Datasets:
Question stringlengths 480 1.06k | Answer stringclasses 2 values | TargetMolecule stringlengths 4 580 | SampleMethod stringclasses 1 value | SampleNum int64 0 0 | SampleRep stringclasses 1 value | image imagewidth (px) 300 300 |
|---|---|---|---|---|---|---|
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict whether this molecule can inhibit HIV replication (Yes) or cannot inhibit HIV replication (No). Consider all molecular properties provided to assess the compound's potential as an antiviral agent against HIV.
Target Molecule (Smiles): COC(=O)C(Cc1c[nH]c2ccccc12)NP(=O)(O)OCC1OC(n2ccc(=N)[nH]c2=O)C(O)C1O
HIV Inhibition:
| <boolean>No</boolean> | COC(=O)C(Cc1c[nH]c2ccccc12)NP(=O)(O)OCC1OC(n2ccc(=N)[nH]c2=O)C(O)C1O | random | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict whether this molecule can inhibit HIV replication (Yes) or cannot inhibit HIV replication (No). Consider all molecular properties provided to assess the compound's potential as an antiviral agent against HIV.
Target Molecule (Smiles): Oc1nc(-c2ccccc2)nc2cc(Cl)ccc12
HIV Inhibition:
| <boolean>No</boolean> | Oc1nc(-c2ccccc2)nc2cc(Cl)ccc12 | random | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict whether this molecule can inhibit HIV replication (Yes) or cannot inhibit HIV replication (No). Consider all molecular properties provided to assess the compound's potential as an antiviral agent against HIV.
Target Molecule (Smiles): CCOC(=O)C(=CN1CCNC1=S)C(=O)OCC
HIV Inhibition:
| <boolean>No</boolean> | CCOC(=O)C(=CN1CCNC1=S)C(=O)OCC | random | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict whether this molecule can inhibit HIV replication (Yes) or cannot inhibit HIV replication (No). Consider all molecular properties provided to assess the compound's potential as an antiviral agent against HIV.
Target Molecule (Smiles): O=C(NP(=O)(N1CC1)N1CC1)OCc1ccccc1
HIV Inhibition:
| <boolean>No</boolean> | O=C(NP(=O)(N1CC1)N1CC1)OCc1ccccc1 | random | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict whether this molecule can inhibit HIV replication (Yes) or cannot inhibit HIV replication (No). Consider all molecular properties provided to assess the compound's potential as an antiviral agent against HIV.
Target Molecule (Smiles): CC1NS(=O)(=O)N(C)C1=O
HIV Inhibition:
| <boolean>No</boolean> | CC1NS(=O)(=O)N(C)C1=O | random | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict whether this molecule can inhibit HIV replication (Yes) or cannot inhibit HIV replication (No). Consider all molecular properties provided to assess the compound's potential as an antiviral agent against HIV.
Target Molecule (Smiles): Cc1cc2ncc3c(=O)n(NS(=O)(=O)c4ccc(N)cc4)ccc3n2n1
HIV Inhibition:
| <boolean>No</boolean> | Cc1cc2ncc3c(=O)n(NS(=O)(=O)c4ccc(N)cc4)ccc3n2n1 | random | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict whether this molecule can inhibit HIV replication (Yes) or cannot inhibit HIV replication (No). Consider all molecular properties provided to assess the compound's potential as an antiviral agent against HIV.
Target Molecule (Smiles): COC1C=CC23c4cc5c(cc4C(O)OC2CN(C)C3C1)OCO5
HIV Inhibition:
| <boolean>No</boolean> | COC1C=CC23c4cc5c(cc4C(O)OC2CN(C)C3C1)OCO5 | random | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict whether this molecule can inhibit HIV replication (Yes) or cannot inhibit HIV replication (No). Consider all molecular properties provided to assess the compound's potential as an antiviral agent against HIV.
Target Molecule (Smiles): CC(C)C=CC1=C(O)C(=O)c2ccccc2C1=O
HIV Inhibition:
| <boolean>No</boolean> | CC(C)C=CC1=C(O)C(=O)c2ccccc2C1=O | random | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict whether this molecule can inhibit HIV replication (Yes) or cannot inhibit HIV replication (No). Consider all molecular properties provided to assess the compound's potential as an antiviral agent against HIV.
Target Molecule (Smiles): CN(N=O)C(=O)ON1C(=O)CCC1=O
HIV Inhibition:
| <boolean>No</boolean> | CN(N=O)C(=O)ON1C(=O)CCC1=O | random | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict whether this molecule can inhibit HIV replication (Yes) or cannot inhibit HIV replication (No). Consider all molecular properties provided to assess the compound's potential as an antiviral agent against HIV.
Target Molecule (Smiles): N=S(c1ccccc1[N+](=O)[O-])c1ccccc1[N+](=O)[O-]
HIV Inhibition:
| <boolean>No</boolean> | N=S(c1ccccc1[N+](=O)[O-])c1ccccc1[N+](=O)[O-] | random | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict whether this molecule can inhibit HIV replication (Yes) or cannot inhibit HIV replication (No). Consider all molecular properties provided to assess the compound's potential as an antiviral agent against HIV.
Target Molecule (Smiles): CNC(=S)NN=C(C)c1ccc(OC)cc1O
HIV Inhibition:
| <boolean>No</boolean> | CNC(=S)NN=C(C)c1ccc(OC)cc1O | random | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict whether this molecule can inhibit HIV replication (Yes) or cannot inhibit HIV replication (No). Consider all molecular properties provided to assess the compound's potential as an antiviral agent against HIV.
Target Molecule (Smiles): C#CCOCn1cnc2ncnc(Cl)c21
HIV Inhibition:
| <boolean>No</boolean> | C#CCOCn1cnc2ncnc(Cl)c21 | random | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict whether this molecule can inhibit HIV replication (Yes) or cannot inhibit HIV replication (No). Consider all molecular properties provided to assess the compound's potential as an antiviral agent against HIV.
Target Molecule (Smiles): COc1cc(C(=O)OC2CC(C)=CCC3(C)CCC(O)(C(C)C)C23)ccc1O
HIV Inhibition:
| <boolean>No</boolean> | COc1cc(C(=O)OC2CC(C)=CCC3(C)CCC(O)(C(C)C)C23)ccc1O | random | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict whether this molecule can inhibit HIV replication (Yes) or cannot inhibit HIV replication (No). Consider all molecular properties provided to assess the compound's potential as an antiviral agent against HIV.
Target Molecule (Smiles): CC(CCc1nc(C#N)c(N)o1)C1CCC2C3C(O)CC4CC(O)CCC4(C)C3CC(O)C12C
HIV Inhibition:
| <boolean>No</boolean> | CC(CCc1nc(C#N)c(N)o1)C1CCC2C3C(O)CC4CC(O)CCC4(C)C3CC(O)C12C | random | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict whether this molecule can inhibit HIV replication (Yes) or cannot inhibit HIV replication (No). Consider all molecular properties provided to assess the compound's potential as an antiviral agent against HIV.
Target Molecule (Smiles): CC(C)C(Nc1c2ccccc2[n+]([O-])c2ccccc12)C(=O)O
HIV Inhibition:
| <boolean>No</boolean> | CC(C)C(Nc1c2ccccc2[n+]([O-])c2ccccc12)C(=O)O | random | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict whether this molecule can inhibit HIV replication (Yes) or cannot inhibit HIV replication (No). Consider all molecular properties provided to assess the compound's potential as an antiviral agent against HIV.
Target Molecule (Smiles): CC1=NC(=Cc2cc(Br)cc(Br)c2)C(=O)N1n1c(-c2ccccc2)nc2ccccc2c1=O
HIV Inhibition:
| <boolean>No</boolean> | CC1=NC(=Cc2cc(Br)cc(Br)c2)C(=O)N1n1c(-c2ccccc2)nc2ccccc2c1=O | random | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict whether this molecule can inhibit HIV replication (Yes) or cannot inhibit HIV replication (No). Consider all molecular properties provided to assess the compound's potential as an antiviral agent against HIV.
Target Molecule (Smiles): CC(=O)OC12CCCC1C1(O)C(O)CCCC21
HIV Inhibition:
| <boolean>No</boolean> | CC(=O)OC12CCCC1C1(O)C(O)CCCC21 | random | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict whether this molecule can inhibit HIV replication (Yes) or cannot inhibit HIV replication (No). Consider all molecular properties provided to assess the compound's potential as an antiviral agent against HIV.
Target Molecule (Smiles): I.S=C(NNC1=NCCCN1)Nc1ccccc1
HIV Inhibition:
| <boolean>No</boolean> | I.S=C(NNC1=NCCCN1)Nc1ccccc1 | random | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict whether this molecule can inhibit HIV replication (Yes) or cannot inhibit HIV replication (No). Consider all molecular properties provided to assess the compound's potential as an antiviral agent against HIV.
Target Molecule (Smiles): O=C1C(=Cc2ccccc2Cl)COc2ccc(Br)cc21
HIV Inhibition:
| <boolean>No</boolean> | O=C1C(=Cc2ccccc2Cl)COc2ccc(Br)cc21 | random | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict whether this molecule can inhibit HIV replication (Yes) or cannot inhibit HIV replication (No). Consider all molecular properties provided to assess the compound's potential as an antiviral agent against HIV.
Target Molecule (Smiles): O=c1n(CCCCn2c(=O)n(CC3CS3)c3ccccc32)c2ccccc2n1CC1CS1
HIV Inhibition:
| <boolean>No</boolean> | O=c1n(CCCCn2c(=O)n(CC3CS3)c3ccccc32)c2ccccc2n1CC1CS1 | random | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict whether this molecule can inhibit HIV replication (Yes) or cannot inhibit HIV replication (No). Consider all molecular properties provided to assess the compound's potential as an antiviral agent against HIV.
Target Molecule (Smiles): Cc1ccc(C(=O)Nc2ccc(CP(=O)(O)O)cc2)cc1NC(=O)c1cccc(N)c1
HIV Inhibition:
| <boolean>No</boolean> | Cc1ccc(C(=O)Nc2ccc(CP(=O)(O)O)cc2)cc1NC(=O)c1cccc(N)c1 | random | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict whether this molecule can inhibit HIV replication (Yes) or cannot inhibit HIV replication (No). Consider all molecular properties provided to assess the compound's potential as an antiviral agent against HIV.
Target Molecule (Smiles): CC(=O)N1C(Nc2cccc3nc(C)ccc23)CCN1c1ccccc1
HIV Inhibition:
| <boolean>No</boolean> | CC(=O)N1C(Nc2cccc3nc(C)ccc23)CCN1c1ccccc1 | random | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict whether this molecule can inhibit HIV replication (Yes) or cannot inhibit HIV replication (No). Consider all molecular properties provided to assess the compound's potential as an antiviral agent against HIV.
Target Molecule (Smiles): CCOC(=O)C(NC(=O)c1ccccc1)(N1CCN(c2cc3c(cc2F)c(=O)c(C(=O)O)cn3CC)CC1)C(F)(F)F
HIV Inhibition:
| <boolean>No</boolean> | CCOC(=O)C(NC(=O)c1ccccc1)(N1CCN(c2cc3c(cc2F)c(=O)c(C(=O)O)cn3CC)CC1)C(F)(F)F | random | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict whether this molecule can inhibit HIV replication (Yes) or cannot inhibit HIV replication (No). Consider all molecular properties provided to assess the compound's potential as an antiviral agent against HIV.
Target Molecule (Smiles): COC(=O)CC1(C(=O)OC)C2CCCN2C2(C#N)c3ccccc3CCC12Br
HIV Inhibition:
| <boolean>No</boolean> | COC(=O)CC1(C(=O)OC)C2CCCN2C2(C#N)c3ccccc3CCC12Br | random | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict whether this molecule can inhibit HIV replication (Yes) or cannot inhibit HIV replication (No). Consider all molecular properties provided to assess the compound's potential as an antiviral agent against HIV.
Target Molecule (Smiles): COc1cccc2c(N)c3cccc(C(=O)NCCN(C)C)c3nc12.Cl
HIV Inhibition:
| <boolean>No</boolean> | COc1cccc2c(N)c3cccc(C(=O)NCCN(C)C)c3nc12.Cl | random | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict whether this molecule can inhibit HIV replication (Yes) or cannot inhibit HIV replication (No). Consider all molecular properties provided to assess the compound's potential as an antiviral agent against HIV.
Target Molecule (Smiles): CC(C)CCCC(C)C1CCC2C3CCC4CC(O)(C(c5cc(Cl)c(O)c(C(=O)O)c5)c5cc(Cl)c(O)c(C(=O)O)c5)CCC4(C)C3CCC12C.N
HIV Inhibition:
| <boolean>No</boolean> | CC(C)CCCC(C)C1CCC2C3CCC4CC(O)(C(c5cc(Cl)c(O)c(C(=O)O)c5)c5cc(Cl)c(O)c(C(=O)O)c5)CCC4(C)C3CCC12C.N | random | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict whether this molecule can inhibit HIV replication (Yes) or cannot inhibit HIV replication (No). Consider all molecular properties provided to assess the compound's potential as an antiviral agent against HIV.
Target Molecule (Smiles): ClCc1nn(-c2ccccc2)c(CCl)c1CCl
HIV Inhibition:
| <boolean>No</boolean> | ClCc1nn(-c2ccccc2)c(CCl)c1CCl | random | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict whether this molecule can inhibit HIV replication (Yes) or cannot inhibit HIV replication (No). Consider all molecular properties provided to assess the compound's potential as an antiviral agent against HIV.
Target Molecule (Smiles): CC1=[N+]2[N-]C(N3CC4CCC(CC4)C3)=[S+][Cu-2]2[n+]2ncccc21
HIV Inhibition:
| <boolean>No</boolean> | CC1=[N+]2[N-]C(N3CC4CCC(CC4)C3)=[S+][Cu-2]2[n+]2ncccc21 | random | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict whether this molecule can inhibit HIV replication (Yes) or cannot inhibit HIV replication (No). Consider all molecular properties provided to assess the compound's potential as an antiviral agent against HIV.
Target Molecule (Smiles): Brc1ccc(N=NN2CCCC2)cc1
HIV Inhibition:
| <boolean>No</boolean> | Brc1ccc(N=NN2CCCC2)cc1 | random | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict whether this molecule can inhibit HIV replication (Yes) or cannot inhibit HIV replication (No). Consider all molecular properties provided to assess the compound's potential as an antiviral agent against HIV.
Target Molecule (Smiles): CCOC(=O)c1c(NC(=O)c2ccccc2)c(C#N)c2n1CCCCC2
HIV Inhibition:
| <boolean>No</boolean> | CCOC(=O)c1c(NC(=O)c2ccccc2)c(C#N)c2n1CCCCC2 | random | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict whether this molecule can inhibit HIV replication (Yes) or cannot inhibit HIV replication (No). Consider all molecular properties provided to assess the compound's potential as an antiviral agent against HIV.
Target Molecule (Smiles): CCOC(=O)c1ccc(CS(=O)(=O)c2ccc(OC)cc2)c([N+](=O)[O-])c1
HIV Inhibition:
| <boolean>No</boolean> | CCOC(=O)c1ccc(CS(=O)(=O)c2ccc(OC)cc2)c([N+](=O)[O-])c1 | random | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict whether this molecule can inhibit HIV replication (Yes) or cannot inhibit HIV replication (No). Consider all molecular properties provided to assess the compound's potential as an antiviral agent against HIV.
Target Molecule (Smiles): CCCNC(=O)N(C)S(=O)(=O)c1ccc(Cl)cc1
HIV Inhibition:
| <boolean>No</boolean> | CCCNC(=O)N(C)S(=O)(=O)c1ccc(Cl)cc1 | random | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict whether this molecule can inhibit HIV replication (Yes) or cannot inhibit HIV replication (No). Consider all molecular properties provided to assess the compound's potential as an antiviral agent against HIV.
Target Molecule (Smiles): COc1cc2c(cc1OC)C(C1CC1)ON(C)CC2
HIV Inhibition:
| <boolean>Yes</boolean> | COc1cc2c(cc1OC)C(C1CC1)ON(C)CC2 | random | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict whether this molecule can inhibit HIV replication (Yes) or cannot inhibit HIV replication (No). Consider all molecular properties provided to assess the compound's potential as an antiviral agent against HIV.
Target Molecule (Smiles): O=C(c1ccccc1)c1nnn(Cc2cccc(Cl)c2)c1C(=O)c1ccccc1
HIV Inhibition:
| <boolean>No</boolean> | O=C(c1ccccc1)c1nnn(Cc2cccc(Cl)c2)c1C(=O)c1ccccc1 | random | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict whether this molecule can inhibit HIV replication (Yes) or cannot inhibit HIV replication (No). Consider all molecular properties provided to assess the compound's potential as an antiviral agent against HIV.
Target Molecule (Smiles): Nc1nc2cc(CNc3ccc(C(=O)NC(CCC(=O)O)C(=O)O)cc3)ccc2nc1-c1ccccc1
HIV Inhibition:
| <boolean>No</boolean> | Nc1nc2cc(CNc3ccc(C(=O)NC(CCC(=O)O)C(=O)O)cc3)ccc2nc1-c1ccccc1 | random | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict whether this molecule can inhibit HIV replication (Yes) or cannot inhibit HIV replication (No). Consider all molecular properties provided to assess the compound's potential as an antiviral agent against HIV.
Target Molecule (Smiles): N=c1nc2n(cc1F)C1OC(CO)C(O)C1O2.O=CO
HIV Inhibition:
| <boolean>No</boolean> | N=c1nc2n(cc1F)C1OC(CO)C(O)C1O2.O=CO | random | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict whether this molecule can inhibit HIV replication (Yes) or cannot inhibit HIV replication (No). Consider all molecular properties provided to assess the compound's potential as an antiviral agent against HIV.
Target Molecule (Smiles): N=C(N)NS(=O)(=O)c1ccc(NC(=O)c2ccc3[nH]c4ccccc4c(=O)c3c2)cc1
HIV Inhibition:
| <boolean>No</boolean> | N=C(N)NS(=O)(=O)c1ccc(NC(=O)c2ccc3[nH]c4ccccc4c(=O)c3c2)cc1 | random | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict whether this molecule can inhibit HIV replication (Yes) or cannot inhibit HIV replication (No). Consider all molecular properties provided to assess the compound's potential as an antiviral agent against HIV.
Target Molecule (Smiles): Cc1cc2cc3ccccc3cc2c(O)n1
HIV Inhibition:
| <boolean>No</boolean> | Cc1cc2cc3ccccc3cc2c(O)n1 | random | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict whether this molecule can inhibit HIV replication (Yes) or cannot inhibit HIV replication (No). Consider all molecular properties provided to assess the compound's potential as an antiviral agent against HIV.
Target Molecule (Smiles): COc1ccc2[nH]c3c(O)nncc3c2c1
HIV Inhibition:
| <boolean>No</boolean> | COc1ccc2[nH]c3c(O)nncc3c2c1 | random | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict whether this molecule can inhibit HIV replication (Yes) or cannot inhibit HIV replication (No). Consider all molecular properties provided to assess the compound's potential as an antiviral agent against HIV.
Target Molecule (Smiles): CC(C)C(C)C=CC(C)C1CC2C3=CC=C4CC(OC5OCC(O)C6OC(=O)C(=O)OC56)CCC4(C)C3CCC2(C)C1
HIV Inhibition:
| <boolean>No</boolean> | CC(C)C(C)C=CC(C)C1CC2C3=CC=C4CC(OC5OCC(O)C6OC(=O)C(=O)OC56)CCC4(C)C3CCC2(C)C1 | random | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict whether this molecule can inhibit HIV replication (Yes) or cannot inhibit HIV replication (No). Consider all molecular properties provided to assess the compound's potential as an antiviral agent against HIV.
Target Molecule (Smiles): CC(C=NNC1=NCCCN1)=NNC1=NCCCN1.I
HIV Inhibition:
| <boolean>No</boolean> | CC(C=NNC1=NCCCN1)=NNC1=NCCCN1.I | random | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict whether this molecule can inhibit HIV replication (Yes) or cannot inhibit HIV replication (No). Consider all molecular properties provided to assess the compound's potential as an antiviral agent against HIV.
Target Molecule (Smiles): COc1cc(-c2cc(CCC(=O)Nc3ccccc3[N+](=O)[O-])n(-c3ccc([N+](=O)[O-])cc3[N+](=O)[O-])n2)ccc1O
HIV Inhibition:
| <boolean>No</boolean> | COc1cc(-c2cc(CCC(=O)Nc3ccccc3[N+](=O)[O-])n(-c3ccc([N+](=O)[O-])cc3[N+](=O)[O-])n2)ccc1O | random | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict whether this molecule can inhibit HIV replication (Yes) or cannot inhibit HIV replication (No). Consider all molecular properties provided to assess the compound's potential as an antiviral agent against HIV.
Target Molecule (Smiles): COc1ccc(N=Cc2cc(OC)c(OC)c(OC)c2)cc1
HIV Inhibition:
| <boolean>No</boolean> | COc1ccc(N=Cc2cc(OC)c(OC)c(OC)c2)cc1 | random | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict whether this molecule can inhibit HIV replication (Yes) or cannot inhibit HIV replication (No). Consider all molecular properties provided to assess the compound's potential as an antiviral agent against HIV.
Target Molecule (Smiles): CC(=O)c1c(-c2ccco2)c(C#N)c(=S)n(C2OC(CO)C(O)C(O)C2O)c1C
HIV Inhibition:
| <boolean>No</boolean> | CC(=O)c1c(-c2ccco2)c(C#N)c(=S)n(C2OC(CO)C(O)C(O)C2O)c1C | random | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict whether this molecule can inhibit HIV replication (Yes) or cannot inhibit HIV replication (No). Consider all molecular properties provided to assess the compound's potential as an antiviral agent against HIV.
Target Molecule (Smiles): COc1cccc(C(=O)C#Cc2cnc(OC)nc2OC)c1
HIV Inhibition:
| <boolean>No</boolean> | COc1cccc(C(=O)C#Cc2cnc(OC)nc2OC)c1 | random | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict whether this molecule can inhibit HIV replication (Yes) or cannot inhibit HIV replication (No). Consider all molecular properties provided to assess the compound's potential as an antiviral agent against HIV.
Target Molecule (Smiles): COC(C=Cc1ccccc1)=C[SH](C)(=O)N(C)C
HIV Inhibition:
| <boolean>No</boolean> | COC(C=Cc1ccccc1)=C[SH](C)(=O)N(C)C | random | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict whether this molecule can inhibit HIV replication (Yes) or cannot inhibit HIV replication (No). Consider all molecular properties provided to assess the compound's potential as an antiviral agent against HIV.
Target Molecule (Smiles): O=NNc1nc(-c2cccnc2)nc2ccccc12.[NaH]
HIV Inhibition:
| <boolean>No</boolean> | O=NNc1nc(-c2cccnc2)nc2ccccc12.[NaH] | random | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict whether this molecule can inhibit HIV replication (Yes) or cannot inhibit HIV replication (No). Consider all molecular properties provided to assess the compound's potential as an antiviral agent against HIV.
Target Molecule (Smiles): O=S(=O)(C=CC(=Cc1ccccc1)S(=O)(=O)c1ccccc1)c1ccccc1
HIV Inhibition:
| <boolean>No</boolean> | O=S(=O)(C=CC(=Cc1ccccc1)S(=O)(=O)c1ccccc1)c1ccccc1 | random | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict whether this molecule can inhibit HIV replication (Yes) or cannot inhibit HIV replication (No). Consider all molecular properties provided to assess the compound's potential as an antiviral agent against HIV.
Target Molecule (Smiles): Cl.O=C1CN2Cc3cc(N4CCOCC4)ccc3NC2=N1
HIV Inhibition:
| <boolean>No</boolean> | Cl.O=C1CN2Cc3cc(N4CCOCC4)ccc3NC2=N1 | random | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict whether this molecule can inhibit HIV replication (Yes) or cannot inhibit HIV replication (No). Consider all molecular properties provided to assess the compound's potential as an antiviral agent against HIV.
Target Molecule (Smiles): CCN(CC)CCOc1ccc(C(=C(Cl)c2ccccc2)c2ccccc2)cc1.O=C(O)CC(O)(CC(=O)O)C(=O)O
HIV Inhibition:
| <boolean>No</boolean> | CCN(CC)CCOc1ccc(C(=C(Cl)c2ccccc2)c2ccccc2)cc1.O=C(O)CC(O)(CC(=O)O)C(=O)O | random | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict whether this molecule can inhibit HIV replication (Yes) or cannot inhibit HIV replication (No). Consider all molecular properties provided to assess the compound's potential as an antiviral agent against HIV.
Target Molecule (Smiles): O=C(C=Cc1ccc(Cl)cc1)c1cccs1
HIV Inhibition:
| <boolean>No</boolean> | O=C(C=Cc1ccc(Cl)cc1)c1cccs1 | random | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict whether this molecule can inhibit HIV replication (Yes) or cannot inhibit HIV replication (No). Consider all molecular properties provided to assess the compound's potential as an antiviral agent against HIV.
Target Molecule (Smiles): O=C(Nc1ccccc1)C(O)C(O)C(=O)Nc1ccccc1
HIV Inhibition:
| <boolean>No</boolean> | O=C(Nc1ccccc1)C(O)C(O)C(=O)Nc1ccccc1 | random | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict whether this molecule can inhibit HIV replication (Yes) or cannot inhibit HIV replication (No). Consider all molecular properties provided to assess the compound's potential as an antiviral agent against HIV.
Target Molecule (Smiles): COc1cc(Nc2cnc3cc(N)ccc3n2)cc(OC)c1OC
HIV Inhibition:
| <boolean>No</boolean> | COc1cc(Nc2cnc3cc(N)ccc3n2)cc(OC)c1OC | random | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict whether this molecule can inhibit HIV replication (Yes) or cannot inhibit HIV replication (No). Consider all molecular properties provided to assess the compound's potential as an antiviral agent against HIV.
Target Molecule (Smiles): CN1C(=O)C2N(N(C)C1=O)C1(Br)C(=O)NC(=O)C21Br
HIV Inhibition:
| <boolean>Yes</boolean> | CN1C(=O)C2N(N(C)C1=O)C1(Br)C(=O)NC(=O)C21Br | random | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict whether this molecule can inhibit HIV replication (Yes) or cannot inhibit HIV replication (No). Consider all molecular properties provided to assess the compound's potential as an antiviral agent against HIV.
Target Molecule (Smiles): Clc1ccc([S+](c2ccc(Cl)cc2)C(Cl)(Cl)C(Cl)(Cl)Cl)cc1
HIV Inhibition:
| <boolean>No</boolean> | Clc1ccc([S+](c2ccc(Cl)cc2)C(Cl)(Cl)C(Cl)(Cl)Cl)cc1 | random | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict whether this molecule can inhibit HIV replication (Yes) or cannot inhibit HIV replication (No). Consider all molecular properties provided to assess the compound's potential as an antiviral agent against HIV.
Target Molecule (Smiles): CC1(C)OC2COC(C)(C)OC(C3SCCCS3)C2O1
HIV Inhibition:
| <boolean>No</boolean> | CC1(C)OC2COC(C)(C)OC(C3SCCCS3)C2O1 | random | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict whether this molecule can inhibit HIV replication (Yes) or cannot inhibit HIV replication (No). Consider all molecular properties provided to assess the compound's potential as an antiviral agent against HIV.
Target Molecule (Smiles): O=C(CSc1nnc(Cc2ccccc2)o1)Nc1ccc(Cl)cc1
HIV Inhibition:
| <boolean>No</boolean> | O=C(CSc1nnc(Cc2ccccc2)o1)Nc1ccc(Cl)cc1 | random | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict whether this molecule can inhibit HIV replication (Yes) or cannot inhibit HIV replication (No). Consider all molecular properties provided to assess the compound's potential as an antiviral agent against HIV.
Target Molecule (Smiles): COC(=N)CCSSCCC(=N)OC
HIV Inhibition:
| <boolean>No</boolean> | COC(=N)CCSSCCC(=N)OC | random | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict whether this molecule can inhibit HIV replication (Yes) or cannot inhibit HIV replication (No). Consider all molecular properties provided to assess the compound's potential as an antiviral agent against HIV.
Target Molecule (Smiles): Oc1nc2cccccc-2c1-c1nc2ccccc2[nH]1
HIV Inhibition:
| <boolean>No</boolean> | Oc1nc2cccccc-2c1-c1nc2ccccc2[nH]1 | random | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict whether this molecule can inhibit HIV replication (Yes) or cannot inhibit HIV replication (No). Consider all molecular properties provided to assess the compound's potential as an antiviral agent against HIV.
Target Molecule (Smiles): CC(C)(C)[Si](C)(C)OCC1OC(n2cnc3c(O)nc(NC(=O)c4ccccc4)nc32)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C
HIV Inhibition:
| <boolean>No</boolean> | CC(C)(C)[Si](C)(C)OCC1OC(n2cnc3c(O)nc(NC(=O)c4ccccc4)nc32)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C | random | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict whether this molecule can inhibit HIV replication (Yes) or cannot inhibit HIV replication (No). Consider all molecular properties provided to assess the compound's potential as an antiviral agent against HIV.
Target Molecule (Smiles): COCCN1C2=CCCCC2=Nc2c(N)nc(N)nc21
HIV Inhibition:
| <boolean>No</boolean> | COCCN1C2=CCCCC2=Nc2c(N)nc(N)nc21 | random | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict whether this molecule can inhibit HIV replication (Yes) or cannot inhibit HIV replication (No). Consider all molecular properties provided to assess the compound's potential as an antiviral agent against HIV.
Target Molecule (Smiles): COC(=O)C(NC(=O)c1ccccc1)c1ccco1
HIV Inhibition:
| <boolean>No</boolean> | COC(=O)C(NC(=O)c1ccccc1)c1ccco1 | random | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict whether this molecule can inhibit HIV replication (Yes) or cannot inhibit HIV replication (No). Consider all molecular properties provided to assess the compound's potential as an antiviral agent against HIV.
Target Molecule (Smiles): CN(C(=O)C1=CCCCCC1)c1ccccc1I
HIV Inhibition:
| <boolean>No</boolean> | CN(C(=O)C1=CCCCCC1)c1ccccc1I | random | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict whether this molecule can inhibit HIV replication (Yes) or cannot inhibit HIV replication (No). Consider all molecular properties provided to assess the compound's potential as an antiviral agent against HIV.
Target Molecule (Smiles): Cc1ccc2[nH]c3c(c(=O)n(C)c(=O)n3C)c2c1
HIV Inhibition:
| <boolean>No</boolean> | Cc1ccc2[nH]c3c(c(=O)n(C)c(=O)n3C)c2c1 | random | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict whether this molecule can inhibit HIV replication (Yes) or cannot inhibit HIV replication (No). Consider all molecular properties provided to assess the compound's potential as an antiviral agent against HIV.
Target Molecule (Smiles): CC1N(O)CC2OC(n3ccc(=O)[nH]c3=O)C(O)C21O.CC1N(O)CC2OC(n3ccc(=O)[nH]c3=O)C(O)C21O
HIV Inhibition:
| <boolean>No</boolean> | CC1N(O)CC2OC(n3ccc(=O)[nH]c3=O)C(O)C21O.CC1N(O)CC2OC(n3ccc(=O)[nH]c3=O)C(O)C21O | random | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict whether this molecule can inhibit HIV replication (Yes) or cannot inhibit HIV replication (No). Consider all molecular properties provided to assess the compound's potential as an antiviral agent against HIV.
Target Molecule (Smiles): COc1ccc(CC(=O)NC(C)Cc2ccc(OC)c(OC)c2)cc1OC
HIV Inhibition:
| <boolean>No</boolean> | COc1ccc(CC(=O)NC(C)Cc2ccc(OC)c(OC)c2)cc1OC | random | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict whether this molecule can inhibit HIV replication (Yes) or cannot inhibit HIV replication (No). Consider all molecular properties provided to assess the compound's potential as an antiviral agent against HIV.
Target Molecule (Smiles): O=c1[nH]nc(-c2ccccc2)n1N=Cc1cccnc1
HIV Inhibition:
| <boolean>No</boolean> | O=c1[nH]nc(-c2ccccc2)n1N=Cc1cccnc1 | random | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict whether this molecule can inhibit HIV replication (Yes) or cannot inhibit HIV replication (No). Consider all molecular properties provided to assess the compound's potential as an antiviral agent against HIV.
Target Molecule (Smiles): Cc1cc(C)n(C(=C(C(Cl)=C(Cl)Cl)[N+](=O)[O-])n2nc(C)cc2C)n1
HIV Inhibition:
| <boolean>No</boolean> | Cc1cc(C)n(C(=C(C(Cl)=C(Cl)Cl)[N+](=O)[O-])n2nc(C)cc2C)n1 | random | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict whether this molecule can inhibit HIV replication (Yes) or cannot inhibit HIV replication (No). Consider all molecular properties provided to assess the compound's potential as an antiviral agent against HIV.
Target Molecule (Smiles): c1ccc2c(c1)ccn2CCc1c[nH]c2ccccc12
HIV Inhibition:
| <boolean>No</boolean> | c1ccc2c(c1)ccn2CCc1c[nH]c2ccccc12 | random | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict whether this molecule can inhibit HIV replication (Yes) or cannot inhibit HIV replication (No). Consider all molecular properties provided to assess the compound's potential as an antiviral agent against HIV.
Target Molecule (Smiles): CC1CCCN(CC(O)CN2CCN(CC(O)CN3CCCC(C)C3)CC2)C1
HIV Inhibition:
| <boolean>No</boolean> | CC1CCCN(CC(O)CN2CCN(CC(O)CN3CCCC(C)C3)CC2)C1 | random | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict whether this molecule can inhibit HIV replication (Yes) or cannot inhibit HIV replication (No). Consider all molecular properties provided to assess the compound's potential as an antiviral agent against HIV.
Target Molecule (Smiles): COc1cc2ccc1OCc1cccc(n1)COc1ccc(cc1OC)C=NCCNCCN=C2
HIV Inhibition:
| <boolean>Yes</boolean> | COc1cc2ccc1OCc1cccc(n1)COc1ccc(cc1OC)C=NCCNCCN=C2 | random | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict whether this molecule can inhibit HIV replication (Yes) or cannot inhibit HIV replication (No). Consider all molecular properties provided to assess the compound's potential as an antiviral agent against HIV.
Target Molecule (Smiles): c1cc(-c2csc(-c3ccsc3)c2)cs1
HIV Inhibition:
| <boolean>No</boolean> | c1cc(-c2csc(-c3ccsc3)c2)cs1 | random | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict whether this molecule can inhibit HIV replication (Yes) or cannot inhibit HIV replication (No). Consider all molecular properties provided to assess the compound's potential as an antiviral agent against HIV.
Target Molecule (Smiles): CCCCOC(=O)NC(Nc1cccc(C(F)(F)F)c1)(C(F)(F)F)C(F)(F)F
HIV Inhibition:
| <boolean>No</boolean> | CCCCOC(=O)NC(Nc1cccc(C(F)(F)F)c1)(C(F)(F)F)C(F)(F)F | random | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict whether this molecule can inhibit HIV replication (Yes) or cannot inhibit HIV replication (No). Consider all molecular properties provided to assess the compound's potential as an antiviral agent against HIV.
Target Molecule (Smiles): O=[N+]([O-])c1ccc2occ3c2c1CCC3
HIV Inhibition:
| <boolean>Yes</boolean> | O=[N+]([O-])c1ccc2occ3c2c1CCC3 | random | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict whether this molecule can inhibit HIV replication (Yes) or cannot inhibit HIV replication (No). Consider all molecular properties provided to assess the compound's potential as an antiviral agent against HIV.
Target Molecule (Smiles): CCc1n[nH]c(=O)n1-c1ccncc1
HIV Inhibition:
| <boolean>No</boolean> | CCc1n[nH]c(=O)n1-c1ccncc1 | random | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict whether this molecule can inhibit HIV replication (Yes) or cannot inhibit HIV replication (No). Consider all molecular properties provided to assess the compound's potential as an antiviral agent against HIV.
Target Molecule (Smiles): COc1cc2c(cc1OCCCCN1C(=O)c3cccc4cccc(c34)C1=O)N=CC1CCCN1C2=O
HIV Inhibition:
| <boolean>No</boolean> | COc1cc2c(cc1OCCCCN1C(=O)c3cccc4cccc(c34)C1=O)N=CC1CCCN1C2=O | random | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict whether this molecule can inhibit HIV replication (Yes) or cannot inhibit HIV replication (No). Consider all molecular properties provided to assess the compound's potential as an antiviral agent against HIV.
Target Molecule (Smiles): Br.CN(C)c1nc(=NCc2ccccc2)ss1
HIV Inhibition:
| <boolean>No</boolean> | Br.CN(C)c1nc(=NCc2ccccc2)ss1 | random | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict whether this molecule can inhibit HIV replication (Yes) or cannot inhibit HIV replication (No). Consider all molecular properties provided to assess the compound's potential as an antiviral agent against HIV.
Target Molecule (Smiles): Cc1ccccc1C1SCc2nc3ccccc3n21
HIV Inhibition:
| <boolean>No</boolean> | Cc1ccccc1C1SCc2nc3ccccc3n21 | random | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict whether this molecule can inhibit HIV replication (Yes) or cannot inhibit HIV replication (No). Consider all molecular properties provided to assess the compound's potential as an antiviral agent against HIV.
Target Molecule (Smiles): CN(C)CCn1[nH]c(=N)c2nc3cc(C(F)(F)F)ccc3nc21
HIV Inhibition:
| <boolean>No</boolean> | CN(C)CCn1[nH]c(=N)c2nc3cc(C(F)(F)F)ccc3nc21 | random | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict whether this molecule can inhibit HIV replication (Yes) or cannot inhibit HIV replication (No). Consider all molecular properties provided to assess the compound's potential as an antiviral agent against HIV.
Target Molecule (Smiles): O=C(NC(Cc1ccccc1)P(=O)(O)c1ccccc1)OCc1ccccc1
HIV Inhibition:
| <boolean>No</boolean> | O=C(NC(Cc1ccccc1)P(=O)(O)c1ccccc1)OCc1ccccc1 | random | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict whether this molecule can inhibit HIV replication (Yes) or cannot inhibit HIV replication (No). Consider all molecular properties provided to assess the compound's potential as an antiviral agent against HIV.
Target Molecule (Smiles): CCOC(=O)C1=C(Nc2ccc(NC3=C(C(=O)OCC)C(=O)CS3)cc2)SCC1=O
HIV Inhibition:
| <boolean>No</boolean> | CCOC(=O)C1=C(Nc2ccc(NC3=C(C(=O)OCC)C(=O)CS3)cc2)SCC1=O | random | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict whether this molecule can inhibit HIV replication (Yes) or cannot inhibit HIV replication (No). Consider all molecular properties provided to assess the compound's potential as an antiviral agent against HIV.
Target Molecule (Smiles): CCc1cc2c(c3c1CCCC3)CC1(Cc3ccc(C(=O)OC)cc3C1)C2
HIV Inhibition:
| <boolean>No</boolean> | CCc1cc2c(c3c1CCCC3)CC1(Cc3ccc(C(=O)OC)cc3C1)C2 | random | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict whether this molecule can inhibit HIV replication (Yes) or cannot inhibit HIV replication (No). Consider all molecular properties provided to assess the compound's potential as an antiviral agent against HIV.
Target Molecule (Smiles): O=P(c1ccccc1)(c1ccccc1)C(NCc1ccccc1)c1ccc(F)cc1
HIV Inhibition:
| <boolean>No</boolean> | O=P(c1ccccc1)(c1ccccc1)C(NCc1ccccc1)c1ccc(F)cc1 | random | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict whether this molecule can inhibit HIV replication (Yes) or cannot inhibit HIV replication (No). Consider all molecular properties provided to assess the compound's potential as an antiviral agent against HIV.
Target Molecule (Smiles): CCOC(=O)Nn1c(C)cc(C(=O)OC)c1C
HIV Inhibition:
| <boolean>No</boolean> | CCOC(=O)Nn1c(C)cc(C(=O)OC)c1C | random | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict whether this molecule can inhibit HIV replication (Yes) or cannot inhibit HIV replication (No). Consider all molecular properties provided to assess the compound's potential as an antiviral agent against HIV.
Target Molecule (Smiles): CC1(C)OCC(C2OC3OC(C)(C)OC3C2c2ccccc2)O1
HIV Inhibition:
| <boolean>No</boolean> | CC1(C)OCC(C2OC3OC(C)(C)OC3C2c2ccccc2)O1 | random | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict whether this molecule can inhibit HIV replication (Yes) or cannot inhibit HIV replication (No). Consider all molecular properties provided to assess the compound's potential as an antiviral agent against HIV.
Target Molecule (Smiles): CN1CCN(CCSSCCN2CCN(C)CC2)CC1
HIV Inhibition:
| <boolean>No</boolean> | CN1CCN(CCSSCCN2CCN(C)CC2)CC1 | random | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict whether this molecule can inhibit HIV replication (Yes) or cannot inhibit HIV replication (No). Consider all molecular properties provided to assess the compound's potential as an antiviral agent against HIV.
Target Molecule (Smiles): CN1CC=C(OP(=O)(NCc2ccccc2)N(CCCl)CCCl)CC1.O=C(O)C(=O)O
HIV Inhibition:
| <boolean>No</boolean> | CN1CC=C(OP(=O)(NCc2ccccc2)N(CCCl)CCCl)CC1.O=C(O)C(=O)O | random | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict whether this molecule can inhibit HIV replication (Yes) or cannot inhibit HIV replication (No). Consider all molecular properties provided to assess the compound's potential as an antiviral agent against HIV.
Target Molecule (Smiles): COc1cc(Nc2cc(Cl)cc(Cl)c2)nc(N)n1
HIV Inhibition:
| <boolean>No</boolean> | COc1cc(Nc2cc(Cl)cc(Cl)c2)nc(N)n1 | random | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict whether this molecule can inhibit HIV replication (Yes) or cannot inhibit HIV replication (No). Consider all molecular properties provided to assess the compound's potential as an antiviral agent against HIV.
Target Molecule (Smiles): C[n+]1ccc(-c2nc(-c3cc[n+](C)cc3)nc(-c3cc[n+](C)cc3)n2)cc1
HIV Inhibition:
| <boolean>No</boolean> | C[n+]1ccc(-c2nc(-c3cc[n+](C)cc3)nc(-c3cc[n+](C)cc3)n2)cc1 | random | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict whether this molecule can inhibit HIV replication (Yes) or cannot inhibit HIV replication (No). Consider all molecular properties provided to assess the compound's potential as an antiviral agent against HIV.
Target Molecule (Smiles): CCOc1nc(C(=O)O)cc2ccsc12
HIV Inhibition:
| <boolean>No</boolean> | CCOc1nc(C(=O)O)cc2ccsc12 | random | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict whether this molecule can inhibit HIV replication (Yes) or cannot inhibit HIV replication (No). Consider all molecular properties provided to assess the compound's potential as an antiviral agent against HIV.
Target Molecule (Smiles): [Cl-].[O+]#C[Ru-4]12(C#[O+])(C#[O+])[PH](c3ccccc3)(CC[PH]1(c1ccccc1)c1ccccc1)CC[PH]2(c1ccccc1)c1ccccc1
HIV Inhibition:
| <boolean>No</boolean> | [Cl-].[O+]#C[Ru-4]12(C#[O+])(C#[O+])[PH](c3ccccc3)(CC[PH]1(c1ccccc1)c1ccccc1)CC[PH]2(c1ccccc1)c1ccccc1 | random | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict whether this molecule can inhibit HIV replication (Yes) or cannot inhibit HIV replication (No). Consider all molecular properties provided to assess the compound's potential as an antiviral agent against HIV.
Target Molecule (Smiles): Cc1nc(Nc2ccccc2Cl)sc1C(=O)CC(=O)C(N)=O
HIV Inhibition:
| <boolean>No</boolean> | Cc1nc(Nc2ccccc2Cl)sc1C(=O)CC(=O)C(N)=O | random | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict whether this molecule can inhibit HIV replication (Yes) or cannot inhibit HIV replication (No). Consider all molecular properties provided to assess the compound's potential as an antiviral agent against HIV.
Target Molecule (Smiles): COc1ccc(C2NC(=S)N3C(c4ccc(OC)c(OC)c4)NC(=S)N23)cc1OC
HIV Inhibition:
| <boolean>No</boolean> | COc1ccc(C2NC(=S)N3C(c4ccc(OC)c(OC)c4)NC(=S)N23)cc1OC | random | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict whether this molecule can inhibit HIV replication (Yes) or cannot inhibit HIV replication (No). Consider all molecular properties provided to assess the compound's potential as an antiviral agent against HIV.
Target Molecule (Smiles): O=C(Nc1cccc(C2=NCCN2)c1)Nc1cccc(C2=NCCN2)c1
HIV Inhibition:
| <boolean>No</boolean> | O=C(Nc1cccc(C2=NCCN2)c1)Nc1cccc(C2=NCCN2)c1 | random | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict whether this molecule can inhibit HIV replication (Yes) or cannot inhibit HIV replication (No). Consider all molecular properties provided to assess the compound's potential as an antiviral agent against HIV.
Target Molecule (Smiles): O=S(=O)(O)SCCNCC(O)C(O)CNCCSS(=O)(=O)O
HIV Inhibition:
| <boolean>No</boolean> | O=S(=O)(O)SCCNCC(O)C(O)CNCCSS(=O)(=O)O | random | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict whether this molecule can inhibit HIV replication (Yes) or cannot inhibit HIV replication (No). Consider all molecular properties provided to assess the compound's potential as an antiviral agent against HIV.
Target Molecule (Smiles): CSCCC(NC(=O)c1ccccc1C(=O)O)C(=O)O
HIV Inhibition:
| <boolean>No</boolean> | CSCCC(NC(=O)c1ccccc1C(=O)O)C(=O)O | random | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict whether this molecule can inhibit HIV replication (Yes) or cannot inhibit HIV replication (No). Consider all molecular properties provided to assess the compound's potential as an antiviral agent against HIV.
Target Molecule (Smiles): Cc1cc(S(=O)(=O)Nc2nc(Nc3ccccc3)n[nH]2)c(SCC(=O)O)cc1Cl
HIV Inhibition:
| <boolean>No</boolean> | Cc1cc(S(=O)(=O)Nc2nc(Nc3ccccc3)n[nH]2)c(SCC(=O)O)cc1Cl | random | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict whether this molecule can inhibit HIV replication (Yes) or cannot inhibit HIV replication (No). Consider all molecular properties provided to assess the compound's potential as an antiviral agent against HIV.
Target Molecule (Smiles): COc1cc2c(cc1OC)C1CC3(CC4c5cc(OC)c(OC)cc5CCN4CC3CO)C(CO)CN1CC2
HIV Inhibition:
| <boolean>No</boolean> | COc1cc2c(cc1OC)C1CC3(CC4c5cc(OC)c(OC)cc5CCN4CC3CO)C(CO)CN1CC2 | random | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict whether this molecule can inhibit HIV replication (Yes) or cannot inhibit HIV replication (No). Consider all molecular properties provided to assess the compound's potential as an antiviral agent against HIV.
Target Molecule (Smiles): CCCC(=O)NC(Nc1ccc(F)cc1)(C(F)(F)F)C(F)(F)F
HIV Inhibition:
| <boolean>No</boolean> | CCCC(=O)NC(Nc1ccc(F)cc1)(C(F)(F)F)C(F)(F)F | random | 0 | smiles | |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict whether this molecule can inhibit HIV replication (Yes) or cannot inhibit HIV replication (No). Consider all molecular properties provided to assess the compound's potential as an antiviral agent against HIV.
Target Molecule (Smiles): Cc1cnc2nc(N)nc(N)c2n1
HIV Inhibition:
| <boolean>No</boolean> | Cc1cnc2nc(N)nc(N)c2n1 | random | 0 | smiles |
End of preview. Expand
in Data Studio
HIV-V-SMILES Train Dataset
Dataset Description
This dataset contains molecular data with visual representations for HIV related compounds.
Features
- Question: Question related to the molecule
- Answer: Corresponding answer
- TargetMolecule: SMILES representation of the target molecule
- SampleMethod: Method used for sampling
- SampleNum: Sample number
- SampleRep: Sample repetition
- image: Generated molecular structure image from SMILES
Dataset Statistics
- Total samples: 32000
- Image format: PIL Image (RGB)
- Image size: 300x300 pixels
Usage
from datasets import load_dataset
dataset = load_dataset("molvision/HIV-V-Train")
Data Fields
Question(string): Question textAnswer(string): Answer textTargetMolecule(string): SMILES representationSampleMethod(string): Sampling methodSampleNum(int): Sample numberSampleRep(string): Sample repetitionimage(PIL.Image): Molecular structure visualization
Citation
Please cite this dataset if you use it in your research.
- Downloads last month
- 14