Datasets:
task_id int64 101 206 | prompt stringlengths 115 242 | input_smiles stringlengths 14 103 | output_smiles stringlengths 4 125 | action_type stringclasses 3
values | edit stringlengths 9 126 | target_delta float64 -5.49 6 ⌀ | SA_delta float64 -4.44 4.26 | MW_delta float64 -318.31 272 | QED_delta float64 -0.76 0.66 | murcko_scaffold_retained bool 2
classes |
|---|---|---|---|---|---|---|---|---|---|---|
105 | Can you make molecule O=C(NC[C@H]1CCC[C@@H]1O)Nc1nc(-c2ccccc2)ns1 higher permeability? The output molecule should be similar to the input molecule. | O=C(NC[C@H]1CCC[C@@H]1O)Nc1nc(-c2ccccc2)ns1 | O=C(NC[C@H]1CCC[C@@H]1O)Nc1ncc(-c2ccccc2)s1 | replace | replaced c1ncsn1 with c1nc[*]sc1[*] | 0.605 | -0.086409 | -0.988 | 0.002948 | false |
102 | Can you make molecule CCOC(=O)[C@H]1C=C(C#N)O[C@@H](c2ccc(C)cc2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)[C@H]1C=C(C#N)O[C@@H](c2ccc(C)cc2)C1 | CCOC(=O)[C@H]1C=C(C#N)O[C@@H](N2C[C@H](c3ccc(C)cc3)CC[C@H]2C)C1 | insert | inserted N1[*]C[C@H][*]CC[C@H]1C connected to N#CC1=CCCCO1, Cc1ccccc1 | 0.8529 | 0.647793 | 97.161 | -0.038205 | false |
101 | Can you make molecule O=C(Cc1csc(-c2ccsc2)n1)Nc1ccccc1F more soluble in water? The output molecule should be similar to the input molecule. | O=C(Cc1csc(-c2ccsc2)n1)Nc1ccccc1F | Cc1c(C(=O)Cc2csc(-c3ccsc3)n2)[nH+]n(Nc2ccccc2F)c1N | insert | inserted c1[*][nH+]n[*]c(N)c1C connected to CC=O, N | -0.37438 | 1.356107 | 96.113 | -0.31368 | false |
102 | Can you make molecule O=C(NCCNC(=O)c1ccco1)Nc1cnn(C[C@@H]2CCCO2)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCCNC(=O)c1ccco1)Nc1cnn(C[C@@H]2CCCO2)c1 | O=C(NCCC(=O)c1ccco1)Nc1cnn(C[C@@H]2CCCO2)c1 | delete | deleted N | 0.843 | 0.090743 | -15.015 | 0.104098 | false |
108 | Can you make molecule CC(C)[C@@H](ON1C(=O)c2ccccc2C1=O)C(=O)[O-] with more hydrogen bond donors? The output molecule should be similar to the input molecule. | CC(C)[C@@H](ON1C(=O)c2ccccc2C1=O)C(=O)[O-] | CC(C)(O)CCNOON1C(=O)c2ccccc2C1=O | replace | replaced CC(C)CC(=O)[O-] with CC(C)(O)CCNO[*] | 2 | -0.282186 | 18.039 | -0.365192 | true |
101 | Can you make molecule COc1ccc(F)cc1NC(=O)c1sccc1S(=O)(=O)N(C)C more soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(F)cc1NC(=O)c1sccc1S(=O)(=O)N(C)C | COc1ccc(F)cc1NC(=O)c1sccc1S(=O)(=O)c1[nH+]n(N(C)C)c(N)c1C | insert | inserted c1[*][nH+]n[*]c(N)c1C connected to O=[SH](=O)c1ccsc1, CNC | -0.71368 | 1.255109 | 96.113 | -0.305774 | false |
203 | Can you make molecule O=C1N(Cc2cccc(F)c2)c2ccccc2[C@]1(O)c1cccc(F)c1 more soluble in water and more hydrogen bond donors? The output molecule should be similar to the input molecule. | O=C1N(Cc2cccc(F)c2)c2ccccc2[C@]1(O)c1cccc(F)c1 | Nc1ccc(CN2C(=O)[C@@](O)(c3cccc(F)c3)c3ccccc32)c(N)c1 | replace | replaced Fc1ccccc1 with c1[*]ccc(N)cc1N | null | 0.266748 | 12.04 | -0.156735 | true |
108 | Can you make molecule O=C(c1ccc(Cl)cc1)N1CCC(Cn2cnc3ccccc32)CC1 with more hydrogen bond donors? The output molecule should be similar to the input molecule. | O=C(c1ccc(Cl)cc1)N1CCC(Cn2cnc3ccccc32)CC1 | O=C(CN1CCC(Cn2cnc3ccccc32)CC1)NNC(=S)Nc1ccc(Cl)cc1 | replace | replaced C=O with O=C(C[*])NNC(=S)N[*] | 3 | 0.330662 | 103.15 | -0.302593 | false |
102 | Can you make molecule Cc1nc(Br)ccc1NC(=O)C(=O)N1C[C@H](C)C[C@@H](C)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(Br)ccc1NC(=O)C(=O)N1C[C@H](C)C[C@@H](C)C1 | Cc1nc(Br)ccc1NC(=O)CCCC(=O)N1C[C@H](C)C[C@@H](C)C1 | replace | replaced O=CC=O with C[*](=O)CCCC[*]=O | 1.1703 | -0.150825 | 42.081 | 0.148286 | false |
106 | Can you make molecule NS(=O)(=O)c1ccc(NC(=O)COc2ccc(Cl)cc2)cc1 lower permeability? The output molecule should be similar to the input molecule. | NS(=O)(=O)c1ccc(NC(=O)COc2ccc(Cl)cc2)cc1 | Cc1nc(-c2ccc(S(N)(=O)=O)cc2)cn1NC(=O)COc1ccc(Cl)cc1 | insert | inserted Cc1nc[*]cn1[*] connected to NS(=O)(=O)c1ccccc1, N | 0.30352 | 0.731188 | 80.09 | -0.23499 | false |
107 | Can you make molecule CCc1ccc(S(=O)(=O)NCC2([NH+](C)C)CCOCC2)s1 with more hydrogen bond acceptors? The output molecule should be similar to the input molecule. | CCc1ccc(S(=O)(=O)NCC2([NH+](C)C)CCOCC2)s1 | CCc1ccc(S(=O)(=O)NCC2(c3nnc([NH+](C)C)n(N)c3=O)CCOCC2)s1 | insert | inserted c1[*]nnc[*]n(N)c1=O connected to C1CCOCC1, C[NH2+]C | 5 | 0.17757 | 110.076 | -0.329495 | false |
206 | Can you make molecule CC[C@H](C)N(C)C(=O)c1cc(F)ccc1N more soluble in water and lower permeability? The output molecule should be similar to the input molecule. | CC[C@H](C)N(C)C(=O)c1cc(F)ccc1N | CC[C@H](C)N(C)C(=O)n1[nH+]c(-c2cc(F)ccc2N)c(C)c1N | insert | inserted c1[*][nH+]n[*]c(N)c1C connected to Nc1ccc(F)cc1, C=O | null | 1.417744 | 96.113 | 0.049413 | false |
101 | Can you make molecule CCc1nnc(NS(=O)(=O)c2ccc(NC(=O)c3cccc(F)c3)cc2)s1 more soluble in water? The output molecule should be similar to the input molecule. | CCc1nnc(NS(=O)(=O)c2ccc(NC(=O)c3cccc(F)c3)cc2)s1 | CCc1nnc(NS(=O)(=O)c2ccc(C(=O)NONC(=O)c3cccc(F)c3)cc2)s1 | insert | inserted C[*](=O)NO[*] connected to O=[SH](=O)c1ccccc1, N | -1.2459 | 0.566177 | 59.024 | -0.221432 | false |
108 | Can you make molecule C[C@]1(Oc2c[nH]c3ccc(Br)c(Cl)c23)O[C@H](CO)[C@@](C)(O)[C@](C)(O)[C@@]1(C)O with more hydrogen bond donors? The output molecule should be similar to the input molecule. | C[C@]1(Oc2c[nH]c3ccc(Br)c(Cl)c23)O[C@H](CO)[C@@](C)(O)[C@](C)(O)[C@@]1(C)O | C[C@@]1(O)[C@@](C)(O)[C@](C)(O)[C@@H](CO)O[C@]1(C)CC/[NH+]=C(\N)NOc1c[nH]c2ccc(Br)c(Cl)c12 | insert | inserted C[*]C/[NH+]=C(\N)N[*] connected to C[C@@H]1OC[C@@](C)(O)[C@](C)(O)[C@@]1(C)O, O | 3 | 0.753605 | 86.118 | -0.338879 | false |
104 | Can you make molecule C[C@@H]1CN(C(=O)NCc2ncnn2C)C[C@H](C)O1 less like a drug? The output molecule should be similar to the input molecule. | C[C@@H]1CN(C(=O)NCc2ncnn2C)C[C@H](C)O1 | C[C@@H]1CN(C(=O)Nc2cnc3ccc(Cc4ncnn4C)nn3c2=O)C[C@H](C)O1 | insert | inserted c1[*]cnc2ccc[*]nn2c1=O connected to N, C | -0.133009 | 0.484701 | 145.121 | -0.133009 | false |
103 | Can you make molecule COC[C@H](O)C[NH+]1CCC(C)(C)C1 more like a drug? The output molecule should be similar to the input molecule. | COC[C@H](O)C[NH+]1CCC(C)(C)C1 | COc1ccc2ncc(C[C@H](O)C[NH+]3CCC(C)(C)C3)c(=O)n2n1 | insert | inserted c1[*]cnc2ccc[*]nn2c1=O connected to CC(C)O, CO | 0.145375 | -0.518134 | 145.121 | 0.145375 | false |
202 | Can you make molecule O=C(N/N=C\c1ccoc1)c1ccccc1[N+](=O)[O-] less soluble in water and more hydrogen bond acceptors? The output molecule should be similar to the input molecule. | O=C(N/N=C\c1ccoc1)c1ccccc1[N+](=O)[O-] | O=C(N/N=C\c1ccoc1)c1cnc2sccn2c1=S | replace | replaced O=[N+]([O-])c1ccccc1 with S=c1c[*]cnc2sccn12 | null | 0.820308 | 45.135 | -0.056815 | false |
104 | Can you make molecule COc1cc(OC)c(NC(=O)Nc2c(-c3cccnc3)[nH]c3ccccc23)cc1Cl less like a drug? The output molecule should be similar to the input molecule. | COc1cc(OC)c(NC(=O)Nc2c(-c3cccnc3)[nH]c3ccccc23)cc1Cl | COc1cc(OC)c(-c2cc(NC(=O)Nc3c(-c4cccnc4)[nH]c4ccccc34)c(F)cc2Cl)cc1Cl | insert | inserted c1[*]cc[*]c(F)cc1Cl connected to Clc1ccccc1, N | -0.193851 | 0.337959 | 128.533 | -0.193851 | false |
103 | Can you make molecule FC(F)(Cl)Oc1ccccc1 more like a drug? The output molecule should be similar to the input molecule. | FC(F)(Cl)Oc1ccccc1 | Cc1nc(OC(F)(F)Cl)nc2c1CN(c1ccccc1)CC2 | insert | inserted N1[*]CCc2nc[*]nc(C)c2C1 connected to c1ccccc1, OC(F)(F)Cl | 0.176249 | 0.871555 | 147.181 | 0.176249 | false |
107 | Can you make molecule CCOc1cccc(NC(=O)NCc2ccc(N3CCSCC3)cc2)c1 with more hydrogen bond acceptors? The output molecule should be similar to the input molecule. | CCOc1cccc(NC(=O)NCc2ccc(N3CCSCC3)cc2)c1 | CCOc1cccc(Nc2nc(C)c3c(n2)CCN(C(=O)NCc2ccc(N4CCSCC4)cc2)C3)c1 | insert | inserted N1[*]CCc2nc[*]nc(C)c2C1 connected to C=O, N | 3 | 0.668074 | 147.181 | -0.339839 | false |
104 | Can you make molecule COC(=O)[C@@]1(NC2CCCC2)CCCS[C@H]1C less like a drug? The output molecule should be similar to the input molecule. | COC(=O)[C@@]1(NC2CCCC2)CCCS[C@H]1C | COC(=O)[C@@]1(Nc2nnc(C3CCCC3)c(=O)n2N)CCCS[C@H]1C | insert | inserted c1[*]nnc[*]n(N)c1=O connected to C1CCCC1, N | -0.183802 | 0.460854 | 110.076 | -0.183802 | false |
103 | Can you make molecule [O-][S@@+](Cc1csc(-c2ccc(F)cc2)n1)c1cccc(F)c1 more like a drug? The output molecule should be similar to the input molecule. | [O-][S@@+](Cc1csc(-c2ccc(F)cc2)n1)c1cccc(F)c1 | [O-][S@@+](Cc1csc(N2CCC(F)CC2)n1)c1cccc(F)c1 | replace | replaced Fc1ccccc1 with N1[*]CCC(F)CC1 | 0.135374 | 0.465213 | 7.036 | 0.135374 | false |
108 | Can you make molecule Cc1cccc(C(=O)Nc2cc3c(cc2N2CCCCC2)n(C)c(=O)c(=O)n3C)c1 with more hydrogen bond donors? The output molecule should be similar to the input molecule. | Cc1cccc(C(=O)Nc2cc3c(cc2N2CCCCC2)n(C)c(=O)c(=O)n3C)c1 | Cc1cccc(CNNC(=O)Nc2cc3c(cc2N2CCCCC2)n(C)c(=O)c(=O)n3C)c1 | replace | replaced C=O with C[*](=O)NNC[*] | 2 | 0.313257 | 44.057 | -0.269539 | false |
104 | Can you make molecule O=C(NC(=S)NC[C@@H]1CCCO1)c1ccc(Cl)cc1Cl less like a drug? The output molecule should be similar to the input molecule. | O=C(NC(=S)NC[C@@H]1CCCO1)c1ccc(Cl)cc1Cl | C[C@@H]1CC[C@@H](CNC(=S)NC(=O)c2ccc(Cl)cc2Cl)CN1[C@@H]1CCCO1 | insert | inserted N1[*]C[C@H][*]CC[C@H]1C connected to C1CCOC1, C | -0.123939 | 1.008554 | 97.161 | -0.123939 | false |
108 | Can you make molecule CC[n+]1c(N)n(CCOc2ccc(Cl)cc2Cl)c2ccccc21 with more hydrogen bond donors? The output molecule should be similar to the input molecule. | CC[n+]1c(N)n(CCOc2ccc(Cl)cc2Cl)c2ccccc21 | CC[n+]1c(N)n(CCONC2=NN[C@H](c3ccc(Cl)cc3Cl)S2)c2ccccc21 | insert | inserted [C@H]1[*]NN=C(N[*])S1 connected to Clc1cccc(Cl)c1, O | 2 | 1.402181 | 101.134 | -0.406168 | false |
107 | Can you make molecule Cc1cc([C@H](C)NC(=O)C(=O)Nc2cc(NC(=O)C3CC3)ccc2C)c(C)o1 with more hydrogen bond acceptors? The output molecule should be similar to the input molecule. | Cc1cc([C@H](C)NC(=O)C(=O)Nc2cc(NC(=O)C3CC3)ccc2C)c(C)o1 | Cc1ccc(C)o1.Cc1ccc(NC(=O)C2CC2)cc1NC(=O)C(=O)N[C@@H]1CNCCN1 | replace | replaced CC with [C@@H]1[*]CN[*]CCN1 | 2 | 0.498222 | 58.084 | -0.228094 | false |
104 | Can you make molecule CC(C)n1cc(S(=O)(=O)N2CCn3c(nn(C)c3=O)C2)cn1 less like a drug? The output molecule should be similar to the input molecule. | CC(C)n1cc(S(=O)(=O)N2CCn3c(nn(C)c3=O)C2)cn1 | Cc1nc(N2CCn3c(nn(C)c3=O)C2)cn1S(=O)(=O)c1cnn(C(C)C)c1 | insert | inserted Cc1nc[*]cn1[*] connected to Cn1nc2n(c1=O)CCNC2, O=[SH](=O)c1cn[nH]c1 | -0.157444 | 0.432637 | 80.09 | -0.157444 | false |
201 | Can you make molecule COc1ccc2c(c1)CCN(C(=O)[C@H](C)n1nc(-c3ccccc3)ccc1=O)C2 more soluble in water and more hydrogen bond acceptors? The output molecule should be similar to the input molecule. | COc1ccc2c(c1)CCN(C(=O)[C@H](C)n1nc(-c3ccccc3)ccc1=O)C2 | COc1ccc2c(c1)CCN(NC(=S)NNC(=S)NC(=O)[C@H](C)n1nc(-c3ccccc3)ccc1=O)C2 | insert | inserted N[*]C(=S)NNC(=S)N[*] connected to c1ccc2c(c1)CCNC2, CCC=O | null | 0.649896 | 148.216 | -0.403908 | false |
202 | Can you make molecule COc1ccccc1[C@H]1CCCN1C(=O)[C@@H](C)CCOc1ccccc1 less soluble in water and more hydrogen bond acceptors? The output molecule should be similar to the input molecule. | COc1ccccc1[C@H]1CCCN1C(=O)[C@@H](C)CCOc1ccccc1 | COc1ccccc1[C@H]1CCCN1CC[C@@](C)(C#N)C(=O)[C@@H](C)CCOc1ccccc1 | insert | inserted [C@][*](C)(C#N)CC[*] connected to CC[C@H](C)C=O, C1CCNC1 | null | 0.856603 | 81.118 | -0.265306 | false |
106 | Can you make molecule CC[NH+]1CCN(c2ccc(NC(=O)C3C[C@H](C)O[C@@H](C)C3)c(C)c2)CC1 lower permeability? The output molecule should be similar to the input molecule. | CC[NH+]1CCN(c2ccc(NC(=O)C3C[C@H](C)O[C@@H](C)C3)c(C)c2)CC1 | CC[NH+]1CCN(c2ccc(NC(=O)CN(C)OC3C[C@H](C)O[C@@H](C)C3)c(C)c2)CC1 | replace | replaced C=O with CN(CC[*]=O)O[*] | -0.3842 | 0.334617 | 59.068 | -0.205665 | false |
107 | Can you make molecule CC(C)Oc1cccc(C(=O)[C@@H]2CCCN(C(=O)CCc3ccccn3)C2)c1 with more hydrogen bond acceptors? The output molecule should be similar to the input molecule. | CC(C)Oc1cccc(C(=O)[C@@H]2CCCN(C(=O)CCc3ccccn3)C2)c1 | Cc1nc(-c2cccc(OC(C)C)c2)cn1C(=O)[C@@H]1CCCN(C(=O)CCc2ccccn2)C1 | insert | inserted Cc1nc[*]cn1[*] connected to c1ccccc1, C=O | 2 | 0.452874 | 80.09 | -0.166368 | false |
102 | Can you make molecule CCCn1c(C[NH+]2CCCCCC2)nc2cc(NC(=O)C(C)C)ccc21 less soluble in water? The output molecule should be similar to the input molecule. | CCCn1c(C[NH+]2CCCCCC2)nc2cc(NC(=O)C(C)C)ccc21 | CC1CC(n2c(C[NH+]3CCCCCC3)nc3cc(NC(=O)C(C)C)ccc32)C1 | replace | replaced CCC with CC1CC[*]C1 | 0.561 | 0.158636 | 26.038 | -0.005539 | false |
104 | Can you make molecule C[C@@H]1CCCN(C(=O)Cn2cnc3c(nc4n3CCCCC4)c2=O)C1 less like a drug? The output molecule should be similar to the input molecule. | C[C@@H]1CCCN(C(=O)Cn2cnc3c(nc4n3CCCCC4)c2=O)C1 | C[C@H]1c2cccn2CCN1C(=O)Cn1cnc2c(nc3n2CCCCC3)c1=O | replace | replaced C[C@@H]1CCCNC1 with C[C@H]1c2cccn2CCN1[*] | -0.151476 | 0.310259 | 37.021 | -0.151476 | false |
108 | Can you make molecule CCc1nn(C)c(OC)c1CNC(=O)c1cc(SC)ccc1C with more hydrogen bond donors? The output molecule should be similar to the input molecule. | CCc1nn(C)c(OC)c1CNC(=O)c1cc(SC)ccc1C | COc1c(CNC(=O)c2cc(SC)ccc2C)c(C(CO)CO)nn1C | replace | replaced CC with C[*](CO)CO | 2 | 0.349787 | 46.025 | -0.224867 | true |
107 | Can you make molecule CN(C)c1cccc(C(=O)NC2CC[NH+](Cc3ccccc3)CC2)c1 with more hydrogen bond acceptors? The output molecule should be similar to the input molecule. | CN(C)c1cccc(C(=O)NC2CC[NH+](Cc3ccccc3)CC2)c1 | Cc1nc(-c2cccc(N(C)C)c2)cn1C(=O)NC1CC[NH+](Cc2ccccc2)CC1 | insert | inserted Cc1nc[*]cn1[*] connected to c1ccccc1, C=O | 2 | 0.393732 | 80.09 | -0.201162 | false |
204 | Can you make molecule c1ccc(Cn2c(SCc3ncon3)nnc2-c2cccs2)cc1 less soluble in water and more hydrogen bond donors? The output molecule should be similar to the input molecule. | c1ccc(Cn2c(SCc3ncon3)nnc2-c2cccs2)cc1 | c1ccc(/N=C(/Nc2ccccc2)Nn2c(SCc3ncon3)nnc2-c2cccs2)cc1 | replace | replaced C with N[*]/C(=N\c1ccccc1)N[*] | null | 0.561226 | 119.127 | -0.298637 | false |
108 | Can you make molecule CC(C)(CNC(=O)c1cccc(N2CCCNC2=O)c1)c1ccncc1 with more hydrogen bond donors? The output molecule should be similar to the input molecule. | CC(C)(CNC(=O)c1cccc(N2CCCNC2=O)c1)c1ccncc1 | C[C@@H](C(=O)NNC(=O)NC(=O)c1cccc(N2CCCNC2=O)c1)c1ccncc1 | replace | replaced CC(C)C with C[C@H][*]C(=O)NNC[*]=O | 2 | 0.611804 | 57.996 | -0.305006 | false |
107 | Can you make molecule CCCN1CCN(C(=O)CCn2c(=O)c3cccn3c3cccnc32)CC1 with more hydrogen bond acceptors? The output molecule should be similar to the input molecule. | CCCN1CCN(C(=O)CCn2c(=O)c3cccn3c3cccnc32)CC1 | CCCN1CCN(C(=O)CCONC(=O)n2c(=O)c3cccn3c3cccnc32)CC1 | insert | inserted C[*](=O)NO[*] connected to O=c1[nH]c2ncccc2n2cccc12, CCC=O | 2 | 0.496721 | 59.024 | -0.219431 | false |
106 | Can you make molecule Cc1c(COC(=O)c2cc[nH]n2)cccc1[N+](=O)[O-] lower permeability? The output molecule should be similar to the input molecule. | Cc1c(COC(=O)c2cc[nH]n2)cccc1[N+](=O)[O-] | Cc1c(-c2cnc3ccc(COC(=O)c4cc[nH]n4)nn3c2=O)cccc1[N+](=O)[O-] | insert | inserted c1[*]cnc2ccc[*]nn2c1=O connected to Cc1ccccc1[N+](=O)[O-], C | 0.0699 | 0.421465 | 145.121 | -0.214155 | false |
107 | Can you make molecule Cc1cccc2[nH+]c(CNC(=O)NCCNc3ccc4ccccc4n3)cn12 with more hydrogen bond acceptors? The output molecule should be similar to the input molecule. | Cc1cccc2[nH+]c(CNC(=O)NCCNc3ccc4ccccc4n3)cn12 | Cc1cccc2[nH+]c(CNC(=O)Nc3ccc4ncc(CCNc5ccc6ccccc6n5)c(=O)n4n3)cn12 | insert | inserted c1[*]cnc2ccc[*]nn2c1=O connected to CC, N | 4 | 0.32096 | 145.121 | -0.156302 | false |
204 | Can you make molecule CC[NH+](CCO[C@H]1CCCCO1)CC1CC[NH2+]CC1 less soluble in water and more hydrogen bond donors? The output molecule should be similar to the input molecule. | CC[NH+](CCO[C@H]1CCCCO1)CC1CC[NH2+]CC1 | CC[NH+]1CCC(=O)NNc2ccsc2C1.O[C@H]1CCCCO1 | replace | replaced C1CC[NH2+]CC1 with c1[*]sccc1NNC[*]=O | null | -0.281659 | 56.025 | -0.044307 | false |
201 | Can you make molecule COCC(=O)N1CCCc2ccc(NC(=O)c3cccc(Br)c3)cc21 more soluble in water and more hydrogen bond acceptors? The output molecule should be similar to the input molecule. | COCC(=O)N1CCCc2ccc(NC(=O)c3cccc(Br)c3)cc21 | COCC(=O)N1CCCc2ccc(N3CCC[C@@](O)(NC(=O)c4cccc(Br)c4)C3)cc21 | insert | inserted N1[*]CCC[C@][*](O)C1 connected to c1ccc2c(c1)CCCN2, N | null | 1.15985 | 99.133 | -0.233815 | false |
103 | Can you make molecule CC(=O)N[C@@H](CC(=O)N[C@H](C(N)=O)C(C)(C)C)c1c(F)cccc1F more like a drug? The output molecule should be similar to the input molecule. | CC(=O)N[C@@H](CC(=O)N[C@H](C(N)=O)C(C)(C)C)c1c(F)cccc1F | CC(=O)N[C@@H](CC(=O)N[C@]1(C)CC(C)=NO1)c1c(F)cccc1F | replace | replaced CC(C)(C)CC(N)=O with [C@@]1[*](C)CC(C)=NO1 | 0.141212 | 0.598419 | -16.043 | 0.141212 | false |
108 | Can you make molecule O=C(NCCC(=O)N1CCc2c1cccc2[N+](=O)[O-])c1ccsc1 with more hydrogen bond donors? The output molecule should be similar to the input molecule. | O=C(NCCC(=O)N1CCc2c1cccc2[N+](=O)[O-])c1ccsc1 | N/C(NNCCC(=O)N1CCc2c1cccc2[N+](=O)[O-])=[NH+]\CCC(=O)c1ccsc1 | insert | inserted C[*]C/[NH+]=C(\N)N[*] connected to C=O, N | 3 | 1.105078 | 86.118 | -0.558434 | false |
204 | Can you make molecule Cc1cc(CC(=O)Nc2ccc(OC(F)F)c3ncccc23)no1 less soluble in water and more hydrogen bond donors? The output molecule should be similar to the input molecule. | Cc1cc(CC(=O)Nc2ccc(OC(F)F)c3ncccc23)no1 | Cc1cc(CC(=O)Nc2ccc(NC(=N)C(C)(C)C)c3ncccc23)no1 | replace | replaced OC(F)F with CC(C)(C)C(=N)N[*] | null | 0.37191 | 32.143 | -0.299045 | true |
107 | Can you make molecule CC[C@]1(c2ccc(Cl)cc2)NC(=O)N(CC(=O)c2ccccc2)C1=O with more hydrogen bond acceptors? The output molecule should be similar to the input molecule. | CC[C@]1(c2ccc(Cl)cc2)NC(=O)N(CC(=O)c2ccccc2)C1=O | CC[C@]1(c2ccc(Cl)cc2)NC(=O)N(SSC(=O)c2ccccc2)C1=O | replace | replaced CC=O with S[*]SC[*]=O | 2 | 0.76411 | 50.107 | -0.214341 | false |
104 | Can you make molecule CCCn1nnnc1C[NH+](C)C1CCN(c2ccc(F)cc2)CC1 less like a drug? The output molecule should be similar to the input molecule. | CCCn1nnnc1C[NH+](C)C1CCN(c2ccc(F)cc2)CC1 | C[NH+](Cc1nnnn1CCCBr)C1CCN(c2ccc(F)cc2)CC1 | replace | replaced CCC with C[*]CCBr | -0.156823 | 0.137672 | 78.896 | -0.156823 | true |
201 | Can you make molecule Cc1ccc(C[NH+]2CCC(N3CCC(C(=O)N4CCOCC4)CC3)CC2)o1 more soluble in water and more hydrogen bond acceptors? The output molecule should be similar to the input molecule. | Cc1ccc(C[NH+]2CCC(N3CCC(C(=O)N4CCOCC4)CC3)CC2)o1 | Cc1ccc(C[NH+]2CCC(N3CCC(C(=O)N4C(=O)COCC4=O)CC3)CC2)o1 | replace | replaced C1COCCN1 with O=C1COCC(=O)N1[*] | null | 0.374349 | 27.966 | -0.143205 | false |
202 | Can you make molecule CC(C)(C)[C@@H](CS)C[NH+]1CCN(c2ccccc2Cl)CC1 less soluble in water and more hydrogen bond acceptors? The output molecule should be similar to the input molecule. | CC(C)(C)[C@@H](CS)C[NH+]1CCN(c2ccccc2Cl)CC1 | CC(C)(C)[C@@H](CS)CSN1CCN(c2ccccc2Cl)CC1 | replace | replaced C1C[NH2+]CCN1 with S[*]N1CCN[*]CC1 | null | -0.744344 | 31.059 | -0.205371 | false |
201 | Can you make molecule CC[NH+]1CC[C@@H](CNCc2ccc([O-])c[nH+]2)C1 more soluble in water and more hydrogen bond acceptors? The output molecule should be similar to the input molecule. | CC[NH+]1CC[C@@H](CNCc2ccc([O-])c[nH+]2)C1 | CC[NH+]1CC[C@@H](c2cc(CNCc3ccc([O-])c[nH+]3)nc(NN)n2)C1 | insert | inserted NNc1nc[*]cc[*]n1 connected to C1CC[NH2+]C1, C | null | -0.539219 | 108.104 | -0.307308 | false |
205 | Can you make molecule COc1ccc(OC)c([C@H]2OC(COc3ccc4c(c3)OCO4)=NN2C(C)=O)c1 more soluble in water and higher permeability? The output molecule should be similar to the input molecule. | COc1ccc(OC)c([C@H]2OC(COc3ccc4c(c3)OCO4)=NN2C(C)=O)c1 | COc1ccc(OC)c([C@H]2OC(CO[NH+]3CCN(C)CC3)=NN2C(C)=O)c1 | replace | replaced c1ccc2c(c1)OCO2 with [NH+]1[*]CCN(C)CC1 | null | 1.10969 | -20.95 | -0.008008 | false |
104 | Can you make molecule C[NH+](CCc1ccccc1)Cc1ccccc1-c1nc([O-])cc(C(F)(F)F)n1 less like a drug? The output molecule should be similar to the input molecule. | C[NH+](CCc1ccccc1)Cc1ccccc1-c1nc([O-])cc(C(F)(F)F)n1 | Cc1nc([NH+](C)Cc2ccccc2-c2nc([O-])cc(C(F)(F)F)n2)cn1CCc1ccccc1 | insert | inserted Cc1nc[*]cn1[*] connected to C[NH3+], CC | -0.254431 | 0.145868 | 80.09 | -0.254431 | false |
103 | Can you make molecule COc1ccccc1CNC(=O)C1(Cc2cc(-c3ccccc3C)no2)CCOCC1 more like a drug? The output molecule should be similar to the input molecule. | COc1ccccc1CNC(=O)C1(Cc2cc(-c3ccccc3C)no2)CCOCC1 | COc1ccccc1CNC(=O)C1(CN2CCNC2=O)CCOCC1.Cc1ccccc1 | replace | replaced c1cnoc1 with N1[*]CCN[*]C1=O | 0.108423 | 0.045971 | 19.047 | 0.108423 | false |
206 | Can you make molecule Cc1ccc(-c2nc(C)c(C(=O)N(C)Cc3ncnn3C)s2)c(C)c1 more soluble in water and lower permeability? The output molecule should be similar to the input molecule. | Cc1ccc(-c2nc(C)c(C(=O)N(C)Cc3ncnn3C)s2)c(C)c1 | Cc1ccc(CC/[NH+]=C(\N)Nc2nc(C)c(C(=O)N(C)Cc3ncnn3C)s2)c(C)c1 | insert | inserted C[*]C/[NH+]=C(\N)N[*] connected to Cc1cccc(C)c1, Cc1cscn1 | null | 0.859301 | 86.118 | -0.357517 | false |
204 | Can you make molecule COc1ccc(-n2nc3ccc(NC(=O)c4ccccc4Cl)cc3n2)cc1Cl less soluble in water and more hydrogen bond donors? The output molecule should be similar to the input molecule. | COc1ccc(-n2nc3ccc(NC(=O)c4ccccc4Cl)cc3n2)cc1Cl | COc1ccc(-n2nc3ccc(Nc4cccc(C(=N)Nc5ccccc5Cl)c4)cc3n2)cc1Cl | replace | replaced C=O with c1[*]cccc(C(=N)N[*])c1 | null | 0.534826 | 90.129 | -0.339009 | false |
102 | Can you make molecule CC(C)c1nnc2c(=O)n(CC(=O)Nc3ccc(Br)cc3F)c3ccccc3n12 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)c1nnc2c(=O)n(CC(=O)Nc3ccc(Br)cc3F)c3ccccc3n12 | CC(C)[C@@H]1CC[C@@H](C)N(c2nnc3c(=O)n(CC(=O)Nc4ccc(Br)cc4F)c4ccccc4n23)C1 | insert | inserted N1[*]C[C@H][*]CC[C@H]1C connected to O=c1[nH]c2ccccc2n2cnnc12, CCC | 1.1375 | 1.167596 | 97.161 | -0.124814 | false |
107 | Can you make molecule CC(C)(C)OC(=O)N1CCC[C@@H](COS(C)(=O)=O)C1 with more hydrogen bond acceptors? The output molecule should be similar to the input molecule. | CC(C)(C)OC(=O)N1CCC[C@@H](COS(C)(=O)=O)C1 | CC(C)(C)OC(=O)NON1CCC[C@@H](COS(C)(=O)=O)C1 | replace | replaced C=O with C[*](=O)NO[*] | 2 | 0.774193 | 31.014 | -0.142812 | true |
205 | Can you make molecule Cc1nc(Cn2cc(N)cn2)sc1C more soluble in water and higher permeability? The output molecule should be similar to the input molecule. | Cc1nc(Cn2cc(N)cn2)sc1C | Cc1nc(C[NH+]2CCN(C)CC2)sc1C | replace | replaced Nc1cn[nH]c1 with [NH+]1[*]CCN(C)CC1 | null | 1.563948 | 18.079 | -0.0436 | false |
201 | Can you make molecule Cc1cc(CCC(N)=O)cc([C@H]2CCC[NH+]2Cc2cccnc2)n1 more soluble in water and more hydrogen bond acceptors? The output molecule should be similar to the input molecule. | Cc1cc(CCC(N)=O)cc([C@H]2CCC[NH+]2Cc2cccnc2)n1 | Cc1cc(N2CC(=O)NC(=O)C2)cc([C@H]2CCC[NH+]2Cc2cccnc2)n1 | replace | replaced CCC(N)=O with N1[*]CC(=O)NC(=O)C1 | null | 0.12885 | 41.009 | -0.081525 | false |
203 | Can you make molecule CC(C)(CNC(=O)NCc1ccc(OC2CCCC2)nc1)N1CCOCC1 more soluble in water and more hydrogen bond donors? The output molecule should be similar to the input molecule. | CC(C)(CNC(=O)NCc1ccc(OC2CCCC2)nc1)N1CCOCC1 | CC(C)(CNC(=O)NCc1ccc(ONC2=[NH+]CCC2)nc1)N1CCOCC1 | replace | replaced C1CCCC1 with N[*]C1=[NH+]CCC1 | null | 1.101273 | 14.995 | -0.311965 | false |
202 | Can you make molecule O=C(CSc1nc2ccccc2c(=O)n1C[C@@H]1CCCO1)OC1CCCCC1 less soluble in water and more hydrogen bond acceptors? The output molecule should be similar to the input molecule. | O=C(CSc1nc2ccccc2c(=O)n1C[C@@H]1CCCO1)OC1CCCCC1 | O=C(CSc1nc2ccccc2c(=O)n1C[C@@H]1CCCO1)Oc1cc2sc(Cl)cc2s1 | replace | replaced C1CCCCC1 with c1[*]cc2sc(Cl)cc2s1 | null | 0.546086 | 90.515 | -0.209032 | false |
104 | Can you make molecule COCC[C@H](C)C(=O)N[C@@H](C)COC less like a drug? The output molecule should be similar to the input molecule. | COCC[C@H](C)C(=O)N[C@@H](C)COC | COCC[C@H](C)C(=O)ON=C1CCN([C@@H](C)COC)CC1 | replace | replaced N with O[*]N=C1CCN[*]CC1 | -0.161689 | 0.719764 | 97.117 | -0.161689 | false |
107 | Can you make molecule CCCC[C@@H](C)NC(=O)[C@H]1CCC[NH2+][C@@H]1C with more hydrogen bond acceptors? The output molecule should be similar to the input molecule. | CCCC[C@@H](C)NC(=O)[C@H]1CCC[NH2+][C@@H]1C | CCCC[C@@H](C)NC(=O)c1nnc([C@H]2CCC[NH2+][C@@H]2C)c(=O)n1N | insert | inserted c1[*]nnc[*]n(N)c1=O connected to C[C@@H]1CCCC[NH2+]1, C=O | 5 | 0.332319 | 110.076 | -0.120132 | false |
108 | Can you make molecule C[C@H]1CCCN(C(=O)Nc2ccc3ccccc3c2)[C@H]1CO with more hydrogen bond donors? The output molecule should be similar to the input molecule. | C[C@H]1CCCN(C(=O)Nc2ccc3ccccc3c2)[C@H]1CO | C[C@H]1CCCN(C(=O)c2cc(Nc3ccc4ccccc4c3)nc(NN)n2)[C@H]1CO | insert | inserted NNc1nc[*]cc[*]n1 connected to C=O, N | 2 | 0.519945 | 108.104 | -0.511569 | false |
106 | Can you make molecule C[C@H](CC(=O)N1CCC(C(=O)[O-])CC1)N1C(=O)c2ccccc2C1=O lower permeability? The output molecule should be similar to the input molecule. | C[C@H](CC(=O)N1CCC(C(=O)[O-])CC1)N1C(=O)c2ccccc2C1=O | C[C@H](C(=O)NON1CCC(C(=O)[O-])CC1)N1C(=O)c2ccccc2C1=O | replace | replaced CCCC=O with C[C@@H][*]C(=O)NO[*] | -0.9539 | 0.475633 | 16.987 | -0.186129 | false |
108 | Can you make molecule O=C(c1ccco1)N1N=C2CCCCC[C@@H]2[C@]1(O)C(F)(F)F with more hydrogen bond donors? The output molecule should be similar to the input molecule. | O=C(c1ccco1)N1N=C2CCCCC[C@@H]2[C@]1(O)C(F)(F)F | NNc1ccnc(C(=O)N2N=C3CCCCC[C@@H]3[C@]2(O)C(F)(F)F)c1 | replace | replaced c1ccoc1 with c1[*]cc(NN)ccn1 | 2 | 0.157208 | 41.057 | -0.311232 | false |
108 | Can you make molecule N#CCCCNC(=O)[C@H]1CC[C@H](C[NH3+])O1 with more hydrogen bond donors? The output molecule should be similar to the input molecule. | N#CCCCNC(=O)[C@H]1CC[C@H](C[NH3+])O1 | N#CCCCNc1cc(C(=O)[C@H]2CC[C@H](C[NH3+])O2)nc(NN)n1 | insert | inserted NNc1nc[*]cc[*]n1 connected to C=O, N | 2 | 0.322536 | 108.104 | -0.369069 | false |
104 | Can you make molecule CCC(C)(C)C(=O)NC[C@H](c1cccs1)[NH+]1CCC(C)CC1 less like a drug? The output molecule should be similar to the input molecule. | CCC(C)(C)C(=O)NC[C@H](c1cccs1)[NH+]1CCC(C)CC1 | CCC(C)(C)C(=O)NC[C@H]([C@@H]1CC[C@@H](C)N(c2cccs2)C1)[NH+]1CCC(C)CC1 | insert | inserted N1[*]C[C@H][*]CC[C@H]1C connected to c1ccsc1, CC | -0.121707 | 0.606395 | 97.161 | -0.121707 | false |
101 | Can you make molecule CC[C@H](c1ccccc1)[S@+]([O-])CC(=O)Nc1cccc(C#N)c1 more soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](c1ccccc1)[S@+]([O-])CC(=O)Nc1cccc(C#N)c1 | CC[C@H](c1ccccc1)[S@+]([O-])CC(=O)Nn1[nH+]c(-c2cccc(C#N)c2)c(C)c1N | insert | inserted c1[*][nH+]n[*]c(N)c1C connected to N#Cc1ccccc1, N | -0.69518 | 1.050143 | 96.113 | -0.258052 | false |
204 | Can you make molecule Cc1cc(C)n(C[C@H](C)NS(=O)(=O)c2cn(C(C)C)cn2)n1 less soluble in water and more hydrogen bond donors? The output molecule should be similar to the input molecule. | Cc1cc(C)n(C[C@H](C)NS(=O)(=O)c2cn(C(C)C)cn2)n1 | Cc1cc(C)n(C[C@H](C)NC(=S)NN=C2CCC(NS(=O)(=O)c3cn(C(C)C)cn3)CC2)n1 | insert | inserted N[*]C(=S)NN=C1CCC[*]CC1 connected to CCC, N | null | 0.432684 | 169.253 | -0.494328 | false |
102 | Can you make molecule O=C(Nc1ccccc1Cl)c1c[nH]c2nccc(Cl)c12 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Nc1ccccc1Cl)c1c[nH]c2nccc(Cl)c12 | Clc1ccccc1NO/N=C/c1ccc(-c2c[nH]c3nccc(Cl)c23)o1 | replace | replaced C=O with O[*]/N=C/c1ccc[*]o1 | 1.3853 | 0.888206 | 81.074 | -0.397965 | false |
205 | Can you make molecule O=C(C[C@@H]1C[NH2+]CCO1)N[C@H]1C=CS(=O)(=O)C1 more soluble in water and higher permeability? The output molecule should be similar to the input molecule. | O=C(C[C@@H]1C[NH2+]CCO1)N[C@H]1C=CS(=O)(=O)C1 | O=S1(=O)C=C[C@H](N[NH+]2CC([C@@H]3C[NH2+]CCO3)C2)C1 | replace | replaced CC=O with [NH+]1[*]CC[*]C1 | null | 1.234111 | 14.051 | -0.106256 | false |
106 | Can you make molecule Cc1cc(C)c(NC(=O)CSCCN2CCOCC2)c(C)c1 lower permeability? The output molecule should be similar to the input molecule. | Cc1cc(C)c(NC(=O)CSCCN2CCOCC2)c(C)c1 | Cc1cc(C)c(NC(=O)CSc2nnc(CCN3CCOCC3)c(=O)n2N)c(C)c1 | insert | inserted c1[*]nnc[*]n(N)c1=O connected to CC, S | -1.7329 | 0.39384 | 110.076 | -0.328165 | false |
104 | Can you make molecule C[C@H](c1cccc(F)c1)N1CCN(C(=O)C[C@H]2CCOc3ccccc32)CC1 less like a drug? The output molecule should be similar to the input molecule. | C[C@H](c1cccc(F)c1)N1CCN(C(=O)C[C@H]2CCOc3ccccc32)CC1 | C[C@H](c1cccc(F)c1)N1CCN([C@@H]2CC[C@@H](C)N(C(=O)C[C@H]3CCOc4ccccc43)C2)CC1 | insert | inserted N1[*]C[C@H][*]CC[C@H]1C connected to O=CC[C@H]1CCOc2ccccc21, C1CNCCN1 | -0.186738 | 0.684508 | 97.161 | -0.186738 | false |
206 | Can you make molecule NC(=O)c1nc(-c2ccc3c(c2)OCCO3)nc2c1n(Cc1ccccc1)c(=O)n2-c1ccc(F)cc1 more soluble in water and lower permeability? The output molecule should be similar to the input molecule. | NC(=O)c1nc(-c2ccc3c(c2)OCCO3)nc2c1n(Cc1ccccc1)c(=O)n2-c1ccc(F)cc1 | NC(=O)c1nc(-c2nnc(-c3ccc4c(c3)OCCO4)n(N)c2=O)nc2c1n(Cc1ccccc1)c(=O)n2-c1ccc(F)cc1 | insert | inserted c1[*]nnc[*]n(N)c1=O connected to O=c1[nH]c2cncnc2[nH]1, c1ccc2c(c1)OCCO2 | null | 0.481102 | 110.076 | -0.135081 | false |
202 | Can you make molecule COc1ccc(C=CC2=[NH+]CCN2)cc1 less soluble in water and more hydrogen bond acceptors? The output molecule should be similar to the input molecule. | COc1ccc(C=CC2=[NH+]CCN2)cc1 | COc1ccc(C=C2CSCC(=CC3=[NH+]CCN3)C2=O)cc1 | insert | inserted C1=[*]CSCC=[*]C1=O connected to C=Cc1ccccc1, C=CC1=[NH+]CCN1 | null | 0.243846 | 112.153 | 0.080408 | false |
203 | Can you make molecule O=S(=O)(c1ccccc1)N1C[C@H]2c3ccccc3CC[NH+]2[C@H]1c1ccccc1 more soluble in water and more hydrogen bond donors? The output molecule should be similar to the input molecule. | O=S(=O)(c1ccccc1)N1C[C@H]2c3ccccc3CC[NH+]2[C@H]1c1ccccc1 | Nc1ccc(O)c(N2C[C@H]3c4ccccc4CC[NH+]3[C@H]2c2ccccc2)c1 | replace | replaced O=[SH](=O)c1ccccc1 with Nc1ccc(O)c[*]c1 | null | 0.293143 | -33.051 | -0.258045 | false |
201 | Can you make molecule C#CCNC(=O)c1ccccc1NC(=O)[C@H]1SCCc2ccccc21 more soluble in water and more hydrogen bond acceptors? The output molecule should be similar to the input molecule. | C#CCNC(=O)c1ccccc1NC(=O)[C@H]1SCCc2ccccc21 | C#CCN[C@@H](C)C(=O)NOc1ccccc1NC(=O)[C@H]1SCCc2ccccc21 | replace | replaced C=O with C[C@H][*]C(=O)NO[*] | null | 0.752848 | 59.068 | -0.349541 | true |
104 | Can you make molecule CC[NH+]1CCC[C@@H]1CN(C)S(=O)(=O)c1cccc(C[NH3+])c1 less like a drug? The output molecule should be similar to the input molecule. | CC[NH+]1CCC[C@@H]1CN(C)S(=O)(=O)c1cccc(C[NH3+])c1 | CC[NH+]1CCC[C@@H]1CN(C)ONC(=O)S(=O)(=O)c1cccc(C[NH3+])c1 | insert | inserted C[*](=O)NO[*] connected to O=[SH](=O)c1ccccc1, CN | -0.196776 | 0.551345 | 59.024 | -0.196776 | false |
202 | Can you make molecule COc1cc(-c2nnc(SCc3cc(C)on3)o2)cc(OC)c1OC less soluble in water and more hydrogen bond acceptors? The output molecule should be similar to the input molecule. | COc1cc(-c2nnc(SCc3cc(C)on3)o2)cc(OC)c1OC | COc1cc(-c2nnc(Sn3cc(Br)c(Cc4cc(C)on4)n3)o2)cc(OC)c1OC | insert | inserted n1[*]cc(Br)c[*]n1 connected to S, C | null | 0.810845 | 144.959 | -0.241704 | false |
106 | Can you make molecule Cc1ccc(S(=O)(=O)NCCC(=O)N2CCCC2)c(C)c1N(C)S(C)(=O)=O lower permeability? The output molecule should be similar to the input molecule. | Cc1ccc(S(=O)(=O)NCCC(=O)N2CCCC2)c(C)c1N(C)S(C)(=O)=O | Cc1ccc(S(=O)(=O)NCCC(=O)N2CCCC2)c(C)c1N(C)n1cc(S(C)(=O)=O)nc1C | insert | inserted Cc1nc[*]cn1[*] connected to C[SH](=O)=O, CN | 0.41212 | 0.623901 | 80.09 | -0.127475 | false |
104 | Can you make molecule Cc1cccnc1C[C@@H](Cl)c1ccoc1 less like a drug? The output molecule should be similar to the input molecule. | Cc1cccnc1C[C@@H](Cl)c1ccoc1 | Cc1cccnc1C[C@@H](Cl)c1ccccc1C=O | replace | replaced c1ccoc1 with c1[*]ccccc1C=O | -0.123142 | -0.220979 | 38.049 | -0.123142 | false |
106 | Can you make molecule COC(=O)[C@@H](C)Oc1ccc(Oc2cnc3cc(Cl)ccc3n2)cc1 lower permeability? The output molecule should be similar to the input molecule. | COC(=O)[C@@H](C)Oc1ccc(Oc2cnc3cc(Cl)ccc3n2)cc1 | C[C@@H](Oc1ccc(Oc2cnc3cc(Cl)ccc3n2)cc1)C(=O)C(CO)CO | replace | replaced CO with C[*](CO)CO | -1.0031 | 0.446019 | 44.053 | -0.044834 | true |
101 | Can you make molecule CC[NH+](C)CCNC(=O)N1CCC(CC(=O)[O-])CC1 more soluble in water? The output molecule should be similar to the input molecule. | CC[NH+](C)CCNC(=O)N1CCC(CC(=O)[O-])CC1 | CC[NH+](C)CCNC(=O)N1CCC([C@H](O)C(=O)[O-])CC1 | replace | replaced CC(=O)[O-] with O=C([O-])[C@H][*]O | -1.0292 | 0.369492 | 15.999 | -0.104705 | true |
104 | Can you make molecule CC(C)(C)[NH2+]Cc1ncoc1[C@H]1CCCCO1 less like a drug? The output molecule should be similar to the input molecule. | CC(C)(C)[NH2+]Cc1ncoc1[C@H]1CCCCO1 | Cc1noc2nc(-c3ocnc3C[NH2+]C(C)(C)C)nc([C@H]3CCCCO3)c12 | insert | inserted c1[*]nc[*]c2c(C)noc2n1 connected to c1cocn1, C1CCOCC1 | -0.123781 | -0.007391 | 133.11 | -0.123781 | false |
204 | Can you make molecule CC[C@H](C)Nc1ccc(C(F)(F)F)cc1[N+](=O)[O-] less soluble in water and more hydrogen bond donors? The output molecule should be similar to the input molecule. | CC[C@H](C)Nc1ccc(C(F)(F)F)cc1[N+](=O)[O-] | CC[C@H](C)Nc1ccc(C(=O)NNc2cc(C(F)(F)F)ccc2Cl)cc1[N+](=O)[O-] | insert | inserted C[*](=O)NNc1cc[*]ccc1Cl connected to O=[N+]([O-])c1ccccc1, FC(F)F | null | 0.274573 | 168.583 | -0.250057 | false |
105 | Can you make molecule Cc1ccc([N+](=O)[O-])cc1C(=O)Nc1cnc(-c2ccccc2)s1 higher permeability? The output molecule should be similar to the input molecule. | Cc1ccc([N+](=O)[O-])cc1C(=O)Nc1cnc(-c2ccccc2)s1 | CC(CCc1cc([N+](=O)[O-])ccc1C)=Nc1cnc(-c2ccccc2)s1 | replace | replaced C=O with C=[*](C)CC[*] | 1.4729 | 0.519863 | 26.082 | -0.250648 | false |
206 | Can you make molecule N#CCOc1ccccc1N1CCCCC1=O more soluble in water and lower permeability? The output molecule should be similar to the input molecule. | N#CCOc1ccccc1N1CCCCC1=O | N#CC1(Oc2ccccc2N2CCCCC2=O)CNC1 | replace | replaced CC#N with N#CC1[*]CNC1 | null | 0.775391 | 41.053 | 0.104652 | false |
102 | Can you make molecule C[C@@H](c1ccccc1)N(C)C(=O)Nc1cccc(C[NH+](C)C)c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](c1ccccc1)N(C)C(=O)Nc1cccc(C[NH+](C)C)c1 | C[C@@H](c1ccccc1)N(C)C(=O)Nc1cccc(-c2cc(C[NH+](C)C)c(F)cc2Cl)c1 | insert | inserted c1[*]cc[*]c(F)cc1Cl connected to c1ccccc1, C | 2.4595 | 0.130402 | 128.533 | -0.319836 | false |
204 | Can you make molecule CCc1nn(C)cc1NC(=O)N[C@@H](C)c1cccc(Br)c1 less soluble in water and more hydrogen bond donors? The output molecule should be similar to the input molecule. | CCc1nn(C)cc1NC(=O)N[C@@H](C)c1cccc(Br)c1 | CCC1CCC(=NNC(=S)Nc2nn(C)cc2NC(=O)N[C@@H](C)c2cccc(Br)c2)CC1 | insert | inserted N[*]C(=S)NN=C1CCC[*]CC1 connected to Cn1cccn1, CC | null | 0.586141 | 169.253 | -0.57774 | false |
202 | Can you make molecule CCN(CC(=O)N1CCc2ccccc2C1)S(=O)(=O)c1cc(F)ccc1OC less soluble in water and more hydrogen bond acceptors? The output molecule should be similar to the input molecule. | CCN(CC(=O)N1CCc2ccccc2C1)S(=O)(=O)c1cc(F)ccc1OC | CCN(CC(=O)N1CCc2ccccc2C1)n1ccs/c1=N/C(=O)S(=O)(=O)c1cc(F)ccc1OC | insert | inserted C[*](=O)/N=c1/sccn1[*] connected to O=[SH](=O)c1cccc(F)c1, N | null | 1.046575 | 126.14 | -0.255067 | false |
107 | Can you make molecule C[C@@H](OC(=O)[C@@H]1C[C@@H]1c1ccc(OC(F)(F)F)cc1)c1ccccn1 with more hydrogen bond acceptors? The output molecule should be similar to the input molecule. | C[C@@H](OC(=O)[C@@H]1C[C@@H]1c1ccc(OC(F)(F)F)cc1)c1ccccn1 | C[C@@H](OC(=O)[C@@H]1C[C@@H]1c1ccc(OC(F)(F)F)cc1)c1ccc(N)c(N)n1 | replace | replaced c1ccncc1 with c1[*]ccc(N)c(N)n1 | 2 | 0.316637 | 30.03 | 0.018539 | true |
206 | Can you make molecule Cc1cc([C@](C)(O)CNC(=O)[C@H]2CCCN2C(=O)CC(C)(C)C)c(C)o1 more soluble in water and lower permeability? The output molecule should be similar to the input molecule. | Cc1cc([C@](C)(O)CNC(=O)[C@H]2CCCN2C(=O)CC(C)(C)C)c(C)o1 | Cc1cc(C(=O)NO[C@](C)(O)CNC(=O)[C@H]2CCCN2C(=O)CC(C)(C)C)c(C)o1 | insert | inserted C[*](=O)NO[*] connected to Cc1ccc(C)o1, CC(C)O | null | 0.194491 | 59.024 | -0.387062 | false |
202 | Can you make molecule C[C@H](CNC(=O)N1CCN(S(C)(=O)=O)CC1)N1CCOCC1 less soluble in water and more hydrogen bond acceptors? The output molecule should be similar to the input molecule. | C[C@H](CNC(=O)N1CCN(S(C)(=O)=O)CC1)N1CCOCC1 | Cc1cc(N2CCN(C(=O)NC[C@@H](C)N3CCOCC3)CC2)nc2nc(S(C)(=O)=O)ccc12 | insert | inserted Cc1cc[*]nc2nc[*]ccc12 connected to C1CNCCN1, C[SH](=O)=O | null | 0.512193 | 142.161 | -0.034519 | false |
203 | Can you make molecule CCCCOc1ccccc1NC(=O)c1scnc1C1CC1 more soluble in water and more hydrogen bond donors? The output molecule should be similar to the input molecule. | CCCCOc1ccccc1NC(=O)c1scnc1C1CC1 | CCCCOc1ccccc1NC(=O)c1c(O)nc(C2CC2)[nH]c1=O | replace | replaced c1cscn1 with c1[*]c(O)nc[*][nH]c1=O | null | 0.079302 | 26.957 | -0.097039 | false |
104 | Can you make molecule CC1([C@H]([NH3+])Cc2cccs2)CCCC1 less like a drug? The output molecule should be similar to the input molecule. | CC1([C@H]([NH3+])Cc2cccs2)CCCC1 | CC1(NC(=S)NNC(=S)N[C@H]([NH3+])Cc2cccs2)CCCC1 | insert | inserted N[*]C(=S)NNC(=S)N[*] connected to CC1CCCC1, CC[NH3+] | -0.479111 | 0.153169 | 148.216 | -0.479111 | false |
206 | Can you make molecule O=C(c1cc2ccccc2o1)N(C[C@H]1CCCO1)c1nc2c(F)cccc2s1 more soluble in water and lower permeability? The output molecule should be similar to the input molecule. | O=C(c1cc2ccccc2o1)N(C[C@H]1CCCO1)c1nc2c(F)cccc2s1 | O=C(/C=N/Oc1cc2ccccc2o1)N(C[C@H]1CCCO1)c1nc2c(F)cccc2s1 | replace | replaced C=O with O=C[*]/C=N/O[*] | null | 0.638878 | 43.025 | -0.16687 | false |
206 | Can you make molecule CCC[NH2+][C@H]1[C@H](S(=O)(=O)C(C)C)CCC1(C)C more soluble in water and lower permeability? The output molecule should be similar to the input molecule. | CCC[NH2+][C@H]1[C@H](S(=O)(=O)C(C)C)CCC1(C)C | CC(C)S(=O)(=O)[C@@H]1CCC(C)(C)[C@H]1[NH2+]CCN1CCC2CN1C2=O | replace | replaced CCC with C[*](=O)N1CC2CCN1CC2 | null | 1.164779 | 96.089 | -0.133726 | false |
203 | Can you make molecule CC(=O)N[C@H](C)C(=O)Nc1ccc(Sc2nncs2)c(Cl)c1 more soluble in water and more hydrogen bond donors? The output molecule should be similar to the input molecule. | CC(=O)N[C@H](C)C(=O)Nc1ccc(Sc2nncs2)c(Cl)c1 | CC(=O)N[C@@H]1NN=C(NNc2ccc(Sc3nncs3)c(Cl)c2)S1 | replace | replaced CCC=O with [C@@H]1[*]NN=C(N[*])S1 | null | 1.015334 | 45.07 | -0.294475 | false |
202 | Can you make molecule O=C(NC[C@@H]1CCC[NH+](Cc2ccccc2F)C1)c1nc[nH]n1 less soluble in water and more hydrogen bond acceptors? The output molecule should be similar to the input molecule. | O=C(NC[C@@H]1CCC[NH+](Cc2ccccc2F)C1)c1nc[nH]n1 | Cc1cc2nc(C[NH+]3CCC[C@@H](CNC(=O)c4nc[nH]n4)C3)sc2cc1C | replace | replaced Fc1ccccc1 with Cc1cc2nc[*]sc2cc1C | null | 0.08267 | 67.141 | -0.118594 | false |
End of preview. Expand in Data Studio
MEGA: A Large-Scale Molecular Editing Dataset for Guided-Action Optimization
Large-scale molecular editing dataset with 522K examples for training models to modify molecular structures based on natural language instructions.
Paper: MEGA: A Large-Scale Molecular Editing Dataset for Guided-Action Optimization Official Repository: https://github.com/nfsrules/MEGA-moledit
Usage
from datasets import load_dataset
# Load dataset
dataset = load_dataset("nfsrulesFR/mega-moledit-522K")
# Access splits
# Positive examples (successful edits)
train_data = dataset["train"]
val_data = dataset["validation"]
# Negative examples (unsuccessful edits)
train_neg_data = dataset["train_neg"]
val_neg_data = dataset["validation_neg"]
# Example
example = train_data[0]
print(f"Prompt: {example['prompt']}")
print(f"Input: {example['input_smiles']}")
print(f"Output: {example['output_smiles']}")
Supported Tasks
| Task ID | Description |
|---|---|
| 101 | Increase water solubility |
| 102 | Decrease water solubility |
| 103 | Increase drug-likeness |
| 104 | Decrease drug-likeness |
| 105 | Increase permeability |
| 106 | Decrease permeability |
| 107 | Increase hydrogen bond acceptors |
| 108 | Increase hydrogen bond donors |
| 201 | Increase solubility + HBA |
| 202 | Decrease solubility + increase HBA |
| 203 | Increase solubility + HBD |
| 204 | Decrease solubility + increase HBD |
| 205 | Increase solubility + permeability |
| 206 | Increase solubility + decrease permeability |
Dataset Structure
Each example contains:
task_id: Task identifierprompt: Natural language instructioninput_smiles: Input moleculeoutput_smiles: Target moleculeaction_type: Edit operation typeedit: Specific edit appliedtarget_delta: Change in target propertySA_delta: Change in Synthetic AccessibilityMW_delta: Change in Molecular WeightQED_delta: Change in Drug-likenessmurcko_scaffold_retained: Scaffold preservation flag
Splits: train (469K), validation (52K), train_neg (469K), validation_neg (52K)
Trained Models
Llama 3 8B-based models for molecular optimization:
- MEGA-SFT: nfsrulesFR/mega-sft - Supervised fine-tuning model
- MEGA-GRPO: nfsrulesFR/mega-grpo - Tanimoto-GRPO optimized model
Citation
@article{
fernandezillouz2025mega,
title={MEGA: A Large-Scale Molecular Editing Dataset for Guided-Action Optimization},
author={Nelson Fernandez and Maxime Illouz and Luis Pinto and Entao Yang and Habiboulaye Amadou Boubacar},
journal={Under review at International Conference on Learning Representations},
year={2025},
url={https://openreview.net/pdf?id=MaS7e2EVFm}
}
- Downloads last month
- 13