Question stringlengths 471 531 | Answer stringlengths 19 34 | TargetMolecule stringlengths 2 62 | SampleMethod stringclasses 1
value | SampleNum int64 0 0 | SampleRep stringclasses 1
value | image imagewidth (px) 300 300 |
|---|---|---|---|---|---|---|
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular propertie... | <float>-7.2</float> | ClC(Cl)C(c1ccc(Cl)cc1)c2ccc(Cl)cc2 | scaffold | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular propertie... | <float>-2.78</float> | COc1ccc(Cl)cc1 | scaffold | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular propertie... | <float>-5.68</float> | CCCN(CCC)c1c(cc(cc1N(=O)=O)C(F)(F)F)N(=O)=O | scaffold | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular propertie... | <float>-2.42</float> | Cc1c[nH]c2ccccc12 | scaffold | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular propertie... | <float>-5.21</float> | Clc1cccc(Cl)c1c2ccccc2 | scaffold | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular propertie... | <float>-5.382000000000001</float> | CCOP(=S)(OCC)Oc2ccc1oc(=O)c(Cl)c(C)c1c2 | scaffold | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular propertie... | <float>-4.26</float> | CC(C)CC(C)C | scaffold | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular propertie... | <float>-2.68</float> | CCCC=C | scaffold | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular propertie... | <float>-5.03</float> | ClC(Cl)CC(=O)NC2=C(Cl)C(=O)c1ccccc1C2=O | scaffold | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular propertie... | <float>-2.48</float> | CC(C)N(C(=O)CCl)c1ccccc1 | scaffold | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular propertie... | <float>-2.111</float> | OCC(NC(=O)C(Cl)Cl)C(O)c1ccc(cc1)N(=O)=O | scaffold | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular propertie... | <float>-1.92</float> | CN(C)c1ccccc1 | scaffold | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular propertie... | <float>-2.36</float> | CC(=O)Nc1nnc(s1)S(N)(=O)=O | scaffold | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular propertie... | <float>-1.66</float> | COC(=O)c1ccccc1C(=O)OC | scaffold | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular propertie... | <float>-5.51</float> | CCCCCCCCC=C | scaffold | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular propertie... | <float>-3.0</float> | Cc1c(cccc1N(=O)=O)N(=O)=O | scaffold | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular propertie... | <float>-3.55</float> | Clc1cccc(I)c1 | scaffold | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular propertie... | <float>-5.06</float> | CCCCCCCCBr | scaffold | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular propertie... | <float>-0.85</float> | CN(C)C(=O)OC1=CC(=O)CC(C)(C)C1 | scaffold | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular propertie... | <float>-0.807</float> | Cn1ccc(=O)[nH]c1=O | scaffold | 0 | smiles |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.