MMTEB: Massive Multilingual Text Embedding Benchmark
Paper
• 2502.13595 • Published
• 45
sentence1 string | sentence2 string | labels int64 |
|---|---|---|
Nadifloxacin | 9-Fluoro-6,7-dihydro-8-(4-hydroxy-1-piperidinyl)-5-methyl-1-oxo-1H,5H-benzo[ij]quinolizine-2-carboxylic Acid | 1 |
Ethanol | Art Naturals | 1 |
Digalacturonic acid | alpha-D-galactopyranuronosyl-(1->4)-D-galactopyranuronic acid | 1 |
Carbendazim | Equitdazin | 1 |
Isovaleric acid | DELPHINIC-ACID | 1 |
Methantheline | Methanthelinum | 1 |
Climbazole | 1-(4-chlorophenoxy)-1-imidazol-1-yl-3,3-dimethylbutan-2-one | 1 |
4-Ethyl-2-methoxyphenol | 4-Ethyl-2-methoxy phenol | 1 |
Adipic Acid | adipic acid | 1 |
Diisopropylethylamine | N-ethyldiiso-propyl-amine | 1 |
1,3-Diphenylguanidine | Melaniline | 1 |
Desthiobiotin | 6-(5-methyl-2-oxoimidazolidin-4-yl)hexanoic acid | 1 |
2-Butyne-1,4-diol | 1,4-Dimethoxyacetylene | 1 |
Promoxolane | WLN: T5O COTJ BY1&1 BY1&1 D1Q | 1 |
Iproniazid | Marsilid | 1 |
Diazepam | DIAZEPAM (IARC) | 1 |
Ractopamine | BENZENEMETHANOL, 4-HYDROXY-.ALPHA.-(((3-(4-HYDROXYPHENYL)-1-METHYLPROPYL)AMINO)METHYL)- | 1 |
Helium | HELIUM [WHO-DD] | 1 |
2-Fluoro-5-hydroxy-L-tyrosine | L-Tyrosine, 2-fluoro-5-hydroxy- | 1 |
Dihydroergotamine | Ergotamine, 9,10-dihydro- | 1 |
Trolnitrate phosphate | TROLNITRATE PHOSPHATE [MART.] | 1 |
2-Hydroxyethyl phosphate | 2-hydroxyethyl dihydrogen phosphate | 1 |
Triclocarban | DG BodyAntibacterial Deodorant 3.5 oz bar | 1 |
Carbon Disulfide | Dithioxomethane | 1 |
Cladribine | 6-amino-2-chloro-9-(2-deoxy-beta-D-erythro-pentofuranosyl)purine | 1 |
2-Chloro-p-phenylenediamine sulfate | 2-chlorobenzene-1,4-diamine;sulfuric acid | 1 |
2,4,6-Trinitrotoluene | 2,4,6-TRINITROTOLUENE | 1 |
Tedisamil | TEDISAMIL [WHO-DD] | 1 |
Meclizine Hydrochloride | Bonamine | 1 |
Iridium | Iridium, wire reel, 0.2m, diameter 1.0mm, as drawn, 99.9% | 1 |
Maprounic acid | 3-Hydroxyurs-12-en-29-oic acid | 1 |
Decahydronaphthalene | Decalin(R) | 1 |
Phenylpropanolamine | 1S,2R-PHENYLPROPANOLAMINE HYDROCHLORIDE | 1 |
Tridihexethyl bromide | 3-cyclohexyl-N,N,N-triethyl-3-hydroxy-3-phenylpropan-1-aminium bromide | 1 |
Edaravone | EDARAVONE [MART.] | 1 |
Tanshinone I | Tanshinone | 1 |
Dibucaine | Nupercainal | 1 |
alpha-Cotonefuran | 3,4,6-trimethoxydibenzo[b,d]furan-2,7-diol | 1 |
Isovalerylalanine | N-Isovalerylalanine | 1 |
Sodium Monofluorophosphate | Disodiummonofluorophosphate | 1 |
Laminine | Laminine | 1 |
Pyridoxal phosphate hydrate | 3-Hydroxy-2-methyl-5-((phosphonooxy)methyl)-4-pyridinecarboxaldehyde monohydrate | 1 |
Batyl alcohol | 3-(Octadecyloxy)-1,2-propanediol | 1 |
4-(Trifluoromethyl)phenol | 4-(trifluoromethyl)phenyl alcohol | 1 |
6-Methylmercaptopurine riboside | Purine-6-thiol, 6-methyl-9-ribofuranosyl- | 1 |
12alpha-Hydroxyprogesterone | 12.ALPHA.-HYDROXYPROGESTERONE | 1 |
(1S,2S)-1,2-dihydronaphthalene-1,2-diol | trans-1,2-Dihydronaphthalene-1,2-diol | 1 |
1,2,3,4,7,8,9-Heptachlorodibenzofuran | 1,2,3,4,7,8,9-HpCDF | 1 |
Sennoside B | (9R,9'S)-5,5'-bis(beta-D-glucopyranosyloxy)-4,4'-dihydroxy-10,10'-dioxo-9,9',10,10'-tetrahydro-9,9'-bianthracene-2,2'-dicarboxylic acid | 1 |
Roxindole | roxindol | 1 |
(+)-8-epi-Altholactone | (+)-8-epi-Altholactone | 1 |
(Methylthio)acetic acid | 2-methylsulfanylacetic acid | 1 |
Phosmet | S-PHTHALIMIDOMETHYL O,O-DIMETHYL PHOSPHORODITHIOATE | 1 |
Paramethasone | Dillar | 1 |
5alpha-Androstan-2-en-17beta-ol | Androst-2-en-17-ol | 1 |
Triiodothyronine sulfate | 3,5,3'-Triiodo-L-thyronine 4'-O-sulphate | 1 |
gamma-Heptalactone | 5-propyldihydrofuran-2(3h)-one | 1 |
Sulfadiazine | Thi-Di-Mer | 1 |
Doramapimod | Doramapimod (USAN/INN) | 1 |
4'-Hydroxydiclofenac | Diclofenac-4-hydroxy | 1 |
Cyclobenzaprine | Ciclobenzaprina (INN-Spanish) | 1 |
Hexachlorobenzene | NO Bunt liquid | 1 |
Azelastine Hydrochloride | Azelastine Hydrochloride 1.0 mg/ml in Methanol (as free base) | 1 |
Glutathione | GLUTATHIONE [MART.] | 1 |
Antibiotic Bu 2545 | N-[2-methoxy-1-(3,4,5-trihydroxy-6-methylsulanyloxan-2-yl)propyl]-1-methylpyrrolidine-2-carboxamide | 1 |
17-Hydroxyandrost-4-en-3-one | 17-Hydroxy-10,13-dimethyl-1,2,6,7,8,9,10,11,12,13,14,15,16,17-tetradecahydro-cyclopenta[a]phenanthren-3-one(testosterone) | 1 |
1-Hydroxyisoquinoline | InChI=1/C9H7NO/c11-9-8-4-2-1-3-7(8)5-6-10-9/h1-6H,(H,10,11 | 1 |
Tantalum | Tantalum, foil, 0.5m coil, thickness 0.03mm, coil width 1.2mm, annealed, 99.9% | 1 |
D-Psicose | D-Psicopyranoside | 1 |
Dexetimide | (+)-Benzetimide | 1 |
3-O-Acetylpinobanksin | rac-Pinobanksin Acetate | 1 |
Doxylamine Succinate | DIMETHYLAMINOETHOXYMETHYLBENZYLPYRIDINE SUCCINATE | 1 |
Angiotensin IV | Angiotensin II (3-8), human | 1 |
Ciprofloxacin | CIPROFLOXACIN (USP-RS) | 1 |
N-Acetylhistamine | N-[2-(1H-Imidazol-4-yl)ethyl]acetamide # | 1 |
Hydralazine Hydrochloride | 1(2H)-Phthalazinone, hydrazone, hydrochloride | 1 |
Dibenzyl disulfide | Benzyl disulfide, 8CI | 1 |
Dimethylphenylpiperazinium | Piperazinium, 1,1-dimethyl-4-phenyl- | 1 |
Chromic acid | tetraoxochromic acid | 1 |
Lanthanum | La(2+) | 1 |
2-(Methylthio)ethanol | 2-(METHYLTHIO)ETHANOL [FHFI] | 1 |
1,3-Dinitroglycerin | 2-hydroxypropane-1,3-diyl dinitrate | 1 |
2H-Chromene | 1,2-Benzopyran | 1 |
Isotanshinone IIB | Isotanshinone IIB | 1 |
2-Hydroxypiperitone | 2-Hydroxypiperitone | 1 |
Tetracaine Hydrochloride | 2-(Dimethylamino)ethyl p-(butylamino)benzoate monohydrochloride | 1 |
4'-Hydroxyacetophenone | 4''-hydroxyacetophenone | 1 |
Sulfometuron-methyl | SULFOMETURON-METHYL [MI] | 1 |
Picric Acid | Pikrinsaeure [German] | 1 |
Phosphothiophosphoric acid-adenylate ester | Adenosine 5'-(trihydrogen diphosphate), P'-anhydride with phosphorothioic acid (9CI) | 1 |
Barium acetate | Octan barnaty [Czech] | 1 |
2-Aminotetradecanoic acid | 2-aminotetradecanoic acid | 1 |
Bombykol | LZT8R8TVZ7 | 1 |
n-(5-Aminopentyl)acetamide | Monoacetylcadaverine | 1 |
Gliquidone | ARDF-26 | 1 |
Ethylene Glycol | FC72KVT52F | 1 |
Cetraxate | Cetraxate [INN] | 1 |
Tramiprosate | 3-amino-1-propane sulfonic acid | 1 |
2,2',4,4',6,6'-Hexachlorobiphenyl | HEXACHLOROBIPHENYL, 2,4,6,2',4',6'- | 1 |
(2S)-2-Hydroxybutanedioic acid | (S)-Hydroxybutanedioate | 1 |
ChemTEB evaluates the performance of text embedding models on chemical domain data.
| Task category | t2t |
| Domains | Chemistry |
| Reference | https://arxiv.org/abs/2412.00532 |
You can evaluate an embedding model on this dataset using the following code:
import mteb
task = mteb.get_task("PubChemSynonymPC")
evaluator = mteb.MTEB([task])
model = mteb.get_model(YOUR_MODEL)
evaluator.run(model)
To learn more about how to run models on mteb task check out the GitHub repository.
If you use this dataset, please cite the dataset as well as mteb, as this dataset likely includes additional processing as a part of the MMTEB Contribution.
@article{kasmaee2024chemteb,
author = {Kasmaee, Ali Shiraee and Khodadad, Mohammad and Saloot, Mohammad Arshi and Sherck, Nick and Dokas, Stephen and Mahyar, Hamidreza and Samiee, Soheila},
journal = {arXiv preprint arXiv:2412.00532},
title = {ChemTEB: Chemical Text Embedding Benchmark, an Overview of Embedding Models Performance \& Efficiency on a Specific Domain},
year = {2024},
}
@article{kim2023pubchem,
author = {Kim, Sunghwan and Chen, Jie and Cheng, Tiejun and Gindulyte, Asta and He, Jia and He, Siqian and Li, Qingliang and Shoemaker, Benjamin A and Thiessen, Paul A and Yu, Bo and others},
journal = {Nucleic acids research},
number = {D1},
pages = {D1373--D1380},
publisher = {Oxford University Press},
title = {PubChem 2023 update},
volume = {51},
year = {2023},
}
@article{enevoldsen2025mmtebmassivemultilingualtext,
title={MMTEB: Massive Multilingual Text Embedding Benchmark},
author={Kenneth Enevoldsen and Isaac Chung and Imene Kerboua and Márton Kardos and Ashwin Mathur and David Stap and Jay Gala and Wissam Siblini and Dominik Krzemiński and Genta Indra Winata and Saba Sturua and Saiteja Utpala and Mathieu Ciancone and Marion Schaeffer and Gabriel Sequeira and Diganta Misra and Shreeya Dhakal and Jonathan Rystrøm and Roman Solomatin and Ömer Çağatan and Akash Kundu and Martin Bernstorff and Shitao Xiao and Akshita Sukhlecha and Bhavish Pahwa and Rafał Poświata and Kranthi Kiran GV and Shawon Ashraf and Daniel Auras and Björn Plüster and Jan Philipp Harries and Loïc Magne and Isabelle Mohr and Mariya Hendriksen and Dawei Zhu and Hippolyte Gisserot-Boukhlef and Tom Aarsen and Jan Kostkan and Konrad Wojtasik and Taemin Lee and Marek Šuppa and Crystina Zhang and Roberta Rocca and Mohammed Hamdy and Andrianos Michail and John Yang and Manuel Faysse and Aleksei Vatolin and Nandan Thakur and Manan Dey and Dipam Vasani and Pranjal Chitale and Simone Tedeschi and Nguyen Tai and Artem Snegirev and Michael Günther and Mengzhou Xia and Weijia Shi and Xing Han Lù and Jordan Clive and Gayatri Krishnakumar and Anna Maksimova and Silvan Wehrli and Maria Tikhonova and Henil Panchal and Aleksandr Abramov and Malte Ostendorff and Zheng Liu and Simon Clematide and Lester James Miranda and Alena Fenogenova and Guangyu Song and Ruqiya Bin Safi and Wen-Ding Li and Alessia Borghini and Federico Cassano and Hongjin Su and Jimmy Lin and Howard Yen and Lasse Hansen and Sara Hooker and Chenghao Xiao and Vaibhav Adlakha and Orion Weller and Siva Reddy and Niklas Muennighoff},
publisher = {arXiv},
journal={arXiv preprint arXiv:2502.13595},
year={2025},
url={https://arxiv.org/abs/2502.13595},
doi = {10.48550/arXiv.2502.13595},
}
@article{muennighoff2022mteb,
author = {Muennighoff, Niklas and Tazi, Nouamane and Magne, Loïc and Reimers, Nils},
title = {MTEB: Massive Text Embedding Benchmark},
publisher = {arXiv},
journal={arXiv preprint arXiv:2210.07316},
year = {2022}
url = {https://arxiv.org/abs/2210.07316},
doi = {10.48550/ARXIV.2210.07316},
}
The following code contains the descriptive statistics from the task. These can also be obtained using:
import mteb
task = mteb.get_task("PubChemSynonymPC")
desc_stats = task.metadata.descriptive_stats
{}
This dataset card was automatically generated using MTEB