' +\r\n\t\t\t\t\t\t\t'<input type=\"text\" class=\"form-control\" data-value=\"status\" value=\"Active\" readonly>'\r\n\t\t\t\t\t\t);\r\n\t\t\t\t\t\t\r\n\t\t\t\t\t// Append select\r\n\t\t\t\t\t} else {\t\t\t\t\t\r\n\t\t\t\t\t\tmodalBody.find('#status-box').append(\r\n\t\t\t\t\t\t\t'<select class=\"form-control\" data-field=\"status\">' +\r\n\t\t\t\t\t\t\t\t'<option value=\"1\">Active</option>' +\r\n\t\t\t\t\t\t\t\t'<option value=\"0\">Inactive</option>' +\r\n\t\t\t\t\t\t\t'</select>'\r\n\t\t\t\t\t\t);\t\t\t\t\t\t\r\n\t\t\t\t\t}\t\r\n\r\n\t\t\t\t\t// Load form values\r\n\t\t\t\t\t$.each(rowData, function (name, value) {\t\t\t\t\t\t\r\n\t\t\t\t\t\tif (name === 'status') {\r\n\t\t\t\t\t\t\tmodalBody.find('select[data-field=\"status\"]').val(value === 'Active' ? '1' : '0')\r\n\t\t\t\t\t\t\tmodalBody.find('select[data-field=\"status\"]').selectpicker();\r\n\t\t\t\t\t\t}\telse {\r\n\t\t\t\t\t\t\tmodalBody.find('input[data-field=\"' + name + '\"]').val(value);\t\t\t\t\t\t\t\r\n\t\t\t\t\t\t}\t\t\t\t\r\n\t\t\t\t\t});\t\t\t\t\t\t\r\n\t\t\t\t})\r\n\t\t\t\t\r\n\t\t\t\t// Show WS Error\r\n\t\t\t\t.fail(function () {\r\n\t\t\t\t\tSTIC.ShowWSError({ formId: params.formId });\r\n\t\t\t\t});\r\n\t\t}","function update() {\n axios.post('../../api/controller.php', {\n action: \"update-disciplina\",\n values: [\n $(\"#editar_disciplina\").val(),\n $(\"#id_disciplina\").val()\n ]\n }).then(function (response) {\n if (response.data) {\n $('#modal_update_disciplinas').modal('hide')\n $(\"#editar_disciplina\").val(\"\")\n Swal.fire(\n 'Sucesso',\n 'Disciplina Editada com sucesso',\n 'success'\n );\n $(\"#table\").DataTable().destroy()\n getDisciplinas()\n\n\n } else {\n Swal.fire(\n 'Ops :(',\n 'Não foi possivel editar essa disciplina',\n 'error'\n );\n $(\"#table\").DataTable().destroy()\n getDisciplinas()\n }\n })\n}","function actualizar_oi(){\n $('#confirmar_actualizar_oi').modal('show');\n}","function showEditPromotionModal(productSku, productName, productModel, carePakSku, carePakType, carePakPeriod, startDate, endDate, registrationPeriod) {\n // Rest form of previous values\n $(\"#editPromotionInfo\")[0].reset();\n // Assign the json values to the fields\n $(\"#productSku\").val(productSku);\n $(\"#productName\").val(productName);\n $(\"#productModel\").val(productModel);\n $(\"#carePakSku\").val(carePakSku);\n $(\"#carePakType\").val(carePakType);\n $(\"#carePakPeriod\").val(carePakPeriod);\n $(\"#startDate\").val(startDate);\n $(\"#endDate\").val(endDate);\n $(\"#registrationPeriod\").val(registrationPeriod);\n\n // Show the overlay\n $(\".overlay\").css('display', 'block');\n $(\"#editPromotionModal\").css('display', 'block');\n}","function successReload(option) {\n visitas.closeModal(option); //Aquí cerramos el modal, llamamos al JS que se llama visitas y ejecutamos el metodo closeModal\n //alert(\"Todo bien\");\n alertUpdate(); //metodo hub\n }","function updateService() { //add to onlick\n $.ajax({'success': function (html) {\n\t\t$('#modalServiceGroupsBody').html(html);\n\t\t$('#modalServiceGroups').modal('show');\n\t\t$('#Paid_Services_price').inputmask(\"9{2,9}.9{2}\");\n\t},\n\t\t\t'url': $(this).attr('href')\n });\n return false;\n}","function uncoretModal(){\n $(\"#uncoretModal .modal-body\").html(\"Yakin kembalikan \"+currentProfile.tec_regno+\" (\"+currentProfile.name+\") ?\")\n $('#uncoretModal').modal('show');\n}","function modal_edit_refaccion(refaccion) \r\n{\r\n /*Recuperar el id de la garantia que se desea actualizar*/\r\n var refaccion_id = refaccion;\r\n $('#modal_edit_refaccion').modal('toggle');\r\n search_refaccion(refaccion);//Buscar las refacciones\r\n\r\n return false;\r\n}","toggleModal() {\n if (this.modal == true) {\n customerService.getCustomerSearch(result => {\n this.temporaryOptions = [];\n result.map(e => {\n this.temporaryOptions.push({ value: e.c_id, label: e.fullname });\n });\n this.searchbarOptions = this.temporaryOptions;\n });\n }\n this.modal ? (this.modal = false) : (this.modal = true);\n }","function mostrarFechasResultantes (infoFechaInmunidad, infoFechaRevacunacion){\n //levanto el modal donde están las cajas de mensaje donde\n //cargo la información de las fechas\n $('#modalInfo').modal();\n //asigno la información de las fechas a las cajas de texto\n const infoFechaInmune = document.getElementById(\"fInmune\");\n infoFechaInmune.innerHTML = `${infoFechaInmunidad}`;\n const infoFechaRevacunar = document.getElementById(\"fRevacunacion\");\n infoFechaRevacunar.innerHTML = `${infoFechaRevacunacion}`;\n\n\n}","update() {\n this.scoreHTML.innerText = this.score;\n // show modal if you score 12\n if(this.score == 12){\n this.win();\n }\n }","function setModal(id, json){\r\n for(var i = 0; i < json['products'].length; i++){\r\n var data = json['products'][i]\r\n if(data['id'] == id){\r\n $(\"#modal-shop-title\").html(data['name']);\r\n $(\"#modal-shop-price\").html(data['price']+\"€\");\r\n $(\"#modal-shop-description\").html(data['description']);\r\n\r\n UIkit.modal(\"#modal-shop\").show();\r\n }\r\n }\r\n}","function show_modal_response( data ){\n //debugger\n if(data){\n j('#response').html( S(data) );\n j('#fancybox_trigger').trigger('click');\n }\n }","function showModel(TSID, task) {\n var jsonAction = JSON.parse(list.filter(o => o.treansactionID_FK == currentVacationId)[0].actions).filter(o => o.TSID == TSID)[0];\n $.ajax({\n url: \"/TicketsApprovment/forTickets/\" + currentVacationId,\n typr: \"GET\",\n contentType: \"application/json;charset=UTF-8\",\n dataType: \"json\",\n success: function (Data) {\n tickets = JSON.parse(Data.Data);\n if (Data.Code === 200) { \n var result = myUserControl(jsonAction, task, Data.Data);\n $(\"#userControl\").css(\"margin-top\", \"7%\");\n $(\"#userControl .modal-title\").html(result[0]);\n $(\"#userControl .modal-body\").html(result[1]);\n $(\"#userControl .modal-footer\").html(result[2]);\n $(\"#userControl .modal-dialog\").width(result[2] + '%');\n\n\n\n $(\"#userControl\").modal('show');\n }\n },\n error: function (errormessage) {\n console.log(errormessage.responseText);\n }\n\n });\n\n\n \n\n}","function showEditContactModal(data) { \n var jdata = arcGetJson(data);\n $(\"#contactname\").val(jdata.name);\n $(\"#contacttitle\").val(jdata.title);\n $(\"#contactemail\").val(jdata.email);\n $(\"#contactphone\").val(jdata.phone);\n $(\"#contactid\").val(jdata.id);\n $(\"#editContactModal\").modal(\"show\");\n}","function modalDisplay(chosenRest) {\n // in case no restaurant fits the criteria\n if (chosenRest === undefined) {\n $(\"#no-results-modal\").removeClass(\"modal_hidden\");\n $(\"#load\").addClass(\"hidden\");\n return;\n }\n $(\"#res-name\").text(chosenRest.name);\n $(\"#res-icon\").attr(\"src\", chosenRest.icon);\n $(\"#address\").text(chosenRest.vicinity);\n $(\"#res-rate\").text(\"Rating: \" + chosenRest.rating);\n\n $(\"#res-modal\").removeClass(\"modal_hidden\");\n }","function openModalMaaltijdfilterUpdate(htmlColumn) {\n\tsetModalMaaltijdfilterModus(false);\n\trow = htmlColumn.closest(\"tr\");\n\tid = getColumnValue(row, 'id');\n\tproductgroepId = getColumnValue(row, 'productgroep-id');\n\tmaaltijdtypeId = getColumnValue(row, 'maaltijdtype-id');\n\tmaaltijdsubtypeId = getColumnValue(row, 'maaltijdsubtype-id');\n\ttooltip = getColumnValue(row, 'tooltip');\n\t// Set the id for the row so it can be identified for a text update.\n\trow.attr('id', 'fltr_' + id);\n\tsetModalMaaltijdfilterModus(false);\n\tsetModalMaaltijdfilterValue('id',id, false);\n\tsetModalMaaltijdfilterValue('productgroep-id',productgroepId, false, 'select');\n\tsetModalMaaltijdfilterValue('maaltijdtype-id',maaltijdtypeId, false, 'select');\n\tsetModalMaaltijdfilterValue('maaltijdsubtype-id',maaltijdsubtypeId, false, 'select');\n\tsetModalMaaltijdfilterValue('tooltip',tooltip, false, 'textarea');\n\t$(\"#modal-maaltijdfilter\").modal('show');\n}","function updateViewEmployeeModal() {\n var image_url = $('#baseUrl').val();\n $('#viewEmployeeDataModal').find('.emp_name').html(current_employee.name);\n $('#viewEmployeeDataModal').find('.emp_address').html(current_employee.address);\n\n if (current_employee.image && current_employee.image != null) {\n $('#viewEmployeeDataModal').find('.emp_image').attr('src', (image_url + current_employee.image));\n }\n updateViewMapLoc(current_employee.lat, current_employee.lng);\n}","function okOnGet(data, postFun){\r\n $(\"#\"+modal+\" .modal-body\").html(data.content);\r\n registerForm(postFun);\r\n $(\"#\"+modal).modal(\"show\");\r\n //mymodal.open();\r\n }","function showModal() {\n\n $('#myModal').modal(\"show\");\n $(\".modal-title\").text(data.name)\n $(\".modal-img\").attr('src', data.sprites.other['official-artwork'].front_default);\n $(\".modal-li-1\").text(\"Type: \" + data.types[0].type.name)\n $(\".modal-li-2\").text(\"Abilities: \" + data.abilities[0].ability.name + \"/\" + data.abilities[1].ability.name)\n $(\".modal-li-3\").text(\"Stats: \" + \"HP: \" + data.stats[0].base_stat + \" ATK: \" + data.stats[1].base_stat + \" DEF: \" + data.stats[2].base_stat + \" SP. ATK: \" + data.stats[3].base_stat + \" SP. DEF: \" + data.stats[4].base_stat + \" SPD: \" + data.stats[5].base_stat)\n $(\".modal-li-4\").text(\"Base XP: \" + data.base_experience);\n $(\".modal-li-5\").text(\"Height: \" + data.height + \" ft \" + \"Weight: \" + data.weight + \" lbs\")\n }","function editCategoryModal(id) {\n $.ajax({\n url: '../Category/categoryApi.php', // url where to submit the request\n type: \"POST\", // type of action POST || GET\n data: {getUpdate: id}, // post data || get data\n success: function (data) {\n console.log(data);\n var obj = JSON.parse(data);\n $('#id').val(obj.category_id);\n $('#name').val(obj.category_name);\n $('#des').val(obj.category_des);\n $('#editCate').modal(\"show\");\n },\n error: function (result) {\n showNotification('top', 'right', 'This Category can\\'t be edit', '2');\n console.log(result);\n\n }\n });\n}","function modalViewOnShown(dialogRef) {\r\n\t\t\tvar rowData = dt.row('.selected').data(),\r\n\t\t\t\tmodalBody = dialogRef.getModalBody();\r\n\t\t\t$.each(rowData, function (name, value) {\r\n\t\t\t\tmodalBody.find('td[data-cell=\"' + name + '\"]').text(value);\r\n\t\t\t});\r\n\t\t}","function modal(data) {\n // Set modal title\n $('.modal-title').html(data.title);\n // Clear buttons except Cancel\n $('.modal-footer button:not(\".btn-default\")').remove();\n // Set input values\n $('#title').val(data.event ? data.event.title : '');\n $('#description').val(data.event ? data.event.description : '');\n $('#color').val(data.event ? data.event.color : '#3a87ad');\n // Create Butttons\n $.each(data.buttons, function(index, button){\n $('.modal-footer').prepend('<button type=\"button\" id=\"' + button.id + '\" class=\"btn ' + button.css + '\">' + button.label + '</button>')\n })\n //Show Modal\n $('.modal').modal('show');\n }","function modal(data) {\n // Set modal title\n $('.modal-title').html(data.title);\n // Clear buttons except Cancel\n $('.modal-footer button:not(\".btn-default\")').remove();\n // Set input values\n $('#title').val(data.event ? data.event.title : ''); \n $('#description').val(data.event ? data.event.description : '');\n $('#color').val(data.event ? data.event.color : '#3a87ad');\n // Create Butttons\n $.each(data.buttons, function(index, button){\n $('.modal-footer').prepend('<button type=\"button\" id=\"' + button.id + '\" class=\"btn ' + button.css + '\">' + button.label + '</button>')\n })\n //Show Modal\n $('.modal').modal('show');\n }","function InsertDataIntoCourseUpdateModal(id){\r\n\t$.ajax({\r\n\t\ttype: 'GET',\r\n\t\tcontentType: 'application/json; charset=utf-8',\r\n\t\turl: 'http://localhost:8000/Course/'+id+'/',\r\n\t\tdataType: 'json',\r\n\t}).then(function(data){\r\n\t\tconsole.log(data);\r\n\t\t$('#uCourseId').val(data.id);\r\n\t\t$('#uCourseName').val(data.courseName);\r\n\t\t$('#uMajor').val(data.major);\r\n\t});\r\n}","function update_form_data(res) {\n $(\"#promo_id\").val(res.id);\n $(\"#promo_name\").val(res.name);\n $(\"#promo_type\").val(res.promo_type);\n $(\"#promo_value\").val(res.value);\n $(\"#promo_start_date\").val(res.start_date);\n $(\"#promo_end_date\").val(res.end_date);\n $(\"#promo_detail\").val(res.detail);\n }","async function createConsumablesCWModal() {\n const modal = await modalController.create({\n component: \"consume-cw-modal\",\n cssClass: \"consumeCWModal\",\n });\n\n var settings = {\n \"url\": `http://localhost:8080/api/caseworker/consumables/detail/${storedButtonID}`,\n \"method\": \"GET\",\n \"timeout\": 0,\n };\n \n $.ajax(settings).done(function (response) {\n var dataArray2 = JSON.parse(response);\n console.log(dataArray2);\n\n var comments;\n\n if(dataArray2[0].cons_comment = \"undefined\"){\n comments = \" - \";\n }else{\n comments = dataArray2[0].cons_comment;\n }\n\n document.getElementById(\"cwConsName\").innerHTML = dataArray2[0].cons_name;\n document.getElementById(\"cwConsID\").innerHTML = dataArray2[0].cons_id;\n document.getElementById(\"cwConsLabel\").innerHTML = dataArray2[0].cons_label;\n document.getElementById(\"cwConsStatus\").innerHTML = dataArray2[0].cons_status;\n document.getElementById(\"cwConsComments\").innerHTML = comments;\n \n });\n\n await modal.present();\n currentModal = modal;\n}","function showModal(title, body) {\n updateModal(title, body)\n $(modal).modal('show')\n}","function modalResult() {\n\tlet href = \"#modal-result\";\n\twindow.open(href, \"_self\");\n}","function openUpdatePromo(promoId) {\n\tjQuery.ajax({\n\t url: \"service.php\",\n\t type: \"GET\",\n\t data: {updatePromoId:promoId},\n\t success: function(json_data)\n\t\t{\n\t\t\t//fills data\n\t\t\tvar data_array = $.parseJSON(json_data);\n\t\t\t\n\t\t\tconsole.log(data_array);\n\t\t\t\n\t\t\topenModal(data_array);\t\t\t\t\n\t\t},\n\t\terror: function (jqXHR, textStatus, errorThrown)\n\t\t{\n\t\t\tconsole.log(errorThrown);//)\n\t\t}\n\t});\n}","function showSerialManageModal(data)\r\n{\r\n //you can do anything with data, or pass more data to this function. i set this data to modal header for example\r\n\t $('.serialManageDeleteByAdmin').attr('href','/serialManageDeleteByAdmin?id='+data);\r\n\t$(\"#mySerialManageModal .serialManageDeleteByAdminId\").html(data)\r\n $(\"#mySerialManageModal\").modal();\r\n}","async function createPayAdminModal() {\n const modal = await modalController.create({\n component: \"pay-admin-modal\",\n cssClass: \"payAdminModal\",\n });\n\n var settings = {\n \"url\": `http://localhost:8080/api/admin/payment/${storedButtonID}`,\n \"method\": \"GET\",\n \"timeout\": 0,\n };\n \n $.ajax(settings).done(function (response) {\n var dataArray = JSON.parse(response);\n console.log(dataArray);\n\n var paymentNotes;\n\n if(dataArray[0].paymentNote = \"undefined\"){\n paymentNotes = \" - \";\n }\n else{\n paymentNotes = dataArray[0].paymentNote;\n }\n\n document.getElementById(\"paymentTenantID\").innerHTML = dataArray[0].tenant_id;\n document.getElementById(\"paymentAmount\").innerHTML = \"$\" + dataArray[0].amount_owe;\n document.getElementById(\"paymentDeduction\").innerHTML = \"$\" + dataArray[0].deposit_deduction;\n document.getElementById(\"paymentCategory\").innerHTML = dataArray[0].payment_cat;\n document.getElementById(\"paymentCharges\").innerHTML = \"$\" + dataArray[0].negligence_charge;\n document.getElementById(\"paymentNotes\").innerHTML =paymentNotes;\n });\n\n await modal.present();\n currentModal = modal;\n}","function setSearchResults(response, endpoint, searchParam) {\n searchContent.empty();\n searchContentUl.empty();\n if(response.count) {\n searchContent.append(searchContentUl);\n delete response.results[0].created;\n delete response.results[0].edited;\n delete response.results[0].url;\n $.each(response.results[0], function(index,value) {\n if(!Array.isArray(value)) {\n searchContentUl.append($(\"<li>\" + index + \": \" + value + \"</li>\"));\n }\n });\n } else {\n //Creating modal and triggering on empty SWAPI response.results object.\n let modal = $(\"<div id='modal-close-outside' uk-modal>\");\n modal.empty();\n let modalBody = $(\"<div class='uk-modal-dialog uk-modal-body'>\");\n let modalBtn = $(\"<button class='uk-modal-close-outside' type='button' uk-close></button>\");\n let modalTitle = $(\"<h2 class='uk-modal-title'>Force Disturbance</h2>\");\n let modalGif = $(\"<img src='./assets/img/jedi-mind-trick.gif'/>\");\n switch (endpoint) {\n case \"planets\":\n endpoint = \"planet\";\n break;\n case \"people\":\n endpoint = \"person\";\n break;\n case \"starships\":\n endpoint = \"starship\";\n break;\n case \"species\":\n endpoint = \"species\";\n break; \n default:\n endpoint = \"film\";\n break;\n }\n let modalP = $(\"<p>This is not the \" + endpoint + \" you are looking for. \" + searchParam.charAt(0).toUpperCase() + searchParam.slice(1) + \" is not a \" + endpoint + \" in a galaxy far, far away.</p>\");\n modal.append(modalBody);\n modalBody.append(modalBtn,modalTitle,modalGif,modalP);\n console.log(modal);\n UIkit.modal(modal).show();\n };\n}","async function updateModal(req, res) {\n \n console.log('UPD Modal Item')\n\n try {\n const modal = await findByID(req.params.id, 'modal_items')\n \n if (!modal) {\n res.status(404).json({message : `Modal Not Found ${req.params.id}`})\n } else {\n const data = await getPostData(req)\n \n const { name, addInfo, price } = JSON.parse(data)\n\n const modalData = {\n name: name || modal.name,\n addInfo: addInfo || modal.addInfo,\n price: price || modal.price,\n }\n \n const updatedModal = await update(req.params.id, modalData, 'modal_items')\n\n res.status(200).json(updatedModal)\n }\n } catch (error) {\n console.log(error);\n }\n}","function modal(data) {\n // Set modal title\n $('.modal-title').html(data.title);\n // Clear buttons except Cancel\n $('.modal-footer button:not(\".btn-default\")').remove();\n // Set input values\n $('#title').val(data.event ? data.event.title : '');\n if( ! data.event) {\n // When adding set timepicker to current time\n var now = new Date();\n var time = now.getHours() + ':' + (now.getMinutes() < 10 ? '0' + now.getMinutes() : now.getMinutes());\n } else {\n // When editing set timepicker to event's time\n var time = data.event.date.split(' ')[1].slice(0, -3);\n time = time.charAt(0) === '0' ? time.slice(1) : time;\n }\n $('#time').val(time);\n $('#description').val(data.event ? data.event.description : '');\n $(\"#id_sala option:selected\").val(data.event ? data.event.id_sala : '');\n $('#color').val(data.event ? data.event.color : '#3a87ad');\n // Create Butttons\n $.each(data.buttons, function(index, button){\n $('.modal-footer').prepend('<button type=\"button\" id=\"' + button.id + '\" class=\"btn ' + button.css + '\">' + button.label + '</button>')\n });\n //Show Modal\n $('.modal').modal('show');\n }","function populateModal(response) {\n let year;\n let month;\n let day;\n let types = [];\n\n title.text(response.nom + ' ' + response.prenom)\n\n $('#nom').val(response.nom);\n $('#prenom').val(response.prenom);\n\n arrayDate = response.birth_date.split('-');\n year = arrayDate[0];\n month = arrayDate[1];\n day = arrayDate[2].substring(0, 2);\n $('#birth_date').datepicker('setDate', day + '/' + month + '/' + year);\n\n response.types.forEach(type => {\n types.push(type.id);\n });\n select.multipleSelect('setSelects', types);\n \n $('#weight').val(response.weight);\n $('#adress').val(response.adress);\n $('#phone').val(response.phone);\n $('#boxer_id').val(response.id)\n $('#parent_name').val(response.parent_name);\n $('#parent_phone').val(response.parent_phone);\n }","function actualizarMostrar(id,cedula,nombre,apellido1,apellido2,telefono,correo,productoid){\n$(\"#idActualizar\").val(id);\n$(\"#cedulaM\").val(cedula);\n$(\"#nombreM\").val(nombre);\n$(\"#apellido1M\").val(apellido1);\n$(\"#apellido2M\").val(apellido2);\n$(\"#telefonoM\").val(telefono);\n$(\"#correoM\").val(correo);\n$(\"#productoM\").val(productoid);\n\n document.getElementById(\"modalModificar\").style.display = \"block\";\n}","function updateMelons(results) {\n if (results.code === \"OK\") {\n $('#order-status').html(\"<p>\" + results.msg + \"</p>\");\n }\n else {\n $('#order-status').addCtygtglass(\"order-error\");\n $('#order-status').html(\"<p><b>\" + results.msg + \"</b></p>\");\n }\n}","function place(e){\n\t\t\t\te.preventDefault();\n\t\t\t\tdocument.getElementById('submitButton').style.opacity=0.3;\n\t\t\t\tcheckoutID=document.getElementById('checkoutID').value;\n\t\t\t\tid=sessionStorage.shopID;\n\t\t\t\tverifyCheckoutID(id,checkoutID)\n\t\t\t\t.then(function(){\n\t\t\t\t\tupdate(id,checkoutID)\n\t\t\t\t\t.then(function(){\n\t\t\t\t\t\tconsole.log('updated');\n\t\t\t\t\t})\n\t\t\t\t\t.catch(function(){\n\n\t\t\t\t\t})\n\t\t\t\t\tlocation.reload();\n\t\t\t\t})\n\t\t\t\t.catch(function(){\n\t\t\t\t\tdocument.getElementById('submitButton').setAttribute(\"data-toggle\",\"modal\");\n\t\t\t\t\t$(\"#myModal\").modal(\"show\");\n\t\t\t\t});\n\t\t\t\tdocument.getElementById('submitButton').style.opacity=1;\n\n\t\t\t}","function modal_souvenir(id)\n {\n document.getElementById('mg_title').innerHTML=\"Souvenir Information\";\n console.log(server+'_data_souvenir_1.php?cari='+id);\n $.ajax({url: server+'_data_souvenir_1.php?cari='+id, data: \"\", dataType: 'json', success: function(rows){ \n for (var i in rows.data){ \n var row = rows.data[i];\n var id = row.id;\n var name = row.name;\n var owner = row.owner;\n var cp = row.cp;\n var address = row.address;\n var employee = row.employee;\n var type_souvenir = row.type_souvenir;\n var lat=row.lat;\n var lng = row.lng;\n console.log(name);\n document.getElementById('mg_body').innerHTML=\"<h2>\"+name+\"</h2><br><div style='margin-left:20px'>Address: \"+address+\"<br>Contact Person: \"+cp+\"<br>Owner: \"+owner+\"<br>Employee: \"+employee+\"<br>Type: \"+type_souvenir+\"</div>\";\n }//end for\n\n $('#modal_gallery').modal('show');\n }});//end ajax \n }","function getShowById(id) {\n $(\"#title\").text(\"Show Detail\")\n $.ajax({\n url: '/Show/GetShowById/' + id,\n type: 'GET',\n datatype: 'json',\n success: function (data) {\n $(\"#Id\").val(data.Id);\n $(\"#Name\").val(data.Name);\n $(\"#Price\").val(data.Price);\n isUpdate = true;\n $(\"#showModal\").modal('show');\n },\n error: function (err) {\n alert(\"Error\" + err.ResponseText);\n }\n });\n}","function showAnswerActions(answers) {\n answers.forEach(function (answer) {\n var id = 'actions_' + answer.answer_id;\n var html = \"<button class='btn btn-primary' id='myBtn\" + answer.answer_id + \"' data-toggle='modal' data-target='#myModal\" + answer.answer_id + \"'>Edit</button>\";\n document.getElementById(id).innerHTML = html;\n });\n var models = [];\n answers.forEach(function (answer) {\n var html = \"<div id='myModal\" + answer.answer_id + \"' class='modal'>\"\n + \"<div class='modal-content'>\"\n + \" <span class='close' data-dismiss='modal'>×</span>\"\n + \"<textarea class='textarea' id='newAnswer\" + answer.answer_id + \"'>\" + answer.answer_body + \"</textarea><br>\"\n + \"<button class='btn btn-primary' id='updateBtn' onclick='updateUserAnswer(\" + JSON.stringify(answer) + \");'>Update</button>\"\n + \"</div>\"\n + \"</div>\";\n models.push(html);\n });\n document.getElementById('includes').innerHTML = models.join(\"\");\n}","function success() {\n\n Modal.success({\n okText:\"Done\",\n title: 'Submit successful!',\n // content: 'View your requests to see your new entry.',\n onOk() {\n doneRedirect();\n }\n });\n }","function mostrarModalEditContacto(idContacto, idAgencia){\n //alert(idContacto+\" \"+idAgencia);\n $.ajax({\n type: 'POST',\n url: 'getContactos.php',\n dataType: 'json',\n data: {\n idContacto: idContacto,\n idAgencia: idAgencia,\n flagContacto: 'getContacto'\n }\n })\n .done(function(resultado){\n if(resultado.error == false){\n $('#modalEditContact').modal('show');\n $('#editIdContacto').val(idContacto);\n $('#editNombreContacto').val(resultado.nombreContacto);\n $('#editPuestoContacto').val(resultado.puestoContacto);\n $('#editSkypeContacto').val(resultado.skypeContacto);\n $('#editTelefonoContacto').val(resultado.telefonoContacto);\n }\n })\n \n}","function showData() {\n GetUser().then((res) => {\n for (const key in res) {\n addModalBox(res[key]);\n }\n });\n}","function openFormEditKienNghi() {\n showLoadingOverlay(modalIdKienNghi + \" .modal-content\");\n $.ajax({\n type: \"GET\",\n url: editKienNghiUrl,\n data: {\n id: HoSoVuAnID\n },\n success: function (response) {\n $(modalIdKienNghi + \" .modal-content\").html(response);\n\n hideLoadingOverlay(modalIdKienNghi + \" .modal-content\");\n }\n });\n }","function inicioEditar(idEmpresa){\n $.post(\"/censocc/viewcontroller/getAllDataEncuesta.php\", {idEmpresa : idEmpresa}, function(allDataEditar){\n var dataEdit = allDataEditar[0];\n $.post(\"editarencuesta.php\",function(data){\n //console.log(data);\n var $miModal = $(\"#myModalFormEdit\");\n $(\"#modalContentFormBody\").html(data);\n vaciarDatos(allDataEditar,$miModal);\n });\n });\n}","async function ModalUpdate(index) {\n const response = await api.get('analises');\n let contar = 0;\n const analisesBanco = response.data;\n\n analisesBanco.map(async analise => {\n const ObjAnalise = {\n id: analise.id,\n nomeAnalise: analise.analise,\n };\n contar += 1;\n setSelectAnalises(state => [...state, ObjAnalise]);\n if (analise.id === relatorioCacp[index].analiseId) {\n setIndex3(new IndexPath(contar));\n }\n // console.log(index3);\n });\n const item = {\n tipo_item_id: 1,\n };\n const response2 = await api.get('piscinas', { params: item });\n let contar1 = 0;\n const piscinasBanco = response2.data;\n\n piscinasBanco.map(async piscina => {\n const ObjPiscina = {\n id: piscina.id,\n nomePiscina: piscina.piscina,\n };\n contar1 += 1;\n setSelectPiscinas(state => [...state, ObjPiscina]);\n if (piscina.id === relatorioCacp[index].piscinaId) {\n setIndex(new IndexPath(contar1));\n }\n });\n\n setVisible(true);\n setRelatorioCacpId(relatorioCacp[index].id);\n setCloro(relatorioCacp[index].cloro.toString());\n setQualidadeAgua(relatorioCacp[index].qualidade_agua.toString());\n setTemperatura(relatorioCacp[index].temperatura.toString());\n setHidrogeron(relatorioCacp[index].hidrogeron.toString());\n setTemperaturaAmbiente(\n relatorioCacp[index].temperatura_ambiente.toString()\n );\n\n setTemperaturaRio(relatorioCacp[index].temperatura_rio.toString());\n setPh(relatorioCacp[index].ph.toString());\n\n setChecked(relatorioCacp[index].status_id === 1);\n }","function changeStatus() {\n // Grab id and new status from button\n // Attribute data-new-status holds \"true\" for save button and \"false\" for remove button\n const mongoId = $(this).attr('data-id');\n const newStatus = $(this).attr('data-new-status');\n // AJAX call to update article by ID\n $.ajax({\n method: 'PUT',\n url: `/articles/${mongoId}`,\n data: {\n saved: newStatus\n }\n })\n .then(function(data) {\n // If save was successfull, notify user\n if (data.saved === true) {\n // modal here\n console.log('saved');\n } else {\n // error message here\n console.log('something went wrong.');\n }\n // reload page\n location.reload();\n });\n }","function setNShowStatus(data) {\r\n $('.likesmodel').html(data);\r\n $('.likesmodel').modal('show')\r\n }","function modificarAuditoria()\n{\n var id = $(\"#idAuditoria\").val()\n console.log(\"id\",id_auditoria)\n sel_normas = \"\";\n $(\"#sel_normas option:selected\").each(function() {\n sel_normas = $(\"#sel_normas\").val();\n });\n\n // VALIDAMOS EL FORMUALARIO\n var res = validarAuditoria()\n //console.log(\"res\",res)\n\n if(result)\n {\n // ABRIMOS MODAL CONFIRMAR CAMBIOS EN AUDITORIA\n $('#modalConfirmarCambiosAuditoria').modal('show')\n // CERRAMOS MODAL MODIFICAR AUDITORIA\n $('#modificarAuditoriaModal').modal('hide');\n }\n else{ swal(\"Error\",\"Ingrese todos los datos\",\"error\") }\n\n}//*/","function showRulesModal(data)\r\n{\r\n //you can do anything with data, or pass more data to this function. i set this data to modal header for example\r\n\t $('.rulesDeleteByAdmin').attr('href','/rulesDeleteByAdmin?id='+data);\r\n\t$(\"#myRulesModal .rulesDeleteByAdminId\").html(data)\r\n $(\"#myRulesModal\").modal();\r\n}","function updateStaff(id){\r\n id = $('#modal_id').val();\r\n name = $('#modal_name').val();\r\n gender = $('#modal_gender').val();\r\n uni = $('#modal_uni').val();\r\n room = $('#modal_room').val();\r\n $.post(\"update.act\",{\r\n id:id,\r\n name:name,\r\n gender:gender,\r\n uni:uni,\r\n room:room,\r\n },function(data){\r\n clearChild();\r\n getList();\r\n swal({ type: \"success\", title: \"Update Successfully!\", timer: 1000, showConfirmButton: false });\r\n });\r\n}"],"string":"[\n \"function view_update_modal(id_table, url) {\\n $(`#${id_table} tbody`).on('click', '.btn-info', function() {\\n const id = $(this).data('id');\\n const response = get(`${url}${id}`);\\n response.then((res) => {\\n load_preloader_container(res.form.id, 10);\\n $('#modal_update').modal('show');\\n set_data_in_form(res.form.id, res.data);\\n stop_preloader(res.form.id, 1000);\\n update_data(res.form.id, res.form.rules, res.form.confirm, res.form.url);\\n }).catch((err) => {\\n toastr.error(err.message);\\n });\\n });\\n}\",\n \"function successUpdate() {\\n updateForm.style.display = \\\"none\\\";\\n updateSuccessView.style.display = \\\"block\\\";\\n setTimeout(closeUpdateModal, 1500);\\n }\",\n \"function updateVote(result, status) {\\n console.log(result);\\n $('p.votes').text(result.voted); // update the current display value\\n current_popup.find('p.votes').text(result.voted); // update the saved display value\\n}\",\n \"function updateModal(e) {\\n var articleDoi = $('.schedule-cancel-btn[data-article-id=\\\"' + schedule.articleId + '\\\"]').attr('data-article-doi');\\n $('.article-cancel-info', '#schedule-modal').html(articleDoi);\\n validateForm();\\n }\",\n \"function upcoming_tours_update_modal(offer_id)\\n{\\n\\t $.post( \\n \\\"upcoming_tours_update_modal.php\\\",\\n { offer_id : offer_id },\\n function(data) { \\n $('#div_upcoming_tours_update_modal').html(data);\\n });\\n}\",\n \"function displayModal() {\\n\\t\\t\\t\\t$(\\\"#user-name\\\").text(newPerson.name);\\n\\t\\t\\t\\t$(\\\"#match-name\\\").text(matchName);\\n\\t\\t\\t\\t$(\\\"#match-img\\\").attr(\\\"src\\\", matchImage);\\n\\t\\t\\t\\t$(\\\"#myModal\\\").modal();\\n\\t\\t\\t}\",\n \"async function createInvAdminModal() {\\n const modal = await modalController.create({\\n component: \\\"inv-admin-modal\\\",\\n cssClass: \\\"invAdminModal\\\",\\n });\\n\\n var settings = {\\n \\\"url\\\": `http://localhost:8080/api/admin/inventory/detail/${storedButtonID}`,\\n \\\"method\\\": \\\"GET\\\",\\n \\\"timeout\\\": 0,\\n };\\n \\n $.ajax(settings).done(function (response) {\\n var dataArray2 = JSON.parse(response);\\n console.log(dataArray2);\\n\\n document.getElementById(\\\"adminInvDonorName\\\").innerHTML = dataArray2[0].donor_name + \\\" | \\\" + dataArray2[0].donor_id;\\n document.getElementById(\\\"adminInvItemName\\\").innerHTML = dataArray2[0].item_name + \\\" | \\\" + dataArray2[0].item_id;\\n document.getElementById(\\\"adminInvLocation\\\").innerHTML = dataArray2[0].item_location;\\n document.getElementById(\\\"adminInvRepairFre\\\").innerHTML = dataArray2[0].repair_frequency;\\n document.getElementById(\\\"adminInvRepairSta\\\").innerHTML = dataArray2[0].repair_status;\\n document.getElementById(\\\"adminInvRepairType\\\").innerHTML = dataArray2[0].repair_type;\\n document.getElementById(\\\"adminInvStatus\\\").innerHTML = dataArray2[0].item_status;\\n\\n for (var i = 0; i < dataArray2.length; i++){\\n document.getElementById(\\\"adminInvStaHist\\\").append(dataArray2[i].item_status+\\\", \\\");\\n document.getElementById(\\\"adminInvLocHist\\\").append(dataArray2[i].item_location+\\\", \\\");\\n document.getElementById(\\\"adminInvDateHist\\\").append(dataArray2[i].item_date+\\\", \\\");\\n \\n }\\n\\n });\\n\\n \\n await modal.present();\\n currentModal = modal;\\n}\",\n \"function update_load_data()\\n{\\n\\t$(function(){\\n\\t$(\\\".update_object\\\").on(\\\"click\\\",function(e)\\n\\t{\\n\\t\\tvar id=$(this).attr(\\\"update_id\\\");\\n\\t\\te.preventDefault();\\n\\t\\t$.ajax({\\n\\t\\t\\turl:\\\"member_update_load.php\\\",\\n\\t\\t\\tdata:{id:id},\\n\\t\\t\\tmethod:\\\"POST\\\",\\n\\t\\t\\tsuccess:function(response)\\n\\t\\t\\t{\\n\\t\\t\\t\\t$(\\\".update_modal_body\\\").html(response);\\n\\t\\t\\t $(\\\"#UpdateMember\\\").modal(\\\"show\\\");\\n\\t\\t\\t}\\n\\t\\t});\\n\\t})\\n\\t});\\n}\",\n \"function updateClientModal() {\\n $(\\\"#clientNameValue\\\").val(selectedClient.name);\\n $(\\\"#clientCreditValue\\\").val(selectedClient.credit);\\n $(\\\"#clientLastLessonDateValue\\\").val(selectedClient.lastLessonDate);\\n}\",\n \"function updateAboutModal() {\\r\\n /**\\r\\n * we fetch the metrics\\r\\n */\\r\\n $.ajax({\\r\\n type: 'GET',\\r\\n url: 'ajax/fetch_about_modal_metrics.php',\\r\\n dataType: 'json',\\r\\n success: function (json) {\\r\\n $('#span_controller_url').html(json.controller_url);\\r\\n $('#span_controller_user').html(json.controller_user);\\r\\n $('#span_controller_version').html(json.controller_version);\\r\\n $('#span_memory_used').html(json.memory_used);\\r\\n },\\r\\n error: function(jqXHR, textStatus, errorThrown) {\\r\\n console.log(jqXHR);\\r\\n }\\r\\n });\\r\\n}\",\n \"function response_in_modal(response) {\\n $(\\\".modal-title\\\").html(response);\\n $(\\\"#empModal\\\").modal(\\\"show\\\");\\n}\",\n \"function showModalUpdate(id, autor,fecha,tnovedad,estado,detalle,idTabla,button,fila){\\n showModalRegister(id, autor,fecha,tnovedad,estado,detalle,idTabla);\\n var $d = $(button).parent(\\\"td\\\");\\n var Grid_Table = document.getElementById(idTabla); \\n $('#Autor').val(Grid_Table.rows[fila].cells[1].textContent);\\n $('#selectTnovedad').val(Grid_Table.rows[fila].cells[3].textContent);\\n $('#titulonovedad').val(Grid_Table.rows[fila].cells[5].textContent);\\n $('#detallenovedad').val(Grid_Table.rows[fila].cells[6].textContent); \\n }\",\n \"async function presentEditFeedModal( $item, langs_data ) {\\n // create the modal with the `modal-page` component\\n $doc.trigger('open-modal', [\\n await modalController.create({\\n component: 'modal-update-feed',\\n componentProps: {\\n 'langs' : langs_data,\\n 'lang' : $item.data('lang'),\\n 'id' : $item.data('id'),\\n 'url' : $item.data('url'),\\n 'title' : $item.find('ion-label h3 span').text(),\\n 'allow_duplicates' : $item.data('allow-duplicates'),\\n },\\n }),\\n function() {\\n setTimeout(function() {\\n $('#feed_title')[0].setFocus();\\n }, 500);\\n }\\n ]);\\n }\",\n \"addUpdateListener() {\\n this.updateBtn.click(() => {\\n if (this.text !== $('#modalText').val()) {\\n $.ajax({\\n type: \\\"PUT\\\",\\n url: `/api/chirps/${this.id}`,\\n data: JSON.stringify({ user: this.author, text: $('#modalText').val() }),\\n contentType: 'application/json',\\n success: () => {\\n console.log(\\\"successful update, id: \\\" + '/api/chirps/' + this.id);\\n }\\n });\\n displayAllChirps();\\n }\\n $('#exampleModalCenter').modal('toggle');\\n\\n });\\n }\",\n \"async function createCWInvModal() {\\n const modal = await modalController.create({\\n component: \\\"inv-cw-modal\\\",\\n cssClass: \\\"CWInvModal\\\",\\n });\\n\\n var settings = {\\n \\\"url\\\": `http://localhost:8080/api/caseworker/inventory/detail/${storedButtonID}`,\\n \\\"method\\\": \\\"GET\\\",\\n \\\"timeout\\\": 0,\\n };\\n \\n $.ajax(settings).done(function (response) {\\n var dataArray2 = JSON.parse(response);\\n console.log(dataArray2);\\n\\n document.getElementById(\\\"cwInvDonorName\\\").innerHTML = dataArray2[0].donor_name + \\\" | \\\" + dataArray2[0].donor_id;\\n document.getElementById(\\\"cwInvItemName\\\").innerHTML = dataArray2[0].item_name + \\\" | \\\" + dataArray2[0].item_id;\\n document.getElementById(\\\"cwInvItemLocation\\\").innerHTML = dataArray2[0].item_location;\\n document.getElementById(\\\"cwInvRepairFre\\\").innerHTML = dataArray2[0].repair_frequency;\\n document.getElementById(\\\"cwInvRepairSta\\\").innerHTML = dataArray2[0].repair_status;\\n document.getElementById(\\\"cwInvRepairType\\\").innerHTML = dataArray2[0].repair_type;\\n document.getElementById(\\\"cwInvItemStatus\\\").innerHTML = dataArray2[0].item_status;\\n\\n for (var i = 0; i < dataArray2.length; i++){\\n document.getElementById(\\\"cwInvStaHist\\\").append(dataArray2[i].item_status+\\\", \\\");\\n document.getElementById(\\\"cwInvLocHist\\\").append(dataArray2[i].item_location+\\\", \\\");\\n document.getElementById(\\\"cwInvDateHist\\\").append(dataArray2[i].item_date+\\\", \\\");\\n \\n }\\n\\n });\\n\\n await modal.present();\\n currentModal = modal;\\n}\",\n \"function updateInfo() {\\n const updatedInfoModal = document.getElementById('updatedInfoModal');\\n\\n updatedInfoModal.style.display = \\\"block\\\";\\n\\n $(\\\".okay\\\").on(\\\"click\\\", function () {\\n updatedInfoModal.style.display = \\\"none\\\";\\n })\\n}\",\n \"function updateModal(title, body) {\\n modal.querySelector(\\\".modal-title\\\").innerHTML = title\\n modal.querySelector(\\\".modal-body\\\").innerHTML = body\\n}\",\n \"function btnUpdate_click(dep) {\\n const title = document.getElementById(\\\"mdCreateTitle\\\");\\n title.textContent = \\\"Atualizar curso\\\";\\n\\n document.getElementById(\\\"txtName\\\").value = dep.name;\\n actualId = dep.id;\\n $(\\\"#modalCreate\\\").modal();\\n}\",\n \"function successModal(message1,message2) {\\n $(\\\"#modalsave\\\").hide();\\n $(\\\"#sure .modal-title\\\").text(message1);\\n $(\\\"#sure .modal-body\\\").html(message2);\\n $(\\\"#sure\\\").modal('show');\\n $(\\\"#sure\\\").modal('handleUpdate'); \\n }\",\n \"function setUpdateEvent(data){\\n\\t\\tvar theID = '#' + data.doc._rev;\\n\\t\\t$(theID).click(function(){\\n\\t\\t\\t$.each(jsonData.rows,function(i){\\n\\t\\t\\t\\tif(jsonData.rows[i].doc._rev == data.doc._rev){\\n\\t\\t\\t\\t\\tmodal.style.display = \\\"block\\\";\\n\\t\\t\\t\\t\\tlocalStorage.setItem(\\\"currentQuestion\\\",data.doc._rev);\\n\\t\\t\\t\\t\\tdocument.getElementById('english-question').value=data.doc[\\\"english-question\\\"];\\n\\t\\t\\t\\t\\tdocument.getElementById('english-answer').value=data.doc[\\\"english-answer\\\"];\\n\\t\\t\\t\\t\\tdocument.getElementById('arabic-question').value=data.doc[\\\"arabic-question\\\"];\\n\\t\\t\\t\\t\\tdocument.getElementById('arabic-answer').value=data.doc[\\\"arabic-answer\\\"];\\n\\t\\t\\t\\t\\tdocument.getElementById('playing-frequency').value=data.doc[\\\"playing frequency\\\"];\\n\\t\\t\\t\\t\\tdocument.getElementById('video-type').value=data.doc[\\\"video-type\\\"];\\n\\t\\t\\t\\t\\treturn false;\\n\\t\\t\\t\\t}\\n\\t\\t\\t})\\n\\t\\t});\\n}\",\n \"function updateData(nr) {\\n let item = users[nr];\\n\\n $(\\\".modal-img\\\").attr(\\\"src\\\", `${item.picture.large}`);\\n $(\\\".modal-name\\\").html(\\n `${item.name.title} ${item.name.first} ${item.name.last}`\\n );\\n $(\\\".modal-text\\\")\\n .eq(0)\\n .html(`${item.email}`);\\n $(\\\".modal-text\\\")\\n .eq(1)\\n .html(`${item.location.city}`);\\n $(\\\".modal-text\\\")\\n .eq(2)\\n .html(`${item.cell}`);\\n $(\\\".modal-text\\\")\\n .eq(3)\\n .html(\\n `${item.location.street}, ${item.location.city}, ${item.location.state} ${\\n item.location.postcode\\n }`\\n );\\n $(\\\".modal-text\\\")\\n .eq(4)\\n .html(`Birthday: ${item.dob.date.split(\\\"T\\\")[0]}`); // Split TS to only get Date\\n}\",\n \"function updateProfileModal() {\\n $.ajax({\\n url: _BASEURLJSONSERVER + '/' + supervisorList,\\n data: {\\n \\\"id\\\": empid\\n },\\n success: function(data) {\\n fillAndShowUpdateProfileModal(data,'supervisor');\\n },\\n error: function() {\\n alert('unable to get data from server');\\n }\\n\\n });\\n }\",\n \"function showEditDialog(row_id) {\\n $(\\\"#ServiceModal h4\\\").text(\\\"Edit Service \\\"+row_id);\\n /*\\n * Get info about service from server\\n * perform an ajax POST\\n */\\n $.ajax( { \\n url: $SCRIPT_ROOT +\\\"/get_row\\\",\\n contentType: \\\"application/json; charset=utf-8\\\",\\n method: \\\"GET\\\",\\n dataType: \\\"json\\\",\\n data: { \\\"row_id\\\": row_id },\\n success: function ( json ) {\\n if (json.status == 'OK'){\\n $.each( json, function( key, val ) {\\n // pre-populate the fields\\n $('input[name=\\\"'+key+'\\\"]').val(val);\\n $('textarea[name=\\\"'+key+'\\\"]').val(val);\\n });\\n }\\n else{\\n alert(json.status);\\n }\\n },\\n error: function ( req, reqStatus, reqObj ) {\\n alert(\\\"ERROR! Server returned error from ajax submit, try again\\\");\\n }\\n\\n });\\n\\n $(\\\"#ServiceModal\\\").modal(\\\"show\\\");\\n }\",\n \"function updateSuccess(itemsdata) {\\n tbl.clear();\\n redrawTable(tbl, itemsdata);\\n buttonEvents();\\n $(\\\"#editDiv\\\").hide();\\n swal(\\\"עודכן בהצלחה!\\\", \\\"הפעולה בוצעה\\\", \\\"success\\\");\\n mode = \\\"\\\";\\n }\",\n \"function showModal() {\\n\\n $('#myModal').modal(\\\"show\\\");\\n $(\\\".modal-title\\\") .text(data.name)\\n $(\\\".modal-li-1\\\") .text(\\\"Accuracy: \\\" + data.accuracy)\\n $(\\\".modal-li-2\\\").text(\\\"PP: \\\" + data.pp)\\n $(\\\".modal-li-3\\\").text(\\\"Power: \\\" + data.power)\\n $(\\\".modal-li-4\\\").text(\\\"Type: \\\" + data.type.name)\\n $(\\\".modal-li-5\\\").text(\\\"Priority: \\\" + data.priority)\\n \\n }\",\n \"function showLastRunDetails() {\\n $('#modal-container').html(last_run_details_template(runResults))\\n $('#modal-container').modal()\\n}\",\n \"function updateView(result) {\\n showScheduleButton();\\n showResultMessage(result.message);\\n loadTasks();\\n}\",\n \"function updateCallbackOk(result) {\\n $(\\\"#mdlAlert\\\").modal(\\\"hide\\\");\\n $(\\\"#tblAlerts\\\").bootstrapTable(\\\"updateRow\\\", {\\n index: TableUtil.getTableIndexById(\\\"#tblAlerts\\\", $(\\\"#txtAlertId\\\").val()),\\n row: {\\n Id: $(\\\"#txtAlertId\\\").val(),\\n Name: $(\\\"#txtAlertName\\\").val(),\\n Description: $(\\\"#txtAlertDescription\\\").val(),\\n DueDate: DateUtil.formatDateTime($(\\\"#txtAlertDueDate\\\")\\n .data(\\\"DateTimePicker\\\").date())\\n }\\n });\\n }\",\n \"function openModal(data) {\\n\\n\\t//change beginning and end inputs to date objects\\n\\t// Split timestamp into [ Y, M, D, h, m, s ]\\n\\tvar d = data[0]['date_debut'].split(/[- :]/);\\n\\tvar f = data[0]['date_fin'].split(/[- :]/);\\n\\n\\t// Apply each element to the Date function\\n\\tvar debut = new Date(Date.UTC(d[0], d[1]-1, d[2], d[3], d[4], d[5]));\\n\\tvar fin = new Date(Date.UTC(f[0], f[1]-1, f[2], f[3], f[4], f[5]));\\n\\n\\t//fill modal with correct data\\n\\t$('#updateServiceId').val(data[0]['fk_service']);\\n\\t$('#updatePromoServiceId').val(data[0]['pk_promotion_service']);\\n\\tdocument.getElementById(\\\"debut\\\").valueAsDate = debut;\\n\\tdocument.getElementById(\\\"fin\\\").valueAsDate = fin;\\n\\t$('#updateCodePromo').val(data[0]['code']);\\n\\t$('#updatePromoName').val(data[0]['fk_promotion']);\\n\\t\\n\\t//change percentage of box based on chosen promotion\\n\\tvar e = document.getElementById('updatePromoName');\\n var promo = e.children[e.selectedIndex];\\n var percent = promo.getAttribute(\\\"data-percent\\\");\\n document.getElementById('updatePromoNb').innerHTML = percent * 100 + \\\"%\\\";\\n\\t\\n modal.style.display = \\\"block\\\";\\n}\",\n \"function Editclick(obj) {\\n var rowID = $(obj).attr('id');\\n $.ajax({\\n url: `https://localhost:44397/api/patients/ ${rowID}`,\\n type: 'GET',\\n success: function (response) {\\n $.ajax({\\n type: \\\"GET\\\",\\n url: '/Home/CreateorUpdate',\\n cache: false,\\n data:response,\\n dataType: \\\"html\\\",\\n success: function (responseText) {\\n $('#editor-content-container').html(responseText);\\n console.log(responseText);\\n $('#editor-container').modal('show');\\n }\\n });\\n },\\n });\\n}\",\n \"function updateResults() {\\n const resultLink = $(\\\"#resultlink\\\").serialize();\\n $.ajax({\\n method: \\\"GET\\\",\\n url: \\\"/update\\\",\\n data: resultLink,\\n dataType: \\\"json\\\",\\n success: function (result) {\\n console.log(\\\"it was success \\\", result);\\n },\\n error: function (err) {\\n console.log(\\\"we are in an error\\\", err);\\n }\\n })\\n\\n }\",\n \"function InitUpdateModal(detailUser) {\\n $(\\\"#name\\\").val(detailUser.name);\\n $(\\\"#phone\\\").val(detailUser.phone);\\n}\",\n \"function showModal() {\\n\\n $('#myModal').modal(\\\"show\\\");\\n $(\\\".modal-title\\\").text(data.name)\\n $(\\\".modal-li-1\\\").text(\\\"Generation: \\\" + data.generation.name)\\n $(\\\".modal-li-2\\\").text(\\\"Effect: \\\" + data.effect_changes[0].effect_entries[1].effect)\\n $(\\\".modal-li-3\\\").text(\\\"Chance: \\\" + data.effect_entries[1].effect)\\n $(\\\".modal-li-4\\\").text(\\\"Bonus Effect: \\\" + data.flavor_text_entries[0].flavor_text)\\n }\",\n \"function modalCommentary(id)\\n{\\n $.ajax({\\n url: apiCatalogo + 'get',\\n type: 'post',\\n data:{\\n idProducto: id\\n },\\n datatype: 'json'\\n })\\n .done(function(response){\\n //Se verifica si la respuesta de la API es una cadena JSON, sino se muestra el resultado en consola\\n if (isJSONString(response)) {\\n const result = JSON.parse(response);\\n //Se comprueba si el resultado es satisfactorio para mostrar los valores en el formulario, sino se muestra la excepción\\n if (result.status) {\\n $('#form-comentario')[0].reset();\\n $('#idProducto').val(result.dataset.idProducto); \\n M.updateTextFields();\\n $('#modalComentario').modal('open');\\n } else {\\n sweetAlert(2, result.exception, null);\\n }\\n } else {\\n console.log(response);\\n }\\n })\\n .fail(function(jqXHR){\\n //Se muestran en consola los posibles errores de la solicitud AJAX\\n console.log('Error: ' + jqXHR.status + ' ' + jqXHR.statusText);\\n });\\n}\",\n \"function updateRelease() {\\n const relId = document.getElementById(\\\"modal-id\\\").value.substring(3);\\n const nom = document.getElementById(\\\"modal-name\\\").value;\\n const date = document.getElementById(\\\"modal-date\\\").value;\\n const description = document.getElementById(\\\"modal-description\\\").value;\\n const link = document.getElementById(\\\"modal-src_link\\\").value;\\n const sprint = document.getElementById(\\\"modal-sprint\\\").value;\\n\\n let jsonData = {\\n \\\"name\\\": nom,\\n \\\"release_date\\\": formatDate(date, false),\\n \\\"description\\\": description,\\n \\\"src_link\\\": link,\\n \\\"sprint\\\": sprint\\n };\\n\\n sendAjax(\\\"/api/release/\\\" + relId, 'PUT', JSON.stringify(jsonData)).then(res => {\\n $(\\\"#rel\\\" + res.id + \\\"-name\\\").empty().append(res.name);\\n $(\\\"#rel\\\" + res.id + \\\"-description\\\").empty().append(res.description);\\n $(\\\"#rel\\\" + res.id + \\\"-releaseDate\\\").empty().append(formatDate(res.releaseDate));\\n $(\\\"#rel\\\" + res.id + \\\"-src_link\\\").empty().append(res.srcLink);\\n $(\\\"#rel\\\" + res.id + \\\"-sprint\\\").empty().append(\\\"<span id='sprint-id-rel-\\\" + res.id + \\\"' class='hidden'>\\\" + res.sprint.id + \\\"</span>\\\" +\\n \\\"Du \\\" + formatDate(res.sprint.startDate) + \\\" au \\\" + formatDate(res.sprint.endDate));\\n $(\\\"#modal-release\\\").modal(\\\"hide\\\");\\n })\\n}\",\n \"function adminModif(id){\\n console.log(id)\\n biblio = biblioteca[id]\\n document.querySelector(\\\"#titleModal\\\").innerText = biblio.titulo\\n document.querySelector(\\\"#authorModal\\\").value = biblio.autor\\n document.querySelector(\\\"#demogModal\\\").value = biblio.demografia\\n document.querySelector(\\\"#categModal\\\").value = biblio.categoria\\n document.querySelector(\\\"#añoModal\\\").value = biblio.año\\n document.querySelector(\\\"#ediModal\\\").value = biblio.editorial\\n document.querySelector(\\\"#tomoModal\\\").value = biblio.tomo\\n document.querySelector(\\\"#imgModal\\\").value = biblio.imagen\\n document.querySelector(\\\"#descripModal\\\").value = biblio.descripcion\\n \\n $('#adminModif').modal('show')\\n \\n}\",\n \"function onUpdateSuccess(data) {\\n console.log(\\\"update success!\\\");\\n console.log(data);\\n var jsonData = $.parseJSON(data);\\n var results = $('<h2>');\\n results.html(\\\"Created Video ID: \\\" + jsonData.result.id);\\n $('#results').append(results); \\n $('#results').css('backgroundColor', '#AFFFB4');\\n}\",\n \"function displayResults() {\\n modalMoves.innerHTML = movesCounter.innerHTML;\\n modalTime.innerHTML = timerDisplay.innerHTML;\\n modal.style.display = 'block';\\n}\",\n \"showEditDeleteModal(rowData) {\\n $(\\\"#rid\\\").val(rowData.id);\\n $(\\\"#rdescription\\\").val(rowData.description);\\n $(\\\"#rprice\\\").val(rowData.price);\\n $(\\\"#rrooms\\\").val(rowData.rooms);\\n $(\\\"#rmail\\\").val(rowData.mail);\\n $(\\\"#rname\\\").val(rowData.name);\\n $(\\\"#rphoneNr\\\").val(rowData.phoneNr);\\n $(\\\"#editDeleteModal\\\").modal('show');\\n }\",\n \"function onEditCallSuccess (json) {\\n var listingToEdit = json;\\n $modal = $('#updateListingModal');\\n // $imgUrlField = $modal.find('#updateListingImgUrl');\\n\\n //$zipField = $modal.find('#updateListingZip');\\n $titleField = $modal.find('#updateListingTitle');\\n $rentField = $modal.find('#updateListingRent');\\n\\n //$imgUrlField.val(listingToEdit.imgUrl);\\n //$streetField.val(listingToEdit.street);\\n //$cityField.val(listingToEdit.city);\\n //$stateField.val(listingToEdit.state);\\n //$zipField.val(listingToEdit.zip);\\n $titleField.val(listingToEdit.title);\\n $rentField.val(listingToEdit.rent);\\n\\n $('#updateListing').on('click', handleUpdateListing);\\n\\n}\",\n \"function editRecg(questionId){\\n $.ajax({\\n url : 'recognition.php',\\n method: 'post',\\n dataType: 'json',\\n data:{\\n key: 'getRecg',\\n questionId: questionId\\n },\\n \\n success: function(response){\\n $('#editRecgId').val(questionId);\\n $('#question_number').val(response.question_number);\\n $('#survey_question').val(response.survey_question);\\n $('#agree').val(response.agree);\\n $('#disagree').val(response.disagree);\\n $('#prefer_not_to_say').val(response.prefer_not_to_say);\\n $('#recgModal').modal('show');\\n\\n /**\\n * change the value of input to update and the button style whilst\\n * updating the row with the updated data\\n */\\n $('#updateRecg').attr('value', 'Update').attr('class', \\\"btn btn-dark\\\").attr('onclick', \\\"manageData('updateRecg')\\\")\\n alert(response)\\n }\\n })\\n}\",\n \"function updateCallbackOk(result) {\\n $(\\\"#mdlTask\\\").modal(\\\"hide\\\");\\n $(\\\"#tblTasks\\\").bootstrapTable(\\\"updateRow\\\", {\\n index: TableUtil.getTableIndexById(\\\"#tblTasks\\\", $(\\\"#txtTaskId\\\").val()),\\n row: {\\n Id: $(\\\"#txtTaskId\\\").val(),\\n Name: $(\\\"#txtTaskName\\\").val(),\\n Description: $(\\\"#txtTaskDescription\\\").val(),\\n Order: $(\\\"#txtTaskOrder\\\").val(),\\n Status: $(\\\"#ddlTaskStatus option:selected\\\").text()\\n }\\n });\\n }\",\n \"function updateModal(bill, noOfPeople, totalPPS) {\\n $('#billPara').html('€' + bill);\\n $('#peoplePara').html(noOfPeople);\\n\\n switch (tipPercentMultiplier) {\\n case '1.05':\\n percentage = 5;\\n break;\\n case '1.10':\\n percentage = 10;\\n break;\\n case '1.15':\\n percentage = 15;\\n break;\\n case '1.20':\\n percentage = 20;\\n break;\\n case '1.25':\\n percentage = 25;\\n break;\\n default:\\n percentage = 0;\\n }\\n\\n $('#percentagePara').html(percentage + '%');\\n $('#totalPerPersonPara').html('€' + totalPPS);\\n}\",\n \"function Mostrar(id) {\\n$(\\\"#hidden_usuario_id\\\").val(id);\\n$.post(\\\"../../model/users/unique_info.php\\\", {\\nid: id\\n},\\nfunction (data, status) {\\nvar dato = JSON.parse(data);\\n$(\\\"#nick2\\\").val(dato.nick);\\n$(\\\"#nombre2\\\").val(dato.nombre_usuario);\\n$(\\\"#correo2\\\").val(dato.correo_usuario);\\n$(\\\"#nivel2\\\").val(dato.nivel);\\n}\\n);\\n$(\\\"#modaluserupdate\\\").modal(\\\"show\\\");\\n}\",\n \"function top_track_moda (tracks){\\n var id_modal = \\\"#modal_track\\\";\\n $(id_modal+ \\\" h4\\\").text(\\\"Track\\\");\\n var result='<table class=\\\"table\\\">'+\\n '<thead>'+\\n '<tr>'+\\n '<th colspan=\\\"5\\\" class=\\\"text-center\\\"><h2>'+tracks.track_name+'</h2></th>'+\\n '</tr>'+\\n '</thead>'+\\n '<tbody>'+\\n '<tr>'+\\n '<th class=\\\"text-center\\\">Disc Number</th><th class=\\\"text-center\\\">Track Number</th><th class=\\\"text-center\\\">Album Name</th><th class=\\\"text-center\\\">Duration</th><th class=\\\"text-center\\\">Preview</th>'+\\n '</tr>'+ \\n '<tr>'+\\n '<td class=\\\"text-center\\\">'+tracks.disc_number+'</td>'+\\n '<td class=\\\"text-center\\\">'+tracks.track_number+'</td>'+\\n '<td id=\\\"'+tracks.album_id+'\\\" class=\\\"text-center\\\">'+tracks.album_name+'</td>'+\\n '<td class=\\\"text-center\\\">'+millisToMinutesAndSeconds(tracks.duration_ms)+'</td>'+\\n '<td class=\\\"text-center\\\"><a target=\\\"_blank\\\" href=\\\"'+tracks.preview_url+'\\\"><span class=\\\"glyphicon glyphicon-music\\\"></span></a></td>'+\\n '</tr>'; \\n \\n '</tbody>'+\\n '</table>';\\n // $(\\\"#tracklist_list\\\").empty();\\n //$(\\\"#tracklist_list\\\").append(result);\\n $(id_modal+\\\" .modal-body\\\").empty();\\n $(id_modal+\\\" .modal-body\\\").append(result);\\n $(id_modal+\\\" td:nth-child(3)\\\").click(function (){\\n var id_album =$(this).attr(\\\"id\\\");\\n var url = \\\"https://api.spotify.com/v1/albums/\\\" + id_album + \\\"/tracks\\\";\\n request(url,\\\"load_tracks\\\",tracks.album_name);\\n });\\n \\n \\n $(id_modal).modal('show'); \\n}\",\n \"function results(){\\n totalMoves = moves.innerHTML;\\n totalTime = timerDiv.innerHTML;\\n\\n let modalStars = document.querySelector('.total-stars');\\n let modalTimer = document.querySelector('.total-time');\\n let modalMoves = document.querySelector('.total-moves');\\n\\n modalMoves.innerHTML = totalMoves;\\n modalTimer.innerHTML = totalTime;\\n modalStars.innerHTML = `Stars remaining: ${totalStars}`\\n}\",\n \"function modalSearch(){\\n\\t$('#lbl_title').text('Search Data Infaq');\\n\\t$('#m_search').modal('show');\\n}\",\n \"function modalEditOnShown(dialogRef) {\\r\\n\\t\\t\\tvar rowData = dt.row('.selected').data(),\\r\\n\\t\\t\\t\\tmodalBody = dialogRef.getModalBody(),\\r\\n\\t\\t\\t\\r\\n\\t\\t\\t// For checking active licenses\\r\\n\\t\\t\\tparams = { \\r\\n\\t\\t\\t\\tlicense_status: 1,\\r\\n\\t\\t\\t\\tclientLicenseId: rowData.client_id \\r\\n\\t\\t\\t};\\r\\n\\t\\t\\t\\t\\r\\n\\t\\t\\t// Check if client have active licenses\\r\\n\\t\\t\\t$.post(WS_LIST_LICENSES, params)\\r\\n\\t\\t\\t\\t.done(function (results, status) {\\r\\n\\t\\t\\t\\t\\t\\r\\n\\t\\t\\t\\t\\t// Remove elements for status\\r\\n\\t\\t\\t\\t\\tmodalBody.find('select[data-field=\\\"status\\\"]').selectpicker('destroy');\\r\\n\\t\\t\\t\\t\\tmodalBody.find('select[data-field=\\\"status\\\"]').remove();\\r\\n\\t\\t\\t\\t\\tmodalBody.find('input[data-field=\\\"status\\\"]').remove();\\r\\n\\t\\t\\t\\t\\tmodalBody.find('input[data-value=\\\"status\\\"]').remove();\\r\\n\\t\\t\\t\\t\\t\\r\\n\\t\\t\\t\\t\\t// Append input (readonly) \\r\\n\\t\\t\\t\\t\\tif (results.response.type === 'SUCCESS') {\\t\\t\\t\\t\\t\\t\\r\\n\\t\\t\\t\\t\\t\\tmodalBody.find('#status-box').append(\\r\\n\\t\\t\\t\\t\\t\\t\\t'<input type=\\\"hidden\\\" data-field=\\\"status\\\" value=\\\"1\\\">' +\\r\\n\\t\\t\\t\\t\\t\\t\\t'<input type=\\\"text\\\" class=\\\"form-control\\\" data-value=\\\"status\\\" value=\\\"Active\\\" readonly>'\\r\\n\\t\\t\\t\\t\\t\\t);\\r\\n\\t\\t\\t\\t\\t\\t\\r\\n\\t\\t\\t\\t\\t// Append select\\r\\n\\t\\t\\t\\t\\t} else {\\t\\t\\t\\t\\t\\r\\n\\t\\t\\t\\t\\t\\tmodalBody.find('#status-box').append(\\r\\n\\t\\t\\t\\t\\t\\t\\t'<select class=\\\"form-control\\\" data-field=\\\"status\\\">' +\\r\\n\\t\\t\\t\\t\\t\\t\\t\\t'<option value=\\\"1\\\">Active</option>' +\\r\\n\\t\\t\\t\\t\\t\\t\\t\\t'<option value=\\\"0\\\">Inactive</option>' +\\r\\n\\t\\t\\t\\t\\t\\t\\t'</select>'\\r\\n\\t\\t\\t\\t\\t\\t);\\t\\t\\t\\t\\t\\t\\r\\n\\t\\t\\t\\t\\t}\\t\\r\\n\\r\\n\\t\\t\\t\\t\\t// Load form values\\r\\n\\t\\t\\t\\t\\t$.each(rowData, function (name, value) {\\t\\t\\t\\t\\t\\t\\r\\n\\t\\t\\t\\t\\t\\tif (name === 'status') {\\r\\n\\t\\t\\t\\t\\t\\t\\tmodalBody.find('select[data-field=\\\"status\\\"]').val(value === 'Active' ? '1' : '0')\\r\\n\\t\\t\\t\\t\\t\\t\\tmodalBody.find('select[data-field=\\\"status\\\"]').selectpicker();\\r\\n\\t\\t\\t\\t\\t\\t}\\telse {\\r\\n\\t\\t\\t\\t\\t\\t\\tmodalBody.find('input[data-field=\\\"' + name + '\\\"]').val(value);\\t\\t\\t\\t\\t\\t\\t\\r\\n\\t\\t\\t\\t\\t\\t}\\t\\t\\t\\t\\r\\n\\t\\t\\t\\t\\t});\\t\\t\\t\\t\\t\\t\\r\\n\\t\\t\\t\\t})\\r\\n\\t\\t\\t\\t\\r\\n\\t\\t\\t\\t// Show WS Error\\r\\n\\t\\t\\t\\t.fail(function () {\\r\\n\\t\\t\\t\\t\\tSTIC.ShowWSError({ formId: params.formId });\\r\\n\\t\\t\\t\\t});\\r\\n\\t\\t}\",\n \"function update() {\\n axios.post('../../api/controller.php', {\\n action: \\\"update-disciplina\\\",\\n values: [\\n $(\\\"#editar_disciplina\\\").val(),\\n $(\\\"#id_disciplina\\\").val()\\n ]\\n }).then(function (response) {\\n if (response.data) {\\n $('#modal_update_disciplinas').modal('hide')\\n $(\\\"#editar_disciplina\\\").val(\\\"\\\")\\n Swal.fire(\\n 'Sucesso',\\n 'Disciplina Editada com sucesso',\\n 'success'\\n );\\n $(\\\"#table\\\").DataTable().destroy()\\n getDisciplinas()\\n\\n\\n } else {\\n Swal.fire(\\n 'Ops :(',\\n 'Não foi possivel editar essa disciplina',\\n 'error'\\n );\\n $(\\\"#table\\\").DataTable().destroy()\\n getDisciplinas()\\n }\\n })\\n}\",\n \"function actualizar_oi(){\\n $('#confirmar_actualizar_oi').modal('show');\\n}\",\n \"function showEditPromotionModal(productSku, productName, productModel, carePakSku, carePakType, carePakPeriod, startDate, endDate, registrationPeriod) {\\n // Rest form of previous values\\n $(\\\"#editPromotionInfo\\\")[0].reset();\\n // Assign the json values to the fields\\n $(\\\"#productSku\\\").val(productSku);\\n $(\\\"#productName\\\").val(productName);\\n $(\\\"#productModel\\\").val(productModel);\\n $(\\\"#carePakSku\\\").val(carePakSku);\\n $(\\\"#carePakType\\\").val(carePakType);\\n $(\\\"#carePakPeriod\\\").val(carePakPeriod);\\n $(\\\"#startDate\\\").val(startDate);\\n $(\\\"#endDate\\\").val(endDate);\\n $(\\\"#registrationPeriod\\\").val(registrationPeriod);\\n\\n // Show the overlay\\n $(\\\".overlay\\\").css('display', 'block');\\n $(\\\"#editPromotionModal\\\").css('display', 'block');\\n}\",\n \"function successReload(option) {\\n visitas.closeModal(option); //Aquí cerramos el modal, llamamos al JS que se llama visitas y ejecutamos el metodo closeModal\\n //alert(\\\"Todo bien\\\");\\n alertUpdate(); //metodo hub\\n }\",\n \"function updateService() { //add to onlick\\n $.ajax({'success': function (html) {\\n\\t\\t$('#modalServiceGroupsBody').html(html);\\n\\t\\t$('#modalServiceGroups').modal('show');\\n\\t\\t$('#Paid_Services_price').inputmask(\\\"9{2,9}.9{2}\\\");\\n\\t},\\n\\t\\t\\t'url': $(this).attr('href')\\n });\\n return false;\\n}\",\n \"function uncoretModal(){\\n $(\\\"#uncoretModal .modal-body\\\").html(\\\"Yakin kembalikan \\\"+currentProfile.tec_regno+\\\" (\\\"+currentProfile.name+\\\") ?\\\")\\n $('#uncoretModal').modal('show');\\n}\",\n \"function modal_edit_refaccion(refaccion) \\r\\n{\\r\\n /*Recuperar el id de la garantia que se desea actualizar*/\\r\\n var refaccion_id = refaccion;\\r\\n $('#modal_edit_refaccion').modal('toggle');\\r\\n search_refaccion(refaccion);//Buscar las refacciones\\r\\n\\r\\n return false;\\r\\n}\",\n \"toggleModal() {\\n if (this.modal == true) {\\n customerService.getCustomerSearch(result => {\\n this.temporaryOptions = [];\\n result.map(e => {\\n this.temporaryOptions.push({ value: e.c_id, label: e.fullname });\\n });\\n this.searchbarOptions = this.temporaryOptions;\\n });\\n }\\n this.modal ? (this.modal = false) : (this.modal = true);\\n }\",\n \"function mostrarFechasResultantes (infoFechaInmunidad, infoFechaRevacunacion){\\n //levanto el modal donde están las cajas de mensaje donde\\n //cargo la información de las fechas\\n $('#modalInfo').modal();\\n //asigno la información de las fechas a las cajas de texto\\n const infoFechaInmune = document.getElementById(\\\"fInmune\\\");\\n infoFechaInmune.innerHTML = `${infoFechaInmunidad}`;\\n const infoFechaRevacunar = document.getElementById(\\\"fRevacunacion\\\");\\n infoFechaRevacunar.innerHTML = `${infoFechaRevacunacion}`;\\n\\n\\n}\",\n \"update() {\\n this.scoreHTML.innerText = this.score;\\n // show modal if you score 12\\n if(this.score == 12){\\n this.win();\\n }\\n }\",\n \"function setModal(id, json){\\r\\n for(var i = 0; i < json['products'].length; i++){\\r\\n var data = json['products'][i]\\r\\n if(data['id'] == id){\\r\\n $(\\\"#modal-shop-title\\\").html(data['name']);\\r\\n $(\\\"#modal-shop-price\\\").html(data['price']+\\\"€\\\");\\r\\n $(\\\"#modal-shop-description\\\").html(data['description']);\\r\\n\\r\\n UIkit.modal(\\\"#modal-shop\\\").show();\\r\\n }\\r\\n }\\r\\n}\",\n \"function show_modal_response( data ){\\n //debugger\\n if(data){\\n j('#response').html( S(data) );\\n j('#fancybox_trigger').trigger('click');\\n }\\n }\",\n \"function showModel(TSID, task) {\\n var jsonAction = JSON.parse(list.filter(o => o.treansactionID_FK == currentVacationId)[0].actions).filter(o => o.TSID == TSID)[0];\\n $.ajax({\\n url: \\\"/TicketsApprovment/forTickets/\\\" + currentVacationId,\\n typr: \\\"GET\\\",\\n contentType: \\\"application/json;charset=UTF-8\\\",\\n dataType: \\\"json\\\",\\n success: function (Data) {\\n tickets = JSON.parse(Data.Data);\\n if (Data.Code === 200) { \\n var result = myUserControl(jsonAction, task, Data.Data);\\n $(\\\"#userControl\\\").css(\\\"margin-top\\\", \\\"7%\\\");\\n $(\\\"#userControl .modal-title\\\").html(result[0]);\\n $(\\\"#userControl .modal-body\\\").html(result[1]);\\n $(\\\"#userControl .modal-footer\\\").html(result[2]);\\n $(\\\"#userControl .modal-dialog\\\").width(result[2] + '%');\\n\\n\\n\\n $(\\\"#userControl\\\").modal('show');\\n }\\n },\\n error: function (errormessage) {\\n console.log(errormessage.responseText);\\n }\\n\\n });\\n\\n\\n \\n\\n}\",\n \"function showEditContactModal(data) { \\n var jdata = arcGetJson(data);\\n $(\\\"#contactname\\\").val(jdata.name);\\n $(\\\"#contacttitle\\\").val(jdata.title);\\n $(\\\"#contactemail\\\").val(jdata.email);\\n $(\\\"#contactphone\\\").val(jdata.phone);\\n $(\\\"#contactid\\\").val(jdata.id);\\n $(\\\"#editContactModal\\\").modal(\\\"show\\\");\\n}\",\n \"function modalDisplay(chosenRest) {\\n // in case no restaurant fits the criteria\\n if (chosenRest === undefined) {\\n $(\\\"#no-results-modal\\\").removeClass(\\\"modal_hidden\\\");\\n $(\\\"#load\\\").addClass(\\\"hidden\\\");\\n return;\\n }\\n $(\\\"#res-name\\\").text(chosenRest.name);\\n $(\\\"#res-icon\\\").attr(\\\"src\\\", chosenRest.icon);\\n $(\\\"#address\\\").text(chosenRest.vicinity);\\n $(\\\"#res-rate\\\").text(\\\"Rating: \\\" + chosenRest.rating);\\n\\n $(\\\"#res-modal\\\").removeClass(\\\"modal_hidden\\\");\\n }\",\n \"function openModalMaaltijdfilterUpdate(htmlColumn) {\\n\\tsetModalMaaltijdfilterModus(false);\\n\\trow = htmlColumn.closest(\\\"tr\\\");\\n\\tid = getColumnValue(row, 'id');\\n\\tproductgroepId = getColumnValue(row, 'productgroep-id');\\n\\tmaaltijdtypeId = getColumnValue(row, 'maaltijdtype-id');\\n\\tmaaltijdsubtypeId = getColumnValue(row, 'maaltijdsubtype-id');\\n\\ttooltip = getColumnValue(row, 'tooltip');\\n\\t// Set the id for the row so it can be identified for a text update.\\n\\trow.attr('id', 'fltr_' + id);\\n\\tsetModalMaaltijdfilterModus(false);\\n\\tsetModalMaaltijdfilterValue('id',id, false);\\n\\tsetModalMaaltijdfilterValue('productgroep-id',productgroepId, false, 'select');\\n\\tsetModalMaaltijdfilterValue('maaltijdtype-id',maaltijdtypeId, false, 'select');\\n\\tsetModalMaaltijdfilterValue('maaltijdsubtype-id',maaltijdsubtypeId, false, 'select');\\n\\tsetModalMaaltijdfilterValue('tooltip',tooltip, false, 'textarea');\\n\\t$(\\\"#modal-maaltijdfilter\\\").modal('show');\\n}\",\n \"function updateViewEmployeeModal() {\\n var image_url = $('#baseUrl').val();\\n $('#viewEmployeeDataModal').find('.emp_name').html(current_employee.name);\\n $('#viewEmployeeDataModal').find('.emp_address').html(current_employee.address);\\n\\n if (current_employee.image && current_employee.image != null) {\\n $('#viewEmployeeDataModal').find('.emp_image').attr('src', (image_url + current_employee.image));\\n }\\n updateViewMapLoc(current_employee.lat, current_employee.lng);\\n}\",\n \"function okOnGet(data, postFun){\\r\\n $(\\\"#\\\"+modal+\\\" .modal-body\\\").html(data.content);\\r\\n registerForm(postFun);\\r\\n $(\\\"#\\\"+modal).modal(\\\"show\\\");\\r\\n //mymodal.open();\\r\\n }\",\n \"function showModal() {\\n\\n $('#myModal').modal(\\\"show\\\");\\n $(\\\".modal-title\\\").text(data.name)\\n $(\\\".modal-img\\\").attr('src', data.sprites.other['official-artwork'].front_default);\\n $(\\\".modal-li-1\\\").text(\\\"Type: \\\" + data.types[0].type.name)\\n $(\\\".modal-li-2\\\").text(\\\"Abilities: \\\" + data.abilities[0].ability.name + \\\"/\\\" + data.abilities[1].ability.name)\\n $(\\\".modal-li-3\\\").text(\\\"Stats: \\\" + \\\"HP: \\\" + data.stats[0].base_stat + \\\" ATK: \\\" + data.stats[1].base_stat + \\\" DEF: \\\" + data.stats[2].base_stat + \\\" SP. ATK: \\\" + data.stats[3].base_stat + \\\" SP. DEF: \\\" + data.stats[4].base_stat + \\\" SPD: \\\" + data.stats[5].base_stat)\\n $(\\\".modal-li-4\\\").text(\\\"Base XP: \\\" + data.base_experience);\\n $(\\\".modal-li-5\\\").text(\\\"Height: \\\" + data.height + \\\" ft \\\" + \\\"Weight: \\\" + data.weight + \\\" lbs\\\")\\n }\",\n \"function editCategoryModal(id) {\\n $.ajax({\\n url: '../Category/categoryApi.php', // url where to submit the request\\n type: \\\"POST\\\", // type of action POST || GET\\n data: {getUpdate: id}, // post data || get data\\n success: function (data) {\\n console.log(data);\\n var obj = JSON.parse(data);\\n $('#id').val(obj.category_id);\\n $('#name').val(obj.category_name);\\n $('#des').val(obj.category_des);\\n $('#editCate').modal(\\\"show\\\");\\n },\\n error: function (result) {\\n showNotification('top', 'right', 'This Category can\\\\'t be edit', '2');\\n console.log(result);\\n\\n }\\n });\\n}\",\n \"function modalViewOnShown(dialogRef) {\\r\\n\\t\\t\\tvar rowData = dt.row('.selected').data(),\\r\\n\\t\\t\\t\\tmodalBody = dialogRef.getModalBody();\\r\\n\\t\\t\\t$.each(rowData, function (name, value) {\\r\\n\\t\\t\\t\\tmodalBody.find('td[data-cell=\\\"' + name + '\\\"]').text(value);\\r\\n\\t\\t\\t});\\r\\n\\t\\t}\",\n \"function modal(data) {\\n // Set modal title\\n $('.modal-title').html(data.title);\\n // Clear buttons except Cancel\\n $('.modal-footer button:not(\\\".btn-default\\\")').remove();\\n // Set input values\\n $('#title').val(data.event ? data.event.title : '');\\n $('#description').val(data.event ? data.event.description : '');\\n $('#color').val(data.event ? data.event.color : '#3a87ad');\\n // Create Butttons\\n $.each(data.buttons, function(index, button){\\n $('.modal-footer').prepend('<button type=\\\"button\\\" id=\\\"' + button.id + '\\\" class=\\\"btn ' + button.css + '\\\">' + button.label + '</button>')\\n })\\n //Show Modal\\n $('.modal').modal('show');\\n }\",\n \"function modal(data) {\\n // Set modal title\\n $('.modal-title').html(data.title);\\n // Clear buttons except Cancel\\n $('.modal-footer button:not(\\\".btn-default\\\")').remove();\\n // Set input values\\n $('#title').val(data.event ? data.event.title : ''); \\n $('#description').val(data.event ? data.event.description : '');\\n $('#color').val(data.event ? data.event.color : '#3a87ad');\\n // Create Butttons\\n $.each(data.buttons, function(index, button){\\n $('.modal-footer').prepend('<button type=\\\"button\\\" id=\\\"' + button.id + '\\\" class=\\\"btn ' + button.css + '\\\">' + button.label + '</button>')\\n })\\n //Show Modal\\n $('.modal').modal('show');\\n }\",\n \"function InsertDataIntoCourseUpdateModal(id){\\r\\n\\t$.ajax({\\r\\n\\t\\ttype: 'GET',\\r\\n\\t\\tcontentType: 'application/json; charset=utf-8',\\r\\n\\t\\turl: 'http://localhost:8000/Course/'+id+'/',\\r\\n\\t\\tdataType: 'json',\\r\\n\\t}).then(function(data){\\r\\n\\t\\tconsole.log(data);\\r\\n\\t\\t$('#uCourseId').val(data.id);\\r\\n\\t\\t$('#uCourseName').val(data.courseName);\\r\\n\\t\\t$('#uMajor').val(data.major);\\r\\n\\t});\\r\\n}\",\n \"function update_form_data(res) {\\n $(\\\"#promo_id\\\").val(res.id);\\n $(\\\"#promo_name\\\").val(res.name);\\n $(\\\"#promo_type\\\").val(res.promo_type);\\n $(\\\"#promo_value\\\").val(res.value);\\n $(\\\"#promo_start_date\\\").val(res.start_date);\\n $(\\\"#promo_end_date\\\").val(res.end_date);\\n $(\\\"#promo_detail\\\").val(res.detail);\\n }\",\n \"async function createConsumablesCWModal() {\\n const modal = await modalController.create({\\n component: \\\"consume-cw-modal\\\",\\n cssClass: \\\"consumeCWModal\\\",\\n });\\n\\n var settings = {\\n \\\"url\\\": `http://localhost:8080/api/caseworker/consumables/detail/${storedButtonID}`,\\n \\\"method\\\": \\\"GET\\\",\\n \\\"timeout\\\": 0,\\n };\\n \\n $.ajax(settings).done(function (response) {\\n var dataArray2 = JSON.parse(response);\\n console.log(dataArray2);\\n\\n var comments;\\n\\n if(dataArray2[0].cons_comment = \\\"undefined\\\"){\\n comments = \\\" - \\\";\\n }else{\\n comments = dataArray2[0].cons_comment;\\n }\\n\\n document.getElementById(\\\"cwConsName\\\").innerHTML = dataArray2[0].cons_name;\\n document.getElementById(\\\"cwConsID\\\").innerHTML = dataArray2[0].cons_id;\\n document.getElementById(\\\"cwConsLabel\\\").innerHTML = dataArray2[0].cons_label;\\n document.getElementById(\\\"cwConsStatus\\\").innerHTML = dataArray2[0].cons_status;\\n document.getElementById(\\\"cwConsComments\\\").innerHTML = comments;\\n \\n });\\n\\n await modal.present();\\n currentModal = modal;\\n}\",\n \"function showModal(title, body) {\\n updateModal(title, body)\\n $(modal).modal('show')\\n}\",\n \"function modalResult() {\\n\\tlet href = \\\"#modal-result\\\";\\n\\twindow.open(href, \\\"_self\\\");\\n}\",\n \"function openUpdatePromo(promoId) {\\n\\tjQuery.ajax({\\n\\t url: \\\"service.php\\\",\\n\\t type: \\\"GET\\\",\\n\\t data: {updatePromoId:promoId},\\n\\t success: function(json_data)\\n\\t\\t{\\n\\t\\t\\t//fills data\\n\\t\\t\\tvar data_array = $.parseJSON(json_data);\\n\\t\\t\\t\\n\\t\\t\\tconsole.log(data_array);\\n\\t\\t\\t\\n\\t\\t\\topenModal(data_array);\\t\\t\\t\\t\\n\\t\\t},\\n\\t\\terror: function (jqXHR, textStatus, errorThrown)\\n\\t\\t{\\n\\t\\t\\tconsole.log(errorThrown);//)\\n\\t\\t}\\n\\t});\\n}\",\n \"function showSerialManageModal(data)\\r\\n{\\r\\n //you can do anything with data, or pass more data to this function. i set this data to modal header for example\\r\\n\\t $('.serialManageDeleteByAdmin').attr('href','/serialManageDeleteByAdmin?id='+data);\\r\\n\\t$(\\\"#mySerialManageModal .serialManageDeleteByAdminId\\\").html(data)\\r\\n $(\\\"#mySerialManageModal\\\").modal();\\r\\n}\",\n \"async function createPayAdminModal() {\\n const modal = await modalController.create({\\n component: \\\"pay-admin-modal\\\",\\n cssClass: \\\"payAdminModal\\\",\\n });\\n\\n var settings = {\\n \\\"url\\\": `http://localhost:8080/api/admin/payment/${storedButtonID}`,\\n \\\"method\\\": \\\"GET\\\",\\n \\\"timeout\\\": 0,\\n };\\n \\n $.ajax(settings).done(function (response) {\\n var dataArray = JSON.parse(response);\\n console.log(dataArray);\\n\\n var paymentNotes;\\n\\n if(dataArray[0].paymentNote = \\\"undefined\\\"){\\n paymentNotes = \\\" - \\\";\\n }\\n else{\\n paymentNotes = dataArray[0].paymentNote;\\n }\\n\\n document.getElementById(\\\"paymentTenantID\\\").innerHTML = dataArray[0].tenant_id;\\n document.getElementById(\\\"paymentAmount\\\").innerHTML = \\\"$\\\" + dataArray[0].amount_owe;\\n document.getElementById(\\\"paymentDeduction\\\").innerHTML = \\\"$\\\" + dataArray[0].deposit_deduction;\\n document.getElementById(\\\"paymentCategory\\\").innerHTML = dataArray[0].payment_cat;\\n document.getElementById(\\\"paymentCharges\\\").innerHTML = \\\"$\\\" + dataArray[0].negligence_charge;\\n document.getElementById(\\\"paymentNotes\\\").innerHTML =paymentNotes;\\n });\\n\\n await modal.present();\\n currentModal = modal;\\n}\",\n \"function setSearchResults(response, endpoint, searchParam) {\\n searchContent.empty();\\n searchContentUl.empty();\\n if(response.count) {\\n searchContent.append(searchContentUl);\\n delete response.results[0].created;\\n delete response.results[0].edited;\\n delete response.results[0].url;\\n $.each(response.results[0], function(index,value) {\\n if(!Array.isArray(value)) {\\n searchContentUl.append($(\\\"<li>\\\" + index + \\\": \\\" + value + \\\"</li>\\\"));\\n }\\n });\\n } else {\\n //Creating modal and triggering on empty SWAPI response.results object.\\n let modal = $(\\\"<div id='modal-close-outside' uk-modal>\\\");\\n modal.empty();\\n let modalBody = $(\\\"<div class='uk-modal-dialog uk-modal-body'>\\\");\\n let modalBtn = $(\\\"<button class='uk-modal-close-outside' type='button' uk-close></button>\\\");\\n let modalTitle = $(\\\"<h2 class='uk-modal-title'>Force Disturbance</h2>\\\");\\n let modalGif = $(\\\"<img src='./assets/img/jedi-mind-trick.gif'/>\\\");\\n switch (endpoint) {\\n case \\\"planets\\\":\\n endpoint = \\\"planet\\\";\\n break;\\n case \\\"people\\\":\\n endpoint = \\\"person\\\";\\n break;\\n case \\\"starships\\\":\\n endpoint = \\\"starship\\\";\\n break;\\n case \\\"species\\\":\\n endpoint = \\\"species\\\";\\n break; \\n default:\\n endpoint = \\\"film\\\";\\n break;\\n }\\n let modalP = $(\\\"<p>This is not the \\\" + endpoint + \\\" you are looking for. \\\" + searchParam.charAt(0).toUpperCase() + searchParam.slice(1) + \\\" is not a \\\" + endpoint + \\\" in a galaxy far, far away.</p>\\\");\\n modal.append(modalBody);\\n modalBody.append(modalBtn,modalTitle,modalGif,modalP);\\n console.log(modal);\\n UIkit.modal(modal).show();\\n };\\n}\",\n \"async function updateModal(req, res) {\\n \\n console.log('UPD Modal Item')\\n\\n try {\\n const modal = await findByID(req.params.id, 'modal_items')\\n \\n if (!modal) {\\n res.status(404).json({message : `Modal Not Found ${req.params.id}`})\\n } else {\\n const data = await getPostData(req)\\n \\n const { name, addInfo, price } = JSON.parse(data)\\n\\n const modalData = {\\n name: name || modal.name,\\n addInfo: addInfo || modal.addInfo,\\n price: price || modal.price,\\n }\\n \\n const updatedModal = await update(req.params.id, modalData, 'modal_items')\\n\\n res.status(200).json(updatedModal)\\n }\\n } catch (error) {\\n console.log(error);\\n }\\n}\",\n \"function modal(data) {\\n // Set modal title\\n $('.modal-title').html(data.title);\\n // Clear buttons except Cancel\\n $('.modal-footer button:not(\\\".btn-default\\\")').remove();\\n // Set input values\\n $('#title').val(data.event ? data.event.title : '');\\n if( ! data.event) {\\n // When adding set timepicker to current time\\n var now = new Date();\\n var time = now.getHours() + ':' + (now.getMinutes() < 10 ? '0' + now.getMinutes() : now.getMinutes());\\n } else {\\n // When editing set timepicker to event's time\\n var time = data.event.date.split(' ')[1].slice(0, -3);\\n time = time.charAt(0) === '0' ? time.slice(1) : time;\\n }\\n $('#time').val(time);\\n $('#description').val(data.event ? data.event.description : '');\\n $(\\\"#id_sala option:selected\\\").val(data.event ? data.event.id_sala : '');\\n $('#color').val(data.event ? data.event.color : '#3a87ad');\\n // Create Butttons\\n $.each(data.buttons, function(index, button){\\n $('.modal-footer').prepend('<button type=\\\"button\\\" id=\\\"' + button.id + '\\\" class=\\\"btn ' + button.css + '\\\">' + button.label + '</button>')\\n });\\n //Show Modal\\n $('.modal').modal('show');\\n }\",\n \"function populateModal(response) {\\n let year;\\n let month;\\n let day;\\n let types = [];\\n\\n title.text(response.nom + ' ' + response.prenom)\\n\\n $('#nom').val(response.nom);\\n $('#prenom').val(response.prenom);\\n\\n arrayDate = response.birth_date.split('-');\\n year = arrayDate[0];\\n month = arrayDate[1];\\n day = arrayDate[2].substring(0, 2);\\n $('#birth_date').datepicker('setDate', day + '/' + month + '/' + year);\\n\\n response.types.forEach(type => {\\n types.push(type.id);\\n });\\n select.multipleSelect('setSelects', types);\\n \\n $('#weight').val(response.weight);\\n $('#adress').val(response.adress);\\n $('#phone').val(response.phone);\\n $('#boxer_id').val(response.id)\\n $('#parent_name').val(response.parent_name);\\n $('#parent_phone').val(response.parent_phone);\\n }\",\n \"function actualizarMostrar(id,cedula,nombre,apellido1,apellido2,telefono,correo,productoid){\\n$(\\\"#idActualizar\\\").val(id);\\n$(\\\"#cedulaM\\\").val(cedula);\\n$(\\\"#nombreM\\\").val(nombre);\\n$(\\\"#apellido1M\\\").val(apellido1);\\n$(\\\"#apellido2M\\\").val(apellido2);\\n$(\\\"#telefonoM\\\").val(telefono);\\n$(\\\"#correoM\\\").val(correo);\\n$(\\\"#productoM\\\").val(productoid);\\n\\n document.getElementById(\\\"modalModificar\\\").style.display = \\\"block\\\";\\n}\",\n \"function updateMelons(results) {\\n if (results.code === \\\"OK\\\") {\\n $('#order-status').html(\\\"<p>\\\" + results.msg + \\\"</p>\\\");\\n }\\n else {\\n $('#order-status').addCtygtglass(\\\"order-error\\\");\\n $('#order-status').html(\\\"<p><b>\\\" + results.msg + \\\"</b></p>\\\");\\n }\\n}\",\n \"function place(e){\\n\\t\\t\\t\\te.preventDefault();\\n\\t\\t\\t\\tdocument.getElementById('submitButton').style.opacity=0.3;\\n\\t\\t\\t\\tcheckoutID=document.getElementById('checkoutID').value;\\n\\t\\t\\t\\tid=sessionStorage.shopID;\\n\\t\\t\\t\\tverifyCheckoutID(id,checkoutID)\\n\\t\\t\\t\\t.then(function(){\\n\\t\\t\\t\\t\\tupdate(id,checkoutID)\\n\\t\\t\\t\\t\\t.then(function(){\\n\\t\\t\\t\\t\\t\\tconsole.log('updated');\\n\\t\\t\\t\\t\\t})\\n\\t\\t\\t\\t\\t.catch(function(){\\n\\n\\t\\t\\t\\t\\t})\\n\\t\\t\\t\\t\\tlocation.reload();\\n\\t\\t\\t\\t})\\n\\t\\t\\t\\t.catch(function(){\\n\\t\\t\\t\\t\\tdocument.getElementById('submitButton').setAttribute(\\\"data-toggle\\\",\\\"modal\\\");\\n\\t\\t\\t\\t\\t$(\\\"#myModal\\\").modal(\\\"show\\\");\\n\\t\\t\\t\\t});\\n\\t\\t\\t\\tdocument.getElementById('submitButton').style.opacity=1;\\n\\n\\t\\t\\t}\",\n \"function modal_souvenir(id)\\n {\\n document.getElementById('mg_title').innerHTML=\\\"Souvenir Information\\\";\\n console.log(server+'_data_souvenir_1.php?cari='+id);\\n $.ajax({url: server+'_data_souvenir_1.php?cari='+id, data: \\\"\\\", dataType: 'json', success: function(rows){ \\n for (var i in rows.data){ \\n var row = rows.data[i];\\n var id = row.id;\\n var name = row.name;\\n var owner = row.owner;\\n var cp = row.cp;\\n var address = row.address;\\n var employee = row.employee;\\n var type_souvenir = row.type_souvenir;\\n var lat=row.lat;\\n var lng = row.lng;\\n console.log(name);\\n document.getElementById('mg_body').innerHTML=\\\"<h2>\\\"+name+\\\"</h2><br><div style='margin-left:20px'>Address: \\\"+address+\\\"<br>Contact Person: \\\"+cp+\\\"<br>Owner: \\\"+owner+\\\"<br>Employee: \\\"+employee+\\\"<br>Type: \\\"+type_souvenir+\\\"</div>\\\";\\n }//end for\\n\\n $('#modal_gallery').modal('show');\\n }});//end ajax \\n }\",\n \"function getShowById(id) {\\n $(\\\"#title\\\").text(\\\"Show Detail\\\")\\n $.ajax({\\n url: '/Show/GetShowById/' + id,\\n type: 'GET',\\n datatype: 'json',\\n success: function (data) {\\n $(\\\"#Id\\\").val(data.Id);\\n $(\\\"#Name\\\").val(data.Name);\\n $(\\\"#Price\\\").val(data.Price);\\n isUpdate = true;\\n $(\\\"#showModal\\\").modal('show');\\n },\\n error: function (err) {\\n alert(\\\"Error\\\" + err.ResponseText);\\n }\\n });\\n}\",\n \"function showAnswerActions(answers) {\\n answers.forEach(function (answer) {\\n var id = 'actions_' + answer.answer_id;\\n var html = \\\"<button class='btn btn-primary' id='myBtn\\\" + answer.answer_id + \\\"' data-toggle='modal' data-target='#myModal\\\" + answer.answer_id + \\\"'>Edit</button>\\\";\\n document.getElementById(id).innerHTML = html;\\n });\\n var models = [];\\n answers.forEach(function (answer) {\\n var html = \\\"<div id='myModal\\\" + answer.answer_id + \\\"' class='modal'>\\\"\\n + \\\"<div class='modal-content'>\\\"\\n + \\\" <span class='close' data-dismiss='modal'>×</span>\\\"\\n + \\\"<textarea class='textarea' id='newAnswer\\\" + answer.answer_id + \\\"'>\\\" + answer.answer_body + \\\"</textarea><br>\\\"\\n + \\\"<button class='btn btn-primary' id='updateBtn' onclick='updateUserAnswer(\\\" + JSON.stringify(answer) + \\\");'>Update</button>\\\"\\n + \\\"</div>\\\"\\n + \\\"</div>\\\";\\n models.push(html);\\n });\\n document.getElementById('includes').innerHTML = models.join(\\\"\\\");\\n}\",\n \"function success() {\\n\\n Modal.success({\\n okText:\\\"Done\\\",\\n title: 'Submit successful!',\\n // content: 'View your requests to see your new entry.',\\n onOk() {\\n doneRedirect();\\n }\\n });\\n }\",\n \"function mostrarModalEditContacto(idContacto, idAgencia){\\n //alert(idContacto+\\\" \\\"+idAgencia);\\n $.ajax({\\n type: 'POST',\\n url: 'getContactos.php',\\n dataType: 'json',\\n data: {\\n idContacto: idContacto,\\n idAgencia: idAgencia,\\n flagContacto: 'getContacto'\\n }\\n })\\n .done(function(resultado){\\n if(resultado.error == false){\\n $('#modalEditContact').modal('show');\\n $('#editIdContacto').val(idContacto);\\n $('#editNombreContacto').val(resultado.nombreContacto);\\n $('#editPuestoContacto').val(resultado.puestoContacto);\\n $('#editSkypeContacto').val(resultado.skypeContacto);\\n $('#editTelefonoContacto').val(resultado.telefonoContacto);\\n }\\n })\\n \\n}\",\n \"function showData() {\\n GetUser().then((res) => {\\n for (const key in res) {\\n addModalBox(res[key]);\\n }\\n });\\n}\",\n \"function openFormEditKienNghi() {\\n showLoadingOverlay(modalIdKienNghi + \\\" .modal-content\\\");\\n $.ajax({\\n type: \\\"GET\\\",\\n url: editKienNghiUrl,\\n data: {\\n id: HoSoVuAnID\\n },\\n success: function (response) {\\n $(modalIdKienNghi + \\\" .modal-content\\\").html(response);\\n\\n hideLoadingOverlay(modalIdKienNghi + \\\" .modal-content\\\");\\n }\\n });\\n }\",\n \"function inicioEditar(idEmpresa){\\n $.post(\\\"/censocc/viewcontroller/getAllDataEncuesta.php\\\", {idEmpresa : idEmpresa}, function(allDataEditar){\\n var dataEdit = allDataEditar[0];\\n $.post(\\\"editarencuesta.php\\\",function(data){\\n //console.log(data);\\n var $miModal = $(\\\"#myModalFormEdit\\\");\\n $(\\\"#modalContentFormBody\\\").html(data);\\n vaciarDatos(allDataEditar,$miModal);\\n });\\n });\\n}\",\n \"async function ModalUpdate(index) {\\n const response = await api.get('analises');\\n let contar = 0;\\n const analisesBanco = response.data;\\n\\n analisesBanco.map(async analise => {\\n const ObjAnalise = {\\n id: analise.id,\\n nomeAnalise: analise.analise,\\n };\\n contar += 1;\\n setSelectAnalises(state => [...state, ObjAnalise]);\\n if (analise.id === relatorioCacp[index].analiseId) {\\n setIndex3(new IndexPath(contar));\\n }\\n // console.log(index3);\\n });\\n const item = {\\n tipo_item_id: 1,\\n };\\n const response2 = await api.get('piscinas', { params: item });\\n let contar1 = 0;\\n const piscinasBanco = response2.data;\\n\\n piscinasBanco.map(async piscina => {\\n const ObjPiscina = {\\n id: piscina.id,\\n nomePiscina: piscina.piscina,\\n };\\n contar1 += 1;\\n setSelectPiscinas(state => [...state, ObjPiscina]);\\n if (piscina.id === relatorioCacp[index].piscinaId) {\\n setIndex(new IndexPath(contar1));\\n }\\n });\\n\\n setVisible(true);\\n setRelatorioCacpId(relatorioCacp[index].id);\\n setCloro(relatorioCacp[index].cloro.toString());\\n setQualidadeAgua(relatorioCacp[index].qualidade_agua.toString());\\n setTemperatura(relatorioCacp[index].temperatura.toString());\\n setHidrogeron(relatorioCacp[index].hidrogeron.toString());\\n setTemperaturaAmbiente(\\n relatorioCacp[index].temperatura_ambiente.toString()\\n );\\n\\n setTemperaturaRio(relatorioCacp[index].temperatura_rio.toString());\\n setPh(relatorioCacp[index].ph.toString());\\n\\n setChecked(relatorioCacp[index].status_id === 1);\\n }\",\n \"function changeStatus() {\\n // Grab id and new status from button\\n // Attribute data-new-status holds \\\"true\\\" for save button and \\\"false\\\" for remove button\\n const mongoId = $(this).attr('data-id');\\n const newStatus = $(this).attr('data-new-status');\\n // AJAX call to update article by ID\\n $.ajax({\\n method: 'PUT',\\n url: `/articles/${mongoId}`,\\n data: {\\n saved: newStatus\\n }\\n })\\n .then(function(data) {\\n // If save was successfull, notify user\\n if (data.saved === true) {\\n // modal here\\n console.log('saved');\\n } else {\\n // error message here\\n console.log('something went wrong.');\\n }\\n // reload page\\n location.reload();\\n });\\n }\",\n \"function setNShowStatus(data) {\\r\\n $('.likesmodel').html(data);\\r\\n $('.likesmodel').modal('show')\\r\\n }\",\n \"function modificarAuditoria()\\n{\\n var id = $(\\\"#idAuditoria\\\").val()\\n console.log(\\\"id\\\",id_auditoria)\\n sel_normas = \\\"\\\";\\n $(\\\"#sel_normas option:selected\\\").each(function() {\\n sel_normas = $(\\\"#sel_normas\\\").val();\\n });\\n\\n // VALIDAMOS EL FORMUALARIO\\n var res = validarAuditoria()\\n //console.log(\\\"res\\\",res)\\n\\n if(result)\\n {\\n // ABRIMOS MODAL CONFIRMAR CAMBIOS EN AUDITORIA\\n $('#modalConfirmarCambiosAuditoria').modal('show')\\n // CERRAMOS MODAL MODIFICAR AUDITORIA\\n $('#modificarAuditoriaModal').modal('hide');\\n }\\n else{ swal(\\\"Error\\\",\\\"Ingrese todos los datos\\\",\\\"error\\\") }\\n\\n}//*/\",\n \"function showRulesModal(data)\\r\\n{\\r\\n //you can do anything with data, or pass more data to this function. i set this data to modal header for example\\r\\n\\t $('.rulesDeleteByAdmin').attr('href','/rulesDeleteByAdmin?id='+data);\\r\\n\\t$(\\\"#myRulesModal .rulesDeleteByAdminId\\\").html(data)\\r\\n $(\\\"#myRulesModal\\\").modal();\\r\\n}\",\n \"function updateStaff(id){\\r\\n id = $('#modal_id').val();\\r\\n name = $('#modal_name').val();\\r\\n gender = $('#modal_gender').val();\\r\\n uni = $('#modal_uni').val();\\r\\n room = $('#modal_room').val();\\r\\n $.post(\\\"update.act\\\",{\\r\\n id:id,\\r\\n name:name,\\r\\n gender:gender,\\r\\n uni:uni,\\r\\n room:room,\\r\\n },function(data){\\r\\n clearChild();\\r\\n getList();\\r\\n swal({ type: \\\"success\\\", title: \\\"Update Successfully!\\\", timer: 1000, showConfirmButton: false });\\r\\n });\\r\\n}\"\n]","isConversational":false},"negative_scores":{"kind":"list like","value":["0.70432013","0.67155415","0.6565725","0.6510939","0.64728963","0.6413299","0.63912356","0.6362877","0.63580984","0.6355751","0.6333586","0.6310187","0.6285229","0.62677604","0.6260749","0.62368536","0.62367016","0.6213442","0.61973274","0.6185287","0.61645913","0.6160022","0.61457914","0.61433524","0.6137182","0.61290705","0.6127737","0.6116959","0.6111435","0.61026794","0.6093947","0.60898036","0.60808086","0.60502595","0.60485494","0.60464066","0.60417473","0.60378814","0.6012714","0.6007784","0.6002946","0.59901685","0.5987796","0.59773463","0.59663653","0.59659696","0.59638965","0.59623396","0.59606534","0.59595656","0.5958163","0.5953495","0.59496903","0.59402364","0.5938254","0.59374577","0.5930026","0.5927235","0.5914126","0.59108084","0.590761","0.59059453","0.5891434","0.5886481","0.5881078","0.5875473","0.58741385","0.5873608","0.58656085","0.58611286","0.58606166","0.58578557","0.5857141","0.58475906","0.58409435","0.5839602","0.5835967","0.5834035","0.583171","0.5829915","0.58296585","0.58264583","0.58232486","0.581376","0.5809675","0.5809487","0.58045846","0.5802001","0.5795484","0.5785773","0.57853377","0.57751775","0.57728636","0.5772538","0.577135","0.5768161","0.57674265","0.57667714","0.57640725","0.576386"],"string":"[\n \"0.70432013\",\n \"0.67155415\",\n \"0.6565725\",\n \"0.6510939\",\n \"0.64728963\",\n \"0.6413299\",\n \"0.63912356\",\n \"0.6362877\",\n \"0.63580984\",\n \"0.6355751\",\n \"0.6333586\",\n \"0.6310187\",\n \"0.6285229\",\n \"0.62677604\",\n \"0.6260749\",\n \"0.62368536\",\n \"0.62367016\",\n \"0.6213442\",\n \"0.61973274\",\n \"0.6185287\",\n \"0.61645913\",\n \"0.6160022\",\n \"0.61457914\",\n \"0.61433524\",\n \"0.6137182\",\n \"0.61290705\",\n \"0.6127737\",\n \"0.6116959\",\n \"0.6111435\",\n \"0.61026794\",\n \"0.6093947\",\n \"0.60898036\",\n \"0.60808086\",\n \"0.60502595\",\n \"0.60485494\",\n \"0.60464066\",\n \"0.60417473\",\n \"0.60378814\",\n \"0.6012714\",\n \"0.6007784\",\n \"0.6002946\",\n \"0.59901685\",\n \"0.5987796\",\n \"0.59773463\",\n \"0.59663653\",\n \"0.59659696\",\n \"0.59638965\",\n \"0.59623396\",\n \"0.59606534\",\n \"0.59595656\",\n \"0.5958163\",\n \"0.5953495\",\n \"0.59496903\",\n \"0.59402364\",\n \"0.5938254\",\n \"0.59374577\",\n \"0.5930026\",\n \"0.5927235\",\n \"0.5914126\",\n \"0.59108084\",\n \"0.590761\",\n \"0.59059453\",\n \"0.5891434\",\n \"0.5886481\",\n \"0.5881078\",\n \"0.5875473\",\n \"0.58741385\",\n \"0.5873608\",\n \"0.58656085\",\n \"0.58611286\",\n \"0.58606166\",\n \"0.58578557\",\n \"0.5857141\",\n \"0.58475906\",\n \"0.58409435\",\n \"0.5839602\",\n \"0.5835967\",\n \"0.5834035\",\n \"0.583171\",\n \"0.5829915\",\n \"0.58296585\",\n \"0.58264583\",\n \"0.58232486\",\n \"0.581376\",\n \"0.5809675\",\n \"0.5809487\",\n \"0.58045846\",\n \"0.5802001\",\n \"0.5795484\",\n \"0.5785773\",\n \"0.57853377\",\n \"0.57751775\",\n \"0.57728636\",\n \"0.5772538\",\n \"0.577135\",\n \"0.5768161\",\n \"0.57674265\",\n \"0.57667714\",\n \"0.57640725\",\n \"0.576386\"\n]","isConversational":false},"document_score":{"kind":"string","value":"0.65053934"},"document_rank":{"kind":"string","value":"4"}}},{"rowIdx":4590,"cells":{"query":{"kind":"string","value":"function to reset game"},"document":{"kind":"string","value":"function restartGame() {\n\tallOpenedCards.length = 0;\n\tresetTimer();\n\tresetMoveCount();\n\tresetStar();\n\tresetCards();\n\ttoggleModal();\n\tinit();\n}"},"metadata":{"kind":"string","value":"{\n \"objective\": {\n \"self\": [],\n \"paired\": [],\n \"triplet\": [\n [\n \"query\",\n \"document\",\n \"negatives\"\n ]\n ]\n }\n}"},"negatives":{"kind":"list like","value":["function resetGame() {\n resetClockAndTime();\n resetMoves(); \n resetRatings();\n startGame();\n}","function resetGame() {\n resetClockAndTime();\n resetMoves();\n resetStars();\n initGame();\n activateCards();\n startGame();\n}","function reset() {\n //Reset the game\n channelResetGame();\n }","function resetGame() {\n clearGameCards();\n resetMoves();\n resetTimer();\n}","function resetGame() {\n resetTimer();\n resetMoves();\n resetStars();\n shuffleDeck();\n resetCards();\n}","function reset() {\n timesPlayed = -1;\n right = 0;\n wrong = 0;\n startGame ();\n }","function reset() {\n time = 120;\n gameRun = false;\n }","function resetGame() {\n counter = 0;\n }","function resetGame() {\n gBoard = buildBoard();\n gGame.shownCount = 0;\n gGame.isOn = false;\n gLivesCount = 3;\n}","function resetGame(){\n game_mode='';\n player_sequence=[];\n game_sequence=[];\n player_clicks = 0;\n createGame();\n}","function resetGame() {\n matched = 0;\n resetTimer();\n resetMoves();\n resetStars();\n resetCards();\n shuffleDeck();\n}","function resetGame() {\n stopGoodTones();\n stopErrTone();\n clearScore();\n game.genSeq = [];\n game.playerSeq = [];\n game.err = false;\n }","function resetGame() {\n\tresetClockAndTime();\n\tresetMoves();\n\tresetStars();\n\tshuffleDeck();\n\tresetCards();\n\tmatched = 0;\n\ttoggledCards = [];\n}","function resetCurrentGame() {\n clearGameCards();\n resetMoves();\n resetTimer();\n startGame();\n resetGameSound();\n}","function reset(){\n\n theme.play();\n\n gameState = PLAY;\n gameOver.visible = false;\n restart.visible = false;\n \n monsterGroup.destroyEach();\n \n Mario.changeAnimation(\"running\",MarioRunning);\n\n score=0;\n\n monsterGroup.destroyEach();\n\n \n}","function resetGame() {\n cardShuffle();\n resetBoard();\n cardsInPlay = [];\n cardInPlayId = -1;\n}","function reset() {\n\t\t/**\n\t\t * TODO: create initial game start page and additional\n\t\t * \tinteractivity when game resets once understand more about\n\t\t * animation\n\t\t */\n\t}","function resetGame() {\n counter = 0;\n correctCounter = 0;\n incorrectCounter = 0;\n unansweredCounter = 0;\n timer = 30;\n startGame();\n timerHolder();\n }","function reset(){\r\n gameState = PLAY;\r\n gameOver.visible = false;\r\n // restart.visible = false;\r\n enemiesGroup.destroyEach();\r\n blockGroup.destroyEach();\r\n stars1Group.destroyEach();\r\n stars2Group.destroyEach();\r\n candyGirl.addAnimation(\"running\", candygirl_running);\r\n score = 0;\r\n}","function gameReset(){\n\t\t\tshowAction(\"RESET!\");\n\t\t\tif(timer) gameEnd();\n\t\t\t$(\".info .timer .sec\").text(0);\n\t\t\t$(\".info .timer .sectext\").hide();\n\t\t\ttime = null;\n\t\t\tcardsleft = settings.cardcnt;\n\t\t\t$(\"#wrap-gameboard li.flip\").removeClass(\"found selected flip\");\n\t\t\t$(\"#wrap-gameboard li.hover\").removeClass(\"hover\");\n\t\t}","function resetGame() {\n stopPongGame();\n\n // reset positions\n\n // reset scores\n\n // start game again\n}","function resetGame () { \n\t\t\t\t\t\t\tblueNum = 0;\n\t\t\t\t\t\t greenNum = 0;\n\t\t\t\t\t\t\tredNum = 0;\n\t\t\t\t\t\t\tyellowNum = 0;\n\t\t\t\t\t\t scoreResult=0;\n\t\t\t\t\t\t\ttargetScore = 0;\n\t\t\t\t\t\t\tgetNumber(); // Restart the game and assigns new traget number\n\t\t\t\t\t\t\tscoreBoard(); // Update the score board with new values.\n\t\t}","function resetGame() {\n \n // reset varaibles\n wrong = 0;\n correct = 0;\n index = -1;\n \n // Update HTML\n clearContent();\n\n // Restart game\n loadQuestion();\n }","function gameReset() {\n totalScore = 0;\n setupGame();\n }","function resetGame() {\n account.score = 0;\n account.lines = 0;\n account.level = 0;\n board.reset();\n time = { start: 0, elapsed: 0, level: LEVEL[account.level] };\n}","function resetGame () {\n resetBricks ();\n store.commit ('setScore', 0);\n store.commit ('setLives', 3);\n resetBoard ();\n draw ();\n}","function resetGame() {\n userScore = 0;\n computerScore = 0;\n gameSwitch(winningScore);\n}","function resetGame() {\n window.cancelAnimationFrame(anim_id);\n playing = false;\n score = 0;\n level = 1;\n new_game = true;\n speed = init_speed\n direction = ''\n snake.reset(init_speed);\n fruit.reset();\n }","resetGame() {\n\t\t//stop game\n\t\tthis.running = false\n\t\tclearInterval(this.loop);\n\n\t\t//set original values\n\t\tthis.aliens = [1, 3, 5, 7, 9, 23, 25, 27, 29, 31];\n\t\tthis.direction = 1;\n\t\tthis.ship = [104, 114, 115, 116];\n\t\tthis.missiles = [];\n\t\tthis.level = 1;\n\t\tthis.currentLevel = 1;\n\t\tthis.speed = 512;\n\t\tthis.score = 0;\n\n\t\tconsole.log(\"Game reset.\");\n\t}","function resetGame() {\n generateTarget();\n generateNumbers();\n distributeNumbers();\n}","function gameReset() {\n\t//maybe add gameOverStatus\n\t//initial gameStatus\n\tcounter = 100;\n\tgameOverStatus = false;\n\twindow.location.hash = \"#game-board\";\n\tmessageBoard.innerText = \"Game Start!\\n\" + \"Current Score: \" + counter + \" points\";\n\tshuffleCards();\n}","function reset() {\n generateLevel(0);\n Resources.setGameOver(false);\n paused = false;\n score = 0;\n lives = 3;\n level = 1;\n changeRows = false;\n pressedKeys = {\n left: false,\n right: false,\n up: false,\n down: false\n };\n }","function reset() {\n x = 20;\n y = 35;\n level = 1;\n lost = false;\n won =false;\n game = false;\n loseColor =0;\n winColor=1;\n}","function restart(){\n myGameArea.reset();\n}","function resetGame() {\n timer.stop();\n startGame();\n}","function NewGameReset(){\n\t\tconsole.log(\"Game Reset\");\n\n\t\t\n\t\t//Clear Score value and color\n\t\tUtil.one(\"#score\").innerHTML = 0;\n\t\tUtil.one(\"#points\").setAttribute(\"class\", \"grey_background\");\n\t\tUtil.one(\"#score\").setAttribute(\"class\", \"grey_background\");\n\t\tUtil.one(\"#point_text\").setAttribute(\"class\", \"grey_background\");\n\t\t\n\t\t\n\t\t//Reset all event flags\n\t\tcrushing_in_progress = false;\n\t\tshowing_hint = true;\n\t\tlastmove = new Date().getTime();\n\t\t\n\t\t\n}","function resetGame() {\n newSquares = Array(9).fill(null);\n setSquares(newSquares);\n setXTurn(true);\n }","function resetGame() {\n\t// Repopulate card deck\n\tcardDeck = masterDeck.map(function(card) { return card }); \n\t// Empty all containers of their elements\n\t$('#game-board').html('')\n\t$('#p1-hand').html(''); \n\t$('#p2-hand').html('');\n\t$('#p1-points').html('');\n\t$('#p2-points').html('');\n\t$('#turn-count').html('');\n\t// Reset board array\n\tgameBoard = [0, 1, 2, 3, 4, 5, 6, 7, 8]; \n\t// Reset turn count\n\tturnCount = 0;\n\t// Reset points\n\tplayer1.points = 5; \n\tplayer2.points = 5;\n}","function resetGame() {\n gameStart();\n stopTimer();\n resetStars();\n resetCards();\n moves = 0;\n movesText.innerHTML = '0';\n second = 0;\n minute = 0;\n hour = 0;\n clock.innerHTML = '0:00';\n}","function resetGame() {\n // Position of prey and player will reset\n setupPrey();\n setupPlayer();\n // movement and speed of prey will reset\n movePrey();\n // sound will replay\n nightSound.play();\n // Size and color of player will reset\n playerRadius = 20;\n firegreen = 0;\n // score will reset\n preyEaten = 0;\n // prey speed will reset\n preyMaxSpeed = 4\n // All of this when game is over\n gameOver = false;\n}","function resetGame() {\n\n gameOver = false;\n state = `menu`;\n\n scoreMoney = 0;\n score = 0;\n\n setup();\n\n // clearInterval of mouse \n if (minigame1) {\n clearInterval(mousePosInterval);\n }\n // Resets the fishies\n if (minigame2) {\n for (let i = 0; i < NUM_FISHIES; i++) {\n let fish = fishies[i];\n fish.reset();\n }\n }\n}","function resetGame() {\n game.correctAnswers = 0;\n game.incorrectAnswers = 0;\n game.unanswered = 0;\n game.time = 0;\n game.questionIndex = 0;\n clearInterval(game.intervalId);\n clearTimeout(game.timeoutID);\n}","function resetGame() {\n localStorage.setItem('Game.State', null);\n document.querySelector('.moves').textContent = \"0\";\n \n if (cardDeck) {\n cardDeck.clear();\n }\n \n cardDeck = new CarDeck();\n cardDeck.shuffle();\n bindClickEvent();\n \n cardDeck.cards.forEach(card => {\n card.closeCard()\n card.unmatch()\n });\n \n state = {\n matchingCard: null,\n isMatching: false,\n totalMoves: 0,\n elapsedSeconds: 0,\n isGameOver: false\n }\n \n updateScreenMode(true)\n }","function resetGame(){\n setWinner(undefined)\n setPlayerBoard(()=> GameBoard('player'))\n setAiBoard(()=> GameBoard('ai'))\n setAI(() => Player('ai'))\n setIsPlayerTurn(true)\n setUpGame()\n }","function resetGame() {\r\n shuffle(deck);\r\n gameStart();\r\n dealerarea.innerHTML = \"\";\r\n playerarea.innerHTML = \"\";\r\n winnerarea.innerHTML = \"\";\r\n playerHand.firsttotal = 0;\r\n dealerHand.firsttotal = 0;\r\n playerHand.secondtotal = 0;\r\n dealerHand.secondtotal = 0;\r\n }","function resetGame() {\n if (dinoStegosaurus.foodEaten + dinoTriceratops.foodEaten >= 20) {\n tornado.reset();\n }\n if (dinoStegosaurus.foodEaten + dinoTriceratops.foodEaten >= 30) {\n fire.reset();\n }\n if (dinoStegosaurus.foodEaten + dinoTriceratops.foodEaten >= 40) {\n meteor.reset();\n }\n foodLeaves.reset();\n foodBerries.reset();\n foodPlant.reset();\n dinoStegosaurus.reset();\n dinoTriceratops.reset();\n gameOverScreen = false;\n titleScreen = true;\n instructionsScreen = false;\n gameWon = false;\n}","function resetGame() {\n\n\t// show it (when page loads the bugs are hidden)\n\t$(\".bug-bg\").css({\n\t\t\"display\": \"block\"\n\t});\n\n\t// reset state vars\n\tcurrentHighestIndex = 0;\n\tnumberErrors = 0;\n\n\tplaySound('#resetSound');\n\n\t// reset visuals\n\t$(\"#currentHighestIndex\").html(currentHighestIndex);\n\t$(\"#numberErrors\").html(numberErrors);\n\t// remove all boxes\n\t$(\".hidden-btn\").removeClass(\"correct\").removeClass(\"incorrect\");\n}","function reset(){\n score=0;\n gameTime=0;\n updateScore();\n}","function gameReset() {\n\t\tquestionCounter = 0;\n\t\tcorrectGuesses = 0;\n\t\tincorrectGuesses = 0;\n\t}","function gameReset() {\n\t\tquestionCounter = 0;\n\t\tcorrectGuesses = 0;\n\t\tincorrectGuesses = 0;\n\t}","function gameReset() {\n\t\tquestionCounter = 0;\n\t\tcorrectGuesses = 0;\n\t\tincorrectGuesses = 0;\n\t}","function gameReset() {\n\t\tquestionCounter = 0;\n\t\tcorrectGuesses = 0;\n\t\tincorrectGuesses = 0;\n\t}","function resetGame() {\n location.reload();\n }","function resetGame () {\n clearBoard();\n window.location.reload();\n}","function resetGameState() {\n\t\tgameOngoing = true;\n\t\tcurrentPlayer = player1;\n\t}","function reset() {\n resetGame(gameId);\n updateCharList([]);\n updateChar(\"\");\n }","function reset() {\n clear();\n initialize(gameData);\n }","function resetGame() {\n clearGame();\n levelSpace.innerHTML = \"Press Start/Stop to Begin\";\n}","function resetGame() {\n\tquestionCounter = 0;\n\tcorrectTally = 0;\n\tincorrectTally = 0;\n\tunansweredTally = 0;\n\tcounter = 30;\n\tgenerateHTML();\n\ttimerWrapper();\n}","function gameReset() {\n hideWinPanel();\n timerStop();\n timeInSeconds = 0;\n hours = 0;\n minutes = 0;\n updateTimerDisplay(0);\n movesCounter = 0;\n movesCounterDisplay(movesCounter);\n cardsMatched = 0;\n shuffle(cards);\n setupCardDeckDisplay(deckElement, cards);\n resetStarsDisplay();\n cardElements = deckElement.getElementsByClassName('card');\n cardDeckFlashDisplay(cardElements);\n timerStart();\n}","function reset() {\n\t$snake.off(\"keydown\");\n\tdeleteSnake();\n\t\n\tmakeSnake();\n\tupdateScores();\n\tassignKeys();\n\tplayGame();\n}","function resetGame(){\n console.log(gamePaused);\n gamePaused=false;\n console.log(gamePaused);\n if(!gamePaused && !stopGame){\n removeModal(); \n playGame();\n } else{\n removeModal();\n addCirclesToHoverBar();\n //clearing all dots of game board\n clearGameBoard();\n clearMessageBoard(); \n changeMessageBoardBG(\"none\"); \n stopGame=false;\n count=30;\n startGame();\n } \n}","function resetGame() {\n // reset the global variables\n cardsCollected = [];\n DeckOfCards = [];\n cardOneElement = null;\n cardTwoElement = null;\n startTime = null;\n currentTurn = 0;\n gameWon = false;\n seconds = 0;\n moves = 0;\n stars = 3;\n}","function resetGame() {\r\n\t\r\n\t\tfor(var i=0; i<board.length; i++) {\r\n\t\t\tboard[i].innerHTML = \" \";\r\n\t\t\tboard[i].style.color = 'navy';\r\n\t\t\tboard[i].style.backgroundColor = 'transparent';\r\n\t\t}\r\n\t\tgameOver = false;\r\n\t\tempty = 9;\r\n\t\tsetMessage(player + \" gets to start.\");\r\n\t\tsetMessage2(\"Go!\");\r\n\t\tconsole.log(\"visited resetGame\");\r\n\t}","function resetGame() {\n moves = 0;\n match_found = 0;\n $('#deck').empty();\n $('#stars').empty();\n $('#game-deck')[0].style.display = \"\";\n $('#sucess-result')[0].style.display = \"none\";\n game_started = false;\n timer.stop();\n $('#timer').html(\"00:00:00\");\n playGame();\n}","function resetGame() {\n game.player1.gameScore = 0;\n game.player2.gameScore = 0;\n gameScoreIndex++;\n pointScoreIndex = 0; //for after looking at matchStats\n // gameScoreIndex = 0;\n // game.gameScoreCollection.push(pushArr);\n if (game.startSer === 'player1') {\n swal(game.player2.name + \" serves first\");\n game.startSer = 'player2';\n game.player1.curSer = false;\n game.player2.curSer = true;\n }else if (game.startSer === 'player2'){\n swal(game.player1.name + \" serves first\");\n game.startSer = 'player1';\n game.player1.curSer = true;\n game.player2.curSer = false;\n }\n }","function resetGame() {\n\t$(\"#gameOver\").fadeOut();\n\ttotal = 0;\n\tupdateTotal(0);\n\ttotalEmptyCells = 16;\n\tgrid = getGrid();\n\tgridSpans = getSpanGrid();\n\t$(gridSpans).each(function(i,r) { $(r).each(function(i,c) { $(c).parent().css(\"background-color\", \"#D1E3EB\"); $(c).text(\"\"); }); });\n\tsetRandCell(get2or4());\n\tsetRandCell(get2or4());\n}","function resetGame(){\n startingLevel = 1;\n startingScore = 0;\n startingLives = 5;\n\n changeScore(startingLevel, startingScore);\n changeLevel(startingLevel);\n}","function reset() {\n // make a new game object\n myGame = new Game('X');\n // update the view\n updateView();\n document.getElementById(\"status\").innerHTML = \"Start Game!\";\n document.getElementById(\"reset-btn\").innerHTML = \"Reset Game\";\n}","function reset() {\n status.gameArr = [];\n status.level = 0;\n topLeft.off();\n topRight.off();\n bottomLeft.off();\n bottomRight.off();\n status.running = false;\n level.html(\"0\").css(\"color\", 'red');\n start.html('<i class=\"fa fa-play\"></i>').css('color', 'red');\n}","function resetGame() {\n\tcards = [];\n\tcardsDisplayed = 0;\n\tclearTimeout(timer);\n\ttoggleNumbers();\n\t$('#timer').html('30');\n\t$('.card').each(function() {\n\t\t$(this).html(' ');\n\t\t\n\t}); // end each\n\t$('#total').html(' ');\n\t$('#answer').text('');\n\t$('.card').each(function() {\n\t\tif ($(this).hasClass('disabled')) {\n\t\t\t$(this).removeClass('disabled');\n\t\t}\n\t\tif ($(this).hasClass('pause')) {\n\t\t\t$(this).removeClass('pause');\n\t\t}\n\t}); // end each\n\t$('#variables').html('');\n\tuserVariables = [];\n\t$('#notice').fadeOut();\n\t\n}","function resetme(){\n\tinitiateBoard();\n\tmode=0;\n\tdisplay(0);\n}","function resetGame() {\n randomizer();\n attempt = 0;\n $(\".showTarget\").text(target);\n $(\".showAttempt\").text(attempt);\n $(\".showWins\").text(wins);\n $(\".showLosses\").text(losses);\n }","function resetGame() {\n // reset game by going through buttons\n for (var i=0; i < buttons.length; i++) {\n buttons[i].style.backgroundColor = ''; // change color back to original\n buttons[i].innerHTML = ''; // delete x's and o's\n }\n gameover = false;\n }","function resetGame() {\n // Clear the main boxes and the minimap boxes\n for(var rIndex = 0; rIndex < NUM_ROWS; rIndex++) {\n for(var cIndex = 0; cIndex < NUM_COLS; cIndex++) {\n // Clear main boxes\n boxes[rIndex][cIndex].classList.remove(xClass, oClass);\n boxes[rIndex][cIndex].textContent = \"\";\n // Clear minimap boxes\n miniboxes[rIndex][cIndex].classList.remove(xClass, oClass);\n miniboxes[rIndex][cIndex].textContent = \"\";\n }\n }\n\n // Hide end game text\n $(victoryText).hide();\n\n // Reset number of filled boxes\n boxCount = 0;\n\n // Start the game again\n gameOver = false;\n }","resetGame() {\n // clear game seeds\n this.gameSeed = '';\n this.currentString = '';\n\n if (this.gameStarted) {\n this.toggleGameStarted();\n this.flashCount();\n document.getElementById('simon-points').innerHTML = '--';\n // delayed set to default in-case point flashing causes issues\n setTimeout(() => { document.getElementById('simon-points').innerHTML = '--'; }, 525);\n this.flashTimer = setInterval(() => { this.flashCount(); }, 1000);\n }\n }","function resetGame(){\t\t\n\thasStarted=false;\n\tinput=-1;\n\tsequence=[];\n\tlevel=0;\n\tdisplay(\"--\");\n\tsetTimeout(function(){\n\t\t\t$(\"#board div\").removeClass(\"clickable\");\n\t\t},500);\t\n}","function resetGame() {\n\tusedQuestions = [];\n\ttime = 20;\n\tscore = 0;\n\twrongAnswers = 0;\n\tnoAnswer = 0;\n\t$(\"#results\").empty();\n\tsetGame();\n}","function actionOnResetClick () {\n gameRestart();\n }","function gameReset() {\n questionCounter = 0;\n correctGuesses = 0;\n incorrectGuesses = 0;\n }","function gameReset() {\n questionCounter = 0;\n correctGuesses = 0;\n incorrectGuesses = 0;\n }","function resetGame() {\n history = [];\n guessesCount = -1;\n level = 0;\n $('.level').text(level);\n }","function gameReset() {\n questionCounter = 0;\n correctGuesses = 0;\n incorrectGuesses = 0;\n }","function resetGame() {\n deck.innerHTML = '';\n openCards = [];\n matchedCards = [];\n moves = 0;\n clickCounter = 0;\n clearInterval(timer);\n seconds = 0;\n minutes = 0;\n timer = 0;\n time.textContent = '00:00';\n generateStar(starsLost);\n starsLost = 0;\n initGame();\n}","function gameReset() {\r\n\tgameState.score = 0;\r\n\t$(\"#score\").html(\"Points: <br>\"+gameState.score);\r\n\t$(\"#wins\").html(\"Wins: \"+gameState.wins);\r\n\t$(\"#losses\").html(\"Losses: \"+gameState.losses);\r\n\tgameState.match = getRandom(19,120);\r\n\t$(\"#randomNum\").html(\"Match: <br>\"+gameState.match);\r\n\tgameInit()\r\n}","resetGame() {\n this.initGrid();\n this.setDefaultSeeds();\n this.iteration = 0;\n }","function resetGame() {\n location.reload()\n}","resetGame() {\n this.winner = null;\n this.grid.resetGrid();\n }","function resetGame(){\n if (!win || win){\n clearWinOrLoseScreen()\n }\n BGM.currentTime = 0\n BGM.play()\n // BGM.volume = 0.2\n win = null\n cells[enemyA.position].classList.remove('enemy1')\n cells[enemyB.position].classList.remove('enemy2')\n cells[enemyC.position].classList.remove('enemy3')\n cells[enemyD.position].classList.remove('enemy4')\n clearInterval(gametimer)\n clearInterval(berryTimer)\n gameOver = false\n playerScore = 0\n scoreboard.innerHTML = playerScore\n createMaze()\n startTimer()\n startBerryTimer()\n cookiesRemaining = 212\n playerPosition = 487\n cells[playerPosition].classList.add('sprite')\n enemyA.position = 337\n cells[enemyA.position].classList.add('enemy1')\n enemyB.position = 335\n cells[enemyB.position].classList.add('enemy2')\n enemyC.position = 339\n cells[enemyC.position].classList.add('enemy3')\n enemyD.position = 338\n cells[enemyD.position].classList.add('enemy4')\n\n }","function resetGameState() {\r\n\r\n // Reset difficulty and enemy speed.\r\n increaseDifficulty.difficulty = \"start\";\r\n Enemy.v = 4;\r\n toggleEnemySpawner.spawnRate = 2000;\r\n\r\n // Clear the list of game objects.\r\n observers = [];\r\n\r\n // Reset player.\r\n player = new Player();\r\n\r\n // Reset game state data.\r\n time = 90;\r\n document.getElementById(\"time-numeric\").innerHTML = time;\r\n Player.score = 100;\r\n document.getElementById(\"score-numeric\").innerHTML = Player.score;\r\n timeAt100 = 0;\r\n}","function gameReset () {\n questionCounter = 0;\n correctGuesses = 0;\n incorrectGuesses = 0;\n }","resetGame() {\n\t\tthis.App.setGetters.setGameProperty('timer', this.App.game.settings.gameLength);\n\t\tthis.App.setGetters.setPlayersProperty('correct', false);\t\t\n\t\tthis.App.setGetters.setGameStoreProperty('paths', {});\n\t\tthis.App.setGetters.setGameStoreProperty('chatLog', {});\n\t\tthis.App.clientComms.emitToAllSockets('reset');\n\t\tthis.App.clientComms.emitToAllSockets('puzzle', []);\n\t}","function resetGame() {\n toggleMenu(Menu.MAIN);\n $('#statsOutput').hide();\n $('#ammoBarsContainer').hide();\n scene.stopMusic();\n renderer.clear(false, true, true);\n scene = new TheScene(renderer.domElement);\n}","function resetGame() {\n for (let i = 0; i < kids.length; i++) {\n kids[i].reset();\n player.reset();\n isGameOver = false;\n }\n}","function resetGame(){\n\t\n\tlocation.reload(); \n\t\n}","function resetGame() {\n\t\ttokbox.forceUnpublish();\n\t\tfor(x = 1; x < 21; x++) {\n\t\t\t$(\"#score_\"+x).css(\"background-color\", \"transparent\");\n\t\t\tif(x < 5) {\n\t\t\t\t$(\"#solution_\"+ (x - 1) + \"_right\").html(\"\");\n\t\t\t\t$(\"#solution_\" + (x - 1) + \"_container\").css(\"background-color\", \"#BFBB11\").css(\"border-color\", \"#730046\").css(\"color\", \"black\");\n\t\t\t}\n\t\t\t$(\"#help_container_computer_normal\").fadeIn('slow');\n\t\t\t$(\"#help_container_audience_normal\").fadeIn('slow');\n\t\t\t$(\"#help_container_phone_normal\").fadeIn('slow');\n\t\t\tif(user_type == 'host') {\n\t\t\t\t$(\"#correct_answer\").html(\"\");\n\t\t\t}\n\t\t\tif(user_type == 'user') {\n\t\t\t\t$(\".question_holder\").unbind('click');\n\t\t\t\t$(\"#help_container_phone_normal\").unbind('click');\n\t\t\t\t$(\"#help_container_audience_normal\").unbind('click');\n\t\t\t\t$(\"#help_container_computer_normal\").unbind('click');\n\t\t\t\tuser_type = \"viewer\";\n\t\t\t\t\n\t\t\t}\n\t\t}\n\t\tif(user_type == 'host') {\n\t\t\tquestion_counter = 0;\n\t\t\ttrivia_questions = [];\n\t\t\tdisplay_question = [];\n\t\t\tloadQuestions(MAX_QUESTIONS);\n\t\t}\n\t\t$(\"#actual_question\").html(\"\");\n\t\t$(\"#game_recap_container\").fadeOut('slow');\n\t}","function reset() {\n gameMode = modeSelector.options[ modeSelector.selectedIndex ].value;\n gameDifficulty = difficultySelector.options[ difficultySelector.selectedIndex ].value;\n if ( gameDifficulty === \"Easy\" ) {\n playGame( 3 );\n } else {\n playGame( 6 );\n }\n}","function resetGame(){\n\t\t\n\t\tguessesLeft = 10;\n\t\tguessesMade = [];\n\n\t}//END resetGame()","function resetGame() {\n\t$('.box').removeClass('played');\n\t$('.box').removeClass('U-turn');\n\t$('.box').removeClass('I-turn');\n\t$('.box').html('');\n\t$('.box').addClass('free');\n\tisPlayerOne = true;\n\tisPlayerTwo = false;\n\n}","function resetGame() {\n rights = 0;\n wrongs = 0;\n timeLeft = 11;\n questionIndex = undefined;\n currentQ = undefined;\n correctOption = undefined;\n gameInProgress = false;\n intervalId = undefined;\n questionsArray = [];\n pauseTime();\n $(\"#questionText\").empty();\n $(\"#answerOptions\").empty();\n $(\"#video\").empty();\n $(\"#gameResults\").empty();\n $(\"#gameResults\").css(\"display\", \"none\");\n $(\"#resetGame\").css(\"display\", \"none\");\n $(\"#bonusQ\").css(\"display\", \"none\");\n $(\"#gameElements\").css(\"display\", \"none\");\n $(\"#startGame\").css(\"display\", \"block\");\n}","function resetGame() {\n deck.innerHTML = '';\n tally.textContent = 0;\n seconds = 0;\n minutes = 0;\n moves = 0;\n stars.innerHTML = '';\n pairedCards = [];\n setupDeck();\n modal.style.display = 'none';\n}"],"string":"[\n \"function resetGame() {\\n resetClockAndTime();\\n resetMoves(); \\n resetRatings();\\n startGame();\\n}\",\n \"function resetGame() {\\n resetClockAndTime();\\n resetMoves();\\n resetStars();\\n initGame();\\n activateCards();\\n startGame();\\n}\",\n \"function reset() {\\n //Reset the game\\n channelResetGame();\\n }\",\n \"function resetGame() {\\n clearGameCards();\\n resetMoves();\\n resetTimer();\\n}\",\n \"function resetGame() {\\n resetTimer();\\n resetMoves();\\n resetStars();\\n shuffleDeck();\\n resetCards();\\n}\",\n \"function reset() {\\n timesPlayed = -1;\\n right = 0;\\n wrong = 0;\\n startGame ();\\n }\",\n \"function reset() {\\n time = 120;\\n gameRun = false;\\n }\",\n \"function resetGame() {\\n counter = 0;\\n }\",\n \"function resetGame() {\\n gBoard = buildBoard();\\n gGame.shownCount = 0;\\n gGame.isOn = false;\\n gLivesCount = 3;\\n}\",\n \"function resetGame(){\\n game_mode='';\\n player_sequence=[];\\n game_sequence=[];\\n player_clicks = 0;\\n createGame();\\n}\",\n \"function resetGame() {\\n matched = 0;\\n resetTimer();\\n resetMoves();\\n resetStars();\\n resetCards();\\n shuffleDeck();\\n}\",\n \"function resetGame() {\\n stopGoodTones();\\n stopErrTone();\\n clearScore();\\n game.genSeq = [];\\n game.playerSeq = [];\\n game.err = false;\\n }\",\n \"function resetGame() {\\n\\tresetClockAndTime();\\n\\tresetMoves();\\n\\tresetStars();\\n\\tshuffleDeck();\\n\\tresetCards();\\n\\tmatched = 0;\\n\\ttoggledCards = [];\\n}\",\n \"function resetCurrentGame() {\\n clearGameCards();\\n resetMoves();\\n resetTimer();\\n startGame();\\n resetGameSound();\\n}\",\n \"function reset(){\\n\\n theme.play();\\n\\n gameState = PLAY;\\n gameOver.visible = false;\\n restart.visible = false;\\n \\n monsterGroup.destroyEach();\\n \\n Mario.changeAnimation(\\\"running\\\",MarioRunning);\\n\\n score=0;\\n\\n monsterGroup.destroyEach();\\n\\n \\n}\",\n \"function resetGame() {\\n cardShuffle();\\n resetBoard();\\n cardsInPlay = [];\\n cardInPlayId = -1;\\n}\",\n \"function reset() {\\n\\t\\t/**\\n\\t\\t * TODO: create initial game start page and additional\\n\\t\\t * \\tinteractivity when game resets once understand more about\\n\\t\\t * animation\\n\\t\\t */\\n\\t}\",\n \"function resetGame() {\\n counter = 0;\\n correctCounter = 0;\\n incorrectCounter = 0;\\n unansweredCounter = 0;\\n timer = 30;\\n startGame();\\n timerHolder();\\n }\",\n \"function reset(){\\r\\n gameState = PLAY;\\r\\n gameOver.visible = false;\\r\\n // restart.visible = false;\\r\\n enemiesGroup.destroyEach();\\r\\n blockGroup.destroyEach();\\r\\n stars1Group.destroyEach();\\r\\n stars2Group.destroyEach();\\r\\n candyGirl.addAnimation(\\\"running\\\", candygirl_running);\\r\\n score = 0;\\r\\n}\",\n \"function gameReset(){\\n\\t\\t\\tshowAction(\\\"RESET!\\\");\\n\\t\\t\\tif(timer) gameEnd();\\n\\t\\t\\t$(\\\".info .timer .sec\\\").text(0);\\n\\t\\t\\t$(\\\".info .timer .sectext\\\").hide();\\n\\t\\t\\ttime = null;\\n\\t\\t\\tcardsleft = settings.cardcnt;\\n\\t\\t\\t$(\\\"#wrap-gameboard li.flip\\\").removeClass(\\\"found selected flip\\\");\\n\\t\\t\\t$(\\\"#wrap-gameboard li.hover\\\").removeClass(\\\"hover\\\");\\n\\t\\t}\",\n \"function resetGame() {\\n stopPongGame();\\n\\n // reset positions\\n\\n // reset scores\\n\\n // start game again\\n}\",\n \"function resetGame () { \\n\\t\\t\\t\\t\\t\\t\\tblueNum = 0;\\n\\t\\t\\t\\t\\t\\t greenNum = 0;\\n\\t\\t\\t\\t\\t\\t\\tredNum = 0;\\n\\t\\t\\t\\t\\t\\t\\tyellowNum = 0;\\n\\t\\t\\t\\t\\t\\t scoreResult=0;\\n\\t\\t\\t\\t\\t\\t\\ttargetScore = 0;\\n\\t\\t\\t\\t\\t\\t\\tgetNumber(); // Restart the game and assigns new traget number\\n\\t\\t\\t\\t\\t\\t\\tscoreBoard(); // Update the score board with new values.\\n\\t\\t}\",\n \"function resetGame() {\\n \\n // reset varaibles\\n wrong = 0;\\n correct = 0;\\n index = -1;\\n \\n // Update HTML\\n clearContent();\\n\\n // Restart game\\n loadQuestion();\\n }\",\n \"function gameReset() {\\n totalScore = 0;\\n setupGame();\\n }\",\n \"function resetGame() {\\n account.score = 0;\\n account.lines = 0;\\n account.level = 0;\\n board.reset();\\n time = { start: 0, elapsed: 0, level: LEVEL[account.level] };\\n}\",\n \"function resetGame () {\\n resetBricks ();\\n store.commit ('setScore', 0);\\n store.commit ('setLives', 3);\\n resetBoard ();\\n draw ();\\n}\",\n \"function resetGame() {\\n userScore = 0;\\n computerScore = 0;\\n gameSwitch(winningScore);\\n}\",\n \"function resetGame() {\\n window.cancelAnimationFrame(anim_id);\\n playing = false;\\n score = 0;\\n level = 1;\\n new_game = true;\\n speed = init_speed\\n direction = ''\\n snake.reset(init_speed);\\n fruit.reset();\\n }\",\n \"resetGame() {\\n\\t\\t//stop game\\n\\t\\tthis.running = false\\n\\t\\tclearInterval(this.loop);\\n\\n\\t\\t//set original values\\n\\t\\tthis.aliens = [1, 3, 5, 7, 9, 23, 25, 27, 29, 31];\\n\\t\\tthis.direction = 1;\\n\\t\\tthis.ship = [104, 114, 115, 116];\\n\\t\\tthis.missiles = [];\\n\\t\\tthis.level = 1;\\n\\t\\tthis.currentLevel = 1;\\n\\t\\tthis.speed = 512;\\n\\t\\tthis.score = 0;\\n\\n\\t\\tconsole.log(\\\"Game reset.\\\");\\n\\t}\",\n \"function resetGame() {\\n generateTarget();\\n generateNumbers();\\n distributeNumbers();\\n}\",\n \"function gameReset() {\\n\\t//maybe add gameOverStatus\\n\\t//initial gameStatus\\n\\tcounter = 100;\\n\\tgameOverStatus = false;\\n\\twindow.location.hash = \\\"#game-board\\\";\\n\\tmessageBoard.innerText = \\\"Game Start!\\\\n\\\" + \\\"Current Score: \\\" + counter + \\\" points\\\";\\n\\tshuffleCards();\\n}\",\n \"function reset() {\\n generateLevel(0);\\n Resources.setGameOver(false);\\n paused = false;\\n score = 0;\\n lives = 3;\\n level = 1;\\n changeRows = false;\\n pressedKeys = {\\n left: false,\\n right: false,\\n up: false,\\n down: false\\n };\\n }\",\n \"function reset() {\\n x = 20;\\n y = 35;\\n level = 1;\\n lost = false;\\n won =false;\\n game = false;\\n loseColor =0;\\n winColor=1;\\n}\",\n \"function restart(){\\n myGameArea.reset();\\n}\",\n \"function resetGame() {\\n timer.stop();\\n startGame();\\n}\",\n \"function NewGameReset(){\\n\\t\\tconsole.log(\\\"Game Reset\\\");\\n\\n\\t\\t\\n\\t\\t//Clear Score value and color\\n\\t\\tUtil.one(\\\"#score\\\").innerHTML = 0;\\n\\t\\tUtil.one(\\\"#points\\\").setAttribute(\\\"class\\\", \\\"grey_background\\\");\\n\\t\\tUtil.one(\\\"#score\\\").setAttribute(\\\"class\\\", \\\"grey_background\\\");\\n\\t\\tUtil.one(\\\"#point_text\\\").setAttribute(\\\"class\\\", \\\"grey_background\\\");\\n\\t\\t\\n\\t\\t\\n\\t\\t//Reset all event flags\\n\\t\\tcrushing_in_progress = false;\\n\\t\\tshowing_hint = true;\\n\\t\\tlastmove = new Date().getTime();\\n\\t\\t\\n\\t\\t\\n}\",\n \"function resetGame() {\\n newSquares = Array(9).fill(null);\\n setSquares(newSquares);\\n setXTurn(true);\\n }\",\n \"function resetGame() {\\n\\t// Repopulate card deck\\n\\tcardDeck = masterDeck.map(function(card) { return card }); \\n\\t// Empty all containers of their elements\\n\\t$('#game-board').html('')\\n\\t$('#p1-hand').html(''); \\n\\t$('#p2-hand').html('');\\n\\t$('#p1-points').html('');\\n\\t$('#p2-points').html('');\\n\\t$('#turn-count').html('');\\n\\t// Reset board array\\n\\tgameBoard = [0, 1, 2, 3, 4, 5, 6, 7, 8]; \\n\\t// Reset turn count\\n\\tturnCount = 0;\\n\\t// Reset points\\n\\tplayer1.points = 5; \\n\\tplayer2.points = 5;\\n}\",\n \"function resetGame() {\\n gameStart();\\n stopTimer();\\n resetStars();\\n resetCards();\\n moves = 0;\\n movesText.innerHTML = '0';\\n second = 0;\\n minute = 0;\\n hour = 0;\\n clock.innerHTML = '0:00';\\n}\",\n \"function resetGame() {\\n // Position of prey and player will reset\\n setupPrey();\\n setupPlayer();\\n // movement and speed of prey will reset\\n movePrey();\\n // sound will replay\\n nightSound.play();\\n // Size and color of player will reset\\n playerRadius = 20;\\n firegreen = 0;\\n // score will reset\\n preyEaten = 0;\\n // prey speed will reset\\n preyMaxSpeed = 4\\n // All of this when game is over\\n gameOver = false;\\n}\",\n \"function resetGame() {\\n\\n gameOver = false;\\n state = `menu`;\\n\\n scoreMoney = 0;\\n score = 0;\\n\\n setup();\\n\\n // clearInterval of mouse \\n if (minigame1) {\\n clearInterval(mousePosInterval);\\n }\\n // Resets the fishies\\n if (minigame2) {\\n for (let i = 0; i < NUM_FISHIES; i++) {\\n let fish = fishies[i];\\n fish.reset();\\n }\\n }\\n}\",\n \"function resetGame() {\\n game.correctAnswers = 0;\\n game.incorrectAnswers = 0;\\n game.unanswered = 0;\\n game.time = 0;\\n game.questionIndex = 0;\\n clearInterval(game.intervalId);\\n clearTimeout(game.timeoutID);\\n}\",\n \"function resetGame() {\\n localStorage.setItem('Game.State', null);\\n document.querySelector('.moves').textContent = \\\"0\\\";\\n \\n if (cardDeck) {\\n cardDeck.clear();\\n }\\n \\n cardDeck = new CarDeck();\\n cardDeck.shuffle();\\n bindClickEvent();\\n \\n cardDeck.cards.forEach(card => {\\n card.closeCard()\\n card.unmatch()\\n });\\n \\n state = {\\n matchingCard: null,\\n isMatching: false,\\n totalMoves: 0,\\n elapsedSeconds: 0,\\n isGameOver: false\\n }\\n \\n updateScreenMode(true)\\n }\",\n \"function resetGame(){\\n setWinner(undefined)\\n setPlayerBoard(()=> GameBoard('player'))\\n setAiBoard(()=> GameBoard('ai'))\\n setAI(() => Player('ai'))\\n setIsPlayerTurn(true)\\n setUpGame()\\n }\",\n \"function resetGame() {\\r\\n shuffle(deck);\\r\\n gameStart();\\r\\n dealerarea.innerHTML = \\\"\\\";\\r\\n playerarea.innerHTML = \\\"\\\";\\r\\n winnerarea.innerHTML = \\\"\\\";\\r\\n playerHand.firsttotal = 0;\\r\\n dealerHand.firsttotal = 0;\\r\\n playerHand.secondtotal = 0;\\r\\n dealerHand.secondtotal = 0;\\r\\n }\",\n \"function resetGame() {\\n if (dinoStegosaurus.foodEaten + dinoTriceratops.foodEaten >= 20) {\\n tornado.reset();\\n }\\n if (dinoStegosaurus.foodEaten + dinoTriceratops.foodEaten >= 30) {\\n fire.reset();\\n }\\n if (dinoStegosaurus.foodEaten + dinoTriceratops.foodEaten >= 40) {\\n meteor.reset();\\n }\\n foodLeaves.reset();\\n foodBerries.reset();\\n foodPlant.reset();\\n dinoStegosaurus.reset();\\n dinoTriceratops.reset();\\n gameOverScreen = false;\\n titleScreen = true;\\n instructionsScreen = false;\\n gameWon = false;\\n}\",\n \"function resetGame() {\\n\\n\\t// show it (when page loads the bugs are hidden)\\n\\t$(\\\".bug-bg\\\").css({\\n\\t\\t\\\"display\\\": \\\"block\\\"\\n\\t});\\n\\n\\t// reset state vars\\n\\tcurrentHighestIndex = 0;\\n\\tnumberErrors = 0;\\n\\n\\tplaySound('#resetSound');\\n\\n\\t// reset visuals\\n\\t$(\\\"#currentHighestIndex\\\").html(currentHighestIndex);\\n\\t$(\\\"#numberErrors\\\").html(numberErrors);\\n\\t// remove all boxes\\n\\t$(\\\".hidden-btn\\\").removeClass(\\\"correct\\\").removeClass(\\\"incorrect\\\");\\n}\",\n \"function reset(){\\n score=0;\\n gameTime=0;\\n updateScore();\\n}\",\n \"function gameReset() {\\n\\t\\tquestionCounter = 0;\\n\\t\\tcorrectGuesses = 0;\\n\\t\\tincorrectGuesses = 0;\\n\\t}\",\n \"function gameReset() {\\n\\t\\tquestionCounter = 0;\\n\\t\\tcorrectGuesses = 0;\\n\\t\\tincorrectGuesses = 0;\\n\\t}\",\n \"function gameReset() {\\n\\t\\tquestionCounter = 0;\\n\\t\\tcorrectGuesses = 0;\\n\\t\\tincorrectGuesses = 0;\\n\\t}\",\n \"function gameReset() {\\n\\t\\tquestionCounter = 0;\\n\\t\\tcorrectGuesses = 0;\\n\\t\\tincorrectGuesses = 0;\\n\\t}\",\n \"function resetGame() {\\n location.reload();\\n }\",\n \"function resetGame () {\\n clearBoard();\\n window.location.reload();\\n}\",\n \"function resetGameState() {\\n\\t\\tgameOngoing = true;\\n\\t\\tcurrentPlayer = player1;\\n\\t}\",\n \"function reset() {\\n resetGame(gameId);\\n updateCharList([]);\\n updateChar(\\\"\\\");\\n }\",\n \"function reset() {\\n clear();\\n initialize(gameData);\\n }\",\n \"function resetGame() {\\n clearGame();\\n levelSpace.innerHTML = \\\"Press Start/Stop to Begin\\\";\\n}\",\n \"function resetGame() {\\n\\tquestionCounter = 0;\\n\\tcorrectTally = 0;\\n\\tincorrectTally = 0;\\n\\tunansweredTally = 0;\\n\\tcounter = 30;\\n\\tgenerateHTML();\\n\\ttimerWrapper();\\n}\",\n \"function gameReset() {\\n hideWinPanel();\\n timerStop();\\n timeInSeconds = 0;\\n hours = 0;\\n minutes = 0;\\n updateTimerDisplay(0);\\n movesCounter = 0;\\n movesCounterDisplay(movesCounter);\\n cardsMatched = 0;\\n shuffle(cards);\\n setupCardDeckDisplay(deckElement, cards);\\n resetStarsDisplay();\\n cardElements = deckElement.getElementsByClassName('card');\\n cardDeckFlashDisplay(cardElements);\\n timerStart();\\n}\",\n \"function reset() {\\n\\t$snake.off(\\\"keydown\\\");\\n\\tdeleteSnake();\\n\\t\\n\\tmakeSnake();\\n\\tupdateScores();\\n\\tassignKeys();\\n\\tplayGame();\\n}\",\n \"function resetGame(){\\n console.log(gamePaused);\\n gamePaused=false;\\n console.log(gamePaused);\\n if(!gamePaused && !stopGame){\\n removeModal(); \\n playGame();\\n } else{\\n removeModal();\\n addCirclesToHoverBar();\\n //clearing all dots of game board\\n clearGameBoard();\\n clearMessageBoard(); \\n changeMessageBoardBG(\\\"none\\\"); \\n stopGame=false;\\n count=30;\\n startGame();\\n } \\n}\",\n \"function resetGame() {\\n // reset the global variables\\n cardsCollected = [];\\n DeckOfCards = [];\\n cardOneElement = null;\\n cardTwoElement = null;\\n startTime = null;\\n currentTurn = 0;\\n gameWon = false;\\n seconds = 0;\\n moves = 0;\\n stars = 3;\\n}\",\n \"function resetGame() {\\r\\n\\t\\r\\n\\t\\tfor(var i=0; i<board.length; i++) {\\r\\n\\t\\t\\tboard[i].innerHTML = \\\" \\\";\\r\\n\\t\\t\\tboard[i].style.color = 'navy';\\r\\n\\t\\t\\tboard[i].style.backgroundColor = 'transparent';\\r\\n\\t\\t}\\r\\n\\t\\tgameOver = false;\\r\\n\\t\\tempty = 9;\\r\\n\\t\\tsetMessage(player + \\\" gets to start.\\\");\\r\\n\\t\\tsetMessage2(\\\"Go!\\\");\\r\\n\\t\\tconsole.log(\\\"visited resetGame\\\");\\r\\n\\t}\",\n \"function resetGame() {\\n moves = 0;\\n match_found = 0;\\n $('#deck').empty();\\n $('#stars').empty();\\n $('#game-deck')[0].style.display = \\\"\\\";\\n $('#sucess-result')[0].style.display = \\\"none\\\";\\n game_started = false;\\n timer.stop();\\n $('#timer').html(\\\"00:00:00\\\");\\n playGame();\\n}\",\n \"function resetGame() {\\n game.player1.gameScore = 0;\\n game.player2.gameScore = 0;\\n gameScoreIndex++;\\n pointScoreIndex = 0; //for after looking at matchStats\\n // gameScoreIndex = 0;\\n // game.gameScoreCollection.push(pushArr);\\n if (game.startSer === 'player1') {\\n swal(game.player2.name + \\\" serves first\\\");\\n game.startSer = 'player2';\\n game.player1.curSer = false;\\n game.player2.curSer = true;\\n }else if (game.startSer === 'player2'){\\n swal(game.player1.name + \\\" serves first\\\");\\n game.startSer = 'player1';\\n game.player1.curSer = true;\\n game.player2.curSer = false;\\n }\\n }\",\n \"function resetGame() {\\n\\t$(\\\"#gameOver\\\").fadeOut();\\n\\ttotal = 0;\\n\\tupdateTotal(0);\\n\\ttotalEmptyCells = 16;\\n\\tgrid = getGrid();\\n\\tgridSpans = getSpanGrid();\\n\\t$(gridSpans).each(function(i,r) { $(r).each(function(i,c) { $(c).parent().css(\\\"background-color\\\", \\\"#D1E3EB\\\"); $(c).text(\\\"\\\"); }); });\\n\\tsetRandCell(get2or4());\\n\\tsetRandCell(get2or4());\\n}\",\n \"function resetGame(){\\n startingLevel = 1;\\n startingScore = 0;\\n startingLives = 5;\\n\\n changeScore(startingLevel, startingScore);\\n changeLevel(startingLevel);\\n}\",\n \"function reset() {\\n // make a new game object\\n myGame = new Game('X');\\n // update the view\\n updateView();\\n document.getElementById(\\\"status\\\").innerHTML = \\\"Start Game!\\\";\\n document.getElementById(\\\"reset-btn\\\").innerHTML = \\\"Reset Game\\\";\\n}\",\n \"function reset() {\\n status.gameArr = [];\\n status.level = 0;\\n topLeft.off();\\n topRight.off();\\n bottomLeft.off();\\n bottomRight.off();\\n status.running = false;\\n level.html(\\\"0\\\").css(\\\"color\\\", 'red');\\n start.html('<i class=\\\"fa fa-play\\\"></i>').css('color', 'red');\\n}\",\n \"function resetGame() {\\n\\tcards = [];\\n\\tcardsDisplayed = 0;\\n\\tclearTimeout(timer);\\n\\ttoggleNumbers();\\n\\t$('#timer').html('30');\\n\\t$('.card').each(function() {\\n\\t\\t$(this).html(' ');\\n\\t\\t\\n\\t}); // end each\\n\\t$('#total').html(' ');\\n\\t$('#answer').text('');\\n\\t$('.card').each(function() {\\n\\t\\tif ($(this).hasClass('disabled')) {\\n\\t\\t\\t$(this).removeClass('disabled');\\n\\t\\t}\\n\\t\\tif ($(this).hasClass('pause')) {\\n\\t\\t\\t$(this).removeClass('pause');\\n\\t\\t}\\n\\t}); // end each\\n\\t$('#variables').html('');\\n\\tuserVariables = [];\\n\\t$('#notice').fadeOut();\\n\\t\\n}\",\n \"function resetme(){\\n\\tinitiateBoard();\\n\\tmode=0;\\n\\tdisplay(0);\\n}\",\n \"function resetGame() {\\n randomizer();\\n attempt = 0;\\n $(\\\".showTarget\\\").text(target);\\n $(\\\".showAttempt\\\").text(attempt);\\n $(\\\".showWins\\\").text(wins);\\n $(\\\".showLosses\\\").text(losses);\\n }\",\n \"function resetGame() {\\n // reset game by going through buttons\\n for (var i=0; i < buttons.length; i++) {\\n buttons[i].style.backgroundColor = ''; // change color back to original\\n buttons[i].innerHTML = ''; // delete x's and o's\\n }\\n gameover = false;\\n }\",\n \"function resetGame() {\\n // Clear the main boxes and the minimap boxes\\n for(var rIndex = 0; rIndex < NUM_ROWS; rIndex++) {\\n for(var cIndex = 0; cIndex < NUM_COLS; cIndex++) {\\n // Clear main boxes\\n boxes[rIndex][cIndex].classList.remove(xClass, oClass);\\n boxes[rIndex][cIndex].textContent = \\\"\\\";\\n // Clear minimap boxes\\n miniboxes[rIndex][cIndex].classList.remove(xClass, oClass);\\n miniboxes[rIndex][cIndex].textContent = \\\"\\\";\\n }\\n }\\n\\n // Hide end game text\\n $(victoryText).hide();\\n\\n // Reset number of filled boxes\\n boxCount = 0;\\n\\n // Start the game again\\n gameOver = false;\\n }\",\n \"resetGame() {\\n // clear game seeds\\n this.gameSeed = '';\\n this.currentString = '';\\n\\n if (this.gameStarted) {\\n this.toggleGameStarted();\\n this.flashCount();\\n document.getElementById('simon-points').innerHTML = '--';\\n // delayed set to default in-case point flashing causes issues\\n setTimeout(() => { document.getElementById('simon-points').innerHTML = '--'; }, 525);\\n this.flashTimer = setInterval(() => { this.flashCount(); }, 1000);\\n }\\n }\",\n \"function resetGame(){\\t\\t\\n\\thasStarted=false;\\n\\tinput=-1;\\n\\tsequence=[];\\n\\tlevel=0;\\n\\tdisplay(\\\"--\\\");\\n\\tsetTimeout(function(){\\n\\t\\t\\t$(\\\"#board div\\\").removeClass(\\\"clickable\\\");\\n\\t\\t},500);\\t\\n}\",\n \"function resetGame() {\\n\\tusedQuestions = [];\\n\\ttime = 20;\\n\\tscore = 0;\\n\\twrongAnswers = 0;\\n\\tnoAnswer = 0;\\n\\t$(\\\"#results\\\").empty();\\n\\tsetGame();\\n}\",\n \"function actionOnResetClick () {\\n gameRestart();\\n }\",\n \"function gameReset() {\\n questionCounter = 0;\\n correctGuesses = 0;\\n incorrectGuesses = 0;\\n }\",\n \"function gameReset() {\\n questionCounter = 0;\\n correctGuesses = 0;\\n incorrectGuesses = 0;\\n }\",\n \"function resetGame() {\\n history = [];\\n guessesCount = -1;\\n level = 0;\\n $('.level').text(level);\\n }\",\n \"function gameReset() {\\n questionCounter = 0;\\n correctGuesses = 0;\\n incorrectGuesses = 0;\\n }\",\n \"function resetGame() {\\n deck.innerHTML = '';\\n openCards = [];\\n matchedCards = [];\\n moves = 0;\\n clickCounter = 0;\\n clearInterval(timer);\\n seconds = 0;\\n minutes = 0;\\n timer = 0;\\n time.textContent = '00:00';\\n generateStar(starsLost);\\n starsLost = 0;\\n initGame();\\n}\",\n \"function gameReset() {\\r\\n\\tgameState.score = 0;\\r\\n\\t$(\\\"#score\\\").html(\\\"Points: <br>\\\"+gameState.score);\\r\\n\\t$(\\\"#wins\\\").html(\\\"Wins: \\\"+gameState.wins);\\r\\n\\t$(\\\"#losses\\\").html(\\\"Losses: \\\"+gameState.losses);\\r\\n\\tgameState.match = getRandom(19,120);\\r\\n\\t$(\\\"#randomNum\\\").html(\\\"Match: <br>\\\"+gameState.match);\\r\\n\\tgameInit()\\r\\n}\",\n \"resetGame() {\\n this.initGrid();\\n this.setDefaultSeeds();\\n this.iteration = 0;\\n }\",\n \"function resetGame() {\\n location.reload()\\n}\",\n \"resetGame() {\\n this.winner = null;\\n this.grid.resetGrid();\\n }\",\n \"function resetGame(){\\n if (!win || win){\\n clearWinOrLoseScreen()\\n }\\n BGM.currentTime = 0\\n BGM.play()\\n // BGM.volume = 0.2\\n win = null\\n cells[enemyA.position].classList.remove('enemy1')\\n cells[enemyB.position].classList.remove('enemy2')\\n cells[enemyC.position].classList.remove('enemy3')\\n cells[enemyD.position].classList.remove('enemy4')\\n clearInterval(gametimer)\\n clearInterval(berryTimer)\\n gameOver = false\\n playerScore = 0\\n scoreboard.innerHTML = playerScore\\n createMaze()\\n startTimer()\\n startBerryTimer()\\n cookiesRemaining = 212\\n playerPosition = 487\\n cells[playerPosition].classList.add('sprite')\\n enemyA.position = 337\\n cells[enemyA.position].classList.add('enemy1')\\n enemyB.position = 335\\n cells[enemyB.position].classList.add('enemy2')\\n enemyC.position = 339\\n cells[enemyC.position].classList.add('enemy3')\\n enemyD.position = 338\\n cells[enemyD.position].classList.add('enemy4')\\n\\n }\",\n \"function resetGameState() {\\r\\n\\r\\n // Reset difficulty and enemy speed.\\r\\n increaseDifficulty.difficulty = \\\"start\\\";\\r\\n Enemy.v = 4;\\r\\n toggleEnemySpawner.spawnRate = 2000;\\r\\n\\r\\n // Clear the list of game objects.\\r\\n observers = [];\\r\\n\\r\\n // Reset player.\\r\\n player = new Player();\\r\\n\\r\\n // Reset game state data.\\r\\n time = 90;\\r\\n document.getElementById(\\\"time-numeric\\\").innerHTML = time;\\r\\n Player.score = 100;\\r\\n document.getElementById(\\\"score-numeric\\\").innerHTML = Player.score;\\r\\n timeAt100 = 0;\\r\\n}\",\n \"function gameReset () {\\n questionCounter = 0;\\n correctGuesses = 0;\\n incorrectGuesses = 0;\\n }\",\n \"resetGame() {\\n\\t\\tthis.App.setGetters.setGameProperty('timer', this.App.game.settings.gameLength);\\n\\t\\tthis.App.setGetters.setPlayersProperty('correct', false);\\t\\t\\n\\t\\tthis.App.setGetters.setGameStoreProperty('paths', {});\\n\\t\\tthis.App.setGetters.setGameStoreProperty('chatLog', {});\\n\\t\\tthis.App.clientComms.emitToAllSockets('reset');\\n\\t\\tthis.App.clientComms.emitToAllSockets('puzzle', []);\\n\\t}\",\n \"function resetGame() {\\n toggleMenu(Menu.MAIN);\\n $('#statsOutput').hide();\\n $('#ammoBarsContainer').hide();\\n scene.stopMusic();\\n renderer.clear(false, true, true);\\n scene = new TheScene(renderer.domElement);\\n}\",\n \"function resetGame() {\\n for (let i = 0; i < kids.length; i++) {\\n kids[i].reset();\\n player.reset();\\n isGameOver = false;\\n }\\n}\",\n \"function resetGame(){\\n\\t\\n\\tlocation.reload(); \\n\\t\\n}\",\n \"function resetGame() {\\n\\t\\ttokbox.forceUnpublish();\\n\\t\\tfor(x = 1; x < 21; x++) {\\n\\t\\t\\t$(\\\"#score_\\\"+x).css(\\\"background-color\\\", \\\"transparent\\\");\\n\\t\\t\\tif(x < 5) {\\n\\t\\t\\t\\t$(\\\"#solution_\\\"+ (x - 1) + \\\"_right\\\").html(\\\"\\\");\\n\\t\\t\\t\\t$(\\\"#solution_\\\" + (x - 1) + \\\"_container\\\").css(\\\"background-color\\\", \\\"#BFBB11\\\").css(\\\"border-color\\\", \\\"#730046\\\").css(\\\"color\\\", \\\"black\\\");\\n\\t\\t\\t}\\n\\t\\t\\t$(\\\"#help_container_computer_normal\\\").fadeIn('slow');\\n\\t\\t\\t$(\\\"#help_container_audience_normal\\\").fadeIn('slow');\\n\\t\\t\\t$(\\\"#help_container_phone_normal\\\").fadeIn('slow');\\n\\t\\t\\tif(user_type == 'host') {\\n\\t\\t\\t\\t$(\\\"#correct_answer\\\").html(\\\"\\\");\\n\\t\\t\\t}\\n\\t\\t\\tif(user_type == 'user') {\\n\\t\\t\\t\\t$(\\\".question_holder\\\").unbind('click');\\n\\t\\t\\t\\t$(\\\"#help_container_phone_normal\\\").unbind('click');\\n\\t\\t\\t\\t$(\\\"#help_container_audience_normal\\\").unbind('click');\\n\\t\\t\\t\\t$(\\\"#help_container_computer_normal\\\").unbind('click');\\n\\t\\t\\t\\tuser_type = \\\"viewer\\\";\\n\\t\\t\\t\\t\\n\\t\\t\\t}\\n\\t\\t}\\n\\t\\tif(user_type == 'host') {\\n\\t\\t\\tquestion_counter = 0;\\n\\t\\t\\ttrivia_questions = [];\\n\\t\\t\\tdisplay_question = [];\\n\\t\\t\\tloadQuestions(MAX_QUESTIONS);\\n\\t\\t}\\n\\t\\t$(\\\"#actual_question\\\").html(\\\"\\\");\\n\\t\\t$(\\\"#game_recap_container\\\").fadeOut('slow');\\n\\t}\",\n \"function reset() {\\n gameMode = modeSelector.options[ modeSelector.selectedIndex ].value;\\n gameDifficulty = difficultySelector.options[ difficultySelector.selectedIndex ].value;\\n if ( gameDifficulty === \\\"Easy\\\" ) {\\n playGame( 3 );\\n } else {\\n playGame( 6 );\\n }\\n}\",\n \"function resetGame(){\\n\\t\\t\\n\\t\\tguessesLeft = 10;\\n\\t\\tguessesMade = [];\\n\\n\\t}//END resetGame()\",\n \"function resetGame() {\\n\\t$('.box').removeClass('played');\\n\\t$('.box').removeClass('U-turn');\\n\\t$('.box').removeClass('I-turn');\\n\\t$('.box').html('');\\n\\t$('.box').addClass('free');\\n\\tisPlayerOne = true;\\n\\tisPlayerTwo = false;\\n\\n}\",\n \"function resetGame() {\\n rights = 0;\\n wrongs = 0;\\n timeLeft = 11;\\n questionIndex = undefined;\\n currentQ = undefined;\\n correctOption = undefined;\\n gameInProgress = false;\\n intervalId = undefined;\\n questionsArray = [];\\n pauseTime();\\n $(\\\"#questionText\\\").empty();\\n $(\\\"#answerOptions\\\").empty();\\n $(\\\"#video\\\").empty();\\n $(\\\"#gameResults\\\").empty();\\n $(\\\"#gameResults\\\").css(\\\"display\\\", \\\"none\\\");\\n $(\\\"#resetGame\\\").css(\\\"display\\\", \\\"none\\\");\\n $(\\\"#bonusQ\\\").css(\\\"display\\\", \\\"none\\\");\\n $(\\\"#gameElements\\\").css(\\\"display\\\", \\\"none\\\");\\n $(\\\"#startGame\\\").css(\\\"display\\\", \\\"block\\\");\\n}\",\n \"function resetGame() {\\n deck.innerHTML = '';\\n tally.textContent = 0;\\n seconds = 0;\\n minutes = 0;\\n moves = 0;\\n stars.innerHTML = '';\\n pairedCards = [];\\n setupDeck();\\n modal.style.display = 'none';\\n}\"\n]","isConversational":false},"negative_scores":{"kind":"list like","value":["0.8925137","0.8868678","0.8839611","0.88265324","0.87974507","0.87514013","0.8715469","0.8713044","0.8680245","0.8623561","0.8620319","0.8616942","0.85936975","0.8580226","0.8546222","0.85140723","0.85026693","0.84723043","0.84667","0.8462359","0.8455414","0.8451833","0.8442891","0.8424668","0.84143925","0.8388871","0.83775264","0.83762723","0.83579504","0.8341541","0.83314526","0.8324106","0.8315676","0.83126473","0.8303249","0.830314","0.82950765","0.8291193","0.8289443","0.82878953","0.82870626","0.82855386","0.82538867","0.8250463","0.82480896","0.8247941","0.82466596","0.8240372","0.8229444","0.8229444","0.8229444","0.8229444","0.82265186","0.82251513","0.82157415","0.82132614","0.8193146","0.81906617","0.8189592","0.8185963","0.8183939","0.8181182","0.8166817","0.81579626","0.81529856","0.8146057","0.8141091","0.8136706","0.813504","0.8134281","0.81328386","0.8132477","0.8131344","0.8129234","0.8127255","0.81235284","0.8121095","0.81193054","0.81135315","0.81115264","0.81115264","0.81084144","0.81035","0.809848","0.8096778","0.8093534","0.8093221","0.8089283","0.808705","0.8084159","0.8077102","0.80747557","0.80616146","0.8061053","0.8056562","0.80477357","0.80476534","0.8042496","0.8040736","0.80404156","0.8036304"],"string":"[\n \"0.8925137\",\n \"0.8868678\",\n \"0.8839611\",\n \"0.88265324\",\n \"0.87974507\",\n \"0.87514013\",\n \"0.8715469\",\n \"0.8713044\",\n \"0.8680245\",\n \"0.8623561\",\n \"0.8620319\",\n \"0.8616942\",\n \"0.85936975\",\n \"0.8580226\",\n \"0.8546222\",\n \"0.85140723\",\n \"0.85026693\",\n \"0.84723043\",\n \"0.84667\",\n \"0.8462359\",\n \"0.8455414\",\n \"0.8451833\",\n \"0.8442891\",\n \"0.8424668\",\n \"0.84143925\",\n \"0.8388871\",\n \"0.83775264\",\n \"0.83762723\",\n \"0.83579504\",\n \"0.8341541\",\n \"0.83314526\",\n \"0.8324106\",\n \"0.8315676\",\n \"0.83126473\",\n \"0.8303249\",\n \"0.830314\",\n \"0.82950765\",\n \"0.8291193\",\n \"0.8289443\",\n \"0.82878953\",\n \"0.82870626\",\n \"0.82855386\",\n \"0.82538867\",\n \"0.8250463\",\n \"0.82480896\",\n \"0.8247941\",\n \"0.82466596\",\n \"0.8240372\",\n \"0.8229444\",\n \"0.8229444\",\n \"0.8229444\",\n \"0.8229444\",\n \"0.82265186\",\n \"0.82251513\",\n \"0.82157415\",\n \"0.82132614\",\n \"0.8193146\",\n \"0.81906617\",\n \"0.8189592\",\n \"0.8185963\",\n \"0.8183939\",\n \"0.8181182\",\n \"0.8166817\",\n \"0.81579626\",\n \"0.81529856\",\n \"0.8146057\",\n \"0.8141091\",\n \"0.8136706\",\n \"0.813504\",\n \"0.8134281\",\n \"0.81328386\",\n \"0.8132477\",\n \"0.8131344\",\n \"0.8129234\",\n \"0.8127255\",\n \"0.81235284\",\n \"0.8121095\",\n \"0.81193054\",\n \"0.81135315\",\n \"0.81115264\",\n \"0.81115264\",\n \"0.81084144\",\n \"0.81035\",\n \"0.809848\",\n \"0.8096778\",\n \"0.8093534\",\n \"0.8093221\",\n \"0.8089283\",\n \"0.808705\",\n \"0.8084159\",\n \"0.8077102\",\n \"0.80747557\",\n \"0.80616146\",\n \"0.8061053\",\n \"0.8056562\",\n \"0.80477357\",\n \"0.80476534\",\n \"0.8042496\",\n \"0.8040736\",\n \"0.80404156\",\n \"0.8036304\"\n]","isConversational":false},"document_score":{"kind":"string","value":"0.0"},"document_rank":{"kind":"string","value":"-1"}}},{"rowIdx":4591,"cells":{"query":{"kind":"string","value":"function to stop the game once the user win and toggle the modal to show result"},"document":{"kind":"string","value":"function gameOver() {\n\tstopTimer();\n\tupdateModal();\n\ttoggleModal();\n}"},"metadata":{"kind":"string","value":"{\n \"objective\": {\n \"self\": [],\n \"paired\": [],\n \"triplet\": [\n [\n \"query\",\n \"document\",\n \"negatives\"\n ]\n ]\n }\n}"},"negatives":{"kind":"list like","value":["function winGame() {\n stopTimer();\n toggleModal();\n}","function continueGame() {\n // clear modal\n $(\".modal\").removeClass(\"bg-modal\");\n $(\".modal-inner\").removeClass(\"modal-content\").html(\"\");\n // has endgame condition been reached\n if (selectedGlyphs.length === numQuestionsPerGame) {\n endCondition_gameOver();\n } else {\n selectGlyph();\n }\n }","function wonGame(){\n stopClock();\n modalData();\n $('.modal_background').removeClass('hide');\n}","function gameWonMessage() {\n $('.play-again').click(gameStart);\n $('#gameWon').modal(\"show\");\n}","checkIfWon() {\n let func = () => {\n this.reset();\n }\n if (this.y < 0) {\n this.gameWon = true;\n document.querySelector('.modal').style.display = 'block';\n document.querySelector('.modal-wnd').style.display = 'block';\n document.getElementById('replay-btn').addEventListener('click', function() {\n document.querySelector('.modal').style.display = 'none';\n document.querySelector('.modal-wnd').style.display = 'none';\n func();\n });\n }\n }","function restartGameFromModal() {\n modal.style.display = \"none\";\n newGame();\n}","function gameStatus() {\n\tpairsToGuess--;\n\tif (pairsToGuess == 0) {\n\t\ttoStopWatch(); //stop the stopwatch\n\t\tsetTimeout(function() { //display result popup\n\t\t\tdisplayResult(); //to put results to the modal\n \t\tmodalResult(); // to show modal with results\n \t\t}, 500); \n\t} else {\n\t\t\n\t}\n}","function triggerModal () {\n modal.style.display = 'block';\n\n if (turn !== 1) {\n winner.innerHTML = 'Player 1 Wins!';\n console.log ('Player 1 Wins!');\n }\n if (turn === 1) {\n winner.innerHTML = 'Player 2 Wins!';\n console.log ('Player 2 Wins!');\n }\n }","function endGame() {\n stopMusic();\n win.play();\n modal.style.display = \"block\";\n modalContent.innerHTML = `<h1 class=\"centered\">Congratulation!</h1><h3 class=\"centered\">You have completed the game!</h3><h3 class=\"centered\">Points scored: ${player.score}</h3><h3 class=\"centered\">Lives saved: ${player.lives}</h3><h3 class=\"centered\">Final Score: ${player.score*player.lives}</h3><button class=\"restart button centered\">RESTART!</button>`;\n}","function gameDraw(){\n $(\"#winMsg\").html(\"Game is a draw!! Play Again!\");\n $(\"#winModal\").modal(\"show\");\n }","function checkStatus() {\n if (matchPairCounter == 8) {\n timer.timer('pause');\n $('#totalscore').text(`You finished the game in ${timer.data('seconds')} seconds with ${movesCounter} moves and ${starsCounter} star(s)`);\n $('#myModal').modal({backdrop: 'static', keyboard: false});\n \n }\n}","function continueGame() {\n\tGAME_COMPLETE = false;\n\tGAME_OVER = false;\n\tGAME_CONTINUE = true;\n\t$('#winner').hide();\n}","function checkForWin() {\n if (score > score2){\n $('#player1WinModal').show();\n $('#player1WinModalClose').click(function(){\n $('#player1WinModal').hide();\n });\n } else if (score < score2){\n $('#player2WinModal').show();\n $('#player2WinModalClose').click(function(){\n $('#player2WinModal').hide();\n });\n } else if (score = score2) {\n $('#drawModal').show();\n $('#drawModalClose').click(function(){\n $('#drawModal').hide();\n });\n }\n }","function winGame() {\n if (matched.length === 8) { \n stopTimer();\n toggleModal();\n } \n}","checkIfWin() {\n if (this.score === 10) {\n this.started = false;\n allEnemies = [];\n showWinModal();\n }\n }","function showGameResult () {\n if ($( \".flippable\" ).length === 2 && $('.show').length === 12) { // we pop up a winner modal\n $('.modal-body').html(\n `\n <div class=\"score-item\">Your Time: ${$('.Timer').text()}</div>\n <div class=\"score-item\">Your Score: ${$('.stars').html()}<div>\n `\n );\n $('#endGameModalLabel').text('You Win!');\n $('#endGameModal').modal('show');\n clearInterval(timer);\n resetBoard();\n } else if (moves === 0) { // else we pop up a loser modal\n $('.modal-body').html(\n `\n <div class=\"score-item\">Your Time: ${$('.Timer').text()}</div>\n `\n );\n $('#endGameModalLabel').text('You Lose!');\n $('#endGameModal').modal('show');\n clearInterval(timer);\n resetBoard();\n } else { // not the end of the game!\n return;\n }\n}","function endGame() {\n\t$(\"#lossModal\").modal({backdrop: 'static', keyboard: false});\n\t$(\"#lossModal\").modal('show');\n\t$(\"#name-loss\").text(playerName);\n\t$(\"#poke-number-caught\").text(winCount);\n\t$(\"#score-span\").text(score);\n}","function gameOver() {\n stopMusic();\n loose.play();\n modal.style.display = \"block\";\n modalContent.innerHTML = `<h1 class=\"centered\">Game Over!</h1><h3 class=\"centered\">You have lost all lives and collected ${player.score} points!</h3><button class=\"restart button centered\">RESTART!</button>`;\n}","function checkWin() {\n\t\tif (pairsRemain === 0) {\n\t\t\t\ttimerOff();\n\t\t\t\topenModal();\n\t\t};\n}","function winOrLose (result) {\n const overlayTitle = document.querySelector('.title');\n const startButton = document.querySelector('.btn__reset');\n\n overlay.style.display = '';\n overlay.className = result;\n overlayTitle.innerHTML = `you ${result} the game`;\n startButton.innerHTML = 'Start New Game'\n\n // Reset the game after win or lose\n resetGame();\n}","function gameOver() {\n stopClock();\n writeModalStats();\n toggleModal();\n}","function modalStart(e) {\n e.preventDefault();\n document.querySelector('p.numbers span').textContent = game.numbers = 0;\n document.querySelector('p.wins span').textContent = game.wins = 0;\n document.querySelector('p.losses span').textContent = game.losses = 0;\n document.querySelector('p.draws span').textContent = game.draws = 0;\n document.querySelector('[data-summary=\"who-win\"]').textContent = '';\n document.querySelector('[data-summary=\"your-choice\"]').textContent = '';\n document.querySelector('[data-summary=\"ai-choice\"]').textContent = '';\n if (!isNaN(params.playerName = document.querySelector('input[name=\"firstname\"]').value)){\n return alert('You Have To Give Your Name!!!')\n };\n params.numberRounds = document.querySelector('input[name=\"rounds\"]').value;\n infoRounds.innerHTML = `${params.numberRounds} Rounds to the End of the Game`\n params.play = true;\n document.querySelector('#modal-overlay').classList.remove('show');\n choice.innerHTML = params.playerName.toUpperCase();\n}","function winGame() {\n if (matchList === 8) {\n pause();\n openModal();\n timerModal.innerText = `Final time is: ${min}:${zeroPlaceholder}${second}`;\n playTimer.style.display = 'none';\n gameStarted = false;\n }\n if (moves < 20 && moves > 12) {\n starCount[5].style.display = 'none';\n } else if (moves > 20) {\n starCount[4].style.display = 'none';\n }\n countModal.innerHTML = moves;\n}","function gameWon() {\n modal();\n const playAgain = document.querySelector('.button');\n playAgain.addEventListener('click', function() {\n restart();\n const modal = document.getElementById('endGame');\n modal.classList.remove('appear');\n \n }); \n \n}","function win() {\n if (cardList.length === liMatch.length) {\n stopTimer();\n displayModal();\n }\n}","function replayGame() {\n resetGame();\n toggleModal();\n}","function replayGame() {\n resetGame();\n toggleModal();\n}","function winOrLoseScreen(){\n if (!win){\n GameOverGraphic()\n BGM.pause()\n } else {\n youWinGraphic()\n BGM.pause()\n }\n }","function winner(){\n gameMode = false;\n $('.pop-up').html(curPlayer + \" is victorious! <br><br> Press 'New Game' to play again\");\n $('.pop-up').css(\"visibility\", \"visible\");\n}","function victoryModal(typeOfVictory) {\r\n if (typeOfVictory === \"draw\") {\r\n $(\"#game\").css(\"display\", \"none\");\r\n $(\"#draw\").css(\"display\", \"block\");\r\n let counter = 5;\r\n let int3 = setInterval(() => {\r\n if (counter === 1) {\r\n\r\n $(\"#draw\").fadeOut(\"slow\", () => {\r\n $(\"#modal\").css(\"display\", \"block\");\r\n $(\"#draw\").css(\"display\", \"none\");\r\n });\r\n }\r\n else if (counter === 0) {\r\n clearInterval(int3);\r\n }\r\n $(\"#countdown\").text(counter);\r\n counter--;\r\n }, 1000);\r\n }\r\n else if (typeOfVictory === \"win\") {\r\n $(\"#displayWinner\").text(\"Winner is: \" + winner);\r\n $(\"#currentPlayer\").css(\"display\", \"none\");\r\n $(\"#game\").css(\"margin-top\", \"35px\");\r\n\r\n let counter = 5;\r\n let int4 = setInterval(() => {\r\n if (counter === 1) {\r\n $(\"#game\").fadeOut(\"slow\", () => {\r\n $(\"#modal\").css(\"display\", \"block\");\r\n $(\"#game\").css(\"display\", \"none\");\r\n });\r\n }\r\n else if (counter === 0) {\r\n clearInterval(int4);\r\n }\r\n $(\"#restartCounter\").css(\"display\", \"block\");\r\n $(\"#restartCounter\").text(\"Restarting in : \" + counter);\r\n counter--;\r\n }, 1000);\r\n }\r\n }","function playAgain() {\n modal.classList.remove(\"show\");\n restartGame();\n}","restartGame() {\n score=5;\n $('#restart-button').on('click', () => {\n $('.modal').hide();\n $('.game-container').css('display', 'block');\n $('.mushroom-container').css('display', 'block');\n setUpRound();\n $('#restart-button').off();\n });\n }","function endScreen(){\n toggleModalOn();\n var newGameSelector = document.getElementById('modal-new-game');\n var modalCancel = document.getElementById('modal-cancel');\n \n newGameSelector.addEventListener('click', event=>{\n toggleModalOff();\n newGame();\n })\n \n modalCancel.addEventListener('click', event =>{\n toggleModalOff();\n })\n \n}","function youWon() {\n //stop the timer\n clearInterval(interval);\n //elaborate the score\n score();\n const modal = document.querySelector('.modal');\n //show the score\n modal.style.display = 'block';\n tryAgain.addEventListener('click', function () {\n restart();\n modal.style.display = 'none';\n });\n}","function playAgain(){\n modal.classList.remove(\"show\");\n resetGame();\n}","function UserContinue() {\n //close window\n Modal.closeLevelCompleteWindow();\n //exit current level\n continueGame();\n}","function showModal(){\n gamePaused=true;\n let container=$QS('.gameDisplayDiv');\n let modal=$CESC('div', 'msg-modal');\n \n let h2=$CESC('h2', 'modal-heading');\n h2.innerText='pause';\n //continue game , restart, quit game\n let continueBtn=$CESC('button', 'modal-btn continue-btn');\n continueBtn.innerText='continue game';\n continueBtn.onclick=continueGame;\n\n let resetBtn=$CESC('button', 'modal-btn reset-btn');\n resetBtn.innerText='Restart';\n resetBtn.onclick=resetGame;\n\n let quitBtn=$CESC('button', 'modal-btn quit-btn');\n quitBtn.innerText='quit btn';\n quitBtn.onclick=goToHomePage;\n \n $ACP(modal, h2);\n $ACP(modal, continueBtn);\n $ACP(modal, resetBtn);\n $ACP(modal, quitBtn);\n\n $ACP(container, modal);\n}","showGameWonModal() {\n let modalView = document.getElementById(\"modal-container-view\");\n let modalCloseBtn = document.getElementById(\"modal-close-btn\");\n modalView.style.display = \"flex\";\n\n // Allows user to dimiss the modal message\n modalCloseBtn.onclick = function () {\n modalView.style.display = \"none\";\n }\n\n // When the user clicks anywhere outside of the modal, close it\n window.onclick = function (event) {\n if (event.target == modalView) {\n modalView.style.display = \"none\";\n }\n }\n console.log(\"game won!\");\n }","function continueGame(){\n removeModal();\n\n if(stopGame){\n addCirclesToHoverBar();\n //clearing all dots of game board\n clearGameBoard();\n clearMessageBoard(); \n changeMessageBoardBG(\"none\"); \n stopGame=false;\n count=30;\n startGame();\n }\n\n if(gamePaused){\n gamePaused=false;\n playGame();\n }\n}","toggleDialog() {\n document.getElementById('gameOver').classList.toggle('is-visible');\n stopInterval();\n }","function gameOver() {\n clearInterval(timer);\n getTimeClock();\n setTimeout(function () {\n $(\"#winModal\").toggleClass(\"hidden animated bounceIn\");\n }, 500);\n }","function gameOver() {\n\tstopClock();\n\twriteModalStats();\n\ttoggleModal();\n}","function displayWinner(name) {\n const winnerModal = document.getElementById(\"winnerModal\");\n const restartGame = document.getElementById(\"restartGame\");\n document.getElementById('winner').innerHTML = name;\n gameStarted = false;\n winnerModal.style.display = \"block\";\n restartGame.onclick = (e) => {\n e.preventDefault();\n player1.score = 0;\n player2.score = 0;\n newGame();\n }\n}","function gameWinPopup(){\n var modalGameWin = document.getElementById('modalGameWin');\n var rePlay = document.getElementById(\"replayBtnWin\");\n var img = document.querySelectorAll(\"img\")[0];\n\n modalGameWin.style.display = \"block\";\n $(\"#scoreWin\").html(\"Final score: \" + finalScore);\n // When the user clicks button replay, close it\n rePlay.onclick = function() {\n window.location.assign(\"../start.html\");\n }\n }","function gameOver() {\n stopTimer();\n toggleModal();\n writeModalStats();\n}","function replayGame() {\n\tresetGame();\n\ttoggleModal();\n}","function replayGame() {\n\tresetGame();\n\ttoggleModal();\n}","function showModal(modalForWin) {\n var elModal = document.querySelector(\".modal\");\n elModal.style.display = 'block'\n var resString = (modalForWin) ? `Well Done ` : 'Try again..'\n elModal.innerHTML = `${resString} <button onclick=\"init()\">Play again</button>`\n}","function nameModuleClose() {\n winnerDeclared = document.querySelector('.declaredWinner');\n pvpModal.style.cssText = \"display: none;\";\n let numOne = first.value;\n let numTwo = second.value;\n firstPlayer.winner(numOne);\n computer.winner(numTwo);\n \n // determines which parts of code run\n GBModule.power('on');\n firstPlayer.power('on');\n computer.power('on');\n AIGame.switch('off');\n winnerDeclared.style.cssText = \"display: none;\";\n\n }","function show_win(){\n alert(' You Win !!');\n game_end();\n}","function gameOver() {\n\tstopClock();\n\twriteModalStats();\n\ttoggleModal();\n\tmatched=0;\n}","function isGameOver() {\n if (matchedCards.length === symbols.length) {\n //stop timer\n clearInterval(interval);\n \n //popup congratulation message\n const modal = document.querySelector('.modal');\n const playAgain = document.querySelector('.play-again');\n modal.style.display = \"block\";\n playAgain.addEventListener(\"click\", function() {\n modal.style.display = \"none\";\n\n //call restartGame function\n restartGame();\n }); \n }\n}","function checkWin() {\n if (matchFound === 8) {\n $(\"#runner\").css(\"display\",\"none\")\n $(\".win-modal\").css(\"display\",\"block\");\n $(\".win-modal .stars\").text(stars);\n $(\".win-modal .moves\").text(moves);\n $(\".win-modal .runner\").text(minute + \":\" + second);\n }\n }","function winCheck() {\n\tif(matches === 8){\n\t\ttimerEnd();\n\t\taddRating(moves);\n\t\tpopUpModal();\n\t\tpopUp.classList.remove('display-none');\n\t}\n}","function showEndModal(showType) {\n // CREDIT - Code for showing modal was taken from W3 Schools and adapted to fit this project\n let modal = document.getElementsByClassName(\"end-modal-background\")[0];\n let closeSpan = document.getElementsByClassName(\"end-close\")[0];\n modal.style.display = \"flex\";\n\n closeSpan.onclick = function() {\n modal.style.display = \"none\";\n\n if (showType === \"end\") {\n endGame();\n }\n };\n\n window.onclick = function(event) {\n if (event.target === modal) {\n modal.style.display = \"none\";\n\n if (showType === \"end\") {\n endGame();\n }\n }\n };\n\n if (showType === \"quit\") {\n document.getElementsByClassName(\"end-game\")[0].style.display = \"none\";\n document.getElementsByClassName(\"quit-game\")[0].style.display = \"block\";\n } else if (showType === \"end\") {\n document.getElementsByClassName(\"quit-game\")[0].style.display = \"none\";\n document.getElementsByClassName(\"end-game\")[0].style.display = \"block\";\n\n if (previousWinner === \"player\") {\n document.getElementById(\"end-lose\").style.display = \"none\";\n document.getElementById(\"end-win\").style.display = \"block\";\n let endScore = document.getElementById(\"end-score-win\");\n endScore.textContent = `${playerScore.textContent} - ${computerScore.textContent}`;\n } else if (previousWinner === \"computer\") {\n document.getElementById(\"end-win\").style.display = \"none\";\n document.getElementById(\"end-lose\").style.display = \"block\";\n let endScore = document.getElementById(\"end-score-lose\");\n endScore.textContent = `${playerScore.textContent} - ${computerScore.textContent}`;\n }\n }\n}","function findWinner() {\n \n if (matchFound === 8) {\n timer.pause();\n\n var modal = document.getElementById(\"winner-popup\");\n var span = document.getElementsByClassName(\"close\")[0];\n\n $(\"#total-moves\").text(moves);\n $(\"#total-stars\").text(starRating);\n $(\".minutes\").text(timer.getTimeValues().minutes);\n $(\".seconds\").text(timer.getTimeValues().seconds);\n \n modal.style.display = \"block\";\n \n // When the user clicks on <span> (x), close the modal\n span.onclick = function() {\n modal.style.display = \"none\";\n }\n\n $(\"#play-again\").on(\"click\", function() {\n location.reload()\n });\n \n clearInterval(timer);\n }\n}","function endGame() {\n // console.log(matchNum);\n starModalCount();\n openModal();\n}","function lost(){\r\n let failureMessage = document.querySelector('.failure-message');\r\n modal.classList.remove('hidden');\r\n failureMessage.classList.remove('hidden');\r\n let againBtn = document.querySelector('.again');\r\n againBtn.onclick = function(){\r\n modal.classList.add('hidden');\r\n failureMessage.classList.add('hidden');\r\n player.x = 350;\r\n player.y = 430;\r\n resetGame();\r\n };\r\n}","function playAgain(){\r\n modal.classList.remove(\"show\");\r\n buildDeck();\r\n}","function checkWinningPlayer(player){\n if(player.score === 3){\n document.getElementById('main-content').style.display = 'none'\n let gameOverModal = document.getElementById('gameOverModal')\n gameOverModal.style.display = 'block'\n document.getElementById('winner-container').innerText = `${player.name} won the game!`\n document.getElementById('restart-button').addEventListener('click', restartGame)\n return true\n }\n return false\n}","modalShow() {\n\t\tlet modal = document.getElementById(\"myModal\");\n\t\tlet restartBtn = document.getElementsByClassName(\"close\")[0];\n\n\t\tthis.scene.pause(); // pause timer & game When colliding with a bomb\n\t\tmodal.style.display = \"block\"; // show modal\n\n\t\trestartBtn.addEventListener(\"click\", (e) => {\n\t\t\te.preventDefault();\n\t\t\tmodal.style.display = \"none\"; // hide modal on clicking 'RESTART' button\n\n\t\t\t// restart after clicking 'restart' - clear all events & set game in initial point\n\t\t\tthis.restartGame();\n\t\t});\n\t}","function makeDecision() {\n //set up modal\n $(\"#modalLine1\").removeClass('redAlert')\n $(\"#loader\").removeClass(\"active\")\n $(\"#modalBtn\").text(\"Play Again\")\n $(\"#modalBtn\").removeClass('quit')\n $(\"#modalBtn\").addClass('playA')\n\n //if you are player one\n if (whoAreYou === 'Player1') {\n\n //call whoWon function to determine winner,\n //change text to you won, you lost, or you tied\n if (whoWon(p1, p2) === 'p1') {\n $(\"#modalTop\").text(\"You won!\")\n }\n if (whoWon(p1, p2) === 'p2') {\n $(\"#modalTop\").text(\"You lost!\")\n }\n if (whoWon(p1, p2) === 'Tied') {\n $(\"#modalTop\").text(\"You tied!\")\n }\n $(\"#modalLine1\").text('You choose ' + p1)\n $(\"#modalLine2\").text('Your opponent choose ' + p2)\n callModal()\n }\n\n //if you are player 2\n if (whoAreYou === 'Player2') {\n\n //call whoWon function to determine winner,\n //change text to you won, you lost, or you tied\n if (whoWon(p1, p2) === 'p1') {\n $(\"#modalTop\").text(\"You lost!\")\n }\n if (whoWon(p1, p2) === 'p2') {\n $(\"#modalTop\").text(\"You won!\")\n }\n if (whoWon(p1, p2) === 'Tied') {\n $(\"#modalTop\").text(\"You tied!\")\n }\n $(\"#modalLine1\").text('You choose ' + p2)\n $(\"#modalLine2\").text('Your opponent choose ' + p1)\n callModal()\n }\n //wait one second and call reset function\n setTimeout(reset, 1000)\n}","function gameIsOver() {\n \n // Append the message in the modal dialog respectively\n if(player1 > player2)\n {\n $(\"#winner\").text(\"Winner!!Player1 catched more Pokemons\");\n }\n if(player2 > player1){\n $(\"#winner\").text(\"Winner!!Player2 catched more Pokemons\");\n }\n if(player1 === player2)\n {\n $(\"#winner\").text(\"Both players catched equal Pokemons\");\n }\n // show modal dialog \n $(\"#myModal\").modal('show');\n\n}","function closeWinModalAndReset() {\n $(document).click(function(event) {\n if ($(event.target).hasClass(\"resetGame\")) {\n if (!$(\".lockedLevelModal\").hasClass(\"showModal\")) {\n closeModal();\n changeMusic();\n resetGame(); \n }\n }\n });\n}","function winGame() {\n if(matchedCards.length === 8) {\n swal({\n closeOnClickOutside: false,\n closeOnEsc: false,\n title: \"You win!\",\n text: \"You matched all 8 pairs in \" + seconds + \" seconds, \" + moveCount + \" moves, and with \" + starResult + \" stars remaining.\",\n icon: \"success\",\n button: \"Play again!\"\n }).then(function(isConfirm) {\n if (isConfirm) {\n $('.deck, .moves').empty();\n reset();\n }\n });\n clearInterval(countSeconds);\n }\n}","function endGameModal() {\n $('#endGameModal').modal(\"show\");\n\n}","function gameOver() {\n if (gameState == \"win\") {\n console.log(\"You win!!\");\n $(\"#gameOverDialog\").dialog(\"open\");\n $(\"#gameOverDialog\").text(\"You win. You successfully avoided too much harmful content.\");\n } else if (gameState == \"lose\") {\n console.log(\"You lose!!\");\n $(\"#gameOverDialog\").dialog(\"open\");\n $(\"#gameOverDialog\").text(\"You lose. You were unable to avoid harmful content.\");\n }\n}","function won() {\n stopTimer();\n let rating = document.getElementById(\"stars\").innerHTML;\n let ratingModal = document.getElementById(\"stars-modal\");\n ratingModal.innerHTML = rating;\n let time = document.getElementById(\"timerLabel\").textContent;\n let timeModal = document.getElementById(\"time-modal\");\n timeModal.textContent = \"Time: \" + time;\n // I can break it to min sec and ms later\n modal.style.display = \"block\";\n\n let replay = document.getElementById('replay');\n\n replay.addEventListener('click', function() {\n modal.style.display = \"none\";\n restartGame();\n });\n\n // When the user clicks on <span> (x), close the modal\n closeModal.onclick = function() {\n modal.style.display = \"none\";\n }\n\n // When the user clicks anywhere outside of the modal, close it\n window.onclick = function(event) {\n if (event.target == modal) {\n modal.style.display = \"none\";\n }\n }\n\n }","function winOrLose(winCounter, lives) {\n if (winCounter == randomWord.length) {\n $('.theWord').text(randomWord.toUpperCase());\n $('#winModal').modal('show');\n gamesWon++;\n $('#smart')[0].play();\n newGame();\n } else if (lives === 0) {\n $('.theWord').text(randomWord.toUpperCase());\n $('#doh')[0].play();\n $('#loseModal').modal('show');\n newGame();\n }\n}","function modalShow(){\n let modal = document.querySelector(\".modal\");\n modal.classList.add(\"modalShow\");\n //set the moves\n let endMoves = document.querySelector(\".endMoves\"); \n endMoves.textContent = turnCounter;\n //set the timer\n paused = true;\n let endTime= document.querySelector(\".endTime\"); \n endTime.textContent = time;\n //display the final star rating\n const two = document.querySelector(\".endTwo\");\n const three = document.querySelector(\".endThree\");\n //display the star rating in the modal\n if(turnCounter >= 20){\n two.classList.add(\"hidden\");\n three.classList.add(\"hidden\");\n }else if(turnCounter > 13 && turnCounter <20){\n three.classList.add(\"hidden\");\n }\n //make the reset button do actually reset the application\n let button = document.querySelector(\".button\");\n button.addEventListener(\"click\",resetClicked);\n}","function winner() {\n\twinPage.classList.remove('hidden');\n\twinPage.style.display = 'block';\n\tgamePage.classList.add('hidden');\n\tplayAgainBtn.classList.remove('hidden');\n\tclearInterval(setTimer);\n}","function endgame(){\n $('#guess-box').prop('disabled', true)\n $('span.element').show();\n $('#element-list').show();\n $('.cell').not('.success').addClass('fail').removeClass('s d p f');\n }","win() {\n modal.style.display = 'block';\n playAgainButton.focus();\n this.clear();\n }","function result () {\n gameWindow.classList.add('hide')\n welcomeWindow.classList.add('hide')\n scoreWindow.classList.remove('hide')\n getScore()\n}","function finishGame(isVictory) {\n if (isVictory) {\n highestScore(gLevel.type, gGame.secsPassed);\n renderSmiley(true);\n winningAudio.play();\n // alert('You Win!');\n openModal('You Won!');\n gGame.isOn = false;\n } else {\n gGame.isOn = false;\n losingAudio.play();\n openModal('You Lost :(');\n revealMines();\n }\n clearInterval(gTimerInterval);\n}","function closeModal() {\n modal.classList.remove(\"show\");\n restartGame();\n}","function finishedGame() {\n timer.pause();\n let pText = document.querySelector(\"#resultFinished\");\n let iStars = parseInt(countStars);\n let middle = countStars > iStars ? 'and a half' : '';\n pText.innerHTML = `You won with ${countMoves} moves and ${iStars} ${middle} stars in ${timer.getTimeValues().toString()}.`;\n $('#myModal').modal();\n}","function continueGame() {\n game.updateDisplay();\n if (game.getState() == \"playing\") {\n $(\"#startButton\").toggleClass(\"hidden\");\n } else {\n $(\"#resetButton\").toggleClass(\"hidden\");\n }\n saveGame();\n}","function checkEndGame() {\r\n if (cardMatches == 8) {\r\n console.log(\"gameEnd\");\r\n // stop the clock\r\n clearInterval(ticking);\r\n // open end game modal\r\n openModal();\r\n }\r\n}","function winnerResult() {\n if (gameScoreWon === 3 || gameScoreLost === 3) {\n document.getElementById('games-won').style.display = \"none\";\n document.getElementById('game-con').style.display = \"none\";\n document.getElementById('final-result').style.display = \"block\";\n document.getElementById('rules-btn').disabled = true;\n document.getElementById('play').disabled = true;\n \n }\n if (gameScoreWon === 3) {\n document.getElementById('winner').style.display = \"block\";\n document.getElementById('loser').style.display = \"none\";\n document.getElementById('result-msg').innerText = \"Awesome - You won the Game!\";\n } else if (gameScoreLost === 3) {\n document.getElementById('loser').style.display = \"block\";\n document.getElementById('winner').style.display = \"none\";\n document.getElementById('result-msg').innerText = \"Better luck next time!\";\n }\n}","function gameOver() {\n // Clear the interval\n clearInterval(info.timeout);\n // Display the modal\n divs.modal_div.style.display = \"block\";\n // Update the final score element\n divs.final_score.innerText = \"Your final score is: \" + info.score;\n}","function winner() {\n winnerPrompt.classList.remove('hidden-winner');\n resetPlayAgain.classList.remove('hidden');\n hide1.classList.add('hide-all');\n hide2.classList.add('hide-all');\n resetSpan.textContent = 'Play Again?';\n }","function openModal() {\npaused = true;\nmyModal.style.display = 'block';\nendScore.innerHTML = score;\ndocument.getElementsByClassName('play-again')[0].addEventListener('click', reset);\ndocument.getElementsByClassName('quit')[0].addEventListener('click', clearModal);\n}","function openModal() {\n modal.style.display = \"block\";\n passTheScore();\n}","checkForGameEnd() {\n const { numberOfLockedCards, shuffledCards } = this.state;\n if(numberOfLockedCards === shuffledCards.length) {\n // Show modal and hide the main content\n this.setState({\n modalVisible: true,\n timer: clearInterval(this.state.timer)\n });\n }\n }","function celebration(){\n\t // if all cards = is solved then display (animation? and final photo) \n\t //in raw html/css first so image is on the page display none in css\n\t //show it with a slow fade in\n\t $(\"#group-silly\").fadeIn(\"slow\");\n\t // stop timer using variable \n\t clearTimeout(myVar);\n\t $(\".start-button\").html(\"Play Again\");\n\t $(\".start-button\").click(restartGame);\n\t // call restartGame function\n}","function gameWin(player){\n var playerColor = player.toUpperCase();\n $(\"#winMsg\").html(playerColor + \" WINS!!!\");\n $(\"#winModal\").modal(\"show\");\n if(player == \"red\"){\n redWins++;\n $(\".redWins\").html(redWins);\n turn = \"red\";\n }else{\n blackWins++;\n $(\".blackWins\").html(blackWins);\n turn = \"black\";\n }\n }","function toggleScoreModal() {\n stopTimer();\n finalScore();\n let modal = document.querySelector('#score-modal');\n modal.classList.toggle('modal-hide');\n}","async win (){\n if(this.state.turn){\n await this.setState({winner: this.state.player1Name});\n this.updateMineFieldChange();\n //Alert who has won and suggestion of restarting the game\n if(window.confirm(this.state.player1Name + ' has won the game, do you wish to restart it?')){\n }\n }\n else{\n await this.setState({winner: this.state.player2Name});\n this.updateMineFieldChange();\n //Alert who has won and suggestion of restarting the game\n if(window.confirm(this.state.player2Name + ' has won the game, do you wish to restart it?')){\n }\n }\n return;\n }","function win () { \n style = { font: \"65px Arial\", fill: \"#fff\", align: \"center\" };\n game.add.text(game.camera.x+325, game.camera.y+150, \"You Win!\", style);\n button = game.add.button(game.camera.x+275, game.camera.y+250, 'reset-button', actionOnResetClick, this);\n button = game.add.button(game.camera.x+475, game.camera.y+250, 'contact-button', actionOnContactClick, this); \n // The following lines kill the players movement before disabling keyboard inputs\n player.body.velocity.x = 0;\n setTimeout(game.input.keyboard.disabled = true, 1000); \n // Plays the victory song \n victory.play('');\n // When the Reset button is clicked, it calls this function, which in turn calls the game to be reloaded.\n // Here we display the contact and replay button options, calling either respective function\n function actionOnResetClick () {\n gameRestart();\n }\n\n // When the contact button is clicked it redirects through to contact form\n function actionOnContactClick () {\n\n window.location = (\"/contacts/\" + lastName)\n \n } \n }","function endGame(status) {\n let // Select Popuo Element\n popup = document.querySelector(\".popup\"),\n // Select Player Status Element\n playerStatus = popup.querySelector(\".player-status\"),\n // Select Player Status Span\n playerStatusSpan = playerStatus.querySelector(\"span\"),\n // Select Wrong Attempts Span\n wrongAttemptsSpan = popup.querySelector(\".wrong-attempts span\"),\n // Select Play Again Button\n playAgainBtn = popup.querySelector(\".play-again\");\n\n // Show Popup Element\n popup.style.display = \"block\";\n\n // Set Player Status [Win Or Fail]\n playerStatusSpan.textContent = status;\n\n // Set Wrong Attempts Number\n wrongAttemptsSpan.textContent = wrongAttempts;\n\n // Check If The Player [Win Or Fail]\n if (status === \"Win\") {\n playerStatus.classList.add(\"win\");\n\n if (playerStatus.classList.contains(\"fail\")) {\n playerStatus.classList.remove(\"fail\");\n }\n } else {\n playerStatus.classList.add(\"fail\");\n\n if (playerStatus.classList.contains(\"win\")) {\n playerStatus.classList.remove(\"win\");\n }\n }\n\n // Play Again\n playAgainBtn.onclick = function () {\n // Hid Popup Element\n popup.style.display = \"none\";\n\n // Reset [wrongAttempts] & [rightChoose] Value\n wrongAttempts = 0;\n rightChoose = 0;\n\n // Empty Letters Container\n lettersContainer.innerHTML = \"\";\n\n // Remove Finished Class From Letters Container\n if (lettersContainer.classList.contains(\"finished\")) {\n lettersContainer.classList.remove(\"finished\");\n }\n\n // Trigger Generate Letters Function\n generateLetters();\n\n // Trigger Get Word Functuin\n getWord();\n\n // Empty Letters Guess Contianer\n lettersGuessContainer.innerHTML = \"\";\n\n // Trigger Guess Function\n guess();\n\n // Remove Wrong Class From Hangman Draw\n for (let i = 1; i <= 8; i++) {\n if (theDraw.classList.contains(`wrong-${i}`)) {\n theDraw.classList.remove(`wrong-${i}`);\n }\n }\n\n gameMacanism();\n };\n}","function gameOver() {\n $('#winnerText').text(`Your final score is ${score}`);\n $('#winnerModal').modal('toggle');\n}","function finish(){\n\n // sound-effect\n playIncorrect()\n // Disable buttons, because we don't need them.\n elements.correctButton.disabled = true\n elements.incorrectButton.disabled = true\n window.setTimeout(displayGameOver,1500)\n}","function gameWon() {\n //This element will hide the game section\n document.getElementById('main').style.display = 'none';\n\n //This element will hide the victory-screen section.\n document.getElementById('victory-screen').style.display = 'flex';\n\n //Setting the event listener for the play again button.\n document.getElementById('play-again-button').addEventListener('click', resetGame);\n}","function win() {\n if (squares[4].classList.contains('man')) {\n result.innerHTML = 'I am Inevitable 😍'\n squares[index].classList.remove('man')\n clearInterval(timerId)\n document.removeEventListener('keyup', moveman)\n }\n }","function isFinished(){\n if(counter === 10){\n counter = 0;\n result.textContent = \"Play again!\";\n result.className = \"\";\n reset = true;\n showConclusionModal();\n }\n}","function checkWin() {\n\tif (towerC.childElementCount === 3) {\n\t\tmodal.style.display = 'inline';\n\t\tplayerMessage.innerHTML = '';\n\t\tmodalContent.innerHTML = 'YOU WON!!!! LFG';\n\t\tclearInterval(countUp); //stops the timer.\n\t}\n}","function closeModal() {\n close.click(function(e) {\n gameEnd.removeClass('show');\n start();\n });\n}","function endOfGame() {\n\n if (matchFound === 8) {\n window.clearInterval(timer);\n var modal = document.getElementById('message');\n var span = document.getElementsByClassName(\"close\")[0];\n\n $(\"#total-moves\").text(moves);\n $(\"#total-stars\").text(starNumber);\n\n modal.style.display = \"block\";\n\n\n span.onclick = function() {\n modal.style.display = \"none\";\n };\n // Play again button\n $(\"#play-again-btn\").on(\"click\", function() {\n location.reload()\n });\n\n clearInterval(timer);\n }\n}","function gameOverPopup(){\n var modalGameOver = document.getElementById('modalGameOver');\n var rePlay = document.getElementById(\"replayBtn\");\n var img = document.querySelectorAll(\"img\")[0];\n\n modalGameOver.style.display = \"block\";\n $(\"#score\").html(\"Final score: \" + finalScore);\n // When the user clicks button replay, close it\n rePlay.onclick = function() {\n window.location.assign(\"../start.html\");\n }\n }"],"string":"[\n \"function winGame() {\\n stopTimer();\\n toggleModal();\\n}\",\n \"function continueGame() {\\n // clear modal\\n $(\\\".modal\\\").removeClass(\\\"bg-modal\\\");\\n $(\\\".modal-inner\\\").removeClass(\\\"modal-content\\\").html(\\\"\\\");\\n // has endgame condition been reached\\n if (selectedGlyphs.length === numQuestionsPerGame) {\\n endCondition_gameOver();\\n } else {\\n selectGlyph();\\n }\\n }\",\n \"function wonGame(){\\n stopClock();\\n modalData();\\n $('.modal_background').removeClass('hide');\\n}\",\n \"function gameWonMessage() {\\n $('.play-again').click(gameStart);\\n $('#gameWon').modal(\\\"show\\\");\\n}\",\n \"checkIfWon() {\\n let func = () => {\\n this.reset();\\n }\\n if (this.y < 0) {\\n this.gameWon = true;\\n document.querySelector('.modal').style.display = 'block';\\n document.querySelector('.modal-wnd').style.display = 'block';\\n document.getElementById('replay-btn').addEventListener('click', function() {\\n document.querySelector('.modal').style.display = 'none';\\n document.querySelector('.modal-wnd').style.display = 'none';\\n func();\\n });\\n }\\n }\",\n \"function restartGameFromModal() {\\n modal.style.display = \\\"none\\\";\\n newGame();\\n}\",\n \"function gameStatus() {\\n\\tpairsToGuess--;\\n\\tif (pairsToGuess == 0) {\\n\\t\\ttoStopWatch(); //stop the stopwatch\\n\\t\\tsetTimeout(function() { //display result popup\\n\\t\\t\\tdisplayResult(); //to put results to the modal\\n \\t\\tmodalResult(); // to show modal with results\\n \\t\\t}, 500); \\n\\t} else {\\n\\t\\t\\n\\t}\\n}\",\n \"function triggerModal () {\\n modal.style.display = 'block';\\n\\n if (turn !== 1) {\\n winner.innerHTML = 'Player 1 Wins!';\\n console.log ('Player 1 Wins!');\\n }\\n if (turn === 1) {\\n winner.innerHTML = 'Player 2 Wins!';\\n console.log ('Player 2 Wins!');\\n }\\n }\",\n \"function endGame() {\\n stopMusic();\\n win.play();\\n modal.style.display = \\\"block\\\";\\n modalContent.innerHTML = `<h1 class=\\\"centered\\\">Congratulation!</h1><h3 class=\\\"centered\\\">You have completed the game!</h3><h3 class=\\\"centered\\\">Points scored: ${player.score}</h3><h3 class=\\\"centered\\\">Lives saved: ${player.lives}</h3><h3 class=\\\"centered\\\">Final Score: ${player.score*player.lives}</h3><button class=\\\"restart button centered\\\">RESTART!</button>`;\\n}\",\n \"function gameDraw(){\\n $(\\\"#winMsg\\\").html(\\\"Game is a draw!! Play Again!\\\");\\n $(\\\"#winModal\\\").modal(\\\"show\\\");\\n }\",\n \"function checkStatus() {\\n if (matchPairCounter == 8) {\\n timer.timer('pause');\\n $('#totalscore').text(`You finished the game in ${timer.data('seconds')} seconds with ${movesCounter} moves and ${starsCounter} star(s)`);\\n $('#myModal').modal({backdrop: 'static', keyboard: false});\\n \\n }\\n}\",\n \"function continueGame() {\\n\\tGAME_COMPLETE = false;\\n\\tGAME_OVER = false;\\n\\tGAME_CONTINUE = true;\\n\\t$('#winner').hide();\\n}\",\n \"function checkForWin() {\\n if (score > score2){\\n $('#player1WinModal').show();\\n $('#player1WinModalClose').click(function(){\\n $('#player1WinModal').hide();\\n });\\n } else if (score < score2){\\n $('#player2WinModal').show();\\n $('#player2WinModalClose').click(function(){\\n $('#player2WinModal').hide();\\n });\\n } else if (score = score2) {\\n $('#drawModal').show();\\n $('#drawModalClose').click(function(){\\n $('#drawModal').hide();\\n });\\n }\\n }\",\n \"function winGame() {\\n if (matched.length === 8) { \\n stopTimer();\\n toggleModal();\\n } \\n}\",\n \"checkIfWin() {\\n if (this.score === 10) {\\n this.started = false;\\n allEnemies = [];\\n showWinModal();\\n }\\n }\",\n \"function showGameResult () {\\n if ($( \\\".flippable\\\" ).length === 2 && $('.show').length === 12) { // we pop up a winner modal\\n $('.modal-body').html(\\n `\\n <div class=\\\"score-item\\\">Your Time: ${$('.Timer').text()}</div>\\n <div class=\\\"score-item\\\">Your Score: ${$('.stars').html()}<div>\\n `\\n );\\n $('#endGameModalLabel').text('You Win!');\\n $('#endGameModal').modal('show');\\n clearInterval(timer);\\n resetBoard();\\n } else if (moves === 0) { // else we pop up a loser modal\\n $('.modal-body').html(\\n `\\n <div class=\\\"score-item\\\">Your Time: ${$('.Timer').text()}</div>\\n `\\n );\\n $('#endGameModalLabel').text('You Lose!');\\n $('#endGameModal').modal('show');\\n clearInterval(timer);\\n resetBoard();\\n } else { // not the end of the game!\\n return;\\n }\\n}\",\n \"function endGame() {\\n\\t$(\\\"#lossModal\\\").modal({backdrop: 'static', keyboard: false});\\n\\t$(\\\"#lossModal\\\").modal('show');\\n\\t$(\\\"#name-loss\\\").text(playerName);\\n\\t$(\\\"#poke-number-caught\\\").text(winCount);\\n\\t$(\\\"#score-span\\\").text(score);\\n}\",\n \"function gameOver() {\\n stopMusic();\\n loose.play();\\n modal.style.display = \\\"block\\\";\\n modalContent.innerHTML = `<h1 class=\\\"centered\\\">Game Over!</h1><h3 class=\\\"centered\\\">You have lost all lives and collected ${player.score} points!</h3><button class=\\\"restart button centered\\\">RESTART!</button>`;\\n}\",\n \"function checkWin() {\\n\\t\\tif (pairsRemain === 0) {\\n\\t\\t\\t\\ttimerOff();\\n\\t\\t\\t\\topenModal();\\n\\t\\t};\\n}\",\n \"function winOrLose (result) {\\n const overlayTitle = document.querySelector('.title');\\n const startButton = document.querySelector('.btn__reset');\\n\\n overlay.style.display = '';\\n overlay.className = result;\\n overlayTitle.innerHTML = `you ${result} the game`;\\n startButton.innerHTML = 'Start New Game'\\n\\n // Reset the game after win or lose\\n resetGame();\\n}\",\n \"function gameOver() {\\n stopClock();\\n writeModalStats();\\n toggleModal();\\n}\",\n \"function modalStart(e) {\\n e.preventDefault();\\n document.querySelector('p.numbers span').textContent = game.numbers = 0;\\n document.querySelector('p.wins span').textContent = game.wins = 0;\\n document.querySelector('p.losses span').textContent = game.losses = 0;\\n document.querySelector('p.draws span').textContent = game.draws = 0;\\n document.querySelector('[data-summary=\\\"who-win\\\"]').textContent = '';\\n document.querySelector('[data-summary=\\\"your-choice\\\"]').textContent = '';\\n document.querySelector('[data-summary=\\\"ai-choice\\\"]').textContent = '';\\n if (!isNaN(params.playerName = document.querySelector('input[name=\\\"firstname\\\"]').value)){\\n return alert('You Have To Give Your Name!!!')\\n };\\n params.numberRounds = document.querySelector('input[name=\\\"rounds\\\"]').value;\\n infoRounds.innerHTML = `${params.numberRounds} Rounds to the End of the Game`\\n params.play = true;\\n document.querySelector('#modal-overlay').classList.remove('show');\\n choice.innerHTML = params.playerName.toUpperCase();\\n}\",\n \"function winGame() {\\n if (matchList === 8) {\\n pause();\\n openModal();\\n timerModal.innerText = `Final time is: ${min}:${zeroPlaceholder}${second}`;\\n playTimer.style.display = 'none';\\n gameStarted = false;\\n }\\n if (moves < 20 && moves > 12) {\\n starCount[5].style.display = 'none';\\n } else if (moves > 20) {\\n starCount[4].style.display = 'none';\\n }\\n countModal.innerHTML = moves;\\n}\",\n \"function gameWon() {\\n modal();\\n const playAgain = document.querySelector('.button');\\n playAgain.addEventListener('click', function() {\\n restart();\\n const modal = document.getElementById('endGame');\\n modal.classList.remove('appear');\\n \\n }); \\n \\n}\",\n \"function win() {\\n if (cardList.length === liMatch.length) {\\n stopTimer();\\n displayModal();\\n }\\n}\",\n \"function replayGame() {\\n resetGame();\\n toggleModal();\\n}\",\n \"function replayGame() {\\n resetGame();\\n toggleModal();\\n}\",\n \"function winOrLoseScreen(){\\n if (!win){\\n GameOverGraphic()\\n BGM.pause()\\n } else {\\n youWinGraphic()\\n BGM.pause()\\n }\\n }\",\n \"function winner(){\\n gameMode = false;\\n $('.pop-up').html(curPlayer + \\\" is victorious! <br><br> Press 'New Game' to play again\\\");\\n $('.pop-up').css(\\\"visibility\\\", \\\"visible\\\");\\n}\",\n \"function victoryModal(typeOfVictory) {\\r\\n if (typeOfVictory === \\\"draw\\\") {\\r\\n $(\\\"#game\\\").css(\\\"display\\\", \\\"none\\\");\\r\\n $(\\\"#draw\\\").css(\\\"display\\\", \\\"block\\\");\\r\\n let counter = 5;\\r\\n let int3 = setInterval(() => {\\r\\n if (counter === 1) {\\r\\n\\r\\n $(\\\"#draw\\\").fadeOut(\\\"slow\\\", () => {\\r\\n $(\\\"#modal\\\").css(\\\"display\\\", \\\"block\\\");\\r\\n $(\\\"#draw\\\").css(\\\"display\\\", \\\"none\\\");\\r\\n });\\r\\n }\\r\\n else if (counter === 0) {\\r\\n clearInterval(int3);\\r\\n }\\r\\n $(\\\"#countdown\\\").text(counter);\\r\\n counter--;\\r\\n }, 1000);\\r\\n }\\r\\n else if (typeOfVictory === \\\"win\\\") {\\r\\n $(\\\"#displayWinner\\\").text(\\\"Winner is: \\\" + winner);\\r\\n $(\\\"#currentPlayer\\\").css(\\\"display\\\", \\\"none\\\");\\r\\n $(\\\"#game\\\").css(\\\"margin-top\\\", \\\"35px\\\");\\r\\n\\r\\n let counter = 5;\\r\\n let int4 = setInterval(() => {\\r\\n if (counter === 1) {\\r\\n $(\\\"#game\\\").fadeOut(\\\"slow\\\", () => {\\r\\n $(\\\"#modal\\\").css(\\\"display\\\", \\\"block\\\");\\r\\n $(\\\"#game\\\").css(\\\"display\\\", \\\"none\\\");\\r\\n });\\r\\n }\\r\\n else if (counter === 0) {\\r\\n clearInterval(int4);\\r\\n }\\r\\n $(\\\"#restartCounter\\\").css(\\\"display\\\", \\\"block\\\");\\r\\n $(\\\"#restartCounter\\\").text(\\\"Restarting in : \\\" + counter);\\r\\n counter--;\\r\\n }, 1000);\\r\\n }\\r\\n }\",\n \"function playAgain() {\\n modal.classList.remove(\\\"show\\\");\\n restartGame();\\n}\",\n \"restartGame() {\\n score=5;\\n $('#restart-button').on('click', () => {\\n $('.modal').hide();\\n $('.game-container').css('display', 'block');\\n $('.mushroom-container').css('display', 'block');\\n setUpRound();\\n $('#restart-button').off();\\n });\\n }\",\n \"function endScreen(){\\n toggleModalOn();\\n var newGameSelector = document.getElementById('modal-new-game');\\n var modalCancel = document.getElementById('modal-cancel');\\n \\n newGameSelector.addEventListener('click', event=>{\\n toggleModalOff();\\n newGame();\\n })\\n \\n modalCancel.addEventListener('click', event =>{\\n toggleModalOff();\\n })\\n \\n}\",\n \"function youWon() {\\n //stop the timer\\n clearInterval(interval);\\n //elaborate the score\\n score();\\n const modal = document.querySelector('.modal');\\n //show the score\\n modal.style.display = 'block';\\n tryAgain.addEventListener('click', function () {\\n restart();\\n modal.style.display = 'none';\\n });\\n}\",\n \"function playAgain(){\\n modal.classList.remove(\\\"show\\\");\\n resetGame();\\n}\",\n \"function UserContinue() {\\n //close window\\n Modal.closeLevelCompleteWindow();\\n //exit current level\\n continueGame();\\n}\",\n \"function showModal(){\\n gamePaused=true;\\n let container=$QS('.gameDisplayDiv');\\n let modal=$CESC('div', 'msg-modal');\\n \\n let h2=$CESC('h2', 'modal-heading');\\n h2.innerText='pause';\\n //continue game , restart, quit game\\n let continueBtn=$CESC('button', 'modal-btn continue-btn');\\n continueBtn.innerText='continue game';\\n continueBtn.onclick=continueGame;\\n\\n let resetBtn=$CESC('button', 'modal-btn reset-btn');\\n resetBtn.innerText='Restart';\\n resetBtn.onclick=resetGame;\\n\\n let quitBtn=$CESC('button', 'modal-btn quit-btn');\\n quitBtn.innerText='quit btn';\\n quitBtn.onclick=goToHomePage;\\n \\n $ACP(modal, h2);\\n $ACP(modal, continueBtn);\\n $ACP(modal, resetBtn);\\n $ACP(modal, quitBtn);\\n\\n $ACP(container, modal);\\n}\",\n \"showGameWonModal() {\\n let modalView = document.getElementById(\\\"modal-container-view\\\");\\n let modalCloseBtn = document.getElementById(\\\"modal-close-btn\\\");\\n modalView.style.display = \\\"flex\\\";\\n\\n // Allows user to dimiss the modal message\\n modalCloseBtn.onclick = function () {\\n modalView.style.display = \\\"none\\\";\\n }\\n\\n // When the user clicks anywhere outside of the modal, close it\\n window.onclick = function (event) {\\n if (event.target == modalView) {\\n modalView.style.display = \\\"none\\\";\\n }\\n }\\n console.log(\\\"game won!\\\");\\n }\",\n \"function continueGame(){\\n removeModal();\\n\\n if(stopGame){\\n addCirclesToHoverBar();\\n //clearing all dots of game board\\n clearGameBoard();\\n clearMessageBoard(); \\n changeMessageBoardBG(\\\"none\\\"); \\n stopGame=false;\\n count=30;\\n startGame();\\n }\\n\\n if(gamePaused){\\n gamePaused=false;\\n playGame();\\n }\\n}\",\n \"toggleDialog() {\\n document.getElementById('gameOver').classList.toggle('is-visible');\\n stopInterval();\\n }\",\n \"function gameOver() {\\n clearInterval(timer);\\n getTimeClock();\\n setTimeout(function () {\\n $(\\\"#winModal\\\").toggleClass(\\\"hidden animated bounceIn\\\");\\n }, 500);\\n }\",\n \"function gameOver() {\\n\\tstopClock();\\n\\twriteModalStats();\\n\\ttoggleModal();\\n}\",\n \"function displayWinner(name) {\\n const winnerModal = document.getElementById(\\\"winnerModal\\\");\\n const restartGame = document.getElementById(\\\"restartGame\\\");\\n document.getElementById('winner').innerHTML = name;\\n gameStarted = false;\\n winnerModal.style.display = \\\"block\\\";\\n restartGame.onclick = (e) => {\\n e.preventDefault();\\n player1.score = 0;\\n player2.score = 0;\\n newGame();\\n }\\n}\",\n \"function gameWinPopup(){\\n var modalGameWin = document.getElementById('modalGameWin');\\n var rePlay = document.getElementById(\\\"replayBtnWin\\\");\\n var img = document.querySelectorAll(\\\"img\\\")[0];\\n\\n modalGameWin.style.display = \\\"block\\\";\\n $(\\\"#scoreWin\\\").html(\\\"Final score: \\\" + finalScore);\\n // When the user clicks button replay, close it\\n rePlay.onclick = function() {\\n window.location.assign(\\\"../start.html\\\");\\n }\\n }\",\n \"function gameOver() {\\n stopTimer();\\n toggleModal();\\n writeModalStats();\\n}\",\n \"function replayGame() {\\n\\tresetGame();\\n\\ttoggleModal();\\n}\",\n \"function replayGame() {\\n\\tresetGame();\\n\\ttoggleModal();\\n}\",\n \"function showModal(modalForWin) {\\n var elModal = document.querySelector(\\\".modal\\\");\\n elModal.style.display = 'block'\\n var resString = (modalForWin) ? `Well Done ` : 'Try again..'\\n elModal.innerHTML = `${resString} <button onclick=\\\"init()\\\">Play again</button>`\\n}\",\n \"function nameModuleClose() {\\n winnerDeclared = document.querySelector('.declaredWinner');\\n pvpModal.style.cssText = \\\"display: none;\\\";\\n let numOne = first.value;\\n let numTwo = second.value;\\n firstPlayer.winner(numOne);\\n computer.winner(numTwo);\\n \\n // determines which parts of code run\\n GBModule.power('on');\\n firstPlayer.power('on');\\n computer.power('on');\\n AIGame.switch('off');\\n winnerDeclared.style.cssText = \\\"display: none;\\\";\\n\\n }\",\n \"function show_win(){\\n alert(' You Win !!');\\n game_end();\\n}\",\n \"function gameOver() {\\n\\tstopClock();\\n\\twriteModalStats();\\n\\ttoggleModal();\\n\\tmatched=0;\\n}\",\n \"function isGameOver() {\\n if (matchedCards.length === symbols.length) {\\n //stop timer\\n clearInterval(interval);\\n \\n //popup congratulation message\\n const modal = document.querySelector('.modal');\\n const playAgain = document.querySelector('.play-again');\\n modal.style.display = \\\"block\\\";\\n playAgain.addEventListener(\\\"click\\\", function() {\\n modal.style.display = \\\"none\\\";\\n\\n //call restartGame function\\n restartGame();\\n }); \\n }\\n}\",\n \"function checkWin() {\\n if (matchFound === 8) {\\n $(\\\"#runner\\\").css(\\\"display\\\",\\\"none\\\")\\n $(\\\".win-modal\\\").css(\\\"display\\\",\\\"block\\\");\\n $(\\\".win-modal .stars\\\").text(stars);\\n $(\\\".win-modal .moves\\\").text(moves);\\n $(\\\".win-modal .runner\\\").text(minute + \\\":\\\" + second);\\n }\\n }\",\n \"function winCheck() {\\n\\tif(matches === 8){\\n\\t\\ttimerEnd();\\n\\t\\taddRating(moves);\\n\\t\\tpopUpModal();\\n\\t\\tpopUp.classList.remove('display-none');\\n\\t}\\n}\",\n \"function showEndModal(showType) {\\n // CREDIT - Code for showing modal was taken from W3 Schools and adapted to fit this project\\n let modal = document.getElementsByClassName(\\\"end-modal-background\\\")[0];\\n let closeSpan = document.getElementsByClassName(\\\"end-close\\\")[0];\\n modal.style.display = \\\"flex\\\";\\n\\n closeSpan.onclick = function() {\\n modal.style.display = \\\"none\\\";\\n\\n if (showType === \\\"end\\\") {\\n endGame();\\n }\\n };\\n\\n window.onclick = function(event) {\\n if (event.target === modal) {\\n modal.style.display = \\\"none\\\";\\n\\n if (showType === \\\"end\\\") {\\n endGame();\\n }\\n }\\n };\\n\\n if (showType === \\\"quit\\\") {\\n document.getElementsByClassName(\\\"end-game\\\")[0].style.display = \\\"none\\\";\\n document.getElementsByClassName(\\\"quit-game\\\")[0].style.display = \\\"block\\\";\\n } else if (showType === \\\"end\\\") {\\n document.getElementsByClassName(\\\"quit-game\\\")[0].style.display = \\\"none\\\";\\n document.getElementsByClassName(\\\"end-game\\\")[0].style.display = \\\"block\\\";\\n\\n if (previousWinner === \\\"player\\\") {\\n document.getElementById(\\\"end-lose\\\").style.display = \\\"none\\\";\\n document.getElementById(\\\"end-win\\\").style.display = \\\"block\\\";\\n let endScore = document.getElementById(\\\"end-score-win\\\");\\n endScore.textContent = `${playerScore.textContent} - ${computerScore.textContent}`;\\n } else if (previousWinner === \\\"computer\\\") {\\n document.getElementById(\\\"end-win\\\").style.display = \\\"none\\\";\\n document.getElementById(\\\"end-lose\\\").style.display = \\\"block\\\";\\n let endScore = document.getElementById(\\\"end-score-lose\\\");\\n endScore.textContent = `${playerScore.textContent} - ${computerScore.textContent}`;\\n }\\n }\\n}\",\n \"function findWinner() {\\n \\n if (matchFound === 8) {\\n timer.pause();\\n\\n var modal = document.getElementById(\\\"winner-popup\\\");\\n var span = document.getElementsByClassName(\\\"close\\\")[0];\\n\\n $(\\\"#total-moves\\\").text(moves);\\n $(\\\"#total-stars\\\").text(starRating);\\n $(\\\".minutes\\\").text(timer.getTimeValues().minutes);\\n $(\\\".seconds\\\").text(timer.getTimeValues().seconds);\\n \\n modal.style.display = \\\"block\\\";\\n \\n // When the user clicks on <span> (x), close the modal\\n span.onclick = function() {\\n modal.style.display = \\\"none\\\";\\n }\\n\\n $(\\\"#play-again\\\").on(\\\"click\\\", function() {\\n location.reload()\\n });\\n \\n clearInterval(timer);\\n }\\n}\",\n \"function endGame() {\\n // console.log(matchNum);\\n starModalCount();\\n openModal();\\n}\",\n \"function lost(){\\r\\n let failureMessage = document.querySelector('.failure-message');\\r\\n modal.classList.remove('hidden');\\r\\n failureMessage.classList.remove('hidden');\\r\\n let againBtn = document.querySelector('.again');\\r\\n againBtn.onclick = function(){\\r\\n modal.classList.add('hidden');\\r\\n failureMessage.classList.add('hidden');\\r\\n player.x = 350;\\r\\n player.y = 430;\\r\\n resetGame();\\r\\n };\\r\\n}\",\n \"function playAgain(){\\r\\n modal.classList.remove(\\\"show\\\");\\r\\n buildDeck();\\r\\n}\",\n \"function checkWinningPlayer(player){\\n if(player.score === 3){\\n document.getElementById('main-content').style.display = 'none'\\n let gameOverModal = document.getElementById('gameOverModal')\\n gameOverModal.style.display = 'block'\\n document.getElementById('winner-container').innerText = `${player.name} won the game!`\\n document.getElementById('restart-button').addEventListener('click', restartGame)\\n return true\\n }\\n return false\\n}\",\n \"modalShow() {\\n\\t\\tlet modal = document.getElementById(\\\"myModal\\\");\\n\\t\\tlet restartBtn = document.getElementsByClassName(\\\"close\\\")[0];\\n\\n\\t\\tthis.scene.pause(); // pause timer & game When colliding with a bomb\\n\\t\\tmodal.style.display = \\\"block\\\"; // show modal\\n\\n\\t\\trestartBtn.addEventListener(\\\"click\\\", (e) => {\\n\\t\\t\\te.preventDefault();\\n\\t\\t\\tmodal.style.display = \\\"none\\\"; // hide modal on clicking 'RESTART' button\\n\\n\\t\\t\\t// restart after clicking 'restart' - clear all events & set game in initial point\\n\\t\\t\\tthis.restartGame();\\n\\t\\t});\\n\\t}\",\n \"function makeDecision() {\\n //set up modal\\n $(\\\"#modalLine1\\\").removeClass('redAlert')\\n $(\\\"#loader\\\").removeClass(\\\"active\\\")\\n $(\\\"#modalBtn\\\").text(\\\"Play Again\\\")\\n $(\\\"#modalBtn\\\").removeClass('quit')\\n $(\\\"#modalBtn\\\").addClass('playA')\\n\\n //if you are player one\\n if (whoAreYou === 'Player1') {\\n\\n //call whoWon function to determine winner,\\n //change text to you won, you lost, or you tied\\n if (whoWon(p1, p2) === 'p1') {\\n $(\\\"#modalTop\\\").text(\\\"You won!\\\")\\n }\\n if (whoWon(p1, p2) === 'p2') {\\n $(\\\"#modalTop\\\").text(\\\"You lost!\\\")\\n }\\n if (whoWon(p1, p2) === 'Tied') {\\n $(\\\"#modalTop\\\").text(\\\"You tied!\\\")\\n }\\n $(\\\"#modalLine1\\\").text('You choose ' + p1)\\n $(\\\"#modalLine2\\\").text('Your opponent choose ' + p2)\\n callModal()\\n }\\n\\n //if you are player 2\\n if (whoAreYou === 'Player2') {\\n\\n //call whoWon function to determine winner,\\n //change text to you won, you lost, or you tied\\n if (whoWon(p1, p2) === 'p1') {\\n $(\\\"#modalTop\\\").text(\\\"You lost!\\\")\\n }\\n if (whoWon(p1, p2) === 'p2') {\\n $(\\\"#modalTop\\\").text(\\\"You won!\\\")\\n }\\n if (whoWon(p1, p2) === 'Tied') {\\n $(\\\"#modalTop\\\").text(\\\"You tied!\\\")\\n }\\n $(\\\"#modalLine1\\\").text('You choose ' + p2)\\n $(\\\"#modalLine2\\\").text('Your opponent choose ' + p1)\\n callModal()\\n }\\n //wait one second and call reset function\\n setTimeout(reset, 1000)\\n}\",\n \"function gameIsOver() {\\n \\n // Append the message in the modal dialog respectively\\n if(player1 > player2)\\n {\\n $(\\\"#winner\\\").text(\\\"Winner!!Player1 catched more Pokemons\\\");\\n }\\n if(player2 > player1){\\n $(\\\"#winner\\\").text(\\\"Winner!!Player2 catched more Pokemons\\\");\\n }\\n if(player1 === player2)\\n {\\n $(\\\"#winner\\\").text(\\\"Both players catched equal Pokemons\\\");\\n }\\n // show modal dialog \\n $(\\\"#myModal\\\").modal('show');\\n\\n}\",\n \"function closeWinModalAndReset() {\\n $(document).click(function(event) {\\n if ($(event.target).hasClass(\\\"resetGame\\\")) {\\n if (!$(\\\".lockedLevelModal\\\").hasClass(\\\"showModal\\\")) {\\n closeModal();\\n changeMusic();\\n resetGame(); \\n }\\n }\\n });\\n}\",\n \"function winGame() {\\n if(matchedCards.length === 8) {\\n swal({\\n closeOnClickOutside: false,\\n closeOnEsc: false,\\n title: \\\"You win!\\\",\\n text: \\\"You matched all 8 pairs in \\\" + seconds + \\\" seconds, \\\" + moveCount + \\\" moves, and with \\\" + starResult + \\\" stars remaining.\\\",\\n icon: \\\"success\\\",\\n button: \\\"Play again!\\\"\\n }).then(function(isConfirm) {\\n if (isConfirm) {\\n $('.deck, .moves').empty();\\n reset();\\n }\\n });\\n clearInterval(countSeconds);\\n }\\n}\",\n \"function endGameModal() {\\n $('#endGameModal').modal(\\\"show\\\");\\n\\n}\",\n \"function gameOver() {\\n if (gameState == \\\"win\\\") {\\n console.log(\\\"You win!!\\\");\\n $(\\\"#gameOverDialog\\\").dialog(\\\"open\\\");\\n $(\\\"#gameOverDialog\\\").text(\\\"You win. You successfully avoided too much harmful content.\\\");\\n } else if (gameState == \\\"lose\\\") {\\n console.log(\\\"You lose!!\\\");\\n $(\\\"#gameOverDialog\\\").dialog(\\\"open\\\");\\n $(\\\"#gameOverDialog\\\").text(\\\"You lose. You were unable to avoid harmful content.\\\");\\n }\\n}\",\n \"function won() {\\n stopTimer();\\n let rating = document.getElementById(\\\"stars\\\").innerHTML;\\n let ratingModal = document.getElementById(\\\"stars-modal\\\");\\n ratingModal.innerHTML = rating;\\n let time = document.getElementById(\\\"timerLabel\\\").textContent;\\n let timeModal = document.getElementById(\\\"time-modal\\\");\\n timeModal.textContent = \\\"Time: \\\" + time;\\n // I can break it to min sec and ms later\\n modal.style.display = \\\"block\\\";\\n\\n let replay = document.getElementById('replay');\\n\\n replay.addEventListener('click', function() {\\n modal.style.display = \\\"none\\\";\\n restartGame();\\n });\\n\\n // When the user clicks on <span> (x), close the modal\\n closeModal.onclick = function() {\\n modal.style.display = \\\"none\\\";\\n }\\n\\n // When the user clicks anywhere outside of the modal, close it\\n window.onclick = function(event) {\\n if (event.target == modal) {\\n modal.style.display = \\\"none\\\";\\n }\\n }\\n\\n }\",\n \"function winOrLose(winCounter, lives) {\\n if (winCounter == randomWord.length) {\\n $('.theWord').text(randomWord.toUpperCase());\\n $('#winModal').modal('show');\\n gamesWon++;\\n $('#smart')[0].play();\\n newGame();\\n } else if (lives === 0) {\\n $('.theWord').text(randomWord.toUpperCase());\\n $('#doh')[0].play();\\n $('#loseModal').modal('show');\\n newGame();\\n }\\n}\",\n \"function modalShow(){\\n let modal = document.querySelector(\\\".modal\\\");\\n modal.classList.add(\\\"modalShow\\\");\\n //set the moves\\n let endMoves = document.querySelector(\\\".endMoves\\\"); \\n endMoves.textContent = turnCounter;\\n //set the timer\\n paused = true;\\n let endTime= document.querySelector(\\\".endTime\\\"); \\n endTime.textContent = time;\\n //display the final star rating\\n const two = document.querySelector(\\\".endTwo\\\");\\n const three = document.querySelector(\\\".endThree\\\");\\n //display the star rating in the modal\\n if(turnCounter >= 20){\\n two.classList.add(\\\"hidden\\\");\\n three.classList.add(\\\"hidden\\\");\\n }else if(turnCounter > 13 && turnCounter <20){\\n three.classList.add(\\\"hidden\\\");\\n }\\n //make the reset button do actually reset the application\\n let button = document.querySelector(\\\".button\\\");\\n button.addEventListener(\\\"click\\\",resetClicked);\\n}\",\n \"function winner() {\\n\\twinPage.classList.remove('hidden');\\n\\twinPage.style.display = 'block';\\n\\tgamePage.classList.add('hidden');\\n\\tplayAgainBtn.classList.remove('hidden');\\n\\tclearInterval(setTimer);\\n}\",\n \"function endgame(){\\n $('#guess-box').prop('disabled', true)\\n $('span.element').show();\\n $('#element-list').show();\\n $('.cell').not('.success').addClass('fail').removeClass('s d p f');\\n }\",\n \"win() {\\n modal.style.display = 'block';\\n playAgainButton.focus();\\n this.clear();\\n }\",\n \"function result () {\\n gameWindow.classList.add('hide')\\n welcomeWindow.classList.add('hide')\\n scoreWindow.classList.remove('hide')\\n getScore()\\n}\",\n \"function finishGame(isVictory) {\\n if (isVictory) {\\n highestScore(gLevel.type, gGame.secsPassed);\\n renderSmiley(true);\\n winningAudio.play();\\n // alert('You Win!');\\n openModal('You Won!');\\n gGame.isOn = false;\\n } else {\\n gGame.isOn = false;\\n losingAudio.play();\\n openModal('You Lost :(');\\n revealMines();\\n }\\n clearInterval(gTimerInterval);\\n}\",\n \"function closeModal() {\\n modal.classList.remove(\\\"show\\\");\\n restartGame();\\n}\",\n \"function finishedGame() {\\n timer.pause();\\n let pText = document.querySelector(\\\"#resultFinished\\\");\\n let iStars = parseInt(countStars);\\n let middle = countStars > iStars ? 'and a half' : '';\\n pText.innerHTML = `You won with ${countMoves} moves and ${iStars} ${middle} stars in ${timer.getTimeValues().toString()}.`;\\n $('#myModal').modal();\\n}\",\n \"function continueGame() {\\n game.updateDisplay();\\n if (game.getState() == \\\"playing\\\") {\\n $(\\\"#startButton\\\").toggleClass(\\\"hidden\\\");\\n } else {\\n $(\\\"#resetButton\\\").toggleClass(\\\"hidden\\\");\\n }\\n saveGame();\\n}\",\n \"function checkEndGame() {\\r\\n if (cardMatches == 8) {\\r\\n console.log(\\\"gameEnd\\\");\\r\\n // stop the clock\\r\\n clearInterval(ticking);\\r\\n // open end game modal\\r\\n openModal();\\r\\n }\\r\\n}\",\n \"function winnerResult() {\\n if (gameScoreWon === 3 || gameScoreLost === 3) {\\n document.getElementById('games-won').style.display = \\\"none\\\";\\n document.getElementById('game-con').style.display = \\\"none\\\";\\n document.getElementById('final-result').style.display = \\\"block\\\";\\n document.getElementById('rules-btn').disabled = true;\\n document.getElementById('play').disabled = true;\\n \\n }\\n if (gameScoreWon === 3) {\\n document.getElementById('winner').style.display = \\\"block\\\";\\n document.getElementById('loser').style.display = \\\"none\\\";\\n document.getElementById('result-msg').innerText = \\\"Awesome - You won the Game!\\\";\\n } else if (gameScoreLost === 3) {\\n document.getElementById('loser').style.display = \\\"block\\\";\\n document.getElementById('winner').style.display = \\\"none\\\";\\n document.getElementById('result-msg').innerText = \\\"Better luck next time!\\\";\\n }\\n}\",\n \"function gameOver() {\\n // Clear the interval\\n clearInterval(info.timeout);\\n // Display the modal\\n divs.modal_div.style.display = \\\"block\\\";\\n // Update the final score element\\n divs.final_score.innerText = \\\"Your final score is: \\\" + info.score;\\n}\",\n \"function winner() {\\n winnerPrompt.classList.remove('hidden-winner');\\n resetPlayAgain.classList.remove('hidden');\\n hide1.classList.add('hide-all');\\n hide2.classList.add('hide-all');\\n resetSpan.textContent = 'Play Again?';\\n }\",\n \"function openModal() {\\npaused = true;\\nmyModal.style.display = 'block';\\nendScore.innerHTML = score;\\ndocument.getElementsByClassName('play-again')[0].addEventListener('click', reset);\\ndocument.getElementsByClassName('quit')[0].addEventListener('click', clearModal);\\n}\",\n \"function openModal() {\\n modal.style.display = \\\"block\\\";\\n passTheScore();\\n}\",\n \"checkForGameEnd() {\\n const { numberOfLockedCards, shuffledCards } = this.state;\\n if(numberOfLockedCards === shuffledCards.length) {\\n // Show modal and hide the main content\\n this.setState({\\n modalVisible: true,\\n timer: clearInterval(this.state.timer)\\n });\\n }\\n }\",\n \"function celebration(){\\n\\t // if all cards = is solved then display (animation? and final photo) \\n\\t //in raw html/css first so image is on the page display none in css\\n\\t //show it with a slow fade in\\n\\t $(\\\"#group-silly\\\").fadeIn(\\\"slow\\\");\\n\\t // stop timer using variable \\n\\t clearTimeout(myVar);\\n\\t $(\\\".start-button\\\").html(\\\"Play Again\\\");\\n\\t $(\\\".start-button\\\").click(restartGame);\\n\\t // call restartGame function\\n}\",\n \"function gameWin(player){\\n var playerColor = player.toUpperCase();\\n $(\\\"#winMsg\\\").html(playerColor + \\\" WINS!!!\\\");\\n $(\\\"#winModal\\\").modal(\\\"show\\\");\\n if(player == \\\"red\\\"){\\n redWins++;\\n $(\\\".redWins\\\").html(redWins);\\n turn = \\\"red\\\";\\n }else{\\n blackWins++;\\n $(\\\".blackWins\\\").html(blackWins);\\n turn = \\\"black\\\";\\n }\\n }\",\n \"function toggleScoreModal() {\\n stopTimer();\\n finalScore();\\n let modal = document.querySelector('#score-modal');\\n modal.classList.toggle('modal-hide');\\n}\",\n \"async win (){\\n if(this.state.turn){\\n await this.setState({winner: this.state.player1Name});\\n this.updateMineFieldChange();\\n //Alert who has won and suggestion of restarting the game\\n if(window.confirm(this.state.player1Name + ' has won the game, do you wish to restart it?')){\\n }\\n }\\n else{\\n await this.setState({winner: this.state.player2Name});\\n this.updateMineFieldChange();\\n //Alert who has won and suggestion of restarting the game\\n if(window.confirm(this.state.player2Name + ' has won the game, do you wish to restart it?')){\\n }\\n }\\n return;\\n }\",\n \"function win () { \\n style = { font: \\\"65px Arial\\\", fill: \\\"#fff\\\", align: \\\"center\\\" };\\n game.add.text(game.camera.x+325, game.camera.y+150, \\\"You Win!\\\", style);\\n button = game.add.button(game.camera.x+275, game.camera.y+250, 'reset-button', actionOnResetClick, this);\\n button = game.add.button(game.camera.x+475, game.camera.y+250, 'contact-button', actionOnContactClick, this); \\n // The following lines kill the players movement before disabling keyboard inputs\\n player.body.velocity.x = 0;\\n setTimeout(game.input.keyboard.disabled = true, 1000); \\n // Plays the victory song \\n victory.play('');\\n // When the Reset button is clicked, it calls this function, which in turn calls the game to be reloaded.\\n // Here we display the contact and replay button options, calling either respective function\\n function actionOnResetClick () {\\n gameRestart();\\n }\\n\\n // When the contact button is clicked it redirects through to contact form\\n function actionOnContactClick () {\\n\\n window.location = (\\\"/contacts/\\\" + lastName)\\n \\n } \\n }\",\n \"function endGame(status) {\\n let // Select Popuo Element\\n popup = document.querySelector(\\\".popup\\\"),\\n // Select Player Status Element\\n playerStatus = popup.querySelector(\\\".player-status\\\"),\\n // Select Player Status Span\\n playerStatusSpan = playerStatus.querySelector(\\\"span\\\"),\\n // Select Wrong Attempts Span\\n wrongAttemptsSpan = popup.querySelector(\\\".wrong-attempts span\\\"),\\n // Select Play Again Button\\n playAgainBtn = popup.querySelector(\\\".play-again\\\");\\n\\n // Show Popup Element\\n popup.style.display = \\\"block\\\";\\n\\n // Set Player Status [Win Or Fail]\\n playerStatusSpan.textContent = status;\\n\\n // Set Wrong Attempts Number\\n wrongAttemptsSpan.textContent = wrongAttempts;\\n\\n // Check If The Player [Win Or Fail]\\n if (status === \\\"Win\\\") {\\n playerStatus.classList.add(\\\"win\\\");\\n\\n if (playerStatus.classList.contains(\\\"fail\\\")) {\\n playerStatus.classList.remove(\\\"fail\\\");\\n }\\n } else {\\n playerStatus.classList.add(\\\"fail\\\");\\n\\n if (playerStatus.classList.contains(\\\"win\\\")) {\\n playerStatus.classList.remove(\\\"win\\\");\\n }\\n }\\n\\n // Play Again\\n playAgainBtn.onclick = function () {\\n // Hid Popup Element\\n popup.style.display = \\\"none\\\";\\n\\n // Reset [wrongAttempts] & [rightChoose] Value\\n wrongAttempts = 0;\\n rightChoose = 0;\\n\\n // Empty Letters Container\\n lettersContainer.innerHTML = \\\"\\\";\\n\\n // Remove Finished Class From Letters Container\\n if (lettersContainer.classList.contains(\\\"finished\\\")) {\\n lettersContainer.classList.remove(\\\"finished\\\");\\n }\\n\\n // Trigger Generate Letters Function\\n generateLetters();\\n\\n // Trigger Get Word Functuin\\n getWord();\\n\\n // Empty Letters Guess Contianer\\n lettersGuessContainer.innerHTML = \\\"\\\";\\n\\n // Trigger Guess Function\\n guess();\\n\\n // Remove Wrong Class From Hangman Draw\\n for (let i = 1; i <= 8; i++) {\\n if (theDraw.classList.contains(`wrong-${i}`)) {\\n theDraw.classList.remove(`wrong-${i}`);\\n }\\n }\\n\\n gameMacanism();\\n };\\n}\",\n \"function gameOver() {\\n $('#winnerText').text(`Your final score is ${score}`);\\n $('#winnerModal').modal('toggle');\\n}\",\n \"function finish(){\\n\\n // sound-effect\\n playIncorrect()\\n // Disable buttons, because we don't need them.\\n elements.correctButton.disabled = true\\n elements.incorrectButton.disabled = true\\n window.setTimeout(displayGameOver,1500)\\n}\",\n \"function gameWon() {\\n //This element will hide the game section\\n document.getElementById('main').style.display = 'none';\\n\\n //This element will hide the victory-screen section.\\n document.getElementById('victory-screen').style.display = 'flex';\\n\\n //Setting the event listener for the play again button.\\n document.getElementById('play-again-button').addEventListener('click', resetGame);\\n}\",\n \"function win() {\\n if (squares[4].classList.contains('man')) {\\n result.innerHTML = 'I am Inevitable 😍'\\n squares[index].classList.remove('man')\\n clearInterval(timerId)\\n document.removeEventListener('keyup', moveman)\\n }\\n }\",\n \"function isFinished(){\\n if(counter === 10){\\n counter = 0;\\n result.textContent = \\\"Play again!\\\";\\n result.className = \\\"\\\";\\n reset = true;\\n showConclusionModal();\\n }\\n}\",\n \"function checkWin() {\\n\\tif (towerC.childElementCount === 3) {\\n\\t\\tmodal.style.display = 'inline';\\n\\t\\tplayerMessage.innerHTML = '';\\n\\t\\tmodalContent.innerHTML = 'YOU WON!!!! LFG';\\n\\t\\tclearInterval(countUp); //stops the timer.\\n\\t}\\n}\",\n \"function closeModal() {\\n close.click(function(e) {\\n gameEnd.removeClass('show');\\n start();\\n });\\n}\",\n \"function endOfGame() {\\n\\n if (matchFound === 8) {\\n window.clearInterval(timer);\\n var modal = document.getElementById('message');\\n var span = document.getElementsByClassName(\\\"close\\\")[0];\\n\\n $(\\\"#total-moves\\\").text(moves);\\n $(\\\"#total-stars\\\").text(starNumber);\\n\\n modal.style.display = \\\"block\\\";\\n\\n\\n span.onclick = function() {\\n modal.style.display = \\\"none\\\";\\n };\\n // Play again button\\n $(\\\"#play-again-btn\\\").on(\\\"click\\\", function() {\\n location.reload()\\n });\\n\\n clearInterval(timer);\\n }\\n}\",\n \"function gameOverPopup(){\\n var modalGameOver = document.getElementById('modalGameOver');\\n var rePlay = document.getElementById(\\\"replayBtn\\\");\\n var img = document.querySelectorAll(\\\"img\\\")[0];\\n\\n modalGameOver.style.display = \\\"block\\\";\\n $(\\\"#score\\\").html(\\\"Final score: \\\" + finalScore);\\n // When the user clicks button replay, close it\\n rePlay.onclick = function() {\\n window.location.assign(\\\"../start.html\\\");\\n }\\n }\"\n]","isConversational":false},"negative_scores":{"kind":"list like","value":["0.79958755","0.7674914","0.7590692","0.7562863","0.75202096","0.7463216","0.74332577","0.7370642","0.736813","0.73266023","0.7278763","0.7268241","0.7261297","0.72610885","0.7241172","0.72255564","0.72160333","0.72023773","0.7202213","0.7199982","0.71915716","0.7189895","0.71889216","0.7187446","0.71789646","0.7166189","0.7166189","0.7162732","0.71512085","0.7146162","0.71250755","0.7124917","0.7122165","0.71140504","0.71050334","0.70826083","0.7081608","0.70704484","0.7067574","0.70663816","0.7055887","0.7045389","0.7043902","0.7025624","0.70068204","0.70002407","0.70002407","0.6988729","0.6957064","0.69469076","0.69355595","0.692904","0.69118965","0.6911346","0.6910631","0.6909339","0.69085497","0.690487","0.68827564","0.6878053","0.68715584","0.68586427","0.6853054","0.6847448","0.6838475","0.6828403","0.6825362","0.682418","0.68124145","0.6811421","0.6806929","0.68059486","0.6802486","0.6784522","0.6781022","0.678078","0.6779199","0.6778522","0.67784894","0.6778383","0.6775107","0.6774229","0.6773439","0.6769036","0.6757667","0.6753235","0.67517793","0.6746199","0.67455566","0.6739178","0.67263985","0.6721057","0.6720466","0.6708937","0.67064357","0.6698592","0.66912633","0.668426","0.6682957","0.6677367"],"string":"[\n \"0.79958755\",\n \"0.7674914\",\n \"0.7590692\",\n \"0.7562863\",\n \"0.75202096\",\n \"0.7463216\",\n \"0.74332577\",\n \"0.7370642\",\n \"0.736813\",\n \"0.73266023\",\n \"0.7278763\",\n \"0.7268241\",\n \"0.7261297\",\n \"0.72610885\",\n \"0.7241172\",\n \"0.72255564\",\n \"0.72160333\",\n \"0.72023773\",\n \"0.7202213\",\n \"0.7199982\",\n \"0.71915716\",\n \"0.7189895\",\n \"0.71889216\",\n \"0.7187446\",\n \"0.71789646\",\n \"0.7166189\",\n \"0.7166189\",\n \"0.7162732\",\n \"0.71512085\",\n \"0.7146162\",\n \"0.71250755\",\n \"0.7124917\",\n \"0.7122165\",\n \"0.71140504\",\n \"0.71050334\",\n \"0.70826083\",\n \"0.7081608\",\n \"0.70704484\",\n \"0.7067574\",\n \"0.70663816\",\n \"0.7055887\",\n \"0.7045389\",\n \"0.7043902\",\n \"0.7025624\",\n \"0.70068204\",\n \"0.70002407\",\n \"0.70002407\",\n \"0.6988729\",\n \"0.6957064\",\n \"0.69469076\",\n \"0.69355595\",\n \"0.692904\",\n \"0.69118965\",\n \"0.6911346\",\n \"0.6910631\",\n \"0.6909339\",\n \"0.69085497\",\n \"0.690487\",\n \"0.68827564\",\n \"0.6878053\",\n \"0.68715584\",\n \"0.68586427\",\n \"0.6853054\",\n \"0.6847448\",\n \"0.6838475\",\n \"0.6828403\",\n \"0.6825362\",\n \"0.682418\",\n \"0.68124145\",\n \"0.6811421\",\n \"0.6806929\",\n \"0.68059486\",\n \"0.6802486\",\n \"0.6784522\",\n \"0.6781022\",\n \"0.678078\",\n \"0.6779199\",\n \"0.6778522\",\n \"0.67784894\",\n \"0.6778383\",\n \"0.6775107\",\n \"0.6774229\",\n \"0.6773439\",\n \"0.6769036\",\n \"0.6757667\",\n \"0.6753235\",\n \"0.67517793\",\n \"0.6746199\",\n \"0.67455566\",\n \"0.6739178\",\n \"0.67263985\",\n \"0.6721057\",\n \"0.6720466\",\n \"0.6708937\",\n \"0.67064357\",\n \"0.6698592\",\n \"0.66912633\",\n \"0.668426\",\n \"0.6682957\",\n \"0.6677367\"\n]","isConversational":false},"document_score":{"kind":"string","value":"0.73718977"},"document_rank":{"kind":"string","value":"7"}}},{"rowIdx":4592,"cells":{"query":{"kind":"string","value":"TODO: Clean this crap up"},"document":{"kind":"string","value":"async reAuthorize(user, pass, options) {\n return new Promise((resolve, reject) => { \n puppeteer.launch({args: ['--no-sandbox', '--disable-setuid-sandbox']}).then(async browser => {\n try {\n const page = await browser.newPage();\n try {\n console.log(`[cbs api] - navigate to ${CbsAPI.login.page}`);\n await page.goto(`${CbsAPI.login.page}?${CbsAPI.login.params}`);\n await page.type(CbsAPI.login.userSelector, user);\n await page.type(CbsAPI.login.passwordSelector, pass);\n console.log('[cbs api] - submit login form')\n await page.$eval(CbsAPI.login.form, form => form.submit());\n await page.waitForNavigation();\n console.log(`[cbs api] - Login Complete. Get access_tokens`);\n await page.waitForSelector(CbsAPI.teams.waitSelector);\n const tokens = await this.getAllTokens(page, options);\n console.log(`[cbs api] - ${tokens.length} valid leagues`);\n resolve(new CbsProfile(user, tokens));\n } catch (err) {\n console.log(err);\n reject(error);\n }\n } finally {\n console.log('[cbs api] - close browser');\n await browser.close();\n }\n });\n });\n }"},"metadata":{"kind":"string","value":"{\n \"objective\": {\n \"self\": [],\n \"paired\": [],\n \"triplet\": [\n [\n \"query\",\n \"document\",\n \"negatives\"\n ]\n ]\n }\n}"},"negatives":{"kind":"list like","value":["private internal function m248() {}","private public function m246() {}","protected internal function m252() {}","transient private protected internal function m182() {}","static private internal function m121() {}","transient protected internal function m189() {}","static final private internal function m106() {}","transient private internal function m185() {}","transient final protected internal function m174() {}","static private protected internal function m118() {}","static transient final private internal function m43() {}","static transient final protected internal function m47() {}","static transient private protected internal function m55() {}","transient private protected public internal function m181() {}","transient final private protected internal function m167() {}","obtain(){}","transient final private internal function m170() {}","static transient final protected public internal function m46() {}","static transient final private protected internal function m40() {}","__previnit(){}","function _____SHARED_functions_____(){}","static transient private protected public internal function m54() {}","static protected internal function m125() {}","static final private protected internal function m103() {}","static transient private internal function m58() {}","static private protected public internal function m117() {}","function DWRUtil() { }","transient private public function m183() {}","static transient private public function m56() {}","function AeUtil() {}","prepare() {}","static transient final protected function m44() {}","transient final private protected public internal function m166() {}","static transient final private protected public internal function m39() {}","static final private public function m104() {}","static final protected internal function m110() {}","function PathSearchResultCollector() {\n\n}","static final private protected public internal function m102() {}","static transient final private public function m41() {}","_firstRendered() { }","apply () {}","lastUsed() { }","function findCanonicalReferences() {\n\n }","function TMP() {\n return;\n }","static private public function m119() {}","static transient final private protected public function m38() {}","initialize() {}","initialize() {}","initialize() {}","initialize() {}","initialize() {}","initialize() {}","function Utils() {}","function Utils() {}","resolution() { }","init () {\n\t\treturn null;\n\t}","function fm(){}","constructor() {\n \n\n \n \n\n \n\n \n }","constructor() {\n \n\n \n \n\n \n\n \n }","constructor() {\n \n\n \n \n\n \n\n \n }","constructor() {\n \n\n \n \n\n \n\n \n }","constructor() {\n \n\n \n \n\n \n\n \n }","constructor() {\n \n\n \n \n\n \n\n \n }","constructor() {\n \n\n \n \n\n \n\n \n }","constructor() {\n \n\n \n \n\n \n\n \n }","constructor() {\n \n\n \n \n\n \n\n \n }","constructor() {\n \n\n \n \n\n \n\n \n }","constructor() {\n \n\n \n \n\n \n\n \n }","constructor() {\n \n\n \n \n\n \n\n \n }","constructor() {\n \n\n \n \n\n \n\n \n }","constructor() {\n \n\n \n \n\n \n\n \n }","constructor() {\n \n\n \n \n\n \n\n \n }","constructor() {\n \n\n \n \n\n \n\n \n }","constructor() {\n \n\n \n \n\n \n\n \n }","constructor() {\n \n\n \n \n\n \n\n \n }","constructor() {\n \n\n \n \n\n \n\n \n }","constructor() {\n \n\n \n \n\n \n\n \n }","constructor() {\n \n\n \n \n\n \n\n \n }","constructor() {\n \n\n \n \n\n \n\n \n }","constructor() {\n \n\n \n \n\n \n\n \n }","constructor() {\n \n\n \n \n\n \n\n \n }","constructor() {\n \n\n \n \n\n \n\n \n }","constructor() {\n \n\n \n \n\n \n\n \n }","constructor() {\n \n\n \n \n\n \n\n \n }","constructor() {\n \n\n \n \n\n \n\n \n }","constructor() {\n \n\n \n \n\n \n\n \n }","constructor() {\n \n\n \n \n\n \n\n \n }","constructor() {\n \n\n \n \n\n \n\n \n }","constructor() {\n \n\n \n \n\n \n\n \n }","constructor() {\n \n\n \n \n\n \n\n \n }","constructor() {\n \n\n \n \n\n \n\n \n }","constructor() {\n \n\n \n \n\n \n\n \n }","constructor() {\n \n\n \n \n\n \n\n \n }","constructor() {\n \n\n \n \n\n \n\n \n }","getResult() {}","function SeleneseMapper() {\n}","function StupidBug() {}","static transient protected internal function m62() {}","function o0(o1)\n{\n var o2 = -1;\n try {\nfor (var o259 = 0; o3 < o1.length; function (o502, name, o38, o781, o782, o837, o585, o838, o549) {\n try {\no839.o468();\n}catch(e){}\n // TODO we should allow people to just pass in a complete filename instead\n // of parent and name being that we just join them anyways\n var o840 = name ? o591.resolve(o591.o592(o502, name)) : o502;\n\n function o841(o842) {\n function o843(o842) {\n try {\nif (!o838) {\n try {\no474.o800(o502, name, o842, o781, o782, o549);\n}catch(e){}\n }\n}catch(e){}\n try {\nif (o837) try {\no837();\n}catch(e){}\n}catch(e){}\n try {\no334('cp ' + o840);\n}catch(e){}\n }\n var o844 = false;\n try {\nModule['preloadPlugins'].forEach(function (o845) {\n try {\nif (o844) try {\nreturn;\n}catch(e){}\n}catch(e){}\n try {\nif (o845['canHandle'](o840)) {\n try {\no845['handle'](o842, o840, o843, function () {\n try {\nif (o585) try {\no585();\n}catch(e){}\n}catch(e){}\n try {\no334('cp ' + o840);\n}catch(e){}\n });\n}catch(e){}\n try {\no844 = true;\n}catch(e){}\n }\n}catch(e){}\n });\n}catch(e){}\n try {\nif (!o844) try {\no843(o842);\n}catch(e){}\n}catch(e){}\n }\n try {\no332('cp ' + o840);\n}catch(e){}\n try {\nif (typeof o38 == 'string') {\n try {\no839.o846(o38, function (o842) {\n try {\no841(o842);\n}catch(e){}\n }, o585);\n}catch(e){}\n } else {\n try {\no841(o38);\n}catch(e){}\n }\n}catch(e){}\n })\n {\n try {\nif (o1[o3] == undefined)\n {\n try {\nif (o2 == -1)\n {\n try {\no2 = o3;\n}catch(e){}\n }\n}catch(e){}\n }\n else\n {\n try {\nif (o2 != -1)\n {\n try {\no4.o5(o2 + \"-\" + (o3-1) + \" = undefined\");\n}catch(e){}\n try {\no2 = -1;\n}catch(e){}\n }\n}catch(e){}\n try {\no4.o5(o3 + \" = \" + o1[o3]);\n}catch(e){}\n }\n}catch(e){}\n }\n}catch(e){}\n}","transient final private public function m168() {}","constructor () {\r\n\t\t\r\n\t}"],"string":"[\n \"private internal function m248() {}\",\n \"private public function m246() {}\",\n \"protected internal function m252() {}\",\n \"transient private protected internal function m182() {}\",\n \"static private internal function m121() {}\",\n \"transient protected internal function m189() {}\",\n \"static final private internal function m106() {}\",\n \"transient private internal function m185() {}\",\n \"transient final protected internal function m174() {}\",\n \"static private protected internal function m118() {}\",\n \"static transient final private internal function m43() {}\",\n \"static transient final protected internal function m47() {}\",\n \"static transient private protected internal function m55() {}\",\n \"transient private protected public internal function m181() {}\",\n \"transient final private protected internal function m167() {}\",\n \"obtain(){}\",\n \"transient final private internal function m170() {}\",\n \"static transient final protected public internal function m46() {}\",\n \"static transient final private protected internal function m40() {}\",\n \"__previnit(){}\",\n \"function _____SHARED_functions_____(){}\",\n \"static transient private protected public internal function m54() {}\",\n \"static protected internal function m125() {}\",\n \"static final private protected internal function m103() {}\",\n \"static transient private internal function m58() {}\",\n \"static private protected public internal function m117() {}\",\n \"function DWRUtil() { }\",\n \"transient private public function m183() {}\",\n \"static transient private public function m56() {}\",\n \"function AeUtil() {}\",\n \"prepare() {}\",\n \"static transient final protected function m44() {}\",\n \"transient final private protected public internal function m166() {}\",\n \"static transient final private protected public internal function m39() {}\",\n \"static final private public function m104() {}\",\n \"static final protected internal function m110() {}\",\n \"function PathSearchResultCollector() {\\n\\n}\",\n \"static final private protected public internal function m102() {}\",\n \"static transient final private public function m41() {}\",\n \"_firstRendered() { }\",\n \"apply () {}\",\n \"lastUsed() { }\",\n \"function findCanonicalReferences() {\\n\\n }\",\n \"function TMP() {\\n return;\\n }\",\n \"static private public function m119() {}\",\n \"static transient final private protected public function m38() {}\",\n \"initialize() {}\",\n \"initialize() {}\",\n \"initialize() {}\",\n \"initialize() {}\",\n \"initialize() {}\",\n \"initialize() {}\",\n \"function Utils() {}\",\n \"function Utils() {}\",\n \"resolution() { }\",\n \"init () {\\n\\t\\treturn null;\\n\\t}\",\n \"function fm(){}\",\n \"constructor() {\\n \\n\\n \\n \\n\\n \\n\\n \\n }\",\n \"constructor() {\\n \\n\\n \\n \\n\\n \\n\\n \\n }\",\n \"constructor() {\\n \\n\\n \\n \\n\\n \\n\\n \\n }\",\n \"constructor() {\\n \\n\\n \\n \\n\\n \\n\\n \\n }\",\n \"constructor() {\\n \\n\\n \\n \\n\\n \\n\\n \\n }\",\n \"constructor() {\\n \\n\\n \\n \\n\\n \\n\\n \\n }\",\n \"constructor() {\\n \\n\\n \\n \\n\\n \\n\\n \\n }\",\n \"constructor() {\\n \\n\\n \\n \\n\\n \\n\\n \\n }\",\n \"constructor() {\\n \\n\\n \\n \\n\\n \\n\\n \\n }\",\n \"constructor() {\\n \\n\\n \\n \\n\\n \\n\\n \\n }\",\n \"constructor() {\\n \\n\\n \\n \\n\\n \\n\\n \\n }\",\n \"constructor() {\\n \\n\\n \\n \\n\\n \\n\\n \\n }\",\n \"constructor() {\\n \\n\\n \\n \\n\\n \\n\\n \\n }\",\n \"constructor() {\\n \\n\\n \\n \\n\\n \\n\\n \\n }\",\n \"constructor() {\\n \\n\\n \\n \\n\\n \\n\\n \\n }\",\n \"constructor() {\\n \\n\\n \\n \\n\\n \\n\\n \\n }\",\n \"constructor() {\\n \\n\\n \\n \\n\\n \\n\\n \\n }\",\n \"constructor() {\\n \\n\\n \\n \\n\\n \\n\\n \\n }\",\n \"constructor() {\\n \\n\\n \\n \\n\\n \\n\\n \\n }\",\n \"constructor() {\\n \\n\\n \\n \\n\\n \\n\\n \\n }\",\n \"constructor() {\\n \\n\\n \\n \\n\\n \\n\\n \\n }\",\n \"constructor() {\\n \\n\\n \\n \\n\\n \\n\\n \\n }\",\n \"constructor() {\\n \\n\\n \\n \\n\\n \\n\\n \\n }\",\n \"constructor() {\\n \\n\\n \\n \\n\\n \\n\\n \\n }\",\n \"constructor() {\\n \\n\\n \\n \\n\\n \\n\\n \\n }\",\n \"constructor() {\\n \\n\\n \\n \\n\\n \\n\\n \\n }\",\n \"constructor() {\\n \\n\\n \\n \\n\\n \\n\\n \\n }\",\n \"constructor() {\\n \\n\\n \\n \\n\\n \\n\\n \\n }\",\n \"constructor() {\\n \\n\\n \\n \\n\\n \\n\\n \\n }\",\n \"constructor() {\\n \\n\\n \\n \\n\\n \\n\\n \\n }\",\n \"constructor() {\\n \\n\\n \\n \\n\\n \\n\\n \\n }\",\n \"constructor() {\\n \\n\\n \\n \\n\\n \\n\\n \\n }\",\n \"constructor() {\\n \\n\\n \\n \\n\\n \\n\\n \\n }\",\n \"constructor() {\\n \\n\\n \\n \\n\\n \\n\\n \\n }\",\n \"constructor() {\\n \\n\\n \\n \\n\\n \\n\\n \\n }\",\n \"constructor() {\\n \\n\\n \\n \\n\\n \\n\\n \\n }\",\n \"constructor() {\\n \\n\\n \\n \\n\\n \\n\\n \\n }\",\n \"getResult() {}\",\n \"function SeleneseMapper() {\\n}\",\n \"function StupidBug() {}\",\n \"static transient protected internal function m62() {}\",\n \"function o0(o1)\\n{\\n var o2 = -1;\\n try {\\nfor (var o259 = 0; o3 < o1.length; function (o502, name, o38, o781, o782, o837, o585, o838, o549) {\\n try {\\no839.o468();\\n}catch(e){}\\n // TODO we should allow people to just pass in a complete filename instead\\n // of parent and name being that we just join them anyways\\n var o840 = name ? o591.resolve(o591.o592(o502, name)) : o502;\\n\\n function o841(o842) {\\n function o843(o842) {\\n try {\\nif (!o838) {\\n try {\\no474.o800(o502, name, o842, o781, o782, o549);\\n}catch(e){}\\n }\\n}catch(e){}\\n try {\\nif (o837) try {\\no837();\\n}catch(e){}\\n}catch(e){}\\n try {\\no334('cp ' + o840);\\n}catch(e){}\\n }\\n var o844 = false;\\n try {\\nModule['preloadPlugins'].forEach(function (o845) {\\n try {\\nif (o844) try {\\nreturn;\\n}catch(e){}\\n}catch(e){}\\n try {\\nif (o845['canHandle'](o840)) {\\n try {\\no845['handle'](o842, o840, o843, function () {\\n try {\\nif (o585) try {\\no585();\\n}catch(e){}\\n}catch(e){}\\n try {\\no334('cp ' + o840);\\n}catch(e){}\\n });\\n}catch(e){}\\n try {\\no844 = true;\\n}catch(e){}\\n }\\n}catch(e){}\\n });\\n}catch(e){}\\n try {\\nif (!o844) try {\\no843(o842);\\n}catch(e){}\\n}catch(e){}\\n }\\n try {\\no332('cp ' + o840);\\n}catch(e){}\\n try {\\nif (typeof o38 == 'string') {\\n try {\\no839.o846(o38, function (o842) {\\n try {\\no841(o842);\\n}catch(e){}\\n }, o585);\\n}catch(e){}\\n } else {\\n try {\\no841(o38);\\n}catch(e){}\\n }\\n}catch(e){}\\n })\\n {\\n try {\\nif (o1[o3] == undefined)\\n {\\n try {\\nif (o2 == -1)\\n {\\n try {\\no2 = o3;\\n}catch(e){}\\n }\\n}catch(e){}\\n }\\n else\\n {\\n try {\\nif (o2 != -1)\\n {\\n try {\\no4.o5(o2 + \\\"-\\\" + (o3-1) + \\\" = undefined\\\");\\n}catch(e){}\\n try {\\no2 = -1;\\n}catch(e){}\\n }\\n}catch(e){}\\n try {\\no4.o5(o3 + \\\" = \\\" + o1[o3]);\\n}catch(e){}\\n }\\n}catch(e){}\\n }\\n}catch(e){}\\n}\",\n \"transient final private public function m168() {}\",\n \"constructor () {\\r\\n\\t\\t\\r\\n\\t}\"\n]","isConversational":false},"negative_scores":{"kind":"list like","value":["0.6629856","0.64722884","0.6315378","0.59493625","0.58367836","0.58133566","0.5773609","0.57577735","0.5658787","0.5511058","0.5473137","0.54320234","0.5384917","0.53504694","0.53492665","0.53312796","0.5299023","0.52425486","0.5214896","0.5134584","0.5102485","0.5073686","0.50611746","0.50600356","0.50535417","0.50495934","0.5047122","0.49607447","0.48987287","0.48795825","0.4870619","0.4867342","0.48294634","0.48215133","0.4786205","0.47728947","0.47662288","0.4764877","0.4725948","0.47178438","0.47054914","0.46974608","0.46955356","0.46919054","0.4690006","0.46631268","0.46493202","0.46493202","0.46493202","0.46493202","0.46493202","0.46493202","0.46421102","0.46421102","0.46340513","0.46312746","0.4625699","0.4624448","0.4624448","0.4624448","0.4624448","0.4624448","0.4624448","0.4624448","0.4624448","0.4624448","0.4624448","0.4624448","0.4624448","0.4624448","0.4624448","0.4624448","0.4624448","0.4624448","0.4624448","0.4624448","0.4624448","0.4624448","0.4624448","0.4624448","0.4624448","0.4624448","0.4624448","0.4624448","0.4624448","0.4624448","0.4624448","0.4624448","0.4624448","0.4624448","0.4624448","0.4624448","0.4624448","0.4624448","0.46160704","0.45969164","0.45964774","0.4582676","0.45813","0.4571879","0.45672163"],"string":"[\n \"0.6629856\",\n \"0.64722884\",\n \"0.6315378\",\n \"0.59493625\",\n \"0.58367836\",\n \"0.58133566\",\n \"0.5773609\",\n \"0.57577735\",\n \"0.5658787\",\n \"0.5511058\",\n \"0.5473137\",\n \"0.54320234\",\n \"0.5384917\",\n \"0.53504694\",\n \"0.53492665\",\n \"0.53312796\",\n \"0.5299023\",\n \"0.52425486\",\n \"0.5214896\",\n \"0.5134584\",\n \"0.5102485\",\n \"0.5073686\",\n \"0.50611746\",\n \"0.50600356\",\n \"0.50535417\",\n \"0.50495934\",\n \"0.5047122\",\n \"0.49607447\",\n \"0.48987287\",\n \"0.48795825\",\n \"0.4870619\",\n \"0.4867342\",\n \"0.48294634\",\n \"0.48215133\",\n \"0.4786205\",\n \"0.47728947\",\n \"0.47662288\",\n \"0.4764877\",\n \"0.4725948\",\n \"0.47178438\",\n \"0.47054914\",\n \"0.46974608\",\n \"0.46955356\",\n \"0.46919054\",\n \"0.4690006\",\n \"0.46631268\",\n \"0.46493202\",\n \"0.46493202\",\n \"0.46493202\",\n \"0.46493202\",\n \"0.46493202\",\n \"0.46493202\",\n \"0.46421102\",\n \"0.46421102\",\n \"0.46340513\",\n \"0.46312746\",\n \"0.4625699\",\n \"0.4624448\",\n \"0.4624448\",\n \"0.4624448\",\n \"0.4624448\",\n \"0.4624448\",\n \"0.4624448\",\n \"0.4624448\",\n \"0.4624448\",\n \"0.4624448\",\n \"0.4624448\",\n \"0.4624448\",\n \"0.4624448\",\n \"0.4624448\",\n \"0.4624448\",\n \"0.4624448\",\n \"0.4624448\",\n \"0.4624448\",\n \"0.4624448\",\n \"0.4624448\",\n \"0.4624448\",\n \"0.4624448\",\n \"0.4624448\",\n \"0.4624448\",\n \"0.4624448\",\n \"0.4624448\",\n \"0.4624448\",\n \"0.4624448\",\n \"0.4624448\",\n \"0.4624448\",\n \"0.4624448\",\n \"0.4624448\",\n \"0.4624448\",\n \"0.4624448\",\n \"0.4624448\",\n \"0.4624448\",\n \"0.4624448\",\n \"0.4624448\",\n \"0.46160704\",\n \"0.45969164\",\n \"0.45964774\",\n \"0.4582676\",\n \"0.45813\",\n \"0.4571879\",\n \"0.45672163\"\n]","isConversational":false},"document_score":{"kind":"string","value":"0.0"},"document_rank":{"kind":"string","value":"-1"}}},{"rowIdx":4593,"cells":{"query":{"kind":"string","value":"TODO: OBJECT FOR MAPPING OWNERS TO TEAM"},"document":{"kind":"string","value":"mapTeamData(team, ownersList) {\n const owners = ownersList.filter(owner => owner.team.id == team.id).map(ownerObj => {\n const owner = Object.assign({}, ownerObj);\n const name = owner.name.split(' ');\n owner.isLeagueManager = owner.commissioner == 1;\n owner.displayName = owner.name;\n owner.firstName = name.length > 0 ? name[0] : '';\n owner.lastName = name.length > 1 ? name[1] : '';\n delete owner.name;\n delete owner.team;\n delete owner.commissioner;\n delete owner.logged_in_owner;\n return owner;\n });\n \n const roster = team.players.map(player => {\n return {\n id: parseInt(player.id),\n firstName: player.firstname,\n lastName: player.lastname,\n fullName: player.fullname\n }\n });\n \n team.owners = owners;\n team.roster = roster;\n team.id = parseInt(team.id);\n team.abbrev = team.abbr;\n delete team.abbr;\n delete team.projected_points;\n delete team.lineup_status;\n delete team.players;\n delete team.warning;\n delete team.point;\n delete team.long_abbr;\n delete team.short_name;\n delete team.division;\n return team;\n}"},"metadata":{"kind":"string","value":"{\n \"objective\": {\n \"self\": [],\n \"paired\": [],\n \"triplet\": [\n [\n \"query\",\n \"document\",\n \"negatives\"\n ]\n ]\n }\n}"},"negatives":{"kind":"list like","value":["get owners() {\r\n return new Owners(this);\r\n }","function getProjectMembersOrTenderers() {\n $scope.membersList = $rootScope.getProjectMembers(people);\n $scope.tags = [];\n _.each($rootScope.currentTeam.fileTags, function(tag) {\n $scope.tags.push({name: tag, select: false});\n });\n \n // get unique member \n $scope.membersList = _.uniq($scope.membersList, \"_id\");\n\n // filter members list again\n _.each(file.members, function(member) {\n _.remove($scope.membersList, {_id: member._id});\n });\n\n // remove current user from the members list\n _.remove($scope.membersList, {_id: $rootScope.currentUser._id});\n\n // remove the file owner from available assignees\n _.remove($scope.membersList, {_id: $scope.file.owner._id})\n\n // get invitees for related item\n $scope.invitees = angular.copy($scope.file.members);\n _.each($scope.file.notMembers, function(member) {\n $scope.invitees.push({email: member});\n });\n $scope.invitees.push($scope.file.owner);\n $scope.invitees = _.uniq($scope.invitees, \"email\");\n _.remove($scope.invitees, {_id: $rootScope.currentUser._id});\n }","function getUserTeam() {\n API.getTeam(user.email)\n .then(res => {\n if (res.data != null) {\n setTeam(res.data)\n setTeamPlayers(res.data.players);\n }\n })\n .catch(err => console.log(err))\n setTeam({ ...team, owner: user.email })\n }","getOwners() {\n return this.owners;\n }","get owner() { return this.ownerIn; }","function Company(obj) {\n return obj.team && Team(obj.team);\n}","getMultiOwnerInfo() {\n if (this._payingUsers.length <= 1) { return null; }\n const info = [];\n this._payingUsers.forEach((payerObj) => {\n const portionOfTipOwed = (payerObj.percentage / 100) * (this.tip || 0);\n const portionOfInvoiceOwed = (payerObj.percentage / 100) * this.addServiceFee(this.amount);\n const totalPaidAmt = (portionOfTipOwed + portionOfInvoiceOwed).toFixed(2);\n const ownerInfo = {\n name: payerObj._user.name,\n percentage: payerObj.percentage,\n paidAmount: totalPaidAmt,\n };\n info.push(ownerInfo);\n });\n return info;\n }","function Players(name, age, goals, cards) {\n this.team = 'Barcelona';\n this.name = name;\n this.age = age;\n this.goals = goals;\n this.yellowCards = cards;\n}","function Players(name, age, goals, cards) {\n this.team = 'Barcelona';\n this.name = name;\n this.age = age;\n this.goals = goals;\n this.yellowCards = cards;\n}","get team() {\r\n return new Team(this);\r\n }","function footballTeam (player){\n\tvar teamobj = {}\n\tteamobj.player = player;\n\tteamobj.addInfo =addInfo;\n\tteamobj.arrayOfPlayers= [];\n\tteamobj.increaseLevel=increaseLevel;\n\tteamobj.isAvailable=isAvailable;\n\tteamobj.decrease=decrease;\n\tteamobj.sortPalyerBy=sortPalyerBy;\n\treturn teamobj\n}","function OwnerID() {}","function OwnerID() {}","function OwnerID() {}","function OwnerID() {}","function OwnerID() {}","function OwnerID() {}","function OwnerID() {}","function OwnerID() {}","function OwnerID() {}","function OwnerID() {}","function OwnerID() {}","function OwnerID() {}","function OwnerID() {}","function OwnerID() {}","function OwnerID() {}","function OwnerID() {}","function OwnerID() {}","function OwnerID() {}","function OwnerID() {}","function OwnerID() {}","function OwnerID() {}","function OwnerID() {}","function OwnerID() {}","function OwnerID() {}","function OwnerID() {}","function OwnerID() {}","function OwnerID() {}","function OwnerID() {}","function OwnerID() {}","function OwnerID() {}","function OwnerID() {}","function OwnerID() {}","function OwnerID() {}","function OwnerID() {}","function OwnerID() {}","function OwnerID() {}","function OwnerID() {}","function OwnerID() {}","function OwnerID() {}","function OwnerID() {}","function OwnerID() {}","function OwnerID() {}","function OwnerID() {}","function OwnerID() {}","function OwnerID() {}","function OwnerID() {}","function OwnerID() {}","function OwnerID() {}","function OwnerID() {}","function OwnerID() {}","function OwnerID() {}","function OwnerID() {}","function OwnerID() {}","function OwnerID() {}","function OwnerID() {}","function OwnerID() {}","function OwnerID() {}","function OwnerID() {}","function OwnerID() {}","function OwnerID() {}","function OwnerID() {}","function OwnerID() {}","function OwnerID() {}","function OwnerID() {}","function OwnerID() {}","function OwnerID() {}","function OwnerID() {}","function OwnerID() {}","function OwnerID() {}","function OwnerID() {}","function OwnerID() {}","function OwnerID() {}","function OwnerID() {}","function OwnerID() {}","function OwnerID() {}","function OwnerID() {}","function OwnerID() {}","findOwners() {\n return this._getRelationship('owner', 'from');\n }","function setOwnership(country, selectedPlayer){\n\tcountry.owner = selectedPlayer;\n\tcountry.style.border = \"5px solid \" + selectedPlayer.colour;\n}","function ownedByLuke(pet) {\n return pet.ownerName == \"Luke\";\n}","static revive(projectObject)\n {\n let realProject = new Project();\n realProject.name = projectObject.name;\n realProject.team = projectObject.team;\n realProject.tasks = projectObject.tasks;\n\n for(let i = 0;i < realProject.team.length; i++)\n {\n let memberObject = realProject.team[i];\n let realMember = new Member(memberObject.color, memberObject.name);\n realProject.team[i] = realMember;\n }\n\n for(let i = 0;i < realProject.tasks.length; i++)\n {\n let taskObject= realProject.tasks[i];\n let realTask = new Task();\n\n realTask.name = taskObject.name;\n realTask.from = new Date(taskObject.from);\n realTask.to = new Date(taskObject.to);\n realTask.finished = taskObject.finished;\n realTask.workingOn = taskObject.workingOn;\n if(taskObject.inCharge !== undefined)\n {\n realTask.inCharge = getMember(realProject.team, taskObject.inCharge.name, taskObject.inCharge.color);\n }\n\n for(let j = 0;j < realTask.workingOn.length; j++)\n {\n let memberObject = realTask.workingOn[j];\n let realMember = getMember(realProject.team, memberObject.name, memberObject.color);\n realTask.workingOn[j] = realMember;\n }\n\n realProject.tasks[i] = realTask;\n }\n\n return realProject;\n }","joinTeam(team) {\n team.members.push(this)\n }","function teamObj(id, teamMembers, teamName, currentStanding){\n\t\tthis.teamId = id;\n\t\tthis.teamMembers = teamMembers;\n\t\tthis.teamName = teamName;\n\t\tthis.currentStanding = currentStanding;\n\t\tthis.totalDrinks = 0;\n\t\tthis.playersPlaced = 0;\n\t\tthis.disableDrinks = \"\";\n\t\tthis.drank = false;\n\t}","function OwnerID() { }","function getOwner(){\n return owner;\n }","async function getTeamInfo() {\n try{\n let myData = await fetch('https://fantasy.premierleague.com/api/me/', {});\n let myDataJSON = await myData.json();\n\n let teamId = myDataJSON.player.entry;\n let myTeam = await fetch(`https://fantasy.premierleague.com/api/my-team/${teamId}/`, {});\n let myTeamJSON = await myTeam.json();\n\n myTeamJSON.teamId = teamId;\n //console.log(myTeamJSON);\n return myTeamJSON;\n } catch (e) {\n return {};\n }\n}","function joinTeam(input) { }","function Team(client){\n\tthis.client = client;\n\tthis.myTanks = {};\n\tthis.init();\n}","addFollowerSpecific() {\n this.definition.extendedType = NSmartContract.SmartContractType.FOLLOWER1;\n\n let ownerLink = new roles.RoleLink(\"owner_link\", \"owner\");\n this.registerRole(ownerLink);\n\n let fieldsMap = {};\n fieldsMap[\"action\"] = null;\n fieldsMap[\"/expires_at\"] = null;\n fieldsMap[FollowerContract.PAID_U_FIELD_NAME] = null;\n fieldsMap[FollowerContract.PREPAID_OD_FIELD_NAME] = null;\n fieldsMap[FollowerContract.PREPAID_FROM_TIME_FIELD_NAME] = null;\n fieldsMap[FollowerContract.FOLLOWED_ORIGINS_FIELD_NAME] = null;\n fieldsMap[FollowerContract.SPENT_OD_FIELD_NAME] = null;\n fieldsMap[FollowerContract.SPENT_OD_TIME_FIELD_NAME] = null;\n fieldsMap[FollowerContract.CALLBACK_RATE_FIELD_NAME] = null;\n fieldsMap[FollowerContract.TRACKING_ORIGINS_FIELD_NAME] = null;\n fieldsMap[FollowerContract.CALLBACK_KEYS_FIELD_NAME] = null;\n\n let modifyDataPermission = new permissions.ModifyDataPermission(ownerLink, {fields : fieldsMap});\n this.definition.addPermission(modifyDataPermission);\n }"],"string":"[\n \"get owners() {\\r\\n return new Owners(this);\\r\\n }\",\n \"function getProjectMembersOrTenderers() {\\n $scope.membersList = $rootScope.getProjectMembers(people);\\n $scope.tags = [];\\n _.each($rootScope.currentTeam.fileTags, function(tag) {\\n $scope.tags.push({name: tag, select: false});\\n });\\n \\n // get unique member \\n $scope.membersList = _.uniq($scope.membersList, \\\"_id\\\");\\n\\n // filter members list again\\n _.each(file.members, function(member) {\\n _.remove($scope.membersList, {_id: member._id});\\n });\\n\\n // remove current user from the members list\\n _.remove($scope.membersList, {_id: $rootScope.currentUser._id});\\n\\n // remove the file owner from available assignees\\n _.remove($scope.membersList, {_id: $scope.file.owner._id})\\n\\n // get invitees for related item\\n $scope.invitees = angular.copy($scope.file.members);\\n _.each($scope.file.notMembers, function(member) {\\n $scope.invitees.push({email: member});\\n });\\n $scope.invitees.push($scope.file.owner);\\n $scope.invitees = _.uniq($scope.invitees, \\\"email\\\");\\n _.remove($scope.invitees, {_id: $rootScope.currentUser._id});\\n }\",\n \"function getUserTeam() {\\n API.getTeam(user.email)\\n .then(res => {\\n if (res.data != null) {\\n setTeam(res.data)\\n setTeamPlayers(res.data.players);\\n }\\n })\\n .catch(err => console.log(err))\\n setTeam({ ...team, owner: user.email })\\n }\",\n \"getOwners() {\\n return this.owners;\\n }\",\n \"get owner() { return this.ownerIn; }\",\n \"function Company(obj) {\\n return obj.team && Team(obj.team);\\n}\",\n \"getMultiOwnerInfo() {\\n if (this._payingUsers.length <= 1) { return null; }\\n const info = [];\\n this._payingUsers.forEach((payerObj) => {\\n const portionOfTipOwed = (payerObj.percentage / 100) * (this.tip || 0);\\n const portionOfInvoiceOwed = (payerObj.percentage / 100) * this.addServiceFee(this.amount);\\n const totalPaidAmt = (portionOfTipOwed + portionOfInvoiceOwed).toFixed(2);\\n const ownerInfo = {\\n name: payerObj._user.name,\\n percentage: payerObj.percentage,\\n paidAmount: totalPaidAmt,\\n };\\n info.push(ownerInfo);\\n });\\n return info;\\n }\",\n \"function Players(name, age, goals, cards) {\\n this.team = 'Barcelona';\\n this.name = name;\\n this.age = age;\\n this.goals = goals;\\n this.yellowCards = cards;\\n}\",\n \"function Players(name, age, goals, cards) {\\n this.team = 'Barcelona';\\n this.name = name;\\n this.age = age;\\n this.goals = goals;\\n this.yellowCards = cards;\\n}\",\n \"get team() {\\r\\n return new Team(this);\\r\\n }\",\n \"function footballTeam (player){\\n\\tvar teamobj = {}\\n\\tteamobj.player = player;\\n\\tteamobj.addInfo =addInfo;\\n\\tteamobj.arrayOfPlayers= [];\\n\\tteamobj.increaseLevel=increaseLevel;\\n\\tteamobj.isAvailable=isAvailable;\\n\\tteamobj.decrease=decrease;\\n\\tteamobj.sortPalyerBy=sortPalyerBy;\\n\\treturn teamobj\\n}\",\n \"function OwnerID() {}\",\n \"function OwnerID() {}\",\n \"function OwnerID() {}\",\n \"function OwnerID() {}\",\n \"function OwnerID() {}\",\n \"function OwnerID() {}\",\n \"function OwnerID() {}\",\n \"function OwnerID() {}\",\n \"function OwnerID() {}\",\n \"function OwnerID() {}\",\n \"function OwnerID() {}\",\n \"function OwnerID() {}\",\n \"function OwnerID() {}\",\n \"function OwnerID() {}\",\n \"function OwnerID() {}\",\n \"function OwnerID() {}\",\n \"function OwnerID() {}\",\n \"function OwnerID() {}\",\n \"function OwnerID() {}\",\n \"function OwnerID() {}\",\n \"function OwnerID() {}\",\n \"function OwnerID() {}\",\n \"function OwnerID() {}\",\n \"function OwnerID() {}\",\n \"function OwnerID() {}\",\n \"function OwnerID() {}\",\n \"function OwnerID() {}\",\n \"function OwnerID() {}\",\n \"function OwnerID() {}\",\n \"function OwnerID() {}\",\n \"function OwnerID() {}\",\n \"function OwnerID() {}\",\n \"function OwnerID() {}\",\n \"function OwnerID() {}\",\n \"function OwnerID() {}\",\n \"function OwnerID() {}\",\n \"function OwnerID() {}\",\n \"function OwnerID() {}\",\n \"function OwnerID() {}\",\n \"function OwnerID() {}\",\n \"function OwnerID() {}\",\n \"function OwnerID() {}\",\n \"function OwnerID() {}\",\n \"function OwnerID() {}\",\n \"function OwnerID() {}\",\n \"function OwnerID() {}\",\n \"function OwnerID() {}\",\n \"function OwnerID() {}\",\n \"function OwnerID() {}\",\n \"function OwnerID() {}\",\n \"function OwnerID() {}\",\n \"function OwnerID() {}\",\n \"function OwnerID() {}\",\n \"function OwnerID() {}\",\n \"function OwnerID() {}\",\n \"function OwnerID() {}\",\n \"function OwnerID() {}\",\n \"function OwnerID() {}\",\n \"function OwnerID() {}\",\n \"function OwnerID() {}\",\n \"function OwnerID() {}\",\n \"function OwnerID() {}\",\n \"function OwnerID() {}\",\n \"function OwnerID() {}\",\n \"function OwnerID() {}\",\n \"function OwnerID() {}\",\n \"function OwnerID() {}\",\n \"function OwnerID() {}\",\n \"function OwnerID() {}\",\n \"function OwnerID() {}\",\n \"function OwnerID() {}\",\n \"function OwnerID() {}\",\n \"function OwnerID() {}\",\n \"function OwnerID() {}\",\n \"function OwnerID() {}\",\n \"function OwnerID() {}\",\n \"function OwnerID() {}\",\n \"findOwners() {\\n return this._getRelationship('owner', 'from');\\n }\",\n \"function setOwnership(country, selectedPlayer){\\n\\tcountry.owner = selectedPlayer;\\n\\tcountry.style.border = \\\"5px solid \\\" + selectedPlayer.colour;\\n}\",\n \"function ownedByLuke(pet) {\\n return pet.ownerName == \\\"Luke\\\";\\n}\",\n \"static revive(projectObject)\\n {\\n let realProject = new Project();\\n realProject.name = projectObject.name;\\n realProject.team = projectObject.team;\\n realProject.tasks = projectObject.tasks;\\n\\n for(let i = 0;i < realProject.team.length; i++)\\n {\\n let memberObject = realProject.team[i];\\n let realMember = new Member(memberObject.color, memberObject.name);\\n realProject.team[i] = realMember;\\n }\\n\\n for(let i = 0;i < realProject.tasks.length; i++)\\n {\\n let taskObject= realProject.tasks[i];\\n let realTask = new Task();\\n\\n realTask.name = taskObject.name;\\n realTask.from = new Date(taskObject.from);\\n realTask.to = new Date(taskObject.to);\\n realTask.finished = taskObject.finished;\\n realTask.workingOn = taskObject.workingOn;\\n if(taskObject.inCharge !== undefined)\\n {\\n realTask.inCharge = getMember(realProject.team, taskObject.inCharge.name, taskObject.inCharge.color);\\n }\\n\\n for(let j = 0;j < realTask.workingOn.length; j++)\\n {\\n let memberObject = realTask.workingOn[j];\\n let realMember = getMember(realProject.team, memberObject.name, memberObject.color);\\n realTask.workingOn[j] = realMember;\\n }\\n\\n realProject.tasks[i] = realTask;\\n }\\n\\n return realProject;\\n }\",\n \"joinTeam(team) {\\n team.members.push(this)\\n }\",\n \"function teamObj(id, teamMembers, teamName, currentStanding){\\n\\t\\tthis.teamId = id;\\n\\t\\tthis.teamMembers = teamMembers;\\n\\t\\tthis.teamName = teamName;\\n\\t\\tthis.currentStanding = currentStanding;\\n\\t\\tthis.totalDrinks = 0;\\n\\t\\tthis.playersPlaced = 0;\\n\\t\\tthis.disableDrinks = \\\"\\\";\\n\\t\\tthis.drank = false;\\n\\t}\",\n \"function OwnerID() { }\",\n \"function getOwner(){\\n return owner;\\n }\",\n \"async function getTeamInfo() {\\n try{\\n let myData = await fetch('https://fantasy.premierleague.com/api/me/', {});\\n let myDataJSON = await myData.json();\\n\\n let teamId = myDataJSON.player.entry;\\n let myTeam = await fetch(`https://fantasy.premierleague.com/api/my-team/${teamId}/`, {});\\n let myTeamJSON = await myTeam.json();\\n\\n myTeamJSON.teamId = teamId;\\n //console.log(myTeamJSON);\\n return myTeamJSON;\\n } catch (e) {\\n return {};\\n }\\n}\",\n \"function joinTeam(input) { }\",\n \"function Team(client){\\n\\tthis.client = client;\\n\\tthis.myTanks = {};\\n\\tthis.init();\\n}\",\n \"addFollowerSpecific() {\\n this.definition.extendedType = NSmartContract.SmartContractType.FOLLOWER1;\\n\\n let ownerLink = new roles.RoleLink(\\\"owner_link\\\", \\\"owner\\\");\\n this.registerRole(ownerLink);\\n\\n let fieldsMap = {};\\n fieldsMap[\\\"action\\\"] = null;\\n fieldsMap[\\\"/expires_at\\\"] = null;\\n fieldsMap[FollowerContract.PAID_U_FIELD_NAME] = null;\\n fieldsMap[FollowerContract.PREPAID_OD_FIELD_NAME] = null;\\n fieldsMap[FollowerContract.PREPAID_FROM_TIME_FIELD_NAME] = null;\\n fieldsMap[FollowerContract.FOLLOWED_ORIGINS_FIELD_NAME] = null;\\n fieldsMap[FollowerContract.SPENT_OD_FIELD_NAME] = null;\\n fieldsMap[FollowerContract.SPENT_OD_TIME_FIELD_NAME] = null;\\n fieldsMap[FollowerContract.CALLBACK_RATE_FIELD_NAME] = null;\\n fieldsMap[FollowerContract.TRACKING_ORIGINS_FIELD_NAME] = null;\\n fieldsMap[FollowerContract.CALLBACK_KEYS_FIELD_NAME] = null;\\n\\n let modifyDataPermission = new permissions.ModifyDataPermission(ownerLink, {fields : fieldsMap});\\n this.definition.addPermission(modifyDataPermission);\\n }\"\n]","isConversational":false},"negative_scores":{"kind":"list like","value":["0.6072791","0.60671264","0.5977277","0.58441657","0.5806571","0.572325","0.57117057","0.57033056","0.57033056","0.56819993","0.56730604","0.5668324","0.5668324","0.5668324","0.5668324","0.5668324","0.5668324","0.5668324","0.5668324","0.5668324","0.5668324","0.5668324","0.5668324","0.5668324","0.5668324","0.5668324","0.5668324","0.5668324","0.5668324","0.5668324","0.5668324","0.5668324","0.5668324","0.5668324","0.5668324","0.5668324","0.5668324","0.5668324","0.5668324","0.5668324","0.5668324","0.5668324","0.5668324","0.5668324","0.5668324","0.5668324","0.5668324","0.5668324","0.5668324","0.5668324","0.5668324","0.5668324","0.5668324","0.5668324","0.5668324","0.5668324","0.5668324","0.5668324","0.5668324","0.5668324","0.5668324","0.5668324","0.5668324","0.5668324","0.5668324","0.5668324","0.5668324","0.5668324","0.5668324","0.5668324","0.5668324","0.5668324","0.5668324","0.5668324","0.5668324","0.5668324","0.5668324","0.5668324","0.5668324","0.5668324","0.5668324","0.5668324","0.5668324","0.5668324","0.5668324","0.5668324","0.5668324","0.5668324","0.5665458","0.5664456","0.56610847","0.56477314","0.56461716","0.5636138","0.5625381","0.561756","0.5613478","0.5573967","0.55531096","0.5547978"],"string":"[\n \"0.6072791\",\n \"0.60671264\",\n \"0.5977277\",\n \"0.58441657\",\n \"0.5806571\",\n \"0.572325\",\n \"0.57117057\",\n \"0.57033056\",\n \"0.57033056\",\n \"0.56819993\",\n \"0.56730604\",\n \"0.5668324\",\n \"0.5668324\",\n \"0.5668324\",\n \"0.5668324\",\n \"0.5668324\",\n \"0.5668324\",\n \"0.5668324\",\n \"0.5668324\",\n \"0.5668324\",\n \"0.5668324\",\n \"0.5668324\",\n \"0.5668324\",\n \"0.5668324\",\n \"0.5668324\",\n \"0.5668324\",\n \"0.5668324\",\n \"0.5668324\",\n \"0.5668324\",\n \"0.5668324\",\n \"0.5668324\",\n \"0.5668324\",\n \"0.5668324\",\n \"0.5668324\",\n \"0.5668324\",\n \"0.5668324\",\n \"0.5668324\",\n \"0.5668324\",\n \"0.5668324\",\n \"0.5668324\",\n \"0.5668324\",\n \"0.5668324\",\n \"0.5668324\",\n \"0.5668324\",\n \"0.5668324\",\n \"0.5668324\",\n \"0.5668324\",\n \"0.5668324\",\n \"0.5668324\",\n \"0.5668324\",\n \"0.5668324\",\n \"0.5668324\",\n \"0.5668324\",\n \"0.5668324\",\n \"0.5668324\",\n \"0.5668324\",\n \"0.5668324\",\n \"0.5668324\",\n \"0.5668324\",\n \"0.5668324\",\n \"0.5668324\",\n \"0.5668324\",\n \"0.5668324\",\n \"0.5668324\",\n \"0.5668324\",\n \"0.5668324\",\n \"0.5668324\",\n \"0.5668324\",\n \"0.5668324\",\n \"0.5668324\",\n \"0.5668324\",\n \"0.5668324\",\n \"0.5668324\",\n \"0.5668324\",\n \"0.5668324\",\n \"0.5668324\",\n \"0.5668324\",\n \"0.5668324\",\n \"0.5668324\",\n \"0.5668324\",\n \"0.5668324\",\n \"0.5668324\",\n \"0.5668324\",\n \"0.5668324\",\n \"0.5668324\",\n \"0.5668324\",\n \"0.5668324\",\n \"0.5668324\",\n \"0.5665458\",\n \"0.5664456\",\n \"0.56610847\",\n \"0.56477314\",\n \"0.56461716\",\n \"0.5636138\",\n \"0.5625381\",\n \"0.561756\",\n \"0.5613478\",\n \"0.5573967\",\n \"0.55531096\",\n \"0.5547978\"\n]","isConversational":false},"document_score":{"kind":"string","value":"0.6414082"},"document_rank":{"kind":"string","value":"0"}}},{"rowIdx":4594,"cells":{"query":{"kind":"string","value":"P R I V A T E"},"document":{"kind":"string","value":"async getAllTokens(page, options) {\n const tokens = [];\n let teamsList = await page.$$(`${CbsAPI.teams.prefixSelector}${options.sport}${CbsAPI.teams.suffixSelector}`);\n console.log(`[cbs api] - found ${teamsList.length} team(s)`);\n const hrefs = [];\n for (let i = 0; i < teamsList.length; i++) {\n const prop = await teamsList[i].getProperty('href');\n const href = await prop.jsonValue();\n hrefs.push(href);\n }\n for (let i = 0; i <hrefs.length; i++) {\n console.log(`[cbs api] - navigate to ${hrefs[i]} to get check league type and access_token`);\n const token = await this.getAccessToken(page, hrefs[i]);\n tokens.push(token);\n }\n return tokens.filter(token => CbsAPI.allowedTypes.includes(token.leagueType));\n }"},"metadata":{"kind":"string","value":"{\n \"objective\": {\n \"self\": [],\n \"paired\": [],\n \"triplet\": [\n [\n \"query\",\n \"document\",\n \"negatives\"\n ]\n ]\n }\n}"},"negatives":{"kind":"list like","value":["private public function m246() {}","private internal function m248() {}","protected internal function m252() {}","transient private internal function m185() {}","transient protected internal function m189() {}","static private internal function m121() {}","transient private protected internal function m182() {}","obtain(){}","function _p(t,e){0}","static transient final private internal function m43() {}","static transient final protected internal function m47() {}","transient final protected internal function m174() {}","function i(e,t){0}","function i(e,t){0}","function i(e,t){0}","function i(e,t){0}","function i(e,t){0}","function i(e,t){0}","function i(e,t){0}","function i(e,t){0}","function i(e,t){0}","function i(e,t){0}","function i(e,t){0}","function i(e,t){0}","function i(e,t){0}","function i(e,t){0}","function i(e,t){0}","function i(e,t){0}","function i(e,t){0}","function i(e,t){0}","function i(e,t){0}","function i(e,t){0}","function i(e,t){0}","function i(e,t){0}","function i(e,t){0}","function i(e,t){0}","function i(e,t){0}","function i(e,t){0}","function i(e,t){0}","function i(e,t){0}","function i(e,t){0}","function i(e,t){0}","function i(e,t){0}","function i(e,t){0}","function i(e,t){0}","function i(e,t){0}","function i(e,t){0}","function i(e,t){0}","function i(e,t){0}","function i(e,t){0}","function i(e,t){0}","function i(e,t){0}","function i(e,t){0}","function i(e,t){0}","function i(e,t){0}","function i(e,t){0}","function i(e,t){0}","function i(e,t){0}","function i(e,t){0}","function i(e,t){0}","function i(e,t){0}","function i(e,t){0}","function i(e,t){0}","function i(e,t){0}","function i(e,t){0}","function i(e,t){0}","function i(e,t){0}","function i(e,t){0}","function i(e,t){0}","function i(e,t){0}","function i(e,t){0}","function i(e,t){0}","function i(e,t){0}","function i(e,t){0}","function i(e,t){0}","function i(e,t){0}","function i(e,t){0}","function i(e,t){0}","function i(e,t){0}","function i(e,t){0}","function i(e,t){0}","function i(e,t){0}","function i(e,t){0}","function i(e,t){0}","function i(e,t){0}","function i(e,t){0}","function i(e,t){0}","function i(e,t){0}","function i(e,t){0}","function i(e,t){0}","function i(e,t){0}","function i(e,t){0}","function i(e,t){0}","function i(e,t){0}","function i(e,t){0}","function i(e,t){0}","function i(e,t){0}","function i(e,t){0}","function i(e,t){0}","function i(e,t){0}","function i(e,t){0}"],"string":"[\n \"private public function m246() {}\",\n \"private internal function m248() {}\",\n \"protected internal function m252() {}\",\n \"transient private internal function m185() {}\",\n \"transient protected internal function m189() {}\",\n \"static private internal function m121() {}\",\n \"transient private protected internal function m182() {}\",\n \"obtain(){}\",\n \"function _p(t,e){0}\",\n \"static transient final private internal function m43() {}\",\n \"static transient final protected internal function m47() {}\",\n \"transient final protected internal function m174() {}\",\n \"function i(e,t){0}\",\n \"function i(e,t){0}\",\n \"function i(e,t){0}\",\n \"function i(e,t){0}\",\n \"function i(e,t){0}\",\n \"function i(e,t){0}\",\n \"function i(e,t){0}\",\n \"function i(e,t){0}\",\n \"function i(e,t){0}\",\n \"function i(e,t){0}\",\n \"function i(e,t){0}\",\n \"function i(e,t){0}\",\n \"function i(e,t){0}\",\n \"function i(e,t){0}\",\n \"function i(e,t){0}\",\n \"function i(e,t){0}\",\n \"function i(e,t){0}\",\n \"function i(e,t){0}\",\n \"function i(e,t){0}\",\n \"function i(e,t){0}\",\n \"function i(e,t){0}\",\n \"function i(e,t){0}\",\n \"function i(e,t){0}\",\n \"function i(e,t){0}\",\n \"function i(e,t){0}\",\n \"function i(e,t){0}\",\n \"function i(e,t){0}\",\n \"function i(e,t){0}\",\n \"function i(e,t){0}\",\n \"function i(e,t){0}\",\n \"function i(e,t){0}\",\n \"function i(e,t){0}\",\n \"function i(e,t){0}\",\n \"function i(e,t){0}\",\n \"function i(e,t){0}\",\n \"function i(e,t){0}\",\n \"function i(e,t){0}\",\n \"function i(e,t){0}\",\n \"function i(e,t){0}\",\n \"function i(e,t){0}\",\n \"function i(e,t){0}\",\n \"function i(e,t){0}\",\n \"function i(e,t){0}\",\n \"function i(e,t){0}\",\n \"function i(e,t){0}\",\n \"function i(e,t){0}\",\n \"function i(e,t){0}\",\n \"function i(e,t){0}\",\n \"function i(e,t){0}\",\n \"function i(e,t){0}\",\n \"function i(e,t){0}\",\n \"function i(e,t){0}\",\n \"function i(e,t){0}\",\n \"function i(e,t){0}\",\n \"function i(e,t){0}\",\n \"function i(e,t){0}\",\n \"function i(e,t){0}\",\n \"function i(e,t){0}\",\n \"function i(e,t){0}\",\n \"function i(e,t){0}\",\n \"function i(e,t){0}\",\n \"function i(e,t){0}\",\n \"function i(e,t){0}\",\n \"function i(e,t){0}\",\n \"function i(e,t){0}\",\n \"function i(e,t){0}\",\n \"function i(e,t){0}\",\n \"function i(e,t){0}\",\n \"function i(e,t){0}\",\n \"function i(e,t){0}\",\n \"function i(e,t){0}\",\n \"function i(e,t){0}\",\n \"function i(e,t){0}\",\n \"function i(e,t){0}\",\n \"function i(e,t){0}\",\n \"function i(e,t){0}\",\n \"function i(e,t){0}\",\n \"function i(e,t){0}\",\n \"function i(e,t){0}\",\n \"function i(e,t){0}\",\n \"function i(e,t){0}\",\n \"function i(e,t){0}\",\n \"function i(e,t){0}\",\n \"function i(e,t){0}\",\n \"function i(e,t){0}\",\n \"function i(e,t){0}\",\n \"function i(e,t){0}\",\n \"function i(e,t){0}\",\n \"function i(e,t){0}\"\n]","isConversational":false},"negative_scores":{"kind":"list like","value":["0.6497584","0.6456844","0.60105735","0.6008095","0.5982573","0.59378886","0.5866038","0.5724313","0.5679906","0.564659","0.5587861","0.55853236","0.55626935","0.55626935","0.55626935","0.55626935","0.55626935","0.55626935","0.55626935","0.55626935","0.55626935","0.55626935","0.55626935","0.55626935","0.55626935","0.55626935","0.55626935","0.55626935","0.55626935","0.55626935","0.55626935","0.55626935","0.55626935","0.55626935","0.55626935","0.55626935","0.55626935","0.55626935","0.55626935","0.55626935","0.55626935","0.55626935","0.55626935","0.55626935","0.55626935","0.55626935","0.55626935","0.55626935","0.55626935","0.55626935","0.55626935","0.55626935","0.55626935","0.55626935","0.55626935","0.55626935","0.55626935","0.55626935","0.55626935","0.55626935","0.55626935","0.55626935","0.55626935","0.55626935","0.55626935","0.55626935","0.55626935","0.55626935","0.55626935","0.55626935","0.55626935","0.55626935","0.55626935","0.55626935","0.55626935","0.55626935","0.55626935","0.55626935","0.55626935","0.55626935","0.55626935","0.55626935","0.55626935","0.55626935","0.55626935","0.55626935","0.55626935","0.55626935","0.55626935","0.55626935","0.55626935","0.55626935","0.55626935","0.55626935","0.55626935","0.55626935","0.55626935","0.55626935","0.55626935","0.55626935","0.55626935"],"string":"[\n \"0.6497584\",\n \"0.6456844\",\n \"0.60105735\",\n \"0.6008095\",\n \"0.5982573\",\n \"0.59378886\",\n \"0.5866038\",\n \"0.5724313\",\n \"0.5679906\",\n \"0.564659\",\n \"0.5587861\",\n \"0.55853236\",\n \"0.55626935\",\n \"0.55626935\",\n \"0.55626935\",\n \"0.55626935\",\n \"0.55626935\",\n \"0.55626935\",\n \"0.55626935\",\n \"0.55626935\",\n \"0.55626935\",\n \"0.55626935\",\n \"0.55626935\",\n \"0.55626935\",\n \"0.55626935\",\n \"0.55626935\",\n \"0.55626935\",\n \"0.55626935\",\n \"0.55626935\",\n \"0.55626935\",\n \"0.55626935\",\n \"0.55626935\",\n \"0.55626935\",\n \"0.55626935\",\n \"0.55626935\",\n \"0.55626935\",\n \"0.55626935\",\n \"0.55626935\",\n \"0.55626935\",\n \"0.55626935\",\n \"0.55626935\",\n \"0.55626935\",\n \"0.55626935\",\n \"0.55626935\",\n \"0.55626935\",\n \"0.55626935\",\n \"0.55626935\",\n \"0.55626935\",\n \"0.55626935\",\n \"0.55626935\",\n \"0.55626935\",\n \"0.55626935\",\n \"0.55626935\",\n \"0.55626935\",\n \"0.55626935\",\n \"0.55626935\",\n \"0.55626935\",\n \"0.55626935\",\n \"0.55626935\",\n \"0.55626935\",\n \"0.55626935\",\n \"0.55626935\",\n \"0.55626935\",\n \"0.55626935\",\n \"0.55626935\",\n \"0.55626935\",\n \"0.55626935\",\n \"0.55626935\",\n \"0.55626935\",\n \"0.55626935\",\n \"0.55626935\",\n \"0.55626935\",\n \"0.55626935\",\n \"0.55626935\",\n \"0.55626935\",\n \"0.55626935\",\n \"0.55626935\",\n \"0.55626935\",\n \"0.55626935\",\n \"0.55626935\",\n \"0.55626935\",\n \"0.55626935\",\n \"0.55626935\",\n \"0.55626935\",\n \"0.55626935\",\n \"0.55626935\",\n \"0.55626935\",\n \"0.55626935\",\n \"0.55626935\",\n \"0.55626935\",\n \"0.55626935\",\n \"0.55626935\",\n \"0.55626935\",\n \"0.55626935\",\n \"0.55626935\",\n \"0.55626935\",\n \"0.55626935\",\n \"0.55626935\",\n \"0.55626935\",\n \"0.55626935\",\n \"0.55626935\"\n]","isConversational":false},"document_score":{"kind":"string","value":"0.0"},"document_rank":{"kind":"string","value":"-1"}}},{"rowIdx":4595,"cells":{"query":{"kind":"string","value":"Function plots cartesian coordiate system"},"document":{"kind":"string","value":"function plotCartesian(x,y,z, target){\n\n let hoverlabel = [\"X: \"+x[0]+\", Y: \"+y[0]+\", Z: \"+z[0],\"X: \"+x[1]+\", Y: \"+y[1]+\", Z: \"+z[1]];\n var data = [{\n type: 'scatter3d',\n mode: 'lines',\n x: x,\n y: y,\n z: z,\n hoverinfo: 'text',\n hovertext: hoverlabel,\n opacity: 1,\n line: {\n width: 6,\n color: \"rgb(0,0,0)\"\n }\n }]\n\n var layout = {\n \tscene: {\n \t\txaxis:{title: 'X AXIS'},\n \t\tyaxis:{title: 'Y AXIS'},\n \t\tzaxis:{title: 'Z AXIS'},\n \t\t}\n }\n\n Plotly.plot(target, data, layout);\n}"},"metadata":{"kind":"string","value":"{\n \"objective\": {\n \"self\": [],\n \"paired\": [],\n \"triplet\": [\n [\n \"query\",\n \"document\",\n \"negatives\"\n ]\n ]\n }\n}"},"negatives":{"kind":"list like","value":["function drawCartesianOverlay() {\n \"use strict\";\n //Draw heavier black lines for grid\n ctx.beginPath();\n ctx.moveTo(0.5, 300.5);\n ctx.lineTo(800.5, 300.5);\n ctx.moveTo(400.5, 0.5);\n ctx.lineTo(400.5, 600.5);\n ctx.strokeStyle = 'black';\n ctx.lineWidth = 1.0;\n ctx.stroke();\n //-x arrow for line\n ctx.beginPath();\n ctx.moveTo(5.5, 295.5);\n ctx.lineTo(0.5, 300.5);\n ctx.lineTo(5.5, 305.5);\n //+x arrow for line\n ctx.moveTo(795.5, 295.5);\n ctx.lineTo(800.5, 300.5);\n ctx.lineTo(795.5, 305.5);\n //+y arrow for line\n ctx.moveTo(395.5, 5.0);\n ctx.lineTo(400.5, 0.5);\n ctx.lineTo(405.5, 5.0);\n //-y arrow for line\n ctx.moveTo(395.5, 595.5);\n ctx.lineTo(400.5, 600.5);\n ctx.lineTo(405.5, 595.5);\n ctx.strokeStyle = 'black';\n ctx.lineWidth = 1.0;\n ctx.stroke();\n //Label Graphs\n ctx.font = \"9px Georgia\";\n ctx.fillText(\"-x\", 1, 288);\n ctx.fillText(\"+\", 790, 288);\n ctx.fillText(\"x\", 795, 288);\n ctx.fillText(\"-y\", 382, 597);\n ctx.fillText(\"+\", 381, 8);\n ctx.fillText(\"y\", 386, 8);\n}","function plotGrid() {\n for (let i = 0; i < grid.length; i++) {\n for (let j = 0; j < grid[i].length; j++) {\n plotRectangle(i, j);\n }\n }\n }","axisPlot() {\n this.ctx = this.canvas.getContext(\"2d\");\n\n /**\n * Grid grid\n */\n if (this.grid.grid) {\n this.ctx.beginPath();\n this.ctx.font = 'italic 18pt Calibri';\n this.ctx.strokeStyle = '#979797';\n this.ctx.lineWidth = 1;\n this.ctx.setLineDash([10, 15]);\n for (let i = 30; i < this.field.width; i+= 100) {\n this.ctx.fillText(Math.ceil(this.ScreenToWorldY(i)*1000)/1000, 0, i);\n this.ctx.moveTo(0, i);\n this.ctx.lineTo(this.field.width, i);\n }\n for (let i = 100; i < this.field.width; i+= 100) {\n this.ctx.fillText(Math.ceil(this.ScreenToWorldX(i)*1000)/1000, i, this.field.height);\n this.ctx.moveTo(i, 0);\n this.ctx.lineTo(i, this.field.height);\n }\n this.ctx.stroke();\n this.ctx.closePath();\n }\n\n\n /**\n * Grid axiss\n */\n if (this.grid.axiss) {\n this.ctx.beginPath();\n this.ctx.strokeStyle = '#b10009';\n this.ctx.lineWidth = 2;\n this.ctx.setLineDash([]);\n\n this.ctx.moveTo(this.center.x, 0);\n this.ctx.lineTo(this.center.x, this.field.height);\n\n this.ctx.moveTo(0, this.center.y);\n this.ctx.lineTo(this.field.width, this.center.y);\n\n this.ctx.stroke();\n this.ctx.closePath();\n }\n\n\n if (this.grid.serifs) {\n this.ctx.beginPath();\n this.ctx.strokeStyle = '#058600';\n this.ctx.fillStyle = '#888888'\n this.ctx.lineWidth = 2;\n this.ctx.setLineDash([]);\n\n let start = 0;\n if (!this.grid.serifsStep){\n return;\n }\n\n let s = Math.abs(\n this.ScreenToWorldY(0) -\n this.ScreenToWorldY(this.grid.serifsSize)\n );\n\n /**\n * To right & to left\n */\n if ((this.center.y > 0) && (this.center.y < this.field.height)) {\n\n let finish = this.ScreenToWorldX(this.field.width);\n\n for (let i = start; i < finish; i+=this.grid.serifsStep) {\n this.moveTo(i+this.grid.serifsStep/2,(s/2));\n this.lineTo(i+this.grid.serifsStep/2,-(s/2));\n this.ctx.fillText(i+this.grid.serifsStep/2, this.WorldToScreenX(i+this.grid.serifsStep/2), this.WorldToScreenY(s/2));\n\n this.moveTo(i+this.grid.serifsStep,s);\n this.lineTo(i+this.grid.serifsStep,-s);\n this.ctx.fillText(i+this.grid.serifsStep, this.WorldToScreenX(i+this.grid.serifsStep), this.WorldToScreenY(s));\n }\n\n finish = this.ScreenToWorldX(0);\n\n for (let i = start; i > finish; i-=this.grid.serifsStep) {\n this.moveTo(i-this.grid.serifsStep/2,(s/2));\n this.lineTo(i-this.grid.serifsStep/2,-(s/2));\n this.ctx.fillText(i-this.grid.serifsStep/2, this.WorldToScreenX(i-this.grid.serifsStep/2), this.WorldToScreenY(s/2));\n\n this.moveTo(i-this.grid.serifsStep,s);\n this.lineTo(i-this.grid.serifsStep,-s);\n this.ctx.fillText(i-this.grid.serifsStep, this.WorldToScreenX(i-this.grid.serifsStep), this.WorldToScreenY(s));\n }\n }\n\n /**\n * To top & to bot\n */\n if ((this.center.x > 0) && (this.center.x < this.field.width)) {\n\n start = 0;\n let finish = this.ScreenToWorldY(0);\n\n for (let i = start; i < finish; i+=this.grid.serifsStep) {\n this.moveTo((s/2),i+this.grid.serifsStep/2);\n this.lineTo(-(s/2),i+this.grid.serifsStep/2);\n this.ctx.fillText(i+this.grid.serifsStep/2, this.WorldToScreenX(s/2), this.WorldToScreenY(i+this.grid.serifsStep/2));\n\n this.moveTo(s, i+this.grid.serifsStep);\n this.lineTo(-s, i+this.grid.serifsStep);\n this.ctx.fillText(i+this.grid.serifsStep, this.WorldToScreenX(s), this.WorldToScreenY(i+this.grid.serifsStep));\n }\n\n finish = this.ScreenToWorldY(this.field.width);\n\n for (let i = start; i > finish-this.grid.serifsStep; i-=this.grid.serifsStep) {\n this.moveTo((s/2),i+this.grid.serifsStep/2);\n this.lineTo(-(s/2),i+this.grid.serifsStep/2);\n this.ctx.fillText(i+this.grid.serifsStep/2, this.WorldToScreenX(s/2), this.WorldToScreenY(i+this.grid.serifsStep/2));\n\n this.moveTo(s, i+this.grid.serifsStep);\n this.lineTo( -s, i+this.grid.serifsStep);\n this.ctx.fillText(i+this.grid.serifsStep, this.WorldToScreenX(s), this.WorldToScreenY(i+this.grid.serifsStep));\n }\n }\n this.ctx.stroke();\n this.ctx.closePath();\n }\n }","function plotGraph() {\n if (houses.data.length > 0) {\n for (let i = 0; i < houses.data.length; i++) {\n xs[i] = map(houses.data[i].inputs[0], 0, zoom, 0, wnx);\n ys[i] = map(houses.data[i].inputs[1], 0, zoom, wny, 200);\n cs[i] = houses.data[i].inputs[8];\n ps[i] = houses.data[i].target[0];\n }\n }\n}","function cartesian(coordinates) {\n const lambda = coordinates[0] * radians,\n phi = coordinates[1] * radians,\n cosphi = cos(phi);\n return [cosphi * cos(lambda), cosphi * sin(lambda), sin(phi)];\n}","function plotPoints(coords) {\n ctx.fillStyle = 'green';\n console.log(coords);\n ctx.fillRect(coords.y, coords.x, 5, 5);\n}","function plot() {\n \n }","plotCyclists() {\n for (let c of this.mapCyclists) {\n if (c.cyclist.id.id == \"0_ghost\" || c.cyclist.id.id == \"ghost\") {\n c.plotGhost(this.map);\n } else {\n c.plotMarker(this.map);\n }\n }\n }","function displayCoord(a) {\r\n\t\tc.beginPath();\r\n\t\tc.moveTo(parseInt(a[0],10)-3,output(parseInt(a[1],10)-3));\r\n\t\tc.lineTo(parseInt(a[0],10)+3,output(parseInt(a[1],10)+3));\r\n\t\tc.stroke();\r\n\t\tc.beginPath();\r\n\t\tc.moveTo(parseInt(a[0],10)-3,output(parseInt(a[1],10)+3));\r\n\t\tc.lineTo(parseInt(a[0],10)+3,output(parseInt(a[1],10)-3));\r\n\t\tc.stroke();\r\n\t\tif (showCoordsCheck) c.fillText(\"(\"+a[0]+\",\"+a[1]+\")\",parseInt(a[0],10)+10,output(parseInt(a[1],10)+10));\r\n\t}","function cartesian(coordinates) {\n var lambda = coordinates[0] * __WEBPACK_IMPORTED_MODULE_1__math__[\"v\" /* radians */],\n phi = coordinates[1] * __WEBPACK_IMPORTED_MODULE_1__math__[\"v\" /* radians */],\n cosphi = Object(__WEBPACK_IMPORTED_MODULE_1__math__[\"h\" /* cos */])(phi);\n return [cosphi * Object(__WEBPACK_IMPORTED_MODULE_1__math__[\"h\" /* cos */])(lambda), cosphi * Object(__WEBPACK_IMPORTED_MODULE_1__math__[\"y\" /* sin */])(lambda), Object(__WEBPACK_IMPORTED_MODULE_1__math__[\"y\" /* sin */])(phi)];\n}","show() {\n fill(255);\n noStroke();\n let sx = map(this.x/this.z, 0, 1, 0, width);\n let sy = map(this.y/this.z, 0, 1, 0, height);\n let r = map(this.z, 0, width, 8, 0);\n //ellipse(sx, sy, r, r);\n stroke(255);\n let px = map(this.x/this.pz, 0, 1, 0, width);\n let py = map(this.y/this.pz, 0, 1, 0, height);\n line(px,py, sx, sy);\n this.pz = this.z;\n }","plot() {\n return \"Cute alien takes over the earth\";\n }","function cartesian$1(coordinates) {\n var lambda = coordinates[0] * radians,\n phi = coordinates[1] * radians,\n cosphi = cos(phi);\n return [\n cosphi * cos(lambda),\n cosphi * sin(lambda),\n sin(phi)\n ];\n}","function cartesian(coordinates) {\n var lambda = coordinates[0] * __WEBPACK_IMPORTED_MODULE_1__math__[\"v\" /* radians */],\n phi = coordinates[1] * __WEBPACK_IMPORTED_MODULE_1__math__[\"v\" /* radians */],\n cosphi = Object(__WEBPACK_IMPORTED_MODULE_1__math__[\"h\" /* cos */])(phi);\n return [\n cosphi * Object(__WEBPACK_IMPORTED_MODULE_1__math__[\"h\" /* cos */])(lambda),\n cosphi * Object(__WEBPACK_IMPORTED_MODULE_1__math__[\"y\" /* sin */])(lambda),\n Object(__WEBPACK_IMPORTED_MODULE_1__math__[\"y\" /* sin */])(phi)\n ];\n}","function plot(rows = 36, cols = 64) {\n\n /* 'c' will contain the whole generated html rect tags string to change innerhtml of enclosing div */\n /* 'y' will denote the 'y' coordinate where the next grid must be placed */\n let c = \"\", y = 0;\n\n /* Looping for each row */\n for (let i = 0; i < rows; i++) {\n\n /* 'x' is a coordinate denoting where the next grid must be placed */\n var x = 0;\n\n /* For each row we will loop for each column present in the Grid */\n for (let j = 0; j < cols; j++) {\n\n /* 'colr' will store the rest grid color which is dark gray currently */\n let colr = grid_color;\n\n /* If the Rectange present in the grid is on the border side then change the color in order to highlight borders */\n if(i === 0 || j === 0 || i === rows - 1 || j === cols - 1){\n colr = border_color;\n }\n\n /* Creating a rect tag that is appending in 'c' for now and will be updated to innerhtml of enclosing div */\n /* I know you will be wondering about the id given to each rect :-\n * Each rect must be provided with id in order to do anything with the corresponding rect.\n * Operations like coloring the grid as well saving saving any number in corresponding matrix needs an id of the rect.\n * Hence id is important to allot to each rect to make further changes in matrix on which whole algo is based.\n * In order to assing every rect id i decided to allot their corresponding row_number + : + col_number to be as id\n * As with this scenario it is easy to remember and will be unique for every rect tag. \n */\n c += `<rect id=${i + \":\" + j} x=\"${x}\" y=\"${y}\" width=\"30\" height=\"30\" fill=\"${colr}\" r=\"0\" rx=\"0\" ry=\"0\" stroke=\"#000\" style=\"-webkit-tap-highlight-color: rgba(0, 0, 0, 0); stroke-opacity: 0.2;\" stroke-opacity=\"0.2\"></rect>`;\n\n /* Incrementing the 'x' coordinate as we have width of 30px and hence 'x' coordinate for next rect will be +30 from current pos. */\n x += 30;\n }\n\n /* Incrementing the 'y' coordinate as we have placed sufficient rect in 1 row now need to advance 'y' as height of each rect \n is 30px hence for every rect in next column the y coordinate will be +30*/\n y += 30;\n }\n\n /* At last after creating rect tags using loops, now update innerHtml of enclosing div with id='container'[grid.html] */\n document.getElementById(\"container\").innerHTML = c;\n\n /* I wanted to preplace the Source - coordinate so at rect with id='src_crd' will be coloured green */\n document.getElementById(src_crd).style.fill = \"rgb(0, 255, 0)\";\n matrix[split(src_crd, 0)][split(src_crd, 1)] = 1; /* Update the pos as '1' to denote source location */\n\n /* I wanted to preplace the Destination - coordinate so at rect with id='dst_crd' will be coloured Red */\n document.getElementById(dst_crd).style.fill = \"rgb(255, 0, 0)\";\n matrix[split(dst_crd, 0)][split(dst_crd, 1)] = 2; /* Update the pos as '2' to denote Destination location */\n\n }","function main(){\n // Same functions used in class for moveTo and lineTo\n function moveToTx(x,y,z,Tx) {\n var loc = [x,y,z];\n var locTx = m4.transformPoint(Tx,loc);\n context.moveTo(locTx[0],locTx[1]);\n }\n function lineToTx(x,y,z,Tx) {\n var loc = [x,y,z];\n var locTx = m4.transformPoint(Tx,loc);\n context.lineTo(locTx[0], locTx[1]);\n }\n function drawAxes(Tx){\n context.beginPath();\n moveToTx(-50, 0, 0, Tx);\n lineToTx(50, 0, 0, Tx);\n context.stroke(); // x-axis\n moveToTx(0, -50, 0, Tx);\n lineToTx(0, 50, 0, Tx);\n context.stroke(); // y-axis\n moveToTx(0, 0, -50, Tx);\n lineToTx(0, 0, 50, Tx);\n context.stroke(); // z-axis\n }\n /**\n Itterates through the 2d array of points (x,y,z), drawing a line\n between each. Points have already been transformed to exist in the world\n coordinate system from the point at which they were added.\n **/\n function drawPicture(Tx, vectArray, toMouse){\n context.beginPath();\n vectArray.forEach(function(point,i){\n if(i === 0){\n moveToTx(point[0],point[1],point[2],Tx);\n }else{\n lineToTx(point[0],point[1],point[2],Tx);\n }\n context.stroke();\n });\n if(toMouse){\n lineToTx(currMousePos[0],currMousePos[1],0,m4.identity());\n }\n context.stroke();\n }\n /**\n Draws a grid on the y=0 plane\n **/\n function drawGrid(Tx){\n context.beginPath();\n var dim = 10;\n var length = 500;\n // Draw from the negative width to pos\n for(var i=-(dim/2); i<=(dim/2); i++){\n iScaled = i * 50;\n moveToTx(iScaled, 0, -length/2, Tx); lineToTx(iScaled, 0, length/2, Tx);\n moveToTx(-length/2, 0, iScaled, Tx); lineToTx(length/2, 0, iScaled, Tx);\n }\n context.stroke();\n }\n // Animation loop\n function draw(){\n // Quick clear for re-draw as well as resize in event of window change\n canvas.width = window.innerWidth; canvas.height = window.innerHeight;\n context.strokeStyle = PRIMARY_TEXT_COLOR;\n\n // Transforms\n var TrotX = m4.rotationX(thetaXSpindle*Math.PI); // Spindle spins independantly of the world.\n var TrotY = m4.rotationY(thetaYSpindle*Math.PI);\n var Ttrans = m4.translation([spindleX,0,spindleZ]);\n Tspindle = m4.multiply(TrotX, TrotY);\n Tspindle = m4.multiply(Tspindle, Ttrans);\n\n var eye = [Math.sin(theta*Math.PI)*radius, camPosY, Math.cos(theta*Math.PI)*radius];\n var target = [0,0,0];\n var up = [0,1,0];\n var TlookAt = m4.lookAt(eye, target, up);\n var Tcamera = m4.inverse(TlookAt);\n Tcamera = m4.multiply(Tcamera, m4.scaling([1,-1,1])); // flip to point Y up\n Tcamera = m4.multiply(Tcamera, m4.translation([canvas.width/2, canvas.height/2, 0]));\n\n context.strokeStyle = 'rgba(255, 255, 255, .15)';\n drawGrid(Tcamera);\n context.strokeStyle = \"lightblue\";\n commits.forEach(function(curr){\n curr.draw(Tcamera);\n });\n // Animation transforms\n thetaYSpindle += rotSpeedY;\n thetaXSpindle += rotSpeedX;\n TspindleMod = m4.multiply(Tspindle, Tcamera);\n // Update the global variable\n mouseToWorld = m4.inverse(TspindleMod);\n\n context.strokeStyle = \"white\";\n drawAxes(TspindleMod);\n context.strokeStyle = \"lightblue\";\n drawPicture(TspindleMod, vectArray, true);\n context.translate(canvas.width/2, canvas.height/2); // Move orgin for UI\n ui.showManual();\n ui.showStats(rotSpeedX, rotSpeedY, spindleX, spindleZ);\n window.requestAnimationFrame(draw);\n }\n draw();\n\n\n // EVENT LISTENERS\n document.onmousemove = function(e){\n currMousePos = [e.pageX, e.pageY, 0];\n }\n document.onmousedown = function(event){\n if(currPos){\n prevPos = currPos\n }\n currPos = [event.clientX, event.clientY, 0];\n currPos = m4.transformPoint(mouseToWorld, currPos);\n vectArray.push(currPos);\n }\n document.addEventListener('keydown', (event) => {\n const keyName = event.key;\n if(keyName === \"c\"){\n // Store drawing\n var drawing = new Drawing(Tspindle, vectArray);\n drawing.rotSpeedY = rotSpeedY;\n drawing.rotSpeedX = rotSpeedX;\n commits.push(drawing);\n // Clear drawing\n vectArray = [];\n currPos = null;\n }\n if(keyName === \"x\"){\n // pop last commit\n commits.pop();\n // Clear drawing\n vectArray = [];\n currPos = null;\n }\n // Controll axis'\n if(keyName === \"ArrowUp\"){\n event.preventDefault();\n rotSpeedX += stepSize;\n }\n if(keyName === \"ArrowDown\"){\n event.preventDefault();\n rotSpeedX -= stepSize;\n }\n if(keyName === \"ArrowLeft\"){\n event.preventDefault();\n rotSpeedY -= stepSize;\n }\n if(keyName === \"ArrowRight\"){\n event.preventDefault();\n rotSpeedY += stepSize;\n }\n if(keyName === \"w\"){\n event.preventDefault();\n camPosY += 1;\n }\n if(keyName === \"s\"){\n event.preventDefault();\n camPosY -= 1;\n }\n if(keyName === \"d\"){\n event.preventDefault();\n theta += .05;\n }\n if(keyName === \"a\"){\n event.preventDefault();\n theta -= .05;\n }\n if(keyName === \"l\"){\n event.preventDefault();\n spindleX += 5;\n }\n if(keyName === \"j\"){\n event.preventDefault();\n spindleX -= 5;\n }\n if(keyName === \"i\"){\n event.preventDefault();\n spindleZ += 5;\n }\n if(keyName === \"k\"){\n event.preventDefault();\n spindleZ -= 5;\n }\n });\n /** Drawing **/\n function Drawing(Tmod, array){\n this.Tmod = Tmod;\n this.array = array;\n // Animation transforms\n this.rotSpeedY;\n this.rotSpeedX;\n // Drawing\n this.draw = function(Tcamera){\n var rot = m4.rotationX(Math.PI*this.rotSpeedX);\n this.Tmod = m4.multiply(rot,this.Tmod);\n rot = m4.rotationY(Math.PI*this.rotSpeedY);\n this.Tmod = m4.multiply(rot, this.Tmod);\n var Tx = m4.multiply(this.Tmod, Tcamera);\n drawPicture(Tx, this.array, false);\n }\n }\n}","function canvasToCartesianAxisCoords(pos) {\n // return an object with x/y corresponding to all used axes\n var res = {},\n i, axis;\n for (i = 0; i < xaxes.length; ++i) {\n axis = xaxes[i];\n if (axis && axis.used) {\n res[\"x\" + axis.n] = axis.c2p(pos.left);\n }\n }\n\n for (i = 0; i < yaxes.length; ++i) {\n axis = yaxes[i];\n if (axis && axis.used) {\n res[\"y\" + axis.n] = axis.c2p(pos.top);\n }\n }\n\n if (res.x1 !== undefined) {\n res.x = res.x1;\n }\n\n if (res.y1 !== undefined) {\n res.y = res.y1;\n }\n\n return res;\n }","function plot() {\n\n}","function CartesianChart(config)\n{\n CartesianChart.superclass.constructor.apply(this, arguments);\n}","function axis(ctx, color, axisx, axisy, px, d1,py, d2) {\n var w = ctx.canvas.width;\n var h = ctx.canvas.height;\n\n ctx.strokeStyle = color;\n\n //if axis function is below grid function\n // and grid is dotted this removes the axis from\n // dotted back to normal line\n ctx.setLineDash([0, 0]);\n\n //if the axis is undefined in both direction creates it at the far left corner like a normal graph\n if (axisy == undefined && axisx == undefined) {\n lines(ctx, 1, h - 1, w - 1, h - 1, 1);\n lines(ctx, 1, 1, 1, h - 1, 1);\n }\n\n //the same as above\n else if (axisx == w && axisy == h) {\n lines(ctx, 1, axisy - 1, axisx - 1, axisy - 1, 1);\n lines(ctx, 1, 1, 1, axisy - 1, 1);\n }\n\n //if axisx and axis y are numbers the axis will be created inwards to the number that has been created.\n else if (typeof axisx == \"number\" && typeof axisy == \"number\") {\n lines(ctx, 0, axisy, w, axisy, 3);\n lines(ctx, axisx, 0, axisx, h, 3);\n }\n\n // if axisy and axisx are inputed as middle the x and y axis will be created in the center of the canvas\n else if (axisx == \"middle\" && axisy == \"middle\") {\n axisx = w / 2;\n axisy = h / 2;\n\n lines(ctx, h / 2, w, h / 2, 2);\n\n lines(ctx, w / 2, w / 2, h, 2);\n }\n\n // creates the x for the creation of axis points as pf now only at the positive x axis\n if (px == \"px\" && py == \"py\") {\n let i = axisx;\n let j = 0;\n let k = 0;\n let l = 0;\n\n //creates positive x axis points\n for (i = axisx; i <= w; i += d1) {\n lines(ctx, i, axisy, i, axisy + 10, 1);\n }\n\n //create negative y axis points\n for (l = axisy; l >= 0; l -= d2) {\n lines(ctx, axisx, l, axisx - 10, l, 1);\n }\n\n //creates positive y axis points\n for (j = axisy; j <= h; j += d2) {\n lines(ctx, axisx - 10, j, axisx, j, 1);\n }\n //creates negative x axis points\n for (k = axisx; k >= 0; k -= d1) {\n lines(ctx, k, axisy, k, axisy + 10, 1);\n }\n }\n\n else if(px =='px' && py == undefined){\n let i = 0;\n let k = 0;\n //creates positive x axis points\n for (i = axisx; i <= w; i += d1) {\n lines(ctx, i, axisy, i, axisy + 10, 1);\n }\n\n //creates negative x axis points\n for (k = axisx; k >= 0; k -= d1) {\n lines(ctx, k, axisy, k, axisy + 10, 1);\n }\n }\n}","function createCoords(svgid,parameters) {\r\n\tthis.svgid = svgid;\r\n\tthis.id = svgid+'_coords';\r\n\tthis.svg = document.getElementById(svgid);\r\n\tthis.fontSize = parseFloat(getComputedStyle(this.svg).fontSize);\r\n\tlet rem = this.fontSize;\r\n\tlet re = new RegExp(\"rem\");\r\n\t\r\n\t\t// MARGINS\r\n\tlet margin = new Array();\r\n\tlet marginTop,marginRight,marginBottom,marginLeft;\t\r\n\tif( parameters['margin'] != undefined ) { margin = parameters['margin']; }\t\r\n\tmarginTop = re.test(margin[0]) ? parseFloat(margin[0])*rem : parseFloat(margin[0]);\r\n\tmarginRight = re.test(margin[1]) ? parseFloat(margin[1])*rem : parseFloat(margin[1]);\r\n\tmarginBottom = re.test(margin[2]) ? parseFloat(margin[2])*rem : parseFloat(margin[2]);\r\n\tmarginLeft = re.test(margin[3]) ? parseFloat(margin[3])*rem : parseFloat(margin[3]);\r\n\tmargin = [marginTop,marginRight,marginBottom,marginLeft];\r\n\tthis.margin = margin;\r\n\tthis.marginTop = marginTop; this.marginRight = marginRight; this.marginBottom = marginBottom; this.marginLeft = marginLeft;\r\n\t\r\n\t\t// svg area [min-u,max-v,width,height] of the plotBox\t\t\r\n\tthis.plotBox = [marginLeft,marginTop,this.svg.clientWidth-(marginRight+marginLeft),this.svg.clientHeight-(marginTop+marginBottom)];\r\n\t\t// svg coordinate Range\r\n\tthis.uMin = this.plotBox[0];\r\n\tthis.uMax = this.plotBox[0]+this.plotBox[2];\r\n\tthis.vMin = this.plotBox[1];\r\n\tthis.vMax = this.plotBox[1]+this.plotBox[3];\t\r\n \r\n\tthis.defineCoords(parameters);\r\n\t\r\n\t // define two special groups for this coordinate system\r\n var g1 = document.createElementNS('http://www.w3.org/2000/svg', 'g');\r\n var g2 = document.createElementNS('http://www.w3.org/2000/svg', 'g');\r\n\t\r\n /* this.g1.id = this.id+'_g1'; this.g2.id = this.id+'_g2'; */\r\n this.svg.g1 = g1; // default for plots\r\n this.svg.g2 = g2; // default for axes\r\n this.svg.appendChild(g2);\r\n this.svg.appendChild(g1);\r\n\t\r\n\tif( parameters['clip'] == true ) { this.plotObject('clip',{'x1':this.xMin,'x2':this.xMax,'y1':this.yMin,'y2':this.yMax}); }\r\n} // END function createCoords()","function generatePositions() {\n rows = [];\n columns = [];\n if (gridOption.enableRow) {\n //use coordinate.y to generate rows\n if (coordinate.y && coordinate.y.model.rotate == 90) {\n coordinate.y.forEach(function(i,length){\n rows.push(coordinate.y.model.beginY-length)\n });\n gridOption._x = coordinate.x.model.beginX;\n } else if (coordinate.x && coordinate.x.model.rotate == 90) {\n coordinate.x.forEach(function (i, length) {\n rows.push(coordinate.x.model.beginY - length)\n });\n\n gridOption._x = coordinate.y.model.beginX;\n }\n gridOption.width = coordinate.size().width || 0;\n gridOption.rows = rows;\n }\n if (gridOption.enableColumn) {\n if (coordinate.y && coordinate.y.model.rotate == 0) {\n coordinate.y.forEach(function(i,length){\n columns.push(coordinate.y.model.beginX+length)\n });\n gridOption._y = coordinate.x.model.beginY;\n } else if (coordinate.x && coordinate.x.model.rotate == 0) {\n coordinate.x.forEach(function (i, length) {\n columns.push(coordinate.x.model.beginX + length)\n });\n gridOption._y = coordinate.y.model.beginY;\n }\n gridOption.height = coordinate.size().height || 0;\n gridOption.columns = columns;\n }\n\n }","plotJourneys() {\n for (let j of this.mapJourneys) {\n //plot ghost Session\n j.plotSessions(this);\n }\n }","function drawPCGraph() {\r\n\r\n\tvar x = d3.scale.ordinal().rangePoints([0, 480], 1),\r\n y= {};\r\n \r\n for (var dim in cars[0]) {\r\n\t if (dim != \"name\") {\r\n\t\t y[dim] = d3.scale.linear()\r\n\t\t\t .domain([d3.min(cars, function(d) { return +d[dim]; }), d3.max(cars, function(d) { return +d[dim]; })])\r\n\t\t .range([height,0]);\r\n\t }\r\n }\r\n \r\n//sets the x domain dimensions\r\n x.domain(dimensions = d3.keys(cars[0]).filter(function(d) { return d != \"name\";}));\r\n\r\n//draws the polylines\r\n for (var i=1; i< cars.length; i++) { //for each car\r\n\r\n//prepare the coordinates for a polyline\r\n\t var lineData = []; //initialize an array for coordinates of a polyline\r\n\t for (var prop in cars[0]) { \r\n\t if (prop != \"name\" ) {\r\n\t var point = {}; \r\n\t var val = cars[i][prop];\r\n\t\t point['x'] = x(prop); \r\n\t point['y'] = y[prop](val);\r\n\t lineData.push(point);\r\n\t }\r\n\t }\r\n\r\n//draws a polyline based on the coordindates \r\n chart.append(\"g\")\r\n\t .attr(\"class\", \"polyline\")\r\n\t .append(\"path\")\r\n\t\t .attr(\"d\", line(lineData))\r\n\t\r\n//Changes stroke red when mouseover\r\n\t.on(\"mouseover\", function(){\r\n\t\t\td3.select(this)\r\n\t\t.style(\"stroke\",\"red\")\r\n\t })\r\n\t.on(\"mouseout\", function(){\r\n\t\td3.select(this)\r\n\t\t.style(\"stroke\",null)\r\n\t\t\r\n})\r\n }\r\n\r\n var g = chart.selectAll(\".dimension\")\r\n\t .data(dimensions)\r\n\t .enter().append(\"g\")\r\n\t .attr(\"class\", \"dimension\")\r\n\t .attr(\"transform\", function(d) { return \"translate(\" + x(d) + \")\"; }) //translate each axis\r\n\r\n g.append(\"g\")\r\n\t .attr(\"class\", \"axis\")\r\n\t .each(function(d) { d3.select(this).call(axis.scale(y[d])); })\r\n\t .append(\"text\")\r\n\t .style(\"text-anchor\", \"middle\")\r\n\t .attr(\"y\", -4)\r\n\t .text(function(d) { return d; });\r\n\t \r\n \r\n}","function pricesGraph() {\n for (let i = 0; i < houses.data.length; i++) {\n\n // Map colors\n let color = mapColor(ps[i]);\n\n // Render\n fill(color.r, color.g, color.b, 255);\n noStroke();\n ellipse(xs[i] + xoff, ys[i] + yoff, 2, 2);\n }\n}","function Cartesian2D(name) {\n Cartesian.call(this, name);\n}","function Cartesian2D(name) {\n Cartesian.call(this, name);\n}","function Cartesian2D(name) {\n Cartesian.call(this, name);\n}","function Cartesian2D(name) {\n Cartesian.call(this, name);\n}","function Cartesian2D(name) {\n Cartesian.call(this, name);\n}","function render() {\n dots\n .attr(\"cx\", function (d) {\n return project(d).x;\n })\n .attr(\"cy\", function (d) {\n return project(d).y;\n });\n }","function draw() {\n \n // background(237, 34, 93);\n for(let i = 0; i < h; i += 10) {\n for(let j = 0; j < w; j+= 10) {\n // if(i == cx[counting] && j == cy[counting]) {\n point_color = 222;\n strokeWeight(1);\n stroke(point_color);\n point(cx[counting],cy[counting])\n counting++;\n // } \n } \n // line(i, 0, i, h)\n counting = 0;\n }\n\n \n}","function drawGraph(xArray, yArray) {\n var xMax = Math.max(...xArray);\n var xMin = Math.min(...xArray);\n //var yMax = Math.max(...yArray);\n //var yMin = Math.min(...yArray);\n\n var yMax = nParticles * 1.13;\n var yMin = 0;\n\n // Conversion between the screen coordiantes and the axis coordiantes\n function xScreen(x) {\n return (x - xMin) / (xMax - xMin) * canvasGraph.width + 5;\n }\n function yScreen(y) {\n return canvasGraph.height - (y - yMin) / (yMax - yMin) * canvasGraph.height - 5;\n }\n\n var x = xArray[0];\n var y = yArray[0];\n ctxGraph.moveTo(xScreen(x), yScreen(y));\n for (var i = 1; i <= xArray.length; i++) {\n x = xArray[i];\n y = yArray[i];\n ctxGraph.lineTo(xScreen(x), yScreen(y));\n }\n}","drawcrosshairs() {\n \n if (this.internal.volume===null) \n return;\n \n for (var i=0;i<=2;i++) \n this.internal.slices[i].drawcrosshairs(this.internal.slicecoord);\n \n // Update Dat.GUI\n if (this.internal.datgui.gui !== null) {\n this.internal.datgui.data.xcoord = this.internal.slicecoord[0];\n this.internal.datgui.data.ycoord = this.internal.slicecoord[1];\n this.internal.datgui.data.zcoord = this.internal.slicecoord[2];\n this.internal.datgui.data.tcoord = this.internal.slicecoord[3];\n this.updateDatGUIControllers();\n }\n this.drawtext();\n this.informToRender(); \n //this.drawcolorscale();\n }","function equilatGrid(L,R,dx,dy){\n let yVals = [];\n let ytip = 70;\n let xtip = 300;\n let yChange = dy/10;\n let xChange = 2*dx/10\n for(let i = 0; i < 9; i++){\n yVals.push((ytip+dy)-yChange*(i+1));\n }\n push();\n let x1, x2, y1, y2;\n // Carrier grid\n stroke(255,100,0,80);\n for(let i = 0; i < yVals.length; i++){\n y1 = yVals[i];\n x1 = (y1-L[1])/L[0];\n y2 = ytip + dy;\n x2 = (xtip-dx) + xChange*(i+1);\n line(x1,y1,x2,y2);\n }\n \n // Solvent grid\n stroke(128,0,128,80);\n for(let i = 0; i < yVals.length; i++){\n y1 = yVals[i];\n x1 = (y1-R[1])/R[0];\n y2 = ytip + dy;\n x2 = (xtip+dx) - xChange*(i+1);\n line(x1,y1,x2,y2);\n }\n // Solute grid\n stroke(0,0,255,80);\n for(let i = 0; i < yVals.length; i++){\n y1 = yVals[i];\n x1 = (y1-L[1])/L[0];\n y2 = y1;\n x2 = (y2-R[1])/R[0];\n line(x1,y1,x2,y2);\n }\n pop();\n}","display(){\n fill (0);\n ellipse(this.x, this.y, 4, 4);\n }","draw_axes(gfx) {\n // Drawing in white\n gfx.noFill();\n gfx.stroke(255);\n\n // Draw the unit circle (width and height 2)\n gfx.ellipse(0, 0, 2, 2);\n\n // Draw x- and y-axes\n gfx.line(-10, 0, 10, 0);\n gfx.line(0, -10, 0, 10);\n }","function apskritimoPlotas(spindulys) {\n console.log('Apskritimo plotas');\n return Math.PI * (spindulys ** 2);\n}","plotRoutes() {\n for (let r of this.mapRoutes) {\n r.plotPath(this.map);\n }\n }","function plotAll() {\n d3.select(\"#scatter-macro-1 svg\").remove()\n d3.select(\"#scatter-macro-2 svg\").remove()\n d3.select(\"#scatter-micro-1 svg\").remove()\n d3.select(\"#scatter-micro-2 svg\").remove()\n doPlot(\"scatter-macro-1\", voltageArr, \"Voltage\", maxLinearVelocityArr, \"Max. Linear Velocity\");\n doPlot(\"scatter-macro-2\", currentArr, \"Current\", accelerationArr, \"Acceleration\");\n doPlot(\"scatter-micro-1\", voltageArr, \"Voltage\", maxAngularVelocityArr, \"Max. Angular Velocity\");\n doPlot(\"scatter-micro-2\", currentArr, \"Current\", torqueArr, \"Torque\");\n}","show() {\n fill(0, 10, 100);\n noStroke();\n\n ellipse(this.x, this.y, this.mainSize, this.mainSize);\n ellipse(this.x - 18, this.y + 20, this.subSize, this.subSize);\n ellipse(this.x - 6, this.y + 20, this.subSize, this.subSize);\n ellipse(this.x + 6, this.y + 20, this.subSize, this.subSize);\n ellipse(this.x + 18, this.y + 20, this.subSize, this.subSize);\n }","function zoom_arc_plot(v_chr, v_start, v_end) {\n // chosen chromosome for zoom\n var xScale_zoomed_chrom,\n // all other chromosomes\n xScale_unzoomed_chrom;\n\n // margin for the zoom function of the arc plot\n var margin = {\n top: 1,\n right: 1,\n bottom: 20,\n left: 10\n };\n\n // padding between the chromosomes\n var padding = 2;\n // width and height of the plot\n var w = 800 - margin.left - margin.right - (24 * padding);\n var h = 600 - margin.top - margin.bottom; \n // chromosome length without the chosen chromosome\n var chrom_scale_compare = chrom_length - chromLength[(v_chr -1)];\n\n //for loop to create the length of the chromosomes\n var chromLength_scaled = [];\n for (var i = 0;i < chromLength.length; i++) {\n var temp;\n if ((v_chr - 1) == i) {\n chromLength_scaled.push(w/2);\n } else {\n temp = ((w/2) / chrom_scale_compare) * chromLength[i];\n chromLength_scaled.push(temp);\n }\n }\n\n //for loop to calculate the x position\n var chrom_x_position = [0];\n var Scaled_abs_xposition = 0;\n for (var i = 0; i < chrom_abs_length.length ; i++) {\n Scaled_abs_xposition = Scaled_abs_xposition + chromLength_scaled[i] + padding;\n chrom_x_position.push(Scaled_abs_xposition);\n }\n\n // var for the chromsome length of the chosen area\n var selected_chrom_area = v_end - v_start;\n // array for the ticks\n var ticks_chrom_chosen = [];\n // for loop to create the ticks for the chosen chromosome\n for (var i = 0; i< 20 ; i++) {\n var temp_x,\n temp_label,\n temp_range,\n temp_range_label,\n temp;\n if(selected_chrom_area == 0) {\n temp_x = chrom_x_position[(v_chr - 1)] + (chromLength_scaled[(v_chr - 1)] / 20) * i;\n temp_label = Math.round(((chromLength[(v_chr - 1)] / 20) / 1000000) * i) + \"MB\";\n } else {\n temp_x = chrom_x_position[(v_chr - 1)] + (chromLength_scaled[(v_chr - 1)] / 20) * i;\n temp = Math.round(v_start + (selected_chrom_area / 20)* i);\n if(temp < 50000) {\n temp_range = 1;\n temp_range_label = \"\";\n } else if(temp < 50000000) {\n temp_range = 1000;\n temp_range_label = \"Kb\";\n } else {\n temp_range = 1000000;\n temp_range_label = \"Mb\";\n }\n temp_label = Math.round((temp / temp_range)) + temp_range_label; \n }\n var obj = {};\n obj[\"x\"] = temp_x;\n obj[\"label\"] = temp_label;\n ticks_chrom_chosen.push(obj);\n }\n\n // array to store all nodes and all links which should not be displayed in the zoom function\n zoom_allNodes = [];\n zoom_links = [];\n links.forEach( function(d) {\n if((allNodes[d.source].chrom == v_chr \n && allNodes[d.source].bp_position >= v_start \n && allNodes[d.source].bp_position <= v_end) ||\n (allNodes[d.source].chrom == v_chr && selected_chrom_area == 0) ||\n (allNodes[d.target].chrom == v_chr && \n allNodes[d.target].bp_position >= v_start && \n allNodes[d.target].bp_position <= v_end) ||\n (allNodes[d.target].chrom == v_chr && selected_chrom_area == 0)) {\n\n zoom_allNodes.push(allNodes[d.source]);\n zoom_allNodes.push(allNodes[d.target]);\n zoom_links.push(d);\n }\n });\n \n // add nodes with degree zero\n allNodes.forEach( function (d) {\n var in_zoomed_chrom = (d.chrom == v_chr && d.degree == 0);\n var in_zoomed_region = (d.bp_position >= v_start && d.bp_position <= v_end);\n\n if(in_zoomed_chrom && in_zoomed_region) {\n zoom_allNodes.push(d);\n }\n });\n \n // sort and make the zoom_allnodes function unique\n var temp_zoomnodes = [];\n\n zoom_allNodes.forEach( function (d) {\n temp_zoomnodes.push(d.id);\n });\n\n temp_zoomnodes = sort_unique(temp_zoomnodes);\n\n zoom_allNodes = [];\n\n temp_zoomnodes.forEach( function (d) {\n zoom_allNodes.push(allNodes[d]);\n });\n \n \n // create SVG for the plot\n var svg = d3.select(\"#chart\")\n .append(\"svg\")\n .attr(\"id\", \"mainplot\")\n .attr(\"width\", width)\n .attr(\"height\", height)\n .append(\"g\")\n .attr(\"transform\", \"translate(\" + margin.left + \",\" + margin.top + \")\");\n\n d3.select('#ld_container').selectAll('svg').remove();\n\n var chromosome_container = svg.selectAll(\"g.group\")\n .data(chromLength)\n .enter().append(\"svg:g\")\n .attr(\"transform\", function(d, i) {\n return \"translate(\" + chrom_x_position[i] + \",\" + height_chrom_bar + \")\"; \n })\n // scales the width of chromosomes\n .attr(\"width\", function(d, i) {\n create_ld_plot(i+1, chromLength_scaled[i], chrom_x_position[i], padding, v_chr, v_start, v_end); \n return chromLength_scaled[i]; \n })\n .attr(\"height\", 40)\n .attr(\"class\", function (d,i) {\n return \"chrom\" + (i+1);\n });\n\n var id_chrom_zoom = \"g.chrom\" + (v_chr);\n // store the the new startpoint\n var startzoom = 0;\n if (v_start == 0 && v_end == 0) {\n var x_scale_zoom = d3.scale.linear()\n .domain([0, chromLength[(v_chr -1)]])\n .range([0, chromLength_scaled[(v_chr -1)]]);\n } else {\n var x_scale_zoom = d3.scale.linear()\n .domain([v_start, v_end])\n .range([0, chromLength_scaled[(v_chr -1)]]);\n }\n \n //function to zoom with the mouse\n var brush = svg.select(id_chrom_zoom)\n .append(\"g\")\n .attr(\"class\", \"brush\")\n .call(d3.svg.brush().x(x_scale_zoom)\n .on(\"brushstart\", brushstart)\n .on(\"brush\", brushmove)\n .on(\"brushend\", brushend))\n .selectAll(\"rect\")\n .attr(\"height\", 40) \n .style(\"stroke\", \"blue\")\n .style(\"fill\", \"blue\")\n .style(\"opacity\" , 0.7);\n\n function brushstart() { \n brush.classed(\"selecting\", true);\n }\n\n function brushmove() {\n var r = d3.event.target.extent(); \n document.getElementById(\"texzs\").value = Math.round(r[0]);\n document.getElementById(\"texze\").value = Math.round(r[1]);\n }\n\n function brushend() { \n brush.classed(\"selecting\", !d3.event.target.empty());\n }\n\n // create rectangle in the g container\n var chrom_bar = chromosome_container.append(\"rect\")\n .attr(\"transform\", \"translate(\" + 0 + \",\" + 0 + \")\")\n .attr(\"class\", \"rect\")\n // scales the width of chromosomes\n .attr(\"width\", function(d, i) {\n return chromLength_scaled[i]; \n })\n .attr(\"height\", 20)\n .style(\"fill\", function(d, i) {\n return chromcolour[i];\n })\n .style(\"stroke\", function(d, i) {\n return chromcolour[i];\n });\n\n //create ticks for the chrom_bar\n svg.selectAll(\"line\")\n .data(ticks_chrom_chosen)\n .enter().append(\"line\")\n .attr(\"class\", \"tickchromosome\")\n .attr(\"x1\", function(d) {\n return + d.x;\n })\n .attr(\"y1\", height_nodes + 25)\n .attr(\"x2\", function (d) {\n return + d.x;\n })\n .attr(\"y2\", height_nodes + 30)\n .style(\"stroke\", \"#000\")\n\n svg.selectAll(\"text\")\n .data(ticks_chrom_chosen)\n .enter().append(\"text\")\n .attr(\"class\", \"label\")\n .attr(\"dy\", \".35em\")\n .attr(\"transform\", function (d) {\n return \"translate(\"+ d.x + \",\" + (height_nodes + 38) + \")\" + \"rotate(90)\"; \n })\n .attr(\"font-size\", \"10\")\n .text(function (d) {\n return d.label; \n });\n\n // create the label for the chromosomes\n chromosome_container.append(\"svg:text\")\n .attr(\"class\", \"chromosom_number\")\n // 2* padding for double digits chromosome numbers\n .attr(\"transform\", function (d, i) {\n if (i == (v_chr-1)) {\n return \"translate(\" + (8 * padding) + \",\" + 15 + \")\";\n } else {\n return \"translate(\" + (4 * padding) + \",\" + 35 + \")\"; \n }\n })\n .append(\"svg:textPath\")\n .text(function(d, i) {\n return i + 1;\n })\n .attr(\"font-size\", function (d, i) {\n if (i == (v_chr-1)) {\n return \"14px\";\n } else {\n return \"9px\";\n }\n })\n .attr(\"text-anchor\", \"end\")\n .style(\"fill\", function(d, i) {\n if (i == (v_chr - 1)) {\n return \"#000\";\n } else {\n return chromcolour[i];\n }\n })\n .style(\"stroke\", function(d, i) {\n if (i == (v_chr - 1)) {\n return \"#000\";\n } else {\n return chromcolour[i];\n }\n });\n\n // object to store the position of the zoomed chromosomes\n var id_chosen = [];\n // create circles for the location of the interacting SNPs \n svg.selectAll(\"circle.vertex\")\n .data(zoom_allNodes)\n .enter().append(\"circle\")\n .attr(\"class\", \"circle_zoom\")\n .style(\"fill\", function(d) {\n return graphColor(d.probe_group);\n })\n .style(\"stroke\", function(d) {\n return graphColor(d.probe_group);\n })\n // positioning the SNPs\n .attr(\"cx\", function(d) {\n if(d.chrom == v_chr && selected_chrom_area == 0) {\n id_chosen[d.id] = chrom_x_position[(d.chrom -1 )] + \n ((w/2) / chromLength[(d.chrom - 1)]) * d.bp_position; \n return id_chosen[d.id];\n\n } else if (d.chrom == v_chr && selected_chrom_area > 0 && d.bp_position >= v_start && \n d.bp_position <= v_end) {\n id_chosen[d.id] = chrom_x_position[(d.chrom -1)] + \n ((w/2) / selected_chrom_area) * (d.bp_position - v_start);\n return id_chosen[d.id];\n\n } else if(d.chrom == v_chr && selected_chrom_area > 0 && d.bp_position < v_start ) {\n id_chosen[d.id] = chrom_x_position[(d.chrom -1)];\n return id_chosen[d.id];\n\n } else if (d.chrom == v_chr && selected_chrom_area > 0 && d.bp_position > v_end) {\n id_chosen[d.id] = chrom_x_position[(d.chrom - 1)] + (w/2);\n return id_chosen[d.id];\n\n } else if(d.chrom != v_chr) {\n id_chosen[d.id] = chrom_x_position[(d.chrom -1 )] +\n ((w/2) / chrom_scale_compare) * d.bp_position; \n return id_chosen[d.id];\n\n } else {\n return id_chosen[d.id] = \"NaN\" ;\n }\n })\n .attr(\"cy\", height_nodes)\n .attr(\"r\", function(d) {\n if(id_chosen[d.id] == \"NaN\" && d.chrom == v_chr ) {\n return 0;\n } else {\n return 2;\n }\n })\n // to get information about the SNPs from different sources, if you click on a circle\n .on(\"click\", function (d,i) { externalLink(d, i); });\n\n // show degree as tooltip - title\n svg.selectAll(\"g .circle_zoom\") \n .append(\"title\")\n .text(function(d) {\n return \"degree: \" + two_dec(d.degree) + \"\\nSNP: \" + d.rs + \"\\nid: \" + d.id + \n \"\\nposition: \" + d.bp_position\n });\n\n // draw the edges between linked SNP's nodes\n var arcs = svg.selectAll(\"path.link\")\n .data(zoom_links)\n .enter().append(\"path\")\n .attr(\"class\", \"link\")\n .style(\"stroke\", function(d) {\n return graphColor(d.probe_group);\n })\n .style(\"stroke\", 1)\n .style(\"stroke-width\", 2.5)\n .style(\"opacity\", 3.7)\n .style(\"fill\", \"none\")\n // function to create the arc for the links\n .attr(\"d\", function (d) {\n // to ensure that the path is drawn correct \n if(d.source > d.target) {\n var temp;\n temp = d.source;\n d.source = d.target;\n d.target = temp;\n } \n\n if (allNodes[d.source].chrom == v_chr || allNodes[d.target].chrom == v_chr) {\n var start_position_x = id_chosen[d.source],\n start_position_y = height_nodes ;\n\n var end_position_x = id_chosen[d.target],\n end_position_y = height_nodes ;\n } else {\n var start_position_x = \"NaN\",\n start_position_y = height_nodes ;\n\n var end_position_x = \"NaN\",\n end_position_y = height_nodes ;\n }\n\n // to ensure that the arc links are drawn on the correct side \n if (end_position_x < start_position_x) {\n var temp; \n temp = end_position_x; \n end_position_x = start_position_x;\n start_position_x = temp; \n }\n\n var radius = (end_position_x - start_position_x) / 2 ;\n\n var c1x = start_position_x,\n c1y = start_position_y - radius,\n c2x = end_position_x,\n c2y = end_position_y - radius ;\n\n return \"M\" + start_position_x + \",\" + start_position_y + \" C\" + c1x +\n \",\" + c1y + \",\" + c2x + \",\" + c2y + \" \" + \n end_position_x + \",\" + end_position_y ; \n })\n .on(\"click\" , function(d,i) { return highlight_snp_pairs(d, i);});\n\n // creates the colour scale indicator for the ld plot\n createColourScale_ldplot();\n}","function plotGraph(){\n createAxis();\n // zoom.x(x).y(y);\n // console.log('setting scales');\n // console.log(x);\n // console.log(y);\n updateBoundaryGraph.setScales(x,y);\n }","function drawLocs(){\n\tfor (var i = 0; i <= loc.length; i++){\n fill(0, 200);\n ellipse(locX[i], locY[i], locSize, locSize);\n fill(255);\n text(loc[i],locX[i], locY[i]);\n }\n}","coordinatesByAxes(coordinates, repetitions) {\n const {\n repetitionsAlongLatticeVectorA,\n repetitionsAlongLatticeVectorB,\n repetitionsAlongLatticeVectorC,\n } = repetitions;\n const maxNumberOfRepetitions = Math.max(\n repetitionsAlongLatticeVectorA,\n repetitionsAlongLatticeVectorB,\n repetitionsAlongLatticeVectorC,\n );\n\n if (\n !repetitionsAlongLatticeVectorA &&\n !repetitionsAlongLatticeVectorB &&\n !repetitionsAlongLatticeVectorC\n )\n return coordinates;\n\n let columns = coordinates.reduce((res, item, index) => {\n if (index % maxNumberOfRepetitions === 0) {\n res[res.length] = [item];\n } else {\n res[res.length - 1].push(item);\n }\n return res;\n }, []);\n\n if (repetitionsAlongLatticeVectorA < maxNumberOfRepetitions) {\n columns = columns.slice(0, maxNumberOfRepetitions * repetitionsAlongLatticeVectorA);\n }\n if (repetitionsAlongLatticeVectorB < maxNumberOfRepetitions) {\n columns = columns.filter(\n (item, index) =>\n index % maxNumberOfRepetitions < repetitionsAlongLatticeVectorB,\n );\n }\n if (repetitionsAlongLatticeVectorC < maxNumberOfRepetitions) {\n columns = columns.map((arr) =>\n arr.filter((item, index) => index < repetitionsAlongLatticeVectorC),\n );\n }\n return columns.reduce((res, item) => {\n res.push(...item);\n return res;\n }, []);\n }","function drawScatterMatrix(trips){\n\n\tspeed = [];\n\tdistance =[];\n\tduration=[];\n\tfor (var i =0;i<trips.length;i++)\n\t{\n\t speed[i]=trips[i].avspeed;\n\t\t distance[i]=trips[i].distance;\n\t\t duration[i]=trips[i].duration;\n\t}\n\n\tgoogle.charts.load('current', {'packages':['corechart']}); \n google.charts.setOnLoadCallback(drawScatterMatrixCallBack(speed,distance,duration)); \n}","function drawXY(){\r\n//setting the x and y domains\r\n x.domain([d3.min(cars, function(d) { return d.year; }), d3.max(cars, function(d) { return d.year; })]);\r\n y.domain([d3.min(cars, function(d) { return d.power; }), d3.max(cars, function(d) { return d.power; })]);\r\n\r\n//setting the yPosition \r\n var yPos = height -20;\r\n//creating the x-Axis\r\n chart.append(\"g\")\r\n\t .attr(\"class\", \"xaxis\")\r\n\t .attr(\"transform\", \"translate(0,\" + yPos + \")\")\r\n\t .call(xAxis);\r\n//creating the Y-axis\r\n chart.append(\"g\")\r\n\t .attr(\"class\", \"yaxis\")\r\n\t .attr(\"transform\", \"translate(480,0)\")\r\n\t .call(yAxis);\r\n\r\n \r\n//selecting ths dot \r\n//adding attributes\t\r\n chart.selectAll(\".dot\")\r\n\t .data(cars)\r\n\t .enter().append(\"circle\")\r\n\t .attr(\"class\", \"dot\")\r\n\t .attr(\"cx\", function(d) { return x(d.year); })\r\n\t .attr(\"cy\", function(d) { return y(d.power); })\r\n\t .attr(\"r\", 3)\r\n\t \r\n//the mouseover function that fills the dots red when the mouse is over them\r\n\t .on(\"mouseover\", function(){\r\n\t\t\td3.select(this)\r\n\t\t\t.attr(\"fill\", \"red\")\r\n\t })\r\n//the mouseout function that changes the dots back to normal color\r\n\t.on(\"mouseout\", function(){\r\n\t\td3.select(this)\r\n\t\t.attr(\"fill\", \"black\")\r\n\t\t\r\n})\r\n\t\r\n \r\n}","function draw_axis(c){\n\n let yplot = 40;\n let d =0;\n\n c.beginPath();\n c.strokeStyle = \"blue\";\n \n c.moveTo(count_block(5),count_block(5));\n c.lineTo(count_block(5), count_block(40));\n c.lineTo(count_block(80), count_block(40));\n\n c.moveTo(count_block(5), count_block(40));\n \n \n\n //loop for the y-axix labels\n for(let i = 1 ;i<=10;i++ ){\n c.strokeText(d, count_block(2), count_block(yplot));\n yplot-=5;\n d+=500;\n }\n c.stroke();\n\n}","show() {\n fill(\"white\");\n ellipse(this.x, this.y, 30, 30);\n }","function draw_axis(c){\n\n let yplot = 40;\n let d =0;\n\n c.beginPath();\n c.strokeStyle = \"black\";\n \n c.moveTo(count_block(5),count_block(5));\n c.lineTo(count_block(5), count_block(40));\n c.lineTo(count_block(80), count_block(40));\n\n c.moveTo(count_block(5), count_block(40));\n \n \n\n //loop for the y-axix labels\n for(let i = 1 ;i<=10;i++ ){\n c.strokeText(d, count_block(2), count_block(yplot));\n yplot-=5;\n d+=500;\n }\n c.stroke();\n\n}","show() {\n fill(\"red\");\n ellipse(this.pos.x, this.pos.y, 15, 15)\n\n }","display(){\r\n point(this.x,this.y);\r\n }","display() {\n fill(127);\n stroke(200);\n strokeWeight(2);\n ellipse(this.x, this.y, this.r * 2, this.r * 2);\n }","plot() {\n if (this.plot === 'Cumulative frequency plot' ||\n this.plot === 'Dot plot') {\n this.createPlot();\n }\n }","plotRoutesCornerPoints() {\n for (let r of this.mapRoutes) {\n r.plotRouteCornerPoints(this.map);\n }\n }","function render() {\n renderPlots1D();\n renderPlots2D();\n}","display() {\n fill(127);\n stroke(200);\n strokeWeight(2);\n ellipse(this.x, this.y, this.radius * 2, this.radius * 2);\n }","display() {\n fill(this.color, 100, 100);\n ellipse(this.x, this.y, this.diameter)\n }","function plotDot(){\n\t for (var i = 0; i<data_dot.dot.length;i++) {\n ctx.beginPath();\n ctx.arc(data_dot.dot[i].x,data_dot.dot[i].y,7,0,2*Math.PI);\n ctx.fillStyle =\"#000\";\n ctx.fill();\n\t}\n}","plot(){\n /* plot the X and Y axis of the graph */\n super.plotXAxis();\n super.plotYAxis();\n\n /* (re)draw the points, grouped in a single graphics element */\n let canvas = d3.select('svg#canvas_bioActivity > g#graph');\n canvas.selectAll('#points').remove();\n canvas.append('g')\n .attr('id', 'points')\n .attr('transform', 'translate('+this._margin.left+', 0)')\n ;\n /* Each data point will be d3 symbol (represented using svg paths) */\n let pts = d3.select('#points').selectAll('g')\n .data(this._data)\n /* each point belongs to the 'data-point' class its positioned in the graph\n * according to the associated (x,y) coordinates and its drawn using its\n * color and shape */\n let point = pts.enter().append('path')\n .attr('class', 'data-point')\n .attr('transform', d => 'translate('+d.x+' '+d.y+')')\n .attr('fill', d => d.color )\n .attr('d', function(d){\n let s = ['Circle','Cross','Diamond','Square','Star','Triangle','Wye']\n let symbol = d3.symbol()\n .size(50)\n .type(d3.symbols[s.indexOf(d.shape)])\n ;\n return symbol();\n })\n ;\n /* each point will also have an associated svg title (tooltip) */\n point.append('svg:title')\n .text((d) => {\n return 'Organism: '+d['Organism Name']+\n '\\nGene: '+d['Gene Symbol']+\n '\\nConcentation: '+d['Activity Concentration']+'nM';\n })\n ;\n }","addCoords(coords) {\n var point = {\n x: this.xScale.invert(coords[0]),\n y: this.yScale.invert(coords[1]),\n c: currentClass\n };\n this.addPoint(point);\n }","function init_xy(){\n\n\t\t\tg.append(\"line\")\n\t\t\t\t.attr(\"class\", \"xy\")\n\t\t\t\t.attr(\"x1\", 0)\n\t\t\t\t.attr(\"x2\", inner_w )\n\t\t\t\t.attr(\"y1\", h + 20)\n\t\t\t\t.attr(\"y2\", h + 20)\n\t\t\t\t.style(\"stroke\", \"#CCC\")\n\t\t\t\t.style(\"stroke-width\", \"1px\")\n\t\t\t\t.style(\"stroke-dasharray\", \"5 3\");\n\n\t\t}","function renderGraphics(coords) {\n // Get the selected RGB combo vis params.\n var visParams = RGB_PARAMS[rgbSelect.getValue()];\n \n // Get the clicked point and buffer it.\n var point = ee.Geometry.Point(coords);\n var aoiCircle = point.buffer(45);\n var aoiBox = point.buffer(regionWidthSlider.getValue()*1000/2);\n \n // Clear previous point from the Map.\n map.layers().forEach(function(el) {\n map.layers().remove(el);\n });\n\n // Add new point to the Map.\n map.addLayer(aoiCircle, {color: AOI_COLOR});\n map.centerObject(aoiCircle, 14);\n \n // Build annual time series collection.\n LCB_PROPS['aoi'] = aoiBox;\n LCB_PROPS['startDate'] = startDayBox.getValue();\n LCB_PROPS['endDate'] = endDayBox.getValue();\n lcb.props = lcb.setProps(LCB_PROPS);\n \n // Define annual collection year range as ee.List.\n var years = ee.List.sequence(lcb.props.startYear, lcb.props.endYear);\n var col = ee.ImageCollection.fromImages(years.map(imgColPlan));\n\n // Display the image chip time series. \n displayBrowseImg(col, aoiBox, aoiCircle);\n\n OPTIONAL_PARAMS['chartParams']['vAxis']['title'] = indexSelect.getValue();\n\n // Render the time series chart.\n rgbTs.rgbTimeSeriesChart(col, aoiCircle, indexSelect.getValue(), visParams,\n chartPanel, OPTIONAL_PARAMS);\n}","function draw(){\n\n drawGrid();\n var seriesIndex;\n\n if(!graph.hasData) {\n return;\n }\n\n if(graph.options.axes.x1.show){\n if(!graph.options.axes.x1.labels || graph.options.axes.x1.labels.length === 0) {\n seriesIndex = graph.options.axes.x1.seriesIndex;\n graph.options.axes.x1.labels= getXLabels(graph.allSeries[seriesIndex].series[0], graph.options.labelDateFormat);\n }\n drawXLabels(graph.options.axes.x1);\n }\n if(graph.options.axes.x2.show && graph.hasData){\n if (!graph.options.axes.x2.labels || graph.options.axes.x2.labels.length === 0) {\n seriesIndex = graph.options.axes.x2.seriesIndex;\n graph.options.axes.x2.labels = getXLabels(graph.allSeries[seriesIndex].series[0], graph.options.labelDateFormat);\n }\n drawXLabels(graph.options.axes.x2);\n }\n\n if (graph.options.axes.y1.show) {\n drawYLabels(graph.maxVals[graph.options.axes.y1.seriesIndex], graph.minVals[graph.options.axes.y1.seriesIndex], graph.options.axes.y1);\n }\n if (graph.options.axes.y2.show) {\n drawYLabels(graph.maxVals[graph.options.axes.y2.seriesIndex], graph.minVals[graph.options.axes.y2.seriesIndex], graph.options.axes.y2);\n }\n }","display() {\n fill(0, 0, 0, 30)\n noStroke()\n ellipse(this.position.x, this.position.y, 4, 4)\n }","createAxes () {\n }","function plot(x) { \n var canvas = document.getElementById(\"canvas\"); \n var c = canvas.getContext(\"2d\"); \n var canvasStyle = window.getComputedStyle(canvas, null); \n var width = parseInt(canvasStyle.width);\n var height= parseInt(canvasStyle.height); \n var offset = (1 / (x.length - 1)) * width;\n var maxX = x.reduce(function(a, b) { return Math.max(a, b);});\n var minX = x.reduce(function(a, b) { return Math.min(a, b);});\n // scale the input values to be plotted\n function drawToScale(input) {\n return height - ( (input-minX)*height) / (maxX-minX); \n } \n // remove the previuous lines\n c.clearRect(0, 0, width, height) \n // plot the new ones\n c.beginPath();\n c.moveTo(0, drawToScale(x[0]));\n for (var i = 1; i < x.length; i++) {\n c.lineTo(i * offset, drawToScale(x[i]) );\n }\n c.stroke();\n }","function drawCoords(currentLat, currentLon) {\n html += \"Latitude: \" + currentLat;\n html += \"<br>Longitude: \" + currentLon;\n $(\".longLat\").html(html);\n }","display(){\n\n fill(255)\n ellipse(this.pos.x, this.pos.y, this.size);\n }","function drawPoints(){\n\tfor (var i=0; i<p.length; i+=1){\n\t\tp[i].pplot(1);\n\t}\n}","function cartesianAxisToCanvasCoords(pos) {\n // get canvas coords from the first pair of x/y found in pos\n var res = {},\n i, axis, key;\n\n for (i = 0; i < xaxes.length; ++i) {\n axis = xaxes[i];\n if (axis && axis.used) {\n key = \"x\" + axis.n;\n if (pos[key] == null && axis.n === 1) {\n key = \"x\";\n }\n\n if (pos[key] != null) {\n res.left = axis.p2c(pos[key]);\n break;\n }\n }\n }\n\n for (i = 0; i < yaxes.length; ++i) {\n axis = yaxes[i];\n if (axis && axis.used) {\n key = \"y\" + axis.n;\n if (pos[key] == null && axis.n === 1) {\n key = \"y\";\n }\n\n if (pos[key] != null) {\n res.top = axis.p2c(pos[key]);\n break;\n }\n }\n }\n\n return res;\n }","display(){\n noStroke();\n fill(0,0,0);\n ellipse(this.location.x, this.location.y, this.mass * 5, this.mass * 5)\n noFill();\n stroke(255,255,255);\n ellipse(this.location.x, this.location.y, 200, 200);\n }","function showGrid(ctx, axis, color = '#000000') {\n\tif (!axis.displayGrid) /* do not show grid */\n\t\treturn;\n\tif (!axis.set) { /* haven't set axis */\n\t\talert('You must set AXIS first!');\n\t\treturn;\n\t}\n\tlet lineSize = 1;\n\tlet i = 0;\n\tfor (; i < axis.xDivision.length; ++i) {\n\t\tx = axis.xDivision[i];\n\t\tdrawLine(ctx, x, axis.yLeftRange, x, axis.yRightRange,\n\t\t\tcolor, lineSize);\n\t}\n\t/* yLeft is pos and yRight is neg */\n\tfor (i = 0; i < axis.yDivision.length; ++i) {\n\t\ty = axis.yDivision[i];\n\t\tdrawLine(ctx, axis.xLeftRange, y, axis.xRightRange, y,\n\t\t\tcolor, lineSize);\n\t}\n}","function Coords($map) {\n var that = this;\n\n this.x = $map.data('x');\n this.y = $map.data('y');\n this.iconTitle = '[' + this.x + ',' + this.y + ']';\n\n var $a = $map.find('a');\n if ($a.length) {\n $map.find('sup').unwrap();\n }\n\n var $markers = $map.find('.map-marker');\n\n this.initMap($map, false, $markers, true);\n\n that.createMapPopupTooltip();\n }","show() {\r\n fill(255);\r\n ellipse(this.x, this.y, this.r*2);\r\n }","function drawAxes() {\n canvas.select(\"#layer1\").append(\"g\")\n .attr(\"class\", \"grid\")\n .attr(\"transform\", \"translate(0,\" + h + \")\")\n .call(xAxis);\n canvas.select(\"#layer1\").append(\"g\")\n .attr(\"class\", \"grid\")\n .call(yAxis);\n}","display() {\n\t\tfill(this.col);\n\t\tstroke(255);\n\t\t// for (var i = 1; i < meter - 1; i++) {\n\t\t// \tline(0,0, width, 0);\n\t\t// }\n\t\tnoStroke();\n\t\tellipseMode(CENTER);\n\t\tellipse(this.x, this.y, this.size, this.size);\n\t}","function drawPrices(x,y,price){\r\n fill(244,24,100);\r\n text(price + \" gp\",x+200,35+(y*50));\r\n }","function Grid( )\n{\n\tthis.lowerLeft = [37.74027582404923, -122.51225523839999];\n\tthis.upperRight = [37.81323020595205, -122.38651514053345];\n\tthis.latStep = 0.004053 / 3;\n\tthis.lngStep = 0.006287 / 4;\n\tthis.widthN = (this.upperRight[1] - this.lowerLeft[1]) / this.lngStep;\n\tthis.heightN = (this.upperRight[0] - this.lowerLeft[0]) / this.latStep;\n\t\n\tthis.plotGrid = function( bbox, row, column ) {\n\t\tvar grid = drawRegion_bbox( bbox );\n\t\tgrid.row = row;\n\t\tgrid.column = column;\n\t\tgrid.id = row * this.widthN + column;\n\t\t\n\t\tgoogle.maps.event.addListener(grid, 'mouseover', function(event) {\n\t\t\tmessage('Grid row ' + this.row + ' column ' + this.column + ' id ' + this.id);\n\t\t});\n\t\t\n\t\tgoogle.maps.event.addListener(grid, 'mouseout', function(event) {\n\t\t\tmessage('');\n\t\t});\n\t\t\n\t\treturn grid;\n\t};\n\t\n\tthis.plotAllGrids= function() {\n\t\tfor (var row = 0; row < this.heightN; row ++)\n\t\t{\n\t\t\tfor (var column = 0; column < this.widthN; column ++)\n\t\t\t{\n\t\t\t\tbbox = [ this.lowerLeft[0] + this.latStep * (this.heightN - row -1), \n\t\t\t\t\t\tthis.lowerLeft[1] + this.lngStep * column,\n\t\t\t\t\t\tthis.upperRight[0] - this.latStep * row, \n\t\t\t\t\t\tthis.upperRight[1] - this.lngStep * (this.widthN - 1 - column)];\n\t\t\t\t\n\t\t\t\tthis.plotGrid( bbox, row, column );\n\t\t\t}\n\t\t}\n\t};\n\t\n\t\n\tthis.plotByID = function( id ) {\n\t\tvar row = Math.floor(id / this.widthN);\n\t\tvar column = id % this.widthN;\n\t\tvar bbox = [ this.lowerLeft[0] + this.latStep * (this.heightN - row -1), \n\t\t\t\t\t\tthis.lowerLeft[1] + this.lngStep * column,\n\t\t\t\t\t\tthis.upperRight[0] - this.latStep * row, \n\t\t\t\t\t\tthis.upperRight[1] - this.lngStep * (this.widthN - 1 - column)];\n\t\treturn this.plotGrid( bbox, row, column );\n\t};\n}","display(){\n noStroke();\n fill(245,172,114);\n ellipse(this.location.x, this.location.y, this.mass * 5, this.mass * 5)\n }","function showCars(){\n for(let i = 0; i < carImage.length; i++){\n image(carImage[i],xCars[i], yCars[i],carWidth,carHeigth); \n print(yCars[i], xCars[i]);\n }\n}","function drawGridCentre(x,y,s,rot){\r\n ctx.save();\r\n ctx.translate(x,y);\r\n ctx.rotate(rot*Math.PI/180);\r\n drawCircle(0,0,20, colArray[0], colArray[0], 2, false, true);\r\n for(j = 0; j<7 ; j++){\r\n for(var i = 0 ; i<7 ; i++){\r\n drawRectangle(0-s/2+i*s/7,0-s/2+j*s/7, s/7,s/7,colArray[3], colArray[4],0.5, false, true);\r\n }\r\n }\r\n ctx.restore();\r\n}","function PolarCoordinates() {\r\n}","function calc_graph(args) {\n\n //calculate the distances between each screen pixel\n var x_step = (args.xmax - args.xmin) / args.width;\n var y_step = (args.ymax - args.ymin) / args.height;\n\n //current complex number\n var x = args.xmin;\n var y = args.ymin;\n\n\n for (var scaleX = 0; scaleX < args.width; scaleX++) {\n y = args.ymin;\n for (var scaleY = 0; scaleY < args.height; scaleY++) {\n var c = new Complex(x,y);\n if(is_mandelbrot_member(c)) {\n postMessage({ x: scaleX, y: scaleY });\n }\n y += y_step;\n }\n x += x_step;\n }\n}","function drawPol(xCor, yCor, N, side) {\n paper.circle(xCor, yCor, 3).attr(\"fill\", \"black\");\n\n var path = \"\", n, temp_x, temp_y, angle;\n\n for (n = 0; n <= N; n += 1) {\n // angulo en radianes parte del circulo a dibujar\n angle = n / N * 2 * Math.PI;\n\n // ajustar valor de x de acuerdo al angulo\n temp_x = xCor + Math.cos(angle) * side;\n // ajustar valor de y de acuerdo al angulo\n temp_y = yCor + Math.sin(angle) * side;\n\n //Empezar a escribir el path\n // Si es el primer punto, se usa M (starting point) si no utilizar L en el formato del path\n //Dato especificado por raphael\n path += (n === 0 ? \"M\" : \"L\") + temp_x + \",\" + temp_y;\n }\n return path;\n}","display() {\n push();\n fill(255, 255, 0);\n let angle = TWO_PI / this.points;\n let halfAngle = angle / 2.0;\n beginShape();\n for (let a = 0; a < TWO_PI; a += angle) {\n let sx = this.x + cos(a) * this.outerRadius;\n let sy = this.y + sin(a) * this.outerRadius;\n vertex(sx, sy);\n sx = this.x + cos(a + halfAngle) * this.innerRadius;\n sy = this.y + sin(a + halfAngle) * this.innerRadius;\n vertex(sx, sy);\n }\n endShape(CLOSE);\n pop();\n }","function genIterDiagram(f, xstar, axis) {\n\n var w = 900\n var h = 300\n var totalIters = 150\n var state_beta = 0.0\n var state_alpha = 0.001\n var num_contours = 15\n var onDrag = function() {}\n var w0 =[-1.21, 0.853]\n //var w0 = [0,0]\n\n function renderIterates(div) {\n\n // Render the other stuff\n var intDiv = div.style(\"width\", w + \"px\")\n .style(\"height\", h + \"px\")\n .style(\"box-shadow\",\"0px 3px 10px rgba(0, 0, 0, 0.4)\")\n .style(\"border\", \"solid black 1px\")\n\n // Render Contours \n var plotCon = contour_plot.ContourPlot(w,h)\n .f(function(x,y) { return f([x,y])[0] })\n .drawAxis(false)\n .xDomain(axis[0])\n .yDomain(axis[1])\n .contourCount(num_contours)\n .minima([{x:xstar[0], y:xstar[1]}]);\n\n var elements = plotCon(intDiv);\n\n var svg = intDiv.append(\"div\")\n .append(\"svg\")\n .style(\"position\", 'absolute')\n .style(\"left\", 0)\n .style(\"top\", 0)\n .style(\"width\", w)\n .style(\"height\", h)\n .style(\"z-index\", 2) \n\n\n // var X = d3.scaleLinear().domain([0,1]).range(axis[0])\n // var Y = d3.scaleLinear().domain([0,1]).range(axis[1])\n\n var X = d3.scaleLinear().domain(axis[0]).range([0, w])\n var Y = d3.scaleLinear().domain(axis[1]).range([0, h])\n \n // Rendeer Draggable dot\n var circ = svg.append(\"circle\")\n .attr(\"cx\", X(w0[0])) \n .attr(\"cy\", Y(w0[1]) )\n .attr(\"r\", 4)\n .style(\"cursor\", \"pointer\")\n .attr(\"fill\", colorbrewer.OrRd[3][1])\n .attr(\"opacity\", 0.8)\n .attr(\"stroke-width\", 1)\n .attr(\"stroke\", colorbrewer.OrRd[3][2])\n .call(d3.drag().on(\"drag\", function() {\n var pt = d3.mouse(this)\n var x = X.invert(pt[0])\n var y = Y.invert(pt[1])\n this.setAttribute(\"cx\", pt[0])\n this.setAttribute(\"cy\", pt[1])\n w0 = [x,y]\n onDrag(w0)\n iter(state_alpha, state_beta, w0);\n }))\n\n var iterColor = d3.scaleLinear().domain([0, totalIters]).range([\"black\", \"black\"])\n\n var update2D = plot2dGen(X, Y, iterColor)(svg)\n\n // Append x^star\n svg.append(\"path\")\n .attr(\"transform\", \"translate(\" + X(xstar[0]) + \",\" + Y(xstar[1]) + \")\")\n .attr(\"d\", \"M 0.000 2.000 L 2.939 4.045 L 1.902 0.618 L 4.755 -1.545 L 1.176 -1.618 L 0.000 -5.000 L -1.176 -1.618 L -4.755 -1.545 L -1.902 0.618 L -2.939 4.045 L 0.000 2.000\")\n .style(\"fill\", \"white\")\n .style(\"stroke-width\",1)\n\n \n function iter(alpha, beta, w0) {\n\n // Update Internal state of alpha and beta\n state_alpha = alpha\n state_beta = beta\n\n // Generate iterates \n var OW = runMomentum(f, w0, alpha, beta, totalIters)\n var W = OW[1]\n\n update2D(W)\n\n circ.attr(\"cx\", X(w0[0]) ).attr(\"cy\", Y(w0[1]) )\n circ.moveToFront()\n\n }\n\n iter(state_alpha, state_beta, w0);\n \n return { control:iter, \n w0:function() { return w0 }, \n alpha:function() { return state_alpha }, \n beta:function() {return state_beta} }\n\n }\n\n renderIterates.width = function (_) {\n w = _; return renderIterates;\n }\n\n renderIterates.height = function (_) {\n h = _; return renderIterates;\n }\n\n renderIterates.iters = function (_) {\n totalIters = _; return renderIterates;\n }\n\n renderIterates.drag = function (_) {\n onDrag = _; return renderIterates;\n }\n\n renderIterates.init = function (_) {\n w0 = _; return renderIterates;\n }\n\n renderIterates.alpha = function (_) {\n state_alpha = _; return renderIterates;\n }\n\n renderIterates.beta = function (_) {\n state_beta = _; return renderIterates;\n }\n\n return renderIterates\n\n}","function plot_function(npoints) {\n data = [...Array(npoints).keys()].map(Math.random);\n\n //yScale for position\n yScale = d3.scaleLinear()\n .domain([d3.min(data), d3.max(data)])\n .range([d3.select(\"#chart\").style(\"height\").replace(\"px\",\"\")-20, 10]);\n\n //This range of continous scales can be colours!\n color = d3.scaleLog()\n .domain([d3.min(data), d3.mean(data), d3.max(data)])\n .range([1,0]);\n\n //Quantized colors can be used to.\n color = d3.scaleQuantize()\n .domain([d3.min(data), d3.max(data)])\n .range(d3.schemeCategory10);\n\n xScale = d3.scaleLinear()\n .domain([0,npoints])\n .range([0,700]);\n\n markers = d3.select(\"#axisbox\")\n .attr(\"transform\", \"translate(80,-20)\")\n .selectAll(\"circle\")\n .data(data)\n .enter()\n .append(\"circle\")\n .attr(\"r\", 2)\n .attr(\"cx\", function(d,i) {return xScale(i);})\n .attr(\"cy\", function(d,i) {return yScale(d);})\n .attr(\"fill\", function(d,i) {return color(d);});\n\n laxis = d3.axisLeft(yScale)\n .ticks(10, 'f');\n\n baxis = d3.axisBottom(xScale)\n .ticks(10);\n\n d3.select(\"#axisbox\")\n .append(\"g\")\n .call(laxis);\n\n d3.select(\"#axisbox\")\n .append(\"g\")\n .attr(\"transform\", \"translate(0,620)\")\n .call(baxis)\n .select(\".domain\")\n}","function plot(x,y,color){\n ctx.fillStyle = color;\n ctx.fillRect(x,y,1,1);\n }","function setGraphCoordinates(canvasSize) {\n let xCoordinate = 0;\n let yCoordinate = 1000;\n const decimalIncrement = 0.1;\n let coordinatesArray = []\n while(yCoordinate > 0) {\n\n let orderedPair = generateOrderedPair(xCoordinate);\n yCoordinate =orderedPair[1] \n coordinatesArray.push(orderedPair);\n xCoordinate +=decimalIncrement;\n }\n return coordinatesArray\n}","function drawChords (matrix, mmap) {\n var w = 980, h = 750, r1 = h / 2, r0 = r1 - 110, duration=5000;\n\n var fill = d3.scale.ordinal()\n // .range(['#c7b570','#c6cdc7','#335c64','#768935','#507282','#5c4a56','#aa7455','#574109','#837722','#73342d','#0a5564','#9c8f57','#7895a4','#4a5456','#b0a690','#0a3542',]);\n //.range(['#E54E45', \"#DBC390\", \"#13A3A5\", \"#403833\", \"#334D5C\", \"#C0748D\", \"#EFC94C\", \"#E27A3F\", \"#DF4949\", \"#7B3722\", \"#8F831F\", \"#F0900D\", \"#10325C\"]);\n .range(['#A9A18C', '#855723', '#4E6172', '#DBCA69', '#A3ADB8', '#668D3C', '#493829']);\n\n var chord = d3.layout.chord()\n .padding(.02)\n .sortSubgroups(d3.descending)\n .sortChords(d3.descending);\n\n var arc = d3.svg.arc()\n .innerRadius(r0)\n .outerRadius(r0 + 20);\n\n var svg = d3.select(\"#ext-chart\").append(\"svg:svg\")\n .attr(\"width\", w)\n .attr(\"height\", h)\n .append(\"svg:g\")\n .attr(\"id\", \"circle\")\n .attr(\"transform\", \"translate(\" + w / 2 + \",\" + h / 2 + \")\");\n\n svg.append(\"circle\")\n .attr(\"r\", r0 + 20);\n\n var rdr = chordRdr(matrix, mmap);\n chord.matrix(matrix);\n\n var g = svg.selectAll(\"g.group\")\n .data(chord.groups())\n .enter().append(\"svg:g\")\n .attr(\"class\", \"group\")\n .on(\"mouseover\", mouseover)\n .on(\"mouseout\", function (d) { d3.select(\"#tooltip\").style(\"visibility\", \"hidden\") });\n\n g.append(\"svg:path\")\n .style(\"stroke\", \"black\")\n .style(\"fill\", function(d) { return fill(rdr(d).gname); })\n .attr(\"d\", arc);\n\n g.append(\"svg:text\")\n .each(function(d) { d.angle = (d.startAngle + d.endAngle) / 2; })\n .attr(\"dy\", \".35em\")\n .style(\"font-family\", \"helvetica, arial, sans-serif\")\n .style(\"font-size\", \"12px\")\n .attr(\"text-anchor\", function(d) { return d.angle > Math.PI ? \"end\" : null; })\n .attr(\"transform\", function(d) {\n return \"rotate(\" + (d.angle * 180 / Math.PI - 90) + \")\"\n + \"translate(\" + (r0 + 26) + \")\"\n + (d.angle > Math.PI ? \"rotate(180)\" : \"\");\n })\n .text(function(d) { return rdr(d).gname; });\n\n var chordPaths = svg.selectAll(\"path.chord\")\n .data(chord.chords())\n .enter().append(\"svg:path\")\n .attr(\"class\", \"chord\")\n .style(\"stroke\", function(d) { return d3.rgb(fill(rdr(d).sname)).darker(); })\n .style(\"fill\", function(d) { return fill(rdr(d).sname); })\n .attr(\"d\", d3.svg.chord().radius(r0))\n .on(\"mouseover\", function (d) {\n d3.select(\"#tooltip\")\n .style(\"visibility\", \"visible\")\n .html(chordTip(rdr(d)))\n .style(\"font\", \"12px sans-serif\")\n .style(\"top\", function () { return (d3.event.pageY - 170)+\"px\"})\n .style(\"left\", function () { return (d3.event.pageX - 100)+\"px\";})\n })\n .on(\"mouseout\", function (d) { d3.select(\"#tooltip\").style(\"visibility\", \"hidden\") });\n\n function chordTip (d) {\n var q = d3.format(\",.1f\")\n return \"Flow Info:<br/><br>\"\n + d.sname + \" flow from \" + d.tname\n + \": \" + q(d.svalue) + \"T<br/>\"\n + \"<br/>\"\n + d.tname + \" flow from \" + d.sname\n + \": \" + q(d.tvalue) + \"T<br/>\";\n }\n\n function groupTip (d) {\n var p = d3.format(\".1%\"), q = d3.format(\",.2f\")\n return \"Influx Info:<br/><br/>\"\n + d.gname + \" : \" + q(d.gvalue) + \"T\"\n }\n\n function mouseover(d, i) {\n d3.select(\"#tooltip\")\n .style(\"visibility\", \"visible\")\n .html(groupTip(rdr(d)))\n .style(\"top\", function () { return (d3.event.pageY - 80)+\"px\"})\n .style(\"left\", function () { return (d3.event.pageX - 130)+\"px\";})\n\n chordPaths.classed(\"fade\", function(p) {\n return p.source.index != i\n && p.target.index != i;\n });\n }\n\n /* for brush slider */\n var margin = {top: 0, right: 50, bottom: 10, left: 50},\n width = w - margin.left - margin.right,\n height = 50 - margin.bottom - margin.top;\n\n var x = d3.scale.linear()\n .domain([10, 22])\n .range([0, width])\n .clamp(true);\n\n var brush = d3.svg.brush()\n .x(x)\n .extent([0, 0])\n .on(\"brush\", brushed);\n\n var svg = d3.select(\"#brush-slider\").append(\"svg\")\n .attr(\"width\", width + margin.left + margin.right)\n .attr(\"height\", height + margin.top + margin.bottom)\n .append(\"g\")\n .attr(\"transform\", \"translate(\" + margin.left + \",\" + margin.top + \")\");\n\n svg.append(\"g\")\n .attr(\"class\", \"x axis\")\n .attr(\"transform\", \"translate(0,\" + height / 2 + \")\")\n .call(d3.svg.axis()\n .scale(x)\n .orient(\"bottom\")\n .tickFormat(function(d) { return d + \":00\"; })\n .tickSize(0)\n .tickPadding(12))\n .select(\".domain\")\n .select(function() { return this.parentNode.appendChild(this.cloneNode(true)); })\n .attr(\"class\", \"halo\");\n\n var slider = svg.append(\"g\")\n .attr(\"class\", \"slider\")\n .call(brush);\n\n slider.selectAll(\".extent,.resize\")\n .remove();\n\n slider.select(\".background\")\n .attr(\"height\", height);\n\n var handle = slider.append(\"circle\")\n .attr(\"class\", \"handle\")\n .attr(\"transform\", \"translate(0,\" + height / 2 + \")\")\n .attr(\"r\", 9);\n\n slider\n .call(brush.event)\n .transition() // gratuitous intro!\n .duration(750)\n .call(brush.extent([16, 16]))\n .call(brush.event);\n\n function brushed() {\n var value = brush.extent()[0];\n\n if (d3.event.sourceEvent) { // not a programmatic event\n value = x.invert(d3.mouse(this)[0]);\n brush.extent([value, value]);\n }\n\n handle.attr(\"cx\", x(value));\n } \n }","function position(dot) {\n dot .attr(\"cx\", function(d) { \n // console.log(\"cx is \" + xScale(x(d)) );\n // return xScale(x(d)); \n return xScale(d.engineers_num);\n } )\n .attr(\"cy\", function(d) { return yScale(d.employees_num) })\n .attr(\"r\", 10\n // function(d) {\n // console.log( radiusScale(radius(d)) );\n // return radiusScale(radius(d)); \n // }\n );\n }","function axialCoords(q, r) {\r\n\tthis.q = q;\r\n\tthis.r = r;\r\n}","function drawGrid(Tx){\n context.beginPath();\n var dim = 10;\n var length = 500;\n // Draw from the negative width to pos\n for(var i=-(dim/2); i<=(dim/2); i++){\n iScaled = i * 50;\n moveToTx(iScaled, 0, -length/2, Tx); lineToTx(iScaled, 0, length/2, Tx);\n moveToTx(-length/2, 0, iScaled, Tx); lineToTx(length/2, 0, iScaled, Tx);\n }\n context.stroke();\n }","function render () {\n\n\t\tfunction pushMatrix (fn) {\n\t\t\tp.push();\n\t\t\tfn();\n\t\t\tp.pop();\n\t\t}\n\n\t\t// Draw Horizontal Lines\n\t\tpushMatrix(function () {\n\t\t\tp.strokeCap(p.ROUND);\n\t\t\tp.stroke(121, 192, 242);\t\t\t\t// Light Blue\n\t\t\tp.translate(p.width/2, p.height/2);\t\t// Translate to center\n\n\t\t\t// Set strokeweight to decrease proportionally to the stretch factor\n\t\t\tvar base_stroke_weight = 2;\n\t\t\tvar stroke_weight = base_stroke_weight - (a_l_de.value * base_stroke_weight);\n\t\t\tp.strokeWeight(stroke_weight);\n\n\t\t\tvar spacing = 60;\t\t\t\t\t\t// Set space around Es\n\t\t\t// Mult by -1 for left line\n\t\t\tvar displacement_start = a_l_ds.value * (p.width / 2) + spacing;\n\t\t\tvar displacement_end = a_l_de.value * (p.width / 2) + spacing;\n\n\t\t\tp.line(-displacement_end, 0, -displacement_start, 0);\t\t// Left Line\n\t\t\tp.line(displacement_end, 0, displacement_start, 0);\t\t// Right Line\n\t\t});\n\n\t\t// Assemble Logo!\n\n\t\t// Rotate E\n\t\tpushMatrix(function () {\n\n\t\t\tp.tint(255, 255); // Opacity (255)\n\t\t\t\n\t\t\tp.translate(p.width / 2, p.height / 2);\n\t\t\tp.rotate(p.radians(a_ed_r.value));\t\t// All rotations must occur here!!!\n\t\t\tp.scale(0.75, 0.75);\n\n\t\t\t// For Dots\n\t\t\tpushMatrix(function () {\n\n\t\t\t\tp.translate(-41.25,-42.65); \t\t// Center offset\n\t\t\t\tp.scale(0.15,0.15);\n\n\t\t\t\t// Polar Coordinates\n\t\t\t\tvar r = a_d_d.value;\t\t\t\t// Origin Offset \t{start: 300, end: 265}\n\t\t\t\tvar angle = p.radians(a_d_r.value);\t\t// Angle Offset\t\t{start: 0, end: 77}\n\t\t\t\tvar x = p.cos(angle) * r;\t\t\t\t// Multiply r * -1 for other Dot\n\t\t\t\tvar y = p.sin(angle) * r;\n\n\t\t\t\t// Top Dot\n\t\t\t\tpushMatrix(function () {\n\t\t\t\t\tp.scale(1, 1);\n\t\t\t\t\t\n\t\t\t\t\tp.translate(x,y);\n\t\t\t\t\tp.translate(276,283); \t\t// Center on Es\n\t\t\t\t\tp.scale(a_d_s.value, a_d_s.value); \t// Each scale <-- Parametric\n\t\t\t\t\tp.image(dot, -50, -50); \t// Center around origin\n\t\t\t\t});\n\n\t\t\t\t// Bottom Dot\n\t\t\t\tpushMatrix(function () {\n\t\t\t\t\tp.scale(1, 1);\n\t\t\t\t\t\n\t\t\t\t\tp.translate(-x,-y);\n\t\t\t\t\tp.translate(276, 283); \t\t// Center on Es, experimentally determined\n\t\t\t\t\tp.scale(a_d_s.value, a_d_s.value); \t// Each scale <-- Parametric\n\t\t\t\t\tp.image(dot2, -50, -50); \t// Center around origin\n\t\t\t\t});\n\t\t\t});\n\n\t\t\t// For Es\n\t\t\tpushMatrix(function () {\n\t\t\t\tp.scale(a_e_s.value, a_e_s.value); \t// Global scale\n\t\t\t\tp.translate(-41.25,-42.65); \t\t// Center offset, experimentally determined\n\t\t\t\tp.scale(0.15,0.15);\n\t\t\t\t\n\t\t\t\t// Bottom E\n\t\t\t\tp.image(E, 100, 100);\n\n\t\t\t\t// Top E\n\t\t\t\tpushMatrix(function () {\n\t\t\t\t\tp.translate(200, 0);\n\t\t\t\t\tp.image(E2, 0, 0);\n\t\t\t\t});\n\t\t\t});\n\n\t\t});\n\n\t\tpushMatrix(function () {\n\t\t\tp.fill(255);\n\t\t\tp.noStroke();\n\t\t\tp.translate(p.width/2, p.height/2);\n\t\t});\n\n\t\tif (global_animator.value >= 1) {\n\t\t\tp.noLoop();\n\t\t}\n\t}","show() {\n\t\tfill(255);\n ellipse(this.x, this.y, this.r*2)\n\t}","function showCoords(c)\r\n {\r\n $('#x1').val(c.x);\r\n $('#y1').val(c.y);\r\n $('#x2').val(c.x2);\r\n $('#y2').val(c.y2);\r\n $('#w').val(c.w);\r\n $('#h').val(c.h);\r\n }","function allDotsDraw(positions) {\n // Loop through each dot and draw\n for (i = 0; i < positions.length; i++){\n dotDrawer(positions[i])\n }\n}","function drawPC() {\r\n\t\r\n//setting the x and y scale \r\n\tvar x = d3.scale.ordinal().rangePoints([0, 480], 1),\r\n y= {};\r\n \r\n// Extract the list of dimensions and create a scale for each.\r\n for (var dim in cars[0]) {\r\n\t if (dim != \"name\") {\r\n\t\t y[dim] = d3.scale.linear()\r\n\t\t\t .domain([d3.min(cars, function(d) { return +d[dim]; }), d3.max(cars, function(d) { return +d[dim]; })])\r\n\t\t .range([height,0]);\r\n\t }\r\n }\r\n \r\n//setting the x domain dimensions\r\n x.domain(dimensions = d3.keys(cars[0]).filter(function(d) { return d != \"name\";}));\r\n\r\n//draw polylines\r\n for (var i=1; i< cars.length; i++) { \r\n\r\n//prepare the coordinates for a polyline\r\n\t var lineData = []; //initialize an array for coordinates of a polyline\r\n\t for (var prop in cars[0]) { //get each dimension\r\n\t if (prop != \"name\" ) { //skip the name dimension\r\n\t var point = {}; //initialize a coordinate object\r\n\t var val = cars[i][prop]; //obtain the value of a car in a dimension\r\n\t\t point['x'] = x(prop); //x value: mapping the dimension \r\n\t point['y'] = y[prop](val);//y value: mapping the value in that dimension\r\n\t lineData.push(point); //add the object into the array \r\n\t }\r\n\t }\r\n\r\n//draw a polyline based on the coordindates \r\n chart.append(\"g\")\r\n\t .attr(\"class\", \"polyline\")\r\n\t .append(\"path\") // a path shape\r\n\t\t .attr(\"d\", line(lineData)) //line() is a function to turn coordinates into SVG commands\r\n\t\r\n//the mouseover function that changes the strokes to red when the mouse is over them\r\n\t.on(\"mouseover\", function(){\r\n\t\t\td3.select(this)\r\n\t\t.style(\"stroke\",\"red\")\r\n\t })\r\n//the mouseout function that changes the strokes back to their original color\r\n\t.on(\"mouseout\", function(){\r\n\t\td3.select(this)\r\n\t\t.style(\"stroke\",null)\r\n\t\t\r\n})\r\n }\r\n\r\n//draw individual dimension lines\r\n//position dimension lines \r\n var g = chart.selectAll(\".dimension\")\r\n\t .data(dimensions)\r\n\t .enter().append(\"g\")\r\n\t .attr(\"class\", \"dimension\")\r\n\t .attr(\"transform\", function(d) { return \"translate(\" + x(d) + \")\"; }) //translate each axis\r\n\r\n\t\r\n// Add an axis and title.\r\n g.append(\"g\")\r\n\t .attr(\"class\", \"axis\")\r\n\t .each(function(d) { d3.select(this).call(axis.scale(y[d])); })\r\n\t .append(\"text\")\r\n\t .style(\"text-anchor\", \"middle\")\r\n\t .attr(\"y\", -4)\r\n\t .text(function(d) { return d; });\r\n\t \r\n \r\n}","show() {\n fill(this.fill, this.alpha);\n strokeWeight(4);\n stroke(255);\n ellipse(this.x, this.y, (this.r * 2));\n }"],"string":"[\n \"function drawCartesianOverlay() {\\n \\\"use strict\\\";\\n //Draw heavier black lines for grid\\n ctx.beginPath();\\n ctx.moveTo(0.5, 300.5);\\n ctx.lineTo(800.5, 300.5);\\n ctx.moveTo(400.5, 0.5);\\n ctx.lineTo(400.5, 600.5);\\n ctx.strokeStyle = 'black';\\n ctx.lineWidth = 1.0;\\n ctx.stroke();\\n //-x arrow for line\\n ctx.beginPath();\\n ctx.moveTo(5.5, 295.5);\\n ctx.lineTo(0.5, 300.5);\\n ctx.lineTo(5.5, 305.5);\\n //+x arrow for line\\n ctx.moveTo(795.5, 295.5);\\n ctx.lineTo(800.5, 300.5);\\n ctx.lineTo(795.5, 305.5);\\n //+y arrow for line\\n ctx.moveTo(395.5, 5.0);\\n ctx.lineTo(400.5, 0.5);\\n ctx.lineTo(405.5, 5.0);\\n //-y arrow for line\\n ctx.moveTo(395.5, 595.5);\\n ctx.lineTo(400.5, 600.5);\\n ctx.lineTo(405.5, 595.5);\\n ctx.strokeStyle = 'black';\\n ctx.lineWidth = 1.0;\\n ctx.stroke();\\n //Label Graphs\\n ctx.font = \\\"9px Georgia\\\";\\n ctx.fillText(\\\"-x\\\", 1, 288);\\n ctx.fillText(\\\"+\\\", 790, 288);\\n ctx.fillText(\\\"x\\\", 795, 288);\\n ctx.fillText(\\\"-y\\\", 382, 597);\\n ctx.fillText(\\\"+\\\", 381, 8);\\n ctx.fillText(\\\"y\\\", 386, 8);\\n}\",\n \"function plotGrid() {\\n for (let i = 0; i < grid.length; i++) {\\n for (let j = 0; j < grid[i].length; j++) {\\n plotRectangle(i, j);\\n }\\n }\\n }\",\n \"axisPlot() {\\n this.ctx = this.canvas.getContext(\\\"2d\\\");\\n\\n /**\\n * Grid grid\\n */\\n if (this.grid.grid) {\\n this.ctx.beginPath();\\n this.ctx.font = 'italic 18pt Calibri';\\n this.ctx.strokeStyle = '#979797';\\n this.ctx.lineWidth = 1;\\n this.ctx.setLineDash([10, 15]);\\n for (let i = 30; i < this.field.width; i+= 100) {\\n this.ctx.fillText(Math.ceil(this.ScreenToWorldY(i)*1000)/1000, 0, i);\\n this.ctx.moveTo(0, i);\\n this.ctx.lineTo(this.field.width, i);\\n }\\n for (let i = 100; i < this.field.width; i+= 100) {\\n this.ctx.fillText(Math.ceil(this.ScreenToWorldX(i)*1000)/1000, i, this.field.height);\\n this.ctx.moveTo(i, 0);\\n this.ctx.lineTo(i, this.field.height);\\n }\\n this.ctx.stroke();\\n this.ctx.closePath();\\n }\\n\\n\\n /**\\n * Grid axiss\\n */\\n if (this.grid.axiss) {\\n this.ctx.beginPath();\\n this.ctx.strokeStyle = '#b10009';\\n this.ctx.lineWidth = 2;\\n this.ctx.setLineDash([]);\\n\\n this.ctx.moveTo(this.center.x, 0);\\n this.ctx.lineTo(this.center.x, this.field.height);\\n\\n this.ctx.moveTo(0, this.center.y);\\n this.ctx.lineTo(this.field.width, this.center.y);\\n\\n this.ctx.stroke();\\n this.ctx.closePath();\\n }\\n\\n\\n if (this.grid.serifs) {\\n this.ctx.beginPath();\\n this.ctx.strokeStyle = '#058600';\\n this.ctx.fillStyle = '#888888'\\n this.ctx.lineWidth = 2;\\n this.ctx.setLineDash([]);\\n\\n let start = 0;\\n if (!this.grid.serifsStep){\\n return;\\n }\\n\\n let s = Math.abs(\\n this.ScreenToWorldY(0) -\\n this.ScreenToWorldY(this.grid.serifsSize)\\n );\\n\\n /**\\n * To right & to left\\n */\\n if ((this.center.y > 0) && (this.center.y < this.field.height)) {\\n\\n let finish = this.ScreenToWorldX(this.field.width);\\n\\n for (let i = start; i < finish; i+=this.grid.serifsStep) {\\n this.moveTo(i+this.grid.serifsStep/2,(s/2));\\n this.lineTo(i+this.grid.serifsStep/2,-(s/2));\\n this.ctx.fillText(i+this.grid.serifsStep/2, this.WorldToScreenX(i+this.grid.serifsStep/2), this.WorldToScreenY(s/2));\\n\\n this.moveTo(i+this.grid.serifsStep,s);\\n this.lineTo(i+this.grid.serifsStep,-s);\\n this.ctx.fillText(i+this.grid.serifsStep, this.WorldToScreenX(i+this.grid.serifsStep), this.WorldToScreenY(s));\\n }\\n\\n finish = this.ScreenToWorldX(0);\\n\\n for (let i = start; i > finish; i-=this.grid.serifsStep) {\\n this.moveTo(i-this.grid.serifsStep/2,(s/2));\\n this.lineTo(i-this.grid.serifsStep/2,-(s/2));\\n this.ctx.fillText(i-this.grid.serifsStep/2, this.WorldToScreenX(i-this.grid.serifsStep/2), this.WorldToScreenY(s/2));\\n\\n this.moveTo(i-this.grid.serifsStep,s);\\n this.lineTo(i-this.grid.serifsStep,-s);\\n this.ctx.fillText(i-this.grid.serifsStep, this.WorldToScreenX(i-this.grid.serifsStep), this.WorldToScreenY(s));\\n }\\n }\\n\\n /**\\n * To top & to bot\\n */\\n if ((this.center.x > 0) && (this.center.x < this.field.width)) {\\n\\n start = 0;\\n let finish = this.ScreenToWorldY(0);\\n\\n for (let i = start; i < finish; i+=this.grid.serifsStep) {\\n this.moveTo((s/2),i+this.grid.serifsStep/2);\\n this.lineTo(-(s/2),i+this.grid.serifsStep/2);\\n this.ctx.fillText(i+this.grid.serifsStep/2, this.WorldToScreenX(s/2), this.WorldToScreenY(i+this.grid.serifsStep/2));\\n\\n this.moveTo(s, i+this.grid.serifsStep);\\n this.lineTo(-s, i+this.grid.serifsStep);\\n this.ctx.fillText(i+this.grid.serifsStep, this.WorldToScreenX(s), this.WorldToScreenY(i+this.grid.serifsStep));\\n }\\n\\n finish = this.ScreenToWorldY(this.field.width);\\n\\n for (let i = start; i > finish-this.grid.serifsStep; i-=this.grid.serifsStep) {\\n this.moveTo((s/2),i+this.grid.serifsStep/2);\\n this.lineTo(-(s/2),i+this.grid.serifsStep/2);\\n this.ctx.fillText(i+this.grid.serifsStep/2, this.WorldToScreenX(s/2), this.WorldToScreenY(i+this.grid.serifsStep/2));\\n\\n this.moveTo(s, i+this.grid.serifsStep);\\n this.lineTo( -s, i+this.grid.serifsStep);\\n this.ctx.fillText(i+this.grid.serifsStep, this.WorldToScreenX(s), this.WorldToScreenY(i+this.grid.serifsStep));\\n }\\n }\\n this.ctx.stroke();\\n this.ctx.closePath();\\n }\\n }\",\n \"function plotGraph() {\\n if (houses.data.length > 0) {\\n for (let i = 0; i < houses.data.length; i++) {\\n xs[i] = map(houses.data[i].inputs[0], 0, zoom, 0, wnx);\\n ys[i] = map(houses.data[i].inputs[1], 0, zoom, wny, 200);\\n cs[i] = houses.data[i].inputs[8];\\n ps[i] = houses.data[i].target[0];\\n }\\n }\\n}\",\n \"function cartesian(coordinates) {\\n const lambda = coordinates[0] * radians,\\n phi = coordinates[1] * radians,\\n cosphi = cos(phi);\\n return [cosphi * cos(lambda), cosphi * sin(lambda), sin(phi)];\\n}\",\n \"function plotPoints(coords) {\\n ctx.fillStyle = 'green';\\n console.log(coords);\\n ctx.fillRect(coords.y, coords.x, 5, 5);\\n}\",\n \"function plot() {\\n \\n }\",\n \"plotCyclists() {\\n for (let c of this.mapCyclists) {\\n if (c.cyclist.id.id == \\\"0_ghost\\\" || c.cyclist.id.id == \\\"ghost\\\") {\\n c.plotGhost(this.map);\\n } else {\\n c.plotMarker(this.map);\\n }\\n }\\n }\",\n \"function displayCoord(a) {\\r\\n\\t\\tc.beginPath();\\r\\n\\t\\tc.moveTo(parseInt(a[0],10)-3,output(parseInt(a[1],10)-3));\\r\\n\\t\\tc.lineTo(parseInt(a[0],10)+3,output(parseInt(a[1],10)+3));\\r\\n\\t\\tc.stroke();\\r\\n\\t\\tc.beginPath();\\r\\n\\t\\tc.moveTo(parseInt(a[0],10)-3,output(parseInt(a[1],10)+3));\\r\\n\\t\\tc.lineTo(parseInt(a[0],10)+3,output(parseInt(a[1],10)-3));\\r\\n\\t\\tc.stroke();\\r\\n\\t\\tif (showCoordsCheck) c.fillText(\\\"(\\\"+a[0]+\\\",\\\"+a[1]+\\\")\\\",parseInt(a[0],10)+10,output(parseInt(a[1],10)+10));\\r\\n\\t}\",\n \"function cartesian(coordinates) {\\n var lambda = coordinates[0] * __WEBPACK_IMPORTED_MODULE_1__math__[\\\"v\\\" /* radians */],\\n phi = coordinates[1] * __WEBPACK_IMPORTED_MODULE_1__math__[\\\"v\\\" /* radians */],\\n cosphi = Object(__WEBPACK_IMPORTED_MODULE_1__math__[\\\"h\\\" /* cos */])(phi);\\n return [cosphi * Object(__WEBPACK_IMPORTED_MODULE_1__math__[\\\"h\\\" /* cos */])(lambda), cosphi * Object(__WEBPACK_IMPORTED_MODULE_1__math__[\\\"y\\\" /* sin */])(lambda), Object(__WEBPACK_IMPORTED_MODULE_1__math__[\\\"y\\\" /* sin */])(phi)];\\n}\",\n \"show() {\\n fill(255);\\n noStroke();\\n let sx = map(this.x/this.z, 0, 1, 0, width);\\n let sy = map(this.y/this.z, 0, 1, 0, height);\\n let r = map(this.z, 0, width, 8, 0);\\n //ellipse(sx, sy, r, r);\\n stroke(255);\\n let px = map(this.x/this.pz, 0, 1, 0, width);\\n let py = map(this.y/this.pz, 0, 1, 0, height);\\n line(px,py, sx, sy);\\n this.pz = this.z;\\n }\",\n \"plot() {\\n return \\\"Cute alien takes over the earth\\\";\\n }\",\n \"function cartesian$1(coordinates) {\\n var lambda = coordinates[0] * radians,\\n phi = coordinates[1] * radians,\\n cosphi = cos(phi);\\n return [\\n cosphi * cos(lambda),\\n cosphi * sin(lambda),\\n sin(phi)\\n ];\\n}\",\n \"function cartesian(coordinates) {\\n var lambda = coordinates[0] * __WEBPACK_IMPORTED_MODULE_1__math__[\\\"v\\\" /* radians */],\\n phi = coordinates[1] * __WEBPACK_IMPORTED_MODULE_1__math__[\\\"v\\\" /* radians */],\\n cosphi = Object(__WEBPACK_IMPORTED_MODULE_1__math__[\\\"h\\\" /* cos */])(phi);\\n return [\\n cosphi * Object(__WEBPACK_IMPORTED_MODULE_1__math__[\\\"h\\\" /* cos */])(lambda),\\n cosphi * Object(__WEBPACK_IMPORTED_MODULE_1__math__[\\\"y\\\" /* sin */])(lambda),\\n Object(__WEBPACK_IMPORTED_MODULE_1__math__[\\\"y\\\" /* sin */])(phi)\\n ];\\n}\",\n \"function plot(rows = 36, cols = 64) {\\n\\n /* 'c' will contain the whole generated html rect tags string to change innerhtml of enclosing div */\\n /* 'y' will denote the 'y' coordinate where the next grid must be placed */\\n let c = \\\"\\\", y = 0;\\n\\n /* Looping for each row */\\n for (let i = 0; i < rows; i++) {\\n\\n /* 'x' is a coordinate denoting where the next grid must be placed */\\n var x = 0;\\n\\n /* For each row we will loop for each column present in the Grid */\\n for (let j = 0; j < cols; j++) {\\n\\n /* 'colr' will store the rest grid color which is dark gray currently */\\n let colr = grid_color;\\n\\n /* If the Rectange present in the grid is on the border side then change the color in order to highlight borders */\\n if(i === 0 || j === 0 || i === rows - 1 || j === cols - 1){\\n colr = border_color;\\n }\\n\\n /* Creating a rect tag that is appending in 'c' for now and will be updated to innerhtml of enclosing div */\\n /* I know you will be wondering about the id given to each rect :-\\n * Each rect must be provided with id in order to do anything with the corresponding rect.\\n * Operations like coloring the grid as well saving saving any number in corresponding matrix needs an id of the rect.\\n * Hence id is important to allot to each rect to make further changes in matrix on which whole algo is based.\\n * In order to assing every rect id i decided to allot their corresponding row_number + : + col_number to be as id\\n * As with this scenario it is easy to remember and will be unique for every rect tag. \\n */\\n c += `<rect id=${i + \\\":\\\" + j} x=\\\"${x}\\\" y=\\\"${y}\\\" width=\\\"30\\\" height=\\\"30\\\" fill=\\\"${colr}\\\" r=\\\"0\\\" rx=\\\"0\\\" ry=\\\"0\\\" stroke=\\\"#000\\\" style=\\\"-webkit-tap-highlight-color: rgba(0, 0, 0, 0); stroke-opacity: 0.2;\\\" stroke-opacity=\\\"0.2\\\"></rect>`;\\n\\n /* Incrementing the 'x' coordinate as we have width of 30px and hence 'x' coordinate for next rect will be +30 from current pos. */\\n x += 30;\\n }\\n\\n /* Incrementing the 'y' coordinate as we have placed sufficient rect in 1 row now need to advance 'y' as height of each rect \\n is 30px hence for every rect in next column the y coordinate will be +30*/\\n y += 30;\\n }\\n\\n /* At last after creating rect tags using loops, now update innerHtml of enclosing div with id='container'[grid.html] */\\n document.getElementById(\\\"container\\\").innerHTML = c;\\n\\n /* I wanted to preplace the Source - coordinate so at rect with id='src_crd' will be coloured green */\\n document.getElementById(src_crd).style.fill = \\\"rgb(0, 255, 0)\\\";\\n matrix[split(src_crd, 0)][split(src_crd, 1)] = 1; /* Update the pos as '1' to denote source location */\\n\\n /* I wanted to preplace the Destination - coordinate so at rect with id='dst_crd' will be coloured Red */\\n document.getElementById(dst_crd).style.fill = \\\"rgb(255, 0, 0)\\\";\\n matrix[split(dst_crd, 0)][split(dst_crd, 1)] = 2; /* Update the pos as '2' to denote Destination location */\\n\\n }\",\n \"function main(){\\n // Same functions used in class for moveTo and lineTo\\n function moveToTx(x,y,z,Tx) {\\n var loc = [x,y,z];\\n var locTx = m4.transformPoint(Tx,loc);\\n context.moveTo(locTx[0],locTx[1]);\\n }\\n function lineToTx(x,y,z,Tx) {\\n var loc = [x,y,z];\\n var locTx = m4.transformPoint(Tx,loc);\\n context.lineTo(locTx[0], locTx[1]);\\n }\\n function drawAxes(Tx){\\n context.beginPath();\\n moveToTx(-50, 0, 0, Tx);\\n lineToTx(50, 0, 0, Tx);\\n context.stroke(); // x-axis\\n moveToTx(0, -50, 0, Tx);\\n lineToTx(0, 50, 0, Tx);\\n context.stroke(); // y-axis\\n moveToTx(0, 0, -50, Tx);\\n lineToTx(0, 0, 50, Tx);\\n context.stroke(); // z-axis\\n }\\n /**\\n Itterates through the 2d array of points (x,y,z), drawing a line\\n between each. Points have already been transformed to exist in the world\\n coordinate system from the point at which they were added.\\n **/\\n function drawPicture(Tx, vectArray, toMouse){\\n context.beginPath();\\n vectArray.forEach(function(point,i){\\n if(i === 0){\\n moveToTx(point[0],point[1],point[2],Tx);\\n }else{\\n lineToTx(point[0],point[1],point[2],Tx);\\n }\\n context.stroke();\\n });\\n if(toMouse){\\n lineToTx(currMousePos[0],currMousePos[1],0,m4.identity());\\n }\\n context.stroke();\\n }\\n /**\\n Draws a grid on the y=0 plane\\n **/\\n function drawGrid(Tx){\\n context.beginPath();\\n var dim = 10;\\n var length = 500;\\n // Draw from the negative width to pos\\n for(var i=-(dim/2); i<=(dim/2); i++){\\n iScaled = i * 50;\\n moveToTx(iScaled, 0, -length/2, Tx); lineToTx(iScaled, 0, length/2, Tx);\\n moveToTx(-length/2, 0, iScaled, Tx); lineToTx(length/2, 0, iScaled, Tx);\\n }\\n context.stroke();\\n }\\n // Animation loop\\n function draw(){\\n // Quick clear for re-draw as well as resize in event of window change\\n canvas.width = window.innerWidth; canvas.height = window.innerHeight;\\n context.strokeStyle = PRIMARY_TEXT_COLOR;\\n\\n // Transforms\\n var TrotX = m4.rotationX(thetaXSpindle*Math.PI); // Spindle spins independantly of the world.\\n var TrotY = m4.rotationY(thetaYSpindle*Math.PI);\\n var Ttrans = m4.translation([spindleX,0,spindleZ]);\\n Tspindle = m4.multiply(TrotX, TrotY);\\n Tspindle = m4.multiply(Tspindle, Ttrans);\\n\\n var eye = [Math.sin(theta*Math.PI)*radius, camPosY, Math.cos(theta*Math.PI)*radius];\\n var target = [0,0,0];\\n var up = [0,1,0];\\n var TlookAt = m4.lookAt(eye, target, up);\\n var Tcamera = m4.inverse(TlookAt);\\n Tcamera = m4.multiply(Tcamera, m4.scaling([1,-1,1])); // flip to point Y up\\n Tcamera = m4.multiply(Tcamera, m4.translation([canvas.width/2, canvas.height/2, 0]));\\n\\n context.strokeStyle = 'rgba(255, 255, 255, .15)';\\n drawGrid(Tcamera);\\n context.strokeStyle = \\\"lightblue\\\";\\n commits.forEach(function(curr){\\n curr.draw(Tcamera);\\n });\\n // Animation transforms\\n thetaYSpindle += rotSpeedY;\\n thetaXSpindle += rotSpeedX;\\n TspindleMod = m4.multiply(Tspindle, Tcamera);\\n // Update the global variable\\n mouseToWorld = m4.inverse(TspindleMod);\\n\\n context.strokeStyle = \\\"white\\\";\\n drawAxes(TspindleMod);\\n context.strokeStyle = \\\"lightblue\\\";\\n drawPicture(TspindleMod, vectArray, true);\\n context.translate(canvas.width/2, canvas.height/2); // Move orgin for UI\\n ui.showManual();\\n ui.showStats(rotSpeedX, rotSpeedY, spindleX, spindleZ);\\n window.requestAnimationFrame(draw);\\n }\\n draw();\\n\\n\\n // EVENT LISTENERS\\n document.onmousemove = function(e){\\n currMousePos = [e.pageX, e.pageY, 0];\\n }\\n document.onmousedown = function(event){\\n if(currPos){\\n prevPos = currPos\\n }\\n currPos = [event.clientX, event.clientY, 0];\\n currPos = m4.transformPoint(mouseToWorld, currPos);\\n vectArray.push(currPos);\\n }\\n document.addEventListener('keydown', (event) => {\\n const keyName = event.key;\\n if(keyName === \\\"c\\\"){\\n // Store drawing\\n var drawing = new Drawing(Tspindle, vectArray);\\n drawing.rotSpeedY = rotSpeedY;\\n drawing.rotSpeedX = rotSpeedX;\\n commits.push(drawing);\\n // Clear drawing\\n vectArray = [];\\n currPos = null;\\n }\\n if(keyName === \\\"x\\\"){\\n // pop last commit\\n commits.pop();\\n // Clear drawing\\n vectArray = [];\\n currPos = null;\\n }\\n // Controll axis'\\n if(keyName === \\\"ArrowUp\\\"){\\n event.preventDefault();\\n rotSpeedX += stepSize;\\n }\\n if(keyName === \\\"ArrowDown\\\"){\\n event.preventDefault();\\n rotSpeedX -= stepSize;\\n }\\n if(keyName === \\\"ArrowLeft\\\"){\\n event.preventDefault();\\n rotSpeedY -= stepSize;\\n }\\n if(keyName === \\\"ArrowRight\\\"){\\n event.preventDefault();\\n rotSpeedY += stepSize;\\n }\\n if(keyName === \\\"w\\\"){\\n event.preventDefault();\\n camPosY += 1;\\n }\\n if(keyName === \\\"s\\\"){\\n event.preventDefault();\\n camPosY -= 1;\\n }\\n if(keyName === \\\"d\\\"){\\n event.preventDefault();\\n theta += .05;\\n }\\n if(keyName === \\\"a\\\"){\\n event.preventDefault();\\n theta -= .05;\\n }\\n if(keyName === \\\"l\\\"){\\n event.preventDefault();\\n spindleX += 5;\\n }\\n if(keyName === \\\"j\\\"){\\n event.preventDefault();\\n spindleX -= 5;\\n }\\n if(keyName === \\\"i\\\"){\\n event.preventDefault();\\n spindleZ += 5;\\n }\\n if(keyName === \\\"k\\\"){\\n event.preventDefault();\\n spindleZ -= 5;\\n }\\n });\\n /** Drawing **/\\n function Drawing(Tmod, array){\\n this.Tmod = Tmod;\\n this.array = array;\\n // Animation transforms\\n this.rotSpeedY;\\n this.rotSpeedX;\\n // Drawing\\n this.draw = function(Tcamera){\\n var rot = m4.rotationX(Math.PI*this.rotSpeedX);\\n this.Tmod = m4.multiply(rot,this.Tmod);\\n rot = m4.rotationY(Math.PI*this.rotSpeedY);\\n this.Tmod = m4.multiply(rot, this.Tmod);\\n var Tx = m4.multiply(this.Tmod, Tcamera);\\n drawPicture(Tx, this.array, false);\\n }\\n }\\n}\",\n \"function canvasToCartesianAxisCoords(pos) {\\n // return an object with x/y corresponding to all used axes\\n var res = {},\\n i, axis;\\n for (i = 0; i < xaxes.length; ++i) {\\n axis = xaxes[i];\\n if (axis && axis.used) {\\n res[\\\"x\\\" + axis.n] = axis.c2p(pos.left);\\n }\\n }\\n\\n for (i = 0; i < yaxes.length; ++i) {\\n axis = yaxes[i];\\n if (axis && axis.used) {\\n res[\\\"y\\\" + axis.n] = axis.c2p(pos.top);\\n }\\n }\\n\\n if (res.x1 !== undefined) {\\n res.x = res.x1;\\n }\\n\\n if (res.y1 !== undefined) {\\n res.y = res.y1;\\n }\\n\\n return res;\\n }\",\n \"function plot() {\\n\\n}\",\n \"function CartesianChart(config)\\n{\\n CartesianChart.superclass.constructor.apply(this, arguments);\\n}\",\n \"function axis(ctx, color, axisx, axisy, px, d1,py, d2) {\\n var w = ctx.canvas.width;\\n var h = ctx.canvas.height;\\n\\n ctx.strokeStyle = color;\\n\\n //if axis function is below grid function\\n // and grid is dotted this removes the axis from\\n // dotted back to normal line\\n ctx.setLineDash([0, 0]);\\n\\n //if the axis is undefined in both direction creates it at the far left corner like a normal graph\\n if (axisy == undefined && axisx == undefined) {\\n lines(ctx, 1, h - 1, w - 1, h - 1, 1);\\n lines(ctx, 1, 1, 1, h - 1, 1);\\n }\\n\\n //the same as above\\n else if (axisx == w && axisy == h) {\\n lines(ctx, 1, axisy - 1, axisx - 1, axisy - 1, 1);\\n lines(ctx, 1, 1, 1, axisy - 1, 1);\\n }\\n\\n //if axisx and axis y are numbers the axis will be created inwards to the number that has been created.\\n else if (typeof axisx == \\\"number\\\" && typeof axisy == \\\"number\\\") {\\n lines(ctx, 0, axisy, w, axisy, 3);\\n lines(ctx, axisx, 0, axisx, h, 3);\\n }\\n\\n // if axisy and axisx are inputed as middle the x and y axis will be created in the center of the canvas\\n else if (axisx == \\\"middle\\\" && axisy == \\\"middle\\\") {\\n axisx = w / 2;\\n axisy = h / 2;\\n\\n lines(ctx, h / 2, w, h / 2, 2);\\n\\n lines(ctx, w / 2, w / 2, h, 2);\\n }\\n\\n // creates the x for the creation of axis points as pf now only at the positive x axis\\n if (px == \\\"px\\\" && py == \\\"py\\\") {\\n let i = axisx;\\n let j = 0;\\n let k = 0;\\n let l = 0;\\n\\n //creates positive x axis points\\n for (i = axisx; i <= w; i += d1) {\\n lines(ctx, i, axisy, i, axisy + 10, 1);\\n }\\n\\n //create negative y axis points\\n for (l = axisy; l >= 0; l -= d2) {\\n lines(ctx, axisx, l, axisx - 10, l, 1);\\n }\\n\\n //creates positive y axis points\\n for (j = axisy; j <= h; j += d2) {\\n lines(ctx, axisx - 10, j, axisx, j, 1);\\n }\\n //creates negative x axis points\\n for (k = axisx; k >= 0; k -= d1) {\\n lines(ctx, k, axisy, k, axisy + 10, 1);\\n }\\n }\\n\\n else if(px =='px' && py == undefined){\\n let i = 0;\\n let k = 0;\\n //creates positive x axis points\\n for (i = axisx; i <= w; i += d1) {\\n lines(ctx, i, axisy, i, axisy + 10, 1);\\n }\\n\\n //creates negative x axis points\\n for (k = axisx; k >= 0; k -= d1) {\\n lines(ctx, k, axisy, k, axisy + 10, 1);\\n }\\n }\\n}\",\n \"function createCoords(svgid,parameters) {\\r\\n\\tthis.svgid = svgid;\\r\\n\\tthis.id = svgid+'_coords';\\r\\n\\tthis.svg = document.getElementById(svgid);\\r\\n\\tthis.fontSize = parseFloat(getComputedStyle(this.svg).fontSize);\\r\\n\\tlet rem = this.fontSize;\\r\\n\\tlet re = new RegExp(\\\"rem\\\");\\r\\n\\t\\r\\n\\t\\t// MARGINS\\r\\n\\tlet margin = new Array();\\r\\n\\tlet marginTop,marginRight,marginBottom,marginLeft;\\t\\r\\n\\tif( parameters['margin'] != undefined ) { margin = parameters['margin']; }\\t\\r\\n\\tmarginTop = re.test(margin[0]) ? parseFloat(margin[0])*rem : parseFloat(margin[0]);\\r\\n\\tmarginRight = re.test(margin[1]) ? parseFloat(margin[1])*rem : parseFloat(margin[1]);\\r\\n\\tmarginBottom = re.test(margin[2]) ? parseFloat(margin[2])*rem : parseFloat(margin[2]);\\r\\n\\tmarginLeft = re.test(margin[3]) ? parseFloat(margin[3])*rem : parseFloat(margin[3]);\\r\\n\\tmargin = [marginTop,marginRight,marginBottom,marginLeft];\\r\\n\\tthis.margin = margin;\\r\\n\\tthis.marginTop = marginTop; this.marginRight = marginRight; this.marginBottom = marginBottom; this.marginLeft = marginLeft;\\r\\n\\t\\r\\n\\t\\t// svg area [min-u,max-v,width,height] of the plotBox\\t\\t\\r\\n\\tthis.plotBox = [marginLeft,marginTop,this.svg.clientWidth-(marginRight+marginLeft),this.svg.clientHeight-(marginTop+marginBottom)];\\r\\n\\t\\t// svg coordinate Range\\r\\n\\tthis.uMin = this.plotBox[0];\\r\\n\\tthis.uMax = this.plotBox[0]+this.plotBox[2];\\r\\n\\tthis.vMin = this.plotBox[1];\\r\\n\\tthis.vMax = this.plotBox[1]+this.plotBox[3];\\t\\r\\n \\r\\n\\tthis.defineCoords(parameters);\\r\\n\\t\\r\\n\\t // define two special groups for this coordinate system\\r\\n var g1 = document.createElementNS('http://www.w3.org/2000/svg', 'g');\\r\\n var g2 = document.createElementNS('http://www.w3.org/2000/svg', 'g');\\r\\n\\t\\r\\n /* this.g1.id = this.id+'_g1'; this.g2.id = this.id+'_g2'; */\\r\\n this.svg.g1 = g1; // default for plots\\r\\n this.svg.g2 = g2; // default for axes\\r\\n this.svg.appendChild(g2);\\r\\n this.svg.appendChild(g1);\\r\\n\\t\\r\\n\\tif( parameters['clip'] == true ) { this.plotObject('clip',{'x1':this.xMin,'x2':this.xMax,'y1':this.yMin,'y2':this.yMax}); }\\r\\n} // END function createCoords()\",\n \"function generatePositions() {\\n rows = [];\\n columns = [];\\n if (gridOption.enableRow) {\\n //use coordinate.y to generate rows\\n if (coordinate.y && coordinate.y.model.rotate == 90) {\\n coordinate.y.forEach(function(i,length){\\n rows.push(coordinate.y.model.beginY-length)\\n });\\n gridOption._x = coordinate.x.model.beginX;\\n } else if (coordinate.x && coordinate.x.model.rotate == 90) {\\n coordinate.x.forEach(function (i, length) {\\n rows.push(coordinate.x.model.beginY - length)\\n });\\n\\n gridOption._x = coordinate.y.model.beginX;\\n }\\n gridOption.width = coordinate.size().width || 0;\\n gridOption.rows = rows;\\n }\\n if (gridOption.enableColumn) {\\n if (coordinate.y && coordinate.y.model.rotate == 0) {\\n coordinate.y.forEach(function(i,length){\\n columns.push(coordinate.y.model.beginX+length)\\n });\\n gridOption._y = coordinate.x.model.beginY;\\n } else if (coordinate.x && coordinate.x.model.rotate == 0) {\\n coordinate.x.forEach(function (i, length) {\\n columns.push(coordinate.x.model.beginX + length)\\n });\\n gridOption._y = coordinate.y.model.beginY;\\n }\\n gridOption.height = coordinate.size().height || 0;\\n gridOption.columns = columns;\\n }\\n\\n }\",\n \"plotJourneys() {\\n for (let j of this.mapJourneys) {\\n //plot ghost Session\\n j.plotSessions(this);\\n }\\n }\",\n \"function drawPCGraph() {\\r\\n\\r\\n\\tvar x = d3.scale.ordinal().rangePoints([0, 480], 1),\\r\\n y= {};\\r\\n \\r\\n for (var dim in cars[0]) {\\r\\n\\t if (dim != \\\"name\\\") {\\r\\n\\t\\t y[dim] = d3.scale.linear()\\r\\n\\t\\t\\t .domain([d3.min(cars, function(d) { return +d[dim]; }), d3.max(cars, function(d) { return +d[dim]; })])\\r\\n\\t\\t .range([height,0]);\\r\\n\\t }\\r\\n }\\r\\n \\r\\n//sets the x domain dimensions\\r\\n x.domain(dimensions = d3.keys(cars[0]).filter(function(d) { return d != \\\"name\\\";}));\\r\\n\\r\\n//draws the polylines\\r\\n for (var i=1; i< cars.length; i++) { //for each car\\r\\n\\r\\n//prepare the coordinates for a polyline\\r\\n\\t var lineData = []; //initialize an array for coordinates of a polyline\\r\\n\\t for (var prop in cars[0]) { \\r\\n\\t if (prop != \\\"name\\\" ) {\\r\\n\\t var point = {}; \\r\\n\\t var val = cars[i][prop];\\r\\n\\t\\t point['x'] = x(prop); \\r\\n\\t point['y'] = y[prop](val);\\r\\n\\t lineData.push(point);\\r\\n\\t }\\r\\n\\t }\\r\\n\\r\\n//draws a polyline based on the coordindates \\r\\n chart.append(\\\"g\\\")\\r\\n\\t .attr(\\\"class\\\", \\\"polyline\\\")\\r\\n\\t .append(\\\"path\\\")\\r\\n\\t\\t .attr(\\\"d\\\", line(lineData))\\r\\n\\t\\r\\n//Changes stroke red when mouseover\\r\\n\\t.on(\\\"mouseover\\\", function(){\\r\\n\\t\\t\\td3.select(this)\\r\\n\\t\\t.style(\\\"stroke\\\",\\\"red\\\")\\r\\n\\t })\\r\\n\\t.on(\\\"mouseout\\\", function(){\\r\\n\\t\\td3.select(this)\\r\\n\\t\\t.style(\\\"stroke\\\",null)\\r\\n\\t\\t\\r\\n})\\r\\n }\\r\\n\\r\\n var g = chart.selectAll(\\\".dimension\\\")\\r\\n\\t .data(dimensions)\\r\\n\\t .enter().append(\\\"g\\\")\\r\\n\\t .attr(\\\"class\\\", \\\"dimension\\\")\\r\\n\\t .attr(\\\"transform\\\", function(d) { return \\\"translate(\\\" + x(d) + \\\")\\\"; }) //translate each axis\\r\\n\\r\\n g.append(\\\"g\\\")\\r\\n\\t .attr(\\\"class\\\", \\\"axis\\\")\\r\\n\\t .each(function(d) { d3.select(this).call(axis.scale(y[d])); })\\r\\n\\t .append(\\\"text\\\")\\r\\n\\t .style(\\\"text-anchor\\\", \\\"middle\\\")\\r\\n\\t .attr(\\\"y\\\", -4)\\r\\n\\t .text(function(d) { return d; });\\r\\n\\t \\r\\n \\r\\n}\",\n \"function pricesGraph() {\\n for (let i = 0; i < houses.data.length; i++) {\\n\\n // Map colors\\n let color = mapColor(ps[i]);\\n\\n // Render\\n fill(color.r, color.g, color.b, 255);\\n noStroke();\\n ellipse(xs[i] + xoff, ys[i] + yoff, 2, 2);\\n }\\n}\",\n \"function Cartesian2D(name) {\\n Cartesian.call(this, name);\\n}\",\n \"function Cartesian2D(name) {\\n Cartesian.call(this, name);\\n}\",\n \"function Cartesian2D(name) {\\n Cartesian.call(this, name);\\n}\",\n \"function Cartesian2D(name) {\\n Cartesian.call(this, name);\\n}\",\n \"function Cartesian2D(name) {\\n Cartesian.call(this, name);\\n}\",\n \"function render() {\\n dots\\n .attr(\\\"cx\\\", function (d) {\\n return project(d).x;\\n })\\n .attr(\\\"cy\\\", function (d) {\\n return project(d).y;\\n });\\n }\",\n \"function draw() {\\n \\n // background(237, 34, 93);\\n for(let i = 0; i < h; i += 10) {\\n for(let j = 0; j < w; j+= 10) {\\n // if(i == cx[counting] && j == cy[counting]) {\\n point_color = 222;\\n strokeWeight(1);\\n stroke(point_color);\\n point(cx[counting],cy[counting])\\n counting++;\\n // } \\n } \\n // line(i, 0, i, h)\\n counting = 0;\\n }\\n\\n \\n}\",\n \"function drawGraph(xArray, yArray) {\\n var xMax = Math.max(...xArray);\\n var xMin = Math.min(...xArray);\\n //var yMax = Math.max(...yArray);\\n //var yMin = Math.min(...yArray);\\n\\n var yMax = nParticles * 1.13;\\n var yMin = 0;\\n\\n // Conversion between the screen coordiantes and the axis coordiantes\\n function xScreen(x) {\\n return (x - xMin) / (xMax - xMin) * canvasGraph.width + 5;\\n }\\n function yScreen(y) {\\n return canvasGraph.height - (y - yMin) / (yMax - yMin) * canvasGraph.height - 5;\\n }\\n\\n var x = xArray[0];\\n var y = yArray[0];\\n ctxGraph.moveTo(xScreen(x), yScreen(y));\\n for (var i = 1; i <= xArray.length; i++) {\\n x = xArray[i];\\n y = yArray[i];\\n ctxGraph.lineTo(xScreen(x), yScreen(y));\\n }\\n}\",\n \"drawcrosshairs() {\\n \\n if (this.internal.volume===null) \\n return;\\n \\n for (var i=0;i<=2;i++) \\n this.internal.slices[i].drawcrosshairs(this.internal.slicecoord);\\n \\n // Update Dat.GUI\\n if (this.internal.datgui.gui !== null) {\\n this.internal.datgui.data.xcoord = this.internal.slicecoord[0];\\n this.internal.datgui.data.ycoord = this.internal.slicecoord[1];\\n this.internal.datgui.data.zcoord = this.internal.slicecoord[2];\\n this.internal.datgui.data.tcoord = this.internal.slicecoord[3];\\n this.updateDatGUIControllers();\\n }\\n this.drawtext();\\n this.informToRender(); \\n //this.drawcolorscale();\\n }\",\n \"function equilatGrid(L,R,dx,dy){\\n let yVals = [];\\n let ytip = 70;\\n let xtip = 300;\\n let yChange = dy/10;\\n let xChange = 2*dx/10\\n for(let i = 0; i < 9; i++){\\n yVals.push((ytip+dy)-yChange*(i+1));\\n }\\n push();\\n let x1, x2, y1, y2;\\n // Carrier grid\\n stroke(255,100,0,80);\\n for(let i = 0; i < yVals.length; i++){\\n y1 = yVals[i];\\n x1 = (y1-L[1])/L[0];\\n y2 = ytip + dy;\\n x2 = (xtip-dx) + xChange*(i+1);\\n line(x1,y1,x2,y2);\\n }\\n \\n // Solvent grid\\n stroke(128,0,128,80);\\n for(let i = 0; i < yVals.length; i++){\\n y1 = yVals[i];\\n x1 = (y1-R[1])/R[0];\\n y2 = ytip + dy;\\n x2 = (xtip+dx) - xChange*(i+1);\\n line(x1,y1,x2,y2);\\n }\\n // Solute grid\\n stroke(0,0,255,80);\\n for(let i = 0; i < yVals.length; i++){\\n y1 = yVals[i];\\n x1 = (y1-L[1])/L[0];\\n y2 = y1;\\n x2 = (y2-R[1])/R[0];\\n line(x1,y1,x2,y2);\\n }\\n pop();\\n}\",\n \"display(){\\n fill (0);\\n ellipse(this.x, this.y, 4, 4);\\n }\",\n \"draw_axes(gfx) {\\n // Drawing in white\\n gfx.noFill();\\n gfx.stroke(255);\\n\\n // Draw the unit circle (width and height 2)\\n gfx.ellipse(0, 0, 2, 2);\\n\\n // Draw x- and y-axes\\n gfx.line(-10, 0, 10, 0);\\n gfx.line(0, -10, 0, 10);\\n }\",\n \"function apskritimoPlotas(spindulys) {\\n console.log('Apskritimo plotas');\\n return Math.PI * (spindulys ** 2);\\n}\",\n \"plotRoutes() {\\n for (let r of this.mapRoutes) {\\n r.plotPath(this.map);\\n }\\n }\",\n \"function plotAll() {\\n d3.select(\\\"#scatter-macro-1 svg\\\").remove()\\n d3.select(\\\"#scatter-macro-2 svg\\\").remove()\\n d3.select(\\\"#scatter-micro-1 svg\\\").remove()\\n d3.select(\\\"#scatter-micro-2 svg\\\").remove()\\n doPlot(\\\"scatter-macro-1\\\", voltageArr, \\\"Voltage\\\", maxLinearVelocityArr, \\\"Max. Linear Velocity\\\");\\n doPlot(\\\"scatter-macro-2\\\", currentArr, \\\"Current\\\", accelerationArr, \\\"Acceleration\\\");\\n doPlot(\\\"scatter-micro-1\\\", voltageArr, \\\"Voltage\\\", maxAngularVelocityArr, \\\"Max. Angular Velocity\\\");\\n doPlot(\\\"scatter-micro-2\\\", currentArr, \\\"Current\\\", torqueArr, \\\"Torque\\\");\\n}\",\n \"show() {\\n fill(0, 10, 100);\\n noStroke();\\n\\n ellipse(this.x, this.y, this.mainSize, this.mainSize);\\n ellipse(this.x - 18, this.y + 20, this.subSize, this.subSize);\\n ellipse(this.x - 6, this.y + 20, this.subSize, this.subSize);\\n ellipse(this.x + 6, this.y + 20, this.subSize, this.subSize);\\n ellipse(this.x + 18, this.y + 20, this.subSize, this.subSize);\\n }\",\n \"function zoom_arc_plot(v_chr, v_start, v_end) {\\n // chosen chromosome for zoom\\n var xScale_zoomed_chrom,\\n // all other chromosomes\\n xScale_unzoomed_chrom;\\n\\n // margin for the zoom function of the arc plot\\n var margin = {\\n top: 1,\\n right: 1,\\n bottom: 20,\\n left: 10\\n };\\n\\n // padding between the chromosomes\\n var padding = 2;\\n // width and height of the plot\\n var w = 800 - margin.left - margin.right - (24 * padding);\\n var h = 600 - margin.top - margin.bottom; \\n // chromosome length without the chosen chromosome\\n var chrom_scale_compare = chrom_length - chromLength[(v_chr -1)];\\n\\n //for loop to create the length of the chromosomes\\n var chromLength_scaled = [];\\n for (var i = 0;i < chromLength.length; i++) {\\n var temp;\\n if ((v_chr - 1) == i) {\\n chromLength_scaled.push(w/2);\\n } else {\\n temp = ((w/2) / chrom_scale_compare) * chromLength[i];\\n chromLength_scaled.push(temp);\\n }\\n }\\n\\n //for loop to calculate the x position\\n var chrom_x_position = [0];\\n var Scaled_abs_xposition = 0;\\n for (var i = 0; i < chrom_abs_length.length ; i++) {\\n Scaled_abs_xposition = Scaled_abs_xposition + chromLength_scaled[i] + padding;\\n chrom_x_position.push(Scaled_abs_xposition);\\n }\\n\\n // var for the chromsome length of the chosen area\\n var selected_chrom_area = v_end - v_start;\\n // array for the ticks\\n var ticks_chrom_chosen = [];\\n // for loop to create the ticks for the chosen chromosome\\n for (var i = 0; i< 20 ; i++) {\\n var temp_x,\\n temp_label,\\n temp_range,\\n temp_range_label,\\n temp;\\n if(selected_chrom_area == 0) {\\n temp_x = chrom_x_position[(v_chr - 1)] + (chromLength_scaled[(v_chr - 1)] / 20) * i;\\n temp_label = Math.round(((chromLength[(v_chr - 1)] / 20) / 1000000) * i) + \\\"MB\\\";\\n } else {\\n temp_x = chrom_x_position[(v_chr - 1)] + (chromLength_scaled[(v_chr - 1)] / 20) * i;\\n temp = Math.round(v_start + (selected_chrom_area / 20)* i);\\n if(temp < 50000) {\\n temp_range = 1;\\n temp_range_label = \\\"\\\";\\n } else if(temp < 50000000) {\\n temp_range = 1000;\\n temp_range_label = \\\"Kb\\\";\\n } else {\\n temp_range = 1000000;\\n temp_range_label = \\\"Mb\\\";\\n }\\n temp_label = Math.round((temp / temp_range)) + temp_range_label; \\n }\\n var obj = {};\\n obj[\\\"x\\\"] = temp_x;\\n obj[\\\"label\\\"] = temp_label;\\n ticks_chrom_chosen.push(obj);\\n }\\n\\n // array to store all nodes and all links which should not be displayed in the zoom function\\n zoom_allNodes = [];\\n zoom_links = [];\\n links.forEach( function(d) {\\n if((allNodes[d.source].chrom == v_chr \\n && allNodes[d.source].bp_position >= v_start \\n && allNodes[d.source].bp_position <= v_end) ||\\n (allNodes[d.source].chrom == v_chr && selected_chrom_area == 0) ||\\n (allNodes[d.target].chrom == v_chr && \\n allNodes[d.target].bp_position >= v_start && \\n allNodes[d.target].bp_position <= v_end) ||\\n (allNodes[d.target].chrom == v_chr && selected_chrom_area == 0)) {\\n\\n zoom_allNodes.push(allNodes[d.source]);\\n zoom_allNodes.push(allNodes[d.target]);\\n zoom_links.push(d);\\n }\\n });\\n \\n // add nodes with degree zero\\n allNodes.forEach( function (d) {\\n var in_zoomed_chrom = (d.chrom == v_chr && d.degree == 0);\\n var in_zoomed_region = (d.bp_position >= v_start && d.bp_position <= v_end);\\n\\n if(in_zoomed_chrom && in_zoomed_region) {\\n zoom_allNodes.push(d);\\n }\\n });\\n \\n // sort and make the zoom_allnodes function unique\\n var temp_zoomnodes = [];\\n\\n zoom_allNodes.forEach( function (d) {\\n temp_zoomnodes.push(d.id);\\n });\\n\\n temp_zoomnodes = sort_unique(temp_zoomnodes);\\n\\n zoom_allNodes = [];\\n\\n temp_zoomnodes.forEach( function (d) {\\n zoom_allNodes.push(allNodes[d]);\\n });\\n \\n \\n // create SVG for the plot\\n var svg = d3.select(\\\"#chart\\\")\\n .append(\\\"svg\\\")\\n .attr(\\\"id\\\", \\\"mainplot\\\")\\n .attr(\\\"width\\\", width)\\n .attr(\\\"height\\\", height)\\n .append(\\\"g\\\")\\n .attr(\\\"transform\\\", \\\"translate(\\\" + margin.left + \\\",\\\" + margin.top + \\\")\\\");\\n\\n d3.select('#ld_container').selectAll('svg').remove();\\n\\n var chromosome_container = svg.selectAll(\\\"g.group\\\")\\n .data(chromLength)\\n .enter().append(\\\"svg:g\\\")\\n .attr(\\\"transform\\\", function(d, i) {\\n return \\\"translate(\\\" + chrom_x_position[i] + \\\",\\\" + height_chrom_bar + \\\")\\\"; \\n })\\n // scales the width of chromosomes\\n .attr(\\\"width\\\", function(d, i) {\\n create_ld_plot(i+1, chromLength_scaled[i], chrom_x_position[i], padding, v_chr, v_start, v_end); \\n return chromLength_scaled[i]; \\n })\\n .attr(\\\"height\\\", 40)\\n .attr(\\\"class\\\", function (d,i) {\\n return \\\"chrom\\\" + (i+1);\\n });\\n\\n var id_chrom_zoom = \\\"g.chrom\\\" + (v_chr);\\n // store the the new startpoint\\n var startzoom = 0;\\n if (v_start == 0 && v_end == 0) {\\n var x_scale_zoom = d3.scale.linear()\\n .domain([0, chromLength[(v_chr -1)]])\\n .range([0, chromLength_scaled[(v_chr -1)]]);\\n } else {\\n var x_scale_zoom = d3.scale.linear()\\n .domain([v_start, v_end])\\n .range([0, chromLength_scaled[(v_chr -1)]]);\\n }\\n \\n //function to zoom with the mouse\\n var brush = svg.select(id_chrom_zoom)\\n .append(\\\"g\\\")\\n .attr(\\\"class\\\", \\\"brush\\\")\\n .call(d3.svg.brush().x(x_scale_zoom)\\n .on(\\\"brushstart\\\", brushstart)\\n .on(\\\"brush\\\", brushmove)\\n .on(\\\"brushend\\\", brushend))\\n .selectAll(\\\"rect\\\")\\n .attr(\\\"height\\\", 40) \\n .style(\\\"stroke\\\", \\\"blue\\\")\\n .style(\\\"fill\\\", \\\"blue\\\")\\n .style(\\\"opacity\\\" , 0.7);\\n\\n function brushstart() { \\n brush.classed(\\\"selecting\\\", true);\\n }\\n\\n function brushmove() {\\n var r = d3.event.target.extent(); \\n document.getElementById(\\\"texzs\\\").value = Math.round(r[0]);\\n document.getElementById(\\\"texze\\\").value = Math.round(r[1]);\\n }\\n\\n function brushend() { \\n brush.classed(\\\"selecting\\\", !d3.event.target.empty());\\n }\\n\\n // create rectangle in the g container\\n var chrom_bar = chromosome_container.append(\\\"rect\\\")\\n .attr(\\\"transform\\\", \\\"translate(\\\" + 0 + \\\",\\\" + 0 + \\\")\\\")\\n .attr(\\\"class\\\", \\\"rect\\\")\\n // scales the width of chromosomes\\n .attr(\\\"width\\\", function(d, i) {\\n return chromLength_scaled[i]; \\n })\\n .attr(\\\"height\\\", 20)\\n .style(\\\"fill\\\", function(d, i) {\\n return chromcolour[i];\\n })\\n .style(\\\"stroke\\\", function(d, i) {\\n return chromcolour[i];\\n });\\n\\n //create ticks for the chrom_bar\\n svg.selectAll(\\\"line\\\")\\n .data(ticks_chrom_chosen)\\n .enter().append(\\\"line\\\")\\n .attr(\\\"class\\\", \\\"tickchromosome\\\")\\n .attr(\\\"x1\\\", function(d) {\\n return + d.x;\\n })\\n .attr(\\\"y1\\\", height_nodes + 25)\\n .attr(\\\"x2\\\", function (d) {\\n return + d.x;\\n })\\n .attr(\\\"y2\\\", height_nodes + 30)\\n .style(\\\"stroke\\\", \\\"#000\\\")\\n\\n svg.selectAll(\\\"text\\\")\\n .data(ticks_chrom_chosen)\\n .enter().append(\\\"text\\\")\\n .attr(\\\"class\\\", \\\"label\\\")\\n .attr(\\\"dy\\\", \\\".35em\\\")\\n .attr(\\\"transform\\\", function (d) {\\n return \\\"translate(\\\"+ d.x + \\\",\\\" + (height_nodes + 38) + \\\")\\\" + \\\"rotate(90)\\\"; \\n })\\n .attr(\\\"font-size\\\", \\\"10\\\")\\n .text(function (d) {\\n return d.label; \\n });\\n\\n // create the label for the chromosomes\\n chromosome_container.append(\\\"svg:text\\\")\\n .attr(\\\"class\\\", \\\"chromosom_number\\\")\\n // 2* padding for double digits chromosome numbers\\n .attr(\\\"transform\\\", function (d, i) {\\n if (i == (v_chr-1)) {\\n return \\\"translate(\\\" + (8 * padding) + \\\",\\\" + 15 + \\\")\\\";\\n } else {\\n return \\\"translate(\\\" + (4 * padding) + \\\",\\\" + 35 + \\\")\\\"; \\n }\\n })\\n .append(\\\"svg:textPath\\\")\\n .text(function(d, i) {\\n return i + 1;\\n })\\n .attr(\\\"font-size\\\", function (d, i) {\\n if (i == (v_chr-1)) {\\n return \\\"14px\\\";\\n } else {\\n return \\\"9px\\\";\\n }\\n })\\n .attr(\\\"text-anchor\\\", \\\"end\\\")\\n .style(\\\"fill\\\", function(d, i) {\\n if (i == (v_chr - 1)) {\\n return \\\"#000\\\";\\n } else {\\n return chromcolour[i];\\n }\\n })\\n .style(\\\"stroke\\\", function(d, i) {\\n if (i == (v_chr - 1)) {\\n return \\\"#000\\\";\\n } else {\\n return chromcolour[i];\\n }\\n });\\n\\n // object to store the position of the zoomed chromosomes\\n var id_chosen = [];\\n // create circles for the location of the interacting SNPs \\n svg.selectAll(\\\"circle.vertex\\\")\\n .data(zoom_allNodes)\\n .enter().append(\\\"circle\\\")\\n .attr(\\\"class\\\", \\\"circle_zoom\\\")\\n .style(\\\"fill\\\", function(d) {\\n return graphColor(d.probe_group);\\n })\\n .style(\\\"stroke\\\", function(d) {\\n return graphColor(d.probe_group);\\n })\\n // positioning the SNPs\\n .attr(\\\"cx\\\", function(d) {\\n if(d.chrom == v_chr && selected_chrom_area == 0) {\\n id_chosen[d.id] = chrom_x_position[(d.chrom -1 )] + \\n ((w/2) / chromLength[(d.chrom - 1)]) * d.bp_position; \\n return id_chosen[d.id];\\n\\n } else if (d.chrom == v_chr && selected_chrom_area > 0 && d.bp_position >= v_start && \\n d.bp_position <= v_end) {\\n id_chosen[d.id] = chrom_x_position[(d.chrom -1)] + \\n ((w/2) / selected_chrom_area) * (d.bp_position - v_start);\\n return id_chosen[d.id];\\n\\n } else if(d.chrom == v_chr && selected_chrom_area > 0 && d.bp_position < v_start ) {\\n id_chosen[d.id] = chrom_x_position[(d.chrom -1)];\\n return id_chosen[d.id];\\n\\n } else if (d.chrom == v_chr && selected_chrom_area > 0 && d.bp_position > v_end) {\\n id_chosen[d.id] = chrom_x_position[(d.chrom - 1)] + (w/2);\\n return id_chosen[d.id];\\n\\n } else if(d.chrom != v_chr) {\\n id_chosen[d.id] = chrom_x_position[(d.chrom -1 )] +\\n ((w/2) / chrom_scale_compare) * d.bp_position; \\n return id_chosen[d.id];\\n\\n } else {\\n return id_chosen[d.id] = \\\"NaN\\\" ;\\n }\\n })\\n .attr(\\\"cy\\\", height_nodes)\\n .attr(\\\"r\\\", function(d) {\\n if(id_chosen[d.id] == \\\"NaN\\\" && d.chrom == v_chr ) {\\n return 0;\\n } else {\\n return 2;\\n }\\n })\\n // to get information about the SNPs from different sources, if you click on a circle\\n .on(\\\"click\\\", function (d,i) { externalLink(d, i); });\\n\\n // show degree as tooltip - title\\n svg.selectAll(\\\"g .circle_zoom\\\") \\n .append(\\\"title\\\")\\n .text(function(d) {\\n return \\\"degree: \\\" + two_dec(d.degree) + \\\"\\\\nSNP: \\\" + d.rs + \\\"\\\\nid: \\\" + d.id + \\n \\\"\\\\nposition: \\\" + d.bp_position\\n });\\n\\n // draw the edges between linked SNP's nodes\\n var arcs = svg.selectAll(\\\"path.link\\\")\\n .data(zoom_links)\\n .enter().append(\\\"path\\\")\\n .attr(\\\"class\\\", \\\"link\\\")\\n .style(\\\"stroke\\\", function(d) {\\n return graphColor(d.probe_group);\\n })\\n .style(\\\"stroke\\\", 1)\\n .style(\\\"stroke-width\\\", 2.5)\\n .style(\\\"opacity\\\", 3.7)\\n .style(\\\"fill\\\", \\\"none\\\")\\n // function to create the arc for the links\\n .attr(\\\"d\\\", function (d) {\\n // to ensure that the path is drawn correct \\n if(d.source > d.target) {\\n var temp;\\n temp = d.source;\\n d.source = d.target;\\n d.target = temp;\\n } \\n\\n if (allNodes[d.source].chrom == v_chr || allNodes[d.target].chrom == v_chr) {\\n var start_position_x = id_chosen[d.source],\\n start_position_y = height_nodes ;\\n\\n var end_position_x = id_chosen[d.target],\\n end_position_y = height_nodes ;\\n } else {\\n var start_position_x = \\\"NaN\\\",\\n start_position_y = height_nodes ;\\n\\n var end_position_x = \\\"NaN\\\",\\n end_position_y = height_nodes ;\\n }\\n\\n // to ensure that the arc links are drawn on the correct side \\n if (end_position_x < start_position_x) {\\n var temp; \\n temp = end_position_x; \\n end_position_x = start_position_x;\\n start_position_x = temp; \\n }\\n\\n var radius = (end_position_x - start_position_x) / 2 ;\\n\\n var c1x = start_position_x,\\n c1y = start_position_y - radius,\\n c2x = end_position_x,\\n c2y = end_position_y - radius ;\\n\\n return \\\"M\\\" + start_position_x + \\\",\\\" + start_position_y + \\\" C\\\" + c1x +\\n \\\",\\\" + c1y + \\\",\\\" + c2x + \\\",\\\" + c2y + \\\" \\\" + \\n end_position_x + \\\",\\\" + end_position_y ; \\n })\\n .on(\\\"click\\\" , function(d,i) { return highlight_snp_pairs(d, i);});\\n\\n // creates the colour scale indicator for the ld plot\\n createColourScale_ldplot();\\n}\",\n \"function plotGraph(){\\n createAxis();\\n // zoom.x(x).y(y);\\n // console.log('setting scales');\\n // console.log(x);\\n // console.log(y);\\n updateBoundaryGraph.setScales(x,y);\\n }\",\n \"function drawLocs(){\\n\\tfor (var i = 0; i <= loc.length; i++){\\n fill(0, 200);\\n ellipse(locX[i], locY[i], locSize, locSize);\\n fill(255);\\n text(loc[i],locX[i], locY[i]);\\n }\\n}\",\n \"coordinatesByAxes(coordinates, repetitions) {\\n const {\\n repetitionsAlongLatticeVectorA,\\n repetitionsAlongLatticeVectorB,\\n repetitionsAlongLatticeVectorC,\\n } = repetitions;\\n const maxNumberOfRepetitions = Math.max(\\n repetitionsAlongLatticeVectorA,\\n repetitionsAlongLatticeVectorB,\\n repetitionsAlongLatticeVectorC,\\n );\\n\\n if (\\n !repetitionsAlongLatticeVectorA &&\\n !repetitionsAlongLatticeVectorB &&\\n !repetitionsAlongLatticeVectorC\\n )\\n return coordinates;\\n\\n let columns = coordinates.reduce((res, item, index) => {\\n if (index % maxNumberOfRepetitions === 0) {\\n res[res.length] = [item];\\n } else {\\n res[res.length - 1].push(item);\\n }\\n return res;\\n }, []);\\n\\n if (repetitionsAlongLatticeVectorA < maxNumberOfRepetitions) {\\n columns = columns.slice(0, maxNumberOfRepetitions * repetitionsAlongLatticeVectorA);\\n }\\n if (repetitionsAlongLatticeVectorB < maxNumberOfRepetitions) {\\n columns = columns.filter(\\n (item, index) =>\\n index % maxNumberOfRepetitions < repetitionsAlongLatticeVectorB,\\n );\\n }\\n if (repetitionsAlongLatticeVectorC < maxNumberOfRepetitions) {\\n columns = columns.map((arr) =>\\n arr.filter((item, index) => index < repetitionsAlongLatticeVectorC),\\n );\\n }\\n return columns.reduce((res, item) => {\\n res.push(...item);\\n return res;\\n }, []);\\n }\",\n \"function drawScatterMatrix(trips){\\n\\n\\tspeed = [];\\n\\tdistance =[];\\n\\tduration=[];\\n\\tfor (var i =0;i<trips.length;i++)\\n\\t{\\n\\t speed[i]=trips[i].avspeed;\\n\\t\\t distance[i]=trips[i].distance;\\n\\t\\t duration[i]=trips[i].duration;\\n\\t}\\n\\n\\tgoogle.charts.load('current', {'packages':['corechart']}); \\n google.charts.setOnLoadCallback(drawScatterMatrixCallBack(speed,distance,duration)); \\n}\",\n \"function drawXY(){\\r\\n//setting the x and y domains\\r\\n x.domain([d3.min(cars, function(d) { return d.year; }), d3.max(cars, function(d) { return d.year; })]);\\r\\n y.domain([d3.min(cars, function(d) { return d.power; }), d3.max(cars, function(d) { return d.power; })]);\\r\\n\\r\\n//setting the yPosition \\r\\n var yPos = height -20;\\r\\n//creating the x-Axis\\r\\n chart.append(\\\"g\\\")\\r\\n\\t .attr(\\\"class\\\", \\\"xaxis\\\")\\r\\n\\t .attr(\\\"transform\\\", \\\"translate(0,\\\" + yPos + \\\")\\\")\\r\\n\\t .call(xAxis);\\r\\n//creating the Y-axis\\r\\n chart.append(\\\"g\\\")\\r\\n\\t .attr(\\\"class\\\", \\\"yaxis\\\")\\r\\n\\t .attr(\\\"transform\\\", \\\"translate(480,0)\\\")\\r\\n\\t .call(yAxis);\\r\\n\\r\\n \\r\\n//selecting ths dot \\r\\n//adding attributes\\t\\r\\n chart.selectAll(\\\".dot\\\")\\r\\n\\t .data(cars)\\r\\n\\t .enter().append(\\\"circle\\\")\\r\\n\\t .attr(\\\"class\\\", \\\"dot\\\")\\r\\n\\t .attr(\\\"cx\\\", function(d) { return x(d.year); })\\r\\n\\t .attr(\\\"cy\\\", function(d) { return y(d.power); })\\r\\n\\t .attr(\\\"r\\\", 3)\\r\\n\\t \\r\\n//the mouseover function that fills the dots red when the mouse is over them\\r\\n\\t .on(\\\"mouseover\\\", function(){\\r\\n\\t\\t\\td3.select(this)\\r\\n\\t\\t\\t.attr(\\\"fill\\\", \\\"red\\\")\\r\\n\\t })\\r\\n//the mouseout function that changes the dots back to normal color\\r\\n\\t.on(\\\"mouseout\\\", function(){\\r\\n\\t\\td3.select(this)\\r\\n\\t\\t.attr(\\\"fill\\\", \\\"black\\\")\\r\\n\\t\\t\\r\\n})\\r\\n\\t\\r\\n \\r\\n}\",\n \"function draw_axis(c){\\n\\n let yplot = 40;\\n let d =0;\\n\\n c.beginPath();\\n c.strokeStyle = \\\"blue\\\";\\n \\n c.moveTo(count_block(5),count_block(5));\\n c.lineTo(count_block(5), count_block(40));\\n c.lineTo(count_block(80), count_block(40));\\n\\n c.moveTo(count_block(5), count_block(40));\\n \\n \\n\\n //loop for the y-axix labels\\n for(let i = 1 ;i<=10;i++ ){\\n c.strokeText(d, count_block(2), count_block(yplot));\\n yplot-=5;\\n d+=500;\\n }\\n c.stroke();\\n\\n}\",\n \"show() {\\n fill(\\\"white\\\");\\n ellipse(this.x, this.y, 30, 30);\\n }\",\n \"function draw_axis(c){\\n\\n let yplot = 40;\\n let d =0;\\n\\n c.beginPath();\\n c.strokeStyle = \\\"black\\\";\\n \\n c.moveTo(count_block(5),count_block(5));\\n c.lineTo(count_block(5), count_block(40));\\n c.lineTo(count_block(80), count_block(40));\\n\\n c.moveTo(count_block(5), count_block(40));\\n \\n \\n\\n //loop for the y-axix labels\\n for(let i = 1 ;i<=10;i++ ){\\n c.strokeText(d, count_block(2), count_block(yplot));\\n yplot-=5;\\n d+=500;\\n }\\n c.stroke();\\n\\n}\",\n \"show() {\\n fill(\\\"red\\\");\\n ellipse(this.pos.x, this.pos.y, 15, 15)\\n\\n }\",\n \"display(){\\r\\n point(this.x,this.y);\\r\\n }\",\n \"display() {\\n fill(127);\\n stroke(200);\\n strokeWeight(2);\\n ellipse(this.x, this.y, this.r * 2, this.r * 2);\\n }\",\n \"plot() {\\n if (this.plot === 'Cumulative frequency plot' ||\\n this.plot === 'Dot plot') {\\n this.createPlot();\\n }\\n }\",\n \"plotRoutesCornerPoints() {\\n for (let r of this.mapRoutes) {\\n r.plotRouteCornerPoints(this.map);\\n }\\n }\",\n \"function render() {\\n renderPlots1D();\\n renderPlots2D();\\n}\",\n \"display() {\\n fill(127);\\n stroke(200);\\n strokeWeight(2);\\n ellipse(this.x, this.y, this.radius * 2, this.radius * 2);\\n }\",\n \"display() {\\n fill(this.color, 100, 100);\\n ellipse(this.x, this.y, this.diameter)\\n }\",\n \"function plotDot(){\\n\\t for (var i = 0; i<data_dot.dot.length;i++) {\\n ctx.beginPath();\\n ctx.arc(data_dot.dot[i].x,data_dot.dot[i].y,7,0,2*Math.PI);\\n ctx.fillStyle =\\\"#000\\\";\\n ctx.fill();\\n\\t}\\n}\",\n \"plot(){\\n /* plot the X and Y axis of the graph */\\n super.plotXAxis();\\n super.plotYAxis();\\n\\n /* (re)draw the points, grouped in a single graphics element */\\n let canvas = d3.select('svg#canvas_bioActivity > g#graph');\\n canvas.selectAll('#points').remove();\\n canvas.append('g')\\n .attr('id', 'points')\\n .attr('transform', 'translate('+this._margin.left+', 0)')\\n ;\\n /* Each data point will be d3 symbol (represented using svg paths) */\\n let pts = d3.select('#points').selectAll('g')\\n .data(this._data)\\n /* each point belongs to the 'data-point' class its positioned in the graph\\n * according to the associated (x,y) coordinates and its drawn using its\\n * color and shape */\\n let point = pts.enter().append('path')\\n .attr('class', 'data-point')\\n .attr('transform', d => 'translate('+d.x+' '+d.y+')')\\n .attr('fill', d => d.color )\\n .attr('d', function(d){\\n let s = ['Circle','Cross','Diamond','Square','Star','Triangle','Wye']\\n let symbol = d3.symbol()\\n .size(50)\\n .type(d3.symbols[s.indexOf(d.shape)])\\n ;\\n return symbol();\\n })\\n ;\\n /* each point will also have an associated svg title (tooltip) */\\n point.append('svg:title')\\n .text((d) => {\\n return 'Organism: '+d['Organism Name']+\\n '\\\\nGene: '+d['Gene Symbol']+\\n '\\\\nConcentation: '+d['Activity Concentration']+'nM';\\n })\\n ;\\n }\",\n \"addCoords(coords) {\\n var point = {\\n x: this.xScale.invert(coords[0]),\\n y: this.yScale.invert(coords[1]),\\n c: currentClass\\n };\\n this.addPoint(point);\\n }\",\n \"function init_xy(){\\n\\n\\t\\t\\tg.append(\\\"line\\\")\\n\\t\\t\\t\\t.attr(\\\"class\\\", \\\"xy\\\")\\n\\t\\t\\t\\t.attr(\\\"x1\\\", 0)\\n\\t\\t\\t\\t.attr(\\\"x2\\\", inner_w )\\n\\t\\t\\t\\t.attr(\\\"y1\\\", h + 20)\\n\\t\\t\\t\\t.attr(\\\"y2\\\", h + 20)\\n\\t\\t\\t\\t.style(\\\"stroke\\\", \\\"#CCC\\\")\\n\\t\\t\\t\\t.style(\\\"stroke-width\\\", \\\"1px\\\")\\n\\t\\t\\t\\t.style(\\\"stroke-dasharray\\\", \\\"5 3\\\");\\n\\n\\t\\t}\",\n \"function renderGraphics(coords) {\\n // Get the selected RGB combo vis params.\\n var visParams = RGB_PARAMS[rgbSelect.getValue()];\\n \\n // Get the clicked point and buffer it.\\n var point = ee.Geometry.Point(coords);\\n var aoiCircle = point.buffer(45);\\n var aoiBox = point.buffer(regionWidthSlider.getValue()*1000/2);\\n \\n // Clear previous point from the Map.\\n map.layers().forEach(function(el) {\\n map.layers().remove(el);\\n });\\n\\n // Add new point to the Map.\\n map.addLayer(aoiCircle, {color: AOI_COLOR});\\n map.centerObject(aoiCircle, 14);\\n \\n // Build annual time series collection.\\n LCB_PROPS['aoi'] = aoiBox;\\n LCB_PROPS['startDate'] = startDayBox.getValue();\\n LCB_PROPS['endDate'] = endDayBox.getValue();\\n lcb.props = lcb.setProps(LCB_PROPS);\\n \\n // Define annual collection year range as ee.List.\\n var years = ee.List.sequence(lcb.props.startYear, lcb.props.endYear);\\n var col = ee.ImageCollection.fromImages(years.map(imgColPlan));\\n\\n // Display the image chip time series. \\n displayBrowseImg(col, aoiBox, aoiCircle);\\n\\n OPTIONAL_PARAMS['chartParams']['vAxis']['title'] = indexSelect.getValue();\\n\\n // Render the time series chart.\\n rgbTs.rgbTimeSeriesChart(col, aoiCircle, indexSelect.getValue(), visParams,\\n chartPanel, OPTIONAL_PARAMS);\\n}\",\n \"function draw(){\\n\\n drawGrid();\\n var seriesIndex;\\n\\n if(!graph.hasData) {\\n return;\\n }\\n\\n if(graph.options.axes.x1.show){\\n if(!graph.options.axes.x1.labels || graph.options.axes.x1.labels.length === 0) {\\n seriesIndex = graph.options.axes.x1.seriesIndex;\\n graph.options.axes.x1.labels= getXLabels(graph.allSeries[seriesIndex].series[0], graph.options.labelDateFormat);\\n }\\n drawXLabels(graph.options.axes.x1);\\n }\\n if(graph.options.axes.x2.show && graph.hasData){\\n if (!graph.options.axes.x2.labels || graph.options.axes.x2.labels.length === 0) {\\n seriesIndex = graph.options.axes.x2.seriesIndex;\\n graph.options.axes.x2.labels = getXLabels(graph.allSeries[seriesIndex].series[0], graph.options.labelDateFormat);\\n }\\n drawXLabels(graph.options.axes.x2);\\n }\\n\\n if (graph.options.axes.y1.show) {\\n drawYLabels(graph.maxVals[graph.options.axes.y1.seriesIndex], graph.minVals[graph.options.axes.y1.seriesIndex], graph.options.axes.y1);\\n }\\n if (graph.options.axes.y2.show) {\\n drawYLabels(graph.maxVals[graph.options.axes.y2.seriesIndex], graph.minVals[graph.options.axes.y2.seriesIndex], graph.options.axes.y2);\\n }\\n }\",\n \"display() {\\n fill(0, 0, 0, 30)\\n noStroke()\\n ellipse(this.position.x, this.position.y, 4, 4)\\n }\",\n \"createAxes () {\\n }\",\n \"function plot(x) { \\n var canvas = document.getElementById(\\\"canvas\\\"); \\n var c = canvas.getContext(\\\"2d\\\"); \\n var canvasStyle = window.getComputedStyle(canvas, null); \\n var width = parseInt(canvasStyle.width);\\n var height= parseInt(canvasStyle.height); \\n var offset = (1 / (x.length - 1)) * width;\\n var maxX = x.reduce(function(a, b) { return Math.max(a, b);});\\n var minX = x.reduce(function(a, b) { return Math.min(a, b);});\\n // scale the input values to be plotted\\n function drawToScale(input) {\\n return height - ( (input-minX)*height) / (maxX-minX); \\n } \\n // remove the previuous lines\\n c.clearRect(0, 0, width, height) \\n // plot the new ones\\n c.beginPath();\\n c.moveTo(0, drawToScale(x[0]));\\n for (var i = 1; i < x.length; i++) {\\n c.lineTo(i * offset, drawToScale(x[i]) );\\n }\\n c.stroke();\\n }\",\n \"function drawCoords(currentLat, currentLon) {\\n html += \\\"Latitude: \\\" + currentLat;\\n html += \\\"<br>Longitude: \\\" + currentLon;\\n $(\\\".longLat\\\").html(html);\\n }\",\n \"display(){\\n\\n fill(255)\\n ellipse(this.pos.x, this.pos.y, this.size);\\n }\",\n \"function drawPoints(){\\n\\tfor (var i=0; i<p.length; i+=1){\\n\\t\\tp[i].pplot(1);\\n\\t}\\n}\",\n \"function cartesianAxisToCanvasCoords(pos) {\\n // get canvas coords from the first pair of x/y found in pos\\n var res = {},\\n i, axis, key;\\n\\n for (i = 0; i < xaxes.length; ++i) {\\n axis = xaxes[i];\\n if (axis && axis.used) {\\n key = \\\"x\\\" + axis.n;\\n if (pos[key] == null && axis.n === 1) {\\n key = \\\"x\\\";\\n }\\n\\n if (pos[key] != null) {\\n res.left = axis.p2c(pos[key]);\\n break;\\n }\\n }\\n }\\n\\n for (i = 0; i < yaxes.length; ++i) {\\n axis = yaxes[i];\\n if (axis && axis.used) {\\n key = \\\"y\\\" + axis.n;\\n if (pos[key] == null && axis.n === 1) {\\n key = \\\"y\\\";\\n }\\n\\n if (pos[key] != null) {\\n res.top = axis.p2c(pos[key]);\\n break;\\n }\\n }\\n }\\n\\n return res;\\n }\",\n \"display(){\\n noStroke();\\n fill(0,0,0);\\n ellipse(this.location.x, this.location.y, this.mass * 5, this.mass * 5)\\n noFill();\\n stroke(255,255,255);\\n ellipse(this.location.x, this.location.y, 200, 200);\\n }\",\n \"function showGrid(ctx, axis, color = '#000000') {\\n\\tif (!axis.displayGrid) /* do not show grid */\\n\\t\\treturn;\\n\\tif (!axis.set) { /* haven't set axis */\\n\\t\\talert('You must set AXIS first!');\\n\\t\\treturn;\\n\\t}\\n\\tlet lineSize = 1;\\n\\tlet i = 0;\\n\\tfor (; i < axis.xDivision.length; ++i) {\\n\\t\\tx = axis.xDivision[i];\\n\\t\\tdrawLine(ctx, x, axis.yLeftRange, x, axis.yRightRange,\\n\\t\\t\\tcolor, lineSize);\\n\\t}\\n\\t/* yLeft is pos and yRight is neg */\\n\\tfor (i = 0; i < axis.yDivision.length; ++i) {\\n\\t\\ty = axis.yDivision[i];\\n\\t\\tdrawLine(ctx, axis.xLeftRange, y, axis.xRightRange, y,\\n\\t\\t\\tcolor, lineSize);\\n\\t}\\n}\",\n \"function Coords($map) {\\n var that = this;\\n\\n this.x = $map.data('x');\\n this.y = $map.data('y');\\n this.iconTitle = '[' + this.x + ',' + this.y + ']';\\n\\n var $a = $map.find('a');\\n if ($a.length) {\\n $map.find('sup').unwrap();\\n }\\n\\n var $markers = $map.find('.map-marker');\\n\\n this.initMap($map, false, $markers, true);\\n\\n that.createMapPopupTooltip();\\n }\",\n \"show() {\\r\\n fill(255);\\r\\n ellipse(this.x, this.y, this.r*2);\\r\\n }\",\n \"function drawAxes() {\\n canvas.select(\\\"#layer1\\\").append(\\\"g\\\")\\n .attr(\\\"class\\\", \\\"grid\\\")\\n .attr(\\\"transform\\\", \\\"translate(0,\\\" + h + \\\")\\\")\\n .call(xAxis);\\n canvas.select(\\\"#layer1\\\").append(\\\"g\\\")\\n .attr(\\\"class\\\", \\\"grid\\\")\\n .call(yAxis);\\n}\",\n \"display() {\\n\\t\\tfill(this.col);\\n\\t\\tstroke(255);\\n\\t\\t// for (var i = 1; i < meter - 1; i++) {\\n\\t\\t// \\tline(0,0, width, 0);\\n\\t\\t// }\\n\\t\\tnoStroke();\\n\\t\\tellipseMode(CENTER);\\n\\t\\tellipse(this.x, this.y, this.size, this.size);\\n\\t}\",\n \"function drawPrices(x,y,price){\\r\\n fill(244,24,100);\\r\\n text(price + \\\" gp\\\",x+200,35+(y*50));\\r\\n }\",\n \"function Grid( )\\n{\\n\\tthis.lowerLeft = [37.74027582404923, -122.51225523839999];\\n\\tthis.upperRight = [37.81323020595205, -122.38651514053345];\\n\\tthis.latStep = 0.004053 / 3;\\n\\tthis.lngStep = 0.006287 / 4;\\n\\tthis.widthN = (this.upperRight[1] - this.lowerLeft[1]) / this.lngStep;\\n\\tthis.heightN = (this.upperRight[0] - this.lowerLeft[0]) / this.latStep;\\n\\t\\n\\tthis.plotGrid = function( bbox, row, column ) {\\n\\t\\tvar grid = drawRegion_bbox( bbox );\\n\\t\\tgrid.row = row;\\n\\t\\tgrid.column = column;\\n\\t\\tgrid.id = row * this.widthN + column;\\n\\t\\t\\n\\t\\tgoogle.maps.event.addListener(grid, 'mouseover', function(event) {\\n\\t\\t\\tmessage('Grid row ' + this.row + ' column ' + this.column + ' id ' + this.id);\\n\\t\\t});\\n\\t\\t\\n\\t\\tgoogle.maps.event.addListener(grid, 'mouseout', function(event) {\\n\\t\\t\\tmessage('');\\n\\t\\t});\\n\\t\\t\\n\\t\\treturn grid;\\n\\t};\\n\\t\\n\\tthis.plotAllGrids= function() {\\n\\t\\tfor (var row = 0; row < this.heightN; row ++)\\n\\t\\t{\\n\\t\\t\\tfor (var column = 0; column < this.widthN; column ++)\\n\\t\\t\\t{\\n\\t\\t\\t\\tbbox = [ this.lowerLeft[0] + this.latStep * (this.heightN - row -1), \\n\\t\\t\\t\\t\\t\\tthis.lowerLeft[1] + this.lngStep * column,\\n\\t\\t\\t\\t\\t\\tthis.upperRight[0] - this.latStep * row, \\n\\t\\t\\t\\t\\t\\tthis.upperRight[1] - this.lngStep * (this.widthN - 1 - column)];\\n\\t\\t\\t\\t\\n\\t\\t\\t\\tthis.plotGrid( bbox, row, column );\\n\\t\\t\\t}\\n\\t\\t}\\n\\t};\\n\\t\\n\\t\\n\\tthis.plotByID = function( id ) {\\n\\t\\tvar row = Math.floor(id / this.widthN);\\n\\t\\tvar column = id % this.widthN;\\n\\t\\tvar bbox = [ this.lowerLeft[0] + this.latStep * (this.heightN - row -1), \\n\\t\\t\\t\\t\\t\\tthis.lowerLeft[1] + this.lngStep * column,\\n\\t\\t\\t\\t\\t\\tthis.upperRight[0] - this.latStep * row, \\n\\t\\t\\t\\t\\t\\tthis.upperRight[1] - this.lngStep * (this.widthN - 1 - column)];\\n\\t\\treturn this.plotGrid( bbox, row, column );\\n\\t};\\n}\",\n \"display(){\\n noStroke();\\n fill(245,172,114);\\n ellipse(this.location.x, this.location.y, this.mass * 5, this.mass * 5)\\n }\",\n \"function showCars(){\\n for(let i = 0; i < carImage.length; i++){\\n image(carImage[i],xCars[i], yCars[i],carWidth,carHeigth); \\n print(yCars[i], xCars[i]);\\n }\\n}\",\n \"function drawGridCentre(x,y,s,rot){\\r\\n ctx.save();\\r\\n ctx.translate(x,y);\\r\\n ctx.rotate(rot*Math.PI/180);\\r\\n drawCircle(0,0,20, colArray[0], colArray[0], 2, false, true);\\r\\n for(j = 0; j<7 ; j++){\\r\\n for(var i = 0 ; i<7 ; i++){\\r\\n drawRectangle(0-s/2+i*s/7,0-s/2+j*s/7, s/7,s/7,colArray[3], colArray[4],0.5, false, true);\\r\\n }\\r\\n }\\r\\n ctx.restore();\\r\\n}\",\n \"function PolarCoordinates() {\\r\\n}\",\n \"function calc_graph(args) {\\n\\n //calculate the distances between each screen pixel\\n var x_step = (args.xmax - args.xmin) / args.width;\\n var y_step = (args.ymax - args.ymin) / args.height;\\n\\n //current complex number\\n var x = args.xmin;\\n var y = args.ymin;\\n\\n\\n for (var scaleX = 0; scaleX < args.width; scaleX++) {\\n y = args.ymin;\\n for (var scaleY = 0; scaleY < args.height; scaleY++) {\\n var c = new Complex(x,y);\\n if(is_mandelbrot_member(c)) {\\n postMessage({ x: scaleX, y: scaleY });\\n }\\n y += y_step;\\n }\\n x += x_step;\\n }\\n}\",\n \"function drawPol(xCor, yCor, N, side) {\\n paper.circle(xCor, yCor, 3).attr(\\\"fill\\\", \\\"black\\\");\\n\\n var path = \\\"\\\", n, temp_x, temp_y, angle;\\n\\n for (n = 0; n <= N; n += 1) {\\n // angulo en radianes parte del circulo a dibujar\\n angle = n / N * 2 * Math.PI;\\n\\n // ajustar valor de x de acuerdo al angulo\\n temp_x = xCor + Math.cos(angle) * side;\\n // ajustar valor de y de acuerdo al angulo\\n temp_y = yCor + Math.sin(angle) * side;\\n\\n //Empezar a escribir el path\\n // Si es el primer punto, se usa M (starting point) si no utilizar L en el formato del path\\n //Dato especificado por raphael\\n path += (n === 0 ? \\\"M\\\" : \\\"L\\\") + temp_x + \\\",\\\" + temp_y;\\n }\\n return path;\\n}\",\n \"display() {\\n push();\\n fill(255, 255, 0);\\n let angle = TWO_PI / this.points;\\n let halfAngle = angle / 2.0;\\n beginShape();\\n for (let a = 0; a < TWO_PI; a += angle) {\\n let sx = this.x + cos(a) * this.outerRadius;\\n let sy = this.y + sin(a) * this.outerRadius;\\n vertex(sx, sy);\\n sx = this.x + cos(a + halfAngle) * this.innerRadius;\\n sy = this.y + sin(a + halfAngle) * this.innerRadius;\\n vertex(sx, sy);\\n }\\n endShape(CLOSE);\\n pop();\\n }\",\n \"function genIterDiagram(f, xstar, axis) {\\n\\n var w = 900\\n var h = 300\\n var totalIters = 150\\n var state_beta = 0.0\\n var state_alpha = 0.001\\n var num_contours = 15\\n var onDrag = function() {}\\n var w0 =[-1.21, 0.853]\\n //var w0 = [0,0]\\n\\n function renderIterates(div) {\\n\\n // Render the other stuff\\n var intDiv = div.style(\\\"width\\\", w + \\\"px\\\")\\n .style(\\\"height\\\", h + \\\"px\\\")\\n .style(\\\"box-shadow\\\",\\\"0px 3px 10px rgba(0, 0, 0, 0.4)\\\")\\n .style(\\\"border\\\", \\\"solid black 1px\\\")\\n\\n // Render Contours \\n var plotCon = contour_plot.ContourPlot(w,h)\\n .f(function(x,y) { return f([x,y])[0] })\\n .drawAxis(false)\\n .xDomain(axis[0])\\n .yDomain(axis[1])\\n .contourCount(num_contours)\\n .minima([{x:xstar[0], y:xstar[1]}]);\\n\\n var elements = plotCon(intDiv);\\n\\n var svg = intDiv.append(\\\"div\\\")\\n .append(\\\"svg\\\")\\n .style(\\\"position\\\", 'absolute')\\n .style(\\\"left\\\", 0)\\n .style(\\\"top\\\", 0)\\n .style(\\\"width\\\", w)\\n .style(\\\"height\\\", h)\\n .style(\\\"z-index\\\", 2) \\n\\n\\n // var X = d3.scaleLinear().domain([0,1]).range(axis[0])\\n // var Y = d3.scaleLinear().domain([0,1]).range(axis[1])\\n\\n var X = d3.scaleLinear().domain(axis[0]).range([0, w])\\n var Y = d3.scaleLinear().domain(axis[1]).range([0, h])\\n \\n // Rendeer Draggable dot\\n var circ = svg.append(\\\"circle\\\")\\n .attr(\\\"cx\\\", X(w0[0])) \\n .attr(\\\"cy\\\", Y(w0[1]) )\\n .attr(\\\"r\\\", 4)\\n .style(\\\"cursor\\\", \\\"pointer\\\")\\n .attr(\\\"fill\\\", colorbrewer.OrRd[3][1])\\n .attr(\\\"opacity\\\", 0.8)\\n .attr(\\\"stroke-width\\\", 1)\\n .attr(\\\"stroke\\\", colorbrewer.OrRd[3][2])\\n .call(d3.drag().on(\\\"drag\\\", function() {\\n var pt = d3.mouse(this)\\n var x = X.invert(pt[0])\\n var y = Y.invert(pt[1])\\n this.setAttribute(\\\"cx\\\", pt[0])\\n this.setAttribute(\\\"cy\\\", pt[1])\\n w0 = [x,y]\\n onDrag(w0)\\n iter(state_alpha, state_beta, w0);\\n }))\\n\\n var iterColor = d3.scaleLinear().domain([0, totalIters]).range([\\\"black\\\", \\\"black\\\"])\\n\\n var update2D = plot2dGen(X, Y, iterColor)(svg)\\n\\n // Append x^star\\n svg.append(\\\"path\\\")\\n .attr(\\\"transform\\\", \\\"translate(\\\" + X(xstar[0]) + \\\",\\\" + Y(xstar[1]) + \\\")\\\")\\n .attr(\\\"d\\\", \\\"M 0.000 2.000 L 2.939 4.045 L 1.902 0.618 L 4.755 -1.545 L 1.176 -1.618 L 0.000 -5.000 L -1.176 -1.618 L -4.755 -1.545 L -1.902 0.618 L -2.939 4.045 L 0.000 2.000\\\")\\n .style(\\\"fill\\\", \\\"white\\\")\\n .style(\\\"stroke-width\\\",1)\\n\\n \\n function iter(alpha, beta, w0) {\\n\\n // Update Internal state of alpha and beta\\n state_alpha = alpha\\n state_beta = beta\\n\\n // Generate iterates \\n var OW = runMomentum(f, w0, alpha, beta, totalIters)\\n var W = OW[1]\\n\\n update2D(W)\\n\\n circ.attr(\\\"cx\\\", X(w0[0]) ).attr(\\\"cy\\\", Y(w0[1]) )\\n circ.moveToFront()\\n\\n }\\n\\n iter(state_alpha, state_beta, w0);\\n \\n return { control:iter, \\n w0:function() { return w0 }, \\n alpha:function() { return state_alpha }, \\n beta:function() {return state_beta} }\\n\\n }\\n\\n renderIterates.width = function (_) {\\n w = _; return renderIterates;\\n }\\n\\n renderIterates.height = function (_) {\\n h = _; return renderIterates;\\n }\\n\\n renderIterates.iters = function (_) {\\n totalIters = _; return renderIterates;\\n }\\n\\n renderIterates.drag = function (_) {\\n onDrag = _; return renderIterates;\\n }\\n\\n renderIterates.init = function (_) {\\n w0 = _; return renderIterates;\\n }\\n\\n renderIterates.alpha = function (_) {\\n state_alpha = _; return renderIterates;\\n }\\n\\n renderIterates.beta = function (_) {\\n state_beta = _; return renderIterates;\\n }\\n\\n return renderIterates\\n\\n}\",\n \"function plot_function(npoints) {\\n data = [...Array(npoints).keys()].map(Math.random);\\n\\n //yScale for position\\n yScale = d3.scaleLinear()\\n .domain([d3.min(data), d3.max(data)])\\n .range([d3.select(\\\"#chart\\\").style(\\\"height\\\").replace(\\\"px\\\",\\\"\\\")-20, 10]);\\n\\n //This range of continous scales can be colours!\\n color = d3.scaleLog()\\n .domain([d3.min(data), d3.mean(data), d3.max(data)])\\n .range([1,0]);\\n\\n //Quantized colors can be used to.\\n color = d3.scaleQuantize()\\n .domain([d3.min(data), d3.max(data)])\\n .range(d3.schemeCategory10);\\n\\n xScale = d3.scaleLinear()\\n .domain([0,npoints])\\n .range([0,700]);\\n\\n markers = d3.select(\\\"#axisbox\\\")\\n .attr(\\\"transform\\\", \\\"translate(80,-20)\\\")\\n .selectAll(\\\"circle\\\")\\n .data(data)\\n .enter()\\n .append(\\\"circle\\\")\\n .attr(\\\"r\\\", 2)\\n .attr(\\\"cx\\\", function(d,i) {return xScale(i);})\\n .attr(\\\"cy\\\", function(d,i) {return yScale(d);})\\n .attr(\\\"fill\\\", function(d,i) {return color(d);});\\n\\n laxis = d3.axisLeft(yScale)\\n .ticks(10, 'f');\\n\\n baxis = d3.axisBottom(xScale)\\n .ticks(10);\\n\\n d3.select(\\\"#axisbox\\\")\\n .append(\\\"g\\\")\\n .call(laxis);\\n\\n d3.select(\\\"#axisbox\\\")\\n .append(\\\"g\\\")\\n .attr(\\\"transform\\\", \\\"translate(0,620)\\\")\\n .call(baxis)\\n .select(\\\".domain\\\")\\n}\",\n \"function plot(x,y,color){\\n ctx.fillStyle = color;\\n ctx.fillRect(x,y,1,1);\\n }\",\n \"function setGraphCoordinates(canvasSize) {\\n let xCoordinate = 0;\\n let yCoordinate = 1000;\\n const decimalIncrement = 0.1;\\n let coordinatesArray = []\\n while(yCoordinate > 0) {\\n\\n let orderedPair = generateOrderedPair(xCoordinate);\\n yCoordinate =orderedPair[1] \\n coordinatesArray.push(orderedPair);\\n xCoordinate +=decimalIncrement;\\n }\\n return coordinatesArray\\n}\",\n \"function drawChords (matrix, mmap) {\\n var w = 980, h = 750, r1 = h / 2, r0 = r1 - 110, duration=5000;\\n\\n var fill = d3.scale.ordinal()\\n // .range(['#c7b570','#c6cdc7','#335c64','#768935','#507282','#5c4a56','#aa7455','#574109','#837722','#73342d','#0a5564','#9c8f57','#7895a4','#4a5456','#b0a690','#0a3542',]);\\n //.range(['#E54E45', \\\"#DBC390\\\", \\\"#13A3A5\\\", \\\"#403833\\\", \\\"#334D5C\\\", \\\"#C0748D\\\", \\\"#EFC94C\\\", \\\"#E27A3F\\\", \\\"#DF4949\\\", \\\"#7B3722\\\", \\\"#8F831F\\\", \\\"#F0900D\\\", \\\"#10325C\\\"]);\\n .range(['#A9A18C', '#855723', '#4E6172', '#DBCA69', '#A3ADB8', '#668D3C', '#493829']);\\n\\n var chord = d3.layout.chord()\\n .padding(.02)\\n .sortSubgroups(d3.descending)\\n .sortChords(d3.descending);\\n\\n var arc = d3.svg.arc()\\n .innerRadius(r0)\\n .outerRadius(r0 + 20);\\n\\n var svg = d3.select(\\\"#ext-chart\\\").append(\\\"svg:svg\\\")\\n .attr(\\\"width\\\", w)\\n .attr(\\\"height\\\", h)\\n .append(\\\"svg:g\\\")\\n .attr(\\\"id\\\", \\\"circle\\\")\\n .attr(\\\"transform\\\", \\\"translate(\\\" + w / 2 + \\\",\\\" + h / 2 + \\\")\\\");\\n\\n svg.append(\\\"circle\\\")\\n .attr(\\\"r\\\", r0 + 20);\\n\\n var rdr = chordRdr(matrix, mmap);\\n chord.matrix(matrix);\\n\\n var g = svg.selectAll(\\\"g.group\\\")\\n .data(chord.groups())\\n .enter().append(\\\"svg:g\\\")\\n .attr(\\\"class\\\", \\\"group\\\")\\n .on(\\\"mouseover\\\", mouseover)\\n .on(\\\"mouseout\\\", function (d) { d3.select(\\\"#tooltip\\\").style(\\\"visibility\\\", \\\"hidden\\\") });\\n\\n g.append(\\\"svg:path\\\")\\n .style(\\\"stroke\\\", \\\"black\\\")\\n .style(\\\"fill\\\", function(d) { return fill(rdr(d).gname); })\\n .attr(\\\"d\\\", arc);\\n\\n g.append(\\\"svg:text\\\")\\n .each(function(d) { d.angle = (d.startAngle + d.endAngle) / 2; })\\n .attr(\\\"dy\\\", \\\".35em\\\")\\n .style(\\\"font-family\\\", \\\"helvetica, arial, sans-serif\\\")\\n .style(\\\"font-size\\\", \\\"12px\\\")\\n .attr(\\\"text-anchor\\\", function(d) { return d.angle > Math.PI ? \\\"end\\\" : null; })\\n .attr(\\\"transform\\\", function(d) {\\n return \\\"rotate(\\\" + (d.angle * 180 / Math.PI - 90) + \\\")\\\"\\n + \\\"translate(\\\" + (r0 + 26) + \\\")\\\"\\n + (d.angle > Math.PI ? \\\"rotate(180)\\\" : \\\"\\\");\\n })\\n .text(function(d) { return rdr(d).gname; });\\n\\n var chordPaths = svg.selectAll(\\\"path.chord\\\")\\n .data(chord.chords())\\n .enter().append(\\\"svg:path\\\")\\n .attr(\\\"class\\\", \\\"chord\\\")\\n .style(\\\"stroke\\\", function(d) { return d3.rgb(fill(rdr(d).sname)).darker(); })\\n .style(\\\"fill\\\", function(d) { return fill(rdr(d).sname); })\\n .attr(\\\"d\\\", d3.svg.chord().radius(r0))\\n .on(\\\"mouseover\\\", function (d) {\\n d3.select(\\\"#tooltip\\\")\\n .style(\\\"visibility\\\", \\\"visible\\\")\\n .html(chordTip(rdr(d)))\\n .style(\\\"font\\\", \\\"12px sans-serif\\\")\\n .style(\\\"top\\\", function () { return (d3.event.pageY - 170)+\\\"px\\\"})\\n .style(\\\"left\\\", function () { return (d3.event.pageX - 100)+\\\"px\\\";})\\n })\\n .on(\\\"mouseout\\\", function (d) { d3.select(\\\"#tooltip\\\").style(\\\"visibility\\\", \\\"hidden\\\") });\\n\\n function chordTip (d) {\\n var q = d3.format(\\\",.1f\\\")\\n return \\\"Flow Info:<br/><br>\\\"\\n + d.sname + \\\" flow from \\\" + d.tname\\n + \\\": \\\" + q(d.svalue) + \\\"T<br/>\\\"\\n + \\\"<br/>\\\"\\n + d.tname + \\\" flow from \\\" + d.sname\\n + \\\": \\\" + q(d.tvalue) + \\\"T<br/>\\\";\\n }\\n\\n function groupTip (d) {\\n var p = d3.format(\\\".1%\\\"), q = d3.format(\\\",.2f\\\")\\n return \\\"Influx Info:<br/><br/>\\\"\\n + d.gname + \\\" : \\\" + q(d.gvalue) + \\\"T\\\"\\n }\\n\\n function mouseover(d, i) {\\n d3.select(\\\"#tooltip\\\")\\n .style(\\\"visibility\\\", \\\"visible\\\")\\n .html(groupTip(rdr(d)))\\n .style(\\\"top\\\", function () { return (d3.event.pageY - 80)+\\\"px\\\"})\\n .style(\\\"left\\\", function () { return (d3.event.pageX - 130)+\\\"px\\\";})\\n\\n chordPaths.classed(\\\"fade\\\", function(p) {\\n return p.source.index != i\\n && p.target.index != i;\\n });\\n }\\n\\n /* for brush slider */\\n var margin = {top: 0, right: 50, bottom: 10, left: 50},\\n width = w - margin.left - margin.right,\\n height = 50 - margin.bottom - margin.top;\\n\\n var x = d3.scale.linear()\\n .domain([10, 22])\\n .range([0, width])\\n .clamp(true);\\n\\n var brush = d3.svg.brush()\\n .x(x)\\n .extent([0, 0])\\n .on(\\\"brush\\\", brushed);\\n\\n var svg = d3.select(\\\"#brush-slider\\\").append(\\\"svg\\\")\\n .attr(\\\"width\\\", width + margin.left + margin.right)\\n .attr(\\\"height\\\", height + margin.top + margin.bottom)\\n .append(\\\"g\\\")\\n .attr(\\\"transform\\\", \\\"translate(\\\" + margin.left + \\\",\\\" + margin.top + \\\")\\\");\\n\\n svg.append(\\\"g\\\")\\n .attr(\\\"class\\\", \\\"x axis\\\")\\n .attr(\\\"transform\\\", \\\"translate(0,\\\" + height / 2 + \\\")\\\")\\n .call(d3.svg.axis()\\n .scale(x)\\n .orient(\\\"bottom\\\")\\n .tickFormat(function(d) { return d + \\\":00\\\"; })\\n .tickSize(0)\\n .tickPadding(12))\\n .select(\\\".domain\\\")\\n .select(function() { return this.parentNode.appendChild(this.cloneNode(true)); })\\n .attr(\\\"class\\\", \\\"halo\\\");\\n\\n var slider = svg.append(\\\"g\\\")\\n .attr(\\\"class\\\", \\\"slider\\\")\\n .call(brush);\\n\\n slider.selectAll(\\\".extent,.resize\\\")\\n .remove();\\n\\n slider.select(\\\".background\\\")\\n .attr(\\\"height\\\", height);\\n\\n var handle = slider.append(\\\"circle\\\")\\n .attr(\\\"class\\\", \\\"handle\\\")\\n .attr(\\\"transform\\\", \\\"translate(0,\\\" + height / 2 + \\\")\\\")\\n .attr(\\\"r\\\", 9);\\n\\n slider\\n .call(brush.event)\\n .transition() // gratuitous intro!\\n .duration(750)\\n .call(brush.extent([16, 16]))\\n .call(brush.event);\\n\\n function brushed() {\\n var value = brush.extent()[0];\\n\\n if (d3.event.sourceEvent) { // not a programmatic event\\n value = x.invert(d3.mouse(this)[0]);\\n brush.extent([value, value]);\\n }\\n\\n handle.attr(\\\"cx\\\", x(value));\\n } \\n }\",\n \"function position(dot) {\\n dot .attr(\\\"cx\\\", function(d) { \\n // console.log(\\\"cx is \\\" + xScale(x(d)) );\\n // return xScale(x(d)); \\n return xScale(d.engineers_num);\\n } )\\n .attr(\\\"cy\\\", function(d) { return yScale(d.employees_num) })\\n .attr(\\\"r\\\", 10\\n // function(d) {\\n // console.log( radiusScale(radius(d)) );\\n // return radiusScale(radius(d)); \\n // }\\n );\\n }\",\n \"function axialCoords(q, r) {\\r\\n\\tthis.q = q;\\r\\n\\tthis.r = r;\\r\\n}\",\n \"function drawGrid(Tx){\\n context.beginPath();\\n var dim = 10;\\n var length = 500;\\n // Draw from the negative width to pos\\n for(var i=-(dim/2); i<=(dim/2); i++){\\n iScaled = i * 50;\\n moveToTx(iScaled, 0, -length/2, Tx); lineToTx(iScaled, 0, length/2, Tx);\\n moveToTx(-length/2, 0, iScaled, Tx); lineToTx(length/2, 0, iScaled, Tx);\\n }\\n context.stroke();\\n }\",\n \"function render () {\\n\\n\\t\\tfunction pushMatrix (fn) {\\n\\t\\t\\tp.push();\\n\\t\\t\\tfn();\\n\\t\\t\\tp.pop();\\n\\t\\t}\\n\\n\\t\\t// Draw Horizontal Lines\\n\\t\\tpushMatrix(function () {\\n\\t\\t\\tp.strokeCap(p.ROUND);\\n\\t\\t\\tp.stroke(121, 192, 242);\\t\\t\\t\\t// Light Blue\\n\\t\\t\\tp.translate(p.width/2, p.height/2);\\t\\t// Translate to center\\n\\n\\t\\t\\t// Set strokeweight to decrease proportionally to the stretch factor\\n\\t\\t\\tvar base_stroke_weight = 2;\\n\\t\\t\\tvar stroke_weight = base_stroke_weight - (a_l_de.value * base_stroke_weight);\\n\\t\\t\\tp.strokeWeight(stroke_weight);\\n\\n\\t\\t\\tvar spacing = 60;\\t\\t\\t\\t\\t\\t// Set space around Es\\n\\t\\t\\t// Mult by -1 for left line\\n\\t\\t\\tvar displacement_start = a_l_ds.value * (p.width / 2) + spacing;\\n\\t\\t\\tvar displacement_end = a_l_de.value * (p.width / 2) + spacing;\\n\\n\\t\\t\\tp.line(-displacement_end, 0, -displacement_start, 0);\\t\\t// Left Line\\n\\t\\t\\tp.line(displacement_end, 0, displacement_start, 0);\\t\\t// Right Line\\n\\t\\t});\\n\\n\\t\\t// Assemble Logo!\\n\\n\\t\\t// Rotate E\\n\\t\\tpushMatrix(function () {\\n\\n\\t\\t\\tp.tint(255, 255); // Opacity (255)\\n\\t\\t\\t\\n\\t\\t\\tp.translate(p.width / 2, p.height / 2);\\n\\t\\t\\tp.rotate(p.radians(a_ed_r.value));\\t\\t// All rotations must occur here!!!\\n\\t\\t\\tp.scale(0.75, 0.75);\\n\\n\\t\\t\\t// For Dots\\n\\t\\t\\tpushMatrix(function () {\\n\\n\\t\\t\\t\\tp.translate(-41.25,-42.65); \\t\\t// Center offset\\n\\t\\t\\t\\tp.scale(0.15,0.15);\\n\\n\\t\\t\\t\\t// Polar Coordinates\\n\\t\\t\\t\\tvar r = a_d_d.value;\\t\\t\\t\\t// Origin Offset \\t{start: 300, end: 265}\\n\\t\\t\\t\\tvar angle = p.radians(a_d_r.value);\\t\\t// Angle Offset\\t\\t{start: 0, end: 77}\\n\\t\\t\\t\\tvar x = p.cos(angle) * r;\\t\\t\\t\\t// Multiply r * -1 for other Dot\\n\\t\\t\\t\\tvar y = p.sin(angle) * r;\\n\\n\\t\\t\\t\\t// Top Dot\\n\\t\\t\\t\\tpushMatrix(function () {\\n\\t\\t\\t\\t\\tp.scale(1, 1);\\n\\t\\t\\t\\t\\t\\n\\t\\t\\t\\t\\tp.translate(x,y);\\n\\t\\t\\t\\t\\tp.translate(276,283); \\t\\t// Center on Es\\n\\t\\t\\t\\t\\tp.scale(a_d_s.value, a_d_s.value); \\t// Each scale <-- Parametric\\n\\t\\t\\t\\t\\tp.image(dot, -50, -50); \\t// Center around origin\\n\\t\\t\\t\\t});\\n\\n\\t\\t\\t\\t// Bottom Dot\\n\\t\\t\\t\\tpushMatrix(function () {\\n\\t\\t\\t\\t\\tp.scale(1, 1);\\n\\t\\t\\t\\t\\t\\n\\t\\t\\t\\t\\tp.translate(-x,-y);\\n\\t\\t\\t\\t\\tp.translate(276, 283); \\t\\t// Center on Es, experimentally determined\\n\\t\\t\\t\\t\\tp.scale(a_d_s.value, a_d_s.value); \\t// Each scale <-- Parametric\\n\\t\\t\\t\\t\\tp.image(dot2, -50, -50); \\t// Center around origin\\n\\t\\t\\t\\t});\\n\\t\\t\\t});\\n\\n\\t\\t\\t// For Es\\n\\t\\t\\tpushMatrix(function () {\\n\\t\\t\\t\\tp.scale(a_e_s.value, a_e_s.value); \\t// Global scale\\n\\t\\t\\t\\tp.translate(-41.25,-42.65); \\t\\t// Center offset, experimentally determined\\n\\t\\t\\t\\tp.scale(0.15,0.15);\\n\\t\\t\\t\\t\\n\\t\\t\\t\\t// Bottom E\\n\\t\\t\\t\\tp.image(E, 100, 100);\\n\\n\\t\\t\\t\\t// Top E\\n\\t\\t\\t\\tpushMatrix(function () {\\n\\t\\t\\t\\t\\tp.translate(200, 0);\\n\\t\\t\\t\\t\\tp.image(E2, 0, 0);\\n\\t\\t\\t\\t});\\n\\t\\t\\t});\\n\\n\\t\\t});\\n\\n\\t\\tpushMatrix(function () {\\n\\t\\t\\tp.fill(255);\\n\\t\\t\\tp.noStroke();\\n\\t\\t\\tp.translate(p.width/2, p.height/2);\\n\\t\\t});\\n\\n\\t\\tif (global_animator.value >= 1) {\\n\\t\\t\\tp.noLoop();\\n\\t\\t}\\n\\t}\",\n \"show() {\\n\\t\\tfill(255);\\n ellipse(this.x, this.y, this.r*2)\\n\\t}\",\n \"function showCoords(c)\\r\\n {\\r\\n $('#x1').val(c.x);\\r\\n $('#y1').val(c.y);\\r\\n $('#x2').val(c.x2);\\r\\n $('#y2').val(c.y2);\\r\\n $('#w').val(c.w);\\r\\n $('#h').val(c.h);\\r\\n }\",\n \"function allDotsDraw(positions) {\\n // Loop through each dot and draw\\n for (i = 0; i < positions.length; i++){\\n dotDrawer(positions[i])\\n }\\n}\",\n \"function drawPC() {\\r\\n\\t\\r\\n//setting the x and y scale \\r\\n\\tvar x = d3.scale.ordinal().rangePoints([0, 480], 1),\\r\\n y= {};\\r\\n \\r\\n// Extract the list of dimensions and create a scale for each.\\r\\n for (var dim in cars[0]) {\\r\\n\\t if (dim != \\\"name\\\") {\\r\\n\\t\\t y[dim] = d3.scale.linear()\\r\\n\\t\\t\\t .domain([d3.min(cars, function(d) { return +d[dim]; }), d3.max(cars, function(d) { return +d[dim]; })])\\r\\n\\t\\t .range([height,0]);\\r\\n\\t }\\r\\n }\\r\\n \\r\\n//setting the x domain dimensions\\r\\n x.domain(dimensions = d3.keys(cars[0]).filter(function(d) { return d != \\\"name\\\";}));\\r\\n\\r\\n//draw polylines\\r\\n for (var i=1; i< cars.length; i++) { \\r\\n\\r\\n//prepare the coordinates for a polyline\\r\\n\\t var lineData = []; //initialize an array for coordinates of a polyline\\r\\n\\t for (var prop in cars[0]) { //get each dimension\\r\\n\\t if (prop != \\\"name\\\" ) { //skip the name dimension\\r\\n\\t var point = {}; //initialize a coordinate object\\r\\n\\t var val = cars[i][prop]; //obtain the value of a car in a dimension\\r\\n\\t\\t point['x'] = x(prop); //x value: mapping the dimension \\r\\n\\t point['y'] = y[prop](val);//y value: mapping the value in that dimension\\r\\n\\t lineData.push(point); //add the object into the array \\r\\n\\t }\\r\\n\\t }\\r\\n\\r\\n//draw a polyline based on the coordindates \\r\\n chart.append(\\\"g\\\")\\r\\n\\t .attr(\\\"class\\\", \\\"polyline\\\")\\r\\n\\t .append(\\\"path\\\") // a path shape\\r\\n\\t\\t .attr(\\\"d\\\", line(lineData)) //line() is a function to turn coordinates into SVG commands\\r\\n\\t\\r\\n//the mouseover function that changes the strokes to red when the mouse is over them\\r\\n\\t.on(\\\"mouseover\\\", function(){\\r\\n\\t\\t\\td3.select(this)\\r\\n\\t\\t.style(\\\"stroke\\\",\\\"red\\\")\\r\\n\\t })\\r\\n//the mouseout function that changes the strokes back to their original color\\r\\n\\t.on(\\\"mouseout\\\", function(){\\r\\n\\t\\td3.select(this)\\r\\n\\t\\t.style(\\\"stroke\\\",null)\\r\\n\\t\\t\\r\\n})\\r\\n }\\r\\n\\r\\n//draw individual dimension lines\\r\\n//position dimension lines \\r\\n var g = chart.selectAll(\\\".dimension\\\")\\r\\n\\t .data(dimensions)\\r\\n\\t .enter().append(\\\"g\\\")\\r\\n\\t .attr(\\\"class\\\", \\\"dimension\\\")\\r\\n\\t .attr(\\\"transform\\\", function(d) { return \\\"translate(\\\" + x(d) + \\\")\\\"; }) //translate each axis\\r\\n\\r\\n\\t\\r\\n// Add an axis and title.\\r\\n g.append(\\\"g\\\")\\r\\n\\t .attr(\\\"class\\\", \\\"axis\\\")\\r\\n\\t .each(function(d) { d3.select(this).call(axis.scale(y[d])); })\\r\\n\\t .append(\\\"text\\\")\\r\\n\\t .style(\\\"text-anchor\\\", \\\"middle\\\")\\r\\n\\t .attr(\\\"y\\\", -4)\\r\\n\\t .text(function(d) { return d; });\\r\\n\\t \\r\\n \\r\\n}\",\n \"show() {\\n fill(this.fill, this.alpha);\\n strokeWeight(4);\\n stroke(255);\\n ellipse(this.x, this.y, (this.r * 2));\\n }\"\n]","isConversational":false},"negative_scores":{"kind":"list like","value":["0.606524","0.58996356","0.5816983","0.5802485","0.5684464","0.56714755","0.5637831","0.5623183","0.55911744","0.55853385","0.5572179","0.55446523","0.553017","0.5528281","0.5513845","0.5494181","0.54765886","0.5468272","0.5444749","0.5409388","0.54050297","0.5395914","0.53905684","0.5358139","0.53568447","0.532887","0.532887","0.532887","0.532887","0.532887","0.53257716","0.5300905","0.5295992","0.5292185","0.52795315","0.5271068","0.52670676","0.5236764","0.52175516","0.5215454","0.51955086","0.51848817","0.51627237","0.51625776","0.5161895","0.5158863","0.5158799","0.51501846","0.51463616","0.514113","0.5139577","0.5137731","0.5132567","0.51304746","0.5130238","0.5114844","0.5090193","0.50843906","0.5080542","0.50802016","0.50799865","0.50774837","0.50752324","0.50729203","0.50669867","0.50567275","0.50500333","0.5047022","0.503867","0.5038485","0.5036975","0.5033208","0.5028407","0.5023549","0.5022242","0.5011926","0.5006844","0.5005144","0.49989474","0.49845433","0.4974301","0.49738157","0.4968948","0.49688894","0.496795","0.49653587","0.49645236","0.4957469","0.49547073","0.49536672","0.49477163","0.49464875","0.4945217","0.49392927","0.49376544","0.49371412","0.49365854","0.4932834","0.4932218","0.49270192"],"string":"[\n \"0.606524\",\n \"0.58996356\",\n \"0.5816983\",\n \"0.5802485\",\n \"0.5684464\",\n \"0.56714755\",\n \"0.5637831\",\n \"0.5623183\",\n \"0.55911744\",\n \"0.55853385\",\n \"0.5572179\",\n \"0.55446523\",\n \"0.553017\",\n \"0.5528281\",\n \"0.5513845\",\n \"0.5494181\",\n \"0.54765886\",\n \"0.5468272\",\n \"0.5444749\",\n \"0.5409388\",\n \"0.54050297\",\n \"0.5395914\",\n \"0.53905684\",\n \"0.5358139\",\n \"0.53568447\",\n \"0.532887\",\n \"0.532887\",\n \"0.532887\",\n \"0.532887\",\n \"0.532887\",\n \"0.53257716\",\n \"0.5300905\",\n \"0.5295992\",\n \"0.5292185\",\n \"0.52795315\",\n \"0.5271068\",\n \"0.52670676\",\n \"0.5236764\",\n \"0.52175516\",\n \"0.5215454\",\n \"0.51955086\",\n \"0.51848817\",\n \"0.51627237\",\n \"0.51625776\",\n \"0.5161895\",\n \"0.5158863\",\n \"0.5158799\",\n \"0.51501846\",\n \"0.51463616\",\n \"0.514113\",\n \"0.5139577\",\n \"0.5137731\",\n \"0.5132567\",\n \"0.51304746\",\n \"0.5130238\",\n \"0.5114844\",\n \"0.5090193\",\n \"0.50843906\",\n \"0.5080542\",\n \"0.50802016\",\n \"0.50799865\",\n \"0.50774837\",\n \"0.50752324\",\n \"0.50729203\",\n \"0.50669867\",\n \"0.50567275\",\n \"0.50500333\",\n \"0.5047022\",\n \"0.503867\",\n \"0.5038485\",\n \"0.5036975\",\n \"0.5033208\",\n \"0.5028407\",\n \"0.5023549\",\n \"0.5022242\",\n \"0.5011926\",\n \"0.5006844\",\n \"0.5005144\",\n \"0.49989474\",\n \"0.49845433\",\n \"0.4974301\",\n \"0.49738157\",\n \"0.4968948\",\n \"0.49688894\",\n \"0.496795\",\n \"0.49653587\",\n \"0.49645236\",\n \"0.4957469\",\n \"0.49547073\",\n \"0.49536672\",\n \"0.49477163\",\n \"0.49464875\",\n \"0.4945217\",\n \"0.49392927\",\n \"0.49376544\",\n \"0.49371412\",\n \"0.49365854\",\n \"0.4932834\",\n \"0.4932218\",\n \"0.49270192\"\n]","isConversational":false},"document_score":{"kind":"string","value":"0.5585903"},"document_rank":{"kind":"string","value":"9"}}},{"rowIdx":4596,"cells":{"query":{"kind":"string","value":"Function plots Cylindrical coordiate system"},"document":{"kind":"string","value":"function plotCylindrical(r,theta,z, target){\n console.log(r,theta,z,target);\n\n let hoverlabel = [\"R: \"+r[0]+\", Θ: \"+theta[0]+\", Z: \"+z[0],\"R: \"+r[1]+\", Θ: \"+theta[1]+\", Z: \"+z[1]];\n var data = [{\n type: 'scatter3d',\n mode: 'lines',\n x: r,\n y: theta,\n z: z,\n hoverinfo: 'text',\n hovertext: hoverlabel,\n opacity: 1,\n line: {\n width: 6,\n color: \"rgb(0,0,0)\",\n reversescale: false\n }\n }]\n\n var layout = {\n \tscene: {\n \t\txaxis:{title: 'R'},\n \t\tyaxis:{title: 'THETA'},\n \t\tzaxis:{title: 'Z'},\n \t\t}\n }\n\n Plotly.plot(target, data, layout);\n}"},"metadata":{"kind":"string","value":"{\n \"objective\": {\n \"self\": [],\n \"paired\": [],\n \"triplet\": [\n [\n \"query\",\n \"document\",\n \"negatives\"\n ]\n ]\n }\n}"},"negatives":{"kind":"list like","value":["plotCyclists() {\n for (let c of this.mapCyclists) {\n if (c.cyclist.id.id == \"0_ghost\" || c.cyclist.id.id == \"ghost\") {\n c.plotGhost(this.map);\n } else {\n c.plotMarker(this.map);\n }\n }\n }","axisPlot() {\n this.ctx = this.canvas.getContext(\"2d\");\n\n /**\n * Grid grid\n */\n if (this.grid.grid) {\n this.ctx.beginPath();\n this.ctx.font = 'italic 18pt Calibri';\n this.ctx.strokeStyle = '#979797';\n this.ctx.lineWidth = 1;\n this.ctx.setLineDash([10, 15]);\n for (let i = 30; i < this.field.width; i+= 100) {\n this.ctx.fillText(Math.ceil(this.ScreenToWorldY(i)*1000)/1000, 0, i);\n this.ctx.moveTo(0, i);\n this.ctx.lineTo(this.field.width, i);\n }\n for (let i = 100; i < this.field.width; i+= 100) {\n this.ctx.fillText(Math.ceil(this.ScreenToWorldX(i)*1000)/1000, i, this.field.height);\n this.ctx.moveTo(i, 0);\n this.ctx.lineTo(i, this.field.height);\n }\n this.ctx.stroke();\n this.ctx.closePath();\n }\n\n\n /**\n * Grid axiss\n */\n if (this.grid.axiss) {\n this.ctx.beginPath();\n this.ctx.strokeStyle = '#b10009';\n this.ctx.lineWidth = 2;\n this.ctx.setLineDash([]);\n\n this.ctx.moveTo(this.center.x, 0);\n this.ctx.lineTo(this.center.x, this.field.height);\n\n this.ctx.moveTo(0, this.center.y);\n this.ctx.lineTo(this.field.width, this.center.y);\n\n this.ctx.stroke();\n this.ctx.closePath();\n }\n\n\n if (this.grid.serifs) {\n this.ctx.beginPath();\n this.ctx.strokeStyle = '#058600';\n this.ctx.fillStyle = '#888888'\n this.ctx.lineWidth = 2;\n this.ctx.setLineDash([]);\n\n let start = 0;\n if (!this.grid.serifsStep){\n return;\n }\n\n let s = Math.abs(\n this.ScreenToWorldY(0) -\n this.ScreenToWorldY(this.grid.serifsSize)\n );\n\n /**\n * To right & to left\n */\n if ((this.center.y > 0) && (this.center.y < this.field.height)) {\n\n let finish = this.ScreenToWorldX(this.field.width);\n\n for (let i = start; i < finish; i+=this.grid.serifsStep) {\n this.moveTo(i+this.grid.serifsStep/2,(s/2));\n this.lineTo(i+this.grid.serifsStep/2,-(s/2));\n this.ctx.fillText(i+this.grid.serifsStep/2, this.WorldToScreenX(i+this.grid.serifsStep/2), this.WorldToScreenY(s/2));\n\n this.moveTo(i+this.grid.serifsStep,s);\n this.lineTo(i+this.grid.serifsStep,-s);\n this.ctx.fillText(i+this.grid.serifsStep, this.WorldToScreenX(i+this.grid.serifsStep), this.WorldToScreenY(s));\n }\n\n finish = this.ScreenToWorldX(0);\n\n for (let i = start; i > finish; i-=this.grid.serifsStep) {\n this.moveTo(i-this.grid.serifsStep/2,(s/2));\n this.lineTo(i-this.grid.serifsStep/2,-(s/2));\n this.ctx.fillText(i-this.grid.serifsStep/2, this.WorldToScreenX(i-this.grid.serifsStep/2), this.WorldToScreenY(s/2));\n\n this.moveTo(i-this.grid.serifsStep,s);\n this.lineTo(i-this.grid.serifsStep,-s);\n this.ctx.fillText(i-this.grid.serifsStep, this.WorldToScreenX(i-this.grid.serifsStep), this.WorldToScreenY(s));\n }\n }\n\n /**\n * To top & to bot\n */\n if ((this.center.x > 0) && (this.center.x < this.field.width)) {\n\n start = 0;\n let finish = this.ScreenToWorldY(0);\n\n for (let i = start; i < finish; i+=this.grid.serifsStep) {\n this.moveTo((s/2),i+this.grid.serifsStep/2);\n this.lineTo(-(s/2),i+this.grid.serifsStep/2);\n this.ctx.fillText(i+this.grid.serifsStep/2, this.WorldToScreenX(s/2), this.WorldToScreenY(i+this.grid.serifsStep/2));\n\n this.moveTo(s, i+this.grid.serifsStep);\n this.lineTo(-s, i+this.grid.serifsStep);\n this.ctx.fillText(i+this.grid.serifsStep, this.WorldToScreenX(s), this.WorldToScreenY(i+this.grid.serifsStep));\n }\n\n finish = this.ScreenToWorldY(this.field.width);\n\n for (let i = start; i > finish-this.grid.serifsStep; i-=this.grid.serifsStep) {\n this.moveTo((s/2),i+this.grid.serifsStep/2);\n this.lineTo(-(s/2),i+this.grid.serifsStep/2);\n this.ctx.fillText(i+this.grid.serifsStep/2, this.WorldToScreenX(s/2), this.WorldToScreenY(i+this.grid.serifsStep/2));\n\n this.moveTo(s, i+this.grid.serifsStep);\n this.lineTo( -s, i+this.grid.serifsStep);\n this.ctx.fillText(i+this.grid.serifsStep, this.WorldToScreenX(s), this.WorldToScreenY(i+this.grid.serifsStep));\n }\n }\n this.ctx.stroke();\n this.ctx.closePath();\n }\n }","function plot() {\n \n }","plot() {\n return \"Cute alien takes over the earth\";\n }","function plotGraph() {\n if (houses.data.length > 0) {\n for (let i = 0; i < houses.data.length; i++) {\n xs[i] = map(houses.data[i].inputs[0], 0, zoom, 0, wnx);\n ys[i] = map(houses.data[i].inputs[1], 0, zoom, wny, 200);\n cs[i] = houses.data[i].inputs[8];\n ps[i] = houses.data[i].target[0];\n }\n }\n}","function tick(){\n\n d3.selectAll('.circ')\n .attr('cx', function(d){return d.x})\n .attr('cy', function(d){return d.y})\n\n }","function concentric() {\n let n = 12\n let res = [WIDTH/2, WIDTH/2]\n for (let r = 100; r < 360; r+=60) {\n for (let i=0; i<n; i++) {\n let x = WIDTH/2 + r * Math.cos(360 * 0.0174533 * i/n)\n let y = WIDTH/2 + r * Math.sin(360 * 0.0174533 * i/n)\n res.push(x, y)\n }\n }\n return res\n}","function Cylindrical( radius, theta, y ) {\n\n\tthis.radius = ( radius !== undefined ) ? radius : 1.0; // distance from the origin to a point in the x-z plane\n\tthis.theta = ( theta !== undefined ) ? theta : 0; // counterclockwise angle in the x-z plane measured in radians from the positive z-axis\n\tthis.y = ( y !== undefined ) ? y : 0; // height above the x-z plane\n\n\treturn this;\n\n}","function Cylindrical( radius, theta, y ) {\n\n\tthis.radius = ( radius !== undefined ) ? radius : 1.0; // distance from the origin to a point in the x-z plane\n\tthis.theta = ( theta !== undefined ) ? theta : 0; // counterclockwise angle in the x-z plane measured in radians from the positive z-axis\n\tthis.y = ( y !== undefined ) ? y : 0; // height above the x-z plane\n\n\treturn this;\n\n}","function plot() {\n\n}","function draw_cos(){\n\tvar x_increments = parseFloat(document.getElementById('x_inc').value)\n\tvar y_increments = parseFloat(document.getElementById('y_inc').value)\n\n if (loopcounter !=0){\n\n\t\tif((x_increments != last_x_inc) || (y_increments != last_y_inc)){\n\t\t\tclear();\n\t\t\tdraw_axis();\n\t\t\tdraw_ticks();\n\t\t}\n\tdraw_adjusted_cos_fn()\n\tlast_x_inc = x_increments\n\tlast_y_inc = y_increments\n\t}\n\n\tif (loopcounter == 0){\n\n\t\tdraw_adjusted_cos_fn()\n\t\tlast_x_inc = x_increments\n\t\tlast_y_inc = y_increments\n\t\tloopcounter+=1\n\t}\n\n}","function plotPoints(coords) {\n ctx.fillStyle = 'green';\n console.log(coords);\n ctx.fillRect(coords.y, coords.x, 5, 5);\n}","function drawCartesianOverlay() {\n \"use strict\";\n //Draw heavier black lines for grid\n ctx.beginPath();\n ctx.moveTo(0.5, 300.5);\n ctx.lineTo(800.5, 300.5);\n ctx.moveTo(400.5, 0.5);\n ctx.lineTo(400.5, 600.5);\n ctx.strokeStyle = 'black';\n ctx.lineWidth = 1.0;\n ctx.stroke();\n //-x arrow for line\n ctx.beginPath();\n ctx.moveTo(5.5, 295.5);\n ctx.lineTo(0.5, 300.5);\n ctx.lineTo(5.5, 305.5);\n //+x arrow for line\n ctx.moveTo(795.5, 295.5);\n ctx.lineTo(800.5, 300.5);\n ctx.lineTo(795.5, 305.5);\n //+y arrow for line\n ctx.moveTo(395.5, 5.0);\n ctx.lineTo(400.5, 0.5);\n ctx.lineTo(405.5, 5.0);\n //-y arrow for line\n ctx.moveTo(395.5, 595.5);\n ctx.lineTo(400.5, 600.5);\n ctx.lineTo(405.5, 595.5);\n ctx.strokeStyle = 'black';\n ctx.lineWidth = 1.0;\n ctx.stroke();\n //Label Graphs\n ctx.font = \"9px Georgia\";\n ctx.fillText(\"-x\", 1, 288);\n ctx.fillText(\"+\", 790, 288);\n ctx.fillText(\"x\", 795, 288);\n ctx.fillText(\"-y\", 382, 597);\n ctx.fillText(\"+\", 381, 8);\n ctx.fillText(\"y\", 386, 8);\n}","function trC(coord){\n\treturn -95 + coord*10;\n}","function Courbe(Y){\t\n\t// Remise à zero de la courbe : \n\tvar svg = d3.select(\"#graph\");\n\n\t// scaleY\n\tvar scaleY = d3.scaleLinear();\n\t// J'inverse min et max car pour Y c'est inversé\n\tscaleY.domain([1,0]);\n\tscaleY.range([0,500]);\n\n\t// Axe Y\n\tvar yAxis = d3.axisLeft(scaleY);\n\tvar gyAxis = svg.select(\"#axisX\");\n\tgyAxis.call(yAxis);\n\tgyAxis.attr(\"font-size\",28);\n\tgyAxis.attr(\"transform\",\"translate(50,50)\");\n\t\n\t// scaleX\n\tvar scaleX = d3.scaleLinear();\n\tscaleX.domain([0,24]);\n\tscaleX.range([0,800]);\n\t\n\t// Axe X\n\tvar xAxis = d3.axisBottom(scaleX);\n\tvar gxAxis = svg.select(\"#axisY\");\n\tgxAxis.call(xAxis.ticks(24));\n\tgxAxis.attr(\"font-size\",28);\n\tgxAxis.attr(\"transform\",\"translate(50,550)\");\n\t\n\t// Ajout titres des axes\n\tvar tmp =\"\";\n\ttmp +='<text x=\"450\" y=\"620\" font-size=\"28\" fill=\"black\" style=\"text-anchor: middle\" >Heure</text>';\n\ttmp += ' <text x=\"100\" y=\"0\" font-size=\"28\" fill=\"black\" style=\"text-anchor: middle\" >Flux de sève (mm/h)</text>';\n\tvar titre_axes = document.getElementById(\"texte\");\n\ttitre_axes.innerHTML = tmp;\t\n\n\t// line\n\tvar lValues = d3.line();\n\tlValues.x(function(d,i) { return scaleX(i/2) });\n\tlValues.y(function(d) { return scaleY(d)});\n\tvar gLine = svg.select(\".courbe\")\n\t.attr(\"transform\", \"translate(50,50)\")\n\t.attr(\"stroke\", \"green\")\n\t.attr(\"stroke-width\",2 )\n\t.attr(\"fill\", \"none\")\n\t.transition()\n\t.duration(500)\n\t.on(\"start\", function(d){\n\t\tvar gPoints = document.getElementById(\"points\");\n\t\tgPoints.innerHTML = \"\" ;\t\n\t})\n\t.on(\"end\", function(d){\n\t\t// Ajout des points\n\t\tcir =\"\";\n\t\tfor (j=0;j<Y.length;j++) {\n\t\t\tcir +=' <circle transform = \"translate(50,50)\" onmouseover=\"drawInfoBox('+Y[j]+','+j+','+scaleX(j)+','+scaleY(Y[j])+')\" onmouseleave=\"removeInfoBox()\" \tcx=\"'+scaleX(j/2)+'\" cy=\"'+scaleY(Y[j])+'\" r=\"5\" fill=\"green\" />' ;\n\t\t}\n\t\tvar gPoints = document.getElementById(\"points\");\n\t\tgPoints.innerHTML = cir ;\t\t\n\t})\n\t.attr(\"d\", lValues(Y));\t\t\n}","function drawcylinder(gl,canvas,a_Position,r,s,x1,y1,x2,y2,numpolyline){\r\n Acolor = 1 - (numpolyline/255) \r\n // ** DRAW CYLINDERS **\r\n //\r\n // multiply degrees by convert to get value in radians \r\n // a circle is 360 degrees, rotate by (360 / s) degrees for every side, where n is number of sides!\r\n let convert = Math.PI/180 \r\n let numsides = 360/s\r\n\r\n // get the angle that the line segment forms\r\n let deltaX = x2-x1\r\n let deltaY = y2-y1 \r\n let degreeToRotate = Math.atan2(deltaY,deltaX)\r\n degreeToRotate = ((2* Math.PI)-degreeToRotate)\r\n \r\n // first we'll draw a circle by rotating around the x axis, then use a transformation matrix to rotate it\r\n // by the angle we found previously so the circle fits around the axis formed by the line segment\r\n let unrotated = []\r\n\r\n for (var i=0 ; i <=360; i+=numsides){ \r\n unrotated.push(0)\r\n unrotated.push((Math.cos(convert*i))*r)\r\n unrotated.push(Math.sin(convert*i)*r)\r\n } \r\n let cylinder_points = [] \r\n let indices = []\r\n let colors = []\r\n let normie = []\r\n //first circle\r\n for (var i = 0 ; i < unrotated.length; i+=3){\r\n cylinder_points.push((unrotated[i] * Math.cos(degreeToRotate)) + (unrotated[i+1] * Math.sin(degreeToRotate)) + x1) \r\n cylinder_points.push((unrotated[i] * (-1 * Math.sin(degreeToRotate))) + (unrotated[i+1] * Math.cos(degreeToRotate)) + y1)\r\n cylinder_points.push(unrotated[i+2])\r\n }\r\n\r\n // second circle\r\n for (var i = 0 ; i < unrotated.length; i+=3){\r\n cylinder_points.push((unrotated[i] * Math.cos(degreeToRotate)) + (unrotated[i+1] * Math.sin(degreeToRotate)) + x2) \r\n cylinder_points.push((unrotated[i] * (-1 * Math.sin(degreeToRotate))) + (unrotated[i+1] * Math.cos(degreeToRotate)) + y2)\r\n cylinder_points.push(unrotated[i+2])\r\n }\r\n\r\n \r\n //calculate face normals from cylinder points \r\n let cylindernormals = calcnormals(gl,canvas,a_Position,r,s,x1,y1,x2,y2,cylinder_points) \r\n // n+1th normal (the point that comes after the last point is the same as the first point) \r\n cylindernormals.push(cylindernormals[0])\r\n cylindernormals.push(cylindernormals[1])\r\n cylindernormals.push(cylindernormals[2])\r\n cylinder_points = []\r\n colors = []\r\n \r\n cylinder_points.push((unrotated[0] * Math.cos(degreeToRotate)) + (unrotated[1] * Math.sin(degreeToRotate)) + x1) \r\n cylinder_points.push((unrotated[0] * (-1 * Math.sin(degreeToRotate))) + (unrotated[1] * Math.cos(degreeToRotate)) + y1)\r\n cylinder_points.push(unrotated[2])\r\n normie.push((cylindernormals[0]+cylindernormals[27]) / 2)\r\n normie.push((cylindernormals[1]+cylindernormals[28]) / 2)\r\n normie.push((cylindernormals[2]+cylindernormals[29]) / 2)\r\n colors.push(Rcolor)\r\n colors.push(Gcolor)\r\n colors.push(Bcolor)\r\n colors.push(Acolor)\r\n\r\n\r\n for (var i = 1 ; i < s+1; i++){\r\n cylinder_points.push((unrotated[3*i] * Math.cos(degreeToRotate)) + (unrotated[3*i+1] * Math.sin(degreeToRotate)) + x1) \r\n cylinder_points.push((unrotated[3*i] * (-1 * Math.sin(degreeToRotate))) + (unrotated[3*i+1] * Math.cos(degreeToRotate)) + y1)\r\n cylinder_points.push(unrotated[3*i+2])\r\n normie.push((cylindernormals[3*i]+cylindernormals[3*(i-1)])/2) \r\n normie.push((cylindernormals[3*i+1]+cylindernormals[3*(i-1)+1])/2) \r\n normie.push((cylindernormals[3*i+2]+cylindernormals[3*(i-1)+2])/2) \r\n colors.push(Rcolor)\r\n colors.push(Gcolor)\r\n colors.push(Bcolor)\r\n colors.push(Acolor)\r\n }\r\n // second circle\r\n cylinder_points.push((unrotated[0] * Math.cos(degreeToRotate)) + (unrotated[1] * Math.sin(degreeToRotate)) + x2) \r\n cylinder_points.push((unrotated[0] * (-1 * Math.sin(degreeToRotate))) + (unrotated[1] * Math.cos(degreeToRotate)) + y2)\r\n cylinder_points.push(unrotated[2])\r\n normie.push((cylindernormals[0]+cylindernormals[27]) / 2)\r\n normie.push((cylindernormals[1]+cylindernormals[28]) / 2)\r\n normie.push((cylindernormals[2]+cylindernormals[29]) / 2)\r\n colors.push(Rcolor)\r\n colors.push(Gcolor)\r\n colors.push(Bcolor)\r\n colors.push(Acolor)\r\n for (var i = 1 ; i < s+1; i++){\r\n cylinder_points.push((unrotated[3*i] * Math.cos(degreeToRotate)) + (unrotated[3*i+1] * Math.sin(degreeToRotate)) + x2) \r\n cylinder_points.push((unrotated[3*i] * (-1 * Math.sin(degreeToRotate))) + (unrotated[3*i+1] * Math.cos(degreeToRotate)) + y2)\r\n cylinder_points.push(unrotated[3*i+2])\r\n normie.push((cylindernormals[3*i]+cylindernormals[3*(i-1)])/2) \r\n normie.push((cylindernormals[3*i+1]+cylindernormals[3*(i-1)+1])/2) \r\n normie.push((cylindernormals[3*i+2]+cylindernormals[3*(i-1)+2])/2) \r\n colors.push(Rcolor)\r\n colors.push(Gcolor)\r\n colors.push(Bcolor)\r\n colors.push(Acolor)\r\n }\r\n\r\n // 2 points to represent the center\r\n cylinder_points.push(x2) \r\n cylinder_points.push(y2)\r\n cylinder_points.push(0)\r\n colors.push(Rcolor)\r\n colors.push(Gcolor)\r\n colors.push(Bcolor)\r\n colors.push(Acolor)\r\n\r\n let len = cylinder_points.length/6\r\n // cool traiangles\r\n for (var i=0 ; i < s; i++){\r\n indices.push(i)\r\n indices.push(i+1) \r\n indices.push(len+i)\r\n indices.push(i)\r\n \r\n indices.push(i+1)\r\n indices.push(i)\r\n indices.push(len+i+1)\r\n indices.push(i+1)\r\n\r\n indices.push(len+i+1)\r\n indices.push(len+i) \r\n indices.push(i+1)\r\n indices.push(len+i+1)\r\n }\r\n\r\n var n = initVertexBuffers(gl,cylinder_points,colors,normie,indices)\r\n if (n<0){\r\n console.log('failed to set vert info')\r\n return\r\n }\r\n // Set the clear color and enable the depth test\r\n gl.enable(gl.DEPTH_TEST);\r\n initAttrib(gl,canvas,numpolyline)\r\n\r\n //draw the cylinder!\r\n gl.drawElements(gl.TRIANGLES, n, gl.UNSIGNED_BYTE, 0);\r\n \r\n\r\n // ** DRAW CAP **\r\n // (FOR SMOOTH EDGES) \r\n let cap_points = []\r\n if (previousFace.length < 1){\r\n // second circle\r\n for (var i = 0 ; i < s+1 ; i++){\r\n previousFace.push((unrotated[3*i] * Math.cos(degreeToRotate)) + (unrotated[3*i+1] * Math.sin(degreeToRotate)) + x2) \r\n previousFace.push((unrotated[3*i] * (-1 * Math.sin(degreeToRotate))) + (unrotated[3*i+1] * Math.cos(degreeToRotate)) + y2)\r\n previousFace.push(unrotated[3*i+2])\r\n }\r\n return\r\n } \r\n for (var j=0 ; j < previousFace.length ;j++){\r\n cap_points.push(previousFace[j]) \r\n }\r\n previousFace = []\r\n for (var i = 0 ; i < s+1 ; i++){\r\n cap_points.push((unrotated[3*i] * Math.cos(degreeToRotate)) + (unrotated[3*i+1] * Math.sin(degreeToRotate)) + x1) \r\n cap_points.push((unrotated[3*i] * (-1 * Math.sin(degreeToRotate))) + (unrotated[3*i+1] * Math.cos(degreeToRotate)) + y1)\r\n cap_points.push(unrotated[3*i+2])\r\n }\r\n for (var i = 0 ; i < s+1 ; i++){\r\n previousFace.push((unrotated[3*i] * Math.cos(degreeToRotate)) + (unrotated[3*i+1] * Math.sin(degreeToRotate)) + x2) \r\n previousFace.push((unrotated[3*i] * (-1 * Math.sin(degreeToRotate))) + (unrotated[3*i+1] * Math.cos(degreeToRotate)) + y2)\r\n previousFace.push(unrotated[3*i+2])\r\n }\r\n var capvertices = new Float32Array(cap_points)\r\n let caplen = capvertices.length/14;\r\n if (caplen === 0)\r\n return\r\n var n = initVertexBuffers(gl,capvertices,colors,normie,indices)\r\n if (n<0){\r\n console.log('failed to set vert info')\r\n return\r\n }\r\n // Set the clear color and enable the depth test\r\n gl.enable(gl.DEPTH_TEST);\r\n initAttrib(gl,canvas,numpolyline)\r\n //draw the cylinder!\r\n gl.drawElements(gl.TRIANGLES, n, gl.UNSIGNED_BYTE, 0);\r\n}","function plotGrid() {\n for (let i = 0; i < grid.length; i++) {\n for (let j = 0; j < grid[i].length; j++) {\n plotRectangle(i, j);\n }\n }\n }","function draw_axis(c){\n\n let yplot = 40;\n let d =0;\n\n c.beginPath();\n c.strokeStyle = \"blue\";\n \n c.moveTo(count_block(5),count_block(5));\n c.lineTo(count_block(5), count_block(40));\n c.lineTo(count_block(80), count_block(40));\n\n c.moveTo(count_block(5), count_block(40));\n \n \n\n //loop for the y-axix labels\n for(let i = 1 ;i<=10;i++ ){\n c.strokeText(d, count_block(2), count_block(yplot));\n yplot-=5;\n d+=500;\n }\n c.stroke();\n\n}","function draw_axis(c){\n\n let yplot = 40;\n let d =0;\n\n c.beginPath();\n c.strokeStyle = \"black\";\n \n c.moveTo(count_block(5),count_block(5));\n c.lineTo(count_block(5), count_block(40));\n c.lineTo(count_block(80), count_block(40));\n\n c.moveTo(count_block(5), count_block(40));\n \n \n\n //loop for the y-axix labels\n for(let i = 1 ;i<=10;i++ ){\n c.strokeText(d, count_block(2), count_block(yplot));\n yplot-=5;\n d+=500;\n }\n c.stroke();\n\n}","circumcenter(ax, ay, bx, by, cx, cy) \n {\n bx -= ax;\n by -= ay;\n cx -= ax;\n cy -= ay;\n\n var bl = bx * bx + by * by;\n var cl = cx * cx + cy * cy;\n\n var d = bx * cy - by * cx;\n\n var x = (cy * bl - by * cl) * 0.5 / d;\n var y = (bx * cl - cx * bl) * 0.5 / d;\n\n return {\n x: ax + x,\n y: ay + y\n };\n }","function draw() {\n \n // background(237, 34, 93);\n for(let i = 0; i < h; i += 10) {\n for(let j = 0; j < w; j+= 10) {\n // if(i == cx[counting] && j == cy[counting]) {\n point_color = 222;\n strokeWeight(1);\n stroke(point_color);\n point(cx[counting],cy[counting])\n counting++;\n // } \n } \n // line(i, 0, i, h)\n counting = 0;\n }\n\n \n}","function drawcylinder(gl,canvas,a_Position,r,s,x1,y1,x2,y2){\r\n\r\n // ** DRAW CYLINDERS **\r\n //\r\n\r\n // multiply degrees by convert to get value in radians \r\n // a circle is 360 degrees, rotate by (360 / s) degrees for every side, where n is number of sides!\r\n const convert = Math.PI/180 \r\n const numsides = 360/s\r\n\r\n // get the angle that the line segment forms\r\n const deltaX = x2-x1\r\n const deltaY = y2-y1 \r\n let degreeToRotate = Math.atan2(deltaY,deltaX)\r\n degreeToRotate = ((2*Math.PI)-degreeToRotate)\r\n \r\n // first we'll draw a circle by rotating around the x axis, then use a transformation matrix to rotate it\r\n // by the angle we found previously so the circle fits around the axis formed by the line segment\r\n let unrotated = []\r\n\r\n for (var i=0 ; i <=360; i+=numsides){ \r\n unrotated.push(0)\r\n unrotated.push((Math.cos(convert*i))*r)\r\n unrotated.push(Math.sin(convert*i)*r)\r\n } \r\n for (var i=0 ; i <=360; i+=numsides){ \r\n unrotated.push(0)\r\n unrotated.push((Math.cos(convert*i))*r)\r\n unrotated.push(Math.sin(convert*i)*r)\r\n } \r\n\r\n // OUR ROTATIONAL MATRIX (Rotating around the Z axis):\r\n // cos sin (0)\r\n // -sin cos (0)\r\n // 0 0 1 \r\n \r\n // first circle\r\n for (var i = 0 ; i < unrotated.length/2 ; i+=3){\r\n cylinder_points.push((unrotated[i] * Math.cos(degreeToRotate)) + (unrotated[i+1] * Math.sin(degreeToRotate)) + x1) \r\n cylinder_points.push((unrotated[i] * (-1 * Math.sin(degreeToRotate))) + (unrotated[i+1] * Math.cos(degreeToRotate)) + y1)\r\n cylinder_points.push(unrotated[i+2])\r\n cylinder_points.push(Rcolor)\r\n cylinder_points.push(Gcolor)\r\n cylinder_points.push(Bcolor)\r\n cylinder_points.push(Acolor)\r\n }\r\n // second circle\r\n for (var i = unrotated.length/2; i < unrotated.length; i+=3){\r\n cylinder_points.push((unrotated[i] * Math.cos(degreeToRotate)) + (unrotated[i+1] * Math.sin(degreeToRotate)) +x2) \r\n cylinder_points.push((unrotated[i] * (-1 * Math.sin(degreeToRotate))) + (unrotated[i+1] * Math.cos(degreeToRotate)) +y2)\r\n cylinder_points.push(unrotated[i+2])\r\n cylinder_points.push(Rcolor)\r\n cylinder_points.push(Gcolor)\r\n cylinder_points.push(Bcolor)\r\n cylinder_points.push(Acolor)\r\n }\r\n let cylindernormals = calcnormals(gl,canvas,a_Position,r,s,x1,y1,x2,y2,cylinder_points) \r\n console.log(cylindernormals)\r\n // actually apply shading after calculating surface normals\r\n let colors = []\r\n // Lambertan Shading Ld = kD * I * Max(0,n dot vl)\r\n light1V = normalize(light1V)\r\n light2V = normalize(light2V)\r\n // now both the light and surface normal are length 1 \r\n \r\n let currentsurfacecolor = findsurfacecolor(light1C,defaultcolor)\r\n if (whiteLightBox.checked){\r\n colors = calculateColors(cylindernormals,light1V,currentsurfacecolor) \r\n }\r\n\r\n if (redLightBox.checked){ \r\n if (whiteLightBox.checked){\r\n currentsurfacecolor = findsurfacecolor (light2C,currentsurfacecolor)\r\n colors = calculateColors(cylindernormals,light2V,currentsurfacecolor) \r\n }\r\n else{\r\n currentsurfacecolor = findsurfacecolor (light2C,defaultcolor)\r\n colors = calculateColors(cylindernormals,light2V,currentsurfacecolor) \r\n }\r\n }\r\n cylinder_points = []\r\n if (colors.length == 0){\r\n console.log (\"Try Turning on a light!\")\r\n return\r\n }\r\n colors.push(colors[0]) \r\n\r\n for (var i = 0 ; i < s ; i++){\r\n cylinder_points.push((unrotated[3*i] * Math.cos(degreeToRotate)) + (unrotated[3*i+1] * Math.sin(degreeToRotate)) + x1) \r\n cylinder_points.push((unrotated[3*i] * (-1 * Math.sin(degreeToRotate))) + (unrotated[3*i+1] * Math.cos(degreeToRotate)) + y1)\r\n cylinder_points.push(unrotated[3*i+2])\r\n cylinder_points.push(colors[i][0])\r\n cylinder_points.push(colors[i][1])\r\n cylinder_points.push(colors[i][2])\r\n cylinder_points.push(colors[i][3])\r\n cylinder_points.push((unrotated[3*i+3] * Math.cos(degreeToRotate)) + (unrotated[3*i+4] * Math.sin(degreeToRotate)) + x1)\r\n cylinder_points.push((unrotated[3*i+3] * (-1 * Math.sin(degreeToRotate))) + (unrotated[3*i+4] * Math.cos(degreeToRotate)) + y1)\r\n cylinder_points.push(unrotated[3*i+5])\r\n cylinder_points.push(colors[i][0])\r\n cylinder_points.push(colors[i][1])\r\n cylinder_points.push(colors[i][2])\r\n cylinder_points.push(colors[i][3])\r\n }\r\n // second circle\r\n for (var i = 0 ; i < s ; i++){\r\n cylinder_points.push((unrotated[3*i] * Math.cos(degreeToRotate)) + (unrotated[3*i+1] * Math.sin(degreeToRotate)) + x2) \r\n cylinder_points.push((unrotated[3*i] * (-1 * Math.sin(degreeToRotate))) + (unrotated[3*i+1] * Math.cos(degreeToRotate)) + y2)\r\n cylinder_points.push(unrotated[3*i+2])\r\n cylinder_points.push(colors[i][0])\r\n cylinder_points.push(colors[i][1])\r\n cylinder_points.push(colors[i][2])\r\n cylinder_points.push(colors[i][3])\r\n cylinder_points.push((unrotated[3*i+3] * Math.cos(degreeToRotate)) + (unrotated[3*i+4] * Math.sin(degreeToRotate)) + x2)\r\n cylinder_points.push((unrotated[3*i+3] * (-1 * Math.sin(degreeToRotate))) + (unrotated[3*i+4] * Math.cos(degreeToRotate)) + y2)\r\n cylinder_points.push(unrotated[3*i+5])\r\n cylinder_points.push(colors[i][0])\r\n cylinder_points.push(colors[i][1])\r\n cylinder_points.push(colors[i][2])\r\n cylinder_points.push(colors[i][3])\r\n }\r\n\r\n let len = cylinder_points.length/14;\r\n let indices = []\r\n // cool traiangles\r\n for (var i=0 ; i < s; i++){\r\n\r\n indices.push(i)\r\n indices.push(i+1) \r\n indices.push(len+i)\r\n indices.push(i)\r\n \r\n indices.push(i+1)\r\n indices.push(i)\r\n indices.push(len+i+1)\r\n indices.push(i+1)\r\n\r\n indices.push(len+i+1)\r\n indices.push(len+i) \r\n indices.push(i+1)\r\n indices.push(len+i+1)\r\n\r\n\r\n }\r\n\r\n var vertices = new Float32Array(cylinder_points)\r\n setVertexBuffer(gl, new Float32Array(vertices))\r\n setIndexBuffer(gl, new Uint16Array(indices))\r\n // draw cylinder\r\n gl.drawElements(gl.TRIANGLES, indices.length, gl.UNSIGNED_SHORT, 0) \r\n //draw normal vectors ! (if applicable)\r\n calcnormals(gl,canvas,a_Position,r,s,x1,y1,x2,y2,cylinder_points) \r\n cylinder_points = []\r\n\r\n\r\n\r\n // ** DRAW CAP **\r\n // (FOR SMOOTH EDGES) \r\n\r\n let cap_points = []\r\n if (previousFace.length < 1){\r\n // second circle\r\n for (var i = 0 ; i < s ; i++){\r\n previousFace.push((unrotated[3*i] * Math.cos(degreeToRotate)) + (unrotated[3*i+1] * Math.sin(degreeToRotate)) + x2) \r\n previousFace.push((unrotated[3*i] * (-1 * Math.sin(degreeToRotate))) + (unrotated[3*i+1] * Math.cos(degreeToRotate)) + y2)\r\n previousFace.push(unrotated[3*i+2])\r\n previousFace.push(colors[i][0])\r\n previousFace.push(colors[i][1])\r\n previousFace.push(colors[i][2])\r\n previousFace.push(colors[i][3])\r\n previousFace.push((unrotated[3*i+3] * Math.cos(degreeToRotate)) + (unrotated[3*i+4] * Math.sin(degreeToRotate)) + x2)\r\n previousFace.push((unrotated[3*i+3] * (-1 * Math.sin(degreeToRotate))) + (unrotated[3*i+4] * Math.cos(degreeToRotate)) + y2)\r\n previousFace.push(unrotated[3*i+5])\r\n previousFace.push(colors[i][0])\r\n previousFace.push(colors[i][1])\r\n previousFace.push(colors[i][2])\r\n previousFace.push(colors[i][3])\r\n }\r\n return\r\n } \r\n for (var j=0 ; j < previousFace.length ;j++){\r\n cap_points.push(previousFace[j]) \r\n }\r\n\r\n previousFace = []\r\n for (var i = 0 ; i < s ; i++){\r\n cap_points.push((unrotated[3*i] * Math.cos(degreeToRotate)) + (unrotated[3*i+1] * Math.sin(degreeToRotate)) + x1) \r\n cap_points.push((unrotated[3*i] * (-1 * Math.sin(degreeToRotate))) + (unrotated[3*i+1] * Math.cos(degreeToRotate)) + y1)\r\n cap_points.push(unrotated[3*i+2])\r\n cap_points.push(colors[i][0])\r\n cap_points.push(colors[i][1])\r\n cap_points.push(colors[i][2])\r\n cap_points.push(colors[i][3])\r\n cap_points.push((unrotated[3*i+3] * Math.cos(degreeToRotate)) + (unrotated[3*i+4] * Math.sin(degreeToRotate)) + x1)\r\n cap_points.push((unrotated[3*i+3] * (-1 * Math.sin(degreeToRotate))) + (unrotated[3*i+4] * Math.cos(degreeToRotate)) + y1)\r\n cap_points.push(unrotated[3*i+5])\r\n cap_points.push(colors[i][0])\r\n cap_points.push(colors[i][1])\r\n cap_points.push(colors[i][2])\r\n cap_points.push(colors[i][3])\r\n }\r\n for (var i = 0 ; i < s ; i++){\r\n previousFace.push((unrotated[3*i] * Math.cos(degreeToRotate)) + (unrotated[3*i+1] * Math.sin(degreeToRotate)) + x2) \r\n previousFace.push((unrotated[3*i] * (-1 * Math.sin(degreeToRotate))) + (unrotated[3*i+1] * Math.cos(degreeToRotate)) + y2)\r\n previousFace.push(unrotated[3*i+2])\r\n previousFace.push(colors[i][0])\r\n previousFace.push(colors[i][1])\r\n previousFace.push(colors[i][2])\r\n previousFace.push(colors[i][3])\r\n previousFace.push((unrotated[3*i+3] * Math.cos(degreeToRotate)) + (unrotated[3*i+4] * Math.sin(degreeToRotate)) + x2)\r\n previousFace.push((unrotated[3*i+3] * (-1 * Math.sin(degreeToRotate))) + (unrotated[3*i+4] * Math.cos(degreeToRotate)) + y2)\r\n previousFace.push(unrotated[3*i+5])\r\n previousFace.push(colors[i][0])\r\n previousFace.push(colors[i][1])\r\n previousFace.push(colors[i][2])\r\n previousFace.push(colors[i][3])\r\n }\r\n var capvertices = new Float32Array(cap_points)\r\n let caplen = capvertices.length/14;\r\n if (caplen === 0)\r\n return\r\n setVertexBuffer(gl, new Float32Array(cap_points))\r\n setIndexBuffer(gl, new Uint16Array(indices))\r\n // draw caps \r\n gl.drawElements(gl.TRIANGLES, indices.length, gl.UNSIGNED_SHORT, 0)\r\n}","function displayCoord(a) {\r\n\t\tc.beginPath();\r\n\t\tc.moveTo(parseInt(a[0],10)-3,output(parseInt(a[1],10)-3));\r\n\t\tc.lineTo(parseInt(a[0],10)+3,output(parseInt(a[1],10)+3));\r\n\t\tc.stroke();\r\n\t\tc.beginPath();\r\n\t\tc.moveTo(parseInt(a[0],10)-3,output(parseInt(a[1],10)+3));\r\n\t\tc.lineTo(parseInt(a[0],10)+3,output(parseInt(a[1],10)-3));\r\n\t\tc.stroke();\r\n\t\tif (showCoordsCheck) c.fillText(\"(\"+a[0]+\",\"+a[1]+\")\",parseInt(a[0],10)+10,output(parseInt(a[1],10)+10));\r\n\t}","function equilatGrid(L,R,dx,dy){\n let yVals = [];\n let ytip = 70;\n let xtip = 300;\n let yChange = dy/10;\n let xChange = 2*dx/10\n for(let i = 0; i < 9; i++){\n yVals.push((ytip+dy)-yChange*(i+1));\n }\n push();\n let x1, x2, y1, y2;\n // Carrier grid\n stroke(255,100,0,80);\n for(let i = 0; i < yVals.length; i++){\n y1 = yVals[i];\n x1 = (y1-L[1])/L[0];\n y2 = ytip + dy;\n x2 = (xtip-dx) + xChange*(i+1);\n line(x1,y1,x2,y2);\n }\n \n // Solvent grid\n stroke(128,0,128,80);\n for(let i = 0; i < yVals.length; i++){\n y1 = yVals[i];\n x1 = (y1-R[1])/R[0];\n y2 = ytip + dy;\n x2 = (xtip+dx) - xChange*(i+1);\n line(x1,y1,x2,y2);\n }\n // Solute grid\n stroke(0,0,255,80);\n for(let i = 0; i < yVals.length; i++){\n y1 = yVals[i];\n x1 = (y1-L[1])/L[0];\n y2 = y1;\n x2 = (y2-R[1])/R[0];\n line(x1,y1,x2,y2);\n }\n pop();\n}","function plot(rows = 36, cols = 64) {\n\n /* 'c' will contain the whole generated html rect tags string to change innerhtml of enclosing div */\n /* 'y' will denote the 'y' coordinate where the next grid must be placed */\n let c = \"\", y = 0;\n\n /* Looping for each row */\n for (let i = 0; i < rows; i++) {\n\n /* 'x' is a coordinate denoting where the next grid must be placed */\n var x = 0;\n\n /* For each row we will loop for each column present in the Grid */\n for (let j = 0; j < cols; j++) {\n\n /* 'colr' will store the rest grid color which is dark gray currently */\n let colr = grid_color;\n\n /* If the Rectange present in the grid is on the border side then change the color in order to highlight borders */\n if(i === 0 || j === 0 || i === rows - 1 || j === cols - 1){\n colr = border_color;\n }\n\n /* Creating a rect tag that is appending in 'c' for now and will be updated to innerhtml of enclosing div */\n /* I know you will be wondering about the id given to each rect :-\n * Each rect must be provided with id in order to do anything with the corresponding rect.\n * Operations like coloring the grid as well saving saving any number in corresponding matrix needs an id of the rect.\n * Hence id is important to allot to each rect to make further changes in matrix on which whole algo is based.\n * In order to assing every rect id i decided to allot their corresponding row_number + : + col_number to be as id\n * As with this scenario it is easy to remember and will be unique for every rect tag. \n */\n c += `<rect id=${i + \":\" + j} x=\"${x}\" y=\"${y}\" width=\"30\" height=\"30\" fill=\"${colr}\" r=\"0\" rx=\"0\" ry=\"0\" stroke=\"#000\" style=\"-webkit-tap-highlight-color: rgba(0, 0, 0, 0); stroke-opacity: 0.2;\" stroke-opacity=\"0.2\"></rect>`;\n\n /* Incrementing the 'x' coordinate as we have width of 30px and hence 'x' coordinate for next rect will be +30 from current pos. */\n x += 30;\n }\n\n /* Incrementing the 'y' coordinate as we have placed sufficient rect in 1 row now need to advance 'y' as height of each rect \n is 30px hence for every rect in next column the y coordinate will be +30*/\n y += 30;\n }\n\n /* At last after creating rect tags using loops, now update innerHtml of enclosing div with id='container'[grid.html] */\n document.getElementById(\"container\").innerHTML = c;\n\n /* I wanted to preplace the Source - coordinate so at rect with id='src_crd' will be coloured green */\n document.getElementById(src_crd).style.fill = \"rgb(0, 255, 0)\";\n matrix[split(src_crd, 0)][split(src_crd, 1)] = 1; /* Update the pos as '1' to denote source location */\n\n /* I wanted to preplace the Destination - coordinate so at rect with id='dst_crd' will be coloured Red */\n document.getElementById(dst_crd).style.fill = \"rgb(255, 0, 0)\";\n matrix[split(dst_crd, 0)][split(dst_crd, 1)] = 2; /* Update the pos as '2' to denote Destination location */\n\n }","draw_axes(gfx) {\n // Drawing in white\n gfx.noFill();\n gfx.stroke(255);\n\n // Draw the unit circle (width and height 2)\n gfx.ellipse(0, 0, 2, 2);\n\n // Draw x- and y-axes\n gfx.line(-10, 0, 10, 0);\n gfx.line(0, -10, 0, 10);\n }","constructor(x1, y1, x2, y2, c)\n {\n this.x1 = x1;\n this.y1 = y1;\n this.x2 = x2;\n this.y2 = y2;\n this.c = c;\n }","show() {\n fill(255);\n noStroke();\n let sx = map(this.x/this.z, 0, 1, 0, width);\n let sy = map(this.y/this.z, 0, 1, 0, height);\n let r = map(this.z, 0, width, 8, 0);\n //ellipse(sx, sy, r, r);\n stroke(255);\n let px = map(this.x/this.pz, 0, 1, 0, width);\n let py = map(this.y/this.pz, 0, 1, 0, height);\n line(px,py, sx, sy);\n this.pz = this.z;\n }","function ColorPlot(canvasId) {\n\tif(typeof(canvasId) === 'undefined' ) \n\t\tcanvasId = \"plotcanvas\";\n\n\tthis.canvasId = canvasId; \n\t\t\n\tthis.minX = 0;\n\tthis.maxX = 10;\n\tthis.scaleX = 1;\n\tthis.scaleY = 1;\n\tthis.minY = 0;\n\tthis.maxY = 1.5;\t\n\tthis.minZ = 0;\n\tthis.maxZ = 1;\n\t\t \n\tthis.x = new Array();\n\tthis.y= new Array();\n\tthis.z= new Array();\n\t\n\tthis.cmap = this.colormap();\n\t\n\tvar canvas = document.getElementById(this.canvasId);\n\tthis.buffer = document.createElement('canvas');\n\tthis.buffer.width = canvas.width;\n\tthis.buffer.height = canvas.height;\n\t\n\tthis.viewX = 0;\n\tthis.viewY = 0;\n\n}","function drawPCGraph() {\r\n\r\n\tvar x = d3.scale.ordinal().rangePoints([0, 480], 1),\r\n y= {};\r\n \r\n for (var dim in cars[0]) {\r\n\t if (dim != \"name\") {\r\n\t\t y[dim] = d3.scale.linear()\r\n\t\t\t .domain([d3.min(cars, function(d) { return +d[dim]; }), d3.max(cars, function(d) { return +d[dim]; })])\r\n\t\t .range([height,0]);\r\n\t }\r\n }\r\n \r\n//sets the x domain dimensions\r\n x.domain(dimensions = d3.keys(cars[0]).filter(function(d) { return d != \"name\";}));\r\n\r\n//draws the polylines\r\n for (var i=1; i< cars.length; i++) { //for each car\r\n\r\n//prepare the coordinates for a polyline\r\n\t var lineData = []; //initialize an array for coordinates of a polyline\r\n\t for (var prop in cars[0]) { \r\n\t if (prop != \"name\" ) {\r\n\t var point = {}; \r\n\t var val = cars[i][prop];\r\n\t\t point['x'] = x(prop); \r\n\t point['y'] = y[prop](val);\r\n\t lineData.push(point);\r\n\t }\r\n\t }\r\n\r\n//draws a polyline based on the coordindates \r\n chart.append(\"g\")\r\n\t .attr(\"class\", \"polyline\")\r\n\t .append(\"path\")\r\n\t\t .attr(\"d\", line(lineData))\r\n\t\r\n//Changes stroke red when mouseover\r\n\t.on(\"mouseover\", function(){\r\n\t\t\td3.select(this)\r\n\t\t.style(\"stroke\",\"red\")\r\n\t })\r\n\t.on(\"mouseout\", function(){\r\n\t\td3.select(this)\r\n\t\t.style(\"stroke\",null)\r\n\t\t\r\n})\r\n }\r\n\r\n var g = chart.selectAll(\".dimension\")\r\n\t .data(dimensions)\r\n\t .enter().append(\"g\")\r\n\t .attr(\"class\", \"dimension\")\r\n\t .attr(\"transform\", function(d) { return \"translate(\" + x(d) + \")\"; }) //translate each axis\r\n\r\n g.append(\"g\")\r\n\t .attr(\"class\", \"axis\")\r\n\t .each(function(d) { d3.select(this).call(axis.scale(y[d])); })\r\n\t .append(\"text\")\r\n\t .style(\"text-anchor\", \"middle\")\r\n\t .attr(\"y\", -4)\r\n\t .text(function(d) { return d; });\r\n\t \r\n \r\n}","function show(c, r, l) {\n var col = l.rgb();\n var str = '(' + col.r + ', ' + col.g + ', ' + col.b + ')';\n\n document.getElementById('xcoord').innerHTML = c[0];\n document.getElementById('ycoord').innerHTML = c[1];\n document.getElementById('radius').innerHTML = r;\n document.getElementById('current-color').innerHTML = l.hex();\n document.getElementById('rgb-color').innerHTML = str;\n}","function plot(x) { \n var canvas = document.getElementById(\"canvas\"); \n var c = canvas.getContext(\"2d\"); \n var canvasStyle = window.getComputedStyle(canvas, null); \n var width = parseInt(canvasStyle.width);\n var height= parseInt(canvasStyle.height); \n var offset = (1 / (x.length - 1)) * width;\n var maxX = x.reduce(function(a, b) { return Math.max(a, b);});\n var minX = x.reduce(function(a, b) { return Math.min(a, b);});\n // scale the input values to be plotted\n function drawToScale(input) {\n return height - ( (input-minX)*height) / (maxX-minX); \n } \n // remove the previuous lines\n c.clearRect(0, 0, width, height) \n // plot the new ones\n c.beginPath();\n c.moveTo(0, drawToScale(x[0]));\n for (var i = 1; i < x.length; i++) {\n c.lineTo(i * offset, drawToScale(x[i]) );\n }\n c.stroke();\n }","function Circular() {\n\tvar D = document.getElementById(\"D\").value;\n\tvar Area, Cx, Cy, Ixx, Iyy;\n\tif (D == undefined) {\n\t\talert: \"Please Enter a Valid input\";\n\t}\n\tArea = 3.14 * D * D / 4;\n\tCx = 0;\n\tCy = 0;\n\tIxx = (3.14 / 64) * Math.pow(D,4);\n\tIyy = Ixx;\n\tdocument.getElementById(\"area\").innerHTML = Area + \" m^2\";\n\tdocument.getElementById(\"cog-x\").innerHTML = Cx + \" m\";\n\tdocument.getElementById(\"cog-y\").innerHTML = Cy + \" m\";\n\tdocument.getElementById(\"moi-xx\").innerHTML = Ixx + \" m^4\";\n\tdocument.getElementById(\"moi-yy\").innerHTML = Iyy + \" m^4\";\n}","function drawGridCentre(x,y,s,rot){\r\n ctx.save();\r\n ctx.translate(x,y);\r\n ctx.rotate(rot*Math.PI/180);\r\n drawCircle(0,0,20, colArray[0], colArray[0], 2, false, true);\r\n for(j = 0; j<7 ; j++){\r\n for(var i = 0 ; i<7 ; i++){\r\n drawRectangle(0-s/2+i*s/7,0-s/2+j*s/7, s/7,s/7,colArray[3], colArray[4],0.5, false, true);\r\n }\r\n }\r\n ctx.restore();\r\n}","function plot(x,y,color){\n ctx.fillStyle = color;\n ctx.fillRect(x,y,1,1);\n }","function plot(data) {\r\n\tconvertData(data);\r\n\tcreateScales(data);\r\n\taddAxes();\r\n\taddGridlines();\r\n\tgroupDataByMainLifts(data);\r\n\tgroupDataByBw(data);\r\n\tdrawLines(mainLiftData);\r\n\tdrawLineLabels(mainLiftData);\r\n\tdrawBwLine(bwData)\r\n\tdrawCircles(data);\r\n\tdrawReps(data);\r\n\tconsole.log((bwData))\r\n}","plot() {\n if (this.plot === 'Cumulative frequency plot' ||\n this.plot === 'Dot plot') {\n this.createPlot();\n }\n }","function drawCircleGrid() {\n\t\tfor (var i = 180; i <= 1100; i+=100) {\n\t\t\tfor (var j = 50; j <= 1100; j+=100) {\n\t\t\t\tvar myCircle = new Path.Circle(new Point(i, j), 10);\n\t\t\t\tmyCircle.fillColor = hue();\n\t\t\t}\n\t\t}\n\t}","function CubicPoly() {\n\n\t \t}","function drawCanyon(t_canyon)\n{\n\tfor(var i = 0; i < canyons.length; i++)\n\t{\n\t\tfill(184, 134, 11);\n\t\trect(t_canyon.x_pos,432,t_canyon.width,150);\n\t\tnoStroke();\n\t\tfill(255);\n\t}\n}","function init_xy(){\n\n\t\t\tg.append(\"line\")\n\t\t\t\t.attr(\"class\", \"xy\")\n\t\t\t\t.attr(\"x1\", 0)\n\t\t\t\t.attr(\"x2\", inner_w )\n\t\t\t\t.attr(\"y1\", h + 20)\n\t\t\t\t.attr(\"y2\", h + 20)\n\t\t\t\t.style(\"stroke\", \"#CCC\")\n\t\t\t\t.style(\"stroke-width\", \"1px\")\n\t\t\t\t.style(\"stroke-dasharray\", \"5 3\");\n\n\t\t}","function drawCanyon(t_canyon) {\n {\n fill(101, 33, 67)\n noStroke();\n rect(t_canyon.canyonPos_x, t_canyon.canyonPos_y, t_canyon.width, t_canyon.height)\n }\n\n}","function _via_draw_control_point(cx, cy) {\n _via_reg_ctx.beginPath();\n _via_reg_ctx.arc(cx, cy, VIA_REGION_POINT_RADIUS, 0, 2*Math.PI, false);\n _via_reg_ctx.closePath();\n\n _via_reg_ctx.fillStyle = \"white\";\n _via_reg_ctx.fill();\n}","function plotGraph(){\n createAxis();\n // zoom.x(x).y(y);\n // console.log('setting scales');\n // console.log(x);\n // console.log(y);\n updateBoundaryGraph.setScales(x,y);\n }","function CubicPoly() {\r\n\r\n\t\t}","circb(x0, y0, r, c) {\n // evaluate runtime errors\n this.colorRangeError(c);\n let x = 0;\n let y = r;\n let p = 3 - 2 * r;\n this.circbPixGroup(x0, y0, x, y, c);\n while (x < y) {\n x++;\n if (p < 0) {\n p = p + 4 * x + 6;\n }\n else {\n y--;\n p = p + 4 * (x - y) + 10;\n }\n this.circbPixGroup(x0, y0, x, y, c);\n }\n }","circPixGroup(x0, y0, x, y, c) {\n this.line(x0 + x, y0 + y, x0 - x, y0 + y, c);\n this.line(x0 + x, y0 - y, x0 - x, y0 - y, c);\n this.line(x0 + y, y0 + x, x0 - y, y0 + x, c);\n this.line(x0 + y, y0 - x, x0 - y, y0 - x, c);\n }","function drawContour (obj)\n {\n // set the axis right\n obj.y.domain(range(obj.data.contour.yy));\n obj.x.domain(range(obj.data.contour.xx));\n\n // draw the target density\n var line = d3.svg.line()\n .x(function(d, i) { return obj.x(d.x); })\n .y(function(d, i) { return obj.y(d.y); });\n\n\t// obj.data.contour.points is array where element is an array corresponding to each contour line\n var lines = obj.plot.selectAll(\"path.contour\")\n .data(obj.data.contour.points);\n \n // This draws the path for the contour plot\n // Note that input is line, which array with each element corresponding to a curve on the contour plot\n lines.enter().append(\"path\")\n .attr(\"class\", \"contour\")\n .attr(\"d\", line)\n\n // draw the point at which the Metropolis algorithm is at\n var poi = {x : obj.data.metropolis.x.val, y : obj.data.metropolis.y.val};\n\n var point = obj.plot.selectAll(\"circle\")\n .data([poi]);\n\n point.enter().append(\"circle\")\n .attr(\"class\", \"currentValue\")\n .attr(\"cx\", function (d, i) { return obj.x(d.x); })\n .attr(\"cy\", function (d, i) { return obj.y(d.y); })\n .attr(\"r\", 7)\n .each( function (d)\n { this._current = Object(); this._current.d = d;\n this._current.name = 'contour'; this._current.obj = obj; return 0; });\n\n\n\t// draw previous points (the entire array of sampled points, including current point) \n\t// create pairs of points\n\t var prevPoi = makePoints(data.metropolis.x.vals,data.metropolis.y.vals)\n\t// create circles of class \"prev\" and pass data\n var prevPoints = obj.plot.selectAll(\"circle.prev\")\n .data(prevPoi);\n\t// plot points\n prevPoints.enter().append(\"circle\")\n .attr(\"class\", \"prev\")\n .attr(\"cx\", function (d, i) { return obj.x(d.x); })\n .attr(\"cy\", function (d, i) { return obj.y(d.y); })\n .attr(\"r\", 4)\n\n\n // create object that will hold lines connecting sampled points; plot lines\n var connectLines = []\n if(data.metropolis.currentIteration > 0){\n \t\tfor(var ii=1; ii < prevPoi.length; ii++){\n \tconnectLines.push({'x1':prevPoi[ii-1].x,'y1':prevPoi[ii-1].y,'x2':prevPoi[ii].x,'y2':prevPoi[ii].y})\n \t}\n }\n\n var lines = obj.plot.selectAll(\"line\")\n .data(connectLines);\n \n lines.enter().append(\"line\")\n .attr('class', 'connect')\n .attr(\"x1\", function (d, i) { return obj.x(d.x1); })\n .attr(\"y1\", function (d, i) { return obj.y(d.y1); })\n .attr(\"x2\", function (d, i) { return obj.x(d.x2); })\n .attr(\"y2\", function (d, i) { return obj.y(d.y2); })\n .style(\"opacity\", 0.85)\n .style(\"stroke\", \"red\")\n .attr(\"stroke-dasharray\", \"5, 5\");\n \n \n\n\t// Calculate acceptance rate of Metropolis algorithm (only if at least 1 iteration...)\n\tif(data.metropolis.accepted.length!=0)\n\t{\n\t\tvar sumAccept = data.metropolis.accepted.reduce(function(a, b) { return a + b });\n\t\tvar percAccept = sumAccept/data.metropolis.accepted.length;\n\t\tvar acceptRate = d3.selectAll(\".acceptRate\");\n\t\tacceptRate.html(\"Acceptance Rate of Proposals: \" + d3.round(100 * percAccept, 2)+\"%\");;\n\t}\n\n\n // handle the transitions (this is necessary to reset plot when hit \"Refresh\")\n var tr = obj.svg.transition().duration(500);\n // rescale axes\n tr.select(\".y.axis\").call(obj.yAxis);\n tr.select(\".x.axis\").call(obj.xAxis);\n // Redraw current point in Metropolis algorithm + path leading to it\n tr.select(\"circle\").attr(\"cx\", function(d){return obj.x(d.x);})\n .attr(\"cy\",function(d){return obj.y(d.y);});\n // Redraw contour plot\n tr.selectAll(\"path.contour\").attr('d', function (d)\n { return line(d) } );\n \n // transitions for lines\n tr.selectAll(\"line.connect\")\n .attr(\"x1\", function (d, i) { return obj.x(d.x1); })\n .attr(\"y1\", function (d, i) { return obj.y(d.y1); })\n .attr(\"x2\", function (d, i) { return obj.x(d.x2); })\n .attr(\"y2\", function (d, i) { return obj.y(d.y2); })\n .style(\"opacity\", 0.85)\n .style(\"stroke\", \"red\")\n .attr(\"stroke-dasharray\", \"5, 5\");\n \n // remove all previous points and lines connecting them from plot when hit \"refresh\"\n prevPoints.exit().remove();\n lines.exit().remove();\n return 0;\n }","function ChannelPlotChannel(imyPlot) {\n this.myPlot = imyPlot;\n this.FixedSizeY = -1; //negative value= flexible\n\n //Draws a vertical scale in the left panel of the channel\n this.DrawVertScale = function(DrawInfo, minvl, maxvl) {\n var jumps = GetScaleJump((maxvl - minvl) / 15);\n\n DrawInfo.LeftContext.fillStyle = \"black\";\n DrawInfo.LeftContext.font = '10px sans-serif';\n DrawInfo.LeftContext.textBaseline = 'bottom';\n DrawInfo.LeftContext.textAlign = 'right';\n\n DrawInfo.LeftContext.strokeStyle = \"black\";\n DrawInfo.CenterContext.strokeStyle = \"black\";\n DrawInfo.LeftContext.globalAlpha = 0.6;\n DrawInfo.CenterContext.globalAlpha = 0.2;\n for (j = Math.ceil(minvl / jumps.Jump1); j <= Math.floor(maxvl / jumps.Jump1); j++) {\n vl = j * jumps.Jump1;\n yp = Math.round(DrawInfo.PosY - DrawInfo.SizeY * 0.1 - (vl - minvl) / (maxvl - minvl) * DrawInfo.SizeY * 0.8) - 0.5;\n if (j % jumps.JumpReduc == 0) {\n DrawInfo.LeftContext.beginPath();\n DrawInfo.LeftContext.moveTo(DrawInfo.LeftSizeX - 8, yp);\n DrawInfo.LeftContext.lineTo(DrawInfo.LeftSizeX, yp);\n DrawInfo.LeftContext.stroke();\n DrawInfo.LeftContext.fillText(vl, DrawInfo.LeftSizeX - 12, yp + 5);\n DrawInfo.CenterContext.beginPath();\n DrawInfo.CenterContext.moveTo(0, yp);\n DrawInfo.CenterContext.lineTo(DrawInfo.SizeX, yp);\n DrawInfo.CenterContext.stroke();\n }\n else {\n DrawInfo.LeftContext.beginPath();\n DrawInfo.LeftContext.moveTo(DrawInfo.LeftSizeX - 4, yp);\n DrawInfo.LeftContext.lineTo(DrawInfo.LeftSizeX, yp);\n DrawInfo.LeftContext.stroke();\n }\n }\n DrawInfo.LeftContext.globalAlpha = 1;\n DrawInfo.CenterContext.globalAlpha = 1;\n\n }\n\n\n //Draws a message in the center panel of the channel\n this.DrawMessage = function (DrawInfo, txt) {\n DrawInfo.CenterContext.fillStyle = \"black\";\n DrawInfo.CenterContext.globalAlpha = 0.2;\n DrawInfo.CenterContext.fillRect(0, DrawInfo.PosY - DrawInfo.SizeY, DrawInfo.SizeX, DrawInfo.SizeY);\n DrawInfo.CenterContext.globalAlpha = 1.0;\n\n DrawInfo.LeftContext.fillStyle = \"black\";\n DrawInfo.LeftContext.globalAlpha = 0.2;\n DrawInfo.LeftContext.fillRect(0, DrawInfo.PosY - DrawInfo.SizeY, DrawInfo.LeftSizeX, DrawInfo.SizeY);\n DrawInfo.LeftContext.globalAlpha = 1.0;\n\n DrawInfo.CenterContext.fillStyle = \"black\";\n DrawInfo.CenterContext.font = '25px sans-serif';\n DrawInfo.CenterContext.textBaseline = 'bottom';\n DrawInfo.CenterContext.textAlign = 'center';\n DrawInfo.CenterContext.globalAlpha = 0.6;\n DrawInfo.CenterContext.fillText(txt, DrawInfo.SizeX / 2, DrawInfo.PosY - DrawInfo.SizeY / 2 + 12);\n DrawInfo.CenterContext.globalAlpha = 1.0;\n }\n\n //Draws a title in the left panel of the channel\n this.DrawTitle = function (DrawInfo) {\n DrawInfo.LeftContext.save();\n DrawInfo.LeftContext.translate(0, DrawInfo.PosY - DrawInfo.SizeY / 2);\n DrawInfo.LeftContext.rotate(-Math.PI / 2);\n DrawInfo.LeftContext.textBaseline = 'top';\n DrawInfo.LeftContext.textAlign = \"center\";\n DrawInfo.LeftContext.font = '14px sans-serif';\n DrawInfo.LeftContext.fillStyle = \"black\";\n if (\"Title\" in this)\n DrawInfo.LeftContext.fillText(this.Title, 0, 5);\n if (\"SubTitle\" in this) {\n DrawInfo.LeftContext.font = '12px sans-serif';\n DrawInfo.LeftContext.fillStyle = \"rgb(100,100,100)\";\n DrawInfo.LeftContext.fillText(this.SubTitle, 0, 25);\n }\n DrawInfo.LeftContext.restore();\n }\n\n //Get tooltip info at a specific point in screen coordinates in the channel\n //Default behaviour: return null. This function can be overriden by a specific implementation of a channel\n //Note that the return object will be digested by the function DrawChannelToolTip\n this.GetToolTipInfo = function (xp, yp) {\n return null;\n }\n\n //Handle a click event inside a channel\n //Default behaviour: do nothing. This function can be overriden by a specific implementation of a channel\n this.OnClick = function (xp, yp) {\n }\n\n\n}","constructor(x, y, t, r, n, c) {\n\t\tsuper(x, y);\n\t\tthis.theta = t;\t//in degrees\n\t\tthis.circumRad = r;\n\t\tthis.vertexNum = n;\n\t\tthis.color = c;\n\t}","function plotGrid() {\n let equalParts = (maxValue/5).toPrecision(2);\n lenAxis = equalParts*6;\n let ticks = [equalParts, equalParts*2, equalParts*3, equalParts*4, equalParts*5, lenAxis];\n \n // griglie\n let circle = svg.selectAll(\".grid\")\n .data(ticks);\n\n circle.exit().remove(); // exit\n\n circle.enter() // enter\n .append(\"circle\")\n .attr(\"class\", \"grid\")\n .attr(\"cx\", cx)\n .attr(\"cy\", cy)\n .attr(\"fill\", \"none\")\n .attr(\"stroke\", \"gray\")\n .transition().duration(1000)\n .attr(\"r\", t=>rScale(t));\n\n // scritte\n let txt = svg.selectAll(\".tick\")\n .data(ticks);\n \n txt.exit().remove(); //exit\n\n txt.enter() //enter\n .append(\"text\")\n .attr(\"class\", \"tick\")\n .attr(\"x\", cx+5)\n .attr(\"y\", t=>cy-rScale(t)-1)\n .transition().duration(1000).delay(1000)\n .attr(\"opacity\", 1)\n .text(t=>t.toString());\n}","function CubicPoly() {\r\n\r\n\t}","function CubicPoly() {\n\n\t}","function CubicPoly() {\n\n\t}","function render() {\n dots\n .attr(\"cx\", function (d) {\n return project(d).x;\n })\n .attr(\"cy\", function (d) {\n return project(d).y;\n });\n }","function drawCirc(){\n for(y = 0; y < shapePosY.length; y++){\n for(i = 0; i < shapePosX.length; i++){\n noStroke();\n fill(colors.reverse()[i]);\n circle(shapePosX[i], shapePosY[y], 20);\n }\n }\n}","constructor(name, x, y) {\n this.name = name;\n this.x = x;\n this.y = y;\n this.w = 50;\n this.h = 50;\n this.ax = x;\n this.ay = y;\n }","function plot (x,y,val){\n\tdocument.getElementById(\"c\"+x+\".\"+y).style.backgroundColor = colors[val]; //on prend l'id cx.y et on lui attribue la valeur du tableau colors, val = indice couleur//\n document.getElementById(\"c\"+x+\".\"+y).value = val; //On dit que la valeur de cette case est val, c'est pour ça qu'on peut la retourner avec la fonction get//\n}","function drawPC() {\r\n\t\r\n//setting the x and y scale \r\n\tvar x = d3.scale.ordinal().rangePoints([0, 480], 1),\r\n y= {};\r\n \r\n// Extract the list of dimensions and create a scale for each.\r\n for (var dim in cars[0]) {\r\n\t if (dim != \"name\") {\r\n\t\t y[dim] = d3.scale.linear()\r\n\t\t\t .domain([d3.min(cars, function(d) { return +d[dim]; }), d3.max(cars, function(d) { return +d[dim]; })])\r\n\t\t .range([height,0]);\r\n\t }\r\n }\r\n \r\n//setting the x domain dimensions\r\n x.domain(dimensions = d3.keys(cars[0]).filter(function(d) { return d != \"name\";}));\r\n\r\n//draw polylines\r\n for (var i=1; i< cars.length; i++) { \r\n\r\n//prepare the coordinates for a polyline\r\n\t var lineData = []; //initialize an array for coordinates of a polyline\r\n\t for (var prop in cars[0]) { //get each dimension\r\n\t if (prop != \"name\" ) { //skip the name dimension\r\n\t var point = {}; //initialize a coordinate object\r\n\t var val = cars[i][prop]; //obtain the value of a car in a dimension\r\n\t\t point['x'] = x(prop); //x value: mapping the dimension \r\n\t point['y'] = y[prop](val);//y value: mapping the value in that dimension\r\n\t lineData.push(point); //add the object into the array \r\n\t }\r\n\t }\r\n\r\n//draw a polyline based on the coordindates \r\n chart.append(\"g\")\r\n\t .attr(\"class\", \"polyline\")\r\n\t .append(\"path\") // a path shape\r\n\t\t .attr(\"d\", line(lineData)) //line() is a function to turn coordinates into SVG commands\r\n\t\r\n//the mouseover function that changes the strokes to red when the mouse is over them\r\n\t.on(\"mouseover\", function(){\r\n\t\t\td3.select(this)\r\n\t\t.style(\"stroke\",\"red\")\r\n\t })\r\n//the mouseout function that changes the strokes back to their original color\r\n\t.on(\"mouseout\", function(){\r\n\t\td3.select(this)\r\n\t\t.style(\"stroke\",null)\r\n\t\t\r\n})\r\n }\r\n\r\n//draw individual dimension lines\r\n//position dimension lines \r\n var g = chart.selectAll(\".dimension\")\r\n\t .data(dimensions)\r\n\t .enter().append(\"g\")\r\n\t .attr(\"class\", \"dimension\")\r\n\t .attr(\"transform\", function(d) { return \"translate(\" + x(d) + \")\"; }) //translate each axis\r\n\r\n\t\r\n// Add an axis and title.\r\n g.append(\"g\")\r\n\t .attr(\"class\", \"axis\")\r\n\t .each(function(d) { d3.select(this).call(axis.scale(y[d])); })\r\n\t .append(\"text\")\r\n\t .style(\"text-anchor\", \"middle\")\r\n\t .attr(\"y\", -4)\r\n\t .text(function(d) { return d; });\r\n\t \r\n \r\n}","function drawPoleZeroPlot() {\n\n zPlaneContext.clearRect(0, 0, 275, 280);\n zPlaneContext.font = '12px Arial';\n\n // This helper function returns the pixel coordinates inside the $z$-plane canvas\n // for a complex number `z`.\n var coordinatesFromComplexNumber = function(z) {\n return {\n x: unitCircle.x + z.real * unitCircle.radius,\n y: unitCircle.y - z.imaginary * unitCircle.radius\n };\n };\n\n // This helper function is used to determine the multiplicity of poles or\n // zeros.\n var countMultiplicity = function(result, z) {\n var w = _.find(result, _.compose(_.partial(Complex.areEqual, z), function(w) { return w.z; }));\n if (w !== undefined) {\n w.multiplicity++;\n }\n else {\n result.push( { z: z, multiplicity: 1 });\n }\n return result;\n };\n\n // Draw a circle at each zero.\n var zerosToRender = _.reduce(filter.zeros, countMultiplicity, []);\n _.each(zerosToRender, function(zero) {\n zPlaneContext.beginPath();\n var p = coordinatesFromComplexNumber(zero.z);\n var radius = Complex.areEqual(zero.z, selection) ? 4.5 : 4.0;\n zPlaneContext.arc(p.x, p.y, radius, 0, 2 * Math.PI, false);\n zPlaneContext.strokeStyle = Complex.areEqual(zero.z, hover) ? '#00677e' : '#00374e';\n zPlaneContext.lineWidth = Complex.areEqual(zero.z, selection) ? 3.0 : 2.0;\n zPlaneContext.stroke();\n if (zero.multiplicity > 1) {\n zPlaneContext.fillText(zero.multiplicity, p.x + 5, p.y - 5);\n }\n });\n\n // Draw a cross at each pole.\n var polesToRender = _.reduce(filter.poles, countMultiplicity, []);\n _.each(polesToRender, function(pole) {\n zPlaneContext.beginPath();\n var p = coordinatesFromComplexNumber(pole.z);\n var radius = Complex.areEqual(pole.z, selection) ? 4.5 : 4.0;\n zPlaneContext.moveTo(p.x - radius, p.y + radius);\n zPlaneContext.lineTo(p.x + radius, p.y - radius);\n zPlaneContext.moveTo(p.x - radius, p.y - radius);\n zPlaneContext.lineTo(p.x + radius, p.y + radius);\n zPlaneContext.strokeStyle = Complex.areEqual(pole.z, hover) ? '#00677e' : '#00374e';\n zPlaneContext.lineWidth = Complex.areEqual(pole.z, selection) ? 3.0 : 2.0;\n zPlaneContext.stroke();\n if (pole.multiplicity > 1) {\n zPlaneContext.fillText(pole.multiplicity, p.x + 5, p.y - 5);\n }\n });\n }","createAxes () {\n }","function axis(ctx, color, axisx, axisy, px, d1,py, d2) {\n var w = ctx.canvas.width;\n var h = ctx.canvas.height;\n\n ctx.strokeStyle = color;\n\n //if axis function is below grid function\n // and grid is dotted this removes the axis from\n // dotted back to normal line\n ctx.setLineDash([0, 0]);\n\n //if the axis is undefined in both direction creates it at the far left corner like a normal graph\n if (axisy == undefined && axisx == undefined) {\n lines(ctx, 1, h - 1, w - 1, h - 1, 1);\n lines(ctx, 1, 1, 1, h - 1, 1);\n }\n\n //the same as above\n else if (axisx == w && axisy == h) {\n lines(ctx, 1, axisy - 1, axisx - 1, axisy - 1, 1);\n lines(ctx, 1, 1, 1, axisy - 1, 1);\n }\n\n //if axisx and axis y are numbers the axis will be created inwards to the number that has been created.\n else if (typeof axisx == \"number\" && typeof axisy == \"number\") {\n lines(ctx, 0, axisy, w, axisy, 3);\n lines(ctx, axisx, 0, axisx, h, 3);\n }\n\n // if axisy and axisx are inputed as middle the x and y axis will be created in the center of the canvas\n else if (axisx == \"middle\" && axisy == \"middle\") {\n axisx = w / 2;\n axisy = h / 2;\n\n lines(ctx, h / 2, w, h / 2, 2);\n\n lines(ctx, w / 2, w / 2, h, 2);\n }\n\n // creates the x for the creation of axis points as pf now only at the positive x axis\n if (px == \"px\" && py == \"py\") {\n let i = axisx;\n let j = 0;\n let k = 0;\n let l = 0;\n\n //creates positive x axis points\n for (i = axisx; i <= w; i += d1) {\n lines(ctx, i, axisy, i, axisy + 10, 1);\n }\n\n //create negative y axis points\n for (l = axisy; l >= 0; l -= d2) {\n lines(ctx, axisx, l, axisx - 10, l, 1);\n }\n\n //creates positive y axis points\n for (j = axisy; j <= h; j += d2) {\n lines(ctx, axisx - 10, j, axisx, j, 1);\n }\n //creates negative x axis points\n for (k = axisx; k >= 0; k -= d1) {\n lines(ctx, k, axisy, k, axisy + 10, 1);\n }\n }\n\n else if(px =='px' && py == undefined){\n let i = 0;\n let k = 0;\n //creates positive x axis points\n for (i = axisx; i <= w; i += d1) {\n lines(ctx, i, axisy, i, axisy + 10, 1);\n }\n\n //creates negative x axis points\n for (k = axisx; k >= 0; k -= d1) {\n lines(ctx, k, axisy, k, axisy + 10, 1);\n }\n }\n}","function cs_geocentric_to_geodetic (cs, p) {\n\n var X =p.x;\n var Y = p.y;\n var Z = p.z;\n var Longitude;\n var Latitude;\n var Height;\n\n var W; /* distance from Z axis */\n var W2; /* square of distance from Z axis */\n var T0; /* initial estimate of vertical component */\n var T1; /* corrected estimate of vertical component */\n var S0; /* initial estimate of horizontal component */\n var S1; /* corrected estimate of horizontal component */\n var Sin_B0; /* Math.sin(B0), B0 is estimate of Bowring aux variable */\n var Sin3_B0; /* cube of Math.sin(B0) */\n var Cos_B0; /* Math.cos(B0) */\n var Sin_p1; /* Math.sin(phi1), phi1 is estimated latitude */\n var Cos_p1; /* Math.cos(phi1) */\n var Rn; /* Earth radius at location */\n var Sum; /* numerator of Math.cos(phi1) */\n var At_Pole; /* indicates location is in polar region */\n\n X = parseFloat(X); // cast from string to float\n Y = parseFloat(Y);\n Z = parseFloat(Z);\n\n At_Pole = false;\n if (X != 0.0)\n {\n Longitude = Math.atan2(Y,X);\n }\n else\n {\n if (Y > 0)\n {\n Longitude = HALF_PI;\n }\n else if (Y < 0)\n {\n Longitude = -HALF_PI;\n }\n else\n {\n At_Pole = true;\n Longitude = 0.0;\n if (Z > 0.0)\n { /* north pole */\n Latitude = HALF_PI;\n }\n else if (Z < 0.0)\n { /* south pole */\n Latitude = -HALF_PI;\n }\n else\n { /* center of earth */\n Latitude = HALF_PI;\n Height = -cs.b;\n return;\n }\n }\n }\n W2 = X*X + Y*Y;\n W = Math.sqrt(W2);\n T0 = Z * AD_C;\n S0 = Math.sqrt(T0 * T0 + W2);\n Sin_B0 = T0 / S0;\n Cos_B0 = W / S0;\n Sin3_B0 = Sin_B0 * Sin_B0 * Sin_B0;\n T1 = Z + cs.b * cs.ep2 * Sin3_B0;\n Sum = W - cs.a * cs.es * Cos_B0 * Cos_B0 * Cos_B0;\n S1 = Math.sqrt(T1*T1 + Sum * Sum);\n Sin_p1 = T1 / S1;\n Cos_p1 = Sum / S1;\n Rn = cs.a / Math.sqrt(1.0 - cs.es * Sin_p1 * Sin_p1);\n if (Cos_p1 >= COS_67P5)\n {\n Height = W / Cos_p1 - Rn;\n }\n else if (Cos_p1 <= -COS_67P5)\n {\n Height = W / -Cos_p1 - Rn;\n }\n else\n {\n Height = Z / Sin_p1 + Rn * (cs.es - 1.0);\n }\n if (At_Pole == false)\n {\n Latitude = Math.atan(Sin_p1 / Cos_p1);\n }\n\n p.x = Longitude;\n p.y =Latitude;\n p.z = Height;\n return 0;\n}","function drawCylinder() {\n setMV();\n Cylinder.draw();\n}","function drawCylinder() {\n setMV();\n Cylinder.draw();\n}","function makecncsvgexport()\n{\n var c,d,x,y,x0,y0,pts,txt=\"\";\n getdefaults();\n var sfx=cutterwidth/(xmax-xmin);\n var sfy=cutterheight/(ymax-ymin);\n switch(originpos)\n {\n case 0: originx=0; originy=0; break; // Bottom left\n case 1: originx=0; originy=cutterheight; break; // Top left\n case 2: originx=cutterwidth; originy=0; break; // Bottom right\n case 3: originx=cutterwidth; originy=cutterheight; break; // Top right\n case 4: originx=cutterwidth/2; originy=cutterheight/2; break; // Middle\n }\n txt+='<?xml version=\"1.0\" encoding=\"utf-8\"?>\\r\\n';\n txt+='<svg id=\"gcodercncsvg\" width=\"'+cutterwidth+'px\" height=\"'+cutterheight+'px\" style=\"background-color:#FFFFFF\" version=\"1.1\" ';\n txt+='xmlns:xlink=\"http://www.w3.org/1999/xlink\" xmlns=\"http://www.w3.org/2000/svg\" ';\n txt+=makedefaultsparams()+' ';\n txt+='>\\r\\n';\n for(c=0;c<commands.length;c++)\n {\n if(commands[c][0]==='L')\n {\n pts=commands[c][1];\n pts=scaletoolpath(pts,sfx,sfy,cutterheight);\n pts=simplifytoolpath(pts,arcdist);\n txt+=' <path id=\"'+commands[c][12]+'\" d=\"M ';\n for(d=0;d<pts.length;d++)\n {\n x=pts[d][0]-originx;\n y=(cutterheight-pts[d][1])-originy;\n if(d===0)\n {\n x0=x;\n y0=y;\n }\n if(d===pts.length-1 && commands[c][11]===1) txt+=\"Z\";\n else txt+=x.toFixed(3)+\",\"+y.toFixed(3)+\" \";\n }\n txt+='\" opacity=\"1\" stroke=\"#000000\" stroke-opacity=\"1\" stroke-width=\"1\" stroke-linecap=\"butt\" stroke-linejoin=\"miter\" stroke-dasharray=\"none\" fill-opacity=\"0\" ';\n txt+=makepathparams(c)+' ';\n txt+='/>\\r\\n';\n }\n }\n txt+='</svg>\\r\\n';\n return txt;\n}","function drawScatterMatrix(trips){\n\n\tspeed = [];\n\tdistance =[];\n\tduration=[];\n\tfor (var i =0;i<trips.length;i++)\n\t{\n\t speed[i]=trips[i].avspeed;\n\t\t distance[i]=trips[i].distance;\n\t\t duration[i]=trips[i].duration;\n\t}\n\n\tgoogle.charts.load('current', {'packages':['corechart']}); \n google.charts.setOnLoadCallback(drawScatterMatrixCallBack(speed,distance,duration)); \n}","function plotCrossHair(bestI) {\n\n // get data from window\n dataList = window.data;\n\n var x = dataList[0][bestI];\n var yMin = dataList[1][bestI];\n var yMax = dataList[2][bestI];\n\n // Draw the cross hair\n ctx.lineWidth = 2;\n var r = 5;\n\n // circles\n ctx.beginPath();\n ctx.arc(x, yMin, r, 0, 2 * Math.PI);\n ctx.stroke();\n ctx.beginPath();\n ctx.arc(x, yMax, r, 0, 2 * Math.PI);\n ctx.stroke();\n\n // vertical line\n ctx.moveTo(x, GRAPH_BOTTOM);\n ctx.lineTo(x, yMin + r);\n ctx.moveTo(x, yMin - r);\n ctx.lineTo(x, yMax + r);\n ctx.moveTo(x, yMax - r);\n ctx.lineTo(x, GRAPH_TOP);\n\n // horizontal line\n ctx.moveTo(GRAPH_LEFT, yMin);\n ctx.lineTo(x - r, yMin);\n ctx.moveTo(x + r, yMin);\n ctx.lineTo(GRAPH_RIGHT, yMin);\n ctx.moveTo(GRAPH_LEFT, yMax);\n ctx.lineTo(x - r, yMax);\n ctx.moveTo(x + r, yMax);\n ctx.lineTo(GRAPH_RIGHT, yMax);\n ctx.stroke();\n\n // draw the x and y data next to the lines\n var date = window.data[4][bestI].toString();\n for (var i = 0; i < date.length; i++) {\n var year = date[0] + date[1] + date[2] + date[3];\n var month = date[4] + date[5];\n var day = date[6] + date[7];\n }\n var dateString = year + '/' + month + '/' + day\n var tempMin = window.data[5][bestI] / 10;\n var tempMax = window.data[6][bestI] / 10;\n\n // type selected data\n ctx.font = \"bold 25px sans-serif\";\n ctx.fillText(dateString + \": Min = \" + tempMin +\n \", Max = \" + tempMax, GRAPH_LEFT + 20, GRAPH_BOTTOM + 60);\n ctx.stroke();\n}","function plotCorr(id) {\n let data = dictMetrics[id];\n dictAbs = dictAbsGlobal[id];\n $(\"#correlation_bar_graph\").html(\"\");\n $(\"#actualPredicted\").html(\"\");\n updatePlot(1997);\n draw_correlation_bar_graph(data);\n}","function CubicPoly() {}","function CubicPoly() {}","function CubicPoly() {}","function CubicPoly() {}","function CubicPoly() {}","function doPlot(id, xArr, xLabel, yArr, yLabel) {\n\n var margin = { top: 10, right: 10, bottom: 50, left: 50 },\n // outerWidth = 350,\n // outerHeight = 300,\n outerWidth = getWidth() / 5,\n outerHeight = getHeight() / 3,\n width = outerWidth - margin.left - margin.right,\n height = outerHeight - margin.top - margin.bottom;\n\n var x = d3.scale.linear()\n .range([0, width]).nice();\n\n var y = d3.scale.linear()\n .range([height, 0]).nice();\n\n // var xLabel = \"Voltage\",\n // yLabel = \"Current\",\n // colorCat = \"Manufacturer\";\n\n // d3.csv(\"http://rohin.me/dev/mettletest/cerial.csv\", function(data) {\n // data.forEach(function(d) {\n // d.Voltage = +d.Voltage;\n // d.Current = +d.Current;\n // });\n\n data = [];\n\n if (xArr.length == 0 || yArr.length == 0) {\n data.push([0, 0]);\n } else {\n data = xArr.map(function (_, i) {\n return [xArr[i], yArr[i], i];\n });\n }\n\n dataLength = data.length\n // data = [];\n // data.push([1, 1]);\n // data.push([2, 2]);\n // data.push([3, 3]);\n // data.push([4, 4]);\n // data.push([5, 5]);\n // console.log(data);\n\n let xMax = d3.max(data, function (d) { return d[0]; }) * 1.05;\n let xMin = d3.min(data, function (d) { return d[0]; });\n\n let yMax = d3.max(data, function (d) { return d[1]; }) * 1.05;\n let yMin = d3.min(data, function (d) { return d[1]; });\n\n yMin = yMin > 0 ? 0 : yMin;\n xMin = xMin > 0 ? 0 : xMin,\n\n x.domain([xMin, xMax]);\n y.domain([yMin, yMax]);\n\n var xAxis = d3.svg.axis()\n .scale(x)\n .orient(\"bottom\")\n .tickSize(-height);\n\n var yAxis = d3.svg.axis()\n .scale(y)\n .orient(\"left\")\n .tickSize(-width);\n\n var color = d3.scale.category10();\n\n var tip = d3.tip()\n .attr(\"class\", \"d3-tip\")\n .offset([-10, 0])\n .html(function (d) {\n $log('graph', 'hover', {\n id: xLabel +\" vs \" + yLabel,\n values: \"(\" + d[0] + \",\" + d[1] + \")\"\n })\n return xLabel + \": \" + d[0] + \"<br>\" + yLabel + \": \" + d[1];\n });\n\n var zoomBeh = d3.behavior.zoom()\n .x(x)\n .y(y)\n .scaleExtent([0, 500])\n .on(\"zoom\", zoom);\n\n var svg = d3.select(\"#\" + id)\n .append(\"svg\")\n .attr(\"width\", outerWidth)\n .attr(\"height\", outerHeight)\n .append(\"g\")\n .attr(\"transform\", \"translate(\" + margin.left + \",\" + margin.top + \")\")\n .call(zoomBeh);\n\n svg.call(tip);\n\n svg.append(\"rect\")\n .attr(\"width\", width)\n .attr(\"height\", height);\n\n svg.append(\"g\")\n .classed(\"x axis\", true)\n .attr(\"transform\", \"translate(0,\" + height + \")\")\n .call(xAxis)\n .append(\"text\")\n .classed(\"label\", true)\n .attr(\"x\", width)\n .attr(\"y\", margin.bottom - 10)\n .style(\"text-anchor\", \"end\")\n .text(xLabel).style(\"font-size\", 20).style(\"font-weight\", \"600\");\n\n svg.append(\"g\")\n .classed(\"y axis\", true)\n .call(yAxis)\n .append(\"text\")\n .classed(\"label\", true)\n .attr(\"transform\", \"rotate(-90)\")\n .attr(\"y\", -margin.left)\n .attr(\"dy\", \".71em\")\n .style(\"text-anchor\", \"end\")\n .text(yLabel).style(\"font-size\", 20).style(\"font-weight\", \"600\");;\n\n var objects = svg.append(\"svg\")\n .classed(\"objects\", true)\n .attr(\"width\", width)\n .attr(\"height\", height);\n\n objects.append(\"svg:line\")\n .classed(\"axisLine hAxisLine\", true)\n .attr(\"x1\", 0)\n .attr(\"y1\", 0)\n .attr(\"x2\", width)\n .attr(\"y2\", 0)\n .attr(\"transform\", \"translate(0,\" + height + \")\");\n\n objects.append(\"svg:line\")\n .classed(\"axisLine vAxisLine\", true)\n .attr(\"x1\", 0)\n .attr(\"y1\", 0)\n .attr(\"x2\", 0)\n .attr(\"y2\", height);\n\n objects.selectAll(\".dot\")\n .data(data)\n .enter().append(\"circle\")\n .classed(\"dot\", true)\n .attr(\"r\", function (d) { /*console.log(d);*/ return 4; /*Math.sqrt(d[rCat] / Math.PI);*/ })\n .attr(\"transform\", transform)\n .style(\"fill\",\n function (d) {\n if (d[2] == dataLength - 1) {\n return \"#FFC107\"\n } else {\n // console.log(\"MotorID\" + motorIDArr[d[2]]);\n var motorID = motorIDArr[d[2]];\n return motorSpecs[motorID ? motorID : 0][4];\n // TODO:very hacky\n }\n })\n .on(\"mouseover\", tip.show)\n .on(\"mouseout\", tip.hide);\n\n var legend = svg.selectAll(\".legend\")\n .data(color.domain())\n .enter().append(\"g\")\n .classed(\"legend\", true)\n .attr(\"transform\", function (d, i) { return \"translate(0,\" + i * 20 + \")\"; });\n\n legend.append(\"circle\")\n .attr(\"r\", 3.5)\n .attr(\"cx\", width + 20)\n .attr(\"fill\", color);\n\n legend.append(\"text\")\n .attr(\"x\", width + 26)\n .attr(\"dy\", \".35em\")\n .text(function (d) { return d; });\n\n // d3.select(\"input\").on(\"click\", change);\n\n // function change() {\n // // xLabel = \"Carbs\";\n // xMax = d3.max(data, function(d) { return d[xLabel]; });\n // xMin = d3.min(data, function(d) { return d[xLabel]; });\n // yMax = d3.max(data, function(d) { return d[yLabel]; });\n // yMin = d3.min(data, function(d) { return d[yLabel]; });\n\n // zoomBeh.x(x.domain([xMin, xMax])).y(y.domain([yMin, yMax]));\n\n // var svg = d3.select(\"#scatter\").transition();\n\n // svg.select(\".x.axis\").duration(750).call(xAxis).select(\".label\").text(xLabel);\n\n // objects.selectAll(\".dot\").transition().duration(1000).attr(\"transform\", transform);\n // }\n\n // hanldes zoom event on graph\n function zoom() {\n svg.select(\".x.axis\").call(xAxis);\n svg.select(\".y.axis\").call(yAxis);\n\n svg.selectAll(\".dot\")\n .attr(\"transform\", transform);\n }\n\n function transform(d) {\n return \"translate(\" + x(d[0]) + \",\" + y(d[1]) + \")\";\n }\n // });\n}","function showConjugates () {\n\n pointsTable = lens.pointsTable.getData(); \n pointsList = Optics.calculatePointToPoint(renderableLens.total, pointsTable);\n totalLens = renderableLens.total;\n\n if (pointsList.length > 0) {\n pointsList.forEach( elem => {\n console.log(\"showing .... conjugate pair id = \" + elem.id);\n drawConjugates(elem, displayOptions);\n } );\n }\n }","function FunctionPlotter(options) {\n let axisTickCounts,\n functions,\n gridBoolean,\n group,\n hasTransitioned,\n plotArea,\n plotter,\n range,\n width,\n where,\n x,\n y;\n\n plotter = this;\n\n init(options);\n\n return plotter;\n\n /* INITIALIZE */\n function init(options) {\n let curtain;\n\n _required(options);\n _defaults(options);\n\n\n curtain = addCurtain();\n plotter.scales = defineScales();\n plotter.axisTitles = {};\n group = addGroup();\n plotArea = addPlotArea();\n plotter.layers = addLayers();\n plotter.grid = addGrid();\n plotter.axes = addAxes();\n plotter.lines = addLines(functions);\n plotter.hotspot = addHotspot();\n\n plotter.hasTransitioned = false;\n\n // valueCircle = false;\n\n\n }\n\n /* PRIVATE METHODS */\n function _defaults(options) {\n\n axisTickCounts = options.axisTicks ? options.axisTicks : {\"x\":1,\"y\":1};\n functions = options.functions ? options.functions : [];\n plotter.height = options.height ? options.height : 400;\n plotter.width = options.width ? options.width : 800;\n plotter.domain = options.domain ? options.domain : [0,10];\n plotter.range = options.range ? options.range : [0,10];\n plotter.margins = options.margins ? options.margins : defaultMargins();\n //TODO: THIS IS SLOPPY. GRID SHOULD BE CLEARER\n gridBoolean = options.hideGrid ? false : true;\n x = options.x ? options.x : 0;\n y = options.y ? options.y : 0;\n plotter.coordinates = options.coordinates ? options.coordinates : {\"x\":x,\"y\":y};\n plotter.fontFamily = options.fontFamily ? options.fontFamily : \"\";\n\n }\n\n function _required(options) {\n\n hasTransitioned = false;\n where = options.where;\n\n }\n\n\n /* PRIVATE METHODS */\n function addAxes() {\n let axes;\n\n axes = {};\n\n axes.x = addXAxis();\n axes.y = addYAxis();\n\n return axes;\n }\n\n function addCurtain() {\n let clipPath,\n rect;\n\n clipPath = where\n .select(\"defs\")\n .append(\"clipPath\")\n .attr(\"id\",\"plotterClipPath\");\n\n rect = clipPath\n .append(\"rect\")\n .attr(\"x\",-1)\n .attr(\"y\",-1)\n .attr(\"width\",width - plotter.margins.left - plotter.margins.right + 1)\n .attr(\"height\",plotter.height - plotter.margins.top - plotter.margins.bottom + 1);\n\n return clipPath;\n }\n\n function addGroup() {\n let group;\n\n group = explorableGroup({\"where\":options.where})\n .attr(\"transform\",\"translate(\"+plotter.coordinates.x+\",\"+plotter.coordinates.y+\")\");\n\n return group;\n }\n\n function addGrid() {\n let grid;\n\n if(gridBoolean) {\n grid = new FunctionPlotterGrid({\n \"axisTickCounts\":axisTickCounts,\n \"domain\":plotter.domain,\n \"range\":range,\n \"scales\":plotter.scales,\n \"where\":plotter.layers.grid,\n \"tickEvery\":1\n });\n }\n\n return grid;\n }\n\n function addHotspot() {\n let hotspot;\n\n hotspot = group\n .append(\"rect\")\n .attr(\"x\",plotter.margins.left)\n .attr(\"y\",plotter.margins.top)\n .attr(\"width\",plotter.width - plotter.margins.left - plotter.margins.right)\n .attr(\"height\",plotter.height - plotter.margins.top - plotter.margins.bottom)\n .attr(\"fill\",\"rgba(0,0,0,0)\");\n\n return hotspot;\n }\n\n function addPlotArea() {\n let plotGroup;\n\n plotGroup = explorableGroup({\n \"where\":group\n })\n .attr(\"transform\",\"translate(\"+plotter.margins.left+\",\"+plotter.margins.top+\")\");\n\n return plotGroup;\n }\n\n function addLayers() {\n let layers;\n\n layers = {};\n layers.plot = explorableGroup({\"where\":group})\n .attr(\"transform\",\"translate(\"+plotter.margins.left+\",\"+plotter.margins.top+\")\");\n\n layers.grid = explorableGroup({\"where\":layers.plot})\n .attr(\"clip-path\",\"url(#plotterClipPath)\");\n\n layers.axes = explorableGroup({\"where\":layers.plot});\n layers.lines = explorableGroup({\"where\":layers.plot});\n\n\n layers.indicators = explorableGroup({\"where\":group});\n layers.tooltip = explorableGroup({\"where\":group});\n\n return layers;\n }\n\n\n function addLines(functions) {\n let lines;\n\n if(functions.length == 0) {\n lines = [];\n\n return lines;\n }\n\n functions.forEach((aFunction) => {\n let line = new FunctionPlotterLine({\n \"function\":aFunction,\n \"where\":plotter.layers.lines,\n \"domain\":plotter.domain,\n \"scales\":plotter.scales,\n });\n\n lines.push(line);\n });\n\n return lines;\n }\n\n function addXAxis() {\n let axis;\n\n axis = new FunctionPlotterAxis({\n \"axisType\":\"bottom\",\n \"scales\":plotter.scales,\n \"tickCount\":axisTickCounts.x,\n \"where\":plotter.layers.axes\n });\n\n return axis;\n }\n\n function addYAxis() {\n let axis;\n\n axis = new FunctionPlotterAxis({\n \"axisType\":\"left\",\n \"scales\":plotter.scales,\n \"tickCount\":axisTickCounts.y,\n \"where\":plotter.layers.axes\n });\n\n return axis;\n }\n\n function defaultMargins() {\n return {\n \"left\":100,\n \"right\":10,\n \"top\":30,\n \"bottom\":50\n };\n }\n\n function defineScale(inputDomain,outputRange) {\n let scale;\n\n scale = d3.scaleLinear()\n .domain(inputDomain)\n .range(outputRange);\n\n return scale;\n }\n\n function defineScales() {\n let scales;\n\n scales = {};\n scales.x = defineScale(plotter.domain,[0,plotter.width - plotter.margins.right - plotter.margins.left]);\n scales.y = defineScale(plotter.range,[plotter.height - plotter.margins.bottom - plotter.margins.top,0]);\n\n return scales;\n }\n\n\n}","function initCola() {\n\t\t\t\t// set up the axes\n\t\t\t\tvar x = d3.scale.linear().domain([0, 350]).range([0, 10]),\n\t\t\t\t y = d3.scale.linear().domain([0, 350]).range([0, 10]),\n\t\t\t\t z = d3.scale.linear().domain([0, 350]).range([0, 10]);\n\n\t\t\t\t//.on(\"tick\", function(e) {\n\t\t\t\tfor (var key in nodes) {\n\t\t\t\t\tspheres[key].position.set(x(nodes[key].x) * 40 - 40, y(nodes[key].y) * 40 - 40, z(nodes[key].z) * 40 - 40);\n\t\t\t\t\tlabels[key].position.set(x(nodes[key].x) * 40 - 40, y(nodes[key].y) * 40 - 40, z(nodes[key].z) * 40 - 40);\n\n\t\t\t\t\tfor (var j = 0; j < three_links.length; j++) {\n\t\t\t\t\t\tvar arrow = three_links[j];\n\t\t\t\t\t\tvar vi = null;\n\t\t\t\t\t\tif (arrow.userData.source === key) {\n\t\t\t\t\t\t\tvi = 0;\n\t\t\t\t\t\t}\n\t\t\t\t\t\tif (arrow.userData.target === key) {\n\t\t\t\t\t\t\tvi = 1;\n\t\t\t\t\t\t}\n\t\t\t\t\t\tif (vi >= 0) {\n\t\t\t\t\t\t\tif (vi == 0) {\n\t\t\t\t\t\t\t\tvar vectOrigin = new THREE.Vector3(spheres[key].position.x, spheres[key].position.y, spheres[key].position.z);\n\t\t\t\t\t\t\t\tsetArrowOrigin(arrow, vectOrigin);\n\t\t\t\t\t\t\t}\n\t\t\t\t\t\t\tif (vi == 1) {\n\t\t\t\t\t\t\t\tvar vectTarget = new THREE.Vector3(spheres[key].position.x, spheres[key].position.y, spheres[key].position.z);\n\t\t\t\t\t\t\t\tsetArrowTarget(arrow, vectTarget);\n\t\t\t\t\t\t\t}\n\t\t\t\t\t\t}\n\t\t\t\t\t}\n\n\t\t\t\t}\n\t\t\t\trenderer.render(scene, camera);\n\t\t\t}","function DrawCtrChart()\n{\n // create/delete rows \n if (ctrTable.getNumberOfRows() < contDataPoints.length)\n { \n var numRows = contDataPoints.length - ctrTable.getNumberOfRows();\n ctrTable.addRows(numRows);\n } else {\n for(var i=(ctrTable.getNumberOfRows()-1); i > contDataPoints.length; i--)\n {\n ctrTable.removeRow(i); \n }\n }\n\n // Populate data table with time/cost data points. \n for(var i=0; i < ctrTable.getNumberOfRows(); i++)\n {\n ctrTable.setCell(i, 0, new Date(parseInt(contDataPoints[i].timestamp)));\n ctrTable.setCell(i, 1, (parseInt(contDataPoints[i].clicks)/parseInt(contDataPoints[i].impressions))*100);\n }\n\n // Draw line chart.\n chartOptions.title = 'Ctr Chart';\n ctrChart.draw(ctrView, chartOptions); \n}","function draw(){\n\n drawGrid();\n var seriesIndex;\n\n if(!graph.hasData) {\n return;\n }\n\n if(graph.options.axes.x1.show){\n if(!graph.options.axes.x1.labels || graph.options.axes.x1.labels.length === 0) {\n seriesIndex = graph.options.axes.x1.seriesIndex;\n graph.options.axes.x1.labels= getXLabels(graph.allSeries[seriesIndex].series[0], graph.options.labelDateFormat);\n }\n drawXLabels(graph.options.axes.x1);\n }\n if(graph.options.axes.x2.show && graph.hasData){\n if (!graph.options.axes.x2.labels || graph.options.axes.x2.labels.length === 0) {\n seriesIndex = graph.options.axes.x2.seriesIndex;\n graph.options.axes.x2.labels = getXLabels(graph.allSeries[seriesIndex].series[0], graph.options.labelDateFormat);\n }\n drawXLabels(graph.options.axes.x2);\n }\n\n if (graph.options.axes.y1.show) {\n drawYLabels(graph.maxVals[graph.options.axes.y1.seriesIndex], graph.minVals[graph.options.axes.y1.seriesIndex], graph.options.axes.y1);\n }\n if (graph.options.axes.y2.show) {\n drawYLabels(graph.maxVals[graph.options.axes.y2.seriesIndex], graph.minVals[graph.options.axes.y2.seriesIndex], graph.options.axes.y2);\n }\n }","function zoom_arc_plot(v_chr, v_start, v_end) {\n // chosen chromosome for zoom\n var xScale_zoomed_chrom,\n // all other chromosomes\n xScale_unzoomed_chrom;\n\n // margin for the zoom function of the arc plot\n var margin = {\n top: 1,\n right: 1,\n bottom: 20,\n left: 10\n };\n\n // padding between the chromosomes\n var padding = 2;\n // width and height of the plot\n var w = 800 - margin.left - margin.right - (24 * padding);\n var h = 600 - margin.top - margin.bottom; \n // chromosome length without the chosen chromosome\n var chrom_scale_compare = chrom_length - chromLength[(v_chr -1)];\n\n //for loop to create the length of the chromosomes\n var chromLength_scaled = [];\n for (var i = 0;i < chromLength.length; i++) {\n var temp;\n if ((v_chr - 1) == i) {\n chromLength_scaled.push(w/2);\n } else {\n temp = ((w/2) / chrom_scale_compare) * chromLength[i];\n chromLength_scaled.push(temp);\n }\n }\n\n //for loop to calculate the x position\n var chrom_x_position = [0];\n var Scaled_abs_xposition = 0;\n for (var i = 0; i < chrom_abs_length.length ; i++) {\n Scaled_abs_xposition = Scaled_abs_xposition + chromLength_scaled[i] + padding;\n chrom_x_position.push(Scaled_abs_xposition);\n }\n\n // var for the chromsome length of the chosen area\n var selected_chrom_area = v_end - v_start;\n // array for the ticks\n var ticks_chrom_chosen = [];\n // for loop to create the ticks for the chosen chromosome\n for (var i = 0; i< 20 ; i++) {\n var temp_x,\n temp_label,\n temp_range,\n temp_range_label,\n temp;\n if(selected_chrom_area == 0) {\n temp_x = chrom_x_position[(v_chr - 1)] + (chromLength_scaled[(v_chr - 1)] / 20) * i;\n temp_label = Math.round(((chromLength[(v_chr - 1)] / 20) / 1000000) * i) + \"MB\";\n } else {\n temp_x = chrom_x_position[(v_chr - 1)] + (chromLength_scaled[(v_chr - 1)] / 20) * i;\n temp = Math.round(v_start + (selected_chrom_area / 20)* i);\n if(temp < 50000) {\n temp_range = 1;\n temp_range_label = \"\";\n } else if(temp < 50000000) {\n temp_range = 1000;\n temp_range_label = \"Kb\";\n } else {\n temp_range = 1000000;\n temp_range_label = \"Mb\";\n }\n temp_label = Math.round((temp / temp_range)) + temp_range_label; \n }\n var obj = {};\n obj[\"x\"] = temp_x;\n obj[\"label\"] = temp_label;\n ticks_chrom_chosen.push(obj);\n }\n\n // array to store all nodes and all links which should not be displayed in the zoom function\n zoom_allNodes = [];\n zoom_links = [];\n links.forEach( function(d) {\n if((allNodes[d.source].chrom == v_chr \n && allNodes[d.source].bp_position >= v_start \n && allNodes[d.source].bp_position <= v_end) ||\n (allNodes[d.source].chrom == v_chr && selected_chrom_area == 0) ||\n (allNodes[d.target].chrom == v_chr && \n allNodes[d.target].bp_position >= v_start && \n allNodes[d.target].bp_position <= v_end) ||\n (allNodes[d.target].chrom == v_chr && selected_chrom_area == 0)) {\n\n zoom_allNodes.push(allNodes[d.source]);\n zoom_allNodes.push(allNodes[d.target]);\n zoom_links.push(d);\n }\n });\n \n // add nodes with degree zero\n allNodes.forEach( function (d) {\n var in_zoomed_chrom = (d.chrom == v_chr && d.degree == 0);\n var in_zoomed_region = (d.bp_position >= v_start && d.bp_position <= v_end);\n\n if(in_zoomed_chrom && in_zoomed_region) {\n zoom_allNodes.push(d);\n }\n });\n \n // sort and make the zoom_allnodes function unique\n var temp_zoomnodes = [];\n\n zoom_allNodes.forEach( function (d) {\n temp_zoomnodes.push(d.id);\n });\n\n temp_zoomnodes = sort_unique(temp_zoomnodes);\n\n zoom_allNodes = [];\n\n temp_zoomnodes.forEach( function (d) {\n zoom_allNodes.push(allNodes[d]);\n });\n \n \n // create SVG for the plot\n var svg = d3.select(\"#chart\")\n .append(\"svg\")\n .attr(\"id\", \"mainplot\")\n .attr(\"width\", width)\n .attr(\"height\", height)\n .append(\"g\")\n .attr(\"transform\", \"translate(\" + margin.left + \",\" + margin.top + \")\");\n\n d3.select('#ld_container').selectAll('svg').remove();\n\n var chromosome_container = svg.selectAll(\"g.group\")\n .data(chromLength)\n .enter().append(\"svg:g\")\n .attr(\"transform\", function(d, i) {\n return \"translate(\" + chrom_x_position[i] + \",\" + height_chrom_bar + \")\"; \n })\n // scales the width of chromosomes\n .attr(\"width\", function(d, i) {\n create_ld_plot(i+1, chromLength_scaled[i], chrom_x_position[i], padding, v_chr, v_start, v_end); \n return chromLength_scaled[i]; \n })\n .attr(\"height\", 40)\n .attr(\"class\", function (d,i) {\n return \"chrom\" + (i+1);\n });\n\n var id_chrom_zoom = \"g.chrom\" + (v_chr);\n // store the the new startpoint\n var startzoom = 0;\n if (v_start == 0 && v_end == 0) {\n var x_scale_zoom = d3.scale.linear()\n .domain([0, chromLength[(v_chr -1)]])\n .range([0, chromLength_scaled[(v_chr -1)]]);\n } else {\n var x_scale_zoom = d3.scale.linear()\n .domain([v_start, v_end])\n .range([0, chromLength_scaled[(v_chr -1)]]);\n }\n \n //function to zoom with the mouse\n var brush = svg.select(id_chrom_zoom)\n .append(\"g\")\n .attr(\"class\", \"brush\")\n .call(d3.svg.brush().x(x_scale_zoom)\n .on(\"brushstart\", brushstart)\n .on(\"brush\", brushmove)\n .on(\"brushend\", brushend))\n .selectAll(\"rect\")\n .attr(\"height\", 40) \n .style(\"stroke\", \"blue\")\n .style(\"fill\", \"blue\")\n .style(\"opacity\" , 0.7);\n\n function brushstart() { \n brush.classed(\"selecting\", true);\n }\n\n function brushmove() {\n var r = d3.event.target.extent(); \n document.getElementById(\"texzs\").value = Math.round(r[0]);\n document.getElementById(\"texze\").value = Math.round(r[1]);\n }\n\n function brushend() { \n brush.classed(\"selecting\", !d3.event.target.empty());\n }\n\n // create rectangle in the g container\n var chrom_bar = chromosome_container.append(\"rect\")\n .attr(\"transform\", \"translate(\" + 0 + \",\" + 0 + \")\")\n .attr(\"class\", \"rect\")\n // scales the width of chromosomes\n .attr(\"width\", function(d, i) {\n return chromLength_scaled[i]; \n })\n .attr(\"height\", 20)\n .style(\"fill\", function(d, i) {\n return chromcolour[i];\n })\n .style(\"stroke\", function(d, i) {\n return chromcolour[i];\n });\n\n //create ticks for the chrom_bar\n svg.selectAll(\"line\")\n .data(ticks_chrom_chosen)\n .enter().append(\"line\")\n .attr(\"class\", \"tickchromosome\")\n .attr(\"x1\", function(d) {\n return + d.x;\n })\n .attr(\"y1\", height_nodes + 25)\n .attr(\"x2\", function (d) {\n return + d.x;\n })\n .attr(\"y2\", height_nodes + 30)\n .style(\"stroke\", \"#000\")\n\n svg.selectAll(\"text\")\n .data(ticks_chrom_chosen)\n .enter().append(\"text\")\n .attr(\"class\", \"label\")\n .attr(\"dy\", \".35em\")\n .attr(\"transform\", function (d) {\n return \"translate(\"+ d.x + \",\" + (height_nodes + 38) + \")\" + \"rotate(90)\"; \n })\n .attr(\"font-size\", \"10\")\n .text(function (d) {\n return d.label; \n });\n\n // create the label for the chromosomes\n chromosome_container.append(\"svg:text\")\n .attr(\"class\", \"chromosom_number\")\n // 2* padding for double digits chromosome numbers\n .attr(\"transform\", function (d, i) {\n if (i == (v_chr-1)) {\n return \"translate(\" + (8 * padding) + \",\" + 15 + \")\";\n } else {\n return \"translate(\" + (4 * padding) + \",\" + 35 + \")\"; \n }\n })\n .append(\"svg:textPath\")\n .text(function(d, i) {\n return i + 1;\n })\n .attr(\"font-size\", function (d, i) {\n if (i == (v_chr-1)) {\n return \"14px\";\n } else {\n return \"9px\";\n }\n })\n .attr(\"text-anchor\", \"end\")\n .style(\"fill\", function(d, i) {\n if (i == (v_chr - 1)) {\n return \"#000\";\n } else {\n return chromcolour[i];\n }\n })\n .style(\"stroke\", function(d, i) {\n if (i == (v_chr - 1)) {\n return \"#000\";\n } else {\n return chromcolour[i];\n }\n });\n\n // object to store the position of the zoomed chromosomes\n var id_chosen = [];\n // create circles for the location of the interacting SNPs \n svg.selectAll(\"circle.vertex\")\n .data(zoom_allNodes)\n .enter().append(\"circle\")\n .attr(\"class\", \"circle_zoom\")\n .style(\"fill\", function(d) {\n return graphColor(d.probe_group);\n })\n .style(\"stroke\", function(d) {\n return graphColor(d.probe_group);\n })\n // positioning the SNPs\n .attr(\"cx\", function(d) {\n if(d.chrom == v_chr && selected_chrom_area == 0) {\n id_chosen[d.id] = chrom_x_position[(d.chrom -1 )] + \n ((w/2) / chromLength[(d.chrom - 1)]) * d.bp_position; \n return id_chosen[d.id];\n\n } else if (d.chrom == v_chr && selected_chrom_area > 0 && d.bp_position >= v_start && \n d.bp_position <= v_end) {\n id_chosen[d.id] = chrom_x_position[(d.chrom -1)] + \n ((w/2) / selected_chrom_area) * (d.bp_position - v_start);\n return id_chosen[d.id];\n\n } else if(d.chrom == v_chr && selected_chrom_area > 0 && d.bp_position < v_start ) {\n id_chosen[d.id] = chrom_x_position[(d.chrom -1)];\n return id_chosen[d.id];\n\n } else if (d.chrom == v_chr && selected_chrom_area > 0 && d.bp_position > v_end) {\n id_chosen[d.id] = chrom_x_position[(d.chrom - 1)] + (w/2);\n return id_chosen[d.id];\n\n } else if(d.chrom != v_chr) {\n id_chosen[d.id] = chrom_x_position[(d.chrom -1 )] +\n ((w/2) / chrom_scale_compare) * d.bp_position; \n return id_chosen[d.id];\n\n } else {\n return id_chosen[d.id] = \"NaN\" ;\n }\n })\n .attr(\"cy\", height_nodes)\n .attr(\"r\", function(d) {\n if(id_chosen[d.id] == \"NaN\" && d.chrom == v_chr ) {\n return 0;\n } else {\n return 2;\n }\n })\n // to get information about the SNPs from different sources, if you click on a circle\n .on(\"click\", function (d,i) { externalLink(d, i); });\n\n // show degree as tooltip - title\n svg.selectAll(\"g .circle_zoom\") \n .append(\"title\")\n .text(function(d) {\n return \"degree: \" + two_dec(d.degree) + \"\\nSNP: \" + d.rs + \"\\nid: \" + d.id + \n \"\\nposition: \" + d.bp_position\n });\n\n // draw the edges between linked SNP's nodes\n var arcs = svg.selectAll(\"path.link\")\n .data(zoom_links)\n .enter().append(\"path\")\n .attr(\"class\", \"link\")\n .style(\"stroke\", function(d) {\n return graphColor(d.probe_group);\n })\n .style(\"stroke\", 1)\n .style(\"stroke-width\", 2.5)\n .style(\"opacity\", 3.7)\n .style(\"fill\", \"none\")\n // function to create the arc for the links\n .attr(\"d\", function (d) {\n // to ensure that the path is drawn correct \n if(d.source > d.target) {\n var temp;\n temp = d.source;\n d.source = d.target;\n d.target = temp;\n } \n\n if (allNodes[d.source].chrom == v_chr || allNodes[d.target].chrom == v_chr) {\n var start_position_x = id_chosen[d.source],\n start_position_y = height_nodes ;\n\n var end_position_x = id_chosen[d.target],\n end_position_y = height_nodes ;\n } else {\n var start_position_x = \"NaN\",\n start_position_y = height_nodes ;\n\n var end_position_x = \"NaN\",\n end_position_y = height_nodes ;\n }\n\n // to ensure that the arc links are drawn on the correct side \n if (end_position_x < start_position_x) {\n var temp; \n temp = end_position_x; \n end_position_x = start_position_x;\n start_position_x = temp; \n }\n\n var radius = (end_position_x - start_position_x) / 2 ;\n\n var c1x = start_position_x,\n c1y = start_position_y - radius,\n c2x = end_position_x,\n c2y = end_position_y - radius ;\n\n return \"M\" + start_position_x + \",\" + start_position_y + \" C\" + c1x +\n \",\" + c1y + \",\" + c2x + \",\" + c2y + \" \" + \n end_position_x + \",\" + end_position_y ; \n })\n .on(\"click\" , function(d,i) { return highlight_snp_pairs(d, i);});\n\n // creates the colour scale indicator for the ld plot\n createColourScale_ldplot();\n}","constructor(x, y) {\n\t\tthis.chadX = 1000;\n\t\tthis.chadY = 10;\n\t\tthis.chadW = 10;\n\t\tthis.chadDy = 5;\n this.color = \"Red\";\n }","function drawXY(){\r\n//setting the x and y domains\r\n x.domain([d3.min(cars, function(d) { return d.year; }), d3.max(cars, function(d) { return d.year; })]);\r\n y.domain([d3.min(cars, function(d) { return d.power; }), d3.max(cars, function(d) { return d.power; })]);\r\n\r\n//setting the yPosition \r\n var yPos = height -20;\r\n//creating the x-Axis\r\n chart.append(\"g\")\r\n\t .attr(\"class\", \"xaxis\")\r\n\t .attr(\"transform\", \"translate(0,\" + yPos + \")\")\r\n\t .call(xAxis);\r\n//creating the Y-axis\r\n chart.append(\"g\")\r\n\t .attr(\"class\", \"yaxis\")\r\n\t .attr(\"transform\", \"translate(480,0)\")\r\n\t .call(yAxis);\r\n\r\n \r\n//selecting ths dot \r\n//adding attributes\t\r\n chart.selectAll(\".dot\")\r\n\t .data(cars)\r\n\t .enter().append(\"circle\")\r\n\t .attr(\"class\", \"dot\")\r\n\t .attr(\"cx\", function(d) { return x(d.year); })\r\n\t .attr(\"cy\", function(d) { return y(d.power); })\r\n\t .attr(\"r\", 3)\r\n\t \r\n//the mouseover function that fills the dots red when the mouse is over them\r\n\t .on(\"mouseover\", function(){\r\n\t\t\td3.select(this)\r\n\t\t\t.attr(\"fill\", \"red\")\r\n\t })\r\n//the mouseout function that changes the dots back to normal color\r\n\t.on(\"mouseout\", function(){\r\n\t\td3.select(this)\r\n\t\t.attr(\"fill\", \"black\")\r\n\t\t\r\n})\r\n\t\r\n \r\n}","function plotTrajectory(trajectoryData, color) {\n console.log(trajectoryData);\n \n \n \n \n \n}","circ(x0, y0, r, c) {\n // evaluate runtime errors\n this.colorRangeError(c);\n // draw filled circle\n let x = 0;\n let y = r;\n let p = 3 - 2 * r;\n this.circPixGroup(x0, y0, x, y, c);\n while (x < y) {\n x++;\n if (p < 0) {\n p = p + 4 * x + 6;\n }\n else {\n y--;\n p = p + 4 * (x - y) + 10;\n }\n this.circPixGroup(x0, y0, x, y, c);\n }\n }","function drawCanyon(t_canyon)\n{\n noStroke();\n\tfill(100, 155, 255);\n\trect(t_canyon.x_pos, t_canyon.y_pos, t_canyon.width, 200);\n}","function render_scatterOnrust() {\n var plotS = hgiScatter().mapping(['uw_eigen_factor', 'onrust']).addLOESS(true).xLabel('Uw eigen factor').yLabel('Onrust').xTicks(5).yTicks(5);\n d3.select('#scatterOnrust').datum(data).call(plotS);\n}","function sheetContour(response) {\r\n graphData = JSON.parse(response);\r\n var data = [\r\n {\r\n x: graphData.x,\r\n y: graphData.y,\r\n z: graphData.z,\r\n type: \"contour\"\r\n }\r\n ];\r\n var layout = {\r\n title: \"Contour\"\r\n };\r\n // Display plot\r\n Plotly.newPlot(\"contourPlot\", data, layout);\r\n}","addAxes () {\n }","function plotAll() {\n d3.select(\"#scatter-macro-1 svg\").remove()\n d3.select(\"#scatter-macro-2 svg\").remove()\n d3.select(\"#scatter-micro-1 svg\").remove()\n d3.select(\"#scatter-micro-2 svg\").remove()\n doPlot(\"scatter-macro-1\", voltageArr, \"Voltage\", maxLinearVelocityArr, \"Max. Linear Velocity\");\n doPlot(\"scatter-macro-2\", currentArr, \"Current\", accelerationArr, \"Acceleration\");\n doPlot(\"scatter-micro-1\", voltageArr, \"Voltage\", maxAngularVelocityArr, \"Max. Angular Velocity\");\n doPlot(\"scatter-micro-2\", currentArr, \"Current\", torqueArr, \"Torque\");\n}","function DrawCircle(xc, yc, r){\n /**@todo */\n let x = 0;\n let y = r;\n let d = 3 - 2 * r;\n DrawEightPoints(xc,x,yc,y);\n while(y >= x) //While we're only looking at degrees from 45-90\n {\n x++;\n if(d > 0){\n y--;\n d += 4 * (x-y) + 10;\n }\n else{\n d += 4 * x + 6;\n }\n DrawEightPoints(xc,x,yc,y);\n }\n}","function CalculMélangeRGB() {\n \n //valeurs des curseurs\n valCurseurR = document.querySelector(\"#curseurRouge\").getElementsByTagName('input')[0].value;\n valCurseurG = document.querySelector(\"#curseurVert\").getElementsByTagName('input')[0].value;\n valCurseurB = document.querySelector(\"#curseurBleu\").getElementsByTagName('input')[0].value;\n //valeurs des curseurs en %\n pCurseurR = valCurseurR / 100;\n pCurseurB = valCurseurB / 100;\n pCurseurG = valCurseurG / 100;\n\n //recuperer les valeurs X Y Z\n XBleu = data.XYZ.B.X;\n YBleu = data.XYZ.B.Y;\n ZBleu = data.XYZ.B.Z;\n //XYZ du Vert\n XVert = data.XYZ.G.X;\n YVert = data.XYZ.G.Y;\n ZVert = data.XYZ.G.Z;\n //XYZ du rouge\n XRouge = data.XYZ.R.X;\n YRouge = data.XYZ.R.Y;\n ZRouge = data.XYZ.R.Z;\n\n //calcul du X,Y,Z pour le mélange\n\n Xmelange = (XBleu * pCurseurB) + (XVert * pCurseurG) + (XRouge * pCurseurR);\n Ymelange = (YBleu * pCurseurB) + (YVert * pCurseurG) + (YRouge * pCurseurR);\n Zmelange = (ZBleu * pCurseurB) + (ZVert * pCurseurG) + (ZRouge * pCurseurR);\n\n //calcul du melange du x et y\n xMelange = Xmelange / (Xmelange + Ymelange + Zmelange);\n yMelange = Ymelange / (Xmelange + Ymelange + Zmelange);\n\n const cieChart = document.querySelector('cie-xy-chart'); // Tu récupère le premier diagramme de ton DOM (par exemple.)\n cieChart.inputs.xy.x.value = xMelange; // Tu définis la valeur du champ x.\n cieChart.inputs.xy.x.dispatchEvent(new InputEvent('input')); // Tu déclenches l'événement \"input\" correspondant à x.\n cieChart.inputs.xy.y.value = yMelange; // Tu définis la valeur du champ y.\n cieChart.inputs.xy.y.dispatchEvent(new InputEvent('input')); // Tu déclenches l'événement \"input\" correspondant à y.\n // Déclencher les événements input devrait rafraîchir le diagramme.\n \n}","function plot() {\n\n // Skip some frames to avoid unnecessary workload\n counterGraph++\n if (counterGraph % skipRateGraph != 0) return\n\n // fill data arrays\n timeArray.push(time);\n susceptibleArray.push(nSusceptible);\n infectedArray.push(nInfected);\n immuneArray.push(nImmune);\n deathsArray.push(nDeaths);\n\n // Clear graph canvas\n ctxGraph.clearRect(0, 0, canvasGraph.width, canvasGraph.height);\n\n // draw the axes\n drawAxes()\n\n // draw the susceptible\n ctxGraph.beginPath();\n ctxGraph.strokeStyle = \"purple\";\n ctxGraph.lineWidth = 3;\n drawGraph(timeArray, susceptibleArray)\n ctxGraph.stroke();\n\n // draw the infected\n ctxGraph.beginPath();\n ctxGraph.strokeStyle = \"red\";\n ctxGraph.lineWidth = 3;\n drawGraph(timeArray, infectedArray)\n ctxGraph.stroke();\n\n // draw the immune\n ctxGraph.beginPath();\n ctxGraph.strokeStyle = \"green\";\n ctxGraph.lineWidth = 3;\n drawGraph(timeArray, immuneArray)\n ctxGraph.stroke();\n\n // draw the deaths\n ctxGraph.beginPath();\n ctxGraph.strokeStyle = \"black\";\n ctxGraph.lineWidth = 3;\n drawGraph(timeArray, deathsArray)\n ctxGraph.stroke();\n}","drawCones(){\r\n // might be place where we add the x and y coords to the canvas to draw the cones\r\n for (let i = 0; i < this.numCones; i++)\r\n {\r\n cones[i].x = ((this.coneLoc[i].x));\r\n cones[i].y = (this.coneLoc[i].y);\r\n }\r\n }","function CubicPoly(){}","function bobaTick(nodes, strokeWidth, cupRadius, hyp2, w) {\n // console.log('tick');\n\n nodes.attr('cx', function (d) {\n return d.x = magicInternetFunction(d.rad, d.x, d.y, strokeWidth, cupRadius, hyp2, w);\n })\n .attr('cy', function (d) {\n return d.y = magicInternetFunction(d.rad, d.y, d.x, strokeWidth, cupRadius, hyp2, w);\n });\n }","function draw() {\n ellipseMode(CENTER);\n drawTrack(h1Pat, whatY(1));\n drawTrack(h2Pat, whatY(2));\n drawTrack(snPat, whatY(3));\n drawTrack(shPat, whatY(4));\n drawTrack(k1Pat, whatY(5));\n drawTrack(k2Pat, whatY(6));\n getTrackCenters();\n}","function drawCases(){\n clear();\n \n div.hide();\n let data = boundary[0].the_geom.coordinates[0];\n stroke(255);\n fill(100,100,100, 50);\n\tbeginShape();\n\t\tfor (var i = 0; i < data.length; i++) {\n\t\t\tlet lon = boundary[0].the_geom.coordinates[0][i][0];\n let lat = boundary[0].the_geom.coordinates[0][i][1];\n \n const p = myMap.latLngToPixel(lat, lon);\n\n\t\t\tlet x = map(lon, city_limit.xMin, city_limit.xMax, 0+padding, width-padding);\n\t\t\tlet y = map(lat,city_limit.yMin, city_limit.yMax, height-padding, 0+padding);\n\n\t\t\tvertex(p.x,p.y);\n\t\t}\n\tendShape(CLOSE);\n\n\n fill(109, 255, 0);\n stroke(100);\n for(var i = 0; i < Object.keys(covidData).length; i++)\n {\n\n const latitude = covidData[i][\"attributes\"][\"Y\"];\n const longitude = covidData[i][\"attributes\"][\"X\"];\n \n\n //if (myMap.map.getBounds().contains([latitude, longitude])) {\n // Transform lat/lng to pixel position\n const pos = myMap.latLngToPixel(latitude, longitude);\n \n //map(value, start1, stop1, start2, stop2)\n let size = covidData[i][\"attributes\"][\"Point_Count\"];\n size = map(size, 0, covidData[0][\"attributes\"][\"Point_Count\"], 1, 25) + myMap.zoom();\n ellipse(pos.x, pos.y, size, size); \n\n \n }\n\n }","function colorwheel(a,theta,x){return a*(1+cos(theta+x))}","function drawCylinder() {\t\r\n\t\t//TODO: update VBO positions based on 'factor' for cone-like effect\r\n\t\tmeshes.cylinder.drawMode = gl.LINE_LOOP;\r\n\t\t\r\n\t\t// Render\r\n\t\tmeshes.cylinder.setAttribLocs(attribs);\r\n\t\tmeshes.cylinder.render();\t\t\t\t\r\n\t}"],"string":"[\n \"plotCyclists() {\\n for (let c of this.mapCyclists) {\\n if (c.cyclist.id.id == \\\"0_ghost\\\" || c.cyclist.id.id == \\\"ghost\\\") {\\n c.plotGhost(this.map);\\n } else {\\n c.plotMarker(this.map);\\n }\\n }\\n }\",\n \"axisPlot() {\\n this.ctx = this.canvas.getContext(\\\"2d\\\");\\n\\n /**\\n * Grid grid\\n */\\n if (this.grid.grid) {\\n this.ctx.beginPath();\\n this.ctx.font = 'italic 18pt Calibri';\\n this.ctx.strokeStyle = '#979797';\\n this.ctx.lineWidth = 1;\\n this.ctx.setLineDash([10, 15]);\\n for (let i = 30; i < this.field.width; i+= 100) {\\n this.ctx.fillText(Math.ceil(this.ScreenToWorldY(i)*1000)/1000, 0, i);\\n this.ctx.moveTo(0, i);\\n this.ctx.lineTo(this.field.width, i);\\n }\\n for (let i = 100; i < this.field.width; i+= 100) {\\n this.ctx.fillText(Math.ceil(this.ScreenToWorldX(i)*1000)/1000, i, this.field.height);\\n this.ctx.moveTo(i, 0);\\n this.ctx.lineTo(i, this.field.height);\\n }\\n this.ctx.stroke();\\n this.ctx.closePath();\\n }\\n\\n\\n /**\\n * Grid axiss\\n */\\n if (this.grid.axiss) {\\n this.ctx.beginPath();\\n this.ctx.strokeStyle = '#b10009';\\n this.ctx.lineWidth = 2;\\n this.ctx.setLineDash([]);\\n\\n this.ctx.moveTo(this.center.x, 0);\\n this.ctx.lineTo(this.center.x, this.field.height);\\n\\n this.ctx.moveTo(0, this.center.y);\\n this.ctx.lineTo(this.field.width, this.center.y);\\n\\n this.ctx.stroke();\\n this.ctx.closePath();\\n }\\n\\n\\n if (this.grid.serifs) {\\n this.ctx.beginPath();\\n this.ctx.strokeStyle = '#058600';\\n this.ctx.fillStyle = '#888888'\\n this.ctx.lineWidth = 2;\\n this.ctx.setLineDash([]);\\n\\n let start = 0;\\n if (!this.grid.serifsStep){\\n return;\\n }\\n\\n let s = Math.abs(\\n this.ScreenToWorldY(0) -\\n this.ScreenToWorldY(this.grid.serifsSize)\\n );\\n\\n /**\\n * To right & to left\\n */\\n if ((this.center.y > 0) && (this.center.y < this.field.height)) {\\n\\n let finish = this.ScreenToWorldX(this.field.width);\\n\\n for (let i = start; i < finish; i+=this.grid.serifsStep) {\\n this.moveTo(i+this.grid.serifsStep/2,(s/2));\\n this.lineTo(i+this.grid.serifsStep/2,-(s/2));\\n this.ctx.fillText(i+this.grid.serifsStep/2, this.WorldToScreenX(i+this.grid.serifsStep/2), this.WorldToScreenY(s/2));\\n\\n this.moveTo(i+this.grid.serifsStep,s);\\n this.lineTo(i+this.grid.serifsStep,-s);\\n this.ctx.fillText(i+this.grid.serifsStep, this.WorldToScreenX(i+this.grid.serifsStep), this.WorldToScreenY(s));\\n }\\n\\n finish = this.ScreenToWorldX(0);\\n\\n for (let i = start; i > finish; i-=this.grid.serifsStep) {\\n this.moveTo(i-this.grid.serifsStep/2,(s/2));\\n this.lineTo(i-this.grid.serifsStep/2,-(s/2));\\n this.ctx.fillText(i-this.grid.serifsStep/2, this.WorldToScreenX(i-this.grid.serifsStep/2), this.WorldToScreenY(s/2));\\n\\n this.moveTo(i-this.grid.serifsStep,s);\\n this.lineTo(i-this.grid.serifsStep,-s);\\n this.ctx.fillText(i-this.grid.serifsStep, this.WorldToScreenX(i-this.grid.serifsStep), this.WorldToScreenY(s));\\n }\\n }\\n\\n /**\\n * To top & to bot\\n */\\n if ((this.center.x > 0) && (this.center.x < this.field.width)) {\\n\\n start = 0;\\n let finish = this.ScreenToWorldY(0);\\n\\n for (let i = start; i < finish; i+=this.grid.serifsStep) {\\n this.moveTo((s/2),i+this.grid.serifsStep/2);\\n this.lineTo(-(s/2),i+this.grid.serifsStep/2);\\n this.ctx.fillText(i+this.grid.serifsStep/2, this.WorldToScreenX(s/2), this.WorldToScreenY(i+this.grid.serifsStep/2));\\n\\n this.moveTo(s, i+this.grid.serifsStep);\\n this.lineTo(-s, i+this.grid.serifsStep);\\n this.ctx.fillText(i+this.grid.serifsStep, this.WorldToScreenX(s), this.WorldToScreenY(i+this.grid.serifsStep));\\n }\\n\\n finish = this.ScreenToWorldY(this.field.width);\\n\\n for (let i = start; i > finish-this.grid.serifsStep; i-=this.grid.serifsStep) {\\n this.moveTo((s/2),i+this.grid.serifsStep/2);\\n this.lineTo(-(s/2),i+this.grid.serifsStep/2);\\n this.ctx.fillText(i+this.grid.serifsStep/2, this.WorldToScreenX(s/2), this.WorldToScreenY(i+this.grid.serifsStep/2));\\n\\n this.moveTo(s, i+this.grid.serifsStep);\\n this.lineTo( -s, i+this.grid.serifsStep);\\n this.ctx.fillText(i+this.grid.serifsStep, this.WorldToScreenX(s), this.WorldToScreenY(i+this.grid.serifsStep));\\n }\\n }\\n this.ctx.stroke();\\n this.ctx.closePath();\\n }\\n }\",\n \"function plot() {\\n \\n }\",\n \"plot() {\\n return \\\"Cute alien takes over the earth\\\";\\n }\",\n \"function plotGraph() {\\n if (houses.data.length > 0) {\\n for (let i = 0; i < houses.data.length; i++) {\\n xs[i] = map(houses.data[i].inputs[0], 0, zoom, 0, wnx);\\n ys[i] = map(houses.data[i].inputs[1], 0, zoom, wny, 200);\\n cs[i] = houses.data[i].inputs[8];\\n ps[i] = houses.data[i].target[0];\\n }\\n }\\n}\",\n \"function tick(){\\n\\n d3.selectAll('.circ')\\n .attr('cx', function(d){return d.x})\\n .attr('cy', function(d){return d.y})\\n\\n }\",\n \"function concentric() {\\n let n = 12\\n let res = [WIDTH/2, WIDTH/2]\\n for (let r = 100; r < 360; r+=60) {\\n for (let i=0; i<n; i++) {\\n let x = WIDTH/2 + r * Math.cos(360 * 0.0174533 * i/n)\\n let y = WIDTH/2 + r * Math.sin(360 * 0.0174533 * i/n)\\n res.push(x, y)\\n }\\n }\\n return res\\n}\",\n \"function Cylindrical( radius, theta, y ) {\\n\\n\\tthis.radius = ( radius !== undefined ) ? radius : 1.0; // distance from the origin to a point in the x-z plane\\n\\tthis.theta = ( theta !== undefined ) ? theta : 0; // counterclockwise angle in the x-z plane measured in radians from the positive z-axis\\n\\tthis.y = ( y !== undefined ) ? y : 0; // height above the x-z plane\\n\\n\\treturn this;\\n\\n}\",\n \"function Cylindrical( radius, theta, y ) {\\n\\n\\tthis.radius = ( radius !== undefined ) ? radius : 1.0; // distance from the origin to a point in the x-z plane\\n\\tthis.theta = ( theta !== undefined ) ? theta : 0; // counterclockwise angle in the x-z plane measured in radians from the positive z-axis\\n\\tthis.y = ( y !== undefined ) ? y : 0; // height above the x-z plane\\n\\n\\treturn this;\\n\\n}\",\n \"function plot() {\\n\\n}\",\n \"function draw_cos(){\\n\\tvar x_increments = parseFloat(document.getElementById('x_inc').value)\\n\\tvar y_increments = parseFloat(document.getElementById('y_inc').value)\\n\\n if (loopcounter !=0){\\n\\n\\t\\tif((x_increments != last_x_inc) || (y_increments != last_y_inc)){\\n\\t\\t\\tclear();\\n\\t\\t\\tdraw_axis();\\n\\t\\t\\tdraw_ticks();\\n\\t\\t}\\n\\tdraw_adjusted_cos_fn()\\n\\tlast_x_inc = x_increments\\n\\tlast_y_inc = y_increments\\n\\t}\\n\\n\\tif (loopcounter == 0){\\n\\n\\t\\tdraw_adjusted_cos_fn()\\n\\t\\tlast_x_inc = x_increments\\n\\t\\tlast_y_inc = y_increments\\n\\t\\tloopcounter+=1\\n\\t}\\n\\n}\",\n \"function plotPoints(coords) {\\n ctx.fillStyle = 'green';\\n console.log(coords);\\n ctx.fillRect(coords.y, coords.x, 5, 5);\\n}\",\n \"function drawCartesianOverlay() {\\n \\\"use strict\\\";\\n //Draw heavier black lines for grid\\n ctx.beginPath();\\n ctx.moveTo(0.5, 300.5);\\n ctx.lineTo(800.5, 300.5);\\n ctx.moveTo(400.5, 0.5);\\n ctx.lineTo(400.5, 600.5);\\n ctx.strokeStyle = 'black';\\n ctx.lineWidth = 1.0;\\n ctx.stroke();\\n //-x arrow for line\\n ctx.beginPath();\\n ctx.moveTo(5.5, 295.5);\\n ctx.lineTo(0.5, 300.5);\\n ctx.lineTo(5.5, 305.5);\\n //+x arrow for line\\n ctx.moveTo(795.5, 295.5);\\n ctx.lineTo(800.5, 300.5);\\n ctx.lineTo(795.5, 305.5);\\n //+y arrow for line\\n ctx.moveTo(395.5, 5.0);\\n ctx.lineTo(400.5, 0.5);\\n ctx.lineTo(405.5, 5.0);\\n //-y arrow for line\\n ctx.moveTo(395.5, 595.5);\\n ctx.lineTo(400.5, 600.5);\\n ctx.lineTo(405.5, 595.5);\\n ctx.strokeStyle = 'black';\\n ctx.lineWidth = 1.0;\\n ctx.stroke();\\n //Label Graphs\\n ctx.font = \\\"9px Georgia\\\";\\n ctx.fillText(\\\"-x\\\", 1, 288);\\n ctx.fillText(\\\"+\\\", 790, 288);\\n ctx.fillText(\\\"x\\\", 795, 288);\\n ctx.fillText(\\\"-y\\\", 382, 597);\\n ctx.fillText(\\\"+\\\", 381, 8);\\n ctx.fillText(\\\"y\\\", 386, 8);\\n}\",\n \"function trC(coord){\\n\\treturn -95 + coord*10;\\n}\",\n \"function Courbe(Y){\\t\\n\\t// Remise à zero de la courbe : \\n\\tvar svg = d3.select(\\\"#graph\\\");\\n\\n\\t// scaleY\\n\\tvar scaleY = d3.scaleLinear();\\n\\t// J'inverse min et max car pour Y c'est inversé\\n\\tscaleY.domain([1,0]);\\n\\tscaleY.range([0,500]);\\n\\n\\t// Axe Y\\n\\tvar yAxis = d3.axisLeft(scaleY);\\n\\tvar gyAxis = svg.select(\\\"#axisX\\\");\\n\\tgyAxis.call(yAxis);\\n\\tgyAxis.attr(\\\"font-size\\\",28);\\n\\tgyAxis.attr(\\\"transform\\\",\\\"translate(50,50)\\\");\\n\\t\\n\\t// scaleX\\n\\tvar scaleX = d3.scaleLinear();\\n\\tscaleX.domain([0,24]);\\n\\tscaleX.range([0,800]);\\n\\t\\n\\t// Axe X\\n\\tvar xAxis = d3.axisBottom(scaleX);\\n\\tvar gxAxis = svg.select(\\\"#axisY\\\");\\n\\tgxAxis.call(xAxis.ticks(24));\\n\\tgxAxis.attr(\\\"font-size\\\",28);\\n\\tgxAxis.attr(\\\"transform\\\",\\\"translate(50,550)\\\");\\n\\t\\n\\t// Ajout titres des axes\\n\\tvar tmp =\\\"\\\";\\n\\ttmp +='<text x=\\\"450\\\" y=\\\"620\\\" font-size=\\\"28\\\" fill=\\\"black\\\" style=\\\"text-anchor: middle\\\" >Heure</text>';\\n\\ttmp += ' <text x=\\\"100\\\" y=\\\"0\\\" font-size=\\\"28\\\" fill=\\\"black\\\" style=\\\"text-anchor: middle\\\" >Flux de sève (mm/h)</text>';\\n\\tvar titre_axes = document.getElementById(\\\"texte\\\");\\n\\ttitre_axes.innerHTML = tmp;\\t\\n\\n\\t// line\\n\\tvar lValues = d3.line();\\n\\tlValues.x(function(d,i) { return scaleX(i/2) });\\n\\tlValues.y(function(d) { return scaleY(d)});\\n\\tvar gLine = svg.select(\\\".courbe\\\")\\n\\t.attr(\\\"transform\\\", \\\"translate(50,50)\\\")\\n\\t.attr(\\\"stroke\\\", \\\"green\\\")\\n\\t.attr(\\\"stroke-width\\\",2 )\\n\\t.attr(\\\"fill\\\", \\\"none\\\")\\n\\t.transition()\\n\\t.duration(500)\\n\\t.on(\\\"start\\\", function(d){\\n\\t\\tvar gPoints = document.getElementById(\\\"points\\\");\\n\\t\\tgPoints.innerHTML = \\\"\\\" ;\\t\\n\\t})\\n\\t.on(\\\"end\\\", function(d){\\n\\t\\t// Ajout des points\\n\\t\\tcir =\\\"\\\";\\n\\t\\tfor (j=0;j<Y.length;j++) {\\n\\t\\t\\tcir +=' <circle transform = \\\"translate(50,50)\\\" onmouseover=\\\"drawInfoBox('+Y[j]+','+j+','+scaleX(j)+','+scaleY(Y[j])+')\\\" onmouseleave=\\\"removeInfoBox()\\\" \\tcx=\\\"'+scaleX(j/2)+'\\\" cy=\\\"'+scaleY(Y[j])+'\\\" r=\\\"5\\\" fill=\\\"green\\\" />' ;\\n\\t\\t}\\n\\t\\tvar gPoints = document.getElementById(\\\"points\\\");\\n\\t\\tgPoints.innerHTML = cir ;\\t\\t\\n\\t})\\n\\t.attr(\\\"d\\\", lValues(Y));\\t\\t\\n}\",\n \"function drawcylinder(gl,canvas,a_Position,r,s,x1,y1,x2,y2,numpolyline){\\r\\n Acolor = 1 - (numpolyline/255) \\r\\n // ** DRAW CYLINDERS **\\r\\n //\\r\\n // multiply degrees by convert to get value in radians \\r\\n // a circle is 360 degrees, rotate by (360 / s) degrees for every side, where n is number of sides!\\r\\n let convert = Math.PI/180 \\r\\n let numsides = 360/s\\r\\n\\r\\n // get the angle that the line segment forms\\r\\n let deltaX = x2-x1\\r\\n let deltaY = y2-y1 \\r\\n let degreeToRotate = Math.atan2(deltaY,deltaX)\\r\\n degreeToRotate = ((2* Math.PI)-degreeToRotate)\\r\\n \\r\\n // first we'll draw a circle by rotating around the x axis, then use a transformation matrix to rotate it\\r\\n // by the angle we found previously so the circle fits around the axis formed by the line segment\\r\\n let unrotated = []\\r\\n\\r\\n for (var i=0 ; i <=360; i+=numsides){ \\r\\n unrotated.push(0)\\r\\n unrotated.push((Math.cos(convert*i))*r)\\r\\n unrotated.push(Math.sin(convert*i)*r)\\r\\n } \\r\\n let cylinder_points = [] \\r\\n let indices = []\\r\\n let colors = []\\r\\n let normie = []\\r\\n //first circle\\r\\n for (var i = 0 ; i < unrotated.length; i+=3){\\r\\n cylinder_points.push((unrotated[i] * Math.cos(degreeToRotate)) + (unrotated[i+1] * Math.sin(degreeToRotate)) + x1) \\r\\n cylinder_points.push((unrotated[i] * (-1 * Math.sin(degreeToRotate))) + (unrotated[i+1] * Math.cos(degreeToRotate)) + y1)\\r\\n cylinder_points.push(unrotated[i+2])\\r\\n }\\r\\n\\r\\n // second circle\\r\\n for (var i = 0 ; i < unrotated.length; i+=3){\\r\\n cylinder_points.push((unrotated[i] * Math.cos(degreeToRotate)) + (unrotated[i+1] * Math.sin(degreeToRotate)) + x2) \\r\\n cylinder_points.push((unrotated[i] * (-1 * Math.sin(degreeToRotate))) + (unrotated[i+1] * Math.cos(degreeToRotate)) + y2)\\r\\n cylinder_points.push(unrotated[i+2])\\r\\n }\\r\\n\\r\\n \\r\\n //calculate face normals from cylinder points \\r\\n let cylindernormals = calcnormals(gl,canvas,a_Position,r,s,x1,y1,x2,y2,cylinder_points) \\r\\n // n+1th normal (the point that comes after the last point is the same as the first point) \\r\\n cylindernormals.push(cylindernormals[0])\\r\\n cylindernormals.push(cylindernormals[1])\\r\\n cylindernormals.push(cylindernormals[2])\\r\\n cylinder_points = []\\r\\n colors = []\\r\\n \\r\\n cylinder_points.push((unrotated[0] * Math.cos(degreeToRotate)) + (unrotated[1] * Math.sin(degreeToRotate)) + x1) \\r\\n cylinder_points.push((unrotated[0] * (-1 * Math.sin(degreeToRotate))) + (unrotated[1] * Math.cos(degreeToRotate)) + y1)\\r\\n cylinder_points.push(unrotated[2])\\r\\n normie.push((cylindernormals[0]+cylindernormals[27]) / 2)\\r\\n normie.push((cylindernormals[1]+cylindernormals[28]) / 2)\\r\\n normie.push((cylindernormals[2]+cylindernormals[29]) / 2)\\r\\n colors.push(Rcolor)\\r\\n colors.push(Gcolor)\\r\\n colors.push(Bcolor)\\r\\n colors.push(Acolor)\\r\\n\\r\\n\\r\\n for (var i = 1 ; i < s+1; i++){\\r\\n cylinder_points.push((unrotated[3*i] * Math.cos(degreeToRotate)) + (unrotated[3*i+1] * Math.sin(degreeToRotate)) + x1) \\r\\n cylinder_points.push((unrotated[3*i] * (-1 * Math.sin(degreeToRotate))) + (unrotated[3*i+1] * Math.cos(degreeToRotate)) + y1)\\r\\n cylinder_points.push(unrotated[3*i+2])\\r\\n normie.push((cylindernormals[3*i]+cylindernormals[3*(i-1)])/2) \\r\\n normie.push((cylindernormals[3*i+1]+cylindernormals[3*(i-1)+1])/2) \\r\\n normie.push((cylindernormals[3*i+2]+cylindernormals[3*(i-1)+2])/2) \\r\\n colors.push(Rcolor)\\r\\n colors.push(Gcolor)\\r\\n colors.push(Bcolor)\\r\\n colors.push(Acolor)\\r\\n }\\r\\n // second circle\\r\\n cylinder_points.push((unrotated[0] * Math.cos(degreeToRotate)) + (unrotated[1] * Math.sin(degreeToRotate)) + x2) \\r\\n cylinder_points.push((unrotated[0] * (-1 * Math.sin(degreeToRotate))) + (unrotated[1] * Math.cos(degreeToRotate)) + y2)\\r\\n cylinder_points.push(unrotated[2])\\r\\n normie.push((cylindernormals[0]+cylindernormals[27]) / 2)\\r\\n normie.push((cylindernormals[1]+cylindernormals[28]) / 2)\\r\\n normie.push((cylindernormals[2]+cylindernormals[29]) / 2)\\r\\n colors.push(Rcolor)\\r\\n colors.push(Gcolor)\\r\\n colors.push(Bcolor)\\r\\n colors.push(Acolor)\\r\\n for (var i = 1 ; i < s+1; i++){\\r\\n cylinder_points.push((unrotated[3*i] * Math.cos(degreeToRotate)) + (unrotated[3*i+1] * Math.sin(degreeToRotate)) + x2) \\r\\n cylinder_points.push((unrotated[3*i] * (-1 * Math.sin(degreeToRotate))) + (unrotated[3*i+1] * Math.cos(degreeToRotate)) + y2)\\r\\n cylinder_points.push(unrotated[3*i+2])\\r\\n normie.push((cylindernormals[3*i]+cylindernormals[3*(i-1)])/2) \\r\\n normie.push((cylindernormals[3*i+1]+cylindernormals[3*(i-1)+1])/2) \\r\\n normie.push((cylindernormals[3*i+2]+cylindernormals[3*(i-1)+2])/2) \\r\\n colors.push(Rcolor)\\r\\n colors.push(Gcolor)\\r\\n colors.push(Bcolor)\\r\\n colors.push(Acolor)\\r\\n }\\r\\n\\r\\n // 2 points to represent the center\\r\\n cylinder_points.push(x2) \\r\\n cylinder_points.push(y2)\\r\\n cylinder_points.push(0)\\r\\n colors.push(Rcolor)\\r\\n colors.push(Gcolor)\\r\\n colors.push(Bcolor)\\r\\n colors.push(Acolor)\\r\\n\\r\\n let len = cylinder_points.length/6\\r\\n // cool traiangles\\r\\n for (var i=0 ; i < s; i++){\\r\\n indices.push(i)\\r\\n indices.push(i+1) \\r\\n indices.push(len+i)\\r\\n indices.push(i)\\r\\n \\r\\n indices.push(i+1)\\r\\n indices.push(i)\\r\\n indices.push(len+i+1)\\r\\n indices.push(i+1)\\r\\n\\r\\n indices.push(len+i+1)\\r\\n indices.push(len+i) \\r\\n indices.push(i+1)\\r\\n indices.push(len+i+1)\\r\\n }\\r\\n\\r\\n var n = initVertexBuffers(gl,cylinder_points,colors,normie,indices)\\r\\n if (n<0){\\r\\n console.log('failed to set vert info')\\r\\n return\\r\\n }\\r\\n // Set the clear color and enable the depth test\\r\\n gl.enable(gl.DEPTH_TEST);\\r\\n initAttrib(gl,canvas,numpolyline)\\r\\n\\r\\n //draw the cylinder!\\r\\n gl.drawElements(gl.TRIANGLES, n, gl.UNSIGNED_BYTE, 0);\\r\\n \\r\\n\\r\\n // ** DRAW CAP **\\r\\n // (FOR SMOOTH EDGES) \\r\\n let cap_points = []\\r\\n if (previousFace.length < 1){\\r\\n // second circle\\r\\n for (var i = 0 ; i < s+1 ; i++){\\r\\n previousFace.push((unrotated[3*i] * Math.cos(degreeToRotate)) + (unrotated[3*i+1] * Math.sin(degreeToRotate)) + x2) \\r\\n previousFace.push((unrotated[3*i] * (-1 * Math.sin(degreeToRotate))) + (unrotated[3*i+1] * Math.cos(degreeToRotate)) + y2)\\r\\n previousFace.push(unrotated[3*i+2])\\r\\n }\\r\\n return\\r\\n } \\r\\n for (var j=0 ; j < previousFace.length ;j++){\\r\\n cap_points.push(previousFace[j]) \\r\\n }\\r\\n previousFace = []\\r\\n for (var i = 0 ; i < s+1 ; i++){\\r\\n cap_points.push((unrotated[3*i] * Math.cos(degreeToRotate)) + (unrotated[3*i+1] * Math.sin(degreeToRotate)) + x1) \\r\\n cap_points.push((unrotated[3*i] * (-1 * Math.sin(degreeToRotate))) + (unrotated[3*i+1] * Math.cos(degreeToRotate)) + y1)\\r\\n cap_points.push(unrotated[3*i+2])\\r\\n }\\r\\n for (var i = 0 ; i < s+1 ; i++){\\r\\n previousFace.push((unrotated[3*i] * Math.cos(degreeToRotate)) + (unrotated[3*i+1] * Math.sin(degreeToRotate)) + x2) \\r\\n previousFace.push((unrotated[3*i] * (-1 * Math.sin(degreeToRotate))) + (unrotated[3*i+1] * Math.cos(degreeToRotate)) + y2)\\r\\n previousFace.push(unrotated[3*i+2])\\r\\n }\\r\\n var capvertices = new Float32Array(cap_points)\\r\\n let caplen = capvertices.length/14;\\r\\n if (caplen === 0)\\r\\n return\\r\\n var n = initVertexBuffers(gl,capvertices,colors,normie,indices)\\r\\n if (n<0){\\r\\n console.log('failed to set vert info')\\r\\n return\\r\\n }\\r\\n // Set the clear color and enable the depth test\\r\\n gl.enable(gl.DEPTH_TEST);\\r\\n initAttrib(gl,canvas,numpolyline)\\r\\n //draw the cylinder!\\r\\n gl.drawElements(gl.TRIANGLES, n, gl.UNSIGNED_BYTE, 0);\\r\\n}\",\n \"function plotGrid() {\\n for (let i = 0; i < grid.length; i++) {\\n for (let j = 0; j < grid[i].length; j++) {\\n plotRectangle(i, j);\\n }\\n }\\n }\",\n \"function draw_axis(c){\\n\\n let yplot = 40;\\n let d =0;\\n\\n c.beginPath();\\n c.strokeStyle = \\\"blue\\\";\\n \\n c.moveTo(count_block(5),count_block(5));\\n c.lineTo(count_block(5), count_block(40));\\n c.lineTo(count_block(80), count_block(40));\\n\\n c.moveTo(count_block(5), count_block(40));\\n \\n \\n\\n //loop for the y-axix labels\\n for(let i = 1 ;i<=10;i++ ){\\n c.strokeText(d, count_block(2), count_block(yplot));\\n yplot-=5;\\n d+=500;\\n }\\n c.stroke();\\n\\n}\",\n \"function draw_axis(c){\\n\\n let yplot = 40;\\n let d =0;\\n\\n c.beginPath();\\n c.strokeStyle = \\\"black\\\";\\n \\n c.moveTo(count_block(5),count_block(5));\\n c.lineTo(count_block(5), count_block(40));\\n c.lineTo(count_block(80), count_block(40));\\n\\n c.moveTo(count_block(5), count_block(40));\\n \\n \\n\\n //loop for the y-axix labels\\n for(let i = 1 ;i<=10;i++ ){\\n c.strokeText(d, count_block(2), count_block(yplot));\\n yplot-=5;\\n d+=500;\\n }\\n c.stroke();\\n\\n}\",\n \"circumcenter(ax, ay, bx, by, cx, cy) \\n {\\n bx -= ax;\\n by -= ay;\\n cx -= ax;\\n cy -= ay;\\n\\n var bl = bx * bx + by * by;\\n var cl = cx * cx + cy * cy;\\n\\n var d = bx * cy - by * cx;\\n\\n var x = (cy * bl - by * cl) * 0.5 / d;\\n var y = (bx * cl - cx * bl) * 0.5 / d;\\n\\n return {\\n x: ax + x,\\n y: ay + y\\n };\\n }\",\n \"function draw() {\\n \\n // background(237, 34, 93);\\n for(let i = 0; i < h; i += 10) {\\n for(let j = 0; j < w; j+= 10) {\\n // if(i == cx[counting] && j == cy[counting]) {\\n point_color = 222;\\n strokeWeight(1);\\n stroke(point_color);\\n point(cx[counting],cy[counting])\\n counting++;\\n // } \\n } \\n // line(i, 0, i, h)\\n counting = 0;\\n }\\n\\n \\n}\",\n \"function drawcylinder(gl,canvas,a_Position,r,s,x1,y1,x2,y2){\\r\\n\\r\\n // ** DRAW CYLINDERS **\\r\\n //\\r\\n\\r\\n // multiply degrees by convert to get value in radians \\r\\n // a circle is 360 degrees, rotate by (360 / s) degrees for every side, where n is number of sides!\\r\\n const convert = Math.PI/180 \\r\\n const numsides = 360/s\\r\\n\\r\\n // get the angle that the line segment forms\\r\\n const deltaX = x2-x1\\r\\n const deltaY = y2-y1 \\r\\n let degreeToRotate = Math.atan2(deltaY,deltaX)\\r\\n degreeToRotate = ((2*Math.PI)-degreeToRotate)\\r\\n \\r\\n // first we'll draw a circle by rotating around the x axis, then use a transformation matrix to rotate it\\r\\n // by the angle we found previously so the circle fits around the axis formed by the line segment\\r\\n let unrotated = []\\r\\n\\r\\n for (var i=0 ; i <=360; i+=numsides){ \\r\\n unrotated.push(0)\\r\\n unrotated.push((Math.cos(convert*i))*r)\\r\\n unrotated.push(Math.sin(convert*i)*r)\\r\\n } \\r\\n for (var i=0 ; i <=360; i+=numsides){ \\r\\n unrotated.push(0)\\r\\n unrotated.push((Math.cos(convert*i))*r)\\r\\n unrotated.push(Math.sin(convert*i)*r)\\r\\n } \\r\\n\\r\\n // OUR ROTATIONAL MATRIX (Rotating around the Z axis):\\r\\n // cos sin (0)\\r\\n // -sin cos (0)\\r\\n // 0 0 1 \\r\\n \\r\\n // first circle\\r\\n for (var i = 0 ; i < unrotated.length/2 ; i+=3){\\r\\n cylinder_points.push((unrotated[i] * Math.cos(degreeToRotate)) + (unrotated[i+1] * Math.sin(degreeToRotate)) + x1) \\r\\n cylinder_points.push((unrotated[i] * (-1 * Math.sin(degreeToRotate))) + (unrotated[i+1] * Math.cos(degreeToRotate)) + y1)\\r\\n cylinder_points.push(unrotated[i+2])\\r\\n cylinder_points.push(Rcolor)\\r\\n cylinder_points.push(Gcolor)\\r\\n cylinder_points.push(Bcolor)\\r\\n cylinder_points.push(Acolor)\\r\\n }\\r\\n // second circle\\r\\n for (var i = unrotated.length/2; i < unrotated.length; i+=3){\\r\\n cylinder_points.push((unrotated[i] * Math.cos(degreeToRotate)) + (unrotated[i+1] * Math.sin(degreeToRotate)) +x2) \\r\\n cylinder_points.push((unrotated[i] * (-1 * Math.sin(degreeToRotate))) + (unrotated[i+1] * Math.cos(degreeToRotate)) +y2)\\r\\n cylinder_points.push(unrotated[i+2])\\r\\n cylinder_points.push(Rcolor)\\r\\n cylinder_points.push(Gcolor)\\r\\n cylinder_points.push(Bcolor)\\r\\n cylinder_points.push(Acolor)\\r\\n }\\r\\n let cylindernormals = calcnormals(gl,canvas,a_Position,r,s,x1,y1,x2,y2,cylinder_points) \\r\\n console.log(cylindernormals)\\r\\n // actually apply shading after calculating surface normals\\r\\n let colors = []\\r\\n // Lambertan Shading Ld = kD * I * Max(0,n dot vl)\\r\\n light1V = normalize(light1V)\\r\\n light2V = normalize(light2V)\\r\\n // now both the light and surface normal are length 1 \\r\\n \\r\\n let currentsurfacecolor = findsurfacecolor(light1C,defaultcolor)\\r\\n if (whiteLightBox.checked){\\r\\n colors = calculateColors(cylindernormals,light1V,currentsurfacecolor) \\r\\n }\\r\\n\\r\\n if (redLightBox.checked){ \\r\\n if (whiteLightBox.checked){\\r\\n currentsurfacecolor = findsurfacecolor (light2C,currentsurfacecolor)\\r\\n colors = calculateColors(cylindernormals,light2V,currentsurfacecolor) \\r\\n }\\r\\n else{\\r\\n currentsurfacecolor = findsurfacecolor (light2C,defaultcolor)\\r\\n colors = calculateColors(cylindernormals,light2V,currentsurfacecolor) \\r\\n }\\r\\n }\\r\\n cylinder_points = []\\r\\n if (colors.length == 0){\\r\\n console.log (\\\"Try Turning on a light!\\\")\\r\\n return\\r\\n }\\r\\n colors.push(colors[0]) \\r\\n\\r\\n for (var i = 0 ; i < s ; i++){\\r\\n cylinder_points.push((unrotated[3*i] * Math.cos(degreeToRotate)) + (unrotated[3*i+1] * Math.sin(degreeToRotate)) + x1) \\r\\n cylinder_points.push((unrotated[3*i] * (-1 * Math.sin(degreeToRotate))) + (unrotated[3*i+1] * Math.cos(degreeToRotate)) + y1)\\r\\n cylinder_points.push(unrotated[3*i+2])\\r\\n cylinder_points.push(colors[i][0])\\r\\n cylinder_points.push(colors[i][1])\\r\\n cylinder_points.push(colors[i][2])\\r\\n cylinder_points.push(colors[i][3])\\r\\n cylinder_points.push((unrotated[3*i+3] * Math.cos(degreeToRotate)) + (unrotated[3*i+4] * Math.sin(degreeToRotate)) + x1)\\r\\n cylinder_points.push((unrotated[3*i+3] * (-1 * Math.sin(degreeToRotate))) + (unrotated[3*i+4] * Math.cos(degreeToRotate)) + y1)\\r\\n cylinder_points.push(unrotated[3*i+5])\\r\\n cylinder_points.push(colors[i][0])\\r\\n cylinder_points.push(colors[i][1])\\r\\n cylinder_points.push(colors[i][2])\\r\\n cylinder_points.push(colors[i][3])\\r\\n }\\r\\n // second circle\\r\\n for (var i = 0 ; i < s ; i++){\\r\\n cylinder_points.push((unrotated[3*i] * Math.cos(degreeToRotate)) + (unrotated[3*i+1] * Math.sin(degreeToRotate)) + x2) \\r\\n cylinder_points.push((unrotated[3*i] * (-1 * Math.sin(degreeToRotate))) + (unrotated[3*i+1] * Math.cos(degreeToRotate)) + y2)\\r\\n cylinder_points.push(unrotated[3*i+2])\\r\\n cylinder_points.push(colors[i][0])\\r\\n cylinder_points.push(colors[i][1])\\r\\n cylinder_points.push(colors[i][2])\\r\\n cylinder_points.push(colors[i][3])\\r\\n cylinder_points.push((unrotated[3*i+3] * Math.cos(degreeToRotate)) + (unrotated[3*i+4] * Math.sin(degreeToRotate)) + x2)\\r\\n cylinder_points.push((unrotated[3*i+3] * (-1 * Math.sin(degreeToRotate))) + (unrotated[3*i+4] * Math.cos(degreeToRotate)) + y2)\\r\\n cylinder_points.push(unrotated[3*i+5])\\r\\n cylinder_points.push(colors[i][0])\\r\\n cylinder_points.push(colors[i][1])\\r\\n cylinder_points.push(colors[i][2])\\r\\n cylinder_points.push(colors[i][3])\\r\\n }\\r\\n\\r\\n let len = cylinder_points.length/14;\\r\\n let indices = []\\r\\n // cool traiangles\\r\\n for (var i=0 ; i < s; i++){\\r\\n\\r\\n indices.push(i)\\r\\n indices.push(i+1) \\r\\n indices.push(len+i)\\r\\n indices.push(i)\\r\\n \\r\\n indices.push(i+1)\\r\\n indices.push(i)\\r\\n indices.push(len+i+1)\\r\\n indices.push(i+1)\\r\\n\\r\\n indices.push(len+i+1)\\r\\n indices.push(len+i) \\r\\n indices.push(i+1)\\r\\n indices.push(len+i+1)\\r\\n\\r\\n\\r\\n }\\r\\n\\r\\n var vertices = new Float32Array(cylinder_points)\\r\\n setVertexBuffer(gl, new Float32Array(vertices))\\r\\n setIndexBuffer(gl, new Uint16Array(indices))\\r\\n // draw cylinder\\r\\n gl.drawElements(gl.TRIANGLES, indices.length, gl.UNSIGNED_SHORT, 0) \\r\\n //draw normal vectors ! (if applicable)\\r\\n calcnormals(gl,canvas,a_Position,r,s,x1,y1,x2,y2,cylinder_points) \\r\\n cylinder_points = []\\r\\n\\r\\n\\r\\n\\r\\n // ** DRAW CAP **\\r\\n // (FOR SMOOTH EDGES) \\r\\n\\r\\n let cap_points = []\\r\\n if (previousFace.length < 1){\\r\\n // second circle\\r\\n for (var i = 0 ; i < s ; i++){\\r\\n previousFace.push((unrotated[3*i] * Math.cos(degreeToRotate)) + (unrotated[3*i+1] * Math.sin(degreeToRotate)) + x2) \\r\\n previousFace.push((unrotated[3*i] * (-1 * Math.sin(degreeToRotate))) + (unrotated[3*i+1] * Math.cos(degreeToRotate)) + y2)\\r\\n previousFace.push(unrotated[3*i+2])\\r\\n previousFace.push(colors[i][0])\\r\\n previousFace.push(colors[i][1])\\r\\n previousFace.push(colors[i][2])\\r\\n previousFace.push(colors[i][3])\\r\\n previousFace.push((unrotated[3*i+3] * Math.cos(degreeToRotate)) + (unrotated[3*i+4] * Math.sin(degreeToRotate)) + x2)\\r\\n previousFace.push((unrotated[3*i+3] * (-1 * Math.sin(degreeToRotate))) + (unrotated[3*i+4] * Math.cos(degreeToRotate)) + y2)\\r\\n previousFace.push(unrotated[3*i+5])\\r\\n previousFace.push(colors[i][0])\\r\\n previousFace.push(colors[i][1])\\r\\n previousFace.push(colors[i][2])\\r\\n previousFace.push(colors[i][3])\\r\\n }\\r\\n return\\r\\n } \\r\\n for (var j=0 ; j < previousFace.length ;j++){\\r\\n cap_points.push(previousFace[j]) \\r\\n }\\r\\n\\r\\n previousFace = []\\r\\n for (var i = 0 ; i < s ; i++){\\r\\n cap_points.push((unrotated[3*i] * Math.cos(degreeToRotate)) + (unrotated[3*i+1] * Math.sin(degreeToRotate)) + x1) \\r\\n cap_points.push((unrotated[3*i] * (-1 * Math.sin(degreeToRotate))) + (unrotated[3*i+1] * Math.cos(degreeToRotate)) + y1)\\r\\n cap_points.push(unrotated[3*i+2])\\r\\n cap_points.push(colors[i][0])\\r\\n cap_points.push(colors[i][1])\\r\\n cap_points.push(colors[i][2])\\r\\n cap_points.push(colors[i][3])\\r\\n cap_points.push((unrotated[3*i+3] * Math.cos(degreeToRotate)) + (unrotated[3*i+4] * Math.sin(degreeToRotate)) + x1)\\r\\n cap_points.push((unrotated[3*i+3] * (-1 * Math.sin(degreeToRotate))) + (unrotated[3*i+4] * Math.cos(degreeToRotate)) + y1)\\r\\n cap_points.push(unrotated[3*i+5])\\r\\n cap_points.push(colors[i][0])\\r\\n cap_points.push(colors[i][1])\\r\\n cap_points.push(colors[i][2])\\r\\n cap_points.push(colors[i][3])\\r\\n }\\r\\n for (var i = 0 ; i < s ; i++){\\r\\n previousFace.push((unrotated[3*i] * Math.cos(degreeToRotate)) + (unrotated[3*i+1] * Math.sin(degreeToRotate)) + x2) \\r\\n previousFace.push((unrotated[3*i] * (-1 * Math.sin(degreeToRotate))) + (unrotated[3*i+1] * Math.cos(degreeToRotate)) + y2)\\r\\n previousFace.push(unrotated[3*i+2])\\r\\n previousFace.push(colors[i][0])\\r\\n previousFace.push(colors[i][1])\\r\\n previousFace.push(colors[i][2])\\r\\n previousFace.push(colors[i][3])\\r\\n previousFace.push((unrotated[3*i+3] * Math.cos(degreeToRotate)) + (unrotated[3*i+4] * Math.sin(degreeToRotate)) + x2)\\r\\n previousFace.push((unrotated[3*i+3] * (-1 * Math.sin(degreeToRotate))) + (unrotated[3*i+4] * Math.cos(degreeToRotate)) + y2)\\r\\n previousFace.push(unrotated[3*i+5])\\r\\n previousFace.push(colors[i][0])\\r\\n previousFace.push(colors[i][1])\\r\\n previousFace.push(colors[i][2])\\r\\n previousFace.push(colors[i][3])\\r\\n }\\r\\n var capvertices = new Float32Array(cap_points)\\r\\n let caplen = capvertices.length/14;\\r\\n if (caplen === 0)\\r\\n return\\r\\n setVertexBuffer(gl, new Float32Array(cap_points))\\r\\n setIndexBuffer(gl, new Uint16Array(indices))\\r\\n // draw caps \\r\\n gl.drawElements(gl.TRIANGLES, indices.length, gl.UNSIGNED_SHORT, 0)\\r\\n}\",\n \"function displayCoord(a) {\\r\\n\\t\\tc.beginPath();\\r\\n\\t\\tc.moveTo(parseInt(a[0],10)-3,output(parseInt(a[1],10)-3));\\r\\n\\t\\tc.lineTo(parseInt(a[0],10)+3,output(parseInt(a[1],10)+3));\\r\\n\\t\\tc.stroke();\\r\\n\\t\\tc.beginPath();\\r\\n\\t\\tc.moveTo(parseInt(a[0],10)-3,output(parseInt(a[1],10)+3));\\r\\n\\t\\tc.lineTo(parseInt(a[0],10)+3,output(parseInt(a[1],10)-3));\\r\\n\\t\\tc.stroke();\\r\\n\\t\\tif (showCoordsCheck) c.fillText(\\\"(\\\"+a[0]+\\\",\\\"+a[1]+\\\")\\\",parseInt(a[0],10)+10,output(parseInt(a[1],10)+10));\\r\\n\\t}\",\n \"function equilatGrid(L,R,dx,dy){\\n let yVals = [];\\n let ytip = 70;\\n let xtip = 300;\\n let yChange = dy/10;\\n let xChange = 2*dx/10\\n for(let i = 0; i < 9; i++){\\n yVals.push((ytip+dy)-yChange*(i+1));\\n }\\n push();\\n let x1, x2, y1, y2;\\n // Carrier grid\\n stroke(255,100,0,80);\\n for(let i = 0; i < yVals.length; i++){\\n y1 = yVals[i];\\n x1 = (y1-L[1])/L[0];\\n y2 = ytip + dy;\\n x2 = (xtip-dx) + xChange*(i+1);\\n line(x1,y1,x2,y2);\\n }\\n \\n // Solvent grid\\n stroke(128,0,128,80);\\n for(let i = 0; i < yVals.length; i++){\\n y1 = yVals[i];\\n x1 = (y1-R[1])/R[0];\\n y2 = ytip + dy;\\n x2 = (xtip+dx) - xChange*(i+1);\\n line(x1,y1,x2,y2);\\n }\\n // Solute grid\\n stroke(0,0,255,80);\\n for(let i = 0; i < yVals.length; i++){\\n y1 = yVals[i];\\n x1 = (y1-L[1])/L[0];\\n y2 = y1;\\n x2 = (y2-R[1])/R[0];\\n line(x1,y1,x2,y2);\\n }\\n pop();\\n}\",\n \"function plot(rows = 36, cols = 64) {\\n\\n /* 'c' will contain the whole generated html rect tags string to change innerhtml of enclosing div */\\n /* 'y' will denote the 'y' coordinate where the next grid must be placed */\\n let c = \\\"\\\", y = 0;\\n\\n /* Looping for each row */\\n for (let i = 0; i < rows; i++) {\\n\\n /* 'x' is a coordinate denoting where the next grid must be placed */\\n var x = 0;\\n\\n /* For each row we will loop for each column present in the Grid */\\n for (let j = 0; j < cols; j++) {\\n\\n /* 'colr' will store the rest grid color which is dark gray currently */\\n let colr = grid_color;\\n\\n /* If the Rectange present in the grid is on the border side then change the color in order to highlight borders */\\n if(i === 0 || j === 0 || i === rows - 1 || j === cols - 1){\\n colr = border_color;\\n }\\n\\n /* Creating a rect tag that is appending in 'c' for now and will be updated to innerhtml of enclosing div */\\n /* I know you will be wondering about the id given to each rect :-\\n * Each rect must be provided with id in order to do anything with the corresponding rect.\\n * Operations like coloring the grid as well saving saving any number in corresponding matrix needs an id of the rect.\\n * Hence id is important to allot to each rect to make further changes in matrix on which whole algo is based.\\n * In order to assing every rect id i decided to allot their corresponding row_number + : + col_number to be as id\\n * As with this scenario it is easy to remember and will be unique for every rect tag. \\n */\\n c += `<rect id=${i + \\\":\\\" + j} x=\\\"${x}\\\" y=\\\"${y}\\\" width=\\\"30\\\" height=\\\"30\\\" fill=\\\"${colr}\\\" r=\\\"0\\\" rx=\\\"0\\\" ry=\\\"0\\\" stroke=\\\"#000\\\" style=\\\"-webkit-tap-highlight-color: rgba(0, 0, 0, 0); stroke-opacity: 0.2;\\\" stroke-opacity=\\\"0.2\\\"></rect>`;\\n\\n /* Incrementing the 'x' coordinate as we have width of 30px and hence 'x' coordinate for next rect will be +30 from current pos. */\\n x += 30;\\n }\\n\\n /* Incrementing the 'y' coordinate as we have placed sufficient rect in 1 row now need to advance 'y' as height of each rect \\n is 30px hence for every rect in next column the y coordinate will be +30*/\\n y += 30;\\n }\\n\\n /* At last after creating rect tags using loops, now update innerHtml of enclosing div with id='container'[grid.html] */\\n document.getElementById(\\\"container\\\").innerHTML = c;\\n\\n /* I wanted to preplace the Source - coordinate so at rect with id='src_crd' will be coloured green */\\n document.getElementById(src_crd).style.fill = \\\"rgb(0, 255, 0)\\\";\\n matrix[split(src_crd, 0)][split(src_crd, 1)] = 1; /* Update the pos as '1' to denote source location */\\n\\n /* I wanted to preplace the Destination - coordinate so at rect with id='dst_crd' will be coloured Red */\\n document.getElementById(dst_crd).style.fill = \\\"rgb(255, 0, 0)\\\";\\n matrix[split(dst_crd, 0)][split(dst_crd, 1)] = 2; /* Update the pos as '2' to denote Destination location */\\n\\n }\",\n \"draw_axes(gfx) {\\n // Drawing in white\\n gfx.noFill();\\n gfx.stroke(255);\\n\\n // Draw the unit circle (width and height 2)\\n gfx.ellipse(0, 0, 2, 2);\\n\\n // Draw x- and y-axes\\n gfx.line(-10, 0, 10, 0);\\n gfx.line(0, -10, 0, 10);\\n }\",\n \"constructor(x1, y1, x2, y2, c)\\n {\\n this.x1 = x1;\\n this.y1 = y1;\\n this.x2 = x2;\\n this.y2 = y2;\\n this.c = c;\\n }\",\n \"show() {\\n fill(255);\\n noStroke();\\n let sx = map(this.x/this.z, 0, 1, 0, width);\\n let sy = map(this.y/this.z, 0, 1, 0, height);\\n let r = map(this.z, 0, width, 8, 0);\\n //ellipse(sx, sy, r, r);\\n stroke(255);\\n let px = map(this.x/this.pz, 0, 1, 0, width);\\n let py = map(this.y/this.pz, 0, 1, 0, height);\\n line(px,py, sx, sy);\\n this.pz = this.z;\\n }\",\n \"function ColorPlot(canvasId) {\\n\\tif(typeof(canvasId) === 'undefined' ) \\n\\t\\tcanvasId = \\\"plotcanvas\\\";\\n\\n\\tthis.canvasId = canvasId; \\n\\t\\t\\n\\tthis.minX = 0;\\n\\tthis.maxX = 10;\\n\\tthis.scaleX = 1;\\n\\tthis.scaleY = 1;\\n\\tthis.minY = 0;\\n\\tthis.maxY = 1.5;\\t\\n\\tthis.minZ = 0;\\n\\tthis.maxZ = 1;\\n\\t\\t \\n\\tthis.x = new Array();\\n\\tthis.y= new Array();\\n\\tthis.z= new Array();\\n\\t\\n\\tthis.cmap = this.colormap();\\n\\t\\n\\tvar canvas = document.getElementById(this.canvasId);\\n\\tthis.buffer = document.createElement('canvas');\\n\\tthis.buffer.width = canvas.width;\\n\\tthis.buffer.height = canvas.height;\\n\\t\\n\\tthis.viewX = 0;\\n\\tthis.viewY = 0;\\n\\n}\",\n \"function drawPCGraph() {\\r\\n\\r\\n\\tvar x = d3.scale.ordinal().rangePoints([0, 480], 1),\\r\\n y= {};\\r\\n \\r\\n for (var dim in cars[0]) {\\r\\n\\t if (dim != \\\"name\\\") {\\r\\n\\t\\t y[dim] = d3.scale.linear()\\r\\n\\t\\t\\t .domain([d3.min(cars, function(d) { return +d[dim]; }), d3.max(cars, function(d) { return +d[dim]; })])\\r\\n\\t\\t .range([height,0]);\\r\\n\\t }\\r\\n }\\r\\n \\r\\n//sets the x domain dimensions\\r\\n x.domain(dimensions = d3.keys(cars[0]).filter(function(d) { return d != \\\"name\\\";}));\\r\\n\\r\\n//draws the polylines\\r\\n for (var i=1; i< cars.length; i++) { //for each car\\r\\n\\r\\n//prepare the coordinates for a polyline\\r\\n\\t var lineData = []; //initialize an array for coordinates of a polyline\\r\\n\\t for (var prop in cars[0]) { \\r\\n\\t if (prop != \\\"name\\\" ) {\\r\\n\\t var point = {}; \\r\\n\\t var val = cars[i][prop];\\r\\n\\t\\t point['x'] = x(prop); \\r\\n\\t point['y'] = y[prop](val);\\r\\n\\t lineData.push(point);\\r\\n\\t }\\r\\n\\t }\\r\\n\\r\\n//draws a polyline based on the coordindates \\r\\n chart.append(\\\"g\\\")\\r\\n\\t .attr(\\\"class\\\", \\\"polyline\\\")\\r\\n\\t .append(\\\"path\\\")\\r\\n\\t\\t .attr(\\\"d\\\", line(lineData))\\r\\n\\t\\r\\n//Changes stroke red when mouseover\\r\\n\\t.on(\\\"mouseover\\\", function(){\\r\\n\\t\\t\\td3.select(this)\\r\\n\\t\\t.style(\\\"stroke\\\",\\\"red\\\")\\r\\n\\t })\\r\\n\\t.on(\\\"mouseout\\\", function(){\\r\\n\\t\\td3.select(this)\\r\\n\\t\\t.style(\\\"stroke\\\",null)\\r\\n\\t\\t\\r\\n})\\r\\n }\\r\\n\\r\\n var g = chart.selectAll(\\\".dimension\\\")\\r\\n\\t .data(dimensions)\\r\\n\\t .enter().append(\\\"g\\\")\\r\\n\\t .attr(\\\"class\\\", \\\"dimension\\\")\\r\\n\\t .attr(\\\"transform\\\", function(d) { return \\\"translate(\\\" + x(d) + \\\")\\\"; }) //translate each axis\\r\\n\\r\\n g.append(\\\"g\\\")\\r\\n\\t .attr(\\\"class\\\", \\\"axis\\\")\\r\\n\\t .each(function(d) { d3.select(this).call(axis.scale(y[d])); })\\r\\n\\t .append(\\\"text\\\")\\r\\n\\t .style(\\\"text-anchor\\\", \\\"middle\\\")\\r\\n\\t .attr(\\\"y\\\", -4)\\r\\n\\t .text(function(d) { return d; });\\r\\n\\t \\r\\n \\r\\n}\",\n \"function show(c, r, l) {\\n var col = l.rgb();\\n var str = '(' + col.r + ', ' + col.g + ', ' + col.b + ')';\\n\\n document.getElementById('xcoord').innerHTML = c[0];\\n document.getElementById('ycoord').innerHTML = c[1];\\n document.getElementById('radius').innerHTML = r;\\n document.getElementById('current-color').innerHTML = l.hex();\\n document.getElementById('rgb-color').innerHTML = str;\\n}\",\n \"function plot(x) { \\n var canvas = document.getElementById(\\\"canvas\\\"); \\n var c = canvas.getContext(\\\"2d\\\"); \\n var canvasStyle = window.getComputedStyle(canvas, null); \\n var width = parseInt(canvasStyle.width);\\n var height= parseInt(canvasStyle.height); \\n var offset = (1 / (x.length - 1)) * width;\\n var maxX = x.reduce(function(a, b) { return Math.max(a, b);});\\n var minX = x.reduce(function(a, b) { return Math.min(a, b);});\\n // scale the input values to be plotted\\n function drawToScale(input) {\\n return height - ( (input-minX)*height) / (maxX-minX); \\n } \\n // remove the previuous lines\\n c.clearRect(0, 0, width, height) \\n // plot the new ones\\n c.beginPath();\\n c.moveTo(0, drawToScale(x[0]));\\n for (var i = 1; i < x.length; i++) {\\n c.lineTo(i * offset, drawToScale(x[i]) );\\n }\\n c.stroke();\\n }\",\n \"function Circular() {\\n\\tvar D = document.getElementById(\\\"D\\\").value;\\n\\tvar Area, Cx, Cy, Ixx, Iyy;\\n\\tif (D == undefined) {\\n\\t\\talert: \\\"Please Enter a Valid input\\\";\\n\\t}\\n\\tArea = 3.14 * D * D / 4;\\n\\tCx = 0;\\n\\tCy = 0;\\n\\tIxx = (3.14 / 64) * Math.pow(D,4);\\n\\tIyy = Ixx;\\n\\tdocument.getElementById(\\\"area\\\").innerHTML = Area + \\\" m^2\\\";\\n\\tdocument.getElementById(\\\"cog-x\\\").innerHTML = Cx + \\\" m\\\";\\n\\tdocument.getElementById(\\\"cog-y\\\").innerHTML = Cy + \\\" m\\\";\\n\\tdocument.getElementById(\\\"moi-xx\\\").innerHTML = Ixx + \\\" m^4\\\";\\n\\tdocument.getElementById(\\\"moi-yy\\\").innerHTML = Iyy + \\\" m^4\\\";\\n}\",\n \"function drawGridCentre(x,y,s,rot){\\r\\n ctx.save();\\r\\n ctx.translate(x,y);\\r\\n ctx.rotate(rot*Math.PI/180);\\r\\n drawCircle(0,0,20, colArray[0], colArray[0], 2, false, true);\\r\\n for(j = 0; j<7 ; j++){\\r\\n for(var i = 0 ; i<7 ; i++){\\r\\n drawRectangle(0-s/2+i*s/7,0-s/2+j*s/7, s/7,s/7,colArray[3], colArray[4],0.5, false, true);\\r\\n }\\r\\n }\\r\\n ctx.restore();\\r\\n}\",\n \"function plot(x,y,color){\\n ctx.fillStyle = color;\\n ctx.fillRect(x,y,1,1);\\n }\",\n \"function plot(data) {\\r\\n\\tconvertData(data);\\r\\n\\tcreateScales(data);\\r\\n\\taddAxes();\\r\\n\\taddGridlines();\\r\\n\\tgroupDataByMainLifts(data);\\r\\n\\tgroupDataByBw(data);\\r\\n\\tdrawLines(mainLiftData);\\r\\n\\tdrawLineLabels(mainLiftData);\\r\\n\\tdrawBwLine(bwData)\\r\\n\\tdrawCircles(data);\\r\\n\\tdrawReps(data);\\r\\n\\tconsole.log((bwData))\\r\\n}\",\n \"plot() {\\n if (this.plot === 'Cumulative frequency plot' ||\\n this.plot === 'Dot plot') {\\n this.createPlot();\\n }\\n }\",\n \"function drawCircleGrid() {\\n\\t\\tfor (var i = 180; i <= 1100; i+=100) {\\n\\t\\t\\tfor (var j = 50; j <= 1100; j+=100) {\\n\\t\\t\\t\\tvar myCircle = new Path.Circle(new Point(i, j), 10);\\n\\t\\t\\t\\tmyCircle.fillColor = hue();\\n\\t\\t\\t}\\n\\t\\t}\\n\\t}\",\n \"function CubicPoly() {\\n\\n\\t \\t}\",\n \"function drawCanyon(t_canyon)\\n{\\n\\tfor(var i = 0; i < canyons.length; i++)\\n\\t{\\n\\t\\tfill(184, 134, 11);\\n\\t\\trect(t_canyon.x_pos,432,t_canyon.width,150);\\n\\t\\tnoStroke();\\n\\t\\tfill(255);\\n\\t}\\n}\",\n \"function init_xy(){\\n\\n\\t\\t\\tg.append(\\\"line\\\")\\n\\t\\t\\t\\t.attr(\\\"class\\\", \\\"xy\\\")\\n\\t\\t\\t\\t.attr(\\\"x1\\\", 0)\\n\\t\\t\\t\\t.attr(\\\"x2\\\", inner_w )\\n\\t\\t\\t\\t.attr(\\\"y1\\\", h + 20)\\n\\t\\t\\t\\t.attr(\\\"y2\\\", h + 20)\\n\\t\\t\\t\\t.style(\\\"stroke\\\", \\\"#CCC\\\")\\n\\t\\t\\t\\t.style(\\\"stroke-width\\\", \\\"1px\\\")\\n\\t\\t\\t\\t.style(\\\"stroke-dasharray\\\", \\\"5 3\\\");\\n\\n\\t\\t}\",\n \"function drawCanyon(t_canyon) {\\n {\\n fill(101, 33, 67)\\n noStroke();\\n rect(t_canyon.canyonPos_x, t_canyon.canyonPos_y, t_canyon.width, t_canyon.height)\\n }\\n\\n}\",\n \"function _via_draw_control_point(cx, cy) {\\n _via_reg_ctx.beginPath();\\n _via_reg_ctx.arc(cx, cy, VIA_REGION_POINT_RADIUS, 0, 2*Math.PI, false);\\n _via_reg_ctx.closePath();\\n\\n _via_reg_ctx.fillStyle = \\\"white\\\";\\n _via_reg_ctx.fill();\\n}\",\n \"function plotGraph(){\\n createAxis();\\n // zoom.x(x).y(y);\\n // console.log('setting scales');\\n // console.log(x);\\n // console.log(y);\\n updateBoundaryGraph.setScales(x,y);\\n }\",\n \"function CubicPoly() {\\r\\n\\r\\n\\t\\t}\",\n \"circb(x0, y0, r, c) {\\n // evaluate runtime errors\\n this.colorRangeError(c);\\n let x = 0;\\n let y = r;\\n let p = 3 - 2 * r;\\n this.circbPixGroup(x0, y0, x, y, c);\\n while (x < y) {\\n x++;\\n if (p < 0) {\\n p = p + 4 * x + 6;\\n }\\n else {\\n y--;\\n p = p + 4 * (x - y) + 10;\\n }\\n this.circbPixGroup(x0, y0, x, y, c);\\n }\\n }\",\n \"circPixGroup(x0, y0, x, y, c) {\\n this.line(x0 + x, y0 + y, x0 - x, y0 + y, c);\\n this.line(x0 + x, y0 - y, x0 - x, y0 - y, c);\\n this.line(x0 + y, y0 + x, x0 - y, y0 + x, c);\\n this.line(x0 + y, y0 - x, x0 - y, y0 - x, c);\\n }\",\n \"function drawContour (obj)\\n {\\n // set the axis right\\n obj.y.domain(range(obj.data.contour.yy));\\n obj.x.domain(range(obj.data.contour.xx));\\n\\n // draw the target density\\n var line = d3.svg.line()\\n .x(function(d, i) { return obj.x(d.x); })\\n .y(function(d, i) { return obj.y(d.y); });\\n\\n\\t// obj.data.contour.points is array where element is an array corresponding to each contour line\\n var lines = obj.plot.selectAll(\\\"path.contour\\\")\\n .data(obj.data.contour.points);\\n \\n // This draws the path for the contour plot\\n // Note that input is line, which array with each element corresponding to a curve on the contour plot\\n lines.enter().append(\\\"path\\\")\\n .attr(\\\"class\\\", \\\"contour\\\")\\n .attr(\\\"d\\\", line)\\n\\n // draw the point at which the Metropolis algorithm is at\\n var poi = {x : obj.data.metropolis.x.val, y : obj.data.metropolis.y.val};\\n\\n var point = obj.plot.selectAll(\\\"circle\\\")\\n .data([poi]);\\n\\n point.enter().append(\\\"circle\\\")\\n .attr(\\\"class\\\", \\\"currentValue\\\")\\n .attr(\\\"cx\\\", function (d, i) { return obj.x(d.x); })\\n .attr(\\\"cy\\\", function (d, i) { return obj.y(d.y); })\\n .attr(\\\"r\\\", 7)\\n .each( function (d)\\n { this._current = Object(); this._current.d = d;\\n this._current.name = 'contour'; this._current.obj = obj; return 0; });\\n\\n\\n\\t// draw previous points (the entire array of sampled points, including current point) \\n\\t// create pairs of points\\n\\t var prevPoi = makePoints(data.metropolis.x.vals,data.metropolis.y.vals)\\n\\t// create circles of class \\\"prev\\\" and pass data\\n var prevPoints = obj.plot.selectAll(\\\"circle.prev\\\")\\n .data(prevPoi);\\n\\t// plot points\\n prevPoints.enter().append(\\\"circle\\\")\\n .attr(\\\"class\\\", \\\"prev\\\")\\n .attr(\\\"cx\\\", function (d, i) { return obj.x(d.x); })\\n .attr(\\\"cy\\\", function (d, i) { return obj.y(d.y); })\\n .attr(\\\"r\\\", 4)\\n\\n\\n // create object that will hold lines connecting sampled points; plot lines\\n var connectLines = []\\n if(data.metropolis.currentIteration > 0){\\n \\t\\tfor(var ii=1; ii < prevPoi.length; ii++){\\n \\tconnectLines.push({'x1':prevPoi[ii-1].x,'y1':prevPoi[ii-1].y,'x2':prevPoi[ii].x,'y2':prevPoi[ii].y})\\n \\t}\\n }\\n\\n var lines = obj.plot.selectAll(\\\"line\\\")\\n .data(connectLines);\\n \\n lines.enter().append(\\\"line\\\")\\n .attr('class', 'connect')\\n .attr(\\\"x1\\\", function (d, i) { return obj.x(d.x1); })\\n .attr(\\\"y1\\\", function (d, i) { return obj.y(d.y1); })\\n .attr(\\\"x2\\\", function (d, i) { return obj.x(d.x2); })\\n .attr(\\\"y2\\\", function (d, i) { return obj.y(d.y2); })\\n .style(\\\"opacity\\\", 0.85)\\n .style(\\\"stroke\\\", \\\"red\\\")\\n .attr(\\\"stroke-dasharray\\\", \\\"5, 5\\\");\\n \\n \\n\\n\\t// Calculate acceptance rate of Metropolis algorithm (only if at least 1 iteration...)\\n\\tif(data.metropolis.accepted.length!=0)\\n\\t{\\n\\t\\tvar sumAccept = data.metropolis.accepted.reduce(function(a, b) { return a + b });\\n\\t\\tvar percAccept = sumAccept/data.metropolis.accepted.length;\\n\\t\\tvar acceptRate = d3.selectAll(\\\".acceptRate\\\");\\n\\t\\tacceptRate.html(\\\"Acceptance Rate of Proposals: \\\" + d3.round(100 * percAccept, 2)+\\\"%\\\");;\\n\\t}\\n\\n\\n // handle the transitions (this is necessary to reset plot when hit \\\"Refresh\\\")\\n var tr = obj.svg.transition().duration(500);\\n // rescale axes\\n tr.select(\\\".y.axis\\\").call(obj.yAxis);\\n tr.select(\\\".x.axis\\\").call(obj.xAxis);\\n // Redraw current point in Metropolis algorithm + path leading to it\\n tr.select(\\\"circle\\\").attr(\\\"cx\\\", function(d){return obj.x(d.x);})\\n .attr(\\\"cy\\\",function(d){return obj.y(d.y);});\\n // Redraw contour plot\\n tr.selectAll(\\\"path.contour\\\").attr('d', function (d)\\n { return line(d) } );\\n \\n // transitions for lines\\n tr.selectAll(\\\"line.connect\\\")\\n .attr(\\\"x1\\\", function (d, i) { return obj.x(d.x1); })\\n .attr(\\\"y1\\\", function (d, i) { return obj.y(d.y1); })\\n .attr(\\\"x2\\\", function (d, i) { return obj.x(d.x2); })\\n .attr(\\\"y2\\\", function (d, i) { return obj.y(d.y2); })\\n .style(\\\"opacity\\\", 0.85)\\n .style(\\\"stroke\\\", \\\"red\\\")\\n .attr(\\\"stroke-dasharray\\\", \\\"5, 5\\\");\\n \\n // remove all previous points and lines connecting them from plot when hit \\\"refresh\\\"\\n prevPoints.exit().remove();\\n lines.exit().remove();\\n return 0;\\n }\",\n \"function ChannelPlotChannel(imyPlot) {\\n this.myPlot = imyPlot;\\n this.FixedSizeY = -1; //negative value= flexible\\n\\n //Draws a vertical scale in the left panel of the channel\\n this.DrawVertScale = function(DrawInfo, minvl, maxvl) {\\n var jumps = GetScaleJump((maxvl - minvl) / 15);\\n\\n DrawInfo.LeftContext.fillStyle = \\\"black\\\";\\n DrawInfo.LeftContext.font = '10px sans-serif';\\n DrawInfo.LeftContext.textBaseline = 'bottom';\\n DrawInfo.LeftContext.textAlign = 'right';\\n\\n DrawInfo.LeftContext.strokeStyle = \\\"black\\\";\\n DrawInfo.CenterContext.strokeStyle = \\\"black\\\";\\n DrawInfo.LeftContext.globalAlpha = 0.6;\\n DrawInfo.CenterContext.globalAlpha = 0.2;\\n for (j = Math.ceil(minvl / jumps.Jump1); j <= Math.floor(maxvl / jumps.Jump1); j++) {\\n vl = j * jumps.Jump1;\\n yp = Math.round(DrawInfo.PosY - DrawInfo.SizeY * 0.1 - (vl - minvl) / (maxvl - minvl) * DrawInfo.SizeY * 0.8) - 0.5;\\n if (j % jumps.JumpReduc == 0) {\\n DrawInfo.LeftContext.beginPath();\\n DrawInfo.LeftContext.moveTo(DrawInfo.LeftSizeX - 8, yp);\\n DrawInfo.LeftContext.lineTo(DrawInfo.LeftSizeX, yp);\\n DrawInfo.LeftContext.stroke();\\n DrawInfo.LeftContext.fillText(vl, DrawInfo.LeftSizeX - 12, yp + 5);\\n DrawInfo.CenterContext.beginPath();\\n DrawInfo.CenterContext.moveTo(0, yp);\\n DrawInfo.CenterContext.lineTo(DrawInfo.SizeX, yp);\\n DrawInfo.CenterContext.stroke();\\n }\\n else {\\n DrawInfo.LeftContext.beginPath();\\n DrawInfo.LeftContext.moveTo(DrawInfo.LeftSizeX - 4, yp);\\n DrawInfo.LeftContext.lineTo(DrawInfo.LeftSizeX, yp);\\n DrawInfo.LeftContext.stroke();\\n }\\n }\\n DrawInfo.LeftContext.globalAlpha = 1;\\n DrawInfo.CenterContext.globalAlpha = 1;\\n\\n }\\n\\n\\n //Draws a message in the center panel of the channel\\n this.DrawMessage = function (DrawInfo, txt) {\\n DrawInfo.CenterContext.fillStyle = \\\"black\\\";\\n DrawInfo.CenterContext.globalAlpha = 0.2;\\n DrawInfo.CenterContext.fillRect(0, DrawInfo.PosY - DrawInfo.SizeY, DrawInfo.SizeX, DrawInfo.SizeY);\\n DrawInfo.CenterContext.globalAlpha = 1.0;\\n\\n DrawInfo.LeftContext.fillStyle = \\\"black\\\";\\n DrawInfo.LeftContext.globalAlpha = 0.2;\\n DrawInfo.LeftContext.fillRect(0, DrawInfo.PosY - DrawInfo.SizeY, DrawInfo.LeftSizeX, DrawInfo.SizeY);\\n DrawInfo.LeftContext.globalAlpha = 1.0;\\n\\n DrawInfo.CenterContext.fillStyle = \\\"black\\\";\\n DrawInfo.CenterContext.font = '25px sans-serif';\\n DrawInfo.CenterContext.textBaseline = 'bottom';\\n DrawInfo.CenterContext.textAlign = 'center';\\n DrawInfo.CenterContext.globalAlpha = 0.6;\\n DrawInfo.CenterContext.fillText(txt, DrawInfo.SizeX / 2, DrawInfo.PosY - DrawInfo.SizeY / 2 + 12);\\n DrawInfo.CenterContext.globalAlpha = 1.0;\\n }\\n\\n //Draws a title in the left panel of the channel\\n this.DrawTitle = function (DrawInfo) {\\n DrawInfo.LeftContext.save();\\n DrawInfo.LeftContext.translate(0, DrawInfo.PosY - DrawInfo.SizeY / 2);\\n DrawInfo.LeftContext.rotate(-Math.PI / 2);\\n DrawInfo.LeftContext.textBaseline = 'top';\\n DrawInfo.LeftContext.textAlign = \\\"center\\\";\\n DrawInfo.LeftContext.font = '14px sans-serif';\\n DrawInfo.LeftContext.fillStyle = \\\"black\\\";\\n if (\\\"Title\\\" in this)\\n DrawInfo.LeftContext.fillText(this.Title, 0, 5);\\n if (\\\"SubTitle\\\" in this) {\\n DrawInfo.LeftContext.font = '12px sans-serif';\\n DrawInfo.LeftContext.fillStyle = \\\"rgb(100,100,100)\\\";\\n DrawInfo.LeftContext.fillText(this.SubTitle, 0, 25);\\n }\\n DrawInfo.LeftContext.restore();\\n }\\n\\n //Get tooltip info at a specific point in screen coordinates in the channel\\n //Default behaviour: return null. This function can be overriden by a specific implementation of a channel\\n //Note that the return object will be digested by the function DrawChannelToolTip\\n this.GetToolTipInfo = function (xp, yp) {\\n return null;\\n }\\n\\n //Handle a click event inside a channel\\n //Default behaviour: do nothing. This function can be overriden by a specific implementation of a channel\\n this.OnClick = function (xp, yp) {\\n }\\n\\n\\n}\",\n \"constructor(x, y, t, r, n, c) {\\n\\t\\tsuper(x, y);\\n\\t\\tthis.theta = t;\\t//in degrees\\n\\t\\tthis.circumRad = r;\\n\\t\\tthis.vertexNum = n;\\n\\t\\tthis.color = c;\\n\\t}\",\n \"function plotGrid() {\\n let equalParts = (maxValue/5).toPrecision(2);\\n lenAxis = equalParts*6;\\n let ticks = [equalParts, equalParts*2, equalParts*3, equalParts*4, equalParts*5, lenAxis];\\n \\n // griglie\\n let circle = svg.selectAll(\\\".grid\\\")\\n .data(ticks);\\n\\n circle.exit().remove(); // exit\\n\\n circle.enter() // enter\\n .append(\\\"circle\\\")\\n .attr(\\\"class\\\", \\\"grid\\\")\\n .attr(\\\"cx\\\", cx)\\n .attr(\\\"cy\\\", cy)\\n .attr(\\\"fill\\\", \\\"none\\\")\\n .attr(\\\"stroke\\\", \\\"gray\\\")\\n .transition().duration(1000)\\n .attr(\\\"r\\\", t=>rScale(t));\\n\\n // scritte\\n let txt = svg.selectAll(\\\".tick\\\")\\n .data(ticks);\\n \\n txt.exit().remove(); //exit\\n\\n txt.enter() //enter\\n .append(\\\"text\\\")\\n .attr(\\\"class\\\", \\\"tick\\\")\\n .attr(\\\"x\\\", cx+5)\\n .attr(\\\"y\\\", t=>cy-rScale(t)-1)\\n .transition().duration(1000).delay(1000)\\n .attr(\\\"opacity\\\", 1)\\n .text(t=>t.toString());\\n}\",\n \"function CubicPoly() {\\r\\n\\r\\n\\t}\",\n \"function CubicPoly() {\\n\\n\\t}\",\n \"function CubicPoly() {\\n\\n\\t}\",\n \"function render() {\\n dots\\n .attr(\\\"cx\\\", function (d) {\\n return project(d).x;\\n })\\n .attr(\\\"cy\\\", function (d) {\\n return project(d).y;\\n });\\n }\",\n \"function drawCirc(){\\n for(y = 0; y < shapePosY.length; y++){\\n for(i = 0; i < shapePosX.length; i++){\\n noStroke();\\n fill(colors.reverse()[i]);\\n circle(shapePosX[i], shapePosY[y], 20);\\n }\\n }\\n}\",\n \"constructor(name, x, y) {\\n this.name = name;\\n this.x = x;\\n this.y = y;\\n this.w = 50;\\n this.h = 50;\\n this.ax = x;\\n this.ay = y;\\n }\",\n \"function plot (x,y,val){\\n\\tdocument.getElementById(\\\"c\\\"+x+\\\".\\\"+y).style.backgroundColor = colors[val]; //on prend l'id cx.y et on lui attribue la valeur du tableau colors, val = indice couleur//\\n document.getElementById(\\\"c\\\"+x+\\\".\\\"+y).value = val; //On dit que la valeur de cette case est val, c'est pour ça qu'on peut la retourner avec la fonction get//\\n}\",\n \"function drawPC() {\\r\\n\\t\\r\\n//setting the x and y scale \\r\\n\\tvar x = d3.scale.ordinal().rangePoints([0, 480], 1),\\r\\n y= {};\\r\\n \\r\\n// Extract the list of dimensions and create a scale for each.\\r\\n for (var dim in cars[0]) {\\r\\n\\t if (dim != \\\"name\\\") {\\r\\n\\t\\t y[dim] = d3.scale.linear()\\r\\n\\t\\t\\t .domain([d3.min(cars, function(d) { return +d[dim]; }), d3.max(cars, function(d) { return +d[dim]; })])\\r\\n\\t\\t .range([height,0]);\\r\\n\\t }\\r\\n }\\r\\n \\r\\n//setting the x domain dimensions\\r\\n x.domain(dimensions = d3.keys(cars[0]).filter(function(d) { return d != \\\"name\\\";}));\\r\\n\\r\\n//draw polylines\\r\\n for (var i=1; i< cars.length; i++) { \\r\\n\\r\\n//prepare the coordinates for a polyline\\r\\n\\t var lineData = []; //initialize an array for coordinates of a polyline\\r\\n\\t for (var prop in cars[0]) { //get each dimension\\r\\n\\t if (prop != \\\"name\\\" ) { //skip the name dimension\\r\\n\\t var point = {}; //initialize a coordinate object\\r\\n\\t var val = cars[i][prop]; //obtain the value of a car in a dimension\\r\\n\\t\\t point['x'] = x(prop); //x value: mapping the dimension \\r\\n\\t point['y'] = y[prop](val);//y value: mapping the value in that dimension\\r\\n\\t lineData.push(point); //add the object into the array \\r\\n\\t }\\r\\n\\t }\\r\\n\\r\\n//draw a polyline based on the coordindates \\r\\n chart.append(\\\"g\\\")\\r\\n\\t .attr(\\\"class\\\", \\\"polyline\\\")\\r\\n\\t .append(\\\"path\\\") // a path shape\\r\\n\\t\\t .attr(\\\"d\\\", line(lineData)) //line() is a function to turn coordinates into SVG commands\\r\\n\\t\\r\\n//the mouseover function that changes the strokes to red when the mouse is over them\\r\\n\\t.on(\\\"mouseover\\\", function(){\\r\\n\\t\\t\\td3.select(this)\\r\\n\\t\\t.style(\\\"stroke\\\",\\\"red\\\")\\r\\n\\t })\\r\\n//the mouseout function that changes the strokes back to their original color\\r\\n\\t.on(\\\"mouseout\\\", function(){\\r\\n\\t\\td3.select(this)\\r\\n\\t\\t.style(\\\"stroke\\\",null)\\r\\n\\t\\t\\r\\n})\\r\\n }\\r\\n\\r\\n//draw individual dimension lines\\r\\n//position dimension lines \\r\\n var g = chart.selectAll(\\\".dimension\\\")\\r\\n\\t .data(dimensions)\\r\\n\\t .enter().append(\\\"g\\\")\\r\\n\\t .attr(\\\"class\\\", \\\"dimension\\\")\\r\\n\\t .attr(\\\"transform\\\", function(d) { return \\\"translate(\\\" + x(d) + \\\")\\\"; }) //translate each axis\\r\\n\\r\\n\\t\\r\\n// Add an axis and title.\\r\\n g.append(\\\"g\\\")\\r\\n\\t .attr(\\\"class\\\", \\\"axis\\\")\\r\\n\\t .each(function(d) { d3.select(this).call(axis.scale(y[d])); })\\r\\n\\t .append(\\\"text\\\")\\r\\n\\t .style(\\\"text-anchor\\\", \\\"middle\\\")\\r\\n\\t .attr(\\\"y\\\", -4)\\r\\n\\t .text(function(d) { return d; });\\r\\n\\t \\r\\n \\r\\n}\",\n \"function drawPoleZeroPlot() {\\n\\n zPlaneContext.clearRect(0, 0, 275, 280);\\n zPlaneContext.font = '12px Arial';\\n\\n // This helper function returns the pixel coordinates inside the $z$-plane canvas\\n // for a complex number `z`.\\n var coordinatesFromComplexNumber = function(z) {\\n return {\\n x: unitCircle.x + z.real * unitCircle.radius,\\n y: unitCircle.y - z.imaginary * unitCircle.radius\\n };\\n };\\n\\n // This helper function is used to determine the multiplicity of poles or\\n // zeros.\\n var countMultiplicity = function(result, z) {\\n var w = _.find(result, _.compose(_.partial(Complex.areEqual, z), function(w) { return w.z; }));\\n if (w !== undefined) {\\n w.multiplicity++;\\n }\\n else {\\n result.push( { z: z, multiplicity: 1 });\\n }\\n return result;\\n };\\n\\n // Draw a circle at each zero.\\n var zerosToRender = _.reduce(filter.zeros, countMultiplicity, []);\\n _.each(zerosToRender, function(zero) {\\n zPlaneContext.beginPath();\\n var p = coordinatesFromComplexNumber(zero.z);\\n var radius = Complex.areEqual(zero.z, selection) ? 4.5 : 4.0;\\n zPlaneContext.arc(p.x, p.y, radius, 0, 2 * Math.PI, false);\\n zPlaneContext.strokeStyle = Complex.areEqual(zero.z, hover) ? '#00677e' : '#00374e';\\n zPlaneContext.lineWidth = Complex.areEqual(zero.z, selection) ? 3.0 : 2.0;\\n zPlaneContext.stroke();\\n if (zero.multiplicity > 1) {\\n zPlaneContext.fillText(zero.multiplicity, p.x + 5, p.y - 5);\\n }\\n });\\n\\n // Draw a cross at each pole.\\n var polesToRender = _.reduce(filter.poles, countMultiplicity, []);\\n _.each(polesToRender, function(pole) {\\n zPlaneContext.beginPath();\\n var p = coordinatesFromComplexNumber(pole.z);\\n var radius = Complex.areEqual(pole.z, selection) ? 4.5 : 4.0;\\n zPlaneContext.moveTo(p.x - radius, p.y + radius);\\n zPlaneContext.lineTo(p.x + radius, p.y - radius);\\n zPlaneContext.moveTo(p.x - radius, p.y - radius);\\n zPlaneContext.lineTo(p.x + radius, p.y + radius);\\n zPlaneContext.strokeStyle = Complex.areEqual(pole.z, hover) ? '#00677e' : '#00374e';\\n zPlaneContext.lineWidth = Complex.areEqual(pole.z, selection) ? 3.0 : 2.0;\\n zPlaneContext.stroke();\\n if (pole.multiplicity > 1) {\\n zPlaneContext.fillText(pole.multiplicity, p.x + 5, p.y - 5);\\n }\\n });\\n }\",\n \"createAxes () {\\n }\",\n \"function axis(ctx, color, axisx, axisy, px, d1,py, d2) {\\n var w = ctx.canvas.width;\\n var h = ctx.canvas.height;\\n\\n ctx.strokeStyle = color;\\n\\n //if axis function is below grid function\\n // and grid is dotted this removes the axis from\\n // dotted back to normal line\\n ctx.setLineDash([0, 0]);\\n\\n //if the axis is undefined in both direction creates it at the far left corner like a normal graph\\n if (axisy == undefined && axisx == undefined) {\\n lines(ctx, 1, h - 1, w - 1, h - 1, 1);\\n lines(ctx, 1, 1, 1, h - 1, 1);\\n }\\n\\n //the same as above\\n else if (axisx == w && axisy == h) {\\n lines(ctx, 1, axisy - 1, axisx - 1, axisy - 1, 1);\\n lines(ctx, 1, 1, 1, axisy - 1, 1);\\n }\\n\\n //if axisx and axis y are numbers the axis will be created inwards to the number that has been created.\\n else if (typeof axisx == \\\"number\\\" && typeof axisy == \\\"number\\\") {\\n lines(ctx, 0, axisy, w, axisy, 3);\\n lines(ctx, axisx, 0, axisx, h, 3);\\n }\\n\\n // if axisy and axisx are inputed as middle the x and y axis will be created in the center of the canvas\\n else if (axisx == \\\"middle\\\" && axisy == \\\"middle\\\") {\\n axisx = w / 2;\\n axisy = h / 2;\\n\\n lines(ctx, h / 2, w, h / 2, 2);\\n\\n lines(ctx, w / 2, w / 2, h, 2);\\n }\\n\\n // creates the x for the creation of axis points as pf now only at the positive x axis\\n if (px == \\\"px\\\" && py == \\\"py\\\") {\\n let i = axisx;\\n let j = 0;\\n let k = 0;\\n let l = 0;\\n\\n //creates positive x axis points\\n for (i = axisx; i <= w; i += d1) {\\n lines(ctx, i, axisy, i, axisy + 10, 1);\\n }\\n\\n //create negative y axis points\\n for (l = axisy; l >= 0; l -= d2) {\\n lines(ctx, axisx, l, axisx - 10, l, 1);\\n }\\n\\n //creates positive y axis points\\n for (j = axisy; j <= h; j += d2) {\\n lines(ctx, axisx - 10, j, axisx, j, 1);\\n }\\n //creates negative x axis points\\n for (k = axisx; k >= 0; k -= d1) {\\n lines(ctx, k, axisy, k, axisy + 10, 1);\\n }\\n }\\n\\n else if(px =='px' && py == undefined){\\n let i = 0;\\n let k = 0;\\n //creates positive x axis points\\n for (i = axisx; i <= w; i += d1) {\\n lines(ctx, i, axisy, i, axisy + 10, 1);\\n }\\n\\n //creates negative x axis points\\n for (k = axisx; k >= 0; k -= d1) {\\n lines(ctx, k, axisy, k, axisy + 10, 1);\\n }\\n }\\n}\",\n \"function cs_geocentric_to_geodetic (cs, p) {\\n\\n var X =p.x;\\n var Y = p.y;\\n var Z = p.z;\\n var Longitude;\\n var Latitude;\\n var Height;\\n\\n var W; /* distance from Z axis */\\n var W2; /* square of distance from Z axis */\\n var T0; /* initial estimate of vertical component */\\n var T1; /* corrected estimate of vertical component */\\n var S0; /* initial estimate of horizontal component */\\n var S1; /* corrected estimate of horizontal component */\\n var Sin_B0; /* Math.sin(B0), B0 is estimate of Bowring aux variable */\\n var Sin3_B0; /* cube of Math.sin(B0) */\\n var Cos_B0; /* Math.cos(B0) */\\n var Sin_p1; /* Math.sin(phi1), phi1 is estimated latitude */\\n var Cos_p1; /* Math.cos(phi1) */\\n var Rn; /* Earth radius at location */\\n var Sum; /* numerator of Math.cos(phi1) */\\n var At_Pole; /* indicates location is in polar region */\\n\\n X = parseFloat(X); // cast from string to float\\n Y = parseFloat(Y);\\n Z = parseFloat(Z);\\n\\n At_Pole = false;\\n if (X != 0.0)\\n {\\n Longitude = Math.atan2(Y,X);\\n }\\n else\\n {\\n if (Y > 0)\\n {\\n Longitude = HALF_PI;\\n }\\n else if (Y < 0)\\n {\\n Longitude = -HALF_PI;\\n }\\n else\\n {\\n At_Pole = true;\\n Longitude = 0.0;\\n if (Z > 0.0)\\n { /* north pole */\\n Latitude = HALF_PI;\\n }\\n else if (Z < 0.0)\\n { /* south pole */\\n Latitude = -HALF_PI;\\n }\\n else\\n { /* center of earth */\\n Latitude = HALF_PI;\\n Height = -cs.b;\\n return;\\n }\\n }\\n }\\n W2 = X*X + Y*Y;\\n W = Math.sqrt(W2);\\n T0 = Z * AD_C;\\n S0 = Math.sqrt(T0 * T0 + W2);\\n Sin_B0 = T0 / S0;\\n Cos_B0 = W / S0;\\n Sin3_B0 = Sin_B0 * Sin_B0 * Sin_B0;\\n T1 = Z + cs.b * cs.ep2 * Sin3_B0;\\n Sum = W - cs.a * cs.es * Cos_B0 * Cos_B0 * Cos_B0;\\n S1 = Math.sqrt(T1*T1 + Sum * Sum);\\n Sin_p1 = T1 / S1;\\n Cos_p1 = Sum / S1;\\n Rn = cs.a / Math.sqrt(1.0 - cs.es * Sin_p1 * Sin_p1);\\n if (Cos_p1 >= COS_67P5)\\n {\\n Height = W / Cos_p1 - Rn;\\n }\\n else if (Cos_p1 <= -COS_67P5)\\n {\\n Height = W / -Cos_p1 - Rn;\\n }\\n else\\n {\\n Height = Z / Sin_p1 + Rn * (cs.es - 1.0);\\n }\\n if (At_Pole == false)\\n {\\n Latitude = Math.atan(Sin_p1 / Cos_p1);\\n }\\n\\n p.x = Longitude;\\n p.y =Latitude;\\n p.z = Height;\\n return 0;\\n}\",\n \"function drawCylinder() {\\n setMV();\\n Cylinder.draw();\\n}\",\n \"function drawCylinder() {\\n setMV();\\n Cylinder.draw();\\n}\",\n \"function makecncsvgexport()\\n{\\n var c,d,x,y,x0,y0,pts,txt=\\\"\\\";\\n getdefaults();\\n var sfx=cutterwidth/(xmax-xmin);\\n var sfy=cutterheight/(ymax-ymin);\\n switch(originpos)\\n {\\n case 0: originx=0; originy=0; break; // Bottom left\\n case 1: originx=0; originy=cutterheight; break; // Top left\\n case 2: originx=cutterwidth; originy=0; break; // Bottom right\\n case 3: originx=cutterwidth; originy=cutterheight; break; // Top right\\n case 4: originx=cutterwidth/2; originy=cutterheight/2; break; // Middle\\n }\\n txt+='<?xml version=\\\"1.0\\\" encoding=\\\"utf-8\\\"?>\\\\r\\\\n';\\n txt+='<svg id=\\\"gcodercncsvg\\\" width=\\\"'+cutterwidth+'px\\\" height=\\\"'+cutterheight+'px\\\" style=\\\"background-color:#FFFFFF\\\" version=\\\"1.1\\\" ';\\n txt+='xmlns:xlink=\\\"http://www.w3.org/1999/xlink\\\" xmlns=\\\"http://www.w3.org/2000/svg\\\" ';\\n txt+=makedefaultsparams()+' ';\\n txt+='>\\\\r\\\\n';\\n for(c=0;c<commands.length;c++)\\n {\\n if(commands[c][0]==='L')\\n {\\n pts=commands[c][1];\\n pts=scaletoolpath(pts,sfx,sfy,cutterheight);\\n pts=simplifytoolpath(pts,arcdist);\\n txt+=' <path id=\\\"'+commands[c][12]+'\\\" d=\\\"M ';\\n for(d=0;d<pts.length;d++)\\n {\\n x=pts[d][0]-originx;\\n y=(cutterheight-pts[d][1])-originy;\\n if(d===0)\\n {\\n x0=x;\\n y0=y;\\n }\\n if(d===pts.length-1 && commands[c][11]===1) txt+=\\\"Z\\\";\\n else txt+=x.toFixed(3)+\\\",\\\"+y.toFixed(3)+\\\" \\\";\\n }\\n txt+='\\\" opacity=\\\"1\\\" stroke=\\\"#000000\\\" stroke-opacity=\\\"1\\\" stroke-width=\\\"1\\\" stroke-linecap=\\\"butt\\\" stroke-linejoin=\\\"miter\\\" stroke-dasharray=\\\"none\\\" fill-opacity=\\\"0\\\" ';\\n txt+=makepathparams(c)+' ';\\n txt+='/>\\\\r\\\\n';\\n }\\n }\\n txt+='</svg>\\\\r\\\\n';\\n return txt;\\n}\",\n \"function drawScatterMatrix(trips){\\n\\n\\tspeed = [];\\n\\tdistance =[];\\n\\tduration=[];\\n\\tfor (var i =0;i<trips.length;i++)\\n\\t{\\n\\t speed[i]=trips[i].avspeed;\\n\\t\\t distance[i]=trips[i].distance;\\n\\t\\t duration[i]=trips[i].duration;\\n\\t}\\n\\n\\tgoogle.charts.load('current', {'packages':['corechart']}); \\n google.charts.setOnLoadCallback(drawScatterMatrixCallBack(speed,distance,duration)); \\n}\",\n \"function plotCrossHair(bestI) {\\n\\n // get data from window\\n dataList = window.data;\\n\\n var x = dataList[0][bestI];\\n var yMin = dataList[1][bestI];\\n var yMax = dataList[2][bestI];\\n\\n // Draw the cross hair\\n ctx.lineWidth = 2;\\n var r = 5;\\n\\n // circles\\n ctx.beginPath();\\n ctx.arc(x, yMin, r, 0, 2 * Math.PI);\\n ctx.stroke();\\n ctx.beginPath();\\n ctx.arc(x, yMax, r, 0, 2 * Math.PI);\\n ctx.stroke();\\n\\n // vertical line\\n ctx.moveTo(x, GRAPH_BOTTOM);\\n ctx.lineTo(x, yMin + r);\\n ctx.moveTo(x, yMin - r);\\n ctx.lineTo(x, yMax + r);\\n ctx.moveTo(x, yMax - r);\\n ctx.lineTo(x, GRAPH_TOP);\\n\\n // horizontal line\\n ctx.moveTo(GRAPH_LEFT, yMin);\\n ctx.lineTo(x - r, yMin);\\n ctx.moveTo(x + r, yMin);\\n ctx.lineTo(GRAPH_RIGHT, yMin);\\n ctx.moveTo(GRAPH_LEFT, yMax);\\n ctx.lineTo(x - r, yMax);\\n ctx.moveTo(x + r, yMax);\\n ctx.lineTo(GRAPH_RIGHT, yMax);\\n ctx.stroke();\\n\\n // draw the x and y data next to the lines\\n var date = window.data[4][bestI].toString();\\n for (var i = 0; i < date.length; i++) {\\n var year = date[0] + date[1] + date[2] + date[3];\\n var month = date[4] + date[5];\\n var day = date[6] + date[7];\\n }\\n var dateString = year + '/' + month + '/' + day\\n var tempMin = window.data[5][bestI] / 10;\\n var tempMax = window.data[6][bestI] / 10;\\n\\n // type selected data\\n ctx.font = \\\"bold 25px sans-serif\\\";\\n ctx.fillText(dateString + \\\": Min = \\\" + tempMin +\\n \\\", Max = \\\" + tempMax, GRAPH_LEFT + 20, GRAPH_BOTTOM + 60);\\n ctx.stroke();\\n}\",\n \"function plotCorr(id) {\\n let data = dictMetrics[id];\\n dictAbs = dictAbsGlobal[id];\\n $(\\\"#correlation_bar_graph\\\").html(\\\"\\\");\\n $(\\\"#actualPredicted\\\").html(\\\"\\\");\\n updatePlot(1997);\\n draw_correlation_bar_graph(data);\\n}\",\n \"function CubicPoly() {}\",\n \"function CubicPoly() {}\",\n \"function CubicPoly() {}\",\n \"function CubicPoly() {}\",\n \"function CubicPoly() {}\",\n \"function doPlot(id, xArr, xLabel, yArr, yLabel) {\\n\\n var margin = { top: 10, right: 10, bottom: 50, left: 50 },\\n // outerWidth = 350,\\n // outerHeight = 300,\\n outerWidth = getWidth() / 5,\\n outerHeight = getHeight() / 3,\\n width = outerWidth - margin.left - margin.right,\\n height = outerHeight - margin.top - margin.bottom;\\n\\n var x = d3.scale.linear()\\n .range([0, width]).nice();\\n\\n var y = d3.scale.linear()\\n .range([height, 0]).nice();\\n\\n // var xLabel = \\\"Voltage\\\",\\n // yLabel = \\\"Current\\\",\\n // colorCat = \\\"Manufacturer\\\";\\n\\n // d3.csv(\\\"http://rohin.me/dev/mettletest/cerial.csv\\\", function(data) {\\n // data.forEach(function(d) {\\n // d.Voltage = +d.Voltage;\\n // d.Current = +d.Current;\\n // });\\n\\n data = [];\\n\\n if (xArr.length == 0 || yArr.length == 0) {\\n data.push([0, 0]);\\n } else {\\n data = xArr.map(function (_, i) {\\n return [xArr[i], yArr[i], i];\\n });\\n }\\n\\n dataLength = data.length\\n // data = [];\\n // data.push([1, 1]);\\n // data.push([2, 2]);\\n // data.push([3, 3]);\\n // data.push([4, 4]);\\n // data.push([5, 5]);\\n // console.log(data);\\n\\n let xMax = d3.max(data, function (d) { return d[0]; }) * 1.05;\\n let xMin = d3.min(data, function (d) { return d[0]; });\\n\\n let yMax = d3.max(data, function (d) { return d[1]; }) * 1.05;\\n let yMin = d3.min(data, function (d) { return d[1]; });\\n\\n yMin = yMin > 0 ? 0 : yMin;\\n xMin = xMin > 0 ? 0 : xMin,\\n\\n x.domain([xMin, xMax]);\\n y.domain([yMin, yMax]);\\n\\n var xAxis = d3.svg.axis()\\n .scale(x)\\n .orient(\\\"bottom\\\")\\n .tickSize(-height);\\n\\n var yAxis = d3.svg.axis()\\n .scale(y)\\n .orient(\\\"left\\\")\\n .tickSize(-width);\\n\\n var color = d3.scale.category10();\\n\\n var tip = d3.tip()\\n .attr(\\\"class\\\", \\\"d3-tip\\\")\\n .offset([-10, 0])\\n .html(function (d) {\\n $log('graph', 'hover', {\\n id: xLabel +\\\" vs \\\" + yLabel,\\n values: \\\"(\\\" + d[0] + \\\",\\\" + d[1] + \\\")\\\"\\n })\\n return xLabel + \\\": \\\" + d[0] + \\\"<br>\\\" + yLabel + \\\": \\\" + d[1];\\n });\\n\\n var zoomBeh = d3.behavior.zoom()\\n .x(x)\\n .y(y)\\n .scaleExtent([0, 500])\\n .on(\\\"zoom\\\", zoom);\\n\\n var svg = d3.select(\\\"#\\\" + id)\\n .append(\\\"svg\\\")\\n .attr(\\\"width\\\", outerWidth)\\n .attr(\\\"height\\\", outerHeight)\\n .append(\\\"g\\\")\\n .attr(\\\"transform\\\", \\\"translate(\\\" + margin.left + \\\",\\\" + margin.top + \\\")\\\")\\n .call(zoomBeh);\\n\\n svg.call(tip);\\n\\n svg.append(\\\"rect\\\")\\n .attr(\\\"width\\\", width)\\n .attr(\\\"height\\\", height);\\n\\n svg.append(\\\"g\\\")\\n .classed(\\\"x axis\\\", true)\\n .attr(\\\"transform\\\", \\\"translate(0,\\\" + height + \\\")\\\")\\n .call(xAxis)\\n .append(\\\"text\\\")\\n .classed(\\\"label\\\", true)\\n .attr(\\\"x\\\", width)\\n .attr(\\\"y\\\", margin.bottom - 10)\\n .style(\\\"text-anchor\\\", \\\"end\\\")\\n .text(xLabel).style(\\\"font-size\\\", 20).style(\\\"font-weight\\\", \\\"600\\\");\\n\\n svg.append(\\\"g\\\")\\n .classed(\\\"y axis\\\", true)\\n .call(yAxis)\\n .append(\\\"text\\\")\\n .classed(\\\"label\\\", true)\\n .attr(\\\"transform\\\", \\\"rotate(-90)\\\")\\n .attr(\\\"y\\\", -margin.left)\\n .attr(\\\"dy\\\", \\\".71em\\\")\\n .style(\\\"text-anchor\\\", \\\"end\\\")\\n .text(yLabel).style(\\\"font-size\\\", 20).style(\\\"font-weight\\\", \\\"600\\\");;\\n\\n var objects = svg.append(\\\"svg\\\")\\n .classed(\\\"objects\\\", true)\\n .attr(\\\"width\\\", width)\\n .attr(\\\"height\\\", height);\\n\\n objects.append(\\\"svg:line\\\")\\n .classed(\\\"axisLine hAxisLine\\\", true)\\n .attr(\\\"x1\\\", 0)\\n .attr(\\\"y1\\\", 0)\\n .attr(\\\"x2\\\", width)\\n .attr(\\\"y2\\\", 0)\\n .attr(\\\"transform\\\", \\\"translate(0,\\\" + height + \\\")\\\");\\n\\n objects.append(\\\"svg:line\\\")\\n .classed(\\\"axisLine vAxisLine\\\", true)\\n .attr(\\\"x1\\\", 0)\\n .attr(\\\"y1\\\", 0)\\n .attr(\\\"x2\\\", 0)\\n .attr(\\\"y2\\\", height);\\n\\n objects.selectAll(\\\".dot\\\")\\n .data(data)\\n .enter().append(\\\"circle\\\")\\n .classed(\\\"dot\\\", true)\\n .attr(\\\"r\\\", function (d) { /*console.log(d);*/ return 4; /*Math.sqrt(d[rCat] / Math.PI);*/ })\\n .attr(\\\"transform\\\", transform)\\n .style(\\\"fill\\\",\\n function (d) {\\n if (d[2] == dataLength - 1) {\\n return \\\"#FFC107\\\"\\n } else {\\n // console.log(\\\"MotorID\\\" + motorIDArr[d[2]]);\\n var motorID = motorIDArr[d[2]];\\n return motorSpecs[motorID ? motorID : 0][4];\\n // TODO:very hacky\\n }\\n })\\n .on(\\\"mouseover\\\", tip.show)\\n .on(\\\"mouseout\\\", tip.hide);\\n\\n var legend = svg.selectAll(\\\".legend\\\")\\n .data(color.domain())\\n .enter().append(\\\"g\\\")\\n .classed(\\\"legend\\\", true)\\n .attr(\\\"transform\\\", function (d, i) { return \\\"translate(0,\\\" + i * 20 + \\\")\\\"; });\\n\\n legend.append(\\\"circle\\\")\\n .attr(\\\"r\\\", 3.5)\\n .attr(\\\"cx\\\", width + 20)\\n .attr(\\\"fill\\\", color);\\n\\n legend.append(\\\"text\\\")\\n .attr(\\\"x\\\", width + 26)\\n .attr(\\\"dy\\\", \\\".35em\\\")\\n .text(function (d) { return d; });\\n\\n // d3.select(\\\"input\\\").on(\\\"click\\\", change);\\n\\n // function change() {\\n // // xLabel = \\\"Carbs\\\";\\n // xMax = d3.max(data, function(d) { return d[xLabel]; });\\n // xMin = d3.min(data, function(d) { return d[xLabel]; });\\n // yMax = d3.max(data, function(d) { return d[yLabel]; });\\n // yMin = d3.min(data, function(d) { return d[yLabel]; });\\n\\n // zoomBeh.x(x.domain([xMin, xMax])).y(y.domain([yMin, yMax]));\\n\\n // var svg = d3.select(\\\"#scatter\\\").transition();\\n\\n // svg.select(\\\".x.axis\\\").duration(750).call(xAxis).select(\\\".label\\\").text(xLabel);\\n\\n // objects.selectAll(\\\".dot\\\").transition().duration(1000).attr(\\\"transform\\\", transform);\\n // }\\n\\n // hanldes zoom event on graph\\n function zoom() {\\n svg.select(\\\".x.axis\\\").call(xAxis);\\n svg.select(\\\".y.axis\\\").call(yAxis);\\n\\n svg.selectAll(\\\".dot\\\")\\n .attr(\\\"transform\\\", transform);\\n }\\n\\n function transform(d) {\\n return \\\"translate(\\\" + x(d[0]) + \\\",\\\" + y(d[1]) + \\\")\\\";\\n }\\n // });\\n}\",\n \"function showConjugates () {\\n\\n pointsTable = lens.pointsTable.getData(); \\n pointsList = Optics.calculatePointToPoint(renderableLens.total, pointsTable);\\n totalLens = renderableLens.total;\\n\\n if (pointsList.length > 0) {\\n pointsList.forEach( elem => {\\n console.log(\\\"showing .... conjugate pair id = \\\" + elem.id);\\n drawConjugates(elem, displayOptions);\\n } );\\n }\\n }\",\n \"function FunctionPlotter(options) {\\n let axisTickCounts,\\n functions,\\n gridBoolean,\\n group,\\n hasTransitioned,\\n plotArea,\\n plotter,\\n range,\\n width,\\n where,\\n x,\\n y;\\n\\n plotter = this;\\n\\n init(options);\\n\\n return plotter;\\n\\n /* INITIALIZE */\\n function init(options) {\\n let curtain;\\n\\n _required(options);\\n _defaults(options);\\n\\n\\n curtain = addCurtain();\\n plotter.scales = defineScales();\\n plotter.axisTitles = {};\\n group = addGroup();\\n plotArea = addPlotArea();\\n plotter.layers = addLayers();\\n plotter.grid = addGrid();\\n plotter.axes = addAxes();\\n plotter.lines = addLines(functions);\\n plotter.hotspot = addHotspot();\\n\\n plotter.hasTransitioned = false;\\n\\n // valueCircle = false;\\n\\n\\n }\\n\\n /* PRIVATE METHODS */\\n function _defaults(options) {\\n\\n axisTickCounts = options.axisTicks ? options.axisTicks : {\\\"x\\\":1,\\\"y\\\":1};\\n functions = options.functions ? options.functions : [];\\n plotter.height = options.height ? options.height : 400;\\n plotter.width = options.width ? options.width : 800;\\n plotter.domain = options.domain ? options.domain : [0,10];\\n plotter.range = options.range ? options.range : [0,10];\\n plotter.margins = options.margins ? options.margins : defaultMargins();\\n //TODO: THIS IS SLOPPY. GRID SHOULD BE CLEARER\\n gridBoolean = options.hideGrid ? false : true;\\n x = options.x ? options.x : 0;\\n y = options.y ? options.y : 0;\\n plotter.coordinates = options.coordinates ? options.coordinates : {\\\"x\\\":x,\\\"y\\\":y};\\n plotter.fontFamily = options.fontFamily ? options.fontFamily : \\\"\\\";\\n\\n }\\n\\n function _required(options) {\\n\\n hasTransitioned = false;\\n where = options.where;\\n\\n }\\n\\n\\n /* PRIVATE METHODS */\\n function addAxes() {\\n let axes;\\n\\n axes = {};\\n\\n axes.x = addXAxis();\\n axes.y = addYAxis();\\n\\n return axes;\\n }\\n\\n function addCurtain() {\\n let clipPath,\\n rect;\\n\\n clipPath = where\\n .select(\\\"defs\\\")\\n .append(\\\"clipPath\\\")\\n .attr(\\\"id\\\",\\\"plotterClipPath\\\");\\n\\n rect = clipPath\\n .append(\\\"rect\\\")\\n .attr(\\\"x\\\",-1)\\n .attr(\\\"y\\\",-1)\\n .attr(\\\"width\\\",width - plotter.margins.left - plotter.margins.right + 1)\\n .attr(\\\"height\\\",plotter.height - plotter.margins.top - plotter.margins.bottom + 1);\\n\\n return clipPath;\\n }\\n\\n function addGroup() {\\n let group;\\n\\n group = explorableGroup({\\\"where\\\":options.where})\\n .attr(\\\"transform\\\",\\\"translate(\\\"+plotter.coordinates.x+\\\",\\\"+plotter.coordinates.y+\\\")\\\");\\n\\n return group;\\n }\\n\\n function addGrid() {\\n let grid;\\n\\n if(gridBoolean) {\\n grid = new FunctionPlotterGrid({\\n \\\"axisTickCounts\\\":axisTickCounts,\\n \\\"domain\\\":plotter.domain,\\n \\\"range\\\":range,\\n \\\"scales\\\":plotter.scales,\\n \\\"where\\\":plotter.layers.grid,\\n \\\"tickEvery\\\":1\\n });\\n }\\n\\n return grid;\\n }\\n\\n function addHotspot() {\\n let hotspot;\\n\\n hotspot = group\\n .append(\\\"rect\\\")\\n .attr(\\\"x\\\",plotter.margins.left)\\n .attr(\\\"y\\\",plotter.margins.top)\\n .attr(\\\"width\\\",plotter.width - plotter.margins.left - plotter.margins.right)\\n .attr(\\\"height\\\",plotter.height - plotter.margins.top - plotter.margins.bottom)\\n .attr(\\\"fill\\\",\\\"rgba(0,0,0,0)\\\");\\n\\n return hotspot;\\n }\\n\\n function addPlotArea() {\\n let plotGroup;\\n\\n plotGroup = explorableGroup({\\n \\\"where\\\":group\\n })\\n .attr(\\\"transform\\\",\\\"translate(\\\"+plotter.margins.left+\\\",\\\"+plotter.margins.top+\\\")\\\");\\n\\n return plotGroup;\\n }\\n\\n function addLayers() {\\n let layers;\\n\\n layers = {};\\n layers.plot = explorableGroup({\\\"where\\\":group})\\n .attr(\\\"transform\\\",\\\"translate(\\\"+plotter.margins.left+\\\",\\\"+plotter.margins.top+\\\")\\\");\\n\\n layers.grid = explorableGroup({\\\"where\\\":layers.plot})\\n .attr(\\\"clip-path\\\",\\\"url(#plotterClipPath)\\\");\\n\\n layers.axes = explorableGroup({\\\"where\\\":layers.plot});\\n layers.lines = explorableGroup({\\\"where\\\":layers.plot});\\n\\n\\n layers.indicators = explorableGroup({\\\"where\\\":group});\\n layers.tooltip = explorableGroup({\\\"where\\\":group});\\n\\n return layers;\\n }\\n\\n\\n function addLines(functions) {\\n let lines;\\n\\n if(functions.length == 0) {\\n lines = [];\\n\\n return lines;\\n }\\n\\n functions.forEach((aFunction) => {\\n let line = new FunctionPlotterLine({\\n \\\"function\\\":aFunction,\\n \\\"where\\\":plotter.layers.lines,\\n \\\"domain\\\":plotter.domain,\\n \\\"scales\\\":plotter.scales,\\n });\\n\\n lines.push(line);\\n });\\n\\n return lines;\\n }\\n\\n function addXAxis() {\\n let axis;\\n\\n axis = new FunctionPlotterAxis({\\n \\\"axisType\\\":\\\"bottom\\\",\\n \\\"scales\\\":plotter.scales,\\n \\\"tickCount\\\":axisTickCounts.x,\\n \\\"where\\\":plotter.layers.axes\\n });\\n\\n return axis;\\n }\\n\\n function addYAxis() {\\n let axis;\\n\\n axis = new FunctionPlotterAxis({\\n \\\"axisType\\\":\\\"left\\\",\\n \\\"scales\\\":plotter.scales,\\n \\\"tickCount\\\":axisTickCounts.y,\\n \\\"where\\\":plotter.layers.axes\\n });\\n\\n return axis;\\n }\\n\\n function defaultMargins() {\\n return {\\n \\\"left\\\":100,\\n \\\"right\\\":10,\\n \\\"top\\\":30,\\n \\\"bottom\\\":50\\n };\\n }\\n\\n function defineScale(inputDomain,outputRange) {\\n let scale;\\n\\n scale = d3.scaleLinear()\\n .domain(inputDomain)\\n .range(outputRange);\\n\\n return scale;\\n }\\n\\n function defineScales() {\\n let scales;\\n\\n scales = {};\\n scales.x = defineScale(plotter.domain,[0,plotter.width - plotter.margins.right - plotter.margins.left]);\\n scales.y = defineScale(plotter.range,[plotter.height - plotter.margins.bottom - plotter.margins.top,0]);\\n\\n return scales;\\n }\\n\\n\\n}\",\n \"function initCola() {\\n\\t\\t\\t\\t// set up the axes\\n\\t\\t\\t\\tvar x = d3.scale.linear().domain([0, 350]).range([0, 10]),\\n\\t\\t\\t\\t y = d3.scale.linear().domain([0, 350]).range([0, 10]),\\n\\t\\t\\t\\t z = d3.scale.linear().domain([0, 350]).range([0, 10]);\\n\\n\\t\\t\\t\\t//.on(\\\"tick\\\", function(e) {\\n\\t\\t\\t\\tfor (var key in nodes) {\\n\\t\\t\\t\\t\\tspheres[key].position.set(x(nodes[key].x) * 40 - 40, y(nodes[key].y) * 40 - 40, z(nodes[key].z) * 40 - 40);\\n\\t\\t\\t\\t\\tlabels[key].position.set(x(nodes[key].x) * 40 - 40, y(nodes[key].y) * 40 - 40, z(nodes[key].z) * 40 - 40);\\n\\n\\t\\t\\t\\t\\tfor (var j = 0; j < three_links.length; j++) {\\n\\t\\t\\t\\t\\t\\tvar arrow = three_links[j];\\n\\t\\t\\t\\t\\t\\tvar vi = null;\\n\\t\\t\\t\\t\\t\\tif (arrow.userData.source === key) {\\n\\t\\t\\t\\t\\t\\t\\tvi = 0;\\n\\t\\t\\t\\t\\t\\t}\\n\\t\\t\\t\\t\\t\\tif (arrow.userData.target === key) {\\n\\t\\t\\t\\t\\t\\t\\tvi = 1;\\n\\t\\t\\t\\t\\t\\t}\\n\\t\\t\\t\\t\\t\\tif (vi >= 0) {\\n\\t\\t\\t\\t\\t\\t\\tif (vi == 0) {\\n\\t\\t\\t\\t\\t\\t\\t\\tvar vectOrigin = new THREE.Vector3(spheres[key].position.x, spheres[key].position.y, spheres[key].position.z);\\n\\t\\t\\t\\t\\t\\t\\t\\tsetArrowOrigin(arrow, vectOrigin);\\n\\t\\t\\t\\t\\t\\t\\t}\\n\\t\\t\\t\\t\\t\\t\\tif (vi == 1) {\\n\\t\\t\\t\\t\\t\\t\\t\\tvar vectTarget = new THREE.Vector3(spheres[key].position.x, spheres[key].position.y, spheres[key].position.z);\\n\\t\\t\\t\\t\\t\\t\\t\\tsetArrowTarget(arrow, vectTarget);\\n\\t\\t\\t\\t\\t\\t\\t}\\n\\t\\t\\t\\t\\t\\t}\\n\\t\\t\\t\\t\\t}\\n\\n\\t\\t\\t\\t}\\n\\t\\t\\t\\trenderer.render(scene, camera);\\n\\t\\t\\t}\",\n \"function DrawCtrChart()\\n{\\n // create/delete rows \\n if (ctrTable.getNumberOfRows() < contDataPoints.length)\\n { \\n var numRows = contDataPoints.length - ctrTable.getNumberOfRows();\\n ctrTable.addRows(numRows);\\n } else {\\n for(var i=(ctrTable.getNumberOfRows()-1); i > contDataPoints.length; i--)\\n {\\n ctrTable.removeRow(i); \\n }\\n }\\n\\n // Populate data table with time/cost data points. \\n for(var i=0; i < ctrTable.getNumberOfRows(); i++)\\n {\\n ctrTable.setCell(i, 0, new Date(parseInt(contDataPoints[i].timestamp)));\\n ctrTable.setCell(i, 1, (parseInt(contDataPoints[i].clicks)/parseInt(contDataPoints[i].impressions))*100);\\n }\\n\\n // Draw line chart.\\n chartOptions.title = 'Ctr Chart';\\n ctrChart.draw(ctrView, chartOptions); \\n}\",\n \"function draw(){\\n\\n drawGrid();\\n var seriesIndex;\\n\\n if(!graph.hasData) {\\n return;\\n }\\n\\n if(graph.options.axes.x1.show){\\n if(!graph.options.axes.x1.labels || graph.options.axes.x1.labels.length === 0) {\\n seriesIndex = graph.options.axes.x1.seriesIndex;\\n graph.options.axes.x1.labels= getXLabels(graph.allSeries[seriesIndex].series[0], graph.options.labelDateFormat);\\n }\\n drawXLabels(graph.options.axes.x1);\\n }\\n if(graph.options.axes.x2.show && graph.hasData){\\n if (!graph.options.axes.x2.labels || graph.options.axes.x2.labels.length === 0) {\\n seriesIndex = graph.options.axes.x2.seriesIndex;\\n graph.options.axes.x2.labels = getXLabels(graph.allSeries[seriesIndex].series[0], graph.options.labelDateFormat);\\n }\\n drawXLabels(graph.options.axes.x2);\\n }\\n\\n if (graph.options.axes.y1.show) {\\n drawYLabels(graph.maxVals[graph.options.axes.y1.seriesIndex], graph.minVals[graph.options.axes.y1.seriesIndex], graph.options.axes.y1);\\n }\\n if (graph.options.axes.y2.show) {\\n drawYLabels(graph.maxVals[graph.options.axes.y2.seriesIndex], graph.minVals[graph.options.axes.y2.seriesIndex], graph.options.axes.y2);\\n }\\n }\",\n \"function zoom_arc_plot(v_chr, v_start, v_end) {\\n // chosen chromosome for zoom\\n var xScale_zoomed_chrom,\\n // all other chromosomes\\n xScale_unzoomed_chrom;\\n\\n // margin for the zoom function of the arc plot\\n var margin = {\\n top: 1,\\n right: 1,\\n bottom: 20,\\n left: 10\\n };\\n\\n // padding between the chromosomes\\n var padding = 2;\\n // width and height of the plot\\n var w = 800 - margin.left - margin.right - (24 * padding);\\n var h = 600 - margin.top - margin.bottom; \\n // chromosome length without the chosen chromosome\\n var chrom_scale_compare = chrom_length - chromLength[(v_chr -1)];\\n\\n //for loop to create the length of the chromosomes\\n var chromLength_scaled = [];\\n for (var i = 0;i < chromLength.length; i++) {\\n var temp;\\n if ((v_chr - 1) == i) {\\n chromLength_scaled.push(w/2);\\n } else {\\n temp = ((w/2) / chrom_scale_compare) * chromLength[i];\\n chromLength_scaled.push(temp);\\n }\\n }\\n\\n //for loop to calculate the x position\\n var chrom_x_position = [0];\\n var Scaled_abs_xposition = 0;\\n for (var i = 0; i < chrom_abs_length.length ; i++) {\\n Scaled_abs_xposition = Scaled_abs_xposition + chromLength_scaled[i] + padding;\\n chrom_x_position.push(Scaled_abs_xposition);\\n }\\n\\n // var for the chromsome length of the chosen area\\n var selected_chrom_area = v_end - v_start;\\n // array for the ticks\\n var ticks_chrom_chosen = [];\\n // for loop to create the ticks for the chosen chromosome\\n for (var i = 0; i< 20 ; i++) {\\n var temp_x,\\n temp_label,\\n temp_range,\\n temp_range_label,\\n temp;\\n if(selected_chrom_area == 0) {\\n temp_x = chrom_x_position[(v_chr - 1)] + (chromLength_scaled[(v_chr - 1)] / 20) * i;\\n temp_label = Math.round(((chromLength[(v_chr - 1)] / 20) / 1000000) * i) + \\\"MB\\\";\\n } else {\\n temp_x = chrom_x_position[(v_chr - 1)] + (chromLength_scaled[(v_chr - 1)] / 20) * i;\\n temp = Math.round(v_start + (selected_chrom_area / 20)* i);\\n if(temp < 50000) {\\n temp_range = 1;\\n temp_range_label = \\\"\\\";\\n } else if(temp < 50000000) {\\n temp_range = 1000;\\n temp_range_label = \\\"Kb\\\";\\n } else {\\n temp_range = 1000000;\\n temp_range_label = \\\"Mb\\\";\\n }\\n temp_label = Math.round((temp / temp_range)) + temp_range_label; \\n }\\n var obj = {};\\n obj[\\\"x\\\"] = temp_x;\\n obj[\\\"label\\\"] = temp_label;\\n ticks_chrom_chosen.push(obj);\\n }\\n\\n // array to store all nodes and all links which should not be displayed in the zoom function\\n zoom_allNodes = [];\\n zoom_links = [];\\n links.forEach( function(d) {\\n if((allNodes[d.source].chrom == v_chr \\n && allNodes[d.source].bp_position >= v_start \\n && allNodes[d.source].bp_position <= v_end) ||\\n (allNodes[d.source].chrom == v_chr && selected_chrom_area == 0) ||\\n (allNodes[d.target].chrom == v_chr && \\n allNodes[d.target].bp_position >= v_start && \\n allNodes[d.target].bp_position <= v_end) ||\\n (allNodes[d.target].chrom == v_chr && selected_chrom_area == 0)) {\\n\\n zoom_allNodes.push(allNodes[d.source]);\\n zoom_allNodes.push(allNodes[d.target]);\\n zoom_links.push(d);\\n }\\n });\\n \\n // add nodes with degree zero\\n allNodes.forEach( function (d) {\\n var in_zoomed_chrom = (d.chrom == v_chr && d.degree == 0);\\n var in_zoomed_region = (d.bp_position >= v_start && d.bp_position <= v_end);\\n\\n if(in_zoomed_chrom && in_zoomed_region) {\\n zoom_allNodes.push(d);\\n }\\n });\\n \\n // sort and make the zoom_allnodes function unique\\n var temp_zoomnodes = [];\\n\\n zoom_allNodes.forEach( function (d) {\\n temp_zoomnodes.push(d.id);\\n });\\n\\n temp_zoomnodes = sort_unique(temp_zoomnodes);\\n\\n zoom_allNodes = [];\\n\\n temp_zoomnodes.forEach( function (d) {\\n zoom_allNodes.push(allNodes[d]);\\n });\\n \\n \\n // create SVG for the plot\\n var svg = d3.select(\\\"#chart\\\")\\n .append(\\\"svg\\\")\\n .attr(\\\"id\\\", \\\"mainplot\\\")\\n .attr(\\\"width\\\", width)\\n .attr(\\\"height\\\", height)\\n .append(\\\"g\\\")\\n .attr(\\\"transform\\\", \\\"translate(\\\" + margin.left + \\\",\\\" + margin.top + \\\")\\\");\\n\\n d3.select('#ld_container').selectAll('svg').remove();\\n\\n var chromosome_container = svg.selectAll(\\\"g.group\\\")\\n .data(chromLength)\\n .enter().append(\\\"svg:g\\\")\\n .attr(\\\"transform\\\", function(d, i) {\\n return \\\"translate(\\\" + chrom_x_position[i] + \\\",\\\" + height_chrom_bar + \\\")\\\"; \\n })\\n // scales the width of chromosomes\\n .attr(\\\"width\\\", function(d, i) {\\n create_ld_plot(i+1, chromLength_scaled[i], chrom_x_position[i], padding, v_chr, v_start, v_end); \\n return chromLength_scaled[i]; \\n })\\n .attr(\\\"height\\\", 40)\\n .attr(\\\"class\\\", function (d,i) {\\n return \\\"chrom\\\" + (i+1);\\n });\\n\\n var id_chrom_zoom = \\\"g.chrom\\\" + (v_chr);\\n // store the the new startpoint\\n var startzoom = 0;\\n if (v_start == 0 && v_end == 0) {\\n var x_scale_zoom = d3.scale.linear()\\n .domain([0, chromLength[(v_chr -1)]])\\n .range([0, chromLength_scaled[(v_chr -1)]]);\\n } else {\\n var x_scale_zoom = d3.scale.linear()\\n .domain([v_start, v_end])\\n .range([0, chromLength_scaled[(v_chr -1)]]);\\n }\\n \\n //function to zoom with the mouse\\n var brush = svg.select(id_chrom_zoom)\\n .append(\\\"g\\\")\\n .attr(\\\"class\\\", \\\"brush\\\")\\n .call(d3.svg.brush().x(x_scale_zoom)\\n .on(\\\"brushstart\\\", brushstart)\\n .on(\\\"brush\\\", brushmove)\\n .on(\\\"brushend\\\", brushend))\\n .selectAll(\\\"rect\\\")\\n .attr(\\\"height\\\", 40) \\n .style(\\\"stroke\\\", \\\"blue\\\")\\n .style(\\\"fill\\\", \\\"blue\\\")\\n .style(\\\"opacity\\\" , 0.7);\\n\\n function brushstart() { \\n brush.classed(\\\"selecting\\\", true);\\n }\\n\\n function brushmove() {\\n var r = d3.event.target.extent(); \\n document.getElementById(\\\"texzs\\\").value = Math.round(r[0]);\\n document.getElementById(\\\"texze\\\").value = Math.round(r[1]);\\n }\\n\\n function brushend() { \\n brush.classed(\\\"selecting\\\", !d3.event.target.empty());\\n }\\n\\n // create rectangle in the g container\\n var chrom_bar = chromosome_container.append(\\\"rect\\\")\\n .attr(\\\"transform\\\", \\\"translate(\\\" + 0 + \\\",\\\" + 0 + \\\")\\\")\\n .attr(\\\"class\\\", \\\"rect\\\")\\n // scales the width of chromosomes\\n .attr(\\\"width\\\", function(d, i) {\\n return chromLength_scaled[i]; \\n })\\n .attr(\\\"height\\\", 20)\\n .style(\\\"fill\\\", function(d, i) {\\n return chromcolour[i];\\n })\\n .style(\\\"stroke\\\", function(d, i) {\\n return chromcolour[i];\\n });\\n\\n //create ticks for the chrom_bar\\n svg.selectAll(\\\"line\\\")\\n .data(ticks_chrom_chosen)\\n .enter().append(\\\"line\\\")\\n .attr(\\\"class\\\", \\\"tickchromosome\\\")\\n .attr(\\\"x1\\\", function(d) {\\n return + d.x;\\n })\\n .attr(\\\"y1\\\", height_nodes + 25)\\n .attr(\\\"x2\\\", function (d) {\\n return + d.x;\\n })\\n .attr(\\\"y2\\\", height_nodes + 30)\\n .style(\\\"stroke\\\", \\\"#000\\\")\\n\\n svg.selectAll(\\\"text\\\")\\n .data(ticks_chrom_chosen)\\n .enter().append(\\\"text\\\")\\n .attr(\\\"class\\\", \\\"label\\\")\\n .attr(\\\"dy\\\", \\\".35em\\\")\\n .attr(\\\"transform\\\", function (d) {\\n return \\\"translate(\\\"+ d.x + \\\",\\\" + (height_nodes + 38) + \\\")\\\" + \\\"rotate(90)\\\"; \\n })\\n .attr(\\\"font-size\\\", \\\"10\\\")\\n .text(function (d) {\\n return d.label; \\n });\\n\\n // create the label for the chromosomes\\n chromosome_container.append(\\\"svg:text\\\")\\n .attr(\\\"class\\\", \\\"chromosom_number\\\")\\n // 2* padding for double digits chromosome numbers\\n .attr(\\\"transform\\\", function (d, i) {\\n if (i == (v_chr-1)) {\\n return \\\"translate(\\\" + (8 * padding) + \\\",\\\" + 15 + \\\")\\\";\\n } else {\\n return \\\"translate(\\\" + (4 * padding) + \\\",\\\" + 35 + \\\")\\\"; \\n }\\n })\\n .append(\\\"svg:textPath\\\")\\n .text(function(d, i) {\\n return i + 1;\\n })\\n .attr(\\\"font-size\\\", function (d, i) {\\n if (i == (v_chr-1)) {\\n return \\\"14px\\\";\\n } else {\\n return \\\"9px\\\";\\n }\\n })\\n .attr(\\\"text-anchor\\\", \\\"end\\\")\\n .style(\\\"fill\\\", function(d, i) {\\n if (i == (v_chr - 1)) {\\n return \\\"#000\\\";\\n } else {\\n return chromcolour[i];\\n }\\n })\\n .style(\\\"stroke\\\", function(d, i) {\\n if (i == (v_chr - 1)) {\\n return \\\"#000\\\";\\n } else {\\n return chromcolour[i];\\n }\\n });\\n\\n // object to store the position of the zoomed chromosomes\\n var id_chosen = [];\\n // create circles for the location of the interacting SNPs \\n svg.selectAll(\\\"circle.vertex\\\")\\n .data(zoom_allNodes)\\n .enter().append(\\\"circle\\\")\\n .attr(\\\"class\\\", \\\"circle_zoom\\\")\\n .style(\\\"fill\\\", function(d) {\\n return graphColor(d.probe_group);\\n })\\n .style(\\\"stroke\\\", function(d) {\\n return graphColor(d.probe_group);\\n })\\n // positioning the SNPs\\n .attr(\\\"cx\\\", function(d) {\\n if(d.chrom == v_chr && selected_chrom_area == 0) {\\n id_chosen[d.id] = chrom_x_position[(d.chrom -1 )] + \\n ((w/2) / chromLength[(d.chrom - 1)]) * d.bp_position; \\n return id_chosen[d.id];\\n\\n } else if (d.chrom == v_chr && selected_chrom_area > 0 && d.bp_position >= v_start && \\n d.bp_position <= v_end) {\\n id_chosen[d.id] = chrom_x_position[(d.chrom -1)] + \\n ((w/2) / selected_chrom_area) * (d.bp_position - v_start);\\n return id_chosen[d.id];\\n\\n } else if(d.chrom == v_chr && selected_chrom_area > 0 && d.bp_position < v_start ) {\\n id_chosen[d.id] = chrom_x_position[(d.chrom -1)];\\n return id_chosen[d.id];\\n\\n } else if (d.chrom == v_chr && selected_chrom_area > 0 && d.bp_position > v_end) {\\n id_chosen[d.id] = chrom_x_position[(d.chrom - 1)] + (w/2);\\n return id_chosen[d.id];\\n\\n } else if(d.chrom != v_chr) {\\n id_chosen[d.id] = chrom_x_position[(d.chrom -1 )] +\\n ((w/2) / chrom_scale_compare) * d.bp_position; \\n return id_chosen[d.id];\\n\\n } else {\\n return id_chosen[d.id] = \\\"NaN\\\" ;\\n }\\n })\\n .attr(\\\"cy\\\", height_nodes)\\n .attr(\\\"r\\\", function(d) {\\n if(id_chosen[d.id] == \\\"NaN\\\" && d.chrom == v_chr ) {\\n return 0;\\n } else {\\n return 2;\\n }\\n })\\n // to get information about the SNPs from different sources, if you click on a circle\\n .on(\\\"click\\\", function (d,i) { externalLink(d, i); });\\n\\n // show degree as tooltip - title\\n svg.selectAll(\\\"g .circle_zoom\\\") \\n .append(\\\"title\\\")\\n .text(function(d) {\\n return \\\"degree: \\\" + two_dec(d.degree) + \\\"\\\\nSNP: \\\" + d.rs + \\\"\\\\nid: \\\" + d.id + \\n \\\"\\\\nposition: \\\" + d.bp_position\\n });\\n\\n // draw the edges between linked SNP's nodes\\n var arcs = svg.selectAll(\\\"path.link\\\")\\n .data(zoom_links)\\n .enter().append(\\\"path\\\")\\n .attr(\\\"class\\\", \\\"link\\\")\\n .style(\\\"stroke\\\", function(d) {\\n return graphColor(d.probe_group);\\n })\\n .style(\\\"stroke\\\", 1)\\n .style(\\\"stroke-width\\\", 2.5)\\n .style(\\\"opacity\\\", 3.7)\\n .style(\\\"fill\\\", \\\"none\\\")\\n // function to create the arc for the links\\n .attr(\\\"d\\\", function (d) {\\n // to ensure that the path is drawn correct \\n if(d.source > d.target) {\\n var temp;\\n temp = d.source;\\n d.source = d.target;\\n d.target = temp;\\n } \\n\\n if (allNodes[d.source].chrom == v_chr || allNodes[d.target].chrom == v_chr) {\\n var start_position_x = id_chosen[d.source],\\n start_position_y = height_nodes ;\\n\\n var end_position_x = id_chosen[d.target],\\n end_position_y = height_nodes ;\\n } else {\\n var start_position_x = \\\"NaN\\\",\\n start_position_y = height_nodes ;\\n\\n var end_position_x = \\\"NaN\\\",\\n end_position_y = height_nodes ;\\n }\\n\\n // to ensure that the arc links are drawn on the correct side \\n if (end_position_x < start_position_x) {\\n var temp; \\n temp = end_position_x; \\n end_position_x = start_position_x;\\n start_position_x = temp; \\n }\\n\\n var radius = (end_position_x - start_position_x) / 2 ;\\n\\n var c1x = start_position_x,\\n c1y = start_position_y - radius,\\n c2x = end_position_x,\\n c2y = end_position_y - radius ;\\n\\n return \\\"M\\\" + start_position_x + \\\",\\\" + start_position_y + \\\" C\\\" + c1x +\\n \\\",\\\" + c1y + \\\",\\\" + c2x + \\\",\\\" + c2y + \\\" \\\" + \\n end_position_x + \\\",\\\" + end_position_y ; \\n })\\n .on(\\\"click\\\" , function(d,i) { return highlight_snp_pairs(d, i);});\\n\\n // creates the colour scale indicator for the ld plot\\n createColourScale_ldplot();\\n}\",\n \"constructor(x, y) {\\n\\t\\tthis.chadX = 1000;\\n\\t\\tthis.chadY = 10;\\n\\t\\tthis.chadW = 10;\\n\\t\\tthis.chadDy = 5;\\n this.color = \\\"Red\\\";\\n }\",\n \"function drawXY(){\\r\\n//setting the x and y domains\\r\\n x.domain([d3.min(cars, function(d) { return d.year; }), d3.max(cars, function(d) { return d.year; })]);\\r\\n y.domain([d3.min(cars, function(d) { return d.power; }), d3.max(cars, function(d) { return d.power; })]);\\r\\n\\r\\n//setting the yPosition \\r\\n var yPos = height -20;\\r\\n//creating the x-Axis\\r\\n chart.append(\\\"g\\\")\\r\\n\\t .attr(\\\"class\\\", \\\"xaxis\\\")\\r\\n\\t .attr(\\\"transform\\\", \\\"translate(0,\\\" + yPos + \\\")\\\")\\r\\n\\t .call(xAxis);\\r\\n//creating the Y-axis\\r\\n chart.append(\\\"g\\\")\\r\\n\\t .attr(\\\"class\\\", \\\"yaxis\\\")\\r\\n\\t .attr(\\\"transform\\\", \\\"translate(480,0)\\\")\\r\\n\\t .call(yAxis);\\r\\n\\r\\n \\r\\n//selecting ths dot \\r\\n//adding attributes\\t\\r\\n chart.selectAll(\\\".dot\\\")\\r\\n\\t .data(cars)\\r\\n\\t .enter().append(\\\"circle\\\")\\r\\n\\t .attr(\\\"class\\\", \\\"dot\\\")\\r\\n\\t .attr(\\\"cx\\\", function(d) { return x(d.year); })\\r\\n\\t .attr(\\\"cy\\\", function(d) { return y(d.power); })\\r\\n\\t .attr(\\\"r\\\", 3)\\r\\n\\t \\r\\n//the mouseover function that fills the dots red when the mouse is over them\\r\\n\\t .on(\\\"mouseover\\\", function(){\\r\\n\\t\\t\\td3.select(this)\\r\\n\\t\\t\\t.attr(\\\"fill\\\", \\\"red\\\")\\r\\n\\t })\\r\\n//the mouseout function that changes the dots back to normal color\\r\\n\\t.on(\\\"mouseout\\\", function(){\\r\\n\\t\\td3.select(this)\\r\\n\\t\\t.attr(\\\"fill\\\", \\\"black\\\")\\r\\n\\t\\t\\r\\n})\\r\\n\\t\\r\\n \\r\\n}\",\n \"function plotTrajectory(trajectoryData, color) {\\n console.log(trajectoryData);\\n \\n \\n \\n \\n \\n}\",\n \"circ(x0, y0, r, c) {\\n // evaluate runtime errors\\n this.colorRangeError(c);\\n // draw filled circle\\n let x = 0;\\n let y = r;\\n let p = 3 - 2 * r;\\n this.circPixGroup(x0, y0, x, y, c);\\n while (x < y) {\\n x++;\\n if (p < 0) {\\n p = p + 4 * x + 6;\\n }\\n else {\\n y--;\\n p = p + 4 * (x - y) + 10;\\n }\\n this.circPixGroup(x0, y0, x, y, c);\\n }\\n }\",\n \"function drawCanyon(t_canyon)\\n{\\n noStroke();\\n\\tfill(100, 155, 255);\\n\\trect(t_canyon.x_pos, t_canyon.y_pos, t_canyon.width, 200);\\n}\",\n \"function render_scatterOnrust() {\\n var plotS = hgiScatter().mapping(['uw_eigen_factor', 'onrust']).addLOESS(true).xLabel('Uw eigen factor').yLabel('Onrust').xTicks(5).yTicks(5);\\n d3.select('#scatterOnrust').datum(data).call(plotS);\\n}\",\n \"function sheetContour(response) {\\r\\n graphData = JSON.parse(response);\\r\\n var data = [\\r\\n {\\r\\n x: graphData.x,\\r\\n y: graphData.y,\\r\\n z: graphData.z,\\r\\n type: \\\"contour\\\"\\r\\n }\\r\\n ];\\r\\n var layout = {\\r\\n title: \\\"Contour\\\"\\r\\n };\\r\\n // Display plot\\r\\n Plotly.newPlot(\\\"contourPlot\\\", data, layout);\\r\\n}\",\n \"addAxes () {\\n }\",\n \"function plotAll() {\\n d3.select(\\\"#scatter-macro-1 svg\\\").remove()\\n d3.select(\\\"#scatter-macro-2 svg\\\").remove()\\n d3.select(\\\"#scatter-micro-1 svg\\\").remove()\\n d3.select(\\\"#scatter-micro-2 svg\\\").remove()\\n doPlot(\\\"scatter-macro-1\\\", voltageArr, \\\"Voltage\\\", maxLinearVelocityArr, \\\"Max. Linear Velocity\\\");\\n doPlot(\\\"scatter-macro-2\\\", currentArr, \\\"Current\\\", accelerationArr, \\\"Acceleration\\\");\\n doPlot(\\\"scatter-micro-1\\\", voltageArr, \\\"Voltage\\\", maxAngularVelocityArr, \\\"Max. Angular Velocity\\\");\\n doPlot(\\\"scatter-micro-2\\\", currentArr, \\\"Current\\\", torqueArr, \\\"Torque\\\");\\n}\",\n \"function DrawCircle(xc, yc, r){\\n /**@todo */\\n let x = 0;\\n let y = r;\\n let d = 3 - 2 * r;\\n DrawEightPoints(xc,x,yc,y);\\n while(y >= x) //While we're only looking at degrees from 45-90\\n {\\n x++;\\n if(d > 0){\\n y--;\\n d += 4 * (x-y) + 10;\\n }\\n else{\\n d += 4 * x + 6;\\n }\\n DrawEightPoints(xc,x,yc,y);\\n }\\n}\",\n \"function CalculMélangeRGB() {\\n \\n //valeurs des curseurs\\n valCurseurR = document.querySelector(\\\"#curseurRouge\\\").getElementsByTagName('input')[0].value;\\n valCurseurG = document.querySelector(\\\"#curseurVert\\\").getElementsByTagName('input')[0].value;\\n valCurseurB = document.querySelector(\\\"#curseurBleu\\\").getElementsByTagName('input')[0].value;\\n //valeurs des curseurs en %\\n pCurseurR = valCurseurR / 100;\\n pCurseurB = valCurseurB / 100;\\n pCurseurG = valCurseurG / 100;\\n\\n //recuperer les valeurs X Y Z\\n XBleu = data.XYZ.B.X;\\n YBleu = data.XYZ.B.Y;\\n ZBleu = data.XYZ.B.Z;\\n //XYZ du Vert\\n XVert = data.XYZ.G.X;\\n YVert = data.XYZ.G.Y;\\n ZVert = data.XYZ.G.Z;\\n //XYZ du rouge\\n XRouge = data.XYZ.R.X;\\n YRouge = data.XYZ.R.Y;\\n ZRouge = data.XYZ.R.Z;\\n\\n //calcul du X,Y,Z pour le mélange\\n\\n Xmelange = (XBleu * pCurseurB) + (XVert * pCurseurG) + (XRouge * pCurseurR);\\n Ymelange = (YBleu * pCurseurB) + (YVert * pCurseurG) + (YRouge * pCurseurR);\\n Zmelange = (ZBleu * pCurseurB) + (ZVert * pCurseurG) + (ZRouge * pCurseurR);\\n\\n //calcul du melange du x et y\\n xMelange = Xmelange / (Xmelange + Ymelange + Zmelange);\\n yMelange = Ymelange / (Xmelange + Ymelange + Zmelange);\\n\\n const cieChart = document.querySelector('cie-xy-chart'); // Tu récupère le premier diagramme de ton DOM (par exemple.)\\n cieChart.inputs.xy.x.value = xMelange; // Tu définis la valeur du champ x.\\n cieChart.inputs.xy.x.dispatchEvent(new InputEvent('input')); // Tu déclenches l'événement \\\"input\\\" correspondant à x.\\n cieChart.inputs.xy.y.value = yMelange; // Tu définis la valeur du champ y.\\n cieChart.inputs.xy.y.dispatchEvent(new InputEvent('input')); // Tu déclenches l'événement \\\"input\\\" correspondant à y.\\n // Déclencher les événements input devrait rafraîchir le diagramme.\\n \\n}\",\n \"function plot() {\\n\\n // Skip some frames to avoid unnecessary workload\\n counterGraph++\\n if (counterGraph % skipRateGraph != 0) return\\n\\n // fill data arrays\\n timeArray.push(time);\\n susceptibleArray.push(nSusceptible);\\n infectedArray.push(nInfected);\\n immuneArray.push(nImmune);\\n deathsArray.push(nDeaths);\\n\\n // Clear graph canvas\\n ctxGraph.clearRect(0, 0, canvasGraph.width, canvasGraph.height);\\n\\n // draw the axes\\n drawAxes()\\n\\n // draw the susceptible\\n ctxGraph.beginPath();\\n ctxGraph.strokeStyle = \\\"purple\\\";\\n ctxGraph.lineWidth = 3;\\n drawGraph(timeArray, susceptibleArray)\\n ctxGraph.stroke();\\n\\n // draw the infected\\n ctxGraph.beginPath();\\n ctxGraph.strokeStyle = \\\"red\\\";\\n ctxGraph.lineWidth = 3;\\n drawGraph(timeArray, infectedArray)\\n ctxGraph.stroke();\\n\\n // draw the immune\\n ctxGraph.beginPath();\\n ctxGraph.strokeStyle = \\\"green\\\";\\n ctxGraph.lineWidth = 3;\\n drawGraph(timeArray, immuneArray)\\n ctxGraph.stroke();\\n\\n // draw the deaths\\n ctxGraph.beginPath();\\n ctxGraph.strokeStyle = \\\"black\\\";\\n ctxGraph.lineWidth = 3;\\n drawGraph(timeArray, deathsArray)\\n ctxGraph.stroke();\\n}\",\n \"drawCones(){\\r\\n // might be place where we add the x and y coords to the canvas to draw the cones\\r\\n for (let i = 0; i < this.numCones; i++)\\r\\n {\\r\\n cones[i].x = ((this.coneLoc[i].x));\\r\\n cones[i].y = (this.coneLoc[i].y);\\r\\n }\\r\\n }\",\n \"function CubicPoly(){}\",\n \"function bobaTick(nodes, strokeWidth, cupRadius, hyp2, w) {\\n // console.log('tick');\\n\\n nodes.attr('cx', function (d) {\\n return d.x = magicInternetFunction(d.rad, d.x, d.y, strokeWidth, cupRadius, hyp2, w);\\n })\\n .attr('cy', function (d) {\\n return d.y = magicInternetFunction(d.rad, d.y, d.x, strokeWidth, cupRadius, hyp2, w);\\n });\\n }\",\n \"function draw() {\\n ellipseMode(CENTER);\\n drawTrack(h1Pat, whatY(1));\\n drawTrack(h2Pat, whatY(2));\\n drawTrack(snPat, whatY(3));\\n drawTrack(shPat, whatY(4));\\n drawTrack(k1Pat, whatY(5));\\n drawTrack(k2Pat, whatY(6));\\n getTrackCenters();\\n}\",\n \"function drawCases(){\\n clear();\\n \\n div.hide();\\n let data = boundary[0].the_geom.coordinates[0];\\n stroke(255);\\n fill(100,100,100, 50);\\n\\tbeginShape();\\n\\t\\tfor (var i = 0; i < data.length; i++) {\\n\\t\\t\\tlet lon = boundary[0].the_geom.coordinates[0][i][0];\\n let lat = boundary[0].the_geom.coordinates[0][i][1];\\n \\n const p = myMap.latLngToPixel(lat, lon);\\n\\n\\t\\t\\tlet x = map(lon, city_limit.xMin, city_limit.xMax, 0+padding, width-padding);\\n\\t\\t\\tlet y = map(lat,city_limit.yMin, city_limit.yMax, height-padding, 0+padding);\\n\\n\\t\\t\\tvertex(p.x,p.y);\\n\\t\\t}\\n\\tendShape(CLOSE);\\n\\n\\n fill(109, 255, 0);\\n stroke(100);\\n for(var i = 0; i < Object.keys(covidData).length; i++)\\n {\\n\\n const latitude = covidData[i][\\\"attributes\\\"][\\\"Y\\\"];\\n const longitude = covidData[i][\\\"attributes\\\"][\\\"X\\\"];\\n \\n\\n //if (myMap.map.getBounds().contains([latitude, longitude])) {\\n // Transform lat/lng to pixel position\\n const pos = myMap.latLngToPixel(latitude, longitude);\\n \\n //map(value, start1, stop1, start2, stop2)\\n let size = covidData[i][\\\"attributes\\\"][\\\"Point_Count\\\"];\\n size = map(size, 0, covidData[0][\\\"attributes\\\"][\\\"Point_Count\\\"], 1, 25) + myMap.zoom();\\n ellipse(pos.x, pos.y, size, size); \\n\\n \\n }\\n\\n }\",\n \"function colorwheel(a,theta,x){return a*(1+cos(theta+x))}\",\n \"function drawCylinder() {\\t\\r\\n\\t\\t//TODO: update VBO positions based on 'factor' for cone-like effect\\r\\n\\t\\tmeshes.cylinder.drawMode = gl.LINE_LOOP;\\r\\n\\t\\t\\r\\n\\t\\t// Render\\r\\n\\t\\tmeshes.cylinder.setAttribLocs(attribs);\\r\\n\\t\\tmeshes.cylinder.render();\\t\\t\\t\\t\\r\\n\\t}\"\n]","isConversational":false},"negative_scores":{"kind":"list like","value":["0.5888707","0.5736098","0.56165415","0.5589112","0.55744106","0.55394167","0.5459294","0.5414624","0.5414624","0.5370074","0.53614116","0.5356966","0.53366965","0.5328876","0.5309544","0.53041136","0.5301971","0.5296474","0.5284543","0.5255541","0.5231733","0.5223299","0.52098805","0.5204737","0.5194695","0.518084","0.5169951","0.5156523","0.51543087","0.5148458","0.51468754","0.5134001","0.51329017","0.5121668","0.51201004","0.5108403","0.5108007","0.51036286","0.509853","0.5095718","0.508755","0.5086827","0.50782615","0.50681853","0.50588816","0.5051154","0.5048031","0.5015852","0.50120556","0.5008874","0.50085956","0.50011784","0.49959576","0.49959576","0.49950635","0.49920264","0.49878576","0.49794656","0.4969593","0.49691632","0.49660802","0.49631706","0.4948637","0.49449918","0.49449918","0.49409166","0.49398968","0.49374905","0.4933055","0.49307865","0.49307865","0.49307865","0.49307865","0.49307865","0.4924931","0.49236783","0.4923673","0.4923485","0.49216768","0.49207845","0.49185085","0.49154055","0.49130273","0.49126133","0.4909292","0.49044555","0.48974872","0.489712","0.4894673","0.48875624","0.4886608","0.488419","0.48815238","0.48779947","0.48776543","0.48682335","0.4861912","0.48605984","0.4853527","0.48507434"],"string":"[\n \"0.5888707\",\n \"0.5736098\",\n \"0.56165415\",\n \"0.5589112\",\n \"0.55744106\",\n \"0.55394167\",\n \"0.5459294\",\n \"0.5414624\",\n \"0.5414624\",\n \"0.5370074\",\n \"0.53614116\",\n \"0.5356966\",\n \"0.53366965\",\n \"0.5328876\",\n \"0.5309544\",\n \"0.53041136\",\n \"0.5301971\",\n \"0.5296474\",\n \"0.5284543\",\n \"0.5255541\",\n \"0.5231733\",\n \"0.5223299\",\n \"0.52098805\",\n \"0.5204737\",\n \"0.5194695\",\n \"0.518084\",\n \"0.5169951\",\n \"0.5156523\",\n \"0.51543087\",\n \"0.5148458\",\n \"0.51468754\",\n \"0.5134001\",\n \"0.51329017\",\n \"0.5121668\",\n \"0.51201004\",\n \"0.5108403\",\n \"0.5108007\",\n \"0.51036286\",\n \"0.509853\",\n \"0.5095718\",\n \"0.508755\",\n \"0.5086827\",\n \"0.50782615\",\n \"0.50681853\",\n \"0.50588816\",\n \"0.5051154\",\n \"0.5048031\",\n \"0.5015852\",\n \"0.50120556\",\n \"0.5008874\",\n \"0.50085956\",\n \"0.50011784\",\n \"0.49959576\",\n \"0.49959576\",\n \"0.49950635\",\n \"0.49920264\",\n \"0.49878576\",\n \"0.49794656\",\n \"0.4969593\",\n \"0.49691632\",\n \"0.49660802\",\n \"0.49631706\",\n \"0.4948637\",\n \"0.49449918\",\n \"0.49449918\",\n \"0.49409166\",\n \"0.49398968\",\n \"0.49374905\",\n \"0.4933055\",\n \"0.49307865\",\n \"0.49307865\",\n \"0.49307865\",\n \"0.49307865\",\n \"0.49307865\",\n \"0.4924931\",\n \"0.49236783\",\n \"0.4923673\",\n \"0.4923485\",\n \"0.49216768\",\n \"0.49207845\",\n \"0.49185085\",\n \"0.49154055\",\n \"0.49130273\",\n \"0.49126133\",\n \"0.4909292\",\n \"0.49044555\",\n \"0.48974872\",\n \"0.489712\",\n \"0.4894673\",\n \"0.48875624\",\n \"0.4886608\",\n \"0.488419\",\n \"0.48815238\",\n \"0.48779947\",\n \"0.48776543\",\n \"0.48682335\",\n \"0.4861912\",\n \"0.48605984\",\n \"0.4853527\",\n \"0.48507434\"\n]","isConversational":false},"document_score":{"kind":"string","value":"0.5288344"},"document_rank":{"kind":"string","value":"18"}}},{"rowIdx":4597,"cells":{"query":{"kind":"string","value":"Function plots Spherical coordiate system"},"document":{"kind":"string","value":"function plotSpherical(r, theta, phi, target){\n\n let hoverlabel = [\"R: \"+r[0]+\", Θ: \"+theta[0]+\", Φ: \"+phi[0],\"R: \"+r[1]+\", Θ: \"+theta[1]+\", Φ: \"+phi[1]];\n var data = [{\n type: 'scatter3d',\n mode: 'lines',\n x: r,\n y: theta,\n z: phi,\n hoverinfo: 'text',\n hovertext: hoverlabel,\n opacity: 1,\n line: {\n width: 6,\n color: \"rgb(0,0,0)\",\n reversescale: false\n }\n }]\n\n var layout = {\n scene: {\n xaxis:{title: 'R'},\n yaxis:{title: 'THETA'},\n zaxis:{title: 'PHI'},\n },\n showticklabels: false\n }\n\n Plotly.plot(target, data, layout);\n}"},"metadata":{"kind":"string","value":"{\n \"objective\": {\n \"self\": [],\n \"paired\": [],\n \"triplet\": [\n [\n \"query\",\n \"document\",\n \"negatives\"\n ]\n ]\n }\n}"},"negatives":{"kind":"list like","value":["function drawSphere(gl) {\n\tdrawCircle(gl);\n\tdrawMarks(gl);\n}","function drawSphere() {\n setMV();\n Sphere.draw();\n}","function drawSphere() {\n setMV();\n Sphere.draw();\n}","function spherical(cartesian) {\n return [Object(__WEBPACK_IMPORTED_MODULE_1__math__[\"g\" /* atan2 */])(cartesian[1], cartesian[0]) * __WEBPACK_IMPORTED_MODULE_1__math__[\"j\" /* degrees */], Object(__WEBPACK_IMPORTED_MODULE_1__math__[\"e\" /* asin */])(Object(__WEBPACK_IMPORTED_MODULE_1__math__[\"q\" /* max */])(-1, Object(__WEBPACK_IMPORTED_MODULE_1__math__[\"r\" /* min */])(1, cartesian[2]))) * __WEBPACK_IMPORTED_MODULE_1__math__[\"j\" /* degrees */]];\n}","function spherical(cartesian) {\n return [\n Object(__WEBPACK_IMPORTED_MODULE_1__math__[\"g\" /* atan2 */])(cartesian[1], cartesian[0]) * __WEBPACK_IMPORTED_MODULE_1__math__[\"j\" /* degrees */],\n Object(__WEBPACK_IMPORTED_MODULE_1__math__[\"e\" /* asin */])(Object(__WEBPACK_IMPORTED_MODULE_1__math__[\"q\" /* max */])(-1, Object(__WEBPACK_IMPORTED_MODULE_1__math__[\"r\" /* min */])(1, cartesian[2]))) * __WEBPACK_IMPORTED_MODULE_1__math__[\"j\" /* degrees */]\n ];\n}","function Sphere1 (long, lat) {\n\n\tthis.name = \"sphere1\";\n\n\t// vertices definition\n\t////////////////////////////////////////////////////////////\n\n\tthis.vertices = new Float32Array(3*((long-1)*(lat)+2));\n\n\tvar radius = 1.0;\n\tvar p;\n var t;\n var p_step = Math.PI / long;\n\tvar t_step = 6.283185307179586476925286766559 / lat;\n\n\tvar vertexoffset = 0;\n // bottom vertex\n this.vertices[vertexoffset] = 0.0;\n this.vertices[vertexoffset+1] = -1.0;\n this.vertices[vertexoffset+2] = 0.0;\n vertexoffset += 3;\n\n // middle sphere\n\tfor (var i = 1; i < long; i++) {\n p = p_step*i - Math.PI/2; //start from -pi/2 and go to pi/2 for longitude\n //console.log(p);\n for(var j = 0; j < lat; j++){\n t = t_step*j;\n //console.log(t);\n this.vertices[vertexoffset] = Math.cos(p) * Math.sin(t);\n //console.log(this.vertices[vertexoffset]);\n \t\tthis.vertices[vertexoffset+1] = Math.sin(p);\n //console.log(this.vertices[vertexoffset+1]);\n \t\tthis.vertices[vertexoffset+2] = Math.cos(p) * Math.cos(t);\n //console.log(this.vertices[vertexoffset+2]);\n \t\tvertexoffset += 3;\n }\n\t}\n\n // top vertex\n this.vertices[vertexoffset] = 0.0;\n this.vertices[vertexoffset+1] = 1.0;\n this.vertices[vertexoffset+2] = 0.0;\n vertexoffset += 3;\n\n var totalvertices = vertexoffset/3;\n\n\t// triangles definition\n\t////////////////////////////////////////////////////////////\n\n\tthis.triangleIndices = new Uint16Array(6*long*lat);\n\n\tvar triangleoffset = 0;\n // bottom of sphere\n\tfor (var i = 0; i < lat; i++)\n\t{\n\t\tthis.triangleIndices[triangleoffset] = 0; //bottom vertex\n\t\tthis.triangleIndices[triangleoffset+1] = i+1;//%totalvertices;\n\t\tthis.triangleIndices[triangleoffset+2] = (i+1)%lat + 1;//%totalvertices;\n\t\ttriangleoffset += 3;\n\t}\n\n //middle of sphere\n\tfor (var i = 0; i <= lat*(long-1); i++)\n\t{\n if(i <= (lat)*(long-2)){\n\t\t this.triangleIndices[triangleoffset] = i;\n\t\t this.triangleIndices[triangleoffset+1] = i+1;\n\t\t this.triangleIndices[triangleoffset+2] = i+lat;\n\t\t triangleoffset += 3;\n }\n\n if(i >= lat){\n\t\t this.triangleIndices[triangleoffset] = i;\n\t\t this.triangleIndices[triangleoffset+1] = i+1;\n\t\t this.triangleIndices[triangleoffset+2] = i+1-lat;\n\t\t triangleoffset += 3;\n }\n\t}\n\n for (var i = 0; i < lat; i++)\n\t{\n\t\tthis.triangleIndices[triangleoffset] = totalvertices-1; //bottom vertex\n\t\tthis.triangleIndices[triangleoffset+1] = i+(lat)*(long-2);//%totalvertices;\n\t\tthis.triangleIndices[triangleoffset+2] = i+1+(lat)*(long-2);//%totalvertices;\n\t\ttriangleoffset += 3;\n\t}\n\n\tthis.numVertices = this.vertices.length/3;\n\tthis.numTriangles = this.triangleIndices.length/3;\n}","function spherical(cartesian) {\n return [\n atan2(cartesian[1], cartesian[0]) * degrees,\n asin(max(-1, min(1, cartesian[2]))) * degrees,\n ];\n}","function phi() {\n\tvar xcoords = [];\n\tvar ycoords = [];\n\tvar turnFraction = (1 + Math.sqrt(5)) / 2;\n\tfor (var i = 0; i < maxIter; i++) {\n\t\tvar dist = i*i / (maxIter - 1);\n\t\tvar angle = 2 * Math.PI * turnFraction * i;\n\t\tvar x = dist * Math.cos(angle);\n\t\tvar y = dist * Math.sin(angle);\n\n\t\txcoords.push(x);\n\t\tycoords.push(y);\n\t}\n\tvar data = {\n\t\tx: xcoords,\n\t\ty: ycoords,\n\t\tmode: 'markers',\n\t\ttype: 'scatter'\n\t}\n\treturn data;\n}","function generateSphere1(config) {\n var scale, lats, longs, generateUVs;\n scale = config.scale || 100;\n lats = config.lats || 20;\n longs = config.longs || 20;\n generateUVs = config.generateUVs || false;\n var points = [],\n edges = [],\n polys = [],\n uvs = [];\n for (let latNumber = 0; latNumber <= lats; ++latNumber) {\n for (let longNumber = 0; longNumber <= longs; ++longNumber) {\n var theta = latNumber * PI / lats;\n var phi = longNumber * TAU / longs;\n var sinTheta = sin(theta);\n var sinPhi = sin(phi);\n var cosTheta = cos(theta);\n var cosPhi = cos(phi);\n var x = cosPhi * sinTheta;\n var y = cosTheta;\n var z = sinPhi * sinTheta;\n if (generateUVs) {\n var u = longNumber / longs;\n var v = latNumber / lats;\n uvs.push({\n u: u,\n v: v\n })\n }\n points.push({\n x: scale * x,\n y: scale * y,\n z: scale * z\n })\n }\n }\n for (let latNumber = 0; latNumber < lats; ++latNumber) {\n for (let longNumber = 0; longNumber < longs; ++longNumber) {\n var first = (latNumber * (longs + 1)) + longNumber;\n var second = first + longs + 1;\n if (latNumber === 0) {\n var p = [first + 1, second + 1, second];\n if (generateUVs) {\n p.uvs = [uvs[first + 1].u, uvs[first + 1].v, uvs[second + 1].u, uvs[second + 1].v, uvs[second].u, uvs[second].v]\n }\n polys.push(p);\n edges.push({\n a: first,\n b: second\n })\n } else {\n if (latNumber === lats - 1) {\n let p = [first + 1, second, first];\n if (generateUVs) {\n p.uvs = [uvs[first + 1].u, uvs[first + 1].v, uvs[second].u, uvs[second].v, uvs[first].u, uvs[first].v]\n }\n polys.push(p);\n edges.push({\n a: first,\n b: second\n })\n } else {\n let p = [first + 1, second + 1, second, first];\n if (generateUVs) {\n p.uvs = [uvs[first + 1].u, uvs[first + 1].v, uvs[second + 1].u, uvs[second + 1].v, uvs[second].u, uvs[second].v, uvs[first].u, uvs[first].v]\n }\n polys.push(p);\n edges.push({\n a: first,\n b: second\n });\n edges.push({\n a: second,\n b: second + 1\n })\n }\n }\n }\n }\n return {\n points: points,\n edges: edges,\n polygons: polys\n }\n }","function plotGraph() {\n if (houses.data.length > 0) {\n for (let i = 0; i < houses.data.length; i++) {\n xs[i] = map(houses.data[i].inputs[0], 0, zoom, 0, wnx);\n ys[i] = map(houses.data[i].inputs[1], 0, zoom, wny, 200);\n cs[i] = houses.data[i].inputs[8];\n ps[i] = houses.data[i].target[0];\n }\n }\n}","function spherical$1(cartesian) {\n return [\n atan2(cartesian[1], cartesian[0]) * degrees,\n asin(max(-1, min(1, cartesian[2]))) * degrees\n ];\n}","function apskritimoPlotas(spindulys) {\n console.log('Apskritimo plotas');\n return Math.PI * (spindulys ** 2);\n}","function drawSpheres() {\n \"use strict\";\n var cuboids = new THREE.Group();\n\n var geometry = new THREE.SphereBufferGeometry(GRID_WIDTH / 2);\n geometry.addAttribute('lightPos', POINT_LIGHT_POSITIONS.GPUBuffer);\n var gridPosition = new GridPosition(0,0,0);\n SPHERES_POSITIONS.forEach(function(item) {\n var material;\n // The color attribute of the material must be assigned in the constructor parameters.\n switch (shadingMethod) {\n case GOURAUD_SHADING:\n material = new THREE.MeshLambertMaterial({color: getRandColor(), side: THREE.FrontSide});\n break;\n case PHONG_SHADING:\n material = chooseShading();\n break;\n }\n var cuboid = new THREE.Mesh(geometry, material);\n cuboid.position.copy(gridPosition.setPosition(item[0], item[1], item[2]).getVector3());\n cuboid.matrixAutoUpdate = true;\n cuboids.add(cuboid);\n });\n\n scene.add(cuboids);\n}","function drawSphere(color) {\r\n mvMatrix = mult(mvMatrix, scalem(0.75, 0.75, 0.75)); // Scale the sphere since it is a little big\r\n gl.uniformMatrix4fv(modelView, false, flatten(mvMatrix));\r\n\tsetDiffuse(color);\r\n for (var i = cubePoints.length; i < cubePoints.length + spherePoints.length; i += 3) {\r\n gl.drawArrays(gl.TRIANGLES, i, 3);\r\n }\r\n}","function sphere() {\n var c = 2 * asin(1 / sqrt(5)) * degrees;\n return {\n type: \"Polygon\",\n coordinates: [\n [[0, 90], [-180, -c + epsilon], [0, -90], [180, -c + epsilon], [0, 90]]\n ]\n };\n}","function sinusoidalZoom(min, max) {\n delta = clock.getDelta();\n theta += delta * 0.2;\n //theta += 0.01;\n camera.position.z = Math.abs((max-min)*Math.sin(theta))+min;\n}","function drawSphere (rex,yon) {\n\t\tconsole.log(\"call Me\");\n\t\t//debugger; \n var waxBall = new DoodleImage({\n src: \"elect.png\",\n left: rex,\n top: yon,\n width: 250,\n height: 50\n });\n draw(waxBall);\n\n }","function OnDrawGizmos()\n{\n\tGizmos.color = Color.green;\n\tGizmos.DrawSphere(transform.position + laneStart, 0.2);\n\t\n\tGizmos.color = Color.red;\n\tGizmos.DrawSphere(transform.position + laneEnd, 0.2);\n}","function Sphere(radius, colorMapURLs, specularMapURL, shininess, animation, lighting) {\n var bands = 30, \n vertices = [], \n normals = [], \n textureCoord = [];\n\n // latitudes\n for (var slice = 0; slice <= bands; slice++) {\n var theta = slice * Math.PI / bands,\n sinTheta = Math.sin(theta),\n cosTheta = Math.cos(theta);\n\n // longitudes\n for (var arc = 0; arc <= bands; arc++) {\n var phi = arc * 2 * Math.PI / bands,\n sinPhi = Math.sin(phi),\n cosPhi = Math.cos(phi);\n\n var x = cosPhi * sinTheta,\n y = cosTheta,\n z = sinPhi * sinTheta,\n u = 1 - (arc / bands),\n v = 1 - (slice / bands);\n\n vertices.push(radius * x, radius * y, radius * z);\n textureCoord.push(u, v);\n normals.push(x, y, z);\n }\n }\n\n var vertexIndices = [];\n for (var slice = 0; slice < bands; slice++) {\n for (var arc = 0; arc < bands; arc++) {\n var first = (slice * (bands + 1)) + arc,\n second = first + bands + 1;\n\n vertexIndices.push(first, second, first + 1, second, second + 1, first + 1);\n }\n }\n\n ItemElements.call(this, vertices, vertexIndices, normals, textureCoord, colorMapURLs, \n specularMapURL, shininess, animation, lighting);\n}","plot() {\n return \"Cute alien takes over the earth\";\n }","function hemisphere2PolarHemisphere(x, y, z) {\n // xy fisheye 直交座標系 + 高さ\b z で表された 半径 r の半球上の座標を lθ+z 半球極座標系へ変換する\n var l = Math.sqrt(Math.pow(x, 2) + Math.pow(y, 2));\n var theta = Math.atan2(y, x);\n return { l: l, theta: theta, z: z };\n}","function generateSphere(subdiv, color, array) {\n\n var step = (360.0 / subdiv) * (Math.PI / 180.0); //how much do we increase the angles by per triangle\n\n for (var lat = 0; lat <= Math.PI; lat += step) { //latitude\n for (var lon = 0; lon + step <= 2 * Math.PI; lon += step) { //longitude\n //triangle 1\n array.push(vec4(Math.sin(lat) * Math.cos(lon), Math.sin(lon) * Math.sin(lat), Math.cos(lat), 1.0)); //position\n array.push(color); //color\n array.push(vec4(Math.sin(lat) * Math.cos(lon), Math.sin(lon) * Math.sin(lat), Math.cos(lat), 0.0)); //normal\n array.push(vec4(Math.sin(lat) * Math.cos(lon + step), Math.sin(lat) * Math.sin(lon + step), Math.cos(lat), 1.0)); //position\n array.push(color); //color\n array.push(vec4(Math.sin(lat) * Math.cos(lon+step), Math.sin(lat) * Math.sin(lon+step), Math.cos(lat), 0.0)); //normal\n array.push(vec4(Math.sin(lat + step) * Math.cos(lon + step), Math.sin(lon + step) * Math.sin(lat + step), Math.cos(lat + step), 1.0)); //etc\n array.push(color); //color\n array.push(vec4(Math.sin(lat+step) * Math.cos(lon+step), Math.sin(lon+step) * Math.sin(lat+step), Math.cos(lat+step), 0.0));//normal\n\n //triangle 2\n array.push(vec4(Math.sin(lat + step) * Math.cos(lon + step), Math.sin(lon + step) * Math.sin(lat + step), Math.cos(lat + step), 1.0));\n array.push(color); //color\n array.push(vec4(Math.sin(lat+step) * Math.cos(lon+step), Math.sin(lon+step) * Math.sin(lat+step), Math.cos(lat+step), 0.0));//normal\n array.push(vec4(Math.sin(lat + step) * Math.cos(lon), Math.sin(lat + step) * Math.sin(lon), Math.cos(lat + step), 1.0));\n array.push(color); //color\n array.push(vec4(Math.sin(lat+step) * Math.cos(lon), Math.sin(lat+step) * Math.sin(lon), Math.cos(lat+step),0.0));//normal\n array.push(vec4(Math.sin (lat) * Math.cos(lon), Math.sin(lon) * Math.sin(lat), Math.cos(lat), 1.0));\n array.push(color); //color\n array.push(vec4(Math.sin(lat) * Math.cos(lon), Math.sin(lon) * Math.sin(lat), Math.cos(lat), 0.0));//normal\n\n if(array === cart) {\n cartVertices += 6;\n } else if (array === lightGlobe) {\n lightVerts += 6;\n } else if (array === alphaSpheres) {\n alphaSphereVertices += 6;\n }\n }\n }\n}","function makeSphere(ctx, radius, lats, longs) {\n var geometryData = [];\n var normalData = [];\n var texCoordData = [];\n var indexData = [];\n var latNumber;\n var longNumber;\n for (latNumber = 0; latNumber <= lats; ++latNumber) {\n for (longNumber = 0; longNumber <= longs; ++longNumber) {\n var theta = latNumber * Math.PI / lats;\n var phi = longNumber * 2 * Math.PI / longs;\n var sinTheta = Math.sin(theta);\n var sinPhi = Math.sin(phi);\n var cosTheta = Math.cos(theta);\n var cosPhi = Math.cos(phi);\n var x = cosPhi * sinTheta;\n var y = cosTheta;\n var z = sinPhi * sinTheta;\n var u = 1 - (longNumber / longs);\n var v = latNumber / lats;\n normalData.push(x);\n normalData.push(y);\n normalData.push(z);\n texCoordData.push(u);\n texCoordData.push(v);\n geometryData.push(radius * x);\n geometryData.push(radius * y);\n geometryData.push(radius * z);\n }\n }\n for (latNumber = 0; latNumber < lats; ++latNumber) {\n for (longNumber = 0; longNumber < longs; ++longNumber) {\n var first = (latNumber * (longs + 1)) + longNumber;\n var second = first + longs + 1;\n indexData.push(first);\n indexData.push(second);\n indexData.push(first + 1);\n indexData.push(second);\n indexData.push(second + 1);\n indexData.push(first + 1);\n }\n }\n // FIXME: What I don't like about this is the coupling of the geometry to the WebGL buffering.\n var normalBuffer = ctx.createBuffer();\n ctx.bindBuffer(ctx.ARRAY_BUFFER, normalBuffer);\n ctx.bufferData(ctx.ARRAY_BUFFER, new Float32Array(normalData), ctx.STATIC_DRAW);\n var texCoordBuffer = ctx.createBuffer();\n ctx.bindBuffer(ctx.ARRAY_BUFFER, texCoordBuffer);\n ctx.bufferData(ctx.ARRAY_BUFFER, new Float32Array(texCoordData), ctx.STATIC_DRAW);\n var vertexBuffer = ctx.createBuffer();\n ctx.bindBuffer(ctx.ARRAY_BUFFER, vertexBuffer);\n ctx.bufferData(ctx.ARRAY_BUFFER, new Float32Array(geometryData), ctx.STATIC_DRAW);\n var numIndices = indexData.length;\n var indexBuffer = ctx.createBuffer();\n ctx.bindBuffer(ctx.ELEMENT_ARRAY_BUFFER, indexBuffer);\n ctx.bufferData(ctx.ELEMENT_ARRAY_BUFFER, new Uint16Array(indexData), ctx.STREAM_DRAW);\n var self = {\n get normalBuffer() {\n return normalBuffer;\n },\n get texCoordBuffer() {\n return texCoordBuffer;\n },\n get vertexBuffer() {\n return vertexBuffer;\n },\n get indexBuffer() {\n return indexBuffer;\n },\n get numIndices() {\n return numIndices;\n }\n };\n return self;\n }","function sphericalToCartesian( r, a, e ) {\n var x = r * Math.cos(e) * Math.cos(a);\n var y = r * Math.sin(e);\n var z = r * Math.cos(e) * Math.sin(a);\n\n return [x,y,z];\n }","show() {\n fill(255);\n noStroke();\n let sx = map(this.x/this.z, 0, 1, 0, width);\n let sy = map(this.y/this.z, 0, 1, 0, height);\n let r = map(this.z, 0, width, 8, 0);\n //ellipse(sx, sy, r, r);\n stroke(255);\n let px = map(this.x/this.pz, 0, 1, 0, width);\n let py = map(this.y/this.pz, 0, 1, 0, height);\n line(px,py, sx, sy);\n this.pz = this.z;\n }","function _drawSphere(pos, r, color) {\n var p = new Primitive();\n p.color = toColor(color);\n\n // Decreasing these angles will increase complexity of sphere.\n var dtheta = 35; var dphi = 35;\n\n for (var theta = -90; theta <= (90 - dtheta); theta += dtheta) {\n for (var phi = 0; phi <= (360 - dphi); phi += dphi) {\n p.vertices.push(new THREE.Vector3(\n pos.x + r * Math.cos(theta * DEG_TO_RAD) * Math.cos(phi * DEG_TO_RAD),\n pos.y + r * Math.cos(theta * DEG_TO_RAD) * Math.sin(phi * DEG_TO_RAD),\n pos.z + r * Math.sin(theta * DEG_TO_RAD)\n ));\n\n p.vertices.push(new THREE.Vector3(\n pos.x + r * Math.cos((theta + dtheta) * DEG_TO_RAD) * Math.cos(phi * DEG_TO_RAD),\n pos.y + r * Math.cos((theta + dtheta) * DEG_TO_RAD) * Math.sin(phi * DEG_TO_RAD),\n pos.z + r * Math.sin((theta + dtheta) * DEG_TO_RAD)\n ));\n\n p.vertices.push(new THREE.Vector3(\n pos.x + r * Math.cos((theta + dtheta) * DEG_TO_RAD) * Math.cos((phi + dphi) * DEG_TO_RAD),\n pos.y + r * Math.cos((theta + dtheta) * DEG_TO_RAD) * Math.sin((phi + dphi) * DEG_TO_RAD),\n pos.z + r * Math.sin((theta + dtheta) * DEG_TO_RAD)\n ));\n\n if ((theta > -90) && (theta < 90)) {\n p.vertices.push(new THREE.Vector3(\n pos.x + r * Math.cos(theta * DEG_TO_RAD) * Math.cos((phi + dphi) * DEG_TO_RAD),\n pos.y + r * Math.cos(theta * DEG_TO_RAD) * Math.sin((phi + dphi) * DEG_TO_RAD),\n pos.z + r * Math.sin(theta * DEG_TO_RAD)\n ));\n }\n }\n }\n\n renderer.addPrimitive(p);\n }","function SphericalHarmonics(numBands, numSamples)\n{\n this.numBands = numBands;\n this.numSamplesSqrt = parseInt(math.sqrt(numSamples));\n this.numSamples = this.numSamplesSqrt * this.numSamplesSqrt;\n this.numCoeffs = numBands * numBands;\n this.samples = [];\n this.coeffs = [];\n for (var i = 0; i < this.numCoeffs; ++i) {\n this.coeffs.push([0, 0, 0]);\n }\n this.scaleMatrix = []; // used to scale the coefficients\n // store (l,m) values, useful for looping\n this.lmPairs = [];\n for(var l=0; l<this.numBands; ++l) {\n for(var m=-l; m<=l; ++m) {\n var ci = l * (l+1) + m; // coefficient index\n this.lmPairs[ci] = [l, m];\n }\n }\n this.setupSphericalSamples();\n}","function d3f_geo_cartesian(spherical) {\n var λ = spherical[0],\n φ = spherical[1],\n cosφ = Math.cos(φ);\n return [\n cosφ * Math.cos(λ),\n cosφ * Math.sin(λ),\n Math.sin(φ)\n ];\n}","function createSphere() {\n var geometry = new THREE.Geometry({\n colorsNeedUpdate : true\n }); // define a blank geometry\n var material = new THREE.MeshBasicMaterial(\n {\n transparency: true,\n opacity: 1.0,\n wireframeLinewidth: 0.5,\n color: 0x444444\n }\n );\n material.wireframe = true;\n\n sphere_radius_3D_S = 60; // test value\n sphere_wSegs_3D_S = 60; // test value 纬带数(纬线数+1)\n sphere_hSegs_3D_S = 60; // test value 经带数\n\n // 【生成所有顶点位置】 latNumber:纬线计数器\n var totalVertex = (sphere_wSegs_3D_S+1)*(sphere_hSegs_3D_S+1);\n for (var latNumber=0; latNumber<=sphere_wSegs_3D_S; latNumber++) {\n var theta = latNumber * Math.PI / sphere_wSegs_3D_S;\n var sinTheta = Math.sin(theta);\n var cosTheta = Math.cos(theta);\n for (var longNumber=0; longNumber<=sphere_hSegs_3D_S; longNumber++) {\n var phi = longNumber * 2 * Math.PI / sphere_hSegs_3D_S;\n var sinPhi = Math.sin(phi);\n var cosPhi = Math.cos(phi);\n // 球坐标系映射到xyz\n var x = sphere_radius_3D_S * sinTheta * cosPhi;\n var y = sphere_radius_3D_S * sinTheta * sinPhi;\n var z = sphere_radius_3D_S * cosTheta;\n var p = new THREE.Vector3(x, y, z);\n geometry.vertices.push(p);\n }\n }\n // 为了把这些顶点缝合到一起，需要【建立三角面片索引列表】\n var indexData = [];\n for (var latNumber = 0; latNumber < sphere_wSegs_3D_S; latNumber++) {\n for (var longNumber = 0; longNumber < sphere_hSegs_3D_S; longNumber++) {\n var first = (latNumber * (sphere_hSegs_3D_S + 1)) + longNumber;\n var second = first + sphere_hSegs_3D_S + 1;\n indexData.push(first);\n indexData.push(second);\n indexData.push(first + 1);\n indexData.push(second);\n indexData.push(second + 1);\n indexData.push(first + 1);\n // 测试用：调整了顶点顺序\n // indexData.push(first + 1);\n // indexData.push(second);\n // indexData.push(second + 1);\n }\n }\n // create faces\n for (var vertexCounter = 0; vertexCounter<indexData.length; vertexCounter+=3) {\n // var face = new THREE.Face3(\n // indexData[vertexCounter],\n // indexData[vertexCounter+1],\n // indexData[vertexCounter+2]\n // );\n var index1 = indexData[vertexCounter];\n var index2 = indexData[vertexCounter+1];\n var index3 = indexData[vertexCounter+2];\n var face = new THREE.Face3(\n index1,\n index2,\n index3\n );\n\n //着色方案1：仅用三种颜色测试\n // var color1 = findColor2(index1);//顶点1颜色\n // var color2 = findColor2(index2);//顶点2颜色\n // var color3 = findColor2(index3);//顶点3颜色\n\n // 着色方案2：灰度→彩色映射\n // 尚未测试\n // var color1 = trans_R( gray_scale(index1,totalVertex) );\n // var color2 = trans_G( gray_scale(index2,totalVertex) );\n // var color3 = trans_B( gray_scale(index3,totalVertex) );\n\n // 着色方案3：随机颜色\n // var color1 = new THREE.Color(0xFFFFFF * Math.random());//顶点1颜色——红色\n // var color2 = new THREE.Color(0xFFFFFF * Math.random());//顶点2颜色——绿色\n // var color3 = new THREE.Color(0xFFFFFF * Math.random());//顶点3颜色——蓝色\n // var color1 = new THREE.Color(getColor());//顶点1颜色——红色 产生随机色の方法2\n // var color2 = new THREE.Color(getColor());//顶点2颜色——绿色\n // var color3 = new THREE.Color(getColor());//顶点3颜色——蓝色\n\n // 着色方案4：随顶点索引数规律变化\n var color1 = findColor(index1,totalVertex);//顶点1颜色——红色\n var color2 = findColor(index2,totalVertex);//顶点2颜色——绿色\n var color3 = findColor(index3,totalVertex);//顶点3颜色——蓝色\n\n face.vertexColors.push(color1, color2, color3);//定义三角面三个顶点的颜色\n geometry.faces.push(face);\n }\n\n sphmat_3D_S=new THREE.MeshBasicMaterial({\n vertexColors: THREE.VertexColors,//以顶点颜色为准\n //vertexColors: geometry.colors,//以顶点颜色为准\n side: THREE.DoubleSide,//两面可见\n transparent: true,\n opacity: 1.0\n });//材质对象\n\n // create sphere and add it to scene\n sphere_3D_S = new THREE.Mesh(geometry,sphmat_3D_S);//网格模型对象\n scene_3D_S.add(sphere_3D_S); //网格模型添加到场景中\n}","function sphere(nameOrM,radius,_boundNum,c1,c_2) {\n var c2 = c_2|| c1;\n\n var transform = new Transform();\n if (nameOrM[0]) scene.new_Part(nameOrM[1]);\n else transform = nameOrM[1];\n var ts = transform.get_Trans();\n var tn = transform.get_Tnorm();\n var index = scene.get_Indexbase();\n\n for(var i=0;i<=_boundNum; i++){\n var lat = i*Math.PI/_boundNum-Math.PI/2;\n if(i==0) lat+=0.001; if(i==_boundNum) lat-=0.001;\n var col = MyGradient(c1,c2,i,_boundNum+1);\n\n for(var j=0;j<=_boundNum; j++){\n var lon = j*2*Math.PI/_boundNum-Math.PI;\n var x = radius*Math.cos(lat)*Math.cos(lon);\n var z = radius*Math.cos(lat)*Math.sin(lon);\n var y = radius*Math.sin(lat);\n var poi = [x,y,z];\n scene.append_VBuffer([m4.transformPoint(ts,poi), col, m4.transformPoint(tn,poi)]);\n }\n }\n for(var i=0;i<_boundNum; i++) {\n for (var j = 0; j < _boundNum; j++) {\n var lu = index + i * (_boundNum + 1) + j;\n var ld = lu + _boundNum + 1;\n scene.append_IBuffer([lu, ld + 1, lu + 1, lu, ld, ld + 1]);\n }\n }\n }","function displaySymmetryDrawObjects(symop){\r\n\tvar symOffsetString = _file.symmetry.symOffset;\r\n\tsymOffsetString = symOffsetString.substring(1);\r\n\tvar symOffsetArray = symOffsetString.split(\",\");\r\n\tvar xOffsetValue = parseInt(symOffsetArray[0])+\"/1\";\r\n\tvar yOffsetValue = parseInt(symOffsetArray[1])+\"/1\";\r\n\tvar zOffsetValue = parseInt(symOffsetArray[2])+\"/1\";\r\n\tvar symopString = \"\"+symop+\"\";\r\n\tvar symopArray = symopString.split(\",\");\r\n\tconsole.log(symopArray)\r\n\tvar xSymopValue = symopArray[0];\r\n\tvar ySymopValue = symopArray[1];\r\n\tvar zSymopValue = symopArray[2];\r\n\tsymopWithOffset = xSymopValue+\"+\"+xOffsetValue+\",\"+ySymopValue+\"+\"+yOffsetValue+\",\"+zSymopValue+\"+\"+zOffsetValue\r\n\trunJmolScriptWait(\"draw symop '\"+symopWithOffset+\"'\");\r\n\taxisFactor = 3;\r\n\trunJmolScriptWait(\"drawCleanSymmetryAxisVectors(\"+axisFactor+\")\");\r\n}","function new_sphere (x, y, z, radius, dr, dg, db, k_ambient, k_specular, specular_pow) {\r\n append(shapes, new Sphere(x, y, z, radius, dr, dg, db, k_ambient, k_specular, specular_pow));\r\n}","function SphereSubdiv (s) {\r\n this.name = \"sphere\";\r\n\r\n var vertices = [\r\n 1.0, 0.0, 0.0,\r\n 0.0, 1.0, 0.0,\r\n -1.0, 0.0, 0.0,\r\n 0.0, -1.0, 0.0,\r\n 0.0, 0.0, 1.0,\r\n 0.0, 0.0, -1.0\r\n ];\r\n var indices = [\r\n /* 0, 1, 4,\r\n 0, 1, 5,\r\n 1, 2, 4,\r\n 1, 2, 5,\r\n 2, 3, 4,\r\n 2, 3, 5,\r\n 3, 0, 4,//*/\r\n 3, 0, 5\r\n ];\r\n\r\n for (var i = 0; i<s; i++){\r\n var newIndices = []\r\n\r\n let vertexCount = vertices.length/3;\r\n\r\n var midpoints = new Array(vertexCount).fill(0).map(row => new Array(vertexCount).fill(-1)); \r\n for (var face = 0; face<indices.length/3; face++){\r\n let f = face*3;\r\n let a = indices[f];\r\n let b = indices[f+1];\r\n let c = indices[f+2];\r\n let ax = vertices[a*3];\r\n let ay = vertices[a*3+1];\r\n let az = vertices[a*3+2];\r\n let bx = vertices[b*3];\r\n let by = vertices[b*3+1];\r\n let bz = vertices[b*3+2];\r\n let cx = vertices[c*3];\r\n let cy = vertices[c*3+1];\r\n let cz = vertices[c*3+2];\r\n\r\n // Find (mx, my, mz), (nx, ny, nz), (px, py, pz) -- centers of segments\r\n var m = midpoints[a][b];\r\n if(m==-1){\r\n var x = (ax+bx)/2;\r\n var y = (ay+by)/2;\r\n var z = (az+bz)/2;\r\n let l = Math.sqrt(x*x + y*y + z*z);\r\n x/=l;\r\n y/=l;\r\n z/=l;\r\n m = vertices.length/3; // The index of the new point\r\n vertices = vertices.concat([x, y, z]);\r\n midpoints[a][b] = m;\r\n midpoints[b][a] = m;\r\n }\r\n var n = midpoints[a][c];\r\n if(n==-1){\r\n var x = (ax+cx)/2;\r\n var y = (ay+cy)/2;\r\n var z = (az+cz)/2;\r\n let l = Math.sqrt(x*x + y*y + z*z);\r\n x/=l;\r\n y/=l;\r\n z/=l;\r\n n = vertices.length/3; // The index of the new point\r\n vertices = vertices.concat([x, y, z]);\r\n midpoints[a][c] = n;\r\n midpoints[c][a] = n;\r\n }\r\n var p = midpoints[c][b];\r\n if(p==-1){\r\n var x = (cx+bx)/2;\r\n var y = (cy+by)/2;\r\n var z = (cz+bz)/2;\r\n let l = Math.sqrt(x*x + y*y + z*z);\r\n x/=l;\r\n y/=l;\r\n z/=l;\r\n p = vertices.length/3; // The index of the new point\r\n vertices = vertices.concat([x, y, z]);\r\n midpoints[c][b] = p;\r\n midpoints[b][c] = p;\r\n }\r\n\r\n newIndices = newIndices.concat([\r\n m, a, n,\r\n m, b, p,\r\n n, c, p,\r\n m, n, p\r\n ]);\r\n }\r\n indices = newIndices;\r\n }\r\n\r\n // Mirror around x\r\n var mirrorStart = vertices.length;\r\n vertices = vertices.concat(vertices);\r\n for(var i = mirrorStart; i<vertices.length; i+=3){\r\n vertices[i] = -vertices[i];\r\n }\r\n var mirrorFacesStart = indices.length;\r\n indices = indices.concat(indices);\r\n for (var i = mirrorFacesStart; i<indices.length; i++){\r\n indices[i]+=mirrorStart/3;\r\n }\r\n // Mirror around y\r\n mirrorStart = vertices.length;\r\n vertices = vertices.concat(vertices);\r\n for(var i = mirrorStart+1; i<vertices.length; i+=3){\r\n vertices[i] = -vertices[i];\r\n }\r\n mirrorFacesStart = indices.length;\r\n indices = indices.concat(indices);\r\n for (var i = mirrorFacesStart; i<indices.length; i++){\r\n indices[i]+=mirrorStart/3;\r\n }\r\n // Mirror around z\r\n mirrorStart = vertices.length;\r\n vertices = vertices.concat(vertices);\r\n for(var i = mirrorStart+2; i<vertices.length; i+=3){\r\n vertices[i] = -vertices[i];\r\n }\r\n mirrorFacesStart = indices.length;\r\n indices = indices.concat(indices);\r\n for (var i = mirrorFacesStart; i<indices.length; i++){\r\n indices[i]+=mirrorStart/3;\r\n }\r\n this.vertices = new Float32Array(vertices);\r\n this.triangleIndices = new Uint16Array(indices);\r\n\r\n this.numVertices = this.vertices.length/3;\r\n this.numTriangles = this.triangleIndices.length/3;\r\n\r\n}","function init$g() {\n //no-op\n if (!this.sphere) {\n this.k0 = msfnz(this.e, Math.sin(this.lat_ts), Math.cos(this.lat_ts));\n }\n}","display() {\n push();\n fill(255, 255, 0);\n let angle = TWO_PI / this.points;\n let halfAngle = angle / 2.0;\n beginShape();\n for (let a = 0; a < TWO_PI; a += angle) {\n let sx = this.x + cos(a) * this.outerRadius;\n let sy = this.y + sin(a) * this.outerRadius;\n vertex(sx, sy);\n sx = this.x + cos(a + halfAngle) * this.innerRadius;\n sy = this.y + sin(a + halfAngle) * this.innerRadius;\n vertex(sx, sy);\n }\n endShape(CLOSE);\n pop();\n }","function showCoords() {\n // TODO: Set the map center to the latitude / longitude position of your own home\n\n\n // TODO: Zoom the map close enough\n\n}","function makeSphere(ctx, radius, lats, longs) {\n\tvar geometryData = [];\n\tvar normalData = [];\n\tvar texCoordData = [];\n\tvar indexData = [];\n\n\tfor (var latNumber = 0; latNumber <= lats; ++latNumber) {\n\t\tfor (var longNumber = 0; longNumber <= longs; ++longNumber) {\n\t\t\tvar theta = latNumber * Math.PI / lats;\n\t\t\tvar phi = longNumber * 2 * Math.PI / longs;\n\t\t\tvar sinTheta = Math.sin(theta);\n\t\t\tvar sinPhi = Math.sin(phi);\n\t\t\tvar cosTheta = Math.cos(theta);\n\t\t\tvar cosPhi = Math.cos(phi);\n\n\t\t\tvar x = cosPhi * sinTheta;\n\t\t\tvar y = cosTheta;\n\t\t\tvar z = sinPhi * sinTheta;\n\t\t\tvar u = 1 - (longNumber / longs);\n\t\t\tvar v = latNumber / lats;\n\n\t\t\tnormalData.push(x);\n\t\t\tnormalData.push(y);\n\t\t\tnormalData.push(z);\n\t\t\ttexCoordData.push(u);\n\t\t\ttexCoordData.push(v);\n\t\t\tgeometryData.push(radius * x);\n\t\t\tgeometryData.push(radius * y);\n\t\t\tgeometryData.push(radius * z);\n\t\t}\n\t}\n\n\tfor (var latNumber = 0; latNumber < lats; ++latNumber) {\n\t\tfor (var longNumber = 0; longNumber < longs; ++longNumber) {\n\t\t\tvar first = (latNumber * (longs + 1)) + longNumber;\n\t\t\tvar second = first + longs + 1;\n\t\t\tindexData.push(first);\n\t\t\tindexData.push(second);\n\t\t\tindexData.push(first + 1);\n\n\t\t\tindexData.push(second);\n\t\t\tindexData.push(second + 1);\n\t\t\tindexData.push(first + 1);\n\t\t}\n\t}\n\n\tvar retval = {};\n\n\tretval.normalObject = ctx.createBuffer();\n\tctx.bindBuffer(ctx.ARRAY_BUFFER, retval.normalObject);\n\tctx.bufferData(ctx.ARRAY_BUFFER, new Float32Array(normalData), ctx.STATIC_DRAW);\n\n\tretval.texCoordObject = ctx.createBuffer();\n\tctx.bindBuffer(ctx.ARRAY_BUFFER, retval.texCoordObject);\n\tctx.bufferData(ctx.ARRAY_BUFFER, new Float32Array(texCoordData), ctx.STATIC_DRAW);\n\n\tretval.vertexObject = ctx.createBuffer();\n\tctx.bindBuffer(ctx.ARRAY_BUFFER, retval.vertexObject);\n\tctx.bufferData(ctx.ARRAY_BUFFER, new Float32Array(geometryData), ctx.STATIC_DRAW);\n\n\tretval.numIndices = indexData.length;\n\tretval.indexObject = ctx.createBuffer();\n\tctx.bindBuffer(ctx.ELEMENT_ARRAY_BUFFER, retval.indexObject);\n\tctx.bufferData(ctx.ELEMENT_ARRAY_BUFFER, new Uint16Array(indexData), ctx.STREAM_DRAW);\n\tretval.indexType = ctx.UNSIGNED_SHORT;\n\n\treturn retval;\n}","function drawVectors() {\n gridPoints.forEach(function(pt, index) {\n translate(pt.x, pt.y);\n // --Basic field:--\n // var xDis = 20 * ((w/2) - pt.x) / w;\n // var yDis = 20 * ((w/2) - pt.y) / w;\n\n // Perfect, this makes it look more continuous and natural:\n var scale = 0.1;\n\n var noiseVal = noise(scale * pt.x/s, scale * pt.y/s);\n\n fullArray.push({\n x: pt.x,\n y: pt.y,\n val: noiseVal\n });\n\n var angle = noiseVal * 2 * Math.PI;\n rotate(angle);\n\n stroke(255);\n line(0, 0, 10, 0);\n\n rotate(-angle);\n\n // line(0, 0, xDis, yDis);\n // don't forget to translate back out -- could also use push and pop to achieve same effect:\n translate(-pt.x, -pt.y);\n });\n}","function drawSphere(numberToSubdivide, useFlatShading, isSun) {\n divideTriangle(va, vb, vc, numberToSubdivide);\n divideTriangle(vd, vc, vb, numberToSubdivide);\n divideTriangle(va, vd, vb, numberToSubdivide);\n divideTriangle(va, vc, vd, numberToSubdivide);\n \n function triangle(a, b, c) {\n pointsArray.push(a, b, c);\n \n //push normal vectors \n if(useFlatShading){\n var t1 = subtract(c,b);\n var t2 = subtract(c,a);\n var normal = vec4(normalize(cross(t1,t2)));\n if(isSun){\n normal = subtract(vec4(0,0,0,0), normal);\n }\n normalsArray.push(normal, normal, normal);\n }\n else{\n normalsArray.push(a, b, c);\n } \n\n index += 3;\n }\n\n function divideTriangle(a, b, c, count) {\n if ( count <= 0 ) { \n triangle(a, b, c);\n }\n else{ \n var ab = mix( a, b, 0.5);\n var ac = mix( a, c, 0.5);\n var bc = mix( b, c, 0.5);\n \n ab = normalize(ab, true);\n ac = normalize(ac, true);\n bc = normalize(bc, true);\n \n divideTriangle( a, ab, ac, count - 1 );\n divideTriangle( ab, b, bc, count - 1 );\n divideTriangle( bc, c, ac, count - 1 );\n divideTriangle( ab, bc, ac, count - 1 );\n }\n }\n\n}","function drawSphere() {\r\n // console.log(xindex + \" \" + yindex + \" \" +xthumb + \" \" + ythumb);\r\n //console.log(handMeshes[userId])\r\n var xs = xindex - xthumb;\r\n var ys = yindex - ythumb;\r\n var r = (Math.sqrt( xs*xs + ys*ys )-10);\r\n //console.log(r)\r\n var obj1 = new THREE.Object3D();\r\n \r\n var sfera = new THREE.SphereGeometry(r);\r\n var matsfe = new THREE.MeshNormalMaterial();\r\n var mesh1 = new THREE.Mesh(sfera, matsfe);\r\n \r\n obj1.position.x = xthumb;\r\n obj1.position.y = ythumb;\r\n \r\n obj1.add(mesh1);\r\n scene.add(obj1);\r\n }","function makeSphere(numLongSteps) {\n \n try {\n if (numLongSteps % 2 != 0)\n throw \"in makeSphere: uneven number of longitude steps!\";\n else if (numLongSteps < 4)\n throw \"in makeSphere: number of longitude steps too small!\";\n else { // good number longitude steps\n \n // make vertices, normals and uvs -- repeat longitude seam\n const INVPI = 1/Math.PI, TWOPI = Math.PI+Math.PI, INV2PI = 1/TWOPI, epsilon=0.001*Math.PI;\n var sphereVertices = [0,-1,0]; // vertices to return, init to south pole\n var sphereUvs = [0.5,0]; // uvs to return, bottom texture row collapsed to one texel\n var angleIncr = TWOPI / numLongSteps; // angular increment \n var latLimitAngle = angleIncr * (Math.floor(numLongSteps*0.25)-1); // start/end lat angle\n var latRadius, latY, latV; // radius, Y and texture V at current latitude\n for (var latAngle=-latLimitAngle; latAngle<=latLimitAngle+epsilon; latAngle+=angleIncr) {\n latRadius = Math.cos(latAngle); // radius of current latitude\n latY = Math.sin(latAngle); // height at current latitude\n latV = latAngle*INVPI + 0.5; // texture v = (latAngle + 0.5*PI) / PI\n for (var longAngle=0; longAngle<=TWOPI+epsilon; longAngle+=angleIncr) { // for each long\n sphereVertices.push(-latRadius*Math.sin(longAngle),latY,latRadius*Math.cos(longAngle));\n sphereUvs.push(longAngle*INV2PI,latV); // texture u = (longAngle/2PI)\n } // end for each longitude\n } // end for each latitude\n sphereVertices.push(0,1,0); // add north pole\n sphereUvs.push(0.5,1); // top texture row collapsed to one texel\n var sphereNormals = sphereVertices.slice(); // for this sphere, vertices = normals; return these\n\n // make triangles, first poles then middle latitudes\n var sphereTriangles = []; // triangles to return\n var numVertices = Math.floor(sphereVertices.length/3); // number of vertices in sphere\n for (var whichLong=1; whichLong<=numLongSteps; whichLong++) { // poles\n sphereTriangles.push(0,whichLong,whichLong+1);\n sphereTriangles.push(numVertices-1,numVertices-whichLong-1,numVertices-whichLong-2);\n } // end for each long\n var llVertex; // lower left vertex in the current quad\n for (var whichLat=0; whichLat<(numLongSteps/2 - 2); whichLat++) { // middle lats\n for (var whichLong=0; whichLong<numLongSteps; whichLong++) {\n llVertex = whichLat*(numLongSteps+1) + whichLong + 1;\n sphereTriangles.push(llVertex,llVertex+numLongSteps+1,llVertex+numLongSteps+2);\n sphereTriangles.push(llVertex,llVertex+numLongSteps+2,llVertex+1);\n } // end for each longitude\n } // end for each latitude\n } // end if good number longitude steps\n return({vertices:sphereVertices, normals:sphereNormals, uvs:sphereUvs, triangles:sphereTriangles});\n } // end try\n \n catch(e) {\n console.log(e);\n } // end catch\n }","function plot() {\n \n }","function getSphereData(isEllipse, sphere) {\n\n sphere.vertices = [];\n if (!isEllipse) {\n sphere.texCoords = [];\n }\n for (var latNumber = 0; latNumber <= latBands; latNumber++) {\n var theta = latNumber * Math.PI / latBands;\n var sinTheta = Math.sin(theta);\n var cosTheta = Math.cos(theta);\n\n for (var longNumber = 0; longNumber <= longBands; longNumber++) {\n var phi = longNumber * 2 * Math.PI / longBands;\n var sinPhi = Math.sin(phi);\n var cosPhi = Math.cos(phi);\n\n var x = cosPhi * sinTheta;\n var y = cosTheta;\n var z = sinPhi * sinTheta;\n if (!isEllipse) {\n sphere.texCoords.push(1 - (longNumber / longBands));\n sphere.texCoords.push(1 - (latNumber / latBands));\n }\n sphere.vertices.push(radius * x);\n if (isEllipse) {\n sphere.vertices.push(2 * radius * y);\n } else {\n sphere.vertices.push(radius * y);\n }\n sphere.vertices.push(radius * z);\n }\n }\n}","function _Sphere(radius) {\n var __sphereData = null,\n __sphereVertexPositionBuffer = null,\n __sphereVertexIndexBuffer = null,\n __sphereVertexNormalBuffer = null,\n\n __colour = {r: 0.8, g: 0.8, b: 0.8, a: 1.0},\n __radius = radius || 1.0,\n __modelMatrix = mat4.create(),\n __rotationMatrix = mat4.create(),\n __translationMatrix = mat4.create(),\n __scaleMatrix = mat4.create(),\n __PVMMatrix = mat4.create(),\n __normalMatrix = mat3.create(),\n __shouldUpdateMatrices = true;\n\n function __init() {\n __sphereData = webGLDrawUtilities.createSphereVertexData(__radius);\n\n // create the buffer for vertex positions and assign it to that buffer to use for later\n __sphereVertexPositionBuffer = _gl.createBuffer();\n __sphereVertexPositionBuffer.itemSize = 3;\n __sphereVertexPositionBuffer.numItems = __sphereData.vertexPositionData.length / __sphereVertexPositionBuffer.itemSize;\n __sphereVertexPositionBuffer.items = new Float32Array(__sphereData.vertexPositionData);\n\n _gl.bindBuffer(_gl.ARRAY_BUFFER, __sphereVertexPositionBuffer);\n _gl.bufferData(_gl.ARRAY_BUFFER, __sphereVertexPositionBuffer.items, _gl.STATIC_DRAW);\n\n // create the buffer for vertex positions indexes and assign it to that buffer to use for later\n __sphereVertexIndexBuffer = _gl.createBuffer();\n __sphereVertexIndexBuffer.itemSize = 1;\n __sphereVertexIndexBuffer.numItems = __sphereData.vertexIndexData.length;\n __sphereVertexIndexBuffer.items = new Uint16Array(__sphereData.vertexIndexData);\n\n _gl.bindBuffer(_gl.ELEMENT_ARRAY_BUFFER, __sphereVertexIndexBuffer);\n _gl.bufferData(_gl.ELEMENT_ARRAY_BUFFER, __sphereVertexIndexBuffer.items, _gl.STATIC_DRAW);\n\n // create the buffer for vertex positions indexes and assign it to that buffer to use for later\n __sphereVertexNormalBuffer = _gl.createBuffer();\n __sphereVertexNormalBuffer.itemSize = 3;\n __sphereVertexNormalBuffer.numItems = __sphereData.vertexNormals.length / __sphereVertexNormalBuffer.itemSize;\n __sphereVertexNormalBuffer.items = new Float32Array(__sphereData.vertexNormals);\n\n _gl.bindBuffer(_gl.ARRAY_BUFFER, __sphereVertexNormalBuffer);\n _gl.bufferData(_gl.ARRAY_BUFFER, __sphereVertexNormalBuffer.items, _gl.STATIC_DRAW);\n\n }\n\n // draw itself\n function __draw() {\n\n mat4.multiply(__modelMatrix, __translationMatrix, __rotationMatrix);\n mat4.multiply(__modelMatrix, __modelMatrix, __scaleMatrix);\n\n // calculate the inverse, transpose of the model Matrix to make sure our surface normals are perpendicular to the surface again!!\n mat3.normalFromMat4(__normalMatrix, __modelMatrix);\n\n // View * Model\n mat4.multiply(__PVMMatrix, _glProgram.customAttribs.viewMatrix, __modelMatrix);\n\n // Perspective * (View * Model)\n mat4.multiply(__PVMMatrix, _glProgram.customAttribs.perspectiveMatrix, __PVMMatrix);\n\n // alright now assign the matrices back to the location of our vertex shader\n _gl.uniformMatrix3fv(_glProgram.customAttribs.u_NormalMatrixRef, false, __normalMatrix);\n _gl.uniformMatrix4fv(_glProgram.customAttribs.u_PVMMatrixRef, false, __PVMMatrix);\n\n // set the position buffer\n _gl.bindBuffer(_gl.ARRAY_BUFFER, __sphereVertexPositionBuffer);\n _gl.vertexAttribPointer(_glProgram.customAttribs.a_PositionRef, __sphereVertexPositionBuffer.itemSize, _gl.FLOAT, false, 0, 0);\n _gl.enableVertexAttribArray(_glProgram.customAttribs.a_PositionRef);\n\n // set the index buffer\n _gl.bindBuffer(_gl.ELEMENT_ARRAY_BUFFER, __sphereVertexIndexBuffer);\n\n // bind the surface normal buffer\n _gl.bindBuffer(_gl.ARRAY_BUFFER, __sphereVertexNormalBuffer);\n _gl.vertexAttribPointer(_glProgram.customAttribs.a_VertexNormalRef, __sphereVertexNormalBuffer.itemSize, _gl.FLOAT, false, 0, 0);\n _gl.enableVertexAttribArray(_glProgram.customAttribs.a_VertexNormalRef);\n\n // make sure the sphere is in the correct colour\n _gl.uniform4f(_glProgram.customAttribs.u_FragColourRef, __colour.r, __colour.g, __colour.b, __colour.a);\n\n // draw the elements!\n _gl.drawElements(_gl.TRIANGLES, __sphereVertexIndexBuffer.numItems, _gl.UNSIGNED_SHORT, 0);\n\n }\n\n // rotate the sphere by x, y, z degrees\n function __rotateOnAxisByDegrees(x, y, z) {\n\n if (typeof x === 'number') {\n mat4.rotateX(__rotationMatrix, __rotationMatrix, glMatrix.toRadian(x));\n }\n\n if (typeof y === 'number') {\n mat4.rotateY(__rotationMatrix, __rotationMatrix, glMatrix.toRadian(y));\n }\n\n if (typeof z === 'number') {\n mat4.rotateZ(__rotationMatrix, __rotationMatrix, glMatrix.toRadian(z));\n }\n\n __shouldUpdateMatrices = true;\n\n return this;\n\n }\n\n // scale the sphere by s units\n function __scale(s) {\n if (typeof s === 'number') {\n mat4.scale(__scaleMatrix, __scaleMatrix, vec3.fromValues(s, s, s));\n }\n\n __shouldUpdateMatrices = true;\n\n return this;\n }\n\n // translate the sphere by (x, y, z) units\n function __translate(x, y, z) {\n\n mat4.translate(__translationMatrix, __translationMatrix, vec3.fromValues(x, y, z));\n\n __shouldUpdateMatrices = true;\n\n return this;\n }\n\n __init();\n\n ////////////////////////////////////////////////////////\n // _Sphere public API\n ////////////////////////////////////////////////////////\n this.rotateOnAxisByDegrees = __rotateOnAxisByDegrees;\n\n this.draw = __draw;\n\n this.scale = __scale;\n\n this.translate = __translate;\n\n // sets the colour of the primitive\n this.setColour = function(r, g, b, a) {\n __colour.r = r;\n __colour.g = g;\n __colour.b = b;\n __colour.a = a;\n\n return this;\n };\n\n this.getRadius = function() {\n return __radius;\n };\n\n return this;\n }","function makeSphere (slices, stacks) {\n // fill in your code here.\n\tvar triangles = [];\n\tvar origin = [0.0, 0.0, 0.0];\n\tconst radius = 0.5;\n\tconst longi_step = radians(360 / slices); // in radian\n\tconst lati_step = radians(180 / stacks); // in radian\n\n\tvar theta = 0.0;\n\t\n\n\tfor (var i=0; i<slices; i++){\n\n\t\tvar phi = 0.0;\n\t\tfor(var j=0; j<stacks; j++){\n\t\t\tvar v1 = [radius * Math.sin(theta) * Math.sin(phi), radius * Math.cos(phi), radius * Math.cos(theta) * Math.sin(phi)];\n\t\t\tvar v2 = [radius * Math.sin(theta + longi_step) * Math.sin(phi), radius * Math.cos(phi), radius * Math.cos(theta + longi_step) * Math.sin(phi)];\n\t\t\tvar v3 = [radius * Math.sin(theta) * Math.sin(phi + lati_step), radius * Math.cos(phi + lati_step), radius * Math.cos(theta) * Math.sin(phi + lati_step)];\n\t\t\tvar v4 = [radius * Math.sin(theta + longi_step) * Math.sin(phi + lati_step), radius * Math.cos(phi + lati_step), radius * Math.cos(theta + longi_step) * Math.sin(phi + lati_step)];\n\n\t\t\ttriangles.push([v1, v3, v2]);\n\t\t\ttriangles.push([v2, v3, v4]);\n\n\t\t\tphi += lati_step;\n\t\t}\n\n\t\ttheta += longi_step;\n\t}\n\n\tconsole.log(triangles.length);\n\n\tfor (tri of triangles){\n\t\taddTriangle(\n\t\t\ttri[0][0], tri[0][1], tri[0][2],\n\t\t\ttri[1][0], tri[1][1], tri[1][2],\n\t\t\ttri[2][0], tri[2][1], tri[2][2]\n\t\t\t);\n\t}\n\n\n}","function makeSphere(numLongSteps) {\n \n try {\n if (numLongSteps % 2 != 0)\n throw \"in makeSphere: uneven number of longitude steps!\";\n else if (numLongSteps < 4)\n throw \"in makeSphere: number of longitude steps too small!\";\n else { // good number longitude steps\n \n// // make vertices and normals\n// \t\n// var sphereVertices = [0,-1,0]; // vertices to return, init to south pole\n// var sphereTextureCoords = [0.5,0];\n// var angleIncr = (Math.PI+Math.PI) / numLongSteps; // angular increment \n// var latLimitAngle = angleIncr * (Math.floor(numLongSteps/4)-1); // start/end lat angle\n// var latRadius, latY; // radius and Y at current latitude\n// for (var latAngle=-latLimitAngle; latAngle<=latLimitAngle; latAngle+=angleIncr) {\n// latRadius = Math.cos(latAngle); // radius of current latitude\n// latY = Math.sin(latAngle); // height at current latitude\n// for (var longAngle=0; longAngle<2*Math.PI; longAngle+=angleIncr){ // for each long\n// sphereVertices.push(latRadius*Math.sin(longAngle),latY,latRadius*Math.cos(longAngle));\n// sphereTextureCoords.push((latRadius*Math.sin(longAngle)+1)/2,(latY+1)/2);\n// }\n// } // end for each latitude\n// sphereVertices.push(0,1,0); // add north pole\n// sphereTextureCoords.push(0.5,1);\n// var sphereNormals = sphereVertices.slice(); // for this sphere, vertices = normals; return these\n// \n// // make triangles, from south pole to middle latitudes to north pole\n// var sphereTriangles = []; // triangles to return\n// for (var whichLong=1; whichLong<numLongSteps; whichLong++) // south pole\n// sphereTriangles.push(0,whichLong,whichLong+1);\n// sphereTriangles.push(0,numLongSteps,1); // longitude wrap tri\n// var llVertex; // lower left vertex in the current quad\n// for (var whichLat=0; whichLat<(numLongSteps/2 - 2); whichLat++) { // middle lats\n// for (var whichLong=0; whichLong<numLongSteps-1; whichLong++) {\n// llVertex = whichLat*numLongSteps + whichLong + 1;\n// sphereTriangles.push(llVertex,llVertex+numLongSteps,llVertex+numLongSteps+1);\n// sphereTriangles.push(llVertex,llVertex+numLongSteps+1,llVertex+1);\n// } // end for each longitude\n// sphereTriangles.push(llVertex+1,llVertex+numLongSteps+1,llVertex+2);\n// sphereTriangles.push(llVertex+1,llVertex+2,llVertex-numLongSteps+2);\n// } // end for each latitude\n// for (var whichLong=llVertex+2; whichLong<llVertex+numLongSteps+1; whichLong++) // north pole\n// sphereTriangles.push(whichLong,sphereVertices.length/3-1,whichLong+1);\n// sphereTriangles.push(sphereVertices.length/3-2,sphereVertices.length/3-1,sphereVertices.length/3-numLongSteps-1); // longitude wrap\n \t\n \t/**Using the sphere from the lesson: http://learningwebgl.com/blog/?p=1253*/\n \tvar vertexPositionData = [];\n var normalData = [];\n var textureCoordData = [];\n for (var latNumber = 0; latNumber <= numLongSteps; latNumber++) {\n var theta = latNumber * Math.PI / numLongSteps;\n var sinTheta = Math.sin(theta);\n var cosTheta = Math.cos(theta);\n\n for (var longNumber = 0; longNumber <= numLongSteps; longNumber++) {\n var phi = longNumber * 2 * Math.PI / numLongSteps;\n var sinPhi = Math.sin(phi);\n var cosPhi = Math.cos(phi);\n\n var x = cosPhi * sinTheta;\n var y = cosTheta;\n var z = sinPhi * sinTheta;\n var u = 1 - (longNumber / numLongSteps);\n var v = 1 - (latNumber / numLongSteps);\n\n normalData.push(x);\n normalData.push(y);\n normalData.push(z);\n textureCoordData.push(u);\n textureCoordData.push(v);\n vertexPositionData.push(x);\n vertexPositionData.push(y);\n vertexPositionData.push(z);\n }\n }\n var indexData = [];\n for (var latNumber = 0; latNumber < numLongSteps; latNumber++) {\n for (var longNumber = 0; longNumber < numLongSteps; longNumber++) {\n var first = (latNumber * (numLongSteps + 1)) + longNumber;\n var second = first + numLongSteps + 1;\n indexData.push(first);\n indexData.push(second);\n indexData.push(first + 1);\n\n indexData.push(second);\n indexData.push(second + 1);\n indexData.push(first + 1);\n }\n }\n \t\n } // end if good number longitude steps\n// return({vertices:sphereVertices, normals:sphereNormals, triangles:sphereTriangles, texture:sphereTextureCoords});\n return({vertices:vertexPositionData, normals:normalData, triangles:indexData, texture:textureCoordData});\n } // end try\n \n catch(e) {\n console.log(e);\n } // end catch\n } // end make sphere","function drawSphere(radius, widthSegments, heightSegments, opacity, color, position){\n\tvar geometry = new THREE.SphereGeometry(radius, widthSegments, heightSegments, 0, 2.*Math.PI, 0, Math.PI)\n\tvar material = new THREE.MeshPhongMaterial( { \n\t\tcolor: color, \n\t\tflatShading: false, \n\t\ttransparent:true,\n\t\topacity:opacity, \n\t\t//shininess:50,\n\t});\n\n\tsphere = new THREE.Mesh( geometry, material );\n\tsphere.position.set(position.x, position.y, position.z)\n\t//update the vertices of the plane geometry so that I can check for the intersection -- not needed (and also breaks the sparse view)\n\t//https://stackoverflow.com/questions/23990354/how-to-update-vertices-geometry-after-rotate-or-move-object\n\t// sphere.updateMatrix();\n\t// sphere.geometry.applyMatrix( sphere.matrix );\n\t// sphere.matrix.identity();\n\t// sphere.position.set( 0, 0, 0 );\n\t// sphere.rotation.set( 0, 0, 0 );\n\t// sphere.scale.set( 1, 1, 1 );\n\n\tparams.scene.add( sphere );\n\t\n\treturn sphere;\n\n}","plotJourneys() {\n for (let j of this.mapJourneys) {\n //plot ghost Session\n j.plotSessions(this);\n }\n }","function drawCircle () {\n\tvar resolution = 8;\n\tvar amplitude = 10;\n\tvar size = 360 / resolution;\n\n\tvar geometry = new THREE.Geometry();\n\tvar material = new THREE.MeshBasicMaterial( { color: 0xFFFFFF,\n\t\tside: THREE.DoubleSide,\n\t\twireframe: true} );\n\t// geometry.vertices.push( new THREE.Vector3( 0, 0, 0 ) );\n\tfor(var i = 0; i <= resolution; i++) {\n\t var segment = ( i * size ) * Math.PI / 180;\n\t var segment2 = ( i * size + size * 0.5 ) * Math.PI / 180;\n\t geometry.vertices.push( new THREE.Vector3( Math.cos( segment ) * amplitude, Math.sin( segment ) * amplitude, 0 ) ); \n\t geometry.vertices.push( new THREE.Vector3( Math.cos( segment2 ) * (amplitude-2), Math.sin( segment2 ) * (amplitude -2), 0 ) ); \n\t}\n\n\tfor ( i = 0; i < geometry.vertices.length -2; i++) {\n\t\tgeometry.faces.push ( new THREE.Face3( i, i+1, i+2 ) );\n\t}\n\tconsole.log ('Vertices', geometry.faces);\n\tgeometry.computeBoundingSphere();\n\n\n\tvar ringMesh = new THREE.Mesh(geometry, material); \n ringMesh.position.set(-1.5, 0.0, -14.0); \n scene.add(ringMesh); \n}","function S(e,t,n,i,r){var o=Math.cos(e),a=Math.sin(e),s=n/t*e,l=Math.cos(s);r.x=i*(2+l)*.5*o,r.y=i*(2+l)*a*.5,r.z=i*Math.sin(s)*.5}","function makeSphere (slices, stacks) {\n // fill in your code here.\n var sliceDivision = radians(360) / slices;\n var stackDivision = radians(180) / stacks;\n var radius = 0.5;\n\n for (var longitude = 0; longitude < radians(360); longitude += sliceDivision) {\n for (var latitude = 0; latitude < radians(180); latitude += stackDivision) {\n addTriangle(radius * Math.cos(longitude) * Math.sin(latitude + stackDivision), radius * Math.sin(longitude) * Math.sin(latitude + stackDivision), radius * Math.cos(latitude + stackDivision), \n radius * Math.cos(longitude) * Math.sin(latitude), radius * Math.sin(longitude) * Math.sin(latitude), radius * Math.cos(latitude), \n radius * Math.cos(longitude + sliceDivision) * Math.sin(latitude + stackDivision), radius * Math.sin(longitude + sliceDivision) * Math.sin(latitude + stackDivision), radius * Math.cos(latitude + stackDivision));\n \n addTriangle(radius * Math.cos(longitude + sliceDivision) * Math.sin(latitude + stackDivision), radius * Math.sin(longitude + sliceDivision) * Math.sin(latitude + stackDivision), radius * Math.cos(latitude + stackDivision), \n radius * Math.cos(longitude) * Math.sin(latitude), radius * Math.sin(longitude) * Math.sin(latitude), radius * Math.cos(latitude), \n radius * Math.cos(longitude + sliceDivision) * Math.sin(latitude), radius * Math.sin(longitude + sliceDivision) * Math.sin(latitude), radius * Math.cos(latitude));\n\n }\n }\n}","function drawSphere() {\r\n gl.bindBuffer(gl.ARRAY_BUFFER, sphereVertexPositionBuffer);\r\n gl.vertexAttribPointer(shaderProgram.vertexPositionAttribute, sphereVertexPositionBuffer.itemSize,\r\n gl.FLOAT, false, 0, 0);\r\n\r\n // Bind normal buffer\r\n gl.bindBuffer(gl.ARRAY_BUFFER, sphereVertexNormalBuffer);\r\n gl.vertexAttribPointer(shaderProgram.vertexNormalAttribute,\r\n sphereVertexNormalBuffer.itemSize,\r\n gl.FLOAT, false, 0, 0);\r\n gl.drawArrays(gl.TRIANGLES, 0, sphereVertexPositionBuffer.numItems);\r\n}","function drawSphere() {\n\n gl.useProgram(sphere.program);\n\n gl.bindBuffer(gl.ELEMENT_ARRAY_BUFFER, indexBuffer);\n gl.bufferData(gl.ELEMENT_ARRAY_BUFFER, new Uint16Array(sphere.indexList), gl.STATIC_DRAW);\n\n gl.bindBuffer(gl.ARRAY_BUFFER, verticesBuffer);\n gl.bufferData(gl.ARRAY_BUFFER, new Float32Array(sphere.vertices), gl.STATIC_DRAW);\n var vertexPosition = gl.getAttribLocation(sphere.program, \"vertexPosition\");\n gl.vertexAttribPointer(vertexPosition, sphere.vertDim, gl.FLOAT, false, 0, 0);\n gl.enableVertexAttribArray(vertexPosition);\n\n gl.bindBuffer(gl.ARRAY_BUFFER, normalsBuffer);\n gl.bufferData(gl.ARRAY_BUFFER, new Float32Array(flatten(sphere.normals)), gl.STATIC_DRAW);\n var nvPosition = gl.getAttribLocation(sphere.program, \"nv\");\n gl.vertexAttribPointer(nvPosition, sphere.vertDim, gl.FLOAT, false, 0, 0);\n gl.enableVertexAttribArray(nvPosition);\n\n gl.activeTexture(gl.TEXTURE0);\n gl.bindTexture(gl.TEXTURE_2D, sphereTexture);\n gl.bindBuffer(gl.ARRAY_BUFFER, texCoordBuffer);\n gl.bufferData(gl.ARRAY_BUFFER, new Float32Array(sphere.texCoords), gl.STATIC_DRAW);\n var texCoordLocation = gl.getAttribLocation(sphere.program, \"texCoord\");\n gl.vertexAttribPointer(texCoordLocation, 2, gl.FLOAT, false, 0, 0);\n gl.enableVertexAttribArray(texCoordLocation);\n\n var MLoc = gl.getUniformLocation(sphere.program, \"M\");\n gl.uniformMatrix4fv(MLoc, false, M);\n\n var SRotLoc = gl.getUniformLocation(sphere.program, \"SRot\");\n gl.uniformMatrix4fv(SRotLoc, false, flatten(sceneRotation));\n\n var MinvTransLoc = gl.getUniformLocation(sphere.program, \"MinvTrans\");\n gl.uniformMatrix4fv(MinvTransLoc, false, MinvTrans);\n\n var PLoc = gl.getUniformLocation(sphere.program, \"P\");\n gl.uniformMatrix4fv(PLoc, false, P);\n\n var thetaLoc = gl.getUniformLocation(sphere.program, \"theta\");\n gl.uniform1f(thetaLoc, sphere.theta);\n\n var scaleLoc = gl.getUniformLocation(sphere.program, \"s\");\n gl.uniform1f(scaleLoc, scale);\n\n var lightDirection1Loc = gl.getUniformLocation(sphere.program, \"lightDirection1\");\n gl.uniform3f(lightDirection1Loc, lightDirection1[0], lightDirection1[1], lightDirection1[2]);\n var directionColor1Loc = gl.getUniformLocation(sphere.program, \"directionColor1\");\n gl.uniform3f(directionColor1Loc, directionColor1[0], directionColor1[1], directionColor1[2]);\n var lightDirection2Loc = gl.getUniformLocation(sphere.program, \"lightDirection2\");\n gl.uniform3f(lightDirection2Loc, lightDirection2[0], lightDirection2[1], lightDirection2[2])\n var directionColor2Loc = gl.getUniformLocation(sphere.program, \"directionColor2\");\n gl.uniform3f(directionColor2Loc, directionColor2[0], directionColor2[1], directionColor2[2])\n\n gl.drawElements(gl.TRIANGLES, sphere.numElems, gl.UNSIGNED_SHORT, 0);\n}","function sphere() {\n\n}","function calculation () { \n var cos = Math.cos(phi), sin = Math.sin(phi);\n xB0 = xM0+R0*cos; yB0 = yM0-R0*sin; // Beobachtungsort (linke Skizze) \n xN0 = xB0-R1*sin; yN0 = yB0-R1*cos; // Norden (linke Skizze)\n xS0 = xB0+R1*sin; yS0 = yB0+R1*cos; // S�den (linke Skizze)\n xZ0 = xB0+R1*cos; yZ0 = yB0-R1*sin; // Zenit (linke Skizze)\n if (phi < 0) {cos = -cos; sin = -sin;} // Vorzeichenumkehr f�r S�dhalbkugel\n xP1 = xB1-R1*cos; yP1 = yB1-R1*sin; // Himmelspol (rechte Skizze) \n }","function showPosition(position) {\n\tvar radlat1 = Math.PI * position.coords.latitude/180\n\tvar radlat2 = Math.PI * myLatitude/180\n\tvar theta = position.coords.longitude-myLongitude\n\tvar radtheta = Math.PI * theta/180\n\tvar dist = Math.sin(radlat1) * Math.sin(radlat2) + Math.cos(radlat1) * Math.cos(radlat2) * Math.cos(radtheta);\n\tdist = Math.acos(dist)\n\tdist = dist * 180/Math.PI\n\tdist = dist * 60 * 1.1515 * 1.609344 * 1000 //convert to meters\n\tdocument.getElementById(myDistance).innerHTML = Math.round(dist) + \" meters\"; \t\n}","function SphericalMercator(options) {\n options = options || {};\n this.size = options.size || 256;\n if (!cache[this.size]) {\n var size = this.size;\n var c = cache[this.size] = {};\n c.Bc = [];\n c.Cc = [];\n c.zc = [];\n c.Ac = [];\n for (var d = 0; d < 30; d++) {\n c.Bc.push(size / 360);\n c.Cc.push(size / (2 * Math.PI));\n c.zc.push(size / 2);\n c.Ac.push(size);\n size *= 2;\n }\n }\n this.Bc = cache[this.size].Bc;\n this.Cc = cache[this.size].Cc;\n this.zc = cache[this.size].zc;\n this.Ac = cache[this.size].Ac;\n}","function OnDrawGizmosSelected() {\n\tvar camera = GetComponent.<Camera>();\n\tvar p = camera.ScreenToWorldPoint(new Vector3(100, 100, camera.nearClipPlane));\n\tGizmos.color = Color.yellow;\n\tGizmos.DrawSphere(p, 0.1F);\n}","function showSphereLighted(model) {\n //code from http://learningwebgl.com/cookbook/index.php/How_to_draw_a_sphere & http://learningwebgl.com/blog/?p=1253\n const latitudeBands = 30;\n const longitudeBands = 30;\n const radius = 100;\n\n const vertexPositionData = [];\n const normalData = [];\n const textureCoordData = [];\n\n for (let latNumber = 0; latNumber <= latitudeBands; latNumber++) {\n const theta = latNumber * Math.PI / latitudeBands;\n const sinTheta = Math.sin(theta);\n const cosTheta = Math.cos(theta);\n\n for (let longNumber = 0; longNumber <= longitudeBands; longNumber++) {\n const phi = longNumber * 2 * Math.PI / longitudeBands;\n const sinPhi = Math.sin(phi);\n const cosPhi = Math.cos(phi);\n const x = cosPhi * sinTheta;\n const y = cosTheta;\n const z = sinPhi * sinTheta;\n const u = 1 - (longNumber / longitudeBands);\n const v = latNumber / latitudeBands;\n\n normalData.push(x);\n normalData.push(-y); //y-inversion\n normalData.push(z);\n\n textureCoordData.push(u);\n textureCoordData.push(1. - v); //y-inversion\n\n vertexPositionData.push(radius * x);\n vertexPositionData.push(- radius * y); //y-inversion\n vertexPositionData.push(radius * z);\n }\n }\n\n const indexData = [];\n\n for (let latNumber = 0; latNumber < latitudeBands; latNumber++) {\n for (let longNumber = 0; longNumber < longitudeBands; longNumber++) {\n const first = (latNumber * (longitudeBands + 1)) + longNumber;\n const second = first + longitudeBands + 1;\n\n indexData.push(first);\n indexData.push(second);\n indexData.push(first + 1);\n\n indexData.push(second);\n indexData.push(second + 1);\n indexData.push(first + 1);\n }\n }\n\n //setup model\n model.vertices(vertexPositionData);\n model.indices(indexData);\n model.normals(normalData);\n model.uvs(textureCoordData);\n\n const w = 2 * radius;\n const h = w;\n\n model.x(w).y(h);\n\n //texture (http://planetpixelemporium.com/earth.html)\n model.src(path.join(__dirname, 'sphere/moonmap1k.jpg'));\n //model.src(path.join(__dirname, 'sphere/earthmap1k.jpg'));\n\n //animate\n model.rx.anim().from(0).to(360).dur(5000).loop(-1).start();\n model.ry.anim().from(0).to(360).dur(5000).loop(-1).start();\n}","function spindulioReiksme () {\n// let ivedimoLaukas = document.querySelector('div input');\n let r = document.querySelector('div input').value;\n let plotas= Math.PI*r*r\n\n// console.log(plotas);\ndocument.querySelector(\".apskritimo-plotas\").innerHTML = plotas;\n}","function staciakampoPlotas(ilgis, aukstis) {\n return ilgis * aukstis;\n}","function drawGridCentre(x,y,s,rot){\r\n ctx.save();\r\n ctx.translate(x,y);\r\n ctx.rotate(rot*Math.PI/180);\r\n drawCircle(0,0,20, colArray[0], colArray[0], 2, false, true);\r\n for(j = 0; j<7 ; j++){\r\n for(var i = 0 ; i<7 ; i++){\r\n drawRectangle(0-s/2+i*s/7,0-s/2+j*s/7, s/7,s/7,colArray[3], colArray[4],0.5, false, true);\r\n }\r\n }\r\n ctx.restore();\r\n}","function pushCartesianFromSpherical(out, latDeg, lonDeg) {\n let latRad = (latDeg / 180.0) * Math.PI,\n lonRad = (lonDeg / 180.0) * Math.PI\n out.push(Math.cos(latRad) * Math.cos(lonRad), Math.cos(latRad) * Math.sin(lonRad), Math.sin(latRad))\n return out\n}","function update_spheroid(path) {\n var i, n, d, dt, x0, y0, x1, y1, tx, ty, l, x2, y2, xa, ya, xb, yb;\n d = \"M{0},0\".fmt(path.heights[0]);\n for (i = 0, n = path.heights.length, dt = 2 * Math.PI / n; i < n; i += 1) {\n x0 = path.heights[(i + n - 1) % n] * Math.cos((i - 1) * dt);\n y0 = path.heights[(i + n - 1) % n] * Math.sin((i - 1) * dt);\n x1 = path.heights[i] * Math.cos(i * dt);\n y1 = path.heights[i] * Math.sin(i * dt);\n x2 = path.heights[(i + 1) % n] * Math.cos((i + 1) * dt);\n y2 = path.heights[(i + 1) % n] * Math.sin((i + 1) * dt);\n tx = x2 - x0;\n ty = y2 - y0;\n l = Math.sqrt(tx * tx + ty * ty);\n tx = tx / l;\n ty = ty / l;\n xa = x1 - SMOOTHING * tx * magnitude(x1 - x0, y1 - y0);\n ya = y1 - SMOOTHING * ty * magnitude(x1 - x0, y1 - y0);\n xb = x1 + SMOOTHING * tx * magnitude(x1 - x2, y1 - y2);\n yb = y1 + SMOOTHING * ty * magnitude(x1 - x2, y1 - y2);\n d += \"C{0},{1} {2},{3} {4},{5}\".fmt(xa, ya, x1, y1, xb, yb);\n }\n path.setAttribute(\"d\", d);\n }","axisPlot() {\n this.ctx = this.canvas.getContext(\"2d\");\n\n /**\n * Grid grid\n */\n if (this.grid.grid) {\n this.ctx.beginPath();\n this.ctx.font = 'italic 18pt Calibri';\n this.ctx.strokeStyle = '#979797';\n this.ctx.lineWidth = 1;\n this.ctx.setLineDash([10, 15]);\n for (let i = 30; i < this.field.width; i+= 100) {\n this.ctx.fillText(Math.ceil(this.ScreenToWorldY(i)*1000)/1000, 0, i);\n this.ctx.moveTo(0, i);\n this.ctx.lineTo(this.field.width, i);\n }\n for (let i = 100; i < this.field.width; i+= 100) {\n this.ctx.fillText(Math.ceil(this.ScreenToWorldX(i)*1000)/1000, i, this.field.height);\n this.ctx.moveTo(i, 0);\n this.ctx.lineTo(i, this.field.height);\n }\n this.ctx.stroke();\n this.ctx.closePath();\n }\n\n\n /**\n * Grid axiss\n */\n if (this.grid.axiss) {\n this.ctx.beginPath();\n this.ctx.strokeStyle = '#b10009';\n this.ctx.lineWidth = 2;\n this.ctx.setLineDash([]);\n\n this.ctx.moveTo(this.center.x, 0);\n this.ctx.lineTo(this.center.x, this.field.height);\n\n this.ctx.moveTo(0, this.center.y);\n this.ctx.lineTo(this.field.width, this.center.y);\n\n this.ctx.stroke();\n this.ctx.closePath();\n }\n\n\n if (this.grid.serifs) {\n this.ctx.beginPath();\n this.ctx.strokeStyle = '#058600';\n this.ctx.fillStyle = '#888888'\n this.ctx.lineWidth = 2;\n this.ctx.setLineDash([]);\n\n let start = 0;\n if (!this.grid.serifsStep){\n return;\n }\n\n let s = Math.abs(\n this.ScreenToWorldY(0) -\n this.ScreenToWorldY(this.grid.serifsSize)\n );\n\n /**\n * To right & to left\n */\n if ((this.center.y > 0) && (this.center.y < this.field.height)) {\n\n let finish = this.ScreenToWorldX(this.field.width);\n\n for (let i = start; i < finish; i+=this.grid.serifsStep) {\n this.moveTo(i+this.grid.serifsStep/2,(s/2));\n this.lineTo(i+this.grid.serifsStep/2,-(s/2));\n this.ctx.fillText(i+this.grid.serifsStep/2, this.WorldToScreenX(i+this.grid.serifsStep/2), this.WorldToScreenY(s/2));\n\n this.moveTo(i+this.grid.serifsStep,s);\n this.lineTo(i+this.grid.serifsStep,-s);\n this.ctx.fillText(i+this.grid.serifsStep, this.WorldToScreenX(i+this.grid.serifsStep), this.WorldToScreenY(s));\n }\n\n finish = this.ScreenToWorldX(0);\n\n for (let i = start; i > finish; i-=this.grid.serifsStep) {\n this.moveTo(i-this.grid.serifsStep/2,(s/2));\n this.lineTo(i-this.grid.serifsStep/2,-(s/2));\n this.ctx.fillText(i-this.grid.serifsStep/2, this.WorldToScreenX(i-this.grid.serifsStep/2), this.WorldToScreenY(s/2));\n\n this.moveTo(i-this.grid.serifsStep,s);\n this.lineTo(i-this.grid.serifsStep,-s);\n this.ctx.fillText(i-this.grid.serifsStep, this.WorldToScreenX(i-this.grid.serifsStep), this.WorldToScreenY(s));\n }\n }\n\n /**\n * To top & to bot\n */\n if ((this.center.x > 0) && (this.center.x < this.field.width)) {\n\n start = 0;\n let finish = this.ScreenToWorldY(0);\n\n for (let i = start; i < finish; i+=this.grid.serifsStep) {\n this.moveTo((s/2),i+this.grid.serifsStep/2);\n this.lineTo(-(s/2),i+this.grid.serifsStep/2);\n this.ctx.fillText(i+this.grid.serifsStep/2, this.WorldToScreenX(s/2), this.WorldToScreenY(i+this.grid.serifsStep/2));\n\n this.moveTo(s, i+this.grid.serifsStep);\n this.lineTo(-s, i+this.grid.serifsStep);\n this.ctx.fillText(i+this.grid.serifsStep, this.WorldToScreenX(s), this.WorldToScreenY(i+this.grid.serifsStep));\n }\n\n finish = this.ScreenToWorldY(this.field.width);\n\n for (let i = start; i > finish-this.grid.serifsStep; i-=this.grid.serifsStep) {\n this.moveTo((s/2),i+this.grid.serifsStep/2);\n this.lineTo(-(s/2),i+this.grid.serifsStep/2);\n this.ctx.fillText(i+this.grid.serifsStep/2, this.WorldToScreenX(s/2), this.WorldToScreenY(i+this.grid.serifsStep/2));\n\n this.moveTo(s, i+this.grid.serifsStep);\n this.lineTo( -s, i+this.grid.serifsStep);\n this.ctx.fillText(i+this.grid.serifsStep, this.WorldToScreenX(s), this.WorldToScreenY(i+this.grid.serifsStep));\n }\n }\n this.ctx.stroke();\n this.ctx.closePath();\n }\n }","static astroToSpherical( dist, decl, ra, sph ) {\n\n\t\tsph = sph || new Spherical();\n\t\tsph.set( dist,\n\t\t\t\t Math.PI / 2 - Utils.radians( decl ),\n\t\t\t\t Utils.radians( ra ) - Math.PI / 2 );\n\t\treturn sph;\n\n\t}","function sphericalDistance(a, b) {\n\t var x = lonToMeters(a[0] - b[0], (a[1] + b[1]) / 2),\n\t y = latToMeters(a[1] - b[1]);\n\t return Math.sqrt((x * x) + (y * y));\n\t}","function plot() {\n\n}","function Sphere(gl, position = [0, 0, 0]) {\n\n\t// Shader program\n\tif (Sphere.shaderProgram === undefined) {\n\t\tSphere.shaderProgram = initShaderProgram(gl, \"vertex-shader\", \"fragment-shader\");\n\t\tif (Sphere.shaderProgram === null) {\n\t\t\tthrow new Error('Creating the shader program failed.');\n\t\t}\n\t\tSphere.locations = {\n\t\t\tattribute: {\n\t\t\t\tvertPosition: gl.getAttribLocation(Sphere.shaderProgram, \"vertPosition\"),\n\t\t\t\tvertColor: gl.getAttribLocation(Sphere.shaderProgram, \"vertColor\"),\n\t\t\t\taNormal: gl.getAttribLocation(Sphere.shaderProgram, \"aNormal\"),\n\t\t\t},\n\t\t\tuniform: {\n\t\t\t\tmMatrix: gl.getUniformLocation(Sphere.shaderProgram, \"mMatrix\"),\n\t\t\t\twMatrix: gl.getUniformLocation(Sphere.shaderProgram, \"wMatrix\"),\n\t\t\t\tvMatrix: gl.getUniformLocation(Sphere.shaderProgram, \"vMatrix\"),\n\t\t\t\tmMatrixInv: gl.getUniformLocation(Sphere.shaderProgram, \"mMatrixInv\"),\n\t\t\t\tpMatrix: gl.getUniformLocation(Sphere.shaderProgram, \"pMatrix\"),\n\t\t\t\tpLight: gl.getUniformLocation(Sphere.shaderProgram, \"pLight\"),\n\t\t\t\tcamera: gl.getUniformLocation(Sphere.shaderProgram, \"camera\"),\n\t\t\t\tspecularEnabled: gl.getUniformLocation(Sphere.shaderProgram, \"specularEnabled\"),\n\t\t\t\tphong: gl.getUniformLocation(Sphere.shaderProgram, \"phong\")\n\t\t\t}\n\t\t};\n\t\tgl.enableVertexAttribArray(Sphere.locations.attribute.vertPosition);\n\t\tgl.enableVertexAttribArray(Sphere.locations.attribute.vertColor);\n\t\tgl.enableVertexAttribArray(Sphere.locations.attribute.aNormal);\n\t}\n\n\t// Buffers\n\tif (Sphere.buffers === undefined) {\n\t\t// Create a buffer with the vertex positions\n\t\t// 3 coordinates per vertex, 3 vertices per triangle\n\t\t// 2 triangles make up the ground plane, 4 triangles make up the sides\n\t\tconst pBuffer = gl.createBuffer();\n\t\tgl.bindBuffer(gl.ARRAY_BUFFER, pBuffer);\n\n\n\t\t// Position vertices\n\t\tlet limit = 33;\n\t\tlet i, hi, si, ci;\n\t\tlet j, hj, sj, cj;\n\t\tlet p1, p2;\n\n\t\tlet vertices = [];\n\t\tlet normals = [];\n\t\tfor (let j = 0; j <= limit; j++) {\n\t\t\thj = j * Math.PI / limit;\n\t\t\tsj = Math.sin(hj);\n\t\t\tcj = Math.cos(hj);\n\t\t\tfor (let i = 0; i <= limit; i++) {\n\t\t\t\thi = i * 2 * Math.PI / limit;\n\t\t\t\tsi = Math.sin(hi);\n\t\t\t\tci = Math.cos(hi);\n\n\t\t\t\t// 0.77 to minimize the sphere\n\t\t\t\tvertices.push(ci * sj * 0.77); // X\n\t\t\t\tvertices.push(cj * 0.77); // Y\n\t\t\t\tvertices.push(si * sj * 0.77); // Z\n\n\t\t\t\tnormals.push(ci*sj);\n\t\t\t\tnormals.push(cj);\n\t\t\t\tnormals.push(si*sj);\n\t\t\t}\n\t\t}\n\n\t\tgl.bufferData(gl.ARRAY_BUFFER, new Float32Array(vertices), gl.STATIC_DRAW);\n\t\tpBuffer.itemSize = 3;\n\t\tpBuffer.numItems = vertices.length;\n\n\n\t\t// Indices\n\t\tlet indices = []\n\t\tlet iBuffer = gl.createBuffer();\n\t\tgl.bindBuffer(gl.ELEMENT_ARRAY_BUFFER, iBuffer);\n\t\tfor (j = 0; j < limit; j++) {\n\t\t\tfor (i = 0; i < limit; i++) {\n\t\t\t\tp1 = j * (limit + 1) + i;\n\t\t\t\tp2 = p1 + (limit + 1);\n\n\t\t\t\tindices.push(p1);\n\t\t\t\tindices.push(p2);\n\t\t\t\tindices.push(p1 + 1);\n\n\t\t\t\tindices.push(p1 + 1);\n\t\t\t\tindices.push(p2);\n\t\t\t\tindices.push(p2 + 1);\n\t\t\t}\n\t\t}\n\n\t\tgl.bufferData(gl.ELEMENT_ARRAY_BUFFER, new Uint16Array(indices), gl.STATIC_DRAW);\n\t\tiBuffer.itemSize = 3;\n\t\tiBuffer.numItems = indices.length;\n\n\n\t\t// Color\n\t\tlet cBuffer = gl.createBuffer();\n\t\tgl.bindBuffer(gl.ARRAY_BUFFER, cBuffer);\n\t\tlet colors = [];\n\n\t\tfor (let i = 0; i <= limit; i++) {\n\t\t\tfor (let j = 0; j <= limit; j++) {\n\t\t\t\tcolors.push(0);\n\t\t\t\tcolors.push(0);\n\t\t\t\tcolors.push(0.99);\n\t\t\t}\n\t\t}\n\t\tgl.bufferData(gl.ARRAY_BUFFER, new Float32Array(colors), gl.STATIC_DRAW);\n\t\tcBuffer.itemSize = 3;\n\t\tcBuffer.numitems = colors.length;\n\n\n\t\t// Lines\n\t\tconst lBuffer = gl.createBuffer();\n\t\tgl.bindBuffer(gl.ARRAY_BUFFER, lBuffer);\n\n\t\tlet lineVertices = [\n\t\t\t0.0, 1.1, 0.0,\n\t\t\t0.0, -1.1, 0.0,\n\n\t\t\t1.1, 0.0, 0.0,\n\t\t\t-1.1, 0.0, 0.0,\n\n\t\t\t0.0, 0.0, 1.1,\n\t\t\t0.0, 0.0, -1.1\n\t\t];\n\t\tgl.bufferData(gl.ARRAY_BUFFER, new Float32Array(lineVertices), gl.STATIC_DRAW);\n\t\tlBuffer.itemSize = 3;\n\t\tlBuffer.numItems = 6;\n\n\n\t\tconst liBuffer = gl.createBuffer();\n\t\tgl.bindBuffer(gl.ELEMENT_ARRAY_BUFFER, liBuffer);\n\n\t\tlet lineIndices = [\n\t\t\t0, 1,\n\t\t\t2, 3,\n\t\t\t4, 5\n\t\t];\n\t\tgl.bufferData(gl.ELEMENT_ARRAY_BUFFER, new Uint16Array(lineIndices), gl.STATIC_DRAW);\n\t\tliBuffer.itemSize = 1;\n\t\tliBuffer.numItems = 6;\n\n\t\tconst lcBuffer = gl.createBuffer();\n\t\tgl.bindBuffer(gl.ARRAY_BUFFER, lcBuffer);\n\n\t\tlet lineColors = [\n\t\t\t0.0, 1.0, 0.0, 1.0,\n\t\t\t0.0, 1.0, 0.0, 1.0,\n\n\t\t\t1.0, 0.0, 0.0, 1.0,\n\t\t\t1.0, 0.0, 0.0, 1.0,\n\n\t\t\t0.0, 0.0, 1.0, 1.0,\n\t\t\t0.0, 0.0, 1.0, 1.0\n\t\t];\n\t\tgl.bufferData(gl.ARRAY_BUFFER, new Float32Array(lineColors), gl.STATIC_DRAW);\n\t\tlcBuffer.itemSize = 4;\n\t\tlcBuffer.numItems = 6;\n\n\n\t\t//Create a buffer with the normals\n\t\tconst nBuffer = gl.createBuffer();\n\t\tgl.bindBuffer(gl.ARRAY_BUFFER, nBuffer);\n\t\tgl.bufferData(gl.ARRAY_BUFFER, new Float32Array(normals), gl.STATIC_DRAW);\n\n\n\t\tSphere.buffers = {\n\t\t\tpBuffer: pBuffer,\n\t\t\tcBuffer: cBuffer,\n\t\t\tnBuffer: nBuffer,\n\t\t\tlBuffer: lBuffer,\n\t\t\tiBuffer: iBuffer,\n\t\t\tliBuffer: liBuffer,\n\t\t\tlcBuffer: lcBuffer,\n\t\t\tpComponents: 3,\n\t\t\tcComponents: 3,\n\t\t\tnComponents: 3,\n\t\t};\n\t}\n\n\t// Object Variables\n\tthis.lcPosition = position;\n\tthis.scale = [1, 1, 1];\n\n\tthis.mMatrix = mat4.create();\n\tthis.lcMatrix = mat4.create();\n\tthis.mMatrixInv = mat3.create();\n\tthis.selected = false;\n\tthis.global = false;\n\n\t// Object draw function\n\tthis.draw = function (gl, pMatrix, vMatrix) {\n\t\tgl.useProgram(Sphere.shaderProgram);\n\t\tgl.uniformMatrix4fv(Sphere.locations.uniform.pMatrix, false, pMatrix);\n\t\tgl.uniformMatrix4fv(Sphere.locations.uniform.mMatrix, false, this.mMatrix);\n\t\tgl.uniformMatrix4fv(Sphere.locations.uniform.wMatrix, false, wMatrix);\n\t\tgl.uniformMatrix4fv(Sphere.locations.uniform.vMatrix, false, vMatrix);\n\t\tgl.uniformMatrix3fv(Sphere.locations.uniform.mMatrixInv, false, this.mMatrixInv);\n\t\tgl.uniform3fv(Sphere.locations.uniform.pLight, lightPosition);\n\t\tgl.uniform3fv(Sphere.locations.uniform.camera, [0, -10, 0]);\n\t\tgl.uniform1f(Sphere.locations.uniform.specularEnabled, specularEnabled);\n\t\tgl.uniform1f(Sphere.locations.uniform.phong, phong);\n\t\tgl.uniform4fv(Sphere.locations.uniform.uColor, [1.0, 0.0, 0.0, 1.0]);\n\n\t\tgl.bindBuffer(gl.ARRAY_BUFFER, Sphere.buffers.pBuffer);\n\t\tgl.vertexAttribPointer(Sphere.locations.attribute.vertPosition, Sphere.buffers.pComponents, gl.FLOAT, false, 0, 0);\n\t\tgl.bindBuffer(gl.ARRAY_BUFFER, Sphere.buffers.cBuffer);\n\t\tgl.vertexAttribPointer(Sphere.locations.attribute.vertColor, Sphere.buffers.cComponents, gl.FLOAT, false, 0, 0);\n\t\tgl.bindBuffer(gl.ARRAY_BUFFER, Sphere.buffers.nBuffer);\n\t\tgl.vertexAttribPointer(Sphere.locations.attribute.aNormal, Sphere.buffers.nComponents, gl.FLOAT, false, 0, 0);\n\n\t\tgl.bindBuffer(gl.ELEMENT_ARRAY_BUFFER, Sphere.buffers.iBuffer);\n\t\tgl.drawElements(gl.TRIANGLES, Sphere.buffers.iBuffer.numItems, gl.UNSIGNED_SHORT, 0);\n\n\t\tgl.drawArrays(gl.TRIANGLES, 0, 18);\n\t};\n\n\n\t// Object drawLines function which are displayed as local coordinates in colors R for x, G for y and B for z axis\n\tthis.drawLines = function (gl, pMatrix) {\n\t\tgl.useProgram(Sphere.shaderProgram);\n\n\t\tgl.bindBuffer(gl.ARRAY_BUFFER, Sphere.buffers.lBuffer);\n\t\tgl.vertexAttribPointer(Sphere.locations.attribute.vertPosition, Sphere.buffers.lBuffer.itemSize, gl.FLOAT, false, 0, 0);\n\n\t\tgl.bindBuffer(gl.ARRAY_BUFFER, Sphere.buffers.lcBuffer);\n\t\tgl.vertexAttribPointer(Sphere.locations.attribute.vertColor, Sphere.buffers.lcBuffer.itemSize, gl.FLOAT, false, 0, 0);\n\n\t\tgl.bindBuffer(gl.ARRAY_BUFFER, Sphere.buffers.nBuffer);\n\t\tgl.vertexAttribPointer(Sphere.locations.attribute.aNormal, Sphere.buffers.nComponents, gl.FLOAT, false, 0, 0);\n\n\n\t\tgl.bindBuffer(gl.ELEMENT_ARRAY_BUFFER, Sphere.buffers.liBuffer);\n\t\tgl.uniformMatrix4fv(Sphere.locations.uniform.pMatrix, false, pMatrix);\n\t\tgl.uniformMatrix4fv(Sphere.locations.uniform.mMatrix, false, this.lcMatrix);\n\n\t\tgl.drawElements(gl.LINES, Sphere.buffers.liBuffer.numItems, gl.UNSIGNED_SHORT, 0);\n\t};\n\n\tthis.start = function () {\n\t\tmat4.translate(this.mMatrix, this.mMatrix, this.lcPosition);\n\t\tmat4.translate(this.lcMatrix, this.lcMatrix, this.lcPosition);\n\t};\n\n\tthis.update = function (x, y, z, position = [0, 0, 0], scale = [1, 1, 1]) {\n\t\t// Global transformations\n\t\tif (this.global) {\n\t\t\t// Move the Object to the center\n\t\t\tmat4.identity(this.mMatrix);\n\t\t\t// Transform the object\n\t\t\tmat4.scale(this.mMatrix, this.mMatrix, scale);\n\t\t\tmat4.rotateX(this.mMatrix, this.mMatrix, x);\n\t\t\tmat4.rotateY(this.mMatrix, this.mMatrix, y);\n\t\t\tmat4.rotateZ(this.mMatrix, this.mMatrix, z);\n\t\t\tmat4.translate(this.mMatrix, this.mMatrix, position);\n\n\t\t\t// Multiply with Local Coordinates to get to the right position\n\t\t\tmat4.multiply(this.mMatrix, this.mMatrix, this.lcMatrix);\n\n\t\t\t// Move Local Coordinates where the object is\n\t\t\tmat4.identity(this.lcMatrix);\n\t\t\tmat4.multiply(this.lcMatrix, this.lcMatrix, this.mMatrix);\n\t\t}\n\t\t// Local transformations\n\t\telse {\n\t\t\t// Transform Object\n\t\t\tmat4.translate(this.mMatrix, this.mMatrix, position);\n\t\t\tmat4.rotateX(this.mMatrix, this.mMatrix, x);\n\t\t\tmat4.rotateZ(this.mMatrix, this.mMatrix, z);\n\t\t\tmat4.rotateY(this.mMatrix, this.mMatrix, y);\n\t\t\tmat4.scale(this.mMatrix, this.mMatrix, scale);\n\n\t\t\t// Transform Local Coordinates\n\t\t\tmat4.translate(this.lcMatrix, this.lcMatrix, position);\n\t\t\tmat4.rotateX(this.lcMatrix, this.lcMatrix, x);\n\t\t\tmat4.rotateZ(this.lcMatrix, this.lcMatrix, z);\n\t\t\tmat4.rotateY(this.lcMatrix, this.lcMatrix, y);\n\t\t\tmat4.scale(this.lcMatrix, this.lcMatrix, scale);\n\t\t}\n\t\tmat3.normalFromMat4(this.mMatrixInv, this.mMatrix);\n\t};\n}","function drawScene(){\n\n\tvar radius = params.size*Math.sqrt(2)/4.\n\n\t//draw the full spheres (this should be from an input file)\n\t//corners\n\tvar p1 = new THREE.Vector3(0, \t\t\t\t0, \t\t\t\t0);\n\tvar p2 = new THREE.Vector3(params.size, \t0, \t\t\t\t0);\n\tvar p3 = new THREE.Vector3(0, \t\t\t\tparams.size, \t0);\n\tvar p4 = new THREE.Vector3(params.size, \tparams.size, \t0);\n\tvar p5 = new THREE.Vector3(0, \t\t\t\t0,\t\t\t\tparams.size);\n\tvar p6 = new THREE.Vector3(params.size, \t0, \t\t\t\tparams.size);\n\tvar p7 = new THREE.Vector3(0, \t\t\t\tparams.size, \tparams.size);\n\tvar p8 = new THREE.Vector3(params.size,\t\tparams.size, \tparams.size);\n\t//centers on planes\n\tvar p9 = new THREE.Vector3(0,\t\t\t\tparams.size/2.,\tparams.size/2.);\n\tvar p10 = new THREE.Vector3(params.size/2.,\t0,\t\t\t\tparams.size/2.);\n\tvar p11 = new THREE.Vector3(params.size/2.,\tparams.size/2.,\t0);\n\tvar p12 = new THREE.Vector3(params.size,\tparams.size/2.,\tparams.size/2.);\n\tvar p13 = new THREE.Vector3(params.size/2.,\tparams.size,\tparams.size/2.);\n\tvar p14 = new THREE.Vector3(params.size/2.,\tparams.size/2.,\tparams.size);\n\n\tvar allP = [p1,p2,p3,p4,p5,p6,p7,p8, p9,p10,p11,p12,p13,p14]\n\tallP.forEach(function(p){\n\t\tvar mesh = drawSphere(radius, params.sphereSegments, params.sphereSegments, params.defaultOuterOpacity, params.sphereColor, p);\n\t\tparams.spheres.push(mesh);\n\t})\n\t\n\t//half spheres\n\tvar r9 = new THREE.Vector3(0,\t\t\t\tMath.PI/2.,\t\t0);\n\tvar r10 = new THREE.Vector3(-Math.PI/2.,\t0,\t\t\t\t0);\n\tvar r11 = new THREE.Vector3(0, \t\t\t\t0,\t\t\t\t0);\n\tvar r12 = new THREE.Vector3(0, \t\t\t\t-Math.PI/2.,\t0);\n\tvar r13 = new THREE.Vector3(Math.PI/2., \t0, \t\t\t\t0);\n\tvar r14 = new THREE.Vector3(Math.PI,\t\t0,\t\t\t0);\n\n\tallP = [p9,p10,p11,p12,p13,p14]\n\tvar allR = [r9,r10,r11,r12,r13,r14]\n\tallP.forEach(function(p, i){\n\t\tvar mesh = drawHalfSphere(radius, params.sphereSegments, params.sphereSegments, params.defaultInnerOpacity, params.sphereColor, p, allR[i]);\n\t\tparams.hemiSpheres.push(mesh);\n\t})\n\n\n\tvar r1 = new THREE.Vector3(0,\t\t\t\tMath.PI/2.,\t\t0); \n\tvar r2 = new THREE.Vector3(0,\t\t\t\t0,\t\t\t\t0); \n\tvar r3 = new THREE.Vector3(Math.PI/2.,\t\tMath.PI/2.,\t\t0); \n\tvar r4 = new THREE.Vector3(Math.PI/2.,\t\t0,\t\t\t\t0);\n\tvar r5 = new THREE.Vector3(0,\t\t\t\tMath.PI/2.,\t\t-Math.PI/2.); \n\tvar r6 = new THREE.Vector3(0,\t\t\t\t-Math.PI/2.,\t0);\n\tvar r7 = new THREE.Vector3(Math.PI/2.,\t\t0,\t\t\t\tMath.PI); \n\tvar r8 = new THREE.Vector3(Math.PI,\t\t0,\t\t\t\t0); \n\tallP = [p1,p2,p3,p4,p5,p6,p7,p8]\n\tallR = [r1,r2,r3,r4,r5,r6,r7,r8]\n\tallP.forEach(function(p, i){\n\t\tvar mesh = drawQuarterSphere(radius, params.sphereSegments, params.sphereSegments, params.defaultInnerOpacity, params.sphereColor, p, allR[i]);\n\t\tparams.hemiSpheres.push(mesh);\n\t})\n\n\n\t//draw slice\n\tvar p = new THREE.Vector3(params.size,\tparams.size/2.,\tparams.size/2.); \n\tvar r = new THREE.Vector3(0,\t\t\tMath.PI/2.,\t\t0); \n\n\tvar slice = drawSlice(2.*params.size, p, r, params.sliceOpacity, params.sliceColor);\n\tparams.sliceMesh.push(slice.plane);\n\tparams.sliceMesh.push(slice.mesh);\n\n\n\t//draw the box\n\tdrawBox();\n\n\n\n\t//lights\n\taddLights()\n\n\n}","function Sphere(center, radius, color, emission, reflectionType) {\n this.center = center;\n this.radius = radius;\n this.color = color;\n this.emission = emission;\n this.reflectionType = reflectionType; // DIFFUSE, SPECULAR, REFRACTIVE\n}","plotRoutes() {\n for (let r of this.mapRoutes) {\n r.plotPath(this.map);\n }\n }","function cs_geocentric_to_geodetic (cs, p) {\n\n var X =p.x;\n var Y = p.y;\n var Z = p.z;\n var Longitude;\n var Latitude;\n var Height;\n\n var W; /* distance from Z axis */\n var W2; /* square of distance from Z axis */\n var T0; /* initial estimate of vertical component */\n var T1; /* corrected estimate of vertical component */\n var S0; /* initial estimate of horizontal component */\n var S1; /* corrected estimate of horizontal component */\n var Sin_B0; /* Math.sin(B0), B0 is estimate of Bowring aux variable */\n var Sin3_B0; /* cube of Math.sin(B0) */\n var Cos_B0; /* Math.cos(B0) */\n var Sin_p1; /* Math.sin(phi1), phi1 is estimated latitude */\n var Cos_p1; /* Math.cos(phi1) */\n var Rn; /* Earth radius at location */\n var Sum; /* numerator of Math.cos(phi1) */\n var At_Pole; /* indicates location is in polar region */\n\n X = parseFloat(X); // cast from string to float\n Y = parseFloat(Y);\n Z = parseFloat(Z);\n\n At_Pole = false;\n if (X != 0.0)\n {\n Longitude = Math.atan2(Y,X);\n }\n else\n {\n if (Y > 0)\n {\n Longitude = HALF_PI;\n }\n else if (Y < 0)\n {\n Longitude = -HALF_PI;\n }\n else\n {\n At_Pole = true;\n Longitude = 0.0;\n if (Z > 0.0)\n { /* north pole */\n Latitude = HALF_PI;\n }\n else if (Z < 0.0)\n { /* south pole */\n Latitude = -HALF_PI;\n }\n else\n { /* center of earth */\n Latitude = HALF_PI;\n Height = -cs.b;\n return;\n }\n }\n }\n W2 = X*X + Y*Y;\n W = Math.sqrt(W2);\n T0 = Z * AD_C;\n S0 = Math.sqrt(T0 * T0 + W2);\n Sin_B0 = T0 / S0;\n Cos_B0 = W / S0;\n Sin3_B0 = Sin_B0 * Sin_B0 * Sin_B0;\n T1 = Z + cs.b * cs.ep2 * Sin3_B0;\n Sum = W - cs.a * cs.es * Cos_B0 * Cos_B0 * Cos_B0;\n S1 = Math.sqrt(T1*T1 + Sum * Sum);\n Sin_p1 = T1 / S1;\n Cos_p1 = Sum / S1;\n Rn = cs.a / Math.sqrt(1.0 - cs.es * Sin_p1 * Sin_p1);\n if (Cos_p1 >= COS_67P5)\n {\n Height = W / Cos_p1 - Rn;\n }\n else if (Cos_p1 <= -COS_67P5)\n {\n Height = W / -Cos_p1 - Rn;\n }\n else\n {\n Height = Z / Sin_p1 + Rn * (cs.es - 1.0);\n }\n if (At_Pole == false)\n {\n Latitude = Math.atan(Sin_p1 / Cos_p1);\n }\n\n p.x = Longitude;\n p.y =Latitude;\n p.z = Height;\n return 0;\n}","function\ntb_project_to_sphere(r, x, y)\n{\n var d, t, z;\n \n d = Math.sqrt(x*x + y*y);\n if (d < r * 0.70710678118654752440) { /* Inside sphere */\n z = Math.sqrt(r*r - d*d);\n } else { /* On hyperbola */\n t = r / 1.41421356237309504880;\n z = t*t / d;\n }\n return z;\n}","function calcSpheric(coords, dt) {\n if (!dw.isTurnable()) return;\n var proj = dw.initProj();\n var rect = dw.viewsizeOf(),\n skyRadius = .32 * Math.sqrt((rect[2] - rect[0]) * (rect[2] - rect[0]) + (rect[3] - rect[1]) * (rect[3] - rect[1])),\n gmst = Starry.siderealTime(dt),\n skyRotationAngle = gmst / 12.0 * Math.PI;\n coords[0] /= skyRadius * Math.PI / 180;\n coords[1] /= skyRadius * Math.PI / 180;\n var cy = -proj.lat0 * 180 / Math.PI,\n cx = lat * 180 / Math.PI + skyRotationAngle * 180 / Math.PI;\n var skyproj = '+proj=ortho +units=m +a=' + proj.a + ' +b=' + proj.b + ' +lon_0=' + cx + ' +lat_0=' + cy;\n Proj4js.defs['SKY'] = skyproj;\n dw.projload['SKY'] = new Proj4js.Proj('SKY');\n var pt = dw.transformCoords('SKY', 'epsg:4326', coords);\n if (pt) {\n // backside\n pt[0] = MUtil.ang360(180 - (pt[0] - cx) + cx) * Math.PI / 180;\n pt[1] = pt[1] * Math.PI / 180;\n }\n return pt;\n}","display() {\n strokeWeight(1);\n stroke(200);\n fill(200);\n beginShape();\n for (let i = 0; i < this.surface.length; i++) {\n let v = scaleToPixels(this.surface[i]);\n vertex(v.x, v.y);\n }\n vertex(width, height);\n vertex(0, height);\n endShape(CLOSE);\n }","function createHemisphereGeometry(radius,dir,cu,cv) {\n let r = radius;\n\n var geom = new THREE.Geometry(); \n\n let points = [];\n\n let num_z_segments = 16;\n let num_xy_segments = 32;\n\n let uvs = [];\n let margin = 0.05;\n let ru = 0.25 * (1.0 - margin);\n let rv = 0.5 * (1.0 - margin);;\n\n let half_pi = Math.PI / 2.0;\n for(let s=0; s<num_z_segments; s++) {\n let zc = (s / num_z_segments) * half_pi;\n\n for(let t=0; t<num_xy_segments; t++) {\n\n // angle of rotation on xy plane in radians\n let xyc = (t / num_xy_segments) * (Math.PI * 2.0) * dir;\n\n let x = Math.cos(xyc) * Math.cos(zc) * r;\n let y = Math.sin(xyc) * Math.cos(zc) * r;\n let z = Math.sin(zc) * r * dir * (-1.0);\n\n geom.vertices.push(new THREE.Vector3(x,y,z));\n\n let u = cu + (Math.cos(xyc) * ru * (num_z_segments - s) / num_z_segments) * dir;\n let v = cv + Math.sin(xyc) * rv * (num_z_segments - s) / num_z_segments;\n uvs.push( new THREE.Vector2(u,v) );\n }\n }\n\n // Add the last one vertex to close the top of the dome\n geom.vertices.push(new THREE.Vector3(0,0,r * dir * (-1.0)));\n uvs.push( new THREE.Vector2(cu,cv) );\n\n // Faces (polygon indices)\n\n for(let s=0; s<num_z_segments-1; s++) {\n for(let t=0; t<num_xy_segments; t++) {\n //let i = ;\n let i0 = s * num_xy_segments + t;\n let i1 = s * num_xy_segments + (t+1) % num_xy_segments;\n let i2 = (s+1) * num_xy_segments + (t+1) % num_xy_segments;\n let i3 = (s+1) * num_xy_segments + t;\n geom.faces.push( new THREE.Face3(i0,i1,i2) );\n geom.faces.push( new THREE.Face3(i0,i2,i3) );\n\n geom.faceVertexUvs[0].push([ uvs[i0], uvs[i1], uvs[i2] ]);\n geom.faceVertexUvs[0].push([ uvs[i0], uvs[i2], uvs[i3] ]);\n }\n }\n\n // Close the hole\n let i2 = num_z_segments * num_xy_segments;\n for(let t=0; t<num_xy_segments; t++) {\n let i0 = (num_z_segments-1) * num_xy_segments + t;\n let i1 = (num_z_segments-1) * num_xy_segments + (t+1) % num_xy_segments;\n geom.faces.push( new THREE.Face3(i0,i1,i2) );\n geom.faceVertexUvs[0].push([ uvs[i0], uvs[i1], uvs[i2] ]);\n }\n\n return geom;\n}","function createSphereVertices(radius,numRings,vertPerRing) {\n\tvar r = radius\n\tnumRings = numRings+1;\n\tvar phi = Math.PI/numRings;\n\tvar theta = 2*Math.PI/vertPerRing;\n\tvar vertices = []\n\tfor (var i = 0; i<numRings+1; i++) { //Should include \"ring\" for top/bot points\n\t\tvertices.push([])\n\t\t\tfor (var j = 0; j<vertPerRing; j++) {\n\t\t\t\tvar y = r*Math.cos(i*phi)\n\t\t\t\tvar x = r*Math.sin(i*phi)*Math.cos(j*theta);// + (i/2)*theta)\n\t\t\t\tvar z = r*Math.sin(i*phi)*Math.sin(j*theta);// + (i/2)*theta)\n\t\t\t\t\n\t\t\t\tvertices[i].push([x,y,z])\n\t\t\t}\n\t}\n\tvar triangle_strip = [];\n\tfor (var i = 0; i<numRings; i++) {\n\t\tvar li = vertices[i].length\n\t\tvar li1 = vertices[i+1].length\n\t\ttriangle_strip = triangle_strip.concat(vertices[i][li-1])\n\t\ttriangle_strip = triangle_strip.concat(vertices[i+1][li1-1])\n\t\tfor (var j = 0; j<vertPerRing; j++) {\n\t\t\ttriangle_strip = triangle_strip.concat(vertices[i][j])\n\t\t\ttriangle_strip = triangle_strip.concat(vertices[i+1][j])\n\t\t}\n\t\ttriangle_strip = triangle_strip.concat(vertices[i][0])\n\t\ttriangle_strip = triangle_strip.concat(vertices[i+1][0])\n\t}\n\tvar numItems = triangle_strip.length/3\t//based on 3-vector\n\treturn [triangle_strip,numItems]\n}","function Sphere(center, radius, mat) {\n this.center = vec3.create(center);\n this.radius = radius;\n this.mat = mat;\n this.id = ++SPHERE_NB;\n\n gl.useProgram(shaderProgram);\n this.centerLocation = gl.getUniformLocation(shaderProgram, \"sphere\"+this.id+\"_center\");\n this.radiusLocation = gl.getUniformLocation(shaderProgram, \"sphere\"+this.id+\"_radius\");\n this.mat.createUniform(this);\n this.updateUniform = function () {\n gl.uniform3f(this.centerLocation,this.center[0],this.center[1],this.center[2]);\n gl.uniform1f(this.radiusLocation,this.radius);\n this.mat.updateUniform();\n };\n this.updateUniform();\n\n this.move = function (direction){\n this.center[0] += direction[0];\n this.center[1] += direction[1];\n this.center[2] += direction[2];\n gl.uniform3f(this.centerLocation,this.center[0],this.center[1],this.center[2]);\n }\n}","function draw3() {\n var a = 0.86,\n // b controls tightness and direction of spiral. b=0 is a circle \n // b->infinity the spiral approaches a straight line\n b = 0.3,\n //b = 0.5,\n rotations = 3.2,\n radius_max = DIAMETER,\n \n arms = 2,\n \n alpha = 0.5,\n beta = 1,\n \n x_0 = 0,\n sigma = 6;\n \n var theta_min = 0,\n theta_max = rotations * (Math.PI * 2);\n for (var j = 0; j < arms; j++) {\n \n \n for (var i = 0; i < PARTICLE_COUNT / arms; i++) {\n \n // Create a new star\n var star = Object.create(Star);\n \n // Create a random theta\n var theta = Math.random() * (theta_max - theta_min + 1) + theta_min\n \n // Adjust the b value based on which arm we are calculating.\n b2 = b + (0.5 * arms);\n \n // Now use the formula for the logarithmic spiral to get the radius\n var radius = Math.pow(a * Math.E, b2 * theta);\n \n // Use the quantile function (inverse cdf) of the Cauchy\n // distribution to spread the stars from the mainline\n var rad_mod = x_0 + sigma * Math.tan(Math.PI * (Math.random() - 0.5));\n //radius = radius + rad_mod;\n \n // Convert to cartesian\n star.x = (radius * Math.cos(theta)) + (DIAMETER / 2);\n star.y = (radius * Math.sin(theta)) + (DIAMETER / 2);\n \n galaxy.stars.push(star);\n \n //sys.puts(\" created star [\" + i + \"] at (\" + star.x + \",\" + star.y + \")\");\n }\n }\n \n}","display() \n { \n this.scene.pushMatrix();\n this.semiSphere2.display();\n this.scene.popMatrix();\n }","function plotGraph(){\n createAxis();\n // zoom.x(x).y(y);\n // console.log('setting scales');\n // console.log(x);\n // console.log(y);\n updateBoundaryGraph.setScales(x,y);\n }","function drawDonut() {\n for (let i = 0; i <= 360; i += angleStep) {\n let x = width * sin(i);\n let y = height * cos(i);\n let z = 0;\n let center = { x, y, z };\n circlesVertices.push(createCircleVertices(center, i, 1));\n }\n drawVertices();\n}","function zoomed() {\n\n\n \tprojection.scale(d3.event.scale);\n\n svgGroup.selectAll(\".land\")\n .attr(\"d\", path);\n svgGroup.selectAll(\".boundary\")\n .attr(\"d\", path);\n svgGroup.selectAll(\".saskatoon\")\n .attr(\"d\", path);\n svgGroup.selectAll(\".saskatoonFOV\")\n .attr(\"d\", path);\n svgGroup.selectAll(\".princegeorge\")\n .attr(\"d\", path);\n svgGroup.selectAll(\".princegeorgeFOV\")\n .attr(\"d\", path);\n svgGroup.selectAll(\".clyde\")\n .attr(\"d\", path);\n svgGroup.selectAll(\".clydeFOV\")\n .attr(\"d\", path);\n svgGroup.selectAll(\".rankin\")\n .attr(\"d\", path);\n svgGroup.selectAll(\".rankinFOV\")\n .attr(\"d\", path);\n svgGroup.selectAll(\".inuvik\")\n .attr(\"d\", path);\n svgGroup.selectAll(\".inuvikFOV\")\n .attr(\"d\", path);\n svgGroup.selectAll(\"#sphere\")\n .attr(\"d\", path);\n\n svgGroup.selectAll(\".circles\")\n\t\t.remove()\n\n\tdrawPoints(\"saskatoon\",\"green\");\n\tdrawPoints(\"rankin\",\"blue\");\n drawPoints(\"princegeorge\",\"red\");\n drawPoints(\"inuvik\",\"orange\");\n drawPoints(\"clyde\",\"purple\"); \n}","show()\n{\n\t var theta = this.vel.heading() + radians(90);\n\t fill(100, 100);\n\t stroke(0);\n\t strokeWeight(1);\n\t push();\n\t translate(this.pos.x,this.pos.y);\n\t rotate(theta);\n\t beginShape();\n\t vertex(0, -this.r*2);\n\t vertex(-this.r, this.r*2);\n\t vertex(this.r, this.r*2);\n\t endShape(CLOSE);\n\t pop();\n}","function Sphere(radius){\n return -1;\n }","function drawShapes() {\n //reference methods: http://glmatrix.net/docs/module-mat4.html\n \n let teapotModelMatrix = glMatrix.mat4.create();\n let teapotColumnModelMatrix = glMatrix.mat4.create();\n let teapotTopModelMatrix = glMatrix.mat4.create();\n let teapotBaseModelMatrix = glMatrix.mat4.create();\n \n let sphereModelMatrix = glMatrix.mat4.create();\n let sphereColumnModelMatrix = glMatrix.mat4.create();\n let sphereTopModelMatrix = glMatrix.mat4.create();\n let sphereBaseModelMatrix = glMatrix.mat4.create();\n \n let coneModelMatrix = glMatrix.mat4.create();\n let coneColumnModelMatrix = glMatrix.mat4.create();\n let coneTopModelMatrix = glMatrix.mat4.create();\n let coneBaseModelMatrix = glMatrix.mat4.create();\n\n \n //*************************************************************************\n //Sphere-- change this orienation to influence the rest...\n transformMatrix(sphereModelMatrix, sphereModelMatrix, 't', 4, .8, 0, 0);\n transformMatrix(sphereModelMatrix, sphereModelMatrix, 's', 2, 2, 2, 0);\n transformMatrix(sphereModelMatrix, sphereModelMatrix, 'rx', 0, 0, 0, radians(-90) );\n gl.uniformMatrix4fv (program.uModelT, false, sphereModelMatrix);\n gl.bindVertexArray(mySphere.VAO);\n gl.drawElements(gl.TRIANGLES, mySphere.indices.length, gl.UNSIGNED_SHORT, 0);\n \n //Sphere Column\n transformMatrix( sphereModelMatrix, sphereColumnModelMatrix, 'rx', 0, 0, 0, radians(180) );\n transformMatrix( sphereColumnModelMatrix, sphereColumnModelMatrix, 't', 0, 0, 1.5, 0 );\n transformMatrix( sphereColumnModelMatrix, sphereColumnModelMatrix, 's', 1, 1, 2.05, 0 );\n gl.uniformMatrix4fv (program.uModelT, false, sphereColumnModelMatrix);\n gl.bindVertexArray(sphereColumn.VAO);\n gl.drawElements(gl.TRIANGLES, sphereColumn.indices.length, gl.UNSIGNED_SHORT, 0);\n \n //sphere Column Top\n transformMatrix( sphereModelMatrix, sphereTopModelMatrix, 'rx', 0, 0, 0, radians(180) );\n transformMatrix( sphereTopModelMatrix, sphereTopModelMatrix, 't', 0, 0, .5, 0 );\n transformMatrix( sphereTopModelMatrix, sphereTopModelMatrix, 's', 1.5, 1.5, .25, 0 );\n gl.uniformMatrix4fv (program.uModelT, false, sphereTopModelMatrix);\n gl.bindVertexArray(sphereTop.VAO);\n gl.drawElements(gl.TRIANGLES, sphereTop.indices.length, gl.UNSIGNED_SHORT, 0);\n \n //sphere Column Base\n transformMatrix( sphereModelMatrix, sphereBaseModelMatrix, 'rx', 0, 0, 0, radians(180) );\n transformMatrix( sphereBaseModelMatrix, sphereBaseModelMatrix, 't', 0, 0, 2.65, 0 );\n transformMatrix( sphereBaseModelMatrix, sphereBaseModelMatrix, 's', 1.5, 1.5, .25, 0 );\n gl.uniformMatrix4fv (program.uModelT, false, sphereBaseModelMatrix);\n gl.bindVertexArray(sphereBase.VAO);\n gl.drawElements(gl.TRIANGLES, sphereBase.indices.length, gl.UNSIGNED_SHORT, 0);\n //*************************************************************************\n \n \n //*************************************************************************\n //Teapot-- did not do anything remotely hierarchical, just eyeballed it\n transformMatrix( teapotModelMatrix, teapotModelMatrix, 'ry', 0, 0, 0, radians(180) );\n gl.uniformMatrix4fv (program.uModelT, false, teapotModelMatrix);\n gl.bindVertexArray(myTeapot.VAO);\n gl.drawElements(gl.TRIANGLES, myTeapot.indices.length, gl.UNSIGNED_SHORT, 0);\n \n //Teapot Column\n transformMatrix( teapotColumnModelMatrix, teapotColumnModelMatrix, 'rx', 0, 0, 0, radians(90) );\n transformMatrix( teapotColumnModelMatrix, teapotColumnModelMatrix, 't', 0, 0, 2.5, 0 );\n transformMatrix( teapotColumnModelMatrix, teapotColumnModelMatrix, 's', 2.2, 2.2, 4, 0 );\n gl.uniformMatrix4fv (program.uModelT, false, teapotColumnModelMatrix);\n gl.bindVertexArray(teapotColumn.VAO);\n gl.drawElements(gl.TRIANGLES, teapotColumn.indices.length, gl.UNSIGNED_SHORT, 0);\n \n //Teapot Column Base\n transformMatrix( teapotBaseModelMatrix, teapotBaseModelMatrix, 't', 0, -4.5, 0, 0);\n transformMatrix( teapotBaseModelMatrix, teapotBaseModelMatrix, 's', 3, .5, 3, 0 );\n gl.uniformMatrix4fv (program.uModelT, false, teapotBaseModelMatrix);\n gl.bindVertexArray(teapotBase.VAO);\n gl.drawElements(gl.TRIANGLES, teapotBase.indices.length, gl.UNSIGNED_SHORT, 0);\n \n //Teapot Column Top\n transformMatrix( teapotTopModelMatrix, teapotTopModelMatrix, 't', 0, -.25, 0, 0);\n transformMatrix( teapotTopModelMatrix, teapotTopModelMatrix, 's', 3, .5, 3, 0 );\n gl.uniformMatrix4fv (program.uModelT, false, teapotTopModelMatrix);\n gl.bindVertexArray(teapotTop.VAO);\n gl.drawElements(gl.TRIANGLES, teapotTop.indices.length, gl.UNSIGNED_SHORT, 0);\n //*************************************************************************\n \n \n //*************************************************************************\n //Cone-- change this orienation to influence the rest...\n transformMatrix(coneModelMatrix, coneModelMatrix, 't', -4, .8, 0, 0);\n transformMatrix(coneModelMatrix, coneModelMatrix, 's', 2, 2, 2, 0);\n transformMatrix(coneModelMatrix, coneModelMatrix, 'rx', 0, 0, 0, radians(-90) );\n gl.uniformMatrix4fv (program.uModelT, false, coneModelMatrix);\n gl.bindVertexArray(myCone.VAO);\n gl.drawElements(gl.TRIANGLES, myCone.indices.length, gl.UNSIGNED_SHORT, 0);\n \n //Cone Column\n transformMatrix( coneModelMatrix, coneColumnModelMatrix, 'rx', 0, 0, 0, radians(180) );\n transformMatrix( coneColumnModelMatrix, coneColumnModelMatrix, 't', 0, 0, 1.5, 0 );\n transformMatrix( coneColumnModelMatrix, coneColumnModelMatrix, 's', 1, 1, 2.05, 0 );\n gl.uniformMatrix4fv (program.uModelT, false, coneColumnModelMatrix);\n gl.bindVertexArray(coneColumn.VAO);\n gl.drawElements(gl.TRIANGLES, coneColumn.indices.length, gl.UNSIGNED_SHORT, 0);\n \n //Cone Column Top\n transformMatrix( coneModelMatrix, coneTopModelMatrix, 'rx', 0, 0, 0, radians(180) );\n transformMatrix( coneTopModelMatrix, coneTopModelMatrix, 't', 0, 0, .5, 0 );\n transformMatrix( coneTopModelMatrix, coneTopModelMatrix, 's', 1.5, 1.5, .25, 0 );\n gl.uniformMatrix4fv (program.uModelT, false, coneTopModelMatrix);\n gl.bindVertexArray(coneTop.VAO);\n gl.drawElements(gl.TRIANGLES, coneTop.indices.length, gl.UNSIGNED_SHORT, 0);\n \n //Cone Column Base\n transformMatrix( coneModelMatrix, coneBaseModelMatrix, 'rx', 0, 0, 0, radians(180) );\n transformMatrix( coneBaseModelMatrix, coneBaseModelMatrix, 't', 0, 0, 2.65, 0 );\n transformMatrix( coneBaseModelMatrix, coneBaseModelMatrix, 's', 1.5, 1.5, .25, 0 );\n gl.uniformMatrix4fv (program.uModelT, false, coneBaseModelMatrix);\n gl.bindVertexArray(coneBase.VAO);\n gl.drawElements(gl.TRIANGLES, coneBase.indices.length, gl.UNSIGNED_SHORT, 0);\n //*************************************************************************\n \n}","function init_latitude(gl) {\n let vertices = [];\n let color = [1, 0, 1];\n for (var i = 0; i <= 360; i += 10) {\n let j = (i * Math.PI) / 180;\n let vert = [0, R * Math.cos(j), R * Math.sin(j)]; // drawing a circle on the YZ plane\n vertices.push(vert[0], vert[1], vert[2]);\n vertices.push(color[0], color[1], color[2]);\n }\n\n let vao = gl.createVertexArray();\n gl.bindVertexArray(vao);\n let vbo = gl.createBuffer();\n\n gl.bindBuffer(gl.ARRAY_BUFFER, vbo);\n gl.bufferData(gl.ARRAY_BUFFER, new Float32Array(vertices), gl.STATIC_DRAW);\n\n // stride is 6, 3 for positions and 3 for the color\n gl.vertexAttribPointer(loc_aPosition, 3, gl.FLOAT, false, 4 * 6, 0); \n gl.enableVertexAttribArray(loc_aPosition);\n\n // stride is 6, offset in this case is 3 color elements are located after 3 position elements..\n gl.vertexAttribPointer(loc_aColor, 3, gl.FLOAT, false, 4 * 6, 4 * 3); \n gl.enableVertexAttribArray(loc_aColor);\n\n gl.bindVertexArray(null);\n gl.bindBuffer(gl.ARRAY_BUFFER, null);\n\n return { vao, n: vertices.length / 6 }; // since it has three coordinates and colors so devide by 6\n}","function Sphere( radius, segmentsY, segmentsX ) {\n Drawable.call( this );\n radius = radius || 1;\n\n segmentsY = segmentsY || 10;\n segmentsX = segmentsX || segmentsY;\n\n var R = radius;\n var p = segmentsY;\n var m = segmentsX;\n\n var model = {\n vertices: [],\n indices: []\n };\n \n var prev = function( x, m ) {\n if ( x === 0 ) {\n return ( m - 1 );\n }\n else {\n return ( x -1 );\n }\n };\n \n var y, x, z, r,cnt = 0, cnt2 = 0;\n for ( var i = 1; i < p-1; i++ ) { // end points are missing\n y = R*Math.sin( -Math.PI/2 + i*Math.PI/( p - 1 ) );\n r = R*Math.cos( -Math.PI/2 + i*Math.PI/( p - 1 ) );\n //console.log( \"y , r \" ,y, r );\n for ( var k = 0; k < m; k++ ) {\n x = r*Math.cos( 2*Math.PI*k/ m );\n z = r*Math.sin( 2*Math.PI*k/ m );\n //console.log( x, z );\n model.vertices[ cnt ] = x;\n model.vertices[ cnt+1 ] = y;\n model.vertices[ cnt+2 ] = z;\n cnt = cnt+3;\n }\n //make the triangle\n \n \n if ( i > 1 ) {\n var st = ( i - 2 )*m;\n for ( x = 0; x < m; x++ ) {\n model.indices[ cnt2 ] = st + x;\n model.indices[ cnt2+1 ] = st + prev( x, m ) + m;\n model.indices[ cnt2+2 ] = st + x + m;\n cnt2 += 3;\n \n model.indices[ cnt2 ] = st + x;\n model.indices[ cnt2+1 ] = st + prev( x, m );\n model.indices[ cnt2+2 ] = st + prev( x, m ) + m;\n cnt2 += 3;\n }\n }\n }\n \n model.vertices[ cnt ] = 0;\n model.vertices[ cnt+1 ] = -R;\n model.vertices[ cnt+2 ] = 0;\n var down = cnt/3;\n cnt += 3;\n model.vertices[ cnt ] = 0;\n model.vertices[ cnt+1 ] = R;\n model.vertices[ cnt+2 ] = 0;\n cnt += 3;\n \n var top = down + 1;\n for ( x = 0; x < m; x++ ) {\n model.indices[ cnt2 ] = down;\n model.indices[ cnt2+1 ] = prev( x, m );\n model.indices[ cnt2+2 ] = x;\n cnt2 += 3;\n \n model.indices[ cnt2 ] = down - m + x;\n model.indices[ cnt2+1 ] = down - m + prev( x, m );\n model.indices[ cnt2+2 ] = top;\n cnt2 +=3;\n }\n\n\n\n var vertices = new Buffer().setData( model.vertices );\n// uvcoords = new Buffer().setData( ret.uvcoords );\n// normals = new Buffer().setData( ret.normals );\n\n vertices = new VertexAttribute( 'Position' ).setBuffer( vertices );\n// uvcoords = new VertexAttribute( 'UVCoord' ).setBuffer( uvcoords ).setSize( 2 );\n// normals = new VertexAttribute( 'Normal' ).setBuffer( normals );\n\n var indices = new Buffer( Buffer.ELEMENT_BUFFER ).setData( model.indices );\n\n m = new Mesh();\n m.setVertexAttribute( vertices );\n// m.setVertexAttribute( normals );\n// m.setVertexAttribute( uvcoords );\n m.setIndexBuffer( indices );\n\n this.mesh = m;\n}","function drawPoleZeroPlot() {\n\n zPlaneContext.clearRect(0, 0, 275, 280);\n zPlaneContext.font = '12px Arial';\n\n // This helper function returns the pixel coordinates inside the $z$-plane canvas\n // for a complex number `z`.\n var coordinatesFromComplexNumber = function(z) {\n return {\n x: unitCircle.x + z.real * unitCircle.radius,\n y: unitCircle.y - z.imaginary * unitCircle.radius\n };\n };\n\n // This helper function is used to determine the multiplicity of poles or\n // zeros.\n var countMultiplicity = function(result, z) {\n var w = _.find(result, _.compose(_.partial(Complex.areEqual, z), function(w) { return w.z; }));\n if (w !== undefined) {\n w.multiplicity++;\n }\n else {\n result.push( { z: z, multiplicity: 1 });\n }\n return result;\n };\n\n // Draw a circle at each zero.\n var zerosToRender = _.reduce(filter.zeros, countMultiplicity, []);\n _.each(zerosToRender, function(zero) {\n zPlaneContext.beginPath();\n var p = coordinatesFromComplexNumber(zero.z);\n var radius = Complex.areEqual(zero.z, selection) ? 4.5 : 4.0;\n zPlaneContext.arc(p.x, p.y, radius, 0, 2 * Math.PI, false);\n zPlaneContext.strokeStyle = Complex.areEqual(zero.z, hover) ? '#00677e' : '#00374e';\n zPlaneContext.lineWidth = Complex.areEqual(zero.z, selection) ? 3.0 : 2.0;\n zPlaneContext.stroke();\n if (zero.multiplicity > 1) {\n zPlaneContext.fillText(zero.multiplicity, p.x + 5, p.y - 5);\n }\n });\n\n // Draw a cross at each pole.\n var polesToRender = _.reduce(filter.poles, countMultiplicity, []);\n _.each(polesToRender, function(pole) {\n zPlaneContext.beginPath();\n var p = coordinatesFromComplexNumber(pole.z);\n var radius = Complex.areEqual(pole.z, selection) ? 4.5 : 4.0;\n zPlaneContext.moveTo(p.x - radius, p.y + radius);\n zPlaneContext.lineTo(p.x + radius, p.y - radius);\n zPlaneContext.moveTo(p.x - radius, p.y - radius);\n zPlaneContext.lineTo(p.x + radius, p.y + radius);\n zPlaneContext.strokeStyle = Complex.areEqual(pole.z, hover) ? '#00677e' : '#00374e';\n zPlaneContext.lineWidth = Complex.areEqual(pole.z, selection) ? 3.0 : 2.0;\n zPlaneContext.stroke();\n if (pole.multiplicity > 1) {\n zPlaneContext.fillText(pole.multiplicity, p.x + 5, p.y - 5);\n }\n });\n }","function ParaGeometry(parameter,scale)\n{\n var x = parameter.x*UnitOf(parameter.lunit)*scale; \n\tvar y = parameter.y*UnitOf(parameter.lunit)*scale; \n\tvar z = parameter.z*UnitOf(parameter.lunit)*scale; \n\tvar alpha = parameter.alpha*UnitOf(parameter.aunit)/UnitOf('deg');\n\tvar theta = parameter.theta*UnitOf(parameter.aunit)/UnitOf('deg');\n\tvar phi = parameter.phi*UnitOf(parameter.aunit)/UnitOf('deg'); \n\n var fDx = x/2;\n var fDy = y/2;\n var fDz = z/2;\n \n alpha=Math.min(alpha,360);\n alpha=Math.PI*alpha/180;\n\n theta=Math.min(theta,360);\n theta=Math.PI*theta/180;\n\n phi=Math.min(phi,180);\n phi=Math.PI*phi/180;\n\n var fTalpha = Math.tan(alpha);\n var fTthetaCphi = Math.tan(theta)*Math.cos(phi);\n var fTthetaSphi = Math.tan(theta)*Math.sin(phi);\n\n \tvar geometry = new THREE.Geometry();\n\n geometry.vertices.push( new THREE.Vector3(-fDz*fTthetaCphi-fDy*fTalpha-fDx, -fDz*fTthetaSphi-fDy, -fDz));\n geometry.vertices.push( new THREE.Vector3(-fDz*fTthetaCphi-fDy*fTalpha+fDx, -fDz*fTthetaSphi-fDy, -fDz));\n geometry.vertices.push( new THREE.Vector3(-fDz*fTthetaCphi+fDy*fTalpha-fDx, -fDz*fTthetaSphi+fDy, -fDz));\n geometry.vertices.push( new THREE.Vector3(-fDz*fTthetaCphi+fDy*fTalpha+fDx, -fDz*fTthetaSphi+fDy, -fDz));\n geometry.vertices.push( new THREE.Vector3(+fDz*fTthetaCphi-fDy*fTalpha-fDx, +fDz*fTthetaSphi-fDy, +fDz));\n geometry.vertices.push( new THREE.Vector3(+fDz*fTthetaCphi-fDy*fTalpha+fDx, +fDz*fTthetaSphi-fDy, +fDz));\n geometry.vertices.push( new THREE.Vector3(+fDz*fTthetaCphi+fDy*fTalpha-fDx, +fDz*fTthetaSphi+fDy, +fDz));\n geometry.vertices.push( new THREE.Vector3(+fDz*fTthetaCphi+fDy*fTalpha+fDx, +fDz*fTthetaSphi+fDy, +fDz));\n\n geometry.faces.push( new THREE.Face3(0,2,1) );\n geometry.faces.push( new THREE.Face3(2,3,1) );\n\n geometry.faces.push( new THREE.Face3(4,5,6) );\n geometry.faces.push( new THREE.Face3(5,7,6) );\n\n geometry.faces.push( new THREE.Face3(0,1,4) );\n geometry.faces.push( new THREE.Face3(1,5,4) );\n\n geometry.faces.push( new THREE.Face3(2,6,7) );\n geometry.faces.push( new THREE.Face3(7,3,2) );\n\n geometry.faces.push( new THREE.Face3(0,4,2) );\n geometry.faces.push( new THREE.Face3(4,6,2) );\n\n geometry.faces.push( new THREE.Face3(1,3,7) );\n geometry.faces.push( new THREE.Face3(7,5,1) );\n\n return geometry;\n\n}","function testSphere(){\n \"use strict\";\n\n let testspheregeo = new THREE.SphereGeometry(1.0,24,24);\n let testspheremat = new THREE.MeshPhongMaterial( {color: new THREE.Color(0.1,0.3,0.1) } );\n let testsphere = new THREE.Mesh(testspheregeo, testspheremat);\n testsphere.position.set(2.0,3.0,5.0);\n testsphere.castShadow = true;\n scene.add(testsphere);\n\n testsphere.animate = function () { this.rotation.y -= 0.01; this.position.y+=0.01 * Math.sin(this.rotation.y); }\n animateobjects.push(testsphere);\n}","function draw() {\n \n\tvar red = 0; // Color value defined\n\tvar green = 1;\n\tvar blue = 2;\n\tvar alpha = 3;\n\n\tvar iter = 81;\n\n\tif(os){ // if oscillation is set true by oscillate(), then do oscilation of \n\t\t\t\t\t\t\t\t\t\t// julia set by using sin(angle) to set real c and cos(angle) to set imaginary c.\n\t\tcx =0.7885*cos(angle);\n\t\tcy =0.7785*sin(angle);\n\t\tangle+= 0.04;\n\t}\n\n\tvar zy = 0.0;\n\tvar zx = 0.0;\n\n loadPixels(); \n\n\n // Interate through the window demision. 'width' and 'hieght' are the with and height of our window\n for (var y = 0; y < height; y++) {\n\n for (var x = 0; x < width; x++) {\n\n\t zy = map(y, 0, height, min_i , max_i); // use map() to scale the range so it will be from \n\t\tzx = map(x, 0, width, minReal, maxReal); // minReal to maxReal and min_i to max_i\n\t\t\n\t\tif(!os && !clicked){ // if neither of 'os' or 'clicked' is true, cy and cx (real and imaginary c) will be the scale of zy and zx.\n\t\t\tcy = zy;\n\t\t\tcx = zx;\n\t\t}\n\t\t\n var counter= 0;\n\n\t\t// calculate the mandelbrot / julia set using:\n\t\t// mandelbrot: f(z) = z^2 + c where c is changing\n\t\t// julia: f(z) = z^2 + c where c is constant\n\t\twhile ((zx * zx + (zy * zy) < 16.0) && counter < iter) {\n\n\t\t\tvar zx_temp = zx * zx - zy * zy +cx\n\n\t\t\tzy = 2.0 * zx * zy+cy;\n\t\t\tzx = zx_temp;\n\n\t\t\t++counter;\n\t\t}\n\t\t\n\t var color = 255;\n\n\t\tif(counter !=iter){\n\t\t\tcolor = counter;\n\t\t}\n\n var pix = (x + y * width) * 4;\n\n pixels[pix + red] = sin(color)%255; // set pixels\n pixels[pix + green] = color;\n pixels[pix + blue] = color;\n\n pixels[pix+alpha] = 255;\n }\n }\n\n updatePixels(); \n}","render() {\n MapPlotter.setUpFilteringButtons();\n MapPlotter.readFiltersValues();\n\n MapPlotter.currentStateName = 'Texas';\n MapPlotter.drawRaceDoughnut();\n\n MapPlotter.drawMap();\n }","function Figure() {\n geometry = new THREE.ParametricGeometry(figureShoeSurface, 100, 100);\n geometry.center();\n}","function Figure() {\n geometry = new THREE.ParametricGeometry(figureShoeSurface, 100, 100);\n geometry.center();\n}","function drawQuarterSphere(radius, widthSegments, heightSegments, opacity, color, position, rotation){\n\tvar sphere = new THREE.SphereGeometry(radius, widthSegments, heightSegments, 0, Math.PI/2., 0, Math.PI/2.)\n\tvar circle1 = new THREE.CircleGeometry(radius, widthSegments, 0., Math.PI/2.)\n\tvar circle2 = new THREE.CircleGeometry(radius, widthSegments, 0., Math.PI/2.)\n\tvar circle3 = new THREE.CircleGeometry(radius, widthSegments, 0., Math.PI/2.)\n\n\tvar sphereMesh = new THREE.Mesh(sphere);\n\n\tvar circle1Mesh = new THREE.Mesh(circle1);\n\tcircle1Mesh.rotation.set(0, 0, Math.PI/2.);\n\n\tvar circle2Mesh = new THREE.Mesh(circle2);\n\tcircle2Mesh.rotation.set(Math.PI/2., 0, Math.PI/2.);\n\n\tvar circle3Mesh = new THREE.Mesh(circle3);\n\tcircle3Mesh.rotation.set(Math.PI/2., Math.PI/2., 0);\n\n\tvar singleGeometry = new THREE.Geometry();\n\n\tsphereMesh.updateMatrix(); // as needed\n\tsingleGeometry.merge(sphereMesh.geometry, sphereMesh.matrix);\n\n\tcircle1Mesh.updateMatrix(); // as needed\n\tsingleGeometry.merge(circle1Mesh.geometry, circle1Mesh.matrix);\n\n\tcircle2Mesh.updateMatrix(); // as needed\n\tsingleGeometry.merge(circle2Mesh.geometry, circle2Mesh.matrix);\n\n\tcircle3Mesh.updateMatrix(); // as needed\n\tsingleGeometry.merge(circle3Mesh.geometry, circle3Mesh.matrix);\n\n\tvar material = new THREE.MeshPhongMaterial( { \n\t\tcolor: color, \n\t\tflatShading: false, \n\t\ttransparent:true,\n\t\t//shininess:50,\n\t\topacity:opacity, \n\t\tside:THREE.DoubleSide,\n\t});\n\n\tvar mesh = new THREE.Mesh(singleGeometry, material);\n\tmesh.position.set(position.x, position.y, position.z);\n\tmesh.rotation.set(rotation.x, rotation.y, rotation.z);\n\tmesh.renderOrder = -1;\n\tparams.scene.add(mesh);\n\treturn mesh;\n\n}","function plotUlam(poses) {\n\t\t// Determine the bounds\n\t\tvar bounds = {\n\t\t\tx: {\n\t\t\t\tmin: 0,\n\t\t\t\tmax: 0\n\t\t\t},\n\t\t\ty: {\n\t\t\t\tmin: 0,\n\t\t\t\tmax: 0\n\t\t\t}\n\t\t};\n\t\t$$.each(poses, function(pos) {\n\t\t\tif (pos.x < bounds.x.min) {\n\t\t\t\tbounds.x.min = pos.x;\n\t\t\t}\n\t\t\tif (pos.x > bounds.x.max) {\n\t\t\t\tbounds.x.max = pos.x;\n\t\t\t}\n\t\t\tif (pos.y < bounds.y.min) {\n\t\t\t\tbounds.y.min = pos.y;\n\t\t\t}\n\t\t\tif (pos.y > bounds.y.max) {\n\t\t\t\tbounds.y.max = pos.y;\n\t\t\t}\n\t\t});\n\t\tvar matrix = $$.makeArray([bounds.y.max - bounds.y.min + 1, bounds.x.max - bounds.x.min + 1], \" \");\n\t\t$$.each(poses, function(pos) {\n\t\t\tvar x = pos.x - bounds.x.min,\n\t\t\t\ty = pos.y - bounds.y.min,\n\t\t\t\tstr = \"\" + pos.ix;\n\t\t\tif (matrix[y][x] != \" \") {\n\t\t\t\tthrow new Error(\"Over-writing something!\");\n\t\t\t}\n\t\t\tmatrix[y][x] = str.substr(str.length - 1);\n\t\t});\n\t\t$$.each(matrix, \"reverse\", function(line) {\n\t\t\tconsole.log(\" \" + line.join(\"\"));\n\t\t});\n\t}","function renderPolarGrid() {\n /*\n * Polar initialization\n */\n var xRadialTickMax = Math.max( Math.abs( xTickMin), Math.abs( xTickMax)),\n yRadialTickMax = Math.max( Math.abs( yTickMin), Math.abs( yTickMax)),\n radialTickMin = 1,\n radialTickMax = xRadialTickMax + yRadialTickMax,\n radialTickMaxSquare = xRadialTickMax * xRadialTickMax +\n yRadialTickMax * yRadialTickMax,\n gridRatio = renderAttrs.gridSpacing.y / renderAttrs.gridSpacing.x,\n isOriginVisibleInX = (xTickMin * xTickMax <= 0),\n isOriginVisibleInY = (yTickMin * yTickMax <= 0);\n \n // Set maximum of radial tick range for rendering\n while( radialTickMax * radialTickMax > radialTickMaxSquare) {\n --radialTickMax;\n }\n ++radialTickMax;\n \n // Set minimum of radial tick range for rendering\n if( !isOriginVisibleInX || !isOriginVisibleInY) {\n var xRadialTickMin = Math.min( Math.abs( xTickMin), Math.abs( xTickMax)),\n yRadialTickMin = Math.min( Math.abs( yTickMin), Math.abs( yTickMax));\n if( isOriginVisibleInX) {\n radialTickMin = yRadialTickMin;\n }\n else if( isOriginVisibleInY) {\n radialTickMin = xRadialTickMin;\n }\n else {\n // Origin not in X or Y range. Set radialTickMin from closest corner.\n var radialTickMinSquare = xRadialTickMin * xRadialTickMin +\n yRadialTickMin * yRadialTickMin;\n while( radialTickMin * radialTickMin <= radialTickMinSquare) {\n ++radialTickMin;\n }\n --radialTickMin;\n }\n }\n \n /*\n * Polar annular rendering\n */\n \n /**\n Draws an annulus of dots at 15-deg intervals.\n Based on RenderPolarGrid() in render_axis.c.\n Uses several closure variables:\n renderAttrs.radius -- the radius of the rendered dots\n renderAttrs.color -- the color of the rendered dots\n @param {Object} ctx -- the canvas context\n @param {Object} iOrigin -- the center of the annulus\n @param {Number} iRadius -- the { x, y } radius of the annulus\n */\n function renderAnnularDots(ctx, iOrigin, iRadius) {\n var latticePt, // index of 15-deg polar line (0..23)\n relativePt = { x: 0, y: 0 }, //\n dotRadius = renderAttrs.radius,\n // Lookup table so RenderPolarGrid can avoid using trig functions.\n // Each pair gives {cos,sin} values for 15-deg increments in Quadrant I.\n kCosSin15Deg = [\n { cos: 1.0, sin: 0.0 }, // 0 deg\n { cos: 0.96592582628907, sin: 0.25881904510252 }, // 15 deg\n { cos: 0.86602540378444, sin: 0.5 }, // 30 deg\n { cos: 0.70710678118655, sin: 0.70710678118655 }, // 45 deg\n { cos: 0.5, sin: 0.86602540378444 }, // 60 deg\n { cos: 0.25881904510252, sin: 0.96592582628907 }, // 75 deg\n { cos: 0.0, sin: 1.0 } // 90 deg\n ];\n \n ctx.fillStyle = renderAttrs.color;\n for( latticePt = 0; latticePt < 7; ++latticePt) {\n \n relativePt.x = iRadius.x * kCosSin15Deg[latticePt].cos;\n relativePt.y = iRadius.y * kCosSin15Deg[latticePt].sin;\n\n // Quadrant I\n drawCircleFill(ctx, { x: iOrigin.x + relativePt.x,\n y: iOrigin.y - relativePt.y }, dotRadius);\n // Quadrant II\n if( (latticePt > 0) && (latticePt < 6)) { // skip for axes\n drawCircleFill(ctx, { x: iOrigin.x - relativePt.x,\n y: iOrigin.y - relativePt.y }, dotRadius);\n }\n // Quadrant III\n drawCircleFill(ctx, { x: iOrigin.x - relativePt.x,\n y: iOrigin.y + relativePt.y }, dotRadius);\n // Quadrant IV\n if( (latticePt > 0) && (latticePt < 6)) { // skip for axes\n drawCircleFill(ctx, { x: iOrigin.x + relativePt.x,\n y: iOrigin.y + relativePt.y }, dotRadius);\n }\n }\n }\n \n // Draw annular gridlines or dots\n var renderFn = renderAttrs.grid === 'dotted'\n ? renderAnnularDots\n : drawEllipseFrame,\n i;\n for( i = 1; i <= radialTickMax; ++i) {\n var radius = { x: i * renderAttrs.gridSpacing.x,\n y: i * renderAttrs.gridSpacing.y };\n renderFn( ctx, renderAttrs.origin, radius);\n }\n \n /*\n * Polar radial rendering\n */\n \n /**\n Utility function for determining if a given radial line is visible\n given the origin placement within the canvas.\n Based on RenderPolarGrid() in render_axis.c.\n @param {Number} iTheta -- angle of the radial in radians\n @param {Array of Points} iPts -- Array of two { x, y } points\n defining the endpoints of the radial\n @param {String} iProp -- 'x' or 'y' for the coordinate to be checked\n @param {Object} iRange -- { min, max } values for the coordinate\n @returns {Boolean} True if the radial is visible and should\n be rendered, false otherwise.\n */\n function isRadialInRange( iTheta, iPts, iProp, iRange) {\n if( iTheta === 0.0) {\n return (iRange.min <= iPts[0][iProp]) && (iPts[0][iProp] <= iRange.max);\n }\n else if( iTheta > 0.0) {\n return iPts[0][iProp] > iRange.max\n ? iPts[1][iProp] <= iRange.max\n : iPts[0][iProp] >= iRange.min;\n }\n else if( iTheta < 0.0) {\n return iPts[0][iProp] < iRange.min\n ? iPts[1][iProp] >= iRange.min\n : iPts[0][iProp] <= iRange.max;\n }\n }\n \n // Draw radial gridlines\n if( renderAttrs.grid === 'gridlines') {\n var deltaTheta = Math.PI / 12.0, // increment by 15 deg\n theta0 = - 2.0 * deltaTheta, // start at -30 deg\n p0 = { x: renderAttrs.origin.x, y: renderAttrs.origin.y },\n p1 = { x: renderAttrs.origin.x, y: renderAttrs.origin.y },\n rp = [ { x: p0.x, y: p0.y }, { x: p1.x, y: p1.y } ],\n theta, tangent;\n\n // Render the radials from -30 deg to 30 deg.\n // These radials are clipped horizontally.\n p0 = { x: renderXMin - renderAttrs.origin.x,\n y: renderAttrs.origin.y };\n rp[0].x = renderXMin;\n p1.x = renderXMax - renderAttrs.origin.x;\n rp[1].x = renderXMax;\n\n for( i = 0; i < 5; ++i) {\n theta = theta0 + i * deltaTheta;\n tangent = - Math.tan( theta) * gridRatio;\n rp[0].y = renderAttrs.origin.y + p0.x * tangent;\n rp[1].y = renderAttrs.origin.y + p1.x * tangent;\n if( isRadialInRange( theta, rp, 'y',\n { min: renderYMin, max: renderYMax })) {\n drawLine( ctx, rp[0], rp[1]);\n }\n }\n \n // Render the radials from 45 deg to 135 deg.\n // Let theta be the complement of the desired angle, so that\n // we can still use tan() without dividing to find cotan().\n // These radials are clipped vertically.\n gridRatio = 1.0 / gridRatio;\n p0.y = renderYMin - renderAttrs.origin.y;\n rp[0].y = renderYMin;\n p1.y = renderYMax - renderAttrs.origin.y;\n rp[1].y = renderYMax;\n \n theta0 = 3 * deltaTheta; // start at 45 deg\n for( i = 0; i < 7; ++i) {\n theta = theta0 - i * deltaTheta;\n tangent = - Math.tan( theta) * gridRatio;\n rp[0].x = renderAttrs.origin.x + p0.y * tangent;\n rp[1].x = renderAttrs.origin.x + p1.y * tangent;\n if( isRadialInRange( theta, rp, 'x',\n { min: renderXMin, max: renderXMax })) {\n drawLine( ctx, rp[0], rp[1]);\n }\n }\n }\n }","function createSphere(radius, hlines, vlines, color) {\n var material = new THREE.MeshPhongMaterial();\n material.color = new THREE.Color(color);\n material.wireframe = false;\n material.shininess = 100;\n var geometry_sphere = new THREE.SphereGeometry(radius, hlines, vlines);\n var ball = new THREE.Mesh(geometry_sphere, material);\n return ball;\n}"],"string":"[\n \"function drawSphere(gl) {\\n\\tdrawCircle(gl);\\n\\tdrawMarks(gl);\\n}\",\n \"function drawSphere() {\\n setMV();\\n Sphere.draw();\\n}\",\n \"function drawSphere() {\\n setMV();\\n Sphere.draw();\\n}\",\n \"function spherical(cartesian) {\\n return [Object(__WEBPACK_IMPORTED_MODULE_1__math__[\\\"g\\\" /* atan2 */])(cartesian[1], cartesian[0]) * __WEBPACK_IMPORTED_MODULE_1__math__[\\\"j\\\" /* degrees */], Object(__WEBPACK_IMPORTED_MODULE_1__math__[\\\"e\\\" /* asin */])(Object(__WEBPACK_IMPORTED_MODULE_1__math__[\\\"q\\\" /* max */])(-1, Object(__WEBPACK_IMPORTED_MODULE_1__math__[\\\"r\\\" /* min */])(1, cartesian[2]))) * __WEBPACK_IMPORTED_MODULE_1__math__[\\\"j\\\" /* degrees */]];\\n}\",\n \"function spherical(cartesian) {\\n return [\\n Object(__WEBPACK_IMPORTED_MODULE_1__math__[\\\"g\\\" /* atan2 */])(cartesian[1], cartesian[0]) * __WEBPACK_IMPORTED_MODULE_1__math__[\\\"j\\\" /* degrees */],\\n Object(__WEBPACK_IMPORTED_MODULE_1__math__[\\\"e\\\" /* asin */])(Object(__WEBPACK_IMPORTED_MODULE_1__math__[\\\"q\\\" /* max */])(-1, Object(__WEBPACK_IMPORTED_MODULE_1__math__[\\\"r\\\" /* min */])(1, cartesian[2]))) * __WEBPACK_IMPORTED_MODULE_1__math__[\\\"j\\\" /* degrees */]\\n ];\\n}\",\n \"function Sphere1 (long, lat) {\\n\\n\\tthis.name = \\\"sphere1\\\";\\n\\n\\t// vertices definition\\n\\t////////////////////////////////////////////////////////////\\n\\n\\tthis.vertices = new Float32Array(3*((long-1)*(lat)+2));\\n\\n\\tvar radius = 1.0;\\n\\tvar p;\\n var t;\\n var p_step = Math.PI / long;\\n\\tvar t_step = 6.283185307179586476925286766559 / lat;\\n\\n\\tvar vertexoffset = 0;\\n // bottom vertex\\n this.vertices[vertexoffset] = 0.0;\\n this.vertices[vertexoffset+1] = -1.0;\\n this.vertices[vertexoffset+2] = 0.0;\\n vertexoffset += 3;\\n\\n // middle sphere\\n\\tfor (var i = 1; i < long; i++) {\\n p = p_step*i - Math.PI/2; //start from -pi/2 and go to pi/2 for longitude\\n //console.log(p);\\n for(var j = 0; j < lat; j++){\\n t = t_step*j;\\n //console.log(t);\\n this.vertices[vertexoffset] = Math.cos(p) * Math.sin(t);\\n //console.log(this.vertices[vertexoffset]);\\n \\t\\tthis.vertices[vertexoffset+1] = Math.sin(p);\\n //console.log(this.vertices[vertexoffset+1]);\\n \\t\\tthis.vertices[vertexoffset+2] = Math.cos(p) * Math.cos(t);\\n //console.log(this.vertices[vertexoffset+2]);\\n \\t\\tvertexoffset += 3;\\n }\\n\\t}\\n\\n // top vertex\\n this.vertices[vertexoffset] = 0.0;\\n this.vertices[vertexoffset+1] = 1.0;\\n this.vertices[vertexoffset+2] = 0.0;\\n vertexoffset += 3;\\n\\n var totalvertices = vertexoffset/3;\\n\\n\\t// triangles definition\\n\\t////////////////////////////////////////////////////////////\\n\\n\\tthis.triangleIndices = new Uint16Array(6*long*lat);\\n\\n\\tvar triangleoffset = 0;\\n // bottom of sphere\\n\\tfor (var i = 0; i < lat; i++)\\n\\t{\\n\\t\\tthis.triangleIndices[triangleoffset] = 0; //bottom vertex\\n\\t\\tthis.triangleIndices[triangleoffset+1] = i+1;//%totalvertices;\\n\\t\\tthis.triangleIndices[triangleoffset+2] = (i+1)%lat + 1;//%totalvertices;\\n\\t\\ttriangleoffset += 3;\\n\\t}\\n\\n //middle of sphere\\n\\tfor (var i = 0; i <= lat*(long-1); i++)\\n\\t{\\n if(i <= (lat)*(long-2)){\\n\\t\\t this.triangleIndices[triangleoffset] = i;\\n\\t\\t this.triangleIndices[triangleoffset+1] = i+1;\\n\\t\\t this.triangleIndices[triangleoffset+2] = i+lat;\\n\\t\\t triangleoffset += 3;\\n }\\n\\n if(i >= lat){\\n\\t\\t this.triangleIndices[triangleoffset] = i;\\n\\t\\t this.triangleIndices[triangleoffset+1] = i+1;\\n\\t\\t this.triangleIndices[triangleoffset+2] = i+1-lat;\\n\\t\\t triangleoffset += 3;\\n }\\n\\t}\\n\\n for (var i = 0; i < lat; i++)\\n\\t{\\n\\t\\tthis.triangleIndices[triangleoffset] = totalvertices-1; //bottom vertex\\n\\t\\tthis.triangleIndices[triangleoffset+1] = i+(lat)*(long-2);//%totalvertices;\\n\\t\\tthis.triangleIndices[triangleoffset+2] = i+1+(lat)*(long-2);//%totalvertices;\\n\\t\\ttriangleoffset += 3;\\n\\t}\\n\\n\\tthis.numVertices = this.vertices.length/3;\\n\\tthis.numTriangles = this.triangleIndices.length/3;\\n}\",\n \"function spherical(cartesian) {\\n return [\\n atan2(cartesian[1], cartesian[0]) * degrees,\\n asin(max(-1, min(1, cartesian[2]))) * degrees,\\n ];\\n}\",\n \"function phi() {\\n\\tvar xcoords = [];\\n\\tvar ycoords = [];\\n\\tvar turnFraction = (1 + Math.sqrt(5)) / 2;\\n\\tfor (var i = 0; i < maxIter; i++) {\\n\\t\\tvar dist = i*i / (maxIter - 1);\\n\\t\\tvar angle = 2 * Math.PI * turnFraction * i;\\n\\t\\tvar x = dist * Math.cos(angle);\\n\\t\\tvar y = dist * Math.sin(angle);\\n\\n\\t\\txcoords.push(x);\\n\\t\\tycoords.push(y);\\n\\t}\\n\\tvar data = {\\n\\t\\tx: xcoords,\\n\\t\\ty: ycoords,\\n\\t\\tmode: 'markers',\\n\\t\\ttype: 'scatter'\\n\\t}\\n\\treturn data;\\n}\",\n \"function generateSphere1(config) {\\n var scale, lats, longs, generateUVs;\\n scale = config.scale || 100;\\n lats = config.lats || 20;\\n longs = config.longs || 20;\\n generateUVs = config.generateUVs || false;\\n var points = [],\\n edges = [],\\n polys = [],\\n uvs = [];\\n for (let latNumber = 0; latNumber <= lats; ++latNumber) {\\n for (let longNumber = 0; longNumber <= longs; ++longNumber) {\\n var theta = latNumber * PI / lats;\\n var phi = longNumber * TAU / longs;\\n var sinTheta = sin(theta);\\n var sinPhi = sin(phi);\\n var cosTheta = cos(theta);\\n var cosPhi = cos(phi);\\n var x = cosPhi * sinTheta;\\n var y = cosTheta;\\n var z = sinPhi * sinTheta;\\n if (generateUVs) {\\n var u = longNumber / longs;\\n var v = latNumber / lats;\\n uvs.push({\\n u: u,\\n v: v\\n })\\n }\\n points.push({\\n x: scale * x,\\n y: scale * y,\\n z: scale * z\\n })\\n }\\n }\\n for (let latNumber = 0; latNumber < lats; ++latNumber) {\\n for (let longNumber = 0; longNumber < longs; ++longNumber) {\\n var first = (latNumber * (longs + 1)) + longNumber;\\n var second = first + longs + 1;\\n if (latNumber === 0) {\\n var p = [first + 1, second + 1, second];\\n if (generateUVs) {\\n p.uvs = [uvs[first + 1].u, uvs[first + 1].v, uvs[second + 1].u, uvs[second + 1].v, uvs[second].u, uvs[second].v]\\n }\\n polys.push(p);\\n edges.push({\\n a: first,\\n b: second\\n })\\n } else {\\n if (latNumber === lats - 1) {\\n let p = [first + 1, second, first];\\n if (generateUVs) {\\n p.uvs = [uvs[first + 1].u, uvs[first + 1].v, uvs[second].u, uvs[second].v, uvs[first].u, uvs[first].v]\\n }\\n polys.push(p);\\n edges.push({\\n a: first,\\n b: second\\n })\\n } else {\\n let p = [first + 1, second + 1, second, first];\\n if (generateUVs) {\\n p.uvs = [uvs[first + 1].u, uvs[first + 1].v, uvs[second + 1].u, uvs[second + 1].v, uvs[second].u, uvs[second].v, uvs[first].u, uvs[first].v]\\n }\\n polys.push(p);\\n edges.push({\\n a: first,\\n b: second\\n });\\n edges.push({\\n a: second,\\n b: second + 1\\n })\\n }\\n }\\n }\\n }\\n return {\\n points: points,\\n edges: edges,\\n polygons: polys\\n }\\n }\",\n \"function plotGraph() {\\n if (houses.data.length > 0) {\\n for (let i = 0; i < houses.data.length; i++) {\\n xs[i] = map(houses.data[i].inputs[0], 0, zoom, 0, wnx);\\n ys[i] = map(houses.data[i].inputs[1], 0, zoom, wny, 200);\\n cs[i] = houses.data[i].inputs[8];\\n ps[i] = houses.data[i].target[0];\\n }\\n }\\n}\",\n \"function spherical$1(cartesian) {\\n return [\\n atan2(cartesian[1], cartesian[0]) * degrees,\\n asin(max(-1, min(1, cartesian[2]))) * degrees\\n ];\\n}\",\n \"function apskritimoPlotas(spindulys) {\\n console.log('Apskritimo plotas');\\n return Math.PI * (spindulys ** 2);\\n}\",\n \"function drawSpheres() {\\n \\\"use strict\\\";\\n var cuboids = new THREE.Group();\\n\\n var geometry = new THREE.SphereBufferGeometry(GRID_WIDTH / 2);\\n geometry.addAttribute('lightPos', POINT_LIGHT_POSITIONS.GPUBuffer);\\n var gridPosition = new GridPosition(0,0,0);\\n SPHERES_POSITIONS.forEach(function(item) {\\n var material;\\n // The color attribute of the material must be assigned in the constructor parameters.\\n switch (shadingMethod) {\\n case GOURAUD_SHADING:\\n material = new THREE.MeshLambertMaterial({color: getRandColor(), side: THREE.FrontSide});\\n break;\\n case PHONG_SHADING:\\n material = chooseShading();\\n break;\\n }\\n var cuboid = new THREE.Mesh(geometry, material);\\n cuboid.position.copy(gridPosition.setPosition(item[0], item[1], item[2]).getVector3());\\n cuboid.matrixAutoUpdate = true;\\n cuboids.add(cuboid);\\n });\\n\\n scene.add(cuboids);\\n}\",\n \"function drawSphere(color) {\\r\\n mvMatrix = mult(mvMatrix, scalem(0.75, 0.75, 0.75)); // Scale the sphere since it is a little big\\r\\n gl.uniformMatrix4fv(modelView, false, flatten(mvMatrix));\\r\\n\\tsetDiffuse(color);\\r\\n for (var i = cubePoints.length; i < cubePoints.length + spherePoints.length; i += 3) {\\r\\n gl.drawArrays(gl.TRIANGLES, i, 3);\\r\\n }\\r\\n}\",\n \"function sphere() {\\n var c = 2 * asin(1 / sqrt(5)) * degrees;\\n return {\\n type: \\\"Polygon\\\",\\n coordinates: [\\n [[0, 90], [-180, -c + epsilon], [0, -90], [180, -c + epsilon], [0, 90]]\\n ]\\n };\\n}\",\n \"function sinusoidalZoom(min, max) {\\n delta = clock.getDelta();\\n theta += delta * 0.2;\\n //theta += 0.01;\\n camera.position.z = Math.abs((max-min)*Math.sin(theta))+min;\\n}\",\n \"function drawSphere (rex,yon) {\\n\\t\\tconsole.log(\\\"call Me\\\");\\n\\t\\t//debugger; \\n var waxBall = new DoodleImage({\\n src: \\\"elect.png\\\",\\n left: rex,\\n top: yon,\\n width: 250,\\n height: 50\\n });\\n draw(waxBall);\\n\\n }\",\n \"function OnDrawGizmos()\\n{\\n\\tGizmos.color = Color.green;\\n\\tGizmos.DrawSphere(transform.position + laneStart, 0.2);\\n\\t\\n\\tGizmos.color = Color.red;\\n\\tGizmos.DrawSphere(transform.position + laneEnd, 0.2);\\n}\",\n \"function Sphere(radius, colorMapURLs, specularMapURL, shininess, animation, lighting) {\\n var bands = 30, \\n vertices = [], \\n normals = [], \\n textureCoord = [];\\n\\n // latitudes\\n for (var slice = 0; slice <= bands; slice++) {\\n var theta = slice * Math.PI / bands,\\n sinTheta = Math.sin(theta),\\n cosTheta = Math.cos(theta);\\n\\n // longitudes\\n for (var arc = 0; arc <= bands; arc++) {\\n var phi = arc * 2 * Math.PI / bands,\\n sinPhi = Math.sin(phi),\\n cosPhi = Math.cos(phi);\\n\\n var x = cosPhi * sinTheta,\\n y = cosTheta,\\n z = sinPhi * sinTheta,\\n u = 1 - (arc / bands),\\n v = 1 - (slice / bands);\\n\\n vertices.push(radius * x, radius * y, radius * z);\\n textureCoord.push(u, v);\\n normals.push(x, y, z);\\n }\\n }\\n\\n var vertexIndices = [];\\n for (var slice = 0; slice < bands; slice++) {\\n for (var arc = 0; arc < bands; arc++) {\\n var first = (slice * (bands + 1)) + arc,\\n second = first + bands + 1;\\n\\n vertexIndices.push(first, second, first + 1, second, second + 1, first + 1);\\n }\\n }\\n\\n ItemElements.call(this, vertices, vertexIndices, normals, textureCoord, colorMapURLs, \\n specularMapURL, shininess, animation, lighting);\\n}\",\n \"plot() {\\n return \\\"Cute alien takes over the earth\\\";\\n }\",\n \"function hemisphere2PolarHemisphere(x, y, z) {\\n // xy fisheye 直交座標系 + 高さ\\b z で表された 半径 r の半球上の座標を lθ+z 半球極座標系へ変換する\\n var l = Math.sqrt(Math.pow(x, 2) + Math.pow(y, 2));\\n var theta = Math.atan2(y, x);\\n return { l: l, theta: theta, z: z };\\n}\",\n \"function generateSphere(subdiv, color, array) {\\n\\n var step = (360.0 / subdiv) * (Math.PI / 180.0); //how much do we increase the angles by per triangle\\n\\n for (var lat = 0; lat <= Math.PI; lat += step) { //latitude\\n for (var lon = 0; lon + step <= 2 * Math.PI; lon += step) { //longitude\\n //triangle 1\\n array.push(vec4(Math.sin(lat) * Math.cos(lon), Math.sin(lon) * Math.sin(lat), Math.cos(lat), 1.0)); //position\\n array.push(color); //color\\n array.push(vec4(Math.sin(lat) * Math.cos(lon), Math.sin(lon) * Math.sin(lat), Math.cos(lat), 0.0)); //normal\\n array.push(vec4(Math.sin(lat) * Math.cos(lon + step), Math.sin(lat) * Math.sin(lon + step), Math.cos(lat), 1.0)); //position\\n array.push(color); //color\\n array.push(vec4(Math.sin(lat) * Math.cos(lon+step), Math.sin(lat) * Math.sin(lon+step), Math.cos(lat), 0.0)); //normal\\n array.push(vec4(Math.sin(lat + step) * Math.cos(lon + step), Math.sin(lon + step) * Math.sin(lat + step), Math.cos(lat + step), 1.0)); //etc\\n array.push(color); //color\\n array.push(vec4(Math.sin(lat+step) * Math.cos(lon+step), Math.sin(lon+step) * Math.sin(lat+step), Math.cos(lat+step), 0.0));//normal\\n\\n //triangle 2\\n array.push(vec4(Math.sin(lat + step) * Math.cos(lon + step), Math.sin(lon + step) * Math.sin(lat + step), Math.cos(lat + step), 1.0));\\n array.push(color); //color\\n array.push(vec4(Math.sin(lat+step) * Math.cos(lon+step), Math.sin(lon+step) * Math.sin(lat+step), Math.cos(lat+step), 0.0));//normal\\n array.push(vec4(Math.sin(lat + step) * Math.cos(lon), Math.sin(lat + step) * Math.sin(lon), Math.cos(lat + step), 1.0));\\n array.push(color); //color\\n array.push(vec4(Math.sin(lat+step) * Math.cos(lon), Math.sin(lat+step) * Math.sin(lon), Math.cos(lat+step),0.0));//normal\\n array.push(vec4(Math.sin (lat) * Math.cos(lon), Math.sin(lon) * Math.sin(lat), Math.cos(lat), 1.0));\\n array.push(color); //color\\n array.push(vec4(Math.sin(lat) * Math.cos(lon), Math.sin(lon) * Math.sin(lat), Math.cos(lat), 0.0));//normal\\n\\n if(array === cart) {\\n cartVertices += 6;\\n } else if (array === lightGlobe) {\\n lightVerts += 6;\\n } else if (array === alphaSpheres) {\\n alphaSphereVertices += 6;\\n }\\n }\\n }\\n}\",\n \"function makeSphere(ctx, radius, lats, longs) {\\n var geometryData = [];\\n var normalData = [];\\n var texCoordData = [];\\n var indexData = [];\\n var latNumber;\\n var longNumber;\\n for (latNumber = 0; latNumber <= lats; ++latNumber) {\\n for (longNumber = 0; longNumber <= longs; ++longNumber) {\\n var theta = latNumber * Math.PI / lats;\\n var phi = longNumber * 2 * Math.PI / longs;\\n var sinTheta = Math.sin(theta);\\n var sinPhi = Math.sin(phi);\\n var cosTheta = Math.cos(theta);\\n var cosPhi = Math.cos(phi);\\n var x = cosPhi * sinTheta;\\n var y = cosTheta;\\n var z = sinPhi * sinTheta;\\n var u = 1 - (longNumber / longs);\\n var v = latNumber / lats;\\n normalData.push(x);\\n normalData.push(y);\\n normalData.push(z);\\n texCoordData.push(u);\\n texCoordData.push(v);\\n geometryData.push(radius * x);\\n geometryData.push(radius * y);\\n geometryData.push(radius * z);\\n }\\n }\\n for (latNumber = 0; latNumber < lats; ++latNumber) {\\n for (longNumber = 0; longNumber < longs; ++longNumber) {\\n var first = (latNumber * (longs + 1)) + longNumber;\\n var second = first + longs + 1;\\n indexData.push(first);\\n indexData.push(second);\\n indexData.push(first + 1);\\n indexData.push(second);\\n indexData.push(second + 1);\\n indexData.push(first + 1);\\n }\\n }\\n // FIXME: What I don't like about this is the coupling of the geometry to the WebGL buffering.\\n var normalBuffer = ctx.createBuffer();\\n ctx.bindBuffer(ctx.ARRAY_BUFFER, normalBuffer);\\n ctx.bufferData(ctx.ARRAY_BUFFER, new Float32Array(normalData), ctx.STATIC_DRAW);\\n var texCoordBuffer = ctx.createBuffer();\\n ctx.bindBuffer(ctx.ARRAY_BUFFER, texCoordBuffer);\\n ctx.bufferData(ctx.ARRAY_BUFFER, new Float32Array(texCoordData), ctx.STATIC_DRAW);\\n var vertexBuffer = ctx.createBuffer();\\n ctx.bindBuffer(ctx.ARRAY_BUFFER, vertexBuffer);\\n ctx.bufferData(ctx.ARRAY_BUFFER, new Float32Array(geometryData), ctx.STATIC_DRAW);\\n var numIndices = indexData.length;\\n var indexBuffer = ctx.createBuffer();\\n ctx.bindBuffer(ctx.ELEMENT_ARRAY_BUFFER, indexBuffer);\\n ctx.bufferData(ctx.ELEMENT_ARRAY_BUFFER, new Uint16Array(indexData), ctx.STREAM_DRAW);\\n var self = {\\n get normalBuffer() {\\n return normalBuffer;\\n },\\n get texCoordBuffer() {\\n return texCoordBuffer;\\n },\\n get vertexBuffer() {\\n return vertexBuffer;\\n },\\n get indexBuffer() {\\n return indexBuffer;\\n },\\n get numIndices() {\\n return numIndices;\\n }\\n };\\n return self;\\n }\",\n \"function sphericalToCartesian( r, a, e ) {\\n var x = r * Math.cos(e) * Math.cos(a);\\n var y = r * Math.sin(e);\\n var z = r * Math.cos(e) * Math.sin(a);\\n\\n return [x,y,z];\\n }\",\n \"show() {\\n fill(255);\\n noStroke();\\n let sx = map(this.x/this.z, 0, 1, 0, width);\\n let sy = map(this.y/this.z, 0, 1, 0, height);\\n let r = map(this.z, 0, width, 8, 0);\\n //ellipse(sx, sy, r, r);\\n stroke(255);\\n let px = map(this.x/this.pz, 0, 1, 0, width);\\n let py = map(this.y/this.pz, 0, 1, 0, height);\\n line(px,py, sx, sy);\\n this.pz = this.z;\\n }\",\n \"function _drawSphere(pos, r, color) {\\n var p = new Primitive();\\n p.color = toColor(color);\\n\\n // Decreasing these angles will increase complexity of sphere.\\n var dtheta = 35; var dphi = 35;\\n\\n for (var theta = -90; theta <= (90 - dtheta); theta += dtheta) {\\n for (var phi = 0; phi <= (360 - dphi); phi += dphi) {\\n p.vertices.push(new THREE.Vector3(\\n pos.x + r * Math.cos(theta * DEG_TO_RAD) * Math.cos(phi * DEG_TO_RAD),\\n pos.y + r * Math.cos(theta * DEG_TO_RAD) * Math.sin(phi * DEG_TO_RAD),\\n pos.z + r * Math.sin(theta * DEG_TO_RAD)\\n ));\\n\\n p.vertices.push(new THREE.Vector3(\\n pos.x + r * Math.cos((theta + dtheta) * DEG_TO_RAD) * Math.cos(phi * DEG_TO_RAD),\\n pos.y + r * Math.cos((theta + dtheta) * DEG_TO_RAD) * Math.sin(phi * DEG_TO_RAD),\\n pos.z + r * Math.sin((theta + dtheta) * DEG_TO_RAD)\\n ));\\n\\n p.vertices.push(new THREE.Vector3(\\n pos.x + r * Math.cos((theta + dtheta) * DEG_TO_RAD) * Math.cos((phi + dphi) * DEG_TO_RAD),\\n pos.y + r * Math.cos((theta + dtheta) * DEG_TO_RAD) * Math.sin((phi + dphi) * DEG_TO_RAD),\\n pos.z + r * Math.sin((theta + dtheta) * DEG_TO_RAD)\\n ));\\n\\n if ((theta > -90) && (theta < 90)) {\\n p.vertices.push(new THREE.Vector3(\\n pos.x + r * Math.cos(theta * DEG_TO_RAD) * Math.cos((phi + dphi) * DEG_TO_RAD),\\n pos.y + r * Math.cos(theta * DEG_TO_RAD) * Math.sin((phi + dphi) * DEG_TO_RAD),\\n pos.z + r * Math.sin(theta * DEG_TO_RAD)\\n ));\\n }\\n }\\n }\\n\\n renderer.addPrimitive(p);\\n }\",\n \"function SphericalHarmonics(numBands, numSamples)\\n{\\n this.numBands = numBands;\\n this.numSamplesSqrt = parseInt(math.sqrt(numSamples));\\n this.numSamples = this.numSamplesSqrt * this.numSamplesSqrt;\\n this.numCoeffs = numBands * numBands;\\n this.samples = [];\\n this.coeffs = [];\\n for (var i = 0; i < this.numCoeffs; ++i) {\\n this.coeffs.push([0, 0, 0]);\\n }\\n this.scaleMatrix = []; // used to scale the coefficients\\n // store (l,m) values, useful for looping\\n this.lmPairs = [];\\n for(var l=0; l<this.numBands; ++l) {\\n for(var m=-l; m<=l; ++m) {\\n var ci = l * (l+1) + m; // coefficient index\\n this.lmPairs[ci] = [l, m];\\n }\\n }\\n this.setupSphericalSamples();\\n}\",\n \"function d3f_geo_cartesian(spherical) {\\n var λ = spherical[0],\\n φ = spherical[1],\\n cosφ = Math.cos(φ);\\n return [\\n cosφ * Math.cos(λ),\\n cosφ * Math.sin(λ),\\n Math.sin(φ)\\n ];\\n}\",\n \"function createSphere() {\\n var geometry = new THREE.Geometry({\\n colorsNeedUpdate : true\\n }); // define a blank geometry\\n var material = new THREE.MeshBasicMaterial(\\n {\\n transparency: true,\\n opacity: 1.0,\\n wireframeLinewidth: 0.5,\\n color: 0x444444\\n }\\n );\\n material.wireframe = true;\\n\\n sphere_radius_3D_S = 60; // test value\\n sphere_wSegs_3D_S = 60; // test value 纬带数(纬线数+1)\\n sphere_hSegs_3D_S = 60; // test value 经带数\\n\\n // 【生成所有顶点位置】 latNumber:纬线计数器\\n var totalVertex = (sphere_wSegs_3D_S+1)*(sphere_hSegs_3D_S+1);\\n for (var latNumber=0; latNumber<=sphere_wSegs_3D_S; latNumber++) {\\n var theta = latNumber * Math.PI / sphere_wSegs_3D_S;\\n var sinTheta = Math.sin(theta);\\n var cosTheta = Math.cos(theta);\\n for (var longNumber=0; longNumber<=sphere_hSegs_3D_S; longNumber++) {\\n var phi = longNumber * 2 * Math.PI / sphere_hSegs_3D_S;\\n var sinPhi = Math.sin(phi);\\n var cosPhi = Math.cos(phi);\\n // 球坐标系映射到xyz\\n var x = sphere_radius_3D_S * sinTheta * cosPhi;\\n var y = sphere_radius_3D_S * sinTheta * sinPhi;\\n var z = sphere_radius_3D_S * cosTheta;\\n var p = new THREE.Vector3(x, y, z);\\n geometry.vertices.push(p);\\n }\\n }\\n // 为了把这些顶点缝合到一起，需要【建立三角面片索引列表】\\n var indexData = [];\\n for (var latNumber = 0; latNumber < sphere_wSegs_3D_S; latNumber++) {\\n for (var longNumber = 0; longNumber < sphere_hSegs_3D_S; longNumber++) {\\n var first = (latNumber * (sphere_hSegs_3D_S + 1)) + longNumber;\\n var second = first + sphere_hSegs_3D_S + 1;\\n indexData.push(first);\\n indexData.push(second);\\n indexData.push(first + 1);\\n indexData.push(second);\\n indexData.push(second + 1);\\n indexData.push(first + 1);\\n // 测试用：调整了顶点顺序\\n // indexData.push(first + 1);\\n // indexData.push(second);\\n // indexData.push(second + 1);\\n }\\n }\\n // create faces\\n for (var vertexCounter = 0; vertexCounter<indexData.length; vertexCounter+=3) {\\n // var face = new THREE.Face3(\\n // indexData[vertexCounter],\\n // indexData[vertexCounter+1],\\n // indexData[vertexCounter+2]\\n // );\\n var index1 = indexData[vertexCounter];\\n var index2 = indexData[vertexCounter+1];\\n var index3 = indexData[vertexCounter+2];\\n var face = new THREE.Face3(\\n index1,\\n index2,\\n index3\\n );\\n\\n //着色方案1：仅用三种颜色测试\\n // var color1 = findColor2(index1);//顶点1颜色\\n // var color2 = findColor2(index2);//顶点2颜色\\n // var color3 = findColor2(index3);//顶点3颜色\\n\\n // 着色方案2：灰度→彩色映射\\n // 尚未测试\\n // var color1 = trans_R( gray_scale(index1,totalVertex) );\\n // var color2 = trans_G( gray_scale(index2,totalVertex) );\\n // var color3 = trans_B( gray_scale(index3,totalVertex) );\\n\\n // 着色方案3：随机颜色\\n // var color1 = new THREE.Color(0xFFFFFF * Math.random());//顶点1颜色——红色\\n // var color2 = new THREE.Color(0xFFFFFF * Math.random());//顶点2颜色——绿色\\n // var color3 = new THREE.Color(0xFFFFFF * Math.random());//顶点3颜色——蓝色\\n // var color1 = new THREE.Color(getColor());//顶点1颜色——红色 产生随机色の方法2\\n // var color2 = new THREE.Color(getColor());//顶点2颜色——绿色\\n // var color3 = new THREE.Color(getColor());//顶点3颜色——蓝色\\n\\n // 着色方案4：随顶点索引数规律变化\\n var color1 = findColor(index1,totalVertex);//顶点1颜色——红色\\n var color2 = findColor(index2,totalVertex);//顶点2颜色——绿色\\n var color3 = findColor(index3,totalVertex);//顶点3颜色——蓝色\\n\\n face.vertexColors.push(color1, color2, color3);//定义三角面三个顶点的颜色\\n geometry.faces.push(face);\\n }\\n\\n sphmat_3D_S=new THREE.MeshBasicMaterial({\\n vertexColors: THREE.VertexColors,//以顶点颜色为准\\n //vertexColors: geometry.colors,//以顶点颜色为准\\n side: THREE.DoubleSide,//两面可见\\n transparent: true,\\n opacity: 1.0\\n });//材质对象\\n\\n // create sphere and add it to scene\\n sphere_3D_S = new THREE.Mesh(geometry,sphmat_3D_S);//网格模型对象\\n scene_3D_S.add(sphere_3D_S); //网格模型添加到场景中\\n}\",\n \"function sphere(nameOrM,radius,_boundNum,c1,c_2) {\\n var c2 = c_2|| c1;\\n\\n var transform = new Transform();\\n if (nameOrM[0]) scene.new_Part(nameOrM[1]);\\n else transform = nameOrM[1];\\n var ts = transform.get_Trans();\\n var tn = transform.get_Tnorm();\\n var index = scene.get_Indexbase();\\n\\n for(var i=0;i<=_boundNum; i++){\\n var lat = i*Math.PI/_boundNum-Math.PI/2;\\n if(i==0) lat+=0.001; if(i==_boundNum) lat-=0.001;\\n var col = MyGradient(c1,c2,i,_boundNum+1);\\n\\n for(var j=0;j<=_boundNum; j++){\\n var lon = j*2*Math.PI/_boundNum-Math.PI;\\n var x = radius*Math.cos(lat)*Math.cos(lon);\\n var z = radius*Math.cos(lat)*Math.sin(lon);\\n var y = radius*Math.sin(lat);\\n var poi = [x,y,z];\\n scene.append_VBuffer([m4.transformPoint(ts,poi), col, m4.transformPoint(tn,poi)]);\\n }\\n }\\n for(var i=0;i<_boundNum; i++) {\\n for (var j = 0; j < _boundNum; j++) {\\n var lu = index + i * (_boundNum + 1) + j;\\n var ld = lu + _boundNum + 1;\\n scene.append_IBuffer([lu, ld + 1, lu + 1, lu, ld, ld + 1]);\\n }\\n }\\n }\",\n \"function displaySymmetryDrawObjects(symop){\\r\\n\\tvar symOffsetString = _file.symmetry.symOffset;\\r\\n\\tsymOffsetString = symOffsetString.substring(1);\\r\\n\\tvar symOffsetArray = symOffsetString.split(\\\",\\\");\\r\\n\\tvar xOffsetValue = parseInt(symOffsetArray[0])+\\\"/1\\\";\\r\\n\\tvar yOffsetValue = parseInt(symOffsetArray[1])+\\\"/1\\\";\\r\\n\\tvar zOffsetValue = parseInt(symOffsetArray[2])+\\\"/1\\\";\\r\\n\\tvar symopString = \\\"\\\"+symop+\\\"\\\";\\r\\n\\tvar symopArray = symopString.split(\\\",\\\");\\r\\n\\tconsole.log(symopArray)\\r\\n\\tvar xSymopValue = symopArray[0];\\r\\n\\tvar ySymopValue = symopArray[1];\\r\\n\\tvar zSymopValue = symopArray[2];\\r\\n\\tsymopWithOffset = xSymopValue+\\\"+\\\"+xOffsetValue+\\\",\\\"+ySymopValue+\\\"+\\\"+yOffsetValue+\\\",\\\"+zSymopValue+\\\"+\\\"+zOffsetValue\\r\\n\\trunJmolScriptWait(\\\"draw symop '\\\"+symopWithOffset+\\\"'\\\");\\r\\n\\taxisFactor = 3;\\r\\n\\trunJmolScriptWait(\\\"drawCleanSymmetryAxisVectors(\\\"+axisFactor+\\\")\\\");\\r\\n}\",\n \"function new_sphere (x, y, z, radius, dr, dg, db, k_ambient, k_specular, specular_pow) {\\r\\n append(shapes, new Sphere(x, y, z, radius, dr, dg, db, k_ambient, k_specular, specular_pow));\\r\\n}\",\n \"function SphereSubdiv (s) {\\r\\n this.name = \\\"sphere\\\";\\r\\n\\r\\n var vertices = [\\r\\n 1.0, 0.0, 0.0,\\r\\n 0.0, 1.0, 0.0,\\r\\n -1.0, 0.0, 0.0,\\r\\n 0.0, -1.0, 0.0,\\r\\n 0.0, 0.0, 1.0,\\r\\n 0.0, 0.0, -1.0\\r\\n ];\\r\\n var indices = [\\r\\n /* 0, 1, 4,\\r\\n 0, 1, 5,\\r\\n 1, 2, 4,\\r\\n 1, 2, 5,\\r\\n 2, 3, 4,\\r\\n 2, 3, 5,\\r\\n 3, 0, 4,//*/\\r\\n 3, 0, 5\\r\\n ];\\r\\n\\r\\n for (var i = 0; i<s; i++){\\r\\n var newIndices = []\\r\\n\\r\\n let vertexCount = vertices.length/3;\\r\\n\\r\\n var midpoints = new Array(vertexCount).fill(0).map(row => new Array(vertexCount).fill(-1)); \\r\\n for (var face = 0; face<indices.length/3; face++){\\r\\n let f = face*3;\\r\\n let a = indices[f];\\r\\n let b = indices[f+1];\\r\\n let c = indices[f+2];\\r\\n let ax = vertices[a*3];\\r\\n let ay = vertices[a*3+1];\\r\\n let az = vertices[a*3+2];\\r\\n let bx = vertices[b*3];\\r\\n let by = vertices[b*3+1];\\r\\n let bz = vertices[b*3+2];\\r\\n let cx = vertices[c*3];\\r\\n let cy = vertices[c*3+1];\\r\\n let cz = vertices[c*3+2];\\r\\n\\r\\n // Find (mx, my, mz), (nx, ny, nz), (px, py, pz) -- centers of segments\\r\\n var m = midpoints[a][b];\\r\\n if(m==-1){\\r\\n var x = (ax+bx)/2;\\r\\n var y = (ay+by)/2;\\r\\n var z = (az+bz)/2;\\r\\n let l = Math.sqrt(x*x + y*y + z*z);\\r\\n x/=l;\\r\\n y/=l;\\r\\n z/=l;\\r\\n m = vertices.length/3; // The index of the new point\\r\\n vertices = vertices.concat([x, y, z]);\\r\\n midpoints[a][b] = m;\\r\\n midpoints[b][a] = m;\\r\\n }\\r\\n var n = midpoints[a][c];\\r\\n if(n==-1){\\r\\n var x = (ax+cx)/2;\\r\\n var y = (ay+cy)/2;\\r\\n var z = (az+cz)/2;\\r\\n let l = Math.sqrt(x*x + y*y + z*z);\\r\\n x/=l;\\r\\n y/=l;\\r\\n z/=l;\\r\\n n = vertices.length/3; // The index of the new point\\r\\n vertices = vertices.concat([x, y, z]);\\r\\n midpoints[a][c] = n;\\r\\n midpoints[c][a] = n;\\r\\n }\\r\\n var p = midpoints[c][b];\\r\\n if(p==-1){\\r\\n var x = (cx+bx)/2;\\r\\n var y = (cy+by)/2;\\r\\n var z = (cz+bz)/2;\\r\\n let l = Math.sqrt(x*x + y*y + z*z);\\r\\n x/=l;\\r\\n y/=l;\\r\\n z/=l;\\r\\n p = vertices.length/3; // The index of the new point\\r\\n vertices = vertices.concat([x, y, z]);\\r\\n midpoints[c][b] = p;\\r\\n midpoints[b][c] = p;\\r\\n }\\r\\n\\r\\n newIndices = newIndices.concat([\\r\\n m, a, n,\\r\\n m, b, p,\\r\\n n, c, p,\\r\\n m, n, p\\r\\n ]);\\r\\n }\\r\\n indices = newIndices;\\r\\n }\\r\\n\\r\\n // Mirror around x\\r\\n var mirrorStart = vertices.length;\\r\\n vertices = vertices.concat(vertices);\\r\\n for(var i = mirrorStart; i<vertices.length; i+=3){\\r\\n vertices[i] = -vertices[i];\\r\\n }\\r\\n var mirrorFacesStart = indices.length;\\r\\n indices = indices.concat(indices);\\r\\n for (var i = mirrorFacesStart; i<indices.length; i++){\\r\\n indices[i]+=mirrorStart/3;\\r\\n }\\r\\n // Mirror around y\\r\\n mirrorStart = vertices.length;\\r\\n vertices = vertices.concat(vertices);\\r\\n for(var i = mirrorStart+1; i<vertices.length; i+=3){\\r\\n vertices[i] = -vertices[i];\\r\\n }\\r\\n mirrorFacesStart = indices.length;\\r\\n indices = indices.concat(indices);\\r\\n for (var i = mirrorFacesStart; i<indices.length; i++){\\r\\n indices[i]+=mirrorStart/3;\\r\\n }\\r\\n // Mirror around z\\r\\n mirrorStart = vertices.length;\\r\\n vertices = vertices.concat(vertices);\\r\\n for(var i = mirrorStart+2; i<vertices.length; i+=3){\\r\\n vertices[i] = -vertices[i];\\r\\n }\\r\\n mirrorFacesStart = indices.length;\\r\\n indices = indices.concat(indices);\\r\\n for (var i = mirrorFacesStart; i<indices.length; i++){\\r\\n indices[i]+=mirrorStart/3;\\r\\n }\\r\\n this.vertices = new Float32Array(vertices);\\r\\n this.triangleIndices = new Uint16Array(indices);\\r\\n\\r\\n this.numVertices = this.vertices.length/3;\\r\\n this.numTriangles = this.triangleIndices.length/3;\\r\\n\\r\\n}\",\n \"function init$g() {\\n //no-op\\n if (!this.sphere) {\\n this.k0 = msfnz(this.e, Math.sin(this.lat_ts), Math.cos(this.lat_ts));\\n }\\n}\",\n \"display() {\\n push();\\n fill(255, 255, 0);\\n let angle = TWO_PI / this.points;\\n let halfAngle = angle / 2.0;\\n beginShape();\\n for (let a = 0; a < TWO_PI; a += angle) {\\n let sx = this.x + cos(a) * this.outerRadius;\\n let sy = this.y + sin(a) * this.outerRadius;\\n vertex(sx, sy);\\n sx = this.x + cos(a + halfAngle) * this.innerRadius;\\n sy = this.y + sin(a + halfAngle) * this.innerRadius;\\n vertex(sx, sy);\\n }\\n endShape(CLOSE);\\n pop();\\n }\",\n \"function showCoords() {\\n // TODO: Set the map center to the latitude / longitude position of your own home\\n\\n\\n // TODO: Zoom the map close enough\\n\\n}\",\n \"function makeSphere(ctx, radius, lats, longs) {\\n\\tvar geometryData = [];\\n\\tvar normalData = [];\\n\\tvar texCoordData = [];\\n\\tvar indexData = [];\\n\\n\\tfor (var latNumber = 0; latNumber <= lats; ++latNumber) {\\n\\t\\tfor (var longNumber = 0; longNumber <= longs; ++longNumber) {\\n\\t\\t\\tvar theta = latNumber * Math.PI / lats;\\n\\t\\t\\tvar phi = longNumber * 2 * Math.PI / longs;\\n\\t\\t\\tvar sinTheta = Math.sin(theta);\\n\\t\\t\\tvar sinPhi = Math.sin(phi);\\n\\t\\t\\tvar cosTheta = Math.cos(theta);\\n\\t\\t\\tvar cosPhi = Math.cos(phi);\\n\\n\\t\\t\\tvar x = cosPhi * sinTheta;\\n\\t\\t\\tvar y = cosTheta;\\n\\t\\t\\tvar z = sinPhi * sinTheta;\\n\\t\\t\\tvar u = 1 - (longNumber / longs);\\n\\t\\t\\tvar v = latNumber / lats;\\n\\n\\t\\t\\tnormalData.push(x);\\n\\t\\t\\tnormalData.push(y);\\n\\t\\t\\tnormalData.push(z);\\n\\t\\t\\ttexCoordData.push(u);\\n\\t\\t\\ttexCoordData.push(v);\\n\\t\\t\\tgeometryData.push(radius * x);\\n\\t\\t\\tgeometryData.push(radius * y);\\n\\t\\t\\tgeometryData.push(radius * z);\\n\\t\\t}\\n\\t}\\n\\n\\tfor (var latNumber = 0; latNumber < lats; ++latNumber) {\\n\\t\\tfor (var longNumber = 0; longNumber < longs; ++longNumber) {\\n\\t\\t\\tvar first = (latNumber * (longs + 1)) + longNumber;\\n\\t\\t\\tvar second = first + longs + 1;\\n\\t\\t\\tindexData.push(first);\\n\\t\\t\\tindexData.push(second);\\n\\t\\t\\tindexData.push(first + 1);\\n\\n\\t\\t\\tindexData.push(second);\\n\\t\\t\\tindexData.push(second + 1);\\n\\t\\t\\tindexData.push(first + 1);\\n\\t\\t}\\n\\t}\\n\\n\\tvar retval = {};\\n\\n\\tretval.normalObject = ctx.createBuffer();\\n\\tctx.bindBuffer(ctx.ARRAY_BUFFER, retval.normalObject);\\n\\tctx.bufferData(ctx.ARRAY_BUFFER, new Float32Array(normalData), ctx.STATIC_DRAW);\\n\\n\\tretval.texCoordObject = ctx.createBuffer();\\n\\tctx.bindBuffer(ctx.ARRAY_BUFFER, retval.texCoordObject);\\n\\tctx.bufferData(ctx.ARRAY_BUFFER, new Float32Array(texCoordData), ctx.STATIC_DRAW);\\n\\n\\tretval.vertexObject = ctx.createBuffer();\\n\\tctx.bindBuffer(ctx.ARRAY_BUFFER, retval.vertexObject);\\n\\tctx.bufferData(ctx.ARRAY_BUFFER, new Float32Array(geometryData), ctx.STATIC_DRAW);\\n\\n\\tretval.numIndices = indexData.length;\\n\\tretval.indexObject = ctx.createBuffer();\\n\\tctx.bindBuffer(ctx.ELEMENT_ARRAY_BUFFER, retval.indexObject);\\n\\tctx.bufferData(ctx.ELEMENT_ARRAY_BUFFER, new Uint16Array(indexData), ctx.STREAM_DRAW);\\n\\tretval.indexType = ctx.UNSIGNED_SHORT;\\n\\n\\treturn retval;\\n}\",\n \"function drawVectors() {\\n gridPoints.forEach(function(pt, index) {\\n translate(pt.x, pt.y);\\n // --Basic field:--\\n // var xDis = 20 * ((w/2) - pt.x) / w;\\n // var yDis = 20 * ((w/2) - pt.y) / w;\\n\\n // Perfect, this makes it look more continuous and natural:\\n var scale = 0.1;\\n\\n var noiseVal = noise(scale * pt.x/s, scale * pt.y/s);\\n\\n fullArray.push({\\n x: pt.x,\\n y: pt.y,\\n val: noiseVal\\n });\\n\\n var angle = noiseVal * 2 * Math.PI;\\n rotate(angle);\\n\\n stroke(255);\\n line(0, 0, 10, 0);\\n\\n rotate(-angle);\\n\\n // line(0, 0, xDis, yDis);\\n // don't forget to translate back out -- could also use push and pop to achieve same effect:\\n translate(-pt.x, -pt.y);\\n });\\n}\",\n \"function drawSphere(numberToSubdivide, useFlatShading, isSun) {\\n divideTriangle(va, vb, vc, numberToSubdivide);\\n divideTriangle(vd, vc, vb, numberToSubdivide);\\n divideTriangle(va, vd, vb, numberToSubdivide);\\n divideTriangle(va, vc, vd, numberToSubdivide);\\n \\n function triangle(a, b, c) {\\n pointsArray.push(a, b, c);\\n \\n //push normal vectors \\n if(useFlatShading){\\n var t1 = subtract(c,b);\\n var t2 = subtract(c,a);\\n var normal = vec4(normalize(cross(t1,t2)));\\n if(isSun){\\n normal = subtract(vec4(0,0,0,0), normal);\\n }\\n normalsArray.push(normal, normal, normal);\\n }\\n else{\\n normalsArray.push(a, b, c);\\n } \\n\\n index += 3;\\n }\\n\\n function divideTriangle(a, b, c, count) {\\n if ( count <= 0 ) { \\n triangle(a, b, c);\\n }\\n else{ \\n var ab = mix( a, b, 0.5);\\n var ac = mix( a, c, 0.5);\\n var bc = mix( b, c, 0.5);\\n \\n ab = normalize(ab, true);\\n ac = normalize(ac, true);\\n bc = normalize(bc, true);\\n \\n divideTriangle( a, ab, ac, count - 1 );\\n divideTriangle( ab, b, bc, count - 1 );\\n divideTriangle( bc, c, ac, count - 1 );\\n divideTriangle( ab, bc, ac, count - 1 );\\n }\\n }\\n\\n}\",\n \"function drawSphere() {\\r\\n // console.log(xindex + \\\" \\\" + yindex + \\\" \\\" +xthumb + \\\" \\\" + ythumb);\\r\\n //console.log(handMeshes[userId])\\r\\n var xs = xindex - xthumb;\\r\\n var ys = yindex - ythumb;\\r\\n var r = (Math.sqrt( xs*xs + ys*ys )-10);\\r\\n //console.log(r)\\r\\n var obj1 = new THREE.Object3D();\\r\\n \\r\\n var sfera = new THREE.SphereGeometry(r);\\r\\n var matsfe = new THREE.MeshNormalMaterial();\\r\\n var mesh1 = new THREE.Mesh(sfera, matsfe);\\r\\n \\r\\n obj1.position.x = xthumb;\\r\\n obj1.position.y = ythumb;\\r\\n \\r\\n obj1.add(mesh1);\\r\\n scene.add(obj1);\\r\\n }\",\n \"function makeSphere(numLongSteps) {\\n \\n try {\\n if (numLongSteps % 2 != 0)\\n throw \\\"in makeSphere: uneven number of longitude steps!\\\";\\n else if (numLongSteps < 4)\\n throw \\\"in makeSphere: number of longitude steps too small!\\\";\\n else { // good number longitude steps\\n \\n // make vertices, normals and uvs -- repeat longitude seam\\n const INVPI = 1/Math.PI, TWOPI = Math.PI+Math.PI, INV2PI = 1/TWOPI, epsilon=0.001*Math.PI;\\n var sphereVertices = [0,-1,0]; // vertices to return, init to south pole\\n var sphereUvs = [0.5,0]; // uvs to return, bottom texture row collapsed to one texel\\n var angleIncr = TWOPI / numLongSteps; // angular increment \\n var latLimitAngle = angleIncr * (Math.floor(numLongSteps*0.25)-1); // start/end lat angle\\n var latRadius, latY, latV; // radius, Y and texture V at current latitude\\n for (var latAngle=-latLimitAngle; latAngle<=latLimitAngle+epsilon; latAngle+=angleIncr) {\\n latRadius = Math.cos(latAngle); // radius of current latitude\\n latY = Math.sin(latAngle); // height at current latitude\\n latV = latAngle*INVPI + 0.5; // texture v = (latAngle + 0.5*PI) / PI\\n for (var longAngle=0; longAngle<=TWOPI+epsilon; longAngle+=angleIncr) { // for each long\\n sphereVertices.push(-latRadius*Math.sin(longAngle),latY,latRadius*Math.cos(longAngle));\\n sphereUvs.push(longAngle*INV2PI,latV); // texture u = (longAngle/2PI)\\n } // end for each longitude\\n } // end for each latitude\\n sphereVertices.push(0,1,0); // add north pole\\n sphereUvs.push(0.5,1); // top texture row collapsed to one texel\\n var sphereNormals = sphereVertices.slice(); // for this sphere, vertices = normals; return these\\n\\n // make triangles, first poles then middle latitudes\\n var sphereTriangles = []; // triangles to return\\n var numVertices = Math.floor(sphereVertices.length/3); // number of vertices in sphere\\n for (var whichLong=1; whichLong<=numLongSteps; whichLong++) { // poles\\n sphereTriangles.push(0,whichLong,whichLong+1);\\n sphereTriangles.push(numVertices-1,numVertices-whichLong-1,numVertices-whichLong-2);\\n } // end for each long\\n var llVertex; // lower left vertex in the current quad\\n for (var whichLat=0; whichLat<(numLongSteps/2 - 2); whichLat++) { // middle lats\\n for (var whichLong=0; whichLong<numLongSteps; whichLong++) {\\n llVertex = whichLat*(numLongSteps+1) + whichLong + 1;\\n sphereTriangles.push(llVertex,llVertex+numLongSteps+1,llVertex+numLongSteps+2);\\n sphereTriangles.push(llVertex,llVertex+numLongSteps+2,llVertex+1);\\n } // end for each longitude\\n } // end for each latitude\\n } // end if good number longitude steps\\n return({vertices:sphereVertices, normals:sphereNormals, uvs:sphereUvs, triangles:sphereTriangles});\\n } // end try\\n \\n catch(e) {\\n console.log(e);\\n } // end catch\\n }\",\n \"function plot() {\\n \\n }\",\n \"function getSphereData(isEllipse, sphere) {\\n\\n sphere.vertices = [];\\n if (!isEllipse) {\\n sphere.texCoords = [];\\n }\\n for (var latNumber = 0; latNumber <= latBands; latNumber++) {\\n var theta = latNumber * Math.PI / latBands;\\n var sinTheta = Math.sin(theta);\\n var cosTheta = Math.cos(theta);\\n\\n for (var longNumber = 0; longNumber <= longBands; longNumber++) {\\n var phi = longNumber * 2 * Math.PI / longBands;\\n var sinPhi = Math.sin(phi);\\n var cosPhi = Math.cos(phi);\\n\\n var x = cosPhi * sinTheta;\\n var y = cosTheta;\\n var z = sinPhi * sinTheta;\\n if (!isEllipse) {\\n sphere.texCoords.push(1 - (longNumber / longBands));\\n sphere.texCoords.push(1 - (latNumber / latBands));\\n }\\n sphere.vertices.push(radius * x);\\n if (isEllipse) {\\n sphere.vertices.push(2 * radius * y);\\n } else {\\n sphere.vertices.push(radius * y);\\n }\\n sphere.vertices.push(radius * z);\\n }\\n }\\n}\",\n \"function _Sphere(radius) {\\n var __sphereData = null,\\n __sphereVertexPositionBuffer = null,\\n __sphereVertexIndexBuffer = null,\\n __sphereVertexNormalBuffer = null,\\n\\n __colour = {r: 0.8, g: 0.8, b: 0.8, a: 1.0},\\n __radius = radius || 1.0,\\n __modelMatrix = mat4.create(),\\n __rotationMatrix = mat4.create(),\\n __translationMatrix = mat4.create(),\\n __scaleMatrix = mat4.create(),\\n __PVMMatrix = mat4.create(),\\n __normalMatrix = mat3.create(),\\n __shouldUpdateMatrices = true;\\n\\n function __init() {\\n __sphereData = webGLDrawUtilities.createSphereVertexData(__radius);\\n\\n // create the buffer for vertex positions and assign it to that buffer to use for later\\n __sphereVertexPositionBuffer = _gl.createBuffer();\\n __sphereVertexPositionBuffer.itemSize = 3;\\n __sphereVertexPositionBuffer.numItems = __sphereData.vertexPositionData.length / __sphereVertexPositionBuffer.itemSize;\\n __sphereVertexPositionBuffer.items = new Float32Array(__sphereData.vertexPositionData);\\n\\n _gl.bindBuffer(_gl.ARRAY_BUFFER, __sphereVertexPositionBuffer);\\n _gl.bufferData(_gl.ARRAY_BUFFER, __sphereVertexPositionBuffer.items, _gl.STATIC_DRAW);\\n\\n // create the buffer for vertex positions indexes and assign it to that buffer to use for later\\n __sphereVertexIndexBuffer = _gl.createBuffer();\\n __sphereVertexIndexBuffer.itemSize = 1;\\n __sphereVertexIndexBuffer.numItems = __sphereData.vertexIndexData.length;\\n __sphereVertexIndexBuffer.items = new Uint16Array(__sphereData.vertexIndexData);\\n\\n _gl.bindBuffer(_gl.ELEMENT_ARRAY_BUFFER, __sphereVertexIndexBuffer);\\n _gl.bufferData(_gl.ELEMENT_ARRAY_BUFFER, __sphereVertexIndexBuffer.items, _gl.STATIC_DRAW);\\n\\n // create the buffer for vertex positions indexes and assign it to that buffer to use for later\\n __sphereVertexNormalBuffer = _gl.createBuffer();\\n __sphereVertexNormalBuffer.itemSize = 3;\\n __sphereVertexNormalBuffer.numItems = __sphereData.vertexNormals.length / __sphereVertexNormalBuffer.itemSize;\\n __sphereVertexNormalBuffer.items = new Float32Array(__sphereData.vertexNormals);\\n\\n _gl.bindBuffer(_gl.ARRAY_BUFFER, __sphereVertexNormalBuffer);\\n _gl.bufferData(_gl.ARRAY_BUFFER, __sphereVertexNormalBuffer.items, _gl.STATIC_DRAW);\\n\\n }\\n\\n // draw itself\\n function __draw() {\\n\\n mat4.multiply(__modelMatrix, __translationMatrix, __rotationMatrix);\\n mat4.multiply(__modelMatrix, __modelMatrix, __scaleMatrix);\\n\\n // calculate the inverse, transpose of the model Matrix to make sure our surface normals are perpendicular to the surface again!!\\n mat3.normalFromMat4(__normalMatrix, __modelMatrix);\\n\\n // View * Model\\n mat4.multiply(__PVMMatrix, _glProgram.customAttribs.viewMatrix, __modelMatrix);\\n\\n // Perspective * (View * Model)\\n mat4.multiply(__PVMMatrix, _glProgram.customAttribs.perspectiveMatrix, __PVMMatrix);\\n\\n // alright now assign the matrices back to the location of our vertex shader\\n _gl.uniformMatrix3fv(_glProgram.customAttribs.u_NormalMatrixRef, false, __normalMatrix);\\n _gl.uniformMatrix4fv(_glProgram.customAttribs.u_PVMMatrixRef, false, __PVMMatrix);\\n\\n // set the position buffer\\n _gl.bindBuffer(_gl.ARRAY_BUFFER, __sphereVertexPositionBuffer);\\n _gl.vertexAttribPointer(_glProgram.customAttribs.a_PositionRef, __sphereVertexPositionBuffer.itemSize, _gl.FLOAT, false, 0, 0);\\n _gl.enableVertexAttribArray(_glProgram.customAttribs.a_PositionRef);\\n\\n // set the index buffer\\n _gl.bindBuffer(_gl.ELEMENT_ARRAY_BUFFER, __sphereVertexIndexBuffer);\\n\\n // bind the surface normal buffer\\n _gl.bindBuffer(_gl.ARRAY_BUFFER, __sphereVertexNormalBuffer);\\n _gl.vertexAttribPointer(_glProgram.customAttribs.a_VertexNormalRef, __sphereVertexNormalBuffer.itemSize, _gl.FLOAT, false, 0, 0);\\n _gl.enableVertexAttribArray(_glProgram.customAttribs.a_VertexNormalRef);\\n\\n // make sure the sphere is in the correct colour\\n _gl.uniform4f(_glProgram.customAttribs.u_FragColourRef, __colour.r, __colour.g, __colour.b, __colour.a);\\n\\n // draw the elements!\\n _gl.drawElements(_gl.TRIANGLES, __sphereVertexIndexBuffer.numItems, _gl.UNSIGNED_SHORT, 0);\\n\\n }\\n\\n // rotate the sphere by x, y, z degrees\\n function __rotateOnAxisByDegrees(x, y, z) {\\n\\n if (typeof x === 'number') {\\n mat4.rotateX(__rotationMatrix, __rotationMatrix, glMatrix.toRadian(x));\\n }\\n\\n if (typeof y === 'number') {\\n mat4.rotateY(__rotationMatrix, __rotationMatrix, glMatrix.toRadian(y));\\n }\\n\\n if (typeof z === 'number') {\\n mat4.rotateZ(__rotationMatrix, __rotationMatrix, glMatrix.toRadian(z));\\n }\\n\\n __shouldUpdateMatrices = true;\\n\\n return this;\\n\\n }\\n\\n // scale the sphere by s units\\n function __scale(s) {\\n if (typeof s === 'number') {\\n mat4.scale(__scaleMatrix, __scaleMatrix, vec3.fromValues(s, s, s));\\n }\\n\\n __shouldUpdateMatrices = true;\\n\\n return this;\\n }\\n\\n // translate the sphere by (x, y, z) units\\n function __translate(x, y, z) {\\n\\n mat4.translate(__translationMatrix, __translationMatrix, vec3.fromValues(x, y, z));\\n\\n __shouldUpdateMatrices = true;\\n\\n return this;\\n }\\n\\n __init();\\n\\n ////////////////////////////////////////////////////////\\n // _Sphere public API\\n ////////////////////////////////////////////////////////\\n this.rotateOnAxisByDegrees = __rotateOnAxisByDegrees;\\n\\n this.draw = __draw;\\n\\n this.scale = __scale;\\n\\n this.translate = __translate;\\n\\n // sets the colour of the primitive\\n this.setColour = function(r, g, b, a) {\\n __colour.r = r;\\n __colour.g = g;\\n __colour.b = b;\\n __colour.a = a;\\n\\n return this;\\n };\\n\\n this.getRadius = function() {\\n return __radius;\\n };\\n\\n return this;\\n }\",\n \"function makeSphere (slices, stacks) {\\n // fill in your code here.\\n\\tvar triangles = [];\\n\\tvar origin = [0.0, 0.0, 0.0];\\n\\tconst radius = 0.5;\\n\\tconst longi_step = radians(360 / slices); // in radian\\n\\tconst lati_step = radians(180 / stacks); // in radian\\n\\n\\tvar theta = 0.0;\\n\\t\\n\\n\\tfor (var i=0; i<slices; i++){\\n\\n\\t\\tvar phi = 0.0;\\n\\t\\tfor(var j=0; j<stacks; j++){\\n\\t\\t\\tvar v1 = [radius * Math.sin(theta) * Math.sin(phi), radius * Math.cos(phi), radius * Math.cos(theta) * Math.sin(phi)];\\n\\t\\t\\tvar v2 = [radius * Math.sin(theta + longi_step) * Math.sin(phi), radius * Math.cos(phi), radius * Math.cos(theta + longi_step) * Math.sin(phi)];\\n\\t\\t\\tvar v3 = [radius * Math.sin(theta) * Math.sin(phi + lati_step), radius * Math.cos(phi + lati_step), radius * Math.cos(theta) * Math.sin(phi + lati_step)];\\n\\t\\t\\tvar v4 = [radius * Math.sin(theta + longi_step) * Math.sin(phi + lati_step), radius * Math.cos(phi + lati_step), radius * Math.cos(theta + longi_step) * Math.sin(phi + lati_step)];\\n\\n\\t\\t\\ttriangles.push([v1, v3, v2]);\\n\\t\\t\\ttriangles.push([v2, v3, v4]);\\n\\n\\t\\t\\tphi += lati_step;\\n\\t\\t}\\n\\n\\t\\ttheta += longi_step;\\n\\t}\\n\\n\\tconsole.log(triangles.length);\\n\\n\\tfor (tri of triangles){\\n\\t\\taddTriangle(\\n\\t\\t\\ttri[0][0], tri[0][1], tri[0][2],\\n\\t\\t\\ttri[1][0], tri[1][1], tri[1][2],\\n\\t\\t\\ttri[2][0], tri[2][1], tri[2][2]\\n\\t\\t\\t);\\n\\t}\\n\\n\\n}\",\n \"function makeSphere(numLongSteps) {\\n \\n try {\\n if (numLongSteps % 2 != 0)\\n throw \\\"in makeSphere: uneven number of longitude steps!\\\";\\n else if (numLongSteps < 4)\\n throw \\\"in makeSphere: number of longitude steps too small!\\\";\\n else { // good number longitude steps\\n \\n// // make vertices and normals\\n// \\t\\n// var sphereVertices = [0,-1,0]; // vertices to return, init to south pole\\n// var sphereTextureCoords = [0.5,0];\\n// var angleIncr = (Math.PI+Math.PI) / numLongSteps; // angular increment \\n// var latLimitAngle = angleIncr * (Math.floor(numLongSteps/4)-1); // start/end lat angle\\n// var latRadius, latY; // radius and Y at current latitude\\n// for (var latAngle=-latLimitAngle; latAngle<=latLimitAngle; latAngle+=angleIncr) {\\n// latRadius = Math.cos(latAngle); // radius of current latitude\\n// latY = Math.sin(latAngle); // height at current latitude\\n// for (var longAngle=0; longAngle<2*Math.PI; longAngle+=angleIncr){ // for each long\\n// sphereVertices.push(latRadius*Math.sin(longAngle),latY,latRadius*Math.cos(longAngle));\\n// sphereTextureCoords.push((latRadius*Math.sin(longAngle)+1)/2,(latY+1)/2);\\n// }\\n// } // end for each latitude\\n// sphereVertices.push(0,1,0); // add north pole\\n// sphereTextureCoords.push(0.5,1);\\n// var sphereNormals = sphereVertices.slice(); // for this sphere, vertices = normals; return these\\n// \\n// // make triangles, from south pole to middle latitudes to north pole\\n// var sphereTriangles = []; // triangles to return\\n// for (var whichLong=1; whichLong<numLongSteps; whichLong++) // south pole\\n// sphereTriangles.push(0,whichLong,whichLong+1);\\n// sphereTriangles.push(0,numLongSteps,1); // longitude wrap tri\\n// var llVertex; // lower left vertex in the current quad\\n// for (var whichLat=0; whichLat<(numLongSteps/2 - 2); whichLat++) { // middle lats\\n// for (var whichLong=0; whichLong<numLongSteps-1; whichLong++) {\\n// llVertex = whichLat*numLongSteps + whichLong + 1;\\n// sphereTriangles.push(llVertex,llVertex+numLongSteps,llVertex+numLongSteps+1);\\n// sphereTriangles.push(llVertex,llVertex+numLongSteps+1,llVertex+1);\\n// } // end for each longitude\\n// sphereTriangles.push(llVertex+1,llVertex+numLongSteps+1,llVertex+2);\\n// sphereTriangles.push(llVertex+1,llVertex+2,llVertex-numLongSteps+2);\\n// } // end for each latitude\\n// for (var whichLong=llVertex+2; whichLong<llVertex+numLongSteps+1; whichLong++) // north pole\\n// sphereTriangles.push(whichLong,sphereVertices.length/3-1,whichLong+1);\\n// sphereTriangles.push(sphereVertices.length/3-2,sphereVertices.length/3-1,sphereVertices.length/3-numLongSteps-1); // longitude wrap\\n \\t\\n \\t/**Using the sphere from the lesson: http://learningwebgl.com/blog/?p=1253*/\\n \\tvar vertexPositionData = [];\\n var normalData = [];\\n var textureCoordData = [];\\n for (var latNumber = 0; latNumber <= numLongSteps; latNumber++) {\\n var theta = latNumber * Math.PI / numLongSteps;\\n var sinTheta = Math.sin(theta);\\n var cosTheta = Math.cos(theta);\\n\\n for (var longNumber = 0; longNumber <= numLongSteps; longNumber++) {\\n var phi = longNumber * 2 * Math.PI / numLongSteps;\\n var sinPhi = Math.sin(phi);\\n var cosPhi = Math.cos(phi);\\n\\n var x = cosPhi * sinTheta;\\n var y = cosTheta;\\n var z = sinPhi * sinTheta;\\n var u = 1 - (longNumber / numLongSteps);\\n var v = 1 - (latNumber / numLongSteps);\\n\\n normalData.push(x);\\n normalData.push(y);\\n normalData.push(z);\\n textureCoordData.push(u);\\n textureCoordData.push(v);\\n vertexPositionData.push(x);\\n vertexPositionData.push(y);\\n vertexPositionData.push(z);\\n }\\n }\\n var indexData = [];\\n for (var latNumber = 0; latNumber < numLongSteps; latNumber++) {\\n for (var longNumber = 0; longNumber < numLongSteps; longNumber++) {\\n var first = (latNumber * (numLongSteps + 1)) + longNumber;\\n var second = first + numLongSteps + 1;\\n indexData.push(first);\\n indexData.push(second);\\n indexData.push(first + 1);\\n\\n indexData.push(second);\\n indexData.push(second + 1);\\n indexData.push(first + 1);\\n }\\n }\\n \\t\\n } // end if good number longitude steps\\n// return({vertices:sphereVertices, normals:sphereNormals, triangles:sphereTriangles, texture:sphereTextureCoords});\\n return({vertices:vertexPositionData, normals:normalData, triangles:indexData, texture:textureCoordData});\\n } // end try\\n \\n catch(e) {\\n console.log(e);\\n } // end catch\\n } // end make sphere\",\n \"function drawSphere(radius, widthSegments, heightSegments, opacity, color, position){\\n\\tvar geometry = new THREE.SphereGeometry(radius, widthSegments, heightSegments, 0, 2.*Math.PI, 0, Math.PI)\\n\\tvar material = new THREE.MeshPhongMaterial( { \\n\\t\\tcolor: color, \\n\\t\\tflatShading: false, \\n\\t\\ttransparent:true,\\n\\t\\topacity:opacity, \\n\\t\\t//shininess:50,\\n\\t});\\n\\n\\tsphere = new THREE.Mesh( geometry, material );\\n\\tsphere.position.set(position.x, position.y, position.z)\\n\\t//update the vertices of the plane geometry so that I can check for the intersection -- not needed (and also breaks the sparse view)\\n\\t//https://stackoverflow.com/questions/23990354/how-to-update-vertices-geometry-after-rotate-or-move-object\\n\\t// sphere.updateMatrix();\\n\\t// sphere.geometry.applyMatrix( sphere.matrix );\\n\\t// sphere.matrix.identity();\\n\\t// sphere.position.set( 0, 0, 0 );\\n\\t// sphere.rotation.set( 0, 0, 0 );\\n\\t// sphere.scale.set( 1, 1, 1 );\\n\\n\\tparams.scene.add( sphere );\\n\\t\\n\\treturn sphere;\\n\\n}\",\n \"plotJourneys() {\\n for (let j of this.mapJourneys) {\\n //plot ghost Session\\n j.plotSessions(this);\\n }\\n }\",\n \"function drawCircle () {\\n\\tvar resolution = 8;\\n\\tvar amplitude = 10;\\n\\tvar size = 360 / resolution;\\n\\n\\tvar geometry = new THREE.Geometry();\\n\\tvar material = new THREE.MeshBasicMaterial( { color: 0xFFFFFF,\\n\\t\\tside: THREE.DoubleSide,\\n\\t\\twireframe: true} );\\n\\t// geometry.vertices.push( new THREE.Vector3( 0, 0, 0 ) );\\n\\tfor(var i = 0; i <= resolution; i++) {\\n\\t var segment = ( i * size ) * Math.PI / 180;\\n\\t var segment2 = ( i * size + size * 0.5 ) * Math.PI / 180;\\n\\t geometry.vertices.push( new THREE.Vector3( Math.cos( segment ) * amplitude, Math.sin( segment ) * amplitude, 0 ) ); \\n\\t geometry.vertices.push( new THREE.Vector3( Math.cos( segment2 ) * (amplitude-2), Math.sin( segment2 ) * (amplitude -2), 0 ) ); \\n\\t}\\n\\n\\tfor ( i = 0; i < geometry.vertices.length -2; i++) {\\n\\t\\tgeometry.faces.push ( new THREE.Face3( i, i+1, i+2 ) );\\n\\t}\\n\\tconsole.log ('Vertices', geometry.faces);\\n\\tgeometry.computeBoundingSphere();\\n\\n\\n\\tvar ringMesh = new THREE.Mesh(geometry, material); \\n ringMesh.position.set(-1.5, 0.0, -14.0); \\n scene.add(ringMesh); \\n}\",\n \"function S(e,t,n,i,r){var o=Math.cos(e),a=Math.sin(e),s=n/t*e,l=Math.cos(s);r.x=i*(2+l)*.5*o,r.y=i*(2+l)*a*.5,r.z=i*Math.sin(s)*.5}\",\n \"function makeSphere (slices, stacks) {\\n // fill in your code here.\\n var sliceDivision = radians(360) / slices;\\n var stackDivision = radians(180) / stacks;\\n var radius = 0.5;\\n\\n for (var longitude = 0; longitude < radians(360); longitude += sliceDivision) {\\n for (var latitude = 0; latitude < radians(180); latitude += stackDivision) {\\n addTriangle(radius * Math.cos(longitude) * Math.sin(latitude + stackDivision), radius * Math.sin(longitude) * Math.sin(latitude + stackDivision), radius * Math.cos(latitude + stackDivision), \\n radius * Math.cos(longitude) * Math.sin(latitude), radius * Math.sin(longitude) * Math.sin(latitude), radius * Math.cos(latitude), \\n radius * Math.cos(longitude + sliceDivision) * Math.sin(latitude + stackDivision), radius * Math.sin(longitude + sliceDivision) * Math.sin(latitude + stackDivision), radius * Math.cos(latitude + stackDivision));\\n \\n addTriangle(radius * Math.cos(longitude + sliceDivision) * Math.sin(latitude + stackDivision), radius * Math.sin(longitude + sliceDivision) * Math.sin(latitude + stackDivision), radius * Math.cos(latitude + stackDivision), \\n radius * Math.cos(longitude) * Math.sin(latitude), radius * Math.sin(longitude) * Math.sin(latitude), radius * Math.cos(latitude), \\n radius * Math.cos(longitude + sliceDivision) * Math.sin(latitude), radius * Math.sin(longitude + sliceDivision) * Math.sin(latitude), radius * Math.cos(latitude));\\n\\n }\\n }\\n}\",\n \"function drawSphere() {\\r\\n gl.bindBuffer(gl.ARRAY_BUFFER, sphereVertexPositionBuffer);\\r\\n gl.vertexAttribPointer(shaderProgram.vertexPositionAttribute, sphereVertexPositionBuffer.itemSize,\\r\\n gl.FLOAT, false, 0, 0);\\r\\n\\r\\n // Bind normal buffer\\r\\n gl.bindBuffer(gl.ARRAY_BUFFER, sphereVertexNormalBuffer);\\r\\n gl.vertexAttribPointer(shaderProgram.vertexNormalAttribute,\\r\\n sphereVertexNormalBuffer.itemSize,\\r\\n gl.FLOAT, false, 0, 0);\\r\\n gl.drawArrays(gl.TRIANGLES, 0, sphereVertexPositionBuffer.numItems);\\r\\n}\",\n \"function drawSphere() {\\n\\n gl.useProgram(sphere.program);\\n\\n gl.bindBuffer(gl.ELEMENT_ARRAY_BUFFER, indexBuffer);\\n gl.bufferData(gl.ELEMENT_ARRAY_BUFFER, new Uint16Array(sphere.indexList), gl.STATIC_DRAW);\\n\\n gl.bindBuffer(gl.ARRAY_BUFFER, verticesBuffer);\\n gl.bufferData(gl.ARRAY_BUFFER, new Float32Array(sphere.vertices), gl.STATIC_DRAW);\\n var vertexPosition = gl.getAttribLocation(sphere.program, \\\"vertexPosition\\\");\\n gl.vertexAttribPointer(vertexPosition, sphere.vertDim, gl.FLOAT, false, 0, 0);\\n gl.enableVertexAttribArray(vertexPosition);\\n\\n gl.bindBuffer(gl.ARRAY_BUFFER, normalsBuffer);\\n gl.bufferData(gl.ARRAY_BUFFER, new Float32Array(flatten(sphere.normals)), gl.STATIC_DRAW);\\n var nvPosition = gl.getAttribLocation(sphere.program, \\\"nv\\\");\\n gl.vertexAttribPointer(nvPosition, sphere.vertDim, gl.FLOAT, false, 0, 0);\\n gl.enableVertexAttribArray(nvPosition);\\n\\n gl.activeTexture(gl.TEXTURE0);\\n gl.bindTexture(gl.TEXTURE_2D, sphereTexture);\\n gl.bindBuffer(gl.ARRAY_BUFFER, texCoordBuffer);\\n gl.bufferData(gl.ARRAY_BUFFER, new Float32Array(sphere.texCoords), gl.STATIC_DRAW);\\n var texCoordLocation = gl.getAttribLocation(sphere.program, \\\"texCoord\\\");\\n gl.vertexAttribPointer(texCoordLocation, 2, gl.FLOAT, false, 0, 0);\\n gl.enableVertexAttribArray(texCoordLocation);\\n\\n var MLoc = gl.getUniformLocation(sphere.program, \\\"M\\\");\\n gl.uniformMatrix4fv(MLoc, false, M);\\n\\n var SRotLoc = gl.getUniformLocation(sphere.program, \\\"SRot\\\");\\n gl.uniformMatrix4fv(SRotLoc, false, flatten(sceneRotation));\\n\\n var MinvTransLoc = gl.getUniformLocation(sphere.program, \\\"MinvTrans\\\");\\n gl.uniformMatrix4fv(MinvTransLoc, false, MinvTrans);\\n\\n var PLoc = gl.getUniformLocation(sphere.program, \\\"P\\\");\\n gl.uniformMatrix4fv(PLoc, false, P);\\n\\n var thetaLoc = gl.getUniformLocation(sphere.program, \\\"theta\\\");\\n gl.uniform1f(thetaLoc, sphere.theta);\\n\\n var scaleLoc = gl.getUniformLocation(sphere.program, \\\"s\\\");\\n gl.uniform1f(scaleLoc, scale);\\n\\n var lightDirection1Loc = gl.getUniformLocation(sphere.program, \\\"lightDirection1\\\");\\n gl.uniform3f(lightDirection1Loc, lightDirection1[0], lightDirection1[1], lightDirection1[2]);\\n var directionColor1Loc = gl.getUniformLocation(sphere.program, \\\"directionColor1\\\");\\n gl.uniform3f(directionColor1Loc, directionColor1[0], directionColor1[1], directionColor1[2]);\\n var lightDirection2Loc = gl.getUniformLocation(sphere.program, \\\"lightDirection2\\\");\\n gl.uniform3f(lightDirection2Loc, lightDirection2[0], lightDirection2[1], lightDirection2[2])\\n var directionColor2Loc = gl.getUniformLocation(sphere.program, \\\"directionColor2\\\");\\n gl.uniform3f(directionColor2Loc, directionColor2[0], directionColor2[1], directionColor2[2])\\n\\n gl.drawElements(gl.TRIANGLES, sphere.numElems, gl.UNSIGNED_SHORT, 0);\\n}\",\n \"function sphere() {\\n\\n}\",\n \"function calculation () { \\n var cos = Math.cos(phi), sin = Math.sin(phi);\\n xB0 = xM0+R0*cos; yB0 = yM0-R0*sin; // Beobachtungsort (linke Skizze) \\n xN0 = xB0-R1*sin; yN0 = yB0-R1*cos; // Norden (linke Skizze)\\n xS0 = xB0+R1*sin; yS0 = yB0+R1*cos; // S�den (linke Skizze)\\n xZ0 = xB0+R1*cos; yZ0 = yB0-R1*sin; // Zenit (linke Skizze)\\n if (phi < 0) {cos = -cos; sin = -sin;} // Vorzeichenumkehr f�r S�dhalbkugel\\n xP1 = xB1-R1*cos; yP1 = yB1-R1*sin; // Himmelspol (rechte Skizze) \\n }\",\n \"function showPosition(position) {\\n\\tvar radlat1 = Math.PI * position.coords.latitude/180\\n\\tvar radlat2 = Math.PI * myLatitude/180\\n\\tvar theta = position.coords.longitude-myLongitude\\n\\tvar radtheta = Math.PI * theta/180\\n\\tvar dist = Math.sin(radlat1) * Math.sin(radlat2) + Math.cos(radlat1) * Math.cos(radlat2) * Math.cos(radtheta);\\n\\tdist = Math.acos(dist)\\n\\tdist = dist * 180/Math.PI\\n\\tdist = dist * 60 * 1.1515 * 1.609344 * 1000 //convert to meters\\n\\tdocument.getElementById(myDistance).innerHTML = Math.round(dist) + \\\" meters\\\"; \\t\\n}\",\n \"function SphericalMercator(options) {\\n options = options || {};\\n this.size = options.size || 256;\\n if (!cache[this.size]) {\\n var size = this.size;\\n var c = cache[this.size] = {};\\n c.Bc = [];\\n c.Cc = [];\\n c.zc = [];\\n c.Ac = [];\\n for (var d = 0; d < 30; d++) {\\n c.Bc.push(size / 360);\\n c.Cc.push(size / (2 * Math.PI));\\n c.zc.push(size / 2);\\n c.Ac.push(size);\\n size *= 2;\\n }\\n }\\n this.Bc = cache[this.size].Bc;\\n this.Cc = cache[this.size].Cc;\\n this.zc = cache[this.size].zc;\\n this.Ac = cache[this.size].Ac;\\n}\",\n \"function OnDrawGizmosSelected() {\\n\\tvar camera = GetComponent.<Camera>();\\n\\tvar p = camera.ScreenToWorldPoint(new Vector3(100, 100, camera.nearClipPlane));\\n\\tGizmos.color = Color.yellow;\\n\\tGizmos.DrawSphere(p, 0.1F);\\n}\",\n \"function showSphereLighted(model) {\\n //code from http://learningwebgl.com/cookbook/index.php/How_to_draw_a_sphere & http://learningwebgl.com/blog/?p=1253\\n const latitudeBands = 30;\\n const longitudeBands = 30;\\n const radius = 100;\\n\\n const vertexPositionData = [];\\n const normalData = [];\\n const textureCoordData = [];\\n\\n for (let latNumber = 0; latNumber <= latitudeBands; latNumber++) {\\n const theta = latNumber * Math.PI / latitudeBands;\\n const sinTheta = Math.sin(theta);\\n const cosTheta = Math.cos(theta);\\n\\n for (let longNumber = 0; longNumber <= longitudeBands; longNumber++) {\\n const phi = longNumber * 2 * Math.PI / longitudeBands;\\n const sinPhi = Math.sin(phi);\\n const cosPhi = Math.cos(phi);\\n const x = cosPhi * sinTheta;\\n const y = cosTheta;\\n const z = sinPhi * sinTheta;\\n const u = 1 - (longNumber / longitudeBands);\\n const v = latNumber / latitudeBands;\\n\\n normalData.push(x);\\n normalData.push(-y); //y-inversion\\n normalData.push(z);\\n\\n textureCoordData.push(u);\\n textureCoordData.push(1. - v); //y-inversion\\n\\n vertexPositionData.push(radius * x);\\n vertexPositionData.push(- radius * y); //y-inversion\\n vertexPositionData.push(radius * z);\\n }\\n }\\n\\n const indexData = [];\\n\\n for (let latNumber = 0; latNumber < latitudeBands; latNumber++) {\\n for (let longNumber = 0; longNumber < longitudeBands; longNumber++) {\\n const first = (latNumber * (longitudeBands + 1)) + longNumber;\\n const second = first + longitudeBands + 1;\\n\\n indexData.push(first);\\n indexData.push(second);\\n indexData.push(first + 1);\\n\\n indexData.push(second);\\n indexData.push(second + 1);\\n indexData.push(first + 1);\\n }\\n }\\n\\n //setup model\\n model.vertices(vertexPositionData);\\n model.indices(indexData);\\n model.normals(normalData);\\n model.uvs(textureCoordData);\\n\\n const w = 2 * radius;\\n const h = w;\\n\\n model.x(w).y(h);\\n\\n //texture (http://planetpixelemporium.com/earth.html)\\n model.src(path.join(__dirname, 'sphere/moonmap1k.jpg'));\\n //model.src(path.join(__dirname, 'sphere/earthmap1k.jpg'));\\n\\n //animate\\n model.rx.anim().from(0).to(360).dur(5000).loop(-1).start();\\n model.ry.anim().from(0).to(360).dur(5000).loop(-1).start();\\n}\",\n \"function spindulioReiksme () {\\n// let ivedimoLaukas = document.querySelector('div input');\\n let r = document.querySelector('div input').value;\\n let plotas= Math.PI*r*r\\n\\n// console.log(plotas);\\ndocument.querySelector(\\\".apskritimo-plotas\\\").innerHTML = plotas;\\n}\",\n \"function staciakampoPlotas(ilgis, aukstis) {\\n return ilgis * aukstis;\\n}\",\n \"function drawGridCentre(x,y,s,rot){\\r\\n ctx.save();\\r\\n ctx.translate(x,y);\\r\\n ctx.rotate(rot*Math.PI/180);\\r\\n drawCircle(0,0,20, colArray[0], colArray[0], 2, false, true);\\r\\n for(j = 0; j<7 ; j++){\\r\\n for(var i = 0 ; i<7 ; i++){\\r\\n drawRectangle(0-s/2+i*s/7,0-s/2+j*s/7, s/7,s/7,colArray[3], colArray[4],0.5, false, true);\\r\\n }\\r\\n }\\r\\n ctx.restore();\\r\\n}\",\n \"function pushCartesianFromSpherical(out, latDeg, lonDeg) {\\n let latRad = (latDeg / 180.0) * Math.PI,\\n lonRad = (lonDeg / 180.0) * Math.PI\\n out.push(Math.cos(latRad) * Math.cos(lonRad), Math.cos(latRad) * Math.sin(lonRad), Math.sin(latRad))\\n return out\\n}\",\n \"function update_spheroid(path) {\\n var i, n, d, dt, x0, y0, x1, y1, tx, ty, l, x2, y2, xa, ya, xb, yb;\\n d = \\\"M{0},0\\\".fmt(path.heights[0]);\\n for (i = 0, n = path.heights.length, dt = 2 * Math.PI / n; i < n; i += 1) {\\n x0 = path.heights[(i + n - 1) % n] * Math.cos((i - 1) * dt);\\n y0 = path.heights[(i + n - 1) % n] * Math.sin((i - 1) * dt);\\n x1 = path.heights[i] * Math.cos(i * dt);\\n y1 = path.heights[i] * Math.sin(i * dt);\\n x2 = path.heights[(i + 1) % n] * Math.cos((i + 1) * dt);\\n y2 = path.heights[(i + 1) % n] * Math.sin((i + 1) * dt);\\n tx = x2 - x0;\\n ty = y2 - y0;\\n l = Math.sqrt(tx * tx + ty * ty);\\n tx = tx / l;\\n ty = ty / l;\\n xa = x1 - SMOOTHING * tx * magnitude(x1 - x0, y1 - y0);\\n ya = y1 - SMOOTHING * ty * magnitude(x1 - x0, y1 - y0);\\n xb = x1 + SMOOTHING * tx * magnitude(x1 - x2, y1 - y2);\\n yb = y1 + SMOOTHING * ty * magnitude(x1 - x2, y1 - y2);\\n d += \\\"C{0},{1} {2},{3} {4},{5}\\\".fmt(xa, ya, x1, y1, xb, yb);\\n }\\n path.setAttribute(\\\"d\\\", d);\\n }\",\n \"axisPlot() {\\n this.ctx = this.canvas.getContext(\\\"2d\\\");\\n\\n /**\\n * Grid grid\\n */\\n if (this.grid.grid) {\\n this.ctx.beginPath();\\n this.ctx.font = 'italic 18pt Calibri';\\n this.ctx.strokeStyle = '#979797';\\n this.ctx.lineWidth = 1;\\n this.ctx.setLineDash([10, 15]);\\n for (let i = 30; i < this.field.width; i+= 100) {\\n this.ctx.fillText(Math.ceil(this.ScreenToWorldY(i)*1000)/1000, 0, i);\\n this.ctx.moveTo(0, i);\\n this.ctx.lineTo(this.field.width, i);\\n }\\n for (let i = 100; i < this.field.width; i+= 100) {\\n this.ctx.fillText(Math.ceil(this.ScreenToWorldX(i)*1000)/1000, i, this.field.height);\\n this.ctx.moveTo(i, 0);\\n this.ctx.lineTo(i, this.field.height);\\n }\\n this.ctx.stroke();\\n this.ctx.closePath();\\n }\\n\\n\\n /**\\n * Grid axiss\\n */\\n if (this.grid.axiss) {\\n this.ctx.beginPath();\\n this.ctx.strokeStyle = '#b10009';\\n this.ctx.lineWidth = 2;\\n this.ctx.setLineDash([]);\\n\\n this.ctx.moveTo(this.center.x, 0);\\n this.ctx.lineTo(this.center.x, this.field.height);\\n\\n this.ctx.moveTo(0, this.center.y);\\n this.ctx.lineTo(this.field.width, this.center.y);\\n\\n this.ctx.stroke();\\n this.ctx.closePath();\\n }\\n\\n\\n if (this.grid.serifs) {\\n this.ctx.beginPath();\\n this.ctx.strokeStyle = '#058600';\\n this.ctx.fillStyle = '#888888'\\n this.ctx.lineWidth = 2;\\n this.ctx.setLineDash([]);\\n\\n let start = 0;\\n if (!this.grid.serifsStep){\\n return;\\n }\\n\\n let s = Math.abs(\\n this.ScreenToWorldY(0) -\\n this.ScreenToWorldY(this.grid.serifsSize)\\n );\\n\\n /**\\n * To right & to left\\n */\\n if ((this.center.y > 0) && (this.center.y < this.field.height)) {\\n\\n let finish = this.ScreenToWorldX(this.field.width);\\n\\n for (let i = start; i < finish; i+=this.grid.serifsStep) {\\n this.moveTo(i+this.grid.serifsStep/2,(s/2));\\n this.lineTo(i+this.grid.serifsStep/2,-(s/2));\\n this.ctx.fillText(i+this.grid.serifsStep/2, this.WorldToScreenX(i+this.grid.serifsStep/2), this.WorldToScreenY(s/2));\\n\\n this.moveTo(i+this.grid.serifsStep,s);\\n this.lineTo(i+this.grid.serifsStep,-s);\\n this.ctx.fillText(i+this.grid.serifsStep, this.WorldToScreenX(i+this.grid.serifsStep), this.WorldToScreenY(s));\\n }\\n\\n finish = this.ScreenToWorldX(0);\\n\\n for (let i = start; i > finish; i-=this.grid.serifsStep) {\\n this.moveTo(i-this.grid.serifsStep/2,(s/2));\\n this.lineTo(i-this.grid.serifsStep/2,-(s/2));\\n this.ctx.fillText(i-this.grid.serifsStep/2, this.WorldToScreenX(i-this.grid.serifsStep/2), this.WorldToScreenY(s/2));\\n\\n this.moveTo(i-this.grid.serifsStep,s);\\n this.lineTo(i-this.grid.serifsStep,-s);\\n this.ctx.fillText(i-this.grid.serifsStep, this.WorldToScreenX(i-this.grid.serifsStep), this.WorldToScreenY(s));\\n }\\n }\\n\\n /**\\n * To top & to bot\\n */\\n if ((this.center.x > 0) && (this.center.x < this.field.width)) {\\n\\n start = 0;\\n let finish = this.ScreenToWorldY(0);\\n\\n for (let i = start; i < finish; i+=this.grid.serifsStep) {\\n this.moveTo((s/2),i+this.grid.serifsStep/2);\\n this.lineTo(-(s/2),i+this.grid.serifsStep/2);\\n this.ctx.fillText(i+this.grid.serifsStep/2, this.WorldToScreenX(s/2), this.WorldToScreenY(i+this.grid.serifsStep/2));\\n\\n this.moveTo(s, i+this.grid.serifsStep);\\n this.lineTo(-s, i+this.grid.serifsStep);\\n this.ctx.fillText(i+this.grid.serifsStep, this.WorldToScreenX(s), this.WorldToScreenY(i+this.grid.serifsStep));\\n }\\n\\n finish = this.ScreenToWorldY(this.field.width);\\n\\n for (let i = start; i > finish-this.grid.serifsStep; i-=this.grid.serifsStep) {\\n this.moveTo((s/2),i+this.grid.serifsStep/2);\\n this.lineTo(-(s/2),i+this.grid.serifsStep/2);\\n this.ctx.fillText(i+this.grid.serifsStep/2, this.WorldToScreenX(s/2), this.WorldToScreenY(i+this.grid.serifsStep/2));\\n\\n this.moveTo(s, i+this.grid.serifsStep);\\n this.lineTo( -s, i+this.grid.serifsStep);\\n this.ctx.fillText(i+this.grid.serifsStep, this.WorldToScreenX(s), this.WorldToScreenY(i+this.grid.serifsStep));\\n }\\n }\\n this.ctx.stroke();\\n this.ctx.closePath();\\n }\\n }\",\n \"static astroToSpherical( dist, decl, ra, sph ) {\\n\\n\\t\\tsph = sph || new Spherical();\\n\\t\\tsph.set( dist,\\n\\t\\t\\t\\t Math.PI / 2 - Utils.radians( decl ),\\n\\t\\t\\t\\t Utils.radians( ra ) - Math.PI / 2 );\\n\\t\\treturn sph;\\n\\n\\t}\",\n \"function sphericalDistance(a, b) {\\n\\t var x = lonToMeters(a[0] - b[0], (a[1] + b[1]) / 2),\\n\\t y = latToMeters(a[1] - b[1]);\\n\\t return Math.sqrt((x * x) + (y * y));\\n\\t}\",\n \"function plot() {\\n\\n}\",\n \"function Sphere(gl, position = [0, 0, 0]) {\\n\\n\\t// Shader program\\n\\tif (Sphere.shaderProgram === undefined) {\\n\\t\\tSphere.shaderProgram = initShaderProgram(gl, \\\"vertex-shader\\\", \\\"fragment-shader\\\");\\n\\t\\tif (Sphere.shaderProgram === null) {\\n\\t\\t\\tthrow new Error('Creating the shader program failed.');\\n\\t\\t}\\n\\t\\tSphere.locations = {\\n\\t\\t\\tattribute: {\\n\\t\\t\\t\\tvertPosition: gl.getAttribLocation(Sphere.shaderProgram, \\\"vertPosition\\\"),\\n\\t\\t\\t\\tvertColor: gl.getAttribLocation(Sphere.shaderProgram, \\\"vertColor\\\"),\\n\\t\\t\\t\\taNormal: gl.getAttribLocation(Sphere.shaderProgram, \\\"aNormal\\\"),\\n\\t\\t\\t},\\n\\t\\t\\tuniform: {\\n\\t\\t\\t\\tmMatrix: gl.getUniformLocation(Sphere.shaderProgram, \\\"mMatrix\\\"),\\n\\t\\t\\t\\twMatrix: gl.getUniformLocation(Sphere.shaderProgram, \\\"wMatrix\\\"),\\n\\t\\t\\t\\tvMatrix: gl.getUniformLocation(Sphere.shaderProgram, \\\"vMatrix\\\"),\\n\\t\\t\\t\\tmMatrixInv: gl.getUniformLocation(Sphere.shaderProgram, \\\"mMatrixInv\\\"),\\n\\t\\t\\t\\tpMatrix: gl.getUniformLocation(Sphere.shaderProgram, \\\"pMatrix\\\"),\\n\\t\\t\\t\\tpLight: gl.getUniformLocation(Sphere.shaderProgram, \\\"pLight\\\"),\\n\\t\\t\\t\\tcamera: gl.getUniformLocation(Sphere.shaderProgram, \\\"camera\\\"),\\n\\t\\t\\t\\tspecularEnabled: gl.getUniformLocation(Sphere.shaderProgram, \\\"specularEnabled\\\"),\\n\\t\\t\\t\\tphong: gl.getUniformLocation(Sphere.shaderProgram, \\\"phong\\\")\\n\\t\\t\\t}\\n\\t\\t};\\n\\t\\tgl.enableVertexAttribArray(Sphere.locations.attribute.vertPosition);\\n\\t\\tgl.enableVertexAttribArray(Sphere.locations.attribute.vertColor);\\n\\t\\tgl.enableVertexAttribArray(Sphere.locations.attribute.aNormal);\\n\\t}\\n\\n\\t// Buffers\\n\\tif (Sphere.buffers === undefined) {\\n\\t\\t// Create a buffer with the vertex positions\\n\\t\\t// 3 coordinates per vertex, 3 vertices per triangle\\n\\t\\t// 2 triangles make up the ground plane, 4 triangles make up the sides\\n\\t\\tconst pBuffer = gl.createBuffer();\\n\\t\\tgl.bindBuffer(gl.ARRAY_BUFFER, pBuffer);\\n\\n\\n\\t\\t// Position vertices\\n\\t\\tlet limit = 33;\\n\\t\\tlet i, hi, si, ci;\\n\\t\\tlet j, hj, sj, cj;\\n\\t\\tlet p1, p2;\\n\\n\\t\\tlet vertices = [];\\n\\t\\tlet normals = [];\\n\\t\\tfor (let j = 0; j <= limit; j++) {\\n\\t\\t\\thj = j * Math.PI / limit;\\n\\t\\t\\tsj = Math.sin(hj);\\n\\t\\t\\tcj = Math.cos(hj);\\n\\t\\t\\tfor (let i = 0; i <= limit; i++) {\\n\\t\\t\\t\\thi = i * 2 * Math.PI / limit;\\n\\t\\t\\t\\tsi = Math.sin(hi);\\n\\t\\t\\t\\tci = Math.cos(hi);\\n\\n\\t\\t\\t\\t// 0.77 to minimize the sphere\\n\\t\\t\\t\\tvertices.push(ci * sj * 0.77); // X\\n\\t\\t\\t\\tvertices.push(cj * 0.77); // Y\\n\\t\\t\\t\\tvertices.push(si * sj * 0.77); // Z\\n\\n\\t\\t\\t\\tnormals.push(ci*sj);\\n\\t\\t\\t\\tnormals.push(cj);\\n\\t\\t\\t\\tnormals.push(si*sj);\\n\\t\\t\\t}\\n\\t\\t}\\n\\n\\t\\tgl.bufferData(gl.ARRAY_BUFFER, new Float32Array(vertices), gl.STATIC_DRAW);\\n\\t\\tpBuffer.itemSize = 3;\\n\\t\\tpBuffer.numItems = vertices.length;\\n\\n\\n\\t\\t// Indices\\n\\t\\tlet indices = []\\n\\t\\tlet iBuffer = gl.createBuffer();\\n\\t\\tgl.bindBuffer(gl.ELEMENT_ARRAY_BUFFER, iBuffer);\\n\\t\\tfor (j = 0; j < limit; j++) {\\n\\t\\t\\tfor (i = 0; i < limit; i++) {\\n\\t\\t\\t\\tp1 = j * (limit + 1) + i;\\n\\t\\t\\t\\tp2 = p1 + (limit + 1);\\n\\n\\t\\t\\t\\tindices.push(p1);\\n\\t\\t\\t\\tindices.push(p2);\\n\\t\\t\\t\\tindices.push(p1 + 1);\\n\\n\\t\\t\\t\\tindices.push(p1 + 1);\\n\\t\\t\\t\\tindices.push(p2);\\n\\t\\t\\t\\tindices.push(p2 + 1);\\n\\t\\t\\t}\\n\\t\\t}\\n\\n\\t\\tgl.bufferData(gl.ELEMENT_ARRAY_BUFFER, new Uint16Array(indices), gl.STATIC_DRAW);\\n\\t\\tiBuffer.itemSize = 3;\\n\\t\\tiBuffer.numItems = indices.length;\\n\\n\\n\\t\\t// Color\\n\\t\\tlet cBuffer = gl.createBuffer();\\n\\t\\tgl.bindBuffer(gl.ARRAY_BUFFER, cBuffer);\\n\\t\\tlet colors = [];\\n\\n\\t\\tfor (let i = 0; i <= limit; i++) {\\n\\t\\t\\tfor (let j = 0; j <= limit; j++) {\\n\\t\\t\\t\\tcolors.push(0);\\n\\t\\t\\t\\tcolors.push(0);\\n\\t\\t\\t\\tcolors.push(0.99);\\n\\t\\t\\t}\\n\\t\\t}\\n\\t\\tgl.bufferData(gl.ARRAY_BUFFER, new Float32Array(colors), gl.STATIC_DRAW);\\n\\t\\tcBuffer.itemSize = 3;\\n\\t\\tcBuffer.numitems = colors.length;\\n\\n\\n\\t\\t// Lines\\n\\t\\tconst lBuffer = gl.createBuffer();\\n\\t\\tgl.bindBuffer(gl.ARRAY_BUFFER, lBuffer);\\n\\n\\t\\tlet lineVertices = [\\n\\t\\t\\t0.0, 1.1, 0.0,\\n\\t\\t\\t0.0, -1.1, 0.0,\\n\\n\\t\\t\\t1.1, 0.0, 0.0,\\n\\t\\t\\t-1.1, 0.0, 0.0,\\n\\n\\t\\t\\t0.0, 0.0, 1.1,\\n\\t\\t\\t0.0, 0.0, -1.1\\n\\t\\t];\\n\\t\\tgl.bufferData(gl.ARRAY_BUFFER, new Float32Array(lineVertices), gl.STATIC_DRAW);\\n\\t\\tlBuffer.itemSize = 3;\\n\\t\\tlBuffer.numItems = 6;\\n\\n\\n\\t\\tconst liBuffer = gl.createBuffer();\\n\\t\\tgl.bindBuffer(gl.ELEMENT_ARRAY_BUFFER, liBuffer);\\n\\n\\t\\tlet lineIndices = [\\n\\t\\t\\t0, 1,\\n\\t\\t\\t2, 3,\\n\\t\\t\\t4, 5\\n\\t\\t];\\n\\t\\tgl.bufferData(gl.ELEMENT_ARRAY_BUFFER, new Uint16Array(lineIndices), gl.STATIC_DRAW);\\n\\t\\tliBuffer.itemSize = 1;\\n\\t\\tliBuffer.numItems = 6;\\n\\n\\t\\tconst lcBuffer = gl.createBuffer();\\n\\t\\tgl.bindBuffer(gl.ARRAY_BUFFER, lcBuffer);\\n\\n\\t\\tlet lineColors = [\\n\\t\\t\\t0.0, 1.0, 0.0, 1.0,\\n\\t\\t\\t0.0, 1.0, 0.0, 1.0,\\n\\n\\t\\t\\t1.0, 0.0, 0.0, 1.0,\\n\\t\\t\\t1.0, 0.0, 0.0, 1.0,\\n\\n\\t\\t\\t0.0, 0.0, 1.0, 1.0,\\n\\t\\t\\t0.0, 0.0, 1.0, 1.0\\n\\t\\t];\\n\\t\\tgl.bufferData(gl.ARRAY_BUFFER, new Float32Array(lineColors), gl.STATIC_DRAW);\\n\\t\\tlcBuffer.itemSize = 4;\\n\\t\\tlcBuffer.numItems = 6;\\n\\n\\n\\t\\t//Create a buffer with the normals\\n\\t\\tconst nBuffer = gl.createBuffer();\\n\\t\\tgl.bindBuffer(gl.ARRAY_BUFFER, nBuffer);\\n\\t\\tgl.bufferData(gl.ARRAY_BUFFER, new Float32Array(normals), gl.STATIC_DRAW);\\n\\n\\n\\t\\tSphere.buffers = {\\n\\t\\t\\tpBuffer: pBuffer,\\n\\t\\t\\tcBuffer: cBuffer,\\n\\t\\t\\tnBuffer: nBuffer,\\n\\t\\t\\tlBuffer: lBuffer,\\n\\t\\t\\tiBuffer: iBuffer,\\n\\t\\t\\tliBuffer: liBuffer,\\n\\t\\t\\tlcBuffer: lcBuffer,\\n\\t\\t\\tpComponents: 3,\\n\\t\\t\\tcComponents: 3,\\n\\t\\t\\tnComponents: 3,\\n\\t\\t};\\n\\t}\\n\\n\\t// Object Variables\\n\\tthis.lcPosition = position;\\n\\tthis.scale = [1, 1, 1];\\n\\n\\tthis.mMatrix = mat4.create();\\n\\tthis.lcMatrix = mat4.create();\\n\\tthis.mMatrixInv = mat3.create();\\n\\tthis.selected = false;\\n\\tthis.global = false;\\n\\n\\t// Object draw function\\n\\tthis.draw = function (gl, pMatrix, vMatrix) {\\n\\t\\tgl.useProgram(Sphere.shaderProgram);\\n\\t\\tgl.uniformMatrix4fv(Sphere.locations.uniform.pMatrix, false, pMatrix);\\n\\t\\tgl.uniformMatrix4fv(Sphere.locations.uniform.mMatrix, false, this.mMatrix);\\n\\t\\tgl.uniformMatrix4fv(Sphere.locations.uniform.wMatrix, false, wMatrix);\\n\\t\\tgl.uniformMatrix4fv(Sphere.locations.uniform.vMatrix, false, vMatrix);\\n\\t\\tgl.uniformMatrix3fv(Sphere.locations.uniform.mMatrixInv, false, this.mMatrixInv);\\n\\t\\tgl.uniform3fv(Sphere.locations.uniform.pLight, lightPosition);\\n\\t\\tgl.uniform3fv(Sphere.locations.uniform.camera, [0, -10, 0]);\\n\\t\\tgl.uniform1f(Sphere.locations.uniform.specularEnabled, specularEnabled);\\n\\t\\tgl.uniform1f(Sphere.locations.uniform.phong, phong);\\n\\t\\tgl.uniform4fv(Sphere.locations.uniform.uColor, [1.0, 0.0, 0.0, 1.0]);\\n\\n\\t\\tgl.bindBuffer(gl.ARRAY_BUFFER, Sphere.buffers.pBuffer);\\n\\t\\tgl.vertexAttribPointer(Sphere.locations.attribute.vertPosition, Sphere.buffers.pComponents, gl.FLOAT, false, 0, 0);\\n\\t\\tgl.bindBuffer(gl.ARRAY_BUFFER, Sphere.buffers.cBuffer);\\n\\t\\tgl.vertexAttribPointer(Sphere.locations.attribute.vertColor, Sphere.buffers.cComponents, gl.FLOAT, false, 0, 0);\\n\\t\\tgl.bindBuffer(gl.ARRAY_BUFFER, Sphere.buffers.nBuffer);\\n\\t\\tgl.vertexAttribPointer(Sphere.locations.attribute.aNormal, Sphere.buffers.nComponents, gl.FLOAT, false, 0, 0);\\n\\n\\t\\tgl.bindBuffer(gl.ELEMENT_ARRAY_BUFFER, Sphere.buffers.iBuffer);\\n\\t\\tgl.drawElements(gl.TRIANGLES, Sphere.buffers.iBuffer.numItems, gl.UNSIGNED_SHORT, 0);\\n\\n\\t\\tgl.drawArrays(gl.TRIANGLES, 0, 18);\\n\\t};\\n\\n\\n\\t// Object drawLines function which are displayed as local coordinates in colors R for x, G for y and B for z axis\\n\\tthis.drawLines = function (gl, pMatrix) {\\n\\t\\tgl.useProgram(Sphere.shaderProgram);\\n\\n\\t\\tgl.bindBuffer(gl.ARRAY_BUFFER, Sphere.buffers.lBuffer);\\n\\t\\tgl.vertexAttribPointer(Sphere.locations.attribute.vertPosition, Sphere.buffers.lBuffer.itemSize, gl.FLOAT, false, 0, 0);\\n\\n\\t\\tgl.bindBuffer(gl.ARRAY_BUFFER, Sphere.buffers.lcBuffer);\\n\\t\\tgl.vertexAttribPointer(Sphere.locations.attribute.vertColor, Sphere.buffers.lcBuffer.itemSize, gl.FLOAT, false, 0, 0);\\n\\n\\t\\tgl.bindBuffer(gl.ARRAY_BUFFER, Sphere.buffers.nBuffer);\\n\\t\\tgl.vertexAttribPointer(Sphere.locations.attribute.aNormal, Sphere.buffers.nComponents, gl.FLOAT, false, 0, 0);\\n\\n\\n\\t\\tgl.bindBuffer(gl.ELEMENT_ARRAY_BUFFER, Sphere.buffers.liBuffer);\\n\\t\\tgl.uniformMatrix4fv(Sphere.locations.uniform.pMatrix, false, pMatrix);\\n\\t\\tgl.uniformMatrix4fv(Sphere.locations.uniform.mMatrix, false, this.lcMatrix);\\n\\n\\t\\tgl.drawElements(gl.LINES, Sphere.buffers.liBuffer.numItems, gl.UNSIGNED_SHORT, 0);\\n\\t};\\n\\n\\tthis.start = function () {\\n\\t\\tmat4.translate(this.mMatrix, this.mMatrix, this.lcPosition);\\n\\t\\tmat4.translate(this.lcMatrix, this.lcMatrix, this.lcPosition);\\n\\t};\\n\\n\\tthis.update = function (x, y, z, position = [0, 0, 0], scale = [1, 1, 1]) {\\n\\t\\t// Global transformations\\n\\t\\tif (this.global) {\\n\\t\\t\\t// Move the Object to the center\\n\\t\\t\\tmat4.identity(this.mMatrix);\\n\\t\\t\\t// Transform the object\\n\\t\\t\\tmat4.scale(this.mMatrix, this.mMatrix, scale);\\n\\t\\t\\tmat4.rotateX(this.mMatrix, this.mMatrix, x);\\n\\t\\t\\tmat4.rotateY(this.mMatrix, this.mMatrix, y);\\n\\t\\t\\tmat4.rotateZ(this.mMatrix, this.mMatrix, z);\\n\\t\\t\\tmat4.translate(this.mMatrix, this.mMatrix, position);\\n\\n\\t\\t\\t// Multiply with Local Coordinates to get to the right position\\n\\t\\t\\tmat4.multiply(this.mMatrix, this.mMatrix, this.lcMatrix);\\n\\n\\t\\t\\t// Move Local Coordinates where the object is\\n\\t\\t\\tmat4.identity(this.lcMatrix);\\n\\t\\t\\tmat4.multiply(this.lcMatrix, this.lcMatrix, this.mMatrix);\\n\\t\\t}\\n\\t\\t// Local transformations\\n\\t\\telse {\\n\\t\\t\\t// Transform Object\\n\\t\\t\\tmat4.translate(this.mMatrix, this.mMatrix, position);\\n\\t\\t\\tmat4.rotateX(this.mMatrix, this.mMatrix, x);\\n\\t\\t\\tmat4.rotateZ(this.mMatrix, this.mMatrix, z);\\n\\t\\t\\tmat4.rotateY(this.mMatrix, this.mMatrix, y);\\n\\t\\t\\tmat4.scale(this.mMatrix, this.mMatrix, scale);\\n\\n\\t\\t\\t// Transform Local Coordinates\\n\\t\\t\\tmat4.translate(this.lcMatrix, this.lcMatrix, position);\\n\\t\\t\\tmat4.rotateX(this.lcMatrix, this.lcMatrix, x);\\n\\t\\t\\tmat4.rotateZ(this.lcMatrix, this.lcMatrix, z);\\n\\t\\t\\tmat4.rotateY(this.lcMatrix, this.lcMatrix, y);\\n\\t\\t\\tmat4.scale(this.lcMatrix, this.lcMatrix, scale);\\n\\t\\t}\\n\\t\\tmat3.normalFromMat4(this.mMatrixInv, this.mMatrix);\\n\\t};\\n}\",\n \"function drawScene(){\\n\\n\\tvar radius = params.size*Math.sqrt(2)/4.\\n\\n\\t//draw the full spheres (this should be from an input file)\\n\\t//corners\\n\\tvar p1 = new THREE.Vector3(0, \\t\\t\\t\\t0, \\t\\t\\t\\t0);\\n\\tvar p2 = new THREE.Vector3(params.size, \\t0, \\t\\t\\t\\t0);\\n\\tvar p3 = new THREE.Vector3(0, \\t\\t\\t\\tparams.size, \\t0);\\n\\tvar p4 = new THREE.Vector3(params.size, \\tparams.size, \\t0);\\n\\tvar p5 = new THREE.Vector3(0, \\t\\t\\t\\t0,\\t\\t\\t\\tparams.size);\\n\\tvar p6 = new THREE.Vector3(params.size, \\t0, \\t\\t\\t\\tparams.size);\\n\\tvar p7 = new THREE.Vector3(0, \\t\\t\\t\\tparams.size, \\tparams.size);\\n\\tvar p8 = new THREE.Vector3(params.size,\\t\\tparams.size, \\tparams.size);\\n\\t//centers on planes\\n\\tvar p9 = new THREE.Vector3(0,\\t\\t\\t\\tparams.size/2.,\\tparams.size/2.);\\n\\tvar p10 = new THREE.Vector3(params.size/2.,\\t0,\\t\\t\\t\\tparams.size/2.);\\n\\tvar p11 = new THREE.Vector3(params.size/2.,\\tparams.size/2.,\\t0);\\n\\tvar p12 = new THREE.Vector3(params.size,\\tparams.size/2.,\\tparams.size/2.);\\n\\tvar p13 = new THREE.Vector3(params.size/2.,\\tparams.size,\\tparams.size/2.);\\n\\tvar p14 = new THREE.Vector3(params.size/2.,\\tparams.size/2.,\\tparams.size);\\n\\n\\tvar allP = [p1,p2,p3,p4,p5,p6,p7,p8, p9,p10,p11,p12,p13,p14]\\n\\tallP.forEach(function(p){\\n\\t\\tvar mesh = drawSphere(radius, params.sphereSegments, params.sphereSegments, params.defaultOuterOpacity, params.sphereColor, p);\\n\\t\\tparams.spheres.push(mesh);\\n\\t})\\n\\t\\n\\t//half spheres\\n\\tvar r9 = new THREE.Vector3(0,\\t\\t\\t\\tMath.PI/2.,\\t\\t0);\\n\\tvar r10 = new THREE.Vector3(-Math.PI/2.,\\t0,\\t\\t\\t\\t0);\\n\\tvar r11 = new THREE.Vector3(0, \\t\\t\\t\\t0,\\t\\t\\t\\t0);\\n\\tvar r12 = new THREE.Vector3(0, \\t\\t\\t\\t-Math.PI/2.,\\t0);\\n\\tvar r13 = new THREE.Vector3(Math.PI/2., \\t0, \\t\\t\\t\\t0);\\n\\tvar r14 = new THREE.Vector3(Math.PI,\\t\\t0,\\t\\t\\t0);\\n\\n\\tallP = [p9,p10,p11,p12,p13,p14]\\n\\tvar allR = [r9,r10,r11,r12,r13,r14]\\n\\tallP.forEach(function(p, i){\\n\\t\\tvar mesh = drawHalfSphere(radius, params.sphereSegments, params.sphereSegments, params.defaultInnerOpacity, params.sphereColor, p, allR[i]);\\n\\t\\tparams.hemiSpheres.push(mesh);\\n\\t})\\n\\n\\n\\tvar r1 = new THREE.Vector3(0,\\t\\t\\t\\tMath.PI/2.,\\t\\t0); \\n\\tvar r2 = new THREE.Vector3(0,\\t\\t\\t\\t0,\\t\\t\\t\\t0); \\n\\tvar r3 = new THREE.Vector3(Math.PI/2.,\\t\\tMath.PI/2.,\\t\\t0); \\n\\tvar r4 = new THREE.Vector3(Math.PI/2.,\\t\\t0,\\t\\t\\t\\t0);\\n\\tvar r5 = new THREE.Vector3(0,\\t\\t\\t\\tMath.PI/2.,\\t\\t-Math.PI/2.); \\n\\tvar r6 = new THREE.Vector3(0,\\t\\t\\t\\t-Math.PI/2.,\\t0);\\n\\tvar r7 = new THREE.Vector3(Math.PI/2.,\\t\\t0,\\t\\t\\t\\tMath.PI); \\n\\tvar r8 = new THREE.Vector3(Math.PI,\\t\\t0,\\t\\t\\t\\t0); \\n\\tallP = [p1,p2,p3,p4,p5,p6,p7,p8]\\n\\tallR = [r1,r2,r3,r4,r5,r6,r7,r8]\\n\\tallP.forEach(function(p, i){\\n\\t\\tvar mesh = drawQuarterSphere(radius, params.sphereSegments, params.sphereSegments, params.defaultInnerOpacity, params.sphereColor, p, allR[i]);\\n\\t\\tparams.hemiSpheres.push(mesh);\\n\\t})\\n\\n\\n\\t//draw slice\\n\\tvar p = new THREE.Vector3(params.size,\\tparams.size/2.,\\tparams.size/2.); \\n\\tvar r = new THREE.Vector3(0,\\t\\t\\tMath.PI/2.,\\t\\t0); \\n\\n\\tvar slice = drawSlice(2.*params.size, p, r, params.sliceOpacity, params.sliceColor);\\n\\tparams.sliceMesh.push(slice.plane);\\n\\tparams.sliceMesh.push(slice.mesh);\\n\\n\\n\\t//draw the box\\n\\tdrawBox();\\n\\n\\n\\n\\t//lights\\n\\taddLights()\\n\\n\\n}\",\n \"function Sphere(center, radius, color, emission, reflectionType) {\\n this.center = center;\\n this.radius = radius;\\n this.color = color;\\n this.emission = emission;\\n this.reflectionType = reflectionType; // DIFFUSE, SPECULAR, REFRACTIVE\\n}\",\n \"plotRoutes() {\\n for (let r of this.mapRoutes) {\\n r.plotPath(this.map);\\n }\\n }\",\n \"function cs_geocentric_to_geodetic (cs, p) {\\n\\n var X =p.x;\\n var Y = p.y;\\n var Z = p.z;\\n var Longitude;\\n var Latitude;\\n var Height;\\n\\n var W; /* distance from Z axis */\\n var W2; /* square of distance from Z axis */\\n var T0; /* initial estimate of vertical component */\\n var T1; /* corrected estimate of vertical component */\\n var S0; /* initial estimate of horizontal component */\\n var S1; /* corrected estimate of horizontal component */\\n var Sin_B0; /* Math.sin(B0), B0 is estimate of Bowring aux variable */\\n var Sin3_B0; /* cube of Math.sin(B0) */\\n var Cos_B0; /* Math.cos(B0) */\\n var Sin_p1; /* Math.sin(phi1), phi1 is estimated latitude */\\n var Cos_p1; /* Math.cos(phi1) */\\n var Rn; /* Earth radius at location */\\n var Sum; /* numerator of Math.cos(phi1) */\\n var At_Pole; /* indicates location is in polar region */\\n\\n X = parseFloat(X); // cast from string to float\\n Y = parseFloat(Y);\\n Z = parseFloat(Z);\\n\\n At_Pole = false;\\n if (X != 0.0)\\n {\\n Longitude = Math.atan2(Y,X);\\n }\\n else\\n {\\n if (Y > 0)\\n {\\n Longitude = HALF_PI;\\n }\\n else if (Y < 0)\\n {\\n Longitude = -HALF_PI;\\n }\\n else\\n {\\n At_Pole = true;\\n Longitude = 0.0;\\n if (Z > 0.0)\\n { /* north pole */\\n Latitude = HALF_PI;\\n }\\n else if (Z < 0.0)\\n { /* south pole */\\n Latitude = -HALF_PI;\\n }\\n else\\n { /* center of earth */\\n Latitude = HALF_PI;\\n Height = -cs.b;\\n return;\\n }\\n }\\n }\\n W2 = X*X + Y*Y;\\n W = Math.sqrt(W2);\\n T0 = Z * AD_C;\\n S0 = Math.sqrt(T0 * T0 + W2);\\n Sin_B0 = T0 / S0;\\n Cos_B0 = W / S0;\\n Sin3_B0 = Sin_B0 * Sin_B0 * Sin_B0;\\n T1 = Z + cs.b * cs.ep2 * Sin3_B0;\\n Sum = W - cs.a * cs.es * Cos_B0 * Cos_B0 * Cos_B0;\\n S1 = Math.sqrt(T1*T1 + Sum * Sum);\\n Sin_p1 = T1 / S1;\\n Cos_p1 = Sum / S1;\\n Rn = cs.a / Math.sqrt(1.0 - cs.es * Sin_p1 * Sin_p1);\\n if (Cos_p1 >= COS_67P5)\\n {\\n Height = W / Cos_p1 - Rn;\\n }\\n else if (Cos_p1 <= -COS_67P5)\\n {\\n Height = W / -Cos_p1 - Rn;\\n }\\n else\\n {\\n Height = Z / Sin_p1 + Rn * (cs.es - 1.0);\\n }\\n if (At_Pole == false)\\n {\\n Latitude = Math.atan(Sin_p1 / Cos_p1);\\n }\\n\\n p.x = Longitude;\\n p.y =Latitude;\\n p.z = Height;\\n return 0;\\n}\",\n \"function\\ntb_project_to_sphere(r, x, y)\\n{\\n var d, t, z;\\n \\n d = Math.sqrt(x*x + y*y);\\n if (d < r * 0.70710678118654752440) { /* Inside sphere */\\n z = Math.sqrt(r*r - d*d);\\n } else { /* On hyperbola */\\n t = r / 1.41421356237309504880;\\n z = t*t / d;\\n }\\n return z;\\n}\",\n \"function calcSpheric(coords, dt) {\\n if (!dw.isTurnable()) return;\\n var proj = dw.initProj();\\n var rect = dw.viewsizeOf(),\\n skyRadius = .32 * Math.sqrt((rect[2] - rect[0]) * (rect[2] - rect[0]) + (rect[3] - rect[1]) * (rect[3] - rect[1])),\\n gmst = Starry.siderealTime(dt),\\n skyRotationAngle = gmst / 12.0 * Math.PI;\\n coords[0] /= skyRadius * Math.PI / 180;\\n coords[1] /= skyRadius * Math.PI / 180;\\n var cy = -proj.lat0 * 180 / Math.PI,\\n cx = lat * 180 / Math.PI + skyRotationAngle * 180 / Math.PI;\\n var skyproj = '+proj=ortho +units=m +a=' + proj.a + ' +b=' + proj.b + ' +lon_0=' + cx + ' +lat_0=' + cy;\\n Proj4js.defs['SKY'] = skyproj;\\n dw.projload['SKY'] = new Proj4js.Proj('SKY');\\n var pt = dw.transformCoords('SKY', 'epsg:4326', coords);\\n if (pt) {\\n // backside\\n pt[0] = MUtil.ang360(180 - (pt[0] - cx) + cx) * Math.PI / 180;\\n pt[1] = pt[1] * Math.PI / 180;\\n }\\n return pt;\\n}\",\n \"display() {\\n strokeWeight(1);\\n stroke(200);\\n fill(200);\\n beginShape();\\n for (let i = 0; i < this.surface.length; i++) {\\n let v = scaleToPixels(this.surface[i]);\\n vertex(v.x, v.y);\\n }\\n vertex(width, height);\\n vertex(0, height);\\n endShape(CLOSE);\\n }\",\n \"function createHemisphereGeometry(radius,dir,cu,cv) {\\n let r = radius;\\n\\n var geom = new THREE.Geometry(); \\n\\n let points = [];\\n\\n let num_z_segments = 16;\\n let num_xy_segments = 32;\\n\\n let uvs = [];\\n let margin = 0.05;\\n let ru = 0.25 * (1.0 - margin);\\n let rv = 0.5 * (1.0 - margin);;\\n\\n let half_pi = Math.PI / 2.0;\\n for(let s=0; s<num_z_segments; s++) {\\n let zc = (s / num_z_segments) * half_pi;\\n\\n for(let t=0; t<num_xy_segments; t++) {\\n\\n // angle of rotation on xy plane in radians\\n let xyc = (t / num_xy_segments) * (Math.PI * 2.0) * dir;\\n\\n let x = Math.cos(xyc) * Math.cos(zc) * r;\\n let y = Math.sin(xyc) * Math.cos(zc) * r;\\n let z = Math.sin(zc) * r * dir * (-1.0);\\n\\n geom.vertices.push(new THREE.Vector3(x,y,z));\\n\\n let u = cu + (Math.cos(xyc) * ru * (num_z_segments - s) / num_z_segments) * dir;\\n let v = cv + Math.sin(xyc) * rv * (num_z_segments - s) / num_z_segments;\\n uvs.push( new THREE.Vector2(u,v) );\\n }\\n }\\n\\n // Add the last one vertex to close the top of the dome\\n geom.vertices.push(new THREE.Vector3(0,0,r * dir * (-1.0)));\\n uvs.push( new THREE.Vector2(cu,cv) );\\n\\n // Faces (polygon indices)\\n\\n for(let s=0; s<num_z_segments-1; s++) {\\n for(let t=0; t<num_xy_segments; t++) {\\n //let i = ;\\n let i0 = s * num_xy_segments + t;\\n let i1 = s * num_xy_segments + (t+1) % num_xy_segments;\\n let i2 = (s+1) * num_xy_segments + (t+1) % num_xy_segments;\\n let i3 = (s+1) * num_xy_segments + t;\\n geom.faces.push( new THREE.Face3(i0,i1,i2) );\\n geom.faces.push( new THREE.Face3(i0,i2,i3) );\\n\\n geom.faceVertexUvs[0].push([ uvs[i0], uvs[i1], uvs[i2] ]);\\n geom.faceVertexUvs[0].push([ uvs[i0], uvs[i2], uvs[i3] ]);\\n }\\n }\\n\\n // Close the hole\\n let i2 = num_z_segments * num_xy_segments;\\n for(let t=0; t<num_xy_segments; t++) {\\n let i0 = (num_z_segments-1) * num_xy_segments + t;\\n let i1 = (num_z_segments-1) * num_xy_segments + (t+1) % num_xy_segments;\\n geom.faces.push( new THREE.Face3(i0,i1,i2) );\\n geom.faceVertexUvs[0].push([ uvs[i0], uvs[i1], uvs[i2] ]);\\n }\\n\\n return geom;\\n}\",\n \"function createSphereVertices(radius,numRings,vertPerRing) {\\n\\tvar r = radius\\n\\tnumRings = numRings+1;\\n\\tvar phi = Math.PI/numRings;\\n\\tvar theta = 2*Math.PI/vertPerRing;\\n\\tvar vertices = []\\n\\tfor (var i = 0; i<numRings+1; i++) { //Should include \\\"ring\\\" for top/bot points\\n\\t\\tvertices.push([])\\n\\t\\t\\tfor (var j = 0; j<vertPerRing; j++) {\\n\\t\\t\\t\\tvar y = r*Math.cos(i*phi)\\n\\t\\t\\t\\tvar x = r*Math.sin(i*phi)*Math.cos(j*theta);// + (i/2)*theta)\\n\\t\\t\\t\\tvar z = r*Math.sin(i*phi)*Math.sin(j*theta);// + (i/2)*theta)\\n\\t\\t\\t\\t\\n\\t\\t\\t\\tvertices[i].push([x,y,z])\\n\\t\\t\\t}\\n\\t}\\n\\tvar triangle_strip = [];\\n\\tfor (var i = 0; i<numRings; i++) {\\n\\t\\tvar li = vertices[i].length\\n\\t\\tvar li1 = vertices[i+1].length\\n\\t\\ttriangle_strip = triangle_strip.concat(vertices[i][li-1])\\n\\t\\ttriangle_strip = triangle_strip.concat(vertices[i+1][li1-1])\\n\\t\\tfor (var j = 0; j<vertPerRing; j++) {\\n\\t\\t\\ttriangle_strip = triangle_strip.concat(vertices[i][j])\\n\\t\\t\\ttriangle_strip = triangle_strip.concat(vertices[i+1][j])\\n\\t\\t}\\n\\t\\ttriangle_strip = triangle_strip.concat(vertices[i][0])\\n\\t\\ttriangle_strip = triangle_strip.concat(vertices[i+1][0])\\n\\t}\\n\\tvar numItems = triangle_strip.length/3\\t//based on 3-vector\\n\\treturn [triangle_strip,numItems]\\n}\",\n \"function Sphere(center, radius, mat) {\\n this.center = vec3.create(center);\\n this.radius = radius;\\n this.mat = mat;\\n this.id = ++SPHERE_NB;\\n\\n gl.useProgram(shaderProgram);\\n this.centerLocation = gl.getUniformLocation(shaderProgram, \\\"sphere\\\"+this.id+\\\"_center\\\");\\n this.radiusLocation = gl.getUniformLocation(shaderProgram, \\\"sphere\\\"+this.id+\\\"_radius\\\");\\n this.mat.createUniform(this);\\n this.updateUniform = function () {\\n gl.uniform3f(this.centerLocation,this.center[0],this.center[1],this.center[2]);\\n gl.uniform1f(this.radiusLocation,this.radius);\\n this.mat.updateUniform();\\n };\\n this.updateUniform();\\n\\n this.move = function (direction){\\n this.center[0] += direction[0];\\n this.center[1] += direction[1];\\n this.center[2] += direction[2];\\n gl.uniform3f(this.centerLocation,this.center[0],this.center[1],this.center[2]);\\n }\\n}\",\n \"function draw3() {\\n var a = 0.86,\\n // b controls tightness and direction of spiral. b=0 is a circle \\n // b->infinity the spiral approaches a straight line\\n b = 0.3,\\n //b = 0.5,\\n rotations = 3.2,\\n radius_max = DIAMETER,\\n \\n arms = 2,\\n \\n alpha = 0.5,\\n beta = 1,\\n \\n x_0 = 0,\\n sigma = 6;\\n \\n var theta_min = 0,\\n theta_max = rotations * (Math.PI * 2);\\n for (var j = 0; j < arms; j++) {\\n \\n \\n for (var i = 0; i < PARTICLE_COUNT / arms; i++) {\\n \\n // Create a new star\\n var star = Object.create(Star);\\n \\n // Create a random theta\\n var theta = Math.random() * (theta_max - theta_min + 1) + theta_min\\n \\n // Adjust the b value based on which arm we are calculating.\\n b2 = b + (0.5 * arms);\\n \\n // Now use the formula for the logarithmic spiral to get the radius\\n var radius = Math.pow(a * Math.E, b2 * theta);\\n \\n // Use the quantile function (inverse cdf) of the Cauchy\\n // distribution to spread the stars from the mainline\\n var rad_mod = x_0 + sigma * Math.tan(Math.PI * (Math.random() - 0.5));\\n //radius = radius + rad_mod;\\n \\n // Convert to cartesian\\n star.x = (radius * Math.cos(theta)) + (DIAMETER / 2);\\n star.y = (radius * Math.sin(theta)) + (DIAMETER / 2);\\n \\n galaxy.stars.push(star);\\n \\n //sys.puts(\\\" created star [\\\" + i + \\\"] at (\\\" + star.x + \\\",\\\" + star.y + \\\")\\\");\\n }\\n }\\n \\n}\",\n \"display() \\n { \\n this.scene.pushMatrix();\\n this.semiSphere2.display();\\n this.scene.popMatrix();\\n }\",\n \"function plotGraph(){\\n createAxis();\\n // zoom.x(x).y(y);\\n // console.log('setting scales');\\n // console.log(x);\\n // console.log(y);\\n updateBoundaryGraph.setScales(x,y);\\n }\",\n \"function drawDonut() {\\n for (let i = 0; i <= 360; i += angleStep) {\\n let x = width * sin(i);\\n let y = height * cos(i);\\n let z = 0;\\n let center = { x, y, z };\\n circlesVertices.push(createCircleVertices(center, i, 1));\\n }\\n drawVertices();\\n}\",\n \"function zoomed() {\\n\\n\\n \\tprojection.scale(d3.event.scale);\\n\\n svgGroup.selectAll(\\\".land\\\")\\n .attr(\\\"d\\\", path);\\n svgGroup.selectAll(\\\".boundary\\\")\\n .attr(\\\"d\\\", path);\\n svgGroup.selectAll(\\\".saskatoon\\\")\\n .attr(\\\"d\\\", path);\\n svgGroup.selectAll(\\\".saskatoonFOV\\\")\\n .attr(\\\"d\\\", path);\\n svgGroup.selectAll(\\\".princegeorge\\\")\\n .attr(\\\"d\\\", path);\\n svgGroup.selectAll(\\\".princegeorgeFOV\\\")\\n .attr(\\\"d\\\", path);\\n svgGroup.selectAll(\\\".clyde\\\")\\n .attr(\\\"d\\\", path);\\n svgGroup.selectAll(\\\".clydeFOV\\\")\\n .attr(\\\"d\\\", path);\\n svgGroup.selectAll(\\\".rankin\\\")\\n .attr(\\\"d\\\", path);\\n svgGroup.selectAll(\\\".rankinFOV\\\")\\n .attr(\\\"d\\\", path);\\n svgGroup.selectAll(\\\".inuvik\\\")\\n .attr(\\\"d\\\", path);\\n svgGroup.selectAll(\\\".inuvikFOV\\\")\\n .attr(\\\"d\\\", path);\\n svgGroup.selectAll(\\\"#sphere\\\")\\n .attr(\\\"d\\\", path);\\n\\n svgGroup.selectAll(\\\".circles\\\")\\n\\t\\t.remove()\\n\\n\\tdrawPoints(\\\"saskatoon\\\",\\\"green\\\");\\n\\tdrawPoints(\\\"rankin\\\",\\\"blue\\\");\\n drawPoints(\\\"princegeorge\\\",\\\"red\\\");\\n drawPoints(\\\"inuvik\\\",\\\"orange\\\");\\n drawPoints(\\\"clyde\\\",\\\"purple\\\"); \\n}\",\n \"show()\\n{\\n\\t var theta = this.vel.heading() + radians(90);\\n\\t fill(100, 100);\\n\\t stroke(0);\\n\\t strokeWeight(1);\\n\\t push();\\n\\t translate(this.pos.x,this.pos.y);\\n\\t rotate(theta);\\n\\t beginShape();\\n\\t vertex(0, -this.r*2);\\n\\t vertex(-this.r, this.r*2);\\n\\t vertex(this.r, this.r*2);\\n\\t endShape(CLOSE);\\n\\t pop();\\n}\",\n \"function Sphere(radius){\\n return -1;\\n }\",\n \"function drawShapes() {\\n //reference methods: http://glmatrix.net/docs/module-mat4.html\\n \\n let teapotModelMatrix = glMatrix.mat4.create();\\n let teapotColumnModelMatrix = glMatrix.mat4.create();\\n let teapotTopModelMatrix = glMatrix.mat4.create();\\n let teapotBaseModelMatrix = glMatrix.mat4.create();\\n \\n let sphereModelMatrix = glMatrix.mat4.create();\\n let sphereColumnModelMatrix = glMatrix.mat4.create();\\n let sphereTopModelMatrix = glMatrix.mat4.create();\\n let sphereBaseModelMatrix = glMatrix.mat4.create();\\n \\n let coneModelMatrix = glMatrix.mat4.create();\\n let coneColumnModelMatrix = glMatrix.mat4.create();\\n let coneTopModelMatrix = glMatrix.mat4.create();\\n let coneBaseModelMatrix = glMatrix.mat4.create();\\n\\n \\n //*************************************************************************\\n //Sphere-- change this orienation to influence the rest...\\n transformMatrix(sphereModelMatrix, sphereModelMatrix, 't', 4, .8, 0, 0);\\n transformMatrix(sphereModelMatrix, sphereModelMatrix, 's', 2, 2, 2, 0);\\n transformMatrix(sphereModelMatrix, sphereModelMatrix, 'rx', 0, 0, 0, radians(-90) );\\n gl.uniformMatrix4fv (program.uModelT, false, sphereModelMatrix);\\n gl.bindVertexArray(mySphere.VAO);\\n gl.drawElements(gl.TRIANGLES, mySphere.indices.length, gl.UNSIGNED_SHORT, 0);\\n \\n //Sphere Column\\n transformMatrix( sphereModelMatrix, sphereColumnModelMatrix, 'rx', 0, 0, 0, radians(180) );\\n transformMatrix( sphereColumnModelMatrix, sphereColumnModelMatrix, 't', 0, 0, 1.5, 0 );\\n transformMatrix( sphereColumnModelMatrix, sphereColumnModelMatrix, 's', 1, 1, 2.05, 0 );\\n gl.uniformMatrix4fv (program.uModelT, false, sphereColumnModelMatrix);\\n gl.bindVertexArray(sphereColumn.VAO);\\n gl.drawElements(gl.TRIANGLES, sphereColumn.indices.length, gl.UNSIGNED_SHORT, 0);\\n \\n //sphere Column Top\\n transformMatrix( sphereModelMatrix, sphereTopModelMatrix, 'rx', 0, 0, 0, radians(180) );\\n transformMatrix( sphereTopModelMatrix, sphereTopModelMatrix, 't', 0, 0, .5, 0 );\\n transformMatrix( sphereTopModelMatrix, sphereTopModelMatrix, 's', 1.5, 1.5, .25, 0 );\\n gl.uniformMatrix4fv (program.uModelT, false, sphereTopModelMatrix);\\n gl.bindVertexArray(sphereTop.VAO);\\n gl.drawElements(gl.TRIANGLES, sphereTop.indices.length, gl.UNSIGNED_SHORT, 0);\\n \\n //sphere Column Base\\n transformMatrix( sphereModelMatrix, sphereBaseModelMatrix, 'rx', 0, 0, 0, radians(180) );\\n transformMatrix( sphereBaseModelMatrix, sphereBaseModelMatrix, 't', 0, 0, 2.65, 0 );\\n transformMatrix( sphereBaseModelMatrix, sphereBaseModelMatrix, 's', 1.5, 1.5, .25, 0 );\\n gl.uniformMatrix4fv (program.uModelT, false, sphereBaseModelMatrix);\\n gl.bindVertexArray(sphereBase.VAO);\\n gl.drawElements(gl.TRIANGLES, sphereBase.indices.length, gl.UNSIGNED_SHORT, 0);\\n //*************************************************************************\\n \\n \\n //*************************************************************************\\n //Teapot-- did not do anything remotely hierarchical, just eyeballed it\\n transformMatrix( teapotModelMatrix, teapotModelMatrix, 'ry', 0, 0, 0, radians(180) );\\n gl.uniformMatrix4fv (program.uModelT, false, teapotModelMatrix);\\n gl.bindVertexArray(myTeapot.VAO);\\n gl.drawElements(gl.TRIANGLES, myTeapot.indices.length, gl.UNSIGNED_SHORT, 0);\\n \\n //Teapot Column\\n transformMatrix( teapotColumnModelMatrix, teapotColumnModelMatrix, 'rx', 0, 0, 0, radians(90) );\\n transformMatrix( teapotColumnModelMatrix, teapotColumnModelMatrix, 't', 0, 0, 2.5, 0 );\\n transformMatrix( teapotColumnModelMatrix, teapotColumnModelMatrix, 's', 2.2, 2.2, 4, 0 );\\n gl.uniformMatrix4fv (program.uModelT, false, teapotColumnModelMatrix);\\n gl.bindVertexArray(teapotColumn.VAO);\\n gl.drawElements(gl.TRIANGLES, teapotColumn.indices.length, gl.UNSIGNED_SHORT, 0);\\n \\n //Teapot Column Base\\n transformMatrix( teapotBaseModelMatrix, teapotBaseModelMatrix, 't', 0, -4.5, 0, 0);\\n transformMatrix( teapotBaseModelMatrix, teapotBaseModelMatrix, 's', 3, .5, 3, 0 );\\n gl.uniformMatrix4fv (program.uModelT, false, teapotBaseModelMatrix);\\n gl.bindVertexArray(teapotBase.VAO);\\n gl.drawElements(gl.TRIANGLES, teapotBase.indices.length, gl.UNSIGNED_SHORT, 0);\\n \\n //Teapot Column Top\\n transformMatrix( teapotTopModelMatrix, teapotTopModelMatrix, 't', 0, -.25, 0, 0);\\n transformMatrix( teapotTopModelMatrix, teapotTopModelMatrix, 's', 3, .5, 3, 0 );\\n gl.uniformMatrix4fv (program.uModelT, false, teapotTopModelMatrix);\\n gl.bindVertexArray(teapotTop.VAO);\\n gl.drawElements(gl.TRIANGLES, teapotTop.indices.length, gl.UNSIGNED_SHORT, 0);\\n //*************************************************************************\\n \\n \\n //*************************************************************************\\n //Cone-- change this orienation to influence the rest...\\n transformMatrix(coneModelMatrix, coneModelMatrix, 't', -4, .8, 0, 0);\\n transformMatrix(coneModelMatrix, coneModelMatrix, 's', 2, 2, 2, 0);\\n transformMatrix(coneModelMatrix, coneModelMatrix, 'rx', 0, 0, 0, radians(-90) );\\n gl.uniformMatrix4fv (program.uModelT, false, coneModelMatrix);\\n gl.bindVertexArray(myCone.VAO);\\n gl.drawElements(gl.TRIANGLES, myCone.indices.length, gl.UNSIGNED_SHORT, 0);\\n \\n //Cone Column\\n transformMatrix( coneModelMatrix, coneColumnModelMatrix, 'rx', 0, 0, 0, radians(180) );\\n transformMatrix( coneColumnModelMatrix, coneColumnModelMatrix, 't', 0, 0, 1.5, 0 );\\n transformMatrix( coneColumnModelMatrix, coneColumnModelMatrix, 's', 1, 1, 2.05, 0 );\\n gl.uniformMatrix4fv (program.uModelT, false, coneColumnModelMatrix);\\n gl.bindVertexArray(coneColumn.VAO);\\n gl.drawElements(gl.TRIANGLES, coneColumn.indices.length, gl.UNSIGNED_SHORT, 0);\\n \\n //Cone Column Top\\n transformMatrix( coneModelMatrix, coneTopModelMatrix, 'rx', 0, 0, 0, radians(180) );\\n transformMatrix( coneTopModelMatrix, coneTopModelMatrix, 't', 0, 0, .5, 0 );\\n transformMatrix( coneTopModelMatrix, coneTopModelMatrix, 's', 1.5, 1.5, .25, 0 );\\n gl.uniformMatrix4fv (program.uModelT, false, coneTopModelMatrix);\\n gl.bindVertexArray(coneTop.VAO);\\n gl.drawElements(gl.TRIANGLES, coneTop.indices.length, gl.UNSIGNED_SHORT, 0);\\n \\n //Cone Column Base\\n transformMatrix( coneModelMatrix, coneBaseModelMatrix, 'rx', 0, 0, 0, radians(180) );\\n transformMatrix( coneBaseModelMatrix, coneBaseModelMatrix, 't', 0, 0, 2.65, 0 );\\n transformMatrix( coneBaseModelMatrix, coneBaseModelMatrix, 's', 1.5, 1.5, .25, 0 );\\n gl.uniformMatrix4fv (program.uModelT, false, coneBaseModelMatrix);\\n gl.bindVertexArray(coneBase.VAO);\\n gl.drawElements(gl.TRIANGLES, coneBase.indices.length, gl.UNSIGNED_SHORT, 0);\\n //*************************************************************************\\n \\n}\",\n \"function init_latitude(gl) {\\n let vertices = [];\\n let color = [1, 0, 1];\\n for (var i = 0; i <= 360; i += 10) {\\n let j = (i * Math.PI) / 180;\\n let vert = [0, R * Math.cos(j), R * Math.sin(j)]; // drawing a circle on the YZ plane\\n vertices.push(vert[0], vert[1], vert[2]);\\n vertices.push(color[0], color[1], color[2]);\\n }\\n\\n let vao = gl.createVertexArray();\\n gl.bindVertexArray(vao);\\n let vbo = gl.createBuffer();\\n\\n gl.bindBuffer(gl.ARRAY_BUFFER, vbo);\\n gl.bufferData(gl.ARRAY_BUFFER, new Float32Array(vertices), gl.STATIC_DRAW);\\n\\n // stride is 6, 3 for positions and 3 for the color\\n gl.vertexAttribPointer(loc_aPosition, 3, gl.FLOAT, false, 4 * 6, 0); \\n gl.enableVertexAttribArray(loc_aPosition);\\n\\n // stride is 6, offset in this case is 3 color elements are located after 3 position elements..\\n gl.vertexAttribPointer(loc_aColor, 3, gl.FLOAT, false, 4 * 6, 4 * 3); \\n gl.enableVertexAttribArray(loc_aColor);\\n\\n gl.bindVertexArray(null);\\n gl.bindBuffer(gl.ARRAY_BUFFER, null);\\n\\n return { vao, n: vertices.length / 6 }; // since it has three coordinates and colors so devide by 6\\n}\",\n \"function Sphere( radius, segmentsY, segmentsX ) {\\n Drawable.call( this );\\n radius = radius || 1;\\n\\n segmentsY = segmentsY || 10;\\n segmentsX = segmentsX || segmentsY;\\n\\n var R = radius;\\n var p = segmentsY;\\n var m = segmentsX;\\n\\n var model = {\\n vertices: [],\\n indices: []\\n };\\n \\n var prev = function( x, m ) {\\n if ( x === 0 ) {\\n return ( m - 1 );\\n }\\n else {\\n return ( x -1 );\\n }\\n };\\n \\n var y, x, z, r,cnt = 0, cnt2 = 0;\\n for ( var i = 1; i < p-1; i++ ) { // end points are missing\\n y = R*Math.sin( -Math.PI/2 + i*Math.PI/( p - 1 ) );\\n r = R*Math.cos( -Math.PI/2 + i*Math.PI/( p - 1 ) );\\n //console.log( \\\"y , r \\\" ,y, r );\\n for ( var k = 0; k < m; k++ ) {\\n x = r*Math.cos( 2*Math.PI*k/ m );\\n z = r*Math.sin( 2*Math.PI*k/ m );\\n //console.log( x, z );\\n model.vertices[ cnt ] = x;\\n model.vertices[ cnt+1 ] = y;\\n model.vertices[ cnt+2 ] = z;\\n cnt = cnt+3;\\n }\\n //make the triangle\\n \\n \\n if ( i > 1 ) {\\n var st = ( i - 2 )*m;\\n for ( x = 0; x < m; x++ ) {\\n model.indices[ cnt2 ] = st + x;\\n model.indices[ cnt2+1 ] = st + prev( x, m ) + m;\\n model.indices[ cnt2+2 ] = st + x + m;\\n cnt2 += 3;\\n \\n model.indices[ cnt2 ] = st + x;\\n model.indices[ cnt2+1 ] = st + prev( x, m );\\n model.indices[ cnt2+2 ] = st + prev( x, m ) + m;\\n cnt2 += 3;\\n }\\n }\\n }\\n \\n model.vertices[ cnt ] = 0;\\n model.vertices[ cnt+1 ] = -R;\\n model.vertices[ cnt+2 ] = 0;\\n var down = cnt/3;\\n cnt += 3;\\n model.vertices[ cnt ] = 0;\\n model.vertices[ cnt+1 ] = R;\\n model.vertices[ cnt+2 ] = 0;\\n cnt += 3;\\n \\n var top = down + 1;\\n for ( x = 0; x < m; x++ ) {\\n model.indices[ cnt2 ] = down;\\n model.indices[ cnt2+1 ] = prev( x, m );\\n model.indices[ cnt2+2 ] = x;\\n cnt2 += 3;\\n \\n model.indices[ cnt2 ] = down - m + x;\\n model.indices[ cnt2+1 ] = down - m + prev( x, m );\\n model.indices[ cnt2+2 ] = top;\\n cnt2 +=3;\\n }\\n\\n\\n\\n var vertices = new Buffer().setData( model.vertices );\\n// uvcoords = new Buffer().setData( ret.uvcoords );\\n// normals = new Buffer().setData( ret.normals );\\n\\n vertices = new VertexAttribute( 'Position' ).setBuffer( vertices );\\n// uvcoords = new VertexAttribute( 'UVCoord' ).setBuffer( uvcoords ).setSize( 2 );\\n// normals = new VertexAttribute( 'Normal' ).setBuffer( normals );\\n\\n var indices = new Buffer( Buffer.ELEMENT_BUFFER ).setData( model.indices );\\n\\n m = new Mesh();\\n m.setVertexAttribute( vertices );\\n// m.setVertexAttribute( normals );\\n// m.setVertexAttribute( uvcoords );\\n m.setIndexBuffer( indices );\\n\\n this.mesh = m;\\n}\",\n \"function drawPoleZeroPlot() {\\n\\n zPlaneContext.clearRect(0, 0, 275, 280);\\n zPlaneContext.font = '12px Arial';\\n\\n // This helper function returns the pixel coordinates inside the $z$-plane canvas\\n // for a complex number `z`.\\n var coordinatesFromComplexNumber = function(z) {\\n return {\\n x: unitCircle.x + z.real * unitCircle.radius,\\n y: unitCircle.y - z.imaginary * unitCircle.radius\\n };\\n };\\n\\n // This helper function is used to determine the multiplicity of poles or\\n // zeros.\\n var countMultiplicity = function(result, z) {\\n var w = _.find(result, _.compose(_.partial(Complex.areEqual, z), function(w) { return w.z; }));\\n if (w !== undefined) {\\n w.multiplicity++;\\n }\\n else {\\n result.push( { z: z, multiplicity: 1 });\\n }\\n return result;\\n };\\n\\n // Draw a circle at each zero.\\n var zerosToRender = _.reduce(filter.zeros, countMultiplicity, []);\\n _.each(zerosToRender, function(zero) {\\n zPlaneContext.beginPath();\\n var p = coordinatesFromComplexNumber(zero.z);\\n var radius = Complex.areEqual(zero.z, selection) ? 4.5 : 4.0;\\n zPlaneContext.arc(p.x, p.y, radius, 0, 2 * Math.PI, false);\\n zPlaneContext.strokeStyle = Complex.areEqual(zero.z, hover) ? '#00677e' : '#00374e';\\n zPlaneContext.lineWidth = Complex.areEqual(zero.z, selection) ? 3.0 : 2.0;\\n zPlaneContext.stroke();\\n if (zero.multiplicity > 1) {\\n zPlaneContext.fillText(zero.multiplicity, p.x + 5, p.y - 5);\\n }\\n });\\n\\n // Draw a cross at each pole.\\n var polesToRender = _.reduce(filter.poles, countMultiplicity, []);\\n _.each(polesToRender, function(pole) {\\n zPlaneContext.beginPath();\\n var p = coordinatesFromComplexNumber(pole.z);\\n var radius = Complex.areEqual(pole.z, selection) ? 4.5 : 4.0;\\n zPlaneContext.moveTo(p.x - radius, p.y + radius);\\n zPlaneContext.lineTo(p.x + radius, p.y - radius);\\n zPlaneContext.moveTo(p.x - radius, p.y - radius);\\n zPlaneContext.lineTo(p.x + radius, p.y + radius);\\n zPlaneContext.strokeStyle = Complex.areEqual(pole.z, hover) ? '#00677e' : '#00374e';\\n zPlaneContext.lineWidth = Complex.areEqual(pole.z, selection) ? 3.0 : 2.0;\\n zPlaneContext.stroke();\\n if (pole.multiplicity > 1) {\\n zPlaneContext.fillText(pole.multiplicity, p.x + 5, p.y - 5);\\n }\\n });\\n }\",\n \"function ParaGeometry(parameter,scale)\\n{\\n var x = parameter.x*UnitOf(parameter.lunit)*scale; \\n\\tvar y = parameter.y*UnitOf(parameter.lunit)*scale; \\n\\tvar z = parameter.z*UnitOf(parameter.lunit)*scale; \\n\\tvar alpha = parameter.alpha*UnitOf(parameter.aunit)/UnitOf('deg');\\n\\tvar theta = parameter.theta*UnitOf(parameter.aunit)/UnitOf('deg');\\n\\tvar phi = parameter.phi*UnitOf(parameter.aunit)/UnitOf('deg'); \\n\\n var fDx = x/2;\\n var fDy = y/2;\\n var fDz = z/2;\\n \\n alpha=Math.min(alpha,360);\\n alpha=Math.PI*alpha/180;\\n\\n theta=Math.min(theta,360);\\n theta=Math.PI*theta/180;\\n\\n phi=Math.min(phi,180);\\n phi=Math.PI*phi/180;\\n\\n var fTalpha = Math.tan(alpha);\\n var fTthetaCphi = Math.tan(theta)*Math.cos(phi);\\n var fTthetaSphi = Math.tan(theta)*Math.sin(phi);\\n\\n \\tvar geometry = new THREE.Geometry();\\n\\n geometry.vertices.push( new THREE.Vector3(-fDz*fTthetaCphi-fDy*fTalpha-fDx, -fDz*fTthetaSphi-fDy, -fDz));\\n geometry.vertices.push( new THREE.Vector3(-fDz*fTthetaCphi-fDy*fTalpha+fDx, -fDz*fTthetaSphi-fDy, -fDz));\\n geometry.vertices.push( new THREE.Vector3(-fDz*fTthetaCphi+fDy*fTalpha-fDx, -fDz*fTthetaSphi+fDy, -fDz));\\n geometry.vertices.push( new THREE.Vector3(-fDz*fTthetaCphi+fDy*fTalpha+fDx, -fDz*fTthetaSphi+fDy, -fDz));\\n geometry.vertices.push( new THREE.Vector3(+fDz*fTthetaCphi-fDy*fTalpha-fDx, +fDz*fTthetaSphi-fDy, +fDz));\\n geometry.vertices.push( new THREE.Vector3(+fDz*fTthetaCphi-fDy*fTalpha+fDx, +fDz*fTthetaSphi-fDy, +fDz));\\n geometry.vertices.push( new THREE.Vector3(+fDz*fTthetaCphi+fDy*fTalpha-fDx, +fDz*fTthetaSphi+fDy, +fDz));\\n geometry.vertices.push( new THREE.Vector3(+fDz*fTthetaCphi+fDy*fTalpha+fDx, +fDz*fTthetaSphi+fDy, +fDz));\\n\\n geometry.faces.push( new THREE.Face3(0,2,1) );\\n geometry.faces.push( new THREE.Face3(2,3,1) );\\n\\n geometry.faces.push( new THREE.Face3(4,5,6) );\\n geometry.faces.push( new THREE.Face3(5,7,6) );\\n\\n geometry.faces.push( new THREE.Face3(0,1,4) );\\n geometry.faces.push( new THREE.Face3(1,5,4) );\\n\\n geometry.faces.push( new THREE.Face3(2,6,7) );\\n geometry.faces.push( new THREE.Face3(7,3,2) );\\n\\n geometry.faces.push( new THREE.Face3(0,4,2) );\\n geometry.faces.push( new THREE.Face3(4,6,2) );\\n\\n geometry.faces.push( new THREE.Face3(1,3,7) );\\n geometry.faces.push( new THREE.Face3(7,5,1) );\\n\\n return geometry;\\n\\n}\",\n \"function testSphere(){\\n \\\"use strict\\\";\\n\\n let testspheregeo = new THREE.SphereGeometry(1.0,24,24);\\n let testspheremat = new THREE.MeshPhongMaterial( {color: new THREE.Color(0.1,0.3,0.1) } );\\n let testsphere = new THREE.Mesh(testspheregeo, testspheremat);\\n testsphere.position.set(2.0,3.0,5.0);\\n testsphere.castShadow = true;\\n scene.add(testsphere);\\n\\n testsphere.animate = function () { this.rotation.y -= 0.01; this.position.y+=0.01 * Math.sin(this.rotation.y); }\\n animateobjects.push(testsphere);\\n}\",\n \"function draw() {\\n \\n\\tvar red = 0; // Color value defined\\n\\tvar green = 1;\\n\\tvar blue = 2;\\n\\tvar alpha = 3;\\n\\n\\tvar iter = 81;\\n\\n\\tif(os){ // if oscillation is set true by oscillate(), then do oscilation of \\n\\t\\t\\t\\t\\t\\t\\t\\t\\t\\t// julia set by using sin(angle) to set real c and cos(angle) to set imaginary c.\\n\\t\\tcx =0.7885*cos(angle);\\n\\t\\tcy =0.7785*sin(angle);\\n\\t\\tangle+= 0.04;\\n\\t}\\n\\n\\tvar zy = 0.0;\\n\\tvar zx = 0.0;\\n\\n loadPixels(); \\n\\n\\n // Interate through the window demision. 'width' and 'hieght' are the with and height of our window\\n for (var y = 0; y < height; y++) {\\n\\n for (var x = 0; x < width; x++) {\\n\\n\\t zy = map(y, 0, height, min_i , max_i); // use map() to scale the range so it will be from \\n\\t\\tzx = map(x, 0, width, minReal, maxReal); // minReal to maxReal and min_i to max_i\\n\\t\\t\\n\\t\\tif(!os && !clicked){ // if neither of 'os' or 'clicked' is true, cy and cx (real and imaginary c) will be the scale of zy and zx.\\n\\t\\t\\tcy = zy;\\n\\t\\t\\tcx = zx;\\n\\t\\t}\\n\\t\\t\\n var counter= 0;\\n\\n\\t\\t// calculate the mandelbrot / julia set using:\\n\\t\\t// mandelbrot: f(z) = z^2 + c where c is changing\\n\\t\\t// julia: f(z) = z^2 + c where c is constant\\n\\t\\twhile ((zx * zx + (zy * zy) < 16.0) && counter < iter) {\\n\\n\\t\\t\\tvar zx_temp = zx * zx - zy * zy +cx\\n\\n\\t\\t\\tzy = 2.0 * zx * zy+cy;\\n\\t\\t\\tzx = zx_temp;\\n\\n\\t\\t\\t++counter;\\n\\t\\t}\\n\\t\\t\\n\\t var color = 255;\\n\\n\\t\\tif(counter !=iter){\\n\\t\\t\\tcolor = counter;\\n\\t\\t}\\n\\n var pix = (x + y * width) * 4;\\n\\n pixels[pix + red] = sin(color)%255; // set pixels\\n pixels[pix + green] = color;\\n pixels[pix + blue] = color;\\n\\n pixels[pix+alpha] = 255;\\n }\\n }\\n\\n updatePixels(); \\n}\",\n \"render() {\\n MapPlotter.setUpFilteringButtons();\\n MapPlotter.readFiltersValues();\\n\\n MapPlotter.currentStateName = 'Texas';\\n MapPlotter.drawRaceDoughnut();\\n\\n MapPlotter.drawMap();\\n }\",\n \"function Figure() {\\n geometry = new THREE.ParametricGeometry(figureShoeSurface, 100, 100);\\n geometry.center();\\n}\",\n \"function Figure() {\\n geometry = new THREE.ParametricGeometry(figureShoeSurface, 100, 100);\\n geometry.center();\\n}\",\n \"function drawQuarterSphere(radius, widthSegments, heightSegments, opacity, color, position, rotation){\\n\\tvar sphere = new THREE.SphereGeometry(radius, widthSegments, heightSegments, 0, Math.PI/2., 0, Math.PI/2.)\\n\\tvar circle1 = new THREE.CircleGeometry(radius, widthSegments, 0., Math.PI/2.)\\n\\tvar circle2 = new THREE.CircleGeometry(radius, widthSegments, 0., Math.PI/2.)\\n\\tvar circle3 = new THREE.CircleGeometry(radius, widthSegments, 0., Math.PI/2.)\\n\\n\\tvar sphereMesh = new THREE.Mesh(sphere);\\n\\n\\tvar circle1Mesh = new THREE.Mesh(circle1);\\n\\tcircle1Mesh.rotation.set(0, 0, Math.PI/2.);\\n\\n\\tvar circle2Mesh = new THREE.Mesh(circle2);\\n\\tcircle2Mesh.rotation.set(Math.PI/2., 0, Math.PI/2.);\\n\\n\\tvar circle3Mesh = new THREE.Mesh(circle3);\\n\\tcircle3Mesh.rotation.set(Math.PI/2., Math.PI/2., 0);\\n\\n\\tvar singleGeometry = new THREE.Geometry();\\n\\n\\tsphereMesh.updateMatrix(); // as needed\\n\\tsingleGeometry.merge(sphereMesh.geometry, sphereMesh.matrix);\\n\\n\\tcircle1Mesh.updateMatrix(); // as needed\\n\\tsingleGeometry.merge(circle1Mesh.geometry, circle1Mesh.matrix);\\n\\n\\tcircle2Mesh.updateMatrix(); // as needed\\n\\tsingleGeometry.merge(circle2Mesh.geometry, circle2Mesh.matrix);\\n\\n\\tcircle3Mesh.updateMatrix(); // as needed\\n\\tsingleGeometry.merge(circle3Mesh.geometry, circle3Mesh.matrix);\\n\\n\\tvar material = new THREE.MeshPhongMaterial( { \\n\\t\\tcolor: color, \\n\\t\\tflatShading: false, \\n\\t\\ttransparent:true,\\n\\t\\t//shininess:50,\\n\\t\\topacity:opacity, \\n\\t\\tside:THREE.DoubleSide,\\n\\t});\\n\\n\\tvar mesh = new THREE.Mesh(singleGeometry, material);\\n\\tmesh.position.set(position.x, position.y, position.z);\\n\\tmesh.rotation.set(rotation.x, rotation.y, rotation.z);\\n\\tmesh.renderOrder = -1;\\n\\tparams.scene.add(mesh);\\n\\treturn mesh;\\n\\n}\",\n \"function plotUlam(poses) {\\n\\t\\t// Determine the bounds\\n\\t\\tvar bounds = {\\n\\t\\t\\tx: {\\n\\t\\t\\t\\tmin: 0,\\n\\t\\t\\t\\tmax: 0\\n\\t\\t\\t},\\n\\t\\t\\ty: {\\n\\t\\t\\t\\tmin: 0,\\n\\t\\t\\t\\tmax: 0\\n\\t\\t\\t}\\n\\t\\t};\\n\\t\\t$$.each(poses, function(pos) {\\n\\t\\t\\tif (pos.x < bounds.x.min) {\\n\\t\\t\\t\\tbounds.x.min = pos.x;\\n\\t\\t\\t}\\n\\t\\t\\tif (pos.x > bounds.x.max) {\\n\\t\\t\\t\\tbounds.x.max = pos.x;\\n\\t\\t\\t}\\n\\t\\t\\tif (pos.y < bounds.y.min) {\\n\\t\\t\\t\\tbounds.y.min = pos.y;\\n\\t\\t\\t}\\n\\t\\t\\tif (pos.y > bounds.y.max) {\\n\\t\\t\\t\\tbounds.y.max = pos.y;\\n\\t\\t\\t}\\n\\t\\t});\\n\\t\\tvar matrix = $$.makeArray([bounds.y.max - bounds.y.min + 1, bounds.x.max - bounds.x.min + 1], \\\" \\\");\\n\\t\\t$$.each(poses, function(pos) {\\n\\t\\t\\tvar x = pos.x - bounds.x.min,\\n\\t\\t\\t\\ty = pos.y - bounds.y.min,\\n\\t\\t\\t\\tstr = \\\"\\\" + pos.ix;\\n\\t\\t\\tif (matrix[y][x] != \\\" \\\") {\\n\\t\\t\\t\\tthrow new Error(\\\"Over-writing something!\\\");\\n\\t\\t\\t}\\n\\t\\t\\tmatrix[y][x] = str.substr(str.length - 1);\\n\\t\\t});\\n\\t\\t$$.each(matrix, \\\"reverse\\\", function(line) {\\n\\t\\t\\tconsole.log(\\\" \\\" + line.join(\\\"\\\"));\\n\\t\\t});\\n\\t}\",\n \"function renderPolarGrid() {\\n /*\\n * Polar initialization\\n */\\n var xRadialTickMax = Math.max( Math.abs( xTickMin), Math.abs( xTickMax)),\\n yRadialTickMax = Math.max( Math.abs( yTickMin), Math.abs( yTickMax)),\\n radialTickMin = 1,\\n radialTickMax = xRadialTickMax + yRadialTickMax,\\n radialTickMaxSquare = xRadialTickMax * xRadialTickMax +\\n yRadialTickMax * yRadialTickMax,\\n gridRatio = renderAttrs.gridSpacing.y / renderAttrs.gridSpacing.x,\\n isOriginVisibleInX = (xTickMin * xTickMax <= 0),\\n isOriginVisibleInY = (yTickMin * yTickMax <= 0);\\n \\n // Set maximum of radial tick range for rendering\\n while( radialTickMax * radialTickMax > radialTickMaxSquare) {\\n --radialTickMax;\\n }\\n ++radialTickMax;\\n \\n // Set minimum of radial tick range for rendering\\n if( !isOriginVisibleInX || !isOriginVisibleInY) {\\n var xRadialTickMin = Math.min( Math.abs( xTickMin), Math.abs( xTickMax)),\\n yRadialTickMin = Math.min( Math.abs( yTickMin), Math.abs( yTickMax));\\n if( isOriginVisibleInX) {\\n radialTickMin = yRadialTickMin;\\n }\\n else if( isOriginVisibleInY) {\\n radialTickMin = xRadialTickMin;\\n }\\n else {\\n // Origin not in X or Y range. Set radialTickMin from closest corner.\\n var radialTickMinSquare = xRadialTickMin * xRadialTickMin +\\n yRadialTickMin * yRadialTickMin;\\n while( radialTickMin * radialTickMin <= radialTickMinSquare) {\\n ++radialTickMin;\\n }\\n --radialTickMin;\\n }\\n }\\n \\n /*\\n * Polar annular rendering\\n */\\n \\n /**\\n Draws an annulus of dots at 15-deg intervals.\\n Based on RenderPolarGrid() in render_axis.c.\\n Uses several closure variables:\\n renderAttrs.radius -- the radius of the rendered dots\\n renderAttrs.color -- the color of the rendered dots\\n @param {Object} ctx -- the canvas context\\n @param {Object} iOrigin -- the center of the annulus\\n @param {Number} iRadius -- the { x, y } radius of the annulus\\n */\\n function renderAnnularDots(ctx, iOrigin, iRadius) {\\n var latticePt, // index of 15-deg polar line (0..23)\\n relativePt = { x: 0, y: 0 }, //\\n dotRadius = renderAttrs.radius,\\n // Lookup table so RenderPolarGrid can avoid using trig functions.\\n // Each pair gives {cos,sin} values for 15-deg increments in Quadrant I.\\n kCosSin15Deg = [\\n { cos: 1.0, sin: 0.0 }, // 0 deg\\n { cos: 0.96592582628907, sin: 0.25881904510252 }, // 15 deg\\n { cos: 0.86602540378444, sin: 0.5 }, // 30 deg\\n { cos: 0.70710678118655, sin: 0.70710678118655 }, // 45 deg\\n { cos: 0.5, sin: 0.86602540378444 }, // 60 deg\\n { cos: 0.25881904510252, sin: 0.96592582628907 }, // 75 deg\\n { cos: 0.0, sin: 1.0 } // 90 deg\\n ];\\n \\n ctx.fillStyle = renderAttrs.color;\\n for( latticePt = 0; latticePt < 7; ++latticePt) {\\n \\n relativePt.x = iRadius.x * kCosSin15Deg[latticePt].cos;\\n relativePt.y = iRadius.y * kCosSin15Deg[latticePt].sin;\\n\\n // Quadrant I\\n drawCircleFill(ctx, { x: iOrigin.x + relativePt.x,\\n y: iOrigin.y - relativePt.y }, dotRadius);\\n // Quadrant II\\n if( (latticePt > 0) && (latticePt < 6)) { // skip for axes\\n drawCircleFill(ctx, { x: iOrigin.x - relativePt.x,\\n y: iOrigin.y - relativePt.y }, dotRadius);\\n }\\n // Quadrant III\\n drawCircleFill(ctx, { x: iOrigin.x - relativePt.x,\\n y: iOrigin.y + relativePt.y }, dotRadius);\\n // Quadrant IV\\n if( (latticePt > 0) && (latticePt < 6)) { // skip for axes\\n drawCircleFill(ctx, { x: iOrigin.x + relativePt.x,\\n y: iOrigin.y + relativePt.y }, dotRadius);\\n }\\n }\\n }\\n \\n // Draw annular gridlines or dots\\n var renderFn = renderAttrs.grid === 'dotted'\\n ? renderAnnularDots\\n : drawEllipseFrame,\\n i;\\n for( i = 1; i <= radialTickMax; ++i) {\\n var radius = { x: i * renderAttrs.gridSpacing.x,\\n y: i * renderAttrs.gridSpacing.y };\\n renderFn( ctx, renderAttrs.origin, radius);\\n }\\n \\n /*\\n * Polar radial rendering\\n */\\n \\n /**\\n Utility function for determining if a given radial line is visible\\n given the origin placement within the canvas.\\n Based on RenderPolarGrid() in render_axis.c.\\n @param {Number} iTheta -- angle of the radial in radians\\n @param {Array of Points} iPts -- Array of two { x, y } points\\n defining the endpoints of the radial\\n @param {String} iProp -- 'x' or 'y' for the coordinate to be checked\\n @param {Object} iRange -- { min, max } values for the coordinate\\n @returns {Boolean} True if the radial is visible and should\\n be rendered, false otherwise.\\n */\\n function isRadialInRange( iTheta, iPts, iProp, iRange) {\\n if( iTheta === 0.0) {\\n return (iRange.min <= iPts[0][iProp]) && (iPts[0][iProp] <= iRange.max);\\n }\\n else if( iTheta > 0.0) {\\n return iPts[0][iProp] > iRange.max\\n ? iPts[1][iProp] <= iRange.max\\n : iPts[0][iProp] >= iRange.min;\\n }\\n else if( iTheta < 0.0) {\\n return iPts[0][iProp] < iRange.min\\n ? iPts[1][iProp] >= iRange.min\\n : iPts[0][iProp] <= iRange.max;\\n }\\n }\\n \\n // Draw radial gridlines\\n if( renderAttrs.grid === 'gridlines') {\\n var deltaTheta = Math.PI / 12.0, // increment by 15 deg\\n theta0 = - 2.0 * deltaTheta, // start at -30 deg\\n p0 = { x: renderAttrs.origin.x, y: renderAttrs.origin.y },\\n p1 = { x: renderAttrs.origin.x, y: renderAttrs.origin.y },\\n rp = [ { x: p0.x, y: p0.y }, { x: p1.x, y: p1.y } ],\\n theta, tangent;\\n\\n // Render the radials from -30 deg to 30 deg.\\n // These radials are clipped horizontally.\\n p0 = { x: renderXMin - renderAttrs.origin.x,\\n y: renderAttrs.origin.y };\\n rp[0].x = renderXMin;\\n p1.x = renderXMax - renderAttrs.origin.x;\\n rp[1].x = renderXMax;\\n\\n for( i = 0; i < 5; ++i) {\\n theta = theta0 + i * deltaTheta;\\n tangent = - Math.tan( theta) * gridRatio;\\n rp[0].y = renderAttrs.origin.y + p0.x * tangent;\\n rp[1].y = renderAttrs.origin.y + p1.x * tangent;\\n if( isRadialInRange( theta, rp, 'y',\\n { min: renderYMin, max: renderYMax })) {\\n drawLine( ctx, rp[0], rp[1]);\\n }\\n }\\n \\n // Render the radials from 45 deg to 135 deg.\\n // Let theta be the complement of the desired angle, so that\\n // we can still use tan() without dividing to find cotan().\\n // These radials are clipped vertically.\\n gridRatio = 1.0 / gridRatio;\\n p0.y = renderYMin - renderAttrs.origin.y;\\n rp[0].y = renderYMin;\\n p1.y = renderYMax - renderAttrs.origin.y;\\n rp[1].y = renderYMax;\\n \\n theta0 = 3 * deltaTheta; // start at 45 deg\\n for( i = 0; i < 7; ++i) {\\n theta = theta0 - i * deltaTheta;\\n tangent = - Math.tan( theta) * gridRatio;\\n rp[0].x = renderAttrs.origin.x + p0.y * tangent;\\n rp[1].x = renderAttrs.origin.x + p1.y * tangent;\\n if( isRadialInRange( theta, rp, 'x',\\n { min: renderXMin, max: renderXMax })) {\\n drawLine( ctx, rp[0], rp[1]);\\n }\\n }\\n }\\n }\",\n \"function createSphere(radius, hlines, vlines, color) {\\n var material = new THREE.MeshPhongMaterial();\\n material.color = new THREE.Color(color);\\n material.wireframe = false;\\n material.shininess = 100;\\n var geometry_sphere = new THREE.SphereGeometry(radius, hlines, vlines);\\n var ball = new THREE.Mesh(geometry_sphere, material);\\n return ball;\\n}\"\n]","isConversational":false},"negative_scores":{"kind":"list like","value":["0.64300853","0.631371","0.631371","0.6163995","0.60776424","0.6008311","0.59189767","0.58383954","0.58289444","0.5808101","0.5748349","0.5744434","0.56139386","0.56059897","0.5590826","0.5570486","0.55594295","0.5548546","0.5505314","0.54518604","0.54491204","0.54481673","0.54432285","0.54424685","0.5420934","0.54164815","0.54089534","0.54077363","0.53985053","0.53601867","0.53371674","0.53319824","0.5317635","0.53171897","0.5316604","0.531189","0.5293096","0.528842","0.5282282","0.5274708","0.5274197","0.5260175","0.52582973","0.52454656","0.52447397","0.5243358","0.52334344","0.52299136","0.5227786","0.52213234","0.5209146","0.5193235","0.5181709","0.5174626","0.5161564","0.5155097","0.51466775","0.5135736","0.5131913","0.51256764","0.51154673","0.51107377","0.51023734","0.50868696","0.50864506","0.5084724","0.5075592","0.5072381","0.50641465","0.5063681","0.5054613","0.505234","0.50480825","0.5042818","0.5040686","0.5037962","0.5031296","0.50144124","0.50076514","0.50031185","0.50027233","0.5001403","0.49958244","0.4993925","0.49812624","0.49741936","0.49706975","0.49671176","0.49443048","0.49423853","0.49387807","0.49349663","0.49264455","0.49262333","0.4923863","0.4923863","0.491693","0.49166143","0.49163544","0.49131718"],"string":"[\n \"0.64300853\",\n \"0.631371\",\n \"0.631371\",\n \"0.6163995\",\n \"0.60776424\",\n \"0.6008311\",\n \"0.59189767\",\n \"0.58383954\",\n \"0.58289444\",\n \"0.5808101\",\n \"0.5748349\",\n \"0.5744434\",\n \"0.56139386\",\n \"0.56059897\",\n \"0.5590826\",\n \"0.5570486\",\n \"0.55594295\",\n \"0.5548546\",\n \"0.5505314\",\n \"0.54518604\",\n \"0.54491204\",\n \"0.54481673\",\n \"0.54432285\",\n \"0.54424685\",\n \"0.5420934\",\n \"0.54164815\",\n \"0.54089534\",\n \"0.54077363\",\n \"0.53985053\",\n \"0.53601867\",\n \"0.53371674\",\n \"0.53319824\",\n \"0.5317635\",\n \"0.53171897\",\n \"0.5316604\",\n \"0.531189\",\n \"0.5293096\",\n \"0.528842\",\n \"0.5282282\",\n \"0.5274708\",\n \"0.5274197\",\n \"0.5260175\",\n \"0.52582973\",\n \"0.52454656\",\n \"0.52447397\",\n \"0.5243358\",\n \"0.52334344\",\n \"0.52299136\",\n \"0.5227786\",\n \"0.52213234\",\n \"0.5209146\",\n \"0.5193235\",\n \"0.5181709\",\n \"0.5174626\",\n \"0.5161564\",\n \"0.5155097\",\n \"0.51466775\",\n \"0.5135736\",\n \"0.5131913\",\n \"0.51256764\",\n \"0.51154673\",\n \"0.51107377\",\n \"0.51023734\",\n \"0.50868696\",\n \"0.50864506\",\n \"0.5084724\",\n \"0.5075592\",\n \"0.5072381\",\n \"0.50641465\",\n \"0.5063681\",\n \"0.5054613\",\n \"0.505234\",\n \"0.50480825\",\n \"0.5042818\",\n \"0.5040686\",\n \"0.5037962\",\n \"0.5031296\",\n \"0.50144124\",\n \"0.50076514\",\n \"0.50031185\",\n \"0.50027233\",\n \"0.5001403\",\n \"0.49958244\",\n \"0.4993925\",\n \"0.49812624\",\n \"0.49741936\",\n \"0.49706975\",\n \"0.49671176\",\n \"0.49443048\",\n \"0.49423853\",\n \"0.49387807\",\n \"0.49349663\",\n \"0.49264455\",\n \"0.49262333\",\n \"0.4923863\",\n \"0.4923863\",\n \"0.491693\",\n \"0.49166143\",\n \"0.49163544\",\n \"0.49131718\"\n]","isConversational":false},"document_score":{"kind":"string","value":"0.6640652"},"document_rank":{"kind":"string","value":"0"}}},{"rowIdx":4598,"cells":{"query":{"kind":"string","value":"\\ ROUTE MAP /\\"},"document":{"kind":"string","value":"function checkDataForInsert(req, res, next) {\n\tlet data = req.body\n\tif (!req.user.id || !data.topic_id || !data.msg) {\n\t\tres.resp(403, errmsg.MISSING_DATA)\n\t} else {\n\t\tif (data.msg.match(regex.string_blank)) {\n\t\t\tres.resp(403, errmsg.BLANK_STRING)\n\t\t}\n\t\tif (data.msg.length > global.limit.msg) {\n\t\t\tres.resp(403, errmsg.LONG_STRING)\n\t\t}\n\t}\n\tlet topic = new Topic()\n\ttopic.import(data.topic_id)\n\t.then((result) => {\n\t\tif(topic.status == 1 || topic.status == 3) {\n\t\t\tres.resp(423, errmsg.ARCHIVED_TOPIC)\n\t\t} else\n\t\t\tnext()\n\t})\n\t.catch((err) => {\n\t\tres.resp(404, errmsg.ID_NOT_FOUND)\n\t})\n}"},"metadata":{"kind":"string","value":"{\n \"objective\": {\n \"self\": [],\n \"paired\": [],\n \"triplet\": [\n [\n \"query\",\n \"document\",\n \"negatives\"\n ]\n ]\n }\n}"},"negatives":{"kind":"list like","value":["function map() {\n\n}","function MAP() {\n\n}","function Map() {}","function Map() {\n\t\n}","function Map() {\n\t\n}","function PathMapper() {\n\t}","function PathMapper() {\n\t}","function ParamMap() { }","function ParamMap() { }","function ParamMap() {}","function ParamMap() {}","function ParamMap(){}","function route() {\n this.method = this.req.method.toLowerCase();\n var n = w.map[this.method];\n if (!n) {\n this.reply4xx(404, \"no route for method: \"+this.req.method);\n this.end();\n return\n } else {\n this.url = w.dep.url.parse(this.req.url, true);\n this.query = this.url.query || {};\n this.context = {};\n for (var e in this.query) { this.context[e] = this.query[e] }\n this.context._work = this;\n this.context._js = [];\n this.context._css = [];\n \n var p = this.url.pathname.split('/');\n console.log(this.req.url, \"route to ===============> \" + this.req.method.toUpperCase(), p);\n \n for (var i = 1; i < p.length; ++i) {\n var segment = p[i];\n if (n.branches[segment]) { n = n.branches[segment]; continue };\n if (n.branches[':']) { //varname\n this.context[n.varname] = segment;\n console.log(\"//varname: \" + n.varname + \" = \" + this.context[n.varname]);\n n = n.branches[':'];\n continue\n };\n if (n.branches['*']) { //wildcard\n this.context['_location'] = p.slice(i).join('/');\n console.log(\"//wildcard: \" + this.context['_location']);\n n = n.branches['*'];\n break\n };\n this.reply4xx(404, \"no route to: \"+this.req.method+' '+this.req.url);\n this.end();\n return\n };\n };\n \n if (n.handler) {\n this.mapnode = n;\n n.handler.call(this);\n this.end();\n return\n }\n\n this.reply5xx(500, \"no handler found for: \"+this.req.method+' '+this.req.url);\n this.end();\n return\n}","function SeleneseMapper() {\n}","static routes() {\n\n\t\tconst keys = ['all', 'delete', 'get', 'patch', 'post', 'put'];\n\n\t\treturn MapContainer.create(...keys);\n\t}","function InvokeDefinitionMap() {\n this.map = [];\n this.lookup_table = {}; // Just for building dictionary\n}","function addMapping(router, mapping) {\n for (let url in mapping) {\n\n if (url.startsWith('GET ')) {\n\n let path = url.substring(4);\n router.get(path, mapping[url]);\n\n } else if (url.startsWith('POST ')) {\n\n let path = url.substring(5);\n router.post(path, mapping[url]);\n\n } else if (url.startsWith('PUT ')) {\n\n let path = url.substring(4);\n router.put(path, mapping[url]);\n\n } else if (url.startsWith('DELETE ')) {\n\n let path = url.substring(7);\n router.delete(path, mapping[url]);\n\n } else {\n console.log(`invalid URL: ${url}`);\n }\n }\n}","function addMapping(router, mapping) {\n for (var url in mapping) {\n if (url.startsWith('GET ')) {\n var path = url.substring(4);\n router.get(path, mapping[url]);\n console.log(`register URL mapping: GET ${path}`);\n } else if (url.startsWith('POST ')) {\n var path = url.substring(5);\n router.post(path, mapping[url]);\n console.log(`register URL mapping: POST ${path}`);\n } else if (url.startsWith('PUT ')) {\n var path = url.substring(4);\n router.put(path, mapping[url]);\n console.log(`register URL mapping: PUT ${path}`);\n } else if (url.startsWith('DELETE ')) {\n var path = url.substring(7);\n router.del(path, mapping[url]);\n console.log(`register URL mapping: DELETE ${path}`);\n } else {\n console.log(`invalid URL: ${url}`);\n }\n }\n}","map(id, source) {}","function PathMap() {\n /**\n * Contains a map of path elements\n *\n * <h1>Path definition</h1>\n * A parameterized path is defined like this:\n * <pre>\n * 'GATEWAY_PARALLEL': {\n * d: 'm {mx},{my} {e.x0},0 0,{e.x1} {e.x1},0 0,{e.y0} -{e.x1},0 0,{e.y1} ' +\n '-{e.x0},0 0,-{e.y1} -{e.x1},0 0,-{e.y0} {e.x1},0 z',\n * height: 17.5,\n * width: 17.5,\n * heightElements: [2.5, 7.5],\n * widthElements: [2.5, 7.5]\n * }\n * </pre>\n * <p>It's important to specify a correct <b>height and width</b> for the path as the scaling\n * is based on the ratio between the specified height and width in this object and the\n * height and width that is set as scale target (Note x,y coordinates will be scaled with\n * individual ratios).</p>\n * <p>The '<b>heightElements</b>' and '<b>widthElements</b>' array must contain the values that will be scaled.\n * The scaling is based on the computed ratios.\n * Coordinates on the y axis should be in the <b>heightElement</b>'s array, they will be scaled using\n * the computed ratio coefficient.\n * In the parameterized path the scaled values can be accessed through the 'e' object in {} brackets.\n * <ul>\n * <li>The values for the y axis can be accessed in the path string using {e.y0}, {e.y1}, ....</li>\n * <li>The values for the x axis can be accessed in the path string using {e.x0}, {e.x1}, ....</li>\n * </ul>\n * The numbers x0, x1 respectively y0, y1, ... map to the corresponding array index.\n * </p>\n m1,1\n l 0,55.3\n c 29.8,19.7 48.4,-4.2 67.2,-6.7\n c 12.2,-2.3 19.8,1.6 30.8,6.2\n l 0,-54.6\n z\n */\n this.pathMap = {\n 'KNOWLEDGE_SOURCE': {\n d: 'm {mx},{my} ' + 'l 0,{e.y0} ' + 'c {e.x0},{e.y1} {e.x1},-{e.y2} {e.x2},-{e.y3} ' + 'c {e.x3},-{e.y4} {e.x4},{e.y5} {e.x5},{e.y6} ' + 'l 0,-{e.y7}z',\n width: 100,\n height: 65,\n widthElements: [29.8, 48.4, 67.2, 12.2, 19.8, 30.8],\n heightElements: [55.3, 19.7, 4.2, 6.7, 2.3, 1.6, 6.2, 54.6]\n },\n 'BUSINESS_KNOWLEDGE_MODEL': {\n d: 'm {mx},{my} l {e.x0},-{e.y0} l {e.x1},0 l 0,{e.y1} l -{e.x2},{e.y2} l -{e.x3},0z',\n width: 125,\n height: 45,\n widthElements: [13.8, 109.2, 13.8, 109.1],\n heightElements: [13.2, 29.8, 13.2]\n },\n 'TEXT_ANNOTATION': {\n d: 'm {mx}, {my} m 10,0 l -10,0 l 0,{e.y0} l 10,0',\n width: 10,\n height: 30,\n widthElements: [10],\n heightElements: [30]\n }\n };\n this.getRawPath = function getRawPath(pathId) {\n return this.pathMap[pathId].d;\n };\n /**\n * Scales the path to the given height and width.\n * <h1>Use case</h1>\n * <p>Use case is to scale the content of elements (event, gateways) based\n * on the element bounding box's size.\n * </p>\n * <h1>Why not transform</h1>\n * <p>Scaling a path with transform() will also scale the stroke and IE does not support\n * the option 'non-scaling-stroke' to prevent this.\n * Also there are use cases where only some parts of a path should be\n * scaled.</p>\n *\n * @param {String} pathId The ID of the path.\n * @param {Object} param <p>\n * Example param object scales the path to 60% size of the container (data.width, data.height).\n * <pre>\n * {\n * xScaleFactor: 0.6,\n * yScaleFactor:0.6,\n * containerWidth: data.width,\n * containerHeight: data.height,\n * position: {\n * mx: 0.46,\n * my: 0.2,\n * }\n * }\n * </pre>\n * <ul>\n * <li>targetpathwidth = xScaleFactor * containerWidth</li>\n * <li>targetpathheight = yScaleFactor * containerHeight</li>\n * <li>Position is used to set the starting coordinate of the path. M is computed:\n * <ul>\n * <li>position.x * containerWidth</li>\n * <li>position.y * containerHeight</li>\n * </ul>\n * Center of the container <pre> position: {\n * mx: 0.5,\n * my: 0.5,\n * }</pre>\n * Upper left corner of the container\n * <pre> position: {\n * mx: 0.0,\n * my: 0.0,\n * }</pre>\n * </li>\n * </ul>\n * </p>\n *\n */\n this.getScaledPath = function getScaledPath(pathId, param) {\n var rawPath = this.pathMap[pathId];\n // positioning\n // compute the start point of the path\n var mx, my;\n if (param.abspos) {\n mx = param.abspos.x;\n my = param.abspos.y;\n }\n else {\n mx = param.containerWidth * param.position.mx;\n my = param.containerHeight * param.position.my;\n }\n var coordinates = {}; // map for the scaled coordinates\n if (param.position) {\n // path\n var heightRatio = param.containerHeight / rawPath.height * param.yScaleFactor;\n var widthRatio = param.containerWidth / rawPath.width * param.xScaleFactor;\n // Apply height ratio\n for (var heightIndex = 0; heightIndex < rawPath.heightElements.length; heightIndex++) {\n coordinates['y' + heightIndex] = rawPath.heightElements[heightIndex] * heightRatio;\n }\n // Apply width ratio\n for (var widthIndex = 0; widthIndex < rawPath.widthElements.length; widthIndex++) {\n coordinates['x' + widthIndex] = rawPath.widthElements[widthIndex] * widthRatio;\n }\n }\n // Apply value to raw path\n var path = format(rawPath.d, {\n mx: mx,\n my: my,\n e: coordinates\n });\n return path;\n };\n}","function PathMap() {\n /**\n * Contains a map of path elements\n *\n * <h1>Path definition</h1>\n * A parameterized path is defined like this:\n * <pre>\n * 'GATEWAY_PARALLEL': {\n * d: 'm {mx},{my} {e.x0},0 0,{e.x1} {e.x1},0 0,{e.y0} -{e.x1},0 0,{e.y1} ' +\n '-{e.x0},0 0,-{e.y1} -{e.x1},0 0,-{e.y0} {e.x1},0 z',\n * height: 17.5,\n * width: 17.5,\n * heightElements: [2.5, 7.5],\n * widthElements: [2.5, 7.5]\n * }\n * </pre>\n * <p>It's important to specify a correct <b>height and width</b> for the path as the scaling\n * is based on the ratio between the specified height and width in this object and the\n * height and width that is set as scale target (Note x,y coordinates will be scaled with\n * individual ratios).</p>\n * <p>The '<b>heightElements</b>' and '<b>widthElements</b>' array must contain the values that will be scaled.\n * The scaling is based on the computed ratios.\n * Coordinates on the y axis should be in the <b>heightElement</b>'s array, they will be scaled using\n * the computed ratio coefficient.\n * In the parameterized path the scaled values can be accessed through the 'e' object in {} brackets.\n * <ul>\n * <li>The values for the y axis can be accessed in the path string using {e.y0}, {e.y1}, ....</li>\n * <li>The values for the x axis can be accessed in the path string using {e.x0}, {e.x1}, ....</li>\n * </ul>\n * The numbers x0, x1 respectively y0, y1, ... map to the corresponding array index.\n * </p>\n m1,1\n l 0,55.3\n c 29.8,19.7 48.4,-4.2 67.2,-6.7\n c 12.2,-2.3 19.8,1.6 30.8,6.2\n l 0,-54.6\n z\n */\n this.pathMap = {\n 'KNOWLEDGE_SOURCE': {\n d: 'm {mx},{my} ' + 'l 0,{e.y0} ' + 'c {e.x0},{e.y1} {e.x1},-{e.y2} {e.x2},-{e.y3} ' + 'c {e.x3},-{e.y4} {e.x4},{e.y5} {e.x5},{e.y6} ' + 'l 0,-{e.y7}z',\n width: 100,\n height: 65,\n widthElements: [29.8, 48.4, 67.2, 12.2, 19.8, 30.8],\n heightElements: [55.3, 19.7, 4.2, 6.7, 2.3, 1.6, 6.2, 54.6]\n },\n 'BUSINESS_KNOWLEDGE_MODEL': {\n d: 'm {mx},{my} l {e.x0},-{e.y0} l {e.x1},0 l 0,{e.y1} l -{e.x2},{e.y2} l -{e.x3},0z',\n width: 125,\n height: 45,\n widthElements: [13.8, 109.2, 13.8, 109.1],\n heightElements: [13.2, 29.8, 13.2]\n },\n 'TEXT_ANNOTATION': {\n d: 'm {mx}, {my} m 10,0 l -10,0 l 0,{e.y0} l 10,0',\n width: 10,\n height: 30,\n widthElements: [10],\n heightElements: [30]\n }\n };\n\n this.getRawPath = function getRawPath(pathId) {\n return this.pathMap[pathId].d;\n };\n /**\n * Scales the path to the given height and width.\n * <h1>Use case</h1>\n * <p>Use case is to scale the content of elements (event, gateways) based\n * on the element bounding box's size.\n * </p>\n * <h1>Why not transform</h1>\n * <p>Scaling a path with transform() will also scale the stroke and IE does not support\n * the option 'non-scaling-stroke' to prevent this.\n * Also there are use cases where only some parts of a path should be\n * scaled.</p>\n *\n * @param {String} pathId The ID of the path.\n * @param {Object} param <p>\n * Example param object scales the path to 60% size of the container (data.width, data.height).\n * <pre>\n * {\n * xScaleFactor: 0.6,\n * yScaleFactor:0.6,\n * containerWidth: data.width,\n * containerHeight: data.height,\n * position: {\n * mx: 0.46,\n * my: 0.2,\n * }\n * }\n * </pre>\n * <ul>\n * <li>targetpathwidth = xScaleFactor * containerWidth</li>\n * <li>targetpathheight = yScaleFactor * containerHeight</li>\n * <li>Position is used to set the starting coordinate of the path. M is computed:\n * <ul>\n * <li>position.x * containerWidth</li>\n * <li>position.y * containerHeight</li>\n * </ul>\n * Center of the container <pre> position: {\n * mx: 0.5,\n * my: 0.5,\n * }</pre>\n * Upper left corner of the container\n * <pre> position: {\n * mx: 0.0,\n * my: 0.0,\n * }</pre>\n * </li>\n * </ul>\n * </p>\n *\n */\n\n\n this.getScaledPath = function getScaledPath(pathId, param) {\n var rawPath = this.pathMap[pathId]; // positioning\n // compute the start point of the path\n\n var mx, my;\n\n if (param.abspos) {\n mx = param.abspos.x;\n my = param.abspos.y;\n } else {\n mx = param.containerWidth * param.position.mx;\n my = param.containerHeight * param.position.my;\n }\n\n var coordinates = {}; // map for the scaled coordinates\n\n if (param.position) {\n // path\n var heightRatio = param.containerHeight / rawPath.height * param.yScaleFactor;\n var widthRatio = param.containerWidth / rawPath.width * param.xScaleFactor; // Apply height ratio\n\n for (var heightIndex = 0; heightIndex < rawPath.heightElements.length; heightIndex++) {\n coordinates['y' + heightIndex] = rawPath.heightElements[heightIndex] * heightRatio;\n } // Apply width ratio\n\n\n for (var widthIndex = 0; widthIndex < rawPath.widthElements.length; widthIndex++) {\n coordinates['x' + widthIndex] = rawPath.widthElements[widthIndex] * widthRatio;\n }\n } // Apply value to raw path\n\n\n var path = format(rawPath.d, {\n mx: mx,\n my: my,\n e: coordinates\n });\n return path;\n };\n } // helpers //////////////////////","function mapa1(){\n // Crea un arreglo con los nodos visitados hasta ahora.\n var nodes = [\n \n {id: 1, label: 'Brasil'},\n ];\n\n // Crea un arreglo con las conexiones entre los nodos.\n var edges = [\n\n ];\n // Crea un arreglo con los nodos activos.\n var activeNode = [ 1 ];\n mapa( nodes, edges, activeNode );\n }","function Rn(){this.seq=[],this.map={}}// --- Utilities ---","function PathMap() {\n\n /**\n * Contains a map of path elements\n *\n * <h1>Path definition</h1>\n * A parameterized path is defined like this:\n * <pre>\n * 'GATEWAY_PARALLEL': {\n * d: 'm {mx},{my} {e.x0},0 0,{e.x1} {e.x1},0 0,{e.y0} -{e.x1},0 0,{e.y1} ' +\n '-{e.x0},0 0,-{e.y1} -{e.x1},0 0,-{e.y0} {e.x1},0 z',\n * height: 17.5,\n * width: 17.5,\n * heightElements: [2.5, 7.5],\n * widthElements: [2.5, 7.5]\n * }\n * </pre>\n * <p>It's important to specify a correct <b>height and width</b> for the path as the scaling\n * is based on the ratio between the specified height and width in this object and the\n * height and width that is set as scale target (Note x,y coordinates will be scaled with\n * individual ratios).</p>\n * <p>The '<b>heightElements</b>' and '<b>widthElements</b>' array must contain the values that will be scaled.\n * The scaling is based on the computed ratios.\n * Coordinates on the y axis should be in the <b>heightElement</b>'s array, they will be scaled using\n * the computed ratio coefficient.\n * In the parameterized path the scaled values can be accessed through the 'e' object in {} brackets.\n * <ul>\n * <li>The values for the y axis can be accessed in the path string using {e.y0}, {e.y1}, ....</li>\n * <li>The values for the x axis can be accessed in the path string using {e.x0}, {e.x1}, ....</li>\n * </ul>\n * The numbers x0, x1 respectively y0, y1, ... map to the corresponding array index.\n * </p>\n */\n this.pathMap = {\n 'EVENT_MESSAGE': {\n d: 'm {mx},{my} l 0,{e.y1} l {e.x1},0 l 0,-{e.y1} z l {e.x0},{e.y0} l {e.x0},-{e.y0}',\n height: 36,\n width: 36,\n heightElements: [6, 14],\n widthElements: [10.5, 21]\n },\n 'EVENT_SIGNAL': {\n d: 'M {mx},{my} l {e.x0},{e.y0} l -{e.x1},0 Z',\n height: 36,\n width: 36,\n heightElements: [18],\n widthElements: [10, 20]\n },\n 'EVENT_ESCALATION': {\n d: 'm {mx},{my} c -{e.x1},{e.y0} -{e.x3},{e.y1} -{e.x5},{e.y4} {e.x1},-{e.y3} {e.x3},-{e.y5} {e.x5},-{e.y6} ' +\n '{e.x0},{e.y3} {e.x2},{e.y5} {e.x4},{e.y6} -{e.x0},-{e.y0} -{e.x2},-{e.y1} -{e.x4},-{e.y4} z',\n height: 36,\n width: 36,\n heightElements: [2.382, 4.764, 4.926, 6.589333, 7.146, 13.178667, 19.768],\n widthElements: [2.463, 2.808, 4.926, 5.616, 7.389, 8.424]\n },\n 'EVENT_CONDITIONAL': {\n d: 'M {e.x0},{e.y0} l {e.x1},0 l 0,{e.y2} l -{e.x1},0 Z ' +\n 'M {e.x2},{e.y3} l {e.x0},0 ' +\n 'M {e.x2},{e.y4} l {e.x0},0 ' +\n 'M {e.x2},{e.y5} l {e.x0},0 ' +\n 'M {e.x2},{e.y6} l {e.x0},0 ' +\n 'M {e.x2},{e.y7} l {e.x0},0 ' +\n 'M {e.x2},{e.y8} l {e.x0},0 ',\n height: 36,\n width: 36,\n heightElements: [8.5, 14.5, 18, 11.5, 14.5, 17.5, 20.5, 23.5, 26.5],\n widthElements: [10.5, 14.5, 12.5]\n },\n 'EVENT_LINK': {\n d: 'm {mx},{my} 0,{e.y0} -{e.x1},0 0,{e.y1} {e.x1},0 0,{e.y0} {e.x0},-{e.y2} -{e.x0},-{e.y2} z',\n height: 36,\n width: 36,\n heightElements: [4.4375, 6.75, 7.8125],\n widthElements: [9.84375, 13.5]\n },\n 'EVENT_ERROR': {\n d: 'm {mx},{my} {e.x0},-{e.y0} {e.x1},-{e.y1} {e.x2},{e.y2} {e.x3},-{e.y3} -{e.x4},{e.y4} -{e.x5},-{e.y5} z',\n height: 36,\n width: 36,\n heightElements: [0.023, 8.737, 8.151, 16.564, 10.591, 8.714],\n widthElements: [0.085, 6.672, 6.97, 4.273, 5.337, 6.636]\n },\n 'EVENT_CANCEL_45': {\n d: 'm {mx},{my} -{e.x1},0 0,{e.x0} {e.x1},0 0,{e.y1} {e.x0},0 ' +\n '0,-{e.y1} {e.x1},0 0,-{e.y0} -{e.x1},0 0,-{e.y1} -{e.x0},0 z',\n height: 36,\n width: 36,\n heightElements: [4.75, 8.5],\n widthElements: [4.75, 8.5]\n },\n 'EVENT_COMPENSATION': {\n d: 'm {mx},{my} {e.x0},-{e.y0} 0,{e.y1} z m {e.x0},0 {e.x0},-{e.y0} 0,{e.y1} z',\n height: 36,\n width: 36,\n heightElements: [5, 10],\n widthElements: [10]\n },\n 'EVENT_TIMER_WH': {\n d: 'M {mx},{my} l {e.x0},-{e.y0} m -{e.x0},{e.y0} l {e.x1},{e.y1} ',\n height: 36,\n width: 36,\n heightElements: [10, 2],\n widthElements: [3, 7]\n },\n 'EVENT_TIMER_LINE': {\n d: 'M {mx},{my} ' +\n 'm {e.x0},{e.y0} l -{e.x1},{e.y1} ',\n height: 36,\n width: 36,\n heightElements: [10, 3],\n widthElements: [0, 0]\n },\n 'EVENT_MULTIPLE': {\n d:'m {mx},{my} {e.x1},-{e.y0} {e.x1},{e.y0} -{e.x0},{e.y1} -{e.x2},0 z',\n height: 36,\n width: 36,\n heightElements: [6.28099, 12.56199],\n widthElements: [3.1405, 9.42149, 12.56198]\n },\n 'EVENT_PARALLEL_MULTIPLE': {\n d:'m {mx},{my} {e.x0},0 0,{e.y1} {e.x1},0 0,{e.y0} -{e.x1},0 0,{e.y1} ' +\n '-{e.x0},0 0,-{e.y1} -{e.x1},0 0,-{e.y0} {e.x1},0 z',\n height: 36,\n width: 36,\n heightElements: [2.56228, 7.68683],\n widthElements: [2.56228, 7.68683]\n },\n 'GATEWAY_EXCLUSIVE': {\n d:'m {mx},{my} {e.x0},{e.y0} {e.x1},{e.y0} {e.x2},0 {e.x4},{e.y2} ' +\n '{e.x4},{e.y1} {e.x2},0 {e.x1},{e.y3} {e.x0},{e.y3} ' +\n '{e.x3},0 {e.x5},{e.y1} {e.x5},{e.y2} {e.x3},0 z',\n height: 17.5,\n width: 17.5,\n heightElements: [8.5, 6.5312, -6.5312, -8.5],\n widthElements: [6.5, -6.5, 3, -3, 5, -5]\n },\n 'GATEWAY_PARALLEL': {\n d:'m {mx},{my} 0,{e.y1} -{e.x1},0 0,{e.y0} {e.x1},0 0,{e.y1} {e.x0},0 ' +\n '0,-{e.y1} {e.x1},0 0,-{e.y0} -{e.x1},0 0,-{e.y1} -{e.x0},0 z',\n height: 30,\n width: 30,\n heightElements: [5, 12.5],\n widthElements: [5, 12.5]\n },\n 'GATEWAY_EVENT_BASED': {\n d:'m {mx},{my} {e.x0},{e.y0} {e.x0},{e.y1} {e.x1},{e.y2} {e.x2},0 z',\n height: 11,\n width: 11,\n heightElements: [-6, 6, 12, -12],\n widthElements: [9, -3, -12]\n },\n 'GATEWAY_COMPLEX': {\n d:'m {mx},{my} 0,{e.y0} -{e.x0},-{e.y1} -{e.x1},{e.y2} {e.x0},{e.y1} -{e.x2},0 0,{e.y3} ' +\n '{e.x2},0 -{e.x0},{e.y1} l {e.x1},{e.y2} {e.x0},-{e.y1} 0,{e.y0} {e.x3},0 0,-{e.y0} {e.x0},{e.y1} ' +\n '{e.x1},-{e.y2} -{e.x0},-{e.y1} {e.x2},0 0,-{e.y3} -{e.x2},0 {e.x0},-{e.y1} -{e.x1},-{e.y2} ' +\n '-{e.x0},{e.y1} 0,-{e.y0} -{e.x3},0 z',\n height: 17.125,\n width: 17.125,\n heightElements: [4.875, 3.4375, 2.125, 3],\n widthElements: [3.4375, 2.125, 4.875, 3]\n },\n 'DATA_OBJECT_PATH': {\n d:'m 0,0 {e.x1},0 {e.x0},{e.y0} 0,{e.y1} -{e.x2},0 0,-{e.y2} {e.x1},0 0,{e.y0} {e.x0},0',\n height: 61,\n width: 51,\n heightElements: [10, 50, 60],\n widthElements: [10, 40, 50, 60]\n },\n 'DATA_OBJECT_COLLECTION_PATH': {\n d:'m {mx}, {my} ' +\n 'm 0 15 l 0 -15 ' +\n 'm 4 15 l 0 -15 ' +\n 'm 4 15 l 0 -15 ',\n height: 61,\n width: 51,\n heightElements: [12],\n widthElements: [1, 6, 12, 15]\n },\n 'DATA_ARROW': {\n d:'m 5,9 9,0 0,-3 5,5 -5,5 0,-3 -9,0 z',\n height: 61,\n width: 51,\n heightElements: [],\n widthElements: []\n },\n 'DATA_STORE': {\n d:'m {mx},{my} ' +\n 'l 0,{e.y2} ' +\n 'c {e.x0},{e.y1} {e.x1},{e.y1} {e.x2},0 ' +\n 'l 0,-{e.y2} ' +\n 'c -{e.x0},-{e.y1} -{e.x1},-{e.y1} -{e.x2},0' +\n 'c {e.x0},{e.y1} {e.x1},{e.y1} {e.x2},0 ' +\n 'm -{e.x2},{e.y0}' +\n 'c {e.x0},{e.y1} {e.x1},{e.y1} {e.x2},0' +\n 'm -{e.x2},{e.y0}' +\n 'c {e.x0},{e.y1} {e.x1},{e.y1} {e.x2},0',\n height: 61,\n width: 61,\n heightElements: [7, 10, 45],\n widthElements: [2, 58, 60]\n },\n 'TEXT_ANNOTATION': {\n d: 'm {mx}, {my} m 10,0 l -10,0 l 0,{e.y0} l 10,0',\n height: 30,\n width: 10,\n heightElements: [30],\n widthElements: [10]\n },\n 'MARKER_SUB_PROCESS': {\n d: 'm{mx},{my} m 7,2 l 0,10 m -5,-5 l 10,0',\n height: 10,\n width: 10,\n heightElements: [],\n widthElements: []\n },\n 'MARKER_PARALLEL': {\n d: 'm{mx},{my} m 3,2 l 0,10 m 3,-10 l 0,10 m 3,-10 l 0,10',\n height: 10,\n width: 10,\n heightElements: [],\n widthElements: []\n },\n 'MARKER_SEQUENTIAL': {\n d: 'm{mx},{my} m 0,3 l 10,0 m -10,3 l 10,0 m -10,3 l 10,0',\n height: 10,\n width: 10,\n heightElements: [],\n widthElements: []\n },\n 'MARKER_COMPENSATION': {\n d: 'm {mx},{my} 8,-5 0,10 z m 9,0 8,-5 0,10 z',\n height: 10,\n width: 21,\n heightElements: [],\n widthElements: []\n },\n 'MARKER_LOOP': {\n d: 'm {mx},{my} c 3.526979,0 6.386161,-2.829858 6.386161,-6.320661 0,-3.490806 -2.859182,-6.320661 ' +\n '-6.386161,-6.320661 -3.526978,0 -6.38616,2.829855 -6.38616,6.320661 0,1.745402 ' +\n '0.714797,3.325567 1.870463,4.469381 0.577834,0.571908 1.265885,1.034728 2.029916,1.35457 ' +\n 'l -0.718163,-3.909793 m 0.718163,3.909793 -3.885211,0.802902',\n height: 13.9,\n width: 13.7,\n heightElements: [],\n widthElements: []\n },\n 'MARKER_ADHOC': {\n d: 'm {mx},{my} m 0.84461,2.64411 c 1.05533,-1.23780996 2.64337,-2.07882 4.29653,-1.97997996 2.05163,0.0805 ' +\n '3.85579,1.15803 5.76082,1.79107 1.06385,0.34139996 2.24454,0.1438 3.18759,-0.43767 0.61743,-0.33642 ' +\n '1.2775,-0.64078 1.7542,-1.17511 0,0.56023 0,1.12046 0,1.6807 -0.98706,0.96237996 -2.29792,1.62393996 ' +\n '-3.6918,1.66181996 -1.24459,0.0927 -2.46671,-0.2491 -3.59505,-0.74812 -1.35789,-0.55965 ' +\n '-2.75133,-1.33436996 -4.27027,-1.18121996 -1.37741,0.14601 -2.41842,1.13685996 -3.44288,1.96782996 z',\n height: 4,\n width: 15,\n heightElements: [],\n widthElements: []\n },\n 'TASK_TYPE_SEND': {\n d: 'm {mx},{my} l 0,{e.y1} l {e.x1},0 l 0,-{e.y1} z l {e.x0},{e.y0} l {e.x0},-{e.y0}',\n height: 14,\n width: 21,\n heightElements: [6, 14],\n widthElements: [10.5, 21]\n },\n 'TASK_TYPE_SCRIPT': {\n d: 'm {mx},{my} c 9.966553,-6.27276 -8.000926,-7.91932 2.968968,-14.938 l -8.802728,0 ' +\n 'c -10.969894,7.01868 6.997585,8.66524 -2.968967,14.938 z ' +\n 'm -7,-12 l 5,0 ' +\n 'm -4.5,3 l 4.5,0 ' +\n 'm -3,3 l 5,0' +\n 'm -4,3 l 5,0',\n height: 15,\n width: 12.6,\n heightElements: [6, 14],\n widthElements: [10.5, 21]\n },\n 'TASK_TYPE_USER_1': {\n d: 'm {mx},{my} c 0.909,-0.845 1.594,-2.049 1.594,-3.385 0,-2.554 -1.805,-4.62199999 ' +\n '-4.357,-4.62199999 -2.55199998,0 -4.28799998,2.06799999 -4.28799998,4.62199999 0,1.348 ' +\n '0.974,2.562 1.89599998,3.405 -0.52899998,0.187 -5.669,2.097 -5.794,4.7560005 v 6.718 ' +\n 'h 17 v -6.718 c 0,-2.2980005 -5.5279996,-4.5950005 -6.0509996,-4.7760005 z' +\n 'm -8,6 l 0,5.5 m 11,0 l 0,-5'\n },\n 'TASK_TYPE_USER_2': {\n d: 'm {mx},{my} m 2.162,1.009 c 0,2.4470005 -2.158,4.4310005 -4.821,4.4310005 ' +\n '-2.66499998,0 -4.822,-1.981 -4.822,-4.4310005 '\n },\n 'TASK_TYPE_USER_3': {\n d: 'm {mx},{my} m -6.9,-3.80 c 0,0 2.25099998,-2.358 4.27399998,-1.177 2.024,1.181 4.221,1.537 ' +\n '4.124,0.965 -0.098,-0.57 -0.117,-3.79099999 -4.191,-4.13599999 -3.57499998,0.001 ' +\n '-4.20799998,3.36699999 -4.20699998,4.34799999 z'\n },\n 'TASK_TYPE_MANUAL': {\n d: 'm {mx},{my} c 0.234,-0.01 5.604,0.008 8.029,0.004 0.808,0 1.271,-0.172 1.417,-0.752 0.227,-0.898 ' +\n '-0.334,-1.314 -1.338,-1.316 -2.467,-0.01 -7.886,-0.004 -8.108,-0.004 -0.014,-0.079 0.016,-0.533 0,-0.61 ' +\n '0.195,-0.042 8.507,0.006 9.616,0.002 0.877,-0.007 1.35,-0.438 1.353,-1.208 0.003,-0.768 -0.479,-1.09 ' +\n '-1.35,-1.091 -2.968,-0.002 -9.619,-0.013 -9.619,-0.013 v -0.591 c 0,0 5.052,-0.016 7.225,-0.016 ' +\n '0.888,-0.002 1.354,-0.416 1.351,-1.193 -0.006,-0.761 -0.492,-1.196 -1.361,-1.196 -3.473,-0.005 ' +\n '-10.86,-0.003 -11.0829995,-0.003 -0.022,-0.047 -0.045,-0.094 -0.069,-0.139 0.3939995,-0.319 ' +\n '2.0409995,-1.626 2.4149995,-2.017 0.469,-0.4870005 0.519,-1.1650005 0.162,-1.6040005 -0.414,-0.511 ' +\n '-0.973,-0.5 -1.48,-0.236 -1.4609995,0.764 -6.5999995,3.6430005 -7.7329995,4.2710005 -0.9,0.499 ' +\n '-1.516,1.253 -1.882,2.19 -0.37000002,0.95 -0.17,2.01 -0.166,2.979 0.004,0.718 -0.27300002,1.345 ' +\n '-0.055,2.063 0.629,2.087 2.425,3.312 4.859,3.318 4.6179995,0.014 9.2379995,-0.139 13.8569995,-0.158 ' +\n '0.755,-0.004 1.171,-0.301 1.182,-1.033 0.012,-0.754 -0.423,-0.969 -1.183,-0.973 -1.778,-0.01 ' +\n '-5.824,-0.004 -6.04,-0.004 10e-4,-0.084 0.003,-0.586 10e-4,-0.67 z'\n },\n 'TASK_TYPE_INSTANTIATING_SEND': {\n d: 'm {mx},{my} l 0,8.4 l 12.6,0 l 0,-8.4 z l 6.3,3.6 l 6.3,-3.6'\n },\n 'TASK_TYPE_SERVICE': {\n d: 'm {mx},{my} v -1.71335 c 0.352326,-0.0705 0.703932,-0.17838 1.047628,-0.32133 ' +\n '0.344416,-0.14465 0.665822,-0.32133 0.966377,-0.52145 l 1.19431,1.18005 1.567487,-1.57688 ' +\n '-1.195028,-1.18014 c 0.403376,-0.61394 0.683079,-1.29908 0.825447,-2.01824 l 1.622133,-0.01 ' +\n 'v -2.2196 l -1.636514,0.01 c -0.07333,-0.35153 -0.178319,-0.70024 -0.323564,-1.04372 ' +\n '-0.145244,-0.34406 -0.321407,-0.6644 -0.522735,-0.96217 l 1.131035,-1.13631 -1.583305,-1.56293 ' +\n '-1.129598,1.13589 c -0.614052,-0.40108 -1.302883,-0.68093 -2.022633,-0.82247 l 0.0093,-1.61852 ' +\n 'h -2.241173 l 0.0042,1.63124 c -0.353763,0.0736 -0.705369,0.17977 -1.049785,0.32371 -0.344415,0.14437 ' +\n '-0.665102,0.32092 -0.9635006,0.52046 l -1.1698628,-1.15823 -1.5667691,1.5792 1.1684265,1.15669 ' +\n 'c -0.4026573,0.61283 -0.68308,1.29797 -0.8247287,2.01713 l -1.6588041,0.003 v 2.22174 ' +\n 'l 1.6724648,-0.006 c 0.073327,0.35077 0.1797598,0.70243 0.3242851,1.04472 0.1452428,0.34448 ' +\n '0.3214064,0.6644 0.5227339,0.96066 l -1.1993431,1.19723 1.5840256,1.56011 1.1964668,-1.19348 ' +\n 'c 0.6140517,0.40346 1.3028827,0.68232 2.0233517,0.82331 l 7.19e-4,1.69892 h 2.226848 z ' +\n 'm 0.221462,-3.9957 c -1.788948,0.7502 -3.8576,-0.0928 -4.6097055,-1.87438 -0.7521065,-1.78321 ' +\n '0.090598,-3.84627 1.8802645,-4.59604 1.78823,-0.74936 3.856881,0.0929 4.608987,1.87437 ' +\n '0.752106,1.78165 -0.0906,3.84612 -1.879546,4.59605 z'\n },\n 'TASK_TYPE_SERVICE_FILL': {\n d: 'm {mx},{my} c -1.788948,0.7502 -3.8576,-0.0928 -4.6097055,-1.87438 -0.7521065,-1.78321 ' +\n '0.090598,-3.84627 1.8802645,-4.59604 1.78823,-0.74936 3.856881,0.0929 4.608987,1.87437 ' +\n '0.752106,1.78165 -0.0906,3.84612 -1.879546,4.59605 z'\n },\n 'TASK_TYPE_BUSINESS_RULE_HEADER': {\n d: 'm {mx},{my} 0,4 20,0 0,-4 z'\n },\n 'TASK_TYPE_BUSINESS_RULE_MAIN': {\n d: 'm {mx},{my} 0,12 20,0 0,-12 z' +\n 'm 0,8 l 20,0 ' +\n 'm -13,-4 l 0,8'\n },\n 'MESSAGE_FLOW_MARKER': {\n d: 'm {mx},{my} m -10.5 ,-7 l 0,14 l 21,0 l 0,-14 z l 10.5,6 l 10.5,-6'\n }\n };\n\n this.getRawPath = function getRawPath(pathId) {\n return this.pathMap[pathId].d;\n };\n\n /**\n * Scales the path to the given height and width.\n * <h1>Use case</h1>\n * <p>Use case is to scale the content of elements (event, gateways) based\n * on the element bounding box's size.\n * </p>\n * <h1>Why not transform</h1>\n * <p>Scaling a path with transform() will also scale the stroke and IE does not support\n * the option 'non-scaling-stroke' to prevent this.\n * Also there are use cases where only some parts of a path should be\n * scaled.</p>\n *\n * @param {String} pathId The ID of the path.\n * @param {Object} param <p>\n * Example param object scales the path to 60% size of the container (data.width, data.height).\n * <pre>\n * {\n * xScaleFactor: 0.6,\n * yScaleFactor:0.6,\n * containerWidth: data.width,\n * containerHeight: data.height,\n * position: {\n * mx: 0.46,\n * my: 0.2,\n * }\n * }\n * </pre>\n * <ul>\n * <li>targetpathwidth = xScaleFactor * containerWidth</li>\n * <li>targetpathheight = yScaleFactor * containerHeight</li>\n * <li>Position is used to set the starting coordinate of the path. M is computed:\n * <ul>\n * <li>position.x * containerWidth</li>\n * <li>position.y * containerHeight</li>\n * </ul>\n * Center of the container <pre> position: {\n * mx: 0.5,\n * my: 0.5,\n * }</pre>\n * Upper left corner of the container\n * <pre> position: {\n * mx: 0.0,\n * my: 0.0,\n * }</pre>\n * </li>\n * </ul>\n * </p>\n *\n */\n this.getScaledPath = function getScaledPath(pathId, param) {\n var rawPath = this.pathMap[pathId];\n\n // positioning\n // compute the start point of the path\n var mx, my;\n\n if(!!param.abspos) {\n mx = param.abspos.x;\n my = param.abspos.y;\n } else {\n mx = param.containerWidth * param.position.mx;\n my = param.containerHeight * param.position.my;\n }\n\n var coordinates = {}; //map for the scaled coordinates\n if(param.position) {\n\n // path\n var heightRatio = (param.containerHeight / rawPath.height) * param.yScaleFactor;\n var widthRatio = (param.containerWidth / rawPath.width) * param.xScaleFactor;\n\n\n //Apply height ratio\n for (var heightIndex = 0; heightIndex < rawPath.heightElements.length; heightIndex++) {\n coordinates['y' + heightIndex] = rawPath.heightElements[heightIndex] * heightRatio;\n }\n\n //Apply width ratio\n for (var widthIndex = 0; widthIndex < rawPath.widthElements.length; widthIndex++) {\n coordinates['x' + widthIndex] = rawPath.widthElements[widthIndex] * widthRatio;\n }\n }\n\n //Apply value to raw path\n var path = Snap.format(\n rawPath.d, {\n mx: mx,\n my: my,\n e: coordinates\n }\n );\n return path;\n };\n}","function PathMap() {\n\n /**\n * Contains a map of path elements\n *\n * <h1>Path definition</h1>\n * A parameterized path is defined like this:\n * <pre>\n * 'GATEWAY_PARALLEL': {\n * d: 'm {mx},{my} {e.x0},0 0,{e.x1} {e.x1},0 0,{e.y0} -{e.x1},0 0,{e.y1} ' +\n '-{e.x0},0 0,-{e.y1} -{e.x1},0 0,-{e.y0} {e.x1},0 z',\n * height: 17.5,\n * width: 17.5,\n * heightElements: [2.5, 7.5],\n * widthElements: [2.5, 7.5]\n * }\n * </pre>\n * <p>It's important to specify a correct <b>height and width</b> for the path as the scaling\n * is based on the ratio between the specified height and width in this object and the\n * height and width that is set as scale target (Note x,y coordinates will be scaled with\n * individual ratios).</p>\n * <p>The '<b>heightElements</b>' and '<b>widthElements</b>' array must contain the values that will be scaled.\n * The scaling is based on the computed ratios.\n * Coordinates on the y axis should be in the <b>heightElement</b>'s array, they will be scaled using\n * the computed ratio coefficient.\n * In the parameterized path the scaled values can be accessed through the 'e' object in {} brackets.\n * <ul>\n * <li>The values for the y axis can be accessed in the path string using {e.y0}, {e.y1}, ....</li>\n * <li>The values for the x axis can be accessed in the path string using {e.x0}, {e.x1}, ....</li>\n * </ul>\n * The numbers x0, x1 respectively y0, y1, ... map to the corresponding array index.\n * </p>\n */\n this.pathMap = {\n 'EVENT_MESSAGE': {\n d: 'm {mx},{my} l 0,{e.y1} l {e.x1},0 l 0,-{e.y1} z l {e.x0},{e.y0} l {e.x0},-{e.y0}',\n height: 36,\n width: 36,\n heightElements: [6, 14],\n widthElements: [10.5, 21]\n },\n 'EVENT_SIGNAL': {\n d: 'M {mx},{my} l {e.x0},{e.y0} l -{e.x1},0 Z',\n height: 36,\n width: 36,\n heightElements: [18],\n widthElements: [10, 20]\n },\n 'EVENT_ESCALATION': {\n d: 'M {mx},{my} l {e.x0},{e.y0} l -{e.x0},-{e.y1} l -{e.x0},{e.y1} Z',\n height: 36,\n width: 36,\n heightElements: [20, 7],\n widthElements: [8]\n },\n 'EVENT_CONDITIONAL': {\n d: 'M {e.x0},{e.y0} l {e.x1},0 l 0,{e.y2} l -{e.x1},0 Z ' +\n 'M {e.x2},{e.y3} l {e.x0},0 ' +\n 'M {e.x2},{e.y4} l {e.x0},0 ' +\n 'M {e.x2},{e.y5} l {e.x0},0 ' +\n 'M {e.x2},{e.y6} l {e.x0},0 ' +\n 'M {e.x2},{e.y7} l {e.x0},0 ' +\n 'M {e.x2},{e.y8} l {e.x0},0 ',\n height: 36,\n width: 36,\n heightElements: [8.5, 14.5, 18, 11.5, 14.5, 17.5, 20.5, 23.5, 26.5],\n widthElements: [10.5, 14.5, 12.5]\n },\n 'EVENT_LINK': {\n d: 'm {mx},{my} 0,{e.y0} -{e.x1},0 0,{e.y1} {e.x1},0 0,{e.y0} {e.x0},-{e.y2} -{e.x0},-{e.y2} z',\n height: 36,\n width: 36,\n heightElements: [4.4375, 6.75, 7.8125],\n widthElements: [9.84375, 13.5]\n },\n 'EVENT_ERROR': {\n d: 'm {mx},{my} {e.x0},-{e.y0} {e.x1},-{e.y1} {e.x2},{e.y2} {e.x3},-{e.y3} -{e.x4},{e.y4} -{e.x5},-{e.y5} z',\n height: 36,\n width: 36,\n heightElements: [0.023, 8.737, 8.151, 16.564, 10.591, 8.714],\n widthElements: [0.085, 6.672, 6.97, 4.273, 5.337, 6.636]\n },\n 'EVENT_CANCEL_45': {\n d: 'm {mx},{my} -{e.x1},0 0,{e.x0} {e.x1},0 0,{e.y1} {e.x0},0 ' +\n '0,-{e.y1} {e.x1},0 0,-{e.y0} -{e.x1},0 0,-{e.y1} -{e.x0},0 z',\n height: 36,\n width: 36,\n heightElements: [4.75, 8.5],\n widthElements: [4.75, 8.5]\n },\n 'EVENT_COMPENSATION': {\n d: 'm {mx},{my} {e.x0},-{e.y0} 0,{e.y1} z m {e.x1},-{e.y2} {e.x2},-{e.y3} 0,{e.y1} -{e.x2},-{e.y3} z',\n height: 36,\n width: 36,\n heightElements: [6.5, 13, 0.4, 6.1],\n widthElements: [9, 9.3, 8.7]\n },\n 'EVENT_TIMER_WH': {\n d: 'M {mx},{my} l {e.x0},-{e.y0} m -{e.x0},{e.y0} l {e.x1},{e.y1} ',\n height: 36,\n width: 36,\n heightElements: [10, 2],\n widthElements: [3, 7]\n },\n 'EVENT_TIMER_LINE': {\n d: 'M {mx},{my} ' +\n 'm {e.x0},{e.y0} l -{e.x1},{e.y1} ',\n height: 36,\n width: 36,\n heightElements: [10, 3],\n widthElements: [0, 0]\n },\n 'EVENT_MULTIPLE': {\n d:'m {mx},{my} {e.x1},-{e.y0} {e.x1},{e.y0} -{e.x0},{e.y1} -{e.x2},0 z',\n height: 36,\n width: 36,\n heightElements: [6.28099, 12.56199],\n widthElements: [3.1405, 9.42149, 12.56198]\n },\n 'EVENT_PARALLEL_MULTIPLE': {\n d:'m {mx},{my} {e.x0},0 0,{e.y1} {e.x1},0 0,{e.y0} -{e.x1},0 0,{e.y1} ' +\n '-{e.x0},0 0,-{e.y1} -{e.x1},0 0,-{e.y0} {e.x1},0 z',\n height: 36,\n width: 36,\n heightElements: [2.56228, 7.68683],\n widthElements: [2.56228, 7.68683]\n },\n 'GATEWAY_EXCLUSIVE': {\n d:'m {mx},{my} {e.x0},{e.y0} {e.x1},{e.y0} {e.x2},0 {e.x4},{e.y2} ' +\n '{e.x4},{e.y1} {e.x2},0 {e.x1},{e.y3} {e.x0},{e.y3} ' +\n '{e.x3},0 {e.x5},{e.y1} {e.x5},{e.y2} {e.x3},0 z',\n height: 17.5,\n width: 17.5,\n heightElements: [8.5, 6.5312, -6.5312, -8.5],\n widthElements: [6.5, -6.5, 3, -3, 5, -5]\n },\n 'GATEWAY_PARALLEL': {\n d:'m {mx},{my} 0,{e.y1} -{e.x1},0 0,{e.y0} {e.x1},0 0,{e.y1} {e.x0},0 ' +\n '0,-{e.y1} {e.x1},0 0,-{e.y0} -{e.x1},0 0,-{e.y1} -{e.x0},0 z',\n height: 30,\n width: 30,\n heightElements: [5, 12.5],\n widthElements: [5, 12.5]\n },\n 'GATEWAY_EVENT_BASED': {\n d:'m {mx},{my} {e.x0},{e.y0} {e.x0},{e.y1} {e.x1},{e.y2} {e.x2},0 z',\n height: 11,\n width: 11,\n heightElements: [-6, 6, 12, -12],\n widthElements: [9, -3, -12]\n },\n 'GATEWAY_COMPLEX': {\n d:'m {mx},{my} 0,{e.y0} -{e.x0},-{e.y1} -{e.x1},{e.y2} {e.x0},{e.y1} -{e.x2},0 0,{e.y3} ' +\n '{e.x2},0 -{e.x0},{e.y1} l {e.x1},{e.y2} {e.x0},-{e.y1} 0,{e.y0} {e.x3},0 0,-{e.y0} {e.x0},{e.y1} ' +\n '{e.x1},-{e.y2} -{e.x0},-{e.y1} {e.x2},0 0,-{e.y3} -{e.x2},0 {e.x0},-{e.y1} -{e.x1},-{e.y2} ' +\n '-{e.x0},{e.y1} 0,-{e.y0} -{e.x3},0 z',\n height: 17.125,\n width: 17.125,\n heightElements: [4.875, 3.4375, 2.125, 3],\n widthElements: [3.4375, 2.125, 4.875, 3]\n },\n 'DATA_OBJECT_PATH': {\n d:'m 0,0 {e.x1},0 {e.x0},{e.y0} 0,{e.y1} -{e.x2},0 0,-{e.y2} {e.x1},0 0,{e.y0} {e.x0},0',\n height: 61,\n width: 51,\n heightElements: [10, 50, 60],\n widthElements: [10, 40, 50, 60]\n },\n 'DATA_OBJECT_COLLECTION_PATH': {\n d: 'm{mx},{my} m 3,2 l 0,10 m 3,-10 l 0,10 m 3,-10 l 0,10',\n height: 10,\n width: 10,\n heightElements: [],\n widthElements: []\n },\n 'DATA_ARROW': {\n d:'m 5,9 9,0 0,-3 5,5 -5,5 0,-3 -9,0 z',\n height: 61,\n width: 51,\n heightElements: [],\n widthElements: []\n },\n 'DATA_STORE': {\n d:'m {mx},{my} ' +\n 'l 0,{e.y2} ' +\n 'c {e.x0},{e.y1} {e.x1},{e.y1} {e.x2},0 ' +\n 'l 0,-{e.y2} ' +\n 'c -{e.x0},-{e.y1} -{e.x1},-{e.y1} -{e.x2},0' +\n 'c {e.x0},{e.y1} {e.x1},{e.y1} {e.x2},0 ' +\n 'm -{e.x2},{e.y0}' +\n 'c {e.x0},{e.y1} {e.x1},{e.y1} {e.x2},0' +\n 'm -{e.x2},{e.y0}' +\n 'c {e.x0},{e.y1} {e.x1},{e.y1} {e.x2},0',\n height: 61,\n width: 61,\n heightElements: [7, 10, 45],\n widthElements: [2, 58, 60]\n },\n 'TEXT_ANNOTATION': {\n d: 'm {mx}, {my} m 10,0 l -10,0 l 0,{e.y0} l 10,0',\n height: 30,\n width: 10,\n heightElements: [30],\n widthElements: [10]\n },\n 'MARKER_SUB_PROCESS': {\n d: 'm{mx},{my} m 7,2 l 0,10 m -5,-5 l 10,0',\n height: 10,\n width: 10,\n heightElements: [],\n widthElements: []\n },\n 'MARKER_PARALLEL': {\n d: 'm{mx},{my} m 3,2 l 0,10 m 3,-10 l 0,10 m 3,-10 l 0,10',\n height: 10,\n width: 10,\n heightElements: [],\n widthElements: []\n },\n 'MARKER_SEQUENTIAL': {\n d: 'm{mx},{my} m 0,3 l 10,0 m -10,3 l 10,0 m -10,3 l 10,0',\n height: 10,\n width: 10,\n heightElements: [],\n widthElements: []\n },\n 'MARKER_COMPENSATION': {\n d: 'm {mx},{my} 7,-5 0,10 z m 7.1,-0.3 6.9,-4.7 0,10 -6.9,-4.7 z',\n height: 10,\n width: 21,\n heightElements: [],\n widthElements: []\n },\n 'MARKER_LOOP': {\n d: 'm {mx},{my} c 3.526979,0 6.386161,-2.829858 6.386161,-6.320661 0,-3.490806 -2.859182,-6.320661 ' +\n '-6.386161,-6.320661 -3.526978,0 -6.38616,2.829855 -6.38616,6.320661 0,1.745402 ' +\n '0.714797,3.325567 1.870463,4.469381 0.577834,0.571908 1.265885,1.034728 2.029916,1.35457 ' +\n 'l -0.718163,-3.909793 m 0.718163,3.909793 -3.885211,0.802902',\n height: 13.9,\n width: 13.7,\n heightElements: [],\n widthElements: []\n },\n 'MARKER_ADHOC': {\n d: 'm {mx},{my} m 0.84461,2.64411 c 1.05533,-1.23780996 2.64337,-2.07882 4.29653,-1.97997996 2.05163,0.0805 ' +\n '3.85579,1.15803 5.76082,1.79107 1.06385,0.34139996 2.24454,0.1438 3.18759,-0.43767 0.61743,-0.33642 ' +\n '1.2775,-0.64078 1.7542,-1.17511 0,0.56023 0,1.12046 0,1.6807 -0.98706,0.96237996 -2.29792,1.62393996 ' +\n '-3.6918,1.66181996 -1.24459,0.0927 -2.46671,-0.2491 -3.59505,-0.74812 -1.35789,-0.55965 ' +\n '-2.75133,-1.33436996 -4.27027,-1.18121996 -1.37741,0.14601 -2.41842,1.13685996 -3.44288,1.96782996 z',\n height: 4,\n width: 15,\n heightElements: [],\n widthElements: []\n },\n 'TASK_TYPE_SEND': {\n d: 'm {mx},{my} l 0,{e.y1} l {e.x1},0 l 0,-{e.y1} z l {e.x0},{e.y0} l {e.x0},-{e.y0}',\n height: 14,\n width: 21,\n heightElements: [6, 14],\n widthElements: [10.5, 21]\n },\n 'TASK_TYPE_SCRIPT': {\n d: 'm {mx},{my} c 9.966553,-6.27276 -8.000926,-7.91932 2.968968,-14.938 l -8.802728,0 ' +\n 'c -10.969894,7.01868 6.997585,8.66524 -2.968967,14.938 z ' +\n 'm -7,-12 l 5,0 ' +\n 'm -4.5,3 l 4.5,0 ' +\n 'm -3,3 l 5,0' +\n 'm -4,3 l 5,0',\n height: 15,\n width: 12.6,\n heightElements: [6, 14],\n widthElements: [10.5, 21]\n },\n 'TASK_TYPE_USER_1': {\n d: 'm {mx},{my} c 0.909,-0.845 1.594,-2.049 1.594,-3.385 0,-2.554 -1.805,-4.62199999 ' +\n '-4.357,-4.62199999 -2.55199998,0 -4.28799998,2.06799999 -4.28799998,4.62199999 0,1.348 ' +\n '0.974,2.562 1.89599998,3.405 -0.52899998,0.187 -5.669,2.097 -5.794,4.7560005 v 6.718 ' +\n 'h 17 v -6.718 c 0,-2.2980005 -5.5279996,-4.5950005 -6.0509996,-4.7760005 z' +\n 'm -8,6 l 0,5.5 m 11,0 l 0,-5'\n },\n 'TASK_TYPE_USER_2': {\n d: 'm {mx},{my} m 2.162,1.009 c 0,2.4470005 -2.158,4.4310005 -4.821,4.4310005 ' +\n '-2.66499998,0 -4.822,-1.981 -4.822,-4.4310005 '\n },\n 'TASK_TYPE_USER_3': {\n d: 'm {mx},{my} m -6.9,-3.80 c 0,0 2.25099998,-2.358 4.27399998,-1.177 2.024,1.181 4.221,1.537 ' +\n '4.124,0.965 -0.098,-0.57 -0.117,-3.79099999 -4.191,-4.13599999 -3.57499998,0.001 ' +\n '-4.20799998,3.36699999 -4.20699998,4.34799999 z'\n },\n 'TASK_TYPE_MANUAL': {\n d: 'm {mx},{my} c 0.234,-0.01 5.604,0.008 8.029,0.004 0.808,0 1.271,-0.172 1.417,-0.752 0.227,-0.898 ' +\n '-0.334,-1.314 -1.338,-1.316 -2.467,-0.01 -7.886,-0.004 -8.108,-0.004 -0.014,-0.079 0.016,-0.533 0,-0.61 ' +\n '0.195,-0.042 8.507,0.006 9.616,0.002 0.877,-0.007 1.35,-0.438 1.353,-1.208 0.003,-0.768 -0.479,-1.09 ' +\n '-1.35,-1.091 -2.968,-0.002 -9.619,-0.013 -9.619,-0.013 v -0.591 c 0,0 5.052,-0.016 7.225,-0.016 ' +\n '0.888,-0.002 1.354,-0.416 1.351,-1.193 -0.006,-0.761 -0.492,-1.196 -1.361,-1.196 -3.473,-0.005 ' +\n '-10.86,-0.003 -11.0829995,-0.003 -0.022,-0.047 -0.045,-0.094 -0.069,-0.139 0.3939995,-0.319 ' +\n '2.0409995,-1.626 2.4149995,-2.017 0.469,-0.4870005 0.519,-1.1650005 0.162,-1.6040005 -0.414,-0.511 ' +\n '-0.973,-0.5 -1.48,-0.236 -1.4609995,0.764 -6.5999995,3.6430005 -7.7329995,4.2710005 -0.9,0.499 ' +\n '-1.516,1.253 -1.882,2.19 -0.37000002,0.95 -0.17,2.01 -0.166,2.979 0.004,0.718 -0.27300002,1.345 ' +\n '-0.055,2.063 0.629,2.087 2.425,3.312 4.859,3.318 4.6179995,0.014 9.2379995,-0.139 13.8569995,-0.158 ' +\n '0.755,-0.004 1.171,-0.301 1.182,-1.033 0.012,-0.754 -0.423,-0.969 -1.183,-0.973 -1.778,-0.01 ' +\n '-5.824,-0.004 -6.04,-0.004 10e-4,-0.084 0.003,-0.586 10e-4,-0.67 z'\n },\n 'TASK_TYPE_INSTANTIATING_SEND': {\n d: 'm {mx},{my} l 0,8.4 l 12.6,0 l 0,-8.4 z l 6.3,3.6 l 6.3,-3.6'\n },\n 'TASK_TYPE_SERVICE': {\n d: 'm {mx},{my} v -1.71335 c 0.352326,-0.0705 0.703932,-0.17838 1.047628,-0.32133 ' +\n '0.344416,-0.14465 0.665822,-0.32133 0.966377,-0.52145 l 1.19431,1.18005 1.567487,-1.57688 ' +\n '-1.195028,-1.18014 c 0.403376,-0.61394 0.683079,-1.29908 0.825447,-2.01824 l 1.622133,-0.01 ' +\n 'v -2.2196 l -1.636514,0.01 c -0.07333,-0.35153 -0.178319,-0.70024 -0.323564,-1.04372 ' +\n '-0.145244,-0.34406 -0.321407,-0.6644 -0.522735,-0.96217 l 1.131035,-1.13631 -1.583305,-1.56293 ' +\n '-1.129598,1.13589 c -0.614052,-0.40108 -1.302883,-0.68093 -2.022633,-0.82247 l 0.0093,-1.61852 ' +\n 'h -2.241173 l 0.0042,1.63124 c -0.353763,0.0736 -0.705369,0.17977 -1.049785,0.32371 -0.344415,0.14437 ' +\n '-0.665102,0.32092 -0.9635006,0.52046 l -1.1698628,-1.15823 -1.5667691,1.5792 1.1684265,1.15669 ' +\n 'c -0.4026573,0.61283 -0.68308,1.29797 -0.8247287,2.01713 l -1.6588041,0.003 v 2.22174 ' +\n 'l 1.6724648,-0.006 c 0.073327,0.35077 0.1797598,0.70243 0.3242851,1.04472 0.1452428,0.34448 ' +\n '0.3214064,0.6644 0.5227339,0.96066 l -1.1993431,1.19723 1.5840256,1.56011 1.1964668,-1.19348 ' +\n 'c 0.6140517,0.40346 1.3028827,0.68232 2.0233517,0.82331 l 7.19e-4,1.69892 h 2.226848 z ' +\n 'm 0.221462,-3.9957 c -1.788948,0.7502 -3.8576,-0.0928 -4.6097055,-1.87438 -0.7521065,-1.78321 ' +\n '0.090598,-3.84627 1.8802645,-4.59604 1.78823,-0.74936 3.856881,0.0929 4.608987,1.87437 ' +\n '0.752106,1.78165 -0.0906,3.84612 -1.879546,4.59605 z'\n },\n 'TASK_TYPE_SERVICE_FILL': {\n d: 'm {mx},{my} c -1.788948,0.7502 -3.8576,-0.0928 -4.6097055,-1.87438 -0.7521065,-1.78321 ' +\n '0.090598,-3.84627 1.8802645,-4.59604 1.78823,-0.74936 3.856881,0.0929 4.608987,1.87437 ' +\n '0.752106,1.78165 -0.0906,3.84612 -1.879546,4.59605 z'\n },\n 'TASK_TYPE_BUSINESS_RULE_HEADER': {\n d: 'm {mx},{my} 0,4 20,0 0,-4 z'\n },\n 'TASK_TYPE_BUSINESS_RULE_MAIN': {\n d: 'm {mx},{my} 0,12 20,0 0,-12 z' +\n 'm 0,8 l 20,0 ' +\n 'm -13,-4 l 0,8'\n },\n 'MESSAGE_FLOW_MARKER': {\n d: 'm {mx},{my} m -10.5 ,-7 l 0,14 l 21,0 l 0,-14 z l 10.5,6 l 10.5,-6'\n }\n };\n\n this.getRawPath = function getRawPath(pathId) {\n return this.pathMap[pathId].d;\n };\n\n /**\n * Scales the path to the given height and width.\n * <h1>Use case</h1>\n * <p>Use case is to scale the content of elements (event, gateways) based\n * on the element bounding box's size.\n * </p>\n * <h1>Why not transform</h1>\n * <p>Scaling a path with transform() will also scale the stroke and IE does not support\n * the option 'non-scaling-stroke' to prevent this.\n * Also there are use cases where only some parts of a path should be\n * scaled.</p>\n *\n * @param {string} pathId The ID of the path.\n * @param {Object} param <p>\n * Example param object scales the path to 60% size of the container (data.width, data.height).\n * <pre>\n * {\n * xScaleFactor: 0.6,\n * yScaleFactor:0.6,\n * containerWidth: data.width,\n * containerHeight: data.height,\n * position: {\n * mx: 0.46,\n * my: 0.2,\n * }\n * }\n * </pre>\n * <ul>\n * <li>targetpathwidth = xScaleFactor * containerWidth</li>\n * <li>targetpathheight = yScaleFactor * containerHeight</li>\n * <li>Position is used to set the starting coordinate of the path. M is computed:\n * <ul>\n * <li>position.x * containerWidth</li>\n * <li>position.y * containerHeight</li>\n * </ul>\n * Center of the container <pre> position: {\n * mx: 0.5,\n * my: 0.5,\n * }</pre>\n * Upper left corner of the container\n * <pre> position: {\n * mx: 0.0,\n * my: 0.0,\n * }</pre>\n * </li>\n * </ul>\n * </p>\n *\n */\n this.getScaledPath = function getScaledPath(pathId, param) {\n var rawPath = this.pathMap[pathId];\n\n // positioning\n // compute the start point of the path\n var mx, my;\n\n if (param.abspos) {\n mx = param.abspos.x;\n my = param.abspos.y;\n } else {\n mx = param.containerWidth * param.position.mx;\n my = param.containerHeight * param.position.my;\n }\n\n var coordinates = {}; // map for the scaled coordinates\n if (param.position) {\n\n // path\n var heightRatio = (param.containerHeight / rawPath.height) * param.yScaleFactor;\n var widthRatio = (param.containerWidth / rawPath.width) * param.xScaleFactor;\n\n\n // Apply height ratio\n for (var heightIndex = 0; heightIndex < rawPath.heightElements.length; heightIndex++) {\n coordinates['y' + heightIndex] = rawPath.heightElements[heightIndex] * heightRatio;\n }\n\n // Apply width ratio\n for (var widthIndex = 0; widthIndex < rawPath.widthElements.length; widthIndex++) {\n coordinates['x' + widthIndex] = rawPath.widthElements[widthIndex] * widthRatio;\n }\n }\n\n // Apply value to raw path\n var path = format$1(\n rawPath.d, {\n mx: mx,\n my: my,\n e: coordinates\n }\n );\n return path;\n };\n}","function addMapping(router, mapping) {\n for (let url in mapping.default) {\n if (url.startsWith('GET ')) {\n var path = url.substring(4);\n router.get(path, mapping[url]);\n console.log(`register URL mapping: GET ${path}`);\n\n } else if (url.startsWith('POST ')) {\n var path = url.substring(5);\n router.post(path, mapping[url]);\n console.log(`register URL mapping: POST ${path}`);\n\n } else if (url.startsWith('PUT ')) {\n var path = url.substring(4);\n router.put(path, mapping[url]);\n console.log(`register URL mapping: PUT ${path}`);\n\n } else if (url.startsWith('DELETE ')) {\n var path = url.substring(7);\n router.del(path, mapping[url]);\n console.log(`register URL mapping: DELETE ${path}`);\n\n } else {\n console.log(`invalid URL: ${url}`);\n }\n }\n}","function PathMap() {\n /**\n * Contains a map of path elements\n *\n * <h1>Path definition</h1>\n * A parameterized path is defined like this:\n * <pre>\n * 'GATEWAY_PARALLEL': {\n * d: 'm {mx},{my} {e.x0},0 0,{e.x1} {e.x1},0 0,{e.y0} -{e.x1},0 0,{e.y1} ' +\n '-{e.x0},0 0,-{e.y1} -{e.x1},0 0,-{e.y0} {e.x1},0 z',\n * height: 17.5,\n * width: 17.5,\n * heightElements: [2.5, 7.5],\n * widthElements: [2.5, 7.5]\n * }\n * </pre>\n * <p>It's important to specify a correct <b>height and width</b> for the path as the scaling\n * is based on the ratio between the specified height and width in this object and the\n * height and width that is set as scale target (Note x,y coordinates will be scaled with\n * individual ratios).</p>\n * <p>The '<b>heightElements</b>' and '<b>widthElements</b>' array must contain the values that will be scaled.\n * The scaling is based on the computed ratios.\n * Coordinates on the y axis should be in the <b>heightElement</b>'s array, they will be scaled using\n * the computed ratio coefficient.\n * In the parameterized path the scaled values can be accessed through the 'e' object in {} brackets.\n * <ul>\n * <li>The values for the y axis can be accessed in the path string using {e.y0}, {e.y1}, ....</li>\n * <li>The values for the x axis can be accessed in the path string using {e.x0}, {e.x1}, ....</li>\n * </ul>\n * The numbers x0, x1 respectively y0, y1, ... map to the corresponding array index.\n * </p>\n */\n this.pathMap = {\n 'EVENT_MESSAGE': {\n d: 'm {mx},{my} l 0,{e.y1} l {e.x1},0 l 0,-{e.y1} z l {e.x0},{e.y0} l {e.x0},-{e.y0}',\n height: 36,\n width: 36,\n heightElements: [6, 14],\n widthElements: [10.5, 21]\n },\n 'EVENT_SIGNAL': {\n d: 'M {mx},{my} l {e.x0},{e.y0} l -{e.x1},0 Z',\n height: 36,\n width: 36,\n heightElements: [18],\n widthElements: [10, 20]\n },\n 'EVENT_ESCALATION': {\n d: 'M {mx},{my} l {e.x0},{e.y0} l -{e.x0},-{e.y1} l -{e.x0},{e.y1} Z',\n height: 36,\n width: 36,\n heightElements: [20, 7],\n widthElements: [8]\n },\n 'EVENT_CONDITIONAL': {\n d: 'M {e.x0},{e.y0} l {e.x1},0 l 0,{e.y2} l -{e.x1},0 Z ' +\n 'M {e.x2},{e.y3} l {e.x0},0 ' +\n 'M {e.x2},{e.y4} l {e.x0},0 ' +\n 'M {e.x2},{e.y5} l {e.x0},0 ' +\n 'M {e.x2},{e.y6} l {e.x0},0 ' +\n 'M {e.x2},{e.y7} l {e.x0},0 ' +\n 'M {e.x2},{e.y8} l {e.x0},0 ',\n height: 36,\n width: 36,\n heightElements: [8.5, 14.5, 18, 11.5, 14.5, 17.5, 20.5, 23.5, 26.5],\n widthElements: [10.5, 14.5, 12.5]\n },\n 'EVENT_LINK': {\n d: 'm {mx},{my} 0,{e.y0} -{e.x1},0 0,{e.y1} {e.x1},0 0,{e.y0} {e.x0},-{e.y2} -{e.x0},-{e.y2} z',\n height: 36,\n width: 36,\n heightElements: [4.4375, 6.75, 7.8125],\n widthElements: [9.84375, 13.5]\n },\n 'EVENT_ERROR': {\n d: 'm {mx},{my} {e.x0},-{e.y0} {e.x1},-{e.y1} {e.x2},{e.y2} {e.x3},-{e.y3} -{e.x4},{e.y4} -{e.x5},-{e.y5} z',\n height: 36,\n width: 36,\n heightElements: [0.023, 8.737, 8.151, 16.564, 10.591, 8.714],\n widthElements: [0.085, 6.672, 6.97, 4.273, 5.337, 6.636]\n },\n 'EVENT_CANCEL_45': {\n d: 'm {mx},{my} -{e.x1},0 0,{e.x0} {e.x1},0 0,{e.y1} {e.x0},0 ' +\n '0,-{e.y1} {e.x1},0 0,-{e.y0} -{e.x1},0 0,-{e.y1} -{e.x0},0 z',\n height: 36,\n width: 36,\n heightElements: [4.75, 8.5],\n widthElements: [4.75, 8.5]\n },\n 'EVENT_COMPENSATION': {\n d: 'm {mx},{my} {e.x0},-{e.y0} 0,{e.y1} z m {e.x1},-{e.y2} {e.x2},-{e.y3} 0,{e.y1} -{e.x2},-{e.y3} z',\n height: 36,\n width: 36,\n heightElements: [6.5, 13, 0.4, 6.1],\n widthElements: [9, 9.3, 8.7]\n },\n 'EVENT_TIMER_WH': {\n d: 'M {mx},{my} l {e.x0},-{e.y0} m -{e.x0},{e.y0} l {e.x1},{e.y1} ',\n height: 36,\n width: 36,\n heightElements: [10, 2],\n widthElements: [3, 7]\n },\n 'EVENT_TIMER_LINE': {\n d: 'M {mx},{my} ' +\n 'm {e.x0},{e.y0} l -{e.x1},{e.y1} ',\n height: 36,\n width: 36,\n heightElements: [10, 3],\n widthElements: [0, 0]\n },\n 'EVENT_MULTIPLE': {\n d: 'm {mx},{my} {e.x1},-{e.y0} {e.x1},{e.y0} -{e.x0},{e.y1} -{e.x2},0 z',\n height: 36,\n width: 36,\n heightElements: [6.28099, 12.56199],\n widthElements: [3.1405, 9.42149, 12.56198]\n },\n 'EVENT_PARALLEL_MULTIPLE': {\n d: 'm {mx},{my} {e.x0},0 0,{e.y1} {e.x1},0 0,{e.y0} -{e.x1},0 0,{e.y1} ' +\n '-{e.x0},0 0,-{e.y1} -{e.x1},0 0,-{e.y0} {e.x1},0 z',\n height: 36,\n width: 36,\n heightElements: [2.56228, 7.68683],\n widthElements: [2.56228, 7.68683]\n },\n 'GATEWAY_EXCLUSIVE': {\n d: 'm {mx},{my} {e.x0},{e.y0} {e.x1},{e.y0} {e.x2},0 {e.x4},{e.y2} ' +\n '{e.x4},{e.y1} {e.x2},0 {e.x1},{e.y3} {e.x0},{e.y3} ' +\n '{e.x3},0 {e.x5},{e.y1} {e.x5},{e.y2} {e.x3},0 z',\n height: 17.5,\n width: 17.5,\n heightElements: [8.5, 6.5312, -6.5312, -8.5],\n widthElements: [6.5, -6.5, 3, -3, 5, -5]\n },\n 'GATEWAY_PARALLEL': {\n d: 'm {mx},{my} 0,{e.y1} -{e.x1},0 0,{e.y0} {e.x1},0 0,{e.y1} {e.x0},0 ' +\n '0,-{e.y1} {e.x1},0 0,-{e.y0} -{e.x1},0 0,-{e.y1} -{e.x0},0 z',\n height: 30,\n width: 30,\n heightElements: [5, 12.5],\n widthElements: [5, 12.5]\n },\n 'GATEWAY_EVENT_BASED': {\n d: 'm {mx},{my} {e.x0},{e.y0} {e.x0},{e.y1} {e.x1},{e.y2} {e.x2},0 z',\n height: 11,\n width: 11,\n heightElements: [-6, 6, 12, -12],\n widthElements: [9, -3, -12]\n },\n 'GATEWAY_COMPLEX': {\n d: 'm {mx},{my} 0,{e.y0} -{e.x0},-{e.y1} -{e.x1},{e.y2} {e.x0},{e.y1} -{e.x2},0 0,{e.y3} ' +\n '{e.x2},0 -{e.x0},{e.y1} l {e.x1},{e.y2} {e.x0},-{e.y1} 0,{e.y0} {e.x3},0 0,-{e.y0} {e.x0},{e.y1} ' +\n '{e.x1},-{e.y2} -{e.x0},-{e.y1} {e.x2},0 0,-{e.y3} -{e.x2},0 {e.x0},-{e.y1} -{e.x1},-{e.y2} ' +\n '-{e.x0},{e.y1} 0,-{e.y0} -{e.x3},0 z',\n height: 17.125,\n width: 17.125,\n heightElements: [4.875, 3.4375, 2.125, 3],\n widthElements: [3.4375, 2.125, 4.875, 3]\n },\n 'DATA_OBJECT_PATH': {\n d: 'm 0,0 {e.x1},0 {e.x0},{e.y0} 0,{e.y1} -{e.x2},0 0,-{e.y2} {e.x1},0 0,{e.y0} {e.x0},0',\n height: 61,\n width: 51,\n heightElements: [10, 50, 60],\n widthElements: [10, 40, 50, 60]\n },\n 'DATA_OBJECT_COLLECTION_PATH': {\n d: 'm {mx}, {my} ' +\n 'm 0 15 l 0 -15 ' +\n 'm 4 15 l 0 -15 ' +\n 'm 4 15 l 0 -15 ',\n height: 61,\n width: 51,\n heightElements: [12],\n widthElements: [1, 6, 12, 15]\n },\n 'DATA_ARROW': {\n d: 'm 5,9 9,0 0,-3 5,5 -5,5 0,-3 -9,0 z',\n height: 61,\n width: 51,\n heightElements: [],\n widthElements: []\n },\n 'DATA_STORE': {\n d: 'm {mx},{my} ' +\n 'l 0,{e.y2} ' +\n 'c {e.x0},{e.y1} {e.x1},{e.y1} {e.x2},0 ' +\n 'l 0,-{e.y2} ' +\n 'c -{e.x0},-{e.y1} -{e.x1},-{e.y1} -{e.x2},0' +\n 'c {e.x0},{e.y1} {e.x1},{e.y1} {e.x2},0 ' +\n 'm -{e.x2},{e.y0}' +\n 'c {e.x0},{e.y1} {e.x1},{e.y1} {e.x2},0' +\n 'm -{e.x2},{e.y0}' +\n 'c {e.x0},{e.y1} {e.x1},{e.y1} {e.x2},0',\n height: 61,\n width: 61,\n heightElements: [7, 10, 45],\n widthElements: [2, 58, 60]\n },\n 'TEXT_ANNOTATION': {\n d: 'm {mx}, {my} m 10,0 l -10,0 l 0,{e.y0} l 10,0',\n height: 30,\n width: 10,\n heightElements: [30],\n widthElements: [10]\n },\n 'MARKER_SUB_PROCESS': {\n d: 'm{mx},{my} m 7,2 l 0,10 m -5,-5 l 10,0',\n height: 10,\n width: 10,\n heightElements: [],\n widthElements: []\n },\n 'MARKER_PARALLEL': {\n d: 'm{mx},{my} m 3,2 l 0,10 m 3,-10 l 0,10 m 3,-10 l 0,10',\n height: 10,\n width: 10,\n heightElements: [],\n widthElements: []\n },\n 'MARKER_SEQUENTIAL': {\n d: 'm{mx},{my} m 0,3 l 10,0 m -10,3 l 10,0 m -10,3 l 10,0',\n height: 10,\n width: 10,\n heightElements: [],\n widthElements: []\n },\n 'MARKER_COMPENSATION': {\n d: 'm {mx},{my} 7,-5 0,10 z m 7.1,-0.3 6.9,-4.7 0,10 -6.9,-4.7 z',\n height: 10,\n width: 21,\n heightElements: [],\n widthElements: []\n },\n 'MARKER_LOOP': {\n d: 'm {mx},{my} c 3.526979,0 6.386161,-2.829858 6.386161,-6.320661 0,-3.490806 -2.859182,-6.320661 ' +\n '-6.386161,-6.320661 -3.526978,0 -6.38616,2.829855 -6.38616,6.320661 0,1.745402 ' +\n '0.714797,3.325567 1.870463,4.469381 0.577834,0.571908 1.265885,1.034728 2.029916,1.35457 ' +\n 'l -0.718163,-3.909793 m 0.718163,3.909793 -3.885211,0.802902',\n height: 13.9,\n width: 13.7,\n heightElements: [],\n widthElements: []\n },\n 'MARKER_ADHOC': {\n d: 'm {mx},{my} m 0.84461,2.64411 c 1.05533,-1.23780996 2.64337,-2.07882 4.29653,-1.97997996 2.05163,0.0805 ' +\n '3.85579,1.15803 5.76082,1.79107 1.06385,0.34139996 2.24454,0.1438 3.18759,-0.43767 0.61743,-0.33642 ' +\n '1.2775,-0.64078 1.7542,-1.17511 0,0.56023 0,1.12046 0,1.6807 -0.98706,0.96237996 -2.29792,1.62393996 ' +\n '-3.6918,1.66181996 -1.24459,0.0927 -2.46671,-0.2491 -3.59505,-0.74812 -1.35789,-0.55965 ' +\n '-2.75133,-1.33436996 -4.27027,-1.18121996 -1.37741,0.14601 -2.41842,1.13685996 -3.44288,1.96782996 z',\n height: 4,\n width: 15,\n heightElements: [],\n widthElements: []\n },\n 'TASK_TYPE_SEND': {\n d: 'm {mx},{my} l 0,{e.y1} l {e.x1},0 l 0,-{e.y1} z l {e.x0},{e.y0} l {e.x0},-{e.y0}',\n height: 14,\n width: 21,\n heightElements: [6, 14],\n widthElements: [10.5, 21]\n },\n 'TASK_TYPE_SCRIPT': {\n d: 'm {mx},{my} c 9.966553,-6.27276 -8.000926,-7.91932 2.968968,-14.938 l -8.802728,0 ' +\n 'c -10.969894,7.01868 6.997585,8.66524 -2.968967,14.938 z ' +\n 'm -7,-12 l 5,0 ' +\n 'm -4.5,3 l 4.5,0 ' +\n 'm -3,3 l 5,0' +\n 'm -4,3 l 5,0',\n height: 15,\n width: 12.6,\n heightElements: [6, 14],\n widthElements: [10.5, 21]\n },\n 'TASK_TYPE_USER_1': {\n d: 'm {mx},{my} c 0.909,-0.845 1.594,-2.049 1.594,-3.385 0,-2.554 -1.805,-4.62199999 ' +\n '-4.357,-4.62199999 -2.55199998,0 -4.28799998,2.06799999 -4.28799998,4.62199999 0,1.348 ' +\n '0.974,2.562 1.89599998,3.405 -0.52899998,0.187 -5.669,2.097 -5.794,4.7560005 v 6.718 ' +\n 'h 17 v -6.718 c 0,-2.2980005 -5.5279996,-4.5950005 -6.0509996,-4.7760005 z' +\n 'm -8,6 l 0,5.5 m 11,0 l 0,-5'\n },\n 'TASK_TYPE_USER_2': {\n d: 'm {mx},{my} m 2.162,1.009 c 0,2.4470005 -2.158,4.4310005 -4.821,4.4310005 ' +\n '-2.66499998,0 -4.822,-1.981 -4.822,-4.4310005 '\n },\n 'TASK_TYPE_USER_3': {\n d: 'm {mx},{my} m -6.9,-3.80 c 0,0 2.25099998,-2.358 4.27399998,-1.177 2.024,1.181 4.221,1.537 ' +\n '4.124,0.965 -0.098,-0.57 -0.117,-3.79099999 -4.191,-4.13599999 -3.57499998,0.001 ' +\n '-4.20799998,3.36699999 -4.20699998,4.34799999 z'\n },\n 'TASK_TYPE_MANUAL': {\n d: 'm {mx},{my} c 0.234,-0.01 5.604,0.008 8.029,0.004 0.808,0 1.271,-0.172 1.417,-0.752 0.227,-0.898 ' +\n '-0.334,-1.314 -1.338,-1.316 -2.467,-0.01 -7.886,-0.004 -8.108,-0.004 -0.014,-0.079 0.016,-0.533 0,-0.61 ' +\n '0.195,-0.042 8.507,0.006 9.616,0.002 0.877,-0.007 1.35,-0.438 1.353,-1.208 0.003,-0.768 -0.479,-1.09 ' +\n '-1.35,-1.091 -2.968,-0.002 -9.619,-0.013 -9.619,-0.013 v -0.591 c 0,0 5.052,-0.016 7.225,-0.016 ' +\n '0.888,-0.002 1.354,-0.416 1.351,-1.193 -0.006,-0.761 -0.492,-1.196 -1.361,-1.196 -3.473,-0.005 ' +\n '-10.86,-0.003 -11.0829995,-0.003 -0.022,-0.047 -0.045,-0.094 -0.069,-0.139 0.3939995,-0.319 ' +\n '2.0409995,-1.626 2.4149995,-2.017 0.469,-0.4870005 0.519,-1.1650005 0.162,-1.6040005 -0.414,-0.511 ' +\n '-0.973,-0.5 -1.48,-0.236 -1.4609995,0.764 -6.5999995,3.6430005 -7.7329995,4.2710005 -0.9,0.499 ' +\n '-1.516,1.253 -1.882,2.19 -0.37000002,0.95 -0.17,2.01 -0.166,2.979 0.004,0.718 -0.27300002,1.345 ' +\n '-0.055,2.063 0.629,2.087 2.425,3.312 4.859,3.318 4.6179995,0.014 9.2379995,-0.139 13.8569995,-0.158 ' +\n '0.755,-0.004 1.171,-0.301 1.182,-1.033 0.012,-0.754 -0.423,-0.969 -1.183,-0.973 -1.778,-0.01 ' +\n '-5.824,-0.004 -6.04,-0.004 10e-4,-0.084 0.003,-0.586 10e-4,-0.67 z'\n },\n 'TASK_TYPE_INSTANTIATING_SEND': {\n d: 'm {mx},{my} l 0,8.4 l 12.6,0 l 0,-8.4 z l 6.3,3.6 l 6.3,-3.6'\n },\n 'TASK_TYPE_SERVICE': {\n d: 'm {mx},{my} v -1.71335 c 0.352326,-0.0705 0.703932,-0.17838 1.047628,-0.32133 ' +\n '0.344416,-0.14465 0.665822,-0.32133 0.966377,-0.52145 l 1.19431,1.18005 1.567487,-1.57688 ' +\n '-1.195028,-1.18014 c 0.403376,-0.61394 0.683079,-1.29908 0.825447,-2.01824 l 1.622133,-0.01 ' +\n 'v -2.2196 l -1.636514,0.01 c -0.07333,-0.35153 -0.178319,-0.70024 -0.323564,-1.04372 ' +\n '-0.145244,-0.34406 -0.321407,-0.6644 -0.522735,-0.96217 l 1.131035,-1.13631 -1.583305,-1.56293 ' +\n '-1.129598,1.13589 c -0.614052,-0.40108 -1.302883,-0.68093 -2.022633,-0.82247 l 0.0093,-1.61852 ' +\n 'h -2.241173 l 0.0042,1.63124 c -0.353763,0.0736 -0.705369,0.17977 -1.049785,0.32371 -0.344415,0.14437 ' +\n '-0.665102,0.32092 -0.9635006,0.52046 l -1.1698628,-1.15823 -1.5667691,1.5792 1.1684265,1.15669 ' +\n 'c -0.4026573,0.61283 -0.68308,1.29797 -0.8247287,2.01713 l -1.6588041,0.003 v 2.22174 ' +\n 'l 1.6724648,-0.006 c 0.073327,0.35077 0.1797598,0.70243 0.3242851,1.04472 0.1452428,0.34448 ' +\n '0.3214064,0.6644 0.5227339,0.96066 l -1.1993431,1.19723 1.5840256,1.56011 1.1964668,-1.19348 ' +\n 'c 0.6140517,0.40346 1.3028827,0.68232 2.0233517,0.82331 l 7.19e-4,1.69892 h 2.226848 z ' +\n 'm 0.221462,-3.9957 c -1.788948,0.7502 -3.8576,-0.0928 -4.6097055,-1.87438 -0.7521065,-1.78321 ' +\n '0.090598,-3.84627 1.8802645,-4.59604 1.78823,-0.74936 3.856881,0.0929 4.608987,1.87437 ' +\n '0.752106,1.78165 -0.0906,3.84612 -1.879546,4.59605 z'\n },\n 'TASK_TYPE_SERVICE_FILL': {\n d: 'm {mx},{my} c -1.788948,0.7502 -3.8576,-0.0928 -4.6097055,-1.87438 -0.7521065,-1.78321 ' +\n '0.090598,-3.84627 1.8802645,-4.59604 1.78823,-0.74936 3.856881,0.0929 4.608987,1.87437 ' +\n '0.752106,1.78165 -0.0906,3.84612 -1.879546,4.59605 z'\n },\n 'TASK_TYPE_BUSINESS_RULE_HEADER': {\n d: 'm {mx},{my} 0,4 20,0 0,-4 z'\n },\n 'TASK_TYPE_BUSINESS_RULE_MAIN': {\n d: 'm {mx},{my} 0,12 20,0 0,-12 z' +\n 'm 0,8 l 20,0 ' +\n 'm -13,-4 l 0,8'\n },\n 'MESSAGE_FLOW_MARKER': {\n d: 'm {mx},{my} m -10.5 ,-7 l 0,14 l 21,0 l 0,-14 z l 10.5,6 l 10.5,-6'\n }\n };\n this.getRawPath = function getRawPath(pathId) {\n return this.pathMap[pathId].d;\n };\n /**\n * Scales the path to the given height and width.\n * <h1>Use case</h1>\n * <p>Use case is to scale the content of elements (event, gateways) based\n * on the element bounding box's size.\n * </p>\n * <h1>Why not transform</h1>\n * <p>Scaling a path with transform() will also scale the stroke and IE does not support\n * the option 'non-scaling-stroke' to prevent this.\n * Also there are use cases where only some parts of a path should be\n * scaled.</p>\n *\n * @param {String} pathId The ID of the path.\n * @param {Object} param <p>\n * Example param object scales the path to 60% size of the container (data.width, data.height).\n * <pre>\n * {\n * xScaleFactor: 0.6,\n * yScaleFactor:0.6,\n * containerWidth: data.width,\n * containerHeight: data.height,\n * position: {\n * mx: 0.46,\n * my: 0.2,\n * }\n * }\n * </pre>\n * <ul>\n * <li>targetpathwidth = xScaleFactor * containerWidth</li>\n * <li>targetpathheight = yScaleFactor * containerHeight</li>\n * <li>Position is used to set the starting coordinate of the path. M is computed:\n * <ul>\n * <li>position.x * containerWidth</li>\n * <li>position.y * containerHeight</li>\n * </ul>\n * Center of the container <pre> position: {\n * mx: 0.5,\n * my: 0.5,\n * }</pre>\n * Upper left corner of the container\n * <pre> position: {\n * mx: 0.0,\n * my: 0.0,\n * }</pre>\n * </li>\n * </ul>\n * </p>\n *\n */\n this.getScaledPath = function getScaledPath(pathId, param) {\n var rawPath = this.pathMap[pathId];\n // positioning\n // compute the start point of the path\n var mx, my;\n if (param.abspos) {\n mx = param.abspos.x;\n my = param.abspos.y;\n }\n else {\n mx = param.containerWidth * param.position.mx;\n my = param.containerHeight * param.position.my;\n }\n var coordinates = {}; // map for the scaled coordinates\n if (param.position) {\n // path\n var heightRatio = (param.containerHeight / rawPath.height) * param.yScaleFactor;\n var widthRatio = (param.containerWidth / rawPath.width) * param.xScaleFactor;\n // Apply height ratio\n for (var heightIndex = 0; heightIndex < rawPath.heightElements.length; heightIndex++) {\n coordinates['y' + heightIndex] = rawPath.heightElements[heightIndex] * heightRatio;\n }\n // Apply width ratio\n for (var widthIndex = 0; widthIndex < rawPath.widthElements.length; widthIndex++) {\n coordinates['x' + widthIndex] = rawPath.widthElements[widthIndex] * widthRatio;\n }\n }\n // Apply value to raw path\n var path = format(rawPath.d, {\n mx: mx,\n my: my,\n e: coordinates\n });\n return path;\n };\n}","static rmap(context) {\n return Pierce.dimap(context).call(Hask.id(context));\n }","function map(n, d1, d2, r1, r2) {\r\n\tvar Rd = d2-d1;\r\n\tvar Rr = r2-r1;\r\n\treturn (Rr/Rd)*(n - d1) + r1;\r\n}","function map(n, d1, d2, r1, r2) {\r\n\tvar Rd = d2-d1;\r\n\tvar Rr = r2-r1;\r\n\treturn (Rr/Rd)*(n - d1) + r1;\r\n}","function mapTest() {\n return \"Hello\"\n}","function mapa2(){\n // Crea un arreglo con los nodos visitados hasta ahora.\n var nodes = [\n \n {id: 1, label: 'Brasil'},\n {id: 2, label: 'Finlandia'},\n\n ];\n\n // Crea un arreglo con las conexiones entre los nodos.\n var edges = [\n {from: 1, to: 2},\n ];\n // Crea un arreglo con los nodos activos.\n var activeNode = [ 2 ];\n mapa( nodes, edges, activeNode );\n }","get Mipmaps() {}","function map(stats) {\n return stats.path;\n}","handleMapLoad(map) {\n }","function sc_map(proc, l1) {\n if (l1 === undefined)\n\treturn null;\n // else\n var nbApplyArgs = arguments.length - 1;\n var applyArgs = new Array(nbApplyArgs);\n var revres = null;\n while (l1 !== null) {\n\tfor (var i = 0; i < nbApplyArgs; i++) {\n\t applyArgs[i] = arguments[i + 1].car;\n\t arguments[i + 1] = arguments[i + 1].cdr;\n\t}\n\trevres = sc_cons(proc.apply(null, applyArgs), revres);\n }\n return sc_reverseAppendBang(revres, null);\n}","map(route) {\r\n if (Array.isArray(route)) {\r\n route.forEach(r => this.map(r));\r\n return this;\r\n }\r\n return this.mapRoute(route);\r\n }","function WoWMapProjection(){}","function mapPath(i) {\n return pArr[i];\n }","function i(e,t){return(0,u.default)(t).map(function(n){var r=t[n];return(0,l.default)(r)?{name:n,direction:e,fn:r}:(0,o.default)({name:n},r)})}","function map$4(f, param) {\n return /* Dual */[_1(f, param[0])];\n }","function routeMap(routePath) {\n return \"https://maps.googleapis.com/maps/api/staticmap?path=color:0x0000ff|weight:5\"+\n routePath + \"&size=400x400&key=AIzaSyAH-KSfz-462dVd84424pUVWa7vO2RgfAs\";\n}","constructor(maps = [], mirror, from2 = 0, to = maps.length) {\n this.maps = maps;\n this.mirror = mirror;\n this.from = from2;\n this.to = to;\n }","function elaborateRoute(map, legs, polyline, bounds, markers,\n contentStrings, totExcitement, alg){\n if(alg==0) return elaborateDH(map, legs, polyline, bounds,\n markers, contentStrings, totExcitement);\n else if(alg==1) return elaborateNumSections(map, legs,\n polyline, bounds, markers, contentStrings, totExcitement);\n}","function main() {\n getRoutes();\n}","map_system() {\n\t\t// First 8K of RAM\n\t\tthis.map_loram(0x00, 0x3F, 0x0000, 0x1FFF, 0);\n\t\t// PPU regs\n\t\tthis.map_kind(0x00, 0x3F, 0x2000, 0x3FFF, 0x2000, MAP_TI.PPU);\n\t\t// CPU regs\n\t\tthis.map_kind(0x00, 0x3F, 0x4000, 0x5FFF, 0x4000, MAP_TI.CPU);\n\t\t// All of this mirrored again at 0x80\n\t\tthis.map_loram(0x80, 0xBF, 0x00, 0x1FFF, 0);\n\t\tthis.map_kind(0x80, 0xBF, 0x2000, 0x3FFF, 0x2000, MAP_TI.PPU);\n\t\tthis.map_kind(0x80, 0xBF, 0x4000, 0x5FFF, 0x4000, MAP_TI.CPU);\n\t}","static lmap(context) {\n return new Hask(function(sa) {\n return Pierce.dimap(context).call(sa).call(Hask.id(context));\n });\n }","_map(inputStart, inputEnd, outputStart, outputEnd, input) {\n return outputStart + ((outputEnd - outputStart) / (inputEnd - inputStart)) * (input - inputStart);\n }","set Mipmaps(value) {}","function LangMap() {}","function LangMap() {}","function send_route_map(stops) {\n //create routes include many stop\n if(stops.length==1) return\n var mode = stops[1].mode\n route_mode[\"route1\"]=mode;\n //console.log(mode)\n var start = 1,\n route_index = 1;\n if(stops.length==2){\n routeArray[\"route1\"]=[]\n routeArray[\"route1\"].push(stops[1])\n stops[1][\"route_index\"]=1\n }\n while (start < stops.length) {\n routeArray[\"route\" + route_index]=[]\n for (var i = start; i < stops.length; i++) {\n //add stop to route\n if (stops[i].mode != mode) {\n start = i\n mode = stops[i].mode\n route_mode[\"route\"+(route_index+1)]=mode;\n\n //next route\n break\n }\n stops[i][\"route_index\"]=route_index\n routeArray[\"route\" + route_index].push({\n \"lat\": stops[i].lat,\n \"lng\": stops[i].lng\n });\n\n //increase start route\n start = i + 1\n //console.log(start)\n\n }\n \n route_index++ \n \n\n }\n //console.log(route_index);\n console.log(route_mode);\n //add route mode last\n //route_mode[\"route\"+(route_index-1)]\n // console.log()\n stops[0][\"route_index\"]=1\n routeArray[\"route1\"].unshift({\n \"lat\": stops[0].lat,\n \"lng\": stops[0].lng\n }); \n console.log(routeArray); \n }","mapToPath() {\n Path.mapMin1 = this.params.mapMin1;\n Path.mapMax1 = this.params.mapMax1;\n Path.mapMin2 = this.params.mapMin2;\n Path.mapMax2 = this.params.mapMax2;\n }","getRoutingNames() {\n\n }","function map(a,b,c,d,e){return(a-b)/(c-b)*(e-d)+d}","function z(a){function b(b,c){this.tgt=a.getTgt(b,c)}\n// Simple map declared as function\nreturn Z(a)&&(a={getTgt:a}),a.baseMap&&(a=j(j({},a.baseMap),a)),a.map=function(a,c){return new b(a,c)},a}","function map(value,\n istart, istop,\n ostart, ostop) {\n return ostart + (ostop - ostart) * ((value - istart) / (istop - istart));\n}","function initMap() {\n}","map(value, istart, istop, ostart, ostop) {\n\t\treturn ostart + (ostop - ostart) * ((value - istart) / (istop - istart));\n\t}","function modify()\r{\r\tvar entry = getindex(arguments[0]);\r\tvar args = new Array();\r\tfor(var i=1; i<arguments.length; i++){\r\t\targs[i-1] = arguments[i];\r\t}\r\toutlet(0, \"script\", \"send\", \"mapping_object_alg_\"+entry, args);\r}","function processRoute (data){\n console.log(\"reitti: \", data);\n var segments = data.routes[0].segments;\n segmentNames.length = 0;\n segmentKind.length = 0;\n\tsegmentDuration.length = 0;\n \n $.each(segments, function(index, value){\n processSegments(value);\n });\n printRoute();\n preparePolyline(data);\n initMap();\n}","function init() {\n\n var mapOptions = {\n // center: locations[0],\n zoom: 4,\n mapTypeId: google.maps.MapTypeId.ROADMAP\n };\n map = new google.maps.Map(document.getElementById('dvMap'), mapOptions);\n // calcRoute(msg);\n // calcRoute(m);\n // calcRoute(ms);\n\n\n for(i = 0; i < to_loc.length; i++) {\n \tvar lol = new Array();\n \tlol[0] = from_loc[i];\n \tlol[1] = to_loc[i];\n \tcalcRoute(lol);\n }\n\n}","mapValue(value){\r\n var map={\r\n 8: 1, 7: 2, 6: 3, 5: 4, 4: 5, 3: 6, 2: 7, 1: 8,\r\n \"h\":\"a\", \"g\":\"b\", \"f\":\"c\", \"e\":\"d\", \"d\":\"e\", \"c\":\"f\", \"b\":\"g\", \"a\":\"h\"\r\n }\r\n return(map[value])\r\n }","function goMap(map_num){\n \n var file_name;\n \n switch (map_num){\n \n //assign parameters for respective page\n \n case 0:\n file_name = 'signup2.html';\n var params = new Array(file_name);\n params[file_name] = new Array();\n params[file_name][0] = 'name';\n params[file_name][1] = 'email';\n params[file_name][2] = 'phone';\n params[file_name][3] = 'password';\n return params;\n \n case 1:\n file_name = 'credit_card.html';\n var params = new Array(file_name);\n params[file_name] = new Array();\n params[file_name][0] = 'address';\n params[file_name][1] = 'address2';\n params[file_name][2] = 'zip';\n return params;\n \n \n case 3:\n file_name = 'sign_in.html';\n var params = new Array(file_name);\n params[file_name] = new Array();\n params[file_name][0] = 'email';\n params[file_name][1] = 'password';\n return params;\n \n }\n \n}","function summonCaptainPlanet() {\r\n\tconsole.log(map)\r\n}","function getRaresMap() {\n var map = {};\n var lines = require('fs').readFileSync(__dirname+'/wallabee_rares.dat').toString().split(/\\r?\\n/);\n for (var i in lines) {\n var parts = lines[i].split(/\\|/);\n parts[1] = parseInt(parts[1]);\n map[parts[0]] = parts;\n }\n return map;\n}","function myMap(arr, cb) {\n // enter your code here\n}","function MapTable() {\r\n}","static mapStops(direction) {\n const out = new Map();\n const stops =\n direction === \"North\"\n ? caltrainServiceData.northStops\n : caltrainServiceData.southStops;\n for (let i = 0; i < stops.length; i++) {\n out.set(stops[i], i);\n }\n return out;\n }","function create_map(name, code) {\n var view = '\"' + name + '\": {' + '\\n';\n view += '\"map\": \"' + escape(code) + '\"}';\n return view;\n}","function getUserRouteMap(canonicalRoutes) {\n return canonicalRoutes.reduce((mapping, route) => {\n switch (route) {\n case 'GS':\n case 'FS':\n case 'H': {\n const newMap = { [route]: 'S' }\n return Object.assign({}, mapping, newMap)\n }\n default: {\n const newMap = { [route]: route }\n return Object.assign({}, mapping, newMap)\n }\n }\n }, {})\n}","function Mapping(){this.generatedLine=0;this.generatedColumn=0;this.source=null;this.originalLine=null;this.originalColumn=null;this.name=null;}","function Routes(){\n\tthis.static = require('../../static/static')();\n\tthis.routes = new Map();\n}","function getPosMapping() {\n\tvar NOU = 0;\n\tvar PRO = 1;\n\tvar ADJ = 2;\n\tvar VER = 3;\n\tvar ADV = 4;\n\tvar PRE = 5;\n\tvar CON = 6;\n\tvar INT = 7;\n\tvar DET = 8;\n\tvar NUL = 9;\n\tvar posDict = {\"CC\":CON, \"CD\": NUL, \"DT\": DET, \"EX\": NUL, \"FW\": NUL,\n\t\t\t\t\t\"IN\": PRE, \"JJ\": ADJ, \"JJR\": ADJ, \"JJS\":ADJ,\"LS\":NUL,\n\t\t\t\t\t\"MD\":NUL, \"NN\":NOU, \"NNS\":NOU, \"NNP\":NOU,\"NNPS\":NOU,\"PDT\":NUL,\"POS\":NUL,\"PRP\":PRO,\n\t\t\t\t\t\"PRP$\":PRO,\"RB\":ADV,\"RBR\":ADV,\"RBS\":ADV,\"RP\":PRE,\"SYM\":NUL,\"TO\":PRE,\"UH\":INT,\n\t\t\t\t\t\"VB\":VER,\"VBD\":VER,\"VBG\":VER,\"VBN\":VER,\"VBP\":VER,\"VBZ\":VER,\"WDT\":DET,\"WP\":PRE,\n\t\t\t\t\t\"WP$\":PRE,\"WRB\":ADV};\n\treturn posDict;\n}","function mapa3(){\n // Crea un arreglo con los nodos visitados hasta ahora.\n var nodes = [\n \n {id: 1, label: 'Brasil'},\n {id: 2, label: 'Finlandia'},\n {id: 3, label: 'China'},\n ];\n\n // Crea un arreglo con las conexiones entre los nodos.\n var edges = [\n {from: 1, to: 2},\n {from: 2, to: 3},\n\n \n\n ];\n // Crea un arreglo con los nodos activos.\n var activeNode = [ 3 ];\n mapa( nodes, edges, activeNode );\n}","function\nmap0$fopr_2343_(a5x1)\n{\nlet xtmp57;\n;\n{\nxtmp57 = a1x2(a5x1);\n}\n;\nreturn xtmp57;\n}","constructor() {\n // _routes will contain a mapping of HTTP method name ('GET', etc.) to an\n // array of all the corresponding Route instances that are registered.\n this._routes = new Map();\n }","function arpMapping(x, y, pageId) {\n\tconst coords = {\n\t\t// midi 10\n\t\t'200 50': {alias: 'rndarp_launchcontrol', chan: 7, cc_strict: 21, type: 'fader'},\n\n '25 50': {alias: 'gate_length', chan: 10, cc: 2, type: 'fader'},\n\t\t'400 50': {alias: 'gaterate', chan: 10, cc: 3, type: '8step'},\n\n '50 500': {alias: 'attack', chan: 10, cc: 4, type: 'fader'},\n '100 500': {alias: 'decay', chan: 10, cc: 5, type: 'fader'},\n '150 500': {alias: 'sustain', chan: 10, cc: 6, type: 'fader'},\n '200 500': {alias: 'release', chan: 10, cc: 7, type: 'fader'},\n '300 525': {alias: 'volume', chan: 10, cc: 8, type: 'fader'},\n\n\t\t// midi 11\n\t\t'0 250': {alias: 'pitchon', chan: 11, cc: 1, type: 'on_off'},\n\t\t'400 200': {alias: 'pitchrate', chan: 11, cc: 2, type: '8step'},\n\t\t'400 300': {alias: 'pitchsteps', chan: 11, cc: 3, type: '8step'},\n\t\t'25 225': {alias: 'pitchhold', chan: 11, cc: 4, type: 'fader'},\n\t\t'800 200': {alias: 'pitchdist', chan: 11, cc: 5, type: 'fader'},\n\t\t'900 50': {alias: 'rnd', chan: 11, cc: 6, type: 'fader'},\n\t\t'900 200': {alias: 'scale_scale', chan: 11, cc: 8, type: 'fader' },\n\t\t'950 200': {alias: 'scale_choice', chan: 11, cc: 7, type: 'fader' },\n\t\t'200 225': {alias: 'drop', chan: 11, cc: 9, type: 'fader'},\n\n\t\t// midi 12 + 13 as fallback\n\t\t'500 500': {alias: 'delay_left', chan: 12, cc: 1, type: '8-2step'},\n\t\t'500 600': {alias: 'delay_right', chan: 13, cc: 1, type: '8-2step'},\n\n\t\t'800 500': {alias: 'delayfb', chan: 12, cc: 2, type: 'fader'},\n\t\t'850 500': {alias: 'link', chan: 13, cc: 3, type: 'on_off'},\n\t\t'900 500': {alias: 'gain', chan: 13, cc: 2, type: 'fader'},\n\t\t'950 500': {alias: 'delaymix', chan: 12, cc: 3, type: 'fader'}\n\t};\n\treturn coords[`${x} ${y}`];\n}","map(layout){\n\t\tvar map = new Mapping(layout);\n\t\treturn map.section();\n\t}","function runRules(vmap, cmap, rmap, start, n) {\n\n var start_str = start;\n var result = \"\";\n\n for (var j = 0; j < n; j++) {\n for (var i = 0; i < start_str.length; i++) {\n // No rule found\n if (rmap[start_str[i]] == null) {\n result += start_str[i];\n } else {\n result += rmap[start_str[i]];\n }\n }\n start_str = result;\n result = \"\";\n }\n\n return start_str;\n}","function render() {\n debugMap(map, 10, 20);\n }","['fantasy-land/map'](f) {\n return this.map(f);\n }","function MapIterator() {}","function init(){\n basemap();\n}","match(route) {\n //match route against dictionary of defined paths to their relevant attributes\n for (let [path, {pathRoute, handler, params}] of this.routes) {\n const match = pathRoute.exec(route);\n //each route will be associated with a handler\n //this handler will handle all of the rendering associated with a new change\n if (match !== null) {\n //remove the first / from the route\n //loop through values and add each value with its associated parameter\n const routeParams = match.slice(1).\n reduce((allParams, value, index) => {\n allParams[params[index]] = value;\n return allParams;\n }, {});\n //split parameters using the ?varName=varVal \n this.currentPath = path;\n //check if we have any query parameters to parse\n if (window.location.search) {\n this.getQueryParameters(window.location.search, routeParams);\n }\n handler(route, routeParams);\n //we don't want to execute more than route once we've matched one\n //if it can match multiple ones so we break\n break;\n }\n\n }\n }","function generateSafeInternalRouteMap() {\n const map = new Map();\n for (const keyAsString in InternalRoute_1.default) {\n const key = parseInt(keyAsString, 10);\n // skipt enum literals, use only the numeric keys\n if (isNaN(key) || !isFinite(key) || typeof key !== 'number') {\n continue;\n }\n // generate a random hash for the URL and prepend a slash so the server can resolve it\n let hash;\n const ensureUnique = () => {\n hash = generateRandomHash();\n for (const value of map.values()) {\n if (hash === value) {\n ensureUnique();\n return;\n }\n }\n };\n ensureUnique();\n // actually update the hash\n map.set(key, hash);\n }\n return map;\n}","function getMap() {\n showJourneyMap();\n}","generateStops (routes, reRenderKey) {\n return routes.map((route) => {\n return route.stops.map((stop, i) => {\n if (route.display) {\n // const boundPress = this.props.fetchStopData.bind(this, stop.id, route.id)\n const key = Platform.OS === 'ios' ? `${stop.id}-${reRenderKey}`: `${stop.id}`\n return (\n <MapView.Circle center={{latitude: stop.lat, longitude: stop.lng}} radius={stop.radius ? stop.radius : 10} zIndex={stop.zindex ? stop.zindex : 1} fillColor={stop.fillColor ? stop.fillColor: 'black'} strokeColor={route.routeColor}/>\n ) \n }\n })\n })\n }","function PhoneticMapper(map)\n{\n this.map = map;\n}","function testFunction(req, res) {\n res.render('map-test');\n\n}","function Mapping() {\n this.generatedLine = 0\n this.generatedColumn = 0\n this.source = null\n this.originalLine = null\n this.originalColumn = null\n this.name = null\n}","static match(map) {\n let direct = Object.create(null);\n for (let prop in map)\n for (let name of prop.split(\" \"))\n direct[name] = map[prop];\n return (node) => {\n for (let groups = node.prop(NodeProp.group), i = -1; i < (groups ? groups.length : 0); i++) {\n let found = direct[i < 0 ? node.name : groups[i]];\n if (found)\n return found;\n }\n };\n }","_generateMap() {\n // Generate all the empty tiles\n var width = this.display.getOptions().width;\n var height = this.display.getOptions().height;\n for (let x = 0; x < width; x++) {\n for (let y = 0; y < height; y++) {\n let tile = new Tile(\"empty\", x, y);\n let key = tile.getPositionKey();\n this.map[key] = tile;\n }\n }\n\n // Next, use celluar automata to lay down the first layer of resources\n // but make sure they meet the minimum bar\n var sumIronTiles = 0;\n while (sumIronTiles <= config.map.resources.iron.minTiles) {\n var ironMap = new ROT.Map.Cellular(width, height, { connected: true});\n // % chance to be iron\n ironMap.randomize(config.map.resources.iron.baseChance);\n // iterations smooth out and connect live tiles\n for (let i = 0; i < config.map.resources.iron.generations; i++) {\n ironMap.create();\n }\n // Check to ensure that we have a minimum number of iron tiles\n sumIronTiles = ironMap._map.flat().reduce(doSum, 0);\n }\n\n // Go through the map and change the tiles we touch to type \"iron\"\n for (let x = 0; x < width; x++) {\n for (let y = 0; y < height; y++) {\n if (ironMap._map[x][y] == 1) {\n let key = `${x},${y}`\n let tile = this.map[key];\n let resourceAmount = this._calculateResourceAmount(x, y, ironMap._map, \"iron\");\n tile.addResources(\"iron\", resourceAmount);\n }\n }\n }\n\n // Same for coal\n var sumCoalTiles = 0;\n while (sumCoalTiles <= config.map.resources.coal.minTiles) {\n var coalMap = new ROT.Map.Cellular(width, height, { connected: true });\n coalMap.randomize(config.map.resources.coal.baseChance);\n for (let i = 0; i< config.map.resources.coal.generations; i++) {\n coalMap.create();\n }\n sumCoalTiles = coalMap._map.flat().reduce(doSum, 0);\n }\n\n // Change tiles to \"coal\", but only if they're empty!\n for (let x = 0; x < width; x++) {\n for (let y = 0; y < height; y++) {\n if (coalMap._map[x][y] == 1) {\n let key = `${x},${y}`\n let tile = this.map[key];\n if (tile.tileType == \"empty\") {\n let resourceAmount = this._calculateResourceAmount(x, y, coalMap._map, \"coal\");\n tile.addResources(\"coal\", resourceAmount);\n }\n }\n }\n }\n\n // Same for copper\n var sumCopperTiles = 0;\n while (sumCopperTiles <= config.map.resources.copper.minTiles) {\n var copperMap = new ROT.Map.Cellular(width, height, { connected: true });\n copperMap.randomize(config.map.resources.copper.baseChance);\n for (let i = 0; i< config.map.resources.copper.generations; i++) {\n copperMap.create();\n }\n sumCopperTiles = copperMap._map.flat().reduce(doSum, 0);\n }\n\n // Change tiles to \"copper\", but only if they're empty!\n for (let x = 0; x < width; x++) {\n for (let y = 0; y < height; y++) {\n if (copperMap._map[x][y] == 1) {\n let key = `${x},${y}`\n let tile = this.map[key];\n if (tile.tileType == \"empty\") {\n let resourceAmount = this._calculateResourceAmount(x, y, copperMap._map, \"copper\");\n tile.addResources(\"copper\", resourceAmount);\n }\n }\n }\n }\n }","function refreshMap() {\n\t\t$.each(routes, function(i,m) {\n\t\t\tshowRouteVehicles(m.tag);\n\t\t});\n\t}","function getMapping(idx) {\n return mapping[idx]\n}","__init25() {this.forceRenames = new Map()}","get routes(){\n\t\treturn {\n\t\t\t'get /': [actionFilter, 'index'],\n\t\t\t'get /home/about': 'about'\n\t\t}\n\t}","function Map(value, from1, to1, from2, to2) {\n return (value - from1) / (to1 - from1) * (to2 - from2) + from2;\n}","exec() {\n return _map[MMU.rb(regPC[0]++)]();\n }","packageRoutes(nodes) {\n var map = {};\n var routes = [];\n\n // Compute a map from name to node.\n nodes.forEach(function(d) {\n map[d.data.name] = d;\n });\n\n // For each route, construct a link from the source to target node.\n nodes.forEach(function(d) {\n if (d.data.routes) d.data.routes.forEach(function(i) {\n routes.push(map[d.data.name].path(map[i]));\n });\n });\n return routes;\n }","function initializeMap(){\n let brewery1 = state.body[0];\n initMap(brewery1);\n}"],"string":"[\n \"function map() {\\n\\n}\",\n \"function MAP() {\\n\\n}\",\n \"function Map() {}\",\n \"function Map() {\\n\\t\\n}\",\n \"function Map() {\\n\\t\\n}\",\n \"function PathMapper() {\\n\\t}\",\n \"function PathMapper() {\\n\\t}\",\n \"function ParamMap() { }\",\n \"function ParamMap() { }\",\n \"function ParamMap() {}\",\n \"function ParamMap() {}\",\n \"function ParamMap(){}\",\n \"function route() {\\n this.method = this.req.method.toLowerCase();\\n var n = w.map[this.method];\\n if (!n) {\\n this.reply4xx(404, \\\"no route for method: \\\"+this.req.method);\\n this.end();\\n return\\n } else {\\n this.url = w.dep.url.parse(this.req.url, true);\\n this.query = this.url.query || {};\\n this.context = {};\\n for (var e in this.query) { this.context[e] = this.query[e] }\\n this.context._work = this;\\n this.context._js = [];\\n this.context._css = [];\\n \\n var p = this.url.pathname.split('/');\\n console.log(this.req.url, \\\"route to ===============> \\\" + this.req.method.toUpperCase(), p);\\n \\n for (var i = 1; i < p.length; ++i) {\\n var segment = p[i];\\n if (n.branches[segment]) { n = n.branches[segment]; continue };\\n if (n.branches[':']) { //varname\\n this.context[n.varname] = segment;\\n console.log(\\\"//varname: \\\" + n.varname + \\\" = \\\" + this.context[n.varname]);\\n n = n.branches[':'];\\n continue\\n };\\n if (n.branches['*']) { //wildcard\\n this.context['_location'] = p.slice(i).join('/');\\n console.log(\\\"//wildcard: \\\" + this.context['_location']);\\n n = n.branches['*'];\\n break\\n };\\n this.reply4xx(404, \\\"no route to: \\\"+this.req.method+' '+this.req.url);\\n this.end();\\n return\\n };\\n };\\n \\n if (n.handler) {\\n this.mapnode = n;\\n n.handler.call(this);\\n this.end();\\n return\\n }\\n\\n this.reply5xx(500, \\\"no handler found for: \\\"+this.req.method+' '+this.req.url);\\n this.end();\\n return\\n}\",\n \"function SeleneseMapper() {\\n}\",\n \"static routes() {\\n\\n\\t\\tconst keys = ['all', 'delete', 'get', 'patch', 'post', 'put'];\\n\\n\\t\\treturn MapContainer.create(...keys);\\n\\t}\",\n \"function InvokeDefinitionMap() {\\n this.map = [];\\n this.lookup_table = {}; // Just for building dictionary\\n}\",\n \"function addMapping(router, mapping) {\\n for (let url in mapping) {\\n\\n if (url.startsWith('GET ')) {\\n\\n let path = url.substring(4);\\n router.get(path, mapping[url]);\\n\\n } else if (url.startsWith('POST ')) {\\n\\n let path = url.substring(5);\\n router.post(path, mapping[url]);\\n\\n } else if (url.startsWith('PUT ')) {\\n\\n let path = url.substring(4);\\n router.put(path, mapping[url]);\\n\\n } else if (url.startsWith('DELETE ')) {\\n\\n let path = url.substring(7);\\n router.delete(path, mapping[url]);\\n\\n } else {\\n console.log(`invalid URL: ${url}`);\\n }\\n }\\n}\",\n \"function addMapping(router, mapping) {\\n for (var url in mapping) {\\n if (url.startsWith('GET ')) {\\n var path = url.substring(4);\\n router.get(path, mapping[url]);\\n console.log(`register URL mapping: GET ${path}`);\\n } else if (url.startsWith('POST ')) {\\n var path = url.substring(5);\\n router.post(path, mapping[url]);\\n console.log(`register URL mapping: POST ${path}`);\\n } else if (url.startsWith('PUT ')) {\\n var path = url.substring(4);\\n router.put(path, mapping[url]);\\n console.log(`register URL mapping: PUT ${path}`);\\n } else if (url.startsWith('DELETE ')) {\\n var path = url.substring(7);\\n router.del(path, mapping[url]);\\n console.log(`register URL mapping: DELETE ${path}`);\\n } else {\\n console.log(`invalid URL: ${url}`);\\n }\\n }\\n}\",\n \"map(id, source) {}\",\n \"function PathMap() {\\n /**\\n * Contains a map of path elements\\n *\\n * <h1>Path definition</h1>\\n * A parameterized path is defined like this:\\n * <pre>\\n * 'GATEWAY_PARALLEL': {\\n * d: 'm {mx},{my} {e.x0},0 0,{e.x1} {e.x1},0 0,{e.y0} -{e.x1},0 0,{e.y1} ' +\\n '-{e.x0},0 0,-{e.y1} -{e.x1},0 0,-{e.y0} {e.x1},0 z',\\n * height: 17.5,\\n * width: 17.5,\\n * heightElements: [2.5, 7.5],\\n * widthElements: [2.5, 7.5]\\n * }\\n * </pre>\\n * <p>It's important to specify a correct <b>height and width</b> for the path as the scaling\\n * is based on the ratio between the specified height and width in this object and the\\n * height and width that is set as scale target (Note x,y coordinates will be scaled with\\n * individual ratios).</p>\\n * <p>The '<b>heightElements</b>' and '<b>widthElements</b>' array must contain the values that will be scaled.\\n * The scaling is based on the computed ratios.\\n * Coordinates on the y axis should be in the <b>heightElement</b>'s array, they will be scaled using\\n * the computed ratio coefficient.\\n * In the parameterized path the scaled values can be accessed through the 'e' object in {} brackets.\\n * <ul>\\n * <li>The values for the y axis can be accessed in the path string using {e.y0}, {e.y1}, ....</li>\\n * <li>The values for the x axis can be accessed in the path string using {e.x0}, {e.x1}, ....</li>\\n * </ul>\\n * The numbers x0, x1 respectively y0, y1, ... map to the corresponding array index.\\n * </p>\\n m1,1\\n l 0,55.3\\n c 29.8,19.7 48.4,-4.2 67.2,-6.7\\n c 12.2,-2.3 19.8,1.6 30.8,6.2\\n l 0,-54.6\\n z\\n */\\n this.pathMap = {\\n 'KNOWLEDGE_SOURCE': {\\n d: 'm {mx},{my} ' + 'l 0,{e.y0} ' + 'c {e.x0},{e.y1} {e.x1},-{e.y2} {e.x2},-{e.y3} ' + 'c {e.x3},-{e.y4} {e.x4},{e.y5} {e.x5},{e.y6} ' + 'l 0,-{e.y7}z',\\n width: 100,\\n height: 65,\\n widthElements: [29.8, 48.4, 67.2, 12.2, 19.8, 30.8],\\n heightElements: [55.3, 19.7, 4.2, 6.7, 2.3, 1.6, 6.2, 54.6]\\n },\\n 'BUSINESS_KNOWLEDGE_MODEL': {\\n d: 'm {mx},{my} l {e.x0},-{e.y0} l {e.x1},0 l 0,{e.y1} l -{e.x2},{e.y2} l -{e.x3},0z',\\n width: 125,\\n height: 45,\\n widthElements: [13.8, 109.2, 13.8, 109.1],\\n heightElements: [13.2, 29.8, 13.2]\\n },\\n 'TEXT_ANNOTATION': {\\n d: 'm {mx}, {my} m 10,0 l -10,0 l 0,{e.y0} l 10,0',\\n width: 10,\\n height: 30,\\n widthElements: [10],\\n heightElements: [30]\\n }\\n };\\n this.getRawPath = function getRawPath(pathId) {\\n return this.pathMap[pathId].d;\\n };\\n /**\\n * Scales the path to the given height and width.\\n * <h1>Use case</h1>\\n * <p>Use case is to scale the content of elements (event, gateways) based\\n * on the element bounding box's size.\\n * </p>\\n * <h1>Why not transform</h1>\\n * <p>Scaling a path with transform() will also scale the stroke and IE does not support\\n * the option 'non-scaling-stroke' to prevent this.\\n * Also there are use cases where only some parts of a path should be\\n * scaled.</p>\\n *\\n * @param {String} pathId The ID of the path.\\n * @param {Object} param <p>\\n * Example param object scales the path to 60% size of the container (data.width, data.height).\\n * <pre>\\n * {\\n * xScaleFactor: 0.6,\\n * yScaleFactor:0.6,\\n * containerWidth: data.width,\\n * containerHeight: data.height,\\n * position: {\\n * mx: 0.46,\\n * my: 0.2,\\n * }\\n * }\\n * </pre>\\n * <ul>\\n * <li>targetpathwidth = xScaleFactor * containerWidth</li>\\n * <li>targetpathheight = yScaleFactor * containerHeight</li>\\n * <li>Position is used to set the starting coordinate of the path. M is computed:\\n * <ul>\\n * <li>position.x * containerWidth</li>\\n * <li>position.y * containerHeight</li>\\n * </ul>\\n * Center of the container <pre> position: {\\n * mx: 0.5,\\n * my: 0.5,\\n * }</pre>\\n * Upper left corner of the container\\n * <pre> position: {\\n * mx: 0.0,\\n * my: 0.0,\\n * }</pre>\\n * </li>\\n * </ul>\\n * </p>\\n *\\n */\\n this.getScaledPath = function getScaledPath(pathId, param) {\\n var rawPath = this.pathMap[pathId];\\n // positioning\\n // compute the start point of the path\\n var mx, my;\\n if (param.abspos) {\\n mx = param.abspos.x;\\n my = param.abspos.y;\\n }\\n else {\\n mx = param.containerWidth * param.position.mx;\\n my = param.containerHeight * param.position.my;\\n }\\n var coordinates = {}; // map for the scaled coordinates\\n if (param.position) {\\n // path\\n var heightRatio = param.containerHeight / rawPath.height * param.yScaleFactor;\\n var widthRatio = param.containerWidth / rawPath.width * param.xScaleFactor;\\n // Apply height ratio\\n for (var heightIndex = 0; heightIndex < rawPath.heightElements.length; heightIndex++) {\\n coordinates['y' + heightIndex] = rawPath.heightElements[heightIndex] * heightRatio;\\n }\\n // Apply width ratio\\n for (var widthIndex = 0; widthIndex < rawPath.widthElements.length; widthIndex++) {\\n coordinates['x' + widthIndex] = rawPath.widthElements[widthIndex] * widthRatio;\\n }\\n }\\n // Apply value to raw path\\n var path = format(rawPath.d, {\\n mx: mx,\\n my: my,\\n e: coordinates\\n });\\n return path;\\n };\\n}\",\n \"function PathMap() {\\n /**\\n * Contains a map of path elements\\n *\\n * <h1>Path definition</h1>\\n * A parameterized path is defined like this:\\n * <pre>\\n * 'GATEWAY_PARALLEL': {\\n * d: 'm {mx},{my} {e.x0},0 0,{e.x1} {e.x1},0 0,{e.y0} -{e.x1},0 0,{e.y1} ' +\\n '-{e.x0},0 0,-{e.y1} -{e.x1},0 0,-{e.y0} {e.x1},0 z',\\n * height: 17.5,\\n * width: 17.5,\\n * heightElements: [2.5, 7.5],\\n * widthElements: [2.5, 7.5]\\n * }\\n * </pre>\\n * <p>It's important to specify a correct <b>height and width</b> for the path as the scaling\\n * is based on the ratio between the specified height and width in this object and the\\n * height and width that is set as scale target (Note x,y coordinates will be scaled with\\n * individual ratios).</p>\\n * <p>The '<b>heightElements</b>' and '<b>widthElements</b>' array must contain the values that will be scaled.\\n * The scaling is based on the computed ratios.\\n * Coordinates on the y axis should be in the <b>heightElement</b>'s array, they will be scaled using\\n * the computed ratio coefficient.\\n * In the parameterized path the scaled values can be accessed through the 'e' object in {} brackets.\\n * <ul>\\n * <li>The values for the y axis can be accessed in the path string using {e.y0}, {e.y1}, ....</li>\\n * <li>The values for the x axis can be accessed in the path string using {e.x0}, {e.x1}, ....</li>\\n * </ul>\\n * The numbers x0, x1 respectively y0, y1, ... map to the corresponding array index.\\n * </p>\\n m1,1\\n l 0,55.3\\n c 29.8,19.7 48.4,-4.2 67.2,-6.7\\n c 12.2,-2.3 19.8,1.6 30.8,6.2\\n l 0,-54.6\\n z\\n */\\n this.pathMap = {\\n 'KNOWLEDGE_SOURCE': {\\n d: 'm {mx},{my} ' + 'l 0,{e.y0} ' + 'c {e.x0},{e.y1} {e.x1},-{e.y2} {e.x2},-{e.y3} ' + 'c {e.x3},-{e.y4} {e.x4},{e.y5} {e.x5},{e.y6} ' + 'l 0,-{e.y7}z',\\n width: 100,\\n height: 65,\\n widthElements: [29.8, 48.4, 67.2, 12.2, 19.8, 30.8],\\n heightElements: [55.3, 19.7, 4.2, 6.7, 2.3, 1.6, 6.2, 54.6]\\n },\\n 'BUSINESS_KNOWLEDGE_MODEL': {\\n d: 'm {mx},{my} l {e.x0},-{e.y0} l {e.x1},0 l 0,{e.y1} l -{e.x2},{e.y2} l -{e.x3},0z',\\n width: 125,\\n height: 45,\\n widthElements: [13.8, 109.2, 13.8, 109.1],\\n heightElements: [13.2, 29.8, 13.2]\\n },\\n 'TEXT_ANNOTATION': {\\n d: 'm {mx}, {my} m 10,0 l -10,0 l 0,{e.y0} l 10,0',\\n width: 10,\\n height: 30,\\n widthElements: [10],\\n heightElements: [30]\\n }\\n };\\n\\n this.getRawPath = function getRawPath(pathId) {\\n return this.pathMap[pathId].d;\\n };\\n /**\\n * Scales the path to the given height and width.\\n * <h1>Use case</h1>\\n * <p>Use case is to scale the content of elements (event, gateways) based\\n * on the element bounding box's size.\\n * </p>\\n * <h1>Why not transform</h1>\\n * <p>Scaling a path with transform() will also scale the stroke and IE does not support\\n * the option 'non-scaling-stroke' to prevent this.\\n * Also there are use cases where only some parts of a path should be\\n * scaled.</p>\\n *\\n * @param {String} pathId The ID of the path.\\n * @param {Object} param <p>\\n * Example param object scales the path to 60% size of the container (data.width, data.height).\\n * <pre>\\n * {\\n * xScaleFactor: 0.6,\\n * yScaleFactor:0.6,\\n * containerWidth: data.width,\\n * containerHeight: data.height,\\n * position: {\\n * mx: 0.46,\\n * my: 0.2,\\n * }\\n * }\\n * </pre>\\n * <ul>\\n * <li>targetpathwidth = xScaleFactor * containerWidth</li>\\n * <li>targetpathheight = yScaleFactor * containerHeight</li>\\n * <li>Position is used to set the starting coordinate of the path. M is computed:\\n * <ul>\\n * <li>position.x * containerWidth</li>\\n * <li>position.y * containerHeight</li>\\n * </ul>\\n * Center of the container <pre> position: {\\n * mx: 0.5,\\n * my: 0.5,\\n * }</pre>\\n * Upper left corner of the container\\n * <pre> position: {\\n * mx: 0.0,\\n * my: 0.0,\\n * }</pre>\\n * </li>\\n * </ul>\\n * </p>\\n *\\n */\\n\\n\\n this.getScaledPath = function getScaledPath(pathId, param) {\\n var rawPath = this.pathMap[pathId]; // positioning\\n // compute the start point of the path\\n\\n var mx, my;\\n\\n if (param.abspos) {\\n mx = param.abspos.x;\\n my = param.abspos.y;\\n } else {\\n mx = param.containerWidth * param.position.mx;\\n my = param.containerHeight * param.position.my;\\n }\\n\\n var coordinates = {}; // map for the scaled coordinates\\n\\n if (param.position) {\\n // path\\n var heightRatio = param.containerHeight / rawPath.height * param.yScaleFactor;\\n var widthRatio = param.containerWidth / rawPath.width * param.xScaleFactor; // Apply height ratio\\n\\n for (var heightIndex = 0; heightIndex < rawPath.heightElements.length; heightIndex++) {\\n coordinates['y' + heightIndex] = rawPath.heightElements[heightIndex] * heightRatio;\\n } // Apply width ratio\\n\\n\\n for (var widthIndex = 0; widthIndex < rawPath.widthElements.length; widthIndex++) {\\n coordinates['x' + widthIndex] = rawPath.widthElements[widthIndex] * widthRatio;\\n }\\n } // Apply value to raw path\\n\\n\\n var path = format(rawPath.d, {\\n mx: mx,\\n my: my,\\n e: coordinates\\n });\\n return path;\\n };\\n } // helpers //////////////////////\",\n \"function mapa1(){\\n // Crea un arreglo con los nodos visitados hasta ahora.\\n var nodes = [\\n \\n {id: 1, label: 'Brasil'},\\n ];\\n\\n // Crea un arreglo con las conexiones entre los nodos.\\n var edges = [\\n\\n ];\\n // Crea un arreglo con los nodos activos.\\n var activeNode = [ 1 ];\\n mapa( nodes, edges, activeNode );\\n }\",\n \"function Rn(){this.seq=[],this.map={}}// --- Utilities ---\",\n \"function PathMap() {\\n\\n /**\\n * Contains a map of path elements\\n *\\n * <h1>Path definition</h1>\\n * A parameterized path is defined like this:\\n * <pre>\\n * 'GATEWAY_PARALLEL': {\\n * d: 'm {mx},{my} {e.x0},0 0,{e.x1} {e.x1},0 0,{e.y0} -{e.x1},0 0,{e.y1} ' +\\n '-{e.x0},0 0,-{e.y1} -{e.x1},0 0,-{e.y0} {e.x1},0 z',\\n * height: 17.5,\\n * width: 17.5,\\n * heightElements: [2.5, 7.5],\\n * widthElements: [2.5, 7.5]\\n * }\\n * </pre>\\n * <p>It's important to specify a correct <b>height and width</b> for the path as the scaling\\n * is based on the ratio between the specified height and width in this object and the\\n * height and width that is set as scale target (Note x,y coordinates will be scaled with\\n * individual ratios).</p>\\n * <p>The '<b>heightElements</b>' and '<b>widthElements</b>' array must contain the values that will be scaled.\\n * The scaling is based on the computed ratios.\\n * Coordinates on the y axis should be in the <b>heightElement</b>'s array, they will be scaled using\\n * the computed ratio coefficient.\\n * In the parameterized path the scaled values can be accessed through the 'e' object in {} brackets.\\n * <ul>\\n * <li>The values for the y axis can be accessed in the path string using {e.y0}, {e.y1}, ....</li>\\n * <li>The values for the x axis can be accessed in the path string using {e.x0}, {e.x1}, ....</li>\\n * </ul>\\n * The numbers x0, x1 respectively y0, y1, ... map to the corresponding array index.\\n * </p>\\n */\\n this.pathMap = {\\n 'EVENT_MESSAGE': {\\n d: 'm {mx},{my} l 0,{e.y1} l {e.x1},0 l 0,-{e.y1} z l {e.x0},{e.y0} l {e.x0},-{e.y0}',\\n height: 36,\\n width: 36,\\n heightElements: [6, 14],\\n widthElements: [10.5, 21]\\n },\\n 'EVENT_SIGNAL': {\\n d: 'M {mx},{my} l {e.x0},{e.y0} l -{e.x1},0 Z',\\n height: 36,\\n width: 36,\\n heightElements: [18],\\n widthElements: [10, 20]\\n },\\n 'EVENT_ESCALATION': {\\n d: 'm {mx},{my} c -{e.x1},{e.y0} -{e.x3},{e.y1} -{e.x5},{e.y4} {e.x1},-{e.y3} {e.x3},-{e.y5} {e.x5},-{e.y6} ' +\\n '{e.x0},{e.y3} {e.x2},{e.y5} {e.x4},{e.y6} -{e.x0},-{e.y0} -{e.x2},-{e.y1} -{e.x4},-{e.y4} z',\\n height: 36,\\n width: 36,\\n heightElements: [2.382, 4.764, 4.926, 6.589333, 7.146, 13.178667, 19.768],\\n widthElements: [2.463, 2.808, 4.926, 5.616, 7.389, 8.424]\\n },\\n 'EVENT_CONDITIONAL': {\\n d: 'M {e.x0},{e.y0} l {e.x1},0 l 0,{e.y2} l -{e.x1},0 Z ' +\\n 'M {e.x2},{e.y3} l {e.x0},0 ' +\\n 'M {e.x2},{e.y4} l {e.x0},0 ' +\\n 'M {e.x2},{e.y5} l {e.x0},0 ' +\\n 'M {e.x2},{e.y6} l {e.x0},0 ' +\\n 'M {e.x2},{e.y7} l {e.x0},0 ' +\\n 'M {e.x2},{e.y8} l {e.x0},0 ',\\n height: 36,\\n width: 36,\\n heightElements: [8.5, 14.5, 18, 11.5, 14.5, 17.5, 20.5, 23.5, 26.5],\\n widthElements: [10.5, 14.5, 12.5]\\n },\\n 'EVENT_LINK': {\\n d: 'm {mx},{my} 0,{e.y0} -{e.x1},0 0,{e.y1} {e.x1},0 0,{e.y0} {e.x0},-{e.y2} -{e.x0},-{e.y2} z',\\n height: 36,\\n width: 36,\\n heightElements: [4.4375, 6.75, 7.8125],\\n widthElements: [9.84375, 13.5]\\n },\\n 'EVENT_ERROR': {\\n d: 'm {mx},{my} {e.x0},-{e.y0} {e.x1},-{e.y1} {e.x2},{e.y2} {e.x3},-{e.y3} -{e.x4},{e.y4} -{e.x5},-{e.y5} z',\\n height: 36,\\n width: 36,\\n heightElements: [0.023, 8.737, 8.151, 16.564, 10.591, 8.714],\\n widthElements: [0.085, 6.672, 6.97, 4.273, 5.337, 6.636]\\n },\\n 'EVENT_CANCEL_45': {\\n d: 'm {mx},{my} -{e.x1},0 0,{e.x0} {e.x1},0 0,{e.y1} {e.x0},0 ' +\\n '0,-{e.y1} {e.x1},0 0,-{e.y0} -{e.x1},0 0,-{e.y1} -{e.x0},0 z',\\n height: 36,\\n width: 36,\\n heightElements: [4.75, 8.5],\\n widthElements: [4.75, 8.5]\\n },\\n 'EVENT_COMPENSATION': {\\n d: 'm {mx},{my} {e.x0},-{e.y0} 0,{e.y1} z m {e.x0},0 {e.x0},-{e.y0} 0,{e.y1} z',\\n height: 36,\\n width: 36,\\n heightElements: [5, 10],\\n widthElements: [10]\\n },\\n 'EVENT_TIMER_WH': {\\n d: 'M {mx},{my} l {e.x0},-{e.y0} m -{e.x0},{e.y0} l {e.x1},{e.y1} ',\\n height: 36,\\n width: 36,\\n heightElements: [10, 2],\\n widthElements: [3, 7]\\n },\\n 'EVENT_TIMER_LINE': {\\n d: 'M {mx},{my} ' +\\n 'm {e.x0},{e.y0} l -{e.x1},{e.y1} ',\\n height: 36,\\n width: 36,\\n heightElements: [10, 3],\\n widthElements: [0, 0]\\n },\\n 'EVENT_MULTIPLE': {\\n d:'m {mx},{my} {e.x1},-{e.y0} {e.x1},{e.y0} -{e.x0},{e.y1} -{e.x2},0 z',\\n height: 36,\\n width: 36,\\n heightElements: [6.28099, 12.56199],\\n widthElements: [3.1405, 9.42149, 12.56198]\\n },\\n 'EVENT_PARALLEL_MULTIPLE': {\\n d:'m {mx},{my} {e.x0},0 0,{e.y1} {e.x1},0 0,{e.y0} -{e.x1},0 0,{e.y1} ' +\\n '-{e.x0},0 0,-{e.y1} -{e.x1},0 0,-{e.y0} {e.x1},0 z',\\n height: 36,\\n width: 36,\\n heightElements: [2.56228, 7.68683],\\n widthElements: [2.56228, 7.68683]\\n },\\n 'GATEWAY_EXCLUSIVE': {\\n d:'m {mx},{my} {e.x0},{e.y0} {e.x1},{e.y0} {e.x2},0 {e.x4},{e.y2} ' +\\n '{e.x4},{e.y1} {e.x2},0 {e.x1},{e.y3} {e.x0},{e.y3} ' +\\n '{e.x3},0 {e.x5},{e.y1} {e.x5},{e.y2} {e.x3},0 z',\\n height: 17.5,\\n width: 17.5,\\n heightElements: [8.5, 6.5312, -6.5312, -8.5],\\n widthElements: [6.5, -6.5, 3, -3, 5, -5]\\n },\\n 'GATEWAY_PARALLEL': {\\n d:'m {mx},{my} 0,{e.y1} -{e.x1},0 0,{e.y0} {e.x1},0 0,{e.y1} {e.x0},0 ' +\\n '0,-{e.y1} {e.x1},0 0,-{e.y0} -{e.x1},0 0,-{e.y1} -{e.x0},0 z',\\n height: 30,\\n width: 30,\\n heightElements: [5, 12.5],\\n widthElements: [5, 12.5]\\n },\\n 'GATEWAY_EVENT_BASED': {\\n d:'m {mx},{my} {e.x0},{e.y0} {e.x0},{e.y1} {e.x1},{e.y2} {e.x2},0 z',\\n height: 11,\\n width: 11,\\n heightElements: [-6, 6, 12, -12],\\n widthElements: [9, -3, -12]\\n },\\n 'GATEWAY_COMPLEX': {\\n d:'m {mx},{my} 0,{e.y0} -{e.x0},-{e.y1} -{e.x1},{e.y2} {e.x0},{e.y1} -{e.x2},0 0,{e.y3} ' +\\n '{e.x2},0 -{e.x0},{e.y1} l {e.x1},{e.y2} {e.x0},-{e.y1} 0,{e.y0} {e.x3},0 0,-{e.y0} {e.x0},{e.y1} ' +\\n '{e.x1},-{e.y2} -{e.x0},-{e.y1} {e.x2},0 0,-{e.y3} -{e.x2},0 {e.x0},-{e.y1} -{e.x1},-{e.y2} ' +\\n '-{e.x0},{e.y1} 0,-{e.y0} -{e.x3},0 z',\\n height: 17.125,\\n width: 17.125,\\n heightElements: [4.875, 3.4375, 2.125, 3],\\n widthElements: [3.4375, 2.125, 4.875, 3]\\n },\\n 'DATA_OBJECT_PATH': {\\n d:'m 0,0 {e.x1},0 {e.x0},{e.y0} 0,{e.y1} -{e.x2},0 0,-{e.y2} {e.x1},0 0,{e.y0} {e.x0},0',\\n height: 61,\\n width: 51,\\n heightElements: [10, 50, 60],\\n widthElements: [10, 40, 50, 60]\\n },\\n 'DATA_OBJECT_COLLECTION_PATH': {\\n d:'m {mx}, {my} ' +\\n 'm 0 15 l 0 -15 ' +\\n 'm 4 15 l 0 -15 ' +\\n 'm 4 15 l 0 -15 ',\\n height: 61,\\n width: 51,\\n heightElements: [12],\\n widthElements: [1, 6, 12, 15]\\n },\\n 'DATA_ARROW': {\\n d:'m 5,9 9,0 0,-3 5,5 -5,5 0,-3 -9,0 z',\\n height: 61,\\n width: 51,\\n heightElements: [],\\n widthElements: []\\n },\\n 'DATA_STORE': {\\n d:'m {mx},{my} ' +\\n 'l 0,{e.y2} ' +\\n 'c {e.x0},{e.y1} {e.x1},{e.y1} {e.x2},0 ' +\\n 'l 0,-{e.y2} ' +\\n 'c -{e.x0},-{e.y1} -{e.x1},-{e.y1} -{e.x2},0' +\\n 'c {e.x0},{e.y1} {e.x1},{e.y1} {e.x2},0 ' +\\n 'm -{e.x2},{e.y0}' +\\n 'c {e.x0},{e.y1} {e.x1},{e.y1} {e.x2},0' +\\n 'm -{e.x2},{e.y0}' +\\n 'c {e.x0},{e.y1} {e.x1},{e.y1} {e.x2},0',\\n height: 61,\\n width: 61,\\n heightElements: [7, 10, 45],\\n widthElements: [2, 58, 60]\\n },\\n 'TEXT_ANNOTATION': {\\n d: 'm {mx}, {my} m 10,0 l -10,0 l 0,{e.y0} l 10,0',\\n height: 30,\\n width: 10,\\n heightElements: [30],\\n widthElements: [10]\\n },\\n 'MARKER_SUB_PROCESS': {\\n d: 'm{mx},{my} m 7,2 l 0,10 m -5,-5 l 10,0',\\n height: 10,\\n width: 10,\\n heightElements: [],\\n widthElements: []\\n },\\n 'MARKER_PARALLEL': {\\n d: 'm{mx},{my} m 3,2 l 0,10 m 3,-10 l 0,10 m 3,-10 l 0,10',\\n height: 10,\\n width: 10,\\n heightElements: [],\\n widthElements: []\\n },\\n 'MARKER_SEQUENTIAL': {\\n d: 'm{mx},{my} m 0,3 l 10,0 m -10,3 l 10,0 m -10,3 l 10,0',\\n height: 10,\\n width: 10,\\n heightElements: [],\\n widthElements: []\\n },\\n 'MARKER_COMPENSATION': {\\n d: 'm {mx},{my} 8,-5 0,10 z m 9,0 8,-5 0,10 z',\\n height: 10,\\n width: 21,\\n heightElements: [],\\n widthElements: []\\n },\\n 'MARKER_LOOP': {\\n d: 'm {mx},{my} c 3.526979,0 6.386161,-2.829858 6.386161,-6.320661 0,-3.490806 -2.859182,-6.320661 ' +\\n '-6.386161,-6.320661 -3.526978,0 -6.38616,2.829855 -6.38616,6.320661 0,1.745402 ' +\\n '0.714797,3.325567 1.870463,4.469381 0.577834,0.571908 1.265885,1.034728 2.029916,1.35457 ' +\\n 'l -0.718163,-3.909793 m 0.718163,3.909793 -3.885211,0.802902',\\n height: 13.9,\\n width: 13.7,\\n heightElements: [],\\n widthElements: []\\n },\\n 'MARKER_ADHOC': {\\n d: 'm {mx},{my} m 0.84461,2.64411 c 1.05533,-1.23780996 2.64337,-2.07882 4.29653,-1.97997996 2.05163,0.0805 ' +\\n '3.85579,1.15803 5.76082,1.79107 1.06385,0.34139996 2.24454,0.1438 3.18759,-0.43767 0.61743,-0.33642 ' +\\n '1.2775,-0.64078 1.7542,-1.17511 0,0.56023 0,1.12046 0,1.6807 -0.98706,0.96237996 -2.29792,1.62393996 ' +\\n '-3.6918,1.66181996 -1.24459,0.0927 -2.46671,-0.2491 -3.59505,-0.74812 -1.35789,-0.55965 ' +\\n '-2.75133,-1.33436996 -4.27027,-1.18121996 -1.37741,0.14601 -2.41842,1.13685996 -3.44288,1.96782996 z',\\n height: 4,\\n width: 15,\\n heightElements: [],\\n widthElements: []\\n },\\n 'TASK_TYPE_SEND': {\\n d: 'm {mx},{my} l 0,{e.y1} l {e.x1},0 l 0,-{e.y1} z l {e.x0},{e.y0} l {e.x0},-{e.y0}',\\n height: 14,\\n width: 21,\\n heightElements: [6, 14],\\n widthElements: [10.5, 21]\\n },\\n 'TASK_TYPE_SCRIPT': {\\n d: 'm {mx},{my} c 9.966553,-6.27276 -8.000926,-7.91932 2.968968,-14.938 l -8.802728,0 ' +\\n 'c -10.969894,7.01868 6.997585,8.66524 -2.968967,14.938 z ' +\\n 'm -7,-12 l 5,0 ' +\\n 'm -4.5,3 l 4.5,0 ' +\\n 'm -3,3 l 5,0' +\\n 'm -4,3 l 5,0',\\n height: 15,\\n width: 12.6,\\n heightElements: [6, 14],\\n widthElements: [10.5, 21]\\n },\\n 'TASK_TYPE_USER_1': {\\n d: 'm {mx},{my} c 0.909,-0.845 1.594,-2.049 1.594,-3.385 0,-2.554 -1.805,-4.62199999 ' +\\n '-4.357,-4.62199999 -2.55199998,0 -4.28799998,2.06799999 -4.28799998,4.62199999 0,1.348 ' +\\n '0.974,2.562 1.89599998,3.405 -0.52899998,0.187 -5.669,2.097 -5.794,4.7560005 v 6.718 ' +\\n 'h 17 v -6.718 c 0,-2.2980005 -5.5279996,-4.5950005 -6.0509996,-4.7760005 z' +\\n 'm -8,6 l 0,5.5 m 11,0 l 0,-5'\\n },\\n 'TASK_TYPE_USER_2': {\\n d: 'm {mx},{my} m 2.162,1.009 c 0,2.4470005 -2.158,4.4310005 -4.821,4.4310005 ' +\\n '-2.66499998,0 -4.822,-1.981 -4.822,-4.4310005 '\\n },\\n 'TASK_TYPE_USER_3': {\\n d: 'm {mx},{my} m -6.9,-3.80 c 0,0 2.25099998,-2.358 4.27399998,-1.177 2.024,1.181 4.221,1.537 ' +\\n '4.124,0.965 -0.098,-0.57 -0.117,-3.79099999 -4.191,-4.13599999 -3.57499998,0.001 ' +\\n '-4.20799998,3.36699999 -4.20699998,4.34799999 z'\\n },\\n 'TASK_TYPE_MANUAL': {\\n d: 'm {mx},{my} c 0.234,-0.01 5.604,0.008 8.029,0.004 0.808,0 1.271,-0.172 1.417,-0.752 0.227,-0.898 ' +\\n '-0.334,-1.314 -1.338,-1.316 -2.467,-0.01 -7.886,-0.004 -8.108,-0.004 -0.014,-0.079 0.016,-0.533 0,-0.61 ' +\\n '0.195,-0.042 8.507,0.006 9.616,0.002 0.877,-0.007 1.35,-0.438 1.353,-1.208 0.003,-0.768 -0.479,-1.09 ' +\\n '-1.35,-1.091 -2.968,-0.002 -9.619,-0.013 -9.619,-0.013 v -0.591 c 0,0 5.052,-0.016 7.225,-0.016 ' +\\n '0.888,-0.002 1.354,-0.416 1.351,-1.193 -0.006,-0.761 -0.492,-1.196 -1.361,-1.196 -3.473,-0.005 ' +\\n '-10.86,-0.003 -11.0829995,-0.003 -0.022,-0.047 -0.045,-0.094 -0.069,-0.139 0.3939995,-0.319 ' +\\n '2.0409995,-1.626 2.4149995,-2.017 0.469,-0.4870005 0.519,-1.1650005 0.162,-1.6040005 -0.414,-0.511 ' +\\n '-0.973,-0.5 -1.48,-0.236 -1.4609995,0.764 -6.5999995,3.6430005 -7.7329995,4.2710005 -0.9,0.499 ' +\\n '-1.516,1.253 -1.882,2.19 -0.37000002,0.95 -0.17,2.01 -0.166,2.979 0.004,0.718 -0.27300002,1.345 ' +\\n '-0.055,2.063 0.629,2.087 2.425,3.312 4.859,3.318 4.6179995,0.014 9.2379995,-0.139 13.8569995,-0.158 ' +\\n '0.755,-0.004 1.171,-0.301 1.182,-1.033 0.012,-0.754 -0.423,-0.969 -1.183,-0.973 -1.778,-0.01 ' +\\n '-5.824,-0.004 -6.04,-0.004 10e-4,-0.084 0.003,-0.586 10e-4,-0.67 z'\\n },\\n 'TASK_TYPE_INSTANTIATING_SEND': {\\n d: 'm {mx},{my} l 0,8.4 l 12.6,0 l 0,-8.4 z l 6.3,3.6 l 6.3,-3.6'\\n },\\n 'TASK_TYPE_SERVICE': {\\n d: 'm {mx},{my} v -1.71335 c 0.352326,-0.0705 0.703932,-0.17838 1.047628,-0.32133 ' +\\n '0.344416,-0.14465 0.665822,-0.32133 0.966377,-0.52145 l 1.19431,1.18005 1.567487,-1.57688 ' +\\n '-1.195028,-1.18014 c 0.403376,-0.61394 0.683079,-1.29908 0.825447,-2.01824 l 1.622133,-0.01 ' +\\n 'v -2.2196 l -1.636514,0.01 c -0.07333,-0.35153 -0.178319,-0.70024 -0.323564,-1.04372 ' +\\n '-0.145244,-0.34406 -0.321407,-0.6644 -0.522735,-0.96217 l 1.131035,-1.13631 -1.583305,-1.56293 ' +\\n '-1.129598,1.13589 c -0.614052,-0.40108 -1.302883,-0.68093 -2.022633,-0.82247 l 0.0093,-1.61852 ' +\\n 'h -2.241173 l 0.0042,1.63124 c -0.353763,0.0736 -0.705369,0.17977 -1.049785,0.32371 -0.344415,0.14437 ' +\\n '-0.665102,0.32092 -0.9635006,0.52046 l -1.1698628,-1.15823 -1.5667691,1.5792 1.1684265,1.15669 ' +\\n 'c -0.4026573,0.61283 -0.68308,1.29797 -0.8247287,2.01713 l -1.6588041,0.003 v 2.22174 ' +\\n 'l 1.6724648,-0.006 c 0.073327,0.35077 0.1797598,0.70243 0.3242851,1.04472 0.1452428,0.34448 ' +\\n '0.3214064,0.6644 0.5227339,0.96066 l -1.1993431,1.19723 1.5840256,1.56011 1.1964668,-1.19348 ' +\\n 'c 0.6140517,0.40346 1.3028827,0.68232 2.0233517,0.82331 l 7.19e-4,1.69892 h 2.226848 z ' +\\n 'm 0.221462,-3.9957 c -1.788948,0.7502 -3.8576,-0.0928 -4.6097055,-1.87438 -0.7521065,-1.78321 ' +\\n '0.090598,-3.84627 1.8802645,-4.59604 1.78823,-0.74936 3.856881,0.0929 4.608987,1.87437 ' +\\n '0.752106,1.78165 -0.0906,3.84612 -1.879546,4.59605 z'\\n },\\n 'TASK_TYPE_SERVICE_FILL': {\\n d: 'm {mx},{my} c -1.788948,0.7502 -3.8576,-0.0928 -4.6097055,-1.87438 -0.7521065,-1.78321 ' +\\n '0.090598,-3.84627 1.8802645,-4.59604 1.78823,-0.74936 3.856881,0.0929 4.608987,1.87437 ' +\\n '0.752106,1.78165 -0.0906,3.84612 -1.879546,4.59605 z'\\n },\\n 'TASK_TYPE_BUSINESS_RULE_HEADER': {\\n d: 'm {mx},{my} 0,4 20,0 0,-4 z'\\n },\\n 'TASK_TYPE_BUSINESS_RULE_MAIN': {\\n d: 'm {mx},{my} 0,12 20,0 0,-12 z' +\\n 'm 0,8 l 20,0 ' +\\n 'm -13,-4 l 0,8'\\n },\\n 'MESSAGE_FLOW_MARKER': {\\n d: 'm {mx},{my} m -10.5 ,-7 l 0,14 l 21,0 l 0,-14 z l 10.5,6 l 10.5,-6'\\n }\\n };\\n\\n this.getRawPath = function getRawPath(pathId) {\\n return this.pathMap[pathId].d;\\n };\\n\\n /**\\n * Scales the path to the given height and width.\\n * <h1>Use case</h1>\\n * <p>Use case is to scale the content of elements (event, gateways) based\\n * on the element bounding box's size.\\n * </p>\\n * <h1>Why not transform</h1>\\n * <p>Scaling a path with transform() will also scale the stroke and IE does not support\\n * the option 'non-scaling-stroke' to prevent this.\\n * Also there are use cases where only some parts of a path should be\\n * scaled.</p>\\n *\\n * @param {String} pathId The ID of the path.\\n * @param {Object} param <p>\\n * Example param object scales the path to 60% size of the container (data.width, data.height).\\n * <pre>\\n * {\\n * xScaleFactor: 0.6,\\n * yScaleFactor:0.6,\\n * containerWidth: data.width,\\n * containerHeight: data.height,\\n * position: {\\n * mx: 0.46,\\n * my: 0.2,\\n * }\\n * }\\n * </pre>\\n * <ul>\\n * <li>targetpathwidth = xScaleFactor * containerWidth</li>\\n * <li>targetpathheight = yScaleFactor * containerHeight</li>\\n * <li>Position is used to set the starting coordinate of the path. M is computed:\\n * <ul>\\n * <li>position.x * containerWidth</li>\\n * <li>position.y * containerHeight</li>\\n * </ul>\\n * Center of the container <pre> position: {\\n * mx: 0.5,\\n * my: 0.5,\\n * }</pre>\\n * Upper left corner of the container\\n * <pre> position: {\\n * mx: 0.0,\\n * my: 0.0,\\n * }</pre>\\n * </li>\\n * </ul>\\n * </p>\\n *\\n */\\n this.getScaledPath = function getScaledPath(pathId, param) {\\n var rawPath = this.pathMap[pathId];\\n\\n // positioning\\n // compute the start point of the path\\n var mx, my;\\n\\n if(!!param.abspos) {\\n mx = param.abspos.x;\\n my = param.abspos.y;\\n } else {\\n mx = param.containerWidth * param.position.mx;\\n my = param.containerHeight * param.position.my;\\n }\\n\\n var coordinates = {}; //map for the scaled coordinates\\n if(param.position) {\\n\\n // path\\n var heightRatio = (param.containerHeight / rawPath.height) * param.yScaleFactor;\\n var widthRatio = (param.containerWidth / rawPath.width) * param.xScaleFactor;\\n\\n\\n //Apply height ratio\\n for (var heightIndex = 0; heightIndex < rawPath.heightElements.length; heightIndex++) {\\n coordinates['y' + heightIndex] = rawPath.heightElements[heightIndex] * heightRatio;\\n }\\n\\n //Apply width ratio\\n for (var widthIndex = 0; widthIndex < rawPath.widthElements.length; widthIndex++) {\\n coordinates['x' + widthIndex] = rawPath.widthElements[widthIndex] * widthRatio;\\n }\\n }\\n\\n //Apply value to raw path\\n var path = Snap.format(\\n rawPath.d, {\\n mx: mx,\\n my: my,\\n e: coordinates\\n }\\n );\\n return path;\\n };\\n}\",\n \"function PathMap() {\\n\\n /**\\n * Contains a map of path elements\\n *\\n * <h1>Path definition</h1>\\n * A parameterized path is defined like this:\\n * <pre>\\n * 'GATEWAY_PARALLEL': {\\n * d: 'm {mx},{my} {e.x0},0 0,{e.x1} {e.x1},0 0,{e.y0} -{e.x1},0 0,{e.y1} ' +\\n '-{e.x0},0 0,-{e.y1} -{e.x1},0 0,-{e.y0} {e.x1},0 z',\\n * height: 17.5,\\n * width: 17.5,\\n * heightElements: [2.5, 7.5],\\n * widthElements: [2.5, 7.5]\\n * }\\n * </pre>\\n * <p>It's important to specify a correct <b>height and width</b> for the path as the scaling\\n * is based on the ratio between the specified height and width in this object and the\\n * height and width that is set as scale target (Note x,y coordinates will be scaled with\\n * individual ratios).</p>\\n * <p>The '<b>heightElements</b>' and '<b>widthElements</b>' array must contain the values that will be scaled.\\n * The scaling is based on the computed ratios.\\n * Coordinates on the y axis should be in the <b>heightElement</b>'s array, they will be scaled using\\n * the computed ratio coefficient.\\n * In the parameterized path the scaled values can be accessed through the 'e' object in {} brackets.\\n * <ul>\\n * <li>The values for the y axis can be accessed in the path string using {e.y0}, {e.y1}, ....</li>\\n * <li>The values for the x axis can be accessed in the path string using {e.x0}, {e.x1}, ....</li>\\n * </ul>\\n * The numbers x0, x1 respectively y0, y1, ... map to the corresponding array index.\\n * </p>\\n */\\n this.pathMap = {\\n 'EVENT_MESSAGE': {\\n d: 'm {mx},{my} l 0,{e.y1} l {e.x1},0 l 0,-{e.y1} z l {e.x0},{e.y0} l {e.x0},-{e.y0}',\\n height: 36,\\n width: 36,\\n heightElements: [6, 14],\\n widthElements: [10.5, 21]\\n },\\n 'EVENT_SIGNAL': {\\n d: 'M {mx},{my} l {e.x0},{e.y0} l -{e.x1},0 Z',\\n height: 36,\\n width: 36,\\n heightElements: [18],\\n widthElements: [10, 20]\\n },\\n 'EVENT_ESCALATION': {\\n d: 'M {mx},{my} l {e.x0},{e.y0} l -{e.x0},-{e.y1} l -{e.x0},{e.y1} Z',\\n height: 36,\\n width: 36,\\n heightElements: [20, 7],\\n widthElements: [8]\\n },\\n 'EVENT_CONDITIONAL': {\\n d: 'M {e.x0},{e.y0} l {e.x1},0 l 0,{e.y2} l -{e.x1},0 Z ' +\\n 'M {e.x2},{e.y3} l {e.x0},0 ' +\\n 'M {e.x2},{e.y4} l {e.x0},0 ' +\\n 'M {e.x2},{e.y5} l {e.x0},0 ' +\\n 'M {e.x2},{e.y6} l {e.x0},0 ' +\\n 'M {e.x2},{e.y7} l {e.x0},0 ' +\\n 'M {e.x2},{e.y8} l {e.x0},0 ',\\n height: 36,\\n width: 36,\\n heightElements: [8.5, 14.5, 18, 11.5, 14.5, 17.5, 20.5, 23.5, 26.5],\\n widthElements: [10.5, 14.5, 12.5]\\n },\\n 'EVENT_LINK': {\\n d: 'm {mx},{my} 0,{e.y0} -{e.x1},0 0,{e.y1} {e.x1},0 0,{e.y0} {e.x0},-{e.y2} -{e.x0},-{e.y2} z',\\n height: 36,\\n width: 36,\\n heightElements: [4.4375, 6.75, 7.8125],\\n widthElements: [9.84375, 13.5]\\n },\\n 'EVENT_ERROR': {\\n d: 'm {mx},{my} {e.x0},-{e.y0} {e.x1},-{e.y1} {e.x2},{e.y2} {e.x3},-{e.y3} -{e.x4},{e.y4} -{e.x5},-{e.y5} z',\\n height: 36,\\n width: 36,\\n heightElements: [0.023, 8.737, 8.151, 16.564, 10.591, 8.714],\\n widthElements: [0.085, 6.672, 6.97, 4.273, 5.337, 6.636]\\n },\\n 'EVENT_CANCEL_45': {\\n d: 'm {mx},{my} -{e.x1},0 0,{e.x0} {e.x1},0 0,{e.y1} {e.x0},0 ' +\\n '0,-{e.y1} {e.x1},0 0,-{e.y0} -{e.x1},0 0,-{e.y1} -{e.x0},0 z',\\n height: 36,\\n width: 36,\\n heightElements: [4.75, 8.5],\\n widthElements: [4.75, 8.5]\\n },\\n 'EVENT_COMPENSATION': {\\n d: 'm {mx},{my} {e.x0},-{e.y0} 0,{e.y1} z m {e.x1},-{e.y2} {e.x2},-{e.y3} 0,{e.y1} -{e.x2},-{e.y3} z',\\n height: 36,\\n width: 36,\\n heightElements: [6.5, 13, 0.4, 6.1],\\n widthElements: [9, 9.3, 8.7]\\n },\\n 'EVENT_TIMER_WH': {\\n d: 'M {mx},{my} l {e.x0},-{e.y0} m -{e.x0},{e.y0} l {e.x1},{e.y1} ',\\n height: 36,\\n width: 36,\\n heightElements: [10, 2],\\n widthElements: [3, 7]\\n },\\n 'EVENT_TIMER_LINE': {\\n d: 'M {mx},{my} ' +\\n 'm {e.x0},{e.y0} l -{e.x1},{e.y1} ',\\n height: 36,\\n width: 36,\\n heightElements: [10, 3],\\n widthElements: [0, 0]\\n },\\n 'EVENT_MULTIPLE': {\\n d:'m {mx},{my} {e.x1},-{e.y0} {e.x1},{e.y0} -{e.x0},{e.y1} -{e.x2},0 z',\\n height: 36,\\n width: 36,\\n heightElements: [6.28099, 12.56199],\\n widthElements: [3.1405, 9.42149, 12.56198]\\n },\\n 'EVENT_PARALLEL_MULTIPLE': {\\n d:'m {mx},{my} {e.x0},0 0,{e.y1} {e.x1},0 0,{e.y0} -{e.x1},0 0,{e.y1} ' +\\n '-{e.x0},0 0,-{e.y1} -{e.x1},0 0,-{e.y0} {e.x1},0 z',\\n height: 36,\\n width: 36,\\n heightElements: [2.56228, 7.68683],\\n widthElements: [2.56228, 7.68683]\\n },\\n 'GATEWAY_EXCLUSIVE': {\\n d:'m {mx},{my} {e.x0},{e.y0} {e.x1},{e.y0} {e.x2},0 {e.x4},{e.y2} ' +\\n '{e.x4},{e.y1} {e.x2},0 {e.x1},{e.y3} {e.x0},{e.y3} ' +\\n '{e.x3},0 {e.x5},{e.y1} {e.x5},{e.y2} {e.x3},0 z',\\n height: 17.5,\\n width: 17.5,\\n heightElements: [8.5, 6.5312, -6.5312, -8.5],\\n widthElements: [6.5, -6.5, 3, -3, 5, -5]\\n },\\n 'GATEWAY_PARALLEL': {\\n d:'m {mx},{my} 0,{e.y1} -{e.x1},0 0,{e.y0} {e.x1},0 0,{e.y1} {e.x0},0 ' +\\n '0,-{e.y1} {e.x1},0 0,-{e.y0} -{e.x1},0 0,-{e.y1} -{e.x0},0 z',\\n height: 30,\\n width: 30,\\n heightElements: [5, 12.5],\\n widthElements: [5, 12.5]\\n },\\n 'GATEWAY_EVENT_BASED': {\\n d:'m {mx},{my} {e.x0},{e.y0} {e.x0},{e.y1} {e.x1},{e.y2} {e.x2},0 z',\\n height: 11,\\n width: 11,\\n heightElements: [-6, 6, 12, -12],\\n widthElements: [9, -3, -12]\\n },\\n 'GATEWAY_COMPLEX': {\\n d:'m {mx},{my} 0,{e.y0} -{e.x0},-{e.y1} -{e.x1},{e.y2} {e.x0},{e.y1} -{e.x2},0 0,{e.y3} ' +\\n '{e.x2},0 -{e.x0},{e.y1} l {e.x1},{e.y2} {e.x0},-{e.y1} 0,{e.y0} {e.x3},0 0,-{e.y0} {e.x0},{e.y1} ' +\\n '{e.x1},-{e.y2} -{e.x0},-{e.y1} {e.x2},0 0,-{e.y3} -{e.x2},0 {e.x0},-{e.y1} -{e.x1},-{e.y2} ' +\\n '-{e.x0},{e.y1} 0,-{e.y0} -{e.x3},0 z',\\n height: 17.125,\\n width: 17.125,\\n heightElements: [4.875, 3.4375, 2.125, 3],\\n widthElements: [3.4375, 2.125, 4.875, 3]\\n },\\n 'DATA_OBJECT_PATH': {\\n d:'m 0,0 {e.x1},0 {e.x0},{e.y0} 0,{e.y1} -{e.x2},0 0,-{e.y2} {e.x1},0 0,{e.y0} {e.x0},0',\\n height: 61,\\n width: 51,\\n heightElements: [10, 50, 60],\\n widthElements: [10, 40, 50, 60]\\n },\\n 'DATA_OBJECT_COLLECTION_PATH': {\\n d: 'm{mx},{my} m 3,2 l 0,10 m 3,-10 l 0,10 m 3,-10 l 0,10',\\n height: 10,\\n width: 10,\\n heightElements: [],\\n widthElements: []\\n },\\n 'DATA_ARROW': {\\n d:'m 5,9 9,0 0,-3 5,5 -5,5 0,-3 -9,0 z',\\n height: 61,\\n width: 51,\\n heightElements: [],\\n widthElements: []\\n },\\n 'DATA_STORE': {\\n d:'m {mx},{my} ' +\\n 'l 0,{e.y2} ' +\\n 'c {e.x0},{e.y1} {e.x1},{e.y1} {e.x2},0 ' +\\n 'l 0,-{e.y2} ' +\\n 'c -{e.x0},-{e.y1} -{e.x1},-{e.y1} -{e.x2},0' +\\n 'c {e.x0},{e.y1} {e.x1},{e.y1} {e.x2},0 ' +\\n 'm -{e.x2},{e.y0}' +\\n 'c {e.x0},{e.y1} {e.x1},{e.y1} {e.x2},0' +\\n 'm -{e.x2},{e.y0}' +\\n 'c {e.x0},{e.y1} {e.x1},{e.y1} {e.x2},0',\\n height: 61,\\n width: 61,\\n heightElements: [7, 10, 45],\\n widthElements: [2, 58, 60]\\n },\\n 'TEXT_ANNOTATION': {\\n d: 'm {mx}, {my} m 10,0 l -10,0 l 0,{e.y0} l 10,0',\\n height: 30,\\n width: 10,\\n heightElements: [30],\\n widthElements: [10]\\n },\\n 'MARKER_SUB_PROCESS': {\\n d: 'm{mx},{my} m 7,2 l 0,10 m -5,-5 l 10,0',\\n height: 10,\\n width: 10,\\n heightElements: [],\\n widthElements: []\\n },\\n 'MARKER_PARALLEL': {\\n d: 'm{mx},{my} m 3,2 l 0,10 m 3,-10 l 0,10 m 3,-10 l 0,10',\\n height: 10,\\n width: 10,\\n heightElements: [],\\n widthElements: []\\n },\\n 'MARKER_SEQUENTIAL': {\\n d: 'm{mx},{my} m 0,3 l 10,0 m -10,3 l 10,0 m -10,3 l 10,0',\\n height: 10,\\n width: 10,\\n heightElements: [],\\n widthElements: []\\n },\\n 'MARKER_COMPENSATION': {\\n d: 'm {mx},{my} 7,-5 0,10 z m 7.1,-0.3 6.9,-4.7 0,10 -6.9,-4.7 z',\\n height: 10,\\n width: 21,\\n heightElements: [],\\n widthElements: []\\n },\\n 'MARKER_LOOP': {\\n d: 'm {mx},{my} c 3.526979,0 6.386161,-2.829858 6.386161,-6.320661 0,-3.490806 -2.859182,-6.320661 ' +\\n '-6.386161,-6.320661 -3.526978,0 -6.38616,2.829855 -6.38616,6.320661 0,1.745402 ' +\\n '0.714797,3.325567 1.870463,4.469381 0.577834,0.571908 1.265885,1.034728 2.029916,1.35457 ' +\\n 'l -0.718163,-3.909793 m 0.718163,3.909793 -3.885211,0.802902',\\n height: 13.9,\\n width: 13.7,\\n heightElements: [],\\n widthElements: []\\n },\\n 'MARKER_ADHOC': {\\n d: 'm {mx},{my} m 0.84461,2.64411 c 1.05533,-1.23780996 2.64337,-2.07882 4.29653,-1.97997996 2.05163,0.0805 ' +\\n '3.85579,1.15803 5.76082,1.79107 1.06385,0.34139996 2.24454,0.1438 3.18759,-0.43767 0.61743,-0.33642 ' +\\n '1.2775,-0.64078 1.7542,-1.17511 0,0.56023 0,1.12046 0,1.6807 -0.98706,0.96237996 -2.29792,1.62393996 ' +\\n '-3.6918,1.66181996 -1.24459,0.0927 -2.46671,-0.2491 -3.59505,-0.74812 -1.35789,-0.55965 ' +\\n '-2.75133,-1.33436996 -4.27027,-1.18121996 -1.37741,0.14601 -2.41842,1.13685996 -3.44288,1.96782996 z',\\n height: 4,\\n width: 15,\\n heightElements: [],\\n widthElements: []\\n },\\n 'TASK_TYPE_SEND': {\\n d: 'm {mx},{my} l 0,{e.y1} l {e.x1},0 l 0,-{e.y1} z l {e.x0},{e.y0} l {e.x0},-{e.y0}',\\n height: 14,\\n width: 21,\\n heightElements: [6, 14],\\n widthElements: [10.5, 21]\\n },\\n 'TASK_TYPE_SCRIPT': {\\n d: 'm {mx},{my} c 9.966553,-6.27276 -8.000926,-7.91932 2.968968,-14.938 l -8.802728,0 ' +\\n 'c -10.969894,7.01868 6.997585,8.66524 -2.968967,14.938 z ' +\\n 'm -7,-12 l 5,0 ' +\\n 'm -4.5,3 l 4.5,0 ' +\\n 'm -3,3 l 5,0' +\\n 'm -4,3 l 5,0',\\n height: 15,\\n width: 12.6,\\n heightElements: [6, 14],\\n widthElements: [10.5, 21]\\n },\\n 'TASK_TYPE_USER_1': {\\n d: 'm {mx},{my} c 0.909,-0.845 1.594,-2.049 1.594,-3.385 0,-2.554 -1.805,-4.62199999 ' +\\n '-4.357,-4.62199999 -2.55199998,0 -4.28799998,2.06799999 -4.28799998,4.62199999 0,1.348 ' +\\n '0.974,2.562 1.89599998,3.405 -0.52899998,0.187 -5.669,2.097 -5.794,4.7560005 v 6.718 ' +\\n 'h 17 v -6.718 c 0,-2.2980005 -5.5279996,-4.5950005 -6.0509996,-4.7760005 z' +\\n 'm -8,6 l 0,5.5 m 11,0 l 0,-5'\\n },\\n 'TASK_TYPE_USER_2': {\\n d: 'm {mx},{my} m 2.162,1.009 c 0,2.4470005 -2.158,4.4310005 -4.821,4.4310005 ' +\\n '-2.66499998,0 -4.822,-1.981 -4.822,-4.4310005 '\\n },\\n 'TASK_TYPE_USER_3': {\\n d: 'm {mx},{my} m -6.9,-3.80 c 0,0 2.25099998,-2.358 4.27399998,-1.177 2.024,1.181 4.221,1.537 ' +\\n '4.124,0.965 -0.098,-0.57 -0.117,-3.79099999 -4.191,-4.13599999 -3.57499998,0.001 ' +\\n '-4.20799998,3.36699999 -4.20699998,4.34799999 z'\\n },\\n 'TASK_TYPE_MANUAL': {\\n d: 'm {mx},{my} c 0.234,-0.01 5.604,0.008 8.029,0.004 0.808,0 1.271,-0.172 1.417,-0.752 0.227,-0.898 ' +\\n '-0.334,-1.314 -1.338,-1.316 -2.467,-0.01 -7.886,-0.004 -8.108,-0.004 -0.014,-0.079 0.016,-0.533 0,-0.61 ' +\\n '0.195,-0.042 8.507,0.006 9.616,0.002 0.877,-0.007 1.35,-0.438 1.353,-1.208 0.003,-0.768 -0.479,-1.09 ' +\\n '-1.35,-1.091 -2.968,-0.002 -9.619,-0.013 -9.619,-0.013 v -0.591 c 0,0 5.052,-0.016 7.225,-0.016 ' +\\n '0.888,-0.002 1.354,-0.416 1.351,-1.193 -0.006,-0.761 -0.492,-1.196 -1.361,-1.196 -3.473,-0.005 ' +\\n '-10.86,-0.003 -11.0829995,-0.003 -0.022,-0.047 -0.045,-0.094 -0.069,-0.139 0.3939995,-0.319 ' +\\n '2.0409995,-1.626 2.4149995,-2.017 0.469,-0.4870005 0.519,-1.1650005 0.162,-1.6040005 -0.414,-0.511 ' +\\n '-0.973,-0.5 -1.48,-0.236 -1.4609995,0.764 -6.5999995,3.6430005 -7.7329995,4.2710005 -0.9,0.499 ' +\\n '-1.516,1.253 -1.882,2.19 -0.37000002,0.95 -0.17,2.01 -0.166,2.979 0.004,0.718 -0.27300002,1.345 ' +\\n '-0.055,2.063 0.629,2.087 2.425,3.312 4.859,3.318 4.6179995,0.014 9.2379995,-0.139 13.8569995,-0.158 ' +\\n '0.755,-0.004 1.171,-0.301 1.182,-1.033 0.012,-0.754 -0.423,-0.969 -1.183,-0.973 -1.778,-0.01 ' +\\n '-5.824,-0.004 -6.04,-0.004 10e-4,-0.084 0.003,-0.586 10e-4,-0.67 z'\\n },\\n 'TASK_TYPE_INSTANTIATING_SEND': {\\n d: 'm {mx},{my} l 0,8.4 l 12.6,0 l 0,-8.4 z l 6.3,3.6 l 6.3,-3.6'\\n },\\n 'TASK_TYPE_SERVICE': {\\n d: 'm {mx},{my} v -1.71335 c 0.352326,-0.0705 0.703932,-0.17838 1.047628,-0.32133 ' +\\n '0.344416,-0.14465 0.665822,-0.32133 0.966377,-0.52145 l 1.19431,1.18005 1.567487,-1.57688 ' +\\n '-1.195028,-1.18014 c 0.403376,-0.61394 0.683079,-1.29908 0.825447,-2.01824 l 1.622133,-0.01 ' +\\n 'v -2.2196 l -1.636514,0.01 c -0.07333,-0.35153 -0.178319,-0.70024 -0.323564,-1.04372 ' +\\n '-0.145244,-0.34406 -0.321407,-0.6644 -0.522735,-0.96217 l 1.131035,-1.13631 -1.583305,-1.56293 ' +\\n '-1.129598,1.13589 c -0.614052,-0.40108 -1.302883,-0.68093 -2.022633,-0.82247 l 0.0093,-1.61852 ' +\\n 'h -2.241173 l 0.0042,1.63124 c -0.353763,0.0736 -0.705369,0.17977 -1.049785,0.32371 -0.344415,0.14437 ' +\\n '-0.665102,0.32092 -0.9635006,0.52046 l -1.1698628,-1.15823 -1.5667691,1.5792 1.1684265,1.15669 ' +\\n 'c -0.4026573,0.61283 -0.68308,1.29797 -0.8247287,2.01713 l -1.6588041,0.003 v 2.22174 ' +\\n 'l 1.6724648,-0.006 c 0.073327,0.35077 0.1797598,0.70243 0.3242851,1.04472 0.1452428,0.34448 ' +\\n '0.3214064,0.6644 0.5227339,0.96066 l -1.1993431,1.19723 1.5840256,1.56011 1.1964668,-1.19348 ' +\\n 'c 0.6140517,0.40346 1.3028827,0.68232 2.0233517,0.82331 l 7.19e-4,1.69892 h 2.226848 z ' +\\n 'm 0.221462,-3.9957 c -1.788948,0.7502 -3.8576,-0.0928 -4.6097055,-1.87438 -0.7521065,-1.78321 ' +\\n '0.090598,-3.84627 1.8802645,-4.59604 1.78823,-0.74936 3.856881,0.0929 4.608987,1.87437 ' +\\n '0.752106,1.78165 -0.0906,3.84612 -1.879546,4.59605 z'\\n },\\n 'TASK_TYPE_SERVICE_FILL': {\\n d: 'm {mx},{my} c -1.788948,0.7502 -3.8576,-0.0928 -4.6097055,-1.87438 -0.7521065,-1.78321 ' +\\n '0.090598,-3.84627 1.8802645,-4.59604 1.78823,-0.74936 3.856881,0.0929 4.608987,1.87437 ' +\\n '0.752106,1.78165 -0.0906,3.84612 -1.879546,4.59605 z'\\n },\\n 'TASK_TYPE_BUSINESS_RULE_HEADER': {\\n d: 'm {mx},{my} 0,4 20,0 0,-4 z'\\n },\\n 'TASK_TYPE_BUSINESS_RULE_MAIN': {\\n d: 'm {mx},{my} 0,12 20,0 0,-12 z' +\\n 'm 0,8 l 20,0 ' +\\n 'm -13,-4 l 0,8'\\n },\\n 'MESSAGE_FLOW_MARKER': {\\n d: 'm {mx},{my} m -10.5 ,-7 l 0,14 l 21,0 l 0,-14 z l 10.5,6 l 10.5,-6'\\n }\\n };\\n\\n this.getRawPath = function getRawPath(pathId) {\\n return this.pathMap[pathId].d;\\n };\\n\\n /**\\n * Scales the path to the given height and width.\\n * <h1>Use case</h1>\\n * <p>Use case is to scale the content of elements (event, gateways) based\\n * on the element bounding box's size.\\n * </p>\\n * <h1>Why not transform</h1>\\n * <p>Scaling a path with transform() will also scale the stroke and IE does not support\\n * the option 'non-scaling-stroke' to prevent this.\\n * Also there are use cases where only some parts of a path should be\\n * scaled.</p>\\n *\\n * @param {string} pathId The ID of the path.\\n * @param {Object} param <p>\\n * Example param object scales the path to 60% size of the container (data.width, data.height).\\n * <pre>\\n * {\\n * xScaleFactor: 0.6,\\n * yScaleFactor:0.6,\\n * containerWidth: data.width,\\n * containerHeight: data.height,\\n * position: {\\n * mx: 0.46,\\n * my: 0.2,\\n * }\\n * }\\n * </pre>\\n * <ul>\\n * <li>targetpathwidth = xScaleFactor * containerWidth</li>\\n * <li>targetpathheight = yScaleFactor * containerHeight</li>\\n * <li>Position is used to set the starting coordinate of the path. M is computed:\\n * <ul>\\n * <li>position.x * containerWidth</li>\\n * <li>position.y * containerHeight</li>\\n * </ul>\\n * Center of the container <pre> position: {\\n * mx: 0.5,\\n * my: 0.5,\\n * }</pre>\\n * Upper left corner of the container\\n * <pre> position: {\\n * mx: 0.0,\\n * my: 0.0,\\n * }</pre>\\n * </li>\\n * </ul>\\n * </p>\\n *\\n */\\n this.getScaledPath = function getScaledPath(pathId, param) {\\n var rawPath = this.pathMap[pathId];\\n\\n // positioning\\n // compute the start point of the path\\n var mx, my;\\n\\n if (param.abspos) {\\n mx = param.abspos.x;\\n my = param.abspos.y;\\n } else {\\n mx = param.containerWidth * param.position.mx;\\n my = param.containerHeight * param.position.my;\\n }\\n\\n var coordinates = {}; // map for the scaled coordinates\\n if (param.position) {\\n\\n // path\\n var heightRatio = (param.containerHeight / rawPath.height) * param.yScaleFactor;\\n var widthRatio = (param.containerWidth / rawPath.width) * param.xScaleFactor;\\n\\n\\n // Apply height ratio\\n for (var heightIndex = 0; heightIndex < rawPath.heightElements.length; heightIndex++) {\\n coordinates['y' + heightIndex] = rawPath.heightElements[heightIndex] * heightRatio;\\n }\\n\\n // Apply width ratio\\n for (var widthIndex = 0; widthIndex < rawPath.widthElements.length; widthIndex++) {\\n coordinates['x' + widthIndex] = rawPath.widthElements[widthIndex] * widthRatio;\\n }\\n }\\n\\n // Apply value to raw path\\n var path = format$1(\\n rawPath.d, {\\n mx: mx,\\n my: my,\\n e: coordinates\\n }\\n );\\n return path;\\n };\\n}\",\n \"function addMapping(router, mapping) {\\n for (let url in mapping.default) {\\n if (url.startsWith('GET ')) {\\n var path = url.substring(4);\\n router.get(path, mapping[url]);\\n console.log(`register URL mapping: GET ${path}`);\\n\\n } else if (url.startsWith('POST ')) {\\n var path = url.substring(5);\\n router.post(path, mapping[url]);\\n console.log(`register URL mapping: POST ${path}`);\\n\\n } else if (url.startsWith('PUT ')) {\\n var path = url.substring(4);\\n router.put(path, mapping[url]);\\n console.log(`register URL mapping: PUT ${path}`);\\n\\n } else if (url.startsWith('DELETE ')) {\\n var path = url.substring(7);\\n router.del(path, mapping[url]);\\n console.log(`register URL mapping: DELETE ${path}`);\\n\\n } else {\\n console.log(`invalid URL: ${url}`);\\n }\\n }\\n}\",\n \"function PathMap() {\\n /**\\n * Contains a map of path elements\\n *\\n * <h1>Path definition</h1>\\n * A parameterized path is defined like this:\\n * <pre>\\n * 'GATEWAY_PARALLEL': {\\n * d: 'm {mx},{my} {e.x0},0 0,{e.x1} {e.x1},0 0,{e.y0} -{e.x1},0 0,{e.y1} ' +\\n '-{e.x0},0 0,-{e.y1} -{e.x1},0 0,-{e.y0} {e.x1},0 z',\\n * height: 17.5,\\n * width: 17.5,\\n * heightElements: [2.5, 7.5],\\n * widthElements: [2.5, 7.5]\\n * }\\n * </pre>\\n * <p>It's important to specify a correct <b>height and width</b> for the path as the scaling\\n * is based on the ratio between the specified height and width in this object and the\\n * height and width that is set as scale target (Note x,y coordinates will be scaled with\\n * individual ratios).</p>\\n * <p>The '<b>heightElements</b>' and '<b>widthElements</b>' array must contain the values that will be scaled.\\n * The scaling is based on the computed ratios.\\n * Coordinates on the y axis should be in the <b>heightElement</b>'s array, they will be scaled using\\n * the computed ratio coefficient.\\n * In the parameterized path the scaled values can be accessed through the 'e' object in {} brackets.\\n * <ul>\\n * <li>The values for the y axis can be accessed in the path string using {e.y0}, {e.y1}, ....</li>\\n * <li>The values for the x axis can be accessed in the path string using {e.x0}, {e.x1}, ....</li>\\n * </ul>\\n * The numbers x0, x1 respectively y0, y1, ... map to the corresponding array index.\\n * </p>\\n */\\n this.pathMap = {\\n 'EVENT_MESSAGE': {\\n d: 'm {mx},{my} l 0,{e.y1} l {e.x1},0 l 0,-{e.y1} z l {e.x0},{e.y0} l {e.x0},-{e.y0}',\\n height: 36,\\n width: 36,\\n heightElements: [6, 14],\\n widthElements: [10.5, 21]\\n },\\n 'EVENT_SIGNAL': {\\n d: 'M {mx},{my} l {e.x0},{e.y0} l -{e.x1},0 Z',\\n height: 36,\\n width: 36,\\n heightElements: [18],\\n widthElements: [10, 20]\\n },\\n 'EVENT_ESCALATION': {\\n d: 'M {mx},{my} l {e.x0},{e.y0} l -{e.x0},-{e.y1} l -{e.x0},{e.y1} Z',\\n height: 36,\\n width: 36,\\n heightElements: [20, 7],\\n widthElements: [8]\\n },\\n 'EVENT_CONDITIONAL': {\\n d: 'M {e.x0},{e.y0} l {e.x1},0 l 0,{e.y2} l -{e.x1},0 Z ' +\\n 'M {e.x2},{e.y3} l {e.x0},0 ' +\\n 'M {e.x2},{e.y4} l {e.x0},0 ' +\\n 'M {e.x2},{e.y5} l {e.x0},0 ' +\\n 'M {e.x2},{e.y6} l {e.x0},0 ' +\\n 'M {e.x2},{e.y7} l {e.x0},0 ' +\\n 'M {e.x2},{e.y8} l {e.x0},0 ',\\n height: 36,\\n width: 36,\\n heightElements: [8.5, 14.5, 18, 11.5, 14.5, 17.5, 20.5, 23.5, 26.5],\\n widthElements: [10.5, 14.5, 12.5]\\n },\\n 'EVENT_LINK': {\\n d: 'm {mx},{my} 0,{e.y0} -{e.x1},0 0,{e.y1} {e.x1},0 0,{e.y0} {e.x0},-{e.y2} -{e.x0},-{e.y2} z',\\n height: 36,\\n width: 36,\\n heightElements: [4.4375, 6.75, 7.8125],\\n widthElements: [9.84375, 13.5]\\n },\\n 'EVENT_ERROR': {\\n d: 'm {mx},{my} {e.x0},-{e.y0} {e.x1},-{e.y1} {e.x2},{e.y2} {e.x3},-{e.y3} -{e.x4},{e.y4} -{e.x5},-{e.y5} z',\\n height: 36,\\n width: 36,\\n heightElements: [0.023, 8.737, 8.151, 16.564, 10.591, 8.714],\\n widthElements: [0.085, 6.672, 6.97, 4.273, 5.337, 6.636]\\n },\\n 'EVENT_CANCEL_45': {\\n d: 'm {mx},{my} -{e.x1},0 0,{e.x0} {e.x1},0 0,{e.y1} {e.x0},0 ' +\\n '0,-{e.y1} {e.x1},0 0,-{e.y0} -{e.x1},0 0,-{e.y1} -{e.x0},0 z',\\n height: 36,\\n width: 36,\\n heightElements: [4.75, 8.5],\\n widthElements: [4.75, 8.5]\\n },\\n 'EVENT_COMPENSATION': {\\n d: 'm {mx},{my} {e.x0},-{e.y0} 0,{e.y1} z m {e.x1},-{e.y2} {e.x2},-{e.y3} 0,{e.y1} -{e.x2},-{e.y3} z',\\n height: 36,\\n width: 36,\\n heightElements: [6.5, 13, 0.4, 6.1],\\n widthElements: [9, 9.3, 8.7]\\n },\\n 'EVENT_TIMER_WH': {\\n d: 'M {mx},{my} l {e.x0},-{e.y0} m -{e.x0},{e.y0} l {e.x1},{e.y1} ',\\n height: 36,\\n width: 36,\\n heightElements: [10, 2],\\n widthElements: [3, 7]\\n },\\n 'EVENT_TIMER_LINE': {\\n d: 'M {mx},{my} ' +\\n 'm {e.x0},{e.y0} l -{e.x1},{e.y1} ',\\n height: 36,\\n width: 36,\\n heightElements: [10, 3],\\n widthElements: [0, 0]\\n },\\n 'EVENT_MULTIPLE': {\\n d: 'm {mx},{my} {e.x1},-{e.y0} {e.x1},{e.y0} -{e.x0},{e.y1} -{e.x2},0 z',\\n height: 36,\\n width: 36,\\n heightElements: [6.28099, 12.56199],\\n widthElements: [3.1405, 9.42149, 12.56198]\\n },\\n 'EVENT_PARALLEL_MULTIPLE': {\\n d: 'm {mx},{my} {e.x0},0 0,{e.y1} {e.x1},0 0,{e.y0} -{e.x1},0 0,{e.y1} ' +\\n '-{e.x0},0 0,-{e.y1} -{e.x1},0 0,-{e.y0} {e.x1},0 z',\\n height: 36,\\n width: 36,\\n heightElements: [2.56228, 7.68683],\\n widthElements: [2.56228, 7.68683]\\n },\\n 'GATEWAY_EXCLUSIVE': {\\n d: 'm {mx},{my} {e.x0},{e.y0} {e.x1},{e.y0} {e.x2},0 {e.x4},{e.y2} ' +\\n '{e.x4},{e.y1} {e.x2},0 {e.x1},{e.y3} {e.x0},{e.y3} ' +\\n '{e.x3},0 {e.x5},{e.y1} {e.x5},{e.y2} {e.x3},0 z',\\n height: 17.5,\\n width: 17.5,\\n heightElements: [8.5, 6.5312, -6.5312, -8.5],\\n widthElements: [6.5, -6.5, 3, -3, 5, -5]\\n },\\n 'GATEWAY_PARALLEL': {\\n d: 'm {mx},{my} 0,{e.y1} -{e.x1},0 0,{e.y0} {e.x1},0 0,{e.y1} {e.x0},0 ' +\\n '0,-{e.y1} {e.x1},0 0,-{e.y0} -{e.x1},0 0,-{e.y1} -{e.x0},0 z',\\n height: 30,\\n width: 30,\\n heightElements: [5, 12.5],\\n widthElements: [5, 12.5]\\n },\\n 'GATEWAY_EVENT_BASED': {\\n d: 'm {mx},{my} {e.x0},{e.y0} {e.x0},{e.y1} {e.x1},{e.y2} {e.x2},0 z',\\n height: 11,\\n width: 11,\\n heightElements: [-6, 6, 12, -12],\\n widthElements: [9, -3, -12]\\n },\\n 'GATEWAY_COMPLEX': {\\n d: 'm {mx},{my} 0,{e.y0} -{e.x0},-{e.y1} -{e.x1},{e.y2} {e.x0},{e.y1} -{e.x2},0 0,{e.y3} ' +\\n '{e.x2},0 -{e.x0},{e.y1} l {e.x1},{e.y2} {e.x0},-{e.y1} 0,{e.y0} {e.x3},0 0,-{e.y0} {e.x0},{e.y1} ' +\\n '{e.x1},-{e.y2} -{e.x0},-{e.y1} {e.x2},0 0,-{e.y3} -{e.x2},0 {e.x0},-{e.y1} -{e.x1},-{e.y2} ' +\\n '-{e.x0},{e.y1} 0,-{e.y0} -{e.x3},0 z',\\n height: 17.125,\\n width: 17.125,\\n heightElements: [4.875, 3.4375, 2.125, 3],\\n widthElements: [3.4375, 2.125, 4.875, 3]\\n },\\n 'DATA_OBJECT_PATH': {\\n d: 'm 0,0 {e.x1},0 {e.x0},{e.y0} 0,{e.y1} -{e.x2},0 0,-{e.y2} {e.x1},0 0,{e.y0} {e.x0},0',\\n height: 61,\\n width: 51,\\n heightElements: [10, 50, 60],\\n widthElements: [10, 40, 50, 60]\\n },\\n 'DATA_OBJECT_COLLECTION_PATH': {\\n d: 'm {mx}, {my} ' +\\n 'm 0 15 l 0 -15 ' +\\n 'm 4 15 l 0 -15 ' +\\n 'm 4 15 l 0 -15 ',\\n height: 61,\\n width: 51,\\n heightElements: [12],\\n widthElements: [1, 6, 12, 15]\\n },\\n 'DATA_ARROW': {\\n d: 'm 5,9 9,0 0,-3 5,5 -5,5 0,-3 -9,0 z',\\n height: 61,\\n width: 51,\\n heightElements: [],\\n widthElements: []\\n },\\n 'DATA_STORE': {\\n d: 'm {mx},{my} ' +\\n 'l 0,{e.y2} ' +\\n 'c {e.x0},{e.y1} {e.x1},{e.y1} {e.x2},0 ' +\\n 'l 0,-{e.y2} ' +\\n 'c -{e.x0},-{e.y1} -{e.x1},-{e.y1} -{e.x2},0' +\\n 'c {e.x0},{e.y1} {e.x1},{e.y1} {e.x2},0 ' +\\n 'm -{e.x2},{e.y0}' +\\n 'c {e.x0},{e.y1} {e.x1},{e.y1} {e.x2},0' +\\n 'm -{e.x2},{e.y0}' +\\n 'c {e.x0},{e.y1} {e.x1},{e.y1} {e.x2},0',\\n height: 61,\\n width: 61,\\n heightElements: [7, 10, 45],\\n widthElements: [2, 58, 60]\\n },\\n 'TEXT_ANNOTATION': {\\n d: 'm {mx}, {my} m 10,0 l -10,0 l 0,{e.y0} l 10,0',\\n height: 30,\\n width: 10,\\n heightElements: [30],\\n widthElements: [10]\\n },\\n 'MARKER_SUB_PROCESS': {\\n d: 'm{mx},{my} m 7,2 l 0,10 m -5,-5 l 10,0',\\n height: 10,\\n width: 10,\\n heightElements: [],\\n widthElements: []\\n },\\n 'MARKER_PARALLEL': {\\n d: 'm{mx},{my} m 3,2 l 0,10 m 3,-10 l 0,10 m 3,-10 l 0,10',\\n height: 10,\\n width: 10,\\n heightElements: [],\\n widthElements: []\\n },\\n 'MARKER_SEQUENTIAL': {\\n d: 'm{mx},{my} m 0,3 l 10,0 m -10,3 l 10,0 m -10,3 l 10,0',\\n height: 10,\\n width: 10,\\n heightElements: [],\\n widthElements: []\\n },\\n 'MARKER_COMPENSATION': {\\n d: 'm {mx},{my} 7,-5 0,10 z m 7.1,-0.3 6.9,-4.7 0,10 -6.9,-4.7 z',\\n height: 10,\\n width: 21,\\n heightElements: [],\\n widthElements: []\\n },\\n 'MARKER_LOOP': {\\n d: 'm {mx},{my} c 3.526979,0 6.386161,-2.829858 6.386161,-6.320661 0,-3.490806 -2.859182,-6.320661 ' +\\n '-6.386161,-6.320661 -3.526978,0 -6.38616,2.829855 -6.38616,6.320661 0,1.745402 ' +\\n '0.714797,3.325567 1.870463,4.469381 0.577834,0.571908 1.265885,1.034728 2.029916,1.35457 ' +\\n 'l -0.718163,-3.909793 m 0.718163,3.909793 -3.885211,0.802902',\\n height: 13.9,\\n width: 13.7,\\n heightElements: [],\\n widthElements: []\\n },\\n 'MARKER_ADHOC': {\\n d: 'm {mx},{my} m 0.84461,2.64411 c 1.05533,-1.23780996 2.64337,-2.07882 4.29653,-1.97997996 2.05163,0.0805 ' +\\n '3.85579,1.15803 5.76082,1.79107 1.06385,0.34139996 2.24454,0.1438 3.18759,-0.43767 0.61743,-0.33642 ' +\\n '1.2775,-0.64078 1.7542,-1.17511 0,0.56023 0,1.12046 0,1.6807 -0.98706,0.96237996 -2.29792,1.62393996 ' +\\n '-3.6918,1.66181996 -1.24459,0.0927 -2.46671,-0.2491 -3.59505,-0.74812 -1.35789,-0.55965 ' +\\n '-2.75133,-1.33436996 -4.27027,-1.18121996 -1.37741,0.14601 -2.41842,1.13685996 -3.44288,1.96782996 z',\\n height: 4,\\n width: 15,\\n heightElements: [],\\n widthElements: []\\n },\\n 'TASK_TYPE_SEND': {\\n d: 'm {mx},{my} l 0,{e.y1} l {e.x1},0 l 0,-{e.y1} z l {e.x0},{e.y0} l {e.x0},-{e.y0}',\\n height: 14,\\n width: 21,\\n heightElements: [6, 14],\\n widthElements: [10.5, 21]\\n },\\n 'TASK_TYPE_SCRIPT': {\\n d: 'm {mx},{my} c 9.966553,-6.27276 -8.000926,-7.91932 2.968968,-14.938 l -8.802728,0 ' +\\n 'c -10.969894,7.01868 6.997585,8.66524 -2.968967,14.938 z ' +\\n 'm -7,-12 l 5,0 ' +\\n 'm -4.5,3 l 4.5,0 ' +\\n 'm -3,3 l 5,0' +\\n 'm -4,3 l 5,0',\\n height: 15,\\n width: 12.6,\\n heightElements: [6, 14],\\n widthElements: [10.5, 21]\\n },\\n 'TASK_TYPE_USER_1': {\\n d: 'm {mx},{my} c 0.909,-0.845 1.594,-2.049 1.594,-3.385 0,-2.554 -1.805,-4.62199999 ' +\\n '-4.357,-4.62199999 -2.55199998,0 -4.28799998,2.06799999 -4.28799998,4.62199999 0,1.348 ' +\\n '0.974,2.562 1.89599998,3.405 -0.52899998,0.187 -5.669,2.097 -5.794,4.7560005 v 6.718 ' +\\n 'h 17 v -6.718 c 0,-2.2980005 -5.5279996,-4.5950005 -6.0509996,-4.7760005 z' +\\n 'm -8,6 l 0,5.5 m 11,0 l 0,-5'\\n },\\n 'TASK_TYPE_USER_2': {\\n d: 'm {mx},{my} m 2.162,1.009 c 0,2.4470005 -2.158,4.4310005 -4.821,4.4310005 ' +\\n '-2.66499998,0 -4.822,-1.981 -4.822,-4.4310005 '\\n },\\n 'TASK_TYPE_USER_3': {\\n d: 'm {mx},{my} m -6.9,-3.80 c 0,0 2.25099998,-2.358 4.27399998,-1.177 2.024,1.181 4.221,1.537 ' +\\n '4.124,0.965 -0.098,-0.57 -0.117,-3.79099999 -4.191,-4.13599999 -3.57499998,0.001 ' +\\n '-4.20799998,3.36699999 -4.20699998,4.34799999 z'\\n },\\n 'TASK_TYPE_MANUAL': {\\n d: 'm {mx},{my} c 0.234,-0.01 5.604,0.008 8.029,0.004 0.808,0 1.271,-0.172 1.417,-0.752 0.227,-0.898 ' +\\n '-0.334,-1.314 -1.338,-1.316 -2.467,-0.01 -7.886,-0.004 -8.108,-0.004 -0.014,-0.079 0.016,-0.533 0,-0.61 ' +\\n '0.195,-0.042 8.507,0.006 9.616,0.002 0.877,-0.007 1.35,-0.438 1.353,-1.208 0.003,-0.768 -0.479,-1.09 ' +\\n '-1.35,-1.091 -2.968,-0.002 -9.619,-0.013 -9.619,-0.013 v -0.591 c 0,0 5.052,-0.016 7.225,-0.016 ' +\\n '0.888,-0.002 1.354,-0.416 1.351,-1.193 -0.006,-0.761 -0.492,-1.196 -1.361,-1.196 -3.473,-0.005 ' +\\n '-10.86,-0.003 -11.0829995,-0.003 -0.022,-0.047 -0.045,-0.094 -0.069,-0.139 0.3939995,-0.319 ' +\\n '2.0409995,-1.626 2.4149995,-2.017 0.469,-0.4870005 0.519,-1.1650005 0.162,-1.6040005 -0.414,-0.511 ' +\\n '-0.973,-0.5 -1.48,-0.236 -1.4609995,0.764 -6.5999995,3.6430005 -7.7329995,4.2710005 -0.9,0.499 ' +\\n '-1.516,1.253 -1.882,2.19 -0.37000002,0.95 -0.17,2.01 -0.166,2.979 0.004,0.718 -0.27300002,1.345 ' +\\n '-0.055,2.063 0.629,2.087 2.425,3.312 4.859,3.318 4.6179995,0.014 9.2379995,-0.139 13.8569995,-0.158 ' +\\n '0.755,-0.004 1.171,-0.301 1.182,-1.033 0.012,-0.754 -0.423,-0.969 -1.183,-0.973 -1.778,-0.01 ' +\\n '-5.824,-0.004 -6.04,-0.004 10e-4,-0.084 0.003,-0.586 10e-4,-0.67 z'\\n },\\n 'TASK_TYPE_INSTANTIATING_SEND': {\\n d: 'm {mx},{my} l 0,8.4 l 12.6,0 l 0,-8.4 z l 6.3,3.6 l 6.3,-3.6'\\n },\\n 'TASK_TYPE_SERVICE': {\\n d: 'm {mx},{my} v -1.71335 c 0.352326,-0.0705 0.703932,-0.17838 1.047628,-0.32133 ' +\\n '0.344416,-0.14465 0.665822,-0.32133 0.966377,-0.52145 l 1.19431,1.18005 1.567487,-1.57688 ' +\\n '-1.195028,-1.18014 c 0.403376,-0.61394 0.683079,-1.29908 0.825447,-2.01824 l 1.622133,-0.01 ' +\\n 'v -2.2196 l -1.636514,0.01 c -0.07333,-0.35153 -0.178319,-0.70024 -0.323564,-1.04372 ' +\\n '-0.145244,-0.34406 -0.321407,-0.6644 -0.522735,-0.96217 l 1.131035,-1.13631 -1.583305,-1.56293 ' +\\n '-1.129598,1.13589 c -0.614052,-0.40108 -1.302883,-0.68093 -2.022633,-0.82247 l 0.0093,-1.61852 ' +\\n 'h -2.241173 l 0.0042,1.63124 c -0.353763,0.0736 -0.705369,0.17977 -1.049785,0.32371 -0.344415,0.14437 ' +\\n '-0.665102,0.32092 -0.9635006,0.52046 l -1.1698628,-1.15823 -1.5667691,1.5792 1.1684265,1.15669 ' +\\n 'c -0.4026573,0.61283 -0.68308,1.29797 -0.8247287,2.01713 l -1.6588041,0.003 v 2.22174 ' +\\n 'l 1.6724648,-0.006 c 0.073327,0.35077 0.1797598,0.70243 0.3242851,1.04472 0.1452428,0.34448 ' +\\n '0.3214064,0.6644 0.5227339,0.96066 l -1.1993431,1.19723 1.5840256,1.56011 1.1964668,-1.19348 ' +\\n 'c 0.6140517,0.40346 1.3028827,0.68232 2.0233517,0.82331 l 7.19e-4,1.69892 h 2.226848 z ' +\\n 'm 0.221462,-3.9957 c -1.788948,0.7502 -3.8576,-0.0928 -4.6097055,-1.87438 -0.7521065,-1.78321 ' +\\n '0.090598,-3.84627 1.8802645,-4.59604 1.78823,-0.74936 3.856881,0.0929 4.608987,1.87437 ' +\\n '0.752106,1.78165 -0.0906,3.84612 -1.879546,4.59605 z'\\n },\\n 'TASK_TYPE_SERVICE_FILL': {\\n d: 'm {mx},{my} c -1.788948,0.7502 -3.8576,-0.0928 -4.6097055,-1.87438 -0.7521065,-1.78321 ' +\\n '0.090598,-3.84627 1.8802645,-4.59604 1.78823,-0.74936 3.856881,0.0929 4.608987,1.87437 ' +\\n '0.752106,1.78165 -0.0906,3.84612 -1.879546,4.59605 z'\\n },\\n 'TASK_TYPE_BUSINESS_RULE_HEADER': {\\n d: 'm {mx},{my} 0,4 20,0 0,-4 z'\\n },\\n 'TASK_TYPE_BUSINESS_RULE_MAIN': {\\n d: 'm {mx},{my} 0,12 20,0 0,-12 z' +\\n 'm 0,8 l 20,0 ' +\\n 'm -13,-4 l 0,8'\\n },\\n 'MESSAGE_FLOW_MARKER': {\\n d: 'm {mx},{my} m -10.5 ,-7 l 0,14 l 21,0 l 0,-14 z l 10.5,6 l 10.5,-6'\\n }\\n };\\n this.getRawPath = function getRawPath(pathId) {\\n return this.pathMap[pathId].d;\\n };\\n /**\\n * Scales the path to the given height and width.\\n * <h1>Use case</h1>\\n * <p>Use case is to scale the content of elements (event, gateways) based\\n * on the element bounding box's size.\\n * </p>\\n * <h1>Why not transform</h1>\\n * <p>Scaling a path with transform() will also scale the stroke and IE does not support\\n * the option 'non-scaling-stroke' to prevent this.\\n * Also there are use cases where only some parts of a path should be\\n * scaled.</p>\\n *\\n * @param {String} pathId The ID of the path.\\n * @param {Object} param <p>\\n * Example param object scales the path to 60% size of the container (data.width, data.height).\\n * <pre>\\n * {\\n * xScaleFactor: 0.6,\\n * yScaleFactor:0.6,\\n * containerWidth: data.width,\\n * containerHeight: data.height,\\n * position: {\\n * mx: 0.46,\\n * my: 0.2,\\n * }\\n * }\\n * </pre>\\n * <ul>\\n * <li>targetpathwidth = xScaleFactor * containerWidth</li>\\n * <li>targetpathheight = yScaleFactor * containerHeight</li>\\n * <li>Position is used to set the starting coordinate of the path. M is computed:\\n * <ul>\\n * <li>position.x * containerWidth</li>\\n * <li>position.y * containerHeight</li>\\n * </ul>\\n * Center of the container <pre> position: {\\n * mx: 0.5,\\n * my: 0.5,\\n * }</pre>\\n * Upper left corner of the container\\n * <pre> position: {\\n * mx: 0.0,\\n * my: 0.0,\\n * }</pre>\\n * </li>\\n * </ul>\\n * </p>\\n *\\n */\\n this.getScaledPath = function getScaledPath(pathId, param) {\\n var rawPath = this.pathMap[pathId];\\n // positioning\\n // compute the start point of the path\\n var mx, my;\\n if (param.abspos) {\\n mx = param.abspos.x;\\n my = param.abspos.y;\\n }\\n else {\\n mx = param.containerWidth * param.position.mx;\\n my = param.containerHeight * param.position.my;\\n }\\n var coordinates = {}; // map for the scaled coordinates\\n if (param.position) {\\n // path\\n var heightRatio = (param.containerHeight / rawPath.height) * param.yScaleFactor;\\n var widthRatio = (param.containerWidth / rawPath.width) * param.xScaleFactor;\\n // Apply height ratio\\n for (var heightIndex = 0; heightIndex < rawPath.heightElements.length; heightIndex++) {\\n coordinates['y' + heightIndex] = rawPath.heightElements[heightIndex] * heightRatio;\\n }\\n // Apply width ratio\\n for (var widthIndex = 0; widthIndex < rawPath.widthElements.length; widthIndex++) {\\n coordinates['x' + widthIndex] = rawPath.widthElements[widthIndex] * widthRatio;\\n }\\n }\\n // Apply value to raw path\\n var path = format(rawPath.d, {\\n mx: mx,\\n my: my,\\n e: coordinates\\n });\\n return path;\\n };\\n}\",\n \"static rmap(context) {\\n return Pierce.dimap(context).call(Hask.id(context));\\n }\",\n \"function map(n, d1, d2, r1, r2) {\\r\\n\\tvar Rd = d2-d1;\\r\\n\\tvar Rr = r2-r1;\\r\\n\\treturn (Rr/Rd)*(n - d1) + r1;\\r\\n}\",\n \"function map(n, d1, d2, r1, r2) {\\r\\n\\tvar Rd = d2-d1;\\r\\n\\tvar Rr = r2-r1;\\r\\n\\treturn (Rr/Rd)*(n - d1) + r1;\\r\\n}\",\n \"function mapTest() {\\n return \\\"Hello\\\"\\n}\",\n \"function mapa2(){\\n // Crea un arreglo con los nodos visitados hasta ahora.\\n var nodes = [\\n \\n {id: 1, label: 'Brasil'},\\n {id: 2, label: 'Finlandia'},\\n\\n ];\\n\\n // Crea un arreglo con las conexiones entre los nodos.\\n var edges = [\\n {from: 1, to: 2},\\n ];\\n // Crea un arreglo con los nodos activos.\\n var activeNode = [ 2 ];\\n mapa( nodes, edges, activeNode );\\n }\",\n \"get Mipmaps() {}\",\n \"function map(stats) {\\n return stats.path;\\n}\",\n \"handleMapLoad(map) {\\n }\",\n \"function sc_map(proc, l1) {\\n if (l1 === undefined)\\n\\treturn null;\\n // else\\n var nbApplyArgs = arguments.length - 1;\\n var applyArgs = new Array(nbApplyArgs);\\n var revres = null;\\n while (l1 !== null) {\\n\\tfor (var i = 0; i < nbApplyArgs; i++) {\\n\\t applyArgs[i] = arguments[i + 1].car;\\n\\t arguments[i + 1] = arguments[i + 1].cdr;\\n\\t}\\n\\trevres = sc_cons(proc.apply(null, applyArgs), revres);\\n }\\n return sc_reverseAppendBang(revres, null);\\n}\",\n \"map(route) {\\r\\n if (Array.isArray(route)) {\\r\\n route.forEach(r => this.map(r));\\r\\n return this;\\r\\n }\\r\\n return this.mapRoute(route);\\r\\n }\",\n \"function WoWMapProjection(){}\",\n \"function mapPath(i) {\\n return pArr[i];\\n }\",\n \"function i(e,t){return(0,u.default)(t).map(function(n){var r=t[n];return(0,l.default)(r)?{name:n,direction:e,fn:r}:(0,o.default)({name:n},r)})}\",\n \"function map$4(f, param) {\\n return /* Dual */[_1(f, param[0])];\\n }\",\n \"function routeMap(routePath) {\\n return \\\"https://maps.googleapis.com/maps/api/staticmap?path=color:0x0000ff|weight:5\\\"+\\n routePath + \\\"&size=400x400&key=AIzaSyAH-KSfz-462dVd84424pUVWa7vO2RgfAs\\\";\\n}\",\n \"constructor(maps = [], mirror, from2 = 0, to = maps.length) {\\n this.maps = maps;\\n this.mirror = mirror;\\n this.from = from2;\\n this.to = to;\\n }\",\n \"function elaborateRoute(map, legs, polyline, bounds, markers,\\n contentStrings, totExcitement, alg){\\n if(alg==0) return elaborateDH(map, legs, polyline, bounds,\\n markers, contentStrings, totExcitement);\\n else if(alg==1) return elaborateNumSections(map, legs,\\n polyline, bounds, markers, contentStrings, totExcitement);\\n}\",\n \"function main() {\\n getRoutes();\\n}\",\n \"map_system() {\\n\\t\\t// First 8K of RAM\\n\\t\\tthis.map_loram(0x00, 0x3F, 0x0000, 0x1FFF, 0);\\n\\t\\t// PPU regs\\n\\t\\tthis.map_kind(0x00, 0x3F, 0x2000, 0x3FFF, 0x2000, MAP_TI.PPU);\\n\\t\\t// CPU regs\\n\\t\\tthis.map_kind(0x00, 0x3F, 0x4000, 0x5FFF, 0x4000, MAP_TI.CPU);\\n\\t\\t// All of this mirrored again at 0x80\\n\\t\\tthis.map_loram(0x80, 0xBF, 0x00, 0x1FFF, 0);\\n\\t\\tthis.map_kind(0x80, 0xBF, 0x2000, 0x3FFF, 0x2000, MAP_TI.PPU);\\n\\t\\tthis.map_kind(0x80, 0xBF, 0x4000, 0x5FFF, 0x4000, MAP_TI.CPU);\\n\\t}\",\n \"static lmap(context) {\\n return new Hask(function(sa) {\\n return Pierce.dimap(context).call(sa).call(Hask.id(context));\\n });\\n }\",\n \"_map(inputStart, inputEnd, outputStart, outputEnd, input) {\\n return outputStart + ((outputEnd - outputStart) / (inputEnd - inputStart)) * (input - inputStart);\\n }\",\n \"set Mipmaps(value) {}\",\n \"function LangMap() {}\",\n \"function LangMap() {}\",\n \"function send_route_map(stops) {\\n //create routes include many stop\\n if(stops.length==1) return\\n var mode = stops[1].mode\\n route_mode[\\\"route1\\\"]=mode;\\n //console.log(mode)\\n var start = 1,\\n route_index = 1;\\n if(stops.length==2){\\n routeArray[\\\"route1\\\"]=[]\\n routeArray[\\\"route1\\\"].push(stops[1])\\n stops[1][\\\"route_index\\\"]=1\\n }\\n while (start < stops.length) {\\n routeArray[\\\"route\\\" + route_index]=[]\\n for (var i = start; i < stops.length; i++) {\\n //add stop to route\\n if (stops[i].mode != mode) {\\n start = i\\n mode = stops[i].mode\\n route_mode[\\\"route\\\"+(route_index+1)]=mode;\\n\\n //next route\\n break\\n }\\n stops[i][\\\"route_index\\\"]=route_index\\n routeArray[\\\"route\\\" + route_index].push({\\n \\\"lat\\\": stops[i].lat,\\n \\\"lng\\\": stops[i].lng\\n });\\n\\n //increase start route\\n start = i + 1\\n //console.log(start)\\n\\n }\\n \\n route_index++ \\n \\n\\n }\\n //console.log(route_index);\\n console.log(route_mode);\\n //add route mode last\\n //route_mode[\\\"route\\\"+(route_index-1)]\\n // console.log()\\n stops[0][\\\"route_index\\\"]=1\\n routeArray[\\\"route1\\\"].unshift({\\n \\\"lat\\\": stops[0].lat,\\n \\\"lng\\\": stops[0].lng\\n }); \\n console.log(routeArray); \\n }\",\n \"mapToPath() {\\n Path.mapMin1 = this.params.mapMin1;\\n Path.mapMax1 = this.params.mapMax1;\\n Path.mapMin2 = this.params.mapMin2;\\n Path.mapMax2 = this.params.mapMax2;\\n }\",\n \"getRoutingNames() {\\n\\n }\",\n \"function map(a,b,c,d,e){return(a-b)/(c-b)*(e-d)+d}\",\n \"function z(a){function b(b,c){this.tgt=a.getTgt(b,c)}\\n// Simple map declared as function\\nreturn Z(a)&&(a={getTgt:a}),a.baseMap&&(a=j(j({},a.baseMap),a)),a.map=function(a,c){return new b(a,c)},a}\",\n \"function map(value,\\n istart, istop,\\n ostart, ostop) {\\n return ostart + (ostop - ostart) * ((value - istart) / (istop - istart));\\n}\",\n \"function initMap() {\\n}\",\n \"map(value, istart, istop, ostart, ostop) {\\n\\t\\treturn ostart + (ostop - ostart) * ((value - istart) / (istop - istart));\\n\\t}\",\n \"function modify()\\r{\\r\\tvar entry = getindex(arguments[0]);\\r\\tvar args = new Array();\\r\\tfor(var i=1; i<arguments.length; i++){\\r\\t\\targs[i-1] = arguments[i];\\r\\t}\\r\\toutlet(0, \\\"script\\\", \\\"send\\\", \\\"mapping_object_alg_\\\"+entry, args);\\r}\",\n \"function processRoute (data){\\n console.log(\\\"reitti: \\\", data);\\n var segments = data.routes[0].segments;\\n segmentNames.length = 0;\\n segmentKind.length = 0;\\n\\tsegmentDuration.length = 0;\\n \\n $.each(segments, function(index, value){\\n processSegments(value);\\n });\\n printRoute();\\n preparePolyline(data);\\n initMap();\\n}\",\n \"function init() {\\n\\n var mapOptions = {\\n // center: locations[0],\\n zoom: 4,\\n mapTypeId: google.maps.MapTypeId.ROADMAP\\n };\\n map = new google.maps.Map(document.getElementById('dvMap'), mapOptions);\\n // calcRoute(msg);\\n // calcRoute(m);\\n // calcRoute(ms);\\n\\n\\n for(i = 0; i < to_loc.length; i++) {\\n \\tvar lol = new Array();\\n \\tlol[0] = from_loc[i];\\n \\tlol[1] = to_loc[i];\\n \\tcalcRoute(lol);\\n }\\n\\n}\",\n \"mapValue(value){\\r\\n var map={\\r\\n 8: 1, 7: 2, 6: 3, 5: 4, 4: 5, 3: 6, 2: 7, 1: 8,\\r\\n \\\"h\\\":\\\"a\\\", \\\"g\\\":\\\"b\\\", \\\"f\\\":\\\"c\\\", \\\"e\\\":\\\"d\\\", \\\"d\\\":\\\"e\\\", \\\"c\\\":\\\"f\\\", \\\"b\\\":\\\"g\\\", \\\"a\\\":\\\"h\\\"\\r\\n }\\r\\n return(map[value])\\r\\n }\",\n \"function goMap(map_num){\\n \\n var file_name;\\n \\n switch (map_num){\\n \\n //assign parameters for respective page\\n \\n case 0:\\n file_name = 'signup2.html';\\n var params = new Array(file_name);\\n params[file_name] = new Array();\\n params[file_name][0] = 'name';\\n params[file_name][1] = 'email';\\n params[file_name][2] = 'phone';\\n params[file_name][3] = 'password';\\n return params;\\n \\n case 1:\\n file_name = 'credit_card.html';\\n var params = new Array(file_name);\\n params[file_name] = new Array();\\n params[file_name][0] = 'address';\\n params[file_name][1] = 'address2';\\n params[file_name][2] = 'zip';\\n return params;\\n \\n \\n case 3:\\n file_name = 'sign_in.html';\\n var params = new Array(file_name);\\n params[file_name] = new Array();\\n params[file_name][0] = 'email';\\n params[file_name][1] = 'password';\\n return params;\\n \\n }\\n \\n}\",\n \"function summonCaptainPlanet() {\\r\\n\\tconsole.log(map)\\r\\n}\",\n \"function getRaresMap() {\\n var map = {};\\n var lines = require('fs').readFileSync(__dirname+'/wallabee_rares.dat').toString().split(/\\\\r?\\\\n/);\\n for (var i in lines) {\\n var parts = lines[i].split(/\\\\|/);\\n parts[1] = parseInt(parts[1]);\\n map[parts[0]] = parts;\\n }\\n return map;\\n}\",\n \"function myMap(arr, cb) {\\n // enter your code here\\n}\",\n \"function MapTable() {\\r\\n}\",\n \"static mapStops(direction) {\\n const out = new Map();\\n const stops =\\n direction === \\\"North\\\"\\n ? caltrainServiceData.northStops\\n : caltrainServiceData.southStops;\\n for (let i = 0; i < stops.length; i++) {\\n out.set(stops[i], i);\\n }\\n return out;\\n }\",\n \"function create_map(name, code) {\\n var view = '\\\"' + name + '\\\": {' + '\\\\n';\\n view += '\\\"map\\\": \\\"' + escape(code) + '\\\"}';\\n return view;\\n}\",\n \"function getUserRouteMap(canonicalRoutes) {\\n return canonicalRoutes.reduce((mapping, route) => {\\n switch (route) {\\n case 'GS':\\n case 'FS':\\n case 'H': {\\n const newMap = { [route]: 'S' }\\n return Object.assign({}, mapping, newMap)\\n }\\n default: {\\n const newMap = { [route]: route }\\n return Object.assign({}, mapping, newMap)\\n }\\n }\\n }, {})\\n}\",\n \"function Mapping(){this.generatedLine=0;this.generatedColumn=0;this.source=null;this.originalLine=null;this.originalColumn=null;this.name=null;}\",\n \"function Routes(){\\n\\tthis.static = require('../../static/static')();\\n\\tthis.routes = new Map();\\n}\",\n \"function getPosMapping() {\\n\\tvar NOU = 0;\\n\\tvar PRO = 1;\\n\\tvar ADJ = 2;\\n\\tvar VER = 3;\\n\\tvar ADV = 4;\\n\\tvar PRE = 5;\\n\\tvar CON = 6;\\n\\tvar INT = 7;\\n\\tvar DET = 8;\\n\\tvar NUL = 9;\\n\\tvar posDict = {\\\"CC\\\":CON, \\\"CD\\\": NUL, \\\"DT\\\": DET, \\\"EX\\\": NUL, \\\"FW\\\": NUL,\\n\\t\\t\\t\\t\\t\\\"IN\\\": PRE, \\\"JJ\\\": ADJ, \\\"JJR\\\": ADJ, \\\"JJS\\\":ADJ,\\\"LS\\\":NUL,\\n\\t\\t\\t\\t\\t\\\"MD\\\":NUL, \\\"NN\\\":NOU, \\\"NNS\\\":NOU, \\\"NNP\\\":NOU,\\\"NNPS\\\":NOU,\\\"PDT\\\":NUL,\\\"POS\\\":NUL,\\\"PRP\\\":PRO,\\n\\t\\t\\t\\t\\t\\\"PRP$\\\":PRO,\\\"RB\\\":ADV,\\\"RBR\\\":ADV,\\\"RBS\\\":ADV,\\\"RP\\\":PRE,\\\"SYM\\\":NUL,\\\"TO\\\":PRE,\\\"UH\\\":INT,\\n\\t\\t\\t\\t\\t\\\"VB\\\":VER,\\\"VBD\\\":VER,\\\"VBG\\\":VER,\\\"VBN\\\":VER,\\\"VBP\\\":VER,\\\"VBZ\\\":VER,\\\"WDT\\\":DET,\\\"WP\\\":PRE,\\n\\t\\t\\t\\t\\t\\\"WP$\\\":PRE,\\\"WRB\\\":ADV};\\n\\treturn posDict;\\n}\",\n \"function mapa3(){\\n // Crea un arreglo con los nodos visitados hasta ahora.\\n var nodes = [\\n \\n {id: 1, label: 'Brasil'},\\n {id: 2, label: 'Finlandia'},\\n {id: 3, label: 'China'},\\n ];\\n\\n // Crea un arreglo con las conexiones entre los nodos.\\n var edges = [\\n {from: 1, to: 2},\\n {from: 2, to: 3},\\n\\n \\n\\n ];\\n // Crea un arreglo con los nodos activos.\\n var activeNode = [ 3 ];\\n mapa( nodes, edges, activeNode );\\n}\",\n \"function\\nmap0$fopr_2343_(a5x1)\\n{\\nlet xtmp57;\\n;\\n{\\nxtmp57 = a1x2(a5x1);\\n}\\n;\\nreturn xtmp57;\\n}\",\n \"constructor() {\\n // _routes will contain a mapping of HTTP method name ('GET', etc.) to an\\n // array of all the corresponding Route instances that are registered.\\n this._routes = new Map();\\n }\",\n \"function arpMapping(x, y, pageId) {\\n\\tconst coords = {\\n\\t\\t// midi 10\\n\\t\\t'200 50': {alias: 'rndarp_launchcontrol', chan: 7, cc_strict: 21, type: 'fader'},\\n\\n '25 50': {alias: 'gate_length', chan: 10, cc: 2, type: 'fader'},\\n\\t\\t'400 50': {alias: 'gaterate', chan: 10, cc: 3, type: '8step'},\\n\\n '50 500': {alias: 'attack', chan: 10, cc: 4, type: 'fader'},\\n '100 500': {alias: 'decay', chan: 10, cc: 5, type: 'fader'},\\n '150 500': {alias: 'sustain', chan: 10, cc: 6, type: 'fader'},\\n '200 500': {alias: 'release', chan: 10, cc: 7, type: 'fader'},\\n '300 525': {alias: 'volume', chan: 10, cc: 8, type: 'fader'},\\n\\n\\t\\t// midi 11\\n\\t\\t'0 250': {alias: 'pitchon', chan: 11, cc: 1, type: 'on_off'},\\n\\t\\t'400 200': {alias: 'pitchrate', chan: 11, cc: 2, type: '8step'},\\n\\t\\t'400 300': {alias: 'pitchsteps', chan: 11, cc: 3, type: '8step'},\\n\\t\\t'25 225': {alias: 'pitchhold', chan: 11, cc: 4, type: 'fader'},\\n\\t\\t'800 200': {alias: 'pitchdist', chan: 11, cc: 5, type: 'fader'},\\n\\t\\t'900 50': {alias: 'rnd', chan: 11, cc: 6, type: 'fader'},\\n\\t\\t'900 200': {alias: 'scale_scale', chan: 11, cc: 8, type: 'fader' },\\n\\t\\t'950 200': {alias: 'scale_choice', chan: 11, cc: 7, type: 'fader' },\\n\\t\\t'200 225': {alias: 'drop', chan: 11, cc: 9, type: 'fader'},\\n\\n\\t\\t// midi 12 + 13 as fallback\\n\\t\\t'500 500': {alias: 'delay_left', chan: 12, cc: 1, type: '8-2step'},\\n\\t\\t'500 600': {alias: 'delay_right', chan: 13, cc: 1, type: '8-2step'},\\n\\n\\t\\t'800 500': {alias: 'delayfb', chan: 12, cc: 2, type: 'fader'},\\n\\t\\t'850 500': {alias: 'link', chan: 13, cc: 3, type: 'on_off'},\\n\\t\\t'900 500': {alias: 'gain', chan: 13, cc: 2, type: 'fader'},\\n\\t\\t'950 500': {alias: 'delaymix', chan: 12, cc: 3, type: 'fader'}\\n\\t};\\n\\treturn coords[`${x} ${y}`];\\n}\",\n \"map(layout){\\n\\t\\tvar map = new Mapping(layout);\\n\\t\\treturn map.section();\\n\\t}\",\n \"function runRules(vmap, cmap, rmap, start, n) {\\n\\n var start_str = start;\\n var result = \\\"\\\";\\n\\n for (var j = 0; j < n; j++) {\\n for (var i = 0; i < start_str.length; i++) {\\n // No rule found\\n if (rmap[start_str[i]] == null) {\\n result += start_str[i];\\n } else {\\n result += rmap[start_str[i]];\\n }\\n }\\n start_str = result;\\n result = \\\"\\\";\\n }\\n\\n return start_str;\\n}\",\n \"function render() {\\n debugMap(map, 10, 20);\\n }\",\n \"['fantasy-land/map'](f) {\\n return this.map(f);\\n }\",\n \"function MapIterator() {}\",\n \"function init(){\\n basemap();\\n}\",\n \"match(route) {\\n //match route against dictionary of defined paths to their relevant attributes\\n for (let [path, {pathRoute, handler, params}] of this.routes) {\\n const match = pathRoute.exec(route);\\n //each route will be associated with a handler\\n //this handler will handle all of the rendering associated with a new change\\n if (match !== null) {\\n //remove the first / from the route\\n //loop through values and add each value with its associated parameter\\n const routeParams = match.slice(1).\\n reduce((allParams, value, index) => {\\n allParams[params[index]] = value;\\n return allParams;\\n }, {});\\n //split parameters using the ?varName=varVal \\n this.currentPath = path;\\n //check if we have any query parameters to parse\\n if (window.location.search) {\\n this.getQueryParameters(window.location.search, routeParams);\\n }\\n handler(route, routeParams);\\n //we don't want to execute more than route once we've matched one\\n //if it can match multiple ones so we break\\n break;\\n }\\n\\n }\\n }\",\n \"function generateSafeInternalRouteMap() {\\n const map = new Map();\\n for (const keyAsString in InternalRoute_1.default) {\\n const key = parseInt(keyAsString, 10);\\n // skipt enum literals, use only the numeric keys\\n if (isNaN(key) || !isFinite(key) || typeof key !== 'number') {\\n continue;\\n }\\n // generate a random hash for the URL and prepend a slash so the server can resolve it\\n let hash;\\n const ensureUnique = () => {\\n hash = generateRandomHash();\\n for (const value of map.values()) {\\n if (hash === value) {\\n ensureUnique();\\n return;\\n }\\n }\\n };\\n ensureUnique();\\n // actually update the hash\\n map.set(key, hash);\\n }\\n return map;\\n}\",\n \"function getMap() {\\n showJourneyMap();\\n}\",\n \"generateStops (routes, reRenderKey) {\\n return routes.map((route) => {\\n return route.stops.map((stop, i) => {\\n if (route.display) {\\n // const boundPress = this.props.fetchStopData.bind(this, stop.id, route.id)\\n const key = Platform.OS === 'ios' ? `${stop.id}-${reRenderKey}`: `${stop.id}`\\n return (\\n <MapView.Circle center={{latitude: stop.lat, longitude: stop.lng}} radius={stop.radius ? stop.radius : 10} zIndex={stop.zindex ? stop.zindex : 1} fillColor={stop.fillColor ? stop.fillColor: 'black'} strokeColor={route.routeColor}/>\\n ) \\n }\\n })\\n })\\n }\",\n \"function PhoneticMapper(map)\\n{\\n this.map = map;\\n}\",\n \"function testFunction(req, res) {\\n res.render('map-test');\\n\\n}\",\n \"function Mapping() {\\n this.generatedLine = 0\\n this.generatedColumn = 0\\n this.source = null\\n this.originalLine = null\\n this.originalColumn = null\\n this.name = null\\n}\",\n \"static match(map) {\\n let direct = Object.create(null);\\n for (let prop in map)\\n for (let name of prop.split(\\\" \\\"))\\n direct[name] = map[prop];\\n return (node) => {\\n for (let groups = node.prop(NodeProp.group), i = -1; i < (groups ? groups.length : 0); i++) {\\n let found = direct[i < 0 ? node.name : groups[i]];\\n if (found)\\n return found;\\n }\\n };\\n }\",\n \"_generateMap() {\\n // Generate all the empty tiles\\n var width = this.display.getOptions().width;\\n var height = this.display.getOptions().height;\\n for (let x = 0; x < width; x++) {\\n for (let y = 0; y < height; y++) {\\n let tile = new Tile(\\\"empty\\\", x, y);\\n let key = tile.getPositionKey();\\n this.map[key] = tile;\\n }\\n }\\n\\n // Next, use celluar automata to lay down the first layer of resources\\n // but make sure they meet the minimum bar\\n var sumIronTiles = 0;\\n while (sumIronTiles <= config.map.resources.iron.minTiles) {\\n var ironMap = new ROT.Map.Cellular(width, height, { connected: true});\\n // % chance to be iron\\n ironMap.randomize(config.map.resources.iron.baseChance);\\n // iterations smooth out and connect live tiles\\n for (let i = 0; i < config.map.resources.iron.generations; i++) {\\n ironMap.create();\\n }\\n // Check to ensure that we have a minimum number of iron tiles\\n sumIronTiles = ironMap._map.flat().reduce(doSum, 0);\\n }\\n\\n // Go through the map and change the tiles we touch to type \\\"iron\\\"\\n for (let x = 0; x < width; x++) {\\n for (let y = 0; y < height; y++) {\\n if (ironMap._map[x][y] == 1) {\\n let key = `${x},${y}`\\n let tile = this.map[key];\\n let resourceAmount = this._calculateResourceAmount(x, y, ironMap._map, \\\"iron\\\");\\n tile.addResources(\\\"iron\\\", resourceAmount);\\n }\\n }\\n }\\n\\n // Same for coal\\n var sumCoalTiles = 0;\\n while (sumCoalTiles <= config.map.resources.coal.minTiles) {\\n var coalMap = new ROT.Map.Cellular(width, height, { connected: true });\\n coalMap.randomize(config.map.resources.coal.baseChance);\\n for (let i = 0; i< config.map.resources.coal.generations; i++) {\\n coalMap.create();\\n }\\n sumCoalTiles = coalMap._map.flat().reduce(doSum, 0);\\n }\\n\\n // Change tiles to \\\"coal\\\", but only if they're empty!\\n for (let x = 0; x < width; x++) {\\n for (let y = 0; y < height; y++) {\\n if (coalMap._map[x][y] == 1) {\\n let key = `${x},${y}`\\n let tile = this.map[key];\\n if (tile.tileType == \\\"empty\\\") {\\n let resourceAmount = this._calculateResourceAmount(x, y, coalMap._map, \\\"coal\\\");\\n tile.addResources(\\\"coal\\\", resourceAmount);\\n }\\n }\\n }\\n }\\n\\n // Same for copper\\n var sumCopperTiles = 0;\\n while (sumCopperTiles <= config.map.resources.copper.minTiles) {\\n var copperMap = new ROT.Map.Cellular(width, height, { connected: true });\\n copperMap.randomize(config.map.resources.copper.baseChance);\\n for (let i = 0; i< config.map.resources.copper.generations; i++) {\\n copperMap.create();\\n }\\n sumCopperTiles = copperMap._map.flat().reduce(doSum, 0);\\n }\\n\\n // Change tiles to \\\"copper\\\", but only if they're empty!\\n for (let x = 0; x < width; x++) {\\n for (let y = 0; y < height; y++) {\\n if (copperMap._map[x][y] == 1) {\\n let key = `${x},${y}`\\n let tile = this.map[key];\\n if (tile.tileType == \\\"empty\\\") {\\n let resourceAmount = this._calculateResourceAmount(x, y, copperMap._map, \\\"copper\\\");\\n tile.addResources(\\\"copper\\\", resourceAmount);\\n }\\n }\\n }\\n }\\n }\",\n \"function refreshMap() {\\n\\t\\t$.each(routes, function(i,m) {\\n\\t\\t\\tshowRouteVehicles(m.tag);\\n\\t\\t});\\n\\t}\",\n \"function getMapping(idx) {\\n return mapping[idx]\\n}\",\n \"__init25() {this.forceRenames = new Map()}\",\n \"get routes(){\\n\\t\\treturn {\\n\\t\\t\\t'get /': [actionFilter, 'index'],\\n\\t\\t\\t'get /home/about': 'about'\\n\\t\\t}\\n\\t}\",\n \"function Map(value, from1, to1, from2, to2) {\\n return (value - from1) / (to1 - from1) * (to2 - from2) + from2;\\n}\",\n \"exec() {\\n return _map[MMU.rb(regPC[0]++)]();\\n }\",\n \"packageRoutes(nodes) {\\n var map = {};\\n var routes = [];\\n\\n // Compute a map from name to node.\\n nodes.forEach(function(d) {\\n map[d.data.name] = d;\\n });\\n\\n // For each route, construct a link from the source to target node.\\n nodes.forEach(function(d) {\\n if (d.data.routes) d.data.routes.forEach(function(i) {\\n routes.push(map[d.data.name].path(map[i]));\\n });\\n });\\n return routes;\\n }\",\n \"function initializeMap(){\\n let brewery1 = state.body[0];\\n initMap(brewery1);\\n}\"\n]","isConversational":false},"negative_scores":{"kind":"list like","value":["0.68645376","0.6628688","0.65455055","0.6352502","0.6352502","0.6338502","0.6338502","0.63022685","0.63022685","0.62968117","0.62968117","0.61751074","0.6137952","0.6093293","0.60596484","0.6041014","0.5973534","0.59055483","0.5819673","0.5810476","0.5810476","0.5714253","0.57025236","0.56983805","0.56983805","0.5696133","0.5681549","0.5661081","0.5634524","0.5634524","0.5614651","0.55855685","0.55671936","0.5560953","0.55517304","0.55320966","0.5524759","0.5522271","0.5508456","0.55082893","0.5492555","0.54821557","0.5464685","0.54385996","0.54352826","0.543207","0.54105306","0.5375306","0.53708696","0.5368987","0.5368987","0.5367772","0.53511477","0.53491277","0.53480566","0.5344039","0.5330519","0.5320954","0.5303524","0.5295402","0.52941567","0.528932","0.5273567","0.5272712","0.52666795","0.5266564","0.5260394","0.5249588","0.5248639","0.5235252","0.5226762","0.52253836","0.5221467","0.52036005","0.5203296","0.5199588","0.51964355","0.51961356","0.51819247","0.51758987","0.5175409","0.51723695","0.5170031","0.5169641","0.51620775","0.515672","0.51488316","0.5145472","0.5139013","0.51231706","0.510709","0.5091593","0.5085569","0.5085388","0.50843906","0.5083146","0.50823855","0.5081064","0.5078971","0.50752914","0.50723124"],"string":"[\n \"0.68645376\",\n \"0.6628688\",\n \"0.65455055\",\n \"0.6352502\",\n \"0.6352502\",\n \"0.6338502\",\n \"0.6338502\",\n \"0.63022685\",\n \"0.63022685\",\n \"0.62968117\",\n \"0.62968117\",\n \"0.61751074\",\n \"0.6137952\",\n \"0.6093293\",\n \"0.60596484\",\n \"0.6041014\",\n \"0.5973534\",\n \"0.59055483\",\n \"0.5819673\",\n \"0.5810476\",\n \"0.5810476\",\n \"0.5714253\",\n \"0.57025236\",\n \"0.56983805\",\n \"0.56983805\",\n \"0.5696133\",\n \"0.5681549\",\n \"0.5661081\",\n \"0.5634524\",\n \"0.5634524\",\n \"0.5614651\",\n \"0.55855685\",\n \"0.55671936\",\n \"0.5560953\",\n \"0.55517304\",\n \"0.55320966\",\n \"0.5524759\",\n \"0.5522271\",\n \"0.5508456\",\n \"0.55082893\",\n \"0.5492555\",\n \"0.54821557\",\n \"0.5464685\",\n \"0.54385996\",\n \"0.54352826\",\n \"0.543207\",\n \"0.54105306\",\n \"0.5375306\",\n \"0.53708696\",\n \"0.5368987\",\n \"0.5368987\",\n \"0.5367772\",\n \"0.53511477\",\n \"0.53491277\",\n \"0.53480566\",\n \"0.5344039\",\n \"0.5330519\",\n \"0.5320954\",\n \"0.5303524\",\n \"0.5295402\",\n \"0.52941567\",\n \"0.528932\",\n \"0.5273567\",\n \"0.5272712\",\n \"0.52666795\",\n \"0.5266564\",\n \"0.5260394\",\n \"0.5249588\",\n \"0.5248639\",\n \"0.5235252\",\n \"0.5226762\",\n \"0.52253836\",\n \"0.5221467\",\n \"0.52036005\",\n \"0.5203296\",\n \"0.5199588\",\n \"0.51964355\",\n \"0.51961356\",\n \"0.51819247\",\n \"0.51758987\",\n \"0.5175409\",\n \"0.51723695\",\n \"0.5170031\",\n \"0.5169641\",\n \"0.51620775\",\n \"0.515672\",\n \"0.51488316\",\n \"0.5145472\",\n \"0.5139013\",\n \"0.51231706\",\n \"0.510709\",\n \"0.5091593\",\n \"0.5085569\",\n \"0.5085388\",\n \"0.50843906\",\n \"0.5083146\",\n \"0.50823855\",\n \"0.5081064\",\n \"0.5078971\",\n \"0.50752914\",\n \"0.50723124\"\n]","isConversational":false},"document_score":{"kind":"string","value":"0.0"},"document_rank":{"kind":"string","value":"-1"}}},{"rowIdx":4599,"cells":{"query":{"kind":"string","value":"Getter for quantity If _value is an instance of Quantity, will return object with properties number and unit Otherwise return null;"},"document":{"kind":"string","value":"get quantity() {\n if (this._observation.dataValue \n && this._observation.dataValue.value instanceof Quantity) {\n return {\n number: this._observation.dataValue.value.number.decimal,\n unit: this._observation.dataValue.value.units.coding.codeValue.value,\n };\n } else {\n return null;\n }\n }"},"metadata":{"kind":"string","value":"{\n \"objective\": {\n \"self\": [],\n \"paired\": [],\n \"triplet\": [\n [\n \"query\",\n \"document\",\n \"negatives\"\n ]\n ]\n }\n}"},"negatives":{"kind":"list like","value":["get valueQuantity () {\r\n\t\treturn this._valueQuantity;\r\n\t}","get valueQuantity () {\r\n\t\treturn this.__valueQuantity;\r\n\t}","get quantity() {\n\t\treturn this.__quantity;\n\t}","get quantity() {\n\t\treturn this.__quantity;\n\t}","get quantity() {\n\t\treturn this.__quantity;\n\t}","function getQuantityValueAndUnit(ob) {\n if (typeof ob != 'undefined' &&\n typeof ob.valueQuantity != 'undefined' &&\n typeof ob.valueQuantity.value != 'undefined' &&\n typeof ob.valueQuantity.unit != 'undefined') {\n return Number(parseFloat((ob.valueQuantity.value)).toFixed(2)) + ' ' + ob.valueQuantity.unit;\n } else {\n return undefined;\n }\n}","function getQuantityFieldValue() {\n\t\treturn parseInt(quantityField.getText(), 10);\n\t}","function getQuantityValueAndUnit(ob) {\n if (typeof ob != 'undefined' &&\n typeof ob.valueQuantity != 'undefined' &&\n typeof ob.valueQuantity.value != 'undefined' &&\n typeof ob.valueQuantity.unit != 'undefined') {\n return Number(parseFloat((ob.valueQuantity.value)).toFixed(2)) + ' ' + ob.valueQuantity.unit;\n } else {\n return undefined;\n }\n}","function getUnitValue(u) { return (u.value != undefined) ? u.value : u; }","function getQuantityValueAndUnit(ob) {\n if (\n typeof ob != \"undefined\" &&\n typeof ob.valueQuantity != \"undefined\" &&\n typeof ob.valueQuantity.value != \"undefined\" &&\n typeof ob.valueQuantity.unit != \"undefined\"\n ) {\n return (\n Number(parseFloat(ob.valueQuantity.value).toFixed(2)) +\n \" \" +\n ob.valueQuantity.unit\n );\n } else {\n return undefined;\n }\n}","get detailQuantity () {\n\t\treturn this._detailQuantity;\n\t}","get detailQuantity() {\n\t\treturn this.__detailQuantity;\n\t}","function getItemValue(price, quantity) {\n return currency(price)\n .multiply(quantity.toString())\n .format();\n}","get defaultValueQuantity() {\n\t\treturn this.__defaultValueQuantity;\n\t}","function ItemQuantity(item, quantity = 1) {\n this.item = item;\n this.quantity = quantity;\n}","getStandardConversion(quantity) {\n\t\tswitch(this.unit.toLowerCase()){\n\t\t\tcase \"seconds\": return quantity;\n\t\t\tcase \"minutes\": return quantity * 60;\n\t\t\tcase \"hours\": return quantity * (60 * 60);\n\t\t\tcase \"days\": return quantity * (24 * 60 * 60);\n\t\t\tcase \"weeks\": return quantity * (7 * 24 * 60 * 60);\n\t\t\tdefault: return null;\n\t\t}\n\t}","function getQuantityFromInputField()\n {\n return nanCheck($('.cr_current_quantity_class').val());\n }","quantity(amount) {\n return assay.coerce(amount).quantity;\n }","get units() {\n return this._units;\n }","get specimenQuantity () {\n\t\treturn this._specimenQuantity;\n\t}","setQuantity(quantity) {\n this.quantity = quantity;\n }","get unit () {\n\t\treturn this._unit;\n\t}","static get __resourceType() {\n\t\treturn 'Quantity';\n\t}","function getVal(input, key) {\n for (var i=0; i < input.length ; ++i){\n if(input[i]['size'] == key){\n return input[i]['quantity'];\n }\n }\n }","get unit() {\n\t\treturn this.__unit;\n\t}","get value() {\n return this.amount;\n }","getSignalQuantity()\n {\n return parseInt(this.quantity);\n }","get unitPrice() {\n\t\treturn this.__unitPrice;\n\t}","calculateQuantity() {\n console.log('Calculating quantity... ');\n const symbol = this.symbol.meta;\n const minQuantity = symbol.minQty;\n const maxQuantity = symbol.maxQty;\n const quantitySigFig = symbol.quantitySigFig;\n const stepSize = symbol.stepSize; //minimum quantity difference you can trade by\n const currentPrice = this.ticker.meta.bid;\n const budget = this.config.budget;\n\n let quantity = minQuantity;\n while (quantity * currentPrice <= budget) quantity += stepSize;\n if (quantity * currentPrice > budget) quantity -= stepSize;\n if (quantity === 0) quantity = minQuantity;\n\n assert(quantity >= minQuantity && quantity <= maxQuantity, 'invalid quantity');\n\n console.log('Quantity Calculated: ', quantity.toFixed(quantitySigFig));\n return quantity.toFixed(quantitySigFig);\n }","function getUnits(quantity) {\n var db = getDatabase();\n var res=\"\";\n db.transaction(function(tx) {\n var rs = tx.executeSql('SELECT name FROM units WHERE quantity=?;', [quantity]);\n if (rs.rows.length > 0) {\n res = rs;\n } else {\n res = \"Unknown\";\n }\n })\n // The function returns “Unknown” if the setting was not found in the database\n // For more advanced projects, this should probably be handled through error codes\n return res\n}","function quantity(val) {\n\t return Math.pow(10, quantityExponent(val));\n\t }","toFormattedQuantityUnit(value) {\n if (value >= 1000000)\n return format('%.2fM', value / 1000000);\n else if (value >= 1000)\n return format('%.2fk', value / 1000);\n else\n return format('%.2f', value);\n }","constructor(ticker, quantity, currentValue) {\n this.ticker = ticker;\n this.quantity = quantity == null ? null : quantity;\n this.currentPrice = null;\n this.high = null;\n this.low = null;\n this.currentValue = currentValue == null ? null : currentValue;\n }","getTotalMilliseconds() {\n return this._quantity;\n }","function getQuantity() {\n let quantity = 0;\n for (let i = 0; i < cart.length; i++) {\n quantity += cart[i].quantity;\n }\n\n return quantity;\n}","function orderItem() {\n\t\t\tthis.id = null ;\n\t\t\tthis.name = null ;\n\t\t\tthis.unit_size = null ;\n\t\t\tthis.category = null ;\n\t\t\tthis.languages = [] ;\n\t\t\tthis.quantities = [] ;\n\t\t\tthis.limits = [];\n\t\t}","get value() {\n return this.getNumberAttribute('value');\n }","function getQuantity(qty) {\n\tvar num = document.getElementById(\"qty\").value;\n\tconsole.log(\"quantity ordered: \" + num)\n\treturn qty * num;\n}","init() {\n this.quantity = 3;\n }","function fruit(){\n this.name = \"apple\";\n this.color = \"red\";\n this.qty = 4;\n // this.getQty = function(){\n // return this.qty;\n // }\n}","shelfSize()\n {\n return this.values.size * this.values.quantity;\n }","getValorTotal(){\n return this._valorUnitario * this._quantidade;\n }","function loadQuantity(){\n //console.log(\"loadQuantity\");\n var $inputs = $('.' + _input);\n for(var i = 0; i < $inputs.length; i++){\n var $input = $($inputs[i]);\n var datas = $input.data();\n if (datas && datas[_inputStructureId]) {\n var strId = datas[_inputStructureId];\n var jCookie = getJCookie(_cookieName);\n var jResource = jCookie[_jResources][strId];\n if (jResource && jResource[_jQuantity]) {\n $input.val(jResource[_jQuantity]);\n }\n }\n }\n }","constructor() {\r\n super();\r\n this.quantity = 1;\r\n }","get value() {\n if (!this._value) {\n this._value = 0;\n }\n return this._value;\n }","function stockQuantity(id, quantity) {\n connection.query(\n \"SELECT stock_quantity, price FROM products WHERE id = \" + id,\n function(err, res) {\n if (err) throw err;\n purchase(res[0].stock_quantity, quantity, res[0].price, id);\n }\n );\n}","minOrderQuantity(minValue) {\n return minValue;\n }","getInteger() {\n return this.value ? this.value : null;\n }","getPos() {\n return this.units;\n }","function getQuantitySelected() {\n return parseInt(document.getElementById(\"productQuantity\").value);\n}","getValorUnitario(){\n return this._valorUnitario;\n }","get quaternionValue() {}","function cartItem(detail, name, price, quantity) {\n this.detail = detail;\n this.name = name;\n this.price = price * 1;\n this.quantity = quantity * 1;\n}","function cartItem(sku, name, price, quantity) {\r\n this.sku = sku;\r\n this.name = name;\r\n this.price = price * 1;\r\n this.quantity = quantity * 1;\r\n}","static loadItem(id, quantity) {\n // TODO: Update with API call\n for(let i = 0; i < placeholderData.items.length; i++){\n if(id === placeholderData.items[i].id){\n const item = placeholderData.items[i];\n // Enrich data with quantity.\n item.quantity = quantity;\n return item;\n }\n }\n return null;\n }","function changeQuantity() {\n var number = document.getElementById(\"quantityList\");\n var quantity = number.value;\n return quantity;\n } // end function","function getQty(ID, qty) {\n var query = connection.query(\"SELECT Stock_QTY FROM products WHERE ID = ?;\",[ID] ,function(err, res) {\n if (err) throw err;\n stock = res[0].Stock_QTY;\n updateProducts(stock, ID, qty);\n });\n return stock;\n}","get amount() {\n\t\t\treturn this.items\n\t\t\t\t.map(item => item.qty * item.price)\n\t\t\t\t.reduce((total, qty) => total += qty, 0);\n\t\t}","function quantity(val) {\n return Math.pow(10, quantityExponent(val));\n}","function CartItem(sku, type,name, slug, mrp, price, quantity, image, category, size, weight) {\r\n // console.log(size);\r\n this.sku = sku;\r\n this.type = type;\r\n this.name = name;\r\n this.slug = slug;\r\n this.image = image;\r\n this.category = category;\r\n this.size = size;\r\n this.mrp = mrp;\r\n this.price = price * 1;\r\n this.quantity = quantity * 1;\r\n this.weight = weight * 1;\r\n this.status = 0;\r\n}","function QuantitySelector(_ref) {\n var name = _ref.name,\n classes = _ref.classes,\n addIcon = _ref.addIcon,\n addButtonProps = _ref.addButtonProps,\n subtractIcon = _ref.subtractIcon,\n subtractButtonProps = _ref.subtractButtonProps,\n value = _ref.value,\n minValue = _ref.minValue,\n maxValue = _ref.maxValue,\n onChange = _ref.onChange,\n inputProps = _ref.inputProps,\n ariaLabel = _ref.ariaLabel;\n classes = useStyles({\n classes: classes\n });\n var _classes = classes,\n quantitySelector = _classes.quantitySelector,\n icon = _classes.icon,\n button = _classes.button,\n inputClasses = (0, _objectWithoutProperties2[\"default\"])(_classes, [\"quantitySelector\", \"icon\", \"button\"]);\n if (!value) value = 1;\n\n function handleChange(value) {\n if (value >= minValue && value <= maxValue) {\n onChange(value);\n }\n }\n\n return /*#__PURE__*/_react[\"default\"].createElement(_react[\"default\"].Fragment, null, /*#__PURE__*/_react[\"default\"].createElement(_IconButton[\"default\"], (0, _extends2[\"default\"])({\n size: \"small\",\n classes: {\n root: button\n },\n className: classes.subtract,\n onClick: function onClick() {\n return handleChange(value - 1);\n },\n \"aria-label\": \"add one \".concat(ariaLabel)\n }, subtractButtonProps), subtractIcon || /*#__PURE__*/_react[\"default\"].createElement(_Remove[\"default\"], {\n classes: {\n root: icon\n }\n })), /*#__PURE__*/_react[\"default\"].createElement(\"input\", (0, _extends2[\"default\"])({\n onChange: handleChange,\n value: value,\n name: name\n }, {\n 'aria-label': ariaLabel\n }, {\n className: (0, _clsx[\"default\"])([classes.input, inputClasses])\n }, inputProps, {\n readOnly: true\n })), /*#__PURE__*/_react[\"default\"].createElement(_IconButton[\"default\"], (0, _extends2[\"default\"])({\n size: \"small\",\n classes: {\n root: button\n },\n className: classes.add,\n onClick: function onClick() {\n return handleChange(value + 1);\n },\n \"aria-label\": \"subtract one \".concat(ariaLabel)\n }, addButtonProps), addIcon || /*#__PURE__*/_react[\"default\"].createElement(_Add[\"default\"], {\n classes: {\n root: icon\n }\n })));\n}","constructor(item, quantity) {\r\n this.item = item;\r\n this.quantity = quantity;\r\n this.children = {};\r\n }","function cartItem(sku, name, price, quantity) {\n this.sku = sku;\n this.name = name;\n this.price = price * 1;\n this.quantity = quantity * 1;\n }","valueOf() {\n return this.money;\n }","get number() {\n return Number(this.view.value);\n }","constructor() {\n this.order = null;\n this.desc = null;\n this.quantity = null;\n this.length = null;\n this.width = null;\n this.height = null;\n this.rotate = null;\n this.stack = null;\n this.group = null;\n }","function getSubTotalByProductAmountAndQuantity()\n {\n return ((getQuantityFromInputField() * getProductAmountFromInputField()).toFixed(2));\n }","get value() {}","get value() {}","get amount () {\n return Math.abs(this.raw) / this.scale\n }","function getQuantityNumber (airClass) {\n const airClassInput = document.getElementById(airClass + '-quantity');\n const airClassQuantity = parseFloat(airClassInput.value);\n return airClassQuantity;\n}","function quantity(pid, selections) {\n var up = function (ev) {\n event({\n __ctor: \"QuantityClick\",\n product: pid,\n action: \"up\"\n });\n };\n var down = function (ev) {\n event({\n __ctor: \"QuantityClick\",\n product: pid,\n action: \"down\"\n });\n };\n var q = selections.has(pid)\n ? selections.get(pid).quantity\n : 0;\n return maquette_1.h(\"div.row\", { key: \"quantity\" }, [\n maquette_1.h(\"div.col-sm\", { key: 1, onclick: down }, [\"(-)\"]),\n maquette_1.h(\"div.col-sm\", { key: 2 }, [q.toString()]),\n maquette_1.h(\"div.col-sm\", { key: 3, onclick: up }, [\"(+)\"])\n ]);\n}","toString() { return `${this.value || '?'} ${this.unit}`.trim() }","function getUnitFromInput() {\n\t\tvar unit_id = $(\"#units-select\").val();\n\t\treturn units[unit_id];\n\t}","totalItemPrice(item) {\n if(undefined === item.price || undefined === item.quantity){\n return 0;\n }\n return item.price * item.quantity;\n }","valueOfStock()\n {\n return this.numberofshare*this.shareprice\n }","handleQuantity() {\n // dummy function which will invoke inside created().\n }","quantity(fileName) {\n return this.stored.bag[fileName] || 0\n }","get StockNum() {\n return this._stockNum;\n }","function _setQuantity(xml) {\n var valueNode = Sdk.Xml.selectSingleNode(xml, \"//a:KeyValuePairOfstringanyType[b:key='Quantity']/b:value\");\n if (!Sdk.Xml.isNodeNull(valueNode)) {\n _quantity = parseInt(Sdk.Xml.getNodeText(valueNode), 10);\n }\n }","getNormalizedValue() {\n return this.value === null ? null : normalize(this.unitList, this.value, options.type);\n }","getValue() {\n return this.value;\n }","get valueAsNumber() {\n return this.getInput().valueAsNumber;\n }","getValue() {\n return this.value;\n }","getValue() {\n return this.value;\n }","getValue() {\n return this.value;\n }","function getQuantityByProduct(itemNode) {\n var qtyNode = itemNode.querySelector(\".quantity-input\");\n var qty = qtyNode.value;\n return qty;\n}","_getValue() {\n return this._value;\n }","function Item (name, quantity, location) {\n this.name = name;\n this.quantity = quantity;\n this.location = location;\n}","_get_value() {\n return this._has_value() ? this._value : undefined;\n }","getValue()\n {\n return this.value;\n }","function getQty(){\n let qty = 0;\n for(let i = 0; i < cart.length; i += 1){\n qty += cart[i].qty;\n }\n return qty\n}","function get() {\n return _value;\n }","get value() { return this._value; }","get value() { return this._value; }","get value() { return this._value; }","get value() { return this._value; }","get value() { return this._value; }","get value() { return this._value; }","get value() { return this._value; }"],"string":"[\n \"get valueQuantity () {\\r\\n\\t\\treturn this._valueQuantity;\\r\\n\\t}\",\n \"get valueQuantity () {\\r\\n\\t\\treturn this.__valueQuantity;\\r\\n\\t}\",\n \"get quantity() {\\n\\t\\treturn this.__quantity;\\n\\t}\",\n \"get quantity() {\\n\\t\\treturn this.__quantity;\\n\\t}\",\n \"get quantity() {\\n\\t\\treturn this.__quantity;\\n\\t}\",\n \"function getQuantityValueAndUnit(ob) {\\n if (typeof ob != 'undefined' &&\\n typeof ob.valueQuantity != 'undefined' &&\\n typeof ob.valueQuantity.value != 'undefined' &&\\n typeof ob.valueQuantity.unit != 'undefined') {\\n return Number(parseFloat((ob.valueQuantity.value)).toFixed(2)) + ' ' + ob.valueQuantity.unit;\\n } else {\\n return undefined;\\n }\\n}\",\n \"function getQuantityFieldValue() {\\n\\t\\treturn parseInt(quantityField.getText(), 10);\\n\\t}\",\n \"function getQuantityValueAndUnit(ob) {\\n if (typeof ob != 'undefined' &&\\n typeof ob.valueQuantity != 'undefined' &&\\n typeof ob.valueQuantity.value != 'undefined' &&\\n typeof ob.valueQuantity.unit != 'undefined') {\\n return Number(parseFloat((ob.valueQuantity.value)).toFixed(2)) + ' ' + ob.valueQuantity.unit;\\n } else {\\n return undefined;\\n }\\n}\",\n \"function getUnitValue(u) { return (u.value != undefined) ? u.value : u; }\",\n \"function getQuantityValueAndUnit(ob) {\\n if (\\n typeof ob != \\\"undefined\\\" &&\\n typeof ob.valueQuantity != \\\"undefined\\\" &&\\n typeof ob.valueQuantity.value != \\\"undefined\\\" &&\\n typeof ob.valueQuantity.unit != \\\"undefined\\\"\\n ) {\\n return (\\n Number(parseFloat(ob.valueQuantity.value).toFixed(2)) +\\n \\\" \\\" +\\n ob.valueQuantity.unit\\n );\\n } else {\\n return undefined;\\n }\\n}\",\n \"get detailQuantity () {\\n\\t\\treturn this._detailQuantity;\\n\\t}\",\n \"get detailQuantity() {\\n\\t\\treturn this.__detailQuantity;\\n\\t}\",\n \"function getItemValue(price, quantity) {\\n return currency(price)\\n .multiply(quantity.toString())\\n .format();\\n}\",\n \"get defaultValueQuantity() {\\n\\t\\treturn this.__defaultValueQuantity;\\n\\t}\",\n \"function ItemQuantity(item, quantity = 1) {\\n this.item = item;\\n this.quantity = quantity;\\n}\",\n \"getStandardConversion(quantity) {\\n\\t\\tswitch(this.unit.toLowerCase()){\\n\\t\\t\\tcase \\\"seconds\\\": return quantity;\\n\\t\\t\\tcase \\\"minutes\\\": return quantity * 60;\\n\\t\\t\\tcase \\\"hours\\\": return quantity * (60 * 60);\\n\\t\\t\\tcase \\\"days\\\": return quantity * (24 * 60 * 60);\\n\\t\\t\\tcase \\\"weeks\\\": return quantity * (7 * 24 * 60 * 60);\\n\\t\\t\\tdefault: return null;\\n\\t\\t}\\n\\t}\",\n \"function getQuantityFromInputField()\\n {\\n return nanCheck($('.cr_current_quantity_class').val());\\n }\",\n \"quantity(amount) {\\n return assay.coerce(amount).quantity;\\n }\",\n \"get units() {\\n return this._units;\\n }\",\n \"get specimenQuantity () {\\n\\t\\treturn this._specimenQuantity;\\n\\t}\",\n \"setQuantity(quantity) {\\n this.quantity = quantity;\\n }\",\n \"get unit () {\\n\\t\\treturn this._unit;\\n\\t}\",\n \"static get __resourceType() {\\n\\t\\treturn 'Quantity';\\n\\t}\",\n \"function getVal(input, key) {\\n for (var i=0; i < input.length ; ++i){\\n if(input[i]['size'] == key){\\n return input[i]['quantity'];\\n }\\n }\\n }\",\n \"get unit() {\\n\\t\\treturn this.__unit;\\n\\t}\",\n \"get value() {\\n return this.amount;\\n }\",\n \"getSignalQuantity()\\n {\\n return parseInt(this.quantity);\\n }\",\n \"get unitPrice() {\\n\\t\\treturn this.__unitPrice;\\n\\t}\",\n \"calculateQuantity() {\\n console.log('Calculating quantity... ');\\n const symbol = this.symbol.meta;\\n const minQuantity = symbol.minQty;\\n const maxQuantity = symbol.maxQty;\\n const quantitySigFig = symbol.quantitySigFig;\\n const stepSize = symbol.stepSize; //minimum quantity difference you can trade by\\n const currentPrice = this.ticker.meta.bid;\\n const budget = this.config.budget;\\n\\n let quantity = minQuantity;\\n while (quantity * currentPrice <= budget) quantity += stepSize;\\n if (quantity * currentPrice > budget) quantity -= stepSize;\\n if (quantity === 0) quantity = minQuantity;\\n\\n assert(quantity >= minQuantity && quantity <= maxQuantity, 'invalid quantity');\\n\\n console.log('Quantity Calculated: ', quantity.toFixed(quantitySigFig));\\n return quantity.toFixed(quantitySigFig);\\n }\",\n \"function getUnits(quantity) {\\n var db = getDatabase();\\n var res=\\\"\\\";\\n db.transaction(function(tx) {\\n var rs = tx.executeSql('SELECT name FROM units WHERE quantity=?;', [quantity]);\\n if (rs.rows.length > 0) {\\n res = rs;\\n } else {\\n res = \\\"Unknown\\\";\\n }\\n })\\n // The function returns “Unknown” if the setting was not found in the database\\n // For more advanced projects, this should probably be handled through error codes\\n return res\\n}\",\n \"function quantity(val) {\\n\\t return Math.pow(10, quantityExponent(val));\\n\\t }\",\n \"toFormattedQuantityUnit(value) {\\n if (value >= 1000000)\\n return format('%.2fM', value / 1000000);\\n else if (value >= 1000)\\n return format('%.2fk', value / 1000);\\n else\\n return format('%.2f', value);\\n }\",\n \"constructor(ticker, quantity, currentValue) {\\n this.ticker = ticker;\\n this.quantity = quantity == null ? null : quantity;\\n this.currentPrice = null;\\n this.high = null;\\n this.low = null;\\n this.currentValue = currentValue == null ? null : currentValue;\\n }\",\n \"getTotalMilliseconds() {\\n return this._quantity;\\n }\",\n \"function getQuantity() {\\n let quantity = 0;\\n for (let i = 0; i < cart.length; i++) {\\n quantity += cart[i].quantity;\\n }\\n\\n return quantity;\\n}\",\n \"function orderItem() {\\n\\t\\t\\tthis.id = null ;\\n\\t\\t\\tthis.name = null ;\\n\\t\\t\\tthis.unit_size = null ;\\n\\t\\t\\tthis.category = null ;\\n\\t\\t\\tthis.languages = [] ;\\n\\t\\t\\tthis.quantities = [] ;\\n\\t\\t\\tthis.limits = [];\\n\\t\\t}\",\n \"get value() {\\n return this.getNumberAttribute('value');\\n }\",\n \"function getQuantity(qty) {\\n\\tvar num = document.getElementById(\\\"qty\\\").value;\\n\\tconsole.log(\\\"quantity ordered: \\\" + num)\\n\\treturn qty * num;\\n}\",\n \"init() {\\n this.quantity = 3;\\n }\",\n \"function fruit(){\\n this.name = \\\"apple\\\";\\n this.color = \\\"red\\\";\\n this.qty = 4;\\n // this.getQty = function(){\\n // return this.qty;\\n // }\\n}\",\n \"shelfSize()\\n {\\n return this.values.size * this.values.quantity;\\n }\",\n \"getValorTotal(){\\n return this._valorUnitario * this._quantidade;\\n }\",\n \"function loadQuantity(){\\n //console.log(\\\"loadQuantity\\\");\\n var $inputs = $('.' + _input);\\n for(var i = 0; i < $inputs.length; i++){\\n var $input = $($inputs[i]);\\n var datas = $input.data();\\n if (datas && datas[_inputStructureId]) {\\n var strId = datas[_inputStructureId];\\n var jCookie = getJCookie(_cookieName);\\n var jResource = jCookie[_jResources][strId];\\n if (jResource && jResource[_jQuantity]) {\\n $input.val(jResource[_jQuantity]);\\n }\\n }\\n }\\n }\",\n \"constructor() {\\r\\n super();\\r\\n this.quantity = 1;\\r\\n }\",\n \"get value() {\\n if (!this._value) {\\n this._value = 0;\\n }\\n return this._value;\\n }\",\n \"function stockQuantity(id, quantity) {\\n connection.query(\\n \\\"SELECT stock_quantity, price FROM products WHERE id = \\\" + id,\\n function(err, res) {\\n if (err) throw err;\\n purchase(res[0].stock_quantity, quantity, res[0].price, id);\\n }\\n );\\n}\",\n \"minOrderQuantity(minValue) {\\n return minValue;\\n }\",\n \"getInteger() {\\n return this.value ? this.value : null;\\n }\",\n \"getPos() {\\n return this.units;\\n }\",\n \"function getQuantitySelected() {\\n return parseInt(document.getElementById(\\\"productQuantity\\\").value);\\n}\",\n \"getValorUnitario(){\\n return this._valorUnitario;\\n }\",\n \"get quaternionValue() {}\",\n \"function cartItem(detail, name, price, quantity) {\\n this.detail = detail;\\n this.name = name;\\n this.price = price * 1;\\n this.quantity = quantity * 1;\\n}\",\n \"function cartItem(sku, name, price, quantity) {\\r\\n this.sku = sku;\\r\\n this.name = name;\\r\\n this.price = price * 1;\\r\\n this.quantity = quantity * 1;\\r\\n}\",\n \"static loadItem(id, quantity) {\\n // TODO: Update with API call\\n for(let i = 0; i < placeholderData.items.length; i++){\\n if(id === placeholderData.items[i].id){\\n const item = placeholderData.items[i];\\n // Enrich data with quantity.\\n item.quantity = quantity;\\n return item;\\n }\\n }\\n return null;\\n }\",\n \"function changeQuantity() {\\n var number = document.getElementById(\\\"quantityList\\\");\\n var quantity = number.value;\\n return quantity;\\n } // end function\",\n \"function getQty(ID, qty) {\\n var query = connection.query(\\\"SELECT Stock_QTY FROM products WHERE ID = ?;\\\",[ID] ,function(err, res) {\\n if (err) throw err;\\n stock = res[0].Stock_QTY;\\n updateProducts(stock, ID, qty);\\n });\\n return stock;\\n}\",\n \"get amount() {\\n\\t\\t\\treturn this.items\\n\\t\\t\\t\\t.map(item => item.qty * item.price)\\n\\t\\t\\t\\t.reduce((total, qty) => total += qty, 0);\\n\\t\\t}\",\n \"function quantity(val) {\\n return Math.pow(10, quantityExponent(val));\\n}\",\n \"function CartItem(sku, type,name, slug, mrp, price, quantity, image, category, size, weight) {\\r\\n // console.log(size);\\r\\n this.sku = sku;\\r\\n this.type = type;\\r\\n this.name = name;\\r\\n this.slug = slug;\\r\\n this.image = image;\\r\\n this.category = category;\\r\\n this.size = size;\\r\\n this.mrp = mrp;\\r\\n this.price = price * 1;\\r\\n this.quantity = quantity * 1;\\r\\n this.weight = weight * 1;\\r\\n this.status = 0;\\r\\n}\",\n \"function QuantitySelector(_ref) {\\n var name = _ref.name,\\n classes = _ref.classes,\\n addIcon = _ref.addIcon,\\n addButtonProps = _ref.addButtonProps,\\n subtractIcon = _ref.subtractIcon,\\n subtractButtonProps = _ref.subtractButtonProps,\\n value = _ref.value,\\n minValue = _ref.minValue,\\n maxValue = _ref.maxValue,\\n onChange = _ref.onChange,\\n inputProps = _ref.inputProps,\\n ariaLabel = _ref.ariaLabel;\\n classes = useStyles({\\n classes: classes\\n });\\n var _classes = classes,\\n quantitySelector = _classes.quantitySelector,\\n icon = _classes.icon,\\n button = _classes.button,\\n inputClasses = (0, _objectWithoutProperties2[\\\"default\\\"])(_classes, [\\\"quantitySelector\\\", \\\"icon\\\", \\\"button\\\"]);\\n if (!value) value = 1;\\n\\n function handleChange(value) {\\n if (value >= minValue && value <= maxValue) {\\n onChange(value);\\n }\\n }\\n\\n return /*#__PURE__*/_react[\\\"default\\\"].createElement(_react[\\\"default\\\"].Fragment, null, /*#__PURE__*/_react[\\\"default\\\"].createElement(_IconButton[\\\"default\\\"], (0, _extends2[\\\"default\\\"])({\\n size: \\\"small\\\",\\n classes: {\\n root: button\\n },\\n className: classes.subtract,\\n onClick: function onClick() {\\n return handleChange(value - 1);\\n },\\n \\\"aria-label\\\": \\\"add one \\\".concat(ariaLabel)\\n }, subtractButtonProps), subtractIcon || /*#__PURE__*/_react[\\\"default\\\"].createElement(_Remove[\\\"default\\\"], {\\n classes: {\\n root: icon\\n }\\n })), /*#__PURE__*/_react[\\\"default\\\"].createElement(\\\"input\\\", (0, _extends2[\\\"default\\\"])({\\n onChange: handleChange,\\n value: value,\\n name: name\\n }, {\\n 'aria-label': ariaLabel\\n }, {\\n className: (0, _clsx[\\\"default\\\"])([classes.input, inputClasses])\\n }, inputProps, {\\n readOnly: true\\n })), /*#__PURE__*/_react[\\\"default\\\"].createElement(_IconButton[\\\"default\\\"], (0, _extends2[\\\"default\\\"])({\\n size: \\\"small\\\",\\n classes: {\\n root: button\\n },\\n className: classes.add,\\n onClick: function onClick() {\\n return handleChange(value + 1);\\n },\\n \\\"aria-label\\\": \\\"subtract one \\\".concat(ariaLabel)\\n }, addButtonProps), addIcon || /*#__PURE__*/_react[\\\"default\\\"].createElement(_Add[\\\"default\\\"], {\\n classes: {\\n root: icon\\n }\\n })));\\n}\",\n \"constructor(item, quantity) {\\r\\n this.item = item;\\r\\n this.quantity = quantity;\\r\\n this.children = {};\\r\\n }\",\n \"function cartItem(sku, name, price, quantity) {\\n this.sku = sku;\\n this.name = name;\\n this.price = price * 1;\\n this.quantity = quantity * 1;\\n }\",\n \"valueOf() {\\n return this.money;\\n }\",\n \"get number() {\\n return Number(this.view.value);\\n }\",\n \"constructor() {\\n this.order = null;\\n this.desc = null;\\n this.quantity = null;\\n this.length = null;\\n this.width = null;\\n this.height = null;\\n this.rotate = null;\\n this.stack = null;\\n this.group = null;\\n }\",\n \"function getSubTotalByProductAmountAndQuantity()\\n {\\n return ((getQuantityFromInputField() * getProductAmountFromInputField()).toFixed(2));\\n }\",\n \"get value() {}\",\n \"get value() {}\",\n \"get amount () {\\n return Math.abs(this.raw) / this.scale\\n }\",\n \"function getQuantityNumber (airClass) {\\n const airClassInput = document.getElementById(airClass + '-quantity');\\n const airClassQuantity = parseFloat(airClassInput.value);\\n return airClassQuantity;\\n}\",\n \"function quantity(pid, selections) {\\n var up = function (ev) {\\n event({\\n __ctor: \\\"QuantityClick\\\",\\n product: pid,\\n action: \\\"up\\\"\\n });\\n };\\n var down = function (ev) {\\n event({\\n __ctor: \\\"QuantityClick\\\",\\n product: pid,\\n action: \\\"down\\\"\\n });\\n };\\n var q = selections.has(pid)\\n ? selections.get(pid).quantity\\n : 0;\\n return maquette_1.h(\\\"div.row\\\", { key: \\\"quantity\\\" }, [\\n maquette_1.h(\\\"div.col-sm\\\", { key: 1, onclick: down }, [\\\"(-)\\\"]),\\n maquette_1.h(\\\"div.col-sm\\\", { key: 2 }, [q.toString()]),\\n maquette_1.h(\\\"div.col-sm\\\", { key: 3, onclick: up }, [\\\"(+)\\\"])\\n ]);\\n}\",\n \"toString() { return `${this.value || '?'} ${this.unit}`.trim() }\",\n \"function getUnitFromInput() {\\n\\t\\tvar unit_id = $(\\\"#units-select\\\").val();\\n\\t\\treturn units[unit_id];\\n\\t}\",\n \"totalItemPrice(item) {\\n if(undefined === item.price || undefined === item.quantity){\\n return 0;\\n }\\n return item.price * item.quantity;\\n }\",\n \"valueOfStock()\\n {\\n return this.numberofshare*this.shareprice\\n }\",\n \"handleQuantity() {\\n // dummy function which will invoke inside created().\\n }\",\n \"quantity(fileName) {\\n return this.stored.bag[fileName] || 0\\n }\",\n \"get StockNum() {\\n return this._stockNum;\\n }\",\n \"function _setQuantity(xml) {\\n var valueNode = Sdk.Xml.selectSingleNode(xml, \\\"//a:KeyValuePairOfstringanyType[b:key='Quantity']/b:value\\\");\\n if (!Sdk.Xml.isNodeNull(valueNode)) {\\n _quantity = parseInt(Sdk.Xml.getNodeText(valueNode), 10);\\n }\\n }\",\n \"getNormalizedValue() {\\n return this.value === null ? null : normalize(this.unitList, this.value, options.type);\\n }\",\n \"getValue() {\\n return this.value;\\n }\",\n \"get valueAsNumber() {\\n return this.getInput().valueAsNumber;\\n }\",\n \"getValue() {\\n return this.value;\\n }\",\n \"getValue() {\\n return this.value;\\n }\",\n \"getValue() {\\n return this.value;\\n }\",\n \"function getQuantityByProduct(itemNode) {\\n var qtyNode = itemNode.querySelector(\\\".quantity-input\\\");\\n var qty = qtyNode.value;\\n return qty;\\n}\",\n \"_getValue() {\\n return this._value;\\n }\",\n \"function Item (name, quantity, location) {\\n this.name = name;\\n this.quantity = quantity;\\n this.location = location;\\n}\",\n \"_get_value() {\\n return this._has_value() ? this._value : undefined;\\n }\",\n \"getValue()\\n {\\n return this.value;\\n }\",\n \"function getQty(){\\n let qty = 0;\\n for(let i = 0; i < cart.length; i += 1){\\n qty += cart[i].qty;\\n }\\n return qty\\n}\",\n \"function get() {\\n return _value;\\n }\",\n \"get value() { return this._value; }\",\n \"get value() { return this._value; }\",\n \"get value() { return this._value; }\",\n \"get value() { return this._value; }\",\n \"get value() { return this._value; }\",\n \"get value() { return this._value; }\",\n \"get value() { return this._value; }\"\n]","isConversational":false},"negative_scores":{"kind":"list like","value":["0.73006326","0.7286378","0.70620376","0.70620376","0.70620376","0.6507041","0.64678663","0.6447228","0.64377165","0.6419223","0.6379325","0.63425386","0.6100222","0.6005071","0.58844334","0.5869871","0.5835774","0.583076","0.58057064","0.57182","0.5714805","0.57037574","0.56409436","0.55763","0.5523546","0.5497091","0.5464132","0.5444517","0.5444067","0.54053134","0.5385414","0.5373996","0.53449875","0.5273777","0.52737665","0.5270375","0.52645326","0.52591217","0.52530664","0.5227396","0.52167296","0.52146137","0.52052295","0.51983494","0.5197908","0.519709","0.5196031","0.519328","0.51843405","0.5179871","0.5174384","0.51677483","0.5164473","0.5138329","0.51379335","0.5136521","0.50830436","0.50819755","0.5080884","0.50771147","0.5066792","0.50667244","0.50647134","0.50604385","0.50548697","0.5048589","0.5048423","0.5044601","0.5044601","0.50398636","0.5028527","0.50263566","0.50056404","0.5003554","0.5003099","0.49879223","0.49811682","0.49804372","0.49776748","0.49734843","0.49716595","0.4971525","0.4965383","0.49619517","0.49619517","0.49619517","0.49458006","0.49434304","0.49378595","0.49367273","0.4925654","0.49253488","0.49141017","0.4906687","0.4906687","0.4906687","0.4906687","0.4906687","0.4906687","0.4906687"],"string":"[\n \"0.73006326\",\n \"0.7286378\",\n \"0.70620376\",\n \"0.70620376\",\n \"0.70620376\",\n \"0.6507041\",\n \"0.64678663\",\n \"0.6447228\",\n \"0.64377165\",\n \"0.6419223\",\n \"0.6379325\",\n \"0.63425386\",\n \"0.6100222\",\n \"0.6005071\",\n \"0.58844334\",\n \"0.5869871\",\n \"0.5835774\",\n \"0.583076\",\n \"0.58057064\",\n \"0.57182\",\n \"0.5714805\",\n \"0.57037574\",\n \"0.56409436\",\n \"0.55763\",\n \"0.5523546\",\n \"0.5497091\",\n \"0.5464132\",\n \"0.5444517\",\n \"0.5444067\",\n \"0.54053134\",\n \"0.5385414\",\n \"0.5373996\",\n \"0.53449875\",\n \"0.5273777\",\n \"0.52737665\",\n \"0.5270375\",\n \"0.52645326\",\n \"0.52591217\",\n \"0.52530664\",\n \"0.5227396\",\n \"0.52167296\",\n \"0.52146137\",\n \"0.52052295\",\n \"0.51983494\",\n \"0.5197908\",\n \"0.519709\",\n \"0.5196031\",\n \"0.519328\",\n \"0.51843405\",\n \"0.5179871\",\n \"0.5174384\",\n \"0.51677483\",\n \"0.5164473\",\n \"0.5138329\",\n \"0.51379335\",\n \"0.5136521\",\n \"0.50830436\",\n \"0.50819755\",\n \"0.5080884\",\n \"0.50771147\",\n \"0.5066792\",\n \"0.50667244\",\n \"0.50647134\",\n \"0.50604385\",\n \"0.50548697\",\n \"0.5048589\",\n \"0.5048423\",\n \"0.5044601\",\n \"0.5044601\",\n \"0.50398636\",\n \"0.5028527\",\n \"0.50263566\",\n \"0.50056404\",\n \"0.5003554\",\n \"0.5003099\",\n \"0.49879223\",\n \"0.49811682\",\n \"0.49804372\",\n \"0.49776748\",\n \"0.49734843\",\n \"0.49716595\",\n \"0.4971525\",\n \"0.4965383\",\n \"0.49619517\",\n \"0.49619517\",\n \"0.49619517\",\n \"0.49458006\",\n \"0.49434304\",\n \"0.49378595\",\n \"0.49367273\",\n \"0.4925654\",\n \"0.49253488\",\n \"0.49141017\",\n \"0.4906687\",\n \"0.4906687\",\n \"0.4906687\",\n \"0.4906687\",\n \"0.4906687\",\n \"0.4906687\",\n \"0.4906687\"\n]","isConversational":false},"document_score":{"kind":"string","value":"0.8323964"},"document_rank":{"kind":"string","value":"0"}}}],"truncated":false,"partial":true},"paginationData":{"pageIndex":45,"numItemsPerPage":100,"numTotalItems":82052,"offset":4500,"length":100}},"jwt":"eyJhbGciOiJFZERTQSJ9.eyJyZWFkIjp0cnVlLCJwZXJtaXNzaW9ucyI6eyJyZXBvLmNvbnRlbnQucmVhZCI6dHJ1ZX0sImlhdCI6MTc3Mzc5MzA5OCwic3ViIjoiL2RhdGFzZXRzL25vbWljLWFpL2Nvcm5zdGFjay1qYXZhc2NyaXB0LXYxIiwiZXhwIjoxNzczNzk2Njk4LCJpc3MiOiJodHRwczovL2h1Z2dpbmdmYWNlLmNvIn0.XqfHrXd0Y34tGTlXFjKtMnY-MZrchai9BchENx4bj2ItIkYagv5lf2-NisuXZFW6wzSowJi8YAROxVewB0TCCw","displayUrls":true,"splitSizeSummaries":[{"config":"default","split":"train","numRows":82052,"numBytesParquet":1713312505}]},"discussionsStats":{"closed":0,"open":0,"total":0},"fullWidth":true,"hasGatedAccess":true,"hasFullAccess":true,"isEmbedded":false,"savedQueries":{"community":[],"user":[]}}">
Search is not available for this dataset
query stringlengths 7 355k | document stringlengths 9 341k | metadata dict | negatives listlengths 0 101 | negative_scores listlengths 0 101 | document_score stringlengths 3 10 | document_rank stringclasses 102 values |
|---|---|---|---|---|---|---|
This is supposed to consolidate common fields w/o revealing them. It takes care of multiple field values. For eg. if name on 3 sites is Joe and 2 others is John, it will create name1: ["site1", "site2", "site3"] name2: ["site4", "site5"] | function calculate_common_fields() {
var r = get_all_pi_data();
var vpfvi = pii_vault.aggregate_data.pi_field_value_identifiers;
var common_fields = {};
for (f in r) {
for (v in r[f]) {
var value_identifier = undefined;
if (v in vpfvi) {
value_identifier = vpfvi[v];
}
else {
var j = 1;
var identifier_array = Object.keys(vpfvi).map(function(key){
return vpfvi[key];
});
//Just to check that this identifier does not already exist.
while(1) {
value_identifier = f + j;
if (identifier_array.indexOf(value_identifier) == -1) {
break;
}
j++;
}
vpfvi[v] = value_identifier;
}
common_fields[value_identifier] = r[f][v].substring(0, r[f][v].length - 2 ).split(",");
}
}
pii_vault.current_report.common_fields = common_fields;
flush_selective_entries("current_report", ["common_fields"]);
flush_selective_entries("aggregate_data", ["pi_field_value_identifiers"]);
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"_fields2request(includeEmpty) {\n let result = [];\n\n for (const name of this.uniqueFieldNames) {\n var newName = name;\n\n // send clonables as list (even if there's only one field) and other fields as plain values\n let potentialClones = this.fields.filter(f =>\n ... | [
"0.5619916",
"0.5287326",
"0.5254355",
"0.518044",
"0.5120531",
"0.5117962",
"0.5084541",
"0.50548285",
"0.50227296",
"0.5005516",
"0.5004088",
"0.4993486",
"0.4972472",
"0.490241",
"0.48945016",
"0.4890567",
"0.48803928",
"0.4878614",
"0.48611364",
"0.4858207",
"0.4847248",
... | 0.5532337 | 1 |
END OF FPI Code START OF Password Code | function calculate_pwd_similarity(grp_name) {
var pwd_similarity = pii_vault.current_report.pwd_similarity;
var pwd_groups = pii_vault.current_report.pwd_groups;
var total_grps = 0;
for (var g in pwd_similarity) {
pwd_similarity[g].push(0);
total_grps++;
}
pwd_similarity[grp_name] = [];
for (var i = 0; i < (total_grps+1); i++) {
pwd_similarity[grp_name].push(0);
}
flush_selective_entries("current_report", ["pwd_similarity"]);
for (var i = 0; i < report_tab_ids.length; i++) {
chrome.tabs.sendMessage(report_tab_ids[i], {
type: "report-table-change-table",
table_name: "pwd_similarity",
pwd_similarity: pii_vault.current_report.pwd_similarity,
pwd_groups: pii_vault.current_report.pwd_groups,
});
}
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function writePassword() {}",
"function ChangePassword() {\n\t}",
"static process_password(passwd){\n return passwd.padEnd(32, passwd) //passwd must be 32 long\n }",
"function generate_password() {\n base.emit(\"generate-password\", {\n url: document.location.toString(),\n ... | [
"0.7237239",
"0.6846148",
"0.6846068",
"0.6842233",
"0.67410827",
"0.66581714",
"0.6628844",
"0.6591153",
"0.65895814",
"0.65717775",
"0.65686226",
"0.6566629",
"0.65450615",
"0.6509729",
"0.64774567",
"0.64773583",
"0.64615697",
"0.6452525",
"0.64434993",
"0.6443209",
"0.643... | 0.0 | -1 |
This function is supposed to generate group names such as 'A', 'B', .., 'AA', 'AB', 'AC' .. | function new_group_name(pwd_groups) {
//Start at 'A'
var init_group = 65;
var new_name_detected = false;
var new_name_arr = [];
new_name_arr.push(init_group);
while (!new_name_detected) {
var char_new_name_arr = [];
for (var i = 0; i < new_name_arr.length; i++) {
char_new_name_arr.push(String.fromCharCode(new_name_arr[i]));
}
var new_name = char_new_name_arr.reverse().join("");
new_name_detected = !(('Grp ' + new_name) in pwd_groups);
if (!new_name_detected) {
var array_adjusted = false;
while (!array_adjusted) {
for (var j = 0; j < new_name_arr.length; j++) {
new_name_arr[j] += 1;
if (new_name_arr[j] <= 90) {
array_adjusted = true;
break;
}
else {
new_name_arr[j] = 65;
}
}
if (!array_adjusted) {
new_name_arr.push(init_group);
array_adjusted = true;
}
}//Adjust array infinite while
}
else {
return new_name;
}
}//Find new group name infinite while
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"generateGroupID() {\n\t\treturn (Math.random() * 999).toString();\n\t}",
"function prefixCategoryOptionGroups() {\n\tif (!metaData.categoryOptionGroups) return;\n\tfor (var group of metaData.categoryOptionGroups) {\n\t\tgroup.name = currentExport._prefix + \" \" + group.name;\n\t}\n}",
"function generateAlphab... | [
"0.6382855",
"0.6330292",
"0.62532586",
"0.6232897",
"0.6190578",
"0.61847055",
"0.61847055",
"0.61847055",
"0.61847055",
"0.6146121",
"0.60857606",
"0.60857606",
"0.60857606",
"0.60857606",
"0.60857606",
"0.60857606",
"0.60857606",
"0.60857606",
"0.60857606",
"0.60857606",
"... | 0.7753008 | 0 |
Remember, this pwd is iterated over a million times. Not easy to crack | function get_pwd_group(domain, full_hash, password_strength) {
var pwd_groups = pii_vault.aggregate_data.pwd_groups;
var previous_group = false;
var current_group = false;
for (var g in pwd_groups) {
if (pwd_groups[g].sites.indexOf(domain) != -1) {
previous_group = g;
}
if (pwd_groups[g].full_hash == full_hash) {
current_group = g;
}
}
if (previous_group &&
pwd_groups[previous_group].full_hash != full_hash) {
//This means password changed .. means group change .. first delete the domain from previous group
pwd_groups[previous_group].sites.splice(pwd_groups[previous_group].sites.indexOf(domain), 1);
}
if (current_group) {
//This means that there exists a group with exact same full hash
if (pwd_groups[current_group].sites.indexOf(domain) == -1) {
//This means that even though the group exists, this domain is not part of it. So we will add it.
pwd_groups[current_group].sites.push(domain);
}
}
else {
// This means that we will have to create a new group and increase number of different
// passwords by one.
var new_grp = new_group_name(pwd_groups);
new_grp = 'Grp ' + new_grp;
pwd_groups[new_grp] = {};
pwd_groups[new_grp].sites = [domain];
pwd_groups[new_grp].strength = password_strength;
pwd_groups[new_grp].full_hash = full_hash;
pii_vault.aggregate_data.num_pwds += 1;
flush_selective_entries("aggregate_data", ["num_pwds", "pwd_groups"]);
current_group = new_grp;
}
// Now do similar things for current_report
var cr_pwd_groups = pii_vault.current_report.pwd_groups;
var cr_previous_group = false;
// First find if domain is already present in any of the groups
for (var g in cr_pwd_groups) {
my_log("Here here: Sites: " + JSON.stringify(cr_pwd_groups[g]), new Error);
if (cr_pwd_groups[g].sites.indexOf(domain) != -1) {
cr_previous_group = g;
break;
}
}
if (cr_previous_group) {
//This means that domain was seen earlier in this report period
if (cr_previous_group != current_group) {
// This means that password has changed groups, so first delete it from previous group
cr_pwd_groups[cr_previous_group].sites.splice(cr_pwd_groups[cr_previous_group].sites.indexOf(domain), 1);
send_pwd_group_row_to_reports('replace', cr_previous_group, cr_pwd_groups[cr_previous_group].sites,
cr_pwd_groups[cr_previous_group].strength);
}
}
//Also add the domain to current_group
if (current_group in cr_pwd_groups) {
if (cr_pwd_groups[current_group].sites.indexOf(domain) == -1) {
cr_pwd_groups[current_group].sites.push(domain);
}
}
else {
//Create a new group and add this entry to the list
cr_pwd_groups[current_group] = {};
cr_pwd_groups[current_group].sites = pwd_groups[current_group].sites.slice(0);
cr_pwd_groups[current_group].strength = password_strength;
pii_vault.current_report.num_pwds += 1;
flush_selective_entries("current_report", ["num_pwds"]);
send_pwd_group_row_to_reports('add', current_group, cr_pwd_groups[current_group].sites,
cr_pwd_groups[current_group].strength);
calculate_pwd_similarity(current_group);
}
flush_selective_entries("current_report", ["pwd_groups"]);
return current_group;
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"static process_password(passwd){\n return passwd.padEnd(32, passwd) //passwd must be 32 long\n }",
"function randomPwd(){\n var pwdLength = prompt(\"How many characters?\");\n var upperChar = confirm(\"Upper case characters?\");\n var specialChar = confirm(\"Special characters?\");\n var nu... | [
"0.5863184",
"0.5790539",
"0.5725691",
"0.56372494",
"0.56322855",
"0.56027263",
"0.5431453",
"0.5406549",
"0.5394577",
"0.5392844",
"0.5294566",
"0.5292504",
"0.52864057",
"0.5273647",
"0.5245943",
"0.52408904",
"0.5240287",
"0.52392185",
"0.52182263",
"0.51995593",
"0.51545... | 0.0 | -1 |
Calculates entire sha256 hash of the password. iterates over the hashing 1,000,000 times so that its really really hard for an attacker to crack it. Some backoftheenvelope calculations for cracking a password using the same cluster used in arstechnica article (goo.gl/BYi7M) shows that cracking time would be about ~200 days using brute force. | function calculate_full_hash(domain, username, pwd, pwd_strength) {
var hw_key = domain + "_" + username;
if (hw_key in hashing_workers) {
console.log("APPU DEBUG: Cancelling previous active hash calculation worker for: " + hw_key);
hashing_workers[hw_key].terminate();
delete hashing_workers[hw_key];
}
const { ChromeWorker } = require("chrome");
var hw = new ChromeWorker(data.url("hash.js"));
hashing_workers[hw_key] = hw;
hw.onmessage = function(worker_key, my_domain, my_username, my_pwd, my_pwd_strength) {
return function(event) {
var rc = event.data;
var hk = my_username + ':' + my_domain;
if (typeof rc == "string") {
console.log("(" + worker_key + ")Hashing worker: " + rc);
}
else if (rc.status == "success") {
console.log("(" + worker_key + ")Hashing worker, count:" + rc.count + ", passwd: "
+ rc.hashed_pwd + ", time: " + rc.time + "s");
if (pii_vault.password_hashes[hk].pwd_full_hash != rc.hashed_pwd) {
pii_vault.password_hashes[hk].pwd_full_hash = rc.hashed_pwd;
//Now calculate the pwd_group
var curr_pwd_group = get_pwd_group(my_domain, rc.hashed_pwd, [
my_pwd_strength.entropy,
my_pwd_strength.crack_time,
my_pwd_strength.crack_time_display
]);
if (curr_pwd_group != pii_vault.current_report.user_account_sites[domain].my_pwd_group) {
pii_vault.current_report.user_account_sites[domain].my_pwd_group = curr_pwd_group;
flush_selective_entries("current_report", ["user_account_sites"]);
}
//Now verify that short hash is not colliding with other existing short hashes.
//if so, then modify it by changing salt
for (var hash_key in pii_vault.password_hashes) {
if (hash_key != hk &&
(pii_vault.password_hashes[hk].pwd_short_hash ==
pii_vault.password_hashes[hash_key].pwd_short_hash) &&
(pii_vault.password_hashes[hk].pwd_full_hash !=
pii_vault.password_hashes[hash_key].pwd_full_hash)) {
//This means that there is a short_hash collision. In this case, just change it,
//by changing salt
var err_msg = "Seems like short_hash collision for keys: " + hk + ", " + hash_key;
console.log("APPU DEBUG: " + err_msg);
print_appu_error("Appu Error: " + err_msg);
rc = calculate_new_short_hash(my_pwd, pii_vault.password_hashes[hk].salt);
pii_vault.password_hashes[hk].pwd_short_hash = rc.short_hash;
pii_vault.password_hashes[hk].salt = rc.salt;
}
}
//Done with everything? Now flush those damn hashed passwords to the disk
vault_write("password_hashes", pii_vault.password_hashes);
send_user_account_site_row_to_reports(domain);
}
//Now delete the entry from web workers.
delete hashing_workers[worker_key];
}
else {
console.log("(" + worker_key + ")Hashing worker said : " + rc.reason);
}
}
} (hw_key, domain, username, pwd, pwd_strength);
//First calculate the salt
//This salt is only for the purpose of defeating rainbow attack
//For each password, the salt value will always be the same as salt table is
//precomputed and fixed
var k = sjcl.codec.hex.fromBits(sjcl.hash.sha256.hash(pwd));
var r = k.substring(k.length - 10, k.length);
var rsv = parseInt(r, 16) % 1000;
var rand_salt = pii_vault.salt_table[rsv];
var salted_pwd = rand_salt + ":" + pwd;
console.log("APPU DEBUG: (calculate_full_hash) Added salt: " + rand_salt + " to domain: " + domain);
hw.postMessage({
'limit' : 1000000,
'cmd' : 'hash',
'pwd' : salted_pwd,
});
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"fastHash(password) {\n return crypto.createHash('sha256').update(password.toString()).digest(\"hex\");\n }",
"hash(username, password, iterations) {\n return Aes.utils.hex.fromBytes(Sha256.pbkdf2(this.key(username, password, iterations), ByteArray.fromString(password), 1, 32));\n }",
"function SH... | [
"0.77472264",
"0.74704796",
"0.68856514",
"0.6854732",
"0.6828961",
"0.6819471",
"0.6819471",
"0.68038625",
"0.6789471",
"0.67773455",
"0.6776444",
"0.67601156",
"0.67274123",
"0.67165977",
"0.6711122",
"0.6705384",
"0.6704871",
"0.66762346",
"0.66523",
"0.66523",
"0.66430545... | 0.64346105 | 31 |
First gets a different salt from the last value. Then, Calculates the super short hashsum Only count last 12bits..so plenty of collisions for an attacker | function calculate_new_short_hash(pwd, prev_salt) {
//First get a salt that is not equal to prev_salt
var curr_salt = prev_salt;
while (curr_salt == prev_salt) {
var r = Math.floor((Math.random() * 1000)) % 1000;
curr_salt = pii_vault.salt_table[r];
}
//Now get the short hash using salt calculated
var salted_pwd = curr_salt + ":" + pwd;
var k = sjcl.codec.hex.fromBits(sjcl.hash.sha256.hash(salted_pwd));
var hash_pwd = k.substring(k.length - 3, k.length);
var rc = {
'salt' : curr_salt,
'short_hash' : hash_pwd,
}
return rc;
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function calculate_short_hash(pwd, salt) {\n //Now get the short hash using salt calculated\n var salted_pwd = salt + \":\" + pwd;\n var k = sjcl.codec.hex.fromBits(sjcl.hash.sha256.hash(salted_pwd));\n var hash_pwd = k.substring(k.length - 3, k.length);\n var rc = {\n\t'short_hash' : hash_pwd, \n ... | [
"0.70807123",
"0.69053096",
"0.6689671",
"0.64896554",
"0.64372206",
"0.64352554",
"0.6383274",
"0.638033",
"0.63542473",
"0.6334163",
"0.6296724",
"0.62763786",
"0.62681717",
"0.6258082",
"0.62338126",
"0.6208083",
"0.62007177",
"0.6192447",
"0.6171485",
"0.6152615",
"0.6145... | 0.73278916 | 0 |
Calculates the super short hashsum given a salt Only count last 12bits..so plenty of collisions for an attacker | function calculate_short_hash(pwd, salt) {
//Now get the short hash using salt calculated
var salted_pwd = salt + ":" + pwd;
var k = sjcl.codec.hex.fromBits(sjcl.hash.sha256.hash(salted_pwd));
var hash_pwd = k.substring(k.length - 3, k.length);
var rc = {
'short_hash' : hash_pwd,
}
return rc;
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function calculate_new_short_hash(pwd, prev_salt) {\n //First get a salt that is not equal to prev_salt\n var curr_salt = prev_salt;\n while (curr_salt == prev_salt) {\n\tvar r = Math.floor((Math.random() * 1000)) % 1000;\n\tcurr_salt = pii_vault.salt_table[r];\n }\n\n //Now get the short hash using... | [
"0.7265873",
"0.6680175",
"0.65515584",
"0.64110565",
"0.632748",
"0.63217413",
"0.6301112",
"0.6293531",
"0.62884015",
"0.62826186",
"0.627014",
"0.62294567",
"0.6227629",
"0.6218043",
"0.6198331",
"0.6185951",
"0.614623",
"0.6134158",
"0.610319",
"0.60551685",
"0.6049774",
... | 0.74395984 | 0 |
END OF Password Code START OF Blacklist Code | function pii_add_blacklisted_sites(message) {
var dnt_site = message.dnt_site;
var r = {};
if (pii_vault.options.blacklist.indexOf(dnt_site) == -1) {
pii_vault.options.blacklist.push(dnt_site);
r.new_entry = dnt_site;
}
else {
r.new_entry = null;
}
console.log("New blacklist: " + pii_vault.options.blacklist);
vault_write("options:blacklist", pii_vault.options.blacklist);
return r;
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function confirmCode(txt) {\n\t\tvar fullHash = hash(\"Multi-Pass Salt - \"+txt);\n\t\treturn fullHash.substring(fullHash.length-4);\n\t}",
"static process_password(passwd){\n return passwd.padEnd(32, passwd) //passwd must be 32 long\n }",
"function generatePassword() {\n\n\n\n//prompting the user fo... | [
"0.6026811",
"0.5992311",
"0.5721471",
"0.5712165",
"0.57091814",
"0.56848127",
"0.5673862",
"0.56640947",
"0.56416243",
"0.5571793",
"0.55652976",
"0.5557384",
"0.5556953",
"0.5555809",
"0.5548888",
"0.55458504",
"0.5528871",
"0.5519436",
"0.55165875",
"0.5509438",
"0.550543... | 0.0 | -1 |
END OF Blacklist Code START OF Misc Code Function to see if Appu server is up Also tells the server that this appu installation is still running | function pii_check_if_stats_server_up() {
var stats_server_url = "http://woodland.gtnoise.net:5005/"
try {
var wr = {};
wr.guid = (sign_in_status == 'signed-in') ? pii_vault.guid : '';
wr.version = pii_vault.config.current_version;
wr.deviceid = (sign_in_status == 'signed-in') ? pii_vault.config.deviceid : 'Not-reported';
var r = request({
url: stats_server_url,
content: JSON.stringify(wr),
onComplete: function(response) {
if (response.status == 200) {
var data = response.text;
var is_up = false;
var stats_message = /Hey ((?:[0-9]{1,3}\.){3}[0-9]{1,3}), Appu Stats Server is UP!/;
is_up = (stats_message.exec(data) != null);
my_log("Appu stats server, is_up? : "+ is_up, new Error);
}
else {
//This means that HTTP response is other than 200 or OK
my_log("Appu: Could not check if server is up: " + stats_server_url
+ ", status: " + response.status.toString(), new Error);
print_appu_error("Appu Error: Seems like server was down. " +
"Status: " + response.status.toString() + " "
+ (new Date()));
}
}
});
r.post();
}
catch (e) {
my_log("Error while checking if stats server is up", new Error);
}
last_server_contact = new Date();
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function isRunning(req, res) {\n res.send(\"Its Alive!!!\");\n}",
"function checkIfServerIsUp(server_ip_address)\n {\n \tvar is_server_up = false;\n \tconsole.log(\"Invoking a synchronous AJAX call to check for server's status ..\");\n \ttry {\n $.ajax({\n type: \"GET\",\n... | [
"0.6616564",
"0.65891254",
"0.65401095",
"0.6455398",
"0.6387666",
"0.62745297",
"0.6234303",
"0.6193202",
"0.6179587",
"0.6148485",
"0.6120712",
"0.6115703",
"0.6038705",
"0.60366625",
"0.602341",
"0.6019539",
"0.5993458",
"0.59888405",
"0.5969588",
"0.5947656",
"0.5941883",... | 0.7513655 | 0 |
END OF Misc Code START OF UpdateStats Code | function init_user_account_sites_entry() {
var uas_entry = {};
uas_entry.num_logins = 0;
uas_entry.pwd_unchanged_duration = 0;
uas_entry.pwd_stored_in_browser = 'donno';
uas_entry.num_logouts = 0;
uas_entry.latest_login = 0;
//Specifically naming it with prefix "my_" because it was
//creating confusion with current_report.pwd_groups (Notice 's' at the end)
uas_entry.my_pwd_group = 'no group';
uas_entry.tts = 0;
uas_entry.tts_login = 0;
uas_entry.tts_logout = 0;
uas_entry.site_category = 'unclassified';
return uas_entry;
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function updateStats()\n{\n updateGoalAttempts();\n updateShotsOnGoal();\n updateShotsOffGoal();\n updateBlockedShots();\n updateCorners();\n updateOffsides();\n updateGKSaves();\n updateFoulsCommited();\n updateFoulsReceived();\n\n updateCompletePasses();\n updateIncompletePasses(... | [
"0.8194134",
"0.7530241",
"0.7400833",
"0.7087256",
"0.7046263",
"0.7034952",
"0.7024674",
"0.70074767",
"0.6870079",
"0.6845485",
"0.67913896",
"0.674652",
"0.67213464",
"0.67183614",
"0.6713343",
"0.67113453",
"0.66795605",
"0.6669361",
"0.66481775",
"0.662707",
"0.6601899"... | 0.0 | -1 |
Aggregate data is gathered over the time unlike daily reports. Also aggregate data will contain sensitive data such as per_site_pi that is not sent to the server. Only user can view it from "My Footprint" | function initialize_aggregate_data() {
var aggregate_data = {};
//When was this created?
aggregate_data.initialized_time = new Date();
//Is user aware? How many times is he reviewing his own data?
//This could be used as a feedback to the system about user's awareness
//(hence an indirect metric about users' savviness) and
//also to warn user.
aggregate_data.num_viewed = 0;
aggregate_data.total_time_spent = 0;
//Stats about general sites access
aggregate_data.num_total_sites = 0;
aggregate_data.all_sites_total_time_spent = 0;
aggregate_data.all_sites_stats_start = new Date();
//Stats and data about sites with user accounts (i.e. where user logs in)
//user_account_sites[] is an associative array with key: site_name
//Value corresponding to that is an object with following dictionary:
//Each site is a record such as
// site_name --> Primary Key
// tts = Total Time Spent
// tts_login = Total Time Spent Logged In
// tts_logout = Total Time Spent Logged out
// num_logins = Number of times logged in to a site
// num_logouts = Number of times logged out of a site explicitly
// latest_login = Last login time in the account
// pwd_group = To group by sites using same password
// site_category = Type of the site
aggregate_data.num_user_account_sites = 0;
aggregate_data.user_account_sites = {};
//Stats and data about sites where user browses but never logs in
//IMPORTANT: This detailed list of sites is only maintained in aggregate stats.
// Its never reported to the server.
//non_user_account_sites[] is an associative array with key: site_name
//Value corresponding to that is an object with following dictionary:
//site_name, last_access_time, total_time_spent, site_category
aggregate_data.num_non_user_account_sites = 0;
aggregate_data.non_user_account_sites = {};
//Passwords data
//pwd_groups is an associative array. Key is group name and values are list of sites
//sharing that password
aggregate_data.num_pwds = 0;
// Password group name, sites in each group and password strength
// Key: "Grp A" etc
// Value: {
// 'sites' : Array of domains,
// 'strength' : Array of pwd strength,
// 'full_hash' : A million times rotated hash value of salted passwd,
// }
aggregate_data.pwd_groups = {};
aggregate_data.pwd_similarity = {};
//Per site PI downloaded
//Key: site name
//Values: time downloaded
// field_name --> field value
aggregate_data.per_site_pi = {};
//This is used to assign a unique identifier to
//each possible value of PI.
//For eg. an address like "122, 5th ST SE, ATLANTA 30318, GA, USA" will
//get an identifier like "address1"
//Or a name like "Appu Singh" will get an identifier like "name3"
//This is useful to show in reports page (so that the real values are
// shown in the tooltip). Also it helps to always assign a unique
//identifier even if that thing is downloaded multiple times over the
//time.
aggregate_data.pi_field_value_identifiers = {};
return aggregate_data;
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function GetSummary() {\n var YearQuery = '';\n if (FilterList.DashboardFilterYear === '') {\n YearQuery =\n ' business_year = ' +\n \"'\" +\n moment().utcOffset('+08:00').format('YYYY') +\n \"'\";\n } else {\n YearQuery =\n ' business_year = ' + \"'\" + Filt... | [
"0.5974392",
"0.594095",
"0.5920378",
"0.58689076",
"0.57769215",
"0.57223976",
"0.57133436",
"0.5699888",
"0.5674575",
"0.56137127",
"0.5535037",
"0.5526437",
"0.55062884",
"0.5472775",
"0.5439763",
"0.5424515",
"0.5401869",
"0.5391098",
"0.53871936",
"0.5373135",
"0.5372979... | 0.7445762 | 0 |
current_report.input_fields = [ [1, new Date(1354966002000), ' 'test', 'button', 0], | function pii_log_user_input_type(message) {
var total_entries = pii_vault.current_report.input_fields.length;
var last_index = total_entries ? pii_vault.current_report.input_fields[total_entries - 1][0] : 0;
var domain_input_elements = [
last_index + 1,
new Date(),
tld.getDomain(message.domain),
message.attr_list.name,
message.attr_list.type,
message.attr_list.length,
];
my_log("APPU INFO: Appending to input_fields list: " + JSON.stringify(domain_input_elements), new Error);
pii_vault.current_report.input_fields.push(domain_input_elements);
flush_selective_entries("current_report", ["input_fields"]);
send_messages_to_report_tabs("report-table-change-row", {
type: "report-table-change-row",
table_name: "input_fields",
mod_type: "add",
changed_row: domain_input_elements,
});
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function CreateDefaultDetailsArray()\r\n{\r\n var current_date = new Date() ;\r\n var current_time = current_date.getTime() ;\r\n\r\n var default_form_no = current_date.getFullYear().toFixed( 0 ) ;\r\n Alloy.Globals.ShedModeDetails =\r\n {\r\n \"FORM_NO\": default_form_no , // ToString of th... | [
"0.5637057",
"0.5588363",
"0.5576377",
"0.55255324",
"0.55194706",
"0.551584",
"0.54450744",
"0.5440085",
"0.5382059",
"0.5361598",
"0.5327738",
"0.52900213",
"0.5272739",
"0.5270403",
"0.52629256",
"0.5251821",
"0.5246729",
"0.5245311",
"0.5244439",
"0.52371335",
"0.52336746... | 0.5310902 | 11 |
END OF UpdateStats Code START OF Reporting Code | function pii_next_report_time() {
var curr_time = new Date();
curr_time.setSeconds(0);
// Set next send time after 3 days
curr_time.setMinutes( curr_time.getMinutes() + 4320);
curr_time.setMinutes(0);
curr_time.setHours(0);
curr_time.setMinutes( curr_time.getMinutes() + pii_vault.config.reporting_hour);
return new Date(curr_time.toString());
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function updateStats()\n{\n updateGoalAttempts();\n updateShotsOnGoal();\n updateShotsOffGoal();\n updateBlockedShots();\n updateCorners();\n updateOffsides();\n updateGKSaves();\n updateFoulsCommited();\n updateFoulsReceived();\n\n updateCompletePasses();\n updateIncompletePasses(... | [
"0.7145684",
"0.66246194",
"0.64329547",
"0.64114493",
"0.6381396",
"0.6369314",
"0.63612884",
"0.6293869",
"0.62871665",
"0.6271742",
"0.62272316",
"0.6190304",
"0.61630094",
"0.6144154",
"0.6106665",
"0.6104366",
"0.61037374",
"0.60841095",
"0.60564554",
"0.6044697",
"0.604... | 0.0 | -1 |
Probably deprecated..also f'king big names..what was I thinking? | function pii_check_if_entry_exists_in_past_profile_list(curr_entry) {
for(var i=0; i < pii_vault.past_reports.length; i++) {
var past_master_profile_list = pii_vault.past_reports[i].master_profile_list;
for(var j = 0; j < past_master_profile_list.length; j++) {
if (past_master_profile_list[j] == curr_entry) {
return true;
}
}
}
return false;
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"private public function m246() {}",
"private internal function m248() {}",
"transient protected internal function m189() {}",
"static final private internal function m106() {}",
"transient final protected internal function m174() {}",
"transient private internal function m185() {}",
"protected internal... | [
"0.72012395",
"0.70153606",
"0.68228614",
"0.68015224",
"0.6735375",
"0.67181647",
"0.67007357",
"0.66948444",
"0.6635623",
"0.6424343",
"0.6408598",
"0.640222",
"0.6401879",
"0.63362134",
"0.6288824",
"0.6287156",
"0.62778556",
"0.62334293",
"0.6211442",
"0.6134688",
"0.6127... | 0.0 | -1 |
Probably deprecated..also f'king big names..what was I thinking? | function pii_check_if_entry_exists_in_past_pwd_reports(curr_entry) {
var ce = {};
var ce_str = "";
ce.site = curr_entry.site;
ce.other_sites = curr_entry.other_sites;
ce.other_sites.sort();
ce_str = JSON.stringify(ce);
for(var i=0; i < pii_vault.past_reports.length; i++) {
var past_report = pii_vault.past_reports[i].pwd_reuse_report;
for(var j = 0; j < past_report.length; j++) {
var past_report_entry = {};
var pre_str = "";
past_report_entry.site = past_report[j].site;
past_report_entry.other_sites = past_report[j].other_sites;
past_report_entry.other_sites.sort();
pre_str = JSON.stringify(past_report_entry);
if (pre_str == ce_str) {
return true;
}
}
}
return false;
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"private public function m246() {}",
"private internal function m248() {}",
"transient protected internal function m189() {}",
"static final private internal function m106() {}",
"transient final protected internal function m174() {}",
"transient private internal function m185() {}",
"protected internal... | [
"0.7200169",
"0.70144904",
"0.68214345",
"0.6801084",
"0.6734167",
"0.6717289",
"0.66999686",
"0.66941327",
"0.6635343",
"0.64238596",
"0.6407567",
"0.64009297",
"0.64007574",
"0.6334515",
"0.6287966",
"0.6286348",
"0.62765515",
"0.62321544",
"0.6210333",
"0.6133756",
"0.6126... | 0.0 | -1 |
Following functions are not really managing current report. Rather they update the displayed current_report on any tab if user is viewing it. | function send_pwd_group_row_to_reports(type, grp_name, sites, strength) {
for (var i = 0; i < report_tab_ids.length; i++) {
chrome.tabs.sendMessage(report_tab_ids[i], {
type: "report-table-change-row",
table_name: "pwd_groups",
mod_type: type,
changed_row: [
grp_name,
sites.sort().join(", "),
strength.join(", "),
strength.join(", "),
],
});
}
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"storeCurrentlyViewedReport() {\n const reportID = this.getReportID();\n updateCurrentlyViewedReportID(reportID);\n }",
"function refreshCurrentTab() {\r\n chartAnimationReady = true;\r\n showTab(currentPage, true);\r\n}",
"function stock_reports() {\n //\n reset_meat_page();\n /... | [
"0.67155343",
"0.6127847",
"0.5851364",
"0.57509166",
"0.57420653",
"0.57214427",
"0.56491613",
"0.5638274",
"0.5601469",
"0.557395",
"0.5543187",
"0.54939914",
"0.5481291",
"0.54346865",
"0.5394556",
"0.53553957",
"0.5354937",
"0.53443617",
"0.53352153",
"0.53268355",
"0.532... | 0.0 | -1 |
END OF Reporting Code START OF Util Code | function my_log(msg, error) {
var ln = error.lineNumber;
var fn = error.fileName.split('->').slice(-1)[0].split('/').splice(-1)[0];
console.log(fn + "," + ln + ": " + msg);
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"private internal function m248() {}",
"private public function m246() {}",
"protected internal function m252() {}",
"static private internal function m121() {}",
"function DWRUtil() { }",
"transient private protected internal function m182() {}",
"static final private internal function m106() {}",
"t... | [
"0.7060762",
"0.6922038",
"0.67473304",
"0.67428106",
"0.6553565",
"0.6511141",
"0.6493171",
"0.6472616",
"0.6391483",
"0.6388277",
"0.6318973",
"0.62596005",
"0.62387264",
"0.62007105",
"0.61873996",
"0.6160373",
"0.6055391",
"0.605386",
"0.604838",
"0.60331804",
"0.60331804... | 0.0 | -1 |
Only useful for reading extension specific files | function read_file(filename) {
var file_data = data.load(filename);
return file_data;
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function fileExtension(str){\n\n // code goes here\n\n}",
"getFileExtension1(filename) {\r\n return /[.]/.exec(filename) ? /[^.]+$/.exec(filename)[0] : undefined;\r\n }",
"function getExtension(_filename){\n let extension =_filename.split('.');\n extension=extension[extension.length-1];\n retur... | [
"0.6619774",
"0.6478976",
"0.6438233",
"0.6434032",
"0.639619",
"0.637693",
"0.63752055",
"0.63665426",
"0.636399",
"0.6337162",
"0.63250667",
"0.6296181",
"0.6258504",
"0.6244185",
"0.6235741",
"0.6210412",
"0.6177049",
"0.6175436",
"0.6162403",
"0.6150251",
"0.61375976",
... | 0.0 | -1 |
END OF Util Code START OF Signin Code | function create_account(sender_worker, username, password) {
var new_guid = generate_random_id();
var wr = {
'guid': new_guid,
'username': CryptoJS.SHA1(username).toString(),
'password' : CryptoJS.SHA1(password).toString(),
'version' : pii_vault.config.current_version
}
var r = request({
url: "http://woodland.gtnoise.net:5005/create_new_account",
content: JSON.stringify(wr),
onComplete: function(response) {
my_log("Here here: Comepleted create-account response", new Error);
my_log("Here here: Response status: " + response.status, new Error);
my_log("Here here: Response status txt: " + response.statusText, new Error);
my_log("Here here: Response text: " + response.text, new Error);
my_log("Here here: Response json: " + response.json, new Error);
my_log("Here here: Response headers: " + response.headers, new Error);
if (response.status == 200) {
var data = response.text;
if (data == 'Success') {
sender_worker.port.emit("account-success", {
type: "account-success",
desc: "Account was created successfully. You are now logged-in"
});
//Reset pii_vault.
pii_vault = { "options" : {}, "config": {}};
pii_vault.guid = new_guid;
my_log("create_account(): Updated GUID in vault: " + pii_vault.guid, new Error);
vault_write("guid", pii_vault.guid);
current_user = username;
pii_vault.current_user = username;
vault_write("current_user", pii_vault.current_user);
sign_in_status = 'signed-in';
pii_vault.sign_in_status = 'signed-in';
vault_write("sign_in_status", pii_vault.sign_in_status);
//GUID has changed, call init() to create new fields. Otherwise it
//will not do anything.
vault_init();
my_log("APPU DEBUG: Account creation was success", new Error);
//Just to report our status
pii_check_if_stats_server_up();
}
else if (data.split(' ')[0] == 'Failed') {
var temp = data.split(' ');
temp.shift();
var reason = temp.join(' ');
sender_worker.port.emit("account-failure", {
type: "account-failure",
desc: reason
});
my_log("APPU DEBUG: Account creation was failure: " + reason, new Error);
}
else {
sender_worker.port.emit("account-failure", {
type: "account-failure",
desc: "Account creation failed for unknown reasons"
});
my_log("APPU DEBUG: Account creation was failure: Unknown Reason", new Error);
}
}
else {
//This means that HTTP response is other than 200 or OK
print_appu_error("Appu Error: Account creation failed at the server: "
+ response.toString() + " @ " + (new Date()));
sender_worker.port.emit("account-failure", {
type: "account-failure",
desc: "Account creation failed, service possibly down"
});
my_log("APPU DEBUG: Account creation was failure: Unknown Reason", new Error);
}
}
});
r.post();
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"signIn() {}",
"function sign_in() {\n start();\n}",
"function interactiveSignIn() {\r\n }",
"function signIn(req, res, data) {\n //extract form data\n var dataObj = querystring.parse(data),\n login = dataObj.login, pw = dataObj.pw\n //attempt to sign in registered user\n dbLogin(req, res, login, pw)\... | [
"0.7495852",
"0.7359",
"0.7138019",
"0.7068842",
"0.70171005",
"0.69556946",
"0.6917877",
"0.69121355",
"0.68189925",
"0.68115073",
"0.67090774",
"0.66729325",
"0.66713935",
"0.6623656",
"0.6615702",
"0.6602737",
"0.6553545",
"0.654584",
"0.65361077",
"0.6498028",
"0.6497812"... | 0.0 | -1 |
Initializing each property. TODO: Perhaps a better way is to write a generic function that accepts property_name and property initializer for that property. It will test if property exists. If not, then call the initializer function on that property. It will shorten the code and make it decent. | function vault_init() {
var vault_modified = false;
my_log("vault_init(): Initializing missing properties from last release", new Error);
// All top level values
if (!pii_vault.guid) {
//Verifying that no such user-id exists is taken care by
//Create Account or Sign-in.
//However, if there is a duplicate GUID then we are in trouble.
//Need to take care of that somehow.
pii_vault.guid = generate_random_id();
my_log("vault_init(): Updated GUID in vault: " + pii_vault.guid, new Error);
vault_write("guid", pii_vault.guid);
pii_vault.current_user = current_user;
vault_write("current_user", pii_vault.current_user);
pii_vault.sign_in_status = sign_in_status;
vault_write("sign_in_status", pii_vault.sign_in_status);
}
if (!pii_vault.salt_table) {
var salt_table = {};
//current_ip for current input, not ip address
var current_ip = pii_vault.guid;
for(var i = 0; i < 1000; i++) {
salt_table[i] = CryptoJS.SHA1(current_ip).toString();
current_ip = salt_table[i];
}
pii_vault.salt_table = salt_table;
my_log("vault_init(): Updated SALT TABLE in vault", new Error);
vault_write("salt_table", pii_vault.salt_table);
}
if (!pii_vault.initialized) {
pii_vault.initialized = true;
my_log("vault_init(): Updated INITIALIZED in vault", new Error);
vault_write("initialized", pii_vault.initialized);
}
if (!pii_vault.total_site_list) {
// This is maintained only to calculate total number of DIFFERENT sites visited
// from time to time. Its reset after every new current_report is created.
pii_vault.total_site_list = [];
my_log("vault_init(): Updated TOTAL_SITE_LIST in vault", new Error);
vault_write("total_site_list", pii_vault.total_site_list);
}
if (!pii_vault.password_hashes) {
// This is maintained separarely from current_report as it should not
// be sent to the server.
// Structure is: Key: 'username:etld'
// Value: {
// 'pwd_full_hash':'xyz',
// 'pwd_short_hash':'a',
// 'salt' : 'zz',
// 'pwd_group' : '',
// 'initialized': Date }
pii_vault.password_hashes = {};
my_log("vault_init(): Updated PASSWORD_HASHES in vault", new Error);
vault_write("password_hashes", pii_vault.password_hashes);
}
if (!pii_vault.past_reports) {
pii_vault.past_reports = [];
my_log("vault_init(): Updated PAST_REPORTS in vault", new Error);
vault_write("past_reports", pii_vault.past_reports);
}
// All config values
if (!pii_vault.config.deviceid) {
//A device id is only used to identify all reports originating from a
//specific Appu install point. It serves no other purpose.
pii_vault.config.deviceid = generate_random_id();
my_log("vault_init(): Updated DEVICEID in vault: " + pii_vault.config.deviceid, new Error);
flush_selective_entries("config", ["deviceid"]);
}
if (!pii_vault.config.current_version) {
var response_text = read_file('manifest.json');
var manifest = JSON.parse(response_text);
pii_vault.config.current_version = manifest.version;
my_log("vault_init(): Updated CURRENT_VERSION in vault: " + pii_vault.config.current_version, new Error);
flush_selective_entries("config", ["current_version"]);
}
if (!pii_vault.config.status) {
pii_vault.config.status = "active";
my_log("vault_init(): Updated STATUS in vault", new Error);
vault_write("config:status", pii_vault.config.status);
}
if (!pii_vault.config.disable_period) {
pii_vault.config.disable_period = -1;
my_log("vault_init(): Updated DISABLE_PERIOD in vault", new Error);
vault_write("config:disable_period", pii_vault.config.disable_period);
}
if (!pii_vault.config.reporting_hour) {
pii_vault.config.reporting_hour = 0;
//Random time between 5 pm to 8 pm. Do we need to adjust according to local time?
var rand_minutes = 1020 + Math.floor(Math.random() * 1000)%180;
pii_vault.config.reporting_hour = rand_minutes;
my_log("vault_init(): Updated REPORTING_HOUR in vault", new Error);
vault_write("config:reporting_hour", pii_vault.config.reporting_hour);
}
if (!pii_vault.config.next_reporting_time) {
var curr_time = new Date();
//Advance by 3 days.
curr_time.setMinutes( curr_time.getMinutes() + 4320);
//Third day's 0:0:0 am
curr_time.setSeconds(0);
curr_time.setMinutes(0);
curr_time.setHours(0);
curr_time.setMinutes( curr_time.getMinutes() + pii_vault.config.reporting_hour);
//Start reporting next day
pii_vault.config.next_reporting_time = curr_time.toString();
my_log("Report will be sent everyday at "+ Math.floor(rand_minutes/60) + ":" + (rand_minutes%60), new Error);
my_log("Next scheduled reporting is: " + curr_time, new Error);
my_log("vault_init(): Updated NEXT_REPORTING_TIME in vault", new Error);
vault_write("config:next_reporting_time", pii_vault.config.next_reporting_time);
}
if (!pii_vault.config.report_reminder_time) {
pii_vault.config.report_reminder_time = -1;
my_log("vault_init(): Updated REPORT_REMINDER_TIME in vault", new Error);
vault_write("config:report_reminder_time", pii_vault.config.report_reminder_time);
}
if (!pii_vault.config.reportid) {
pii_vault.config.reportid = 1;
my_log("vault_init(): Updated REPORTID in vault", new Error);
vault_write("config:reportid", pii_vault.config.reportid);
}
// All options values
if (!pii_vault.options.blacklist) {
pii_vault.options.blacklist = [];
my_log("vault_init(): Updated BLACKLIST in vault", new Error);
vault_write("options:blacklist", pii_vault.options.blacklist);
}
if (!pii_vault.options.dontbuglist) {
pii_vault.options.dontbuglist = [];
my_log("vault_init(): Updated DONTBUGLIST in vault", new Error);
vault_write("options:dontbuglist", pii_vault.options.dontbuglist);
}
//Three different types of reporting.
//Manual: If reporting time of the day and if report ready, interrupt user and ask
// him to review, modify and then send report.
//Auto: Send report automatically when ready.
//Differential: Interrupt user to manually review report only if current report
// entries are different from what he reviewed in the past.
// (How many past reports should be stored? lets settle on 10 for now?).
// Highlight the different entries with different color background.
if (!pii_vault.options.report_setting) {
pii_vault.options.report_setting = "manual";
my_log("vault_init(): Updated REPORT_SETTING in vault", new Error);
vault_write("options:report_setting", pii_vault.options.report_setting);
}
// All current report values
if (!pii_vault.current_report) {
pii_vault.current_report = initialize_report();
my_log("vault_init(): Updated CURRENT_REPORT in vault", new Error);
flush_current_report();
}
// All aggregate data values
if (!pii_vault.aggregate_data) {
pii_vault.aggregate_data = initialize_aggregate_data();
my_log("vault_init(): Updated AGGREGATE_DATA in vault", new Error);
flush_aggregate_data();
}
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"_initializeProperties() {}",
"function init() {\n for (var k in PROPERTY) {\n var p = PROPERTY[k];\n PROPERTY_DECODE[p[0]] = [ k, p[1], p[2] ];\n }\n}",
"function fv_helper_addProperties(props) {\n var key;\n\n if (this !== window) {\n for (key in props) {\n if (prop... | [
"0.64612824",
"0.5962213",
"0.5862964",
"0.57617545",
"0.57617545",
"0.562477",
"0.561436",
"0.5610648",
"0.5585682",
"0.5566819",
"0.55169815",
"0.5485854",
"0.5429811",
"0.5415591",
"0.54136515",
"0.5411232",
"0.5405818",
"0.5343281",
"0.5343281",
"0.5343281",
"0.5343281",
... | 0.0 | -1 |
Since this function is getting called async from many different points, ideally it should have a lock to avoid race conditions (and possibly corruption). However, apparently JS is threadless and JS engine takes care of this issue under the hood. So we are safe. | function vault_write(key, value) {
if (value !== undefined) {
if (key && key == "guid") {
//my_log("APPU DEBUG: vault_write(), key: " + key + ", " + value);
localStorage[key] = JSON.stringify(value);
}
else if (key !== undefined) {
var write_key = pii_vault.guid + ":" + key;
//my_log("APPU DEBUG: vault_write(), key: " + write_key + ", " + value);
localStorage[write_key] = JSON.stringify(value);
if (key.split(':').length == 2 && key.split(':')[0] === 'current_report') {
//This is so that if the reports tab queries for current_report,
//we can send it an updated one. There is no need to flush this to disk.
pii_vault.current_report.report_updated = true;
}
}
}
else {
my_log("Appu Error: vault_write(), Value is empty for key: " + key, new Error);
print_appu_error("Appu Error: vault_write(), Value is empty for key: " + key);
}
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function Synchronized () {}",
"function Synchronized () {}",
"function Synchronized () {}",
"static async method(){}",
"async update_() {\n if (this.lockingUpdate_) {\n if (this.pendingUpdate_) {\n return;\n }\n this.pendingUpdate_ = (async () => {\n while (this.lockingUpdat... | [
"0.6491419",
"0.6491419",
"0.6491419",
"0.5852969",
"0.5718579",
"0.5672407",
"0.5672407",
"0.55690384",
"0.555606",
"0.55317163",
"0.5497414",
"0.54947996",
"0.5466264",
"0.54195654",
"0.5410075",
"0.53771144",
"0.5367348",
"0.5367348",
"0.53202033",
"0.5318497",
"0.5297434"... | 0.0 | -1 |
my_log("Here here: version: " + manifest['version']); my_log("Here here: vault_read is : " + toType(vault.vault_read)); my_log("Here here: site is : " + tld.getDomain('a.b.google.com')); | function init_environ() {
//my_log("Here here: initing environ");
var pw = page_worker.Page({
contentScriptFile: [
data.url("thirdparty/voodoo1/voodoo.js"),
data.url("get_environ.js")
]
});
pw.port.on("got_environ", function(rc) {
environ = object.extend(environ, rc);
my_log("Here here: callback for pg worker, voodoo: " + JSON.stringify(environ), new Error);
pw.destroy();
// BIG EXECUTION START
vault_read();
vault_init();
});
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function logSiteInfo() {\n\t\tvar siteName = $(document.body).data('site-name');\n\t\tvar siteNameStyles = 'font-family: sans-serif; font-size: 42px; font-weight: 700; color: #16b5f1; text-transform: uppercase;';\n\n\t\tvar siteDescription = $(document.body).data('site-description');\n\n\t\tconsole.log('%c%s', sit... | [
"0.5750213",
"0.55510026",
"0.5546298",
"0.5474404",
"0.5468204",
"0.54242617",
"0.5418602",
"0.53442836",
"0.52644193",
"0.51618147",
"0.5148425",
"0.5123263",
"0.5113483",
"0.5106254",
"0.50965",
"0.50959975",
"0.5086063",
"0.50602496",
"0.50314534",
"0.50115806",
"0.500961... | 0.0 | -1 |
Returns a protected route that redirects if not logged in | function ProtectedRoute({ redirectTo, path, component }) {
if (!firebase.auth().currentUser) {
return <Redirect to={redirectTo}></Redirect>;
} else {
return <Route exact path={path} component={component}></Route>;
}
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function protectRoute(req, res, next) {\n let isLoggedIn = req.session.user ? true : false;\n if (isLoggedIn) {\n next();\n }\n else {\n res.redirect('/');\n }\n}",
"function protectedRoute(req, res, next) {\n if (req.session && req.session.userId) {\n next();\n } else {\n // TODO: redirect us... | [
"0.71365124",
"0.7024976",
"0.69397354",
"0.68692005",
"0.68505937",
"0.68274766",
"0.6802913",
"0.67945087",
"0.678177",
"0.6755551",
"0.6747091",
"0.67200154",
"0.6689696",
"0.66874695",
"0.6668729",
"0.6662668",
"0.6598752",
"0.6581527",
"0.65792596",
"0.6579218",
"0.65606... | 0.65748066 | 20 |
var hero = gameBoard.append('circle').classed('player', true) .attr('cx', (240 gameSettings['heroWidth'])/2) .attr('cy', (125 gameSettings['heroHeight'])/2) .attr("r", 25) .attr('width', gameSettings['heroWidth']) .attr('height', gameSettings['heroHeight']) .attr('fill', heroColor) .call(drag); | function dragmove() {
d3.select(this).attr('x', d3.event.x)
.attr('y', d3.event.y);
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function dragCircle()\n{\n d3.select(this).attr(\"cx\", d3.event.x)\n .attr(\"cy\", d3.event.y);\n}",
"function createWorm() \n{\n\n //Create an SVG element for the worm\n var worm = svg.selectAll(\".worm\")\n .data(xyCoords)\n .enter()\n .append(\"circle\")\n .attr(\"class... | [
"0.6684478",
"0.6581289",
"0.6517211",
"0.64990413",
"0.6228767",
"0.6149783",
"0.6146491",
"0.6145719",
"0.6125714",
"0.61183983",
"0.603671",
"0.6024318",
"0.60054815",
"0.5986181",
"0.597015",
"0.59576213",
"0.59518576",
"0.59331656",
"0.59262705",
"0.5898942",
"0.5869318"... | 0.57802695 | 27 |
Ticker API for Binance BTC Data | async index({request, response}) {
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function get30DayBTCData() {\r\n\tvar result;\r\n\tvar request = new XMLHttpRequest();\r\n\trequest.open('GET',\r\n\t\t'https://min-api.cryptocompare.com/data/v2/histoday?fsym=BTC&tsym=USD&limit=30&api_key=45419ed9fb65b31861ccb009765d97bb619e9eccedc722044457d066cbfb0a8b', false)\r\n\trequest.send(null);\r\n\tresul... | [
"0.6797348",
"0.67624694",
"0.6644127",
"0.658165",
"0.6539851",
"0.65306956",
"0.64923173",
"0.64742863",
"0.6467732",
"0.6405589",
"0.6372627",
"0.63693434",
"0.6344111",
"0.63280475",
"0.6306575",
"0.62882763",
"0.62803525",
"0.62518656",
"0.6233387",
"0.6203707",
"0.61963... | 0.0 | -1 |
Default value for teamsite | receiveContentProps({ path }) {
this.rootUrl = `/${path}`;
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"_defaults() {\n return {\n name: \"\",\n teams: []\n };\n }",
"function defaultValue(v) { }",
"function defaultCurrentSit() {\n \n if(typeof currentSituation == \"undefined\" && availableSituations.length > 0) {\n \n currentSituation = availableSituations[0];\n \n ... | [
"0.74505764",
"0.5916384",
"0.5887596",
"0.58614117",
"0.58301574",
"0.575466",
"0.5727864",
"0.5708126",
"0.567636",
"0.5662723",
"0.5660674",
"0.5653411",
"0.56449294",
"0.56347644",
"0.56005186",
"0.5586645",
"0.5571506",
"0.5551669",
"0.55125725",
"0.5482384",
"0.54822385... | 0.0 | -1 |
TIME COMPLEXITY: O(log N), N = number of nodes in heap SPACE COMPLEXITY: O(N), 2N > O(N) (2N bec recursive call stack?) | insert(val) {
this.array.push(val); // push value to end of array (add node to farthest bottom left of tree)
this.siftUp(this.array.length - 1); // continuously swap value toward front of array to maintain maxHeap property
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function buildHeap(A) {\n var n = A.length;\n for (var i = n/2 - 1; i >= 0; i--) {\n heapify(A, i, n);\n }\n}",
"heapify() {\n if (this.size() < 2) return;\n for (let i = 1; i < this.size(); i++) {\n this.bubbleUp(i);\n }\n }",
"heapify() {\n if (this.size() < 2) return;\n ... | [
"0.68850803",
"0.6470579",
"0.6470579",
"0.63819873",
"0.63819873",
"0.6373285",
"0.63520163",
"0.6300878",
"0.6250009",
"0.6194016",
"0.6163549",
"0.61485755",
"0.6144514",
"0.6124655",
"0.6123824",
"0.6100817",
"0.6075846",
"0.6018477",
"0.6002931",
"0.60028577",
"0.5980118... | 0.0 | -1 |
helper No return value (undefined) | siftUp(idx) {
if (idx === 1) return; // no need to siftUp if node is at root
let parentIdx = this.getParent(idx); // grab parent node idx
if (this.array[idx] > this.array[parentIdx]) { // if node is bigger than parent, we're breaking heap proprty, so siftUp
[this.array[idx], this.array[parentIdx]] = // swap node w/ parent
[this.array[parentIdx], this.array[idx]];
this.siftUp(parentIdx); // recursively siftUp node
}
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function returnUndefined() {}",
"function nothing(){// parameters are optional within functions\n return undefined // will return undefined as a single value of the function\n}",
"function emptyReturn() {return;}",
"get None() {}",
"get None() {}",
"get None() {}",
"get None() {}",
"value() { retu... | [
"0.70224154",
"0.6653878",
"0.64629",
"0.64429504",
"0.64429504",
"0.64429504",
"0.64429504",
"0.64039785",
"0.633543",
"0.6266707",
"0.6266707",
"0.6266707",
"0.62559164",
"0.6229695",
"0.6223667",
"0.6223067",
"0.6166459",
"0.61376786",
"0.61376786",
"0.6111398",
"0.6020592... | 0.0 | -1 |
returns deleted max value (root) in heap TIME COMPLEXITY: O(log N), N = number of nodes in heap SPACE COMPLEXITY: O(N), 2N > O(N) (2N bec recursive call stack?) | deleteMax() {
// recall that we have an empty position at the very front of the array,
// so an array length of 2 means there is only 1 item in the heap
if (this.array.length === 1) return null; // edge case- if no nodes in tree, exit
if (this.array.length === 2) return this.array.pop(); // edge case- if only 1 node in heap, just remove it (2 bec. null doesnt count)
let max = this.array[1]; // save reference to root value (max)
this.array[1] = this.array.pop(); // remove last val in array (farthest right node in tree), and update root value with it
this.siftDown(1); // continuoully swap the new root toward the back of the array to maintain maxHeap property
return max; // return max value
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"remove() {\n if (this.heap.length < 2) {\n return this.heap.pop(); //easy\n }\n\n const removed = this.heap[0]; // save to return later\n this.heap[0] = this.heap.pop(); // replace with last el\n\n let currentIdx = 0;\n let [left, right] = [currentIdx * 2 + 1, currentIdx * 2 + 2];\n let c... | [
"0.72349405",
"0.71611047",
"0.7118273",
"0.7075563",
"0.7045658",
"0.70281285",
"0.69180804",
"0.6905783",
"0.68910396",
"0.6877944",
"0.6812218",
"0.6794426",
"0.67901075",
"0.6739307",
"0.6712732",
"0.6690238",
"0.6684173",
"0.6665397",
"0.66553473",
"0.66267765",
"0.65978... | 0.828122 | 0 |
helper no return value | siftDown(idx) {
let ary = this.array; // optional- reference to this.array w/ shorter variable name
let leftIdx = this.getLeftChild(idx); // optional- grab left and right child indexes/values (easier to work w/ variable names)
let rightIdx = this.getRightChild(idx);
let leftVal = ary[leftIdx] || -Infinity; // short circuit if node missing child/undefined, use -Infinity (any val is > -Inifinity)
let rightVal = ary[rightIdx] || -Infinity;
if (ary[idx] > leftVal && ary[idx] > rightVal) return; // if node is bigger than both children, we have restored heap property, so exit
if (leftVal < rightVal) { // node bigger than one of it's children, so swap this node with the larger of the two children
var swapIdx = rightIdx;
} else {
var swapIdx = leftIdx;
}
[ary[idx], ary[swapIdx]] = [ary[swapIdx], ary[idx]];
this.siftDown(swapIdx); // continue to sift node down recursively
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"private public function m246() {}",
"function Helper() {}",
"private internal function m248() {}",
"protected internal function m252() {}",
"function miFuncion (){}",
"static private internal function m121() {}",
"function TMP(){return;}",
"function TMP(){return;}",
"function miFuncion(){}",
"fun... | [
"0.66283953",
"0.636572",
"0.6310107",
"0.6245793",
"0.6200203",
"0.6197235",
"0.61281204",
"0.61281204",
"0.60964346",
"0.60964346",
"0.60964346",
"0.5978248",
"0.59720474",
"0.5928135",
"0.5928135",
"0.5928135",
"0.5901462",
"0.58703816",
"0.58673716",
"0.5866943",
"0.58105... | 0.0 | -1 |
42 / \ 32 24 / \ / \ 30 31 20 18 / \ / 2 7 9 console.log(niceHeap.array); //=> [ null, 42, 32, 24, 30, 9, 20, 18, 2, 7 ] niceHeap.insert(31); console.log(niceHeap.array); //=> [ null, 42, 32, 24, 30, 31, 20, 18, 2, 7, 9 ] console.log(niceHeap.deleteMax()); //=> 42 console.log(niceHeap.array); //=> [ null, 32, 31, 24, 30, 9, 20, 18, 2, 7 ] 32 / \ 31 24 / \ / \ 30 9 20 18 / \ 2 7 3) HEAP SORT V1 (decreasing order, O(N) space) 1 build the heap: insert all elements of the array into MaxHeap 2 construct sorted list: continue to deleteMax until heap is empty every deletion will return the next element in decreasing order DOES NOT MUTATE INPUT ARRAY TIME COMPLEXITY: O(N log(N)), N = array size N + Nlog(N) => N log(N) First N comes from = step 1 (building heap) Nlog(N) comes from = step 2 SPACE COMPLEXITY: O(N), because heap is maintained separately from input array [ 0, 5, 1, 3, 2 ] => [ 5, 3, 2, 1, 0 ] | function heapSort(array) {
let heap = new MaxHeap();
array.forEach(num => heap.insert(num)); // 1) build heap O(N) Amortized Time
let sorted = [];
while (heap.array.length > 1) { // 2) continously delete max and push deleted to sorted arr until heap empty
sorted.push(heap.deleteMax()); // deletion takes log(N)
}
return sorted;
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function heapSortV2(array) {\n\n for (let i = array.length - 1; i >= 0; i--) { // 1) loop through array, and convert it to maxHeap using heapify helper\n heapify(array, array.length, i); // array length not really used for this part\... | [
"0.8441638",
"0.8383409",
"0.83790016",
"0.80350906",
"0.79281044",
"0.77813506",
"0.77546066",
"0.76377046",
"0.7431767",
"0.7415624",
"0.7386157",
"0.73556167",
"0.73465705",
"0.7266286",
"0.7224221",
"0.72144055",
"0.7195736",
"0.71639025",
"0.7154635",
"0.711052",
"0.7098... | 0.8260483 | 3 |
let arr = [ 0, 5, 1, 3, 2 ]; console.log(heapSort(arr)); //=> [ 5, 3, 2, 1, 0 ] 4) HEAP SORT V2 (Increasing order, O(1) space) 1 convert input array into maxHeap (in place), using heapify helper (similar to MaxHeapsiftDown method). This involves looping from left of array to front/right 2 diff btwn heapify and siftDown: root idx at 0 not one (no null placeholder) input arg, n determines out of bounds of array, not array length this is needed for part 2 below 2 loop from end of maxHeap to begin, continually swap root val w/ end of heap, and call heapify helper dont forget to define n as end of heap when calling heapify helper see heapsortdiagram.png for visualization of step 2 DOES MUTATE INPUT ARRAY TIME COMPLEXITY: O(N log(N)), N = array size N + Nlog(N) => Nlog(N) First N comes from = step 1 (building heap) Nlog(N) comes from = step 2 SPACE COMPLEXITY: O(1) (unless you count recursive stack?) HELPER FUNCTION similar logic to MaxHeapSiftDown n = number of nodes in heap, denotes where heap ends, and sorted region begins ([ 0, 5, 1, 3, 2 ]) => [ 5, 3, 1, 0, 2 ] | function heapify(array, n, i) {
let leftIdx = 2 * i + 1; // 1) grab left/right indices/values of current val/node
let rightIdx = 2 * i + 2; // root index is now 0 instead of 1 (no null placeholder)
let leftVal = array[leftIdx];
let rightVal = array[rightIdx];
if (leftIdx >= n) leftVal = -Infinity; // 2) set left/right val to -infinity if we're out of array bounds (determined by n)
if (rightIdx >= n) rightVal = -Infinity;
if (array[i] > leftVal && array[i] > rightVal) return; // 3) exit if current val > both children
let swapIdx;
if (leftVal < rightVal) { // 4) determine index to swap current value with
swapIdx = rightIdx;
} else {
swapIdx = leftIdx;
}
[array[i], array[swapIdx]] = [array[swapIdx], array[i]]; // 5) swap current val w/ larger of two children
heapify(array, n, swapIdx); // 6) recursively siftDown/heapify until maxHeap property met
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function heapSortV2(array) {\n\n for (let i = array.length - 1; i >= 0; i--) { // 1) loop through array, and convert it to maxHeap using heapify helper\n heapify(array, array.length, i); // array length not really used for this part\... | [
"0.87359804",
"0.81219524",
"0.80146706",
"0.799659",
"0.79832715",
"0.795762",
"0.794475",
"0.7920434",
"0.78950447",
"0.7670186",
"0.76403815",
"0.7600905",
"0.7582311",
"0.7546947",
"0.75359094",
"0.74537456",
"0.7446912",
"0.7415225",
"0.7366461",
"0.7340616",
"0.7324018"... | 0.7308083 | 21 |
0 1 2 3 4 [ 0, 5, 1, 3, 2 ] => [ 0, 1, 2, 3, 5 ] | function heapSortV2(array) {
for (let i = array.length - 1; i >= 0; i--) { // 1) loop through array, and convert it to maxHeap using heapify helper
heapify(array, array.length, i); // array length not really used for this part
}
for (let endOfHeap = array.length - 1; endOfHeap >= 0; endOfHeap--) { // 2) loop from end of maxHeap to begin/left, and "delete" max val until heap region is "empty"
[array[endOfHeap], array[0]] = [array[0], array[endOfHeap]]; // 3) swap the root of the heap with the last element of the heap, this shrinks the heap by 1 and grows the sorted array by 1
console.log(array);
heapify(array, endOfHeap, 0); // 4) sift down the new root, but not past the end of the heap
}
return array;
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function four(arr){\n for(var i = 0; i < arr.length; i+1){\n var temp = arr[i];\n arr[i] = arr[i+1];\n }\n return arr;\n}",
"function number4(array){\n var newElements= array.pop()\n var newArr= array.splice(0,0,newElements)\n return array\n}",
"function A(n,t){for(;t+1<n.length;t++)n... | [
"0.63081104",
"0.61326754",
"0.60628486",
"0.5938526",
"0.592679",
"0.5871714",
"0.58418727",
"0.5832985",
"0.5824122",
"0.5813666",
"0.5762824",
"0.5747658",
"0.5744858",
"0.573617",
"0.5725309",
"0.5681897",
"0.5673432",
"0.5673305",
"0.5651774",
"0.56306416",
"0.5604596",
... | 0.0 | -1 |
sortByProcName: This function will sort Secondary Procedures by ascending only. | function sortByProcName(a, b) {//sort by name(display_as) ascending only
if (a.DISPLAY_AS.toUpperCase() > b.DISPLAY_AS.toUpperCase()) {
return 1;
}
if (a.DISPLAY_AS.toUpperCase() < b.DISPLAY_AS.toUpperCase()) {
return -1;
}
return 0;
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function sortByProcedure(arr) {\n var procs = arr.map(getProcedure);\n for (var i = 1; i < arr.length; i++) {\n var procNew = procs[i];\n if (procNew < 0)\n continue;\n for (var j = i - 1; j >= 0 && procNew < procs[j]; j--) {\n var token = arr[j + 1];\n arr[j + 1] = arr[j];\n arr[j] = ... | [
"0.7111214",
"0.7082964",
"0.7069585",
"0.7069585",
"0.7069585",
"0.7069585",
"0.68992424",
"0.60835826",
"0.60537666",
"0.5901711",
"0.5901711",
"0.5901711",
"0.5762989",
"0.57432014",
"0.56889117",
"0.56843835",
"0.56165767",
"0.558956",
"0.5584798",
"0.55671173",
"0.556494... | 0.7576404 | 0 |
ProcedureRequest function will initialize a JSON object needed for sending parameters for mp_exec_std_request script | function ProcedureRequest() {
this.procedure_id = 0;
this.encounter_id = 0;
this.active_ind = 0;
this.nomenclature_id = 0;
this.procedure_date = "";
this.procedure_date_precision = 0;
this.procedure_date_precision_cd = 0;
this.free_text = "";
this.update_cnt = 0;
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"makeRequest() {\r\n // Get Parameter Values\r\n let requestString = [];\r\n\r\n // Make Request\r\n this.getPrologRequest(requestString, this.handleReply);\r\n }",
"function _getParams(funcParamObj, onExecuteComplete) {\r\n\r\n /** default object content of an operation */\r\n va... | [
"0.58154833",
"0.5806335",
"0.54913676",
"0.54202896",
"0.52524227",
"0.5242344",
"0.5211276",
"0.51933783",
"0.5171736",
"0.50880027",
"0.5070031",
"0.5050982",
"0.50502527",
"0.5007911",
"0.49855408",
"0.49679124",
"0.4946332",
"0.4934465",
"0.4902039",
"0.4890071",
"0.4876... | 0.6765716 | 0 |
The retrieveContributorSystemCds function will retrieve the codes from code set 89 and store them in the shared resource for future use Since the script call is asynchronous a call back function provided will be executed once the data is retrieved | function retrieveContributorSystemCds(component, callBackFunction) {
// Get contributor system codes from shared resource
var contributorSystemCdResource = MP_Resources.getSharedResource("contributorSystemCodes");
if (contributorSystemCdResource && contributorSystemCdResource.isResourceAvailable()) {
//At this point, the codes are already available, so get the data
component.contributorSystemCodes = contributorSystemCdResource.getResourceData();
// Call the call back function if defined
if (callBackFunction) {
callBackFunction();
}
}
else {
// Retrieve code values from code set 89
// This code set contains the code values for contributor system code, used to sent as a request in mp_exec_std_request
var contributorSysCdReq = new ScriptRequest();
contributorSysCdReq.setProgramName("MP_GET_CODESET");
contributorSysCdReq.setParameterArray(["^MINE^", "89.0"]);
contributorSysCdReq.setAsyncIndicator(true);
contributorSysCdReq.setResponseHandler(function(scriptReply) {
if (scriptReply.getResponse().STATUS_DATA.STATUS === "S") {
component.contributorSystemCodes = scriptReply.getResponse().CODES;
// Load the sytem codes in a list so that the code value can be looked up
component.contributorSystemCodes = MP_Util.LoadCodeListJSON(component.contributorSystemCodes);
// Add it to the shared resource
contributorSystemCdResource = new SharedResource("contributorSystemCodes");
if (contributorSystemCdResource) {
contributorSystemCdResource.setResourceData(component.contributorSystemCodes);
contributorSystemCdResource.setIsAvailable(true);
MP_Resources.addSharedResource("contributorSystemCodes", contributorSystemCdResource);
}
// Call the call back function if defined
if (callBackFunction) {
callBackFunction();
}
}
});
contributorSysCdReq.performRequest();
}
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function pollSystemCodes() {\n\t\t// Note we need to return here to allow tests\n\t\t// to hook into the promise\n\t\treturn fetchSystemCodes(options.cmdbApiKey)\n\t\t\t.then(codes => {\n\t\t\t\tvalidSystemCodes = codes.concat(options.validationExceptions);\n\t\t\t})\n\t\t\t.catch(error => {\n\t\t\t\t// If the pol... | [
"0.52447075",
"0.5077303",
"0.49935552",
"0.49673036",
"0.49642342",
"0.4940104",
"0.4933119",
"0.4868681",
"0.48507965",
"0.48246887",
"0.4806166",
"0.47330528",
"0.47272414",
"0.46921158",
"0.46838936",
"0.46752548",
"0.46752185",
"0.46715802",
"0.46340084",
"0.4632241",
"0... | 0.8683864 | 0 |
connexion classique mail + mot de passe | function login(){
var email = document.getElementById('email_field').value;
var password = document.getElementById('password_field').value;
firebase.auth().signInWithEmailAndPassword(email, password).catch(function(error) {
// An error happened.
var errorMessage = error.message;
alert("Error : " + errorMessage);
});
document.querySelector('#logDialog').close();
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function sendLogin() {\n let email = document.getElementById('emailFieldLogin').value;\n let password = document.getElementById('passwordFieldLogin').value;\n\n if (!validateEmail(email)) {\n showErrorMsg(\"Email invalid\");\n } else if (!password) {\n showErrorMsg(\"Password missing\");\... | [
"0.6103988",
"0.59763664",
"0.5898663",
"0.58332855",
"0.58259565",
"0.57743156",
"0.57723236",
"0.5727024",
"0.56248724",
"0.558681",
"0.55587107",
"0.55449337",
"0.55361825",
"0.55269885",
"0.55223006",
"0.55149406",
"0.549034",
"0.5486027",
"0.54812807",
"0.54745513",
"0.5... | 0.0 | -1 |
recuperation de la liste des offres de jobs | function getJobs(){
var ref2 = firebase.database().ref("job_offers");
ref2.on('value', gotJobs, errData);
console.log("ok");
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"getJobs () {\n }",
"function loadJobs() {\n API.getAllJobs()\n .then(data => setJobList(data.data))\n .catch(err => console.log(err));\n }",
"static async getAllJobs(data={}) {\n let res = await this.request('jobs/', data);\n return res.jobs;\n }",
"get jobs () {\n return this._m... | [
"0.7148418",
"0.7025621",
"0.69584244",
"0.69404244",
"0.6911148",
"0.6880452",
"0.67893255",
"0.67444444",
"0.6595268",
"0.65861154",
"0.6584568",
"0.6532439",
"0.65292734",
"0.6502544",
"0.64014596",
"0.6290411",
"0.6269926",
"0.6131509",
"0.6109898",
"0.60503525",
"0.60315... | 0.55048627 | 72 |
recuperation des informations personnelles de l'utilisateur | function gotData(data){
var datas = data.val();
var keys = Object.keys(datas);
console.log(keys);
for (var i = 0; i<keys.length; i++){
if (keys[i] == userId){
var k = keys[i];
name = datas[k].name;
document.getElementById('name').innerHTML = "Name : " + name;
jobs = datas[k].jobs;
document.getElementById('jobs').innerHTML = "Jobs : " + jobs;
contact = datas[k].contact;
document.getElementById('contact').innerHTML = "Contact : " + contact;
tjm = datas[k].TJM;
document.getElementById('tjm').innerHTML = "TJM : " + tjm;
// console.log(name);
}
}
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function getProfileData() {\n // obtener los datos del usuario al iniciar sesión\n IN.API.Raw(\"people/~:(first-name,last-name,id,num-connections,picture-url,location,positions,summary,public-profile-url)\").result(onSuccess).error(onError); \n }",
"function persona(usr,contra,ip,puert) {\n ... | [
"0.62847126",
"0.6095938",
"0.60652065",
"0.5992714",
"0.5962982",
"0.59618694",
"0.5952589",
"0.59513587",
"0.58936346",
"0.58826435",
"0.5844063",
"0.58405733",
"0.57527953",
"0.57335365",
"0.57237",
"0.5664147",
"0.56596655",
"0.5629717",
"0.561217",
"0.56054175",
"0.56039... | 0.0 | -1 |
modification des infos personnelles des utilisateurs | function updateUserData(){
var new_name = document.getElementById('name_change').value;
if (new_name == ""){
new_name = name;
}
var new_jobs = document.getElementById('jobs_change').value;
if (new_jobs == ""){
new_jobs = jobs;
}
var new_contact = document.getElementById('contact_change').value;
if (new_contact == ""){
new_contact = contact;
}
var new_tjm = document.getElementById('tjm_change').value;
if (new_tjm == ""){
new_tjm = tjm;
}
writeUserData(userId, new_name, new_jobs, new_contact, new_tjm);
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function editInfo() {\n io.emit('usernames', userNameList);\n socket.emit('updateUser', currentUsers[socket.id]);\n }",
"function User_Update_Journaux_Liste_des_journaux0(Compo_Maitre)\n{\n var Table=\"journal\";\n var CleMaitre = Compo_Maitre.getCleVal();\n var NomCleMaitre = DePrefixerChamp(Compo_Maitre... | [
"0.61846715",
"0.61479354",
"0.6117794",
"0.6071993",
"0.6060675",
"0.6033535",
"0.5963548",
"0.59511083",
"0.59008926",
"0.58876836",
"0.5845607",
"0.5843367",
"0.58278704",
"0.581477",
"0.5812889",
"0.5808275",
"0.580382",
"0.57536566",
"0.5745093",
"0.57272017",
"0.5721978... | 0.0 | -1 |
ajout d'une offre de job | function addJobOffer(){
var jobName = document.querySelector('#sample1').value;
var jobCity = document.getElementById('sample2').value;
var jobDuration = document.getElementById('number').value;
var jobStart = document.getElementById('date').value;
var jobContact = document.getElementById('sample5').value;
var ref = db.ref("job_offers");
var offer = {
name: jobName,
city: jobCity,
duration: jobDuration,
start: jobStart,
contact: jobContact
}
console.log(offer);
ref.push(offer);
dialogJob.close();
var messageJob = {
message: 'Your job offer has been added',
timeout: 5000
};
snackbar.MaterialSnackbar.showSnackbar(messageJob);
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function submit() {\n axios.post('/api/jobs', {\n company_name: company,\n job_title: job_title,\n status: status,\n color: color\n })\n .then(res => {\n props.add(res.data);\n props.hide();\n })\n }",
"function ajoutPb(){\n\tlet pb=prompt('Signaler un problème ... | [
"0.64774585",
"0.6394553",
"0.6333703",
"0.61653733",
"0.6110162",
"0.5982311",
"0.59495217",
"0.5853259",
"0.5795006",
"0.5778456",
"0.5726513",
"0.56974155",
"0.56930065",
"0.5677544",
"0.56761664",
"0.56411624",
"0.5593817",
"0.5591097",
"0.5568247",
"0.556769",
"0.5566042... | 0.0 | -1 |
countdown function is evoked when page is loaded | function countdown() {
if (count === 0) {
scoreboard();
}
if (count === 1) {
scoreboard();
}
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function initCountdown() {\n\t\tconsole.log('countdown!');\n\t\tshowElement(countdown);\n\t\tvar sec = 3;\n\t\t$('.countdown h1').text('LOOK HERE!');\n\t\tvar timer = setInterval(function() {\n\t\t $('.countdown h1').animate({\n\t\t opacity: 0\n\t\t }, 1000, function() {\n\t\t $('.countdown h1'... | [
"0.7374361",
"0.72822064",
"0.72148097",
"0.7186722",
"0.7177281",
"0.7176871",
"0.7135527",
"0.7130493",
"0.71292883",
"0.70448345",
"0.7040736",
"0.69690907",
"0.69690514",
"0.6960145",
"0.69167423",
"0.6907455",
"0.687414",
"0.6863684",
"0.68504184",
"0.6841362",
"0.684051... | 0.0 | -1 |
this will stop doubling the timer further when respective hit button is pressed | function timer() {
setTimeout("decrement()", 60);
if (click === 0) {
btn1.removeEventListener("click", timer);
}
if (click === 1) {
btn2.removeEventListener("click", timer);
}
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function stopClick(){\n clearInterval(intervalId);\n currentTime= 1;\n time.innerHTML= currentTime;\n noDanger();\n next.click();\n}",
"function theFinalCountDown(){\n var timerDisplay = $(\"#timerDisplay\");\n var timeCounter= 10;\n var countDownInterval = window.setInterval(function(){\n tim... | [
"0.7086916",
"0.7003422",
"0.6968046",
"0.69316846",
"0.6838469",
"0.6818079",
"0.68083584",
"0.67917424",
"0.6781963",
"0.6781121",
"0.6774875",
"0.6766777",
"0.67615664",
"0.6720698",
"0.6718187",
"0.670676",
"0.66962636",
"0.6687011",
"0.66725296",
"0.6663069",
"0.6661286"... | 0.66042143 | 35 |
Returns a random item from a given array when called. Uses Math.floor and Math.random to generate a random number from the array's length. | function getRandomItem (array) {
const randomItem = Math.floor(Math.random() * array.length)
return array[randomItem]
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function randomItem(array) {\n return array[Math.floor(Math.random() * array.length)];\n }",
"function getRandomItem(array) {\n return array[Math.floor(Math.random() * array.length)];\n}",
"function randomItem(arr) {\n return arr[Math.floor(arr.length*Math.random())];\n}",
"function rando... | [
"0.8589939",
"0.8543405",
"0.84198713",
"0.8411864",
"0.8242904",
"0.8228494",
"0.8228494",
"0.81731963",
"0.815102",
"0.81372774",
"0.8111017",
"0.81056434",
"0.81056434",
"0.81027895",
"0.80907637",
"0.8080127",
"0.8078969",
"0.80689394",
"0.8065756",
"0.8063431",
"0.805813... | 0.8387497 | 4 |
Changes the background colors of various elements when called. | function changeColors (arrayOfColors, doc) {
const button = document.getElementById('load-quote')
const quoteBox = document.getElementById('quote-box')
const header = document.getElementById('random-quotes')
const buttonHeaderColor = getRandomItem(arrayOfColors)
button.style.backgroundColor = buttonHeaderColor
quoteBox.style.backgroundColor = buttonHeaderColor
header.style.backgroundColor = buttonHeaderColor
document.body.style.backgroundColor = getRandomItem(arrayOfColors)
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function setAllColors(){\n\tfor (i=0; i<squares.length; i++){\n\t\tsquares[i].style.background = pickColor;\n\t}\n\th1.style.background = pickColor;\n}",
"function setBackground(elements) {\n elements.each(function (k, element) {\n var element = $(element);\n ... | [
"0.7469339",
"0.7369226",
"0.69989985",
"0.6975701",
"0.69386196",
"0.6912672",
"0.6851615",
"0.6847945",
"0.6797477",
"0.6783347",
"0.66997266",
"0.66977763",
"0.66920155",
"0.6676432",
"0.6647599",
"0.66395426",
"0.6634584",
"0.6618205",
"0.6604011",
"0.66025305",
"0.659671... | 0.0 | -1 |
Prints a random quote and source to the page. Calls the getRandomItemfunction and stores a quote in randomQuote. Prints to the page the random quote with the quote's source, citation, year, and tag if applicable. | function printQuote () {
const randomQuote = getRandomItem(quotes)
let html = `<p class="quote">${randomQuote.quote}</p>
<p class="source">${randomQuote.source}`
if (randomQuote.citation && randomQuote.year) {
html += `<span class="citation">${randomQuote.citation}</span>
<span class="year">${randomQuote.year}</span>`
} else if (randomQuote.citation && !randomQuote.year) {
html += `<span class="citation">${randomQuote.citation}</span>`
} else if (randomQuote.year && !randomQuote.citation) {
html += `<span class="year">${randomQuote.year}</span>`
}
if (randomQuote.tag) {
html += `<span class="tag">${randomQuote.tag}</span>`
}
html += `</p>`
document.getElementById('quote-box').innerHTML = html
changeColors(colors, document)
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function printQuote() {\n\n var quote = getRandomQuote(); // Call getRandomQuote function and put the return into a variable\n\n // presentation structure\n var html = '<p class=\"quote\">' + quote.quote + '</p>';\n html += '<p class=\"source\">' + quote.source;\n if (quote.citation !== \"... | [
"0.76662225",
"0.7648948",
"0.76363146",
"0.75433254",
"0.7529829",
"0.7508792",
"0.74934775",
"0.7486076",
"0.7458956",
"0.7439598",
"0.743714",
"0.7436879",
"0.74291784",
"0.74247473",
"0.74184126",
"0.74169546",
"0.73882276",
"0.7362797",
"0.73611253",
"0.7343178",
"0.7322... | 0.749463 | 6 |
Javascript that deletes local storage data so that the name will be asked again if user wants to change it | function new_name(){
localStorage.removeItem('name');
location.reload();
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function removeOldData() {\n\tlocalStorage.clear();\n}",
"clear(){\r\n\r\n localStorage.removeItem(this.name)\r\n\r\n }",
"function resetLocalStorage(){\n StorageArea.remove(['username', 'freq', 'name', 'gender'], function () {\n console.log('Removed username, name, gender and freq from sto... | [
"0.79943126",
"0.78904116",
"0.7869835",
"0.76576805",
"0.76267236",
"0.7625369",
"0.7500418",
"0.74822146",
"0.74266934",
"0.74051",
"0.7399496",
"0.7363018",
"0.73619837",
"0.73619837",
"0.7350709",
"0.7349437",
"0.7339277",
"0.73384535",
"0.73374176",
"0.73310184",
"0.7331... | 0.7885775 | 2 |
private static vis: Visual; | function Visual(options) {
console.log('Visual constructor', options);
Visual.host = options.host;
this.selectionIdBuilder = options.host.createSelectionIdBuilder();
this.target = options.element;
this.selectionManager = options.host.createSelectionManager();
//Visual.vis = this;
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function Object_Visual(data) {\n Object_Visual.__super__.constructor.call(this);\n\n /**\n * Indiciates if the game object is visible on screen.\n * @property visible\n * @type boolean\n */\n this.visible = true;\n\n /**\n * The object's destination rectangle on screen.\n * @property... | [
"0.6412795",
"0.63840026",
"0.6101102",
"0.59558827",
"0.59144247",
"0.5860045",
"0.5819913",
"0.58192855",
"0.57873297",
"0.5782663",
"0.577427",
"0.5762772",
"0.5742079",
"0.57368773",
"0.5654134",
"0.5634488",
"0.5607981",
"0.55945486",
"0.55728716",
"0.55708385",
"0.55388... | 0.6597097 | 0 |
! Vue.js v2.4.2 (c) 20142017 Evan You Released under the MIT License. | function i(t){return void 0===t||null===t} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"mounted() {\n }",
"mounted() {\n\n }",
"mounted() {\n\n }",
"constructor() {\n this.vue = new Vue();\n }",
"mounted() {\n /* eslint-disable no-console */\n console.log('Mounted!');\n /* eslint-enable no-console */\n }",
"created () {\n\n }",
"created () {... | [
"0.69328445",
"0.68909883",
"0.6867494",
"0.65414625",
"0.64629644",
"0.63754064",
"0.63754064",
"0.6326233",
"0.63201004",
"0.63125116",
"0.62708193",
"0.6259883",
"0.62272424",
"0.62232596",
"0.6221954",
"0.62114173",
"0.6200276",
"0.61847085",
"0.61762",
"0.61762",
"0.6157... | 0.0 | -1 |
This function check if the input has a value | function isInputTextActive () {
const mdInput = document.querySelectorAll('.md-form-control .md-input-text');
for (var i = 0; i < mdInput.length; i++) {
if (mdInput[i].value.length > 0) {
mdInput[i].parentElement.classList.add('focus');
}else {
mdInput[i].parentElement.classList.remove('focus');
}
}
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"hasInput_(value) {\n return value.length > 0;\n }",
"function inputValueCheck(el) {\n\t \tif (el.value === '') {\n\t \t\treturn false; // If element has no value, return false\n\t \t} else {\n\t \t\treturn true;\n\t \t}\n\t }",
"isValueEmpty(input) {\n return input ? true : false\n }",
"funct... | [
"0.8111857",
"0.78716815",
"0.7745731",
"0.76705307",
"0.76291656",
"0.75072837",
"0.7404344",
"0.73506147",
"0.730056",
"0.7245602",
"0.7172446",
"0.714344",
"0.711454",
"0.70703685",
"0.7021145",
"0.7003248",
"0.6964873",
"0.6936055",
"0.693212",
"0.6874725",
"0.67384046",
... | 0.0 | -1 |
Toggles the collapse menu of the navbar | toggle() {
this.setState({ isOpen: (!this.state.isOpen) });
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function collapse() {\n $('.navbar-toggler').trigger('click');\n }",
"function toggleMenu() {\n\t\ttoggle.classList.toggle('navbar-collapsed');\n\t\t// collapse.classList.toggle('mtn-navbar__collapse');\n\t\tcollapse.classList.toggle('in');\n\t}",
"toggleMenu(collapse) {\n collapse.classList.toggl... | [
"0.82967776",
"0.82390314",
"0.7836361",
"0.76158655",
"0.74567425",
"0.7431856",
"0.73397756",
"0.7267149",
"0.7211442",
"0.71399754",
"0.70945776",
"0.7093044",
"0.70641786",
"0.7049426",
"0.70408",
"0.7006897",
"0.70055026",
"0.7003146",
"0.69993573",
"0.6976472",
"0.69709... | 0.0 | -1 |
this method works in the case where you insert at the position this.length | insert(index,value) {
if (index < 0 || index>this.length){
throw new Error('Index error')
}
if (this.length >= this._capacity){
this._resize((this.length + 1)*Array.SIZE_RATIO)
}
Memory.copy(this.ptr+index+1,this.ptr+index,this.length-index)
this.length ++
this.set(index,value)
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"insert(index_num, value){\n if(index_num<0 || index_num>this.length){\n console.log(\"INSERT - false\");\n return false;\n }\n if(index_num===0){\n this.unshift(value);\n console.log(\"INSERT using UNSHIFT - true\");\n return true;\n ... | [
"0.7203813",
"0.6965906",
"0.6765198",
"0.67382383",
"0.672827",
"0.66598845",
"0.6654216",
"0.66512036",
"0.6649753",
"0.6641324",
"0.661329",
"0.6609445",
"0.6607198",
"0.6600132",
"0.6597229",
"0.6584083",
"0.6561471",
"0.6547141",
"0.6529939",
"0.65191644",
"0.649897",
... | 0.6575339 | 16 |
returns array where position i is the product of all array items at position !== i | function products(arr){
let newArr = []
let p ;
for (let i=0;i<arr.length;i++){
p=1
for (let j=0;j<arr.length;j++){
if (i !== j){
p = p * arr[j]
}
}
newArr.push(p)
}
return newArr
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function products(arr){\n let result = [];\n for (let i = 0 ; i < arr.length; i ++ ){\n let prod = 1\n for (let j = 0; j < arr.length; j++){\n if (i !== j){\n prod *= arr[j]\n }\n }\n result.push(prod);\n }\n return result;\n\n}",
"function getProductsOfAllIntsExceptAtIndex... | [
"0.7924141",
"0.75988436",
"0.75666434",
"0.7527754",
"0.75120986",
"0.74601114",
"0.739436",
"0.7383821",
"0.73430246",
"0.7331095",
"0.72412246",
"0.7159923",
"0.7079049",
"0.7061158",
"0.7027686",
"0.6867319",
"0.6836262",
"0.68275666",
"0.67885095",
"0.6773457",
"0.677215... | 0.775681 | 1 |
Listen on SIGINT, SIGTERM | function controlledShutdown(signal) {
console.warn(`Caught ${signal}. Removing pid-file and will then exit.`);
FS.unlinkSync(pidFile);
process.exit();
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"handleExits() {\r\n process.on('SIGINT', () => {\r\n logger.info('Shutting down gracefully...');\r\n this.server.close(() => {\r\n logger.info(colors.red('Web server closed'));\r\n process.exit();\r\n });\r\n });\r\n }",
"setupTerminationHandlers() {\n // Process on ex... | [
"0.6797574",
"0.6779071",
"0.6668288",
"0.64953864",
"0.64800245",
"0.64800245",
"0.64800245",
"0.64739484",
"0.63946885",
"0.6386353",
"0.62767696",
"0.6132052",
"0.61204475",
"0.6086918",
"0.60660744",
"0.60128516",
"0.5998729",
"0.5998729",
"0.5993028",
"0.59504896",
"0.59... | 0.0 | -1 |
Chamada de quando o elemento for exibido na tela | componentWillMount() {
axios.get(baseUrl,{
crossdomain: true
})
.then(resp => {
this.setState({ list: resp.data }) /**salvando dentro da lista de requisições */
})
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function CeEx (){\t\t// Cerrar explicación\n\tif (explicacionMostrando != ''){\n\t\tvar nodo = document.getElementById(explicacionMostrando + '_ex');\n\t\tnodo.parentNode.removeChild(nodo);\n\t}\n}",
"function entramosEnEscuderia(e){\n\t\n\testamosDentroEscuderia=true;\n\t/*e.preventDefault();\n\telemento = e.ta... | [
"0.6341398",
"0.627739",
"0.6101217",
"0.6055294",
"0.6025185",
"0.59946585",
"0.59715515",
"0.59475726",
"0.5936613",
"0.59285897",
"0.5891073",
"0.58023816",
"0.5786556",
"0.5768657",
"0.57285595",
"0.572832",
"0.57169247",
"0.57082736",
"0.57082623",
"0.56661916",
"0.56551... | 0.0 | -1 |
Iteration 1: Ordering by year Order by year, ascending (in growing order) | function orderByYear(array) {
let newArray = array.map(elm => {
return elm
})
newArray.sort((a, b) => {
if (a.year > b.year) return 1
if (a.year < b.year) return -1
if ((a.year == b.year) && (a.title > b.title)) return 1
if ((a.year == b.year) && (a.title < b.title)) return -1
})
return newArray
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function orderByYear(someArr){\n const order = someArr.sort((a, b) => a.year > b.year ? 1 : -1)\n return order;\n}",
"function orderByYear(arr) {\n let byYear = [...arr].sort((s1, s2) => {\n if (s1.year > s2.year) return 1;\n else return -1\n })\n return byYear\n}",
"function order... | [
"0.72275954",
"0.7135998",
"0.7133108",
"0.71112806",
"0.7054949",
"0.7049193",
"0.7022546",
"0.7011991",
"0.70116156",
"0.6954844",
"0.69396275",
"0.6934575",
"0.69301045",
"0.69145787",
"0.6911264",
"0.6902474",
"0.68897897",
"0.68856317",
"0.6878473",
"0.68769145",
"0.6869... | 0.67686546 | 26 |
Iteration 2: Steven Spielberg. The best? How many drama movies did STEVEN SPIELBERG direct | function howManyMovies(movieNum) {
let dramaMovies = movieNum.filter(elm => elm.genre.includes("Drama") && elm.director === "Steven Spielberg")
return dramaMovies.length
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function howManyMovies(movies){\n if (movies == 0){}\n else {\n var dramaFilms = [];\n for (var i = 0; i < movies.length; i++){\n for (var j = 0; j < movies[i].genre.length; j++){\n if (movies[i].genre[j] === 'Drama'){\n dramaFilms.push(movies[i])\n }\n }\n}\n var stevenFilms = dramaFilms.filter(... | [
"0.6601088",
"0.64523566",
"0.63859904",
"0.6343344",
"0.6334379",
"0.63339186",
"0.6318041",
"0.6316198",
"0.62765855",
"0.627466",
"0.62453973",
"0.6232094",
"0.61976904",
"0.61933565",
"0.6190182",
"0.6167203",
"0.6165928",
"0.61546344",
"0.6128751",
"0.61215264",
"0.61038... | 0.0 | -1 |
Iteration 3: Alphabetic Order Order by title and print the first 20 titles | function orderAlphabetically(moviesAlph) {
let alphArray = moviesAlph.map(elm => {
return elm.title
})
alphArray.sort((a, b) => {
if (a > b) return 1
if (a < b) return -1
if (a == b) return 0
})
return alphArray.slice(0, 20)
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function orderAlphabetically(array){\n let titles = array.map(i=>i.title)\n if (array.length <= 20) {\n for (i = 0; i<array.length; i++) {\n console.log(titles.sort()[i]);\n }\n } else {\n for (i = 0; i<20; i++) {\n console.log(titles.sort()[i]);\n }\n }\n}",
"fu... | [
"0.7802424",
"0.7719607",
"0.7523073",
"0.75131094",
"0.74586827",
"0.7456341",
"0.74306804",
"0.7410855",
"0.74006325",
"0.73221534",
"0.7291631",
"0.7289742",
"0.7282026",
"0.7262289",
"0.7215079",
"0.7188504",
"0.71582454",
"0.7137464",
"0.7134475",
"0.7132253",
"0.7110948... | 0.70316327 | 33 |
Iteration 4: All rates average Get the average of all rates with 2 decimals | function ratesAverage(avgRate) {
if (avgRate.length === 0) {
return 0;
}
let ratesArray = avgRate.reduce((acc, elm) => {
return acc + elm.rate
}, 0);
return number(ratesArray / avgRate.length.toFixed(2))
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function ratesAverage(arr) {\n var allRates = arr.reduce(function(acc, elem) {\n return (acc += Number(elem.rate));\n }, 0);\n return parseFloat((allRates / arr.length).toFixed(2));\n}",
"function ratesAverage(allRates) {\n\n if (allRates.length === 0) {\n return 0;\n }\n\n meanRates = allR... | [
"0.81201476",
"0.8045915",
"0.8008566",
"0.79965955",
"0.7941593",
"0.7932597",
"0.7908035",
"0.79006124",
"0.7883331",
"0.78420365",
"0.7804975",
"0.7800371",
"0.7782459",
"0.7768673",
"0.77451664",
"0.7740817",
"0.77304035",
"0.7724927",
"0.7723992",
"0.77208954",
"0.769589... | 0.78522944 | 9 |
Iteration 5: Drama movies Get the average of Drama Movies | function dramaMoviesRate(dMovies) {
let dramaMov = dMovies.filter(function (dMovie) {
return dMovie.genre.includes("Drama")
})
if (dramaMov.length == 0) {
return 0;
} else {
let totalDramaRates = dramaMov.reduce(function (acc, dramaMov) {
return acc + dramaMov.rate;
}, 0);
return number(totalDramaRates / dramaMov.length.toFixed(2))
}
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function calculateMovieAverage() {\n\tfor (let i = 0; i < movies.length; i++) {\n\t\tlet sumOfRatings = movies[i].ratings.reduce((a, b) => a + b, 0);\n\t\tmovies[i].average = sumOfRatings / movies[i].ratings.length;\n\t}\n}",
"function dramaMoviesRate(movies) {\n let drama = movies.filter(function(elem){\n ... | [
"0.8198215",
"0.8126122",
"0.80235314",
"0.79801685",
"0.7953655",
"0.79192615",
"0.78840476",
"0.78715247",
"0.7824512",
"0.7768616",
"0.77648723",
"0.775556",
"0.7724957",
"0.7711103",
"0.7704011",
"0.7691488",
"0.7689545",
"0.76855373",
"0.7682447",
"0.7660273",
"0.763618"... | 0.0 | -1 |
Iteration 6: Time Format Turn duration of the movies from hours to minutes; | function turnHoursToMinutes(duration) {} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function turnHoursToMinutes (movie){\n for (var i=0; i<movie.length;i++){\n var horas=parseInt(movie[i].duration.split(\" \")[0].toString().replace('h',''));\n var minutos=parseInt(movie[i].duration.split(\" \")[1].toString().replace('min',''));\n var tiempo=(horas*60)+minutos\n movie[i].dur... | [
"0.8079936",
"0.7859964",
"0.7851876",
"0.78014445",
"0.77884597",
"0.77884597",
"0.77513224",
"0.76728314",
"0.7625841",
"0.762416",
"0.76172984",
"0.7615136",
"0.76059455",
"0.7568617",
"0.75211906",
"0.75048834",
"0.7458502",
"0.74136585",
"0.74086255",
"0.74062926",
"0.74... | 0.68605906 | 75 |
This does all the d3 drawing, I wish we could just databind in aurelia but it seems to slow right now. | scaleUpdated() {
this.pointCoords = this.data.map(d=>[this.xaxis.scale(d[0]), this.yscale(d[1])]);
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"drawCanvas(arrData) {\n const W = +this.elements.$tags.contentWrap.getBoundingClientRect().width;\n const H = +this.panel.svgHeight;\n const dateFrom = this.range.from.clone();\n const dateTo = this.range.to.clone();\n\n // область визуализации с данными (график)\n const margin = this.elements.si... | [
"0.6549076",
"0.64834744",
"0.6460986",
"0.6456793",
"0.6455284",
"0.6453635",
"0.6431173",
"0.64093983",
"0.6392877",
"0.63787854",
"0.6356816",
"0.63239366",
"0.6311759",
"0.6289212",
"0.62745196",
"0.6274105",
"0.6241139",
"0.6204532",
"0.62030774",
"0.6201816",
"0.6197175... | 0.0 | -1 |
When a new async handle is created | function init(uid, handle, provider, parentId) {
if (hasContext(parentId || currentUid)) {
// This new async handle is the child of a handle with a context.
// Set this handles context to that of its parent.
contexts.set(uid, contexts.get(parentId || currentUid));
}
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"[kSetHandle](handle) {\n const state = this[kInternalState];\n const current = this[kHandle];\n this[kHandle] = handle;\n if (handle !== undefined) {\n handle.onread = onStreamRead;\n handle[owner_symbol] = this;\n this[async_id_symbol] = handle.getAsyncId();\n state.id = handle.id(... | [
"0.6204729",
"0.59472567",
"0.5932039",
"0.57917786",
"0.5751853",
"0.56844246",
"0.56844246",
"0.56794965",
"0.56794965",
"0.5599177",
"0.5566484",
"0.55219877",
"0.54567814",
"0.5456563",
"0.5445722",
"0.5427156",
"0.5422927",
"0.54227614",
"0.54101485",
"0.5377925",
"0.537... | 0.55969024 | 10 |
Before a handle starts | function pre(uid) {
currentUid = uid;
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function BeforeStart(){return}",
"function BeforeStart(){return}",
"function BeforeStart(){return}",
"function BeforeStart(){return}",
"function BeforeStart(){return}",
"function BeforeStart(){return}",
"function BeforeStart(){return}",
"function BeforeStart(){return}",
"preStart() {\n }",
"be... | [
"0.6353478",
"0.6353478",
"0.6353478",
"0.6353478",
"0.6353478",
"0.6353478",
"0.6353478",
"0.6353478",
"0.5956316",
"0.59344554",
"0.5929525",
"0.59088933",
"0.5886011",
"0.5876046",
"0.5837104",
"0.57874477",
"0.56936026",
"0.5689687",
"0.5654993",
"0.56520075",
"0.5633241"... | 0.0 | -1 |
After a handle ends | function post() {
currentUid = null;
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"_onEnd() {}",
"handleFinish(useful) {\n recordFinish(this.state.currentGuide.id, useful);\n closeGuide();\n }",
"async end() { }",
"function handleFinished() {\n resolve(Buffer.concat(_this.buffers));\n cleanup();\n }",
"function HandleEnd()\n{\n this.device.close(); // clos... | [
"0.68474317",
"0.6664979",
"0.6641499",
"0.65521944",
"0.6507137",
"0.6491127",
"0.63348365",
"0.63143176",
"0.62901276",
"0.6277134",
"0.6264915",
"0.6178254",
"0.6159167",
"0.6144463",
"0.61310816",
"0.61133814",
"0.6111553",
"0.60959893",
"0.6052513",
"0.6010353",
"0.59932... | 0.0 | -1 |
When a handle is destroyed | function destroy(uid) {
if (hasContext(uid)) {
contexts.delete(uid);
}
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"destroy() {\n if (!this._destroyCallback) {\n throw new Error('Destroying an inactive handle');\n }\n\n // We give the handle rather than set it as the this, because setting it as the this is @#$#@\n // confusing.\n this._destroyCallback(this, this._userData);\n\n // Releasing these will all... | [
"0.8037547",
"0.70259666",
"0.6890695",
"0.67938477",
"0.6737528",
"0.661633",
"0.661633",
"0.6615557",
"0.6578729",
"0.65628374",
"0.6530463",
"0.652776",
"0.6527581",
"0.6527581",
"0.6527581",
"0.64884436",
"0.6485455",
"0.6485455",
"0.6485455",
"0.6485455",
"0.6485455",
... | 0.0 | -1 |
const BASE_COLOR="rgb(52, 73, 94)"; const OTHER_COLOR="7f8c8d"; | function handleClick(){
title.classList.toggle(CLICK_CLASS);
/*const hasClass=title.classList.contains(CLICK_CLASS);
if(hasClass){
title.classList.remove(CLICK_CLASS);
} else{
title.classList.add(CLICK_CLASS);
}*/
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function _named(str) {\r\n var c = __WEBPACK_IMPORTED_MODULE_1__colorValues__[\"COLOR_VALUES\"][str.toLowerCase()];\r\n if (c) {\r\n return {\r\n r: c[0],\r\n g: c[1],\r\n b: c[2],\r\n a: MAX_COLOR_ALPHA\r\n };\r\n }\r\n}",
"function color (i){\n... | [
"0.6961668",
"0.68916845",
"0.6700817",
"0.6678551",
"0.66782284",
"0.66608876",
"0.6643742",
"0.66131294",
"0.66131294",
"0.6605643",
"0.6589712",
"0.657579",
"0.6565881",
"0.65377825",
"0.65377825",
"0.6521719",
"0.64915735",
"0.6485219",
"0.6475696",
"0.6474047",
"0.647404... | 0.0 | -1 |
THEN YOU CAN CONSUME THE ABOVE REST ENDPOINT ON THE FRONTEND IN YOUR APP | function userRequest() {
$.getJSON('/users/userlist', function (data) {
// For each item in our JSON, do something like render some HTML to the DOM
$.each(data, function () {
// mock up some html
});
});
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function showEndpoint(response){\n}",
"function homepage(req, res) {\n let url = `https://thesimpsonsquoteapi.glitch.me/quotes?count=10`\n\n superagent.get(url).set('User-Agent', '1.0').then(resp =>{\n\nres.render('./pages/index.ejs' , {data: resp.body});\n }).catch(err => console.log(err));\n}",
"GET... | [
"0.6349256",
"0.62948835",
"0.620569",
"0.61175245",
"0.6066087",
"0.60186315",
"0.59338164",
"0.59224004",
"0.5835331",
"0.5821035",
"0.58198047",
"0.58032036",
"0.5780124",
"0.57164294",
"0.57122374",
"0.5694852",
"0.56575316",
"0.56528956",
"0.56261426",
"0.56086445",
"0.5... | 0.0 | -1 |
The purpose of mixins is to take one object and mix in the functionalities of another object jquery has its own $.extend() method that is used for the puspose of mixing functionalities | function extend(target){
//target is the target object to which we want to
//add the functionalities of other objects to
//extend() when invoked should take multiple
//parameters...the first param is the target
//object and the params starting from index 1
// are the mixin objects
//if there are no mixin objects return nothing.
if(!arguments[1]){
return;
}
for(var i = 1; i < arguments.length; i++){
//source is an object
var source = arguments[i];
//loop through source
for(prop in source){
//if the property doesnt exist on the target object
//and the property is the source object's own property
//and not on its prototype...the assign the property to target
if(!target[prop] && source.hasOwnProperty(prop)){
target[prop] = source[prop];
}
}
}
console.log(source);
console.log(target);
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function Mixin() {}",
"function _extend()\n {\n // copy reference to target object\n var target = arguments[0] || {}, i = 1, length = arguments.length, deep = false, options, name, src, copy, copyIsArray;\n\n // Handle a deep copy situation\n if ( typeof target === \"bo... | [
"0.71583384",
"0.69417536",
"0.69385594",
"0.68285346",
"0.6706275",
"0.6662885",
"0.6653502",
"0.6639317",
"0.6616183",
"0.6616183",
"0.6616183",
"0.6616183",
"0.6616183",
"0.6616183",
"0.66160655",
"0.6604702",
"0.6592668",
"0.65924734",
"0.65924734",
"0.65924734",
"0.65924... | 0.6564246 | 32 |
Recursively finds the biggest decimal odd that is smaller than num | function findNearestLadderKey(startIndex, endIndex, num) {
var middleIndex = startIndex + Math.ceil((endIndex - startIndex)/2);
if((middleIndex === 0 && ladderKeys[middleIndex] > num) || (middleIndex === ladderKeys.length - 1 && ladderKeys[middleIndex] < num) || (ladderKeys[middleIndex] < num && num < ladderKeys[middleIndex + 1])) {
return ladderKeys[middleIndex];
} else {
if(ladderKeys[middleIndex] < num) {
return findNearestLadderKey(middleIndex, endIndex, num);
} else {
return findNearestLadderKey(startIndex, middleIndex-1, num);
}
}
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function nextBigger(n){\n let arr = n.toString().split(\"\") // creates string from number and splits it to an array\n let num = -1\n for (let i = arr.length-1; i >0; i--) { // sets up loop to look for the moment when the digit to the right if \"i\" is larger than \"i\"\n if (arr[i] > arr[i-1]) {\n num ... | [
"0.6730373",
"0.66105",
"0.6608684",
"0.63724303",
"0.6371496",
"0.6321737",
"0.6297459",
"0.6284052",
"0.6275032",
"0.62392884",
"0.621486",
"0.6196732",
"0.61922294",
"0.61634904",
"0.61601347",
"0.6152286",
"0.61352134",
"0.61269116",
"0.6124017",
"0.6110064",
"0.6101486",... | 0.0 | -1 |
Does not render the description unless it is not empty. So, each item in the list will have a different height, depending on whether or not the item has a description. | render () {
return (<View key={this.props.id} onLayout={this.handleOnLayout} style={this.props.style}>
<Text style={styles.item}>{this.props.name}</Text>
{this.props.desc &&
<Text style={styles.item}>{this.props.desc}</Text>
}
</View>);
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function Description(props) {\n if (clothing.desc) {\n return (<div> <SubHeading> <div> Description</div></SubHeading>\n <Desc> {clothing.desc} </Desc></div>\n\n\n );\n } else {\n return (<div></div>);\n }\n }",
"function ItemDescription(props) {\n var children = props.children,\... | [
"0.66724217",
"0.6530175",
"0.6507974",
"0.65043104",
"0.64899737",
"0.64899737",
"0.64856285",
"0.647921",
"0.6452029",
"0.6452029",
"0.6410688",
"0.6345662",
"0.6345662",
"0.6256617",
"0.6251506",
"0.6226316",
"0.6226316",
"0.6223395",
"0.6216989",
"0.6216294",
"0.6212008",... | 0.61509806 | 27 |
Find nearest cell to that coordinates via minimum of Euclidean distances. | function getNearestCell(x, y, cells) {
var min = Infinity;
var result;
$.each(cells, function(index, cell) {
var d = distance(x, y, cell.center_x, cell.center_y);
// Update minimum.
if (d < min) {
min = d;
result = cell;
}
});
return result;
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function nearest(from) {\n\tvar to = indexOfMin(distances[from]);\n\tif (distances[from][to] < infinDist) {\n\t\tdistances[from][to] = distances[to][from]= infinDist;\n\t\treturn to;\n\t}\n\treturn -1;\n}",
"function getNeighbor(current, all) {\n 'use strict';\n var closest = -1,\n minDistance = Infinity,... | [
"0.685125",
"0.67425996",
"0.6669267",
"0.6649439",
"0.6381675",
"0.63721305",
"0.6362173",
"0.6355284",
"0.6316656",
"0.6240928",
"0.6228612",
"0.62226576",
"0.6206366",
"0.6205011",
"0.61719936",
"0.61674714",
"0.6155445",
"0.6140501",
"0.61386454",
"0.61174345",
"0.6116153... | 0.82347417 | 0 |
Returns true if client is actively mining new blocks. | _mining(){
return false;
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"isOnline(lastUsed) {\n return utils.xSecondsAgoUTC(12) < lastUsed ? true : false\n }",
"canBlock()\n {\n if(this.blocks < game.settings.maxBlocks)\n {\n return true;\n }\n\n return false;\n\n }",
"isAvailable () {\n const lessThanOneHourAgo = (date) => {\n ... | [
"0.5999326",
"0.59735894",
"0.5895674",
"0.5672302",
"0.5659759",
"0.5626051",
"0.56140405",
"0.56121016",
"0.5603506",
"0.55044883",
"0.54964226",
"0.54964226",
"0.54964226",
"0.54964226",
"0.54964226",
"0.54964226",
"0.54964226",
"0.54964226",
"0.54964226",
"0.54897654",
"0... | 0.0 | -1 |
set up the event listener for a card. If a card is clicked: display the card's symbol (put this functionality in another function that you call from this one) add the card to a list of "open" cards (put this functionality in another function that you call from this one) if the list already has another card, check to see if the two cards match + if the cards do match, lock the cards in the open position (put this functionality in another function that you call from this one) + if the cards do not match, remove the cards from the list and hide the card's symbol (put this functionality in another function that you call from this one) + increment the move counter and display it on the page (put this functionality in another function that you call from this one) + if all cards have matched, display a message with the final score (put this functionality in another function that you call from this one) shuffle cards in deck array to create new deck | function shuffledDeck() {
let shuffledDeck = shuffle(deck);
$('.deck').empty();
for(let card = 0; card < shuffledDeck.length; card++) {
$('.deck').append($('<li class="card"><i class="fa fa-' + shuffledDeck[card] + '"></i></li>'))
}
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function clickCard(event) {\n // discard clicks on already matched or open cards\n if (event.target.nodeName === 'LI'\n && !(event.target.classList.contains(\"match\"))\n && !(event.target.classList.contains(\"open\")) ) {\n\n clickCounter += 1;\n\n if(clickCounter == 1) {\n st... | [
"0.83509505",
"0.8140722",
"0.80919325",
"0.80569696",
"0.8001356",
"0.79951125",
"0.7924273",
"0.7889374",
"0.78789896",
"0.7862501",
"0.78373975",
"0.77550113",
"0.7748669",
"0.7738757",
"0.7725312",
"0.7721494",
"0.7714245",
"0.7690667",
"0.7676613",
"0.7667446",
"0.765147... | 0.0 | -1 |
event handler for clicked card | function clickedCard() {
$('li.card').on('click', function() {
let openCard = $(this);
toggleOpenShow(openCard);
if(openCard.hasClass('open show disabled')
&& allOpenedCards.length < 2) {
allOpenedCards.push(openCard);
}
matchedCard();
});
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function cardClicked(e) {\n\n const clickedCard = e.target;\n if (clickedCard.classList.contains('card') && !clickedCard.classList.contains('show')) {\n clickedCard.classList.add('show');\n addToOpenCards(clickedCard);\n }\n }",
"function apply_card_event_handlers(){... | [
"0.8312875",
"0.81319517",
"0.81228703",
"0.80927646",
"0.79460865",
"0.7917277",
"0.7762856",
"0.7724018",
"0.76542777",
"0.76164526",
"0.75316477",
"0.7515705",
"0.7494764",
"0.74928045",
"0.74820167",
"0.7470019",
"0.74594855",
"0.74531555",
"0.7408042",
"0.7392202",
"0.73... | 0.7702436 | 8 |
toggling open and show class on clicked card | function toggleOpenShow(card) {
card.addClass('open show disabled');
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function openCard() {\n\t\tevent.target.classList.toggle('open');\n\t\tevent.target.classList.toggle('show');\n\t}",
"function showCard(clickedCard) {\n $(clickedCard).addClass('open show');\n}",
"function clickedCards(card) {\n $(card).addClass('show open');\n}",
"function toggleCard() {\n\tthis.classList... | [
"0.8499252",
"0.8365504",
"0.83585036",
"0.82536286",
"0.8201574",
"0.81460655",
"0.8103942",
"0.8103942",
"0.8098911",
"0.809776",
"0.80665207",
"0.80101484",
"0.7970789",
"0.7960427",
"0.79336786",
"0.7920794",
"0.78743166",
"0.78577405",
"0.78483397",
"0.78322405",
"0.7817... | 0.8375648 | 1 |
flip cards back over after modal display | function resetCards() {
let cardsInDeck = $('.deck li')
for(card of cardsInDeck) {
card.className = 'card';
}
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function flipCardOver (clickedCard) {\n clickedCard.classList.toggle('open');\n clickedCard.classList.toggle('show'); \n}",
"function flip(card){\r\ncard.target.classList.add(\"open\");\r\ncard.target.classList.add(\"show\");\r\n\r\n}",
"function flip(card) {\n card.classList.toggle('open');\n card.cl... | [
"0.7347733",
"0.7144152",
"0.7125572",
"0.7061022",
"0.70547336",
"0.7011751",
"0.69605386",
"0.69433624",
"0.6926739",
"0.6856992",
"0.6850814",
"0.68347245",
"0.6827213",
"0.68114984",
"0.6804681",
"0.6737662",
"0.6736725",
"0.6727424",
"0.67223996",
"0.67174643",
"0.670717... | 0.0 | -1 |
match first card clicked to second card clicked | function matchedCard() {
let firstCard = allOpenedCards[0];
let secondCard = allOpenedCards[1];
if(allOpenedCards.length === 2) {
moveCounter();
scoreCheck();
if(firstCard.children().attr('class') === secondCard.children().attr('class')) {
firstCard.addClass('match');
secondCard.addClass('match');
allOpenedCards.length = 0;
matchCount++;
if(matchCount === matchedPairs) {
gameOver();
}
} else {
setTimeout(function() {
firstCard.removeClass('open show disabled');
secondCard.removeClass('open show disabled');
allOpenedCards.length = 0;
}, 300);
}
}
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function manipulateCard(event) {\n\t// Check if there is any card already clicked\n\tif (firstClickedElement === null){\n\n\t\t// No card clicked yet => store its value (class) into firstCard variable\n\t\tfirstCard = event.target.lastElementChild.getAttribute('class');\n\n\t\t// Show the card\n\t\tshowCard(event)... | [
"0.77947104",
"0.7635646",
"0.7528747",
"0.7339774",
"0.73222744",
"0.7298105",
"0.7261481",
"0.72083944",
"0.70965254",
"0.70963365",
"0.70742667",
"0.70650405",
"0.70599145",
"0.70543504",
"0.7036428",
"0.70251215",
"0.7016041",
"0.7015723",
"0.70014864",
"0.6997069",
"0.69... | 0.6707762 | 58 |
count moves user make and update to screen | function moveCounter() {
moveCount++;
$('.moves').text(moveCount);
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function increaseMoveCounter() {\n state.totalMoves++;\n document.querySelector('.moves').textContent = state.totalMoves;\n }",
"function updateMoves() {\n moves++;\n movesCounter.textContent = moves;\n}",
"function moveCounter () {\n moves += 1;\n document.querySelector('.moves').textConten... | [
"0.7853812",
"0.7808541",
"0.76460904",
"0.7616671",
"0.7587451",
"0.75746083",
"0.7565361",
"0.7546887",
"0.75449276",
"0.7528779",
"0.7520808",
"0.7499674",
"0.7475477",
"0.7448939",
"0.74280125",
"0.7410912",
"0.7370721",
"0.7339002",
"0.73389035",
"0.73168457",
"0.7312919... | 0.76627684 | 2 |
remove stars based on how many moves user make | function scoreCheck() {
if(moveCount === 8 || moveCount === 16 || moveCount === 24) {
removeStar();
}
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function starCounter(moves) {\r\n if (moves >= 20 && moves <= 30) {\r\n // stars.innerHTML.remove();\r\n stars.innerHTML = star.repeat(4);\r\n } else if (moves >= 31 && moves <= 40) {\r\n // stars.innerHTML.remove();\r\n stars.innerHTML = star.repeat(3);\r\n } else if (moves >= 41 && moves <= 50) {\... | [
"0.7903617",
"0.78775245",
"0.7817392",
"0.78047484",
"0.77238584",
"0.76920605",
"0.76788247",
"0.7649155",
"0.7590312",
"0.7540466",
"0.7526105",
"0.74457574",
"0.7412945",
"0.73602223",
"0.7320222",
"0.731811",
"0.73134935",
"0.7310747",
"0.7249409",
"0.7239241",
"0.723015... | 0.68883044 | 36 |
reset move count back to zero | function resetMoveCount() {
moveCount = 0;
$('.moves').text(moveCount);
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function resetMoves() {\n debug(\"resetMoves\");\n count = document.querySelector('.moves');\n\n count.innerHTML = \"0\";\n }",
"resetState() {\n this._movements = 0;\n }",
"function resetCounter() {\n numberOfMoves = 0;\n moveCounter.innerHTML = numberOfMoves;\n}",
"funct... | [
"0.7635513",
"0.7538035",
"0.7435507",
"0.74042773",
"0.7306319",
"0.7157502",
"0.71389836",
"0.7016031",
"0.7010484",
"0.6892859",
"0.685494",
"0.67444164",
"0.67438745",
"0.67438745",
"0.67194545",
"0.6632518",
"0.65582544",
"0.65319884",
"0.6526455",
"0.65249395",
"0.64984... | 0.7834286 | 0 |
remove star based on how many moves user make | function removeStar() {
for(star of allStars) {
if(star.style.display !== 'none') {
star.style.display = 'none';
break;
}
}
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function starCount() {\n if (moveCountNum === 20 || moveCountNum === 35) {\n removeStar();\n }\n}",
"function removeStar() {\n const stars = Array.from(document.querySelectorAll('.fa-star'));\n if (moves === 12 || moves === 15 || moves === 18) {\n for (star of stars){\n if (star.style.display !== ... | [
"0.76538664",
"0.76076657",
"0.7605075",
"0.758455",
"0.75703126",
"0.75592345",
"0.7516247",
"0.74422425",
"0.74289495",
"0.7418153",
"0.7416017",
"0.74063593",
"0.7231626",
"0.7148592",
"0.7124285",
"0.7105445",
"0.70814943",
"0.702841",
"0.7028299",
"0.700433",
"0.6989616"... | 0.64332324 | 41 |
count how many stars left to display based on how many moves user make | function updateStar() {
let starCount = 0;
for(star of allStars) {
if(star.hidden === false) {
starCount++;
}
}
return starCount;
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function moveCount () {\n var moves = parseInt($(\".moves\").text())\n moves += 1\n $(\".moves\").text(moves)\n stars( moves )\n}",
"function countStars() {\n\n if (moves <= 20) {\n stars = 3;\n } else if (moves <= 25) {\n stars = 2;\n } else {\n stars = 1;\n }\n\n display... | [
"0.7933151",
"0.79283005",
"0.7891076",
"0.7783046",
"0.77191734",
"0.76528335",
"0.7643846",
"0.7593916",
"0.7527442",
"0.7516414",
"0.75119305",
"0.7493098",
"0.7484972",
"0.74546975",
"0.7440623",
"0.7417278",
"0.7394762",
"0.7394098",
"0.73380494",
"0.73275435",
"0.728496... | 0.6901675 | 46 |
restore stars count to default | function resetStar() {
for(star of allStars) {
star.style.display = 'inline';
}
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function resetStarRating() {\n stars[1].classList.remove(\"fa-star-o\");\n stars[1].classList.add(\"fa-star\");\n stars[2].classList.remove(\"fa-star-o\");\n stars[2].classList.add(\"fa-star\");\n rating = 3;\n}",
"function resetStarColors() {\n $('.star-rate').css('color', 'black');\n }... | [
"0.7508352",
"0.7249987",
"0.72125965",
"0.7198685",
"0.71526194",
"0.71423477",
"0.71411514",
"0.7135055",
"0.71320564",
"0.70547706",
"0.7045222",
"0.70349437",
"0.6987225",
"0.69333035",
"0.69304264",
"0.69177014",
"0.6892717",
"0.68557566",
"0.68507874",
"0.6833608",
"0.6... | 0.6861697 | 17 |
start a timer once the game loads | function startTimer() {
time = 0;
countUp = setInterval(function () {
time++;
displayTimer();
}, 1000);
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function startTimer() {\n\tgameData.timer = setInterval(timerData.timeCounter, 1000);\n}",
"function start(data) {\n startGameTimer();\n}",
"function startGame() {\n timerStat = true;\n showGamePanel();\n runTimer();\n displayImage();\n}",
"function gameStart(){\n\t\t\tshuffleCards();\n\t\t\tt... | [
"0.78974557",
"0.7727225",
"0.76524043",
"0.7542344",
"0.7488791",
"0.7340845",
"0.732516",
"0.73242277",
"0.73122287",
"0.73114747",
"0.7294211",
"0.7273359",
"0.7237607",
"0.7219074",
"0.7194123",
"0.71939105",
"0.71915674",
"0.71911687",
"0.71771586",
"0.71349347",
"0.7090... | 0.0 | -1 |
stop timer when user win | function stopTimer() {
clearInterval(countUp);
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function stopTimer() {\n if (!stoptime) {\n stoptime = true;\n }\n}",
"function stopTimer() {\n // check timer is on or off\n if (stopTime == false) {\n stopTime = true;\n }\n }",
"function stopTimer(){ clearInterval(interval)}",
"function breakTimer() {}",
"function stopTimer... | [
"0.73457396",
"0.72465724",
"0.72084236",
"0.7204068",
"0.7135043",
"0.70913154",
"0.7090592",
"0.70748055",
"0.7052787",
"0.7048408",
"0.7041365",
"0.70258296",
"0.69861686",
"0.6981033",
"0.6980792",
"0.6971905",
"0.69695824",
"0.69453716",
"0.6935854",
"0.69013435",
"0.689... | 0.6921759 | 19 |
displaying timer with live update | function displayTimer() {
let clock = $('.timer').text(time);
let mins = Math.floor(time / 60);
let secs = time % 60;
if(secs < 10) {
clock.text(`${mins}:0${secs}`);
} else {
clock.text(`${mins}:${secs}`);
}
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function updateTimerDisplay(){\n // Update current time text display.\n $('#current-time').text(formatTime( player.getCurrentTime() ));\n $('#duration').text(formatTime( player.getDuration() ));\n }",
"function updateTimerDisplay(){\n // Update current time text display.\n $('#curre... | [
"0.8108987",
"0.8053087",
"0.79875094",
"0.78876555",
"0.7877026",
"0.7836753",
"0.77575207",
"0.76473975",
"0.76145405",
"0.75946945",
"0.75683683",
"0.7521375",
"0.7513487",
"0.7442374",
"0.740356",
"0.73958313",
"0.7374653",
"0.7365908",
"0.7354137",
"0.7297008",
"0.728948... | 0.6841012 | 81 |
reset the timer to start counting time from the beginning | function resetTimer() {
stopTimer();
timeStart = true;
time = 0;
displayTimer();
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"resetTimer() {\n this.timeSelected = 0;\n this.completeElapsed = 0;\n this.complete = false;\n }",
"reset() {\n this.stop();\n $(this._timerElemjQuery).text(\"00\");\n this._start = null;\n this._duration = 0;\n }",
"reset() {\n this.stop();\n ... | [
"0.8165589",
"0.8099327",
"0.8099327",
"0.7967145",
"0.7961562",
"0.79461545",
"0.79386926",
"0.7879661",
"0.78262764",
"0.7717204",
"0.7717105",
"0.7710925",
"0.7660638",
"0.76589066",
"0.76543236",
"0.75742245",
"0.75660044",
"0.7560766",
"0.75526357",
"0.7541143",
"0.75276... | 0.79940706 | 3 |
toggle modal on or off | function toggleModal() {
$('.modal-results').toggleClass('show-modal');
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function toggle() {\r\n setModal(!modal)\r\n }",
"toggleModal () {\n\t\tthis.model.toggleModalState();\n\t\tthis.view.toggleModal( this.model.isModalOpen )\n\t}",
"toggle() {\n this.setState({\n modal: !this.state.modal\n });\n }",
"toggle() {\n this.setState({\n ... | [
"0.8614924",
"0.78581",
"0.7577401",
"0.7509253",
"0.7509253",
"0.7470424",
"0.7466745",
"0.74192214",
"0.74085176",
"0.73702323",
"0.732111",
"0.732111",
"0.72533655",
"0.7232697",
"0.72234124",
"0.72224724",
"0.7196147",
"0.7166964",
"0.7128359",
"0.7122359",
"0.7122359",
... | 0.7193635 | 17 |
update modal with results | function updateModal() {
let newTime = $('.timer').text();
let newStars = updateStar();
$('.modal-time').text(`Time: ${newTime}`);
$('.modal-moves').text(`Moves: ${moveCount}`);
$('.modal-stars').text(`Stars: ${newStars}`);
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function view_update_modal(id_table, url) {\n $(`#${id_table} tbody`).on('click', '.btn-info', function() {\n const id = $(this).data('id');\n const response = get(`${url}${id}`);\n response.then((res) => {\n load_preloader_container(res.form.id, 10);\n $('#modal_updat... | [
"0.70432013",
"0.67155415",
"0.6565725",
"0.6510939",
"0.64728963",
"0.6413299",
"0.63912356",
"0.6362877",
"0.63580984",
"0.6355751",
"0.6333586",
"0.6310187",
"0.6285229",
"0.62677604",
"0.6260749",
"0.62368536",
"0.62367016",
"0.6213442",
"0.61973274",
"0.6185287",
"0.6164... | 0.65053934 | 4 |
function to reset game | function restartGame() {
allOpenedCards.length = 0;
resetTimer();
resetMoveCount();
resetStar();
resetCards();
toggleModal();
init();
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function resetGame() {\n resetClockAndTime();\n resetMoves(); \n resetRatings();\n startGame();\n}",
"function resetGame() {\n resetClockAndTime();\n resetMoves();\n resetStars();\n initGame();\n activateCards();\n startGame();\n}",
"function reset() {\n //Reset the game\n c... | [
"0.8925137",
"0.8868678",
"0.8839611",
"0.88265324",
"0.87974507",
"0.87514013",
"0.8715469",
"0.8713044",
"0.8680245",
"0.8623561",
"0.8620319",
"0.8616942",
"0.85936975",
"0.8580226",
"0.8546222",
"0.85140723",
"0.85026693",
"0.84723043",
"0.84667",
"0.8462359",
"0.8455414"... | 0.0 | -1 |
function to stop the game once the user win and toggle the modal to show result | function gameOver() {
stopTimer();
updateModal();
toggleModal();
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function winGame() {\n stopTimer();\n toggleModal();\n}",
"function continueGame() {\n // clear modal\n $(\".modal\").removeClass(\"bg-modal\");\n $(\".modal-inner\").removeClass(\"modal-content\").html(\"\");\n // has endgame condition been reached\n if (selectedGlyphs.l... | [
"0.79958755",
"0.7674914",
"0.7590692",
"0.7562863",
"0.75202096",
"0.7463216",
"0.74332577",
"0.7370642",
"0.736813",
"0.73266023",
"0.7278763",
"0.7268241",
"0.7261297",
"0.72610885",
"0.7241172",
"0.72255564",
"0.72160333",
"0.72023773",
"0.7202213",
"0.7199982",
"0.719157... | 0.73718977 | 7 |
TODO: Clean this crap up | async reAuthorize(user, pass, options) {
return new Promise((resolve, reject) => {
puppeteer.launch({args: ['--no-sandbox', '--disable-setuid-sandbox']}).then(async browser => {
try {
const page = await browser.newPage();
try {
console.log(`[cbs api] - navigate to ${CbsAPI.login.page}`);
await page.goto(`${CbsAPI.login.page}?${CbsAPI.login.params}`);
await page.type(CbsAPI.login.userSelector, user);
await page.type(CbsAPI.login.passwordSelector, pass);
console.log('[cbs api] - submit login form')
await page.$eval(CbsAPI.login.form, form => form.submit());
await page.waitForNavigation();
console.log(`[cbs api] - Login Complete. Get access_tokens`);
await page.waitForSelector(CbsAPI.teams.waitSelector);
const tokens = await this.getAllTokens(page, options);
console.log(`[cbs api] - ${tokens.length} valid leagues`);
resolve(new CbsProfile(user, tokens));
} catch (err) {
console.log(err);
reject(error);
}
} finally {
console.log('[cbs api] - close browser');
await browser.close();
}
});
});
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"private internal function m248() {}",
"private public function m246() {}",
"protected internal function m252() {}",
"transient private protected internal function m182() {}",
"static private internal function m121() {}",
"transient protected internal function m189() {}",
"static final private internal ... | [
"0.6629856",
"0.64722884",
"0.6315378",
"0.59493625",
"0.58367836",
"0.58133566",
"0.5773609",
"0.57577735",
"0.5658787",
"0.5511058",
"0.5473137",
"0.54320234",
"0.5384917",
"0.53504694",
"0.53492665",
"0.53312796",
"0.5299023",
"0.52425486",
"0.5214896",
"0.5134584",
"0.510... | 0.0 | -1 |
TODO: OBJECT FOR MAPPING OWNERS TO TEAM | mapTeamData(team, ownersList) {
const owners = ownersList.filter(owner => owner.team.id == team.id).map(ownerObj => {
const owner = Object.assign({}, ownerObj);
const name = owner.name.split(' ');
owner.isLeagueManager = owner.commissioner == 1;
owner.displayName = owner.name;
owner.firstName = name.length > 0 ? name[0] : '';
owner.lastName = name.length > 1 ? name[1] : '';
delete owner.name;
delete owner.team;
delete owner.commissioner;
delete owner.logged_in_owner;
return owner;
});
const roster = team.players.map(player => {
return {
id: parseInt(player.id),
firstName: player.firstname,
lastName: player.lastname,
fullName: player.fullname
}
});
team.owners = owners;
team.roster = roster;
team.id = parseInt(team.id);
team.abbrev = team.abbr;
delete team.abbr;
delete team.projected_points;
delete team.lineup_status;
delete team.players;
delete team.warning;
delete team.point;
delete team.long_abbr;
delete team.short_name;
delete team.division;
return team;
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"get owners() {\r\n return new Owners(this);\r\n }",
"function getProjectMembersOrTenderers() {\n $scope.membersList = $rootScope.getProjectMembers(people);\n $scope.tags = [];\n _.each($rootScope.currentTeam.fileTags, function(tag) {\n $scope.tags.push({name: tag, select... | [
"0.6072791",
"0.60671264",
"0.5977277",
"0.58441657",
"0.5806571",
"0.572325",
"0.57117057",
"0.57033056",
"0.57033056",
"0.56819993",
"0.56730604",
"0.5668324",
"0.5668324",
"0.5668324",
"0.5668324",
"0.5668324",
"0.5668324",
"0.5668324",
"0.5668324",
"0.5668324",
"0.5668324... | 0.6414082 | 0 |
P R I V A T E | async getAllTokens(page, options) {
const tokens = [];
let teamsList = await page.$$(`${CbsAPI.teams.prefixSelector}${options.sport}${CbsAPI.teams.suffixSelector}`);
console.log(`[cbs api] - found ${teamsList.length} team(s)`);
const hrefs = [];
for (let i = 0; i < teamsList.length; i++) {
const prop = await teamsList[i].getProperty('href');
const href = await prop.jsonValue();
hrefs.push(href);
}
for (let i = 0; i <hrefs.length; i++) {
console.log(`[cbs api] - navigate to ${hrefs[i]} to get check league type and access_token`);
const token = await this.getAccessToken(page, hrefs[i]);
tokens.push(token);
}
return tokens.filter(token => CbsAPI.allowedTypes.includes(token.leagueType));
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"private public function m246() {}",
"private internal function m248() {}",
"protected internal function m252() {}",
"transient private internal function m185() {}",
"transient protected internal function m189() {}",
"static private internal function m121() {}",
"transient private protected internal fun... | [
"0.6497584",
"0.6456844",
"0.60105735",
"0.6008095",
"0.5982573",
"0.59378886",
"0.5866038",
"0.5724313",
"0.5679906",
"0.564659",
"0.5587861",
"0.55853236",
"0.55626935",
"0.55626935",
"0.55626935",
"0.55626935",
"0.55626935",
"0.55626935",
"0.55626935",
"0.55626935",
"0.556... | 0.0 | -1 |
Function plots cartesian coordiate system | function plotCartesian(x,y,z, target){
let hoverlabel = ["X: "+x[0]+", Y: "+y[0]+", Z: "+z[0],"X: "+x[1]+", Y: "+y[1]+", Z: "+z[1]];
var data = [{
type: 'scatter3d',
mode: 'lines',
x: x,
y: y,
z: z,
hoverinfo: 'text',
hovertext: hoverlabel,
opacity: 1,
line: {
width: 6,
color: "rgb(0,0,0)"
}
}]
var layout = {
scene: {
xaxis:{title: 'X AXIS'},
yaxis:{title: 'Y AXIS'},
zaxis:{title: 'Z AXIS'},
}
}
Plotly.plot(target, data, layout);
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function drawCartesianOverlay() {\n \"use strict\";\n //Draw heavier black lines for grid\n ctx.beginPath();\n ctx.moveTo(0.5, 300.5);\n ctx.lineTo(800.5, 300.5);\n ctx.moveTo(400.5, 0.5);\n ctx.lineTo(400.5, 600.5);\n ctx.strokeStyle = 'black';\n ctx.lineWidth = 1.0;\n ctx.stroke();\... | [
"0.606524",
"0.58996356",
"0.5816983",
"0.5802485",
"0.5684464",
"0.56714755",
"0.5637831",
"0.5623183",
"0.55911744",
"0.55853385",
"0.5572179",
"0.55446523",
"0.553017",
"0.5528281",
"0.5513845",
"0.5494181",
"0.54765886",
"0.5468272",
"0.5444749",
"0.5409388",
"0.54050297"... | 0.5585903 | 9 |
Function plots Cylindrical coordiate system | function plotCylindrical(r,theta,z, target){
console.log(r,theta,z,target);
let hoverlabel = ["R: "+r[0]+", Θ: "+theta[0]+", Z: "+z[0],"R: "+r[1]+", Θ: "+theta[1]+", Z: "+z[1]];
var data = [{
type: 'scatter3d',
mode: 'lines',
x: r,
y: theta,
z: z,
hoverinfo: 'text',
hovertext: hoverlabel,
opacity: 1,
line: {
width: 6,
color: "rgb(0,0,0)",
reversescale: false
}
}]
var layout = {
scene: {
xaxis:{title: 'R'},
yaxis:{title: 'THETA'},
zaxis:{title: 'Z'},
}
}
Plotly.plot(target, data, layout);
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"plotCyclists() {\n for (let c of this.mapCyclists) {\n if (c.cyclist.id.id == \"0_ghost\" || c.cyclist.id.id == \"ghost\") {\n c.plotGhost(this.map);\n } else {\n c.plotMarker(this.map);\n }\n }\n }",
"axisPlot() {\n this.ctx ... | [
"0.5888707",
"0.5736098",
"0.56165415",
"0.5589112",
"0.55744106",
"0.55394167",
"0.5459294",
"0.5414624",
"0.5414624",
"0.5370074",
"0.53614116",
"0.5356966",
"0.53366965",
"0.5328876",
"0.5309544",
"0.53041136",
"0.5301971",
"0.5296474",
"0.5284543",
"0.5255541",
"0.5231733... | 0.5288344 | 18 |
Function plots Spherical coordiate system | function plotSpherical(r, theta, phi, target){
let hoverlabel = ["R: "+r[0]+", Θ: "+theta[0]+", Φ: "+phi[0],"R: "+r[1]+", Θ: "+theta[1]+", Φ: "+phi[1]];
var data = [{
type: 'scatter3d',
mode: 'lines',
x: r,
y: theta,
z: phi,
hoverinfo: 'text',
hovertext: hoverlabel,
opacity: 1,
line: {
width: 6,
color: "rgb(0,0,0)",
reversescale: false
}
}]
var layout = {
scene: {
xaxis:{title: 'R'},
yaxis:{title: 'THETA'},
zaxis:{title: 'PHI'},
},
showticklabels: false
}
Plotly.plot(target, data, layout);
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function drawSphere(gl) {\n\tdrawCircle(gl);\n\tdrawMarks(gl);\n}",
"function drawSphere() {\n setMV();\n Sphere.draw();\n}",
"function drawSphere() {\n setMV();\n Sphere.draw();\n}",
"function spherical(cartesian) {\n return [Object(__WEBPACK_IMPORTED_MODULE_1__math__[\"g\" /* atan2 */])(cartes... | [
"0.64300853",
"0.631371",
"0.631371",
"0.6163995",
"0.60776424",
"0.6008311",
"0.59189767",
"0.58383954",
"0.58289444",
"0.5808101",
"0.5748349",
"0.5744434",
"0.56139386",
"0.56059897",
"0.5590826",
"0.5570486",
"0.55594295",
"0.5548546",
"0.5505314",
"0.54518604",
"0.544912... | 0.6640652 | 0 |
\ ROUTE MAP /\ | function checkDataForInsert(req, res, next) {
let data = req.body
if (!req.user.id || !data.topic_id || !data.msg) {
res.resp(403, errmsg.MISSING_DATA)
} else {
if (data.msg.match(regex.string_blank)) {
res.resp(403, errmsg.BLANK_STRING)
}
if (data.msg.length > global.limit.msg) {
res.resp(403, errmsg.LONG_STRING)
}
}
let topic = new Topic()
topic.import(data.topic_id)
.then((result) => {
if(topic.status == 1 || topic.status == 3) {
res.resp(423, errmsg.ARCHIVED_TOPIC)
} else
next()
})
.catch((err) => {
res.resp(404, errmsg.ID_NOT_FOUND)
})
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function map() {\n\n}",
"function MAP() {\n\n}",
"function Map() {}",
"function Map() {\n\t\n}",
"function Map() {\n\t\n}",
"function PathMapper() {\n\t}",
"function PathMapper() {\n\t}",
"function ParamMap() { }",
"function ParamMap() { }",
"function ParamMap() {}",
"function ParamMap() {}",
... | [
"0.68645376",
"0.6628688",
"0.65455055",
"0.6352502",
"0.6352502",
"0.6338502",
"0.6338502",
"0.63022685",
"0.63022685",
"0.62968117",
"0.62968117",
"0.61751074",
"0.6137952",
"0.6093293",
"0.60596484",
"0.6041014",
"0.5973534",
"0.59055483",
"0.5819673",
"0.5810476",
"0.5810... | 0.0 | -1 |
Getter for quantity If _value is an instance of Quantity, will return object with properties number and unit Otherwise return null; | get quantity() {
if (this._observation.dataValue
&& this._observation.dataValue.value instanceof Quantity) {
return {
number: this._observation.dataValue.value.number.decimal,
unit: this._observation.dataValue.value.units.coding.codeValue.value,
};
} else {
return null;
}
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"get valueQuantity () {\r\n\t\treturn this._valueQuantity;\r\n\t}",
"get valueQuantity () {\r\n\t\treturn this.__valueQuantity;\r\n\t}",
"get quantity() {\n\t\treturn this.__quantity;\n\t}",
"get quantity() {\n\t\treturn this.__quantity;\n\t}",
"get quantity() {\n\t\treturn this.__quantity;\n\t}",
"functi... | [
"0.73006326",
"0.7286378",
"0.70620376",
"0.70620376",
"0.70620376",
"0.6507041",
"0.64678663",
"0.6447228",
"0.64377165",
"0.6419223",
"0.6379325",
"0.63425386",
"0.6100222",
"0.6005071",
"0.58844334",
"0.5869871",
"0.5835774",
"0.583076",
"0.58057064",
"0.57182",
"0.5714805... | 0.8323964 | 0 |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.