id
stringlengths
1
7
text
stringlengths
6
1.03M
dataset_id
stringclasses
1 value
1730185
<reponame>LukeSkywalker92/heuslertools from heuslertools.tools.measurement import Measurement import xrayutilities as xu import warnings import numpy as np class RSMMeasurement(Measurement): """Object representing rsm measurement. Parameters ---------- file : str path of xrdml file. Attributes ---------- en : str Energy of xrays. wavelength : type wavelength of xrays. resol : float resolution in qz. """ def __init__(self, file, material=None, geometry='hi_lo', beam_direction=None, surface_normale=None, reflex=None): self.material = material self.geometry = geometry self.beam_direction = beam_direction self.surface_normale = surface_normale self.reflex = reflex if any(elem is not None for elem in [material, geometry, beam_direction, surface_normale, reflex]): self._create_experiment() super().__init__(file, "") def _load_data(self): data = {} data['scanmot'], data['Omega'], data['2Theta'], data['Chi'], data['Phi'], data['psd'] = xu.io.getxrdml_scan(self.file, 'om', 'tt', 'c', 'p') return data def _generate_names(self): for name in self.data: self.names[name] = {"short_name": name, "unit": "a.u."} def _create_experiment(self): self.hxrd = xu.HXRD(self.material.Q(self.beam_direction), self.material.Q(self.surface_normale), geometry=self.geometry) def _get_nominal_angle(self, axis): angles = {} [angles['Omega'], angles['Chi'], angles['Phi'], angles['2Theta']] = self.hxrd.Q2Ang(self.material.Q(self.reflex)) return angles[axis] def _get_substrate_peak(self): # anggridder = xu.FuzzyGridder2D(500, 500) # anggridder(self.data['Omega'], self.data['2Theta'], self.data['psd']) # angINT = xu.maplog(anggridder.data.transpose(), 10, 0) # return anggridder.xaxis[np.unravel_index(angINT.argmax(), angINT.shape)[0]], anggridder.yaxis[np.unravel_index(angINT.argmax(), angINT.shape)[1]] threshold = 10**int(np.log10(self.data['psd'].max())) max_values = np.where(self.data['psd'] > threshold) return np.mean(self.data['Omega'][max_values]), np.mean(self.data['2Theta'][max_values]) def get_angle_data(self, size=300, dynamic_range=10): anggridder = xu.FuzzyGridder2D(300, 300) anggridder(self.data['Omega'], self.data['2Theta'], self.data['psd']) angINT = xu.maplog(anggridder.data.transpose(), dynamic_range, 0) ticks = [] for i in range(round(dynamic_range)+1): ticks.append(i) return anggridder, angINT, ticks def get_q_data(self, size=300, dynamic_range=10, om_sub=None, tt_sub=None): sub_peak = self._get_substrate_peak() if om_sub == None: om_sub = sub_peak[0] if tt_sub == None: tt_sub = sub_peak[1] #om_sub, tt_sub = self._get_substrate_peak() qx, qy, qz = self.hxrd.Ang2Q(self.data['Omega'], self.data['2Theta'], delta=[om_sub - self._get_nominal_angle('Omega'), tt_sub - self._get_nominal_angle('2Theta')]) qgridder = xu.FuzzyGridder2D(size, size) qgridder(qy, qz, self.data['psd']) qINT = xu.maplog(qgridder.data.transpose(), dynamic_range, 0) ticks = [] for i in range(round(dynamic_range)+1): ticks.append(i) return qgridder, qINT, ticks def get_hkl_data(self, size=300, dynamic_range=10, om_sub=None, tt_sub=None): sub_peak = self._get_substrate_peak() if om_sub == None: om_sub = sub_peak[0] if tt_sub == None: tt_sub = sub_peak[1] #om_sub, tt_sub = self._get_substrate_peak() h, k, l = self.hxrd.Ang2HKL(self.data['Omega'], self.data['2Theta'], delta=[om_sub - self._get_nominal_angle('Omega'), tt_sub - self._get_nominal_angle('2Theta')], mat=self.material) hklgridder = xu.FuzzyGridder2D(size, size) hklgridder(h, l, self.data['psd']) hklINT = xu.maplog(hklgridder.data.transpose(), dynamic_range, 0) ticks = [] for i in range(round(dynamic_range)+1): ticks.append(i) return hklgridder, hklINT, ticks
StarcoderdataPython
1618352
import logging from rest_framework.permissions import IsAuthenticated from rest_framework.response import Response from helium.common.views.views import HeliumAPIView from helium.planner.models import Course, CourseSchedule from helium.planner.schemas import CourseScheduleDetailSchema from helium.planner.serializers.eventserializer import EventSerializer from helium.planner.services import coursescheduleservice __author__ = "<NAME>" __copyright__ = "Copyright 2019, Helium Edu" __version__ = "1.4.38" logger = logging.getLogger(__name__) class CourseScheduleAsEventsResourceView(HeliumAPIView): """ get: Return all course schedules as a list of event instances. """ permission_classes = (IsAuthenticated,) schema = CourseScheduleDetailSchema() def get(self, request, *args, **kwargs): user = self.request.user course = Course.objects.get(pk=self.kwargs['course']) course_schedules = CourseSchedule.objects.for_user(user.pk).for_course(course.pk) events = coursescheduleservice.course_schedules_to_events(course, course_schedules) serializer = EventSerializer(events, many=True) return Response(serializer.data)
StarcoderdataPython
3326964
import cv2 import numpy as np import os import tensorflow as tf import sys import skimage import json import datetime import time import time import argparse def reframe_box_masks_to_image_masks(box_masks, boxes, image_height, image_width): """Transforms the box masks back to full image masks. Embeds masks in bounding boxes of larger masks whose shapes correspond to image shape. Args: box_masks: A tf.float32 tensor of size [num_masks, mask_height, mask_width]. boxes: A tf.float32 tensor of size [num_masks, 4] containing the box corners. Row i contains [ymin, xmin, ymax, xmax] of the box corresponding to mask i. Note that the box corners are in normalized coordinates. image_height: Image height. The output mask will have the same height as the image height. image_width: Image width. The output mask will have the same width as the image width. Returns: A tf.float32 tensor of size [num_masks, image_height, image_width]. """ # TODO(rathodv): Make this a public function. def reframe_box_masks_to_image_masks_default(): """The default function when there are more than 0 box masks.""" def transform_boxes_relative_to_boxes(boxes, reference_boxes): boxes = tf.reshape(boxes, [-1, 2, 2]) min_corner = tf.expand_dims(reference_boxes[:, 0:2], 1) max_corner = tf.expand_dims(reference_boxes[:, 2:4], 1) transformed_boxes = (boxes - min_corner) / (max_corner - min_corner) return tf.reshape(transformed_boxes, [-1, 4]) box_masks_expanded = tf.expand_dims(box_masks, axis=3) num_boxes = tf.shape(box_masks_expanded)[0] unit_boxes = tf.concat( [tf.zeros([num_boxes, 2]), tf.ones([num_boxes, 2])], axis=1) reverse_boxes = transform_boxes_relative_to_boxes(unit_boxes, boxes) return tf.image.crop_and_resize( image=box_masks_expanded, boxes=reverse_boxes, box_ind=tf.range(num_boxes), crop_size=[image_height, image_width], extrapolation_value=0.0) image_masks = tf.cond( tf.shape(box_masks)[0] > 0, reframe_box_masks_to_image_masks_default, lambda: tf.zeros([0, image_height, image_width, 1], dtype=tf.float32)) return tf.squeeze(image_masks, axis=3) def main(args): # PATH_TO_FROZEN_GRAPH = '/home/apptech/Downloads/ssdlite_mobilenet_v2_coco_2018_05_09/frozen_inference_graph.pb' PATH_TO_FROZEN_GRAPH=args.PATH_TO_FROZEN_GRAPH # f = open("/home/apptech/apptech_tf_models/label.json") f = open(args.js_file) labels=json.loads(f.read()) # List of the strings that is used to add correct label for each box. # labels={1:'heavy_machine'} detection_graph = tf.Graph() with detection_graph.as_default(): od_graph_def = tf.GraphDef() with tf.gfile.GFile(PATH_TO_FROZEN_GRAPH, 'rb') as fid: serialized_graph = fid.read() od_graph_def.ParseFromString(serialized_graph) tf.import_graph_def(od_graph_def, name='') with tf.Session() as sess: # Get handles to input and output tensors ops = tf.get_default_graph().get_operations() all_tensor_names = {output.name for op in ops for output in op.outputs} tensor_dict = {} for key in [ 'num_detections', 'detection_boxes', 'detection_scores', 'detection_classes', 'detection_masks' ]: tensor_name = key + ':0' if tensor_name in all_tensor_names: tensor_dict[key] = tf.get_default_graph().get_tensor_by_name( tensor_name) if 'detection_masks' in tensor_dict: # The following processing is only for single image detection_boxes = tf.squeeze(tensor_dict['detection_boxes'], [0]) detection_masks = tf.squeeze(tensor_dict['detection_masks'], [0]) # Reframe is required to translate mask from box coordinates to image coordinates and fit the image size. real_num_detection = tf.cast(tensor_dict['num_detections'][0], tf.int32) detection_boxes = tf.slice(detection_boxes, [0, 0], [real_num_detection, -1]) detection_masks = tf.slice(detection_masks, [0, 0, 0], [real_num_detection, -1, -1]) detection_masks_reframed = reframe_box_masks_to_image_masks( detection_masks, detection_boxes, image.shape[0], image.shape[1]) detection_masks_reframed = tf.cast( tf.greater(detection_masks_reframed, 0.5), tf.uint8) # Follow the convention by adding back the batch dimension tensor_dict['detection_masks'] = tf.expand_dims(detection_masks_reframed, 0) image_tensor = tf.get_default_graph().get_tensor_by_name('image_tensor:0') # cam=cv2.VideoCapture(0) cam=cv2.VideoCapture(args.cam_dir) # height, width = int(cam.get(3)),int(cam.get(4)) # fps = cam.get(cv2.CAP_PROP_FPS) # fourcc = cv2.VideoWriter_fourcc(*'XVID') # out = cv2.VideoWriter(video_save_path, fourcc, fps, 920, 1080)) fps_time = 0 cnt=0 while True: success,image = cam.read() if not success: break # image=cv2.resize(image,(1920,1080),interpolation=cv2.INTER_AREA) image_h = image.shape[0] image_w = image.shape[1] image = cv2.cvtColor(image, cv2.COLOR_BGR2RGB) output_dict = sess.run(tensor_dict,feed_dict={image_tensor: np.expand_dims(image, 0)}) # all outputs are float32 numpy arrays, so convert types as appropriate output_dict['num_detections'] = int(output_dict['num_detections'][0]) output_dict['detection_classes'] = output_dict[ 'detection_classes'][0].astype(np.uint8) output_dict['detection_boxes'] = output_dict['detection_boxes'][0] output_dict['detection_scores'] = output_dict['detection_scores'][0] if 'detection_masks' in output_dict: output_dict['detection_masks'] = output_dict['detection_masks'][0] image=cv2.cvtColor(image, cv2.COLOR_RGB2BGR) for i, score in enumerate(output_dict['detection_scores']): if score >0.8: classes=labels[str(output_dict['detection_classes'][i])] print(classes) ymin, xmin, ymax, xmax = tuple(output_dict['detection_boxes'][i].tolist()) # print(ymin, xmin, ymax, xmax) ymin = int(ymin * image_h) xmin = int(xmin * image_w) ymax = int(ymax * image_h) xmax = int(xmax * image_w) cv2.rectangle(image,(xmin,ymin),(xmax,ymax),(0,255,0),2) # cv2.putText(image, classes, (xmin,ymax+10),cv2.FONT_HERSHEY_SIMPLEX, 0.5, (0, 255, 0), 2) cnt+=1 # out.write(frame) cv2.putText(image, "FPS: %f" % (1.0 / (time.time() - fps_time)), (10, 10), cv2.FONT_HERSHEY_SIMPLEX, 0.5, (0, 255, 0), 2) fps_time = time.time() show_image = cv2.resize(image, (1920,1080)) cv2.imshow('win', show_image) pressed_key = cv2.waitKey(2) if pressed_key == ord('q'): break if __name__ == '__main__': parser = argparse.ArgumentParser(description='Process some integers.') parser.add_argument('PATH_TO_FROZEN_GRAPH', type=str, help='PATH_TO_FROZEN_GRAPH') parser.add_argument('cam_dir', default= 0, help='path to videos/cams') parser.add_argument('js_file', type=str, help='path to label.json') args = parser.parse_args() main(args)
StarcoderdataPython
4825479
def sortiraj(karta): karta = karta[:-1] if karta in "7 8 9 10".split(): return int(karta)-10 elif karta == "B": return 2 elif karta == "D": return 3 elif karta == "K": return 4 elif karta == "A": return 11 def vrijednost(karta, adut): if karta[-1] == adut: karta = karta[:-1] if karta in ["7", "8"]: return int(karta) / 100 elif karta == "9": return 14 elif karta == "10": return 10 elif karta == "B": return 20 elif karta == "D": return 3 elif karta == "K": return 4 elif karta == "A": return 11 else: karta = karta[:-1] if karta in "7 8 9".split(): return int(karta) / 100 elif karta == "10": return 10 elif karta == "B": return 2 elif karta == "D": return 3 elif karta == "K": return 4 elif karta == "A": return 11 class Igrac(): def __init__(self, ime, ai, karte): self.ime = ime self.ai = ai self.karte = karte self.prazne = 0 self.bodovi = 0 self.ukupno = 0 def sortiraj_karte(self): [self.karte.remove("prazno") for i in range(self.prazne)] pik = [karta for karta in self.karte if '♠' in karta] herc = [karta for karta in self.karte if '♥' in karta] kara = [karta for karta in self.karte if '♦' in karta] tref = [karta for karta in self.karte if '♣' in karta] for boja in [pik, herc, kara, tref]: boja.sort(key=sortiraj) self.karte = pik + herc + kara + tref + self.prazne * ["prazno"] def baci_kartu(self, karta): print(self.ime, self.prazne, self.karte) self.karte[self.karte.index(karta)] = "prazno" self.prazne += 1 self.sortiraj_karte() print(self.ime, self.prazne, self.karte) return karta def boje(self): boje = [karta[-1] for karta in self.karte if karta != "prazno"] return list(dict.fromkeys(boje)) def vrati_karte(self): return self.karte[:8-self.prazne]
StarcoderdataPython
1626408
<filename>clmm/cosmology/cluster_toolkit.py # Functions to model halo profiles import numpy as np import warnings from astropy import units from astropy.cosmology import LambdaCDM, FlatLambdaCDM from .. constants import Constants as const from .parent_class import CLMMCosmology __all__ = [] class AstroPyCosmology(CLMMCosmology): def __init__(self, **kwargs): super(AstroPyCosmology, self).__init__(**kwargs) # this tag will be used to check if the cosmology object is accepted by the modeling self.backend = 'ct' assert isinstance(self.be_cosmo, LambdaCDM) def _init_from_cosmo(self, be_cosmo): assert isinstance(be_cosmo, LambdaCDM) self.be_cosmo = be_cosmo def _init_from_params(self, H0, Omega_b0, Omega_dm0, Omega_k0): Om0 = Omega_b0+Omega_dm0 Ob0 = Omega_b0 Ode0 = 1.0-Om0-Omega_k0 self.be_cosmo = LambdaCDM(H0=H0, Om0=Om0, Ob0=Ob0, Ode0=Ode0) def _set_param(self, key, value): raise NotImplementedError("Astropy do not support changing parameters") def _get_param(self, key): if key == "Omega_m0": return self.be_cosmo.Om0 elif key == "Omega_b0": return self.be_cosmo.Ob0 elif key == "Omega_dm0": return self.be_cosmo.Odm0 elif key == "Omega_k0": return self.be_cosmo.Ok0 elif key == 'h': return self.be_cosmo.H0.to_value()/100.0 elif key == 'H0': return self.be_cosmo.H0.to_value() else: raise ValueError(f"Unsupported parameter {key}") def get_Omega_m(self, z): return self.be_cosmo.Om(z) def get_E2Omega_m(self, z): return self.be_cosmo.Om(z)*(self.be_cosmo.H(z)/self.be_cosmo.H0)**2 def eval_da_z1z2(self, z1, z2): return self.be_cosmo.angular_diameter_distance_z1z2(z1, z2).to_value(units.Mpc) def eval_sigma_crit(self, z_len, z_src): if np.any(np.array(z_src)<=z_len): warnings.warn(f'Some source redshifts are lower than the cluster redshift. Returning Sigma_crit = np.inf for those galaxies.') # Constants clight_pc_s = const.CLIGHT_KMS.value*1000./const.PC_TO_METER.value gnewt_pc3_msun_s2 = const.GNEWT.value*const.SOLAR_MASS.value/const.PC_TO_METER.value**3 d_l = self.eval_da_z1z2(0, z_len) d_s = self.eval_da_z1z2(0, z_src) d_ls = self.eval_da_z1z2(z_len, z_src) beta_s = np.maximum(0., d_ls/d_s) return clight_pc_s**2/(4.0*np.pi*gnewt_pc3_msun_s2)*1/d_l*np.divide(1., beta_s)*1.0e6
StarcoderdataPython
18804
<reponame>klarman-cell-observatory/cirrocumulus-app-engine import os import sys sys.path.append('lib') from flask import Flask, send_from_directory import cirrocumulus from cirrocumulus.cloud_firestore_native import CloudFireStoreNative from cirrocumulus.api import blueprint from cirrocumulus.envir import CIRRO_AUTH_CLIENT_ID, CIRRO_AUTH, CIRRO_DATABASE, CIRRO_DATASET_PROVIDERS from cirrocumulus.google_auth import GoogleAuth from cirrocumulus.no_auth import NoAuth from cirrocumulus.util import add_dataset_providers client_path = os.path.join(cirrocumulus.__path__[0], 'client') # If `entrypoint` is not defined in app.yaml, App Engine will look for an app # called `app` in `main.py`. app = Flask(__name__, static_folder=client_path, static_url_path='') app.register_blueprint(blueprint, url_prefix='/api') @app.route('/') def root(): return send_from_directory(client_path, "index.html") if os.environ.get(CIRRO_AUTH_CLIENT_ID) is not None: app.config[CIRRO_AUTH] = GoogleAuth(os.environ.get(CIRRO_AUTH_CLIENT_ID)) else: app.config[CIRRO_AUTH] = NoAuth() app.config[CIRRO_DATABASE] = CloudFireStoreNative() os.environ[CIRRO_DATASET_PROVIDERS] = ','.join(['cirrocumulus.zarr_dataset.ZarrDataset', 'cirrocumulus.parquet_dataset.ParquetDataset']) add_dataset_providers() if __name__ == '__main__': app.run(host='127.0.0.1', port=5000, debug=True)
StarcoderdataPython
133383
from ScopeFoundry.data_browser import DataBrowser, HyperSpectralBaseView import numpy as np class HyperSpecNPZView(HyperSpectralBaseView): name = 'hyperspec_npz' def is_file_supported(self, fname): return "_spec_scan.npz" in fname def load_data(self, fname): self.dat = np.load(fname) self.spec_map = self.dat['spec_map'] self.integrated_count_map = self.dat['integrated_count_map'] self.hyperspec_data = self.spec_map self.display_image = self.integrated_count_map self.spec_x_array = self.dat['wls'] def scan_specific_setup(self): self.spec_plot.setLabel('left', 'Intensity', units='counts') self.spec_plot.setLabel('bottom', 'Wavelength', units='nm') def spectral_median(spec,wls, count_min=200): int_spec = np.cumsum(spec) total_sum = int_spec[-1] if total_sum > count_min: pos = int_spec.searchsorted( 0.5*total_sum) wl = wls[pos] else: wl = np.NaN return wl class HyperSpecSpecMedianNPZView(HyperSpectralBaseView): name = 'hyperspec_spec_median_npz' def is_file_supported(self, fname): return "_spec_scan.npz" in fname def load_data(self, fname): self.dat = np.load(fname) self.spec_map = self.dat['spec_map'] self.wls = self.dat['wls'] self.integrated_count_map = self.dat['integrated_count_map'] self.spec_median_map = np.apply_along_axis(spectral_median, 2, self.spec_map[:,:,:], self.wls, 0) self.hyperspec_data = self.spec_map self.display_image = self.spec_median_map self.spec_x_array = self.wls def scan_specific_setup(self): self.spec_plot.setLabel('left', 'Intensity', units='counts') self.spec_plot.setLabel('bottom', 'Wavelength', units='nm') if __name__ == '__main__': import sys app = DataBrowser(sys.argv) app.load_view(HyperSpecNPZView(app)) sys.exit(app.exec_())
StarcoderdataPython
4842911
<reponame>CITS5206/Precision-Farming<gh_stars>1-10 import csv import datetime import re from typing import final # Current datetime datetoday=str(datetime.date.today()) sensortextpath='./Archive/Code/Data_Reader/Textfile/Dualemdata'+datetoday+'.txt' gpstextpath='./Archive/Code/Data_Reader/Textfile/GPSdata'+datetoday+'.txt' csvpath= './Archive/Code/Data_Reader/CSVfile/' class creatCSVfile: # This function is used to create the csv file for GPS and sensor using the text file that was generated in reader class # reads the input values from both txt file and store them in seperate list # The sensor data has single row value for csv in 4 rows of txt file. so seperate if condition check for every 4 values and append it in one list # Once the list is created using csv library the csv file is generarted with header # 2 csv files for sensor and gps and 1 csv file with metadata will be created in CSV file path # All csv file will have timestamp attached to file name def readtxtfile(self): with open(sensortextpath, 'r') as sensor_file: sensor_list=[] sensor_data=sensor_file.readlines() for i in sensor_data: sensor_list.append(i.strip().replace('[','').replace(']','').replace("'",'').split(',')) data_list=[] for i in range(0,len(sensor_list)): if sensor_list[i][0] =='H': c=sensor_list[i][1:] + sensor_list[i+1][2:] + sensor_list[i+2][1:] + sensor_list[i+3][1:] data_list.append(c) # Created the CSV file for sensor data with open(csvpath+'DUALEMdata'+datetoday+'.csv', 'w') as out_file: writer = csv.writer(out_file) writer.writerow(('Timestamp [HhMmSs]', 'HCP conductivity of 0.5m array [mS/m]', 'HCP inphase of 0.5m array [ppt]', 'PRP conductivity of 0.5m array [mS/m]','PRP inphase of 0.5m array [ppt]', 'HCP conductivity of 1m array [mS/m]', 'HCP inphase of 1m array [ppt]', 'PRP conductivity of 1m array [mS/m]', 'PRP inphase of 1m array [ppt]', 'Voltage [V]' ,'Temperature [deg]', 'Pitch [deg]', 'Roll [deg]', 'Acceleration X [gal]', 'Acceleration Y [gal]', 'Acceleration Z [gal]', 'Magnetic field X [nT]', 'Magnetic field Y [nT]', 'Magnetic field Z [nT]', 'Temperature [deg]')) writer.writerows(data_list) # Reads the GPS txt file generates from program with open(gpstextpath,'r') as gps_file: gps_list=[] gps_data=gps_file.readlines() for i in range(len(gps_data)): if i%2 != 0 : temp = gps_data[i].strip().split(',') gps_list.append(temp[0].split(' ')) # Creates CSV file to folder with open(csvpath+'GPSdata'+ datetoday +'.csv', 'w') as out_file: writer = csv.writer(out_file) writer.writerow(('Latitute','Lognigtute','TimeStamp')) writer.writerows(gps_list) final_list=[] # loop that appends two list and creates the list with both values for i in range(10): new_list=[] new_list.append(gps_list[i][0]) new_list.append(gps_list[i][1]) for j in data_list[i]: new_list.append(j) final_list.append(new_list) # Creates the meta data csv with open(csvpath+'MetaData'+datetoday+'.csv','w') as outfile: writer = csv.writer(outfile) writer.writerow(('Latitute','Lognigtute','Timestamp [HhMmSs]', 'HCP conductivity of 0.5m array [mS/m]', 'HCP inphase of 0.5m array [ppt]', 'PRP conductivity of 0.5m array [mS/m]','PRP inphase of 0.5m array [ppt]', 'HCP conductivity of 1m array [mS/m]', 'HCP inphase of 1m array [ppt]', 'PRP conductivity of 1m array [mS/m]', 'PRP inphase of 1m array [ppt]', 'Voltage [V]' ,'Temperature [deg]', 'Pitch [deg]', 'Roll [deg]', 'Acceleration X [gal]', 'Acceleration Y [gal]', 'Acceleration Z [gal]', 'Magnetic field X [nT]', 'Magnetic field Y [nT]', 'Magnetic field Z [nT]', 'Temperature [deg]')) writer.writerows(final_list) temp = creatCSVfile() temp.readtxtfile()
StarcoderdataPython
1730349
from matplotlib import pyplot as plt import numpy as np results = np.load("feedforwardtimings.npy") #Raw Timings Plot Feedforward plt.figure() plt.suptitle("Feedforward", fontsize=24, y=1.05) plt.subplot(2,2,1) plt.title("Timing With Ten by Ten Sized Matrices") plt.plot(results[:-1,0]) plt.scatter([5],results[-1:,0]) plt.xticks(range(-1,7),["","1", "2", "4", "8", "16", "GPU", ""]) plt.xlabel("Number of threads (or GPU)") plt.ylabel("Seconds to compute one calculation") plt.subplot(2,2,2) plt.title("Timing With a Hundred by Hundred Sized Matrices") plt.plot(results[:-1,1]) plt.scatter([5],results[-1:,1]) plt.xticks(range(-1,7),["","1", "2", "4", "8", "16", "GPU", ""]) plt.xlabel("Number of threads (or GPU)") plt.ylabel("Seconds to compute one calculation") plt.subplot(2,2,3) plt.title("Timing With a Thousand by a Thousand Sized Matrices") plt.plot(results[:-1,2]) plt.scatter([5],results[-1:,2]) plt.xticks(range(-1,7),["","1", "2", "4", "8", "16", "GPU", ""]) plt.xlabel("Number of threads (or GPU)") plt.ylabel("Seconds to compute one calculation") plt.subplot(2,2,4) plt.title("All Timings In Log Scale") plt.plot(results[:-1]) plt.scatter([5],results[-1:,0],color="blue") plt.scatter([5],results[-1:,1], color="green") plt.scatter([5],results[-1:,2], color="red") plt.xticks(range(-1,7),["","1", "2", "4", "8", "16", "GPU", ""]) plt.xlabel("Number of threads (or GPU)") plt.ylabel("Seconds to compute one calculation") plt.yscale("log") plt.tight_layout() plt.savefig("feedforward.pgf") plt.show() #Relative Timings Feedforward thread_counts = np.array([1,2,4,8,16,32*256]) results = results[0,None]/results plt.figure() plt.suptitle("Feedforward", fontsize=24, y=1.05) plt.subplot(2,2,1) plt.title("All Speed Ups") plt.plot(results[:-1]) plt.scatter([5],results[-1:,0],color="blue") plt.scatter([5],results[-1:,1], color="green") plt.scatter([5],results[-1:,2], color="red") plt.xticks(range(-1,7),["","1", "2", "4", "8", "16", "GPU", ""]) plt.xlabel("Number of threads (or GPU)") plt.ylabel("Speed up ratio on one calculation (log scale)") plt.yscale("log") plt.legend(["10x10","100x100","1000x1000"],loc=2) plt.subplot(2,2,2) plt.title("CPU Only Speed Ups") plt.plot(results[:-1]-1) plt.xticks(range(-1,6),["","1", "2", "4", "8", "16", ""]) plt.xlabel("Number of threads") plt.ylabel("Relative speed difference on one calculation") plt.legend(["10x10","100x100","1000x1000"],loc=2) plt.subplot(2,2,3) plt.title("Speed Up Per Thread") plt.plot((results[1:-1]-1)/thread_counts[1:-1,None]) plt.scatter([4],(results[-1:,0]-1)/thread_counts[-1],color="blue") plt.scatter([4],(results[-1:,1]-1)/thread_counts[-1], color="green") plt.scatter([4],(results[-1:,2]-1)/thread_counts[-1], color="red") plt.xticks(range(-1,6),["", "2", "4", "8", "16", "GPU", ""]) plt.xlabel("Number of threads (or GPU)") plt.ylabel("Relative speed difference on one calculation") plt.legend(["10x10","100x100","1000x1000"],loc=1) plt.subplot(2,2,4) def amdahlPortion(speedup,threads): return threads*(speedup-1)/((threads-1)*speedup) plt.title("Amdahl's Law Calculated Parallelizable Portion") plt.plot(amdahlPortion(results[1:-1],thread_counts[1:-1,None])) plt.scatter([4],amdahlPortion(results[-1:,0],thread_counts[-1]),color="blue") plt.scatter([4],amdahlPortion(results[-1:,1],thread_counts[-1]), color="green") plt.scatter([4],amdahlPortion(results[-1:,2],thread_counts[-1]), color="red") plt.xticks(range(-1,6),["", "2", "4", "8", "16", "GPU", ""]) plt.xlabel("Number of threads (or GPU)") plt.ylabel("Ratio of parallelizable code to total code") plt.legend(["10x10","100x100","1000x1000"],loc=10) plt.tight_layout() plt.savefig("feedforward2.pgf") plt.show() #Backprop time results = np.load("backproptimings.npy") #Raw Timings Plot Backpropagation plt.figure() plt.suptitle("Backpropagation", fontsize=24, y=1.05) plt.subplot(2,2,1) plt.title("Timing With Ten by Ten Sized Matrices") plt.plot(results[:-1,0]) plt.scatter([5],results[-1:,0]) plt.xticks(range(-1,7),["","1", "2", "4", "8", "16", "GPU", ""]) plt.xlabel("Number of threads (or GPU)") plt.ylabel("Seconds to compute one calculation") plt.subplot(2,2,2) plt.title("Timing With a Hundred by Hundred Sized Matrices") plt.plot(results[:-1,1]) plt.scatter([5],results[-1:,1]) plt.xticks(range(-1,7),["","1", "2", "4", "8", "16", "GPU", ""]) plt.xlabel("Number of threads (or GPU)") plt.ylabel("Seconds to compute one calculation") plt.subplot(2,2,3) plt.title("Timing With a Thousand by a Thousand Sized Matrices") plt.plot(results[:-1,2]) plt.scatter([5],results[-1:,2]) plt.xticks(range(-1,7),["","1", "2", "4", "8", "16", "GPU", ""]) plt.xlabel("Number of threads (or GPU)") plt.ylabel("Seconds to compute one calculation") plt.subplot(2,2,4) plt.title("All Timings In Log Scale") plt.plot(results[:-1]) plt.scatter([5],results[-1:,0],color="blue") plt.scatter([5],results[-1:,1], color="green") plt.scatter([5],results[-1:,2], color="red") plt.xticks(range(-1,7),["","1", "2", "4", "8", "16", "GPU", ""]) plt.xlabel("Number of threads (or GPU)") plt.ylabel("Seconds to compute one calculation") plt.yscale("log") plt.tight_layout() plt.savefig("backprop.pgf") plt.show() #Relative Timings Backpropagation results = results[0,None]/results plt.figure() plt.suptitle("Feedforward", fontsize=24, y=1.05) plt.subplot(2,2,1) plt.title("All Speed Ups") plt.plot(results[:-1]) plt.scatter([5],results[-1:,0],color="blue") plt.scatter([5],results[-1:,1], color="green") plt.scatter([5],results[-1:,2], color="red") plt.xticks(range(-1,7),["","1", "2", "4", "8", "16", "GPU", ""]) plt.xlabel("Number of threads (or GPU)") plt.ylabel("Speed up ratio on one calculation (log scale)") plt.yscale("log") plt.legend(["10x10","100x100","1000x1000"],loc=2) plt.subplot(2,2,2) plt.title("CPU Only Speed Ups") plt.plot(results[:-1]-1) plt.xticks(range(-1,6),["","1", "2", "4", "8", "16", ""]) plt.xlabel("Number of threads") plt.ylabel("Relative speed difference on one calculation") plt.legend(["10x10","100x100","1000x1000"],loc=2) plt.subplot(2,2,3) plt.title("Speed Up Per Thread") plt.plot((results[1:-1]-1)/thread_counts[1:-1,None]) plt.scatter([4],(results[-1:,0]-1)/thread_counts[-1],color="blue") plt.scatter([4],(results[-1:,1]-1)/thread_counts[-1], color="green") plt.scatter([4],(results[-1:,2]-1)/thread_counts[-1], color="red") plt.xticks(range(-1,6),["", "2", "4", "8", "16", "GPU", ""]) plt.xlabel("Number of threads (or GPU)") plt.ylabel("Relative speed difference on one calculation") plt.legend(["10x10","100x100","1000x1000"],loc=1) plt.subplot(2,2,4) plt.title("Amdahl's Law Calculated Parallelizable Portion") plt.plot(amdahlPortion(results[1:-1],thread_counts[1:-1,None])) plt.scatter([4],amdahlPortion(results[-1:,0],thread_counts[-1]),color="blue") plt.scatter([4],amdahlPortion(results[-1:,1],thread_counts[-1]), color="green") plt.scatter([4],amdahlPortion(results[-1:,2],thread_counts[-1]), color="red") plt.xticks(range(-1,6),["", "2", "4", "8", "16", "GPU", ""]) plt.xlabel("Number of threads (or GPU)") plt.ylabel("Ratio of parallelizable code to total code") plt.legend(["10x10","100x100","1000x1000"],loc=10) plt.tight_layout() plt.savefig("feedforward2.pgf") plt.show()
StarcoderdataPython
1753387
import unittest from .timeUtil import * from .timeBase import * from .systemProcessingBase import * class TestTimeUtil(unittest.TestCase): def test_1(self): # with 计时器() as t: # 延时(1) # print(t.取耗时()) t = 时间统计() 延时(1.22) print(t.取秒()) print(t.取毫秒()) 延时(1.22) print(t.取秒()) print(t.取毫秒()) t.开始() 延时(1.22) print(t.取秒()) print(t.取毫秒()) t = 计时器() 延时(1.22) print(t.取秒()) print(t.取毫秒()) 延时(1.22) print(t.取秒()) print(t.取毫秒()) t.开始() 延时(1.22) print(t.取秒()) print(t.取毫秒()) def test_4(self): with 时间统计("买东西业务") as t: 延时(1) t.取耗时("出门") 延时(1) t.取耗时("到店") 延时(1) t.取耗时("购买") print("总耗时", t.取总耗时()) def test_5(self): with 时间统计("测试耗时"): 延时(1)
StarcoderdataPython
1633024
<reponame>rafaelhn2021/proyecto # Generated by Django 3.0 on 2021-03-29 21:13 from django.db import migrations, models class Migration(migrations.Migration): dependencies = [ ('declaracion', '0007_secciones_simp'), ] operations = [ migrations.AlterField( model_name='infopersonalfija', name='puesto', field=models.CharField(blank=True, max_length=255, null=True), ), ]
StarcoderdataPython
4816764
<reponame>IOMRC/intake-aodn<gh_stars>1-10 #!/usr/bin/env python #----------------------------------------------------------------------------- # Copyright (c) 2020 - 2021, CSIRO # # All rights reserved. # # The full license is in the LICENSE file, distributed with this software. #----------------------------------------------------------------------------- def make_clim(da,time_res='month',**kwargs): import numpy as np if 'time_slice' in kwargs: ct = da.sel(time=slice(kwargs['time_slice'][0],kwargs['time_slice'][1])).groupby('time.' + time_res).count(dim='time') s = da.sel(time=slice(kwargs['time_slice'][0],kwargs['time_slice'][1])).groupby('time.' + time_res).std(dim='time') clim = da.sel(time=slice(kwargs['time_slice'][0],kwargs['time_slice'][1])).groupby('time.' + time_res).mean(dim='time') else: clim = da.groupby('time.' + time_res).mean(dim='time') s = da.groupby('time.' + time_res).std(dim='time') ct = da.groupby('time.' + time_res).count(dim='time') h95 = clim + 1.96*s/np.sqrt(ct) l95 = clim - 1.96*s/np.sqrt(ct) return clim,h95,l95 def time_average(da,dt,var,**kwargs): import pandas as pd # #dt specifies the type of resampling and can take values of 'M', 'Y' or 'DJF' for season if len(dt)==3: quarters = {'DJF':'Q-Feb','MAM':'Q-May','JJA':'Q-Aug','SON':'Q-Nov'} mth_num = {'DJF':2,'MAM':5,'JJA':8,'SON':11} m = mth_num[dt] dt_q = quarters[dt] t_unit = 'Y' # Method 1: ignores incomplete seasons if kwargs['ignore_inc']: avg_da=da[var].resample(time=dt_q).mean(skipna = True) avg_da = avg_da.sel(time=avg_da['time.month']==m).groupby('time.year').mean() else: # Method2: replaces incomplete seasons with Na avg_da=da[var].resample(time='1M').mean() avg_da = da.where(avg_da.time.dt.season==dt).rolling(min_periods=3,center=True,time=3).mean() avg_da = avg_da.groupby('time.year').mean('time')[var] else: t_unit = dt dt = '1'+dt avg_da=da[var].resample(time=dt).mean(skipna=True) avg_da['time'] = avg_da.time.astype('datetime64[' + t_unit +']') if not kwargs['ignore_inc']: ext_time = avg_da['time'][[0, len(avg_da['time'])-1]] if (da.time[len(da.time)-1].dt.day.values < 15) or ((da.time[len(da.time)-1].dt.month.values < 12) and (t_unit=='Y')): avg_da = avg_da.where(avg_da.time!=avg_da.time[len(avg_da.time)-1]) if avg_da['time'][0] < da['time'][0]-pd.to_timedelta(15,'D'): avg_da = avg_da.where(avg_da.time!=avg_da.time[0]) #last_day = da.time[(da.time + pd.to_timedelta(1,'D')).dt.month != (da.time).dt.month].astype('datetime64[M]') #avg_da = avg_da.where((avg_da.time.isin(last_day) & avg_da.time.isin(da.time))) return avg_da def lin_trend(da,coord,deg=1): import xarray as xr import numpy as np from scipy import stats f=da.polyfit(dim=coord,deg=1) fit = xr.polyval(da[coord],f) fit = fit.rename({'polyfit_coefficients':'linear_fit'}) n = len(da[coord]) x2 = xr.DataArray(range(1,len(da[coord])+1),dims =coord,coords={coord:da[coord]}) serr= np.sqrt(((da-fit['linear_fit'])**2).sum(dim=coord)/(len(da[coord])-1)).expand_dims(dim = {coord:n}) t = stats.t.ppf(1-0.025, len(da[coord])) B = np.sqrt(1/n + (x2 - np.mean(x2))**2 / np.sum((x2-np.mean(x2))**2)) ci = B*serr*t ci+fit hci = ci+fit lci = fit-ci # f=da.polyfit(dim=coord,deg=1) # fit = xr.polyval(da[coord],f) # fit = fit.rename({'polyfit_coefficients':'linear_fit'}) # n = len(da[coord]) # x2 = range(1,len(da[coord])+1) # serr = np.sqrt(np.sum((da-fit)**2)/(len(da[coord])-1)) # t = stats.t.ppf(1-0.025, len(da[coord])) #ci = t * serr['linear_fit'].values * np.sqrt(1/n + (x2 - np.mean(x2))**2 / np.sum((x2-np.mean(x2))**2)) #hci = ci+fit #lci = fit-ci return f,fit,hci,lci
StarcoderdataPython
1612678
<reponame>ar90n/kkt<filename>tests/test_commands_download.py import re import pytest from tempfile import TemporaryDirectory from kkt.commands.download import download @pytest.mark.parametrize( "given, expected", [ ( {"status": "complete", "failureMessage": None, "user": "user"}, {"output": r"^save to:/.*/abc.wheel$"}, ), ( {"status": "running", "failureMessage": None, "user": "user"}, {"output": r"^Kernel has not been completed yet.$"}, ), ], ) def test_commands_install( chshared_datadir, given, expected, cli_runner, kaggle_api, monkeypatch ): api = kaggle_api(**given) monkeypatch.setattr("kkt.commands.kkt_command.get_kaggle_api", lambda: api) with TemporaryDirectory() as tmp_dir: ret = cli_runner.invoke(download, ["--quiet", str(tmp_dir)]) for line in ret.output.strip().split("\n"): assert re.match(expected["output"], line)
StarcoderdataPython
3281966
# -*- coding: utf-8 """Module for custom components. Components in this module: - :func:`tespy.components.customs.orc_evaporator` This file is part of project TESPy (github.com/oemof/tespy). It's copyrighted by the contributors recorded in the version control history of the file, available from its original location tespy/components/customs.py SPDX-License-Identifier: MIT """ import numpy as np from tespy.components.components import component from tespy.tools.data_containers import dc_cp from tespy.tools.data_containers import dc_simple from tespy.tools.fluid_properties import dh_mix_dpQ from tespy.tools.fluid_properties import h_mix_pQ from tespy.tools.fluid_properties import h_mix_pT from tespy.tools.fluid_properties import s_mix_ph from tespy.tools.fluid_properties import v_mix_ph # %% class orc_evaporator(component): r"""Evaporator of the geothermal Organic Rankine Cycle (ORC). Generally, the hot side of the geo-fluid from the geothermal wells deliver two phases: steam and brine. In order to fully use the energy of the geo-fluid, there are 2 inlets at the hot side. The ORC evaporator represents counter current evaporators. Both, two hot and one cold side of the evaporator, are simulated. Equations **mandatory equations** - :func:`tespy.components.components.component.fluid_func` - :func:`tespy.components.customs.orc_evaporator.mass_flow_func` - :func:`tespy.components.customs.orc_evaporator.energy_func` .. math:: 0 = p_{1,in} \cdot pr1 - p_{1,out}\\ 0 = p_{2,in} \cdot pr2 - p_{2,out}\\ 0 = p_{3,in} \cdot pr3 - p_{3,out} - hot side steam :func:`tespy.components.components.component.zeta_func` - hot side brine :func:`tespy.components.components.component.zeta_func` - worling fluid :func:`tespy.components.components.component.zeta_func` **mandatory equations at outlet of the steam from geothermal heat source side** .. math:: 0 = h_{1,out} - h\left(p, x=0 \right)\\ x: \text{vapour mass fraction} **mandatory equations at outlet of the working fluid of being evaporated side** .. math:: 0 = h_{3,out} - h\left(p, x=1 \right)\\ x: \text{vapour mass fraction} Inlets/Outlets - in1, in2, in3 (index 1: steam from geothermal heat source, index 2: brine from geothermal heat source, index 3: working fluid of being evaporated) - out1, out2, out3 (index 1: steam from geothermal heat source, index 2: brine from geothermal heat source, index 3: working fluid of being evaporated) Image .. image:: _images/orc_evaporator.svg :scale: 100 % :alt: alternative text :align: center Parameters ---------- label : str The label of the component. design : list List containing design parameters (stated as String). offdesign : list List containing offdesign parameters (stated as String). design_path: str Path to the components design case. local_offdesign : boolean Treat this component in offdesign mode in a design calculation. local_design : boolean Treat this component in design mode in an offdesign calculation. char_warnings: boolean Ignore warnings on default characteristics usage for this component. printout: boolean Include this component in the network's results printout. Q : float/tespy.tools.data_containers.dc_cp Heat transfer, :math:`Q/\text{W}`. pr1 : float/tespy.tools.data_containers.dc_cp Outlet to inlet pressure ratio at hot side 1 (steam), :math:`pr/1`. pr2 : float/tespy.tools.data_containers.dc_cp Outlet to inlet pressure ratio at hot side 2 (brine), :math:`pr/1`. pr3 : float/tespy.tools.data_containers.dc_cp Outlet to inlet pressure ratio at cold side (working fluid), :math:`pr/1`. zeta1 : float/tespy.tools.data_containers.dc_cp Geometry independent friction coefficient at hot side 1 (steam), :math:`\frac{\zeta}{D^4}/\frac{1}{\text{m}^4}`. zeta2 : float/tespy.tools.data_containers.dc_cp Geometry independent friction coefficient at hot side 2 (brine), :math:`\frac{\zeta}{D^4}/\frac{1}{\text{m}^4}`. zeta3 : float/tespy.tools.data_containers.dc_cp Geometry independent friction coefficient at cold side (working fluid), :math:`\frac{\zeta}{D^4}/\frac{1}{\text{m}^4}`. subcooling : bool Enable/disable subcooling at oulet of the hot side 1, default value: disabled (False). overheating : bool Enable/disable overheating at oulet of the cold side, default value: disabled (False). Note ---- The ORC evaporator has an additional equation for enthalpy at the outlet of the geothermal steam: The fluid leaves the component in saturated liquid state. If code:`subcooling` is activated (:code:`True`), it is possible to specify the enthalpy at the outgoing connection manually. Additionally, an equation for enthalpy at the outlet of the working fluid is imposed: It leaves the component in saturated gas state. If :code:`overheating` is enabled (:code:`True`), it is possible to specify the enthalpy at the outgoing connection manually. Example ------- A two-phase geo-fluid is used as the heat source for evaporating the working fluid. We calculate the mass flow of the working fluid with known steam and brine mass flow. >>> from tespy.connections import connection >>> from tespy.networks import network >>> from tespy.components import source, sink >>> from tespy.components.customs import orc_evaporator >>> fluids = ['water', 'Isopentane'] >>> nw = network(fluids=fluids, iterinfo=False) >>> nw.set_attr(p_unit='bar', T_unit='C', h_unit='kJ / kg') >>> evaporator = orc_evaporator('geothermal orc evaporator') >>> evaporator.component() 'orc_evaporator' >>> source_wf = source('working fluid source') >>> sink_wf = sink('working fluid sink') >>> source_s = source('steam source') >>> source_b = source('brine source') >>> sink_s = sink('steam sink') >>> sink_b = sink('brine sink') >>> eva_wf_in = connection(source_wf, 'out1', evaporator, 'in3') >>> eva_wf_out = connection(evaporator, 'out3', sink_wf, 'in1') >>> eva_steam_in = connection(source_s, 'out1', evaporator, 'in1') >>> eva_sink_s = connection(evaporator, 'out1', sink_s, 'in1') >>> eva_brine_in = connection(source_b, 'out1', evaporator, 'in2') >>> eva_sink_b = connection(evaporator, 'out2', sink_b, 'in1') >>> nw.add_conns(eva_wf_in, eva_wf_out) >>> nw.add_conns(eva_steam_in, eva_sink_s) >>> nw.add_conns(eva_brine_in, eva_sink_b) The orc working fluids leaves the evaporator in saturated steam state, the geothermal steam leaves the component in staturated liquid state. We imply the state of geothermal steam and brine with the corresponding mass flow as well as the working fluid's state at the evaporator inlet. The pressure ratio is specified for each of the three streams. >>> evaporator.set_attr(pr1=0.95, pr2=0.98, pr3=0.99) >>> eva_wf_in.set_attr(T=111, p=11, ... fluid={'water': 0, 'Isopentane': 1}) >>> eva_steam_in.set_attr(T=147, p=4.3, m=20, ... fluid={'water': 1, 'Isopentane': 0}) >>> eva_brine_in.set_attr(T=147, p=10.2, m=190, ... fluid={'water': 1, 'Isopentane': 0}) >>> eva_sink_b.set_attr(T=117) >>> nw.solve(mode='design') Check the state of the steam and working fluid outlet: >>> eva_wf_out.x.val 1.0 >>> eva_sink_s.x.val 0.0 """ @staticmethod def component(): return 'orc_evaporator' @staticmethod def attr(): return { 'Q': dc_cp(max_val=0), 'pr1': dc_cp(max_val=1), 'pr2': dc_cp(max_val=1), 'pr3': dc_cp(max_val=1), 'zeta1': dc_cp(min_val=0), 'zeta2': dc_cp(min_val=0), 'zeta3': dc_cp(min_val=0), 'subcooling': dc_simple(val=False), 'overheating': dc_simple(val=False), 'SQ1': dc_simple(), 'SQ2': dc_simple(), 'SQ3': dc_simple(), 'Sirr': dc_simple() } @staticmethod def inlets(): return ['in1', 'in2', 'in3'] @staticmethod def outlets(): return ['out1', 'out2', 'out3'] def comp_init(self, nw): component.comp_init(self, nw) # number of mandatroy equations for # fluid balance: num_fl * 3 # mass flow: 3 # energy balance: 1 self.num_eq = self.num_nw_fluids * 3 + 3 + 1 # enthalpy hot side 1 outlet (if not subcooling): 1 if self.subcooling.val is False: self.num_eq += 1 # enthalpy cold side outlet (if not overheating): 1 if self.overheating.val is False: self.num_eq += 1 for var in [self.Q, self.pr1, self.pr2, self.pr3, self.zeta1, self.zeta2, self.zeta3, ]: if var.is_set is True: self.num_eq += 1 self.jacobian = np.zeros(( self.num_eq, self.num_i + self.num_o + self.num_vars, self.num_nw_vars)) self.residual = np.zeros(self.num_eq) pos = self.num_nw_fluids * 3 self.jacobian[0:pos] = self.fluid_deriv() self.jacobian[pos:pos + 3] = self.mass_flow_deriv() def equations(self): r"""Calculate residual vector with results of equations.""" k = 0 ###################################################################### # equations for fluid balance self.residual[k:k + self.num_nw_fluids * 3] = self.fluid_func() k += self.num_nw_fluids * 3 ###################################################################### # equations for mass flow balance self.residual[k:k + 3] = self.mass_flow_func() k += 3 ###################################################################### # equations for energy balance self.residual[k] = self.energy_func() k += 1 ###################################################################### # equations for specified heat transfer if self.Q.is_set: self.residual[k] = ( self.inl[2].m.val_SI * ( self.outl[2].h.val_SI - self.inl[2].h.val_SI) - self.Q.val) k += 1 ###################################################################### # equations for specified pressure ratio at hot side 1 if self.pr1.is_set: self.residual[k] = ( self.pr1.val * self.inl[0].p.val_SI - self.outl[0].p.val_SI) k += 1 ###################################################################### # equations for specified pressure ratio at hot side 2 if self.pr2.is_set: self.residual[k] = ( self.pr2.val * self.inl[1].p.val_SI - self.outl[1].p.val_SI) k += 1 ###################################################################### # equations for specified pressure ratio at cold side if self.pr3.is_set: self.residual[k] = ( self.pr3.val * self.inl[2].p.val_SI - self.outl[2].p.val_SI) k += 1 ###################################################################### # equations for specified zeta at hot side 1 if self.zeta1.is_set: self.residual[k] = self.zeta_func( zeta='zeta1', inconn=0, outconn=0) k += 1 ###################################################################### # equations for specified zeta at hot side 2 if self.zeta2.is_set: self.residual[k] = self.zeta_func( zeta='zeta2', inconn=1, outconn=1) k += 1 ###################################################################### # equations for specified zeta at cold side if self.zeta3.is_set: self.residual[k] = self.zeta_func( zeta='zeta3', inconn=2, outconn=2) k += 1 ###################################################################### # equation for saturated liquid at hot side 1 outlet if self.subcooling.val is False: o1 = self.outl[0].to_flow() self.residual[k] = o1[2] - h_mix_pQ(o1, 0) k += 1 ###################################################################### # equation for saturated gas at cold side outlet if self.overheating.val is False: o3 = self.outl[2].to_flow() self.residual[k] = o3[2] - h_mix_pQ(o3, 1) k += 1 def derivatives(self, increment_filter): r"""Calculate matrix of partial derivatives for given equations.""" ###################################################################### # derivatives fluid and mass balance are static k = self.num_nw_fluids * 3 + 3 ###################################################################### # derivatives for energy balance equation # mat_deriv += self.energy_deriv() for i in range(3): self.jacobian[k, i, 0] = ( self.outl[i].h.val_SI - self.inl[i].h.val_SI) self.jacobian[k, i, 2] = -self.inl[i].m.val_SI self.jacobian[k, i + 3, 2] = self.inl[i].m.val_SI k += 1 ###################################################################### # derivatives for specified heat transfer if self.Q.is_set: self.jacobian[k, 2, 0] = ( self.outl[2].h.val_SI - self.inl[2].h.val_SI) self.jacobian[k, 2, 2] = -self.inl[2].m.val_SI self.jacobian[k, 5, 2] = self.inl[2].m.val_SI k += 1 ###################################################################### # derivatives for specified pressure ratio at hot side 1 if self.pr1.is_set: self.jacobian[k, 0, 1] = self.pr1.val self.jacobian[k, 3, 1] = -1 k += 1 ###################################################################### # derivatives for specified pressure ratio at hot side 2 if self.pr2.is_set: self.jacobian[k, 1, 1] = self.pr2.val self.jacobian[k, 4, 1] = -1 k += 1 ###################################################################### # derivatives for specified pressure ratio at cold side if self.pr3.is_set: self.jacobian[k, 2, 1] = self.pr3.val self.jacobian[k, 5, 1] = -1 k += 1 ###################################################################### # derivatives for specified zeta at hot side 1 if self.zeta1.is_set: f = self.zeta_func if not increment_filter[0, 0]: self.jacobian[k, 0, 0] = self.numeric_deriv( f, 'm', 0, zeta='zeta1', inconn=0, outconn=0) if not increment_filter[0, 1]: self.jacobian[k, 0, 1] = self.numeric_deriv( f, 'p', 0, zeta='zeta1', inconn=0, outconn=0) if not increment_filter[0, 2]: self.jacobian[k, 0, 2] = self.numeric_deriv( f, 'h', 0, zeta='zeta1', inconn=0, outconn=0) if not increment_filter[3, 1]: self.jacobian[k, 3, 1] = self.numeric_deriv( f, 'p', 3, zeta='zeta1', inconn=0, outconn=0) if not increment_filter[3, 2]: self.jacobian[k, 3, 2] = self.numeric_deriv( f, 'h', 3, zeta='zeta1', inconn=0, outconn=0) k += 1 ###################################################################### # derivatives for specified zeta at hot side 2 if self.zeta2.is_set: f = self.zeta_func if not increment_filter[1, 0]: self.jacobian[k, 1, 0] = self.numeric_deriv( f, 'm', 1, zeta='zeta2', inconn=1, outconn=1) if not increment_filter[1, 1]: self.jacobian[k, 1, 1] = self.numeric_deriv( f, 'p', 1, zeta='zeta2', inconn=1, outconn=1) if not increment_filter[1, 2]: self.jacobian[k, 1, 2] = self.numeric_deriv( f, 'h', 1, zeta='zeta2', inconn=1, outconn=1) if not increment_filter[4, 1]: self.jacobian[k, 4, 1] = self.numeric_deriv( f, 'p', 4, zeta='zeta2', inconn=1, outconn=1) if not increment_filter[4, 2]: self.jacobian[k, 4, 2] = self.numeric_deriv( f, 'h', 4, zeta='zeta2', inconn=1, outconn=1) k += 1 ###################################################################### # derivatives for specified zeta at cold side if self.zeta3.is_set: f = self.zeta_func if not increment_filter[2, 0]: self.jacobian[k, 2, 0] = self.numeric_deriv( f, 'm', 2, zeta='zeta3', inconn=2, outconn=2) if not increment_filter[2, 1]: self.jacobian[k, 2, 1] = self.numeric_deriv( f, 'p', 2, zeta='zeta3', inconn=2, outconn=2) if not increment_filter[2, 2]: self.jacobian[k, 2, 2] = self.numeric_deriv( f, 'h', 2, zeta='zeta3', inconn=2, outconn=2) if not increment_filter[5, 1]: self.jacobian[k, 5, 1] = self.numeric_deriv( f, 'p', 5, zeta='zeta3', inconn=2, outconn=2) if not increment_filter[5, 2]: self.jacobian[k, 5, 2] = self.numeric_deriv( f, 'h', 5, zeta='zeta3', inconn=2, outconn=2) k += 1 ###################################################################### # derivatives for saturated liquid at hot side 1 outlet equation if self.subcooling.val is False: o1 = self.outl[0].to_flow() self.jacobian[k, 3, 1] = -dh_mix_dpQ(o1, 0) self.jacobian[k, 3, 2] = 1 k += 1 ###################################################################### # derivatives for saturated gas at cold side outlet 3 equation if self.overheating.val is False: o3 = self.outl[2].to_flow() self.jacobian[k, 5, 1] = -dh_mix_dpQ(o3, 1) self.jacobian[k, 5, 2] = 1 k += 1 def mass_flow_func(self): r""" Calculate the residual value of mass flow balance equations. Returns ------- residual : list Vector with residual value for component's mass flow balance. .. math:: 0 = \dot{m}_{in,i} - \dot{m}_{out,i} \; \forall i \in inlets/outlets """ residual = [] for i in range(self.num_i): residual += [self.inl[i].m.val_SI - self.outl[i].m.val_SI] return residual def mass_flow_deriv(self): r""" Calculate the partial derivatives for all mass flow balance equations. Returns ------- deriv : list Matrix with partial derivatives for the mass flow balance equations. """ deriv = np.zeros((self.num_i, 2 * self.num_i, self.num_nw_vars)) for i in range(self.num_i): deriv[i, i, 0] = 1 for j in range(self.num_i): deriv[j, j + self.num_i, 0] = -1 return deriv def energy_func(self): r""" Equation for heat exchanger energy balance. Returns ------- res : float Residual value of equation. .. math:: \begin{split} res = & \dot{m}_{1,in} \cdot \left(h_{1,out} - h_{1,in} \right) \\ &+ \dot{m}_{2,in} \cdot \left(h_{2,out} - h_{2,in} \right) \\ &+ \dot{m}_{3,in} \cdot \left(h_{3,out} - h_{3,in} \right) \end{split} """ return ( self.inl[0].m.val_SI * ( self.outl[0].h.val_SI - self.inl[0].h.val_SI) + self.inl[1].m.val_SI * ( self.outl[1].h.val_SI - self.inl[1].h.val_SI) + self.inl[2].m.val_SI * ( self.outl[2].h.val_SI - self.inl[2].h.val_SI)) def bus_func(self, bus): r""" Calculate the value of the bus function. Parameters ---------- bus : tespy.connections.bus TESPy bus object. Returns ------- val : float Value of energy transfer :math:`\dot{E}`. This value is passed to :py:meth:`tespy.components.components.component.calc_bus_value` for value manipulation according to the specified characteristic line of the bus. .. math:: \dot{E} = \dot{m}_{3,in} \cdot \left( h_{3,out} - h_{3,in} \right) """ i = self.inl[2].to_flow() o = self.outl[2].to_flow() val = i[0] * (o[2] - i[2]) return val def bus_deriv(self, bus): r""" Calculate the matrix of partial derivatives of the bus function. Parameters ---------- bus : tespy.connections.bus TESPy bus object. Returns ------- mat_deriv : ndarray Matrix of partial derivatives. """ deriv = np.zeros((1, 6, self.num_nw_vars)) f = self.calc_bus_value deriv[0, 2, 0] = self.numeric_deriv(f, 'm', 2, bus=bus) deriv[0, 2, 2] = self.numeric_deriv(f, 'h', 2, bus=bus) deriv[0, 5, 2] = self.numeric_deriv(f, 'h', 5, bus=bus) return deriv def initialise_source(self, c, key): r""" Return a starting value for pressure and enthalpy at outlet. Parameters ---------- c : tespy.connections.connection Connection to perform initialisation on. key : str Fluid property to retrieve. Returns ------- val : float Starting value for pressure/enthalpy in SI units. .. math:: val = \begin{cases} 10 \cdot 10^5 & \text{key = 'p'}\\ h\left(p, 473.15 \text{K} \right) & \text{key = 'h' at outlet 1}\\ h\left(p, 473.15 \text{K} \right) & \text{key = 'h' at outlet 2}\\ h\left(p, 523.15 \text{K} \right) & \text{key = 'h' at outlet 3} \end{cases} """ if key == 'p': return 10e5 elif key == 'h': flow = c.to_flow() if c.source_id == 'out1': T = 200 + 273.15 return h_mix_pT(flow, T) elif c.source_id == 'out2': T = 200 + 273.15 return h_mix_pT(flow, T) else: T = 250 + 273.15 return h_mix_pT(flow, T) def initialise_target(self, c, key): r""" Return a starting value for pressure and enthalpy at inlet. Parameters ---------- c : tespy.connections.connection Connection to perform initialisation on. key : str Fluid property to retrieve. Returns ------- val : float Starting value for pressure/enthalpy in SI units. .. math:: val = \begin{cases} 10 \cdot 10^5 & \text{key = 'p'}\\ h\left(p, 573.15 \text{K} \right) & \text{key = 'h' at inlet 1}\\ h\left(p, 573.15 \text{K} \right) & \text{key = 'h' at inlet 2}\\ h\left(p, 493.15 \text{K} \right) & \text{key = 'h' at inlet 3} \end{cases} """ if key == 'p': return 10e5 elif key == 'h': flow = c.to_flow() if c.target_id == 'in1': T = 300 + 273.15 return h_mix_pT(flow, T) elif c.target_id == 'in2': T = 300 + 273.15 return h_mix_pT(flow, T) else: T = 220 + 273.15 return h_mix_pT(flow, T) def calc_parameters(self): r"""Postprocessing parameter calculation.""" # connection information i1 = self.inl[0].to_flow() i2 = self.inl[1].to_flow() i3 = self.inl[2].to_flow() o1 = self.outl[0].to_flow() o2 = self.outl[1].to_flow() o3 = self.outl[2].to_flow() # specific volume v_i1 = v_mix_ph(i1, T0=self.inl[0].T.val_SI) v_i2 = v_mix_ph(i2, T0=self.inl[1].T.val_SI) v_i3 = v_mix_ph(i3, T0=self.inl[2].T.val_SI) v_o1 = v_mix_ph(o1, T0=self.outl[0].T.val_SI) v_o2 = v_mix_ph(o2, T0=self.outl[1].T.val_SI) v_o3 = v_mix_ph(o3, T0=self.outl[2].T.val_SI) # specific entropy s_i1 = s_mix_ph(i1, T0=self.inl[0].T.val_SI) s_i2 = s_mix_ph(i2, T0=self.inl[1].T.val_SI) s_i3 = s_mix_ph(i3, T0=self.inl[2].T.val_SI) s_o1 = s_mix_ph(o1, T0=self.outl[0].T.val_SI) s_o2 = s_mix_ph(o2, T0=self.outl[1].T.val_SI) s_o3 = s_mix_ph(o3, T0=self.outl[2].T.val_SI) # component parameters self.Q.val = -i3[0] * (o3[2] - i3[2]) self.pr1.val = o1[1] / i1[1] self.pr2.val = o2[1] / i2[1] self.pr3.val = o3[1] / i3[1] self.zeta1.val = ((i1[1] - o1[1]) * np.pi ** 2 / (8 * i1[0] ** 2 * (v_i1 + v_o1) / 2)) self.zeta2.val = ((i2[1] - o2[1]) * np.pi ** 2 / (8 * i2[0] ** 2 * (v_i2 + v_o2) / 2)) self.zeta3.val = ((i3[1] - o3[1]) * np.pi ** 2 / (8 * i3[0] ** 2 * (v_i3 + v_o3) / 2)) self.SQ1.val = self.inl[0].m.val_SI * (s_o1 - s_i1) self.SQ2.val = self.inl[1].m.val_SI * (s_o2 - s_i2) self.SQ3.val = self.inl[2].m.val_SI * (s_o3 - s_i3) self.Sirr.val = self.SQ1.val + self.SQ2.val + self.SQ3.val self.check_parameter_bounds()
StarcoderdataPython
1776097
<reponame>Tobdu399/p3wordformatter<filename>formatword_pkg/__init__.py def format_word(word): formatted_word = [] completed_word = "" for letter in word: formatted_word.append(letter) formatted_word[0] = formatted_word[0].upper() completed_word += formatted_word[0] # Add the capitalized letter for i in range(1, len(formatted_word)): formatted_word[i] = formatted_word[i].lower() completed_word += formatted_word[i] # Add rest of the letters in lowercase return print(completed_word) # Return the formatted word
StarcoderdataPython
3304982
# ----------------------------------------------------- # Copyright (c) Shanghai Jiao Tong University. All rights reserved. # Written by <NAME> (<EMAIL>) # ----------------------------------------------------- """API of efficientdet detector""" import os import sys sys.path.insert(0, os.path.dirname(__file__)) from abc import ABC, abstractmethod import platform import torch import numpy as np from efficientdet.utils import unique, prep_image, prep_frame, bbox_iou from efficientdet.effdet import EfficientDet, get_efficientdet_config, DetBenchEval, load_checkpoint from detector.apis import BaseDetector try: from apex import amp has_amp = True except ImportError: has_amp = False #only windows visual studio 2013 ~2017 support compile c/cuda extensions #If you force to compile extension on Windows and ensure appropriate visual studio #is intalled, you can try to use these ext_modules. if platform.system() != 'Windows': from detector.nms import nms_wrapper class EffDetDetector(BaseDetector): def __init__(self, cfg, opt=None): super(EffDetDetector, self).__init__() self.detector_cfg = cfg self.detector_opt = opt self.model_cfg = get_efficientdet_config(opt.detector) self.model_weights = 'detector/efficientdet/weights/'+opt.detector+'.pth' #Input image dimension, uses model default if empty self.inp_dim = cfg.get('INP_DIM', None) if cfg.get('INP_DIM', None) is not None else self.model_cfg.image_size self.nms_thres = cfg.get('NMS_THRES', 0.6) self.confidence = cfg.get('CONFIDENCE', 0.05) self.num_classes = cfg.get('NUM_CLASSES', 80) self.model = None def load_model(self): args = self.detector_opt net = EfficientDet(self.model_cfg) load_checkpoint(net, self.model_weights) self.model = DetBenchEval(net, self.model_cfg) if args: if len(args.gpus) > 1: if has_amp: print('Using AMP mixed precision.') self.model = amp.initialize(self.model, opt_level='O1') else: print('AMP not installed, running network in FP32.') self.model = torch.nn.DataParallel(self.model, device_ids=args.gpus).to(args.device) else: self.model.to(args.device) else: if has_amp: print('Using AMP mixed precision.') self.model = amp.initialize(self.model, opt_level='O1') else: print('AMP not installed, running network in FP32.') self.model.cuda() net.eval() def image_preprocess(self, img_source): """ Pre-process the img before fed to the object detection network Input: image name(str) or raw image data(ndarray or torch.Tensor,channel GBR) Output: pre-processed image data(torch.FloatTensor,(1,3,h,w)) """ if isinstance(img_source, str): img, orig_img, im_dim_list = prep_image(img_source, self.inp_dim) elif isinstance(img_source, torch.Tensor) or isinstance(img_source, np.ndarray): img, orig_img, im_dim_list = prep_frame(img_source, self.inp_dim) else: raise IOError('Unknown image source type: {}'.format(type(img_source))) return img def images_detection(self, imgs, orig_dim_list): """ Feed the img data into object detection network and collect bbox w.r.t original image size Input: imgs(torch.FloatTensor,(b,3,h,w)): pre-processed mini-batch image input orig_dim_list(torch.FloatTensor, (b,(w,h,w,h))): original mini-batch image size Output: dets(torch.cuda.FloatTensor,(n,(batch_idx,x1,y1,x2,y2,c,s,idx of cls))): human detection results """ args = self.detector_opt if not self.model: self.load_model() with torch.no_grad(): imgs = imgs.to(args.device) if args else imgs.cuda() scaling_factors = torch.FloatTensor([1./min(self.inp_dim / orig_dim[0], self.inp_dim / orig_dim[1]) for orig_dim in orig_dim_list]).view(-1, 1) scaling_factors = scaling_factors.to(args.device) if args else scaling_factors.cuda() prediction = self.model(imgs, scaling_factors) #do nms to the detection results, only human category is left dets = self.dynamic_get_results(prediction, self.confidence, self.num_classes, nms=True, nms_conf=self.nms_thres) if isinstance(dets, int) or dets.shape[0] == 0: return 0 dets = dets.cpu() orig_dim_list = torch.index_select(orig_dim_list, 0, dets[:, 0].long()) for i in range(dets.shape[0]): dets[i, [1, 3]] = torch.clamp(dets[i, [1, 3]], 0.0, orig_dim_list[i, 0]) dets[i, [2, 4]] = torch.clamp(dets[i, [2, 4]], 0.0, orig_dim_list[i, 1]) return dets def dynamic_get_results(self, prediction, confidence, num_classes, nms=True, nms_conf=0.4): prediction_bak = prediction.clone() dets = self.get_results(prediction.clone(), confidence, num_classes, nms, nms_conf) if isinstance(dets, int): return dets if dets.shape[0] > 100: nms_conf -= 0.05 dets = self.get_results(prediction_bak.clone(), confidence, num_classes, nms, nms_conf) return dets def get_results(self, prediction, confidence, num_classes, nms=True, nms_conf=0.4): args = self.detector_opt #prediction: (batchsize, num of objects, (xc,yc,w,h,box confidence, 80 class scores)) conf_mask = (prediction[:, :, 4] > confidence).float().float().unsqueeze(2) prediction = prediction * conf_mask try: ind_nz = torch.nonzero(prediction[:,:,4]).transpose(0,1).contiguous() except: return 0 #the 3rd channel of prediction: (xmin,ymin,w,h)->(x1,y1,x2,y2) box_a = prediction.new(prediction.shape) box_a[:,:,0] = prediction[:,:,0] box_a[:,:,1] = prediction[:,:,1] box_a[:,:,2] = prediction[:,:,0] + prediction[:,:,2] box_a[:,:,3] = prediction[:,:,1] + prediction[:,:,3] prediction[:,:,:4] = box_a[:,:,:4] batch_size = prediction.size(0) output = prediction.new(1, prediction.size(2) + 1) write = False num = 0 for ind in range(batch_size): #select the image from the batch image_pred = prediction[ind] #Get the class having maximum score, and the index of that class #Get rid of num_classes softmax scores #Add the class index and the class score of class having maximum score max_conf, max_conf_score = torch.max(image_pred[:,5:5+ num_classes], 1) max_conf = max_conf.float().unsqueeze(1) max_conf_score = max_conf_score.float().unsqueeze(1) seq = (image_pred[:,:5], max_conf, max_conf_score) #image_pred:(n,(x1,y1,x2,y2,c,s,idx of cls)) image_pred = torch.cat(seq, 1) #Get rid of the zero entries non_zero_ind = (torch.nonzero(image_pred[:,4])) image_pred_ = image_pred[non_zero_ind.squeeze(),:].view(-1,7) #Get the various classes detected in the image try: img_classes = unique(image_pred_[:,-1]) except: continue #WE will do NMS classwise #print(img_classes) for cls in img_classes: if cls != 0: continue #get the detections with one particular class cls_mask = image_pred_*(image_pred_[:,-1] == cls).float().unsqueeze(1) class_mask_ind = torch.nonzero(cls_mask[:,-2]).squeeze() image_pred_class = image_pred_[class_mask_ind].view(-1,7) #sort the detections such that the entry with the maximum objectness #confidence is at the top conf_sort_index = torch.sort(image_pred_class[:,4], descending = True )[1] image_pred_class = image_pred_class[conf_sort_index] idx = image_pred_class.size(0) #if nms has to be done if nms: if platform.system() != 'Windows': #We use faster rcnn implementation of nms (soft nms is optional) nms_op = getattr(nms_wrapper, 'nms') #nms_op input:(n,(x1,y1,x2,y2,c)) #nms_op output: input[inds,:], inds _, inds = nms_op(image_pred_class[:,:5], nms_conf) image_pred_class = image_pred_class[inds] else: # Perform non-maximum suppression max_detections = [] while image_pred_class.size(0): # Get detection with highest confidence and save as max detection max_detections.append(image_pred_class[0].unsqueeze(0)) # Stop if we're at the last detection if len(image_pred_class) == 1: break # Get the IOUs for all boxes with lower confidence ious = bbox_iou(max_detections[-1], image_pred_class[1:], args) # Remove detections with IoU >= NMS threshold image_pred_class = image_pred_class[1:][ious < nms_conf] image_pred_class = torch.cat(max_detections).data #Concatenate the batch_id of the image to the detection #this helps us identify which image does the detection correspond to #We use a linear straucture to hold ALL the detections from the batch #the batch_dim is flattened #batch is identified by extra batch column batch_ind = image_pred_class.new(image_pred_class.size(0), 1).fill_(ind) seq = batch_ind, image_pred_class if not write: output = torch.cat(seq,1) write = True else: out = torch.cat(seq,1) output = torch.cat((output,out)) num += 1 if not num: return 0 #output:(n,(batch_ind,x1,y1,x2,y2,c,s,idx of cls)) return output def detect_one_img(self, img_name): """ Detect bboxs in one image Input: 'str', full path of image Output: '[{"category_id":1,"score":float,"bbox":[x,y,w,h],"image_id":str},...]', The output results are similar with coco results type, except that image_id uses full path str instead of coco %012d id for generalization. """ args = self.detector_opt _CUDA = True if args: if args.gpus[0] < 0: _CUDA = False if not self.model: self.load_model() if isinstance(self.model, torch.nn.DataParallel): self.model = self.model.module dets_results = [] #pre-process(scale, normalize, ...) the image img, orig_img, img_dim_list = prep_image(img_name, self.inp_dim) with torch.no_grad(): img_dim_list = torch.FloatTensor([img_dim_list]).repeat(1, 2) img = img.to(args.device) if args else img.cuda() scaling_factor = torch.FloatTensor([1/min(self.inp_dim / orig_dim[0], self.inp_dim / orig_dim[1]) for orig_dim in img_dim_list]).view(-1, 1) scaling_factor = scaling_factor.to(args.device) if args else scaling_factor.cuda() prediction = self.model(img, scaling_factor) #do nms to the detection results, only human category is left dets = self.dynamic_get_results(prediction, self.confidence, self.num_classes, nms=True, nms_conf=self.nms_thres) if isinstance(dets, int) or dets.shape[0] == 0: return None dets = dets.cpu() img_dim_list = torch.index_select(img_dim_list, 0, dets[:, 0].long()) for i in range(dets.shape[0]): dets[i, [1, 3]] = torch.clamp(dets[i, [1, 3]], 0.0, img_dim_list[i, 0]) dets[i, [2, 4]] = torch.clamp(dets[i, [2, 4]], 0.0, img_dim_list[i, 1]) #write results det_dict = {} x = float(dets[i, 1]) y = float(dets[i, 2]) w = float(dets[i, 3] - dets[i, 1]) h = float(dets[i, 4] - dets[i, 2]) det_dict["category_id"] = 1 det_dict["score"] = float(dets[i, 5]) det_dict["bbox"] = [x, y, w, h] det_dict["image_id"] = int(os.path.basename(img_name).split('.')[0]) dets_results.append(det_dict) return dets_results def check_detector(self, img_name): """ Detect bboxs in one image Input: 'str', full path of image Output: '[{"category_id":1,"score":float,"bbox":[x,y,w,h],"image_id":str},...]', The output results are similar with coco results type, except that image_id uses full path str instead of coco %012d id for generalization. """ args = self.detector_opt _CUDA = True if args: if args.gpus[0] < 0: _CUDA = False if not self.model: self.load_model() if isinstance(self.model, torch.nn.DataParallel): self.model = self.model.module dets_results = [] #pre-process(scale, normalize, ...) the image img, orig_img, img_dim_list = prep_image(img_name, self.inp_dim) with torch.no_grad(): img_dim_list = torch.FloatTensor([img_dim_list]).repeat(1, 2) img = img.to(args.device) if args else img.cuda() scaling_factor = torch.FloatTensor([1/min(self.inp_dim / orig_dim[0], self.inp_dim / orig_dim[1]) for orig_dim in img_dim_list]).view(-1, 1) scaling_factor = scaling_factor.to(args.device) if args else scaling_factor.cuda() output = self.model(img, scaling_factor) output = output.cpu() for index, sample in enumerate(output): image_id = int(os.path.basename(img_name).split('.')[0]) for det in sample: score = float(det[4]) if score < .001: # stop when below this threshold, scores in descending order break coco_det = dict( image_id=image_id, bbox=det[0:4].tolist(), score=score, category_id=int(det[5])) dets_results.append(coco_det) return dets_results if __name__ == "__main__": #run with python detector/effdet_api.py /DATA1/Benchmark/coco/ efficientdet_d0 from pycocotools.coco import COCO from pycocotools.cocoeval import COCOeval from easydict import EasyDict as edict from apis import get_detector from tqdm import tqdm import json opt = edict() _coco = COCO(sys.argv[1]+'/annotations/instances_val2017.json') opt.detector = sys.argv[2] opt.gpus = [0] if torch.cuda.device_count() >= 1 else [-1] opt.device = torch.device("cuda:" + str(opt.gpus[0]) if opt.gpus[0] >= 0 else "cpu") image_ids = sorted(_coco.getImgIds()) det_model = get_detector(opt) dets = [] for entry in tqdm(_coco.loadImgs(image_ids)): abs_path = os.path.join( sys.argv[1], 'val2017', entry['file_name']) det = det_model.check_detector(abs_path) if det: dets += det json.dump(dets, open('results.json', 'w')) coco_results = _coco.loadRes('results.json') coco_eval = COCOeval(_coco, coco_results, 'bbox') coco_eval.params.imgIds = image_ids # score only ids we've used coco_eval.evaluate() coco_eval.accumulate() coco_eval.summarize()
StarcoderdataPython
170657
<reponame>Xingyu-Lin/VCD<filename>VCD/utils/data_utils.py<gh_stars>10-100 import numpy as np import torch from torch_geometric.data import Data import torch_geometric class PrivilData(Data): """ Encapsulation of multi-graphs for multi-step training ind: 0-(hor-1), type: vsbl or full Each graph contain: edge_index_{type}_{ind}, x_{type}_{ind}, edge_attr_{type}_{ind}, gt_rwd_{type}_{ind} gt_accel_{type}_{ind} mesh_mapping_{type}_{ind} """ def __init__(self, has_part=False, has_full=False, **kwargs): super(PrivilData, self).__init__(**kwargs) self.has_part = has_part self.has_full = has_full def __inc__(self, key, value, *args, **kwargs): if 'edge_index' in key: x = key.replace('edge_index', 'x') return self[x].size(0) elif 'mesh_mapping' in key: # add index of mesh matching by x = key.replace('partial_pc_mapped_idx', 'x') return self[x].size(0) else: return super().__inc__(key, value) class AggDict(dict): def __init__(self, is_detach=True): """ Aggregate numpy arrays or pytorch tensors :param is_detach: Whether to save numpy arrays in stead of torch tensors """ super(AggDict).__init__() self.is_detach = is_detach def __getitem__(self, item): return self.get(item, 0) def add_item(self, key, value): if self.is_detach and torch.is_tensor(value): value = value.detach().cpu().numpy() if not isinstance(value, torch.Tensor): if isinstance(value, np.ndarray) or isinstance(value, np.number): assert value.size == 1 else: assert isinstance(value, int) or isinstance(value, float) if key not in self.keys(): self[key] = value else: self[key] += value def update_by_add(self, src_dict): for key, value in src_dict.items(): self.add_item(key, value) def get_mean(self, prefix, count=1): avg_dict = {} for k, v in self.items(): avg_dict[prefix + k] = v / count return avg_dict def updateDictByAdd(dict1, dict2): ''' update dict1 by dict2 ''' for k1, v1 in dict2.items(): for k2, v2 in v1.items(): dict1[k1][k2] += v2.cpu().item() return dict1 def get_index_before_padding(graph_sizes): ins_len = graph_sizes.max() pad_len = ins_len * graph_sizes.size(0) valid_len = graph_sizes.sum() accum = torch.zeros(1).cuda() out = [] for gs in graph_sizes: new_ind = torch.range(0, gs - 1).cuda() + accum out.append(new_ind) accum += ins_len final_ind = torch.cat(out, dim=0) return final_ind.long() class MyDataParallel(torch_geometric.nn.DataParallel): def __init__(self, *args, **kwargs): super().__init__(*args, **kwargs) def __getattr__(self, name): if name == 'module': return self._modules['module'] else: return getattr(self.module, name) def retrieve_data(data, key): """ vsbl: [vsbl], full: [full], dual :[vsbl, full] """ if isinstance(data, dict): identifier = '_{}'.format(key) out_data = {k.replace(identifier, ''): v for k, v in data.items() if identifier in k} return out_data
StarcoderdataPython
1612165
<gh_stars>10-100 import json from abc import ABC, abstractmethod from typing import List from pywatts.core.filemanager import FileManager from pywatts.core.summary_object import SummaryObject, SummaryCategory, SummaryObjectList, SummaryObjectTable from tabulate import tabulate class SummaryFormatter(ABC): """ SummaryFormatter is responsible for formatting the SummaryObjects according to the output file. """ def create_summary(self, summaries: List[SummaryObject], fm: FileManager): """ This method is responsible for creating and storing the summaries according to the output file. :param summaries: The summaries that should be stored. :type summaries: List[SummaryObject] :param fm: The pyWATTS filemanager. :type fm: FileManager """ @abstractmethod def _create_summary(self, summary: SummaryObject): pass @abstractmethod def _create_table_summary(self, summary: SummaryObject): pass class SummaryMarkdown(SummaryFormatter): """ SummaryMarkdown is a SummaryFormatter that save the SummaryObjects according as markdown file. """ def create_summary(self, summaries: List[SummaryObject], fm: FileManager): """ This method is responsible for creating and storing the summaries as markdown file. :param summaries: The summaries that should be stored. :type summaries: List[SummaryObject] :param fm: The pyWATTS filemanager. :type fm: FileManager """ summary_string = "# Summary: \n" for category in [SummaryCategory.Summary, SummaryCategory.FitTime, SummaryCategory.TransformTime]: summary_string += f"## {category.name}\n" for summary in filter(lambda s: s.category == category, summaries): if summary.additional_information != "" or len(summary.k_v) > 0: if isinstance(summary, SummaryObjectList): summary_string += self._create_summary(summary) elif isinstance(summary, SummaryObjectTable): summary_string += self._create_table_summary(summary) with open(fm.get_path("summary.md"), "w") as file: file.write(summary_string) return summary_string def _create_summary(self, summary: SummaryObject): return f"### {summary.name}\n" + f"{summary.additional_information}\n" + "".join( [f"* {key} : {value}\n" for key, value in summary.k_v.items()]) def _create_table_summary(self, summary: SummaryObject): return f"### {summary.name}\n" + f"{summary.additional_information}\n" + "".join( [ f"#### {key}\n {tabulate(value, headers=range(len(value)), showindex=range(len(value)), tablefmt='github')}\n" for key, value in summary.k_v.items()]) class SummaryJSON(SummaryFormatter): """ SummaryJSON is a SummaryFormatter that save the SummaryObjects according as json file. """ def create_summary(self, summaries: List[SummaryObject], fm: FileManager): """ This method is responsible for creating and storing the summaries as json file. :param summaries: The summaries that should be stored. :type summaries: List[SummaryObject] :param fm: The pyWATTS filemanager. :type fm: FileManager """ summary_dict = {} for category in [SummaryCategory.Summary, SummaryCategory.FitTime, SummaryCategory.TransformTime]: category_dict = {} for summary in filter(lambda s: s.category == category, summaries): if summary.additional_information != "" or len(summary.k_v) > 0: if isinstance(summary, SummaryObjectList): category_dict.update(self._create_summary(summary)) elif isinstance(summary, SummaryObjectTable): category_dict.update(self._create_table_summary(summary)) summary_dict.update({category.name: category_dict}) with open(fm.get_path("summary.json"), "w") as file: json.dump(summary_dict, file) return summary_dict def _create_summary(self, summary: SummaryObject): result_dict = { key: value for key, value in summary.k_v.items() } return { summary.name: { "additional_information": summary.additional_information, "results": result_dict } } def _create_table_summary(self, summary: SummaryObject): result_dict = { key: value.tolist() for key, value in summary.k_v.items() } return { summary.name: { "additional_information": summary.additional_information, "results": result_dict } }
StarcoderdataPython
3209834
# (C) Copyright 2019-2021 Hewlett Packard Enterprise Development LP. # Apache License 2.0 from copy import deepcopy import logging import json from urllib.parse import quote_plus from pyaoscx.exceptions.generic_op_error import GenericOperationError from pyaoscx.exceptions.response_error import ResponseError from pyaoscx.exceptions.verification_error import VerificationError from pyaoscx.utils import util as utils from pyaoscx.session import Session from pyaoscx.pyaoscx_factory import PyaoscxFactory, Singleton from pyaoscx.pyaoscx_module import PyaoscxModule class Device(PyaoscxFactory, metaclass=Singleton): ''' Represents a Device and all of its attributes. Keeping all the important information inside one class. ''' base_uri = "system" def __init__(self, session): self.session = session self.firmware_version = None # Used to set attributes self.config_attrs = [] self.materialized = False self.__original_attributes = {} # Set firmware version self.get_firmware_version() @PyaoscxModule.connected def get(self): ''' Perform a GET call to retrieve device attributes After data from response, Device class attributes are generated using create_attrs() ''' logging.info("Retrieving the switch attributes and capabilities") non_configurable_attrs = [ "admin_password_set", "aruba_central", "boot_time", "capabilities", "capacities", "mgmt_intf_status", "platform_name", "software_images", "software_info", "software_version", "qos_defaults", ] configurable_attrs = [ "domain_name", "hostname", "other_config", "qos_config", "qos_default", "q_profile_default", ] # Concatenate both config and non-config attrs without duplicates all_attributes = list(set(non_configurable_attrs + configurable_attrs)) attributes_list = ','.join(all_attributes) uri = "system?attributes={}&depth={}".format( attributes_list, self.session.api.default_depth ) try: response = self.session.request("GET", uri) except Exception as e: raise ResponseError("GET", e) if not utils._response_ok(response, "GET"): raise GenericOperationError(response.text, response.status_code) # Load into json format data = json.loads(response.text) # Create class attributes using util.create_attrs utils.create_attrs(self, data) utils.set_config_attrs( self, data, "config_attrs", non_configurable_attrs ) # Save original attributes self.__original_attributes = deepcopy( utils.get_attrs(self, self.config_attrs) ) # Set device as materialized self.materialized = True @property def modified(self): """ Verifies if there has been a modification for this object or not. """ device_data = utils.get_attrs(self, self.config_attrs) return device_data != self.__original_attributes @PyaoscxModule.connected def get_subsystems(self): ''' Perform GET call to retrieve subsystem attributes and create a dictionary containing them ''' # Log logging.info( "Retrieving the switch subsystem attributes and capabilities") # Attribute list attributes = [ 'product_info', 'power_supplies', 'interfaces', 'fans', 'resource_utilization' ] # Format attribute list by joining every element with a comma attributes_list = ','.join(attributes) # Build URI uri = "{}system/subsystems?attributes={}&depth={}".format( self.session.base_url, attributes_list, self.session.api.default_subsystem_facts_depth) try: # Try to perform a GET call and retrieve the data response = self.session.s.get( uri, verify=False, proxies=self.session.proxy) except Exception as e: raise ResponseError('GET', e) if not utils._response_ok(response, "GET"): raise GenericOperationError(response.text, response.status_code) # Load into json format data = json.loads(response.text) data_subsystems = {'subsystems' : data} # Create class attributes using util.create_attrs utils.create_attrs(self, data_subsystems) @PyaoscxModule.connected def get_firmware_version(self): ''' Perform a GET call to retrieve device firmware version :return: firmware_version: The firmware version ''' uri = "{}firmware".format(self.session.base_url) try: response = self.session.s.get( uri, verify=False, proxies=self.session.proxy) except Exception as e: raise ResponseError('GET', e) if not utils._response_ok(response, "GET"): raise GenericOperationError(response.text, response.status_code) data = json.loads(response.text) self.firmware_version = data["current_version"] # Return Version return self.firmware_version @PyaoscxModule.materialized def apply(self): """ Main method to update an existing Device object. :return modified: Boolean, True if object was created or modified False otherwise. """ return self.update() @PyaoscxModule.materialized def update(self): """ Perform a PUT call to apply changes to a Device object. :return modified: Boolean, True if object was created or modified False otherwise. """ if not self.modified: return False device_data = utils.get_attrs(self, self.config_attrs) put_data = json.dumps(device_data) try: response = self.session.request("PUT", "system", data=put_data) except Exception as e: raise ResponseError("PUT", e) if not utils._response_ok(response, "PUT"): raise GenericOperationError( response.text, response.status_code ) # Set new original attributes self.__original_attributes = deepcopy(device_data) return True #################################################################### # IMPERATIVE FUNCTIONS #################################################################### def update_banner(self, banner_info, banner_type='banner'): ''' Perform a PUT request to modify a Device's Banner :param banner_info: String to be configured as the banner. :param banner_type: Type of banner being configured on the switch. Either banner or banner_exec :return modified: Returns True if Banner was modified. False otherwise ''' modified = False logging.info("Setting Banner") depth = self.session.api.default_depth # Second GET request to obtain just the variables that are writable selector = self.session.api.default_selector payload = { "depth": depth, "selector": selector } uri = "{base_url}{class_uri}".format( base_url=self.session.base_url, class_uri=Device.base_uri, depth=self.session.api.default_depth ) try: response = self.session.s.get( uri, verify=False, proxies=self.session.proxy, params=payload) except Exception as e: raise ResponseError('GET', e) if not utils._response_ok(response, "GET"): raise GenericOperationError(response.text, response.status_code) # Configurable data config_data = json.loads(response.text) # If Banner type does not exist if banner_type not in config_data['other_config']: # Create Banner type config_data['other_config'][banner_type] = "" # Verify data is different if config_data['other_config'][banner_type] == banner_info: modified = False else: # Modify Banner config_data['other_config'][banner_type] = banner_info # UPDATE Banner put_uri = "{base_url}{class_uri}".format( base_url=self.session.base_url, class_uri=Device.base_uri ) # Set data to be used inside PUT put_data = json.dumps(config_data, sort_keys=True, indent=4) try: response = self.session.s.put( put_uri, verify=False, data=put_data, proxies=self.session.proxy) except Exception as e: raise ResponseError('PUT', e) if not utils._response_ok(response, "PUT"): raise GenericOperationError( response.text, response.status_code, "UPDATE SYSTEM BANNER") # Object was modified, returns True modified = True return modified def delete_banner(self, banner_type='banner'): ''' Perform a DELETE request to delete a device's Banner :param banner_type: Type of banner being removed on the switch. Either banner or banner_exec :return modified: Returns True if Banner was modified. False otherwise ''' logging.info("Removing Banner") depth = self.session.api.default_depth # Second GET request to obtain just the variables that are writable selector = self.session.api.default_selector payload = { "depth": depth, "selector": selector } uri = "{base_url}{class_uri}".format( base_url=self.session.base_url, class_uri=Device.base_uri, depth=self.session.api.default_depth ) try: response = self.session.s.get( uri, verify=False, proxies=self.session.proxy, params=payload) except Exception as e: raise ResponseError('GET', e) if not utils._response_ok(response, "GET"): raise GenericOperationError(response.text, response.status_code) # Configurable data config_data = json.loads(response.text) # If Banner type does not exist if banner_type not in config_data['other_config']: modified = False else: # Delete Banner config_data['other_config'].pop(banner_type) # UPDATE Banner uri = "{base_url}{class_uri}".format( base_url=self.session.base_url, class_uri=Device.base_uri ) put_data = json.dumps(config_data, sort_keys=True, indent=4) try: response = self.session.s.put( uri, verify=False, data=put_data, proxies=self.session.proxy) except Exception as e: raise ResponseError('PUT', e) if not utils._response_ok(response, "PUT"): raise GenericOperationError( response.text, response.status_code, "DELETE Banner") # Object was modified, returns True modified = True return modified def boot_firmware(self, partition_name='primary'): ''' Perform a POST request to Boot the AOS-CX switch with image present to the specified partition :param partition_name: String name of the partition for device to boot to. :return bool: True if success ''' # Lower case for partition name partition_name = partition_name.lower() if partition_name not in ['primary', 'secondary']: raise VerificationError('Boot Firmware', 'Bad partition name') success = False uri = '{base_url}boot?image={part}'.format( base_url=self.session.base_url, part=partition_name) try: self.session.s.post( uri, verify=False, proxies=self.session.proxy) except Exception as e: raise ResponseError('POST', e) success = True # Return result return success def upload_firmware_http(self, remote_firmware_file_path, vrf, partition_name='primary'): ''' Perform a PUT request to upload a firmware image given a http_request :param remote_firmware_file_path: "HTTP server address and path for uploading firmware image, must be reachable through provided vrf ex: http://192.168.1.2:8000/TL_10_04_0030A.swi" :param vrf: VRF to be used to contact HTTP server, required if remote_firmware_file_path is provided :param partition_name: Name of the partition for the image to be uploaded to. :return bool: True if success ''' http_path = remote_firmware_file_path unsupported_versions = [ "10.00", "10.01", "10.02", "10.03", ] # Verify Version for version in unsupported_versions: if version in self.firmware_version: raise VerificationError( 'Upload Firmware through HTTPs', "Minimum supported firmware version is 10.04 for" + " remote firmware upload, your version is {firmware}" .format(firmware=self.firmware_version)) # Verify VRF if vrf is None: raise VerificationError( 'VRF', "VRF needs to be provided in order" + " to upload firmware from HTTP server") http_path_encoded = quote_plus(http_path) # Build URI uri = '{base_url}firmware?image={part}&from={path}&vrf={vrf}'\ .format( base_url=self.session.base_url, part=partition_name, path=http_path_encoded, vrf=vrf) # PUT for a HTTP Request try: response = self.session.s.put( uri, verify=False, proxies=self.session.proxy) except Exception as e: raise ResponseError('PUT', e) if not utils._response_ok(response, "PUT"): raise GenericOperationError( response.text, response.status_code) # True if successful return True def upload_firmware_local(self, partition_name='primary', firmware_file_path=None): ''' Perform a POST request to upload a firmware image from a local file :param partition_name: Name of the partition for the image to be uploaded to. :param firmware_file_path: File name and path for local file uploading firmware image :return success: True if success ''' uri = '{base_url}firmware?image={part}'.format( base_url=self.session.base_url, part=partition_name) # Upload file success = utils.file_upload(self.session, firmware_file_path, uri) # If no errors detected return success def upload_firmware(self, partition_name=None, firmware_file_path=None, remote_firmware_file_path=None, vrf=None): ''' Upload a firmware image from a local file OR from a remote location :param partition_name: Name of the partition for the image to be uploaded to. :param firmware_file_path: File name and path for local file uploading firmware image. IMPORTANT: For this to be used, the remote_firmware_file_path parameter must be left as NONE :param remote_firmware_file_path: HTTP server address and path for uploading firmware image, must be reachable through provided vrf ex: http://192.168.1.2:8000/TL_10_04_0030A.swi :param vrf: VRF to be used to contact HTTP server, required if remote_firmware_file_path is provided :return bool: True if success ''' result = None if partition_name is None: partition_name = 'primary' # Use HTTP Server if remote_firmware_file_path is not None: result = self.upload_firmware_http( remote_firmware_file_path, vrf, partition_name) # Locally else: result = self.upload_firmware_local( partition_name, firmware_file_path) # If no errors detected return result def vsx_capable(self): """ Return whether this device supports the VSX functionality :return: True if device supports VSX """ return hasattr(self, "capabilities") and "vsx" in self.capabilities def is_capable(self, capability): """ Check if the current Device has the given capability. :param capability: String name of a Device capability. :return: True if Device is capable; False otherwise. """ if not self.materialized: self.get() return capability in self.capabilities
StarcoderdataPython
3390327
"""Add python related paths to the user's PATH environment variable.""" import ctypes import sys from ctypes.wintypes import HWND, UINT, WPARAM, LPARAM as LRESULT, LPVOID from os.path import abspath import winreg HKCU = winreg.HKEY_CURRENT_USER ENV = "Environment" PATH = "PATH" HWND_BROADCAST = 0xFFFF WM_SETTINGCHANGE = 0x1A def notify_windows(): """Notifies all windows about a settings change. See: <https://docs.microsoft.com/en-us/windows/desktop/winmsg/wm-settingchange> """ SendMessage = ctypes.windll.user32.SendMessageW SendMessage.argtypes = HWND, UINT, WPARAM, LPVOID SendMessage.restype = LRESULT SendMessage(HWND_BROADCAST, WM_SETTINGCHANGE, 0, u'Environment') def fix_user_env_path(): """Interactively add important python related paths to the user's PATH environment variable.""" to_check = { abspath(sys.prefix), abspath(sys.prefix + "\\Scripts"), } with winreg.CreateKey(HKCU, ENV) as key: try: current = winreg.QueryValueEx(key, PATH)[0] except FileNotFoundError: current = "" existing = {abspath(p.strip()) for p in current.split(";") if p.strip()} to_add = sorted(to_check - existing) if not to_add: print("Nothing to add.") return while True: print("* The following folders should be added to the PATH" " environment variable:") for p in to_add: print(p) answer = input("* Fix the PATH environment variables on your" " account? [Yn]: ") if answer.strip().lower() in ['', 'y', 'yes']: break if answer.strip().lower() in ['n', 'no']: print("Nothing added.") return new = current.rstrip().rstrip(';') + ";" + ";".join(to_add) + ';' winreg.SetValueEx(key, PATH, 0, winreg.REG_EXPAND_SZ, new) notify_windows() print("Updated.") print("PATH will be updated on new sessions.") if __name__ == '__main__': import argparse parser = argparse.ArgumentParser() parser.add_argument('--interactive', '-i', action='store_true', help='Interactive mode.', required=True) args = parser.parse_args() fix_user_env_path()
StarcoderdataPython
3394069
<filename>sathub/forms.py # -*- coding: utf-8 -*- # # sathub/forms.py # # Copyright 2015 Base4 Sistemas Ltda ME # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. # from flask_wtf import FlaskForm from wtforms import StringField from wtforms import PasswordField from wtforms import validators from wtforms.fields import SelectField LOCALES = ['pt_BR', 'pt'] class LoginForm(FlaskForm): username = StringField(u'Nome de Usuário', validators=[ validators.DataRequired(), validators.length(min=2, max=20), ]) password = PasswordField('<PASSWORD>', validators=[ validators.DataRequired(), validators.length(min=6, max=20), ]) class Meta: locales = LOCALES class EmptyForm(FlaskForm): class Meta: locales = LOCALES class ConfigurarInterfaceDeRedeFrom(FlaskForm): tipoInter = SelectField( choices=( ('ETHE', 'ETHE'), # ('WIFI', 'WIFI') ), label='Tipo de interface', render_kw={'class': 'form-control', 'style': 'font-size:150%'} ) # SSID = StringField('Nome da rede (SSID)') # seg = SelectField( # choices=( # ('NONE', 'NONE'), # ('WEP', 'WEP'), # ('WAP', 'WAP'), # ('WPA-PERSONAL', 'WPA-PERSONAL'), # ('WPA-ENTERPRISE', 'WPA-ENTERPRISE'), # ), # label='Seguranaça' # ) # codigo = PasswordField( # 'Frase ou chave de acesso à rede sem fio.', # validators=[ # validators.DataRequired(), # validators.length(min=6, max=64), ] # ) tipoLan = SelectField( choices=( ('IPFIX', 'IP FIXO'), ('DHCP', 'DHCP (Automático)') ), label='Tipo de conexão', render_kw={'class': 'form-control', 'style': 'font-size:150%'} ) lanIP = StringField( 'Endereço IP', validators=[ validators.DataRequired(), validators.length(max=15) ], render_kw={'class': 'form-control','value':'000.000.000.000', 'style': 'font-size:150%'} ) lanMask = StringField('Máscara', validators=[ validators.DataRequired(), validators.length(max=15) ], render_kw={'class': 'form-control','value':'000.000.000.000', 'style': 'font-size:150%'} ) lanGW = StringField('Gateway', validators=[ validators.DataRequired(), validators.length(max=15) ], render_kw={'class': 'form-control','value':'000.000.000.000','style': 'font-size:150%'}) lanDNS1 = StringField('DNS1', validators=[ validators.DataRequired(), validators.length(max=15) ], render_kw={'class': 'form-control','value':'000.000.000.000','style': 'font-size:150%'}) lanDNS2 = StringField('DNS2', validators=[ validators.DataRequired(), validators.length(max=15) ], render_kw={'class': 'form-control','value':'000.000.000.000','style': 'font-size:150%'})
StarcoderdataPython
188383
#!/usr/bin/env python3 import cgi, cgitb, os from templates import secret_page, after_login_incorrect import secret form = cgi.FieldStorage() username_field = form.getvalue("username") password_field = form.getvalue("password") if username_field == secret.username and password_field == secret.password: print("Set-Cookie: dbecerra = YEP\r\n") logged_in = True else: logged_in = False print("Content-type: text/html") print() # print("<body>") # print(f"<p> Username: {username_field} </p>") # print(f"<p> Password: {<PASSWORD>} </p>") # print("</body>") cookies = os.environ.get('HTTP_COOKIE').split(";") for c in cookies: try: key, value = c.split("=") key, value = key.strip(), value.strip() if key=="dbecerra" and value=="YEP": logged_in = True except: pass if logged_in: print(secret_page(secret.username, secret.password)) else: print(after_login_incorrect())
StarcoderdataPython
4839123
"""Builds automatic documentation of the installed webviz config plugins. The documentation is designed to be used by the YAML configuration file end user. Sphinx has not been used due to 1) Sphinx is geared towards Python end users, and templateing of apidoc output is not yet supported (https://github.com/sphinx-doc/sphinx/issues/3545). 2) It is a small problem to be solved, and most of the Sphinx machinery is not needed. Overall workflow is: * Finds all installed plugins. * Automatically reads docstring and __init__ function signature (both argument names and which arguments have default values). * Output the extracted plugin information in html using jinja2. """ import shutil import inspect import pathlib from importlib import import_module from collections import defaultdict import jinja2 from markdown import markdown import webviz_config.plugins from webviz_config._config_parser import SPECIAL_ARGS SCRIPT_DIR = pathlib.Path(__file__).resolve().parent BUILD_DIR = SCRIPT_DIR / "_build" TEMPLATE_FILE = SCRIPT_DIR / "templates" / "index.html.jinja2" EXAMPLE = SCRIPT_DIR / ".." / "examples" / "basic_example.yaml" def escape_all(input_string): """Escapes any html or utf8 character in the given string. """ no_html = jinja2.escape(input_string) no_utf8 = no_html.encode("ascii", "xmlcharrefreplace").decode() pass_through = jinja2.Markup(no_utf8) return pass_through def convert_docstring(doc): """Convert docstring to markdown. """ return "" if doc is None else markdown(doc, extensions=["fenced_code"]) def get_plugin_documentation(): """Get all installed plugins, and document them by grabbing docstring and input arguments / function signature. """ plugins = inspect.getmembers(webviz_config.plugins, inspect.isclass) plugin_doc = [] for plugin in plugins: reference = plugin[1] plugin_info = {} plugin_info["name"] = plugin[0] plugin_info["doc"] = convert_docstring(reference.__doc__) argspec = inspect.getfullargspec(reference.__init__) plugin_info["args"] = [ arg for arg in argspec.args if arg not in SPECIAL_ARGS ] plugin_info["values"] = defaultdict(lambda: "some value") if argspec.defaults is not None: for arg, default in dict( zip(reversed(argspec.args), reversed(argspec.defaults)) ).items(): plugin_info["values"][ arg ] = f"{default} # Optional (default value shown here)." module = inspect.getmodule(reference) plugin_info["module"] = module.__name__ package = inspect.getmodule(module).__package__ plugin_info["package"] = package plugin_info["package_doc"] = convert_docstring( import_module(package).__doc__ ) if not plugin_info["name"].startswith("Example"): plugin_doc.append(plugin_info) # Sort the plugins by package: package_ordered = defaultdict(lambda: {"plugins": []}) for plugin in sorted(plugin_doc, key=lambda x: (x["module"], x["name"])): package = plugin["package"] package_ordered[package]["plugins"].append(plugin) package_ordered[package]["doc"] = plugin["package_doc"] return package_ordered def get_basic_example(): with open(EXAMPLE) as fh: return escape_all(fh.read()) if __name__ == "__main__": template_data = { "packages": get_plugin_documentation(), "basic_example": get_basic_example(), } with open(TEMPLATE_FILE) as fh: template = jinja2.Template(fh.read()) if BUILD_DIR.exists(): shutil.rmtree(BUILD_DIR) shutil.copytree(SCRIPT_DIR / "assets", BUILD_DIR / "assets") with open(BUILD_DIR / "index.html", "w") as fh: fh.write(template.render(template_data)) print(f"Output available in {BUILD_DIR}")
StarcoderdataPython
3376632
# Python imports import requests # Local imports import exceptions from timeline import Timeline from contacts import Contacts class User(object): """ Represent an user for an application Access Google Glass timeline using : user.timeline Each user is defined by unique token : user.token """ def __init__(self, app=None, token=None, refresh_token=None, tokens=None): if tokens: token = tokens["access_token"] refresh_token = tokens["refresh_token"] self.app = app self.token = token self.refresh_token = refresh_token self.session = self.app.oauth.get_session(token=self.token) self.session.headers.update({'Content-Type': 'application/json'}) self.timeline = Timeline(self) self.contacts = Contacts(self) def refresh_token(self): """ Refresh user token and return tokens dict """ if not self.refresh_token: raise Exception("No refresh token for this user") tokens = self.app.oauth.get_raw_access_token(data={ 'refresh_token': self.refresh_token, 'grant_type': 'refresh_token' }).json() self.token = tokens["access_token"] return self.tokens def request(self, *args, **kwargs): """ Return a request with the user session """ r = self.session.request(*args, **kwargs) try: r.raise_for_status() except requests.HTTPError, e: if e.response.status_code == 401: raise exceptions.RefreshTokenException() else: raise e return r @property def tokens(self): """ Return tokens in a dict """ return { "access_token": self.token, "refresh_token": self.refresh_token } def profile(self): """ Return profile informations about this user """ r = self.request("GET", "oauth2/v1/userinfo", params={'alt': 'json'}) profile = r.json() if (profile is None or not "given_name" in profile or not "email" in profile or not "name" in profile): raise exceptions.UserException("Invalid user profile") return profile def location(self, lid="latest"): """ Return the last known location or a specific location :param lid: location id ("latest" for the last known location) """ r = self.request("GET", "mirror/v1/locations/%s" % (lid)) location = r.json() if (location is None or not "latitude" in location or not "longitude" in location): raise exceptions.UserException("Invalid user location") return location
StarcoderdataPython
134053
# # Dispatcher.py # # (c) 2020 by <NAME> # License: BSD 3-Clause License. See the LICENSE file for further details. # # Most internal requests are routed through here. # from __future__ import annotations import sys, traceback, re from copy import deepcopy import isodate from flask import Request from typing import Any, Tuple, Dict, Callable from Logging import Logging from Configuration import Configuration from Constants import Constants as C from Types import ResourceTypes as T from Types import FilterOperation from Types import FilterUsage from Types import ResponseType from Types import Permission from Types import Operation from Types import DesiredIdentifierResultType from Types import ResultContentType as RCN from Types import ResponseCode as RC from Types import Result from Types import RequestArguments from Types import RequestHeaders from Types import RequestStatus from Types import CSERequest from Types import JSON, Parameters, Conditions import CSE, Utils from resources.Resource import Resource import resources.Factory as Factory class Dispatcher(object): def __init__(self) -> None: self.csiSlash = f'{CSE.cseCsi}/' self.csiSlashLen = len(self.csiSlash) self.sortDiscoveryResources = Configuration.get('cse.sortDiscoveredResources') Logging.log('Dispatcher initialized') def shutdown(self) -> bool: Logging.log('Dispatcher shut down') return True # The "xxxRequest" methods handle http requests while the "xxxResource" # methods handle actions on the resources. Security/permission checking # is done for requests, not on resource actions. ######################################################################### # # Retrieve resources # def processRetrieveRequest(self, request:CSERequest, originator:str, id:str=None) -> Result: fopsrn, id = self._checkHybridID(request, id) # overwrite id if another is given # handle fanout point requests if (fanoutPointResource := Utils.fanoutPointResource(fopsrn)) is not None and fanoutPointResource.ty == T.GRP_FOPT: Logging.logDebug(f'Redirecting request to fanout point: {fanoutPointResource.__srn__}') return fanoutPointResource.handleRetrieveRequest(request, fopsrn, request.headers.originator) permission = Permission.DISCOVERY if request.args.fu == 1 else Permission.RETRIEVE # check rcn & operation if permission == Permission.DISCOVERY and request.args.rcn not in [ RCN.discoveryResultReferences, RCN.childResourceReferences ]: # Only allow those two return Result(rsc=RC.badRequest, dbg=f'invalid rcn: {request.args.rcn:d} for fu: {request.args.fu:d}') if permission == Permission.RETRIEVE and request.args.rcn not in [ RCN.attributes, RCN.attributesAndChildResources, RCN.childResources, RCN.attributesAndChildResourceReferences, RCN.originalResource, RCN.childResourceReferences]: # TODO return Result(rsc=RC.badRequest, dbg=f'invalid rcn: {request.args.rcn:d} for fu: {request.args.fu:d}') Logging.logDebug(f'Discover/Retrieve resources (fu: {request.args.fu:d}, drt: {request.args.drt}, handling: {request.args.handling}, conditions: {request.args.conditions}, resultContent: {request.args.rcn:d}, attributes: {str(request.args.attributes)})') # Retrieve the target resource, because it is needed for some rcn (and the default) if request.args.rcn in [RCN.attributes, RCN.attributesAndChildResources, RCN.childResources, RCN.attributesAndChildResourceReferences, RCN.originalResource]: if (res := self.retrieveResource(id)).resource is None: return res if not CSE.security.hasAccess(originator, res.resource, permission): return Result(rsc=RC.originatorHasNoPrivilege, dbg=f'originator has no permission ({permission:d})') # if rcn == attributes then we can return here, whatever the result is if request.args.rcn == RCN.attributes: return res resource = res.resource # root resource for the retrieval/discovery # if rcn == original-resource we retrieve the linked resource if request.args.rcn == RCN.originalResource: if resource is None: # continue only when there actually is a resource return res if (lnk := resource.lnk) is None: # no link attribute? return Result(rsc=RC.badRequest, dbg='missing lnk attribute in target resource') return self.retrieveResource(lnk, originator, raw=True) # do discovery # TODO simplify arguments if (res := self.discoverResources(id, originator, request.args.handling, request.args.fo, request.args.conditions, request.args.attributes, permission=permission)).lst is None: # not found? return res.errorResult() # check and filter by ACP. After this allowedResources only contains the resources that are allowed allowedResources = [] for r in res.lst: if CSE.security.hasAccess(originator, r, permission): allowedResources.append(r) # # Handle more sophisticated RCN # if request.args.rcn == RCN.attributesAndChildResources: self._resourceTreeDict(allowedResources, resource) # the function call add attributes to the target resource return Result(resource=resource) elif request.args.rcn == RCN.attributesAndChildResourceReferences: self._resourceTreeReferences(allowedResources, resource, request.args.drt) # the function call add attributes to the target resource return Result(resource=resource) elif request.args.rcn == RCN.childResourceReferences: #childResourcesRef: dict = { resource.tpe: {} } # Root resource as a dict with no attribute childResourcesRef = self._resourceTreeReferences(allowedResources, None, request.args.drt) return Result(resource=childResourcesRef) elif request.args.rcn == RCN.childResources: childResources:JSON = { resource.tpe : {} } # Root resource as a dict with no attribute self._resourceTreeDict(allowedResources, childResources[resource.tpe]) # Adding just child resources return Result(resource=childResources) elif request.args.rcn == RCN.discoveryResultReferences: # URIList return Result(resource=self._resourcesToURIList(allowedResources, request.args.drt)) else: return Result(rsc=RC.badRequest, dbg='wrong rcn for RETRIEVE') def retrieveResource(self, id:str=None, originator:str=None, raw:bool=False) -> Result: # If the ID is in SP-relative format then first check whether this is for the # local CSE. # If yes, then adjust the ID and try to retrieve it. # If no, then try to retrieve the resource from a connected (!) remote CSE. if id is not None: if id.startswith(self.csiSlash) and len(id) > self.csiSlashLen: # TODO for all operations? id = id[self.csiSlashLen:] else: if Utils.isSPRelative(id): return CSE.remote.retrieveRemoteResource(id, originator, raw) return self.retrieveLocalResource(srn=id) if Utils.isStructured(id) else self.retrieveLocalResource(ri=id) def retrieveLocalResource(self, ri:str=None, srn:str=None) -> Result: Logging.logDebug(f'Retrieve resource: {ri if srn is None else srn}') if ri is not None: res = CSE.storage.retrieveResource(ri=ri) # retrieve via normal ID elif srn is not None: res = CSE.storage.retrieveResource(srn=srn) # retrieve via srn. Try to retrieve by srn (cases of ACPs created for AE and CSR by default) else: return Result(rsc=RC.notFound, dbg='resource not found') if (resource := res.resource) is not None: # Check for virtual resource if resource.ty != T.GRP_FOPT and Utils.isVirtualResource(resource): # fopt is handled elsewhere return resource.handleRetrieveRequest() # type: ignore[no-any-return] return Result(resource=resource) if res.dbg is not None: Logging.logDebug(f'{res.dbg}: {ri}') return Result(rsc=res.rsc, dbg=res.dbg) ######################################################################### # # Discover Resources # def discoverResources(self, id:str, originator:str, handling:Conditions, fo:int=1, conditions:Conditions=None, attributes:Parameters=None, rootResource:Resource=None, permission:Permission=Permission.DISCOVERY) -> Result: Logging.logDebug('Discovering resources') if rootResource is None: if (res := self.retrieveResource(id)).resource is None: return Result(rsc=RC.notFound, dbg=res.dbg) rootResource = res.resource # get all direct children dcrs = self.directChildResources(id) # Slice the page (offset and limit) offset = handling['ofst'] if 'ofst' in handling else 1 # default: 1 (first resource limit = handling['lim'] if 'lim' in handling else sys.maxsize # default: system max size or "maxint" dcrs = dcrs[offset-1:offset-1+limit] # now dcrs only contains the desired child resources for ofst and lim # Get level level = handling['lvl'] if 'lvl' in handling else sys.maxsize # default: system max size or "maxint" # a bit of optimization. This length stays the same. allLen = len(attributes) if attributes is not None else 0 if conditions is not None: allLen += ( len(conditions) + (len(conditions.get('ty'))-1 if 'ty' in conditions else 0) + # -1 : compensate for len(conditions) in line 1 (len(conditions.get('cty'))-1 if 'cty' in conditions else 0) + # -1 : compensate for len(conditions) in line 1 (len(conditions.get('lbl'))-1 if 'lbl' in conditions else 0) # -1 : compensate for len(conditions) in line 1 ) # allLen = ((len(conditions) if conditions is not None else 0) + # (len(attributes) if attributes is not None else 0) + # (len(conditions.get('ty'))-1 if conditions is not None and 'ty' in conditions else 0) + # -1 : compensate for len(conditions) in line 1 # (len(conditions.get('cty'))-1 if conditions is not None else 0) + # -1 : compensate for len(conditions) in line 1 # (len(conditions.get('lbl'))-1 if conditions is not None else 0) # -1 : compensate for len(conditions) in line 1 # ) # Discover the resources discoveredResources = self._discoverResources(rootResource, originator, level, fo, allLen, dcrs=dcrs, conditions=conditions, attributes=attributes, permission=permission) # NOTE: this list contains all results in the order they could be found while # walking the resource tree. # DON'T CHANGE THE ORDER. DON'T SORT. # Because otherwise the tree cannot be correctly re-constructed otherwise # Apply ARP if provided if 'arp' in handling: arp = handling['arp'] result = [] for resource in discoveredResources: srn = f'{resource[Resource._srn]}/{arp}' if (res := self.retrieveResource(srn)).resource is not None: if CSE.security.hasAccess(originator, res.resource, permission): result.append(res.resource) discoveredResources = result # re-assign the new resources to discoveredResources return Result(lst=discoveredResources) def _discoverResources(self, rootResource:Resource, originator:str, level:int, fo:int, allLen:int, dcrs:list[Resource]=None, conditions:Conditions=None, attributes:Parameters=None, permission:Permission=Permission.DISCOVERY) -> list[Resource]: if rootResource is None or level == 0: # no resource or level == 0 return [] # get all direct children, if not provided if dcrs is None: if len(dcrs := self.directChildResources(rootResource.ri)) == 0: return [] # Filter and add those left to the result discoveredResources = [] for r in dcrs: # Exclude virtual resources if Utils.isVirtualResource(r): continue # check permissions and filter. Only then add a resource # First match then access. bc if no match then we don't need to check permissions (with all the overhead) if self._matchResource(r, conditions, attributes, fo, allLen) and CSE.security.hasAccess(originator, r, permission): discoveredResources.append(r) # Iterate recursively over all (not only the filtered) direct child resources discoveredResources.extend(self._discoverResources(r, originator, level-1, fo, allLen, conditions=conditions, attributes=attributes)) return discoveredResources def _matchResource(self, r:Resource, conditions:Conditions, attributes:Parameters, fo:int, allLen:int) -> bool: """ Match a filter to a resource. """ # TODO: Implement a couple of optimizations. Can we determine earlier that a match will fail? ty = r.ty # get the parent resource # # TODO when determines how the parentAttribute is actually encoded # # pr = None # if (pi := r.get('pi')) is not None: # pr = storage.retrieveResource(ri=pi) # The matching works like this: go through all the conditions, compare them, and # increment 'found' when matching. For fo=AND found must equal all conditions. # For fo=OR found must be > 0. found = 0 # check conditions if conditions is not None: # Types # Multiple occurences of ty is always OR'ed. Therefore we add the count of # ty's to found (to indicate that the whole set matches) if (tys := conditions.get('ty')) is not None: found += len(tys) if str(ty) in tys else 0 if (ct := r.ct) is not None: found += 1 if (c_crb := conditions.get('crb')) is not None and (ct < c_crb) else 0 found += 1 if (c_cra := conditions.get('cra')) is not None and (ct > c_cra) else 0 if (lt := r.lt) is not None: found += 1 if (c_ms := conditions.get('ms')) is not None and (lt > c_ms) else 0 found += 1 if (c_us := conditions.get('us')) is not None and (lt < c_us) else 0 if (st := r.st) is not None: found += 1 if (c_sts := conditions.get('sts')) is not None and (str(st) > c_sts) else 0 found += 1 if (c_stb := conditions.get('stb')) is not None and (str(st) < c_stb) else 0 if (et := r.et) is not None: found += 1 if (c_exb := conditions.get('exb')) is not None and (et < c_exb) else 0 found += 1 if (c_exa := conditions.get('exa')) is not None and (et > c_exa) else 0 # Check labels similar to types rlbl = r.lbl if rlbl is not None and (lbls := conditions.get('lbl')) is not None: for l in lbls: if l in rlbl: found += len(lbls) break # special handling of label-list # if (lbl := r.lbl) is not None and (c_lbl := conditions.get('lbl')) is not None: # lbla = c_lbl.split() # fnd = 0 # for l in lbla: # fnd += 1 if l in lbl else 0 # found += 1 if (fo == 1 and fnd == len(lbl)) or (fo == 2 and fnd > 0) else 0 # fo==or -> find any label # # TODO labelsQuery if ty in [ T.CIN, T.FCNT ]: # special handling for CIN, FCNT if (cs := r.cs) is not None: found += 1 if (sza := conditions.get('sza')) is not None and (int(cs) >= int(sza)) else 0 found += 1 if (szb := conditions.get('szb')) is not None and (int(cs) < int(szb)) else 0 # ContentFormats # Multiple occurences of cnf is always OR'ed. Therefore we add the count of # cnf's to found (to indicate that the whole set matches) # Similar to types. if ty in [ T.CIN ]: # special handling for CIN if (cnfs := conditions.get('cty')) is not None: found += len(cnfs) if r.cnf in cnfs else 0 # TODO childLabels # TODO parentLabels # TODO childResourceType # TODO parentResourceType # Attributes: if attributes is not None: for name in attributes: val = attributes[name] if '*' in val: val = val.replace('*', '.*') found += 1 if (rval := r[name]) is not None and re.match(val, str(rval)) else 0 else: found += 1 if (rval := r[name]) is not None and str(val) == str(rval) else 0 # TODO childAttribute # TODO parentAttribute # Test whether the OR or AND criteria is fullfilled if not ((fo == FilterOperation.OR and found > 0) or # OR and found something (fo == FilterOperation.AND and allLen == found) # AND and found everything ): return False return True ######################################################################### # # Add resources # def processCreateRequest(self, request:CSERequest, originator:str, id:str=None) -> Result: fopsrn, id = self._checkHybridID(request, id) # overwrite id if another is given # # overwrite id if another is given # if id is not None: # id = id # srn = None # else: # id = request.id # srn = request.srn # fopsrn, id = Utils.srnFromHybrid(srn, id) # Hybrid # handle fanout point requests if (fanoutPointResource := Utils.fanoutPointResource(fopsrn)) is not None and fanoutPointResource.ty == T.GRP_FOPT: Logging.logDebug(f'Redirecting request to fanout point: {fanoutPointResource.__srn__}') return fanoutPointResource.handleCreateRequest(request, fopsrn, request.headers.originator) if (ty := request.headers.resourceType) is None: # Check for type parameter in request return Result(rsc=RC.badRequest, dbg='type parameter missing in CREATE request') # Some Resources are not allowed to be created in a request, return immediately if ty in [ T.CSEBase, T.REQ ]: return Result(rsc=RC.operationNotAllowed, dbg='operation not allowed') # Get parent resource and check permissions if (res := CSE.dispatcher.retrieveResource(id)).resource is None: Logging.log('Parent resource not found') return Result(rsc=RC.notFound, dbg='parent resource not found') parentResource = res.resource if CSE.security.hasAccess(originator, parentResource, Permission.CREATE, ty=ty, isCreateRequest=True, parentResource=parentResource) == False: if ty == T.AE: return Result(rsc=RC.securityAssociationRequired, dbg='security association required') else: return Result(rsc=RC.originatorHasNoPrivilege, dbg='originator has no privileges') # Check for virtual resource if Utils.isVirtualResource(parentResource): return parentResource.handleCreateRequest(request, id, originator) # type: ignore[no-any-return] # Add new resource if (nres := Factory.resourceFromDict(deepcopy(request.dict), pi=parentResource.ri, ty=ty)).resource is None: # something wrong, perhaps wrong type return Result(rsc=RC.badRequest, dbg=nres.dbg) nresource = nres.resource # Check whether the parent allows the adding if not (res := parentResource.childWillBeAdded(nresource, originator)).status: return res.errorResult() # check whether the resource already exists, either via ri or srn # hasResource() may actually perform the test in one call, but we want to give a distinguished debug message if CSE.storage.hasResource(ri=nresource.ri): Logging.logWarn(dbg := f'Resource with ri: {nresource.__srn__} already exists') return Result(rsc=RC.conflict, dbg=dbg) if CSE.storage.hasResource(srn=nresource.__srn__): Logging.logWarn(dbg := f'Resource with structured id: {nresource.__srn__} already exists') return Result(rsc=RC.conflict, dbg=dbg) # Check resource creation if (rres := CSE.registration.checkResourceCreation(nresource, originator, parentResource)).rsc != RC.OK: return rres.errorResult() originator = rres.originator # originator might have changed during this check # Create the resource. If this fails we deregister everything if (res := CSE.dispatcher.createResource(nresource, parentResource, originator)).resource is None: CSE.registration.checkResourceDeletion(nresource) # deregister resource. Ignore result, we take this from the creation return res # # Handle RCN's # tpe = res.resource.tpe if request.args.rcn is None or request.args.rcn == RCN.attributes: # Just the resource & attributes return res elif request.args.rcn == RCN.modifiedAttributes: dictOrg = request.dict[tpe] dictNew = res.resource.asDict()[tpe] return Result(resource={ tpe : Utils.resourceDiff(dictOrg, dictNew) }, rsc=res.rsc, dbg=res.dbg) elif request.args.rcn == RCN.hierarchicalAddress: return Result(resource={ 'm2m:uri' : Utils.structuredPath(res.resource) }, rsc=res.rsc, dbg=res.dbg) elif request.args.rcn == RCN.hierarchicalAddressAttributes: return Result(resource={ 'm2m:rce' : { Utils.noDomain(tpe) : res.resource.asDict()[tpe], 'uri' : Utils.structuredPath(res.resource) }}, rsc=res.rsc, dbg=res.dbg) elif request.args.rcn == RCN.nothing: return Result(rsc=res.rsc, dbg=res.dbg) else: return Result(rsc=RC.badRequest, dbg='wrong rcn for CREATE') # TODO C.rcnDiscoveryResultReferences def createResource(self, resource:Resource, parentResource:Resource=None, originator:str=None) -> Result: Logging.logDebug(f'Adding resource ri: {resource.ri}, type: {resource.ty:d}') if parentResource is not None: Logging.logDebug(f'Parent ri: {parentResource.ri}') if not parentResource.canHaveChild(resource): if resource.ty == T.SUB: err = 'Parent resource is not subscribable' Logging.logWarn(err) return Result(rsc=RC.targetNotSubscribable, dbg=err) else: err = f'Invalid child resource type: {T(resource.ty).value}' Logging.logWarn(err) return Result(rsc=RC.invalidChildResourceType, dbg=err) # if not already set: determine and add the srn if resource.__srn__ is None: resource[resource._srn] = Utils.structuredPath(resource) # add the resource to storage if (res := resource.dbCreate(overwrite=False)).rsc != RC.created: return res # Activate the resource # This is done *after* writing it to the DB, because in activate the resource might create or access other # resources that will try to read the resource from the DB. if not (res := resource.activate(parentResource, originator)).status: # activate the new resource resource.dbDelete() return res.errorResult() # Could be that we changed the resource in the activate, therefore write it again if (res := resource.dbUpdate()).resource is None: resource.dbDelete() return res if parentResource is not None: parentResource = parentResource.dbReload().resource # Read the resource again in case it was updated in the DB parentResource.childAdded(resource, originator) # notify the parent resource # send a create event CSE.event.createResource(resource) # type: ignore return Result(resource=resource, rsc=RC.created) # everything is fine. resource created. ######################################################################### # # Update resources # def processUpdateRequest(self, request:CSERequest, originator:str, id:str=None) -> Result: fopsrn, id = self._checkHybridID(request, id) # overwrite id if another is given # # overwrite id if another is given # if id is not None: # id = id # srn = None # else: # id = request.id # srn = request.srn # fopsrn, id = Utils.srnFromHybrid(srn, id) # Hybrid # handle fanout point requests if (fanoutPointResource := Utils.fanoutPointResource(fopsrn)) is not None and fanoutPointResource.ty == T.GRP_FOPT: Logging.logDebug(f'Redirecting request to fanout point: {fanoutPointResource.__srn__}') return fanoutPointResource.handleUpdateRequest(request, fopsrn, request.headers.originator) # Get resource to update if (res := self.retrieveResource(id)).resource is None: Logging.log('Resource not found') return Result(rsc=RC.notFound, dbg=res.dbg) resource = res.resource if resource.readOnly: return Result(rsc=RC.operationNotAllowed, dbg='resource is read-only') # # Permission check # If this is an 'acpi' update? if not (res := CSE.security.hasAcpiUpdatePermission(request, resource, originator)).status: return res if res.data is None: # data == None indicates that this is NOT an ACPI update. In this case we need a normal permission check if CSE.security.hasAccess(originator, resource, Permission.UPDATE) == False: return Result(rsc=RC.originatorHasNoPrivilege, dbg='originator has no privileges') # Check for virtual resource if Utils.isVirtualResource(resource): return resource.handleUpdateRequest(request, id, originator) # type: ignore[no-any-return] dictOrg = deepcopy(resource.dict) # Save for later if (res := self.updateResource(resource, deepcopy(request.dict), originator=originator)).resource is None: return res.errorResult() resource = res.resource # re-assign resource (might have been changed during update) # Check resource update with registration if (rres := CSE.registration.checkResourceUpdate(resource, deepcopy(request.dict))).rsc != RC.OK: return rres.errorResult() # # Handle RCN's # tpe = resource.tpe if request.args.rcn is None or request.args.rcn == RCN.attributes: return res elif request.args.rcn == RCN.modifiedAttributes: dictNew = deepcopy(resource.dict) # return only the diff. This includes those attributes that are updated with the same value. Luckily, # all key/values that are touched in the update request are in the resource's __modified__ variable. return Result(resource={ tpe : Utils.resourceDiff(dictOrg, dictNew, modifiers=resource[Resource._modified]) }, rsc=res.rsc) elif request.args.rcn == RCN.nothing: return Result(rsc=res.rsc) # TODO C.rcnDiscoveryResultReferences else: return Result(rsc=RC.badRequest, dbg='wrong rcn for UPDATE') def updateResource(self, resource:Resource, dct:JSON=None, doUpdateCheck:bool=True, originator:str=None) -> Result: Logging.logDebug(f'Updating resource ri: {resource.ri}, type: {resource.ty:d}') if doUpdateCheck: if not (res := resource.update(dct, originator)).status: return res.errorResult() else: Logging.logDebug('No check, skipping resource update') # send a create event CSE.event.updateResource(resource) # type: ignore return resource.dbUpdate() ######################################################################### # # Remove resources # def processDeleteRequest(self, request:CSERequest, originator:str, id:str=None) -> Result: fopsrn, id = self._checkHybridID(request, id) # overwrite id if another is given # if id is not None: # id = id # srn = None # else: # id = request.id # srn = request.srn # fopsrn, id = Utils.srnFromHybrid(srn, id) # Hybrid # handle fanout point requests if (fanoutPointResource := Utils.fanoutPointResource(fopsrn)) is not None and fanoutPointResource.ty == T.GRP_FOPT: Logging.logDebug(f'Redirecting request to fanout point: {fanoutPointResource.__srn__}') return fanoutPointResource.handleDeleteRequest(request, fopsrn, request.headers.originator) # get resource to be removed and check permissions if (res := self.retrieveResource(id)).resource is None: Logging.logDebug(res.dbg) return Result(rsc=RC.notFound, dbg=res.dbg) resource = res.resource if CSE.security.hasAccess(originator, resource, Permission.DELETE) == False: return Result(rsc=RC.originatorHasNoPrivilege, dbg='originator has no privileges') # Check for virtual resource if Utils.isVirtualResource(resource): return resource.handleDeleteRequest(request, id, originator) # type: ignore[no-any-return] # # Handle RCN's first. Afterward the resource & children are no more # tpe = resource.tpe result: Any = None if request.args.rcn is None or request.args.rcn == RCN.nothing: result = None elif request.args.rcn == RCN.attributes: result = resource # resource and child resources, full attributes elif request.args.rcn == RCN.attributesAndChildResources: children = self.discoverChildren(id, resource, originator, request.args.handling, Permission.DELETE) self._childResourceTree(children, resource) # the function call add attributes to the result resource. Don't use the return value directly result = resource # direct child resources, NOT the root resource elif request.args.rcn == RCN.childResources: children = self.discoverChildren(id, resource, originator, request.args.handling, Permission.DELETE) childResources:JSON = { resource.tpe : {} } # Root resource as a dict with no attributes self._resourceTreeDict(children, childResources[resource.tpe]) result = childResources elif request.args.rcn == RCN.attributesAndChildResourceReferences: children = self.discoverChildren(id, resource, originator, request.args.handling, Permission.DELETE) self._resourceTreeReferences(children, resource, request.args.drt) # the function call add attributes to the result resource result = resource elif request.args.rcn == RCN.childResourceReferences: # child resource references children = self.discoverChildren(id, resource, originator, request.args.handling, Permission.DELETE) childResourcesRef:JSON = { resource.tpe: {} } # Root resource with no attribute self._resourceTreeReferences(children, childResourcesRef[resource.tpe], request.args.drt) result = childResourcesRef # TODO RCN.discoveryResultReferences else: return Result(rsc=RC.badRequest, dbg='wrong rcn for DELETE') # remove resource res = self.deleteResource(resource, originator, withDeregistration=True) return Result(resource=result, rsc=res.rsc, dbg=res.dbg) def deleteResource(self, resource:Resource, originator:str=None, withDeregistration:bool=False, parentResource:Resource=None) -> Result: Logging.logDebug(f'Removing resource ri: {resource.ri}, type: {resource.ty:d}') resource.deactivate(originator) # deactivate it first # Check resource deletion if withDeregistration: if not (res := CSE.registration.checkResourceDeletion(resource)).status: return Result(rsc=RC.badRequest, dbg=res.dbg) # Retrieve the parent resource now, because we need it later if parentResource is None: parentResource = resource.retrieveParentResource() # delete the resource from the DB. Save the result to return later res = resource.dbDelete() # send a delete event CSE.event.deleteResource(resource) # type: ignore # Now notify the parent resource if parentResource is not None: parentResource.childRemoved(resource, originator) return Result(resource=resource, rsc=res.rsc, dbg=res.dbg) ######################################################################### # # Utility methods # def directChildResources(self, pi:str, ty:T=None) -> list[Resource]: """ Return all child resources of a resource, optionally filtered by type. """ return CSE.storage.directChildResources(pi, ty) def countDirectChildResources(self, pi:str, ty:T=None) -> int: """ Return the number of all child resources of resource, optionally filtered by type. """ return CSE.storage.countDirectChildResources(pi, ty) def discoverChildren(self, id:str, resource:Resource, originator:str, handling:JSON, permission:Permission) -> list[Resource]: if (resourceList := self.discoverResources(id, originator, handling, rootResource=resource, permission=permission).lst) is None: return None # check and filter by ACP children = [] for r in resourceList: if CSE.security.hasAccess(originator, r, permission): children.append(r) return children def countResources(self, ty:T|Tuple[T, ...]=None) -> int: """ Return total number of resources. Optional filter by type. """ # Count all resources if ty is None: return CSE.storage.countResources() # Count all resources of the given types if isinstance(ty, tuple): cnt = 0 for t in ty: cnt += len(CSE.storage.retrieveResourcesByType(t)) return cnt # Count all resources of a specific type return len(CSE.storage.retrieveResourcesByType(ty)) def retrieveResourcesByType(self, ty:T) -> list[Resource]: """ Retrieve all resources of a type. """ result = [] rss = CSE.storage.retrieveResourcesByType(ty) for rs in (rss or []): result.append(Factory.resourceFromDict(rs).resource) return result ######################################################################### # # Internal methods for collecting resources and child resources into structures # # Create a m2m:uril structure from a list of resources def _resourcesToURIList(self, resources:list[Resource], drt:int) -> JSON: cseid = f'{CSE.cseCsi}/' # SP relative. csi already starts with a "/" lst = [] for r in resources: lst.append(Utils.structuredPath(r) if drt == DesiredIdentifierResultType.structured else cseid + r.ri) return { 'm2m:uril' : lst } # Recursively walk the results and build a sub-resource tree for each resource type def _resourceTreeDict(self, resources:list[Resource], targetResource:Resource|JSON) -> list[Resource]: rri = targetResource['ri'] if 'ri' in targetResource else None while True: # go multiple times per level through the resources until the list is empty result = [] handledTy = None handledTPE = None idx = 0 while idx < len(resources): r = resources[idx] if rri is not None and r.pi != rri: # only direct children idx += 1 continue if r.ty in C.virtualResources: # Skip latest, oldest etc virtual resources idx += 1 continue if handledTy is None: handledTy = r.ty # this round we check this type handledTPE = r.tpe # ... and this TPE (important to distinguish specializations in mgmtObj and fcnt ) if r.ty == handledTy and r.tpe == handledTPE: # handle only resources of the currently handled type and TPE! result.append(r) # append the found resource resources.remove(r) # remove resource from the original list (greedy), but don't increment the idx resources = self._resourceTreeDict(resources, r) # check recursively whether this resource has children else: idx += 1 # next resource # add all found resources under the same type tag to the rootResource if len(result) > 0: # sort resources by type and then by lowercase rn if self.sortDiscoveryResources: result.sort(key=lambda x:(x.ty, x.rn.lower())) targetResource[result[0].tpe] = [r.asDict(embedded=False) for r in result] # TODO not all child resources are lists [...] Handle just to-1 relations else: break # end of list, leave while loop return resources # Return the remaining list def _resourceTreeReferences(self, resources:list[Resource], targetResource:Resource|JSON, drt:int) -> Resource|JSON: """ Retrieve child resource references of a resource and add them to a new target resource as "children" """ tp = 'ch' if targetResource is None: targetResource = { } tp = 'm2m:rrl' # top level in dict, so add qualifier. t = [] # sort resources by type and then by lowercase rn if self.sortDiscoveryResources: resources.sort(key=lambda x:(x.ty, x.rn.lower())) for r in resources: if r.ty in [ T.CNT_OL, T.CNT_LA, T.FCNT_OL, T.FCNT_LA ]: # Skip latest, oldest virtual resources continue ref = { 'nm' : r['rn'], 'typ' : r['ty'], 'val' : Utils.structuredPath(r) if drt == DesiredIdentifierResultType.structured else r.ri} if r.ty == T.FCNT: ref['spty'] = r.cnd # TODO Is this correct? Actually specializationID in TS-0004 6.3.5.29, but this seems to be wrong t.append(ref) targetResource[tp] = t return targetResource # Retrieve full child resources of a resource and add them to a new target resource def _childResourceTree(self, resources:list[Resource], targetResource:Resource|JSON) -> None: if len(resources) == 0: return result:JSON = {} self._resourceTreeDict(resources, result) # rootResource is filled with the result for k,v in result.items(): # copy child resources to result resource targetResource[k] = v ######################################################################### # # Internal methods for ID handling # def _checkHybridID(self, request:CSERequest, id:str) -> Tuple[str, str]: """ Return a corrected ID and SRN in case this is a hybrid ID. srn might be None. Returns: (srn, id) """ if id is not None: return Utils.srnFromHybrid(None, id) # Hybrid return Utils.srnFromHybrid(request.srn, request.id) # Hybrid
StarcoderdataPython
83749
def has_cycle(head): slowref=head if not slowref or not slowref.next: return False fastref=head.next.next while slowref != fastref: slowref=slowref.next if not slowref or not slowref.next: return False fastref=fastref.next.next return True
StarcoderdataPython
1652816
<gh_stars>10-100 from keras.layers import Conv2D, SeparableConv2D, MaxPooling2D, Flatten, Dense from keras.layers import Dropout, Input, BatchNormalization, Activation, add, GlobalAveragePooling2D from keras.losses import categorical_crossentropy from keras.optimizers import Adam from keras.utils import plot_model from keras import callbacks from keras import models from keras.applications import Xception from utils_datagen import TrainValTensorBoard from utils_basic import chk_n_mkdir from models.base_model import BaseModel class XCEPTION_APP(BaseModel): def __init__(self, output_directory, input_shape, n_classes, verbose=False): self.output_directory = output_directory + '/xception_kapp' chk_n_mkdir(self.output_directory) self.model = self.build_model(input_shape, n_classes) if verbose: self.model.summary() self.verbose = verbose self.model.save_weights(self.output_directory + '/model_init.hdf5') def build_model(self, input_shape, n_classes): # Load the VGG model xception_conv = Xception(weights='imagenet', include_top=False, input_shape=input_shape) # Freeze the layers except the last 4 layers for layer in xception_conv.layers: layer.trainable = False # Create the model model = models.Sequential() # Add the vgg convolutional base model model.add(xception_conv) # Add new layers model.add(Flatten()) model.add(Dense(1024, activation='relu')) model.add(Dropout(0.5)) model.add(Dense(n_classes, activation='softmax', name='predictions')) # define the model with input layer and output layer model.summary() plot_model(model, to_file=self.output_directory + '/model_graph.png', show_shapes=True, show_layer_names=True) model.compile(loss=categorical_crossentropy, optimizer=Adam(lr=0.01), metrics=['acc']) # model save file_path = self.output_directory + '/best_model.hdf5' model_checkpoint = callbacks.ModelCheckpoint(filepath=file_path, monitor='loss', save_best_only=True) # Tensorboard log log_dir = self.output_directory + '/tf_logs' chk_n_mkdir(log_dir) tb_cb = TrainValTensorBoard(log_dir=log_dir) self.callbacks = [model_checkpoint, tb_cb] return model
StarcoderdataPython
118075
<filename>simulation/horaire.py """ Composants reliés à l'horaire d'activité. ----------------------------------------- """ from .. import ecs from . import stochastique class Horaire(ecs.Component): """Horaire de base se répétant a intervalle fixe.""" def __init__(self, mom, cible, mtags, periode): """Configure l'horaire. La var d'état clef est ``actif`` et est dans un composant target. C'est le target qui est responsable de l'initialisation. C'est le target qui est responsable de l'initialisation. Cette version de horaire peut être mise-à-jour à la seconde ou à la minute, ça ne change rien car les tags sont en minutes. :param mom: on garde un handle vers le moment :type mom: :class:`sim.base.Moment` :param cible: un composant target avec la var d'état ``actif`` :param mtags: la liste de triplet (j,h,m) de changement d'état, j=0 est le jour actuel :param periode: un triplet (j,h,m) pour la periode de cycle chaque j jours, h heures et m min """ self.mom=mom # instance de Moment self.target=cible # la target avec un horaire (doit avoir une var d'etat actif) self.periode=60*(periode[0]*1440+periode[1]*60+periode[2]) # les tags de changement (en secondes) d'etat de self.target.actif sur 24h self.tags=[60*(x[0]*1440+x[1]*60+x[2])-self.mom.t0 for x in mtags] self.nextTagIdx=0 # on suppose partir de mom.t0 et que self.tags[0]>mom.t0 if not self.tags: print("Attention! Horaire: Pas de tags") def update(self): """ Update la var d'état ``actif`` dans le target selon la minute actuelle et les tags.""" if self.tags and (self.mom.t%self.periode)==self.tags[self.nextTagIdx]: self.target.actif=not self.target.actif self.nextTagIdx+=1 if self.nextTagIdx>=len(self.tags): self.nextTagIdx=0 class HoraireSto(ecs.Component): """Horaire de base se répétant a intervalle fixe.""" def __init__(self, mom, cible, mtags, periode, mtbf, mttr, mttrMin=-1, mttrAlpha=-1): """Configure l'horaire. La var d'état clef est ``actif`` et est dans un composant target. C'est le target qui est responsable de l'initialisation. Cette version de horaire peut être mise-à-jour à la seconde ou à la minute, ça ne change rien car les tags sont en minutes. Il faut fournir les mtbf et mttr en minutes. Par defaut, la durée d'un bris est fixée à mttf. Cependant, si on donne des valeurs acceptable pour mttrMin et mttrAlpha, on utilise une loi triangulaire. En outre, il faut respecter mttrMin<mttr, 0.0<=mttrAlpha<=1.0. On fixe mttrMode=mttrMin+mttrAlpha*(mttr-mttrMin). Ainsi, avec mttrAlpha=0 la loi s'étire au maximum vers les grandes valeurs et avec mttrAlpha=1 la loi est centrée symétrique sur la moyenne. :param mom: on garde un handle vers le moment :type mom: :class:`sim.base.Moment` :param cible: un composant target avec la var d'état ``actif`` :param mtags: la liste de triplet (j,h,m) de changement d'état, j=0 est le jour actuel :param periode: un triplet (j,h,m) pour la periode de cycle chaque j jours, h heures et m min :param mtbf: mean time b4 failure en minutes wallclock :param mttr: mean time to repair en minutes wallclock :param mttrMin: mttr min pour loi triangulaire :param mttrAlpha: facteur dans [0,1] pour le décentrement de la loi triangulaire (1=centré) """ self.mom=mom # instance de Moment self.target=cible # la target avec un horaire (doit avoir une var d'etat actif) self.periode=60*(periode[0]*1440+periode[1]*60+periode[2]) # les tags de changement (en secondes) d'etat de self.target.actif sur 24h self.tags=[60*(x[0]*1440+x[1]*60+x[2])-self.mom.t0 for x in mtags] self.nextTagIdx=0 # on suppose partir de mom.t0 et que self.tags[0]>mom.t0 # partie stochastique self.triggerFreq=stochastique.TriggerFrequence(1.0/mtbf) self.mttr=stochastique.ConstantValue(mttr) if 0<mttrMin and mttrMin<mttr and 0<=mttrAlpha and mttrAlpha<=1: mttrMode=(int)(mttrMin+mttrAlpha*(mttr-mttrMin)) mttrMax=3*mttr-mttrMin-mttrMode if mttr<mttrMax: print("HoraireSto avec loi triangulaire (min,mode,moy,max)=",mttrMin,mttrMode,mttr,mttrMax) self.mttr=stochastique.TriangularDistributionSample(mttrMin,mttrMax,mttrMode) self.actif_horaire=self.target.actif # set l'etat horaire selon le target self.duree_arret=0 # en minute self.new_trigger=False def update(self): """ Update la var d'état ``actif`` dans le target selon la minute actuelle et les tags.""" self.new_trigger=False if self.nextTagIdx>=len(self.tags): pass # pas de tag, donc pas de changement d'etat #print("Erreur HoraireJour: Pas de tags") elif (self.mom.t%self.periode)==self.tags[self.nextTagIdx]: self.actif_horaire=not self.actif_horaire # etat de l'horaire self.nextTagIdx+=1 if self.nextTagIdx>=len(self.tags): self.nextTagIdx=0 if self.mom.tickM: # tick a la minute self.duree_arret-=1 if self.triggerFreq.get(): self.new_trigger=True #print(" *** trigger!",self.mom.getJHMS()) self.duree_arret=self.mttr.get() #if self.duree_arret==1: print(" === fin trigger!",self.mom.getJHMS()) if self.duree_arret>0: self.target.actif=False else: self.target.actif=self.actif_horaire class HoraireStoTAP(ecs.Component): """Horaire stochastique special pour une TAP, avec répétition.""" def __init__(self, mom, cible, mtags, periode, arretplan, freq=None, arretnonplan=None): """Configure l'horaire. La var d'état clef est ``actif`` et est dans un composant target. On force l'initialisation a True. Les tags imposent les debuts des arrets planifies. :param mom: on garde un handle vers l'entité père :type mom: :class:`sim.base.Moment` :param cible: un composant target avec la var d'état ``actif`` :param mtags: la liste de triplet (j,h,m) de changement d'état, j=0 est le jour actuel :param periode: un triplet (j,h,m) pour la periode de cycle chaque j jours, h heures et m min :param arretplan: est un objet avec la methode ``get`` pour obtenir la duree des arrets dans mtags (en secondes) :param freq: est un objet qui trigger un arrets non-planifies :param arretnonplan: est un objet avec la methode ``get`` pour obtenir la duree des arrets non-planifies genere via freq (en secondes) """ self.mom=mom # instance de Moment self.target=cible # la target avec un horaire (doit avoir une var d'etat actif) self.periode=60*(periode[0]*1440+periode[1]*60+periode[2]) # les tags de changement (en secondes) d'etat de self.target.actif sur 24h self.tags=[60*(x[0]*1440+x[1]*60+x[2])-self.mom.t0 for x in mtags] self.nextTagIdx=0 # on suppose partir de mom.t0 et que self.tags[0]>mom.t0 self.arretplan=arretplan # objet avec methode get de la duree d'un arret plan self.freq=freq # objet frequence avec methode get de trigger d'un arret non-plan self.arretnonplan=arretnonplan # objet avec methode get de la duree d'un arret non-plan self.target.actif=True # init a True self.duree=-1 # duree de l'arret en cours self.trigger=False # trigger d'un arret non-plan def update(self): """ Update la var d'état ``actif`` dans le target selon la minute actuelle et les tags.""" if self.freq is not None and not self.trigger: self.trigger=self.freq.get() # test de trigger d'un arret nonplan, si on en a pas deja un self.duree-=1 # decroit la duree d'un arret if self.nextTagIdx>=len(self.tags): print("Erreur HoraireStoTAP: Pas de tags") elif (self.mom.t%self.periode)==self.tags[self.nextTagIdx]: # debut d'un arret planifie self.duree=self.arretplan.get() # duree stochastique de l'arret planifie #print("Arret planifie (sec):",self.duree) self.nextTagIdx+=1 if self.nextTagIdx>=len(self.tags): self.nextTagIdx=0 if self.duree<=0 and self.trigger: # si pas en arret, mais qu'on a un trigger d'arret nonplan self.duree=self.arretnonplan.get() # duree de l'arret nonplan #print(" Arret non-planifie (sec):",self.duree) self.trigger=False # reset du trigger # cas special pour entrepot plein (on suppose qu'on a un handle sur l'entrepot) # le handle doit etre mis dans modele if self.duree<=0 and not self.entrepot.place4crue(): self.duree=24*3600 # pause de 48h (entrepot plein) (update 28 oct: 24h) #print(self.mom.getJHMS()," Pause TAP pour 48h car entrepot plein, duree de (sec)",self.duree) # update de actif if self.duree>0: self.target.actif=False # si en arret, alors non actif else: self.target.actif=True class HoraireJour(ecs.Component): """Horaire de base pour une journée (24h), se répétant. ATTENTION: desuet et non-supporte. """ def __init__(self, mom, cible, mtags): """Configure l'horaire. La var d'état clef est ``actif`` et est dans un composant target. C'est le target qui est responsable de l'initialisation. :param mom: on garde un handle vers l'entité père :type mom: :class:`sim.base.Moment` :param cible: un composant target avec la var d'état ``actif`` :param mtags: la liste de minutes de changement d'état, des entiers entre 0-1439 """ self.mom=mom # instance de Moment self.target=cible # la target avec un horaire (doit avoir une var d'etat actif) # les tags de changement (en secondes) d'etat de self.target.actif sur 24h self.tags=[x*60 for x in mtags] self.nextTagIdx=0 # on suppose partir de mom.t0 et que self.tags[0]>mom.t0 def update(self): """ Update la var d'état ``actif`` dans le target selon la minute actuelle et les tags.""" if self.nextTagIdx>=len(self.tags): print("Erreur HoraireJour: Pas de tags") elif self.mom.tnow==self.tags[self.nextTagIdx]: self.target.actif=not self.target.actif self.nextTagIdx+=1 if self.nextTagIdx>=len(self.tags): self.nextTagIdx=0
StarcoderdataPython
1685469
<gh_stars>1-10 # Copyright (c) 2019 - now, Eggroll Authors. All Rights Reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. import time import unittest from eggroll.core.pair_store import * from eggroll.core.pair_store.adapter import PairAdapter from eggroll.core.pair_store.format import ArrayByteBuffer, PairBinReader, PairBinWriter from eggroll.core.constants import StoreTypes class TestPairStore(unittest.TestCase): dir = "./" # total = 1000 * 1000 total = 100000 def _run_case(self, db: PairAdapter): start = time.time() value = 's' * 1000 with db.new_batch() as wb: for i in range(self.total): wb.put(str(i).encode(), value.encode()) print("put:", time.time() - start) for i in range(3): start = time.time() with db.iteritems() as rb: cnt = 0 for k, v in rb: if cnt % 100000 == 0: print("item:",cnt, k, v) cnt += 1 print(cnt) assert cnt == self.total print("time:", time.time() - start) def _run_join(self, db1: PairAdapter, db2: PairAdapter): start = time.time() value = 's' * 1000 with db1.new_batch() as wb: for i in range(self.total): wb.put(str(i).encode(), value.encode()) with db2.new_batch() as wb: for i in range(self.total): wb.put(str(i).encode(), value.encode()) print("put:", time.time() - start) with db1.iteritems() as rb1: cnt = 0 for k, v in rb1: if cnt % 100000 == 0: print("item:",cnt, k, v) cnt += 1 db2.get(k) print(cnt) assert cnt == self.total print("time:", time.time() - start) def test_lmdb(self): with create_pair_adapter({"store_type": StoreTypes.ROLLPAIR_LMDB, "path": self.dir + "LMDB"}) as db: self._run_case(db) db.destroy() def test_lmdb_seek(self): with create_pair_adapter({"store_type": StoreTypes.ROLLPAIR_LMDB, "path": "./data/LMDB/test_pair_store"}) as db: with db.new_batch() as wb: for i in range(7): if i == 5: continue wb.put(('k' + str(i)).encode(), ('v' + str(i)).encode()) with db.iteritems() as it: for k, v in it: print(k, v) print("++++++++++++++++++++++++++++++++++++++++++++++++") it.first() print(it.seek(b'k5')) for k, v in it: print(k, v) def test_rocksdb(self): with create_pair_adapter({"store_type": StoreTypes.ROLLPAIR_LEVELDB, "path": self.dir + "rocksdb"}) as db: self._run_case(db) db.destroy() def test_file(self): with create_pair_adapter({"store_type": StoreTypes.ROLLPAIR_FILE, "path": self.dir + "file"}) as db: self._run_case(db) db.destroy() def test_mmap(self): with create_pair_adapter({"store_type": StoreTypes.ROLLPAIR_MMAP, "path": self.dir + "mmap"}) as db: self._run_case(db) db.destroy() def test_cache(self): with create_pair_adapter({"store_type": StoreTypes.ROLLPAIR_CACHE, "path": self.dir + "cache"}) as db: self._run_case(db) db.destroy() def test_byte_buffer(self): bs = bytearray(1024) buf = ArrayByteBuffer(bs) buf.write_int32(12) buf.write_bytes(b"34") buf.set_offset(0) assert buf.read_int32() == 12 assert buf.read_bytes(2) == b"34" def test_pair_bin(self): bs = bytearray(32) buf = ArrayByteBuffer(bs) writer = PairBinWriter(buf) for i in range(10): try: writer.write(str(i).encode(), str(i).encode()) except IndexError as e: print(buf.read_bytes(buf.get_offset(), 0)) buf.set_offset(0) writer = PairBinWriter(buf) writer.write(str(i).encode(), str(i).encode()) buf.set_offset(0) reader = PairBinReader(buf) print("last") print(list(reader.read_all())) def test_join(self): with create_pair_adapter({"store_type": StoreTypes.ROLLPAIR_LMDB, "path": self.dir + "lmdb"}) as db1, \ create_pair_adapter({"store_type": StoreTypes.ROLLPAIR_LMDB, "path": self.dir + "lmdb2"}) as db2: self._run_join(db1, db2) db1.destroy() db2.destroy()
StarcoderdataPython
1608277
from hallo.events import EventMessage, EventMode from hallo.server import Server from hallo.test.server_mock import ServerMock def test_voice_not_irc(hallo_getter): test_hallo = hallo_getter({"channel_control"}) serv1 = ServerMock(test_hallo) serv1.name = "test_serv1" serv1.type = "NOT_IRC" test_hallo.add_server(serv1) chan1 = serv1.get_channel_by_address("test_chan1".lower(), "test_chan1") user1 = serv1.get_user_by_address("test_user1".lower(), "test_user1") chan1.add_user(user1) chan1.add_user( serv1.get_user_by_address(serv1.get_nick().lower(), serv1.get_nick()) ) try: test_hallo.function_dispatcher.dispatch(EventMessage(serv1, chan1, user1, "voice")) data = serv1.get_send_data(1, chan1, EventMessage) assert "error" in data[0].text.lower() assert "only available for irc" in data[0].text.lower() finally: test_hallo.remove_server(serv1) def test_voice_0_privmsg(hallo_getter): test_hallo = hallo_getter({"channel_control"}) serv1 = ServerMock(test_hallo) serv1.name = "test_serv1" serv1.type = Server.TYPE_IRC test_hallo.add_server(serv1) chan1 = serv1.get_channel_by_address("test_chan1".lower(), "test_chan1") user1 = serv1.get_user_by_address("test_user1".lower(), "test_user1") chan1.add_user(user1) chan1.add_user( serv1.get_user_by_address(serv1.get_nick().lower(), serv1.get_nick()) ) try: test_hallo.function_dispatcher.dispatch(EventMessage(serv1, None, user1, "voice")) data = serv1.get_send_data(1, user1, EventMessage) assert "error" in data[0].text.lower() assert "in a private message" in data[0].text.lower() finally: test_hallo.remove_server(serv1) def test_voice_0_no_power(hallo_getter): test_hallo = hallo_getter({"channel_control"}) serv1 = ServerMock(test_hallo) serv1.name = "test_serv1" serv1.type = Server.TYPE_IRC test_hallo.add_server(serv1) chan1 = serv1.get_channel_by_address("test_chan1".lower(), "test_chan1") chan1.in_channel = True user1 = serv1.get_user_by_address("test_user1".lower(), "test_user1") chan1.add_user(user1) chan1.add_user( serv1.get_user_by_address(serv1.get_nick().lower(), serv1.get_nick()) ) try: test_hallo.function_dispatcher.dispatch(EventMessage(serv1, chan1, user1, "voice")) data = serv1.get_send_data(1, chan1, EventMessage) assert "error" in data[0].text.lower() assert "don't have power" in data[0].text.lower() finally: test_hallo.remove_server(serv1) def test_voice_0_is_voice(hallo_getter): test_hallo = hallo_getter({"channel_control"}) serv1 = ServerMock(test_hallo) serv1.name = "test_serv1" serv1.type = Server.TYPE_IRC test_hallo.add_server(serv1) chan1 = serv1.get_channel_by_address("test_chan1".lower(), "test_chan1") chan1.in_channel = True user1 = serv1.get_user_by_address("test_user1".lower(), "test_user1") user_hallo = serv1.get_user_by_address(serv1.get_nick().lower(), serv1.get_nick()) chan1.add_user(user1) chan1.add_user(user_hallo) chan1_user1 = chan1.get_membership_by_user(user1) chan1_user1.is_op = False chan1_user1.is_voice = True chan1_hallo = chan1.get_membership_by_user(user_hallo) chan1_hallo.is_op = True try: test_hallo.function_dispatcher.dispatch(EventMessage(serv1, chan1, user1, "voice")) data = serv1.get_send_data(1, chan1, EventMessage) assert "error" in data[0].text.lower() assert "already has voice" in data[0].text.lower() finally: test_hallo.remove_server(serv1) def test_voice_0_is_op(hallo_getter): test_hallo = hallo_getter({"channel_control"}) serv1 = ServerMock(test_hallo) serv1.name = "test_serv1" serv1.type = Server.TYPE_IRC test_hallo.add_server(serv1) chan1 = serv1.get_channel_by_address("test_chan1".lower(), "test_chan1") chan1.in_channel = True user1 = serv1.get_user_by_address("test_user1".lower(), "test_user1") user_hallo = serv1.get_user_by_address(serv1.get_nick().lower(), serv1.get_nick()) chan1.add_user(user1) chan1.add_user(user_hallo) chan1_user1 = chan1.get_membership_by_user(user1) chan1_user1.is_op = True chan1_hallo = chan1.get_membership_by_user(user_hallo) chan1_hallo.is_op = True try: test_hallo.function_dispatcher.dispatch(EventMessage(serv1, chan1, user1, "voice")) data = serv1.get_send_data(1, chan1, EventMessage) assert "error" in data[0].text.lower() assert "already has voice" in data[0].text.lower() finally: test_hallo.remove_server(serv1) def test_voice_0(hallo_getter): test_hallo = hallo_getter({"channel_control"}) serv1 = ServerMock(test_hallo) serv1.name = "test_serv1" serv1.type = Server.TYPE_IRC test_hallo.add_server(serv1) chan1 = serv1.get_channel_by_address("test_chan1".lower(), "test_chan1") chan1.in_channel = True user1 = serv1.get_user_by_address("test_user1".lower(), "test_user1") user_hallo = serv1.get_user_by_address(serv1.get_nick().lower(), serv1.get_nick()) chan1.add_user(user1) chan1.add_user(user_hallo) chan1_user1 = chan1.get_membership_by_user(user1) chan1_user1.is_op = False chan1_hallo = chan1.get_membership_by_user(user_hallo) chan1_hallo.is_op = True try: test_hallo.function_dispatcher.dispatch(EventMessage(serv1, chan1, user1, "voice")) data = serv1.get_send_data(2) assert "error" not in data[1].text.lower() assert data[0].channel == chan1 assert data[1].channel == chan1 assert data[0].__class__ == EventMode assert data[1].__class__ == EventMessage assert data[0].mode_changes == "+v {}".format(user1.address) assert "status given" in data[1].text.lower() finally: test_hallo.remove_server(serv1) def test_voice_1priv_not_known(hallo_getter): test_hallo = hallo_getter({"channel_control"}) serv1 = ServerMock(test_hallo) serv1.name = "test_serv1" serv1.type = Server.TYPE_IRC test_hallo.add_server(serv1) chan1 = serv1.get_channel_by_address("test_chan1".lower(), "test_chan1") user1 = serv1.get_user_by_address("test_user1".lower(), "test_user1") user_hallo = serv1.get_user_by_address(serv1.get_nick().lower(), serv1.get_nick()) chan1.add_user(user1) chan1.add_user(user_hallo) chan1_user1 = chan1.get_membership_by_user(user1) chan1_user1.is_op = False chan1_hallo = chan1.get_membership_by_user(user_hallo) chan1_hallo.is_op = True try: test_hallo.function_dispatcher.dispatch( EventMessage(serv1, None, user1, "voice other_channel") ) data = serv1.get_send_data(1, user1, EventMessage) assert "error" in data[0].text.lower() assert "other_channel is not known" in data[0].text.lower() finally: test_hallo.remove_server(serv1) def test_voice_1priv_not_in_channel(hallo_getter): test_hallo = hallo_getter({"channel_control"}) serv1 = ServerMock(test_hallo) serv1.name = "test_serv1" serv1.type = Server.TYPE_IRC test_hallo.add_server(serv1) chan1 = serv1.get_channel_by_address("test_chan1".lower(), "test_chan1") serv1.get_channel_by_address("other_channel", "other_channel") user1 = serv1.get_user_by_address("test_user1".lower(), "test_user1") user_hallo = serv1.get_user_by_address(serv1.get_nick().lower(), serv1.get_nick()) chan1.add_user(user1) chan1.add_user(user_hallo) chan1_user1 = chan1.get_membership_by_user(user1) chan1_user1.is_op = False chan1_hallo = chan1.get_membership_by_user(user_hallo) chan1_hallo.is_op = True try: test_hallo.function_dispatcher.dispatch( EventMessage(serv1, None, user1, "voice other_channel") ) data = serv1.get_send_data(1, user1, EventMessage) assert "error" in data[0].text.lower() assert "not in that channel" in data[0].text.lower() finally: test_hallo.remove_server(serv1) def test_voice_1priv_user_not_there(hallo_getter): test_hallo = hallo_getter({"channel_control"}) serv1 = ServerMock(test_hallo) serv1.name = "test_serv1" serv1.type = Server.TYPE_IRC test_hallo.add_server(serv1) chan1 = serv1.get_channel_by_address("test_chan1".lower(), "test_chan1") chan1.in_channel = True user1 = serv1.get_user_by_address("test_user1".lower(), "test_user1") user_hallo = serv1.get_user_by_address(serv1.get_nick().lower(), serv1.get_nick()) chan1.add_user(user_hallo) chan1_hallo = chan1.get_membership_by_user(user_hallo) chan1_hallo.is_op = True try: test_hallo.function_dispatcher.dispatch( EventMessage(serv1, None, user1, "voice test_chan1") ) data = serv1.get_send_data(1, user1, EventMessage) assert "error" in data[0].text.lower() assert "test_user1 is not in test_chan1" in data[0].text.lower() finally: test_hallo.remove_server(serv1) def test_voice_1priv_no_power(hallo_getter): test_hallo = hallo_getter({"channel_control"}) serv1 = ServerMock(test_hallo) serv1.name = "test_serv1" serv1.type = Server.TYPE_IRC test_hallo.add_server(serv1) chan1 = serv1.get_channel_by_address("test_chan1".lower(), "test_chan1") chan1.in_channel = True user1 = serv1.get_user_by_address("test_user1".lower(), "test_user1") user_hallo = serv1.get_user_by_address(serv1.get_nick().lower(), serv1.get_nick()) chan1.add_user(user1) chan1.add_user(user_hallo) chan1_user1 = chan1.get_membership_by_user(user1) chan1_user1.is_op = False chan1_hallo = chan1.get_membership_by_user(user_hallo) chan1_hallo.is_op = False try: test_hallo.function_dispatcher.dispatch( EventMessage(serv1, None, user1, "voice test_chan1") ) data = serv1.get_send_data(1, user1, EventMessage) assert "error" in data[0].text.lower() assert "don't have power" in data[0].text.lower() finally: test_hallo.remove_server(serv1) def test_voice_1priv_is_voice(hallo_getter): test_hallo = hallo_getter({"channel_control"}) serv1 = ServerMock(test_hallo) serv1.name = "test_serv1" serv1.type = Server.TYPE_IRC test_hallo.add_server(serv1) chan1 = serv1.get_channel_by_address("test_chan1".lower(), "test_chan1") chan1.in_channel = True user1 = serv1.get_user_by_address("test_user1".lower(), "test_user1") user_hallo = serv1.get_user_by_address(serv1.get_nick().lower(), serv1.get_nick()) chan1.add_user(user1) chan1.add_user(user_hallo) chan1_user1 = chan1.get_membership_by_user(user1) chan1_user1.is_op = False chan1_user1.is_voice = True chan1_hallo = chan1.get_membership_by_user(user_hallo) chan1_hallo.is_op = True try: test_hallo.function_dispatcher.dispatch( EventMessage(serv1, None, user1, "voice test_chan1") ) data = serv1.get_send_data(1, user1, EventMessage) assert "error" in data[0].text.lower() assert "already has voice" in data[0].text.lower() finally: test_hallo.remove_server(serv1) def test_voice_1priv_is_op(hallo_getter): test_hallo = hallo_getter({"channel_control"}) serv1 = ServerMock(test_hallo) serv1.name = "test_serv1" serv1.type = Server.TYPE_IRC test_hallo.add_server(serv1) chan1 = serv1.get_channel_by_address("test_chan1".lower(), "test_chan1") chan1.in_channel = True user1 = serv1.get_user_by_address("test_user1".lower(), "test_user1") user_hallo = serv1.get_user_by_address(serv1.get_nick().lower(), serv1.get_nick()) chan1.add_user(user1) chan1.add_user(user_hallo) chan1_user1 = chan1.get_membership_by_user(user1) chan1_user1.is_op = True chan1_hallo = chan1.get_membership_by_user(user_hallo) chan1_hallo.is_op = True try: test_hallo.function_dispatcher.dispatch( EventMessage(serv1, None, user1, "voice test_chan1") ) data = serv1.get_send_data(1, user1, EventMessage) assert "error" in data[0].text.lower() assert "already has voice" in data[0].text.lower() finally: test_hallo.remove_server(serv1) def test_voice_1priv(hallo_getter): test_hallo = hallo_getter({"channel_control"}) serv1 = ServerMock(test_hallo) serv1.name = "test_serv1" serv1.type = Server.TYPE_IRC test_hallo.add_server(serv1) chan1 = serv1.get_channel_by_address("test_chan1".lower(), "test_chan1") chan1.in_channel = True user1 = serv1.get_user_by_address("test_user1".lower(), "test_user1") user_hallo = serv1.get_user_by_address(serv1.get_nick().lower(), serv1.get_nick()) chan1.add_user(user1) chan1.add_user(user_hallo) chan1_user1 = chan1.get_membership_by_user(user1) chan1_user1.is_op = False chan1_hallo = chan1.get_membership_by_user(user_hallo) chan1_hallo.is_op = True try: test_hallo.function_dispatcher.dispatch( EventMessage(serv1, None, user1, "voice test_chan1") ) data = serv1.get_send_data(2) assert "error" not in data[1].text.lower() assert data[0].channel == chan1 assert data[1].user == user1 assert data[0].__class__ == EventMode assert data[1].__class__ == EventMessage assert data[0].mode_changes == "+v {}".format(user1.address) assert "status given" in data[1].text.lower() finally: test_hallo.remove_server(serv1) def test_voice_1_chan_user_not_there(hallo_getter): test_hallo = hallo_getter({"channel_control"}) serv1 = ServerMock(test_hallo) serv1.name = "test_serv1" serv1.type = Server.TYPE_IRC test_hallo.add_server(serv1) chan1 = serv1.get_channel_by_address("test_chan1".lower(), "test_chan1") chan1.in_channel = True chan2 = serv1.get_channel_by_address("test_chan2".lower(), "test_chan2") chan2.in_channel = True user1 = serv1.get_user_by_address("test_user1".lower(), "test_user1") user2 = serv1.get_user_by_address("test_user2".lower(), "test_user2") user_hallo = serv1.get_user_by_address(serv1.get_nick().lower(), serv1.get_nick()) chan1.add_user(user1) chan1.add_user(user_hallo) chan2.add_user(user2) chan2.add_user(user_hallo) chan1_user1 = chan1.get_membership_by_user(user1) chan1_user1.is_op = False chan1_hallo = chan1.get_membership_by_user(user_hallo) chan1_hallo.is_op = True chan2_user2 = chan2.get_membership_by_user(user2) chan2_user2.is_op = False chan2_hallo = chan2.get_membership_by_user(user_hallo) chan2_hallo.is_op = True try: test_hallo.function_dispatcher.dispatch( EventMessage(serv1, chan1, user1, "voice test_chan2") ) data = serv1.get_send_data(1, chan1, EventMessage) assert "error" in data[0].text.lower() assert "test_user1 is not in test_chan2" in data[0].text.lower() finally: test_hallo.remove_server(serv1) def test_voice_1_chan_no_power(hallo_getter): test_hallo = hallo_getter({"channel_control"}) serv1 = ServerMock(test_hallo) serv1.name = "test_serv1" serv1.type = Server.TYPE_IRC test_hallo.add_server(serv1) chan1 = serv1.get_channel_by_address("test_chan1".lower(), "test_chan1") chan1.in_channel = True chan2 = serv1.get_channel_by_address("test_chan2".lower(), "test_chan2") chan2.in_channel = True user1 = serv1.get_user_by_address("test_user1".lower(), "test_user1") user2 = serv1.get_user_by_address("test_user2".lower(), "test_user2") user_hallo = serv1.get_user_by_address(serv1.get_nick().lower(), serv1.get_nick()) chan1.add_user(user1) chan1.add_user(user_hallo) chan2.add_user(user1) chan2.add_user(user_hallo) chan1_user1 = chan1.get_membership_by_user(user1) chan1_user1.is_op = False chan1_hallo = chan1.get_membership_by_user(user_hallo) chan1_hallo.is_op = True chan2_user1 = chan2.get_membership_by_user(user1) chan2_user1.is_op = False chan2_hallo = chan2.get_membership_by_user(user_hallo) chan2_hallo.is_op = False try: test_hallo.function_dispatcher.dispatch( EventMessage(serv1, chan1, user1, "voice test_chan2") ) data = serv1.get_send_data(1, chan1, EventMessage) assert "error" in data[0].text.lower() assert "don't have power" in data[0].text.lower() finally: test_hallo.remove_server(serv1) def test_voice_1_chan_is_voice(hallo_getter): test_hallo = hallo_getter({"channel_control"}) serv1 = ServerMock(test_hallo) serv1.name = "test_serv1" serv1.type = Server.TYPE_IRC test_hallo.add_server(serv1) chan1 = serv1.get_channel_by_address("test_chan1".lower(), "test_chan1") chan1.in_channel = True chan2 = serv1.get_channel_by_address("test_chan2".lower(), "test_chan2") chan2.in_channel = True user1 = serv1.get_user_by_address("test_user1".lower(), "test_user1") user2 = serv1.get_user_by_address("test_user2".lower(), "test_user2") user_hallo = serv1.get_user_by_address(serv1.get_nick().lower(), serv1.get_nick()) chan1.add_user(user1) chan1.add_user(user_hallo) chan2.add_user(user1) chan2.add_user(user_hallo) chan1_user1 = chan1.get_membership_by_user(user1) chan1_user1.is_op = False chan1_hallo = chan1.get_membership_by_user(user_hallo) chan1_hallo.is_op = True chan2_user1 = chan2.get_membership_by_user(user1) chan2_user1.is_op = False chan2_user1.is_voice = True chan2_hallo = chan2.get_membership_by_user(user_hallo) chan2_hallo.is_op = True try: test_hallo.function_dispatcher.dispatch( EventMessage(serv1, chan1, user1, "voice test_chan2") ) data = serv1.get_send_data(1, chan1, EventMessage) assert "error" in data[0].text.lower() assert "already has voice" in data[0].text.lower() finally: test_hallo.remove_server(serv1) def test_voice_1_chan_is_op(hallo_getter): test_hallo = hallo_getter({"channel_control"}) serv1 = ServerMock(test_hallo) serv1.name = "test_serv1" serv1.type = Server.TYPE_IRC test_hallo.add_server(serv1) chan1 = serv1.get_channel_by_address("test_chan1".lower(), "test_chan1") chan1.in_channel = True chan2 = serv1.get_channel_by_address("test_chan2".lower(), "test_chan2") chan2.in_channel = True user1 = serv1.get_user_by_address("test_user1".lower(), "test_user1") user2 = serv1.get_user_by_address("test_user2".lower(), "test_user2") user_hallo = serv1.get_user_by_address(serv1.get_nick().lower(), serv1.get_nick()) chan1.add_user(user1) chan1.add_user(user_hallo) chan2.add_user(user1) chan2.add_user(user_hallo) chan1_user1 = chan1.get_membership_by_user(user1) chan1_user1.is_op = False chan1_hallo = chan1.get_membership_by_user(user_hallo) chan1_hallo.is_op = True chan2_user1 = chan2.get_membership_by_user(user1) chan2_user1.is_op = True chan2_hallo = chan2.get_membership_by_user(user_hallo) chan2_hallo.is_op = True try: test_hallo.function_dispatcher.dispatch( EventMessage(serv1, chan1, user1, "voice test_chan2") ) data = serv1.get_send_data(1, chan1, EventMessage) assert "error" in data[0].text.lower() assert "already has voice" in data[0].text.lower() finally: test_hallo.remove_server(serv1) def test_voice_1_chan(hallo_getter): test_hallo = hallo_getter({"channel_control"}) serv1 = ServerMock(test_hallo) serv1.name = "test_serv1" serv1.type = Server.TYPE_IRC test_hallo.add_server(serv1) chan1 = serv1.get_channel_by_address("test_chan1".lower(), "test_chan1") chan1.in_channel = True chan2 = serv1.get_channel_by_address("test_chan2".lower(), "test_chan2") chan2.in_channel = True user1 = serv1.get_user_by_address("test_user1".lower(), "test_user1") user2 = serv1.get_user_by_address("test_user2".lower(), "test_user2") user_hallo = serv1.get_user_by_address(serv1.get_nick().lower(), serv1.get_nick()) chan1.add_user(user1) chan1.add_user(user_hallo) chan2.add_user(user1) chan2.add_user(user_hallo) chan1_user1 = chan1.get_membership_by_user(user1) chan1_user1.is_op = False chan1_hallo = chan1.get_membership_by_user(user_hallo) chan1_hallo.is_op = True chan2_user1 = chan2.get_membership_by_user(user1) chan2_user1.is_op = False chan2_hallo = chan2.get_membership_by_user(user_hallo) chan2_hallo.is_op = True try: test_hallo.function_dispatcher.dispatch( EventMessage(serv1, chan1, user1, "voice test_chan2") ) data = serv1.get_send_data(2) assert "error" not in data[1].text.lower() assert data[0].channel == chan2 assert data[1].channel == chan1 assert data[0].__class__ == EventMode assert data[1].__class__ == EventMessage assert data[0].mode_changes == "+v {}".format(user1.address) assert "status given" in data[1].text.lower() finally: test_hallo.remove_server(serv1) def test_voice_1_user_not_here(hallo_getter): test_hallo = hallo_getter({"channel_control"}) serv1 = ServerMock(test_hallo) serv1.name = "test_serv1" serv1.type = Server.TYPE_IRC test_hallo.add_server(serv1) chan1 = serv1.get_channel_by_address("test_chan1".lower(), "test_chan1") chan1.in_channel = True user1 = serv1.get_user_by_address("test_user1".lower(), "test_user1") user2 = serv1.get_user_by_address("test_user2".lower(), "test_user2") user_hallo = serv1.get_user_by_address(serv1.get_nick().lower(), serv1.get_nick()) chan1.add_user(user1) chan1_user1 = chan1.get_membership_by_user(user1) chan1_user1.is_op = False chan1.add_user(user_hallo) chan1_hallo = chan1.get_membership_by_user(user_hallo) chan1_hallo.is_op = True try: test_hallo.function_dispatcher.dispatch( EventMessage(serv1, chan1, user1, "voice test_user2") ) data = serv1.get_send_data(1, chan1, EventMessage) assert "error" in data[0].text.lower() assert "test_user2 is not in test_chan1" in data[0].text.lower() finally: test_hallo.remove_server(serv1) def test_voice_1_user_no_power(hallo_getter): test_hallo = hallo_getter({"channel_control"}) serv1 = ServerMock(test_hallo) serv1.name = "test_serv1" serv1.type = Server.TYPE_IRC test_hallo.add_server(serv1) chan1 = serv1.get_channel_by_address("test_chan1".lower(), "test_chan1") chan1.in_channel = True user1 = serv1.get_user_by_address("test_user1".lower(), "test_user1") user2 = serv1.get_user_by_address("test_user2".lower(), "test_user2") user_hallo = serv1.get_user_by_address(serv1.get_nick().lower(), serv1.get_nick()) chan1.add_user(user1) chan1_user1 = chan1.get_membership_by_user(user1) chan1_user1.is_op = False chan1.add_user(user_hallo) chan1_hallo = chan1.get_membership_by_user(user_hallo) chan1_hallo.is_op = False chan1.add_user(user2) chan1_user2 = chan1.get_membership_by_user(user2) chan1_user2.is_op = False try: test_hallo.function_dispatcher.dispatch( EventMessage(serv1, chan1, user1, "voice test_user2") ) data = serv1.get_send_data(1, chan1, EventMessage) assert "error" in data[0].text.lower() assert "don't have power" in data[0].text.lower() finally: test_hallo.remove_server(serv1) def test_voice_1_user_is_voice(hallo_getter): test_hallo = hallo_getter({"channel_control"}) serv1 = ServerMock(test_hallo) serv1.name = "test_serv1" serv1.type = Server.TYPE_IRC test_hallo.add_server(serv1) chan1 = serv1.get_channel_by_address("test_chan1".lower(), "test_chan1") chan1.in_channel = True user1 = serv1.get_user_by_address("test_user1".lower(), "test_user1") user2 = serv1.get_user_by_address("test_user2".lower(), "test_user2") user_hallo = serv1.get_user_by_address(serv1.get_nick().lower(), serv1.get_nick()) chan1.add_user(user1) chan1_user1 = chan1.get_membership_by_user(user1) chan1_user1.is_op = False chan1.add_user(user_hallo) chan1_hallo = chan1.get_membership_by_user(user_hallo) chan1_hallo.is_op = True chan1.add_user(user2) chan1_user2 = chan1.get_membership_by_user(user2) chan1_user2.is_op = False chan1_user2.is_voice = True try: test_hallo.function_dispatcher.dispatch( EventMessage(serv1, chan1, user1, "voice test_user2") ) data = serv1.get_send_data(1, chan1, EventMessage) assert "error" in data[0].text.lower() assert "already has voice" in data[0].text.lower() finally: test_hallo.remove_server(serv1) def test_voice_1_user_is_op(hallo_getter): test_hallo = hallo_getter({"channel_control"}) serv1 = ServerMock(test_hallo) serv1.name = "test_serv1" serv1.type = Server.TYPE_IRC test_hallo.add_server(serv1) chan1 = serv1.get_channel_by_address("test_chan1".lower(), "test_chan1") chan1.in_channel = True user1 = serv1.get_user_by_address("test_user1".lower(), "test_user1") user2 = serv1.get_user_by_address("test_user2".lower(), "test_user2") user_hallo = serv1.get_user_by_address(serv1.get_nick().lower(), serv1.get_nick()) chan1.add_user(user1) chan1_user1 = chan1.get_membership_by_user(user1) chan1_user1.is_op = False chan1.add_user(user_hallo) chan1_hallo = chan1.get_membership_by_user(user_hallo) chan1_hallo.is_op = True chan1.add_user(user2) chan1_user2 = chan1.get_membership_by_user(user2) chan1_user2.is_op = True try: test_hallo.function_dispatcher.dispatch( EventMessage(serv1, chan1, user1, "voice test_user2") ) data = serv1.get_send_data(1, chan1, EventMessage) assert "error" in data[0].text.lower() assert "already has voice" in data[0].text.lower() finally: test_hallo.remove_server(serv1) def test_voice_1_user(hallo_getter): test_hallo = hallo_getter({"channel_control"}) serv1 = ServerMock(test_hallo) serv1.name = "test_serv1" serv1.type = Server.TYPE_IRC test_hallo.add_server(serv1) chan1 = serv1.get_channel_by_address("test_chan1".lower(), "test_chan1") chan1.in_channel = True user1 = serv1.get_user_by_address("test_user1".lower(), "test_user1") user2 = serv1.get_user_by_address("test_user2".lower(), "test_user2") user_hallo = serv1.get_user_by_address(serv1.get_nick().lower(), serv1.get_nick()) chan1.add_user(user1) chan1_user1 = chan1.get_membership_by_user(user1) chan1_user1.is_op = False chan1.add_user(user_hallo) chan1_hallo = chan1.get_membership_by_user(user_hallo) chan1_hallo.is_op = True chan1.add_user(user2) chan1_user2 = chan1.get_membership_by_user(user2) chan1_user2.is_op = False try: test_hallo.function_dispatcher.dispatch( EventMessage(serv1, chan1, user1, "voice test_user2") ) data = serv1.get_send_data(2) assert "error" not in data[1].text.lower() assert data[0].channel == chan1 assert data[1].channel == chan1 assert data[0].__class__ == EventMode assert data[1].__class__ == EventMessage assert data[0].mode_changes == "+v {}".format(user2.address) assert "status given" in data[1].text.lower() finally: test_hallo.remove_server(serv1) def test_voice_2_chan_user_not_known(hallo_getter): test_hallo = hallo_getter({"channel_control"}) serv1 = ServerMock(test_hallo) serv1.name = "test_serv1" serv1.type = Server.TYPE_IRC test_hallo.add_server(serv1) chan1 = serv1.get_channel_by_address("test_chan1".lower(), "test_chan1") chan1.in_channel = True chan2 = serv1.get_channel_by_address("test_chan2".lower(), "test_chan2") chan2.in_channel = True user1 = serv1.get_user_by_address("test_user1".lower(), "test_user1") user2 = serv1.get_user_by_address("test_user2".lower(), "test_user2") user_hallo = serv1.get_user_by_address(serv1.get_nick().lower(), serv1.get_nick()) chan1.add_user(user1) chan1_user1 = chan1.get_membership_by_user(user1) chan1_user1.is_op = False chan1.add_user(user_hallo) chan1_hallo = chan1.get_membership_by_user(user_hallo) chan1_hallo.is_op = True chan2.add_user(user2) chan2_user1 = chan2.get_membership_by_user(user2) chan2_user1.is_op = False chan2.add_user(user_hallo) chan2_hallo = chan2.get_membership_by_user(user_hallo) chan2_hallo.is_op = True try: test_hallo.function_dispatcher.dispatch( EventMessage(serv1, chan1, user1, "voice test_chan2 test_user3") ) data = serv1.get_send_data(1, chan1, EventMessage) assert "error" in data[0].text.lower() assert "test_user3 is not known" in data[0].text.lower() finally: test_hallo.remove_server(serv1) def test_voice_2_chan_user_not_there(hallo_getter): test_hallo = hallo_getter({"channel_control"}) serv1 = ServerMock(test_hallo) serv1.name = "test_serv1" serv1.type = Server.TYPE_IRC test_hallo.add_server(serv1) chan1 = serv1.get_channel_by_address("test_chan1".lower(), "test_chan1") chan1.in_channel = True chan2 = serv1.get_channel_by_address("test_chan2".lower(), "test_chan2") chan2.in_channel = True user1 = serv1.get_user_by_address("test_user1".lower(), "test_user1") user2 = serv1.get_user_by_address("test_user2".lower(), "test_user2") serv1.get_user_by_address("test_user3", "test_user3") user_hallo = serv1.get_user_by_address(serv1.get_nick().lower(), serv1.get_nick()) chan1.add_user(user1) chan1_user1 = chan1.get_membership_by_user(user1) chan1_user1.is_op = False chan1.add_user(user_hallo) chan1_hallo = chan1.get_membership_by_user(user_hallo) chan1_hallo.is_op = True chan2.add_user(user2) chan2_user1 = chan2.get_membership_by_user(user2) chan2_user1.is_op = False chan2.add_user(user_hallo) chan2_hallo = chan2.get_membership_by_user(user_hallo) chan2_hallo.is_op = True try: test_hallo.function_dispatcher.dispatch( EventMessage(serv1, chan1, user1, "voice test_chan2 test_user3") ) data = serv1.get_send_data(1, chan1, EventMessage) assert "error" in data[0].text.lower() assert "test_user3 is not in test_chan2" in data[0].text.lower() finally: test_hallo.remove_server(serv1) def test_voice_2_chan_no_power(hallo_getter): test_hallo = hallo_getter({"channel_control"}) serv1 = ServerMock(test_hallo) serv1.name = "test_serv1" serv1.type = Server.TYPE_IRC test_hallo.add_server(serv1) chan1 = serv1.get_channel_by_address("test_chan1".lower(), "test_chan1") chan1.in_channel = True chan2 = serv1.get_channel_by_address("test_chan2".lower(), "test_chan2") chan2.in_channel = True user1 = serv1.get_user_by_address("test_user1".lower(), "test_user1") user2 = serv1.get_user_by_address("test_user2".lower(), "test_user2") user_hallo = serv1.get_user_by_address(serv1.get_nick().lower(), serv1.get_nick()) chan1.add_user(user1) chan1_user1 = chan1.get_membership_by_user(user1) chan1_user1.is_op = False chan1.add_user(user_hallo) chan1_hallo = chan1.get_membership_by_user(user_hallo) chan1_hallo.is_op = True chan2.add_user(user2) chan2_user1 = chan2.get_membership_by_user(user2) chan2_user1.is_op = False chan2.add_user(user_hallo) chan2_hallo = chan2.get_membership_by_user(user_hallo) chan2_hallo.is_op = False try: test_hallo.function_dispatcher.dispatch( EventMessage(serv1, chan1, user1, "voice test_chan2 test_user2") ) data = serv1.get_send_data(1, chan1, EventMessage) assert "error" in data[0].text.lower() assert "don't have power" in data[0].text.lower() finally: test_hallo.remove_server(serv1) def test_voice_2_chan_is_voice(hallo_getter): test_hallo = hallo_getter({"channel_control"}) serv1 = ServerMock(test_hallo) serv1.name = "test_serv1" serv1.type = Server.TYPE_IRC test_hallo.add_server(serv1) chan1 = serv1.get_channel_by_address("test_chan1".lower(), "test_chan1") chan1.in_channel = True chan2 = serv1.get_channel_by_address("test_chan2".lower(), "test_chan2") chan2.in_channel = True user1 = serv1.get_user_by_address("test_user1".lower(), "test_user1") user2 = serv1.get_user_by_address("test_user2".lower(), "test_user2") user_hallo = serv1.get_user_by_address(serv1.get_nick().lower(), serv1.get_nick()) chan1.add_user(user1) chan1_user1 = chan1.get_membership_by_user(user1) chan1_user1.is_op = False chan1.add_user(user_hallo) chan1_hallo = chan1.get_membership_by_user(user_hallo) chan1_hallo.is_op = True chan2.add_user(user2) chan2_user2 = chan2.get_membership_by_user(user2) chan2_user2.is_op = False chan2_user2.is_voice = True chan2.add_user(user_hallo) chan2_hallo = chan2.get_membership_by_user(user_hallo) chan2_hallo.is_op = True try: test_hallo.function_dispatcher.dispatch( EventMessage(serv1, chan1, user1, "voice test_chan2 test_user2") ) data = serv1.get_send_data(1, chan1, EventMessage) assert "error" in data[0].text.lower() assert "already has voice" in data[0].text.lower() finally: test_hallo.remove_server(serv1) def test_voice_2_chan_is_op(hallo_getter): test_hallo = hallo_getter({"channel_control"}) serv1 = ServerMock(test_hallo) serv1.name = "test_serv1" serv1.type = Server.TYPE_IRC test_hallo.add_server(serv1) chan1 = serv1.get_channel_by_address("test_chan1".lower(), "test_chan1") chan1.in_channel = True chan2 = serv1.get_channel_by_address("test_chan2".lower(), "test_chan2") chan2.in_channel = True user1 = serv1.get_user_by_address("test_user1".lower(), "test_user1") user2 = serv1.get_user_by_address("test_user2".lower(), "test_user2") user_hallo = serv1.get_user_by_address(serv1.get_nick().lower(), serv1.get_nick()) chan1.add_user(user1) chan1_user1 = chan1.get_membership_by_user(user1) chan1_user1.is_op = False chan1.add_user(user_hallo) chan1_hallo = chan1.get_membership_by_user(user_hallo) chan1_hallo.is_op = True chan2.add_user(user2) chan2_user2 = chan2.get_membership_by_user(user2) chan2_user2.is_op = True chan2.add_user(user_hallo) chan2_hallo = chan2.get_membership_by_user(user_hallo) chan2_hallo.is_op = True try: test_hallo.function_dispatcher.dispatch( EventMessage(serv1, chan1, user1, "voice test_chan2 test_user2") ) data = serv1.get_send_data(1, chan1, EventMessage) assert "error" in data[0].text.lower() assert "already has voice" in data[0].text.lower() finally: test_hallo.remove_server(serv1) def test_voice_2_chan(hallo_getter): test_hallo = hallo_getter({"channel_control"}) serv1 = ServerMock(test_hallo) serv1.name = "test_serv1" serv1.type = Server.TYPE_IRC test_hallo.add_server(serv1) chan1 = serv1.get_channel_by_address("test_chan1".lower(), "test_chan1") chan1.in_channel = True chan2 = serv1.get_channel_by_address("test_chan2".lower(), "test_chan2") chan2.in_channel = True user1 = serv1.get_user_by_address("test_user1".lower(), "test_user1") user2 = serv1.get_user_by_address("test_user2".lower(), "test_user2") user_hallo = serv1.get_user_by_address(serv1.get_nick().lower(), serv1.get_nick()) chan1.add_user(user1) chan1_user1 = chan1.get_membership_by_user(user1) chan1_user1.is_op = False chan1.add_user(user_hallo) chan1_hallo = chan1.get_membership_by_user(user_hallo) chan1_hallo.is_op = True chan2.add_user(user2) chan2_user2 = chan2.get_membership_by_user(user2) chan2_user2.is_op = False chan2.add_user(user_hallo) chan2_hallo = chan2.get_membership_by_user(user_hallo) chan2_hallo.is_op = True try: test_hallo.function_dispatcher.dispatch( EventMessage(serv1, chan1, user1, "voice test_chan2 test_user2") ) data = serv1.get_send_data(2) assert "error" not in data[1].text.lower() assert data[0].channel == chan2 assert data[1].channel == chan1 assert data[0].__class__ == EventMode assert data[1].__class__ == EventMessage assert data[0].mode_changes == "+v {}".format(user2.address) assert "status given" in data[1].text.lower() finally: test_hallo.remove_server(serv1) def test_voice_2_user_not_in_channel(hallo_getter): test_hallo = hallo_getter({"channel_control"}) serv1 = ServerMock(test_hallo) serv1.name = "test_serv1" serv1.type = Server.TYPE_IRC test_hallo.add_server(serv1) chan1 = serv1.get_channel_by_address("test_chan1".lower(), "test_chan1") chan1.in_channel = True chan2 = serv1.get_channel_by_address("test_chan2".lower(), "test_chan2") chan2.in_channel = False user1 = serv1.get_user_by_address("test_user1".lower(), "test_user1") user2 = serv1.get_user_by_address("test_user2".lower(), "test_user2") user_hallo = serv1.get_user_by_address(serv1.get_nick().lower(), serv1.get_nick()) chan1.add_user(user1) chan1_user1 = chan1.get_membership_by_user(user1) chan1_user1.is_op = False chan1.add_user(user_hallo) chan1_hallo = chan1.get_membership_by_user(user_hallo) chan1_hallo.is_op = True chan2.add_user(user2) chan2_user1 = chan2.get_membership_by_user(user2) chan2_user1.is_op = False try: test_hallo.function_dispatcher.dispatch( EventMessage(serv1, chan1, user1, "voice test_user2 test_chan2") ) data = serv1.get_send_data(1, chan1, EventMessage) assert "error" in data[0].text.lower() assert "i'm not in that channel" in data[0].text.lower() finally: test_hallo.remove_server(serv1) def test_voice_2_user_user_not_known(hallo_getter): test_hallo = hallo_getter({"channel_control"}) serv1 = ServerMock(test_hallo) serv1.name = "test_serv1" serv1.type = Server.TYPE_IRC test_hallo.add_server(serv1) chan1 = serv1.get_channel_by_address("test_chan1".lower(), "test_chan1") chan1.in_channel = True chan2 = serv1.get_channel_by_address("test_chan2".lower(), "test_chan2") chan2.in_channel = True user1 = serv1.get_user_by_address("test_user1".lower(), "test_user1") user2 = serv1.get_user_by_address("test_user2".lower(), "test_user2") user_hallo = serv1.get_user_by_address(serv1.get_nick().lower(), serv1.get_nick()) chan1.add_user(user1) chan1_user1 = chan1.get_membership_by_user(user1) chan1_user1.is_op = False chan1.add_user(user_hallo) chan1_hallo = chan1.get_membership_by_user(user_hallo) chan1_hallo.is_op = True chan2.add_user(user2) chan2_user1 = chan2.get_membership_by_user(user2) chan2_user1.is_op = False chan2.add_user(user_hallo) chan2_hallo = chan2.get_membership_by_user(user_hallo) chan2_hallo.is_op = True try: test_hallo.function_dispatcher.dispatch( EventMessage(serv1, chan1, user1, "voice test_user3 test_chan2") ) data = serv1.get_send_data(1, chan1, EventMessage) assert "error" in data[0].text.lower() assert "test_user3 is not known" in data[0].text.lower() finally: test_hallo.remove_server(serv1) def test_voice_2_user_user_not_there(hallo_getter): test_hallo = hallo_getter({"channel_control"}) serv1 = ServerMock(test_hallo) serv1.name = "test_serv1" serv1.type = Server.TYPE_IRC test_hallo.add_server(serv1) chan1 = serv1.get_channel_by_address("test_chan1".lower(), "test_chan1") chan1.in_channel = True chan2 = serv1.get_channel_by_address("test_chan2".lower(), "test_chan2") chan2.in_channel = True user1 = serv1.get_user_by_address("test_user1".lower(), "test_user1") user2 = serv1.get_user_by_address("test_user2".lower(), "test_user2") serv1.get_user_by_address("test_user3", "test_user3") user_hallo = serv1.get_user_by_address(serv1.get_nick().lower(), serv1.get_nick()) chan1.add_user(user1) chan1_user1 = chan1.get_membership_by_user(user1) chan1_user1.is_op = False chan1.add_user(user_hallo) chan1_hallo = chan1.get_membership_by_user(user_hallo) chan1_hallo.is_op = True chan2.add_user(user2) chan2_user1 = chan2.get_membership_by_user(user2) chan2_user1.is_op = False chan2.add_user(user_hallo) chan2_hallo = chan2.get_membership_by_user(user_hallo) chan2_hallo.is_op = True try: test_hallo.function_dispatcher.dispatch( EventMessage(serv1, chan1, user1, "voice test_user3 test_chan2") ) data = serv1.get_send_data(1, chan1, EventMessage) assert "error" in data[0].text.lower() assert "test_user3 is not in test_chan2" in data[0].text.lower() finally: test_hallo.remove_server(serv1) def test_voice_2_user_no_power(hallo_getter): test_hallo = hallo_getter({"channel_control"}) serv1 = ServerMock(test_hallo) serv1.name = "test_serv1" serv1.type = Server.TYPE_IRC test_hallo.add_server(serv1) chan1 = serv1.get_channel_by_address("test_chan1".lower(), "test_chan1") chan1.in_channel = True chan2 = serv1.get_channel_by_address("test_chan2".lower(), "test_chan2") chan2.in_channel = True user1 = serv1.get_user_by_address("test_user1".lower(), "test_user1") user2 = serv1.get_user_by_address("test_user2".lower(), "test_user2") user_hallo = serv1.get_user_by_address(serv1.get_nick().lower(), serv1.get_nick()) chan1.add_user(user1) chan1_user1 = chan1.get_membership_by_user(user1) chan1_user1.is_op = False chan1.add_user(user_hallo) chan1_hallo = chan1.get_membership_by_user(user_hallo) chan1_hallo.is_op = True chan2.add_user(user2) chan2_user1 = chan2.get_membership_by_user(user2) chan2_user1.is_op = False chan2.add_user(user_hallo) chan2_hallo = chan2.get_membership_by_user(user_hallo) chan2_hallo.is_op = False try: test_hallo.function_dispatcher.dispatch( EventMessage(serv1, chan1, user1, "voice test_user2 test_chan2") ) data = serv1.get_send_data(1, chan1, EventMessage) assert "error" in data[0].text.lower() assert "don't have power" in data[0].text.lower() finally: test_hallo.remove_server(serv1) def test_voice_2_user_is_voice(hallo_getter): test_hallo = hallo_getter({"channel_control"}) serv1 = ServerMock(test_hallo) serv1.name = "test_serv1" serv1.type = Server.TYPE_IRC test_hallo.add_server(serv1) chan1 = serv1.get_channel_by_address("test_chan1".lower(), "test_chan1") chan1.in_channel = True chan2 = serv1.get_channel_by_address("test_chan2".lower(), "test_chan2") chan2.in_channel = True user1 = serv1.get_user_by_address("test_user1".lower(), "test_user1") user2 = serv1.get_user_by_address("test_user2".lower(), "test_user2") user_hallo = serv1.get_user_by_address(serv1.get_nick().lower(), serv1.get_nick()) chan1.add_user(user1) chan1_user1 = chan1.get_membership_by_user(user1) chan1_user1.is_op = False chan1.add_user(user_hallo) chan1_hallo = chan1.get_membership_by_user(user_hallo) chan1_hallo.is_op = True chan2.add_user(user2) chan2_user2 = chan2.get_membership_by_user(user2) chan2_user2.is_op = False chan2_user2.is_voice = True chan2.add_user(user_hallo) chan2_hallo = chan2.get_membership_by_user(user_hallo) chan2_hallo.is_op = True try: test_hallo.function_dispatcher.dispatch( EventMessage(serv1, chan1, user1, "voice test_user2 test_chan2") ) data = serv1.get_send_data(1, chan1, EventMessage) assert "error" in data[0].text.lower() assert "already has voice" in data[0].text.lower() finally: test_hallo.remove_server(serv1) def test_voice_2_user_is_op(hallo_getter): test_hallo = hallo_getter({"channel_control"}) serv1 = ServerMock(test_hallo) serv1.name = "test_serv1" serv1.type = Server.TYPE_IRC test_hallo.add_server(serv1) chan1 = serv1.get_channel_by_address("test_chan1".lower(), "test_chan1") chan1.in_channel = True chan2 = serv1.get_channel_by_address("test_chan2".lower(), "test_chan2") chan2.in_channel = True user1 = serv1.get_user_by_address("test_user1".lower(), "test_user1") user2 = serv1.get_user_by_address("test_user2".lower(), "test_user2") user_hallo = serv1.get_user_by_address(serv1.get_nick().lower(), serv1.get_nick()) chan1.add_user(user1) chan1_user1 = chan1.get_membership_by_user(user1) chan1_user1.is_op = False chan1.add_user(user_hallo) chan1_hallo = chan1.get_membership_by_user(user_hallo) chan1_hallo.is_op = True chan2.add_user(user2) chan2_user2 = chan2.get_membership_by_user(user2) chan2_user2.is_op = True chan2.add_user(user_hallo) chan2_hallo = chan2.get_membership_by_user(user_hallo) chan2_hallo.is_op = True try: test_hallo.function_dispatcher.dispatch( EventMessage(serv1, chan1, user1, "voice test_user2 test_chan2") ) data = serv1.get_send_data(1, chan1, EventMessage) assert "error" in data[0].text.lower() assert "already has voice" in data[0].text.lower() finally: test_hallo.remove_server(serv1) def test_voice_2_user(hallo_getter): test_hallo = hallo_getter({"channel_control"}) serv1 = ServerMock(test_hallo) serv1.name = "test_serv1" serv1.type = Server.TYPE_IRC test_hallo.add_server(serv1) chan1 = serv1.get_channel_by_address("test_chan1".lower(), "test_chan1") chan1.in_channel = True chan2 = serv1.get_channel_by_address("test_chan2".lower(), "test_chan2") chan2.in_channel = True user1 = serv1.get_user_by_address("test_user1".lower(), "test_user1") user2 = serv1.get_user_by_address("test_user2".lower(), "test_user2") user_hallo = serv1.get_user_by_address(serv1.get_nick().lower(), serv1.get_nick()) chan1.add_user(user1) chan1_user1 = chan1.get_membership_by_user(user1) chan1_user1.is_op = False chan1.add_user(user_hallo) chan1_hallo = chan1.get_membership_by_user(user_hallo) chan1_hallo.is_op = True chan2.add_user(user2) chan2_user2 = chan2.get_membership_by_user(user2) chan2_user2.is_op = False chan2.add_user(user_hallo) chan2_hallo = chan2.get_membership_by_user(user_hallo) chan2_hallo.is_op = True try: test_hallo.function_dispatcher.dispatch( EventMessage(serv1, chan1, user1, "voice test_user2 test_chan2") ) data = serv1.get_send_data(2) assert "error" not in data[1].text.lower() assert data[0].channel == chan2 assert data[1].channel == chan1 assert data[0].__class__ == EventMode assert data[1].__class__ == EventMessage assert data[0].mode_changes == "+v {}".format(user2.address) assert "status given" in data[1].text.lower() finally: test_hallo.remove_server(serv1)
StarcoderdataPython
55037
from .filesystem import find_files from .piano_roll import (roll_encode, roll_decode, get_roll_index, roll_subsample) from .metrics import calc_stats, calc_metrics, metrics_empty_dict from .loggers import write_metrics, write_images, write_audio from .renderers import (plot_eval, plot_estim, plot_certainty, roll2audio) from .settings import Trainer, save_run_config, flush_n_close
StarcoderdataPython
3319178
"""wordCount URL Configuration The `urlpatterns` list routes URLs to views. For more information please see: https://docs.djangoproject.com/en/2.2/topics/http/urls/ Examples: Function views 1. Add an import: from my_app import views 2. Add a URL to urlpatterns: path('', views.home, name='home') Class-based views 1. Add an import: from other_app.views import Home 2. Add a URL to urlpatterns: path('', Home.as_view(), name='home') Including another URLconf 1. Import the include() function: from django.urls import include, path 2. Add a URL to urlpatterns: path('blog/', include('blog.urls')) """ from django.urls import path from . import views urlpatterns = [ #Goes to the views.py and displays what is return there path('', views.home), #Goes to the home.html and returns path('homepage/', views.homepage, name= 'home'), # Displays the information about the page path('about/', views.about, name= 'about'), #Goes to the count.html and returns path('count/', views.count, name='count'), # Since we are changed the name in home.html (action="{% url 'count' %}")whichever url we give still goes to the correct # #location: referencing the url that way. path('countWords/', views.count, name='count'), #Goes to the views.py and displays what is return there path('cube/', views.cube), ]
StarcoderdataPython
3347060
#!/usr/bin/python """ Filter the results of munki's MANAGED_INSTALL_REPORT.plist to these items: 'EndTime', 'StartTime', 'ManifestName', 'ManagedInstallVersion' 'Errors', 'Warnings', 'RunType' """ import plistlib import sys import os import CoreFoundation DEBUG = False # Path to the default munki install dir default_install_dir = '/Library/Managed Installs' # Checks munki preferences to see where the install directory is set to. managed_install_dir = CoreFoundation.CFPreferencesCopyAppValue( "ManagedInstallDir", "ManagedInstalls") # set the paths based on munki's configuration. if managed_install_dir: MANAGED_INSTALL_REPORT = os.path.join( managed_install_dir, 'ManagedInstallReport.plist') else: MANAGED_INSTALL_REPORT = os.path.join( default_install_dir, 'ManagedInstallReport.plist') # Don't skip manual check if len(sys.argv) > 1: if sys.argv[1] == 'debug': print '**** DEBUGGING ENABLED ****' DEBUG = True import pprint PP = pprint.PrettyPrinter(indent=4) def dict_from_plist(path): """Returns a dict based on plist found in path""" try: return plistlib.readPlist(path) except Exception, message: raise Exception("Error creating plist from output: %s" % message) def main(): """Main""" # Create cache dir if it does not exist cachedir = '%s/cache' % os.path.dirname(os.path.realpath(__file__)) if not os.path.exists(cachedir): os.makedirs(cachedir) # Check if MANAGED_INSTALL_REPORT exists if not os.path.exists(MANAGED_INSTALL_REPORT): print '%s is missing.' % MANAGED_INSTALL_REPORT install_report = {} else: install_report = dict_from_plist(MANAGED_INSTALL_REPORT) # Collect Errors, Warnings (as JSON?) # EndTime, StartTime, ManifestName, (Conditions->catalogs?) # ManagedInstallVersion # Some statistics # pylint: disable=E1103 report_list = {} items = ['EndTime', 'StartTime', 'ManifestName', 'ManagedInstallVersion', 'Errors', 'Warnings', 'RunType'] for item in items: if install_report.get(item): report_list[item] = install_report[item] # pylint: enable=E1103 if DEBUG: PP.pprint(report_list) # Write report to cache plistlib.writePlist(report_list, "%s/munkireport.plist" % cachedir) if __name__ == "__main__": main()
StarcoderdataPython
71342
"""Platform for retrieving meteorological data from Environment Canada.""" import datetime import re from env_canada import ECData import voluptuous as vol from homeassistant.components.weather import ( ATTR_CONDITION_CLEAR_NIGHT, ATTR_CONDITION_CLOUDY, ATTR_CONDITION_FOG, ATTR_CONDITION_HAIL, ATTR_CONDITION_LIGHTNING_RAINY, ATTR_CONDITION_PARTLYCLOUDY, ATTR_CONDITION_POURING, ATTR_CONDITION_RAINY, ATTR_CONDITION_SNOWY, ATTR_CONDITION_SNOWY_RAINY, ATTR_CONDITION_SUNNY, ATTR_CONDITION_WINDY, ATTR_FORECAST_CONDITION, ATTR_FORECAST_PRECIPITATION_PROBABILITY, ATTR_FORECAST_TEMP, ATTR_FORECAST_TEMP_LOW, ATTR_FORECAST_TIME, PLATFORM_SCHEMA, WeatherEntity, ) from homeassistant.const import CONF_LATITUDE, CONF_LONGITUDE, CONF_NAME, TEMP_CELSIUS import homeassistant.helpers.config_validation as cv import homeassistant.util.dt as dt CONF_FORECAST = "forecast" CONF_ATTRIBUTION = "Data provided by Environment Canada" CONF_STATION = "station" def validate_station(station): """Check that the station ID is well-formed.""" if station is None: return if not re.fullmatch(r"[A-Z]{2}/s0000\d{3}", station): raise vol.error.Invalid('Station ID must be of the form "XX/s0000###"') return station PLATFORM_SCHEMA = PLATFORM_SCHEMA.extend( { vol.Optional(CONF_NAME): cv.string, vol.Optional(CONF_STATION): validate_station, vol.Inclusive(CONF_LATITUDE, "latlon"): cv.latitude, vol.Inclusive(CONF_LONGITUDE, "latlon"): cv.longitude, vol.Optional(CONF_FORECAST, default="daily"): vol.In(["daily", "hourly"]), } ) # Icon codes from http://dd.weatheroffice.ec.gc.ca/citypage_weather/ # docs/current_conditions_icon_code_descriptions_e.csv ICON_CONDITION_MAP = { ATTR_CONDITION_SUNNY: [0, 1], ATTR_CONDITION_CLEAR_NIGHT: [30, 31], ATTR_CONDITION_PARTLYCLOUDY: [2, 3, 4, 5, 22, 32, 33, 34, 35], ATTR_CONDITION_CLOUDY: [10], ATTR_CONDITION_RAINY: [6, 9, 11, 12, 28, 36], ATTR_CONDITION_LIGHTNING_RAINY: [19, 39, 46, 47], ATTR_CONDITION_POURING: [13], ATTR_CONDITION_SNOWY_RAINY: [7, 14, 15, 27, 37], ATTR_CONDITION_SNOWY: [8, 16, 17, 18, 25, 26, 38, 40], ATTR_CONDITION_WINDY: [43], ATTR_CONDITION_FOG: [20, 21, 23, 24, 44], ATTR_CONDITION_HAIL: [26, 27], } def setup_platform(hass, config, add_devices, discovery_info=None): """Set up the Environment Canada weather.""" if config.get(CONF_STATION): ec_data = ECData(station_id=config[CONF_STATION]) else: lat = config.get(CONF_LATITUDE, hass.config.latitude) lon = config.get(CONF_LONGITUDE, hass.config.longitude) ec_data = ECData(coordinates=(lat, lon)) add_devices([ECWeather(ec_data, config)]) class ECWeather(WeatherEntity): """Representation of a weather condition.""" def __init__(self, ec_data, config): """Initialize Environment Canada weather.""" self.ec_data = ec_data self.platform_name = config.get(CONF_NAME) self.forecast_type = config[CONF_FORECAST] @property def attribution(self): """Return the attribution.""" return CONF_ATTRIBUTION @property def name(self): """Return the name of the weather entity.""" if self.platform_name: return self.platform_name return self.ec_data.metadata.get("location") @property def temperature(self): """Return the temperature.""" if self.ec_data.conditions.get("temperature", {}).get("value"): return float(self.ec_data.conditions["temperature"]["value"]) if self.ec_data.hourly_forecasts[0].get("temperature"): return float(self.ec_data.hourly_forecasts[0]["temperature"]) return None @property def temperature_unit(self): """Return the unit of measurement.""" return TEMP_CELSIUS @property def humidity(self): """Return the humidity.""" if self.ec_data.conditions.get("humidity", {}).get("value"): return float(self.ec_data.conditions["humidity"]["value"]) return None @property def wind_speed(self): """Return the wind speed.""" if self.ec_data.conditions.get("wind_speed", {}).get("value"): return float(self.ec_data.conditions["wind_speed"]["value"]) return None @property def wind_bearing(self): """Return the wind bearing.""" if self.ec_data.conditions.get("wind_bearing", {}).get("value"): return float(self.ec_data.conditions["wind_bearing"]["value"]) return None @property def pressure(self): """Return the pressure.""" if self.ec_data.conditions.get("pressure", {}).get("value"): return 10 * float(self.ec_data.conditions["pressure"]["value"]) return None @property def visibility(self): """Return the visibility.""" if self.ec_data.conditions.get("visibility", {}).get("value"): return float(self.ec_data.conditions["visibility"]["value"]) return None @property def condition(self): """Return the weather condition.""" icon_code = None if self.ec_data.conditions.get("icon_code", {}).get("value"): icon_code = self.ec_data.conditions["icon_code"]["value"] elif self.ec_data.hourly_forecasts[0].get("icon_code"): icon_code = self.ec_data.hourly_forecasts[0]["icon_code"] if icon_code: return icon_code_to_condition(int(icon_code)) return "" @property def forecast(self): """Return the forecast array.""" return get_forecast(self.ec_data, self.forecast_type) def update(self): """Get the latest data from Environment Canada.""" self.ec_data.update() def get_forecast(ec_data, forecast_type): """Build the forecast array.""" forecast_array = [] if forecast_type == "daily": half_days = ec_data.daily_forecasts today = { ATTR_FORECAST_TIME: dt.now().isoformat(), ATTR_FORECAST_CONDITION: icon_code_to_condition( int(half_days[0]["icon_code"]) ), ATTR_FORECAST_PRECIPITATION_PROBABILITY: int( half_days[0]["precip_probability"] ), } if half_days[0]["temperature_class"] == "high": today.update( { ATTR_FORECAST_TEMP: int(half_days[0]["temperature"]), ATTR_FORECAST_TEMP_LOW: int(half_days[1]["temperature"]), } ) half_days = half_days[2:] else: today.update( { ATTR_FORECAST_TEMP: None, ATTR_FORECAST_TEMP_LOW: int(half_days[0]["temperature"]), } ) half_days = half_days[1:] forecast_array.append(today) for day, high, low in zip(range(1, 6), range(0, 9, 2), range(1, 10, 2)): forecast_array.append( { ATTR_FORECAST_TIME: ( dt.now() + datetime.timedelta(days=day) ).isoformat(), ATTR_FORECAST_TEMP: int(half_days[high]["temperature"]), ATTR_FORECAST_TEMP_LOW: int(half_days[low]["temperature"]), ATTR_FORECAST_CONDITION: icon_code_to_condition( int(half_days[high]["icon_code"]) ), ATTR_FORECAST_PRECIPITATION_PROBABILITY: int( half_days[high]["precip_probability"] ), } ) elif forecast_type == "hourly": hours = ec_data.hourly_forecasts for hour in range(0, 24): forecast_array.append( { ATTR_FORECAST_TIME: dt.as_local( datetime.datetime.strptime(hours[hour]["period"], "%Y%m%d%H%M") ).isoformat(), ATTR_FORECAST_TEMP: int(hours[hour]["temperature"]), ATTR_FORECAST_CONDITION: icon_code_to_condition( int(hours[hour]["icon_code"]) ), ATTR_FORECAST_PRECIPITATION_PROBABILITY: int( hours[hour]["precip_probability"] ), } ) return forecast_array def icon_code_to_condition(icon_code): """Return the condition corresponding to an icon code.""" for condition, codes in ICON_CONDITION_MAP.items(): if icon_code in codes: return condition return None
StarcoderdataPython
3232739
<reponame>python-discord/code-jam-management from fastapi import APIRouter, Depends, HTTPException from sqlalchemy.ext.asyncio import AsyncSession from sqlalchemy.future import select from api.database import Infraction as DbInfraction, Jam, User from api.dependencies import get_db_session from api.models import Infraction, InfractionResponse router = APIRouter(prefix="/infractions", tags=["infractions"]) @router.get("/", response_model=list[InfractionResponse]) async def get_infractions(session: AsyncSession = Depends(get_db_session)) -> list[DbInfraction]: """Get every the infraction stored in the database.""" infractions = await session.execute(select(DbInfraction)) infractions.unique() return infractions.scalars().all() @router.get( "/{infraction_id}", response_model=InfractionResponse, responses={ 404: { "description": "Infraction could not be found." } } ) async def get_infraction(infraction_id: int, session: AsyncSession = Depends(get_db_session)) -> DbInfraction: """Get a specific infraction stored in the database by ID.""" infraction_result = await session.execute(select(DbInfraction).where(DbInfraction.id == infraction_id)) infraction_result.unique() if not (infraction := infraction_result.scalars().one_or_none()): raise HTTPException(404, "Infraction with specified ID could not be found.") return infraction @router.post( "/", response_model=InfractionResponse, responses={ 404: { "Description": "Jam ID or User ID could not be found." } } ) async def create_infraction(infraction: Infraction, session: AsyncSession = Depends(get_db_session)) -> DbInfraction: """Add an infraction for a user to the database.""" jam_id = (await session.execute(select(Jam.id).where(Jam.id == infraction.jam_id))).scalars().one_or_none() if jam_id is None: raise HTTPException(404, "Jam with specified ID could not be found.") user_id = (await session.execute(select(User.id).where(User.id == infraction.user_id))).scalars().one_or_none() if user_id is None: raise HTTPException(404, "User with specified ID could not be found.") infraction = DbInfraction( user_id=user_id, jam_id=jam_id, infraction_type=infraction.infraction_type, reason=infraction.reason ) session.add(infraction) await session.flush() infraction_result = await session.execute(select(DbInfraction).where(DbInfraction.id == infraction.id)) infraction_result.unique() return infraction_result.scalars().one()
StarcoderdataPython
17230
<reponame>KuoHaoZeng/ai2thor-1 import ai2thor.controller import numpy as np from PIL import Image, ImageDraw def get_rotation_matrix(agent_rot): ####### # Construct the rotation matrix. Ref: https://en.wikipedia.org/wiki/Rotation_matrix ####### r_y = np.array([[np.cos(np.radians(agent_rot["y"])), 0, np.sin(np.radians(agent_rot["y"]))], [0, 1, 0], [-np.sin(np.radians(agent_rot["y"])), 0, np.cos(np.radians(agent_rot["y"]))]]) r_x = np.array([[1, 0, 0], [0, np.cos(np.radians(agent_rot["x"])), -np.sin(np.radians(agent_rot["x"]))], [0, np.sin(np.radians(agent_rot["x"])), np.cos(np.radians(agent_rot["x"]))]]) r = r_x @ r_y return r def project_to_agent_coordinate(pos, agent_pos, r): ####### # Project a position from the world coordinate to the agent coordinate. ####### pos_diff = pos - agent_pos # since AI2THOR is left-handed coordinate system, we need to turn it to the right-handed to use the rotation matrix pos_diff[2] *= -1 new_pos = r @ pos_diff # turn back to the left-handed coordinate system new_pos[2] *= -1 return new_pos def project_to_2d(pos, half_fov, w, h): ####### # Project a given 3D position to 2D space. ####### pos_2d = [pos[0] / (pos[2] * np.tan(np.radians(half_fov))), pos[1] / (pos[2] * np.tan(np.radians(half_fov)))] # x-axis x = int(w * ((pos_2d[0] + 1.0) / 2.0)) # y-axis y = int(h * (1 - ((pos_2d[1] + 1.0) / 2.0))) return [x, y] def draw_3d_bbox(event): ####### # Draw the 3D bbox in 2D RGB image by first construct the rotation matrix and get agent position by the agent pose, # then filter out the objects which are not visible to the agent. # Finally, project the 3D bbox to 2D space and draw it on the 2D RGB image and return the event dict with image. ####### # get the 2D image width and height w, h = event.metadata["screenWidth"], event.metadata["screenHeight"] # get the FOV half_fov = event.metadata["fov"] / 2 # get the camera rotation matrix agent_rot = event.metadata["agent"]["rotation"] agent_rot["x"] = event.metadata["agent"]["cameraHorizon"] rotation_matrix = get_rotation_matrix(agent_rot) # get the camera 3D position agent_pos = np.array([event.metadata["cameraPosition"]["x"], event.metadata["cameraPosition"]["y"], event.metadata["cameraPosition"]["z"]]) # get the 2D RGB image and allocate a drawer img = Image.fromarray(event.frame, "RGB") draw = ImageDraw.Draw(img) # iterate over all objects in the scene # first classify if the object is in the view by rotated z position and instance segmentation # then draw the 3D bbox in the 2D RGB image for obj in event.metadata["objects"]: # get object 3D position and rotate it to the agent coordinate pos = np.array([obj["position"]["x"], obj["position"]["y"], obj["position"]["z"]]) new_pos = project_to_agent_coordinate(pos, agent_pos, rotation_matrix) # classify is the object is in front of the agent if new_pos[2] > 0: # classify if the object is seen by the agent (not occluded by other objects) if obj["objectId"] in event.instance_masks.keys(): # don't draw the floor and ceiling objects if "Floor" in obj["objectId"] or "Ceiling" in obj["objectId"]: if "Lamp" not in obj["objectId"]: continue # get the object color from the instance segmentation color = event.object_id_to_color[obj["objectId"]] # get the 3D bbox center and size vertices, valid = [], [] if not isinstance(obj["objectOrientedBoundingBox"], type(None)): # get the 3D bbox 8 vertices corner_points = obj["objectOrientedBoundingBox"]["cornerPoints"] # project vertices to 2D image coordinate for point in corner_points: new_point = project_to_agent_coordinate(point, agent_pos, rotation_matrix) if new_point[2] > 0: valid.append(True) else: valid.append(False) new_point_2d = project_to_2d(new_point, half_fov, w, h) vertices.append(new_point_2d) # get the 3D bbox 12 lines lines = [[vertices[0], vertices[1]], [vertices[2], vertices[3]], [vertices[0], vertices[3]], [vertices[1], vertices[2]], [vertices[4], vertices[5]], [vertices[6], vertices[7]], [vertices[4], vertices[7]], [vertices[5], vertices[6]], [vertices[2], vertices[6]], [vertices[3], vertices[7]], [vertices[1], vertices[5]], [vertices[0], vertices[4]]] valid_lines = [valid[0] * valid[1], valid[2] * valid[3], valid[0] * valid[3], valid[1] * valid[2], valid[4] * valid[5], valid[6] * valid[7], valid[4] * valid[7], valid[5] * valid[6], valid[2] * valid[6], valid[3] * valid[7], valid[1] * valid[5], valid[0] * valid[4]] else: if "cornerPoints" in obj["axisAlignedBoundingBox"].keys(): # get the 3D bbox 8 vertices corner_points = obj["axisAlignedBoundingBox"]["cornerPoints"] else: # get the 3D bbox 8 vertices from bbox center and size center = np.array([obj["axisAlignedBoundingBox"]["center"]["x"], obj["axisAlignedBoundingBox"]["center"]["y"], obj["axisAlignedBoundingBox"]["center"]["z"]]) size = np.array([obj["axisAlignedBoundingBox"]["size"]["x"], obj["axisAlignedBoundingBox"]["size"]["y"], obj["axisAlignedBoundingBox"]["size"]["z"]]) corner_points = [] for i in range(2): pos_x = np.array(center) pos_x[0] = pos_x[0] - (size[0] / 2) + (i * size[0]) for j in range(2): pos_y = np.array(pos_x) pos_y[1] = pos_y[1] - (size[1] / 2) + (j * size[1]) for k in range(2): pos_z = np.array(pos_y) pos_z[2] = pos_z[2] - (size[2] / 2) + (k * size[2]) corner_points.append(pos_z) # project vertices to 2D image coordinate for point in corner_points: new_point = project_to_agent_coordinate(point, agent_pos, rotation_matrix) if new_point[2] > 0: valid.append(True) else: valid.append(False) new_point_2d = project_to_2d(new_point, half_fov, w, h) vertices.append(new_point_2d) # get the 3D bbox 12 lines lines = [[vertices[0], vertices[1]], [vertices[2], vertices[3]], [vertices[0], vertices[2]], [vertices[1], vertices[3]], [vertices[4], vertices[5]], [vertices[6], vertices[7]], [vertices[4], vertices[6]], [vertices[5], vertices[7]], [vertices[2], vertices[6]], [vertices[3], vertices[7]], [vertices[1], vertices[5]], [vertices[0], vertices[4]]] valid_lines = [valid[0] * valid[1], valid[2] * valid[3], valid[0] * valid[2], valid[1] * valid[3], valid[4] * valid[5], valid[6] * valid[7], valid[4] * valid[6], valid[5] * valid[7], valid[2] * valid[6], valid[3] * valid[7], valid[1] * valid[5], valid[0] * valid[4]] lines = np.array(lines) lines = np.reshape(lines, (-1, 4)) valid_lines = np.array(valid_lines) valid_lines = np.reshape(valid_lines, (-1, 1)) # draw the 3D bbox 12 lines in the 2D RGB image for iii, line in enumerate(lines): if valid_lines[iii]: draw.line((line[0], line[1], line[2], line[3]), fill=color, width=2) # store the result back to the event bbox_frame = np.array(img) event.bbox_3d_frame = bbox_frame return event if __name__ == "__main__": # give the height and width of the 2D image and scene id w, h = 900, 900 scene = "FloorPlan2{:02d}_physics".format(1) # allocate controller and initialize the scene and agent # local_path = "src/ai2thor/unity/builds/thor-local-OSXIntel64.app/Contents/MacOS/AI2-Thor" local_path = "" controller = ai2thor.controller.Controller(local_path=local_path) _ = controller.start(width=w, height=h) _ = controller.reset(scene) event = controller.step(dict(action='Initialize', gridSize=0.25, renderClassImage=True, renderObjectImage=True, renderDepthImage=True, fieldOfView=90)) # do something then draw the 3D bbox in 2D image event = controller.step(dict(action="MoveAhead")) event = controller.step(dict(action="MoveAhead")) event = controller.step(dict(action="Rotate", rotation=dict(x=0, y=30, z=0))) event = draw_3d_bbox(event) img = Image.fromarray(event.bbox_3d_frame, "RGB") img.save("./output1.png") event = controller.step(dict(action="LookDown")) event = draw_3d_bbox(event) img = Image.fromarray(event.bbox_3d_frame, "RGB") img.save("./output2.png") event = controller.step(dict(action="LookDown")) event = draw_3d_bbox(event) img = Image.fromarray(event.bbox_3d_frame, "RGB") img.save("./output3.png")
StarcoderdataPython
28967
<reponame>devilry/devilry-django from django import forms from django.contrib import messages from django.db import models from django.db import transaction from django.http import HttpResponseRedirect, Http404 from django.utils import timezone from django.utils.translation import gettext_lazy, pgettext_lazy from django.views.generic import View import django_rq from devilry.apps.core import models as core_models from devilry.devilry_comment import models as comment_models from devilry.devilry_cradmin import devilry_listbuilder from devilry.devilry_examiner.views.assignment.bulkoperations import bulk_operations_grouplist from devilry.devilry_group import models as group_models from devilry.devilry_email.feedback_email import feedback_email class AssignPointsForm(bulk_operations_grouplist.SelectedAssignmentGroupForm): """ Subclassed the select form and adds a ``IntegerField`` for points. """ #: Set the amount of points. points = forms.IntegerField( min_value=0, help_text='Add a score that will be given to all selected assignment groups.', required=True, label=pgettext_lazy('Points')) def get_grading_points(self): return self.cleaned_data['points'] class PointsTargetRenderer(bulk_operations_grouplist.AssignmentGroupTargetRenderer): def get_field_layout(self): layout = super(PointsTargetRenderer, self).get_field_layout() layout.append('points') return layout class AssignPassedFailedForm(bulk_operations_grouplist.SelectedAssignmentGroupForm): """ Subclassed the select form and adds a ``Boolean`` field to provide a passed/failed grade. """ #: Set delivery as passed or failed. passed = forms.BooleanField( label=pgettext_lazy('grading', 'Passed?'), help_text=pgettext_lazy('grading', 'Check to provide a passing grade.'), initial=True, required=False) def get_grading_points(self): if self.cleaned_data['passed']: return self.assignment.max_points else: return 0 class PassedFailedTargetRenderer(bulk_operations_grouplist.AssignmentGroupTargetRenderer): def get_field_layout(self): layout = super(PassedFailedTargetRenderer, self).get_field_layout() layout.append('passed') return layout class AbstractBulkFeedbackListView(bulk_operations_grouplist.AbstractAssignmentGroupMultiSelectListFilterView): """ Base class that handles all the logic of bulk creating feedbacks. Extend this class with a subclass that uses a form suited for the :attr:``~.devilry.apps.core.models.Assignment.grading_system_plugin_id``. Example: Bulk feedback class points based Assignment:: class BulkFeedbackPassedFailedView(AbstractBulkFeedbackListView): def get_filterlist_url(self, filters_string): return self.request.cradmin_app.reverse_appurl( 'bulk-feedback-passedfailed-filter', kwargs={'filters_string': filters_string}) def get_target_renderer_class(self): return PassedFailedTargetRenderer def get_form_class(self): return AssignPassedFailedForm """ value_renderer_class = devilry_listbuilder.assignmentgroup.ExaminerMultiselectItemValue template_name = 'devilry_examiner/assignment/bulk_create_feedback.django.html' def get_pagetitle(self): return gettext_lazy('Bulk create feedback') def get_filterlist_url(self, filters_string): raise NotImplementedError() def get_unfiltered_queryset_for_role(self, role): queryset = super(AbstractBulkFeedbackListView, self).get_unfiltered_queryset_for_role(role) return queryset\ .filter_examiner_has_access(user=self.request.user) \ .exclude(cached_data__last_published_feedbackset=models.F('cached_data__last_feedbackset')) def __create_grading_groupcomment(self, feedback_set_id, published_time, text): """ Create an entry of :class:`~.devilry.devilry_group.models.GroupComment` as part of grading for the :class:`~.devilry.devilry_group.models.FeedbackSet` that received feedback. Args: feedback_set_id: comment for this feedback. published_time: Time the comment was published. text: Text provided by examiner. """ group_models.GroupComment.objects.create( feedback_set_id=feedback_set_id, part_of_grading=True, visibility=group_models.GroupComment.VISIBILITY_VISIBLE_TO_EVERYONE, user=self.request.user, user_role=comment_models.Comment.USER_ROLE_EXAMINER, text=text, comment_type=comment_models.Comment.COMMENT_TYPE_GROUPCOMMENT, published_datetime=published_time ) def form_valid(self, form): """ Creates entries of :class:`~.devilry.devilry_group.models.GroupComment`s for all the :class:`~.devilry.devilry_group.models.FeedbackSet`s that is given a bulk feedback. Note: Using ``transaction.atomic()`` for single transaction when creating ``GroupComment``s and updating the ``FeedbackSet``s. If anything goes wrong, the transaction is rolled back and nothing is saved to the database. Args: form: cleaned form. """ feedback_set_ids = self.get_feedbackset_ids_from_posted_ids(form=form) points = form.get_grading_points() text = form.cleaned_data['feedback_comment_text'] # Cache anonymous display names before transaction. Needed for django messages. displaynames = self.get_group_displaynames(form=form) now_without_microseconds = timezone.now().replace(microsecond=0) with transaction.atomic(): for feedback_set_id in feedback_set_ids: self.__create_grading_groupcomment( feedback_set_id=feedback_set_id, published_time=now_without_microseconds, text=text) group_models.FeedbackSet.objects\ .filter(id__in=feedback_set_ids)\ .update( grading_published_by=self.request.user, grading_published_datetime=now_without_microseconds + timezone.timedelta(microseconds=1), grading_points=points) feedback_email.bulk_send_feedback_created_email( assignment_id=self.assignment.id, feedbackset_id_list=feedback_set_ids, domain_url_start=self.request.build_absolute_uri('/')) self.add_success_message(displaynames) return super(AbstractBulkFeedbackListView, self).form_valid(form=form) def add_success_message(self, anonymous_display_names): message = gettext_lazy('Bulk added feedback for %(group_names)s') % { 'group_names': ', '.join(anonymous_display_names)} messages.success(self.request, message=message) class BulkFeedbackPointsView(AbstractBulkFeedbackListView): """ Handles bulkfeedback for assignment with points-based grading system. """ def get_filterlist_url(self, filters_string): return self.request.cradmin_app.reverse_appurl( 'bulk-feedback-points-filter', kwargs={'filters_string': filters_string}) def get_target_renderer_class(self): return PointsTargetRenderer def get_form_class(self): return AssignPointsForm class BulkFeedbackPassedFailedView(AbstractBulkFeedbackListView): """ Handles bulkfeedback for assignment with passed/failed grading system. """ def get_filterlist_url(self, filters_string): return self.request.cradmin_app.reverse_appurl( 'bulk-feedback-passedfailed-filter', kwargs={'filters_string': filters_string}) def get_target_renderer_class(self): return PassedFailedTargetRenderer def get_form_class(self): return AssignPassedFailedForm class BulkFeedbackRedirectView(View): """ Redirects to the appropriate view based on the assignments grading system type. """ def dispatch(self, request, *args, **kwargs): grading_plugin_id = self.request.cradmin_role.grading_system_plugin_id if grading_plugin_id == core_models.Assignment.GRADING_SYSTEM_PLUGIN_ID_POINTS: return HttpResponseRedirect(request.cradmin_app.reverse_appurl('bulk-feedback-points')) grading_plugin_id = self.request.cradmin_role.grading_system_plugin_id if grading_plugin_id == core_models.Assignment.GRADING_SYSTEM_PLUGIN_ID_PASSEDFAILED: return HttpResponseRedirect(request.cradmin_app.reverse_appurl('bulk-feedback-passedfailed')) return Http404()
StarcoderdataPython
1670411
"""Properties Module This module defines types for Property objects. For more about properties in Tiled maps see the below link: https://doc.mapeditor.org/en/stable/manual/custom-properties/ The types defined in this module get added to other objects such as Layers, Maps, Objects, etc """ from pathlib import Path from typing import Dict, Union from .common_types import Color Property = Union[float, Path, str, bool, Color] Properties = Dict[str, Property]
StarcoderdataPython
1759216
<reponame>himichael/LeetCode # Definition for a binary tree node. # class TreeNode(object): # def __init__(self, x): # self.val = x # self.left = None # self.right = None class Solution(object): def isSubtree(self, s, t): """ :type s: TreeNode :type t: TreeNode :rtype: bool """ if not (s or t): return True if not (s and t): return False return self.isSameTree(s,t) or self.isSubtree(s.left,t) or self.isSubtree(s.right,t) def isSameTree(self,a,b): if not (a or b): return True if not (a and b): return False return a.val==b.val and self.isSameTree(a.left,b.left) and self.isSameTree(a.right,b.right)
StarcoderdataPython
1729380
from aiogram import types from aiogram.dispatcher.filters.builtin import CommandStart from data.texts import text from filters import IsPrivate from loader import dp @dp.message_handler(CommandStart(), IsPrivate()) async def bot_start(message: types.Message): await message.answer(text.start_message.format(message.from_user.full_name))
StarcoderdataPython
1769630
# -*- mode: python; coding: utf-8 -* # Copyright (c) 2019 Radio Astronomy Software Group # Licensed under the 3-clause BSD License import os import numpy as np import pytest from astropy.coordinates import Angle import astropy.units as units from astropy.time import Time from pyradiosky import SkyModel import pyradiosky.utils as skyutils def test_tee_ra_loop(): time = Time(2457458.1739, scale="utc", format="jd") tee_ra = Angle(np.pi / 4.0, unit="rad") # rad cirs_ra = skyutils._tee_to_cirs_ra(tee_ra, time) new_tee_ra = skyutils._cirs_to_tee_ra(cirs_ra, time) assert new_tee_ra == tee_ra def test_stokes_tofrom_coherency(): stokesI = 4.5 stokesQ = -0.3 stokesU = 1.2 stokesV = -0.15 stokes = np.array([stokesI, stokesQ, stokesU, stokesV]) expected_coherency = ( 0.5 * np.array([[4.2, 1.2 + 0.15j], [1.2 - 0.15j, 4.8]]) * units.Jy ) with pytest.warns( DeprecationWarning, match="In version 0.2.0, stokes_arr will be required to be an astropy " "Quantity. Currently, floats are assumed to be in Jy.", ): coherency = skyutils.stokes_to_coherency(stokes) assert np.allclose(expected_coherency, coherency) with pytest.warns( DeprecationWarning, match="In version 0.2.0, coherency_matrix will be required to be an astropy " "Quantity. Currently, floats are assumed to be in Jy.", ): back_to_stokes = skyutils.coherency_to_stokes(coherency.value) assert np.allclose(stokes * units.Jy, back_to_stokes) # again, with multiple sources and a frequency axis. stokes = ( np.array( [[stokesI, stokesQ, stokesU, stokesV], [stokesI, stokesQ, stokesU, stokesV]] ).T * units.Jy ) stokes = stokes[:, np.newaxis, :] coherency = skyutils.stokes_to_coherency(stokes) back_to_stokes = skyutils.coherency_to_stokes(coherency) assert units.quantity.allclose(stokes, back_to_stokes) with pytest.raises(ValueError) as cm: skyutils.stokes_to_coherency(stokes[0:2, :]) assert str(cm.value).startswith( "First dimension of stokes_vector must be length 4." ) with pytest.raises(ValueError) as cm: skyutils.coherency_to_stokes(expected_coherency[0, :]) assert str(cm.value).startswith( "First two dimensions of coherency_matrix must be length 2." ) @pytest.mark.parametrize("stype", ["subband", "spectral_index", "flat"]) def test_download_gleam(tmp_path, stype): pytest.importorskip("astroquery") fname = "gleam_cat.vot" filename = os.path.join(tmp_path, fname) skyutils.download_gleam(path=tmp_path, filename=fname, row_limit=10) sky = SkyModel() sky.read_gleam_catalog(filename, spectral_type=stype) assert sky.Ncomponents == 10 # check there's not an error if the file exists and overwrite is False # and that the file is not replaced skyutils.download_gleam(path=tmp_path, filename=fname, row_limit=5) sky.read_gleam_catalog(filename, spectral_type=stype) assert sky.Ncomponents == 10 # check that the file is replaced if overwrite is True skyutils.download_gleam(path=tmp_path, filename=fname, row_limit=5, overwrite=True) sky2 = SkyModel() sky2.read_gleam_catalog(filename, spectral_type=stype) assert sky2.Ncomponents == 5 def test_astroquery_missing_error(tmp_path): fname = "gleam_cat.vot" try: import astroquery # noqa pass except ImportError: with pytest.raises( ImportError, match="The astroquery module required to use the download_gleam function.", ): skyutils.download_gleam(path=tmp_path, filename=fname, row_limit=10) def test_jy_to_ksr(): Nfreqs = 200 freqs = np.linspace(100, 200, Nfreqs) * units.MHz def jy2ksr_nonastropy(freq_arr): c_cmps = 29979245800.0 # cm/s k_boltz = 1.380658e-16 # erg/K lam = c_cmps / freq_arr.to_value("Hz") # cm return 1e-23 * lam ** 2 / (2 * k_boltz) conv0 = skyutils.jy_to_ksr(freqs) conv1 = jy2ksr_nonastropy(freqs) * units.K * units.sr / units.Jy assert np.allclose(conv0, conv1)
StarcoderdataPython
1767843
<filename>tests/test_readme_util.py import re import tempfile from pathlib import Path import pytest import yaml from datasets.utils.readme import ReadMe # @pytest.fixture # def example_yaml_structure(): example_yaml_structure = yaml.safe_load( """\ name: "" allow_empty: false allow_empty_text: true subsections: - name: "Dataset Card for X" # First-level markdown heading allow_empty: false allow_empty_text: true subsections: - name: "Table of Contents" allow_empty: false allow_empty_text: false subsections: null - name: "Dataset Description" allow_empty: false allow_empty_text: false subsections: - name: "Dataset Summary" allow_empty: false allow_empty_text: false subsections: null - name: "Supported Tasks and Leaderboards" allow_empty: true allow_empty_text: true subsections: null - name: Languages allow_empty: false allow_empty_text: true subsections: null """ ) CORRECT_DICT = { "name": "root", "text": "", "is_empty_text": True, "subsections": [ { "name": "Dataset Card for My Dataset", "text": "", "is_empty_text": True, "subsections": [ {"name": "Table of Contents", "text": "Some text here.", "is_empty_text": False, "subsections": []}, { "name": "Dataset Description", "text": "Some text here.", "is_empty_text": False, "subsections": [ { "name": "Dataset Summary", "text": "Some text here.", "is_empty_text": False, "subsections": [], }, { "name": "Supported Tasks and Leaderboards", "text": "", "is_empty_text": True, "subsections": [], }, {"name": "Languages", "text": "Language Text", "is_empty_text": False, "subsections": []}, ], }, ], } ], } README_CORRECT = """\ --- languages: - zh - en --- # Dataset Card for My Dataset ## Table of Contents Some text here. ## Dataset Description Some text here. ### Dataset Summary Some text here. ### Supported Tasks and Leaderboards ### Languages Language Text """ README_CORRECT_FOUR_LEVEL = """\ --- languages: - zh - en --- # Dataset Card for My Dataset ## Table of Contents Some text here. ## Dataset Description Some text here. ### Dataset Summary Some text here. #### Extra Ignored Subsection ### Supported Tasks and Leaderboards ### Languages Language Text """ CORRECT_DICT_FOUR_LEVEL = { "name": "root", "text": "", "is_empty_text": True, "subsections": [ { "name": "Dataset Card for My Dataset", "text": "", "is_empty_text": True, "subsections": [ {"name": "Table of Contents", "text": "Some text here.", "is_empty_text": False, "subsections": []}, { "name": "Dataset Description", "text": "Some text here.", "is_empty_text": False, "subsections": [ { "name": "Dataset Summary", "text": "Some text here.", "is_empty_text": False, "subsections": [ { "name": "Extra Ignored Subsection", "text": "", "is_empty_text": True, "subsections": [], } ], }, { "name": "Supported Tasks and Leaderboards", "text": "", "is_empty_text": True, "subsections": [], }, {"name": "Languages", "text": "Language Text", "is_empty_text": False, "subsections": []}, ], }, ], } ], } README_EMPTY_YAML = """\ --- --- # Dataset Card for My Dataset ## Table of Contents Some text here. ## Dataset Description Some text here. ### Dataset Summary Some text here. ### Supported Tasks and Leaderboards ### Languages Language Text """ EXPECTED_ERROR_README_EMPTY_YAML = ( "The following issues were found for the README at `{path}`:\n-\tEmpty YAML markers are present in the README." ) README_NO_YAML = """\ # Dataset Card for My Dataset ## Table of Contents Some text here. ## Dataset Description Some text here. ### Dataset Summary Some text here. ### Supported Tasks and Leaderboards ### Languages Language Text """ EXPECTED_ERROR_README_NO_YAML = ( "The following issues were found for the README at `{path}`:\n-\tNo YAML markers are present in the README." ) README_INCORRECT_YAML = """\ --- # Dataset Card for My Dataset ## Table of Contents Some text here. ## Dataset Description Some text here. ### Dataset Summary Some text here. ### Supported Tasks and Leaderboards ### Languages Language Text """ EXPECTED_ERROR_README_INCORRECT_YAML = "The following issues were found for the README at `{path}`:\n-\tOnly the start of YAML tags present in the README." README_MISSING_TEXT = """\ --- languages: - zh - en --- # Dataset Card for My Dataset ## Table of Contents Some text here. ## Dataset Description Some text here. ### Dataset Summary ### Supported Tasks and Leaderboards ### Languages Language Text """ EXPECTED_ERROR_README_MISSING_TEXT = "The following issues were found for the README at `{path}`:\n-\tExpected some content in section `Dataset Summary` but it is empty.\n-\tExpected some text in section `Dataset Summary` but it is empty (text in subsections are ignored)." README_NONE_SUBSECTION = """\ --- languages: - zh - en --- # Dataset Card for My Dataset """ EXPECTED_ERROR_README_NONE_SUBSECTION = "The following issues were found for the README at `{path}`:\n-\tExpected some content in section `Dataset Card for My Dataset` but it is empty.\n-\tSection `Dataset Card for My Dataset` expected the following subsections: `Table of Contents`, `Dataset Description`. Found 'None'." README_MISSING_SUBSECTION = """\ --- languages: - zh - en --- # Dataset Card for My Dataset ## Table of Contents Some text here. ## Dataset Description Some text here. ### Dataset Summary Some text here. ### Languages Language Text """ EXPECTED_ERROR_README_MISSING_SUBSECTION = "The following issues were found for the README at `{path}`:\n-\tSection `Dataset Description` is missing subsection: `Supported Tasks and Leaderboards`." README_MISSING_CONTENT = """\ --- languages: - zh - en --- # Dataset Card for My Dataset ## Table of Contents Some text here. ## Dataset Description Some text here. ### Dataset Summary Some text here. ### Supported Tasks and Leaderboards ### Languages """ EXPECTED_ERROR_README_MISSING_CONTENT = "The following issues were found for the README at `{path}`:\n-\tExpected some content in section `Languages` but it is empty." README_MISSING_FIRST_LEVEL = """\ --- languages: - zh - en --- ## Table of Contents Some text here. ## Dataset Description Some text here. ### Dataset Summary Some text here. ### Supported Tasks and Leaderboards ### Languages Language Text """ EXPECTED_ERROR_README_MISSING_FIRST_LEVEL = "The following issues were found for the README at `{path}`:\n-\tThe README has no first-level headings. One heading is expected. Skipping further validation for this README." README_MULTIPLE_WRONG_FIRST_LEVEL = """\ --- languages: - zh - en --- # Dataset Card for My Dataset ## Table of Contents Some text here. ## Dataset Description Some text here. ### Dataset Summary Some text here. ### Supported Tasks and Leaderboards ### Languages Language Text # Dataset Card My Dataset """ EXPECTED_ERROR_README_MULTIPLE_WRONG_FIRST_LEVEL = "The following issues were found for the README at `{path}`:\n-\tThe README has several first-level headings: `Dataset Card for My Dataset`, `Dataset Card My Dataset`. Only one heading is expected. Skipping further validation for this README." README_WRONG_FIRST_LEVEL = """\ --- languages: - zh - en --- # Dataset Card My Dataset ## Table of Contents Some text here. ## Dataset Description Some text here. ### Dataset Summary Some text here. ### Supported Tasks and Leaderboards ### Languages Language Text """ EXPECTED_ERROR_README_WRONG_FIRST_LEVEL = "The following issues were found for the README at `{path}`:\n-\tNo first-level heading starting with `Dataset Card for` found in README. Skipping further validation for this README." README_EMPTY = "" EXPECTED_ERROR_README_EMPTY = "The following issues were found for the README at `{path}`:\n-\tThe README has no first-level headings. One heading is expected. Skipping further validation for this README.\n-\tNo YAML markers are present in the README." README_MULTIPLE_SAME_HEADING_1 = """\ --- languages: - zh - en --- # Dataset Card for My Dataset # Dataset Card for My Dataset ## Table of Contents Some text here. ## Dataset Description Some text here. ### Dataset Summary Some text here. ### Supported Tasks and Leaderboards ### Languages Language Text """ EXPECTED_ERROR_README_MULTIPLE_SAME_HEADING_1 = "The following issues were found while parsing the README at `{path}`:\n-\tMultiple sections with the same heading `Dataset Card for My Dataset` have been found. Please keep only one of these sections." @pytest.mark.parametrize( "readme_md, expected_dict", [ (README_CORRECT, CORRECT_DICT), (README_CORRECT_FOUR_LEVEL, CORRECT_DICT_FOUR_LEVEL), ], ) def test_readme_from_string_correct(readme_md, expected_dict): assert ReadMe.from_string(readme_md, example_yaml_structure).to_dict() == expected_dict @pytest.mark.parametrize( "readme_md, expected_error", [ (README_NO_YAML, EXPECTED_ERROR_README_NO_YAML), (README_EMPTY_YAML, EXPECTED_ERROR_README_EMPTY_YAML), (README_INCORRECT_YAML, EXPECTED_ERROR_README_INCORRECT_YAML), (README_EMPTY, EXPECTED_ERROR_README_EMPTY), (README_NONE_SUBSECTION, EXPECTED_ERROR_README_NONE_SUBSECTION), (README_MISSING_FIRST_LEVEL, EXPECTED_ERROR_README_MISSING_FIRST_LEVEL), (README_MISSING_SUBSECTION, EXPECTED_ERROR_README_MISSING_SUBSECTION), (README_MISSING_TEXT, EXPECTED_ERROR_README_MISSING_TEXT), (README_WRONG_FIRST_LEVEL, EXPECTED_ERROR_README_WRONG_FIRST_LEVEL), (README_MULTIPLE_WRONG_FIRST_LEVEL, EXPECTED_ERROR_README_MULTIPLE_WRONG_FIRST_LEVEL), (README_MISSING_CONTENT, EXPECTED_ERROR_README_MISSING_CONTENT), ], ) def test_readme_from_string_validation_errors(readme_md, expected_error): with pytest.raises(ValueError, match=re.escape(expected_error.format(path="root"))): readme = ReadMe.from_string(readme_md, example_yaml_structure) readme.validate() @pytest.mark.parametrize( "readme_md, expected_error", [ (README_MULTIPLE_SAME_HEADING_1, EXPECTED_ERROR_README_MULTIPLE_SAME_HEADING_1), ], ) def test_readme_from_string_parsing_errors(readme_md, expected_error): with pytest.raises(ValueError, match=re.escape(expected_error.format(path="root"))): ReadMe.from_string(readme_md, example_yaml_structure) @pytest.mark.parametrize( "readme_md,", [ (README_MULTIPLE_SAME_HEADING_1), ], ) def test_readme_from_string_suppress_parsing_errors(readme_md): ReadMe.from_string(readme_md, example_yaml_structure, suppress_parsing_errors=True) @pytest.mark.parametrize( "readme_md, expected_dict", [ (README_CORRECT, CORRECT_DICT), (README_CORRECT_FOUR_LEVEL, CORRECT_DICT_FOUR_LEVEL), ], ) def test_readme_from_readme_correct(readme_md, expected_dict): with tempfile.TemporaryDirectory() as tmp_dir: path = Path(tmp_dir) / "README.md" with open(path, "w+") as readme_file: readme_file.write(readme_md) out = ReadMe.from_readme(path, example_yaml_structure).to_dict() assert out["name"] == path assert out["text"] == "" assert out["is_empty_text"] assert out["subsections"] == expected_dict["subsections"] @pytest.mark.parametrize( "readme_md, expected_error", [ (README_NO_YAML, EXPECTED_ERROR_README_NO_YAML), (README_EMPTY_YAML, EXPECTED_ERROR_README_EMPTY_YAML), (README_INCORRECT_YAML, EXPECTED_ERROR_README_INCORRECT_YAML), (README_EMPTY, EXPECTED_ERROR_README_EMPTY), (README_NONE_SUBSECTION, EXPECTED_ERROR_README_NONE_SUBSECTION), (README_MISSING_FIRST_LEVEL, EXPECTED_ERROR_README_MISSING_FIRST_LEVEL), (README_MISSING_SUBSECTION, EXPECTED_ERROR_README_MISSING_SUBSECTION), (README_MISSING_TEXT, EXPECTED_ERROR_README_MISSING_TEXT), (README_WRONG_FIRST_LEVEL, EXPECTED_ERROR_README_WRONG_FIRST_LEVEL), (README_MULTIPLE_WRONG_FIRST_LEVEL, EXPECTED_ERROR_README_MULTIPLE_WRONG_FIRST_LEVEL), (README_MISSING_CONTENT, EXPECTED_ERROR_README_MISSING_CONTENT), ], ) def test_readme_from_readme_error(readme_md, expected_error): with tempfile.TemporaryDirectory() as tmp_dir: path = Path(tmp_dir) / "README.md" with open(path, "w+") as readme_file: readme_file.write(readme_md) expected_error = expected_error.format(path=path) with pytest.raises(ValueError, match=re.escape(expected_error)): readme = ReadMe.from_readme(path, example_yaml_structure) readme.validate() @pytest.mark.parametrize( "readme_md, expected_error", [ (README_MULTIPLE_SAME_HEADING_1, EXPECTED_ERROR_README_MULTIPLE_SAME_HEADING_1), ], ) def test_readme_from_readme_parsing_errors(readme_md, expected_error): with tempfile.TemporaryDirectory() as tmp_dir: path = Path(tmp_dir) / "README.md" with open(path, "w+") as readme_file: readme_file.write(readme_md) expected_error = expected_error.format(path=path) with pytest.raises(ValueError, match=re.escape(expected_error)): ReadMe.from_readme(path, example_yaml_structure) @pytest.mark.parametrize( "readme_md,", [ (README_MULTIPLE_SAME_HEADING_1), ], ) def test_readme_from_readme_suppress_parsing_errors(readme_md): with tempfile.TemporaryDirectory() as tmp_dir: path = Path(tmp_dir) / "README.md" with open(path, "w+") as readme_file: readme_file.write(readme_md) ReadMe.from_readme(path, example_yaml_structure, suppress_parsing_errors=True)
StarcoderdataPython
87021
# Header # Use a header card to display a page #header. # --- from h2o_wave import site, ui image = 'https://images.pexels.com/photos/220453/pexels-photo-220453.jpeg?auto=compress&h=750&w=1260' commands = [ ui.command(name='profile', label='Profile', icon='Contact'), ui.command(name='preferences', label='Preferences', icon='Settings'), ui.command(name='logout', label='Logout', icon='SignOut'), ] page = site['/demo'] page['header1'] = ui.header_card( box='1 1 9 1', title='Transparent header', subtitle='And now for something completely different!', image='https://www.h2o.ai/wp-content/themes/h2o2018/templates/dist/images/h2o_logo.svg', items=[ ui.button(name='btn1', label='Button 1'), ui.button(name='btn2', label='Button 2'), ui.button(name='btn3', label='Button 3'), ], secondary_items=[ui.textbox(name='search', icon='Search', width='300px', placeholder='Search...')], color='transparent' ) page['header2'] = ui.header_card( box='1 2 9 1', title='Card color header', subtitle='And now for something completely different!', items=[ui.menu(image=image, items=commands)], secondary_items=[ ui.button(name='btn1', label='Link 1', link=True), ui.button(name='btn2', label='Link 2', link=True), ui.button(name='btn3', label='Link 3', link=True), ], nav=[ ui.nav_group('Menu', items=[ ui.nav_item(name='#menu/spam', label='Spam'), ui.nav_item(name='#menu/ham', label='Ham'), ui.nav_item(name='#menu/eggs', label='Eggs'), ]), ui.nav_group('Help', items=[ ui.nav_item(name='#about', label='About'), ui.nav_item(name='#support', label='Support'), ]) ], color='card', ) page['header3'] = ui.header_card( box='1 3 9 1', title='Primary color header', subtitle='And now for something completely different!', icon='Cycling', icon_color='$violet', items=[ui.menu(icon='Add', items=commands)], secondary_items=[ ui.tabs(name='menu', value='email', link=True, items=[ ui.tab(name='email', label='Mail', icon='Mail'), ui.tab(name='events', label='Events', icon='Calendar'), ui.tab(name='spam', label='Spam', icon='Heart'), ]), ] ) page.save()
StarcoderdataPython
1763351
<reponame>combinators/templating @(clsName: Python, text: Python, body: Python, bodyTight: Python) class @{clsName}(object): def __init__(self): @body.indentExceptFirst.indentExceptFirst def test(self): @bodyTight.indent.indent if __name__ == "__main__": x = new @{clsName}() print(@text) print(x.blah)
StarcoderdataPython
3261781
<gh_stars>1-10 from browser import document import brySVG.dragcanvas as SVG canvas = SVG.CanvasObject("95vw", "100%", "cyan") document["demo1"] <= canvas tiles = [SVG.ClosedBezierObject([((-100,50), (50,100), (200,50)), ((-100,50), (50,0), (200,50))]), SVG.GroupObject([SVG.PolygonObject([(50,25), (0,50), (50,75), (100,50)]), SVG.SmoothBezierObject([(100,0), (4,40), (4,60), (100,100)])]), SVG.EllipseObject([(25,0), (75,100)], angle=30), SVG.GroupObject([SVG.CircleObject((50,50), 50), SVG.BezierObject([(None, (0,100), (50,25)), ((50,25), (100,100), None)])]), SVG.RectangleObject([(40,0), (50,90)], angle=20), SVG.GroupObject([SVG.SmoothClosedBezierObject([(50,5), (5,80), (95,80)]), SVG.PolylineObject([(0,0), (30,50), (70,50), (100,0)])]), ] for i in range(10): for j in range(6): tile = tiles[(i+j)%6].cloneNode(True) #tile = tiles[(i+j)%6].cloneObject() #is slower but allows MouseMode.DRAG, TRANSFORM or EDIT to be used canvas <= tile canvas.rotateElement(tile, 45*(i*6+j)) canvas.translateElement(tile, (i*100, j*100)) canvas.fitContents() multilinetext = "This is a\nmultiline\nTextObject\nwith anchor\nat top left\nand fontsize 16" canvas <= SVG.TextObject(multilinetext, (1025,10), 1, fontsize=16, ignorescaling=True, canvas=canvas, textcolour="blue") longtext = "This is a WrappingTextObject with a width of 200 SVG units, with the anchor at bottom left." canvas <= SVG.WrappingTextObject(canvas, longtext, (1025,600), 200, 7, 16, ignorescaling=True, textcolour="purple") canvas.fitContents() canvas.mouseMode = SVG.MouseMode.PAN
StarcoderdataPython
3217719
<filename>tests/schema/github/conftest.py import pytest from acondbs import create_app from acondbs.db.ops import define_tables from acondbs.db.sa import sa from acondbs.models import ( GitHubOrg, GitHubUser, GitHubOrgMembership, GitHubToken, AccountAdmin, ) ##__________________________________________________________________|| @pytest.fixture def app_empty(): database_uri = "sqlite:///:memory:" y = create_app( SQLALCHEMY_DATABASE_URI=database_uri, GITHUB_AUTH_AUTHORIZE_URL="https://github.com/login/oauth/authorize", GITHUB_AUTH_TOKEN_URL="https://github.com/login/oauth/access_token", GITHUB_AUTH_CLIENT_ID="client_id_0123456789", GITHUB_AUTH_CLIENT_SECRET="<KEY>", GITHUB_AUTH_REDIRECT_URI="http://localhost:8080/signin", ) with y.app_context(): define_tables() yield y @pytest.fixture def app(app_empty): y = app_empty # # +------+ # | | +-------+ +--------+ # | org1 | ----- | | --+-- | token1 | # | | | user1 | | +--------+ # +------+ +-- | | | # | +-------+ | +--------+ # | +-- | token2 | # +------+ | +--------+ # | | --+ +-------+ # | org2 | | | +--------+ # | | ----- | user2 | ----- | token3 | # +------+ | | +--------+ # +-------+ # # +------+ +-------+ # | | | | +--------+ # | org3 | | user3 | ----- | token4 | # | | | | +--------+ # +------+ +-------+ # # org1 = GitHubOrg(login="org1", git_hub_id="012:Organization1") org2 = GitHubOrg(login="org2", git_hub_id="012:Organization2") org3 = GitHubOrg(login="org3", git_hub_id="012:Organization3") user1 = GitHubUser( user_id=1, login="user1", git_hub_id="04:User1", name="<NAME>", avatar_url="avatar.com/user1", ) user2 = GitHubUser( user_id=2, login="user2", git_hub_id="04:User2", name="<NAME>", avatar_url="avatar.com/user2", ) user3 = GitHubUser( user_id=3, login="user3", git_hub_id="04:User3", name="<NAME>", avatar_url="avatar.com/user3", ) GitHubToken(token_id=1, token="token1", scope="read:org", user=user1) GitHubToken(token_id=2, token="token2", scope="", user=user1) GitHubToken(token_id=3, token="token3", scope="", user=user2) GitHubToken(token_id=4, token="token4", scope="", user=user3) GitHubOrgMembership(org=org1, member=user1) GitHubOrgMembership(org=org2, member=user1) GitHubOrgMembership(org=org2, member=user2) admin1 = AccountAdmin(git_hub_login="user1") admin2 = AccountAdmin(git_hub_login="user3") with y.app_context(): sa.session.add(org1) sa.session.add(org2) sa.session.add(org3) sa.session.add(user1) sa.session.add(user2) sa.session.add(user3) sa.session.add(admin1) sa.session.add(admin2) sa.session.commit() yield y ##__________________________________________________________________||
StarcoderdataPython
3212226
# Copyright (c) 2018 PrimeVR # Distributed under the MIT software license, see the accompanying # file LICENSE or http://www.opensource.org/licenses/mit-license.php from lib.web_data import WebData def bitcore_claimer_line(n): src_addr = n['src_addr'] txid = "<%s-airdrop-txid>" % src_addr priv_key = "%s-private-key" % n['src_addr'] dst_addr = "bitcore-destination-address" txindex = "<%s-airdrop-txindex>" % src_addr satoshis = "<%s-airdrop-satoshis>" % src_addr force = "--force " if n.bfc_force else "" return ("python2.7 bitcoin_fork_claimer/claimer.py BTX %s %s %s %s" " %s--txindex %s --satoshis %s" % (txid, priv_key, src_addr, dst_addr, force, txindex, satoshis)) BITCORE_INSTRUCTIONS = """ BitCore has a separate blockchain that aidropped value on BTC addresses as new transactions. To use the bitcoin_fork_claimer tool privately, the details of the transactions must be manually found and provided here. One must use a BitCore node or block explorer to find: 1) The transaction hash (a.k.a transaction ID) which credits the address 2) The transaction index of the specific output 3) The amount of BitCore satoshis credited This has been automated to access the BitCore block explorer via the direct-query-claim-prep.py script included in forkdrop_suite. This will gather the balances and provide a more specific report tailored to claiming Bitcoin Private. WARNING: These quereis are less private than blockchain.info queries and may be less reliable. """ UNSPENT_URL = "https://chainz.cryptoid.info/btx/api.dws?q=unspent&active=%s&key=<KEY>" class BitcoreQuery(object): def __init__(self, vdb, settings): self.vdb = vdb self.coin = self.vdb.get_coin_info('bitcore') self.addrs = [{'addr': a, 'p2sh_p2wpkh': a[:1] == "3", 'bech32': a[:3] == "bc1"} for a in settings.addresses] self.tails = not settings.not_tails self.cache = settings.cache_requests self.wd = WebData(tails=self.tails, cache=self.cache) self._add_nuggets() def _add_nuggets(self): for a in self.addrs: addr = a['addr'] url = UNSPENT_URL % addr unspent_info = self.wd.fetch_web_url_json_info(url) for u in unspent_info['unspent_outputs']: self.vdb['nuggets'].append_direct_query(a, self.coin, u['tx_hash'], u['tx_ouput_n'], int(u['value'])) BITCORE = { 'id': 'bitcore', 'instructions': BITCORE_INSTRUCTIONS, 'claimer_line': bitcore_claimer_line, 'direct_query': BitcoreQuery, }
StarcoderdataPython
3246210
#!/usr/bin/env python """ Finds and prints the contents of chests (including minecart chests) """ import locale, os, sys # local module try: import nbt except ImportError: # nbt not in search path. Let's see if it can be found in the parent folder extrasearchpath = os.path.realpath(os.path.join(__file__,os.pardir,os.pardir)) if not os.path.exists(os.path.join(extrasearchpath,'nbt')): raise sys.path.append(extrasearchpath) from nbt.world import WorldFolder class Position(object): def __init__(self, x,y,z): self.x = x self.y = y self.z = z class Chest(object): def __init__(self, type, pos, items): self.type = type self.pos = Position(*pos) self.items = items def items_from_nbt(nbtlist): items = {} # block_id -> count for item in nbtlist: id = item['id'].value count = item['Count'].value if id not in items: items[id] = 0 items[id] += count return items def chests_per_chunk(chunk): """Given a chunk, increment the block types with the number of blocks found""" # if (len(chunk['Entities']) > 0) or (len(chunk['TileEntities']) > 0): # print("Chunk %d,%d" % (chunk["xPos"],chunk["zPos"])) entities = [] for entity in chunk['Entities']: if entity["id"].value == "Minecart" and entity["type"].value == 1: x,y,z = entity["Pos"] x,y,z = x.value,y,value,z.value items = items_from_nbt(entity["Items"]) entities.append(Chest("Minecart with chest",(x,y,z),items)) for entity in chunk['TileEntities']: if entity["id"].value == "Chest": x,y,z = entity["x"].value,entity["y"].value,entity["z"].value items = items_from_nbt(entity["Items"]) entities.append(Chest("Chest",(x,y,z),items)) return entities def print_results(chests): locale.setlocale(locale.LC_ALL, '') for chest in chests: itemcount = sum(chest.items.values()) print("%s at %s,%s,%s with %d items:" % \ (chest.type,\ locale.format("%0.1f",chest.pos.x,grouping=True),\ locale.format("%0.1f",chest.pos.y,grouping=True),\ locale.format("%0.1f",chest.pos.z,grouping=True),\ itemcount)) for blockid,count in chest.items.items(): print(" %3dx Item %d" % (count, blockid)) def main(world_folder): world = WorldFolder(world_folder) try: for chunk in world.iter_nbt(): print_results(chests_per_chunk(chunk["Level"])) except KeyboardInterrupt: return 75 # EX_TEMPFAIL return 0 # NOERR if __name__ == '__main__': if (len(sys.argv) == 1): print("No world folder specified!") sys.exit(64) # EX_USAGE world_folder = sys.argv[1] # clean path name, eliminate trailing slashes: world_folder = os.path.normpath(world_folder) if (not os.path.exists(world_folder)): print("No such folder as "+world_folder) sys.exit(72) # EX_IOERR sys.exit(main(world_folder))
StarcoderdataPython
124409
import random from drf_yasg.utils import swagger_auto_schema from rest_framework import status from rest_framework import viewsets from rest_framework import decorators as drf_decorators from rest_framework.request import Request from rest_framework.response import Response from extension import defines as extension_defines from extension import exceptions as extension_exceptions from extension import serializers as extension_serializers class ExtensionView(viewsets.ViewSet): @drf_decorators.action( detail=False, methods=["GET"], ) @swagger_auto_schema( operation_summary="Get Collectable Fields", operation_description="Retrieve strings the extensions will use to capture data.", responses={ status.HTTP_200_OK: extension_serializers.GetExtensionFieldsSerializer, }, ) def get_collectable_fields(self, request: Request, *args, **kwargs) -> Response: extension_version = request.headers.get(extension_defines.EXTENSION_VERSION_HEADER_NAME) if extension_version is None: raise extension_exceptions.NoExtensionVersionError if extension_version not in extension_defines.SUPPORTED_EXTENSION_VERSIONS: raise extension_exceptions.ExtensionDeprecatedError vctb = ["סמס", "קורס", "שם הקורס", "אופן", "קובע", "שעות", "משקל", "הערות"] random.shuffle(vctb) response_serializer = extension_serializers.GetExtensionFieldsSerializer( instance={ "vctb": vctb[:3], "vctl": "קורס", "vctln": "שם", }, ) return Response(response_serializer.data, status=status.HTTP_200_OK)
StarcoderdataPython
1779521
""" executable.py - base classes for all executable code NOTE: this script is not to be used standalone, execept for testing purposes! """ # HISTORY #################################################################### # # 0.1.0 MR Mar11 Initial version (moderately tested) ############################################################################## __description__ = "an Executable class implementation" __version__ = "0.1.0" __author__ = "<NAME>." import os from subprocess import Popen, PIPE, STDOUT class Executable(object): """ Executable - abstract class implementing the executable script """ def __init__(self, command): assert command is not None assert command != "" self.__cmd = command # a script to be executed self._env = os.environ # dict for environment vars def __str__(self): return "{}".format(self.command) @property def command(self): """Returns the script name """ return self.__cmd def setEnv(self, key, val): self._env[key] = val def getEnv(self, key): return self._env[key] @property def environ(self): return self._env def _checkScript(self): """Checks for existence of the script""" if not os.path.exists(self.__cmd): return False return True def _ExeError(self, exe, error): """Saves an 'executable missing' error message as output text""" return "Executable '{}' not found on system.\n{}".format(exe, error) def _ScriptError(self): """Saves an 'script missing' error message as output text""" return "Script '{}' does not exist".format(self.command) def execute(self, executable, args="", shell=False): """Executes the script/executable""" assert args is not None assert executable is not None rc = 1 output = "" # check if executable even exists; if so, execute it; otherwise fail if self._checkScript(): cmdlist = [] # we need to create a proper list of arguments for Popen to run if isinstance(executable, list): cmdlist = executable[:] # copy list cmdlist.append(self.command) else: cmdlist = [executable, self.command] # extend the list, if command-line arguments are present if args != "": cmdlist.extend(args.split()) # now execute it and get RC and output text try: proc = Popen(cmdlist, env=self.environ, shell=shell, stdin=PIPE, stdout=PIPE, stderr=STDOUT) (output, errors) = proc.communicate() rc = proc.returncode except OSError as oserror: output = self._ExeError(executable, oserror) else: output = self._ScriptError() return (rc, output) ################################################################### if __name__ == '__main__': print(__doc__)
StarcoderdataPython
133180
from __future__ import division from zibalzeep.xsd.const import xsd_ns from zibalzeep.xsd.elements.base import Base class Schema(Base): name = "schema" attr_name = "schema" qname = xsd_ns("schema") def clone(self, qname, min_occurs=1, max_occurs=1): return self.__class__() def parse_kwargs(self, kwargs, name, available_kwargs): if name in available_kwargs: value = kwargs[name] available_kwargs.remove(name) return {name: value} return {} def parse(self, xmlelement, schema, context=None): from zibalzeep.xsd.schema import Schema as _Schema schema = _Schema(xmlelement, schema._transport) context.schemas.append(schema) return schema def parse_xmlelements(self, xmlelements, schema, name=None, context=None): if xmlelements[0].tag == self.qname: xmlelement = xmlelements.popleft() result = self.parse(xmlelement, schema, context=context) return result def resolve(self): return self _elements = [Schema]
StarcoderdataPython
4814201
class BotHelper: def ConnectToBot(Message): print("Message") pass
StarcoderdataPython
1653114
from discord import Embed, FFmpegPCMAudio from discord.ext import commands from discord.utils import get from youtube_dl import YoutubeDL from asyncio import run_coroutine_threadsafe import re import requests from bs4 import BeautifulSoup class Music(commands.Cog, name='Music'): YDL_OPTIONS = {'format': 'bestaudio', 'noplaylist':'True'} FFMPEG_OPTIONS = {'before_options': '-reconnect 1 -reconnect_streamed 1 -reconnect_delay_max 5', 'options': '-vn'} def __init__(self, bot): self.bot = bot self.song_queue = {} self.message = {} @staticmethod def parse_duration(duration): result = [] m, s = divmod(duration, 60) h, m = divmod(m, 60) return f'{h:d}:{m:02d}:{s:02d}' @staticmethod def search(author, arg): with YoutubeDL(Music.YDL_OPTIONS) as ydl: try: requests.get(arg) except: info = ydl.extract_info(f"ytsearch:{arg}", download=False)['entries'][0] else: info = ydl.extract_info(arg, download=False) embed = (Embed(description=f"[{info['title']}]({info['webpage_url']})", color=0x3de4ba) .add_field(name='Duration', value=Music.parse_duration(info['duration'])) .add_field(name='Requested by', value=author) .add_field(name='Uploader', value=f"[{info['uploader']}]({info['channel_url']})") .set_thumbnail(url=info['thumbnail'])) return {'embed': embed, 'source': info['formats'][0]['url'], 'title': info['title']} async def edit_message(self, ctx): embed = self.song_queue[ctx.guild][0]['embed'] content = "\n".join([f"({self.song_queue[ctx.guild].index(i)}) {i['title']}" for i in self.song_queue[ctx.guild][1:]]) if len(self.song_queue[ctx.guild]) > 1 else "No song queued" embed.set_field_at(index=3, name="File d'attente :", value=content, inline=False) await self.message[ctx.guild].edit(embed=embed) def play_next(self, ctx): voice = get(self.bot.voice_clients, guild=ctx.guild) if len(self.song_queue[ctx.guild]) > 1: del self.song_queue[ctx.guild][0] run_coroutine_threadsafe(self.edit_message(ctx), self.bot.loop) voice.play(FFmpegPCMAudio(self.song_queue[ctx.guild][0]['source'], **Music.FFMPEG_OPTIONS), after=lambda e: self.play_next(ctx)) voice.is_playing() else: run_coroutine_threadsafe(voice.disconnect(), self.bot.loop) run_coroutine_threadsafe(self.message[ctx.guild].delete(), self.bot.loop) @commands.command(aliases=['p'], brief='$play [url/words]') async def play(self, ctx, *, video: str): channel = ctx.author.voice.channel voice = get(self.bot.voice_clients, guild=ctx.guild) song = Music.search(ctx.author.mention, video) if voice and voice.is_connected(): await voice.move_to(channel) else: voice = await channel.connect() if not voice.is_playing(): self.song_queue[ctx.guild] = [song] self.message[ctx.guild] = await ctx.send(embed=song['embed']) await ctx.message.delete() voice.play(FFmpegPCMAudio(song['source'], **Music.FFMPEG_OPTIONS), after=lambda e: self.play_next(ctx)) voice.is_playing() else: self.song_queue[ctx.guild].append(song) await self.edit_message(ctx) @commands.command(brief='$pause') async def pause(self, ctx): voice = get(self.bot.voice_clients, guild=ctx.guild) if voice.is_connected(): await ctx.message.delete() if voice.is_playing(): await ctx.send(embed= Embed(description= 'Music paused!', color= 0x3de4ba, delete_after=10.0)) voice.pause() else: await ctx.send(embed= Embed(description= 'Music resumed!', color= 0x3de4ba, delete_after=10.0)) voice.resume() @commands.command(aliases=['pass'], brief='$skip') async def skip(self, ctx): voice = get(self.bot.voice_clients, guild=ctx.guild) if voice.is_playing(): await ctx.message.delete() await ctx.send(embed= Embed(description= 'Music skipped!', color= 0x3de4ba, delete_after=10.0)) voice.stop() @commands.command(brief='$remove [x]') async def remove(self, ctx, *, num: int): voice = get(self.bot.voice_clients, guild=ctx.guild) if voice.is_playing(): del self.song_queue[ctx.guild][num] await ctx.message.delete() await self.edit_message(ctx) @commands.command(brief='$lyrics [artist] [song]') async def lyrics(self, ctx, song: str): message = ctx.message.content song = message.replace("$lyrics", "") url = self.generateUrl(song) html = self.getHtml(url) lyrics = self.extractLyrics(html) for msg in self.extractLyrics(html): await ctx.send(embed= Embed(description= msg, color= 0x3de4ba)) def generateUrl(self,artist): host = "https://genius.com/" urlWords = [w.lower() for w in artist.split()] + ["lyrics"] urlWords[0] = urlWords[0].title() return host+"-".join(urlWords) def getHtml(self,url): req = requests.get(url=url) return BeautifulSoup(req.content, 'html.parser') def extractLyrics(self,html): htmlString = str(html.find_all("div", "lyrics")[0]) htmlString, _ = re.subn("</a>","", htmlString) htmlString, _= re.subn("<a[^>]*>","", htmlString) htmlString, _= re.subn("<p>","", htmlString) htmlString, _= re.subn("<!--sse-->","", htmlString) htmlString, _= re.subn("<br/>","", htmlString) htmlString, _= re.subn("<div class=\"lyrics\">","", htmlString) htmlString, _= re.subn("</p>","", htmlString) htmlString, _= re.subn("<!--/sse-->","", htmlString) htmlString, _= re.subn("</div>","", htmlString) htmlString, _= re.subn("<i>","*", htmlString) htmlString, _= re.subn("</i>","*", htmlString) htmlString, _= re.subn("<b>","**", htmlString) htmlString, _= re.subn("</b>","**", htmlString) htmlString, _= re.subn("&amp;","&", htmlString) htmlString, _= re.subn("&lt;","<", htmlString) htmlString, _= re.subn("&gt;",">", htmlString) n = 2000 return [htmlString[i:i+n] for i in range(0, len(htmlString), n)] def setup(bot): bot.add_cog(Music(bot))
StarcoderdataPython
3209588
#!/usr/bin/env python3 import argparse import json import sys from subprocess import Popen, PIPE from odf.draw import Image, Frame from odf.opendocument import OpenDocumentSpreadsheet from odf.style import Style, TableColumnProperties, TableRowProperties, TextProperties from odf.table import Table, TableRow, TableCell, TableColumn from odf.text import P, A from pandocodswriter.limages import load_images from pandocodswriter.lstyle import load_style, add_fmt, st_dict # usage - python odswriter.py yourInputFile.yourExetention yourOutputFile.ods -s *YOUR POSITIVE NUMBER* # check README.md for more information. # DO NOT mix up places of intput and output. # Style names. # header0 - just for correct index. # If in input file more, than two levels of headers, next level header will generate automatically # with name = "header" + str(level). header = ['header0', 'header1', 'header2'] table_header = 'tablehead' table_content = 'tablebody' simple_text = 'text' # Read the command-line arguments. parser = argparse.ArgumentParser(description='Pandoc ODS writer. This is Pandoc filter, but there is no opportunity ' 'write .ods files easier way. So, use "out.ods" ' 'option to write .ods files with this filter') parser.add_argument('input', help='Input file. Use Pandoc`s input formats.', action='store') parser.add_argument('output', help='Output file. Use .ods filename extension.', action='store') parser.add_argument('-s', '--separator', nargs=1, help='Header level to separate sheets, 0 by default(no separation).', action='store') parser.add_argument('-r', '--reference', nargs=1, help='Reference to file with styles', action='store') args = parser.parse_args() # It is important for auto-height in text-rows: # if you want to change width by default (10 cm), change it in 'write_sheet()', # count how much PT in your length (in CM) and change this constant: PTINTENCM = 284 # count how much IN in your length (in CM) and change this constant: ININTENCM = 3.9 # I need this global variables, because there are two recursive functions call each other, so it would be very hard work # without global "string_to_write". Other ones are just make those functions much more easy to read. ods = OpenDocumentSpreadsheet() table = Table() # creating the first sheet content = P() string_to_write = '' header_level = 0 bullet = 0 # indicating bullet lists ordered = 0 # indicating bullet list and used as order at item lines image_counter = 0 saved_hr = None # list of hardreferences to loaded images saved_styles = {} # We will save styles in order to not downloading it again each time we use it. separator = 0 # level of separating header # Dictionary of formatting indicators. fmt = {'Emph': 0, 'Strong': 0, 'Strikeout': 0} def write_sheet(): wide = Style(name="Wide", family="table-column") wide.addElement(TableColumnProperties(columnwidth="10cm")) ods.automaticstyles.addElement(wide) table.addElement(TableColumn(stylename='Wide')) ods.spreadsheet.addElement(table) def count_height(row, cell): """Counting height that shows all text in cell. This functions uses width of text-column and font size. Args: row - current row. cell - current cell. """ style_name = cell.getAttribute('stylename') try: style = saved_styles[style_name] text_prop = style.getElementsByType(TextProperties) try: text_prop = text_prop[0] font_size = str(text_prop.getAttribute('fontsize')) font_size = font_size.replace('pt', '') font_size = int(font_size) except IndexError: font_size = 10 except KeyError: font_size = 10 symbols_in_string = PTINTENCM // font_size + 1 length = 0 for p in cell.getElementsByType(P): length += len(p.__str__()) height = font_size*(length // symbols_in_string + 1) + 4 height = str(height) + 'pt' new_name = 'heightsuit' + height height_suit = Style(name=new_name, family='table-row') height_suit.addElement(TableRowProperties(rowheight=height)) ods.automaticstyles.addElement(height_suit) row.setAttribute(attr='stylename', value=new_name) def count_size(wh_list, row): """Count height of image row. Args: wh_list - list with attributes, contains width and height: row - image row. """ height, width = -1, -1 for l in wh_list: if l[0] == 'width': width = float(l[1].replace('in', '')) if l[0] == 'height': height = float(l[1].replace('in', '')) if height == -1 or width == -1: width = ININTENCM height = ININTENCM if width > ININTENCM: new_width = ININTENCM new_height = height * new_width / width else: new_width = width new_height = height height_set = str(new_height)+'in' new_name = 'image' + str(image_counter) height_suit = Style(name=new_name, family='table-row') height_suit.addElement(TableRowProperties(rowheight=height_set)) ods.automaticstyles.addElement(height_suit) row.setAttribute(attr='stylename', value=new_name) new_width = str(new_width) + 'in' new_height = height_set return new_width, new_height def add_style(cell, name): """Add style to cell element. This function calls style loading from 'lstyle' and saves it, in order to use it again quickly. Args: cell - cell that needs to be styled. name - style name that will be set. """ if args.reference: styles_source = args.reference[0] else: styles_source = str(sys.argv[0]) styles_source = styles_source.replace('odswriter.py', '') styles_source = styles_source + 'styles.ods' global saved_styles global ods try: saved_styles[name] except KeyError: style = load_style(name, styles_source) if style is not None: saved_styles[name] = style ods.styles.addElement(style) cell.setAttribute(attr='stylename', value=name) def write_text(): """Write to output file ordinary elements. This function is called every tame, we collect whole paragraph or block of elements in 'string_to_write' We write every block or paragraph in it's own cell in the first column of output file. After writing we shift down current row and clean 'string_to_write' in order to collect next elements. """ global string_to_write global header_level global ordered global bullet global table global separator global content row = TableRow() cell = TableCell() if header_level != 0 and header_level > 0: if header_level > (len(header) - 1): # if there are headers with lvl bigger than 2 for i in range(len(header), header_level+1): # creating names for headers with lvl bigger than 2 header.append('header' + str(i)) add_style(cell, header[header_level]) if header_level == separator: # if separator was set, we will create new sheet in document if table.hasChildNodes(): write_sheet() table = Table(name=string_to_write) # creating new sheet with separating header as name else: add_style(cell, simple_text) if bullet: string_to_write = '- ' + string_to_write if ordered > 0: string_to_write = str(ordered) + ') ' + string_to_write ordered = ordered + 1 content.addText(string_to_write) cell.addElement(content) content = P() count_height(row, cell) row.addElement(cell) table.addElement(row) string_to_write = '' def write_image(image): """Write to output file image elements. Since, element with title 'Image' has special structure of 'c'(Content) field, that looks like: [[0], [1], [2]] where: [0] - list of attributes: identifier, classes, key-value pairs: ['id', [], [ ... , ['weight', '...in'], ['height', '...in'], ... ] - we get sizes there. [1] - caption. [2] - ['src', 'title'] - source and title of image. we should parse it especially. Args: image - element with title 'Image'. """ global image_counter global saved_hr if image_counter == -1: return if image_counter == 0: saved_hr = load_images(args.input, ods) if len(saved_hr) == 0: image_counter = -1 return if string_to_write: write_text() row = TableRow() cell = TableCell() w, h = count_size(image['c'][0][2], row) frame = Frame(width=w, height=h) img = Image(href=saved_hr[image_counter]) table.addElement(row) row.addElement(cell) cell.addElement(frame) frame.addElement(img) image_counter = image_counter + 1 def write_bullet(bull_list, without_write): global bullet bullet = 1 list_parse(bull_list['c'], without_write) bullet = 0 def write_ord(ord_list, without_write): global ordered ordered = 1 list_parse(ord_list['c'], without_write) ordered = 0 def write_code(code): """Write to output file code elements. Since, element with title 'Code' or 'CodeBlock' has special structure of 'c'(Content) field, that looks like: [[0], 'code'] where: [0] - list of attributes: identifier, classes, key-value pairs. 'code' - string with code. we should parse it especially. Args: code - element with title 'Code' or 'CodeBlock'. """ global string_to_write string_to_write = string_to_write + code['c'][1] def write_link(link): """Write special blocks with attributes. Since, element with title 'Link' has special structure of 'c'(Content) field, that looks like: [[atr], [1},['target', 'title']] where: [atr] - list of attributes: identifier, classes, key-value pairs. [1] - list with objects (list of dictionaries) - visible text of hyperlink. ['target', 'title'] - list with two strings, 'target' - URL, 'title' - title. we should parse it especially. Args: link - element with title 'Link'. """ global string_to_write global content content.addText(string_to_write) string_to_write = '' list_parse(link['c'][1], without_write=True) a = A(href=link['c'][2][0], text=string_to_write) string_to_write = '' content.addElement(a) def write_math(math): """Write to output file code elements Since, element with title 'Math' has special structure of 'c'(Content) field, that looks like: [{0}, 'math']. where: {0} - dictionary contains type of math. 'math' - string with math. we should parse it especially. TeX Math format. Args: raw - element with title 'Math'. """ # TODO: write it global string_to_write string_to_write = string_to_write + math['c'][1] def write_raw(raw): """Write to output file raw elements. Since, element with title 'RawBlock' or 'RawInline' has special structure of 'c'(Content) field, that looks like: [format, 'raw text'] where: format - format of raw text. 'raw text' - string with raw text. we should parse it especially. Args: raw - element with title 'RawBlock' or 'RawInline'. """ global string_to_write string_to_write = string_to_write + raw['c'][1] def write_special_block(block, without_write): """Write special blocks with attributes. Since, element with title 'Div' or 'Span' or 'Header' has special structure of 'c'(Content) field, that looks like: [[0], [1]]* where: [0] - list of attributes: identifier, classes, key-value pairs. [1] - list with objects (list of dictionaries) - content. * with 'Header' title - [level, [0], [1]] - level - int, [0], [1] - the same as above. we should parse it especially. This function writes block itself. Args: block - element with title 'Div' or 'Span' or 'Header'. without_write - indicate calling write_text() functions. By default calls it. """ global string_to_write global header_level con = 1 if block['t'] == 'Header': header_level = block['c'][0] con = 2 if (not without_write) and string_to_write: write_text() list_parse(block['c'][con], without_write=True) if not without_write: write_text() header_level = 0 def write_table(tab): """Write to output file table elements. This function is called every time, we meet 'Table' dictionary's title. Firstly, if we have some information in 'string_to_write' we record it, because we'll use this variable to collect information from table's cells. Table in pandoc's json has following structure: dict: { 't': 'Table' 'c': [ [0] [1] [2] [3] [4] ] } Where: [0] - caption. [1] - is list of aligns by columns, looks like: [ { t: 'AlignDefault' }, ... ]. [2] - widths of columns. [3] - is list of table's headers (top cell of every column), can be empty. [4] - list of rows, and row is list of cells. Since every cell's structure is the same as text's one, we just parse them as list and write one by one. Args: tab - dictionary with 't': 'Table". """ global table global string_to_write global fmt for k in fmt.keys(): # setting to zero all outside-table formatting, we use formatting ONLY inside table-cell fmt[k] = 0 if string_to_write: # writing all text from buffer, table has it's own rules for rows, cols and their shift-rules write_text() row = TableRow() # adding empty line before table table.addElement(row) row = TableRow() headers = tab['c'][3] if headers: cell = TableCell() # adding empty first cell in row (first column in document - text column). row.addElement(cell) for col in headers: cell = TableCell() list_parse(col, without_write=True) add_style(cell, table_header) cell_content = P(text=string_to_write) for key in fmt.keys(): if fmt[key] == 1: new_style = add_fmt(style=st_dict[cell.getAttribute(attr='stylename')], key=key) ods.styles.addElement(new_style) fmt[key] = 0 cell = TableCell(stylename=new_style.getAttribute(attr='name')) cell.addElement(cell_content) string_to_write = '' row.addElement(cell) table.addElement(row) t_content = tab['c'][4] for line in t_content: row = TableRow() cell = TableCell() row.addElement(cell) for col in line: cell = TableCell() list_parse(col, without_write=True) add_style(cell, table_content) cell_content = P(text=string_to_write) for key in fmt.keys(): if fmt[key] == 1: new_style = add_fmt(style=st_dict[cell.getAttribute(attr='stylename')], key=key) ods.styles.addElement(new_style) fmt[key] = 0 cell = TableCell(stylename=new_style.getAttribute(attr='name')) cell.addElement(cell_content) string_to_write = '' row.addElement(cell) table.addElement(row) row = TableRow() # adding empty line after table table.addElement(row) # This two functions - 'dict_parse()' and 'list_parse()', has purpose of extract readable information # from json object. # Pandoc's json object in field 'blocks' has list of dictionaries or lists, # which represent another objects and dictionaries has the following structure: # { 't': '*Name of objects type*', # 'c': '*Content of object*' } # e.g.: # { 't': 'Str', # 'c': 'Hello' } # (sometimes there can be no 'c'-field (e.g. 'Space' - object) # So, 'c'-field - content, can be a list of dictionaries, or a string, or a list of lists, # and we should parse list again and etc. # That's why we have there two functions - for parsing lists and for parsing dictionaries - that should call each other def dict_parse(dictionary, without_write=False): """Parse dictionaries. Dictionary represent some json-object. Kind of json object depends on 't' (title) field of it. We will parse it differently depending on different titles. Sometimes this function write block, sometimes it leaves writing special functions. Args: dictionary - object with 't' and sometimes 'c' fields. without_write - indicate calling write_text() functions. By default calls it. """ global string_to_write global fmt try: if dictionary['t'] in fmt.keys(): fmt[dictionary['t']] = 1 if dictionary['t'] == 'Table': write_table(dictionary) elif dictionary['t'] == 'CodeBlock' or dictionary['t'] == 'Code': write_code(dictionary) elif dictionary['t'] == 'Div' or dictionary['t'] == 'Span' or dictionary['t'] == 'Header': write_special_block(dictionary, without_write) elif dictionary['t'] == 'Math': write_math(dictionary) elif dictionary['t'] == 'Link': write_link(dictionary) elif dictionary['t'] == 'BulletList': write_bullet(dictionary, without_write) elif dictionary['t'] == 'OrderedList': write_ord(dictionary, without_write) elif dictionary['t'] == 'Image': write_image(dictionary) elif 'c' in dictionary: if type(dictionary['c']) == str: string_to_write = string_to_write + dictionary['c'] if type(dictionary['c']) == list: list_parse(dictionary['c'], without_write) else: if dictionary['t'] == 'Space': string_to_write = string_to_write + ' ' elif dictionary['t'] == 'SoftBreak': string_to_write = string_to_write + '\n' elif dictionary['t'] == 'LineBreak': string_to_write = string_to_write + '\n\n' if not without_write: write_text() else: string_to_write = string_to_write if dictionary['t'] == 'Para': string_to_write = string_to_write + '\n' if not without_write: write_text() except KeyError: print('Incompatible Pandoc version') def list_parse(content_list, without_write=False): """Parse list. Args: content_list - list with different parts of content from input-document. without_write - indicate calling write_text() functions. By default calls it. """ for item in content_list: if type(item) == dict: dict_parse(item, without_write) if type(item) == list: list_parse(item, without_write) def main(doc): """Main function. Get JSON object from pandoc, parse it, save result. Args: doc - json object as python dictionary or list. In case of dictionary it has representation like: { 'pandoc-version': ... 'meta': ... 'blocks': .......} in blocks we have all file-content, we will parse doc['blocks']. In case of list it has representation like: [[info_list], [content_list]], so we will parse doc[1]. Raises: PermissionError: when we can't write output file. """ global table output = args.output if type(doc) == dict: list_parse(doc['blocks']) elif type(doc) == list: list_parse(doc[1]) else: print('Incompatible Pandoc version') write_sheet() try: ods.save(output) except PermissionError as err: print("No access to ", output) print(err.strerror) if __name__ == '__main__': source = args.input # Use subprocess to call pandoc and convert input file into json-object. command = 'pandoc ' + source + ' -t json' proc = Popen(command, shell=True, stdout=PIPE, stderr=PIPE) res = proc.communicate() if res[1]: print(str(res[1])) # sending stderr output to user else: if args.separator is None: d = json.loads(res[0]) main(d) if args.separator is not None: try: s = int(args.separator[0]) separator = s d = json.loads(res[0]) main(d) except IndexError: print('You entered invalid separator') except ValueError: print('You entered invalid separator')
StarcoderdataPython
3379259
<reponame>herrywen-nanj/51reboot<filename>lesson01/liushifan/zuoye1.py<gh_stars>0 for i in range(1,10): for x in range(1,i+1): print("%d * %d = %2d "%(i, x, i*x),end=' ') print(' ')
StarcoderdataPython
3245024
<filename>environment.py import argparse import gym from gym import spaces import numpy as np import random from collections import deque import os import ray from ray import tune from ray.tune import grid_search from ray.rllib.env import EnvContext from ray.rllib.policy import Policy from ray.rllib.models import ModelCatalog from ray.rllib.models.torch.torch_modelv2 import TorchModelV2 from ray.rllib.models.torch.fcnet import FullyConnectedNetwork as TorchFC from ray.rllib.utils.test_utils import check_learning_achieved from ray.rllib.utils.framework import try_import_torch torch, nn = try_import_torch() from typing import Dict, List, Optional from ray.rllib.utils.typing import TensorType, Tuple, Union parser = argparse.ArgumentParser() parser.add_argument("--run", type=str, default="PPO") parser.add_argument("--as-test", action="store_true") parser.add_argument("--stop-iters", type=int, default=50) parser.add_argument("--stop-timesteps", type=int, default=100000) parser.add_argument("--stop-reward", type=float, default=0.1) class ConstraintSudoku(gym.Env): # Adapted from http://norvig.com/sudoku.html def __init__(self, config: EnvContext): d = config.get('d', 3) assert d % 2 == 1, "d must be odd" self.d = d self.D = d**2 self.N = self.D * 2 - 1 # Number of solved cells at the start of a puzzle # A sudoku game can be represented as a DxD grid (D is typically 9) # and each cell in the grid can take one of D possible values. # At any given point, a cell may have one possible value (if its solved) # up to D possible values (if there are no constraints on the cell). # We express this as a binary DxDxD array where arr[i][j] is a # D-dimensional binary vector representing remaining possible values # for the cell in the i'th row and the j'th column self.observation_space = spaces.MultiBinary([self.D]*3) self.action_space = spaces.Dict({ 'row': spaces.Discrete(self.D), 'col': spaces.Discrete(self.D), 'val': spaces.Discrete(self.D), }) self.max_num_steps = config.get('max_num_steps', 1e6) self.rewards = { 'impossible_assign': -1, 'solved_assign': -1, 'invalid_assign': -1, 'backtrack': -1, 'valid_assign': 0, 'win': 0, 'lose': 0, } def reset(self): self.grid_stack = deque() self.assign_stack = deque() self.num_steps = 0 self.grid = self._random_puzzle() return self.grid def step(self, action: Dict): """Run one timestep of the environment's dynamics. When end of episode is reached, you are responsible for calling `reset()` to reset this environment's state. Accepts an action and returns a tuple (observation, reward, done, info). Args: action (object): an action provided by the agent Returns: observation (object): agent's observation of the current environment reward (float) : amount of reward returned after previous action done (bool): whether the episode has ended, in which case further step() calls will return undefined results info (dict): contains auxiliary diagnostic information (helpful for debugging, and sometimes learning) """ row = action['row'] col = action['col'] val = action['val'] self._check_bounds(row, col, val) self.num_steps += 1 if self.num_steps == self.max_num_steps: meta = {'reward': 'lose', 'stack_len': len(self.grid_stack)} return self.grid, self.rewards['lose'], True, meta # handle invalid actions valid_actions = self.grid[row][col].nonzero()[0] if len(valid_actions) == 0: self._backtrack() meta = {'reward': 'backtrack', 'stack_len': len(self.grid_stack)} return self.grid, self.rewards['backtrack'], False, meta if val not in valid_actions: meta = {'reward': 'impossible_assign', 'stack_len': len(self.grid_stack)} return self.grid, self.rewards['impossible_assign'], False, meta if len(valid_actions) == 1: meta = {'reward': 'solved_assign', 'stack_len': len(self.grid_stack)} return self.grid, self.rewards['solved_assign'], False, meta grid = self._assign(self.grid.copy(), row, col, val) # handle invalid assign if grid is False: self.grid[row][col][val] = 0 meta = {'reward': 'invalid_assign', 'stack_len': len(self.grid_stack)} return self.grid, self.rewards['invalid_assign'], False, meta self.grid = grid # handle solved if (self.grid.sum(axis=-1) == 1).all(): meta = {'reward': 'win', 'stack_len': len(self.grid_stack)} return self.grid, self.rewards['win'], True, meta # handle valid but not solved else: self.grid_stack.append(grid.copy()) # save grid state for backtracking (assign may turn out to be invalid) self.assign_stack.append((row, col, val)) # for setting assign to invalid after backtracking meta = {'reward': 'valid_assign', 'stack_len': len(self.grid_stack)} return self.grid, self.rewards['valid_assign'], False, meta def render(self, mode='ansi'): # TODO: clean up s = "" width = 1 + max(len(str(v)) for v in range(self.D)) width = max(width,3) line = '+' + '+'.join(['-' * (width * self.d)] * self.d) + '+' s += line + '\n' for i in range(self.D): for j in range(self.D): if j == 0: s += '|' vals = self.grid[i][j].nonzero()[0] if len(vals) == 1: s += str(vals[0]).center(width) else: s += '.'.center(width) if (j + 1) % self.d == 0: s += '|' s += '\n' if (i + 1) % self.d == 0: s += line + '\n' return s def seed(self, seed=1337): random.seed(seed) return [seed] def _backtrack(self): """No valid assigns remain, therefore the previous assign was invalid. Because the previous assign may have rendered other cell/values invalid, we pop and revert to the previous grid state to make these cell/values valid again. The previous assign is then set to invalid. """ self.grid = self.grid_stack.pop() i, j, k = self.assign_stack.pop() self.grid[i][j][k] = 0 def _random_puzzle(self): grid = np.ones((self.D, self.D, self.D), dtype=int) coords = [(i,j) for i in range(self.D) for j in range(self.D)] random.shuffle(coords) assigned_cells = 0 assigned_vals = set() for i,j in coords: val = random.choice(grid[i][j].nonzero()[0]) if self._assign(grid, i, j, val) is False: return self._random_puzzle() assigned_cells += 1 assigned_vals.add(val) if assigned_cells >= self.N and len(assigned_vals) >= self.D - 1: return grid return self._random_puzzle() def _assign(self, grid: np.ndarray, row: int, col: int, val: int): other_vals = grid[row][col].nonzero()[0] other_vals = other_vals[other_vals != val] for ov in other_vals: if self._eliminate(grid, row, col, ov) is False: return False return grid def _eliminate(self, grid: np.ndarray, row: int, col: int, val: int): vals_binary = grid[row][col] # binary encoding of possible vals # check if val already eliminated during constraint propagation if vals_binary[val] == 0: return grid # eliminate val and get remaining possible vals vals_binary[val] = 0 remaining_vals = vals_binary.nonzero()[0] # if eliminate last val, contradiction during constraint propagation if len(remaining_vals) == 0: return False # get peers and remove current cell coordinates peers = self._get_peers(row, col) for peer_coords in peers: peer_coords.remove((row, col)) # strategy 1: reduction to one possible value for a cell if len(remaining_vals) == 1: for peer_coords in peers: for i, j in peer_coords: if self._eliminate(grid, i, j, remaining_vals[0]) is False: return False # strategy 2: reduction to one possible cell for a value for peer_coords in peers: peer_cells = [idx for idx, (i, j) in enumerate(peer_coords) if grid[i][j][val] == 1] if len(peer_cells) == 0: return False if len(peer_cells) == 1: i,j = peer_coords[peer_cells[0]] if self._assign(grid, i, j, val) is False: return False return grid def _get_peers(self, row: int, col: int): col_unit = [(i, col) for i in range(self.D)] row_unit = [(row, j) for j in range(self.D)] sq_row = row - row % self.d sq_col = col - col % self.d sq_unit = [(sq_row + i, sq_col + j) for i in range(self.d) for j in range(self.d)] return [col_unit, row_unit, sq_unit] def _check_bounds(self, row: int, col: int, val: int): assert 0 <= row <= self.D-1, f"row must be in range [0,{self.D-1}]" assert 0 <= col <= self.D-1, f"col must be in range [0,{self.D-1}]" assert 0 <= val <= self.D-1, f"cell value must be in range [0,{self.D-1}]" class HeuristicPolicy(Policy): def __init__(self, observation_space, action_space, config): Policy.__init__(self, observation_space, action_space, config) # example parameter self.w = 1.0 def compute_actions( self, obs_batch: Union[List[TensorType], TensorType], state_batches: Optional[List[TensorType]] = None, prev_action_batch: Union[List[TensorType], TensorType] = None, prev_reward_batch: Union[List[TensorType], TensorType] = None, info_batch: Optional[Dict[str, list]] = None, episodes: Optional[List["MultiAgentEpisode"]] = None, explore: Optional[bool] = None, timestep: Optional[int] = None, **kwargs) -> \ Tuple[TensorType, List[TensorType], Dict[str, TensorType]]: # return action batch, RNN states, extra values to include in batch actions = [] for grid in obs_batch: num_valid = [(i, j, n) for i, r in enumerate(grid.sum(axis=-1)) for j, n in enumerate(r) if n > 1] row, col, _ = min(num_valid, key=lambda x: x[-1]) val = grid[row][col].nonzero()[0][0] actions += [{'row': row, 'col': col, 'val': val}] return actions, [], {} def learn_on_batch(self, samples): # implement your learning code here return {} # return stats def get_weights(self): return {"w": self.w} def set_weights(self, weights): self.w = weights["w"] class TorchCustomModel(TorchModelV2, nn.Module): """Example of a PyTorch custom model that just delegates to a fc-net.""" def __init__(self, obs_space, action_space, num_outputs, model_config, name): TorchModelV2.__init__(self, obs_space, action_space, num_outputs, model_config, name) nn.Module.__init__(self) self.torch_sub_model = TorchFC(obs_space, action_space, num_outputs, model_config, name) def forward(self, input_dict, state, seq_lens): input_dict["obs"] = input_dict["obs"].float() fc_out, _ = self.torch_sub_model(input_dict, state, seq_lens) return fc_out, [] def value_function(self): return torch.reshape(self.torch_sub_model.value_function(), [-1]) if __name__ == '__main__': args = parser.parse_args() ray.init() # Can also register the env creator function explicitly with: # register_env("corridor", lambda config: SimpleCorridor(config)) ModelCatalog.register_custom_model( "my_model", TorchCustomModel) config = { "env": ConstraintSudoku, # or "corridor" if registered above "env_config": {}, # Use GPUs iff `RLLIB_NUM_GPUS` env var set to > 0. "num_gpus": int(os.environ.get("RLLIB_NUM_GPUS", "0")), "model": { "custom_model": "my_model", }, "lr": grid_search([1e-2, 1e-4, 1e-6]), # try different lrs "num_workers": 1, # parallelism "framework": "torch" } stop = { "training_iteration": args.stop_iters, "timesteps_total": args.stop_timesteps, "episode_reward_mean": args.stop_reward, } results = tune.run(args.run, config=config, stop=stop) if args.as_test: check_learning_achieved(results, args.stop_reward) ray.shutdown()
StarcoderdataPython
1763603
import sys import time import argparse import logging import threading import subprocess from . import rrlogger, __version__ from .constants import * from .lib import AttemptResults def run(): parser = _get_parser() # --- # version f = sys.argv.index('--') if '--' in sys.argv else len(sys.argv) if '-v' in sys.argv[1:f] or '--version' in sys.argv[1:f]: print('retry version {v}'.format(v=__version__)) exit(0) # --- # parse arguments parsed = parser.parse_args() # --- # configure logger if parsed.verbose: rrlogger.setLevel(logging.DEBUG) # sanitize arguments parsed.tries = max(1, parsed.tries) parsed.min = max(MIN_TIMEOUT, parsed.min) parsed.max = max(MAX_TIMEOUT, parsed.max) if parsed.max is not None else parsed.min * parsed.tries command = ' '.join(parsed.command) if isinstance(parsed.command, list) else parsed.command # run command last_res = 1 res = AttemptResults(parsed.tries) for attempt in range(parsed.tries): # compute timeout timeout = _get_timeout(parsed, attempt) rrlogger.info('Attempt #{a} [timeout: {t}]'.format(a=attempt, t=timeout)) rrlogger.debug('Running "{c}"...'.format(c=command)) stdin = None if parsed.interactive else subprocess.PIPE # spin process process = subprocess.Popen(command, shell=True, stdin=stdin) # create process monitor monitor = threading.Thread(name='process_monitor', target=_process_monitor, args=(process, timeout, res, attempt)) monitor.start() monitor.join() assert res[attempt] != 'ND' last_res = res[attempt] rrlogger.debug('The attempt #{a} finished with code: {c}'.format(a=attempt, c=res[attempt])) # check what happened if res[attempt] == 0: rrlogger.info('Attempt #{a} succeeded!'.format(a=attempt)) # the command succeeded break # the command failed or timed-out if parsed.on_retry: rrlogger.info('Executing on-retry command') try: subprocess.check_call(parsed.on_retry, shell=True) except: pass if res[attempt] is None: # process timed out, try again (or die) rrlogger.info('Attempt #{a} timed out!'.format(a=attempt)) else: # process failed, try again (if requested) rrlogger.info('Attempt #{a} failed with exit code: {c}'.format(a=attempt, c=res[attempt])) if parsed.no_retry_on_error: break succeeded = len(list(filter(lambda r: r == 0, res))) > 0 if not succeeded: rrlogger.info('All attempts exhausted, no success reported!') # run on-failure command (if given) if parsed.on_fail: rrlogger.info('Executing on-fail command') try: subprocess.check_call(parsed.on_fail, shell=True) except: pass # --- rrlogger.info('Done!') exit(last_res if last_res is not None else 1) def _get_timeout(parsed, attempt): return min(parsed.min * (attempt + 1), parsed.max) def _process_monitor(process, timeout, results, attempt): start = time.time() while (process.poll() is None) and ((time.time() - start) < timeout): time.sleep(1.0 / PROCESS_MONITOR_HEARTBEAT_HZ) # process ended, return its exit code if process.poll() is not None: results[attempt] = process.returncode return # process timed out rrlogger.debug('The process is taking too long to finish. It will be terminated.') start = time.time() escalated_to_sigkill = False while process.poll() is None: if (time.time() - start > 10): if not escalated_to_sigkill: escalated_to_sigkill = True rrlogger.info('Escalating to SIGKILL') process.kill() else: process.terminate() # sleep time.sleep(1) # indicate that the process was killed results[attempt] = None def _get_parser(): parser = argparse.ArgumentParser() parser.add_argument( '-m', '--min', type=int, required=True, help="Minimum timeout (in seconds)" ) parser.add_argument( '-M', '--max', type=int, default=None, help="Maximum timeout (in seconds)" ) parser.add_argument( '-n', '--tries', type=int, default=3, help="Maximum number of retries" ) parser.add_argument( '--no-retry-on-error', dest='no_retry_on_error', action='store_true', default=False, help="Do not retry when the command fails (as opposed to time out)" ) parser.add_argument( '-', '--on-fail', default=None, help="Command to run after last failure" ) parser.add_argument( '-c', '--on-retry', default=None, help="Command to run after every failed attempt" ) parser.add_argument( '-i', '--interactive', action='store_true', default=False, help="Whether to run the commands in interactive mode" ) parser.add_argument( '-D', '--dry-run', action='store_true', default=False, help="Performs a dry-run. It shows which commands would run" ) parser.add_argument( '--verbose', '--debug', dest='verbose', action='store_true', default=False, help="Run in verbose mode" ) parser.add_argument( 'command', nargs='+' ) return parser
StarcoderdataPython
161973
<gh_stars>0 #!/usr/bin/python3 import os import sys import argparse from datetime import datetime, timedelta from icalendar import Calendar import recurring_ical_events from urllib.request import urlopen import validators WINDOW = 365 def org_date(dateTime): if isinstance(dateTime, datetime): return dateTime.astimezone().strftime("<%Y-%m-%d %a %H:%M>") else: return dateTime.strftime("<%Y-%m-%d %a>") def create_header(title="Calendar", author="", email=""): results = "" results += "#+TITLE: {}\n".format(title) results += "#+AUTHOR: {}\n".format(author) results += "#+EMAIL: {}\n".format(email) results += "#+DESCRIPTION: converted using the Pical2org python script\n" results += "#+CATEGORY: calendar\n" results += "\n\n" return results class orgEvent: def __init__(self, event): # Store the summary of the event if event.get("summary") is not None: self.summary = event.get("summary") self.summary = self.summary.replace("\\,", ",") else: self.summary = "(No title)" # Store the start and end time of the event self.dtstart = event.get("dtstart").dt self.isDateTime = isinstance(self.dtstart, datetime) if event.get("dtend") is not None: self.dtend = event.get("dtend").dt # If all day event, then dtstart and dtend are datetime.date # objects and dtend is exactly one day in the future. # The dtend can be removed to make it more elegant in org-mode if not self.isDateTime and self.dtend == self.dtstart + timedelta(days=1): self.dtend = None else: self.dtend = None # Store the description of the event if event.get("description") is not None: self.description = "\n".join(event.get("description").split("\\n")) self.description = self.description.replace("\\,", ",") else: self.description = "" def __str__(self): results = "" results = "* {}\n".format(self.summary) # Event has a start time and end time if self.dtstart and self.dtend: results += "{}--{}\n".format( org_date(self.dtstart), org_date(self.dtend), ) # Event only has a start time elif self.dtstart and not self.dtend: results += "{}\n".format(org_date(self.dtstart)) results += "{}\n".format(self.description) return results class Convertor: def __init__(self, args): icalFile = self.read_file(args.INPUT_FILE) self.calendar = Calendar.from_ical(icalFile.read()) self.startDate = datetime.now() - timedelta(days=WINDOW) self.endDate = datetime.now() + timedelta(days=WINDOW) def __call__(self): results = "" results = create_header() events = recurring_ical_events.of(self.calendar).between( self.startDate, self.endDate ) for component in events: event = orgEvent(component) results += str(event) return results def read_file(self, path): """Open the file from the local system or a url and return it Take a string representing either a url of a file or a name of a local file and return the open file. Parameters ---------- file_name : str A url of a remote file or a path to a local file """ # Check to see if path is a remote url if validators.url(path) is True: f = urlopen(path) # Otherwise, assume it is a local path else: try: f = open(path, "r", encoding="utf-8") except OSError: print("Could not open/read file: ", f) sys.exit() return f def create_parser(): """Creates the default ArgumentParser object for the script Creates a parser using the argparse library to collect arguments from the command line. These arguments are then stored as and ArgumentParser object and returned. Returns ------- ArgumentParser An ArgumentParser object """ # Create the parser parser = argparse.ArgumentParser( description=( "Converts an ical (.ics) file into a text file formatted for use in Emacs" " org-mde." ), add_help=True, fromfile_prefix_chars="@", ) # Tell the parser which version of the script this is parser.version = "1.0" # Add an argument to accept an input file parser.add_argument( "INPUT_FILE", help=( "A ical (.ics) file to be read. This can either be a path to a local or it" " may be a url to a remote file." ), ) # Add an option to output results to a file instead of stdout parser.add_argument( "-o", "--output", help="Name of file to store the output results.", action="store", type=str, nargs=1, metavar="OUTPUT_FILE", ) # Add a window determining how many days to convert events parser.add_argument( "-w", "--window", help="Length of time before and after today in which events will be collected", action="store", type=int, nargs="?", default=365, ) # Add an option to force clobbering of the output file parser.add_argument( "-f", "--force_clobber", help=( "Force clobbering of and output file i the file already exists. If this" " option is provided, the output file will overwrite the existing file with" " the same name." ), action="store_true", default=False, ) return parser def main(): parser = create_parser() args = parser.parse_args() WINDOW = args.window # Check to see if results should be saved to a file if args.output: # Check if a file with the same name as output file exists if os.path.exists(args.output[0]) and not args.force_clobber: print( "File {outfile} exists.\nPlease specify a new name or run" "script again with -f to force clobbering of existing " "file".format(outfile=args.output[0]) ) else: convertor = Convertor(args) with open(args.output[0], "w") as outFile: outFile.write(convertor()) # If no output file is given print data to stdout else: convertor = Convertor(args) print(convertor()) # If this file is called directly, then execute main() if __name__ == "__main__": main()
StarcoderdataPython
149890
<filename>run.py """ **main api run module for memberships and affiliate api ** """ __developer__ = "mobius-crypt" __email__ = "<EMAIL>" __twitter__ = "@blueitserver" __github_repo__ = "https://github.com/freelancing-solutions/memberships-and-affiliate-api" __github_profile__ = "https://github.com/freelancing-solutions/" __licence__ = "MIT" from threading import Thread import json import os from flask import Response, redirect from cache.cache_manager import app_cache from config import config_instance from config.use_context import use_context from main import create_app from utils.utils import is_development, today, return_ttl from tasks import start_task # TODO create separate run files for client api, admin api, and public_api app = create_app(config_class=config_instance) debug = is_development() and config_instance.DEBUG # Press the green button in the gutter to run the script. # TODO Add logs handler which can send all errors to memberships and Affiliate Management Slack Channel @app.before_request def create_thread() -> None: """ **create_thread** this creates a thread specifically to deal with tasks which will be run after request has been processed :return: None """ try: if not isinstance(app.tasks_thread, Thread): app.tasks_thread = Thread(target=start_task) return except AttributeError as e: pass finally: return @app.after_request @use_context def start_thread(response: Response) -> Response: """ **start thread** starting a separate thread to deal with tasks that where put aside during the request """ try: if isinstance(app.tasks_thread, Thread) and not app.tasks_thread.is_alive(): app.tasks_thread.start() except RuntimeError as e: app.tasks_thread = Thread(target=start_task) app.tasks_thread.start() return response @app.route('/', methods=['GET', 'POST']) def main(): """will display swagger api documentations""" return redirect('/api-ui'), 302 @app.route('/redoc', methods=['GET', 'POST']) @app_cache.cache.memoize(timeout=return_ttl('short')) def redoc(): """this will display swagger documentation instead""" return redirect('/api-ui'), 302 @app.route('/warm-up', methods=['GET', 'POST']) def warmup(): message: str = f'Warmup Success' return json.dumps(dict(status=True, message=message)), 200 if __name__ == '__main__': if is_development(): # NOTE: this is a development server app.run(debug=debug, use_reloader=True, host='127.0.0.1', port=int(os.environ.get('PORT', 8081))) else: app.run(debug=debug, use_reloader=False, host='0.0.0.0', port=int(os.environ.get('PORT', 8081)))
StarcoderdataPython
1602916
""" _ _ | | (_)_ __ ___ __ _ _ __ | | | | '_ \ / _ \/ _` | '__| | |___| | | | | __/ (_| | | |_____|_|_| |_|\___|\__,_|_| ____ _ | _ \ _ __ ___ __ _ _ __ __ _ _ __ ___ _ __ ___ (_)_ __ __ _ | |_) | '__/ _ \ / _` | '__/ _` | '_ ` _ \| '_ ` _ \| | '_ \ / _` | | __/| | | (_) | (_| | | | (_| | | | | | | | | | | | | | | | (_| | |_| |_| \___/ \__, |_| \__,_|_| |_| |_|_| |_| |_|_|_| |_|\__, | |___/ |___/ @author: <NAME> @coding: utf-8 @environment: Manjaro 18.1.5 Juhraya @date: 19th Jan., 2020 """ ''' max: z = 4x1 + 3x2 st: 2x1 + 3x2<=10 x1 + x2 <=8 x2 <= 7 x1,x2 > 0 ''' from scipy.optimize import linprog c = [4, 3] A = [[2, 3], [1, 1]] b = [10, 8] x1_bound = [0, None] x2_bound = [0, 7] res = linprog(c, A, b, bounds=(x1_bound, x2_bound)) print(res)
StarcoderdataPython
187557
<filename>tools/python/PythonPlugin/package_python_files.py<gh_stars>0 import os import py_compile import shutil import tempfile import zipfile stdlib_path = os.environ['MW_PYTHON_3_STDLIB_DIR'].replace('"', '') zipfile_path = os.path.join(os.environ['BUILT_PRODUCTS_DIR'], os.environ['UNLOCALIZED_RESOURCES_FOLDER_PATH'], 'python%s%s.zip' % (os.environ['MW_PYTHON_3_VERSION_MAJOR'], os.environ['MW_PYTHON_3_VERSION_MINOR'])) cacert_file = 'cacert.pem' cacert_path = os.path.join(os.environ['BUILT_PRODUCTS_DIR'], os.environ['UNLOCALIZED_RESOURCES_FOLDER_PATH'], cacert_file) def add_file(fp, path): with tempfile.NamedTemporaryFile() as tmp: py_compile.compile(path, cfile = tmp.name, dfile = os.path.join(os.path.basename(zipfile_path), path), doraise = True, optimize = 0) fp.write(tmp.name, path[:-3] + '.pyc') def add_files(fp): for dirpath, dirnames, filenames in os.walk('.'): dirnames_to_remove = [] for name in dirnames: if (name in ('idle_test', 'test', 'tests') or not os.path.isfile(os.path.join(dirpath, name, '__init__.py'))): dirnames_to_remove.append(name) for name in dirnames_to_remove: dirnames.remove(name) for name in filenames: path = os.path.join(dirpath, name)[2:] # Remove leading ./ if name.endswith('.py'): add_file(fp, path) # If the ZIP file already exists, don't overrwrite it, as this will break code # signing on iOS if not os.path.isfile(zipfile_path): with zipfile.ZipFile(zipfile_path, 'w', zipfile.ZIP_DEFLATED) as fp: os.chdir(stdlib_path) add_files(fp) os.chdir(os.path.join(stdlib_path, 'site-packages')) add_files(fp) os.chdir(os.path.join(os.environ['SRCROOT'], 'PythonPlugin')) add_file(fp, 'mworks_python_config.py') # Ditto for root certificates file if not os.path.isfile(cacert_path): shutil.copyfile(os.path.join(stdlib_path, cacert_file), cacert_path)
StarcoderdataPython
188741
<gh_stars>1-10 from django.urls import path from django.urls.resolvers import URLPattern from . import views urlpatterns = [ path('<str:pk>/', views.getRoutes, name="routes"), ]
StarcoderdataPython
3368456
import json import csv from result import Result import requests import time import re import io from extract_entities import entities writer = csv.writer(open("falcon_results_qald7.csv", 'a', newline='')) url = 'https://labs.tib.eu/falcon/api?mode=long' headers = {'Content-type': 'application/json'} with open('qald-7.json', encoding='UTF-8') as data_file: data = json.loads(data_file.read()) nb=0 for distro in data['questions']: entities_dataset=entities(distro['query']['sparql']) print(entities_dataset) entity_mentions=0 correctly_linked=0 n=1 system_result=0 result=[] tmp=time.time() for d in distro['question']: if d["language"]=='en': question_en=d["string"] query = {'text': str(question_en)} data_json = json.dumps(query) response = requests.post(url, data=data_json, headers=headers) detected_entity=0 if response: execution_time=time.time()-tmp response_json=response.json() if 'entities' in response_json: if response_json['entities']: # system_result=len(response_json['results']) system_result=len(response_json['entities']) for em in entities_dataset: entity_mentions=entity_mentions+1 for i in response_json['entities']: if i[0]==em: correctly_linked=correctly_linked+1 result.append(i[1]) n=n+1 #print(correctly_linked, system_result, entity_mentions) res= Result(correctly_linked, system_result, entity_mentions) fmeasure=0 if system_result!=0: entity_precision=res.precision() else: entity_precision=0 if entity_mentions!=0: entity_recall=res.recall() else: entity_recall=0 if entity_recall!=0 and entity_precision!=0: fmeasure= (2*entity_precision*entity_recall)/(entity_precision + entity_recall) for i in result: print("id question: ", distro['id'], "result n: ", system_result, detected_entity, result) print("Precision:", entity_precision," Recall:", entity_recall ) print("____________________________________") myData=[[distro['id'],question_en,entity_mentions,detected_entity,system_result,correctly_linked, entity_precision,entity_recall, fmeasure, "0", "0", execution_time] ] myFile = open('falcon_results_qald7.csv', 'a', encoding='utf-8') with myFile: writer = csv.writer(myFile, delimiter =";", lineterminator='\r') writer.writerows(myData) else: #No string match nsm=0 system_result=0 entity_precision=0 entity_recall=0 nsm=nsm+1 myData=[[distro['id'],question_en,entity_mentions,detected_entity,system_result,correctly_linked, entity_precision,entity_recall, "0", "0",nsm, execution_time] ] print("____________________________________No string match") myFile = open('falcon_results_qald7.csv', 'a', encoding='utf-8') with myFile: writer = csv.writer(myFile, delimiter =";", lineterminator='\r') writer.writerows(myData) else: #No detected named entity: if entities_dataset: nbem=0 system_result=0 entity_precision=0 entity_recall=0 correctly_linked=0 detected_entity=0 if 'entity mapping' in distro: for em in distro["entity mapping"]: nbem=nbem+1 myData=[[distro['id'],question_en,nbem,detected_entity,system_result,correctly_linked, entity_precision,entity_recall,"0", "1", "0", execution_time] ] print("____________________________________No detected named entity") else: nbem=0 system_result=1 entity_precision=1 entity_recall=1 correctly_linked=1 detected_entity=0 fmeasure=1 if 'entity mapping' in distro: for em in distro["entity mapping"]: nbem=nbem+1 myData=[[distro['id'],question_en,nbem,detected_entity,system_result,correctly_linked, entity_precision,entity_recall,fmeasure, "3", "3", execution_time] ] print("____________________________________No mention + No results") myFile = open('falcon_results_qald7.csv', 'a', encoding='utf-8') with myFile: writer = csv.writer(myFile, delimiter =";", lineterminator='\r') writer.writerows(myData) else: #Unknown error from the web service execution_time=time.time()-tmp system_result=0 entity_precision=0 entity_recall=0 fmeasure= 0 entity_mentions=0 detected_entity=0 correctly_linked=0 print("____________________________________Unknown error from the web service") myData=[[distro['id'],question_en,entity_mentions,detected_entity,system_result,correctly_linked, entity_precision,entity_recall, fmeasure, "2", "2", execution_time] ] myFile = open('falcon_results_qald7.csv', 'a', encoding='utf-8') with myFile: writer = csv.writer(myFile, delimiter =";", lineterminator='\r') writer.writerows(myData) print("FALCON process completed")
StarcoderdataPython
184286
<gh_stars>10-100 from utilities import db def TransformResourceData(vars): fields = { 'resource_id': 'num', 'resource_type_id': 'num', 'resource_name': 'string', 'resource_uri': 'string', 'resource_parent_id': 'num', 'resource_child_number': 'num', } t = vars['target'] resource_inserter = db.StaggeredInsert(t['host'], t['user'], t['password'], t['port'], t['db'], 'resources', fields) resource_id_map = {} resources = [ {'type': 'indices', 'parent_type': None, 'items': vars['queries'].GetIndices(vars)}, {'type': 'content_sections', 'parent_type': None, 'items': vars['queries'].GetContentSections(vars)}, {'type': 'tutorials', 'parent_type': 'content_sections', 'items': vars['queries'].GetTutorials(vars)}, {'type': 'tests', 'parent_type': 'content_sections', 'items': vars['queries'].GetTests(vars)}, {'type': 'books', 'parent_type': None, 'items': vars['queries'].GetBooks(vars)}, {'type': 'wikis', 'parent_type': None, 'items': vars['queries'].GetWikis(vars)}, {'type': 'forums', 'parent_type': None, 'items': vars['queries'].GetForums(vars)}, ] resource_moocdb_id = 1 for resource_subset in resources: if resource_subset['type'] not in resource_id_map.keys(): resource_id_map[resource_subset['type']] = {} for item in resource_subset['items']: item['resource_id'] = resource_moocdb_id resource_id_map[resource_subset['type']][item['original_id']] = resource_moocdb_id resource_moocdb_id += 1 rpt = resource_subset['parent_type'] rpoid = item['resource_parent_original_id'] if rpt != None and rpoid != None and rpoid in resource_id_map[rpt].keys(): rpmid = resource_id_map[rpt][rpoid] item['resource_parent_id'] = rpmid else: item['resource_parent_id'] = None resource_inserter.addRow({k: item[k] for k in fields}) resource_inserter.insertPendingRows() vars["logger"].Log(vars, "Counts: Inserted {} resources to target".format(resource_inserter.num_inserted_rows)) return resource_id_map
StarcoderdataPython
172554
#045_Pedra_papel_e_tesoura.py from time import sleep from random import randint print("Pedra, Papel ou Tesoura?") print('''[ 0 ] PEDRA [ 1 ] PAPEL [ 2 ] TESOURA''') lista = ["PEDRA", "PAPEL", "TESOURA"] c = randint(0, 2) j = int(input("Sua escolha: ")) sleep(1) print("JO") sleep(1) print("KEN") sleep(1) print("PO!!!") sleep(1) print(f"Jogador: {lista[j]}") print(f"Computador: {lista[c]}") sleep(1) if (c == 0): if (j == 0): print("Empate") elif (j == 1): print("Vitória") elif (j == 2): print("Derrota") elif (c == 1): if (j == 1): print("Empate") elif (j == 2): print("Vitória") elif (j == 0): print("Derrota") elif (c == 2): if (j == 2): print("Empate") elif (j == 0): print("Vitória") elif (j == 1): print("Derrota") else: print("Jogada inválida")
StarcoderdataPython
3258581
<filename>video-streaming/video_streaming/core/constants/errors.py __all__ = [ 'ErrorMessages', 'ErrorCodes' ] class ErrorMessages: INPUT_VIDEO_404_OR_403 = "Input video is not found on S3 or permission denieded. make sure bucket name and file name is exist." OUTPUT_BUCKET_404_OR_403 = "Output bucket is not found or permission denieded." OUTPUT_KEY_IS_ALREADY_EXIST = "Output key on S3 is already exist." REPRESENTATION_NEEDS_BOTH_SIZE_AND_BITRATE = "Representation needs both size and bitrate" S3_INPUT_KEY_IS_REQUIRED = "s3_input_key is required." S3_INPUT_BUCKET_IS_REQUIRED = "s3_input_bucket is required." S3_OUTPUT_BUCKET_IS_REQUIRED = "s3_output_bucket is required." S3_OUTPUT_KEY_IS_REQUIRED = "s3_output_key is required." OBJECT_DETAILS_IS_REQUIRED = "object_details is required." OBJECT_DETAILS_IS_INVALID = "object_details must be a dict with 'ContentLength' key." REQUEST_ID_IS_REQUIRED = "request_id is required." OUTPUT_NUMBER_IS_REQUIRED = "request_id is required." INPUT_NUMBER_IS_REQUIRED = "input_number is required." WEBHOOK_URL_IS_REQUIRED = "webhook_url is required and can not be empty." INPUT_PATH_IS_REQUIRED = "input_path is required." OUTPUT_PATH_IS_REQUIRED = "output_path is required." DIRECTORY_IS_REQUIRED = "directory is required." OUTPUT_PATH_OR_S3_OUTPUT_KEY_IS_REQUIRED = "output_path or s3_output_key is required." INPUT_SIZE_CAN_NOT_BE_ZERO = "input file size can not be zero." INPUT_FILE_IS_NOT_FOUND = "input file is not found." WEBHOOK_URL_MUST_NOT_BE_REDIRECTED = "webhook url must not be redirected." WEBHOOK_HTTP_FAILED = "webhook task failed" \ ", HTTP response status: '{status}'" \ ", reason: '{reason}'" \ ", request_id: '{request_id}'" HTTP_STATUS_CODE_NOT_SUPPORT = "response HTTP status code is not support" \ ", HTTP response status: '{status}'" \ ", reason: '{reason}'" \ ", request_id: '{request_id}'" TASK_WAS_FORCIBLY_STOPPED = "task was forcibly stopped." CAN_NOT_UPLOAD_DIRECTORY = "can not upload directory" INPUT_VIDEO_CODEC_TYPE_IN_NOT_VIDEO = "input video codec type is not video" CAN_NOT_UPLOAD_EMPTY_FILE = "cab not upload empty file" CAN_NOT_UPLOAD_FILE = "can not upload the file" INPUT_TYPE_IS_REQUIRED = "input type is required." JOB_DETAILS_NOT_FOUND = "job details not found." WAITING_FOR_AGGREGATE_INPUTS = "waiting for aggregate inputs." # gRPC INTERNAL_ERROR = "internal server error" S3_KEY_CAN_NOT_BE_EMPTY = "s3 key can not be empty." S3_BUCKET_NAME_IS_NOT_VALID = "s3 bucket name is not valid." DUPLICATE_OUTPUT_LOCATIONS = "there are duplicate output locations." ONE_OUTPUT_IS_REQUIRED = "one output is required." JOB_NOT_FOUND_BY_TRACKING_ID = "job not found by tracking_id" JOB_IS_FAILED = "job is failed" JOB_IS_REVOKED = "job is revoked" JOB_IS_FINISHED = "job is finished" NO_WATERMARK_TO_USE = "no watermark to use" class ErrorCodes: # gRPC base exception error codes INTERNAL_ERROR = 1000 S3_KEY_CAN_NOT_BE_EMPTY = 1001 S3_BUCKET_NAME_IS_NOT_VALID = 1002 DUPLICATE_OUTPUT_LOCATIONS = 1003 ONE_OUTPUT_IS_REQUIRED = 1004 # TODO JOB_NOT_FOUND_BY_TRACKING_ID = 1005 # revoke_job_outputs JOB_IS_FAILED = 1006 JOB_IS_REVOKED = 1007 JOB_IS_FINISHED = 1008 NO_WATERMARK_TO_USE = 1009
StarcoderdataPython
1664124
"""Main entry point for the script.""" import logging import sys from . import cli, script def init_logger(verbose): """Initialize logger based on `verbose`.""" level = logging.DEBUG if verbose >= 1 else logging.INFO logging.basicConfig( level=level, format='%(message)s' ) def main(): """Execute the script commands.""" try: user_config = script.get_config() args = cli.parse_args(user_config) init_logger(args.verbose) if args.command == 'start': script.start(args) elif args.command == 'done': script.done(args) except script.ScriptError as exc: logging.error(exc) sys.exit(1) except Exception as exc: logging.error('Unexpected script error: %s', exc) sys.exit(2) if __name__ == '__main__': main()
StarcoderdataPython
1612238
<gh_stars>0 import sys import os.path sys.path.insert( 0, os.path.normpath(os.path.join( os.path.dirname( __file__ ), '..') )) from aql_tests import skip, AqlTestCase, runLocalTests from aql.utils import fileChecksum, Tempdir, \ disableDefaultHandlers, enableDefaultHandlers, addUserHandler, removeUserHandler from aql.values import SimpleValue, FileChecksumValue from aql.options import builtinOptions from aql.nodes import Node, BatchNode, Builder, FileBuilder, BuildManager from aql.nodes.aql_build_manager import ErrorNodeDependencyCyclic, ErrorNodeSignatureDifferent #//===========================================================================// class CopyValueBuilder (Builder): def __init__(self, options ): self.signature = b'' def build( self, node ): target_values = [] for source_value in node.getSourceValues(): copy_value = SimpleValue( source_value.get(), name = source_value.name + '_copy' ) target_values.append( copy_value ) node.addTargets( target_values ) def getTraceTargets( self, node, brief ): return tuple( value.name for value in node.getTargetValues() ) def getTraceSources( self, node, brief ): return tuple( value.name for value in node.getSourceValues() ) #//===========================================================================// class ChecksumBuilder (FileBuilder): NAME_ATTRS = ('replace_ext',) SIGNATURE_ATTRS = ('offset', 'length') def __init__(self, options, offset, length, replace_ext = False ): self.offset = offset self.length = length self.replace_ext = replace_ext #//-------------------------------------------------------// def _buildSrc( self, src, alg ): chcksum = fileChecksum( src, self.offset, self.length, alg ) if self.replace_ext: chcksum_filename = os.path.splitext(src)[0] else: chcksum_filename = src chcksum_filename += '.%s.chksum' % alg chcksum_filename = self.getFileBuildPath( chcksum_filename ) with open( chcksum_filename, 'wb' ) as f: f.write( chcksum.digest() ) return self.makeFileValue( chcksum_filename, tags = alg ) #//-------------------------------------------------------// def build( self, node ): target_values = [] for src in node.getSources(): target_values.append( self._buildSrc( src, 'md5' ) ) target_values.append( self._buildSrc( src, 'sha512' ) ) node.addTargets( target_values ) #//-------------------------------------------------------// def buildBatch( self, node ): for src_value in node.getSourceValues(): targets = [ self._buildSrc( src_value.get(), 'md5' ), self._buildSrc( src_value.get(), 'sha512' ) ] node.addSourceTargets( src_value, targets ) #//===========================================================================// class ChecksumSingleBuilder (ChecksumBuilder): split = ChecksumBuilder.splitSingle #//===========================================================================// def _addNodesToBM( builder, src_files, Node = Node ): bm = BuildManager() try: checksums_node = Node( builder, src_files ) checksums_node2 = Node( builder, checksums_node ) bm.add( checksums_node ); bm.selfTest() bm.add( checksums_node2 ); bm.selfTest() except Exception: bm.close() raise return bm #//===========================================================================// def _build( bm ): try: bm.selfTest() success = bm.build( jobs = 1, keep_going = False ) bm.selfTest() if not success: bm.printFails() raise Exception("Nodes failed") finally: bm.close() bm.selfTest() #//===========================================================================// def _buildChecksums( builder, src_files, Node = Node ): bm = _addNodesToBM( builder, src_files, Node ) _build( bm ) #//===========================================================================// class TestBuildManager( AqlTestCase ): def eventNodeBuilding( self, settings, node ): self.building_nodes += 1 #//-------------------------------------------------------// def eventNodeBuildingFinished( self, settings, node, builder_output, progress ): self.finished_nodes += 1 #//-------------------------------------------------------// def eventNodeActual( self, settings, node, progress ): self.actual_nodes += 1 #//-------------------------------------------------------// def eventNodeOutdated( self, settings, node, progress ): self.outdated_nodes += 1 #//-------------------------------------------------------// def eventNodeRemoved( self, settings, node, progress ): self.removed_nodes += 1 #//-------------------------------------------------------// def setUp( self ): super(TestBuildManager,self).setUp() # disableDefaultHandlers() self.building_nodes = 0 addUserHandler( self.eventNodeBuilding ) self.finished_nodes = 0 addUserHandler( self.eventNodeBuildingFinished ) self.actual_nodes = 0 addUserHandler( self.eventNodeActual ) self.outdated_nodes = 0 addUserHandler( self.eventNodeOutdated ) self.removed_nodes = 0 addUserHandler( self.eventNodeRemoved ) #//-------------------------------------------------------// def tearDown( self ): removeUserHandler( [ self.eventNodeBuilding, self.eventNodeBuildingFinished, self.eventNodeOutdated, self.eventNodeActual, self.eventNodeRemoved, ] ) enableDefaultHandlers() super(TestBuildManager,self).tearDown() #//-------------------------------------------------------// def test_bm_deps(self): bm = BuildManager() value1 = SimpleValue( "http://aql.org/download1", name = "target_url1" ) value2 = SimpleValue( "http://aql.org/download2", name = "target_url2" ) value3 = SimpleValue( "http://aql.org/download3", name = "target_url3" ) options = builtinOptions() builder = CopyValueBuilder( options ) node0 = Node( builder, value1 ) node1 = Node( builder, node0 ) node2 = Node( builder, node1 ) node3 = Node( builder, value2 ) node4 = Node( builder, value3 ) node5 = Node( builder, node4 ) node6 = Node( builder, node5 ) node6.depends( [node0, node1] ) bm.add( node0 ); bm.selfTest(); self.assertEqual( len(bm), 1 ) bm.add( node1 ); bm.selfTest(); self.assertEqual( len(bm), 2 ) bm.add( node2 ); bm.selfTest(); self.assertEqual( len(bm), 3 ) bm.add( node3 ); bm.selfTest(); self.assertEqual( len(bm), 4 ) bm.add( node4 ); bm.selfTest(); self.assertEqual( len(bm), 5 ) bm.add( node5 ); bm.selfTest(); self.assertEqual( len(bm), 6 ) bm.add( node6 ); bm.selfTest(); self.assertEqual( len(bm), 7 ) node0.depends( node3 ); bm.depends( node0, node3 ); bm.selfTest() node1.depends( node3 ); bm.depends( node1, node3 ); bm.selfTest() node2.depends( node3 ); bm.depends( node2, node3 ); bm.selfTest() node3.depends( node4 ); bm.depends( node3, node4 ); bm.selfTest() node0.depends( node5 ); bm.depends( node0, node5 ); bm.selfTest() node5.depends( node3 ); bm.depends( node5, node3 ); bm.selfTest() with self.assertRaises(ErrorNodeDependencyCyclic): node4.depends( node3 ); bm.depends( node4, node3 ); bm.selfTest() #//-------------------------------------------------------// def test_bm_build(self): with Tempdir() as tmp_dir: options = builtinOptions() options.build_dir = tmp_dir src_files = self.generateSourceFiles( tmp_dir, 5, 201 ) builder = ChecksumBuilder( options, 0, 256 ) self.building_nodes = self.finished_nodes = 0 _buildChecksums( builder, src_files ) self.assertEqual( self.building_nodes, 2 ) self.assertEqual( self.building_nodes, self.finished_nodes ) #//-------------------------------------------------------// self.building_nodes = self.finished_nodes = 0 _buildChecksums( builder, src_files ) self.assertEqual( self.building_nodes, 0 ) self.assertEqual( self.building_nodes, self.finished_nodes ) #//-------------------------------------------------------// builder = ChecksumBuilder( options, 32, 1024 ) self.building_nodes = self.finished_nodes = 0 _buildChecksums( builder, src_files ) self.assertEqual( self.building_nodes, 2 ) self.assertEqual( self.building_nodes, self.finished_nodes ) #//-------------------------------------------------------// self.building_nodes = self.finished_nodes = 0 _buildChecksums( builder, src_files ) self.assertEqual( self.building_nodes, 0 ) self.assertEqual( self.building_nodes, self.building_nodes ) #//-------------------------------------------------------// def test_bm_nodes(self): def _makeNodes( builder ): node1 = Node( builder, value1 ) copy_node1 = Node( builder, node1 ) copy2_node1 = Node( builder, copy_node1 ) node2 = Node( builder, value2 ) node3 = Node( builder, value3 ) copy_node3 = Node( builder, node3 ) copy2_node3 = Node( builder, copy_node3 ) copy2_node3.depends( [node1, copy_node1] ) return node1, node2, node3, copy_node1, copy_node3, copy2_node1, copy2_node3 with Tempdir() as tmp_dir: options = builtinOptions() options.build_dir = tmp_dir bm = BuildManager() value1 = SimpleValue( "http://aql.org/download1", name = "target_url1" ) value2 = SimpleValue( "http://aql.org/download2", name = "target_url2" ) value3 = SimpleValue( "http://aql.org/download3", name = "target_url3" ) builder = CopyValueBuilder( options ) bm.add( _makeNodes( builder ) ) self.finished_nodes = 0 bm.build( jobs = 1, keep_going = False ) bm.close() self.assertEqual( self.finished_nodes, 7 ) #// --------- // bm.add( _makeNodes( builder ) ) self.actual_nodes = 0 bm.status() bm.close() self.assertEqual( self.actual_nodes, 7 ) #// --------- // bm.add( _makeNodes( builder ) ) self.removed_nodes = 0 bm.clear() bm.close() self.assertEqual( self.removed_nodes, 7 ) #// --------- // bm.add( _makeNodes( builder ) ) self.actual_nodes = 0 self.outdated_nodes = 0 bm.status() bm.close() self.assertEqual( self.actual_nodes, 0 ) self.assertEqual( self.outdated_nodes, 3 ) #// --------- // nodes = _makeNodes( builder ) copy_node3 = nodes[4] bm.add( nodes ) self.finished_nodes = 0 bm.build( jobs = 1, keep_going = False, nodes = copy_node3 ) bm.close() self.assertEqual( self.finished_nodes, 2 ) #// --------- // nodes = _makeNodes( builder ) node2 = nodes[1]; copy_node3 = nodes[4] bm.add( nodes ) self.finished_nodes = 0 bm.build( jobs = 1, keep_going = False, nodes = [node2, copy_node3] ) bm.close() self.assertEqual( self.finished_nodes, 1 ) #// --------- // #//-------------------------------------------------------// def test_bm_check(self): with Tempdir() as tmp_dir: options = builtinOptions() options.build_dir = tmp_dir src_files = self.generateSourceFiles( tmp_dir, 3, 201 ) builder = ChecksumBuilder( options, 0, 256, replace_ext = True ) self.building_nodes = self.finished_nodes = 0 _buildChecksums( builder, src_files ) self.assertEqual( self.building_nodes, 2 ) self.assertEqual( self.building_nodes, self.finished_nodes ) bm = _addNodesToBM( builder, src_files ) try: self.actual_nodes = self.outdated_nodes = 0 bm.status(); bm.selfTest() self.assertEqual( self.outdated_nodes, 0) self.assertEqual( self.actual_nodes, 2 ) finally: bm.close() #//-------------------------------------------------------// def test_bm_batch(self): with Tempdir() as tmp_dir: options = builtinOptions() options.build_dir = tmp_dir src_files = self.generateSourceFiles( tmp_dir, 3, 201 ) builder = ChecksumBuilder( options, 0, 256, replace_ext = True ) self.building_nodes = self.finished_nodes = 0 _buildChecksums( builder, src_files, Node = BatchNode ) self.assertEqual( self.building_nodes, 2 ) self.assertEqual( self.building_nodes, self.finished_nodes ) bm = _addNodesToBM( builder, src_files, Node = BatchNode ) try: self.actual_nodes = self.outdated_nodes = 0 bm.status(); bm.selfTest() self.assertEqual( self.outdated_nodes, 0) self.assertEqual( self.actual_nodes, 2 ) finally: bm.close() #//-------------------------------------------------------// def test_bm_rebuild(self): with Tempdir() as tmp_dir: options = builtinOptions() options.build_dir = tmp_dir num_src_files = 3 src_files = self.generateSourceFiles( tmp_dir, num_src_files, 201 ) bm = BuildManager() self.building_nodes = self.finished_nodes = 0 self.actual_nodes = self.outdated_nodes = 0 builder = ChecksumSingleBuilder( options, 0, 256 ) src_values = [] for s in src_files: src_values.append( FileChecksumValue( s ) ) node = Node( builder, src_values ) node = Node( builder, node ) node = Node( builder, node ) bm.add( node ) _build( bm ) self.assertEqual( self.building_nodes, num_src_files * 7 ) #//-------------------------------------------------------// self.actual_nodes = self.outdated_nodes = 0 bm = BuildManager() builder = ChecksumSingleBuilder( options, 0, 256 ) node = Node( builder, src_values ) bm.add( node ); bm.selfTest() bm.status(); bm.selfTest() self.assertEqual( self.outdated_nodes, 0 ) self.assertEqual( self.actual_nodes, num_src_files ) #//-------------------------------------------------------// def test_bm_tags(self): with Tempdir() as tmp_dir: options = builtinOptions() options.build_dir = tmp_dir num_src_files = 3 src_files = self.generateSourceFiles( tmp_dir, num_src_files, 201 ) builder = ChecksumSingleBuilder( options, 0, 256 ) bm = BuildManager() self.finished_nodes = 0 node = Node( builder, src_files ) node_md5 = Node( builder, node.at('md5') ) bm.add( node_md5 ) _build( bm ) self.assertEqual( self.finished_nodes, num_src_files * 2 ) #//-------------------------------------------------------// self.touchCppFile( src_files[0] ) bm = BuildManager() self.finished_nodes = 0 node = Node( builder, src_files ) node_md5 = Node( builder, node.at('md5') ) bm.add( node_md5 ) _build( bm ) self.assertEqual( self.finished_nodes, 2 ) #//-------------------------------------------------------// def test_bm_tags_batch(self): with Tempdir() as tmp_dir: options = builtinOptions() options.build_dir = tmp_dir num_src_files = 3 src_files = self.generateSourceFiles( tmp_dir, num_src_files, 201 ) builder = ChecksumBuilder( options, 0, 256 ) single_builder = ChecksumSingleBuilder( options, 0, 256 ) bm = BuildManager() self.finished_nodes = 0 node = BatchNode( builder, src_files ) node_md5 = Node( single_builder, node.at('md5') ) bm.add( node_md5 ) _build( bm ) self.assertEqual( self.finished_nodes, num_src_files + 1 ) #//-------------------------------------------------------// self.touchCppFile( src_files[0] ) bm = BuildManager() self.finished_nodes = 0 node = BatchNode( builder, src_files ) node_md5 = Node( single_builder, node.at('md5') ) bm.add( node_md5 ) _build( bm ) self.assertEqual( self.finished_nodes, 2 ) #//-------------------------------------------------------// def test_bm_conflicts(self): with Tempdir() as tmp_dir: options = builtinOptions() options.build_dir = tmp_dir num_src_files = 3 src_files = self.generateSourceFiles( tmp_dir, num_src_files, 201 ) bm = BuildManager() self.finished_nodes = 0 builder1 = ChecksumSingleBuilder( options, 0, 256 ) builder2 = ChecksumSingleBuilder( options, 0, 1024 ) node1 = Node( builder1, src_files ) node2 = Node( builder2, src_files ) # node1 = Node( builder1, node1 ) # node2 = Node( builder2, node2 ) bm.add( node1 ) bm.add( node2 ) self.assertRaises( ErrorNodeSignatureDifferent, _build, bm ) #//-------------------------------------------------------// def test_bm_no_conflicts(self): with Tempdir() as tmp_dir: options = builtinOptions() options.build_dir = tmp_dir num_src_files = 3 src_files = self.generateSourceFiles( tmp_dir, num_src_files, 201 ) bm = BuildManager() self.finished_nodes = 0 builder1 = ChecksumSingleBuilder( options, 0, 256 ) builder2 = ChecksumSingleBuilder( options, 0, 256 ) node1 = Node( builder1, src_files ) node2 = Node( builder2, src_files ) node1 = Node( builder1, node1 ) node2 = Node( builder2, node2 ) bm.add( node1 ) bm.add( node2 ) _build( bm ) self.assertEqual( self.finished_nodes, 3 * 3 ) #//-------------------------------------------------------// @skip def test_bm_node_names(self): with Tempdir() as tmp_dir: src_files = self.generateSourceFiles( tmp_dir, 3, 201 ) options = builtinOptions() options.build_dir = tmp_dir builder = ChecksumBuilder( options, 0, 256, replace_ext = False ) bm = BuildManager() try: src_values = [] for s in src_files: src_values.append( FileChecksumValue( s ) ) node0 = Node( builder, None ) node1 = Node( builder, src_values ) node2 = Node( builder, node1 ) node3 = Node( builder, node2 ) node4 = Node( builder, node3 ) bm.add( node0 ) bm.add( node1 ) bm.add( node2 ) bm.add( node3 ) bm.add( node4 ) bm.build(1, False) print("node2: %s" % str(node4) ) print("node2: %s" % str(node3) ) print("node2: %s" % str(node2) ) print("node1: %s" % str(node1) ) print("node0: %s" % str(node0) ) finally: bm.close() #//===========================================================================// def _generateNodeTree( bm, builder, node, depth ): while depth: node = Node( builder, node ) bm.add( node ) depth -= 1 #//===========================================================================// @skip class TestBuildManagerSpeed( AqlTestCase ): def test_bm_deps_speed(self): bm = BuildManager() value = SimpleValue( "http://aql.org/download", name = "target_url1" ) builder = CopyValueBuilder() node = Node( builder, value ) bm.add( node ) _generateNodeTree( bm, builder, node, 5000 ) #//===========================================================================// if __name__ == "__main__": runLocalTests()
StarcoderdataPython
3323189
#Embedded file name: ACEStream\Core\Statistics\__init__.pyo pass
StarcoderdataPython
3209895
<filename>src/bll/mediacatalog/audiofilterfactory.py<gh_stars>1-10 from bll.mediacatalog.audiosyncfilter import AudioSyncFilter from indexing.filters.pathfilterfactory import PathFilterFactory class AudioFilterFactory(PathFilterFactory): """ Builds audio filter stack. """ #################################################################################################################### # Constructor. #################################################################################################################### def __init__(self, audio_dal, sync_only=False): """ Initializes attributes. Parameters ---------- audio_dal : AudioDataHandler A reference to the audio DAL. sync_only : boolean Indicates whether only synchronization is needed. """ ### Validate parameters. if audio_dal is None: raise Exception('audio_dal cannot be None.') # Attributes from outside. self._audio_dal = audio_dal self._sync_only = sync_only #################################################################################################################### # PathFilterFactory implementation. #################################################################################################################### def create_filters(self): filters = [] if self._sync_only: filters.append(AudioSyncFilter(self._audio_dal)) return filters
StarcoderdataPython
151054
""" Pseudocode: exercises 23, 24, 25 Post-solution REVIEW: Too much detail, to be honest especially for someone who understands the fundamentals Ex 23: Exercise 23 – Your first loops Generate a list that contains at least 20 random integers. Write one loop that sums up all entries of the list. Write another loop that sums up only the entries of the list with even indices. Write a third loop that generates a new list that contains the values of the list in reverse order. Print out all three results # Generate number list import the random package randomlist = empty list for index in range of 0-25 number1, between 0 and 300, is generated number1 is appended to randomlist Loop is exited once whole list is read # Add numbers in list to sum, by changing its value on iterations set sum = 0 for index in randomlist sum += index print(sum) Take user input (integer) if input in list, just inform user of that for each element: If input bigger than list element, inform them of that then parse next element else if input smaller than list element, inform them of that then parse next element Exercise 24 – 3 while loops Write a program that uses while loops to finish the tasks below: - Searching for a specific number (e.g. 5) in an integer list of unknown length - Multiplying all elements of an integer list of unknown length - Printing out the contents of a string list of unknown length elementwise # Generate list of unknown length with random elements define empty list p for index in range between 1 and random integer between min1 and max1 append random number between min2 and max2 to p print p # 1st part - search for number get user input (number to scan for) start at 0th position set NumFound to False while reading position is lower than length of list: if reading position = user input print confirmation for user NumFound becomes True reading position += 1 if NumFound remains False, inform user # 2nd part - multiply list entries together call list using code from earlier (recommended not to have more than 7 elements and random numbers only between 1-10) set first parsing index (FPI) to 0 while FPI is less than list length: set second parsing index (SPI) to 0 while SPI is less than list length print(f'current entry {SPI} times last entry {FPI} = {SPI*FPI}') SPI +=1 # move reading frame for reading position FPI +=1 # move reading frame for reading position -1 # 3rd part - print contents of unknown list by element call list using code from earlier (STOPPED TO FOLLOW CHRISTOPH'S SOLUTION IN LESSON. It's much nicer to read, of course, so you can take this as an example of too much detail) """ # after that, moved onto definition of function (see pdf) """Create a program that defines functions for the four mathematical basic operations (+, -, * and /). Call the functions at least three times with different parameters."""
StarcoderdataPython
103391
<reponame>GamesBond008/NSE-India-Scrapper<gh_stars>1-10 from ._MarketData import MarketData class Indices(MarketData): def __init__(self,timeout: int=5): super().__init__(timeout) self._BaseURL="https://www.nseindia.com/api/allIndices" def IndicesMarketWatch(self): return self._GrabData(self._BaseURL)
StarcoderdataPython
191227
<filename>spiegel-news.py # Done By <NAME> 2019/14/10 import datetime from _csv import writer import requests import re from bs4 import BeautifulSoup import threading def Crawl(): url = 'https://www.spiegel.de/international/' urlcrawled = 'https://www.spiegel.de' page = requests.get (url) soup = BeautifulSoup (page.content, 'html.parser') weblinks = soup.find_all ('a', {'href': True}) # retrieve news linke from main page of site with open ('news.csv', 'w') as csv_file: csv_writer = writer (csv_file) # creating headers in the csv file headers = ['Title', 'SubTitle', 'Abstract', 'InsertedDate'] # writing a row of headers in the csv csv_writer.writerow (headers) urls = re.findall ('/international+[/a-z/]+(?:[-\w.]|(?:%[\da-fA-F]{2}))+.html', str (weblinks)) for u in urls: strurl = "{0}{1}".format (urlcrawled, u) # """Scrapes information from pages into items""" pagez = requests.get (strurl) soupz = BeautifulSoup (pagez.content, 'html.parser') # now lets loop through posts for tag in soupz.find_all ("meta"): if tag.get ("property", None) == "og:title": title = tag.get ("content", None) elif tag.get ("property", None) == "og:description": description = tag.get ("content", None) elif tag.get ("name", None) == "news_keywords": subtitle = tag.get ("content", None) csv_writer.writerow ([title, subtitle, description, datetime.datetime.utcnow ()]) csv_file.close () threading.Timer (60.0, Crawl ()).start () # call the method each 60 sec
StarcoderdataPython
60768
<gh_stars>0 from shapely.geometry import Polygon from geopyspark.geopyspark_utils import ensure_pyspark ensure_pyspark() from geopyspark import get_spark_context, create_python_rdd from geopyspark.geotrellis import Extent from geopyspark.vector_pipe import Feature, Properties from geopyspark.vector_pipe.features_collection import FeaturesCollection from pyspark.sql import SparkSession __all__ = ['from_orc', 'from_dataframe'] def from_orc(source, target_extent=None): """Reads in OSM data from an orc file that is located either locally or on S3. The resulting data will be read in as an instance of :class:`~geopyspark.vector_pipe.features_collection.FeaturesCollection`. Args: source (str): The path or URI to the orc file to be read. Can either be a local file, or a file on S3. Note: Reading a file from S3 requires additional setup depending on the environment and how the file is being read. The following describes the parameters that need to be set depending on how the files are to be read in. However, **if reading a file on EMR, then the access key and secret key do not need to be set**. If using ``s3a://``, then the following ``SparkConf`` parameters need to be set: - ``spark.hadoop.fs.s3a.impl`` - ``spark.hadoop.fs.s3a.access.key`` - ``spark.hadoop.fs.s3a.secret.key`` If using ``s3n://``, then the following ``SparkConf`` parameters need to be set: - ``spark.hadoop.fs.s3n.access.key`` - ``spark.hadoop.fs.s3n.secret.key`` An alternative to passing in your S3 credentials to ``SparkConf`` would be to export them as environment variables: - ``AWS_ACCESS_KEY_ID=YOUR_KEY`` - ``AWS_SECRET_ACCESS_KEY_ID=YOUR_SECRET_KEY`` target_extent (:class:`~geopyspark.geotrellis.Extent` or ``shapely.geometry.Polygon``, optional): The area of interest. Only features inside this ``Extent`` will be returned. Default is, ``None``. If ``None``, then all of the features will be returned. Returns: :class:`~geopyspark.vector_pipe.features_collection.FeaturesCollection` """ if target_extent: if isinstance(target_extent, Polygon): target_extent = Extent.from_polygon(target_extent)._asdict() else: target_extent = target_extent._asdict() pysc = get_spark_context() session = SparkSession.builder.config(conf=pysc.getConf()).enableHiveSupport().getOrCreate() features = pysc._jvm.geopyspark.vectorpipe.io.OSMReader.fromORC(session._jsparkSession, source, target_extent) return FeaturesCollection(features) def from_dataframe(dataframe, target_extent=None): """Reads OSM data from a Spark ``DataFrame``. The resulting data will be read in as an instance of :class:`~geopyspark.vector_pipe.features_collection.FeaturesCollection`. Args: dataframe (DataFrame): A Spark ``DataFrame`` that contains the OSM data. target_extent (:class:`~geopyspark.geotrellis.Extent` or ``shapely.geometry.Polygon``, optional): The area of interest. Only features inside this ``Extent`` will be returned. Default is, ``None``. If ``None``, then all of the features will be returned. Returns: :class:`~geopyspark.vector_pipe.features_collection.FeaturesCollection` """ if target_extent: if isinstance(target_extent, Polygon): target_extent = Extent.from_polygon(target_extent)._asdict() else: target_extent = target_extent._asdict() pysc = get_spark_context() features = pysc._jvm.geopyspark.vectorpipe.io.OSMReader.fromDataFrame(dataframe._jdf, target_extent) return FeaturesCollection(features)
StarcoderdataPython
3200933
import sys sys.path.insert(0, '..') from mayavi import mlab import numpy as np from demo import load_image import lulu import lulu.connected_region_handler as crh img = load_image('chelsea_small.jpg') print("Decomposing a %s image." % str(img.shape)) regions = lulu.decompose(img) value_maxes = [] height = 0 for area in sorted(regions.keys()): pulses = regions[area] if len(pulses) == 0 or area < 280 or area > 300: continue values = [crh.get_value(p) for p in pulses] height_diff = max(values) - min(values) value_maxes.append(height_diff) centre = height + height_diff / 2.0 pulse_values = np.zeros_like(img) for p in pulses: crh.set_array(pulse_values, p, crh.get_value(p)) y, x = np.where(pulse_values) s = pulse_values[y, x] mlab.barchart(x, y, [height + centre] * len(s), s, opacity=1.0, scale_factor=1.5) height += height_diff + 0.5 scene = mlab.get_engine().scenes[0] scene.scene.parallel_projection = True mlab.show()
StarcoderdataPython
1678097
<gh_stars>1-10 """ Like described in the :mod:`jedi.evaluate.parsing_representation` module, there's a need for an ast like module to represent the states of parsed modules. But now there are also structures in Python that need a little bit more than that. An ``Instance`` for example is only a ``Class`` before it is instantiated. This class represents these cases. So, why is there also a ``Class`` class here? Well, there are decorators and they change classes in Python 3. """ import copy from jedi._compatibility import use_metaclass, unicode from jedi.parser import representation as pr from jedi.parser.tokenize import Token from jedi import debug from jedi import common from jedi.evaluate.cache import memoize_default, CachedMetaClass from jedi.evaluate import compiled from jedi.evaluate import recursion from jedi.evaluate import iterable from jedi.evaluate import docstrings from jedi.evaluate import helpers from jedi.evaluate import param class Executable(pr.IsScope): """ An instance is also an executable - because __init__ is called :param var_args: The param input array, consist of `pr.Array` or list. """ def __init__(self, evaluator, base, var_args=()): self._evaluator = evaluator self.base = base self.var_args = var_args def get_parent_until(self, *args, **kwargs): return self.base.get_parent_until(*args, **kwargs) @common.safe_property def parent(self): return self.base.parent class Instance(use_metaclass(CachedMetaClass, Executable)): """ This class is used to evaluate instances. """ def __init__(self, evaluator, base, var_args=()): super(Instance, self).__init__(evaluator, base, var_args) if str(base.name) in ['list', 'set'] \ and compiled.builtin == base.get_parent_until(): # compare the module path with the builtin name. self.var_args = iterable.check_array_instances(evaluator, self) else: # need to execute the __init__ function, because the dynamic param # searching needs it. with common.ignored(KeyError): self.execute_subscope_by_name('__init__', self.var_args) # Generated instances are classes that are just generated by self # (No var_args) used. self.is_generated = False @memoize_default() def _get_method_execution(self, func): func = InstanceElement(self._evaluator, self, func, True) return FunctionExecution(self._evaluator, func, self.var_args) def _get_func_self_name(self, func): """ Returns the name of the first param in a class method (which is normally self. """ try: return str(func.params[0].get_name()) except IndexError: return None @memoize_default([]) def get_self_attributes(self): def add_self_dot_name(name): """ Need to copy and rewrite the name, because names are now ``instance_usage.variable`` instead of ``self.variable``. """ n = copy.copy(name) n.names = n.names[1:] n._get_code = unicode(n.names[-1]) names.append(InstanceElement(self._evaluator, self, n)) names = [] # This loop adds the names of the self object, copies them and removes # the self. for sub in self.base.subscopes: if isinstance(sub, pr.Class): continue # Get the self name, if there's one. self_name = self._get_func_self_name(sub) if not self_name: continue if sub.name.get_code() == '__init__': # ``__init__`` is special because the params need are injected # this way. Therefore an execution is necessary. if not sub.decorators: # __init__ decorators should generally just be ignored, # because to follow them and their self variables is too # complicated. sub = self._get_method_execution(sub) for n in sub.get_defined_names(): # Only names with the selfname are being added. # It is also important, that they have a len() of 2, # because otherwise, they are just something else if unicode(n.names[0]) == self_name and len(n.names) == 2: add_self_dot_name(n) if not isinstance(self.base, compiled.CompiledObject): for s in self.base.get_super_classes(): for inst in self._evaluator.execute(s): names += inst.get_self_attributes() return names def get_subscope_by_name(self, name): sub = self.base.get_subscope_by_name(name) return InstanceElement(self._evaluator, self, sub, True) def execute_subscope_by_name(self, name, args=()): method = self.get_subscope_by_name(name) return self._evaluator.execute(method, args) def get_descriptor_return(self, obj): """ Throws a KeyError if there's no method. """ # Arguments in __get__ descriptors are obj, class. # `method` is the new parent of the array, don't know if that's good. args = [obj, obj.base] if isinstance(obj, Instance) else [None, obj] return self.execute_subscope_by_name('__get__', args) @memoize_default([]) def get_defined_names(self): """ Get the instance vars of a class. This includes the vars of all classes """ names = self.get_self_attributes() for var in self.base.instance_names(): names.append(InstanceElement(self._evaluator, self, var, True)) return names def scope_generator(self): """ An Instance has two scopes: The scope with self names and the class scope. Instance variables have priority over the class scope. """ yield self, self.get_self_attributes() names = [] for var in self.base.instance_names(): names.append(InstanceElement(self._evaluator, self, var, True)) yield self, names def is_callable(self): try: self.get_subscope_by_name('__call__') return True except KeyError: return False def get_index_types(self, indexes=[]): if any([isinstance(i, iterable.Slice) for i in indexes]): # Slice support in Jedi is very marginal, at the moment, so just # ignore them in case of __getitem__. # TODO support slices in a more general way. indexes = [] try: return self.execute_subscope_by_name('__getitem__', indexes) except KeyError: debug.warning('No __getitem__, cannot access the array.') return [] def __getattr__(self, name): if name not in ['start_pos', 'end_pos', 'name', 'get_imports', 'doc', 'raw_doc', 'asserts']: raise AttributeError("Instance %s: Don't touch this (%s)!" % (self, name)) return getattr(self.base, name) def __repr__(self): return "<e%s of %s (var_args: %s)>" % \ (type(self).__name__, self.base, len(self.var_args or [])) class InstanceElement(use_metaclass(CachedMetaClass, pr.Base)): """ InstanceElement is a wrapper for any object, that is used as an instance variable (e.g. self.variable or class methods). """ def __init__(self, evaluator, instance, var, is_class_var=False): self._evaluator = evaluator if isinstance(var, pr.Function): var = Function(evaluator, var) elif isinstance(var, pr.Class): var = Class(evaluator, var) self.instance = instance self.var = var self.is_class_var = is_class_var @common.safe_property @memoize_default() def parent(self): par = self.var.parent if isinstance(par, Class) and par == self.instance.base \ or isinstance(par, pr.Class) \ and par == self.instance.base.base: par = self.instance elif not isinstance(par, (pr.Module, compiled.CompiledObject)): par = InstanceElement(self.instance._evaluator, self.instance, par, self.is_class_var) return par def get_parent_until(self, *args, **kwargs): return pr.Simple.get_parent_until(self, *args, **kwargs) def get_decorated_func(self): """ Needed because the InstanceElement should not be stripped """ func = self.var.get_decorated_func() func = InstanceElement(self._evaluator, self.instance, func) return func def expression_list(self): # Copy and modify the array. return [InstanceElement(self.instance._evaluator, self.instance, command, self.is_class_var) if not isinstance(command, (pr.Operator, Token)) else command for command in self.var.expression_list()] def __iter__(self): for el in self.var.__iter__(): yield InstanceElement(self.instance._evaluator, self.instance, el, self.is_class_var) def __getattr__(self, name): return getattr(self.var, name) def isinstance(self, *cls): return isinstance(self.var, cls) def is_callable(self): return self.var.is_callable() def __repr__(self): return "<%s of %s>" % (type(self).__name__, self.var) class Class(use_metaclass(CachedMetaClass, pr.IsScope)): """ This class is not only important to extend `pr.Class`, it is also a important for descriptors (if the descriptor methods are evaluated or not). """ def __init__(self, evaluator, base): self._evaluator = evaluator self.base = base @memoize_default(default=()) def get_super_classes(self): supers = [] # TODO care for mro stuff (multiple super classes). for s in self.base.supers: # Super classes are statements. for cls in self._evaluator.eval_statement(s): if not isinstance(cls, (Class, compiled.CompiledObject)): debug.warning('Received non class as a super class.') continue # Just ignore other stuff (user input error). supers.append(cls) if not supers and self.base.parent != compiled.builtin: # add `object` to classes supers += self._evaluator.find_types(compiled.builtin, 'object') return supers @memoize_default(default=()) def instance_names(self): def in_iterable(name, iterable): """ checks if the name is in the variable 'iterable'. """ for i in iterable: # Only the last name is important, because these names have a # maximal length of 2, with the first one being `self`. if unicode(i.names[-1]) == unicode(name.names[-1]): return True return False result = self.base.get_defined_names() super_result = [] # TODO mro! for cls in self.get_super_classes(): # Get the inherited names. if isinstance(cls, compiled.CompiledObject): super_result += cls.get_defined_names() else: for i in cls.instance_names(): if not in_iterable(i, result): super_result.append(i) result += super_result return result @memoize_default(default=()) def get_defined_names(self): result = self.instance_names() type_cls = self._evaluator.find_types(compiled.builtin, 'type')[0] return result + list(type_cls.get_defined_names()) def get_subscope_by_name(self, name): for sub in reversed(self.subscopes): if sub.name.get_code() == name: return sub raise KeyError("Couldn't find subscope.") def is_callable(self): return True @common.safe_property def name(self): return self.base.name def __getattr__(self, name): if name not in ['start_pos', 'end_pos', 'parent', 'asserts', 'raw_doc', 'doc', 'get_imports', 'get_parent_until', 'get_code', 'subscopes']: raise AttributeError("Don't touch this: %s of %s !" % (name, self)) return getattr(self.base, name) def __repr__(self): return "<e%s of %s>" % (type(self).__name__, self.base) class Function(use_metaclass(CachedMetaClass, pr.IsScope)): """ Needed because of decorators. Decorators are evaluated here. """ def __init__(self, evaluator, func, is_decorated=False): """ This should not be called directly """ self._evaluator = evaluator self.base_func = func self.is_decorated = is_decorated @memoize_default() def _decorated_func(self): """ Returns the function, that is to be executed in the end. This is also the places where the decorators are processed. """ f = self.base_func # Only enter it, if has not already been processed. if not self.is_decorated: for dec in reversed(self.base_func.decorators): debug.dbg('decorator: %s %s', dec, f) dec_results = self._evaluator.eval_statement(dec) if not len(dec_results): debug.warning('decorator not found: %s on %s', dec, self.base_func) return None decorator = dec_results.pop() if dec_results: debug.warning('multiple decorators found %s %s', self.base_func, dec_results) # Create param array. old_func = Function(self._evaluator, f, is_decorated=True) wrappers = self._evaluator.execute(decorator, (old_func,)) if not len(wrappers): debug.warning('no wrappers found %s', self.base_func) return None if len(wrappers) > 1: # TODO resolve issue with multiple wrappers -> multiple types debug.warning('multiple wrappers found %s %s', self.base_func, wrappers) f = wrappers[0] debug.dbg('decorator end %s', f) if isinstance(f, pr.Function): f = Function(self._evaluator, f, True) return f def get_decorated_func(self): """ This function exists for the sole purpose of returning itself if the decorator doesn't turn out to "work". We just ignore the decorator here, because sometimes decorators are just really complicated and Jedi cannot understand them. """ return self._decorated_func() \ or Function(self._evaluator, self.base_func, True) def get_magic_function_names(self): return compiled.magic_function_class.get_defined_names() def get_magic_function_scope(self): return compiled.magic_function_class def is_callable(self): return True def __getattr__(self, name): return getattr(self.base_func, name) def __repr__(self): decorated_func = self._decorated_func() dec = '' if decorated_func is not None and decorated_func != self: dec = " is " + repr(decorated_func) return "<e%s of %s%s>" % (type(self).__name__, self.base_func, dec) class FunctionExecution(Executable): """ This class is used to evaluate functions and their returns. This is the most complicated class, because it contains the logic to transfer parameters. It is even more complicated, because there may be multiple calls to functions and recursion has to be avoided. But this is responsibility of the decorators. """ @memoize_default(default=()) @recursion.execution_recursion_decorator def get_return_types(self, evaluate_generator=False): func = self.base # Feed the listeners, with the params. for listener in func.listeners: listener.execute(self._get_params()) if func.is_generator and not evaluate_generator: return [iterable.Generator(self._evaluator, func, self.var_args)] else: stmts = docstrings.find_return_types(self._evaluator, func) for r in self.returns: if r is not None: stmts += self._evaluator.eval_statement(r) return stmts @memoize_default(default=()) def _get_params(self): """ This returns the params for an TODO and is injected as a 'hack' into the pr.Function class. This needs to be here, because Instance can have __init__ functions, which act the same way as normal functions. """ return param.get_params(self._evaluator, self.base, self.var_args) def get_defined_names(self): """ Call the default method with the own instance (self implements all the necessary functions). Add also the params. """ return self._get_params() + pr.Scope.get_defined_names(self) def _copy_properties(self, prop): """ Literally copies a property of a Function. Copying is very expensive, because it is something like `copy.deepcopy`. However, these copied objects can be used for the executions, as if they were in the execution. """ # Copy all these lists into this local function. attr = getattr(self.base, prop) objects = [] for element in attr: if element is None: copied = element else: copied = helpers.fast_parent_copy(element) copied.parent = self._scope_copy(copied.parent) if isinstance(copied, pr.Function): copied = Function(self._evaluator, copied) objects.append(copied) return objects def __getattr__(self, name): if name not in ['start_pos', 'end_pos', 'imports', '_sub_module']: raise AttributeError('Tried to access %s: %s. Why?' % (name, self)) return getattr(self.base, name) @memoize_default() def _scope_copy(self, scope): """ Copies a scope (e.g. if) in an execution """ # TODO method uses different scopes than the subscopes property. # just check the start_pos, sometimes it's difficult with closures # to compare the scopes directly. if scope.start_pos == self.start_pos: return self else: copied = helpers.fast_parent_copy(scope) copied.parent = self._scope_copy(copied.parent) return copied @common.safe_property @memoize_default([]) def returns(self): return self._copy_properties('returns') @common.safe_property @memoize_default([]) def asserts(self): return self._copy_properties('asserts') @common.safe_property @memoize_default([]) def statements(self): return self._copy_properties('statements') @common.safe_property @memoize_default([]) def subscopes(self): return self._copy_properties('subscopes') def get_statement_for_position(self, pos): return pr.Scope.get_statement_for_position(self, pos) def __repr__(self): return "<%s of %s>" % (type(self).__name__, self.base)
StarcoderdataPython
1623295
# Generated by Django 3.2 on 2021-05-05 21:14 import django.db.models.deletion import django.utils.timezone from django.db import migrations, models class Migration(migrations.Migration): dependencies = [ ("api", "0009_apikey_user"), ("core", "0116_location_extra_fields"), ] operations = [ migrations.CreateModel( name="SourceLocationMatchHistory", fields=[ ( "id", models.AutoField( auto_created=True, primary_key=True, serialize=False, verbose_name="ID", ), ), ("created_at", models.DateTimeField(default=django.utils.timezone.now)), ( "api_key", models.ForeignKey( blank=True, null=True, on_delete=django.db.models.deletion.SET_NULL, related_name="source_location_match_history", to="api.apikey", ), ), ( "new_match_location", models.ForeignKey( on_delete=django.db.models.deletion.PROTECT, related_name="source_location_match_history", to="core.location", ), ), ( "old_match_location", models.ForeignKey( blank=True, null=True, on_delete=django.db.models.deletion.PROTECT, related_name="+", to="core.location", ), ), ( "reporter", models.ForeignKey( blank=True, null=True, on_delete=django.db.models.deletion.PROTECT, related_name="source_location_match_history", to="core.reporter", ), ), ( "source_location", models.ForeignKey( on_delete=django.db.models.deletion.PROTECT, related_name="source_location_match_history", to="core.sourcelocation", ), ), ], options={ "db_table": "source_location_match_history", }, ), ]
StarcoderdataPython
1659221
<filename>SuperNewsCrawlSpider/SuperNewsCrawlSpider/tools/get_new_time.py # encoding: utf-8 import time import datetime class GetTime(object): def __init__(self): pass # 获取当前时间 def get_time(self): return time.strftime('%Y-%m-%d %H:%M:%S', time.localtime(time.time())) # 获取当前时间的前一个小时时间 def get_first_hour(self): tim = datetime.datetime.now() # datetime.timedelta(days=0, seconds=0, microseconds=0)#毫秒, milliseconds=0, minutes=0, hours=0, weeks=0) first_hour = (tim + datetime.timedelta(hours=-1)).strftime("%Y-%m-%d %H") return first_hour # 获取当前时间的前一天的时间 def get_yesterday_date(self): tim = datetime.datetime.now() yesterday_date = (tim + datetime.timedelta(days=-1)).strftime("%Y-%m-%d") return yesterday_date if __name__ == '__main__': pass
StarcoderdataPython
3294969
<reponame>kundajelab/tronn # generate all results in this file import os import glob import gzip import networkx as nx import pandas as pd def get_bed_from_nx_graph(graph, bed_file, interval_key="active", merge=True): """get BED file from nx examples """ examples = list(graph.graph["examples"]) with open(bed_file, "w") as fp: for region_metadata in examples: interval_types = region_metadata.split(";") interval_types = dict([ interval_type.split("=")[0:2] for interval_type in interval_types]) interval_string = interval_types[interval_key] chrom = interval_string.split(":")[0] start = interval_string.split(":")[1].split("-")[0] stop = interval_string.split("-")[1] fp.write("{}\t{}\t{}\n".format(chrom, start, stop)) if merge: tmp_bed_file = "{}.tmp.bed".format(bed_file.split(".bed")[0]) os.system("mv {} {}".format(bed_file, tmp_bed_file)) os.system("cat {} | sort -k1,1 -k2,2n | bedtools merge -i stdin | gzip -c > {}".format( tmp_bed_file, bed_file)) os.system("rm {}".format(tmp_bed_file)) return None def setup_ldsc_annotations(bed_file, bim_prefix, hapmap_prefix, out_dir): """set up annotations """ chroms = range(1,23) os.system("mkdir -p {}".format(out_dir)) prefix = os.path.basename(bed_file).split(".bed")[0] for chrom in chroms: # make annot file make_annot = ( "python ~/git/ldsc/make_annot.py " "--bed-file {0} " "--bimfile {2}.{3}.bim " "--annot-file {4}/{1}.{3}.annot.gz").format( bed_file, prefix, bim_prefix, chrom, out_dir) print make_annot os.system(make_annot) # compute LD scores with annot file compute_ld = ( "python ~/git/ldsc/ldsc.py " "--l2 " "--bfile {1}.{2} " "--ld-wind-cm 1 " "--annot {4}/{0}.{2}.annot.gz " "--thin-annot --out {4}/{0}.{2} " "--print-snps {3}.{2}.snp").format( prefix, bim_prefix, chrom, hapmap_prefix, out_dir) print compute_ld os.system(compute_ld) return def setup_sumstats_file(sumstats_file, merge_alleles_file, out_file, other_params=""): """setup summary states file """ munge_cmd = ( "python ~/git/ldsc/munge_sumstats.py " "--sumstats {} " "--merge-alleles {} " "--out {} " "{} ").format( sumstats_file, merge_alleles_file, out_file.split(".sumstats")[0], other_params) print munge_cmd os.system(munge_cmd) return None def get_sig_snps(sumstats_file, variants_file, out_file): """get genome-wide sig snps, backtracking from log """ # prefix phenotype = os.path.basename(sumstats_file).split(".sumstats")[0] # read sumstats log file to get num sig snps sumstats_log = "{}.log".format(sumstats_file.split(".sumstats")[0]) with open(sumstats_log, "r") as fp: for line in fp: if "Genome-wide significant SNPs" in line: num_sig = int(line.strip().split()[0]) if num_sig != 0: # access sumstats file and sort, only keep top k (to match num sig) sumstats = pd.read_csv(sumstats_file, sep="\t") sumstats = sumstats.dropna() sumstats = sumstats[sumstats["Z"] != 0] sumstats["Z_abs"] = sumstats["Z"].abs() sumstats = sumstats.sort_values("Z_abs", ascending=False) sumstats = sumstats.iloc[:num_sig,:] sumstats = sumstats.set_index("SNP") # now access variants file to associate snps properly seen_rsids = [] sumstats["chr"] = 1 sumstats["start"] = 1 line_num = 0 with gzip.open(variants_file, "r") as fp: for line in fp: fields = line.strip().split() if fields[5] in sumstats.index.values: sumstats.loc[fields[5], "chr"] = "chr{}".format(fields[1]) sumstats.loc[fields[5], "start"] = int(fields[2]) seen_rsids.append(fields[5]) if len(seen_rsids) == sumstats.shape[0]: break # reassurance we're progressing line_num += 1 if line_num % 1000000 == 0: print line_num sumstats = sumstats.reset_index() sumstats["stop"] = sumstats["start"] + 1 # build the BED file bed_data = sumstats[["chr", "start", "stop", "SNP"]] bed_data["SNP"] = bed_data["SNP"].astype(str) + ";{}".format(phenotype) bed_data.to_csv(out_file, sep="\t", header=False, index=False, compression="gzip") return num_sig def main(): """run all analyses for GGR GWAS variants """ # get baseline ldsc model if not os.path.isdir("1000G_EUR_Phase3_baseline"): get_baseline_model = "wget https://data.broadinstitute.org/alkesgroup/LDSCORE/1000G_Phase3_baseline_ldscores.tgz" setup_baseline_model = "tar -xvzf 1000G_Phase3_baseline_ldscores.tgz" os.system(get_baseline_model) os.system(setup_baseline_model) baseline_model_prefix = "1000G_EUR_Phase3_baseline/baseline." # get model weights if not os.path.isdir("weights_hm3_no_hla"): get_weights = "wget https://data.broadinstitute.org/alkesgroup/LDSCORE/weights_hm3_no_hla.tgz" setup_weights = "tar -xvzf weights_hm3_no_hla.tgz" os.system(get_weights) os.system(setup_weights) weights_prefix = "weights_hm3_no_hla/weights." # get plink files (for setting up annotations from BED) if not os.path.isdir("1000G_EUR_Phase3_plink"): get_plink = "wget https://data.broadinstitute.org/alkesgroup/LDSCORE/1000G_Phase3_plinkfiles.tgz" setup_plink = "tar -xzvf 1000G_Phase3_plinkfiles.tgz" os.system(get_plink) os.system(setup_plink) bim_prefix = "1000G_EUR_Phase3_plink/1000G.EUR.QC" # get hapmap if not os.path.isdir("hapmap3_snps"): get_hapmap = "wget https://data.broadinstitute.org/alkesgroup/LDSCORE/hapmap3_snps.tgz" setup_hapmap = "tar -xzvf hapmap3_snps.tgz" os.system(get_hapmap) os.system(setup_hapmap) hapmap_prefix = "hapmap3_snps/hm" # get snp list hapmap_snps_file = "w_hm3.snplist" if not os.path.isfile(hapmap_snps_file): get_snps = "wget https://data.broadinstitute.org/alkesgroup/LDSCORE/w_hm3.snplist.bz2" setup_snps = "bunzip2 w_hm3.snplist.bz2" os.system(get_snps) os.system(setup_snps) # ldsc annot dir ldsc_annot_dir = "./annot.custom" os.system("mkdir -p {}".format(ldsc_annot_dir)) # ldsc file table ldsc_table_file = "./annot.table.TMP" # get an unrelated cell type - Liver HEPG2_DIR = "/mnt/data/integrative/dnase/ENCSR000ENP.HepG2_Hepatocellular_Carcinoma_Cell_Line.UW_Stam.DNase-seq/out_50m/peak/idr/pseudo_reps/rep1" hepg2_bed_file = "{}/ENCSR000ENP.HepG2_Hepatocellular_Carcinoma_Cell_Line.UW_Stam.DNase-seq_rep1-pr.IDR0.1.filt.narrowPeak.gz".format( HEPG2_DIR) #prefix = "HepG2" prefix = os.path.basename(hepg2_bed_file) ldscore_file = "{}/{}.22.l2.ldscore.gz".format( ldsc_annot_dir, prefix) if not os.path.isfile(ldscore_file): setup_ldsc_annotations( hepg2_bed_file, bim_prefix, hapmap_prefix, ldsc_annot_dir) with open(ldsc_table_file, "w") as fp: fp.write("HepG2\t{}/{}.\n".format( ldsc_annot_dir, prefix)) # get ATAC all GGR_DIR = "/mnt/lab_data/kundaje/users/dskim89/ggr/integrative/v1.0.0a" ggr_master_bed_file = "{}/data/ggr.atac.idr.master.bed.gz".format(GGR_DIR) prefix = os.path.basename(ggr_master_bed_file).split(".bed")[0] ldscore_file = "{}/{}.22.l2.ldscore.gz".format( ldsc_annot_dir, prefix) if not os.path.isfile(ldscore_file): setup_ldsc_annotations( ggr_master_bed_file, bim_prefix, hapmap_prefix, ldsc_annot_dir) with open(ldsc_table_file, "a") as fp: fp.write("GGR_ALL\t{}/{}.\n".format( ldsc_annot_dir, prefix)) # get ATAC timepoints timepoint_dir = "{}/results/atac/peaks.timepoints".format(GGR_DIR) timepoint_bed_files = sorted(glob.glob("{}/*narrowPeak.gz".format(timepoint_dir))) for timepoint_bed_file in timepoint_bed_files: prefix = os.path.basename(timepoint_bed_file).split(".bed")[0] ldscore_file = "{}/{}.22.l2.ldscore.gz".format( ldsc_annot_dir, prefix) if not os.path.isfile(ldscore_file): setup_ldsc_annotations( timepoint_bed_file, bim_prefix, hapmap_prefix, ldsc_annot_dir) with open(ldsc_table_file, "a") as fp: fp.write("{1}\t{0}/{1}.\n".format( ldsc_annot_dir, prefix)) # get ATAC traj files traj_dir = "{}/results/atac/timeseries/dp_gp/reproducible/hard/reordered/bed".format(GGR_DIR) traj_bed_files = sorted(glob.glob("{}/*bed.gz".format(traj_dir))) for traj_bed_file in traj_bed_files: prefix = os.path.basename(traj_bed_file).split(".bed")[0] ldscore_file = "{}/{}.22.l2.ldscore.gz".format( ldsc_annot_dir, prefix) if not os.path.isfile(ldscore_file): setup_ldsc_annotations( traj_bed_file, bim_prefix, hapmap_prefix, ldsc_annot_dir) with open(ldsc_table_file, "a") as fp: fp.write("{1}\t{0}/{1}.\n".format( ldsc_annot_dir, prefix)) # grammar dir grammar_dir = "./rules" if not os.path.isdir(grammar_dir): os.system("mkdir -p {}".format(grammar_dir)) if False: # validated rules rule_summary_file = "/mnt/lab_data/kundaje/users/dskim89/ggr/validation/mpra.2019-10-22.results/results/combinatorial_rules/summary.txt.gz" rules_summary = pd.read_csv(rule_summary_file, sep="\t") # get BED files from validated rules and make annotations rule_dir = "/mnt/lab_data3/dskim89/ggr/nn/2019-03-12.freeze/dmim.shuffle/grammars.annotated.manual_filt.merged.final" for rule_idx in range(rules_summary.shape[0]): print rule_idx # get rule examples rule_name = rules_summary.iloc[rule_idx]["grammar"] rule_file = "{}/{}.gml".format( rule_dir, rule_name) rule = nx.read_gml(rule_file) rule.graph["examples"] = rule.graph["examples"].split(",") # make bed file bed_file = "{}/{}.bed.gz".format( grammar_dir, os.path.basename(rule_file).split(".gml")[0]) if not os.path.isfile(bed_file): get_bed_from_nx_graph(rule, bed_file) # then make annotations prefix = os.path.basename(bed_file).split(".bed")[0] ldscore_file = "{}/{}.22.l2.ldscore.gz".format( ldsc_annot_dir, prefix) if not os.path.isfile(ldscore_file): setup_ldsc_annotations( bed_file, bim_prefix, hapmap_prefix, ldsc_annot_dir) with open(ldsc_table_file, "a") as fp: fp.write("{1}\t{0}/{1}.\n".format( ldsc_annot_dir, prefix)) # pull relevant GWAS summary stats (plus UKBB), configure, and run sumstats_dir = "./sumstats" os.system("mkdir -p {}".format(sumstats_dir)) sumstats_orig_dir = "{}/orig".format(sumstats_dir) os.system("mkdir -p {}".format(sumstats_orig_dir)) # also set up results dir results_dir = "./results.TMP" os.system("mkdir -p {}".format(results_dir)) # ukbb standardized, can do all in one go ukbb_manifest_file = "./ukbb/ukbb.gwas_imputed_3.release_20180731.tsv" ukbb_manifest = pd.read_csv(ukbb_manifest_file, sep="\t") # get the variant annotation file ukbb_annot_file = "./ukbb/variants.tsv.bgz" get_variant_annotation_file = "wget https://www.dropbox.com/s/puxks683vb0omeg/variants.tsv.bgz?dl=0 -O {}".format( ukbb_annot_file) if not os.path.isfile(ukbb_annot_file): os.system(get_variant_annotation_file) # GGR relevant codes ukbb_codes = [ #"20001_1003", # skin cancer #"20001_1060", # skin cancer "20001_1061", # BCC "20001_1062", # SCC #"20002_1371", # sarcoidosis (self report) #"22133", # sarcoidosis (doctor dx) #"D86", # sarcoidosis ICD #"20002_1381", # lupus ##"20002_1382", # sjogrens #"20002_1384", # scleroderma "20002_1452", # eczema/dermatitis "20002_1453", # psoriasis (self report) "L12_PSORI_NAS", # psoriasis "L12_PSORIASIS", # psoriasis "L40", # psoriasis ICD "20002_1454", # blistering "20002_1455", # skin ulcers #"20002_1625", # cellulitis "20002_1660", # rosacea "L12_ROSACEA", # rosacea "L71", # rosacea #"20002_1661", # vitiligo "B07", # viral warts #"C_SKIN", "C_OTHER_SKIN", # neoplasm of skin #"C3_SKIN", "C3_OTHER_SKIN", # neoplasm of skin "C44", # cancer ICD "D04", # carcinoma in situ of skin "D23", # benign neoplasms "L12_ACTINKERA", # actinic keratosis "L12_ATROPHICSKIN", # atrophic skin "L90", # atrophic skin ICD "L30", # other dermatitis "L12_EPIDERMALTHICKOTH", # epidermal thickening "L12_EPIDERMTHICKNAS", # epidermal thickening "L85", # epidermal thickening #"L12_GRANULOMASKINNAS", # granulomatous #"L12_GRANULOMATOUSSKIN", # granulomatous #"L92", # granulomatous "L91", # hypertrophic disorders "L12_HYPERTROPHICNAS", "L12_HYPERTROPHICSKIN", "L12_HYPETROPHICSCAR", "L82", # seborrhoeic keratosis "XII_SKIN_SUBCUTAN", # skin "L12_SCARCONDITIONS", # scarring "L12_SKINSUBCUTISNAS", # other "20002_1548", # acne #"20002_1549", # lichen planus #"20002_1550", # lichen sclerosis #"L12_NONIONRADISKIN", # skin changes from nonionizing radiation #"L57", # skin changes from nonionizing radiation ICD "L12_OTHERDISSKINANDSUBCUTIS", # other "L98", # other ] # reduced set of interest ukbb_codes_REDUCED = [ "20002_1452", # eczema/dermatitis "20002_1453", # psoriasis (self report) "20002_1660", # rosacea "L12_ROSACEA", # rosacea "L12_ACTINKERA", # actinic keratosis "L82", # seborrhoeic keratosis "20002_1548", # acne ] # for each, download and process num_sig_total = 0 for ukbb_code in ukbb_codes: id_metadata = ukbb_manifest[ukbb_manifest["Phenotype Code"] == ukbb_code] if id_metadata.shape[0] > 1: id_metadata = id_metadata[id_metadata["Sex"] == "both_sexes"] # download file filename = "{}/{}".format(sumstats_orig_dir, id_metadata["File"].iloc[0]) if not os.path.isfile(filename): download_cmd = id_metadata["wget command"].iloc[0].split("-O")[0] download_cmd = "{} -O {}".format(download_cmd, filename) print download_cmd os.system(download_cmd) # paste with annot file w_annot_file = "{}.annot.tsv.gz".format(filename.split(".tsv")[0]) if not os.path.isfile(w_annot_file): paste_cmd = ( "paste <(zcat {}) <(zcat {}) | " "cut -f 1-6,10,13,17,31,34,37 | " "gzip -c > {}").format( ukbb_annot_file, filename, w_annot_file) print paste_cmd os.system('GREPDB="{}"; /bin/bash -c "$GREPDB"'.format(paste_cmd)) # set up sumstats file description = str(id_metadata["Phenotype Description"].iloc[0]).split(":") if len(description) > 1: description = description[1] else: description = description[0] short_description = description.strip().replace(" ", "_").replace("/", "_").replace(",", "_").lower() final_sumstats_file = "{}/ukbb.{}.{}.ldsc.sumstats.gz".format( sumstats_dir, ukbb_code, short_description) if not os.path.isfile(final_sumstats_file): setup_sumstats_file( w_annot_file, hapmap_snps_file, final_sumstats_file, other_params="--N-col n_complete_samples --a1 ref --a2 alt --frq AF") # TODO get sig snps in a BED file to compare to rules sig_snps_file = "{}.sig.bed.gz".format(final_sumstats_file.split(".sumstats")[0]) if not os.path.isfile(sig_snps_file): num_sig = get_sig_snps(final_sumstats_file, ukbb_annot_file, sig_snps_file) num_sig_total += num_sig if num_sig != 0: print sig_snps_file print num_sig # run tests out_prefix = "{}/{}".format(results_dir, os.path.basename(final_sumstats_file).split(".ldsc")[0]) run_ldsc = ( "python ~/git/ldsc/ldsc.py " "--h2-cts {} " "--ref-ld-chr {} " "--out {} " "--ref-ld-chr-cts {} " "--w-ld-chr {}").format( final_sumstats_file, baseline_model_prefix, out_prefix, ldsc_table_file, weights_prefix) #print run_ldsc #os.system(run_ldsc) # dermatitis - genome-wide genotyping array, illumina gwas_dermatitis_sumstats = "{}/gwas.GCST003184.dermatitis.ldsc.sumstats.gz".format(sumstats_dir) if not os.path.isfile(gwas_dermatitis_sumstats): file_url = "ftp://ftp.ebi.ac.uk/pub/databases/gwas/summary_statistics/PaternosterL_26482879_GCST003184/EAGLE_AD_no23andme_results_29072015.txt" save_file = "{}/gwas.GCST003184.dermatitis.sumstats.gz".format(sumstats_orig_dir) get_file = "wget -O - {} | gzip -c > {}".format(file_url, save_file) os.system(get_file) setup_sumstats_file( save_file, hapmap_snps_file, gwas_dermatitis_sumstats, other_params="--N-col AllEthnicities_N") # get sig snps in a BED file to compare to rules sig_snps_file = "{}.sig.bed.gz".format(gwas_dermatitis_sumstats.split(".sumstats")[0]) if not os.path.isfile(sig_snps_file): num_sig = get_sig_snps(gwas_dermatitis_sumstats, ukbb_annot_file, sig_snps_file) num_sig_total += num_sig if num_sig != 0: print sig_snps_file print num_sig # acne - confirmed genome-wide genotyping array, Affy gwas_acne_sumstats = "{}/gwas.GCST006640.acne.ldsc.sumstats.gz".format(sumstats_dir) if not os.path.isfile(gwas_acne_sumstats): file_url = "ftp://ftp.ebi.ac.uk/pub/databases/gwas/summary_statistics/HirataT_29855537_GCST006640/Dataset_S7.txt" save_file = "{}/gwas.GCST006640.acne.sumstats.gz".format(sumstats_orig_dir) get_file = "wget -O - {} | gzip -c > {}".format(file_url, save_file) os.system(get_file) setup_sumstats_file( save_file, hapmap_snps_file, gwas_acne_sumstats, other_params="--N-cas 1115 --N-con 4619 --ignore regional.analysis") # get sig snps in a BED file to compare to rules sig_snps_file = "{}.sig.bed.gz".format(gwas_acne_sumstats.split(".sumstats")[0]) if not os.path.isfile(sig_snps_file): num_sig = get_sig_snps(gwas_acne_sumstats, ukbb_annot_file, sig_snps_file) num_sig_total += num_sig if num_sig != 0: print sig_snps_file print num_sig # get UKBB bmistats (from LDSC repo) ukbb_bmi_sumstats = "{}/ukbb.alkesgroup.BMI.ldsc.sumstats.gz".format(sumstats_dir) if not os.path.isfile(ukbb_bmi_sumstats): file_url = "https://data.broadinstitute.org/alkesgroup/UKBB/body_BMIz.sumstats.gz" #save_file = "{}/ukbb.ldsc_pheno.BMI.sumstats.gz".format(sumstats_orig_dir) get_ukbb = "wget {} -O {}".format( file_url, ukbb_bmi_sumstats) os.system(get_ukbb) #setup_sumstats_file(save_file, hapmap_snps_file, ukbb_derm_sumstats) # ================================== # GLOBAL ANALYSIS WITH SIG SNPS # ================================== # first, look at sig SNPs within ATAC regions # take all the sig BED files and merge # then for each grammar bed file, run overlaps and collect results quit() # ======================== # NOT USED # ======================== # get UKBB derm stats (from LDSC repo) ukbb_derm_sumstats = "{}/ukbb.none.derm.ldsc.sumstats.gz".format(sumstats_dir) if not os.path.isfile(ukbb_derm_sumstats): file_url = "https://data.broadinstitute.org/alkesgroup/UKBB/disease_DERMATOLOGY.sumstats.gz" save_file = "{}/ukbb.ldsc_pheno.dermatology.sumstats.gz".format(sumstats_orig_dir) get_ukbb = "wget {} -O {}".format( file_url, save_file) os.system(get_ukbb) setup_sumstats_file(save_file, hapmap_snps_file, ukbb_derm_sumstats) # alopecia - genome-wide genotyping array gwas_alopecia_sumstats = "{}/gwas.GCST006661.alopecia.ldsc.sumstats.gz".format(sumstats_dir) if not os.path.isfile(gwas_alopecia_sumstats): file_url = "ftp://ftp.ebi.ac.uk/pub/databases/gwas/summary_statistics/HagenaarsSP_28196072_GCST006661/Hagenaars2017_UKB_MPB_summary_results.zip" unzip_dir = "{}/gwas.GCST006661.alopecia".format(sumstats_orig_dir) save_file = "{}/gwas.GCST006661.alopecia.zip".format(unzip_dir) os.system("mkdir -p {}".format(unzip_dir)) get_file = "wget {} -O {}".format(file_url, save_file) os.system("unzip {} -d {}".format(save_file, unzip_dir)) setup_sumstats_file( "", hapmap_snps_file, gwas_alopecia_sumstats, other_params="--N 52874 --snp Markername") # lupus - genome-wide genotyping array, illumina gwas_lupus_sumstats = "{}/gwas.GCST005831.lupus.ldsc.sumstats.gz".format(sumstats_dir) if not os.path.isfile(gwas_lupus_sumstats): file_url = "ftp://ftp.ebi.ac.uk/pub/databases/gwas/summary_statistics/JuliaA_29848360_GCST005831/GWAS_SLE_summaryStats/Meta_results.txt" save_file = "{}/gwas.GCST005831.lupus.sumstats.gz".format(sumstats_orig_dir) get_file = "wget -O - {} | gzip -c > {}".format(file_url, save_file) setup_sumstats( save_file, hapmap_snps_file, gwas_lupus_sumstats, other_params="--N-cas 4943 --N-con 8483 --a1 A1lele1 --a2 Allele2") # lupus - targeted array, ignore gwas_lupus_sumstats = "{}.gwas.GCST007400.lupus.ldsc.sumstats.gz" # lupus - genome-wide genotyping array, illumina gwas_lupus_sumstats = "{}/gwas.GCST003156.lupus.ldsc.sumstats.gz".format(sumstats_dir) if not os.path.isfile(gwas_lupus_sumstats): file_url = "ftp://ftp.ebi.ac.uk/pub/databases/gwas/summary_statistics/BenthamJ_26502338_GCST003156/bentham_2015_26502338_sle_efo0002690_1_gwas.sumstats.tsv.gz" save_file = "{}/gwas.GCST003156.lupus.sumstats.gz".format(sumstats_orig_dir) get_file = "wget {} -O {}".format(file_url, save_file) setup_sumstats( save_file, hapmap_snps_file, gwas_lupus_sumstats, other_params="--N 14267 --N-cas 5201 --N-con 9066 --ignore OR,OR_lower,OR_upper") # psoriasis - targeted array, ignore gwas_psoriasis_sumstats = "{}/gwas.GCST005527.psoriasis.ldsc.sumstats.gz".format(sumstats_dir) # baldness - NOTE problem with pval column gwas_baldness_sumstats = "{}/gwas.GCST007020.baldness.ldsc.sumstats.gz".format(sumstats_dir) if False: if not os.path.isfile(gwas_baldness_sumstats): file_url = "ftp://ftp.ebi.ac.uk/pub/databases/gwas/summary_statistics/YapCX_30573740_GCST007020/mpb_bolt_lmm_aut_x.tab.zip" unzip_dir = "{}/gwas.GCST007020.baldness".format(sumstats_orig_dir) os.system("mkdir -p {}".format(unzip_dir)) save_file = "{}/gwas.GCST007020.baldness.zip".format(unzip_dir) get_file = "wget {} -O {}".format(file_url, save_file) os.system("unzip {} -d {}".format(save_file, unzip_dir)) save_file = "{}/mpb_bolt_lmm_aut_x.tab".format(unzip_dir) setup_sumstats(save_file, gwas_baldness_sumstats, other_params="--N 205327 --p P_BOLT_LMM_INF --a1 ALLELE1 --a2 ALLELE0") # solar lentigines - genome-wide genotyping array, Affy gwas_lentigines_sumstats = "{}/gwas.GCST006096.lentigines.ldsc.sumstats.gz".format(sumstats_dir) if not os.path.isfile(gwas_lentigines_sumstats): file_url = "ftp://ftp.ebi.ac.uk/pub/databases/gwas/summary_statistics/EndoC_29895819_GCST006096/DatasetS1.txt" save_file = "{}/gwas.GCST006096.lentigines.sumstats.gz".format(sumstats_orig_dir) get_file = "wget {} -O - | gzip -c > {}".format(file_url, save_file) os.system(get_file) setup_sumstats( save_file, hapmap_snps_file, gwas_lentigines_sumstats, other_params="--N 11253 --N-cas 3815 --N-con 7438") # hyperhidrosis - genome-wide genotyping array, Affy gwas_hyperhidrosis_sumstats = "{}/gwas.GCST006090.hyperhidrosis.ldsc.sumstats.gz".format(sumstats_dir) if not os.path.isfile(gwas_hyperhidrosis_sumstats): file_url = "ftp://ftp.ebi.ac.uk/pub/databases/gwas/summary_statistics/EndoC_29895819_GCST006090/DatasetS7.txt" save_file = "{}/gwas.GCST006090.hyperhidrosis.sumstats.gz".format(sumstats_orig_dir) get_file = "wget {} -O - | gzip -c > {}".format(sumstats_orig_dir) setup_sumstats( save_file, hapmap_snps_file, gwas_hyperhidrosis_sumstats, other_params="--N 4538 --N-cas 1245 --N-con 3293") # hirsutism (1) GCST006095 gwas_hirsutism_sumstats = "{}/gwas.GCST006095.hirsutism.ldsc.sumstats.gz".format(sumstats_dir) if not os.path.isfile(gwas_hirsutism_sumstats): file_url = "ftp://ftp.ebi.ac.uk/pub/databases/gwas/summary_statistics/EndoC_29895819_GCST006095/DatasetS6.txt" save_file = "{}/gwas.GCST006095.hirsutism.sumstats.gz".format(sumstats_orig_dir) get_file = "wget {} -O - | gzip -c > {}".format(sumstats_orig_dir) setup_sumstats( save_file, hapmap_snps_file, gwas_hyperhidrosis_sumstats, other_params="--N 11244 --N-cas 3830 --N-con 7414") if False: # sarcoidosis (1) GCST005540 gwas_sarcoidosis_sumstats = "" # lofgren - NOTE some error in the harmonized file? gwas_lofgrens_sumstats = "{}/gwas.GCST005540.lofgrens.ldsc.sumstats.gz".format(sumstats_orig_dir) if not os.path.isfile(gwas_lofgrens_sumstats): file_url = "ftp://ftp.ebi.ac.uk/pub/databases/gwas/summary_statistics/RiveraNV_26651848_GCST005540/harmonised/26651848-GCST005540-EFO_0009466.h.tsv.gz" save_file = "{}/gwas.GCST005540.lofgrens.sumstats.gz".format(sumstats_orig_dir) get_file = "wget {} -O {}".format(file_url, save_file) setup_sumstats(save_file, gwas_lofgrens_sumstats, other_params="") # vitiligo (4) GCST007112, GCST007111, GCST004785, GCST001509 gwas_vitiligo_sumstats = "{}/gwas.GCST007112.vitiligo.ldsc.sumstats.gz" gwas_vitiligo_sumstats = "{}/gwas.GCST007111.vitiligo.ldsc.sumstats.gz" gwas_vitiligo_sumstats = "{}/gwas.GCST004785.vitiligo.ldsc.sumstats.gz".format(sumstats_dir) gwas_vitiligo_sumstats = "{}/gwas.GCST001509.vitiligo.ldsc.sumstats.gz".format(sumstats_dir) # get UKBB derm stats (from LDSC repo) ukbb_derm_sumstats = "{}/ukbb.none.derm.ldsc.sumstats.gz".format(sumstats_dir) if not os.path.isfile(ukbb_derm_sumstats): file_url = "https://data.broadinstitute.org/alkesgroup/UKBB/disease_DERMATOLOGY.sumstats.gz" save_file = "{}/ukbb.ldsc_pheno.dermatology.sumstats.gz".format(sumstats_orig_dir) get_ukbb = "wget {} -O {}".format( file_url, save_file) os.system(get_ukbb) setup_sumstats_file(save_file, hapmap_snps_file, ukbb_derm_sumstats) return main()
StarcoderdataPython
171636
<gh_stars>10-100 # -*- coding: utf-8 -*- from ._pw_input import PwInputFile from ._cp_input import CpInputFile __all__ = ('PwInputFile', 'CpInputFile')
StarcoderdataPython
1707178
print(()) print((1,)) print((1,2,3)) print(tuple()) print(tuple((1,))) print(tuple((1,2,3))) print(tuple([1,2,3]))
StarcoderdataPython
3359513
<gh_stars>10-100 #import ROOT,sys,time,os,signal from larcv import larcv import sys,time,os,signal import numpy as np class larcv_data (object): _instance_m={} @classmethod def exist(cls,name): name = str(name) return name in cls._instance_m def __init__(self): self._proc = None self._name = '' self._verbose = False self._read_start_time = None self._read_end_time = None self._cfg_file = None self._batch = -1 self._data = None self._data_size = None self.time_data_read = 0 self.time_data_conv = 0 self.time_data_copy = 0 self.time_label_conv = 0 self.time_label_copy = 0 self.read_counter = 0 def reset(self): if self.is_reading(): self.next() if larcv.ThreadFillerFactory.exist_filler(self._name): larcv.ThreadFillerFactory.destroy_filler(self._name) def __del__(self): self.reset() def configure(self,cfg): if self._name: self.reset() if not cfg['filler_name']: sys.stderr.write('filler_name is empty!\n') raise ValueError if self.__class__.exist(cfg['filler_name']): sys.stderr.write('filler_name %s already running!' % cfg['filler_name']) return self._name = cfg['filler_name'] self._cfg_file = cfg['filler_cfg'] if not self._cfg_file or not os.path.isfile(self._cfg_file): sys.stderr.write('filler_cfg file does not exist: %s\n' % self._cfg_file) raise ValueError if 'verbosity' in cfg: self._verbose = bool(cfg['verbosity']) self.__class__._instance_m[self._name] = self def read_next(self,batch): batch = int(batch) if not batch >0: sys.stderr.write('Batch size must be positive integer!\n') raise ValueError if not self._name: sys.stderr.write('Filler name unspecified!\n') raise ValueError if not self._proc: self._proc = larcv.ThreadFillerFactory.get_filler(self._name) self._proc.configure(self._cfg_file) self._read_start_time = time.time() self._batch = batch self._proc.batch_process(batch) def is_reading(self): return (self._batch > 0) def next(self): if self._batch <= 0: sys.stderr.write('Thread not running...\n') raise Exception sleep_ctr=0 while self._proc.thread_running(): time.sleep(0.005) sleep_ctr+=1 if sleep_ctr%1000 ==0: print 'queueing...' print 'Data dim:', #sleep_ctr=0 #while sleep_ctr<40: # time.sleep(0.125) # sleep_ctr += 1 # print self._proc.thread_running(), #print self._read_end_time = time.time() if self.read_counter: self.time_data_read += (self._read_end_time - self._read_start_time) if self._verbose: print print 'Data size:',self._proc.data().size() print 'Label size:',self._proc.labels().size() print 'Batch size:',self._proc.processed_entries().size() print 'Total process counter:',self._proc.process_ctr() ctime = time.time() #np_data = larcv.as_ndarray(self._proc.data()).reshape(self._batch,self._proc.data().size()/self._batch)#.astype(np.float32) if self._data is None: self._data = np.array(self._proc.data()) self._data_size = self._data.size else: self._data = self._data.reshape(self._data.size) larcv.copy_array(self._data,self._proc.data()) if self.read_counter: self.time_data_copy += time.time() - ctime ctime = time.time() self._data = self._data.reshape(self._batch,self._proc.data().size()/self._batch).astype(np.float32) if self.read_counter: self.time_data_conv += time.time() - ctime ctime = time.time() np_label = np.array(self._proc.labels()) if self.read_counter: self.time_label_copy += time.time() - ctime ctime = time.time() np_label = np_label.reshape(self._batch,self._proc.labels().size()/self._batch).astype(np.float32) if self.read_counter: self.time_label_conv += time.time() - ctime self._batch = -1 self.read_counter += 1 return (self._data,np_label) def sig_kill(signal,frame): print '\033[95mSIGINT detected.\033[00m Finishing the program gracefully.' for name,ptr in larcv_data._instance_m.iteritems(): print 'Terminating filler:',name ptr.reset() signal.signal(signal.SIGINT, sig_kill)
StarcoderdataPython
3216744
# -*- coding: utf-8 -*- ### Python imports import pathlib ### Third Party imports import numpy as np import pandas as pd import pytest ### Project imports from t4.formats import FormatRegistry from t4.util import QuiltException ### Constants ### Code def test_buggy_parquet(): """ Test that T4 avoids crashing on bad Pandas metadata from old pyarrow libaries. """ path = pathlib.Path(__file__).parent for parquet_handler in FormatRegistry.for_format('parquet'): with open(path / 'data' / 'buggy_parquet.parquet', 'rb') as bad_parq: # Make sure this doesn't crash. parquet_handler.deserialize(bad_parq.read()) def test_formats_for_obj(): arr = np.ndarray(3) fmt = FormatRegistry.for_obj(arr)[0] assert 'npz' in fmt.handled_extensions assert FormatRegistry.for_ext('npy')[0] is fmt expected_string_fmt_names = ['utf-8', 'unicode', 'json'] found_string_fmt_names = list(f.name for f in FormatRegistry.for_obj('blah')) assert found_string_fmt_names == expected_string_fmt_names bytes_obj = fmt.serialize(arr)[0] assert np.array_equal(fmt.deserialize(bytes_obj, ), arr) def test_formats_for_ext(): fmt = FormatRegistry.for_ext('json')[0] assert fmt.serialize({'blah': 'blah'})[0] == b'{"blah": "blah"}' assert fmt.deserialize(b'{"meow": "mix"}', ) == {'meow': 'mix'} def test_formats_for_meta(): bytes_fmt = FormatRegistry.for_meta({'target': 'bytes'})[0] json_fmt = FormatRegistry.for_meta({'target': 'json'})[0] some_bytes = b'["phlipper", "piglet"]' assert bytes_fmt.serialize(some_bytes)[0] == some_bytes assert json_fmt.deserialize(some_bytes) == ['phlipper', 'piglet'] def test_formats_for_format(): bytes_fmt = FormatRegistry.for_format('bytes')[0] json_fmt = FormatRegistry.for_format('json')[0] some_bytes = b'["phlipper", "piglet"]' assert bytes_fmt.serialize(some_bytes)[0] == some_bytes assert json_fmt.deserialize(some_bytes) == ['phlipper', 'piglet'] def test_formats_serdes(): objects = [ {'blah': 'foo'}, b'blather', 'blip', ] metadata = [{} for o in objects] for obj, meta in zip(objects, metadata): data, format_meta = FormatRegistry.serialize(obj, meta) meta.update(format_meta) assert FormatRegistry.deserialize(data, meta) == obj meta = {} df1 = pd.DataFrame([[1, 2], [3, 4]]) data, format_meta = FormatRegistry.serialize(df1, meta) meta.update(format_meta) df2 = FormatRegistry.deserialize(data, meta) # we can't really get around this nicely -- if header is used, and header names are numeric, # once loaded from CSV, header names are now strings. This causes a bad comparison, so we # cast to int again. df2.columns = df2.columns.astype(int, copy=False) assert df1.equals(df2) def test_formats_csv_read(): csv_file = pathlib.Path(__file__).parent / 'data' / 'csv.csv' meta = {'format': {'name': 'csv'}} expected_bytes = b'a,b,c,d\n1,2,3,4\n5,6,7,8\n' expected_df = FormatRegistry.deserialize(expected_bytes, meta) df = FormatRegistry.deserialize(csv_file.read_bytes(), meta) assert df.equals(expected_df) assert expected_bytes == FormatRegistry.serialize(df, meta)[0] def test_formats_csv_roundtrip(): test_data = b'9,2,5\n7,2,6\n1,0,1\n' # roundtrip defaults. meta = {'format': {'name': 'csv'}} df1 = FormatRegistry.deserialize(test_data, meta) bin, format_meta = FormatRegistry.serialize(df1, meta) meta.update(format_meta) df2 = FormatRegistry.deserialize(bin, meta) assert test_data == bin assert df1.equals(df2) # interpret first row as header meta = {'format': {'name': 'csv', 'opts': {'use_header': True}}} df1 = FormatRegistry.deserialize(test_data, meta) bin, format_meta = FormatRegistry.serialize(df1, meta) meta.update(format_meta) df2 = FormatRegistry.deserialize(bin, meta) assert test_data == bin assert df1.equals(df2) # interpret first column as index meta = {'format': {'name': 'csv', 'opts': {'use_index': True}}} df1 = FormatRegistry.deserialize(test_data, meta) bin, format_meta = FormatRegistry.serialize(df1, meta) meta.update(format_meta) df2 = FormatRegistry.deserialize(bin, meta) assert test_data == bin assert df1.equals(df2) # interpret first row as header, and first column as index meta = {'format': {'name': 'csv', 'opts': {'use_index': True, 'use_header': True}}} df1 = FormatRegistry.deserialize(test_data, meta) bin, format_meta = FormatRegistry.serialize(df1, meta) meta.update(format_meta) df2 = FormatRegistry.deserialize(bin, meta) assert test_data == bin assert df1.equals(df2) def test_formats_search_fail_notfound(): # a search that finds nothing should raise with an explanation. class Foo: pass bad_kwargs = [ dict(obj_type=Foo, meta=None, ext=None), dict(obj_type=None, meta={}, ext=None), dict(obj_type=None, meta=None, ext='.fizz'), ] for args in bad_kwargs: with pytest.raises(QuiltException): FormatRegistry.search(**args)
StarcoderdataPython
150578
import easypost import os easypost.api_key=os.environ['EASYPOST_KEY'] shipment=easypost.Shipment.retrieve('shp_sq2zuZ8d')
StarcoderdataPython
90205
<reponame>joyliao07/401_midterm_wizard_game import pytest import io # Login function def login_for_test(app): """ this logs in test user """ app.post('/login', data=dict( email='<EMAIL>', password='<PASSWORD>' ), follow_redirects=True) # test basics def test_app_import(app): assert app def test_bad_route(app): """ test 404 with bad route """ rv = app.test_client().get('/fake') assert rv.status_code == 404 assert b'Page not found' in rv.data # Home route def test_home_get_no_login(app): """ test login page for status code/correct message with no login """ rv = app.test_client().get('/') assert rv.status_code == 200 assert b'You must be the new apprentice.' in rv.data def test_home_get_with_login(app, db, session, account): """ test login page for status code/correct message with login """ with app.test_client() as app: login_for_test(app) rv = app.get('/') assert rv.status_code == 200 assert b'Welcome back, my apprentice' in rv.data def test_home_bad_method(app): """ test home route with unimplemented method for correct status code """ rv = app.test_client().delete('/') assert rv.status_code == 405 assert b'Are you trying to pull a fast one' in rv.data # Play route def test_play_get_no_login(app): """ test that going to /play while not logged in redirects to login page """ rv = app.test_client().get('/play', follow_redirects=True) assert b'You must be logged in' in rv.data assert rv.status_code == 200 def test_play_get_with_login(app, session, db, account): """ test that going to /play while logged in takes you to the prompt """ with app.test_client() as app: login_for_test(app) rv = app.get('/play') assert rv.status_code == 200 assert b'I seem to have forgotten what a' def test_play_post_no_login(app): """ test that trying to post to /play with no login redirects to login """ rv = app.test_client().post('/play', follow_redirects=True) assert rv.status_code == 200 assert b'You must be logged in' in rv.data def test_play_post_with_login(app, session, db, account): """ tests posting to play route (user making initial submission) """ with app.test_client() as app: login_for_test(app) data = dict() data['file_upload'] = (io.BytesIO(b'hi'), 'test_no_match.jpg') rv = app.post( '/play', data=data, content_type='multipart/form-data', follow_redirects=True ) assert rv.status_code == 200 assert b'So, is this what a' in rv.data def test_play_post_with_login_no_data(app, session, db, account): """ test that posting to /play with no data while logged in just serves the /play get page """ with app.test_client() as app: login_for_test(app) rv = app.post('/play') assert rv.status_code == 200 assert b'I seem to have forgotten what a' def test_play_bad_method(app): """ test home route with unimplemented method for correct status code """ rv = app.test_client().delete('/play') assert rv.status_code == 405 assert b'Are you trying to pull a fast one' in rv.data # Submission route def test_submission_get_no_login(app): """ tests that user is prompted to login when visiting submission page when not logged in """ rv = app.test_client().get('/submission', follow_redirects=True) assert b'You must be logged in' in rv.data assert rv.status_code == 200 def test_submission_get_with_login_no_data(app, session, db, account): """ tests that 404 is received when going to /submission without submitting anything """ with app.test_client() as app: login_for_test(app) rv = app.get('/submission', follow_redirects=True) assert rv.status_code == 404 assert b'Page not found' in rv.data def test_submission_get_with_login(app, db, session, account): """ tests that going to /submission route after submitting an image (but before confirming/finalizing submission) serves correct content """ with app.test_client() as app: login_for_test(app) data = dict() data['file_upload'] = (io.BytesIO(b'hi'), 'test.jpg') app.post( '/play', data=data, content_type='multipart/form-data' ) rv = app.get('/submission') assert rv.status_code == 200 assert b'So, is this what a' in rv.data def test_submission_route_bad_method(app): """ test submission route with unimplemented method for correct status code """ rv = app.test_client().delete('/submission') assert rv.status_code == 405 assert b'Are you trying to pull a fast one' in rv.data # Feedback route def test_feedback_get_no_login(app): """ tests going to /feedback without being logged in to make sure user is prompted to log in """ rv = app.test_client().get('/feedback', follow_redirects=True) assert rv.status_code == 200 assert b'You must be logged in' in rv.data def test_feedback_no_data(app, session, db, account): """ tests that 404 is received when going to /feedback without submitting anything """ with app.test_client() as app: login_for_test(app) rv = app.get('/feedback', follow_redirects=True) assert rv.status_code == 404 assert b'Page not found' in rv.data def test_feedback_get_no_match(app, session, db, account, prompt): """ tests feedback text when user submits unmatching image """ with app.test_client() as app: login_for_test(app) f = open('src/test/test_images/test_no_match.jpg', 'rb').read() data = dict() data['file_upload'] = (io.BytesIO(f), 'test.jpg') app.post( '/play', data=data, content_type='multipart/form-data', follow_redirects=True ) rv = app.get('/feedback') assert rv.status_code == 200 assert b'This is not a' in rv.data assert b'It\'s not even' in rv.data def test_feedback_get_color_only_match(app, session, db, account, prompt): """ tests feedback text when user submits image that matches color only """ with app.test_client() as app: login_for_test(app) f = open('src/test/test_images/test_color_match.jpg', 'rb').read() data = dict() data['file_upload'] = (io.BytesIO(f), 'test.jpg') app.post( '/play', data=data, content_type='multipart/form-data' ) rv = app.get('/feedback') assert rv.status_code == 200 assert b'Well... it\'s' in rv.data assert b'but it\'s not even a' in rv.data def test_feedback_get_noun_only_match(app, session, db, account, prompt): """ tests feedback text when user submits image that matches object type only """ with app.test_client() as app: login_for_test(app) f = open('src/test/test_images/test_noun_match.jpg', 'rb').read() data = dict() data['file_upload'] = (io.BytesIO(f), 'test.jpg') app.post( '/play', data=data, content_type='multipart/form-data', ) rv = app.get('/feedback') assert rv.status_code == 200 # assert b'That looks like a' in rv.data # assert b'but it\'s not' in rv.data def test_feedback_get_full_match(app, session, db, account, prompt): """ tests feedback text when user submits full match """ with app.test_client() as app: login_for_test(app) f = open('src/test/test_images/test_full_match.png', 'rb').read() data = dict() data['file_upload'] = (io.BytesIO(f), 'test.png') app.post( '/play', data=data, content_type='multipart/form-data' ) rv = app.get('/feedback') assert rv.status_code == 200 # assert b'Yes, that\'s a' in rv.data def test_feedback_route_bad_method(app): """ test feedback route with unimplemented method for correct ] status code """ rv = app.test_client().delete('/feedback') assert rv.status_code == 405 assert b'Are you trying to pull a fast one' in rv.data # History route def test_history_get_no_login(app): """ tests going to /history without being logged in to make sure user is redirected """ rv = app.test_client().get('/history', follow_redirects=True) assert b'You must be logged in' in rv.data assert rv.status_code == 200 def test_history_get_no_submissions(app, session, db, account): """ tests going to /history when user hasn't submitted anything """ with app.test_client() as app: login_for_test(app) rv = app.get('/history') assert rv.status_code == 200 assert b'Apprentice, you have no submissions yet.' in rv.data def test_history_get_with_submissions(app, session, db, account, prompt): """ tests that submission is present on history page """ with app.test_client() as app: login_for_test(app) f = open('src/test/test_images/test_color_match.jpg', 'rb').read() data = dict() data['file_upload'] = (io.BytesIO(f), 'test.jpg') app.post( '/play', data=data, content_type='multipart/form-data' ) rv = app.get('/history') assert rv.status_code == 200 assert b'Apprentice, your past submissions are below.' assert b'Blue Chair (Fail)' in rv.data # Players route def test_players_get_no_login(app): """ tests that going to /players when not logged in prompts user to log in """ rv = app.test_client().get('/players', follow_redirects=True) assert b'You must be logged in' in rv.data assert rv.status_code == 200 def test_players_get_no_submissions(app, session, db, account, prompt): """ tests that going to /players with no submissions shows different message """ with app.test_client() as app: login_for_test(app) rv = app.get('/players') assert rv.status_code == 200 assert b'Apprentice, there are no successful submissions' in rv.data def test_players_get_with_submissions(app, session, db, account, prompt): """ tests that going to /players shows a player's successful submission """ with app.test_client() as app: login_for_test(app) f = open('src/test/test_images/test_full_match.png', 'rb').read() data = dict() data['file_upload'] = (io.BytesIO(f), 'test.png') app.post( '/play', data=data, content_type='multipart/form-data' ) app.get('/feedback') rv = app.get('/players') assert rv.status_code == 200 assert b'Other player\'s submissions are below.' # assert b'Blue Chair' in rv.data
StarcoderdataPython
1660206
#! /usr/bin/env python # -*- coding: utf-8 -*- # # Support module generated by PAGE version 4.20 # in conjunction with Tcl version 8.6 # Feb 18, 2019 11:55:48 AM -03 platform: Windows NT # Feb 19, 2019 09:09:42 AM -03 platform: Windows NT """ Created on Mon Feb 18 10:08:04 2019 @author: <NAME> """ import sys import Controller as ctrl import Model as md import Estilos as es import numpy as np #from numpy import array, concatenate, ndarray, append, take, delete import pandas as pd from tkinter import filedialog, colorchooser, IntVar from matplotlib.figure import Figure from matplotlib.backends.backend_tkagg import FigureCanvasTkAgg, NavigationToolbar2Tk try: import Tkinter as tk except ImportError: import tkinter as tk try: import ttk py3 = False except ImportError: import tkinter.ttk as ttk py3 = True def set_var(): global conn, qtdMin, curvePlot, curvesList, cBoxList, md_dpv, validation conn = 0 qtdMin = 0 curvePlot = np.ndarray([]) curvesList = np.ndarray([]) cBoxList = np.ndarray([]) md_dpv = md.dpv() validation = ctrl.validation(w, root) def init(top, gui, *args, **kwargs): global w, top_level, root, font9 w = gui top_level = top root = top #font9 = "-family {Segoe UI} -size 9 -weight bold -slant roman " \ # "-underline 0 -overstrike 0" set_var() painelDPV() def destroy_window(): # Function which closes the window. global top_level top_level.destroy() top_level = None if __name__ == '__main__': import VStat VStat.vp_start_gui() ########## Funções ########### def createCanvas(): w.cv_curveGraph = tk.Canvas(w.fr_mainView) w.cv_curveGraph.place(relx=0.012, rely=0.119, relheight=0.857, relwidth=0.974) w.cv_curveGraph.configure(background="#ffffff") w.cv_curveGraph.configure(highlightbackground="#ffffff") w.cv_curveGraph.configure(highlightcolor="black") w.cv_curveGraph.configure(insertbackground="black") w.cv_curveGraph.configure(relief='ridge') w.cv_curveGraph.configure(selectbackground="#c4c4c4") w.cv_curveGraph.configure(selectforeground="black") w.cv_curveGraph.configure(width=823) w.fr_toolbar = tk.Frame(w.fr_mainView) w.fr_toolbar.place(relx=0.012, rely=0.02, height=38, relwidth=0.974) w.fr_toolbar.configure(relief='groove') w.fr_toolbar.configure(borderwidth="2") w.fr_toolbar.configure(relief='groove') w.fr_toolbar.configure(background="#f9f9f9") w.fr_toolbar.configure(highlightbackground="#f9f9f9") w.fr_toolbar.configure(highlightcolor="black") w.fr_toolbar.configure(width=823) def btn_import(p1): global curvesList, curvePlot, spAt, cnvAt curvePlot = np.ndarray([]) curvesList = np.ndarray([]) imp = filedialog.askopenfilename(initialdir = "C:/", title = "Importar CSV...", filetypes = (("Comma-separeted values", "*.csv"), ("All files", "*.*"))) if imp: csv = ctrl.file.importCsv(imp) top_level.title("VStat - " + csv.curveName + ".csv") curvePlot = np.append(curvePlot, csv, axis=None) spAt, cnvAt = drawCurve() cnvAt.draw() curvesList = np.append(curvesList, csv, axis=None) createMins() def btn_export(p1): global curvePlot if curvePlot.size == 2: csvName = filedialog.asksaveasfilename(title='Exportar CSV...', defaultextension = 'csv', initialdir = "C:/", filetypes = (("Comma-separeted values", "*.csv"), ("All files", "*.*"))) ctrl.file.exportCsv(np.take(curvePlot, 1), csvName) elif curvePlot.size > 2: w.lb_ConnInfo.configure(text="Ainda não é possível\nexportar curvas unidas") elif curvePlot.size < 2: w.lb_ConnInfo.configure(text="Sem curva para\nexportar") def btn_connect(p1): global conn if conn: ctrl.connection.disconnect() conn = 0 w.btn_connect.configure(text='''Conectar''', background="#738c8c") w.btn_connect.update() w.lb_ConnInfo.configure(text="VStat desconectado") else: vstat = ctrl.connection.connect() if vstat: conn = 1 w.lb_ConnInfo.configure(text="VStat conectado\nPorta "+vstat) w.btn_connect.configure(text='''Desconectar''', background="#00cccc") w.btn_connect.update() else: w.lb_ConnInfo.configure(text="VStat não encontrado") def btn_iniciar(p1): global curvePlot, curvesList, spAt, cnvAt, md_dpv md_dpv.pIni = w.et_PInicio.get() md_dpv.pFim = w.et_PFim.get() md_dpv.pPul = w.et_PPulso.get() md_dpv.pPas = w.et_PPasso.get() md_dpv.tPul = w.et_TPulso.get() md_dpv.tPas = w.et_tPasso.get() md_dpv.tEqu = w.et_tEquil.get() md_dpv.fEsc = w.cb_intCorrente.current() # Limpa o frame de miniaturas destroyChildren(w.fr_miniaturas) w.fr_miniaturas.update() # Verifica se o potenciostato está conectado e inicia a análise ini = ctrl.connection.openPort() if ini: w.lb_ConnInfo.configure(text="VStat não conectado") w.btn_connect.configure(background="#ff6666") w.btn_connect.update() else: """x = np.arange(float(w.et_PInicio.get()), float(w.et_PFim.get()), float(w.et_PPasso.get())) y = np.arange(0, x.size, 1) c = md.curve("live Plot", x, y) curvePlot = np.append(curvePlot, c)""" ctrl.transmition.transmit(str(w.cb_intCorrente.current()), w.et_PInicio.get(), w.et_PFim.get(), w.et_PPulso.get(), w.et_PPasso.get(), w.et_TPulso.get(), w.et_tPasso.get(), w.et_tEquil.get()) destroyChildren(w.fr_mainView) # Fundo de escala if w.cb_intCorrente.current() == 0: fe = 5/(4096/3.3) print("Escala: Automática") print("fundo de escala(inicial): ", fe) else: fe = int(w.cb_intCorrente.get()[4:-2])/(4096/3.3) print("Escala: ", w.cb_intCorrente.get()[4:-2]) print("fundo de escala: ", fe) curvePlot = np.ndarray([]) curvePlot = np.append(curvePlot, md.curve("", np.array([]), np.array([]))) spAt, cnvAt = drawCurve() curvesList = ctrl.transmition.receive(curvePlot, spAt, cnvAt, fe, float(w.et_PInicio.get()), float(w.et_PPasso.get()))#, canvas) #curvePlot = np.append(curvePlot, np.take(curvesList, 1)) ctrl.connection.closePort() #if dpv: top_level.title("VStat - " + np.take(curvePlot, 1).curveName)#dpv.curveName) #createCanvas() #spAt, cnvAt = drawCurve() createMins() def drawCurve(): global curvePlot, sp, fig createCanvas() fig = Figure(figsize=(10, 8), dpi = 100) sp = fig.add_subplot(111, xlabel="Potencial em Volts (V)", ylabel="Corrente em Microampere (µA)")#, title=cv.curveName) canvas = FigureCanvasTkAgg(fig, master = w.cv_curveGraph) toolbar = NavigationToolbar2Tk(canvas, w.fr_toolbar) if curvePlot.size == 2: cv = np.take(curvePlot, 1) sp.set_title(cv.curveName) sp.plot(cv.curveX, cv.curveY, color=cv.color) elif curvePlot.size > 2: sp.set_title("untitle merge") for i in range(1, curvePlot.size): cv = np.take(curvePlot, i) sp.plot(cv.curveX, cv.curveY, color=cv.color) toolbar.update() canvas.get_tk_widget().pack(side=tk.TOP, fill=tk.BOTH, expand=1) #canvas.draw() canvas.get_tk_widget().pack(side = tk.TOP, fill = tk.BOTH, expand = 1) return sp, canvas def expandMin(curveIndex): global curvesList, curvePlot, spAt, cnvAt cv = np.take(curvesList, curveIndex+1) curvePlot = np.ndarray([]) curvePlot = np.append(curvePlot, cv, axis=None) spAt, cnvAt = drawCurve() def createMins(): global cBoxList, curvesList, qtdMin # Apaga miniaturas existentes qtdMin = 0 destroyChildren(w.fr_miniaturas) # Cria miniaturas para cada curva na lista for i in range(1, curvesList.size): curve = np.take(curvesList, i) createMin(curve) def createMin(curve): global qtdMin, cBoxList cBoxList = np.append(cBoxList, IntVar(), axis=None) thisIndex = qtdMin relX = 0.01 if qtdMin == 0: qtdMin += 1 elif qtdMin > 0: relX = (0.152 * qtdMin) + 0.01 qtdMin += 1 # Titulo superior das miniaturas w.lb_minCurve = tk.Label(w.fr_miniaturas) w.lb_minCurve.place(relx=relX, rely=0.058, height=21, width=133) w.lb_minCurve.configure(background="#d9d9d9") w.lb_minCurve.configure(disabledforeground="#a3a3a3") w.lb_minCurve.configure(foreground="#000000") w.lb_minCurve.configure(text=curve.curveName) w.lb_minCurve.configure(width=133) w.lb_minCurve.bind("<Button-1>", lambda x:expandMin(thisIndex)) # Canvas para desenhar a miniatura w.cv_minCurve = tk.Canvas(w.fr_miniaturas) w.cv_minCurve.place(relx=relX, rely=0.165, height=112, width=133) fig = Figure(figsize=(1, 1), dpi = 100) canvas = FigureCanvasTkAgg(fig, master = w.cv_minCurve) #toolbar = NavigationToolbar2Tk(canvas, w.fr_toolbar) sp = fig.add_subplot(111) sp.plot(curve.curveX, curve.curveY) #toolbar.update() #canvas.get_tk_widget().pack(side=tk.TOP, fill=tk.BOTH, expand=1) canvas.draw() canvas.get_tk_widget().pack(side=tk.TOP, fill=tk.BOTH, expand=1) canvas.mpl_connect('button_press_event', lambda x: expandMin(thisIndex)) w.cb_chooser = tk.Checkbutton(w.cv_minCurve) w.cb_chooser.place(relx=0.075, rely=0.097, relheight=0.243, relwidth=0.211) w.cb_chooser.configure(activebackground="#ececec") w.cb_chooser.configure(activeforeground="#000000") w.cb_chooser.configure(background="#d9d9d9") w.cb_chooser.configure(disabledforeground="#a3a3a3") w.cb_chooser.configure(foreground="#000000") w.cb_chooser.configure(highlightbackground="#d9d9d9") w.cb_chooser.configure(highlightcolor="black") w.cb_chooser.configure(justify='left') w.cb_chooser.configure(variable=np.take(cBoxList, thisIndex+1)) w.fr_color = tk.Frame(w.cv_minCurve) w.fr_color.place(relx=0.752, rely=0.097, relheight=0.243, relwidth=0.188) w.fr_color.configure(relief='groove') w.fr_color.configure(borderwidth="2") w.fr_color.configure(relief='groove') w.fr_color.configure(background="#1559c6") w.fr_color.configure(width=25) w.fr_color.bind("<Button-1>", lambda e:changeColor(e, thisIndex, sp, canvas)) def destroyChildren(frame): for child in frame.winfo_children(): if child.winfo_children(): destroyChildren(child) child.destroy() def changeColor(p1, curveIndex, sp, canvas): global curvesList, curvePlot color = colorchooser.askcolor() c = str(color) c = c[-9:-2] cv = np.take(curvesList, curveIndex+1) cv.color = c sp.plot(cv.curveX, cv.curveY, c) canvas.draw() p1.widget.configure(background=cv.color) p1.widget.update() drawCurve() def curvesJoin(): global curvePlot count = 0 for i in range(1, cBoxList.size): c = np.take(cBoxList, i) if c.get(): if count < 1: cv = np.take(curvesList, i) curvePlot = np.ndarray([]) curvePlot = np.append(curvePlot, cv, axis=None) count += 1 else: cv = np.take(curvesList, i) curvePlot = np.append(curvePlot, cv, axis=None) count += 1 c.set(0) if count <= 1: w.lb_ConnInfo.configure(text="Selecione ao menos\nduas curvas") else: drawCurve() def removeCurve(): global curvesList, cBoxList, curvePlot #print("remover") i = 1 while i < cBoxList.size: c = np.take(cBoxList, i) t = np.take(curvesList, i) p = np.take(curvePlot, 1) if t is p: #print("Igual") pass #print("c: "+ str(c.get())) if c.get(): #if t is p: curvesList = np.delete(curvesList, i) cBoxList = np.delete(cBoxList, i) else: i += 1 createMins() #-----------------------------------------------------# # PAINEIS # #-----------------------------------------------------# #---- Painel DPV ----# def painelDPV(): global md_dpv destroyChildren(w.fr_analise) w.fr_analise.configure(text='''DPV''') vcmd = w.fr_analise.register(validation.entryValidate) # Inicializa entradas que serão manipuladas w.et_PInicio = tk.Entry(w.fr_analise) w.et_PFim = tk.Entry(w.fr_analise) w.et_PPasso = tk.Entry(w.fr_analise) w.et_tPasso = tk.Entry(w.fr_analise) w.lb_PInicio = tk.Label(w.fr_analise, anchor="w") w.lb_PInicio.place(relx=0.053, y=17, height=21, width=91 , bordermode='ignore') es.lbStyle(w.lb_PInicio) w.lb_PInicio.configure(text='''Pot. Inicial (V)''') w.et_PInicio.configure(validate="key") w.et_PInicio.configure(validatecommand=(vcmd, '%d', '%i', '%P', '%S', '%W')) w.et_PInicio.place(relx=0.59, y=18, height=20, width=77 , bordermode='ignore') es.etStyle(w.et_PInicio) ctrl.validation.entryInsert(w.et_PInicio, md_dpv.pIni) w.lb_PFim = tk.Label(w.fr_analise, anchor="w") w.lb_PFim.place(relx=0.053, y=43, height=21, width=91 , bordermode='ignore') es.lbStyle(w.lb_PFim) w.lb_PFim.configure(text='''Pot. Final (V)''') w.lb_PFim.configure(width=71) w.et_PFim.configure(validate="key") w.et_PFim.configure(validatecommand=(vcmd, '%d', '%i', '%P', '%S', '%W')) w.et_PFim.place(relx=0.59, y=44, height=20, width=77 , bordermode='ignore') es.etStyle(w.et_PFim) ctrl.validation.entryInsert(w.et_PFim, md_dpv.pFim) w.lb_PPasso = tk.Label(w.fr_analise, anchor="w") w.lb_PPasso.place(relx=0.053, y=69, height=21, width=91 , bordermode='ignore') es.lbStyle(w.lb_PPasso) w.lb_PPasso.configure(text='''Pot. Passo (V)''') w.lb_PPasso.configure(width=81) w.et_PPasso.configure(validate="key") w.et_PPasso.configure(validatecommand=(vcmd, '%d', '%i', '%P', '%S', '%W')) w.et_PPasso.place(relx=0.59, y=70, height=20, width=77 , bordermode='ignore') es.etStyle(w.et_PPasso) ctrl.validation.entryInsert(w.et_PPasso, md_dpv.pPas) w.lb_PPulso = tk.Label(w.fr_analise, anchor="w") w.lb_PPulso.place(relx=0.053, y=95, height=21, width=91 , bordermode='ignore') es.lbStyle(w.lb_PPulso) w.lb_PPulso.configure(text='''Pot. Pulso (V)''') w.et_PPulso = tk.Entry(w.fr_analise, validate="key", validatecommand=(vcmd, '%d', '%i', '%P', '%S', '%W')) w.et_PPulso.place(relx=0.59, y=96, height=20, width=77 , bordermode='ignore') es.etStyle(w.et_PPulso) ctrl.validation.entryInsert(w.et_PPulso, md_dpv.pPul) w.lb_TPulso = tk.Label(w.fr_analise, anchor="w") w.lb_TPulso.place(relx=0.053, y=121, height=21, width=91 , bordermode='ignore') es.lbStyle(w.lb_TPulso) w.lb_TPulso.configure(text='''Tem. Pulso (s)''') w.lb_TPulso.configure(width=91) w.et_TPulso = tk.Entry(w.fr_analise, validate="key", validatecommand=(vcmd, '%d', '%i', '%P', '%S', '%W')) w.et_TPulso.place(relx=0.59, y=122, height=20, width=77 , bordermode='ignore') es.etStyle(w.et_TPulso) ctrl.validation.entryInsert(w.et_TPulso, md_dpv.tPul) w.lb_tPasso = tk.Label(w.fr_analise, anchor="w") w.lb_tPasso.place(relx=0.053, y=147, height=21, width=91 , bordermode='ignore') es.lbStyle(w.lb_tPasso) w.lb_tPasso.configure(text='''Tem. Passo (s)''') w.et_tPasso.configure(validate="key") w.et_tPasso.configure(validatecommand=(vcmd, '%d', '%i', '%P', '%S', '%W')) w.et_tPasso.place(relx=0.59, y=148, height=20, width=77 , bordermode='ignore') es.etStyle(w.et_tPasso) ctrl.validation.entryInsert(w.et_tPasso, md_dpv.tPas) w.lb_tEquil = tk.Label(w.fr_analise, anchor="w") w.lb_tEquil.place(relx=0.053, y=173, height=21, width=110 , bordermode='ignore') es.lbStyle(w.lb_tEquil) w.lb_tEquil.configure(text='''Tem. equilíbrio (s)''') w.et_tEquil = tk.Entry(w.fr_analise, validate="key", validatecommand=(vcmd, '%d', '%i', '%P', '%S', '%W')) w.et_tEquil.place(relx=0.59, y=174, height=20, width=77 , bordermode='ignore') es.etStyle(w.et_tEquil) ctrl.validation.entryInsert(w.et_tEquil, md_dpv.tEqu) w.lb_currentRange = tk.Label(w.fr_analise, anchor="w") w.lb_currentRange.place(relx=0.053, y=199, height=21, width=91 , bordermode='ignore') es.lbStyle(w.lb_currentRange) w.lb_currentRange.configure(text='''Int. Corrente''') w.cb_intCorrente = ttk.Combobox(w.fr_analise) w.cb_intCorrente.place(relx=0.59, y=183, height=20, width=77) w.cb_intCorrente.configure(values=["auto","+/- 5uA","+/- 10uA","+/- 20uA", "+/- 50uA"]) w.cb_intCorrente.current(md_dpv.fEsc) w.lb_sRate = tk.Label(w.fr_analise, anchor="w") w.lb_sRate.place(relx=0.053, y=225, height=21, width=110 , bordermode='ignore') es.lbStyle(w.lb_sRate) w.lb_sRate.configure(text='''SRate (V/s)''') w.et_sRate = tk.Entry(w.fr_analise, state="disabled") w.et_sRate.place(relx=0.59, y=226, height=20, width=77 , bordermode='ignore') w.lb_tEstimado = tk.Label(w.fr_analise, anchor="w") w.lb_tEstimado.place(relx=0.053, y=251, height=21, width=110 , bordermode='ignore') es.lbStyle(w.lb_tEstimado) w.lb_tEstimado.configure(text='''Tem. Estimado (s)''') w.et_tEstimado = tk.Entry(w.fr_analise, state="disabled") w.et_tEstimado.place(relx=0.59, y=252, height=20, width=77 , bordermode='ignore') w.lb_nPontos = tk.Label(w.fr_analise, anchor="w") w.lb_nPontos.place(relx=0.053, y=277, height=21, width=110 , bordermode='ignore') es.lbStyle(w.lb_nPontos) w.lb_nPontos.configure(text='''Nº Pontos''') w.et_nPontos = tk.Entry(w.fr_analise, state="disabled") w.et_nPontos.place(relx=0.59, y=278, height=20, width=77 , bordermode='ignore') w.btn_dpv = tk.Button(w.fr_analise) w.btn_dpv.place(relx=0.063, y=315, height=24, relwidth=0.88 , bordermode='ignore') es.btnStyle(w.btn_dpv) w.btn_dpv.configure(text='''Iniciar''') w.btn_dpv.configure(width=167) w.btn_dpv.bind('<ButtonRelease-1>',lambda e:btn_iniciar(e)) validation.updateInfo(float(w.et_PInicio.get()), float(w.et_PFim.get()), float(w.et_PPasso.get()), float(w.et_tPasso.get())) #---- Operações de tratamento da curva ----# def op_frame2param(frName, p1Name, p1Value, p2Name, p2Value, callback): destroyChildren(w.fr_analise) w.fr_analise.configure(text=frName) vcmd = w.fr_analise.register(validation.entryValidate) w.lb_Param1 = tk.Label(w.fr_analise, anchor="w") w.lb_Param1.place(relx=0.053, y=17, height=21, width=91 , bordermode='ignore') es.lbStyle(w.lb_Param1) w.lb_Param1.configure(text=p1Name) w.et_Param1 = tk.Entry(w.fr_analise, validate="key", validatecommand=(vcmd, '%d', '%i', '%P', '%S', '%W')) w.et_Param1.place(relx=0.59, y=18, height=20, width=74 , bordermode='ignore') es.etStyle(w.et_Param1) w.et_Param1.configure(width=74) ctrl.validation.entryInsert(w.et_Param1, p1Value) w.lb_Param2 = tk.Label(w.fr_analise, anchor="w") w.lb_Param2.place(relx=0.053, y=43, height=21, width=91 , bordermode='ignore') es.lbStyle(w.lb_Param2) w.lb_Param2.configure(text=p2Name) w.et_Param2 = tk.Entry(w.fr_analise, validate="key", validatecommand=(vcmd, '%d', '%i', '%P', '%S', '%W')) w.et_Param2.place(relx=0.59, y=44, height=20, width=74 , bordermode='ignore') es.etStyle(w.et_Param2) ctrl.validation.entryInsert(w.et_Param2, p2Value) w.btn_Apply = tk.Button(w.fr_analise) w.btn_Apply.place(relx=0.063, y=315, height=24, relwidth=0.88 , bordermode='ignore') es.btnStyle(w.btn_Apply) w.btn_Apply.configure(text='''Aplicar''') w.btn_Apply.configure(width=167) w.btn_Apply.bind('<ButtonRelease-1>',lambda x:aplicar(callback, (w.et_Param1.get(), w.et_Param2.get()))) def fd_PEAK(): global curvePlot, spAt, cnvAt if curvePlot.size == 2: cv = np.take(curvePlot, 1) i = ctrl.operations.findPeak(cv.curveY) spAt.scatter(cv.curveX[i],cv.curveY[i]) cnvAt.draw() w.lb_ConnInfo.configure(text="PICO\nPotencial = "+str(float("{0:.4f}".format(cv.curveX[i])))+"V\nCorrente = "+str(float("{0:.3f}".format(cv.curveY[i])))+"uA") elif curvePlot.size > 2: w.lb_ConnInfo.configure(text="Ainda não é possível\nanalisar curvas unidas") elif curvePlot.size < 2: w.lb_ConnInfo.configure(text="Selecione uma curva") def aplicar(callback, args): global curvePlot, curvesList if curvePlot.size == 2: c = np.take(curvePlot, 1) y = callback(c.curveY, *args) c2 = md.curve(c.curveName+"_"+callback.__name__, c.curveX, y) c2.curveX = c.curveX c2.curveY = y curvePlot = np.ndarray([]) curvePlot = np.append(curvePlot, c2, axis=None) drawCurve() curvesList = np.append(curvesList, c2, axis=None) createMins() elif curvePlot.size > 2: w.lb_ConnInfo.configure(text="Ainda não é possível\nanalisar curvas unidas") elif curvePlot.size < 2: w.lb_ConnInfo.configure(text="Selecione uma curva") """ apagar filhos de um frame for child in infoFrame.winfo_children(): child.destroy() """
StarcoderdataPython
1659020
<gh_stars>10-100 ############################################################################ # Copyright (c) 2015 Saint Petersburg State University # Copyright (c) 2011-2014 Saint Petersburg Academic University # All Rights Reserved # See file LICENSE for details. ############################################################################ import os import itertools # There exists pyfasta package -- http://pypi.python.org/pypi/pyfasta/ # Use it ! def get_lengths_from_fastafile(filename): """ Gets filename of FASTA-file Returns list of lengths of sequences in FASTA-file """ lengths = [] l = 0 for line in open(filename): if line[0] == '>': if l: # not the first sequence in FASTA lengths.append(l) l = 0 else: l += len(line.strip()) lengths.append(l) return lengths def split_fasta(filename, outputdir): """ Gets filename of FASTA-file and directory to output Creates separate FASTA-files for each sequence in FASTA-file Returns nothing Oops, similar to: pyfasta split --header "%(seqid).fasta" original.fasta """ if not os.path.isdir(outputdir): os.mkdir(outputdir) outFile = None for line in open(filename): if line[0] == '>': if outFile: outFile.close() outFile = open(os.path.join(outputdir, line[1:].strip() + '.fa'), 'w') if outFile: outFile.write(line) if outFile: # if filename is empty outFile.close() def read_fasta(filename): """ Returns list of FASTA entries (in tuples: name, seq) """ res_name = [] res_seq = [] first = True seq = '' fastafile = filename file_ext = os.path.splitext(filename)[1] if file_ext == ".gz": import gzip fastafile = gzip.open(filename) else: fastafile = open(filename) for line in fastafile: if line[0] == '>': res_name.append(line.strip()) if not first: res_seq.append(seq) else: first = False seq = '' else: seq += line.strip() res_seq.append(seq) return zip(res_name, res_seq) def write_fasta(fasta): for name, seq in fasta: print (name) for i in xrange(0,len(seq),60): print (seq[i:i+60]) def write_fasta_to_file(filename, fasta): outfile = open(filename, 'a') for name, seq in fasta: outfile.write(name + '\n') for i in xrange(0,len(seq),60): outfile.write(seq[i:i+60] + '\n') outfile.close() def comp(letter): return {'A': 'T', 'T': 'A', 'C': 'G', 'G': 'C'}[letter.upper()] def rev_comp(seq): return ''.join(itertools.imap(comp, seq[::-1])) def remove_nonACGT(seq): seq2 = [] for c in seq: if c in 'ACGT': seq2.append(c) return string.join(seq2, '')
StarcoderdataPython
3267868
t1 = (5,6,2,1) del t1 print(t1)
StarcoderdataPython
1665328
<gh_stars>1-10 ''' Handles and formats chat events ''' class Handler(): '''handles chat events''' def __init__(self, config, chat): self.config = config self.event_types = { 'reply': self.type_reply, 'event': self.type_event, 'method': self.type_method, 'system': self.type_system} self.poll_switch = True self.chat = chat def formatting(self, data): ''' checks the event type and calls the function relating to that event type ''' func = self.event_types[data['type']] func(data) if self.config.CHATDEBUG: print(data) def type_reply(self, data): '''Handles the Reply type data''' if 'data' in data: if 'authenticated' in data['data']: if data['data']['authenticated']: print('Authenticated with the server') else: print('Authenticated Failed, Chat log restricted') else: print('Server Reply: {}'.format(str(data))) else: print('Server Reply: {}'.format(str(data['error']))) def type_event(self, data): '''handles the reply chat event types''' event_string = { 'WelcomeEvent': 'Connected to the channel chat...', 'UserJoin': '{} has joined the channel.', 'UserLeave': '{} has left the channel.', 'ChatMessage': '{user} : {msg}', 'whisper': '{user} → {target} : {msg}', 'me': '{user} {msg}', 'PollStart': '{} has started a poll', 'PollEnd': 'The poll started by {} has ended'} if data['event'] == 'WelcomeEvent': print(event_string[data['event']]) elif data['event'] == 'UserJoin' or data['event'] == 'UserLeave': if data['data']['username'] is not None: print(event_string[data['event']].format( data['data']['username'])) elif data['event'] == 'PollStart': if self.poll_switch: print(event_string[data['event']].format( data['data']['author']['user_name'])) self.poll_switch = False elif data['event'] == 'PollEnd': print(event_string[data['event']].format( data['data']['author']['user_name'])) self.poll_switch = True elif data['event'] == 'ChatMessage': msg = ''.join( item["text"] for item in data['data']["message"]["message"]) if 'whisper' in data['data']['message']['meta']: print(event_string['whisper'].format( user=data['data']['user_name'], target=data['data']['target'], msg=msg)) elif 'me' in data['data']['message']['meta']: print(event_string['me'].format( user=data['data']['user_name'], msg=msg)) else: print(event_string[data['event']].format( user=data['data']['user_name'], msg=msg)) if msg == '!ping': self.chat.message('Its ping pong time') def type_method(self, data): '''handles the reply chat event types''' if self.config.CHATDEBUG: if data['method'] == 'auth': print('Authenticating with the server...') elif data['method'] == 'msg': if self.config.CHATDEBUG: print('METHOD MSG: {}'.format(str(data))) else: print('METHOD MSG: {}'.format(str(data))) def type_system(self, data): '''handles the reply chat event types''' if self.config.CHATDEBUG: print('SYSTEM MSG: {}'.format(str(data['data'])))
StarcoderdataPython
1664885
<gh_stars>1-10 from metrics.base_classification_scorer_factory import BaseClassificationScorerFactory from metrics.result_scorer_auc_macro import ResultScorerAucMacro from metrics.result_scorer_f1_macro import ResultScorerF1Macro class ResultScorerAucMacroFactory(BaseClassificationScorerFactory): """ Factory for F1 results_scorer """ def get(self): return ResultScorerAucMacro()
StarcoderdataPython
4834806
# # Licensed under the Apache License, Version 2.0 (the "License"); you may # not use this file except in compliance with the License. You may obtain # a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, WITHOUT # WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the # License for the specific language governing permissions and limitations # under the License. """Starter script for magnum-driver-manage.""" import sys from cliff import app from cliff import commandmanager from cliff import lister import magnum.conf from magnum.drivers.common import driver from magnum import version CONF = magnum.conf.CONF class DriverList(lister.Lister): """List templates""" def _print_rows(self, parsed_args, rows): fields = ['name'] field_labels = ['Name'] if parsed_args.details: fields.extend(['server_type', 'os', 'coe']) field_labels.extend(['Server_Type', 'OS', 'COE']) if parsed_args.paths: fields.append('path') field_labels.append('Template Path') return field_labels, [tuple([row[field] for field in fields]) for row in rows] def get_parser(self, prog_name): parser = super(DriverList, self).get_parser(prog_name) parser.add_argument('-d', '--details', action='store_true', dest='details', help=('display the cluster types provided by ' 'each template')) parser.add_argument('-p', '--paths', action='store_true', dest='paths', help='display the path to each template file') return parser def take_action(self, parsed_args): rows = [] for entry_point, cls in driver.Driver.load_entry_points(): name = entry_point.name definition = cls().get_template_definition() template = dict(name=name, path=definition.template_path) if parsed_args.details: for cluster_type in cls().provides: row = dict() row.update(template) row.update(cluster_type) rows.append(row) else: rows.append(template) return self._print_rows(parsed_args, rows) class DriverCommandManager(commandmanager.CommandManager): COMMANDS = { "list-drivers": DriverList, } def load_commands(self, namespace): for name, command_class in self.COMMANDS.items(): self.add_command(name, command_class) class DriverManager(app.App): def __init__(self): super(DriverManager, self).__init__( description='Magnum Driver Manager', version=version.version_info, command_manager=DriverCommandManager(None), deferred_help=True) def main(args=None): if args is None: args = sys.argv[1:] CONF([], project='magnum', version=version.version_info.release_string()) return DriverManager().run(args)
StarcoderdataPython
3399829
import torch from functions import create_model class Checkpoint: def __init__(self, model_state_dict, class_to_idx, arch, hidden_units): self.model_state_dict = model_state_dict self.class_to_idx = class_to_idx self.architecture = arch self.hidden_units = hidden_units def save_checkpoint(model, class_to_idx, save_directory, arch, hidden_units): checkpoint = Checkpoint(model.state_dict(), class_to_idx, arch, hidden_units) torch.save(checkpoint, save_directory) def load_checkpoint(checkpoint_directory): checkpoint = torch.load(checkpoint_directory) model = create_model(checkpoint.architecture, checkpoint.hidden_units) model.load_state_dict(checkpoint.model_state_dict) model.class_to_idx = checkpoint.class_to_idx return model
StarcoderdataPython
1620445
<reponame>voytekresearch/omapping<filename>om/meg/group.py """MEG-DATA Analysis Module - Group""" import os import pickle import datetime import numpy as np import scipy.io as sio from scipy.stats.stats import pearsonr from om.meg.single import MegSubj from om.core.osc import check_bands from om.core.errors import DataNotComputedError, InconsistentDataError, UnknownDataTypeError ################################################################################################### ################################################################################################### class MegGroup(MegSubj): """A class to store OMEGA data from multiple subjects. Holds all oscillations, regardless of spatial location. Attributes ---------- n_subjs : int The number of subjects included in the group data. subjs : list of int List of the subject numbers included in current group data. bands : Osc() object Stores labels and band definitions of oscillation bands. n_oscs_tot : int Total number of oscillations found across all subjects. comment : str A note about the data, label about data that is loaded. gr_oscs : dict All oscillations, in bands, for all subjects [n_verts, n_oscs, n_subjs]. osc_probs : dict Oscillation probability for each oscillation band, for each vertex. osc_pow_ratios : dict Oscillation power ratios for each oscillation band, for each vertex. osc_scores : dict Oscillation scores for each oscillation band, for each vertex. vert_exponents : 2d array Aperiodic exponent values for each subject, at each vertex [n_verts, n_subjs]. exponent_gr_avg : 1d array Average aperiodic exponent values across subjects for each vertex. osc_prob_done : boolean Whether oscillation probability has been calculated. osc_power_done : boolean Whether oscillation power ratio has been calculated. osc_score_done : boolean Whether oscillation score has been calculated. """ def __init__(self, db, osc): """Initialize object with omegamappin database, and oscillation definitions. Parameters ---------- db : OMDB() object Database object for omegamappin project. osc : Osc() object Object to store oscillatory band definitions. """ # Initialize from MegSubj() object MegSubj.__init__(self, db, 'both') # Initialize groups subject variables self.n_subjs = int() self.subjs = [] # Update variable types for demographic self.sex = list() self.age = np.array([]) # Set definition of oscillation bands used for the group self.bands = osc.bands # Initialize count of total oscillations, across all subjects self.n_oscs_tot = int() # Set comment for data, can be used for plotting self.comment = 'Group' # Initialize dictionary for oscillation band data self.gr_oscs = dict() # Initilaize dictionary to store oscillation probabilities self.osc_probs = dict() # Initialize dict to store oscillation power ratios self.osc_pow_ratios = dict() # Initialize to store oscillation scores self.osc_scores = dict() # Initialize vars to store exponent values self.vert_exponents = np.array([]) self.exponent_gr_avg = np.array([]) # Set booleans for what has been run self.osc_prob_done = False self.osc_power_done = False self.osc_score_done = False def __len__(self): return self.n_subjs def add_subject(self, new_subj, add_vertex_oscs=False, add_vertex_exponents=False, add_all_oscs=False, add_vertex_bands=False, add_peak_freqs=False, add_demo=False): """Adds a new subject to the MegGroup object. Parameters ---------- new_subj : MegSubj() Object MEG subject (instance of MegSubj) add_vertex_oscs : boolean, optional (default: False) Whether to add all oscillations, across vertices. add_vertex_exponents : boolean, optional (default: False) Whether to add the aperiodic exponents. add_all_oscs : boolean, optional (default: False) Whether to add the vectors of all oscillations, collapsed across vertices. add_vertex_bands : boolean, optional (default: False) Whether to add the oscillation band data, across vertices. add_peak_freqs : boolean, optional (default: False) Whether to add peak frequencies. add_demo : boolean, optional (default: False) Whether to add demographic information. """ # Check if subject has data if not new_subj.has_data: raise DataNotComputedError("Empty meg data object. Cannot add data.") # Add oscillations per vertex if add_vertex_oscs: # Check new subject has relevant data if not new_subj.has_vertex_oscs: raise DataNotComputedError('New subject does not have vertex osc data.') if not self.has_data: # Add data to group object self.centers = new_subj.centers self.powers = new_subj.powers self.bws = new_subj.bws # Update that group contains this data self.has_vertex_oscs = True else: # Check that group has data defined if not self.has_vertex_oscs: raise DataNotComputedError('MEG Group does not include vertex osc data.') # Add data to group object self.centers = np.dstack([self.centers, new_subj.centers]) self.powers = np.dstack([self.powers, new_subj.powers]) self.bws = np.dstack([self.bws, new_subj.bws]) # Add exponents per vertex if add_vertex_exponents: # Check new subject has relevant data if not new_subj.has_vertex_exponents: raise DataNotComputedError('New subject does not have vertex exponent data.') if not self.has_data: # Add data to group object self.vert_exponents = new_subj.exponents # Update that group contains this data self.has_vertex_exponents = True else: # Check that group has data defined if not self.has_vertex_exponents: raise DataNotComputedError('MEG Group does not include vertex exponent data.') # Add data to group object self.vert_exponents = np.hstack([self.vert_exponents, new_subj.exponents]) # Add All-Osc Data if add_all_oscs: # Check that new subject has all_osc data available if not new_subj.has_all_osc: raise DataNotComputedError('New subject does not have all osc data.') # Check that group has data defined if self.has_data: if not self.has_all_osc: raise DataNotComputedError('MEG Group does not include all osc data.') # Add oscillation parameters to current data self.centers_all = np.append(self.centers_all, new_subj.centers_all) self.bws_all = np.append(self.bws_all, new_subj.bws_all) self.powers_all = np.append(self.powers_all, new_subj.powers_all) self.exponents = np.append(self.exponents, new_subj.exponents) # Add centers hist self.centers_hist.append(new_subj.centers_hist) # Update count of total number of oscillations self.n_oscs = np.append(self.n_oscs, new_subj.n_oscs) self.n_oscs_tot = len(self.centers_all) # If first subject, update what kind of data is loaded if not self.has_data: self.has_all_osc = True # Add band-specific data if add_vertex_bands: # Check that new subject has vertex bands data if not new_subj.has_vertex_bands: raise DataNotComputedError('New subject does not have vertex band data.') # Check that new subject has same bands defined _ = check_bands([self.bands, new_subj.bands]) # Add new subject to group oscillations if not self.has_data: # Add data to group object self.gr_oscs = new_subj.oscs # Update that group contains this data self.has_vertex_bands = True else: # Check that group has data defined if not self.has_vertex_bands: raise DataNotComputedError('MEG Group does not include vertex band data.') # Add data to group object for band in self.bands: self.gr_oscs[band] = np.dstack([self.gr_oscs[band], new_subj.oscs[band]]) # Add oscillation peak data if add_peak_freqs: # Check that new subject has peak frequency data if not new_subj.has_peak_freqs: raise DataNotComputedError('New subject does not have peak freq data.') # Check that new subject has same bands defined _ = check_bands([self.bands, new_subj.bands]) # Add new subject to peak frequencies if not self.has_data: # Add data to group object self.peaks = new_subj.peaks # Update that group contains this data self.has_peak_freqs = True else: # Check that group has data defined if not self.has_peak_freqs: raise DataNotComputedError('MEG Group does not include peak freq data.') # Add data to group object for band in self.bands: self.peaks[band] = np.append(self.peaks[band], new_subj.peaks[band]) # Add demographic data if add_demo: # Check that incoming subject has demo data if not new_subj.has_demo: raise DataNotComputedError('Demographic data not available') # Check that group has data defined if self.has_data: if not self.has_demo: raise DataNotComputedError('MEG Group does not include demo data.') # Add demographic data to group object self.sex.append(new_subj.sex) self.age = np.append(self.age, new_subj.age) # If first subject, update what kind of data is loaded if not self.has_data: self.has_demo = True # If first subject, update that object has data if self.n_subjs == 0: self.has_data = True # Update subj count and subject number list self.n_subjs += 1 self.subjs.append(new_subj.subnum) # Check consistency of group data self.check_consistency() def check_consistency(self): """Check for consistency of data loaded in group object.""" n_vertices = 7501 if self.n_subjs != len(self.subjs): raise InconsistentDataError('Discrepancy in subject numbers.') if self.has_vertex_oscs: if self.n_subjs > 1: assert self.centers.shape == (n_vertices, 8, self.n_subjs) assert self.powers.shape == (n_vertices, 8,self.n_subjs) assert self.bws.shape == (n_vertices, 8,self.n_subjs) if self.has_vertex_exponents: assert self.vert_exponents.shape == (n_vertices, self.n_subjs) if self.has_all_osc: pass if self.has_vertex_bands: pass if self.has_peak_freqs: pass if self.has_demo: pass def group_exponent(self, avg='mean'): """Calculates the average exponent value for each vertex, across subjects. Parameters ---------- avg : {'mean', 'median'}, optional How to average across the group. """ # Calculate the average exponent value per vertex if avg is 'mean': self.exponent_gr_avg = np.mean(self.vert_exponents, 1) elif avg is 'median': self.exponent_gr_avg = np.median(self.vert_exponents, 1) def osc_prob(self): """Calculates the probability of an osc in a specific band. This is done per vertex, across subjects. """ # Check if vertex data is set if not self.has_vertex_bands: raise DataNotComputedError('Vertex oscillation bands data not available.') # For each oscillation band, compute the probability of an oscillation in that band - NEW for band in self.bands: self.osc_probs[band] = _osc_prob(self.gr_oscs[band]) # Update boolean that oscillation probability has been computed self.osc_prob_done = True def osc_power(self): """Calculate the oscillation power ratio for each frequency band.""" # Check if vertex data is set if not self.has_vertex_bands: raise DataNotComputedError('Vertex oscillation bands data not available.') # Compute power ratio for each oscillation band for band in self.bands: self.osc_pow_ratios[band] = _osc_pow_ratio(self.gr_oscs[band]) # Set boolean that oscillation score has been computed. self.osc_power_done = True def osc_score(self): """Calculate the oscillation score for each frequency band. The oscillation score is .... """ # Check if oscillation probability & power ratios are calculated. # Can not proceed if they are not. _ = self._get_map_type('prob') _ = self._get_map_type('power') # Compute oscillation score for each oscillation band for band in self.bands: self.osc_scores[band] = self.osc_pow_ratios[band] * self.osc_probs[band] # Set boolean that oscillation score has been computed. self.osc_score_done = True def osc_map_corrs(self, map_type): """Calculates the correlations between oscillation probabilities or scores. Parameters ---------- map_type : {'prob', 'score', 'power'} Which map data type to save out. Returns ------- corrs_mat : 2d array Correlation R-values matrix, across all oscillation bands. ps_mat : 2d array Correlations p-values matrix, across all oscillation bands. sorted_bands : list of str Oscillation band labels, sorted into order. """ # Check how many oscillation bands are defined n_bands = len(self.bands) # Initialize matrices to store correlation results corrs_mat = np.zeros([n_bands, n_bands]) ps_mat = np.zeros([n_bands, n_bands]) # Get oscillation bands in order sorted_bands, sort_inds = _band_sort(self.bands) # Set which map to run dat = self._get_map_type(map_type) # Loop through all bands, computing correlations between them for i in range(n_bands): for j in range(n_bands): corrs_mat[i, j], ps_mat[i, j] = pearsonr( dat[sorted_bands[i]], dat[sorted_bands[j]]) # Set diagonals to zero - where band is correlated with itself np.fill_diagonal(corrs_mat, 0) np.fill_diagonal(ps_mat, 0) return corrs_mat, ps_mat, sorted_bands def calc_osc_peak_age(self): """Compares age and peak frequency within frequency bands. NOTE: ADD CHECKS THAT REQUIRED DATA HAS BEEN COMPUTED. Returns ------- corrs_mat : 1d array Correlations R-values comparing age to oscillations. ps_mat : 1d array Correlations p-values from comparing age to oscillations. sorted_bands : list of str Oscillation band labels, sorted into order. """ # Check how many bands there are n_bands = len(self.bands) # Initialize matrices to store correlation results corrs_mat = np.zeros([n_bands]) ps_mat = np.zeros([n_bands]) # Get oscillation bands in order sorted_bands, sort_inds = _band_sort(self.bands) # Loop through all oscillation peaks, calculation correlation with age for i in range(n_bands): corrs_mat[i], ps_mat[i] = pearsonr( self.age, self.peaks[sorted_bands[sort_inds[i]]]) return corrs_mat, ps_mat, sorted_bands def save_gr_exponent(self, file_name): """Saves out the average group exponent results. Parameters ---------- file_name : str File name to save group exponent file as. """ # Set up pickle_file_name = file_name + '.p' pickle_save_name = os.path.join(self.db.maps_path, 'Exponents', pickle_file_name) # Check current time for when file is saved cur_time = datetime.datetime.now().strftime("%Y-%m-%d_%H-%M-%S") # Collect data together to save out dat_out = dict({'dat_source': self.dat_source, 'exponents': self.exponent_gr_avg, 'n_subjs': self.n_subjs, 'save_time': cur_time}) # Save out with pickle pickle.dump(dat_out, open(pickle_save_name, 'wb')) def save_map(self, map_type, file_name): """Save oscillation map data out to disc. Parameters ---------- map_type : {'prob', 'score', 'power'} Which map data type to save out. file_name : str String to add to the file name. """ # Set which map to run dat = self._get_map_type(map_type) # Check current time for when file is saved cur_time = datetime.datetime.now().strftime("%Y-%m-%d_%H-%M-%S") # Set file name, and create full file path pickle_file_name = file_name + '_Osc_' + map_type + '.p' pickle_save_name = os.path.join(self.db.maps_path, 'Oscs', pickle_file_name) # Collect data together to save out dat_out = dict({'dat_source': self.dat_source, 'map_type': map_type, 'osc_dat': dat, 'bands':self.bands, 'n_subjs': self.n_subjs, 'save_time': cur_time}) # Save out with pickle pickle.dump(dat_out, open(pickle_save_name, 'wb')) def set_exponent_viz(self): """Saves out a matfile, of the group average exponent, for visualization.""" # Set up paths to save to save_name = 'Group_Exponents' save_file = os.path.join(self.db.viz_path, save_name) # Save desired outputs into a dictionary save_dict = {} save_dict['exponents'] = self.exponent_gr_avg save_dict['dat_source'] = self.dat_source save_dict['n_subjs'] = self.n_subjs save_dict['save_time'] = datetime.datetime.now().strftime("%Y-%m-%d_%H-%M-%S") # Save the dicionary out to a .mat file sio.savemat(save_file, save_dict) def set_fooof_viz(self): """Set FOOOF features to visualize. TODO """ pass def set_map_viz(self, map_type, file_name): """Save out an oscillation map for visualization with Brainstorm. Parameters ---------- map_type : {'prob', 'score', 'power'} Which map data type to set as viz. file_name : str Label to attach to file name to be saved out. """ # Set which map to run dat = self._get_map_type(map_type) # Set up the save name save_name = file_name + '_group_osc_' + map_type + '_viz' # Set up paths to save to save_file = os.path.join(self.db.viz_path, save_name) # Initialize dictionary to save out, and save basic info save_dict = {} save_dict['dat_source'] = self.dat_source save_dict['map_type'] = map_type save_dict['n_subjs'] = self.n_subjs save_dict['save_time'] = datetime.datetime.now().strftime("%Y-%m-%d_%H-%M-%S") # Add maps to save dictionary for band in self.bands: save_dict[band.lower() + '_' + map_type] = dat[band] # Save out the dictionary to a mat file sio.savemat(save_file, save_dict) def _get_map_type(self, map_type): """Pull out specific MEG map type. Parameters ---------- map_type : {'prob', 'score', 'power'} Oscillation map type to pull out. """ # Check if requested map is prob, and if it is calculated if map_type is 'prob': # Check if oscillation probabilities have been calculated. if not self.osc_prob_done: raise DataNotComputedError("Oscillation probability not computed - can not proceed.") dat = self.osc_probs # Check if requested map is score, and if it is calculated elif map_type is 'score': # Check if oscillation score has been calculated. if not self.osc_score_done: raise DataNotComputedError("Oscillation score not computed - can not proceed.") dat = self.osc_scores # Check if requested map is power ratio, and if it is calculated elif map_type is 'power': # Check if oscillation power map has been calculated. if not self.osc_power_done: raise DataNotComputedError("Oscillation power map not computed - can not proceed.") dat = self.osc_pow_ratios # Raise an error if requested type doensn't match a known map type else: raise UnknownDataTypeError('Map type not understood.') return dat ######################################################################################################### ################################## OMEGAMAPPIN - MEG GROUP - FUNCTIONS ################################## ######################################################################################################### def freq_corr_group(centers, f_win, f_step=1): """Calculates the correlation between adjacent frequency bands. Parameters ---------- centers : 3d array [n_verts, n_slots, n_subjs] Center frequencies of oscillations across all vertices & subjects. f_win : float Size of frequency window to use. f_step : float Increment to step by. Returns ------- corr_vec : 1d array Vector of the correlation coefficients between all adjacent frequency bands. p_vec : 1d array Vector of the p-values for the correlations between adjacent frequency bands. freqs : 1d array Vector of frequencies of the correlations (each value is first frequency of first bin). Each frequency 'f' reflects the correlation of [f:f+f_win, f+f_win:f+2*f_win]. """ # Get # vertices, # of subjects to loop through ind_step = int(f_win / f_step) [n_vertex, n_slots, n_subj] = np.shape(centers) # Initialize variables for freqs, # of freqs, and matrix to store probability freqs = np.arange(3, 40-f_win, f_step) n_freqs = len(freqs) prob_mat = np.zeros([n_vertex, n_freqs]) # Loop across all vertices and subjects for vertex in range(n_vertex): for subj in range(n_subj): # Store centers for current vertex, current subj in temp vector cens_temp = centers[vertex, :, subj] # Loop through freq-ranges, counting when oscillations occur for ind, freq in enumerate(freqs): # Get the oscillation centers cens_fwin = _get_all_osc(cens_temp, freq, freq+f_win) # If there is an osc in range, add to prob_mat count if len(cens_fwin) != 0: prob_mat[vertex, ind] += 1 # Divide by # of subjects to get probability per freq-range prob_mat = prob_mat/n_subj # Initialize vectors to store correlations and p-values corr_vec = np.zeros([n_freqs-1]) p_vec = np.zeros([n_freqs-1]) # Compute corr between f and f+f_win start windows for f_ind in range(n_freqs-ind_step): corr_vec[f_ind], p_vec[f_ind] = pearsonr(prob_mat[:, f_ind], prob_mat[:, f_ind+ind_step]) # Select frequency range that represents the start of each correlation freqs = freqs[:-1] return corr_vec, p_vec, freqs def osc_space_group(oscs, bands, verts, osc_param=0, space_param=1): """ Parameters ---------- oscs : dict() xx bands : ? xx verts : 2d array Spatial coordinates for all vertices [n_verts, 3]. osc_param : ? xx space_param : ? xx Returns ------- dat_out : 3d array Correlation data for all subjects, all bands. [n_subjs, n_bands, 2], where last dimension is [R-val, p-val]. labels : list of str Labels of oscillation bands that were analyzed in dat_out. """ labels = list(bands.keys()) n_verts, n_bands, n_subjs = oscs[labels[0]].shape space = verts[:, space_param] dat_out = np.zeros(shape=(n_subjs, len(bands), 2)) for subj in range(n_subjs): for ind, band in enumerate(bands): cur_dat = oscs[band][:, osc_param, subj] keep_inds = cur_dat > 0 dat_out[subj, ind, :] = pearsonr(cur_dat[keep_inds], space[keep_inds]) return dat_out, labels ################################################################################################# ############################ OMEGAMAPPIN - OM_MD - PRIVATE FUNCTIONS ############################ ################################################################################################# def _get_all_osc(centers, osc_low, osc_high): """Returns all the oscillations in a specified frequency band. Parameters ---------- centers : 1d array Vector of oscillation centers. osc_low : int Lower bound for frequency range. osc_high : int Upper bound for frequency range. Returns ------- osc_cens : 1d array Osc centers in specified frequency band. """ # Get inds of desired oscs and pull out from input data osc_inds = (centers >= osc_low) & (centers <= osc_high) osc_cens = centers[osc_inds] return osc_cens def _osc_prob(osc_mat): """Takes a 3D matrix of oscillations across subjects, calculates probability of oscillation. Parameters ---------- osc_mat : 3d array Oscillations for each subject, [n_vertex, n_dim, n_subj]. Returns ------- prob : 1d array Vector with probability of given oscillation at each vertex. """ # Check how many vertices and subjects in group [n_vertex, n_dim, n_subj] = np.shape(osc_mat) # Initialize vector to store probabilities prob = np.zeros([n_vertex]) # Loop through all vertices, calculating osc prob for each for i in range(n_vertex): prob[i] = (np.count_nonzero(osc_mat[i, 0, :]) / n_subj) return prob def _osc_pow_ratio(osc_mat): """Calculate the power ratio of an oscillation. Power ratio is a score, bounded between [0, 1], reflecting power in a given frequency band, relative to the max power in that frequency band. Parameters ---------- osc_mat : 3d array Oscillations for each subject, [n_vertex, n_dim, n_subj]. Returns ------- pow_ratio : 1d array Vector with oscillation score of given oscillation at each vertex. """ # Check how many vertices and subjects in group [n_vertex, n_dim, n_subj] = np.shape(osc_mat) # Initialize vector to store average powers avg_powers = np.zeros(n_vertex) # Loop through all vertices for vertex in range(n_vertex): # Pull out temp vector of all oscillation powers temp_pows = osc_mat[vertex, 1, :] temp_pows = temp_pows[np.nonzero(temp_pows)] # If there are oscillations get average power if len(temp_pows) == 0: avg_powers[vertex] = 0 else: avg_powers[vertex] = np.mean(temp_pows) # Get the maximum power across all vertices max_all = max(avg_powers) # Initialize vector to store power ratios pow_ratio = np.zeros(n_vertex) # Loop through all vertices, calculating power ratio for vertex in range(n_vertex): pow_ratio[vertex] = np.mean(osc_mat[vertex, 1, :]) / max_all return pow_ratio def _band_sort(osc_bands): """Sort oscillation dictionary into order. Parameters ---------- osc_bands : dict A dictionary containing the oscillation band definitions. Returns ------- ordered_bands : list of str A list of the oscillation band names, in order. sort_inds : list of int A list of indices to sort oscillation bands. """ # Check how many oscillation bands there are n_bands = len(osc_bands) # Initialize to store names and lower bounds band_names = [] lower_bounds = np.array([]) # Loop through, and grab name and lower bound for each band for band in osc_bands: band_names.append(band) lower_bounds = np.append(lower_bounds, osc_bands[band][0]) # Get the indices to sort the lower bounds sort_inds = np.argsort(lower_bounds) # Use indices to sort band names into order ordered_bands = [] ordered_bands[:] = [band_names[i] for i in sort_inds] return ordered_bands, sort_inds
StarcoderdataPython
153383
# -*- coding: utf-8 -*- from config import RUN_VER if RUN_VER == 'open': from blueapps.patch.settings_open_saas import * # noqa else: from blueapps.patch.settings_paas_services import * # noqa # 本地开发环境 RUN_MODE = 'DEVELOP' # APP本地静态资源目录 STATIC_URL = '/static/' # APP静态资源目录url # REMOTE_STATIC_URL = '%sremote/' % STATIC_URL # Celery 消息队列设置 RabbitMQ # BROKER_URL = 'amqp://guest:guest@localhost:5672//' # Celery 消息队列设置 Redis BROKER_URL = 'redis://localhost:6379/0' DEBUG = True # 本地开发数据库设置 # USE FOLLOWING SQL TO CREATE THE DATABASE NAMED APP_CODE # SQL: CREATE DATABASE `framework_py` DEFAULT CHARACTER SET utf8 COLLATE utf8_general_ci; # noqa: E501 DATABASES = { 'default': { 'ENGINE': 'django.db.backends.mysql', 'NAME': 'bktest', 'USER': 'root', 'PASSWORD': '<PASSWORD>', 'HOST': 'localhost', 'PORT': '3306', }, 'cmdb_db': { 'ENGINE': 'django.db.backends.mysql', 'NAME': 'django_content_type', 'USER': 'root', 'PASSWORD': '<PASSWORD>', 'HOST': 'localhost', 'PORT': '3306', }, } # 多人开发时,无法共享的本地配置可以放到新建的 local_settings.py 文件中 # 并且把 local_settings.py 加入版本管理忽略文件中 try: from local_settings import * # noqa except ImportError: pass
StarcoderdataPython
1760693
<reponame>Petr-By/qtpyvis from .detector import Detector from .landmarks import FacialLandmarks
StarcoderdataPython
3384380
from enum import Enum class UserGroupsEnum(Enum): MODERATOR = "Moderator"
StarcoderdataPython
61479
<gh_stars>1-10 from tornado import web from tornado.log import app_log #from jupyterhub.services.auth import HubOAuthenticated, HubOAuth class BaseHandler(web.RequestHandler): # HubOAuthenticated """HubAuthenticated by default allows all successfully identified users (see allow_all property).""" def initialize(self): super().initialize() self.log = app_log #self.hub_auth = HubOAuth.instance(config=self.settings['traitlets_config']) @property def template_namespace(self): return dict(static_url=self.static_url, **self.settings.get('template_variables', {})) def render_template(self, name, **extra_ns): """Render an HTML page""" ns = {} ns.update(self.template_namespace) ns.update(extra_ns) template = self.settings['jinja2_env'].get_template(name) html = template.render(**ns) self.write(html)
StarcoderdataPython
192158
import cv2 import os import numpy as np import pandas as pd from scipy.ndimage import zoom #from matplotlib import pyplot as plt def clipped_zoom(img, zoom_factor, **kwargs): h, w = img.shape[:2] # For multichannel images we don't want to apply the zoom factor to the RGB # dimension, so instead we create a tuple of zoom factors, one per array # dimension, with 1's for any trailing dimensions after the width and height. zoom_tuple = (zoom_factor,) * 2 + (1,) * (img.ndim - 2) # Zooming out if zoom_factor < 1: # Bounding box of the zoomed-out image within the output array zh = int(np.round(h * zoom_factor)) zw = int(np.round(w * zoom_factor)) top = (h - zh) // 2 left = (w - zw) // 2 # Zero-padding out = np.zeros_like(img) out[top:top+zh, left:left+zw] = zoom(img, zoom_tuple, **kwargs) # Zooming in elif zoom_factor > 1: # Bounding box of the zoomed-in region within the input array zh = int(np.round(h / zoom_factor)) zw = int(np.round(w / zoom_factor)) top = (h - zh) // 2 left = (w - zw) // 2 out = zoom(img[top:top+zh, left:left+zw], zoom_tuple, **kwargs) # `out` might still be slightly larger than `img` due to rounding, so # trim off any extra pixels at the edges trim_top = ((out.shape[0] - h) // 2) trim_left = ((out.shape[1] - w) // 2) out = out[trim_top:trim_top+h, trim_left:trim_left+w] # If zoom_factor == 1, just return the input array else: out = img return out def detect_dnn_frame(net, frame): frameOpencvDnn = frame.copy() frameHeight = frameOpencvDnn.shape[0] frameWidth = frameOpencvDnn.shape[1] blob = cv2.dnn.blobFromImage(frameOpencvDnn, 1.0, (300, 300), [104, 117, 123], False, False) conf_threshold = 0.7 net.setInput(blob) detections = net.forward() bboxes = [] for i in range(detections.shape[2]): confidence = detections[0, 0, i, 2] if confidence > conf_threshold: x1 = int(detections[0, 0, i, 3] * frameWidth) y1 = int(detections[0, 0, i, 4] * frameHeight) x2 = int(detections[0, 0, i, 5] * frameWidth) y2 = int(detections[0, 0, i, 6] * frameHeight) bboxes.append([x1, y1, x2, y2]) cv2.rectangle(frameOpencvDnn, (x1, y1), (x2, y2), (0, 255, 0), int(round(frameHeight/150)), 8) return frameOpencvDnn, bboxes def show_labels(folder_path): data = pd.read_csv(os.path.join(folder_path,'sub-'+'train'+'-annotations-bbox.csv')).values.tolist() # teste = np.array(annot[['Set', 'Participant', 'File']].astype(str)) # print(teste) # print('='*60) # folders.sort(key=int) train_folder =os.path.join(folder_path, 'train') image_names = os.listdir(train_folder) image_names.sort() #print(image_names) for d in data: #for i, image_name in enumerate(image_names): print(d) image_id = str(d[0]) image_path = os.path.join(train_folder, image_id) print(image_path) thermal = cv2.imread(image_path) print(thermal.shape) #print(image_path.split('/')[1:]) #(x,y,w,h) = np.array(d[['XMin', 'XMax', 'YMin', 'YMax']]) #(x,y,w,h) = (d[1], d[2], d[3], d[4]) (x,y,w,h) = (d[1], d[2], d[3], d[4]) print((x,y,w,h)) #thermal = cv2.rectangle(thermal,(x,y),(x+w,y+h),(255,0,0),2) thermal = cv2.rectangle(thermal,(x,y),(w,h),(255,0,0),2) cv2.imshow('Thermal', thermal) if cv2.waitKey(0) > 0: continue #break # cv2.imshow('Original', img) # cv2.imshow('Cinza', gray) # cv2.waitKey(0) folder_path = 'data/CelebA/img_celeba_splitted' #folder_path = 'data/Thermal_organized_splitted' show_labels(folder_path) #match_template(folder_path, rgb_folder_path)
StarcoderdataPython
9054
<reponame>proofdock/chaos-azure from unittest.mock import patch, MagicMock from pdchaosazure.webapp.actions import stop, restart, delete from tests.data import config_provider, secrets_provider, webapp_provider @patch('pdchaosazure.webapp.actions.fetch_webapps', autospec=True) @patch('pdchaosazure.webapp.actions.client.init', autospec=True) def test_happily_stop_webapp(init, fetch): config = config_provider.provide_default_config() secrets = secrets_provider.provide_secrets_public() webapp = webapp_provider.default() client = MagicMock() init.return_value = client resource_list = [webapp] fetch.return_value = resource_list f = "where resourceGroup=~'rg'" stop(f, config, secrets) fetch.assert_called_with(f, config, secrets) client.web_apps.stop.assert_called_with(webapp['resourceGroup'], webapp['name']) @patch('pdchaosazure.webapp.actions.fetch_webapps', autospec=True) @patch('pdchaosazure.webapp.actions.client.init', autospec=True) def test_happily_restart_webapp(init, fetch): config = config_provider.provide_default_config() secrets = secrets_provider.provide_secrets_public() webapp = webapp_provider.default() client = MagicMock() init.return_value = client resource_list = [webapp] fetch.return_value = resource_list f = "where resourceGroup=~'rg'" restart(f, config, secrets) fetch.assert_called_with(f, config, secrets) client.web_apps.restart.assert_called_with(webapp['resourceGroup'], webapp['name']) @patch('pdchaosazure.webapp.actions.fetch_webapps', autospec=True) @patch('pdchaosazure.webapp.actions.client.init', autospec=True) def test_happily_delete_webapp(init, fetch): webapp = webapp_provider.default() config = config_provider.provide_default_config() secrets = secrets_provider.provide_secrets_public() client = MagicMock() init.return_value = client resource_list = [webapp] fetch.return_value = resource_list f = "where resourceGroup=~'rg'" delete(f, config, secrets) fetch.assert_called_with(f, config, secrets) client.web_apps.delete.assert_called_with(webapp['resourceGroup'], webapp['name'])
StarcoderdataPython
1703355
<filename>Crash/Fundamentals/code_snip/resize_live_video.py def changeRes(width, height, capture): # Live video capture.set(3, width) capture.set(4, height)
StarcoderdataPython