MMTEB: Massive Multilingual Text Embedding Benchmark
Paper
• 2502.13595 • Published
• 45
sentence1 string | sentence2 string | labels int64 |
|---|---|---|
alpha-D-kanosamine(1+) | C[C@H]1[C@H]([C@H](C[C@@H](O1)O[C@@H]2C[C@](CC3=C2C(=C4C(=C3O)C(=O)C5=CC=CC=C5C4=O)O)(C(=O)C)O)N)O | 0 |
Norgestrienone is a steroid. It has a role as an estrogen. | CC[C@@H]1C[C@@H](C2=C(N1C(=O)OCC)C=CC(=C2)C(F)(F)F)N(CC3=CC(=CC(=C3)C(F)(F)F)C(F)(F)F)C(=O)OC | 0 |
Pyrrolnitrin is a member of the class of pyrroles carrying chloro and 3-chloro-2-nitrophenyl substituents at positions 3 and 4 respectively. It has a role as a bacterial metabolite and an antifungal drug. It is a member of pyrroles, a member of monochlorobenzenes, a C-nitro compound and an alkaloid. | C1=CC(=C(C(=C1)Cl)[N+](=O)[O-])C2=CNC=C2Cl | 1 |
Kentsin is an oligopeptide. | C[C@H]1CCC(=O)[C@]2([C@]1(C[C@@H](CC2)C(=C)C)O)C | 0 |
(2xi)-D-gluco-heptonic acid | C([C@H]([C@H]([C@@H]([C@H](C(C(=O)O)O)O)O)O)O)O | 1 |
Gaillardin is a sesquiterpene lactone. | C[C@H](CC[C@H](C)C(=C)C)[C@H]1CC[C@@]2([C@@]1(CC[C@]34[C@H]2CC[C@@H]5[C@]3(C4)CC[C@@H](C5(C)C)O)C)C | 0 |
1-Acetylaspidoalbidine is a member of carbazoles. | CC(=O)N[C@@H]1[C@H](CC(O[C@H]1[C@@H]([C@@H](COP(=O)(O)O)O)O)(C(=O)O)O)O | 0 |
Petunidin 3-glucoside | C1=CC=C(C=C1)C[C@@H](C(=O)N[C@@H](CC2=CC=CC=C2)C(=O)O)NC(=O)CN | 0 |
1,5-Dimethylnaphthalene | CCN(CC)CCOC1=CC2=C(C=C1)N=C(S2)N(C)C | 0 |
5,6-dimethoxy-N,N-dipropyl-2,3-dihydro-1H-inden-2-amine is a member of indanes. | C1=CC(=C(C=C1C2=CC(=C(C=C2)Cl)Cl)Cl)Cl | 0 |
N,N'-Diacetyl-lysine is a N-acyl-amino acid. | CC(=O)NCCCCC(C(=O)O)NC(=O)C | 1 |
3-Methoxy-16-octylestra-1,3,5(10)-triene-16beta,17beta-diol is a steroid. It derives from a hydride of an estrane. | CCCCCCCC[C@@]1(C[C@H]2[C@@H]3CCC4=C([C@H]3CC[C@@]2([C@H]1O)C)C=CC(=C4)OC)O | 1 |
Propranolol glucuronide | C([C@H]([C@H]([C@@H]([C@H](C=O)N)O)O)O)OP(=O)(O)O | 0 |
Chlorfenprop-methyl is a member of monochlorobenzenes. | C[N+]1(CCCC1C(=O)[O-])C | 0 |
Troxipide | C(C(C(=O)O)O)(C(=O)O)O | 0 |
methyl (6aR,10aR)-6a,12-dihydroxy-3,8,10a-trimethoxy-1-methyl-6,7,10,11-tetraoxo-6,6a,7,10,10a,11-hexahydrotetracene-2-carboxylate | CC1=C(C(=CC2=CC3=C(C(=C12)O)C(=O)[C@@]4(C(=O)C=C(C(=O)[C@@]4(C3=O)O)OC)OC)OC)C(=O)OC | 1 |
Gibberellin A24 | C[C@@H]1CC[C@H]2[C@@H]1[C@@H](OC=C2C(=O)OC)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O | 0 |
(-)-Acanthocarpan is a member of pterocarpans. | CC1=C[C@@H]2[C@@H](CC[C@H]3N2[C@H](C1)C[C@H]4N3C(=O)CCC4)O | 0 |
Dihydrodehydrodiconiferyl alcohol | C[C@@H]1C[C@@H]2[C@@H]([C@@H](C(=O)O2)C)[C@@H]([C@]3([C@H]1C=CC3=O)C)OC(=O)C(=C)C | 0 |
Epi-Tulipinolide diepoxide is a gamma-lactone. | CCCCN(CCCC)CC[C@@H](C1=C2C=CC(=CC2=C3C=C(C=C(C3=C1)Cl)Cl)C(F)(F)F)O | 0 |
Phenethyl decanoate | C1=CC(=CN=C1)CCC(=O)O | 0 |
Oxacyclotetradecan-2-one | CC1=NC=C(C(=C1O)C(=O)O)CO | 0 |
Calcimycin is an aminobenzoic acid. | CCN(CC)C(=O)C1=CC=C(C=C1)[C@H](C2=CC(=CC=C2)O)N3C[C@H](N(C[C@@H]3C)CC=C)C | 0 |
Betamethasone Dipropionate | CC[C@H]1CN2CCC3=CC(=C(C=C3[C@@H]2C[C@@H]1C[C@@H]4C5=CC(=C(C=C5CCN4)OC)OC)OC)OC.O.Cl.Cl | 0 |
Indisetron | CC(=O)NC1CCC2=CC(=C(C(=C2C3=CC=C(C(=O)C=C13)SC)OC)OC)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O | 0 |
Phenylalanyl-prolyl-arginine | CC(C)(C[C@H]1C2=C([C@@H]([C@@]3(N1C(=O)[C@@H]4CCCN4C3=O)O)O)C5=C(N2)C=C(C=C5)OC)O | 0 |
Pentifylline | C(=O)(N)NS(=O)(=O)NC(=O)N | 0 |
(6R,7R)-7-[[2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-(4-hydroxyphenyl)acetyl]amino]-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid | C[C@@H]1CC[C@H]2[C@@H]1[C@@H](OC=C2C(=O)O)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O | 0 |
Boc-Asn-ONp | COC1=C2C3=C(C(=O)CC3)C(=O)OC2=C4[C@@H]5C[C@@H](O[C@@H]5OC4=C1)O | 0 |
2-Chlorobenzylidenemalononitrile is an organochlorine compound. | CC1=C(C(=CC=C1)C)NC2=NCCCS2 | 0 |
2,6-Dimethylnaphthalene | CCOC(=O)CCC1=CC=CO1 | 0 |
5alpha-Pregnane-3alpha,20alpha-diol is a corticosteroid hormone. | C[C@H]1[C@H](C=CC2=CC(=O)[C@@](C[C@]12C)(C(=C)C=O)O)O | 0 |
Glycohyodeoxycholic acid is a bile acid glycine conjugate. | C[C@]12C[C@@H]([C@]3([C@H]([C@@H]1C[C@H]([C@@]2(C(=O)CO)O)O)CCC4=CC(=O)C=C[C@@]43C)F)O | 0 |
Oxacyclohexadecan-2-one | CC1=CC2=C(C=C1S(=O)(=O)N)S(=O)(=O)CCC2 | 0 |
N-acetyl-o-fluoro-dl-phenylalanine is a phenylalanine derivative. | CC1=CC=C(C=C1)COC(=O)C | 0 |
Homocystine is an organic disulfide obtained by oxidative dimerisation of homocysteine. It has a role as a human metabolite. It is a tautomer of a homocystine zwitterion. | CC(NC(=O)C(CC(=O)O)N)NC(=O)N(C)C(C)(C)C | 0 |
[5-[5-[5-(hydroxymethyl)-2-thiophenyl]-2-furanyl]-2-thiophenyl]methanol is a member of thiophenes. | CC1=NC=C(N1C)[N+](=O)[O-] | 0 |
4-Ethylphenyl 2-thienyl ketone | C1CCC2=C(C1)N=C3CCCCC3=N2 | 0 |
Tiomesterone | CO[C@H]1C[C@H]2[C@]3(CCN2[C@@H](C4=CC5=C(C=C43)OCO5)O)C=C1 | 0 |
Fenchlorphos is an organic thiophosphate. | CC(C)COC(=O)C1=CC=CC=C1 | 0 |
6alpha-Fluoropregn-4-ene-3,20-dione | CC[C@H](CC[C@@H](C)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC=C4[C@@]3(CC[C@@H](C4)O)C)C)C(C)C | 0 |
Selenate is a divalent inorganic anion obtained by removal of both protons from selenic acid. It has a role as a human metabolite. It is a selenium oxoanion and a divalent inorganic anion. It is a conjugate base of a hydrogenselenate. | COC1=CC(=O)C2=C(C1=O)C(=C(C=C2O)OC)O | 0 |
Rollinecin A is a polyketide. | C[C@]12CCC(=O)C=C1C=C[C@@H]3[C@@H]2CC[C@]4([C@H]3CCC(=O)O4)C | 0 |
2-(N-Propyl-N-phenethylamino)-5-hydroxytetralin | CCCN(CCC1=CC=CC=C1)C2CCC3=C(C2)C=CC=C3O | 1 |
Esprocarb | C1=CC(=C(C(=C1)Cl)C#N)Cl | 0 |
N6,N6-Dimethyladenosine | C[C@H](CC[C@@H](C)C(C)C)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC=C4[C@@]3(CC[C@@H](C4)O)C)C | 0 |
(3S,5S,10S,13R,14R,17R)-10,13-dimethyl-17-[(2R)-6-methylhept-5-en-2-yl]-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol | COC1=C(C2=C3[C@@H](CC24C=CC(=O)C=C4)NCCC3=C1)OC | 0 |
N-acetyl-alpha-L-talosaminuronic acid is a carbohydrate acid derivative that is alpha-L-talosaminuronic acid in which the hydroxy group at position 2 is substituted by an acetamido group. It is a carbohydrate acid derivative, an amino monosaccharide and a hexuronic acid derivative. | C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@@H]2OS(=O)(=O)O)CCC4=C3C=CC(=C4)O | 0 |
4-(alpha-(4-allyl-2,5-dimethyl-1-piperazinyl)-3-methoxybenzyl)-N,N-diethylbenzamide | C1=CC=C(C=C1)C[C@@H](C(=O)O)NC(=O)C2=CC=CC=C2 | 0 |
Tenulin is a sesquiterpene lactone. | C[C@]12CC[C@H]3[C@H]([C@@H]1C[C@H](C2=O)O)CCC4=C3C=CC(=C4)O | 0 |
Aniflorine is a member of quinazolines. | CCC1=C2CN3C(=CC4=C(C3=O)COC(=O)[C@@]4(CC)O)C2=NC5=CC=CC=C51 | 0 |
Desipramine | C1NC2=CC(=C(C=C2S(=O)(=O)N1)S(=O)(=O)N)Cl | 0 |
Terguride is an organic molecular entity. | CC(=O)[C@]12C[C@@H](CC[C@]1(CC[C@@H]2O)C)C(=C)C(=O)O | 0 |
Methyl citronellate | CC1=NC=C(C(=C1O)CO)COP(=O)(O)O | 0 |
Norfentanyl | C1=CC=C(C=C1)[N+](=O)[O-] | 0 |
Talwin | CC1=C(C(=O)NC(=O)N1)CO | 0 |
Tibolone is estran-3-one with a double bond between positions 5 and 10, and bearing both an ethynyl group and a hydroxy group at position 17 (R-configuration). A synthetic steroid hormone drug which acts as an agonist at all five type I steroid hormone receptors, it is used in the prevention of postmenopausal osteoporosis and for treatment of endometriosis. It has a role as a hormone agonist and a bone density conservation agent. It is a 17beta-hydroxy steroid and a terminal acetylenic compound. | CC(=CCC/C(=C/CC/C(=C/COP(=O)(O)OP(=O)(O)O)/C)/C)C | 0 |
Stipitatonic acid is a cycloheptafuran and a cyclic dicarboxylic anhydride. It is a conjugate acid of a stipitaton-4-olate. | CC(CCCCCCCCC(=O)O)O | 0 |
5-(beta-D-galactosyloxy)-L-lysine is a 5-glycosyloxy-L-lysine in which the glycosyl fragment is specified as beta-D-galactose. | C[C@H]1CCC/C(=C\C[C@H](OC(=O)C[C@@H](C(C(=O)[C@@H]([C@H]1O)C)(C)C)O)/C(=C/C2=CSC(=N2)C)/C)/C | 0 |
4-(Prop-2-en-1-yl)decahydro-8H-1,5-methanopyrido[1,2-a][1,5]diazocin-8-one | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)OC2=CC(=CC(=C2C(=O)CCC3=CC=C(C=C3)O)O)O)O)O)O | 0 |
Dicyanoaurate(1-) is a gold coordination entity. | CCOC1=CC(=CC(=C1)OCCN2CCOCC2)OCC | 0 |
2-prenyl-1,4-benzoquinone is a member of the class of 1,4-benzoquinones that is 1,4-benzoquinone in which the hydrogen at position 2 has been replaced by a prenyl group. It is functionally related to a 1,4-benzoquinone. | C1=CC2=C(C(=C(C=C2S(=O)(=O)O)I)O)N=C1 | 0 |
N,N-Diethylbenzamide | C1=CC=C2C(=C1)NC3=CC=CC=C3N2 | 0 |
Cholesta-1,4-dien-3-one | CN1[C@H](CCC[C@H]1C[C@@H](C2=CC=CC=C2)O)C[C@H](C3=CC=CC=C3)O | 0 |
2-fluorophenylalanine is a phenylalanine derivative in which the hydrogen at position 2 on the benzene ring is replaced by a fluoro group. It is a phenylalanine derivative, a non-proteinogenic alpha-amino acid and a member of monofluorobenzenes. | CC1=CC=C(C=C1)[N+](=O)[O-] | 0 |
Methyl henicosanoate is a fatty acid methyl ester resulting from the formal condensation of the carboxy group of henicosanoic acid with methanol. It has a role as a plant metabolite. It is functionally related to a henicosanoic acid. | C1=CC2=C3C(=C(C=C2)O)C=CC4=C(C=CC1=C43)O | 0 |
3beta-Hydroxy-12-oxo-5beta-chol-9(11)-en-24-oic Acid is a bile acid. | CC(C)C[C@@H](C(=O)N[C@@H](CC1=CC=CC=C1)C(=O)OC)NC(=O)[C@H](CCSC)NC=O | 0 |
Isoflavone 7-O-beta-D-glucoside | COC(=O)[C@H](CCCN(C1=CC=C(C=C1)[N+](=O)[O-])C2=CC=C(C=C2)[N+](=O)[O-])N | 0 |
2-Acetyl-3-ethylpyrazine | CCC1=NC=CN=C1C(=O)C | 1 |
Methyl alpha-D-mannoside is a methyl mannoside having alpha-configuration at the anomeric centre. It is a methyl mannoside and an alpha-D-mannoside. | CC(=O)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2C[C@H](C4=CC(=O)CC[C@]34C)O)C | 0 |
Egomaketone is an aromatic ketone. | COC1=CC=C(C=C1)C(=O)O | 0 |
2,4-dimethylbenzoic acid is a dimethylbenzoic acid in which the two methyl groups are located at positions 2 and 4. It has a role as a metabolite. It is functionally related to a benzoic acid. It is a conjugate acid of a 2,4-dimethylbenzoate. | CCCC(C(=O)C1=CC=C(C=C1)C)NCC | 0 |
Caffeine, 8-benzyl- | CC(=O)NC(CCS(=O)C)C(=O)O | 0 |
3,5-Diiodo-L-thyronine | C1=CC(=CC=C1O)OC2=C(C=C(C=C2I)C[C@@H](C(=O)O)N)I | 1 |
4-Chloroindole-3-acetic acid | C1=CC2=C(C(=C1)Cl)C(=CN2)CC(=O)O | 1 |
7-cyano-2,3,4,5-tetrahydro-1-(1H-imidazol-4-ylmethyl)-3-(phenylmethyl)-4-(2-thienylsulfonyl)-1H-1,4-benzodiazepine | C([C@@H]1[C@H]([C@@H]([C@](O1)(COC[C@@H]2[C@H]([C@@H]([C@](O2)(CO)O)O)O)O)O)O)O | 0 |
Glyclopyramide is a sulfonamide. | CSC(=O)C1=C2C(=CC=C1)N=NS2 | 0 |
O-desmethylvenlafaxine is a tertiary amino compound that is N,N-dimethylethanamine substituted at position 1 by a 1-hydroxycyclohexyl and 4-hydroxyphenyl group. It is a metabolite of the drug venlafaxine. It has a role as a marine xenobiotic metabolite, a drug metabolite and an antidepressant. It is a member of cyclohexanols, a member of phenols and a tertiary amino compound. | CC(=O)NNC1=CC(=C(C=C1)O)C=O | 0 |
Idebenone | COC1=CC(=C(C=C1)C=O)O | 0 |
Streptamine 5-phosphate is a scyllo-inositol phosphate compound having a phosphate group in the 5-position and amino groups in place of hydroxy groups in the 1- and 3-positions. It is functionally related to a streptamine. | C[C@@H]1[C@H](C(=O)[C@]2([C@H]([C@]1(C)C[C@H]([C@@]3(CO3)C(=O)C=O)O)CCC=C2C)C)O | 0 |
Plantagoside | C([C@@H]1[C@H]([C@@H]([C@H]([C@H](O1)O[C@H]2[C@@H]([C@H](OC([C@@H]2O)O)CO)O)O)O)O)O | 0 |
N-Methyl-DL-glutamic acid is a glutamic acid derivative. | C1OC2=C(O1)C=C(C=C2)O | 0 |
Asn-Gln | C[C@]12CCCC([C@@H]1CC=C3[C@@H]2C(=O)OC3)(C)C | 0 |
Epoxycholesterol | C[C@]12CCC(=O)C=C1[C@@H](C[C@@H]3[C@@H]2CC[C@]4([C@H]3CCC(=O)O4)C)O | 0 |
Ethyl tridecanoate | CC1=CCC(CC1)C(C)CC=O | 0 |
Betamipron is an organonitrogen compound and an organooxygen compound. It is functionally related to a beta-amino acid. | CCCCCCCCCCCCC(C(=O)O)O | 0 |
Cholesta-5,7-diene-1alpha,3beta-diol | C[C@H](CCCC(C)C)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3C2=CC=C4[C@@]3([C@H](C[C@@H](C4)O)O)C)C | 1 |
Calamendiol | CN1CCC2=CC(=C(C=C2[C@@]13[C@H](C4=C(C3=O)C=CC5=C4OCO5)O)O)OC | 0 |
M-trimethylammonio(2,2,2-trifluoro-1,1-dihydroxyethyl)benzene is a quaternary ammonium ion that is the N,N,N-trimethyl derivative of 3-(2,2,2-trifluoro-1,1-dihydroxyethyl)aniline. | CC1=C(C(=CC=C1)C(=O)O)N | 0 |
1D-myo-inositol 6-phosphate | [C@@H]1([C@H](C([C@H]([C@@H](C1O)O)O)OP(=O)(O)O)O)O | 1 |
1-(2,6-Dihydroxy-4-methoxyphenyl)-3-phenylpropan-1-one | CN1C(=NC(=O)N(C1=O)C2CCCCC2)N(C)C | 0 |
4,5-Diamino-5-oxopentanoic acid | C(CC(=O)O)C(C(=O)N)N | 1 |
3',5'-Dihydroxyacetophenone is an aromatic ketone. | CC(=O)C1=CC(=CC(=C1)O)O | 1 |
PS(15:0/0:0) is a 1-acyl-sn-glycero-3-phosphoserine. | CC(C)C[C@@H](C(=O)NC(CC(C)C)C(=O)NC(CCCN=C(N)N)C=O)NC(=O)OC(C)(C)C | 0 |
Matricin | C[C@]12CC[C@H]3[C@H]([C@@H]1CCC2=O)[C@@H](C=C4[C@@]3(CC[C@@H](C4)O)C)O | 0 |
1-amino-1-cyclohexanecarboxylic acid is an alpha-amino acid that is cyclohexanecarboxylic acid substituted by an amino group at position 1. It is functionally related to a cyclohexanecarboxylic acid. | C1CCC(CC1)(C(=O)O)N | 1 |
(+)-neomenthyl beta-D-glucoside | C=C1[C@H]([C@H]([C@](O1)(CO)N2C=NC3=C(N=CN=C32)N)O)O | 0 |
Piperonyl butoxide | CC1=CC(=C(C(=C1)OC)OC)OC | 0 |
5,5-Dimethyl-1-pyrroline N-oxide | C1=C(ONC1=O)C(C(=O)O)N | 0 |
Picloram | CCCCCCCCCCCCOCCOCCOCCOCCOCCOCCOCCOCCO | 0 |
ChemTEB evaluates the performance of text embedding models on chemical domain data.
| Task category | t2t |
| Domains | Chemistry |
| Reference | https://arxiv.org/abs/2412.00532 |
You can evaluate an embedding model on this dataset using the following code:
import mteb
task = mteb.get_task("PubChemSMILESPC")
evaluator = mteb.MTEB([task])
model = mteb.get_model(YOUR_MODEL)
evaluator.run(model)
To learn more about how to run models on mteb task check out the GitHub repository.
If you use this dataset, please cite the dataset as well as mteb, as this dataset likely includes additional processing as a part of the MMTEB Contribution.
@article{kasmaee2024chemteb,
author = {Kasmaee, Ali Shiraee and Khodadad, Mohammad and Saloot, Mohammad Arshi and Sherck, Nick and Dokas, Stephen and Mahyar, Hamidreza and Samiee, Soheila},
journal = {arXiv preprint arXiv:2412.00532},
title = {ChemTEB: Chemical Text Embedding Benchmark, an Overview of Embedding Models Performance \& Efficiency on a Specific Domain},
year = {2024},
}
@article{kim2023pubchem,
author = {Kim, Sunghwan and Chen, Jie and Cheng, Tiejun and Gindulyte, Asta and He, Jia and He, Siqian and Li, Qingliang and Shoemaker, Benjamin A and Thiessen, Paul A and Yu, Bo and others},
journal = {Nucleic acids research},
number = {D1},
pages = {D1373--D1380},
publisher = {Oxford University Press},
title = {PubChem 2023 update},
volume = {51},
year = {2023},
}
@article{enevoldsen2025mmtebmassivemultilingualtext,
title={MMTEB: Massive Multilingual Text Embedding Benchmark},
author={Kenneth Enevoldsen and Isaac Chung and Imene Kerboua and Márton Kardos and Ashwin Mathur and David Stap and Jay Gala and Wissam Siblini and Dominik Krzemiński and Genta Indra Winata and Saba Sturua and Saiteja Utpala and Mathieu Ciancone and Marion Schaeffer and Gabriel Sequeira and Diganta Misra and Shreeya Dhakal and Jonathan Rystrøm and Roman Solomatin and Ömer Çağatan and Akash Kundu and Martin Bernstorff and Shitao Xiao and Akshita Sukhlecha and Bhavish Pahwa and Rafał Poświata and Kranthi Kiran GV and Shawon Ashraf and Daniel Auras and Björn Plüster and Jan Philipp Harries and Loïc Magne and Isabelle Mohr and Mariya Hendriksen and Dawei Zhu and Hippolyte Gisserot-Boukhlef and Tom Aarsen and Jan Kostkan and Konrad Wojtasik and Taemin Lee and Marek Šuppa and Crystina Zhang and Roberta Rocca and Mohammed Hamdy and Andrianos Michail and John Yang and Manuel Faysse and Aleksei Vatolin and Nandan Thakur and Manan Dey and Dipam Vasani and Pranjal Chitale and Simone Tedeschi and Nguyen Tai and Artem Snegirev and Michael Günther and Mengzhou Xia and Weijia Shi and Xing Han Lù and Jordan Clive and Gayatri Krishnakumar and Anna Maksimova and Silvan Wehrli and Maria Tikhonova and Henil Panchal and Aleksandr Abramov and Malte Ostendorff and Zheng Liu and Simon Clematide and Lester James Miranda and Alena Fenogenova and Guangyu Song and Ruqiya Bin Safi and Wen-Ding Li and Alessia Borghini and Federico Cassano and Hongjin Su and Jimmy Lin and Howard Yen and Lasse Hansen and Sara Hooker and Chenghao Xiao and Vaibhav Adlakha and Orion Weller and Siva Reddy and Niklas Muennighoff},
publisher = {arXiv},
journal={arXiv preprint arXiv:2502.13595},
year={2025},
url={https://arxiv.org/abs/2502.13595},
doi = {10.48550/arXiv.2502.13595},
}
@article{muennighoff2022mteb,
author = {Muennighoff, Niklas and Tazi, Nouamane and Magne, Loïc and Reimers, Nils},
title = {MTEB: Massive Text Embedding Benchmark},
publisher = {arXiv},
journal={arXiv preprint arXiv:2210.07316},
year = {2022}
url = {https://arxiv.org/abs/2210.07316},
doi = {10.48550/ARXIV.2210.07316},
}
The following code contains the descriptive statistics from the task. These can also be obtained using:
import mteb
task = mteb.get_task("PubChemSMILESPC")
desc_stats = task.metadata.descriptive_stats
{}
This dataset card was automatically generated using MTEB