDA model of '+xtal) Serial=XChemRefine.GetSerial(self.initial_model_directory,xtal) ####################################################### if not os.path.isdir(os.path.join(self.initial_model_directory,xtal,'cootOut')): os.mkdir(os.path.join(self.initial_model_directory,xtal,'cootOut')) # create folder for new refinement cycle if os.path.isdir(os.path.join(self.initial_model_directory,xtal,'cootOut','Refine_'+str(Serial))): os.chdir(os.path.join(self.initial_model_directory,xtal,'cootOut','Refine_'+str(Serial))) else: os.mkdir(os.path.join(self.initial_model_directory,xtal,'cootOut','Refine_'+str(Serial))) os.chdir(os.path.join(self.initial_model_directory,xtal,'cootOut','Refine_'+str(Serial))) os.system('/bin/cp %s in.pdb' %os.path.join(self.initial_model_directory,xtal,xtal+'-pandda-model.pdb')) Refine=XChemRefine.Refine(self.initial_model_directory,xtal,compoundID,self.datasource) Refine.RunBuster(str(Serial),self.external_software,self.xce_logfile,None) else: self.Logfile.error('%s: cannot find %s-pandda-model.pdb; cannot start refinement...' %(xtal,xtal)) elif xtal in samples_to_export and not os.path.isfile( os.path.join(self.initial_model_directory, xtal, xtal + '.free.mtz')): self.Logfile.error('%s: cannot start refinement because %s.free.mtz is missing in %s' % ( xtal, xtal, os.path.join(self.initial_model_directory, xtal))) else: self.Logfile.insert('%s: nothing to refine' % (xtal)) def export_models(self): self.Logfile.insert('finding out which PanDDA models need to be exported') # first find which samples are in interesting datasets and have a model # and determine the timestamp fileModelsDict={} queryModels='' for model in glob.glob(os.path.join(self.panddas_directory,'processed_datasets','*','modelled_structures','*-pandda-model.pdb')): sample=model[model.rfind('/')+1:].replace('-pandda-model.pdb','') timestamp=datetime.fromtimestamp(os.path.getmtime(model)).strftime('%Y-%m-%d %H:%M:%S') self.Logfile.insert(sample+'-pandda-model.pdb was created on '+str(timestamp)) queryModels+="'"+sample+"'," fileModelsDict[sample]=timestamp # now get these models from the database and compare the datestamps # Note: only get the models that underwent some form of refinement, # because only if the model was updated in pandda.inspect will it be exported and refined dbModelsDict={} if queryModels != '': dbEntries=self.db.execute_statement("select CrystalName,DatePanDDAModelCreated from mainTable where CrystalName in ("+queryModels[:-1]+") and (RefinementOutcome like '3%' or RefinementOutcome like '4%' or RefinementOutcome like '5%')") for item in dbEntries: xtal=str(item[0]) timestamp=str(item[1]) dbModelsDict[xtal]=timestamp self.Logfile.insert('PanDDA model for '+xtal+' is in database and was created on '+str(timestamp)) # compare timestamps and only export the ones where the timestamp of the file is newer than the one in the DB samples_to_export={} self.Logfile.insert('checking which PanDDA models were newly created or updated') if self.which_models=='all': self.Logfile.insert('Note: you chose to export ALL available PanDDA!') for sample in fileModelsDict: if self.which_models=='all': self.Logfile.insert('exporting '+sample) samples_to_export[sample]=fileModelsDict[sample] else: if sample in dbModelsDict: try: difference=(datetime.strptime(fileModelsDict[sample],'%Y-%m-%d %H:%M:%S') - datetime.strptime(dbModelsDict[sample],'%Y-%m-%d %H:%M:%S') ) if difference.seconds != 0: self.Logfile.insert('exporting '+sample+' -> was already refined, but newer PanDDA model available') samples_to_export[sample]=fileModelsDict[sample] except ValueError: # this will be raised if timestamp is not properly formatted; # which will usually be the case when respective field in database is blank # these are hopefully legacy cases which are from before this extensive check was introduced (13/01/2017) advice = ( 'The pandda model of '+xtal+' was changed, but it was already refined! ' 'This is most likely because this was done with an older version of XCE. ' 'If you really want to export and refine this model, you need to open the database ' 'with DBbroweser (sqlitebrowser.org); then change the RefinementOutcome field ' 'of the respective sample to "2 - PANDDA model", save the database and repeat the export prodedure.' ) self.Logfile.insert(advice) else: self.Logfile.insert('exporting '+sample+' -> first time to be exported and refined') samples_to_export[sample]=fileModelsDict[sample] # update the DB: # set timestamp to current timestamp of file and set RefinementOutcome to '2-pandda...' if samples_to_export != {}: select_dir_string='' select_dir_string_new_pannda=' ' for sample in samples_to_export: self.Logfile.insert('changing directory to ' + os.path.join(self.initial_model_directory,sample)) os.chdir(os.path.join(self.initial_model_directory,sample)) self.Logfile.insert(sample + ': copying ' + os.path.join(self.panddas_directory,'processed_datasets',sample,'modelled_structures',sample+'-pandda-model.pdb')) os.system('/bin/cp %s .' %os.path.join(self.panddas_directory,'processed_datasets',sample,'modelled_structures',sample+'-pandda-model.pdb')) db_dict= {'RefinementOutcome': '2 - PANDDA model', 'DatePanDDAModelCreated': samples_to_export[sample]} for old_event_map in glob.glob('*-BDC_*.ccp4'): if not os.path.isdir('old_event_maps'): os.mkdir('old_event_maps') self.Logfile.warning(sample + ': moving ' + old_event_map + ' to old_event_maps folder') os.system('/bin/mv %s old_event_maps' %old_event_map) for event_map in glob.glob(os.path.join(self.panddas_directory,'processed_datasets',sample,'*-BDC_*.ccp4')): self.Logfile.insert(sample + ': copying ' + event_map) os.system('/bin/cp %s .' %event_map) select_dir_string+="select_dir={0!s} ".format(sample) select_dir_string_new_pannda+='{0!s} '.format(sample) self.Logfile.insert('updating database for '+sample+' setting time model was created to '+db_dict['DatePanDDAModelCreated']+' and RefinementOutcome to '+db_dict['RefinementOutcome']) self.db.update_data_source(sample,db_dict) return samples_to_export class run_pandda_export(QtCore.QThread): def __init__(self,panddas_directory,datasource,initial_model_directory,xce_logfile,update_datasource_only,which_models,pandda_params): QtCore.QThread.__init__(self) self.panddas_directory=panddas_directory self.datasource=datasource self.initial_model_directory=initial_model_directory self.db=XChemDB.data_source(self.datasource) self.db.create_missing_columns() self.db_list=self.db.get_empty_db_dict() self.external_software=XChemUtils.external_software(xce_logfile).check() self.xce_logfile=xce_logfile self.Logfile=XChemLog.updateLog(xce_logfile) self.update_datasource_only=update_datasource_only self.which_models=which_models self.already_exported_models=[] self.pandda_analyse_data_table = pandda_params['pandda_table'] self.RefmacParams={ 'HKLIN': '', 'HKLOUT': '', 'XYZIN': '', 'XYZOUT': '', 'LIBIN': '', 'LIBOUT': '', 'TLSIN': '', 'TLSOUT': '', 'TLSADD': '', 'NCYCLES': '10', 'MATRIX_WEIGHT': 'AUTO', 'BREF': ' bref ISOT\n', 'TLS': '', 'NCS': '', 'TWIN': '' } def run(self): # v1.3.8.2 - removed option to update database only # if not self.update_datasource_only: samples_to_export=self.export_models() self.import_samples_into_datasouce(samples_to_export) # if not self.update_datasource_only: self.refine_exported_models(samples_to_export) def refine_exported_models(self,samples_to_export): self.Logfile.insert('will try to refine the following crystals:') for xtal in samples_to_export: self.Logfile.insert(xtal) # sample_list=self.db.execute_statement("select CrystalName,CompoundCode from mainTable where RefinementOutcome='2 - PANDDA model';") # for item in sample_list: # xtal=str(item[0]) for xtal in sorted(samples_to_export): self.Logfile.insert('%s: getting compound code from database' %xtal) query=self.db.execute_statement("select CompoundCode from mainTable where CrystalName='%s';" %xtal) compoundID=str(query[0][0]) self.Logfile.insert('%s: compounds code = %s' %(xtal,compoundID)) # compoundID=str(item[1]) if os.path.isfile(os.path.join(self.initial_model_directory,xtal,xtal+'.free.mtz')): if os.path.isfile(os.path.join(self.initial_model_directory,xtal,xtal+'-ensemble-model.pdb')): self.Logfile.insert('running inital refinement on PANDDA model of '+xtal) Serial=XChemRefine.GetSerial(self.initial_model_directory,xtal) ####################################################### if not os.path.isdir(os.path.join(self.initial_model_directory,xtal,'cootOut')): os.mkdir(os.path.join(self.initial_model_directory,xtal,'cootOut')) # create folder for new refinement cycle if os.path.isdir(os.path.join(self.initial_model_directory,xtal,'cootOut','Refine_'+str(Serial))): os.chdir(os.path.join(self.initial_model_directory,xtal,'cootOut','Refine_'+str(Serial))) try: os.system('/bin/rm *-ensemble-model.pdb *restraints*') except: self.Logfile.error("Restraint files didn't exist to remove. Will try to continue") else: os.mkdir(os.path.join(self.initial_model_directory,xtal,'cootOut','Refine_'+str(Serial))) os.chdir(os.path.join(self.initial_model_directory,xtal,'cootOut','Refine_'+str(Serial))) Refine=XChemRefine.panddaRefine(self.initial_model_directory,xtal,compoundID,self.datasource) os.symlink(os.path.join(self.initial_model_directory,xtal,xtal+'-ensemble-model.pdb'),xtal+'-ensemble-model.pdb') Refine.RunQuickRefine(Serial,self.RefmacParams,self.external_software,self.xce_logfile,'pandda_refmac',None) # elif xtal in os.path.join(self.panddas_directory,'processed_datasets',xtal,'modelled_structures', # '{}-pandda-model.pdb'.format(xtal)): # self.Logfile.insert('{}: cannot start refinement because {}'.format(xtal,xtal) + # ' does not have a modelled structure. Check whether you expect this dataset to ' + # ' have a modelled structure, compare pandda.inspect and datasource,' # ' then tell XCHEMBB ') else: self.Logfile.error('%s: cannot find %s-ensemble-model.pdb; cannot start refinement...' %(xtal,xtal)) self.Logfile.error('Please check terminal window for any PanDDA related tracebacks') elif xtal in samples_to_export and not os.path.isfile( os.path.join(self.initial_model_directory, xtal, xtal + '.free.mtz')): self.Logfile.error('%s: cannot start refinement because %s.free.mtz is missing in %s' % ( xtal, xtal, os.path.join(self.initial_model_directory, xtal))) else: self.Logfile.insert('%s: nothing to refine' % (xtal)) def import_samples_into_datasouce(self,samples_to_export): # first make a note of all the datasets which were used in pandda directory os.chdir(os.path.join(self.panddas_directory,'processed_datasets')) for xtal in glob.glob('*'): self.db.execute_statement("update mainTable set DimplePANDDAwasRun = 'True',DimplePANDDAreject = 'False',DimplePANDDApath='{0!s}' where CrystalName is '{1!s}'".format(self.panddas_directory, xtal)) # do the same as before, but look for rejected datasets try: os.chdir(os.path.join(self.panddas_directory,'rejected_datasets')) for xtal in glob.glob('*'): self.db.execute_statement("update mainTable set DimplePANDDAwasRun = 'True',DimplePANDDAreject = 'True',DimplePANDDApath='{0!s}',DimplePANDDAhit = 'False' where CrystalName is '{1!s}'".format(self.panddas_directory, xtal)) except OSError: pass site_list = [] pandda_hit_list=[] with open(os.path.join(self.panddas_directory,'analyses','pandda_inspect_sites.csv'),'rb') as csv_import: csv_dict = csv.DictReader(csv_import) self.Logfile.insert('reding pandda_inspect_sites.csv') for i,line in enumerate(csv_dict): self.Logfile.insert(str(line).replace('\n','').replace('\r','')) site_index=line['site_idx'] name=line['Name'].replace("'","") comment=line['Comment'] site_list.append([site_index,name,comment]) self.Logfile.insert('add to site_list_:' + str([site_index,name,comment])) progress_step=1 for i,line in enumerate(open(os.path.join(self.panddas_directory,'analyses','pandda_inspect_events.csv'))): n_lines=i if n_lines != 0: progress_step=100/float(n_lines) else: progress_step=0 progress=0 self.emit(QtCore.SIGNAL('update_progress_bar'), progress) self.Logfile.insert('reading '+os.path.join(self.panddas_directory,'analyses','pandda_inspect_events.csv')) with open(os.path.join(self.panddas_directory,'analyses','pandda_inspect_events.csv'),'rb') as csv_import: csv_dict = csv.DictReader(csv_import) for i,line in enumerate(csv_dict): db_dict={} sampleID=line['dtag'] if sampleID not in samples_to_export: self.Logfile.warning('%s: not to be exported; will not add to panddaTable...' %sampleID) continue if sampleID not in pandda_hit_list: pandda_hit_list.append(sampleID) site_index=str(line['site_idx']).replace('.0','') event_index=str(line['event_idx']).replace('.0','') self.Logfile.insert(str(line)) self.Logfile.insert('reading {0!s} -> site {1!s} -> event {2!s}'.format(sampleID, site_index, event_index)) for entry in site_list: if entry[0]==site_index: site_name=entry[1] site_comment=entry[2] break # check if EVENT map exists in project directory event_map='' for file in glob.glob(os.path.join(self.initial_model_directory,sampleID,'*ccp4')): filename=file[file.rfind('/')+1:] if filename.startswith(sampleID+'-event_'+event_index) and filename.endswith('map.native.ccp4'): event_map=file self.Logfile.insert('found respective event maps in {0!s}: {1!s}'.format(self.initial_model_directory, event_map)) break # initial pandda model and mtz file pandda_model='' for file in glob.glob(os.path.join(self.initial_model_directory,sampleID,'*pdb')): filename=file[file.rfind('/')+1:] if filename.endswith('-ensemble-model.pdb'): pandda_model=file if sampleID not in self.already_exported_models: self.already_exported_models.append(sampleID) break inital_mtz='' for file in glob.glob(os.path.join(self.initial_model_directory,sampleID,'*mtz')): filename=file[file.rfind('/')+1:] if filename.endswith('pandda-input.mtz'): inital_mtz=file break db_dict['CrystalName'] = sampleID db_dict['PANDDApath'] = self.panddas_directory db_dict['PANDDA_site_index'] = site_index db_dict['PANDDA_site_name'] = site_name db_dict['PANDDA_site_comment'] = site_comment db_dict['PANDDA_site_event_index'] = event_index db_dict['PANDDA_site_event_comment'] = line['Comment'].replace("'","") db_dict['PANDDA_site_confidence'] = line['Ligand Confidence'] db_dict['PANDDA_site_InspectConfidence'] = line['Ligand Confidence'] db_dict['PANDDA_site_ligand_placed'] = line['Ligand Placed'] db_dict['PANDDA_site_viewed'] = line['Viewed'] db_dict['PANDDA_site_interesting'] = line['Interesting'] db_dict['PANDDA_site_z_peak'] = line['z_peak'] db_dict['PANDDA_site_x'] = line['x'] db_dict['PANDDA_site_y'] = line['y'] db_dict['PANDDA_site_z'] = line['z'] db_dict['PANDDA_site_ligand_id'] = '' db_dict['PANDDA_site_event_map'] = event_map db_dict['PANDDA_site_initial_model'] = pandda_model db_dict['PANDDA_site_initial_mtz'] = inital_mtz db_dict['PANDDA_site_spider_plot'] = '' # find apo structures which were used # XXX missing XXX self.db.update_insert_site_event_panddaTable(sampleID,db_dict) # this is necessary, otherwise RefinementOutcome will be reset for samples that are actually already in refinement self.db.execute_statement("update panddaTable set RefinementOutcome = '2 - PANDDA model' where CrystalName is '{0!s}' and RefinementOutcome is null".format(sampleID)) self.db.execute_statement("update mainTable set RefinementOutcome = '2 - PANDDA model' where CrystalName is '{0!s}' and (RefinementOutcome is null or RefinementOutcome is '1 - Analysis Pending')".format(sampleID)) self.db.execute_statement("update mainTable set DimplePANDDAhit = 'True' where CrystalName is '{0!s}'".format(sampleID)) progress += progress_step self.emit(QtCore.SIGNAL('update_progress_bar'), progress) self.Logfile.insert('done reading pandda_inspect_sites.csv') # finally find all samples which do not have a pandda hit os.chdir(os.path.join(self.panddas_directory,'processed_datasets')) self.Logfile.insert('check which datasets are not interesting') # DimplePANDDAhit # for xtal in glob.glob('*'): # if xtal not in pandda_hit_list: # self.Logfile.insert(xtal+': not in interesting_datasets; updating database...') # self.db.execute_statement("update mainTable set DimplePANDDAhit = 'False' where CrystalName is '{0!s}'".format(xtal)) def export_models(self): self.Logfile.insert('finding out which PanDDA models need to be exported') # first find which samples are in interesting datasets and have a model # and determine the timestamp fileModelsDict={} queryModels='' for model in glob.glob(os.path.join(self.panddas_directory,'processed_datasets','*','modelled_structures','*-pandda-model.pdb')): sample=model[model.rfind('/')+1:].replace('-pandda-model.pdb','') timestamp=datetime.fromtimestamp(os.path.getmtime(model)).strftime('%Y-%m-%d %H:%M:%S') self.Logfile.insert(sample+'-pandda-model.pdb was created on '+str(timestamp)) queryModels+="'"+sample+"'," fileModelsDict[sample]=timestamp # now get these models from the database and compare the datestamps # Note: only get the models that underwent some form of refinement, # because only if the model was updated in pandda.inspect will it be exported and refined dbModelsDict={} if queryModels != '': dbEntries=self.db.execute_statement("select CrystalName,DatePanDDAModelCreated from mainTable where CrystalName in ("+queryModels[:-1]+") and (RefinementOutcome like '3%' or RefinementOutcome like '4%' or RefinementOutcome like '5%')") for item in dbEntries: xtal=str(item[0]) timestamp=str(item[1]) dbModelsDict[xtal]=timestamp self.Logfile.insert('PanDDA model for '+xtal+' is in database and was created on '+str(timestamp)) # compare timestamps and only export the ones where the timestamp of the file is newer than the one in the DB samples_to_export={} self.Logfile.insert('checking which PanDDA models were newly created or updated') if self.which_models=='all': self.Logfile.insert('Note: you chose to export ALL available PanDDA!') for sample in fileModelsDict: if self.which_models=='all': self.Logfile.insert('exporting '+sample) samples_to_export[sample]=fileModelsDict[sample] elif self.which_models == 'selected': for i in range(0, self.pandda_analyse_data_table.rowCount()): if str(self.pandda_analyse_data_table.item(i, 0).text()) == sample: if self.pandda_analyse_data_table.cellWidget(i, 1).isChecked(): self.Logfile.insert('Dataset selected by user -> exporting '+sample) samples_to_export[sample]=fileModelsDict[sample] break else: if sample in dbModelsDict: try: difference=(datetime.strptime(fileModelsDict[sample],'%Y-%m-%d %H:%M:%S') - datetime.strptime(dbModelsDict[sample],'%Y-%m-%d %H:%M:%S') ) if difference.seconds != 0: self.Logfile.insert('exporting '+sample+' -> was already refined, but newer PanDDA model available') samples_to_export[sample]=fileModelsDict[sample] except ValueError: # this will be raised if timestamp is not properly formatted; # which will usually be the case when respective field in database is blank # these are hopefully legacy cases which are from before this extensive check was introduced (13/01/2017) advice = ( 'The pandda model of '+xtal+' was changed, but it was already refined! ' 'This is most likely because this was done with an older version of XCE. ' 'If you really want to export and refine this model, you need to open the database ' 'with DBbroweser (sqlitebrowser.org); then change the RefinementOutcome field ' 'of the respective sample to "2 - PANDDA model", save the database and repeat the export prodedure.' ) self.Logfile.insert(advice) else: self.Logfile.insert('exporting '+sample+' -> first time to be exported and refined') samples_to_export[sample]=fileModelsDict[sample] # update the DB: # set timestamp to current timestamp of file and set RefinementOutcome to '2-pandda...' if samples_to_export != {}: select_dir_string='' select_dir_string_new_pannda=' ' for sample in samples_to_export: db_dict= {'RefinementOutcome': '2 - PANDDA model', 'DatePanDDAModelCreated': samples_to_export[sample]} select_dir_string+="select_dir={0!s} ".format(sample) select_dir_string_new_pannda+='{0!s} '.format(sample) self.Logfile.insert('updating database for '+sample+' setting time model was created to '+db_dict['DatePanDDAModelCreated']+' and RefinementOutcome to '+db_dict['RefinementOutcome']) self.db.update_data_source(sample,db_dict) if os.path.isdir(os.path.join(self.panddas_directory,'rejected_datasets')): Cmds = ( 'pandda.export' ' pandda_dir=%s' %self.panddas_directory+ ' export_dir={0!s}'.format(self.initial_model_directory)+ ' {0!s}'.format(select_dir_string)+ ' export_ligands=False' ' generate_occupancy_groupings=True\n' ) else: Cmds = ( 'source /dls/science/groups/i04-1/software/pandda-update/ccp4/ccp4-7.0/bin/ccp4.setup-sh\n' # 'source '+os.path.join(os.getenv('XChemExplorer_DIR'),'setup-scripts','pandda.setup-sh')+'\n' 'pandda.export' ' pandda_dir=%s' %self.panddas_directory+ ' export_dir={0!s}'.format(self.initial_model_directory)+ ' {0!s}'.format(select_dir_string_new_pannda)+ ' generate_restraints=True\n' ) self.Logfile.insert('running pandda.export with the following settings:\n'+Cmds) os.system(Cmds) return samples_to_export class run_pandda_analyse(QtCore.QThread): def __init__(self,pandda_params,xce_logfile,datasource): QtCore.QThread.__init__(self) self.data_directory=pandda_params['data_dir'] self.panddas_directory=pandda_params['out_dir'] self.submit_mode=pandda_params['submit_mode'] self.pandda_analyse_data_table = pandda_params['pandda_table'] self.nproc=pandda_params['nproc'] self.min_build_datasets=pandda_params['min_build_datasets'] self.pdb_style=pandda_params['pdb_style'] self.mtz_style=pandda_params['mtz_style'] self.sort_event=pandda_params['sort_event'] self.number_of_datasets=pandda_params['N_datasets'] self.max_new_datasets=pandda_params['max_new_datasets'] self.grid_spacing=pandda_params['grid_spacing'] self.reference_dir=pandda_params['reference_dir'] self.filter_pdb=os.path.join(self.reference_dir,pandda_params['filter_pdb']) self.wilson_scaling = pandda_params['perform_diffraction_data_scaling'] self.Logfile=XChemLog.updateLog(xce_logfile) self.datasource=datasource self.db=XChemDB.data_source(datasource) self.appendix=pandda_params['appendix'] self.write_mean_maps=pandda_params['write_mean_map'] self.calc_map_by = pandda_params['average_map'] self.select_ground_state_model='' projectDir = self.data_directory.replace('/*', '') self.make_ligand_links='$CCP4/bin/ccp4-python %s %s %s\n' %(os.path.join(os.getenv('XChemExplorer_DIR'), 'helpers', 'make_ligand_links_after_pandda.py') ,projectDir,self.panddas_directory) self.use_remote = pandda_params['use_remote'] self.remote_string = pandda_params['remote_string'] if self.appendix != '': self.panddas_directory=os.path.join(self.reference_dir,'pandda_'+self.appendix) if os.path.isdir(self.panddas_directory): os.system('/bin/rm -fr %s' %self.panddas_directory) os.mkdir(self.panddas_directory) if self.data_directory.startswith('/dls'): self.select_ground_state_model = 'module load ccp4\n' self.select_ground_state_model +='$CCP4/bin/ccp4-python %s %s\n' %(os.path.join(os.getenv('XChemExplorer_DIR'),'helpers','select_ground_state_dataset.py'),self.panddas_directory) self.make_ligand_links='' def run(self): # print self.reference_dir # print self.filter_pdb # how to run pandda.analyse on large datasets # # 1) Run the normal pandda command, with the new setting, e.g. # pandda.analyse data_dirs=... max_new_datasets=500 # This will do the analysis on the first 500 datasets and build the statistical maps - just as normal. # # 2) Run pandda with the same command: # pandda.analyse data_dirs=... max_new_datasets=500 # This will add 500 new datasets, and process them using the existing statistical maps # (this will be quicker than the original analysis). It will then merge the results of the two analyses. # # 3) Repeat 2) until you don't add any "new" datasets. Then you can build the models as normal. number_of_cyles=int(self.number_of_datasets)/int(self.max_new_datasets) if int(self.number_of_datasets) % int(self.max_new_datasets) != 0: # modulo gives remainder after integer division number_of_cyles+=1 self.Logfile.insert('will run %s rounds of pandda.analyse' %str(number_of_cyles)) if os.path.isfile(os.path.join(self.panddas_directory,'pandda.running')): self.Logfile.insert('it looks as if a pandda.analyse job is currently running in: '+self.panddas_directory) msg = ( 'there are three possibilities:\n' '1.) choose another PANDDA directory\n' '2.) - check if the job is really running either on the cluster (qstat) or on your local machine\n' ' - if so, be patient and wait until the job has finished\n' '3.) same as 2., but instead of waiting, kill the job and remove at least the pandda.running file\n' ' (or all the contents in the directory if you want to start from scratch)\n' ) self.Logfile.insert(msg) return None else: # if os.getenv('SHELL') == '/bin/tcsh' or os.getenv('SHELL') == '/bin/csh': # source_file=os.path.join(os.getenv('XChemExplorer_DIR'),'setup-scripts','pandda.setup-csh\n') # elif os.getenv('SHELL') == '/bin/bash' or self.use_remote: # source_file='export XChemExplorer_DIR="'+os.getenv('XChemExplorer_DIR')+'"\n' # source_file+='source %s\n' %os.path.join(os.getenv('XChemExplorer_DIR'),'setup-scripts','pandda.setup-sh\n') # else: # source_file='' # v1.2.1 - pandda.setup files should be obsolete now that pandda is part of ccp4 # 08/10/2020 - pandda v0.2.12 installation at DLS is obsolete # source_file='source /dls/science/groups/i04-1/software/pandda_0.2.12/ccp4/ccp4-7.0/bin/ccp4.setup-sh\n' source_file = '' source_file += 'export XChemExplorer_DIR="' + os.getenv('XChemExplorer_DIR') + '"\n' if os.path.isfile(self.filter_pdb + '.pdb'): print('filter pdb located') filter_pdb=' filter.pdb='+self.filter_pdb+'.pdb' print('will use ' + filter_pdb + 'as a filter for pandda.analyse') else: if self.use_remote: stat_command = self.remote_string.replace("qsub'", str('stat ' + self.filter_pdb + "'")) output = subprocess.Popen(stat_command, shell=True, stdout=subprocess.PIPE, stderr=subprocess.PIPE) out, err = output.communicate() print out if 'cannot stat' in out: filter_pdb = '' else: filter_pdb = ' filter.pdb=' + self.filter_pdb + '.pdb' else: filter_pdb='' os.chdir(self.panddas_directory) # note: copied latest pandda.setup-sh from XCE2 installation (08/08/2017) dls = '' if self.data_directory.startswith('/dls'): dls = ( source_file + '\n' 'module load pymol/1.8.2.0\n' '\n' 'module load ccp4/7.0.072\n' '\n' ) Cmds = ( '#!'+os.getenv('SHELL')+'\n' + '\n' + dls + 'cd ' + self.panddas_directory + '\n' + '\n' ) ignore = [] char = [] zmap = [] for i in range(0, self.pandda_analyse_data_table.rowCount()): ignore_all_checkbox = self.pandda_analyse_data_table.cellWidget(i, 7) ignore_characterisation_checkbox = self.pandda_analyse_data_table.cellWidget(i, 8) ignore_zmap_checkbox = self.pandda_analyse_data_table.cellWidget(i, 9) if ignore_all_checkbox.isChecked(): ignore.append(str(self.pandda_analyse_data_table.item(i, 0).text())) if ignore_characterisation_checkbox.isChecked(): char.append(str(self.pandda_analyse_data_table.item(i, 0).text())) if ignore_zmap_checkbox.isChecked(): zmap.append(str(self.pandda_analyse_data_table.item(i, 0).text())) print ignore def append_to_ignore_string(datasets_list, append_string): if len(datasets_list)==0: append_string = '' for i in range(0, len(datasets_list)): if i < len(datasets_list)-1: append_string += str(datasets_list[i] + ',') else: append_string += str(datasets_list[i] +'"') print(append_string) return append_string ignore_string = 'ignore_datasets="' ignore_string = append_to_ignore_string(ignore, ignore_string) char_string = 'exclude_from_characterisation="' char_string = append_to_ignore_string(char, char_string) zmap_string = 'exclude_from_z_map_analysis="' zmap_string = append_to_ignore_string(zmap, zmap_string) for i in range(number_of_cyles): Cmds += ( 'pandda.analyse '+ ' data_dirs="'+self.data_directory.replace('/*','')+'/*"'+ ' out_dir="'+self.panddas_directory+'"' ' min_build_datasets='+self.min_build_datasets+ ' max_new_datasets='+self.max_new_datasets+ ' grid_spacing='+self.grid_spacing+ ' cpus='+self.nproc+ ' events.order_by='+self.sort_event+ filter_pdb+ ' pdb_style='+self.pdb_style+ ' mtz_style='+self.mtz_style+ ' lig_style=/compound/*.cif'+ ' apply_b_factor_scaling='+self.wilson_scaling+ ' write_average_map='+self.write_mean_maps + ' average_map=' + self.calc_map_by + ' ' + ignore_string +' '+ char_string +' '+ zmap_string +' '+ '\n' ) Cmds += self.select_ground_state_model Cmds += self.make_ligand_links Cmds += '\n' data_dir_string = self.data_directory.replace('/*', '') Cmds += str( 'find ' + data_dir_string + '/*/compound -name "*.cif" | while read line; do echo ${line//"' + data_dir_string + '"/"' + self.panddas_directory + '/processed_datasets/"}| while read line2; do cp $line ${line2//compound/ligand_files} > /dev/null 2>&1; ' 'done; done;') Cmds += '\n' Cmds += str( 'find ' + data_dir_string + '/*/compound -name "*.pdb" | while read line; do echo ${line//"' + data_dir_string + '"/"' + self.panddas_directory + '/processed_datasets/"}| while read line2; do cp $line ${line2//compound/ligand_files} > /dev/null 2>&1; ' 'done; done;') self.Logfile.insert('running pandda.analyse with the following command:\n'+Cmds) f = open('pandda.sh','w') f.write(Cmds) f.close() # #>>> for testing # self.submit_mode='local machine' self.Logfile.insert('trying to run pandda.analyse on ' + str(self.submit_mode)) if self.submit_mode=='local machine': self.Logfile.insert('running PANDDA on local machine') os.system('chmod +x pandda.sh') os.system('./pandda.sh &') elif self.use_remote: # handles remote submission of pandda.analyse jobs submission_string = self.remote_string.replace("qsub'", str('cd ' + self.panddas_directory + '; ' + "qsub -P labxchem -q medium.q -N pandda 5 -l exclusive,m_mem_free=100G pandda.sh'")) os.system(submission_string) self.Logfile.insert(str('running PANDDA remotely, using: ' + submission_string)) else: self.Logfile.insert('running PANDDA on cluster, using qsub...') os.system('qsub -P labxchem -q medium.q -N pandda -l exclusive,m_mem_free=100G pandda.sh') self.emit(QtCore.SIGNAL('datasource_menu_reload_samples')) class giant_cluster_datasets(QtCore.QThread): def __init__(self,initial_model_directory,pandda_params,xce_logfile,datasource,): QtCore.QThread.__init__(self) self.panddas_directory=pandda_params['out_dir'] self.pdb_style=pandda_params['pdb_style'] self.mtz_style=pandda_params['mtz_style'] self.Logfile=XChemLog.updateLog(xce_logfile) self.initial_model_directory=initial_model_directory self.db=XChemDB.data_source(datasource) def run(self): self.emit(QtCore.SIGNAL('update_progress_bar'), 0) if self.pdb_style.replace(' ','') == '': self.Logfile.insert('PDB style is not set in pandda.analyse!') self.Logfile.insert('cannot start pandda.analyse') self.emit(QtCore.SIGNAL('update_status_bar(QString)'), 'PDB style is not set in pandda.analyse!') return None if self.mtz_style.replace(' ','') == '': self.Logfile.insert('MTZ style is not set in pandda.analyse!') self.Logfile.insert('cannot start pandda.analyse') self.emit(QtCore.SIGNAL('update_status_bar(QString)'), 'MTZ style is not set in pandda.analyse!') return None # 1.) prepare output directory os.chdir(self.panddas_directory) if os.path.isdir('cluster_analysis'): self.Logfile.insert('removing old cluster_analysis directory in {0!s}'.format(self.panddas_directory)) self.emit(QtCore.SIGNAL('update_status_bar(QString)'), 'removing old cluster_analysis directory in {0!s}'.format(self.panddas_directory)) os.system('/bin/rm -fr cluster_analysis 2> /dev/null') self.Logfile.insert('creating cluster_analysis directory in {0!s}'.format(self.panddas_directory)) self.emit(QtCore.SIGNAL('update_status_bar(QString)'), 'creating cluster_analysis directory in {0!s}'.format(self.panddas_directory)) os.mkdir('cluster_analysis') self.emit(QtCore.SIGNAL('update_progress_bar'), 10) # 2.) go through project directory and make sure that all pdb files really exist # broken links derail the giant.cluster_mtzs_and_pdbs script self.Logfile.insert('cleaning up broken links of {0!s} and {1!s} in {2!s}'.format(self.pdb_style, self.mtz_style, self.initial_model_directory)) self.emit(QtCore.SIGNAL('update_status_bar(QString)'), 'cleaning up broken links of {0!s} and {1!s} in {2!s}'.format(self.pdb_style, self.mtz_style, self.initial_model_directory)) os.chdir(self.initial_model_directory) for xtal in glob.glob('*'): if not os.path.isfile(os.path.join(xtal,self.pdb_style)): self.Logfile.insert('missing {0!s} and {1!s} for {2!s}'.format(self.pdb_style, self.mtz_style, xtal)) os.system('/bin/rm {0!s}/{1!s} 2> /dev/null'.format(xtal, self.pdb_style)) os.system('/bin/rm {0!s}/{1!s} 2> /dev/null'.format(xtal, self.mtz_style)) self.emit(QtCore.SIGNAL('update_progress_bar'), 20) # 3.) giant.cluster_mtzs_and_pdbs self.Logfile.insert("running giant.cluster_mtzs_and_pdbs {0!s}/*/{1!s} pdb_regex='{2!s}/(.*)/{3!s}' out_dir='{4!s}/cluster_analysis'".format(self.initial_model_directory, self.pdb_style, self.initial_model_directory, self.pdb_style, self.panddas_directory)) self.emit(QtCore.SIGNAL('update_status_bar(QString)'), 'running giant.cluster_mtzs_and_pdbs') if os.getenv('SHELL') == '/bin/tcsh' or os.getenv('SHELL') == '/bin/csh': source_file=os.path.join(os.getenv('XChemExplorer_DIR'),'setup-scripts','pandda.setup-csh') elif os.getenv('SHELL') == '/bin/bash': source_file=os.path.join(os.getenv('XChemExplorer_DIR'),'setup-scripts','pandda.setup-sh') else: source_file='' Cmds = ( '#!'+os.getenv('SHELL')+'\n' 'unset PYTHONPATH\n' 'source '+source_file+'\n' "giant.datasets.cluster %s/*/%s pdb_regex='%s/(.*)/%s' out_dir='%s/cluster_analysis'" %(self.initial_model_directory,self.pdb_style,self.initial_model_directory,self.pdb_style,self.panddas_directory) ) # os.system("giant.cluster_mtzs_and_pdbs %s/*/%s pdb_regex='%s/(.*)/%s' out_dir='%s/cluster_analysis'" %(self.initial_model_directory,self.pdb_style,self.initial_model_directory,self.pdb_style,self.panddas_directory)) os.system(Cmds) self.emit(QtCore.SIGNAL('update_progress_bar'), 80) # 4.) analyse output self.Logfile.insert('parsing {0!s}/cluster_analysis'.format(self.panddas_directory)) self.emit(QtCore.SIGNAL('update_status_bar(QString)'), 'parsing {0!s}/cluster_analysis'.format(self.panddas_directory)) os.chdir('{0!s}/cluster_analysis'.format(self.panddas_directory)) cluster_dict={} for out_dir in sorted(glob.glob('*')): if os.path.isdir(out_dir): cluster_dict[out_dir]=[] for folder in glob.glob(os.path.join(out_dir,'pdbs','*')): xtal=folder[folder.rfind('/')+1:] cluster_dict[out_dir].append(xtal) self.emit(QtCore.SIGNAL('update_progress_bar'), 90) # 5.) update datasource self.Logfile.insert('updating datasource with results from giant.cluster_mtzs_and_pdbs') if cluster_dict != {}: for key in cluster_dict: for xtal in cluster_dict[key]: db_dict= {'CrystalFormName': key} self.db.update_data_source(xtal,db_dict) # 6.) finish self.emit(QtCore.SIGNAL('update_progress_bar'), 100) self.Logfile.insert('finished giant.cluster_mtzs_and_pdbs') self.emit(QtCore.SIGNAL('datasource_menu_reload_samples')) class check_if_pandda_can_run: # reasons why pandda cannot be run # - there is currently a job running in the pandda directory # - min datasets available is too low # - required input paramters are not complete # - map amplitude and phase labels don't exist def __init__(self,pandda_params,xce_logfile,datasource): self.data_directory=pandda_params['data_dir'] self.panddas_directory=pandda_params['out_dir'] self.min_build_datasets=pandda_params['min_build_datasets'] self.pdb_style=pandda_params['pdb_style'] self.mtz_style=pandda_params['mtz_style'] self.input_dir_structure=pandda_params['pandda_dir_structure'] self.problem_found=False self.error_code=-1 self.Logfile=XChemLog.updateLog(xce_logfile) self.db=XChemDB.data_source(datasource) def number_of_available_datasets(self): counter=0 for file in glob.glob(os.path.join(self.input_dir_structure,self.pdb_style)): if os.path.isfile(file): counter+=1 self.Logfile.insert('pandda.analyse: found {0!s} useable datasets'.format(counter)) return counter def get_first_dataset_in_project_directory(self): first_dataset='' for file in glob.glob(os.path.join(self.input_dir_structure,self.pdb_style)): if os.path.isfile(file): first_dataset=file break return first_dataset def compare_number_of_atoms_in_reference_vs_all_datasets(self,refData,dataset_list): mismatched_datasets=[] pdbtools=XChemUtils.pdbtools(refData) refPDB=refData[refData.rfind('/')+1:] refPDBlist=pdbtools.get_init_pdb_as_list() n_atom_ref=len(refPDBlist) for n_datasets,dataset in enumerate(dataset_list): if os.path.isfile(os.path.join(self.data_directory.replace('*',''),dataset,self.pdb_style)): n_atom=len(pdbtools.get_pdb_as_list(os.path.join(self.data_directory.replace('*',''),dataset,self.pdb_style))) if n_atom_ref == n_atom: self.Logfile.insert('{0!s}: atoms in PDB file ({1!s}): {2!s}; atoms in Reference file: {3!s} ===> OK'.format(dataset, self.pdb_style, str(n_atom), str(n_atom_ref))) if n_atom_ref != n_atom: self.Logfile.insert('{0!s}: atoms in PDB file ({1!s}): {2!s}; atoms in Reference file: {3!s} ===> ERROR'.format(dataset, self.pdb_style, str(n_atom), str(n_atom_ref))) mismatched_datasets.append(dataset) return n_datasets,mismatched_datasets def get_datasets_which_fit_to_reference_file(self,ref,reference_directory,cluster_dict,allowed_unitcell_difference_percent): refStructure=XChemUtils.pdbtools(os.path.join(reference_directory,ref+'.pdb')) symmRef=refStructure.get_spg_number_from_pdb() ucVolRef=refStructure.calc_unitcell_volume_from_pdb() cluster_dict[ref]=[] cluster_dict[ref].append(os.path.join(reference_directory,ref+'.pdb')) for dataset in glob.glob(os.path.join(self.data_directory,self.pdb_style)): datasetStructure=XChemUtils.pdbtools(dataset) symmDataset=datasetStructure.get_spg_number_from_pdb() ucVolDataset=datasetStructure.calc_unitcell_volume_from_pdb() if symmDataset == symmRef: try: difference=math.fabs(1-(float(ucVolRef)/float(ucVolDataset)))*100 if difference < allowed_unitcell_difference_percent: sampleID=dataset.replace('/'+self.pdb_style,'')[dataset.replace('/'+self.pdb_style,'').rfind('/')+1:] cluster_dict[ref].append(sampleID) except ZeroDivisionError: continue return cluster_dict def remove_dimple_files(self,dataset_list): for n_datasets,dataset in enumerate(dataset_list): db_dict={} if os.path.isfile(os.path.join(self.data_directory.replace('*',''),dataset,self.pdb_style)): os.system('/bin/rm '+os.path.join(self.data_directory.replace('*',''),dataset,self.pdb_style)) self.Logfile.insert('{0!s}: removing {1!s}'.format(dataset, self.pdb_style)) db_dict['DimplePathToPDB']='' db_dict['DimpleRcryst']='' db_dict['DimpleRfree']='' db_dict['DimpleResolutionHigh']='' db_dict['DimpleStatus']='pending' if os.path.isfile(os.path.join(self.data_directory.replace('*',''),dataset,self.mtz_style)): os.system('/bin/rm '+os.path.join(self.data_directory.replace('*',''),dataset,self.mtz_style)) self.Logfile.insert('{0!s}: removing {1!s}'.format(dataset, self.mtz_style)) db_dict['DimplePathToMTZ']='' if db_dict != {}: self.db.update_data_source(dataset,db_dict) def analyse_pdb_style(self): pdb_found=False for file in glob.glob(os.path.join(self.data_directory,self.pdb_style)): if os.path.isfile(file): pdb_found=True break if not pdb_found: self.error_code=1 message=self.warning_messages() return message def analyse_mtz_style(self): mtz_found=False for file in glob.glob(os.path.join(self.data_directory,self.mtz_style)): if os.path.isfile(file): mtz_found=True break if not mtz_found: self.error_code=2 message=self.warning_messages() return message def analyse_min_build_dataset(self): counter=0 for file in glob.glob(os.path.join(self.data_directory,self.mtz_style)): if os.path.isfile(file): counter+=1 if counter <= self.min_build_datasets: self.error_code=3 message=self.warning_messages() return message def warning_messages(self): message='' if self.error_code==1: message='PDB file does not exist' if self.error_code==2: message='MTZ file does not exist' if self.error_code==3: message='Not enough datasets available' return message class convert_all_event_maps_in_database(QtCore.QThread): def __init__(self,initial_model_directory,xce_logfile,datasource): QtCore.QThread.__init__(self) self.xce_logfile=xce_logfile self.Logfile=XChemLog.updateLog(xce_logfile) self.initial_model_directory=initial_model_directory self.datasource=datasource self.db=XChemDB.data_source(datasource) def run(self): sqlite = ( 'select' ' CrystalName,' ' PANDDA_site_event_map,' ' PANDDA_site_ligand_resname,' ' PANDDA_site_ligand_chain,' ' PANDDA_site_ligand_sequence_number,' ' PANDDA_site_ligand_altLoc ' 'from panddaTable ' 'where PANDDA_site_event_map not like "event%"' ) print sqlite query=self.db.execute_statement(sqlite) print query progress_step=1 if len(query) != 0: progress_step=100/float(len(query)) else: progress_step=1 progress=0 self.emit(QtCore.SIGNAL('update_progress_bar'), progress) for item in query: print item xtalID=str(item[0]) event_map=str(item[1]) resname=str(item[2]) chainID=str(item[3]) resseq=str(item[4]) altLoc=str(item[5]) if os.path.isfile(os.path.join(self.initial_model_directory,xtalID,'refine.pdb')): os.chdir(os.path.join(self.initial_model_directory,xtalID)) self.Logfile.insert('extracting ligand ({0!s},{1!s},{2!s},{3!s}) from refine.pdb'.format(str(resname), str(chainID), str(resseq), str(altLoc))) XChemUtils.pdbtools(os.path.join(self.initial_model_directory,xtalID,'refine.pdb')).save_specific_ligands_to_pdb(resname,chainID,resseq,altLoc) if os.path.isfile('ligand_{0!s}_{1!s}_{2!s}_{3!s}.pdb'.format(str(resname), str(chainID), str(resseq), str(altLoc))): ligand_pdb='ligand_{0!s}_{1!s}_{2!s}_{3!s}.pdb'.format(str(resname), str(chainID), str(resseq), str(altLoc)) print os.path.join(self.initial_model_directory,xtalID,ligand_pdb) else: self.Logfile.insert('could not extract ligand; trying next...') continue else: self.Logfile.insert('directory: '+os.path.join(self.initial_model_directory,xtalID)+' -> cannot find refine.pdb; trying next') continue if os.path.isfile(os.path.join(self.initial_model_directory,xtalID,'refine.mtz')): resolution=XChemUtils.mtztools(os.path.join(self.initial_model_directory,xtalID,'refine.mtz')).get_high_resolution_from_mtz() else: self.Logfile.insert('directory: '+os.path.join(self.initial_model_directory,xtalID)+' -> cannot find refine.mtz; trying next') continue self.emit(QtCore.SIGNAL('update_status_bar(QString)'), 'eventMap -> SF for '+event_map) convert_event_map_to_SF(self.initial_model_directory,xtalID,event_map,ligand_pdb,self.xce_logfile,self.datasource,resolution).run() progress += progress_step self.emit(QtCore.SIGNAL('update_progress_bar'), progress) class convert_event_map_to_SF: def __init__(self,project_directory,xtalID,event_map,ligand_pdb,xce_logfile,db_file,resolution): self.Logfile=XChemLog.updateLog(xce_logfile) self.event_map=event_map if not os.path.isfile(self.event_map): self.Logfile.insert('cannot find Event map: '+self.event_map) self.Logfile.insert('cannot convert event_map to structure factors!') return None self.project_directory=project_directory self.xtalID=xtalID self.event_map=event_map self.ligand_pdb=ligand_pdb self.event=event_map[event_map.rfind('/')+1:].replace('.map','').replace('.ccp4','') self.db=XChemDB.data_source(db_file) self.resolution=resolution def run(self): os.chdir(os.path.join(self.project_directory,self.xtalID)) # remove exisiting mtz file if os.path.isfile(self.event+'.mtz'): self.Logfile.insert('removing existing '+self.event+'.mtz') os.system('/bin/rm '+self.event+'.mtz') # event maps generated with pandda v0.2 or higher have the same symmetry as the crystal # but phenix.map_to_structure_facors only accepts maps in spg P1 # therefore map is first expanded to full unit cell and spg of map then set tp p1 # other conversion option like cinvfft give for whatever reason uninterpretable maps self.convert_map_to_p1() # run phenix.map_to_structure_factors self.run_phenix_map_to_structure_factors() self.remove_and_rename_column_labels() # check if output files exist if not os.path.isfile('{0!s}.mtz'.format(self.event)): self.Logfile.insert('cannot find {0!s}.mtz'.format(self.event)) else: self.Logfile.insert('conversion successful, {0!s}.mtz exists'.format(self.event)) # update datasource with event_map_mtz information self.update_database() def calculate_electron_density_map(self,mtzin): missing_columns=False column_dict=XChemUtils.mtztools(mtzin).get_all_columns_as_dict() if 'FWT' in column_dict['F'] and 'PHWT' in column_dict['PHS']: labin=' labin F1=FWT PHI=PHWT\n' elif '2FOFCWT' in column_dict['F'] and 'PH2FOFCWT' in column_dict['PHS']: labin=' labin F1=2FOFCWT PHI=PH2FOFCWT\n' else: missing_columns=True if not missing_columns: os.chdir(os.path.join(self.project_directory,self.xtalID)) cmd = ( 'fft hklin '+mtzin+' mapout 2fofc.map << EOF\n' +labin+ 'EOF\n' ) self.Logfile.insert('calculating 2fofc map from '+mtzin) os.system(cmd) else: self.Logfile.insert('cannot calculate 2fofc.map; missing map coefficients') def prepare_conversion_script(self): os.chdir(os.path.join(self.project_directory, self.xtalID)) # see also: # http://www.phaser.cimr.cam.ac.uk/index.php/Using_Electron_Density_as_a_Model if os.getcwd().startswith('/dls'): phenix_module='module_load_phenix\n' else: phenix_module='' cmd = ( '#!'+os.getenv('SHELL')+'\n' '\n' +phenix_module+ '\n' 'pdbset XYZIN %s XYZOUT mask_ligand.pdb << eof\n' %self.ligand_pdb+ ' SPACEGROUP {0!s}\n'.format(self.space_group)+ ' CELL {0!s}\n'.format((' '.join(self.unit_cell)))+ ' END\n' 'eof\n' '\n' 'ncsmask XYZIN mask_ligand.pdb MSKOUT mask_ligand.msk << eof\n' ' GRID %s\n' %(' '.join(self.gridElectronDensityMap))+ ' RADIUS 10\n' ' PEAK 1\n' 'eof\n' '\n' 'mapmask MAPIN %s MAPOUT onecell_event_map.map << eof\n' %self.event_map+ ' XYZLIM CELL\n' 'eof\n' '\n' 'maprot MAPIN onecell_event_map.map MSKIN mask_ligand.msk WRKOUT masked_event_map.map << eof\n' ' MODE FROM\n' ' SYMMETRY WORK %s\n' %self.space_group_numberElectronDensityMap+ ' AVERAGE\n' ' ROTATE EULER 0 0 0\n' ' TRANSLATE 0 0 0\n' 'eof\n' '\n' 'mapmask MAPIN masked_event_map.map MAPOUT masked_event_map_fullcell.map << eof\n' ' XYZLIM CELL\n' ' PAD 0.0\n' 'eof\n' '\n' 'sfall HKLOUT %s.mtz MAPIN masked_event_map_fullcell.map << eof\n' %self.event+ ' LABOUT FC=FC_event PHIC=PHIC_event\n' ' MODE SFCALC MAPIN\n' ' RESOLUTION %s\n' %self.resolution+ ' END\n' ) self.Logfile.insert('preparing script for conversion of Event map to SF') f = open('eventMap2sf.sh','w') f.write(cmd) f.close() os.system('chmod +x eventMap2sf.sh') def run_conversion_script(self): self.Logfile.insert('running conversion script...') os.system('./eventMap2sf.sh') def convert_map_to_p1(self): self.Logfile.insert('running mapmask -> converting map to p1...') cmd = ( '#!'+os.getenv('SHELL')+'\n' '\n' 'mapmask mapin %s mapout %s_p1.map << eof\n' %(self.event_map,self.event) + 'xyzlin cell\n' 'symmetry p1\n' ) self.Logfile.insert('mapmask command:\n%s' %cmd) os.system(cmd) def run_phenix_map_to_structure_factors(self): if float(self.resolution) < 1.21: # program complains if resolution is 1.2 or higher self.resolution='1.21' self.Logfile.insert('running phenix.map_to_structure_factors {0!s}_p1.map d_min={1!s} output_file_name={2!s}_tmp.mtz'.format(self.event, self.resolution, self.event)) os.system('phenix.map_to_structure_factors {0!s}_p1.map d_min={1!s} output_file_name={2!s}_tmp.mtz'.format(self.event, self.resolution, self.event)) def run_cinvfft(self,mtzin): # mtzin is usually refine.mtz self.Logfile.insert('running cinvfft -mapin {0!s} -mtzin {1!s} -mtzout {2!s}_tmp.mtz -colout event'.format(self.event_map, mtzin, self.event)) os.system('cinvfft -mapin {0!s} -mtzin {1!s} -mtzout {2!s}_tmp.mtz -colout event'.format(self.event_map, mtzin, self.event)) def remove_and_rename_column_labels(self): cmd = ( '#!'+os.getenv('SHELL')+'\n' '\n' 'cad hklin1 %s_tmp.mtz hklout %s.mtz << eof\n' %(self.event,self.event)+ ' labin file_number 1 E1=F-obs E2=PHIF\n' ' labout file_number 1 E1=F_ampl E2=PHIF\n' 'eof\n' '\n' ) self.Logfile.insert('running CAD: new column labels F_ampl,PHIF') os.system(cmd) def remove_and_rename_column_labels_after_cinvfft(self): cmd = ( '#!'+os.getenv('SHELL')+'\n' '\n' 'cad hklin1 %s_tmp.mtz hklout %s.mtz << eof\n' %(self.event,self.event)+ ' labin file_number 1 E1=event.F_phi.F E2=event.F_phi.phi\n' ' labout file_number 1 E1=F_ampl E2=PHIF\n' 'eof\n' '\n' ) self.Logfile.insert('running CAD: renaming event.F_phi.F -> F_ampl and event.F_phi.phi -> PHIF') os.system(cmd) def update_database(self): sqlite = ( "update panddaTable set " " PANDDA_site_event_map_mtz = '%s' " %os.path.join(self.project_directory,self.xtalID,self.event+'.mtz')+ " where PANDDA_site_event_map is '{0!s}' ".format(self.event_map) ) self.db.execute_statement(sqlite) self.Logfile.insert('updating data source: '+sqlite) def clean_output_directory(self): os.system('/bin/rm mask_targetcell.pdb') os.system('/bin/rm mask_targetcell.msk') os.system('/bin/rm onecell.map') os.system('/bin/rm masked_targetcell.map') os.system('/bin/rm masked_fullcell.map') os.system('/bin/rm eventMap2sf.sh') os.system('/bin/rm '+self.ligand_pdb) class run_pandda_inspect_at_home(QtCore.QThread): def __init__(self,panddaDir,xce_logfile): QtCore.QThread.__init__(self) self.panddaDir=panddaDir self.Logfile=XChemLog.updateLog(xce_logfile) def run(self): os.chdir(os.path.join(self.panddaDir,'processed_datasets')) progress_step=1 if len(glob.glob('*')) != 0: progress_step=100/float(len(glob.glob('*'))) else: progress_step=1 progress=0 self.emit(QtCore.SIGNAL('update_progress_bar'), progress) self.Logfile.insert('parsing '+self.panddaDir) for xtal in sorted(glob.glob('*')): for files in glob.glob(xtal+'/ligand_files/*'): if os.path.islink(files): self.emit(QtCore.SIGNAL('update_status_bar(QString)'), 'replacing symlink for {0!s} with real file'.format(files)) self.Logfile.insert('replacing symlink for {0!s} with real file'.format(files)) os.system('cp --remove-destination {0!s} {1!s}/ligand_files'.format(os.path.realpath(files), xtal)) progress += progress_step self.emit(QtCore.SIGNAL('update_progress_bar'), progress) XChemToolTips.run_pandda_inspect_at_home(self.panddaDir) class convert_apo_structures_to_mmcif(QtCore.QThread): def __init__(self,panddaDir,xce_logfile): QtCore.QThread.__init__(self) self.panddaDir=panddaDir self.Logfile=XChemLog.updateLog(xce_logfile) def sf_convert_environment(self): pdb_extract_init = '' if os.path.isdir('/dls'): pdb_extract_init = 'source /dls/science/groups/i04-1/software/pdb-extract-prod/setup.sh\n' pdb_extract_init += '/dls/science/groups/i04-1/software/pdb-extract-prod/bin/sf_convert' else: pdb_extract_init = 'source ' + os.path.join(os.getenv('XChemExplorer_DIR'), 'pdb_extract/pdb-extract-prod/setup.sh') + '\n' pdb_extract_init += +os.path.join(os.getenv('XChemExplorer_DIR'), 'pdb_extract/pdb-extract-prod/bin/sf_convert') return pdb_extract_init def run(self): self.Logfile.insert('converting apo structures in pandda directory to mmcif files') self.Logfile.insert('chanfing to '+self.panddaDir) progress_step=1 if len(glob.glob('*')) != 0: progress_step=100/float(len(glob.glob(os.path.join(self.panddaDir,'processed_datasets','*')))) else: progress_step=1 progress=0 self.emit(QtCore.SIGNAL('update_progress_bar'), progress) pdb_extract_init = self.sf_convert_environment() self.Logfile.insert('parsing '+self.panddaDir) for dirs in glob.glob(os.path.join(self.panddaDir,'processed_datasets','*')): xtal = dirs[dirs.rfind('/')+1:] self.Logfile.insert('%s: converting %s to mmcif' %(xtal,xtal+'-pandda-input.mtz')) if os.path.isfile(os.path.join(dirs,xtal+'-pandda-input.mtz')): if os.path.isfile(os.path.join(dirs,xtal+'_sf.mmcif')): self.Logfile.insert('%s: %s_sf.mmcif exists; skipping...' %(xtal,xtal)) else: os.chdir(dirs) Cmd = (pdb_extract_init + ' -o mmcif' ' -sf %s' % xtal+'-pandda-input.mtz' + ' -out {0!s}_sf.mmcif > {1!s}.sf_mmcif.log'.format(xtal, xtal)) self.Logfile.insert('running command: '+Cmd) os.system(Cmd) progress += progress_step self.emit(QtCore.SIGNAL('update_progress_bar'), progress) class check_number_of_modelled_ligands(QtCore.QThread): def __init__(self,project_directory,xce_logfile,db_file): QtCore.QThread.__init__(self) self.Logfile=XChemLog.updateLog(xce_logfile) self.project_directory=project_directory self.db=XChemDB.data_source(db_file) self.errorDict={} def update_errorDict(self,xtal,message): if xtal not in self.errorDict: self.errorDict[xtal]=[] self.errorDict[xtal].append(message) def insert_new_row_in_panddaTable(self,xtal,ligand,site,dbDict): resname= site[0] chain= site[1] seqnum= site[2] altLoc= site[3] x_site= site[5][0] y_site= site[5][1] z_site= site[5][2] resnameSimilarSite= ligand[0] chainSimilarSite= ligand[1] seqnumSimilarSite= ligand[2] siteList=[] for entry in dbDict[xtal]: siteList.append(str(entry[0])) if entry[4] == resnameSimilarSite and entry[5] == chainSimilarSite and entry[6] == seqnumSimilarSite: eventMap= str(entry[7]) eventMap_mtz= str(entry[8]) initialPDB= str(entry[9]) initialMTZ= str(entry[10]) event_id= str(entry[12]) PanDDApath= str(entry[13]) db_dict={ 'PANDDA_site_index': str(int(max(siteList))+1), 'PANDDApath': PanDDApath, 'PANDDA_site_ligand_id': resname+'-'+chain+'-'+seqnum, 'PANDDA_site_ligand_resname': resname, 'PANDDA_site_ligand_chain': chain, 'PANDDA_site_ligand_sequence_number': seqnum, 'PANDDA_site_ligand_altLoc': 'D', 'PANDDA_site_event_index': event_id, 'PANDDA_site_event_map': eventMap, 'PANDDA_site_event_map_mtz': eventMap_mtz, 'PANDDA_site_initial_model': initialPDB, 'PANDDA_site_initial_mtz': initialMTZ, 'PANDDA_site_ligand_placed': 'True', 'PANDDA_site_x': x_site, 'PANDDA_site_y': y_site, 'PANDDA_site_z': z_site } print xtal,db_dict def run(self): self.Logfile.insert('reading modelled ligands from panddaTable') dbDict={} sqlite = ( "select " " CrystalName," " PANDDA_site_index," " PANDDA_site_x," " PANDDA_site_y," " PANDDA_site_z," " PANDDA_site_ligand_resname," " PANDDA_site_ligand_chain," " PANDDA_site_ligand_sequence_number," " PANDDA_site_event_map," " PANDDA_site_event_map_mtz," " PANDDA_site_initial_model," " PANDDA_site_initial_mtz," " RefinementOutcome," " PANDDA_site_event_index," " PANDDApath " "from panddaTable " ) dbEntries=self.db.execute_statement(sqlite) for item in dbEntries: xtal= str(item[0]) site= str(item[1]) x= str(item[2]) y= str(item[3]) z= str(item[4]) resname= str(item[5]) chain= str(item[6]) seqnum= str(item[7]) eventMap= str(item[8]) eventMap_mtz= str(item[9]) initialPDB= str(item[10]) initialMTZ= str(item[11]) outcome= str(item[12]) event= str(item[13]) PanDDApath= str(item[14]) if xtal not in dbDict: dbDict[xtal]=[] dbDict[xtal].append([site,x,y,z,resname,chain,seqnum,eventMap,eventMap_mtz,initialPDB,initialMTZ,outcome,event,PanDDApath]) os.chdir(self.project_directory) progress_step=1 if len(glob.glob('*')) != 0: progress_step=100/float(len(glob.glob('*'))) else: progress_step=1 progress=0 self.emit(QtCore.SIGNAL('update_progress_bar'), progress) for xtal in sorted(glob.glob('*')): if os.path.isfile(os.path.join(xtal,'refine.pdb')): ligands=XChemUtils.pdbtools(os.path.join(xtal,'refine.pdb')).ligand_details_as_list() self.Logfile.insert('{0!s}: found file refine.pdb'.format(xtal)) if ligands: if os.path.isdir(os.path.join(xtal,'xceTmp')): os.system('/bin/rm -fr {0!s}'.format(os.path.join(xtal,'xceTmp'))) os.mkdir(os.path.join(xtal,'xceTmp')) else: self.Logfile.warning('{0!s}: cannot find ligand molecule in refine.pdb; skipping...'.format(xtal)) continue made_sym_copies=False ligands_not_in_panddaTable=[] for n,item in enumerate(ligands): resnameLIG= item[0] chainLIG= item[1] seqnumLIG= item[2] altLocLIG= item[3] occupancyLig= item[4] if altLocLIG.replace(' ','') == '': self.Logfile.insert(xtal+': found a ligand not modelled with pandda.inspect -> {0!s} {1!s} {2!s}'.format(resnameLIG, chainLIG, seqnumLIG)) residue_xyz = XChemUtils.pdbtools(os.path.join(xtal,'refine.pdb')).get_center_of_gravity_of_residue_ish(item[1],item[2]) ligands[n].append(residue_xyz) foundLigand=False if xtal in dbDict: for entry in dbDict[xtal]: resnameTable=entry[4] chainTable=entry[5] seqnumTable=entry[6] self.Logfile.insert('panddaTable: {0!s} {1!s} {2!s} {3!s}'.format(xtal, resnameTable, chainTable, seqnumTable)) if resnameLIG == resnameTable and chainLIG == chainTable and seqnumLIG == seqnumTable: self.Logfile.insert('{0!s}: found ligand in database -> {1!s} {2!s} {3!s}'.format(xtal, resnameTable, chainTable, seqnumTable)) foundLigand=True if not foundLigand: self.Logfile.error('{0!s}: did NOT find ligand in database -> {1!s} {2!s} {3!s}'.format(xtal, resnameLIG, chainLIG, seqnumLIG)) ligands_not_in_panddaTable.append([resnameLIG,chainLIG,seqnumLIG,altLocLIG,occupancyLig,residue_xyz]) else: self.Logfile.warning('ligand in PDB file, but dataset not listed in panddaTable: {0!s} -> {1!s} {2!s} {3!s}'.format(xtal, item[0], item[1], item[2])) for entry in ligands_not_in_panddaTable: self.Logfile.error('{0!s}: refine.pdb contains a ligand that is not assigned in the panddaTable: {1!s} {2!s} {3!s} {4!s}'.format(xtal, entry[0], entry[1], entry[2], entry[3])) for site in ligands_not_in_panddaTable: for files in glob.glob(os.path.join(self.project_directory,xtal,'xceTmp','ligand_*_*.pdb')): mol_xyz = XChemUtils.pdbtools(files).get_center_of_gravity_of_molecule_ish() # now need to check if there is a unassigned entry in panddaTable that is close for entry in dbDict[xtal]: distance = XChemUtils.misc().calculate_distance_between_coordinates(mol_xyz[0], mol_xyz[1],mol_xyz[2],entry[1],entry[2], entry[3]) self.Logfile.insert('{0!s}: {1!s} {2!s} {3!s} <---> {4!s} {5!s} {6!s}'.format(xtal, mol_xyz[0], mol_xyz[1], mol_xyz[2], entry[1], entry[2], entry[3])) self.Logfile.insert('{0!s}: symm equivalent molecule: {1!s}'.format(xtal, files)) self.Logfile.insert('{0!s}: distance: {1!s}'.format(xtal, str(distance))) progress += progress_step self.emit(QtCore.SIGNAL('update_progress_bar'), progress) if self.errorDict != {}: self.update_errorDict('General','The aforementioned PDB files were automatically changed by XCE!\nPlease check and refine them!!!') self.emit(QtCore.SIGNAL('show_error_dict'), self.errorDict) class find_event_map_for_ligand(QtCore.QThread): def __init__(self,project_directory,xce_logfile,external_software): QtCore.QThread.__init__(self) self.Logfile=XChemLog.updateLog(xce_logfile) self.project_directory=project_directory self.external_software=external_software try: import gemmi self.Logfile.insert('found gemmi library in ccp4-python') except ImportError: self.external_software['gemmi'] = False self.Logfile.warning('cannot import gemmi; will use phenix.map_to_structure_factors instead') def run(self): self.Logfile.insert('======== checking ligand CC in event maps ========') for dirs in sorted(glob.glob(os.path.join(self.project_directory,'*'))): xtal = dirs[dirs.rfind('/')+1:] if os.path.isfile(os.path.join(dirs,'refine.pdb')) and \ os.path.isfile(os.path.join(dirs,'refine.mtz')): self.Logfile.insert('%s: found refine.pdb' %xtal) os.chdir(dirs) try: p = gemmi.read_structure('refine.pdb') except: self.Logfile.error('gemmi library not available') self.external_software['gemmi'] = False reso = XChemUtils.mtztools('refine.mtz').get_dmin() ligList = XChemUtils.pdbtools('refine.pdb').save_residues_with_resname(dirs,'LIG') self.Logfile.insert('%s: found %s ligands of type LIG in refine.pdb' %(xtal,str(len(ligList)))) for maps in glob.glob(os.path.join(dirs,'*event*.native.ccp4')): if self.external_software['gemmi']: self.convert_map_to_sf_with_gemmi(maps,p) else: self.expand_map_to_p1(maps) self.convert_map_to_sf(maps.replace('.ccp4','.P1.ccp4'),reso) summary = '' for lig in sorted(ligList): if self.external_software['gemmi']: for mtz in sorted(glob.glob(os.path.join(dirs,'*event*.native.mtz'))): self.get_lig_cc(mtz,lig) cc = self.check_lig_cc(mtz.replace('.mtz', '_CC.log')) summary += '%s: %s LIG CC = %s (%s)\n' %(xtal,lig,cc,mtz[mtz.rfind('/')+1:]) else: for mtz in sorted(glob.glob(os.path.join(dirs,'*event*.native*P1.mtz'))): self.get_lig_cc(mtz,lig) cc = self.check_lig_cc(mtz.replace('.mtz', '_CC.log')) summary += '%s: %s LIG CC = %s (%s)\n' %(xtal,lig,cc,mtz[mtz.rfind('/')+1:]) self.Logfile.insert('\nsummary of CC analysis:\n======================:\n'+summary) def expand_map_to_p1(self,emap): self.Logfile.insert('expanding map to P1: %s' %emap) if os.path.isfile(emap.replace('.ccp4','.P1.ccp4')): self.Logfile.warning('P1 map exists; skipping...') return cmd = ( 'mapmask MAPIN %s MAPOUT %s << eof\n' %(emap,emap.replace('.ccp4','.P1.ccp4'))+ ' XYZLIM CELL\n' ' PAD 0.0\n' ' SYMMETRY 1\n' 'eof\n' ) os.system(cmd) def convert_map_to_sf(self,emap,reso): self.Logfile.insert('converting ccp4 map to mtz with phenix.map_to_structure_factors: %s' %emap) if os.path.isfile(emap.replace('.ccp4','.mtz')): self.Logfile.warning('mtz file of event map exists; skipping...') return cmd = ( 'module load phenix\n' 'phenix.map_to_structure_factors %s d_min=%s\n' %(emap,reso)+ '/bin/mv map_to_structure_factors.mtz %s' %emap.replace('.ccp4', '.mtz') ) os.system(cmd) def get_lig_cc(self,mtz,lig): self.Logfile.insert('calculating CC for %s in %s' %(lig,mtz)) if os.path.isfile(mtz.replace('.mtz', '_CC.log')): self.Logfile.warning('logfile of CC analysis exists; skipping...') return cmd = ( 'module load phenix\n' 'phenix.get_cc_mtz_pdb %s %s > %s' % (mtz, lig, mtz.replace('.mtz', '_CC.log')) ) os.system(cmd) def check_lig_cc(self,log): cc = 'n/a' if os.path.isfile(log): for line in open(log): if line.startswith('local'): cc = line.split()[len(line.split()) - 1] else: self.Logfile.error('logfile does not exist: %s' %log) return cc def convert_map_to_sf_with_gemmi(self,emap,p): self.Logfile.insert('converting ccp4 map to mtz with gemmi map2sf: %s' %emap) if os.path.isfile(emap.replace('.ccp4','.mtz')): self.Logfile.warning('mtz file of event map exists; skipping...') return cmd = 'gemmi map2sf %s %s FWT PHWT --dmin=%s' %(emap,emap.replace('.ccp4','.mtz'),p.resolution) self.Logfile.insert('converting map with command:\n' + cmd) os.system(cmd)
StarcoderdataPython
3391400
from typing import Any, Final, TypedDict import numpy as np import numpy.typing as npt HelloWorldType: Final[Any] = TypedDict("HelloWorldType", {"Hello": str}) IntegerArrayType: Final[Any] = npt.NDArray[np.int_]
StarcoderdataPython
1680855
from graphRL.envs.graphRL import graphRL
StarcoderdataPython
95602
# Autogenerated config.py # # NOTE: config.py is intended for advanced users who are comfortable # with manually migrating the config file on qutebrowser upgrades. If # you prefer, you can also configure qutebrowser using the # :set/:bind/:config-* commands without having to write a config.py # file. # # Documentation: # qute://help/configuring.html # qute://help/settings.html # Change the argument to True to still load settings configured via autoconfig.yml config.load_autoconfig(False) # Always restore open sites when qutebrowser is reopened. Without this # option set, `:wq` (`:quit --save`) needs to be used to save open tabs # (and restore them), while quitting qutebrowser in any other way will # not save/restore the session. By default, this will save to the # session which was last loaded. This behavior can be customized via the # `session.default_name` setting. # Type: Bool c.auto_save.session = True # Which cookies to accept. With QtWebEngine, this setting also controls # other features with tracking capabilities similar to those of cookies; # including IndexedDB, DOM storage, filesystem API, service workers, and # AppCache. Note that with QtWebKit, only `all` and `never` are # supported as per-domain values. Setting `no-3rdparty` or `no- # unknown-3rdparty` per-domain on QtWebKit will have the same effect as # `all`. If this setting is used with URL patterns, the pattern gets # applied to the origin/first party URL of the page making the request, # not the request URL. With QtWebEngine 5.15.0+, paths will be stripped # from URLs, so URL patterns using paths will not match. With # QtWebEngine 5.15.2+, subdomains are additionally stripped as well, so # you will typically need to set this setting for `example.com` when the # cookie is set on `somesubdomain.example.com` for it to work properly. # To debug issues with this setting, start qutebrowser with `--debug # --logfilter network --debug-flag log-cookies` which will show all # cookies being set. # Type: String # Valid values: # - all: Accept all cookies. # - no-3rdparty: Accept cookies from the same origin only. This is known to break some sites, such as GMail. # - no-unknown-3rdparty: Accept cookies from the same origin only, unless a cookie is already set for the domain. On QtWebEngine, this is the same as no-3rdparty. # - never: Don't accept cookies at all. config.set('content.cookies.accept', 'all', 'chrome-devtools://*') # Which cookies to accept. With QtWebEngine, this setting also controls # other features with tracking capabilities similar to those of cookies; # including IndexedDB, DOM storage, filesystem API, service workers, and # AppCache. Note that with QtWebKit, only `all` and `never` are # supported as per-domain values. Setting `no-3rdparty` or `no- # unknown-3rdparty` per-domain on QtWebKit will have the same effect as # `all`. If this setting is used with URL patterns, the pattern gets # applied to the origin/first party URL of the page making the request, # not the request URL. With QtWebEngine 5.15.0+, paths will be stripped # from URLs, so URL patterns using paths will not match. With # QtWebEngine 5.15.2+, subdomains are additionally stripped as well, so # you will typically need to set this setting for `example.com` when the # cookie is set on `somesubdomain.example.com` for it to work properly. # To debug issues with this setting, start qutebrowser with `--debug # --logfilter network --debug-flag log-cookies` which will show all # cookies being set. # Type: String # Valid values: # - all: Accept all cookies. # - no-3rdparty: Accept cookies from the same origin only. This is known to break some sites, such as GMail. # - no-unknown-3rdparty: Accept cookies from the same origin only, unless a cookie is already set for the domain. On QtWebEngine, this is the same as no-3rdparty. # - never: Don't accept cookies at all. config.set('content.cookies.accept', 'all', 'devtools://*') # Allow websites to request geolocations. # Type: BoolAsk # Valid values: # - true # - false # - ask config.set('content.geolocation', False, 'https://www.google.com.ar') # Allow websites to request geolocations. # Type: BoolAsk # Valid values: # - true # - false # - ask # Value to send in the `Accept-Language` header. Note that the value # read from JavaScript is always the global value. # Type: String config.set('content.headers.accept_language', '', 'https://matchmaker.krunker.io/*') # User agent to send. The following placeholders are defined: * # `{os_info}`: Something like "X11; Linux x86_64". * `{webkit_version}`: # The underlying WebKit version (set to a fixed value with # QtWebEngine). * `{qt_key}`: "Qt" for QtWebKit, "QtWebEngine" for # QtWebEngine. * `{qt_version}`: The underlying Qt version. * # `{upstream_browser_key}`: "Version" for QtWebKit, "Chrome" for # QtWebEngine. * `{upstream_browser_version}`: The corresponding # Safari/Chrome version. * `{qutebrowser_version}`: The currently # running qutebrowser version. The default value is equal to the # unchanged user agent of QtWebKit/QtWebEngine. Note that the value # read from JavaScript is always the global value. With QtWebEngine # between 5.12 and 5.14 (inclusive), changing the value exposed to # JavaScript requires a restart. # Type: FormatString config.set('content.headers.user_agent', 'Mozilla/5.0 ({os_info}) AppleWebKit/{webkit_version} (KHTML, like Gecko) {upstream_browser_key}/{upstream_browser_version} Safari/{webkit_version}', 'https://web.whatsapp.com/') # User agent to send. The following placeholders are defined: * # `{os_info}`: Something like "X11; Linux x86_64". * `{webkit_version}`: # The underlying WebKit version (set to a fixed value with # QtWebEngine). * `{qt_key}`: "Qt" for QtWebKit, "QtWebEngine" for # QtWebEngine. * `{qt_version}`: The underlying Qt version. * # `{upstream_browser_key}`: "Version" for QtWebKit, "Chrome" for # QtWebEngine. * `{upstream_browser_version}`: The corresponding # Safari/Chrome version. * `{qutebrowser_version}`: The currently # running qutebrowser version. The default value is equal to the # unchanged user agent of QtWebKit/QtWebEngine. Note that the value # read from JavaScript is always the global value. With QtWebEngine # between 5.12 and 5.14 (inclusive), changing the value exposed to # JavaScript requires a restart. # Type: FormatString config.set('content.headers.user_agent', 'Mozilla/5.0 ({os_info}) AppleWebKit/{webkit_version} (KHTML, like Gecko) {upstream_browser_key}/{upstream_browser_version} Safari/{webkit_version} Edg/{upstream_browser_version}', 'https://accounts.google.com/*') # User agent to send. The following placeholders are defined: * # `{os_info}`: Something like "X11; Linux x86_64". * `{webkit_version}`: # The underlying WebKit version (set to a fixed value with # QtWebEngine). * `{qt_key}`: "Qt" for QtWebKit, "QtWebEngine" for # QtWebEngine. * `{qt_version}`: The underlying Qt version. * # `{upstream_browser_key}`: "Version" for QtWebKit, "Chrome" for # QtWebEngine. * `{upstream_browser_version}`: The corresponding # Safari/Chrome version. * `{qutebrowser_version}`: The currently # running qutebrowser version. The default value is equal to the # unchanged user agent of QtWebKit/QtWebEngine. Note that the value # read from JavaScript is always the global value. With QtWebEngine # between 5.12 and 5.14 (inclusive), changing the value exposed to # JavaScript requires a restart. # Type: FormatString config.set('content.headers.user_agent', 'Mozilla/5.0 ({os_info}) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/99 Safari/537.36', 'https://*.slack.com/*') # Load images automatically in web pages. # Type: Bool config.set('content.images', True, 'chrome-devtools://*') # Load images automatically in web pages. # Type: Bool config.set('content.images', True, 'devtools://*') # Enable JavaScript. # Type: Bool config.set('content.javascript.enabled', True, 'chrome-devtools://*') # Enable JavaScript. # Type: Bool config.set('content.javascript.enabled', True, 'devtools://*') # Enable JavaScript. # Type: Bool config.set('content.javascript.enabled', True, 'chrome://*/*') # Enable JavaScript. # Type: Bool config.set('content.javascript.enabled', True, 'qute://*/*') # Allow websites to record audio. # Type: BoolAsk # Valid values: # - true # - false # - ask config.set('content.media.audio_capture', True, 'https://discord.com') # Allow websites to record audio and video. # Type: BoolAsk # Valid values: # - true # - false # - ask config.set('content.media.audio_video_capture', True, 'https://hangouts.google.com') # Allow websites to show notifications. # Type: BoolAsk # Valid values: # - true # - false # - ask config.set('content.notifications.enabled', False, 'https://www.facebook.com') # Allow websites to show notifications. # Type: BoolAsk # Valid values: # - true # - false # - ask config.set('content.notifications.enabled', False, 'https://www.netflix.com') # Allow websites to show notifications. # Type: BoolAsk # Valid values: # - true # - false # - ask config.set('content.notifications.enabled', False, 'https://www.nokia.com') # Allow websites to show notifications. # Type: BoolAsk # Valid values: # - true # - false # - ask config.set('content.notifications.enabled', False, 'https://www.reddit.com') # Allow websites to show notifications. # Type: BoolAsk # Valid values: # - true # - false # - ask config.set('content.notifications.enabled', False, 'https://www.samsung.com') # Allow websites to show notifications. # Type: BoolAsk # Valid values: # - true # - false # - ask config.set('content.notifications.enabled', False, 'https://www.youtube.com') # Allow websites to register protocol handlers via # `navigator.registerProtocolHandler`. # Type: BoolAsk # Valid values: # - true # - false # - ask config.set('content.register_protocol_handler', False, 'https://mail.google.com?extsrc=mailto&url=%25s') # Duration (in milliseconds) to wait before removing finished downloads. # If set to -1, downloads are never removed. # Type: Int c.downloads.remove_finished = 4000 # When to show the statusbar. # Type: String # Valid values: # - always: Always show the statusbar. # - never: Always hide the statusbar. # - in-mode: Show the statusbar when in modes other than normal mode. c.statusbar.show = 'in-mode' # How to behave when the last tab is closed. If the # `tabs.tabs_are_windows` setting is set, this is ignored and the # behavior is always identical to the `close` value. # Type: String # Valid values: # - ignore: Don't do anything. # - blank: Load a blank page. # - startpage: Load the start page. # - default-page: Load the default page. # - close: Close the window. c.tabs.last_close = 'startpage' # When to show the tab bar. # Type: String # Valid values: # - always: Always show the tab bar. # - never: Always hide the tab bar. # - multiple: Hide the tab bar if only one tab is open. # - switching: Show the tab bar when switching tabs. c.tabs.show = 'never' # Open a new window for every tab. # Type: Bool c.tabs.tabs_are_windows = True # Search engines which can be used via the address bar. Maps a search # engine name (such as `DEFAULT`, or `ddg`) to a URL with a `{}` # placeholder. The placeholder will be replaced by the search term, use # `{{` and `}}` for literal `{`/`}` braces. The following further # placeholds are defined to configure how special characters in the # search terms are replaced by safe characters (called 'quoting'): * # `{}` and `{semiquoted}` quote everything except slashes; this is the # most sensible choice for almost all search engines (for the search # term `slash/and&amp` this placeholder expands to `slash/and%26amp`). # * `{quoted}` quotes all characters (for `slash/and&amp` this # placeholder expands to `slash%2Fand%26amp`). * `{unquoted}` quotes # nothing (for `slash/and&amp` this placeholder expands to # `slash/and&amp`). * `{0}` means the same as `{}`, but can be used # multiple times. The search engine named `DEFAULT` is used when # `url.auto_search` is turned on and something else than a URL was # entered to be opened. Other search engines can be used by prepending # the search engine name to the search term, e.g. `:open google # qutebrowser`. # Type: Dict c.url.searchengines = {'DEFAULT': 'https://www.google.com/search?q={}', 'am': 'https://www.amazon.co.in/s?k={}', 'aw': 'https://wiki.archlinux.org/?search={}', 'g': 'https://www.google.com/search?q={}', 're': 'https://www.reddit.com/r/{}', 'wiki': 'https://en.wikipedia.org/wiki/{}', 'yt': 'https://www.youtube.com/results?search_query={}'} # Page(s) to open at the start. # Type: List of FuzzyUrl, or FuzzyUrl c.url.start_pages = '/home/nml/.config/qutebrowser/startpage/index.html' # Default font families to use. Whenever "default_family" is used in a # font setting, it's replaced with the fonts listed here. If set to an # empty value, a system-specific monospace default is used. # Type: List of Font, or Font c.fonts.default_family = 'Inter' # Default font size to use. Whenever "default_size" is used in a font # setting, it's replaced with the size listed here. Valid values are # either a float value with a "pt" suffix, or an integer value with a # "px" suffix. # Type: String c.fonts.default_size = '16px' # Font used in the completion widget. # Type: Font c.fonts.completion.entry = '12pt "Inter"' # Font used in the completion categories. # Type: Font c.fonts.completion.category = '12pt "Inter"' # Font used for the context menu. If set to null, the Qt default is # used. # Type: Font c.fonts.contextmenu = '12pt "Inter"' # Font used for the debugging console. # Type: Font c.fonts.debug_console = '12pt "Inter"' # Font used for the downloadbar. # Type: Font c.fonts.downloads = '12pt "Inter"' # Font used for the hints. # Type: Font c.fonts.hints = '12pt "Inter"' # Font used in the keyhint widget. # Type: Font c.fonts.keyhint = '12pt "Inter"' # Font used for info messages. # Type: Font c.fonts.messages.info = '12pt "Inter"' # Font used for prompts. # Type: Font c.fonts.prompts = '12pt "Inter"' # Font used in the statusbar. # Type: Font c.fonts.statusbar = '12pt "Inter"' # Font family for standard fonts. # Type: FontFamily c.fonts.web.family.standard = 'Inter' # Font family for sans-serif fonts. # Type: FontFamily c.fonts.web.family.sans_serif = 'Inter' config.source('gruvbox.py') # Bindings for normal mode config.bind(',M', 'hint links spawn mpv {hint-url}') config.bind(',m', 'spawn mpv {url}')
StarcoderdataPython
51947
# -*- coding: utf-8 -*- """Hello module.""" import platform import sys def get_hello(): system = platform.system() py_version = sys.version_info.major if system == "Windows": if py_version < 3: return "Hello Windows, I'm Python2 or earlier!" else: return "Hello Windows, I'm Python3 or later!" elif system == "Darwin": if py_version < 3: return "Hello Mac OSX, I'm Python2 or earlier!" else: return "Hello Mac OSX, I'm Python3 or later!" else: if py_version < 3: return "Hello {}, I'm Python2 or earlier!".format(system) else: return "Hello {}, I'm Python3 or later!".format(system)
StarcoderdataPython
3388632
<filename>rwb/editor/custom_notebook.py '''Tree-based Notebook TODO: decouple the notebook from the listbox. Let them communicate via events, or have them work together via an interface (eg: notebook.configure(tablist=self.tablist) ''' import os import Tkinter as tk import ttk from rwb.widgets import AutoScrollbar from editor_page import EditorPage from tablist import TabList # orange and gray colors taken from # http://www.colorcombos.com/color-schemes/218/ColorCombo218.html class CustomNotebook(tk.Frame): def __init__(self, parent, app=None): tk.Frame.__init__(self, parent) background = self.cget("background") self.app = app self.pages = [] self.nodelist = [] self.current_page = None # within the frame are two panes; the left has a tree, # the right shows the current page. We need a splitter self.pw = tk.PanedWindow(self, orient="horizontal", background="#f58735", borderwidth=1,relief='solid', sashwidth=3) self.pw.pack(side="top", fill="both", expand=True, pady = (4,1), padx=4) self.left = tk.Frame(self.pw, background=background, borderwidth=0, highlightthickness=0) self.right = tk.Frame(self.pw, background="white", width=600, height=600, borderwidth=0, highlightthickness=0) self.pw.add(self.left) self.pw.add(self.right) self.list = TabList(self.left) vsb = AutoScrollbar(self.left, command=self.list.yview, orient="vertical") hsb = AutoScrollbar(self.left, command=self.list.xview, orient="horizontal") self.list.configure(xscrollcommand=hsb.set, yscrollcommand=vsb.set) self.list.grid(row=0, column=1, sticky="nsew", padx=0, pady=0) vsb.grid(row=0, column=0, sticky="ns") hsb.grid(row=1, column=1, sticky="ew") self.left.grid_rowconfigure(0, weight=1) self.left.grid_columnconfigure(1, weight=1) self.list.bind("<<ListboxSelect>>", self.on_list_selection) # start with them invisible; they will reappear when needed vsb.grid_remove() hsb.grid_remove() def get_current_page(self): return self.current_page def on_list_selection(self, event): page = self.list.get()[1] self._select_page(page) def delete_page(self, page): print __file__, "delete_page is presently under development..." if page in self.pages: self.pages.remove(page) self.list.remove(page) selection = self.list.get() page.pack_forget() page.destroy() # if selection is not None and len(selection) > 0: # self.select_page(selection[1]) def _page_name_changed(self, page): self.list.rename(page) def get_page_by_name(self, name): for page in self.pages: if page.name == name: return page return None def get_page_for_path(self, path): target_path = os.path.abspath(path) for page in self.pages: if page.path == target_path: return page return None def add_custom_page(self, page_class): new_page = page_class(self.right) self.pages.append(new_page) self.list.add(new_page.name, new_page) self._select_page(new_page) return new_page def add_page(self, path=None, name=None): if path is None and name is None: raise Exception("you must specify either a path or a name") if path is not None and name is not None: raise Exception("you cannot specify both a path and a name") new_page = EditorPage(self.right, path, name=name, app=self.app) new_page.bind("<<NameChanged>>", lambda event, page=new_page: self._page_name_changed(page)) self.pages.append(new_page) self.list.add(new_page.name, new_page) self._select_page(new_page) return new_page def select_page(self, page): self.list.select(page) def _select_page(self, page): for p in self.pages: p.pack_forget() if page is not None: page.pack(fill="both", expand=True, padx=4, pady=0) self.after_idle(page.focus) self.current_page = page return page
StarcoderdataPython
122171
<reponame>gitter-badger/share-analytics from __future__ import absolute_import, unicode_literals import os import dj_database_url from .base import * #ALLOWED_HOSTS = ['share.osf.io/dashboard'] ALLOWED_HOSTS = ['*'] DEBUG=False if os.environ.get('DEIS'): DATABASES = { 'default': { 'ENGINE': os.environ.get('DATABASE_ENGINE'), 'NAME': os.environ.get('DATABASE_NAME'), 'USER': os.environ.get('DATABASE_USER'), 'PASSWORD': os.environ.get('DATABASE_PASSWORD'), 'HOST': os.environ.get('DATABASE_HOST'), 'PORT': os.environ.get('DATABASE_PORT'), } } else: DATABASES['default'] = dj_database_url.config() # For Heroku SECRET_KEY = os.environ['SECRET_KEY'] try: from .local import * except ImportError: pass
StarcoderdataPython
189897
""" mixcoatl.admin.billing_code --------------------------- Implements access to the DCM Billingcode API """ from mixcoatl.resource import Resource from mixcoatl.decorators.lazy import lazy_property from mixcoatl.decorators.validations import required_attrs from mixcoatl.utils import uncamel, camelize, camel_keys, uncamel_keys import json class BillingCode(Resource): """A billing code is a budget item with optional hard and soft quotas against which cloud resources may be provisioned and tracked.""" PATH = 'admin/BillingCode' COLLECTION_NAME = 'billingCodes' PRIMARY_KEY = 'billing_code_id' def __init__(self, billing_code_id=None, endpoint=None, *args, **kwargs): Resource.__init__(self, endpoint=endpoint) self.__billing_code_id = billing_code_id @property def billing_code_id(self): """`int` - The unique id of this billing code""" return self.__billing_code_id @lazy_property def budget_state(self): """`str` - The ability of users to provision against this budget""" return self.__budget_state @lazy_property def current_usage(self): """`dict` - The month-to-data usage across all clouds for this code""" return self.__current_usage @lazy_property def customer(self): """`dict` - The customer to whom this code belongs""" return self.__customer @lazy_property def description(self): """`str` - User-friendly description of this code""" return self.__description @description.setter def description(self, d): self.__description = d @lazy_property def finance_code(self): """`str` - The alphanumeric identifier of this billing code""" return self.__finance_code @finance_code.setter def finance_code(self, f): self.__finance_code = f @lazy_property def name(self): """`str` - User-friendly name for this billing code""" return self.__name @name.setter def name(self, n): self.__name = n @lazy_property def projected_usage(self): """`dict` - Estimated end-of-month total to be charged against this budget""" return self.__projected_usage @lazy_property def status(self): """`str` - The status of this billing code""" return self.__status @lazy_property def hard_quota(self): """`dict` - Cutoff point where no further resources can be billed to this code""" return self.__hard_quota @hard_quota.setter def hard_quota(self, h): self.__hard_quota = h @lazy_property def soft_quota(self): """`dict` - Point where budget alerts will be triggered for this billing code""" return self.__soft_quota @soft_quota.setter def soft_quota(self, s): self.__soft_quota = s @classmethod def all(cls, keys_only=False, endpoint=None, **kwargs): """Get all visible billing codes .. note:: The keys used to make the original request determine result visibility :param keys_only: Only return :attr:`billing_code_id` instead of :class:`BillingCode` objects :type keys_only: bool. :param detail: The level of detail to return - `basic` or `extended` :type detail: str. :returns: `list` - of :class:`BillingCode` or :attr:`billing_code_id` :raises: :class:`BillingCodeException` """ r = Resource(cls.PATH, endpoint=endpoint) params = {} if 'details' in kwargs: r.request_details = kwargs['details'] else: r.request_details = 'basic' x = r.get() if r.last_error is None: if keys_only is True: return [i[camelize(cls.PRIMARY_KEY)] for i in x[cls.COLLECTION_NAME]] else: return [type(cls.__name__, (object,), i) for i in uncamel_keys(x)[uncamel(cls.COLLECTION_NAME)]] else: raise BillingCodeException(r.last_error) @required_attrs(['soft_quota', 'hard_quota', 'name', 'finance_code', 'description']) def add(self): """Add a new billing code. """ payload = {"addBillingCode": [{ "softQuota": {"value": self.soft_quota, "currency": "USD"}, "hardQuota": {"value": self.hard_quota, "currency": "USD"}, "status": "ACTIVE", "name": self.name, "financeCode": self.finance_code, "description": self.description}]} response = self.post(data=json.dumps(payload)) if self.last_error is None: return response else: raise BillingCodeAddException(self.last_error) @required_attrs(['billing_code_id']) def destroy(self, reason, replacement_code): """Destroy billing code with a specified reason :attr:`reason` :param reason: The reason of destroying the billing code. :type reason: str. :param replacement_code: The replacement code. :type replacement_code: int. :returns: bool -- Result of API call """ p = self.PATH + "/" + str(self.billing_code_id) qopts = {'reason': reason, 'replacementCode': replacement_code} self.delete(p, params=qopts) if self.last_error is None: return True else: raise BillingCodeDestroyException(self.last_error) class BillingCodeException(BaseException): pass class BillingCodeAddException(BillingCodeException): pass class BillingCodeDestroyException(BillingCodeException): pass
StarcoderdataPython
1602188
<filename>chamber/config.py from django.conf import settings as django_settings DEFAULTS = { 'MAX_FILE_UPLOAD_SIZE': 20, 'MULTIDOMAINS_OVERTAKER_AUTH_COOKIE_NAME': None, 'DEFAULT_IMAGE_ALLOWED_CONTENT_TYPES': {'image/jpeg', 'image/png', 'image/gif'}, 'PRIVATE_S3_STORAGE_URL_EXPIRATION': 3600, 'AWS_S3_ON': getattr(django_settings, 'AWS_S3_ON', False), 'AWS_REGION': getattr(django_settings, 'AWS_REGION', None), } class Settings: def __getattr__(self, attr): if attr not in DEFAULTS: raise AttributeError('Invalid CHAMBER setting: "{}"'.format(attr)) default = DEFAULTS[attr] return getattr(django_settings, 'CHAMBER_{}'.format(attr), default(self) if callable(default) else default) settings = Settings()
StarcoderdataPython
3216876
<reponame>codilime/contrail-controller-arch # # Copyright (c) 2013,2014 Juniper Networks, Inc. All rights reserved. # import gevent import os import sys import socket import errno import uuid import logging import coverage import cgitb cgitb.enable(format='text') import testtools from testtools.matchers import Equals, MismatchError, Not, Contains from testtools import content, content_type, ExpectedException import unittest import re import json import copy import inspect import pycassa import kombu import requests import bottle from vnc_api.vnc_api import * import vnc_api.gen.vnc_api_test_gen from vnc_api.gen.resource_test import * import cfgm_common sys.path.append('../common/tests') from test_utils import * import test_common import test_case logger = logging.getLogger(__name__) logger.setLevel(logging.DEBUG) class TestIpAlloc(test_case.ApiServerTestCase): def __init__(self, *args, **kwargs): ch = logging.StreamHandler() ch.setLevel(logging.DEBUG) logger.addHandler(ch) super(TestIpAlloc, self).__init__(*args, **kwargs) def test_subnet_quota(self): domain = Domain('v4-domain') self._vnc_lib.domain_create(domain) # Create Project project = Project('v4-proj', domain) self._vnc_lib.project_create(project) project = self._vnc_lib.project_read(fq_name=['v4-domain', 'v4-proj']) ipam1_sn_v4 = IpamSubnetType(subnet=SubnetType('172.16.58.3', 28)) ipam2_sn_v4 = IpamSubnetType(subnet=SubnetType('172.16.17.32', 28)) ipam3_sn_v4 = IpamSubnetType(subnet=SubnetType('192.168.3.11', 28)) ipam4_sn_v4 = IpamSubnetType(subnet=SubnetType('192.168.3.11', 28)) #create two ipams ipam1 = NetworkIpam('ipam1', project, IpamType("dhcp")) self._vnc_lib.network_ipam_create(ipam1) ipam1 = self._vnc_lib.network_ipam_read(fq_name=['v4-domain', 'v4-proj', 'ipam1']) ipam2 = NetworkIpam('ipam2', project, IpamType("dhcp")) self._vnc_lib.network_ipam_create(ipam2) ipam2 = self._vnc_lib.network_ipam_read(fq_name=['v4-domain', 'v4-proj', 'ipam2']) #create virtual network with unlimited subnet quota without any subnets vn = VirtualNetwork('my-vn', project) vn.add_network_ipam(ipam1, VnSubnetsType([])) vn.add_network_ipam(ipam2, VnSubnetsType([])) self._vnc_lib.virtual_network_create(vn) net_obj = self._vnc_lib.virtual_network_read(id = vn.uuid) #inspect net_obj to make sure we have 0 cidrs ipam_refs = net_obj.__dict__.get('network_ipam_refs', []) def _get_total_subnets_count(ipam_refs): subnet_count = 0 for ipam_ref in ipam_refs: vnsn_data = ipam_ref['attr'].__dict__ ipam_subnets = vnsn_data.get('ipam_subnets', []) for ipam_subnet in ipam_subnets: subnet_dict = ipam_subnet.__dict__.get('subnet', {}) if 'ip_prefix' in subnet_dict.__dict__: subnet_count += 1 return subnet_count total_subnets = _get_total_subnets_count(ipam_refs) if total_subnets: raise Exception("No Subnets expected in Virtual Network") self._vnc_lib.virtual_network_delete(id=vn.uuid) #keep subnet quota unlimited and have 4 cidrs in two ipams vn = VirtualNetwork('my-vn', project) vn.add_network_ipam(ipam1, VnSubnetsType([ipam1_sn_v4, ipam3_sn_v4])) vn.add_network_ipam(ipam2, VnSubnetsType([ipam2_sn_v4, ipam4_sn_v4])) self._vnc_lib.virtual_network_create(vn) net_obj = self._vnc_lib.virtual_network_read(id = vn.uuid) #inspect net_obj to make sure we have 4 cidrs ipam_refs = net_obj.__dict__.get('network_ipam_refs', []) total_subnets = _get_total_subnets_count(ipam_refs) if total_subnets != 4: raise Exception("4 Subnets expected in Virtual Network") #Delete vn and create new one with a subnet quota of 1 self._vnc_lib.virtual_network_delete(id=vn.uuid) quota_type = QuotaType() quota_type.set_subnet(1) project.set_quota(quota_type) self._vnc_lib.project_update(project) vn = VirtualNetwork('my-new-vn', project) vn.add_network_ipam(ipam1, VnSubnetsType([ipam1_sn_v4])) vn.add_network_ipam(ipam2, VnSubnetsType([ipam2_sn_v4])) with ExpectedException(cfgm_common.exceptions.OverQuota): self._vnc_lib.virtual_network_create(vn) #increase subnet quota to 2, and network_create will go through.. quota_type.set_subnet(2) project.set_quota(quota_type) self._vnc_lib.project_update(project) self._vnc_lib.virtual_network_create(vn) net_obj = self._vnc_lib.virtual_network_read(id = vn.uuid) ipam_refs = net_obj.__dict__.get('network_ipam_refs', []) total_subnets = _get_total_subnets_count(ipam_refs) if total_subnets != 2: raise Exception("2 Subnets expected in Virtual Network") #test quota through network_update vn.add_network_ipam(ipam1, VnSubnetsType([ipam1_sn_v4, ipam3_sn_v4])) vn.add_network_ipam(ipam2, VnSubnetsType([ipam2_sn_v4])) with ExpectedException(cfgm_common.exceptions.OverQuota): self._vnc_lib.virtual_network_update(vn) self._vnc_lib.virtual_network_delete(id=vn.uuid) quota_type.set_subnet(4) project.set_quota(quota_type) self._vnc_lib.project_update(project) vn = VirtualNetwork('my-new-vn', project) vn.add_network_ipam(ipam1, VnSubnetsType([ipam1_sn_v4])) vn.add_network_ipam(ipam2, VnSubnetsType([ipam2_sn_v4])) self._vnc_lib.virtual_network_create(vn) vn.add_network_ipam(ipam1, VnSubnetsType([ipam1_sn_v4, ipam3_sn_v4])) vn.add_network_ipam(ipam2, VnSubnetsType([ipam2_sn_v4, ipam4_sn_v4])) self._vnc_lib.virtual_network_update(vn) net_obj = self._vnc_lib.virtual_network_read(id = vn.uuid) ipam_refs = net_obj.__dict__.get('network_ipam_refs', []) total_subnets = _get_total_subnets_count(ipam_refs) if total_subnets != 4: raise Exception("4 Subnets expected in Virtual Network") self._vnc_lib.virtual_network_delete(id=vn.uuid) self._vnc_lib.network_ipam_delete(id=ipam1.uuid) self._vnc_lib.network_ipam_delete(id=ipam2.uuid) self._vnc_lib.project_delete(id=project.uuid) def test_subnet_alloc_unit(self): # Create Domain domain = Domain('my-v4-v6-domain') self._vnc_lib.domain_create(domain) logger.debug('Created domain ') # Create Project project = Project('my-v4-v6-proj', domain) self._vnc_lib.project_create(project) logger.debug('Created Project') # Create NetworkIpam ipam = NetworkIpam('default-network-ipam', project, IpamType("dhcp")) self._vnc_lib.network_ipam_create(ipam) logger.debug('Created network ipam') ipam = self._vnc_lib.network_ipam_read(fq_name=['my-v4-v6-domain', 'my-v4-v6-proj', 'default-network-ipam']) logger.debug('Read network ipam') # create ipv4 subnet with alloc_unit not power of 2 ipam_sn_v4 = IpamSubnetType(subnet=SubnetType('172.16.58.3', 24), alloc_unit=3) vn = VirtualNetwork('my-v4-v6-vn', project) vn.add_network_ipam(ipam, VnSubnetsType([ipam_sn_v4])) try: self._vnc_lib.virtual_network_create(vn) except HttpError: logger.debug('alloc-unit is not power of 2') pass vn.del_network_ipam(ipam) # create ipv6 subnet with alloc_unit not power of 2 ipam_sn_v6 = IpamSubnetType(subnet=SubnetType('fd14::', 120), alloc_unit=3) vn.add_network_ipam(ipam, VnSubnetsType([ipam_sn_v6])) try: self._vnc_lib.virtual_network_create(vn) except HttpError: logger.debug('alloc-unit is not power of 2') pass vn.del_network_ipam(ipam) # Create subnets ipam_sn_v4 = IpamSubnetType(subnet=SubnetType('172.16.58.3', 24), alloc_unit=4) ipam_sn_v6 = IpamSubnetType(subnet=SubnetType('fd14::', 120), alloc_unit=4) vn.add_network_ipam(ipam, VnSubnetsType([ipam_sn_v4, ipam_sn_v6])) self._vnc_lib.virtual_network_create(vn) logger.debug('Created Virtual Network object %s', vn.uuid) net_obj = self._vnc_lib.virtual_network_read(id = vn.uuid) # Create v4 Ip objects ipv4_obj1 = InstanceIp(name=str(uuid.uuid4()), instance_ip_family='v4') ipv4_obj1.uuid = ipv4_obj1.name logger.debug('Created Instance IPv4 object 1 %s', ipv4_obj1.uuid) ipv4_obj2 = InstanceIp(name=str(uuid.uuid4()), instance_ip_family='v4') ipv4_obj2.uuid = ipv4_obj2.name logger.debug('Created Instance IPv4 object 2 %s', ipv4_obj2.uuid) # Create v6 Ip object ipv6_obj1 = InstanceIp(name=str(uuid.uuid4()), instance_ip_family='v6') ipv6_obj1.uuid = ipv6_obj1.name logger.debug('Created Instance IPv6 object 2 %s', ipv6_obj1.uuid) ipv6_obj2 = InstanceIp(name=str(uuid.uuid4()), instance_ip_family='v6') ipv6_obj2.uuid = ipv6_obj2.name logger.debug('Created Instance IPv6 object 2 %s', ipv6_obj2.uuid) # Create VM vm_inst_obj1 = VirtualMachine(str(uuid.uuid4())) vm_inst_obj1.uuid = vm_inst_obj1.name self._vnc_lib.virtual_machine_create(vm_inst_obj1) id_perms = IdPermsType(enable=True) port_obj1 = VirtualMachineInterface( str(uuid.uuid4()), vm_inst_obj1, id_perms=id_perms) port_obj1.uuid = port_obj1.name port_obj1.set_virtual_network(vn) ipv4_obj1.set_virtual_machine_interface(port_obj1) ipv4_obj1.set_virtual_network(net_obj) ipv4_obj2.set_virtual_machine_interface(port_obj1) ipv4_obj2.set_virtual_network(net_obj) ipv6_obj1.set_virtual_machine_interface(port_obj1) ipv6_obj1.set_virtual_network(net_obj) ipv6_obj2.set_virtual_machine_interface(port_obj1) ipv6_obj2.set_virtual_network(net_obj) port_id1 = self._vnc_lib.virtual_machine_interface_create(port_obj1) logger.debug('Wrong ip address request,not aligned with alloc-unit') ipv4_obj1.set_instance_ip_address('172.16.58.3') with ExpectedException(BadRequest, 'Virtual-Network\(my-v4-v6-domain:my-v4-v6-proj:my-v4-v6-vn:172.16.58.3/24\) has invalid alloc_unit\(4\) in subnet\(172.16.58.3/24\)') as e: ipv4_id1 = self._vnc_lib.instance_ip_create(ipv4_obj1) ipv4_obj1.set_instance_ip_address(None) logger.debug('Allocating an IP4 address for first VM') ipv4_id1 = self._vnc_lib.instance_ip_create(ipv4_obj1) ipv4_obj1 = self._vnc_lib.instance_ip_read(id=ipv4_id1) ipv4_addr1 = ipv4_obj1.get_instance_ip_address() logger.debug(' got v4 IP Address for first instance %s', ipv4_addr1) if ipv4_addr1 != '192.168.3.11': logger.debug('Allocation failed, expected v4 IP Address 192.168.3.11') logger.debug('Allocating an IPV4 address for second VM') ipv4_id2 = self._vnc_lib.instance_ip_create(ipv4_obj2) ipv4_obj2 = self._vnc_lib.instance_ip_read(id=ipv4_id2) ipv4_addr2 = ipv4_obj2.get_instance_ip_address() logger.debug(' got v6 IP Address for first instance %s', ipv4_addr2) if ipv4_addr2 != '192.168.127.12': logger.debug('Allocation failed, expected v4 IP Address 192.168.127.12') logger.debug('Allocating an IP6 address for first VM') ipv6_id1 = self._vnc_lib.instance_ip_create(ipv6_obj1) ipv6_obj1 = self._vnc_lib.instance_ip_read(id=ipv6_id1) ipv6_addr1 = ipv6_obj1.get_instance_ip_address() logger.debug(' got v6 IP Address for first instance %s', ipv6_addr1) if ipv6_addr1 != 'fd14::f8': logger.debug('Allocation failed, expected v6 IP Address fd14::f8') logger.debug('Allocating an IP6 address for second VM') ipv6_id2 = self._vnc_lib.instance_ip_create(ipv6_obj2) ipv6_obj2 = self._vnc_lib.instance_ip_read(id=ipv6_id2) ipv6_addr2 = ipv6_obj2.get_instance_ip_address() logger.debug(' got v6 IP Address for first instance %s', ipv6_addr2) if ipv6_addr2 != 'fd14::f4': logger.debug('Allocation failed, expected v6 IP Address fd14::f4') #cleanup logger.debug('Cleaning up') self._vnc_lib.instance_ip_delete(id=ipv4_id1) self._vnc_lib.instance_ip_delete(id=ipv4_id2) self._vnc_lib.instance_ip_delete(id=ipv6_id1) self._vnc_lib.instance_ip_delete(id=ipv6_id2) self._vnc_lib.virtual_machine_interface_delete(id=port_obj1.uuid) self._vnc_lib.virtual_machine_delete(id=vm_inst_obj1.uuid) self._vnc_lib.virtual_network_delete(id=vn.uuid) self._vnc_lib.network_ipam_delete(id=ipam.uuid) self._vnc_lib.project_delete(id=project.uuid) self._vnc_lib.domain_delete(id=domain.uuid) #end def test_ip_alloction(self): # Create Domain domain = Domain('my-v4-v6-domain') self._vnc_lib.domain_create(domain) logger.debug('Created domain ') # Create Project project = Project('my-v4-v6-proj', domain) self._vnc_lib.project_create(project) logger.debug('Created Project') # Create NetworkIpam ipam = NetworkIpam('default-network-ipam', project, IpamType("dhcp")) self._vnc_lib.network_ipam_create(ipam) logger.debug('Created network ipam') ipam = self._vnc_lib.network_ipam_read(fq_name=['my-v4-v6-domain', 'my-v4-v6-proj', 'default-network-ipam']) logger.debug('Read network ipam') # Create subnets ipam_sn_v4 = IpamSubnetType(subnet=SubnetType('172.16.58.3', 24)) ipam_sn_v6 = IpamSubnetType(subnet=SubnetType('fd14::', 120)) # Create VN vn = VirtualNetwork('my-v4-v6-vn', project) vn.add_network_ipam(ipam, VnSubnetsType([ipam_sn_v4, ipam_sn_v6])) self._vnc_lib.virtual_network_create(vn) logger.debug('Created Virtual Network object %s', vn.uuid) net_obj = self._vnc_lib.virtual_network_read(id = vn.uuid) # Create v4 Ip object ip_obj1 = InstanceIp(name=str(uuid.uuid4()), instance_ip_family='v4') ip_obj1.uuid = ip_obj1.name logger.debug('Created Instance IP object 1 %s', ip_obj1.uuid) # Create v6 Ip object ip_obj2 = InstanceIp(name=str(uuid.uuid4()), instance_ip_family='v6') ip_obj2.uuid = ip_obj2.name logger.debug('Created Instance IP object 2 %s', ip_obj2.uuid) # Create VM vm_inst_obj1 = VirtualMachine(str(uuid.uuid4())) vm_inst_obj1.uuid = vm_inst_obj1.name self._vnc_lib.virtual_machine_create(vm_inst_obj1) id_perms = IdPermsType(enable=True) port_obj1 = VirtualMachineInterface( str(uuid.uuid4()), vm_inst_obj1, id_perms=id_perms) port_obj1.uuid = port_obj1.name port_obj1.set_virtual_network(vn) ip_obj1.set_virtual_machine_interface(port_obj1) ip_obj1.set_virtual_network(net_obj) ip_obj2.set_virtual_machine_interface(port_obj1) ip_obj2.set_virtual_network(net_obj) port_id1 = self._vnc_lib.virtual_machine_interface_create(port_obj1) logger.debug('Allocating an IP4 address for first VM') ip_id1 = self._vnc_lib.instance_ip_create(ip_obj1) ip_obj1 = self._vnc_lib.instance_ip_read(id=ip_id1) ip_addr1 = ip_obj1.get_instance_ip_address() logger.debug(' got v4 IP Address for first instance %s', ip_addr1) if ip_addr1 != '192.168.3.11': logger.debug('Allocation failed, expected v4 IP Address 192.168.3.11') logger.debug('Allocating an IP6 address for first VM') ip_id2 = self._vnc_lib.instance_ip_create(ip_obj2) ip_obj2 = self._vnc_lib.instance_ip_read(id=ip_id2) ip_addr2 = ip_obj2.get_instance_ip_address() logger.debug(' got v6 IP Address for first instance %s', ip_addr2) if ip_addr2 != 'fd14::fd': logger.debug('Allocation failed, expected v6 IP Address fd14::fd') # Read gateway ip address logger.debug('Read default gateway ip address' ) ipam_refs = net_obj.get_network_ipam_refs() for ipam_ref in ipam_refs: subnets = ipam_ref['attr'].get_ipam_subnets() for subnet in subnets: logger.debug('Gateway for subnet (%s/%s) is (%s)' %(subnet.subnet.get_ip_prefix(), subnet.subnet.get_ip_prefix_len(), subnet.get_default_gateway())) #cleanup logger.debug('Cleaning up') self._vnc_lib.instance_ip_delete(id=ip_id1) self._vnc_lib.instance_ip_delete(id=ip_id2) self._vnc_lib.virtual_machine_interface_delete(id=port_obj1.uuid) self._vnc_lib.virtual_machine_delete(id=vm_inst_obj1.uuid) self._vnc_lib.virtual_network_delete(id=vn.uuid) self._vnc_lib.network_ipam_delete(id=ipam.uuid) self._vnc_lib.project_delete(id=project.uuid) self._vnc_lib.domain_delete(id=domain.uuid) #end def test_ip_alloction_pools(self): # Create Domain domain = Domain('my-v4-v6-domain') self._vnc_lib.domain_create(domain) logger.debug('Created domain ') # Create Project project = Project('my-v4-v6-proj', domain) self._vnc_lib.project_create(project) logger.debug('Created Project') # Create NetworkIpam ipam = NetworkIpam('default-network-ipam', project, IpamType("dhcp")) self._vnc_lib.network_ipam_create(ipam) logger.debug('Created network ipam') ipam = self._vnc_lib.network_ipam_read(fq_name=['my-v4-v6-domain', 'my-v4-v6-proj', 'default-network-ipam']) logger.debug('Read network ipam') # Create subnets alloc_pool_list = [] alloc_pool_list.append(AllocationPoolType(start='172.16.31.10', end='192.168.127.12')) ipam_sn_v4 = IpamSubnetType(subnet=SubnetType('172.16.58.3', 24), allocation_pools=alloc_pool_list, addr_from_start=True) alloc_pool_list_v6 = [] alloc_pool_list_v6.append(AllocationPoolType(start='fd14::30', end='fd14::40')) ipam_sn_v6 = IpamSubnetType(subnet=SubnetType('fd14::', 120), allocation_pools=alloc_pool_list_v6, addr_from_start=True) # Create VN vn = VirtualNetwork('my-v4-v6-vn', project) vn.add_network_ipam(ipam, VnSubnetsType([ipam_sn_v4, ipam_sn_v6])) self._vnc_lib.virtual_network_create(vn) logger.debug('Created Virtual Network object %s', vn.uuid) net_obj = self._vnc_lib.virtual_network_read(id = vn.uuid) # Create v4 Ip object ip_obj1 = InstanceIp(name=str(uuid.uuid4()), instance_ip_family='v4') ip_obj1.uuid = ip_obj1.name logger.debug('Created Instance IP object 1 %s', ip_obj1.uuid) # Create v6 Ip object ip_obj2 = InstanceIp(name=str(uuid.uuid4()), instance_ip_family='v6') ip_obj2.uuid = ip_obj2.name logger.debug('Created Instance IP object 2 %s', ip_obj2.uuid) # Create VM vm_inst_obj1 = VirtualMachine(str(uuid.uuid4())) vm_inst_obj1.uuid = vm_inst_obj1.name self._vnc_lib.virtual_machine_create(vm_inst_obj1) id_perms = IdPermsType(enable=True) port_obj1 = VirtualMachineInterface( str(uuid.uuid4()), vm_inst_obj1, id_perms=id_perms) port_obj1.uuid = port_obj1.name port_obj1.set_virtual_network(vn) ip_obj1.set_virtual_machine_interface(port_obj1) ip_obj1.set_virtual_network(net_obj) ip_obj2.set_virtual_machine_interface(port_obj1) ip_obj2.set_virtual_network(net_obj) port_id1 = self._vnc_lib.virtual_machine_interface_create(port_obj1) logger.debug('Allocating an IP4 address for first VM') ip_id1 = self._vnc_lib.instance_ip_create(ip_obj1) ip_obj1 = self._vnc_lib.instance_ip_read(id=ip_id1) ip_addr1 = ip_obj1.get_instance_ip_address() logger.debug('got v4 IP Address for first instance %s', ip_addr1) if ip_addr1 != '172.16.31.10': logger.debug('Allocation failed, expected v4 IP Address 172.16.31.10') logger.debug('Allocating an IP6 address for first VM') ip_id2 = self._vnc_lib.instance_ip_create(ip_obj2) ip_obj2 = self._vnc_lib.instance_ip_read(id=ip_id2) ip_addr2 = ip_obj2.get_instance_ip_address() logger.debug('got v6 IP Address for first instance %s', ip_addr2) if ip_addr2 != 'fd14::30': logger.debug('Allocation failed, expected v6 IP Address fd14::30') # Read gateway ip address logger.debug('Read default gateway ip address') ipam_refs = net_obj.get_network_ipam_refs() for ipam_ref in ipam_refs: subnets = ipam_ref['attr'].get_ipam_subnets() for subnet in subnets: logger.debug('Gateway for subnet (%s/%s) is (%s)' %(subnet.subnet.get_ip_prefix(), subnet.subnet.get_ip_prefix_len(), subnet.get_default_gateway())) #cleanup logger.debug('Cleaning up') #cleanup subnet and allocation pools self._vnc_lib.instance_ip_delete(id=ip_id1) self._vnc_lib.instance_ip_delete(id=ip_id2) self._vnc_lib.virtual_machine_interface_delete(id=port_obj1.uuid) self._vnc_lib.virtual_machine_delete(id=vm_inst_obj1.uuid) self._vnc_lib.virtual_network_delete(id=vn.uuid) self._vnc_lib.network_ipam_delete(id=ipam.uuid) self._vnc_lib.project_delete(id=project.uuid) self._vnc_lib.domain_delete(id=domain.uuid) #end def test_subnet_gateway_ip_alloc(self): # Create Domain domain = Domain('my-v4-v6-domain') self._vnc_lib.domain_create(domain) logger.debug('Created domain ') # Create Project project = Project('my-v4-v6-proj', domain) self._vnc_lib.project_create(project) logger.debug('Created Project') # Create NetworkIpam ipam = NetworkIpam('default-network-ipam', project, IpamType("dhcp")) self._vnc_lib.network_ipam_create(ipam) logger.debug('Created network ipam') ipam = self._vnc_lib.network_ipam_read(fq_name=['my-v4-v6-domain', 'my-v4-v6-proj', 'default-network-ipam']) logger.debug('Read network ipam') # Create subnets alloc_pool_list = [] alloc_pool_list.append(AllocationPoolType(start='172.16.31.10', end='192.168.127.12')) ipam_sn_v4 = IpamSubnetType(subnet=SubnetType('172.16.58.3', 24), allocation_pools=alloc_pool_list, addr_from_start=True) alloc_pool_list_v6 = [] alloc_pool_list_v6.append(AllocationPoolType(start='fd14::30', end='fd14::40')) ipam_sn_v6 = IpamSubnetType(subnet=SubnetType('fd14::', 120), allocation_pools=alloc_pool_list_v6, addr_from_start=True) # Create VN vn = VirtualNetwork('my-v4-v6-vn', project) vn.add_network_ipam(ipam, VnSubnetsType([ipam_sn_v4, ipam_sn_v6])) self._vnc_lib.virtual_network_create(vn) logger.debug('Created Virtual Network object %s', vn.uuid) net_obj = self._vnc_lib.virtual_network_read(id = vn.uuid) # Read gateway ip address logger.debug('Read default gateway ip address') ipam_refs = net_obj.get_network_ipam_refs() for ipam_ref in ipam_refs: subnets = ipam_ref['attr'].get_ipam_subnets() for subnet in subnets: logger.debug('Gateway for subnet (%s/%s) is (%s)' %(subnet.subnet.get_ip_prefix(), subnet.subnet.get_ip_prefix_len(), subnet.get_default_gateway())) if subnet.subnet.get_ip_prefix() == '172.16.58.3': if subnet.get_default_gateway() != '192.168.3.11': logger.debug(' Failure, expected gateway ip address 192.168.3.11') if subnet.subnet.get_ip_prefix() == 'fd14::': if subnet.get_default_gateway() != 'fd14::1': logger.debug(' Failure, expected gateway ip address fd14::1') #cleanup logger.debug('Cleaning up') self._vnc_lib.virtual_network_delete(id=vn.uuid) self._vnc_lib.network_ipam_delete(id=ipam.uuid) self._vnc_lib.project_delete(id=project.uuid) self._vnc_lib.domain_delete(id=domain.uuid) #end def test_bulk_ip_alloc_free(self): # Create Domain domain = Domain('v4-domain') self._vnc_lib.domain_create(domain) logger.debug('Created domain ') # Create Project project = Project('v4-proj', domain) self._vnc_lib.project_create(project) logger.debug('Created Project') # Create NetworkIpam ipam = NetworkIpam('default-network-ipam', project, IpamType("dhcp")) self._vnc_lib.network_ipam_create(ipam) logger.debug('Created network ipam') ipam = self._vnc_lib.network_ipam_read(fq_name=['v4-domain', 'v4-proj', 'default-network-ipam']) logger.debug('Read network ipam') # Create subnets ipam_sn_v4 = IpamSubnetType(subnet=SubnetType('172.16.58.3', 24)) # Create VN vn = VirtualNetwork('v4-vn', project) vn.add_network_ipam(ipam, VnSubnetsType([ipam_sn_v4])) self._vnc_lib.virtual_network_create(vn) logger.debug('Created Virtual Network object %s', vn.uuid) net_obj = self._vnc_lib.virtual_network_read(id = vn.uuid) # request to allocate 10 ip address using bulk allocation api data = {"subnet" : "172.16.58.3/24", "count" : 10} url = '/virtual-network/%s/ip-alloc' %(vn.uuid) rv_json = self._vnc_lib._request_server(rest.OP_POST, url, json.dumps(data)) ret_data = json.loads(rv_json) ret_ip_addr = ret_data['ip_addr'] expected_ip_addr = ['192.168.3.11', '172.16.31.10', '172.16.17.32', '172.16.58.3', '192.168.3.11', '172.16.31.10', '172.16.31.10', '192.168.3.11', '192.168.127.12', '192.168.127.12'] self.assertEqual(len(expected_ip_addr), len(ret_ip_addr)) for idx in range(len(expected_ip_addr)): self.assertEqual(expected_ip_addr[idx], ret_ip_addr[idx]) logger.debug('Verify bulk ip address allocation') # Find out number of allocated ips from given VN/subnet # We should not get 13 ip allocated from this subnet # 10 user request + 3 reserved ips (first, last and gw). data = {"subnet_list" : ["172.16.58.3/24"]} url = '/virtual-network/%s/subnet-ip-count' %(vn.uuid) rv_json = self._vnc_lib._request_server(rest.OP_POST, url, json.dumps(data)) ret_ip_count = json.loads(rv_json)['ip_count_list'][0] allocated_ip = ret_ip_count - 3 self.assertEqual(allocated_ip, 10) #free 5 allocated ip addresses from vn data = {"subnet" : "172.16.58.3/24", "ip_addr" : ['192.168.3.11', '172.16.31.10', '172.16.17.32', '172.16.58.3', '192.168.3.11']} url = '/virtual-network/%s/ip-free' %(vn.uuid) self._vnc_lib._request_server(rest.OP_POST, url, json.dumps(data)) # Find out number of allocated ips from given VN/subnet # We should get 5+3 ip allocated from this subnet data = {"subnet_list" : ["172.16.58.3/24"]} url = '/virtual-network/%s/subnet-ip-count' %(vn.uuid) rv_json = self._vnc_lib._request_server(rest.OP_POST, url, json.dumps(data)) ret_ip_count = json.loads(rv_json)['ip_count_list'][0] allocated_ip = ret_ip_count - 3 self.assertEqual(allocated_ip, 5) #free remaining 5 allocated ip addresses from vn data = {"subnet" : "172.16.58.3/24", "ip_addr": ['172.16.31.10', '172.16.31.10', '192.168.3.11', '192.168.127.12', '192.168.127.12']} url = '/virtual-network/%s/ip-free' %(vn.uuid) self._vnc_lib._request_server(rest.OP_POST, url, json.dumps(data)) data = {"subnet_list" : ["172.16.58.3/24"]} url = '/virtual-network/%s/subnet-ip-count' %(vn.uuid) rv_json = self._vnc_lib._request_server(rest.OP_POST, url, json.dumps(data)) ret_ip_count = json.loads(rv_json)['ip_count_list'][0] allocated_ip = ret_ip_count - 3 self.assertEqual(allocated_ip, 0) logger.debug('Verified bulk ip free') # cleanup self._vnc_lib.virtual_network_delete(id=vn.uuid) self._vnc_lib.network_ipam_delete(id=ipam.uuid) self._vnc_lib.project_delete(id=project.uuid) self._vnc_lib.domain_delete(id=domain.uuid) #end def test_v4_ip_allocation_exhaust(self): # Create Domain domain = Domain('v4-domain') self._vnc_lib.domain_create(domain) logger.debug('Created domain ') # Create Project project = Project('v4-proj', domain) self._vnc_lib.project_create(project) logger.debug('Created Project') # Create NetworkIpam ipam = NetworkIpam('default-network-ipam', project, IpamType("dhcp")) self._vnc_lib.network_ipam_create(ipam) logger.debug('Created network ipam') ipam = self._vnc_lib.network_ipam_read(fq_name=['v4-domain', 'v4-proj', 'default-network-ipam']) logger.debug('Read network ipam') ip_alloc_from_start = [True, False] for from_start in ip_alloc_from_start: # Create subnets alloc_pool_list = [] alloc_pool_list.append( AllocationPoolType(start='192.168.3.11', end='172.16.31.10')) alloc_pool_list.append( AllocationPoolType(start='172.16.58.3', end='172.16.31.10')) ipam_sn_v4 = IpamSubnetType(subnet=SubnetType('172.16.58.3', 24), allocation_pools=alloc_pool_list, addr_from_start=from_start) ip_addr_list = [] for alloc_pool in alloc_pool_list: start_ip = alloc_pool.start end_ip = alloc_pool.end start = list(map(int, start_ip.split("."))) end = list(map(int, end_ip.split("."))) temp = start ip_addr_list.append(start_ip) while temp != end: start[3] += 1 for i in (3, 2, 1): if temp[i] == 256: temp[i] = 0 temp[i-1] += 1 ip_addr_list.append(".".join(map(str, temp))) if from_start is False: ip_addr_list.reverse() total_addr = len(ip_addr_list) logger.debug('ip address alloc list: %s', ip_addr_list[0:total_addr]) # Create VN vn = VirtualNetwork('v4-vn', project) vn.add_network_ipam(ipam, VnSubnetsType([ipam_sn_v4])) self._vnc_lib.virtual_network_create(vn) logger.debug('Created Virtual Network object %s', vn.uuid) net_obj = self._vnc_lib.virtual_network_read(id = vn.uuid) # Create v4 Ip object for all possible addresses in alloc_pool v4_ip_obj_list = [] for idx, val in enumerate(ip_addr_list): v4_ip_obj_list.append( InstanceIp(name=str(uuid.uuid4()), instance_ip_family='v4')) v4_ip_obj_list[idx].uuid = v4_ip_obj_list[idx].name logger.debug('Created Instance IP object %s %s',idx, v4_ip_obj_list[idx].uuid) # Create number of VMs to assign ip addresses # to use all addresses in alloc_pool vm_list_v4 = [] for idx, val in enumerate(ip_addr_list): vm_list_v4.append(VirtualMachine(str(uuid.uuid4()))) vm_list_v4[idx].uuid = vm_list_v4[idx].name self._vnc_lib.virtual_machine_create(vm_list_v4[idx]) port_list = [] port_id_list = [] for idx, val in enumerate(ip_addr_list): id_perms = IdPermsType(enable=True) port_list.append( VirtualMachineInterface(str(uuid.uuid4()), vm_list_v4[idx], id_perms=id_perms)) port_list[idx].uuid = port_list[idx].name port_list[idx].set_virtual_network(vn) v4_ip_obj_list[idx].set_virtual_machine_interface(port_list[idx]) v4_ip_obj_list[idx].set_virtual_network(net_obj) port_id_list.append( self._vnc_lib.virtual_machine_interface_create(port_list[idx])) ip_ids = [] logger.debug('Allocating an IP4 address for VMs') for idx, val in enumerate(ip_addr_list): ip_ids.append( self._vnc_lib.instance_ip_create(v4_ip_obj_list[idx])) v4_ip_obj_list[idx] = self._vnc_lib.instance_ip_read( id=ip_ids[idx]) ip_addr = v4_ip_obj_list[idx].get_instance_ip_address() logger.debug('got v4 IP Address for instance %s:%s', idx, ip_addr) if ip_addr != ip_addr_list[idx]: logger.debug('Allocation failed, expected v4 IP Address: %s', ip_addr_list[idx]) # Find out number of allocated ips from given VN/subnet to test # vn_subnet_ip_count_http_post() data = {"subnet_list" : ["172.16.58.3/24"]} url = '/virtual-network/%s/subnet-ip-count' %(vn.uuid) rv_json = self._vnc_lib._request_server(rest.OP_POST, url, json.dumps(data)) ret_ip_count = json.loads(rv_json)['ip_count_list'][0] total_ip_addr = len(ip_addr_list) self.assertEqual(ret_ip_count, total_ip_addr) # Delete 2 VMs (With First and Last IP), associated Ports # and instanace IPs, # recreate them to make sure that we get same ips again. # Repeat this for 2 VMs from middle of the alloc_pool total_ip_addr = len(ip_addr_list) to_modifies = [[0, total_ip_addr-1], [total_ip_addr/2 -1, total_ip_addr/2]] for to_modify in to_modifies: logger.debug('Delete Instances %s %s', to_modify[0], to_modify[1]) for idx, val in enumerate(to_modify): self._vnc_lib.instance_ip_delete(id=ip_ids[val]) ip_ids[val] = None self._vnc_lib.virtual_machine_interface_delete( id=port_list[val].uuid) port_list[val] = None port_id_list[val] = None self._vnc_lib.virtual_machine_delete( id=vm_list_v4[val].uuid) vm_list_v4[val] = None v4_ip_obj_list[val] = None ip_ids[val] = None logger.debug('Deleted instance %s', val) # Re-create two VMs and assign IP addresses # these should get first and last ip. for idx, val in enumerate(to_modify): v4_ip_obj_list[val] = InstanceIp( name=str(uuid.uuid4()), instance_ip_family='v4') v4_ip_obj_list[val].uuid = v4_ip_obj_list[val].name vm_list_v4[val] = VirtualMachine(str(uuid.uuid4())) vm_list_v4[val].uuid = vm_list_v4[val].name self._vnc_lib.virtual_machine_create(vm_list_v4[val]) id_perms = IdPermsType(enable=True) port_list[val] = VirtualMachineInterface( str(uuid.uuid4()), vm_list_v4[val], id_perms=id_perms) port_list[val].uuid = port_list[val].name port_list[val].set_virtual_network(vn) v4_ip_obj_list[val].set_virtual_machine_interface( port_list[val]) v4_ip_obj_list[val].set_virtual_network(net_obj) port_id_list[val] = self._vnc_lib.virtual_machine_interface_create(port_list[val]) logger.debug('Created instance %s',val) # Allocate IPs to modified VMs for idx, val in enumerate(to_modify): ip_ids[val] = self._vnc_lib.instance_ip_create(v4_ip_obj_list[val]) v4_ip_obj_list[val] = self._vnc_lib.instance_ip_read( id=ip_ids[val]) ip_addr = v4_ip_obj_list[val].get_instance_ip_address() logger.debug('got v4 IP Address for instance %s:%s', val, ip_addr) if ip_addr != ip_addr_list[val]: logger.debug('Allocation failed, expected v4 IP Address: %s', ip_addr_list[val]) # negative test. # Create a new VM and try getting a new instance_ip # we should get an exception as alloc_pool is fully exhausted. logger.debug('Negative Test to create extra instance and try assigning IP address') # Create v4 Ip object ip_obj1 = InstanceIp(name=str(uuid.uuid4()), instance_ip_family='v4') ip_obj1.uuid = ip_obj1.name logger.debug('Created new Instance IP object %s', ip_obj1.uuid) # Create VM vm_inst_obj1 = VirtualMachine(str(uuid.uuid4())) vm_inst_obj1.uuid = vm_inst_obj1.name self._vnc_lib.virtual_machine_create(vm_inst_obj1) id_perms = IdPermsType(enable=True) port_obj1 = VirtualMachineInterface( str(uuid.uuid4()), vm_inst_obj1, id_perms=id_perms) port_obj1.uuid = port_obj1.name port_obj1.set_virtual_network(vn) ip_obj1.set_virtual_machine_interface(port_obj1) ip_obj1.set_virtual_network(net_obj) port_id1 = self._vnc_lib.virtual_machine_interface_create(port_obj1) logger.debug('Created extra instance') logger.debug('Allocating an IP4 address for extra instance') with ExpectedException(BadRequest, 'Virtual-Network\(\[\'v4-domain\', \'v4-proj\', \'v4-vn\'\]\) has exhausted subnet\(all\)') as e: ip_id1 = self._vnc_lib.instance_ip_create(ip_obj1) # cleanup for negative test self._vnc_lib.virtual_machine_interface_delete(id=port_obj1.uuid) self._vnc_lib.virtual_machine_delete(id=vm_inst_obj1.uuid) # user requested instance_ip, if VM is getting created # with user requested ip and ip is already allocated, # system allows VM creation with same ip # Test is with start from begining allocation scheme if from_start is True: # Create a v4 Ip object ip_obj2 = InstanceIp(name=str(uuid.uuid4()), instance_ip_address='192.168.3.11', instance_ip_family='v4') ip_obj2.uuid = ip_obj2.name logger.debug('Created new Instance IP object %s', ip_obj2.uuid) # Create VM vm_inst_obj2 = VirtualMachine(str(uuid.uuid4())) vm_inst_obj2.uuid = vm_inst_obj2.name self._vnc_lib.virtual_machine_create(vm_inst_obj2) id_perms = IdPermsType(enable=True) port_obj2 = VirtualMachineInterface( str(uuid.uuid4()), vm_inst_obj2, id_perms=id_perms) port_obj2.uuid = port_obj2.name port_obj2.set_virtual_network(vn) ip_obj2.set_virtual_machine_interface(port_obj2) ip_obj2.set_virtual_network(net_obj) port_id2 = self._vnc_lib.virtual_machine_interface_create( port_obj2) ip_id2 = self._vnc_lib.instance_ip_create(ip_obj2) #cleanup for user requested IP, VM, port self._vnc_lib.instance_ip_delete(id=ip_id2) self._vnc_lib.virtual_machine_interface_delete( id=port_obj2.uuid) self._vnc_lib.virtual_machine_delete(id=vm_inst_obj2.uuid) #cleanup subnet and allocation pools for idx, val in enumerate(ip_addr_list): self._vnc_lib.instance_ip_delete(id=ip_ids[idx]) self._vnc_lib.virtual_machine_interface_delete( id=port_list[idx].uuid) self._vnc_lib.virtual_machine_delete(id=vm_list_v4[idx].uuid) self._vnc_lib.virtual_network_delete(id=vn.uuid) # end of from_start logger.debug('Cleaning up') self._vnc_lib.network_ipam_delete(id=ipam.uuid) self._vnc_lib.project_delete(id=project.uuid) self._vnc_lib.domain_delete(id=domain.uuid) #end def test_req_ip_allocation(self): # Create Domain domain = Domain('my-v4-v6-req-ip-domain') self._vnc_lib.domain_create(domain) logger.debug('Created domain ') # Create Project project = Project('my-v4-v6-req-ip-proj', domain) self._vnc_lib.project_create(project) logger.debug('Created Project') # Create NetworkIpam ipam = NetworkIpam('default-network-ipam', project, IpamType("dhcp")) self._vnc_lib.network_ipam_create(ipam) logger.debug('Created network ipam') ipam = self._vnc_lib.network_ipam_read(fq_name=['my-v4-v6-req-ip-domain', 'my-v4-v6-req-ip-proj', 'default-network-ipam']) logger.debug('Read network ipam') # Create subnets ipam_sn_v4 = IpamSubnetType(subnet=SubnetType('172.16.58.3', 24)) ipam_sn_v6 = IpamSubnetType(subnet=SubnetType('fd14::', 120)) # Create VN vn = VirtualNetwork('my-v4-v6-vn', project) vn.add_network_ipam(ipam, VnSubnetsType([ipam_sn_v4, ipam_sn_v6])) self._vnc_lib.virtual_network_create(vn) logger.debug('Created Virtual Network object %s', vn.uuid) net_obj = self._vnc_lib.virtual_network_read(id = vn.uuid) # Create v4 Ip object, with v4 requested ip ip_obj1 = InstanceIp(name=str(uuid.uuid4()), instance_ip_address='172.16.58.3', instance_ip_family='v4') ip_obj1.uuid = ip_obj1.name logger.debug('Created Instance IP object 1 %s', ip_obj1.uuid) # Create v6 Ip object with v6 requested ip ip_obj2 = InstanceIp(name=str(uuid.uuid4()), instance_ip_address='fd14::4', instance_ip_family='v6') ip_obj2.uuid = ip_obj2.name logger.debug('Created Instance IP object 2 %s', ip_obj2.uuid) # Create VM vm_inst_obj1 = VirtualMachine(str(uuid.uuid4())) vm_inst_obj1.uuid = vm_inst_obj1.name self._vnc_lib.virtual_machine_create(vm_inst_obj1) id_perms = IdPermsType(enable=True) port_obj1 = VirtualMachineInterface( str(uuid.uuid4()), vm_inst_obj1, id_perms=id_perms) port_obj1.uuid = port_obj1.name port_obj1.set_virtual_network(vn) ip_obj1.set_virtual_machine_interface(port_obj1) ip_obj1.set_virtual_network(net_obj) ip_obj2.set_virtual_machine_interface(port_obj1) ip_obj2.set_virtual_network(net_obj) port_id1 = self._vnc_lib.virtual_machine_interface_create(port_obj1) logger.debug('Allocating an IP4 address for first VM') ip_id1 = self._vnc_lib.instance_ip_create(ip_obj1) ip_obj1 = self._vnc_lib.instance_ip_read(id=ip_id1) ip_addr1 = ip_obj1.get_instance_ip_address() logger.debug(' got v4 IP Address for first instance %s', ip_addr1) if ip_addr1 != '172.16.58.3': logger.debug('Allocation failed, expected v4 IP Address 172.16.58.3') logger.debug('Allocating an IP6 address for first VM') ip_id2 = self._vnc_lib.instance_ip_create(ip_obj2) ip_obj2 = self._vnc_lib.instance_ip_read(id=ip_id2) ip_addr2 = ip_obj2.get_instance_ip_address() logger.debug(' got v6 IP Address for first instance %s', ip_addr2) if ip_addr2 != 'fd14::4': logger.debug('Allocation failed, expected v6 IP Address fd14::4') # Read gateway ip address logger.debug('Read default gateway ip address') ipam_refs = net_obj.get_network_ipam_refs() for ipam_ref in ipam_refs: subnets = ipam_ref['attr'].get_ipam_subnets() for subnet in subnets: logger.debug('Gateway for subnet (%s/%s) is (%s)' %(subnet.subnet.get_ip_prefix(), subnet.subnet.get_ip_prefix_len(), subnet.get_default_gateway())) #cleanup logger.debug('Cleaning up') self._vnc_lib.instance_ip_delete(id=ip_id1) self._vnc_lib.instance_ip_delete(id=ip_id2) self._vnc_lib.virtual_machine_interface_delete(id=port_obj1.uuid) self._vnc_lib.virtual_machine_delete(id=vm_inst_obj1.uuid) self._vnc_lib.virtual_network_delete(id=vn.uuid) self._vnc_lib.network_ipam_delete(id=ipam.uuid) self._vnc_lib.project_delete(id=project.uuid) self._vnc_lib.domain_delete(id=domain.uuid) #end def test_notify_doesnt_persist(self): # net/ip notify context shouldn't persist to db, should only # update in-memory book-keeping def_ipam = NetworkIpam() ipam_obj = self._vnc_lib.network_ipam_read( fq_name=def_ipam.get_fq_name()) vn_obj = VirtualNetwork('vn-%s' %(self.id())) ipam_sn_v4 = IpamSubnetType(subnet=SubnetType('172.16.58.3', 24)) vn_obj.add_network_ipam(ipam_obj, VnSubnetsType([ipam_sn_v4])) self._vnc_lib.virtual_network_create(vn_obj) iip_obj = InstanceIp('iip-%s' %(self.id())) iip_obj.add_virtual_network(vn_obj) class SpyCreateNode(object): def __init__(self, orig_object, method_name): self._orig_method = getattr(orig_object, method_name) self._invoked = 0 # end __init__ def __call__(self, *args, **kwargs): if self._invoked >= 1: raise Exception( "Instance IP was persisted more than once") if args[1].startswith('/api-server/subnets'): self._invoked += 1 return self._orig_method(args, kwargs) # end SpyCreateNode orig_object = self._api_server._db_conn._zk_db._zk_client method_name = 'create_node' with test_common.patch(orig_object, method_name, SpyCreateNode(orig_object, method_name)): self._vnc_lib.instance_ip_create(iip_obj) self.assertTill(self.ifmap_has_ident, obj=iip_obj) #end test_notify_doesnt_persist def test_ip_alloc_clash(self): # prep objects for testing proj_obj = Project('proj-%s' %(self.id()), parent_obj=Domain()) self._vnc_lib.project_create(proj_obj) ipam_obj = NetworkIpam('ipam-%s' %(self.id()), proj_obj) self._vnc_lib.network_ipam_create(ipam_obj) vn_obj = VirtualNetwork('vn-%s' %(self.id()), proj_obj) ipam_sn_v4 = IpamSubnetType(subnet=SubnetType('172.16.58.3', 24)) vn_obj.add_network_ipam(ipam_obj, VnSubnetsType([ipam_sn_v4])) self._vnc_lib.virtual_network_create(vn_obj) fip_pool_obj = FloatingIpPool( 'fip-pool-%s' %(self.id()), parent_obj=vn_obj) self._vnc_lib.floating_ip_pool_create(fip_pool_obj) aip_pool_obj = AliasIpPool( 'aip-pool-%s' %(self.id()), parent_obj=vn_obj) self._vnc_lib.alias_ip_pool_create(aip_pool_obj) iip_obj = InstanceIp('existing-iip-%s' %(self.id())) iip_obj.add_virtual_network(vn_obj) self._vnc_lib.instance_ip_create(iip_obj) # read-in to find allocated address iip_obj = self._vnc_lib.instance_ip_read(id=iip_obj.uuid) fip_obj = FloatingIp('existing-fip-%s' %(self.id()), fip_pool_obj) fip_obj.add_project(proj_obj) self._vnc_lib.floating_ip_create(fip_obj) # read-in to find allocated address fip_obj = self._vnc_lib.floating_ip_read(id=fip_obj.uuid) aip_obj = AliasIp('existing-aip-%s' %(self.id()), aip_pool_obj) aip_obj.add_project(proj_obj) self._vnc_lib.alias_ip_create(aip_obj) # read-in to find allocated address aip_obj = self._vnc_lib.alias_ip_read(id=aip_obj.uuid) vm_obj = VirtualMachine('vm-%s' %(self.id())) self._vnc_lib.virtual_machine_create(vm_obj) vm_vmi_obj = VirtualMachineInterface('vm-vmi-%s' %(self.id()), proj_obj) vm_vmi_obj.add_virtual_network(vn_obj) vm_vmi_obj.add_virtual_machine(vm_obj) self._vnc_lib.virtual_machine_interface_create(vm_vmi_obj) rtr_vmi_obj = VirtualMachineInterface('rtr-vmi-%s' %(self.id()), proj_obj) rtr_vmi_obj.add_virtual_network(vn_obj) self._vnc_lib.virtual_machine_interface_create(rtr_vmi_obj) lr_obj = LogicalRouter('rtr-%s' %(self.id()), proj_obj) lr_obj.add_virtual_machine_interface(rtr_vmi_obj) self._vnc_lib.logical_router_create(lr_obj) isolated_vmi_obj = VirtualMachineInterface('iso-vmi-%s' %(self.id()), proj_obj) isolated_vmi_obj.add_virtual_network(vn_obj) self._vnc_lib.virtual_machine_interface_create(isolated_vmi_obj) # allocate instance-ip clashing with existing instance-ip iip2_obj = InstanceIp('clashing-iip-%s' %(self.id()), instance_ip_address=iip_obj.instance_ip_address) iip2_obj.add_virtual_network(vn_obj) with ExpectedException(cfgm_common.exceptions.BadRequest, 'Ip address already in use') as e: self._vnc_lib.instance_ip_create(iip2_obj) # allocate instance-ip clashing with existing floating-ip iip2_obj.set_instance_ip_address(fip_obj.floating_ip_address) with ExpectedException(cfgm_common.exceptions.BadRequest, 'Ip address already in use') as e: self._vnc_lib.instance_ip_create(iip2_obj) # allocate floating-ip clashing with existing floating-ip fip2_obj = FloatingIp('clashing-fip-%s' %(self.id()), fip_pool_obj, floating_ip_address=fip_obj.floating_ip_address) fip2_obj.add_project(proj_obj) with ExpectedException(cfgm_common.exceptions.BadRequest, 'Ip address already in use') as e: self._vnc_lib.floating_ip_create(fip2_obj) # allocate alias-ip clashing with existing alias-ip aip2_obj = AliasIp('clashing-aip-%s' %(self.id()), aip_pool_obj, alias_ip_address=aip_obj.alias_ip_address) aip2_obj.add_project(proj_obj) with ExpectedException(cfgm_common.exceptions.BadRequest, 'Ip address already in use') as e: self._vnc_lib.alias_ip_create(aip2_obj) # allocate floating-ip clashing with existing instance-ip fip2_obj.set_floating_ip_address(iip_obj.instance_ip_address) with ExpectedException(cfgm_common.exceptions.BadRequest, 'Ip address already in use') as e: self._vnc_lib.floating_ip_create(fip2_obj) # allocate alias-ip clashing with existing instance-ip aip2_obj.set_alias_ip_address(iip_obj.instance_ip_address) with ExpectedException(cfgm_common.exceptions.BadRequest, 'Ip address already in use') as e: self._vnc_lib.alias_ip_create(aip2_obj) # allocate alias-ip clashing with existing floating-ip aip2_obj.set_alias_ip_address(fip_obj.floating_ip_address) with ExpectedException(cfgm_common.exceptions.BadRequest, 'Ip address already in use') as e: self._vnc_lib.alias_ip_create(aip2_obj) # allocate floating-ip with gateway ip and verify failure fip2_obj.set_floating_ip_address('172.16.31.10') with ExpectedException(cfgm_common.exceptions.BadRequest, 'Ip address already in use') as e: self._vnc_lib.floating_ip_create(fip2_obj) # allocate alias-ip with gateway ip and verify failure aip2_obj.set_alias_ip_address('172.16.31.10') with ExpectedException(cfgm_common.exceptions.BadRequest, 'Ip address already in use') as e: self._vnc_lib.alias_ip_create(aip2_obj) # allocate 2 instance-ip with gateway ip - should work # then verify iip cannot # ref to vm port (during iip-update # or vmi-update) iip_gw_ip = InstanceIp('gw-ip-iip-%s' %(self.id()), instance_ip_address='172.16.31.10') iip_gw_ip.add_virtual_network(vn_obj) self._vnc_lib.instance_ip_create(iip_gw_ip) iip2_gw_ip = InstanceIp('gw-ip-iip2-%s' %(self.id()), instance_ip_address='172.16.31.10') iip2_gw_ip.add_virtual_network(vn_obj) iip2_gw_ip.add_virtual_machine_interface(rtr_vmi_obj) self._vnc_lib.instance_ip_create(iip2_gw_ip) iip_gw_ip.add_virtual_machine_interface(vm_vmi_obj) with ExpectedException(cfgm_common.exceptions.BadRequest, 'Gateway IP cannot be used by VM port') as e: self._vnc_lib.instance_ip_update(iip_gw_ip) iip_gw_ip.del_virtual_machine_interface(vm_vmi_obj) iip_gw_ip.add_virtual_machine_interface(rtr_vmi_obj) self._vnc_lib.instance_ip_update(iip_gw_ip) iip2_gw_ip.add_virtual_machine_interface(isolated_vmi_obj) self._vnc_lib.instance_ip_update(iip2_gw_ip) isolated_vmi_obj.add_virtual_machine(vm_obj) with ExpectedException(cfgm_common.exceptions.BadRequest, 'Gateway IP cannot be used by VM port') as e: self._vnc_lib.virtual_machine_interface_update( isolated_vmi_obj) # end test_ip_alloc_clash #end class TestIpAlloc if __name__ == '__main__': ch = logging.StreamHandler() ch.setLevel(logging.DEBUG) logger.addHandler(ch) unittest.main()
StarcoderdataPython
1632050
<gh_stars>0 import api.tutils import time import sys import api.objmodel # Test configure ACI mode def testACIMode(testbed): api.tutils.info("testACIMode starting") api.objmodel.setFabricMode("aci") # Create a network testTen = api.objmodel.tenant('default') testNet = testTen.newNetwork("aciNet", 0, "192.168.127.12/24", "192.168.3.11", "vlan") # Create two epgs epgA = testNet.newGroup("epgA") epgB = testNet.newGroup("epgB") # Start two containers each on epgA and epgB cA1 = testbed.runContainerOnNode(0, "epgA.aciNet") cA2 = testbed.runContainerOnNode(0, "epgA.aciNet") cB1 = testbed.runContainerOnNode(0, "epgB.aciNet") cB2 = testbed.runContainerOnNode(0, "epgB.aciNet") # Verify cA1 can ping cA2 cA1.checkPing(cA2.getIpAddr()) # Verify cB1 can ping cB2 cB1.checkPing(cB2.getIpAddr()) # Verify cA1 cannot ping cB1 cA1.checkPingFailure(cB1.getIpAddr()) # remove containers testbed.removeContainers([cA1, cA2, cB1, cB2]) # delete epgs testNet.deleteGroup("epgA") testNet.deleteGroup("epgB") # delete network testTen.deleteNetwork("aciNet") api.objmodel.setFabricMode("default") # Check for errors testbed.chekForNetpluginErrors() api.tutils.info("testACIMode Test passed")
StarcoderdataPython
60240
<gh_stars>10-100 #!/usr/bin/env python3 # # Visualize filters in the network import time from math import sqrt import torch import torchvision from torch import nn from args import args from made import MADE from pixelcnn import PixelCNN from utils import ensure_dir, get_ham_args_features # Set args here or through CLI to match the state args.ham = 'afm' args.lattice = 'tri' args.boundary = 'periodic' args.L = 4 args.beta = 2 args.net = 'pixelcnn' args.net_depth = 3 args.net_width = 64 args.half_kernel_size = 3 args.bias = True args.beta_anneal = 0.998 args.max_step = 10**4 args.print_step = 100 args.visual_step = 1000 state_dir = 'out' ham_args, features = get_ham_args_features() state_filename = '{state_dir}/{ham_args}/{features}/out{args.out_infix}_save/10000.state'.format( **locals()) target_layer = 1 num_channel = 1 out_dir = '../support/fig/filters/{ham_args}/{features}/layer{target_layer}'.format( **locals()) if __name__ == '__main__': ensure_dir(out_dir + '/') if args.net == 'made': net = MADE(**vars(args)) elif args.net == 'pixelcnn': net = PixelCNN(**vars(args)) else: raise ValueError('Unknown net: {}'.format(args.net)) net.to(args.device) print('{}\n'.format(net)) print(state_filename) state = torch.load(state_filename, map_location=args.device) net.load_state_dict(state['net']) sample = torch.zeros([num_channel, 1, args.L, args.L], requires_grad=True) nn.init.normal_(sample) optimizer = torch.optim.Adam([sample], lr=1e-3, weight_decay=1) start_time = time.time() for step in range(args.max_step + 1): optimizer.zero_grad() x = sample for idx, layer in enumerate(net.net): x = layer(x) if idx == target_layer: break sample loss = torch.mean( torch.stack([ torch.mean(x[channel, channel]) for channel in range(num_channel) ])) loss.backward() optimizer.step() if args.print_step and step % args.print_step == 0: used_time = time.time() - start_time print('step = {}, loss = {:.8g}, used_time = {:.3f}'.format( step, loss, used_time)) if args.visual_step and step % args.visual_step == 0: torchvision.utils.save_image( sample, '{}/{}.png'.format(out_dir, step), nrow=int(sqrt(sample.shape[0])), padding=2, normalize=True)
StarcoderdataPython
1706907
<reponame>wikimedia/search-MjoLniR<gh_stars>10-100 from collections import defaultdict from functools import partial import tempfile from typing import cast, Any, Callable, Dict, List, Mapping, Optional import hyperopt import numpy as np from pyspark.sql import SparkSession import xgboost as xgb from mjolnir.training.tuning import make_cv_objective, ModelSelection from mjolnir.utils import as_local_path, as_local_paths, as_output_file def _coerce_params(params: Mapping[str, Any]) -> Dict[str, Any]: """Force xgboost parameters into appropriate types The output from hyperopt is always floats, but some xgboost parameters explicitly require integers. Cast those as necessary Parameters ---------- params : dict xgboost parameters Returns ------- dict Input parameters coerced as necessary """ def identity(x): return x def sloppy_int(x): try: return int(x) except ValueError: pass val = float(x) # This could fail for larger numbers due to fp precision, but not # expecting integer values larger than two digits here. if val.is_integer(): return int(val) raise ValueError('Not parsable as integer: {}'.format(x)) types = cast(Dict[str, Callable[[Any], Any]], defaultdict(lambda: identity)) types.update({ 'max_depth': sloppy_int, 'max_bin': sloppy_int, 'num_class': sloppy_int, 'silent': sloppy_int, }) return {k: types[k](v) for k, v in params.items()} def train( fold: Mapping[str, str], params: Mapping[str, Any], train_matrix: Optional[str] = None, spark: Optional[SparkSession] = None ) -> 'XGBoostModel': """Train a single xgboost ranking model. Primary entry point for hyperparameter tuning normalizes parameters and auto detects some values. Actual training is passed on to XGBoostModel.trainWithFiles Parameters ---------- fold : Map from split name to data path. All provided splits will be evaluated on each boosting iteration. params : parameters to pass on to xgboost training train_matrix : Optional name of training matrix in fold. If not provided will auto-detect to either 'all' or 'train' spark: If provided, train remotely over spark Returns ------- XGBoostModel Trained xgboost model """ # hyperparameter tuning may have given us floats where we need # ints, so this gets all the types right for Java. Also makes # a copy of params so we don't modifying the incoming dict. # TODO: Does python care about this? Even if not, in the end it seems # reasonable to not pass floats for integer values. params = _coerce_params(params) # TODO: Maybe num_rounds should just be external? But it's easier # to do hyperparameter optimization with a consistent dict interface kwargs = cast(Dict[str, Any], { 'num_boost_round': 100, }) if 'num_boost_round' in params: kwargs['num_boost_round'] = params['num_boost_round'] del params['num_rounds'] if 'early_stopping_rounds' in params: kwargs['early_stopping_rounds'] = params['early_stopping_rounds'] del params['early_stopping_rounds'] # Set some sane defaults for ranking tasks if 'objective' not in params: params['objective'] = 'rank:ndcg' if 'eval_metric' not in params: params['eval_metric'] = 'ndcg@10' # Not really ranking specific, but generally fastest method if 'tree_method' not in params: params['tree_method'] = 'hist' # Convenience for some situations, but typically be explicit # about the name of the matrix to train against. if train_matrix is None: train_matrix = "all" if "all" in fold else "train" if spark: return XGBoostModel.trainWithFilesRemote(spark, fold, train_matrix, params, **kwargs) else: return XGBoostModel.trainWithFiles(fold, train_matrix, params, **kwargs) # Top level: matrix name # Second level: metric name # Inner list: stringified per-iteration metric value EvalsResult = Mapping[str, Mapping[str, List[str]]] class XGBoostBooster(object): """Wrapper for xgb.Booster usage in mjolnir Wraps the booster to distinguish what we have after training, the XGBoostModel, from what we write to disk, which is only the booster. Would be better if there was a clean way to wrap all the data up an serialize together, while working with xgboost's c++ methods that expect file paths. """ def __init__(self, booster: xgb.Booster) -> None: self.booster = booster @staticmethod def loadBoosterFromHadoopFile(path: str) -> 'XGBoostBooster': with as_local_path(path) as local_path: return XGBoostBooster.loadBoosterFromLocalFile(local_path) @staticmethod def loadBoosterFromLocalFile(path: str) -> 'XGBoostBooster': booster = xgb.Booster.load_model(path) # TODO: Not having the training parameters or the evaluation metrics # almost makes this a different thing... return XGBoostBooster(booster) def saveBoosterAsHadoopFile(self, path: str): with as_output_file(path) as f: self.saveBoosterAsLocalFile(f.name) def saveBoosterAsLocalFile(self, path: str): # TODO: This doesn't save any metrics, should it? self.booster.save_model(path) class XGBoostModel(XGBoostBooster): """xgboost booster along with train-time metrics TODO: Take XGBoostBooster as init arg instead of xgb.Booster? """ def __init__( self, booster: xgb.Booster, evals_result: EvalsResult, params: Mapping[str, Any] ) -> None: super().__init__(booster) self.evals_result = evals_result self.params = params @staticmethod def trainWithFilesRemote( spark: SparkSession, fold: Mapping[str, str], train_matrix: str, params: Mapping[str, Any], **kwargs ) -> 'XGBoostModel': """Train model on a single remote spark executor. Silly hack to train models inside the yarn cluster. To train multiple models in parallel python threads will need to be used. Wish pyspark had collectAsync. """ nthread = int(spark.conf.get('spark.task.cpus', '1')) if 'nthread' not in params: params = dict(params, nthread=nthread) elif params['nthread'] != nthread: raise Exception("Executors have [{}] cpus but training requested [{}]".format( nthread, params['nthread'])) return ( spark.sparkContext .parallelize([1], 1) .map(lambda x: XGBoostModel.trainWithFiles(fold, train_matrix, params, **kwargs)) .collect()[0] ) @staticmethod def trainWithFiles( fold: Mapping[str, str], train_matrix: str, params: Mapping[str, Any], **kwargs ) -> 'XGBoostModel': """Wrapper around xgb.train This intentionally forwards to trainWithRDD, rather than trainWithDataFrame, as the underlying method currently prevents using rank:pairwise and metrics with @, such as ndcg@5. Parameters ---------- fold : Map from split name to data path. All provided splits will be evaluated on each boosting iteration. train_matrix: str name of split in fold to train against params : dict XGBoost training parameters Returns ------- mjolnir.training.xgboost.XGBoostModel trained xgboost ranking model """ with as_local_paths(fold.values()) as local_paths: matrices = {name: xgb.DMatrix(path) for name, path in zip(fold.keys(), local_paths)} dtrain = matrices[train_matrix] evallist = [(dmat, name) for name, dmat in matrices.items()] metrics = cast(Mapping, {}) booster = xgb.train(params, dtrain, evals=evallist, evals_result=metrics, **kwargs) return XGBoostModel(booster, metrics, params) def dump(self, features=None, with_stats=False, format="json"): """Dumps the xgboost model Parameters ---------- features : list of str or None, optional list of features names, or None for no feature names in dump. (Default: None) withStats : bool, optional Should various additional statistics be included? These are not necessary for prediction. (Default: False) format : string, optional The format of dump to produce, either json or text. (Default: json) Returns ------- str valid json string containing all trees """ # Annoyingly the xgboost api doesn't take the feature map as a string, but # instead as a filename. Write the feature map out to a file if necessary. if features: # When we write the svmrank formatted files the features are indexed # starting at 1. We need to throw a fake index 0 in here or it's all # wrong. feat_map = "0 PLACEHOLDER_FEAT q\n" + \ "\n".join(["%d %s q" % (i, fname) for i, fname in enumerate(features, 1)]) fmap_f = tempfile.NamedTemporaryFile(mode='w') fmap_f.write(feat_map) fmap_f.flush() fmap_path = fmap_f.name else: fmap_path = '' trees = self.booster.get_dump(fmap_path, with_stats, dump_format='json') # For whatever reason we get a json line per tree. Turn that into an array # so we have a single valid json string. return '[' + ','.join(trees) + ']' def cv_transformer(model: XGBoostModel, params: Mapping[str, Any]): """Report model metrics in format expected by model selection""" metric = params['eval_metric'] return { 'train': model.evals_result['train'][metric][-1], 'test': model.evals_result['test'][metric][-1], 'metrics': model.evals_result, } def tune( folds: List[Mapping[str, str]], stats: Dict, train_matrix: str, num_cv_jobs: int = 5, initial_num_trees: int = 100, final_num_trees: int = 500, iterations: int = 150, spark: Optional[SparkSession] = None ): """Find appropriate hyperparameters for training df This is far from perfect, hyperparameter tuning is a bit of a black art and could probably benefit from human interaction at each stage. Various parameters depend a good bit on the number of samples in df, and how that data is shaped. Below is tuned for a dataframe with approximatly 10k normalized queries, 110k total queries, and 2.2M samples. This is actually a relatively small dataset, we should rework the values used with larger data sets if they are promising. It may also be that the current feature space can't take advantage of more samples. Note that hyperopt uses the first 20 iterations to initialize, during those first 20 this is a strictly random search. Parameters ---------- folds : list of dict containing train and test keys stats : dict stats about the fold from the make_folds utility script num_cv_jobs : int, optional The number of cross validation folds to train in parallel. (Default: 5) initial_num_trees: int, optional The number of trees to do most of the hyperparameter tuning with. This should be large enough to be resonably representative of the final training size. (Default: 100) final_num_trees: int, optional The number of trees to do the final eta optimization with. If set to None the final eta optimization will be skipped and initial_n_tree will be kept. Returns ------- dict Dict with two keys, trials and params. params is the optimal set of parameters. trials contains a dict of individual optimization steps performed, each containing a hyperopt.Trials object recording what happened. """ num_obs = stats['num_observations'] if num_obs > 8000000: dataset_size = 'xlarge' elif num_obs > 1000000: dataset_size = 'large' elif num_obs > 500000: dataset_size = 'med' elif num_obs > 500: dataset_size = 'small' else: dataset_size = 'xsmall' # Setup different tuning profiles for different sizes of datasets. tune_spaces = [ ('initial', { 'iterations': iterations, 'space': { 'xlarge': { 'eta': hyperopt.hp.uniform('eta', 0.3, 0.8), # Have seen values of 7 and 10 as best on roughly same size # datasets from different wikis. It really just depends. 'max_depth': hyperopt.hp.quniform('max_depth', 6, 11, 1), 'min_child_weight': hyperopt.hp.qloguniform( 'min_child_weight', np.log(10), np.log(500), 10), # % of features to use for each tree. helps prevent overfit 'colsample_bytree': hyperopt.hp.quniform('colsample_bytree', 0.8, 1, .01), 'subsample': hyperopt.hp.quniform('subsample', 0.8, 1, .01), }, 'large': { 'eta': hyperopt.hp.uniform('eta', 0.3, 0.6), 'max_depth': hyperopt.hp.quniform('max_depth', 5, 9, 1), 'min_child_weight': hyperopt.hp.qloguniform( 'min_child_weight', np.log(10), np.log(300), 10), 'colsample_bytree': hyperopt.hp.quniform('colsample_bytree', 0.8, 1, .01), 'subsample': hyperopt.hp.quniform('subsample', 0.8, 1, .01), }, 'med': { 'eta': hyperopt.hp.uniform('eta', 0.1, 0.6), 'max_depth': hyperopt.hp.quniform('max_depth', 4, 7, 1), 'min_child_weight': hyperopt.hp.qloguniform( 'min_child_weight', np.log(10), np.log(300), 10), 'colsample_bytree': hyperopt.hp.quniform('colsample_bytree', 0.8, 1, .01), 'subsample': hyperopt.hp.quniform('subsample', 0.8, 1, .01), }, 'small': { 'eta': hyperopt.hp.uniform('eta', 0.1, 0.4), 'max_depth': hyperopt.hp.quniform('max_depth', 3, 6, 1), 'min_child_weight': hyperopt.hp.qloguniform( 'min_child_weight', np.log(10), np.log(100), 10), 'colsample_bytree': hyperopt.hp.quniform('colsample_bytree', 0.8, 1, .01), 'subsample': hyperopt.hp.quniform('subsample', 0.8, 1, .01), }, 'xsmall': { 'eta': hyperopt.hp.uniform('eta', 0.1, 0.4), 'max_depth': hyperopt.hp.quniform('max_depth', 3, 6, 1), # Never use for real data, but convenient for tiny sets in test suite 'min_child_weight': 0, 'colsample_bytree': hyperopt.hp.quniform('colsample_bytree', 0.8, 1, .01), 'subsample': hyperopt.hp.quniform('subsample', 0.8, 1, .01), } }[dataset_size] }) ] if final_num_trees is not None and final_num_trees != initial_num_trees: tune_spaces.append(('trees', { 'iterations': 30, 'space': { 'num_rounds': final_num_trees, 'eta': hyperopt.hp.uniform('eta', 0.1, 0.4), } })) # Baseline parameters to start with. Roughly tuned by what has worked in # the past. These vary though depending on number of training samples. These # defaults are for the smallest of wikis, which are then overridden for larger # wikis space = { 'objective': 'rank:ndcg', 'eval_metric': 'ndcg@10', 'num_rounds': initial_num_trees, 'min_child_weight': 200, 'max_depth': { 'xlarge': 7, 'large': 6, 'med': 5, 'small': 4, 'xsmall': 3, }[dataset_size], 'gamma': 0, 'subsample': 1.0, 'colsample_bytree': 0.8, } tuner = ModelSelection(space, tune_spaces) train_func = make_cv_objective( partial(train, spark=spark), folds, num_cv_jobs, cv_transformer, train_matrix=train_matrix) trials_pool = tuner.build_pool(folds, num_cv_jobs) return tuner(train_func, trials_pool)
StarcoderdataPython
3281025
# -*- coding: utf-8 -*- """Tests that use cross-checks for generic methods Should be easy to check consistency across models Does not cover tsa Initial cases copied from test_shrink_pickle Created on Wed Oct 30 14:01:27 2013 Author: <NAME> """ from statsmodels.compat.pandas import assert_series_equal, assert_index_equal from statsmodels.compat.platform import (PLATFORM_OSX, PLATFORM_LINUX32, PLATFORM_WIN32) from statsmodels.compat.scipy import SCIPY_GT_14 import numpy as np import pandas as pd import pytest import statsmodels.api as sm from statsmodels.tools.sm_exceptions import HessianInversionWarning import statsmodels.tools._testing as smt from statsmodels.formula.api import ols, glm from numpy.testing import (assert_, assert_allclose, assert_equal, assert_array_equal) class CheckGenericMixin(object): @classmethod def setup_class(cls): nobs = 500 np.random.seed(987689) x = np.random.randn(nobs, 3) x = sm.add_constant(x) cls.exog = x cls.xf = 0.25 * np.ones((2, 4)) cls.predict_kwds = {} cls.transform_index = None def test_ttest_tvalues(self): # test that t_test has same results a params, bse, tvalues, ... smt.check_ttest_tvalues(self.results) res = self.results mat = np.eye(len(res.params)) tt = res.t_test(mat[0]) string_confint = lambda alpha: "[%4.3F %4.3F]" % ( alpha / 2, 1- alpha / 2) summ = tt.summary() # smoke test for #1323 assert_allclose(tt.pvalue, res.pvalues[0], rtol=5e-10) assert_(string_confint(0.05) in str(summ)) # issue #3116 alpha not used in column headers summ = tt.summary(alpha=0.1) ss = "[0.05 0.95]" # different formatting assert_(ss in str(summ)) summf = tt.summary_frame(alpha=0.1) pvstring_use_t = 'P>|z|' if res.use_t is False else 'P>|t|' tstring_use_t = 'z' if res.use_t is False else 't' cols = ['coef', 'std err', tstring_use_t, pvstring_use_t, 'Conf. Int. Low', 'Conf. Int. Upp.'] assert_array_equal(summf.columns.values, cols) def test_ftest_pvalues(self): smt.check_ftest_pvalues(self.results) def test_fitted(self): smt.check_fitted(self.results) def test_predict_types(self): smt.check_predict_types(self.results) def test_zero_constrained(self): # not completely generic yet if (isinstance(self.results.model, (sm.GEE))): # GEE does not subclass LikelihoodModel pytest.skip('GEE does not subclass LikelihoodModel') use_start_params = not isinstance(self.results.model, (sm.RLM, sm.OLS, sm.WLS)) self.use_start_params = use_start_params # attach for _get_constrained keep_index = list(range(self.results.model.exog.shape[1])) # index for params might include extra params keep_index_p = list(range(self.results.params.shape[0])) drop_index = [1] for i in drop_index: del keep_index[i] del keep_index_p[i] if use_start_params: res1 = self.results.model._fit_zeros(keep_index, maxiter=500, start_params=self.results.params) else: res1 = self.results.model._fit_zeros(keep_index, maxiter=500) res2 = self._get_constrained(keep_index, keep_index_p) assert_allclose(res1.params[keep_index_p], res2.params, rtol=1e-10, atol=1e-10) assert_equal(res1.params[drop_index], 0) assert_allclose(res1.bse[keep_index_p], res2.bse, rtol=1e-10, atol=1e-10) assert_equal(res1.bse[drop_index], 0) # OSX has many slight failures on this test tol = 1e-8 if PLATFORM_OSX else 1e-10 tvals1 = res1.tvalues[keep_index_p] assert_allclose(tvals1, res2.tvalues, rtol=tol, atol=tol) # See gh5993 if PLATFORM_LINUX32 or SCIPY_GT_14: pvals1 = res1.pvalues[keep_index_p] else: pvals1 = res1.pvalues[keep_index_p] assert_allclose(pvals1, res2.pvalues, rtol=tol, atol=tol) if hasattr(res1, 'resid'): # discrete models, Logit do not have `resid` yet # atol discussion at gh-5158 rtol = 1e-10 atol = 1e-12 if PLATFORM_OSX or PLATFORM_WIN32: # GH 5628 rtol = 1e-8 atol = 1e-10 assert_allclose(res1.resid, res2.resid, rtol=rtol, atol=atol) ex = self.results.model.exog.mean(0) predicted1 = res1.predict(ex, **self.predict_kwds) predicted2 = res2.predict(ex[keep_index], **self.predict_kwds) assert_allclose(predicted1, predicted2, rtol=1e-10) ex = self.results.model.exog[:5] predicted1 = res1.predict(ex, **self.predict_kwds) predicted2 = res2.predict(ex[:, keep_index], **self.predict_kwds) assert_allclose(predicted1, predicted2, rtol=1e-10) def _get_constrained(self, keep_index, keep_index_p): # override in some test classes, no fit_kwds yet, e.g. cov_type mod2 = self.results.model mod_cls = mod2.__class__ init_kwds = mod2._get_init_kwds() mod = mod_cls(mod2.endog, mod2.exog[:, keep_index], **init_kwds) if self.use_start_params: res = mod.fit(start_params=self.results.params[keep_index_p], maxiter=500) else: res = mod.fit(maxiter=500) return res def test_zero_collinear(self): # not completely generic yet if isinstance(self.results.model, (sm.GEE)): pytest.skip('Not completely generic yet') use_start_params = not isinstance(self.results.model, (sm.RLM, sm.OLS, sm.WLS, sm.GLM)) self.use_start_params = use_start_params # attach for _get_constrained keep_index = list(range(self.results.model.exog.shape[1])) # index for params might include extra params keep_index_p = list(range(self.results.params.shape[0])) drop_index = [] for i in drop_index: del keep_index[i] del keep_index_p[i] keep_index_p = list(range(self.results.params.shape[0])) # create collinear model mod2 = self.results.model mod_cls = mod2.__class__ init_kwds = mod2._get_init_kwds() ex = np.column_stack((mod2.exog, mod2.exog)) mod = mod_cls(mod2.endog, ex, **init_kwds) keep_index = list(range(self.results.model.exog.shape[1])) keep_index_p = list(range(self.results.model.exog.shape[1])) k_vars = ex.shape[1] k_extra = 0 if hasattr(mod, 'k_extra') and mod.k_extra > 0: keep_index_p += list(range(k_vars, k_vars + mod.k_extra)) k_extra = mod.k_extra # TODO: Can we choose a test case without this issue? # If not, should we be getting this warning for all # model subclasses? warn_cls = HessianInversionWarning if isinstance(mod, sm.GLM) else None cov_types = ['nonrobust', 'HC0'] for cov_type in cov_types: # Note: for RLM we only check default when cov_type is 'nonrobust' # cov_type is otherwise ignored if cov_type != 'nonrobust' and (isinstance(self.results.model, sm.RLM)): return if use_start_params: start_params = np.zeros(k_vars + k_extra) method = self.results.mle_settings['optimizer'] # string in `method` is not mutable, so no need for copy sp = self.results.mle_settings['start_params'].copy() if self.transform_index is not None: # work around internal transform_params, currently in NB sp[self.transform_index] = np.exp(sp[self.transform_index]) start_params[keep_index_p] = sp with pytest.warns(warn_cls): res1 = mod._fit_collinear(cov_type=cov_type, start_params=start_params, method=method, disp=0) if cov_type != 'nonrobust': # reestimate original model to get robust cov with pytest.warns(warn_cls): res2 = self.results.model.fit(cov_type=cov_type, start_params=sp, method=method, disp=0) else: with pytest.warns(warn_cls): # more special casing RLM if (isinstance(self.results.model, (sm.RLM))): res1 = mod._fit_collinear() else: res1 = mod._fit_collinear(cov_type=cov_type) if cov_type != 'nonrobust': # reestimate original model to get robust cov res2 = self.results.model.fit(cov_type=cov_type) if cov_type == 'nonrobust': res2 = self.results # check fit optimizer arguments, if mle_settings is available if hasattr(res2, 'mle_settings'): assert_equal(res1.results_constrained.mle_settings['optimizer'], res2.mle_settings['optimizer']) if 'start_params' in res2.mle_settings: spc = res1.results_constrained.mle_settings['start_params'] assert_allclose(spc, res2.mle_settings['start_params'], rtol=1e-10, atol=1e-20) assert_equal(res1.mle_settings['optimizer'], res2.mle_settings['optimizer']) assert_allclose(res1.mle_settings['start_params'], res2.mle_settings['start_params'], rtol=1e-10, atol=1e-20) # Poisson has reduced precision in params, difficult optimization? assert_allclose(res1.params[keep_index_p], res2.params, rtol=1e-6) assert_allclose(res1.params[drop_index], 0, rtol=1e-10) assert_allclose(res1.bse[keep_index_p], res2.bse, rtol=1e-8) assert_allclose(res1.bse[drop_index], 0, rtol=1e-10) tvals1 = res1.tvalues[keep_index_p] assert_allclose(tvals1, res2.tvalues, rtol=5e-8) # See gh5993 if PLATFORM_LINUX32 or SCIPY_GT_14: pvals1 = res1.pvalues[keep_index_p] else: pvals1 = res1.pvalues[keep_index_p] assert_allclose(pvals1, res2.pvalues, rtol=1e-6, atol=1e-30) if hasattr(res1, 'resid'): # discrete models, Logit do not have `resid` yet assert_allclose(res1.resid, res2.resid, rtol=1e-5, atol=1e-10) ex = res1.model.exog.mean(0) predicted1 = res1.predict(ex, **self.predict_kwds) predicted2 = res2.predict(ex[keep_index], **self.predict_kwds) assert_allclose(predicted1, predicted2, rtol=1e-8, atol=1e-11) ex = res1.model.exog[:5] kwds = getattr(self, 'predict_kwds_5', {}) predicted1 = res1.predict(ex, **kwds) predicted2 = res2.predict(ex[:, keep_index], **kwds) assert_allclose(predicted1, predicted2, rtol=1e-8, atol=1e-11) ######### subclasses for individual models, unchanged from test_shrink_pickle # TODO: check if setup_class is faster than setup class TestGenericOLS(CheckGenericMixin): def setup(self): #fit for each test, because results will be changed by test x = self.exog np.random.seed(987689) y = x.sum(1) + np.random.randn(x.shape[0]) self.results = sm.OLS(y, self.exog).fit() class TestGenericOLSOneExog(CheckGenericMixin): # check with single regressor (no constant) def setup(self): #fit for each test, because results will be changed by test x = self.exog[:, 1] np.random.seed(987689) y = x + np.random.randn(x.shape[0]) self.results = sm.OLS(y, x).fit() def test_zero_constrained(self): # override, we cannot remove the only regressor pytest.skip('Override since cannot remove the only regressor') pass class TestGenericWLS(CheckGenericMixin): def setup(self): #fit for each test, because results will be changed by test x = self.exog np.random.seed(987689) y = x.sum(1) + np.random.randn(x.shape[0]) self.results = sm.WLS(y, self.exog, weights=np.ones(len(y))).fit() class TestGenericPoisson(CheckGenericMixin): def setup(self): #fit for each test, because results will be changed by test x = self.exog np.random.seed(987689) y_count = np.random.poisson(np.exp(x.sum(1) - x.mean())) model = sm.Poisson(y_count, x) # use start_params to converge faster start_params = np.array([0.75334818, 0.99425553, 1.00494724, 1.00247112]) self.results = model.fit(start_params=start_params, method='bfgs', disp=0) class TestGenericPoissonOffset(CheckGenericMixin): def setup(self): #fit for each test, because results will be changed by test x = self.exog nobs = x.shape[0] np.random.seed(987689) y_count = np.random.poisson(np.exp(x.sum(1) - x.mean())) model = sm.Poisson(y_count, x, offset=0.01 * np.ones(nobs), exposure=np.ones(nobs)) # bug with default # use start_params to converge faster start_params = np.array([0.75334818, 0.99425553, 1.00494724, 1.00247112]) self.results = model.fit(start_params=start_params, method='bfgs', disp=0) self.predict_kwds_5 = dict(exposure=0.01 * np.ones(5), offset=np.ones(5)) self.predict_kwds = dict(exposure=1, offset=0) class TestGenericNegativeBinomial(CheckGenericMixin): def setup(self): #fit for each test, because results will be changed by test np.random.seed(987689) data = sm.datasets.randhie.load(as_pandas=False) exog = sm.add_constant(data.exog, prepend=False) mod = sm.NegativeBinomial(data.endog, exog) start_params = np.array([-0.05783623, -0.26655806, 0.04109148, -0.03815837, 0.2685168 , 0.03811594, -0.04426238, 0.01614795, 0.17490962, 0.66461151, 1.2925957 ]) self.results = mod.fit(start_params=start_params, disp=0, maxiter=500) self.transform_index = -1 class TestGenericLogit(CheckGenericMixin): def setup(self): #fit for each test, because results will be changed by test x = self.exog nobs = x.shape[0] np.random.seed(987689) y_bin = (np.random.rand(nobs) < 1.0 / (1 + np.exp(x.sum(1) - x.mean()))).astype(int) model = sm.Logit(y_bin, x) #, exposure=np.ones(nobs), offset=np.zeros(nobs)) #bug with default # use start_params to converge faster start_params = np.array([-0.73403806, -1.00901514, -0.97754543, -0.95648212]) self.results = model.fit(start_params=start_params, method='bfgs', disp=0) class TestGenericRLM(CheckGenericMixin): def setup(self): #fit for each test, because results will be changed by test x = self.exog np.random.seed(987689) y = x.sum(1) + np.random.randn(x.shape[0]) self.results = sm.RLM(y, self.exog).fit() class TestGenericGLM(CheckGenericMixin): def setup(self): #fit for each test, because results will be changed by test x = self.exog np.random.seed(987689) y = x.sum(1) + np.random.randn(x.shape[0]) self.results = sm.GLM(y, self.exog).fit() class TestGenericGLMPoissonOffset(CheckGenericMixin): def setup(self): #fit for each test, because results will be changed by test x = self.exog nobs = x.shape[0] np.random.seed(987689) y_count = np.random.poisson(np.exp(x.sum(1) - x.mean())) model = sm.GLM(y_count, x, family=sm.families.Poisson(), offset=0.01 * np.ones(nobs), exposure=np.ones(nobs)) # use start_params to converge faster start_params = np.array([0.75334818, 0.99425553, 1.00494724, 1.00247112]) self.results = model.fit(start_params=start_params, method='bfgs', disp=0) self.predict_kwds_5 = dict(exposure=0.01 * np.ones(5), offset=np.ones(5)) self.predict_kwds = dict(exposure=1, offset=0) class TestGenericGEEPoisson(CheckGenericMixin): def setup(self): #fit for each test, because results will be changed by test x = self.exog np.random.seed(987689) y_count = np.random.poisson(np.exp(x.sum(1) - x.mean())) groups = np.random.randint(0, 4, size=x.shape[0]) # use start_params to speed up test, difficult convergence not tested start_params = np.array([0., 1., 1., 1.]) vi = sm.cov_struct.Independence() family = sm.families.Poisson() self.results = sm.GEE(y_count, self.exog, groups, family=family, cov_struct=vi).fit(start_params=start_params) class TestGenericGEEPoissonNaive(CheckGenericMixin): def setup(self): #fit for each test, because results will be changed by test x = self.exog np.random.seed(987689) #y_count = np.random.poisson(np.exp(x.sum(1) - x.mean())) y_count = np.random.poisson(np.exp(x.sum(1) - x.sum(1).mean(0))) groups = np.random.randint(0, 4, size=x.shape[0]) # use start_params to speed up test, difficult convergence not tested start_params = np.array([0., 1., 1., 1.]) vi = sm.cov_struct.Independence() family = sm.families.Poisson() self.results = sm.GEE(y_count, self.exog, groups, family=family, cov_struct=vi).fit(start_params=start_params, cov_type='naive') class TestGenericGEEPoissonBC(CheckGenericMixin): def setup(self): #fit for each test, because results will be changed by test x = self.exog np.random.seed(987689) #y_count = np.random.poisson(np.exp(x.sum(1) - x.mean())) y_count = np.random.poisson(np.exp(x.sum(1) - x.sum(1).mean(0))) groups = np.random.randint(0, 4, size=x.shape[0]) # use start_params to speed up test, difficult convergence not tested start_params = np.array([0., 1., 1., 1.]) # params_est = np.array([-0.0063238 , 0.99463752, 1.02790201, 0.98080081]) vi = sm.cov_struct.Independence() family = sm.families.Poisson() mod = sm.GEE(y_count, self.exog, groups, family=family, cov_struct=vi) self.results = mod.fit(start_params=start_params, cov_type='bias_reduced') # Other test classes class CheckAnovaMixin(object): @classmethod def setup_class(cls): import statsmodels.stats.tests.test_anova as ttmod test = ttmod.TestAnova3() test.setup_class() cls.data = test.data.drop([0,1,2]) cls.initialize() def test_combined(self): res = self.res wa = res.wald_test_terms(skip_single=False, combine_terms=['Duration', 'Weight']) eye = np.eye(len(res.params)) c_const = eye[0] c_w = eye[[2,3]] c_d = eye[1] c_dw = eye[[4,5]] c_weight = eye[2:6] c_duration = eye[[1, 4, 5]] compare_waldres(res, wa, [c_const, c_d, c_w, c_dw, c_duration, c_weight]) def test_categories(self): # test only multicolumn terms res = self.res wa = res.wald_test_terms(skip_single=True) eye = np.eye(len(res.params)) c_w = eye[[2,3]] c_dw = eye[[4,5]] compare_waldres(res, wa, [c_w, c_dw]) def compare_waldres(res, wa, constrasts): for i, c in enumerate(constrasts): wt = res.wald_test(c) assert_allclose(wa.table.values[i, 0], wt.statistic) assert_allclose(wa.table.values[i, 1], wt.pvalue) df = c.shape[0] if c.ndim == 2 else 1 assert_equal(wa.table.values[i, 2], df) # attributes assert_allclose(wa.statistic[i], wt.statistic) assert_allclose(wa.pvalues[i], wt.pvalue) assert_equal(wa.df_constraints[i], df) if res.use_t: assert_equal(wa.df_denom[i], res.df_resid) col_names = wa.col_names if res.use_t: assert_equal(wa.distribution, 'F') assert_equal(col_names[0], 'F') assert_equal(col_names[1], 'P>F') else: assert_equal(wa.distribution, 'chi2') assert_equal(col_names[0], 'chi2') assert_equal(col_names[1], 'P>chi2') # SMOKETEST wa.summary_frame() class TestWaldAnovaOLS(CheckAnovaMixin): @classmethod def initialize(cls): mod = ols("np.log(Days+1) ~ C(Duration, Sum)*C(Weight, Sum)", cls.data) cls.res = mod.fit(use_t=False) def test_noformula(self): # this verifies single and composite constraints against explicit # wald test endog = self.res.model.endog exog = self.res.model.data.orig_exog exog = pd.DataFrame(exog) res = sm.OLS(endog, exog).fit() wa = res.wald_test_terms(skip_single=False, combine_terms=['Duration', 'Weight']) eye = np.eye(len(res.params)) c_single = [row for row in eye] c_weight = eye[2:6] c_duration = eye[[1, 4, 5]] compare_waldres(res, wa, c_single + [c_duration, c_weight]) # assert correct df_constraints, see #5475 for bug in single constraint df_constraints = [1] * len(c_single) + [3, 4] assert_equal(wa.df_constraints, df_constraints) class TestWaldAnovaOLSF(CheckAnovaMixin): @classmethod def initialize(cls): mod = ols("np.log(Days+1) ~ C(Duration, Sum)*C(Weight, Sum)", cls.data) cls.res = mod.fit() # default use_t=True def test_predict_missing(self): ex = self.data[:5].copy() ex.iloc[0, 1] = np.nan predicted1 = self.res.predict(ex) predicted2 = self.res.predict(ex[1:]) assert_index_equal(predicted1.index, ex.index) assert_series_equal(predicted1[1:], predicted2) assert_equal(predicted1.values[0], np.nan) class TestWaldAnovaGLM(CheckAnovaMixin): @classmethod def initialize(cls): mod = glm("np.log(Days+1) ~ C(Duration, Sum)*C(Weight, Sum)", cls.data) cls.res = mod.fit(use_t=False) class TestWaldAnovaPoisson(CheckAnovaMixin): @classmethod def initialize(cls): from statsmodels.discrete.discrete_model import Poisson mod = Poisson.from_formula("Days ~ C(Duration, Sum)*C(Weight, Sum)", cls.data) cls.res = mod.fit(cov_type='HC0') class TestWaldAnovaNegBin(CheckAnovaMixin): @classmethod def initialize(cls): from statsmodels.discrete.discrete_model import NegativeBinomial formula = "Days ~ C(Duration, Sum)*C(Weight, Sum)" mod = NegativeBinomial.from_formula(formula, cls.data, loglike_method='nb2') cls.res = mod.fit() class TestWaldAnovaNegBin1(CheckAnovaMixin): @classmethod def initialize(cls): from statsmodels.discrete.discrete_model import NegativeBinomial formula = "Days ~ C(Duration, Sum)*C(Weight, Sum)" mod = NegativeBinomial.from_formula(formula, cls.data, loglike_method='nb1') cls.res = mod.fit(cov_type='HC0') class CheckPairwise(object): def test_default(self): res = self.res tt = res.t_test(self.constraints) pw = res.t_test_pairwise(self.term_name) pw_frame = pw.result_frame assert_allclose(pw_frame.iloc[:, :6].values, tt.summary_frame().values) class TestTTestPairwiseOLS(CheckPairwise): @classmethod def setup_class(cls): from statsmodels.formula.api import ols import statsmodels.stats.tests.test_anova as ttmod test = ttmod.TestAnova3() test.setup_class() cls.data = test.data.drop([0,1,2]) mod = ols("np.log(Days+1) ~ C(Duration) + C(Weight)", cls.data) cls.res = mod.fit() cls.term_name = "C(Weight)" cls.constraints = ['C(Weight)[T.2]', 'C(Weight)[T.3]', 'C(Weight)[T.3] - C(Weight)[T.2]'] def test_alpha(self): pw1 = self.res.t_test_pairwise(self.term_name, method='hommel', factor_labels='A B C'.split()) pw2 = self.res.t_test_pairwise(self.term_name, method='hommel', alpha=0.01) assert_allclose(pw1.result_frame.iloc[:, :7].values, pw2.result_frame.iloc[:, :7].values, rtol=1e-10) assert_equal(pw1.result_frame.iloc[:, -1].values, [True]*3) assert_equal(pw2.result_frame.iloc[:, -1].values, [False, True, False]) assert_equal(pw1.result_frame.index.values, np.array(['B-A', 'C-A', 'C-B'], dtype=object)) class TestTTestPairwiseOLS2(CheckPairwise): @classmethod def setup_class(cls): from statsmodels.formula.api import ols import statsmodels.stats.tests.test_anova as ttmod test = ttmod.TestAnova3() test.setup_class() cls.data = test.data.drop([0,1,2]) mod = ols("np.log(Days+1) ~ C(Weight) + C(Duration)", cls.data) cls.res = mod.fit() cls.term_name = "C(Weight)" cls.constraints = ['C(Weight)[T.2]', 'C(Weight)[T.3]', 'C(Weight)[T.3] - C(Weight)[T.2]'] class TestTTestPairwiseOLS3(CheckPairwise): @classmethod def setup_class(cls): from statsmodels.formula.api import ols import statsmodels.stats.tests.test_anova as ttmod test = ttmod.TestAnova3() test.setup_class() cls.data = test.data.drop([0,1,2]) mod = ols("np.log(Days+1) ~ C(Weight) + C(Duration) - 1", cls.data) cls.res = mod.fit() cls.term_name = "C(Weight)" cls.constraints = ['C(Weight)[2] - C(Weight)[1]', 'C(Weight)[3] - C(Weight)[1]', 'C(Weight)[3] - C(Weight)[2]'] class TestTTestPairwiseOLS4(CheckPairwise): @classmethod def setup_class(cls): from statsmodels.formula.api import ols import statsmodels.stats.tests.test_anova as ttmod test = ttmod.TestAnova3() test.setup_class() cls.data = test.data.drop([0,1,2]) mod = ols("np.log(Days+1) ~ C(Weight, Treatment(2)) + C(Duration)", cls.data) cls.res = mod.fit() cls.term_name = "C(Weight, Treatment(2))" cls.constraints = ['-C(Weight, Treatment(2))[T.1]', 'C(Weight, Treatment(2))[T.3] - C(Weight, Treatment(2))[T.1]', 'C(Weight, Treatment(2))[T.3]',] class TestTTestPairwisePoisson(CheckPairwise): @classmethod def setup_class(cls): from statsmodels.discrete.discrete_model import Poisson import statsmodels.stats.tests.test_anova as ttmod test = ttmod.TestAnova3() test.setup_class() cls.data = test.data.drop([0,1,2]) mod = Poisson.from_formula("Days ~ C(Duration) + C(Weight)", cls.data) cls.res = mod.fit(cov_type='HC0') cls.term_name = "C(Weight)" cls.constraints = ['C(Weight)[T.2]', 'C(Weight)[T.3]', 'C(Weight)[T.3] - C(Weight)[T.2]']
StarcoderdataPython
61272
import ctypes """ /*=======================================================================* * Fixed width word size data types: * * int8_T, int16_T, int32_T - signed 8, 16, or 32 bit integers * * uint8_T, uint16_T, uint32_T - unsigned 8, 16, or 32 bit integers * * real32_T, real64_T - 32 and 64 bit floating point numbers * *=======================================================================*/ """ int8_T = ctypes.c_byte uint8_T = ctypes.c_ubyte int16_T = ctypes.c_short uint16_T = ctypes.c_ushort int32_T = ctypes.c_int uint32_T = ctypes.c_uint int64_T = ctypes.c_longlong uint64_T = ctypes.c_ulonglong real32_T = ctypes.c_float real64_T = ctypes.c_double """ /*===========================================================================* * Generic type definitions: boolean_T, char_T, byte_T, int_T, uint_T, * * real_T, time_T, ulong_T, ulonglong_T. * *===========================================================================*/ """ real_T = ctypes.c_double time_T = ctypes.c_double boolean_T = ctypes.c_ubyte int_T = ctypes.c_int uint_T = ctypes.c_uint ulong_T = ctypes.c_ulong ulonglong_T = ctypes.c_ulonglong char_T = ctypes.c_char uchar_T = ctypes.c_ubyte char_T = ctypes.c_byte """ /*===========================================================================* * Complex number type definitions * *===========================================================================*/ """ class creal32_T(ctypes.Structure): _fields_ = [ ("re", real32_T), ("im", real32_T), ] class creal64_T(ctypes.Structure): _fields_ = [ ("re", real64_T), ("im", real64_T), ] class creal_T(ctypes.Structure): _fields_ = [ ("re", real_T), ("im", real_T), ] class cint8_T(ctypes.Structure): _fields_ = [ ("re", int8_T), ("im", int8_T), ] class cuint8_T(ctypes.Structure): _fields_ = [ ("re", uint8_T), ("im", uint8_T), ] class cint16_T(ctypes.Structure): _fields_ = [ ("re", int16_T), ("im", int16_T), ] class cuint16_T(ctypes.Structure): _fields_ = [ ("re", uint16_T), ("im", uint16_T), ] class cint32_T(ctypes.Structure): _fields_ = [ ("re", int32_T), ("im", int32_T), ] class cuint32_T(ctypes.Structure): _fields_ = [ ("re", uint32_T), ("im", uint32_T), ] class cint64_T(ctypes.Structure): _fields_ = [ ("re", int64_T), ("im", int64_T), ] class cuint64_T(ctypes.Structure): _fields_ = [ ("re", uint64_T), ("im", uint64_T), ]
StarcoderdataPython
3231668
# Copyright 2016 NTT DATA # All Rights Reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); you may # not use this file except in compliance with the License. You may obtain # a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, WITHOUT # WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the # License for the specific language governing permissions and limitations # under the License. from eventlet import timeout as etimeout from oslo_config import cfg from oslo_log import log as logging from oslo_service import loopingcall from taskflow.patterns import linear_flow import masakari.conf from masakari.engine.drivers.taskflow import base from masakari import exception CONF = masakari.conf.CONF LOG = logging.getLogger(__name__) ACTION = "process:recovery" TASKFLOW_CONF = cfg.CONF.taskflow_driver_recovery_flows class DisableComputeNodeTask(base.MasakariTask): def __init__(self, context, novaclient, **kwargs): kwargs['requires'] = ["process_name", "host_name"] super(DisableComputeNodeTask, self).__init__(context, novaclient, **kwargs) def execute(self, process_name, host_name): msg = "Disabling compute service on host: '%s'" % host_name self.update_details(msg) if not self.novaclient.is_service_down(self.context, host_name, process_name): # disable compute node on given host self.novaclient.enable_disable_service(self.context, host_name) msg = "Disabled compute service on host: '%s'" % host_name self.update_details(msg, 1.0) else: msg = ("Skipping recovery for process %(process_name)s as it is " "already disabled") % {'process_name': process_name} LOG.info(msg) self.update_details(msg, 1.0) class ConfirmComputeNodeDisabledTask(base.MasakariTask): def __init__(self, context, novaclient, **kwargs): kwargs['requires'] = ["process_name", "host_name"] super(ConfirmComputeNodeDisabledTask, self).__init__(context, novaclient, **kwargs) def execute(self, process_name, host_name): def _wait_for_disable(): service_disabled = self.novaclient.is_service_down( self.context, host_name, process_name) if service_disabled: raise loopingcall.LoopingCallDone() periodic_call = loopingcall.FixedIntervalLoopingCall( _wait_for_disable) try: msg = "Confirming compute service is disabled on host: '%s'" % ( host_name) self.update_details(msg) # add a timeout to the periodic call. periodic_call.start(interval=CONF.verify_interval) etimeout.with_timeout( CONF.wait_period_after_service_update, periodic_call.wait) msg = "Confirmed compute service is disabled on host: '%s'" % ( host_name) self.update_details(msg, 1.0) except etimeout.Timeout: msg = "Failed to disable service %(process_name)s" % { 'process_name': process_name } self.update_details(msg, 1.0) raise exception.ProcessRecoveryFailureException( message=msg) finally: # stop the periodic call, in case of exceptions or Timeout. periodic_call.stop() def get_compute_process_recovery_flow(context, novaclient, process_what): """Constructs and returns the engine entrypoint flow. This flow will do the following: 1. Disable nova-compute process 2. Confirm nova-compute process is disabled """ flow_name = ACTION.replace(":", "_") + "_engine" nested_flow = linear_flow.Flow(flow_name) task_dict = TASKFLOW_CONF.process_failure_recovery_tasks process_recovery_workflow_pre = linear_flow.Flow('pre_tasks') for plugin in base.get_recovery_flow(task_dict['pre'], context=context, novaclient=novaclient): process_recovery_workflow_pre.add(plugin) process_recovery_workflow_main = linear_flow.Flow('main_tasks') for plugin in base.get_recovery_flow(task_dict['main'], context=context, novaclient=novaclient): process_recovery_workflow_main.add(plugin) process_recovery_workflow_post = linear_flow.Flow('post_tasks') for plugin in base.get_recovery_flow(task_dict['post'], context=context, novaclient=novaclient): process_recovery_workflow_post.add(plugin) nested_flow.add(process_recovery_workflow_pre) nested_flow.add(process_recovery_workflow_main) nested_flow.add(process_recovery_workflow_post) return base.load_taskflow_into_engine(ACTION, nested_flow, process_what)
StarcoderdataPython
61806
<filename>get_image_url.py import urllib.request import time import flickr N = 5 PATH = "data/queries.txt" def get_queries(path): queries = [] with open(path) as f: for line in f: q = line.strip() queries.append(q) return queries if __name__ == "__main__": queries = get_queries(PATH) for q in queries: flickr.search_photos(q, n=N, sort="relevance") time.sleep(1)
StarcoderdataPython
183335
""" Creates the views for the: - index page - FAQ page - About page - Contact Us page """ from django.shortcuts import render def get_index(request): """ Returns index page :param request: The request type :return: index page """ return render(request, 'index.html') def get_faq(request): """ Returns FAQ page :param request: The request type :return: FAQ page """ return render(request, 'faq.html') def get_about(request): """ Returns the About Us page :param request: The request type :return: About Us page """ return render(request, 'about.html') def get_contact(request): """ Returns the Contact Us page :param request: The request type :return: Contact Us page """ return render(request, 'contact.html')
StarcoderdataPython
194163
import pandas as pd import json import glob def get_catalog(lst: list, num: int = 5): if num == 0: return lst lst += glob.glob(f"jsons_unzipped/{'*/'*num}/cata*.json", recursive=True) return get_catalog(lst, num-1) cats = get_catalog([], 7) cols = [c.split('\\')[-2] for c in cats] periods = [] langs = [] def get_period(elem: dict): return f'{elem["period"]}' if elem.get("period") else "" def get_language(elem: dict): return f'{elem["language"]}' if elem.get("language") else "" def files_write(langs: list, period: list): with open("data/lists/periob ds.txt", "w", encoding="utf_8") as file: file.writelines(period) with open("data/lists/langhjs.txt", "w", encoding="utf_8") as file: file.writelines(langs) def create_lists(cats: list): global langs, periods for c in cats: try: with open(c, "r", encoding="utf_8") as file: data = json.load(file)["members"] for d in data: periods.append(get_period(data[d])) langs.append(get_language(data[d])) except: continue langs = list(set(langs)) periods = list(set(periods)) def count_langs(lang: str): lag = {} lag["Name"] = lang global cats # global l global cols for c, projects in zip(cats, cols): counter = 0 try: with open(c, "r", encoding="utf_8") as file: data = json.load(file)["members"] for d in data: counter += 1 if get_language(data[d]) == lang else 0 lag[projects] = counter except: continue return lag if __name__ == "__main__": create_lists(cats) df = pd.DataFrame() for l in langs: try: namen = count_langs(l) if namen["Name"] == "": namen.update({"Name": "None"}) df = df.append(namen, True) except ValueError: continue with pd.ExcelWriter("data/lists/___excel.file.xlsx", "openpyxl") as xl: df.to_excel(xl, index=False)
StarcoderdataPython
80199
import torch import torch.nn as nn #==============================<Abstract Classes>==============================# """ Class that acts as the base building-blocks of ProgNets. Includes a module (usually a single layer), a set of lateral modules, and an activation. """ class ProgBlock(nn.Module): """ Runs the block on input x. Returns output tensor or list of output tensors. """ def runBlock(self, x): raise NotImplementedError """ Runs lateral i on input x. Returns output tensor or list of output tensors. """ def runLateral(self, i, x): raise NotImplementedError """ Runs activation of the block on x. Returns output tensor or list of output tensors. """ def runActivation(self, x): raise NotImplementedError """ Returns a dictionary of data about the block. """ def getData(self): raise NotImplementedError """ Returns True if block is meant to contain laterals. Returns False if block is meant to be a utility with not lateral inputs. Default is True. """ def isLateralized(self): return True """ Conveniance class for un-lateralized blocks. """ class ProgInertBlock(ProgBlock): def isLateralized(self): return False """ A special case of ProgBlock with multiple paths. """ ''' class ProgMultiBlock(ProgBlock): """ Returns a list of booleans (pass_list). Length of the pass_list is equal to the number of channels in the block. Channels that return True do not operate on their inputs, and simply pass them to the next block. """ def getPassDescriptor(self): raise NotImplementedError def getNumChannels(self): raise NotImplementedError ''' """ Class that generates new ProgColumns using the method generateColumn. The parentCols list will contain references to each parent column, such that columns can access lateral outputs. Additional information may be passed through the msg argument in generateColumn and ProgNet.addColumn. """ class ProgColumnGenerator: def generateColumn(self, parentCols, msg = None): raise NotImplementedError #============================<ProgColumn & ProgNet>============================# """ A column representing one sequential ANN with all of its lateral modules. Outputs of the last forward run are stored for child column laterals. Output of each layer is calculated as: y = activation(block(x) + sum(laterals(x))) colID -- A unique identifier for the column. blockList -- A list of ProgBlocks that will be run sequentially. parentCols -- A list of pointers to columns that will be laterally connectected. If the list is empty, the column is unlateralized. """ class ProgColumn(nn.Module): def __init__(self, colID, blockList, parentCols = []): super().__init__() self.colID = colID self.isFrozen = False self.parentCols = parentCols self.blocks = nn.ModuleList(blockList) self.numRows = len(blockList) self.lastOutputList = [] def freeze(self, unfreeze = False): if not unfreeze: # Freeze params. self.isFrozen = True for param in self.parameters(): param.requires_grad = False else: # Unfreeze params. self.isFrozen = False for param in self.parameters(): param.requires_grad = True def getData(self): data = dict() data["colID"] = self.colID data["rows"] = self.numRows data["frozen"] = self.isFrozen #data["last_outputs"] = self.lastOutputList data["blocks"] = [block.getData() for block in self.blocks] data["parent_cols"] = [col.colID for col in self.parentCols] return data def forward(self, input): outputs = [] x = input for r, block in enumerate(self.blocks): #if isinstance(block, ProgMultiBlock): #y = self.__forwardMulti(x, r, block) #else: y = self.__forwardSimple(x, r, block) outputs.append(y) x = y self.lastOutputList = outputs return outputs[-1] def __forwardSimple(self, x, row, block): currOutput = block.runBlock(x) if not block.isLateralized() or row == 0 or len(self.parentCols) < 1: y = block.runActivation(currOutput) elif isinstance(currOutput, list): for c, col in enumerate(self.parentCols): lats = block.runLateral(c, col.lastOutputList[row - 1]) for i in range(len(currOutput)): if currOutput[i] is not None and lats[i] is not None: currOutput[i] += lats[i] y = block.runActivation(currOutput) else: for c, col in enumerate(self.parentCols): currOutput += block.runLateral(c, col.lastOutputList[row - 1]) y = block.runActivation(currOutput) return y def __forwardMulti(self, x, row, block): if not isinstance(x, list): raise ValueError("[Doric]: Multiblock input must be a python list of inputs.") currOutput = block.runBlock(x) if not block.isLateralized() or row == 0 or len(self.parentCols) < 1: y = block.runActivation(currOutput) else: for c, col in enumerate(self.parentCols): lats = block.runLateral(c, col.lastOutputList[row - 1]) for i, p in enumerate(block.getPassDescriptor()): if not p: currOutput[i] += lats[i] y = block.runActivation(currOutput) return y """ A progressive neural network as described in Progressive Neural Networks (Rusu et al.). Columns can be added manually or with a ProgColumnGenerator. https://arxiv.org/abs/1606.04671 """ class ProgNet(nn.Module): def __init__(self, colGen = None): super().__init__() self.columns = nn.ModuleList() self.numRows = None self.numCols = 0 self.colMap = dict() self.colGen = colGen def addColumn(self, col = None, msg = None): if not col: if self.colGen is None: raise ValueError("[Doric]: No column or generator supplied.") parents = [colRef for colRef in self.columns] col = self.colGen.generateColumn(parents, msg) self.columns.append(col) if col.colID in self.colMap: raise ValueError("[Doric]: Column ID must be unique.") self.colMap[col.colID] = self.numCols if self.numRows is None: self.numRows = col.numRows else: if self.numRows != col.numRows: raise ValueError("[Doric]: Each column must have equal number of rows.") self.numCols += 1 return col.colID def freezeColumn(self, id): if id not in self.colMap: raise ValueError("[Doric]: No column with ID %s found." % str(id)) col = self.columns[self.colMap[id]] col.freeze() def freezeAllColumns(self): for col in self.columns: col.freeze() def unfreezeColumn(self, id): if id not in self.colMap: raise ValueError("[Doric]: No column with ID %s found." % str(id)) col = self.columns[self.colMap[id]] col.freeze(unfreeze = True) def unfreezeAllColumns(self): for col in self.columns: col.freeze(unfreeze = True) def isColumnFrozen(self, id): if id not in self.colMap: raise ValueError("[Doric]: No column with ID %s found." % str(id)) col = self.columns[self.colMap[id]] return col.isFrozen def getColumn(self, id): if id not in self.colMap: raise ValueError("[Doric]: No column with ID %s found." % str(id)) col = self.columns[self.colMap[id]] return col def forward(self, id, x): if self.numCols <= 0: raise ValueError("[Doric]: ProgNet cannot be run without at least one column.") if id not in self.colMap: raise ValueError("[Doric]: No column with ID %s found." % str(id)) colToOutput = self.colMap[id] for i, col in enumerate(self.columns): y = col(x) if i == colToOutput: return y def getData(self): data = dict() data["cols"] = [c.getData() for c in self.columns] return data #===============================================================================
StarcoderdataPython
3385070
<filename>library/microsoft_adcs_cert.py # READ LICENSE before using this module from __future__ import absolute_import, division, print_function __metaclass__ = type ANSIBLE_METADATA = {'metadata_version': '1.0', 'status': ['stableinteface'], 'supported_by': 'curated'} DOCUMENTATION = r''' --- module: msacds_certreq short_description: Upload CSR and download signed SSL certificate from Microsoft Active Directory Certificate Services. description: - This module generates and downloads certs from internal Microsoft Active Directory Certificate Services (CA). - This module does not generate a CSR, CSR should be pre-existing in local disk and full path for CSR file should be passed in as variable. - This module was tested only against Windows Server 2012 R2 Datacenter 64 bit Edition. - This module uses kerberos as authentication mechanism, since NTLM has vulnerabilities. - This module needs requests_kerberos,krbcontext [pip install requests_kerberos krbcontext] package as a pre-requisite. version_added: 2.9 author: <EMAIL> options: ca_server: description: - Include Fully Qualified domain name or IP address of the Certificate Microsoft Active Directory Certificate server. This server should be reachable from controller and 'https' GUI should be enabled. type: str required: True user: description: - Admin user name that has access to request certificate from the CA. type: str required: True credential_cachepath: description: - Full path to the kerberos credentail cache for C(user). type: str required: True ca_template_name: description: - Name of the template that will be used in CA to sign the CSR request. type: str required: True san_names: description: - List of Subject Alternative Names. type: str required: True csr_file_path: description: - Complete path to CSR file in local disc. type: str required: True cert_encoding: description: - Option to specify the encoding type while downloading the cert. type: str choices: - pem - der default: pem notes: - Tested only against Windows Server 2012 R2 Datacenter 64 bit Edition. - Backslash should be escaped , refer example. - Valid Kerberos ticket TGT must be already avaliable in the controller machine by running the kinit command. - 'Compatible with both py v2.7 and py v3.6+' - requests_ntlm package should be installed and available. pip3 install requests_kerberos pip3 install krbcontext - Cert file will be written in the same directory as input CSR file. ''' EXAMPLES = r''' - name: Upload a CSR and download Signed SSL cert msadcs_certreq: ca_server: msadserver.mydomain.com user: "<EMAIL>" credential_cachepath: "/tmp/user@DOMAIN.COM" ca_template_name: CSR_SIGNING_TEMPLATE_2048 san_names: - altname1.mydomain.com - altname2.mydomain.com csr_file_path: '/full/path/to/csr/file' cert_encoding: pem register: result ''' RESULT = r''' msacds_certreq_facts: cert_full_path : '/full/path/to/cert/file' err: '<Disposition Message if any> or null' ''' from ansible.module_utils.basic import AnsibleModule import json import re import sys import time import requests from requests.packages.urllib3.exceptions import InsecureRequestWarning requests.packages.urllib3.disable_warnings(InsecureRequestWarning) from requests_kerberos import HTTPKerberosAuth, OPTIONAL from krbcontext import krbContext if sys.version.startswith('3') : from urllib.parse import quote_plus as encode_util SLEEP_TIME=3 else : from urllib import quote_plus as encode_util SLEEP_TIME=3.0 ENCODING_MAP = { 'pem':'b64', 'der':'bin' } class ArgumentSpec(object): ''' Aruguments specification to align with Ansible argument class. ''' def __init__(self): self.supports_check_mode = False argument_spec = dict( ca_server=dict( required=True, aliases=['ca'], type = 'str' ), user=dict( required=True, aliases=['ca_admin_user'], type='str' ), credential_cachepath=dict( required=True, aliases=['ccachepath'], type='str', no_log=True ), ca_template_name=dict( required=True, type='str' ), san_names=dict( required=True, type='list' ), csr_file_path=dict( required=True, type='str' ), cert_encoding=dict( type='str', default='pem', choices=['pem', 'der'] ) ) self.argument_spec = {} self.argument_spec.update(argument_spec) def _get_csr_content() : ''' private function to read csr from given file path and return URL encoded CSR data. Parameters : None : csr_path(global str) : Full path to CSR file. Returns : URL encoded CSR data only the content is returned header ('BEGIN CERTIFICATE REQUEST') and footer ('END CERTIFICATE REQUEST') are removed.(str) ''' csr_f = open(csr_path,'r') csr_data = csr_f.read().replace('-----BEGIN CERTIFICATE REQUEST-----','') csr_f.close() csr_data = csr_data.split('-----END CERTIFICATE REQUEST-----',1) csr_data = csr_data[0] return csr_data def _get_crt_attrib(): ''' private function to frame CertAttrib fpor the CURL calls. Parameters : None : sans(global list(str)) : List of San names. None : ca_template(global str) : Template name to use for CSR signing. Returns : URL encoded crt_attribute data neccessary for the cert request call.(str) ''' crt_attrb = '' san_list = [] for each_san in sans : san_list.append("dns={each_san}".format(each_san=each_san)) #CA SAN format : SAN:dns=host1.mydomain.com&dns=host2&dns=host3.mydomain.com san_updated = 'SAN:'+('&'.join(san_list)) crt_attrb += san_updated crt_attrb += "\nCertificateTemplate:{ca_template}".format(ca_template=ca_template) crt_attrb += '\nUserAgent:Mozilla/5.0 \(Windows NT 10.0; Win64; x64\) AppleWebKit/537.36 \(KHTML, like Gecko\) Chrome/81.0.4044.122 Safari/537.36' return crt_attrb def _request_cert_req(): ''' private function to submit a csr signing request. Parameters : None : global vars Returns : request ID to download cert(str) Raises: Disposition message if any. ''' payload =dict() payload['Mode'] = 'newreq' payload['CertRequest'] = _get_csr_content() payload['CertAttrib'] = _get_crt_attrib() payload['TargetStoreFlags'] = 0 payload['SaveCert'] = 'yes' payload['ThumbPrint'] = '' payload['FriendlyType'] = encode_util('Saved-Request Certificate') headers=dict() headers['Accept'] = "text/html,application/xhtml+xml,application/xml;q=0.9,image/webp,image/apng,*/*;q=0.8,application/signed-exchange;v=b3;q=0.9" headers['Accept-Encoding'] = "gzip, deflate, br" headers['Accept-Language'] = "en-US,en;q=0.9" headers['Content-Type'] = "application/x-www-form-urlencoded" headers['Cache-Control'] = "max-age=0" headers['Connection'] = "keep-alive" headers['Host'] = ca headers['Origin'] = "https://{ca}".format(ca=ca) headers['Referer'] = "https://{ca}/certsrv/certrqxt.asp".format(ca=ca) headers['User-Agent'] = "Mozilla/5.0 (Windows NT 10.0; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/81.0.4044.122 Safari/537.36" response = session.post(cert_req_ep,data=payload,headers=headers,verify=False) rsp_txt = response.text try : match = re.search('certnew.p7b\?ReqID=(.+?)\&\"\+getEncoding',rsp_txt) req_id = match.group(1) except Exception: match = re.search('The disposition message is (.+?)\\n',rsp_txt) err_msg = match.group(1) raise ValueError(err_msg) return req_id def _download_cert_req(req_id,encoding) : ''' private function to download certificate after signing. Parameters : req_id(str) : request ID to download the certificate. Returns : cert_obj(dict) : returns { 'cert_full_path' '/full/path/to/cert/in/local/disc', 'err': 'Exception messages if any' or null} ''' crt_path = csr_path.replace('.csr','.p7b') download_url = cert_down_ep.replace('<req_id>',req_id) headers=dict() headers['Accept'] = "text/html,application/xhtml+xml,application/xml;q=0.9,image/webp,image/apng,*/*;q=0.8,application/signed-exchange;v=b3;q=0.9" headers['Accept-Encoding'] = "gzip, deflate, br" headers['Accept-Language'] = "en-US,en;q=0.9" headers['Content-Type'] = "application/x-www-form-urlencoded" headers['Cache-Control'] = "max-age=0" headers['Connection'] = "keep-alive" headers['Host'] = ca headers['Origin'] = "https://{ca}".format(ca=ca) headers['Referer'] = "https://{ca}/certsrv/certfnsh.asp".format(ca=ca) headers['User-Agent'] = "Mozilla/5.0 (Windows NT 10.0; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/81.0.4044.122 Safari/537.36" err=None try: #Handle for DER formatted file download. if encoding == "der" : #Download only leaf cert response = session.get(download_url.replace('.p7b','.cer'),headers=headers,verify=False) crt_path = csr_path.replace('.csr','.crt') file = open(crt_path, "wb") file.write(response.content) else: response = session.get(download_url,headers=headers,verify=False) file = open(crt_path, "w") file.write(response.text) file.close() except Exception as e: err = str(e) if err: return { 'cert_full_path' : None, 'err' : err } return { 'cert_full_path' : crt_path, 'err' : err } def _exec_module(module): ''' private proxy ansible function to invoke the cert request routines. Parameters : module(AnsibleModule) : request ID to download the certificate. Returns : updated results(dict) : returns updated cert object path { 'cert_full_path' '/full/path/to/cert/in/local/disc', 'err': 'Exception messages if any' or null} ''' results = dict() args = module.params global csr_path csr_path = args['csr_file_path'] global session session=requests.Session() session.verify=False session.auth = HTTPKerberosAuth(mutual_authentication=OPTIONAL) global ca_template ca_template=args['ca_template_name'] global sans sans=args['san_names'] global ca ca=args['ca_server'] global cert_req_ep cert_req_ep = 'https://{ca}/certsrv/certfnsh.asp'.format(ca=ca) encoding = args['cert_encoding'] global cert_down_ep cert_down_ep = "https://{ca}/certsrv/certnew.p7b?ReqID=<req_id>&Enc={encoding}".format(ca=ca,encoding=ENCODING_MAP[encoding]) req_id = _request_cert_req() time.sleep(SLEEP_TIME) crt_path_obj = _download_cert_req(req_id,encoding) err_msg = crt_path_obj['err'] if err_msg: module.fail_json(msg='400:'+err_msg) results.update(crt_path_obj) return results def main(): ''' Main routine. Returns : path facts to the invoking ansible play (dict) : returns msacds_certreq_facts dict "msacds_certreq_facts": { "cert_full_path": "/tmp/ansiblehost.mydomain.com.p7b", "err": null }, "msg": "200:Success" } ''' spec = ArgumentSpec() module = AnsibleModule( argument_spec=spec.argument_spec, supports_check_mode=spec.supports_check_mode ) try: user = module.params['user'] credential_cachepath = module.params['credential_cachepath'] with krbContext(principal=user, ccache_file=credential_cachepath): results = _exec_module(module) module.exit_json(changed=True,msacds_certreq_facts=results,msg='200:Success') except Exception as ex: module.fail_json(msg='400:'+str(ex)) if __name__ == '__main__': main()
StarcoderdataPython
169989
from HSTB.kluster.gui.backends._qt import QtGui, QtCore, QtWidgets, Signal from HSTB.kluster.gui.common_widgets import SaveStateDialog from HSTB.kluster import kluster_variables class PatchTestDialog(SaveStateDialog): patch_query = Signal(str) # submit new query to main for data def __init__(self, parent=None, title='', settings=None): super().__init__(parent, settings, widgetname='patchtestdialog') self.setWindowTitle('Patch Test') self.setMinimumWidth(900) self.setMinimumHeight(400) self.main_layout = QtWidgets.QVBoxLayout() self.listlayout = QtWidgets.QHBoxLayout() self.leftlayout = QtWidgets.QVBoxLayout() self.choose_layout = QtWidgets.QHBoxLayout() self.from_selected_lines = QtWidgets.QRadioButton('Use selected lines') self.from_selected_lines.setChecked(True) self.choose_layout.addWidget(self.from_selected_lines) self.from_points_view = QtWidgets.QRadioButton('Use Points View selection') self.from_points_view.setChecked(False) self.from_points_view.setDisabled(True) self.choose_layout.addWidget(self.from_points_view) self.choose_layout.addStretch() self.leftlayout.addLayout(self.choose_layout) self.button_layout = QtWidgets.QHBoxLayout() self.analyze_button = QtWidgets.QPushButton('Analyze') self.button_layout.addWidget(self.analyze_button) self.button_layout.addStretch() self.leftlayout.addLayout(self.button_layout) self.line_list = LineList(self) self.leftlayout.addWidget(self.line_list) self.rightlayout = QtWidgets.QHBoxLayout() self.explanation = QtWidgets.QTextEdit('', self) self.explanation.setMinimumWidth(150) self.rightlayout.addWidget(self.explanation) self.listlayout.addLayout(self.leftlayout) self.listlayout.addLayout(self.rightlayout) self.main_layout.addLayout(self.listlayout) self.button_layout = QtWidgets.QHBoxLayout() self.button_layout.addStretch(1) self.ok_button = QtWidgets.QPushButton('Run', self) self.button_layout.addWidget(self.ok_button) self.button_layout.addStretch(1) self.cancel_button = QtWidgets.QPushButton('Cancel', self) self.button_layout.addWidget(self.cancel_button) self.button_layout.addStretch(1) self.main_layout.addLayout(self.button_layout) self.hlayout_msg = QtWidgets.QHBoxLayout() self.warning_message = QtWidgets.QLabel('', self) self.warning_message.setStyleSheet("color : {};".format(kluster_variables.error_color)) self.hlayout_msg.addWidget(self.warning_message) self.main_layout.addLayout(self.hlayout_msg) self.setLayout(self.main_layout) self.canceled = False self.return_pairs = None self.from_selected_lines.clicked.connect(self.radio_selected) self.from_points_view.clicked.connect(self.radio_selected) self.analyze_button.clicked.connect(self.analyze_data) self.ok_button.clicked.connect(self.return_patch_test_data) self.cancel_button.clicked.connect(self.cancel_patch) self.text_controls = [] self.checkbox_controls = [['from_points_view', self.from_points_view], ['from_selected_lines', self.from_selected_lines]] self.read_settings() self._set_explanation() @property def row_full_attribution(self): return self.line_list.final_attribution def _set_explanation(self): msg = 'Based on "Computation of Calibration Parameters for Multibeam Echo Sounders Using the Least Squares Method"' msg += ', by <NAME>\n\nCompute new offsets/angles for the data provided using this automated least squares' msg += ' adjustment.' self.explanation.setText(msg) def err_message(self, text: str = ''): if text: self.warning_message.setText('ERROR: ' + text) else: self.warning_message.setText('') def analyze_data(self): self.err_message() if self.from_selected_lines.isChecked(): self.patch_query.emit('lines') elif self.from_points_view.isChecked(): self.patch_query.emit('pointsview') def radio_selected(self, ev): if self.from_selected_lines.isChecked(): self.from_points_view.setChecked(False) elif self.from_points_view.isChecked(): self.from_selected_lines.setChecked(False) def add_line(self, line_data: list): self.line_list.add_line(line_data) def validate_pairs(self): pair_dict, err, msg = self.line_list.form_pairs() if err: self.err_message(msg) return err, pair_dict def return_patch_test_data(self): self.canceled = False err, pairdict = self.validate_pairs() if not err: self.return_pairs = pairdict self.save_settings() self.accept() def cancel_patch(self): self.canceled = True self.accept() def clear(self): self.line_list.setup_table() class LineList(QtWidgets.QTableWidget): def __init__(self, parent): super().__init__(parent) self.setDragEnabled(True) # enable support for dragging table items self.setAcceptDrops(True) # enable drop events self.viewport().setAcceptDrops(True) # viewport is the total rendered area, this is recommended from my reading self.setDragDropOverwriteMode(False) # False makes sure we don't overwrite rows on dragging self.setDropIndicatorShown(True) self.setSortingEnabled(True) # ExtendedSelection - allows multiselection with shift/ctrl self.setSelectionMode(QtWidgets.QAbstractItemView.ExtendedSelection) self.setSelectionBehavior(QtWidgets.QAbstractItemView.SelectRows) self.setDragDropMode(QtWidgets.QAbstractItemView.DragDrop) # makes it so no editing is possible with the table self.setEditTriggers(QtWidgets.QAbstractItemView.NoEditTriggers) self.headr = ['Pair', 'Line Name', 'Heading'] self.setColumnCount(3) self.setHorizontalHeaderLabels(self.headr) self.setColumnWidth(0, 40) self.setColumnWidth(1, 299) self.setColumnWidth(2, 80) self.row_full_attribution = {} @property def final_attribution(self): curdata = self.row_full_attribution actual_lines = [] for row in range(self.rowCount()): # update the pair numbers from the table comboboxes first pair_num = int(self.cellWidget(row, 0).currentText()) line_name = str(self.item(row, 1).text()) curdata[line_name][0] = pair_num actual_lines.append(line_name) dropthese = [] for lname in curdata.keys(): if lname not in actual_lines: dropthese.append(lname) for lname in dropthese: curdata.pop(lname) return curdata def keyReleaseEvent(self, e): """ Catch keyboard driven events to delete entries or select new rows Parameters ---------- e: QEvent generated on keyboard key release """ if e.matches(QtGui.QKeySequence.Delete) or e.matches(QtGui.QKeySequence.Back): rows = sorted(set(item.row() for item in self.selectedItems())) for row in rows: self.removeRow(row) def dragEnterEvent(self, e): """ Catch mouse drag enter events to block things not move/read related Parameters ---------- e: QEvent which is sent to a widget when a drag and drop action enters it """ if e.source() == self: # allow MIME type files, have a 'file://', 'http://', etc. e.accept() else: e.ignore() def dragMoveEvent(self, e): """ Catch mouse drag enter events to block things not move/read related Parameters ---------- e: QEvent which is sent while a drag and drop action is in progress """ if e.source() == self: e.accept() else: e.ignore() def dropEvent(self, e): """ On drag and drop, handle either reordering of rows or incoming new data from zarr store Parameters ---------- e: QEvent which is sent when a drag and drop action is completed """ if not e.isAccepted() and e.source() == self: e.setDropAction(QtCore.Qt.MoveAction) drop_row = self.drop_on(e) self.custom_move_row(drop_row) else: e.ignore() def drop_on(self, e): """ Returns the integer row index of the insertion point on drag and drop Parameters ---------- e: QEvent which is sent when a drag and drop action is completed Returns ------- int: row index """ index = self.indexAt(e.pos()) if not index.isValid(): return self.rowCount() return index.row() + 1 if self.is_below(e.pos(), index) else index.row() def is_below(self, pos, index): """ Using the event position and the row rect shape, figure out if the new row should go above the index row or below. Parameters ---------- pos: position of the cursor at the event time index: row index at the cursor Returns ------- bool: True if new row should go below, False otherwise """ rect = self.visualRect(index) margin = 2 if pos.y() - rect.top() < margin: return False elif rect.bottom() - pos.y() < margin: return True return rect.contains(pos, True) and pos.y() >= rect.center().y() def custom_move_row(self, drop_row): """ Something I stole from someone online. Will get the row indices of the selected rows and insert those rows at the drag-n-drop mouse cursor location. Will even account for relative cursor position to the center of the row, see is_below. Parameters ---------- drop_row: int, row index of the insertion point for the drag and drop """ self.setSortingEnabled(False) rows = sorted(set(item.row() for item in self.selectedItems())) # pull all the selected rows rows_to_move = [[QtWidgets.QTableWidgetItem(self.item(row_index, column_index)) for column_index in range(self.columnCount())] for row_index in rows] # get the data for the rows for row_index in reversed(rows): self.removeRow(row_index) if row_index < drop_row: drop_row -= 1 for row_index, data in enumerate(rows_to_move): row_index += drop_row self.insertRow(row_index) for column_index, column_data in enumerate(data): self.setItem(row_index, column_index, column_data) for row_index in range(len(rows_to_move)): for i in range(int(len(self.headr))): self.item(drop_row + row_index, i).setSelected(True) self.setSortingEnabled(True) def setup_table(self): self.clearContents() self.setRowCount(0) self.row_full_attribution = {} def add_line(self, line_data: list): if line_data: self.setSortingEnabled(False) pair_number, linename, heading = line_data if linename in self.row_full_attribution: raise Exception("ERROR: PatchTest - Unable to add line {} when this line already exists".format(linename)) self.row_full_attribution[linename] = [pair_number, heading] next_row = self.rowCount() self.insertRow(next_row) for column_index, column_data in enumerate(line_data): if column_index == 0: item = QtWidgets.QComboBox() item.addItems([str(i) for i in range(0, 15)]) item.setCurrentText(str(column_data)) self.setCellWidget(next_row, column_index, item) else: if column_index == 2: # heading item = QtWidgets.QTableWidgetItem('{:3.3f}'.format(float(column_data)).zfill(7)) else: item = QtWidgets.QTableWidgetItem(str(column_data)) self.setItem(next_row, column_index, item) self.setSortingEnabled(True) def form_pairs(self): pair_dict = {} az_dict = {} err = False msg = '' for lname, ldata in self.final_attribution.items(): pair_index = int(ldata[0]) azimuth = float(ldata[1]) if pair_index in pair_dict: pair_dict[pair_index].append(lname) az_dict[pair_index].append(azimuth) else: pair_dict[pair_index] = [lname] az_dict[pair_index] = [azimuth] for pair_cnt, pair_lines in pair_dict.items(): if len(pair_lines) > 2: msg = 'Pair {} has {} lines, can only have 2'.format(pair_cnt, len(pair_lines)) err = True elif len(pair_lines) < 2: msg = 'Pair {} has less than 2 lines, each pair must have 2 lines'.format(pair_cnt) err = True for pairidx, az_list in az_dict.items(): # tack on the lowest azimuth pair_dict[pairidx].append(min(az_list)) return pair_dict, err, msg if __name__ == '__main__': try: # pyside2 app = QtWidgets.QApplication() except TypeError: # pyqt5 app = QtWidgets.QApplication([]) dlog = PatchTestDialog() dlog.add_line([1, 'tstline', 0.0]) dlog.add_line([2, 'tstline2', 180.0]) dlog.show() if dlog.exec_(): pass
StarcoderdataPython
3305196
<reponame>L-Net-1992/oneflow """ Copyright 2020 The OneFlow Authors. All rights reserved. Licensed under the Apache License, Version 2.0 (the "License"); you may not use this file except in compliance with the License. You may obtain a copy of the License at http://www.apache.org/licenses/LICENSE-2.0 Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the specific language governing permissions and limitations under the License. """ import unittest import numpy as np import oneflow as flow import oneflow.unittest from collections import OrderedDict from oneflow.test_utils.test_util import GenArgList def get_sbp(device: str): return flow.env.all_device_placement(device), flow.sbp.split(0) shapes = {2: (128, 8), 3: (16, 8, 64), 4: (16, 8, 32, 32), 5: (16, 8, 16, 16, 16)} def compare_loss(device_type, dim, reduction, cls, data_generator): x, y, x1, y1 = data_generator(dim, device_type, *get_sbp(device_type)) reduce_loss_func = cls(reduction=reduction).to(device_type) none_loss_func = cls(reduction="none").to(device_type) loss_mean = reduce_loss_func(x, y) loss_none = ( flow.mean(none_loss_func(x1, y1)) if reduction == "mean" else flow.sum(none_loss_func(x1, y1)) ) loss_mean.backward() loss_none.backward() assert np.allclose( loss_none.to_local().numpy(), loss_mean.to_local().numpy(), rtol=1e-05, atol=1e-05, ) assert np.allclose(loss_none.numpy(), loss_mean.numpy(), rtol=1e-05, atol=1e-05,) assert np.allclose( x.grad.to_local().numpy(), x1.grad.to_local().numpy(), rtol=1e-05, atol=1e-05, ) def generate_necessity_default(dim: int, device: str, placement, sbp): shape = shapes[dim] x_np = np.random.uniform(0, 1, shape) y_np = np.random.uniform(0, 1, shape) def f(x, requires_grad): t = flow.tensor(x, device=device, requires_grad=requires_grad).to_global( placement=placement, sbp=[sbp] ) if requires_grad: t.retain_grad() return t return f(x_np, True), f(y_np, False), f(x_np, True), f(y_np, False) def generate_necessity_for_cross_entropy_or_nll_loss( dim: int, device: str, placement, sbp ): shape = shapes[dim] y_shape = (shape[0],) if dim == 2 else (shape[0], *shape[2:]) x_np = np.random.uniform(0, 1, shape) y_np = np.random.randint(0, shape[1], y_shape) def f(x, requires_grad): t = flow.tensor(x, device=device, requires_grad=requires_grad).to_global( placement=placement, sbp=[sbp] ) if requires_grad: t.retain_grad() return t return f(x_np, True), f(y_np, False), f(x_np, True), f(y_np, False) class TestBCELossOrWithLogitsConsistent(flow.unittest.TestCase): @flow.unittest.skip_unless_1n2d() def test_bce_loss(testcase): arg_dict = OrderedDict() arg_dict["device_type"] = ["cuda", "cpu"] arg_dict["dim"] = [2, 3, 4, 5] arg_dict["reduction"] = ["sum", "mean"] arg_dict["cls"] = [flow.nn.BCELoss, flow.nn.BCEWithLogitsLoss] arg_dict["data_generator"] = [generate_necessity_default] for arg in GenArgList(arg_dict): compare_loss(*arg) class TestCrossEntropyOrNllLossConsistent(flow.unittest.TestCase): @flow.unittest.skip_unless_1n2d() def test_cross_entropy_loss_or_nll_loss(testcase): arg_dict = OrderedDict() arg_dict["device_type"] = ["cuda", "cpu"] arg_dict["dim"] = [2, 3, 4, 5] arg_dict["reduction"] = ["sum", "mean"] arg_dict["cls"] = [flow.nn.CrossEntropyLoss, flow.nn.NLLLoss] arg_dict["data_generator"] = [generate_necessity_for_cross_entropy_or_nll_loss] for arg in GenArgList(arg_dict): compare_loss(*arg) class TestKLDivLossConsistent(flow.unittest.TestCase): @flow.unittest.skip_unless_1n2d() def test_kl_div_loss(testcase): arg_dict = OrderedDict() arg_dict["device_type"] = ["cuda", "cpu"] arg_dict["dim"] = [2, 3, 4, 5] arg_dict["reduction"] = ["sum", "mean"] arg_dict["cls"] = [flow.nn.KLDivLoss] arg_dict["data_generator"] = [generate_necessity_default] for arg in GenArgList(arg_dict): compare_loss(*arg) class TestSmoothL1LossConsistent(flow.unittest.TestCase): @flow.unittest.skip_unless_1n2d() def test_smooth_l1_loss(testcase): arg_dict = OrderedDict() arg_dict["device_type"] = ["cuda", "cpu"] arg_dict["dim"] = [2, 3, 4, 5] arg_dict["reduction"] = ["sum", "mean"] arg_dict["cls"] = [flow.nn.SmoothL1Loss] arg_dict["data_generator"] = [generate_necessity_default] for arg in GenArgList(arg_dict): compare_loss(*arg) if __name__ == "__main__": unittest.main()
StarcoderdataPython
3200339
from flask.ext.wtf import (Form, TextField, PasswordField, FormField, required, EqualTo, Email, ValidationError, Optional) from flask.ext.login import current_user from nano.models import User from nano.extensions import db class UserForm(Form): first_name = TextField(u'First name', validators=[required()]) last_name = TextField(u'Last name', validators=[required()]) email_address = TextField(u'Email address', validators=[required(), Email()]) password = PasswordField(u'<PASSWORD>', validators=[Optional(), EqualTo('password_confirm')]) password_confirm = PasswordField(u'Password confirm', validators=[Optional()]) def __init__(self, formdata=None, obj=None, prefix='', **kwargs): super(UserForm, self).__init__(formdata, obj, prefix, **kwargs) if obj: self.user = obj else: self.user = None def validate_email_address(self, field): user = User.query.filter_by(email_address=field.data) \ .filter(User.id != self.user.id).first() if user: raise ValidationError('That email address is already in use') def save(self): self.user.first_name = self.first_name.data self.user.last_name = self.last_name.data self.user.email_address = self.email_address.data if len(self.password.data) > 1: self.user.password = self.password.data db.session.add(self.user) db.session.commit() return self.user
StarcoderdataPython
4829936
<filename>bigml/centroid.py # -*- coding: utf-8 -*- #!/usr/bin/env python # # Copyright 2014-2020 BigML # # Licensed under the Apache License, Version 2.0 (the "License"); you may # not use this file except in compliance with the License. You may obtain # a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, WITHOUT # WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the # License for the specific language governing permissions and limitations # under the License. """Centroid structure for the BigML local Cluster This module defines an auxiliary Centroid predicate structure that is used in the cluster. """ import math import sys INDENT = " " * 4 STATISTIC_MEASURES = [ 'Minimum', 'Mean', 'Median', 'Maximum', 'Standard deviation', 'Sum', 'Sum squares', 'Variance'] def cosine_distance2(terms, centroid_terms, scale): """Returns the distance defined by cosine similarity """ # Centroid values for the field can be an empty list. # Then the distance for an empty input is 1 # (before applying the scale factor). if not terms and not centroid_terms: return 0 if not terms or not centroid_terms: return scale ** 2 input_count = 0 for term in centroid_terms: if term in terms: input_count += 1 cosine_similarity = input_count / math.sqrt( len(terms) * len(centroid_terms)) similarity_distance = scale * (1 - cosine_similarity) return similarity_distance ** 2 class Centroid(object): """A Centroid. """ def __init__(self, centroid_info): self.center = centroid_info.get('center', {}) self.count = centroid_info.get('count', 0) self.centroid_id = centroid_info.get('id', None) self.name = centroid_info.get('name', None) self.distance = centroid_info.get('distance', {}) def distance2(self, input_data, term_sets, scales, stop_distance2=None): """Squared Distance from the given input data to the centroid """ distance2 = 0.0 for field_id, value in self.center.items(): if isinstance(value, list): # text field terms = ([] if field_id not in term_sets else term_sets[field_id]) distance2 += cosine_distance2(terms, value, scales[field_id]) elif isinstance(value, basestring): if field_id not in input_data or input_data[field_id] != value: distance2 += 1 * scales[field_id] ** 2 else: distance2 += ((input_data[field_id] - value) * scales[field_id]) ** 2 if stop_distance2 is not None and distance2 >= stop_distance2: return None return distance2 def print_statistics(self, out=sys.stdout): """Print the statistics for the training data clustered around the centroid """ out.write(u"%s%s:\n" % (INDENT, self.name)) literal = u"%s%s: %s\n" for measure_title in STATISTIC_MEASURES: measure = measure_title.lower().replace(" ", "_") out.write(literal % (INDENT * 2, measure_title, self.distance[measure])) out.write("\n")
StarcoderdataPython
3396147
import numpy as np from helpers import baseline_discretization, solve_set_based, solve_sample_based, comparison_wrapper from models import makeMatrixModel, makeSkewModel, makeDecayModel, make1DHeatModel # define problem dimensions inputDim, outputDim = 2, 2 # define reference parameter # refParam = np.array([0.5]*inputDim) if __name__ == "__main__": import argparse desc = """ Make voronoi-cell diagrams with uniform random samples in a 2D unit domain. """ parser = argparse.ArgumentParser(description=desc) parser.add_argument('-m', '--model', default='random', type=str, help=""" Choose model from - 'skew' (linear matrix map) - 'identity' (linear matrix map) - 'random' (linear matrix map) - 'decay' (exponential decay) - 'heatrod' (1-dimensional heat eq) - 'diagonal' (linear matrix map) If unrecognized, it will revert to 'random' (linear map). """) parser.add_argument('-n', '--num', default=int(1E2), type=int, help=""" Set number of samples (default: 1E2). If given as <=1, it will revert to the default value. """) parser.add_argument('-u', '--uncert_rect_size', default=0.2, type=float, help='Set uncertainty (`rect_size`) (default: 0.2)') parser.add_argument('-s', '--seed', default=21, type=int, help='Set random seed (default: 21).') parser.add_argument('-o', '--observed_cells_per_dim', default=1, type=int, help=""" Cells per dimension (default: 1) for regular grid discretizing the `output_probability_set`. If given as <1, it will revert to the default value. """) parser.add_argument('-i', '--input_cells_per_dim', default=49, type=int, help=""" Cells per dimension (default: 49) for regular grid discretizing the `input_sample_set`. If given as <1, it will revert to the default value. """) parser.add_argument('--mc_points', default=0, type=int, help=""" Number of samples (default: 0) in calculation of volumes using Monte Carlo emulation (integration). If given as <100, it will revert to None. If None, or not supplied, default to using the Monte Carlo assumption (volumes = 1/num_samples). """) parser.add_argument('--reg', action='store_true', help='Use regular grid sampling for input space.') parser.add_argument('--pdf', action='store_true', help='Store as pdf instead of png.') parser.add_argument('--show', action='store_true', help='Call `plt.show()` after plotting.') parser.add_argument('--noplot', action='store_true', help='Option to not create/save plots.') parser.add_argument('--fontsize', default=16, type=float, help='Sets `plt.rcParams[\'font.size\']` (default: 16).') parser.add_argument('--figsize', default=5, type=int, help=""" Sets `plt.rcParams[\'figure.size\']`(default: 5). Assumes square aspect ratio. """) parser.add_argument('-l', '--numlevels', default=10, type=int, help=""" Number of contours to plot (default=10). If given as <2, it will revert to 2. """) parser.add_argument('--figlabel', default='', type=str, help='Label in figure saved name.') parser.add_argument('-t', '--title', default=None, type=str, help='Title for figure. If `None`, use `--model` in title.') # which problem type to solve? parser.add_argument('--set', action='store_true', help='Only do set-based solution.') parser.add_argument('--sample', action='store_true', help='Only do sample-based solution.') # model- specific arguments parser.add_argument('--skew', default=1.0, type=float, help='Sets skew if `--model=\'skew\'` (default: 1.0).') parser.add_argument('--lam1', default=0.5, type=float, help='Sets first default parameter (default: 0.5).') parser.add_argument('--lam2', default=0.5, type=float, help='Sets second default parameter (default: 0.5).') parser.add_argument('--t0', default=0.5, type=float, help='Decay model: 1st observation time (default: 0.5). \ Heatrod model: 1st thermometer location.') parser.add_argument('--t1', default=0.75, type=float, help='Decay model: 2nd observation time (default: 0.75). \ Heatrod model: 1st thermometer location.') parser.add_argument('--noeval', action='store_true', help='Sample based model: plot using original samples, not mesh.') #### START OF FUNCTIONALITY ### args = parser.parse_args() numSamples, r_seed = args.num, args.seed eval = not args.noeval # evaluate sample-based model at new samples? if numSamples <= 1: print("Incompatible number of samples. Using default.") numSamples = int(1E2) if r_seed > 0: np.random.seed(r_seed) # define width of sidelengths of support of observed uncert_rect_size = args.uncert_rect_size # regular-grid discretization of sets (set-based approach): # cpd = cells per dimension # output_probability_set discretization cpd_observed = args.observed_cells_per_dim if cpd_observed < 1: cpd_observed = 1 # input_sample_set discretization (if regular) # only pay attention to cpd_input if regular sampling has been specified. if args.reg: cpd_input = args.input_cells_per_dim if cpd_input < 1: cpd_input = 49 else: cpd_input = None n_mc_points = int(args.mc_points) if n_mc_points < 100: n_mc_points = None # MODEL SELECTION if args.lam1 < 0 or args.lam1 > 1: lam1 = 0.5 if args.lam2 < 0 or args.lam2 > 1: lam2 = 0.5 refParam = np.array([args.lam1, args.lam2]) model_choice = args.model # default domain min_val, max_val = 0, 1 # TODO: add options to set it: need to take in list, potentially if model_choice == 'skew': # can be list for higher-dimensional outputs. skew = args.skew if skew < 1: raise ValueError("Skewness must be greater than 1.") myModel = makeSkewModel(skew) elif model_choice == 'decay': # times to evaluate define the QoI map # error-handling for times. if args.t0 > 0: t0 = args.t0 else: raise ValueError("t0<0.") if args.t1 > 0: t1 = args.t1 else: raise ValueError("t1<0.") if args.t1 <= t0: raise ValueError("t1<t0.") else: t1 = args.t1 eval_times = [t0, t1] myModel = makeDecayModel(eval_times) model_choice += 'T=[%s-%s]'%(t0, t1) elif model_choice == 'random': A = np.random.randn(outputDim,inputDim) myModel = makeMatrixModel(A) elif model_choice == 'diagonal': print("Using `t0/t1` as diagonal entries for operator.") diag = [args.t0, args.t1] D = np.diag(diag) myModel = makeMatrixModel(D) elif model_choice == 'heatrod': print("Using `t0/t1` for thermometer locations") assert args.t0 < 1 and args.t0 > 0 assert args.t1 < 1 and args.t1 > 0 myModel = make1DHeatModel([args.t0, args.t1]) min_val, max_val = 0.01, 0.2 if np.min(refParam) < min_val or np.max(refParam) > max_val: print("Reference parameter passed out of range. Mapping to interval.") refParam = refParam*(max_val - min_val) + min_val # ADD NEW MODELS BELOW HERE with `elif` else: model_choice = 'identity' I = np.eye(inputDim) myModel = makeMatrixModel(I) if not args.set and not args.sample: # if both false, set both to true. args.set, args.sample = True, True print("Solving using both methods.") disc, disc_set, disc_samp = comparison_wrapper(model=myModel, num_samples=numSamples, input_dim=inputDim, param_ref=refParam, rect_size=uncert_rect_size, cpd_observed=cpd_observed, input_cpd=cpd_input, n_mc_points=n_mc_points, min_val=min_val, max_val=max_val) else: # only do one or the other. # Create baseline discretization disc = baseline_discretization(model=myModel, num_samples=numSamples, input_dim=inputDim, param_ref=refParam, input_cpd=cpd_input, n_mc_points=n_mc_points, min_val=min_val, max_val=max_val) if args.sample: print("Solving only with sample-based approach.") # Set up sample-based approach disc_samp = solve_sample_based(discretization=disc, rect_size=uncert_rect_size) elif args.set: print("Solving only with set-based approach.") # Set up set-based approach disc_set = solve_set_based(discretization=disc, rect_size=uncert_rect_size, obs_cpd=cpd_observed) ### STEP 4 ### # plot results if not args.noplot: save_pdf = args.pdf figLabel = args.figlabel import matplotlib.pyplot as plt import matplotlib.cm as cm from plot_examples import plot_2d plt.rcParams['font.size'] = args.fontsize plt.rcParams['figure.figsize'] = args.figsize, args.figsize # square ratio ### MISC ### Qref = disc.get_output().get_reference_value() print('Reference Value:', refParam, 'maps to', Qref) ### ACTUAL PLOTTING CODE ### nbins = 50 # xmn, xmx = 0.25, 0.75 # ymn, ymx = 0.25, 0.75 xmn, xmx = min_val, max_val ymn, ymx = min_val, max_val xi, yi = np.mgrid[xmn:xmx:nbins*1j, ymn:ymx:nbins*1j] if args.title is None: model_title = args.model.capitalize() + ' Model' else: model_title = args.title numLevels = args.numlevels if numLevels <2: numLevels = 2 show_prev = args.show # label keyword defaults to approx if args.set: print("\tPlotting set-based.") plot_2d(xi, yi, disc_set, num_levels=numLevels, label=figLabel, annotate='set', title=model_title, pdf=save_pdf, preview=show_prev) if args.sample: print("\tPlotting sample-based.") plot_2d(xi, yi, disc_samp, num_levels=numLevels, label=figLabel, annotate='sample', title=model_title, pdf=save_pdf, eval=eval, preview=show_prev) print("Done.")
StarcoderdataPython
1770906
<reponame>YasinEhsan/interview-prep #9.26 6:35pm def insert(intervals, new_interval): merged = [] start,end, i = 0,1,0 while i < len(intervals) and intervals[i][end] < new_interval[start]: merged.append(intervals[i]) i+=1 while i < len(intervals) and intervals[i][start] <= new_interval[end]: new_interval[start] = min(new_interval[start], intervals[i][start]) new_interval[end] = max(new_interval[end], intervals[i][end]) i+=1 merged.append(new_interval) if i != len(intervals): merged.append(intervals[i:len(intervals)]) return merged # merged = [] # # TODO: Write your code here # combinedRange = new_interval # start, end = 0,1 # for i in range(len(intervals)): # curr = intervals[i] # if curr[end] < new_interval[start]: # merged.append(curr) # else: # combinedRange[start] = min(curr[start], combinedRange[start]) # combinedRange[end] = max(curr[end], combinedRange[end]) # if combinedRange[start] < curr[end]: # merged.append(combinedRange) # merged.append(intervals[i:len(intervals)]) # break # return merged # def insert(intervals, new_interval): # merged = [] # # TODO: Write your code here # interval_start = new_interval[0] # interval_end = new_interval[1] # found = False # for i in range(len(intervals)): # curr_start = intervals[i][0] # curr_end = intervals[i][1] # if found and interval_end < curr_start: # merged.append([interval_start, interval_end]) # merged.append(intervals[i:len(intervals[i])]) # break # if interval_start <= curr_start: # interval_end = max(curr_end, interval_end) # found = True # else: # merged.append(intervals[i]) # return merged
StarcoderdataPython
1632153
<filename>fakerfaker.py import torch import numpy as np import sys def fake_prob(upper, quantile=0.999, mode="exp"): if mode == "exp": beta = - upper / (np.log(1 - quantile)) return beta elif mode == "lognorm": pass else: sys.exit(f"NOT support mode {mode}") def fake_data(num_samples=4096, num_t=1, num_d=13, num_s=26, ln_emb=None, text_file=None, quantile=0.999, mode="exp"): """ num_samples: number of samples num_t: number of target num_d: number of dense features num_s: number of sparse features ln_emb: embedding sizes text_file: output file """ # generate place holder random array, including dense features a = np.random.randint(0, 10, (num_t + num_d + num_s, num_samples)) # generate targets a[0, :] = np.random.randint(0, 2, num_samples) # generate sparse features for k, size in enumerate(ln_emb): if size <= 10000: # uniqual dist a[num_t + num_d + k, :] = np.random.randint(0, size, num_samples) else: # exp dist beta = fake_prob(size, quantile=quantile, mode=mode) a[num_t + num_d + k, :] = np.random.exponential(beta, num_samples).astype(np.int) a = np.transpose(a) # generate print format lstr = [] for _ in range(num_t + num_d): lstr.append("%d") for _ in range(num_s): lstr.append("%x") if text_file is not None: np.savetxt(text_file, a, fmt=lstr, delimiter='\t',) def fake_emb( sparse_feature_size=None, sparse_feature_num=26, emb_size="", min_cat=2, max_cat=1000000, shuffle=True): """ make up `sparse_feature_num` embedding tables and each emb has size (category, `sparse_feature_size`), where `min_cat` < category < `max_cat` """ if sparse_feature_size is None: sparse_feature_size = np.random.choice([16,32,64,128,256]) if emb_size: ln_emb = np.fromstring(emb_size, dtype=int, sep="-") ln_emb = np.asarray(ln_emb) assert ln_emb.size == sparse_feature_num, "sparse_feature_num not match num_emb" else: emb_list = [] # hope to generate cat number evenly and reasonable p = len(str(max_cat)) # 7 q = sparse_feature_num // p # 26//7=3 for i in range(p): for _ in range(q): s = 10**i if 10**i > min_cat else min_cat e = 10**(i+1)-1 if 10**(i+1)-1 < max_cat else max_cat # print(s,e) size = np.random.randint(s,e) if s<e else s emb_list.append(size) if len(emb_list) >= sparse_feature_num: break if len(emb_list) >= sparse_feature_num: break while len(emb_list) < sparse_feature_num: s = 10**i if 10**i > min_cat else min_cat e = 10**(i+1)-1 if 10**(i+1)-1 < max_cat else max_cat # print(s,e) size = np.random.randint(s,e) if s<e else s emb_list.append(size) ln_emb = np.array(emb_list) if shuffle: np.random.shuffle(ln_emb) print("=== fake embedding info ===") print(f"sparse_feature_size: {sparse_feature_size}") print(f"{ln_emb.size} ln_emb: {ln_emb}") print("===========================") return sparse_feature_size, sparse_feature_num, ln_emb if __name__=="__main__": profile = "terabyte0875" num_samples = 4096 emb_dim=64 num_dense = 13 num_sparse = 26 num_days = 24 out_dir = "./fake_" + profile + "/" out_name = "day_" # make emb spa_size, spa_num, ln_emb = fake_emb(sparse_feature_size=emb_dim, sparse_feature_num=num_sparse, shuffle=True) # make data # for k in range(num_days): # text_file = out_dir + out_name + ("" if profile == "kaggle" else str(k)) # fake_data(num_samples=num_samples, num_d=num_dense, num_s=spa_num, ln_emb=ln_emb, text_file=text_file) # print(f"faked data saved at {text_file}")
StarcoderdataPython
143105
import copy import numpy as np import pytest import tensorflow as tf from tfsnippet.layers import as_gated def safe_sigmoid(x): return np.where(x < 0, np.exp(x) / (1. + np.exp(x)), 1. / (1. + np.exp(-x))) class AsGatedHelper(object): def __init__(self, main_ret, gate_ret): self.main_args = None self.gate_args = None self.main_ret = main_ret self.gate_ret = gate_ret def __call__(self, *args, **kwargs): scope = kwargs['scope'] if scope == 'main': assert(self.main_args is None) self.main_args = (args, copy.copy(kwargs)) return self.main_ret elif scope == 'gate': assert(self.gate_args is None) self.gate_args = (args, copy.copy(kwargs)) return self.gate_ret else: raise RuntimeError() class TestAsGated(tf.test.TestCase): def test_as_gated(self): main_ret = np.random.normal(size=[2, 3, 4]).astype(np.float32) gate_ret = np.random.normal(size=[2, 3, 4]).astype(np.float32) activation_fn = object() # default_name infer failed with pytest.raises(ValueError, match='`default_name` cannot be inferred'): g = as_gated(AsGatedHelper(main_ret, gate_ret)) with self.test_session() as sess: # test infer default name f = AsGatedHelper(main_ret, gate_ret) f.__name__ = 'f' g = as_gated(f) g_ret = g(1, xyz=2, activation_fn=activation_fn) np.testing.assert_allclose( sess.run(g_ret), main_ret * safe_sigmoid(gate_ret + 2.)) self.assertTrue(g_ret.name, 'gated_f/') self.assertEqual( f.main_args, ( (1,), {'xyz': 2, 'activation_fn': activation_fn, 'scope': 'main'} ) ) self.assertEqual( f.gate_args, ( (1,), {'xyz': 2, 'scope': 'gate'} ) ) # test specify default name f = AsGatedHelper(main_ret, gate_ret) g = as_gated(f, sigmoid_bias=1., default_name='ff') g_ret = g(1, xyz=2, activation_fn=activation_fn) np.testing.assert_allclose( sess.run(g_ret), main_ret * safe_sigmoid(gate_ret + 1.)) self.assertTrue(g_ret.name, 'gated_ff/') self.assertEqual( f.main_args, ( (1,), {'xyz': 2, 'activation_fn': activation_fn, 'scope': 'main'} ) ) self.assertEqual( f.gate_args, ( (1,), {'xyz': 2, 'scope': 'gate'} ) ) # test using `name` f = AsGatedHelper(main_ret, gate_ret) g = as_gated(f, default_name='f') g_ret = g(1, xyz=2, activation_fn=activation_fn, name='name') np.testing.assert_allclose( sess.run(g_ret), main_ret * safe_sigmoid(gate_ret + 2.)) self.assertTrue(g_ret.name, 'name/') # test using `scope` f = AsGatedHelper(main_ret, gate_ret) g = as_gated(f, default_name='f') g_ret = g(1, xyz=2, activation_fn=activation_fn, scope='scope') np.testing.assert_allclose( sess.run(g_ret), main_ret * safe_sigmoid(gate_ret + 2.)) self.assertTrue(g_ret.name, 'scope/')
StarcoderdataPython
1635573
# -*- coding: utf-8 -*- """ Created on Fri Sep 13 06:55:29 2019 @author: Joule """ from sender_reciever import Reciever, Sender from affine import Affine from ubrytelig import Ubrytelig class Hacker(Reciever): """Brute force hacker! Denne versjonen trenger ikke å få det brukte cipheret som input, hvis cipheret er det Ubrytelige, tar dekrypteringen bare 52 sekunder lengre""" def __init__(self): Reciever.__init__(self) _f = open('english_words.txt', "r") self.valid_words = set(_f.read().split()) self.valid_inverse = [1, 2, 3, 4, 6, 7, 8, 9, 11,\ 12, 13, 14, 16, 17, 18, 21, 22, 23, 24, 26, 27, 28, 29, 31, 32, 33, 34, 36, 37, 39, 41, 42, 43, 44, 46, 47, 48, 49, 51, 52, 53, 54, 56, 58, 59, 61, 62, 63, 64, 66, 67, 68, 69, 71, 72, 73, 74, 77, 78, 79, 81, 82, 83, 84, 86, 87, 88, 89, 91, 92, 93, 94] _f.close() def decode(self, text): guessed_word = '' words_recognized_record = 0 dummy = Reciever() dummy.set_cipher(Affine()) """Tester for Affine cipher, siden det også plukker opp alle multiplikasjon og alle Caesar""" for multiply in self.valid_inverse: for add in range(95): dummy.set_key((multiply, add)) dummy.decode(text) decoded_text = dummy.get_decoded().lower().split() matching_words = set(decoded_text).intersection(self.valid_words) if len(matching_words) > words_recognized_record: words_recognized_record = len(matching_words) guessed_word = " ".join(decoded_text) """Hvis vi kjenner igjen minst tre ord, så kan vi stoppe searchet tidlig og spare opp til ca 50 sekunder""" if words_recognized_record >= 3: return guessed_word """Ellers må vi annta at det "ubrytelige" cipheret ble brukt""" """10 min å hacke med kodeord "pizza"... og 30 sekund å hacke med kodeord "ant"... """ dummy.set_cipher(Ubrytelig()) count = 1 for kodeord in self.valid_words: dummy.set_key(kodeord) dummy.decode(text) decoded_text = dummy.get_decoded().lower().split() #For å visualisere hvor langt dekrypteringen har kommet i fase 2 print(decoded_text, count) count += 1 #Denne operasjonen koster sykt mye matching_words = set(decoded_text).intersection(self.valid_words) if len(matching_words) > words_recognized_record: words_recognized_record = len(matching_words) guessed_word = " ".join(decoded_text) if words_recognized_record >= 5: print("Kodeordet er", kodeord) return guessed_word else: return "Could not brute force the message" A = Sender() #A.set_key((2,0)) #A.set_cipher(Affine()) A.set_key("pizza") A.set_cipher(Ubrytelig()) A.encode("To recieve full marks you have to solve all parts") #Print how the encrypted text looks like print(A.get_encoded()) H = Hacker() print(H.decode(A.get_encoded()))
StarcoderdataPython
3210020
import os import sys import tempfile import zipfile def create_importable_zip(filename): z = zipfile.ZipFile(filename, 'w') z.writestr('hello.py', 'def f(): return "hello world from " + __file__\n') z.close() def import_and_run_module(): import hello print hello.f() def main(): fhandle, filename = tempfile.mkstemp('.zip') create_importable_zip(filename) sys.path.insert(0, filename) import_and_run_module() os.close(fhandle) os.unlink(filename) if __name__ == '__main__': main()
StarcoderdataPython
52912
<filename>thirdparty_xentax/test_extraction.py # -*- coding: utf-8 -*- import phyre, importlib, os importlib.reload(phyre) # 1 or 2 ffx=1 # pc, npc, mon, obj, skl, sum, or wep tp = 'pc' # model number (no leading zeros) num = 106 ffxBaseDir=r'C:\SteamLibrary\steamapps\common\FINAL FANTASY FFX&FFX-2 HD Remaster\data\FFX_Data_VBF\ffx_data\gamedata\ps3data\chr' ffx2BaseDir=r'C:\SteamLibrary\steamapps\common\FINAL FANTASY FFX&FFX-2 HD Remaster\data\FFX2_Data_VBF\ffx-2_data\gamedata\ps3data\chr' baseDir=[ffxBaseDir, ffx2BaseDir] types={'pc':'c', 'npc':'n', 'mon':'m', 'obj':'f', 'skl':'k', 'sum':'s', 'wep':'w'} file=baseDir[ffx-1] cs = types[tp] + '%03d' % num meshFile = os.path.join(file, tp, cs,'mdl','d3d11', cs + r'.dae.phyre') ddsFile = os.path.join(file, tp, cs, 'tex', 'd3d11', cs + r'.dds.phyre') outFile = r'mytest.obj' outFile2 = r'mytest.dds' #outFile = None phyre.extractMesh(meshFile,outFile, debug=False) print("\n") if os.path.isfile(ddsFile): phyre.extractDDS(ddsFile, outFile2) else: print("DDS file not found. Skipping")
StarcoderdataPython
150658
from ferris import BasicModel, ndb import logging class Main(BasicModel): criteria = ndb.StringProperty() data = ndb.JsonProperty() permissions = ndb.JsonProperty() resolved = ndb.BooleanProperty() @classmethod def create(cls, params): entity = cls.get(params['criteria']) if entity: return entity item = cls(id=params['criteria']) item.populate(**params) item.put() return item @classmethod def get(cls, key_name, key_only=False): if not key_name: return None key = ndb.Key(cls, key_name) ret = key.get() if key_only: return key if ret else None return ret
StarcoderdataPython
161470
# Name: <NAME> and <NAME> # Date: 7/10/18 import random """ proj 03: Guessing Game Generate a random number between 1 and 9 (including 1 and 9). Ask the user to guess the number, then tell them whether they guessed too low, too high, or exactly right. Keep the game going until the user types exit. Keep track of how many guesses the user has taken, and when the game ends, print this out. """ #define variables first_loop = True points = 0 #loop while first_loop == True: second_loop = True random_number = random.randint(1, 9) guess_number = 0 print "I'm thinking of a number between 1 and 9. Can you guess my number?" max_guesses = int(raw_input("How many guesses do you want? ")) while second_loop == True: if guess_number == max_guesses: print "You are out of guesses! The number was " + str(random_number) + "." second_loop = False print "You have " + str(points) + " points." play_again = raw_input("Would you like to play again? (y/n)") if play_again == "n": first_loop = False print "Game ended." else: user_input = raw_input("Enter a number, or 'exit' to end the game: ") try: int(user_input) if int(user_input) < 1 or int(user_input) > 9: print "That is not a number between 1 and 9!" elif int(user_input) > random_number: print "Your number is too high!" guess_number = guess_number + 1 elif int(user_input) < random_number: print "Your number is too low!" guess_number = guess_number + 1 elif int(user_input) == random_number: guess_number = guess_number + 1 print "Congratulations, you guessed my number!", "You used", guess_number, "guesses." second_loop = False points = points + 1 if points == 1: print "You have " + str(points) + " point." else: print "You have " + str(points) + " points." play_again = raw_input("Would you like to play again? (y/n)" ) if play_again == "n": first_loop = False print "Game ended." except ValueError: if str(user_input) == "exit" or "Exit": print "Game ended." first_loop = False second_loop = False else: print "That is not a valid answer!"
StarcoderdataPython
1659567
<filename>engine/test/mock_app/mock_stream_timeout.py import asyncio from hopeit.app.logger import app_extra_logger from hopeit.app.context import EventContext __steps__ = ['wait'] from mock_app import MockData, MockResult logger, extra = app_extra_logger() async def wait(payload: MockData, context: EventContext) -> MockResult: logger.info(context, "mock_stream_timeout.wait") if payload.value == "timeout": await asyncio.sleep(5.0) return MockResult("ok: ok")
StarcoderdataPython
1799818
from bokeh.plotting import figure from bokeh.layouts import column from bokeh.io import export_png, show from bokeh.palettes import Category20 from sklearn.decomposition import PCA import holoviews as hv from holoviews.operation import gridmatrix import numpy as np import pandas as pd import os if not os.path.exists("./simulated_pca_data.csv"): print("Generating and saving new data") N = 15 Profiles = np.random.uniform(0, 2, size=(5, N)) U = np.random.choice([0, 1, 2, 3, 4], size=200, replace=True) d = np.zeros((200, N + 1)) for i, x in enumerate(U): d[i, :-1] = np.random.normal(Profiles[x, :], 0.3) d[:, N] = U.astype(int) np.savetxt("./simulated_pca_data.csv", d, delimiter=",") d = d[:, :-1] pd.DataFrame(d,columns=[str(x) for x in range(N)]).to_csv('../data/simulated_pca_data.csv') pd.DataFrame(U).to_csv('../data/simulated_pca_data_labels.csv') else: F = np.loadtxt("./simulated_pca_data.csv", delimiter=",") d = F[:, :-1] U = F[:, -1].astype(int) N = d.shape[1] print("Loaded array with {} features and {} samples".format(d.shape[0], d.shape[1])) colors = ["blue", "red", "black", "orange", "green"] P = PCA(n_components=N).fit(d) S = P.components_ D = P.transform(d) pc_plot = figure( x_range=(-4, 4), y_range=(-4, 4), title="Scatter plot of two most significant principal components", toolbar_location=None, ) pc_plot.scatter(x=D[:, 0], y=D[:, 1]) export_png(pc_plot, filename="../img/pcadimred.png") pc_plot_colored = figure( x_range=(-4, 4), y_range=(-4, 4), title="Scatter plot of two most significant principal components (colored by underlying group)", toolbar_location=None, ) pc_plot_colored.scatter(x=D[:, 0], y=D[:, 1], color=[Category20[10][i] for i in U]) export_png(pc_plot_colored, filename="../img/pcadimred_colors.png") eigenvalue_plot = figure( title="Eigenvalues of the covariance matrix", toolbar_location=None ) eigenvalue_plot.line(x=range(1, N + 1), y=P.explained_variance_) eigenvalue_plot.circle(x=range(1, N + 1), y=P.explained_variance_) export_png(eigenvalue_plot, filename="../img/eigenvalues.png") feature_plot = figure( x_range=(-4, 4), y_range=(-4, 4), title="Scatter plot of two of the original features", toolbar_location=None, ) feature_plot.scatter(x=d[:, 0], y=d[:, 7]) export_png(feature_plot, filename="../img/features.png") ds = hv.Dataset(pd.DataFrame(d, columns=[str(x) for x in range(N)])) hv.extension("bokeh") density_grid = gridmatrix(ds, chart_type=hv.Points).opts( height=1000, width=1000, toolbar=None ) hv.save(density_grid, "../img/density.png") with open("./simulated_pca_data_table.html", "w") as f: pd.DataFrame( d, columns=["f-{}".format(x) for x in range(15)], index=["s-{}".format(x) for x in range(200)], ).to_html(float_format=lambda x: "{:.2f}".format(x), max_rows=5, buf=f) loading_plot = figure( x_range=(-4, 4), y_range=(-4, 4), title="Projection of feature axes (loadings) in PC space", toolbar_location=None, ) loading_plot.scatter(x=D[:, 0], y=D[:, 1]) for i in range(15): loading_plot.line( x=[-100 * S[0, i], 100 * S[0, i]], y=[-100 * S[1, i], 100 * S[1, i]], color=Category20[20][i], line_width=1, legend_label=str(i), ) loading_plot.legend.location = "top_left" loading_plot.legend.click_policy = "hide" export_png(loading_plot, filename="../img/loading.png") show(column(pc_plot, pc_plot_colored, feature_plot, eigenvalue_plot, loading_plot))
StarcoderdataPython
1661548
import logging.config from pathlib import Path import sqlite3 import yaml # configuring logging with open('log_config.yaml', 'r') as f: log_config = yaml.safe_load(f.read()) logging.config.dictConfig(log_config) logger = logging.getLogger(__name__) class BooksPipeline(object): def __init__(self): self.create_connection() def create_connection(self): db_path = Path(__file__).parent.parent / 'db' / 'books.db' self.conn = sqlite3.connect(db_path) logger.info('Database connection created.') self.cursor = self.conn.cursor() def process_item(self, item, spider): self.store_db(item) return item def store_db(self, item): self.cursor.execute(''' INSERT INTO scraped_books_stage VALUES (?, ?, ?, ?, ?, ?, ?)''', ( item['author'], item['book_title'], item['series_title'], item['number_in_series'], item['publication_year'], item['publication_month'], item['scraped_at'] )) self.conn.commit() logger.debug('Inserted items into scraped_books_stage table: %s, %s, %s, %s, %s, %s, %s', item['author'], item['book_title'], item['series_title'], item['number_in_series'], item['publication_year'], item['publication_month'], item['scraped_at'] ) def close_spider(self, spider): # add new books to scraped_books table and clear table scraped_books_stage self.cursor.executescript(''' INSERT INTO scraped_books ('author', 'book_title', 'series_title', 'number_in_series', 'publication_year', 'publication_month', 'scraped_at') SELECT ss.* FROM scraped_books_stage ss LEFT JOIN scraped_books s ON s.author = ss.author and s.book_title = ss.book_title WHERE s.author IS NULL; DELETE FROM scraped_books_stage ''') logger.info('Checked new items for scraped_books table.') self.conn.commit() self.conn.close() logger.info('Database connection closed.')
StarcoderdataPython
1667068
<gh_stars>0 import math from functools import lru_cache, partial from typing import List, Tuple, Optional, Mapping import numpy as np import pandas as pd from .exp_center import exp_center_file_in_directory from .input import find_input_file_in_directory, get_input_values, _OUTPUT_NAMES from .log import log_process from .outformation import find_outformation_in_directory, load_outformation from .simudata import simudata_file_in_directory from .trans import ff, l2_distance, epsg4326_to_3857 # K formation_num # K initial_reduce # K final_total_size # K dispersion # K density # K center_gap # K dangerous_frequency # K crash_probability # K polarization # execute_time # K airway_bias # K loc_bias # X adjust_ratio # K stable_time def get_formation_num(outformation_data: List[Tuple[float, int, int]]) -> float: num = 0 last_t_time = 0 for data in outformation_data: t_time, out_form, total_size = data num += (total_size - out_form) last_t_time = t_time return num / (int(last_t_time) * 10 * 5) def get_initial_reduce_and_final_total_size(outformation_data: List[Tuple[float, int, int]]) -> Tuple[float, float]: first = 0 for line in outformation_data: time, _, total_size = line if total_size < 20: first = time break _, _, final_total_size = outformation_data[-1] return first, final_total_size def get_dispersion(simudata: pd.DataFrame, exp_data: pd.DataFrame, outformation_data: List[Tuple[float, int, int]]) -> float: aim_list = [] j = 0 for i in range(exp_data.shape[0]): current_time = exp_data['time'][i] while abs(outformation_data[j][0] - current_time) >= 1e-4 and \ outformation_data[j][0] <= current_time: j += 1 if abs(outformation_data[j][0] - current_time) >= 1e-4: continue _, outformation_num, cur_total_size = outformation_data[j] if (cur_total_size - outformation_num) >= 0.95 * cur_total_size: distance_list = [] center = [exp_data['r_x'][i], exp_data['r_y'][i], exp_data['r_h'][i]] tt = ff(exp_data['time'][i]) tmp_sim = simudata[(simudata['time'] < tt + 0.001) & (simudata['time'] > tt - 0.001)].reset_index( drop=True) if tmp_sim.shape[0] > 0: for j in range(tmp_sim.shape[0]): distance_list.append( l2_distance(center, [tmp_sim['x'][j], tmp_sim['y'][j], tmp_sim['height'][j]])) distance_list.sort() distance_list = distance_list[0:int(0.9 * len(distance_list))] aim_list.append(np.std(np.array(distance_list)) / np.mean(np.array(distance_list))) else: continue # noinspection PyTypeChecker return -1 if len(aim_list) == 0 else np.mean(np.array(aim_list)) def get_density(simudata: pd.DataFrame, exp_data: pd.DataFrame) -> float: density = 0 for i in range(exp_data.shape[0]): center = [exp_data['r_x'][i], exp_data['r_y'][i], exp_data['r_h'][i]] tt = ff(exp_data['time'][i]) tmp_sim = simudata[(simudata['time'] < tt + 0.001) & (simudata['time'] > tt - 0.001)].reset_index(drop=True) distances = [] for j in range(tmp_sim.shape[0]): x = tmp_sim['x'][j] y = tmp_sim['y'][j] obj = [x, y, tmp_sim['height'][j]] distances.append(l2_distance(center, obj)) distances.sort() bias = int(len(distances) * 0.9) r_value = distances[bias - 1] res = 3 * bias / (4 * math.pi * (r_value ** 3)) density += res return density / (exp_data.shape[0]) * (100 ** 3) def get_center_gap(simudata: pd.DataFrame, exp_data: pd.DataFrame) -> float: center_avg_gap = 0 for i in range(exp_data.shape[0]): tt = ff(exp_data['time'][i]) tmp_sim = simudata[(simudata['time'] < tt + 0.001) & (simudata['time'] > tt - 0.001)].reset_index(drop=True) dist = 0 obj = [0, 0, 0] for j in range(tmp_sim.shape[0]): x = tmp_sim['x'][j] y = tmp_sim['y'][j] obj[0] += x obj[1] += y obj[2] += tmp_sim['height'][j] center = [obj[0] / tmp_sim.shape[0], obj[1] / tmp_sim.shape[0], obj[2] / tmp_sim.shape[0]] distances = [] for j in range(tmp_sim.shape[0]): x = tmp_sim['x'][j] y = tmp_sim['y'][j] obj2 = [x, y, tmp_sim['height'][j]] distances.append(l2_distance(center, obj2)) distances.sort() distances = distances[0:int(len(distances) * 0.9)] for d in distances: dist += d center_avg_gap += dist / len(distances) return center_avg_gap / exp_data.shape[0] def get_danger_frequency(outformation_data: List[Tuple[float, int, int]]) -> float: init_num, crash_num = 20, 0 for item in outformation_data: _, _, cur_total_size = item if cur_total_size < init_num: crash_num += (init_num - cur_total_size) * (init_num - cur_total_size - 1) init_num = cur_total_size return crash_num / 20 def get_crash_probability(outformation_data: List[Tuple[float, int, int]]) -> float: init_num, crash_num = 20, 0 for item in outformation_data: _, _, cur_total_size = item if cur_total_size < init_num: crash_num += init_num - cur_total_size init_num = cur_total_size return crash_num / 20 def get_polarization(simudata: pd.DataFrame, exp_data: pd.DataFrame, outformation_data: List[Tuple[float, int, int]]) -> float: aim_list = [] j = 0 for i in range(exp_data.shape[0]): if i == 0: continue current_time = exp_data['time'][i] while abs(outformation_data[j][0] - current_time) >= 1e-4 and \ outformation_data[j][0] <= current_time: j += 1 if abs(outformation_data[j][0] - current_time) >= 1e-4: continue _, outformation_num, cur_total_size = outformation_data[j] if (cur_total_size - outformation_num) >= 0.95 * cur_total_size: ans = [0, 0, 0] center = [exp_data['r_x'][i], exp_data['r_y'][i], exp_data['r_h'][i]] tt = ff(exp_data['time'][i]) tmp_sim = simudata[(simudata['time'] < tt + 0.001) & (simudata['time'] > tt - 0.001)] \ .reset_index(drop=True) pre_center = [exp_data['r_x'][i - 1], exp_data['r_y'][i - 1], exp_data['r_h'][i - 1]] pre_tt = ff(exp_data['time'][i - 1]) pre_tmp_sim = simudata[ (simudata['time'] < pre_tt + 0.001) & (simudata['time'] > pre_tt - 0.001)] \ .reset_index(drop=True) center_dir = [center[0] - pre_center[0], center[1] - pre_center[1], center[2] - pre_center[2]] if tmp_sim.shape[0] > 0: for j in range(tmp_sim.shape[0]): for k in range(pre_tmp_sim.shape[0]): if pre_tmp_sim['id'][k] == tmp_sim['id'][j]: item_dir = [tmp_sim['x'][j] - pre_tmp_sim['x'][k], tmp_sim['y'][j] - pre_tmp_sim['y'][k], tmp_sim['height'][j] - pre_tmp_sim['height'][k]] ans[0] += item_dir[0] - center_dir[0] ans[1] += item_dir[1] - center_dir[1] ans[2] += item_dir[2] - center_dir[2] break aim_list.append(math.sqrt(np.sum(np.array(ans) ** 2))) return -1 if len(aim_list) == 0 else np.mean(np.array(aim_list)) @lru_cache() def _prepare_airway_bias(): p1 = [13.147670731635747, 43.65982853870639, 2000.0] p2 = [13.186799589095362, 43.78649351263097, 2000.0] p1[0], p1[1] = epsg4326_to_3857(p1[1], p1[0]) p2[0], p2[1] = epsg4326_to_3857(p2[1], p2[0]) return p2[0] - p1[0], p2[1] - p1[1], p2[2] - p1[2] def get_airway_bias(simudata: pd.DataFrame, exp_data: pd.DataFrame) -> float: way_dir = _prepare_airway_bias() aim_list = [] for i in range(exp_data.shape[0]): if i == 0: continue center = [exp_data['r_x'][i], exp_data['r_y'][i], exp_data['r_h'][i]] pre_center = [exp_data['r_x'][i - 1], exp_data['r_y'][i - 1], exp_data['r_h'][i - 1]] center_dir = [center[0] - pre_center[0], center[1] - pre_center[1], center[2] - pre_center[2]] ans = math.acos( (way_dir[0] * center_dir[0] + way_dir[1] * center_dir[1] + way_dir[2] * center_dir[2]) / (math.sqrt(np.sum(np.array(way_dir) ** 2)) * math.sqrt(np.sum(np.array(center_dir) ** 2))) ) aim_list.append(ans) # noinspection PyTypeChecker return np.mean(np.array(aim_list)) def get_loc_bias(simudata: pd.DataFrame, exp_data: pd.DataFrame) -> float: p2 = [13.186799589095362, 43.78649351263097, 2000.0] p2[0], p2[1] = epsg4326_to_3857(p2[1], p2[0]) aim = float('inf') for i in range(exp_data.shape[0]): center = [exp_data['r_x'][i], exp_data['r_y'][i], exp_data['r_h'][i]] cur_ans = math.sqrt((center[0] - p2[0]) ** 2 + (center[1] - p2[1]) ** 2 + (center[2] - p2[2]) ** 2) if cur_ans < aim: aim = cur_ans return aim def get_execute_time(inputs: Mapping[str, object], outformation_data: List[Tuple[float, int, int]]): control_time = (inputs['time'], inputs['time.1']) execute_time = 0 c_index = 0 cur_time = control_time[c_index] for time_, out_form, total_size in outformation_data: if abs(time_ - outformation_data[-1][0]) < 1e-6: execute_time += time_ - cur_time break if c_index + 1 < len(control_time): if time_ > control_time[c_index + 1]: execute_time += time_ - cur_time cur_time = control_time[c_index + 1] c_index += 1 if (total_size - out_form) >= int(total_size * 0.95): if time_ > cur_time: execute_time += time_ - cur_time if c_index + 1 == len(control_time): break else: cur_time = control_time[c_index + 1] c_index += 1 return execute_time def get_stable_time(outformation_data: List[Tuple[float, int, int]]) -> float: num = 0 for data in outformation_data: _, out_form, total_size = data if (total_size - out_form) >= int(total_size * 0.95): num += 1 return ff(num / len(outformation_data) * 100) _ALL_NAME_LIST = [ # inputs *_OUTPUT_NAMES, # metrics 'formation_num', 'initial_reduce', 'final_total_size', 'dispersion', 'density', 'center_gap', 'dangerous_frequency', 'crash_probability', 'polarization', 'execute_time', 'airway_bias', 'loc_bias', # 'adjust_ratio', 'stable_time', ] def get_all_metrics(directory: str, force: bool = False, shown_names: Optional[List[str]] = None): shown_names = shown_names or _ALL_NAME_LIST input_file = find_input_file_in_directory(directory) simudata_file = simudata_file_in_directory(directory) exp_center_file = exp_center_file_in_directory(directory) outformation_file = find_outformation_in_directory(directory) log_process(directory, force) input_values = get_input_values(input_file) simudata = pd.read_csv(simudata_file) exp_data = pd.read_csv(exp_center_file) outformation_data = load_outformation(outformation_file) irft = None def _get_irft() -> Tuple[float, float]: nonlocal irft if irft is None: irft = get_initial_reduce_and_final_total_size(outformation_data) return irft data_map = { 'formation_num': lambda: get_formation_num(outformation_data), 'initial_reduce': lambda: _get_irft()[0], 'final_total_size': lambda: _get_irft()[1], 'dispersion': lambda: get_dispersion(simudata, exp_data, outformation_data), 'density': lambda: get_density(simudata, exp_data), 'center_gap': lambda: get_center_gap(simudata, exp_data), 'dangerous_frequency': lambda: get_danger_frequency(outformation_data), 'crash_probability': lambda: get_crash_probability(outformation_data), 'polarization': lambda: get_polarization(simudata, exp_data, outformation_data), 'execute_time': lambda: get_execute_time(input_values, outformation_data), 'airway_bias': lambda: get_airway_bias(simudata, exp_data), 'loc_bias': lambda: get_loc_bias(simudata, exp_data), # 'adjust_ratio': lambda: -1, 'stable_time': lambda: get_stable_time(outformation_data), **{name: partial(input_values.__getitem__, name) for name in _OUTPUT_NAMES}, } return {name: data_map[name]() for name in shown_names}
StarcoderdataPython
4816797
<reponame>npvisual/fondat-aws import pytest import asyncio from fondat.aws import Client, Config from fondat.aws.secrets import Secret, secrets_resource from fondat.error import BadRequestError, NotFoundError from uuid import uuid4 pytestmark = pytest.mark.asyncio config = Config( endpoint_url="http://localhost:4566", aws_access_key_id="id", aws_secret_access_key="secret", region_name="us-east-1", ) @pytest.fixture(scope="module") def event_loop(): loop = asyncio.new_event_loop() yield loop loop.close() @pytest.fixture(scope="module") async def client(): async with Client(service_name="secretsmanager", config=config) as client: yield client @pytest.fixture(scope="module") async def resource(client): yield secrets_resource(client) async def test_string_binary(resource): name = str(uuid4()) with pytest.raises(NotFoundError): await resource[name].delete() with pytest.raises(NotFoundError): await resource[name].put(Secret(value="something")) await resource.post(name=name, secret=Secret(value="string")) assert (await resource[name].get()).value == "string" await resource[name].put(Secret(value=b"binary")) assert (await resource[name].get()).value == b"binary" await resource[name].delete() with pytest.raises(BadRequestError): await resource[name].get() async def test_binary_string(resource): name = str(uuid4()) await resource.post(name=name, secret=Secret(value=b"binary")) assert (await resource[name].get()).value == b"binary" await resource[name].put(Secret(value="string")) assert (await resource[name].get()).value == "string" await resource[name].delete() async def test_get_cache(client): resource = secrets_resource(client, cache_size=10, cache_expire=10) name = str(uuid4()) secret = Secret(value=name) await client.create_secret(Name=name, SecretString=secret.value) assert await resource[name].get() == secret # caches secret await client.delete_secret(SecretId=name) assert await resource[name].get() == secret # still cached async def test_put_get_cache(client): resource = secrets_resource(client, cache_size=10, cache_expire=10) name = str(uuid4()) secret = Secret(value=name) await resource.post(name=name, secret=secret) # caches secret await client.delete_secret(SecretId=name) assert await resource[name].get() == secret # still cached async def test_delete_cache(client): resource = secrets_resource(client, cache_size=10, cache_expire=10) name = str(uuid4()) secret = Secret(value=name) await resource.post(name=name, secret=secret) # caches secret await resource[name].get() # still cached await resource[name].delete() # deletes cached row with pytest.raises(BadRequestError): # marked as deleted await resource[name].get() async def test_get_cache_evict(client): resource = secrets_resource(client, cache_size=1, cache_expire=10) name1 = str(uuid4()) secret1 = Secret(value=name1) await client.create_secret(Name=name1, SecretString=secret1.value) name2 = str(uuid4()) secret2 = Secret(value=name2) await client.create_secret(Name=name2, SecretString=secret2.value) assert await resource[name1].get() == secret1 assert await resource[name2].get() == secret2 await client.delete_secret(SecretId=name1) await client.delete_secret(SecretId=name2) with pytest.raises(BadRequestError): await resource[name1].get() # evicted and marked deleted assert await resource[name2].get() == secret2 # still cached
StarcoderdataPython
1724993
from .image import subimage_by_roi import astimp class Antibiotic(): "an antibiotic tested in an AST" def __init__(self, short_name, pellet_circle, inhibition, image, roi, px_per_mm): self.short_name = short_name self.pellet_circle = pellet_circle self.inhibition = inhibition self.img = image self.px_per_mm = px_per_mm self.roi = roi self._center_in_roi = None @property def center_in_roi(self): """center relative to the roi coordinate""" if self._center_in_roi is None: cx, cy = self.pellet_circle.center cx -= self.roi.left cy -= self.roi.top self._center_in_roi = (cx, cy) return self._center_in_roi def __repr__(self): return "ATB : {n}, inhibition diameter: {d:.1f}mm".format(n=self.short_name, d=self.inhibition.diameter) class AST(): """Represent an AST""" def __init__(self, ast_image): self.img = ast_image self._crop = None self._petriDish = None self._circles = None self._rois = None self._mm_per_px = None self._px_per_mm = None self._pellets = None self._labels = None self._labels_text = None self._preproc = None self._inhibitions = None @property def crop(self): """cropped image of Petri dish""" if self._crop is None: self._crop = self.petriDish.img return self._crop @crop.setter def crop(self, image): self._crop = image @property def petriDish(self): """Petri dish""" if self._petriDish is None: self._petriDish = astimp.getPetriDish(self.img) return self._petriDish @property def circles(self): """circles representing pellets""" if self._circles is None: self._circles = astimp.find_atb_pellets(self.crop) return self._circles @property def rois(self): if self._rois is None: max_diam_mm = 40 # TODO: get this from config self._rois = astimp.inhibition_disks_ROIs( self.circles, self.crop, max_diam_mm*self.px_per_mm) return self._rois @property def mm_per_px(self): """image scale""" if self._mm_per_px is None: self._mm_per_px = astimp.get_mm_per_px(self.circles) return self._mm_per_px @property def px_per_mm(self): """image scale""" if self._px_per_mm is None: self._px_per_mm = 1/astimp.get_mm_per_px(self.circles) return self._px_per_mm @property def pellets(self): """subimages of the found pellets""" if self._pellets is None: self._pellets = [astimp.cutOnePelletInImage( self.crop, circle) for circle in self.circles] return self._pellets @property def labels(self): """label objects""" if self._labels is None: self._labels = [astimp.getOnePelletText( pellet) for pellet in self.pellets] return self._labels @property def labels_text(self): """label texts""" if self._labels_text is None: self._labels_text = tuple(label.text for label in self.labels) return self._labels_text @property def preproc(self): """preporc object for inhib diameter measurement""" if self._preproc is None: self._preproc = astimp.inhib_diam_preprocessing( self.petriDish, self.circles) return self._preproc @property def inhibitions(self): """preporc object for inhib diameter measurement""" if self._inhibitions is None: self._inhibitions = astimp.measureDiameters(self.preproc) return self._inhibitions def get_atb_by_idx(self, idx): return Antibiotic(short_name=self.labels[idx].text, pellet_circle=self.circles[idx], roi=self.rois[idx], inhibition=self.inhibitions[idx], image=subimage_by_roi(self.crop, self.rois[idx]), px_per_mm=self.px_per_mm) def get_atb_idx_by_name(self, short_name): return self.labels_text.index(short_name)
StarcoderdataPython
1740906
# flake8: noqa from .charts_options import ( BarItem, BarBackgroundStyleOpts, BMapCopyrightTypeOpts, BMapGeoLocationControlOpts, BMapNavigationControlOpts, BMapOverviewMapControlOpts, BMapScaleControlOpts, BMapTypeControlOpts, BoxplotItem, CandleStickItem, ComponentTitleOpts, EffectScatterItem, GaugeDetailOpts, GaugePointerOpts, GaugeTitleOpts, GraphCategory, GraphicBasicStyleOpts, GraphicGroup, GraphicImage, GraphicImageStyleOpts, GraphicItem, GraphicRect, GraphicShapeOpts, GraphicText, GraphicTextStyleOpts, GraphLink, GraphNode, HeatMapItem, LineItem, MapItem, Map3DColorMaterialOpts, Map3DLabelOpts, Map3DLightOpts, Map3DLambertMaterialOpts, Map3DPostEffectOpts, Map3DRealisticMaterialOpts, Map3DViewControlOpts, PageLayoutOpts, ParallelItem, PieItem, RadarItem, SankeyLevelsOpts, ScatterItem, SunburstItem, ThemeRiverItem, TreeItem, TreeMapItemStyleOpts, TreeMapLevelsOpts, ) from .global_options import ( AngleAxisItem, AngleAxisOpts, AnimationOpts, Axis3DOpts, AxisLineOpts, AxisOpts, AxisPointerOpts, AxisTickOpts, BrushOpts, CalendarOpts, CalendarDayLabelOpts, CalendarMonthLabelOpts, CalendarYearLabelOpts, DataZoomOpts, Grid3DOpts, GridOpts, InitOpts, LegendOpts, ParallelAxisOpts, ParallelOpts, PolarOpts, RadarIndicatorItem, RadiusAxisItem, RadiusAxisOpts, SingleAxisOpts, TitleOpts, ToolBoxFeatureBrushOpts, ToolBoxFeatureDataViewOpts, ToolBoxFeatureDataZoomOpts, ToolBoxFeatureMagicTypeOpts, ToolBoxFeatureOpts, ToolBoxFeatureRestoreOpts, ToolBoxFeatureSaveAsImageOpts, ToolboxOpts, TooltipOpts, VisualMapOpts, ) from .series_options import ( AreaStyleOpts, EffectOpts, ItemStyleOpts, LabelOpts, LineStyleOpts, Lines3DEffectOpts, MarkAreaItem, MarkAreaOpts, MarkLineItem, MarkLineOpts, MarkPointItem, MarkPointOpts, MinorSplitLineOpts, MinorTickOpts, SplitAreaOpts, SplitLineOpts, TextStyleOpts, TreeMapBreadcrumbOpts, )
StarcoderdataPython
127049
<reponame>jakelong0509/master """import numpy as np import matplotlib.pyplot as plt class Grid: def __init__(self, height, weight, start): self.height = height self.weight = weight self.i = start[0] self.j = start[1] def set(self, rewards, actions): self.rewards = rewards self.actions = actions def set_state(self, s): self.i = s[0] self.j = s[1] def current_state(self): return (self.i, self.j) def is_terminal(self, s): return s not in self.actions def move(self, action): if action in self.actions[(self.i, self.j)]: if action == 'U': self.i -= 1 if action == "D": self.i += 1 if action == "R": self.j += 1 if action == "L": self.j -= 1 return self.rewards.get((self.i, self.j), 0) def undo_move(self, action): if action == 'U': self.i += 1 if action == 'D': self.i -= 1 if action == 'R': self.j -= 1 if action == 'L': self.j += 1 assert(self.current_state in self.all_states) def game_over(self): return (self.i, self.j) not in self.actions def all_states(self): return set(self.actions.keys()) | set(self.rewards.keys()) def standard_grid(): g = Grid(3, 4, (0,2)) rewards = {(0,3) : 1, (1,3) : -1} actions = { (0, 0): ('D', 'R'), (0, 1): ('L', 'R'), (0, 2): ('L', 'D', 'R'), (1, 0): ('U', 'D'), (1, 2): ('U', 'D', 'R'), (2, 0): ('U', 'R'), (2, 1): ('L', 'R'), (2, 2): ('L', 'R', 'U'), (2, 3): ('L', 'U'), } g.set(rewards, actions) return g def negative_grid(step_cost = -0.1): g = standard_grid() g.rewards.update({ (0, 0): step_cost, (0, 1): step_cost, (0, 2): step_cost, (1, 0): step_cost, (1, 2): step_cost, (2, 0): step_cost, (2, 1): step_cost, (2, 2): step_cost, (2, 3): step_cost, }) return g """ class Grid: #Environment def __init__(self, width, height, start): self.height = height self.width = width self.i = start[0] self.j = start[1] def set(self, rewards , actions): self.rewards = rewards self.actions = actions def set_state(self, s): self.i = s[0] self.j = s[1] def current_state(self): return (self.i, self.j) def game_over(self): return (self.i, self.j) not in self.actions def is_terminal(self, s): return s not in self.actions def move(self, action): if action in self.actions[(self.i, self.j)]: if action == 'U': self.i -= 1 if action == 'D': self.i += 1 if action == 'R': self.j += 1 if action == 'L': self.j -= 1 return self.rewards.get((self.i, self.j), 0) def undo_move(self, action): if action == 'U': self.i += 1 if action == 'D': self.i -= 1 if action == 'R': self.j -= 1 if action == 'L': self.j += 1 assert(self.current_state in self.all_states) def all_states(self): return set(self.actions.keys()) | set(self.rewards.keys()) def standard_grid(): g = Grid(3, 4, (2,0)) rewards = {(0,3) : 1, (1,3) : -1} actions = { (0, 0): ('D', 'R'), (0, 1): ('L', 'R'), (0, 2): ('L', 'D', 'R'), (1, 0): ('U', 'D'), (1, 2): ('U', 'D', 'R'), (2, 0): ('U', 'R'), (2, 1): ('L', 'R'), (2, 2): ('L', 'R', 'U'), (2, 3): ('L', 'U'), } g.set(rewards, actions) return g def negative_grid(step_cost = -0.1): g = standard_grid() g.rewards.update({ (0, 0): step_cost, (0, 1): step_cost, (0, 2): step_cost, (1, 0): step_cost, (1, 2): step_cost, (2, 0): step_cost, (2, 1): step_cost, (2, 2): step_cost, (2, 3): step_cost, }) return g
StarcoderdataPython
40290
import sys from logs.logger import log from utils import check_internet , get_public_ip import bot if __name__ == "__main__": if check_internet() is True: try: log.info(f'Internet connection found : {get_public_ip()}') bot.run() except KeyboardInterrupt: # quit sys.exit() else: log.info('Please check your internet connection') sys.exit()
StarcoderdataPython
156374
<gh_stars>1-10 import numpy as np import json import sys import os import pandas as pd # To parse and dump JSON from kafka import KafkaConsumer # Import Kafka consumer from kafka import KafkaProducer # Import Kafka producer import pickle # Library to save and load ML regressors using pickle import pandas as pd # scikit learn from sklearn.ensemble import RandomForestRegressor, GradientBoostingRegressor from sklearn.model_selection import GridSearchCV # Getting the current path of the project current_path = os.getcwd() class Learner : def __init__(self, T_obs, samples, model, counter=1): self.T_obs = T_obs self.samples = samples if model == 'RandomForest' : self.model = RandomForestRegressor() elif model == 'GradientBoosting' : self.model = GradientBoostingRegressor() self.counter = counter def _reset_model(self) : if model == 'RandomForest' : self.model = RandomForestRegressor() elif model == 'GradientBoosting' : self.model = GradientBoostingRegressor() def fit(self): grid_parameters = {'max_depth': [10], 'min_samples_leaf': [1, 2, 4], 'min_samples_split': [2, 5, 10] } self._reset_model() reg = GridSearchCV(self.model, grid_parameters, cv=3) X = self.samples.iloc[:, :-1].values y = self.samples.iloc[:, -1].values reg.fit(X, y) self.model = reg.best_estimator_ if __name__ == '__main__' : if len(sys.argv) != 2 : print("Usage" + sys.argv[0] + " <config-filename>") exit() else : with open(current_path + "/" + str(sys.argv[1])) as f : for line in f : if line[0] not in ['#','[', ' '] : param = list(map(lambda x: x.strip(' \' \n'), line.split('='))) if param[0] == 'brokers' : brokers = param[1] elif param[0] == 'in_' : in_ = param[1] elif param[0] == 'out_' : out_ = param[1] elif param[0] == 'treshold_to_learn' : treshold_to_learn = float(param[1]) elif param[0] == 'model' : model = param[1] consumer = KafkaConsumer(in_, # Topic name bootstrap_servers = brokers, # List of brokers key_deserializer= lambda v: int(v.decode()), # How to deserialize a key (if any) value_deserializer=lambda v: json.loads(v.decode('utf-8')) # How to deserialize sample messages ) producer = KafkaProducer( bootstrap_servers = brokers, # List of brokers passed from the command line key_serializer=str.encode, # How to serialize the key value_serializer=lambda v: pickle.dumps(v) # How to serialize a model ) learners={} # for each key a learner for msg in consumer : print("\n -----------------Sample in------------------------") samples_msg = msg.value key = str(msg.key) X = samples_msg['X'] y = samples_msg['W'] sample = pd.DataFrame(np.array(X + [y]).reshape(1, -1), columns=['beta','n_star','G1', 'W']) if key not in learners.keys() : print(f'Created a new learner for key : {key}') learner = Learner(key, sample, model) learners[key] = learner else : #print(f'samples df before append = {learners[key].samples}') print(f'Appended the sample to the dataframe for key: {key}') learners[key].samples = learners[key].samples.append(sample, ignore_index=True) learners[key].counter += 1 #print(f'samples df after append = {learners[key].samples}') if learners[key].counter >= treshold_to_learn : print(f'Time to learn for key : {key} !') print(f'counter = {learners[key].counter} !') learners[key].fit() learners[key].counter = 0 producer.send(out_, key=key, value=learners[key].model) print(f'Model for key : {key} succesfully sent to the predictor') print('-------------------------------------------')
StarcoderdataPython
1688378
<reponame>julpark-rh/cephci """ Entry module for executing RBD test scripts from ceph-qe-scripts. This acts as a wrapper around the automation scripts in ceph-qe-scripts for cephci. The following things are done - Call the appropriate test script - Return the status code of the script. """ from utility.log import Log log = Log(__name__) def run(**kw): """ Execute the test script. Args: kw: Supports the below keys ceph_cluster: Ceph object config: User configuration provided in the test suite. """ log.info("Running rbd tests") ceph_cluster = kw["ceph_cluster"] client_nodes = ceph_cluster.get_nodes(role="client") client_node = client_nodes[0] if not client_node: log.error("Require a client node to execute the tests.") return 1 # function constants test_folder = "rbd-tests" script_folder = "ceph-qe-scripts/rbd/system" venv_folder = "venv" python_cmd = "sudo venv/bin/python" git_url = "https://github.com/red-hat-storage/ceph-qe-scripts.git" git_clone = f"git clone {git_url}" # Cleaning up the cloned repo to avoid test residues client_node.exec_command( cmd=f"sudo rm -rf {test_folder}" + f" ; mkdir {test_folder}" + f" ; cd {test_folder}" + f" ; {git_clone}" ) # Optimizing the installation of prerequisites so that they are executed once check_venv, err = client_node.exec_command(cmd="ls -l venv", check_ec=False) if not check_venv: commands = ["sudo yum install -y python3", f"python3 -m venv {venv_folder}"] for command in commands: client_node.exec_command(cmd=command) config = kw["config"] script_name = config["test_name"] timeout = config.get("timeout", 1800) command = f"{python_cmd} {test_folder}/{script_folder}/{script_name}" if config.get("ec-pool-k-m", None): ec_pool_arg = " --ec-pool-k-m " + config.get("ec-pool-k-m") command = command + f" {ec_pool_arg}" if config.get("test_case_name", None): test_case_name = "--test-case " + config.get("test_case_name") command = command + f" {test_case_name}" out, err = client_node.exec_command(cmd=command, check_ec=False, timeout=timeout) if out: log.info(out) if err: log.error(err) rc = client_node.exit_status if rc == 0: log.info("%s completed successfully", command) else: log.error("%s has failed", command) return rc
StarcoderdataPython
1673801
<gh_stars>10-100 """baseline Revision ID: c7b63286fd71 Revises: Create Date: 2021-05-27 21:56:12.258456 """ from alembic import op import sqlalchemy as sa from sqlalchemy.engine.reflection import Inspector # revision identifiers, used by Alembic. revision = 'c7b63286fd71' down_revision = None branch_labels = None depends_on = None def upgrade(): conn = op.get_bind() inspector = Inspector.from_engine(conn) tables = inspector.get_table_names() if 'orders' not in tables: op.create_table( 'orders', sa.Column('id', sa.Integer, primary_key=True), sa.Column('bid', sa.Integer, default=0), sa.Column('message_size', sa.Integer, nullable=False), sa.Column('bid_per_byte', sa.Float, default=0), sa.Column('message_digest', sa.String(64), nullable=False), sa.Column('status', sa.Integer), sa.Column('uuid', sa.String(36), nullable=False), sa.Column('created_at', sa.DateTime, default=sa.func.now()), sa.Column('cancelled_at', sa.DateTime), sa.Column('started_transmission_at', sa.DateTime), sa.Column('ended_transmission_at', sa.DateTime), sa.Column('tx_seq_num', sa.Integer, unique=True), sa.Column('unpaid_bid', sa.Integer, nullable=False)) if 'invoices' not in tables: op.create_table( 'invoices', sa.Column('id', sa.Integer, primary_key=True), sa.Column('lid', sa.String(100), nullable=False), sa.Column('invoice', sa.String(1024), nullable=False), sa.Column('paid_at', sa.DateTime), sa.Column('created_at', sa.DateTime, default=sa.func.now()), sa.Column('order_id', sa.Integer, sa.ForeignKey('orders.id')), sa.Column('status', sa.Integer), sa.Column('amount', sa.Integer), sa.Column('expires_at', sa.DateTime, nullable=False)) if 'tx_confirmations' not in tables: op.create_table( 'tx_confirmations', sa.Column('id', sa.Integer, primary_key=True), sa.Column('created_at', sa.DateTime, default=sa.func.now()), sa.Column('order_id', sa.Integer, sa.ForeignKey('orders.id')), sa.Column('region_id', sa.Integer), sa.Column('presumed', sa.Boolean, default=False)) if 'rx_confirmations' not in tables: op.create_table( 'rx_confirmations', sa.Column('id', sa.Integer, primary_key=True), sa.Column('created_at', sa.DateTime, default=sa.func.now()), sa.Column('order_id', sa.Integer, sa.ForeignKey('orders.id')), sa.Column('region_id', sa.Integer), sa.Column('presumed', sa.Boolean, default=False)) def downgrade(): op.drop_table('orders') op.drop_table('invoices') op.drop_table('tx_confirmations') op.drop_table('rx_confirmations')
StarcoderdataPython
49281
<filename>gogolook/models/task.py from enum import IntEnum from typing import Optional from pydantic import Field from sqlalchemy import Column, Enum, String from gogolook.models import Base, BaseSchema class TaskStatus(IntEnum): Incomplete = 0 Complete = 1 class Task(Base): name = Column(String(length=100)) status = Column(Enum(TaskStatus), default=TaskStatus.Incomplete) class TaskSchema(BaseSchema): id: int = Field(description="The id of Task") name: str = Field(description="The name of Task") status: TaskStatus = Field( description="The status of Task", default=TaskStatus.Incomplete ) class TaskUpdateSchema(TaskSchema): name: Optional[str] = Field(description="The name of Task") status: Optional[TaskStatus] = Field(description="The status of Task")
StarcoderdataPython
52403
from flask_login import AnonymousUserMixin from flask_login import UserMixin as BaseUserMixin from werkzeug.datastructures import ImmutableList from ayeauth import db from ayeauth.auth.password import <PASSWORD>_password from ayeauth.models import BaseModel class UserMixin(BaseUserMixin): @property def is_active(self): return self.active def has_role(self, role): if role in self.roles: return True return False class User(BaseModel, UserMixin): __tablename__ = "users" username = db.Column(db.String(255), unique=True, nullable=False) password = db.Column(db.String(255), nullable=False) active = db.Column(db.Boolean(), default=True) roles = db.relationship( "Role", secondary="user_roles", backref=db.backref("users", lazy="dynamic") ) authorized_applications = db.relationship( "Application", secondary="user_authorized_applications", backref=db.backref("users", lazy="dynamic"), ) def __init__(self, username, password): super(User, self).__init__() self.username = username self.password = <PASSWORD>(password) def __str__(self): return str(self.username) class AnonymousUser(AnonymousUserMixin): def __init__(self): self.roles = ImmutableList() def has_role(self, *args): return False
StarcoderdataPython
1616814
# 反转链表 # 输入一个链表,反转链表后,输出新链表的表头。 # 链表结构 class ListNode: def __init__(self, x): self.val = x self.next = None # 打印链表 def printChain(head): node = head while node: print(node.val) node = node.next class Solution: def ReverseList(self, pHead): if pHead == None: return None if pHead.next == None: return pHead leftPointer = pHead middlePointer = pHead.next rightPointer = pHead.next.next leftPointer.next = None while rightPointer != None: middlePointer.next = leftPointer leftPointer = middlePointer middlePointer = rightPointer rightPointer = rightPointer.next middlePointer.next = leftPointer return middlePointer if __name__ == '__main__': # 创建链表 l1 = ListNode(1) l2 = ListNode(2) l3 = ListNode(3) l4 = ListNode(4) l5 = ListNode(5) l1.next = l2 l2.next = l3 l3.next = l4 l4.next = l5 print(Solution().ReverseList(l1))
StarcoderdataPython
3316841
<filename>hackerrank/Python/Strings/Print-Fucntion.py<gh_stars>0 #Represent all int values before stdin print(*range(1, int(input())+1), sep='')
StarcoderdataPython
1621239
<filename>api/src/opentrons/protocol_engine/resources/model_utils.py """Unique ID generation provider.""" from datetime import datetime, timezone from uuid import uuid4 class ModelUtils: """Common resource model utilities provider.""" @staticmethod def generate_id() -> str: """Generate a unique identifier. Uses UUIDv4 for safety in a multiprocessing environment. """ return str(uuid4()) @staticmethod def get_timestamp() -> datetime: """Get a timestamp of the current time.""" return datetime.now(tz=timezone.utc)
StarcoderdataPython
3317529
<gh_stars>0 # Copyright 2017 Apex.AI, Inc. # flake8: noqa This file is for plotting data. Its dependencies are not necessarily on the CI. import os import sys import numpy as np import pandas as pd import matplotlib import matplotlib.pyplot as plt # noqa: if len(sys.argv) == 2: directory = sys.argv[1] else: print("Usage: python performance_test_file_reader.py /path_to_log_files") sys.exit(0) logfiles = [] N = 14 # Number of line to skip before CSV data starts. for file in os.listdir(directory): if file.startswith("log_"): print(os.path.join(directory, file)) logfiles.append(os.path.join(directory, file)) for f in logfiles: try: print("Parsing file:" + str(f)) dataframe = pd.read_csv(f, skiprows=N + 1, sep="[ \t]*,[ \t]*", engine='python') # dataframe = dataframe.drop(columns=['Unnamed: 19']) with open(f) as myfile: head = [next(myfile) for x in range(0, N)] print(''.join(head)) if not dataframe.empty: pd.options.display.float_format = '{:.4f}'.format dataframe.drop(list(dataframe.filter(regex='ru_')), axis=1, inplace=True) dataframe["latency_variance (ms) * 100"] = 100.0 * dataframe["latency_variance (ms)"] dataframe[["T_experiment", "latency_min (ms)", "latency_max (ms)", "latency_mean (ms)", "latency_variance (ms) * 100"]] \ .plot(x='T_experiment') plt.figtext(0.0, 1.0, ''.join(head), fontsize=8, horizontalalignment='left') plt.figtext(0.65, 0.9, dataframe.mean().round(4), fontsize=8, horizontalalignment='left') plt.savefig(os.path.basename(f) + ".pdf", bbox_inches=matplotlib.transforms.Bbox(np.array(((0, 0), (8, 8))))) except: # noqa: E722 I do rethrow. print("Could not parse file: " + str(f) + "\n") raise
StarcoderdataPython
114342
<reponame>christopher-roelofs/MiSTerDash<gh_stars>0 from time import sleep import json import config from flask import Flask, Response, render_template import time app = Flask(__name__) quit = False SETTINGS = config.get_config() RECENTS_FOLDER = '/media/{}/config/'.format(SETTINGS['core_storage']) details = {} @app.route('/') def index(): return render_template('details.html') @app.route('/details') def game_details(): def get_game_details(): while True: json_data = json.dumps( {'rom_id': 5815, 'system_id': 20, 'name': '007: Everything or Nothing', 'region': 'Europe', 'front_cover': 'https://gamefaqs.gamespot.com/a/box/5/0/6/53506_front.jpg', 'back_cover': 'https://gamefaqs.gamespot.com/a/box/5/0/6/53506_back.jpg', 'description': "Think like Bond, act like Bond, and experience an entirely new Bond adventure.<NAME>, the world's greatest secret agent, returns in Everything or Nothing with new guns and gadgets, combat skills, and clever tricks--and it's up to you to put them to good use.Travel through four exciting continents including the Valley of the Kings in Egypt and the French Quarter in New Orleans.The game also features two-player co-op missions and four-player multiplayer arena modes.", 'developer': 'Griptonite Games', 'publisher': None, 'genre': 'Action,Shooter,Third-Person,Modern', 'release_date': 'Nov 17, 2003', 'gamefaqs': 'http://www.gamefaqs.com/gba/914854-007-everything-or-nothing'}) yield f"data:{json_data}\n\n" time.sleep(1) return Response(get_game_details(), mimetype='text/event-stream') app.run(threaded=True,host='0.0.0.0', port=8080)
StarcoderdataPython
92791
<filename>refinery/lib/deobfuscation.py #!/usr/bin/env python3 # -*- coding: utf-8 -*- """ Contains functions to aid in deobfuscation. """ from typing import Optional, Any import ast import re class ExpressionParsingFailure(ValueError): pass _ALLOWED_NODE_TYPES = frozenset({ ast.Add, ast.BinOp, ast.BitAnd, ast.BitAnd, ast.BitOr, ast.BitXor, ast.Constant, ast.Div, ast.FloorDiv, ast.Invert, ast.LShift, ast.Mod, ast.Mult, ast.Not, ast.NotEq, ast.Num, ast.Or, ast.RShift, ast.Sub, ast.UAdd, ast.UnaryOp, ast.USub }) def cautious_eval(definition: str, size_limit: Optional[int] = None) -> Any: """ Very, very, very, very, very carefully evaluate a Python expression. """ definition = re.sub(R'\s+', '', definition) class Abort(ExpressionParsingFailure): def __init__(self, msg): super().__init__(F'{msg}: {definition}') if size_limit and len(definition) > size_limit: raise Abort(F'Size limit {size_limit} was exceeded while parsing') if any(x not in '.^%|&~<>()-+/*0123456789xabcdefABCDEF' for x in definition): raise Abort('Unknown characters in expression') try: expression = ast.parse(definition) nodes = ast.walk(expression) except Exception: raise Abort('Python AST parser failed') try: assert type(next(nodes)) == ast.Module assert type(next(nodes)) == ast.Expr except (StopIteration, AssertionError): raise Abort('Not a Python expression') nodes = list(nodes) types = set(type(node) for node in nodes) if not types <= _ALLOWED_NODE_TYPES: problematic = types - _ALLOWED_NODE_TYPES raise Abort('Expression contains operations that are not allowed: {}'.format(', '.join(str(p) for p in problematic))) return eval(definition) def cautious_eval_or_default(definition: str, default: Optional[Any] = None, size_limit: Optional[int] = None) -> Any: try: return cautious_eval(definition) except ExpressionParsingFailure: return default
StarcoderdataPython
1646925
<gh_stars>10-100 # coding: utf-8 import ncloud_cdn from ncloud_cdn.api.v2_api import V2Api from ncloud_cdn.rest import ApiException import ncloud_apikey configuration = ncloud_cdn.Configuration() apikeys = ncloud_apikey.ncloud_key.NcloudKey().keys() configuration.access_key = apikeys['access_key'] # "<KEY>" configuration.secret_key = apikeys['secret_key'] # "<KEY>" api = V2Api(ncloud_cdn.ApiClient(configuration)) get_cdn_plus_instance_list_request = ncloud_cdn.GetCdnPlusInstanceListRequest() try: api_response = api.get_cdn_plus_instance_list(get_cdn_plus_instance_list_request) print(api_response) except ApiException as e: print("Exception when calling V2Api->get_cdn_plus_instance_list: %s\n" % e)
StarcoderdataPython
1718560
<reponame>Kittycatguspm/shuecm """ Place this db models. """
StarcoderdataPython
3214893
<gh_stars>10-100 #!/usr/bin/env python __all__ = [ "RequestPacket", "ResponsePacket" ] from CraftProtocol.Protocol.v1_8.Packet.Status.RequestPacket import RequestPacket from CraftProtocol.Protocol.v1_8.Packet.Status.ResponsePacket import ResponsePacket
StarcoderdataPython
7934
def execucoes(): return int(input()) def entradas(): return input().split(' ') def imprimir(v): print(v) def tamanho_a(a): return len(a) def tamanho_b(b): return len(b) def diferenca_tamanhos(a, b): return (len(a) <= len(b)) def analisar(e, i, s): a, b = e if(diferenca_tamanhos(a, b)): for i in range(tamanho_a(a)): s += a[i] s += b[i] s += b[tamanho_a(a):] else: for i in range(tamanho_b(b)): s += a[i] s += b[i] s += a[tamanho_b(b):] return s def combinador(): n = execucoes() for i in range(n): imprimir(analisar(entradas(), i, '')) combinador()
StarcoderdataPython
1740753
<filename>mars/tensor/execution/tests/test_datasource_execute.py #!/usr/bin/env python # -*- coding: utf-8 -*- # Copyright 1999-2018 Alibaba Group Holding Ltd. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. import numpy as np import scipy.sparse as sps from mars.tests.core import TestBase from mars.tensor.execution.core import Executor from mars.tensor.expressions.datasource import tensor, ones_like, zeros, zeros_like, full, \ arange, empty, empty_like, diag, diagflat, eye, linspace, meshgrid, indices, \ triu, tril from mars.lib.sparse import SparseNDArray from mars.tensor.expressions.lib import nd_grid class Test(TestBase): def setUp(self): super(Test, self).setUp() self.executor = Executor() def testCreateSparseExecution(self): mat = sps.csr_matrix([[0, 0, 2], [2, 0, 0]]) t = tensor(mat, dtype='f8', chunks=2) res = self.executor.execute_tensor(t) self.assertIsInstance(res[0], SparseNDArray) self.assertEqual(res[0].dtype, np.float64) np.testing.assert_array_equal(res[0].toarray(), mat[..., :2].toarray()) np.testing.assert_array_equal(res[1].toarray(), mat[..., 2:].toarray()) t2 = ones_like(t, dtype='f4') res = self.executor.execute_tensor(t2) expected = sps.csr_matrix([[0, 0, 1], [1, 0, 0]]) self.assertIsInstance(res[0], SparseNDArray) self.assertEqual(res[0].dtype, np.float32) np.testing.assert_array_equal(res[0].toarray(), expected[..., :2].toarray()) np.testing.assert_array_equal(res[1].toarray(), expected[..., 2:].toarray()) t3 = tensor(np.array([[0, 0, 2], [2, 0, 0]]), chunks=2).tosparse() res = self.executor.execute_tensor(t3) self.assertIsInstance(res[0], SparseNDArray) self.assertEqual(res[0].dtype, np.int_) np.testing.assert_array_equal(res[0].toarray(), mat[..., :2].toarray()) np.testing.assert_array_equal(res[1].toarray(), mat[..., 2:].toarray()) def testZerosExecution(self): t = zeros((20, 30), dtype='i8', chunks=5) res = self.executor.execute_tensor(t, concat=True) self.assertTrue(np.array_equal(res[0], np.zeros((20, 30), dtype='i8'))) self.assertEqual(res[0].dtype, np.int64) t2 = zeros_like(t) res = self.executor.execute_tensor(t2, concat=True) self.assertTrue(np.array_equal(res[0], np.zeros((20, 30), dtype='i8'))) self.assertEqual(res[0].dtype, np.int64) t = zeros((20, 30), dtype='i4', chunks=5, sparse=True) res = self.executor.execute_tensor(t, concat=True) self.assertEqual(res[0].nnz, 0) def testEmptyExecution(self): t = empty((20, 30), dtype='i8', chunks=5) res = self.executor.execute_tensor(t, concat=True) self.assertEqual(res[0].shape, (20, 30)) self.assertEqual(res[0].dtype, np.int64) self.assertFalse(np.array_equal(res, np.zeros((20, 30)))) t = empty((20, 30), chunks=5) res = self.executor.execute_tensor(t, concat=True) self.assertFalse(np.allclose(res, np.zeros((20, 30)))) t2 = empty_like(t) res = self.executor.execute_tensor(t2, concat=True) self.assertEqual(res[0].shape, (20, 30)) self.assertEqual(res[0].dtype, np.float64) def testFullExecution(self): t = full((2, 2), 1, dtype='f4', chunks=1) res = self.executor.execute_tensor(t, concat=True) self.assertTrue(np.array_equal(res[0], np.full((2, 2), 1, dtype='f4'))) t = full((2, 2), [1, 2], dtype='f8', chunks=1) res = self.executor.execute_tensor(t, concat=True) self.assertTrue(np.array_equal(res[0], np.full((2, 2), [1, 2], dtype='f8'))) def testArangeExecution(self): t = arange(1, 20, 3, chunks=2) res = self.executor.execute_tensor(t, concat=True)[0] self.assertTrue(np.array_equal(res, np.arange(1, 20, 3))) t = arange(1, 20, .3, chunks=4) res = self.executor.execute_tensor(t, concat=True)[0] expected = np.arange(1, 20, .3) self.assertTrue(np.allclose(res, expected)) t = arange(1.0, 1.8, .3, chunks=4) res = self.executor.execute_tensor(t, concat=True)[0] expected = np.arange(1.0, 1.8, .3) self.assertTrue(np.allclose(res, expected)) t = arange('1066-10-13', '1066-10-31', dtype=np.datetime64, chunks=3) res = self.executor.execute_tensor(t, concat=True)[0] expected = np.arange('1066-10-13', '1066-10-31', dtype=np.datetime64) self.assertTrue(np.array_equal(res, expected)) def testDiagExecution(self): # 2-d 6 * 6 a = arange(36, chunks=2).reshape(6, 6) d = diag(a) res = self.executor.execute_tensor(d, concat=True)[0] expected = np.diag(np.arange(36).reshape(6, 6)) np.testing.assert_equal(res, expected) d = diag(a, k=1) res = self.executor.execute_tensor(d, concat=True)[0] expected = np.diag(np.arange(36).reshape(6, 6), k=1) np.testing.assert_equal(res, expected) d = diag(a, k=3) res = self.executor.execute_tensor(d, concat=True)[0] expected = np.diag(np.arange(36).reshape(6, 6), k=3) np.testing.assert_equal(res, expected) d = diag(a, k=-2) res = self.executor.execute_tensor(d, concat=True)[0] expected = np.diag(np.arange(36).reshape(6, 6), k=-2) np.testing.assert_equal(res, expected) d = diag(a, k=-5) res = self.executor.execute_tensor(d)[0] expected = np.diag(np.arange(36).reshape(6, 6), k=-5) np.testing.assert_equal(res, expected) # 2-d 4 * 9 a = arange(36, chunks=2).reshape(4, 9) d = diag(a) res = self.executor.execute_tensor(d, concat=True)[0] expected = np.diag(np.arange(36).reshape(4, 9)) np.testing.assert_equal(res, expected) d = diag(a, k=1) res = self.executor.execute_tensor(d, concat=True)[0] expected = np.diag(np.arange(36).reshape(4, 9), k=1) np.testing.assert_equal(res, expected) d = diag(a, k=3) res = self.executor.execute_tensor(d, concat=True)[0] expected = np.diag(np.arange(36).reshape(4, 9), k=3) np.testing.assert_equal(res, expected) d = diag(a, k=-2) res = self.executor.execute_tensor(d, concat=True)[0] expected = np.diag(np.arange(36).reshape(4, 9), k=-2) np.testing.assert_equal(res, expected) d = diag(a, k=-3) res = self.executor.execute_tensor(d)[0] expected = np.diag(np.arange(36).reshape(4, 9), k=-3) np.testing.assert_equal(res, expected) # 1-d a = arange(5, chunks=2) d = diag(a) res = self.executor.execute_tensor(d, concat=True)[0] expected = np.diag(np.arange(5)) np.testing.assert_equal(res, expected) d = diag(a, k=1) res = self.executor.execute_tensor(d, concat=True)[0] expected = np.diag(np.arange(5), k=1) np.testing.assert_equal(res, expected) d = diag(a, k=3) res = self.executor.execute_tensor(d, concat=True)[0] expected = np.diag(np.arange(5), k=3) np.testing.assert_equal(res, expected) d = diag(a, k=-2) res = self.executor.execute_tensor(d, concat=True)[0] expected = np.diag(np.arange(5), k=-2) np.testing.assert_equal(res, expected) d = diag(a, k=-3) res = self.executor.execute_tensor(d, concat=True)[0] expected = np.diag(np.arange(5), k=-3) np.testing.assert_equal(res, expected) d = diag(a, sparse=True) res = self.executor.execute_tensor(d, concat=True)[0] expected = np.diag(np.arange(5)) self.assertIsInstance(res, SparseNDArray) np.testing.assert_equal(res.toarray(), expected) d = diag(a, k=1, sparse=True) res = self.executor.execute_tensor(d, concat=True)[0] expected = np.diag(np.arange(5), k=1) self.assertIsInstance(res, SparseNDArray) np.testing.assert_equal(res.toarray(), expected) d = diag(a, k=2, sparse=True) res = self.executor.execute_tensor(d, concat=True)[0] expected = np.diag(np.arange(5), k=2) self.assertIsInstance(res, SparseNDArray) np.testing.assert_equal(res.toarray(), expected) d = diag(a, k=-2, sparse=True) res = self.executor.execute_tensor(d, concat=True)[0] expected = np.diag(np.arange(5), k=-2) self.assertIsInstance(res, SparseNDArray) np.testing.assert_equal(res.toarray(), expected) d = diag(a, k=-3, sparse=True) res = self.executor.execute_tensor(d, concat=True)[0] expected = np.diag(np.arange(5), k=-3) self.assertIsInstance(res, SparseNDArray) np.testing.assert_equal(res.toarray(), expected) def testDiagflatExecution(self): a = diagflat([[1, 2], [3, 4]], chunks=1) res = self.executor.execute_tensor(a, concat=True)[0] expected = np.diagflat([[1, 2], [3, 4]]) np.testing.assert_equal(res, expected) d = tensor([[1, 2], [3, 4]], chunks=1) a = diagflat(d) res = self.executor.execute_tensor(a, concat=True)[0] expected = np.diagflat([[1, 2], [3, 4]]) np.testing.assert_equal(res, expected) a = diagflat([1, 2], 1, chunks=1) res = self.executor.execute_tensor(a, concat=True)[0] expected = np.diagflat([1, 2], 1) np.testing.assert_equal(res, expected) d = tensor([[1, 2]], chunks=1) a = diagflat(d, 1) res = self.executor.execute_tensor(a, concat=True)[0] expected = np.diagflat([1, 2], 1) np.testing.assert_equal(res, expected) def testEyeExecution(self): t = eye(5, chunks=2) res = self.executor.execute_tensor(t, concat=True)[0] expected = np.eye(5) np.testing.assert_equal(res, expected) t = eye(5, k=1, chunks=2) res = self.executor.execute_tensor(t, concat=True)[0] expected = np.eye(5, k=1) np.testing.assert_equal(res, expected) t = eye(5, k=2, chunks=2) res = self.executor.execute_tensor(t, concat=True)[0] expected = np.eye(5, k=2) np.testing.assert_equal(res, expected) t = eye(5, k=-1, chunks=2) res = self.executor.execute_tensor(t, concat=True)[0] expected = np.eye(5, k=-1) np.testing.assert_equal(res, expected) t = eye(5, k=-3, chunks=2) res = self.executor.execute_tensor(t, concat=True)[0] expected = np.eye(5, k=-3) np.testing.assert_equal(res, expected) t = eye(5, M=3, k=1, chunks=2) res = self.executor.execute_tensor(t, concat=True)[0] expected = np.eye(5, M=3, k=1) np.testing.assert_equal(res, expected) t = eye(5, M=3, k=-3, chunks=2) res = self.executor.execute_tensor(t, concat=True)[0] expected = np.eye(5, M=3, k=-3) np.testing.assert_equal(res, expected) t = eye(5, M=7, k=1, chunks=2) res = self.executor.execute_tensor(t, concat=True)[0] expected = np.eye(5, M=7, k=1) np.testing.assert_equal(res, expected) t = eye(5, M=8, k=-3, chunks=2) res = self.executor.execute_tensor(t, concat=True)[0] expected = np.eye(5, M=8, k=-3) np.testing.assert_equal(res, expected) t = eye(2, dtype=int) res = self.executor.execute_tensor(t, concat=True)[0] self.assertEqual(res.dtype, np.int_) # test sparse t = eye(5, sparse=True, chunks=2) res = self.executor.execute_tensor(t, concat=True)[0] expected = np.eye(5) self.assertIsInstance(res, SparseNDArray) np.testing.assert_equal(res.toarray(), expected) t = eye(5, k=1, sparse=True, chunks=2) res = self.executor.execute_tensor(t, concat=True)[0] expected = np.eye(5, k=1) self.assertIsInstance(res, SparseNDArray) np.testing.assert_equal(res.toarray(), expected) t = eye(5, k=2, sparse=True, chunks=2) res = self.executor.execute_tensor(t, concat=True)[0] expected = np.eye(5, k=2) self.assertIsInstance(res, SparseNDArray) np.testing.assert_equal(res.toarray(), expected) t = eye(5, k=-1, sparse=True, chunks=2) res = self.executor.execute_tensor(t, concat=True)[0] expected = np.eye(5, k=-1) self.assertIsInstance(res, SparseNDArray) np.testing.assert_equal(res.toarray(), expected) t = eye(5, k=-3, sparse=True, chunks=2) res = self.executor.execute_tensor(t, concat=True)[0] expected = np.eye(5, k=-3) self.assertIsInstance(res, SparseNDArray) np.testing.assert_equal(res.toarray(), expected) t = eye(5, M=3, k=1, sparse=True, chunks=2) res = self.executor.execute_tensor(t, concat=True)[0] expected = np.eye(5, M=3, k=1) self.assertIsInstance(res, SparseNDArray) np.testing.assert_equal(res.toarray(), expected) t = eye(5, M=3, k=-3, sparse=True, chunks=2) res = self.executor.execute_tensor(t, concat=True)[0] expected = np.eye(5, M=3, k=-3) self.assertIsInstance(res, SparseNDArray) np.testing.assert_equal(res.toarray(), expected) t = eye(5, M=7, k=1, sparse=True, chunks=2) res = self.executor.execute_tensor(t, concat=True)[0] expected = np.eye(5, M=7, k=1) self.assertIsInstance(res, SparseNDArray) np.testing.assert_equal(res.toarray(), expected) t = eye(5, M=8, k=-3, sparse=True, chunks=2) res = self.executor.execute_tensor(t, concat=True)[0] expected = np.eye(5, M=8, k=-3) self.assertIsInstance(res, SparseNDArray) np.testing.assert_equal(res.toarray(), expected) def testLinspaceExecution(self): a = linspace(2.0, 9.0, num=11, chunks=3) res = self.executor.execute_tensor(a, concat=True)[0] expected = np.linspace(2.0, 9.0, num=11) np.testing.assert_allclose(res, expected) a = linspace(2.0, 9.0, num=11, endpoint=False, chunks=3) res = self.executor.execute_tensor(a, concat=True)[0] expected = np.linspace(2.0, 9.0, num=11, endpoint=False) np.testing.assert_allclose(res, expected) a = linspace(2.0, 9.0, num=11, chunks=3, dtype=int) res = self.executor.execute_tensor(a, concat=True)[0] self.assertEqual(res.dtype, np.int_) def testMeshgridExecution(self): a = arange(5, chunks=2) b = arange(6, 12, chunks=3) c = arange(12, 19, chunks=4) A, B, C = meshgrid(a, b, c) A_res = self.executor.execute_tensor(A, concat=True)[0] A_expected = np.meshgrid(np.arange(5), np.arange(6, 12), np.arange(12, 19))[0] np.testing.assert_equal(A_res, A_expected) B_res = self.executor.execute_tensor(B, concat=True)[0] B_expected = np.meshgrid(np.arange(5), np.arange(6, 12), np.arange(12, 19))[1] np.testing.assert_equal(B_res, B_expected) C_res = self.executor.execute_tensor(C, concat=True)[0] C_expected = np.meshgrid(np.arange(5), np.arange(6, 12), np.arange(12, 19))[2] np.testing.assert_equal(C_res, C_expected) A, B, C = meshgrid(a, b, c, indexing='ij') A_res = self.executor.execute_tensor(A, concat=True)[0] A_expected = np.meshgrid(np.arange(5), np.arange(6, 12), np.arange(12, 19), indexing='ij')[0] np.testing.assert_equal(A_res, A_expected) B_res = self.executor.execute_tensor(B, concat=True)[0] B_expected = np.meshgrid(np.arange(5), np.arange(6, 12), np.arange(12, 19), indexing='ij')[1] np.testing.assert_equal(B_res, B_expected) C_res = self.executor.execute_tensor(C, concat=True)[0] C_expected = np.meshgrid(np.arange(5), np.arange(6, 12), np.arange(12, 19), indexing='ij')[2] np.testing.assert_equal(C_res, C_expected) A, B, C = meshgrid(a, b, c, sparse=True) A_res = self.executor.execute_tensor(A, concat=True)[0] A_expected = np.meshgrid(np.arange(5), np.arange(6, 12), np.arange(12, 19), sparse=True)[0] np.testing.assert_equal(A_res, A_expected) B_res = self.executor.execute_tensor(B, concat=True)[0] B_expected = np.meshgrid(np.arange(5), np.arange(6, 12), np.arange(12, 19), sparse=True)[1] np.testing.assert_equal(B_res, B_expected) C_res = self.executor.execute_tensor(C, concat=True)[0] C_expected = np.meshgrid(np.arange(5), np.arange(6, 12), np.arange(12, 19), sparse=True)[2] np.testing.assert_equal(C_res, C_expected) A, B, C = meshgrid(a, b, c, indexing='ij', sparse=True) A_res = self.executor.execute_tensor(A, concat=True)[0] A_expected = np.meshgrid(np.arange(5), np.arange(6, 12), np.arange(12, 19), indexing='ij', sparse=True)[0] np.testing.assert_equal(A_res, A_expected) B_res = self.executor.execute_tensor(B, concat=True)[0] B_expected = np.meshgrid(np.arange(5), np.arange(6, 12), np.arange(12, 19), indexing='ij', sparse=True)[1] np.testing.assert_equal(B_res, B_expected) C_res = self.executor.execute_tensor(C, concat=True)[0] C_expected = np.meshgrid(np.arange(5), np.arange(6, 12), np.arange(12, 19), indexing='ij', sparse=True)[2] np.testing.assert_equal(C_res, C_expected) def testIndicesExecution(self): grid = indices((2, 3), chunks=1) res = self.executor.execute_tensor(grid, concat=True)[0] expected = np.indices((2, 3)) np.testing.assert_equal(res, expected) res = self.executor.execute_tensor(grid[0], concat=True)[0] np.testing.assert_equal(res, expected[0]) res = self.executor.execute_tensor(grid[1], concat=True)[0] np.testing.assert_equal(res, expected[1]) def testTriuExecution(self): a = arange(24, chunks=2).reshape(2, 3, 4) t = triu(a) res = self.executor.execute_tensor(t, concat=True)[0] expected = np.triu(np.arange(24).reshape(2, 3, 4)) np.testing.assert_equal(res, expected) t = triu(a, k=1) res = self.executor.execute_tensor(t, concat=True)[0] expected = np.triu(np.arange(24).reshape(2, 3, 4), k=1) np.testing.assert_equal(res, expected) t = triu(a, k=2) res = self.executor.execute_tensor(t, concat=True)[0] expected = np.triu(np.arange(24).reshape(2, 3, 4), k=2) np.testing.assert_equal(res, expected) t = triu(a, k=-1) res = self.executor.execute_tensor(t, concat=True)[0] expected = np.triu(np.arange(24).reshape(2, 3, 4), k=-1) np.testing.assert_equal(res, expected) t = triu(a, k=-2) res = self.executor.execute_tensor(t, concat=True)[0] expected = np.triu(np.arange(24).reshape(2, 3, 4), k=-2) np.testing.assert_equal(res, expected) # test sparse a = arange(12, chunks=2).reshape(3, 4).tosparse() t = triu(a) res = self.executor.execute_tensor(t, concat=True)[0] expected = np.triu(np.arange(12).reshape(3, 4)) self.assertIsInstance(res, SparseNDArray) np.testing.assert_equal(res, expected) t = triu(a, k=1) res = self.executor.execute_tensor(t, concat=True)[0] expected = np.triu(np.arange(12).reshape(3, 4), k=1) self.assertIsInstance(res, SparseNDArray) np.testing.assert_equal(res, expected) t = triu(a, k=2) res = self.executor.execute_tensor(t, concat=True)[0] expected = np.triu(np.arange(12).reshape(3, 4), k=2) self.assertIsInstance(res, SparseNDArray) np.testing.assert_equal(res, expected) t = triu(a, k=-1) res = self.executor.execute_tensor(t, concat=True)[0] expected = np.triu(np.arange(12).reshape(3, 4), k=-1) self.assertIsInstance(res, SparseNDArray) np.testing.assert_equal(res, expected) t = triu(a, k=-2) res = self.executor.execute_tensor(t, concat=True)[0] expected = np.triu(np.arange(12).reshape(3, 4), k=-2) self.assertIsInstance(res, SparseNDArray) np.testing.assert_equal(res, expected) def testTrilExecution(self): a = arange(24, chunks=2).reshape(2, 3, 4) t = tril(a) res = self.executor.execute_tensor(t, concat=True)[0] expected = np.tril(np.arange(24).reshape(2, 3, 4)) np.testing.assert_equal(res, expected) t = tril(a, k=1) res = self.executor.execute_tensor(t, concat=True)[0] expected = np.tril(np.arange(24).reshape(2, 3, 4), k=1) np.testing.assert_equal(res, expected) t = tril(a, k=2) res = self.executor.execute_tensor(t, concat=True)[0] expected = np.tril(np.arange(24).reshape(2, 3, 4), k=2) np.testing.assert_equal(res, expected) t = tril(a, k=-1) res = self.executor.execute_tensor(t, concat=True)[0] expected = np.tril(np.arange(24).reshape(2, 3, 4), k=-1) np.testing.assert_equal(res, expected) t = tril(a, k=-2) res = self.executor.execute_tensor(t, concat=True)[0] expected = np.tril(np.arange(24).reshape(2, 3, 4), k=-2) np.testing.assert_equal(res, expected) a = arange(12, chunks=2).reshape(3, 4).tosparse() t = tril(a) res = self.executor.execute_tensor(t, concat=True)[0] expected = np.tril(np.arange(12).reshape(3, 4)) self.assertIsInstance(res, SparseNDArray) np.testing.assert_equal(res, expected) t = tril(a, k=1) res = self.executor.execute_tensor(t, concat=True)[0] expected = np.tril(np.arange(12).reshape(3, 4), k=1) self.assertIsInstance(res, SparseNDArray) np.testing.assert_equal(res, expected) t = tril(a, k=2) res = self.executor.execute_tensor(t, concat=True)[0] expected = np.tril(np.arange(12).reshape(3, 4), k=2) self.assertIsInstance(res, SparseNDArray) np.testing.assert_equal(res, expected) t = tril(a, k=-1) res = self.executor.execute_tensor(t, concat=True)[0] expected = np.tril(np.arange(12).reshape(3, 4), k=-1) self.assertIsInstance(res, SparseNDArray) np.testing.assert_equal(res, expected) t = tril(a, k=-2) res = self.executor.execute_tensor(t, concat=True)[0] expected = np.tril(np.arange(12).reshape(3, 4), k=-2) self.assertIsInstance(res, SparseNDArray) np.testing.assert_equal(res, expected) def testIndexTrickExecution(self): mgrid = nd_grid() t = mgrid[0:5, 0:5] res = self.executor.execute_tensor(t, concat=True)[0] expected = np.lib.index_tricks.nd_grid()[0:5, 0:5] np.testing.assert_equal(res, expected) t = mgrid[-1:1:5j] res = self.executor.execute_tensor(t, concat=True)[0] expected = np.lib.index_tricks.nd_grid()[-1:1:5j] np.testing.assert_equal(res, expected) ogrid = nd_grid(sparse=True) t = ogrid[0:5, 0:5] res = [self.executor.execute_tensor(o, concat=True)[0] for o in t] expected = np.lib.index_tricks.nd_grid(sparse=True)[0:5, 0:5] [np.testing.assert_equal(r, e) for r, e in zip(res, expected)]
StarcoderdataPython
1730685
<filename>Cap 11/rascunho.py # -*- coding: utf-8 -*- """ Created on Tue May 19 01:44:14 2020 @author: dreis """ def histogram(s): d = dict() for c in s: if c not in d: d[c] = 1 else: d[c] += 1 return print(d) def histogram_get(s): d = dict() for letra in s: d[letra] = d.get(letra, 0) + 1 return print(d) def fibonacci(n): global known known = {0: 0, 1: 1} if n in known: return known[n] res = fibonacci(n-1) + fibonacci(n-2) known[n] = res return res print(fibonacci(40))
StarcoderdataPython
157862
<filename>nematus/metrics/test_chrf.py #!/usr/bin/env python # -*- coding: utf-8 -*- import unittest from chrf import CharacterFScorer class TestCharacterFScoreReference(unittest.TestCase): """ Regression tests for SmoothedBleuReference """ @staticmethod def tokenize(sentence): return sentence.split(" ") def test_identical_segments(self): segment = self.tokenize("Consistency is the last refuge of the unimaginative") scorer = CharacterFScorer('n=6,beta=3') scorer.set_reference(segment) self.assertEqual(scorer.score(segment), 1.0) def test_completely_different_segments(self): segment_a = self.tokenize("AAAAAA") segment_b = self.tokenize("BBBB") scorer = CharacterFScorer('n=3,beta=3') scorer.set_reference(segment_a) self.assertEqual(scorer.score(segment_b), 0.0) def test_empty_string(self): segment_a = self.tokenize("") segment_b = self.tokenize("") scorer = CharacterFScorer('n=6,beta=3') scorer.set_reference(segment_a) self.assertEqual(scorer.score(segment_b), 1.0) def test_one_character_empty_string(self): segment_a = self.tokenize("A") segment_b = self.tokenize("") scorer = CharacterFScorer('n=6,beta=3') scorer.set_reference(segment_a) self.assertEqual(scorer.score(segment_b), 0.0) def test_empty_string_one_character(self): segment_a = self.tokenize("") segment_b = self.tokenize("A") scorer = CharacterFScorer('n=6,beta=3') scorer.set_reference(segment_a) self.assertEqual(scorer.score(segment_b), 0.0) def test_half_right(self): segment_a = self.tokenize("AB") segment_b = self.tokenize("AA") scorer = CharacterFScorer('n=6,beta=3') scorer.set_reference(segment_a) self.assertEqual(scorer.score(segment_b), 0.25) def test_one_character(self): segment_a = self.tokenize("A") segment_b = self.tokenize("A") scorer = CharacterFScorer('n=6,beta=3') scorer.set_reference(segment_a) self.assertEqual(scorer.score(segment_b), 1.0) def test_almost_correct(self): segment_a = self.tokenize("risk assessment has to be undertaken by those who are qualified and expert in that area - that is the scientists .") segment_b = self.tokenize(" risk assessment must be made of those who are qualified and expertise in the sector - these are the scientists .") scorer = CharacterFScorer('n=6,beta=3') scorer.set_reference(segment_a) self.assertEqual('{0:.12f}'.format(scorer.score(segment_b)), "0.652414427449") if __name__ == '__main__': unittest.main()
StarcoderdataPython
3249237
<filename>app.py<gh_stars>0 import graphviz as graphviz import streamlit as st from modules import helper_module_app as helper st.set_option('deprecation.showPyplotGlobalUse', False) def main(): """ glues all parts together """ st.sidebar.title("Model configurations") st.title("Topic discovering") st.write("") graph = graphviz.Digraph() graph.edge('Input model embeddings from documents', 'Dimension reduction (Step 2)') graph.edge('Input documents', 'Extract keywords \ and perform word embeddings (Step 1)') graph.edge('Dimension reduction (Step 2)', 'Clustering (Step 3)') graph.edge('Clustering (Step 3)', 'Construct topic vectors') graph.edge('Construct topic vectors', 'Attach keywords \ (ngrams) to each topic vector') graph.edge('Extract keywords and perform word embeddings (Step 1)', 'Attach keywords \ (ngrams) to each topic vector') st.graphviz_chart(graph) # choose dataset dataset = st.sidebar.selectbox( "Choose dataset", (["REIT-Industrial"]) ) df, doc_embed, example_text = helper.load_data(dataset) original_data_expander = st.beta_expander("Show raw data (source)") paragraphs = df.paragraph.values.tolist() if dataset == "Newsgroup20 Subset": st.sidebar.markdown("For more information about the newsgroup20 dataset, \ see [here](https://scikit-learn.org/0.19/datasets/twenty_newsgroups.html).") # loads model if dataset == "REIT-Industrial": add_stop_words = ["Alexandrias", "Alexandria", "Yellow", "Yellows"] add_stop_words = list(df.company.unique()) + add_stop_words model = helper.load_model(add_stops_words=add_stop_words) else: model = helper.load_model() if model.dataset_name != dataset: with st.spinner("Change of dataset: updating step 1 to 3"): # update and reset arguments model.doc_embedding = doc_embed model.documents = paragraphs model.dataset_name = dataset model.topic_sizes_reduced = None model.topic_vectors_reduced = None model.topic_words_reduced = None model.topic_word_scores_reduced = None model.topic_hierarchy = None model.perform_steps() st.sidebar.markdown("The paragraph and word embeddings were obtained using \ [distiluse-base-multilingual-cased](https://arxiv.org/abs/1910.01108) \ from the [sentence transformer library](https://www.sbert.net/).") with original_data_expander.beta_container(): original_data_expander.markdown("Here you see the (sources) of the original \ data.") if dataset == "REIT-Industrial": show_p = original_data_expander.checkbox( "Show extracted paragraphs", value=False ) if show_p: original_data_expander.dataframe(df) else: original_data_expander.dataframe( df.iloc[:, 0:5].drop_duplicates(). reset_index(inplace=False, drop=True) ) else: original_data_expander.dataframe(df.iloc[:, 1]) # parameters word embeddings model, stop_words, lower_ngrams, upper_ngrams, min_df, max_df = ( helper.params_word_embed(model) ) # parameters dim reduction model, n_components, n_neighbors, densmap = ( helper.params_dim_red(model) ) # parameters clustering (model, min_cluster_size, min_samples, selection_epsilon) = ( helper.params_clustering(model) ) st.sidebar.markdown("Do not forget to hit the **update model configurations** \ button when changing the parameter values. \ The updating should take no longer than 1 minute.") if st.sidebar.button("Update model configurations"): model = helper.update_model_steps( model=model, doc_embed=doc_embed, paragraphs=paragraphs, lower_ngrams=lower_ngrams, upper_ngrams=upper_ngrams, min_df=min_df, max_df=max_df, stop_words=stop_words, n_neighbors=n_neighbors, n_components=n_components, densmap=densmap, min_cluster_size=min_cluster_size, min_samples=min_samples, selection_epsilon=selection_epsilon ) # apply topic reduction? topic_reduction = st.sidebar.checkbox("Topic reduction", value=False) if topic_reduction: st.sidebar.markdown("Do not foret to hit the **update number of topics** \ button when changing the number of topics.") # Section 1: Table with topics expander_topics, reduced_topic_sec_tw, = ( helper.display_topics(model, topic_reduction) ) # expander_topics.write("\n") # helper.display_word_cloud( # model, expander_topics, reduced_topic_sec_tw # ) # Section 2: Keyword loadings on topics helper.topic_keywords( model, example_text, topic_reduction ) # Section 3: Topic similarity matrix helper.show_similarity_matrix(model, topic_reduction) # Section 4: Search most relevant documents for a topic cluster helper.most_relevant_doc_top(df, model, topic_reduction) # Section 5: Search documents by keywords helper.documents_keywords(model, df, example_text) # Section 6: Search documents by keywords if dataset == "REIT-Industrial": helper.topic_size_vars_value(model, df, topic_reduction) if __name__ == "__main__": st.set_page_config(layout="wide") main()
StarcoderdataPython
54088
<reponame>CCC-CS-github/ursina_ks3<gh_stars>1-10 """ private dev for the PythonCraft code -- i.e. in case I break the original, PythonCraft.py. Also -- I want the original kept to approx. 30 lines. """ # Import the ursina module, and its First Person character. from ursina import * # Import the Perlin Noise module for creating terrain. from perlin_terrain import Terrain from character import Character # Create Window. Set background colour to sky blue. app = Ursina() window.color=color.rgb(0,200,255) # *** # scene.fog_density = 0.02 # scene.fog.color = rgb(0,200,255) # Initialise our terrain. # cambridge = Terrain(frequency=48,amplitude=32) # *** cambridge = Terrain(advanced=True, a1=64,f1=128, a2=12,f2=120, a3=3,f3=9, seed=99) # Initialise and set up our first-person character. steve = Character(speed=6) # Our main program update loop. def update(): # Allow character to move over terrain. steve.move(cambridge) # Function that responds to key and mouse presses. def input(key): steve.input(key) # Character responds to 'escape' key. # Start the program :) app.run()
StarcoderdataPython
3385199
<reponame>ablot/Pinceau # -*- coding: utf-8 -*- from PyQt4.QtCore import * from PyQt4.QtGui import * import ui_graphDlg import matplotlib.image as mpimg class graphDlg(QDialog, ui_graphDlg.Ui_graphDialog): def __init__(self,parent=None,debug=0): super(graphDlg, self).__init__(parent) self.setupUi(self) self.MPLNav.initToolbar(self.MPLFig.fig.canvas) self.graph = parent.tree.graph self.updateGraph(1) self.setWindowTitle('Graph of tree %s'%parent.tree.name) self.connect(self.groupCheckBox, SIGNAL("stateChanged(int)"), self.updateGraph) def updateGraph(self, doIt = 0): if self.sender is self.groupCheckBox: doIt = 1 if not doIt and not self.interactiveCheckBox.isChecked(): return self.graph.updateGraph(groups = self.groupCheckBox.isChecked(), verbose = 0) img=mpimg.imread(self.graph.path) ax = self.MPLFig.fig.add_axes([0,0,1,1]) imgplot = ax.imshow(img, aspect = 'equal') ax.axis('off') self.MPLFig.fig.canvas.draw() @pyqtSignature("") def on_refreshPushButton_clicked(self): self.updateGraph(1)
StarcoderdataPython
3294439
<reponame>ckamtsikis/cmssw<gh_stars>100-1000 import FWCore.ParameterSet.Config as cms egmGedGsfElectronPFNoPileUpIsolation = cms.EDProducer( "CITKPFIsolationSumProducer", srcToIsolate = cms.InputTag("gedGsfElectrons"), srcForIsolationCone = cms.InputTag('pfNoPileUpCandidates'), isolationConeDefinitions = cms.VPSet( cms.PSet( isolationAlgo = cms.string('ElectronPFIsolationWithConeVeto'), coneSize = cms.double(0.3), VetoConeSizeBarrel = cms.double(0.0), VetoConeSizeEndcaps = cms.double(0.015), isolateAgainst = cms.string('h+'), miniAODVertexCodes = cms.vuint32(2,3) ), cms.PSet( isolationAlgo = cms.string('ElectronPFIsolationWithConeVeto'), coneSize = cms.double(0.3), VetoConeSizeBarrel = cms.double(0.0), VetoConeSizeEndcaps = cms.double(0.0), isolateAgainst = cms.string('h0'), miniAODVertexCodes = cms.vuint32(2,3) ), cms.PSet( isolationAlgo = cms.string('ElectronPFIsolationWithConeVeto'), coneSize = cms.double(0.3), VetoConeSizeBarrel = cms.double(0.0), VetoConeSizeEndcaps = cms.double(0.08), isolateAgainst = cms.string('gamma'), miniAODVertexCodes = cms.vuint32(2,3) ) ) ) egmGedGsfElectronPFPileUpIsolation = cms.EDProducer( "CITKPFIsolationSumProducer", srcToIsolate = cms.InputTag("gedGsfElectrons"), srcForIsolationCone = cms.InputTag('pfPileUpAllChargedParticles'), isolationConeDefinitions = cms.VPSet( cms.PSet( isolationAlgo = cms.string('ElectronPFIsolationWithConeVeto'), coneSize = cms.double(0.3), VetoConeSizeBarrel = cms.double(0.0), VetoConeSizeEndcaps = cms.double(0.015), isolateAgainst = cms.string('h+'), miniAODVertexCodes = cms.vuint32(0,1) ) ) ) egmGedGsfElectronPFNoPileUpIsolationMapBasedVeto = cms.EDProducer( "CITKPFIsolationSumProducer", srcToIsolate = cms.InputTag("gedGsfElectrons"), srcForIsolationCone = cms.InputTag('pfNoPileUpCandidates'), isolationConeDefinitions = cms.VPSet( cms.PSet( isolationAlgo = cms.string('ElectronPFIsolationWithMapBasedVeto'), coneSize = cms.double(0.3), isolateAgainst = cms.string('h+'), miniAODVertexCodes = cms.vuint32(2,3), vertexIndex = cms.int32(0), particleBasedIsolation = cms.InputTag("particleBasedIsolation", "gedGsfElectrons") ), cms.PSet( isolationAlgo = cms.string('ElectronPFIsolationWithMapBasedVeto'), coneSize = cms.double(0.3), isolateAgainst = cms.string('h0'), miniAODVertexCodes = cms.vuint32(2,3), vertexIndex = cms.int32(0), particleBasedIsolation = cms.InputTag("particleBasedIsolation", "gedGsfElectrons") ), cms.PSet( isolationAlgo = cms.string('ElectronPFIsolationWithMapBasedVeto'), coneSize = cms.double(0.3), isolateAgainst = cms.string('gamma'), miniAODVertexCodes = cms.vuint32(2,3), vertexIndex = cms.int32(0), particleBasedIsolation = cms.InputTag("particleBasedIsolation", "gedGsfElectrons") ) ) ) egmGedGsfElectronPFPileUpIsolationMapBasedVeto = cms.EDProducer( "CITKPFIsolationSumProducer", srcToIsolate = cms.InputTag("gedGsfElectrons"), srcForIsolationCone = cms.InputTag('pfPileUpAllChargedParticles'), isolationConeDefinitions = cms.VPSet( cms.PSet( isolationAlgo = cms.string('ElectronPFIsolationWithMapBasedVeto'), coneSize = cms.double(0.3), isolateAgainst = cms.string('h+'), miniAODVertexCodes = cms.vuint32(2,3), vertexIndex = cms.int32(0), particleBasedIsolation = cms.InputTag("particleBasedIsolation", "gedGsfElectrons") ) ) )
StarcoderdataPython
1727781
<reponame>sasha-kantoriz/ocdsapi<filename>tests/test_records.py<gh_stars>0 from .base import storage, app from werkzeug.exceptions import NotFound def test_get(client, storage): with client.get('/api/record.json?ocid=test_ocid') as response: assert response.json['releases'][0] == storage.get_ocid('test_ocid') def test_get_not_found(client, storage): with client.get('/api/record.json?ocid=') as response: assert response.status_code == 404 def test_response_ids_only(client, storage): with client.get('/api/records.json?idsOnly=True') as response: result = response.json assert result['records'] == [{"id": 'spam_id', "ocid": 'spam_ocid'}] def test_prepare_response(client, storage): with client.get('/api/records.json') as response: result = response.json record = result['records'][0] assert 'compiledRelease' in record assert 'versionedRelease' in record assert 'releases' in record
StarcoderdataPython
37251
<reponame>timkrentz/SunTracker import sys # Override theSystemPath so it throws KeyError on gi.pygtkcompat: from twisted.python import modules modules.theSystemPath = modules.PythonPath([], moduleDict={}) # Now, when we import gireactor it shouldn't use pygtkcompat, and should # instead prevent gobject from being importable: from twisted.internet import gireactor for name in gireactor._PYGTK_MODULES: if sys.modules[name] is not None: sys.stdout.write("failure, sys.modules[%r] is %r, instead of None" % (name, sys.modules["gobject"])) sys.exit(0) try: import gobject except ImportError: sys.stdout.write("success") else: sys.stdout.write("failure: %s was imported" % (gobject.__path__,))
StarcoderdataPython
3345836
# -*- coding: utf-8 -*- """ @description: warnings @author:Yee """ from __future__ import print_function from __future__ import unicode_literals # 引入警告模块 import warnings # 我们使用 warnings 中的 warn 函数: # warn(msg, WarningType = UserWarning) def month_warining(m): if not 1 <= m <= 12: msg = "month (%d) is not between 1 and 12 " % m warnings.warn(msg, RuntimeWarning) month_warining(13) # 报警告 # 有时候我们想要忽略特定类型的警告,可以使用 warnings 的 filterwarnings 函数: # filterwarnings(action, category) # 将 action 设置为 'ignore' 便可以忽略特定类型的警告: warnings.filterwarnings(action='ignore', category=RuntimeWarning) month_warining(13) # 不报警告
StarcoderdataPython
3239552
""" Based on https://djangosnippets.org/snippets/1179/ """ import django from django.conf import settings as django_settings from django.http import HttpResponseRedirect from re import compile from django_auth_adfs.config import settings from django_auth_adfs.util import get_adfs_auth_url try: from django.urls import reverse except ImportError: # Django < 1.10 from django.core.urlresolvers import reverse try: from django.utils.deprecation import MiddlewareMixin except ImportError: # Django < 1.10 MiddlewareMixin = object LOGIN_EXEMPT_URLS = [ compile(django_settings.LOGIN_URL.lstrip('/')), compile(reverse("django_auth_adfs:login").lstrip('/')), ] if hasattr(settings, 'LOGIN_EXEMPT_URLS'): LOGIN_EXEMPT_URLS += [compile(expr) for expr in settings.LOGIN_EXEMPT_URLS] class LoginRequiredMiddleware(MiddlewareMixin): """ Middleware that requires a user to be authenticated to view any page other than LOGIN_URL. Exemptions to this requirement can optionally be specified in settings via a list of regular expressions in LOGIN_EXEMPT_URLS (which you can copy from your urls.py). Requires authentication middleware and template context processors to be loaded. You'll get an error if they aren't. """ def process_request(self, request): assert hasattr(request, 'user'), "The Login Required middleware requires" \ " authentication middleware to be installed." \ " Edit your MIDDLEWARE setting to insert" \ " 'django.contrib.auth.middlware.AuthenticationMiddleware'." \ " If that doesn't work, ensure your TEMPLATE_CONTEXT_PROCESSORS" \ " setting includes 'django.core.context_processors.auth'." if django.VERSION[:2] < (1, 10): user_authenticated = request.user.is_authenticated() else: user_authenticated = request.user.is_authenticated if not user_authenticated: path = request.path_info.lstrip('/') if not any(m.match(path) for m in LOGIN_EXEMPT_URLS): return HttpResponseRedirect(get_adfs_auth_url())
StarcoderdataPython
3368296
<reponame>oist-cnru/VCBot #!/usr/bin/env python3 # -*- coding: utf-8 -*- """ BSD 3-Clause License Copyright (c) 2020 Okinawa Institute of Science and Technology (OIST). All rights reserved. Redistribution and use in source and binary forms, with or without modification, are permitted provided that the following conditions are met: * Redistributions of source code must retain the above copyright notice, this list of conditions and the following disclaimer. * Redistributions in binary form must reproduce the above copyright notice, this list of conditions and the following disclaimer in the documentation and/or other materials provided with the distribution. * Neither the name of Willow Garage, Inc. nor the names of its contributors may be used to endorse or promote products derived from this software without specific prior written permission. THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. Author: <NAME> <<EMAIL>> Publication: <NAME>., <NAME>., & <NAME>. (2020). A hybrid human-neurorobotics approach to primary intersubjectivity via active inference. Frontiers in psychology, 11. Okinawa Institute of Science and Technology Graduate University (OIST) Cognitive Neurorobotics Research Unit (CNRU) 1919-1, Tancha, Onna, Kunigami District, Okinawa 904-0495, Japan """ import numpy as np import matplotlib.pyplot as plt class TrainingPlot(): def __init__(self, _mName, _train, _context): wW = 8 wH = 5 fig, axes = plt.subplots(nrows=2, ncols=2, figsize=(wW, wH)) fig.canvas.set_window_title('Agent {} training details'.format(_mName)) fig.subplots_adjust(wspace=0.2, hspace=0.8) for i in range (2): for j in range (2): ax = axes[i][j] ax.grid(linestyle='dotted') ax.ticklabel_format(style='sci', axis='y', scilimits=(0,0)) ax.ticklabel_format(style='sci', axis='x', scilimits=(0,0)) ax.set_xlabel('epochs') times = np.cumsum(np.ones(_train.shape[0])) times = (times - 1) * _train[0,0] axes[0][0].ticklabel_format(style='sci', axis='y', scilimits=(0,0)) axes[0][0].ticklabel_format(style='sci', axis='x', scilimits=(0,0)) titleY = 1.1 font = {'family': 'serif', 'color': 'darkred', 'weight': 'normal', 'size': 12, } axes[0][0].set_title('Posterior reconstruction error', y=titleY, fontdict=font) axes[0][0].plot(times, _train[:,2]) axes[0][1].set_title('Prior reconstruction error', y=titleY, fontdict=font) axes[0][1].plot(times, _train[:,3], color='brown') axes[1][0].set_title('Regulation error', y=titleY, fontdict=font) axes[1][0].plot(times, _train[:,4], color='darkgreen') axes[1][1].set_title('Loss (Negative ELBO)', y=titleY, fontdict=font) axes[1][1].plot(times, _train[:,5], color='darkmagenta') plt.show()
StarcoderdataPython
1666934
from cryptography.fernet import Fernet, InvalidToken from django.conf import settings class Fern: # """ # Usage: # encrypt('foo') # decrypt('CIPHERTEXT_ENCRYPTED_TEXT') # """ def __init__(self, key=None): if key: self.key = key else: self.key = settings.BETA_ENVIRONMENT def encrypt(self, message: str) -> str: message_b = message.encode('utf-8') ciphertext_b = Fernet(self.key).encrypt(message_b) return ciphertext_b.decode('utf-8') def decrypt(self, ciphertext: str) -> str: try: ciphertext_b = Fernet(self.key).decrypt(ciphertext.encode('utf-8')) return ciphertext_b.decode('utf-8') except InvalidToken: return ''
StarcoderdataPython
1629508
<filename>api/estimator/serializers.py<gh_stars>0 from rest_framework import serializers from estimator.models import LogsModel class LogsSerializer(serializers.ModelSerializer): class Meta: model = LogsModel fields = ('id', 'method', 'endpoint', 'status', 'response_time')
StarcoderdataPython
3249202
#!/usr/bin/env python import sys input = sys.stdin.readline print = sys.stdout.write if __name__ == '__main__': for _ in range(int(input())): n = int(input()) x = list(map(int, input().strip().split())) y = list(map(int, input().strip().split())) a = b = 0 for j, (zi, i) in enumerate(sorted(((xi + yi, i) for i, (xi, yi) in enumerate(zip(x, y))), reverse=True)): if j & 1: b += y[i] else: a += x[i] print(f"{a - b}\n")
StarcoderdataPython
1791548
<reponame>mbelda/GCOM # -*- coding: utf-8 -*- """ Created on Wed Feb 26 12:33:47 2020 @author: Majo """ import numpy as np iteraciones = 50 epsilon = 1e-40 def H(d): #lim delta -> 0 suma = 0 i = iteraciones delta = (1/3)**i #suma normas 1 ^d suma = 8**i * delta**2**d return suma d = 1.99 while H(d) < epsilon : d = d - 1e-10 print(d) print(d) print('Log8/log3 =', np.log(8)/np.log(3))
StarcoderdataPython
1635105
import re from typing import List from compile_md import get_md_files LECTION_FILE_REGEXP = r"lec4_(\d+).*?.md" def group_report(ids: List[int], start_id: int, end_id: int, group_name: str = "unknown"): group_ids = list(range(start_id, end_id+1)) done_count = len(list(filter(lambda x: x in ids, group_ids))) not_done_ids = list(filter(lambda x: x not in ids, group_ids)) print(f"\nОтчет по группе {group_name}") print(f"Завершено {(done_count / (end_id - start_id + 1)) * 100.0}%") print(f"Не завершены слайды: {', '.join(str(i) for i in not_done_ids)}") def main(): files = get_md_files("lection/") matches = [re.search(LECTION_FILE_REGEXP, f.name) for f in files] ids = [int(m.group(1)) for m in matches if m] group_report(ids, 1, 34, group_name="438-1") group_report(ids, 35, 69, group_name="438-2") group_report(ids, 70, 99, group_name="438-3") if __name__ == "__main__": main()
StarcoderdataPython
198815
<reponame>bperez7/moments_models import torch from collections import OrderedDict def inflate_from_2d_model(state_dict_2d, state_dict_3d, skipped_keys=None, inflated_dim=2): if skipped_keys is None: skipped_keys = [] missed_keys = [] new_keys = [] for old_key in state_dict_2d.keys(): if old_key not in state_dict_3d.keys(): missed_keys.append(old_key) for new_key in state_dict_3d.keys(): if new_key not in state_dict_2d.keys(): new_keys.append(new_key) print("Missed tensors: {}".format(missed_keys)) print("New tensors: {}".format(new_keys)) print("Following layers will be skipped: {}".format(skipped_keys)) state_d = OrderedDict() unused_layers = [k for k in state_dict_2d.keys()] uninitialized_layers = [k for k in state_dict_3d.keys()] initialized_layers = [] for key, value in state_dict_2d.items(): skipped = False for skipped_key in skipped_keys: if skipped_key in key: skipped = True break if skipped: continue new_value = value # only inflated conv's weights if key in state_dict_3d: # TODO: a better way to identify conv layer? # if 'conv.weight' in key or \ # 'conv1.weight' in key or 'conv2.weight' in key or 'conv3.weight' in key or \ # 'downsample.0.weight' in key: if value.ndimension() == 4 and 'weight' in key: value = torch.unsqueeze(value, inflated_dim) # value.unsqueeze_(inflated_dim) repeated_dim = torch.ones(state_dict_3d[key].ndimension(), dtype=torch.int) repeated_dim[inflated_dim] = state_dict_3d[key].size(inflated_dim) new_value = value.repeat(repeated_dim.tolist()) state_d[key] = new_value initialized_layers.append(key) uninitialized_layers.remove(key) unused_layers.remove(key) print("Initialized layers: {}".format(initialized_layers)) print("Uninitialized layers: {}".format(uninitialized_layers)) print("Unused layers: {}".format(unused_layers)) return state_d def convert_rgb_model_to_others(state_dict, input_channels, ks=7): new_state_dict = {} for key, value in state_dict.items(): if "conv1.weight" in key: o_c, in_c, k_h, k_w = value.shape else: o_c, in_c, k_h, k_w = 0, 0, 0, 0 if in_c == 3 and k_h == ks and k_w == ks: # average the weights and expand to all channels new_shape = (o_c, input_channels, k_h, k_w) new_value = value.mean(dim=1, keepdim=True).expand(new_shape).contiguous() else: new_value = value new_state_dict[key] = new_value return new_state_dict def convert_rgb_model_to_group(src_state_dict, target_state_dict, groups): new_state_dict = {} for key, value in target_state_dict.items(): if key in src_state_dict: if len(src_state_dict[key].shape) == 0: #skip non-parameters new_state_dict[key] = src_state_dict[key] #print ('NO DATA === %s' % (key)) continue #print (key, target_state_dict[key].shape, src_state_dict[key].shape) assert target_state_dict[key].shape[0] == groups * src_state_dict[key].shape[0] assert len(src_state_dict[key].shape) == 1 or len(src_state_dict[key].shape) == 4 #new_state_dict[key] = src_state_dict[key] if len(src_state_dict[key].shape) == 1: new_state_dict[key] = src_state_dict[key].repeat(groups) else: new_state_dict[key] = src_state_dict[key].repeat(groups, 1, 1, 1) #print (value.shape, src_state_dict[key].shape) #else: #print ('NOT COPIED ***** %s' % (key)) return new_state_dict
StarcoderdataPython
1730418
<gh_stars>100-1000 #!/usr/bin/env python # -*- coding: utf-8 -*- import json from alipay.aop.api.constant.ParamConstants import * from alipay.aop.api.domain.CaptureCreateOrder import CaptureCreateOrder class AlipayBossFncSettleCaptureCreateModel(object): def __init__(self): self._capture_create_order_list = None @property def capture_create_order_list(self): return self._capture_create_order_list @capture_create_order_list.setter def capture_create_order_list(self, value): if isinstance(value, list): self._capture_create_order_list = list() for i in value: if isinstance(i, CaptureCreateOrder): self._capture_create_order_list.append(i) else: self._capture_create_order_list.append(CaptureCreateOrder.from_alipay_dict(i)) def to_alipay_dict(self): params = dict() if self.capture_create_order_list: if isinstance(self.capture_create_order_list, list): for i in range(0, len(self.capture_create_order_list)): element = self.capture_create_order_list[i] if hasattr(element, 'to_alipay_dict'): self.capture_create_order_list[i] = element.to_alipay_dict() if hasattr(self.capture_create_order_list, 'to_alipay_dict'): params['capture_create_order_list'] = self.capture_create_order_list.to_alipay_dict() else: params['capture_create_order_list'] = self.capture_create_order_list return params @staticmethod def from_alipay_dict(d): if not d: return None o = AlipayBossFncSettleCaptureCreateModel() if 'capture_create_order_list' in d: o.capture_create_order_list = d['capture_create_order_list'] return o
StarcoderdataPython
4825238
# -*- coding: utf-8 -*- # Copyright 2018-2021 releng-tool class RelengPackage: """ a releng package A package tracks the name, options and dependencies of the package. Args: name: the name of the package Attributes: asc_file: file containing ascii-armored data to validate this package build_dir: directory for a package's buildable content build_output_dir: build output directory for the package process build_subdir: override for a package's buildable content (if applicable) cache_dir: cache directory for the package (if applicable) cache_file: cache file for the package (if applicable) def_dir: directory for the package definition deps: list of dependencies for this package devmode_ignore_cache: whether or not cache files should be ignored ext_modifiers: extension-defined modifiers (dict) extract_type: extraction type override (for extensions, if applicable) fixed_jobs: fixed job count for this specific package git_config: git config options to apply (if applicable) git_depth: git fetch depth (if applicable) git_refspecs: additional git refspecs to fetch (if applicable) git_submodules: fetch any git submodules (if applicable) git_verify_revision: verify signed git revisions has_devmode_option: whether or not the package has a devmode revision hash_file: file containing hashes to validate this package install_type: install container for the package (target, staged, etc.) is_internal: whether or not this package is an project internal package license: license(s) of the package license_files: list of files in sources holding license information name: name of the package no_extraction: whether or not this package will extract nv: name-version value of the package prefix: system root prefix override (if applicable) revision: revision to use to fetch from vcs (if applicable) site: site to acquire package assets skip_remote_config: whether or not to skip any remote configuration skip_remote_scripts: whether or not to skip any remote scripts strip_count: archive extraction strip count (if applicable) type: package type (script-based, cmake, etc.) vcs_type: vcs type of the package (git, file, etc.) version: package version (package type - common) build_defs: package-type build definitions build_env: package-type build environment overrides build_opts: package-type build option overrides conf_defs: package-type configuration definitions conf_env: package-type configuration environment overrides conf_opts: package-type configuration option overrides install_defs: package-type installation definitions install_env: package-type installation environment overrides install_opts: package-type installation option overrides (package type - autotools) autotools_autoreconf: flag to invoke autoreconf (other - python) python_interpreter: python interpreter to invoke stages with """ def __init__(self, name, version): self.name = name self.nv = '{}-{}'.format(name, version) self.version = version # (commons) self.asc_file = None self.build_dir = None self.build_subdir = None self.build_output_dir = None self.cache_dir = None self.cache_file = None self.def_dir = None self.deps = [] self.devmode_ignore_cache = None self.fixed_jobs = None self.has_devmode_option = None self.hash_file = None self.ext_modifiers = None self.extract_type = None self.install_type = None self.is_internal = None self.license = None self.license_files = None self.no_extraction = False self.prefix = None self.revision = None self.site = None self.skip_remote_config = None self.skip_remote_scripts = None self.strip_count = None self.type = None self.vcs_type = None # (package type - common) self.build_defs = None self.build_env = None self.build_opts = None self.conf_defs = None self.conf_env = None self.conf_opts = None self.install_defs = None self.install_env = None self.install_opts = None # (package type - autotools) self.autotools_autoreconf = None # (other - git) self.git_config = None self.git_depth = None self.git_refspecs = None self.git_submodules = None self.git_verify_revision = None # (other - python) self.python_interpreter = None
StarcoderdataPython
124978
<filename>project_3_genetic_algorithms_using_binear_string.py import math import time import matplotlib.pyplot as plt from random import random, randint, uniform def function_f1(x1, x2): out = x2+10**(-5)*(x2-x1)**2-1 return out def function_f2(x1, x2): out = 1/(27*math.sqrt(3))*((x1-3)**2-9)*x2**3 return out def function_f3(x1, x2): out = (1/3)*(x1-2)**3+x2-11/3 return out class Chromosome: def __init__(self, gene=''): self.pheno_x1 = 0 self.pheno_x2 = 0 self.value = 0 self.fitness = 0 self.feasible = True if gene == 'random': self.random_gene() self.update_value() while self.feasible==False: self.random_gene() self.update_value() else: self.geno = gene self.update_value() return def crossover(self, mate): pivot = randint(0, len(self.geno) - 1) gene1 = self.geno[:pivot] + mate.geno[pivot:] gene2 = mate.geno[:pivot] + self.geno[pivot:] return Chromosome(gene1), Chromosome(gene2) def mutate(self): gene = self.geno idx = randint(0, len(gene) - 1) gene = gene[:idx] + str((int(gene[idx])+1)%2) + gene[idx+1:] return Chromosome(gene) def update_value(self): x1_gene = self.geno[0:10] x2_gene = self.geno[10:18] x1_pheno = 0 x2_pheno = 0 ''' Binary code''' # for i in range(11): # x1_pheno = x1_pheno*2 + int(x1_gene[i]) # x2_pheno = x2_pheno*2 + int(x2_gene[i]) ''' Gray code ''' x1_flip = False x2_flip = False for i in range(10): x1_read = int(x1_gene[i]) if not x1_flip else (int(x1_gene[i])+1)%2 x1_pheno = x1_pheno*2 + x1_read x1_flip = True if x1_read==1 else False for i in range(8): x2_read = int(x2_gene[i]) if not x2_flip else (int(x2_gene[i])+1)%2 x2_pheno = x2_pheno*2 + x2_read x2_flip = True if x2_read==1 else False x1_pheno = x1_pheno/1024*6 x2_pheno = x2_pheno/256*math.sqrt(3) self.pheno_x1 = x1_pheno self.pheno_x2 = x2_pheno if x2_pheno<0 or abs(x1_pheno-3)>(1-x2_pheno/math.sqrt(3))*3: self.feasible = False return else: self.feasible = True if 0<=x1_pheno and x1_pheno<2: self.value = function_f1(x1_pheno,x2_pheno) elif 2<=x1_pheno and x1_pheno<4: self.value = function_f2(x1_pheno,x2_pheno) elif 4<=x1_pheno and x1_pheno<=6: self.value = function_f3(x1_pheno,x2_pheno) else: print('update_value error !') return def random_gene(self): gene = '' for i in range(18): gene = gene + str(randint(0, 1)) self.geno = gene return class Population: def __init__(self, size=64, crossover_rate=0.7, mutation_rate=0.1): self.size = size self.crossover_rate = crossover_rate self.mutation_rate = mutation_rate self.population = [] self.children = [] for i in range(size): self.population.append(Chromosome('random')) self.population = sorted(self.population, key=lambda x: x.value) return def survive(self): ''' Roulette Wheel ''' # self.population = [] # sum_fitness = sum([(400-c.value) for c in self.children]) # for i in range(self.size): # pick = uniform(0, sum_fitness) # current = 0 # for survivor in self.children: # current = current+(400-survivor.value) # if current >= pick: # self.population.extend([survivor]) # break # else: # print('ERROR~!') ''' Roulette Wheel 2 ''' self.population = [] self.children = sorted(self.children, key=lambda x: x.value) self.population.extend([self.children[0]]) self.children.remove(self.children[0]) L = len(self.children) for i in range(L): self.children[i].fitness = L - i sum_fitness = sum(range(1,L+1)) for i in range(self.size-1): pick = uniform(0, sum_fitness) current = 0 for survivor in self.children: current = current + survivor.fitness if current >= pick: self.population.extend([survivor]) self.children.remove(survivor) sum_fitness = sum_fitness - survivor.fitness break else: print('survive error !') print('i= %d pick= %f current= %f'%(i, pick, current)) ''' First (size) children survive ''' # self.population = sorted(self.children, key=lambda x: x.value)[:self.size] return def select_parents(self): if len(self.population)<2: print('select_parents error !') return None return self.population.pop(randint(0,len(self.population)-1)), self.population.pop(randint(0,len(self.population)-1)) def evolve(self): self.children = [] while (len(self.population)>0): p1, p2 = self.select_parents() self.children.extend([p1, p2]) if random() <= self.crossover_rate: c1, c2 = p1.crossover(p2) if c1.feasible: self.children.extend([c1]) if c2.feasible: self.children.extend([c2]) for idx in range(len(self.children)): if random() <= self.mutation_rate: cm = self.children[idx].mutate() if cm.feasible: self.children.extend([cm]) self.survive() self.population = sorted(self.population, key=lambda x: x.value) return def plot(self,generation=0): for i in range(self.size): plt.plot(self.population[i].pheno_x1, self.population[i].pheno_x2,'bo', markersize=2) plt.xlim(-1,7) plt.ylim(-2,4) plt.savefig('generation%03d.png'%(generation)) plt.show() return if __name__ == "__main__": maxGenerations = 100 times = 100 every_value=[] every_x1=[] every_x2=[] set_minimum = [] top_idx = -1 top_value = 1000 correct = 0 min_times = 0 Tstart = time.time() for k in range(times): P = Population(size=64, crossover_rate=0.7, mutation_rate=0.1) for i in range(1, maxGenerations + 1): # print("Generation %d: %f %f %f"%(i, P.population[0].pheno_x1, # P.population[0].pheno_x2, # P.population[0].value)) # set_minimum.append(P.population[0].value) ''' plot individual distribution ''' # P.plot(generation=i) P.evolve() ''' compute the minimum found times ''' for individual in P.population: if (individual.pheno_x1-0)**2+(individual.pheno_x2-0)**2<0.0001: min_times = min_times +1 break for individual in P.population: if (individual.pheno_x1-3)**2+(individual.pheno_x2-math.sqrt(3))**2<0.0001: min_times = min_times +1 break for individual in P.population: if (individual.pheno_x1-4)**2+(individual.pheno_x2-0)**2<0.0001: min_times = min_times +1 break Tend = time.time() ''' plot convergence figure ''' # for i in range(times): # set_minimum[i]=sum(set_minimum[i::maxGenerations])/times # plt.plot(list(range(1,maxGenerations+1)),set_minimum[:maxGenerations]) # plt.ylim(-1,-0.9) # plt.savefig('./GABinary_%d'%(P.size)) print('Find %d global minimum in total %d global minimum'%(min_times, times*3)) print('Time : %f'%(Tend-Tstart))
StarcoderdataPython
7403
# coding: utf-8 """ Isilon SDK Isilon SDK - Language bindings for the OneFS API # noqa: E501 OpenAPI spec version: 3 Contact: <EMAIL> Generated by: https://github.com/swagger-api/swagger-codegen.git """ import pprint import re # noqa: F401 import six class AuthAccessAccessItemFile(object): """NOTE: This class is auto generated by the swagger code generator program. Do not edit the class manually. """ """ Attributes: swagger_types (dict): The key is attribute name and the value is attribute type. attribute_map (dict): The key is attribute name and the value is json key in definition. """ swagger_types = { 'group': 'str', 'mode': 'str', 'owner': 'str', 'relevant_mode': 'str' } attribute_map = { 'group': 'group', 'mode': 'mode', 'owner': 'owner', 'relevant_mode': 'relevant_mode' } def __init__(self, group=None, mode=None, owner=None, relevant_mode=None): # noqa: E501 """AuthAccessAccessItemFile - a model defined in Swagger""" # noqa: E501 self._group = None self._mode = None self._owner = None self._relevant_mode = None self.discriminator = None if group is not None: self.group = group if mode is not None: self.mode = mode if owner is not None: self.owner = owner if relevant_mode is not None: self.relevant_mode = relevant_mode @property def group(self): """Gets the group of this AuthAccessAccessItemFile. # noqa: E501 Specifies the group name or ID for the file. # noqa: E501 :return: The group of this AuthAccessAccessItemFile. # noqa: E501 :rtype: str """ return self._group @group.setter def group(self, group): """Sets the group of this AuthAccessAccessItemFile. Specifies the group name or ID for the file. # noqa: E501 :param group: The group of this AuthAccessAccessItemFile. # noqa: E501 :type: str """ self._group = group @property def mode(self): """Gets the mode of this AuthAccessAccessItemFile. # noqa: E501 Specifies the mode bits on the file. # noqa: E501 :return: The mode of this AuthAccessAccessItemFile. # noqa: E501 :rtype: str """ return self._mode @mode.setter def mode(self, mode): """Sets the mode of this AuthAccessAccessItemFile. Specifies the mode bits on the file. # noqa: E501 :param mode: The mode of this AuthAccessAccessItemFile. # noqa: E501 :type: str """ self._mode = mode @property def owner(self): """Gets the owner of this AuthAccessAccessItemFile. # noqa: E501 Specifies the name or ID of the file owner. # noqa: E501 :return: The owner of this AuthAccessAccessItemFile. # noqa: E501 :rtype: str """ return self._owner @owner.setter def owner(self, owner): """Sets the owner of this AuthAccessAccessItemFile. Specifies the name or ID of the file owner. # noqa: E501 :param owner: The owner of this AuthAccessAccessItemFile. # noqa: E501 :type: str """ self._owner = owner @property def relevant_mode(self): """Gets the relevant_mode of this AuthAccessAccessItemFile. # noqa: E501 Specifies the mode bits that are related to the user. # noqa: E501 :return: The relevant_mode of this AuthAccessAccessItemFile. # noqa: E501 :rtype: str """ return self._relevant_mode @relevant_mode.setter def relevant_mode(self, relevant_mode): """Sets the relevant_mode of this AuthAccessAccessItemFile. Specifies the mode bits that are related to the user. # noqa: E501 :param relevant_mode: The relevant_mode of this AuthAccessAccessItemFile. # noqa: E501 :type: str """ self._relevant_mode = relevant_mode def to_dict(self): """Returns the model properties as a dict""" result = {} for attr, _ in six.iteritems(self.swagger_types): value = getattr(self, attr) if isinstance(value, list): result[attr] = list(map( lambda x: x.to_dict() if hasattr(x, "to_dict") else x, value )) elif hasattr(value, "to_dict"): result[attr] = value.to_dict() elif isinstance(value, dict): result[attr] = dict(map( lambda item: (item[0], item[1].to_dict()) if hasattr(item[1], "to_dict") else item, value.items() )) else: result[attr] = value return result def to_str(self): """Returns the string representation of the model""" return pprint.pformat(self.to_dict()) def __repr__(self): """For `print` and `pprint`""" return self.to_str() def __eq__(self, other): """Returns true if both objects are equal""" if not isinstance(other, AuthAccessAccessItemFile): return False return self.__dict__ == other.__dict__ def __ne__(self, other): """Returns true if both objects are not equal""" return not self == other
StarcoderdataPython
4816785
N = int(input()) C = N // 100 if N % 100 == 0: print(C) else: print(C + 1)
StarcoderdataPython
27754
from django.db import models # Description of an object in the arena class Entity(models.Model): entityId = models.AutoField(primary_key=True) entityClass = models.CharField(max_length=30) entityName = models.CharField(max_length=30, null=True, blank=True) entityCategory = models.CharField(max_length=30, null=True, blank=True) entityColor = models.CharField(max_length=30, null=True, blank=True) entityWeight = models.FloatField(default=None, null=True, blank=True) entitySize = models.FloatField(default=None, null=True, blank=True) entityIsRoom = models.BooleanField(default=False, blank=True) entityIsWaypoint = models.BooleanField(default=False, blank=True) entityIsContainer = models.BooleanField(default=False, blank=True) entityGotPosition = models.BooleanField(default=False, blank=True) # The position of the object in space if available entityPosX = models.FloatField(default=None, null=True, blank=True) entityPosY = models.FloatField(default=None, null=True, blank=True) entityPosZ = models.FloatField(default=None, null=True, blank=True) entityPosYaw = models.FloatField(default=None, null=True, blank=True) entityPosPitch = models.FloatField(default=None, null=True, blank=True) entityPosRoll = models.FloatField(default=None, null=True, blank=True) # The position to reach to be able to catch the object entityWaypointX = models.FloatField(default=None, null=True, blank=True) entityWaypointY = models.FloatField(default=None, null=True, blank=True) entityWaypointYaw = models.FloatField(default=None, null=True, blank=True) # Just for serializer depth_waypoint = models.IntegerField(null=True, blank=True) depth_position = models.IntegerField(null=True, blank=True) entityContainer = models.ForeignKey('self', on_delete=models.SET_NULL, null=True, blank=True) def __str__(self): return self.entityClass + " - " + str(self.entityId) # Description of an object in the arena class People(models.Model): peopleId = models.AutoField(primary_key=True) peopleRecognitionId = models.IntegerField(null=True, blank=True, unique=True) peopleName = models.CharField(max_length=30, null=True, blank=True) peopleAge = models.IntegerField(null=True, blank=True) peopleColor = models.CharField(max_length=30, null=True, blank=True) peoplePose = models.CharField(max_length=30, null=True, blank=True) peoplePoseAccuracy = models.FloatField(default=None, null=True, blank=True) peopleEmotion = models.CharField(max_length=30, null=True, blank=True) peopleEmotionAccuracy = models.FloatField(default=None, null=True, blank=True) peopleGender = models.CharField(max_length=10, null=True, blank=True) peopleGenderAccuracy = models.FloatField(default=None, null=True, blank=True) peopleIsOperator = models.BooleanField(default=False) def __str__(self): return str(self.peopleId) + "(" + str( self.peopleRecognitionId) + ") - " + self.peopleGender + " - " + self.peopleColor + " - " + self.peoplePose
StarcoderdataPython
1759899
<filename>foxylib/tools/network/http/formdata_tool.py import io import os from foxylib.tools.file.file_tool import FileTool class FormdataTool: @classmethod def filepath2item(cls, filepath): # https://stackoverflow.com/a/35712344 bytes = FileTool.filepath2bytes(filepath) basename = os.path.basename(filepath) return io.BytesIO(bytes), basename
StarcoderdataPython
3362767
<gh_stars>1-10 from datetime import datetime from typing import List, Dict import src.dfa as dfa from src.api.weather import WeatherAPI, ResponseStatus, WeatherDescription, WeatherTime from src.parse.intent import Intent, Command class GetCityWeatherState(dfa.BaseState): _disable_message = "Модуль погоды ушёл в отпуск и сейчас недоступен." __unavailable_message = "Сервер сейчас недоступен, попробуйте позже." __unknown_city_message = "Я не знаю такого города: {}" __today_weather_message = "Сейчас там {}. Температура {}°C, но ощущается как {}°C. Ветер дует со скоростью {} м/с." __tomorrow_weather_message = ( "Завтра там будет {}. Температура {}°C, но ощущаться будет как {}°C. Ветер будет дуть со скоростью {} м/с." ) __next_week_forecast = "А вот прогноз на следующую неделю." __forecast_message = ( "{} там будет {}. Температура {}°C, но ощущаться будет как {}°C. Ветер будет дуть со скоростью {} м/с." ) __weekdays = ["В понедельник", "Во вторник", "В среду", "В четверг", "В пятницу", "В субботу", "В воскресенье"] def __init__(self): super().__init__() self._command_handler[Command.WEATHER] = self.handle_weather_command self.__weather_api = WeatherAPI() if not self.__weather_api.enabled: self.move = self._disable_move self.__history: Dict[int, Intent] = {} @property def is_technical_state(self) -> bool: return True def __prepare_message(self, weather_descriptions: List[WeatherDescription], time: WeatherTime) -> str: if time == WeatherTime.TODAY: desc = weather_descriptions[0] return self.__today_weather_message.format(desc.weather, desc.temperature, desc.feels_like, desc.wind_speed) elif time == WeatherTime.TOMORROW: desc = weather_descriptions[1] return self.__tomorrow_weather_message.format( desc.weather, desc.temperature, desc.feels_like, desc.wind_speed ) else: desc = weather_descriptions[0] message = [ self.__today_weather_message.format(desc.weather, desc.temperature, desc.feels_like, desc.wind_speed), self.__next_week_forecast, ] today_weekday = datetime.today().weekday() for i, desc in enumerate(weather_descriptions[1:]): weekday = self.__weekdays[(today_weekday + 1 + i) % len(self.__weekdays)] message.append( self.__forecast_message.format( weekday, desc.weather, desc.temperature, desc.feels_like, desc.wind_speed ) ) return "\n".join(message) def handle_weather_command(self, intent: Intent, user_id: int) -> dfa.MoveResponse: if "city" in intent.parameters: api_response = self.__weather_api.get_weather(intent.parameters["city"]) next_state = dfa.StartState() if api_response.status == ResponseStatus.UNAVAILABLE: message = self.__unavailable_message elif api_response.status == ResponseStatus.NOT_FOUND: message = self.__unknown_city_message.format(intent.parameters["city"]) else: desc = api_response.weather_description if "time" in intent.parameters: time = intent.parameters["time"] elif user_id in self.__history: time = self.__history[user_id].parameters["time"] else: time = WeatherTime.TODAY message = self.__prepare_message(desc, time) return dfa.MoveResponse(next_state, message) if "time" in intent.parameters: self.__history[user_id] = intent return dfa.MoveResponse(dfa.AskCityState(), None)
StarcoderdataPython