1 else None\\n _is_file = os.path.isfile\\n if not cfg_path or not _is_file(cfg_path):\\n if cfg_path:\\n _info(\\\"no config at {}, trying the default location\\\".format(\\n cfg_path))\\n cfg_path = _DEFAULT_PATH\\n if not _is_file(cfg_path):\\n _info(\\\"no config at {}, exiting\\\".format(cfg_path))\\n return None\\n return cfg_path\",\n \"def get_lex_path(env, append_paths: bool=False) -> Optional[str]:\\n for prog in BINS:\\n bin_path = SCons.Tool.find_program_path(\\n env,\\n prog,\\n default_paths=DEFAULT_PATHS,\\n add_path=append_paths,\\n )\\n if bin_path:\\n return bin_path\\n\\n SCons.Warnings.warn(\\n SCons.Warnings.SConsWarning,\\n 'lex tool requested, but lex or flex binary not found in ENV PATH'\\n )\",\n \"def path_to_program_dir(self):\\n\\tpath = sys.argv[0]\\n\\n\\tif not os.path.isdir(path):\\n\\t path = os.path.dirname(path)\\n\\n\\tif not path: return '.'\\n\\n\\treturn path\",\n \"def SearchPath(name, path=None):\\n path = path or os.environ['PATH']\\n for dir in path.split(os.pathsep):\\n binpath = os.path.join(dir, name)\\n if os.path.exists(binpath):\\n return os.path.abspath(binpath)\\n return None\",\n \"def find_config_file(filename):\\n if os.path.exists( filename) :\\n return filename\\n if os.path.exists( filename + \\\".cfg\\\") :\\n return filename + \\\".cfg\\\"\\n\\n # Search in script folder\\n progname = sys.argv[0]\\n basedir = os.path.dirname( progname)\\n filename2 = os.path.join( basedir, filename)\\n\\n if os.path.exists( filename2) :\\n return filename2\\n if os.path.exists( filename2 + \\\".cfg\\\") :\\n return filename2 + \\\".cfg\\\"\\n\\n # Otherwise, we are screwed\\n raise IOError(\\\"cannot find configuration file\\\")\",\n \"def _findConfigPath(self, name):\\n for path in reversed(self._makeAllConfigPaths(name)):\\n if os.path.exists(path):\\n return path\",\n \"def _findconfigfile():\\n\\n # A ordered list of possible config files\\n configfiles = [\\\"~/.githubhooksrc\\\",\\n \\\"/etc/githubhooks\\\"]\\n\\n for configfile in configfiles:\\n if os.path.isfile(os.path.expanduser(configfile)):\\n return os.path.expanduser(configfile)\\n\\n # No valid config file found\\n print \\\"ERROR: No valid config file found in any of the following locations:\\\"\\n for configfile in configfiles:\\n print \\\" - %s\\\" % configfile\\n sys.exit(1)\",\n \"def _detect(env):\\n try:\\n return env['KCC']\\n except KeyError:\\n pass\\n\\n kcc = env.WhereIs('kcc', env['KCC_DIR'])\\n if kcc:\\n return kcc\\n\\n raise SCons.Errors.StopError(\\n KccNotFound,\\n \\\"Could not find Kalimba C compiler (kcc.exe)\\\")\",\n \"def find_executable(name):\\n for dir in os.environ.get('PATH', '').split(os.pathsep):\\n if not dir:\\n continue\\n fn = os.path.abspath(os.path.join(dir, name))\\n if os.path.exists(fn):\\n return os.path.abspath(fn)\",\n \"def path_which(args):\\n print(header(\\\"$PATH Lookup: {}\\\".format(args.look)))\\n loop_fmt = \\\"{color}{path}\\\"\\n\\n cnt = 0\\n for part in os.environ[\\\"PATH\\\"].split(\\\":\\\"):\\n color = u\\\"\\\"\\n if args.color:\\n color = CODES[cnt]\\n\\n msg = check_exec(part, args.look, args.version)\\n if msg:\\n print(header(loop_fmt.format(color=color, path=part), '-'))\\n print(msg)\\n cnt = (cnt + 1) % len(CODES)\",\n \"def _find_config_file(self) -> str or None:\\n import os\\n\\n for path in self.paths:\\n path = os.path.expanduser(path)\\n for extension in self.file_extensions:\\n for file_name in self.file_names:\\n file_path = os.path.join(path, \\\"{}.{}\\\".format(file_name, extension))\\n if os.path.isfile(file_path):\\n return file_path\\n\\n return None\",\n \"def scan_path(executable=\\\"mongod\\\"):\\n for path in os.environ.get(\\\"PATH\\\", \\\"\\\").split(\\\":\\\"):\\n path = os.path.abspath(path)\\n executable_path = os.path.join(path, executable)\\n if os.path.exists(executable_path):\\n return executable_path\",\n \"def is_tool(name):\\n return find_executable(name) is not None\",\n \"def find_bin_by_name(bin_name):\\n bin_path = shutil.which(bin_name)\\n if bin_path is None:\\n return None\\n else:\\n major = parse_version_major(bin_path)\\n return bin_path if major == required_clang_format_major else None\",\n \"def build(self, progname):\\n self.run_programm(self.COMPILED[self.progtype][0], \\\"%s %s %s\\\" %\\\\\\n (progname, self.COMPILED[self.progtype][1], COMPILED_FILENAME ))\\n\\n compiled_progname=COMPILED_FILENAME\\n return compiled_progname\",\n \"def is_executable(program):\\n def is_exe(fpath):\\n return os.path.isfile(fpath) and os.access(fpath, os.X_OK)\\n\\n fpath, fname = os.path.split(program)\\n if fpath:\\n if is_exe(program):\\n return True\\n else:\\n for path in os.environ[\\\"PATH\\\"].split(os.pathsep):\\n path = path.strip('\\\"')\\n exe_file = os.path.join(path, program)\\n if is_exe(exe_file):\\n return True\\n\\n return False\",\n \"def find_executable(binary):\\n\\n\\tfor syspath in os.environ.get('PATH', default_path).split(':'):\\n\\t\\tif os.path.exists(os.path.join(syspath, binary)):\\n\\t\\t\\treturn os.path.join(syspath, binary)\\n\\n\\treturn None\",\n \"def exec_exists(name):\\n\\n with settings(hide('everything'), warn_only=True):\\n return local('which %s' % name, capture=True)\",\n \"def get_app_location(self, name: str) -> Path:\\n location = self.config[\\\"apps\\\"].get(name)\\n if location is None:\\n _print_and_quit(f\\\"Unknown app '{name}'.\\\")\\n return Path(location)\",\n \"def check_path():\\n print('[GenHub] Checking PATH for executables and scripts.')\\n\\n execs = ['gt', 'cd-hit', 'tidygff3', 'locuspocus', 'xtractore',\\n 'canon-gff3', 'pmrna', 'lpdriver.py', 'uloci.py', 'seq-reg.py']\\n paths = list()\\n for exe in execs:\\n try:\\n proc = subprocess.Popen(['which', exe], stdout=subprocess.PIPE,\\n stderr=subprocess.PIPE,\\n universal_newlines=True)\\n resultcode = proc.wait()\\n if resultcode == 0:\\n procpath = next(proc.stdout)\\n procpath = str(procpath).rstrip()\\n paths.append((exe, procpath))\\n else:\\n paths.append((exe, None))\\n except subprocess.CalledProcessError:\\n paths.append((exe, None))\\n\\n missing = False\\n for exe, path in paths:\\n char = '+'\\n if path is None:\\n char = '-'\\n path = '???'\\n missing = True\\n print('%s %-20s: %s' % (char, exe, path))\\n if missing:\\n print('Executables / scripts cannot be found in your PATH.', end='')\\n print(' Certain build commands will not work.')\",\n \"def checkSanity(binaryPath, componentName):\\n\\n path = \\\"%s/%s.exe\\\" % (binaryPath, componentName)\\n\\n if not os.path.exists(path):\\n print(\\\"config.binaryPath '%s' does not exist! Aborting.\\\" % path, file=sys.stderr)\\n sys.exit(1)\",\n \"def check_for_application_file(self, application):\\n # 1. Get the path of the app_config directory\\n app_conf_dir = self.sys_conf['configs']['env'][self.env]['app_config_url']\\n\\n # 2. Get the path for the given application configuration file\\n app_conf_dir += '/{file}.yaml'.format(file=application)\\n\\n # 3. Validate the path exists\\n chk = file_check(app_conf_dir)\\n\\n # 4. Return the result\\n return chk\",\n \"def get_project_config(filepath):\\n config_file = Path.joinpath(filepath, \\\".td.cfg\\\")\\n\\n if Path.home() >= filepath:\\n return None\\n elif Path.exists(config_file):\\n return config_file\\n else:\\n return get_project_config(filepath.parent)\",\n \"def prog():\\n global program\\n return program\",\n \"def find_in_app(self, app, path):\\n storage = self.storages.get(app)\\n if storage:\\n # only try to find a file if the source dir actually exists\\n if storage.exists(path):\\n matched_path = storage.path(path)\\n if matched_path:\\n return matched_path\",\n \"def get_cs_path(circuitscapeDir):\\r\\n csPath = os.path.join(circuitscapeDir,'Circuitscape\\\\\\\\cs_run.exe')\\r\\n if os.path.exists(csPath): \\r\\n return csPath\\r\\n envList = [\\\"ProgramW6432\\\", \\\"ProgramFiles\\\", \\\"ProgramFiles(x86)\\\"]\\r\\n for x in range (0,len(envList)):\\r\\n try:\\r\\n pfPath = os.environ[envList[x]]\\r\\n csPath = os.path.join(pfPath,'Circuitscape\\\\\\\\cs_run.exe')\\r\\n if os.path.exists(csPath): return csPath\\r\\n except: pass\\r\\n return None\",\n \"def _which(executable):\\n\\n def is_exe(fpath):\\n \\\"\\\"\\\"Returns True if the path is an executable\\\"\\\"\\\"\\n return os.path.isfile(fpath) and os.access(fpath, os.X_OK)\\n\\n fpath, _ = os.path.split(executable)\\n if fpath:\\n if is_exe(executable):\\n return executable\\n else:\\n for path in os.environ[\\\"PATH\\\"].split(os.pathsep):\\n path = path.strip('\\\"')\\n exe_file = os.path.join(path, executable)\\n if is_exe(exe_file):\\n return exe_file\\n\\n return None\",\n \"def _build_binary_file_path(program_path: pathlib.Path, build_dir: pathlib.Path, hex_file: bool) -> pathlib.Path:\\n fw_fbase = build_dir / program_path.name\\n fw_file = fw_fbase.with_suffix(\\\".hex\\\" if hex_file else \\\".bin\\\")\\n if not fw_file.exists():\\n raise BinaryFileNotFoundError(f\\\"Build program file (firmware) not found {fw_file}\\\")\\n return fw_file\",\n \"def find_config():\\n print(\\\"in find_config()\\\")\\n print(os.getcwd())\\n print(os.listdir(os.getcwd()))\\n print(os.path.expanduser(\\\"~/.pylcmodel\\\"))\\n if os.path.isfile(os.path.join(os.getcwd(), \\\".pylcmodel\\\")):\\n return os.path.join(os.getcwd(), \\\".pylcmodel\\\")\\n elif os.path.isfile(os.path.expanduser(\\\"~/.pylcmodel\\\")):\\n return os.path.expanduser(\\\"~/.pylcmodel\\\")\\n else:\\n raise FileNotFoundError(\\\"No .pylcmodel config file found.\\\")\",\n \"def clean_program(self):\\n program_id = self.cleaned_data[self.Fields.PROGRAM].strip()\\n if not program_id:\\n return None\\n\\n try:\\n client = CourseCatalogApiClient(self._user)\\n program = client.get_program_by_uuid(program_id) or client.get_program_by_title(program_id)\\n except MultipleProgramMatchError as exc:\\n raise ValidationError(ValidationMessages.MULTIPLE_PROGRAM_MATCH.format(program_count=exc.programs_matched))\\n except (HttpClientError, HttpServerError):\\n raise ValidationError(ValidationMessages.INVALID_PROGRAM_ID.format(program_id=program_id))\\n\\n if not program:\\n raise ValidationError(ValidationMessages.INVALID_PROGRAM_ID.format(program_id=program_id))\\n\\n if program['status'] != ProgramStatuses.ACTIVE:\\n raise ValidationError(\\n ValidationMessages.PROGRAM_IS_INACTIVE.format(program_id=program_id, status=program['status'])\\n )\\n\\n return program\",\n \"def SearchPath(name):\\n search_path = os.getenv('PATH', os.defpath).split(os.pathsep)\\n for directory in search_path:\\n if directory:\\n path = os.path.join(directory, name)\\n if os.path.isfile(path) and os.access(path, os.X_OK):\\n return path\\n return None\",\n \"def is_installed(programme: str) -> bool:\\n res = shutil.which(programme)\\n return res is not None\",\n \"def is_tool(name):\\n\\n # from whichcraft import which\\n from shutil import which\\n\\n return which(name) is not None\",\n \"def is_tool(name):\\n\\n # from whichcraft import which\\n from shutil import which\\n\\n return which(name) is not None\",\n \"def has_required_programs(program_list):\\n \\n returnValue = True\\n \\n for program in program_list:\\n if commands.getstatusoutput(\\\"which \\\"+program)[0] != 0:\\n log.error(program+\\\" is required by \\\"+PROGRAM_NAME)\\n returnValue = False\\n \\n return returnValue\",\n \"def getResource(resname, loc = None):\\n # check the HOME for personal config file\\n prv_filename = os.path.join(os.getenv(\\\"HOME\\\"), \\\".aphla\\\", resname)\\n if os.path.exists(prv_filename):\\n return prv_filename\\n elif loc and resource_exists(loc, resname):\\n # use the config within distribution\\n return resource_filename(loc, resname)\\n else:\\n return None\",\n \"def program_data(progf):\\r\\n if os.path.exists(progf):\\r\\n prog = \\\"\\\"\\r\\n for line in open(progf, \\\"r\\\", encoding=\\\"utf-8\\\"):\\r\\n line = line.split(\\\"#\\\")[0]\\r\\n prog += line\\r\\n prog = prog.split()\\r\\n return prog\",\n \"def _check_exe_folder(self):\\n executable_folder = os.path.split(sys.executable)[0]\\n return self._check_folder(executable_folder)\",\n \"def find_executable(name, names=None, required=True):\\n path_from_env = os.environ.get(name.upper())\\n if path_from_env is not None:\\n return path_from_env\\n names = [name] + (names or [])\\n for _name in names:\\n if osp.isabs(_name):\\n return _name\\n paths = os.environ.get('PATH', '').split(os.pathsep)\\n eax = find_in_paths(_name, paths)\\n if eax:\\n return eax\\n if required:\\n raise NameError('Could not find %s executable' % name)\",\n \"def path(self):\\n if not self._path:\\n logger.spam(\\\"Checking for helper executable %s\\\", self.name)\\n self._path = distutils.spawn.find_executable(self.name)\\n if self._path:\\n logger.debug(\\\"%s is at %s\\\", self.name, self.path)\\n self._installed = True\\n else:\\n logger.debug(\\\"No path to %s found\\\", self.name)\\n return self._path\",\n \"def which(name):\\n # Inspired by https://twistedmatrix.com/trac/browser/tags/releases/\\n # twisted-8.2.0/twisted/python/procutils.py\\n # pylint: disable=W0141\\n result = []\\n path = os.environ.get('PATH', None)\\n if path is None:\\n return []\\n for pdir in os.environ.get('PATH', '').split(os.pathsep):\\n fname = os.path.join(pdir, name)\\n if os.path.isfile(fname) and os.access(fname, os.X_OK):\\n result.append(fname)\\n return result[0] if result else None\",\n \"def check_for_config(conf, confs_path):\\n if yes_no('Is there a configuration file you would like to load?'):\\n options = os.listdir(confs_path)\\n if len(options) > 0:\\n options.append('Specify a Path')\\n option = ask_options(\\n 'Pick a configuration file', options, title=False)\\n if option == 'Specify a Path':\\n conf['config'] = ask_path(\\n 'Enter the path for the configuration file')\\n else:\\n conf['config'] = os.path.join(confs_path, option)\\n else:\\n conf['config'] = ask_path(\\n 'Enter the path for the configuration file')\\n conf = get_config_file(conf)\\n conf, _ = confirm_conf(conf)\\n conf.pop('config')\\n return conf\",\n \"def get_config_filepath():\\n scs_installation_dirs = _path_utils.get_addon_installation_paths()\\n\\n # SEARCH FOR CONFIG...\\n scs_config_file = ''\\n for i, location in enumerate(scs_installation_dirs):\\n test_path = os.path.join(location, 'config.txt')\\n if os.path.isfile(test_path):\\n scs_config_file = test_path\\n break\\n\\n # IF NO CONFIG FILE, CREATE ONE...\\n if scs_config_file == '':\\n lprint(\\\"S Creating new 'config.txt' file:\\\\n\\\\t %r\\\", (os.path.join(scs_installation_dirs[0], 'config.txt'),))\\n scs_config_file = new_config_file(os.path.join(scs_installation_dirs[0], 'config.txt'))\\n\\n # print('SCS Blender Tools Config File:\\\\n \\\"%s\\\"\\\\n' % os.path.join(scs_installation_dirs[0], 'config.txt'))\\n return scs_config_file\",\n \"def isPath(self,pin,head=\\\"check path exist\\\",exit_on_error=False,logmsg=False):\\n p = os.path.abspath(self.expandvars(pin))\\n if os.path.isdir(p):\\n if logmsg:\\n logger.info(head + \\\"\\\\n --> dir exist: {}\\\\n -> abs dir{:>18} {}\\\".format(pin,':',p))\\n return p\\n #--- error no such file\\n logger.error(head + \\\"\\\\n --> no such directory: {}\\\\n -> abs dir{:>18} {}\\\".format(pin,':',p))\\n if exit_on_error:\\n raise SystemError(self.__MSG_CODE_PATH_NOT_EXIST)\\n return False\",\n \"def get_configuration_file():\\n path = os.path.abspath(os.curdir)\\n while path != os.sep:\\n config_path = os.path.join(path, CONFIG_FILE_NAME)\\n if os.path.exists(config_path):\\n return config_path\\n path = os.path.dirname(path)\\n return None\",\n \"def is_tool(name):\\n from shutil import which\\n return which(name) is not None\"\n]","isConversational":false},"negative_scores":{"kind":"list like","value":["0.67661804","0.66921204","0.65894896","0.6528314","0.64908946","0.6469822","0.641857","0.63612264","0.6318409","0.6250026","0.61892205","0.61833847","0.61833847","0.61687654","0.61340445","0.61195254","0.61188084","0.6089571","0.6089144","0.6088777","0.6067471","0.6052141","0.603533","0.60347813","0.60298467","0.6018274","0.6010809","0.5988568","0.5961038","0.59277034","0.58570784","0.5808107","0.579121","0.578302","0.57613057","0.5747836","0.5674065","0.5660955","0.5643536","0.56426734","0.564117","0.564117","0.5635836","0.5624014","0.5592774","0.5562834","0.5531512","0.55250835","0.55167806","0.55148953","0.55129755","0.5500029","0.5469049","0.5462654","0.5416429","0.5371614","0.53664064","0.53429466","0.5330231","0.5278239","0.5261108","0.524947","0.52019376","0.52009887","0.5193419","0.51912993","0.5189134","0.51348096","0.51338047","0.5126475","0.50995487","0.5093953","0.50801635","0.5079956","0.50599104","0.50598043","0.50457036","0.5037033","0.50325257","0.50291616","0.50217605","0.5014148","0.5012881","0.50010127","0.50002706","0.4997456","0.49935958","0.49935958","0.4985408","0.4984052","0.4983618","0.49791455","0.49767783","0.49613348","0.4953374","0.49508175","0.49443257","0.49416217","0.492491","0.4923244"],"string":"[\n \"0.67661804\",\n \"0.66921204\",\n \"0.65894896\",\n \"0.6528314\",\n \"0.64908946\",\n \"0.6469822\",\n \"0.641857\",\n \"0.63612264\",\n \"0.6318409\",\n \"0.6250026\",\n \"0.61892205\",\n \"0.61833847\",\n \"0.61833847\",\n \"0.61687654\",\n \"0.61340445\",\n \"0.61195254\",\n \"0.61188084\",\n \"0.6089571\",\n \"0.6089144\",\n \"0.6088777\",\n \"0.6067471\",\n \"0.6052141\",\n \"0.603533\",\n \"0.60347813\",\n \"0.60298467\",\n \"0.6018274\",\n \"0.6010809\",\n \"0.5988568\",\n \"0.5961038\",\n \"0.59277034\",\n \"0.58570784\",\n \"0.5808107\",\n \"0.579121\",\n \"0.578302\",\n \"0.57613057\",\n \"0.5747836\",\n \"0.5674065\",\n \"0.5660955\",\n \"0.5643536\",\n \"0.56426734\",\n \"0.564117\",\n \"0.564117\",\n \"0.5635836\",\n \"0.5624014\",\n \"0.5592774\",\n \"0.5562834\",\n \"0.5531512\",\n \"0.55250835\",\n \"0.55167806\",\n \"0.55148953\",\n \"0.55129755\",\n \"0.5500029\",\n \"0.5469049\",\n \"0.5462654\",\n \"0.5416429\",\n \"0.5371614\",\n \"0.53664064\",\n \"0.53429466\",\n \"0.5330231\",\n \"0.5278239\",\n \"0.5261108\",\n \"0.524947\",\n \"0.52019376\",\n \"0.52009887\",\n \"0.5193419\",\n \"0.51912993\",\n \"0.5189134\",\n \"0.51348096\",\n \"0.51338047\",\n \"0.5126475\",\n \"0.50995487\",\n \"0.5093953\",\n \"0.50801635\",\n \"0.5079956\",\n \"0.50599104\",\n \"0.50598043\",\n \"0.50457036\",\n \"0.5037033\",\n \"0.50325257\",\n \"0.50291616\",\n \"0.50217605\",\n \"0.5014148\",\n \"0.5012881\",\n \"0.50010127\",\n \"0.50002706\",\n \"0.4997456\",\n \"0.49935958\",\n \"0.49935958\",\n \"0.4985408\",\n \"0.4984052\",\n \"0.4983618\",\n \"0.49791455\",\n \"0.49767783\",\n \"0.49613348\",\n \"0.4953374\",\n \"0.49508175\",\n \"0.49443257\",\n \"0.49416217\",\n \"0.492491\",\n \"0.4923244\"\n]","isConversational":false},"document_score":{"kind":"string","value":"0.7263758"},"document_rank":{"kind":"string","value":"0"}}},{"rowIdx":10189,"cells":{"query":{"kind":"string","value":"This function is from SCons but extended with additional flags, e.g. the extra_libs. Another (more sophisticated) test for a library. Checks, if library and header is available for language (may be 'C' or 'CXX'). Call maybe be a valid expression _with_ a trailing ';'. As in CheckLib, we support library=None, to test if the call compiles without extra link flags."},"document":{"kind":"string","value":"def CheckLibWithHeader(context, libs, header, language,\n call = None, extra_libs = None, autoadd = 1):\n prog_prefix, dummy = \\\n SCons.SConf.createIncludesFromHeaders(header, 0)\n if libs == []:\n libs = [None]\n\n if not SCons.Util.is_List(libs):\n libs = [libs]\n\n res = SCons.Conftest.CheckLib(context, libs, None, prog_prefix,\n call = call, language = language, extra_libs = extra_libs,\n autoadd = autoadd)\n context.did_show_result = 1\n return not res"},"metadata":{"kind":"string","value":"{\n \"objective\": {\n \"self\": [],\n \"paired\": [],\n \"triplet\": [\n [\n \"query\",\n \"document\",\n \"negatives\"\n ]\n ]\n }\n}"},"negatives":{"kind":"list like","value":["def check_library(self, **kw):\n\tself.check(\n\t\tcompile_filename = [],\n\t\tfeatures = 'link_lib_test',\n\t\tmsg = 'Checking for libraries',\n\t\t)","def check_libraries(env):\n # Detect OS X python installation, and attempt to correct for it.\n if os.uname()[0] == 'Darwin':\n env.Replace(SHLINKFLAGS='$LINKFLAGS -bundle -flat_namespace -undefined suppress')\n env.Replace(SHLIBSUFFIX='.so')\n if os.path.isdir('/opt/local'):\n env.Append(\n LIBPATH=['/opt/local/lib'],\n CPPPATH=['/opt/local/include']\n )\n\n # Detect the presence of necessary dependencies.\n conf = Configure(env)\n\n if not conf.CheckLibWithHeader('m', 'math.h', 'c'):\n print \"Can't find standard math libraries.\"\n Exit(1)\n\n if not conf.CheckLibWithHeader('python%s' % python_version,\n 'Python.h', 'c'):\n print \"Can't find python %s.\" % python_version\n Exit(1)\n\n env = conf.Finish()\n\n return env","def checkLibraries(env):\n # Detect OS X python installation, and attempt to correct for it.\n if os.uname()[0] == 'Darwin':\n env.Replace(SHLINKFLAGS='$LINKFLAGS -bundle -flat_namespace -undefined suppress')\n env.Replace(SHLIBSUFFIX='.so')\n\n # Detect the presence of necessary dependencies.\n conf = Configure(env)\n\n if not conf.CheckLibWithHeader('m', 'math.h', 'c'):\n print \"Can't find standard math libraries.\"\n Exit(1)\n\n env = conf.Finish()\n\n return env","def examineLoadLibrary(lib):\n from PyJobTransformsCore.envutil import examine_library\n\n # turn module name into library name\n if not lib.startswith('lib') and not lib.endswith('.so'):\n lib = 'lib' + lib + '.so'\n print (\"Examining library \" + lib)\n diagLines = []\n errorAcronym = None\n missingSystemLibs = []\n missingOtherLibs = []\n misLibs = examine_library(lib)\n for l in misLibs:\n if systemLibsRE.search(l):\n missingSystemLibs.append(l)\n else:\n missingOtherLibs.append(l)\n if missingSystemLibs:\n if len(missingSystemLibs) == 1: libWord = 'library'\n else: libWord = 'libraries'\n diagLines.append( 'Site problem: Missing system %s: %s' % (libWord, ','.join(missingSystemLibs)) )\n if not errorAcronym: errorAcronym = \"ATH_SITE_SYSLIBS\"\n\n if missingOtherLibs:\n if len(missingOtherLibs) == 1: libWord = 'library'\n else: libWord = 'libraries'\n diagLines.append( 'Can not find %s: %s Please check software installation.' % (libWord,','.join(missingOtherLibs)) )\n if not errorAcronym: errorAcronym = \"ATH_SITE_LIBS\"\n return (errorAcronym,os.linesep.join(diagLines))","def checkArguments ( ) :\r\n\r\n if len( sys.argv ) <= 1 : return None\r\n\r\n\r\n # splits the arguments that contain quotes\r\n \r\n wordList = [ ]\r\n\r\n for argument in sys.argv :\r\n\r\n wordList.extend( argument.split( '\"' ) )\r\n\r\n\r\n # places all the arguments that start with \"--\" at the end, and joins the others into words\r\n\r\n noMinusList = [ ]\r\n\r\n minusList = [ ]\r\n\r\n argument = \"\"\r\n\r\n for word in wordList[ 1 : ] :\r\n\r\n # strips spaces and quotes\r\n \r\n word = word.strip( \" \\\"'\" ) \r\n\r\n if word.startswith( \"--\" ) :\r\n\r\n minusList.append( word )\r\n\r\n if len( argument ) > 0 : noMinusList.append( argument )\r\n\r\n argument = \"\"\r\n\r\n elif argument == \"\" :\r\n\r\n argument = word\r\n\r\n else :\r\n\r\n argument = argument + \" \" + word\r\n\r\n if len( argument ) > 0 : noMinusList.append( argument )\r\n\r\n\r\n # library = 1st argument of the form \"-- ... /\" that exists\r\n\r\n libraryPath = None\r\n\r\n for argument in minusList :\r\n\r\n if ( ( argument.endswith( os.sep ) ) and ( os.path.exists( argument.strip( \"- \" ) ) ) ) :\r\n\r\n libraryPath = argument.strip( \"-\" )\r\n\r\n break\r\n\r\n # recomposes the command line\r\n \r\n sys.argv = wordList[ : 1 ] + noMinusList + minusList \r\n\r\n return libraryPath","def check_linking(self):\n\n # This one checks if the linking command works out of the box or\n # if any specific flag is required. For example if the linker if the\n # Intel FORTRAN compiler, then the \"-nofor_main\" is usually required.\n # This function only checks if linker works but does not automatically\n # detect the required flags\n print 'Checking loader...',\n sys.stdout.flush()\n writefile('tmpf.f',\"\"\"\n subroutine fsub()\n write(*,*)'success'\n stop\n end\\n\"\"\")\n writefile('tmpc.c',\"\"\"\n #if defined ADD_\n #define fsub fsub_\n #elif defined NOCHANGE\n #define fsub fsub\n #elif defined fcIsF2C\n #define fsub fsub_\n #elif defined UPCASE\n #define fsub FSUB\n #endif\n void main(){\n fsub();}\\n\"\"\")\n\n ccomm = self.config.cc+' '+self.config.ccflags+' '+self.mangling+' -c -o tmpc.o tmpc.c'\n fcomm = self.config.fc+' '+self.config.fcflags+' -c -o tmpf.o tmpf.f'\n lcomm = self.config.fc+' '+self.config.ldflags_fc+' '+self.config.ld_fcmain+' -o lnk tmpf.o tmpc.o'\n\n (output, error, retz) = runShellCommand(ccomm)\n if retz:\n print '\\n\\nCOMMON: in check_linking: cannot compile'\n print 'command is: ',ccomm\n print 'error is:\\n','*'*40,'\\n',error,'\\n','*'*40\n sys.exit()\n\n (output, error, retz) = runShellCommand(fcomm)\n if retz:\n print '\\n\\nCOMMON: in check_linking: cannot compile'\n print 'command is: ',fcomm\n print 'error is:\\n','*'*40,'\\n',error,'\\n','*'*40\n sys.exit()\n\n (output, error, retz) = runShellCommand(lcomm)\n if retz:\n print \"\"\"\\n\\nCOMMON: in check_linking: cannot link\n Cannot link a C main program to a Fortran77 subroutine\n Make sure that the appropriate flags are passed to the linker.\"\"\"\n print 'command is: ',lcomm\n print 'error is:\\n','*'*40,'\\n',error,'\\n','*'*40\n sys.exit()\n\n\n killfiles(['lnk', 'tmpf.f', 'tmpf.o', 'tmpc.c', 'tmpc.o'])\n\n print 'works'\n return 1;","def find_python_library():\n python_library = sysconfig.get_config_var('LIBRARY')\n if (not python_library or os.path.splitext(python_library)[1][-2:] == '.a'):\n candidate_lib_prefixes = ['', 'lib']\n candidate_implementations = ['python']\n if hasattr(sys, \"pypy_version_info\"):\n candidate_implementations = ['pypy-c', 'pypy3-c']\n candidate_extensions = ['.lib', '.so', '.a']\n if sysconfig.get_config_var('WITH_DYLD'):\n candidate_extensions.insert(0, '.dylib')\n candidate_versions = []\n candidate_versions.append('')\n candidate_versions.insert(0, str(sys.version_info.major) +\n \".\" + str(sys.version_info.minor))\n abiflags = getattr(sys, 'abiflags', '')\n candidate_abiflags = [abiflags]\n if abiflags:\n candidate_abiflags.append('')\n # Ensure the value injected by virtualenv is\n # returned on windows.\n # Because calling `sysconfig.get_config_var('multiarchsubdir')`\n # returns an empty string on Linux, `du_sysconfig` is only used to\n # get the value of `LIBDIR`.\n libdir = du_sysconfig.get_config_var('LIBDIR')\n if sysconfig.get_config_var('MULTIARCH'):\n masd = sysconfig.get_config_var('multiarchsubdir')\n if masd:\n if masd.startswith(os.sep):\n masd = masd[len(os.sep):]\n libdir = os.path.join(libdir, masd)\n if libdir is None:\n libdir = os.path.abspath(os.path.join(\n sysconfig.get_config_var('LIBDEST'), \"..\", \"libs\"))\n no_valid_candidate = True\n for (pre, impl, ext, ver, abi) in itertools.product(candidate_lib_prefixes,\n candidate_implementations,\n candidate_extensions,\n candidate_versions,\n candidate_abiflags):\n candidate = os.path.join(libdir, ''.join((pre, impl, ver, abi, ext)))\n if os.path.exists(candidate):\n python_library = candidate\n no_valid_candidate = False\n break\n # If there is not valid candidate then set the python_library is empty\n if no_valid_candidate:\n python_library = \"\"\n return python_library","def _add_linking_libs(context, call):\n libs = getattr(call, \"libs\", ())\n if libs:\n context.add_linking_libs(libs)","def CustomCFlagCheck(context, flag, append=True):\n context.Message(\"Checking if C compiler supports \" + flag + \" flag \")\n ccflags = context.env[\"CCFLAGS\"]\n context.env.Append(CCFLAGS=flag)\n result = context.TryCompile(\"int main(int argc, char **argv) { return 0; }\", \".c\")\n context.Result(result)\n if not append or not result:\n context.env.Replace(CCFLAGS=ccflags)\n return result","def is_lib_available(library):\n try:\n __import__(library)\n return True\n except ImportError:\n return False","def CustomCompileCheck(context, message, source, extension=\".cc\"):\n context.Message(message)\n\n env = context.env\n if env.GetOption(\"clean\") or env.GetOption(\"help\") or env.GetOption(\"no_exec\"):\n result = True\n else:\n result = context.TryCompile(source, extension)\n\n context.Result(result)\n\n return result","def selected_libs(args: Namespace) -> List[str]:\n return args.lib or [\"python\", \"lkt\"]","def has_library(self, library_id, ignore_case=False, **kwargs): # lint-amnesty, pylint: disable=unused-argument\n if not isinstance(library_id, LibraryLocator):\n return None\n\n index = self.get_course_index(library_id, ignore_case)\n if index:\n return LibraryLocator(index['org'], index['course'], library_id.branch)\n return None","def has_flag(compiler, flag, ext=None):\n return try_compile(compiler, flags=[flag], ext=ext)","def is_static_library(lib_file):\n if sys.platform.startswith('aix'):\n # An AIX library could be both, but for simplicity assume it isn't.\n return not AIXDumpExtractor.is_shared_lib(lib_file)\n else:\n _, ext = os.path.splitext(lib_file)\n return ext == '.a'","def _c_optimizations_required():\n pure_env = os.environ.get('PURE_PYTHON')\n require_c = pure_env == \"0\"\n return require_c","def CustomCppFlagCheck(context, flag, append=True):\n context.Message(\"Checking if C++ compiler supports \" + flag + \" flag \")\n cxxflags = context.env[\"CXXFLAGS\"]\n context.env.Append(CXXFLAGS=flag)\n result = context.TryCompile(\"int main(int argc, char **argv) { return 0; }\", \".cc\")\n context.Result(result)\n if not append or not result:\n context.env.Replace(CXXFLAGS=cxxflags)\n return result","def try_add_flag(args, compiler, flag, ext=None):\n if try_compile(compiler, flags=args+[flag], ext=ext):\n args.append(flag)","def _get_linker_flags(\n target,\n fc,\n cc,\n syslibs,\n srcfiles,\n sharedobject=False,\n osname=None,\n verbose=False,\n):\n # get list of unique fortran and c/c++ file extensions\n fext = _get_fortran_files(srcfiles, extensions=True)\n\n # remove .exe extension of necessary\n if fc is not None:\n fc = _get_base_app_name(fc)\n if cc is not None:\n cc = _get_base_app_name(cc)\n\n # set linker compiler\n compiler = None\n if len(srcfiles) < 1:\n if fc is not None:\n compiler = fc\n else:\n if fext is not None:\n compiler = fc\n if compiler is None:\n compiler = cc\n\n # remove target .exe extension, if necessary\n target = _get_base_app_name(target)\n\n # get lower case OS string\n if osname is None:\n osname = _get_osname()\n\n # get - or / to prepend for compiler switches\n prepend = _get_prepend(compiler, osname)\n\n # set outgoing syslibs\n syslibs_out = []\n\n # add option to statically link intel provided libraries on osx and linux\n if sharedobject:\n if osname in (\n \"darwin\",\n \"linux\",\n ):\n if compiler == fc:\n if fc in (\n \"ifort\",\n \"mpiifort\",\n ):\n syslibs_out.append(\"static-intel\")\n\n # add linker switch for a shared object\n if sharedobject:\n gnu_compiler = True\n if compiler == fc:\n if fc in (\n \"ifort\",\n \"mpiifort\",\n ):\n gnu_compiler = False\n else:\n if cc in (\n \"icc\",\n \"mpiicc\",\n \"icl\",\n \"cl\",\n ):\n gnu_compiler = False\n if osname == \"win32\":\n if gnu_compiler:\n copt = \"shared\"\n else:\n copt = \"dll\"\n else:\n if osname == \"darwin\":\n copt = \"dynamiclib\"\n else:\n copt = \"shared\"\n syslibs_out.append(copt)\n # add static link flags for GNU compilers\n else:\n if \"shared\" in syslibs_out:\n syslibs_out.remove(\"shared\")\n if \"dynamiclib\" in syslibs_out:\n syslibs_out.remove(\"dynamiclib\")\n if \"dll\" in syslibs_out:\n syslibs_out.remove(\"dll\")\n isstatic = False\n isgfortran = False\n if osname == \"win32\":\n if compiler == fc and fc in (\"gfortran\",):\n isstatic = True\n isgfortran = True\n if not isstatic:\n if compiler == cc and cc in (\n \"gcc\",\n \"g++\",\n ):\n isstatic = True\n if isstatic:\n syslibs_out.append(\"static\")\n if isgfortran:\n syslibs_out.append(\"static-libgfortran\")\n syslibs_out.append(\"static-libgcc\")\n syslibs_out.append(\"static-libstdc++\")\n syslibs_out.append(\"lm\")\n\n # add -nologo switch for compiling on windows with intel compilers\n if osname == \"win32\":\n addswitch = False\n if compiler == fc:\n if fc in (\n \"ifort\",\n \"mpiifort\",\n ):\n addswitch = True\n else:\n if cc in (\n \"icl\",\n \"cl\",\n ):\n addswitch = True\n if addswitch:\n syslibs_out.append(\"nologo\")\n\n # process passed syslibs switches - check for switches with a space between\n # the switch and a setting\n for idx, flag in enumerate(syslibs[1:]):\n if flag[0] not in (\"/\", \"-\"):\n syslibs[idx] += \" {}\".format(flag)\n syslibs[idx + 1] = \"\"\n\n # add passed syslibs switches - assume that flags have - or / as the\n # first character.\n for switch in syslibs:\n if len(switch) < 1:\n continue\n if switch[1:] not in syslibs_out:\n syslibs_out.append(switch[1:])\n\n # add target specific linker (syslib) switches\n tlist = _set_syslibs(target, fc=fc, cc=cc, argv=False, osname=osname)\n if len(tlist) > 0:\n for switch in tlist:\n if switch[1:] not in syslibs_out:\n syslibs_out.append(switch[1:])\n\n # add prepend to syslibs flags\n for idx, switch in enumerate(syslibs_out):\n syslibs_out[idx] = prepend + switch\n\n return compiler, syslibs_out","def isLibSBMLCompiledWith(*args):\n return _libsbml.isLibSBMLCompiledWith(*args)","def check_prerequisites() -> None:\n # check black code formatter is installed\n if not is_installed(\"black\"):\n raise FileNotFoundError(\n \"Cannot find black code formatter! To install, please follow this link: https://black.readthedocs.io/en/stable/installation_and_usage.html\"\n )\n\n # check isort code formatter is installed\n if not is_installed(\"isort\"):\n raise FileNotFoundError(\n \"Cannot find isort code formatter! To install, please follow this link: https://pycqa.github.io/isort/#installing-isort\"\n )\n\n # check protolint code formatter is installed\n if subprocess.call(f\"{base_protolint_command()} version\", shell=True) != 0: # nosec\n raise FileNotFoundError(\n \"Cannot find protolint protocol buffer schema file linter! To install, please follow this link: https://github.com/yoheimuta/protolint.\"\n )\n\n # check protocol buffer compiler is installed\n if not is_installed(\"protoc\"):\n raise FileNotFoundError(\n \"Cannot find protocol buffer compiler! To install, please follow this link: https://developers.google.com/protocol-buffers/\"\n )","def is_valid_language(args, skip=False):\n if (is_valid_file_and_directory(args) and is_valid_comments(args)) or skip:\n if args.language is not None:\n return True\n return False","def is_selection(cfg):\n if LIBRARIES in list(cfg.keys()):\n return True\n else:\n return False","def detect(self):\n GCCLike.detect(self)\n\n if self._platform != platforms.lumin.NAME:\n err = self.detect_version_on_path_or_env('CPP', 'cpp', False)\n if err:\n return err\n err = self.detect_version_on_path_or_env('CC', 'clang',\n needs_version=self._suffix != '',\n allow_unversioned=not self._suffix)\n if err:\n return err\n err = self.detect_version_on_path_or_env('CXX', 'clang++',\n needs_version=self._suffix != '',\n allow_unversioned=not self._suffix)\n if err:\n return err\n err = self.detect_version_on_path_or_env('AS', 'llvm-as',\n needs_version=self._suffix != '',\n allow_unversioned=not self._suffix)\n if err:\n err = self.detect_version_on_path_or_env('AS', 'as', False)\n if err:\n return err\n err = self.detect_version_on_path_or_env('AR', 'ar', False)\n if err:\n return err\n else:\n err = self.add_cross_toolchain_tool('CPP', 'cpp')\n if err:\n return err\n err = self.add_cross_toolchain_tool('CC', 'clang')\n if err:\n return err\n err = self.add_cross_toolchain_tool('CXX', 'clang++')\n if err:\n return err\n err = self.add_cross_toolchain_tool('AS', 'as')\n if err:\n return err\n err = self.add_cross_toolchain_tool('AR', 'gcc-ar')\n if err:\n return err\n err = self.add_cross_toolchain_tool('OBJCOPY', 'objcopy')\n if err:\n return err\n err = self.add_cross_toolchain_tool('STRIP', 'strip')\n if err:\n return err\n\n return None","def _cached_create_libspec(\n self,\n libname: str,\n is_builtin: bool,\n target_file: Optional[str],\n args: Optional[str],\n *,\n _internal_force_text=False, # Should only be set from within this function.\n ) -> Optional[str]:\n from robotframework_ls.impl import robot_constants\n\n if not is_builtin:\n if not target_file:\n is_builtin = libname in robot_constants.STDLIBS\n\n import time\n from robocorp_ls_core.subprocess_wrapper import subprocess\n from robocorp_ls_core.robotframework_log import get_log_level\n\n acquire_mutex = _timed_acquire_mutex_for_spec_filename\n\n if _internal_force_text:\n # In this case this is a recursive call and we already have the lock.\n acquire_mutex = NULL\n\n log_exception = log.exception\n if is_builtin and libname == \"Dialogs\" and get_log_level() < 1:\n # Dialogs may have dependencies that are not available, so, don't show\n # it unless verbose mode is enabled.\n log_exception = log.debug\n\n if not libname.replace(\".\", \"\").replace(\"/\", \"\").replace(\"\\\\\", \"\").strip():\n return f\"Unable to generate libspec for: {libname}\"\n\n additional_path = None\n additional_path_exists = False\n\n log_time = True\n cwd = None\n\n if target_file is not None:\n additional_path = os.path.dirname(target_file)\n if os.path.splitext(os.path.basename(target_file))[0] == \"__init__\":\n additional_path = os.path.dirname(additional_path)\n\n additional_path_exists = os.path.exists(additional_path)\n if additional_path and additional_path_exists:\n cwd = additional_path\n if libname.endswith((\"/\", \"\\\\\")):\n libname = libname[:-1]\n libname = os.path.basename(libname)\n if libname.lower().endswith((\".py\", \".class\", \".java\")):\n libname = os.path.splitext(libname)[0]\n\n curtime = time.time()\n\n try:\n try:\n call = [sys.executable]\n major_version = self.get_robot_major_version()\n if major_version < 4:\n call.extend(\"-m robot.libdoc --format XML\".split())\n else:\n call.extend(\n \"-m robot.libdoc --format XML --specdocformat RAW\".split()\n )\n\n if additional_path and additional_path_exists:\n call.extend([\"-P\", os.path.normpath(additional_path)])\n\n if _internal_force_text:\n call.append(\"--docformat\")\n call.append(\"text\")\n\n # Note: always set as a whole, so, iterate in generator is thread-safe.\n for entry in self._additional_pythonpath_folder_to_folder_info:\n if os.path.exists(entry):\n call.extend([\"-P\", os.path.normpath(entry)])\n\n if not args:\n call.append(libname)\n else:\n call.append(\"::\".join([libname, args]))\n\n libspec_filename = self._compute_libspec_filename(\n libname, is_builtin, target_file, args\n )\n\n log.debug(f\"Obtaining mutex to generate libspec: {libspec_filename}.\")\n with acquire_mutex(libspec_filename): # Could fail.\n log.debug(\n f\"Obtained mutex to generate libspec: {libspec_filename}.\"\n )\n call.append(libspec_filename)\n\n mtime: float = -1\n try:\n mtime = os.path.getmtime(libspec_filename)\n except:\n pass\n\n log.debug(\n \"Generating libspec for: %s.\\nCwd:%s\\nCommand line:\\n%s\",\n libname,\n cwd,\n \" \".join(call),\n )\n try:\n try:\n # Note: stdout is always subprocess.PIPE in this call.\n # Note: the env is always inherited (the process which has\n # the LibspecManager must be the target env already).\n self._subprocess_check_output(\n call,\n stderr=subprocess.STDOUT,\n stdin=subprocess.PIPE,\n cwd=cwd,\n )\n except OSError as e:\n log.exception(\"Error calling: %s\", call)\n # We may have something as: Ignore OSError: [WinError 6] The handle is invalid,\n # give the result based on whether the file changed on disk.\n try:\n if mtime != os.path.getmtime(libspec_filename):\n _dump_spec_filename_additional_info(\n self,\n libspec_filename,\n is_builtin=is_builtin,\n obtain_mutex=False,\n )\n return None\n except:\n pass\n\n log.debug(\"Not retrying after OSError failure.\")\n return str(e)\n\n except subprocess.CalledProcessError as e:\n if not _internal_force_text:\n if (\n b\"reST format requires 'docutils' module to be installed\"\n in e.output\n ):\n return self._cached_create_libspec(\n libname,\n is_builtin,\n target_file,\n args,\n _internal_force_text=True,\n )\n\n log_exception(\n \"Error creating libspec: %s.\\nReturn code: %s\\nOutput:\\n%s\",\n libname,\n e.returncode,\n e.output,\n )\n bytes_output = e.output\n output = bytes_output.decode(\"utf-8\", \"replace\")\n\n # Remove things we don't want to show.\n for s in (\"Try --help\", \"--help\", \"Traceback\"):\n index = output.find(s)\n if index >= 0:\n output = output[:index].strip()\n\n if output:\n return output\n return f\"Error creating libspec: {output}\"\n\n _dump_spec_filename_additional_info(\n self,\n libspec_filename,\n is_builtin=is_builtin,\n obtain_mutex=False,\n )\n return None\n except Exception as e:\n log_exception(\"Error creating libspec: %s\", libname)\n return str(e)\n finally:\n if log_time:\n delta = time.time() - curtime\n log.debug(\"Took: %.2fs to generate info for: %s\" % (delta, libname))","def test_add_library_cmd_line(self):\n\n lib_name = self.conf.options('libs')[0]\n cmd = ['pydroid', 'add', 'library', lib_name]\n subprocess.call(cmd)\n self.assertTrue(os.path.exists(os.path.join(project_libs_dir(),\n lib_name)))","def _get_ldflags() -> str:\n # windows gcc does not support linking with unresolved symbols\n if sys.platform == 'win32': # pragma: win32 cover\n libs = os.path.join(sys.base_prefix, 'libs')\n return f'-L{libs} -lpython{sys.version_info[0]}'\n else: # pragma: win32 no cover\n cc = subprocess.check_output(('go', 'env', 'CC')).decode().strip()\n\n with _tmpdir() as tmpdir:\n testf = os.path.join(tmpdir, 'test.c')\n with open(testf, 'w') as f:\n f.write('int f(int); int main(void) { return f(0); }\\n')\n\n for lflag in LFLAGS: # pragma: no cover (platform specific)\n try:\n subprocess.check_call((cc, testf, lflag), cwd=tmpdir)\n return lflag\n except subprocess.CalledProcessError:\n pass\n else: # pragma: no cover (platform specific)\n # wellp, none of them worked, fall back to gcc and they'll get\n # a hopefully reasonable error message\n return LFLAG_GCC","def detectExtensions(builder):\n print (\"Checking if C extensions can be compiled, don't be alarmed if \"\n \"a few compile errors are printed.\")\n\n if not builder._compile_helper(\"#define X 1\\n\"):\n print \"Compiler not found, skipping C extensions.\"\n return []\n\n # Extension modules to build.\n exts = [\n Extension(\"twisted.spread.cBanana\",\n [\"twisted/spread/cBanana.c\"],\n define_macros=builder.define_macros),\n ]\n\n # urllib.unquote accelerator\n exts.append( Extension(\"twisted.protocols._c_urlarg\",\n [\"twisted/protocols/_c_urlarg.c\"],\n define_macros=builder.define_macros) )\n\n if sys.platform == 'darwin':\n exts.append(\n Extension(\"twisted.internet.cfsupport\",\n [\"twisted/internet/cfsupport/cfsupport.c\"],\n extra_compile_args=['-w'],\n extra_link_args=['-framework','CoreFoundation',\n '-framework','CoreServices',\n '-framework','Carbon'],\n define_macros=builder.define_macros))\n\n if sys.platform == 'win32':\n exts.append( Extension(\"twisted.internet.iocpreactor._iocp\",\n [\"twisted/internet/iocpreactor/_iocp.c\"],\n libraries=[\"ws2_32\", \"mswsock\"],\n define_macros=builder.define_macros))\n\n return exts","def KengeLibrary(self, name, buildname=None, source = None, public_headers = None, **kargs):\n library_args = {}\n\n library_args[\"CPPPATH\"] = []\n\n if buildname is None:\n buildname = name\n\n if source is None:\n # User didn't provide any source files\n # explicitly, so we work out it form them\n # based on some hueristics.\n glob_list = []\n dirs = [\"include/interfaces/\", \"src/\", \"src/arch-%s/\" % env.arch]\n\t if self.test_lib == name:\n\t\tdirs.append(\"test/\")\n if self[\"BUILD_TESTS\"]:\n dirs += [\"test/\"]\n for src_ext in env.src_exts:\n for dir_ in dirs:\n glob_list.append(dir_ + \"*.\" + src_ext)\n else:\n glob_list = source\n\n libs = []\n \n if \"LIBS\" in kargs:\n if self[\"BUILD_TESTS\"]:\n kargs[\"LIBS\"].append(\"check\")\n for lib in kargs[\"LIBS\"]:\n libs.append(lib)\n if lib not in self.libs.keys():\n raise SCons.Errors.UserError, \"Library [%s] was looking for library [%s] but it doesn't exist \" \\\n \"in environment [%s]\\n This environment has: %s\" % (name, lib, self.name, self.libs.keys())\n\n del kargs[\"LIBS\"]\n\n # He we expand the glob to a list of files\n source_list = Flatten([src_glob(glob) for glob in glob_list])\n\n idl_files = [fn for fn in source_list if fn.endswith(\".idl4\")]\n reg_files = [fn for fn in source_list if fn.endswith(\".reg\")]\n\n # Now we go through everything in the kargs:\n for arg in kargs:\n if arg.startswith(\"EXTRA_\"):\n argname = arg[6:]\n library_args[argname] = self[argname] + kargs[arg]\n else:\n library_args[arg] = kargs[arg]\n\n # Generally this is the only public headers\n if public_headers is None:\n public_headers = [\"#libs/%s/include\" % name, \"#libs/%s/test\" % name]\n\n if len(idl_files) or len(reg_files):\n # Unless we have generated files\n public_headers.append(Dir(\".\").abspath + \"/include\")\n\n # Now if we are for real compiling stuff...\n cpp_path = copy.copy(self[\"CPPPATH\"])\n\tif self.test_lib:\n\t\tcpp_path.append(\"#libs/check/include\")\n \n # Make sure we include any of the libraries header file's\n for each in public_headers:\n cpp_path.append(each)\n\n # This ensure that any generated header files\n # Maybe move this somewhere else later though\n cpp_path.append(Dir('.').abspath + \"/src\") # Broken\n cpp_path.append(Dir('.').abspath + \"/include\")\n\n # Find any .idl4 files that should be generated\n for file in idl_files:\n gen_file = self.IDL4(file)\n\n # Generate any .reg files\n for file in reg_files:\n self.Reg(file)\n \n library_args[\"CPPPATH\"] += cpp_path + self.end_cpp_path # End cpp_path is a hack hack hack!\n \n # Now we just call the normal StaticLibrary with our simple defaults\n lib = self.StaticLibrary(buildname, source_list, **library_args)\n\n assert(len(lib) == 1)\n lib = lib[0]\n\n if self[\"FLINT_RUN\"]:\n for each in lib.children():\n if str(each).endswith(\".o\"):\n if str(each.children()[0]).endswith(\".c\") or \\\n str(each.children()[0]).endswith(\".cc\"):\n self.AddPreAction(each, \"$FLINTCOM\")\n\n # And construct our definition of the library\n # This should suck muhc much less... how about a class?\n lib = (public_headers, lib, \"#\" + os.path.dirname(lib.path), None, libs)\n return lib","def try_lib_load():\n # If we are building the documentation, then we abort the import\n rtd_build_environ = 'PYGORPHO_BUILD_READTHEDOCS'\n if rtd_build_environ in os.environ:\n import warnings\n warnings.warn('Environment variable {} exists - we assume '\n 'documentation is being built and are aborting the '\n 'import'.format(rtd_build_environ))\n return _DummyLib(), __file__\n\n path_candidates = []\n # If PYGORPHO_PATH was set we start looking there\n if os.getenv('PYGORPHO_PATH') is not None:\n path_candidates.append(os.path.abspath(os.getenv('PYGORPHO_PATH')))\n # Look in the dir. where this python file is placed\n path_candidates.append(os.path.dirname(__file__))\n # Look in dir. one level up from current file dir.\n path_candidates.append(os.path.dirname(path_candidates[-1]))\n # Start looking\n for path in path_candidates:\n try:\n if platform.system() == 'Windows':\n lib = ctl.load_library('pygorpho', path)\n else:\n lib = ctl.load_library('libpygorpho', path)\n # Load was successful, so return path and lib now\n return lib, path\n except OSError:\n # Lib was not here so move on...\n pass\n else:\n raise ImportError('could not find pygorpho dynamic library file '\n '(try setting PYGORPHO_PATH environment variable)')","def is_library_installed(name):\n\n return __item_installed(name, dtf.core.item.TYPE_LIBRARY)","def AddLibrary(self, lib, buildname=None, **kargs):\n \n if buildname is None:\n buildname = lib\n lib_builddir = \"%s/%s/libs/%s\" % (self.builddir, self.name, buildname)\n\n # We export \"env\" and \"args\" to the library build file\n env = self\n Export(\"env\")\n args = kargs\n Export(\"args\")\n args[\"buildname\"] = buildname\n # We call the libraries SConstruct file to build it.\n #if self.headers_only:\n # self.cpp_path += SConscript(\"libs/%s/SConstruct\" % lib, build_dir=lib_builddir, duplicate=0)\n #else:\n self.libs[buildname] = SConscript(\"libs/%s\" % lib, build_dir=lib_builddir, duplicate=0)\n #self[\"_EXTRA_CPPPATH\"] += \n self[\"CPPPATH\"] += self.libs[buildname][0]\n return self.libs[buildname]","def extra_link_args(self):\n\n status, stdout, stderr = self.__xcall__(['--libs-only-other'])\n\n if status != 0:\n raise RuntimeError(\"error querying --libs-only-other for package `%s': %s\" % (self.name, stderr))\n\n return stdout.strip().split()","def is_library(code):\n return 3000 <= code <= 3999","def _is_installed(self):\n header = self._system.file_exists(\"curl.h\", os.path.join(self.get_install_path(), \n \"include/curl\"))\n lib = self._system.library_exists(\"libcurl\", os.path.join(self.get_install_path(), \"lib\"))\n config = self._system.file_exists(\"curl-config\", os.path.join(self.get_install_path(), \"bin\"))\n return header and lib and config","def test_build_system_flags_not_implemented(self, temp_env):\n s = spack.spec.Spec(\"mpileaks cppflags=-g\").concretized()\n s.package.flag_handler = build_system_flags\n try:\n spack.build_environment.setup_package(s.package, False)\n assert False\n except NotImplementedError:\n assert True","def check_system_dependencies():\n out_info(\"Checking System Dependencies...\")\n check_cmake()\n if OS_VERSION[0] == \"Windows\":\n check_visual_studio()\n check_cplus_plus()\n if OS_VERSION[0] == \"Linux\":\n check_gcc()\n check_gpp()","def _set_syslibs(\n target, fc=\"gfortran\", cc=\"gcc\", argv=True, osname=None, verbose=False\n):\n # get lower case OS string\n if osname is None:\n osname = _get_osname()\n\n # remove target .exe extension, if necessary\n target = _get_base_app_name(target)\n\n # remove .exe extension of necessary\n if fc is not None:\n fc = _get_base_app_name(fc)\n if cc is not None:\n cc = _get_base_app_name(cc)\n\n # initialize syslibs\n syslibs = []\n\n # determine if default syslibs will be defined\n default_syslibs = True\n if osname == \"win32\":\n if fc is not None:\n if fc in [\"ifort\", \"gfortran\"]:\n default_syslibs = False\n if default_syslibs:\n if cc is not None:\n if cc in [\"cl\", \"icl\", \"gcc\", \"g++\"]:\n default_syslibs = False\n\n if verbose:\n print(\"\\nosname: \", osname)\n print(\"fc: \", fc)\n print(\"cc: \", cc)\n print(\"default: {}\\n\".format(default_syslibs))\n\n # set default syslibs\n if default_syslibs:\n syslibs.append(\"-lc\")\n\n # add additional syslibs for select programs\n if target == \"triangle\":\n if osname in [\"linux\", \"darwin\"]:\n if fc is None:\n lfc = True\n else:\n lfc = fc.startswith(\"g\")\n lcc = False\n if cc in [\"gcc\", \"g++\", \"clang\", \"clang++\"]:\n lcc = True\n if lfc and lcc:\n syslibs += [\"-lm\"]\n elif target == \"gsflow\":\n if \"win32\" not in osname:\n if \"ifort\" in fc:\n syslibs += [\"-nofor_main\"]\n\n # add additional syslibs from the command line\n if argv:\n for idx, arg in enumerate(sys.argv):\n if \"--syslibs\" in arg.lower():\n s = sys.argv[idx + 1]\n delim = \" -\"\n if \" /\" in s:\n delim = \" /\"\n syslibs += s.split(delim)\n\n # write syslibs\n if verbose:\n msg = \"{} will use the following predefined syslibs:\\n\".format(target)\n msg += \" '{}'\\n\".format(\" \".join(syslibs))\n print(msg)\n\n return syslibs","def test_config_have_biopython():\n assert core.HAVE_BIOPYTHON\n args = Namespace(extended_validation='all')\n config = core.Config.from_args(args)\n assert config.extended_validation == 'all'","def check(self, quiet=False, exclude=None):\n\n exclude = exclude if exclude else []\n missing = set()\n pkg_types = set()\n python_interpreters = set()\n vcs_types = set()\n\n # package-defined requirements check\n for pkg in self.pkgs:\n if pkg.type not in exclude:\n pkg_types.add(pkg.type)\n if pkg.vcs_type not in exclude:\n vcs_types.add(pkg.vcs_type)\n\n if pkg.type == PackageType.AUTOTOOLS:\n if pkg.autotools_autoreconf:\n if AUTORECONF_COMMAND not in exclude:\n if AUTORECONF.exists():\n self._verbose_exists(AUTORECONF)\n else:\n missing.add(AUTORECONF.tool)\n\n elif pkg.type == PackageType.PYTHON:\n if pkg.python_interpreter:\n if pkg.python_interpreter not in exclude:\n python_tool = PythonTool(pkg.python_interpreter)\n python_interpreters.add(python_tool)\n else:\n python_interpreters.add(PYTHON)\n\n if PackageType.AUTOTOOLS in pkg_types or PackageType.MAKE in pkg_types:\n if MAKE.exists():\n self._verbose_exists(MAKE)\n else:\n missing.add(MAKE.tool)\n\n if PackageType.CMAKE in pkg_types:\n if CMAKE.exists():\n self._verbose_exists(CMAKE)\n else:\n missing.add(CMAKE.tool)\n\n if PackageType.MESON in pkg_types:\n if MESON.exists():\n self._verbose_exists(MESON)\n else:\n missing.add(MESON.tool)\n\n if PackageType.PYTHON in pkg_types:\n for interpreter in python_interpreters:\n if interpreter.exists():\n self._verbose_exists(interpreter)\n else:\n missing.add(interpreter.tool)\n\n if PackageType.SCONS in pkg_types:\n if SCONS.exists():\n self._verbose_exists(SCONS)\n else:\n missing.add(SCONS.tool)\n\n if VcsType.BZR in vcs_types:\n if BZR.exists():\n self._verbose_exists(BZR)\n else:\n missing.add(BZR.tool)\n\n if VcsType.CVS in vcs_types:\n if CVS.exists():\n self._verbose_exists(CVS)\n else:\n missing.add(CVS.tool)\n\n if VcsType.GIT in vcs_types:\n if GIT.exists():\n self._verbose_exists(GIT)\n else:\n missing.add(GIT.tool)\n\n if VcsType.HG in vcs_types:\n if HG.exists():\n self._verbose_exists(HG)\n else:\n missing.add(HG.tool)\n\n if VcsType.PERFORCE in vcs_types:\n if GIT.exists():\n self._verbose_exists(GIT)\n else:\n missing.add(GIT.tool)\n\n if VcsType.RSYNC in vcs_types:\n if RSYNC.exists():\n self._verbose_exists(RSYNC)\n else:\n missing.add(RSYNC.tool)\n\n if VcsType.SCP in vcs_types:\n if SCP.exists():\n self._verbose_exists(SCP)\n else:\n missing.add(SCP.tool)\n\n if VcsType.SVN in vcs_types:\n if SVN.exists():\n self._verbose_exists(SVN)\n else:\n missing.add(SVN.tool)\n\n # project-provided tools check\n for tool in self.tools:\n if tool not in exclude:\n if which(tool):\n verbose('prerequisite exists: ' + tool)\n else:\n missing.add(tool)\n\n if missing and not quiet:\n sorted_missing = list(missing)\n sorted_missing.sort()\n\n msg = 'missing the following host tools for this project:'\n msg += '\\n'\n msg += '\\n'\n for entry in sorted_missing:\n msg += ' ' + entry + '\\n'\n err(msg)\n\n return len(missing) == 0","def is_library_installed(name):\n\n return pm.is_library_installed(name)","def find_libca():\n # Test 1: if PYEPICS_LIBCA env var is set, use it.\n dllpath = os.environ.get('PYEPICS_LIBCA', None)\n if (dllpath is not None and os.path.exists(dllpath) and\n os.path.isfile(dllpath)):\n return dllpath\n\n # Test 2: look through Python path and PATH env var for dll\n path_sep = ':'\n dylib = 'lib'\n # For windows, we assume the DLLs are installed with the library\n if os.name == 'nt':\n path_sep = ';'\n dylib = 'DLLs'\n\n _path = [os.path.split(os.path.abspath(__file__))[0],\n os.path.split(os.path.dirname(os.__file__))[0],\n os.path.join(sys.prefix, dylib)]\n\n search_path = []\n for adir in (_path + sys.path +\n os.environ.get('PATH','').split(path_sep) +\n os.environ.get('LD_LIBRARY_PATH','').split(path_sep) +\n os.environ.get('DYLD_LIBRARY_PATH','').split(path_sep)):\n if adir not in search_path and os.path.isdir(adir):\n search_path.append(adir)\n\n os.environ['PATH'] = path_sep.join(search_path)\n\n # with PATH set above, the ctypes utility, find_library *should*\n # find the dll....\n dllpath = ctypes.util.find_library('ca')\n if dllpath is not None:\n return dllpath\n\n # Test 3: on unixes, look expliticly with EPICS_BASE env var and\n # known architectures for ca.so q\n if os.name == 'posix':\n known_hosts = {'Linux': ('linux-x86', 'linux-x86_64') ,\n 'Darwin': ('darwin-ppc', 'darwin-x86'),\n 'SunOS': ('solaris-sparc', 'solaris-sparc-gnu') }\n\n libname = 'libca.so'\n if sys.platform == 'darwin':\n libname = 'libca.dylib'\n\n epics_base = os.environ.get('EPICS_BASE', '.')\n host_arch = os.uname()[0]\n if host_arch in known_hosts:\n epicspath = []\n for adir in known_hosts[host_arch]:\n epicspath.append(os.path.join(epics_base, 'lib', adir))\n for adir in search_path + epicspath:\n if os.path.exists(adir) and os.path.isdir(adir):\n if libname in os.listdir(adir):\n return os.path.join(adir, libname)\n\n raise ChannelAccessException('cannot find Epics CA DLL')","def exists():\n return PYTHON_VERSION is not None","def should_build_ib():\n ib_util_found = False\n ib_lib_found = False\n ib_header_found = False\n\n try:\n # If the command doesn't exist, we can directly return instead of\n # making a subprocess call\n full_cmd_path = get_command_path(IB_DEVINFO_CMD)\n if not full_cmd_path:\n ib_util_found = False\n subprocess.check_output([full_cmd_path, \"--list\"])\n # Here we just would like to simply run the command to test if IB\n # related tools / lib are installed without parsing the output. We\n # will enable IB build as long as the command runs successfully.\n #\n # The output should look like either:\n #\n # > ibv_devinfo --list\n # 0 HCAs founds:\n #\n # or\n #\n # > ibv_devinfo --list\n # 4 HCAs found:\n # mlx5_3\n # mlx5_2\n # mlx5_1\n # mlx5_0\n ib_util_found = True\n except Exception:\n # We just take all the exceptions here without affecting the build\n ib_util_found = False\n\n lib_paths = list(filter(bool, [\n \"/usr/lib/\",\n \"/usr/lib/x86_64-linux-gnu/\",\n \"/usr/lib/powerpc64le-linux-gnu/\",\n \"/usr/lib/aarch64-linux-gnu/\",\n ] + gather_paths([\n \"LIBRARY_PATH\",\n ]) + gather_paths([\n \"LD_LIBRARY_PATH\",\n ])))\n\n include_paths = [\n \"/usr/include/\",\n ]\n\n if IS_CONDA:\n lib_paths.append(os.path.join(CONDA_DIR, \"lib\"))\n include_paths.append(os.path.join(CONDA_DIR, \"include\"))\n\n for path in lib_paths:\n if path is None or not os.path.exists(path):\n continue\n ib_libraries = sorted(glob.glob(os.path.join(path, \"libibverbs*\")))\n if ib_libraries:\n ib_lib_found = True\n break\n\n for path in include_paths:\n if path is None or not os.path.exists(path):\n continue\n if os.path.exists(os.path.join(path, \"infiniband/verbs.h\")):\n ib_header_found = True\n break\n\n return ib_util_found and ib_lib_found and ib_lib_found","def exists(env):\n java_exists = env.Detect('java')\n jsrun_exists = env.Detect('$JSDOC_JSRUN')\n run_exists = env.Detect('$JSDOC_RUN')\n return (java_exists and jsrun_exists and run_exists)","def is_cxx_compiler():\n\n wrapper_command = os.path.basename(sys.argv[0])\n return re.match(r'(.+)c\\+\\+(.*)', wrapper_command)","def toolHasOptions(*args, **kwargs)->bool:\n pass","def flags_compile(local_cflags, local_ldflags):\n return compile_test(source, args.compiler,\n \" \".join([\"-Werror\"] + local_cflags),\n \" \".join(local_ldflags))","def test_libs_config(self):\n libs = [l for l in os.listdir(framework_libs_dir()) if l != 'libs.conf']\n self.assertTrue(sorted(libs), sorted(self.conf.options('libs')))","def check_pycurl_installed(func):\n\n def inner(*args, **kwargs): # pylint: disable=inconsistent-return-statements\n if pycurl is None:\n return\n return func(*args, **kwargs)\n\n return inner","def ldflags(libs=True, flags=False, libs_dir=False, include_dir=False):\r\n rval = []\r\n if libs_dir:\r\n found_dyn = False\r\n dirs = [x[2:] for x in config.blas.ldflags.split()\r\n if x.startswith('-L')]\r\n l = ldflags()\r\n for d in dirs:\r\n for f in os.listdir(d):\r\n if (f.endswith('.so') or f.endswith('.dylib') or\r\n f.endswith('.dll')):\r\n if any([f.find(ll) >= 0 for ll in l]):\r\n found_dyn = True\r\n if not found_dyn and dirs:\r\n _logger.warning(\"We did not found a dynamic library into the \"\r\n \"library_dir of the library we use for blas. If you use \"\r\n \"ATLAS, make sure to compile it with dynamics library.\")\r\n\r\n for t in config.blas.ldflags.split():\r\n #Remove extra quote.\r\n if t.startswith(\"'\") or t.startswith('\"'):\r\n t = t[1:]\r\n if t.endswith(\"'\") or t.endswith('\"'):\r\n t = t[:-1]\r\n\r\n try:\r\n t0, t1, t2 = t[0:3]\r\n assert t0 == '-'\r\n except Exception:\r\n raise ValueError('invalid token in config.blas.ldflags', t)\r\n if libs_dir and t1 == 'L':\r\n rval.append(t[2:])\r\n elif include_dir and t1 == 'I':\r\n raise ValueError('Include dirs are not used for blas. We disable'\r\n ' this as this can hide other headers and this'\r\n ' is not wanted.', t)\r\n rval.append(t[2:])\r\n elif libs and t1 == 'l': # example -lmkl\r\n rval.append(t[2:])\r\n elif flags and t1 not in ['L', 'I', 'l']: # example -openmp\r\n rval.append(t)\r\n elif flags and t1 == 'L':\r\n #to find it when we load the compiled op if the env of the\r\n #used is not well configured.\r\n rval.append('-Wl,-rpath,' + t[2:])\r\n return rval","def check_packages(packages, namespace=None, language=\"python\", import_into_backend=False, verbose=False):\n # Force packages into sorted non-redundant list\n if isinstance(packages,(str, tuple)):\n packages = [packages]\n packages = set(packages)\n\n # Set up decorator for Python imports\n if language.lower() == \"python\":\n import_package = importlib.import_module\n importing_error = ImportError\n # Set up decorator for R imports\n if language.lower() == \"r\":\n try:\n import rpy2\n except ImportError:\n raise Exception(\"Please install 'rpy2' to import R packages\")\n from rpy2.robjects.packages import importr\n from rpy2 import __version__ as rpy2_version\n rpy2_version_major = int(rpy2_version.split(\".\")[0])\n assert rpy2_version_major > 1, \"Please update your rpy2 version\"\n if rpy2_version_major == 2:\n from rpy2.rinterface import RRuntimeError\n importing_error = RRuntimeError\n if rpy2_version_major == 3:\n # from rpy2.rinterface_lib.embedded import RRuntimeError\n from rpy2.robjects.packages import PackageNotInstalledError\n importing_error = PackageNotInstalledError\n import_package = importr\n\n # Wrapper\n def decorator(func):\n @functools.wraps(func)\n def wrapper(*args, **kwargs):\n missing_packages = []\n for pkg in packages:\n if isinstance(pkg, tuple):\n assert len(pkg) == 2, \"If a package is tuple type then it must have 2 elements e.g. ('numpy', 'np')\"\n pkg_name, pkg_variable = pkg\n else:\n pkg_name = pkg_variable = pkg \n try:\n package = import_package(pkg_name)\n if import_into_backend:\n globals()[pkg_variable] = package\n if namespace is not None:\n namespace[pkg_variable] = package\n if verbose:\n print(\"Importing {} as {}\".format(pkg_name, pkg_variable), True, file=sys.stderr)\n except importing_error:\n missing_packages.append(pkg_name)\n if verbose:\n print(\"Cannot import {}:\".format(pkg_name), False, file=sys.stderr)\n assert not missing_packages, \"Please install the following {} packages to use this function:\\n{}\".format(language.capitalize(), \", \".join(missing_packages))\n return func(*args, **kwargs)\n\n return wrapper\n return decorator","def IsClangWinBuild(build_dir, target):\n if not IsWindows():\n return False\n\n gn_file = os.path.join(build_dir, target, 'args.gn')\n if not os.path.isfile(gn_file):\n print 'WARNING: Unable to find the args.gn file.'\n return False\n # Matches e.g. \"gn_arg = value\"\n gn_arg_re = re.compile(r'^(?P<flag>[^= ]+)\\s*=\\s*(?P<value>[^ \\n]+)$')\n for line in open(gn_file):\n m = gn_arg_re.match(line)\n if m and m.group('flag') == 'is_clang':\n return m.group('value') == 'true'\n return False","def add_installed_libraries(self, extra_libs = [\"SeleniumLibrary\",\n \"SudsLibrary\",\n \"RequestsLibrary\"]):\n\n libdir = os.path.dirname(robot.libraries.__file__)\n loaded = []\n for filename in os.listdir(libdir):\n if filename.endswith(\".py\") or filename.endswith(\".pyc\"):\n libname, ext = os.path.splitext(filename)\n if (libname.lower() not in loaded and\n not self._should_ignore(libname)):\n\n try:\n self.add(libname)\n loaded.append(libname.lower())\n except Exception as e:\n # need a better way to log this...\n self.log.debug(\"unable to add library: \" + str(e))\n\n # I hate how I implemented this, but I don't think there's\n # any way to find out which installed python packages are\n # robot libraries.\n for library in extra_libs:\n if (library.lower() not in loaded and\n not self._should_ignore(library)):\n try:\n self.add(library)\n loaded.append(library.lower())\n except Exception as e:\n self.log.debug(\"unable to add external library %s: %s\" % \\\n (library, str(e)))","def check_requirements():\n process_output = subprocess.check_output([sys.executable, '-m', 'pip', 'freeze'])\n installed_packages = [r.decode().split('==')[0] for r in process_output.split()]\n if 'pandas' and 'matplotlib' in installed_packages:\n return True\n else:\n print('You don`t have one of required libralies\\n'\n 'I can`t create histogram\\n'\n 'Required libralies: \\n'\n '->pandas\\n'\n '->matplotlib\\n')\n return False","def is_libpsp():\n return __is_libpsp__","def _c_optimizations_ignored():\n pure_env = os.environ.get('PURE_PYTHON')\n return pure_env != \"0\" if pure_env is not None else PYPY","def install_langkit_support(args: Namespace) -> None:\n base_argv = [\n \"gprinstall\", \"-P\", SUPPORT_GPR, \"-p\",\n f\"-XBUILD_MODE={args.build_mode}\",\n f\"--prefix={args.prefix}\",\n \"--build-var=LIBRARY_TYPE\",\n \"--build-var=LANGKIT_SUPPORT_LIBRARY_TYPE\",\n \"--sources-subdir=include/langkit_support\"\n ]\n if args.build_dir:\n base_argv.extend([f\"--relocate-build-tree={args.build_dir}\"])\n\n # Install the static libraries first, so that in the resulting project\n # files, \"static\" is the default library type.\n lib_types = [l.value for l in args.library_types]\n for library_type in (\"static\", \"static-pic\", \"relocatable\"):\n if library_type in lib_types:\n subprocess.check_call(base_argv + [\n f\"-XLIBRARY_TYPE={library_type}\",\n f\"--build-name={library_type}\"\n ])","def has_source(self):\n return any(map(utils.assert_package_is_source, self.pkg_arguments))","def is_installed(cls, language=None):\n if language == 'python':\n return True\n return False","def is_installed():\n # type: () -> bool\n try:\n # noinspection PyUnresolvedReferences\n from ccurl import Curl as CCurl\n except ImportError:\n return False\n else:\n # noinspection PyUnresolvedReferences\n from iota.crypto import Curl\n return issubclass(Curl, CCurl)","def _check_deseq_args(self, arg_libs, conditions):\n if len(arg_libs) != len(conditions):\n self._write_err_msg_and_quit(\n \"Error - The read library file list and condition list must \"\n \"have the same number of elements. You entered \\n%s \"\n \"(= %s elements)\\nand \\n%s (= %s elements).\\n\"\n % (\n self._args.libs,\n len(arg_libs),\n self._args.conditions,\n len(conditions),\n )\n )\n raw_stat_data_reader = RawStatDataReader()\n alignment_stats = [\n raw_stat_data_reader.read(\n self._pathcreator.read_alignments_stats_path\n )\n ]\n lib_names = list(alignment_stats[0].keys())\n if len(lib_names) != len(arg_libs):\n self._write_err_msg_and_quit(\n \"The number of read libraries is lower or higher than \"\n \"expected. The following read libs are available: %s\\nThe \"\n 'following read list string is suggested: \"%s\"\\n'\n % (\", \".join(lib_names), \",\".join(lib_names))\n )\n for lib in lib_names:\n if lib not in arg_libs:\n self._write_err_msg_and_quit(\n 'The library \"%s\" is not present in your list of '\n \"libraries. Please add it.\\n\" % (lib)\n )","def _check_libgmt(libgmt):\n # Check if a few of the functions we need are in the library\n functions = ['Create_Session', 'Get_Enum', 'Call_Module',\n 'Destroy_Session']\n for func in functions:\n if not hasattr(libgmt, 'GMT_' + func):\n msg = ' '.join([\n \"Error loading libgmt.\",\n \"Couldn't access function GMT_{}.\".format(func),\n ])\n raise GMTCLibError(msg)","def _is_installed(self):\n return self._system.is_library(os.path.join(self.get_install_path(), \"lib/libG4event\")) or \\\n self._system.is_library(os.path.join(self.get_install_path(), \"lib64/libG4event\"))","def load_library(name):\n with _stderr_capture() as err:\n gSystem = gbl.gSystem\n if name[:3] != 'lib':\n if not gSystem.FindDynamicLibrary(gbl.CppyyLegacy.TString(name), True) and\\\n gSystem.FindDynamicLibrary(gbl.CppyyLegacy.TString('lib'+name), True):\n name = 'lib'+name\n sc = gSystem.Load(name)\n if sc == -1:\n raise RuntimeError('Unable to load library \"%s\"%s' % (name, err.err))\n return True","def has_extras(self):\n return any(map(utils.assert_package_has_extras, self.pkg_arguments))","def sanity_check_step(self):\n\n dirs = [os.path.join('include', 'gromacs')]\n\n # in GROMACS v5.1, only 'gmx' binary is there\n # (only) in GROMACS v5.0, other binaries are symlinks to 'gmx'\n bins = []\n libnames = []\n if LooseVersion(self.version) < LooseVersion('5.1'):\n bins.extend(['editconf', 'g_lie', 'genbox', 'genconf', 'mdrun'])\n\n if LooseVersion(self.version) >= LooseVersion('5.0'):\n bins.append('gmx')\n libnames.append('gromacs')\n if LooseVersion(self.version) < LooseVersion('5.1') and self.toolchain.options.get('usempi', None):\n bins.append('mdrun')\n else:\n libnames.extend(['gmxana', 'gmx', 'md'])\n # note: gmxpreprocess may also already be there for earlier versions\n if LooseVersion(self.version) > LooseVersion('4.6'):\n libnames.append('gmxpreprocess')\n\n # also check for MPI-specific binaries/libraries\n if self.toolchain.options.get('usempi', None):\n if LooseVersion(self.version) < LooseVersion('4.6'):\n mpisuff = self.cfg['mpisuffix']\n else:\n mpisuff = '_mpi'\n\n bins.extend([binary + mpisuff for binary in bins])\n libnames.extend([libname + mpisuff for libname in libnames])\n\n suff = ''\n # add the _d suffix to the suffix, in case of the double precission\n if re.search('DGMX_DOUBLE=(ON|YES|TRUE|Y|[1-9])', self.cfg['configopts'], re.I):\n suff = '_d'\n\n libs = ['lib%s%s.%s' % (libname, suff, self.libext) for libname in libnames]\n\n # pkgconfig dir not available for earlier versions, exact version to use here is unclear\n if LooseVersion(self.version) >= LooseVersion('4.6'):\n dirs.append(os.path.join(self.lib_subdir, 'pkgconfig'))\n\n custom_paths = {\n 'files': [os.path.join('bin', b + suff) for b in bins] + [os.path.join(self.lib_subdir, l) for l in libs],\n 'dirs': dirs,\n }\n super(EB_GROMACS, self).sanity_check_step(custom_paths=custom_paths)","def add_library(command):\n from src.praxxis.library import list_library\n\n namespace = app.main(command)\n assert namespace.command == 'al' or namespace.command == \"addlibrary\"\n assert namespace.path == \"test\"","def _c_optimizations_available(module_name):\n import importlib\n catch = () if _c_optimizations_required() else (ImportError,)\n try:\n return importlib.import_module('BTrees._' + module_name)\n except catch: # pragma: no cover\n return False","def is_shared_lib(lib):\n dump = AIXDumpExtractor.find_tool()\n if dump is None:\n print(\"ERROR: Could not find dump\")\n sys.exit(1)\n cmd = [dump, '-X32_64', '-ov', lib]\n out = subprocess.check_output(cmd).decode()\n return out.find(\"SHROBJ\") != -1","def HAS(strArg, composList, atomDict):\n splitArgs = strArg.split(',')\n if len(splitArgs) > 1:\n for atom, _ in composList:\n tStr = splitArgs[0].replace('DEADBEEF', atom)\n where = eval(tStr)\n what = eval(splitArgs[1])\n if what in where:\n return 1\n return 0\n else:\n return -666","def _PostParseCheck(options):\n if options.local_pkg_path and not os.path.isfile(options.local_pkg_path):\n cros_build_lib.Die('%s is not a file.', options.local_pkg_path)\n\n if not options.gyp_defines:\n gyp_env = os.getenv('GYP_DEFINES')\n if gyp_env is not None:\n options.gyp_defines = chrome_util.ProcessGypDefines(gyp_env)\n logging.info('GYP_DEFINES taken from environment: %s',\n options.gyp_defines)\n\n if not options.gn_args:\n gn_env = os.getenv('GN_ARGS')\n if gn_env is not None:\n options.gn_args = gn_helpers.FromGNArgs(gn_env)\n logging.info('GN_ARGS taken from environment: %s', options.gn_args)\n\n if not options.staging_flags:\n use_env = os.getenv('USE')\n if use_env is not None:\n options.staging_flags = ' '.join(set(use_env.split()).intersection(\n chrome_util.STAGING_FLAGS))\n logging.info('Staging flags taken from USE in environment: %s',\n options.staging_flags)","def find_library(arguments):\n\n\tpaths = {}\n\n\t# find library\n\tif arguments.lib is not None:\n\t\t# find from arguments\n\t\tpaths['library'] = arguments.lib\n\n\telse:\n\t\t# find from environment\n\t\ttry:\n\t\t\tpaths['library'] = os.environ['MPI_LIB']\n\n\t\texcept KeyError:\n\t\t\tprint 'MPI_LIB is not defined in the environment variables.'\n\t\t\tsys.exit(1)\n\n\t# check existance of library file\n\tif not os.path.isdir(paths['library']):\n\t\tprint paths['library'], ' is not a directory.'\n\t\tsys.exit(3)\n\n\tif arguments.inc is not None:\n\t\t# find from arguments\n\t\tpaths['include'] = arguments.inc\n\n\telse:\n\t\t# find from environment\n\t\ttry:\n\t\t\tpaths['include'] = os.environ['MPI_INC']\n\n\t\texcept KeyError:\n\t\t\tprint 'MPI_INC is not defined in the environment variables.'\n\t\t\tsys.exit(2)\n\n\t# check existance of include directory\n\tif not os.path.isdir(paths['include']):\n\t\tprint paths['include'], ' is not a directory.'\n\t\tsys.exit(4)\n\n\treturn paths","def _validate_built_in(self, tipo):\n\n self.source_type = False\n self.source_file = \"builtin\"\n return tipo in self.c_built_ins or self._match_array(tipo, self.c_built_in_array_types)","def set_cxx_flags_hook(build_ext, ext):\n cc = build_ext._cxx_compiler\n args = ext.extra_compile_args\n\n std_flag = get_cxx_std_flag(cc)\n if std_flag is not None:\n args.append(std_flag)\n\n if sys.platform == 'darwin':\n # Set min macOS version\n min_macos_flag = '-mmacosx-version-min=10.9'\n if has_flag(cc, min_macos_flag):\n args.append(min_macos_flag)\n ext.extra_link_args.append(min_macos_flag)","def skip_if_no_ssl (func):\n try:\n import evy.patched.ssl\n except ImportError:\n try:\n import evy.patched.OpenSSL\n except ImportError:\n skipped(func)","def validate():\n if not os.path.exists(os.path.join(ROOT, APP, '__init__.py')):\n message = ansi.error() + ' Python module not found.'\n if os.environ.get('LORE_APP') is None:\n message += ' $LORE_APP is not set. Should it be different than \"%s\"?' % APP\n else:\n message += ' $LORE_APP is set to \"%s\". Should it be different?' % APP\n sys.exit(message)\n\n if exists():\n return\n\n if len(sys.argv) > 1:\n command = sys.argv[1]\n else:\n command = 'lore'\n sys.exit(\n ansi.error() + ' %s is only available in lore '\n 'app directories (missing %s)' % (\n ansi.bold(command),\n ansi.underline(VERSION_PATH)\n )\n )","def is_jar_library(self):\r\n return self.has_label('jars')","def _locate_gcc(self, format_for_stdlib_flag, use_stdlib_through_env_vars):\n\n # Artefacts built by all C++ compilers require link-time\n # access to a C++ standard library, and often other libraries\n # such as for OpenMP or sanitizers are typically installed\n # alongside that standard library. So for gcc, we ensure that\n # we link to components from the matching gcc version, rather\n # than the system default gcc. For clang and icc, we link to a\n # gcc specified for each build agent.\n gcc_name=None\n if self.compiler == Compiler.GCC:\n gcc_name = self.c_compiler\n elif self.compiler == Compiler.CLANG or self.compiler == Compiler.INTEL:\n gcc_name = agents.get_default_gcc_for_libstdcxx(self._node_name)\n\n gcc_toolchain_path=None\n if gcc_name:\n gcc_exe = self._cmd_runner.find_executable(gcc_name)\n if self.compiler != Compiler.GCC:\n self.gcc_exe = gcc_exe\n gcc_exe_dirname = os.path.dirname(gcc_exe)\n gcc_toolchain_path = os.path.join(gcc_exe_dirname, '..')\n\n if gcc_toolchain_path:\n if format_for_stdlib_flag and use_stdlib_through_env_vars:\n stdlibflag=format_for_stdlib_flag.format(gcctoolchain=gcc_toolchain_path)\n self.append_to_env_var('CFLAGS', stdlibflag)\n self.append_to_env_var('CXXFLAGS', stdlibflag)\n # Linker flag needed for all (#2846)\n format_for_linker_flags=\"-Wl,-rpath,{gcctoolchain}/lib64 -L{gcctoolchain}/lib64\"\n self.extra_cmake_options['CMAKE_CXX_LINK_FLAGS'] = format_for_linker_flags.format(gcctoolchain=gcc_toolchain_path)","def test_override_builtin_extension_without_explicit_flag(self):\n with self.assertRaises(ValueError):\n PyLoader.register()","def test_check_module(self) -> None:\n check_module(\"os\")","def _is_in_stdlib(module, some_object):\n # Clear PYTHONPATH temporarily and try importing the given module.\n original_sys_path = sys.path\n lib_path = os.path.dirname(traceback.__file__)\n sys.path = [lib_path]\n\n # On Mac, some extra library paths are required.\n if 'darwin' in platform.system().lower():\n for path in original_sys_path:\n if 'site-packages' not in path:\n sys.path.append(path)\n\n in_stdlib = False\n\n try:\n module = importlib.import_module(module)\n\n if some_object:\n getattr(module, some_object)\n\n in_stdlib = True\n except (ImportError, AttributeError):\n pass\n\n sys.path = original_sys_path\n\n return in_stdlib","def is_file_ancillary(args):\n # pylint: disable=bad-continuation\n if (\n # skip the parent check and only\n # determine if the parameter is present\n is_valid_exists(args, skip=True)\n or is_valid_comments(args, skip=True)\n or is_valid_paragraphs(args, skip=True)\n or is_valid_words(args, skip=True)\n ):\n return True\n return False","def validate_use_http_wrapper(check):\n has_failed = False\n check_uses_http_wrapper = False\n for file in get_check_files(check, include_tests=False):\n if file.endswith('.py'):\n file_uses_http_wrapper, file_uses_request_lib = validate_use_http_wrapper_file(file, check)\n has_failed = has_failed or file_uses_request_lib\n check_uses_http_wrapper = check_uses_http_wrapper or file_uses_http_wrapper\n\n if has_failed:\n abort()\n return check_uses_http_wrapper","def library():\n finder = LibraryFinder()\n p = finder.find()\n return p if p else ''","def dependency_check(dependency_set=CORE, exit_on_failure=True):\n verify_python_version()\n \n disable_warnings()\n\n platform = get_current_platform()\n\n #\n # Check for missing python modules\n #\n failed_deps = []\n pip_distributions = pip.get_installed_distributions()\n \n for w3af_req in platform.PIP_PACKAGES[dependency_set]:\n for dist in pip_distributions:\n if w3af_req.package_name.lower() == dist.project_name.lower():\n\n w3af_req_version = str(Version(w3af_req.package_version))\n dist_version = str(dist.version)\n\n if w3af_req_version == dist_version:\n # It's installed and the version matches!\n break\n else:\n failed_deps.append(w3af_req)\n\n #\n # Check for missing operating system packages\n #\n missing_os_packages = []\n for os_package in platform.SYSTEM_PACKAGES[dependency_set]:\n if not platform.os_package_is_installed(os_package):\n missing_os_packages.append(os_package)\n \n os_packages = list(set(missing_os_packages))\n\n # All installed?\n if not failed_deps and not os_packages:\n # False means: do not exit()\n enable_warnings()\n return False\n\n generate_requirements_txt(failed_deps)\n script_path = generate_helper_script(platform.PKG_MANAGER_CMD, os_packages,\n platform.PIP_CMD, failed_deps)\n\n #\n # Report the missing system packages\n #\n msg = ('w3af\\'s requirements are not met, one or more third-party'\n ' libraries need to be installed.\\n\\n')\n \n if os_packages:\n missing_pkgs = ' '.join(os_packages)\n \n msg += ('On %s systems please install the following operating'\n ' system packages before running the pip installer:\\n'\n ' %s %s\\n')\n print(msg % (platform.SYSTEM_NAME, platform.PKG_MANAGER_CMD,\n missing_pkgs))\n \n #\n # Report all missing python modules\n # \n if failed_deps:\n # pylint: disable=E1101\n msg = ('Your python installation needs the following modules'\n ' to run w3af:\\n')\n msg += ' ' + ' '.join([fdep.module_name for fdep in failed_deps])\n print(msg)\n print('\\n')\n # pylint: enable=E1101\n \n #\n # Report missing pip packages\n #\n not_git_pkgs = [fdep for fdep in failed_deps if not fdep.is_git]\n git_pkgs = [fdep.git_src for fdep in failed_deps if fdep.is_git]\n \n msg = ('After installing any missing operating system packages, use'\n ' pip to install the remaining modules:\\n')\n \n if not_git_pkgs:\n cmd = generate_pip_install_non_git(platform.PIP_CMD, not_git_pkgs)\n msg += ' %s\\n' % cmd\n \n if git_pkgs:\n for missing_git_pkg in git_pkgs:\n msg += ' %s\\n' % generate_pip_install_git(platform.PIP_CMD,\n missing_git_pkg)\n \n print(msg)\n \n msg = 'A script with these commands has been created for you at %s'\n print(msg % script_path)\n \n enable_warnings()\n platform.after_hook()\n \n if exit_on_failure:\n sys.exit(1)\n else:\n return True","def other_libraries(self):\n\n status, stdout, stderr = self.__xcall__(['--libs-only-other'])\n\n if status != 0:\n raise RuntimeError(\"error querying --libs-only-other for package `%s': %s\" % (self.name, stderr))\n\n return uniq(stdout.split())","def _pip_check():\n check_pipe = subprocess.Popen(\n [sys.executable, \"-m\", \"pip\", \"check\"],\n stdout=subprocess.PIPE,\n )\n pip_check = check_pipe.communicate()[0].decode()\n pip_check_lower = pip_check.lower()\n for package_tup in libraries.values():\n for package in package_tup:\n if package.lower() in pip_check_lower:\n raise RuntimeError(\"Dependency conflict found: {}\".format(pip_check))","def detect_compilers(self):\n # By users experience it is known which compiler flags are required\n # in some cases. This function tries to detect which compilers are used\n # and sets the flags accordingly\n\n print 'Detecting Fortran compiler...',\n if self.fc_is_intel():\n # The Intel FORTRAN compiler requires -nofor_main flag\n # for the linking and the -mp flag to maintain the\n # floating-point precision\n self.config.fcflags += ' -diag-disable vec -fltconsistency -fp_port'\n self.config.ldflags_c += ' ' # used to link\n self.config.ldflags_fc += ' '\n self.config.ld_fcmain = ' -nofor_main'\n self.config.noopt += ' -mp'\n self.testing = 0; # Cannot compile lintest with fc_main option\n print 'Intel'\n elif self.fc_is_gnu():\n print 'GNU'\n self.config.ld_fcmain = ''\n elif self.fc_is_xlf():\n self.config.fcflags += ' -qstrict -qthreaded'\n self.config.ld_fcmain = ''\n print 'IBM'\n elif self.fc_is_pgi():\n self.config.ldflags_c += ''\n self.config.ldflags_fc += ''\n self.config.ld_fcmain = ' -Mnomain'\n self.testing = 0; # Cannot compile lintest with fc_main option\n else:\n self.config.compiler = \"Unknown\"\n print 'unknown'\n\n print 'Detecting C compiler...',\n if self.cc_is_intel():\n self.config.compiler = \"Intel\"\n self.config.ccflags += ' -diag-disable vec'\n print 'Intel'\n elif self.cc_is_gnu():\n self.config.compiler = \"GNU\"\n print 'GNU'\n elif self.cc_is_xlc():\n self.config.compiler = \"XLC\"\n self.config.ccflags += ' -qstrict -qthreaded'\n print 'IBM'\n elif self.cc_is_pgi():\n self.config.compiler = \"PGI\"\n print 'PGI'\n else:\n print 'unknown'\n\n print 'Selected C compiler flags: '+self.config.ccflags\n print 'Selected Fortran compiler flags: '+self.config.fcflags\n print 'Selected loader flags (C main): '+self.config.ldflags_c\n print 'Selected loader flags (Fortran main): '+self.config.ldflags_fc\n return","def check_phenotools():\n if not os.path.exists(PHENOTOOLS):\n os.system('../setup.py')\n else:\n print(\"[INFO] we found \")","def test_arm_c_lib(self):\n mock_target = mock.MagicMock()\n mock_target.core = \"Cortex-M4\"\n mock_target.supported_c_libs = {\"arm\": [\"small\"]}\n mock_target.c_lib = \"sMALL\"\n del mock_target.default_lib\n mock_target.default_toolchain = \"ARM\"\n mock_target.supported_toolchains = [\"ARM\", \"uARM\", \"ARMC5\", \"ARMC6\"]\n arm_std_obj = ARM_STD(mock_target)\n arm_micro_obj = ARM_MICRO(mock_target)\n\n mock_target.default_toolchain = \"ARMC6\"\n arm_c6_obj = ARMC6(mock_target)\n\n self.assertIn(\"-D__MICROLIB\", arm_std_obj.flags[\"common\"])\n self.assertIn(\"-D__MICROLIB\", arm_micro_obj.flags[\"common\"])\n self.assertIn(\"-D__MICROLIB\", arm_c6_obj.flags[\"common\"])\n\n self.assertIn(\"--library_type=microlib\", arm_std_obj.flags[\"ld\"])\n self.assertIn(\"--library_type=microlib\", arm_micro_obj.flags[\"ld\"])\n self.assertIn(\"--library_type=microlib\", arm_c6_obj.flags[\"ld\"]) \n self.assertIn(\"--library_type=microlib\", arm_c6_obj.flags[\"asm\"])","def _should_attempt_c_optimizations():\n if PYPY:\n return False\n\n if _c_optimizations_required():\n return True\n return not _c_optimizations_ignored()","def should_use_libarchive_c(self):\n if self.manager.no_libarchive:\n return False\n\n return has_optional_dependency(\n \"libarchive\",\n \"install libarchive-c for better perfomance when working with archives: {error}\",\n )","def have_pyrex():\n pyrex_impls = 'Cython.Distutils.build_ext', 'Pyrex.Distutils.build_ext'\n for pyrex_impl in pyrex_impls:\n try:\n # from (pyrex_impl) import build_ext\n __import__(pyrex_impl, fromlist=['build_ext']).build_ext\n return True\n except Exception:\n pass\n return False","def add_lib(ctx, sources, library, folder, roles, lib_desc, lib_synopsis, datatype, no_file_check, replace, no_biomaj_env):\n\n if not sources:\n print(\"Nothing to do\")\n return\n\n if not library:\n if 'dbname' in os.environ:\n library = os.environ['dbname']\n else:\n raise Exception('No library defined. Use the --library option.')\n\n sources = check_input(sources, check_existence=(not no_file_check), use_biomaj_env=(not no_biomaj_env))\n\n r_roles = []\n if roles:\n print(\"Checking roles\")\n roles = roles.split(',')\n r_roles = get_roles(ctx.gi, roles)\n\n print(\"Adding to data library '\" + str(library) + \"'\")\n\n if not folder:\n folder = '/'\n dest = os.path.normpath(folder)\n dest = dest.split(os.sep)\n dest = [x for x in dest if x] # Remove empty string when sep at the begin or end, or multiple sep\n\n found_lib = get_library(ctx.gi, library, lib_desc, lib_synopsis)\n\n print(\"Preparing folders in library '\" + library + \"'\")\n\n dest_folder = create_tree(ctx.gi, found_lib, dest)\n\n check_existing(ctx.gi, found_lib, dest, sources, replace)\n\n print(\"Adding \" + str(len(sources)) + \" file(s) to the library '\" + library + \"'\")\n add_files(ctx.gi, found_lib, dest_folder, sources, r_roles, datatype)\n\n print(\"Done!\")","def test_add_library_python_api(self):\n\n lib_name = 'qt_components'\n add_library.add_library([lib_name])\n self.assertTrue(os.path.exists(os.path.join(project_libs_dir(),\n lib_name)))","def setup_lib():\n global _lib\n if not _lib:\n for name in [ find_library(\"http_parser\"), \"libhttp_parser.so\", \"libhttp_parser\" ]:\n try:\n _lib = cdll.LoadLibrary(name)\n except OSError as e:\n pass\n else:\n break\n if not _lib:\n _lib = cdll.http_parser # propogate OSError if this fails\n\n _lib.http_parser_version.argtypes = []\n _lib.http_parser_version.restype = c_ulong\n\n _lib.http_parser_settings_init.argtypes = [c_void_p]\n _lib.http_parser_settings_init.restype = None\n\n _lib.http_parser_execute.argtypes = [c_void_p, c_void_p, POINTER(c_char), c_size_t]\n _lib.http_parser_execute.restype = c_size_t\n\n _lib.http_should_keep_alive.argtypes = [c_void_p]\n _lib.http_should_keep_alive.restype = c_int\n\n _lib.http_method_str.argtypes = [c_int]\n _lib.http_method_str.restype = c_char_p\n\n _lib.http_status_str.argtypes = [c_int]\n _lib.http_status_str.restype = c_char_p\n\n _lib.http_errno_name.argtypes = [c_int]\n _lib.http_errno_name.restype = c_char_p\n\n _lib.http_errno_description.argtypes = [c_int]\n _lib.http_errno_description.restype = c_char_p\n\n _lib.http_parser_url_init.argtypes = [c_void_p]\n _lib.http_parser_url_init.restype = None\n\n _lib.http_parser_parse_url.argtypes = [POINTER(c_char), c_size_t, c_int, c_void_p]\n _lib.http_parser_parse_url.restype = c_int\n\n _lib.http_parser_pause.argtypes = [c_void_p, c_int]\n _lib.http_parser_pause.restype = None\n\n _lib.http_body_is_final.argtypes = [c_void_p]\n _lib.http_body_is_final.restype = c_int\n\n _lib.http_parser_set_max_header_size.argtypes = [c_int]\n _lib.http_parser_set_max_header_size.restype = None\n\n return _lib","def recognize_lib(self, a, lib):\n logging.debug(\"in recognize lib\")\n self.produce(KEYWORD, lib)\n self.begin('lib')","def checklib(module):\n import imp\n for mod in module:\n try:\n imp.find_module(mod)\n ret = 1\n except ImportError as imperror:\n print(imperror)\n ret = 0\n return ret","def check_dependencies(target_binary, target_platform, target_architecture, target_type):\n check_architecture(target_architecture)\n check_platform(target_platform)"],"string":"[\n \"def check_library(self, **kw):\\n\\tself.check(\\n\\t\\tcompile_filename = [],\\n\\t\\tfeatures = 'link_lib_test',\\n\\t\\tmsg = 'Checking for libraries',\\n\\t\\t)\",\n \"def check_libraries(env):\\n # Detect OS X python installation, and attempt to correct for it.\\n if os.uname()[0] == 'Darwin':\\n env.Replace(SHLINKFLAGS='$LINKFLAGS -bundle -flat_namespace -undefined suppress')\\n env.Replace(SHLIBSUFFIX='.so')\\n if os.path.isdir('/opt/local'):\\n env.Append(\\n LIBPATH=['/opt/local/lib'],\\n CPPPATH=['/opt/local/include']\\n )\\n\\n # Detect the presence of necessary dependencies.\\n conf = Configure(env)\\n\\n if not conf.CheckLibWithHeader('m', 'math.h', 'c'):\\n print \\\"Can't find standard math libraries.\\\"\\n Exit(1)\\n\\n if not conf.CheckLibWithHeader('python%s' % python_version,\\n 'Python.h', 'c'):\\n print \\\"Can't find python %s.\\\" % python_version\\n Exit(1)\\n\\n env = conf.Finish()\\n\\n return env\",\n \"def checkLibraries(env):\\n # Detect OS X python installation, and attempt to correct for it.\\n if os.uname()[0] == 'Darwin':\\n env.Replace(SHLINKFLAGS='$LINKFLAGS -bundle -flat_namespace -undefined suppress')\\n env.Replace(SHLIBSUFFIX='.so')\\n\\n # Detect the presence of necessary dependencies.\\n conf = Configure(env)\\n\\n if not conf.CheckLibWithHeader('m', 'math.h', 'c'):\\n print \\\"Can't find standard math libraries.\\\"\\n Exit(1)\\n\\n env = conf.Finish()\\n\\n return env\",\n \"def examineLoadLibrary(lib):\\n from PyJobTransformsCore.envutil import examine_library\\n\\n # turn module name into library name\\n if not lib.startswith('lib') and not lib.endswith('.so'):\\n lib = 'lib' + lib + '.so'\\n print (\\\"Examining library \\\" + lib)\\n diagLines = []\\n errorAcronym = None\\n missingSystemLibs = []\\n missingOtherLibs = []\\n misLibs = examine_library(lib)\\n for l in misLibs:\\n if systemLibsRE.search(l):\\n missingSystemLibs.append(l)\\n else:\\n missingOtherLibs.append(l)\\n if missingSystemLibs:\\n if len(missingSystemLibs) == 1: libWord = 'library'\\n else: libWord = 'libraries'\\n diagLines.append( 'Site problem: Missing system %s: %s' % (libWord, ','.join(missingSystemLibs)) )\\n if not errorAcronym: errorAcronym = \\\"ATH_SITE_SYSLIBS\\\"\\n\\n if missingOtherLibs:\\n if len(missingOtherLibs) == 1: libWord = 'library'\\n else: libWord = 'libraries'\\n diagLines.append( 'Can not find %s: %s Please check software installation.' % (libWord,','.join(missingOtherLibs)) )\\n if not errorAcronym: errorAcronym = \\\"ATH_SITE_LIBS\\\"\\n return (errorAcronym,os.linesep.join(diagLines))\",\n \"def checkArguments ( ) :\\r\\n\\r\\n if len( sys.argv ) <= 1 : return None\\r\\n\\r\\n\\r\\n # splits the arguments that contain quotes\\r\\n \\r\\n wordList = [ ]\\r\\n\\r\\n for argument in sys.argv :\\r\\n\\r\\n wordList.extend( argument.split( '\\\"' ) )\\r\\n\\r\\n\\r\\n # places all the arguments that start with \\\"--\\\" at the end, and joins the others into words\\r\\n\\r\\n noMinusList = [ ]\\r\\n\\r\\n minusList = [ ]\\r\\n\\r\\n argument = \\\"\\\"\\r\\n\\r\\n for word in wordList[ 1 : ] :\\r\\n\\r\\n # strips spaces and quotes\\r\\n \\r\\n word = word.strip( \\\" \\\\\\\"'\\\" ) \\r\\n\\r\\n if word.startswith( \\\"--\\\" ) :\\r\\n\\r\\n minusList.append( word )\\r\\n\\r\\n if len( argument ) > 0 : noMinusList.append( argument )\\r\\n\\r\\n argument = \\\"\\\"\\r\\n\\r\\n elif argument == \\\"\\\" :\\r\\n\\r\\n argument = word\\r\\n\\r\\n else :\\r\\n\\r\\n argument = argument + \\\" \\\" + word\\r\\n\\r\\n if len( argument ) > 0 : noMinusList.append( argument )\\r\\n\\r\\n\\r\\n # library = 1st argument of the form \\\"-- ... /\\\" that exists\\r\\n\\r\\n libraryPath = None\\r\\n\\r\\n for argument in minusList :\\r\\n\\r\\n if ( ( argument.endswith( os.sep ) ) and ( os.path.exists( argument.strip( \\\"- \\\" ) ) ) ) :\\r\\n\\r\\n libraryPath = argument.strip( \\\"-\\\" )\\r\\n\\r\\n break\\r\\n\\r\\n # recomposes the command line\\r\\n \\r\\n sys.argv = wordList[ : 1 ] + noMinusList + minusList \\r\\n\\r\\n return libraryPath\",\n \"def check_linking(self):\\n\\n # This one checks if the linking command works out of the box or\\n # if any specific flag is required. For example if the linker if the\\n # Intel FORTRAN compiler, then the \\\"-nofor_main\\\" is usually required.\\n # This function only checks if linker works but does not automatically\\n # detect the required flags\\n print 'Checking loader...',\\n sys.stdout.flush()\\n writefile('tmpf.f',\\\"\\\"\\\"\\n subroutine fsub()\\n write(*,*)'success'\\n stop\\n end\\\\n\\\"\\\"\\\")\\n writefile('tmpc.c',\\\"\\\"\\\"\\n #if defined ADD_\\n #define fsub fsub_\\n #elif defined NOCHANGE\\n #define fsub fsub\\n #elif defined fcIsF2C\\n #define fsub fsub_\\n #elif defined UPCASE\\n #define fsub FSUB\\n #endif\\n void main(){\\n fsub();}\\\\n\\\"\\\"\\\")\\n\\n ccomm = self.config.cc+' '+self.config.ccflags+' '+self.mangling+' -c -o tmpc.o tmpc.c'\\n fcomm = self.config.fc+' '+self.config.fcflags+' -c -o tmpf.o tmpf.f'\\n lcomm = self.config.fc+' '+self.config.ldflags_fc+' '+self.config.ld_fcmain+' -o lnk tmpf.o tmpc.o'\\n\\n (output, error, retz) = runShellCommand(ccomm)\\n if retz:\\n print '\\\\n\\\\nCOMMON: in check_linking: cannot compile'\\n print 'command is: ',ccomm\\n print 'error is:\\\\n','*'*40,'\\\\n',error,'\\\\n','*'*40\\n sys.exit()\\n\\n (output, error, retz) = runShellCommand(fcomm)\\n if retz:\\n print '\\\\n\\\\nCOMMON: in check_linking: cannot compile'\\n print 'command is: ',fcomm\\n print 'error is:\\\\n','*'*40,'\\\\n',error,'\\\\n','*'*40\\n sys.exit()\\n\\n (output, error, retz) = runShellCommand(lcomm)\\n if retz:\\n print \\\"\\\"\\\"\\\\n\\\\nCOMMON: in check_linking: cannot link\\n Cannot link a C main program to a Fortran77 subroutine\\n Make sure that the appropriate flags are passed to the linker.\\\"\\\"\\\"\\n print 'command is: ',lcomm\\n print 'error is:\\\\n','*'*40,'\\\\n',error,'\\\\n','*'*40\\n sys.exit()\\n\\n\\n killfiles(['lnk', 'tmpf.f', 'tmpf.o', 'tmpc.c', 'tmpc.o'])\\n\\n print 'works'\\n return 1;\",\n \"def find_python_library():\\n python_library = sysconfig.get_config_var('LIBRARY')\\n if (not python_library or os.path.splitext(python_library)[1][-2:] == '.a'):\\n candidate_lib_prefixes = ['', 'lib']\\n candidate_implementations = ['python']\\n if hasattr(sys, \\\"pypy_version_info\\\"):\\n candidate_implementations = ['pypy-c', 'pypy3-c']\\n candidate_extensions = ['.lib', '.so', '.a']\\n if sysconfig.get_config_var('WITH_DYLD'):\\n candidate_extensions.insert(0, '.dylib')\\n candidate_versions = []\\n candidate_versions.append('')\\n candidate_versions.insert(0, str(sys.version_info.major) +\\n \\\".\\\" + str(sys.version_info.minor))\\n abiflags = getattr(sys, 'abiflags', '')\\n candidate_abiflags = [abiflags]\\n if abiflags:\\n candidate_abiflags.append('')\\n # Ensure the value injected by virtualenv is\\n # returned on windows.\\n # Because calling `sysconfig.get_config_var('multiarchsubdir')`\\n # returns an empty string on Linux, `du_sysconfig` is only used to\\n # get the value of `LIBDIR`.\\n libdir = du_sysconfig.get_config_var('LIBDIR')\\n if sysconfig.get_config_var('MULTIARCH'):\\n masd = sysconfig.get_config_var('multiarchsubdir')\\n if masd:\\n if masd.startswith(os.sep):\\n masd = masd[len(os.sep):]\\n libdir = os.path.join(libdir, masd)\\n if libdir is None:\\n libdir = os.path.abspath(os.path.join(\\n sysconfig.get_config_var('LIBDEST'), \\\"..\\\", \\\"libs\\\"))\\n no_valid_candidate = True\\n for (pre, impl, ext, ver, abi) in itertools.product(candidate_lib_prefixes,\\n candidate_implementations,\\n candidate_extensions,\\n candidate_versions,\\n candidate_abiflags):\\n candidate = os.path.join(libdir, ''.join((pre, impl, ver, abi, ext)))\\n if os.path.exists(candidate):\\n python_library = candidate\\n no_valid_candidate = False\\n break\\n # If there is not valid candidate then set the python_library is empty\\n if no_valid_candidate:\\n python_library = \\\"\\\"\\n return python_library\",\n \"def _add_linking_libs(context, call):\\n libs = getattr(call, \\\"libs\\\", ())\\n if libs:\\n context.add_linking_libs(libs)\",\n \"def CustomCFlagCheck(context, flag, append=True):\\n context.Message(\\\"Checking if C compiler supports \\\" + flag + \\\" flag \\\")\\n ccflags = context.env[\\\"CCFLAGS\\\"]\\n context.env.Append(CCFLAGS=flag)\\n result = context.TryCompile(\\\"int main(int argc, char **argv) { return 0; }\\\", \\\".c\\\")\\n context.Result(result)\\n if not append or not result:\\n context.env.Replace(CCFLAGS=ccflags)\\n return result\",\n \"def is_lib_available(library):\\n try:\\n __import__(library)\\n return True\\n except ImportError:\\n return False\",\n \"def CustomCompileCheck(context, message, source, extension=\\\".cc\\\"):\\n context.Message(message)\\n\\n env = context.env\\n if env.GetOption(\\\"clean\\\") or env.GetOption(\\\"help\\\") or env.GetOption(\\\"no_exec\\\"):\\n result = True\\n else:\\n result = context.TryCompile(source, extension)\\n\\n context.Result(result)\\n\\n return result\",\n \"def selected_libs(args: Namespace) -> List[str]:\\n return args.lib or [\\\"python\\\", \\\"lkt\\\"]\",\n \"def has_library(self, library_id, ignore_case=False, **kwargs): # lint-amnesty, pylint: disable=unused-argument\\n if not isinstance(library_id, LibraryLocator):\\n return None\\n\\n index = self.get_course_index(library_id, ignore_case)\\n if index:\\n return LibraryLocator(index['org'], index['course'], library_id.branch)\\n return None\",\n \"def has_flag(compiler, flag, ext=None):\\n return try_compile(compiler, flags=[flag], ext=ext)\",\n \"def is_static_library(lib_file):\\n if sys.platform.startswith('aix'):\\n # An AIX library could be both, but for simplicity assume it isn't.\\n return not AIXDumpExtractor.is_shared_lib(lib_file)\\n else:\\n _, ext = os.path.splitext(lib_file)\\n return ext == '.a'\",\n \"def _c_optimizations_required():\\n pure_env = os.environ.get('PURE_PYTHON')\\n require_c = pure_env == \\\"0\\\"\\n return require_c\",\n \"def CustomCppFlagCheck(context, flag, append=True):\\n context.Message(\\\"Checking if C++ compiler supports \\\" + flag + \\\" flag \\\")\\n cxxflags = context.env[\\\"CXXFLAGS\\\"]\\n context.env.Append(CXXFLAGS=flag)\\n result = context.TryCompile(\\\"int main(int argc, char **argv) { return 0; }\\\", \\\".cc\\\")\\n context.Result(result)\\n if not append or not result:\\n context.env.Replace(CXXFLAGS=cxxflags)\\n return result\",\n \"def try_add_flag(args, compiler, flag, ext=None):\\n if try_compile(compiler, flags=args+[flag], ext=ext):\\n args.append(flag)\",\n \"def _get_linker_flags(\\n target,\\n fc,\\n cc,\\n syslibs,\\n srcfiles,\\n sharedobject=False,\\n osname=None,\\n verbose=False,\\n):\\n # get list of unique fortran and c/c++ file extensions\\n fext = _get_fortran_files(srcfiles, extensions=True)\\n\\n # remove .exe extension of necessary\\n if fc is not None:\\n fc = _get_base_app_name(fc)\\n if cc is not None:\\n cc = _get_base_app_name(cc)\\n\\n # set linker compiler\\n compiler = None\\n if len(srcfiles) < 1:\\n if fc is not None:\\n compiler = fc\\n else:\\n if fext is not None:\\n compiler = fc\\n if compiler is None:\\n compiler = cc\\n\\n # remove target .exe extension, if necessary\\n target = _get_base_app_name(target)\\n\\n # get lower case OS string\\n if osname is None:\\n osname = _get_osname()\\n\\n # get - or / to prepend for compiler switches\\n prepend = _get_prepend(compiler, osname)\\n\\n # set outgoing syslibs\\n syslibs_out = []\\n\\n # add option to statically link intel provided libraries on osx and linux\\n if sharedobject:\\n if osname in (\\n \\\"darwin\\\",\\n \\\"linux\\\",\\n ):\\n if compiler == fc:\\n if fc in (\\n \\\"ifort\\\",\\n \\\"mpiifort\\\",\\n ):\\n syslibs_out.append(\\\"static-intel\\\")\\n\\n # add linker switch for a shared object\\n if sharedobject:\\n gnu_compiler = True\\n if compiler == fc:\\n if fc in (\\n \\\"ifort\\\",\\n \\\"mpiifort\\\",\\n ):\\n gnu_compiler = False\\n else:\\n if cc in (\\n \\\"icc\\\",\\n \\\"mpiicc\\\",\\n \\\"icl\\\",\\n \\\"cl\\\",\\n ):\\n gnu_compiler = False\\n if osname == \\\"win32\\\":\\n if gnu_compiler:\\n copt = \\\"shared\\\"\\n else:\\n copt = \\\"dll\\\"\\n else:\\n if osname == \\\"darwin\\\":\\n copt = \\\"dynamiclib\\\"\\n else:\\n copt = \\\"shared\\\"\\n syslibs_out.append(copt)\\n # add static link flags for GNU compilers\\n else:\\n if \\\"shared\\\" in syslibs_out:\\n syslibs_out.remove(\\\"shared\\\")\\n if \\\"dynamiclib\\\" in syslibs_out:\\n syslibs_out.remove(\\\"dynamiclib\\\")\\n if \\\"dll\\\" in syslibs_out:\\n syslibs_out.remove(\\\"dll\\\")\\n isstatic = False\\n isgfortran = False\\n if osname == \\\"win32\\\":\\n if compiler == fc and fc in (\\\"gfortran\\\",):\\n isstatic = True\\n isgfortran = True\\n if not isstatic:\\n if compiler == cc and cc in (\\n \\\"gcc\\\",\\n \\\"g++\\\",\\n ):\\n isstatic = True\\n if isstatic:\\n syslibs_out.append(\\\"static\\\")\\n if isgfortran:\\n syslibs_out.append(\\\"static-libgfortran\\\")\\n syslibs_out.append(\\\"static-libgcc\\\")\\n syslibs_out.append(\\\"static-libstdc++\\\")\\n syslibs_out.append(\\\"lm\\\")\\n\\n # add -nologo switch for compiling on windows with intel compilers\\n if osname == \\\"win32\\\":\\n addswitch = False\\n if compiler == fc:\\n if fc in (\\n \\\"ifort\\\",\\n \\\"mpiifort\\\",\\n ):\\n addswitch = True\\n else:\\n if cc in (\\n \\\"icl\\\",\\n \\\"cl\\\",\\n ):\\n addswitch = True\\n if addswitch:\\n syslibs_out.append(\\\"nologo\\\")\\n\\n # process passed syslibs switches - check for switches with a space between\\n # the switch and a setting\\n for idx, flag in enumerate(syslibs[1:]):\\n if flag[0] not in (\\\"/\\\", \\\"-\\\"):\\n syslibs[idx] += \\\" {}\\\".format(flag)\\n syslibs[idx + 1] = \\\"\\\"\\n\\n # add passed syslibs switches - assume that flags have - or / as the\\n # first character.\\n for switch in syslibs:\\n if len(switch) < 1:\\n continue\\n if switch[1:] not in syslibs_out:\\n syslibs_out.append(switch[1:])\\n\\n # add target specific linker (syslib) switches\\n tlist = _set_syslibs(target, fc=fc, cc=cc, argv=False, osname=osname)\\n if len(tlist) > 0:\\n for switch in tlist:\\n if switch[1:] not in syslibs_out:\\n syslibs_out.append(switch[1:])\\n\\n # add prepend to syslibs flags\\n for idx, switch in enumerate(syslibs_out):\\n syslibs_out[idx] = prepend + switch\\n\\n return compiler, syslibs_out\",\n \"def isLibSBMLCompiledWith(*args):\\n return _libsbml.isLibSBMLCompiledWith(*args)\",\n \"def check_prerequisites() -> None:\\n # check black code formatter is installed\\n if not is_installed(\\\"black\\\"):\\n raise FileNotFoundError(\\n \\\"Cannot find black code formatter! To install, please follow this link: https://black.readthedocs.io/en/stable/installation_and_usage.html\\\"\\n )\\n\\n # check isort code formatter is installed\\n if not is_installed(\\\"isort\\\"):\\n raise FileNotFoundError(\\n \\\"Cannot find isort code formatter! To install, please follow this link: https://pycqa.github.io/isort/#installing-isort\\\"\\n )\\n\\n # check protolint code formatter is installed\\n if subprocess.call(f\\\"{base_protolint_command()} version\\\", shell=True) != 0: # nosec\\n raise FileNotFoundError(\\n \\\"Cannot find protolint protocol buffer schema file linter! To install, please follow this link: https://github.com/yoheimuta/protolint.\\\"\\n )\\n\\n # check protocol buffer compiler is installed\\n if not is_installed(\\\"protoc\\\"):\\n raise FileNotFoundError(\\n \\\"Cannot find protocol buffer compiler! To install, please follow this link: https://developers.google.com/protocol-buffers/\\\"\\n )\",\n \"def is_valid_language(args, skip=False):\\n if (is_valid_file_and_directory(args) and is_valid_comments(args)) or skip:\\n if args.language is not None:\\n return True\\n return False\",\n \"def is_selection(cfg):\\n if LIBRARIES in list(cfg.keys()):\\n return True\\n else:\\n return False\",\n \"def detect(self):\\n GCCLike.detect(self)\\n\\n if self._platform != platforms.lumin.NAME:\\n err = self.detect_version_on_path_or_env('CPP', 'cpp', False)\\n if err:\\n return err\\n err = self.detect_version_on_path_or_env('CC', 'clang',\\n needs_version=self._suffix != '',\\n allow_unversioned=not self._suffix)\\n if err:\\n return err\\n err = self.detect_version_on_path_or_env('CXX', 'clang++',\\n needs_version=self._suffix != '',\\n allow_unversioned=not self._suffix)\\n if err:\\n return err\\n err = self.detect_version_on_path_or_env('AS', 'llvm-as',\\n needs_version=self._suffix != '',\\n allow_unversioned=not self._suffix)\\n if err:\\n err = self.detect_version_on_path_or_env('AS', 'as', False)\\n if err:\\n return err\\n err = self.detect_version_on_path_or_env('AR', 'ar', False)\\n if err:\\n return err\\n else:\\n err = self.add_cross_toolchain_tool('CPP', 'cpp')\\n if err:\\n return err\\n err = self.add_cross_toolchain_tool('CC', 'clang')\\n if err:\\n return err\\n err = self.add_cross_toolchain_tool('CXX', 'clang++')\\n if err:\\n return err\\n err = self.add_cross_toolchain_tool('AS', 'as')\\n if err:\\n return err\\n err = self.add_cross_toolchain_tool('AR', 'gcc-ar')\\n if err:\\n return err\\n err = self.add_cross_toolchain_tool('OBJCOPY', 'objcopy')\\n if err:\\n return err\\n err = self.add_cross_toolchain_tool('STRIP', 'strip')\\n if err:\\n return err\\n\\n return None\",\n \"def _cached_create_libspec(\\n self,\\n libname: str,\\n is_builtin: bool,\\n target_file: Optional[str],\\n args: Optional[str],\\n *,\\n _internal_force_text=False, # Should only be set from within this function.\\n ) -> Optional[str]:\\n from robotframework_ls.impl import robot_constants\\n\\n if not is_builtin:\\n if not target_file:\\n is_builtin = libname in robot_constants.STDLIBS\\n\\n import time\\n from robocorp_ls_core.subprocess_wrapper import subprocess\\n from robocorp_ls_core.robotframework_log import get_log_level\\n\\n acquire_mutex = _timed_acquire_mutex_for_spec_filename\\n\\n if _internal_force_text:\\n # In this case this is a recursive call and we already have the lock.\\n acquire_mutex = NULL\\n\\n log_exception = log.exception\\n if is_builtin and libname == \\\"Dialogs\\\" and get_log_level() < 1:\\n # Dialogs may have dependencies that are not available, so, don't show\\n # it unless verbose mode is enabled.\\n log_exception = log.debug\\n\\n if not libname.replace(\\\".\\\", \\\"\\\").replace(\\\"/\\\", \\\"\\\").replace(\\\"\\\\\\\\\\\", \\\"\\\").strip():\\n return f\\\"Unable to generate libspec for: {libname}\\\"\\n\\n additional_path = None\\n additional_path_exists = False\\n\\n log_time = True\\n cwd = None\\n\\n if target_file is not None:\\n additional_path = os.path.dirname(target_file)\\n if os.path.splitext(os.path.basename(target_file))[0] == \\\"__init__\\\":\\n additional_path = os.path.dirname(additional_path)\\n\\n additional_path_exists = os.path.exists(additional_path)\\n if additional_path and additional_path_exists:\\n cwd = additional_path\\n if libname.endswith((\\\"/\\\", \\\"\\\\\\\\\\\")):\\n libname = libname[:-1]\\n libname = os.path.basename(libname)\\n if libname.lower().endswith((\\\".py\\\", \\\".class\\\", \\\".java\\\")):\\n libname = os.path.splitext(libname)[0]\\n\\n curtime = time.time()\\n\\n try:\\n try:\\n call = [sys.executable]\\n major_version = self.get_robot_major_version()\\n if major_version < 4:\\n call.extend(\\\"-m robot.libdoc --format XML\\\".split())\\n else:\\n call.extend(\\n \\\"-m robot.libdoc --format XML --specdocformat RAW\\\".split()\\n )\\n\\n if additional_path and additional_path_exists:\\n call.extend([\\\"-P\\\", os.path.normpath(additional_path)])\\n\\n if _internal_force_text:\\n call.append(\\\"--docformat\\\")\\n call.append(\\\"text\\\")\\n\\n # Note: always set as a whole, so, iterate in generator is thread-safe.\\n for entry in self._additional_pythonpath_folder_to_folder_info:\\n if os.path.exists(entry):\\n call.extend([\\\"-P\\\", os.path.normpath(entry)])\\n\\n if not args:\\n call.append(libname)\\n else:\\n call.append(\\\"::\\\".join([libname, args]))\\n\\n libspec_filename = self._compute_libspec_filename(\\n libname, is_builtin, target_file, args\\n )\\n\\n log.debug(f\\\"Obtaining mutex to generate libspec: {libspec_filename}.\\\")\\n with acquire_mutex(libspec_filename): # Could fail.\\n log.debug(\\n f\\\"Obtained mutex to generate libspec: {libspec_filename}.\\\"\\n )\\n call.append(libspec_filename)\\n\\n mtime: float = -1\\n try:\\n mtime = os.path.getmtime(libspec_filename)\\n except:\\n pass\\n\\n log.debug(\\n \\\"Generating libspec for: %s.\\\\nCwd:%s\\\\nCommand line:\\\\n%s\\\",\\n libname,\\n cwd,\\n \\\" \\\".join(call),\\n )\\n try:\\n try:\\n # Note: stdout is always subprocess.PIPE in this call.\\n # Note: the env is always inherited (the process which has\\n # the LibspecManager must be the target env already).\\n self._subprocess_check_output(\\n call,\\n stderr=subprocess.STDOUT,\\n stdin=subprocess.PIPE,\\n cwd=cwd,\\n )\\n except OSError as e:\\n log.exception(\\\"Error calling: %s\\\", call)\\n # We may have something as: Ignore OSError: [WinError 6] The handle is invalid,\\n # give the result based on whether the file changed on disk.\\n try:\\n if mtime != os.path.getmtime(libspec_filename):\\n _dump_spec_filename_additional_info(\\n self,\\n libspec_filename,\\n is_builtin=is_builtin,\\n obtain_mutex=False,\\n )\\n return None\\n except:\\n pass\\n\\n log.debug(\\\"Not retrying after OSError failure.\\\")\\n return str(e)\\n\\n except subprocess.CalledProcessError as e:\\n if not _internal_force_text:\\n if (\\n b\\\"reST format requires 'docutils' module to be installed\\\"\\n in e.output\\n ):\\n return self._cached_create_libspec(\\n libname,\\n is_builtin,\\n target_file,\\n args,\\n _internal_force_text=True,\\n )\\n\\n log_exception(\\n \\\"Error creating libspec: %s.\\\\nReturn code: %s\\\\nOutput:\\\\n%s\\\",\\n libname,\\n e.returncode,\\n e.output,\\n )\\n bytes_output = e.output\\n output = bytes_output.decode(\\\"utf-8\\\", \\\"replace\\\")\\n\\n # Remove things we don't want to show.\\n for s in (\\\"Try --help\\\", \\\"--help\\\", \\\"Traceback\\\"):\\n index = output.find(s)\\n if index >= 0:\\n output = output[:index].strip()\\n\\n if output:\\n return output\\n return f\\\"Error creating libspec: {output}\\\"\\n\\n _dump_spec_filename_additional_info(\\n self,\\n libspec_filename,\\n is_builtin=is_builtin,\\n obtain_mutex=False,\\n )\\n return None\\n except Exception as e:\\n log_exception(\\\"Error creating libspec: %s\\\", libname)\\n return str(e)\\n finally:\\n if log_time:\\n delta = time.time() - curtime\\n log.debug(\\\"Took: %.2fs to generate info for: %s\\\" % (delta, libname))\",\n \"def test_add_library_cmd_line(self):\\n\\n lib_name = self.conf.options('libs')[0]\\n cmd = ['pydroid', 'add', 'library', lib_name]\\n subprocess.call(cmd)\\n self.assertTrue(os.path.exists(os.path.join(project_libs_dir(),\\n lib_name)))\",\n \"def _get_ldflags() -> str:\\n # windows gcc does not support linking with unresolved symbols\\n if sys.platform == 'win32': # pragma: win32 cover\\n libs = os.path.join(sys.base_prefix, 'libs')\\n return f'-L{libs} -lpython{sys.version_info[0]}'\\n else: # pragma: win32 no cover\\n cc = subprocess.check_output(('go', 'env', 'CC')).decode().strip()\\n\\n with _tmpdir() as tmpdir:\\n testf = os.path.join(tmpdir, 'test.c')\\n with open(testf, 'w') as f:\\n f.write('int f(int); int main(void) { return f(0); }\\\\n')\\n\\n for lflag in LFLAGS: # pragma: no cover (platform specific)\\n try:\\n subprocess.check_call((cc, testf, lflag), cwd=tmpdir)\\n return lflag\\n except subprocess.CalledProcessError:\\n pass\\n else: # pragma: no cover (platform specific)\\n # wellp, none of them worked, fall back to gcc and they'll get\\n # a hopefully reasonable error message\\n return LFLAG_GCC\",\n \"def detectExtensions(builder):\\n print (\\\"Checking if C extensions can be compiled, don't be alarmed if \\\"\\n \\\"a few compile errors are printed.\\\")\\n\\n if not builder._compile_helper(\\\"#define X 1\\\\n\\\"):\\n print \\\"Compiler not found, skipping C extensions.\\\"\\n return []\\n\\n # Extension modules to build.\\n exts = [\\n Extension(\\\"twisted.spread.cBanana\\\",\\n [\\\"twisted/spread/cBanana.c\\\"],\\n define_macros=builder.define_macros),\\n ]\\n\\n # urllib.unquote accelerator\\n exts.append( Extension(\\\"twisted.protocols._c_urlarg\\\",\\n [\\\"twisted/protocols/_c_urlarg.c\\\"],\\n define_macros=builder.define_macros) )\\n\\n if sys.platform == 'darwin':\\n exts.append(\\n Extension(\\\"twisted.internet.cfsupport\\\",\\n [\\\"twisted/internet/cfsupport/cfsupport.c\\\"],\\n extra_compile_args=['-w'],\\n extra_link_args=['-framework','CoreFoundation',\\n '-framework','CoreServices',\\n '-framework','Carbon'],\\n define_macros=builder.define_macros))\\n\\n if sys.platform == 'win32':\\n exts.append( Extension(\\\"twisted.internet.iocpreactor._iocp\\\",\\n [\\\"twisted/internet/iocpreactor/_iocp.c\\\"],\\n libraries=[\\\"ws2_32\\\", \\\"mswsock\\\"],\\n define_macros=builder.define_macros))\\n\\n return exts\",\n \"def KengeLibrary(self, name, buildname=None, source = None, public_headers = None, **kargs):\\n library_args = {}\\n\\n library_args[\\\"CPPPATH\\\"] = []\\n\\n if buildname is None:\\n buildname = name\\n\\n if source is None:\\n # User didn't provide any source files\\n # explicitly, so we work out it form them\\n # based on some hueristics.\\n glob_list = []\\n dirs = [\\\"include/interfaces/\\\", \\\"src/\\\", \\\"src/arch-%s/\\\" % env.arch]\\n\\t if self.test_lib == name:\\n\\t\\tdirs.append(\\\"test/\\\")\\n if self[\\\"BUILD_TESTS\\\"]:\\n dirs += [\\\"test/\\\"]\\n for src_ext in env.src_exts:\\n for dir_ in dirs:\\n glob_list.append(dir_ + \\\"*.\\\" + src_ext)\\n else:\\n glob_list = source\\n\\n libs = []\\n \\n if \\\"LIBS\\\" in kargs:\\n if self[\\\"BUILD_TESTS\\\"]:\\n kargs[\\\"LIBS\\\"].append(\\\"check\\\")\\n for lib in kargs[\\\"LIBS\\\"]:\\n libs.append(lib)\\n if lib not in self.libs.keys():\\n raise SCons.Errors.UserError, \\\"Library [%s] was looking for library [%s] but it doesn't exist \\\" \\\\\\n \\\"in environment [%s]\\\\n This environment has: %s\\\" % (name, lib, self.name, self.libs.keys())\\n\\n del kargs[\\\"LIBS\\\"]\\n\\n # He we expand the glob to a list of files\\n source_list = Flatten([src_glob(glob) for glob in glob_list])\\n\\n idl_files = [fn for fn in source_list if fn.endswith(\\\".idl4\\\")]\\n reg_files = [fn for fn in source_list if fn.endswith(\\\".reg\\\")]\\n\\n # Now we go through everything in the kargs:\\n for arg in kargs:\\n if arg.startswith(\\\"EXTRA_\\\"):\\n argname = arg[6:]\\n library_args[argname] = self[argname] + kargs[arg]\\n else:\\n library_args[arg] = kargs[arg]\\n\\n # Generally this is the only public headers\\n if public_headers is None:\\n public_headers = [\\\"#libs/%s/include\\\" % name, \\\"#libs/%s/test\\\" % name]\\n\\n if len(idl_files) or len(reg_files):\\n # Unless we have generated files\\n public_headers.append(Dir(\\\".\\\").abspath + \\\"/include\\\")\\n\\n # Now if we are for real compiling stuff...\\n cpp_path = copy.copy(self[\\\"CPPPATH\\\"])\\n\\tif self.test_lib:\\n\\t\\tcpp_path.append(\\\"#libs/check/include\\\")\\n \\n # Make sure we include any of the libraries header file's\\n for each in public_headers:\\n cpp_path.append(each)\\n\\n # This ensure that any generated header files\\n # Maybe move this somewhere else later though\\n cpp_path.append(Dir('.').abspath + \\\"/src\\\") # Broken\\n cpp_path.append(Dir('.').abspath + \\\"/include\\\")\\n\\n # Find any .idl4 files that should be generated\\n for file in idl_files:\\n gen_file = self.IDL4(file)\\n\\n # Generate any .reg files\\n for file in reg_files:\\n self.Reg(file)\\n \\n library_args[\\\"CPPPATH\\\"] += cpp_path + self.end_cpp_path # End cpp_path is a hack hack hack!\\n \\n # Now we just call the normal StaticLibrary with our simple defaults\\n lib = self.StaticLibrary(buildname, source_list, **library_args)\\n\\n assert(len(lib) == 1)\\n lib = lib[0]\\n\\n if self[\\\"FLINT_RUN\\\"]:\\n for each in lib.children():\\n if str(each).endswith(\\\".o\\\"):\\n if str(each.children()[0]).endswith(\\\".c\\\") or \\\\\\n str(each.children()[0]).endswith(\\\".cc\\\"):\\n self.AddPreAction(each, \\\"$FLINTCOM\\\")\\n\\n # And construct our definition of the library\\n # This should suck muhc much less... how about a class?\\n lib = (public_headers, lib, \\\"#\\\" + os.path.dirname(lib.path), None, libs)\\n return lib\",\n \"def try_lib_load():\\n # If we are building the documentation, then we abort the import\\n rtd_build_environ = 'PYGORPHO_BUILD_READTHEDOCS'\\n if rtd_build_environ in os.environ:\\n import warnings\\n warnings.warn('Environment variable {} exists - we assume '\\n 'documentation is being built and are aborting the '\\n 'import'.format(rtd_build_environ))\\n return _DummyLib(), __file__\\n\\n path_candidates = []\\n # If PYGORPHO_PATH was set we start looking there\\n if os.getenv('PYGORPHO_PATH') is not None:\\n path_candidates.append(os.path.abspath(os.getenv('PYGORPHO_PATH')))\\n # Look in the dir. where this python file is placed\\n path_candidates.append(os.path.dirname(__file__))\\n # Look in dir. one level up from current file dir.\\n path_candidates.append(os.path.dirname(path_candidates[-1]))\\n # Start looking\\n for path in path_candidates:\\n try:\\n if platform.system() == 'Windows':\\n lib = ctl.load_library('pygorpho', path)\\n else:\\n lib = ctl.load_library('libpygorpho', path)\\n # Load was successful, so return path and lib now\\n return lib, path\\n except OSError:\\n # Lib was not here so move on...\\n pass\\n else:\\n raise ImportError('could not find pygorpho dynamic library file '\\n '(try setting PYGORPHO_PATH environment variable)')\",\n \"def is_library_installed(name):\\n\\n return __item_installed(name, dtf.core.item.TYPE_LIBRARY)\",\n \"def AddLibrary(self, lib, buildname=None, **kargs):\\n \\n if buildname is None:\\n buildname = lib\\n lib_builddir = \\\"%s/%s/libs/%s\\\" % (self.builddir, self.name, buildname)\\n\\n # We export \\\"env\\\" and \\\"args\\\" to the library build file\\n env = self\\n Export(\\\"env\\\")\\n args = kargs\\n Export(\\\"args\\\")\\n args[\\\"buildname\\\"] = buildname\\n # We call the libraries SConstruct file to build it.\\n #if self.headers_only:\\n # self.cpp_path += SConscript(\\\"libs/%s/SConstruct\\\" % lib, build_dir=lib_builddir, duplicate=0)\\n #else:\\n self.libs[buildname] = SConscript(\\\"libs/%s\\\" % lib, build_dir=lib_builddir, duplicate=0)\\n #self[\\\"_EXTRA_CPPPATH\\\"] += \\n self[\\\"CPPPATH\\\"] += self.libs[buildname][0]\\n return self.libs[buildname]\",\n \"def extra_link_args(self):\\n\\n status, stdout, stderr = self.__xcall__(['--libs-only-other'])\\n\\n if status != 0:\\n raise RuntimeError(\\\"error querying --libs-only-other for package `%s': %s\\\" % (self.name, stderr))\\n\\n return stdout.strip().split()\",\n \"def is_library(code):\\n return 3000 <= code <= 3999\",\n \"def _is_installed(self):\\n header = self._system.file_exists(\\\"curl.h\\\", os.path.join(self.get_install_path(), \\n \\\"include/curl\\\"))\\n lib = self._system.library_exists(\\\"libcurl\\\", os.path.join(self.get_install_path(), \\\"lib\\\"))\\n config = self._system.file_exists(\\\"curl-config\\\", os.path.join(self.get_install_path(), \\\"bin\\\"))\\n return header and lib and config\",\n \"def test_build_system_flags_not_implemented(self, temp_env):\\n s = spack.spec.Spec(\\\"mpileaks cppflags=-g\\\").concretized()\\n s.package.flag_handler = build_system_flags\\n try:\\n spack.build_environment.setup_package(s.package, False)\\n assert False\\n except NotImplementedError:\\n assert True\",\n \"def check_system_dependencies():\\n out_info(\\\"Checking System Dependencies...\\\")\\n check_cmake()\\n if OS_VERSION[0] == \\\"Windows\\\":\\n check_visual_studio()\\n check_cplus_plus()\\n if OS_VERSION[0] == \\\"Linux\\\":\\n check_gcc()\\n check_gpp()\",\n \"def _set_syslibs(\\n target, fc=\\\"gfortran\\\", cc=\\\"gcc\\\", argv=True, osname=None, verbose=False\\n):\\n # get lower case OS string\\n if osname is None:\\n osname = _get_osname()\\n\\n # remove target .exe extension, if necessary\\n target = _get_base_app_name(target)\\n\\n # remove .exe extension of necessary\\n if fc is not None:\\n fc = _get_base_app_name(fc)\\n if cc is not None:\\n cc = _get_base_app_name(cc)\\n\\n # initialize syslibs\\n syslibs = []\\n\\n # determine if default syslibs will be defined\\n default_syslibs = True\\n if osname == \\\"win32\\\":\\n if fc is not None:\\n if fc in [\\\"ifort\\\", \\\"gfortran\\\"]:\\n default_syslibs = False\\n if default_syslibs:\\n if cc is not None:\\n if cc in [\\\"cl\\\", \\\"icl\\\", \\\"gcc\\\", \\\"g++\\\"]:\\n default_syslibs = False\\n\\n if verbose:\\n print(\\\"\\\\nosname: \\\", osname)\\n print(\\\"fc: \\\", fc)\\n print(\\\"cc: \\\", cc)\\n print(\\\"default: {}\\\\n\\\".format(default_syslibs))\\n\\n # set default syslibs\\n if default_syslibs:\\n syslibs.append(\\\"-lc\\\")\\n\\n # add additional syslibs for select programs\\n if target == \\\"triangle\\\":\\n if osname in [\\\"linux\\\", \\\"darwin\\\"]:\\n if fc is None:\\n lfc = True\\n else:\\n lfc = fc.startswith(\\\"g\\\")\\n lcc = False\\n if cc in [\\\"gcc\\\", \\\"g++\\\", \\\"clang\\\", \\\"clang++\\\"]:\\n lcc = True\\n if lfc and lcc:\\n syslibs += [\\\"-lm\\\"]\\n elif target == \\\"gsflow\\\":\\n if \\\"win32\\\" not in osname:\\n if \\\"ifort\\\" in fc:\\n syslibs += [\\\"-nofor_main\\\"]\\n\\n # add additional syslibs from the command line\\n if argv:\\n for idx, arg in enumerate(sys.argv):\\n if \\\"--syslibs\\\" in arg.lower():\\n s = sys.argv[idx + 1]\\n delim = \\\" -\\\"\\n if \\\" /\\\" in s:\\n delim = \\\" /\\\"\\n syslibs += s.split(delim)\\n\\n # write syslibs\\n if verbose:\\n msg = \\\"{} will use the following predefined syslibs:\\\\n\\\".format(target)\\n msg += \\\" '{}'\\\\n\\\".format(\\\" \\\".join(syslibs))\\n print(msg)\\n\\n return syslibs\",\n \"def test_config_have_biopython():\\n assert core.HAVE_BIOPYTHON\\n args = Namespace(extended_validation='all')\\n config = core.Config.from_args(args)\\n assert config.extended_validation == 'all'\",\n \"def check(self, quiet=False, exclude=None):\\n\\n exclude = exclude if exclude else []\\n missing = set()\\n pkg_types = set()\\n python_interpreters = set()\\n vcs_types = set()\\n\\n # package-defined requirements check\\n for pkg in self.pkgs:\\n if pkg.type not in exclude:\\n pkg_types.add(pkg.type)\\n if pkg.vcs_type not in exclude:\\n vcs_types.add(pkg.vcs_type)\\n\\n if pkg.type == PackageType.AUTOTOOLS:\\n if pkg.autotools_autoreconf:\\n if AUTORECONF_COMMAND not in exclude:\\n if AUTORECONF.exists():\\n self._verbose_exists(AUTORECONF)\\n else:\\n missing.add(AUTORECONF.tool)\\n\\n elif pkg.type == PackageType.PYTHON:\\n if pkg.python_interpreter:\\n if pkg.python_interpreter not in exclude:\\n python_tool = PythonTool(pkg.python_interpreter)\\n python_interpreters.add(python_tool)\\n else:\\n python_interpreters.add(PYTHON)\\n\\n if PackageType.AUTOTOOLS in pkg_types or PackageType.MAKE in pkg_types:\\n if MAKE.exists():\\n self._verbose_exists(MAKE)\\n else:\\n missing.add(MAKE.tool)\\n\\n if PackageType.CMAKE in pkg_types:\\n if CMAKE.exists():\\n self._verbose_exists(CMAKE)\\n else:\\n missing.add(CMAKE.tool)\\n\\n if PackageType.MESON in pkg_types:\\n if MESON.exists():\\n self._verbose_exists(MESON)\\n else:\\n missing.add(MESON.tool)\\n\\n if PackageType.PYTHON in pkg_types:\\n for interpreter in python_interpreters:\\n if interpreter.exists():\\n self._verbose_exists(interpreter)\\n else:\\n missing.add(interpreter.tool)\\n\\n if PackageType.SCONS in pkg_types:\\n if SCONS.exists():\\n self._verbose_exists(SCONS)\\n else:\\n missing.add(SCONS.tool)\\n\\n if VcsType.BZR in vcs_types:\\n if BZR.exists():\\n self._verbose_exists(BZR)\\n else:\\n missing.add(BZR.tool)\\n\\n if VcsType.CVS in vcs_types:\\n if CVS.exists():\\n self._verbose_exists(CVS)\\n else:\\n missing.add(CVS.tool)\\n\\n if VcsType.GIT in vcs_types:\\n if GIT.exists():\\n self._verbose_exists(GIT)\\n else:\\n missing.add(GIT.tool)\\n\\n if VcsType.HG in vcs_types:\\n if HG.exists():\\n self._verbose_exists(HG)\\n else:\\n missing.add(HG.tool)\\n\\n if VcsType.PERFORCE in vcs_types:\\n if GIT.exists():\\n self._verbose_exists(GIT)\\n else:\\n missing.add(GIT.tool)\\n\\n if VcsType.RSYNC in vcs_types:\\n if RSYNC.exists():\\n self._verbose_exists(RSYNC)\\n else:\\n missing.add(RSYNC.tool)\\n\\n if VcsType.SCP in vcs_types:\\n if SCP.exists():\\n self._verbose_exists(SCP)\\n else:\\n missing.add(SCP.tool)\\n\\n if VcsType.SVN in vcs_types:\\n if SVN.exists():\\n self._verbose_exists(SVN)\\n else:\\n missing.add(SVN.tool)\\n\\n # project-provided tools check\\n for tool in self.tools:\\n if tool not in exclude:\\n if which(tool):\\n verbose('prerequisite exists: ' + tool)\\n else:\\n missing.add(tool)\\n\\n if missing and not quiet:\\n sorted_missing = list(missing)\\n sorted_missing.sort()\\n\\n msg = 'missing the following host tools for this project:'\\n msg += '\\\\n'\\n msg += '\\\\n'\\n for entry in sorted_missing:\\n msg += ' ' + entry + '\\\\n'\\n err(msg)\\n\\n return len(missing) == 0\",\n \"def is_library_installed(name):\\n\\n return pm.is_library_installed(name)\",\n \"def find_libca():\\n # Test 1: if PYEPICS_LIBCA env var is set, use it.\\n dllpath = os.environ.get('PYEPICS_LIBCA', None)\\n if (dllpath is not None and os.path.exists(dllpath) and\\n os.path.isfile(dllpath)):\\n return dllpath\\n\\n # Test 2: look through Python path and PATH env var for dll\\n path_sep = ':'\\n dylib = 'lib'\\n # For windows, we assume the DLLs are installed with the library\\n if os.name == 'nt':\\n path_sep = ';'\\n dylib = 'DLLs'\\n\\n _path = [os.path.split(os.path.abspath(__file__))[0],\\n os.path.split(os.path.dirname(os.__file__))[0],\\n os.path.join(sys.prefix, dylib)]\\n\\n search_path = []\\n for adir in (_path + sys.path +\\n os.environ.get('PATH','').split(path_sep) +\\n os.environ.get('LD_LIBRARY_PATH','').split(path_sep) +\\n os.environ.get('DYLD_LIBRARY_PATH','').split(path_sep)):\\n if adir not in search_path and os.path.isdir(adir):\\n search_path.append(adir)\\n\\n os.environ['PATH'] = path_sep.join(search_path)\\n\\n # with PATH set above, the ctypes utility, find_library *should*\\n # find the dll....\\n dllpath = ctypes.util.find_library('ca')\\n if dllpath is not None:\\n return dllpath\\n\\n # Test 3: on unixes, look expliticly with EPICS_BASE env var and\\n # known architectures for ca.so q\\n if os.name == 'posix':\\n known_hosts = {'Linux': ('linux-x86', 'linux-x86_64') ,\\n 'Darwin': ('darwin-ppc', 'darwin-x86'),\\n 'SunOS': ('solaris-sparc', 'solaris-sparc-gnu') }\\n\\n libname = 'libca.so'\\n if sys.platform == 'darwin':\\n libname = 'libca.dylib'\\n\\n epics_base = os.environ.get('EPICS_BASE', '.')\\n host_arch = os.uname()[0]\\n if host_arch in known_hosts:\\n epicspath = []\\n for adir in known_hosts[host_arch]:\\n epicspath.append(os.path.join(epics_base, 'lib', adir))\\n for adir in search_path + epicspath:\\n if os.path.exists(adir) and os.path.isdir(adir):\\n if libname in os.listdir(adir):\\n return os.path.join(adir, libname)\\n\\n raise ChannelAccessException('cannot find Epics CA DLL')\",\n \"def exists():\\n return PYTHON_VERSION is not None\",\n \"def should_build_ib():\\n ib_util_found = False\\n ib_lib_found = False\\n ib_header_found = False\\n\\n try:\\n # If the command doesn't exist, we can directly return instead of\\n # making a subprocess call\\n full_cmd_path = get_command_path(IB_DEVINFO_CMD)\\n if not full_cmd_path:\\n ib_util_found = False\\n subprocess.check_output([full_cmd_path, \\\"--list\\\"])\\n # Here we just would like to simply run the command to test if IB\\n # related tools / lib are installed without parsing the output. We\\n # will enable IB build as long as the command runs successfully.\\n #\\n # The output should look like either:\\n #\\n # > ibv_devinfo --list\\n # 0 HCAs founds:\\n #\\n # or\\n #\\n # > ibv_devinfo --list\\n # 4 HCAs found:\\n # mlx5_3\\n # mlx5_2\\n # mlx5_1\\n # mlx5_0\\n ib_util_found = True\\n except Exception:\\n # We just take all the exceptions here without affecting the build\\n ib_util_found = False\\n\\n lib_paths = list(filter(bool, [\\n \\\"/usr/lib/\\\",\\n \\\"/usr/lib/x86_64-linux-gnu/\\\",\\n \\\"/usr/lib/powerpc64le-linux-gnu/\\\",\\n \\\"/usr/lib/aarch64-linux-gnu/\\\",\\n ] + gather_paths([\\n \\\"LIBRARY_PATH\\\",\\n ]) + gather_paths([\\n \\\"LD_LIBRARY_PATH\\\",\\n ])))\\n\\n include_paths = [\\n \\\"/usr/include/\\\",\\n ]\\n\\n if IS_CONDA:\\n lib_paths.append(os.path.join(CONDA_DIR, \\\"lib\\\"))\\n include_paths.append(os.path.join(CONDA_DIR, \\\"include\\\"))\\n\\n for path in lib_paths:\\n if path is None or not os.path.exists(path):\\n continue\\n ib_libraries = sorted(glob.glob(os.path.join(path, \\\"libibverbs*\\\")))\\n if ib_libraries:\\n ib_lib_found = True\\n break\\n\\n for path in include_paths:\\n if path is None or not os.path.exists(path):\\n continue\\n if os.path.exists(os.path.join(path, \\\"infiniband/verbs.h\\\")):\\n ib_header_found = True\\n break\\n\\n return ib_util_found and ib_lib_found and ib_lib_found\",\n \"def exists(env):\\n java_exists = env.Detect('java')\\n jsrun_exists = env.Detect('$JSDOC_JSRUN')\\n run_exists = env.Detect('$JSDOC_RUN')\\n return (java_exists and jsrun_exists and run_exists)\",\n \"def is_cxx_compiler():\\n\\n wrapper_command = os.path.basename(sys.argv[0])\\n return re.match(r'(.+)c\\\\+\\\\+(.*)', wrapper_command)\",\n \"def toolHasOptions(*args, **kwargs)->bool:\\n pass\",\n \"def flags_compile(local_cflags, local_ldflags):\\n return compile_test(source, args.compiler,\\n \\\" \\\".join([\\\"-Werror\\\"] + local_cflags),\\n \\\" \\\".join(local_ldflags))\",\n \"def test_libs_config(self):\\n libs = [l for l in os.listdir(framework_libs_dir()) if l != 'libs.conf']\\n self.assertTrue(sorted(libs), sorted(self.conf.options('libs')))\",\n \"def check_pycurl_installed(func):\\n\\n def inner(*args, **kwargs): # pylint: disable=inconsistent-return-statements\\n if pycurl is None:\\n return\\n return func(*args, **kwargs)\\n\\n return inner\",\n \"def ldflags(libs=True, flags=False, libs_dir=False, include_dir=False):\\r\\n rval = []\\r\\n if libs_dir:\\r\\n found_dyn = False\\r\\n dirs = [x[2:] for x in config.blas.ldflags.split()\\r\\n if x.startswith('-L')]\\r\\n l = ldflags()\\r\\n for d in dirs:\\r\\n for f in os.listdir(d):\\r\\n if (f.endswith('.so') or f.endswith('.dylib') or\\r\\n f.endswith('.dll')):\\r\\n if any([f.find(ll) >= 0 for ll in l]):\\r\\n found_dyn = True\\r\\n if not found_dyn and dirs:\\r\\n _logger.warning(\\\"We did not found a dynamic library into the \\\"\\r\\n \\\"library_dir of the library we use for blas. If you use \\\"\\r\\n \\\"ATLAS, make sure to compile it with dynamics library.\\\")\\r\\n\\r\\n for t in config.blas.ldflags.split():\\r\\n #Remove extra quote.\\r\\n if t.startswith(\\\"'\\\") or t.startswith('\\\"'):\\r\\n t = t[1:]\\r\\n if t.endswith(\\\"'\\\") or t.endswith('\\\"'):\\r\\n t = t[:-1]\\r\\n\\r\\n try:\\r\\n t0, t1, t2 = t[0:3]\\r\\n assert t0 == '-'\\r\\n except Exception:\\r\\n raise ValueError('invalid token in config.blas.ldflags', t)\\r\\n if libs_dir and t1 == 'L':\\r\\n rval.append(t[2:])\\r\\n elif include_dir and t1 == 'I':\\r\\n raise ValueError('Include dirs are not used for blas. We disable'\\r\\n ' this as this can hide other headers and this'\\r\\n ' is not wanted.', t)\\r\\n rval.append(t[2:])\\r\\n elif libs and t1 == 'l': # example -lmkl\\r\\n rval.append(t[2:])\\r\\n elif flags and t1 not in ['L', 'I', 'l']: # example -openmp\\r\\n rval.append(t)\\r\\n elif flags and t1 == 'L':\\r\\n #to find it when we load the compiled op if the env of the\\r\\n #used is not well configured.\\r\\n rval.append('-Wl,-rpath,' + t[2:])\\r\\n return rval\",\n \"def check_packages(packages, namespace=None, language=\\\"python\\\", import_into_backend=False, verbose=False):\\n # Force packages into sorted non-redundant list\\n if isinstance(packages,(str, tuple)):\\n packages = [packages]\\n packages = set(packages)\\n\\n # Set up decorator for Python imports\\n if language.lower() == \\\"python\\\":\\n import_package = importlib.import_module\\n importing_error = ImportError\\n # Set up decorator for R imports\\n if language.lower() == \\\"r\\\":\\n try:\\n import rpy2\\n except ImportError:\\n raise Exception(\\\"Please install 'rpy2' to import R packages\\\")\\n from rpy2.robjects.packages import importr\\n from rpy2 import __version__ as rpy2_version\\n rpy2_version_major = int(rpy2_version.split(\\\".\\\")[0])\\n assert rpy2_version_major > 1, \\\"Please update your rpy2 version\\\"\\n if rpy2_version_major == 2:\\n from rpy2.rinterface import RRuntimeError\\n importing_error = RRuntimeError\\n if rpy2_version_major == 3:\\n # from rpy2.rinterface_lib.embedded import RRuntimeError\\n from rpy2.robjects.packages import PackageNotInstalledError\\n importing_error = PackageNotInstalledError\\n import_package = importr\\n\\n # Wrapper\\n def decorator(func):\\n @functools.wraps(func)\\n def wrapper(*args, **kwargs):\\n missing_packages = []\\n for pkg in packages:\\n if isinstance(pkg, tuple):\\n assert len(pkg) == 2, \\\"If a package is tuple type then it must have 2 elements e.g. ('numpy', 'np')\\\"\\n pkg_name, pkg_variable = pkg\\n else:\\n pkg_name = pkg_variable = pkg \\n try:\\n package = import_package(pkg_name)\\n if import_into_backend:\\n globals()[pkg_variable] = package\\n if namespace is not None:\\n namespace[pkg_variable] = package\\n if verbose:\\n print(\\\"Importing {} as {}\\\".format(pkg_name, pkg_variable), True, file=sys.stderr)\\n except importing_error:\\n missing_packages.append(pkg_name)\\n if verbose:\\n print(\\\"Cannot import {}:\\\".format(pkg_name), False, file=sys.stderr)\\n assert not missing_packages, \\\"Please install the following {} packages to use this function:\\\\n{}\\\".format(language.capitalize(), \\\", \\\".join(missing_packages))\\n return func(*args, **kwargs)\\n\\n return wrapper\\n return decorator\",\n \"def IsClangWinBuild(build_dir, target):\\n if not IsWindows():\\n return False\\n\\n gn_file = os.path.join(build_dir, target, 'args.gn')\\n if not os.path.isfile(gn_file):\\n print 'WARNING: Unable to find the args.gn file.'\\n return False\\n # Matches e.g. \\\"gn_arg = value\\\"\\n gn_arg_re = re.compile(r'^(?P<flag>[^= ]+)\\\\s*=\\\\s*(?P<value>[^ \\\\n]+)$')\\n for line in open(gn_file):\\n m = gn_arg_re.match(line)\\n if m and m.group('flag') == 'is_clang':\\n return m.group('value') == 'true'\\n return False\",\n \"def add_installed_libraries(self, extra_libs = [\\\"SeleniumLibrary\\\",\\n \\\"SudsLibrary\\\",\\n \\\"RequestsLibrary\\\"]):\\n\\n libdir = os.path.dirname(robot.libraries.__file__)\\n loaded = []\\n for filename in os.listdir(libdir):\\n if filename.endswith(\\\".py\\\") or filename.endswith(\\\".pyc\\\"):\\n libname, ext = os.path.splitext(filename)\\n if (libname.lower() not in loaded and\\n not self._should_ignore(libname)):\\n\\n try:\\n self.add(libname)\\n loaded.append(libname.lower())\\n except Exception as e:\\n # need a better way to log this...\\n self.log.debug(\\\"unable to add library: \\\" + str(e))\\n\\n # I hate how I implemented this, but I don't think there's\\n # any way to find out which installed python packages are\\n # robot libraries.\\n for library in extra_libs:\\n if (library.lower() not in loaded and\\n not self._should_ignore(library)):\\n try:\\n self.add(library)\\n loaded.append(library.lower())\\n except Exception as e:\\n self.log.debug(\\\"unable to add external library %s: %s\\\" % \\\\\\n (library, str(e)))\",\n \"def check_requirements():\\n process_output = subprocess.check_output([sys.executable, '-m', 'pip', 'freeze'])\\n installed_packages = [r.decode().split('==')[0] for r in process_output.split()]\\n if 'pandas' and 'matplotlib' in installed_packages:\\n return True\\n else:\\n print('You don`t have one of required libralies\\\\n'\\n 'I can`t create histogram\\\\n'\\n 'Required libralies: \\\\n'\\n '->pandas\\\\n'\\n '->matplotlib\\\\n')\\n return False\",\n \"def is_libpsp():\\n return __is_libpsp__\",\n \"def _c_optimizations_ignored():\\n pure_env = os.environ.get('PURE_PYTHON')\\n return pure_env != \\\"0\\\" if pure_env is not None else PYPY\",\n \"def install_langkit_support(args: Namespace) -> None:\\n base_argv = [\\n \\\"gprinstall\\\", \\\"-P\\\", SUPPORT_GPR, \\\"-p\\\",\\n f\\\"-XBUILD_MODE={args.build_mode}\\\",\\n f\\\"--prefix={args.prefix}\\\",\\n \\\"--build-var=LIBRARY_TYPE\\\",\\n \\\"--build-var=LANGKIT_SUPPORT_LIBRARY_TYPE\\\",\\n \\\"--sources-subdir=include/langkit_support\\\"\\n ]\\n if args.build_dir:\\n base_argv.extend([f\\\"--relocate-build-tree={args.build_dir}\\\"])\\n\\n # Install the static libraries first, so that in the resulting project\\n # files, \\\"static\\\" is the default library type.\\n lib_types = [l.value for l in args.library_types]\\n for library_type in (\\\"static\\\", \\\"static-pic\\\", \\\"relocatable\\\"):\\n if library_type in lib_types:\\n subprocess.check_call(base_argv + [\\n f\\\"-XLIBRARY_TYPE={library_type}\\\",\\n f\\\"--build-name={library_type}\\\"\\n ])\",\n \"def has_source(self):\\n return any(map(utils.assert_package_is_source, self.pkg_arguments))\",\n \"def is_installed(cls, language=None):\\n if language == 'python':\\n return True\\n return False\",\n \"def is_installed():\\n # type: () -> bool\\n try:\\n # noinspection PyUnresolvedReferences\\n from ccurl import Curl as CCurl\\n except ImportError:\\n return False\\n else:\\n # noinspection PyUnresolvedReferences\\n from iota.crypto import Curl\\n return issubclass(Curl, CCurl)\",\n \"def _check_deseq_args(self, arg_libs, conditions):\\n if len(arg_libs) != len(conditions):\\n self._write_err_msg_and_quit(\\n \\\"Error - The read library file list and condition list must \\\"\\n \\\"have the same number of elements. You entered \\\\n%s \\\"\\n \\\"(= %s elements)\\\\nand \\\\n%s (= %s elements).\\\\n\\\"\\n % (\\n self._args.libs,\\n len(arg_libs),\\n self._args.conditions,\\n len(conditions),\\n )\\n )\\n raw_stat_data_reader = RawStatDataReader()\\n alignment_stats = [\\n raw_stat_data_reader.read(\\n self._pathcreator.read_alignments_stats_path\\n )\\n ]\\n lib_names = list(alignment_stats[0].keys())\\n if len(lib_names) != len(arg_libs):\\n self._write_err_msg_and_quit(\\n \\\"The number of read libraries is lower or higher than \\\"\\n \\\"expected. The following read libs are available: %s\\\\nThe \\\"\\n 'following read list string is suggested: \\\"%s\\\"\\\\n'\\n % (\\\", \\\".join(lib_names), \\\",\\\".join(lib_names))\\n )\\n for lib in lib_names:\\n if lib not in arg_libs:\\n self._write_err_msg_and_quit(\\n 'The library \\\"%s\\\" is not present in your list of '\\n \\\"libraries. Please add it.\\\\n\\\" % (lib)\\n )\",\n \"def _check_libgmt(libgmt):\\n # Check if a few of the functions we need are in the library\\n functions = ['Create_Session', 'Get_Enum', 'Call_Module',\\n 'Destroy_Session']\\n for func in functions:\\n if not hasattr(libgmt, 'GMT_' + func):\\n msg = ' '.join([\\n \\\"Error loading libgmt.\\\",\\n \\\"Couldn't access function GMT_{}.\\\".format(func),\\n ])\\n raise GMTCLibError(msg)\",\n \"def _is_installed(self):\\n return self._system.is_library(os.path.join(self.get_install_path(), \\\"lib/libG4event\\\")) or \\\\\\n self._system.is_library(os.path.join(self.get_install_path(), \\\"lib64/libG4event\\\"))\",\n \"def load_library(name):\\n with _stderr_capture() as err:\\n gSystem = gbl.gSystem\\n if name[:3] != 'lib':\\n if not gSystem.FindDynamicLibrary(gbl.CppyyLegacy.TString(name), True) and\\\\\\n gSystem.FindDynamicLibrary(gbl.CppyyLegacy.TString('lib'+name), True):\\n name = 'lib'+name\\n sc = gSystem.Load(name)\\n if sc == -1:\\n raise RuntimeError('Unable to load library \\\"%s\\\"%s' % (name, err.err))\\n return True\",\n \"def has_extras(self):\\n return any(map(utils.assert_package_has_extras, self.pkg_arguments))\",\n \"def sanity_check_step(self):\\n\\n dirs = [os.path.join('include', 'gromacs')]\\n\\n # in GROMACS v5.1, only 'gmx' binary is there\\n # (only) in GROMACS v5.0, other binaries are symlinks to 'gmx'\\n bins = []\\n libnames = []\\n if LooseVersion(self.version) < LooseVersion('5.1'):\\n bins.extend(['editconf', 'g_lie', 'genbox', 'genconf', 'mdrun'])\\n\\n if LooseVersion(self.version) >= LooseVersion('5.0'):\\n bins.append('gmx')\\n libnames.append('gromacs')\\n if LooseVersion(self.version) < LooseVersion('5.1') and self.toolchain.options.get('usempi', None):\\n bins.append('mdrun')\\n else:\\n libnames.extend(['gmxana', 'gmx', 'md'])\\n # note: gmxpreprocess may also already be there for earlier versions\\n if LooseVersion(self.version) > LooseVersion('4.6'):\\n libnames.append('gmxpreprocess')\\n\\n # also check for MPI-specific binaries/libraries\\n if self.toolchain.options.get('usempi', None):\\n if LooseVersion(self.version) < LooseVersion('4.6'):\\n mpisuff = self.cfg['mpisuffix']\\n else:\\n mpisuff = '_mpi'\\n\\n bins.extend([binary + mpisuff for binary in bins])\\n libnames.extend([libname + mpisuff for libname in libnames])\\n\\n suff = ''\\n # add the _d suffix to the suffix, in case of the double precission\\n if re.search('DGMX_DOUBLE=(ON|YES|TRUE|Y|[1-9])', self.cfg['configopts'], re.I):\\n suff = '_d'\\n\\n libs = ['lib%s%s.%s' % (libname, suff, self.libext) for libname in libnames]\\n\\n # pkgconfig dir not available for earlier versions, exact version to use here is unclear\\n if LooseVersion(self.version) >= LooseVersion('4.6'):\\n dirs.append(os.path.join(self.lib_subdir, 'pkgconfig'))\\n\\n custom_paths = {\\n 'files': [os.path.join('bin', b + suff) for b in bins] + [os.path.join(self.lib_subdir, l) for l in libs],\\n 'dirs': dirs,\\n }\\n super(EB_GROMACS, self).sanity_check_step(custom_paths=custom_paths)\",\n \"def add_library(command):\\n from src.praxxis.library import list_library\\n\\n namespace = app.main(command)\\n assert namespace.command == 'al' or namespace.command == \\\"addlibrary\\\"\\n assert namespace.path == \\\"test\\\"\",\n \"def _c_optimizations_available(module_name):\\n import importlib\\n catch = () if _c_optimizations_required() else (ImportError,)\\n try:\\n return importlib.import_module('BTrees._' + module_name)\\n except catch: # pragma: no cover\\n return False\",\n \"def is_shared_lib(lib):\\n dump = AIXDumpExtractor.find_tool()\\n if dump is None:\\n print(\\\"ERROR: Could not find dump\\\")\\n sys.exit(1)\\n cmd = [dump, '-X32_64', '-ov', lib]\\n out = subprocess.check_output(cmd).decode()\\n return out.find(\\\"SHROBJ\\\") != -1\",\n \"def HAS(strArg, composList, atomDict):\\n splitArgs = strArg.split(',')\\n if len(splitArgs) > 1:\\n for atom, _ in composList:\\n tStr = splitArgs[0].replace('DEADBEEF', atom)\\n where = eval(tStr)\\n what = eval(splitArgs[1])\\n if what in where:\\n return 1\\n return 0\\n else:\\n return -666\",\n \"def _PostParseCheck(options):\\n if options.local_pkg_path and not os.path.isfile(options.local_pkg_path):\\n cros_build_lib.Die('%s is not a file.', options.local_pkg_path)\\n\\n if not options.gyp_defines:\\n gyp_env = os.getenv('GYP_DEFINES')\\n if gyp_env is not None:\\n options.gyp_defines = chrome_util.ProcessGypDefines(gyp_env)\\n logging.info('GYP_DEFINES taken from environment: %s',\\n options.gyp_defines)\\n\\n if not options.gn_args:\\n gn_env = os.getenv('GN_ARGS')\\n if gn_env is not None:\\n options.gn_args = gn_helpers.FromGNArgs(gn_env)\\n logging.info('GN_ARGS taken from environment: %s', options.gn_args)\\n\\n if not options.staging_flags:\\n use_env = os.getenv('USE')\\n if use_env is not None:\\n options.staging_flags = ' '.join(set(use_env.split()).intersection(\\n chrome_util.STAGING_FLAGS))\\n logging.info('Staging flags taken from USE in environment: %s',\\n options.staging_flags)\",\n \"def find_library(arguments):\\n\\n\\tpaths = {}\\n\\n\\t# find library\\n\\tif arguments.lib is not None:\\n\\t\\t# find from arguments\\n\\t\\tpaths['library'] = arguments.lib\\n\\n\\telse:\\n\\t\\t# find from environment\\n\\t\\ttry:\\n\\t\\t\\tpaths['library'] = os.environ['MPI_LIB']\\n\\n\\t\\texcept KeyError:\\n\\t\\t\\tprint 'MPI_LIB is not defined in the environment variables.'\\n\\t\\t\\tsys.exit(1)\\n\\n\\t# check existance of library file\\n\\tif not os.path.isdir(paths['library']):\\n\\t\\tprint paths['library'], ' is not a directory.'\\n\\t\\tsys.exit(3)\\n\\n\\tif arguments.inc is not None:\\n\\t\\t# find from arguments\\n\\t\\tpaths['include'] = arguments.inc\\n\\n\\telse:\\n\\t\\t# find from environment\\n\\t\\ttry:\\n\\t\\t\\tpaths['include'] = os.environ['MPI_INC']\\n\\n\\t\\texcept KeyError:\\n\\t\\t\\tprint 'MPI_INC is not defined in the environment variables.'\\n\\t\\t\\tsys.exit(2)\\n\\n\\t# check existance of include directory\\n\\tif not os.path.isdir(paths['include']):\\n\\t\\tprint paths['include'], ' is not a directory.'\\n\\t\\tsys.exit(4)\\n\\n\\treturn paths\",\n \"def _validate_built_in(self, tipo):\\n\\n self.source_type = False\\n self.source_file = \\\"builtin\\\"\\n return tipo in self.c_built_ins or self._match_array(tipo, self.c_built_in_array_types)\",\n \"def set_cxx_flags_hook(build_ext, ext):\\n cc = build_ext._cxx_compiler\\n args = ext.extra_compile_args\\n\\n std_flag = get_cxx_std_flag(cc)\\n if std_flag is not None:\\n args.append(std_flag)\\n\\n if sys.platform == 'darwin':\\n # Set min macOS version\\n min_macos_flag = '-mmacosx-version-min=10.9'\\n if has_flag(cc, min_macos_flag):\\n args.append(min_macos_flag)\\n ext.extra_link_args.append(min_macos_flag)\",\n \"def skip_if_no_ssl (func):\\n try:\\n import evy.patched.ssl\\n except ImportError:\\n try:\\n import evy.patched.OpenSSL\\n except ImportError:\\n skipped(func)\",\n \"def validate():\\n if not os.path.exists(os.path.join(ROOT, APP, '__init__.py')):\\n message = ansi.error() + ' Python module not found.'\\n if os.environ.get('LORE_APP') is None:\\n message += ' $LORE_APP is not set. Should it be different than \\\"%s\\\"?' % APP\\n else:\\n message += ' $LORE_APP is set to \\\"%s\\\". Should it be different?' % APP\\n sys.exit(message)\\n\\n if exists():\\n return\\n\\n if len(sys.argv) > 1:\\n command = sys.argv[1]\\n else:\\n command = 'lore'\\n sys.exit(\\n ansi.error() + ' %s is only available in lore '\\n 'app directories (missing %s)' % (\\n ansi.bold(command),\\n ansi.underline(VERSION_PATH)\\n )\\n )\",\n \"def is_jar_library(self):\\r\\n return self.has_label('jars')\",\n \"def _locate_gcc(self, format_for_stdlib_flag, use_stdlib_through_env_vars):\\n\\n # Artefacts built by all C++ compilers require link-time\\n # access to a C++ standard library, and often other libraries\\n # such as for OpenMP or sanitizers are typically installed\\n # alongside that standard library. So for gcc, we ensure that\\n # we link to components from the matching gcc version, rather\\n # than the system default gcc. For clang and icc, we link to a\\n # gcc specified for each build agent.\\n gcc_name=None\\n if self.compiler == Compiler.GCC:\\n gcc_name = self.c_compiler\\n elif self.compiler == Compiler.CLANG or self.compiler == Compiler.INTEL:\\n gcc_name = agents.get_default_gcc_for_libstdcxx(self._node_name)\\n\\n gcc_toolchain_path=None\\n if gcc_name:\\n gcc_exe = self._cmd_runner.find_executable(gcc_name)\\n if self.compiler != Compiler.GCC:\\n self.gcc_exe = gcc_exe\\n gcc_exe_dirname = os.path.dirname(gcc_exe)\\n gcc_toolchain_path = os.path.join(gcc_exe_dirname, '..')\\n\\n if gcc_toolchain_path:\\n if format_for_stdlib_flag and use_stdlib_through_env_vars:\\n stdlibflag=format_for_stdlib_flag.format(gcctoolchain=gcc_toolchain_path)\\n self.append_to_env_var('CFLAGS', stdlibflag)\\n self.append_to_env_var('CXXFLAGS', stdlibflag)\\n # Linker flag needed for all (#2846)\\n format_for_linker_flags=\\\"-Wl,-rpath,{gcctoolchain}/lib64 -L{gcctoolchain}/lib64\\\"\\n self.extra_cmake_options['CMAKE_CXX_LINK_FLAGS'] = format_for_linker_flags.format(gcctoolchain=gcc_toolchain_path)\",\n \"def test_override_builtin_extension_without_explicit_flag(self):\\n with self.assertRaises(ValueError):\\n PyLoader.register()\",\n \"def test_check_module(self) -> None:\\n check_module(\\\"os\\\")\",\n \"def _is_in_stdlib(module, some_object):\\n # Clear PYTHONPATH temporarily and try importing the given module.\\n original_sys_path = sys.path\\n lib_path = os.path.dirname(traceback.__file__)\\n sys.path = [lib_path]\\n\\n # On Mac, some extra library paths are required.\\n if 'darwin' in platform.system().lower():\\n for path in original_sys_path:\\n if 'site-packages' not in path:\\n sys.path.append(path)\\n\\n in_stdlib = False\\n\\n try:\\n module = importlib.import_module(module)\\n\\n if some_object:\\n getattr(module, some_object)\\n\\n in_stdlib = True\\n except (ImportError, AttributeError):\\n pass\\n\\n sys.path = original_sys_path\\n\\n return in_stdlib\",\n \"def is_file_ancillary(args):\\n # pylint: disable=bad-continuation\\n if (\\n # skip the parent check and only\\n # determine if the parameter is present\\n is_valid_exists(args, skip=True)\\n or is_valid_comments(args, skip=True)\\n or is_valid_paragraphs(args, skip=True)\\n or is_valid_words(args, skip=True)\\n ):\\n return True\\n return False\",\n \"def validate_use_http_wrapper(check):\\n has_failed = False\\n check_uses_http_wrapper = False\\n for file in get_check_files(check, include_tests=False):\\n if file.endswith('.py'):\\n file_uses_http_wrapper, file_uses_request_lib = validate_use_http_wrapper_file(file, check)\\n has_failed = has_failed or file_uses_request_lib\\n check_uses_http_wrapper = check_uses_http_wrapper or file_uses_http_wrapper\\n\\n if has_failed:\\n abort()\\n return check_uses_http_wrapper\",\n \"def library():\\n finder = LibraryFinder()\\n p = finder.find()\\n return p if p else ''\",\n \"def dependency_check(dependency_set=CORE, exit_on_failure=True):\\n verify_python_version()\\n \\n disable_warnings()\\n\\n platform = get_current_platform()\\n\\n #\\n # Check for missing python modules\\n #\\n failed_deps = []\\n pip_distributions = pip.get_installed_distributions()\\n \\n for w3af_req in platform.PIP_PACKAGES[dependency_set]:\\n for dist in pip_distributions:\\n if w3af_req.package_name.lower() == dist.project_name.lower():\\n\\n w3af_req_version = str(Version(w3af_req.package_version))\\n dist_version = str(dist.version)\\n\\n if w3af_req_version == dist_version:\\n # It's installed and the version matches!\\n break\\n else:\\n failed_deps.append(w3af_req)\\n\\n #\\n # Check for missing operating system packages\\n #\\n missing_os_packages = []\\n for os_package in platform.SYSTEM_PACKAGES[dependency_set]:\\n if not platform.os_package_is_installed(os_package):\\n missing_os_packages.append(os_package)\\n \\n os_packages = list(set(missing_os_packages))\\n\\n # All installed?\\n if not failed_deps and not os_packages:\\n # False means: do not exit()\\n enable_warnings()\\n return False\\n\\n generate_requirements_txt(failed_deps)\\n script_path = generate_helper_script(platform.PKG_MANAGER_CMD, os_packages,\\n platform.PIP_CMD, failed_deps)\\n\\n #\\n # Report the missing system packages\\n #\\n msg = ('w3af\\\\'s requirements are not met, one or more third-party'\\n ' libraries need to be installed.\\\\n\\\\n')\\n \\n if os_packages:\\n missing_pkgs = ' '.join(os_packages)\\n \\n msg += ('On %s systems please install the following operating'\\n ' system packages before running the pip installer:\\\\n'\\n ' %s %s\\\\n')\\n print(msg % (platform.SYSTEM_NAME, platform.PKG_MANAGER_CMD,\\n missing_pkgs))\\n \\n #\\n # Report all missing python modules\\n # \\n if failed_deps:\\n # pylint: disable=E1101\\n msg = ('Your python installation needs the following modules'\\n ' to run w3af:\\\\n')\\n msg += ' ' + ' '.join([fdep.module_name for fdep in failed_deps])\\n print(msg)\\n print('\\\\n')\\n # pylint: enable=E1101\\n \\n #\\n # Report missing pip packages\\n #\\n not_git_pkgs = [fdep for fdep in failed_deps if not fdep.is_git]\\n git_pkgs = [fdep.git_src for fdep in failed_deps if fdep.is_git]\\n \\n msg = ('After installing any missing operating system packages, use'\\n ' pip to install the remaining modules:\\\\n')\\n \\n if not_git_pkgs:\\n cmd = generate_pip_install_non_git(platform.PIP_CMD, not_git_pkgs)\\n msg += ' %s\\\\n' % cmd\\n \\n if git_pkgs:\\n for missing_git_pkg in git_pkgs:\\n msg += ' %s\\\\n' % generate_pip_install_git(platform.PIP_CMD,\\n missing_git_pkg)\\n \\n print(msg)\\n \\n msg = 'A script with these commands has been created for you at %s'\\n print(msg % script_path)\\n \\n enable_warnings()\\n platform.after_hook()\\n \\n if exit_on_failure:\\n sys.exit(1)\\n else:\\n return True\",\n \"def other_libraries(self):\\n\\n status, stdout, stderr = self.__xcall__(['--libs-only-other'])\\n\\n if status != 0:\\n raise RuntimeError(\\\"error querying --libs-only-other for package `%s': %s\\\" % (self.name, stderr))\\n\\n return uniq(stdout.split())\",\n \"def _pip_check():\\n check_pipe = subprocess.Popen(\\n [sys.executable, \\\"-m\\\", \\\"pip\\\", \\\"check\\\"],\\n stdout=subprocess.PIPE,\\n )\\n pip_check = check_pipe.communicate()[0].decode()\\n pip_check_lower = pip_check.lower()\\n for package_tup in libraries.values():\\n for package in package_tup:\\n if package.lower() in pip_check_lower:\\n raise RuntimeError(\\\"Dependency conflict found: {}\\\".format(pip_check))\",\n \"def detect_compilers(self):\\n # By users experience it is known which compiler flags are required\\n # in some cases. This function tries to detect which compilers are used\\n # and sets the flags accordingly\\n\\n print 'Detecting Fortran compiler...',\\n if self.fc_is_intel():\\n # The Intel FORTRAN compiler requires -nofor_main flag\\n # for the linking and the -mp flag to maintain the\\n # floating-point precision\\n self.config.fcflags += ' -diag-disable vec -fltconsistency -fp_port'\\n self.config.ldflags_c += ' ' # used to link\\n self.config.ldflags_fc += ' '\\n self.config.ld_fcmain = ' -nofor_main'\\n self.config.noopt += ' -mp'\\n self.testing = 0; # Cannot compile lintest with fc_main option\\n print 'Intel'\\n elif self.fc_is_gnu():\\n print 'GNU'\\n self.config.ld_fcmain = ''\\n elif self.fc_is_xlf():\\n self.config.fcflags += ' -qstrict -qthreaded'\\n self.config.ld_fcmain = ''\\n print 'IBM'\\n elif self.fc_is_pgi():\\n self.config.ldflags_c += ''\\n self.config.ldflags_fc += ''\\n self.config.ld_fcmain = ' -Mnomain'\\n self.testing = 0; # Cannot compile lintest with fc_main option\\n else:\\n self.config.compiler = \\\"Unknown\\\"\\n print 'unknown'\\n\\n print 'Detecting C compiler...',\\n if self.cc_is_intel():\\n self.config.compiler = \\\"Intel\\\"\\n self.config.ccflags += ' -diag-disable vec'\\n print 'Intel'\\n elif self.cc_is_gnu():\\n self.config.compiler = \\\"GNU\\\"\\n print 'GNU'\\n elif self.cc_is_xlc():\\n self.config.compiler = \\\"XLC\\\"\\n self.config.ccflags += ' -qstrict -qthreaded'\\n print 'IBM'\\n elif self.cc_is_pgi():\\n self.config.compiler = \\\"PGI\\\"\\n print 'PGI'\\n else:\\n print 'unknown'\\n\\n print 'Selected C compiler flags: '+self.config.ccflags\\n print 'Selected Fortran compiler flags: '+self.config.fcflags\\n print 'Selected loader flags (C main): '+self.config.ldflags_c\\n print 'Selected loader flags (Fortran main): '+self.config.ldflags_fc\\n return\",\n \"def check_phenotools():\\n if not os.path.exists(PHENOTOOLS):\\n os.system('../setup.py')\\n else:\\n print(\\\"[INFO] we found \\\")\",\n \"def test_arm_c_lib(self):\\n mock_target = mock.MagicMock()\\n mock_target.core = \\\"Cortex-M4\\\"\\n mock_target.supported_c_libs = {\\\"arm\\\": [\\\"small\\\"]}\\n mock_target.c_lib = \\\"sMALL\\\"\\n del mock_target.default_lib\\n mock_target.default_toolchain = \\\"ARM\\\"\\n mock_target.supported_toolchains = [\\\"ARM\\\", \\\"uARM\\\", \\\"ARMC5\\\", \\\"ARMC6\\\"]\\n arm_std_obj = ARM_STD(mock_target)\\n arm_micro_obj = ARM_MICRO(mock_target)\\n\\n mock_target.default_toolchain = \\\"ARMC6\\\"\\n arm_c6_obj = ARMC6(mock_target)\\n\\n self.assertIn(\\\"-D__MICROLIB\\\", arm_std_obj.flags[\\\"common\\\"])\\n self.assertIn(\\\"-D__MICROLIB\\\", arm_micro_obj.flags[\\\"common\\\"])\\n self.assertIn(\\\"-D__MICROLIB\\\", arm_c6_obj.flags[\\\"common\\\"])\\n\\n self.assertIn(\\\"--library_type=microlib\\\", arm_std_obj.flags[\\\"ld\\\"])\\n self.assertIn(\\\"--library_type=microlib\\\", arm_micro_obj.flags[\\\"ld\\\"])\\n self.assertIn(\\\"--library_type=microlib\\\", arm_c6_obj.flags[\\\"ld\\\"]) \\n self.assertIn(\\\"--library_type=microlib\\\", arm_c6_obj.flags[\\\"asm\\\"])\",\n \"def _should_attempt_c_optimizations():\\n if PYPY:\\n return False\\n\\n if _c_optimizations_required():\\n return True\\n return not _c_optimizations_ignored()\",\n \"def should_use_libarchive_c(self):\\n if self.manager.no_libarchive:\\n return False\\n\\n return has_optional_dependency(\\n \\\"libarchive\\\",\\n \\\"install libarchive-c for better perfomance when working with archives: {error}\\\",\\n )\",\n \"def have_pyrex():\\n pyrex_impls = 'Cython.Distutils.build_ext', 'Pyrex.Distutils.build_ext'\\n for pyrex_impl in pyrex_impls:\\n try:\\n # from (pyrex_impl) import build_ext\\n __import__(pyrex_impl, fromlist=['build_ext']).build_ext\\n return True\\n except Exception:\\n pass\\n return False\",\n \"def add_lib(ctx, sources, library, folder, roles, lib_desc, lib_synopsis, datatype, no_file_check, replace, no_biomaj_env):\\n\\n if not sources:\\n print(\\\"Nothing to do\\\")\\n return\\n\\n if not library:\\n if 'dbname' in os.environ:\\n library = os.environ['dbname']\\n else:\\n raise Exception('No library defined. Use the --library option.')\\n\\n sources = check_input(sources, check_existence=(not no_file_check), use_biomaj_env=(not no_biomaj_env))\\n\\n r_roles = []\\n if roles:\\n print(\\\"Checking roles\\\")\\n roles = roles.split(',')\\n r_roles = get_roles(ctx.gi, roles)\\n\\n print(\\\"Adding to data library '\\\" + str(library) + \\\"'\\\")\\n\\n if not folder:\\n folder = '/'\\n dest = os.path.normpath(folder)\\n dest = dest.split(os.sep)\\n dest = [x for x in dest if x] # Remove empty string when sep at the begin or end, or multiple sep\\n\\n found_lib = get_library(ctx.gi, library, lib_desc, lib_synopsis)\\n\\n print(\\\"Preparing folders in library '\\\" + library + \\\"'\\\")\\n\\n dest_folder = create_tree(ctx.gi, found_lib, dest)\\n\\n check_existing(ctx.gi, found_lib, dest, sources, replace)\\n\\n print(\\\"Adding \\\" + str(len(sources)) + \\\" file(s) to the library '\\\" + library + \\\"'\\\")\\n add_files(ctx.gi, found_lib, dest_folder, sources, r_roles, datatype)\\n\\n print(\\\"Done!\\\")\",\n \"def test_add_library_python_api(self):\\n\\n lib_name = 'qt_components'\\n add_library.add_library([lib_name])\\n self.assertTrue(os.path.exists(os.path.join(project_libs_dir(),\\n lib_name)))\",\n \"def setup_lib():\\n global _lib\\n if not _lib:\\n for name in [ find_library(\\\"http_parser\\\"), \\\"libhttp_parser.so\\\", \\\"libhttp_parser\\\" ]:\\n try:\\n _lib = cdll.LoadLibrary(name)\\n except OSError as e:\\n pass\\n else:\\n break\\n if not _lib:\\n _lib = cdll.http_parser # propogate OSError if this fails\\n\\n _lib.http_parser_version.argtypes = []\\n _lib.http_parser_version.restype = c_ulong\\n\\n _lib.http_parser_settings_init.argtypes = [c_void_p]\\n _lib.http_parser_settings_init.restype = None\\n\\n _lib.http_parser_execute.argtypes = [c_void_p, c_void_p, POINTER(c_char), c_size_t]\\n _lib.http_parser_execute.restype = c_size_t\\n\\n _lib.http_should_keep_alive.argtypes = [c_void_p]\\n _lib.http_should_keep_alive.restype = c_int\\n\\n _lib.http_method_str.argtypes = [c_int]\\n _lib.http_method_str.restype = c_char_p\\n\\n _lib.http_status_str.argtypes = [c_int]\\n _lib.http_status_str.restype = c_char_p\\n\\n _lib.http_errno_name.argtypes = [c_int]\\n _lib.http_errno_name.restype = c_char_p\\n\\n _lib.http_errno_description.argtypes = [c_int]\\n _lib.http_errno_description.restype = c_char_p\\n\\n _lib.http_parser_url_init.argtypes = [c_void_p]\\n _lib.http_parser_url_init.restype = None\\n\\n _lib.http_parser_parse_url.argtypes = [POINTER(c_char), c_size_t, c_int, c_void_p]\\n _lib.http_parser_parse_url.restype = c_int\\n\\n _lib.http_parser_pause.argtypes = [c_void_p, c_int]\\n _lib.http_parser_pause.restype = None\\n\\n _lib.http_body_is_final.argtypes = [c_void_p]\\n _lib.http_body_is_final.restype = c_int\\n\\n _lib.http_parser_set_max_header_size.argtypes = [c_int]\\n _lib.http_parser_set_max_header_size.restype = None\\n\\n return _lib\",\n \"def recognize_lib(self, a, lib):\\n logging.debug(\\\"in recognize lib\\\")\\n self.produce(KEYWORD, lib)\\n self.begin('lib')\",\n \"def checklib(module):\\n import imp\\n for mod in module:\\n try:\\n imp.find_module(mod)\\n ret = 1\\n except ImportError as imperror:\\n print(imperror)\\n ret = 0\\n return ret\",\n \"def check_dependencies(target_binary, target_platform, target_architecture, target_type):\\n check_architecture(target_architecture)\\n check_platform(target_platform)\"\n]","isConversational":false},"negative_scores":{"kind":"list like","value":["0.70988935","0.6297976","0.60500425","0.56923157","0.55388916","0.5488028","0.53949934","0.5367634","0.532435","0.5322072","0.5235258","0.5161452","0.5156778","0.51427037","0.5137287","0.5064834","0.501241","0.4967916","0.49471545","0.49432126","0.4930325","0.4925288","0.4912353","0.49113977","0.48917145","0.48783392","0.48603076","0.4857446","0.48449332","0.48327386","0.48159316","0.47771326","0.47724834","0.47702527","0.47640395","0.47629893","0.47597376","0.47520003","0.47502416","0.47393835","0.47272483","0.4725001","0.4719215","0.4685199","0.46828705","0.4676625","0.46542948","0.46504793","0.4649845","0.46476495","0.46454597","0.46200514","0.46148482","0.4607311","0.46057707","0.46050033","0.4602694","0.4595223","0.45929104","0.4587039","0.45867208","0.458586","0.4582044","0.45763215","0.4575507","0.45744884","0.45734555","0.45682058","0.45609227","0.45405653","0.4533447","0.45302805","0.45267013","0.45253912","0.45236996","0.4522971","0.4511472","0.45079246","0.4503659","0.45019764","0.4501286","0.4494163","0.44920737","0.44835007","0.44829714","0.4481279","0.4472502","0.4469484","0.4468771","0.44684124","0.44651645","0.4450132","0.44493902","0.4449291","0.44437364","0.4439065","0.44368336","0.44325182","0.44190392","0.44146645"],"string":"[\n \"0.70988935\",\n \"0.6297976\",\n \"0.60500425\",\n \"0.56923157\",\n \"0.55388916\",\n \"0.5488028\",\n \"0.53949934\",\n \"0.5367634\",\n \"0.532435\",\n \"0.5322072\",\n \"0.5235258\",\n \"0.5161452\",\n \"0.5156778\",\n \"0.51427037\",\n \"0.5137287\",\n \"0.5064834\",\n \"0.501241\",\n \"0.4967916\",\n \"0.49471545\",\n \"0.49432126\",\n \"0.4930325\",\n \"0.4925288\",\n \"0.4912353\",\n \"0.49113977\",\n \"0.48917145\",\n \"0.48783392\",\n \"0.48603076\",\n \"0.4857446\",\n \"0.48449332\",\n \"0.48327386\",\n \"0.48159316\",\n \"0.47771326\",\n \"0.47724834\",\n \"0.47702527\",\n \"0.47640395\",\n \"0.47629893\",\n \"0.47597376\",\n \"0.47520003\",\n \"0.47502416\",\n \"0.47393835\",\n \"0.47272483\",\n \"0.4725001\",\n \"0.4719215\",\n \"0.4685199\",\n \"0.46828705\",\n \"0.4676625\",\n \"0.46542948\",\n \"0.46504793\",\n \"0.4649845\",\n \"0.46476495\",\n \"0.46454597\",\n \"0.46200514\",\n \"0.46148482\",\n \"0.4607311\",\n \"0.46057707\",\n \"0.46050033\",\n \"0.4602694\",\n \"0.4595223\",\n \"0.45929104\",\n \"0.4587039\",\n \"0.45867208\",\n \"0.458586\",\n \"0.4582044\",\n \"0.45763215\",\n \"0.4575507\",\n \"0.45744884\",\n \"0.45734555\",\n \"0.45682058\",\n \"0.45609227\",\n \"0.45405653\",\n \"0.4533447\",\n \"0.45302805\",\n \"0.45267013\",\n \"0.45253912\",\n \"0.45236996\",\n \"0.4522971\",\n \"0.4511472\",\n \"0.45079246\",\n \"0.4503659\",\n \"0.45019764\",\n \"0.4501286\",\n \"0.4494163\",\n \"0.44920737\",\n \"0.44835007\",\n \"0.44829714\",\n \"0.4481279\",\n \"0.4472502\",\n \"0.4469484\",\n \"0.4468771\",\n \"0.44684124\",\n \"0.44651645\",\n \"0.4450132\",\n \"0.44493902\",\n \"0.4449291\",\n \"0.44437364\",\n \"0.4439065\",\n \"0.44368336\",\n \"0.44325182\",\n \"0.44190392\",\n \"0.44146645\"\n]","isConversational":false},"document_score":{"kind":"string","value":"0.71553355"},"document_rank":{"kind":"string","value":"0"}}},{"rowIdx":10190,"cells":{"query":{"kind":"string","value":"Generate a normal distribution of sleep patterns based around 7 hours of sleep a day"},"document":{"kind":"string","value":"def _get_random_sleep_series(index, mean=60 * 7, std_dev=60):\n data_points_to_create = len(index)\n sleep_times = np.random.normal(loc=mean, scale=std_dev, size=data_points_to_create)\n sleep_series = pd.Series(sleep_times, index=index)\n return sleep_series"},"metadata":{"kind":"string","value":"{\n \"objective\": {\n \"self\": [],\n \"paired\": [],\n \"triplet\": [\n [\n \"query\",\n \"document\",\n \"negatives\"\n ]\n ]\n }\n}"},"negatives":{"kind":"list like","value":["def generate_rand_7():\n\n while(True):\n # This generates a random number uniformly distributed between 1 and 24.\n # The first term is 5 times a rand num between 1 - 4, yielding {5, 10,\n # 15, 20}. The second is a rand num between 1 - 4.\n # Since the two numbers are *independent*, adding them gives a rand num\n # uniformly distributed between 1 - 24.\n # The test then rejects any number that is 21 or above. This is then\n # divided into 7 numbers between 1 - 7 using % 7. Since there are 21\n # numbers in the interval [1, 21] and 21 is divisble by 7, the numbers\n # between 1 and 7 will occur with equal probability.\n num = 5 * (np.random.uniform(1, 5, 1) - 1) +\\\n (np.random.uniform(1, 5, 1) - 1)\n if num[0] < 21:\n return int(num[0] % 7 + 1)","def simulate_weekend():\n\t\tfor person in Simulation.community:\n\t\t\tif Simulation.community[person].has_random:\n\t\t\t\tSimulation.community[person].get_random_attendance()\n\t\t\tSimulation.community[person].eval_strategies()","def create_random_time_interval_gaps(days, gaps_as_percent, avg_gap_as_percent):\n \n print \"days \",days\n #first find the total number of gap days by calculating it as percent of the total days\n total_size_of_missing_days = round(days * (float(gaps_as_percent)/100))\n print \"total size of missing days \", total_size_of_missing_days\n #now, calculate the average gap size as percent of the total number of gap days\n average_gap_in_days = round(total_size_of_missing_days * (float(avg_gap_as_percent)/100)) \n num_of_time_gaps = round(float(days)/average_gap_in_days)\n\n #number of fills is a space around the gaps, from day 0 to last day\n # there are num_of_gaps + 1\n num_of_time_fills = num_of_time_gaps + 1\n size_of_fill = int(round((float(days)-total_size_of_missing_days)/num_of_time_fills))\n \n print \"num_of_time_gaps \", num_of_time_gaps\n print \"num_of_time_files \", num_of_time_fills\n print \"size_of_fill \", size_of_fill\n\n start_indices = []\n begin = 0\n for i in range(0,int(num_of_time_gaps)):\n begin = randint(begin,int(size_of_fill)-1)\n start_indices.append(begin)\n begin = begin + size_of_fill\n if begin + average_gap_in_days > total_size_of_missing_days:\n break\n\n \n print start_indices \n print \"num of time gaps \", num_of_time_gaps \n print \"num of time fills \", num_of_time_fills \n\n interval_tuples = []\n credit_space = days - total_size_of_missing_days\n start = 0\n end = randint(0,avg_size)\n #algorithm - take the size of present data and, using it as a reminder, create a distribution of days","def run_simulation(days, meeting_probability, patient_zero_health):\n patient = load_patients(75)\n patient[0].set_health(patient_zero_health)\n each_day_effected_stats = []\n\n for index in range(days):\n \"\"\"Each day simulation.\"\"\"\n for patient_index in range(len(patient)):\n \"\"\"Simulation through list of patients.\"\"\"\n friends_list = patient[patient_index].get_friends()\n for friend_index in friends_list:\n \"\"\"Simulation for each person in connetion with the friend.\"\"\"\n probability_of_meeting = random()\n if probability_of_meeting < meeting_probability:\n \"\"\"Probability of meeting is compared with entered probability.\"\"\"\n if friend_index.is_contagious():\n \"\"\"If friend is contagious, he will spread the infection to patient.\"\"\"\n friend_viral_load = 5 + (((friend_index.get_health() - 25) ** 2) / 62)\n patient[patient_index].infect(friend_viral_load)\n elif patient[patient_index].is_contagious():\n \"\"\"Else if patient is contagious, he will spread the infection to his friend.\"\"\"\n patient_viral_load = 5 + (((patient[patient_index].get_health() - 25) ** 2) / 62)\n friend_index.infect(patient_viral_load)\n\n day_patients_effected = 0\n for patient_index in patient:\n \"\"\"Loop to put all the persons to sleep and\n also to count the contagious people in a given day.\"\"\"\n if patient_index.is_contagious():\n \"\"\"If patient is contagious, Number of \n patients effected is incremented.\"\"\"\n day_patients_effected += 1\n patient_index.sleep() # Each patient is put to sleep at end of day.\n each_day_effected_stats.append(day_patients_effected) # list of each day stats are stored in a list.\n\n return each_day_effected_stats","def generate_24hrs():\n\n hrs = []\n\n for i in xrange(1, 25):\n hrs.append([i, 0])\n\n return hrs","def _get_day_attack_schedule(self):\n planer_args = self.planner_config[\"args\"]\n start_time = datetime.strptime(planer_args[\"min_time\"], \"%H:%M\").time()\n start_date = datetime.combine(datetime.today().date(), start_time)\n end_time = datetime.strptime(planer_args[\"max_time\"], \"%H:%M\").time()\n end_date = datetime.combine(datetime.today().date(), end_time)\n\n random.seed()\n attack_schedule = []\n for start, end in self._split_date_range(start_date, end_date, planer_args[\"times\"]):\n attack_schedule.append(random.uniform(start, end))\n\n return attack_schedule","def generate_exptime_table(self, ):\n\n # Perform calculation for all stars in biased sample\n Ndraw = self.NBIAS\n\n np.random.seed(seed=None)\n\n # Allocate memory for exposure times\n t_tots = np.zeros(Ndraw)\n tpbpcs = []\n pct_obs_iwas = []\n lammax_obs_iwas = []\n specs = []\n\n \"\"\"\n Calculate the exposure times and spectra in each bandpass for each\n star in biased sample\n \"\"\"\n\n # Loop over stars in this sample\n for i in range(Ndraw):\n #print(\"HIP %i, %.2f pc, %s \" %(hip[i], dist[i], stype[i]))\n\n # Set system parameters for this star\n self.prep_ith_star(i)\n\n # Calculate the time to observe the complete spectrum\n t_tots[i], tpbpc, spectrum, iwa = self.complete_spectrum_time()\n\n tpbpcs.append(tpbpc)\n pct_obs_iwas.append(iwa[0])\n specs.append(spectrum)\n\n # Calculate channel widths\n deltas = []\n for channel in CHANNELS:\n l = default_luvoir(channel=channel)\n deltas.append(l.lammax - l.lammin)\n self.deltas = np.array(deltas)\n\n # Calculate channel fractional completeness\n self.channel_weights = (self.deltas / np.sum(self.deltas))\n\n # Calculate completeness for each star in sample\n self.completeness = np.sum(np.array(pct_obs_iwas) * self.channel_weights, axis = 1)\n\n \"\"\"\n Make a Lookup Table of Exposure times for each star in sample\n \"\"\"\n\n tpbpcs_rect = [] # Time per bandpass\n tpcs_rect = [] # Time per channel\n\n # Loop over all the stars in sample\n for idrew in range(self.NBIAS):\n\n tpbpcs_rect.append([])\n tpcs_rect.append([])\n bp_names = []\n bp_chan = []\n\n # Loop over all the LUVOIR channels\n for ichan in range(len(CHANNELS)):\n\n tpcs_rect[idrew].append(0.0)\n\n # Loop over all the bands in this channel\n for iband in range(len(tpbpcs[0][ichan])):\n\n bp_names.append(\"%s %i\" %(CHANNELS[ichan], iband+1))\n bp_chan.append(ichan)\n tpbpcs_rect[idrew].append(tpbpcs[idrew][ichan][iband])\n tpcs_rect[idrew][ichan] += tpbpcs[idrew][ichan][iband]\n\n # Make np arrays\n tpbpcs_rect = np.array(tpbpcs_rect)\n tpcs_rect = np.array(tpcs_rect)\n bp_names = np.array(bp_names)\n bp_chan = np.array(bp_chan)\n\n # Make infs --> nans\n infmask = ~np.isfinite(tpbpcs_rect)\n tpbpcs_rect[infmask] = np.nan\n infmask = ~np.isfinite(tpcs_rect)\n tpcs_rect[infmask] = np.nan\n\n # Set attributes\n self.tpbpcs_rect = tpbpcs_rect\n self.tpcs_rect = tpcs_rect\n self.bp_names = bp_names\n self.bp_chan = bp_chan\n\n \"\"\"\n New completeness calculations\n \"\"\"\n\n bandpasses = []\n\n # Loop over telescope channels\n for j, channel in enumerate(CHANNELS):\n\n # Channel dependent bandwidth?\n if type(self.bandwidth) is float:\n bandwidth = self.bandwidth\n else:\n assert len(self.bandwidth) == len(CHANNELS)\n bandwidth = self.bandwidth[j]\n\n # Get the channel specific telescope parameters\n luvoir = default_luvoir(channel=channel)\n self.cn.telescope = luvoir\n\n # Calculate the bandpass edges\n edges = calculate_bandpass_edges(luvoir.lammin, luvoir.lammax, bandwidth = bandwidth)\n\n # Calculate the number of bandpasses\n Nbands = len(edges) - 1\n\n # Loop over bandpasses\n for i in range(Nbands):\n\n # Get the max, min, and middle wavelenths for this bandpass\n lammin = edges[i]\n lammax = edges[i+1]\n\n bandpasses.append([lammin, lammax])\n\n bandpasses = np.array(bandpasses)\n lmin, lmax = np.min(np.hstack(bandpasses)), np.max(np.hstack(bandpasses))\n\n # Fractional completeness of each bandpass\n bp_frac = ((bandpasses[:,1] - bandpasses[:,0]) / (lmax - lmin)) / np.sum((bandpasses[:,1] - bandpasses[:,0]) / (lmax - lmin))\n\n # Completeness by target\n tot_completeness = np.sum(np.isfinite(self.tpbpcs_rect) * bp_frac, axis=1)\n\n # Fraction of stars in biased sample that can completely observe each bandpass\n frac_bias_bp = np.sum(np.isfinite(tpbpcs_rect)*1.0, axis=0) / self.NBIAS\n\n # Set attributes\n self.bandpasses = bandpasses\n self.bp_frac = bp_frac\n self.tot_completeness = tot_completeness\n self.frac_bias_bp = frac_bias_bp\n\n self._make_pandas_table()\n\n return","def make_pattern(self):\n probability = random.SystemRandom().random()\n if probability < 0.1:\n _pattern = [0 for x in range(32)]\n elif probability > 0.5:\n pattern_num = SECURE_RANDOM.choice(CLASSIC)\n _probability = random.SystemRandom().random()\n if _probability > 0.80:\n _pattern = [1 if random.SystemRandom().random() < pattern_num/32 else 0 for x in range(1,33)]\n elif _probability < 0.40:\n _offset = random.SystemRandom().randint(2, 16)\n _pattern = [1 if (x == _offset) or (x % pattern_num == _offset) else 0 for x in range(1,33)]\n else:\n _pattern = [1 if (x == 1) or (x % pattern_num == 1) else 0 for x in range(1,33)]\n else:\n pattern_num = SECURE_RANDOM.choice(INNER_CLASSIC)\n _probability = random.SystemRandom().random()\n if _probability > 0.50:\n _pattern = [1 if (x == 1) or (x % pattern_num == 1) else 0 for x in range(1,33)]\n else:\n _pattern = [1 if random.SystemRandom().random() < pattern_num/32 else 0 for x in range(1,33)]\n\n if not self.global_swing:\n _probability = random.SystemRandom().random()\n if _probability > 0.3:\n _pattern.extend([random.SystemRandom().uniform(0.01, 0.5), random.SystemRandom().randint(1, 14), 0])\n else:\n _pattern.extend([0,1,0])\n else: \n _pattern.extend([0,1,1]) \n\n return _pattern","def fixed_time_trajectories(self, ll=1, distributions=None, discrete=False, noise=0):\n\n self.time_uniform = np.linspace(0, self.nsteps, self.nsteps * self.padding)\n\n for t in tqdm.tqdm(range(self.ntraj)):\n\n if distributions is not None:\n\n if self.dwell_distribution == 'exponential':\n self.lamb = np.random.choice(distributions[0])\n elif self.dwell_distribution == 'power':\n self.alpha = np.random.choice(distributions[0])\n\n self.hop_sigma = np.random.choice(distributions[1])\n self.H = np.random.choice(distributions[2])\n #self.H = np.mean(distributions[2])\n\n time = [0]\n total_time = 0 # saves a lot of time\n\n while total_time < self.nsteps:\n\n # hop at random time intervals according to one of the following PDFs\n if self.dwell_distribution == 'exponential':\n time.append(sampling.random_exponential_dwell(self.lamb))\n elif self.dwell_distribution == 'power':\n if self.alpha == 1:\n time.append(1)\n else:\n time.append(sampling.random_power_law_dwell(1 + self.alpha, ll=ll, discrete=discrete)[0])\n else:\n sys.exit('Please enter a valid dwell time probability distribution')\n total_time += time[-1]\n\n time = np.cumsum(time)\n\n if self.hop_distribution in ['gaussian', 'Gaussian']:\n\n z = np.cumsum(np.random.normal(loc=0, scale=self.hop_sigma, size=len(time)))\n z -= z[0] # untested\n\n elif self.hop_distribution in ['fbm', 'fractional', 'fraction_brownian_motion']:\n z = fbm.FBM(len(time), self.H, method=\"daviesharte\").fbm()[:-1] # automatically inserts zero at beginning of array\n z /= ((1.0 / len(time)) ** self.H) # reversing a normalization done in the fbm code\n z *= self.hop_sigma\n self.steps.append(z[1:] - z[:-1]) # for autocorrelation calculation\n\n else:\n sys.exit('Please enter a valid hop distance probability distribution')\n\n # for visualizing hops\n # trajectory_hops = np.zeros([2 * len(time) - 1, 2])\n #\n # trajectory_hops[1::2, 0] = time[1:]\n # trajectory_hops[2::2, 0] = time[1:]\n #\n # trajectory_hops[::2, 1] = z\n # trajectory_hops[1:-1:2, 1] = z[:-1]\n # trajectory_hops[-1, 1] = z[-1]\n # plt.plot(trajectory_hops[:, 0], trajectory_hops[:, 1])\n # plt.show()\n # exit()\n\n # make uniform time intervals with the same interval for each simulated trajectory\n self.z_interpolated[t, :] = z[np.digitize(self.time_uniform, time, right=False) - 1]\n\n #plt.hist(np.random.normal(loc=0, scale=noise, size=len(self.time_uniform)))\n\n if noise > 0:\n self.z_interpolated += np.random.normal(loc=0, scale=noise, size=len(self.time_uniform))\n\n self.time_uniform *= self.dt\n # plt.plot(trajectory_hops[:, 0]*self.dt, trajectory_hops[:, 1])\n # plt.plot(self.time_uniform, self.z_interpolated[-1, :])\n # plt.show()\n # exit()","def weekly():","def hourly_data():\n return generate_df_for_tests(freq=\"H\", periods=24 * 500)","def forecast(days):\n transition = np.array([[.7, .6], [.3, .4]])\n state = 0\n record = []\n for day in xrange(days):\n state = np.random.binomial(1, transition[1, state])\n record.append(state)\n return record","def generate_program():\n sun = get_sun()\n sunrise = sun.get_sunrise_time() + timedelta(minutes=30)\n sunset = sun.get_sunset_time() - timedelta(minutes=30)\n\n program = {}\n\n # Iterate over each switch\n for id, config in switches.items():\n program[id] = OrderedDict()\n # morning\n if config['morning']:\n ts_on = get_random_time_in_range(days_events['getting_up'])\n ts_off = get_random_time_around(sunrise, interval_minutes=15)\n\n if ts_off > ts_on:\n program[id][get_random_time_in_range(days_events['getting_up'])] = 'on'\n program[id][get_random_time_around(sunrise, interval_minutes=15)] = 'off'\n else:\n logging.info('Sun goes up earlier %s than %s. No switching on in the morning',\n datetime.fromtimestamp(ts_on, tz=tzlocal()).strftime(\"%H:%M:%S %z\"),\n datetime.fromtimestamp(ts_off, tz=tzlocal()).strftime(\"%H:%M:%S %z\"),\n )\n\n # evening\n if config['evening']:\n program[id][get_random_time_around(sunset, interval_minutes=15)] = 'on'\n program[id][get_random_time_in_range(days_events['bedtime'])] = 'off'\n # program[id][datetime.now().timestamp() + 1*60 ] = 'off'\n\n return program","def get_work_time_for_24_7_open_locations() -> SimTimeTuple:\n # roll the dice for day shift or night shift\n if globals.numpy_rng.random() < 0.5:\n # night shift\n hours = (22, 23) + tuple(range(0, 7))\n else:\n # distribute the work hours of the day shifts between 7 am to 10pm\n start = globals.numpy_rng.randint(7, 13)\n hours = tuple(range(start, start + 9))\n\n start = globals.numpy_rng.randint(0, 2)\n week_days = tuple(range(start, start + 6))\n return SimTimeTuple(hours, week_days)","def generate_hour_cycle(self, hour, names):\n hour_log = []\n\n for time in range(0, self.random_with_deviation(self.HOUR_SHEET[hour])):\n log_time = self.generate_datetime(hour)\n\n hour_log.extend(self.generate_log_in_cycle(log_time, self.rand_name(names)))\n\n return hour_log","def simulate(self):\n\t\tcounter = 1\n\t\tweek = 1\n\t\twhile counter != 0:\n\t\t\tself.oneWeek(week)\n\t\t\tweek += 1\n\t\t\tcounter = len(self.teams[0].schedule)","def runRandomEntryStrat(self):\n start, end = self.randomDays()\n \n gain = (self.df.adj_close[end] - getInfl(self.df.adj_close[start], start.year, end.year)) / \\\n getInfl(self.df.adj_close[start], start.year, end.year)\n #if gain > 6:\n # print \"Windfall: \", start, end, gain\n return gain","def calc_sleep(n_new, n_fetched, new_per):\n if False:\n # So, my fancy way of doing this wasn't really better than the\n # simple way below.\n if not hasattr(calc_sleep, \"sleep_time_hours\"):\n calc_sleep.sleep_time_hours = 1.5 # Starting sleep time.\n # Sleep for some amount of time using `new_perecent`.\n # Target is approximately 70 %, since if 90 % we take 1/3rd the time,\n # if 50 % we take 5/3rds the time, and scale from 1/3 to 5/3 inbetween,\n # capping if not in between. The randdom part is just so the\n # resulting numbers are not even and we don't end up in a loop.\n # Liner scale:\n # f(x) = C * (1 - (x - A) / (B - A)) + D * (x - A) / (B - A)\n # Which is:\n # f(x) = x * (D - C) / (B - A) + C + A * (C - D) / (B - A)\n # So for (A, B) -> (C, D) = (50, 90) -> (5/3, 1/3)\n # f(x) = 3.33333333 - 0.03333333 * x\n new_per = 3.33333333 - 0.03333333 * new_per\n if new_per > 1.7:\n new_per = 1.7\n elif new_per < 0.3:\n new_per = 0.3\n # Plus something between -0.128 and 0.127.\n new_per = new_per + float(ord(os.urandom(1)) - 128) / 1000\n calc_sleep.sleep_time_hours = calc_sleep.sleep_time_hours * new_per\n return calc_sleep.sleep_time_hours\n else:\n # This is 5.8 + rand(-1.28, 1.27).\n max_sleep_time = 5.8 + float(ord(os.urandom(1)) - 128) / 100\n return float(n_fetched - n_new) * max_sleep_time / float(n_fetched)\n\n # If we get here, the big if didn't return anything.\n return 1.5 # Hours.","def test_gen_delays(self):\n min_freq = 1e6\n max_freq = 50e6\n exp = StarkRamseyXY(\n physical_qubits=[0],\n stark_amp=0.1,\n min_freq=min_freq,\n max_freq=max_freq,\n )\n test_delays = exp.delays()\n ref_delays = np.arange(0, 1 / min_freq, 1 / max_freq / 2)\n np.testing.assert_array_equal(test_delays, ref_delays)","def bootstrap_events():\n import datetime\n import random\n # let's have each event occur once between 3 and 6 pm, \n # some day in the next month, and then recur for the next 1 to 8 weeks\n\n now = datetime.datetime.now().replace(minute=0, second=0)\n\n for program in Program.objects.all():\n start_hour = random.randint(15, 18)\n the_date = now.replace(hour=start_hour) + datetime.timedelta(random.randint(0, 31))\n duration = random.randint(1,6) * 30\n next_week = datetime.timedelta(7)\n\n program.events.add(EventDate.objects.create(\n date=the_date, \n duration_mins = duration))\n\n for next_occur in range(random.randint(1,8)):\n the_date += next_week\n program.events.add(EventDate.objects.create(\n date = the_date,\n duration_mins = duration))\n\n print \"Scheduled\", program.events.count(), \"events for\", program","def simulate_time_rescaling(runtime,\n kernel=functions.kernel_zhao,\n p=functions.infectious_rate_tweets,\n dt=0.01,\n follower_pool=None,\n int_fol_cnt=10000,\n follower_mean=200,\n split=0.015):\n events = [(0, int_fol_cnt)]\n ti = 0\n print_cnt = 0\n\n while 0 <= ti < runtime and len(events) < 4500:\n X = rand.exponential()\n tj = solve_integral(ti, X, kernel, p, events, dt, runtime)\n if follower_pool is not None:\n fol = rand.choice(follower_pool)\n else:\n fol = rand_followers_extended(int_fol_cnt, follower_mean, split)\n if tj > 0:\n events.append((tj, fol))\n ti = tj\n if print_cnt % 100 == 0:\n print(\"Simulating [%f%%]...\" % (ti / runtime * 100), flush=True)\n print_cnt += 1\n\n print(\"\\nOver %d events generated\" % len(events))\n\n return events","def time_to_failure():\r\n return random.expovariate(BREAK_MEAN)","def beat_perturber(beat, timings, probibility_add, depth, repeater):\n # the possibilities\n perturbances = []\n\n for i in range(2, depth+2):\n perturbances.append(int(beat / i))\n\n # roll a Gaussian distributition for every\n # current drum hit, perturb those below the probability threshold\n px_vec = np.random.random(len(timings)-1)\n indices_to_perturb = np.argwhere(px_vec < probibility_add).ravel()\n\n for idx in indices_to_perturb:\n # randomly sample from the 'perturbenaces'\n random_perturb = np.random.choice(perturbances, 1)[0]\n n_reps = np.random.poisson(repeater)\n timings = timings[0:idx] + ([random_perturb] * n_reps) + timings[idx:]\n\n return timings","def unforeseen():\r\n return random.gauss(300., 100.)","def generate_poisson_workload(wid_args: dict, mix: list, n: int, t: float) -> list:\n workload = generate_workload(wid_args, mix, n)\n\n time = t * 3600 #t is in hours\n lambda_poisson = n / time\n #Generate intervals via Poisson\n intervals = rng.exponential(1.0/lambda_poisson, len(workload))\n\n #Zip the strings of workload and interval\n str_cat = lambda x, y: x[:-1] + \", {:.3f} \\n\".format(y)\n workload = list(map(str_cat, workload, intervals))\n\n return workload","def time_per_part():\r\n return random.normalvariate(PT_MEAN, PT_SIGMA)","def _fill_time(beats, shard, *args, **kwargs):\n total = 0\n for delay in shard(*args, **kwargs):\n total += delay.count\n yield delay\n yield Beat(beats - total)","def rand10():\n res = 40\n while res >= 40:\n res = 7 * (rand7() - 1) + (rand7() - 1)\n return res % 10 + 1","def generate_day_cycle(self, names):\n day_log = []\n time_delta = timedelta(days=1)\n\n for i in range(0, len(self.HOUR_SHEET)):\n if self.is_time_for_bruteforce(i):\n day_log.extend(self.generate_brute_force_log(i, names))\n\n day_log.extend(self.generate_hour_cycle(i, names))\n\n day_log.sort()\n\n self.date += time_delta\n\n return day_log","def goodmorning(host):","def test_1000_populations_with_activity_12perday_should_yield_60k_logs_in_5days():\n\n with path.tempdir() as log_parent_folder:\n log_folder = os.path.join(log_parent_folder, \"logs\")\n\n # note that we cannot have clock_step > 2h since that\n run_test_scenario_1(clock_step=\"1h\",\n simulation_duration=\"5 days\",\n n_stories=12,\n per=pd.Timedelta(\"1day\"),\n log_folder=log_folder)\n\n logging.info(\"loading produced logs\")\n logs = load_all_logs(log_folder)[\"the_logs\"]\n\n logging.info(\"number of produced logs: {} logs\".format(logs.shape[0]))\n\n # 5 days of simulation should produce 1000 * 12 * 5 == 60k logs\n assert 55e3 <= logs.shape[0] <= 65e3","def generate_brute_force_log(self, hour, names):\n time = self.generate_datetime(hour)\n d = timedelta(seconds=randint(1, 3))\n attacks_per_second = \\\n self.random_with_deviation(self.MAX_NR_OF_ATTACKS / self.SECONDS_IN_DAY)\n username = self.rand_name(names)\n duration = randint(0, self.SECONDS_IN_DAY - 1)\n log = []\n count = 0\n\n while count < duration:\n for i in range(0, attacks_per_second):\n log.append([time, username, 0, 0])\n\n count += 1\n\n d = timedelta(seconds=randint(0, 3))\n time += d\n\n return log","def extra_tasks_for_today(self):\n localtz = tzlocal()\n datetime_today = datetime.fromtimestamp(rospy.get_rostime().to_sec(), tz=localtz)\n day_today = datetime_today.strftime(\"%A\")\n date_today = datetime_today.date()\n rospy.loginfo('Looking for daily tasks for %s, %s' % (day_today, date_today))\n \n eight_forty_five= time(8,45, tzinfo=localtz)\n eleven_thirty= time(11,30, tzinfo=localtz)\n fourteen_thirty=time(14,30, tzinfo=localtz)\n seventeen_fifteen= time(17,15, tzinfo=localtz)\n past_bedtime = time(23,59, tzinfo=localtz)\n \n # day_end = seventeen_fifteen\n day_end = past_bedtime\n\n\n\n metric_wps=['WayPoint13', 'WayPoint18', 'WayPoint9','WayPoint11','WayPoint5','WayPoint3'] \n object_learn_wps=['WayPoint13', 'WayPoint18', 'WayPoint9', 'WayPoint11'] \n object_search_wps=['WayPoint1', 'WayPoint2', 'WayPoint3']\n door_wps=['WayPoint7', 'WayPoint4']\n \n morning_start = eight_forty_five\n morning_duration = delta_between(eleven_thirty, morning_start)\n \n lunch_start = eleven_thirty\n lunch_duration = delta_between(fourteen_thirty, lunch_start)\n\n afternoon_start = fourteen_thirty\n afternoon_duration = delta_between(day_end, afternoon_start)\n\n tasks = []\n \n #door checks at fixed times (to evaluate system ability to do stuff at corret times)\n task=create_door_check_task(door_wps[0])\n start_time=datetime.combine(date_today, time(10,30, tzinfo=localtz))\n end_time = start_time+timedelta(seconds=30)\n task.start_after=rospy.Time(unix_time(start_time))\n task.end_before=rospy.Time(unix_time(end_time))\n tasks.append(task)\n \n task=create_door_check_task(door_wps[0])\n start_time=datetime.combine(date_today, time(13,30, tzinfo=localtz))\n end_time = start_time+timedelta(seconds=30)\n task.start_after=rospy.Time(unix_time(start_time))\n task.end_before=rospy.Time(unix_time(end_time))\n tasks.append(task)\n \n task=create_door_check_task(door_wps[0])\n start_time=datetime.combine(date_today, time(16,30, tzinfo=localtz))\n end_time = start_time+timedelta(seconds=30)\n task.start_after=rospy.Time(unix_time(start_time))\n task.end_before=rospy.Time(unix_time(end_time))\n tasks.append(task)\n \n \n #random tasks\n for i in range(4):\n #morning\n task=create_metric_map_task(random.choice(metric_wps))\n self.set_random_task_time(task, date_today, morning_start, morning_duration)\n tasks.append(task)\n \n task=create_door_check_task(random.choice(door_wps))\n self.set_random_task_time(task, date_today, morning_start, morning_duration)\n tasks.append(task)\n \n if i<3:\n task=create_object_learn_task(random.choice(object_learn_wps))\n self.set_random_task_time(task, date_today, morning_start, morning_duration)\n tasks.append(task)\n \n task=create_object_search_task(random.choice(object_search_wps))\n self.set_random_task_time(task, date_today, morning_start, morning_duration)\n tasks.append(task)\n \n #lunch (less tasks because we want the robot mostly learning people tracks)\n if i<1:\n task=create_metric_map_task(random.choice(metric_wps))\n self.set_random_task_time(task, date_today, lunch_start, lunch_duration)\n tasks.append(task)\n \n task=create_door_check_task(random.choice(door_wps))\n self.set_random_task_time(task, date_today, lunch_start, lunch_duration)\n tasks.append(task)\n \n task=create_object_learn_task(random.choice(object_learn_wps))\n self.set_random_task_time(task, date_today, lunch_start, lunch_duration)\n tasks.append(task)\n \n task=create_object_search_task(random.choice(object_search_wps))\n self.set_random_task_time(task, date_today, lunch_start, lunch_duration)\n tasks.append(task)\n \n \n #afternoon\n task=create_metric_map_task(random.choice(metric_wps))\n self.set_random_task_time(task, date_today, afternoon_start, afternoon_duration)\n tasks.append(task)\n \n task=create_door_check_task(random.choice(door_wps))\n self.set_random_task_time(task, date_today, afternoon_start, afternoon_duration)\n tasks.append(task)\n \n if i<3:\n task=create_object_learn_task(random.choice(object_learn_wps))\n self.set_random_task_time(task, date_today, afternoon_start, afternoon_duration)\n tasks.append(task)\n \n task=create_object_search_task(random.choice(object_search_wps))\n self.set_random_task_time(task, date_today, afternoon_start, afternoon_duration)\n tasks.append(task)\n return tasks","def generate_totp(secret, period=30):\n counter = int(time.time()) // period\n return generate_hotp(secret, counter)","def create_population(num_schedules, size=10, rate_range=(-6, 0)):\n pop = []\n for _ in range(0, num_schedules):\n exponents = np.random.uniform(rate_range[0], rate_range[1], size)\n schedule = np.power(10, exponents).tolist()\n pop.append(schedule)\n return pop","def get_random_sleep() -> int:\n return random.randint(1, 9)","def generate_fire_recurrence(self):\r\n \r\n self.time_to_next_fire = round(weibullvariate(self.scale_parameter, self.shape_parameter),2)\r\n return self.time_to_next_fire","def time_period_based(sched, warmup_time_period, time_period, runner, params):\n next_scheduled = 0\n start = time.perf_counter()\n if time_period is None:\n iterations = params.size()\n for it in range(0, iterations):\n sample_type = metrics.SampleType.Warmup if time.perf_counter() - start < warmup_time_period else metrics.SampleType.Normal\n percent_completed = (it + 1) / iterations\n yield (next_scheduled, sample_type, percent_completed, runner, params.params())\n next_scheduled = sched.next(next_scheduled)\n else:\n end = start + warmup_time_period + time_period\n it = 0\n\n while time.perf_counter() < end:\n now = time.perf_counter()\n sample_type = metrics.SampleType.Warmup if now - start < warmup_time_period else metrics.SampleType.Normal\n percent_completed = (now - start) / (warmup_time_period + time_period)\n yield (next_scheduled, sample_type, percent_completed, runner, params.params())\n next_scheduled = sched.next(next_scheduled)\n it += 1","def dice():\n return random.randrange(1, 7)","def gen_time(self):\n t_min = self.times['Min']\n t_max = self.times['Max']\n t_sig = self.times['Mean']\n # generating activity time based on truncnorm distribution\n # see StatDistExp jupyter notebook for more details\n # if in test sample, activity time mean/max brought 25% closer\n # the min\n if self.activity in self.test_sample:\n t_max = min(int(t_min + (t_max - t_min)*3/4), t_max-1)\n t_sig = min(int(t_min + (t_sig - t_min)*3/4), t_sig-1)\n t_max = max(t_max, 1)\n t_sig = max(t_sig, 1)\n t_scale = min(t_sig-t_min, t_max-t_sig)/3*2\n #accounting for when activity time is always 1 day\n if t_min == t_max == t_sig:\n self.sample = t_min\n else:\n #this is the normal case generation of activity time\n self.sample = truncnorm.rvs(a=t_min-t_sig, b=t_max-t_sig, scale=t_scale, size=1)[0]\n self.sample += t_sig\n self.sample = int(self.sample)","def punches(self):\n #:TODO Need to parameterize n\n # Initialize smoothing function\n # Also because I can't take the second derivitive\n\n n = 3\n assert (len(self.averages)==len(self.timestamps))\n size = len(self.averages)\n slopes = []\n for t in [0,size-n]:\n averages = np.asarray(self.averages[t:size])\n timestamps = np.asarray(self.timestamps[t:size])\n \"\"\"\n slope = np.absolute((np.corrcoef(averages,\n timestamps))*np.std(averages)/np.std(timestamps))\n \"\"\"\n slope = np.absolute(np.polyfit(timestamps, averages, 1)[0])*1000000\n #plt.scatter(timestamps, averages)\n slopes.append(slope)\n # If you were punching you are likely still punching need to set a weighting factor to this somehow\n # print(slopes[1])\n self.smoothing_queue.pop(0)\n if self.SIG_DELTA_AVERAGE < slopes[1]:\n self.smoothing_queue.append(1)\n else:\n self.smoothing_queue.append(0)\n if self.smoothing_queue.count(1) > len(self.smoothing_queue)/2:\n punching = True\n else: punching = False\n # print(self.smoothing_queue)\n\n return punching\n #self.counter +=1\n \"\"\"\n if self.counter==self.timing:\n self.counter == 0\n else:\n \"\"\"","def random_times(p):\n while True:\n if sum(p.values()) != 1:\n raise ValueError('Probabilities must sum to unity')\n r = random.random()\n remaining = 1\n for category, probability in p.items():\n remaining -= probability\n if remaining <= r:\n yield category\n break","def bernoulli_episode_scheduler(keep_probability: float) -> Scheduler:\n if keep_probability < 0.0 or keep_probability > 1.0:\n raise ValueError(\n f'keep_probability must be in [0,1], got: {keep_probability}')\n\n def f(data: step_data.StepData) -> bool:\n if data.timestep.last():\n f.current_p = np.random.random()\n return f.current_p < keep_probability\n\n f.current_p = np.random.random()\n\n return f","def artificial_data(dt1, dt2, minutes=1):\n\n def fxweek(x):\n return 2 - x * (1 - x)\n\n def sat(x):\n return 2 * x + 2\n\n data = []\n dt = datetime.timedelta(minutes=minutes)\n while dt1 < dt2:\n if dt1.weekday() == 6:\n dt1 += dt\n continue\n if minutes <= 120 and not (dt1.hour >= 8 and dt1.hour <= 18):\n dt1 += dt\n continue\n x = (dt1.hour - 8) / 10\n if dt1.weekday() == 5:\n y = sat(x)\n else:\n y = fxweek(x)\n data.append({'time': dt1, 'y': y})\n dt1 += dt\n df = pandas.DataFrame(data)\n df['y'] += numpy.random.randn(df.shape[0]) * 0.1\n df['time'] = pandas.DatetimeIndex(df['time'])\n return df","def test_1000_populations_with_activity_12perday_should_yield_24k_logs_in_2days():\n\n with path.tempdir() as log_parent_folder:\n log_folder = os.path.join(log_parent_folder, \"logs\")\n\n run_test_scenario_1(clock_step=\"15 min\",\n simulation_duration=\"2 days\",\n n_stories=12,\n per=pd.Timedelta(\"1day\"),\n log_folder=log_folder)\n\n logging.info(\"loading produced logs\")\n logs = load_all_logs(log_folder)[\"the_logs\"]\n\n # 2 days of simulation should produce 1000 * 12 * 2 == 24k logs\n logging.info(\"number of produced logs: {} logs\".format(logs.shape[0]))\n assert 22e3 <= logs.shape[0] <= 26e3","def generate_teacher_schedule_primary_daycare(N_classes):\n\n\tassert N_classes % 2 == 0, 'number of classes must be even'\n\n\t## teacher schedule\n\tN_teachers = get_N_teachers('primary_dc', N_classes)\n\tteacher_nodes = ['t{:04d}'.format(i) for i in range(1, N_teachers + 1)]\n\n\tN_teaching_hours = get_teaching_hours('primary_dc')\n\tmax_hours, N_weekdays, weekend_days = get_teaching_framework()\n\n\tschedule = {t:[] for t in teacher_nodes}\n\n\t# the first two hours are taught by teachers 1 to N_classes:\n\tfor i in range(1, N_classes + 1):\n\t\tschedule['t{:04d}'.format(i)].extend([i] * 2)\n\tfor i in range(N_classes + 1, N_classes * 2 + 1):\n\t\tschedule['t{:04d}'.format(i)].extend([pd.NA] * 2)\n\n\t# the third hour is also taught by teachers 1 to N_classes, but classes\n\t# are shifted:\n\tfor i in range(1, N_classes + 1):\n\t\tschedule['t{:04d}'.format(i)].append(i % N_classes + 1)\n\tfor i in range(N_classes + 1, N_classes * 2 + 1):\n\t\tschedule['t{:04d}'.format(i)].append(pd.NA)\n\t\t\n\t# the fourth hour is taught by teachers N_classes + 1 to N_classes * 2\n\tfor i, j in enumerate(range(N_classes + 1, N_classes * 2 + 1)):\n\t\tschedule['t{:04d}'.format(j)].append(i + 1)\n\tfor i in range(1, N_classes + 1):\n\t\tschedule['t{:04d}'.format(i)].append(pd.NA)\n\n\t# the fifth hour is lunchbreak for all teachers\n\tfor t in teacher_nodes:\n\t\tschedule[t].append(pd.NA)\n\t\t\n\t# the afternoon supervision is done by teachers N_classes + 1 to \n\t# N_classes * 2 and every two teachers supervise a group\n\tfor i, j in enumerate(range(N_classes + 1, N_classes * 2 + 1)):\n\t\tschedule['t{:04d}'.format(j)].extend(\\\n\t\t\t\t[int(i / 2 + 1)] * (max_hours - N_teaching_hours))\n\t# the rest of the teachers go home\n\tfor i in range(1, N_classes + 1):\n\t\tschedule['t{:04d}'.format(i)].extend(\\\n\t\t\t\t[pd.NA] * (max_hours - N_teaching_hours))\n\t\t\n\tschedule_df = pd.DataFrame(columns=['teacher'] + \\\n\t\t\t\t\t['hour_{}'.format(i) for i in range(1, max_hours + 1)])\n\tschedule_df['teacher'] = teacher_nodes * N_weekdays\n\titerables = [range(1, N_weekdays + 1), teacher_nodes]\n\tindex = pd.MultiIndex.from_product(iterables, names=['weekday', 'teacher'])\n\tschedule_df.index = index\n\tschedule_df = schedule_df.drop(columns = ['teacher'])\n\n\tfor wd in range(1, N_weekdays + 1):\n\t\tfor t in teacher_nodes:\n\t\t\tfor hour, c in enumerate(schedule[t]):\n\t\t\t\tif wd not in weekend_days:\n\t\t\t\t\tschedule_df.loc[wd, t]['hour_{}'.format(hour + 1)] = c\n\n\treturn schedule_df","def get_driver_schedule(self, duration_mins=60):\n elapsed_mins, schedule = 0, []\n while elapsed_mins < duration_mins:\n elapsed_mins += expon.ppf(random()) * self.mins_between_drivers\n schedule.append(elapsed_mins)\n return schedule","def generate_fire_time_series(self):\r\n self.fire_events =[]\r\n event = self.generate_fire_recurrence()\r\n end_event = event + 365.0\r\n self.fire_events.append([event, end_event])\r\n t = 0\r\n i = 0\r\n while t <= self.total_run_time:\r\n fire = self.generate_fire_recurrence()\r\n start_fire = self.fire_events[i][0] + (fire)\r\n end_fire = start_fire + (365.0) \r\n self.fire_events.append([start_fire, end_fire])\r\n t += end_fire\r\n i+=1","def simulate_hawkes_time_increment(runtime,\n dt=0.01,\n lbd=functions.kernel_zhao,\n p=functions.infectious_rate_tweets,\n start_time=0,\n int_fol_cnt=10000,\n follower_mean=200,\n split=0.02):\n events = [(0, int_fol_cnt)]\n lambda_t = [p(0) * int_fol_cnt * lbd(0)]\n memory_effect_t = [int_fol_cnt * lbd(0)]\n n = round(runtime / dt) # number of intervals\n\n for i in range(1, n):\n cur_interval = i * dt\n x = rand.uniform()\n memory_effect = sum([\n fol_cnt * lbd(cur_interval - event_time)\n for event_time, fol_cnt in events\n ])\n llambda = p(cur_interval + start_time\n ) * memory_effect * dt # intensity for current interval\n\n lambda_t.append(llambda)\n memory_effect_t.append(memory_effect)\n\n if x < llambda: # event occurred\n events.append((int(cur_interval),\n rand_followers_extended(int_fol_cnt, follower_mean,\n split)))\n return events, lambda_t, memory_effect_t","def make_transition_probs(self):\n n = len(self.speakers) # TODO why this line ???\n transitions = np.random.randint(5, size=(n, n)) + 1\n transitions += transitions.transpose()\n for i in range(0, math.floor(n / 2)):\n s1 = np.random.randint(n)\n s2 = np.random.randint(n)\n transitions[s1][s2] += 10\n transitions[s2][s1] += 8\n return(transitions)","def simulationDelayedTreatment(numTrials):\n \n #Initialization\n #delayList = [300, 150, 75, 0]\n delayList = [150]\n #Patient init variables\n numViruses = 100\n maxPop = 1000\n #Virus init variables\n maxBirthProb = 0.1\n clearProb = 0.05\n #clearProb = 0.10\n resistances = { 'guttagonol': True }\n mutProb = 0.005\n \n results = {}\n \n for n in delayList:\n cured = 0\n popList = []\n for i in range(numTrials):\n pop = runTrial(n, numViruses, maxPop, maxBirthProb, clearProb, resistances, mutProb)\n popList.append(pop)\n if pop == 0:\n cured +=1\n results[n] = popList\n #print popList\n print \"Delay : %(delay)d Percentage cured %(percent)2f\" % {\"delay\" : n, \"percent\" : cured/float(numTrials) }\n \n\n drawHist(results, numTrials)","def run_hourly_hygienist(self):\n self.ensure_timebox_trackers_accurate()\n self.copy_tasks_with_schedule_string()","def test_sevenreds(self):\n seq = [1, 1, 1, 1, 1, 1, 1, 2, 1, 1, 1, 1, 1, 1, 1]\n _SR = SevenReds(table=self.table, stake=100, rounds_to_go=100)\n\n for i in range(76):\n\n seed = seq.pop(0)\n self.nonrandom.set_seed(seed)\n self.game.cycle(_SR)\n seq.append(seed)\n if i < 7:\n # there should be non betting until round 8\n self.assertEqual(_SR.stake, 100)\n # 5 wins, 5 loses\n self.assertEqual(_SR.stake, 104)","def _generate_hourly_time_series(\n self,\n size: int,\n hourly_seasonality: float,\n hourly_seasonality_params: Optional[List[Tuple[float, float]]] = None,\n trend_params: Optional[List[TrendParams]] = None,\n weekday_dummy_params: Optional[List[float]] = None,\n annual_seasonality_params: Optional[List[Tuple[float, float]]] = None,\n holiday_alpha: float = 3.5,\n outlier_alpha: float = 2.5,\n noise_scale: float = 1.0,\n ):\n if hourly_seasonality_params is None:\n # Create 10 random hourly seasonality parameters\n hourly_seasonality_params = [\n (\n np.random.normal() / 100,\n np.random.normal() / 100,\n )\n for i in range(4)\n ]\n\n time_range = np.arange(size)\n\n hourly_seasonality_series = (\n self._generate_hourly_seasonality(\n time_range=time_range,\n hourly_seasonality_params=hourly_seasonality_params,\n )\n * hourly_seasonality\n )\n\n hourly_outliers = self._generate_posneg_pareto(outlier_alpha, size)\n\n daily_time_series = self._generate_daily_time_series(\n size=ceil(size / 24),\n trend_params=trend_params,\n weekday_dummy_params=weekday_dummy_params,\n annual_seasonality_params=annual_seasonality_params,\n holiday_alpha=holiday_alpha,\n outlier_alpha=1000000, # outlier_alpha,\n noise_scale=noise_scale,\n )\n return (\n np.exp(hourly_seasonality_series) * np.repeat(daily_time_series, 24)[:size]\n + hourly_outliers\n )","def example7(n):\n return mvmt.randomize(tile, n)","def generate_fire_recurrence(self):\n\n self.time_to_next_fire = round(weibullvariate(self.scale_parameter, self.shape_parameter),2)\n return self.time_to_next_fire","def migration_time(rand):\n ta=np.random.uniform(4,8)*1e4*yr\n K=np.power(10,rand)\n te=ta/K\n return ta, te","def get_timings(beat, max_length, rand_beat):\n BEATS = [int(beat/4),\n int(beat/2),\n int(beat),\n int(beat*2),\n int(beat*4)]\n\n total_steps = beat * max_length\n timings = [beat] * max_length\n\n if rand_beat == True:\n timings = []\n while total_steps > 0:\n duration = random.sample(BEATS, 1)[0]\n total_steps -= duration\n timings.append(duration)\n\n return timings","def part2() -> int:\n sleepiest_minute = None\n sleeping_guard = None\n sleep_frequency = 0\n\n for guard, times in sleep_times.items():\n if len(times) == 0:\n continue\n _sleepiest_minute = max(\n sleep_times[guard], key=sleep_times[guard].count)\n _sleep_frequency = sleep_times[guard].count(_sleepiest_minute)\n\n if _sleep_frequency > sleep_frequency:\n sleepiest_minute = _sleepiest_minute\n sleeping_guard = guard\n sleep_frequency = _sleep_frequency\n\n assert sleeping_guard is not None and sleepiest_minute is not None\n return sleeping_guard * sleepiest_minute","def generate_days_list():\n\n seven_days = []\n\n for i in xrange(1, 8):\n seven_days.append([i, 0])\n\n return seven_days","def gen_random_walk(self,n_step=100):\n # Warning about the small number of steps\n if n_step < 30:\n print(\"WARNING! The number of steps is small. It may not generate a good stochastic process sequence!\")\n \n w = np.ones(n_step)*self.x0\n \n for i in range(1,n_step):\n # Sampling from the Normal distribution with probability 1/2\n yi = np.random.choice([1,-1])\n # Weiner process\n w[i] = w[i-1]+(yi/np.sqrt(n_step))\n \n return w","def run_baseline_right_away(self, n_days_base, sim_time):\n baseline_power = np.zeros([sim_time, ])\n baseline_cycles = np.zeros([sim_time, ])\n baseline_Tin = np.zeros([sim_time, ])\n baseline_std_Tin = np.zeros([sim_time, ])\n baseline_Tin_max = np.zeros([sim_time, ])\n baseline_Tin_min = np.zeros([sim_time, ])\n baseline_soc = np.zeros([sim_time, ]) \n baseline_std_soc = np.zeros([sim_time, ]) \n\n EIRrated = 0.31019\n Qrated=14600\n\n # inputs and outputs path\n inputs_file='./fleets/HVAC_fleet/data_file/LasVegas_HighCDD.csv'\n bldg_file='./fleets/HVAC_fleet/data_file/normal_building_para.xlsx'\n save_dir='./fleets/HVAC_fleet/data_file/baseline'\n\n\n #read in weather data and increase resolution to match time step of simulation\n inputs=pd.read_csv(inputs_file, sep=',',skipfooter=48,engine='python')\n inputs[c.COL_DATETIME]=pd.to_datetime(inputs[c.COL_DATETIME])\n inputs=inputs.set_index(c.COL_DATETIME)\n inputs_ts=inputs.resample(str(self.sim_step)+'T').interpolate()\n \n for day in range(n_days_base):\n print(\"Day %i\" %(day+1))\n \n #initialize dataframes\n timeB = np.array(np.arange(0,60*60*24,self.sim_step))\n plot_timeB = np.array(np.arange(0,24,self.sim_step/3600))\n\n Tin=pd.DataFrame(data=0,index=timeB,columns=range(0,self.numHVAC))\n Tmass=pd.DataFrame(data=0,index=timeB,columns=range(0,self.numHVAC))\n Twall=pd.DataFrame(data=0,index=timeB,columns=range(0,self.numHVAC))\n Tattic=pd.DataFrame(data=0,index=timeB,columns=range(0,self.numHVAC))\n ACstatus=pd.DataFrame(data=0,index=timeB,columns=range(0,self.numHVAC))\n dTin=pd.DataFrame(data=0,index=timeB,columns=range(0,self.numHVAC))\n dTmass=pd.DataFrame(data=0,index=timeB,columns=range(0,self.numHVAC))\n dTwall=pd.DataFrame(data=0,index=timeB,columns=range(0,self.numHVAC))\n dTattic=pd.DataFrame(data=0,index=timeB,columns=range(0,self.numHVAC))\n Power=pd.DataFrame(data=0,index=timeB,columns=range(0,self.numHVAC))\n cycles=pd.DataFrame(data=0,index=timeB,columns=range(0,self.numHVAC))\n SOC=pd.DataFrame(data=0,index=timeB,columns=range(0,self.numHVAC))\n \n num_homes = self.numHVAC \n \n #Load building characteristics from file\n df_bldg=pd.DataFrame.from_csv(bldg_file,sep=',')\n \n #Initialize Temperatures and assign building and AC characteristics\n b=[0]*num_homes\n ac=[0]*num_homes\n\n for i in range(0,num_homes):\n b[i]=building(df_bldg.T_in[i],df_bldg.T_mass[i],df_bldg.T_wall[i],df_bldg.T_attic[i],df_bldg.Rwall[i],df_bldg.Rattic[i],df_bldg.Rwin[i],df_bldg.SHGC[i],df_bldg.Cwall[i],df_bldg.Cin[i],df_bldg.C1[i],df_bldg.C2[i],df_bldg.C3[i],df_bldg.Cattic[i],df_bldg.Rroof[i],df_bldg.Cmass[i],df_bldg.Rmass[i],df_bldg.Sp1[i],df_bldg.Sp2[i],df_bldg.Sp3[i],df_bldg.Qrated[i],df_bldg.EIRrated[i],df_bldg.TinWB[i],df_bldg.Initial_On[i])\n Tin.iloc[0,i]=b[i].T_in\n Tmass.iloc[0,i]=b[i].T_mass\n Twall.iloc[0,i]=b[i].T_wall\n Tattic.iloc[0,i]=b[i].T_attic\n\n ac[i]=AC(df_bldg.Qrated[i],df_bldg.EIRrated[i])\n \n #Main simulation loop \n for i in range(0,int(1440*60/self.sim_step)):\n for j in range(0,num_homes): \n \n if i>0: #initialize AC status for each timestep to prior state\n ACstatus.iloc[i,j]=ACstatus.iloc[i-1,j]\n else: #Set AC status based on file input for first timestep\n ACstatus.iloc[i,j]=b[j].Initial_On\n if Tin.iloc[i,j]>=self.Tset+self.deadband and ACstatus.iloc[max(i-self.shortcycle_ts,0):i,j].sum()==0: #if temp is above deadband and unit has not run in past duration corresponding to short cycle timer turn on unit\n ACstatus.iloc[i,j]=1.0\n if Tin.iloc[i,j]<=self.Tset-self.deadband: #if temperature is below bottom deadband, turn off unit\n ACstatus.iloc[i,j]=0.0\n #count cycles\n if i>0 and ACstatus.iloc[i-1,j]==1.0 and ACstatus.iloc[i,j]==0.0:\n cycles.iloc[i,j]=1.0\n \n #calculate power use for each AC based on status\n Power.iloc[i,j]=ACstatus.iloc[i,j]*Capacity(ac[j],inputs_ts[c.COL_TOUT][i],b[j].TinWB)*EIR(ac[j],inputs_ts[c.COL_TOUT][i],b[j].TinWB)\n \n # calculate SOC for each AC\n SOC.iloc[i,j] = (self.Tset+self.deadband - Tin.iloc[i,j])/(2*self.deadband)\n\n #building model dT calculations\n ts = self.sim_step\n dTin.iloc[i,j]=ts*1.0/b[j].Cin*((Twall.iloc[i,j]-Tin.iloc[i,j])*2.0/b[j].Rwall\n +(Tattic.iloc[i,j]-Tin.iloc[i,j])/b[j].Rattic\n +(Tmass.iloc[i,j]-Tin.iloc[i,j])/b[j].Rmass+inputs_ts[c.COL_QIHL][i]*b[j].C1*b[j].Sp1\n +inputs_ts[c.COL_RADWIN][i]*b[j].SHGC*25.76*b[j].C3*b[j].Sp3\n -ACstatus.iloc[i,j]*Capacity(ac[j],inputs_ts[c.COL_TOUT][i],b[j].TinWB)*SHR(inputs_ts[c.COL_TOUT][i],Tin.iloc[i,j],b[j].TinWB)*b[j].C2*b[j].Sp2\n +(inputs_ts[c.COL_TOUT][i]-Tin.iloc[i,j])/b[j].Rwin)\n dTmass.iloc[i,j]=ts*1.0/b[j].Cmass*((Tin.iloc[i,j]-Tmass.iloc[i,j])/b[j].Rmass\n +inputs_ts[c.COL_QIHL][i]*b[j].C1*(1-b[j].Sp1)\n +inputs_ts[c.COL_RADWIN][i]*b[j].SHGC*25.76*b[j].C3*(1-b[j].Sp3)\n -ACstatus.iloc[i,j]*Capacity(ac[j],inputs_ts[c.COL_TOUT][i],b[j].TinWB)*SHR(inputs_ts[c.COL_TOUT][i],Tin.iloc[i,j],b[j].TinWB)*b[j].C2*(1-b[j].Sp2))\n dTwall.iloc[i,j]=ts*1.0/b[j].Cwall*((inputs_ts['Tsolw'].iloc[i]-Twall.iloc[i,j])*2.0/b[j].Rwall\n +(Tin.iloc[i,j]-Twall.iloc[i,j])*2.0/b[j].Rwall)\n dTattic.iloc[i,j]=ts*1.0/b[j].Cattic*((inputs_ts['Tsolr'].iloc[i]-Tattic.iloc[i,j])/b[j].Rroof\n +(Tin.iloc[i,j]-Tattic.iloc[i,j])/b[j].Rattic)\n \n #calculate temperatures for next time step\n if i<(1440*60/ts-1):\n Tin.iloc[i+1,j]=Tin.iloc[i,j]+dTin.iloc[i,j]\n Tmass.iloc[i+1,j]=Tmass.iloc[i,j]+dTmass.iloc[i,j]\n Tattic.iloc[i+1,j]=Tattic.iloc[i,j]+dTattic.iloc[i,j]\n Twall.iloc[i+1,j]=Twall.iloc[i,j]+dTwall.iloc[i,j]\n\n # calculate peak power and plot data\n PeakPower=Power.sum(axis=1).max()*1.0 # plot out the peak power in kW\n Plot_Power=np.full(len(plot_timeB),PeakPower/1000.0)\n fig,ax = plt.subplots(2,1,figsize=(6,8),sharey='row')\n p1=ax[0].plot(plot_timeB,Power.sum(axis=1)/1000.0,color='blue',linestyle='solid',label='Baseline')\n ax[0].plot(plot_timeB,Plot_Power,color='black',linestyle='--',label='Targeted Power')\n ax[0].set_ylabel('Total Power (kW)')\n ax[1].set_ylabel('Indoor Temperature ($^\\circ$C)')\n ax[1].set_xlabel('Hour of Day')\n p2=ax[1].plot(plot_timeB,Tin.mean(axis=1),color='blue',linestyle='solid',label='Baseline Avg')\n p3=ax[1].plot(plot_timeB,Tin.max(axis=1),color='blue',linestyle='dotted',label='Baseline Min/Max')\n p4=ax[1].plot(plot_timeB,Tin.min(axis=1),color='blue',linestyle='dotted',label='_nolegend_')\n \n # Saves baseline data to csv\n #ToDo: needs cut the whole day simulation to compare only segment with providing grid services\n # But, that requires the simulation steps information.\n\n Power.to_csv(str(save_dir)+'\\\\Power_base'+'.csv')\n Tin.to_csv(str(save_dir)+'\\\\Tin_base'+'.csv')\n SOC.to_csv(str(save_dir)+'\\\\SOC_base'+'.csv')\n cycles.to_csv(str(save_dir)+'\\\\Cycles_base'+'.csv')\n \n # return values\n baseline_power = Power.sum(axis = 1)\n baseline_cycles = cycles.sum(axis = 1)\n\n baseline_soc = SOC.mean(axis = 1)\n baseline_std_soc = SOC.std(axis = 1)\n\n baseline_Tin = Tin.mean(axis = 1)\n baseline_std_Tin = Tin.std(axis = 1)\n baseline_Tin_max = Tin.max(axis=1)\n baseline_Tin_min = Tin.min(axis=1)\n \n return baseline_soc, baseline_std_soc, baseline_power, baseline_cycles, baseline_Tin, baseline_std_Tin, baseline_Tin_max, baseline_Tin_min","def randomWeights(patterns):\n weights = []\n for i in range(patterns):\n weights.append(random.random())\n return weights","def genWeather():\n\n weather = random.choice(weather_conditions.keys())\n condition = weather_conditions[weather]\n (tMax, tMin) = condition[\"temperature\"]\n (pMax, pMin) = condition[\"pressure\"]\n (hMax, hMin) = condition[\"humidity\"]\n\n return weather + \"|\" + str(round(random.uniform(tMax, tMin), 1)) + \"|\" + \\\n str(round(random.uniform(pMax, pMin), 1)) + \"|\" + \\\n str(random.randrange(hMax, hMin, -1))","def test_weekly_resolution_perfect_model(daily_initialized, daily_obs):\n weekly_pm = daily_initialized.resample(init=\"W\").mean()\n weekly_obs = daily_obs.resample(time=\"W\").mean()\n weekly_pm.lead.attrs[\"units\"] = \"weeks\"\n assert compute_hindcast(weekly_pm, weekly_obs).all()","def hr_report():\n\n # Load the peak data.\n db = Persistence()\n if not (activities := db.load_all()):\n print(\"No data to report on\")\n return\n\n # Find the maximum for each value.\n max = _load_max_values(activities)\n\n # Totals for the current week\n week_distance_total = 0\n week_elevation_total = 0\n week_duration_total = timedelta()\n week_work_days = 0\n week_5sec_average = []\n week_30sec_average = []\n week_60sec_average = []\n week_5min_average = []\n week_10min_average = []\n week_20min_average = []\n week_30min_average = []\n week_60min_average = []\n week_90min_average = []\n week_120min_average = []\n\n # Print the peak data for each week.\n current_weekday = None\n for activity in activities:\n\n # Time to break to a new week?\n if current_weekday is None or current_weekday > activity.start_time.weekday():\n if current_weekday:\n _print_footer(\n week_distance_total=week_distance_total,\n week_elevation_total=week_elevation_total,\n week_duration_total=week_duration_total,\n week_work_days=week_work_days,\n week_5sec_average=week_5sec_average,\n week_30sec_average=week_30sec_average,\n week_60sec_average=week_60sec_average,\n week_5min_average=week_5min_average,\n week_10min_average=week_10min_average,\n week_20min_average=week_20min_average,\n week_30min_average=week_30min_average,\n week_60min_average=week_60min_average,\n week_90min_average=week_90min_average,\n week_120min_average=week_120min_average,\n )\n week_distance_total = 0\n week_elevation_total = 0\n week_duration_total = timedelta(0)\n week_work_days = 0\n week_5sec_average = []\n week_30sec_average = []\n week_60sec_average = []\n week_5min_average = []\n week_10min_average = []\n week_20min_average = []\n week_30min_average = []\n week_60min_average = []\n week_90min_average = []\n week_120min_average = []\n\n _print_header()\n\n # Capture the weekday.\n if current_weekday is None or current_weekday != activity.start_time.weekday():\n week_work_days = week_work_days + 1\n\n current_weekday = activity.start_time.weekday()\n\n # Print the detail.\n _print_detail(activity, max)\n\n # Find the duration.\n duration = activity.end_time - activity.start_time\n\n # Accumulate for this week\n week_distance_total = week_distance_total + activity.distance\n if activity.elevation:\n week_elevation_total = week_elevation_total + activity.elevation\n week_duration_total = week_duration_total + duration\n week_5sec_average.append(activity.peak_5sec_hr)\n week_30sec_average.append(activity.peak_30sec_hr)\n week_60sec_average.append(activity.peak_60sec_hr)\n if activity.peak_5min_hr:\n week_5min_average.append(activity.peak_5min_hr)\n if activity.peak_10min_hr:\n week_10min_average.append(activity.peak_10min_hr)\n if activity.peak_20min_hr:\n week_20min_average.append(activity.peak_20min_hr)\n if activity.peak_30min_hr:\n week_30min_average.append(activity.peak_30min_hr)\n if activity.peak_60min_hr:\n week_60min_average.append(activity.peak_60min_hr)\n if activity.peak_90min_hr:\n week_90min_average.append(activity.peak_90min_hr)\n if activity.peak_120min_hr:\n week_120min_average.append(activity.peak_120min_hr)\n\n # Final footer.\n _print_footer(\n week_distance_total=week_distance_total,\n week_elevation_total=week_elevation_total,\n week_duration_total=week_duration_total,\n week_work_days=week_work_days,\n week_5sec_average=week_5sec_average,\n week_30sec_average=week_30sec_average,\n week_60sec_average=week_60sec_average,\n week_5min_average=week_5min_average,\n week_10min_average=week_10min_average,\n week_20min_average=week_20min_average,\n week_30min_average=week_30min_average,\n week_60min_average=week_60min_average,\n week_90min_average=week_90min_average,\n week_120min_average=week_120min_average,\n )\n\n # Print the summary.\n _print_summary(max)","def generate_fire_time_series(self):\n\n self.fire_events =[]\n event = self.generate_fire_recurrence()\n end_event = event + 365.0\n self.fire_events.append([event, end_event])\n t = 0\n i = 0\n while t <= self.total_run_time:\n fire = self.generate_fire_recurrence()\n start_fire = self.fire_events[i][0] + (fire)\n end_fire = start_fire + (365.0)\n self.fire_events.append([start_fire, end_fire])\n t += end_fire\n i+=1","def _scheduled_sampling(self):\n step = tf.train.get_or_create_global_step()\n step = tf.cast(step, tf.float32)\n progress = tf.minimum(\n (step-self.args.warmup_step) / float(self.args.max_step-self.args.warmup_step), 1.0)\n return tf.minimum(1.0, 1.0 - progress * (1.0 -self.args.min_rate))","def get_heating_and_cooling_schedule(region: int) -> (np.ndarray, np.ndarray, np.ndarray):\n\n heating_period = np.array([\n [True] * 157 + [False] * 110 + [True] * 98,\n [True] * 154 + [False] * 115 + [True] * 96,\n [True] * 150 + [False] * 123 + [True] * 92,\n [True] * 149 + [False] * 125 + [True] * 91,\n [True] * 134 + [False] * 149 + [True] * 82,\n [True] * 110 + [False] * 198 + [True] * 57,\n [True] * 85 + [False] * 245 + [True] * 35,\n [True] * 0 + [False] * 365 + [True] * 0,\n ][region - 1])\n\n cooling_period = np.array([\n [False] * 190 + [True] * 53 + [False] * 122,\n [False] * 195 + [True] * 48 + [False] * 122,\n [False] * 190 + [True] * 53 + [False] * 122,\n [False] * 190 + [True] * 53 + [False] * 122,\n [False] * 186 + [True] * 57 + [False] * 122,\n [False] * 149 + [True] * 117 + [False] * 99,\n [False] * 134 + [True] * 152 + [False] * 79,\n [False] * 83 + [True] * 265 + [False] * 17,\n ][region - 1])\n\n hc_period = np.where(heating_period, 'h', np.where(cooling_period, 'c', 'm'))\n\n return np.repeat(hc_period, 24)","def minute_asleep_frequency(self):\n minutes_asleep = defaultdict(int)\n for shift in self.shifts:\n for minute in shift.minutes_asleep:\n minutes_asleep[minute] += 1\n return minutes_asleep","def generate_teacher_schedule_lower_secondary_daycare(N_classes):\n\tassert N_classes % 2 == 0, 'number of classes must be even'\n\n\tN_teachers = get_N_teachers('lower_secondary_dc', N_classes)\n\tN_hours = get_teaching_hours('lower_secondary_dc')\n\tmax_hours, N_weekdays, weekend_days = get_teaching_framework()\n\tdaycare_hours = range(N_hours + 1, max_hours)\n\tif 5 in daycare_hours:\n\t\tdaycare_hours.remove(5)\n\tteacher_nodes = ['t{:04d}'.format(i) for i in range(1, N_teachers + 1)]\n\t\n\n\t# for lower secondary schools with daycare, there are 3 teachers per class\n\t# 5 out of 6 hours / day are taught in team-teaching and daycare supervision\n\t# of each group is also done by two teachers. To create the schedule for the\n\t# teachers, we have to make sure that no teacher teaches two classes at the \n\t# same time and that teachers see a different class every hour (to account \n\t# for the number of classes a teacher sees on average, according to the \n\t# interviews we conducted). The following solution is a bit hacky but gets \n\t# the job done:\n\n\t# first, we construct a sequential list of length N_classes * 6, to ensure \n\t# that in every hour there is at least one teacher in every class \n\n\t# during the first three hours, all teachers teach once\n\tfirst_teacher_list = list(range(1, N_teachers + 1)) \n\t# by shifting the list by 1 for the hours 4-6, we ensure that no teacher \n\t# teaches the same class twice\n\tfirst_teacher_list.extend(list(range(2, N_teachers + 1)) + [1]) \n\t# the list is then reshaped into an N_hours X N_classes array - the schedule\n\tfirst_teacher_list = np.asarray(first_teacher_list)\n\tfirst_teachers = first_teacher_list.reshape((N_hours, N_classes))\n\t# we convert the array to a data frame for easier indexing when we create \n\t# the overall teacher schedule below\n\tfirst_teacher_schedule = pd.DataFrame(columns=['hour'] + \\\n\t\t\t\t['class_{}'.format(i) for i in range(1, N_classes + 1)])\n\tfirst_teacher_schedule['hour'] = [i for i in range(1, N_hours + 1)]\n\n\tfor i in range(0, N_classes):\n\t\tfirst_teacher_schedule['class_{}'.format(i + 1)] = first_teachers[0:,i]\n\tfirst_teacher_schedule.index = first_teacher_schedule['hour']\n\tfirst_teacher_schedule = first_teacher_schedule.drop(columns = ['hour'])\n\t\t\n\t# then we construct a sequential list of length N_classes * 5, intended to \n\t# add a second teacher to 5 out of 6 lessons per day. The list is shifted in\n\t# such a way that no teacher teaches the same class twice or is supposed to\n\t# teach two classes during the same time\n\tsecond_teacher_list = list(range(9, N_teachers + 1)) + list(range(1, 9))\n\tsecond_teacher_list.extend(list(range(4, 4 + N_classes * 2)))\n\t# the list is reshaped into a 5 hours X N_classes array, which is then \n\t# superimposed with the schedule of first teachers, to create the team-\n\t# teaching schedule\n\tsecond_teacher_list = np.asarray(second_teacher_list)\n\tsecond_teachers = second_teacher_list.reshape((5, N_classes))\n\tsecond_teacher_schedule = pd.DataFrame(columns=['hour'] + \\\n\t\t\t\t['class_{}'.format(i) for i in range(1, N_classes + 1)])\n\tsecond_teacher_schedule['hour'] = [i for i in range(1, 5 + 1)]\n\tfor i in range(0, N_classes):\n\t\tsecond_teacher_schedule['class_{}'.format(i+1)] = second_teachers[0:, i]\n\tsecond_teacher_schedule.index = second_teacher_schedule['hour']\n\tsecond_teacher_schedule = second_teacher_schedule.drop(columns = ['hour'])\n\n\t# the overall schedule is a table of (N_weekdays * N_teachers) X N_hours,\n\t# in which the entries are the class that is taught by a given teacher in a\n\t# given time. We construct this table from the first teacher schedule and \n\t# the second teacher schedule\n\tschedule_df = pd.DataFrame(columns=['teacher'] + ['hour_{}'.format(i) for\\\n\t\t\t i in range(1, max_hours + 1)])\n\tschedule_df['teacher'] = teacher_nodes * N_weekdays\n\titerables = [range(1, N_weekdays + 1), teacher_nodes]\n\tindex = pd.MultiIndex.from_product(iterables, names=['weekday', 'teacher'])\n\tschedule_df.index = index\n\tschedule_df = schedule_df.drop(columns = ['teacher'])\n\n\tfor c in range(1, N_classes + 1):\n\t\tfor hour in range(1, N_hours + 1):\n\t\t\tfor wd in range(1, N_weekdays):\n\t\t\t\tif not wd in weekend_days:\n\t\t\t\t\tt1 = first_teacher_schedule.loc[hour, 'class_{}'.format(c)]\n\t\t\t\t\tschedule_df.loc[wd, 't{:04d}'.format(t1)]\\\n\t\t\t\t\t\t['hour_{}'.format(hour)] = c\n\t\t\t\t\t# not all hours have a second teacher\n\t\t\t\t\ttry:\n\t\t\t\t\t\tt2 = second_teacher_schedule.loc[\\\n\t\t\t\t\t\t\t\t\t\thour, 'class_{}'.format(c)]\n\t\t\t\t\t\tschedule_df.loc[wd, 't{:04d}'.format(t2)]\\\n\t\t\t\t\t\t\t['hour_{}'.format(hour)] = c\n\t\t\t\t\texcept KeyError:\n\t\t\t\t\t\tpass\n\n\t# daycare is handled separately: in the afternoon, half of the students go \n\t# home and the other half are randomly distributed to a number of groups \n\t# equal to N_classes / 2. These groups are supervised by two teachers each. \n\t# The supervising teachers are the first N_classes teachers and the last \n\t# N_classes teachers, since these teachers have a smaller number of team-\n\t# teaching lessons than the other teachers\n\tdaycare_teacher_list = list(range(1, int(N_classes / 2) + 1))\n\tdaycare_teacher_list.extend(list(range(N_teachers - int(N_classes / 2) + 1,\\\n\t\t\t\t\t\t\t\t\t\t N_teachers + 1)))\n\tdaycare_teacher_list = np.asarray(daycare_teacher_list)\\\n\t\t\t\t\t\t\t .reshape((2, int(N_classes / 2)))\n\t# add the daycare supervision to the overall teacher schedule\n\tfor dc_group in range(0, int(N_classes / 2)):\n\t\tfor t in daycare_teacher_list[0:, dc_group]:\n\t\t\tfor wd in range(1, N_weekdays + 1):\n\t\t\t\tif wd not in weekend_days:\n\t\t\t\t\tfor hour in daycare_hours:\n\t\t\t\t\t\tschedule_df.loc[wd, 't{:04d}'.format(t)]\\\n\t\t\t\t\t\t\t['hour_{}'.format(hour)] = dc_group + 1\n\n\n\tschedule_df = schedule_df.replace({np.nan:pd.NA})\n\t# shift afternoon teaching hours by one to make space for the lunch break\n\t# in the fifth hour:\n\tschedule_df = schedule_df.rename(columns={\n\t\t\t\t'hour_9':'hour_5', 'hour_5':'hour_6','hour_6':'hour_7',\n\t\t\t\t'hour_7':'hour_8', 'hour_8':'hour_9'})\n\tschedule_df = schedule_df[['hour_{}'.format(i) \\\n\t\t\t\tfor i in range(1, max_hours + 1)]]\n\n\treturn schedule_df","def run_experiment():\n return [random.random() < 0.5 for _ in range(1000)]","def run_experiment():\n return [random.random() < 0.5 for _ in range(1000)]","def run_experiment():\n return [random.random() < 0.5 for _ in range(1000)]","def run_experiment():\n return [random.random() < 0.5 for _ in range(1000)]","def _burn_cpu():\n while True:\n random()*random()","def schedulebuzzerrooms(self, field):\n divisions = ['8', '7', 'Elementary']\n field = list(filter(lambda stu: stu.bee, field))\n for player in field:\n player.schedule = list(sorted(player.schedule, key=itemgetter(1)))\n\n # create a list of players in each round (1 - 16)\n playersperround = [[] for _ in range(len(self.buzzerschedule))]\n for i, time in enumerate(self.buzzerschedule, 0):\n for player in field:\n for event in player.schedule:\n if time in event:\n playersperround[i].append(player)\n\n # create a list of rooms being used to try and spread across hotels\n \"\"\"\n totrooms = [[] for _ in range(len(self.buzzerschedule))]\n for i, rnd in enumerate(totrooms):\n k = len(list(filter(lambda stu: stu.division == '8' and stu.seed == 'a', playersperround[i])))\n k += len(list(filter(lambda stu: stu.division == '7' and stu.seed == 'a', playersperround[i])))\n k += len(list(filter(lambda stu: stu.division == 'Elementary' and stu.seed == 'a', playersperround[i])))\n rnd = range(1, MAX_ROOMS + 1)\n numtoremove = MAX_ROOMS - k\n toremove = sample(rnd, numtoremove)\n rnd = [x for x in rnd if x not in toremove]\n shuffle(rnd)\n totrooms[i] = rnd\n \"\"\"\n\n totrooms = [[1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 22, 23, 24, 25, 26, 27, 28, 29, 30, 33, 34, 35, 36, 39, 40, 41],\n [1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 22, 23, 24, 25, 26, 27, 28, 29, 30, 33, 34, 35, 36, 39, 40, 41],\n [1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 22, 23, 24, 25, 26, 27, 28, 29, 30, 33, 34, 35, 36, 39, 40, 41],\n [1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 22, 23, 24, 25, 26, 27, 28, 29, 30, 33, 34, 35, 36, 39, 40, 41],\n [1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 22, 23, 24, 25, 26, 27, 28, 29, 30, 33, 34, 35, 36, 39, 40, 41, 42],\n [1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 22, 23, 24, 25, 26, 27, 28, 29, 30, 33, 34, 35, 36, 39, 40, 41, 42],\n [1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 22, 23, 24, 25, 26, 27, 28, 29, 30, 33, 34, 35, 36, 39, 40, 41, 42],\n [1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 22, 23, 24, 25, 26, 27, 28, 29, 30, 33, 34, 35, 36, 39, 40, 41, 42],\n [1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 22, 23, 24, 25, 26, 27, 28, 29, 30, 33, 34, 35, 36, 39, 40, 41],\n [1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 22, 23, 24, 25, 26, 27, 28, 29, 30, 33, 34, 35, 36, 39, 40, 41],\n [1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 22, 23, 24, 25, 26, 27, 28, 29, 30, 33, 34, 35, 36, 39, 40, 41],\n [1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 22, 23, 24, 25, 26, 27, 28, 29, 30, 33, 34, 35, 36, 39, 40, 41],\n [1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 22, 23, 24, 25, 26, 27, 28, 29, 30, 33, 34, 35, 36, 39, 40, 41, 42],\n [1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 22, 23, 24, 25, 26, 27, 28, 29, 30, 33, 34, 35, 36, 39, 40, 41, 42],\n [1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 22, 23, 24, 25, 26, 27, 28, 29, 30, 33, 34, 35, 36, 39, 40, 41, 42],\n [1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 22, 23, 24, 25, 26, 27, 28, 29, 30, 33, 34, 35, 36, 39, 40, 41, 42]]\n\n for rnd in totrooms:\n shuffle(rnd)\n\n # for each round, assign the players in totrooms to a room\n count = 0\n for rnd, rooms in enumerate(totrooms):\n tosched = playersperround[rnd]\n for div in divisions:\n divforround = list(filter(lambda stu: stu.division == div, tosched))\n for i in range(\n len(list(filter(lambda stu: stu.division == div and stu.seed == 'a', playersperround[rnd])))):\n room = sample(rooms, 1)[0]\n roomplayers = self.pickten(divforround)\n rooms.remove(room)\n for player in roomplayers:\n self.buzzerrooms[rnd][room - 1].addplayer(player)\n for ev in player.schedule:\n if ev[0] == \"History Bee Buzzer Round\" and ev[1] == self.buzzerschedule[rnd]:\n ev[2] = \"ACE Room \" + str(room)\n count += 1","def test_random(year, site):\n res_file = os.path.join(TESTDATADIR,\n 'wtk/ri_100_wtk_{}.h5'.format(year))\n sam_files = os.path.join(TESTDATADIR,\n 'SAM/wind_gen_standard_losses_0.json')\n results = []\n no_curtail = None\n curtailment = {\"dawn_dusk\": \"nautical\", \"months\": [4, 5, 6, 7],\n \"precipitation\": None, \"probability\": 1,\n \"temperature\": None, \"wind_speed\": 10.0}\n prob_curtail = {\"dawn_dusk\": \"nautical\", \"months\": [4, 5, 6, 7],\n \"precipitation\": None, \"probability\": 0.5,\n \"temperature\": None, \"wind_speed\": 10.0}\n\n for c in [no_curtail, curtailment, prob_curtail]:\n\n points = slice(site, site + 1)\n\n # run reV 2.0 generation and write to disk\n gen = Gen('windpower', points, sam_files, res_file,\n output_request=('cf_profile',), curtailment=c,\n sites_per_worker=50, scale_outputs=True)\n gen.run(max_workers=1)\n\n results.append(gen.out['cf_mean'])\n\n assert results[0] > results[1], 'Curtailment did not decrease cf_mean!'\n\n expected = (results[0] + results[1]) / 2\n diff = expected - results[2]\n msg = ('Curtailment with 50% probability did not result in 50% less '\n 'curtailment! No curtailment, curtailment, and 50% curtailment '\n 'have the following cf_means: {}'.format(results))\n assert diff <= 2, msg","def return_weekly_figure():\n today = datetime.datetime.now()\n\n while 1:\n try:\n today_str = str(today.day) + \"/\" + \"{:02d}\".format(today.month) + \"/\" + str(today.year)\n match = covid_table.find(date=today_str)\n match.next()\n running_total = 0\n for i in range(7):\n running_total += return_daily_figure(today)\n today = today - datetime.timedelta(days=1)\n average_dose_per_day = round(running_total/7)\n return running_total, average_dose_per_day \n except:\n today = today - datetime.timedelta(days=1)","def weekly():\n\n response = {}\n\n # 0..6 => Sunday..Saturday\n for i in range(7):\n hours = []\n interactions = 0\n\n for j in range(25):\n try:\n wfile = open(common.stats_path + '/weekly-average/' + str(i) + '/' + str(j))\n data = wfile.read()\n\n if j == 24:\n interactions = int(data)\n else:\n hours.append(int(data))\n\n wfile.close()\n except IOError:\n if i < 24:\n hours.append(0)\n\n response[DAYS[i]] = {'hours': hours, 'interactions': interactions}\n\n return response","def getProbabilityDistribution(probEnter = 0.8):\n idealTimer = probEnter * 5\n initialProbs = [0.05, 0.05, 0.05, 0.05, 0.05]\n for i in range(5):\n if idealTimer <= i + 1:\n initialProbs[i] = 0.6\n if i == 0:\n initialProbs[1] = 0.2\n initialProbs[2] = 0.1\n elif i == 4:\n initialProbs[3] = 0.2\n initialProbs[2] = 0.1\n else:\n initialProbs[i + 1] = 0.15\n initialProbs[i - 1] = 0.15\n\n return initialProbs","def shotgenerator():\n return random.randint(0, 9), random.randint(0, 9)","def test_wake_hour_less_than_sleep_hour(self):\n self.mock_clock.now.return_value = datetime.datetime(2016, 5, 24, 0)\n sleep_windows = [(22, 8)]\n pump_sched = pump_scheduler.PumpScheduler(self.mock_clock,\n sleep_windows)\n self.assertFalse(pump_sched.is_running_pump_allowed())","def __fill_person (self, person):\n \n scheduled = True\n while person.get_monthly_hours_difference (self.date) > 0 and scheduled:\n scheduled = False\n #schedule person\n scheduling_units = self.__get_emptiest (person)\n dates = self.workers.get_dates ( )\n for date in dates:\n for scheduling_unit in scheduling_units:\n \n turnuses = list (self.mapper.get_turnuses (scheduling_unit, person))\n random.shuffle (turnuses)\n \n for turnus in turnuses:\n if self.__is_valid_move (scheduling_unit, turnus, date, person, True):\n person.schedule_turnus (date, turnus, scheduling_unit)\n \n #block the previous day, if it was the night turnus\n prev_date = date - datetime.timedelta(days=1)\n if turnus.code[0] == 'N' and not person.is_blocked(prev_date, turnus):\n person.add_invalid_turnus(prev_date, turnus)\n \n # the is valid move has taken care of any potential violations, so that you\n # can just schedule turnuses\n if person.packet_night_turnuses and turnus.code[0] == 'N':\n next_date = date + datetime.timedelta(days=1)\n person.schedule_turnus (next_date, turnus, scheduling_unit)\n #if it is Saturday, schedule one more\n if next_date.weekday() == 5:\n next_date += datetime.timedelta(days=1)\n #find the workfree night turnus\n night_turnus = None\n for temp_turnus in self.mapper.get_turnuses (scheduling_unit, person):\n if temp_turnus.holiday and temp_turnus.code[0] == 'N':\n night_turnus = temp_turnus\n break\n else:\n raise Exception ('Napaka pri dodajanju osebe z zdruzenimi nocnimi turnusi.')\n person.schedule_turnus(next_date, night_turnus, scheduling_unit)\n if turnus.code[0] == 'N' and not person.is_blocked(next_date + datetime.timedelta(days=1), turnus):\n person.add_invalid_turnus(next_date + datetime.timedelta(days=1), turnus)\n else:\n if turnus.code[0] == 'N' and not person.is_blocked(next_date + datetime.timedelta(days=1), turnus):\n person.add_invalid_turnus(next_date + datetime.timedelta(days=1), turnus) \n \n if holiday.is_workfree(date):\n schedule_utils.add_free_day (person, date)\n scheduled = True\n if person.get_monthly_hours_difference (self.date) <= 0:\n return\n else:\n scheduled = False\n if person.get_monthly_hours_difference (self.date) <= 0:\n return","def data_feeder_2():\n return random.sample(range(100), 10)","def generation(Duration, amount):\n # Generate group sizes, the total group number is \"amount\"， the number of people in each group is between 1 and 6\n size = np.random.randint(1, 7, amount)\n # Generate vip situation, based on the probability of 8%\n vip = []\n for i in range(amount):\n num = np.random.randint(0, 101, 1)\n if (num >= 0) & (num <= 8):\n vip.append(True)\n else:\n vip.append(False)\n # Generate the registration time for each group\n timestamp_list = mod_pert_random(0, Duration // 2, Duration, samples=amount).astype(int)\n timestamp_list = list(timestamp_list)\n\n counter = 0\n queue_2 = Queue()\n queue_4 = Queue()\n queue_6 = Queue()\n\n table_2, table_4, table_6 = tablesSetting(6, 4, 2) # Initializing tables\n\n total_timeR_2 = [] # For calculating total average waiting time\n nextGroup_endTime_2 = {} # {No. of table: the ending time of the table}\n\n total_timeR_4 = []\n nextGroup_endTime_4 = {}\n total_timeR_6 = []\n nextGroup_endTime_6 = {}\n\n groupNumb = 0 # all group have their unique ID\n\n for i in range(Duration):\n while i in timestamp_list:\n if size[counter] == 1 or size[counter] == 2:\n queue_2.add_queue(Group(i, 2, vip[counter], groupNumb))\n counter += 1\n groupNumb += 1\n elif size[counter] == 3 or size[counter] == 4:\n queue_4.add_queue(Group(i, 4, vip[counter], groupNumb))\n counter += 1\n groupNumb += 1\n elif size[counter] == 5 or size[counter] == 6:\n queue_6.add_queue(Group(i, 6, vip[counter], groupNumb))\n counter += 1\n groupNumb += 1\n timestamp_list.remove(i) # Deal with the situation that several groups arrive at the same time point\n\n # Run the simulation\n simulation(i, table_2, Duration, queue_2, total_timeR_2, nextGroup_endTime_2)\n simulation(i, table_4, Duration, queue_4, total_timeR_4, nextGroup_endTime_4)\n simulation(i, table_6, Duration, queue_6, total_timeR_6, nextGroup_endTime_6)\n\n # Summary\n if i == Duration-1:\n print(\"Total groups served (groups who finished their meal or on the table currently):\",\n len(total_timeR_2)+len(total_timeR_4)+len(total_timeR_6))\n avg=(sum(total_timeR_2)+sum(total_timeR_4)+sum(total_timeR_6))/(len(total_timeR_2)+len(total_timeR_4)+len(total_timeR_6))\n print('Average waiting time for groups served: {0:.2f}'.format(avg), \"minute(s)\")","def determine_sleep_times(self):\n\n determined_sleep_time = \\\n random.randrange(self.dns_conf.min_backoff_range,\n self.dns_conf.max_backoff_range)\n\n backoff = [(2 ** i) * determined_sleep_time for i in\n range(0, self.dns_conf.retries)]\n\n return backoff","def sample_times(times, num_examples):\n sample = random.sample(times, num_examples)\n make_hist(sample, 10, 'Sample of Size ' + str(num_examples),\n 'Minutes to Complete Race', 'Number of Runners')","def generate_fire_recurrence(self):\n self._time_to_next_fire = round(\n weibullvariate(self._scale_parameter, self._shape_parameter), 2\n )\n return self._time_to_next_fire","def calculateScheduleDHL(self, dayHourList):\n schedule = self.blankSchedule()\n for dayHour in dayHourList:\n schedule[dayHour[0]][dayHour[1]] = 1\n return schedule","def simulate_fish_population(fish, days):\n for _ in range(days):\n new_fish = []\n for fish in fish:\n if fish == 0:\n new_fish.append(6)\n new_fish.append(8)\n else:\n new_fish.append(fish - 1)\n fish = new_fish\n return fish","def generate_zonal_demand(self, t):\n t_hour = (t / 3600)\n t_15_min = convert_seconds_to_15_min(t)\n\n # this needs to be double checked\n if self.WARMUP_PHASE and t >= self.ANALYSIS_TIME_SECONDS:\n # print(\"changing demand rate from warm up to analysis\")\n # self.set_analysis_time(self.ANALYSIS_TIME_HOUR)\n self.WARMUP_PHASE = False\n # update drivers infor/expectations\n\n # generate demand only every 15 minutes\n if t % 900 == 0:\n for z in self.zones:\n z.generate_requests_to_time(t) # t is seconds","def create_trials(self):\n exp_s = self.settings['experiment']\n\n # get stimuli\n with h5py.File(exp_s['stim_file'], 'r') as f:\n self.stim_rgb_arr = np.array(f['patterns'])\n self.stimuli = [GratingStim(win=self.session.win, tex=s.T)\n for s in self.stim_rgb_arr]\n self.fixation_dot = Circle(self.win, radius=0.1, edges=100, color='r')\n\n # timings that define how many trials etc.\n mean_trial_duration = exp_s['isi_min'] + exp_s['isi_mean']\n self.n_trials = round(\n (exp_s['total_run_duration'] - (exp_s['start_end_period'] * 2)) / mean_trial_duration)\n tolerance_range = [exp_s['total_run_duration'] - exp_s['temporal_tolerance'],\n exp_s['total_run_duration'] + exp_s['temporal_tolerance']]\n\n # and then search for the right isis to fill up the experiment exactly.\n isis = np.random.exponential(\n exp_s['isi_mean'], n_trials) + exp_s['isi_min']\n exp_duration = isis + (exp_s['start_end_period'] * 2)\n while exp_duration < tolerance_range[0] or exp_duration > tolerance_range[1]:\n isis = np.random.exponential(\n exp_s['isi_mean'], n_trials) + exp_s['isi_min']\n exp_duration = isis + (exp_s['start_end_period'] * 2)\n pretimes = np.zeros(self.n_trials)\n pretimes[[0, -1]] = exp_s['start_end_period']\n\n # deciding which stimuli to show when\n self.how_many_images_per_trial = exp_s['stim_flicker_freq'] * \\\n exp_s['stim_duration']\n self.duration_per_image = 1.0/exp_s['stim_flicker_freq']\n\n trial_images = np.random.randint(len(self.stimuli), size=(\n self.n_trials, self.how_many_images_per_trial))\n\n for i in range(self.n_trials):\n self.trials.append(HRFMapperTrial(\n session=self,\n trial_nr=i,\n phase_durations=[\n pretimes[i], exp_s['stim_duration'], isis[i]-exp_s['stim_duration']],\n phase_names=['slack', 'stim', 'isi'],\n parameters={'isi': isis[i],\n 'stim_list': trial_images[i]},\n timing='seconds',\n load_next_during_phase=None,\n verbose=True,\n condition='hrf'\n ))","def __dice_generator(self):\n self.current_dice = np.random.randint(1, 6 + 1)","def generate_synth_data(n):","def sim_alternating_exp():\n catches = 0\n for _ in range(100000):\n j = np.random.uniform()*1000\n # j = np.random.exponential(500)\n t_i = 0\n i = 0\n while t_i < j+100:\n if i % 2 == 1:\n t_i += np.random.exponential(10)\n else:\n t_i += np.random.exponential(20)\n if j < t_i and t_i < j+1:\n catches += 1\n i += 1\n print(catches/100000)","def test_power(self):\r\n a = 6 # shape\r\n samples = 5000\r\n max = -0.06\r\n min = -3.3\r\n s = np.random.power(a, samples) * -1 * (min - max) + min\r\n plt.hist(s, bins=30, density=False)\r\n plt.xlabel('Interlayer point energy [eV]')\r\n plt.ylabel('Frequency')\r\n plt.show()","def sim_an_reheat(neighborhood, Tmax, Tmin, iterations):\n\n temp = Tmax\n\n # set iteration number to 0 at start\n n = 0\n\n plot_list = []\n\n current_costs = neighborhood.get_total_costs()\n cooling_rate = float(Tmin/Tmax)**(1/iterations)\n\n reheat_moment = 0.99\n reheat_factor = 0.7\n\n reheated = False\n\n while n < iterations:\n\n\n if n == iterations * reheat_moment and not reheated:\n print(f\"costs before: {neighborhood.get_total_costs()}\")\n n -= (n * reheat_factor)\n # print(f\"n aftere: {n}\")\n # print(\"yes\")\n reheated = True\n\n\n # adjust temperature according to exponential cooling scheme\n temp = Tmax * (float(cooling_rate)**float(n))\n #\n # print(f\"{n}, {temp}\")\n\n swap_succes = False\n while not swap_succes:\n cable_1 = random.choice(neighborhood.cables)\n cable_2 = random.choice(neighborhood.cables)\n swap_succes = neighborhood.swap_connection(cable_1, cable_2)\n\n new_costs = neighborhood.get_total_costs()\n if (acceptance_probability(current_costs, new_costs, temp) > random.random()):\n current_costs = new_costs\n else:\n cable_1 = neighborhood.cables[-1]\n cable_2 = neighborhood.cables[-2]\n neighborhood.swap_connection(cable_1, cable_2)\n\n plot_list.append(current_costs)\n n += 1\n\n print(f\"costs after: {neighborhood.get_total_costs()}\")","def randomDays(self):\n flag = False\n while not flag:\n r = np.floor(np.random.rand() * len(self.df.index))\n start = self.df.index[r]\n if r+self.daysHeld < len(self.df.index)-1:\n end = self.df.index[r+self.daysHeld]\n flag = True\n return (start,end)","def sample_times():\n\tthe_times = []\n\tday = config.window_start_date\n\twhile day <= config.window_end_date:\n\t\t# times from start of window on day to end of window \n\t\ttime = config.tz.localize( datetime.combine( \n\t\t\tday, config.window_start_time \n\t\t) )\n\t\tend_time = config.tz.localize( datetime.combine( \n\t\t\tday, config.window_end_time \n\t\t) )\n\t\twhile time < end_time: # While still in the time window\n\t\t\tthe_times.append( time )\n\t\t\ttime += timedelta(minutes=1)\n\t\tday += timedelta(days=1)\n\treturn the_times"],"string":"[\n \"def generate_rand_7():\\n\\n while(True):\\n # This generates a random number uniformly distributed between 1 and 24.\\n # The first term is 5 times a rand num between 1 - 4, yielding {5, 10,\\n # 15, 20}. The second is a rand num between 1 - 4.\\n # Since the two numbers are *independent*, adding them gives a rand num\\n # uniformly distributed between 1 - 24.\\n # The test then rejects any number that is 21 or above. This is then\\n # divided into 7 numbers between 1 - 7 using % 7. Since there are 21\\n # numbers in the interval [1, 21] and 21 is divisble by 7, the numbers\\n # between 1 and 7 will occur with equal probability.\\n num = 5 * (np.random.uniform(1, 5, 1) - 1) +\\\\\\n (np.random.uniform(1, 5, 1) - 1)\\n if num[0] < 21:\\n return int(num[0] % 7 + 1)\",\n \"def simulate_weekend():\\n\\t\\tfor person in Simulation.community:\\n\\t\\t\\tif Simulation.community[person].has_random:\\n\\t\\t\\t\\tSimulation.community[person].get_random_attendance()\\n\\t\\t\\tSimulation.community[person].eval_strategies()\",\n \"def create_random_time_interval_gaps(days, gaps_as_percent, avg_gap_as_percent):\\n \\n print \\\"days \\\",days\\n #first find the total number of gap days by calculating it as percent of the total days\\n total_size_of_missing_days = round(days * (float(gaps_as_percent)/100))\\n print \\\"total size of missing days \\\", total_size_of_missing_days\\n #now, calculate the average gap size as percent of the total number of gap days\\n average_gap_in_days = round(total_size_of_missing_days * (float(avg_gap_as_percent)/100)) \\n num_of_time_gaps = round(float(days)/average_gap_in_days)\\n\\n #number of fills is a space around the gaps, from day 0 to last day\\n # there are num_of_gaps + 1\\n num_of_time_fills = num_of_time_gaps + 1\\n size_of_fill = int(round((float(days)-total_size_of_missing_days)/num_of_time_fills))\\n \\n print \\\"num_of_time_gaps \\\", num_of_time_gaps\\n print \\\"num_of_time_files \\\", num_of_time_fills\\n print \\\"size_of_fill \\\", size_of_fill\\n\\n start_indices = []\\n begin = 0\\n for i in range(0,int(num_of_time_gaps)):\\n begin = randint(begin,int(size_of_fill)-1)\\n start_indices.append(begin)\\n begin = begin + size_of_fill\\n if begin + average_gap_in_days > total_size_of_missing_days:\\n break\\n\\n \\n print start_indices \\n print \\\"num of time gaps \\\", num_of_time_gaps \\n print \\\"num of time fills \\\", num_of_time_fills \\n\\n interval_tuples = []\\n credit_space = days - total_size_of_missing_days\\n start = 0\\n end = randint(0,avg_size)\\n #algorithm - take the size of present data and, using it as a reminder, create a distribution of days\",\n \"def run_simulation(days, meeting_probability, patient_zero_health):\\n patient = load_patients(75)\\n patient[0].set_health(patient_zero_health)\\n each_day_effected_stats = []\\n\\n for index in range(days):\\n \\\"\\\"\\\"Each day simulation.\\\"\\\"\\\"\\n for patient_index in range(len(patient)):\\n \\\"\\\"\\\"Simulation through list of patients.\\\"\\\"\\\"\\n friends_list = patient[patient_index].get_friends()\\n for friend_index in friends_list:\\n \\\"\\\"\\\"Simulation for each person in connetion with the friend.\\\"\\\"\\\"\\n probability_of_meeting = random()\\n if probability_of_meeting < meeting_probability:\\n \\\"\\\"\\\"Probability of meeting is compared with entered probability.\\\"\\\"\\\"\\n if friend_index.is_contagious():\\n \\\"\\\"\\\"If friend is contagious, he will spread the infection to patient.\\\"\\\"\\\"\\n friend_viral_load = 5 + (((friend_index.get_health() - 25) ** 2) / 62)\\n patient[patient_index].infect(friend_viral_load)\\n elif patient[patient_index].is_contagious():\\n \\\"\\\"\\\"Else if patient is contagious, he will spread the infection to his friend.\\\"\\\"\\\"\\n patient_viral_load = 5 + (((patient[patient_index].get_health() - 25) ** 2) / 62)\\n friend_index.infect(patient_viral_load)\\n\\n day_patients_effected = 0\\n for patient_index in patient:\\n \\\"\\\"\\\"Loop to put all the persons to sleep and\\n also to count the contagious people in a given day.\\\"\\\"\\\"\\n if patient_index.is_contagious():\\n \\\"\\\"\\\"If patient is contagious, Number of \\n patients effected is incremented.\\\"\\\"\\\"\\n day_patients_effected += 1\\n patient_index.sleep() # Each patient is put to sleep at end of day.\\n each_day_effected_stats.append(day_patients_effected) # list of each day stats are stored in a list.\\n\\n return each_day_effected_stats\",\n \"def generate_24hrs():\\n\\n hrs = []\\n\\n for i in xrange(1, 25):\\n hrs.append([i, 0])\\n\\n return hrs\",\n \"def _get_day_attack_schedule(self):\\n planer_args = self.planner_config[\\\"args\\\"]\\n start_time = datetime.strptime(planer_args[\\\"min_time\\\"], \\\"%H:%M\\\").time()\\n start_date = datetime.combine(datetime.today().date(), start_time)\\n end_time = datetime.strptime(planer_args[\\\"max_time\\\"], \\\"%H:%M\\\").time()\\n end_date = datetime.combine(datetime.today().date(), end_time)\\n\\n random.seed()\\n attack_schedule = []\\n for start, end in self._split_date_range(start_date, end_date, planer_args[\\\"times\\\"]):\\n attack_schedule.append(random.uniform(start, end))\\n\\n return attack_schedule\",\n \"def generate_exptime_table(self, ):\\n\\n # Perform calculation for all stars in biased sample\\n Ndraw = self.NBIAS\\n\\n np.random.seed(seed=None)\\n\\n # Allocate memory for exposure times\\n t_tots = np.zeros(Ndraw)\\n tpbpcs = []\\n pct_obs_iwas = []\\n lammax_obs_iwas = []\\n specs = []\\n\\n \\\"\\\"\\\"\\n Calculate the exposure times and spectra in each bandpass for each\\n star in biased sample\\n \\\"\\\"\\\"\\n\\n # Loop over stars in this sample\\n for i in range(Ndraw):\\n #print(\\\"HIP %i, %.2f pc, %s \\\" %(hip[i], dist[i], stype[i]))\\n\\n # Set system parameters for this star\\n self.prep_ith_star(i)\\n\\n # Calculate the time to observe the complete spectrum\\n t_tots[i], tpbpc, spectrum, iwa = self.complete_spectrum_time()\\n\\n tpbpcs.append(tpbpc)\\n pct_obs_iwas.append(iwa[0])\\n specs.append(spectrum)\\n\\n # Calculate channel widths\\n deltas = []\\n for channel in CHANNELS:\\n l = default_luvoir(channel=channel)\\n deltas.append(l.lammax - l.lammin)\\n self.deltas = np.array(deltas)\\n\\n # Calculate channel fractional completeness\\n self.channel_weights = (self.deltas / np.sum(self.deltas))\\n\\n # Calculate completeness for each star in sample\\n self.completeness = np.sum(np.array(pct_obs_iwas) * self.channel_weights, axis = 1)\\n\\n \\\"\\\"\\\"\\n Make a Lookup Table of Exposure times for each star in sample\\n \\\"\\\"\\\"\\n\\n tpbpcs_rect = [] # Time per bandpass\\n tpcs_rect = [] # Time per channel\\n\\n # Loop over all the stars in sample\\n for idrew in range(self.NBIAS):\\n\\n tpbpcs_rect.append([])\\n tpcs_rect.append([])\\n bp_names = []\\n bp_chan = []\\n\\n # Loop over all the LUVOIR channels\\n for ichan in range(len(CHANNELS)):\\n\\n tpcs_rect[idrew].append(0.0)\\n\\n # Loop over all the bands in this channel\\n for iband in range(len(tpbpcs[0][ichan])):\\n\\n bp_names.append(\\\"%s %i\\\" %(CHANNELS[ichan], iband+1))\\n bp_chan.append(ichan)\\n tpbpcs_rect[idrew].append(tpbpcs[idrew][ichan][iband])\\n tpcs_rect[idrew][ichan] += tpbpcs[idrew][ichan][iband]\\n\\n # Make np arrays\\n tpbpcs_rect = np.array(tpbpcs_rect)\\n tpcs_rect = np.array(tpcs_rect)\\n bp_names = np.array(bp_names)\\n bp_chan = np.array(bp_chan)\\n\\n # Make infs --> nans\\n infmask = ~np.isfinite(tpbpcs_rect)\\n tpbpcs_rect[infmask] = np.nan\\n infmask = ~np.isfinite(tpcs_rect)\\n tpcs_rect[infmask] = np.nan\\n\\n # Set attributes\\n self.tpbpcs_rect = tpbpcs_rect\\n self.tpcs_rect = tpcs_rect\\n self.bp_names = bp_names\\n self.bp_chan = bp_chan\\n\\n \\\"\\\"\\\"\\n New completeness calculations\\n \\\"\\\"\\\"\\n\\n bandpasses = []\\n\\n # Loop over telescope channels\\n for j, channel in enumerate(CHANNELS):\\n\\n # Channel dependent bandwidth?\\n if type(self.bandwidth) is float:\\n bandwidth = self.bandwidth\\n else:\\n assert len(self.bandwidth) == len(CHANNELS)\\n bandwidth = self.bandwidth[j]\\n\\n # Get the channel specific telescope parameters\\n luvoir = default_luvoir(channel=channel)\\n self.cn.telescope = luvoir\\n\\n # Calculate the bandpass edges\\n edges = calculate_bandpass_edges(luvoir.lammin, luvoir.lammax, bandwidth = bandwidth)\\n\\n # Calculate the number of bandpasses\\n Nbands = len(edges) - 1\\n\\n # Loop over bandpasses\\n for i in range(Nbands):\\n\\n # Get the max, min, and middle wavelenths for this bandpass\\n lammin = edges[i]\\n lammax = edges[i+1]\\n\\n bandpasses.append([lammin, lammax])\\n\\n bandpasses = np.array(bandpasses)\\n lmin, lmax = np.min(np.hstack(bandpasses)), np.max(np.hstack(bandpasses))\\n\\n # Fractional completeness of each bandpass\\n bp_frac = ((bandpasses[:,1] - bandpasses[:,0]) / (lmax - lmin)) / np.sum((bandpasses[:,1] - bandpasses[:,0]) / (lmax - lmin))\\n\\n # Completeness by target\\n tot_completeness = np.sum(np.isfinite(self.tpbpcs_rect) * bp_frac, axis=1)\\n\\n # Fraction of stars in biased sample that can completely observe each bandpass\\n frac_bias_bp = np.sum(np.isfinite(tpbpcs_rect)*1.0, axis=0) / self.NBIAS\\n\\n # Set attributes\\n self.bandpasses = bandpasses\\n self.bp_frac = bp_frac\\n self.tot_completeness = tot_completeness\\n self.frac_bias_bp = frac_bias_bp\\n\\n self._make_pandas_table()\\n\\n return\",\n \"def make_pattern(self):\\n probability = random.SystemRandom().random()\\n if probability < 0.1:\\n _pattern = [0 for x in range(32)]\\n elif probability > 0.5:\\n pattern_num = SECURE_RANDOM.choice(CLASSIC)\\n _probability = random.SystemRandom().random()\\n if _probability > 0.80:\\n _pattern = [1 if random.SystemRandom().random() < pattern_num/32 else 0 for x in range(1,33)]\\n elif _probability < 0.40:\\n _offset = random.SystemRandom().randint(2, 16)\\n _pattern = [1 if (x == _offset) or (x % pattern_num == _offset) else 0 for x in range(1,33)]\\n else:\\n _pattern = [1 if (x == 1) or (x % pattern_num == 1) else 0 for x in range(1,33)]\\n else:\\n pattern_num = SECURE_RANDOM.choice(INNER_CLASSIC)\\n _probability = random.SystemRandom().random()\\n if _probability > 0.50:\\n _pattern = [1 if (x == 1) or (x % pattern_num == 1) else 0 for x in range(1,33)]\\n else:\\n _pattern = [1 if random.SystemRandom().random() < pattern_num/32 else 0 for x in range(1,33)]\\n\\n if not self.global_swing:\\n _probability = random.SystemRandom().random()\\n if _probability > 0.3:\\n _pattern.extend([random.SystemRandom().uniform(0.01, 0.5), random.SystemRandom().randint(1, 14), 0])\\n else:\\n _pattern.extend([0,1,0])\\n else: \\n _pattern.extend([0,1,1]) \\n\\n return _pattern\",\n \"def fixed_time_trajectories(self, ll=1, distributions=None, discrete=False, noise=0):\\n\\n self.time_uniform = np.linspace(0, self.nsteps, self.nsteps * self.padding)\\n\\n for t in tqdm.tqdm(range(self.ntraj)):\\n\\n if distributions is not None:\\n\\n if self.dwell_distribution == 'exponential':\\n self.lamb = np.random.choice(distributions[0])\\n elif self.dwell_distribution == 'power':\\n self.alpha = np.random.choice(distributions[0])\\n\\n self.hop_sigma = np.random.choice(distributions[1])\\n self.H = np.random.choice(distributions[2])\\n #self.H = np.mean(distributions[2])\\n\\n time = [0]\\n total_time = 0 # saves a lot of time\\n\\n while total_time < self.nsteps:\\n\\n # hop at random time intervals according to one of the following PDFs\\n if self.dwell_distribution == 'exponential':\\n time.append(sampling.random_exponential_dwell(self.lamb))\\n elif self.dwell_distribution == 'power':\\n if self.alpha == 1:\\n time.append(1)\\n else:\\n time.append(sampling.random_power_law_dwell(1 + self.alpha, ll=ll, discrete=discrete)[0])\\n else:\\n sys.exit('Please enter a valid dwell time probability distribution')\\n total_time += time[-1]\\n\\n time = np.cumsum(time)\\n\\n if self.hop_distribution in ['gaussian', 'Gaussian']:\\n\\n z = np.cumsum(np.random.normal(loc=0, scale=self.hop_sigma, size=len(time)))\\n z -= z[0] # untested\\n\\n elif self.hop_distribution in ['fbm', 'fractional', 'fraction_brownian_motion']:\\n z = fbm.FBM(len(time), self.H, method=\\\"daviesharte\\\").fbm()[:-1] # automatically inserts zero at beginning of array\\n z /= ((1.0 / len(time)) ** self.H) # reversing a normalization done in the fbm code\\n z *= self.hop_sigma\\n self.steps.append(z[1:] - z[:-1]) # for autocorrelation calculation\\n\\n else:\\n sys.exit('Please enter a valid hop distance probability distribution')\\n\\n # for visualizing hops\\n # trajectory_hops = np.zeros([2 * len(time) - 1, 2])\\n #\\n # trajectory_hops[1::2, 0] = time[1:]\\n # trajectory_hops[2::2, 0] = time[1:]\\n #\\n # trajectory_hops[::2, 1] = z\\n # trajectory_hops[1:-1:2, 1] = z[:-1]\\n # trajectory_hops[-1, 1] = z[-1]\\n # plt.plot(trajectory_hops[:, 0], trajectory_hops[:, 1])\\n # plt.show()\\n # exit()\\n\\n # make uniform time intervals with the same interval for each simulated trajectory\\n self.z_interpolated[t, :] = z[np.digitize(self.time_uniform, time, right=False) - 1]\\n\\n #plt.hist(np.random.normal(loc=0, scale=noise, size=len(self.time_uniform)))\\n\\n if noise > 0:\\n self.z_interpolated += np.random.normal(loc=0, scale=noise, size=len(self.time_uniform))\\n\\n self.time_uniform *= self.dt\\n # plt.plot(trajectory_hops[:, 0]*self.dt, trajectory_hops[:, 1])\\n # plt.plot(self.time_uniform, self.z_interpolated[-1, :])\\n # plt.show()\\n # exit()\",\n \"def weekly():\",\n \"def hourly_data():\\n return generate_df_for_tests(freq=\\\"H\\\", periods=24 * 500)\",\n \"def forecast(days):\\n transition = np.array([[.7, .6], [.3, .4]])\\n state = 0\\n record = []\\n for day in xrange(days):\\n state = np.random.binomial(1, transition[1, state])\\n record.append(state)\\n return record\",\n \"def generate_program():\\n sun = get_sun()\\n sunrise = sun.get_sunrise_time() + timedelta(minutes=30)\\n sunset = sun.get_sunset_time() - timedelta(minutes=30)\\n\\n program = {}\\n\\n # Iterate over each switch\\n for id, config in switches.items():\\n program[id] = OrderedDict()\\n # morning\\n if config['morning']:\\n ts_on = get_random_time_in_range(days_events['getting_up'])\\n ts_off = get_random_time_around(sunrise, interval_minutes=15)\\n\\n if ts_off > ts_on:\\n program[id][get_random_time_in_range(days_events['getting_up'])] = 'on'\\n program[id][get_random_time_around(sunrise, interval_minutes=15)] = 'off'\\n else:\\n logging.info('Sun goes up earlier %s than %s. No switching on in the morning',\\n datetime.fromtimestamp(ts_on, tz=tzlocal()).strftime(\\\"%H:%M:%S %z\\\"),\\n datetime.fromtimestamp(ts_off, tz=tzlocal()).strftime(\\\"%H:%M:%S %z\\\"),\\n )\\n\\n # evening\\n if config['evening']:\\n program[id][get_random_time_around(sunset, interval_minutes=15)] = 'on'\\n program[id][get_random_time_in_range(days_events['bedtime'])] = 'off'\\n # program[id][datetime.now().timestamp() + 1*60 ] = 'off'\\n\\n return program\",\n \"def get_work_time_for_24_7_open_locations() -> SimTimeTuple:\\n # roll the dice for day shift or night shift\\n if globals.numpy_rng.random() < 0.5:\\n # night shift\\n hours = (22, 23) + tuple(range(0, 7))\\n else:\\n # distribute the work hours of the day shifts between 7 am to 10pm\\n start = globals.numpy_rng.randint(7, 13)\\n hours = tuple(range(start, start + 9))\\n\\n start = globals.numpy_rng.randint(0, 2)\\n week_days = tuple(range(start, start + 6))\\n return SimTimeTuple(hours, week_days)\",\n \"def generate_hour_cycle(self, hour, names):\\n hour_log = []\\n\\n for time in range(0, self.random_with_deviation(self.HOUR_SHEET[hour])):\\n log_time = self.generate_datetime(hour)\\n\\n hour_log.extend(self.generate_log_in_cycle(log_time, self.rand_name(names)))\\n\\n return hour_log\",\n \"def simulate(self):\\n\\t\\tcounter = 1\\n\\t\\tweek = 1\\n\\t\\twhile counter != 0:\\n\\t\\t\\tself.oneWeek(week)\\n\\t\\t\\tweek += 1\\n\\t\\t\\tcounter = len(self.teams[0].schedule)\",\n \"def runRandomEntryStrat(self):\\n start, end = self.randomDays()\\n \\n gain = (self.df.adj_close[end] - getInfl(self.df.adj_close[start], start.year, end.year)) / \\\\\\n getInfl(self.df.adj_close[start], start.year, end.year)\\n #if gain > 6:\\n # print \\\"Windfall: \\\", start, end, gain\\n return gain\",\n \"def calc_sleep(n_new, n_fetched, new_per):\\n if False:\\n # So, my fancy way of doing this wasn't really better than the\\n # simple way below.\\n if not hasattr(calc_sleep, \\\"sleep_time_hours\\\"):\\n calc_sleep.sleep_time_hours = 1.5 # Starting sleep time.\\n # Sleep for some amount of time using `new_perecent`.\\n # Target is approximately 70 %, since if 90 % we take 1/3rd the time,\\n # if 50 % we take 5/3rds the time, and scale from 1/3 to 5/3 inbetween,\\n # capping if not in between. The randdom part is just so the\\n # resulting numbers are not even and we don't end up in a loop.\\n # Liner scale:\\n # f(x) = C * (1 - (x - A) / (B - A)) + D * (x - A) / (B - A)\\n # Which is:\\n # f(x) = x * (D - C) / (B - A) + C + A * (C - D) / (B - A)\\n # So for (A, B) -> (C, D) = (50, 90) -> (5/3, 1/3)\\n # f(x) = 3.33333333 - 0.03333333 * x\\n new_per = 3.33333333 - 0.03333333 * new_per\\n if new_per > 1.7:\\n new_per = 1.7\\n elif new_per < 0.3:\\n new_per = 0.3\\n # Plus something between -0.128 and 0.127.\\n new_per = new_per + float(ord(os.urandom(1)) - 128) / 1000\\n calc_sleep.sleep_time_hours = calc_sleep.sleep_time_hours * new_per\\n return calc_sleep.sleep_time_hours\\n else:\\n # This is 5.8 + rand(-1.28, 1.27).\\n max_sleep_time = 5.8 + float(ord(os.urandom(1)) - 128) / 100\\n return float(n_fetched - n_new) * max_sleep_time / float(n_fetched)\\n\\n # If we get here, the big if didn't return anything.\\n return 1.5 # Hours.\",\n \"def test_gen_delays(self):\\n min_freq = 1e6\\n max_freq = 50e6\\n exp = StarkRamseyXY(\\n physical_qubits=[0],\\n stark_amp=0.1,\\n min_freq=min_freq,\\n max_freq=max_freq,\\n )\\n test_delays = exp.delays()\\n ref_delays = np.arange(0, 1 / min_freq, 1 / max_freq / 2)\\n np.testing.assert_array_equal(test_delays, ref_delays)\",\n \"def bootstrap_events():\\n import datetime\\n import random\\n # let's have each event occur once between 3 and 6 pm, \\n # some day in the next month, and then recur for the next 1 to 8 weeks\\n\\n now = datetime.datetime.now().replace(minute=0, second=0)\\n\\n for program in Program.objects.all():\\n start_hour = random.randint(15, 18)\\n the_date = now.replace(hour=start_hour) + datetime.timedelta(random.randint(0, 31))\\n duration = random.randint(1,6) * 30\\n next_week = datetime.timedelta(7)\\n\\n program.events.add(EventDate.objects.create(\\n date=the_date, \\n duration_mins = duration))\\n\\n for next_occur in range(random.randint(1,8)):\\n the_date += next_week\\n program.events.add(EventDate.objects.create(\\n date = the_date,\\n duration_mins = duration))\\n\\n print \\\"Scheduled\\\", program.events.count(), \\\"events for\\\", program\",\n \"def simulate_time_rescaling(runtime,\\n kernel=functions.kernel_zhao,\\n p=functions.infectious_rate_tweets,\\n dt=0.01,\\n follower_pool=None,\\n int_fol_cnt=10000,\\n follower_mean=200,\\n split=0.015):\\n events = [(0, int_fol_cnt)]\\n ti = 0\\n print_cnt = 0\\n\\n while 0 <= ti < runtime and len(events) < 4500:\\n X = rand.exponential()\\n tj = solve_integral(ti, X, kernel, p, events, dt, runtime)\\n if follower_pool is not None:\\n fol = rand.choice(follower_pool)\\n else:\\n fol = rand_followers_extended(int_fol_cnt, follower_mean, split)\\n if tj > 0:\\n events.append((tj, fol))\\n ti = tj\\n if print_cnt % 100 == 0:\\n print(\\\"Simulating [%f%%]...\\\" % (ti / runtime * 100), flush=True)\\n print_cnt += 1\\n\\n print(\\\"\\\\nOver %d events generated\\\" % len(events))\\n\\n return events\",\n \"def time_to_failure():\\r\\n return random.expovariate(BREAK_MEAN)\",\n \"def beat_perturber(beat, timings, probibility_add, depth, repeater):\\n # the possibilities\\n perturbances = []\\n\\n for i in range(2, depth+2):\\n perturbances.append(int(beat / i))\\n\\n # roll a Gaussian distributition for every\\n # current drum hit, perturb those below the probability threshold\\n px_vec = np.random.random(len(timings)-1)\\n indices_to_perturb = np.argwhere(px_vec < probibility_add).ravel()\\n\\n for idx in indices_to_perturb:\\n # randomly sample from the 'perturbenaces'\\n random_perturb = np.random.choice(perturbances, 1)[0]\\n n_reps = np.random.poisson(repeater)\\n timings = timings[0:idx] + ([random_perturb] * n_reps) + timings[idx:]\\n\\n return timings\",\n \"def unforeseen():\\r\\n return random.gauss(300., 100.)\",\n \"def generate_poisson_workload(wid_args: dict, mix: list, n: int, t: float) -> list:\\n workload = generate_workload(wid_args, mix, n)\\n\\n time = t * 3600 #t is in hours\\n lambda_poisson = n / time\\n #Generate intervals via Poisson\\n intervals = rng.exponential(1.0/lambda_poisson, len(workload))\\n\\n #Zip the strings of workload and interval\\n str_cat = lambda x, y: x[:-1] + \\\", {:.3f} \\\\n\\\".format(y)\\n workload = list(map(str_cat, workload, intervals))\\n\\n return workload\",\n \"def time_per_part():\\r\\n return random.normalvariate(PT_MEAN, PT_SIGMA)\",\n \"def _fill_time(beats, shard, *args, **kwargs):\\n total = 0\\n for delay in shard(*args, **kwargs):\\n total += delay.count\\n yield delay\\n yield Beat(beats - total)\",\n \"def rand10():\\n res = 40\\n while res >= 40:\\n res = 7 * (rand7() - 1) + (rand7() - 1)\\n return res % 10 + 1\",\n \"def generate_day_cycle(self, names):\\n day_log = []\\n time_delta = timedelta(days=1)\\n\\n for i in range(0, len(self.HOUR_SHEET)):\\n if self.is_time_for_bruteforce(i):\\n day_log.extend(self.generate_brute_force_log(i, names))\\n\\n day_log.extend(self.generate_hour_cycle(i, names))\\n\\n day_log.sort()\\n\\n self.date += time_delta\\n\\n return day_log\",\n \"def goodmorning(host):\",\n \"def test_1000_populations_with_activity_12perday_should_yield_60k_logs_in_5days():\\n\\n with path.tempdir() as log_parent_folder:\\n log_folder = os.path.join(log_parent_folder, \\\"logs\\\")\\n\\n # note that we cannot have clock_step > 2h since that\\n run_test_scenario_1(clock_step=\\\"1h\\\",\\n simulation_duration=\\\"5 days\\\",\\n n_stories=12,\\n per=pd.Timedelta(\\\"1day\\\"),\\n log_folder=log_folder)\\n\\n logging.info(\\\"loading produced logs\\\")\\n logs = load_all_logs(log_folder)[\\\"the_logs\\\"]\\n\\n logging.info(\\\"number of produced logs: {} logs\\\".format(logs.shape[0]))\\n\\n # 5 days of simulation should produce 1000 * 12 * 5 == 60k logs\\n assert 55e3 <= logs.shape[0] <= 65e3\",\n \"def generate_brute_force_log(self, hour, names):\\n time = self.generate_datetime(hour)\\n d = timedelta(seconds=randint(1, 3))\\n attacks_per_second = \\\\\\n self.random_with_deviation(self.MAX_NR_OF_ATTACKS / self.SECONDS_IN_DAY)\\n username = self.rand_name(names)\\n duration = randint(0, self.SECONDS_IN_DAY - 1)\\n log = []\\n count = 0\\n\\n while count < duration:\\n for i in range(0, attacks_per_second):\\n log.append([time, username, 0, 0])\\n\\n count += 1\\n\\n d = timedelta(seconds=randint(0, 3))\\n time += d\\n\\n return log\",\n \"def extra_tasks_for_today(self):\\n localtz = tzlocal()\\n datetime_today = datetime.fromtimestamp(rospy.get_rostime().to_sec(), tz=localtz)\\n day_today = datetime_today.strftime(\\\"%A\\\")\\n date_today = datetime_today.date()\\n rospy.loginfo('Looking for daily tasks for %s, %s' % (day_today, date_today))\\n \\n eight_forty_five= time(8,45, tzinfo=localtz)\\n eleven_thirty= time(11,30, tzinfo=localtz)\\n fourteen_thirty=time(14,30, tzinfo=localtz)\\n seventeen_fifteen= time(17,15, tzinfo=localtz)\\n past_bedtime = time(23,59, tzinfo=localtz)\\n \\n # day_end = seventeen_fifteen\\n day_end = past_bedtime\\n\\n\\n\\n metric_wps=['WayPoint13', 'WayPoint18', 'WayPoint9','WayPoint11','WayPoint5','WayPoint3'] \\n object_learn_wps=['WayPoint13', 'WayPoint18', 'WayPoint9', 'WayPoint11'] \\n object_search_wps=['WayPoint1', 'WayPoint2', 'WayPoint3']\\n door_wps=['WayPoint7', 'WayPoint4']\\n \\n morning_start = eight_forty_five\\n morning_duration = delta_between(eleven_thirty, morning_start)\\n \\n lunch_start = eleven_thirty\\n lunch_duration = delta_between(fourteen_thirty, lunch_start)\\n\\n afternoon_start = fourteen_thirty\\n afternoon_duration = delta_between(day_end, afternoon_start)\\n\\n tasks = []\\n \\n #door checks at fixed times (to evaluate system ability to do stuff at corret times)\\n task=create_door_check_task(door_wps[0])\\n start_time=datetime.combine(date_today, time(10,30, tzinfo=localtz))\\n end_time = start_time+timedelta(seconds=30)\\n task.start_after=rospy.Time(unix_time(start_time))\\n task.end_before=rospy.Time(unix_time(end_time))\\n tasks.append(task)\\n \\n task=create_door_check_task(door_wps[0])\\n start_time=datetime.combine(date_today, time(13,30, tzinfo=localtz))\\n end_time = start_time+timedelta(seconds=30)\\n task.start_after=rospy.Time(unix_time(start_time))\\n task.end_before=rospy.Time(unix_time(end_time))\\n tasks.append(task)\\n \\n task=create_door_check_task(door_wps[0])\\n start_time=datetime.combine(date_today, time(16,30, tzinfo=localtz))\\n end_time = start_time+timedelta(seconds=30)\\n task.start_after=rospy.Time(unix_time(start_time))\\n task.end_before=rospy.Time(unix_time(end_time))\\n tasks.append(task)\\n \\n \\n #random tasks\\n for i in range(4):\\n #morning\\n task=create_metric_map_task(random.choice(metric_wps))\\n self.set_random_task_time(task, date_today, morning_start, morning_duration)\\n tasks.append(task)\\n \\n task=create_door_check_task(random.choice(door_wps))\\n self.set_random_task_time(task, date_today, morning_start, morning_duration)\\n tasks.append(task)\\n \\n if i<3:\\n task=create_object_learn_task(random.choice(object_learn_wps))\\n self.set_random_task_time(task, date_today, morning_start, morning_duration)\\n tasks.append(task)\\n \\n task=create_object_search_task(random.choice(object_search_wps))\\n self.set_random_task_time(task, date_today, morning_start, morning_duration)\\n tasks.append(task)\\n \\n #lunch (less tasks because we want the robot mostly learning people tracks)\\n if i<1:\\n task=create_metric_map_task(random.choice(metric_wps))\\n self.set_random_task_time(task, date_today, lunch_start, lunch_duration)\\n tasks.append(task)\\n \\n task=create_door_check_task(random.choice(door_wps))\\n self.set_random_task_time(task, date_today, lunch_start, lunch_duration)\\n tasks.append(task)\\n \\n task=create_object_learn_task(random.choice(object_learn_wps))\\n self.set_random_task_time(task, date_today, lunch_start, lunch_duration)\\n tasks.append(task)\\n \\n task=create_object_search_task(random.choice(object_search_wps))\\n self.set_random_task_time(task, date_today, lunch_start, lunch_duration)\\n tasks.append(task)\\n \\n \\n #afternoon\\n task=create_metric_map_task(random.choice(metric_wps))\\n self.set_random_task_time(task, date_today, afternoon_start, afternoon_duration)\\n tasks.append(task)\\n \\n task=create_door_check_task(random.choice(door_wps))\\n self.set_random_task_time(task, date_today, afternoon_start, afternoon_duration)\\n tasks.append(task)\\n \\n if i<3:\\n task=create_object_learn_task(random.choice(object_learn_wps))\\n self.set_random_task_time(task, date_today, afternoon_start, afternoon_duration)\\n tasks.append(task)\\n \\n task=create_object_search_task(random.choice(object_search_wps))\\n self.set_random_task_time(task, date_today, afternoon_start, afternoon_duration)\\n tasks.append(task)\\n return tasks\",\n \"def generate_totp(secret, period=30):\\n counter = int(time.time()) // period\\n return generate_hotp(secret, counter)\",\n \"def create_population(num_schedules, size=10, rate_range=(-6, 0)):\\n pop = []\\n for _ in range(0, num_schedules):\\n exponents = np.random.uniform(rate_range[0], rate_range[1], size)\\n schedule = np.power(10, exponents).tolist()\\n pop.append(schedule)\\n return pop\",\n \"def get_random_sleep() -> int:\\n return random.randint(1, 9)\",\n \"def generate_fire_recurrence(self):\\r\\n \\r\\n self.time_to_next_fire = round(weibullvariate(self.scale_parameter, self.shape_parameter),2)\\r\\n return self.time_to_next_fire\",\n \"def time_period_based(sched, warmup_time_period, time_period, runner, params):\\n next_scheduled = 0\\n start = time.perf_counter()\\n if time_period is None:\\n iterations = params.size()\\n for it in range(0, iterations):\\n sample_type = metrics.SampleType.Warmup if time.perf_counter() - start < warmup_time_period else metrics.SampleType.Normal\\n percent_completed = (it + 1) / iterations\\n yield (next_scheduled, sample_type, percent_completed, runner, params.params())\\n next_scheduled = sched.next(next_scheduled)\\n else:\\n end = start + warmup_time_period + time_period\\n it = 0\\n\\n while time.perf_counter() < end:\\n now = time.perf_counter()\\n sample_type = metrics.SampleType.Warmup if now - start < warmup_time_period else metrics.SampleType.Normal\\n percent_completed = (now - start) / (warmup_time_period + time_period)\\n yield (next_scheduled, sample_type, percent_completed, runner, params.params())\\n next_scheduled = sched.next(next_scheduled)\\n it += 1\",\n \"def dice():\\n return random.randrange(1, 7)\",\n \"def gen_time(self):\\n t_min = self.times['Min']\\n t_max = self.times['Max']\\n t_sig = self.times['Mean']\\n # generating activity time based on truncnorm distribution\\n # see StatDistExp jupyter notebook for more details\\n # if in test sample, activity time mean/max brought 25% closer\\n # the min\\n if self.activity in self.test_sample:\\n t_max = min(int(t_min + (t_max - t_min)*3/4), t_max-1)\\n t_sig = min(int(t_min + (t_sig - t_min)*3/4), t_sig-1)\\n t_max = max(t_max, 1)\\n t_sig = max(t_sig, 1)\\n t_scale = min(t_sig-t_min, t_max-t_sig)/3*2\\n #accounting for when activity time is always 1 day\\n if t_min == t_max == t_sig:\\n self.sample = t_min\\n else:\\n #this is the normal case generation of activity time\\n self.sample = truncnorm.rvs(a=t_min-t_sig, b=t_max-t_sig, scale=t_scale, size=1)[0]\\n self.sample += t_sig\\n self.sample = int(self.sample)\",\n \"def punches(self):\\n #:TODO Need to parameterize n\\n # Initialize smoothing function\\n # Also because I can't take the second derivitive\\n\\n n = 3\\n assert (len(self.averages)==len(self.timestamps))\\n size = len(self.averages)\\n slopes = []\\n for t in [0,size-n]:\\n averages = np.asarray(self.averages[t:size])\\n timestamps = np.asarray(self.timestamps[t:size])\\n \\\"\\\"\\\"\\n slope = np.absolute((np.corrcoef(averages,\\n timestamps))*np.std(averages)/np.std(timestamps))\\n \\\"\\\"\\\"\\n slope = np.absolute(np.polyfit(timestamps, averages, 1)[0])*1000000\\n #plt.scatter(timestamps, averages)\\n slopes.append(slope)\\n # If you were punching you are likely still punching need to set a weighting factor to this somehow\\n # print(slopes[1])\\n self.smoothing_queue.pop(0)\\n if self.SIG_DELTA_AVERAGE < slopes[1]:\\n self.smoothing_queue.append(1)\\n else:\\n self.smoothing_queue.append(0)\\n if self.smoothing_queue.count(1) > len(self.smoothing_queue)/2:\\n punching = True\\n else: punching = False\\n # print(self.smoothing_queue)\\n\\n return punching\\n #self.counter +=1\\n \\\"\\\"\\\"\\n if self.counter==self.timing:\\n self.counter == 0\\n else:\\n \\\"\\\"\\\"\",\n \"def random_times(p):\\n while True:\\n if sum(p.values()) != 1:\\n raise ValueError('Probabilities must sum to unity')\\n r = random.random()\\n remaining = 1\\n for category, probability in p.items():\\n remaining -= probability\\n if remaining <= r:\\n yield category\\n break\",\n \"def bernoulli_episode_scheduler(keep_probability: float) -> Scheduler:\\n if keep_probability < 0.0 or keep_probability > 1.0:\\n raise ValueError(\\n f'keep_probability must be in [0,1], got: {keep_probability}')\\n\\n def f(data: step_data.StepData) -> bool:\\n if data.timestep.last():\\n f.current_p = np.random.random()\\n return f.current_p < keep_probability\\n\\n f.current_p = np.random.random()\\n\\n return f\",\n \"def artificial_data(dt1, dt2, minutes=1):\\n\\n def fxweek(x):\\n return 2 - x * (1 - x)\\n\\n def sat(x):\\n return 2 * x + 2\\n\\n data = []\\n dt = datetime.timedelta(minutes=minutes)\\n while dt1 < dt2:\\n if dt1.weekday() == 6:\\n dt1 += dt\\n continue\\n if minutes <= 120 and not (dt1.hour >= 8 and dt1.hour <= 18):\\n dt1 += dt\\n continue\\n x = (dt1.hour - 8) / 10\\n if dt1.weekday() == 5:\\n y = sat(x)\\n else:\\n y = fxweek(x)\\n data.append({'time': dt1, 'y': y})\\n dt1 += dt\\n df = pandas.DataFrame(data)\\n df['y'] += numpy.random.randn(df.shape[0]) * 0.1\\n df['time'] = pandas.DatetimeIndex(df['time'])\\n return df\",\n \"def test_1000_populations_with_activity_12perday_should_yield_24k_logs_in_2days():\\n\\n with path.tempdir() as log_parent_folder:\\n log_folder = os.path.join(log_parent_folder, \\\"logs\\\")\\n\\n run_test_scenario_1(clock_step=\\\"15 min\\\",\\n simulation_duration=\\\"2 days\\\",\\n n_stories=12,\\n per=pd.Timedelta(\\\"1day\\\"),\\n log_folder=log_folder)\\n\\n logging.info(\\\"loading produced logs\\\")\\n logs = load_all_logs(log_folder)[\\\"the_logs\\\"]\\n\\n # 2 days of simulation should produce 1000 * 12 * 2 == 24k logs\\n logging.info(\\\"number of produced logs: {} logs\\\".format(logs.shape[0]))\\n assert 22e3 <= logs.shape[0] <= 26e3\",\n \"def generate_teacher_schedule_primary_daycare(N_classes):\\n\\n\\tassert N_classes % 2 == 0, 'number of classes must be even'\\n\\n\\t## teacher schedule\\n\\tN_teachers = get_N_teachers('primary_dc', N_classes)\\n\\tteacher_nodes = ['t{:04d}'.format(i) for i in range(1, N_teachers + 1)]\\n\\n\\tN_teaching_hours = get_teaching_hours('primary_dc')\\n\\tmax_hours, N_weekdays, weekend_days = get_teaching_framework()\\n\\n\\tschedule = {t:[] for t in teacher_nodes}\\n\\n\\t# the first two hours are taught by teachers 1 to N_classes:\\n\\tfor i in range(1, N_classes + 1):\\n\\t\\tschedule['t{:04d}'.format(i)].extend([i] * 2)\\n\\tfor i in range(N_classes + 1, N_classes * 2 + 1):\\n\\t\\tschedule['t{:04d}'.format(i)].extend([pd.NA] * 2)\\n\\n\\t# the third hour is also taught by teachers 1 to N_classes, but classes\\n\\t# are shifted:\\n\\tfor i in range(1, N_classes + 1):\\n\\t\\tschedule['t{:04d}'.format(i)].append(i % N_classes + 1)\\n\\tfor i in range(N_classes + 1, N_classes * 2 + 1):\\n\\t\\tschedule['t{:04d}'.format(i)].append(pd.NA)\\n\\t\\t\\n\\t# the fourth hour is taught by teachers N_classes + 1 to N_classes * 2\\n\\tfor i, j in enumerate(range(N_classes + 1, N_classes * 2 + 1)):\\n\\t\\tschedule['t{:04d}'.format(j)].append(i + 1)\\n\\tfor i in range(1, N_classes + 1):\\n\\t\\tschedule['t{:04d}'.format(i)].append(pd.NA)\\n\\n\\t# the fifth hour is lunchbreak for all teachers\\n\\tfor t in teacher_nodes:\\n\\t\\tschedule[t].append(pd.NA)\\n\\t\\t\\n\\t# the afternoon supervision is done by teachers N_classes + 1 to \\n\\t# N_classes * 2 and every two teachers supervise a group\\n\\tfor i, j in enumerate(range(N_classes + 1, N_classes * 2 + 1)):\\n\\t\\tschedule['t{:04d}'.format(j)].extend(\\\\\\n\\t\\t\\t\\t[int(i / 2 + 1)] * (max_hours - N_teaching_hours))\\n\\t# the rest of the teachers go home\\n\\tfor i in range(1, N_classes + 1):\\n\\t\\tschedule['t{:04d}'.format(i)].extend(\\\\\\n\\t\\t\\t\\t[pd.NA] * (max_hours - N_teaching_hours))\\n\\t\\t\\n\\tschedule_df = pd.DataFrame(columns=['teacher'] + \\\\\\n\\t\\t\\t\\t\\t['hour_{}'.format(i) for i in range(1, max_hours + 1)])\\n\\tschedule_df['teacher'] = teacher_nodes * N_weekdays\\n\\titerables = [range(1, N_weekdays + 1), teacher_nodes]\\n\\tindex = pd.MultiIndex.from_product(iterables, names=['weekday', 'teacher'])\\n\\tschedule_df.index = index\\n\\tschedule_df = schedule_df.drop(columns = ['teacher'])\\n\\n\\tfor wd in range(1, N_weekdays + 1):\\n\\t\\tfor t in teacher_nodes:\\n\\t\\t\\tfor hour, c in enumerate(schedule[t]):\\n\\t\\t\\t\\tif wd not in weekend_days:\\n\\t\\t\\t\\t\\tschedule_df.loc[wd, t]['hour_{}'.format(hour + 1)] = c\\n\\n\\treturn schedule_df\",\n \"def get_driver_schedule(self, duration_mins=60):\\n elapsed_mins, schedule = 0, []\\n while elapsed_mins < duration_mins:\\n elapsed_mins += expon.ppf(random()) * self.mins_between_drivers\\n schedule.append(elapsed_mins)\\n return schedule\",\n \"def generate_fire_time_series(self):\\r\\n self.fire_events =[]\\r\\n event = self.generate_fire_recurrence()\\r\\n end_event = event + 365.0\\r\\n self.fire_events.append([event, end_event])\\r\\n t = 0\\r\\n i = 0\\r\\n while t <= self.total_run_time:\\r\\n fire = self.generate_fire_recurrence()\\r\\n start_fire = self.fire_events[i][0] + (fire)\\r\\n end_fire = start_fire + (365.0) \\r\\n self.fire_events.append([start_fire, end_fire])\\r\\n t += end_fire\\r\\n i+=1\",\n \"def simulate_hawkes_time_increment(runtime,\\n dt=0.01,\\n lbd=functions.kernel_zhao,\\n p=functions.infectious_rate_tweets,\\n start_time=0,\\n int_fol_cnt=10000,\\n follower_mean=200,\\n split=0.02):\\n events = [(0, int_fol_cnt)]\\n lambda_t = [p(0) * int_fol_cnt * lbd(0)]\\n memory_effect_t = [int_fol_cnt * lbd(0)]\\n n = round(runtime / dt) # number of intervals\\n\\n for i in range(1, n):\\n cur_interval = i * dt\\n x = rand.uniform()\\n memory_effect = sum([\\n fol_cnt * lbd(cur_interval - event_time)\\n for event_time, fol_cnt in events\\n ])\\n llambda = p(cur_interval + start_time\\n ) * memory_effect * dt # intensity for current interval\\n\\n lambda_t.append(llambda)\\n memory_effect_t.append(memory_effect)\\n\\n if x < llambda: # event occurred\\n events.append((int(cur_interval),\\n rand_followers_extended(int_fol_cnt, follower_mean,\\n split)))\\n return events, lambda_t, memory_effect_t\",\n \"def make_transition_probs(self):\\n n = len(self.speakers) # TODO why this line ???\\n transitions = np.random.randint(5, size=(n, n)) + 1\\n transitions += transitions.transpose()\\n for i in range(0, math.floor(n / 2)):\\n s1 = np.random.randint(n)\\n s2 = np.random.randint(n)\\n transitions[s1][s2] += 10\\n transitions[s2][s1] += 8\\n return(transitions)\",\n \"def simulationDelayedTreatment(numTrials):\\n \\n #Initialization\\n #delayList = [300, 150, 75, 0]\\n delayList = [150]\\n #Patient init variables\\n numViruses = 100\\n maxPop = 1000\\n #Virus init variables\\n maxBirthProb = 0.1\\n clearProb = 0.05\\n #clearProb = 0.10\\n resistances = { 'guttagonol': True }\\n mutProb = 0.005\\n \\n results = {}\\n \\n for n in delayList:\\n cured = 0\\n popList = []\\n for i in range(numTrials):\\n pop = runTrial(n, numViruses, maxPop, maxBirthProb, clearProb, resistances, mutProb)\\n popList.append(pop)\\n if pop == 0:\\n cured +=1\\n results[n] = popList\\n #print popList\\n print \\\"Delay : %(delay)d Percentage cured %(percent)2f\\\" % {\\\"delay\\\" : n, \\\"percent\\\" : cured/float(numTrials) }\\n \\n\\n drawHist(results, numTrials)\",\n \"def run_hourly_hygienist(self):\\n self.ensure_timebox_trackers_accurate()\\n self.copy_tasks_with_schedule_string()\",\n \"def test_sevenreds(self):\\n seq = [1, 1, 1, 1, 1, 1, 1, 2, 1, 1, 1, 1, 1, 1, 1]\\n _SR = SevenReds(table=self.table, stake=100, rounds_to_go=100)\\n\\n for i in range(76):\\n\\n seed = seq.pop(0)\\n self.nonrandom.set_seed(seed)\\n self.game.cycle(_SR)\\n seq.append(seed)\\n if i < 7:\\n # there should be non betting until round 8\\n self.assertEqual(_SR.stake, 100)\\n # 5 wins, 5 loses\\n self.assertEqual(_SR.stake, 104)\",\n \"def _generate_hourly_time_series(\\n self,\\n size: int,\\n hourly_seasonality: float,\\n hourly_seasonality_params: Optional[List[Tuple[float, float]]] = None,\\n trend_params: Optional[List[TrendParams]] = None,\\n weekday_dummy_params: Optional[List[float]] = None,\\n annual_seasonality_params: Optional[List[Tuple[float, float]]] = None,\\n holiday_alpha: float = 3.5,\\n outlier_alpha: float = 2.5,\\n noise_scale: float = 1.0,\\n ):\\n if hourly_seasonality_params is None:\\n # Create 10 random hourly seasonality parameters\\n hourly_seasonality_params = [\\n (\\n np.random.normal() / 100,\\n np.random.normal() / 100,\\n )\\n for i in range(4)\\n ]\\n\\n time_range = np.arange(size)\\n\\n hourly_seasonality_series = (\\n self._generate_hourly_seasonality(\\n time_range=time_range,\\n hourly_seasonality_params=hourly_seasonality_params,\\n )\\n * hourly_seasonality\\n )\\n\\n hourly_outliers = self._generate_posneg_pareto(outlier_alpha, size)\\n\\n daily_time_series = self._generate_daily_time_series(\\n size=ceil(size / 24),\\n trend_params=trend_params,\\n weekday_dummy_params=weekday_dummy_params,\\n annual_seasonality_params=annual_seasonality_params,\\n holiday_alpha=holiday_alpha,\\n outlier_alpha=1000000, # outlier_alpha,\\n noise_scale=noise_scale,\\n )\\n return (\\n np.exp(hourly_seasonality_series) * np.repeat(daily_time_series, 24)[:size]\\n + hourly_outliers\\n )\",\n \"def example7(n):\\n return mvmt.randomize(tile, n)\",\n \"def generate_fire_recurrence(self):\\n\\n self.time_to_next_fire = round(weibullvariate(self.scale_parameter, self.shape_parameter),2)\\n return self.time_to_next_fire\",\n \"def migration_time(rand):\\n ta=np.random.uniform(4,8)*1e4*yr\\n K=np.power(10,rand)\\n te=ta/K\\n return ta, te\",\n \"def get_timings(beat, max_length, rand_beat):\\n BEATS = [int(beat/4),\\n int(beat/2),\\n int(beat),\\n int(beat*2),\\n int(beat*4)]\\n\\n total_steps = beat * max_length\\n timings = [beat] * max_length\\n\\n if rand_beat == True:\\n timings = []\\n while total_steps > 0:\\n duration = random.sample(BEATS, 1)[0]\\n total_steps -= duration\\n timings.append(duration)\\n\\n return timings\",\n \"def part2() -> int:\\n sleepiest_minute = None\\n sleeping_guard = None\\n sleep_frequency = 0\\n\\n for guard, times in sleep_times.items():\\n if len(times) == 0:\\n continue\\n _sleepiest_minute = max(\\n sleep_times[guard], key=sleep_times[guard].count)\\n _sleep_frequency = sleep_times[guard].count(_sleepiest_minute)\\n\\n if _sleep_frequency > sleep_frequency:\\n sleepiest_minute = _sleepiest_minute\\n sleeping_guard = guard\\n sleep_frequency = _sleep_frequency\\n\\n assert sleeping_guard is not None and sleepiest_minute is not None\\n return sleeping_guard * sleepiest_minute\",\n \"def generate_days_list():\\n\\n seven_days = []\\n\\n for i in xrange(1, 8):\\n seven_days.append([i, 0])\\n\\n return seven_days\",\n \"def gen_random_walk(self,n_step=100):\\n # Warning about the small number of steps\\n if n_step < 30:\\n print(\\\"WARNING! The number of steps is small. It may not generate a good stochastic process sequence!\\\")\\n \\n w = np.ones(n_step)*self.x0\\n \\n for i in range(1,n_step):\\n # Sampling from the Normal distribution with probability 1/2\\n yi = np.random.choice([1,-1])\\n # Weiner process\\n w[i] = w[i-1]+(yi/np.sqrt(n_step))\\n \\n return w\",\n \"def run_baseline_right_away(self, n_days_base, sim_time):\\n baseline_power = np.zeros([sim_time, ])\\n baseline_cycles = np.zeros([sim_time, ])\\n baseline_Tin = np.zeros([sim_time, ])\\n baseline_std_Tin = np.zeros([sim_time, ])\\n baseline_Tin_max = np.zeros([sim_time, ])\\n baseline_Tin_min = np.zeros([sim_time, ])\\n baseline_soc = np.zeros([sim_time, ]) \\n baseline_std_soc = np.zeros([sim_time, ]) \\n\\n EIRrated = 0.31019\\n Qrated=14600\\n\\n # inputs and outputs path\\n inputs_file='./fleets/HVAC_fleet/data_file/LasVegas_HighCDD.csv'\\n bldg_file='./fleets/HVAC_fleet/data_file/normal_building_para.xlsx'\\n save_dir='./fleets/HVAC_fleet/data_file/baseline'\\n\\n\\n #read in weather data and increase resolution to match time step of simulation\\n inputs=pd.read_csv(inputs_file, sep=',',skipfooter=48,engine='python')\\n inputs[c.COL_DATETIME]=pd.to_datetime(inputs[c.COL_DATETIME])\\n inputs=inputs.set_index(c.COL_DATETIME)\\n inputs_ts=inputs.resample(str(self.sim_step)+'T').interpolate()\\n \\n for day in range(n_days_base):\\n print(\\\"Day %i\\\" %(day+1))\\n \\n #initialize dataframes\\n timeB = np.array(np.arange(0,60*60*24,self.sim_step))\\n plot_timeB = np.array(np.arange(0,24,self.sim_step/3600))\\n\\n Tin=pd.DataFrame(data=0,index=timeB,columns=range(0,self.numHVAC))\\n Tmass=pd.DataFrame(data=0,index=timeB,columns=range(0,self.numHVAC))\\n Twall=pd.DataFrame(data=0,index=timeB,columns=range(0,self.numHVAC))\\n Tattic=pd.DataFrame(data=0,index=timeB,columns=range(0,self.numHVAC))\\n ACstatus=pd.DataFrame(data=0,index=timeB,columns=range(0,self.numHVAC))\\n dTin=pd.DataFrame(data=0,index=timeB,columns=range(0,self.numHVAC))\\n dTmass=pd.DataFrame(data=0,index=timeB,columns=range(0,self.numHVAC))\\n dTwall=pd.DataFrame(data=0,index=timeB,columns=range(0,self.numHVAC))\\n dTattic=pd.DataFrame(data=0,index=timeB,columns=range(0,self.numHVAC))\\n Power=pd.DataFrame(data=0,index=timeB,columns=range(0,self.numHVAC))\\n cycles=pd.DataFrame(data=0,index=timeB,columns=range(0,self.numHVAC))\\n SOC=pd.DataFrame(data=0,index=timeB,columns=range(0,self.numHVAC))\\n \\n num_homes = self.numHVAC \\n \\n #Load building characteristics from file\\n df_bldg=pd.DataFrame.from_csv(bldg_file,sep=',')\\n \\n #Initialize Temperatures and assign building and AC characteristics\\n b=[0]*num_homes\\n ac=[0]*num_homes\\n\\n for i in range(0,num_homes):\\n b[i]=building(df_bldg.T_in[i],df_bldg.T_mass[i],df_bldg.T_wall[i],df_bldg.T_attic[i],df_bldg.Rwall[i],df_bldg.Rattic[i],df_bldg.Rwin[i],df_bldg.SHGC[i],df_bldg.Cwall[i],df_bldg.Cin[i],df_bldg.C1[i],df_bldg.C2[i],df_bldg.C3[i],df_bldg.Cattic[i],df_bldg.Rroof[i],df_bldg.Cmass[i],df_bldg.Rmass[i],df_bldg.Sp1[i],df_bldg.Sp2[i],df_bldg.Sp3[i],df_bldg.Qrated[i],df_bldg.EIRrated[i],df_bldg.TinWB[i],df_bldg.Initial_On[i])\\n Tin.iloc[0,i]=b[i].T_in\\n Tmass.iloc[0,i]=b[i].T_mass\\n Twall.iloc[0,i]=b[i].T_wall\\n Tattic.iloc[0,i]=b[i].T_attic\\n\\n ac[i]=AC(df_bldg.Qrated[i],df_bldg.EIRrated[i])\\n \\n #Main simulation loop \\n for i in range(0,int(1440*60/self.sim_step)):\\n for j in range(0,num_homes): \\n \\n if i>0: #initialize AC status for each timestep to prior state\\n ACstatus.iloc[i,j]=ACstatus.iloc[i-1,j]\\n else: #Set AC status based on file input for first timestep\\n ACstatus.iloc[i,j]=b[j].Initial_On\\n if Tin.iloc[i,j]>=self.Tset+self.deadband and ACstatus.iloc[max(i-self.shortcycle_ts,0):i,j].sum()==0: #if temp is above deadband and unit has not run in past duration corresponding to short cycle timer turn on unit\\n ACstatus.iloc[i,j]=1.0\\n if Tin.iloc[i,j]<=self.Tset-self.deadband: #if temperature is below bottom deadband, turn off unit\\n ACstatus.iloc[i,j]=0.0\\n #count cycles\\n if i>0 and ACstatus.iloc[i-1,j]==1.0 and ACstatus.iloc[i,j]==0.0:\\n cycles.iloc[i,j]=1.0\\n \\n #calculate power use for each AC based on status\\n Power.iloc[i,j]=ACstatus.iloc[i,j]*Capacity(ac[j],inputs_ts[c.COL_TOUT][i],b[j].TinWB)*EIR(ac[j],inputs_ts[c.COL_TOUT][i],b[j].TinWB)\\n \\n # calculate SOC for each AC\\n SOC.iloc[i,j] = (self.Tset+self.deadband - Tin.iloc[i,j])/(2*self.deadband)\\n\\n #building model dT calculations\\n ts = self.sim_step\\n dTin.iloc[i,j]=ts*1.0/b[j].Cin*((Twall.iloc[i,j]-Tin.iloc[i,j])*2.0/b[j].Rwall\\n +(Tattic.iloc[i,j]-Tin.iloc[i,j])/b[j].Rattic\\n +(Tmass.iloc[i,j]-Tin.iloc[i,j])/b[j].Rmass+inputs_ts[c.COL_QIHL][i]*b[j].C1*b[j].Sp1\\n +inputs_ts[c.COL_RADWIN][i]*b[j].SHGC*25.76*b[j].C3*b[j].Sp3\\n -ACstatus.iloc[i,j]*Capacity(ac[j],inputs_ts[c.COL_TOUT][i],b[j].TinWB)*SHR(inputs_ts[c.COL_TOUT][i],Tin.iloc[i,j],b[j].TinWB)*b[j].C2*b[j].Sp2\\n +(inputs_ts[c.COL_TOUT][i]-Tin.iloc[i,j])/b[j].Rwin)\\n dTmass.iloc[i,j]=ts*1.0/b[j].Cmass*((Tin.iloc[i,j]-Tmass.iloc[i,j])/b[j].Rmass\\n +inputs_ts[c.COL_QIHL][i]*b[j].C1*(1-b[j].Sp1)\\n +inputs_ts[c.COL_RADWIN][i]*b[j].SHGC*25.76*b[j].C3*(1-b[j].Sp3)\\n -ACstatus.iloc[i,j]*Capacity(ac[j],inputs_ts[c.COL_TOUT][i],b[j].TinWB)*SHR(inputs_ts[c.COL_TOUT][i],Tin.iloc[i,j],b[j].TinWB)*b[j].C2*(1-b[j].Sp2))\\n dTwall.iloc[i,j]=ts*1.0/b[j].Cwall*((inputs_ts['Tsolw'].iloc[i]-Twall.iloc[i,j])*2.0/b[j].Rwall\\n +(Tin.iloc[i,j]-Twall.iloc[i,j])*2.0/b[j].Rwall)\\n dTattic.iloc[i,j]=ts*1.0/b[j].Cattic*((inputs_ts['Tsolr'].iloc[i]-Tattic.iloc[i,j])/b[j].Rroof\\n +(Tin.iloc[i,j]-Tattic.iloc[i,j])/b[j].Rattic)\\n \\n #calculate temperatures for next time step\\n if i<(1440*60/ts-1):\\n Tin.iloc[i+1,j]=Tin.iloc[i,j]+dTin.iloc[i,j]\\n Tmass.iloc[i+1,j]=Tmass.iloc[i,j]+dTmass.iloc[i,j]\\n Tattic.iloc[i+1,j]=Tattic.iloc[i,j]+dTattic.iloc[i,j]\\n Twall.iloc[i+1,j]=Twall.iloc[i,j]+dTwall.iloc[i,j]\\n\\n # calculate peak power and plot data\\n PeakPower=Power.sum(axis=1).max()*1.0 # plot out the peak power in kW\\n Plot_Power=np.full(len(plot_timeB),PeakPower/1000.0)\\n fig,ax = plt.subplots(2,1,figsize=(6,8),sharey='row')\\n p1=ax[0].plot(plot_timeB,Power.sum(axis=1)/1000.0,color='blue',linestyle='solid',label='Baseline')\\n ax[0].plot(plot_timeB,Plot_Power,color='black',linestyle='--',label='Targeted Power')\\n ax[0].set_ylabel('Total Power (kW)')\\n ax[1].set_ylabel('Indoor Temperature ($^\\\\circ$C)')\\n ax[1].set_xlabel('Hour of Day')\\n p2=ax[1].plot(plot_timeB,Tin.mean(axis=1),color='blue',linestyle='solid',label='Baseline Avg')\\n p3=ax[1].plot(plot_timeB,Tin.max(axis=1),color='blue',linestyle='dotted',label='Baseline Min/Max')\\n p4=ax[1].plot(plot_timeB,Tin.min(axis=1),color='blue',linestyle='dotted',label='_nolegend_')\\n \\n # Saves baseline data to csv\\n #ToDo: needs cut the whole day simulation to compare only segment with providing grid services\\n # But, that requires the simulation steps information.\\n\\n Power.to_csv(str(save_dir)+'\\\\\\\\Power_base'+'.csv')\\n Tin.to_csv(str(save_dir)+'\\\\\\\\Tin_base'+'.csv')\\n SOC.to_csv(str(save_dir)+'\\\\\\\\SOC_base'+'.csv')\\n cycles.to_csv(str(save_dir)+'\\\\\\\\Cycles_base'+'.csv')\\n \\n # return values\\n baseline_power = Power.sum(axis = 1)\\n baseline_cycles = cycles.sum(axis = 1)\\n\\n baseline_soc = SOC.mean(axis = 1)\\n baseline_std_soc = SOC.std(axis = 1)\\n\\n baseline_Tin = Tin.mean(axis = 1)\\n baseline_std_Tin = Tin.std(axis = 1)\\n baseline_Tin_max = Tin.max(axis=1)\\n baseline_Tin_min = Tin.min(axis=1)\\n \\n return baseline_soc, baseline_std_soc, baseline_power, baseline_cycles, baseline_Tin, baseline_std_Tin, baseline_Tin_max, baseline_Tin_min\",\n \"def randomWeights(patterns):\\n weights = []\\n for i in range(patterns):\\n weights.append(random.random())\\n return weights\",\n \"def genWeather():\\n\\n weather = random.choice(weather_conditions.keys())\\n condition = weather_conditions[weather]\\n (tMax, tMin) = condition[\\\"temperature\\\"]\\n (pMax, pMin) = condition[\\\"pressure\\\"]\\n (hMax, hMin) = condition[\\\"humidity\\\"]\\n\\n return weather + \\\"|\\\" + str(round(random.uniform(tMax, tMin), 1)) + \\\"|\\\" + \\\\\\n str(round(random.uniform(pMax, pMin), 1)) + \\\"|\\\" + \\\\\\n str(random.randrange(hMax, hMin, -1))\",\n \"def test_weekly_resolution_perfect_model(daily_initialized, daily_obs):\\n weekly_pm = daily_initialized.resample(init=\\\"W\\\").mean()\\n weekly_obs = daily_obs.resample(time=\\\"W\\\").mean()\\n weekly_pm.lead.attrs[\\\"units\\\"] = \\\"weeks\\\"\\n assert compute_hindcast(weekly_pm, weekly_obs).all()\",\n \"def hr_report():\\n\\n # Load the peak data.\\n db = Persistence()\\n if not (activities := db.load_all()):\\n print(\\\"No data to report on\\\")\\n return\\n\\n # Find the maximum for each value.\\n max = _load_max_values(activities)\\n\\n # Totals for the current week\\n week_distance_total = 0\\n week_elevation_total = 0\\n week_duration_total = timedelta()\\n week_work_days = 0\\n week_5sec_average = []\\n week_30sec_average = []\\n week_60sec_average = []\\n week_5min_average = []\\n week_10min_average = []\\n week_20min_average = []\\n week_30min_average = []\\n week_60min_average = []\\n week_90min_average = []\\n week_120min_average = []\\n\\n # Print the peak data for each week.\\n current_weekday = None\\n for activity in activities:\\n\\n # Time to break to a new week?\\n if current_weekday is None or current_weekday > activity.start_time.weekday():\\n if current_weekday:\\n _print_footer(\\n week_distance_total=week_distance_total,\\n week_elevation_total=week_elevation_total,\\n week_duration_total=week_duration_total,\\n week_work_days=week_work_days,\\n week_5sec_average=week_5sec_average,\\n week_30sec_average=week_30sec_average,\\n week_60sec_average=week_60sec_average,\\n week_5min_average=week_5min_average,\\n week_10min_average=week_10min_average,\\n week_20min_average=week_20min_average,\\n week_30min_average=week_30min_average,\\n week_60min_average=week_60min_average,\\n week_90min_average=week_90min_average,\\n week_120min_average=week_120min_average,\\n )\\n week_distance_total = 0\\n week_elevation_total = 0\\n week_duration_total = timedelta(0)\\n week_work_days = 0\\n week_5sec_average = []\\n week_30sec_average = []\\n week_60sec_average = []\\n week_5min_average = []\\n week_10min_average = []\\n week_20min_average = []\\n week_30min_average = []\\n week_60min_average = []\\n week_90min_average = []\\n week_120min_average = []\\n\\n _print_header()\\n\\n # Capture the weekday.\\n if current_weekday is None or current_weekday != activity.start_time.weekday():\\n week_work_days = week_work_days + 1\\n\\n current_weekday = activity.start_time.weekday()\\n\\n # Print the detail.\\n _print_detail(activity, max)\\n\\n # Find the duration.\\n duration = activity.end_time - activity.start_time\\n\\n # Accumulate for this week\\n week_distance_total = week_distance_total + activity.distance\\n if activity.elevation:\\n week_elevation_total = week_elevation_total + activity.elevation\\n week_duration_total = week_duration_total + duration\\n week_5sec_average.append(activity.peak_5sec_hr)\\n week_30sec_average.append(activity.peak_30sec_hr)\\n week_60sec_average.append(activity.peak_60sec_hr)\\n if activity.peak_5min_hr:\\n week_5min_average.append(activity.peak_5min_hr)\\n if activity.peak_10min_hr:\\n week_10min_average.append(activity.peak_10min_hr)\\n if activity.peak_20min_hr:\\n week_20min_average.append(activity.peak_20min_hr)\\n if activity.peak_30min_hr:\\n week_30min_average.append(activity.peak_30min_hr)\\n if activity.peak_60min_hr:\\n week_60min_average.append(activity.peak_60min_hr)\\n if activity.peak_90min_hr:\\n week_90min_average.append(activity.peak_90min_hr)\\n if activity.peak_120min_hr:\\n week_120min_average.append(activity.peak_120min_hr)\\n\\n # Final footer.\\n _print_footer(\\n week_distance_total=week_distance_total,\\n week_elevation_total=week_elevation_total,\\n week_duration_total=week_duration_total,\\n week_work_days=week_work_days,\\n week_5sec_average=week_5sec_average,\\n week_30sec_average=week_30sec_average,\\n week_60sec_average=week_60sec_average,\\n week_5min_average=week_5min_average,\\n week_10min_average=week_10min_average,\\n week_20min_average=week_20min_average,\\n week_30min_average=week_30min_average,\\n week_60min_average=week_60min_average,\\n week_90min_average=week_90min_average,\\n week_120min_average=week_120min_average,\\n )\\n\\n # Print the summary.\\n _print_summary(max)\",\n \"def generate_fire_time_series(self):\\n\\n self.fire_events =[]\\n event = self.generate_fire_recurrence()\\n end_event = event + 365.0\\n self.fire_events.append([event, end_event])\\n t = 0\\n i = 0\\n while t <= self.total_run_time:\\n fire = self.generate_fire_recurrence()\\n start_fire = self.fire_events[i][0] + (fire)\\n end_fire = start_fire + (365.0)\\n self.fire_events.append([start_fire, end_fire])\\n t += end_fire\\n i+=1\",\n \"def _scheduled_sampling(self):\\n step = tf.train.get_or_create_global_step()\\n step = tf.cast(step, tf.float32)\\n progress = tf.minimum(\\n (step-self.args.warmup_step) / float(self.args.max_step-self.args.warmup_step), 1.0)\\n return tf.minimum(1.0, 1.0 - progress * (1.0 -self.args.min_rate))\",\n \"def get_heating_and_cooling_schedule(region: int) -> (np.ndarray, np.ndarray, np.ndarray):\\n\\n heating_period = np.array([\\n [True] * 157 + [False] * 110 + [True] * 98,\\n [True] * 154 + [False] * 115 + [True] * 96,\\n [True] * 150 + [False] * 123 + [True] * 92,\\n [True] * 149 + [False] * 125 + [True] * 91,\\n [True] * 134 + [False] * 149 + [True] * 82,\\n [True] * 110 + [False] * 198 + [True] * 57,\\n [True] * 85 + [False] * 245 + [True] * 35,\\n [True] * 0 + [False] * 365 + [True] * 0,\\n ][region - 1])\\n\\n cooling_period = np.array([\\n [False] * 190 + [True] * 53 + [False] * 122,\\n [False] * 195 + [True] * 48 + [False] * 122,\\n [False] * 190 + [True] * 53 + [False] * 122,\\n [False] * 190 + [True] * 53 + [False] * 122,\\n [False] * 186 + [True] * 57 + [False] * 122,\\n [False] * 149 + [True] * 117 + [False] * 99,\\n [False] * 134 + [True] * 152 + [False] * 79,\\n [False] * 83 + [True] * 265 + [False] * 17,\\n ][region - 1])\\n\\n hc_period = np.where(heating_period, 'h', np.where(cooling_period, 'c', 'm'))\\n\\n return np.repeat(hc_period, 24)\",\n \"def minute_asleep_frequency(self):\\n minutes_asleep = defaultdict(int)\\n for shift in self.shifts:\\n for minute in shift.minutes_asleep:\\n minutes_asleep[minute] += 1\\n return minutes_asleep\",\n \"def generate_teacher_schedule_lower_secondary_daycare(N_classes):\\n\\tassert N_classes % 2 == 0, 'number of classes must be even'\\n\\n\\tN_teachers = get_N_teachers('lower_secondary_dc', N_classes)\\n\\tN_hours = get_teaching_hours('lower_secondary_dc')\\n\\tmax_hours, N_weekdays, weekend_days = get_teaching_framework()\\n\\tdaycare_hours = range(N_hours + 1, max_hours)\\n\\tif 5 in daycare_hours:\\n\\t\\tdaycare_hours.remove(5)\\n\\tteacher_nodes = ['t{:04d}'.format(i) for i in range(1, N_teachers + 1)]\\n\\t\\n\\n\\t# for lower secondary schools with daycare, there are 3 teachers per class\\n\\t# 5 out of 6 hours / day are taught in team-teaching and daycare supervision\\n\\t# of each group is also done by two teachers. To create the schedule for the\\n\\t# teachers, we have to make sure that no teacher teaches two classes at the \\n\\t# same time and that teachers see a different class every hour (to account \\n\\t# for the number of classes a teacher sees on average, according to the \\n\\t# interviews we conducted). The following solution is a bit hacky but gets \\n\\t# the job done:\\n\\n\\t# first, we construct a sequential list of length N_classes * 6, to ensure \\n\\t# that in every hour there is at least one teacher in every class \\n\\n\\t# during the first three hours, all teachers teach once\\n\\tfirst_teacher_list = list(range(1, N_teachers + 1)) \\n\\t# by shifting the list by 1 for the hours 4-6, we ensure that no teacher \\n\\t# teaches the same class twice\\n\\tfirst_teacher_list.extend(list(range(2, N_teachers + 1)) + [1]) \\n\\t# the list is then reshaped into an N_hours X N_classes array - the schedule\\n\\tfirst_teacher_list = np.asarray(first_teacher_list)\\n\\tfirst_teachers = first_teacher_list.reshape((N_hours, N_classes))\\n\\t# we convert the array to a data frame for easier indexing when we create \\n\\t# the overall teacher schedule below\\n\\tfirst_teacher_schedule = pd.DataFrame(columns=['hour'] + \\\\\\n\\t\\t\\t\\t['class_{}'.format(i) for i in range(1, N_classes + 1)])\\n\\tfirst_teacher_schedule['hour'] = [i for i in range(1, N_hours + 1)]\\n\\n\\tfor i in range(0, N_classes):\\n\\t\\tfirst_teacher_schedule['class_{}'.format(i + 1)] = first_teachers[0:,i]\\n\\tfirst_teacher_schedule.index = first_teacher_schedule['hour']\\n\\tfirst_teacher_schedule = first_teacher_schedule.drop(columns = ['hour'])\\n\\t\\t\\n\\t# then we construct a sequential list of length N_classes * 5, intended to \\n\\t# add a second teacher to 5 out of 6 lessons per day. The list is shifted in\\n\\t# such a way that no teacher teaches the same class twice or is supposed to\\n\\t# teach two classes during the same time\\n\\tsecond_teacher_list = list(range(9, N_teachers + 1)) + list(range(1, 9))\\n\\tsecond_teacher_list.extend(list(range(4, 4 + N_classes * 2)))\\n\\t# the list is reshaped into a 5 hours X N_classes array, which is then \\n\\t# superimposed with the schedule of first teachers, to create the team-\\n\\t# teaching schedule\\n\\tsecond_teacher_list = np.asarray(second_teacher_list)\\n\\tsecond_teachers = second_teacher_list.reshape((5, N_classes))\\n\\tsecond_teacher_schedule = pd.DataFrame(columns=['hour'] + \\\\\\n\\t\\t\\t\\t['class_{}'.format(i) for i in range(1, N_classes + 1)])\\n\\tsecond_teacher_schedule['hour'] = [i for i in range(1, 5 + 1)]\\n\\tfor i in range(0, N_classes):\\n\\t\\tsecond_teacher_schedule['class_{}'.format(i+1)] = second_teachers[0:, i]\\n\\tsecond_teacher_schedule.index = second_teacher_schedule['hour']\\n\\tsecond_teacher_schedule = second_teacher_schedule.drop(columns = ['hour'])\\n\\n\\t# the overall schedule is a table of (N_weekdays * N_teachers) X N_hours,\\n\\t# in which the entries are the class that is taught by a given teacher in a\\n\\t# given time. We construct this table from the first teacher schedule and \\n\\t# the second teacher schedule\\n\\tschedule_df = pd.DataFrame(columns=['teacher'] + ['hour_{}'.format(i) for\\\\\\n\\t\\t\\t i in range(1, max_hours + 1)])\\n\\tschedule_df['teacher'] = teacher_nodes * N_weekdays\\n\\titerables = [range(1, N_weekdays + 1), teacher_nodes]\\n\\tindex = pd.MultiIndex.from_product(iterables, names=['weekday', 'teacher'])\\n\\tschedule_df.index = index\\n\\tschedule_df = schedule_df.drop(columns = ['teacher'])\\n\\n\\tfor c in range(1, N_classes + 1):\\n\\t\\tfor hour in range(1, N_hours + 1):\\n\\t\\t\\tfor wd in range(1, N_weekdays):\\n\\t\\t\\t\\tif not wd in weekend_days:\\n\\t\\t\\t\\t\\tt1 = first_teacher_schedule.loc[hour, 'class_{}'.format(c)]\\n\\t\\t\\t\\t\\tschedule_df.loc[wd, 't{:04d}'.format(t1)]\\\\\\n\\t\\t\\t\\t\\t\\t['hour_{}'.format(hour)] = c\\n\\t\\t\\t\\t\\t# not all hours have a second teacher\\n\\t\\t\\t\\t\\ttry:\\n\\t\\t\\t\\t\\t\\tt2 = second_teacher_schedule.loc[\\\\\\n\\t\\t\\t\\t\\t\\t\\t\\t\\t\\thour, 'class_{}'.format(c)]\\n\\t\\t\\t\\t\\t\\tschedule_df.loc[wd, 't{:04d}'.format(t2)]\\\\\\n\\t\\t\\t\\t\\t\\t\\t['hour_{}'.format(hour)] = c\\n\\t\\t\\t\\t\\texcept KeyError:\\n\\t\\t\\t\\t\\t\\tpass\\n\\n\\t# daycare is handled separately: in the afternoon, half of the students go \\n\\t# home and the other half are randomly distributed to a number of groups \\n\\t# equal to N_classes / 2. These groups are supervised by two teachers each. \\n\\t# The supervising teachers are the first N_classes teachers and the last \\n\\t# N_classes teachers, since these teachers have a smaller number of team-\\n\\t# teaching lessons than the other teachers\\n\\tdaycare_teacher_list = list(range(1, int(N_classes / 2) + 1))\\n\\tdaycare_teacher_list.extend(list(range(N_teachers - int(N_classes / 2) + 1,\\\\\\n\\t\\t\\t\\t\\t\\t\\t\\t\\t\\t N_teachers + 1)))\\n\\tdaycare_teacher_list = np.asarray(daycare_teacher_list)\\\\\\n\\t\\t\\t\\t\\t\\t\\t .reshape((2, int(N_classes / 2)))\\n\\t# add the daycare supervision to the overall teacher schedule\\n\\tfor dc_group in range(0, int(N_classes / 2)):\\n\\t\\tfor t in daycare_teacher_list[0:, dc_group]:\\n\\t\\t\\tfor wd in range(1, N_weekdays + 1):\\n\\t\\t\\t\\tif wd not in weekend_days:\\n\\t\\t\\t\\t\\tfor hour in daycare_hours:\\n\\t\\t\\t\\t\\t\\tschedule_df.loc[wd, 't{:04d}'.format(t)]\\\\\\n\\t\\t\\t\\t\\t\\t\\t['hour_{}'.format(hour)] = dc_group + 1\\n\\n\\n\\tschedule_df = schedule_df.replace({np.nan:pd.NA})\\n\\t# shift afternoon teaching hours by one to make space for the lunch break\\n\\t# in the fifth hour:\\n\\tschedule_df = schedule_df.rename(columns={\\n\\t\\t\\t\\t'hour_9':'hour_5', 'hour_5':'hour_6','hour_6':'hour_7',\\n\\t\\t\\t\\t'hour_7':'hour_8', 'hour_8':'hour_9'})\\n\\tschedule_df = schedule_df[['hour_{}'.format(i) \\\\\\n\\t\\t\\t\\tfor i in range(1, max_hours + 1)]]\\n\\n\\treturn schedule_df\",\n \"def run_experiment():\\n return [random.random() < 0.5 for _ in range(1000)]\",\n \"def run_experiment():\\n return [random.random() < 0.5 for _ in range(1000)]\",\n \"def run_experiment():\\n return [random.random() < 0.5 for _ in range(1000)]\",\n \"def run_experiment():\\n return [random.random() < 0.5 for _ in range(1000)]\",\n \"def _burn_cpu():\\n while True:\\n random()*random()\",\n \"def schedulebuzzerrooms(self, field):\\n divisions = ['8', '7', 'Elementary']\\n field = list(filter(lambda stu: stu.bee, field))\\n for player in field:\\n player.schedule = list(sorted(player.schedule, key=itemgetter(1)))\\n\\n # create a list of players in each round (1 - 16)\\n playersperround = [[] for _ in range(len(self.buzzerschedule))]\\n for i, time in enumerate(self.buzzerschedule, 0):\\n for player in field:\\n for event in player.schedule:\\n if time in event:\\n playersperround[i].append(player)\\n\\n # create a list of rooms being used to try and spread across hotels\\n \\\"\\\"\\\"\\n totrooms = [[] for _ in range(len(self.buzzerschedule))]\\n for i, rnd in enumerate(totrooms):\\n k = len(list(filter(lambda stu: stu.division == '8' and stu.seed == 'a', playersperround[i])))\\n k += len(list(filter(lambda stu: stu.division == '7' and stu.seed == 'a', playersperround[i])))\\n k += len(list(filter(lambda stu: stu.division == 'Elementary' and stu.seed == 'a', playersperround[i])))\\n rnd = range(1, MAX_ROOMS + 1)\\n numtoremove = MAX_ROOMS - k\\n toremove = sample(rnd, numtoremove)\\n rnd = [x for x in rnd if x not in toremove]\\n shuffle(rnd)\\n totrooms[i] = rnd\\n \\\"\\\"\\\"\\n\\n totrooms = [[1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 22, 23, 24, 25, 26, 27, 28, 29, 30, 33, 34, 35, 36, 39, 40, 41],\\n [1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 22, 23, 24, 25, 26, 27, 28, 29, 30, 33, 34, 35, 36, 39, 40, 41],\\n [1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 22, 23, 24, 25, 26, 27, 28, 29, 30, 33, 34, 35, 36, 39, 40, 41],\\n [1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 22, 23, 24, 25, 26, 27, 28, 29, 30, 33, 34, 35, 36, 39, 40, 41],\\n [1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 22, 23, 24, 25, 26, 27, 28, 29, 30, 33, 34, 35, 36, 39, 40, 41, 42],\\n [1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 22, 23, 24, 25, 26, 27, 28, 29, 30, 33, 34, 35, 36, 39, 40, 41, 42],\\n [1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 22, 23, 24, 25, 26, 27, 28, 29, 30, 33, 34, 35, 36, 39, 40, 41, 42],\\n [1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 22, 23, 24, 25, 26, 27, 28, 29, 30, 33, 34, 35, 36, 39, 40, 41, 42],\\n [1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 22, 23, 24, 25, 26, 27, 28, 29, 30, 33, 34, 35, 36, 39, 40, 41],\\n [1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 22, 23, 24, 25, 26, 27, 28, 29, 30, 33, 34, 35, 36, 39, 40, 41],\\n [1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 22, 23, 24, 25, 26, 27, 28, 29, 30, 33, 34, 35, 36, 39, 40, 41],\\n [1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 22, 23, 24, 25, 26, 27, 28, 29, 30, 33, 34, 35, 36, 39, 40, 41],\\n [1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 22, 23, 24, 25, 26, 27, 28, 29, 30, 33, 34, 35, 36, 39, 40, 41, 42],\\n [1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 22, 23, 24, 25, 26, 27, 28, 29, 30, 33, 34, 35, 36, 39, 40, 41, 42],\\n [1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 22, 23, 24, 25, 26, 27, 28, 29, 30, 33, 34, 35, 36, 39, 40, 41, 42],\\n [1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 22, 23, 24, 25, 26, 27, 28, 29, 30, 33, 34, 35, 36, 39, 40, 41, 42]]\\n\\n for rnd in totrooms:\\n shuffle(rnd)\\n\\n # for each round, assign the players in totrooms to a room\\n count = 0\\n for rnd, rooms in enumerate(totrooms):\\n tosched = playersperround[rnd]\\n for div in divisions:\\n divforround = list(filter(lambda stu: stu.division == div, tosched))\\n for i in range(\\n len(list(filter(lambda stu: stu.division == div and stu.seed == 'a', playersperround[rnd])))):\\n room = sample(rooms, 1)[0]\\n roomplayers = self.pickten(divforround)\\n rooms.remove(room)\\n for player in roomplayers:\\n self.buzzerrooms[rnd][room - 1].addplayer(player)\\n for ev in player.schedule:\\n if ev[0] == \\\"History Bee Buzzer Round\\\" and ev[1] == self.buzzerschedule[rnd]:\\n ev[2] = \\\"ACE Room \\\" + str(room)\\n count += 1\",\n \"def test_random(year, site):\\n res_file = os.path.join(TESTDATADIR,\\n 'wtk/ri_100_wtk_{}.h5'.format(year))\\n sam_files = os.path.join(TESTDATADIR,\\n 'SAM/wind_gen_standard_losses_0.json')\\n results = []\\n no_curtail = None\\n curtailment = {\\\"dawn_dusk\\\": \\\"nautical\\\", \\\"months\\\": [4, 5, 6, 7],\\n \\\"precipitation\\\": None, \\\"probability\\\": 1,\\n \\\"temperature\\\": None, \\\"wind_speed\\\": 10.0}\\n prob_curtail = {\\\"dawn_dusk\\\": \\\"nautical\\\", \\\"months\\\": [4, 5, 6, 7],\\n \\\"precipitation\\\": None, \\\"probability\\\": 0.5,\\n \\\"temperature\\\": None, \\\"wind_speed\\\": 10.0}\\n\\n for c in [no_curtail, curtailment, prob_curtail]:\\n\\n points = slice(site, site + 1)\\n\\n # run reV 2.0 generation and write to disk\\n gen = Gen('windpower', points, sam_files, res_file,\\n output_request=('cf_profile',), curtailment=c,\\n sites_per_worker=50, scale_outputs=True)\\n gen.run(max_workers=1)\\n\\n results.append(gen.out['cf_mean'])\\n\\n assert results[0] > results[1], 'Curtailment did not decrease cf_mean!'\\n\\n expected = (results[0] + results[1]) / 2\\n diff = expected - results[2]\\n msg = ('Curtailment with 50% probability did not result in 50% less '\\n 'curtailment! No curtailment, curtailment, and 50% curtailment '\\n 'have the following cf_means: {}'.format(results))\\n assert diff <= 2, msg\",\n \"def return_weekly_figure():\\n today = datetime.datetime.now()\\n\\n while 1:\\n try:\\n today_str = str(today.day) + \\\"/\\\" + \\\"{:02d}\\\".format(today.month) + \\\"/\\\" + str(today.year)\\n match = covid_table.find(date=today_str)\\n match.next()\\n running_total = 0\\n for i in range(7):\\n running_total += return_daily_figure(today)\\n today = today - datetime.timedelta(days=1)\\n average_dose_per_day = round(running_total/7)\\n return running_total, average_dose_per_day \\n except:\\n today = today - datetime.timedelta(days=1)\",\n \"def weekly():\\n\\n response = {}\\n\\n # 0..6 => Sunday..Saturday\\n for i in range(7):\\n hours = []\\n interactions = 0\\n\\n for j in range(25):\\n try:\\n wfile = open(common.stats_path + '/weekly-average/' + str(i) + '/' + str(j))\\n data = wfile.read()\\n\\n if j == 24:\\n interactions = int(data)\\n else:\\n hours.append(int(data))\\n\\n wfile.close()\\n except IOError:\\n if i < 24:\\n hours.append(0)\\n\\n response[DAYS[i]] = {'hours': hours, 'interactions': interactions}\\n\\n return response\",\n \"def getProbabilityDistribution(probEnter = 0.8):\\n idealTimer = probEnter * 5\\n initialProbs = [0.05, 0.05, 0.05, 0.05, 0.05]\\n for i in range(5):\\n if idealTimer <= i + 1:\\n initialProbs[i] = 0.6\\n if i == 0:\\n initialProbs[1] = 0.2\\n initialProbs[2] = 0.1\\n elif i == 4:\\n initialProbs[3] = 0.2\\n initialProbs[2] = 0.1\\n else:\\n initialProbs[i + 1] = 0.15\\n initialProbs[i - 1] = 0.15\\n\\n return initialProbs\",\n \"def shotgenerator():\\n return random.randint(0, 9), random.randint(0, 9)\",\n \"def test_wake_hour_less_than_sleep_hour(self):\\n self.mock_clock.now.return_value = datetime.datetime(2016, 5, 24, 0)\\n sleep_windows = [(22, 8)]\\n pump_sched = pump_scheduler.PumpScheduler(self.mock_clock,\\n sleep_windows)\\n self.assertFalse(pump_sched.is_running_pump_allowed())\",\n \"def __fill_person (self, person):\\n \\n scheduled = True\\n while person.get_monthly_hours_difference (self.date) > 0 and scheduled:\\n scheduled = False\\n #schedule person\\n scheduling_units = self.__get_emptiest (person)\\n dates = self.workers.get_dates ( )\\n for date in dates:\\n for scheduling_unit in scheduling_units:\\n \\n turnuses = list (self.mapper.get_turnuses (scheduling_unit, person))\\n random.shuffle (turnuses)\\n \\n for turnus in turnuses:\\n if self.__is_valid_move (scheduling_unit, turnus, date, person, True):\\n person.schedule_turnus (date, turnus, scheduling_unit)\\n \\n #block the previous day, if it was the night turnus\\n prev_date = date - datetime.timedelta(days=1)\\n if turnus.code[0] == 'N' and not person.is_blocked(prev_date, turnus):\\n person.add_invalid_turnus(prev_date, turnus)\\n \\n # the is valid move has taken care of any potential violations, so that you\\n # can just schedule turnuses\\n if person.packet_night_turnuses and turnus.code[0] == 'N':\\n next_date = date + datetime.timedelta(days=1)\\n person.schedule_turnus (next_date, turnus, scheduling_unit)\\n #if it is Saturday, schedule one more\\n if next_date.weekday() == 5:\\n next_date += datetime.timedelta(days=1)\\n #find the workfree night turnus\\n night_turnus = None\\n for temp_turnus in self.mapper.get_turnuses (scheduling_unit, person):\\n if temp_turnus.holiday and temp_turnus.code[0] == 'N':\\n night_turnus = temp_turnus\\n break\\n else:\\n raise Exception ('Napaka pri dodajanju osebe z zdruzenimi nocnimi turnusi.')\\n person.schedule_turnus(next_date, night_turnus, scheduling_unit)\\n if turnus.code[0] == 'N' and not person.is_blocked(next_date + datetime.timedelta(days=1), turnus):\\n person.add_invalid_turnus(next_date + datetime.timedelta(days=1), turnus)\\n else:\\n if turnus.code[0] == 'N' and not person.is_blocked(next_date + datetime.timedelta(days=1), turnus):\\n person.add_invalid_turnus(next_date + datetime.timedelta(days=1), turnus) \\n \\n if holiday.is_workfree(date):\\n schedule_utils.add_free_day (person, date)\\n scheduled = True\\n if person.get_monthly_hours_difference (self.date) <= 0:\\n return\\n else:\\n scheduled = False\\n if person.get_monthly_hours_difference (self.date) <= 0:\\n return\",\n \"def data_feeder_2():\\n return random.sample(range(100), 10)\",\n \"def generation(Duration, amount):\\n # Generate group sizes, the total group number is \\\"amount\\\"， the number of people in each group is between 1 and 6\\n size = np.random.randint(1, 7, amount)\\n # Generate vip situation, based on the probability of 8%\\n vip = []\\n for i in range(amount):\\n num = np.random.randint(0, 101, 1)\\n if (num >= 0) & (num <= 8):\\n vip.append(True)\\n else:\\n vip.append(False)\\n # Generate the registration time for each group\\n timestamp_list = mod_pert_random(0, Duration // 2, Duration, samples=amount).astype(int)\\n timestamp_list = list(timestamp_list)\\n\\n counter = 0\\n queue_2 = Queue()\\n queue_4 = Queue()\\n queue_6 = Queue()\\n\\n table_2, table_4, table_6 = tablesSetting(6, 4, 2) # Initializing tables\\n\\n total_timeR_2 = [] # For calculating total average waiting time\\n nextGroup_endTime_2 = {} # {No. of table: the ending time of the table}\\n\\n total_timeR_4 = []\\n nextGroup_endTime_4 = {}\\n total_timeR_6 = []\\n nextGroup_endTime_6 = {}\\n\\n groupNumb = 0 # all group have their unique ID\\n\\n for i in range(Duration):\\n while i in timestamp_list:\\n if size[counter] == 1 or size[counter] == 2:\\n queue_2.add_queue(Group(i, 2, vip[counter], groupNumb))\\n counter += 1\\n groupNumb += 1\\n elif size[counter] == 3 or size[counter] == 4:\\n queue_4.add_queue(Group(i, 4, vip[counter], groupNumb))\\n counter += 1\\n groupNumb += 1\\n elif size[counter] == 5 or size[counter] == 6:\\n queue_6.add_queue(Group(i, 6, vip[counter], groupNumb))\\n counter += 1\\n groupNumb += 1\\n timestamp_list.remove(i) # Deal with the situation that several groups arrive at the same time point\\n\\n # Run the simulation\\n simulation(i, table_2, Duration, queue_2, total_timeR_2, nextGroup_endTime_2)\\n simulation(i, table_4, Duration, queue_4, total_timeR_4, nextGroup_endTime_4)\\n simulation(i, table_6, Duration, queue_6, total_timeR_6, nextGroup_endTime_6)\\n\\n # Summary\\n if i == Duration-1:\\n print(\\\"Total groups served (groups who finished their meal or on the table currently):\\\",\\n len(total_timeR_2)+len(total_timeR_4)+len(total_timeR_6))\\n avg=(sum(total_timeR_2)+sum(total_timeR_4)+sum(total_timeR_6))/(len(total_timeR_2)+len(total_timeR_4)+len(total_timeR_6))\\n print('Average waiting time for groups served: {0:.2f}'.format(avg), \\\"minute(s)\\\")\",\n \"def determine_sleep_times(self):\\n\\n determined_sleep_time = \\\\\\n random.randrange(self.dns_conf.min_backoff_range,\\n self.dns_conf.max_backoff_range)\\n\\n backoff = [(2 ** i) * determined_sleep_time for i in\\n range(0, self.dns_conf.retries)]\\n\\n return backoff\",\n \"def sample_times(times, num_examples):\\n sample = random.sample(times, num_examples)\\n make_hist(sample, 10, 'Sample of Size ' + str(num_examples),\\n 'Minutes to Complete Race', 'Number of Runners')\",\n \"def generate_fire_recurrence(self):\\n self._time_to_next_fire = round(\\n weibullvariate(self._scale_parameter, self._shape_parameter), 2\\n )\\n return self._time_to_next_fire\",\n \"def calculateScheduleDHL(self, dayHourList):\\n schedule = self.blankSchedule()\\n for dayHour in dayHourList:\\n schedule[dayHour[0]][dayHour[1]] = 1\\n return schedule\",\n \"def simulate_fish_population(fish, days):\\n for _ in range(days):\\n new_fish = []\\n for fish in fish:\\n if fish == 0:\\n new_fish.append(6)\\n new_fish.append(8)\\n else:\\n new_fish.append(fish - 1)\\n fish = new_fish\\n return fish\",\n \"def generate_zonal_demand(self, t):\\n t_hour = (t / 3600)\\n t_15_min = convert_seconds_to_15_min(t)\\n\\n # this needs to be double checked\\n if self.WARMUP_PHASE and t >= self.ANALYSIS_TIME_SECONDS:\\n # print(\\\"changing demand rate from warm up to analysis\\\")\\n # self.set_analysis_time(self.ANALYSIS_TIME_HOUR)\\n self.WARMUP_PHASE = False\\n # update drivers infor/expectations\\n\\n # generate demand only every 15 minutes\\n if t % 900 == 0:\\n for z in self.zones:\\n z.generate_requests_to_time(t) # t is seconds\",\n \"def create_trials(self):\\n exp_s = self.settings['experiment']\\n\\n # get stimuli\\n with h5py.File(exp_s['stim_file'], 'r') as f:\\n self.stim_rgb_arr = np.array(f['patterns'])\\n self.stimuli = [GratingStim(win=self.session.win, tex=s.T)\\n for s in self.stim_rgb_arr]\\n self.fixation_dot = Circle(self.win, radius=0.1, edges=100, color='r')\\n\\n # timings that define how many trials etc.\\n mean_trial_duration = exp_s['isi_min'] + exp_s['isi_mean']\\n self.n_trials = round(\\n (exp_s['total_run_duration'] - (exp_s['start_end_period'] * 2)) / mean_trial_duration)\\n tolerance_range = [exp_s['total_run_duration'] - exp_s['temporal_tolerance'],\\n exp_s['total_run_duration'] + exp_s['temporal_tolerance']]\\n\\n # and then search for the right isis to fill up the experiment exactly.\\n isis = np.random.exponential(\\n exp_s['isi_mean'], n_trials) + exp_s['isi_min']\\n exp_duration = isis + (exp_s['start_end_period'] * 2)\\n while exp_duration < tolerance_range[0] or exp_duration > tolerance_range[1]:\\n isis = np.random.exponential(\\n exp_s['isi_mean'], n_trials) + exp_s['isi_min']\\n exp_duration = isis + (exp_s['start_end_period'] * 2)\\n pretimes = np.zeros(self.n_trials)\\n pretimes[[0, -1]] = exp_s['start_end_period']\\n\\n # deciding which stimuli to show when\\n self.how_many_images_per_trial = exp_s['stim_flicker_freq'] * \\\\\\n exp_s['stim_duration']\\n self.duration_per_image = 1.0/exp_s['stim_flicker_freq']\\n\\n trial_images = np.random.randint(len(self.stimuli), size=(\\n self.n_trials, self.how_many_images_per_trial))\\n\\n for i in range(self.n_trials):\\n self.trials.append(HRFMapperTrial(\\n session=self,\\n trial_nr=i,\\n phase_durations=[\\n pretimes[i], exp_s['stim_duration'], isis[i]-exp_s['stim_duration']],\\n phase_names=['slack', 'stim', 'isi'],\\n parameters={'isi': isis[i],\\n 'stim_list': trial_images[i]},\\n timing='seconds',\\n load_next_during_phase=None,\\n verbose=True,\\n condition='hrf'\\n ))\",\n \"def __dice_generator(self):\\n self.current_dice = np.random.randint(1, 6 + 1)\",\n \"def generate_synth_data(n):\",\n \"def sim_alternating_exp():\\n catches = 0\\n for _ in range(100000):\\n j = np.random.uniform()*1000\\n # j = np.random.exponential(500)\\n t_i = 0\\n i = 0\\n while t_i < j+100:\\n if i % 2 == 1:\\n t_i += np.random.exponential(10)\\n else:\\n t_i += np.random.exponential(20)\\n if j < t_i and t_i < j+1:\\n catches += 1\\n i += 1\\n print(catches/100000)\",\n \"def test_power(self):\\r\\n a = 6 # shape\\r\\n samples = 5000\\r\\n max = -0.06\\r\\n min = -3.3\\r\\n s = np.random.power(a, samples) * -1 * (min - max) + min\\r\\n plt.hist(s, bins=30, density=False)\\r\\n plt.xlabel('Interlayer point energy [eV]')\\r\\n plt.ylabel('Frequency')\\r\\n plt.show()\",\n \"def sim_an_reheat(neighborhood, Tmax, Tmin, iterations):\\n\\n temp = Tmax\\n\\n # set iteration number to 0 at start\\n n = 0\\n\\n plot_list = []\\n\\n current_costs = neighborhood.get_total_costs()\\n cooling_rate = float(Tmin/Tmax)**(1/iterations)\\n\\n reheat_moment = 0.99\\n reheat_factor = 0.7\\n\\n reheated = False\\n\\n while n < iterations:\\n\\n\\n if n == iterations * reheat_moment and not reheated:\\n print(f\\\"costs before: {neighborhood.get_total_costs()}\\\")\\n n -= (n * reheat_factor)\\n # print(f\\\"n aftere: {n}\\\")\\n # print(\\\"yes\\\")\\n reheated = True\\n\\n\\n # adjust temperature according to exponential cooling scheme\\n temp = Tmax * (float(cooling_rate)**float(n))\\n #\\n # print(f\\\"{n}, {temp}\\\")\\n\\n swap_succes = False\\n while not swap_succes:\\n cable_1 = random.choice(neighborhood.cables)\\n cable_2 = random.choice(neighborhood.cables)\\n swap_succes = neighborhood.swap_connection(cable_1, cable_2)\\n\\n new_costs = neighborhood.get_total_costs()\\n if (acceptance_probability(current_costs, new_costs, temp) > random.random()):\\n current_costs = new_costs\\n else:\\n cable_1 = neighborhood.cables[-1]\\n cable_2 = neighborhood.cables[-2]\\n neighborhood.swap_connection(cable_1, cable_2)\\n\\n plot_list.append(current_costs)\\n n += 1\\n\\n print(f\\\"costs after: {neighborhood.get_total_costs()}\\\")\",\n \"def randomDays(self):\\n flag = False\\n while not flag:\\n r = np.floor(np.random.rand() * len(self.df.index))\\n start = self.df.index[r]\\n if r+self.daysHeld < len(self.df.index)-1:\\n end = self.df.index[r+self.daysHeld]\\n flag = True\\n return (start,end)\",\n \"def sample_times():\\n\\tthe_times = []\\n\\tday = config.window_start_date\\n\\twhile day <= config.window_end_date:\\n\\t\\t# times from start of window on day to end of window \\n\\t\\ttime = config.tz.localize( datetime.combine( \\n\\t\\t\\tday, config.window_start_time \\n\\t\\t) )\\n\\t\\tend_time = config.tz.localize( datetime.combine( \\n\\t\\t\\tday, config.window_end_time \\n\\t\\t) )\\n\\t\\twhile time < end_time: # While still in the time window\\n\\t\\t\\tthe_times.append( time )\\n\\t\\t\\ttime += timedelta(minutes=1)\\n\\t\\tday += timedelta(days=1)\\n\\treturn the_times\"\n]","isConversational":false},"negative_scores":{"kind":"list like","value":["0.62330836","0.59178996","0.58577496","0.57935345","0.5758614","0.5758422","0.5744238","0.5741066","0.5537405","0.5528022","0.5510911","0.549863","0.548807","0.5447449","0.544088","0.54101473","0.53661644","0.5355117","0.53540385","0.53415316","0.53243715","0.5321794","0.5318524","0.53185225","0.53161865","0.5312922","0.5304228","0.5291349","0.52673453","0.52572966","0.5254025","0.52297294","0.52052665","0.52046996","0.51671517","0.5155645","0.51475406","0.5147482","0.51456153","0.5142897","0.5139536","0.5137367","0.5136464","0.51355225","0.513319","0.5117329","0.5113306","0.51130766","0.5110622","0.5109215","0.5105868","0.51014394","0.5099365","0.50444067","0.504339","0.50407994","0.50402457","0.50396305","0.5036043","0.50341845","0.502918","0.50246876","0.5022592","0.50213355","0.5016536","0.5015885","0.49987307","0.4997224","0.4995662","0.4994225","0.49922138","0.4990832","0.4990832","0.4990832","0.4990832","0.49881056","0.49852127","0.4984801","0.49837944","0.49817416","0.49806654","0.49764168","0.49728838","0.4969871","0.49684393","0.49678618","0.49625966","0.49583873","0.49532664","0.49531934","0.49472654","0.49387926","0.49328512","0.49320942","0.49296376","0.49256954","0.49199525","0.49185252","0.4918318","0.49163234"],"string":"[\n \"0.62330836\",\n \"0.59178996\",\n \"0.58577496\",\n \"0.57935345\",\n \"0.5758614\",\n \"0.5758422\",\n \"0.5744238\",\n \"0.5741066\",\n \"0.5537405\",\n \"0.5528022\",\n \"0.5510911\",\n \"0.549863\",\n \"0.548807\",\n \"0.5447449\",\n \"0.544088\",\n \"0.54101473\",\n \"0.53661644\",\n \"0.5355117\",\n \"0.53540385\",\n \"0.53415316\",\n \"0.53243715\",\n \"0.5321794\",\n \"0.5318524\",\n \"0.53185225\",\n \"0.53161865\",\n \"0.5312922\",\n \"0.5304228\",\n \"0.5291349\",\n \"0.52673453\",\n \"0.52572966\",\n \"0.5254025\",\n \"0.52297294\",\n \"0.52052665\",\n \"0.52046996\",\n \"0.51671517\",\n \"0.5155645\",\n \"0.51475406\",\n \"0.5147482\",\n \"0.51456153\",\n \"0.5142897\",\n \"0.5139536\",\n \"0.5137367\",\n \"0.5136464\",\n \"0.51355225\",\n \"0.513319\",\n \"0.5117329\",\n \"0.5113306\",\n \"0.51130766\",\n \"0.5110622\",\n \"0.5109215\",\n \"0.5105868\",\n \"0.51014394\",\n \"0.5099365\",\n \"0.50444067\",\n \"0.504339\",\n \"0.50407994\",\n \"0.50402457\",\n \"0.50396305\",\n \"0.5036043\",\n \"0.50341845\",\n \"0.502918\",\n \"0.50246876\",\n \"0.5022592\",\n \"0.50213355\",\n \"0.5016536\",\n \"0.5015885\",\n \"0.49987307\",\n \"0.4997224\",\n \"0.4995662\",\n \"0.4994225\",\n \"0.49922138\",\n \"0.4990832\",\n \"0.4990832\",\n \"0.4990832\",\n \"0.4990832\",\n \"0.49881056\",\n \"0.49852127\",\n \"0.4984801\",\n \"0.49837944\",\n \"0.49817416\",\n \"0.49806654\",\n \"0.49764168\",\n \"0.49728838\",\n \"0.4969871\",\n \"0.49684393\",\n \"0.49678618\",\n \"0.49625966\",\n \"0.49583873\",\n \"0.49532664\",\n \"0.49531934\",\n \"0.49472654\",\n \"0.49387926\",\n \"0.49328512\",\n \"0.49320942\",\n \"0.49296376\",\n \"0.49256954\",\n \"0.49199525\",\n \"0.49185252\",\n \"0.4918318\",\n \"0.49163234\"\n]","isConversational":false},"document_score":{"kind":"string","value":"0.5421668"},"document_rank":{"kind":"string","value":"15"}}},{"rowIdx":10191,"cells":{"query":{"kind":"string","value":"Used for fetching the attributes for __init__."},"document":{"kind":"string","value":"def _connect(self):\n try:\n return self.query('/')\n except Exception as err:\n log.error('%s: %s', self.baseurl, err)\n raise NotFound('No server found at: %s' % self.baseurl)"},"metadata":{"kind":"string","value":"{\n \"objective\": {\n \"self\": [],\n \"paired\": [],\n \"triplet\": [\n [\n \"query\",\n \"document\",\n \"negatives\"\n ]\n ]\n }\n}"},"negatives":{"kind":"list like","value":["def init_attrs(self):\n raise NotImplementedError","def __attrs_post_init__(self):","def attributes(self):\n ...","def attributes(self):","def extra_init(self):\n pass","def __init__():","def _init_attributes(self):\n self.attr = {\n 'name': None,\n 'tags': [],\n 'openHours': None,\n 'type': None,\n 'parent': None,\n 'locationId': None,\n 'bannerAbbreviation': None,\n 'arcGisAbbreviation': None,\n 'geoLocation': None,\n 'geometry': None,\n 'summary': None,\n 'description': None,\n 'descriptionHtml': None,\n 'address': None,\n 'city': None,\n 'state': None,\n 'zip': None,\n 'county': None,\n 'telephone': None,\n 'fax': None,\n 'thumbnails': [],\n 'images': [],\n 'departments': [],\n 'website': None,\n 'sqft': None,\n 'calendar': None,\n 'campus': None,\n 'girCount': None,\n 'girLimit': False,\n 'girLocations': None,\n 'synonyms': [],\n 'bldgId': None,\n 'parkingZoneGroup': None,\n 'propId': None,\n 'adaParkingSpaceCount': None,\n 'motorcycleParkingSpaceCount': None,\n 'evParkingSpaceCount': None,\n 'weeklyMenu': None,\n 'notes': None,\n 'labels': {},\n 'steward': None,\n 'shape': {}\n }","def attributes(self):\n raise NotImplementedError","def __init__(self):\n self.__dict__ = dict()\n self.load()","def _init(self):\n pass","def __init__(self, attrs):\n self.attrs = attrs\n self.iterobj = attrs.type.fields().__iter__()","def __init__(self, attrs: Dict[str, Any]) -> None:\n self.attrs = attrs","def load_attrs(self):\n return loads(self.get_attr().GetObject()) or {}","def getAttributes(self):\n pass","def _init_attributes(self):\n if os.name == \"nt\":\n if \"64\" in platform.architecture()[0]:\n platform_arch = \"x86_64\"\n elif \"32\" in platform.architecture()[0]:\n platform_arch = \"i386\"\n else:\n platform_arch = platform.architecture()\n os_ver = f\"Windows-{platform.win32_ver()[1]}\"\n else:\n platform_arch = platform.machine()\n if platform.system() == \"Darwin\":\n os_ver = f\"macOS-{platform.mac_ver()[0]}\"\n else:\n os_ver = \"-\".join(linux_distribution()[0:2])\n\n license_chunks = LICENSE.split(\" \")\n if license_chunks[0] == \"GPLv2\":\n client_license = \"GPL-2.0\"\n else:\n client_license = \"Commercial\"\n\n default_attributes = {\n # Process id\n \"_pid\": str(os.getpid()),\n # Platform architecture\n \"_platform\": platform_arch,\n # OS version\n \"_os\": os_ver,\n # Hostname of the local machine\n \"_source_host\": socket.gethostname(),\n # Client's name\n \"_client_name\": \"mysql-connector-python\",\n # Client's version\n \"_client_version\": \".\".join([str(x) for x in VERSION[0:3]]),\n # Client's License identifier\n \"_client_license\": client_license,\n }\n self._settings[\"attributes\"].update(default_attributes)\n\n if \"connection-attributes\" in self._settings:\n for attr_name in self._settings[\"connection-attributes\"]:\n attr_value = self._settings[\"connection-attributes\"][attr_name]\n # Validate name type\n if not isinstance(attr_name, str):\n raise InterfaceError(\n f\"Attribute name '{attr_name}' must be a string type\"\n )\n # Validate attribute name limit 32 characters\n if len(attr_name) > 32:\n raise InterfaceError(\n f\"Attribute name '{attr_name}' exceeds 32 characters \"\n \"limit size\"\n )\n # Validate names in connection-attributes cannot start with \"_\"\n if attr_name.startswith(\"_\"):\n raise InterfaceError(\n \"Key names in 'session-connect-attributes' cannot \"\n f\"start with '_', found: {attr_name}\"\n )\n # Validate value type\n if not isinstance(attr_value, str):\n raise InterfaceError(\n f\"Attribute name '{attr_name}' value '{attr_value}' \"\n \" must be a string type\"\n )\n\n # Validate attribute value limit 1024 characters\n if len(attr_value) > 1024:\n raise InterfaceError(\n f\"Attribute name '{attr_name}' value: '{attr_value}' \"\n \"exceeds 1024 characters limit size\"\n )\n\n self._settings[\"attributes\"][attr_name] = attr_value","def init(self):\n pass","def init(self):\n pass","def init(self):\n pass","def init(self):\n pass","def init(self):\n pass","def init(self):\n pass","def init(self):\n pass","def init(self):\n pass","def _initFields(self):\n pass","def __init__(object):","def from_init(attr):\n # text = importlib.resources.read_text(\"ebisim\", \"__init__.py\")\n loc = os.path.abspath(os.path.dirname(__file__))\n with open(os.path.join(loc, \"ebisim\", \"__init__.py\")) as f:\n text = f.read()\n for line in text.split(\"\\n\"):\n if line.strip().startswith(attr):\n return line.split(\"=\")[-1].strip(\" \\n\\'\\\"\")\n return \"attr not found\"","def initialize(cls):","def _init(self):","def get_attrs(self):\n return dir(self.config)","def get_attrs(self):\n return dir(self.config)","def __init__(self):\n self.some_att = 42","def __init__(self):\n self.__name = 'name'","def init():","def __init__(self, attribs):\n self.__instanced = False\n self.__initAccessor(attribs)\n self.__setValues(attribs)\n self.__instanced = True","def test_get_attributes(self):\n pass","def __init__(self, **kwargs):\n\n for name, attr in kwargs.items():\n setattr(self, name, attr)\n\n if 'scope' in kwargs.keys():\n self.is_main = True\n\n # collect all fields from all configs and regular kwargs\n fields = (_get_fields(attr) for name, attr in\n sorted(kwargs.items(), key=itemgetter(0))\n if not name == \"scope\")\n\n self.identifier_fields = sum(fields, [])","def __init__(__self__):\n pass","def __init__(__self__):\n pass","def __init__(__self__):\n pass","def __init__(__self__):\n pass","def __init__(__self__):\n pass","def __init__(__self__):\n pass","def __init__(__self__):\n pass","def __init__(__self__):\n pass","def __init__(__self__):\n pass","def __init__(__self__):\n pass","def _get_init_args(self):\n signature = inspect.signature(self.__init__)\n parameters = signature.parameters\n args = [arg for arg, p in parameters.items()\n if p.kind is p.POSITIONAL_OR_KEYWORD]\n\n return {arg: getattr(self, arg) for arg in args if arg != 'self'}","def __init__(self, attrs = None):\n\n if attrs != None:\n self.__dict__.update(attrs)","def init(self) -> None:","def init_vars(self):\n # type: () -> None\n raise NotImplementedError","def __init_on_load__(self):","def getProperties():","def attrs(self):\n return self.__dict__","def init(self):","def init(self):","def __init__(self, **attrs):\n \n # set given attributes\n for name, value in attrs.items():\n if hasattr(self, name):\n setattr(self, name, value)\n else:\n raise AttributeError(\"Attribute not found! --> %s\" % name)","def __init__(self):\n self.swagger_types = {\n 'discovery': 'Discovery',\n 'groups': 'list[str]',\n 'labels': 'object'\n }\n\n self.attribute_map = {\n 'discovery': 'discovery',\n 'groups': 'groups',\n 'labels': 'labels'\n }\n\n self._discovery = None\n self._groups = None\n self._labels = None","def __init__(self):\n self._inst = {}","def get_attributes(self) -> Dict[str, str]:\n pass","def __init__(self, attributes_names: list):\r\n self.attributes_names = attributes_names","def __init__(self, attributes_names: list):\r\n self.attributes_names = attributes_names","def __init__(self, *args, **kwargs):\n super(AttrDict, self).__init__(*args, **kwargs)\n self.__dict__ = self","def get_properties():","def properties(self):","def properties(self):","def properties(self):","def __init__(self, attr=None):\r\n self.attr = attr","def do_init(self):\n\n pass","def __init__ (self):\n pass","def __init__(self):\n self.relation = ''\n self.attributes = []\n self.attribute_types = dict()\n self.attribute_data = dict()\n self.comment = []\n self.data = []\n pass","def init(self):\n return self._init","def init(self) -> None:\n ...","def __init__(self):\n self.properties = {}","def __init__(self, name, config):\n # self.rest = rest\n self._name = name\n self._config = config\n self._attributes = {}","def test_init(attributes):\n namespace = Namespace(miriam_id=\"MIR:00000022\", prefix=\"go\", pattern=r\"^GO:\\d{7}$\")\n instance = CompartmentAnnotation(namespace=namespace, **attributes)\n for attr, value in attributes.items():\n assert getattr(instance, attr) == value","def test_init_attributes(self):\n t = self.Test({'id': 1, 'poop': 'abc'})\n\n self.assertEqual(t.id, 1)\n self.assertEqual(t.name, None)\n self.assertRaises(AttributeError, t.__getattribute__, 'poop')","def get_attributes(cls):\r\n return []","def __init__(self):\n self.info = dict()","def _get_init_kwds(self):\n kwds = dict(((key, getattr(self, key, None))\n for key in self._init_keys))\n return kwds","def init_attributes(self):\n # Set default values\n for key, value in self.defaults.items():\n setattr(self, key, value)\n\n # Parse all arguments in kwargs\n for key, value in self.kwargs.items():\n parsed_value = eval_arg(value, key)\n logging.info('Setting ' + str(type(parsed_value)) + ' self.' + str(key) + ' = ' + str(parsed_value))\n setattr(self, key, parsed_value)\n\n # self.today = date_utils.get_datetime_from_timezone(self.date_offset, self.timezone)\n self.today = datetime.datetime.today()","def __init__(self, **attributes):\n for key, value in attributes.items():\n setattr(self, key, value)","def user_init(self):\n pass","def _init(self):\n raise NotImplementedError","def _get_inits(self):\n # Fast-path already loaded\n if self.__inits is not None:\n return self.__inits\n # Initialize the dictionary\n self.__inits = dict()\n # Populate this dictionary with PyTorch's initialization functions\n for name in dir(torch.nn.init):\n if len(name) == 0 or name[0] == \"_\": # Ignore \"protected\" members\n continue\n if name[-1] != \"_\": # Ignore non-inplace members (heuristic)\n continue\n func = getattr(torch.nn.init, name)\n if isinstance(func, types.FunctionType): # Heuristic\n self.__inits[name[:-1]] = func\n # Return the dictionary\n return self.__inits","def test_default_attributes_set_in_init(self):\n\n x = BaseTransformer()\n\n expected_attributes = {\n \"version_\": tubular._version.__version__,\n \"verbose\": False,\n \"columns\": None,\n \"copy\": True,\n }\n\n h.test_object_attributes(\n obj=x,\n expected_attributes=expected_attributes,\n msg=\"Default attributes set in init\",\n )","def __init_accessors (self):\n self.colors = ay.utils.Colors\n self.layout = Layout(self.seed)\n self.shapes = Shapes","def __init__(self, **initial_attributes):\n\n for attribute_name, attribute_value in initial_attributes.items():\n setattr(self, attribute_name, attribute_value)","def __init__(self):\n\n try:\n # read attributes from attributes file\n with open(const.Storage.ATTRIBUTES) as attributes_file:\n # read the file and parse it to JSON data\n json_data = attributes_file.read()\n attributes = json.loads(json_data)\n\n # set attributes\n self.id = str(attributes[\"id\"])\n self.length = float(attributes[\"length\"])\n self.width = float(attributes[\"width\"])\n except OSError:\n raise OSError(\"The attributes file could not be opened.\")","def initialise(self):","def __init__(self):\n super().__init__()\n self.name = '' # name of this istance (alias)\n self.type = type(self).__name__ # specific type within this class\n self.verbosity = None # verbosity level (see message handler)\n self.globalAttributes = {} # this is a dictionary that contains parameters that are set at the level of the base classes defining the types\n self._knownAttribute = [] # this is a list of strings representing the allowed attribute in the xml input for the class\n self._knownAttribute += ['name','verbosity'] # attributes that are known\n self.printTag = 'BaseType' # the tag that refers to this class in all the specific printing\n self.variableGroups = {} # the variables this class needs to be aware of\n self.metadataKeys = set() # list of registered metadata keys to expect from this entity\n self.metadataParams = {} # dictionary of registered metadata keys with repect to their indexes","def getInitParams(self):\n return {}","def _get_constructor_parameters(self) -> Dict[str, Any]:\n return dict(\n obs_space=self.obs_space,\n action_space=self.action_space,\n scale_imgs=self.scale_imgs,\n )","def __post_init__(self):\n pass","def properties(self):\n pass","def attributes(self):\n return self.__dict.keys()","def initialize(self, **kwargs):","def attrs(self):\n return self.__slots__","def __init__(self, name, attr=None):\n self.name = name\n self.propertiesstr = attr","def init(self):\n raise NotImplementedError","def init(self):\n raise NotImplementedError","def _init_node_attributes(self):\n assert False"],"string":"[\n \"def init_attrs(self):\\n raise NotImplementedError\",\n \"def __attrs_post_init__(self):\",\n \"def attributes(self):\\n ...\",\n \"def attributes(self):\",\n \"def extra_init(self):\\n pass\",\n \"def __init__():\",\n \"def _init_attributes(self):\\n self.attr = {\\n 'name': None,\\n 'tags': [],\\n 'openHours': None,\\n 'type': None,\\n 'parent': None,\\n 'locationId': None,\\n 'bannerAbbreviation': None,\\n 'arcGisAbbreviation': None,\\n 'geoLocation': None,\\n 'geometry': None,\\n 'summary': None,\\n 'description': None,\\n 'descriptionHtml': None,\\n 'address': None,\\n 'city': None,\\n 'state': None,\\n 'zip': None,\\n 'county': None,\\n 'telephone': None,\\n 'fax': None,\\n 'thumbnails': [],\\n 'images': [],\\n 'departments': [],\\n 'website': None,\\n 'sqft': None,\\n 'calendar': None,\\n 'campus': None,\\n 'girCount': None,\\n 'girLimit': False,\\n 'girLocations': None,\\n 'synonyms': [],\\n 'bldgId': None,\\n 'parkingZoneGroup': None,\\n 'propId': None,\\n 'adaParkingSpaceCount': None,\\n 'motorcycleParkingSpaceCount': None,\\n 'evParkingSpaceCount': None,\\n 'weeklyMenu': None,\\n 'notes': None,\\n 'labels': {},\\n 'steward': None,\\n 'shape': {}\\n }\",\n \"def attributes(self):\\n raise NotImplementedError\",\n \"def __init__(self):\\n self.__dict__ = dict()\\n self.load()\",\n \"def _init(self):\\n pass\",\n \"def __init__(self, attrs):\\n self.attrs = attrs\\n self.iterobj = attrs.type.fields().__iter__()\",\n \"def __init__(self, attrs: Dict[str, Any]) -> None:\\n self.attrs = attrs\",\n \"def load_attrs(self):\\n return loads(self.get_attr().GetObject()) or {}\",\n \"def getAttributes(self):\\n pass\",\n \"def _init_attributes(self):\\n if os.name == \\\"nt\\\":\\n if \\\"64\\\" in platform.architecture()[0]:\\n platform_arch = \\\"x86_64\\\"\\n elif \\\"32\\\" in platform.architecture()[0]:\\n platform_arch = \\\"i386\\\"\\n else:\\n platform_arch = platform.architecture()\\n os_ver = f\\\"Windows-{platform.win32_ver()[1]}\\\"\\n else:\\n platform_arch = platform.machine()\\n if platform.system() == \\\"Darwin\\\":\\n os_ver = f\\\"macOS-{platform.mac_ver()[0]}\\\"\\n else:\\n os_ver = \\\"-\\\".join(linux_distribution()[0:2])\\n\\n license_chunks = LICENSE.split(\\\" \\\")\\n if license_chunks[0] == \\\"GPLv2\\\":\\n client_license = \\\"GPL-2.0\\\"\\n else:\\n client_license = \\\"Commercial\\\"\\n\\n default_attributes = {\\n # Process id\\n \\\"_pid\\\": str(os.getpid()),\\n # Platform architecture\\n \\\"_platform\\\": platform_arch,\\n # OS version\\n \\\"_os\\\": os_ver,\\n # Hostname of the local machine\\n \\\"_source_host\\\": socket.gethostname(),\\n # Client's name\\n \\\"_client_name\\\": \\\"mysql-connector-python\\\",\\n # Client's version\\n \\\"_client_version\\\": \\\".\\\".join([str(x) for x in VERSION[0:3]]),\\n # Client's License identifier\\n \\\"_client_license\\\": client_license,\\n }\\n self._settings[\\\"attributes\\\"].update(default_attributes)\\n\\n if \\\"connection-attributes\\\" in self._settings:\\n for attr_name in self._settings[\\\"connection-attributes\\\"]:\\n attr_value = self._settings[\\\"connection-attributes\\\"][attr_name]\\n # Validate name type\\n if not isinstance(attr_name, str):\\n raise InterfaceError(\\n f\\\"Attribute name '{attr_name}' must be a string type\\\"\\n )\\n # Validate attribute name limit 32 characters\\n if len(attr_name) > 32:\\n raise InterfaceError(\\n f\\\"Attribute name '{attr_name}' exceeds 32 characters \\\"\\n \\\"limit size\\\"\\n )\\n # Validate names in connection-attributes cannot start with \\\"_\\\"\\n if attr_name.startswith(\\\"_\\\"):\\n raise InterfaceError(\\n \\\"Key names in 'session-connect-attributes' cannot \\\"\\n f\\\"start with '_', found: {attr_name}\\\"\\n )\\n # Validate value type\\n if not isinstance(attr_value, str):\\n raise InterfaceError(\\n f\\\"Attribute name '{attr_name}' value '{attr_value}' \\\"\\n \\\" must be a string type\\\"\\n )\\n\\n # Validate attribute value limit 1024 characters\\n if len(attr_value) > 1024:\\n raise InterfaceError(\\n f\\\"Attribute name '{attr_name}' value: '{attr_value}' \\\"\\n \\\"exceeds 1024 characters limit size\\\"\\n )\\n\\n self._settings[\\\"attributes\\\"][attr_name] = attr_value\",\n \"def init(self):\\n pass\",\n \"def init(self):\\n pass\",\n \"def init(self):\\n pass\",\n \"def init(self):\\n pass\",\n \"def init(self):\\n pass\",\n \"def init(self):\\n pass\",\n \"def init(self):\\n pass\",\n \"def init(self):\\n pass\",\n \"def _initFields(self):\\n pass\",\n \"def __init__(object):\",\n \"def from_init(attr):\\n # text = importlib.resources.read_text(\\\"ebisim\\\", \\\"__init__.py\\\")\\n loc = os.path.abspath(os.path.dirname(__file__))\\n with open(os.path.join(loc, \\\"ebisim\\\", \\\"__init__.py\\\")) as f:\\n text = f.read()\\n for line in text.split(\\\"\\\\n\\\"):\\n if line.strip().startswith(attr):\\n return line.split(\\\"=\\\")[-1].strip(\\\" \\\\n\\\\'\\\\\\\"\\\")\\n return \\\"attr not found\\\"\",\n \"def initialize(cls):\",\n \"def _init(self):\",\n \"def get_attrs(self):\\n return dir(self.config)\",\n \"def get_attrs(self):\\n return dir(self.config)\",\n \"def __init__(self):\\n self.some_att = 42\",\n \"def __init__(self):\\n self.__name = 'name'\",\n \"def init():\",\n \"def __init__(self, attribs):\\n self.__instanced = False\\n self.__initAccessor(attribs)\\n self.__setValues(attribs)\\n self.__instanced = True\",\n \"def test_get_attributes(self):\\n pass\",\n \"def __init__(self, **kwargs):\\n\\n for name, attr in kwargs.items():\\n setattr(self, name, attr)\\n\\n if 'scope' in kwargs.keys():\\n self.is_main = True\\n\\n # collect all fields from all configs and regular kwargs\\n fields = (_get_fields(attr) for name, attr in\\n sorted(kwargs.items(), key=itemgetter(0))\\n if not name == \\\"scope\\\")\\n\\n self.identifier_fields = sum(fields, [])\",\n \"def __init__(__self__):\\n pass\",\n \"def __init__(__self__):\\n pass\",\n \"def __init__(__self__):\\n pass\",\n \"def __init__(__self__):\\n pass\",\n \"def __init__(__self__):\\n pass\",\n \"def __init__(__self__):\\n pass\",\n \"def __init__(__self__):\\n pass\",\n \"def __init__(__self__):\\n pass\",\n \"def __init__(__self__):\\n pass\",\n \"def __init__(__self__):\\n pass\",\n \"def _get_init_args(self):\\n signature = inspect.signature(self.__init__)\\n parameters = signature.parameters\\n args = [arg for arg, p in parameters.items()\\n if p.kind is p.POSITIONAL_OR_KEYWORD]\\n\\n return {arg: getattr(self, arg) for arg in args if arg != 'self'}\",\n \"def __init__(self, attrs = None):\\n\\n if attrs != None:\\n self.__dict__.update(attrs)\",\n \"def init(self) -> None:\",\n \"def init_vars(self):\\n # type: () -> None\\n raise NotImplementedError\",\n \"def __init_on_load__(self):\",\n \"def getProperties():\",\n \"def attrs(self):\\n return self.__dict__\",\n \"def init(self):\",\n \"def init(self):\",\n \"def __init__(self, **attrs):\\n \\n # set given attributes\\n for name, value in attrs.items():\\n if hasattr(self, name):\\n setattr(self, name, value)\\n else:\\n raise AttributeError(\\\"Attribute not found! --> %s\\\" % name)\",\n \"def __init__(self):\\n self.swagger_types = {\\n 'discovery': 'Discovery',\\n 'groups': 'list[str]',\\n 'labels': 'object'\\n }\\n\\n self.attribute_map = {\\n 'discovery': 'discovery',\\n 'groups': 'groups',\\n 'labels': 'labels'\\n }\\n\\n self._discovery = None\\n self._groups = None\\n self._labels = None\",\n \"def __init__(self):\\n self._inst = {}\",\n \"def get_attributes(self) -> Dict[str, str]:\\n pass\",\n \"def __init__(self, attributes_names: list):\\r\\n self.attributes_names = attributes_names\",\n \"def __init__(self, attributes_names: list):\\r\\n self.attributes_names = attributes_names\",\n \"def __init__(self, *args, **kwargs):\\n super(AttrDict, self).__init__(*args, **kwargs)\\n self.__dict__ = self\",\n \"def get_properties():\",\n \"def properties(self):\",\n \"def properties(self):\",\n \"def properties(self):\",\n \"def __init__(self, attr=None):\\r\\n self.attr = attr\",\n \"def do_init(self):\\n\\n pass\",\n \"def __init__ (self):\\n pass\",\n \"def __init__(self):\\n self.relation = ''\\n self.attributes = []\\n self.attribute_types = dict()\\n self.attribute_data = dict()\\n self.comment = []\\n self.data = []\\n pass\",\n \"def init(self):\\n return self._init\",\n \"def init(self) -> None:\\n ...\",\n \"def __init__(self):\\n self.properties = {}\",\n \"def __init__(self, name, config):\\n # self.rest = rest\\n self._name = name\\n self._config = config\\n self._attributes = {}\",\n \"def test_init(attributes):\\n namespace = Namespace(miriam_id=\\\"MIR:00000022\\\", prefix=\\\"go\\\", pattern=r\\\"^GO:\\\\d{7}$\\\")\\n instance = CompartmentAnnotation(namespace=namespace, **attributes)\\n for attr, value in attributes.items():\\n assert getattr(instance, attr) == value\",\n \"def test_init_attributes(self):\\n t = self.Test({'id': 1, 'poop': 'abc'})\\n\\n self.assertEqual(t.id, 1)\\n self.assertEqual(t.name, None)\\n self.assertRaises(AttributeError, t.__getattribute__, 'poop')\",\n \"def get_attributes(cls):\\r\\n return []\",\n \"def __init__(self):\\n self.info = dict()\",\n \"def _get_init_kwds(self):\\n kwds = dict(((key, getattr(self, key, None))\\n for key in self._init_keys))\\n return kwds\",\n \"def init_attributes(self):\\n # Set default values\\n for key, value in self.defaults.items():\\n setattr(self, key, value)\\n\\n # Parse all arguments in kwargs\\n for key, value in self.kwargs.items():\\n parsed_value = eval_arg(value, key)\\n logging.info('Setting ' + str(type(parsed_value)) + ' self.' + str(key) + ' = ' + str(parsed_value))\\n setattr(self, key, parsed_value)\\n\\n # self.today = date_utils.get_datetime_from_timezone(self.date_offset, self.timezone)\\n self.today = datetime.datetime.today()\",\n \"def __init__(self, **attributes):\\n for key, value in attributes.items():\\n setattr(self, key, value)\",\n \"def user_init(self):\\n pass\",\n \"def _init(self):\\n raise NotImplementedError\",\n \"def _get_inits(self):\\n # Fast-path already loaded\\n if self.__inits is not None:\\n return self.__inits\\n # Initialize the dictionary\\n self.__inits = dict()\\n # Populate this dictionary with PyTorch's initialization functions\\n for name in dir(torch.nn.init):\\n if len(name) == 0 or name[0] == \\\"_\\\": # Ignore \\\"protected\\\" members\\n continue\\n if name[-1] != \\\"_\\\": # Ignore non-inplace members (heuristic)\\n continue\\n func = getattr(torch.nn.init, name)\\n if isinstance(func, types.FunctionType): # Heuristic\\n self.__inits[name[:-1]] = func\\n # Return the dictionary\\n return self.__inits\",\n \"def test_default_attributes_set_in_init(self):\\n\\n x = BaseTransformer()\\n\\n expected_attributes = {\\n \\\"version_\\\": tubular._version.__version__,\\n \\\"verbose\\\": False,\\n \\\"columns\\\": None,\\n \\\"copy\\\": True,\\n }\\n\\n h.test_object_attributes(\\n obj=x,\\n expected_attributes=expected_attributes,\\n msg=\\\"Default attributes set in init\\\",\\n )\",\n \"def __init_accessors (self):\\n self.colors = ay.utils.Colors\\n self.layout = Layout(self.seed)\\n self.shapes = Shapes\",\n \"def __init__(self, **initial_attributes):\\n\\n for attribute_name, attribute_value in initial_attributes.items():\\n setattr(self, attribute_name, attribute_value)\",\n \"def __init__(self):\\n\\n try:\\n # read attributes from attributes file\\n with open(const.Storage.ATTRIBUTES) as attributes_file:\\n # read the file and parse it to JSON data\\n json_data = attributes_file.read()\\n attributes = json.loads(json_data)\\n\\n # set attributes\\n self.id = str(attributes[\\\"id\\\"])\\n self.length = float(attributes[\\\"length\\\"])\\n self.width = float(attributes[\\\"width\\\"])\\n except OSError:\\n raise OSError(\\\"The attributes file could not be opened.\\\")\",\n \"def initialise(self):\",\n \"def __init__(self):\\n super().__init__()\\n self.name = '' # name of this istance (alias)\\n self.type = type(self).__name__ # specific type within this class\\n self.verbosity = None # verbosity level (see message handler)\\n self.globalAttributes = {} # this is a dictionary that contains parameters that are set at the level of the base classes defining the types\\n self._knownAttribute = [] # this is a list of strings representing the allowed attribute in the xml input for the class\\n self._knownAttribute += ['name','verbosity'] # attributes that are known\\n self.printTag = 'BaseType' # the tag that refers to this class in all the specific printing\\n self.variableGroups = {} # the variables this class needs to be aware of\\n self.metadataKeys = set() # list of registered metadata keys to expect from this entity\\n self.metadataParams = {} # dictionary of registered metadata keys with repect to their indexes\",\n \"def getInitParams(self):\\n return {}\",\n \"def _get_constructor_parameters(self) -> Dict[str, Any]:\\n return dict(\\n obs_space=self.obs_space,\\n action_space=self.action_space,\\n scale_imgs=self.scale_imgs,\\n )\",\n \"def __post_init__(self):\\n pass\",\n \"def properties(self):\\n pass\",\n \"def attributes(self):\\n return self.__dict.keys()\",\n \"def initialize(self, **kwargs):\",\n \"def attrs(self):\\n return self.__slots__\",\n \"def __init__(self, name, attr=None):\\n self.name = name\\n self.propertiesstr = attr\",\n \"def init(self):\\n raise NotImplementedError\",\n \"def init(self):\\n raise NotImplementedError\",\n \"def _init_node_attributes(self):\\n assert False\"\n]","isConversational":false},"negative_scores":{"kind":"list like","value":["0.7480157","0.72398555","0.7138921","0.71215737","0.66924196","0.66607845","0.6618965","0.65260583","0.65222377","0.6492983","0.6481646","0.63778156","0.6333728","0.6315431","0.6311145","0.6308918","0.6308918","0.6308918","0.6308918","0.6308918","0.6308918","0.6308918","0.6308918","0.6304838","0.63018423","0.62869483","0.62827075","0.6272005","0.62311095","0.62311095","0.6230525","0.6216272","0.62059456","0.61870354","0.6185741","0.61856693","0.6185283","0.6185283","0.6185283","0.6185283","0.6185283","0.6185283","0.6185283","0.6185283","0.6185283","0.6185283","0.6182565","0.61790115","0.61766106","0.6165054","0.6164909","0.61524075","0.6126714","0.6120716","0.6120716","0.6113128","0.61052185","0.60965544","0.6078587","0.60749835","0.60749835","0.6064437","0.6062452","0.60613465","0.60613465","0.60613465","0.60608196","0.60601145","0.6033882","0.60314155","0.60293233","0.60251784","0.60243267","0.6005088","0.6001408","0.59850615","0.5980888","0.5979299","0.597399","0.5964896","0.59591043","0.5955392","0.594433","0.59332395","0.5928796","0.5926054","0.5918241","0.5899467","0.58948463","0.58893543","0.5889263","0.58773476","0.587242","0.5856645","0.58533686","0.58529514","0.58523417","0.5842882","0.5838421","0.5838421","0.5837502"],"string":"[\n \"0.7480157\",\n \"0.72398555\",\n \"0.7138921\",\n \"0.71215737\",\n \"0.66924196\",\n \"0.66607845\",\n \"0.6618965\",\n \"0.65260583\",\n \"0.65222377\",\n \"0.6492983\",\n \"0.6481646\",\n \"0.63778156\",\n \"0.6333728\",\n \"0.6315431\",\n \"0.6311145\",\n \"0.6308918\",\n \"0.6308918\",\n \"0.6308918\",\n \"0.6308918\",\n \"0.6308918\",\n \"0.6308918\",\n \"0.6308918\",\n \"0.6308918\",\n \"0.6304838\",\n \"0.63018423\",\n \"0.62869483\",\n \"0.62827075\",\n \"0.6272005\",\n \"0.62311095\",\n \"0.62311095\",\n \"0.6230525\",\n \"0.6216272\",\n \"0.62059456\",\n \"0.61870354\",\n \"0.6185741\",\n \"0.61856693\",\n \"0.6185283\",\n \"0.6185283\",\n \"0.6185283\",\n \"0.6185283\",\n \"0.6185283\",\n \"0.6185283\",\n \"0.6185283\",\n \"0.6185283\",\n \"0.6185283\",\n \"0.6185283\",\n \"0.6182565\",\n \"0.61790115\",\n \"0.61766106\",\n \"0.6165054\",\n \"0.6164909\",\n \"0.61524075\",\n \"0.6126714\",\n \"0.6120716\",\n \"0.6120716\",\n \"0.6113128\",\n \"0.61052185\",\n \"0.60965544\",\n \"0.6078587\",\n \"0.60749835\",\n \"0.60749835\",\n \"0.6064437\",\n \"0.6062452\",\n \"0.60613465\",\n \"0.60613465\",\n \"0.60613465\",\n \"0.60608196\",\n \"0.60601145\",\n \"0.6033882\",\n \"0.60314155\",\n \"0.60293233\",\n \"0.60251784\",\n \"0.60243267\",\n \"0.6005088\",\n \"0.6001408\",\n \"0.59850615\",\n \"0.5980888\",\n \"0.5979299\",\n \"0.597399\",\n \"0.5964896\",\n \"0.59591043\",\n \"0.5955392\",\n \"0.594433\",\n \"0.59332395\",\n \"0.5928796\",\n \"0.5926054\",\n \"0.5918241\",\n \"0.5899467\",\n \"0.58948463\",\n \"0.58893543\",\n \"0.5889263\",\n \"0.58773476\",\n \"0.587242\",\n \"0.5856645\",\n \"0.58533686\",\n \"0.58529514\",\n \"0.58523417\",\n \"0.5842882\",\n \"0.5838421\",\n \"0.5838421\",\n \"0.5837502\"\n]","isConversational":false},"document_score":{"kind":"string","value":"0.0"},"document_rank":{"kind":"string","value":"-1"}}},{"rowIdx":10192,"cells":{"query":{"kind":"string","value":"Library to browse or search your media."},"document":{"kind":"string","value":"def library(self):\n if not self._library:\n self._library = Library(self, self.query('/library/'))\n return self._library"},"metadata":{"kind":"string","value":"{\n \"objective\": {\n \"self\": [],\n \"paired\": [],\n \"triplet\": [\n [\n \"query\",\n \"document\",\n \"negatives\"\n ]\n ]\n }\n}"},"negatives":{"kind":"list like","value":["async def async_browse_media(self, media_content_type=None, media_content_id=None):\n return await media_source.async_browse_media(\n self.hass,\n media_content_id,\n content_filter=lambda item: item.media_content_type.startswith(\"audio/\"),\n )\n \n #TODO: combide the BrowseMedia Media Sources above with the BrowseMedia Directory below\n #if \"udisk\" in self._source_list: \n # if media_content_id not in (None, \"root\"):\n # raise BrowseError(\n # f\"Media not found: {media_content_type} / {media_content_id}\"\n # )\n\n # source_media_name = self._source_list.get(\"udisk\", \"USB Disk\")\n\n # if len(self._trackq) > 0:\n # radio = [\n # BrowseMedia(\n # title = preset,\n # media_class = MEDIA_CLASS_MUSIC,\n # media_content_id = index,\n # media_content_type = MEDIA_TYPE_MUSIC,\n # can_play = True,\n # can_expand = False,\n # )\n # for index, preset in enumerate(self._trackq, start=1)\n # ]\n\n # root = BrowseMedia(\n # title=self._name + \" \" + source_media_name,\n # media_class = MEDIA_CLASS_DIRECTORY,\n # media_content_id = \"root\",\n # media_content_type = \"listing\",\n # can_play = False,\n # can_expand = True,\n # children = radio,\n # )\n\n # else:\n # root = BrowseMedia(\n # title=self._name + \" \" + source_media_name,\n # media_class = MEDIA_CLASS_DIRECTORY,\n # media_content_id = \"root\",\n # media_content_type = \"listing\",\n # can_play = False,\n # can_expand = False,\n # )\n\n # return root","async def async_browse_media(self, media_content_type=None, media_content_id=None):\n if media_content_type in [None, \"library\"]:\n pass\n\n if media_content_id is None:\n object_id = \"0\"\n else:\n object_id = media_content_id\n\n metadata = await self._raumfeld.async_browse_media(object_id, BROWSE_METADATA)\n metadata = metadata[0]\n\n children = await self._raumfeld.async_browse_media(object_id, BROWSE_CHILDREN)\n\n if children is None:\n log_fatal(\"No media identified\")\n\n metadata.children = children\n return metadata","def searchDiscover(self, query, limit=30, libtype=None):\n libtypes = {'movie': 'movies', 'show': 'tv'}\n libtype = libtypes.get(libtype, 'movies,tv')\n\n headers = {\n 'Accept': 'application/json'\n }\n params = {\n 'query': query,\n 'limit': limit,\n 'searchTypes': libtype,\n 'includeMetadata': 1\n }\n\n data = self.query(f'{self.METADATA}/library/search', headers=headers, params=params)\n searchResults = data['MediaContainer'].get('SearchResults', [])\n searchResult = next((s.get('SearchResult', []) for s in searchResults if s.get('id') == 'external'), [])\n\n results = []\n for result in searchResult:\n metadata = result['Metadata']\n type = metadata['type']\n if type == 'movie':\n tag = 'Video'\n elif type == 'show':\n tag = 'Directory'\n else:\n continue\n attrs = ''.join(f'{k}=\"{html.escape(str(v))}\" ' for k, v in metadata.items())\n xml = f'<{tag} {attrs}/>'\n results.append(self._manuallyLoadXML(xml))\n\n return self._toOnlineMetadata(results)","def browse(request):\n klass = media_klass_from_request(request)\n filter_args, filter_kwargs = filter_args_from_request(request)\n press_gallery = request.GET.get('press_gallery', '')\n press_gallery = press_gallery.lower() == 'true'\n if press_gallery:\n if not request.user.has_perm('gallery.can_see_press_gallery'):\n raise PermissionDenied\n # for now we only allow photos in the press gallery, not\n # artifacts or any other types. it's okay if the search query\n # doesn't specify a type, or if it specifies the photo type,\n # but we disallow other types of searches. it's a little ugly\n # to be doing explicit type checking, but expedience demands\n # it :P\n if klass is models.MediaBase:\n klass = models.Photo\n if klass is not models.Photo:\n return handler400(request)\n filter_kwargs['in_press_gallery'] = True\n status = request.GET.get('status')\n if not status:\n filter_kwargs['status'] = 'approved'\n elif status != 'approved':\n if not request.user.has_perm('gallery.can_review'):\n # only reviewers can arbitrarily query based on status;\n # non-reviewers are restricted to seeing their own\n # submissions if they search on a status other than\n # 'approved'\n if request.user.is_anonymous():\n raise PermissionDenied\n filter_kwargs['owner'] = request.user\n filter_kwargs['status'] = status\n else:\n filter_kwargs['status'] = status\n\n full_results = klass.objects.filter(*filter_args, **filter_kwargs)\n # reverse the order so most recent is first\n full_results = full_results.order_by('id').reverse()\n tag = request.GET.get('tag')\n if tag:\n full_results = tagmodels.TaggedItem.objects.get_by_model(full_results,\n tag)\n text = request.GET.get('text')\n if text:\n full_results = apply_searchable_text_filter(full_results, text)\n paginator = BetterPaginator(full_results, settings.PAGINATION_BATCH_SIZE)\n try:\n page = int(request.GET.get('page', '1'))\n except ValueError:\n page = 1\n try:\n page_results = paginator.page(page)\n except (InvalidPage, EmptyPage):\n page_results = paginator.page(paginator.num_pages)\n query_string = request.META.get('QUERY_STRING')\n # remove 'page' from query string so it doesn't get used in the template\n query_map = parse_qs(query_string)\n query_map.pop('page', None)\n query_string = urlencode(query_map, doseq=True)\n for extra_filter in ('owner', 'tag', 'press_gallery'):\n if extra_filter in query_map:\n del(query_map[extra_filter])\n qs_no_extra_filters = urlencode(query_map, doseq=True)\n no_extra_filters_url = reverse('bm.gallery.views.browse')\n if qs_no_extra_filters:\n no_extra_filters_url = '%s?%s' % (no_extra_filters_url,\n qs_no_extra_filters)\n template_map = {'page_results': page_results,\n 'total_count': full_results.count(),\n 'query_string': query_string,\n 'no_extra_filters_url': no_extra_filters_url,\n 'paginator': paginator.get_context(page),\n 'page': page}\n owner_username = request.GET.get('owner')\n if owner_username:\n template_map['owner'] = authmodels.User.objects.get(username=owner_username)\n if tag:\n template_map['tag'] = tag\n if press_gallery:\n template_map['press_gallery'] = True\n context = RequestContext(request, template_map)\n return render_to_response('gallery/browse.html', context)","async def async_browse_media(\n self,\n media_content_type: MediaType | str | None = None,\n media_content_id: str | None = None,\n ) -> BrowseMedia:\n self.thumbnail_cache = {}\n if media_content_type in (None, \"library\"):\n return await browse_top_level(self._volumio)\n\n return await browse_node(\n self, self._volumio, media_content_type, media_content_id\n )","def search(self):\n query = self.get_request_arg(\"query\")\n if query:\n album = self.ctrl.library.search(query)\n return self.resp_from_data(album)\n return self.resp_from_data(\n {\"message\": \"No query parameters specified\"}, 400)","async def search(self, keyword):\n await self.coordinator.data.search_media(self.zone_id, keyword)","def media_search(query, term):\n table = Media.__table__\n search_statement = or_(\n cast(table.c.id, Text).ilike('%' + term + '%'),\n cast(table.c.type, Text).ilike('%' + term + '%'),\n table.c.name.ilike('%' + term + '%'),\n table.c.cast.ilike('%' + term + '%'),\n cast(table.c.seasons, Text).ilike('%' + term + '%'),\n cast(table.c.release_date, Text).ilike('%' + term + '%'),\n table.c.last_aired.ilike('%' + term + '%'),\n table.c.image.ilike('%' + term + '%'),\n cast(table.c.running, Text).ilike('%' + term + '%'),\n table.c.overview.ilike('%' + term + '%'),\n table.c.other_images.ilike('%' + term + '%'),\n table.c.videos.ilike('%' + term + '%'),\n cast(table.c.imdb_id, Text).ilike('%' + term + '%'),\n cast(table.c.tmdb_id, Text).ilike('%' + term + '%'),\n cast(table.c.runtime, Text).ilike('%' + term + '%'),\n table.c.tagline.ilike('%' + term + '%'),\n cast(table.c.popularity, Text).ilike('%' + term + '%'),\n cast(table.c.average_rating, Text).ilike('%' + term + '%'))\n return query.filter(search_statement)","def media(self, path):\n path = \"/media/%s%s\" % (self.session.root, format_path(path))\n\n url, params, headers = self.request(path, method='GET')\n\n return self.rest_client.GET(url, headers)","def Scan(self, lib='video'):\n self.logger.debug(\"Scanning \" + lib + \"-library\")\n xbmc = Server(self.url('/jsonrpc', True))\n if lib == 'video':\n return xbmc.VideoLibrary.Scan()\n elif lib == 'audio':\n return xbmc.AudioLibrary.Scan()","def view_media(self, obj):\n for handle in self.selected_handles():\n ref_obj = self.dbstate.db.get_object_from_handle(handle)\n mpath = media_path_full(self.dbstate.db, ref_obj.get_path())\n open_file_with_default_application(mpath)","def folder_scan(self):\r\n\r\n cursor = connection.cursor()\r\n\r\n # Parsing the entire media folder and scanning each file\r\n for filename in os.listdir(media_folder):\r\n full_path = os.path.join(media_folder, filename).replace(\"\\\\\", \"/\")\r\n\r\n # Checks if the file is indexed to the database\r\n cursor.execute(\"SELECT COUNT(1) FROM media WHERE full_path = \\\"\" + full_path + \"\\\"\")\r\n result = int(str(cursor.fetchone())[1])\r\n\r\n if not result: # If the file is not indexed, the program automatically adds it to the database\r\n add_media(full_path, 1, self)\r\n\r\n connection.commit()\r\n\r\n # Resetting GUI-specific variables and counters before refreshing the media list\r\n self.library_items = []\r\n self.path_frame_parent.destroy()\r\n self.display_media()","async def async_browse_media(self, media_content_type=None, media_content_id=None):\n return await build_item_response(\n self._zone_id,\n self.coordinator,\n media_content_type,\n media_content_id,\n )","async def async_browse_media(\n self,\n media_content_type: MediaType | str | None = None,\n media_content_id: str | None = None,\n ) -> BrowseMedia:\n content_filter = None\n\n chromecast = self._get_chromecast()\n if chromecast.cast_type in (\n pychromecast.const.CAST_TYPE_AUDIO,\n pychromecast.const.CAST_TYPE_GROUP,\n ):\n\n def audio_content_filter(item):\n \"\"\"Filter non audio content.\"\"\"\n return item.media_content_type.startswith(\"audio/\")\n\n content_filter = audio_content_filter\n\n if media_content_id is None:\n return await self._async_root_payload(content_filter)\n\n platform: CastProtocol\n assert media_content_type is not None\n for platform in self.hass.data[CAST_DOMAIN][\"cast_platform\"].values():\n browse_media = await platform.async_browse_media(\n self.hass,\n media_content_type,\n media_content_id,\n chromecast.cast_type,\n )\n if browse_media:\n return browse_media\n\n return await media_source.async_browse_media(\n self.hass, media_content_id, content_filter=content_filter\n )","def _do_search(self,search_terms,order_by='relevance'):\n try:\n self._logger.info('Hey!listen up!...Attempting to perform a search in MegaVideo')\n self._logger.debug('Search Terms: %s',search_terms)\n srv = MegaVideoService(self._logger)\n query = MegaVideoQuery()\n query.query = search_terms\n query.sort = order_by\n query.max_results=int(self.search_max_results)\n return srv.query(query)\n except:\n self._logger.exception('Dammit!...An error ocurred while searching in MegaVideo...')\n return None\n else:\n self._logger.info('Great!...The MegaVideo search was succesfull...')","def index():\n\tform = FORM('',\n\t\t\t\tINPUT(_name='search_term', requires = IS_NOT_EMPTY(), _class='input-large search-query', \n\t\t\t\t\t_placeholder='Search for music', _autocomplete=\"off\"),\n\t\t\t\tINPUT(_type='submit', _class='btn', _value='Search'), _class='form-search')\n\tif form.process().accepted:\n\t\tredirect(URL('search', vars=dict(search_term=request.vars.search_term)))\n\tfeatured_albums = db.executesql(\"select * from top_release_group;\")\n\tgroupinfo = []\n\timagelink = []\n\tfor row in featured_albums:\n\t\tgroupinfo.append(row[0])\n\t\tif (row[2]):\n\t\t\timagelink.append(row[2])\n\t\telse:\n\t\t\timageurl = get_link(\"http://www.coverartarchive.org/release-group/\"+row[1]);\n\t\t\tdb.executesql(\"update top_release_group set url = '\"+str(imageurl)+\"' where id=\"+str(row[0])+\";\")\n\t\t\timagelink.append(imageurl)\n\treturn dict(form=form, groupinfo=groupinfo, imagelink=imagelink)","def search(self, entry):\r\n\r\n if entry.get() != \"\": # The algorithm only needs to run if the user has entered a search query\r\n\r\n cursor = connection.cursor()\r\n\r\n # Looking up the search entry in each of the database's columns\r\n cursor.execute(\"SELECT full_path FROM media WHERE INSTR(title, \" + \"\\\"\" + entry.get() + \"\\\"\" +\r\n \") > 0 OR INSTR(artist, \" + \"\\\"\" + entry.get() + \"\\\"\" + \") > 0 OR INSTR(album, \" + \"\\\"\" +\r\n entry.get() + \"\\\"\" + \") > 0 OR INSTR(release_date, \" + \"\\\"\" + entry.get() + \"\\\"\" + \") > 0\" +\r\n \" OR INSTR(tags, \" + \"\\\"\" + entry.get() + \"\\\"\" + \") > 0\")\r\n\r\n files = cursor.fetchall()\r\n\r\n # Packing the \"Back\" button, which quits the searching session\r\n self.back_button.grid(row=0, column=0, padx=5)\r\n self.search_entry.grid(row=0, column=1, padx=10, pady=20)\r\n self.search_button.grid(row=0, column=2, padx=5)\r\n # self.advanced_search_button.grid(row=0, column=3, padx=5)\r\n\r\n self.display_media(files) # Displaying the media list containing only the search results\r\n\r\n else: # The user has attempted a search on an empty string; displaying the entire media list instead\r\n self.display_media()","def test_list_media_type(self):\n\n # check if documentalist has access to list media-types\n self.login_documentalist()\n response = self.client.get('/multimedia/media-types/' )\n\n # 403 = unauthorized\n self.assertEqual(response.status_code, 403)\n\n self.client.logout()\n self.login_admin()\n\n response = self.client.get('/multimedia/media-types/')\n self.assertContains(response, \"Video\")","def uses_media(self):\n return True","def filter(self):\n for f in FileHelper.ALL_PATHS:\n media_obj = MediaObject(FileHelper.get_url(f), FileHelper.get_title(f), FileHelper.get_media_type(f), FileHelper.get_icon(f), FileHelper.get_duration(f), FileHelper.get_ctype(f))\n _id = media_obj.uuid\n if media_obj.media_type == \"image\":\n DB.IMAGES[_id] = media_obj\n elif media_obj.media_type == \"audio\":\n DB.MUSIC[_id] = media_obj\n elif media_obj.media_type == \"video\":\n DB.VIDEOS[_id] = media_obj\n else:\n print \"File '%s' doesn't play nice.\" % (f)","def display_media(self, search_list=None):\r\n\r\n global config_var # Using the global variable that reads and modifies the configuration file\r\n\r\n cursor = connection.cursor()\r\n\r\n index = 0 # Using an index to determine the correct row in which every media item needs to be placed\r\n\r\n if media_folder != \"\":\r\n self.header.pack(pady=10)\r\n\r\n # Resetting the media frame\r\n self.library_items = []\r\n self.path_frame_parent.destroy()\r\n self.path_frame_parent = Frame(self.media_frame, relief=GROOVE, width=500, height=100, bd=1)\r\n self.path_frame_parent.pack()\r\n\r\n # The canvas will store every item in the media list\r\n self.canvas = Canvas(self.path_frame_parent, width=500)\r\n path_frame_child = Frame(self.canvas, width=500)\r\n\r\n # Adding a scrollbar in case the media list height exceeds the window height\r\n scrollbar = Scrollbar(self.path_frame_parent, orient=\"vertical\", command=self.canvas.yview)\r\n self.canvas.configure(yscrollcommand=scrollbar.set)\r\n\r\n self.canvas.create_window((0, 0), window=path_frame_child, anchor='nw')\r\n scrollbar.pack(side=RIGHT, fill=Y)\r\n self.canvas.pack(side=LEFT)\r\n\r\n # The variable that stores the length (in characters) of the longest item in the media list\r\n self.longest_item_length = 0\r\n\r\n if search_list is None: # No search string was provided; displaying the entire media list\r\n self.back_button.grid_forget()\r\n self.search_entry.delete(0, 'end')\r\n\r\n # Parsing the entire database and displaying every record that matches the current media folder\r\n cursor.execute(\"SELECT COUNT(*) FROM media\")\r\n\r\n number_of_entries = cursor.fetchone() # This variable will store the amount of records in the database\r\n\r\n for i in range(number_of_entries[0]): # Parsing every item in the database\r\n index += 1\r\n\r\n cursor.execute(\"SELECT full_path FROM media WHERE id = \" + str(i + 1))\r\n entry_path = cursor.fetchone() # This variable will store the path of the currently selected item\r\n\r\n display_entry = StringVar()\r\n display_entry.set(os.path.basename(entry_path[0]))\r\n\r\n # This variable will store the name of the media file without showing the extension\r\n label_entry = StringVar()\r\n label_entry.set(os.path.splitext(display_entry.get())[0])\r\n\r\n # Checking if the currently selected item from the database is located in the media folder\r\n if (os.path.dirname(entry_path[0])) == config_var['MEDIA FOLDER']['folder']:\r\n # Adding the media item title to the media list\r\n cursor.execute(\"SELECT mode FROM media WHERE id = \" + str(i + 1))\r\n mode = cursor.fetchone()\r\n\r\n if int(mode[0]): # Displaying the media label using its filename\r\n self.library_items.append(Label(path_frame_child, textvariable=display_entry))\r\n self.library_items[-1].grid(row=index, column=1)\r\n\r\n current_item_length = len(display_entry.get())\r\n if current_item_length > self.longest_item_length:\r\n self.longest_item_length = current_item_length\r\n\r\n else: # Displaying the media label using its metadata\r\n cursor.execute(\"SELECT artist FROM media WHERE id = \" + str(i + 1))\r\n artist = cursor.fetchone()\r\n cursor.execute(\"SELECT title FROM media WHERE id = \" + str(i + 1))\r\n title = cursor.fetchone()\r\n\r\n display_label = StringVar()\r\n display_label.set(artist[0] + \" - \" + title[0])\r\n\r\n self.library_items.append(Label(path_frame_child, textvariable=display_label))\r\n self.library_items[-1].grid(row=index, column=1)\r\n\r\n current_item_length = len(display_label.get())\r\n if current_item_length > self.longest_item_length:\r\n self.longest_item_length = current_item_length\r\n\r\n # Adding the play button specific to the current media item\r\n self.library_items.append(Button(path_frame_child, text=\"Play\",\r\n command=lambda file_path=entry_path[0]:\r\n play_media(file_path, 1, self)))\r\n self.library_items[-1].grid(row=index, column=2, padx=10, pady=5)\r\n\r\n \"\"\"\r\n # Adding the info button specific to the current media item\r\n self.library_items.append(Button(path_frame_child, text=\"Info\"))\r\n self.library_items[-1].grid(row=index, column=3, padx=10, pady=5)\r\n \"\"\"\r\n\r\n # Adding the configuration button specific to the current media item\r\n self.library_items.append(Button(path_frame_child, text=\"Configure\",\r\n command=lambda media_title=label_entry.get(),\r\n file_path=entry_path[0]:\r\n self.configure_media(media_title, file_path)))\r\n self.library_items[-1].grid(row=index, column=4, padx=10, pady=5)\r\n\r\n # Adding the removal button specific to the current media item\r\n self.library_items.append(Button(path_frame_child, text=\"Remove\",\r\n command=lambda media_title=label_entry.get(),\r\n file_path=entry_path[0]:\r\n self.remove_media_query(media_title, file_path)))\r\n self.library_items[-1].grid(row=index, column=5, padx=10, pady=5)\r\n\r\n else: # A search string was provided\r\n for i in search_list: # Displaying every item in the search results\r\n index += 1\r\n\r\n display_entry = StringVar()\r\n display_entry.set(os.path.basename(i[0]))\r\n\r\n # This variable will store the name of the media file without showing the extension\r\n label_entry = StringVar()\r\n label_entry.set(os.path.splitext(display_entry.get())[0])\r\n\r\n # Checking if the currently selected item from the database is located in the media folder\r\n if (os.path.dirname(i[0])) == config_var['MEDIA FOLDER']['folder']:\r\n\r\n # Adding the media item title to the media list\r\n cursor.execute(\"SELECT mode FROM media WHERE full_path = \" + \"\\\"\" + i[0] + \"\\\"\")\r\n mode = cursor.fetchone()\r\n\r\n if int(mode[0]): # Displaying the media label using its metadata\r\n self.library_items.append(\r\n Label(path_frame_child, textvariable=display_entry))\r\n self.library_items[-1].grid(row=index, column=1)\r\n\r\n current_item_length = len(display_entry.get())\r\n if current_item_length > self.longest_item_length:\r\n self.longest_item_length = current_item_length\r\n\r\n else: # Displaying the media label using its filename\r\n cursor.execute(\"SELECT artist FROM media WHERE full_path = \" + \"\\\"\" + i[0] + \"\\\"\")\r\n artist = cursor.fetchone()\r\n cursor.execute(\"SELECT title FROM media WHERE full_path = \" + \"\\\"\" + i[0] + \"\\\"\")\r\n title = cursor.fetchone()\r\n\r\n display_label = StringVar()\r\n display_label.set(artist[0] + \" - \" + title[0])\r\n\r\n self.library_items.append(\r\n Label(path_frame_child, textvariable=display_label))\r\n self.library_items[-1].grid(row=index, column=1)\r\n\r\n current_item_length = len(display_label.get())\r\n if current_item_length > self.longest_item_length:\r\n self.longest_item_length = current_item_length\r\n\r\n # Adding the play button specific to the current media item\r\n self.library_items.append(Button(path_frame_child, text=\"Play\"))\r\n self.library_items[-1].grid(row=index, column=2, padx=10, pady=5)\r\n\r\n \"\"\"\r\n # Adding the info button specific to the current media item\r\n self.library_items.append(Button(path_frame_child, text=\"Info\"))\r\n self.library_items[-1].grid(row=index, column=3, padx=10, pady=5)\r\n \"\"\"\r\n\r\n # Adding the configuration button specific to the current media item\r\n self.library_items.append(Button(path_frame_child, text=\"Configure\",\r\n command=lambda media_title=label_entry.get(), file_path=i[0]:\r\n self.configure_media(media_title, file_path)))\r\n self.library_items[-1].grid(row=index, column=4, padx=10, pady=5)\r\n\r\n # Adding the removal button specific to the current media item\r\n self.library_items.append(Button(path_frame_child, text=\"Remove\",\r\n command=lambda media_title=label_entry.get(), file_path=i[0]:\r\n self.remove_media_query(media_title, file_path)))\r\n self.library_items[-1].grid(row=index, column=5, padx=10, pady=5)\r\n\r\n # Updating the width of the scrollable area\r\n path_frame_child.bind(\"<Configure>\", lambda event, x=self.longest_item_length: self.scroll_function(event, x))\r\n\r\n # Refreshing the add button\r\n self.add_music_button.destroy()\r\n self.add_music_button = ttk.Button(self.button_frame, text=\"Add Media...\",\r\n command=self.add_media_dialog)\r\n self.add_music_button.grid(row=0, column=0, padx=10, pady=20)\r\n\r\n # Refreshing the savelist button\r\n self.create_savelist_button.destroy()\r\n self.create_savelist_button = ttk.Button(self.button_frame, text=\"Create Savelist...\",\r\n command=self.create_savelist)\r\n self.create_savelist_button.grid(row=0, column=1, padx=10, pady=20)\r\n\r\n cursor.close()","def voiceSearch(self):\n\n # Set the device ID of the mic that we\n # specifically want to use to avoid ambiguity\n for i, microphone_name in enumerate(\n sr.Microphone.list_microphone_names()):\n if(microphone_name == MIC_NAME):\n device_id = i\n break\n\n # obtain audio from the microphone\n r = sr.Recognizer()\n with sr.Microphone(device_index=device_id) as source:\n # clear console of errors\n subprocess.run(\"clear\")\n\n # wait for a second to let the recognizer adjust the\n # energy threshold based on the surrounding noise level\n r.adjust_for_ambient_noise(source)\n\n print(\"Say something to search for books: \")\n try:\n audio = r.listen(source, timeout=1.5)\n except sr.WaitTimeoutError:\n return None\n\n # recognize speech using Google Speech Recognition\n translation = None\n try:\n translation = r.recognize_google(audio)\n except(sr.UnknownValueError, sr.RequestError):\n pass\n finally:\n return translation","def search_videos(self, search_term):\n print(\"search_videos needs implementation\")","def open(self):\n file = askopenfilename(\n initialdir=self.initial_directory,\n filetypes=(\n (\"Audio Video Interleave\", \"*.avi\"),\n (\"Matroska\", \"*.mkv\"),(\"MPEG-4 AVC\",\"*.mp4\"),\n )\n )\n if isinstance(file, tuple):\n return\n if os.path.isfile(file):\n self.play_film(file)","async def imgran(self):\r\n search=\"random\"\r\n search = client.gallery()\r\n holder=[]\r\n for d in search:\r\n holder.append(d.link)\r\n await self.bot.say(random.choice(holder))","def browse():\n rino.browse.open()","def browse(*args):","def get_list(self ):\n headers = { 'Authorization' : self.client.authorization_header }\n response = requests.get(\n self.client.url + '/media', \n headers = headers\n )\n\n return json.loads(response.text)","def search_gallery(self, q):\n url = \"https://api.imgur.com/3/gallery/search?q={0}\".format(q)\n resp = self._send_request(url)\n return [_get_album_or_image(thing, self) for thing in resp]","def test_get(self):\n fields = {\n 'title': 'Test media title',\n 'description': 'Test media description',\n 'local_media_file': 'test_64K_short.mp3',\n }\n\n media_filename = \"%s/%s\" % (settings.get('base', 'path.local.media'), fields['local_media_file'])\n m = Media.create(\n client=self.client,\n media_filename=media_filename,\n title=fields['title'],\n description=fields['description'],\n )\n\n m = Media.get(client=self.client, uuid=m.uuid)\n assert m.title == fields['title']\n assert m.description == fields['description']","def browse(self, param=None):\n data = self._http_get(\"browse\", query=param)\n return data.json()","def display_media_cli():\r\n\r\n global config_var # Using the global variable that reads and modifies the configuration file\r\n\r\n cursor = connection.cursor()\r\n count = 0 # The total amount of items displayed\r\n\r\n # Parsing the entire database and displaying every record that matches the current media folder\r\n cursor.execute(\"SELECT COUNT(*) FROM media\")\r\n\r\n number_of_entries = cursor.fetchone() # This variable will store the amount of records in the database\r\n\r\n for i in range(number_of_entries[0]):\r\n cursor.execute(\"SELECT full_path FROM media WHERE id = \" + str(i + 1))\r\n entry_path = cursor.fetchone() # This variable will store the path of the currently selected item\r\n\r\n # Checking if the currently selected item from the database is located in the media folder\r\n if (os.path.dirname(entry_path[0])) == config_var['MEDIA FOLDER']['folder']:\r\n print(\"\\n\" + os.path.basename(entry_path[0]) + \" || ID: \" + str(i + 1))\r\n count += 1\r\n\r\n if not count: # No items could be found\r\n print(\"\\nThere are no media files in the media folder.\")\r\n\r\n cursor.close()","def handle_media( environ ):\n # TODO: implement me\n return 200, [], _html.format(\n title = 'MEDIA',\n head = '',\n body = 'MEDIA'\n )","def test_ms_playlist_search(helpers):\n item_from_xml, item_from_dict = common_tests(\n MSAlbumList,\n MS_PLAYLIST_SEARCH_XML,\n MS_PLAYLIST_SEARCH_DICT,\n \"00020064playlistsearch:Dans &\",\n helpers,\n )\n getter_attributes_test(\n \"uri\", item_from_xml, item_from_dict, MS_PLAYLIST_SEARCH_DICT[\"uri\"]\n )","def MainMenu():\n\n # You have to open an object container to produce the icons you want to appear on this page.\n oc = ObjectContainer()\n main_list = [('New Videos', ''), ('Best Videos', '/best'), ('Pornstars', '/pornstars')]\n for pt, h in main_list:\n oc.add(DirectoryObject(\n key=Callback(ShowHTML, pTitle=pt, href=h),\n title=pt, thumb=Callback(GetThumb, url=BASE_URL)))\n oc.add(DirectoryObject(\n key=Callback(ShowHTML, pTitle=\"Pornstars\", href='/channels'),\n title=\"Channels\", thumb=Callback(GetThumb, url=BASE_URL)))\n\n oc.add(InputDirectoryObject(key=Callback(Search), title='Search Videos', prompt='Search Videos'))\n\n return oc","def browseDirectory ( directory ) :\r\n\r\n library = \"libraryPython\"\r\n\r\n if not directory.endswith( os.sep ) : directory = directory + os.sep\r\n\r\n try :\r\n\r\n items = os.listdir( directory )\r\n\r\n except Exception, exception :\r\n\r\n items = [ ]\r\n\r\n for item in items :\r\n\r\n if item == library :\r\n\r\n if not item.endswith( os.sep ) : item = item + os.sep\r\n\r\n return directory + item \r\n\r\n if item.startswith( \".\" ) : continue\r\n\r\n if item.startswith( \"_\" ) : continue\r\n\r\n if item.startswith( \"~\" ) : continue\r\n\r\n if not os.path.isdir( directory + item ) : continue\r\n\r\n found = browseDirectory( directory + item )\r\n\r\n if not found is None : return found\r\n\r\n return None","async def async_browse_media(\n hass: HomeAssistant,\n media_content_id: str | None,\n *,\n content_filter: Callable[[BrowseMedia], bool] | None = None,\n) -> BrowseMediaSource:\n if DOMAIN not in hass.data:\n raise BrowseError(\"Media Source not loaded\")\n\n try:\n item = await _get_media_item(hass, media_content_id, None).async_browse()\n except ValueError as err:\n raise BrowseError(str(err)) from err\n\n if content_filter is None or item.children is None:\n return item\n\n old_count = len(item.children)\n item.children = [\n child for child in item.children if child.can_expand or content_filter(child)\n ]\n item.not_shown += old_count - len(item.children)\n return item","def get_single_media(media_id):\n return query_single(media_id, Media, media_schema)","def add_media_dialog(self):\r\n\r\n file = filedialog.askopenfilename()\r\n\r\n if add_media(file, 0, self): # Checking if the process of adding the media file was successful\r\n\r\n if file: # Checking whether the user has aborted the operation\r\n # Getting the path of the file with respect to the current media folder (since the \"file\" variable\r\n # points to the location of the source file)\r\n full_path = os.path.join(media_folder, os.path.basename(file)).replace(\"\\\\\", \"/\")\r\n\r\n # Whenever a media item is added, the user is automatically prompted to configure its metadata\r\n self.configure_media(os.path.basename(file), full_path)","def search(\n\tlog,\n\tverbose,\n\tquiet,\n\tusername,\n\tdevice_id,\n\tyes,\n\tfilters\n):\n\n\tconfigure_logging(verbose - quiet, username, log_to_file=log)\n\n\tlogger.info(\"Logging in to Google Music\")\n\tmc = google_music.mobileclient(username, device_id=device_id)\n\n\tif not mc.is_authenticated:\n\t\tsys.exit(\"Failed to authenticate client.\")\n\n\tsearch_results = filter_songs(mc.songs(), filters)\n\tsearch_results.sort(\n\t\tkey=lambda song: (\n\t\t\tsong.get('artist', ''),\n\t\t\tsong.get('album', ''),\n\t\t\tsong.get('trackNumber', 0)\n\t\t)\n\t)\n\n\tif search_results:\n\t\tresult_num = 0\n\t\ttotal = len(search_results)\n\t\tpad = len(str(total))\n\n\t\tconfirm = (\n\t\t\tyes\n\t\t\tor input(f\"\\nDisplay {len(search_results)} results? (y/n) \") in (\"y\", \"Y\")\n\t\t)\n\n\t\tif confirm:\n\t\t\tfor result in search_results:\n\t\t\t\tresult_num += 1\n\n\t\t\t\ttitle = result.get('title', \"<empty>\")\n\t\t\t\tartist = result.get('artist', \"<empty>\")\n\t\t\t\talbum = result.get('album', \"<empty>\")\n\t\t\t\tsong_id = result['id']\n\n\t\t\t\tlogger.info(\n\t\t\t\t\tf\"{result_num:>{pad}}/{total} {title} -- {artist} -- {album} ({song_id})\"\n\t\t\t\t)\n\telse:\n\t\tlogger.info(\"No songs found matching query\")\n\n\tmc.logout()\n\tlogger.info(\"All done!\")","def search(self, query, mediatype=None):\n items = utils.listItems(self, '/search?query=%s' % quote(query))\n if mediatype:\n return [item for item in items if item.type == mediatype]\n return items","def __init__(self, media, username, password):\n self.media = media\n self.username = username\n self.password = password","def __searchFiles(self):\n self.ui.showFindFilesDialog(self.textForFind())","def album(self, q, page=None):\r\n return self.get('album', q, page)","def initiateSearch(search_context, text):\n searches = []\n log.msg(\"Searching: %s\" % text)\n\n if not isinstance(text, dict) :\n \n artistStart = text.find(SearchKeys.ARTIST)\n titleStart = text.find(SearchKeys.TITLE)\n albumStart = text.find(SearchKeys.ALBUM)\n\n if max(artistStart, titleStart, albumStart) != -1:\n d = dict()\n \n def pullout(text2):\n if text2.find(SearchKeys.ARTIST) != -1:\n text2 = text2[0:text2.find(SearchKeys.ARTIST)]\n\n if text2.find(SearchKeys.ALBUM) != -1:\n text2 = text2[0:text2.find(SearchKeys.ALBUM)]\n\n if text2.find(SearchKeys.TITLE) != -1:\n text2 = text2[0:text2.find(SearchKeys.TITLE)]\n return text2.strip()\n\n if artistStart != -1:\n d['artist'] = pullout(text[artistStart+len(SearchKeys.ARTIST) : len(text)])\n\n if titleStart != -1:\n d['title'] = pullout(text[titleStart+len(SearchKeys.TITLE) : len(text)])\n \n if albumStart != -1:\n d['album'] = pullout(text[albumStart+len(SearchKeys.ALBUM) : len(text)])\n log.msg(\"Parsed Search: \" + str(d))\n text = d\n\n # Fire off search in parallel\n for key, mediasrc in __mediaSources.items():\n log.msg(\"\\tSending Search Request to %s\" % key)\n searches.append(deferToThread(mediasrc.search, text))\n\n # When all searches return combine them. The lists will be\n # returned as a list of a touples consisting of a sucess/failure\n # boolean followed by the results returned by the individual source\n dl = DeferredList(searches)\n\n def sendResults(results):\n \"\"\"\n Combines the results returned by the deferred list\n into master_result and passes it to all the registered\n controllers.\n \"\"\"\n log.msg(\"Search Returned from all sources\")\n master_result = []\n for status, result in results:\n if status:\n master_result += result\n\n for key, mediactr in __controllers.items():\n log.msg(\"\\tSending Result to %s\" % key)\n mediactr.searchCompleted(search_context, master_result)\n\n dl.addCallback(sendResults)","def view_file(self):\n\n index_list = self.ui.tableWidget.selectionModel().selectedIndexes()\n index = None\n if len(index_list) > 0:\n index = index_list[0].row()\n if index is None:\n return\n\n # Need the data as a dictionary to view images and audio/video\n dictionary = {'name': self.allfiles[index][NAME], 'mediapath': self.allfiles[index][MEDIAPATH],\n 'owner': self.allfiles[index][OWNER], 'id': self.allfiles[index][0],\n 'date': self.allfiles[index][DATE],\n 'memo': self.allfiles[index][MEMO], 'fulltext': self.allfiles[index][FULLTEXT],\n 'av_text_id': self.allfiles[index][AV_TEXT_ID]}\n # Mediapath will be None for a .transcribed empty text media entry, and 'docs:' for a linked text document\n if self.allfiles[index][MEDIAPATH] is None or self.allfiles[index][MEDIAPATH][0:5] == 'docs:':\n return\n # Added checks to test for media presence\n if self.allfiles[index][MEDIAPATH][:6] in (\"/video\", \"video:\"):\n if self.allfiles[index][MEDIAPATH][:6] == \"video:\":\n abs_path = self.allfiles[index][MEDIAPATH].split(':')[1]\n if not os.path.exists(abs_path):\n return\n if self.allfiles[index][MEDIAPATH][:6] == \"/video\":\n abs_path = self.app.project_path + self.allfiles[index][MEDIAPATH]\n if not os.path.exists(abs_path):\n return\n ui_av = DialogViewAV(self.app, dictionary)\n ui_av.exec()\n if self.allfiles[index][MEDIAPATH][:6] in (\"/audio\", \"audio:\"):\n if self.allfiles[index][MEDIAPATH][0:6] == \"audio:\":\n abs_path = self.allfiles[index][MEDIAPATH].split(':')[1]\n if not os.path.exists(abs_path):\n return\n if self.allfiles[index][MEDIAPATH][0:6] == \"/audio\":\n abs_path = self.app.project_path + self.allfiles[index][MEDIAPATH]\n if not os.path.exists(abs_path):\n return\n ui_av = DialogViewAV(self.app, dictionary)\n ui_av.exec()\n if self.allfiles[index][MEDIAPATH][:7] in (\"/images\", \"images:\"):\n if self.allfiles[index][MEDIAPATH][0:7] == \"images:\":\n abs_path = self.allfiles[index][MEDIAPATH].split(':')[1]\n if not os.path.exists(abs_path):\n return\n if self.allfiles[index][MEDIAPATH][0:7] == \"/images\":\n abs_path = self.app.project_path + self.allfiles[index][MEDIAPATH]\n if not os.path.exists(abs_path):\n return\n # Requires {name, mediapath, owner, id, date, memo, fulltext}\n ui_img = DialogViewImage(self.app, dictionary)\n ui_img.exec()","def cmd_gallery_search(client, args):\n if args.advanced:\n config = data_fields(args.advanced, client.allowed_advanced_search_fields)\n else:\n config = None\n gallery_search = client.gallery_search(args.q, config, args.sort,\n args.window, args.page)\n data = [item.__dict__ for item in gallery_search]\n generate_output({'gallery_search': data}, args.output_file)","def url_media(self, csvlinks=\"\", csvset=\"\", urldir=\"\", medialog_file=\"\",\n directory=\"\", ignore_twitter_link=True, mediatype=\"vi\",\n site_sources=[], name_scraping=\"\", video_timelimit=1000,\n image_timelimit=60):\n\n if csvlinks == \"\":\n csvlinks = CSVLINKS\n if csvset == \"\":\n csvset = CSVSETURL\n if medialog_file == \"\":\n medialog_file = MEDIALOG\n if directory == \"\":\n directory = self.directory\n\n if urldir == \"\" and name_scraping == \"\":\n urldir = URLDIR\n name_scraping = urldir.lower()\n elif name_scraping == \"\":\n name_scraping = urldir.lower()\n elif urldir == \"\":\n urldir = name_scraping\n\n if urldir[-1] != \"/\":\n urldir = urldir + \"/\"\n if name_scraping[-1] == \"/\":\n name_scraping = name_scraping[:-1]\n\n mediatype = str(mediatype).lower()\n if mediatype not in (\"v\", \"i\", \"vi\", \"iv\"):\n mediatype = \"vi\"\n\n root_dir = os.getcwd()\n\n if directory != \"\":\n os.chdir(directory)\n directory = os.getcwd()\n else:\n directory = root_dir\n\n setUrls = CSVUtils.csv_to_dict(csvset, 1, 0)\n\n if urldir[-1] == '/':\n urldir = urldir[:-1]\n OSUtils.createDir(urldir)\n\n seq = \"\"\n\n # get next sequence number\n if os.path.isfile(medialog_file):\n seq = JSONUtils.read_keyval_json(\"next_\"+name_scraping+\"Seq\",\n medialog_file)\n\n # if the parameter does not exist, get the seq from the\n if seq == \"\":\n seq = max([int(d) for d in os.listdir(urldir)] + [0]) + 1\n\n try:\n seqdir = os.path.realpath(urldir + \"/\" + str(seq))\n\n # implemented in order to give a feedback about progresss %\n total_row = sum(1 for row in CSVUtils.csvGenerator(csvlinks))\n row_count = 0\n\n # iterate through each link\n for line in CSVUtils.csvGenerator(csvlinks):\n row_count += 1\n\n if \"https://twitter.com\" in line[0] and ignore_twitter_link:\n continue\n\n url = self.__expandURL(line[0])\n\n if len(site_sources) > 0:\n if len([site for site in site_sources if site in url]\n ) == 0:\n continue\n\n if url not in setUrls.keys():\n\n print('\\x1b[6;30;42m' + \"Starting Scrapping for Link \"\n + str(url) + \" (\" + str(seq) + \")\" + '\\x1b[0m')\n\n os.mkdir(seqdir)\n os.chdir(seqdir)\n\n if \"v\" in mediatype:\n try:\n # in order to avoid stalls in lives\n signal.signal(signal.SIGALRM,\n OSUtils.handler_timeout)\n signal.alarm(video_timelimit)\n\n youtube_dl.YoutubeDL({}).download([url])\n except KeyboardInterrupt:\n raise\n except Exception as e:\n print(e)\n finally:\n signal.alarm(0)\n\n if \"i\" in mediatype:\n for im in self.__urlImageGenerator(url):\n try:\n signal.signal(signal.SIGALRM,\n OSUtils.handler_timeout)\n signal.alarm(image_timelimit)\n\n if \"base64,\" in im:\n continue\n\n lo = Text.lastocc(im, \"/\")+1\n\n if lo < len(im)-1:\n output = im[Text.lastocc(im, \"/\")+1:]\n else:\n output = im[\n Text.lastocc(im[:-1], \"/\")+1:-1]\n\n if output == \"\" or len(output) > 80:\n output = random.randint(1, 10000000000000)\n\n self.__request_download(link=im,\n output=str(output))\n except requests.exceptions.ConnectionError as e:\n print(e)\n continue\n except requests.exceptions.InvalidSchema as e:\n print(e)\n continue\n except Exception as e:\n print(e)\n finally:\n signal.alarm(0)\n\n os.chdir(directory)\n\n setUrls[url] = seq\n\n CSVUtils.write_line_b_csv(csvfile=csvset, line=[seq, url])\n\n print('\\x1b[6;30;42m' + \"Scrap Finished for Link \"\n + str(url) + \" (\"\n + str(round(row_count*100/total_row, 4)) + \"%)\"\n + '\\x1b[0m')\n\n seq += 1\n seqdir = os.path.realpath(urldir + \"/\" + str(seq))\n\n os.chdir(root_dir)\n\n except KeyboardInterrupt:\n print(\"Stopping...\")\n\n JSONUtils.add_keyval_json(\"next_\"+name_scraping+\"Seq\", seq,\n medialog_file)\n\n os.chdir(root_dir)\n\n shutil.rmtree(seqdir)\n except Exception as e:\n JSONUtils.add_keyval_json(\"next_\"+name_scraping+\"Seq\", seq,\n medialog_file)\n\n os.chdir(root_dir)\n\n shutil.rmtree(seqdir)\n print(e)\n raise","async def video(self, ctx, *, arg: str):\n await ctx.send(site + self.extraire(search + self.traduire(arg.split(' ')), watch_))","def OnPlay(self):\r\n # check if there is a file to play, otherwise open a\r\n # Tk.FileDialog to select a file\r\n print(\"1-1\")\r\n\r\n\r\n self.Media = self.Instance.media_new(self.youtube_url)\r\n self.player.set_media(self.Media)\r\n\r\n # set the window id where to render VLC's video output\r\n if platform.system() == 'Windows':\r\n print(\"1-3\")\r\n self.player.set_hwnd(self.GetHandle())\r\n else:\r\n print(\"1-4\")\r\n self.player.set_xwindow(self.GetHandle()) # this line messes up windows\r\n # FIXME: this should be made cross-platform\r\n\r\n # Try to launch the media, if this fails display an error message\r\n if self.player.play() == -1:\r\n print(\"1-6\")\r\n self.errorDialog(\"Unable to play.\")","def get_all_mediafiles(user_id, params=None, fields=None):\n fields = fields or [MediaFiles.id, MediaFiles.user_id, MediaFiles.path, MediaFiles.duration,\n MediaFiles.size, MediaFiles.title, MediaFiles.comment, MediaFiles.tags,\n MediaFiles.description, MediaFiles.coords, MediaFiles.location_id,\n MediaFiles.year, MediaFiles.created, MediaFiles.imported,\n MediaFiles.updated, MediaFiles.accessed, MediaFiles.visits]\n query = MediaFiles.query \\\n .outerjoin(Locations, MediaFiles.location_id == Locations.id) \\\n .outerjoin(Users, MediaFiles.user_id == Users.id)\n\n year = params.get('year', 'any')\n if year != 'any' and re.match('[1-2]{1}[0-9]{3}', year) or year == '0':\n query = query.filter(MediaFiles.year == year)\n\n location = params.get('location', 'any')\n if location != 'any':\n query = query.filter(MediaFiles.location_id == location)\n\n if user_id != -1: # user_id = -1 will not apply filtering on ownership (used for statistics)\n public = params.get('ownership_public')\n private = params.get('ownership_private')\n if private or public:\n ownership = []\n if public:\n ownership.append(MediaFiles.user_id == 0)\n if private:\n ownership.append(MediaFiles.user_id == int(user_id))\n query = query.filter(or_(*ownership))\n else: # If none of Public/Private selected, then result must be empty\n query = query.filter(MediaFiles.user_id == -1)\n\n entry = params.get('search', '').strip()\n matching = params.get('tags_matching')\n if entry:\n other_matches = []\n if params.get('search_in_path'):\n other_matches.append(MediaFiles.path.contains(entry))\n if params.get('search_in_title'):\n other_matches.append(MediaFiles.title.contains(entry))\n if params.get('search_in_description'):\n other_matches.append(MediaFiles.description.contains(entry))\n if params.get('search_in_comment'):\n other_matches.append(MediaFiles.comment.contains(entry))\n query = query.filter(or_(*other_matches))\n # Note: tags filtering is applied if no other terms are selected\n if params.get('search_in_tags') and not other_matches:\n tag_matches = []\n for tag in entry.split():\n tag_matches.append(MediaFiles.tags.contains(tag))\n if matching == 'strict':\n query = query.filter(and_(*tag_matches))\n else:\n query = query.filter(or_(*tag_matches))\n query = query.add_columns(*fields).order_by(func.random())\n logging.debug('Query executed: %s' % query)\n return query","def test_ms_album_search(helpers):\n item_from_xml, item_from_dict = common_tests(\n MSAlbum,\n MS_ALBUM_SEARCH_XML,\n MS_ALBUM_SEARCH_DICT,\n \"00020064albumsearch:de unge\",\n helpers,\n )\n getter_attributes_test(\n \"artist\", item_from_xml, item_from_dict, MS_ALBUM_SEARCH_DICT.get(\"artist\")\n )\n getter_attributes_test(\n \"uri\", item_from_xml, item_from_dict, MS_ALBUM_SEARCH_DICT[\"uri\"]\n )","def play_media(self, media=None, **kwargs):\n args = {\"version\": self.pms.version}\n args.update(kwargs)\n super().play_media(media, **args)","def test_Browse(self):\n d = Deferred()\n\n @wrapped(d)\n def the_result(mediaserver):\n cdc = mediaserver.client.content_directory\n self.assertEqual(self.uuid, mediaserver.udn)\n call = cdc.browse(process_result=False)\n call.addCallback(got_first_answer, cdc)\n\n @wrapped(d)\n def got_first_answer(r, cdc):\n self.assertEqual(int(r['TotalMatches']), 1)\n didl = DIDLLite.DIDLElement.fromString(r['Result'])\n item = didl.getItems()[0]\n self.assertEqual(item.childCount, 3)\n call = cdc.browse(object_id=item.id, process_result=False)\n call.addCallback(got_second_answer, item.childCount)\n\n @wrapped(d)\n def got_second_answer(r, childcount):\n self.assertEqual(int(r['TotalMatches']), childcount)\n d.callback(None)\n\n self.coherence.ctrl.add_query(\n DeviceQuery('uuid', self.uuid,\n the_result, timeout=10, oneshot=True))\n return d","async def async_play_media(\n self, media_type: MediaType | str, media_id: str, **kwargs: Any\n ) -> None:\n await self._volumio.replace_and_play(json.loads(media_id))","def search_list(search_term, results=10):\r\n if search_term:\r\n url = SEARCH_URL.format(API_KEY, util.web.quote(search_term.encode('ascii', 'ignore')))\r\n response = util.web.http_get(url=url, json=True, referer='https://tinychat.com')\r\n\r\n if response['json'] is not None:\r\n media_list = []\r\n try:\r\n if 'items' in response['json']:\r\n for i, item in enumerate(response['json']['items']):\r\n if i == results:\r\n return media_list\r\n else:\r\n video_id = item['id']['videoId']\r\n details = video_details(video_id)\r\n if details is not None:\r\n media_info = {\r\n 'type': 'youTube',\r\n 'video_id': video_id,\r\n 'video_time': details['video_time'],\r\n 'video_title': details['video_title']\r\n }\r\n log.debug('Youtube item %s %s' % (i, media_info))\r\n media_list.append(media_info)\r\n except KeyError as ke:\r\n log.error(ke, exc_info=True)\r\n return None","async def async_play_media(self, media_type, media_id, **kwargs):\n if media_id.isdigit():\n currentgallery_id = self._gallery_status[\"current_gallery\"]\n currentitems = await self.local_meural.send_get_items_by_gallery(currentgallery_id)\n in_playlist = next((g[\"title\"] for g in currentitems if g[\"id\"] == media_id), None)\n if in_playlist is None:\n# _LOGGER.warning(\"Item %s is not in current playlist, trying to play via remote API.\", media_id)\n await self.meural.device_load_item(self.meural_device_id, media_id)\n else:\n# _LOGGER.warning(\"Item %s in current playlist %s, loading locally.\", media_id, self._gallery_status[\"current_gallery_name\"])\n await self.local_meural.send_change_item(media_id)\n else:\n _LOGGER.warning(\"Can't play media: %s is not an item ID\", media_id)","async def async_media_play(self) -> None:\n await self._projector.send_command(PLAY)","def test_XBOX_Browse(self):\n d = Deferred()\n\n @wrapped(d)\n def the_result(mediaserver):\n\n def my_browse(*args, **kwargs):\n kwargs['ContainerID'] = kwargs['ObjectID']\n del kwargs['ObjectID']\n del kwargs['BrowseFlag']\n kwargs['SearchCriteria'] = ''\n return 'Search', kwargs\n\n #mediaserver.client.overlay_actions = {'Browse': my_browse}\n mediaserver.client.overlay_headers = {\n 'user-agent': 'Xbox/Coherence emulation'}\n cdc = mediaserver.client.content_directory\n self.assertEqual(self.uuid, mediaserver.udn)\n call = cdc.browse(object_id='4', process_result=False)\n call.addCallback(got_first_answer)\n\n @wrapped(d)\n def got_first_answer(r):\n \"\"\" we expect four audio files here \"\"\"\n self.assertEqual(int(r['TotalMatches']), 4)\n d.callback(None)\n\n d = Deferred()\n self.coherence.ctrl.add_query(\n DeviceQuery('uuid', self.uuid, the_result,\n timeout=10, oneshot=True))\n return d","async def async_tracklist_via_upnp(self, media):\n if self._upnp_device is None:\n return\n\n if media == 'USB':\n queuename = 'USBDiskQueue' # 'CurrentQueue' # 'USBDiskQueue'\n rootdir = ROOTDIR_USB\n else:\n _LOGGER.debug(\"Tracklist retrieval: %s, %s is not supported. You can use only 'USB' for now.\", self.entity_id, media)\n self._trackq = []\n return\n\n self._service = self._upnp_device.service('urn:schemas-wiimu-com:service:PlayQueue:1')\n #_LOGGER.debug(\"PlayQueue for: %s, UPNP service:%s\", self.entity_id, self._service)\n \n media_info = dict()\n media_metadata = None\n try:\n media_info = await self._service.action(\"BrowseQueue\").async_call(QueueName=queuename)\n media_metadata = media_info.get('QueueContext')\n #_LOGGER.debug(\"PlayQueue for: %s, UPNP media_metadata:%s\", self.entity_id, media_info)\n except:\n _LOGGER.debug(\"PlayQueue/QueueContext UPNP error, media not present?: %s\", self.entity_id)\n\n if media_metadata is None:\n return\n\n xml_tree = ET.fromstring(media_metadata)\n\n trackq = []\n for playlist in xml_tree:\n for tracks in playlist:\n for track in tracks:\n if track.tag == 'URL':\n if rootdir in track.text:\n tracku = track.text.replace(rootdir, '')\n trackq.append(tracku)\n\n if len(trackq) > 0:\n self._trackq = trackq","def mediaGenerator(request):\n folder = 'content/' + request\n mediaPaths = glob(folder + '/*')\n return random.choice(mediaPaths)","def search(file_path):\n search_url = 'http://www.google.hr/searchbyimage/upload'\n multipart = {'encoded_image': (file_path, open(file_path, 'rb')), 'image_content': ''}\n response = requests.post(search_url, files=multipart, allow_redirects=False)\n fetch_url = response.headers['Location']\n webbrowser.open(fetch_url)","def similar_search(tmdb_obj, media_id):\n res = tmdb_obj.get_recommendations(media_id)\n if not res:\n return []\n return res","def media(self, media_id):\r\n return Media(self, media_id)","def OpenSoundFiles():\n\n wildcard = create_wildcard(\"Sound files\", sppas.src.audiodata.aio.extensionsul)\n wildcard += '|' + create_wildcard(\"All files\", ['*', '*.*'])\n\n files = list()\n dlg = wx.FileDialog(None, \n \"Select sound file(s)\", \n paths.samples, \n \"\", \n wildcard, \n wx.FD_OPEN | wx.MULTIPLE | wx.FD_CHANGE_DIR)\n if dlg.ShowModal() == wx.ID_OK:\n files = dlg.GetPaths()\n\n dlg.Destroy()\n\n return files","def demonstrate():\n\n api = authenticate()\n\n # Demonstrate upload feature.\n # Create a list of one or more file paths of the mp3s you would like \n # to upload\n filepaths = []\n filepaths.append('./song1.mp3')\n\n # Upload an mp3 to your library. upload() returns a tuple of information\n # about the success or failure of uploads\n print(\"Beginning upload...\\n\")\n uploaded = api.upload(filepaths) \n\n # Print all successfully uploaded songs\n if len(uploaded[0]) > 0:\n print(\"Successfully uploaded:\")\n i = 1\n for key in uploaded[0]:\n print(\"%d. %s\" % (i, key))\n i += 1\n\n # Print all unsuccessfully uploaded songs and a description of why\n # songs weren't uploaded\n if len(uploaded[2]) == 0:\n print(\"\\nAll songs successfully uploaded.\")\n else:\n print(\"Not all songs were successfully uploaded:\")\n i = 1\n for key in uploaded[2]:\n print(\"%d. %s not uploaded: %s\" % (i, key, uploaded[2][key]))\n i += 1\n\n\n # Demonstrate download feature\n # Get information about songs previously uploaded that are available\n # to be downloaded\n uploaded_songs = api.get_uploaded_songs()\n\n if len(uploaded_songs) == 0:\n print(\"There are no songs currently available for download\")\n else:\n # Print songs that are available for download and store their ids\n # so we can download them\n song_ids = []\n print(\"\\nThe following songs are available for download\")\n for i in range(len(uploaded_songs)):\n song_ids.append(uploaded_songs[i]['id'])\n print(\"%d. %s\" % (i+1, uploaded_songs[i]['title']))\n\n # Download uploaded songs from your library\n print(\"\\nBeginning download...\")\n for i in range(len(song_ids)):\n filename, audio = api.download_song(song_ids[i])\n\n # Write song to disk\n with open(filename, 'wb') as f:\n f.write(audio)\n\n print(\"%d. Written to ./%s\" % (i + 1, filename))\n print(\"\\nDownload complete.\")\n\n # It's good practice to logout when finished\n api.logout()","def prepare_media(self):\n start=self.get_pref('starttime')\n stop=self.get_pref('stoptime')\n## volume=limit(self.get_pref('volume'),0,200) # use limit() to ensure that volume pref is sensible...\n m=self.instance.media_new(self.mrl())\n# NONE of the following options work\n# m=self.instance.media_new(self.mrl(),'gain=0.2')\n## m=self.instance.media_new(self.mrl(),'sout-raop-volume=%s' % volume)\n# m=self.instance.media_new(self.mrl(),'audio-replay-gain-mode=track','--audio-replay-gain-default=0.2')\n if start:\n m.add_options('start-time=%s' % start) \n if stop:\n m.add_options('stop-time=%s' % stop) \n# the following test code DOES NOT WORK, though it does in cvlc at the command line, eg > cvlc my.mp3 --gain=0.2\n# gain=\"1.5\"\n# print \"SETTING GAIN for %s at %s%%\" % (self.uid,gain)\n# m.add_option('gain=%s' % gain)\n return m","async def search(\n user_input: str,\n limit: int,\n c: str,\n g: Optional[List[str]] = Query(None),\n p: Optional[List[str]] = Query(None),\n):\n genres = g\n providers = p\n country_code = c\n\n if genres and providers:\n genre_list: List[str] = [f'genres=\"{genre}\"' for genre in genres]\n provider_list: List[List[str]] = [\n [f'specific_provider_names=\"{providers}\"' for providers in providers]\n ]\n\n return client.index(f\"media_{country_code}\").search(\n user_input,\n {\n \"limit\": limit,\n \"filter\": genre_list + provider_list,\n \"sort\": [\"popularity:desc\"],\n },\n )\n elif genres:\n return client.index(f\"media_{country_code}\").search(\n user_input,\n {\n \"limit\": limit,\n # This is using AND logic\n \"filter\": [f'genres=\"{genre}\"' for genre in genres],\n \"sort\": [\"popularity:desc\"],\n },\n )\n elif providers:\n return client.index(f\"media_{country_code}\").search(\n user_input,\n {\n \"limit\": limit,\n # This is using OR logic\n \"filter\": [\n [\n f'specific_provider_names=\"{providers}\"'\n for providers in providers\n ]\n ],\n \"sort\": [\"popularity:desc\"],\n },\n )\n return client.index(f\"media_{country_code}\").search(\n user_input, {\"limit\": limit, \"sort\": [\"popularity:desc\"]}\n )","def search(search_term):\r\n if search_term:\r\n if 'list' in search_term:\r\n search_term = search_term.split('?list')[0]\r\n\r\n url = SEARCH_URL.format(API_KEY, util.web.quote(search_term.encode('ascii', 'ignore')))\r\n response = util.web.http_get(url=url, json=True, referer='http://tinychat.com')\r\n\r\n if response['json'] is not None:\r\n try:\r\n if 'items' in response['json']:\r\n for item in response['json']['items']:\r\n video_id = item['id']['videoId']\r\n details = video_details(video_id)\r\n if details is not None:\r\n return {\r\n 'type': 'youTube',\r\n 'video_id': video_id,\r\n 'video_time': details['video_time'],\r\n 'video_title': details['video_title']\r\n }\r\n except KeyError as ke:\r\n log.error(ke, exc_info=True)\r\n return None","def __searchOpenFiles(self):\n self.ui.showFindFilesDialog(self.textForFind(), openFiles=True)","def search():\n\tif not request.vars.search_term:\n\t\tredirect(URL('index'))\n\tterm = request.vars.search_term\n\torigterm = term\n\tterm = term.replace(' ','|')\n\tartists = db.executesql(\"select distinct(m1.id), m1.art_name, m1.artist_type, m1.country, m1.b_year,m1.b_month,m1.b_date,m1.e_year,m1.e_month,m1.e_day,ts_rank(to_tsvector(m1.art_name),to_tsquery('\"+term+\"')) rank from art_info m1 where to_tsvector('english',m1.art_name) @@ to_tsquery('\"+term+\"') order by rank desc limit 20;\")\n\talbums = db.executesql(\"select distinct(m1.id),m2.name,m1.art_id,m1.art_name,m1.rel_type,m1.count,ts_rank(to_tsvector(m2.name),to_tsquery('\"+term+\"')) rank from rel_art m1, release_name m2, release_group m3 where m3.name = m2.id and m3.id = m1.id and to_tsvector('english',m2.name) @@ to_tsquery('\"+term+\"') order by rank desc limit 20;\")\n\tsongs = db.executesql(\"select m2.id, m1.name, m3.art_id, m3.art_name, m3.rel_id, m3.rel_name from track_name m1, recording m2, rec_rel_art m3 where m1.id = m2.name and m2.id = m3.rec_id and lower(m1.name) LIKE lower('%%\"+origterm+\"%%') limit 20;\")\n\treturn dict(songs=songs, albums=albums, artists=artists)","def LibThread(q):\n os.nice(1)\n time.sleep(0)\n library = cmus.library()\n cache = cmus.Cache()\n liblist = {}\n # BUG: newly added tracks don't appear in the listing as they aren't recorded\n # neither in the cache nor in the library.pl\n # TODO: report progress values, maybe even return partial results?\n for track in cache:\n # allow other thread to jump in\n time.sleep(0)\n try:\n q.get_nowait()\n q.task_done()\n return False\n except Queue.Empty:\n pass\n\n try:\n del library[library.index(track['file'])]\n except ValueError:\n # file is in cache but not in library\n continue\n\n # use dummy values if no value given\n artist = track['albumartist'] if track.has_key('albumartist') and track['albumartist'] != '' \\\n else track['artist'] if track.has_key('artist') and track['artist'] != '' \\\n else '[unknown]'\n\n album = track['album'] if track.has_key('album') and track['album'] != '' \\\n else '[unknown]'\n\n title = track['title'] if track.has_key('title') and track['title'] != '' \\\n else os.path.basename(track['file']).rsplit('.', 1)[0]\n\n if not liblist.has_key(artist):\n liblist[artist] = {}\n if not liblist[artist].has_key(album):\n liblist[artist][album] = {}\n liblist[artist][album][title] = track\n\n # TODO: get files not in cache manually\n # (hint: library contains their paths now)\n\n def sorter(x):\n ref = liblist[artist][album][x]\n if ref.has_key('tracknumber') and ref['tracknumber'] != 0:\n return ref['tracknumber']\n elif ref.has_key('title') and ref['title'] != '':\n return ref['title']\n else:\n return 0\n\n for artist in liblist.keys():\n for album in liblist[artist].keys():\n # sort by tracknumber if existant, title else\n liblist[artist][album]['__keys__'] = \\\n sorted(liblist[artist][album].keys(), key=sorter)\n liblist[artist]['__keys__'] = sorted(liblist[artist].keys(), key=str.lower)\n liblist['__keys__'] = sorted(liblist.keys(), key=str.lower)\n q.put(liblist)","def getMediaFiles(path):\n fileList = getMediaFileList(path)\n # dirList = getDirectoryList(path)\n\n # results = map(getMediaFiles, dirList)\n\n # for result in results:\n # fileList = fileList + result\n\n return fileList","def index(request):\n\n main_menu = [\n (\n buildUrl(request.basePath(), {\"path\": \"/search\"}),\n xbmcgui.ListItem(\n label=xbmcaddon.Addon().getLocalizedString(30009),\n iconImage=getMediaResource(\"search.png\"),\n path=buildUrl(request.basePath(), {\"path\": \"/search\"})\n ),\n True\n ),\n (\n buildUrl(request.basePath(), {\"path\": \"/categories\"}),\n xbmcgui.ListItem(label=xbmcaddon.Addon().getLocalizedString(30014)),\n True\n ),\n (\n buildUrl(request.basePath(), {\"path\": \"/list_movies/latest\"}),\n xbmcgui.ListItem(label=xbmcaddon.Addon().getLocalizedString(30015)),\n True\n ),\n ]\n\n # Add all items at once - this should be faster than adding one by one.\n xbmcplugin.addDirectoryItems(request.handle(), main_menu)\n xbmcplugin.addSortMethod(request.handle(), xbmcplugin.SORT_METHOD_NONE)\n xbmcplugin.endOfDirectory(request.handle(), succeeded=True)","def show_medias():\n t0 = time.time()\n print(f\"--- {request}\")\n print(f\"--- {user_session}\")\n # Set context by owner and the data selections\n u_context = UserContext(user_session, current_user, request)\n # Which range of data is shown\n u_context.set_scope_from_request(request, \"media_scope\")\n u_context.count = 20\n\n with MediaReader(\"read\", u_context) as service:\n # datareader = MediaReader(readservice, u_context)\n res = service.read_my_media_list()\n\n if Status.has_failed(res, False):\n flash(f'{res.get(\"statustext\",\"error\")}', \"error\")\n medias = res.get(\"items\", [])\n\n stk_logger(u_context, f\"-> bp.scene.media.show_medias fw n={len(medias)}\")\n return render_template(\n \"/scene/medias.html\",\n medias=medias,\n user_context=u_context,\n elapsed=time.time() - t0,\n )","def testMediaUpload(self):\n self._testUpload(DefaultStorage(), 'media')\n self._testUpload(StaticStorage(), 'static')","def playListMode(self):\n print(\"[b blue]PlayList mode[/]\")\n while True:\n url = qr.text(\n \"Enter the URL for the PlayList:\", qmark=\"*\", multiline=True\n ).ask()\n\n try:\n requests.get(url)\n # resp.status_code\n except requests.ConnectionError as e:\n print(e)\n return\n else:\n print(\"URL validated successfully!\")\n break\n\n pathForSong = qr.path(\n \"Select the Folder to which you want to download the songs:\",\n only_directories=True,\n ).ask()","def album_search(query, term):\n table = Album.__table__\n search_statement = or_(\n table.c.name.ilike('%' + term + '%'),\n cast(table.c.release_date, Text).ilike('%' + term + '%'),\n table.c.image.ilike('%' + term + '%'),\n table.c.label.ilike('%' + term + '%'),\n table.c.tracks.ilike('%' + term + '%'),\n table.c.spotify_uri.ilike('%' + term + '%'),\n cast(table.c.id, Text).ilike('%' + term + '%'))\n return query.filter(search_statement)","def search(self):\r\n return resources.Search(self)","def medias(self):\n ret = {}\n m = self.application_tree['medias']\n for k, v in six.iteritems(m):\n ret[k] = media.Media(k, v)\n return ret","def manage_library(action):\n albums = tracked_albums()\n\n # Setting function to call and message to print\n if action == 'add':\n func = LocalLibrary.add\n prt = action + ' to'\n elif action == 'remove':\n func = LocalLibrary.remove\n prt = action + ' from'\n else:\n return None\n\n ids = input('\\nType ID numbers of albums you want to {} download list\\n'\n '(comma separated, leave empty to cancel):\\n>> '.format(prt))\n if ids is not '':\n ids = ids.split(',')\n for i in ids:\n # Handling exception - user gives not int or not a number...\n try:\n if int(i) > 0: # need to be here! list accepts negative indexes\n func(library, albums[int(i)-1].id)\n except (ValueError, IndexError):\n pass\n os.system('cls')\n tracked_albums()","def test_add_media_type(self):\n\n # check if documentalist has access to create new media-types\n self.login_documentalist()\n response = self.client.get('/multimedia/media-type/new' )\n\n # 403 = unauthorized\n self.assertEqual(response.status_code, 403)\n\n self.client.logout()\n self.login_admin()\n\n form_data = {\n 'status': '0',\n 'acronym': 'foto',\n 'name': 'Foto',\n 'language' : 'pt-br',\n 'mediatypelocal_set-TOTAL_FORMS': '0',\n 'mediatypelocal_set-INITIAL_FORMS': '0',\n }\n\n response = self.client.post('/multimedia/media-type/new', form_data, follow=True )\n\n self.assertRedirects(response, '/multimedia/media-types')\n self.assertContains(response, \"Foto\")","def search_cli(sys_arguments):\r\n\r\n cursor = connection.cursor()\r\n\r\n # The arrays storing the results of the SQL entries for each of the entries' contents\r\n valid_title_files = []\r\n valid_artist_files = []\r\n valid_album_files = []\r\n valid_release_year_files = []\r\n valid_tags_files = []\r\n\r\n for index in range(len(sys_arguments) - 2):\r\n if sys_arguments[index + 2].startswith(\"title=\"): # The user has specified a custom criterion for the title\r\n cursor.execute(\"SELECT full_path FROM media WHERE INSTR(title, \" + \"\\\"\" + sys_arguments[index + 2][6:]\r\n + \"\\\"\" + \") > 0\")\r\n\r\n for i in cursor.fetchall(): # Updating the corresponding list using the cursor result\r\n if os.path.dirname(i[0]) == media_folder:\r\n valid_title_files.append(i[0])\r\n\r\n # The user has specified a custom criterion for the artist\r\n if sys_arguments[index + 2].startswith(\"artist=\"):\r\n cursor.execute(\r\n \"SELECT full_path FROM media WHERE INSTR(artist, \" + \"\\\"\" + sys_arguments[index + 2][7:] +\r\n \"\\\") > 0\")\r\n\r\n for i in cursor.fetchall(): # Updating the corresponding list using the cursor result\r\n if os.path.dirname(i[0]) == media_folder:\r\n valid_artist_files.append(i[0])\r\n\r\n if sys_arguments[index + 2].startswith(\"album=\"): # The user has specified a custom criterion for the album\r\n cursor.execute(\r\n \"SELECT full_path FROM media WHERE album = \" + \"\\\"\" + sys_arguments[index + 2][6:] + \"\\\"\")\r\n\r\n for i in cursor.fetchall(): # Updating the corresponding list using the cursor result\r\n if os.path.dirname(i[0]) == media_folder:\r\n valid_album_files.append(i[0])\r\n\r\n # The user has specified a custom criterion for the release year\r\n if sys_arguments[index + 2].startswith(\"release_year=\"):\r\n cursor.execute(\r\n \"SELECT full_path FROM media WHERE release_date = \" + \"\\\"\" + sys_arguments[index + 2][13:]\r\n + \"\\\"\")\r\n\r\n for i in cursor.fetchall(): # Updating the corresponding list using the cursor result\r\n if os.path.dirname(i[0]) == media_folder:\r\n valid_release_year_files.append(i[0])\r\n\r\n if sys_arguments[index + 2].startswith(\"tags=\"): # The user has specified a custom criterion for the tags\r\n tags_list = sys_arguments[index + 2][5:].replace('\\\"', '').replace(' ', '').split(\",\")\r\n\r\n for tag in tags_list:\r\n cursor.execute(\"SELECT full_path FROM media WHERE INSTR(tags, \\\"\" + tag + \"\\\") > 0\")\r\n\r\n for i in cursor.fetchall(): # Updating the corresponding list using the cursor result\r\n if os.path.dirname(i[0]) == media_folder:\r\n valid_tags_files.append(i[0])\r\n\r\n # We are now performing intersection operation for each of the lists in order display only the files that match\r\n # every criterion passed by the user\r\n files = intersection(intersection(intersection(intersection(valid_title_files, valid_artist_files),\r\n valid_album_files), valid_release_year_files), valid_tags_files)\r\n\r\n if not files:\r\n print(\"\\nNo results.\")\r\n else:\r\n for i in files:\r\n print(\"\\n\" + i)","def open_my_playlist(self):\n com_util.tap_on(self.driver, element['Music'])\n com_util.tap_on(self.driver, element['MyPlaylist'])\n com_util.tap_on(self.driver, element['ClickMySongs'])","async def async_media_play(self) -> None:\n await self._volumio.play()","def search(q):\n if q in DB.SEARCH_CACHE.keys():\n return DB.SEARCH_CACHE[q]\n else:\n DB.SEARCH_CACHE[q] = {}\n for k, v in DB.MUSIC.iteritems():\n if v.is_like(q):\n DB.SEARCH_CACHE[q][v.uuid] = v.__dict__\n for k, v in DB.VIDEOS.iteritems():\n if v.is_like(q):\n DB.SEARCH_CACHE[q][v.uuid] = v.__dict__\n for k, v in DB.IMAGES.iteritems():\n if v.is_like(q):\n DB.SEARCH_CACHE[q][v.uuid] = v.__dict__\n return DB.SEARCH_CACHE[q]","def play_song(self):\r\n path = input('Give path to wanted song: ') # Request path to song\r\n path = path.replace('\\\\', '/')\r\n if not self.path_storage_re.match(path): # Check if the wanted song is from the storage directory\r\n print(\"Give a valid path\")\r\n else:\r\n p = vlc.MediaPlayer(path) # Create VLC instance and play the song\r\n p.play()\r\n self.playSong.append(p)\r\n self.isPlaying = True","def sync_media(c, environment):\n env = c.config[environment]\n settings.configure()\n current_settings = _get_settings_file()\n c.run(\n 'echo Getting media files from {}...'.format(env.verbose_name)\n )\n c.run(\n 'rsync -avz --rsh=\"ssh\" {remote_user}@{remote_host}:'\n '{remote_folder}/ {media_root}/'.format(\n remote_user=env.user,\n remote_host=env.hosts,\n remote_folder=env.media_path.rstrip('/'),\n media_root=settings.MEDIA_ROOT.rstrip('/')\n )\n )","async def search_magnets(query, page, type_):\n\n def parse_url(url):\n \"\"\"\n Parse url, either a magnet or a normal url.\n Returns the query string and the torrent title\n\n returns url, torrenttitle\n \"\"\"\n url = urllib.parse.urlparse(url)\n query = urllib.parse.parse_qs(url.query)\n query_ = query.get('dn', query.get('title', ''))[0]\n if url.scheme == \"magnet\":\n return \"magnet:?xt={}\".format(query['xt'][0]), query_\n return \"http://{}{}{}\".format(*url[0:3]), query_\n\n with aiohttp.ClientSession() as session:\n url = 'https://kickasstorrents.to/usearch/{}/{}/'.format(query, page)\n async with session.get(url) as response:\n assert response.status == 200\n iter_ = TYPES[type_].finditer(\n await response.text(), re.IGNORECASE)\n return [parse_url(url.group(0)[1:-1]) for url in iter_]","def search(self, what, cat='all'):\n # Sign in:\n if self.search_auth:\n self._sign_in()\n opener = self.opener\n else:\n opener = urllib2.build_opener(urllib2.BaseHandler())\n ret = []\n page = 0\n while page < self.PAGE_NUMBER:\n results = []\n parser = self.FilelistParser(results, self.url)\n url = self.url+'/browse.php?search=%s&cat=%s&searchin=0&sort=0&page=%d'%(what, self.supported_categories[cat], page)\n f = opener.open(url)\n dat = f.read().decode('iso-8859-1', 'replace')\n results_re = re.compile(\"(?s)<div class='cblock-innercontent'>.*\")\n for match in results_re.finditer(dat):\n res_tab = match.group(0)\n parser.feed(res_tab)\n parser.close()\n break\n if len(results) <= 0:\n break\n page += 1","def get_tracks(self):\n artist = self.get_request_arg(\"artist\")\n album = self.get_request_arg(\"album\")\n if not (album and artist):\n return self.resp_from_data(\n {\"message\": \"Please specify a valid artist and album\"}, 403)\n else:\n tracks = self.ctrl.library.get_tracks(artist, album)\n return self.resp_from_data(tracks)","def extract_media_v1(data):\n user = data[\"user\"]\n location = data.get(\"location\")\n if location:\n location = {\"pk\": int(location.get(\"pk\")), \"name\": location.get(\"name\")}\n video_url = \"\"\n if \"video_versions\" in data:\n # Select Best Quality by Resolutiuon\n video_url = sorted(\n data[\"video_versions\"], key=lambda o: o[\"height\"] * o[\"width\"]\n ).pop()[\"url\"]\n product_type = data.get(\"product_type\", \"\")\n if data[\"media_type\"] == 2 and not product_type:\n product_type = \"feed\"\n thumbnail_url = ''\n if 'image_versions2' in data:\n thumbnail_url = sorted(\n data[\"image_versions2\"][\"candidates\"],\n key=lambda o: o[\"height\"] * o[\"width\"],\n ).pop()[\"url\"]\n return {\n \"pk\": int(data[\"pk\"]),\n \"taken_at\": int(data[\"taken_at\"]),\n \"id\": data[\"id\"],\n \"media_type\": data[\"media_type\"],\n \"product_type\": product_type,\n \"code\": data[\"code\"],\n \"thumbnail_url\": thumbnail_url,\n \"location\": location,\n \"user\": extract_user_short(user),\n \"comment_count\": int(data.get(\"comment_count\") or 0),\n \"like_count\": int(data.get(\"like_count\") or 0), # the media just published has no like_count\n \"caption_text\": json_value(data, \"caption\", \"text\", default=\"\"),\n \"usertags\": [\n extract_usertag(usertag)\n for usertag in data.get(\"usertags\", {}).get(\"in\", [])\n ],\n \"video_url\": video_url,\n \"view_count\": int(data.get('view_count') or 0),\n \"video_duration\": data.get('video_duration'),\n \"title\": data.get(\"title\") or None,\n \"resources\": [\n extract_resource_v1(edge)\n for edge in data.get('carousel_media', [])\n ]\n }","def get(self):\n mb = MusicbrainzClient()\n query = self.get_argument('q')\n artists, tracks = yield [mb.search_artists(query),\n mb.search_tracks(query)]\n data = {\n 'artists': [\n {\n 'id': artist['id'],\n 'artist': artist['name'],\n 'note': artist.get('disambiguation', '')\n }\n for artist in artists['artist-list']\n ],\n 'tracks': [\n {\n 'id': track['id'],\n 'title': track['title'],\n 'artist': track['artist-credit-phrase']\n }\n for track in tracks['recording-list']\n ]\n }\n self.finish(data)","async def async_locate(self, **kwargs: Any) -> None:\n await self._vacuum_bot.execute_command(PlaySound())","def load_interface(self):\r\n\r\n self.display_media_folder()\r\n\r\n if media_folder != \"\":\r\n self.folder_scan()\r\n\r\n self.add_music_button.grid(row=0, column=0, padx=10, pady=20)\r\n self.create_savelist_button.grid(row=0, column=1, padx=10, pady=20)\r\n self.quit_button.grid(row=0, column=2, padx=10, pady=20)","def _searchOnTitle(self, title, media, quality, results, offset=0):\n try:\n params = {\n 'cid': 210, # Movie/Video category\n 'offset': offset,\n 'limit': T411.limit\n }\n url = self.urls['search'].format(simplifyString(title),\n tryUrlencode(params))\n data = self.getJsonData(url, headers=self.headers)\n self.checkError(data)\n now = datetime.now()\n for torrent in data['torrents']:\n category = int(torrent['category'])\n # Filter on animations, movies & documentaries\n if category in [455, 631, 634]:\n added = datetime.strptime(torrent['added'],\n '%Y-%m-%d %H:%M:%S')\n # Convert size from byte to kilobyte\n size = int(torrent['size'])/1024\n id_ = int(torrent['id'])\n result = {\n 'id': id_,\n 'name': torrent['name'],\n 'seeders': int(torrent['seeders']),\n 'leechers': int(torrent['leechers']),\n 'size': self.parseSize(str(size)+self.size_kb[0]),\n 'age': (now - added).days,\n 'url': self.urls['url'].format(id_),\n 'detail_url': self.urls['detail_url'].format(id_),\n 'verified': bool(int(torrent['isVerified'])),\n 'get_more_info': self.getMoreInfo,\n 'extra_check': self.extraCheck\n }\n T411.log.debug('{0}|{1}'.format(result.get('id'),\n simplifyString(result.get('name'))))\n results.append(result)\n # Get next page if we don't have all results\n if int(data['total']) > len(data['torrents'])+offset:\n self._searchOnTitle(title, media, quality, results,\n offset+T411.limit)\n except:\n T411.log.error('Failed searching release from {0}: {1}'.\n format(self.getName(), traceback.format_exc()))","def searchImage(text):\n creds = None\n # The file token.json stores the user's access and refresh tokens, and is\n # created automatically when the authorization flow completes for the first\n # time.\n if os.path.exists('token.json'):\n creds = Credentials.from_authorized_user_file('token.json', SCOPES)\n # If there are no (valid) credentials available, let the user log in.\n if not creds or not creds.valid:\n if creds and creds.expired and creds.refresh_token:\n creds.refresh(Request())\n else:\n flow = InstalledAppFlow.from_client_secrets_file(\n 'credentials.json', SCOPES)\n creds = flow.run_local_server(port=0)\n # Save the credentials for the next run\n with open('token.json', 'w') as token:\n token.write(creds.to_json())\n\n service = build('drive', 'v3', credentials=creds)\n\n results_length = 0\n results_message = []\n nextPageToken = \"first\"\n flex_dict = {\n \"type\": \"carousel\",\n \"contents\": []\n }\n\n with open(\"episode_info.json\", 'r', encoding=\"utf-8\") as f:\n episode_info = json.load(f)\n\n # imageFolder: https://drive.google.com/drive/u/0/folders/1CH7i08P4NK0WkhASe4_qs92fsL2Mz0tM\n\n while nextPageToken != []:\n if nextPageToken == \"first\":\n results = service.files().list(q=\"'1CH7i08P4NK0WkhASe4_qs92fsL2Mz0tM' in parents and fullText contains '{}'\".format(text), pageSize=1000,\n fields=\"nextPageToken, files(id, name)\").execute()\n else:\n results = service.files().list(q=\"'1CH7i08P4NK0WkhASe4_qs92fsL2Mz0tM' in parents and fullText contains '{}'\".format(text), pageSize=1000, pageToken=nextPageToken,\n fields=\"nextPageToken, files(id, name)\").execute()\n items = results.get('files', [])\n nextPageToken = results.get('nextPageToken', [])\n print(len(items))\n for item in items:\n img_url = \"https://lh3.googleusercontent.com/d/{}=w1080\".format(\n item['id'])\n # print(u'{0} ({1})'.format(item['name'], img_url))\n\n positino_left_brackets = item['name'].find(\"【\")\n position_right_brackets = item['name'].find(\"】\")\n position_dot = item['name'].find(\".jpg\")\n img_episode = item['name'][positino_left_brackets +\n 1:position_right_brackets]\n img_title = item['name'][position_right_brackets+1:position_dot]\n if img_title.find(text) != -1:\n results_length += 1\n if len(flex_dict[\"contents\"]) < 12:\n try:\n esfio = episode_info[img_episode][\"Every Spongebob Frame In Order\"]\n chn_episode_title = episode_info[img_episode][\"中文集數名稱\"]\n eng_episode_title = episode_info[img_episode][\"英文集數名稱\"]\n except:\n pass\n\n new_bubble_flex_message = {}\n\n with open(\"bubble_flex_message.json\", \"r\", encoding='utf-8') as f:\n new_bubble_flex_message = json.load(f)\n\n new_bubble_flex_message[\"hero\"][\"url\"] = img_url\n new_bubble_flex_message[\"body\"][\"contents\"][0][\"contents\"][0][\"text\"] = img_title\n new_bubble_flex_message[\"body\"][\"contents\"][1][\"contents\"][0][\"contents\"][1][\"text\"] = img_episode\n new_bubble_flex_message[\"body\"][\"contents\"][1][\"contents\"][1][\"contents\"][1][\"text\"] = esfio\n new_bubble_flex_message[\"body\"][\"contents\"][1][\"contents\"][2][\"contents\"][1][\"text\"] = chn_episode_title\n new_bubble_flex_message[\"body\"][\"contents\"][1][\"contents\"][3][\"contents\"][1][\"text\"] = eng_episode_title\n new_bubble_flex_message[\"footer\"][\"contents\"][0][\"action\"][\"data\"] = \"傳\" + img_url\n new_bubble_flex_message[\"footer\"][\"contents\"][1][\"action\"][\"uri\"] = img_url\n\n flex_dict[\"contents\"].append(new_bubble_flex_message)\n if len(flex_dict[\"contents\"]) == 12:\n if len(results_message) < 5:\n results_message.append(FlexSendMessage(\n alt_text=\"搜尋結果\",\n contents=flex_dict)\n )\n if len(results_message) == 5:\n print(\"len(results_message)1: \", len(results_message))\n return {\"length\": results_length, \"top5_url_list\": results_message}\n flex_dict[\"contents\"] = []\n if nextPageToken == []:\n if len(flex_dict[\"contents\"]) != 0:\n if len(results_message) < 5:\n results_message.append(FlexSendMessage(\n alt_text=\"搜尋結果\",\n contents=flex_dict)\n )\n print(\"len(results_message)2: \", len(results_message))\n return {\"length\": results_length, \"top5_url_list\": results_message}\n\n print(\"len(results_message)3: \", len(results_message))\n return {\"length\": results_length, \"top5_url_list\": results_message}","def listall(self):\n list_query = \"\"\"SELECT * FROM %s\"\"\" % MediaCollection.COLLECTIONS_TABLE\n self.cursor.execute(list_query)\n return [Media.fromtuple(media) for media in self.cursor.fetchall()]","async def bingvideo(self, *, text):\n settings = loadauth()\n operation = 'videosearch'\n if settings['apikey'] == '' or settings['apikey'] == 'blank':\n return await self.bot.say(\"Missing or incorrect API key. Please \" +\n \"contact the owner to add an API key.\")\n apikey = settings['apikey']\n text, limit = self.limitget(text)\n result = self.getfrombing(apikey, text, limit, operation)\n bottext = self.obtainresult(result, operation)\n return await self.bot.say(bottext)","def media(self, req):\n first_part = req.path_info_peek()\n if first_part in self.media_paths:\n req.path_info_pop()\n path = self.media_paths[first_part]\n else:\n path = resource_filename(\"weberror\", \"eval-media\")\n app = urlparser.StaticURLParser(path)\n return app","def wikimedia_request(search_term, continue_val):\n S = requests.Session()\n\n URL = \"https://en.wikipedia.org/w/api.php\"\n\n # SEARCHPAGE = \"matrix\"\n\n PARAMS = {\n \"action\": \"query\",\n \"format\": \"json\",\n \"list\": \"search\",\n \"srsearch\": search_term,\n \"srlimit\": 400\n }\n if continue_val:\n PARAMS.update(continue_val)\n R = S.get(url=URL, params=PARAMS).json()\n return R"],"string":"[\n \"async def async_browse_media(self, media_content_type=None, media_content_id=None):\\n return await media_source.async_browse_media(\\n self.hass,\\n media_content_id,\\n content_filter=lambda item: item.media_content_type.startswith(\\\"audio/\\\"),\\n )\\n \\n #TODO: combide the BrowseMedia Media Sources above with the BrowseMedia Directory below\\n #if \\\"udisk\\\" in self._source_list: \\n # if media_content_id not in (None, \\\"root\\\"):\\n # raise BrowseError(\\n # f\\\"Media not found: {media_content_type} / {media_content_id}\\\"\\n # )\\n\\n # source_media_name = self._source_list.get(\\\"udisk\\\", \\\"USB Disk\\\")\\n\\n # if len(self._trackq) > 0:\\n # radio = [\\n # BrowseMedia(\\n # title = preset,\\n # media_class = MEDIA_CLASS_MUSIC,\\n # media_content_id = index,\\n # media_content_type = MEDIA_TYPE_MUSIC,\\n # can_play = True,\\n # can_expand = False,\\n # )\\n # for index, preset in enumerate(self._trackq, start=1)\\n # ]\\n\\n # root = BrowseMedia(\\n # title=self._name + \\\" \\\" + source_media_name,\\n # media_class = MEDIA_CLASS_DIRECTORY,\\n # media_content_id = \\\"root\\\",\\n # media_content_type = \\\"listing\\\",\\n # can_play = False,\\n # can_expand = True,\\n # children = radio,\\n # )\\n\\n # else:\\n # root = BrowseMedia(\\n # title=self._name + \\\" \\\" + source_media_name,\\n # media_class = MEDIA_CLASS_DIRECTORY,\\n # media_content_id = \\\"root\\\",\\n # media_content_type = \\\"listing\\\",\\n # can_play = False,\\n # can_expand = False,\\n # )\\n\\n # return root\",\n \"async def async_browse_media(self, media_content_type=None, media_content_id=None):\\n if media_content_type in [None, \\\"library\\\"]:\\n pass\\n\\n if media_content_id is None:\\n object_id = \\\"0\\\"\\n else:\\n object_id = media_content_id\\n\\n metadata = await self._raumfeld.async_browse_media(object_id, BROWSE_METADATA)\\n metadata = metadata[0]\\n\\n children = await self._raumfeld.async_browse_media(object_id, BROWSE_CHILDREN)\\n\\n if children is None:\\n log_fatal(\\\"No media identified\\\")\\n\\n metadata.children = children\\n return metadata\",\n \"def searchDiscover(self, query, limit=30, libtype=None):\\n libtypes = {'movie': 'movies', 'show': 'tv'}\\n libtype = libtypes.get(libtype, 'movies,tv')\\n\\n headers = {\\n 'Accept': 'application/json'\\n }\\n params = {\\n 'query': query,\\n 'limit': limit,\\n 'searchTypes': libtype,\\n 'includeMetadata': 1\\n }\\n\\n data = self.query(f'{self.METADATA}/library/search', headers=headers, params=params)\\n searchResults = data['MediaContainer'].get('SearchResults', [])\\n searchResult = next((s.get('SearchResult', []) for s in searchResults if s.get('id') == 'external'), [])\\n\\n results = []\\n for result in searchResult:\\n metadata = result['Metadata']\\n type = metadata['type']\\n if type == 'movie':\\n tag = 'Video'\\n elif type == 'show':\\n tag = 'Directory'\\n else:\\n continue\\n attrs = ''.join(f'{k}=\\\"{html.escape(str(v))}\\\" ' for k, v in metadata.items())\\n xml = f'<{tag} {attrs}/>'\\n results.append(self._manuallyLoadXML(xml))\\n\\n return self._toOnlineMetadata(results)\",\n \"def browse(request):\\n klass = media_klass_from_request(request)\\n filter_args, filter_kwargs = filter_args_from_request(request)\\n press_gallery = request.GET.get('press_gallery', '')\\n press_gallery = press_gallery.lower() == 'true'\\n if press_gallery:\\n if not request.user.has_perm('gallery.can_see_press_gallery'):\\n raise PermissionDenied\\n # for now we only allow photos in the press gallery, not\\n # artifacts or any other types. it's okay if the search query\\n # doesn't specify a type, or if it specifies the photo type,\\n # but we disallow other types of searches. it's a little ugly\\n # to be doing explicit type checking, but expedience demands\\n # it :P\\n if klass is models.MediaBase:\\n klass = models.Photo\\n if klass is not models.Photo:\\n return handler400(request)\\n filter_kwargs['in_press_gallery'] = True\\n status = request.GET.get('status')\\n if not status:\\n filter_kwargs['status'] = 'approved'\\n elif status != 'approved':\\n if not request.user.has_perm('gallery.can_review'):\\n # only reviewers can arbitrarily query based on status;\\n # non-reviewers are restricted to seeing their own\\n # submissions if they search on a status other than\\n # 'approved'\\n if request.user.is_anonymous():\\n raise PermissionDenied\\n filter_kwargs['owner'] = request.user\\n filter_kwargs['status'] = status\\n else:\\n filter_kwargs['status'] = status\\n\\n full_results = klass.objects.filter(*filter_args, **filter_kwargs)\\n # reverse the order so most recent is first\\n full_results = full_results.order_by('id').reverse()\\n tag = request.GET.get('tag')\\n if tag:\\n full_results = tagmodels.TaggedItem.objects.get_by_model(full_results,\\n tag)\\n text = request.GET.get('text')\\n if text:\\n full_results = apply_searchable_text_filter(full_results, text)\\n paginator = BetterPaginator(full_results, settings.PAGINATION_BATCH_SIZE)\\n try:\\n page = int(request.GET.get('page', '1'))\\n except ValueError:\\n page = 1\\n try:\\n page_results = paginator.page(page)\\n except (InvalidPage, EmptyPage):\\n page_results = paginator.page(paginator.num_pages)\\n query_string = request.META.get('QUERY_STRING')\\n # remove 'page' from query string so it doesn't get used in the template\\n query_map = parse_qs(query_string)\\n query_map.pop('page', None)\\n query_string = urlencode(query_map, doseq=True)\\n for extra_filter in ('owner', 'tag', 'press_gallery'):\\n if extra_filter in query_map:\\n del(query_map[extra_filter])\\n qs_no_extra_filters = urlencode(query_map, doseq=True)\\n no_extra_filters_url = reverse('bm.gallery.views.browse')\\n if qs_no_extra_filters:\\n no_extra_filters_url = '%s?%s' % (no_extra_filters_url,\\n qs_no_extra_filters)\\n template_map = {'page_results': page_results,\\n 'total_count': full_results.count(),\\n 'query_string': query_string,\\n 'no_extra_filters_url': no_extra_filters_url,\\n 'paginator': paginator.get_context(page),\\n 'page': page}\\n owner_username = request.GET.get('owner')\\n if owner_username:\\n template_map['owner'] = authmodels.User.objects.get(username=owner_username)\\n if tag:\\n template_map['tag'] = tag\\n if press_gallery:\\n template_map['press_gallery'] = True\\n context = RequestContext(request, template_map)\\n return render_to_response('gallery/browse.html', context)\",\n \"async def async_browse_media(\\n self,\\n media_content_type: MediaType | str | None = None,\\n media_content_id: str | None = None,\\n ) -> BrowseMedia:\\n self.thumbnail_cache = {}\\n if media_content_type in (None, \\\"library\\\"):\\n return await browse_top_level(self._volumio)\\n\\n return await browse_node(\\n self, self._volumio, media_content_type, media_content_id\\n )\",\n \"def search(self):\\n query = self.get_request_arg(\\\"query\\\")\\n if query:\\n album = self.ctrl.library.search(query)\\n return self.resp_from_data(album)\\n return self.resp_from_data(\\n {\\\"message\\\": \\\"No query parameters specified\\\"}, 400)\",\n \"async def search(self, keyword):\\n await self.coordinator.data.search_media(self.zone_id, keyword)\",\n \"def media_search(query, term):\\n table = Media.__table__\\n search_statement = or_(\\n cast(table.c.id, Text).ilike('%' + term + '%'),\\n cast(table.c.type, Text).ilike('%' + term + '%'),\\n table.c.name.ilike('%' + term + '%'),\\n table.c.cast.ilike('%' + term + '%'),\\n cast(table.c.seasons, Text).ilike('%' + term + '%'),\\n cast(table.c.release_date, Text).ilike('%' + term + '%'),\\n table.c.last_aired.ilike('%' + term + '%'),\\n table.c.image.ilike('%' + term + '%'),\\n cast(table.c.running, Text).ilike('%' + term + '%'),\\n table.c.overview.ilike('%' + term + '%'),\\n table.c.other_images.ilike('%' + term + '%'),\\n table.c.videos.ilike('%' + term + '%'),\\n cast(table.c.imdb_id, Text).ilike('%' + term + '%'),\\n cast(table.c.tmdb_id, Text).ilike('%' + term + '%'),\\n cast(table.c.runtime, Text).ilike('%' + term + '%'),\\n table.c.tagline.ilike('%' + term + '%'),\\n cast(table.c.popularity, Text).ilike('%' + term + '%'),\\n cast(table.c.average_rating, Text).ilike('%' + term + '%'))\\n return query.filter(search_statement)\",\n \"def media(self, path):\\n path = \\\"/media/%s%s\\\" % (self.session.root, format_path(path))\\n\\n url, params, headers = self.request(path, method='GET')\\n\\n return self.rest_client.GET(url, headers)\",\n \"def Scan(self, lib='video'):\\n self.logger.debug(\\\"Scanning \\\" + lib + \\\"-library\\\")\\n xbmc = Server(self.url('/jsonrpc', True))\\n if lib == 'video':\\n return xbmc.VideoLibrary.Scan()\\n elif lib == 'audio':\\n return xbmc.AudioLibrary.Scan()\",\n \"def view_media(self, obj):\\n for handle in self.selected_handles():\\n ref_obj = self.dbstate.db.get_object_from_handle(handle)\\n mpath = media_path_full(self.dbstate.db, ref_obj.get_path())\\n open_file_with_default_application(mpath)\",\n \"def folder_scan(self):\\r\\n\\r\\n cursor = connection.cursor()\\r\\n\\r\\n # Parsing the entire media folder and scanning each file\\r\\n for filename in os.listdir(media_folder):\\r\\n full_path = os.path.join(media_folder, filename).replace(\\\"\\\\\\\\\\\", \\\"/\\\")\\r\\n\\r\\n # Checks if the file is indexed to the database\\r\\n cursor.execute(\\\"SELECT COUNT(1) FROM media WHERE full_path = \\\\\\\"\\\" + full_path + \\\"\\\\\\\"\\\")\\r\\n result = int(str(cursor.fetchone())[1])\\r\\n\\r\\n if not result: # If the file is not indexed, the program automatically adds it to the database\\r\\n add_media(full_path, 1, self)\\r\\n\\r\\n connection.commit()\\r\\n\\r\\n # Resetting GUI-specific variables and counters before refreshing the media list\\r\\n self.library_items = []\\r\\n self.path_frame_parent.destroy()\\r\\n self.display_media()\",\n \"async def async_browse_media(self, media_content_type=None, media_content_id=None):\\n return await build_item_response(\\n self._zone_id,\\n self.coordinator,\\n media_content_type,\\n media_content_id,\\n )\",\n \"async def async_browse_media(\\n self,\\n media_content_type: MediaType | str | None = None,\\n media_content_id: str | None = None,\\n ) -> BrowseMedia:\\n content_filter = None\\n\\n chromecast = self._get_chromecast()\\n if chromecast.cast_type in (\\n pychromecast.const.CAST_TYPE_AUDIO,\\n pychromecast.const.CAST_TYPE_GROUP,\\n ):\\n\\n def audio_content_filter(item):\\n \\\"\\\"\\\"Filter non audio content.\\\"\\\"\\\"\\n return item.media_content_type.startswith(\\\"audio/\\\")\\n\\n content_filter = audio_content_filter\\n\\n if media_content_id is None:\\n return await self._async_root_payload(content_filter)\\n\\n platform: CastProtocol\\n assert media_content_type is not None\\n for platform in self.hass.data[CAST_DOMAIN][\\\"cast_platform\\\"].values():\\n browse_media = await platform.async_browse_media(\\n self.hass,\\n media_content_type,\\n media_content_id,\\n chromecast.cast_type,\\n )\\n if browse_media:\\n return browse_media\\n\\n return await media_source.async_browse_media(\\n self.hass, media_content_id, content_filter=content_filter\\n )\",\n \"def _do_search(self,search_terms,order_by='relevance'):\\n try:\\n self._logger.info('Hey!listen up!...Attempting to perform a search in MegaVideo')\\n self._logger.debug('Search Terms: %s',search_terms)\\n srv = MegaVideoService(self._logger)\\n query = MegaVideoQuery()\\n query.query = search_terms\\n query.sort = order_by\\n query.max_results=int(self.search_max_results)\\n return srv.query(query)\\n except:\\n self._logger.exception('Dammit!...An error ocurred while searching in MegaVideo...')\\n return None\\n else:\\n self._logger.info('Great!...The MegaVideo search was succesfull...')\",\n \"def index():\\n\\tform = FORM('',\\n\\t\\t\\t\\tINPUT(_name='search_term', requires = IS_NOT_EMPTY(), _class='input-large search-query', \\n\\t\\t\\t\\t\\t_placeholder='Search for music', _autocomplete=\\\"off\\\"),\\n\\t\\t\\t\\tINPUT(_type='submit', _class='btn', _value='Search'), _class='form-search')\\n\\tif form.process().accepted:\\n\\t\\tredirect(URL('search', vars=dict(search_term=request.vars.search_term)))\\n\\tfeatured_albums = db.executesql(\\\"select * from top_release_group;\\\")\\n\\tgroupinfo = []\\n\\timagelink = []\\n\\tfor row in featured_albums:\\n\\t\\tgroupinfo.append(row[0])\\n\\t\\tif (row[2]):\\n\\t\\t\\timagelink.append(row[2])\\n\\t\\telse:\\n\\t\\t\\timageurl = get_link(\\\"http://www.coverartarchive.org/release-group/\\\"+row[1]);\\n\\t\\t\\tdb.executesql(\\\"update top_release_group set url = '\\\"+str(imageurl)+\\\"' where id=\\\"+str(row[0])+\\\";\\\")\\n\\t\\t\\timagelink.append(imageurl)\\n\\treturn dict(form=form, groupinfo=groupinfo, imagelink=imagelink)\",\n \"def search(self, entry):\\r\\n\\r\\n if entry.get() != \\\"\\\": # The algorithm only needs to run if the user has entered a search query\\r\\n\\r\\n cursor = connection.cursor()\\r\\n\\r\\n # Looking up the search entry in each of the database's columns\\r\\n cursor.execute(\\\"SELECT full_path FROM media WHERE INSTR(title, \\\" + \\\"\\\\\\\"\\\" + entry.get() + \\\"\\\\\\\"\\\" +\\r\\n \\\") > 0 OR INSTR(artist, \\\" + \\\"\\\\\\\"\\\" + entry.get() + \\\"\\\\\\\"\\\" + \\\") > 0 OR INSTR(album, \\\" + \\\"\\\\\\\"\\\" +\\r\\n entry.get() + \\\"\\\\\\\"\\\" + \\\") > 0 OR INSTR(release_date, \\\" + \\\"\\\\\\\"\\\" + entry.get() + \\\"\\\\\\\"\\\" + \\\") > 0\\\" +\\r\\n \\\" OR INSTR(tags, \\\" + \\\"\\\\\\\"\\\" + entry.get() + \\\"\\\\\\\"\\\" + \\\") > 0\\\")\\r\\n\\r\\n files = cursor.fetchall()\\r\\n\\r\\n # Packing the \\\"Back\\\" button, which quits the searching session\\r\\n self.back_button.grid(row=0, column=0, padx=5)\\r\\n self.search_entry.grid(row=0, column=1, padx=10, pady=20)\\r\\n self.search_button.grid(row=0, column=2, padx=5)\\r\\n # self.advanced_search_button.grid(row=0, column=3, padx=5)\\r\\n\\r\\n self.display_media(files) # Displaying the media list containing only the search results\\r\\n\\r\\n else: # The user has attempted a search on an empty string; displaying the entire media list instead\\r\\n self.display_media()\",\n \"def test_list_media_type(self):\\n\\n # check if documentalist has access to list media-types\\n self.login_documentalist()\\n response = self.client.get('/multimedia/media-types/' )\\n\\n # 403 = unauthorized\\n self.assertEqual(response.status_code, 403)\\n\\n self.client.logout()\\n self.login_admin()\\n\\n response = self.client.get('/multimedia/media-types/')\\n self.assertContains(response, \\\"Video\\\")\",\n \"def uses_media(self):\\n return True\",\n \"def filter(self):\\n for f in FileHelper.ALL_PATHS:\\n media_obj = MediaObject(FileHelper.get_url(f), FileHelper.get_title(f), FileHelper.get_media_type(f), FileHelper.get_icon(f), FileHelper.get_duration(f), FileHelper.get_ctype(f))\\n _id = media_obj.uuid\\n if media_obj.media_type == \\\"image\\\":\\n DB.IMAGES[_id] = media_obj\\n elif media_obj.media_type == \\\"audio\\\":\\n DB.MUSIC[_id] = media_obj\\n elif media_obj.media_type == \\\"video\\\":\\n DB.VIDEOS[_id] = media_obj\\n else:\\n print \\\"File '%s' doesn't play nice.\\\" % (f)\",\n \"def display_media(self, search_list=None):\\r\\n\\r\\n global config_var # Using the global variable that reads and modifies the configuration file\\r\\n\\r\\n cursor = connection.cursor()\\r\\n\\r\\n index = 0 # Using an index to determine the correct row in which every media item needs to be placed\\r\\n\\r\\n if media_folder != \\\"\\\":\\r\\n self.header.pack(pady=10)\\r\\n\\r\\n # Resetting the media frame\\r\\n self.library_items = []\\r\\n self.path_frame_parent.destroy()\\r\\n self.path_frame_parent = Frame(self.media_frame, relief=GROOVE, width=500, height=100, bd=1)\\r\\n self.path_frame_parent.pack()\\r\\n\\r\\n # The canvas will store every item in the media list\\r\\n self.canvas = Canvas(self.path_frame_parent, width=500)\\r\\n path_frame_child = Frame(self.canvas, width=500)\\r\\n\\r\\n # Adding a scrollbar in case the media list height exceeds the window height\\r\\n scrollbar = Scrollbar(self.path_frame_parent, orient=\\\"vertical\\\", command=self.canvas.yview)\\r\\n self.canvas.configure(yscrollcommand=scrollbar.set)\\r\\n\\r\\n self.canvas.create_window((0, 0), window=path_frame_child, anchor='nw')\\r\\n scrollbar.pack(side=RIGHT, fill=Y)\\r\\n self.canvas.pack(side=LEFT)\\r\\n\\r\\n # The variable that stores the length (in characters) of the longest item in the media list\\r\\n self.longest_item_length = 0\\r\\n\\r\\n if search_list is None: # No search string was provided; displaying the entire media list\\r\\n self.back_button.grid_forget()\\r\\n self.search_entry.delete(0, 'end')\\r\\n\\r\\n # Parsing the entire database and displaying every record that matches the current media folder\\r\\n cursor.execute(\\\"SELECT COUNT(*) FROM media\\\")\\r\\n\\r\\n number_of_entries = cursor.fetchone() # This variable will store the amount of records in the database\\r\\n\\r\\n for i in range(number_of_entries[0]): # Parsing every item in the database\\r\\n index += 1\\r\\n\\r\\n cursor.execute(\\\"SELECT full_path FROM media WHERE id = \\\" + str(i + 1))\\r\\n entry_path = cursor.fetchone() # This variable will store the path of the currently selected item\\r\\n\\r\\n display_entry = StringVar()\\r\\n display_entry.set(os.path.basename(entry_path[0]))\\r\\n\\r\\n # This variable will store the name of the media file without showing the extension\\r\\n label_entry = StringVar()\\r\\n label_entry.set(os.path.splitext(display_entry.get())[0])\\r\\n\\r\\n # Checking if the currently selected item from the database is located in the media folder\\r\\n if (os.path.dirname(entry_path[0])) == config_var['MEDIA FOLDER']['folder']:\\r\\n # Adding the media item title to the media list\\r\\n cursor.execute(\\\"SELECT mode FROM media WHERE id = \\\" + str(i + 1))\\r\\n mode = cursor.fetchone()\\r\\n\\r\\n if int(mode[0]): # Displaying the media label using its filename\\r\\n self.library_items.append(Label(path_frame_child, textvariable=display_entry))\\r\\n self.library_items[-1].grid(row=index, column=1)\\r\\n\\r\\n current_item_length = len(display_entry.get())\\r\\n if current_item_length > self.longest_item_length:\\r\\n self.longest_item_length = current_item_length\\r\\n\\r\\n else: # Displaying the media label using its metadata\\r\\n cursor.execute(\\\"SELECT artist FROM media WHERE id = \\\" + str(i + 1))\\r\\n artist = cursor.fetchone()\\r\\n cursor.execute(\\\"SELECT title FROM media WHERE id = \\\" + str(i + 1))\\r\\n title = cursor.fetchone()\\r\\n\\r\\n display_label = StringVar()\\r\\n display_label.set(artist[0] + \\\" - \\\" + title[0])\\r\\n\\r\\n self.library_items.append(Label(path_frame_child, textvariable=display_label))\\r\\n self.library_items[-1].grid(row=index, column=1)\\r\\n\\r\\n current_item_length = len(display_label.get())\\r\\n if current_item_length > self.longest_item_length:\\r\\n self.longest_item_length = current_item_length\\r\\n\\r\\n # Adding the play button specific to the current media item\\r\\n self.library_items.append(Button(path_frame_child, text=\\\"Play\\\",\\r\\n command=lambda file_path=entry_path[0]:\\r\\n play_media(file_path, 1, self)))\\r\\n self.library_items[-1].grid(row=index, column=2, padx=10, pady=5)\\r\\n\\r\\n \\\"\\\"\\\"\\r\\n # Adding the info button specific to the current media item\\r\\n self.library_items.append(Button(path_frame_child, text=\\\"Info\\\"))\\r\\n self.library_items[-1].grid(row=index, column=3, padx=10, pady=5)\\r\\n \\\"\\\"\\\"\\r\\n\\r\\n # Adding the configuration button specific to the current media item\\r\\n self.library_items.append(Button(path_frame_child, text=\\\"Configure\\\",\\r\\n command=lambda media_title=label_entry.get(),\\r\\n file_path=entry_path[0]:\\r\\n self.configure_media(media_title, file_path)))\\r\\n self.library_items[-1].grid(row=index, column=4, padx=10, pady=5)\\r\\n\\r\\n # Adding the removal button specific to the current media item\\r\\n self.library_items.append(Button(path_frame_child, text=\\\"Remove\\\",\\r\\n command=lambda media_title=label_entry.get(),\\r\\n file_path=entry_path[0]:\\r\\n self.remove_media_query(media_title, file_path)))\\r\\n self.library_items[-1].grid(row=index, column=5, padx=10, pady=5)\\r\\n\\r\\n else: # A search string was provided\\r\\n for i in search_list: # Displaying every item in the search results\\r\\n index += 1\\r\\n\\r\\n display_entry = StringVar()\\r\\n display_entry.set(os.path.basename(i[0]))\\r\\n\\r\\n # This variable will store the name of the media file without showing the extension\\r\\n label_entry = StringVar()\\r\\n label_entry.set(os.path.splitext(display_entry.get())[0])\\r\\n\\r\\n # Checking if the currently selected item from the database is located in the media folder\\r\\n if (os.path.dirname(i[0])) == config_var['MEDIA FOLDER']['folder']:\\r\\n\\r\\n # Adding the media item title to the media list\\r\\n cursor.execute(\\\"SELECT mode FROM media WHERE full_path = \\\" + \\\"\\\\\\\"\\\" + i[0] + \\\"\\\\\\\"\\\")\\r\\n mode = cursor.fetchone()\\r\\n\\r\\n if int(mode[0]): # Displaying the media label using its metadata\\r\\n self.library_items.append(\\r\\n Label(path_frame_child, textvariable=display_entry))\\r\\n self.library_items[-1].grid(row=index, column=1)\\r\\n\\r\\n current_item_length = len(display_entry.get())\\r\\n if current_item_length > self.longest_item_length:\\r\\n self.longest_item_length = current_item_length\\r\\n\\r\\n else: # Displaying the media label using its filename\\r\\n cursor.execute(\\\"SELECT artist FROM media WHERE full_path = \\\" + \\\"\\\\\\\"\\\" + i[0] + \\\"\\\\\\\"\\\")\\r\\n artist = cursor.fetchone()\\r\\n cursor.execute(\\\"SELECT title FROM media WHERE full_path = \\\" + \\\"\\\\\\\"\\\" + i[0] + \\\"\\\\\\\"\\\")\\r\\n title = cursor.fetchone()\\r\\n\\r\\n display_label = StringVar()\\r\\n display_label.set(artist[0] + \\\" - \\\" + title[0])\\r\\n\\r\\n self.library_items.append(\\r\\n Label(path_frame_child, textvariable=display_label))\\r\\n self.library_items[-1].grid(row=index, column=1)\\r\\n\\r\\n current_item_length = len(display_label.get())\\r\\n if current_item_length > self.longest_item_length:\\r\\n self.longest_item_length = current_item_length\\r\\n\\r\\n # Adding the play button specific to the current media item\\r\\n self.library_items.append(Button(path_frame_child, text=\\\"Play\\\"))\\r\\n self.library_items[-1].grid(row=index, column=2, padx=10, pady=5)\\r\\n\\r\\n \\\"\\\"\\\"\\r\\n # Adding the info button specific to the current media item\\r\\n self.library_items.append(Button(path_frame_child, text=\\\"Info\\\"))\\r\\n self.library_items[-1].grid(row=index, column=3, padx=10, pady=5)\\r\\n \\\"\\\"\\\"\\r\\n\\r\\n # Adding the configuration button specific to the current media item\\r\\n self.library_items.append(Button(path_frame_child, text=\\\"Configure\\\",\\r\\n command=lambda media_title=label_entry.get(), file_path=i[0]:\\r\\n self.configure_media(media_title, file_path)))\\r\\n self.library_items[-1].grid(row=index, column=4, padx=10, pady=5)\\r\\n\\r\\n # Adding the removal button specific to the current media item\\r\\n self.library_items.append(Button(path_frame_child, text=\\\"Remove\\\",\\r\\n command=lambda media_title=label_entry.get(), file_path=i[0]:\\r\\n self.remove_media_query(media_title, file_path)))\\r\\n self.library_items[-1].grid(row=index, column=5, padx=10, pady=5)\\r\\n\\r\\n # Updating the width of the scrollable area\\r\\n path_frame_child.bind(\\\"<Configure>\\\", lambda event, x=self.longest_item_length: self.scroll_function(event, x))\\r\\n\\r\\n # Refreshing the add button\\r\\n self.add_music_button.destroy()\\r\\n self.add_music_button = ttk.Button(self.button_frame, text=\\\"Add Media...\\\",\\r\\n command=self.add_media_dialog)\\r\\n self.add_music_button.grid(row=0, column=0, padx=10, pady=20)\\r\\n\\r\\n # Refreshing the savelist button\\r\\n self.create_savelist_button.destroy()\\r\\n self.create_savelist_button = ttk.Button(self.button_frame, text=\\\"Create Savelist...\\\",\\r\\n command=self.create_savelist)\\r\\n self.create_savelist_button.grid(row=0, column=1, padx=10, pady=20)\\r\\n\\r\\n cursor.close()\",\n \"def voiceSearch(self):\\n\\n # Set the device ID of the mic that we\\n # specifically want to use to avoid ambiguity\\n for i, microphone_name in enumerate(\\n sr.Microphone.list_microphone_names()):\\n if(microphone_name == MIC_NAME):\\n device_id = i\\n break\\n\\n # obtain audio from the microphone\\n r = sr.Recognizer()\\n with sr.Microphone(device_index=device_id) as source:\\n # clear console of errors\\n subprocess.run(\\\"clear\\\")\\n\\n # wait for a second to let the recognizer adjust the\\n # energy threshold based on the surrounding noise level\\n r.adjust_for_ambient_noise(source)\\n\\n print(\\\"Say something to search for books: \\\")\\n try:\\n audio = r.listen(source, timeout=1.5)\\n except sr.WaitTimeoutError:\\n return None\\n\\n # recognize speech using Google Speech Recognition\\n translation = None\\n try:\\n translation = r.recognize_google(audio)\\n except(sr.UnknownValueError, sr.RequestError):\\n pass\\n finally:\\n return translation\",\n \"def search_videos(self, search_term):\\n print(\\\"search_videos needs implementation\\\")\",\n \"def open(self):\\n file = askopenfilename(\\n initialdir=self.initial_directory,\\n filetypes=(\\n (\\\"Audio Video Interleave\\\", \\\"*.avi\\\"),\\n (\\\"Matroska\\\", \\\"*.mkv\\\"),(\\\"MPEG-4 AVC\\\",\\\"*.mp4\\\"),\\n )\\n )\\n if isinstance(file, tuple):\\n return\\n if os.path.isfile(file):\\n self.play_film(file)\",\n \"async def imgran(self):\\r\\n search=\\\"random\\\"\\r\\n search = client.gallery()\\r\\n holder=[]\\r\\n for d in search:\\r\\n holder.append(d.link)\\r\\n await self.bot.say(random.choice(holder))\",\n \"def browse():\\n rino.browse.open()\",\n \"def browse(*args):\",\n \"def get_list(self ):\\n headers = { 'Authorization' : self.client.authorization_header }\\n response = requests.get(\\n self.client.url + '/media', \\n headers = headers\\n )\\n\\n return json.loads(response.text)\",\n \"def search_gallery(self, q):\\n url = \\\"https://api.imgur.com/3/gallery/search?q={0}\\\".format(q)\\n resp = self._send_request(url)\\n return [_get_album_or_image(thing, self) for thing in resp]\",\n \"def test_get(self):\\n fields = {\\n 'title': 'Test media title',\\n 'description': 'Test media description',\\n 'local_media_file': 'test_64K_short.mp3',\\n }\\n\\n media_filename = \\\"%s/%s\\\" % (settings.get('base', 'path.local.media'), fields['local_media_file'])\\n m = Media.create(\\n client=self.client,\\n media_filename=media_filename,\\n title=fields['title'],\\n description=fields['description'],\\n )\\n\\n m = Media.get(client=self.client, uuid=m.uuid)\\n assert m.title == fields['title']\\n assert m.description == fields['description']\",\n \"def browse(self, param=None):\\n data = self._http_get(\\\"browse\\\", query=param)\\n return data.json()\",\n \"def display_media_cli():\\r\\n\\r\\n global config_var # Using the global variable that reads and modifies the configuration file\\r\\n\\r\\n cursor = connection.cursor()\\r\\n count = 0 # The total amount of items displayed\\r\\n\\r\\n # Parsing the entire database and displaying every record that matches the current media folder\\r\\n cursor.execute(\\\"SELECT COUNT(*) FROM media\\\")\\r\\n\\r\\n number_of_entries = cursor.fetchone() # This variable will store the amount of records in the database\\r\\n\\r\\n for i in range(number_of_entries[0]):\\r\\n cursor.execute(\\\"SELECT full_path FROM media WHERE id = \\\" + str(i + 1))\\r\\n entry_path = cursor.fetchone() # This variable will store the path of the currently selected item\\r\\n\\r\\n # Checking if the currently selected item from the database is located in the media folder\\r\\n if (os.path.dirname(entry_path[0])) == config_var['MEDIA FOLDER']['folder']:\\r\\n print(\\\"\\\\n\\\" + os.path.basename(entry_path[0]) + \\\" || ID: \\\" + str(i + 1))\\r\\n count += 1\\r\\n\\r\\n if not count: # No items could be found\\r\\n print(\\\"\\\\nThere are no media files in the media folder.\\\")\\r\\n\\r\\n cursor.close()\",\n \"def handle_media( environ ):\\n # TODO: implement me\\n return 200, [], _html.format(\\n title = 'MEDIA',\\n head = '',\\n body = 'MEDIA'\\n )\",\n \"def test_ms_playlist_search(helpers):\\n item_from_xml, item_from_dict = common_tests(\\n MSAlbumList,\\n MS_PLAYLIST_SEARCH_XML,\\n MS_PLAYLIST_SEARCH_DICT,\\n \\\"00020064playlistsearch:Dans &\\\",\\n helpers,\\n )\\n getter_attributes_test(\\n \\\"uri\\\", item_from_xml, item_from_dict, MS_PLAYLIST_SEARCH_DICT[\\\"uri\\\"]\\n )\",\n \"def MainMenu():\\n\\n # You have to open an object container to produce the icons you want to appear on this page.\\n oc = ObjectContainer()\\n main_list = [('New Videos', ''), ('Best Videos', '/best'), ('Pornstars', '/pornstars')]\\n for pt, h in main_list:\\n oc.add(DirectoryObject(\\n key=Callback(ShowHTML, pTitle=pt, href=h),\\n title=pt, thumb=Callback(GetThumb, url=BASE_URL)))\\n oc.add(DirectoryObject(\\n key=Callback(ShowHTML, pTitle=\\\"Pornstars\\\", href='/channels'),\\n title=\\\"Channels\\\", thumb=Callback(GetThumb, url=BASE_URL)))\\n\\n oc.add(InputDirectoryObject(key=Callback(Search), title='Search Videos', prompt='Search Videos'))\\n\\n return oc\",\n \"def browseDirectory ( directory ) :\\r\\n\\r\\n library = \\\"libraryPython\\\"\\r\\n\\r\\n if not directory.endswith( os.sep ) : directory = directory + os.sep\\r\\n\\r\\n try :\\r\\n\\r\\n items = os.listdir( directory )\\r\\n\\r\\n except Exception, exception :\\r\\n\\r\\n items = [ ]\\r\\n\\r\\n for item in items :\\r\\n\\r\\n if item == library :\\r\\n\\r\\n if not item.endswith( os.sep ) : item = item + os.sep\\r\\n\\r\\n return directory + item \\r\\n\\r\\n if item.startswith( \\\".\\\" ) : continue\\r\\n\\r\\n if item.startswith( \\\"_\\\" ) : continue\\r\\n\\r\\n if item.startswith( \\\"~\\\" ) : continue\\r\\n\\r\\n if not os.path.isdir( directory + item ) : continue\\r\\n\\r\\n found = browseDirectory( directory + item )\\r\\n\\r\\n if not found is None : return found\\r\\n\\r\\n return None\",\n \"async def async_browse_media(\\n hass: HomeAssistant,\\n media_content_id: str | None,\\n *,\\n content_filter: Callable[[BrowseMedia], bool] | None = None,\\n) -> BrowseMediaSource:\\n if DOMAIN not in hass.data:\\n raise BrowseError(\\\"Media Source not loaded\\\")\\n\\n try:\\n item = await _get_media_item(hass, media_content_id, None).async_browse()\\n except ValueError as err:\\n raise BrowseError(str(err)) from err\\n\\n if content_filter is None or item.children is None:\\n return item\\n\\n old_count = len(item.children)\\n item.children = [\\n child for child in item.children if child.can_expand or content_filter(child)\\n ]\\n item.not_shown += old_count - len(item.children)\\n return item\",\n \"def get_single_media(media_id):\\n return query_single(media_id, Media, media_schema)\",\n \"def add_media_dialog(self):\\r\\n\\r\\n file = filedialog.askopenfilename()\\r\\n\\r\\n if add_media(file, 0, self): # Checking if the process of adding the media file was successful\\r\\n\\r\\n if file: # Checking whether the user has aborted the operation\\r\\n # Getting the path of the file with respect to the current media folder (since the \\\"file\\\" variable\\r\\n # points to the location of the source file)\\r\\n full_path = os.path.join(media_folder, os.path.basename(file)).replace(\\\"\\\\\\\\\\\", \\\"/\\\")\\r\\n\\r\\n # Whenever a media item is added, the user is automatically prompted to configure its metadata\\r\\n self.configure_media(os.path.basename(file), full_path)\",\n \"def search(\\n\\tlog,\\n\\tverbose,\\n\\tquiet,\\n\\tusername,\\n\\tdevice_id,\\n\\tyes,\\n\\tfilters\\n):\\n\\n\\tconfigure_logging(verbose - quiet, username, log_to_file=log)\\n\\n\\tlogger.info(\\\"Logging in to Google Music\\\")\\n\\tmc = google_music.mobileclient(username, device_id=device_id)\\n\\n\\tif not mc.is_authenticated:\\n\\t\\tsys.exit(\\\"Failed to authenticate client.\\\")\\n\\n\\tsearch_results = filter_songs(mc.songs(), filters)\\n\\tsearch_results.sort(\\n\\t\\tkey=lambda song: (\\n\\t\\t\\tsong.get('artist', ''),\\n\\t\\t\\tsong.get('album', ''),\\n\\t\\t\\tsong.get('trackNumber', 0)\\n\\t\\t)\\n\\t)\\n\\n\\tif search_results:\\n\\t\\tresult_num = 0\\n\\t\\ttotal = len(search_results)\\n\\t\\tpad = len(str(total))\\n\\n\\t\\tconfirm = (\\n\\t\\t\\tyes\\n\\t\\t\\tor input(f\\\"\\\\nDisplay {len(search_results)} results? (y/n) \\\") in (\\\"y\\\", \\\"Y\\\")\\n\\t\\t)\\n\\n\\t\\tif confirm:\\n\\t\\t\\tfor result in search_results:\\n\\t\\t\\t\\tresult_num += 1\\n\\n\\t\\t\\t\\ttitle = result.get('title', \\\"<empty>\\\")\\n\\t\\t\\t\\tartist = result.get('artist', \\\"<empty>\\\")\\n\\t\\t\\t\\talbum = result.get('album', \\\"<empty>\\\")\\n\\t\\t\\t\\tsong_id = result['id']\\n\\n\\t\\t\\t\\tlogger.info(\\n\\t\\t\\t\\t\\tf\\\"{result_num:>{pad}}/{total} {title} -- {artist} -- {album} ({song_id})\\\"\\n\\t\\t\\t\\t)\\n\\telse:\\n\\t\\tlogger.info(\\\"No songs found matching query\\\")\\n\\n\\tmc.logout()\\n\\tlogger.info(\\\"All done!\\\")\",\n \"def search(self, query, mediatype=None):\\n items = utils.listItems(self, '/search?query=%s' % quote(query))\\n if mediatype:\\n return [item for item in items if item.type == mediatype]\\n return items\",\n \"def __init__(self, media, username, password):\\n self.media = media\\n self.username = username\\n self.password = password\",\n \"def __searchFiles(self):\\n self.ui.showFindFilesDialog(self.textForFind())\",\n \"def album(self, q, page=None):\\r\\n return self.get('album', q, page)\",\n \"def initiateSearch(search_context, text):\\n searches = []\\n log.msg(\\\"Searching: %s\\\" % text)\\n\\n if not isinstance(text, dict) :\\n \\n artistStart = text.find(SearchKeys.ARTIST)\\n titleStart = text.find(SearchKeys.TITLE)\\n albumStart = text.find(SearchKeys.ALBUM)\\n\\n if max(artistStart, titleStart, albumStart) != -1:\\n d = dict()\\n \\n def pullout(text2):\\n if text2.find(SearchKeys.ARTIST) != -1:\\n text2 = text2[0:text2.find(SearchKeys.ARTIST)]\\n\\n if text2.find(SearchKeys.ALBUM) != -1:\\n text2 = text2[0:text2.find(SearchKeys.ALBUM)]\\n\\n if text2.find(SearchKeys.TITLE) != -1:\\n text2 = text2[0:text2.find(SearchKeys.TITLE)]\\n return text2.strip()\\n\\n if artistStart != -1:\\n d['artist'] = pullout(text[artistStart+len(SearchKeys.ARTIST) : len(text)])\\n\\n if titleStart != -1:\\n d['title'] = pullout(text[titleStart+len(SearchKeys.TITLE) : len(text)])\\n \\n if albumStart != -1:\\n d['album'] = pullout(text[albumStart+len(SearchKeys.ALBUM) : len(text)])\\n log.msg(\\\"Parsed Search: \\\" + str(d))\\n text = d\\n\\n # Fire off search in parallel\\n for key, mediasrc in __mediaSources.items():\\n log.msg(\\\"\\\\tSending Search Request to %s\\\" % key)\\n searches.append(deferToThread(mediasrc.search, text))\\n\\n # When all searches return combine them. The lists will be\\n # returned as a list of a touples consisting of a sucess/failure\\n # boolean followed by the results returned by the individual source\\n dl = DeferredList(searches)\\n\\n def sendResults(results):\\n \\\"\\\"\\\"\\n Combines the results returned by the deferred list\\n into master_result and passes it to all the registered\\n controllers.\\n \\\"\\\"\\\"\\n log.msg(\\\"Search Returned from all sources\\\")\\n master_result = []\\n for status, result in results:\\n if status:\\n master_result += result\\n\\n for key, mediactr in __controllers.items():\\n log.msg(\\\"\\\\tSending Result to %s\\\" % key)\\n mediactr.searchCompleted(search_context, master_result)\\n\\n dl.addCallback(sendResults)\",\n \"def view_file(self):\\n\\n index_list = self.ui.tableWidget.selectionModel().selectedIndexes()\\n index = None\\n if len(index_list) > 0:\\n index = index_list[0].row()\\n if index is None:\\n return\\n\\n # Need the data as a dictionary to view images and audio/video\\n dictionary = {'name': self.allfiles[index][NAME], 'mediapath': self.allfiles[index][MEDIAPATH],\\n 'owner': self.allfiles[index][OWNER], 'id': self.allfiles[index][0],\\n 'date': self.allfiles[index][DATE],\\n 'memo': self.allfiles[index][MEMO], 'fulltext': self.allfiles[index][FULLTEXT],\\n 'av_text_id': self.allfiles[index][AV_TEXT_ID]}\\n # Mediapath will be None for a .transcribed empty text media entry, and 'docs:' for a linked text document\\n if self.allfiles[index][MEDIAPATH] is None or self.allfiles[index][MEDIAPATH][0:5] == 'docs:':\\n return\\n # Added checks to test for media presence\\n if self.allfiles[index][MEDIAPATH][:6] in (\\\"/video\\\", \\\"video:\\\"):\\n if self.allfiles[index][MEDIAPATH][:6] == \\\"video:\\\":\\n abs_path = self.allfiles[index][MEDIAPATH].split(':')[1]\\n if not os.path.exists(abs_path):\\n return\\n if self.allfiles[index][MEDIAPATH][:6] == \\\"/video\\\":\\n abs_path = self.app.project_path + self.allfiles[index][MEDIAPATH]\\n if not os.path.exists(abs_path):\\n return\\n ui_av = DialogViewAV(self.app, dictionary)\\n ui_av.exec()\\n if self.allfiles[index][MEDIAPATH][:6] in (\\\"/audio\\\", \\\"audio:\\\"):\\n if self.allfiles[index][MEDIAPATH][0:6] == \\\"audio:\\\":\\n abs_path = self.allfiles[index][MEDIAPATH].split(':')[1]\\n if not os.path.exists(abs_path):\\n return\\n if self.allfiles[index][MEDIAPATH][0:6] == \\\"/audio\\\":\\n abs_path = self.app.project_path + self.allfiles[index][MEDIAPATH]\\n if not os.path.exists(abs_path):\\n return\\n ui_av = DialogViewAV(self.app, dictionary)\\n ui_av.exec()\\n if self.allfiles[index][MEDIAPATH][:7] in (\\\"/images\\\", \\\"images:\\\"):\\n if self.allfiles[index][MEDIAPATH][0:7] == \\\"images:\\\":\\n abs_path = self.allfiles[index][MEDIAPATH].split(':')[1]\\n if not os.path.exists(abs_path):\\n return\\n if self.allfiles[index][MEDIAPATH][0:7] == \\\"/images\\\":\\n abs_path = self.app.project_path + self.allfiles[index][MEDIAPATH]\\n if not os.path.exists(abs_path):\\n return\\n # Requires {name, mediapath, owner, id, date, memo, fulltext}\\n ui_img = DialogViewImage(self.app, dictionary)\\n ui_img.exec()\",\n \"def cmd_gallery_search(client, args):\\n if args.advanced:\\n config = data_fields(args.advanced, client.allowed_advanced_search_fields)\\n else:\\n config = None\\n gallery_search = client.gallery_search(args.q, config, args.sort,\\n args.window, args.page)\\n data = [item.__dict__ for item in gallery_search]\\n generate_output({'gallery_search': data}, args.output_file)\",\n \"def url_media(self, csvlinks=\\\"\\\", csvset=\\\"\\\", urldir=\\\"\\\", medialog_file=\\\"\\\",\\n directory=\\\"\\\", ignore_twitter_link=True, mediatype=\\\"vi\\\",\\n site_sources=[], name_scraping=\\\"\\\", video_timelimit=1000,\\n image_timelimit=60):\\n\\n if csvlinks == \\\"\\\":\\n csvlinks = CSVLINKS\\n if csvset == \\\"\\\":\\n csvset = CSVSETURL\\n if medialog_file == \\\"\\\":\\n medialog_file = MEDIALOG\\n if directory == \\\"\\\":\\n directory = self.directory\\n\\n if urldir == \\\"\\\" and name_scraping == \\\"\\\":\\n urldir = URLDIR\\n name_scraping = urldir.lower()\\n elif name_scraping == \\\"\\\":\\n name_scraping = urldir.lower()\\n elif urldir == \\\"\\\":\\n urldir = name_scraping\\n\\n if urldir[-1] != \\\"/\\\":\\n urldir = urldir + \\\"/\\\"\\n if name_scraping[-1] == \\\"/\\\":\\n name_scraping = name_scraping[:-1]\\n\\n mediatype = str(mediatype).lower()\\n if mediatype not in (\\\"v\\\", \\\"i\\\", \\\"vi\\\", \\\"iv\\\"):\\n mediatype = \\\"vi\\\"\\n\\n root_dir = os.getcwd()\\n\\n if directory != \\\"\\\":\\n os.chdir(directory)\\n directory = os.getcwd()\\n else:\\n directory = root_dir\\n\\n setUrls = CSVUtils.csv_to_dict(csvset, 1, 0)\\n\\n if urldir[-1] == '/':\\n urldir = urldir[:-1]\\n OSUtils.createDir(urldir)\\n\\n seq = \\\"\\\"\\n\\n # get next sequence number\\n if os.path.isfile(medialog_file):\\n seq = JSONUtils.read_keyval_json(\\\"next_\\\"+name_scraping+\\\"Seq\\\",\\n medialog_file)\\n\\n # if the parameter does not exist, get the seq from the\\n if seq == \\\"\\\":\\n seq = max([int(d) for d in os.listdir(urldir)] + [0]) + 1\\n\\n try:\\n seqdir = os.path.realpath(urldir + \\\"/\\\" + str(seq))\\n\\n # implemented in order to give a feedback about progresss %\\n total_row = sum(1 for row in CSVUtils.csvGenerator(csvlinks))\\n row_count = 0\\n\\n # iterate through each link\\n for line in CSVUtils.csvGenerator(csvlinks):\\n row_count += 1\\n\\n if \\\"https://twitter.com\\\" in line[0] and ignore_twitter_link:\\n continue\\n\\n url = self.__expandURL(line[0])\\n\\n if len(site_sources) > 0:\\n if len([site for site in site_sources if site in url]\\n ) == 0:\\n continue\\n\\n if url not in setUrls.keys():\\n\\n print('\\\\x1b[6;30;42m' + \\\"Starting Scrapping for Link \\\"\\n + str(url) + \\\" (\\\" + str(seq) + \\\")\\\" + '\\\\x1b[0m')\\n\\n os.mkdir(seqdir)\\n os.chdir(seqdir)\\n\\n if \\\"v\\\" in mediatype:\\n try:\\n # in order to avoid stalls in lives\\n signal.signal(signal.SIGALRM,\\n OSUtils.handler_timeout)\\n signal.alarm(video_timelimit)\\n\\n youtube_dl.YoutubeDL({}).download([url])\\n except KeyboardInterrupt:\\n raise\\n except Exception as e:\\n print(e)\\n finally:\\n signal.alarm(0)\\n\\n if \\\"i\\\" in mediatype:\\n for im in self.__urlImageGenerator(url):\\n try:\\n signal.signal(signal.SIGALRM,\\n OSUtils.handler_timeout)\\n signal.alarm(image_timelimit)\\n\\n if \\\"base64,\\\" in im:\\n continue\\n\\n lo = Text.lastocc(im, \\\"/\\\")+1\\n\\n if lo < len(im)-1:\\n output = im[Text.lastocc(im, \\\"/\\\")+1:]\\n else:\\n output = im[\\n Text.lastocc(im[:-1], \\\"/\\\")+1:-1]\\n\\n if output == \\\"\\\" or len(output) > 80:\\n output = random.randint(1, 10000000000000)\\n\\n self.__request_download(link=im,\\n output=str(output))\\n except requests.exceptions.ConnectionError as e:\\n print(e)\\n continue\\n except requests.exceptions.InvalidSchema as e:\\n print(e)\\n continue\\n except Exception as e:\\n print(e)\\n finally:\\n signal.alarm(0)\\n\\n os.chdir(directory)\\n\\n setUrls[url] = seq\\n\\n CSVUtils.write_line_b_csv(csvfile=csvset, line=[seq, url])\\n\\n print('\\\\x1b[6;30;42m' + \\\"Scrap Finished for Link \\\"\\n + str(url) + \\\" (\\\"\\n + str(round(row_count*100/total_row, 4)) + \\\"%)\\\"\\n + '\\\\x1b[0m')\\n\\n seq += 1\\n seqdir = os.path.realpath(urldir + \\\"/\\\" + str(seq))\\n\\n os.chdir(root_dir)\\n\\n except KeyboardInterrupt:\\n print(\\\"Stopping...\\\")\\n\\n JSONUtils.add_keyval_json(\\\"next_\\\"+name_scraping+\\\"Seq\\\", seq,\\n medialog_file)\\n\\n os.chdir(root_dir)\\n\\n shutil.rmtree(seqdir)\\n except Exception as e:\\n JSONUtils.add_keyval_json(\\\"next_\\\"+name_scraping+\\\"Seq\\\", seq,\\n medialog_file)\\n\\n os.chdir(root_dir)\\n\\n shutil.rmtree(seqdir)\\n print(e)\\n raise\",\n \"async def video(self, ctx, *, arg: str):\\n await ctx.send(site + self.extraire(search + self.traduire(arg.split(' ')), watch_))\",\n \"def OnPlay(self):\\r\\n # check if there is a file to play, otherwise open a\\r\\n # Tk.FileDialog to select a file\\r\\n print(\\\"1-1\\\")\\r\\n\\r\\n\\r\\n self.Media = self.Instance.media_new(self.youtube_url)\\r\\n self.player.set_media(self.Media)\\r\\n\\r\\n # set the window id where to render VLC's video output\\r\\n if platform.system() == 'Windows':\\r\\n print(\\\"1-3\\\")\\r\\n self.player.set_hwnd(self.GetHandle())\\r\\n else:\\r\\n print(\\\"1-4\\\")\\r\\n self.player.set_xwindow(self.GetHandle()) # this line messes up windows\\r\\n # FIXME: this should be made cross-platform\\r\\n\\r\\n # Try to launch the media, if this fails display an error message\\r\\n if self.player.play() == -1:\\r\\n print(\\\"1-6\\\")\\r\\n self.errorDialog(\\\"Unable to play.\\\")\",\n \"def get_all_mediafiles(user_id, params=None, fields=None):\\n fields = fields or [MediaFiles.id, MediaFiles.user_id, MediaFiles.path, MediaFiles.duration,\\n MediaFiles.size, MediaFiles.title, MediaFiles.comment, MediaFiles.tags,\\n MediaFiles.description, MediaFiles.coords, MediaFiles.location_id,\\n MediaFiles.year, MediaFiles.created, MediaFiles.imported,\\n MediaFiles.updated, MediaFiles.accessed, MediaFiles.visits]\\n query = MediaFiles.query \\\\\\n .outerjoin(Locations, MediaFiles.location_id == Locations.id) \\\\\\n .outerjoin(Users, MediaFiles.user_id == Users.id)\\n\\n year = params.get('year', 'any')\\n if year != 'any' and re.match('[1-2]{1}[0-9]{3}', year) or year == '0':\\n query = query.filter(MediaFiles.year == year)\\n\\n location = params.get('location', 'any')\\n if location != 'any':\\n query = query.filter(MediaFiles.location_id == location)\\n\\n if user_id != -1: # user_id = -1 will not apply filtering on ownership (used for statistics)\\n public = params.get('ownership_public')\\n private = params.get('ownership_private')\\n if private or public:\\n ownership = []\\n if public:\\n ownership.append(MediaFiles.user_id == 0)\\n if private:\\n ownership.append(MediaFiles.user_id == int(user_id))\\n query = query.filter(or_(*ownership))\\n else: # If none of Public/Private selected, then result must be empty\\n query = query.filter(MediaFiles.user_id == -1)\\n\\n entry = params.get('search', '').strip()\\n matching = params.get('tags_matching')\\n if entry:\\n other_matches = []\\n if params.get('search_in_path'):\\n other_matches.append(MediaFiles.path.contains(entry))\\n if params.get('search_in_title'):\\n other_matches.append(MediaFiles.title.contains(entry))\\n if params.get('search_in_description'):\\n other_matches.append(MediaFiles.description.contains(entry))\\n if params.get('search_in_comment'):\\n other_matches.append(MediaFiles.comment.contains(entry))\\n query = query.filter(or_(*other_matches))\\n # Note: tags filtering is applied if no other terms are selected\\n if params.get('search_in_tags') and not other_matches:\\n tag_matches = []\\n for tag in entry.split():\\n tag_matches.append(MediaFiles.tags.contains(tag))\\n if matching == 'strict':\\n query = query.filter(and_(*tag_matches))\\n else:\\n query = query.filter(or_(*tag_matches))\\n query = query.add_columns(*fields).order_by(func.random())\\n logging.debug('Query executed: %s' % query)\\n return query\",\n \"def test_ms_album_search(helpers):\\n item_from_xml, item_from_dict = common_tests(\\n MSAlbum,\\n MS_ALBUM_SEARCH_XML,\\n MS_ALBUM_SEARCH_DICT,\\n \\\"00020064albumsearch:de unge\\\",\\n helpers,\\n )\\n getter_attributes_test(\\n \\\"artist\\\", item_from_xml, item_from_dict, MS_ALBUM_SEARCH_DICT.get(\\\"artist\\\")\\n )\\n getter_attributes_test(\\n \\\"uri\\\", item_from_xml, item_from_dict, MS_ALBUM_SEARCH_DICT[\\\"uri\\\"]\\n )\",\n \"def play_media(self, media=None, **kwargs):\\n args = {\\\"version\\\": self.pms.version}\\n args.update(kwargs)\\n super().play_media(media, **args)\",\n \"def test_Browse(self):\\n d = Deferred()\\n\\n @wrapped(d)\\n def the_result(mediaserver):\\n cdc = mediaserver.client.content_directory\\n self.assertEqual(self.uuid, mediaserver.udn)\\n call = cdc.browse(process_result=False)\\n call.addCallback(got_first_answer, cdc)\\n\\n @wrapped(d)\\n def got_first_answer(r, cdc):\\n self.assertEqual(int(r['TotalMatches']), 1)\\n didl = DIDLLite.DIDLElement.fromString(r['Result'])\\n item = didl.getItems()[0]\\n self.assertEqual(item.childCount, 3)\\n call = cdc.browse(object_id=item.id, process_result=False)\\n call.addCallback(got_second_answer, item.childCount)\\n\\n @wrapped(d)\\n def got_second_answer(r, childcount):\\n self.assertEqual(int(r['TotalMatches']), childcount)\\n d.callback(None)\\n\\n self.coherence.ctrl.add_query(\\n DeviceQuery('uuid', self.uuid,\\n the_result, timeout=10, oneshot=True))\\n return d\",\n \"async def async_play_media(\\n self, media_type: MediaType | str, media_id: str, **kwargs: Any\\n ) -> None:\\n await self._volumio.replace_and_play(json.loads(media_id))\",\n \"def search_list(search_term, results=10):\\r\\n if search_term:\\r\\n url = SEARCH_URL.format(API_KEY, util.web.quote(search_term.encode('ascii', 'ignore')))\\r\\n response = util.web.http_get(url=url, json=True, referer='https://tinychat.com')\\r\\n\\r\\n if response['json'] is not None:\\r\\n media_list = []\\r\\n try:\\r\\n if 'items' in response['json']:\\r\\n for i, item in enumerate(response['json']['items']):\\r\\n if i == results:\\r\\n return media_list\\r\\n else:\\r\\n video_id = item['id']['videoId']\\r\\n details = video_details(video_id)\\r\\n if details is not None:\\r\\n media_info = {\\r\\n 'type': 'youTube',\\r\\n 'video_id': video_id,\\r\\n 'video_time': details['video_time'],\\r\\n 'video_title': details['video_title']\\r\\n }\\r\\n log.debug('Youtube item %s %s' % (i, media_info))\\r\\n media_list.append(media_info)\\r\\n except KeyError as ke:\\r\\n log.error(ke, exc_info=True)\\r\\n return None\",\n \"async def async_play_media(self, media_type, media_id, **kwargs):\\n if media_id.isdigit():\\n currentgallery_id = self._gallery_status[\\\"current_gallery\\\"]\\n currentitems = await self.local_meural.send_get_items_by_gallery(currentgallery_id)\\n in_playlist = next((g[\\\"title\\\"] for g in currentitems if g[\\\"id\\\"] == media_id), None)\\n if in_playlist is None:\\n# _LOGGER.warning(\\\"Item %s is not in current playlist, trying to play via remote API.\\\", media_id)\\n await self.meural.device_load_item(self.meural_device_id, media_id)\\n else:\\n# _LOGGER.warning(\\\"Item %s in current playlist %s, loading locally.\\\", media_id, self._gallery_status[\\\"current_gallery_name\\\"])\\n await self.local_meural.send_change_item(media_id)\\n else:\\n _LOGGER.warning(\\\"Can't play media: %s is not an item ID\\\", media_id)\",\n \"async def async_media_play(self) -> None:\\n await self._projector.send_command(PLAY)\",\n \"def test_XBOX_Browse(self):\\n d = Deferred()\\n\\n @wrapped(d)\\n def the_result(mediaserver):\\n\\n def my_browse(*args, **kwargs):\\n kwargs['ContainerID'] = kwargs['ObjectID']\\n del kwargs['ObjectID']\\n del kwargs['BrowseFlag']\\n kwargs['SearchCriteria'] = ''\\n return 'Search', kwargs\\n\\n #mediaserver.client.overlay_actions = {'Browse': my_browse}\\n mediaserver.client.overlay_headers = {\\n 'user-agent': 'Xbox/Coherence emulation'}\\n cdc = mediaserver.client.content_directory\\n self.assertEqual(self.uuid, mediaserver.udn)\\n call = cdc.browse(object_id='4', process_result=False)\\n call.addCallback(got_first_answer)\\n\\n @wrapped(d)\\n def got_first_answer(r):\\n \\\"\\\"\\\" we expect four audio files here \\\"\\\"\\\"\\n self.assertEqual(int(r['TotalMatches']), 4)\\n d.callback(None)\\n\\n d = Deferred()\\n self.coherence.ctrl.add_query(\\n DeviceQuery('uuid', self.uuid, the_result,\\n timeout=10, oneshot=True))\\n return d\",\n \"async def async_tracklist_via_upnp(self, media):\\n if self._upnp_device is None:\\n return\\n\\n if media == 'USB':\\n queuename = 'USBDiskQueue' # 'CurrentQueue' # 'USBDiskQueue'\\n rootdir = ROOTDIR_USB\\n else:\\n _LOGGER.debug(\\\"Tracklist retrieval: %s, %s is not supported. You can use only 'USB' for now.\\\", self.entity_id, media)\\n self._trackq = []\\n return\\n\\n self._service = self._upnp_device.service('urn:schemas-wiimu-com:service:PlayQueue:1')\\n #_LOGGER.debug(\\\"PlayQueue for: %s, UPNP service:%s\\\", self.entity_id, self._service)\\n \\n media_info = dict()\\n media_metadata = None\\n try:\\n media_info = await self._service.action(\\\"BrowseQueue\\\").async_call(QueueName=queuename)\\n media_metadata = media_info.get('QueueContext')\\n #_LOGGER.debug(\\\"PlayQueue for: %s, UPNP media_metadata:%s\\\", self.entity_id, media_info)\\n except:\\n _LOGGER.debug(\\\"PlayQueue/QueueContext UPNP error, media not present?: %s\\\", self.entity_id)\\n\\n if media_metadata is None:\\n return\\n\\n xml_tree = ET.fromstring(media_metadata)\\n\\n trackq = []\\n for playlist in xml_tree:\\n for tracks in playlist:\\n for track in tracks:\\n if track.tag == 'URL':\\n if rootdir in track.text:\\n tracku = track.text.replace(rootdir, '')\\n trackq.append(tracku)\\n\\n if len(trackq) > 0:\\n self._trackq = trackq\",\n \"def mediaGenerator(request):\\n folder = 'content/' + request\\n mediaPaths = glob(folder + '/*')\\n return random.choice(mediaPaths)\",\n \"def search(file_path):\\n search_url = 'http://www.google.hr/searchbyimage/upload'\\n multipart = {'encoded_image': (file_path, open(file_path, 'rb')), 'image_content': ''}\\n response = requests.post(search_url, files=multipart, allow_redirects=False)\\n fetch_url = response.headers['Location']\\n webbrowser.open(fetch_url)\",\n \"def similar_search(tmdb_obj, media_id):\\n res = tmdb_obj.get_recommendations(media_id)\\n if not res:\\n return []\\n return res\",\n \"def media(self, media_id):\\r\\n return Media(self, media_id)\",\n \"def OpenSoundFiles():\\n\\n wildcard = create_wildcard(\\\"Sound files\\\", sppas.src.audiodata.aio.extensionsul)\\n wildcard += '|' + create_wildcard(\\\"All files\\\", ['*', '*.*'])\\n\\n files = list()\\n dlg = wx.FileDialog(None, \\n \\\"Select sound file(s)\\\", \\n paths.samples, \\n \\\"\\\", \\n wildcard, \\n wx.FD_OPEN | wx.MULTIPLE | wx.FD_CHANGE_DIR)\\n if dlg.ShowModal() == wx.ID_OK:\\n files = dlg.GetPaths()\\n\\n dlg.Destroy()\\n\\n return files\",\n \"def demonstrate():\\n\\n api = authenticate()\\n\\n # Demonstrate upload feature.\\n # Create a list of one or more file paths of the mp3s you would like \\n # to upload\\n filepaths = []\\n filepaths.append('./song1.mp3')\\n\\n # Upload an mp3 to your library. upload() returns a tuple of information\\n # about the success or failure of uploads\\n print(\\\"Beginning upload...\\\\n\\\")\\n uploaded = api.upload(filepaths) \\n\\n # Print all successfully uploaded songs\\n if len(uploaded[0]) > 0:\\n print(\\\"Successfully uploaded:\\\")\\n i = 1\\n for key in uploaded[0]:\\n print(\\\"%d. %s\\\" % (i, key))\\n i += 1\\n\\n # Print all unsuccessfully uploaded songs and a description of why\\n # songs weren't uploaded\\n if len(uploaded[2]) == 0:\\n print(\\\"\\\\nAll songs successfully uploaded.\\\")\\n else:\\n print(\\\"Not all songs were successfully uploaded:\\\")\\n i = 1\\n for key in uploaded[2]:\\n print(\\\"%d. %s not uploaded: %s\\\" % (i, key, uploaded[2][key]))\\n i += 1\\n\\n\\n # Demonstrate download feature\\n # Get information about songs previously uploaded that are available\\n # to be downloaded\\n uploaded_songs = api.get_uploaded_songs()\\n\\n if len(uploaded_songs) == 0:\\n print(\\\"There are no songs currently available for download\\\")\\n else:\\n # Print songs that are available for download and store their ids\\n # so we can download them\\n song_ids = []\\n print(\\\"\\\\nThe following songs are available for download\\\")\\n for i in range(len(uploaded_songs)):\\n song_ids.append(uploaded_songs[i]['id'])\\n print(\\\"%d. %s\\\" % (i+1, uploaded_songs[i]['title']))\\n\\n # Download uploaded songs from your library\\n print(\\\"\\\\nBeginning download...\\\")\\n for i in range(len(song_ids)):\\n filename, audio = api.download_song(song_ids[i])\\n\\n # Write song to disk\\n with open(filename, 'wb') as f:\\n f.write(audio)\\n\\n print(\\\"%d. Written to ./%s\\\" % (i + 1, filename))\\n print(\\\"\\\\nDownload complete.\\\")\\n\\n # It's good practice to logout when finished\\n api.logout()\",\n \"def prepare_media(self):\\n start=self.get_pref('starttime')\\n stop=self.get_pref('stoptime')\\n## volume=limit(self.get_pref('volume'),0,200) # use limit() to ensure that volume pref is sensible...\\n m=self.instance.media_new(self.mrl())\\n# NONE of the following options work\\n# m=self.instance.media_new(self.mrl(),'gain=0.2')\\n## m=self.instance.media_new(self.mrl(),'sout-raop-volume=%s' % volume)\\n# m=self.instance.media_new(self.mrl(),'audio-replay-gain-mode=track','--audio-replay-gain-default=0.2')\\n if start:\\n m.add_options('start-time=%s' % start) \\n if stop:\\n m.add_options('stop-time=%s' % stop) \\n# the following test code DOES NOT WORK, though it does in cvlc at the command line, eg > cvlc my.mp3 --gain=0.2\\n# gain=\\\"1.5\\\"\\n# print \\\"SETTING GAIN for %s at %s%%\\\" % (self.uid,gain)\\n# m.add_option('gain=%s' % gain)\\n return m\",\n \"async def search(\\n user_input: str,\\n limit: int,\\n c: str,\\n g: Optional[List[str]] = Query(None),\\n p: Optional[List[str]] = Query(None),\\n):\\n genres = g\\n providers = p\\n country_code = c\\n\\n if genres and providers:\\n genre_list: List[str] = [f'genres=\\\"{genre}\\\"' for genre in genres]\\n provider_list: List[List[str]] = [\\n [f'specific_provider_names=\\\"{providers}\\\"' for providers in providers]\\n ]\\n\\n return client.index(f\\\"media_{country_code}\\\").search(\\n user_input,\\n {\\n \\\"limit\\\": limit,\\n \\\"filter\\\": genre_list + provider_list,\\n \\\"sort\\\": [\\\"popularity:desc\\\"],\\n },\\n )\\n elif genres:\\n return client.index(f\\\"media_{country_code}\\\").search(\\n user_input,\\n {\\n \\\"limit\\\": limit,\\n # This is using AND logic\\n \\\"filter\\\": [f'genres=\\\"{genre}\\\"' for genre in genres],\\n \\\"sort\\\": [\\\"popularity:desc\\\"],\\n },\\n )\\n elif providers:\\n return client.index(f\\\"media_{country_code}\\\").search(\\n user_input,\\n {\\n \\\"limit\\\": limit,\\n # This is using OR logic\\n \\\"filter\\\": [\\n [\\n f'specific_provider_names=\\\"{providers}\\\"'\\n for providers in providers\\n ]\\n ],\\n \\\"sort\\\": [\\\"popularity:desc\\\"],\\n },\\n )\\n return client.index(f\\\"media_{country_code}\\\").search(\\n user_input, {\\\"limit\\\": limit, \\\"sort\\\": [\\\"popularity:desc\\\"]}\\n )\",\n \"def search(search_term):\\r\\n if search_term:\\r\\n if 'list' in search_term:\\r\\n search_term = search_term.split('?list')[0]\\r\\n\\r\\n url = SEARCH_URL.format(API_KEY, util.web.quote(search_term.encode('ascii', 'ignore')))\\r\\n response = util.web.http_get(url=url, json=True, referer='http://tinychat.com')\\r\\n\\r\\n if response['json'] is not None:\\r\\n try:\\r\\n if 'items' in response['json']:\\r\\n for item in response['json']['items']:\\r\\n video_id = item['id']['videoId']\\r\\n details = video_details(video_id)\\r\\n if details is not None:\\r\\n return {\\r\\n 'type': 'youTube',\\r\\n 'video_id': video_id,\\r\\n 'video_time': details['video_time'],\\r\\n 'video_title': details['video_title']\\r\\n }\\r\\n except KeyError as ke:\\r\\n log.error(ke, exc_info=True)\\r\\n return None\",\n \"def __searchOpenFiles(self):\\n self.ui.showFindFilesDialog(self.textForFind(), openFiles=True)\",\n \"def search():\\n\\tif not request.vars.search_term:\\n\\t\\tredirect(URL('index'))\\n\\tterm = request.vars.search_term\\n\\torigterm = term\\n\\tterm = term.replace(' ','|')\\n\\tartists = db.executesql(\\\"select distinct(m1.id), m1.art_name, m1.artist_type, m1.country, m1.b_year,m1.b_month,m1.b_date,m1.e_year,m1.e_month,m1.e_day,ts_rank(to_tsvector(m1.art_name),to_tsquery('\\\"+term+\\\"')) rank from art_info m1 where to_tsvector('english',m1.art_name) @@ to_tsquery('\\\"+term+\\\"') order by rank desc limit 20;\\\")\\n\\talbums = db.executesql(\\\"select distinct(m1.id),m2.name,m1.art_id,m1.art_name,m1.rel_type,m1.count,ts_rank(to_tsvector(m2.name),to_tsquery('\\\"+term+\\\"')) rank from rel_art m1, release_name m2, release_group m3 where m3.name = m2.id and m3.id = m1.id and to_tsvector('english',m2.name) @@ to_tsquery('\\\"+term+\\\"') order by rank desc limit 20;\\\")\\n\\tsongs = db.executesql(\\\"select m2.id, m1.name, m3.art_id, m3.art_name, m3.rel_id, m3.rel_name from track_name m1, recording m2, rec_rel_art m3 where m1.id = m2.name and m2.id = m3.rec_id and lower(m1.name) LIKE lower('%%\\\"+origterm+\\\"%%') limit 20;\\\")\\n\\treturn dict(songs=songs, albums=albums, artists=artists)\",\n \"def LibThread(q):\\n os.nice(1)\\n time.sleep(0)\\n library = cmus.library()\\n cache = cmus.Cache()\\n liblist = {}\\n # BUG: newly added tracks don't appear in the listing as they aren't recorded\\n # neither in the cache nor in the library.pl\\n # TODO: report progress values, maybe even return partial results?\\n for track in cache:\\n # allow other thread to jump in\\n time.sleep(0)\\n try:\\n q.get_nowait()\\n q.task_done()\\n return False\\n except Queue.Empty:\\n pass\\n\\n try:\\n del library[library.index(track['file'])]\\n except ValueError:\\n # file is in cache but not in library\\n continue\\n\\n # use dummy values if no value given\\n artist = track['albumartist'] if track.has_key('albumartist') and track['albumartist'] != '' \\\\\\n else track['artist'] if track.has_key('artist') and track['artist'] != '' \\\\\\n else '[unknown]'\\n\\n album = track['album'] if track.has_key('album') and track['album'] != '' \\\\\\n else '[unknown]'\\n\\n title = track['title'] if track.has_key('title') and track['title'] != '' \\\\\\n else os.path.basename(track['file']).rsplit('.', 1)[0]\\n\\n if not liblist.has_key(artist):\\n liblist[artist] = {}\\n if not liblist[artist].has_key(album):\\n liblist[artist][album] = {}\\n liblist[artist][album][title] = track\\n\\n # TODO: get files not in cache manually\\n # (hint: library contains their paths now)\\n\\n def sorter(x):\\n ref = liblist[artist][album][x]\\n if ref.has_key('tracknumber') and ref['tracknumber'] != 0:\\n return ref['tracknumber']\\n elif ref.has_key('title') and ref['title'] != '':\\n return ref['title']\\n else:\\n return 0\\n\\n for artist in liblist.keys():\\n for album in liblist[artist].keys():\\n # sort by tracknumber if existant, title else\\n liblist[artist][album]['__keys__'] = \\\\\\n sorted(liblist[artist][album].keys(), key=sorter)\\n liblist[artist]['__keys__'] = sorted(liblist[artist].keys(), key=str.lower)\\n liblist['__keys__'] = sorted(liblist.keys(), key=str.lower)\\n q.put(liblist)\",\n \"def getMediaFiles(path):\\n fileList = getMediaFileList(path)\\n # dirList = getDirectoryList(path)\\n\\n # results = map(getMediaFiles, dirList)\\n\\n # for result in results:\\n # fileList = fileList + result\\n\\n return fileList\",\n \"def index(request):\\n\\n main_menu = [\\n (\\n buildUrl(request.basePath(), {\\\"path\\\": \\\"/search\\\"}),\\n xbmcgui.ListItem(\\n label=xbmcaddon.Addon().getLocalizedString(30009),\\n iconImage=getMediaResource(\\\"search.png\\\"),\\n path=buildUrl(request.basePath(), {\\\"path\\\": \\\"/search\\\"})\\n ),\\n True\\n ),\\n (\\n buildUrl(request.basePath(), {\\\"path\\\": \\\"/categories\\\"}),\\n xbmcgui.ListItem(label=xbmcaddon.Addon().getLocalizedString(30014)),\\n True\\n ),\\n (\\n buildUrl(request.basePath(), {\\\"path\\\": \\\"/list_movies/latest\\\"}),\\n xbmcgui.ListItem(label=xbmcaddon.Addon().getLocalizedString(30015)),\\n True\\n ),\\n ]\\n\\n # Add all items at once - this should be faster than adding one by one.\\n xbmcplugin.addDirectoryItems(request.handle(), main_menu)\\n xbmcplugin.addSortMethod(request.handle(), xbmcplugin.SORT_METHOD_NONE)\\n xbmcplugin.endOfDirectory(request.handle(), succeeded=True)\",\n \"def show_medias():\\n t0 = time.time()\\n print(f\\\"--- {request}\\\")\\n print(f\\\"--- {user_session}\\\")\\n # Set context by owner and the data selections\\n u_context = UserContext(user_session, current_user, request)\\n # Which range of data is shown\\n u_context.set_scope_from_request(request, \\\"media_scope\\\")\\n u_context.count = 20\\n\\n with MediaReader(\\\"read\\\", u_context) as service:\\n # datareader = MediaReader(readservice, u_context)\\n res = service.read_my_media_list()\\n\\n if Status.has_failed(res, False):\\n flash(f'{res.get(\\\"statustext\\\",\\\"error\\\")}', \\\"error\\\")\\n medias = res.get(\\\"items\\\", [])\\n\\n stk_logger(u_context, f\\\"-> bp.scene.media.show_medias fw n={len(medias)}\\\")\\n return render_template(\\n \\\"/scene/medias.html\\\",\\n medias=medias,\\n user_context=u_context,\\n elapsed=time.time() - t0,\\n )\",\n \"def testMediaUpload(self):\\n self._testUpload(DefaultStorage(), 'media')\\n self._testUpload(StaticStorage(), 'static')\",\n \"def playListMode(self):\\n print(\\\"[b blue]PlayList mode[/]\\\")\\n while True:\\n url = qr.text(\\n \\\"Enter the URL for the PlayList:\\\", qmark=\\\"*\\\", multiline=True\\n ).ask()\\n\\n try:\\n requests.get(url)\\n # resp.status_code\\n except requests.ConnectionError as e:\\n print(e)\\n return\\n else:\\n print(\\\"URL validated successfully!\\\")\\n break\\n\\n pathForSong = qr.path(\\n \\\"Select the Folder to which you want to download the songs:\\\",\\n only_directories=True,\\n ).ask()\",\n \"def album_search(query, term):\\n table = Album.__table__\\n search_statement = or_(\\n table.c.name.ilike('%' + term + '%'),\\n cast(table.c.release_date, Text).ilike('%' + term + '%'),\\n table.c.image.ilike('%' + term + '%'),\\n table.c.label.ilike('%' + term + '%'),\\n table.c.tracks.ilike('%' + term + '%'),\\n table.c.spotify_uri.ilike('%' + term + '%'),\\n cast(table.c.id, Text).ilike('%' + term + '%'))\\n return query.filter(search_statement)\",\n \"def search(self):\\r\\n return resources.Search(self)\",\n \"def medias(self):\\n ret = {}\\n m = self.application_tree['medias']\\n for k, v in six.iteritems(m):\\n ret[k] = media.Media(k, v)\\n return ret\",\n \"def manage_library(action):\\n albums = tracked_albums()\\n\\n # Setting function to call and message to print\\n if action == 'add':\\n func = LocalLibrary.add\\n prt = action + ' to'\\n elif action == 'remove':\\n func = LocalLibrary.remove\\n prt = action + ' from'\\n else:\\n return None\\n\\n ids = input('\\\\nType ID numbers of albums you want to {} download list\\\\n'\\n '(comma separated, leave empty to cancel):\\\\n>> '.format(prt))\\n if ids is not '':\\n ids = ids.split(',')\\n for i in ids:\\n # Handling exception - user gives not int or not a number...\\n try:\\n if int(i) > 0: # need to be here! list accepts negative indexes\\n func(library, albums[int(i)-1].id)\\n except (ValueError, IndexError):\\n pass\\n os.system('cls')\\n tracked_albums()\",\n \"def test_add_media_type(self):\\n\\n # check if documentalist has access to create new media-types\\n self.login_documentalist()\\n response = self.client.get('/multimedia/media-type/new' )\\n\\n # 403 = unauthorized\\n self.assertEqual(response.status_code, 403)\\n\\n self.client.logout()\\n self.login_admin()\\n\\n form_data = {\\n 'status': '0',\\n 'acronym': 'foto',\\n 'name': 'Foto',\\n 'language' : 'pt-br',\\n 'mediatypelocal_set-TOTAL_FORMS': '0',\\n 'mediatypelocal_set-INITIAL_FORMS': '0',\\n }\\n\\n response = self.client.post('/multimedia/media-type/new', form_data, follow=True )\\n\\n self.assertRedirects(response, '/multimedia/media-types')\\n self.assertContains(response, \\\"Foto\\\")\",\n \"def search_cli(sys_arguments):\\r\\n\\r\\n cursor = connection.cursor()\\r\\n\\r\\n # The arrays storing the results of the SQL entries for each of the entries' contents\\r\\n valid_title_files = []\\r\\n valid_artist_files = []\\r\\n valid_album_files = []\\r\\n valid_release_year_files = []\\r\\n valid_tags_files = []\\r\\n\\r\\n for index in range(len(sys_arguments) - 2):\\r\\n if sys_arguments[index + 2].startswith(\\\"title=\\\"): # The user has specified a custom criterion for the title\\r\\n cursor.execute(\\\"SELECT full_path FROM media WHERE INSTR(title, \\\" + \\\"\\\\\\\"\\\" + sys_arguments[index + 2][6:]\\r\\n + \\\"\\\\\\\"\\\" + \\\") > 0\\\")\\r\\n\\r\\n for i in cursor.fetchall(): # Updating the corresponding list using the cursor result\\r\\n if os.path.dirname(i[0]) == media_folder:\\r\\n valid_title_files.append(i[0])\\r\\n\\r\\n # The user has specified a custom criterion for the artist\\r\\n if sys_arguments[index + 2].startswith(\\\"artist=\\\"):\\r\\n cursor.execute(\\r\\n \\\"SELECT full_path FROM media WHERE INSTR(artist, \\\" + \\\"\\\\\\\"\\\" + sys_arguments[index + 2][7:] +\\r\\n \\\"\\\\\\\") > 0\\\")\\r\\n\\r\\n for i in cursor.fetchall(): # Updating the corresponding list using the cursor result\\r\\n if os.path.dirname(i[0]) == media_folder:\\r\\n valid_artist_files.append(i[0])\\r\\n\\r\\n if sys_arguments[index + 2].startswith(\\\"album=\\\"): # The user has specified a custom criterion for the album\\r\\n cursor.execute(\\r\\n \\\"SELECT full_path FROM media WHERE album = \\\" + \\\"\\\\\\\"\\\" + sys_arguments[index + 2][6:] + \\\"\\\\\\\"\\\")\\r\\n\\r\\n for i in cursor.fetchall(): # Updating the corresponding list using the cursor result\\r\\n if os.path.dirname(i[0]) == media_folder:\\r\\n valid_album_files.append(i[0])\\r\\n\\r\\n # The user has specified a custom criterion for the release year\\r\\n if sys_arguments[index + 2].startswith(\\\"release_year=\\\"):\\r\\n cursor.execute(\\r\\n \\\"SELECT full_path FROM media WHERE release_date = \\\" + \\\"\\\\\\\"\\\" + sys_arguments[index + 2][13:]\\r\\n + \\\"\\\\\\\"\\\")\\r\\n\\r\\n for i in cursor.fetchall(): # Updating the corresponding list using the cursor result\\r\\n if os.path.dirname(i[0]) == media_folder:\\r\\n valid_release_year_files.append(i[0])\\r\\n\\r\\n if sys_arguments[index + 2].startswith(\\\"tags=\\\"): # The user has specified a custom criterion for the tags\\r\\n tags_list = sys_arguments[index + 2][5:].replace('\\\\\\\"', '').replace(' ', '').split(\\\",\\\")\\r\\n\\r\\n for tag in tags_list:\\r\\n cursor.execute(\\\"SELECT full_path FROM media WHERE INSTR(tags, \\\\\\\"\\\" + tag + \\\"\\\\\\\") > 0\\\")\\r\\n\\r\\n for i in cursor.fetchall(): # Updating the corresponding list using the cursor result\\r\\n if os.path.dirname(i[0]) == media_folder:\\r\\n valid_tags_files.append(i[0])\\r\\n\\r\\n # We are now performing intersection operation for each of the lists in order display only the files that match\\r\\n # every criterion passed by the user\\r\\n files = intersection(intersection(intersection(intersection(valid_title_files, valid_artist_files),\\r\\n valid_album_files), valid_release_year_files), valid_tags_files)\\r\\n\\r\\n if not files:\\r\\n print(\\\"\\\\nNo results.\\\")\\r\\n else:\\r\\n for i in files:\\r\\n print(\\\"\\\\n\\\" + i)\",\n \"def open_my_playlist(self):\\n com_util.tap_on(self.driver, element['Music'])\\n com_util.tap_on(self.driver, element['MyPlaylist'])\\n com_util.tap_on(self.driver, element['ClickMySongs'])\",\n \"async def async_media_play(self) -> None:\\n await self._volumio.play()\",\n \"def search(q):\\n if q in DB.SEARCH_CACHE.keys():\\n return DB.SEARCH_CACHE[q]\\n else:\\n DB.SEARCH_CACHE[q] = {}\\n for k, v in DB.MUSIC.iteritems():\\n if v.is_like(q):\\n DB.SEARCH_CACHE[q][v.uuid] = v.__dict__\\n for k, v in DB.VIDEOS.iteritems():\\n if v.is_like(q):\\n DB.SEARCH_CACHE[q][v.uuid] = v.__dict__\\n for k, v in DB.IMAGES.iteritems():\\n if v.is_like(q):\\n DB.SEARCH_CACHE[q][v.uuid] = v.__dict__\\n return DB.SEARCH_CACHE[q]\",\n \"def play_song(self):\\r\\n path = input('Give path to wanted song: ') # Request path to song\\r\\n path = path.replace('\\\\\\\\', '/')\\r\\n if not self.path_storage_re.match(path): # Check if the wanted song is from the storage directory\\r\\n print(\\\"Give a valid path\\\")\\r\\n else:\\r\\n p = vlc.MediaPlayer(path) # Create VLC instance and play the song\\r\\n p.play()\\r\\n self.playSong.append(p)\\r\\n self.isPlaying = True\",\n \"def sync_media(c, environment):\\n env = c.config[environment]\\n settings.configure()\\n current_settings = _get_settings_file()\\n c.run(\\n 'echo Getting media files from {}...'.format(env.verbose_name)\\n )\\n c.run(\\n 'rsync -avz --rsh=\\\"ssh\\\" {remote_user}@{remote_host}:'\\n '{remote_folder}/ {media_root}/'.format(\\n remote_user=env.user,\\n remote_host=env.hosts,\\n remote_folder=env.media_path.rstrip('/'),\\n media_root=settings.MEDIA_ROOT.rstrip('/')\\n )\\n )\",\n \"async def search_magnets(query, page, type_):\\n\\n def parse_url(url):\\n \\\"\\\"\\\"\\n Parse url, either a magnet or a normal url.\\n Returns the query string and the torrent title\\n\\n returns url, torrenttitle\\n \\\"\\\"\\\"\\n url = urllib.parse.urlparse(url)\\n query = urllib.parse.parse_qs(url.query)\\n query_ = query.get('dn', query.get('title', ''))[0]\\n if url.scheme == \\\"magnet\\\":\\n return \\\"magnet:?xt={}\\\".format(query['xt'][0]), query_\\n return \\\"http://{}{}{}\\\".format(*url[0:3]), query_\\n\\n with aiohttp.ClientSession() as session:\\n url = 'https://kickasstorrents.to/usearch/{}/{}/'.format(query, page)\\n async with session.get(url) as response:\\n assert response.status == 200\\n iter_ = TYPES[type_].finditer(\\n await response.text(), re.IGNORECASE)\\n return [parse_url(url.group(0)[1:-1]) for url in iter_]\",\n \"def search(self, what, cat='all'):\\n # Sign in:\\n if self.search_auth:\\n self._sign_in()\\n opener = self.opener\\n else:\\n opener = urllib2.build_opener(urllib2.BaseHandler())\\n ret = []\\n page = 0\\n while page < self.PAGE_NUMBER:\\n results = []\\n parser = self.FilelistParser(results, self.url)\\n url = self.url+'/browse.php?search=%s&cat=%s&searchin=0&sort=0&page=%d'%(what, self.supported_categories[cat], page)\\n f = opener.open(url)\\n dat = f.read().decode('iso-8859-1', 'replace')\\n results_re = re.compile(\\\"(?s)<div class='cblock-innercontent'>.*\\\")\\n for match in results_re.finditer(dat):\\n res_tab = match.group(0)\\n parser.feed(res_tab)\\n parser.close()\\n break\\n if len(results) <= 0:\\n break\\n page += 1\",\n \"def get_tracks(self):\\n artist = self.get_request_arg(\\\"artist\\\")\\n album = self.get_request_arg(\\\"album\\\")\\n if not (album and artist):\\n return self.resp_from_data(\\n {\\\"message\\\": \\\"Please specify a valid artist and album\\\"}, 403)\\n else:\\n tracks = self.ctrl.library.get_tracks(artist, album)\\n return self.resp_from_data(tracks)\",\n \"def extract_media_v1(data):\\n user = data[\\\"user\\\"]\\n location = data.get(\\\"location\\\")\\n if location:\\n location = {\\\"pk\\\": int(location.get(\\\"pk\\\")), \\\"name\\\": location.get(\\\"name\\\")}\\n video_url = \\\"\\\"\\n if \\\"video_versions\\\" in data:\\n # Select Best Quality by Resolutiuon\\n video_url = sorted(\\n data[\\\"video_versions\\\"], key=lambda o: o[\\\"height\\\"] * o[\\\"width\\\"]\\n ).pop()[\\\"url\\\"]\\n product_type = data.get(\\\"product_type\\\", \\\"\\\")\\n if data[\\\"media_type\\\"] == 2 and not product_type:\\n product_type = \\\"feed\\\"\\n thumbnail_url = ''\\n if 'image_versions2' in data:\\n thumbnail_url = sorted(\\n data[\\\"image_versions2\\\"][\\\"candidates\\\"],\\n key=lambda o: o[\\\"height\\\"] * o[\\\"width\\\"],\\n ).pop()[\\\"url\\\"]\\n return {\\n \\\"pk\\\": int(data[\\\"pk\\\"]),\\n \\\"taken_at\\\": int(data[\\\"taken_at\\\"]),\\n \\\"id\\\": data[\\\"id\\\"],\\n \\\"media_type\\\": data[\\\"media_type\\\"],\\n \\\"product_type\\\": product_type,\\n \\\"code\\\": data[\\\"code\\\"],\\n \\\"thumbnail_url\\\": thumbnail_url,\\n \\\"location\\\": location,\\n \\\"user\\\": extract_user_short(user),\\n \\\"comment_count\\\": int(data.get(\\\"comment_count\\\") or 0),\\n \\\"like_count\\\": int(data.get(\\\"like_count\\\") or 0), # the media just published has no like_count\\n \\\"caption_text\\\": json_value(data, \\\"caption\\\", \\\"text\\\", default=\\\"\\\"),\\n \\\"usertags\\\": [\\n extract_usertag(usertag)\\n for usertag in data.get(\\\"usertags\\\", {}).get(\\\"in\\\", [])\\n ],\\n \\\"video_url\\\": video_url,\\n \\\"view_count\\\": int(data.get('view_count') or 0),\\n \\\"video_duration\\\": data.get('video_duration'),\\n \\\"title\\\": data.get(\\\"title\\\") or None,\\n \\\"resources\\\": [\\n extract_resource_v1(edge)\\n for edge in data.get('carousel_media', [])\\n ]\\n }\",\n \"def get(self):\\n mb = MusicbrainzClient()\\n query = self.get_argument('q')\\n artists, tracks = yield [mb.search_artists(query),\\n mb.search_tracks(query)]\\n data = {\\n 'artists': [\\n {\\n 'id': artist['id'],\\n 'artist': artist['name'],\\n 'note': artist.get('disambiguation', '')\\n }\\n for artist in artists['artist-list']\\n ],\\n 'tracks': [\\n {\\n 'id': track['id'],\\n 'title': track['title'],\\n 'artist': track['artist-credit-phrase']\\n }\\n for track in tracks['recording-list']\\n ]\\n }\\n self.finish(data)\",\n \"async def async_locate(self, **kwargs: Any) -> None:\\n await self._vacuum_bot.execute_command(PlaySound())\",\n \"def load_interface(self):\\r\\n\\r\\n self.display_media_folder()\\r\\n\\r\\n if media_folder != \\\"\\\":\\r\\n self.folder_scan()\\r\\n\\r\\n self.add_music_button.grid(row=0, column=0, padx=10, pady=20)\\r\\n self.create_savelist_button.grid(row=0, column=1, padx=10, pady=20)\\r\\n self.quit_button.grid(row=0, column=2, padx=10, pady=20)\",\n \"def _searchOnTitle(self, title, media, quality, results, offset=0):\\n try:\\n params = {\\n 'cid': 210, # Movie/Video category\\n 'offset': offset,\\n 'limit': T411.limit\\n }\\n url = self.urls['search'].format(simplifyString(title),\\n tryUrlencode(params))\\n data = self.getJsonData(url, headers=self.headers)\\n self.checkError(data)\\n now = datetime.now()\\n for torrent in data['torrents']:\\n category = int(torrent['category'])\\n # Filter on animations, movies & documentaries\\n if category in [455, 631, 634]:\\n added = datetime.strptime(torrent['added'],\\n '%Y-%m-%d %H:%M:%S')\\n # Convert size from byte to kilobyte\\n size = int(torrent['size'])/1024\\n id_ = int(torrent['id'])\\n result = {\\n 'id': id_,\\n 'name': torrent['name'],\\n 'seeders': int(torrent['seeders']),\\n 'leechers': int(torrent['leechers']),\\n 'size': self.parseSize(str(size)+self.size_kb[0]),\\n 'age': (now - added).days,\\n 'url': self.urls['url'].format(id_),\\n 'detail_url': self.urls['detail_url'].format(id_),\\n 'verified': bool(int(torrent['isVerified'])),\\n 'get_more_info': self.getMoreInfo,\\n 'extra_check': self.extraCheck\\n }\\n T411.log.debug('{0}|{1}'.format(result.get('id'),\\n simplifyString(result.get('name'))))\\n results.append(result)\\n # Get next page if we don't have all results\\n if int(data['total']) > len(data['torrents'])+offset:\\n self._searchOnTitle(title, media, quality, results,\\n offset+T411.limit)\\n except:\\n T411.log.error('Failed searching release from {0}: {1}'.\\n format(self.getName(), traceback.format_exc()))\",\n \"def searchImage(text):\\n creds = None\\n # The file token.json stores the user's access and refresh tokens, and is\\n # created automatically when the authorization flow completes for the first\\n # time.\\n if os.path.exists('token.json'):\\n creds = Credentials.from_authorized_user_file('token.json', SCOPES)\\n # If there are no (valid) credentials available, let the user log in.\\n if not creds or not creds.valid:\\n if creds and creds.expired and creds.refresh_token:\\n creds.refresh(Request())\\n else:\\n flow = InstalledAppFlow.from_client_secrets_file(\\n 'credentials.json', SCOPES)\\n creds = flow.run_local_server(port=0)\\n # Save the credentials for the next run\\n with open('token.json', 'w') as token:\\n token.write(creds.to_json())\\n\\n service = build('drive', 'v3', credentials=creds)\\n\\n results_length = 0\\n results_message = []\\n nextPageToken = \\\"first\\\"\\n flex_dict = {\\n \\\"type\\\": \\\"carousel\\\",\\n \\\"contents\\\": []\\n }\\n\\n with open(\\\"episode_info.json\\\", 'r', encoding=\\\"utf-8\\\") as f:\\n episode_info = json.load(f)\\n\\n # imageFolder: https://drive.google.com/drive/u/0/folders/1CH7i08P4NK0WkhASe4_qs92fsL2Mz0tM\\n\\n while nextPageToken != []:\\n if nextPageToken == \\\"first\\\":\\n results = service.files().list(q=\\\"'1CH7i08P4NK0WkhASe4_qs92fsL2Mz0tM' in parents and fullText contains '{}'\\\".format(text), pageSize=1000,\\n fields=\\\"nextPageToken, files(id, name)\\\").execute()\\n else:\\n results = service.files().list(q=\\\"'1CH7i08P4NK0WkhASe4_qs92fsL2Mz0tM' in parents and fullText contains '{}'\\\".format(text), pageSize=1000, pageToken=nextPageToken,\\n fields=\\\"nextPageToken, files(id, name)\\\").execute()\\n items = results.get('files', [])\\n nextPageToken = results.get('nextPageToken', [])\\n print(len(items))\\n for item in items:\\n img_url = \\\"https://lh3.googleusercontent.com/d/{}=w1080\\\".format(\\n item['id'])\\n # print(u'{0} ({1})'.format(item['name'], img_url))\\n\\n positino_left_brackets = item['name'].find(\\\"【\\\")\\n position_right_brackets = item['name'].find(\\\"】\\\")\\n position_dot = item['name'].find(\\\".jpg\\\")\\n img_episode = item['name'][positino_left_brackets +\\n 1:position_right_brackets]\\n img_title = item['name'][position_right_brackets+1:position_dot]\\n if img_title.find(text) != -1:\\n results_length += 1\\n if len(flex_dict[\\\"contents\\\"]) < 12:\\n try:\\n esfio = episode_info[img_episode][\\\"Every Spongebob Frame In Order\\\"]\\n chn_episode_title = episode_info[img_episode][\\\"中文集數名稱\\\"]\\n eng_episode_title = episode_info[img_episode][\\\"英文集數名稱\\\"]\\n except:\\n pass\\n\\n new_bubble_flex_message = {}\\n\\n with open(\\\"bubble_flex_message.json\\\", \\\"r\\\", encoding='utf-8') as f:\\n new_bubble_flex_message = json.load(f)\\n\\n new_bubble_flex_message[\\\"hero\\\"][\\\"url\\\"] = img_url\\n new_bubble_flex_message[\\\"body\\\"][\\\"contents\\\"][0][\\\"contents\\\"][0][\\\"text\\\"] = img_title\\n new_bubble_flex_message[\\\"body\\\"][\\\"contents\\\"][1][\\\"contents\\\"][0][\\\"contents\\\"][1][\\\"text\\\"] = img_episode\\n new_bubble_flex_message[\\\"body\\\"][\\\"contents\\\"][1][\\\"contents\\\"][1][\\\"contents\\\"][1][\\\"text\\\"] = esfio\\n new_bubble_flex_message[\\\"body\\\"][\\\"contents\\\"][1][\\\"contents\\\"][2][\\\"contents\\\"][1][\\\"text\\\"] = chn_episode_title\\n new_bubble_flex_message[\\\"body\\\"][\\\"contents\\\"][1][\\\"contents\\\"][3][\\\"contents\\\"][1][\\\"text\\\"] = eng_episode_title\\n new_bubble_flex_message[\\\"footer\\\"][\\\"contents\\\"][0][\\\"action\\\"][\\\"data\\\"] = \\\"傳\\\" + img_url\\n new_bubble_flex_message[\\\"footer\\\"][\\\"contents\\\"][1][\\\"action\\\"][\\\"uri\\\"] = img_url\\n\\n flex_dict[\\\"contents\\\"].append(new_bubble_flex_message)\\n if len(flex_dict[\\\"contents\\\"]) == 12:\\n if len(results_message) < 5:\\n results_message.append(FlexSendMessage(\\n alt_text=\\\"搜尋結果\\\",\\n contents=flex_dict)\\n )\\n if len(results_message) == 5:\\n print(\\\"len(results_message)1: \\\", len(results_message))\\n return {\\\"length\\\": results_length, \\\"top5_url_list\\\": results_message}\\n flex_dict[\\\"contents\\\"] = []\\n if nextPageToken == []:\\n if len(flex_dict[\\\"contents\\\"]) != 0:\\n if len(results_message) < 5:\\n results_message.append(FlexSendMessage(\\n alt_text=\\\"搜尋結果\\\",\\n contents=flex_dict)\\n )\\n print(\\\"len(results_message)2: \\\", len(results_message))\\n return {\\\"length\\\": results_length, \\\"top5_url_list\\\": results_message}\\n\\n print(\\\"len(results_message)3: \\\", len(results_message))\\n return {\\\"length\\\": results_length, \\\"top5_url_list\\\": results_message}\",\n \"def listall(self):\\n list_query = \\\"\\\"\\\"SELECT * FROM %s\\\"\\\"\\\" % MediaCollection.COLLECTIONS_TABLE\\n self.cursor.execute(list_query)\\n return [Media.fromtuple(media) for media in self.cursor.fetchall()]\",\n \"async def bingvideo(self, *, text):\\n settings = loadauth()\\n operation = 'videosearch'\\n if settings['apikey'] == '' or settings['apikey'] == 'blank':\\n return await self.bot.say(\\\"Missing or incorrect API key. Please \\\" +\\n \\\"contact the owner to add an API key.\\\")\\n apikey = settings['apikey']\\n text, limit = self.limitget(text)\\n result = self.getfrombing(apikey, text, limit, operation)\\n bottext = self.obtainresult(result, operation)\\n return await self.bot.say(bottext)\",\n \"def media(self, req):\\n first_part = req.path_info_peek()\\n if first_part in self.media_paths:\\n req.path_info_pop()\\n path = self.media_paths[first_part]\\n else:\\n path = resource_filename(\\\"weberror\\\", \\\"eval-media\\\")\\n app = urlparser.StaticURLParser(path)\\n return app\",\n \"def wikimedia_request(search_term, continue_val):\\n S = requests.Session()\\n\\n URL = \\\"https://en.wikipedia.org/w/api.php\\\"\\n\\n # SEARCHPAGE = \\\"matrix\\\"\\n\\n PARAMS = {\\n \\\"action\\\": \\\"query\\\",\\n \\\"format\\\": \\\"json\\\",\\n \\\"list\\\": \\\"search\\\",\\n \\\"srsearch\\\": search_term,\\n \\\"srlimit\\\": 400\\n }\\n if continue_val:\\n PARAMS.update(continue_val)\\n R = S.get(url=URL, params=PARAMS).json()\\n return R\"\n]","isConversational":false},"negative_scores":{"kind":"list like","value":["0.668259","0.61301744","0.60395354","0.59826845","0.5969798","0.59561574","0.57918155","0.5790495","0.57535","0.57049066","0.56371135","0.55711895","0.55135405","0.54885805","0.54820323","0.5427746","0.54237807","0.5411913","0.54091287","0.5393908","0.53881943","0.53611827","0.53305966","0.5329709","0.5288691","0.527122","0.52511525","0.5251083","0.5232354","0.52287424","0.5209604","0.5187351","0.5183585","0.5170095","0.5163278","0.5120803","0.50931877","0.5083823","0.5048015","0.5043585","0.50380194","0.50314","0.50236946","0.501775","0.501503","0.4968334","0.4961344","0.49596927","0.495877","0.4952404","0.49509746","0.49507666","0.49405527","0.4937945","0.4925752","0.49216175","0.49206758","0.49010694","0.4899019","0.4897168","0.48932275","0.48921576","0.48902753","0.4884053","0.48835203","0.48821586","0.48609596","0.48582262","0.48557258","0.48512143","0.48494014","0.48469087","0.4844852","0.4843893","0.48405668","0.48353964","0.4833124","0.48299232","0.4826649","0.4825397","0.48190638","0.48186857","0.4818081","0.481791","0.4817803","0.48115456","0.48075333","0.48023438","0.47965437","0.47957948","0.47882044","0.47872713","0.47870547","0.47816545","0.4778481","0.47710058","0.47543836","0.47495744","0.4746377","0.47461432","0.47415298"],"string":"[\n \"0.668259\",\n \"0.61301744\",\n \"0.60395354\",\n \"0.59826845\",\n \"0.5969798\",\n \"0.59561574\",\n \"0.57918155\",\n \"0.5790495\",\n \"0.57535\",\n \"0.57049066\",\n \"0.56371135\",\n \"0.55711895\",\n \"0.55135405\",\n \"0.54885805\",\n \"0.54820323\",\n \"0.5427746\",\n \"0.54237807\",\n \"0.5411913\",\n \"0.54091287\",\n \"0.5393908\",\n \"0.53881943\",\n \"0.53611827\",\n \"0.53305966\",\n \"0.5329709\",\n \"0.5288691\",\n \"0.527122\",\n \"0.52511525\",\n \"0.5251083\",\n \"0.5232354\",\n \"0.52287424\",\n \"0.5209604\",\n \"0.5187351\",\n \"0.5183585\",\n \"0.5170095\",\n \"0.5163278\",\n \"0.5120803\",\n \"0.50931877\",\n \"0.5083823\",\n \"0.5048015\",\n \"0.5043585\",\n \"0.50380194\",\n \"0.50314\",\n \"0.50236946\",\n \"0.501775\",\n \"0.501503\",\n \"0.4968334\",\n \"0.4961344\",\n \"0.49596927\",\n \"0.495877\",\n \"0.4952404\",\n \"0.49509746\",\n \"0.49507666\",\n \"0.49405527\",\n \"0.4937945\",\n \"0.4925752\",\n \"0.49216175\",\n \"0.49206758\",\n \"0.49010694\",\n \"0.4899019\",\n \"0.4897168\",\n \"0.48932275\",\n \"0.48921576\",\n \"0.48902753\",\n \"0.4884053\",\n \"0.48835203\",\n \"0.48821586\",\n \"0.48609596\",\n \"0.48582262\",\n \"0.48557258\",\n \"0.48512143\",\n \"0.48494014\",\n \"0.48469087\",\n \"0.4844852\",\n \"0.4843893\",\n \"0.48405668\",\n \"0.48353964\",\n \"0.4833124\",\n \"0.48299232\",\n \"0.4826649\",\n \"0.4825397\",\n \"0.48190638\",\n \"0.48186857\",\n \"0.4818081\",\n \"0.481791\",\n \"0.4817803\",\n \"0.48115456\",\n \"0.48075333\",\n \"0.48023438\",\n \"0.47965437\",\n \"0.47957948\",\n \"0.47882044\",\n \"0.47872713\",\n \"0.47870547\",\n \"0.47816545\",\n \"0.4778481\",\n \"0.47710058\",\n \"0.47543836\",\n \"0.47495744\",\n \"0.4746377\",\n \"0.47461432\",\n \"0.47415298\"\n]","isConversational":false},"document_score":{"kind":"string","value":"0.0"},"document_rank":{"kind":"string","value":"-1"}}},{"rowIdx":10193,"cells":{"query":{"kind":"string","value":"Query PMS for all clients connected to PMS."},"document":{"kind":"string","value":"def clients(self):\n items = []\n for elem in self.query('/clients'):\n baseurl = 'http://%s:%s' % (elem.attrib['address'],\n elem.attrib['port'])\n items.append(PlexClient(baseurl, server=self, data=elem))\n return items"},"metadata":{"kind":"string","value":"{\n \"objective\": {\n \"self\": [],\n \"paired\": [],\n \"triplet\": [\n [\n \"query\",\n \"document\",\n \"negatives\"\n ]\n ]\n }\n}"},"negatives":{"kind":"list like","value":["def serviceQueries(self):\n #log.debug(f\"{self.name}: servicing queries for {len(self.connections)} connections.\")\n for ca, requester in self.connections.items():\n if requester.ims:\n log.info(\"Server %s received:\\n%s\\n\", self.name, requester.ims)\n requester.process()\n for label, msg in requester.process_results_iter():\n requester.send(msg, label=label)\n break # throttle just do one cue at a time\n\n if not requester.persistent: # not persistent so close and remove\n ix = self.server.ixes[ca]\n if not ix.txbs: # wait for outgoing txes to be empty\n self.closeConnection(ca)","def get_client_list(self):\r\n cursor = self.conn.cursor()\r\n cursor.execute(\"\"\"SELECT * FROM CLIENT\"\"\")\r\n return cursor.fetchall()","def clients(self):\n self.update_results()\n return self._clients","def redis_client_list(self):\n def func(server):\n return server.server.client_list()\n self.__run_redis_cmd(func)","def list(self):\n\t\tif self.client is None:\n\t\t\traise UsageError(\"Not connected!\")\n\t\treturn self.client.list_conns()","def query_all(self):\n return multisearch.queries.QueryAll().connect(self)","def get(self):\n return get_clientes()","def clients(self, protocol=None, groups=None):\n\n groups = self.check_parameters_for_validity(groups, \"group\", self.groups())\n retval = []\n if \"world\" in groups:\n q = self.query(Client).filter(Client.group == 'world')\n retval += list(q)\n if 'dev' in groups:\n q = self.query(Client).filter(Client.group == 'dev')\n retval += list(q)\n if 'eval' in groups:\n q = self.query(Client).filter(Client.group == 'eval')\n retval += list(q)\n return retval","def subscribedQueries(self):\n return map(Query.get, self.subscriptions)","def get_elements(self):\n query = f\"select name, middle_name, last_name, age from `{self.table_id}`\"\n query_job = self.client.query(query)\n clients = []\n for row in query_job:\n print('Name', row['name'], 'middle name:', row['middle_name'], 'last name: ',row['last_name'], 'age:', row['age'])\n clients.append(Client(row['name'],row['middle_name'],row['last_name'],row['age']))\n return clients","def queryAllRequests(self):\n logging.info(\"Querying all requests at ReqMgr instance ...\")\n r = self.reqMgrService.getRequestNames()\n print \"Found %s requests:\" % len(r)\n for req in r:\n print req","def clients(self):\n return self._clients","def driver_queries(self) -> Iterable[Dict[str, str]]:\n return self.svc_queries","async def get_objects(conn: Database, query):\n return await conn.fetch_all(query=query)","def get_clients():\n data = DataTable(document=ClientDocument, schema=ClientSchema).get_data\n return Response(data=data).send()","def process_clients():\n for client in state.CLIENT_LIST:\n if client.active and client.cmd_ready:\n logging.debug(\"Found a message, processing...\")\n msg_processor(client)","def get_all_servicech(self, conf):\n\t\tpass","def get_subscribed_clients(self, mtype):\n return self.hub.get_subscribed_clients(self.get_private_key(), mtype)","def list_clients(self):\n\n return self.clients_info","def clients(self, r):\r\n return r.clients","def queries(self):\n request = Request(method=\"get\", endpoint=\"/query/current\")\n\n def response_handler(resp):\n if not resp.is_success:\n raise C8QLQueryListError(resp, request)\n return self._format_queries(resp.body)\n\n return self._execute(request, response_handler)","def clients(self):\n\n try:\n req = requests.get(self.root_url + \"/clients\")\n except requests.exceptions.ConnectionError as e:\n req = None\n print(str(e), file=sys.stderr)\n except Exception as e:\n print(\"Unknown error making a request to the Sensu API\", file=sys.stderr)\n print(str(e), file=sys.stderr)\n\n if req and req.status_code == 200:\n dat = req.json()\n for host in dat:\n self.metrics.append(('sensu_status', host['status'], {'host': host['name'], 'dc': host['dc']}))","def list_clients(): # Listar clientes\n global clients\n\n for idx, client in enumerate(clients):\n print('{}: {}'.format(idx, client))","def update_clients():\n if rabbit.leader_node_is_ready() or rabbit.client_node_is_ready():\n for rid in relation_ids('amqp'):\n for unit in related_units(rid):\n amqp_changed(relation_id=rid, remote_unit=unit)","def get_clients(self):\n\n return (self._clients['pps'], self._clients['pfs'])","def list_available_clients(self):\n connected_clients = self.all_clients.keys()\n return connected_clients","def get_subscribed_clients(self, private_key, mtype):\n return self._samp_hub.getSubscribedClients(private_key, mtype)","def get_amp_computers(\n host=env.AMP.get(\"host\"),\n client_id=env.AMP_CLIENT_ID,\n api_key=env.AMP_API_KEY\n):\n print(\"\\n==> Computers from AMP\")\n url = f\"https://{client_id}:{api_key}@{host}/v1/computers\"\n response = requests.get(url, verify=False)\n response.raise_for_status()\n computers_list = response.json()[\"data\"] \n return computers_list","def _run_async_query(self, context):\n result = self._cb.get_object(self._doc_class.urlobject.format(self._cb.credentials.org_key))\n results = result.get(\"results\", [])\n self._total_results = len(results)\n self._count_valid = True\n return [self._doc_class(self._cb, item[\"id\"], item) for item in results]","def fetch_process_queries(self):\n url = \"/api/investigate/v1/orgs/{}/processes/search_jobs\".format(\n self.credentials.org_key\n )\n ids = self.get_object(url)\n return ids.get(\"query_ids\", [])","async def get_all(self) -> typing.List[Connection]:\n return [Connection.from_dict(conn) for conn in await self.query(CONNECTION_URL)]","def get_mos_from_localhost(self):\n rewards = dict() # saves the reward of each client from each ap\n _, data = self.command_ap('localhost', 8080, '', \"/get_mos_client\") # the interface (3rd param) does not matter\n self.log.debug(\"data for MOS @ {} => {}\".format('all', data))\n stations = {'gnu-nb3': ['cloud'],\n 'fenrir': ['storm'],\n }\n for ap in self.aps:\n d = []\n for sta in stations[ap.name]:\n entries = [x[:4] for x in data if x[4] == sta]\n d.extend(entries)\n rs = self.get_rs(d)\n rewards[ap.id] = rs\n return rewards","def all(cls):\n return (cls(**client) for client in cls.collection().find({}))","def sitecurclntconnections(self) :\n\t\ttry :\n\t\t\treturn self._sitecurclntconnections\n\t\texcept Exception as e:\n\t\t\traise e","def get_all_crawlers(self):\n try:\n conn = psycopg2.connect(\"dbname='{0}'\".format(DATABASE))\n cur = conn.cursor(cursor_factory=psycopg2.extras.RealDictCursor)\n cur.execute(\"SELECT * FROM host WHERE type = 'Crawler';\")\n results = cur.fetchall()\n cur.close()\n return results\n except Exception as e:\n print(e)","def service(self):\n self.serviceConnects()\n self.serviceQueries()","def select_all():\n sql = 'SELECT * FROM dostawy.przesylki'\n rows = DBconnector.fetch_query(sql)\n return _wrap_in_parcel_list(rows)","def get_client_gyms(self, client_id):\r\n cursor = self.conn.cursor()\r\n cursor.execute(\"\"\"SELECT g.* \r\n FROM CLIENT_GYM AS cg\r\n JOIN GYM AS g ON cg.gym_id=g.id\r\n WHERE cg.client_id={}\"\"\".format(client_id))\r\n return cursor.fetchall()","def get_registered_clients(self):\n return self.hub.get_registered_clients(self.get_private_key())","async def run_all_clients():\n completed_clients = 0\n for client_result in asyncio.as_completed(clients):\n completed_clients += await client_result\n return completed_clients","def get_all(self):\n return {\"parcels\": self.db}, 200","def queries(self):\n return self.__queries","def list(self):\n return self.connection.get(self.service)","def query(self) -> QueryServiceProxy:\n if self._query_services is None:\n self._query_services = QueryServiceProxy(self)\n return self._query_services","def query(self):\n self.session_status()\n try:\n if self.keyword['limit'] == None:\n query = self.session.query(self.keyword['tablename']).filter(\n self.keyword['filter']).all()\n else:\n query = self.session.query(self.keyword['tablename']).filter(\n self.keyword['filter']).limit(self.keyword['limit']).all()\n except OperationalError:\n self.retry += 1\n if self.retry > self.max_retry_time:\n raise OperationalError, 'RETRY OUT'\n time.sleep(3)\n self.session.close()\n self.query()\n\n self.session.close()\n\n if not query:\n return []\n self.retry = 0\n return query","def _query(self):\n # When search matches no minions, salt prints to stdout.\n # Suppress stdout.\n _stdout = sys.stdout\n sys.stdout = open(os.devnull, 'w')\n\n self.local.cmd('*', 'saltutil.pillar_refresh')\n minions = self.local.cmd('*', 'pillar.get', ['minion_nodes'],\n tgt_type=\"compound\")\n sys.stdout = _stdout\n for minion in minions:\n if minions[minion]:\n return minions[minion]\n\n return []","def get_people(self):\n cur = self.conn.cursor(pymysql.cursors.DictCursor)\n\n cur.execute('SELECT name FROM Client;')\n\n return CursorIterator(cur)","def get_pmids(self, uid):\n self.setQuery(\"\"\"\n Select ?pmid where {\n ?who <http://vivo.dartmouth.edu/ontology/geiselId> \\\"\"\"\" + str(uid) + \"\"\"\"^^<http://www.w3.org/2001/XMLSchema#int> .\n ?auth <http://vivoweb.org/ontology/core#relates> ?who .\n ?auth a <http://vivoweb.org/ontology/core#Authorship> .\n ?auth <http://vivoweb.org/ontology/core#relates> ?what .\n ?what a <http://purl.org/ontology/bibo/Article> .\n ?what <http://purl.org/ontology/bibo/pmid> ?pmid .\n }\"\"\")\n\n try:\n rval = self.query()\n g = rval.convert()\n return [x['pmid']['value'] for x in g['results']['bindings']]\n except:\n print \"Select failed\"\n traceback.print_exc(file=sys.stdout)","def fetch_all(): \n client, index_name = connection_es()\n res = client.search(index = index_name+\"*\")\n return res","def _getAllProvas(self):\n return self.execSql(\"select_all_provas\")","def db_select_all(self):\n \n query = \"SELECT * FROM %s\" % PUBLICATIONS_TABLE\n with self.connection:\n c = self.connection.cursor()\n c.execute(query)\n return c.fetchall()","def get_clients(self, channel):\n if channel not in self.clients.keys():\n return []\n return self.clients[channel]","def clients(self, server):\n servers = coordinator.get_job_servers(self.job)\n for sid, name in servers.iteritems():\n if name == server:\n # assuming sid is zero-based and all sid < number of servers:\n clpsv = (self.numclients + len(servers) - 1) / len(servers)\n clients = range(self.numclients)[sid * clpsv:(sid + 1) * clpsv]\n return [str(n) for n in clients]\n return []","def queryThis(query: Query) -> list:\n q = str(query) # extra line for clarity. calls the __str__ magic function\n\n return list(client.query(q).result())","def clients():\n pass","def select_clients(self, my_round, num_clients=20):\n samples_futures = []\n for cs in self.client_servers:\n samples_future = cs.select_clients.remote(my_round, num_clients)\n samples_futures.append(samples_future)\n\n return [p for future in samples_futures for p in ray.get(future)]","def clientlist(self) -> None:\n from bacommon.servermanager import ClientListCommand\n self._enqueue_server_command(ClientListCommand())\n self._block_for_command_completion()","def clients(self):\n return ClientsTable(self.rpc, self.name)","def get_queryset(self, request):\n user = request.user\n if is_superuser_or_manager(user):\n return super(ClientAdminConfig, self).get_queryset(request)\n\n return Client.objects.filter(\n Q(main_sales_contact=user)\n | Q(contracts__sales_contact=user)\n | Q(contracts__event__support_contact=user)\n ).distinct()","def get_all(self) -> typing.List[Connection]:\n return [Connection.from_dict(conn) for conn in self.query(CONNECTION_URL)]","def query(self):\n pass","def _run_query(self):\n self._search_query()\n logger.debug(\"Payload\")\n logger.debug(self._payload)\n _resp = query_public_ip_pools(self._payload)\n logger.debug(_resp)\n _resp = self.load_json(_resp)\n _ret_list = []\n if _resp is None:\n self._record_total = self._record_filtered = 0\n return []\n _ret_list = _resp[\"ret_set\"]\n self._record_filtered = self._record_total = _resp.get(\"total_count\") or 100\n return _ret_list","async def fetchall(self, query, connection=None):\n async with self.connection(connection) as conn:\n r = await conn.execute(query)\n return await r.fetchall()","def get_active_clients():\n global drivers\n\n if not drivers:\n return jsonify([])\n\n result = {client: get_client_info(client) for client in drivers}\n return jsonify(result)","def send_query(self):\n results = []\n for username in self.constraints.get(\"usernames\", []):\n values = self.newt.get_usage(username)\n if values:\n with contextlib.suppress(KeyError):\n # Empty return from get_usage, so just move on\n results.extend(values[\"items\"])\n # filter results based on constraints specified in newt_keys dictionary\n newt_keys = self.constraints.get(\"newt_keys\", {})\n for key, values in newt_keys.items():\n k = key\n # The below remapping is needed for backward compatibility with\n # existing config files\n if key == \"rname\":\n k = \"repoName\"\n if key == \"repo_type\":\n k = \"repoType\"\n if values:\n results = [x for x in results if x[k] in values]\n return results","def select_all_meetings(self):\n db_connection = DbConnection()\n\n try:\n connection = db_connection.get_connection()\n\n cursor = connection.cursor()\n cursor.execute(self.select_all_sql)\n rows = cursor.fetchall()\n\n cursor.close()\n db_connection.close_connection()\n except Exception:\n raise\n\n else:\n\n return rows","def _perform_query(self, from_row=0, max_rows=-1):\n result = self._cb.get_object(self._doc_class.urlobject.format(self._cb.credentials.org_key))\n results = result.get(\"results\", [])\n\n self._total_results = len(results)\n self._count_valid = True\n\n for item in results:\n yield self._doc_class(self._cb, item[\"id\"], item)","def get_clients():\n clients = Client.query.all()\n clients_schema = ClientSchema()\n result = clients_schema.dump(clients, many=True)\n return jsonify({'clients': result.data})","def collect(self, query_list):\n try:\n while True:\n # For each app, we iterate through the query list and make the API request.\n for current_app in range(self.number_apps):\n for q_index, current_query in enumerate(query_list):\n response = self.request_data(search_query=current_query, app_index=current_app)\n if utils.validate_response(response):\n # STORE DATA\n data = response.json()\n print(data.keys())\n #pass\n else:\n raise BadResponseError()\n except KeyboardInterrupt:\n return -1\n except BadResponseError:\n return -1","def select_all_members(conn):\n cur = conn.cursor()\n cur.execute(\"SELECT * FROM dashboard_gymcheckin\")\n\n rows = cur.fetchall()\n\n for row in rows:\n print(row)","def get_all_psus(self):\n return self._psu_list","def get_clients(self):\n clis = []\n for c in self._clients:\n clis.append(c.get_address())\n return clis","def get_clients(self):\n clis = []\n for c in self._clients:\n clis.append(c.get_address())\n return clis","def select_active_hosts():\n return IMPL.select_active_hosts()","def get_all():\n return SavedQuery.get_all()","def view_all_persons():\n message = ''\n global conn\n with conn:\n rows = select_all_persons(conn)\n for row in rows:\n message += str(row) + \"\\n\"\n messagebox.showinfo('Person Table', message)","def get_all():\n return PushManager.query.all()","def soql_query(self, query):\n self.builtin.log(\"Running SOQL Query: {}\".format(query))\n return self.cumulusci.sf.query_all(query)","def get_skeletons_from_mongodb(self):\n query = {\"date\":self.date}\n print \"query:\", query\n ret = self._store_client.query(query, skeleton_complete._type) # ret is a list of all queried msgs, returned as tuples. (msg, meta)\n\n # for (complete_skel_msg, meta) in ret:\n # do stuff\n return ret","def getQueries(self):\r\n\t\tp=[]\r\n\t\tfor pa in self.session.query(Query):\r\n\t\t\tp.append(pa)\r\n\t\treturn p","def selectAll(conn, params):\n cur = conn.cursor()\n cur.execute(f\"SELECT {params} FROM criptomonedas\")\n\n # rows = cur.fetchall()\n rows = [r[0] for r in cur]\n # for row in rows:\n # print(row[0])\n return rows","def all (self):\n sparql_results = self.query (\"\"\"\n select distinct ?rs ?session ?name ?number ?pid ?sitename\n where {\n \n ?rs rdf:type austalk:RecordedSession .\n ?rs olac:speaker ?participant .\n \n ?participant austalk:id ?pid .\n ?participant austalk:recording_site ?site .\n ?site rdfs:label ?sitename .\n \n ?rs austalk:prototype ?session .\n ?session austalk:name ?name .\n ?session austalk:id ?number .\n }\n ORDER BY ?name\"\"\")\n\n results = []\n\n for result in sparql_results[\"results\"][\"bindings\"]:\n\n results.append (Session (\n client = self.client,\n identifier = result[\"rs\"][\"value\"],\n prototype = result[\"session\"][\"value\"],\n name = result[\"name\"][\"value\"],\n number = result[\"number\"][\"value\"],\n site = result[\"sitename\"][\"value\"],\n participantId = result[\"pid\"][\"value\"]))\n\n return results","def getMonitoringHosts(self):\r\n return self.monitoringClients.values()","def select_all_from_teachers_db(connection):\r\n with connection:\r\n f = connection.execute(GET_ALL_TEACHERS)\r\n return f.fetchall()","def test_03_get_all_client(self):\n try:\n return_value = ClientsUnitTest._client_dao.get_clients()\n self.assertGreater(len(return_value), 1)\n\n except DBException as error:\n print(error.error_string())","def n1qlQueryAll(self, *args, **kwargs):\n if not self.connected:\n cb = lambda x: self.n1qlQueryAll(*args, **kwargs)\n return self.connect().addCallback(cb)\n\n kwargs['itercls'] = BatchedN1QLRequest\n o = super(RawBucket, self).n1ql_query(*args, **kwargs)\n o.start()\n return o._getDeferred()","def askAll(self, query, context):\n return self.ask(query, context, False)","def available_clients(self, user_id: int) -> List[str]:\n return list(self.clients[user_id])","def query(params: Params):\n return service.query(**params.query, n_neighbors=params.n_neighbors)","def list_all_customers(*args):\n logger.info(f\"Perparing dict of all products...\")\n all_customers_dict = {}\n\n with MONGO:\n mdb = eval(Settings.connect_string)\n customers = mdb[\"customers\"]\n all_customers = customers.find({})\n for customer in all_customers:\n user_id = customer[\"user_id\"]\n del customer[\"_id\"]\n del customer[\"user_id\"]\n all_customers_dict[user_id] = customer\n return all_customers_dict","def stream_query(self, commands):\n # The CLI transport does not support pipelining.\n if self.transport is pywatchman.CLIProcessTransport:\n raise NotImplementedError()\n\n cmd_buf = deque(command for command in reversed(commands))\n self._connect()\n\n while 1:\n # Interleave sends and receives to avoid bi-directional communication issues.\n if cmd_buf:\n item = cmd_buf.pop()\n try:\n self.sendConn.send(item)\n except pywatchman.SocketTimeout:\n cmd_buf.append(item)\n yield\n\n try:\n result = self.recvConn.receive()\n except pywatchman.SocketTimeout:\n # Socket timeout - yield runtime context.\n yield\n else:\n if 'error' in result:\n raise pywatchman.WatchmanError('error from watchman: {}'.format(result['error']))\n elif self.isUnilateralResponse(result) or 'subscribe' in result:\n yield result\n else:\n yield result\n break","def list():\n\n result = {}\n status = 404\n\n # nodes=Property.query.all()\n props_by_user = Property.query.filter(Property.users.contains(current_user)).all()\n if props_by_user:\n result['props'] = props_by_user\n status = 200\n\n return result, status","def query(self):","def get_client_requsts(cls):\n response =[]\n query_to_get_all_client_requests = 'SELECT * FROM client_request'\n connection.cursor.execute(query_to_get_all_client_requests)\n rows = connection.cursor.fetchall()\n if not rows:\n return \"Client request not available\"\n for row in rows:\n response.append({\n 'id': row[0],\n 'createdby': row[1],\n 'category': row[2],\n 'product':row[3],\n })\n return response","def get_all_clients(self) -> Sequence[MarathonClient]:\n return dedupe_clients(self.current + self.previous) # type: ignore","def fetchAll(self, *args, **kwargs):\n return KorAPClient.fetchAll(self, *args, **kwargs)","def select_all_counties(conn):\n cur = conn.cursor()\n cur.execute(\"SELECT * FROM County\")\n\n rows = cur.fetchall()\n return rows # return the rows","async def fetch_all(self, query: str, args: Optional[Iterable]=None) -> List:\n stats.inc('queries', 'SQL')\n async with self.pool.acquire() as conn:\n async with conn.cursor() as cur:\n await cur.execute(query, args)\n ret = await cur.fetchall()\n return ret","def getKIDsPC():\n\tdb = MySQLdb.connect(host='tddb.astro.washington.edu', user='tddb', passwd='tddb', db='Kepler')\n\tcursor = db.cursor()\n\tfoo1 = 'select KID from KEPPC'\n\tcursor.execute(foo1)\n\tresults = cursor.fetchall()\n\tr1 = ([el[0] for el in results])\n\tresults=set(r1)\n\n\treturn results","def items(ctx):\n config = buildConfig(ctx.obj[\"HOST\"], ctx.obj[\"PORT\"])\n clientList = getClientList(config)\n for client in clientList:\n for id in slabIds(client.stats(\"items\")):\n k = client.stats('cachedump', id, '0').keys()\n for key in k:\n click.echo(key)\n click.echo(f\"*********** SERVER {client.server} contains {len(k)} keys\")\n print()"],"string":"[\n \"def serviceQueries(self):\\n #log.debug(f\\\"{self.name}: servicing queries for {len(self.connections)} connections.\\\")\\n for ca, requester in self.connections.items():\\n if requester.ims:\\n log.info(\\\"Server %s received:\\\\n%s\\\\n\\\", self.name, requester.ims)\\n requester.process()\\n for label, msg in requester.process_results_iter():\\n requester.send(msg, label=label)\\n break # throttle just do one cue at a time\\n\\n if not requester.persistent: # not persistent so close and remove\\n ix = self.server.ixes[ca]\\n if not ix.txbs: # wait for outgoing txes to be empty\\n self.closeConnection(ca)\",\n \"def get_client_list(self):\\r\\n cursor = self.conn.cursor()\\r\\n cursor.execute(\\\"\\\"\\\"SELECT * FROM CLIENT\\\"\\\"\\\")\\r\\n return cursor.fetchall()\",\n \"def clients(self):\\n self.update_results()\\n return self._clients\",\n \"def redis_client_list(self):\\n def func(server):\\n return server.server.client_list()\\n self.__run_redis_cmd(func)\",\n \"def list(self):\\n\\t\\tif self.client is None:\\n\\t\\t\\traise UsageError(\\\"Not connected!\\\")\\n\\t\\treturn self.client.list_conns()\",\n \"def query_all(self):\\n return multisearch.queries.QueryAll().connect(self)\",\n \"def get(self):\\n return get_clientes()\",\n \"def clients(self, protocol=None, groups=None):\\n\\n groups = self.check_parameters_for_validity(groups, \\\"group\\\", self.groups())\\n retval = []\\n if \\\"world\\\" in groups:\\n q = self.query(Client).filter(Client.group == 'world')\\n retval += list(q)\\n if 'dev' in groups:\\n q = self.query(Client).filter(Client.group == 'dev')\\n retval += list(q)\\n if 'eval' in groups:\\n q = self.query(Client).filter(Client.group == 'eval')\\n retval += list(q)\\n return retval\",\n \"def subscribedQueries(self):\\n return map(Query.get, self.subscriptions)\",\n \"def get_elements(self):\\n query = f\\\"select name, middle_name, last_name, age from `{self.table_id}`\\\"\\n query_job = self.client.query(query)\\n clients = []\\n for row in query_job:\\n print('Name', row['name'], 'middle name:', row['middle_name'], 'last name: ',row['last_name'], 'age:', row['age'])\\n clients.append(Client(row['name'],row['middle_name'],row['last_name'],row['age']))\\n return clients\",\n \"def queryAllRequests(self):\\n logging.info(\\\"Querying all requests at ReqMgr instance ...\\\")\\n r = self.reqMgrService.getRequestNames()\\n print \\\"Found %s requests:\\\" % len(r)\\n for req in r:\\n print req\",\n \"def clients(self):\\n return self._clients\",\n \"def driver_queries(self) -> Iterable[Dict[str, str]]:\\n return self.svc_queries\",\n \"async def get_objects(conn: Database, query):\\n return await conn.fetch_all(query=query)\",\n \"def get_clients():\\n data = DataTable(document=ClientDocument, schema=ClientSchema).get_data\\n return Response(data=data).send()\",\n \"def process_clients():\\n for client in state.CLIENT_LIST:\\n if client.active and client.cmd_ready:\\n logging.debug(\\\"Found a message, processing...\\\")\\n msg_processor(client)\",\n \"def get_all_servicech(self, conf):\\n\\t\\tpass\",\n \"def get_subscribed_clients(self, mtype):\\n return self.hub.get_subscribed_clients(self.get_private_key(), mtype)\",\n \"def list_clients(self):\\n\\n return self.clients_info\",\n \"def clients(self, r):\\r\\n return r.clients\",\n \"def queries(self):\\n request = Request(method=\\\"get\\\", endpoint=\\\"/query/current\\\")\\n\\n def response_handler(resp):\\n if not resp.is_success:\\n raise C8QLQueryListError(resp, request)\\n return self._format_queries(resp.body)\\n\\n return self._execute(request, response_handler)\",\n \"def clients(self):\\n\\n try:\\n req = requests.get(self.root_url + \\\"/clients\\\")\\n except requests.exceptions.ConnectionError as e:\\n req = None\\n print(str(e), file=sys.stderr)\\n except Exception as e:\\n print(\\\"Unknown error making a request to the Sensu API\\\", file=sys.stderr)\\n print(str(e), file=sys.stderr)\\n\\n if req and req.status_code == 200:\\n dat = req.json()\\n for host in dat:\\n self.metrics.append(('sensu_status', host['status'], {'host': host['name'], 'dc': host['dc']}))\",\n \"def list_clients(): # Listar clientes\\n global clients\\n\\n for idx, client in enumerate(clients):\\n print('{}: {}'.format(idx, client))\",\n \"def update_clients():\\n if rabbit.leader_node_is_ready() or rabbit.client_node_is_ready():\\n for rid in relation_ids('amqp'):\\n for unit in related_units(rid):\\n amqp_changed(relation_id=rid, remote_unit=unit)\",\n \"def get_clients(self):\\n\\n return (self._clients['pps'], self._clients['pfs'])\",\n \"def list_available_clients(self):\\n connected_clients = self.all_clients.keys()\\n return connected_clients\",\n \"def get_subscribed_clients(self, private_key, mtype):\\n return self._samp_hub.getSubscribedClients(private_key, mtype)\",\n \"def get_amp_computers(\\n host=env.AMP.get(\\\"host\\\"),\\n client_id=env.AMP_CLIENT_ID,\\n api_key=env.AMP_API_KEY\\n):\\n print(\\\"\\\\n==> Computers from AMP\\\")\\n url = f\\\"https://{client_id}:{api_key}@{host}/v1/computers\\\"\\n response = requests.get(url, verify=False)\\n response.raise_for_status()\\n computers_list = response.json()[\\\"data\\\"] \\n return computers_list\",\n \"def _run_async_query(self, context):\\n result = self._cb.get_object(self._doc_class.urlobject.format(self._cb.credentials.org_key))\\n results = result.get(\\\"results\\\", [])\\n self._total_results = len(results)\\n self._count_valid = True\\n return [self._doc_class(self._cb, item[\\\"id\\\"], item) for item in results]\",\n \"def fetch_process_queries(self):\\n url = \\\"/api/investigate/v1/orgs/{}/processes/search_jobs\\\".format(\\n self.credentials.org_key\\n )\\n ids = self.get_object(url)\\n return ids.get(\\\"query_ids\\\", [])\",\n \"async def get_all(self) -> typing.List[Connection]:\\n return [Connection.from_dict(conn) for conn in await self.query(CONNECTION_URL)]\",\n \"def get_mos_from_localhost(self):\\n rewards = dict() # saves the reward of each client from each ap\\n _, data = self.command_ap('localhost', 8080, '', \\\"/get_mos_client\\\") # the interface (3rd param) does not matter\\n self.log.debug(\\\"data for MOS @ {} => {}\\\".format('all', data))\\n stations = {'gnu-nb3': ['cloud'],\\n 'fenrir': ['storm'],\\n }\\n for ap in self.aps:\\n d = []\\n for sta in stations[ap.name]:\\n entries = [x[:4] for x in data if x[4] == sta]\\n d.extend(entries)\\n rs = self.get_rs(d)\\n rewards[ap.id] = rs\\n return rewards\",\n \"def all(cls):\\n return (cls(**client) for client in cls.collection().find({}))\",\n \"def sitecurclntconnections(self) :\\n\\t\\ttry :\\n\\t\\t\\treturn self._sitecurclntconnections\\n\\t\\texcept Exception as e:\\n\\t\\t\\traise e\",\n \"def get_all_crawlers(self):\\n try:\\n conn = psycopg2.connect(\\\"dbname='{0}'\\\".format(DATABASE))\\n cur = conn.cursor(cursor_factory=psycopg2.extras.RealDictCursor)\\n cur.execute(\\\"SELECT * FROM host WHERE type = 'Crawler';\\\")\\n results = cur.fetchall()\\n cur.close()\\n return results\\n except Exception as e:\\n print(e)\",\n \"def service(self):\\n self.serviceConnects()\\n self.serviceQueries()\",\n \"def select_all():\\n sql = 'SELECT * FROM dostawy.przesylki'\\n rows = DBconnector.fetch_query(sql)\\n return _wrap_in_parcel_list(rows)\",\n \"def get_client_gyms(self, client_id):\\r\\n cursor = self.conn.cursor()\\r\\n cursor.execute(\\\"\\\"\\\"SELECT g.* \\r\\n FROM CLIENT_GYM AS cg\\r\\n JOIN GYM AS g ON cg.gym_id=g.id\\r\\n WHERE cg.client_id={}\\\"\\\"\\\".format(client_id))\\r\\n return cursor.fetchall()\",\n \"def get_registered_clients(self):\\n return self.hub.get_registered_clients(self.get_private_key())\",\n \"async def run_all_clients():\\n completed_clients = 0\\n for client_result in asyncio.as_completed(clients):\\n completed_clients += await client_result\\n return completed_clients\",\n \"def get_all(self):\\n return {\\\"parcels\\\": self.db}, 200\",\n \"def queries(self):\\n return self.__queries\",\n \"def list(self):\\n return self.connection.get(self.service)\",\n \"def query(self) -> QueryServiceProxy:\\n if self._query_services is None:\\n self._query_services = QueryServiceProxy(self)\\n return self._query_services\",\n \"def query(self):\\n self.session_status()\\n try:\\n if self.keyword['limit'] == None:\\n query = self.session.query(self.keyword['tablename']).filter(\\n self.keyword['filter']).all()\\n else:\\n query = self.session.query(self.keyword['tablename']).filter(\\n self.keyword['filter']).limit(self.keyword['limit']).all()\\n except OperationalError:\\n self.retry += 1\\n if self.retry > self.max_retry_time:\\n raise OperationalError, 'RETRY OUT'\\n time.sleep(3)\\n self.session.close()\\n self.query()\\n\\n self.session.close()\\n\\n if not query:\\n return []\\n self.retry = 0\\n return query\",\n \"def _query(self):\\n # When search matches no minions, salt prints to stdout.\\n # Suppress stdout.\\n _stdout = sys.stdout\\n sys.stdout = open(os.devnull, 'w')\\n\\n self.local.cmd('*', 'saltutil.pillar_refresh')\\n minions = self.local.cmd('*', 'pillar.get', ['minion_nodes'],\\n tgt_type=\\\"compound\\\")\\n sys.stdout = _stdout\\n for minion in minions:\\n if minions[minion]:\\n return minions[minion]\\n\\n return []\",\n \"def get_people(self):\\n cur = self.conn.cursor(pymysql.cursors.DictCursor)\\n\\n cur.execute('SELECT name FROM Client;')\\n\\n return CursorIterator(cur)\",\n \"def get_pmids(self, uid):\\n self.setQuery(\\\"\\\"\\\"\\n Select ?pmid where {\\n ?who <http://vivo.dartmouth.edu/ontology/geiselId> \\\\\\\"\\\"\\\"\\\" + str(uid) + \\\"\\\"\\\"\\\"^^<http://www.w3.org/2001/XMLSchema#int> .\\n ?auth <http://vivoweb.org/ontology/core#relates> ?who .\\n ?auth a <http://vivoweb.org/ontology/core#Authorship> .\\n ?auth <http://vivoweb.org/ontology/core#relates> ?what .\\n ?what a <http://purl.org/ontology/bibo/Article> .\\n ?what <http://purl.org/ontology/bibo/pmid> ?pmid .\\n }\\\"\\\"\\\")\\n\\n try:\\n rval = self.query()\\n g = rval.convert()\\n return [x['pmid']['value'] for x in g['results']['bindings']]\\n except:\\n print \\\"Select failed\\\"\\n traceback.print_exc(file=sys.stdout)\",\n \"def fetch_all(): \\n client, index_name = connection_es()\\n res = client.search(index = index_name+\\\"*\\\")\\n return res\",\n \"def _getAllProvas(self):\\n return self.execSql(\\\"select_all_provas\\\")\",\n \"def db_select_all(self):\\n \\n query = \\\"SELECT * FROM %s\\\" % PUBLICATIONS_TABLE\\n with self.connection:\\n c = self.connection.cursor()\\n c.execute(query)\\n return c.fetchall()\",\n \"def get_clients(self, channel):\\n if channel not in self.clients.keys():\\n return []\\n return self.clients[channel]\",\n \"def clients(self, server):\\n servers = coordinator.get_job_servers(self.job)\\n for sid, name in servers.iteritems():\\n if name == server:\\n # assuming sid is zero-based and all sid < number of servers:\\n clpsv = (self.numclients + len(servers) - 1) / len(servers)\\n clients = range(self.numclients)[sid * clpsv:(sid + 1) * clpsv]\\n return [str(n) for n in clients]\\n return []\",\n \"def queryThis(query: Query) -> list:\\n q = str(query) # extra line for clarity. calls the __str__ magic function\\n\\n return list(client.query(q).result())\",\n \"def clients():\\n pass\",\n \"def select_clients(self, my_round, num_clients=20):\\n samples_futures = []\\n for cs in self.client_servers:\\n samples_future = cs.select_clients.remote(my_round, num_clients)\\n samples_futures.append(samples_future)\\n\\n return [p for future in samples_futures for p in ray.get(future)]\",\n \"def clientlist(self) -> None:\\n from bacommon.servermanager import ClientListCommand\\n self._enqueue_server_command(ClientListCommand())\\n self._block_for_command_completion()\",\n \"def clients(self):\\n return ClientsTable(self.rpc, self.name)\",\n \"def get_queryset(self, request):\\n user = request.user\\n if is_superuser_or_manager(user):\\n return super(ClientAdminConfig, self).get_queryset(request)\\n\\n return Client.objects.filter(\\n Q(main_sales_contact=user)\\n | Q(contracts__sales_contact=user)\\n | Q(contracts__event__support_contact=user)\\n ).distinct()\",\n \"def get_all(self) -> typing.List[Connection]:\\n return [Connection.from_dict(conn) for conn in self.query(CONNECTION_URL)]\",\n \"def query(self):\\n pass\",\n \"def _run_query(self):\\n self._search_query()\\n logger.debug(\\\"Payload\\\")\\n logger.debug(self._payload)\\n _resp = query_public_ip_pools(self._payload)\\n logger.debug(_resp)\\n _resp = self.load_json(_resp)\\n _ret_list = []\\n if _resp is None:\\n self._record_total = self._record_filtered = 0\\n return []\\n _ret_list = _resp[\\\"ret_set\\\"]\\n self._record_filtered = self._record_total = _resp.get(\\\"total_count\\\") or 100\\n return _ret_list\",\n \"async def fetchall(self, query, connection=None):\\n async with self.connection(connection) as conn:\\n r = await conn.execute(query)\\n return await r.fetchall()\",\n \"def get_active_clients():\\n global drivers\\n\\n if not drivers:\\n return jsonify([])\\n\\n result = {client: get_client_info(client) for client in drivers}\\n return jsonify(result)\",\n \"def send_query(self):\\n results = []\\n for username in self.constraints.get(\\\"usernames\\\", []):\\n values = self.newt.get_usage(username)\\n if values:\\n with contextlib.suppress(KeyError):\\n # Empty return from get_usage, so just move on\\n results.extend(values[\\\"items\\\"])\\n # filter results based on constraints specified in newt_keys dictionary\\n newt_keys = self.constraints.get(\\\"newt_keys\\\", {})\\n for key, values in newt_keys.items():\\n k = key\\n # The below remapping is needed for backward compatibility with\\n # existing config files\\n if key == \\\"rname\\\":\\n k = \\\"repoName\\\"\\n if key == \\\"repo_type\\\":\\n k = \\\"repoType\\\"\\n if values:\\n results = [x for x in results if x[k] in values]\\n return results\",\n \"def select_all_meetings(self):\\n db_connection = DbConnection()\\n\\n try:\\n connection = db_connection.get_connection()\\n\\n cursor = connection.cursor()\\n cursor.execute(self.select_all_sql)\\n rows = cursor.fetchall()\\n\\n cursor.close()\\n db_connection.close_connection()\\n except Exception:\\n raise\\n\\n else:\\n\\n return rows\",\n \"def _perform_query(self, from_row=0, max_rows=-1):\\n result = self._cb.get_object(self._doc_class.urlobject.format(self._cb.credentials.org_key))\\n results = result.get(\\\"results\\\", [])\\n\\n self._total_results = len(results)\\n self._count_valid = True\\n\\n for item in results:\\n yield self._doc_class(self._cb, item[\\\"id\\\"], item)\",\n \"def get_clients():\\n clients = Client.query.all()\\n clients_schema = ClientSchema()\\n result = clients_schema.dump(clients, many=True)\\n return jsonify({'clients': result.data})\",\n \"def collect(self, query_list):\\n try:\\n while True:\\n # For each app, we iterate through the query list and make the API request.\\n for current_app in range(self.number_apps):\\n for q_index, current_query in enumerate(query_list):\\n response = self.request_data(search_query=current_query, app_index=current_app)\\n if utils.validate_response(response):\\n # STORE DATA\\n data = response.json()\\n print(data.keys())\\n #pass\\n else:\\n raise BadResponseError()\\n except KeyboardInterrupt:\\n return -1\\n except BadResponseError:\\n return -1\",\n \"def select_all_members(conn):\\n cur = conn.cursor()\\n cur.execute(\\\"SELECT * FROM dashboard_gymcheckin\\\")\\n\\n rows = cur.fetchall()\\n\\n for row in rows:\\n print(row)\",\n \"def get_all_psus(self):\\n return self._psu_list\",\n \"def get_clients(self):\\n clis = []\\n for c in self._clients:\\n clis.append(c.get_address())\\n return clis\",\n \"def get_clients(self):\\n clis = []\\n for c in self._clients:\\n clis.append(c.get_address())\\n return clis\",\n \"def select_active_hosts():\\n return IMPL.select_active_hosts()\",\n \"def get_all():\\n return SavedQuery.get_all()\",\n \"def view_all_persons():\\n message = ''\\n global conn\\n with conn:\\n rows = select_all_persons(conn)\\n for row in rows:\\n message += str(row) + \\\"\\\\n\\\"\\n messagebox.showinfo('Person Table', message)\",\n \"def get_all():\\n return PushManager.query.all()\",\n \"def soql_query(self, query):\\n self.builtin.log(\\\"Running SOQL Query: {}\\\".format(query))\\n return self.cumulusci.sf.query_all(query)\",\n \"def get_skeletons_from_mongodb(self):\\n query = {\\\"date\\\":self.date}\\n print \\\"query:\\\", query\\n ret = self._store_client.query(query, skeleton_complete._type) # ret is a list of all queried msgs, returned as tuples. (msg, meta)\\n\\n # for (complete_skel_msg, meta) in ret:\\n # do stuff\\n return ret\",\n \"def getQueries(self):\\r\\n\\t\\tp=[]\\r\\n\\t\\tfor pa in self.session.query(Query):\\r\\n\\t\\t\\tp.append(pa)\\r\\n\\t\\treturn p\",\n \"def selectAll(conn, params):\\n cur = conn.cursor()\\n cur.execute(f\\\"SELECT {params} FROM criptomonedas\\\")\\n\\n # rows = cur.fetchall()\\n rows = [r[0] for r in cur]\\n # for row in rows:\\n # print(row[0])\\n return rows\",\n \"def all (self):\\n sparql_results = self.query (\\\"\\\"\\\"\\n select distinct ?rs ?session ?name ?number ?pid ?sitename\\n where {\\n \\n ?rs rdf:type austalk:RecordedSession .\\n ?rs olac:speaker ?participant .\\n \\n ?participant austalk:id ?pid .\\n ?participant austalk:recording_site ?site .\\n ?site rdfs:label ?sitename .\\n \\n ?rs austalk:prototype ?session .\\n ?session austalk:name ?name .\\n ?session austalk:id ?number .\\n }\\n ORDER BY ?name\\\"\\\"\\\")\\n\\n results = []\\n\\n for result in sparql_results[\\\"results\\\"][\\\"bindings\\\"]:\\n\\n results.append (Session (\\n client = self.client,\\n identifier = result[\\\"rs\\\"][\\\"value\\\"],\\n prototype = result[\\\"session\\\"][\\\"value\\\"],\\n name = result[\\\"name\\\"][\\\"value\\\"],\\n number = result[\\\"number\\\"][\\\"value\\\"],\\n site = result[\\\"sitename\\\"][\\\"value\\\"],\\n participantId = result[\\\"pid\\\"][\\\"value\\\"]))\\n\\n return results\",\n \"def getMonitoringHosts(self):\\r\\n return self.monitoringClients.values()\",\n \"def select_all_from_teachers_db(connection):\\r\\n with connection:\\r\\n f = connection.execute(GET_ALL_TEACHERS)\\r\\n return f.fetchall()\",\n \"def test_03_get_all_client(self):\\n try:\\n return_value = ClientsUnitTest._client_dao.get_clients()\\n self.assertGreater(len(return_value), 1)\\n\\n except DBException as error:\\n print(error.error_string())\",\n \"def n1qlQueryAll(self, *args, **kwargs):\\n if not self.connected:\\n cb = lambda x: self.n1qlQueryAll(*args, **kwargs)\\n return self.connect().addCallback(cb)\\n\\n kwargs['itercls'] = BatchedN1QLRequest\\n o = super(RawBucket, self).n1ql_query(*args, **kwargs)\\n o.start()\\n return o._getDeferred()\",\n \"def askAll(self, query, context):\\n return self.ask(query, context, False)\",\n \"def available_clients(self, user_id: int) -> List[str]:\\n return list(self.clients[user_id])\",\n \"def query(params: Params):\\n return service.query(**params.query, n_neighbors=params.n_neighbors)\",\n \"def list_all_customers(*args):\\n logger.info(f\\\"Perparing dict of all products...\\\")\\n all_customers_dict = {}\\n\\n with MONGO:\\n mdb = eval(Settings.connect_string)\\n customers = mdb[\\\"customers\\\"]\\n all_customers = customers.find({})\\n for customer in all_customers:\\n user_id = customer[\\\"user_id\\\"]\\n del customer[\\\"_id\\\"]\\n del customer[\\\"user_id\\\"]\\n all_customers_dict[user_id] = customer\\n return all_customers_dict\",\n \"def stream_query(self, commands):\\n # The CLI transport does not support pipelining.\\n if self.transport is pywatchman.CLIProcessTransport:\\n raise NotImplementedError()\\n\\n cmd_buf = deque(command for command in reversed(commands))\\n self._connect()\\n\\n while 1:\\n # Interleave sends and receives to avoid bi-directional communication issues.\\n if cmd_buf:\\n item = cmd_buf.pop()\\n try:\\n self.sendConn.send(item)\\n except pywatchman.SocketTimeout:\\n cmd_buf.append(item)\\n yield\\n\\n try:\\n result = self.recvConn.receive()\\n except pywatchman.SocketTimeout:\\n # Socket timeout - yield runtime context.\\n yield\\n else:\\n if 'error' in result:\\n raise pywatchman.WatchmanError('error from watchman: {}'.format(result['error']))\\n elif self.isUnilateralResponse(result) or 'subscribe' in result:\\n yield result\\n else:\\n yield result\\n break\",\n \"def list():\\n\\n result = {}\\n status = 404\\n\\n # nodes=Property.query.all()\\n props_by_user = Property.query.filter(Property.users.contains(current_user)).all()\\n if props_by_user:\\n result['props'] = props_by_user\\n status = 200\\n\\n return result, status\",\n \"def query(self):\",\n \"def get_client_requsts(cls):\\n response =[]\\n query_to_get_all_client_requests = 'SELECT * FROM client_request'\\n connection.cursor.execute(query_to_get_all_client_requests)\\n rows = connection.cursor.fetchall()\\n if not rows:\\n return \\\"Client request not available\\\"\\n for row in rows:\\n response.append({\\n 'id': row[0],\\n 'createdby': row[1],\\n 'category': row[2],\\n 'product':row[3],\\n })\\n return response\",\n \"def get_all_clients(self) -> Sequence[MarathonClient]:\\n return dedupe_clients(self.current + self.previous) # type: ignore\",\n \"def fetchAll(self, *args, **kwargs):\\n return KorAPClient.fetchAll(self, *args, **kwargs)\",\n \"def select_all_counties(conn):\\n cur = conn.cursor()\\n cur.execute(\\\"SELECT * FROM County\\\")\\n\\n rows = cur.fetchall()\\n return rows # return the rows\",\n \"async def fetch_all(self, query: str, args: Optional[Iterable]=None) -> List:\\n stats.inc('queries', 'SQL')\\n async with self.pool.acquire() as conn:\\n async with conn.cursor() as cur:\\n await cur.execute(query, args)\\n ret = await cur.fetchall()\\n return ret\",\n \"def getKIDsPC():\\n\\tdb = MySQLdb.connect(host='tddb.astro.washington.edu', user='tddb', passwd='tddb', db='Kepler')\\n\\tcursor = db.cursor()\\n\\tfoo1 = 'select KID from KEPPC'\\n\\tcursor.execute(foo1)\\n\\tresults = cursor.fetchall()\\n\\tr1 = ([el[0] for el in results])\\n\\tresults=set(r1)\\n\\n\\treturn results\",\n \"def items(ctx):\\n config = buildConfig(ctx.obj[\\\"HOST\\\"], ctx.obj[\\\"PORT\\\"])\\n clientList = getClientList(config)\\n for client in clientList:\\n for id in slabIds(client.stats(\\\"items\\\")):\\n k = client.stats('cachedump', id, '0').keys()\\n for key in k:\\n click.echo(key)\\n click.echo(f\\\"*********** SERVER {client.server} contains {len(k)} keys\\\")\\n print()\"\n]","isConversational":false},"negative_scores":{"kind":"list like","value":["0.6438978","0.615843","0.61226875","0.59365004","0.5798395","0.5786192","0.5703405","0.56942713","0.5646254","0.5593451","0.5584262","0.556786","0.55544364","0.55305445","0.5511454","0.5496943","0.54856825","0.5469359","0.54657024","0.5449885","0.5416547","0.5397011","0.53886354","0.53704685","0.53529096","0.5352156","0.5348026","0.5345837","0.53373665","0.5335023","0.5330559","0.53250337","0.53172153","0.53054625","0.5303908","0.53027993","0.5301414","0.52699745","0.5255434","0.52226657","0.5215618","0.51926595","0.5192438","0.51920587","0.51888716","0.51786697","0.51734775","0.51648456","0.5164827","0.5163946","0.51428664","0.51423985","0.5135897","0.51346123","0.5134151","0.5131533","0.5130658","0.51272637","0.51270676","0.5120219","0.5113412","0.5112457","0.5110928","0.50977516","0.5081285","0.5080898","0.50753385","0.50734425","0.50621593","0.50541174","0.5048403","0.5046494","0.5046494","0.50442564","0.5039044","0.50337917","0.50292385","0.50195205","0.5018267","0.50145173","0.50138307","0.50107145","0.5008483","0.50046295","0.49932972","0.4991917","0.49869308","0.49827817","0.49797368","0.49763352","0.49701586","0.49652517","0.49637723","0.49609354","0.49544612","0.49524826","0.49524117","0.4951898","0.49495098","0.49443504"],"string":"[\n \"0.6438978\",\n \"0.615843\",\n \"0.61226875\",\n \"0.59365004\",\n \"0.5798395\",\n \"0.5786192\",\n \"0.5703405\",\n \"0.56942713\",\n \"0.5646254\",\n \"0.5593451\",\n \"0.5584262\",\n \"0.556786\",\n \"0.55544364\",\n \"0.55305445\",\n \"0.5511454\",\n \"0.5496943\",\n \"0.54856825\",\n \"0.5469359\",\n \"0.54657024\",\n \"0.5449885\",\n \"0.5416547\",\n \"0.5397011\",\n \"0.53886354\",\n \"0.53704685\",\n \"0.53529096\",\n \"0.5352156\",\n \"0.5348026\",\n \"0.5345837\",\n \"0.53373665\",\n \"0.5335023\",\n \"0.5330559\",\n \"0.53250337\",\n \"0.53172153\",\n \"0.53054625\",\n \"0.5303908\",\n \"0.53027993\",\n \"0.5301414\",\n \"0.52699745\",\n \"0.5255434\",\n \"0.52226657\",\n \"0.5215618\",\n \"0.51926595\",\n \"0.5192438\",\n \"0.51920587\",\n \"0.51888716\",\n \"0.51786697\",\n \"0.51734775\",\n \"0.51648456\",\n \"0.5164827\",\n \"0.5163946\",\n \"0.51428664\",\n \"0.51423985\",\n \"0.5135897\",\n \"0.51346123\",\n \"0.5134151\",\n \"0.5131533\",\n \"0.5130658\",\n \"0.51272637\",\n \"0.51270676\",\n \"0.5120219\",\n \"0.5113412\",\n \"0.5112457\",\n \"0.5110928\",\n \"0.50977516\",\n \"0.5081285\",\n \"0.5080898\",\n \"0.50753385\",\n \"0.50734425\",\n \"0.50621593\",\n \"0.50541174\",\n \"0.5048403\",\n \"0.5046494\",\n \"0.5046494\",\n \"0.50442564\",\n \"0.5039044\",\n \"0.50337917\",\n \"0.50292385\",\n \"0.50195205\",\n \"0.5018267\",\n \"0.50145173\",\n \"0.50138307\",\n \"0.50107145\",\n \"0.5008483\",\n \"0.50046295\",\n \"0.49932972\",\n \"0.4991917\",\n \"0.49869308\",\n \"0.49827817\",\n \"0.49797368\",\n \"0.49763352\",\n \"0.49701586\",\n \"0.49652517\",\n \"0.49637723\",\n \"0.49609354\",\n \"0.49544612\",\n \"0.49524826\",\n \"0.49524117\",\n \"0.4951898\",\n \"0.49495098\",\n \"0.49443504\"\n]","isConversational":false},"document_score":{"kind":"string","value":"0.58461624"},"document_rank":{"kind":"string","value":"4"}}},{"rowIdx":10194,"cells":{"query":{"kind":"string","value":"Querys PMS for all clients connected to PMS."},"document":{"kind":"string","value":"def client(self, name):\n for elem in self.query('/clients'):\n if elem.attrib.get('name').lower() == name.lower():\n baseurl = 'http://%s:%s' % (\n elem.attrib['address'], elem.attrib['port'])\n return PlexClient(baseurl, server=self, data=elem)\n raise NotFound('Unknown client name: %s' % name)"},"metadata":{"kind":"string","value":"{\n \"objective\": {\n \"self\": [],\n \"paired\": [],\n \"triplet\": [\n [\n \"query\",\n \"document\",\n \"negatives\"\n ]\n ]\n }\n}"},"negatives":{"kind":"list like","value":["def serviceQueries(self):\n #log.debug(f\"{self.name}: servicing queries for {len(self.connections)} connections.\")\n for ca, requester in self.connections.items():\n if requester.ims:\n log.info(\"Server %s received:\\n%s\\n\", self.name, requester.ims)\n requester.process()\n for label, msg in requester.process_results_iter():\n requester.send(msg, label=label)\n break # throttle just do one cue at a time\n\n if not requester.persistent: # not persistent so close and remove\n ix = self.server.ixes[ca]\n if not ix.txbs: # wait for outgoing txes to be empty\n self.closeConnection(ca)","def clients(self):\n self.update_results()\n return self._clients","def get_client_list(self):\r\n cursor = self.conn.cursor()\r\n cursor.execute(\"\"\"SELECT * FROM CLIENT\"\"\")\r\n return cursor.fetchall()","def redis_client_list(self):\n def func(server):\n return server.server.client_list()\n self.__run_redis_cmd(func)","def query_all(self):\n return multisearch.queries.QueryAll().connect(self)","def clients(self):\n items = []\n for elem in self.query('/clients'):\n baseurl = 'http://%s:%s' % (elem.attrib['address'],\n elem.attrib['port'])\n items.append(PlexClient(baseurl, server=self, data=elem))\n return items","def list(self):\n\t\tif self.client is None:\n\t\t\traise UsageError(\"Not connected!\")\n\t\treturn self.client.list_conns()","def queryAllRequests(self):\n logging.info(\"Querying all requests at ReqMgr instance ...\")\n r = self.reqMgrService.getRequestNames()\n print \"Found %s requests:\" % len(r)\n for req in r:\n print req","def get(self):\n return get_clientes()","def subscribedQueries(self):\n return map(Query.get, self.subscriptions)","def clients(self, protocol=None, groups=None):\n\n groups = self.check_parameters_for_validity(groups, \"group\", self.groups())\n retval = []\n if \"world\" in groups:\n q = self.query(Client).filter(Client.group == 'world')\n retval += list(q)\n if 'dev' in groups:\n q = self.query(Client).filter(Client.group == 'dev')\n retval += list(q)\n if 'eval' in groups:\n q = self.query(Client).filter(Client.group == 'eval')\n retval += list(q)\n return retval","def clients(self):\n return self._clients","def clients(self):\n\n try:\n req = requests.get(self.root_url + \"/clients\")\n except requests.exceptions.ConnectionError as e:\n req = None\n print(str(e), file=sys.stderr)\n except Exception as e:\n print(\"Unknown error making a request to the Sensu API\", file=sys.stderr)\n print(str(e), file=sys.stderr)\n\n if req and req.status_code == 200:\n dat = req.json()\n for host in dat:\n self.metrics.append(('sensu_status', host['status'], {'host': host['name'], 'dc': host['dc']}))","def get_clients():\n data = DataTable(document=ClientDocument, schema=ClientSchema).get_data\n return Response(data=data).send()","def list_clients(self):\n\n return self.clients_info","def queries(self):\n request = Request(method=\"get\", endpoint=\"/query/current\")\n\n def response_handler(resp):\n if not resp.is_success:\n raise C8QLQueryListError(resp, request)\n return self._format_queries(resp.body)\n\n return self._execute(request, response_handler)","def get_subscribed_clients(self, mtype):\n return self.hub.get_subscribed_clients(self.get_private_key(), mtype)","def get_all_servicech(self, conf):\n\t\tpass","def driver_queries(self) -> Iterable[Dict[str, str]]:\n return self.svc_queries","def get_elements(self):\n query = f\"select name, middle_name, last_name, age from `{self.table_id}`\"\n query_job = self.client.query(query)\n clients = []\n for row in query_job:\n print('Name', row['name'], 'middle name:', row['middle_name'], 'last name: ',row['last_name'], 'age:', row['age'])\n clients.append(Client(row['name'],row['middle_name'],row['last_name'],row['age']))\n return clients","def process_clients():\n for client in state.CLIENT_LIST:\n if client.active and client.cmd_ready:\n logging.debug(\"Found a message, processing...\")\n msg_processor(client)","def service(self):\n self.serviceConnects()\n self.serviceQueries()","async def get_objects(conn: Database, query):\n return await conn.fetch_all(query=query)","def update_clients():\n if rabbit.leader_node_is_ready() or rabbit.client_node_is_ready():\n for rid in relation_ids('amqp'):\n for unit in related_units(rid):\n amqp_changed(relation_id=rid, remote_unit=unit)","async def get_all(self) -> typing.List[Connection]:\n return [Connection.from_dict(conn) for conn in await self.query(CONNECTION_URL)]","def all(cls):\n return (cls(**client) for client in cls.collection().find({}))","def clients(self, r):\r\n return r.clients","def list_clients(): # Listar clientes\n global clients\n\n for idx, client in enumerate(clients):\n print('{}: {}'.format(idx, client))","def list_available_clients(self):\n connected_clients = self.all_clients.keys()\n return connected_clients","async def run_all_clients():\n completed_clients = 0\n for client_result in asyncio.as_completed(clients):\n completed_clients += await client_result\n return completed_clients","def get_subscribed_clients(self, private_key, mtype):\n return self._samp_hub.getSubscribedClients(private_key, mtype)","def _run_async_query(self, context):\n result = self._cb.get_object(self._doc_class.urlobject.format(self._cb.credentials.org_key))\n results = result.get(\"results\", [])\n self._total_results = len(results)\n self._count_valid = True\n return [self._doc_class(self._cb, item[\"id\"], item) for item in results]","def get_registered_clients(self):\n return self.hub.get_registered_clients(self.get_private_key())","def get_clients(self):\n\n return (self._clients['pps'], self._clients['pfs'])","def get_amp_computers(\n host=env.AMP.get(\"host\"),\n client_id=env.AMP_CLIENT_ID,\n api_key=env.AMP_API_KEY\n):\n print(\"\\n==> Computers from AMP\")\n url = f\"https://{client_id}:{api_key}@{host}/v1/computers\"\n response = requests.get(url, verify=False)\n response.raise_for_status()\n computers_list = response.json()[\"data\"] \n return computers_list","def query(self) -> QueryServiceProxy:\n if self._query_services is None:\n self._query_services = QueryServiceProxy(self)\n return self._query_services","def sitecurclntconnections(self) :\n\t\ttry :\n\t\t\treturn self._sitecurclntconnections\n\t\texcept Exception as e:\n\t\t\traise e","def get_mos_from_localhost(self):\n rewards = dict() # saves the reward of each client from each ap\n _, data = self.command_ap('localhost', 8080, '', \"/get_mos_client\") # the interface (3rd param) does not matter\n self.log.debug(\"data for MOS @ {} => {}\".format('all', data))\n stations = {'gnu-nb3': ['cloud'],\n 'fenrir': ['storm'],\n }\n for ap in self.aps:\n d = []\n for sta in stations[ap.name]:\n entries = [x[:4] for x in data if x[4] == sta]\n d.extend(entries)\n rs = self.get_rs(d)\n rewards[ap.id] = rs\n return rewards","def fetch_process_queries(self):\n url = \"/api/investigate/v1/orgs/{}/processes/search_jobs\".format(\n self.credentials.org_key\n )\n ids = self.get_object(url)\n return ids.get(\"query_ids\", [])","def get_all(self):\n return {\"parcels\": self.db}, 200","def clientlist(self) -> None:\n from bacommon.servermanager import ClientListCommand\n self._enqueue_server_command(ClientListCommand())\n self._block_for_command_completion()","def list(self):\n return self.connection.get(self.service)","def query(self):\n self.session_status()\n try:\n if self.keyword['limit'] == None:\n query = self.session.query(self.keyword['tablename']).filter(\n self.keyword['filter']).all()\n else:\n query = self.session.query(self.keyword['tablename']).filter(\n self.keyword['filter']).limit(self.keyword['limit']).all()\n except OperationalError:\n self.retry += 1\n if self.retry > self.max_retry_time:\n raise OperationalError, 'RETRY OUT'\n time.sleep(3)\n self.session.close()\n self.query()\n\n self.session.close()\n\n if not query:\n return []\n self.retry = 0\n return query","def get_all_crawlers(self):\n try:\n conn = psycopg2.connect(\"dbname='{0}'\".format(DATABASE))\n cur = conn.cursor(cursor_factory=psycopg2.extras.RealDictCursor)\n cur.execute(\"SELECT * FROM host WHERE type = 'Crawler';\")\n results = cur.fetchall()\n cur.close()\n return results\n except Exception as e:\n print(e)","def get_all(self) -> typing.List[Connection]:\n return [Connection.from_dict(conn) for conn in self.query(CONNECTION_URL)]","def clients(self):\n return ClientsTable(self.rpc, self.name)","def queries(self):\n return self.__queries","def select_all():\n sql = 'SELECT * FROM dostawy.przesylki'\n rows = DBconnector.fetch_query(sql)\n return _wrap_in_parcel_list(rows)","def get_queryset(self, request):\n user = request.user\n if is_superuser_or_manager(user):\n return super(ClientAdminConfig, self).get_queryset(request)\n\n return Client.objects.filter(\n Q(main_sales_contact=user)\n | Q(contracts__sales_contact=user)\n | Q(contracts__event__support_contact=user)\n ).distinct()","def collect(self, query_list):\n try:\n while True:\n # For each app, we iterate through the query list and make the API request.\n for current_app in range(self.number_apps):\n for q_index, current_query in enumerate(query_list):\n response = self.request_data(search_query=current_query, app_index=current_app)\n if utils.validate_response(response):\n # STORE DATA\n data = response.json()\n print(data.keys())\n #pass\n else:\n raise BadResponseError()\n except KeyboardInterrupt:\n return -1\n except BadResponseError:\n return -1","def get_clients():\n clients = Client.query.all()\n clients_schema = ClientSchema()\n result = clients_schema.dump(clients, many=True)\n return jsonify({'clients': result.data})","def get_active_clients():\n global drivers\n\n if not drivers:\n return jsonify([])\n\n result = {client: get_client_info(client) for client in drivers}\n return jsonify(result)","def fetchAll(self, *args, **kwargs):\n return KorAPClient.fetchAll(self, *args, **kwargs)","def get_clients(x_additional_headers: Optional[Dict[str, str]] = None, **kwargs):\n request = GetClients.create()\n return run_request(request, additional_headers=x_additional_headers, **kwargs)","def n1qlQueryAll(self, *args, **kwargs):\n if not self.connected:\n cb = lambda x: self.n1qlQueryAll(*args, **kwargs)\n return self.connect().addCallback(cb)\n\n kwargs['itercls'] = BatchedN1QLRequest\n o = super(RawBucket, self).n1ql_query(*args, **kwargs)\n o.start()\n return o._getDeferred()","def get_client_gyms(self, client_id):\r\n cursor = self.conn.cursor()\r\n cursor.execute(\"\"\"SELECT g.* \r\n FROM CLIENT_GYM AS cg\r\n JOIN GYM AS g ON cg.gym_id=g.id\r\n WHERE cg.client_id={}\"\"\".format(client_id))\r\n return cursor.fetchall()","def db_select_all(self):\n \n query = \"SELECT * FROM %s\" % PUBLICATIONS_TABLE\n with self.connection:\n c = self.connection.cursor()\n c.execute(query)\n return c.fetchall()","def clients():\n pass","def fetch_all(): \n client, index_name = connection_es()\n res = client.search(index = index_name+\"*\")\n return res","def _perform_query(self, from_row=0, max_rows=-1):\n result = self._cb.get_object(self._doc_class.urlobject.format(self._cb.credentials.org_key))\n results = result.get(\"results\", [])\n\n self._total_results = len(results)\n self._count_valid = True\n\n for item in results:\n yield self._doc_class(self._cb, item[\"id\"], item)","def select_clients(self, my_round, num_clients=20):\n samples_futures = []\n for cs in self.client_servers:\n samples_future = cs.select_clients.remote(my_round, num_clients)\n samples_futures.append(samples_future)\n\n return [p for future in samples_futures for p in ray.get(future)]","async def fetchall(self, query, connection=None):\n async with self.connection(connection) as conn:\n r = await conn.execute(query)\n return await r.fetchall()","def _getAllProvas(self):\n return self.execSql(\"select_all_provas\")","def all (self):\n sparql_results = self.query (\"\"\"\n select distinct ?rs ?session ?name ?number ?pid ?sitename\n where {\n \n ?rs rdf:type austalk:RecordedSession .\n ?rs olac:speaker ?participant .\n \n ?participant austalk:id ?pid .\n ?participant austalk:recording_site ?site .\n ?site rdfs:label ?sitename .\n \n ?rs austalk:prototype ?session .\n ?session austalk:name ?name .\n ?session austalk:id ?number .\n }\n ORDER BY ?name\"\"\")\n\n results = []\n\n for result in sparql_results[\"results\"][\"bindings\"]:\n\n results.append (Session (\n client = self.client,\n identifier = result[\"rs\"][\"value\"],\n prototype = result[\"session\"][\"value\"],\n name = result[\"name\"][\"value\"],\n number = result[\"number\"][\"value\"],\n site = result[\"sitename\"][\"value\"],\n participantId = result[\"pid\"][\"value\"]))\n\n return results","def get_clients(self, channel):\n if channel not in self.clients.keys():\n return []\n return self.clients[channel]","def get_all():\n return PushManager.query.all()","def list_all_customers(*args):\n logger.info(f\"Perparing dict of all products...\")\n all_customers_dict = {}\n\n with MONGO:\n mdb = eval(Settings.connect_string)\n customers = mdb[\"customers\"]\n all_customers = customers.find({})\n for customer in all_customers:\n user_id = customer[\"user_id\"]\n del customer[\"_id\"]\n del customer[\"user_id\"]\n all_customers_dict[user_id] = customer\n return all_customers_dict","def test_03_get_all_client(self):\n try:\n return_value = ClientsUnitTest._client_dao.get_clients()\n self.assertGreater(len(return_value), 1)\n\n except DBException as error:\n print(error.error_string())","def get_clients(self):\n clis = []\n for c in self._clients:\n clis.append(c.get_address())\n return clis","def get_clients(self):\n clis = []\n for c in self._clients:\n clis.append(c.get_address())\n return clis","def get_people(self):\n cur = self.conn.cursor(pymysql.cursors.DictCursor)\n\n cur.execute('SELECT name FROM Client;')\n\n return CursorIterator(cur)","def select_all_meetings(self):\n db_connection = DbConnection()\n\n try:\n connection = db_connection.get_connection()\n\n cursor = connection.cursor()\n cursor.execute(self.select_all_sql)\n rows = cursor.fetchall()\n\n cursor.close()\n db_connection.close_connection()\n except Exception:\n raise\n\n else:\n\n return rows","def clients(self, server):\n servers = coordinator.get_job_servers(self.job)\n for sid, name in servers.iteritems():\n if name == server:\n # assuming sid is zero-based and all sid < number of servers:\n clpsv = (self.numclients + len(servers) - 1) / len(servers)\n clients = range(self.numclients)[sid * clpsv:(sid + 1) * clpsv]\n return [str(n) for n in clients]\n return []","def send_query(self):\n results = []\n for username in self.constraints.get(\"usernames\", []):\n values = self.newt.get_usage(username)\n if values:\n with contextlib.suppress(KeyError):\n # Empty return from get_usage, so just move on\n results.extend(values[\"items\"])\n # filter results based on constraints specified in newt_keys dictionary\n newt_keys = self.constraints.get(\"newt_keys\", {})\n for key, values in newt_keys.items():\n k = key\n # The below remapping is needed for backward compatibility with\n # existing config files\n if key == \"rname\":\n k = \"repoName\"\n if key == \"repo_type\":\n k = \"repoType\"\n if values:\n results = [x for x in results if x[k] in values]\n return results","def get_all_clients(self) -> Sequence[MarathonClient]:\n return dedupe_clients(self.current + self.previous) # type: ignore","def view_all(options, client):\n if options.show_events:\n return display_events(client.events())\n\n return \"\".join([\n display.DisplayServices().format(client.services()),\n '\\n',\n display.DisplayJobs(options).format(client.jobs())\n ])","def classic_connect_all(self):\n return [s.classic_connect() for s in self.servers]","def _run_query(self):\n self._search_query()\n logger.debug(\"Payload\")\n logger.debug(self._payload)\n _resp = query_public_ip_pools(self._payload)\n logger.debug(_resp)\n _resp = self.load_json(_resp)\n _ret_list = []\n if _resp is None:\n self._record_total = self._record_filtered = 0\n return []\n _ret_list = _resp[\"ret_set\"]\n self._record_filtered = self._record_total = _resp.get(\"total_count\") or 100\n return _ret_list","def get_all_songs(self):\n to_send = self.db.get_all_songs()\n to_send = '$'.join(to_send)\n self.send_message(to_send)","def query(self):\n query_url = self.get_query_url()\n logging.info('Querying: ' + query_url)\n json_data = request.urlopen(query_url).read().decode()\n logging.debug('Retrieved the following ' + json_data)\n response = json.loads(json_data)\n\n return self.get_docs_from_response(response)","def all(self):\n return self.owner.hydrate(\n self.connection.query(\n self.to_qmark(), self._bindings) or self.owner.new_collection([])\n )","def load_clients(self):\n channel_dict = self.config.get('channels', {})\n for channel in channel_dict:\n self.add_channel(channel)\n for user_data in channel_dict.get(channel, []):\n self.subscribe(user_data['url'], user_data['key'], channel)","def get_all_psus(self):\n return self._psu_list","def askAll(self, query, context):\n return self.ask(query, context, False)","def get_all():\n return SavedQuery.get_all()","def queryThis(query: Query) -> list:\n q = str(query) # extra line for clarity. calls the __str__ magic function\n\n return list(client.query(q).result())","def multiQuery(self, query, limit):\n try:\n results = self.sp.search(query, limit)\n resultLists = results['tracks']['items']\n return resultLists\n except spotipy.SpotifyException as se:\n self.authenticate()\n return self.multiQuery(query, limit)","def listarClientes(self, request, context):\n context.set_code(grpc.StatusCode.UNIMPLEMENTED)\n context.set_details('Method not implemented!')\n raise NotImplementedError('Method not implemented!')","def available_clients(self, user_id: int) -> List[str]:\n return list(self.clients[user_id])","def query(self):\n pass","def get_all(self):\n url = self._dbname + '/_all'\n return self._connection.get(url).json()","def get_all(self):\n\n servers = self._scoped_servers()\n servers = [{u'id': x.id, u'name': x.name} for x in servers]\n return self.format_collection(servers)","async def fetch_all(self, query: str, args: Optional[Iterable]=None) -> List:\n stats.inc('queries', 'SQL')\n async with self.pool.acquire() as conn:\n async with conn.cursor() as cur:\n await cur.execute(query, args)\n ret = await cur.fetchall()\n return ret","def on_connect(self):\n if current_user.is_authenticated:\n polls = Poll.query \\\n .filter(User.rooms.any(User.id == current_user.id)) \\\n .filter(or_(Poll.visible.is_(True), Room.owner_id == current_user.id)).all()\n else:\n if session.get(\"rooms\") is not None:\n polls = Poll.query \\\n .filter(Room.id.in_(session.get(\"rooms\"))) \\\n .filter(Poll.visible.is_(True)).all()\n else:\n polls = []\n\n for poll in polls:\n join_room(poll.id)","def query(params: Params):\n return service.query(**params.query, n_neighbors=params.n_neighbors)","def talk_clients(self):\n c = self.conn.cursor()\n\n c.execute('''SELECT value FROM headers WHERE header = 'To' AND value NOT LIKE '%,%';''')\n\n clients = {'android': 0, 'Adium': 0, 'BlackBerry': 0, 'Festoon': 0, 'fire': 0,\n 'Gush': 0, 'Gaim': 0, 'gmail': 0, 'Meebo': 0, 'Miranda': 0,\n 'Psi': 0, 'iChat': 0, 'iGoogle': 0, 'IM+': 0, 'Talk': 0,\n 'Trillian': 0, 'Unknown': 0\n }\n for row in c.fetchall():\n try:\n domain = row[0].split('@', 1)[1]\n resource_part = domain.split('/', 1)[1]\n except IndexError: # Throws when the address does not have an @ or a / in the string.\n continue\n\n unknown = True\n for client in clients:\n if client in resource_part:\n clients[client] += 1\n unknown = False\n\n if unknown:\n clients['Unknown'] += 1\n\n for client in clients.keys():\n if clients[client] is 0:\n del clients[client]\n\n trace = pgo.Pie(\n labels=clients.keys(),\n values=clients.values(),\n marker=dict(\n colors=[\n self.config.get('color', 'primary'),\n self.config.get('color', 'secondary'),\n ]\n )\n )\n\n layout_args = plotly_default_layout_options()\n layout_args['title'] = 'Chat Clients'\n del layout_args['xaxis']\n del layout_args['yaxis']\n\n layout = pgo.Layout(**layout_args)\n\n return plotly_output(pgo.Figure(data=[trace], layout=layout))","def _scoped_servers(self):\n\n # If project scoped explicitly set the project list\n projects = None if utils.all_projects() else [pecan.request.token.project_id]\n\n # Must do a detailed search here as it returns the tenant_id field\n servers = self.compute.servers.list(search_opts={'all_tenants': 'True'})\n\n servers = Scope.filter(servers, projects=projects)\n return utils.paginate(servers, pecan.request.GET.get('marker'),\n pecan.request.GET.get('limit'))","def select_all_from_teachers_db(connection):\r\n with connection:\r\n f = connection.execute(GET_ALL_TEACHERS)\r\n return f.fetchall()","def get_all_pls_of_user(self, username):\n to_send = self.db.get_all_pls_of_user(username)\n to_send = DOLLAR.join(to_send)\n print(to_send)\n self.send_message(to_send)","def get_all_tickets():\n db_connect = DBConnect().mysql_connect(mysql_user='user5100',\n mysql_password='ePPkLlao')\n db_connect.execute(db_queries.query_all_tickets())\n db_results = db_connect.fetchall()\n db_connect.close()\n\n return query_response(db_results)","def getQueries(self):\r\n\t\tp=[]\r\n\t\tfor pa in self.session.query(Query):\r\n\t\t\tp.append(pa)\r\n\t\treturn p"],"string":"[\n \"def serviceQueries(self):\\n #log.debug(f\\\"{self.name}: servicing queries for {len(self.connections)} connections.\\\")\\n for ca, requester in self.connections.items():\\n if requester.ims:\\n log.info(\\\"Server %s received:\\\\n%s\\\\n\\\", self.name, requester.ims)\\n requester.process()\\n for label, msg in requester.process_results_iter():\\n requester.send(msg, label=label)\\n break # throttle just do one cue at a time\\n\\n if not requester.persistent: # not persistent so close and remove\\n ix = self.server.ixes[ca]\\n if not ix.txbs: # wait for outgoing txes to be empty\\n self.closeConnection(ca)\",\n \"def clients(self):\\n self.update_results()\\n return self._clients\",\n \"def get_client_list(self):\\r\\n cursor = self.conn.cursor()\\r\\n cursor.execute(\\\"\\\"\\\"SELECT * FROM CLIENT\\\"\\\"\\\")\\r\\n return cursor.fetchall()\",\n \"def redis_client_list(self):\\n def func(server):\\n return server.server.client_list()\\n self.__run_redis_cmd(func)\",\n \"def query_all(self):\\n return multisearch.queries.QueryAll().connect(self)\",\n \"def clients(self):\\n items = []\\n for elem in self.query('/clients'):\\n baseurl = 'http://%s:%s' % (elem.attrib['address'],\\n elem.attrib['port'])\\n items.append(PlexClient(baseurl, server=self, data=elem))\\n return items\",\n \"def list(self):\\n\\t\\tif self.client is None:\\n\\t\\t\\traise UsageError(\\\"Not connected!\\\")\\n\\t\\treturn self.client.list_conns()\",\n \"def queryAllRequests(self):\\n logging.info(\\\"Querying all requests at ReqMgr instance ...\\\")\\n r = self.reqMgrService.getRequestNames()\\n print \\\"Found %s requests:\\\" % len(r)\\n for req in r:\\n print req\",\n \"def get(self):\\n return get_clientes()\",\n \"def subscribedQueries(self):\\n return map(Query.get, self.subscriptions)\",\n \"def clients(self, protocol=None, groups=None):\\n\\n groups = self.check_parameters_for_validity(groups, \\\"group\\\", self.groups())\\n retval = []\\n if \\\"world\\\" in groups:\\n q = self.query(Client).filter(Client.group == 'world')\\n retval += list(q)\\n if 'dev' in groups:\\n q = self.query(Client).filter(Client.group == 'dev')\\n retval += list(q)\\n if 'eval' in groups:\\n q = self.query(Client).filter(Client.group == 'eval')\\n retval += list(q)\\n return retval\",\n \"def clients(self):\\n return self._clients\",\n \"def clients(self):\\n\\n try:\\n req = requests.get(self.root_url + \\\"/clients\\\")\\n except requests.exceptions.ConnectionError as e:\\n req = None\\n print(str(e), file=sys.stderr)\\n except Exception as e:\\n print(\\\"Unknown error making a request to the Sensu API\\\", file=sys.stderr)\\n print(str(e), file=sys.stderr)\\n\\n if req and req.status_code == 200:\\n dat = req.json()\\n for host in dat:\\n self.metrics.append(('sensu_status', host['status'], {'host': host['name'], 'dc': host['dc']}))\",\n \"def get_clients():\\n data = DataTable(document=ClientDocument, schema=ClientSchema).get_data\\n return Response(data=data).send()\",\n \"def list_clients(self):\\n\\n return self.clients_info\",\n \"def queries(self):\\n request = Request(method=\\\"get\\\", endpoint=\\\"/query/current\\\")\\n\\n def response_handler(resp):\\n if not resp.is_success:\\n raise C8QLQueryListError(resp, request)\\n return self._format_queries(resp.body)\\n\\n return self._execute(request, response_handler)\",\n \"def get_subscribed_clients(self, mtype):\\n return self.hub.get_subscribed_clients(self.get_private_key(), mtype)\",\n \"def get_all_servicech(self, conf):\\n\\t\\tpass\",\n \"def driver_queries(self) -> Iterable[Dict[str, str]]:\\n return self.svc_queries\",\n \"def get_elements(self):\\n query = f\\\"select name, middle_name, last_name, age from `{self.table_id}`\\\"\\n query_job = self.client.query(query)\\n clients = []\\n for row in query_job:\\n print('Name', row['name'], 'middle name:', row['middle_name'], 'last name: ',row['last_name'], 'age:', row['age'])\\n clients.append(Client(row['name'],row['middle_name'],row['last_name'],row['age']))\\n return clients\",\n \"def process_clients():\\n for client in state.CLIENT_LIST:\\n if client.active and client.cmd_ready:\\n logging.debug(\\\"Found a message, processing...\\\")\\n msg_processor(client)\",\n \"def service(self):\\n self.serviceConnects()\\n self.serviceQueries()\",\n \"async def get_objects(conn: Database, query):\\n return await conn.fetch_all(query=query)\",\n \"def update_clients():\\n if rabbit.leader_node_is_ready() or rabbit.client_node_is_ready():\\n for rid in relation_ids('amqp'):\\n for unit in related_units(rid):\\n amqp_changed(relation_id=rid, remote_unit=unit)\",\n \"async def get_all(self) -> typing.List[Connection]:\\n return [Connection.from_dict(conn) for conn in await self.query(CONNECTION_URL)]\",\n \"def all(cls):\\n return (cls(**client) for client in cls.collection().find({}))\",\n \"def clients(self, r):\\r\\n return r.clients\",\n \"def list_clients(): # Listar clientes\\n global clients\\n\\n for idx, client in enumerate(clients):\\n print('{}: {}'.format(idx, client))\",\n \"def list_available_clients(self):\\n connected_clients = self.all_clients.keys()\\n return connected_clients\",\n \"async def run_all_clients():\\n completed_clients = 0\\n for client_result in asyncio.as_completed(clients):\\n completed_clients += await client_result\\n return completed_clients\",\n \"def get_subscribed_clients(self, private_key, mtype):\\n return self._samp_hub.getSubscribedClients(private_key, mtype)\",\n \"def _run_async_query(self, context):\\n result = self._cb.get_object(self._doc_class.urlobject.format(self._cb.credentials.org_key))\\n results = result.get(\\\"results\\\", [])\\n self._total_results = len(results)\\n self._count_valid = True\\n return [self._doc_class(self._cb, item[\\\"id\\\"], item) for item in results]\",\n \"def get_registered_clients(self):\\n return self.hub.get_registered_clients(self.get_private_key())\",\n \"def get_clients(self):\\n\\n return (self._clients['pps'], self._clients['pfs'])\",\n \"def get_amp_computers(\\n host=env.AMP.get(\\\"host\\\"),\\n client_id=env.AMP_CLIENT_ID,\\n api_key=env.AMP_API_KEY\\n):\\n print(\\\"\\\\n==> Computers from AMP\\\")\\n url = f\\\"https://{client_id}:{api_key}@{host}/v1/computers\\\"\\n response = requests.get(url, verify=False)\\n response.raise_for_status()\\n computers_list = response.json()[\\\"data\\\"] \\n return computers_list\",\n \"def query(self) -> QueryServiceProxy:\\n if self._query_services is None:\\n self._query_services = QueryServiceProxy(self)\\n return self._query_services\",\n \"def sitecurclntconnections(self) :\\n\\t\\ttry :\\n\\t\\t\\treturn self._sitecurclntconnections\\n\\t\\texcept Exception as e:\\n\\t\\t\\traise e\",\n \"def get_mos_from_localhost(self):\\n rewards = dict() # saves the reward of each client from each ap\\n _, data = self.command_ap('localhost', 8080, '', \\\"/get_mos_client\\\") # the interface (3rd param) does not matter\\n self.log.debug(\\\"data for MOS @ {} => {}\\\".format('all', data))\\n stations = {'gnu-nb3': ['cloud'],\\n 'fenrir': ['storm'],\\n }\\n for ap in self.aps:\\n d = []\\n for sta in stations[ap.name]:\\n entries = [x[:4] for x in data if x[4] == sta]\\n d.extend(entries)\\n rs = self.get_rs(d)\\n rewards[ap.id] = rs\\n return rewards\",\n \"def fetch_process_queries(self):\\n url = \\\"/api/investigate/v1/orgs/{}/processes/search_jobs\\\".format(\\n self.credentials.org_key\\n )\\n ids = self.get_object(url)\\n return ids.get(\\\"query_ids\\\", [])\",\n \"def get_all(self):\\n return {\\\"parcels\\\": self.db}, 200\",\n \"def clientlist(self) -> None:\\n from bacommon.servermanager import ClientListCommand\\n self._enqueue_server_command(ClientListCommand())\\n self._block_for_command_completion()\",\n \"def list(self):\\n return self.connection.get(self.service)\",\n \"def query(self):\\n self.session_status()\\n try:\\n if self.keyword['limit'] == None:\\n query = self.session.query(self.keyword['tablename']).filter(\\n self.keyword['filter']).all()\\n else:\\n query = self.session.query(self.keyword['tablename']).filter(\\n self.keyword['filter']).limit(self.keyword['limit']).all()\\n except OperationalError:\\n self.retry += 1\\n if self.retry > self.max_retry_time:\\n raise OperationalError, 'RETRY OUT'\\n time.sleep(3)\\n self.session.close()\\n self.query()\\n\\n self.session.close()\\n\\n if not query:\\n return []\\n self.retry = 0\\n return query\",\n \"def get_all_crawlers(self):\\n try:\\n conn = psycopg2.connect(\\\"dbname='{0}'\\\".format(DATABASE))\\n cur = conn.cursor(cursor_factory=psycopg2.extras.RealDictCursor)\\n cur.execute(\\\"SELECT * FROM host WHERE type = 'Crawler';\\\")\\n results = cur.fetchall()\\n cur.close()\\n return results\\n except Exception as e:\\n print(e)\",\n \"def get_all(self) -> typing.List[Connection]:\\n return [Connection.from_dict(conn) for conn in self.query(CONNECTION_URL)]\",\n \"def clients(self):\\n return ClientsTable(self.rpc, self.name)\",\n \"def queries(self):\\n return self.__queries\",\n \"def select_all():\\n sql = 'SELECT * FROM dostawy.przesylki'\\n rows = DBconnector.fetch_query(sql)\\n return _wrap_in_parcel_list(rows)\",\n \"def get_queryset(self, request):\\n user = request.user\\n if is_superuser_or_manager(user):\\n return super(ClientAdminConfig, self).get_queryset(request)\\n\\n return Client.objects.filter(\\n Q(main_sales_contact=user)\\n | Q(contracts__sales_contact=user)\\n | Q(contracts__event__support_contact=user)\\n ).distinct()\",\n \"def collect(self, query_list):\\n try:\\n while True:\\n # For each app, we iterate through the query list and make the API request.\\n for current_app in range(self.number_apps):\\n for q_index, current_query in enumerate(query_list):\\n response = self.request_data(search_query=current_query, app_index=current_app)\\n if utils.validate_response(response):\\n # STORE DATA\\n data = response.json()\\n print(data.keys())\\n #pass\\n else:\\n raise BadResponseError()\\n except KeyboardInterrupt:\\n return -1\\n except BadResponseError:\\n return -1\",\n \"def get_clients():\\n clients = Client.query.all()\\n clients_schema = ClientSchema()\\n result = clients_schema.dump(clients, many=True)\\n return jsonify({'clients': result.data})\",\n \"def get_active_clients():\\n global drivers\\n\\n if not drivers:\\n return jsonify([])\\n\\n result = {client: get_client_info(client) for client in drivers}\\n return jsonify(result)\",\n \"def fetchAll(self, *args, **kwargs):\\n return KorAPClient.fetchAll(self, *args, **kwargs)\",\n \"def get_clients(x_additional_headers: Optional[Dict[str, str]] = None, **kwargs):\\n request = GetClients.create()\\n return run_request(request, additional_headers=x_additional_headers, **kwargs)\",\n \"def n1qlQueryAll(self, *args, **kwargs):\\n if not self.connected:\\n cb = lambda x: self.n1qlQueryAll(*args, **kwargs)\\n return self.connect().addCallback(cb)\\n\\n kwargs['itercls'] = BatchedN1QLRequest\\n o = super(RawBucket, self).n1ql_query(*args, **kwargs)\\n o.start()\\n return o._getDeferred()\",\n \"def get_client_gyms(self, client_id):\\r\\n cursor = self.conn.cursor()\\r\\n cursor.execute(\\\"\\\"\\\"SELECT g.* \\r\\n FROM CLIENT_GYM AS cg\\r\\n JOIN GYM AS g ON cg.gym_id=g.id\\r\\n WHERE cg.client_id={}\\\"\\\"\\\".format(client_id))\\r\\n return cursor.fetchall()\",\n \"def db_select_all(self):\\n \\n query = \\\"SELECT * FROM %s\\\" % PUBLICATIONS_TABLE\\n with self.connection:\\n c = self.connection.cursor()\\n c.execute(query)\\n return c.fetchall()\",\n \"def clients():\\n pass\",\n \"def fetch_all(): \\n client, index_name = connection_es()\\n res = client.search(index = index_name+\\\"*\\\")\\n return res\",\n \"def _perform_query(self, from_row=0, max_rows=-1):\\n result = self._cb.get_object(self._doc_class.urlobject.format(self._cb.credentials.org_key))\\n results = result.get(\\\"results\\\", [])\\n\\n self._total_results = len(results)\\n self._count_valid = True\\n\\n for item in results:\\n yield self._doc_class(self._cb, item[\\\"id\\\"], item)\",\n \"def select_clients(self, my_round, num_clients=20):\\n samples_futures = []\\n for cs in self.client_servers:\\n samples_future = cs.select_clients.remote(my_round, num_clients)\\n samples_futures.append(samples_future)\\n\\n return [p for future in samples_futures for p in ray.get(future)]\",\n \"async def fetchall(self, query, connection=None):\\n async with self.connection(connection) as conn:\\n r = await conn.execute(query)\\n return await r.fetchall()\",\n \"def _getAllProvas(self):\\n return self.execSql(\\\"select_all_provas\\\")\",\n \"def all (self):\\n sparql_results = self.query (\\\"\\\"\\\"\\n select distinct ?rs ?session ?name ?number ?pid ?sitename\\n where {\\n \\n ?rs rdf:type austalk:RecordedSession .\\n ?rs olac:speaker ?participant .\\n \\n ?participant austalk:id ?pid .\\n ?participant austalk:recording_site ?site .\\n ?site rdfs:label ?sitename .\\n \\n ?rs austalk:prototype ?session .\\n ?session austalk:name ?name .\\n ?session austalk:id ?number .\\n }\\n ORDER BY ?name\\\"\\\"\\\")\\n\\n results = []\\n\\n for result in sparql_results[\\\"results\\\"][\\\"bindings\\\"]:\\n\\n results.append (Session (\\n client = self.client,\\n identifier = result[\\\"rs\\\"][\\\"value\\\"],\\n prototype = result[\\\"session\\\"][\\\"value\\\"],\\n name = result[\\\"name\\\"][\\\"value\\\"],\\n number = result[\\\"number\\\"][\\\"value\\\"],\\n site = result[\\\"sitename\\\"][\\\"value\\\"],\\n participantId = result[\\\"pid\\\"][\\\"value\\\"]))\\n\\n return results\",\n \"def get_clients(self, channel):\\n if channel not in self.clients.keys():\\n return []\\n return self.clients[channel]\",\n \"def get_all():\\n return PushManager.query.all()\",\n \"def list_all_customers(*args):\\n logger.info(f\\\"Perparing dict of all products...\\\")\\n all_customers_dict = {}\\n\\n with MONGO:\\n mdb = eval(Settings.connect_string)\\n customers = mdb[\\\"customers\\\"]\\n all_customers = customers.find({})\\n for customer in all_customers:\\n user_id = customer[\\\"user_id\\\"]\\n del customer[\\\"_id\\\"]\\n del customer[\\\"user_id\\\"]\\n all_customers_dict[user_id] = customer\\n return all_customers_dict\",\n \"def test_03_get_all_client(self):\\n try:\\n return_value = ClientsUnitTest._client_dao.get_clients()\\n self.assertGreater(len(return_value), 1)\\n\\n except DBException as error:\\n print(error.error_string())\",\n \"def get_clients(self):\\n clis = []\\n for c in self._clients:\\n clis.append(c.get_address())\\n return clis\",\n \"def get_clients(self):\\n clis = []\\n for c in self._clients:\\n clis.append(c.get_address())\\n return clis\",\n \"def get_people(self):\\n cur = self.conn.cursor(pymysql.cursors.DictCursor)\\n\\n cur.execute('SELECT name FROM Client;')\\n\\n return CursorIterator(cur)\",\n \"def select_all_meetings(self):\\n db_connection = DbConnection()\\n\\n try:\\n connection = db_connection.get_connection()\\n\\n cursor = connection.cursor()\\n cursor.execute(self.select_all_sql)\\n rows = cursor.fetchall()\\n\\n cursor.close()\\n db_connection.close_connection()\\n except Exception:\\n raise\\n\\n else:\\n\\n return rows\",\n \"def clients(self, server):\\n servers = coordinator.get_job_servers(self.job)\\n for sid, name in servers.iteritems():\\n if name == server:\\n # assuming sid is zero-based and all sid < number of servers:\\n clpsv = (self.numclients + len(servers) - 1) / len(servers)\\n clients = range(self.numclients)[sid * clpsv:(sid + 1) * clpsv]\\n return [str(n) for n in clients]\\n return []\",\n \"def send_query(self):\\n results = []\\n for username in self.constraints.get(\\\"usernames\\\", []):\\n values = self.newt.get_usage(username)\\n if values:\\n with contextlib.suppress(KeyError):\\n # Empty return from get_usage, so just move on\\n results.extend(values[\\\"items\\\"])\\n # filter results based on constraints specified in newt_keys dictionary\\n newt_keys = self.constraints.get(\\\"newt_keys\\\", {})\\n for key, values in newt_keys.items():\\n k = key\\n # The below remapping is needed for backward compatibility with\\n # existing config files\\n if key == \\\"rname\\\":\\n k = \\\"repoName\\\"\\n if key == \\\"repo_type\\\":\\n k = \\\"repoType\\\"\\n if values:\\n results = [x for x in results if x[k] in values]\\n return results\",\n \"def get_all_clients(self) -> Sequence[MarathonClient]:\\n return dedupe_clients(self.current + self.previous) # type: ignore\",\n \"def view_all(options, client):\\n if options.show_events:\\n return display_events(client.events())\\n\\n return \\\"\\\".join([\\n display.DisplayServices().format(client.services()),\\n '\\\\n',\\n display.DisplayJobs(options).format(client.jobs())\\n ])\",\n \"def classic_connect_all(self):\\n return [s.classic_connect() for s in self.servers]\",\n \"def _run_query(self):\\n self._search_query()\\n logger.debug(\\\"Payload\\\")\\n logger.debug(self._payload)\\n _resp = query_public_ip_pools(self._payload)\\n logger.debug(_resp)\\n _resp = self.load_json(_resp)\\n _ret_list = []\\n if _resp is None:\\n self._record_total = self._record_filtered = 0\\n return []\\n _ret_list = _resp[\\\"ret_set\\\"]\\n self._record_filtered = self._record_total = _resp.get(\\\"total_count\\\") or 100\\n return _ret_list\",\n \"def get_all_songs(self):\\n to_send = self.db.get_all_songs()\\n to_send = '$'.join(to_send)\\n self.send_message(to_send)\",\n \"def query(self):\\n query_url = self.get_query_url()\\n logging.info('Querying: ' + query_url)\\n json_data = request.urlopen(query_url).read().decode()\\n logging.debug('Retrieved the following ' + json_data)\\n response = json.loads(json_data)\\n\\n return self.get_docs_from_response(response)\",\n \"def all(self):\\n return self.owner.hydrate(\\n self.connection.query(\\n self.to_qmark(), self._bindings) or self.owner.new_collection([])\\n )\",\n \"def load_clients(self):\\n channel_dict = self.config.get('channels', {})\\n for channel in channel_dict:\\n self.add_channel(channel)\\n for user_data in channel_dict.get(channel, []):\\n self.subscribe(user_data['url'], user_data['key'], channel)\",\n \"def get_all_psus(self):\\n return self._psu_list\",\n \"def askAll(self, query, context):\\n return self.ask(query, context, False)\",\n \"def get_all():\\n return SavedQuery.get_all()\",\n \"def queryThis(query: Query) -> list:\\n q = str(query) # extra line for clarity. calls the __str__ magic function\\n\\n return list(client.query(q).result())\",\n \"def multiQuery(self, query, limit):\\n try:\\n results = self.sp.search(query, limit)\\n resultLists = results['tracks']['items']\\n return resultLists\\n except spotipy.SpotifyException as se:\\n self.authenticate()\\n return self.multiQuery(query, limit)\",\n \"def listarClientes(self, request, context):\\n context.set_code(grpc.StatusCode.UNIMPLEMENTED)\\n context.set_details('Method not implemented!')\\n raise NotImplementedError('Method not implemented!')\",\n \"def available_clients(self, user_id: int) -> List[str]:\\n return list(self.clients[user_id])\",\n \"def query(self):\\n pass\",\n \"def get_all(self):\\n url = self._dbname + '/_all'\\n return self._connection.get(url).json()\",\n \"def get_all(self):\\n\\n servers = self._scoped_servers()\\n servers = [{u'id': x.id, u'name': x.name} for x in servers]\\n return self.format_collection(servers)\",\n \"async def fetch_all(self, query: str, args: Optional[Iterable]=None) -> List:\\n stats.inc('queries', 'SQL')\\n async with self.pool.acquire() as conn:\\n async with conn.cursor() as cur:\\n await cur.execute(query, args)\\n ret = await cur.fetchall()\\n return ret\",\n \"def on_connect(self):\\n if current_user.is_authenticated:\\n polls = Poll.query \\\\\\n .filter(User.rooms.any(User.id == current_user.id)) \\\\\\n .filter(or_(Poll.visible.is_(True), Room.owner_id == current_user.id)).all()\\n else:\\n if session.get(\\\"rooms\\\") is not None:\\n polls = Poll.query \\\\\\n .filter(Room.id.in_(session.get(\\\"rooms\\\"))) \\\\\\n .filter(Poll.visible.is_(True)).all()\\n else:\\n polls = []\\n\\n for poll in polls:\\n join_room(poll.id)\",\n \"def query(params: Params):\\n return service.query(**params.query, n_neighbors=params.n_neighbors)\",\n \"def talk_clients(self):\\n c = self.conn.cursor()\\n\\n c.execute('''SELECT value FROM headers WHERE header = 'To' AND value NOT LIKE '%,%';''')\\n\\n clients = {'android': 0, 'Adium': 0, 'BlackBerry': 0, 'Festoon': 0, 'fire': 0,\\n 'Gush': 0, 'Gaim': 0, 'gmail': 0, 'Meebo': 0, 'Miranda': 0,\\n 'Psi': 0, 'iChat': 0, 'iGoogle': 0, 'IM+': 0, 'Talk': 0,\\n 'Trillian': 0, 'Unknown': 0\\n }\\n for row in c.fetchall():\\n try:\\n domain = row[0].split('@', 1)[1]\\n resource_part = domain.split('/', 1)[1]\\n except IndexError: # Throws when the address does not have an @ or a / in the string.\\n continue\\n\\n unknown = True\\n for client in clients:\\n if client in resource_part:\\n clients[client] += 1\\n unknown = False\\n\\n if unknown:\\n clients['Unknown'] += 1\\n\\n for client in clients.keys():\\n if clients[client] is 0:\\n del clients[client]\\n\\n trace = pgo.Pie(\\n labels=clients.keys(),\\n values=clients.values(),\\n marker=dict(\\n colors=[\\n self.config.get('color', 'primary'),\\n self.config.get('color', 'secondary'),\\n ]\\n )\\n )\\n\\n layout_args = plotly_default_layout_options()\\n layout_args['title'] = 'Chat Clients'\\n del layout_args['xaxis']\\n del layout_args['yaxis']\\n\\n layout = pgo.Layout(**layout_args)\\n\\n return plotly_output(pgo.Figure(data=[trace], layout=layout))\",\n \"def _scoped_servers(self):\\n\\n # If project scoped explicitly set the project list\\n projects = None if utils.all_projects() else [pecan.request.token.project_id]\\n\\n # Must do a detailed search here as it returns the tenant_id field\\n servers = self.compute.servers.list(search_opts={'all_tenants': 'True'})\\n\\n servers = Scope.filter(servers, projects=projects)\\n return utils.paginate(servers, pecan.request.GET.get('marker'),\\n pecan.request.GET.get('limit'))\",\n \"def select_all_from_teachers_db(connection):\\r\\n with connection:\\r\\n f = connection.execute(GET_ALL_TEACHERS)\\r\\n return f.fetchall()\",\n \"def get_all_pls_of_user(self, username):\\n to_send = self.db.get_all_pls_of_user(username)\\n to_send = DOLLAR.join(to_send)\\n print(to_send)\\n self.send_message(to_send)\",\n \"def get_all_tickets():\\n db_connect = DBConnect().mysql_connect(mysql_user='user5100',\\n mysql_password='ePPkLlao')\\n db_connect.execute(db_queries.query_all_tickets())\\n db_results = db_connect.fetchall()\\n db_connect.close()\\n\\n return query_response(db_results)\",\n \"def getQueries(self):\\r\\n\\t\\tp=[]\\r\\n\\t\\tfor pa in self.session.query(Query):\\r\\n\\t\\t\\tp.append(pa)\\r\\n\\t\\treturn p\"\n]","isConversational":false},"negative_scores":{"kind":"list like","value":["0.65767473","0.6232553","0.60960466","0.5942476","0.5886892","0.58853275","0.57991374","0.578795","0.5773331","0.5660284","0.565363","0.56275344","0.55649745","0.556454","0.5544258","0.5528457","0.55071217","0.5499738","0.549224","0.5471458","0.54629916","0.5437001","0.5425069","0.5419216","0.5417178","0.53970414","0.53748727","0.5373154","0.5370409","0.5338754","0.533269","0.5327129","0.5323352","0.53188944","0.53134775","0.5303828","0.5265627","0.5253842","0.523023","0.5228405","0.52245456","0.52187026","0.52167994","0.5213536","0.5203858","0.5187911","0.51815474","0.5171844","0.51672333","0.5163913","0.5158656","0.5157618","0.5137588","0.5130102","0.5124103","0.5120621","0.5113494","0.5111519","0.5109903","0.50899684","0.50796264","0.50642645","0.5063698","0.50581056","0.5057162","0.5055965","0.5055387","0.5050776","0.5046518","0.5046518","0.50438255","0.5043266","0.5039289","0.5037473","0.5035464","0.50348556","0.5024653","0.500883","0.50014013","0.4998987","0.49930057","0.4991266","0.4990917","0.49906638","0.49896047","0.49849597","0.4970005","0.4967937","0.4966553","0.49654934","0.4965298","0.49641573","0.49629712","0.49625564","0.4949517","0.49481782","0.49459133","0.4929864","0.49289525","0.4927209","0.49260247"],"string":"[\n \"0.65767473\",\n \"0.6232553\",\n \"0.60960466\",\n \"0.5942476\",\n \"0.5886892\",\n \"0.58853275\",\n \"0.57991374\",\n \"0.578795\",\n \"0.5773331\",\n \"0.5660284\",\n \"0.565363\",\n \"0.56275344\",\n \"0.55649745\",\n \"0.556454\",\n \"0.5544258\",\n \"0.5528457\",\n \"0.55071217\",\n \"0.5499738\",\n \"0.549224\",\n \"0.5471458\",\n \"0.54629916\",\n \"0.5437001\",\n \"0.5425069\",\n \"0.5419216\",\n \"0.5417178\",\n \"0.53970414\",\n \"0.53748727\",\n \"0.5373154\",\n \"0.5370409\",\n \"0.5338754\",\n \"0.533269\",\n \"0.5327129\",\n \"0.5323352\",\n \"0.53188944\",\n \"0.53134775\",\n \"0.5303828\",\n \"0.5265627\",\n \"0.5253842\",\n \"0.523023\",\n \"0.5228405\",\n \"0.52245456\",\n \"0.52187026\",\n \"0.52167994\",\n \"0.5213536\",\n \"0.5203858\",\n \"0.5187911\",\n \"0.51815474\",\n \"0.5171844\",\n \"0.51672333\",\n \"0.5163913\",\n \"0.5158656\",\n \"0.5157618\",\n \"0.5137588\",\n \"0.5130102\",\n \"0.5124103\",\n \"0.5120621\",\n \"0.5113494\",\n \"0.5111519\",\n \"0.5109903\",\n \"0.50899684\",\n \"0.50796264\",\n \"0.50642645\",\n \"0.5063698\",\n \"0.50581056\",\n \"0.5057162\",\n \"0.5055965\",\n \"0.5055387\",\n \"0.5050776\",\n \"0.5046518\",\n \"0.5046518\",\n \"0.50438255\",\n \"0.5043266\",\n \"0.5039289\",\n \"0.5037473\",\n \"0.5035464\",\n \"0.50348556\",\n \"0.5024653\",\n \"0.500883\",\n \"0.50014013\",\n \"0.4998987\",\n \"0.49930057\",\n \"0.4991266\",\n \"0.4990917\",\n \"0.49906638\",\n \"0.49896047\",\n \"0.49849597\",\n \"0.4970005\",\n \"0.4967937\",\n \"0.4966553\",\n \"0.49654934\",\n \"0.4965298\",\n \"0.49641573\",\n \"0.49629712\",\n \"0.49625564\",\n \"0.4949517\",\n \"0.49481782\",\n \"0.49459133\",\n \"0.4929864\",\n \"0.49289525\",\n \"0.4927209\",\n \"0.49260247\"\n]","isConversational":false},"document_score":{"kind":"string","value":"0.0"},"document_rank":{"kind":"string","value":"-1"}}},{"rowIdx":10195,"cells":{"query":{"kind":"string","value":"Headers given to PMS."},"document":{"kind":"string","value":"def headers(self):\n headers = BASE_HEADERS\n if self.token:\n headers['X-Plex-Token'] = self.token\n return headers"},"metadata":{"kind":"string","value":"{\n \"objective\": {\n \"self\": [],\n \"paired\": [],\n \"triplet\": [\n [\n \"query\",\n \"document\",\n \"negatives\"\n ]\n ]\n }\n}"},"negatives":{"kind":"list like","value":["def headers(self) -> dict:\n raise NotImplementedError # pragma: no cover","def get_headers(self):\r\n raise NotImplementedError","def getAllHeaders():","def headers(self):\n\n return None","def headers(self) -> Mapping[str, str]:\n return pulumi.get(self, \"headers\")","def get_headers(self):\n return ['dep_red', 'dep_sd', 'hyp_red', 'hyp_sd']","def define_headers(self):\n return {}","def headers(cls):\n return [\n 'Patient Last Name',\n 'Patient First Name',\n 'Patient DOB',\n 'Patient Acct No'\n ]","def requestheaders(self, flow: mitmproxy.http.HTTPFlow):\n pass","def requestheaders(self, flow: mitmproxy.http.HTTPFlow):\n pass","def requestheaders(self, flow: mitmproxy.http.HTTPFlow):","def headers(self, v):\n raise NotImplementedError","def _headers(self):\n\n auth_token = SendbeeAuth(self.client.api_secret).get_auth_token()\n headers = {\n 'X-Auth-Token': auth_token,\n 'X-Api-Key': self.client.api_key,\n 'Accept': 'application/json',\n 'Content-Type': 'application/json',\n 'User-Agent': 'Sendbee Python API Client'\n }\n self.debug.ok('headers', headers)\n\n return headers","def generate_headers(self):\n raise NotImplementedError()","def _headers(self) -> Mapping[str, str]:\n return {}","def _headers(self) -> Mapping[str, str]:\n return self.auth.headers() if self.auth else {}","def _headers(self, **kwargs):\n headers = BASE_HEADERS.copy()\n if self._token:\n headers['X-Plex-Token'] = self._token\n headers.update(kwargs)\n return headers","def _headers(self, **kwargs):\n headers = BASE_HEADERS.copy()\n if self._token:\n headers['X-Plex-Token'] = self._token\n headers.update(kwargs)\n return headers","def __get_headers(self):\n\n return {}","def get_headers(self):\n \n return self.headers","def responseheaders(self, flow: mitmproxy.http.HTTPFlow):","def responseheaders(self, flow: mitmproxy.http.HTTPFlow):\n pass","def responseheaders(self, flow: mitmproxy.http.HTTPFlow):\n pass","def headers(self) -> Sequence['outputs.HeaderResponse']:\n return pulumi.get(self, \"headers\")","def headers(self):\n return self.generator.headers","def get_headers(self, environ=None):\n return [('Content-Type', 'application/json')]","def headers(self):\r\n return dict(**self._get_headers())","def headers(self):\n return self._header","def currentSBHeaders(self):\n headers = {}\n for header_name in [options['Headers','classification_header_name'],\n options['Headers','mailid_header_name'],\n options['Headers','classification_header_name'] + \"-ID\",\n options['Headers','thermostat_header_name'],\n options['Headers','evidence_header_name'],\n options['Headers','score_header_name'],\n options['Headers','trained_header_name'],\n ]:\n value = self[header_name]\n if value is not None:\n headers[header_name] = value\n return headers","def get_headers():\n headers = {\n \"Authorization\": \"Token {}\".format(get_token()),\n }\n\n return headers","def get_bp_headers(self) -> None:\n self.bp_headers = []\n for bp in self.body_parts_lst:\n c1, c2, c3 = (f\"{bp}_x\", f\"{bp}_y\", f\"{bp}_p\")\n self.bp_headers.extend((c1, c2, c3))","def _headers(self):\n auth = AuthenticationProvider.currentAuth()\n\n return {\n 'Authorization': '%s %s' % (auth.tokenType, auth.accessToken),\n 'Content-Type': 'application/json'}","def get_headers():\n if not headers:\n headers[\"Content-Type\"] = \"application/json\"\n headers[\"Accept\"] = \"application/json\"\n headers[\"User-Agent\"] = constants.USER_AGENT\n headers[\"Authorization\"] = get_token(constants.AUTH_URL, cfg[\"key\"])\n\n return headers\n\n return headers","def headers():\n return {\n 'user-agent': 'integration-tester',\n 'content-type': 'application/json',\n }","def _get_headers() -> dict:\n api_key = API_KEY_CRED_LOADER.load_credentials()\n api_secret = API_SECRET_CRED_LOADER.load_credentials()\n return {\"Authorization\": \"sso-key {}:{}\".format(api_key, api_secret)}","def fill_headers(self, headers):\n self.headers = {h[0]: h[1] for h in headers}","def getHeaders(self):\n hd = {}\n line = self.conn.readline()\n while line != \"\\r\\n\":\n print \":\"+line+\":\"+\" len = \",len(line)\n key,value = line.split(':',1)\n hd[key] = value.rstrip()\n line = self.conn.readline()\n return hd","def headers(self):\n return [h for h, _ in self.data]","def headers(self):\n return Dict(**self._get_headers())","def parse_header(self):","def _build_headers(self):\n headers = {}\n headers.update(self.data_sources)\n headers.update(self.seasons)\n headers.update(self.region)\n headers.update(self.subregions)\n return headers","def get_headers(self):\n return [('Content-Type', self.MULTIPART_HEADER % self.boundary)]","def test_build_headers(self):\n\n headers = self_signed.build_headers()\n assert 'Content-Length' in headers\n assert 'X-Amz-Date' in headers\n assert 'Host' in headers\n assert 'X-Amz-Security-Token' in headers\n assert 'Content-Type' in headers\n assert 'Authorization' in headers","def get_headers(self):\n return self.numHeadList","def get_http_headers(self):\n return dict(self.headers)","def headers(self):\n payload = {inflection.underscore(k): v for k, v, in self._headers.items()}\n HeadersTuple = namedtuple('HeadersTuple', sorted(payload))\n the_tuple = HeadersTuple(**payload)\n return the_tuple","def _headers(self) -> dict[str, str]:\n headers = super()._headers()\n headers[\"Authorization\"] = f\"Bearer {self.__token}\"\n return headers","def headers(self) -> Optional[pulumi.Input[Mapping[str, pulumi.Input[str]]]]:\n return pulumi.get(self, \"headers\")","def get_bp_headers(self) -> None:\n self.col_headers = []\n for bp in self.body_parts_lst:\n c1, c2, c3 = (f\"{bp}_x\", f\"{bp}_y\", f\"{bp}_p\")\n self.col_headers.extend((c1, c2, c3))","def header(self, fields):\n return fields","def getAllHeaders(self, req):\n headers = {}\n for k, v in req.requestHeaders.getAllRawHeaders():\n headers[k.lower()] = v[-1]\n return headers","def headers(self):\n return(self.__response.headers)","def getheaders(self):\n return self.__headers","def get_headers(self, environ):\n return [('Content-Type', 'text/html'),\n ('Access-Control-Allow-Origin', '*')]","def _headers(helper):\n return {\n 'Authorization': 'Splunk {0}'.format(\n helper.context_meta['session_key'])}","def getHeaders(self):\n\n\t\tself.line = self.mctalFile.readline().split()\n\n\t\tif len(self.line) == 7:\n\t\t\tself.header.kod = self.line[0]\n\t\t\tself.header.ver = self.line[1]\n\t\t\tpID_date = self.line[2]\n\t\t\tself.header.probid = np.append(self.header.probid, pID_date)\n\t\t\tpID_time = self.line[3]\n\t\t\tself.header.probid = np.append(self.header.probid, pID_time)\n\t\t\tself.header.knod = int(self.line[4])\n\t\t\tself.header.nps = int(self.line[5])\n\t\t\tself.header.rnr = int(self.line[6])\n\t\telif len(self.line) == 3:\n\t\t\tself.header.knod = int(self.line[0])\n\t\t\tself.header.nps = int(self.line[1])\n\t\t\tself.header.rnr = int(self.line[2])\n\t\t\t\n\n\t\tself.header.title = self.mctalFile.readline().strip()\n\n\t\tself.line = self.mctalFile.readline().split()\n\n\t\tself.header.ntal = int(self.line[1])\n\n\t\tif self.header.ntal == 0:\n\t\t\tprint >> sys.stderr, \"\\n \\033[1;31mNo tallies in this MCTAL file. Exiting.\\033[0m\\n\"\n\t\t\tsys.exit(1)\n\n\t\tif len(self.line) == 4:\n\t\t\tself.header.npert = int(self.line[3])\n\t\t\tprint >> sys.stderr, \"\\n \\033[1;31mMCTAL file with perturbation card. Not supported. Exiting.\\033[0m\\n\"\n\t\t\tsys.exit(1)\n\n\t\tself.line = self.mctalFile.readline().split()\n\n\t\twhile self.line[0].lower() != \"tally\":\n\t\t\tfor l in self.line: self.header.ntals = np.append(self.header.ntals,int(l))\n\t\t\tself.line = self.mctalFile.readline().split()","def getHeaders(self):\n return [\"Temp\"]","def get_headers(self) -> Dict[str, str]:\n header_dict = self.generate_auth_dict()\n\n return {\n \"Authorization\": \"Basic \" + header_dict[\"signature\"],\n \"Content-Type\": 'application/json',\n }","def test_headers(self):\n self.assert_expected_token_value()","def headers(self):\n header_list = [(_RESPONSE_HEADER_DICT.get(k, k), v) for k, v in self._headers.iteritems()]\n if hasattr(self, '_cookies'):\n for v in self._cookies.itervalues():\n header_list.append(('Set-Cookie', v))\n header_list.append(_HEADER_X_POWERED_BY)\n return header_list","def get_headers(self,\n method,\n url,\n params) -> Dict[str, Any]:\n payload = self.generate_payload(method, url, params)\n headers = {\n \"Authorization\": f\"HS256 {payload}\",\n \"Content-Type\": \"application/x-www-form-urlencoded\",\n }\n return headers","def _headers(self, headers_dict):\n return Headers(dict((k,[v]) for (k,v) in headers_dict.items()))","def _headers(self, **kwargs):\n headers = BASE_HEADERS.copy()\n if self.headers:\n headers.update(self.headers)\n headers.update(kwargs)\n return headers","def _unpack_headers(self, headers):\n return dict((k,v[0]) for (k,v) in headers.getAllRawHeaders())","def get_headers(self):\n return {\n 'Authorization': 'JWT {}'.format(self.token)\n }","def get_headers(self):\n headers = {\n \"Content-Type\": \"application/json\",\n \"Authorization\": \"Basic %s\" % self.rest_auth_key\n }\n return headers","def spamHeaders(self) -> Tuple[List[str], Dict[str, str]]:\n sections = [\"STATUS\", \"TITLE\", \"PROJECT\", \"FILE\", \"SITE\", \"CHANNAME\", \"DATA\"]\n sectionHeaders = {}\n sectionHeaders[\"STATUS\"] = [\"STATUS\"]\n sectionHeaders[\"TITLE\"] = [\"AUTHOR\", \"VERSION\", \"DATE\", \"COMMENT\"]\n sectionHeaders[\"FILE\"] = [\"NAME\", \"FREQBAND\", \"DATE\"]\n sectionHeaders[\"CHANNAME\"] = [\"ITEMS\", \"NAME\"]\n sectionHeaders[\"DATA\"] = [\"ITEMS\", \"CHAN\"]\n return sections, sectionHeaders","def http_headers(self) -> Optional[pulumi.Input[Sequence[pulumi.Input['HTTPHeaderArgs']]]]:\n return pulumi.get(self, \"http_headers\")","def _build_headers(self):\n headers = {\n 'Authorization': 'Bearer {api_key}'.format(api_key=self._api_key),\n 'SplitSDKVersion': SDK_VERSION,\n 'Accept-Encoding': 'gzip'\n }\n\n if self._split_sdk_machine_name is not None:\n headers['SplitSDKMachineName'] = self._split_sdk_machine_name() \\\n if callable(self._split_sdk_machine_name) else self._split_sdk_machine_name\n\n if self._split_sdk_machine_ip is not None:\n headers['SplitSDKMachineIP'] = self._split_sdk_machine_ip() \\\n if callable(self._split_sdk_machine_ip) else self._split_sdk_machine_ip\n\n return headers","def get_headers(self):\n # Creating headers.\n headers = {'accept': 'text/html,application/xhtml+xml,application/xml;q=0.9,image/webp,*/*;q=0.8',\n 'accept-encoding': 'gzip, deflate, sdch, br',\n 'accept-language': 'en-GB,en;q=0.8,en-US;q=0.6,ml;q=0.4',\n 'cache-control': 'max-age=0',\n 'upgrade-insecure-requests': '1',\n 'user-agent': 'Mozilla/5.0 (X11; Linux x86_64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/74.0.3729.131 Safari/537.36'}\n return headers","def get_headers():\n headers = []\n for field in Isolate._meta.get_fields():\n if field.name != \"organism_group\" and field.name != \"amr_genotypes\":\n headers.append(field.name)\n return headers","def __get_headers(self, passed_headers: Dict) -> Dict:\n\n # User-Agent for HTTP request\n library_details = [\n f\"requests {requests.__version__}\",\n f\"python {platform.python_version()}\",\n f\"connector {self.__class__.__name__}\",\n ]\n library_details = \"; \".join(library_details)\n user_agent = f\"Infermedica-API-Python {__version__} ({library_details})\"\n\n headers = {\n \"Accept\": \"application/json\",\n \"User-Agent\": user_agent,\n \"App-Id\": self.app_id,\n \"App-Key\": self.app_key,\n }\n headers.update(self.default_headers)\n headers.update(passed_headers) # Make sure passed headers take precedence\n return headers","def get_headers(self):\n headers = []\n for text, level in self._headers:\n headers.append(text)\n return headers","def _make_headers() -> CaseInsensitiveDict:\n headers = CaseInsensitiveDict()\n headers['Authorization'] = f'Token {os.environ[\"TOKEN\"]}'\n headers['Content-type'] = 'application/json'\n return headers","def _get_headers(self, request):\n headers = {}\n for key, value in request.META.items():\n if key.startswith('HTTP_') and key != 'HTTP_HOST':\n headers[key[5:].replace('_', '-')] = value\n elif key in ('CONTENT_TYPE', 'CONTENT_LENGTH') and value:\n headers[key.replace('_', '-')] = value\n\n if request.user:\n headers['PARTNER-EMAIL'] = request.user.email\n lang = self._get_lang(request)\n if lang:\n headers['ACCEPT-LANGUAGE'] = lang\n return headers","def get_headers() -> dict:\n headers = {}\n token = GoogleAuthService.get_report_api_token()\n if token:\n headers['Authorization'] = 'Bearer {}'.format(token)\n return headers","def __parseHeaders(headers):\n global __all_headers\n if headers and len(headers) > 0:\n for header in headers:\n name = header.getElementsByTagName(\"name\")[0].childNodes[0].data\n value = header.getElementsByTagName(\"value\")[0].childNodes[0].data\n __addHeader(name, value)\n #print(__all_headers)","def get_headers_for_print(self):\n lines_for_print = []\n for header in self.metadata:\n lines_for_print.append(self.metadata[header])\n lines_for_print.append('\\t'.join(self.header))\n lines_for_print[-1] = '#' + lines_for_print[-1]\n return lines_for_print","def updateheader(self, headerlist=[], http_s_obj=None):\n header = {}\n for headerparam in headerlist:\n key_value = headerparam.split(\":\", 1)\n if len(key_value) == 2:\n try:\n key = key_value[0]\n value = key_value[1].strip()\n header.update({key: value})\n if http_s_obj:\n if http_s_obj.header.get(key):\n http_s_obj.header.update({key: value})\n except Exception:\n continue\n return header","def get_headers(input_header):\n if input_header:\n header = input_header\n else:\n header = create_marconi_headers()\n\n return header","def view_headers():\n\n return jsonify(get_dict('headers'))","def parse_header(self): # -> list[Unknown]:\n ...","def __headers(content_type='application/json'):\n headers = {\n 'accept': content_type,\n 'content-type': content_type,\n }\n return headers","def check_headers(self, headers):\n h = headers.values()[0]\n\n if 'DT' in PAR:\n if h.dt != PAR.DT:\n h.dt = PAR.DT\n\n if 'NT' in PAR:\n if h.nt != PAR.NT:\n print 'Warning: h.nt != PAR.NT'\n\n if 'NREC' in PAR:\n if h.nr != PAR.NREC:\n print 'Warning: h.nr != PAR.NREC'\n\n return h","def Show_Headers( self ):\r\n self.system.Change_Seq( \"Header\" )","def fusion_api_get_headers(self):\n return self.fusion_client._headers.copy()","def getheaders(self):\n return self.urllib3_response.getheaders()","def getheaders(self):\n return self.urllib3_response.getheaders()","def getheaders(self):\n return self.urllib3_response.getheaders()","def get_headers(self, session, **kwargs):\n token = self.get_token(session)\n\n if not token:\n return None\n\n return {IDENTITY_AUTH_HEADER_NAME: token}","def Headers(self):\n if self._headers is None:\n return None\n if len(self._headers) == 0:\n return None\n return self._headers","def get_header():\n str_list = ['specimennumber','speciesid','group','family','genus','species','scientificname', \\\n 'commonname','country','state','county','locality','latitude','longitude', \\\n 'source','accuracy','drainagename','centroidtype','huc8name','huc8', \\\n 'huc10name','huc10','huc12name','huc12','date','year','month','day','status','comments', \\\n 'recordtype','disposal','museumcatnumber','freshmarineintro','references']\n return str_list","def Headers_items0():\n assert_eq(\n sorted(k for k, v in Headers(API_KEY, API_SECRET).items()),\n ['x-dnsme-apiKey', 'x-dnsme-hmac', 'x-dnsme-requestDate'])","def headers(self) -> Optional[Mapping[str, Any]]:\n if hasattr(self, \"_headers\"):\n return self._headers\n return None","def writeHeaders(code, headers):\n pass","def getHeader():\n return _HEADER","def header( self ):\n\t\treturn '; '.join( [ '='.join(i) for i in self.items() ] )","def header(self):\n ...","def get_headers() -> dict:\n\n return {\"Connection\": \"keep-alive\",\n \"Cache-Control\": \"max-age=0\",\n \"Upgrade-Insecure-Requests\": 1,\n \"User-Agent\": (\"Mozilla/5.0 (X11; Linux x86_64)\"\n \" AppleWebKit/537.36 (KHTML, like Gecko) \"\n \"Chrome/73.0.3683.86 Safari/537.36\"),\n \"Accept\": (\"text/html,application/xhtml+xml,\"\n \"application/xml;q=0.9,image/webp,\"\n \"image/apng,*/*;q=0.8,\"\n \"application/signed-exchange;v=b3\"),\n \"Accept-Encoding\": \"gzip, deflate, br\",\n \"Accept-Language\": \"en-US,en;q=0.9\"}","def get_headers(self, ):\n return self.attrs.get(self.AttributeNames.HEADERS, None)"],"string":"[\n \"def headers(self) -> dict:\\n raise NotImplementedError # pragma: no cover\",\n \"def get_headers(self):\\r\\n raise NotImplementedError\",\n \"def getAllHeaders():\",\n \"def headers(self):\\n\\n return None\",\n \"def headers(self) -> Mapping[str, str]:\\n return pulumi.get(self, \\\"headers\\\")\",\n \"def get_headers(self):\\n return ['dep_red', 'dep_sd', 'hyp_red', 'hyp_sd']\",\n \"def define_headers(self):\\n return {}\",\n \"def headers(cls):\\n return [\\n 'Patient Last Name',\\n 'Patient First Name',\\n 'Patient DOB',\\n 'Patient Acct No'\\n ]\",\n \"def requestheaders(self, flow: mitmproxy.http.HTTPFlow):\\n pass\",\n \"def requestheaders(self, flow: mitmproxy.http.HTTPFlow):\\n pass\",\n \"def requestheaders(self, flow: mitmproxy.http.HTTPFlow):\",\n \"def headers(self, v):\\n raise NotImplementedError\",\n \"def _headers(self):\\n\\n auth_token = SendbeeAuth(self.client.api_secret).get_auth_token()\\n headers = {\\n 'X-Auth-Token': auth_token,\\n 'X-Api-Key': self.client.api_key,\\n 'Accept': 'application/json',\\n 'Content-Type': 'application/json',\\n 'User-Agent': 'Sendbee Python API Client'\\n }\\n self.debug.ok('headers', headers)\\n\\n return headers\",\n \"def generate_headers(self):\\n raise NotImplementedError()\",\n \"def _headers(self) -> Mapping[str, str]:\\n return {}\",\n \"def _headers(self) -> Mapping[str, str]:\\n return self.auth.headers() if self.auth else {}\",\n \"def _headers(self, **kwargs):\\n headers = BASE_HEADERS.copy()\\n if self._token:\\n headers['X-Plex-Token'] = self._token\\n headers.update(kwargs)\\n return headers\",\n \"def _headers(self, **kwargs):\\n headers = BASE_HEADERS.copy()\\n if self._token:\\n headers['X-Plex-Token'] = self._token\\n headers.update(kwargs)\\n return headers\",\n \"def __get_headers(self):\\n\\n return {}\",\n \"def get_headers(self):\\n \\n return self.headers\",\n \"def responseheaders(self, flow: mitmproxy.http.HTTPFlow):\",\n \"def responseheaders(self, flow: mitmproxy.http.HTTPFlow):\\n pass\",\n \"def responseheaders(self, flow: mitmproxy.http.HTTPFlow):\\n pass\",\n \"def headers(self) -> Sequence['outputs.HeaderResponse']:\\n return pulumi.get(self, \\\"headers\\\")\",\n \"def headers(self):\\n return self.generator.headers\",\n \"def get_headers(self, environ=None):\\n return [('Content-Type', 'application/json')]\",\n \"def headers(self):\\r\\n return dict(**self._get_headers())\",\n \"def headers(self):\\n return self._header\",\n \"def currentSBHeaders(self):\\n headers = {}\\n for header_name in [options['Headers','classification_header_name'],\\n options['Headers','mailid_header_name'],\\n options['Headers','classification_header_name'] + \\\"-ID\\\",\\n options['Headers','thermostat_header_name'],\\n options['Headers','evidence_header_name'],\\n options['Headers','score_header_name'],\\n options['Headers','trained_header_name'],\\n ]:\\n value = self[header_name]\\n if value is not None:\\n headers[header_name] = value\\n return headers\",\n \"def get_headers():\\n headers = {\\n \\\"Authorization\\\": \\\"Token {}\\\".format(get_token()),\\n }\\n\\n return headers\",\n \"def get_bp_headers(self) -> None:\\n self.bp_headers = []\\n for bp in self.body_parts_lst:\\n c1, c2, c3 = (f\\\"{bp}_x\\\", f\\\"{bp}_y\\\", f\\\"{bp}_p\\\")\\n self.bp_headers.extend((c1, c2, c3))\",\n \"def _headers(self):\\n auth = AuthenticationProvider.currentAuth()\\n\\n return {\\n 'Authorization': '%s %s' % (auth.tokenType, auth.accessToken),\\n 'Content-Type': 'application/json'}\",\n \"def get_headers():\\n if not headers:\\n headers[\\\"Content-Type\\\"] = \\\"application/json\\\"\\n headers[\\\"Accept\\\"] = \\\"application/json\\\"\\n headers[\\\"User-Agent\\\"] = constants.USER_AGENT\\n headers[\\\"Authorization\\\"] = get_token(constants.AUTH_URL, cfg[\\\"key\\\"])\\n\\n return headers\\n\\n return headers\",\n \"def headers():\\n return {\\n 'user-agent': 'integration-tester',\\n 'content-type': 'application/json',\\n }\",\n \"def _get_headers() -> dict:\\n api_key = API_KEY_CRED_LOADER.load_credentials()\\n api_secret = API_SECRET_CRED_LOADER.load_credentials()\\n return {\\\"Authorization\\\": \\\"sso-key {}:{}\\\".format(api_key, api_secret)}\",\n \"def fill_headers(self, headers):\\n self.headers = {h[0]: h[1] for h in headers}\",\n \"def getHeaders(self):\\n hd = {}\\n line = self.conn.readline()\\n while line != \\\"\\\\r\\\\n\\\":\\n print \\\":\\\"+line+\\\":\\\"+\\\" len = \\\",len(line)\\n key,value = line.split(':',1)\\n hd[key] = value.rstrip()\\n line = self.conn.readline()\\n return hd\",\n \"def headers(self):\\n return [h for h, _ in self.data]\",\n \"def headers(self):\\n return Dict(**self._get_headers())\",\n \"def parse_header(self):\",\n \"def _build_headers(self):\\n headers = {}\\n headers.update(self.data_sources)\\n headers.update(self.seasons)\\n headers.update(self.region)\\n headers.update(self.subregions)\\n return headers\",\n \"def get_headers(self):\\n return [('Content-Type', self.MULTIPART_HEADER % self.boundary)]\",\n \"def test_build_headers(self):\\n\\n headers = self_signed.build_headers()\\n assert 'Content-Length' in headers\\n assert 'X-Amz-Date' in headers\\n assert 'Host' in headers\\n assert 'X-Amz-Security-Token' in headers\\n assert 'Content-Type' in headers\\n assert 'Authorization' in headers\",\n \"def get_headers(self):\\n return self.numHeadList\",\n \"def get_http_headers(self):\\n return dict(self.headers)\",\n \"def headers(self):\\n payload = {inflection.underscore(k): v for k, v, in self._headers.items()}\\n HeadersTuple = namedtuple('HeadersTuple', sorted(payload))\\n the_tuple = HeadersTuple(**payload)\\n return the_tuple\",\n \"def _headers(self) -> dict[str, str]:\\n headers = super()._headers()\\n headers[\\\"Authorization\\\"] = f\\\"Bearer {self.__token}\\\"\\n return headers\",\n \"def headers(self) -> Optional[pulumi.Input[Mapping[str, pulumi.Input[str]]]]:\\n return pulumi.get(self, \\\"headers\\\")\",\n \"def get_bp_headers(self) -> None:\\n self.col_headers = []\\n for bp in self.body_parts_lst:\\n c1, c2, c3 = (f\\\"{bp}_x\\\", f\\\"{bp}_y\\\", f\\\"{bp}_p\\\")\\n self.col_headers.extend((c1, c2, c3))\",\n \"def header(self, fields):\\n return fields\",\n \"def getAllHeaders(self, req):\\n headers = {}\\n for k, v in req.requestHeaders.getAllRawHeaders():\\n headers[k.lower()] = v[-1]\\n return headers\",\n \"def headers(self):\\n return(self.__response.headers)\",\n \"def getheaders(self):\\n return self.__headers\",\n \"def get_headers(self, environ):\\n return [('Content-Type', 'text/html'),\\n ('Access-Control-Allow-Origin', '*')]\",\n \"def _headers(helper):\\n return {\\n 'Authorization': 'Splunk {0}'.format(\\n helper.context_meta['session_key'])}\",\n \"def getHeaders(self):\\n\\n\\t\\tself.line = self.mctalFile.readline().split()\\n\\n\\t\\tif len(self.line) == 7:\\n\\t\\t\\tself.header.kod = self.line[0]\\n\\t\\t\\tself.header.ver = self.line[1]\\n\\t\\t\\tpID_date = self.line[2]\\n\\t\\t\\tself.header.probid = np.append(self.header.probid, pID_date)\\n\\t\\t\\tpID_time = self.line[3]\\n\\t\\t\\tself.header.probid = np.append(self.header.probid, pID_time)\\n\\t\\t\\tself.header.knod = int(self.line[4])\\n\\t\\t\\tself.header.nps = int(self.line[5])\\n\\t\\t\\tself.header.rnr = int(self.line[6])\\n\\t\\telif len(self.line) == 3:\\n\\t\\t\\tself.header.knod = int(self.line[0])\\n\\t\\t\\tself.header.nps = int(self.line[1])\\n\\t\\t\\tself.header.rnr = int(self.line[2])\\n\\t\\t\\t\\n\\n\\t\\tself.header.title = self.mctalFile.readline().strip()\\n\\n\\t\\tself.line = self.mctalFile.readline().split()\\n\\n\\t\\tself.header.ntal = int(self.line[1])\\n\\n\\t\\tif self.header.ntal == 0:\\n\\t\\t\\tprint >> sys.stderr, \\\"\\\\n \\\\033[1;31mNo tallies in this MCTAL file. Exiting.\\\\033[0m\\\\n\\\"\\n\\t\\t\\tsys.exit(1)\\n\\n\\t\\tif len(self.line) == 4:\\n\\t\\t\\tself.header.npert = int(self.line[3])\\n\\t\\t\\tprint >> sys.stderr, \\\"\\\\n \\\\033[1;31mMCTAL file with perturbation card. Not supported. Exiting.\\\\033[0m\\\\n\\\"\\n\\t\\t\\tsys.exit(1)\\n\\n\\t\\tself.line = self.mctalFile.readline().split()\\n\\n\\t\\twhile self.line[0].lower() != \\\"tally\\\":\\n\\t\\t\\tfor l in self.line: self.header.ntals = np.append(self.header.ntals,int(l))\\n\\t\\t\\tself.line = self.mctalFile.readline().split()\",\n \"def getHeaders(self):\\n return [\\\"Temp\\\"]\",\n \"def get_headers(self) -> Dict[str, str]:\\n header_dict = self.generate_auth_dict()\\n\\n return {\\n \\\"Authorization\\\": \\\"Basic \\\" + header_dict[\\\"signature\\\"],\\n \\\"Content-Type\\\": 'application/json',\\n }\",\n \"def test_headers(self):\\n self.assert_expected_token_value()\",\n \"def headers(self):\\n header_list = [(_RESPONSE_HEADER_DICT.get(k, k), v) for k, v in self._headers.iteritems()]\\n if hasattr(self, '_cookies'):\\n for v in self._cookies.itervalues():\\n header_list.append(('Set-Cookie', v))\\n header_list.append(_HEADER_X_POWERED_BY)\\n return header_list\",\n \"def get_headers(self,\\n method,\\n url,\\n params) -> Dict[str, Any]:\\n payload = self.generate_payload(method, url, params)\\n headers = {\\n \\\"Authorization\\\": f\\\"HS256 {payload}\\\",\\n \\\"Content-Type\\\": \\\"application/x-www-form-urlencoded\\\",\\n }\\n return headers\",\n \"def _headers(self, headers_dict):\\n return Headers(dict((k,[v]) for (k,v) in headers_dict.items()))\",\n \"def _headers(self, **kwargs):\\n headers = BASE_HEADERS.copy()\\n if self.headers:\\n headers.update(self.headers)\\n headers.update(kwargs)\\n return headers\",\n \"def _unpack_headers(self, headers):\\n return dict((k,v[0]) for (k,v) in headers.getAllRawHeaders())\",\n \"def get_headers(self):\\n return {\\n 'Authorization': 'JWT {}'.format(self.token)\\n }\",\n \"def get_headers(self):\\n headers = {\\n \\\"Content-Type\\\": \\\"application/json\\\",\\n \\\"Authorization\\\": \\\"Basic %s\\\" % self.rest_auth_key\\n }\\n return headers\",\n \"def spamHeaders(self) -> Tuple[List[str], Dict[str, str]]:\\n sections = [\\\"STATUS\\\", \\\"TITLE\\\", \\\"PROJECT\\\", \\\"FILE\\\", \\\"SITE\\\", \\\"CHANNAME\\\", \\\"DATA\\\"]\\n sectionHeaders = {}\\n sectionHeaders[\\\"STATUS\\\"] = [\\\"STATUS\\\"]\\n sectionHeaders[\\\"TITLE\\\"] = [\\\"AUTHOR\\\", \\\"VERSION\\\", \\\"DATE\\\", \\\"COMMENT\\\"]\\n sectionHeaders[\\\"FILE\\\"] = [\\\"NAME\\\", \\\"FREQBAND\\\", \\\"DATE\\\"]\\n sectionHeaders[\\\"CHANNAME\\\"] = [\\\"ITEMS\\\", \\\"NAME\\\"]\\n sectionHeaders[\\\"DATA\\\"] = [\\\"ITEMS\\\", \\\"CHAN\\\"]\\n return sections, sectionHeaders\",\n \"def http_headers(self) -> Optional[pulumi.Input[Sequence[pulumi.Input['HTTPHeaderArgs']]]]:\\n return pulumi.get(self, \\\"http_headers\\\")\",\n \"def _build_headers(self):\\n headers = {\\n 'Authorization': 'Bearer {api_key}'.format(api_key=self._api_key),\\n 'SplitSDKVersion': SDK_VERSION,\\n 'Accept-Encoding': 'gzip'\\n }\\n\\n if self._split_sdk_machine_name is not None:\\n headers['SplitSDKMachineName'] = self._split_sdk_machine_name() \\\\\\n if callable(self._split_sdk_machine_name) else self._split_sdk_machine_name\\n\\n if self._split_sdk_machine_ip is not None:\\n headers['SplitSDKMachineIP'] = self._split_sdk_machine_ip() \\\\\\n if callable(self._split_sdk_machine_ip) else self._split_sdk_machine_ip\\n\\n return headers\",\n \"def get_headers(self):\\n # Creating headers.\\n headers = {'accept': 'text/html,application/xhtml+xml,application/xml;q=0.9,image/webp,*/*;q=0.8',\\n 'accept-encoding': 'gzip, deflate, sdch, br',\\n 'accept-language': 'en-GB,en;q=0.8,en-US;q=0.6,ml;q=0.4',\\n 'cache-control': 'max-age=0',\\n 'upgrade-insecure-requests': '1',\\n 'user-agent': 'Mozilla/5.0 (X11; Linux x86_64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/74.0.3729.131 Safari/537.36'}\\n return headers\",\n \"def get_headers():\\n headers = []\\n for field in Isolate._meta.get_fields():\\n if field.name != \\\"organism_group\\\" and field.name != \\\"amr_genotypes\\\":\\n headers.append(field.name)\\n return headers\",\n \"def __get_headers(self, passed_headers: Dict) -> Dict:\\n\\n # User-Agent for HTTP request\\n library_details = [\\n f\\\"requests {requests.__version__}\\\",\\n f\\\"python {platform.python_version()}\\\",\\n f\\\"connector {self.__class__.__name__}\\\",\\n ]\\n library_details = \\\"; \\\".join(library_details)\\n user_agent = f\\\"Infermedica-API-Python {__version__} ({library_details})\\\"\\n\\n headers = {\\n \\\"Accept\\\": \\\"application/json\\\",\\n \\\"User-Agent\\\": user_agent,\\n \\\"App-Id\\\": self.app_id,\\n \\\"App-Key\\\": self.app_key,\\n }\\n headers.update(self.default_headers)\\n headers.update(passed_headers) # Make sure passed headers take precedence\\n return headers\",\n \"def get_headers(self):\\n headers = []\\n for text, level in self._headers:\\n headers.append(text)\\n return headers\",\n \"def _make_headers() -> CaseInsensitiveDict:\\n headers = CaseInsensitiveDict()\\n headers['Authorization'] = f'Token {os.environ[\\\"TOKEN\\\"]}'\\n headers['Content-type'] = 'application/json'\\n return headers\",\n \"def _get_headers(self, request):\\n headers = {}\\n for key, value in request.META.items():\\n if key.startswith('HTTP_') and key != 'HTTP_HOST':\\n headers[key[5:].replace('_', '-')] = value\\n elif key in ('CONTENT_TYPE', 'CONTENT_LENGTH') and value:\\n headers[key.replace('_', '-')] = value\\n\\n if request.user:\\n headers['PARTNER-EMAIL'] = request.user.email\\n lang = self._get_lang(request)\\n if lang:\\n headers['ACCEPT-LANGUAGE'] = lang\\n return headers\",\n \"def get_headers() -> dict:\\n headers = {}\\n token = GoogleAuthService.get_report_api_token()\\n if token:\\n headers['Authorization'] = 'Bearer {}'.format(token)\\n return headers\",\n \"def __parseHeaders(headers):\\n global __all_headers\\n if headers and len(headers) > 0:\\n for header in headers:\\n name = header.getElementsByTagName(\\\"name\\\")[0].childNodes[0].data\\n value = header.getElementsByTagName(\\\"value\\\")[0].childNodes[0].data\\n __addHeader(name, value)\\n #print(__all_headers)\",\n \"def get_headers_for_print(self):\\n lines_for_print = []\\n for header in self.metadata:\\n lines_for_print.append(self.metadata[header])\\n lines_for_print.append('\\\\t'.join(self.header))\\n lines_for_print[-1] = '#' + lines_for_print[-1]\\n return lines_for_print\",\n \"def updateheader(self, headerlist=[], http_s_obj=None):\\n header = {}\\n for headerparam in headerlist:\\n key_value = headerparam.split(\\\":\\\", 1)\\n if len(key_value) == 2:\\n try:\\n key = key_value[0]\\n value = key_value[1].strip()\\n header.update({key: value})\\n if http_s_obj:\\n if http_s_obj.header.get(key):\\n http_s_obj.header.update({key: value})\\n except Exception:\\n continue\\n return header\",\n \"def get_headers(input_header):\\n if input_header:\\n header = input_header\\n else:\\n header = create_marconi_headers()\\n\\n return header\",\n \"def view_headers():\\n\\n return jsonify(get_dict('headers'))\",\n \"def parse_header(self): # -> list[Unknown]:\\n ...\",\n \"def __headers(content_type='application/json'):\\n headers = {\\n 'accept': content_type,\\n 'content-type': content_type,\\n }\\n return headers\",\n \"def check_headers(self, headers):\\n h = headers.values()[0]\\n\\n if 'DT' in PAR:\\n if h.dt != PAR.DT:\\n h.dt = PAR.DT\\n\\n if 'NT' in PAR:\\n if h.nt != PAR.NT:\\n print 'Warning: h.nt != PAR.NT'\\n\\n if 'NREC' in PAR:\\n if h.nr != PAR.NREC:\\n print 'Warning: h.nr != PAR.NREC'\\n\\n return h\",\n \"def Show_Headers( self ):\\r\\n self.system.Change_Seq( \\\"Header\\\" )\",\n \"def fusion_api_get_headers(self):\\n return self.fusion_client._headers.copy()\",\n \"def getheaders(self):\\n return self.urllib3_response.getheaders()\",\n \"def getheaders(self):\\n return self.urllib3_response.getheaders()\",\n \"def getheaders(self):\\n return self.urllib3_response.getheaders()\",\n \"def get_headers(self, session, **kwargs):\\n token = self.get_token(session)\\n\\n if not token:\\n return None\\n\\n return {IDENTITY_AUTH_HEADER_NAME: token}\",\n \"def Headers(self):\\n if self._headers is None:\\n return None\\n if len(self._headers) == 0:\\n return None\\n return self._headers\",\n \"def get_header():\\n str_list = ['specimennumber','speciesid','group','family','genus','species','scientificname', \\\\\\n 'commonname','country','state','county','locality','latitude','longitude', \\\\\\n 'source','accuracy','drainagename','centroidtype','huc8name','huc8', \\\\\\n 'huc10name','huc10','huc12name','huc12','date','year','month','day','status','comments', \\\\\\n 'recordtype','disposal','museumcatnumber','freshmarineintro','references']\\n return str_list\",\n \"def Headers_items0():\\n assert_eq(\\n sorted(k for k, v in Headers(API_KEY, API_SECRET).items()),\\n ['x-dnsme-apiKey', 'x-dnsme-hmac', 'x-dnsme-requestDate'])\",\n \"def headers(self) -> Optional[Mapping[str, Any]]:\\n if hasattr(self, \\\"_headers\\\"):\\n return self._headers\\n return None\",\n \"def writeHeaders(code, headers):\\n pass\",\n \"def getHeader():\\n return _HEADER\",\n \"def header( self ):\\n\\t\\treturn '; '.join( [ '='.join(i) for i in self.items() ] )\",\n \"def header(self):\\n ...\",\n \"def get_headers() -> dict:\\n\\n return {\\\"Connection\\\": \\\"keep-alive\\\",\\n \\\"Cache-Control\\\": \\\"max-age=0\\\",\\n \\\"Upgrade-Insecure-Requests\\\": 1,\\n \\\"User-Agent\\\": (\\\"Mozilla/5.0 (X11; Linux x86_64)\\\"\\n \\\" AppleWebKit/537.36 (KHTML, like Gecko) \\\"\\n \\\"Chrome/73.0.3683.86 Safari/537.36\\\"),\\n \\\"Accept\\\": (\\\"text/html,application/xhtml+xml,\\\"\\n \\\"application/xml;q=0.9,image/webp,\\\"\\n \\\"image/apng,*/*;q=0.8,\\\"\\n \\\"application/signed-exchange;v=b3\\\"),\\n \\\"Accept-Encoding\\\": \\\"gzip, deflate, br\\\",\\n \\\"Accept-Language\\\": \\\"en-US,en;q=0.9\\\"}\",\n \"def get_headers(self, ):\\n return self.attrs.get(self.AttributeNames.HEADERS, None)\"\n]","isConversational":false},"negative_scores":{"kind":"list like","value":["0.7567973","0.7393012","0.7389167","0.72775483","0.7240663","0.723666","0.720173","0.720087","0.71737015","0.71737015","0.7157145","0.7148502","0.7143607","0.7109385","0.7090964","0.7078412","0.70776564","0.70776564","0.70469546","0.70202124","0.70194054","0.7015218","0.7015218","0.69858074","0.69853276","0.6932256","0.69217527","0.69046086","0.69038224","0.69021106","0.68593633","0.684705","0.68167484","0.68094003","0.6795991","0.6774253","0.67720485","0.67710096","0.67486864","0.67280734","0.6716529","0.67012036","0.6697459","0.6678518","0.66755867","0.6672829","0.6666974","0.6625317","0.6616722","0.66137","0.6609172","0.6598105","0.6588702","0.6587794","0.65827686","0.65740734","0.65668553","0.6564881","0.6560801","0.65587157","0.65475065","0.6542334","0.6540024","0.6529773","0.6526346","0.65044665","0.6500647","0.6487939","0.64875895","0.6478537","0.64524114","0.64519143","0.6447438","0.6442982","0.6438029","0.6425583","0.6423055","0.63894314","0.63763475","0.63636386","0.63527995","0.6352688","0.6329102","0.6321364","0.63199306","0.63074297","0.6306641","0.6306641","0.6306641","0.63056135","0.63033307","0.6294913","0.62939376","0.62901396","0.62888753","0.6282107","0.6279059","0.62655467","0.626451","0.62540805"],"string":"[\n \"0.7567973\",\n \"0.7393012\",\n \"0.7389167\",\n \"0.72775483\",\n \"0.7240663\",\n \"0.723666\",\n \"0.720173\",\n \"0.720087\",\n \"0.71737015\",\n \"0.71737015\",\n \"0.7157145\",\n \"0.7148502\",\n \"0.7143607\",\n \"0.7109385\",\n \"0.7090964\",\n \"0.7078412\",\n \"0.70776564\",\n \"0.70776564\",\n \"0.70469546\",\n \"0.70202124\",\n \"0.70194054\",\n \"0.7015218\",\n \"0.7015218\",\n \"0.69858074\",\n \"0.69853276\",\n \"0.6932256\",\n \"0.69217527\",\n \"0.69046086\",\n \"0.69038224\",\n \"0.69021106\",\n \"0.68593633\",\n \"0.684705\",\n \"0.68167484\",\n \"0.68094003\",\n \"0.6795991\",\n \"0.6774253\",\n \"0.67720485\",\n \"0.67710096\",\n \"0.67486864\",\n \"0.67280734\",\n \"0.6716529\",\n \"0.67012036\",\n \"0.6697459\",\n \"0.6678518\",\n \"0.66755867\",\n \"0.6672829\",\n \"0.6666974\",\n \"0.6625317\",\n \"0.6616722\",\n \"0.66137\",\n \"0.6609172\",\n \"0.6598105\",\n \"0.6588702\",\n \"0.6587794\",\n \"0.65827686\",\n \"0.65740734\",\n \"0.65668553\",\n \"0.6564881\",\n \"0.6560801\",\n \"0.65587157\",\n \"0.65475065\",\n \"0.6542334\",\n \"0.6540024\",\n \"0.6529773\",\n \"0.6526346\",\n \"0.65044665\",\n \"0.6500647\",\n \"0.6487939\",\n \"0.64875895\",\n \"0.6478537\",\n \"0.64524114\",\n \"0.64519143\",\n \"0.6447438\",\n \"0.6442982\",\n \"0.6438029\",\n \"0.6425583\",\n \"0.6423055\",\n \"0.63894314\",\n \"0.63763475\",\n \"0.63636386\",\n \"0.63527995\",\n \"0.6352688\",\n \"0.6329102\",\n \"0.6321364\",\n \"0.63199306\",\n \"0.63074297\",\n \"0.6306641\",\n \"0.6306641\",\n \"0.6306641\",\n \"0.63056135\",\n \"0.63033307\",\n \"0.6294913\",\n \"0.62939376\",\n \"0.62901396\",\n \"0.62888753\",\n \"0.6282107\",\n \"0.6279059\",\n \"0.62655467\",\n \"0.626451\",\n \"0.62540805\"\n]","isConversational":false},"document_score":{"kind":"string","value":"0.73056155"},"document_rank":{"kind":"string","value":"3"}}},{"rowIdx":10196,"cells":{"query":{"kind":"string","value":"Returns a playlist with a given name or raise NotFound."},"document":{"kind":"string","value":"def playlist(self, title): # noqa\n for item in self.playlists():\n if item.title == title:\n return item\n raise NotFound('Invalid playlist title: %s' % title)"},"metadata":{"kind":"string","value":"{\n \"objective\": {\n \"self\": [],\n \"paired\": [],\n \"triplet\": [\n [\n \"query\",\n \"document\",\n \"negatives\"\n ]\n ]\n }\n}"},"negatives":{"kind":"list like","value":["def getPlaylist(self,name):\n playlist = self.getAllPlaylists(name)\n return playlist[0] if playlist else None","def find_playlist(playlist_name):\n\n playlists = spotifyObject.user_playlists(config.USERNAME)\n\n for playlist in playlists['items']:\n if playlist['name'] == playlist_name:\n return playlist['id']\n \n raise PlaylistNotFoundException(f\"The playlist name: {playlist_name} was not found.\")","def find_playlist(playlist_name):\n\n playlists = spotifyObject.user_playlists(config.USERNAME)\n\n for playlist in playlists['items']:\n if playlist['name'] == playlist_name:\n return playlist['id']\n \n raise PlaylistNotFoundException(\"The given playlist name was not found.\")","def get_playlist(speaker, name):\n playlists = speaker.get_sonos_playlists(complete_result=True)\n # Strict match\n for playlist in playlists:\n if name == playlist.title:\n logging.info(\n \"Found playlist '{}' using strict match\".format(playlist.title)\n )\n return playlist\n # Fuzzy match\n name = name.lower()\n for playlist in playlists:\n if name in playlist.title.lower():\n logging.info(\"Found playlist '{}' using fuzzy match\".format(playlist.title))\n return playlist\n return None","def playlist(self):\n _LOGGER.debug(\"Fetching Playlist info\")\n parameters = {\n 'cmd': None,\n 'param3': 'playlist.json'\n }\n try:\n res = requests.get(url=self.url, headers=headers, params=parameters, timeout=self.timeout).json()\n except (ConnectionError, OSError) as e:\n _LOGGER.error(\"Fetching playlist info failed: %s\", e)\n res = None\n return res","def lookup(self, uri):\n uri_scheme = urllib.parse.urlparse(uri).scheme\n backend = self.backends.with_playlists.get(uri_scheme, None)\n if not backend:\n return None\n\n with _backend_error_handling(backend):\n playlist = backend.playlists.lookup(uri).get()\n playlist is None or validation.check_instance(playlist, Playlist)\n return playlist\n\n return None","def show_playlist(self, playlist_name):\n playlist_exists = False\n for playlist in list(self.playlists.keys()):\n if playlist_name.upper() == playlist.upper():\n playlist_exists = True\n real_playlist_name = playlist\n break\n if playlist_exists:\n print(f\"Showing playlist: {playlist_name}\")\n if len(self.playlists[real_playlist_name]) == 0:\n print(\"\\tNo videos here yet\")\n else:\n for song in self.playlists[real_playlist_name]:\n video = self._video_library.get_video(song)\n tags = str(video.tags)\n tags=tags.replace(\"'\",\"\")\n tags=tags.replace(\",\", \"\") \n tags=tags.replace(\")\", \"\") \n tags=tags.replace(\"(\", \"\") \n print(f\"{video.title} ({video.video_id}) [{tags}]\")\n\n else:\n print(f\"\\tCannot show playlist {playlist_name}: Playlist does not exist\")\n\n # print(\"show_playlist needs implementation\")","def get_playlist_by_id(cls, id):\n try:\n return cls._playlists_by_id[id]\n except KeyError:\n return None","def lookup(self, uri: Uri) -> Optional[Playlist]:\n uri_scheme = UriScheme(urllib.parse.urlparse(uri).scheme)\n backend = self.backends.with_playlists.get(uri_scheme, None)\n if not backend:\n return None\n\n with _backend_error_handling(backend):\n playlist = backend.playlists.lookup(uri).get()\n if playlist is not None:\n validation.check_instance(playlist, Playlist)\n return playlist\n\n return None","async def playlist(self, ctx, *, query):\n # Setup the headers with the token that should be here\n headers = {\"Authorization\": \"Bearer {}\".format(self._token)}\n opts = {\"q\": query, \"type\": \"playlist\"}\n url = \"https://api.spotify.com/v1/search\"\n response = await utils.request(url, headers=headers, payload=opts)\n try:\n await ctx.send(\n response.get(\"playlists\")\n .get(\"items\")[0]\n .get(\"external_urls\")\n .get(\"spotify\")\n )\n except (KeyError, AttributeError, IndexError):\n await ctx.send(\"Couldn't find a song for:\\n{}\".format(query))","def get_playlist_id(name):\n \n #search for the first playlist result given a drama name\n search_response = youtube.search().list(q=name,type=\"playlist\",part=\"id\",maxResults=1).execute()\n result = search_response.get(\"items\", [])\n playlist_id = result[0]['id']['playlistId']\n return playlist_id","def show_playlist(self, playlist_name):\n playlist_id = playlist_name.lower()\n if not playlist_id in self.playlists.keys():\n print(f\"Cannot show playlist {playlist_name}: Playlist does not exist\")\n return\n\n playlist = self.playlists.get(playlist_id)\n videos = playlist.videos\n\n if len(videos) == 0:\n print(f\"Showing playlist: {playlist_name}\")\n print(\"No videos here yet\")\n return\n\n print(f\"Showing playlist: {playlist_name}\")\n for video_id in videos:\n print(self._video_library.get_video(video_id))\n return","def show_playlist(self, playlist_name):\n if playlist_name.lower() not in self._playlists:\n print(f\"Cannot show playlist {playlist_name}: Playlist does not exist\")\n return\n playlist = self._playlists[playlist_name.lower()]\n print(f\"Showing playlist: {playlist_name}\")\n if not playlist.videos:\n print(\"No videos here yet\")\n for video in playlist.videos:\n print(video)","def _get_playlist_index_by_name(library_list, playlist_name):\n for playlist in library_list:\n if playlist['name'] == playlist_name:\n return library_list.index(playlist)\n return None","def get_playlist(cls, tag):\n try:\n return cls._playlists_by_tag[tag]\n except KeyError:\n return None","def get_playlist_id(self, username, playlist_name):\n playlist_id = ''\n playlists = self.spotify.user_playlists(username)\n for playlist in playlists['items']:\n if playlist['name'] == playlist_name:\n playlist_id = playlist['id']\n return playlist_id\n while playlists['next']: # If there are more playlists\n playlists = self.spotify.next(playlists)\n for playlist in playlists['items']:\n if playlist['name'] == playlist_name:\n playlist_id = playlist['id']\n return playlist_id\n return playlist_id","def get_playlist(self, playlist_uuid, *args):\n\n if playlist_uuid not in self.playlists:\n return rsp_codes[2]\n\n rsp = rsp_codes[0]\n rsp['playlist'] = self.playlists[playlist_uuid]\n return rsp","def create_playlist(self, name):\n\n user_id = self.get_current_user()\n endpoint = f\"/users/{user_id}/playlists\"\n headers = self.headers\n headers.update()\n response = self._send(\n endpoint,\n \"POST\",\n extra_headers={\"Content-Type\": \"application/json\"},\n data=json.dumps({\"name\": name, \"public\": False})\n )\n playlist_id = response.json()[\"id\"]\n return playlist_id","def get_playlist_by_id(self, request):\n pl = Playlist.find_by_id(request.pid)\n response = PlaylistResponse(pid=pl.key.id(),\n name=pl.name,\n songs=[])\n songs = Song.find_by_playlist(pl.key).fetch()\n for song in songs:\n response.songs.append(SongMessage(id=song.key.id(),\n spotify_id=song.spotify_id,\n name=song.name,\n vote_count=song.vote_count))\n return response","def from_id(id):\n response = settings.database.get_item(Key={'id': id})\n raise_for_response(response)\n if not \"Item\" in response.keys():\n raise NotFoundException(\"Playlist with id \" + str(id) + \" couldn't be found\")\n playlist = Playlist()\n playlist.init_from_body(response[\"Item\"])\n return playlist","def _mpd_get_playlist(position=None):\n \n if position != None:\n return _mpd_client.playlistinfo(position)\n else:\n return _mpd_client.playlistinfo()","async def get_playlist(self, part=\"snippet\", max_results=7, playlist_id=\"\", playlist_url=\"\"):\n\n url = self.url_api.get_playlist_url(playlist_id, part, max_results, playlist_url)\n\n response = await self.session.get(url)\n search_results = await response.json()\n return search_results","def get_playlists_for_user_by_name(self, request): \n user = Account.find_by_username(request.username)\n playlists = Playlist.find_by_owner(user.key).fetch(20)\n return self.build_playlist_response(playlists)","def get_playlist(self, object_id):\n return self.get_object(\"playlist\", object_id)","def show_playlist(self, playlist_name):\n print(f\"Showing playlist: {playlist_name}\")\n print(\" No videos here yet\")","def create_playlist(self, playlist_name):\n if playlist_name.lower() in self._playlists:\n print(\"Cannot create playlist: A playlist with the same name already exists\")\n return\n print(f\"Successfully created new playlist: {playlist_name}\")\n self._playlists[playlist_name.lower()] = Playlist(playlist_name)","def create_playlist(self, playlist_name):\n print(\"create_playlist needs implementation\")","def playlist(self, playlist_id: str, fields: str = None,\n market: str = 'from_token'):\n return self._get('playlists/' + playlist_id,\n fields=fields, market=market)","def Playlist(self, type='audio'):\n self.logger.debug(\"Loading Playlist of type \" + type)\n xbmc = Server(self.url('/jsonrpc', True))\n if type == 'video':\n return xbmc.Playlist.GetItems(playlistid=1, properties=['year', 'showtitle', 'season', 'episode', 'runtime'])\n\n return xbmc.Playlist.GetItems(playlistid=0, properties=['artist', 'title', 'album', 'duration'])","def getAllPlaylists(self,name):\n return [p for p in self.playlists if p.title == name]","def create_playlist(self, playlist_name):\n new_playlist_id = playlist_name.lower()\n if new_playlist_id in self.playlists.keys():\n print(\"Cannot create playlist: A playlist with the same name already exists\")\n return\n\n new_playlist = Playlist(playlist_name)\n self.playlists[new_playlist_id] = new_playlist\n print(f\"Successfully created new playlist: {playlist_name}\")","def create(\n self,\n name: str,\n uri_scheme: Optional[UriScheme] = None,\n ) -> Optional[Playlist]:\n if uri_scheme in self.backends.with_playlists:\n backends = [self.backends.with_playlists[uri_scheme]]\n else:\n backends = self.backends.with_playlists.values()\n\n for backend in backends:\n with _backend_error_handling(backend):\n result = backend.playlists.create(name).get()\n if result is None:\n continue\n validation.check_instance(result, Playlist)\n listener.CoreListener.send(\"playlist_changed\", playlist=result)\n return result\n\n return None","def delete_playlist(self, playlist_name):\n playlist_exists = False\n for playlist in list(self.playlists.keys()):\n if playlist_name.upper() == playlist.upper():\n playlist_exists = True\n real_playlist_name = playlist\n break\n if playlist_exists:\n self.playlists.pop(real_playlist_name, None)\n print(f\"Deleted playlist: {playlist_name}\")\n else:\n print(f\"Cannot delete playlist {playlist_name}: Playlist does not exist\")\n # print(\"deletes_playlist needs implementation\")","def create_playlist(self, playlist_name):\n playlist_name = Playlist()\n if self != playlist_name:\n print(f\"successfully created new playlist: {playlist_name}\")\n else:\n print(\"Cannot create playlist: A playlist with the same name already exists\")","def _get_song_index_by_name(playlist_list, song_name):\n for song in playlist_list:\n if song['title'] == song_name:\n return playlist_list.index(song)\n return None","def create_playlist(self, playlist_name):\n for playlist in self.playlists.keys():\n if playlist_name.upper() == playlist.upper():\n print(\"Cannot create playlist: A playlist with the same name already exists\")\n break\n else:\n self.playlists[playlist_name]=[]\n print(\"Successfully created new playlist: \" + playlist_name)\n # print(\"create_playlist needs implementation\")","def show_playlist(self, playlist_name):\n \n if playlist_name.lower() not in self.playlists:\n print(\"Cannot show playlist\", playlist_name, end=\"\")\n print(\": Playlist does not exist\")\n elif len(self.playlists[playlist_name.lower()]) == 0:\n print(\"Showing playlist:\", playlist_name)\n print(\"No videos here yet\")\n else:\n print(\"Showing playlist:\", playlist_name)\n for video in self.playlists[playlist_name.lower()]:\n if video.flagged:\n print(f\"{self.videos_dict[video]} - FLAGGED (reason: {video.flag_reason})\")\n else:\n print(self.videos_dict[video])","def SearchPlaylist(self, playlistName):\n self.__playlistName = playlistName\n self.__itemsFoundList = []\n for item in self.__playlists:\n if self.__playlistName in item:\n self.__itemsFoundList.append(item)\n return sorted(self.__itemsFoundList)","def create_playlist(self, playlist_name):\n if playlist_name.lower() in self.playlists:\n print(\"Cannot create playlist: A playlist with the same name already exists\")\n else:\n self.playlist_names[playlist_name.lower()] = playlist_name\n self.playlists[playlist_name.lower()] = []\n print(\"Successfully created new playlist:\", playlist_name)","def delete_playlist(self, playlist_name):\n if playlist_name.lower() in self.playlists:\n self.playlists.pop(playlist_name.lower())\n print(f\"Deleted playlist: {playlist_name}\")\n else:\n print(f\"Cannot delete playlist {playlist_name}: Playlist does not exist\")","def play_pl(name):\n if name.isdigit():\n name = int(name)\n name = sorted(g.userpl)[name - 1]\n\n saved = g.userpl.get(name)\n\n if not saved:\n name = get_near_name(name, g.userpl)\n saved = g.userpl.get(name)\n\n if saved:\n g.model.songs = list(saved.songs)\n play_all(\"\", \"\", \"\")\n\n else:\n g.message = F(\"pl not found\") % name\n g.content = playlists_display()","def find_player(self, name):\n for index in range(0, len(self.player_list)):\n if self.player_list[index].name == name:\n return self.player_list[index]","def delete_playlist(self, playlist_name):\n if playlist_name.upper() in self.playlist.keys():\n del self.playlist[playlist_name.upper()]\n print(f\"Deleted playlist: {playlist_name}\")\n else:\n print(f\"Cannot delete playlist {playlist_name}: Playlist does not exist\")","def create_playlist(self, playlist_name):\n #self._video_playlist.name=playlist_name\n #self._video_playlist.caseless=playlist_name.lower()\n #print(f\"Successfully created new playlist: {self._video_playlist.name}\")\n if playlist_name.lower() not in self.playlists:\n self.playlists[playlist_name.lower()]=[]\n print(\"Successfully created new playlist: {0}\".format(playlist_name))\n else:\n print(\"Cannot create playlist: A playlist with the same name already exists\")","def grab_playlist():\n sp = credentials()\n playlists = sp.current_user_playlists()\n for playlist in playlists['items']:\n if playlist['name'] == 'Billboard Hot 100':\n playlist_id = playlist['uri']\n return playlist_id","def create_playlist(self, playlist_name):\n if playlist_name.upper() in self.playlist.keys():\n print(\"Cannot create playlist: A playlist with the same name already exists\")\n else:\n self.playlist[playlist_name.upper()] = []\n self.playlist_list.append(playlist_name)\n print(f\"Successfully created new playlist: {playlist_name}\")","def delete_playlist(self, playlist_name):\n if playlist_name.lower() not in self.playlists:\n print(\"Cannot delete playlist\", playlist_name, end=\"\")\n print(\": Playlist does not exist\")\n else:\n print(\"Deleted playlist:\", playlist_name)\n self.playlists.pop(playlist_name.lower())","def create(self, name, uri_scheme=None):\n if uri_scheme in self.backends.with_playlists:\n backends = [self.backends.with_playlists[uri_scheme]]\n else:\n backends = self.backends.with_playlists.values()\n\n for backend in backends:\n with _backend_error_handling(backend):\n result = backend.playlists.create(name).get()\n if result is None:\n continue\n validation.check_instance(result, Playlist)\n listener.CoreListener.send('playlist_changed', playlist=result)\n return result\n\n return None","def delete_playlist(self, playlist_name):\n playlist_id = playlist_name.lower()\n if not playlist_id in self.playlists.keys():\n print(f\"Cannot delete playlist {playlist_name}: Playlist does not exist\")\n return\n\n self.playlists.pop(playlist_id)\n print(f\"Deleted playlist: {playlist_name}\")","async def get_player_playlist(self, player: Player) -> Optional[Playlist]:\n\n return await get_playlist(self.spotify, self.youtube, player.used_query)","def show_playlist(self, playlist_name):\n if self.playlists[playlist_name.lower()]!=[]:\n print(f\"Showing playlist: {playlist_name}\")\n for i in self.playlists[playlist_name.lower()]:\n videos = self._video_library.get_all_videos()\n templist = []\n\n def converttostr(input_seq, seperator):\n # Join all the strings in list\n final_str = seperator.join(input_seq)\n return final_str\n\n for vid in videos:\n if i == vid.video_id:\n templist.append([vid.title,vid.video_id,vid.tags])\n\n print(f\" {templist[0][0]} ({templist[0][1]}) [{converttostr(list(templist[0][2]), ' ')}]\")\n else:\n print(f\"Showing playlist: {playlist_name}\")\n print(\" No videos here yet\")\n #print(\"show_playlist needs implementation\")","def playlist_create_failed(self, name):\n message = {\n \"timestamp\": self._get_time(),\n \"level\": \"ERROR\",\n \"type\": \"PLAYLIST_CREATE_FAILED\",\n \"name\": name,\n }\n\n self._log_queue.put(json.dumps(message))","def create_new_playlist(self, name, desc=''):\n pl_names, _, _ = self.list_playlists()\n if name in pl_names:\n self.logger.debug(\n 'Playlist Name Already Exists, please use another name')\n else:\n pl = self.sp.user_playlist_create(\n self.user, name, public=False, description=desc)\n self.sp.user_playlist_change_details(\n self.user, pl['id'], collaborative=True)","def get(cls, name):\n result = cls.query().filter(FileRecord.artist == name).first()\n\n if result and len(result) > 0:\n return cls(*result)\n else:\n return None","def search_for_artist(name):\n\ttoken = get_token()\n\tif token:\n\t\theaders = {\"Content-Type\": \"application/json\", \"Authorization\": \"Bearer \" + token}\n\t\toptions = {\n\t\t\t'q': name, 'type': 'artist', 'limit': '1'\n\t\t}\n\n\t\tresponse = requests.get(\n\t\t\t'https://api.spotify.com/v1/search',\n\t\t\theaders=headers,\n\t\t\tparams=options\n\t\t)\n\t\tif response.status_code == 200:\n\t\t\tcontent = json.loads(response.content.decode('utf-8'))\n\t\t\tif content:\n\t\t\t\treturn content['artists']['items'][0]['id']\n\t\t\telse: return None\n\t\telse:\n\t\t\treturn None\n\telse:\n\t\treturn None","def current_playlist(self):\n if (self._playlists == {}):\n return None\n else:\n for title, id in self._playlists.items():\n if (id == self._current_playlist_id):\n return title\n return None","def delete_playlist(self, playlist_name):\n if playlist_name.lower() not in self._playlists:\n print(f\"Cannot delete playlist {playlist_name}: Playlist does not exist\")\n return\n print(f\"Deleted playlist: {playlist_name}\")\n self._playlists.pop(playlist_name.lower())","def playlist(self):\n def iconv(s):\n encoding = self.options[\"id3_encoding\"]\n try:\n if encoding:\n return s.encode('latin1').decode(encoding).encode('utf-8')\n else:\n return s.encode('latin1')\n except UnicodeEncodeError:\n return \"\"\n\n lst = []\n r = self.x.playlist_list_entries()\n r.wait()\n for id in r.get_list():\n r = self.x.medialib_get_info(id)\n r.wait()\n if r.iserror():\n print r.get_error()\n lst.append(' ')\n continue\n song = r.get_propdict()\n try:\n artist = iconv(song[('plugin/id3v2', 'artist')])\n except KeyError:\n try:\n artist = iconv(song[('plugin/mad', 'artist')])\n except KeyError:\n artist = ''\n try:\n title = iconv(song[('plugin/id3v2', 'title')])\n except KeyError:\n try:\n title = iconv(song[('plugin/mad', 'title')])\n except KeyError:\n title = ''\n if artist == \"\" and title == \"\":\n name = os.path.split(song[('server', 'url')])[1]\n name = os.path.splitext(name)[0]\n name = urllib.unquote(name.decode('utf-8').encode('latin1'))\n name = name.replace(\"+\", \" \")\n lst.append(' ' + name)\n else:\n lst.append(' %s - %s' % (artist.ljust(6), title))\n\n return lst","async def get_playlist(\n self, user: discord.User, playlist_id: str, partial: bool = False\n ) -> Optional[UserPlaylist]:\n\n playlist = await self.database.select(\n self.tables[\"playlists\"], [], {\"user\": user.id, \"id\": playlist_id}\n )\n\n if playlist:\n return UserPlaylist(\n self,\n user,\n playlist_id,\n await get_playlist(self.spotify, self.youtube, playlist[\"playlist_url\"])\n if not partial\n else None,\n )","def create_playlist(self, playlist_name: str, song_ids: List[str]) -> str:\n user = self.init_user()\n user_id = user.me()['id']\n playlist_data = user.user_playlist_create(\n user=user_id, name=playlist_name, public=True)\n user.playlist_add_items(playlist_data['id'], song_ids)\n playlist_link = playlist_data['external_urls']['spotify']\n return playlist_link","async def async_parse_pls_url(self, playlist):\n try:\n websession = async_get_clientsession(self.hass)\n async with async_timeout.timeout(10):\n response = await websession.get(playlist)\n\n except (asyncio.TimeoutError, aiohttp.ClientError) as error:\n _LOGGER.warning(\n \"For: %s unable to get the PLS playlist: %s\", self._name, playlist\n )\n return playlist\n\n if response.status == HTTPStatus.OK:\n data = await response.text()\n _LOGGER.debug(\"For: %s PLS playlist: %s contents: %s\", self._name, playlist, data)\n\n lines = [line.strip(\"\\n\\r\") for line in data.split(\"\\n\") if line.strip(\"\\n\\r\") != \"\"]\n if len(lines) > 0:\n _LOGGER.debug(\"For: %s PLS playlist: %s lines: %s\", self._name, playlist, lines)\n urls = [u for u in lines if u.startswith('File')]\n _LOGGER.debug(\"For: %s PLS playlist: %s urls: %s\", self._name, playlist, urls)\n if len(urls) > 0:\n url = urls[0].split('=')\n if len(url) > 1:\n return url[1]\n else:\n _LOGGER.error(\"For: %s PLS playlist: %s No valid http URL in the playlist!!!\", self._name, playlist)\n self._nometa = True\n else:\n _LOGGER.error(\"For: %s PLS playlist: %s No content to parse!!!\", self._name, playlist)\n\n else:\n _LOGGER.error(\n \"For: %s (%s) Get failed, response code: %s Full message: %s\",\n self._name,\n self._host,\n response.status,\n response,\n )\n\n return playlist","def remove_from_playlist(self, playlist_name, video_id):\n if playlist_name.lower() not in self.playlists:\n print(\"Cannot remove video from\", playlist_name, end=\"\")\n print(\": Playlist does not exist\")\n elif self._video_library.get_video(video_id) is None:\n print(\"Cannot remove video from\", playlist_name, end=\"\") \n print(\": Video does not exist\") \n elif self._video_library.get_video(video_id) not in self.playlists[playlist_name.lower()]:\n print(\"Cannot remove video from\", playlist_name, end=\"\")\n print(\": Video is not in playlist \")\n else:\n print(\"Removed video from\", playlist_name, end=\"\")\n print(\":\", self._video_library.get_video(video_id).title)\n self.playlists[playlist_name.lower()].remove(self._video_library.get_video(video_id))","def playlist_search(search_term, results=5):\r\n if search_term:\r\n url = PLAYLIST_SEARCH_URL.format(API_KEY, util.web.quote(search_term.encode('ascii', 'ignore')))\r\n response = util.web.http_get(url=url, json=True, referer='https://tinychat.com')\r\n\r\n if response['json'] is not None:\r\n play_lists = []\r\n try:\r\n if 'items' in response['json']:\r\n for i, item in enumerate(response['json']['items']):\r\n if i == results:\r\n return play_lists\r\n playlist_id = item['id']['playlistId']\r\n playlist_title = item['snippet']['title'].encode('ascii', 'ignore')\r\n play_list_info = {\r\n 'playlist_title': playlist_title,\r\n 'playlist_id': playlist_id\r\n }\r\n play_lists.append(play_list_info)\r\n except KeyError as ke:\r\n log.error(ke, exc_info=True)\r\n return None","def search_song(self, name):\n self.logger.debug('Searched for Song: {}'.format(name))\n results = self.sp.search(q='track:' + name, type='track')\n songs = [song for song in results['tracks']['items']]\n i = 1\n songs_ls = []\n table_ls = []\n for song in songs:\n table_ls.append([i,\n song['name'][0:20].strip(),\n song['album']['name'][0:20].strip(),\n \"%0.2f\" % (song['duration_ms'] / 60000),\n song['popularity']])\n songs_ls.append(song['uri'])\n i = i + 1\n return songs_ls, table_ls","def spotify_create_playlist(\n playlist_name: str,\n access_token: str,\n user_spotify_id: str,\n public: bool = True,\n description: str = None,\n) -> str:\n headers = {\n \"Authorization\": \"Bearer {}\".format(access_token),\n \"Content-Type\": \"application/json\",\n }\n body = {\"name\": playlist_name, \"public\": public}\n if description is not None:\n body[\"description\"] = description\n response = requests.post(\n \"https://api.spotify.com/v1/users/{}/playlists\".format(user_spotify_id),\n headers=headers,\n json=body,\n )\n if response.status_code != 200 and response.status_code != 201:\n return \"Error {}\".format(response.text)\n return response.json()[\"id\"]","def playlistid(self, track_id=None):\n track_id = '' if track_id is None else track_id\n lines = yield from self.command('playlistid {}'.format(track_id))\n return parse_playlist(lines)","def playlist_remove(name):\n if name.isdigit() or g.userpl.get(name):\n\n if name.isdigit():\n name = int(name) - 1\n name = sorted(g.userpl)[name]\n\n del g.userpl[name]\n g.message = \"Deleted playlist %s%s%s\" % (c.y, name, c.w)\n g.content = playlists_display()\n save_to_file()\n\n else:\n g.message = F('pl not found advise ls') % name\n g.content = playlists_display()","def search_song(self, name, album=None, artist=None):\n\n endpoint = \"/search\"\n query = f\"track:{self._strip_punctuation(name)}\"\n if artist:\n query += f\" artist:{self._strip_punctuation(artist)}\"\n if album:\n query += f\" album:{self._strip_punctuation(album)}\"\n response = self._send(endpoint, \"GET\", params={\"q\": query, \"type\": \"track\"})\n tracks = response.json()[\"tracks\"]\n if tracks[\"total\"] == 0:\n raise SongNotFoundError(\n f\"song name={name} artist={artist} album={album} could not be found\"\n )\n return tracks[\"items\"]","def remove_from_playlist(self, playlist_name, video_id):\n playlist_exists = False\n video_id_exists = False\n video_exists_in_playlist = False\n for playlist in list(self.playlists.keys()):\n if playlist_name.upper() == playlist.upper():\n playlist_exists = True\n real_playlist_name = playlist\n break\n \n videos = self._video_library.get_all_videos()\n for v in videos:\n if v.video_id.upper() == video_id.upper():\n video_id_exists = True\n video_title = v.title\n break\n if not playlist_exists:\n print(f\"Cannot remove video from {playlist_name}: Playlist does not exist\")\n \n elif not video_id_exists:\n print(f\"Cannot remove video from {playlist_name}: Video does not exist\")\n\n elif video_id not in self.playlists[real_playlist_name]:\n print(f\"Cannot remove video from {playlist_name}: Video is not in playlist\")\n \n else:\n self.playlists[real_playlist_name].remove(video_id.lower())\n print(f\"Removed video from {playlist_name}: {video_title}\")\n # print(\"remove_from_playlist needs implementation\")","async def play(self, ctx, *, query: str):\n # Get the player for this guild from cache.\n player = self.bot.lavalink.player_manager.get(ctx.guild.id)\n\n # If player is paused - unpause, return\n if player.paused:\n return await player.set_pause(False)\n\n # Remove leading and trailing <>. <> may be used to suppress embedding links in Discord.\n query = query.strip('<>')\n\n # Check if the user input might be a URL. If it isn't, we can Lavalink do a YouTube search for it instead.\n # SoundCloud searching is possible by prefixing \"scsearch:\" instead.\n if not url_rx.match(query):\n query = f'ytsearch:{query}'\n\n # Get the results for the query from Lavalink.\n results = await player.node.get_tracks(query)\n\n # Results could be None if Lavalink returns an invalid response (non-JSON/non-200 (OK)).\n # ALternatively, resullts['tracks'] could be an empty array if the query yielded no tracks.\n if not results or not results['tracks']:\n return await ctx.send(embed=self.error_embed(f\"No results found for `{query}`\"))\n\n embed = discord.Embed(color=discord.Color.blurple())\n\n # Valid loadTypes are:\n # TRACK_LOADED - single video/direct URL)\n # PLAYLIST_LOADED - direct URL to playlist)\n # SEARCH_RESULT - query prefixed with either ytsearch: or scsearch:.\n # NO_MATCHES - query yielded no results\n # LOAD_FAILED - most likely, the video encountered an exception during loading.\n if results['loadType'] == 'PLAYLIST_LOADED':\n tracks = results['tracks']\n\n for track in tracks:\n # Add all of the tracks from the playlist to the queue.\n length = track[\"info\"][\"length\"]\n track = lavalink.models.AudioTrack(\n track, requester=ctx.author.id, recommended=True, length=length)\n player.add(requester=ctx.author.id, track=track)\n\n embed.title = ''\n embed.description = f'Queued **{results[\"playlistInfo\"][\"name\"]}** - {len(tracks)} tracks'\n else:\n track = results['tracks'][0]\n embed.title = \"\"\n embed.description = f'Queued [{track[\"info\"][\"title\"]}]({track[\"info\"][\"uri\"]}) [{ctx.message.author.mention}]'\n length = track[\"info\"][\"length\"]\n\n # You can attach additional information to audiotracks through kwargs, however this involves\n # constructing the AudioTrack class yourself.\n track = lavalink.models.AudioTrack(\n track, requester=ctx.author.id, recommended=True, length=length)\n player.add(requester=ctx.author.id, track=track)\n\n # Save text channel in which bot command was sent\n # for further reply\n self.preferred_channels[str(ctx.guild.id)] = ctx.message.channel.id\n\n await ctx.send(embed=embed)\n\n # We don't want to call .play() if the player is playing as that will effectively skip\n # the current track.\n if not player.is_playing:\n await player.play()","def import_spotify(info: dict) -> (str, int):\n url = info[\"playlist_url\"]\n # Validate URL\n matches = (\n re.match(r\"^https?://open\\.spotify\\.com/playlist/([a-zA-Z\\d]*)/?\", url)\n if isinstance(url, str)\n else None\n )\n if not matches:\n return \"Invalid URL\", 400\n playlist_id = matches.group(1)\n query_url = \"https://api.spotify.com/v1/playlists/\" + playlist_id\n query_headers = {\"Authorization\": \"Bearer {}\".format(info[\"access_token\"])}\n # Get/create playlist\n playlist_json = requests.get(query_url, headers=query_headers).json()\n if \"error\" in playlist_json:\n status = playlist_json[\"error\"].get(\"status\")\n message = playlist_json[\"error\"].get(\"message\")\n return (\n message if message else \"Error retrieving playlist\",\n status if status else 500,\n )\n playlist = Playlist(\n name=playlist_json[\"name\"],\n last_sync_spotify=timezone.now(),\n spotify_id=playlist_id,\n )\n if \"user\" in info:\n playlist.owner = PlaylstrUser.objects.filter(id=info[\"user\"]).first()\n if \"owner\" in playlist_json:\n playlist.spotify_creator_id = playlist_json[\"owner\"][\"id\"]\n playlist.spotify_creator_name = playlist_json[\"owner\"][\"display_name\"]\n playlist.save()\n # Get playlist tracks\n tracks_response = requests.get(query_url + \"/tracks\", headers=query_headers)\n if tracks_response.status_code != 200:\n return tracks_response.reason, 500\n tracks_json = tracks_response.json()\n if \"error_description\" in tracks_json:\n return tracks_json[\"error_description\"], 500\n # Get list of tracks\n index = -1\n while \"next\" in tracks_json and tracks_json[\"next\"] is not None:\n for j in tracks_json[\"items\"]:\n index += 1\n track = track_from_spotify_json(j[\"track\"])\n try:\n PlaylistTrack.objects.create(\n playlist=playlist, track=track, index=index\n )\n except IntegrityError as e:\n print(\"Error adding track {}: {}\".format(str(track), str(e)))\n continue\n tracks_json = requests.get(tracks_json[\"next\"], headers=query_headers).json()\n return str(playlist.playlist_id), 200","def playlist_create(self, user_id: str, name: str, public: bool = True,\n description: str = ''):\n payload = {\n 'name': name,\n 'public': public,\n 'description': description\n }\n return self._post(f'users/{user_id}/playlists', payload=payload)","async def add_playlist(\n self, user: discord.User, url: str\n ) -> Optional[UserPlaylist]:\n\n playlist = await get_playlist(self.spotify, self.youtube, url)\n\n if not playlist:\n return\n\n generated_id = str(uuid.uuid4())\n await self.database.insertifnotexists(\n self.tables[\"playlists\"],\n {\"user\": user.id, \"playlist_url\": url, \"id\": generated_id},\n {\"user\": user.id, \"playlist_url\": url},\n )\n\n return UserPlaylist(self, user, generated_id, playlist)","def delete_playlist(self, playlist_name):\n print(\"deletes_playlist needs implementation\")","def playlistinfo(self, pos=None):\n pos = '' if pos is None else pos\n lines = yield from self.command('playlistinfo {}'.format(pos))\n return parse_playlist(lines)","def create_playlist(self):\n playlist=self.sp.user_playlist_create(user=self.username,name=self.nameOfPlaylist,description=self.description)\n return playlist['id']","def play_name(self, name):\n self.name = name\n self._stream_from_name()\n return self.URL","def _get_playlist(self) -> str:\n playlist_url = f'http://{self.tvh_url}/playlist/channels.m3u'\n auth = HTTPBasicAuth(self.tvh_user, self.tvh_pass)\n response = requests.get(playlist_url, auth=auth)\n self.error(response, __name__)\n return response.text","def save(self, playlist):\n validation.check_instance(playlist, Playlist)\n\n if playlist.uri is None:\n return # TODO: log this problem?\n\n uri_scheme = urllib.parse.urlparse(playlist.uri).scheme\n backend = self.backends.with_playlists.get(uri_scheme, None)\n if not backend:\n return None\n\n # TODO: we let AssertionError error through due to legacy tests :/\n with _backend_error_handling(backend, reraise=AssertionError):\n playlist = backend.playlists.save(playlist).get()\n playlist is None or validation.check_instance(playlist, Playlist)\n if playlist:\n listener.CoreListener.send(\n 'playlist_changed', playlist=playlist)\n return playlist\n\n return None","def save(self, playlist: Playlist) -> Optional[Playlist]:\n validation.check_instance(playlist, Playlist)\n\n if playlist.uri is None:\n return None # TODO: log this problem?\n\n uri_scheme = UriScheme(urllib.parse.urlparse(playlist.uri).scheme)\n backend = self.backends.with_playlists.get(uri_scheme, None)\n if not backend:\n return None\n\n # TODO: we let AssertionError error through due to legacy tests :/\n with _backend_error_handling(backend, reraise=AssertionError):\n result = backend.playlists.save(playlist).get()\n if result is not None:\n validation.check_instance(result, Playlist)\n if result:\n listener.CoreListener.send(\"playlist_changed\", playlist=result)\n return result\n\n return None","def playlist_path(folder, listname):\n\n listname = listname.title().strip()\n for char in ['(', ')', '\\'', '\"', '[', ']']:\n listname = listname.replace(char, '')\n\n for char in [' ', '..', ',', '!', '%', '#', '$', '@', '*', '/', '\\\\', '&', '+', ':']:\n listname = listname.replace(char, '-')\n\n\n listname = strip_accents(unicode(listname))\n listname = re.sub('-+', '-', listname)\n listname = re.sub('\\.+', '.', listname)\n listname = listname.strip('-,.')\n\n if not listname:\n return\n\n return os.path.join(folder, listname.replace('.M3U', '.m3u').replace('0S.', '0s.'))","def remove_from_playlist(self, playlist_name, video_id):\n videos = self._video_library.get_all_videos()\n video_id_list = []\n for vid in videos:\n video_id_list.append(vid.video_id)\n if video_id == vid.video_id:\n video = vid\n if playlist_name.upper() in self.playlist.keys() and video.title in self.playlist[playlist_name.upper()]:\n self.playlist[playlist_name.upper()].remove(video.title)\n print(f\"Removed video from {playlist_name}: {video.title}\")\n elif playlist_name.upper() in self.playlist.keys() and video.title not in self.playlist[playlist_name.upper()]:\n print(f\"Cannot remove video from {playlist_name}: Video is not in playlist\")\n if playlist_name.upper() not in self.playlist.keys():\n print(f\"Cannot remove video from {playlist_name}: Playlist does not exist\")\n if video_id not in video_id_list:\n print(f\"Cannot remove video from {playlist_name}: Video does not exist\")","def find_by_name(our_data,name):\n for album in our_data:\n if album['album'] == name:\n return album\n return None","def get_yt_playlist(self, list_id, url=None):\n if self._settings.enable_yt_dl and url:\n try:\n if not self._yt_dl:\n raise YouTubeException(\"yt-dlp is not initialized!\")\n\n self._yt_dl.update_options({\"noplaylist\": False, \"extract_flat\": True})\n info = self._yt_dl.get_info(url, skip_errors=False)\n if \"url\" in info:\n info = self._yt_dl.get_info(info.get(\"url\"), skip_errors=False)\n\n return info.get(\"title\", \"\"), [(e.get(\"title\", \"\"), e.get(\"id\", \"\")) for e in info.get(\"entries\", [])]\n finally:\n # Restoring default options\n if self._yt_dl:\n self._yt_dl.update_options({\"noplaylist\": True, \"extract_flat\": False})\n\n return PlayListParser.get_yt_playlist(list_id)","def get_cached_playlist(self):\n if self.cached_playlist is None:\n self.get_playlist()\n return self.cached_playlist","def media_playlist(self):\n return self._table.active_playlist.name if self._table.active_playlist else None","def get_playlists(section):\n global parent_folder\n # 초기값은 빈 값\n print(f\" getting playlists for section: {section['title']}\")\n # section의 인자로 받은 title 출력\n soup = get_soup(section['link'])\n # section의 인자로 받은 link를 get_soup 함수 실행\n # i.e. https://www.youtube.com//user/gjenkinslbcc/playlists?view=50&sort=dd&shelf_id=2\n if soup is None: # no playlist, create dummy with default link\n url = f'{youtube_base}{parent_folder}{channel_name}/videos'\n return [\n {'title': 'No Playlists', 'link':url }]\n # soup값이 없을 시 [{'title': 'No Playlists', 'link':url }] return\n atags = soup('a', class_='yt-uix-tile-link')\n # a태그의 class가 'yt-uix-tile-link'인 값 파싱\n\n playlists = []\n for a in atags:\n title = a.text\n # atags를 통해 모든 플레이리스트의 title값 파싱\n if title != 'Liked videos': # liked videos 제외\n url = fix_url(a['href'])\n # atags를 통해 모든 플레이리스트 url값 파싱\n playlists.append({'title': title, 'link': url})\n #playlists에 모든 값 저장\n\n if not playlists: # 플레이리스트 없을 시\n url = f'{youtube_base}/{parent_folder}{channel_name}/videos'\n return [{'title': 'No Playlists', 'link': url}]\n\n return playlists","def find_by_name ( self, name, **kw ):\n try:\n return next ( self.find_all_by_name ( name, **kw ) )\n except StopIteration:\n return None","def remove_from_playlist(self, playlist_name, video_id):\n if playlist_name.lower() in self.playlists:\n for i in self.playlists[playlist_name.lower()]:\n videos = self._video_library.get_all_videos()\n templist = []\n\n def converttostr(input_seq, seperator):\n # Join all the strings in list\n final_str = seperator.join(input_seq)\n return final_str\n\n for vid in videos:\n if i == vid.video_id:\n\n temptitle=vid.title\n print(f\"Removed video from {playlist_name}: {temptitle}\")\n self.playlists[playlist_name.lower()].remove(video_id)\n\n\n if playlist_name not in self.playlists:\n print(f\"Cannot remove video from {playlist_name}: Playlist does not exist\")\n elif video_id not in self.playlists[playlist_name.lower()]:\n print(\"Cannot remove video from my_playlist: Video does not exist\")\n #self.playlists[playlist_name.lower()].remove(video_id)\n\n\n\n #print(\"remove_from_playlist needs implementation\")","def current_playlist():\n current_playlists_cmd = {\n \"jsonrpc\": \"2.0\",\n \"method\": \"Playlist.GetPlaylists\",\n \"id\": \"getCurrentPlaylists\"\n }\n playlists_result = execute_log_command(current_playlists_cmd)\n current = next(\n (playlist for playlist in playlists_result[\"result\"] if playlist[\"type\"] == \"video\"),\n None\n )\n if current:\n playlist_contents_cmd = {\n \"jsonrpc\": \"2.0\",\n \"method\": \"Playlist.GetItems\",\n \"id\": \"getPlaylistItems\",\n \"params\": {\n \"playlistid\": current[\"playlistid\"],\n }\n }\n current_playlist_contents = execute_log_command(playlist_contents_cmd)\n return {\n \"id\": current[\"playlistid\"],\n \"items\": current_playlist_contents[\"result\"].get(\"items\", [])\n }\n return None","def get_item(self, name: str) -> Optional[Item]:\n item = self.filter_items(name, limit=1)\n return item[0] if item else None","def get_playlist_section(self,req):\n# if self.kind=='root':\n# playlist=self.get_playorder()\n if self.kind in ('root','playlist'):\n playlist= self.get_dumb_playlist(objects=True)\n else:# must be a smart playlist\n playlist=self.get_smart_playlist(req,objects=True)\n if playlist: # if we have at least one integer value\n # set start and end\n start=safeint(req._pl_start)\n # find current index\n curr=self.transport.uid\n p=0 if curr else -1\n # if we are playing a track and we are in the root or current playlist...\n if curr and ((self.uid==1) or (self.player.list and (self.uid==self.player.list.uid))):\n # adjust _pl_start to display the currently playing track near the top of the list if possible\n # try using the index to find the track in the playlist - this should work\n try:\n p=self.get_index()\n assert playlist[p].uid==curr\n except:\n p=0\n# raise\n # otherwise, look for the currently playing track by uid\n# try:\n# p=playlist.index(self.transport.uid) # find the current track\n# except:\n# raise\n# p=0\n# print \"got p:\",p\n if (\"_pl_start\" not in req) and (p>start):\n start=max(0,p-2) # adjust start so that the current track is third or less on the list\n # adjust end, and set more req parameters\n end=start+50\n req._pl_index=p\n req._pl_start=start\n if start:\n req._pl_back=max(0,start-50)\n if len(playlist)>end:\n req._pl_more=end\n req._pl_len=len(playlist)\n# print \"start=\",start,\" end=\",end,\" index=\",req._pl_index,\" more=\",req._pl_more,\" back=\",req._pl_back, \" len=\",len(playlist)\n return playlist[start:end]\n return []","def _get_player(self, player_name):\n return self._collection.find_one({'name': player_name})","def test_list_playlist_not_duplicated(self):\n user = factories.UserFactory()\n organization = factories.OrganizationFactory()\n\n playlist = factories.PlaylistFactory(\n organization=organization,\n )\n factories.PlaylistAccessFactory(\n playlist=playlist,\n user=user,\n role=models.ADMINISTRATOR,\n )\n factories.PlaylistAccessFactory.create_batch(\n 3,\n playlist=playlist,\n role=models.ADMINISTRATOR,\n )\n factories.OrganizationAccessFactory(\n organization=organization,\n user=user,\n role=models.ADMINISTRATOR,\n )\n factories.OrganizationAccessFactory.create_batch(\n 3,\n organization=organization,\n role=models.ADMINISTRATOR,\n )\n\n jwt_token = UserAccessTokenFactory(user=user)\n\n response = self.client.get(\n \"/api/playlists/\",\n HTTP_AUTHORIZATION=f\"Bearer {jwt_token}\",\n )\n\n self.assertEqual(response.status_code, 200)\n self.assertEqual(response.json()[\"count\"], 1)\n self.assertEqual(response.json()[\"results\"][0][\"id\"], str(playlist.id))","def remove_from_playlist(self, playlist_name, video_id):\n playlist_id = playlist_name.lower()\n if not playlist_id in self.playlists.keys():\n print(f\"Cannot remove video from {playlist_name}: Playlist does not exist\")\n return\n\n if not self._video_library.get_video(video_id):\n print(f\"Cannot remove video from {playlist_name}: Video does not exist\")\n return\n\n if not video_id in self.playlists[playlist_id].videos:\n print(f\"Cannot remove video from {playlist_name}: Video is not in playlist\")\n return\n\n video = self._video_library.get_video(video_id)\n\n self.playlists[playlist_id].videos.remove(video_id)\n print(f\"Removed video from {playlist_name}: {video.title}\")\n return","def clear_playlist(self, playlist_name):\n playlist_exists = False\n \n for playlist in list(self.playlists.keys()):\n if playlist_name.upper() == playlist.upper():\n playlist_exists = True\n real_playlist_name = playlist\n break\n if playlist_exists:\n self.playlists[real_playlist_name] = []\n print(f\"Successfully removed all videos from {playlist_name}\")\n else:\n print(f\"Cannot clear playlist {playlist_name}: Playlist does not exist\")\n # print(\"clears_playlist needs implementation\")","def create_playlist(self, request):\n # TODO: Max amount of playlists at 20 for a user\n user = Account.find_by_id(request.userid)\n if user is None:\n print \"User not found\" \n return PlaylistResponse(errmsg=\"User ID not found\")\n new_pl = Playlist.add_new_playlist(user.key, request.name)\n return PlaylistResponse(pid=new_pl.key.id())","def selectPlay(id):\n\tsong = music.song()\n\tsql = \"SELECT id, title, path, filename, hash, base FROM songs \" \\\n\t\t+ \"WHERE id = \" + str(id) + \";\"\n\tc, conn = connect()\n\tc.execute(sql)\n\tsinfo = c.fetchone()\n\t\n\tif sinfo[0]:\n\t\tsong.id = sinfo[0]\n\tif sinfo[1]:\n\t\tsong.name = sinfo[1]\n\tif sinfo[2]:\n\t\tsong.path = sinfo[2]\n\tif sinfo[3]:\n\t\tsong.filename = sinfo[3]\n\tif sinfo[4]:\n\t\tsong.hash = sinfo[4]\n\tif sinfo[5]:\n\t\tsong.base = sinfo[5]\n\t\n\treturn song","def get_playlists(search_string=None):\n item_type = 'playlists'\n info_dict = spotify.category_playlists(search_string)\n items = info_dict[item_type][\"items\"]\n playlists = []\n for i in range(len(items)):\n playlist_name = items[i][\"name\"]\n owner_name = items[i][\"owner\"][\"display_name\"]\n total_tracks = items[i][\"tracks\"][\"total\"]\n playlist_id = items[i][\"id\"]\n owner_id = items[i][\"owner\"][\"id\"]\n playlists.append({\"Playlist Name\": playlist_name,\n \"Owner Name\": owner_name,\n \"No. of tracks\": total_tracks,\n \"Playlist ID\": playlist_id,\n \"Owner ID\": owner_id\n })\n return playlists","def add_from_playlist(self, params):\n lists = params\n\n # Lists to load\n names = []\n for n in self.listIDs.keys():\n for l in lists:\n if 'playlist:' + l in n:\n names.append(n)\n\n self.add_playlist(names)"],"string":"[\n \"def getPlaylist(self,name):\\n playlist = self.getAllPlaylists(name)\\n return playlist[0] if playlist else None\",\n \"def find_playlist(playlist_name):\\n\\n playlists = spotifyObject.user_playlists(config.USERNAME)\\n\\n for playlist in playlists['items']:\\n if playlist['name'] == playlist_name:\\n return playlist['id']\\n \\n raise PlaylistNotFoundException(f\\\"The playlist name: {playlist_name} was not found.\\\")\",\n \"def find_playlist(playlist_name):\\n\\n playlists = spotifyObject.user_playlists(config.USERNAME)\\n\\n for playlist in playlists['items']:\\n if playlist['name'] == playlist_name:\\n return playlist['id']\\n \\n raise PlaylistNotFoundException(\\\"The given playlist name was not found.\\\")\",\n \"def get_playlist(speaker, name):\\n playlists = speaker.get_sonos_playlists(complete_result=True)\\n # Strict match\\n for playlist in playlists:\\n if name == playlist.title:\\n logging.info(\\n \\\"Found playlist '{}' using strict match\\\".format(playlist.title)\\n )\\n return playlist\\n # Fuzzy match\\n name = name.lower()\\n for playlist in playlists:\\n if name in playlist.title.lower():\\n logging.info(\\\"Found playlist '{}' using fuzzy match\\\".format(playlist.title))\\n return playlist\\n return None\",\n \"def playlist(self):\\n _LOGGER.debug(\\\"Fetching Playlist info\\\")\\n parameters = {\\n 'cmd': None,\\n 'param3': 'playlist.json'\\n }\\n try:\\n res = requests.get(url=self.url, headers=headers, params=parameters, timeout=self.timeout).json()\\n except (ConnectionError, OSError) as e:\\n _LOGGER.error(\\\"Fetching playlist info failed: %s\\\", e)\\n res = None\\n return res\",\n \"def lookup(self, uri):\\n uri_scheme = urllib.parse.urlparse(uri).scheme\\n backend = self.backends.with_playlists.get(uri_scheme, None)\\n if not backend:\\n return None\\n\\n with _backend_error_handling(backend):\\n playlist = backend.playlists.lookup(uri).get()\\n playlist is None or validation.check_instance(playlist, Playlist)\\n return playlist\\n\\n return None\",\n \"def show_playlist(self, playlist_name):\\n playlist_exists = False\\n for playlist in list(self.playlists.keys()):\\n if playlist_name.upper() == playlist.upper():\\n playlist_exists = True\\n real_playlist_name = playlist\\n break\\n if playlist_exists:\\n print(f\\\"Showing playlist: {playlist_name}\\\")\\n if len(self.playlists[real_playlist_name]) == 0:\\n print(\\\"\\\\tNo videos here yet\\\")\\n else:\\n for song in self.playlists[real_playlist_name]:\\n video = self._video_library.get_video(song)\\n tags = str(video.tags)\\n tags=tags.replace(\\\"'\\\",\\\"\\\")\\n tags=tags.replace(\\\",\\\", \\\"\\\") \\n tags=tags.replace(\\\")\\\", \\\"\\\") \\n tags=tags.replace(\\\"(\\\", \\\"\\\") \\n print(f\\\"{video.title} ({video.video_id}) [{tags}]\\\")\\n\\n else:\\n print(f\\\"\\\\tCannot show playlist {playlist_name}: Playlist does not exist\\\")\\n\\n # print(\\\"show_playlist needs implementation\\\")\",\n \"def get_playlist_by_id(cls, id):\\n try:\\n return cls._playlists_by_id[id]\\n except KeyError:\\n return None\",\n \"def lookup(self, uri: Uri) -> Optional[Playlist]:\\n uri_scheme = UriScheme(urllib.parse.urlparse(uri).scheme)\\n backend = self.backends.with_playlists.get(uri_scheme, None)\\n if not backend:\\n return None\\n\\n with _backend_error_handling(backend):\\n playlist = backend.playlists.lookup(uri).get()\\n if playlist is not None:\\n validation.check_instance(playlist, Playlist)\\n return playlist\\n\\n return None\",\n \"async def playlist(self, ctx, *, query):\\n # Setup the headers with the token that should be here\\n headers = {\\\"Authorization\\\": \\\"Bearer {}\\\".format(self._token)}\\n opts = {\\\"q\\\": query, \\\"type\\\": \\\"playlist\\\"}\\n url = \\\"https://api.spotify.com/v1/search\\\"\\n response = await utils.request(url, headers=headers, payload=opts)\\n try:\\n await ctx.send(\\n response.get(\\\"playlists\\\")\\n .get(\\\"items\\\")[0]\\n .get(\\\"external_urls\\\")\\n .get(\\\"spotify\\\")\\n )\\n except (KeyError, AttributeError, IndexError):\\n await ctx.send(\\\"Couldn't find a song for:\\\\n{}\\\".format(query))\",\n \"def get_playlist_id(name):\\n \\n #search for the first playlist result given a drama name\\n search_response = youtube.search().list(q=name,type=\\\"playlist\\\",part=\\\"id\\\",maxResults=1).execute()\\n result = search_response.get(\\\"items\\\", [])\\n playlist_id = result[0]['id']['playlistId']\\n return playlist_id\",\n \"def show_playlist(self, playlist_name):\\n playlist_id = playlist_name.lower()\\n if not playlist_id in self.playlists.keys():\\n print(f\\\"Cannot show playlist {playlist_name}: Playlist does not exist\\\")\\n return\\n\\n playlist = self.playlists.get(playlist_id)\\n videos = playlist.videos\\n\\n if len(videos) == 0:\\n print(f\\\"Showing playlist: {playlist_name}\\\")\\n print(\\\"No videos here yet\\\")\\n return\\n\\n print(f\\\"Showing playlist: {playlist_name}\\\")\\n for video_id in videos:\\n print(self._video_library.get_video(video_id))\\n return\",\n \"def show_playlist(self, playlist_name):\\n if playlist_name.lower() not in self._playlists:\\n print(f\\\"Cannot show playlist {playlist_name}: Playlist does not exist\\\")\\n return\\n playlist = self._playlists[playlist_name.lower()]\\n print(f\\\"Showing playlist: {playlist_name}\\\")\\n if not playlist.videos:\\n print(\\\"No videos here yet\\\")\\n for video in playlist.videos:\\n print(video)\",\n \"def _get_playlist_index_by_name(library_list, playlist_name):\\n for playlist in library_list:\\n if playlist['name'] == playlist_name:\\n return library_list.index(playlist)\\n return None\",\n \"def get_playlist(cls, tag):\\n try:\\n return cls._playlists_by_tag[tag]\\n except KeyError:\\n return None\",\n \"def get_playlist_id(self, username, playlist_name):\\n playlist_id = ''\\n playlists = self.spotify.user_playlists(username)\\n for playlist in playlists['items']:\\n if playlist['name'] == playlist_name:\\n playlist_id = playlist['id']\\n return playlist_id\\n while playlists['next']: # If there are more playlists\\n playlists = self.spotify.next(playlists)\\n for playlist in playlists['items']:\\n if playlist['name'] == playlist_name:\\n playlist_id = playlist['id']\\n return playlist_id\\n return playlist_id\",\n \"def get_playlist(self, playlist_uuid, *args):\\n\\n if playlist_uuid not in self.playlists:\\n return rsp_codes[2]\\n\\n rsp = rsp_codes[0]\\n rsp['playlist'] = self.playlists[playlist_uuid]\\n return rsp\",\n \"def create_playlist(self, name):\\n\\n user_id = self.get_current_user()\\n endpoint = f\\\"/users/{user_id}/playlists\\\"\\n headers = self.headers\\n headers.update()\\n response = self._send(\\n endpoint,\\n \\\"POST\\\",\\n extra_headers={\\\"Content-Type\\\": \\\"application/json\\\"},\\n data=json.dumps({\\\"name\\\": name, \\\"public\\\": False})\\n )\\n playlist_id = response.json()[\\\"id\\\"]\\n return playlist_id\",\n \"def get_playlist_by_id(self, request):\\n pl = Playlist.find_by_id(request.pid)\\n response = PlaylistResponse(pid=pl.key.id(),\\n name=pl.name,\\n songs=[])\\n songs = Song.find_by_playlist(pl.key).fetch()\\n for song in songs:\\n response.songs.append(SongMessage(id=song.key.id(),\\n spotify_id=song.spotify_id,\\n name=song.name,\\n vote_count=song.vote_count))\\n return response\",\n \"def from_id(id):\\n response = settings.database.get_item(Key={'id': id})\\n raise_for_response(response)\\n if not \\\"Item\\\" in response.keys():\\n raise NotFoundException(\\\"Playlist with id \\\" + str(id) + \\\" couldn't be found\\\")\\n playlist = Playlist()\\n playlist.init_from_body(response[\\\"Item\\\"])\\n return playlist\",\n \"def _mpd_get_playlist(position=None):\\n \\n if position != None:\\n return _mpd_client.playlistinfo(position)\\n else:\\n return _mpd_client.playlistinfo()\",\n \"async def get_playlist(self, part=\\\"snippet\\\", max_results=7, playlist_id=\\\"\\\", playlist_url=\\\"\\\"):\\n\\n url = self.url_api.get_playlist_url(playlist_id, part, max_results, playlist_url)\\n\\n response = await self.session.get(url)\\n search_results = await response.json()\\n return search_results\",\n \"def get_playlists_for_user_by_name(self, request): \\n user = Account.find_by_username(request.username)\\n playlists = Playlist.find_by_owner(user.key).fetch(20)\\n return self.build_playlist_response(playlists)\",\n \"def get_playlist(self, object_id):\\n return self.get_object(\\\"playlist\\\", object_id)\",\n \"def show_playlist(self, playlist_name):\\n print(f\\\"Showing playlist: {playlist_name}\\\")\\n print(\\\" No videos here yet\\\")\",\n \"def create_playlist(self, playlist_name):\\n if playlist_name.lower() in self._playlists:\\n print(\\\"Cannot create playlist: A playlist with the same name already exists\\\")\\n return\\n print(f\\\"Successfully created new playlist: {playlist_name}\\\")\\n self._playlists[playlist_name.lower()] = Playlist(playlist_name)\",\n \"def create_playlist(self, playlist_name):\\n print(\\\"create_playlist needs implementation\\\")\",\n \"def playlist(self, playlist_id: str, fields: str = None,\\n market: str = 'from_token'):\\n return self._get('playlists/' + playlist_id,\\n fields=fields, market=market)\",\n \"def Playlist(self, type='audio'):\\n self.logger.debug(\\\"Loading Playlist of type \\\" + type)\\n xbmc = Server(self.url('/jsonrpc', True))\\n if type == 'video':\\n return xbmc.Playlist.GetItems(playlistid=1, properties=['year', 'showtitle', 'season', 'episode', 'runtime'])\\n\\n return xbmc.Playlist.GetItems(playlistid=0, properties=['artist', 'title', 'album', 'duration'])\",\n \"def getAllPlaylists(self,name):\\n return [p for p in self.playlists if p.title == name]\",\n \"def create_playlist(self, playlist_name):\\n new_playlist_id = playlist_name.lower()\\n if new_playlist_id in self.playlists.keys():\\n print(\\\"Cannot create playlist: A playlist with the same name already exists\\\")\\n return\\n\\n new_playlist = Playlist(playlist_name)\\n self.playlists[new_playlist_id] = new_playlist\\n print(f\\\"Successfully created new playlist: {playlist_name}\\\")\",\n \"def create(\\n self,\\n name: str,\\n uri_scheme: Optional[UriScheme] = None,\\n ) -> Optional[Playlist]:\\n if uri_scheme in self.backends.with_playlists:\\n backends = [self.backends.with_playlists[uri_scheme]]\\n else:\\n backends = self.backends.with_playlists.values()\\n\\n for backend in backends:\\n with _backend_error_handling(backend):\\n result = backend.playlists.create(name).get()\\n if result is None:\\n continue\\n validation.check_instance(result, Playlist)\\n listener.CoreListener.send(\\\"playlist_changed\\\", playlist=result)\\n return result\\n\\n return None\",\n \"def delete_playlist(self, playlist_name):\\n playlist_exists = False\\n for playlist in list(self.playlists.keys()):\\n if playlist_name.upper() == playlist.upper():\\n playlist_exists = True\\n real_playlist_name = playlist\\n break\\n if playlist_exists:\\n self.playlists.pop(real_playlist_name, None)\\n print(f\\\"Deleted playlist: {playlist_name}\\\")\\n else:\\n print(f\\\"Cannot delete playlist {playlist_name}: Playlist does not exist\\\")\\n # print(\\\"deletes_playlist needs implementation\\\")\",\n \"def create_playlist(self, playlist_name):\\n playlist_name = Playlist()\\n if self != playlist_name:\\n print(f\\\"successfully created new playlist: {playlist_name}\\\")\\n else:\\n print(\\\"Cannot create playlist: A playlist with the same name already exists\\\")\",\n \"def _get_song_index_by_name(playlist_list, song_name):\\n for song in playlist_list:\\n if song['title'] == song_name:\\n return playlist_list.index(song)\\n return None\",\n \"def create_playlist(self, playlist_name):\\n for playlist in self.playlists.keys():\\n if playlist_name.upper() == playlist.upper():\\n print(\\\"Cannot create playlist: A playlist with the same name already exists\\\")\\n break\\n else:\\n self.playlists[playlist_name]=[]\\n print(\\\"Successfully created new playlist: \\\" + playlist_name)\\n # print(\\\"create_playlist needs implementation\\\")\",\n \"def show_playlist(self, playlist_name):\\n \\n if playlist_name.lower() not in self.playlists:\\n print(\\\"Cannot show playlist\\\", playlist_name, end=\\\"\\\")\\n print(\\\": Playlist does not exist\\\")\\n elif len(self.playlists[playlist_name.lower()]) == 0:\\n print(\\\"Showing playlist:\\\", playlist_name)\\n print(\\\"No videos here yet\\\")\\n else:\\n print(\\\"Showing playlist:\\\", playlist_name)\\n for video in self.playlists[playlist_name.lower()]:\\n if video.flagged:\\n print(f\\\"{self.videos_dict[video]} - FLAGGED (reason: {video.flag_reason})\\\")\\n else:\\n print(self.videos_dict[video])\",\n \"def SearchPlaylist(self, playlistName):\\n self.__playlistName = playlistName\\n self.__itemsFoundList = []\\n for item in self.__playlists:\\n if self.__playlistName in item:\\n self.__itemsFoundList.append(item)\\n return sorted(self.__itemsFoundList)\",\n \"def create_playlist(self, playlist_name):\\n if playlist_name.lower() in self.playlists:\\n print(\\\"Cannot create playlist: A playlist with the same name already exists\\\")\\n else:\\n self.playlist_names[playlist_name.lower()] = playlist_name\\n self.playlists[playlist_name.lower()] = []\\n print(\\\"Successfully created new playlist:\\\", playlist_name)\",\n \"def delete_playlist(self, playlist_name):\\n if playlist_name.lower() in self.playlists:\\n self.playlists.pop(playlist_name.lower())\\n print(f\\\"Deleted playlist: {playlist_name}\\\")\\n else:\\n print(f\\\"Cannot delete playlist {playlist_name}: Playlist does not exist\\\")\",\n \"def play_pl(name):\\n if name.isdigit():\\n name = int(name)\\n name = sorted(g.userpl)[name - 1]\\n\\n saved = g.userpl.get(name)\\n\\n if not saved:\\n name = get_near_name(name, g.userpl)\\n saved = g.userpl.get(name)\\n\\n if saved:\\n g.model.songs = list(saved.songs)\\n play_all(\\\"\\\", \\\"\\\", \\\"\\\")\\n\\n else:\\n g.message = F(\\\"pl not found\\\") % name\\n g.content = playlists_display()\",\n \"def find_player(self, name):\\n for index in range(0, len(self.player_list)):\\n if self.player_list[index].name == name:\\n return self.player_list[index]\",\n \"def delete_playlist(self, playlist_name):\\n if playlist_name.upper() in self.playlist.keys():\\n del self.playlist[playlist_name.upper()]\\n print(f\\\"Deleted playlist: {playlist_name}\\\")\\n else:\\n print(f\\\"Cannot delete playlist {playlist_name}: Playlist does not exist\\\")\",\n \"def create_playlist(self, playlist_name):\\n #self._video_playlist.name=playlist_name\\n #self._video_playlist.caseless=playlist_name.lower()\\n #print(f\\\"Successfully created new playlist: {self._video_playlist.name}\\\")\\n if playlist_name.lower() not in self.playlists:\\n self.playlists[playlist_name.lower()]=[]\\n print(\\\"Successfully created new playlist: {0}\\\".format(playlist_name))\\n else:\\n print(\\\"Cannot create playlist: A playlist with the same name already exists\\\")\",\n \"def grab_playlist():\\n sp = credentials()\\n playlists = sp.current_user_playlists()\\n for playlist in playlists['items']:\\n if playlist['name'] == 'Billboard Hot 100':\\n playlist_id = playlist['uri']\\n return playlist_id\",\n \"def create_playlist(self, playlist_name):\\n if playlist_name.upper() in self.playlist.keys():\\n print(\\\"Cannot create playlist: A playlist with the same name already exists\\\")\\n else:\\n self.playlist[playlist_name.upper()] = []\\n self.playlist_list.append(playlist_name)\\n print(f\\\"Successfully created new playlist: {playlist_name}\\\")\",\n \"def delete_playlist(self, playlist_name):\\n if playlist_name.lower() not in self.playlists:\\n print(\\\"Cannot delete playlist\\\", playlist_name, end=\\\"\\\")\\n print(\\\": Playlist does not exist\\\")\\n else:\\n print(\\\"Deleted playlist:\\\", playlist_name)\\n self.playlists.pop(playlist_name.lower())\",\n \"def create(self, name, uri_scheme=None):\\n if uri_scheme in self.backends.with_playlists:\\n backends = [self.backends.with_playlists[uri_scheme]]\\n else:\\n backends = self.backends.with_playlists.values()\\n\\n for backend in backends:\\n with _backend_error_handling(backend):\\n result = backend.playlists.create(name).get()\\n if result is None:\\n continue\\n validation.check_instance(result, Playlist)\\n listener.CoreListener.send('playlist_changed', playlist=result)\\n return result\\n\\n return None\",\n \"def delete_playlist(self, playlist_name):\\n playlist_id = playlist_name.lower()\\n if not playlist_id in self.playlists.keys():\\n print(f\\\"Cannot delete playlist {playlist_name}: Playlist does not exist\\\")\\n return\\n\\n self.playlists.pop(playlist_id)\\n print(f\\\"Deleted playlist: {playlist_name}\\\")\",\n \"async def get_player_playlist(self, player: Player) -> Optional[Playlist]:\\n\\n return await get_playlist(self.spotify, self.youtube, player.used_query)\",\n \"def show_playlist(self, playlist_name):\\n if self.playlists[playlist_name.lower()]!=[]:\\n print(f\\\"Showing playlist: {playlist_name}\\\")\\n for i in self.playlists[playlist_name.lower()]:\\n videos = self._video_library.get_all_videos()\\n templist = []\\n\\n def converttostr(input_seq, seperator):\\n # Join all the strings in list\\n final_str = seperator.join(input_seq)\\n return final_str\\n\\n for vid in videos:\\n if i == vid.video_id:\\n templist.append([vid.title,vid.video_id,vid.tags])\\n\\n print(f\\\" {templist[0][0]} ({templist[0][1]}) [{converttostr(list(templist[0][2]), ' ')}]\\\")\\n else:\\n print(f\\\"Showing playlist: {playlist_name}\\\")\\n print(\\\" No videos here yet\\\")\\n #print(\\\"show_playlist needs implementation\\\")\",\n \"def playlist_create_failed(self, name):\\n message = {\\n \\\"timestamp\\\": self._get_time(),\\n \\\"level\\\": \\\"ERROR\\\",\\n \\\"type\\\": \\\"PLAYLIST_CREATE_FAILED\\\",\\n \\\"name\\\": name,\\n }\\n\\n self._log_queue.put(json.dumps(message))\",\n \"def create_new_playlist(self, name, desc=''):\\n pl_names, _, _ = self.list_playlists()\\n if name in pl_names:\\n self.logger.debug(\\n 'Playlist Name Already Exists, please use another name')\\n else:\\n pl = self.sp.user_playlist_create(\\n self.user, name, public=False, description=desc)\\n self.sp.user_playlist_change_details(\\n self.user, pl['id'], collaborative=True)\",\n \"def get(cls, name):\\n result = cls.query().filter(FileRecord.artist == name).first()\\n\\n if result and len(result) > 0:\\n return cls(*result)\\n else:\\n return None\",\n \"def search_for_artist(name):\\n\\ttoken = get_token()\\n\\tif token:\\n\\t\\theaders = {\\\"Content-Type\\\": \\\"application/json\\\", \\\"Authorization\\\": \\\"Bearer \\\" + token}\\n\\t\\toptions = {\\n\\t\\t\\t'q': name, 'type': 'artist', 'limit': '1'\\n\\t\\t}\\n\\n\\t\\tresponse = requests.get(\\n\\t\\t\\t'https://api.spotify.com/v1/search',\\n\\t\\t\\theaders=headers,\\n\\t\\t\\tparams=options\\n\\t\\t)\\n\\t\\tif response.status_code == 200:\\n\\t\\t\\tcontent = json.loads(response.content.decode('utf-8'))\\n\\t\\t\\tif content:\\n\\t\\t\\t\\treturn content['artists']['items'][0]['id']\\n\\t\\t\\telse: return None\\n\\t\\telse:\\n\\t\\t\\treturn None\\n\\telse:\\n\\t\\treturn None\",\n \"def current_playlist(self):\\n if (self._playlists == {}):\\n return None\\n else:\\n for title, id in self._playlists.items():\\n if (id == self._current_playlist_id):\\n return title\\n return None\",\n \"def delete_playlist(self, playlist_name):\\n if playlist_name.lower() not in self._playlists:\\n print(f\\\"Cannot delete playlist {playlist_name}: Playlist does not exist\\\")\\n return\\n print(f\\\"Deleted playlist: {playlist_name}\\\")\\n self._playlists.pop(playlist_name.lower())\",\n \"def playlist(self):\\n def iconv(s):\\n encoding = self.options[\\\"id3_encoding\\\"]\\n try:\\n if encoding:\\n return s.encode('latin1').decode(encoding).encode('utf-8')\\n else:\\n return s.encode('latin1')\\n except UnicodeEncodeError:\\n return \\\"\\\"\\n\\n lst = []\\n r = self.x.playlist_list_entries()\\n r.wait()\\n for id in r.get_list():\\n r = self.x.medialib_get_info(id)\\n r.wait()\\n if r.iserror():\\n print r.get_error()\\n lst.append(' ')\\n continue\\n song = r.get_propdict()\\n try:\\n artist = iconv(song[('plugin/id3v2', 'artist')])\\n except KeyError:\\n try:\\n artist = iconv(song[('plugin/mad', 'artist')])\\n except KeyError:\\n artist = ''\\n try:\\n title = iconv(song[('plugin/id3v2', 'title')])\\n except KeyError:\\n try:\\n title = iconv(song[('plugin/mad', 'title')])\\n except KeyError:\\n title = ''\\n if artist == \\\"\\\" and title == \\\"\\\":\\n name = os.path.split(song[('server', 'url')])[1]\\n name = os.path.splitext(name)[0]\\n name = urllib.unquote(name.decode('utf-8').encode('latin1'))\\n name = name.replace(\\\"+\\\", \\\" \\\")\\n lst.append(' ' + name)\\n else:\\n lst.append(' %s - %s' % (artist.ljust(6), title))\\n\\n return lst\",\n \"async def get_playlist(\\n self, user: discord.User, playlist_id: str, partial: bool = False\\n ) -> Optional[UserPlaylist]:\\n\\n playlist = await self.database.select(\\n self.tables[\\\"playlists\\\"], [], {\\\"user\\\": user.id, \\\"id\\\": playlist_id}\\n )\\n\\n if playlist:\\n return UserPlaylist(\\n self,\\n user,\\n playlist_id,\\n await get_playlist(self.spotify, self.youtube, playlist[\\\"playlist_url\\\"])\\n if not partial\\n else None,\\n )\",\n \"def create_playlist(self, playlist_name: str, song_ids: List[str]) -> str:\\n user = self.init_user()\\n user_id = user.me()['id']\\n playlist_data = user.user_playlist_create(\\n user=user_id, name=playlist_name, public=True)\\n user.playlist_add_items(playlist_data['id'], song_ids)\\n playlist_link = playlist_data['external_urls']['spotify']\\n return playlist_link\",\n \"async def async_parse_pls_url(self, playlist):\\n try:\\n websession = async_get_clientsession(self.hass)\\n async with async_timeout.timeout(10):\\n response = await websession.get(playlist)\\n\\n except (asyncio.TimeoutError, aiohttp.ClientError) as error:\\n _LOGGER.warning(\\n \\\"For: %s unable to get the PLS playlist: %s\\\", self._name, playlist\\n )\\n return playlist\\n\\n if response.status == HTTPStatus.OK:\\n data = await response.text()\\n _LOGGER.debug(\\\"For: %s PLS playlist: %s contents: %s\\\", self._name, playlist, data)\\n\\n lines = [line.strip(\\\"\\\\n\\\\r\\\") for line in data.split(\\\"\\\\n\\\") if line.strip(\\\"\\\\n\\\\r\\\") != \\\"\\\"]\\n if len(lines) > 0:\\n _LOGGER.debug(\\\"For: %s PLS playlist: %s lines: %s\\\", self._name, playlist, lines)\\n urls = [u for u in lines if u.startswith('File')]\\n _LOGGER.debug(\\\"For: %s PLS playlist: %s urls: %s\\\", self._name, playlist, urls)\\n if len(urls) > 0:\\n url = urls[0].split('=')\\n if len(url) > 1:\\n return url[1]\\n else:\\n _LOGGER.error(\\\"For: %s PLS playlist: %s No valid http URL in the playlist!!!\\\", self._name, playlist)\\n self._nometa = True\\n else:\\n _LOGGER.error(\\\"For: %s PLS playlist: %s No content to parse!!!\\\", self._name, playlist)\\n\\n else:\\n _LOGGER.error(\\n \\\"For: %s (%s) Get failed, response code: %s Full message: %s\\\",\\n self._name,\\n self._host,\\n response.status,\\n response,\\n )\\n\\n return playlist\",\n \"def remove_from_playlist(self, playlist_name, video_id):\\n if playlist_name.lower() not in self.playlists:\\n print(\\\"Cannot remove video from\\\", playlist_name, end=\\\"\\\")\\n print(\\\": Playlist does not exist\\\")\\n elif self._video_library.get_video(video_id) is None:\\n print(\\\"Cannot remove video from\\\", playlist_name, end=\\\"\\\") \\n print(\\\": Video does not exist\\\") \\n elif self._video_library.get_video(video_id) not in self.playlists[playlist_name.lower()]:\\n print(\\\"Cannot remove video from\\\", playlist_name, end=\\\"\\\")\\n print(\\\": Video is not in playlist \\\")\\n else:\\n print(\\\"Removed video from\\\", playlist_name, end=\\\"\\\")\\n print(\\\":\\\", self._video_library.get_video(video_id).title)\\n self.playlists[playlist_name.lower()].remove(self._video_library.get_video(video_id))\",\n \"def playlist_search(search_term, results=5):\\r\\n if search_term:\\r\\n url = PLAYLIST_SEARCH_URL.format(API_KEY, util.web.quote(search_term.encode('ascii', 'ignore')))\\r\\n response = util.web.http_get(url=url, json=True, referer='https://tinychat.com')\\r\\n\\r\\n if response['json'] is not None:\\r\\n play_lists = []\\r\\n try:\\r\\n if 'items' in response['json']:\\r\\n for i, item in enumerate(response['json']['items']):\\r\\n if i == results:\\r\\n return play_lists\\r\\n playlist_id = item['id']['playlistId']\\r\\n playlist_title = item['snippet']['title'].encode('ascii', 'ignore')\\r\\n play_list_info = {\\r\\n 'playlist_title': playlist_title,\\r\\n 'playlist_id': playlist_id\\r\\n }\\r\\n play_lists.append(play_list_info)\\r\\n except KeyError as ke:\\r\\n log.error(ke, exc_info=True)\\r\\n return None\",\n \"def search_song(self, name):\\n self.logger.debug('Searched for Song: {}'.format(name))\\n results = self.sp.search(q='track:' + name, type='track')\\n songs = [song for song in results['tracks']['items']]\\n i = 1\\n songs_ls = []\\n table_ls = []\\n for song in songs:\\n table_ls.append([i,\\n song['name'][0:20].strip(),\\n song['album']['name'][0:20].strip(),\\n \\\"%0.2f\\\" % (song['duration_ms'] / 60000),\\n song['popularity']])\\n songs_ls.append(song['uri'])\\n i = i + 1\\n return songs_ls, table_ls\",\n \"def spotify_create_playlist(\\n playlist_name: str,\\n access_token: str,\\n user_spotify_id: str,\\n public: bool = True,\\n description: str = None,\\n) -> str:\\n headers = {\\n \\\"Authorization\\\": \\\"Bearer {}\\\".format(access_token),\\n \\\"Content-Type\\\": \\\"application/json\\\",\\n }\\n body = {\\\"name\\\": playlist_name, \\\"public\\\": public}\\n if description is not None:\\n body[\\\"description\\\"] = description\\n response = requests.post(\\n \\\"https://api.spotify.com/v1/users/{}/playlists\\\".format(user_spotify_id),\\n headers=headers,\\n json=body,\\n )\\n if response.status_code != 200 and response.status_code != 201:\\n return \\\"Error {}\\\".format(response.text)\\n return response.json()[\\\"id\\\"]\",\n \"def playlistid(self, track_id=None):\\n track_id = '' if track_id is None else track_id\\n lines = yield from self.command('playlistid {}'.format(track_id))\\n return parse_playlist(lines)\",\n \"def playlist_remove(name):\\n if name.isdigit() or g.userpl.get(name):\\n\\n if name.isdigit():\\n name = int(name) - 1\\n name = sorted(g.userpl)[name]\\n\\n del g.userpl[name]\\n g.message = \\\"Deleted playlist %s%s%s\\\" % (c.y, name, c.w)\\n g.content = playlists_display()\\n save_to_file()\\n\\n else:\\n g.message = F('pl not found advise ls') % name\\n g.content = playlists_display()\",\n \"def search_song(self, name, album=None, artist=None):\\n\\n endpoint = \\\"/search\\\"\\n query = f\\\"track:{self._strip_punctuation(name)}\\\"\\n if artist:\\n query += f\\\" artist:{self._strip_punctuation(artist)}\\\"\\n if album:\\n query += f\\\" album:{self._strip_punctuation(album)}\\\"\\n response = self._send(endpoint, \\\"GET\\\", params={\\\"q\\\": query, \\\"type\\\": \\\"track\\\"})\\n tracks = response.json()[\\\"tracks\\\"]\\n if tracks[\\\"total\\\"] == 0:\\n raise SongNotFoundError(\\n f\\\"song name={name} artist={artist} album={album} could not be found\\\"\\n )\\n return tracks[\\\"items\\\"]\",\n \"def remove_from_playlist(self, playlist_name, video_id):\\n playlist_exists = False\\n video_id_exists = False\\n video_exists_in_playlist = False\\n for playlist in list(self.playlists.keys()):\\n if playlist_name.upper() == playlist.upper():\\n playlist_exists = True\\n real_playlist_name = playlist\\n break\\n \\n videos = self._video_library.get_all_videos()\\n for v in videos:\\n if v.video_id.upper() == video_id.upper():\\n video_id_exists = True\\n video_title = v.title\\n break\\n if not playlist_exists:\\n print(f\\\"Cannot remove video from {playlist_name}: Playlist does not exist\\\")\\n \\n elif not video_id_exists:\\n print(f\\\"Cannot remove video from {playlist_name}: Video does not exist\\\")\\n\\n elif video_id not in self.playlists[real_playlist_name]:\\n print(f\\\"Cannot remove video from {playlist_name}: Video is not in playlist\\\")\\n \\n else:\\n self.playlists[real_playlist_name].remove(video_id.lower())\\n print(f\\\"Removed video from {playlist_name}: {video_title}\\\")\\n # print(\\\"remove_from_playlist needs implementation\\\")\",\n \"async def play(self, ctx, *, query: str):\\n # Get the player for this guild from cache.\\n player = self.bot.lavalink.player_manager.get(ctx.guild.id)\\n\\n # If player is paused - unpause, return\\n if player.paused:\\n return await player.set_pause(False)\\n\\n # Remove leading and trailing <>. <> may be used to suppress embedding links in Discord.\\n query = query.strip('<>')\\n\\n # Check if the user input might be a URL. If it isn't, we can Lavalink do a YouTube search for it instead.\\n # SoundCloud searching is possible by prefixing \\\"scsearch:\\\" instead.\\n if not url_rx.match(query):\\n query = f'ytsearch:{query}'\\n\\n # Get the results for the query from Lavalink.\\n results = await player.node.get_tracks(query)\\n\\n # Results could be None if Lavalink returns an invalid response (non-JSON/non-200 (OK)).\\n # ALternatively, resullts['tracks'] could be an empty array if the query yielded no tracks.\\n if not results or not results['tracks']:\\n return await ctx.send(embed=self.error_embed(f\\\"No results found for `{query}`\\\"))\\n\\n embed = discord.Embed(color=discord.Color.blurple())\\n\\n # Valid loadTypes are:\\n # TRACK_LOADED - single video/direct URL)\\n # PLAYLIST_LOADED - direct URL to playlist)\\n # SEARCH_RESULT - query prefixed with either ytsearch: or scsearch:.\\n # NO_MATCHES - query yielded no results\\n # LOAD_FAILED - most likely, the video encountered an exception during loading.\\n if results['loadType'] == 'PLAYLIST_LOADED':\\n tracks = results['tracks']\\n\\n for track in tracks:\\n # Add all of the tracks from the playlist to the queue.\\n length = track[\\\"info\\\"][\\\"length\\\"]\\n track = lavalink.models.AudioTrack(\\n track, requester=ctx.author.id, recommended=True, length=length)\\n player.add(requester=ctx.author.id, track=track)\\n\\n embed.title = ''\\n embed.description = f'Queued **{results[\\\"playlistInfo\\\"][\\\"name\\\"]}** - {len(tracks)} tracks'\\n else:\\n track = results['tracks'][0]\\n embed.title = \\\"\\\"\\n embed.description = f'Queued [{track[\\\"info\\\"][\\\"title\\\"]}]({track[\\\"info\\\"][\\\"uri\\\"]}) [{ctx.message.author.mention}]'\\n length = track[\\\"info\\\"][\\\"length\\\"]\\n\\n # You can attach additional information to audiotracks through kwargs, however this involves\\n # constructing the AudioTrack class yourself.\\n track = lavalink.models.AudioTrack(\\n track, requester=ctx.author.id, recommended=True, length=length)\\n player.add(requester=ctx.author.id, track=track)\\n\\n # Save text channel in which bot command was sent\\n # for further reply\\n self.preferred_channels[str(ctx.guild.id)] = ctx.message.channel.id\\n\\n await ctx.send(embed=embed)\\n\\n # We don't want to call .play() if the player is playing as that will effectively skip\\n # the current track.\\n if not player.is_playing:\\n await player.play()\",\n \"def import_spotify(info: dict) -> (str, int):\\n url = info[\\\"playlist_url\\\"]\\n # Validate URL\\n matches = (\\n re.match(r\\\"^https?://open\\\\.spotify\\\\.com/playlist/([a-zA-Z\\\\d]*)/?\\\", url)\\n if isinstance(url, str)\\n else None\\n )\\n if not matches:\\n return \\\"Invalid URL\\\", 400\\n playlist_id = matches.group(1)\\n query_url = \\\"https://api.spotify.com/v1/playlists/\\\" + playlist_id\\n query_headers = {\\\"Authorization\\\": \\\"Bearer {}\\\".format(info[\\\"access_token\\\"])}\\n # Get/create playlist\\n playlist_json = requests.get(query_url, headers=query_headers).json()\\n if \\\"error\\\" in playlist_json:\\n status = playlist_json[\\\"error\\\"].get(\\\"status\\\")\\n message = playlist_json[\\\"error\\\"].get(\\\"message\\\")\\n return (\\n message if message else \\\"Error retrieving playlist\\\",\\n status if status else 500,\\n )\\n playlist = Playlist(\\n name=playlist_json[\\\"name\\\"],\\n last_sync_spotify=timezone.now(),\\n spotify_id=playlist_id,\\n )\\n if \\\"user\\\" in info:\\n playlist.owner = PlaylstrUser.objects.filter(id=info[\\\"user\\\"]).first()\\n if \\\"owner\\\" in playlist_json:\\n playlist.spotify_creator_id = playlist_json[\\\"owner\\\"][\\\"id\\\"]\\n playlist.spotify_creator_name = playlist_json[\\\"owner\\\"][\\\"display_name\\\"]\\n playlist.save()\\n # Get playlist tracks\\n tracks_response = requests.get(query_url + \\\"/tracks\\\", headers=query_headers)\\n if tracks_response.status_code != 200:\\n return tracks_response.reason, 500\\n tracks_json = tracks_response.json()\\n if \\\"error_description\\\" in tracks_json:\\n return tracks_json[\\\"error_description\\\"], 500\\n # Get list of tracks\\n index = -1\\n while \\\"next\\\" in tracks_json and tracks_json[\\\"next\\\"] is not None:\\n for j in tracks_json[\\\"items\\\"]:\\n index += 1\\n track = track_from_spotify_json(j[\\\"track\\\"])\\n try:\\n PlaylistTrack.objects.create(\\n playlist=playlist, track=track, index=index\\n )\\n except IntegrityError as e:\\n print(\\\"Error adding track {}: {}\\\".format(str(track), str(e)))\\n continue\\n tracks_json = requests.get(tracks_json[\\\"next\\\"], headers=query_headers).json()\\n return str(playlist.playlist_id), 200\",\n \"def playlist_create(self, user_id: str, name: str, public: bool = True,\\n description: str = ''):\\n payload = {\\n 'name': name,\\n 'public': public,\\n 'description': description\\n }\\n return self._post(f'users/{user_id}/playlists', payload=payload)\",\n \"async def add_playlist(\\n self, user: discord.User, url: str\\n ) -> Optional[UserPlaylist]:\\n\\n playlist = await get_playlist(self.spotify, self.youtube, url)\\n\\n if not playlist:\\n return\\n\\n generated_id = str(uuid.uuid4())\\n await self.database.insertifnotexists(\\n self.tables[\\\"playlists\\\"],\\n {\\\"user\\\": user.id, \\\"playlist_url\\\": url, \\\"id\\\": generated_id},\\n {\\\"user\\\": user.id, \\\"playlist_url\\\": url},\\n )\\n\\n return UserPlaylist(self, user, generated_id, playlist)\",\n \"def delete_playlist(self, playlist_name):\\n print(\\\"deletes_playlist needs implementation\\\")\",\n \"def playlistinfo(self, pos=None):\\n pos = '' if pos is None else pos\\n lines = yield from self.command('playlistinfo {}'.format(pos))\\n return parse_playlist(lines)\",\n \"def create_playlist(self):\\n playlist=self.sp.user_playlist_create(user=self.username,name=self.nameOfPlaylist,description=self.description)\\n return playlist['id']\",\n \"def play_name(self, name):\\n self.name = name\\n self._stream_from_name()\\n return self.URL\",\n \"def _get_playlist(self) -> str:\\n playlist_url = f'http://{self.tvh_url}/playlist/channels.m3u'\\n auth = HTTPBasicAuth(self.tvh_user, self.tvh_pass)\\n response = requests.get(playlist_url, auth=auth)\\n self.error(response, __name__)\\n return response.text\",\n \"def save(self, playlist):\\n validation.check_instance(playlist, Playlist)\\n\\n if playlist.uri is None:\\n return # TODO: log this problem?\\n\\n uri_scheme = urllib.parse.urlparse(playlist.uri).scheme\\n backend = self.backends.with_playlists.get(uri_scheme, None)\\n if not backend:\\n return None\\n\\n # TODO: we let AssertionError error through due to legacy tests :/\\n with _backend_error_handling(backend, reraise=AssertionError):\\n playlist = backend.playlists.save(playlist).get()\\n playlist is None or validation.check_instance(playlist, Playlist)\\n if playlist:\\n listener.CoreListener.send(\\n 'playlist_changed', playlist=playlist)\\n return playlist\\n\\n return None\",\n \"def save(self, playlist: Playlist) -> Optional[Playlist]:\\n validation.check_instance(playlist, Playlist)\\n\\n if playlist.uri is None:\\n return None # TODO: log this problem?\\n\\n uri_scheme = UriScheme(urllib.parse.urlparse(playlist.uri).scheme)\\n backend = self.backends.with_playlists.get(uri_scheme, None)\\n if not backend:\\n return None\\n\\n # TODO: we let AssertionError error through due to legacy tests :/\\n with _backend_error_handling(backend, reraise=AssertionError):\\n result = backend.playlists.save(playlist).get()\\n if result is not None:\\n validation.check_instance(result, Playlist)\\n if result:\\n listener.CoreListener.send(\\\"playlist_changed\\\", playlist=result)\\n return result\\n\\n return None\",\n \"def playlist_path(folder, listname):\\n\\n listname = listname.title().strip()\\n for char in ['(', ')', '\\\\'', '\\\"', '[', ']']:\\n listname = listname.replace(char, '')\\n\\n for char in [' ', '..', ',', '!', '%', '#', '$', '@', '*', '/', '\\\\\\\\', '&', '+', ':']:\\n listname = listname.replace(char, '-')\\n\\n\\n listname = strip_accents(unicode(listname))\\n listname = re.sub('-+', '-', listname)\\n listname = re.sub('\\\\.+', '.', listname)\\n listname = listname.strip('-,.')\\n\\n if not listname:\\n return\\n\\n return os.path.join(folder, listname.replace('.M3U', '.m3u').replace('0S.', '0s.'))\",\n \"def remove_from_playlist(self, playlist_name, video_id):\\n videos = self._video_library.get_all_videos()\\n video_id_list = []\\n for vid in videos:\\n video_id_list.append(vid.video_id)\\n if video_id == vid.video_id:\\n video = vid\\n if playlist_name.upper() in self.playlist.keys() and video.title in self.playlist[playlist_name.upper()]:\\n self.playlist[playlist_name.upper()].remove(video.title)\\n print(f\\\"Removed video from {playlist_name}: {video.title}\\\")\\n elif playlist_name.upper() in self.playlist.keys() and video.title not in self.playlist[playlist_name.upper()]:\\n print(f\\\"Cannot remove video from {playlist_name}: Video is not in playlist\\\")\\n if playlist_name.upper() not in self.playlist.keys():\\n print(f\\\"Cannot remove video from {playlist_name}: Playlist does not exist\\\")\\n if video_id not in video_id_list:\\n print(f\\\"Cannot remove video from {playlist_name}: Video does not exist\\\")\",\n \"def find_by_name(our_data,name):\\n for album in our_data:\\n if album['album'] == name:\\n return album\\n return None\",\n \"def get_yt_playlist(self, list_id, url=None):\\n if self._settings.enable_yt_dl and url:\\n try:\\n if not self._yt_dl:\\n raise YouTubeException(\\\"yt-dlp is not initialized!\\\")\\n\\n self._yt_dl.update_options({\\\"noplaylist\\\": False, \\\"extract_flat\\\": True})\\n info = self._yt_dl.get_info(url, skip_errors=False)\\n if \\\"url\\\" in info:\\n info = self._yt_dl.get_info(info.get(\\\"url\\\"), skip_errors=False)\\n\\n return info.get(\\\"title\\\", \\\"\\\"), [(e.get(\\\"title\\\", \\\"\\\"), e.get(\\\"id\\\", \\\"\\\")) for e in info.get(\\\"entries\\\", [])]\\n finally:\\n # Restoring default options\\n if self._yt_dl:\\n self._yt_dl.update_options({\\\"noplaylist\\\": True, \\\"extract_flat\\\": False})\\n\\n return PlayListParser.get_yt_playlist(list_id)\",\n \"def get_cached_playlist(self):\\n if self.cached_playlist is None:\\n self.get_playlist()\\n return self.cached_playlist\",\n \"def media_playlist(self):\\n return self._table.active_playlist.name if self._table.active_playlist else None\",\n \"def get_playlists(section):\\n global parent_folder\\n # 초기값은 빈 값\\n print(f\\\" getting playlists for section: {section['title']}\\\")\\n # section의 인자로 받은 title 출력\\n soup = get_soup(section['link'])\\n # section의 인자로 받은 link를 get_soup 함수 실행\\n # i.e. https://www.youtube.com//user/gjenkinslbcc/playlists?view=50&sort=dd&shelf_id=2\\n if soup is None: # no playlist, create dummy with default link\\n url = f'{youtube_base}{parent_folder}{channel_name}/videos'\\n return [\\n {'title': 'No Playlists', 'link':url }]\\n # soup값이 없을 시 [{'title': 'No Playlists', 'link':url }] return\\n atags = soup('a', class_='yt-uix-tile-link')\\n # a태그의 class가 'yt-uix-tile-link'인 값 파싱\\n\\n playlists = []\\n for a in atags:\\n title = a.text\\n # atags를 통해 모든 플레이리스트의 title값 파싱\\n if title != 'Liked videos': # liked videos 제외\\n url = fix_url(a['href'])\\n # atags를 통해 모든 플레이리스트 url값 파싱\\n playlists.append({'title': title, 'link': url})\\n #playlists에 모든 값 저장\\n\\n if not playlists: # 플레이리스트 없을 시\\n url = f'{youtube_base}/{parent_folder}{channel_name}/videos'\\n return [{'title': 'No Playlists', 'link': url}]\\n\\n return playlists\",\n \"def find_by_name ( self, name, **kw ):\\n try:\\n return next ( self.find_all_by_name ( name, **kw ) )\\n except StopIteration:\\n return None\",\n \"def remove_from_playlist(self, playlist_name, video_id):\\n if playlist_name.lower() in self.playlists:\\n for i in self.playlists[playlist_name.lower()]:\\n videos = self._video_library.get_all_videos()\\n templist = []\\n\\n def converttostr(input_seq, seperator):\\n # Join all the strings in list\\n final_str = seperator.join(input_seq)\\n return final_str\\n\\n for vid in videos:\\n if i == vid.video_id:\\n\\n temptitle=vid.title\\n print(f\\\"Removed video from {playlist_name}: {temptitle}\\\")\\n self.playlists[playlist_name.lower()].remove(video_id)\\n\\n\\n if playlist_name not in self.playlists:\\n print(f\\\"Cannot remove video from {playlist_name}: Playlist does not exist\\\")\\n elif video_id not in self.playlists[playlist_name.lower()]:\\n print(\\\"Cannot remove video from my_playlist: Video does not exist\\\")\\n #self.playlists[playlist_name.lower()].remove(video_id)\\n\\n\\n\\n #print(\\\"remove_from_playlist needs implementation\\\")\",\n \"def current_playlist():\\n current_playlists_cmd = {\\n \\\"jsonrpc\\\": \\\"2.0\\\",\\n \\\"method\\\": \\\"Playlist.GetPlaylists\\\",\\n \\\"id\\\": \\\"getCurrentPlaylists\\\"\\n }\\n playlists_result = execute_log_command(current_playlists_cmd)\\n current = next(\\n (playlist for playlist in playlists_result[\\\"result\\\"] if playlist[\\\"type\\\"] == \\\"video\\\"),\\n None\\n )\\n if current:\\n playlist_contents_cmd = {\\n \\\"jsonrpc\\\": \\\"2.0\\\",\\n \\\"method\\\": \\\"Playlist.GetItems\\\",\\n \\\"id\\\": \\\"getPlaylistItems\\\",\\n \\\"params\\\": {\\n \\\"playlistid\\\": current[\\\"playlistid\\\"],\\n }\\n }\\n current_playlist_contents = execute_log_command(playlist_contents_cmd)\\n return {\\n \\\"id\\\": current[\\\"playlistid\\\"],\\n \\\"items\\\": current_playlist_contents[\\\"result\\\"].get(\\\"items\\\", [])\\n }\\n return None\",\n \"def get_item(self, name: str) -> Optional[Item]:\\n item = self.filter_items(name, limit=1)\\n return item[0] if item else None\",\n \"def get_playlist_section(self,req):\\n# if self.kind=='root':\\n# playlist=self.get_playorder()\\n if self.kind in ('root','playlist'):\\n playlist= self.get_dumb_playlist(objects=True)\\n else:# must be a smart playlist\\n playlist=self.get_smart_playlist(req,objects=True)\\n if playlist: # if we have at least one integer value\\n # set start and end\\n start=safeint(req._pl_start)\\n # find current index\\n curr=self.transport.uid\\n p=0 if curr else -1\\n # if we are playing a track and we are in the root or current playlist...\\n if curr and ((self.uid==1) or (self.player.list and (self.uid==self.player.list.uid))):\\n # adjust _pl_start to display the currently playing track near the top of the list if possible\\n # try using the index to find the track in the playlist - this should work\\n try:\\n p=self.get_index()\\n assert playlist[p].uid==curr\\n except:\\n p=0\\n# raise\\n # otherwise, look for the currently playing track by uid\\n# try:\\n# p=playlist.index(self.transport.uid) # find the current track\\n# except:\\n# raise\\n# p=0\\n# print \\\"got p:\\\",p\\n if (\\\"_pl_start\\\" not in req) and (p>start):\\n start=max(0,p-2) # adjust start so that the current track is third or less on the list\\n # adjust end, and set more req parameters\\n end=start+50\\n req._pl_index=p\\n req._pl_start=start\\n if start:\\n req._pl_back=max(0,start-50)\\n if len(playlist)>end:\\n req._pl_more=end\\n req._pl_len=len(playlist)\\n# print \\\"start=\\\",start,\\\" end=\\\",end,\\\" index=\\\",req._pl_index,\\\" more=\\\",req._pl_more,\\\" back=\\\",req._pl_back, \\\" len=\\\",len(playlist)\\n return playlist[start:end]\\n return []\",\n \"def _get_player(self, player_name):\\n return self._collection.find_one({'name': player_name})\",\n \"def test_list_playlist_not_duplicated(self):\\n user = factories.UserFactory()\\n organization = factories.OrganizationFactory()\\n\\n playlist = factories.PlaylistFactory(\\n organization=organization,\\n )\\n factories.PlaylistAccessFactory(\\n playlist=playlist,\\n user=user,\\n role=models.ADMINISTRATOR,\\n )\\n factories.PlaylistAccessFactory.create_batch(\\n 3,\\n playlist=playlist,\\n role=models.ADMINISTRATOR,\\n )\\n factories.OrganizationAccessFactory(\\n organization=organization,\\n user=user,\\n role=models.ADMINISTRATOR,\\n )\\n factories.OrganizationAccessFactory.create_batch(\\n 3,\\n organization=organization,\\n role=models.ADMINISTRATOR,\\n )\\n\\n jwt_token = UserAccessTokenFactory(user=user)\\n\\n response = self.client.get(\\n \\\"/api/playlists/\\\",\\n HTTP_AUTHORIZATION=f\\\"Bearer {jwt_token}\\\",\\n )\\n\\n self.assertEqual(response.status_code, 200)\\n self.assertEqual(response.json()[\\\"count\\\"], 1)\\n self.assertEqual(response.json()[\\\"results\\\"][0][\\\"id\\\"], str(playlist.id))\",\n \"def remove_from_playlist(self, playlist_name, video_id):\\n playlist_id = playlist_name.lower()\\n if not playlist_id in self.playlists.keys():\\n print(f\\\"Cannot remove video from {playlist_name}: Playlist does not exist\\\")\\n return\\n\\n if not self._video_library.get_video(video_id):\\n print(f\\\"Cannot remove video from {playlist_name}: Video does not exist\\\")\\n return\\n\\n if not video_id in self.playlists[playlist_id].videos:\\n print(f\\\"Cannot remove video from {playlist_name}: Video is not in playlist\\\")\\n return\\n\\n video = self._video_library.get_video(video_id)\\n\\n self.playlists[playlist_id].videos.remove(video_id)\\n print(f\\\"Removed video from {playlist_name}: {video.title}\\\")\\n return\",\n \"def clear_playlist(self, playlist_name):\\n playlist_exists = False\\n \\n for playlist in list(self.playlists.keys()):\\n if playlist_name.upper() == playlist.upper():\\n playlist_exists = True\\n real_playlist_name = playlist\\n break\\n if playlist_exists:\\n self.playlists[real_playlist_name] = []\\n print(f\\\"Successfully removed all videos from {playlist_name}\\\")\\n else:\\n print(f\\\"Cannot clear playlist {playlist_name}: Playlist does not exist\\\")\\n # print(\\\"clears_playlist needs implementation\\\")\",\n \"def create_playlist(self, request):\\n # TODO: Max amount of playlists at 20 for a user\\n user = Account.find_by_id(request.userid)\\n if user is None:\\n print \\\"User not found\\\" \\n return PlaylistResponse(errmsg=\\\"User ID not found\\\")\\n new_pl = Playlist.add_new_playlist(user.key, request.name)\\n return PlaylistResponse(pid=new_pl.key.id())\",\n \"def selectPlay(id):\\n\\tsong = music.song()\\n\\tsql = \\\"SELECT id, title, path, filename, hash, base FROM songs \\\" \\\\\\n\\t\\t+ \\\"WHERE id = \\\" + str(id) + \\\";\\\"\\n\\tc, conn = connect()\\n\\tc.execute(sql)\\n\\tsinfo = c.fetchone()\\n\\t\\n\\tif sinfo[0]:\\n\\t\\tsong.id = sinfo[0]\\n\\tif sinfo[1]:\\n\\t\\tsong.name = sinfo[1]\\n\\tif sinfo[2]:\\n\\t\\tsong.path = sinfo[2]\\n\\tif sinfo[3]:\\n\\t\\tsong.filename = sinfo[3]\\n\\tif sinfo[4]:\\n\\t\\tsong.hash = sinfo[4]\\n\\tif sinfo[5]:\\n\\t\\tsong.base = sinfo[5]\\n\\t\\n\\treturn song\",\n \"def get_playlists(search_string=None):\\n item_type = 'playlists'\\n info_dict = spotify.category_playlists(search_string)\\n items = info_dict[item_type][\\\"items\\\"]\\n playlists = []\\n for i in range(len(items)):\\n playlist_name = items[i][\\\"name\\\"]\\n owner_name = items[i][\\\"owner\\\"][\\\"display_name\\\"]\\n total_tracks = items[i][\\\"tracks\\\"][\\\"total\\\"]\\n playlist_id = items[i][\\\"id\\\"]\\n owner_id = items[i][\\\"owner\\\"][\\\"id\\\"]\\n playlists.append({\\\"Playlist Name\\\": playlist_name,\\n \\\"Owner Name\\\": owner_name,\\n \\\"No. of tracks\\\": total_tracks,\\n \\\"Playlist ID\\\": playlist_id,\\n \\\"Owner ID\\\": owner_id\\n })\\n return playlists\",\n \"def add_from_playlist(self, params):\\n lists = params\\n\\n # Lists to load\\n names = []\\n for n in self.listIDs.keys():\\n for l in lists:\\n if 'playlist:' + l in n:\\n names.append(n)\\n\\n self.add_playlist(names)\"\n]","isConversational":false},"negative_scores":{"kind":"list like","value":["0.7941071","0.7861843","0.78293544","0.7535346","0.69100803","0.6823972","0.6806134","0.6756279","0.67378354","0.6722012","0.6667086","0.66420937","0.65845215","0.65714145","0.6559312","0.65355885","0.65215516","0.6419069","0.63462394","0.63388675","0.62996066","0.6279552","0.62776995","0.6266178","0.62398326","0.62068707","0.620335","0.62024647","0.61696726","0.6169007","0.6140137","0.61192024","0.61018395","0.6085873","0.60785764","0.60737705","0.6071642","0.60394055","0.599857","0.5994433","0.5988312","0.59729886","0.59632856","0.59218216","0.5888325","0.5863348","0.58344704","0.58247477","0.5822574","0.57902896","0.578161","0.5760189","0.5690467","0.56669223","0.56663835","0.5666069","0.5638868","0.5632817","0.5618105","0.56013435","0.5598789","0.5554301","0.55386245","0.55362946","0.5530257","0.5527836","0.55087113","0.5508158","0.54958767","0.54937553","0.54936713","0.54912","0.5485116","0.54822505","0.5467806","0.5449756","0.5447522","0.5441841","0.54297364","0.5418309","0.54011905","0.5400817","0.5378354","0.53749174","0.5368879","0.5368318","0.5364108","0.53510666","0.53487194","0.5347446","0.5316641","0.52967644","0.5280041","0.5279265","0.5272358","0.5256297","0.52319807","0.5223232","0.52206427","0.5217636"],"string":"[\n \"0.7941071\",\n \"0.7861843\",\n \"0.78293544\",\n \"0.7535346\",\n \"0.69100803\",\n \"0.6823972\",\n \"0.6806134\",\n \"0.6756279\",\n \"0.67378354\",\n \"0.6722012\",\n \"0.6667086\",\n \"0.66420937\",\n \"0.65845215\",\n \"0.65714145\",\n \"0.6559312\",\n \"0.65355885\",\n \"0.65215516\",\n \"0.6419069\",\n \"0.63462394\",\n \"0.63388675\",\n \"0.62996066\",\n \"0.6279552\",\n \"0.62776995\",\n \"0.6266178\",\n \"0.62398326\",\n \"0.62068707\",\n \"0.620335\",\n \"0.62024647\",\n \"0.61696726\",\n \"0.6169007\",\n \"0.6140137\",\n \"0.61192024\",\n \"0.61018395\",\n \"0.6085873\",\n \"0.60785764\",\n \"0.60737705\",\n \"0.6071642\",\n \"0.60394055\",\n \"0.599857\",\n \"0.5994433\",\n \"0.5988312\",\n \"0.59729886\",\n \"0.59632856\",\n \"0.59218216\",\n \"0.5888325\",\n \"0.5863348\",\n \"0.58344704\",\n \"0.58247477\",\n \"0.5822574\",\n \"0.57902896\",\n \"0.578161\",\n \"0.5760189\",\n \"0.5690467\",\n \"0.56669223\",\n \"0.56663835\",\n \"0.5666069\",\n \"0.5638868\",\n \"0.5632817\",\n \"0.5618105\",\n \"0.56013435\",\n \"0.5598789\",\n \"0.5554301\",\n \"0.55386245\",\n \"0.55362946\",\n \"0.5530257\",\n \"0.5527836\",\n \"0.55087113\",\n \"0.5508158\",\n \"0.54958767\",\n \"0.54937553\",\n \"0.54936713\",\n \"0.54912\",\n \"0.5485116\",\n \"0.54822505\",\n \"0.5467806\",\n \"0.5449756\",\n \"0.5447522\",\n \"0.5441841\",\n \"0.54297364\",\n \"0.5418309\",\n \"0.54011905\",\n \"0.5400817\",\n \"0.5378354\",\n \"0.53749174\",\n \"0.5368879\",\n \"0.5368318\",\n \"0.5364108\",\n \"0.53510666\",\n \"0.53487194\",\n \"0.5347446\",\n \"0.5316641\",\n \"0.52967644\",\n \"0.5280041\",\n \"0.5279265\",\n \"0.5272358\",\n \"0.5256297\",\n \"0.52319807\",\n \"0.5223232\",\n \"0.52206427\",\n \"0.5217636\"\n]","isConversational":false},"document_score":{"kind":"string","value":"0.79534113"},"document_rank":{"kind":"string","value":"0"}}},{"rowIdx":10197,"cells":{"query":{"kind":"string","value":"Main method used to handle http connection to PMS. encodes the response to utf8 and parses the xml returned from PMS into a Element"},"document":{"kind":"string","value":"def query(self, path, method=None, headers=None, **kwargs):\n url = self.url(path)\n method = method or self.session.get\n log.info('%s %s', method.__name__.upper(), url)\n h = self.headers().copy()\n if headers:\n h.update(headers)\n response = method(url, headers=h, timeout=TIMEOUT, **kwargs)\n if response.status_code not in [200, 201]:\n codename = codes.get(response.status_code)[0]\n raise BadRequest('(%s) %s' % (response.status_code, codename))\n data = response.text.encode('utf8')\n return ElementTree.fromstring(data) if data else None"},"metadata":{"kind":"string","value":"{\n \"objective\": {\n \"self\": [],\n \"paired\": [],\n \"triplet\": [\n [\n \"query\",\n \"document\",\n \"negatives\"\n ]\n ]\n }\n}"},"negatives":{"kind":"list like","value":["def parse_response(self, resp):\n p, u = self.getparser()\n\n if hasattr(resp, 'text'):\n # modern requests will do this for us\n text = resp.text # this is unicode(py2)/str(py3)\n else:\n\n encoding = requests.utils.get_encoding_from_headers(resp.headers)\n if encoding is None:\n encoding = 'utf-8' # FIXME: what to do here?\n\n if sys.version_info[0] == 2:\n text = unicode( # noqa: F821\n resp.content, encoding, errors='replace')\n else:\n assert sys.version_info[0] == 3\n text = str(resp.content, encoding, errors='replace')\n p.feed(text)\n p.close()\n return u.close()","def parse(self, response):","def execute(self):\n headers = {\n 'Content-type': 'application/x-www-form-urlencoded',\n 'Accept-Charset': 'utf-8',\n 'User-Agent': USER_AGENT\n }\n request = urllib2.Request(self.url(), headers=headers)\n response = urllib2.urlopen(request)\n \n return etree.parse(response)","def make_request_xml(self):\n #print (self.url)\n try:\n with closing(get(self.url, stream=True)) as resp: #returns b`xml`\n if self.is_good_enough_xml(resp):\n return resp.content\n else:\n return None\n except RequestException as e:\n print('Error during requests to {0} : {1}'.format(url, str(e)))\n return None","def setup_response(self):\r\n xml = self.xml\r\n # TODO: XML can override external resource (grader/queue) URL\r\n self.url = xml.get('url', None)\r\n\r\n # We do not support xqueue within Studio.\r\n if self.capa_system.xqueue is not None:\r\n default_queuename = self.capa_system.xqueue['default_queuename']\r\n else:\r\n default_queuename = None\r\n self.queue_name = xml.get('queuename', default_queuename)\r\n\r\n # VS[compat]:\r\n # Check if XML uses the ExternalResponse format or the generic\r\n # CodeResponse format\r\n codeparam = self.xml.find('codeparam')\r\n assert codeparam is not None, \"Unsupported old format! <coderesponse> without <codeparam>\"\r\n self._parse_coderesponse_xml(codeparam)","def parse_response(self):\n pass","def __fetch_data(self, url):\n try:\n response = urlopen(url)\n root = ET.fromstring(response.read())\n except HTTPError as exc:\n root = ET.fromstring(exc.read())\n raise ValueError(root.get('message'))\n return root","def main(self):\n question = Parser(self.question)\n latitude = 0\n longitude = 0\n address = \"Bonjour, je vais bien merci !\"\n history = self._get_papy_sentence()\n article_title = \"\"\n location = question.get_location()\n google = GoogleApi(location, self.google_key)\n google_response = google.parse()\n if question.get_verification():\n latitude = google_response['latitude']\n longitude = google_response['longitude']\n address = google_response['address']\n if google_response['status'] == \"OK\":\n wiki = WikiApi(google_response['latitude'],\n google_response['longitude'])\n wiki_response = wiki.parse()\n if wiki_response['status'] == \"OK\":\n history = wiki_response['history']\n article_title = wiki_response['article_title']\n\n self.response_grandpy = {\n 'latitude': latitude,\n 'longitude': longitude,\n 'address': address,\n 'history': history,\n 'article_title': article_title\n }\n return self.response_grandpy","def _api_call(url: str) -> ET.Element:\n result = requests.get(url)\n if result.status_code != 200:\n raise RequestException(f\"API status code {result.status_code} for URL: {url}\")\n\n # Remove HTML line breaks (which cause confusion in the XML parsing)\n t: str = re.sub(r\"\\s*(<br/>)+\\s*\", r\" \", result.text)\n\n x_tree = ET.fromstring(t)\n return x_tree","def read(self, return_string=False):\r\n # Get result data from debugger engine and verify length of response\r\n data = self.read_data()\r\n\r\n # Show debug output\r\n debug('[Response data] %s' % data)\r\n\r\n # Return data string\r\n if return_string:\r\n return data\r\n\r\n # Remove special character quoting\r\n data = self.unescape(data)\r\n\r\n # Replace invalid XML characters\r\n data = ILLEGAL_XML_RE.sub('?', data)\r\n\r\n # Create XML document object\r\n document = ET.fromstring(data)\r\n return document","def _parse_boxee_response( self, response ):\n from xml.dom import minidom\n\n self._status(\"Parsing response from Boxee:\\n\" + response)\n\n dom = minidom.parseString(response)\n\n for node in dom.getElementsByTagName('BDP1'):\n self.BOXEE_PORT = node.getAttribute('httpPort')","def _api_connection(self, operation, **html_params) -> ETree.ElementTree:\n if operation is not None and operation in NAMESILO_API_IMPLEMENTED_OPERATIONS:\n _api_call = {**html_params, **self._namesilo_api_params} # Join request parameter dicts.\n _api_url = str.join('/', [NAMESILO_COM_API, operation]) # Build URL with operation.\n # print('API connection:', __api_url, __api_call) # dev.\n _ret = _web_worker.get(_api_url, params=_api_call) # Send the API request.\n _ret.raise_for_status() # Builtin check for HTTP success.\n _ret = ETree.XML(_ret.text) # The final form of our return response.\n \"\"\"Response Validation\"\"\"\n try:\n success = _ret.find('.//reply/code').text\n except AttributeError:\n raise ValueError('Could not parse API response.')\n if success != '300':\n raise ValueError('API Operation failed with code {}.'.format(success))\n return _ret\n else:\n raise NotImplementedError('Invalid operation: {} is currently unsupported or undefined.'.format(operation))","def do_request(xml_location):\n request = open(xml_location,\"r\").read()\n webservice = httplib.HTTP(HOST,PORT)\n webservice.putrequest(\"POST\", API_URL)\n webservice.putheader(\"Host\", HOST)\n webservice.putheader(\"User-Agent\",\"Python post\")\n webservice.putheader(\"Content-type\", \"text/xml; charset=\\\"UTF-8\\\"\")\n webservice.putheader(\"Content-length\", \"%d\" % len(request))\n webservice.endheaders()\n webservice.send(request)\n statuscode, statusmessage, header = webservice.getreply()\n result = webservice.getfile().read()\n print statuscode, statusmessage, header\n print result","def do_POST(self):\n \n try:\n # get arguments\n data = self.rfile.read(int(self.headers[\"content-length\"]))\n # In previous versions of SimpleXMLRPCServer, _dispatch\n # could be overridden in this class, instead of in\n # SimpleXMLRPCDispatcher. To maintain backwards compatibility,\n # check to see if a subclass implements _dispatch and dispatch\n # using that method if present.\n response = self.server._marshaled_dispatch(\n data, getattr(self, '_dispatch', None)\n )\n except: # This should only happen if the module is buggy\n # internal error, report as HTTP server error\n self.send_response(500)\n self.end_headers()\n else:\n # got a valid XML RPC response\n self.send_response(200)\n self.send_header(\"Content-type\", \"text/xml\")\n self.send_header(\"Content-length\", str(len(response)))\n self.end_headers()\n self.wfile.write(response)\n \n # shut down the connection\n self.wfile.flush()\n \n #modified as of http://docs.python.org/library/ssl.html\n self.connection.shutdown(socket.SHUT_RDWR)\n self.connection.close()","def main():\n test_network_connection()\n parser()","def parse(self, response):\n\n content_url_list = response.xpath(\n '//*[@height=\"22\"]/font/a/@href').extract()\n yield Request(url='http://www.pbc.gov.cn' + content_url_list[randint(0, 14)], headers=self.headers, callback=self.parse_data, method='POST')","def parsexml(self):\n raise NotImplementedError","def __call_api(self, values):\n # Add auth key to the request dictionary if not supplie\n if 'auth' not in values:\n values['auth'] = self.auth_data['auth']\n\n # Encode the data for a GET request\n data = urllib.parse.urlencode(values)\n\n #print values\n\n # Try to make the request\n xml_string = urllib.request.urlopen(self.xml_rpc + '?' + data).read()\n\n # Parse the XML\n response_data = xmltodict(self.__sanitize(xml_string))\n\n # Ensure that there was XML to parse\n if not response_data:\n return None\n\n # Grab the root element\n response_data = response_data['root'][0]['child']\n\n return response_data","def run(self):\n \n while globalvars.ALIVE:\n self.server.handle_request()\n print \"End of Xml connection...\"","def main_response(self, data):","def main_response(self, data):","def get_response(self, response, pack):\n\n pass","def get_usercp_xml(self,):\n response = self.session.get('https://ngb.to/usercp.php?type=xml')\n return response.text","def _xml_command(self, request):\n response = self._send(request)\n self._check_response(response)\n return response","def parse(self, xml_text):\n xml_doc = parse_doc(xml_text)\n data = findtext(xml_doc, \"Data\")\n if data is None:\n return\n\n cryptutil = CryptUtil(conf.get_openssl_cmd())\n p7m_file = os.path.join(conf.get_lib_dir(), P7M_FILE_NAME)\n p7m = (\"MIME-Version:1.0\\n\"\n \"Content-Disposition: attachment; filename=\\\"{0}\\\"\\n\"\n \"Content-Type: application/x-pkcs7-mime; name=\\\"{1}\\\"\\n\"\n \"Content-Transfer-Encoding: base64\\n\"\n \"\\n\"\n \"{2}\").format(p7m_file, p7m_file, data)\n\n self.client.save_cache(p7m_file, p7m)\n\n trans_prv_file = os.path.join(conf.get_lib_dir(),\n TRANSPORT_PRV_FILE_NAME)\n trans_cert_file = os.path.join(conf.get_lib_dir(),\n TRANSPORT_CERT_FILE_NAME)\n pem_file = os.path.join(conf.get_lib_dir(), PEM_FILE_NAME)\n # decrypt certificates\n cryptutil.decrypt_p7m(p7m_file, trans_prv_file, trans_cert_file,\n pem_file)\n\n # The parsing process use public key to match prv and crt.\n buf = []\n begin_crt = False\n begin_prv = False\n prvs = {}\n thumbprints = {}\n index = 0\n v1_cert_list = []\n with open(pem_file) as pem:\n for line in pem.readlines():\n buf.append(line)\n if re.match(r'[-]+BEGIN.*KEY[-]+', line):\n begin_prv = True\n elif re.match(r'[-]+BEGIN.*CERTIFICATE[-]+', line):\n begin_crt = True\n elif re.match(r'[-]+END.*KEY[-]+', line):\n tmp_file = self.write_to_tmp_file(index, 'prv', buf)\n pub = cryptutil.get_pubkey_from_prv(tmp_file)\n prvs[pub] = tmp_file\n buf = []\n index += 1\n begin_prv = False\n elif re.match(r'[-]+END.*CERTIFICATE[-]+', line):\n tmp_file = self.write_to_tmp_file(index, 'crt', buf)\n pub = cryptutil.get_pubkey_from_crt(tmp_file)\n thumbprint = cryptutil.get_thumbprint_from_crt(tmp_file)\n thumbprints[pub] = thumbprint\n # Rename crt with thumbprint as the file name\n crt = \"{0}.crt\".format(thumbprint)\n v1_cert_list.append({\n \"name\": None,\n \"thumbprint\": thumbprint\n })\n os.rename(tmp_file, os.path.join(conf.get_lib_dir(), crt))\n buf = []\n index += 1\n begin_crt = False\n\n # Rename prv key with thumbprint as the file name\n for pubkey in prvs:\n thumbprint = thumbprints[pubkey]\n if thumbprint:\n tmp_file = prvs[pubkey]\n prv = \"{0}.prv\".format(thumbprint)\n os.rename(tmp_file, os.path.join(conf.get_lib_dir(), prv))\n\n for v1_cert in v1_cert_list:\n cert = Cert()\n set_properties(\"certs\", cert, v1_cert)\n self.cert_list.certificates.append(cert)","def parse(self, response: BeautifulSoup):\n raise NotImplementedError","def Response(self, REQUEST = None):\n stream = REQUEST.stdin\n stream.seek(0)\n response_xml = stream.read()\n self.LOG('INFO', response_xml)\n return","def _process_response(self, response, marker_elems=None):\r\n body = response.read()\r\n #print body\r\n if '<Errors>' not in body:\r\n rs = ResultSet(marker_elems)\r\n h = handler.XmlHandler(rs, self)\r\n xml.sax.parseString(body, h)\r\n return rs\r\n else:\r\n raise MTurkRequestError(response.status, response.reason, body)","def do_POST(self):\n\n try:\n # get arguments\n data = self.rfile.read(int(self.headers[\"content-length\"]))\n # In previous versions of SimpleXMLRPCServer, _dispatch\n # could be overridden in this class, instead of in\n # SimpleXMLRPCDispatcher. To maintain backwards compatibility,\n # check to see if a subclass implements _dispatch and dispatch\n # using that method if present.\n response = self.server._marshaled_dispatch(\n data, getattr(self, '_dispatch', None)\n )\n except: # This should only happen if the module is buggy\n # internal error, report as HTTP server error\n self.send_response(500)\n self.end_headers()\n else:\n # got a valid XML RPC response\n self.send_response(200)\n self.send_header(\"Content-type\", \"text/xml\")\n self.send_header(\"Content-length\", str(len(response)))\n self.end_headers()\n self.wfile.write(response)\n\n # shut down the connection\n self.wfile.flush()\n self.connection.shutdown() # Modified here!","def Parse(self, ctx:Context, resp:Response)->Generator[Any,None,None]:\n yield Error(msg=\"Parse function not implemented\", code=Unimplemented)","def test_parse_response(self, m):\n dummy_response(m)\n c = Client(apikey='')\n c.send(utt=u'ぬるぽ', apiname='Dialogue')\n ret = c.apis['Dialogue'].parse(c.last_response)\n self.assertTrue(isinstance(ret, dict))","def _parse_xml(self, response):\n if response.startswith('\\n'):\n response = response[1:]\n tree = etree.fromstring(response)\n return tree","def _process_request(self, connection, request):\n conn = urllib2.Request(url=connection, data=request.encode(\"utf-8\"))\n f = urllib2.urlopen(conn)\n all_results = f.read()\n self.raw = all_results\n return(fromstring(all_results))","def fetchPlexApi(path='', method='GET', getFormPlextv=False, token=PLEX_TOKEN, params=None):\n headers = {'X-Plex-Token': token,\n 'Accept': 'application/json'}\n if getFormPlextv:\n url = 'plex.tv' \n connection = http.client.HTTPSConnection(url)\n else:\n url = PLEX_URL.rstrip('/').replace('http://','')\n connection = http.client.HTTPConnection(url)\n try:\n if method.upper() == 'GET':\n pass\n elif method.upper() == 'POST':\n headers.update({'Content-type': 'application/x-www-form-urlencoded'})\n pass\n elif method.upper() == 'PUT':\n pass\n elif method.upper() == 'DELETE':\n pass\n else:\n print(\"Invalid request method provided: {method}\".format(method=method))\n connection.close()\n return\n\n connection.request(method.upper(), path , params, headers) \n response = connection.getresponse() \n r = response.read() \n contentType = response.getheader('Content-Type') \n status = response.status \n connection.close()\n\n if response and len(r): \n if 'application/json' in contentType: \n return json.loads(r)\n elif 'application/xml' in contentType:\n return xmltodict.parse(r)\n else:\n return r\n else:\n return r\n\n except Exception as e:\n connection.close()\n print(\"Error fetching from Plex API: {err}\".format(err=e))","def parse(response):\n # print(response.text.encode('utf-8'))\n soup = BeautifulSoup(response.text, 'lxml')\n title = soup.find('title')\n answer = title.string\n return answer","def load_xml(pmid, sleep=None):\n link = \"https://eutils.ncbi.nlm.nih.gov/entrez/eutils/efetch.fcgi?db=pubmed&retmode=xml&id=%s\" % str(pmid) + \"&api_key=\" + API_KEY\n print(link)\n page = requests.get(link)\n tree = html.fromstring(page.content)\n if sleep is not None:\n time.sleep(sleep)\n return tree","def _create_https_connecetion(self,cr, uid, UPS_SERVER,Request_string,UPS_url=\"/ups.app/xml/XAV\", default_port=443, context={}):\n conn=httplib.HTTPSConnection(UPS_SERVER,default_port) #creating http connection\n\n if not conn:\n response_data='Connection failed'\n else:\n try:\n conn.request(\"POST\",UPS_url,Request_string) #requst being sent to ups\n response = conn.getresponse()\n except Exception:\n response_data='Connection failed'\n else:\n response_data = response.read()\n return response_data","def put_burp_to_trafficqueue(self):\n if os.path.exists(self.burp):\n import base64\n from xml.etree import cElementTree as ET\n from model import HttpRequest, HttpResponse\n with open(self.burp)as f:\n xmlstr = f.read()\n try:\n root = ET.fromstring(xmlstr)\n except cElementTree.ParseError as e:\n print('Parse burpsuite data error: '+str(e))\n exit(0)\n for child in root:\n if child.tag == 'item':\n req_headers = {}\n resp_headers = {}\n code = ''\n request, response = '', ''\n for child2 in child:\n if child2.tag == 'method':\n method = child2.text\n if child2.tag == 'url':\n url = child2.text\n # static url in burp\n if static_reg.search(url):\n break\n if child2.tag == 'status':\n code = child2.text\n if child2.tag == 'request':\n req_text = child2.text\n # base64 decode\n req_text = base64.b64decode(req_text)\n headers_list = req_text.split('\\r\\n\\r\\n', 1)[0].split('\\r\\n')[1:]\n for header in headers_list:\n try:\n header_key, header_value = header.split(': ')[0], header.split(': ')[1]\n if header_key not in list(req_headers.keys()):\n req_headers[header_key] = header_value\n # split header error\n except IndexError as e:\n print(e)\n body = req_text.split('\\r\\n\\r\\n', 1)[1]\n request = HttpRequest(method, url, req_headers, body)\n if child2.tag == 'response':\n resp_text = child2.text\n # if response is not None\n if resp_text:\n # base64 decode\n resp_text = base64.b64decode(resp_text)\n reason = resp_text.split('\\r\\n')[0]\n headers_list = resp_text.split('\\r\\n\\r\\n', 1)[0].split('\\r\\n')[1:]\n for header in headers_list:\n header_key, header_value = header.split(': ')[0], header.split(': ')[1]\n if header_key not in list(resp_headers.keys()):\n resp_headers[header_key] = header_value\n data = resp_text.split('\\r\\n\\r\\n', 1)[1]\n response = HttpResponse(code, reason, resp_headers, data)\n if request and response:\n if request.method == 'GET' and '?' in request.url:\n # filter static URL\n if not static_reg.search(url):\n burp_traffic.append((request, response))\n traffic_queue.put((request, response))\n elif request.method == 'POST' and request.body:\n content_type=request.get_header('Content-Type')\n # save multipart\n if content_type and 'multipart/form-data; boundary=' in content_type:\n MULTIPART.append((request, response))\n else:\n burp_traffic.append((request, response))\n traffic_queue.put((request, response))\n else:\n print('%s not exists!' % self.burp)","def getXML(self,url_base):\n\n version=\"1.1.1\"\n print \"Adress %s \" %(url_base[0])\n try :\n ## Read xml with urllib2\n url=url_base[0]+'?service=WMS&version='+version+'&request=GetCapabilities'\n request = urllib2.Request(url, headers={\"Accept\" : \"application/xml\"})\n u = urllib2.urlopen(request)\n u=urllib2.urlopen(url)\n value=u.read()\n tree= ET.fromstring( value )\n #print ET.dump(tree)\n dict_var={}\n cap = tree.findall('Capability')[0]\n layer1 = cap.findall('Layer')[0]\n layer2 = layer1.findall('Layer')[0]\n layers = layer2.findall('Layer')\n for l in layers:\n ## Find Variable name\n variable_name=l.find('Name').text\n print 'variable %s ' %(variable_name)\n ## Find are of product\n list_area=[]\n box=l.find('BoundingBox')\n lonmin=box.attrib['minx']\n list_area.append(lonmin)\n lonmax=box.attrib['maxx']\n list_area.append(lonmax)\n latmin=box.attrib['miny']\n list_area.append(latmin)\n latmax=box.attrib['maxy']\n list_area.append(latmax)\n ## Find time and prof\n dims=l.findall('Extent')\n list_prof=[]\n list_time=[]\n list_tot=[]\n for dim in dims : \n if dim.attrib['name'] == 'elevation' :\n list_prof=str(dim.text).split(',')\n if dim.attrib['name'] == 'time' :\n list_time=str(dim.text).split(',')\n if list_prof == [] : \n list_prof.append('0')\n list_tot.append(list_prof)\n list_tot.append(list_time)\n list_tot.append(list_area)\n dict_var[str(variable_name)]=list_tot\n except:\n raise\n print \"Error in WMS procedure\"\n sys.exit(1)\n return dict_var","def get_response(request):\n uri = \"api.php\"\n response_body = None\n url = proto + \"://\" + host + \"/\" + api_dir + \"/\" + uri\n logger.debug(\"Enter get_response(url=\" + url + \") with request:\")\n logger.debug(request)\n if proto == \"http\":\n conn = httplib.HTTPConnection(host)\n elif proto == \"https\":\n conn = httplib.HTTPSConnection(host)\n else:\n logger.error(\"Unsupported protocol \" + proto)\n return None\n http_response = \"\"\n try:\n conn.connect()\n logger.debug(\"Sending to \" + host + \":\")\n logger.debug(request)\n data_json = json.dumps(request)\n data_json_enc = data_json\n data_json_enc_urlenc = urllib.urlencode({'data': data_json_enc})\n conn.putrequest('POST', \"/\" + api_dir + \"/\" + uri)\n headers = {'Content-Length': \"%d\" % (len(data_json_enc_urlenc)),\n 'Content-Type': 'application/x-www-form-urlencoded'}\n for k in headers:\n conn.putheader(k, headers[k])\n conn.endheaders()\n conn.send(data_json_enc_urlenc)\n http_response = conn.getresponse()\n if http_response.status == 200:\n response_body = http_response.read()\n logger.debug(\"Response from server: %s\" % response_body)\n if not response_body:\n return None\n url = \"%(proto)s://%(host)s/%(api_dir)s/%(uri)s\" % {\n \"proto\": proto,\n \"host\": host,\n \"api_dir\": api_dir,\n \"uri\": uri\n }\n logger.debug(\"Response from %(url)s : %(resp)s\" % {\n \"url\": url,\n \"resp\": response_body\n })\n else:\n logger.error(\"HTTP error %d %s\" % (http_response.status, http_response.reason))\n except socket.error as err:\n logger.error(\"Exception while making request \" + url)\n logger.error(err)\n logger.error(\"Please check that DNS server is reachable and works\")\n return None\n except exceptions.KeyError as err:\n logger.error(\"Failed to decode response from server %s\" % http_response)\n logger.error(\"Could not find key %s\" % err)\n return None\n finally:\n conn.close()\n return response_body","def call_api(self):\n #generate the final call string\n self.generate_call_string();\n #debug\n #print (self.call_url);\n \n #finally make api call\n try: \n #pass; \n self.return_articles= json.loads(urlopen(self.call_url).read());\n #print json.dumps(self.return_articles, indent=4, sort_keys=True)\n except :#elaborate on this later\n print(\"Exception,response did not go through:\");\n e = sys.exc_info()[0]\n print(e);\n raise;\n return;","def load_xml(pmid, sleep=None):\r\n link = \"https://eutils.ncbi.nlm.nih.gov/entrez/eutils/efetch.fcgi?db=pubmed&retmode=xml&id=%s\" % str(pmid) \r\n page = requests.get(link) \r\n tree = html.fromstring(page.content)\r\n if sleep is not None:\r\n time.sleep(sleep)\r\n return tree","def do_POST(self):\n self.send_response(200)\n self.send_header('Content-type','text/html')\n self.send_header('Access-Control-Allow-Origin','*')\n self.end_headers()\n # Send the html message\n self.wfile.write(\"Aivis Panovs, 161REB125\")\n return","def parse(self):","def xml(self, request):\n raise Exception(\"Not Implemented\")","def _handle_response(response: str) -> Result:\n logger.debug('SoapService - _handle_response(response: {})'.format(response))\n result = Result()\n parsed_response = xmltodict.parse(response)['xmlreply']\n response_result = parsed_response['messages']['result']\n\n if response_result == 'OK':\n refno = parsed_response['apmdata']['prospect']['p.cm']['refno']\n result.data = {'Refno': refno}\n result.status = True\n elif response_result == 'Error':\n errors = parsed_response['messages']['error'] if 'error' in parsed_response['messages'] else None # type: list\n result.status = False\n\n return result","def process_AResponse(self) :\n while (1):\n str = self.recv(self.sock)\n if (len(str) > 0):\n response = amazon_pb2.AResponses()\n response.ParseFromString(str)\n print(response)\n # handle import new stock\n for arrive in response.arrived:\n things = arrive.things\n for thing in things:\n products = Whstock.objects.filter(pid = thing.id)\n if len(products) != 0:\n products[0].count = products[0].count + thing.count\n products[0].save()\n else :\n #need to specify world id\n whstock = Whstock()\n whstock.hid = arrive.whnum\n whstock.pid = thing.id\n whstock.dsc = thing.description\n whstock.count = thing.count\n whstock.save()\n # handle pack ready response\n #when ready send AU command to let UPS truck pickup,\n #use another thread for wait for UPS response\n #when receive response send ALoad command\n #when reveived loaded for Sim send AU command and let flag = 1;\n # tell UPS packages is ready and ask for trucks (provide destinaiton address)\n # tell warehouse to load when UPS trucks ready\n for currReady in response.ready:\n #save current state\n trans = Transaction.objects.get(ship_id = currReady)\n trans.ready = True\n trans.save()\n #connect to UPS\n ups_handler = threading.Thread(target=self.process_Uresponse, args=(trans,))\n ups_handler.start()\n self.AUCommand(trans, 0)\n print(\"first msg for UPS sent(to pickup)\")\n ups_handler.join()\n\n #load info from sim\n for load in response.loaded:\n #save current state\n trans = Transaction.objects.get(ship_id = load)\n trans.loaded = True\n trans.save()\n #connect to UPS\n self.AUCommand(trans, 1)\n print(\"second msg for UPS sent(get load success from sim world)\")","def get(self):\n xml = self._robot.GetCapabilitiesXml()\n self.response.headers['Content-Type'] = 'text/xml'\n self.response.out.write(xml)","def xmlrpc_response(data):\n xml = xmlrpc_marshal(data)\n response = webob.Response(xml)\n response.content_type = 'text/xml'\n response.content_length = len(xml)\n return response","def _parse_response(self, xmlstr, response_cls, service, binding,\n outstanding_certs=None, **kwargs):\n\n response = None\n\n if self.config.accepted_time_diff:\n kwargs[\"timeslack\"] = self.config.accepted_time_diff\n\n if \"asynchop\" not in kwargs:\n if binding in [BINDING_SOAP, BINDING_PAOS]:\n kwargs[\"asynchop\"] = False\n else:\n kwargs[\"asynchop\"] = True\n\n if xmlstr:\n if \"return_addrs\" not in kwargs:\n if binding in [BINDING_HTTP_REDIRECT, BINDING_HTTP_POST]:\n try:\n # expected return address\n kwargs[\"return_addrs\"] = self.config.endpoint(\n service, binding=binding)\n except Exception:\n logger.info(\"Not supposed to handle this!\")\n return None\n\n try:\n response = response_cls(self.sec, **kwargs)\n except Exception, exc:\n logger.info(\"%s\" % exc)\n raise\n\n xmlstr = self.unravel(xmlstr, binding, response_cls.msgtype)\n origxml = xmlstr\n if not xmlstr: # Not a valid reponse\n return None\n\n try:\n response = response.loads(xmlstr, False, origxml=origxml)\n except SigverError, err:\n logger.error(\"Signature Error: %s\" % err)\n raise\n except UnsolicitedResponse:\n logger.error(\"Unsolicited response\")\n raise\n except Exception, err:\n if \"not well-formed\" in \"%s\" % err:\n logger.error(\"Not well-formed XML\")\n raise\n\n logger.debug(\"XMLSTR: %s\" % xmlstr)\n\n if response:\n if outstanding_certs:\n try:\n cert = outstanding_certs[response.in_response_to]\n except KeyError:\n key_file = \"\"\n else:\n _, key_file = make_temp(\"%s\" % cert[\"key\"],\n decode=False)\n else:\n key_file = \"\"\n response = response.verify(key_file)\n\n if not response:\n return None\n\n #logger.debug(response)\n\n return response","def response_handling(self) -> global___Snippet.SimpleResponseHandling:","def response_handling(self) -> global___Snippet.SimpleResponseHandling:","def parse_aunit_response(aunit_results_xml):\n\n xml_handler = AUnitResponseHandler()\n xml.sax.parseString(aunit_results_xml, xml_handler)\n\n return xml_handler","def parse_response(self, response: Any) -> Any:\n return response","def process_Uresponse(self, trans):\n while (1):\n str = self.recv(self.Usock)\n if (len(str) > 0):\n response = AU_pb2.UA()\n # try:\n print(str)\n response.ParseFromString(str)\n print(response)\n if (response != None):\n self.ALoad(trans.ship_id, response.truckid)\n trans.package_id = response.packageid\n trans.save()\n return\n # except:\n # print('error')","def response(self):\n soup = BeautifulStoneSoup(self.read())\n\n response = soup.find('response')\n if response is None:\n raise InvalidResponseError('No <response> container found.')\n\n contents = {}\n for key in ['code', 'msg', 'value', 'category', 'action', 'cltrid',\n 'svtrid', 'chksum']:\n value = response.find(key)\n if value is None:\n raise InvalidResponseError(\n 'No {} found in response.'.format(key)\n )\n contents[key] = value.string.strip()\n\n if contents['code'] in ONLINENIC_ERRORS:\n raise ONLINENIC_ERRORS[contents['code']](\n '{} [{}]'.format(contents['msg'], contents['value'])\n )\n\n resdata = response.find('resdata')\n if resdata is not None:\n contents['data'] = {}\n for d in resdata.contents:\n if d is not None and d.string.strip():\n key = d.get('name')\n val = d.string.strip()\n if key in contents['data'].keys():\n if not isinstance(contents['data'][key], list):\n existing_val = contents['data'][key]\n contents['data'][key] = []\n contents['data'][key].append(existing_val)\n contents['data'][key].append(val)\n else:\n contents['data'][key] = val\n\n return contents","def request(self, host, handler, request_body, verbose=0):\n self.verbose = verbose\n\n headers = {'Content-type': 'text/xml'}\n data = request_body\n req = urllib2.Request('http://' + host + handler, data, headers)\n\n response = self.opener.open(req)\n\n return self.parse_response(response)","def scrape(self):\n try:\n self.result = urlfetch.fetch(self.url)\n except DownloadError:\n self.result = urlfetch.fetch(self.url) \n if ((self.result.status_code == 200) and\n (self.result.content_was_truncated == 0)):\n self.soup = BeautifulSoup(self.result.content)\n else:\n logging.critical(\"Bad Status Code: \", self.result.status_code, self.url)\n sys.exit(1)","def output_xml(data,code,headers=None):\r\n resp = make_response(dumps({'response': data}), code)\r\n resp.headers.extend(headers or {})\r\n return resp","def _parse_response(self, response):\n if response is not None:\n return response.string\n return response","def parse_cp_xml_output(data):\n import copy\n\n dom = parseString(data)\n\n parsed_data = {}\n\n #CARD HEADER\n parsed_data = copy.deepcopy(xml_card_header(parsed_data, dom))\n\n # CARD CONTROL\n\n cardname = 'CONTROL'\n target_tags = read_xml_card(dom, cardname)\n\n tagname = 'PP_CHECK_FLAG'\n parsed_data[tagname.lower()] = parse_xml_child_bool(tagname, target_tags)\n\n # CARD STATUS\n\n cardname = 'STATUS'\n target_tags = read_xml_card(dom, cardname)\n\n tagname = 'STEP'\n attrname = 'ITERATION'\n parsed_data[(tagname + '_' + attrname).lower()] = int(parse_xml_child_attribute_str(tagname, attrname, target_tags))\n\n tagname = 'TIME'\n attrname = 'UNITS'\n value = parse_xml_child_float(tagname, target_tags)\n\n units = parse_xml_child_attribute_str(tagname, attrname, target_tags)\n if units not in ['pico-seconds']:\n raise QEOutputParsingError(f'Units {units} are not supported by parser')\n parsed_data[tagname.lower()] = value\n\n tagname = 'TITLE'\n parsed_data[tagname.lower()] = parse_xml_child_str(tagname, target_tags)\n\n # CARD CELL\n parsed_data, lattice_vectors, volume = copy.deepcopy(xml_card_cell(parsed_data, dom))\n\n # CARD IONS\n parsed_data = copy.deepcopy(xml_card_ions(parsed_data, dom, lattice_vectors, volume))\n\n # CARD PLANE WAVES\n\n parsed_data = copy.deepcopy(xml_card_planewaves(parsed_data, dom, 'cp'))\n\n # CARD SPIN\n parsed_data = copy.deepcopy(xml_card_spin(parsed_data, dom))\n\n # CARD EXCHANGE_CORRELATION\n parsed_data = copy.deepcopy(xml_card_exchangecorrelation(parsed_data, dom))\n\n # TODO CARD OCCUPATIONS\n\n # CARD BRILLOUIN ZONE\n # TODO: k points are saved for CP... Why?\n\n cardname = 'BRILLOUIN_ZONE'\n target_tags = read_xml_card(dom, cardname)\n\n tagname = 'NUMBER_OF_K-POINTS'\n parsed_data[tagname.replace('-', '_').lower()] = parse_xml_child_integer(tagname, target_tags)\n\n tagname = 'UNITS_FOR_K-POINTS'\n attrname = 'UNITS'\n metric = parse_xml_child_attribute_str(tagname, attrname, target_tags)\n if metric not in ['2 pi / a']:\n raise QEOutputParsingError(\n f'Error parsing attribute {attrname}, tag {tagname} inside {target_tags.tagName}, units unknown'\n )\n parsed_data[tagname.replace('-', '_').lower()] = metric\n\n # TODO: check what happens if one does not use the monkhorst pack in the code\n tagname = 'MONKHORST_PACK_GRID'\n try:\n a = target_tags.getElementsByTagName(tagname)[0]\n value = [int(a.getAttribute('nk' + str(i + 1))) for i in range(3)]\n parsed_data[tagname.replace('-', '_').lower()] = value\n except:\n raise QEOutputParsingError(f'Error parsing tag {tagname} inside {target_tags.tagName}.')\n\n tagname = 'MONKHORST_PACK_OFFSET'\n try:\n a = target_tags.getElementsByTagName(tagname)[0]\n value = [int(a.getAttribute('k' + str(i + 1))) for i in range(3)]\n parsed_data[tagname.replace('-', '_').lower()] = value\n except:\n raise QEOutputParsingError(f'Error parsing tag {tagname} inside {target_tags.tagName}.')\n\n try:\n kpoints = []\n for i in range(parsed_data['number_of_k_points']):\n tagname = 'K-POINT.' + str(i + 1)\n a = target_tags.getElementsByTagName(tagname)[0]\n b = a.getAttribute('XYZ').replace('\\n', '').rsplit()\n value = [float(s) for s in b]\n\n metric = parsed_data['units_for_k_points']\n if metric == '2 pi / a':\n value = [float(s) / parsed_data['lattice_parameter'] for s in value]\n\n weight = float(a.getAttribute('WEIGHT'))\n\n kpoints.append([value, weight])\n\n parsed_data['k_point'] = kpoints\n except:\n raise QEOutputParsingError(f'Error parsing tag K-POINT.# inside {target_tags.tagName}.')\n\n tagname = 'NORM-OF-Q'\n # TODO decide if save this parameter\n parsed_data[tagname.replace('-', '_').lower()] = parse_xml_child_float(tagname, target_tags)\n\n # CARD PARALLELISM\n # can be optional\n\n try:\n cardname = 'PARALLELISM'\n target_tags = read_xml_card(dom, cardname)\n\n tagname = 'GRANULARITY_OF_K-POINTS_DISTRIBUTION'\n parsed_data[tagname.lower().replace('-', '_')] = parse_xml_child_integer(tagname, target_tags)\n\n tagname = 'NUMBER_OF_PROCESSORS'\n parsed_data[tagname.lower().replace('-', '_')] = parse_xml_child_integer(tagname, target_tags)\n\n tagname = 'NUMBER_OF_PROCESSORS_PER_POOL'\n parsed_data[tagname.lower().replace('-', '_')] = parse_xml_child_integer(tagname, target_tags)\n\n tagname = 'NUMBER_OF_PROCESSORS_PER_IMAGE'\n parsed_data[tagname.lower().replace('-', '_')] = parse_xml_child_integer(tagname, target_tags)\n\n tagname = 'NUMBER_OF_PROCESSORS_PER_TASKGROUP'\n parsed_data[tagname.lower().replace('-', '_')] = parse_xml_child_integer(tagname, target_tags)\n\n tagname = 'NUMBER_OF_PROCESSORS_PER_POT'\n parsed_data[tagname.lower().replace('-', '_')] = parse_xml_child_integer(tagname, target_tags)\n\n tagname = 'NUMBER_OF_PROCESSORS_PER_BAND_GROUP'\n parsed_data[tagname.lower().replace('-', '_')] = parse_xml_child_integer(tagname, target_tags)\n\n tagname = 'NUMBER_OF_PROCESSORS_PER_DIAGONALIZATION'\n parsed_data[tagname.lower().replace('-', '_')] = parse_xml_child_integer(tagname, target_tags)\n except QEOutputParsingError:\n pass\n\n # CARD TIMESTEPS\n\n cardname = 'TIMESTEPS'\n target_tags = read_xml_card(dom, cardname)\n\n for tagname in ['STEP0', 'STEPM']:\n try:\n tag = target_tags.getElementsByTagName(tagname)[0]\n\n try:\n second_tagname = 'ACCUMULATORS'\n second_tag = tag.getElementsByTagName(second_tagname)[0]\n data = second_tag.childNodes[0].data.rstrip().split() # list of floats\n parsed_data[second_tagname.replace('-', '_').lower()] = [float(i) for i in data]\n except:\n pass\n\n second_tagname = 'IONS_POSITIONS'\n second_tag = tag.getElementsByTagName(second_tagname)[0]\n third_tagname = 'stau'\n third_tag = second_tag.getElementsByTagName(third_tagname)[0]\n list_data = third_tag.childNodes[0].data.rstrip().split()\n list_data = [float(i) for i in list_data]\n # convert to matrix\n val = []\n mat = []\n for i, data in enumerate(list_data):\n val.append(data)\n if (i + 1) % 3 == 0:\n mat.append(val)\n val = []\n parsed_data[(second_tagname + '_' + third_tagname).replace('-', '_').lower()] = mat\n third_tagname = 'svel'\n third_tag = second_tag.getElementsByTagName(third_tagname)[0]\n list_data = third_tag.childNodes[0].data.rstrip().split()\n list_data = [float(i) for i in list_data]\n # convert to matrix\n val = []\n mat = []\n for i, data in enumerate(list_data):\n val.append(data)\n if (i + 1) % 3 == 0:\n mat.append(val)\n val = []\n parsed_data[(second_tagname + '_' + third_tagname).replace('-', '_').lower()] = mat\n try:\n third_tagname = 'taui'\n third_tag = second_tag.getElementsByTagName(third_tagname)[0]\n list_data = third_tag.childNodes[0].data.rstrip().split()\n list_data = [float(i) for i in list_data]\n # convert to matrix\n val = []\n mat = []\n for i, data in enumerate(list_data):\n val.append(data)\n if (i + 1) % 3 == 0:\n mat.append(val)\n val = []\n parsed_data[(second_tagname + '_' + third_tagname).replace('-', '_').lower()] = mat\n except:\n pass\n\n try:\n third_tagname = 'cdmi'\n third_tag = second_tag.getElementsByTagName(third_tagname)[0]\n list_data = third_tag.childNodes[0].data.rstrip().split()\n parsed_data[(second_tagname + '_' + third_tagname).replace('-', '_').lower()\n ] = [float(i) for i in list_data]\n except:\n pass\n\n try:\n third_tagname = 'force'\n third_tag = second_tag.getElementsByTagName(third_tagname)[0]\n list_data = third_tag.childNodes[0].data.rstrip().split()\n list_data = [float(i) for i in list_data]\n # convert to matrix\n val = []\n mat = []\n for i, data in enumerate(list_data):\n val.append(data)\n if (i + 1) % 3 == 0:\n mat.append(val)\n val = []\n parsed_data[(second_tagname + '_' + third_tagname).replace('-', '_').lower()] = mat\n except:\n pass\n\n second_tagname = 'IONS_NOSE'\n second_tag = tag.getElementsByTagName(second_tagname)[0]\n third_tagname = 'nhpcl'\n third_tag = second_tag.getElementsByTagName(third_tagname)[0]\n parsed_data[(second_tagname + '_' + third_tagname).replace('-', '_').lower()\n ] = float(third_tag.childNodes[0].data)\n third_tagname = 'nhpdim'\n third_tag = second_tag.getElementsByTagName(third_tagname)[0]\n parsed_data[(second_tagname + '_' + third_tagname).replace('-', '_').lower()\n ] = float(third_tag.childNodes[0].data)\n third_tagname = 'xnhp'\n third_tag = second_tag.getElementsByTagName(third_tagname)[0]\n parsed_data[(second_tagname + '_' + third_tagname).replace('-', '_').lower()\n ] = float(third_tag.childNodes[0].data)\n try:\n third_tagname = 'vnhp'\n third_tag = second_tag.getElementsByTagName(third_tagname)[0]\n parsed_data[(second_tagname + '_' + third_tagname).replace('-', '_').lower()\n ] = float(third_tag.childNodes[0].data)\n except:\n pass\n\n try:\n second_tagname = 'ekincm'\n second_tag = tag.getElementsByTagName(second_tagname)[0]\n parsed_data[second_tagname.replace('-', '_').lower()] = float(second_tag.childNodes[0].data)\n except:\n pass\n\n second_tagname = 'ELECTRONS_NOSE'\n second_tag = tag.getElementsByTagName(second_tagname)[0]\n try:\n third_tagname = 'xnhe'\n third_tag = second_tag.getElementsByTagName(third_tagname)[0]\n parsed_data[(second_tagname + '_' + third_tagname).replace('-', '_').lower()\n ] = float(third_tag.childNodes[0].data)\n except:\n pass\n try:\n third_tagname = 'vnhe'\n third_tag = second_tag.getElementsByTagName(third_tagname)[0]\n parsed_data[(second_tagname + '_' + third_tagname).replace('-', '_').lower()\n ] = float(third_tag.childNodes[0].data)\n except:\n pass\n\n second_tagname = 'CELL_PARAMETERS'\n second_tag = tag.getElementsByTagName(second_tagname)[0]\n try:\n third_tagname = 'ht'\n third_tag = second_tag.getElementsByTagName(third_tagname)[0]\n list_data = third_tag.childNodes[0].data.rstrip().split()\n list_data = [float(i) for i in list_data]\n # convert to matrix\n val = []\n mat = []\n for i, data in enumerate(list_data):\n val.append(data)\n if (i + 1) % 3 == 0:\n mat.append(val)\n val = []\n parsed_data[(second_tagname + '_' + third_tagname).replace('-', '_').lower()] = mat\n except:\n pass\n try:\n third_tagname = 'htvel'\n third_tag = second_tag.getElementsByTagName(third_tagname)[0]\n list_data = third_tag.childNodes[0].data.rstrip().split()\n list_data = [float(i) for i in list_data]\n # convert to matrix\n val = []\n mat = []\n for i, data in enumerate(list_data):\n val.append(data)\n if (i + 1) % 3 == 0:\n mat.append(val)\n val = []\n parsed_data[(second_tagname + '_' + third_tagname).replace('-', '_').lower()] = mat\n except:\n pass\n try:\n third_tagname = 'gvel'\n third_tag = second_tag.getElementsByTagName(third_tagname)[0]\n list_data = third_tag.childNodes[0].data.rstrip().split()\n list_data = [float(i) for i in list_data]\n # convert to matrix\n val = []\n mat = []\n for i, data in enumerate(list_data):\n val.append(data)\n if (i + 1) % 3 == 0:\n mat.append(val)\n val = []\n parsed_data[(second_tagname + '_' + third_tagname).replace('-', '_').lower()] = mat\n except:\n pass\n\n second_tagname = 'CELL_NOSE'\n second_tag = tag.getElementsByTagName(second_tagname)[0]\n try:\n third_tagname = 'xnhh'\n third_tag = second_tag.getElementsByTagName(third_tagname)[0]\n list_data = third_tag.childNodes[0].data.rstrip().split()\n list_data = [float(i) for i in list_data]\n\n # convert to matrix\n val = []\n mat = []\n for i, data in enumerate(list_data):\n val.append(data)\n if (i + 1) % 3 == 0:\n mat.append(val)\n val = []\n parsed_data[(second_tagname + '_' + third_tagname).replace('-', '_').lower()] = mat\n except:\n pass\n try:\n third_tagname = 'vnhh'\n third_tag = second_tag.getElementsByTagName(third_tagname)[0]\n list_data = third_tag.childNodes[0].data.rstrip().split()\n list_data = [float(i) for i in list_data]\n # convert to matrix\n val = []\n mat = []\n for i, data in enumerate(list_data):\n val.append(data)\n if (i + 1) % 3 == 0:\n mat.append(val)\n val = []\n parsed_data[(second_tagname + '_' + third_tagname).replace('-', '_').lower()] = mat\n except:\n pass\n except Exception as e:\n raise QEOutputParsingError(f'Error parsing CARD {cardname}')\n\n # CARD BAND_STRUCTURE_INFO\n\n cardname = 'BAND_STRUCTURE_INFO'\n target_tags = read_xml_card(dom, cardname)\n\n tagname = 'NUMBER_OF_ATOMIC_WFC'\n parsed_data[tagname.lower().replace('-', '_')] = parse_xml_child_integer(tagname, target_tags)\n\n tagname = 'NUMBER_OF_ELECTRONS'\n parsed_data[tagname.lower().replace('-', '_')] = int(parse_xml_child_float(tagname, target_tags))\n\n tagname = 'NUMBER_OF_BANDS'\n parsed_data[tagname.lower().replace('-', '_')] = parse_xml_child_integer(tagname, target_tags)\n\n tagname = 'NUMBER_OF_SPIN_COMPONENTS'\n parsed_data[tagname.lower().replace('-', '_')] = parse_xml_child_integer(tagname, target_tags)\n\n # TODO\n # - EIGENVALUES (that actually just contains occupations)\n # Why should I be interested in that, if CP works for insulators only?\n # - EIGENVECTORS\n # - others TODO are written in the function\n\n return parsed_data","def load_website(self):\n# r = urllib.request.urlopen(self.url).read()\n r = requests.get(self.url).content \n self.soup = bs(r, \"lxml\")","def get_content_from_ulr(self):\n response = urllib.request.urlopen(self.url)\n if response.getcode() != 200:\n self.logger.info(\"Cisco - get_content_from_url()\")\n raise ConnectionError('Unable to load ', self.url)\n content = response.read()\n response.close()\n return content","def parse_response(conn): \n\t\n\t# HEAD\n\thead = read2CRLF(conn)\n\t\n\tif debug == 0: print(\"STATUS LINE: \", head )\n\t\n\t# Tokens in the status line are separated by spaces\n\t# status_line = http-version <SP> status_code <SP> Reason\n\tstatus_line = head.decode().split(' ')\n\t\n\t# Parse the status line\n\tif len(status_line) < 3:\n\t\traise Exception(\"Malformed Response Packet\")\n\t\t\n\tif status_line[0] != HTTPConstants.VERSION:\n\t\traise Exception(\"Malformed Response Packet\")\n\t\n\t# CRLF separation between HEAD and BODY\n\texpectCRLF(conn)\n\t\n\t# BODY\n\tdata = read2CRLF(conn)\n\t\n\tresponse = [ status_line[1], status_line[2] ]\n\t\n\t# return the data in the body\n\treturn response, data","def parse(self, content):\n pass","def test():\n r = Response(response=\"This worked!\", status=200,\n mimetype=\"application/xml\")\n r.headers[\"Content-Type\"] = \"text/xml; charset=utf-8\"\n return r","def run(self):\n #use subprocess for your bindings when develop a new functionality\n fulldate = datetime.now().strftime(\"%A, %d. %B %Y %I:%M%p\")\n\n hours = datetime.now().strftime(\"%I\")\n minutes = datetime.now().strftime(\"%I\")\n\n if self.req_from == 'jabber':\n response = {'request': self.request\n ,'text' : fulldate\n ,'jmsg' : fulldate\n ,'continue' : 0\n ,'type':'response' }\n\n if self.req_from == 'julius':\n response = {'request': self.request\n ,'say': \"IT'S, %d O'CLOCK AND %d MINUTES\" % ( int(hours), int(minutes))\n ,'text' : fulldate\n ,'continue' : 0\n ,'type' : 'response' }\n\n return response\n #import subprocess\n #s = subprocess.Popen(['ffmpeg', '-i', speech, flac ] , stderr=subprocess.STDOUT, stdout=subprocess.PIPE).communicate()[0]","def _post_request_parser(self, tagname):\n\n wpsrequest = self\n\n def parse_post_getcapabilities(doc):\n \"\"\"Parse POST GetCapabilities request\n \"\"\"\n acceptedversions = xpath_ns(\n doc, '/wps:GetCapabilities/ows:AcceptVersions/ows:Version')\n acceptedversions = ','.join(\n map(lambda v: v.text, acceptedversions))\n wpsrequest.check_accepted_versions(acceptedversions)\n\n def parse_post_describeprocess(doc):\n \"\"\"Parse POST DescribeProcess request\n \"\"\"\n\n version = doc.attrib.get('version')\n wpsrequest.check_and_set_version(version)\n\n language = doc.attrib.get('language')\n wpsrequest.check_and_set_language(language)\n\n wpsrequest.operation = 'describeprocess'\n wpsrequest.identifiers = [identifier_el.text for identifier_el in\n xpath_ns(doc, './ows:Identifier')]\n\n def parse_post_execute(doc):\n \"\"\"Parse POST Execute request\n \"\"\"\n\n version = doc.attrib.get('version')\n wpsrequest.check_and_set_version(version)\n\n language = doc.attrib.get('language')\n wpsrequest.check_and_set_language(language)\n\n wpsrequest.operation = 'execute'\n\n identifier = xpath_ns(doc, './ows:Identifier')\n\n if not identifier:\n raise MissingParameterValue(\n 'Process identifier not set', 'Identifier')\n\n wpsrequest.identifier = identifier[0].text\n wpsrequest.lineage = 'false'\n wpsrequest.store_execute = 'false'\n wpsrequest.status = 'false'\n wpsrequest.inputs = get_inputs_from_xml(doc)\n wpsrequest.outputs = get_output_from_xml(doc)\n wpsrequest.raw = False\n if xpath_ns(doc, '/wps:Execute/wps:ResponseForm/wps:RawDataOutput'):\n wpsrequest.raw = True\n # executeResponse XML will not be stored\n wpsrequest.store_execute = 'false'\n\n # check if response document tag has been set then retrieve\n response_document = xpath_ns(\n doc, './wps:ResponseForm/wps:ResponseDocument')\n if len(response_document) > 0:\n wpsrequest.lineage = response_document[\n 0].attrib.get('lineage', 'false')\n wpsrequest.store_execute = response_document[\n 0].attrib.get('storeExecuteResponse', 'false')\n wpsrequest.status = response_document[\n 0].attrib.get('status', 'false')\n\n if tagname == WPS.GetCapabilities().tag:\n self.operation = 'getcapabilities'\n return parse_post_getcapabilities\n elif tagname == WPS.DescribeProcess().tag:\n self.operation = 'describeprocess'\n return parse_post_describeprocess\n elif tagname == WPS.Execute().tag:\n self.operation = 'execute'\n return parse_post_execute\n else:\n raise InvalidParameterValue(\n 'Unknown request %r' % tagname, 'request')","def getArbitraryManHTMLOutput(self, version, prefix=\"\"):\n # Try to normalize the XML a little bit.\n return dom.parseString(\"\"\"\\\n<?xml version=\"1.0\" ?><html>\n <head><title>Yo:MANHOLE.1</title></head>\n <body>\n <div class=\"content\">\n\n<span/>\n\n<h2>NAME<a name=\"auto0\"/></h2>\n\n<p>manhole - Connect to a Twisted Manhole service\n</p>\n\n<h2>SYNOPSIS<a name=\"auto1\"/></h2>\n\n<p><strong>manhole</strong> </p>\n\n<h2>DESCRIPTION<a name=\"auto2\"/></h2>\n\n<p>manhole is a GTK interface to Twisted Manhole services. You can execute python\ncode as if at an interactive Python console inside a running Twisted process\nwith this.</p>\n\n</div>\n <a href=\"%(prefix)sindex.html\">Index</a>\n <span class=\"version\">Version: %(version)s</span>\n </body>\n </html>\"\"\" % {\n 'prefix': prefix, 'version': version}).toxml(\"utf-8\")","def __call__(self):\n params, method = parse_xmlrpc_request(self.request)\n return xmlrpc_response(getattr(self,method)(*params))","def _fetch(self, output_type='xml'):\n\n # authenticate\n self._auth()\n\n # get the table\n response = self._do('GET', self.URLS['adp'])\n\n # load results\n self._results = self._parse_doc(response.text)","def make_request_txt(self):\n #print (self.url)\n try:\n with closing(get(self.url, stream=True)) as resp: #returns b`txt`\n if self.is_txt(resp):\n return resp.content.decode(\"utf-8\")\n else:\n return None\n except RequestException as e:\n print('Error during requests to {0} : {1}'.format(url, str(e)))\n return None","def run(self):\r\n print \"*Ping* We've got a message!\"\r\n # Handle DNS request\r\n resolver = Resolver(self.caching, self.ttl)\r\n aliasRecords = []\r\n addressRecords = []\r\n # Read and resolve the questions one-by-one\r\n questions = self.request.questions\r\n for question in questions:\r\n hostname = question.qname\r\n (hostname, aliases, addresses) = resolver.gethostbyname(hostname)\r\n \r\n for alias in aliases:\r\n aliasData = dns.resource.RecordData.create(Type.CNAME, alias)\r\n aliasRecord = dns.resource.ResourceRecord(hostname, Type.CNAME, Class.IN, 9001, aliasData) # TODO fix ttl\r\n aliasRecords.append(aliasRecord)\r\n for address in addresses:\r\n addressData = dns.resource.RecordData.create(Type.A, address)\r\n addressRecord = dns.resource.ResourceRecord(hostname, Type.A, Class.IN, 9001, addressData)\r\n addressRecords.append(addressRecord)\r\n \r\n # Crafting of the response\r\n respHeader = self.request.header\r\n respHeader.qr = 1\r\n respHeader.qd_count = 0\r\n respHeader.an_count = 1\r\n \r\n respMessage = dns.message.Message(respHeader, [], addressRecords + aliasRecords, [], [])\r\n sock = socket.socket(socket.AF_INET, socket.SOCK_DGRAM)\r\n respMessageByte = respMessage.to_bytes()\r\n sock.sendto(respMessageByte, self.clientAddr)\r\n print \"Ended request: \" + hostname\r\n sock.close()","def post(self):\n xml_raw = self.request.get('xml_input').encode('utf-8')\n root = ET.fromstring(xml_raw)\n\n items = root.findall(\"./\")\n\n for item in items:\n self.insert_item(item)\n\n self.response.out.write('')","def _parse(self):\n pass","def parse(self):\n \n r = requests.get(self.url)\n if r:\n self.title = fetch_title(self.url)\n self.domain = self.fetch_domain()\n self.favicon = self.fetch_favicon()\n self.topics = self.classify_topics()\n self.description = self.fetch_description()\n return self","def parse_data(self):\n\n msg = self.xml['dom'].childNodes[0]\n self.data = xml_to_dicts(msg, False)\n\n # Get some metadata together\n self.id = \"%s:%s\" % (self.data['src']['name']['#cdata'], self.data['src']['id']['#cdata'])\n self.temp = self.data['tmpr']['#cdata']\n self.watts = self.data['ch1']['watts']['#cdata']\n\n # Time - CurrentCost and local\n self.date = {}\n self.date['cc'] = [ int(self.data['date'][k]['#cdata']) for k in ('dsb','hr','min','sec') ]\n self.date['now'] = localtime()","def soap_GetSitesXml(self, ps):\n try:\n #this code is just for deploying on apache\n #httpReq = kw['request']\n rsp = WaterOneFlow.soap_GetSitesXml(self,ps)\n request = self.request\n #get input parameter, save it in a string list strSiteCodeList.\n siteCodeList = request.get_element_site()\n strSiteCodeList = map(str,siteCodeList.get_element_string())\n #construct/renew the siteInfo_site_dictionary.\n #currently, renew it every 14 days (subject to change)?\n if(len(siteInfo_site_dictionary.keys())==1 or \n datetime.now() >= siteInfo_site_dictionary[\"__modTime\"] + timedelta(days=14)):\n #here has a possible race condition, so a lock is placed\n semaphore = open('/home/txhis/CBIService/semaphore/semaphore.file', \"w\")\n lock(semaphore, LOCK_EX)\n treeIter = getIterator(centralRegUrl)\n #save the srs information in dictionary\n buildSiteInfo_siteDictionary(treeIter,siteInfo_site_dictionary)\n siteInfo_site_dictionary[\"__modTime\"]=datetime.now()\n #close semaphore, release the lock file. (otherwise deadlock will be possible)\n semaphore.close()\n # Generate XML String\n #big response node\n siteResponse = SiteInfoResponseType()\n #set queryInfo\n queryInfo = generateQueryInfo_string(request.get_element_site());\n siteResponse.set_queryInfo(queryInfo)\n #get the \"key\" part, ready to match in cached dictionary:\n def getKeyPart(str): \n tempstr = str.split(':')\n if tempstr[0] == 'CBI':return tempstr[1]\n #use map, get siteCode part of every string, saving a loop \n strSiteCodeList = map(getKeyPart,strSiteCodeList)\n #Eliminate the \"None\" element\n strSiteCodeList = [i for i in strSiteCodeList if i]\n #site List array (if multiple sites)\n siteList = []\n # read this logic:\n #if input is empty, return all the Sites as the response\n if (not siteCodeList.get_element_string() or (not siteCodeList.get_element_string()[0] \n and len(siteCodeList.get_element_string())==1)):\n for key in siteInfo_site_dictionary.keys():\n if key == \"__modTime\" or key == 'srs' : continue\n #site nodes\n siteNode = site()\n #siteCodeArray[1]][1][1] is an arbitrary xml node of a certain location\n siteInfoNode = generateSiteInfo_string(siteInfo_site_dictionary[key][1][0],siteInfo_site_dictionary['srs'])\n siteNode.set_siteInfo(siteInfoNode)\n siteList.append(siteNode)\n siteResponse.set_site(siteList) \n siteResponseString = cStringIO.StringIO() \n siteResponse.export(siteResponseString, 0, \\\n namespacedef_=' '.join(['xmlns:gml=\"http://www.opengis.net/gml\"',\n 'xmlns:xsi=\"http://www.w3.org/2001/XMLSchema-instance\"',\n 'xmlns:xlink=\"http://www.w3.org/1999/xlink\"',\n 'xmlns:wtr=\"http://www.cuahsi.org/waterML/\"',\n 'xmlns:xsd=\"http://www.w3.org/2001/XMLSchema\"',\n 'xmlns=\"http://www.cuahsi.org/waterML/1.0/\"'])) \n rsp.set_element_GetSitesXmlResult(siteResponseString.getvalue())\n except Exception, e:\n import traceback\n traceback.print_exc(file=sys.stdout)\n if isinstance(e,Fault):\n detail = None\n if e.detail is not None: \n detail = Detail()\n detail.any = e.detail \n rsp = FaultType(e.code, e.string, e.actor, detail)\n return rsp","def get_pmid_xml(api_key,idtype,searchid):\n headers = {'X-ELS-APIKey':api_key}\n url = \"http://api.elsevier.com/content/search/index:SCOPUS?query=\" + idtype + \"(\" + searchid + \")&field=doi\"\n #url = 'http://api.elsevier.com/content/abstract/scopus_id:' + str(pmid)\n print url\n web = requests.get(url, headers=headers)\n try:\n doi = web.json()['search-results']['entry'][0]['prism:doi']\n except: \n print web.json()\n doi = False\n \n try: \n scopus_abstract = web.json()['search-results']['entry'][0]['prism:url']\n web_scopus = requests.get(scopus_abstract, headers=headers)\n xml_text = web_scopus.text\n except: \n scopus_abstract = False\n xml_text = False\n\n output = {'doi':doi, 'scopus_abstract':scopus_abstract, 'xml_text':xml_text}\n return(output)","def parse(self):\n p = feedparser.parse(self.xml)\n self.p = p\n return p","def parse_snmp_response(response, type):\n values = []\n root = etree.fromstring(response)\n body = root.findall('{%s}Body'%'http://schemas.xmlsoap.org/soap/envelope/')\n for b in body:\n message = b.findall('{%s}message'%'http://ggf.org/ns/nmwg/base/2.0/')\n for m in message:\n data = m.findall('{%s}data'%'http://ggf.org/ns/nmwg/base/2.0/')\n for d in data:\n datum = d.findall('{%s}datum'%'http://ggf.org/ns/nmwg/base/2.0/')\n for d2 in datum:\n #to check this is not an error message\n if d2.text != '':\n if d2.attrib['value'] != '' and d2.attrib['value'] != None and d2.attrib['value'] != 'nan':\n v = {}\n v['timeValue'] = datetime.fromtimestamp(float(d2.attrib['timeValue']))\n v['value']=d2.attrib['value']\n if type!=\"lamp\":\n v['valueUnits'] = d2.attrib['valueUnits']\n values.append(v)\n\n return values","def _call(url, parser=None, params=None, auth=None, verify=True):\n headers = {\n 'User-Agent': 'rwrstats.com'\n }\n\n response = requests.get(\n url,\n params=params,\n auth=auth,\n headers=headers,\n verify=verify,\n timeout=5\n )\n\n response.raise_for_status()\n\n if parser == 'html':\n return html.fromstring(response.text)\n elif parser == 'xml':\n return etree.fromstring(response.text)","def _parse_response_body_from_xml_text(self, response, return_type):\n respbody = response.body\n\n doc = minidom.parseString(respbody)\n return_obj = return_type()\n for node in self._get_child_nodes(doc, return_type.__name__):\n self._fill_data_to_return_object(node, return_obj)\n\n # Note: We always explicitly assign status code to the custom return\n # type object\n return_obj.status = response.status\n\n return return_obj","def parse_response(self, response, case):\n request = response.request\n parsed = {\n 'request': {\n 'method': request.method,\n 'url': request.url,\n 'body': request.body,\n },\n 'response': {\n 'headers': OrderedDict(),\n 'status_code': response.status_code,\n 'reason': response.reason,\n }\n }\n\n # Re-assemble request line\n url_parts = urlparse(request.url)\n parsed['request']['request_line'] = '%s %s%s%s HTTP/1.1' % (\n request.method, url_parts.path, '?' if url_parts.query else '',\n url_parts.query)\n\n # Process request headers\n if self.mode == 'display':\n hostname = url_parts.hostname\n else:\n hostname = self.doc_hostname\n parsed['request']['headers'] = OrderedDict((('Host', hostname),))\n for header in sorted([h.title() for h in request.headers]):\n raw_value = request.headers[header]\n value = self.parse_header(header, raw_value, 'request')\n if value:\n parsed['request']['headers'][header.title()] = value\n\n # Re-assemble response line\n parsed['response']['response_line'] = 'HTTP/1.1 %s %s' % (\n response.status_code, response.reason)\n\n # Process response headers\n for header in sorted([h.title() for h in response.headers]):\n raw_value = response.headers[header]\n value = self.parse_header(header, raw_value, 'response')\n if value:\n fixed_header = header.title().replace('Www', 'WWW')\n parsed['response']['headers'][fixed_header] = value\n\n # Process response body\n response.encoding = 'utf-8'\n body = response.text\n if self.standardize:\n body = body.replace(api, self.doc_base_url)\n for key, value in case.get('standardize', {}).items():\n assert key in ('created', 'modified', 'date')\n pattern = r\"\"\"(?x)(?s) # Be verbose, . include newlines\n \"%s\":\\s\" # Key and quote\n \\d{4}-\\d{2}-\\d{2} # Date\n T\\d{2}:\\d{2}:\\d{2} # Time\n \\.\\d{0,6}Z # Microseconds and UTC timezone\n \", # End quote and comma\n \"\"\" % key\n replace = '\"%s\": \"%s\",' % (key, value)\n body = re.sub(pattern, replace, body)\n parsed['response']['body'] = body\n\n return parsed","def get_init_response():\n speechOutput = GET_INIT_MESSAGE \n\n return response(speech_response_ssml(speechOutput, False))","def __init__(self, res):\n self.fromResponseObj(res)","def __init__(self, res):\n self.fromResponseObj(res)","def do_external_request(self, cmd, extra_payload):\r\n xmlstr = etree.tostring(self.xml, pretty_print=True)\r\n payload = {\r\n 'xml': xmlstr,\r\n 'edX_cmd': cmd,\r\n 'edX_tests': self.tests,\r\n 'processor': self.code,\r\n }\r\n payload.update(extra_payload)\r\n\r\n try:\r\n # call external server. TODO: synchronous call, can block for a\r\n # long time\r\n req = requests.post(self.url, data=payload)\r\n except Exception as err:\r\n msg = 'Error {0} - cannot connect to external server url={1}'.format(err, self.url)\r\n log.error(msg)\r\n raise Exception(msg)\r\n\r\n if self.capa_system.DEBUG:\r\n log.info('response = %s', req.text)\r\n\r\n if (not req.text) or (not req.text.strip()):\r\n raise Exception(\r\n 'Error: no response from external server url=%s' % self.url)\r\n\r\n try:\r\n # response is XML; parse it\r\n rxml = etree.fromstring(req.text)\r\n except Exception as err:\r\n msg = 'Error {0} - cannot parse response from external server req.text={1}'.format(err, req.text)\r\n log.error(msg)\r\n raise Exception(msg)\r\n\r\n return rxml","def __connect_with_server(self,get_operatoin,server_reuest_type):\n\twhat_is_downloaded = server_reuest_type\n\tself.XML_String = None\n\tself.zip_string = None\n\ttry:\n\t conn = httplib.HTTPConnection(self.NAPISY24_url)\n\t conn.request(\"GET\", get_operatoin)\n\t r1 = conn.getresponse()\n\t print r1.status, r1.reason\n\t if what_is_downloaded == \"downloada_subtitle_list_by_film_name\" or what_is_downloaded == \"downloada_subtitle_list_by_IMDB\":\n\t\tself.XML_String = r1.read()\n\t elif what_is_downloaded == \"download_subtilte_zip\":\t\t\n\t\tself.zip_string = r1.read()\n\t return r1.status#, r1.reason\n\texcept (IOError, OSError), e:\n\t print >> sys.stderr, \"Napisy24.pl server connection error.\"\n\t time.sleep(0.5)","def _scrape_response(self, headers, response):\n # identify the responding server\n server_type = None\n server_string = headers.get(\"server\", \"\")\n\n if server_string and \"jetty\" in server_string.lower():\n server_type = \"jetty\"\n\n if server_string and \"coyote\" in server_string.lower():\n server_type = \"tomcat\"\n\n reason = None\n full_html = \"\"\n dom_tree = None\n\n # In Python3, response can be made of bytes\n if IS_PY3 and hasattr(response, \"decode\"):\n response = response.decode()\n if response.startswith(\"<?xml\"):\n # Try a strict XML parse\n try:\n soup = ElementTree.fromstring(response)\n\n reason_node = soup.find('lst[@name=\"error\"]/str[@name=\"msg\"]')\n tb_node = soup.find('lst[@name=\"error\"]/str[@name=\"trace\"]')\n if reason_node is not None:\n full_html = reason = reason_node.text.strip()\n if tb_node is not None:\n full_html = tb_node.text.strip()\n if reason is None:\n reason = full_html\n\n # Since we had a precise match, we'll return the results now:\n if reason and full_html:\n return reason, full_html\n except ElementTree.ParseError:\n # XML parsing error, so we'll let the more liberal code handle it.\n pass\n\n if server_type == \"tomcat\":\n # Tomcat doesn't produce a valid XML response or consistent HTML:\n m = re.search(r\"<(h1)[^>]*>\\s*(.+?)\\s*</\\1>\", response, re.IGNORECASE)\n if m:\n reason = m.group(2)\n else:\n full_html = \"%s\" % response\n else:\n # Let's assume others do produce a valid XML response\n try:\n dom_tree = ElementTree.fromstring(response)\n reason_node = None\n\n # html page might be different for every server\n if server_type == \"jetty\":\n reason_node = dom_tree.find(\"body/pre\")\n else:\n reason_node = dom_tree.find(\"head/title\")\n\n if reason_node is not None:\n reason = reason_node.text\n\n if reason is None:\n full_html = ElementTree.tostring(dom_tree)\n except SyntaxError as err:\n LOG.warning( # NOQA: G200\n \"Unable to extract error message from invalid XML: %s\",\n err,\n extra={\"data\": {\"response\": response}},\n )\n full_html = \"%s\" % response\n\n full_html = force_unicode(full_html)\n full_html = full_html.replace(\"\\n\", \"\")\n full_html = full_html.replace(\"\\r\", \"\")\n full_html = full_html.replace(\"<br/>\", \"\")\n full_html = full_html.replace(\"<br />\", \"\")\n full_html = full_html.strip()\n return reason, full_html","def _get_request_parser(self, operation):\n\n wpsrequest = self\n\n def parse_get_getcapabilities(http_request):\n \"\"\"Parse GET GetCapabilities request\n \"\"\"\n\n acceptedversions = _get_get_param(http_request, 'acceptversions')\n wpsrequest.check_accepted_versions(acceptedversions)\n\n def parse_get_describeprocess(http_request):\n \"\"\"Parse GET DescribeProcess request\n \"\"\"\n version = _get_get_param(http_request, 'version')\n wpsrequest.check_and_set_version(version)\n\n language = _get_get_param(http_request, 'language')\n wpsrequest.check_and_set_language(language)\n\n wpsrequest.identifiers = _get_get_param(\n http_request, 'identifier', aslist=True)\n\n def parse_get_execute(http_request):\n \"\"\"Parse GET Execute request\n \"\"\"\n version = _get_get_param(http_request, 'version')\n wpsrequest.check_and_set_version(version)\n\n language = _get_get_param(http_request, 'language')\n wpsrequest.check_and_set_language(language)\n\n wpsrequest.identifier = _get_get_param(http_request, 'identifier')\n wpsrequest.store_execute = _get_get_param(\n http_request, 'storeExecuteResponse', 'false')\n wpsrequest.status = _get_get_param(http_request, 'status', 'false')\n wpsrequest.lineage = _get_get_param(\n http_request, 'lineage', 'false')\n wpsrequest.inputs = get_data_from_kvp(\n _get_get_param(http_request, 'DataInputs'), 'DataInputs')\n wpsrequest.outputs = {}\n\n # take responseDocument preferably\n resp_outputs = get_data_from_kvp(\n _get_get_param(http_request, 'ResponseDocument'))\n raw_outputs = get_data_from_kvp(\n _get_get_param(http_request, 'RawDataOutput'))\n wpsrequest.raw = False\n if resp_outputs:\n wpsrequest.outputs = resp_outputs\n elif raw_outputs:\n wpsrequest.outputs = raw_outputs\n wpsrequest.raw = True\n # executeResponse XML will not be stored and no updating of\n # status\n wpsrequest.store_execute = 'false'\n wpsrequest.status = 'false'\n\n if not operation:\n raise MissingParameterValue('Missing request value', 'request')\n else:\n self.operation = operation.lower()\n\n if self.operation == 'getcapabilities':\n return parse_get_getcapabilities\n elif self.operation == 'describeprocess':\n return parse_get_describeprocess\n elif self.operation == 'execute':\n return parse_get_execute\n else:\n raise OperationNotSupported(\n 'Unknown request %r' % self.operation, operation)","def __parse_response(self, response_text):\n root = etree.fromstring(response_text)\n namespace = re.search('{(.*)}', root.tag).group(1)\n status_path = '{%s}Status' % namespace\n status = int(root.findtext(status_path))\n response = None\n if status != 0:\n response = Error(status, root, namespace)\n else:\n response = self._parse_response_body(root, namespace)\n return response","def parse(self, url):\n pass","def content_api_xml(url, request):\n headers = {'content-type': 'application/xml'}\n content = 'xml string'\n return response(status_code=200,\n content=content,\n headers=headers,\n request=request)","def main():\n\n handler = PlanetSourceHandler()\n\n parser = xml.sax.make_parser()\n parser.setFeature(xml.sax.handler.feature_namespaces, 1)\n parser.setContentHandler(handler)\n parser.parse(sys.stdin)\n\n print simplejson.JSONEncoder(indent=True).encode(handler.sources)","def __init__(self):\n \n # The length of a name request in bytes\n self.name_size = 32\n \n # The length of the checksum in bytes\n self.chksum_size = 0\n \n # The length of the write flag element in bytes\n self.wflag_size = 1\n \n # The length of the timestamp in bytes\n self.time_size = 4\n \n # The length of a length request in bytes\n self.length_size = 2\n \n # The leght of an ascii request in bytes\n self.ascii_size = 128\n \n # boolean to keep track of command updating\n self.no_commands = True\n \n # Default command list\n self.SCPI_Data = {}\n self.add_command('SUP:TEL? 0', '48', 'ascii')\n self.add_command('SUP:TEL? 1', '8', 'long long')\n self.add_command('SUP:TEL? 2', '8', 'long long')\n self.add_command('SUP:TEL? 3', '2', 'uint')\n self.add_command('SUP:TEL? 4', '22', 'long, long, int, int, int')\n self.add_command('SUP:TEL? 5', '8', 'long long')\n self.add_command('SUP:TEL? 6', '8', 'long long')\n self.add_command('SUP:TEL? 7', '8', 'long long')\n self.add_command('SUP:TEL? 8', '8', 'double')\n \n # Reset flag after initial updating\n self.no_commands = True\n \n # list of errors thrown during the importing of the XML file\n self.error_log = []","def getxml(self, pmcid):\n import requests\n r = requests.get(\n (self.xmlurl).format(pmcid=pmcid))\n return r.content","def process_monit_response(response):\n for regex, replacement in xml_hacks:\n response = re.sub(regex, replacement, response)\n \n if opts.debug:\n print \"=\"*80\n print \"| Monit response: \"\n print \"=\"*80\n print response\n tree = xml.etree.ElementTree.fromstring(response)\n for service in tree.findall('service'):\n process_service(service)\n for infokey in ['server/localhostname', 'server/version', \n 'platform/name', 'platform/machine', 'platform/release', 'platform/version']:\n infoval = tree.find(infokey)\n if infoval is not None: system_info.append('%s'%infoval.text)","async def text(self, encoding=\"utf-8\", errors=\"strict\"):\n return self.response.decode(encoding, errors=errors)","def load_xml(pmid, sleep=None):\n link = \"https://eutils.ncbi.nlm.nih.gov/entrez/eutils/efetch.fcgi?db=pubmed&retmode=xml&id=%s\" % str(pmid)\n page = requests.get(link)\n tree = html.fromstring(page.content)\n if sleep is not None:\n time.sleep(sleep)\n return tree","def run(self):\n import pxp # want to have fresh instance ???!\n ans = {}\n pu.mdbg.log(\"PXPWORKER started ------>cmd:{} cookie:{}\".format(self.cmd, self.cookie))\n if (self.cmd=='tagset'):\n ans = pxp.tagset(self.param)\n elif (self.cmd=='tagmod'): \n ans = pxp.tagmod(self.param)\n elif (self.cmd=='teleset'): \n ans = pxp.teleset(self.param)\n elif (self.cmd=='sumset'): \n ans = pxp.sumset(self.param)\n elif (self.cmd=='sumget'): \n ans = pxp.sumget(self.param)\n elif (self.cmd=='rec_stat'):\n self.rec_stat = {}\n self.rec_stat = self.pxp_rec_stat()\n self.done = True\n ans['cookie'] = self.cookie\n pu.mdbg.log(\"PXPHeler finished ------>cmd:{} param:{}\".format(self.cmd, self.param))\n return\n \n ans['cookie'] = self.cookie\n #resp = pu.disk.sockSendWait(\"AUP|\"+json.dumps(ans), addnewline=True, timeout=1)\n pu.disk.sockSendWait(\"AUP|\"+json.dumps(ans), addnewline=True)\n self.done = True\n pu.mdbg.log(\"PXPHeler finished ------>cmd:{} cookie:{}\".format(self.cmd, self.cookie))"],"string":"[\n \"def parse_response(self, resp):\\n p, u = self.getparser()\\n\\n if hasattr(resp, 'text'):\\n # modern requests will do this for us\\n text = resp.text # this is unicode(py2)/str(py3)\\n else:\\n\\n encoding = requests.utils.get_encoding_from_headers(resp.headers)\\n if encoding is None:\\n encoding = 'utf-8' # FIXME: what to do here?\\n\\n if sys.version_info[0] == 2:\\n text = unicode( # noqa: F821\\n resp.content, encoding, errors='replace')\\n else:\\n assert sys.version_info[0] == 3\\n text = str(resp.content, encoding, errors='replace')\\n p.feed(text)\\n p.close()\\n return u.close()\",\n \"def parse(self, response):\",\n \"def execute(self):\\n headers = {\\n 'Content-type': 'application/x-www-form-urlencoded',\\n 'Accept-Charset': 'utf-8',\\n 'User-Agent': USER_AGENT\\n }\\n request = urllib2.Request(self.url(), headers=headers)\\n response = urllib2.urlopen(request)\\n \\n return etree.parse(response)\",\n \"def make_request_xml(self):\\n #print (self.url)\\n try:\\n with closing(get(self.url, stream=True)) as resp: #returns b`xml`\\n if self.is_good_enough_xml(resp):\\n return resp.content\\n else:\\n return None\\n except RequestException as e:\\n print('Error during requests to {0} : {1}'.format(url, str(e)))\\n return None\",\n \"def setup_response(self):\\r\\n xml = self.xml\\r\\n # TODO: XML can override external resource (grader/queue) URL\\r\\n self.url = xml.get('url', None)\\r\\n\\r\\n # We do not support xqueue within Studio.\\r\\n if self.capa_system.xqueue is not None:\\r\\n default_queuename = self.capa_system.xqueue['default_queuename']\\r\\n else:\\r\\n default_queuename = None\\r\\n self.queue_name = xml.get('queuename', default_queuename)\\r\\n\\r\\n # VS[compat]:\\r\\n # Check if XML uses the ExternalResponse format or the generic\\r\\n # CodeResponse format\\r\\n codeparam = self.xml.find('codeparam')\\r\\n assert codeparam is not None, \\\"Unsupported old format! <coderesponse> without <codeparam>\\\"\\r\\n self._parse_coderesponse_xml(codeparam)\",\n \"def parse_response(self):\\n pass\",\n \"def __fetch_data(self, url):\\n try:\\n response = urlopen(url)\\n root = ET.fromstring(response.read())\\n except HTTPError as exc:\\n root = ET.fromstring(exc.read())\\n raise ValueError(root.get('message'))\\n return root\",\n \"def main(self):\\n question = Parser(self.question)\\n latitude = 0\\n longitude = 0\\n address = \\\"Bonjour, je vais bien merci !\\\"\\n history = self._get_papy_sentence()\\n article_title = \\\"\\\"\\n location = question.get_location()\\n google = GoogleApi(location, self.google_key)\\n google_response = google.parse()\\n if question.get_verification():\\n latitude = google_response['latitude']\\n longitude = google_response['longitude']\\n address = google_response['address']\\n if google_response['status'] == \\\"OK\\\":\\n wiki = WikiApi(google_response['latitude'],\\n google_response['longitude'])\\n wiki_response = wiki.parse()\\n if wiki_response['status'] == \\\"OK\\\":\\n history = wiki_response['history']\\n article_title = wiki_response['article_title']\\n\\n self.response_grandpy = {\\n 'latitude': latitude,\\n 'longitude': longitude,\\n 'address': address,\\n 'history': history,\\n 'article_title': article_title\\n }\\n return self.response_grandpy\",\n \"def _api_call(url: str) -> ET.Element:\\n result = requests.get(url)\\n if result.status_code != 200:\\n raise RequestException(f\\\"API status code {result.status_code} for URL: {url}\\\")\\n\\n # Remove HTML line breaks (which cause confusion in the XML parsing)\\n t: str = re.sub(r\\\"\\\\s*(<br/>)+\\\\s*\\\", r\\\" \\\", result.text)\\n\\n x_tree = ET.fromstring(t)\\n return x_tree\",\n \"def read(self, return_string=False):\\r\\n # Get result data from debugger engine and verify length of response\\r\\n data = self.read_data()\\r\\n\\r\\n # Show debug output\\r\\n debug('[Response data] %s' % data)\\r\\n\\r\\n # Return data string\\r\\n if return_string:\\r\\n return data\\r\\n\\r\\n # Remove special character quoting\\r\\n data = self.unescape(data)\\r\\n\\r\\n # Replace invalid XML characters\\r\\n data = ILLEGAL_XML_RE.sub('?', data)\\r\\n\\r\\n # Create XML document object\\r\\n document = ET.fromstring(data)\\r\\n return document\",\n \"def _parse_boxee_response( self, response ):\\n from xml.dom import minidom\\n\\n self._status(\\\"Parsing response from Boxee:\\\\n\\\" + response)\\n\\n dom = minidom.parseString(response)\\n\\n for node in dom.getElementsByTagName('BDP1'):\\n self.BOXEE_PORT = node.getAttribute('httpPort')\",\n \"def _api_connection(self, operation, **html_params) -> ETree.ElementTree:\\n if operation is not None and operation in NAMESILO_API_IMPLEMENTED_OPERATIONS:\\n _api_call = {**html_params, **self._namesilo_api_params} # Join request parameter dicts.\\n _api_url = str.join('/', [NAMESILO_COM_API, operation]) # Build URL with operation.\\n # print('API connection:', __api_url, __api_call) # dev.\\n _ret = _web_worker.get(_api_url, params=_api_call) # Send the API request.\\n _ret.raise_for_status() # Builtin check for HTTP success.\\n _ret = ETree.XML(_ret.text) # The final form of our return response.\\n \\\"\\\"\\\"Response Validation\\\"\\\"\\\"\\n try:\\n success = _ret.find('.//reply/code').text\\n except AttributeError:\\n raise ValueError('Could not parse API response.')\\n if success != '300':\\n raise ValueError('API Operation failed with code {}.'.format(success))\\n return _ret\\n else:\\n raise NotImplementedError('Invalid operation: {} is currently unsupported or undefined.'.format(operation))\",\n \"def do_request(xml_location):\\n request = open(xml_location,\\\"r\\\").read()\\n webservice = httplib.HTTP(HOST,PORT)\\n webservice.putrequest(\\\"POST\\\", API_URL)\\n webservice.putheader(\\\"Host\\\", HOST)\\n webservice.putheader(\\\"User-Agent\\\",\\\"Python post\\\")\\n webservice.putheader(\\\"Content-type\\\", \\\"text/xml; charset=\\\\\\\"UTF-8\\\\\\\"\\\")\\n webservice.putheader(\\\"Content-length\\\", \\\"%d\\\" % len(request))\\n webservice.endheaders()\\n webservice.send(request)\\n statuscode, statusmessage, header = webservice.getreply()\\n result = webservice.getfile().read()\\n print statuscode, statusmessage, header\\n print result\",\n \"def do_POST(self):\\n \\n try:\\n # get arguments\\n data = self.rfile.read(int(self.headers[\\\"content-length\\\"]))\\n # In previous versions of SimpleXMLRPCServer, _dispatch\\n # could be overridden in this class, instead of in\\n # SimpleXMLRPCDispatcher. To maintain backwards compatibility,\\n # check to see if a subclass implements _dispatch and dispatch\\n # using that method if present.\\n response = self.server._marshaled_dispatch(\\n data, getattr(self, '_dispatch', None)\\n )\\n except: # This should only happen if the module is buggy\\n # internal error, report as HTTP server error\\n self.send_response(500)\\n self.end_headers()\\n else:\\n # got a valid XML RPC response\\n self.send_response(200)\\n self.send_header(\\\"Content-type\\\", \\\"text/xml\\\")\\n self.send_header(\\\"Content-length\\\", str(len(response)))\\n self.end_headers()\\n self.wfile.write(response)\\n \\n # shut down the connection\\n self.wfile.flush()\\n \\n #modified as of http://docs.python.org/library/ssl.html\\n self.connection.shutdown(socket.SHUT_RDWR)\\n self.connection.close()\",\n \"def main():\\n test_network_connection()\\n parser()\",\n \"def parse(self, response):\\n\\n content_url_list = response.xpath(\\n '//*[@height=\\\"22\\\"]/font/a/@href').extract()\\n yield Request(url='http://www.pbc.gov.cn' + content_url_list[randint(0, 14)], headers=self.headers, callback=self.parse_data, method='POST')\",\n \"def parsexml(self):\\n raise NotImplementedError\",\n \"def __call_api(self, values):\\n # Add auth key to the request dictionary if not supplie\\n if 'auth' not in values:\\n values['auth'] = self.auth_data['auth']\\n\\n # Encode the data for a GET request\\n data = urllib.parse.urlencode(values)\\n\\n #print values\\n\\n # Try to make the request\\n xml_string = urllib.request.urlopen(self.xml_rpc + '?' + data).read()\\n\\n # Parse the XML\\n response_data = xmltodict(self.__sanitize(xml_string))\\n\\n # Ensure that there was XML to parse\\n if not response_data:\\n return None\\n\\n # Grab the root element\\n response_data = response_data['root'][0]['child']\\n\\n return response_data\",\n \"def run(self):\\n \\n while globalvars.ALIVE:\\n self.server.handle_request()\\n print \\\"End of Xml connection...\\\"\",\n \"def main_response(self, data):\",\n \"def main_response(self, data):\",\n \"def get_response(self, response, pack):\\n\\n pass\",\n \"def get_usercp_xml(self,):\\n response = self.session.get('https://ngb.to/usercp.php?type=xml')\\n return response.text\",\n \"def _xml_command(self, request):\\n response = self._send(request)\\n self._check_response(response)\\n return response\",\n \"def parse(self, xml_text):\\n xml_doc = parse_doc(xml_text)\\n data = findtext(xml_doc, \\\"Data\\\")\\n if data is None:\\n return\\n\\n cryptutil = CryptUtil(conf.get_openssl_cmd())\\n p7m_file = os.path.join(conf.get_lib_dir(), P7M_FILE_NAME)\\n p7m = (\\\"MIME-Version:1.0\\\\n\\\"\\n \\\"Content-Disposition: attachment; filename=\\\\\\\"{0}\\\\\\\"\\\\n\\\"\\n \\\"Content-Type: application/x-pkcs7-mime; name=\\\\\\\"{1}\\\\\\\"\\\\n\\\"\\n \\\"Content-Transfer-Encoding: base64\\\\n\\\"\\n \\\"\\\\n\\\"\\n \\\"{2}\\\").format(p7m_file, p7m_file, data)\\n\\n self.client.save_cache(p7m_file, p7m)\\n\\n trans_prv_file = os.path.join(conf.get_lib_dir(),\\n TRANSPORT_PRV_FILE_NAME)\\n trans_cert_file = os.path.join(conf.get_lib_dir(),\\n TRANSPORT_CERT_FILE_NAME)\\n pem_file = os.path.join(conf.get_lib_dir(), PEM_FILE_NAME)\\n # decrypt certificates\\n cryptutil.decrypt_p7m(p7m_file, trans_prv_file, trans_cert_file,\\n pem_file)\\n\\n # The parsing process use public key to match prv and crt.\\n buf = []\\n begin_crt = False\\n begin_prv = False\\n prvs = {}\\n thumbprints = {}\\n index = 0\\n v1_cert_list = []\\n with open(pem_file) as pem:\\n for line in pem.readlines():\\n buf.append(line)\\n if re.match(r'[-]+BEGIN.*KEY[-]+', line):\\n begin_prv = True\\n elif re.match(r'[-]+BEGIN.*CERTIFICATE[-]+', line):\\n begin_crt = True\\n elif re.match(r'[-]+END.*KEY[-]+', line):\\n tmp_file = self.write_to_tmp_file(index, 'prv', buf)\\n pub = cryptutil.get_pubkey_from_prv(tmp_file)\\n prvs[pub] = tmp_file\\n buf = []\\n index += 1\\n begin_prv = False\\n elif re.match(r'[-]+END.*CERTIFICATE[-]+', line):\\n tmp_file = self.write_to_tmp_file(index, 'crt', buf)\\n pub = cryptutil.get_pubkey_from_crt(tmp_file)\\n thumbprint = cryptutil.get_thumbprint_from_crt(tmp_file)\\n thumbprints[pub] = thumbprint\\n # Rename crt with thumbprint as the file name\\n crt = \\\"{0}.crt\\\".format(thumbprint)\\n v1_cert_list.append({\\n \\\"name\\\": None,\\n \\\"thumbprint\\\": thumbprint\\n })\\n os.rename(tmp_file, os.path.join(conf.get_lib_dir(), crt))\\n buf = []\\n index += 1\\n begin_crt = False\\n\\n # Rename prv key with thumbprint as the file name\\n for pubkey in prvs:\\n thumbprint = thumbprints[pubkey]\\n if thumbprint:\\n tmp_file = prvs[pubkey]\\n prv = \\\"{0}.prv\\\".format(thumbprint)\\n os.rename(tmp_file, os.path.join(conf.get_lib_dir(), prv))\\n\\n for v1_cert in v1_cert_list:\\n cert = Cert()\\n set_properties(\\\"certs\\\", cert, v1_cert)\\n self.cert_list.certificates.append(cert)\",\n \"def parse(self, response: BeautifulSoup):\\n raise NotImplementedError\",\n \"def Response(self, REQUEST = None):\\n stream = REQUEST.stdin\\n stream.seek(0)\\n response_xml = stream.read()\\n self.LOG('INFO', response_xml)\\n return\",\n \"def _process_response(self, response, marker_elems=None):\\r\\n body = response.read()\\r\\n #print body\\r\\n if '<Errors>' not in body:\\r\\n rs = ResultSet(marker_elems)\\r\\n h = handler.XmlHandler(rs, self)\\r\\n xml.sax.parseString(body, h)\\r\\n return rs\\r\\n else:\\r\\n raise MTurkRequestError(response.status, response.reason, body)\",\n \"def do_POST(self):\\n\\n try:\\n # get arguments\\n data = self.rfile.read(int(self.headers[\\\"content-length\\\"]))\\n # In previous versions of SimpleXMLRPCServer, _dispatch\\n # could be overridden in this class, instead of in\\n # SimpleXMLRPCDispatcher. To maintain backwards compatibility,\\n # check to see if a subclass implements _dispatch and dispatch\\n # using that method if present.\\n response = self.server._marshaled_dispatch(\\n data, getattr(self, '_dispatch', None)\\n )\\n except: # This should only happen if the module is buggy\\n # internal error, report as HTTP server error\\n self.send_response(500)\\n self.end_headers()\\n else:\\n # got a valid XML RPC response\\n self.send_response(200)\\n self.send_header(\\\"Content-type\\\", \\\"text/xml\\\")\\n self.send_header(\\\"Content-length\\\", str(len(response)))\\n self.end_headers()\\n self.wfile.write(response)\\n\\n # shut down the connection\\n self.wfile.flush()\\n self.connection.shutdown() # Modified here!\",\n \"def Parse(self, ctx:Context, resp:Response)->Generator[Any,None,None]:\\n yield Error(msg=\\\"Parse function not implemented\\\", code=Unimplemented)\",\n \"def test_parse_response(self, m):\\n dummy_response(m)\\n c = Client(apikey='')\\n c.send(utt=u'ぬるぽ', apiname='Dialogue')\\n ret = c.apis['Dialogue'].parse(c.last_response)\\n self.assertTrue(isinstance(ret, dict))\",\n \"def _parse_xml(self, response):\\n if response.startswith('\\\\n'):\\n response = response[1:]\\n tree = etree.fromstring(response)\\n return tree\",\n \"def _process_request(self, connection, request):\\n conn = urllib2.Request(url=connection, data=request.encode(\\\"utf-8\\\"))\\n f = urllib2.urlopen(conn)\\n all_results = f.read()\\n self.raw = all_results\\n return(fromstring(all_results))\",\n \"def fetchPlexApi(path='', method='GET', getFormPlextv=False, token=PLEX_TOKEN, params=None):\\n headers = {'X-Plex-Token': token,\\n 'Accept': 'application/json'}\\n if getFormPlextv:\\n url = 'plex.tv' \\n connection = http.client.HTTPSConnection(url)\\n else:\\n url = PLEX_URL.rstrip('/').replace('http://','')\\n connection = http.client.HTTPConnection(url)\\n try:\\n if method.upper() == 'GET':\\n pass\\n elif method.upper() == 'POST':\\n headers.update({'Content-type': 'application/x-www-form-urlencoded'})\\n pass\\n elif method.upper() == 'PUT':\\n pass\\n elif method.upper() == 'DELETE':\\n pass\\n else:\\n print(\\\"Invalid request method provided: {method}\\\".format(method=method))\\n connection.close()\\n return\\n\\n connection.request(method.upper(), path , params, headers) \\n response = connection.getresponse() \\n r = response.read() \\n contentType = response.getheader('Content-Type') \\n status = response.status \\n connection.close()\\n\\n if response and len(r): \\n if 'application/json' in contentType: \\n return json.loads(r)\\n elif 'application/xml' in contentType:\\n return xmltodict.parse(r)\\n else:\\n return r\\n else:\\n return r\\n\\n except Exception as e:\\n connection.close()\\n print(\\\"Error fetching from Plex API: {err}\\\".format(err=e))\",\n \"def parse(response):\\n # print(response.text.encode('utf-8'))\\n soup = BeautifulSoup(response.text, 'lxml')\\n title = soup.find('title')\\n answer = title.string\\n return answer\",\n \"def load_xml(pmid, sleep=None):\\n link = \\\"https://eutils.ncbi.nlm.nih.gov/entrez/eutils/efetch.fcgi?db=pubmed&retmode=xml&id=%s\\\" % str(pmid) + \\\"&api_key=\\\" + API_KEY\\n print(link)\\n page = requests.get(link)\\n tree = html.fromstring(page.content)\\n if sleep is not None:\\n time.sleep(sleep)\\n return tree\",\n \"def _create_https_connecetion(self,cr, uid, UPS_SERVER,Request_string,UPS_url=\\\"/ups.app/xml/XAV\\\", default_port=443, context={}):\\n conn=httplib.HTTPSConnection(UPS_SERVER,default_port) #creating http connection\\n\\n if not conn:\\n response_data='Connection failed'\\n else:\\n try:\\n conn.request(\\\"POST\\\",UPS_url,Request_string) #requst being sent to ups\\n response = conn.getresponse()\\n except Exception:\\n response_data='Connection failed'\\n else:\\n response_data = response.read()\\n return response_data\",\n \"def put_burp_to_trafficqueue(self):\\n if os.path.exists(self.burp):\\n import base64\\n from xml.etree import cElementTree as ET\\n from model import HttpRequest, HttpResponse\\n with open(self.burp)as f:\\n xmlstr = f.read()\\n try:\\n root = ET.fromstring(xmlstr)\\n except cElementTree.ParseError as e:\\n print('Parse burpsuite data error: '+str(e))\\n exit(0)\\n for child in root:\\n if child.tag == 'item':\\n req_headers = {}\\n resp_headers = {}\\n code = ''\\n request, response = '', ''\\n for child2 in child:\\n if child2.tag == 'method':\\n method = child2.text\\n if child2.tag == 'url':\\n url = child2.text\\n # static url in burp\\n if static_reg.search(url):\\n break\\n if child2.tag == 'status':\\n code = child2.text\\n if child2.tag == 'request':\\n req_text = child2.text\\n # base64 decode\\n req_text = base64.b64decode(req_text)\\n headers_list = req_text.split('\\\\r\\\\n\\\\r\\\\n', 1)[0].split('\\\\r\\\\n')[1:]\\n for header in headers_list:\\n try:\\n header_key, header_value = header.split(': ')[0], header.split(': ')[1]\\n if header_key not in list(req_headers.keys()):\\n req_headers[header_key] = header_value\\n # split header error\\n except IndexError as e:\\n print(e)\\n body = req_text.split('\\\\r\\\\n\\\\r\\\\n', 1)[1]\\n request = HttpRequest(method, url, req_headers, body)\\n if child2.tag == 'response':\\n resp_text = child2.text\\n # if response is not None\\n if resp_text:\\n # base64 decode\\n resp_text = base64.b64decode(resp_text)\\n reason = resp_text.split('\\\\r\\\\n')[0]\\n headers_list = resp_text.split('\\\\r\\\\n\\\\r\\\\n', 1)[0].split('\\\\r\\\\n')[1:]\\n for header in headers_list:\\n header_key, header_value = header.split(': ')[0], header.split(': ')[1]\\n if header_key not in list(resp_headers.keys()):\\n resp_headers[header_key] = header_value\\n data = resp_text.split('\\\\r\\\\n\\\\r\\\\n', 1)[1]\\n response = HttpResponse(code, reason, resp_headers, data)\\n if request and response:\\n if request.method == 'GET' and '?' in request.url:\\n # filter static URL\\n if not static_reg.search(url):\\n burp_traffic.append((request, response))\\n traffic_queue.put((request, response))\\n elif request.method == 'POST' and request.body:\\n content_type=request.get_header('Content-Type')\\n # save multipart\\n if content_type and 'multipart/form-data; boundary=' in content_type:\\n MULTIPART.append((request, response))\\n else:\\n burp_traffic.append((request, response))\\n traffic_queue.put((request, response))\\n else:\\n print('%s not exists!' % self.burp)\",\n \"def getXML(self,url_base):\\n\\n version=\\\"1.1.1\\\"\\n print \\\"Adress %s \\\" %(url_base[0])\\n try :\\n ## Read xml with urllib2\\n url=url_base[0]+'?service=WMS&version='+version+'&request=GetCapabilities'\\n request = urllib2.Request(url, headers={\\\"Accept\\\" : \\\"application/xml\\\"})\\n u = urllib2.urlopen(request)\\n u=urllib2.urlopen(url)\\n value=u.read()\\n tree= ET.fromstring( value )\\n #print ET.dump(tree)\\n dict_var={}\\n cap = tree.findall('Capability')[0]\\n layer1 = cap.findall('Layer')[0]\\n layer2 = layer1.findall('Layer')[0]\\n layers = layer2.findall('Layer')\\n for l in layers:\\n ## Find Variable name\\n variable_name=l.find('Name').text\\n print 'variable %s ' %(variable_name)\\n ## Find are of product\\n list_area=[]\\n box=l.find('BoundingBox')\\n lonmin=box.attrib['minx']\\n list_area.append(lonmin)\\n lonmax=box.attrib['maxx']\\n list_area.append(lonmax)\\n latmin=box.attrib['miny']\\n list_area.append(latmin)\\n latmax=box.attrib['maxy']\\n list_area.append(latmax)\\n ## Find time and prof\\n dims=l.findall('Extent')\\n list_prof=[]\\n list_time=[]\\n list_tot=[]\\n for dim in dims : \\n if dim.attrib['name'] == 'elevation' :\\n list_prof=str(dim.text).split(',')\\n if dim.attrib['name'] == 'time' :\\n list_time=str(dim.text).split(',')\\n if list_prof == [] : \\n list_prof.append('0')\\n list_tot.append(list_prof)\\n list_tot.append(list_time)\\n list_tot.append(list_area)\\n dict_var[str(variable_name)]=list_tot\\n except:\\n raise\\n print \\\"Error in WMS procedure\\\"\\n sys.exit(1)\\n return dict_var\",\n \"def get_response(request):\\n uri = \\\"api.php\\\"\\n response_body = None\\n url = proto + \\\"://\\\" + host + \\\"/\\\" + api_dir + \\\"/\\\" + uri\\n logger.debug(\\\"Enter get_response(url=\\\" + url + \\\") with request:\\\")\\n logger.debug(request)\\n if proto == \\\"http\\\":\\n conn = httplib.HTTPConnection(host)\\n elif proto == \\\"https\\\":\\n conn = httplib.HTTPSConnection(host)\\n else:\\n logger.error(\\\"Unsupported protocol \\\" + proto)\\n return None\\n http_response = \\\"\\\"\\n try:\\n conn.connect()\\n logger.debug(\\\"Sending to \\\" + host + \\\":\\\")\\n logger.debug(request)\\n data_json = json.dumps(request)\\n data_json_enc = data_json\\n data_json_enc_urlenc = urllib.urlencode({'data': data_json_enc})\\n conn.putrequest('POST', \\\"/\\\" + api_dir + \\\"/\\\" + uri)\\n headers = {'Content-Length': \\\"%d\\\" % (len(data_json_enc_urlenc)),\\n 'Content-Type': 'application/x-www-form-urlencoded'}\\n for k in headers:\\n conn.putheader(k, headers[k])\\n conn.endheaders()\\n conn.send(data_json_enc_urlenc)\\n http_response = conn.getresponse()\\n if http_response.status == 200:\\n response_body = http_response.read()\\n logger.debug(\\\"Response from server: %s\\\" % response_body)\\n if not response_body:\\n return None\\n url = \\\"%(proto)s://%(host)s/%(api_dir)s/%(uri)s\\\" % {\\n \\\"proto\\\": proto,\\n \\\"host\\\": host,\\n \\\"api_dir\\\": api_dir,\\n \\\"uri\\\": uri\\n }\\n logger.debug(\\\"Response from %(url)s : %(resp)s\\\" % {\\n \\\"url\\\": url,\\n \\\"resp\\\": response_body\\n })\\n else:\\n logger.error(\\\"HTTP error %d %s\\\" % (http_response.status, http_response.reason))\\n except socket.error as err:\\n logger.error(\\\"Exception while making request \\\" + url)\\n logger.error(err)\\n logger.error(\\\"Please check that DNS server is reachable and works\\\")\\n return None\\n except exceptions.KeyError as err:\\n logger.error(\\\"Failed to decode response from server %s\\\" % http_response)\\n logger.error(\\\"Could not find key %s\\\" % err)\\n return None\\n finally:\\n conn.close()\\n return response_body\",\n \"def call_api(self):\\n #generate the final call string\\n self.generate_call_string();\\n #debug\\n #print (self.call_url);\\n \\n #finally make api call\\n try: \\n #pass; \\n self.return_articles= json.loads(urlopen(self.call_url).read());\\n #print json.dumps(self.return_articles, indent=4, sort_keys=True)\\n except :#elaborate on this later\\n print(\\\"Exception,response did not go through:\\\");\\n e = sys.exc_info()[0]\\n print(e);\\n raise;\\n return;\",\n \"def load_xml(pmid, sleep=None):\\r\\n link = \\\"https://eutils.ncbi.nlm.nih.gov/entrez/eutils/efetch.fcgi?db=pubmed&retmode=xml&id=%s\\\" % str(pmid) \\r\\n page = requests.get(link) \\r\\n tree = html.fromstring(page.content)\\r\\n if sleep is not None:\\r\\n time.sleep(sleep)\\r\\n return tree\",\n \"def do_POST(self):\\n self.send_response(200)\\n self.send_header('Content-type','text/html')\\n self.send_header('Access-Control-Allow-Origin','*')\\n self.end_headers()\\n # Send the html message\\n self.wfile.write(\\\"Aivis Panovs, 161REB125\\\")\\n return\",\n \"def parse(self):\",\n \"def xml(self, request):\\n raise Exception(\\\"Not Implemented\\\")\",\n \"def _handle_response(response: str) -> Result:\\n logger.debug('SoapService - _handle_response(response: {})'.format(response))\\n result = Result()\\n parsed_response = xmltodict.parse(response)['xmlreply']\\n response_result = parsed_response['messages']['result']\\n\\n if response_result == 'OK':\\n refno = parsed_response['apmdata']['prospect']['p.cm']['refno']\\n result.data = {'Refno': refno}\\n result.status = True\\n elif response_result == 'Error':\\n errors = parsed_response['messages']['error'] if 'error' in parsed_response['messages'] else None # type: list\\n result.status = False\\n\\n return result\",\n \"def process_AResponse(self) :\\n while (1):\\n str = self.recv(self.sock)\\n if (len(str) > 0):\\n response = amazon_pb2.AResponses()\\n response.ParseFromString(str)\\n print(response)\\n # handle import new stock\\n for arrive in response.arrived:\\n things = arrive.things\\n for thing in things:\\n products = Whstock.objects.filter(pid = thing.id)\\n if len(products) != 0:\\n products[0].count = products[0].count + thing.count\\n products[0].save()\\n else :\\n #need to specify world id\\n whstock = Whstock()\\n whstock.hid = arrive.whnum\\n whstock.pid = thing.id\\n whstock.dsc = thing.description\\n whstock.count = thing.count\\n whstock.save()\\n # handle pack ready response\\n #when ready send AU command to let UPS truck pickup,\\n #use another thread for wait for UPS response\\n #when receive response send ALoad command\\n #when reveived loaded for Sim send AU command and let flag = 1;\\n # tell UPS packages is ready and ask for trucks (provide destinaiton address)\\n # tell warehouse to load when UPS trucks ready\\n for currReady in response.ready:\\n #save current state\\n trans = Transaction.objects.get(ship_id = currReady)\\n trans.ready = True\\n trans.save()\\n #connect to UPS\\n ups_handler = threading.Thread(target=self.process_Uresponse, args=(trans,))\\n ups_handler.start()\\n self.AUCommand(trans, 0)\\n print(\\\"first msg for UPS sent(to pickup)\\\")\\n ups_handler.join()\\n\\n #load info from sim\\n for load in response.loaded:\\n #save current state\\n trans = Transaction.objects.get(ship_id = load)\\n trans.loaded = True\\n trans.save()\\n #connect to UPS\\n self.AUCommand(trans, 1)\\n print(\\\"second msg for UPS sent(get load success from sim world)\\\")\",\n \"def get(self):\\n xml = self._robot.GetCapabilitiesXml()\\n self.response.headers['Content-Type'] = 'text/xml'\\n self.response.out.write(xml)\",\n \"def xmlrpc_response(data):\\n xml = xmlrpc_marshal(data)\\n response = webob.Response(xml)\\n response.content_type = 'text/xml'\\n response.content_length = len(xml)\\n return response\",\n \"def _parse_response(self, xmlstr, response_cls, service, binding,\\n outstanding_certs=None, **kwargs):\\n\\n response = None\\n\\n if self.config.accepted_time_diff:\\n kwargs[\\\"timeslack\\\"] = self.config.accepted_time_diff\\n\\n if \\\"asynchop\\\" not in kwargs:\\n if binding in [BINDING_SOAP, BINDING_PAOS]:\\n kwargs[\\\"asynchop\\\"] = False\\n else:\\n kwargs[\\\"asynchop\\\"] = True\\n\\n if xmlstr:\\n if \\\"return_addrs\\\" not in kwargs:\\n if binding in [BINDING_HTTP_REDIRECT, BINDING_HTTP_POST]:\\n try:\\n # expected return address\\n kwargs[\\\"return_addrs\\\"] = self.config.endpoint(\\n service, binding=binding)\\n except Exception:\\n logger.info(\\\"Not supposed to handle this!\\\")\\n return None\\n\\n try:\\n response = response_cls(self.sec, **kwargs)\\n except Exception, exc:\\n logger.info(\\\"%s\\\" % exc)\\n raise\\n\\n xmlstr = self.unravel(xmlstr, binding, response_cls.msgtype)\\n origxml = xmlstr\\n if not xmlstr: # Not a valid reponse\\n return None\\n\\n try:\\n response = response.loads(xmlstr, False, origxml=origxml)\\n except SigverError, err:\\n logger.error(\\\"Signature Error: %s\\\" % err)\\n raise\\n except UnsolicitedResponse:\\n logger.error(\\\"Unsolicited response\\\")\\n raise\\n except Exception, err:\\n if \\\"not well-formed\\\" in \\\"%s\\\" % err:\\n logger.error(\\\"Not well-formed XML\\\")\\n raise\\n\\n logger.debug(\\\"XMLSTR: %s\\\" % xmlstr)\\n\\n if response:\\n if outstanding_certs:\\n try:\\n cert = outstanding_certs[response.in_response_to]\\n except KeyError:\\n key_file = \\\"\\\"\\n else:\\n _, key_file = make_temp(\\\"%s\\\" % cert[\\\"key\\\"],\\n decode=False)\\n else:\\n key_file = \\\"\\\"\\n response = response.verify(key_file)\\n\\n if not response:\\n return None\\n\\n #logger.debug(response)\\n\\n return response\",\n \"def response_handling(self) -> global___Snippet.SimpleResponseHandling:\",\n \"def response_handling(self) -> global___Snippet.SimpleResponseHandling:\",\n \"def parse_aunit_response(aunit_results_xml):\\n\\n xml_handler = AUnitResponseHandler()\\n xml.sax.parseString(aunit_results_xml, xml_handler)\\n\\n return xml_handler\",\n \"def parse_response(self, response: Any) -> Any:\\n return response\",\n \"def process_Uresponse(self, trans):\\n while (1):\\n str = self.recv(self.Usock)\\n if (len(str) > 0):\\n response = AU_pb2.UA()\\n # try:\\n print(str)\\n response.ParseFromString(str)\\n print(response)\\n if (response != None):\\n self.ALoad(trans.ship_id, response.truckid)\\n trans.package_id = response.packageid\\n trans.save()\\n return\\n # except:\\n # print('error')\",\n \"def response(self):\\n soup = BeautifulStoneSoup(self.read())\\n\\n response = soup.find('response')\\n if response is None:\\n raise InvalidResponseError('No <response> container found.')\\n\\n contents = {}\\n for key in ['code', 'msg', 'value', 'category', 'action', 'cltrid',\\n 'svtrid', 'chksum']:\\n value = response.find(key)\\n if value is None:\\n raise InvalidResponseError(\\n 'No {} found in response.'.format(key)\\n )\\n contents[key] = value.string.strip()\\n\\n if contents['code'] in ONLINENIC_ERRORS:\\n raise ONLINENIC_ERRORS[contents['code']](\\n '{} [{}]'.format(contents['msg'], contents['value'])\\n )\\n\\n resdata = response.find('resdata')\\n if resdata is not None:\\n contents['data'] = {}\\n for d in resdata.contents:\\n if d is not None and d.string.strip():\\n key = d.get('name')\\n val = d.string.strip()\\n if key in contents['data'].keys():\\n if not isinstance(contents['data'][key], list):\\n existing_val = contents['data'][key]\\n contents['data'][key] = []\\n contents['data'][key].append(existing_val)\\n contents['data'][key].append(val)\\n else:\\n contents['data'][key] = val\\n\\n return contents\",\n \"def request(self, host, handler, request_body, verbose=0):\\n self.verbose = verbose\\n\\n headers = {'Content-type': 'text/xml'}\\n data = request_body\\n req = urllib2.Request('http://' + host + handler, data, headers)\\n\\n response = self.opener.open(req)\\n\\n return self.parse_response(response)\",\n \"def scrape(self):\\n try:\\n self.result = urlfetch.fetch(self.url)\\n except DownloadError:\\n self.result = urlfetch.fetch(self.url) \\n if ((self.result.status_code == 200) and\\n (self.result.content_was_truncated == 0)):\\n self.soup = BeautifulSoup(self.result.content)\\n else:\\n logging.critical(\\\"Bad Status Code: \\\", self.result.status_code, self.url)\\n sys.exit(1)\",\n \"def output_xml(data,code,headers=None):\\r\\n resp = make_response(dumps({'response': data}), code)\\r\\n resp.headers.extend(headers or {})\\r\\n return resp\",\n \"def _parse_response(self, response):\\n if response is not None:\\n return response.string\\n return response\",\n \"def parse_cp_xml_output(data):\\n import copy\\n\\n dom = parseString(data)\\n\\n parsed_data = {}\\n\\n #CARD HEADER\\n parsed_data = copy.deepcopy(xml_card_header(parsed_data, dom))\\n\\n # CARD CONTROL\\n\\n cardname = 'CONTROL'\\n target_tags = read_xml_card(dom, cardname)\\n\\n tagname = 'PP_CHECK_FLAG'\\n parsed_data[tagname.lower()] = parse_xml_child_bool(tagname, target_tags)\\n\\n # CARD STATUS\\n\\n cardname = 'STATUS'\\n target_tags = read_xml_card(dom, cardname)\\n\\n tagname = 'STEP'\\n attrname = 'ITERATION'\\n parsed_data[(tagname + '_' + attrname).lower()] = int(parse_xml_child_attribute_str(tagname, attrname, target_tags))\\n\\n tagname = 'TIME'\\n attrname = 'UNITS'\\n value = parse_xml_child_float(tagname, target_tags)\\n\\n units = parse_xml_child_attribute_str(tagname, attrname, target_tags)\\n if units not in ['pico-seconds']:\\n raise QEOutputParsingError(f'Units {units} are not supported by parser')\\n parsed_data[tagname.lower()] = value\\n\\n tagname = 'TITLE'\\n parsed_data[tagname.lower()] = parse_xml_child_str(tagname, target_tags)\\n\\n # CARD CELL\\n parsed_data, lattice_vectors, volume = copy.deepcopy(xml_card_cell(parsed_data, dom))\\n\\n # CARD IONS\\n parsed_data = copy.deepcopy(xml_card_ions(parsed_data, dom, lattice_vectors, volume))\\n\\n # CARD PLANE WAVES\\n\\n parsed_data = copy.deepcopy(xml_card_planewaves(parsed_data, dom, 'cp'))\\n\\n # CARD SPIN\\n parsed_data = copy.deepcopy(xml_card_spin(parsed_data, dom))\\n\\n # CARD EXCHANGE_CORRELATION\\n parsed_data = copy.deepcopy(xml_card_exchangecorrelation(parsed_data, dom))\\n\\n # TODO CARD OCCUPATIONS\\n\\n # CARD BRILLOUIN ZONE\\n # TODO: k points are saved for CP... Why?\\n\\n cardname = 'BRILLOUIN_ZONE'\\n target_tags = read_xml_card(dom, cardname)\\n\\n tagname = 'NUMBER_OF_K-POINTS'\\n parsed_data[tagname.replace('-', '_').lower()] = parse_xml_child_integer(tagname, target_tags)\\n\\n tagname = 'UNITS_FOR_K-POINTS'\\n attrname = 'UNITS'\\n metric = parse_xml_child_attribute_str(tagname, attrname, target_tags)\\n if metric not in ['2 pi / a']:\\n raise QEOutputParsingError(\\n f'Error parsing attribute {attrname}, tag {tagname} inside {target_tags.tagName}, units unknown'\\n )\\n parsed_data[tagname.replace('-', '_').lower()] = metric\\n\\n # TODO: check what happens if one does not use the monkhorst pack in the code\\n tagname = 'MONKHORST_PACK_GRID'\\n try:\\n a = target_tags.getElementsByTagName(tagname)[0]\\n value = [int(a.getAttribute('nk' + str(i + 1))) for i in range(3)]\\n parsed_data[tagname.replace('-', '_').lower()] = value\\n except:\\n raise QEOutputParsingError(f'Error parsing tag {tagname} inside {target_tags.tagName}.')\\n\\n tagname = 'MONKHORST_PACK_OFFSET'\\n try:\\n a = target_tags.getElementsByTagName(tagname)[0]\\n value = [int(a.getAttribute('k' + str(i + 1))) for i in range(3)]\\n parsed_data[tagname.replace('-', '_').lower()] = value\\n except:\\n raise QEOutputParsingError(f'Error parsing tag {tagname} inside {target_tags.tagName}.')\\n\\n try:\\n kpoints = []\\n for i in range(parsed_data['number_of_k_points']):\\n tagname = 'K-POINT.' + str(i + 1)\\n a = target_tags.getElementsByTagName(tagname)[0]\\n b = a.getAttribute('XYZ').replace('\\\\n', '').rsplit()\\n value = [float(s) for s in b]\\n\\n metric = parsed_data['units_for_k_points']\\n if metric == '2 pi / a':\\n value = [float(s) / parsed_data['lattice_parameter'] for s in value]\\n\\n weight = float(a.getAttribute('WEIGHT'))\\n\\n kpoints.append([value, weight])\\n\\n parsed_data['k_point'] = kpoints\\n except:\\n raise QEOutputParsingError(f'Error parsing tag K-POINT.# inside {target_tags.tagName}.')\\n\\n tagname = 'NORM-OF-Q'\\n # TODO decide if save this parameter\\n parsed_data[tagname.replace('-', '_').lower()] = parse_xml_child_float(tagname, target_tags)\\n\\n # CARD PARALLELISM\\n # can be optional\\n\\n try:\\n cardname = 'PARALLELISM'\\n target_tags = read_xml_card(dom, cardname)\\n\\n tagname = 'GRANULARITY_OF_K-POINTS_DISTRIBUTION'\\n parsed_data[tagname.lower().replace('-', '_')] = parse_xml_child_integer(tagname, target_tags)\\n\\n tagname = 'NUMBER_OF_PROCESSORS'\\n parsed_data[tagname.lower().replace('-', '_')] = parse_xml_child_integer(tagname, target_tags)\\n\\n tagname = 'NUMBER_OF_PROCESSORS_PER_POOL'\\n parsed_data[tagname.lower().replace('-', '_')] = parse_xml_child_integer(tagname, target_tags)\\n\\n tagname = 'NUMBER_OF_PROCESSORS_PER_IMAGE'\\n parsed_data[tagname.lower().replace('-', '_')] = parse_xml_child_integer(tagname, target_tags)\\n\\n tagname = 'NUMBER_OF_PROCESSORS_PER_TASKGROUP'\\n parsed_data[tagname.lower().replace('-', '_')] = parse_xml_child_integer(tagname, target_tags)\\n\\n tagname = 'NUMBER_OF_PROCESSORS_PER_POT'\\n parsed_data[tagname.lower().replace('-', '_')] = parse_xml_child_integer(tagname, target_tags)\\n\\n tagname = 'NUMBER_OF_PROCESSORS_PER_BAND_GROUP'\\n parsed_data[tagname.lower().replace('-', '_')] = parse_xml_child_integer(tagname, target_tags)\\n\\n tagname = 'NUMBER_OF_PROCESSORS_PER_DIAGONALIZATION'\\n parsed_data[tagname.lower().replace('-', '_')] = parse_xml_child_integer(tagname, target_tags)\\n except QEOutputParsingError:\\n pass\\n\\n # CARD TIMESTEPS\\n\\n cardname = 'TIMESTEPS'\\n target_tags = read_xml_card(dom, cardname)\\n\\n for tagname in ['STEP0', 'STEPM']:\\n try:\\n tag = target_tags.getElementsByTagName(tagname)[0]\\n\\n try:\\n second_tagname = 'ACCUMULATORS'\\n second_tag = tag.getElementsByTagName(second_tagname)[0]\\n data = second_tag.childNodes[0].data.rstrip().split() # list of floats\\n parsed_data[second_tagname.replace('-', '_').lower()] = [float(i) for i in data]\\n except:\\n pass\\n\\n second_tagname = 'IONS_POSITIONS'\\n second_tag = tag.getElementsByTagName(second_tagname)[0]\\n third_tagname = 'stau'\\n third_tag = second_tag.getElementsByTagName(third_tagname)[0]\\n list_data = third_tag.childNodes[0].data.rstrip().split()\\n list_data = [float(i) for i in list_data]\\n # convert to matrix\\n val = []\\n mat = []\\n for i, data in enumerate(list_data):\\n val.append(data)\\n if (i + 1) % 3 == 0:\\n mat.append(val)\\n val = []\\n parsed_data[(second_tagname + '_' + third_tagname).replace('-', '_').lower()] = mat\\n third_tagname = 'svel'\\n third_tag = second_tag.getElementsByTagName(third_tagname)[0]\\n list_data = third_tag.childNodes[0].data.rstrip().split()\\n list_data = [float(i) for i in list_data]\\n # convert to matrix\\n val = []\\n mat = []\\n for i, data in enumerate(list_data):\\n val.append(data)\\n if (i + 1) % 3 == 0:\\n mat.append(val)\\n val = []\\n parsed_data[(second_tagname + '_' + third_tagname).replace('-', '_').lower()] = mat\\n try:\\n third_tagname = 'taui'\\n third_tag = second_tag.getElementsByTagName(third_tagname)[0]\\n list_data = third_tag.childNodes[0].data.rstrip().split()\\n list_data = [float(i) for i in list_data]\\n # convert to matrix\\n val = []\\n mat = []\\n for i, data in enumerate(list_data):\\n val.append(data)\\n if (i + 1) % 3 == 0:\\n mat.append(val)\\n val = []\\n parsed_data[(second_tagname + '_' + third_tagname).replace('-', '_').lower()] = mat\\n except:\\n pass\\n\\n try:\\n third_tagname = 'cdmi'\\n third_tag = second_tag.getElementsByTagName(third_tagname)[0]\\n list_data = third_tag.childNodes[0].data.rstrip().split()\\n parsed_data[(second_tagname + '_' + third_tagname).replace('-', '_').lower()\\n ] = [float(i) for i in list_data]\\n except:\\n pass\\n\\n try:\\n third_tagname = 'force'\\n third_tag = second_tag.getElementsByTagName(third_tagname)[0]\\n list_data = third_tag.childNodes[0].data.rstrip().split()\\n list_data = [float(i) for i in list_data]\\n # convert to matrix\\n val = []\\n mat = []\\n for i, data in enumerate(list_data):\\n val.append(data)\\n if (i + 1) % 3 == 0:\\n mat.append(val)\\n val = []\\n parsed_data[(second_tagname + '_' + third_tagname).replace('-', '_').lower()] = mat\\n except:\\n pass\\n\\n second_tagname = 'IONS_NOSE'\\n second_tag = tag.getElementsByTagName(second_tagname)[0]\\n third_tagname = 'nhpcl'\\n third_tag = second_tag.getElementsByTagName(third_tagname)[0]\\n parsed_data[(second_tagname + '_' + third_tagname).replace('-', '_').lower()\\n ] = float(third_tag.childNodes[0].data)\\n third_tagname = 'nhpdim'\\n third_tag = second_tag.getElementsByTagName(third_tagname)[0]\\n parsed_data[(second_tagname + '_' + third_tagname).replace('-', '_').lower()\\n ] = float(third_tag.childNodes[0].data)\\n third_tagname = 'xnhp'\\n third_tag = second_tag.getElementsByTagName(third_tagname)[0]\\n parsed_data[(second_tagname + '_' + third_tagname).replace('-', '_').lower()\\n ] = float(third_tag.childNodes[0].data)\\n try:\\n third_tagname = 'vnhp'\\n third_tag = second_tag.getElementsByTagName(third_tagname)[0]\\n parsed_data[(second_tagname + '_' + third_tagname).replace('-', '_').lower()\\n ] = float(third_tag.childNodes[0].data)\\n except:\\n pass\\n\\n try:\\n second_tagname = 'ekincm'\\n second_tag = tag.getElementsByTagName(second_tagname)[0]\\n parsed_data[second_tagname.replace('-', '_').lower()] = float(second_tag.childNodes[0].data)\\n except:\\n pass\\n\\n second_tagname = 'ELECTRONS_NOSE'\\n second_tag = tag.getElementsByTagName(second_tagname)[0]\\n try:\\n third_tagname = 'xnhe'\\n third_tag = second_tag.getElementsByTagName(third_tagname)[0]\\n parsed_data[(second_tagname + '_' + third_tagname).replace('-', '_').lower()\\n ] = float(third_tag.childNodes[0].data)\\n except:\\n pass\\n try:\\n third_tagname = 'vnhe'\\n third_tag = second_tag.getElementsByTagName(third_tagname)[0]\\n parsed_data[(second_tagname + '_' + third_tagname).replace('-', '_').lower()\\n ] = float(third_tag.childNodes[0].data)\\n except:\\n pass\\n\\n second_tagname = 'CELL_PARAMETERS'\\n second_tag = tag.getElementsByTagName(second_tagname)[0]\\n try:\\n third_tagname = 'ht'\\n third_tag = second_tag.getElementsByTagName(third_tagname)[0]\\n list_data = third_tag.childNodes[0].data.rstrip().split()\\n list_data = [float(i) for i in list_data]\\n # convert to matrix\\n val = []\\n mat = []\\n for i, data in enumerate(list_data):\\n val.append(data)\\n if (i + 1) % 3 == 0:\\n mat.append(val)\\n val = []\\n parsed_data[(second_tagname + '_' + third_tagname).replace('-', '_').lower()] = mat\\n except:\\n pass\\n try:\\n third_tagname = 'htvel'\\n third_tag = second_tag.getElementsByTagName(third_tagname)[0]\\n list_data = third_tag.childNodes[0].data.rstrip().split()\\n list_data = [float(i) for i in list_data]\\n # convert to matrix\\n val = []\\n mat = []\\n for i, data in enumerate(list_data):\\n val.append(data)\\n if (i + 1) % 3 == 0:\\n mat.append(val)\\n val = []\\n parsed_data[(second_tagname + '_' + third_tagname).replace('-', '_').lower()] = mat\\n except:\\n pass\\n try:\\n third_tagname = 'gvel'\\n third_tag = second_tag.getElementsByTagName(third_tagname)[0]\\n list_data = third_tag.childNodes[0].data.rstrip().split()\\n list_data = [float(i) for i in list_data]\\n # convert to matrix\\n val = []\\n mat = []\\n for i, data in enumerate(list_data):\\n val.append(data)\\n if (i + 1) % 3 == 0:\\n mat.append(val)\\n val = []\\n parsed_data[(second_tagname + '_' + third_tagname).replace('-', '_').lower()] = mat\\n except:\\n pass\\n\\n second_tagname = 'CELL_NOSE'\\n second_tag = tag.getElementsByTagName(second_tagname)[0]\\n try:\\n third_tagname = 'xnhh'\\n third_tag = second_tag.getElementsByTagName(third_tagname)[0]\\n list_data = third_tag.childNodes[0].data.rstrip().split()\\n list_data = [float(i) for i in list_data]\\n\\n # convert to matrix\\n val = []\\n mat = []\\n for i, data in enumerate(list_data):\\n val.append(data)\\n if (i + 1) % 3 == 0:\\n mat.append(val)\\n val = []\\n parsed_data[(second_tagname + '_' + third_tagname).replace('-', '_').lower()] = mat\\n except:\\n pass\\n try:\\n third_tagname = 'vnhh'\\n third_tag = second_tag.getElementsByTagName(third_tagname)[0]\\n list_data = third_tag.childNodes[0].data.rstrip().split()\\n list_data = [float(i) for i in list_data]\\n # convert to matrix\\n val = []\\n mat = []\\n for i, data in enumerate(list_data):\\n val.append(data)\\n if (i + 1) % 3 == 0:\\n mat.append(val)\\n val = []\\n parsed_data[(second_tagname + '_' + third_tagname).replace('-', '_').lower()] = mat\\n except:\\n pass\\n except Exception as e:\\n raise QEOutputParsingError(f'Error parsing CARD {cardname}')\\n\\n # CARD BAND_STRUCTURE_INFO\\n\\n cardname = 'BAND_STRUCTURE_INFO'\\n target_tags = read_xml_card(dom, cardname)\\n\\n tagname = 'NUMBER_OF_ATOMIC_WFC'\\n parsed_data[tagname.lower().replace('-', '_')] = parse_xml_child_integer(tagname, target_tags)\\n\\n tagname = 'NUMBER_OF_ELECTRONS'\\n parsed_data[tagname.lower().replace('-', '_')] = int(parse_xml_child_float(tagname, target_tags))\\n\\n tagname = 'NUMBER_OF_BANDS'\\n parsed_data[tagname.lower().replace('-', '_')] = parse_xml_child_integer(tagname, target_tags)\\n\\n tagname = 'NUMBER_OF_SPIN_COMPONENTS'\\n parsed_data[tagname.lower().replace('-', '_')] = parse_xml_child_integer(tagname, target_tags)\\n\\n # TODO\\n # - EIGENVALUES (that actually just contains occupations)\\n # Why should I be interested in that, if CP works for insulators only?\\n # - EIGENVECTORS\\n # - others TODO are written in the function\\n\\n return parsed_data\",\n \"def load_website(self):\\n# r = urllib.request.urlopen(self.url).read()\\n r = requests.get(self.url).content \\n self.soup = bs(r, \\\"lxml\\\")\",\n \"def get_content_from_ulr(self):\\n response = urllib.request.urlopen(self.url)\\n if response.getcode() != 200:\\n self.logger.info(\\\"Cisco - get_content_from_url()\\\")\\n raise ConnectionError('Unable to load ', self.url)\\n content = response.read()\\n response.close()\\n return content\",\n \"def parse_response(conn): \\n\\t\\n\\t# HEAD\\n\\thead = read2CRLF(conn)\\n\\t\\n\\tif debug == 0: print(\\\"STATUS LINE: \\\", head )\\n\\t\\n\\t# Tokens in the status line are separated by spaces\\n\\t# status_line = http-version <SP> status_code <SP> Reason\\n\\tstatus_line = head.decode().split(' ')\\n\\t\\n\\t# Parse the status line\\n\\tif len(status_line) < 3:\\n\\t\\traise Exception(\\\"Malformed Response Packet\\\")\\n\\t\\t\\n\\tif status_line[0] != HTTPConstants.VERSION:\\n\\t\\traise Exception(\\\"Malformed Response Packet\\\")\\n\\t\\n\\t# CRLF separation between HEAD and BODY\\n\\texpectCRLF(conn)\\n\\t\\n\\t# BODY\\n\\tdata = read2CRLF(conn)\\n\\t\\n\\tresponse = [ status_line[1], status_line[2] ]\\n\\t\\n\\t# return the data in the body\\n\\treturn response, data\",\n \"def parse(self, content):\\n pass\",\n \"def test():\\n r = Response(response=\\\"This worked!\\\", status=200,\\n mimetype=\\\"application/xml\\\")\\n r.headers[\\\"Content-Type\\\"] = \\\"text/xml; charset=utf-8\\\"\\n return r\",\n \"def run(self):\\n #use subprocess for your bindings when develop a new functionality\\n fulldate = datetime.now().strftime(\\\"%A, %d. %B %Y %I:%M%p\\\")\\n\\n hours = datetime.now().strftime(\\\"%I\\\")\\n minutes = datetime.now().strftime(\\\"%I\\\")\\n\\n if self.req_from == 'jabber':\\n response = {'request': self.request\\n ,'text' : fulldate\\n ,'jmsg' : fulldate\\n ,'continue' : 0\\n ,'type':'response' }\\n\\n if self.req_from == 'julius':\\n response = {'request': self.request\\n ,'say': \\\"IT'S, %d O'CLOCK AND %d MINUTES\\\" % ( int(hours), int(minutes))\\n ,'text' : fulldate\\n ,'continue' : 0\\n ,'type' : 'response' }\\n\\n return response\\n #import subprocess\\n #s = subprocess.Popen(['ffmpeg', '-i', speech, flac ] , stderr=subprocess.STDOUT, stdout=subprocess.PIPE).communicate()[0]\",\n \"def _post_request_parser(self, tagname):\\n\\n wpsrequest = self\\n\\n def parse_post_getcapabilities(doc):\\n \\\"\\\"\\\"Parse POST GetCapabilities request\\n \\\"\\\"\\\"\\n acceptedversions = xpath_ns(\\n doc, '/wps:GetCapabilities/ows:AcceptVersions/ows:Version')\\n acceptedversions = ','.join(\\n map(lambda v: v.text, acceptedversions))\\n wpsrequest.check_accepted_versions(acceptedversions)\\n\\n def parse_post_describeprocess(doc):\\n \\\"\\\"\\\"Parse POST DescribeProcess request\\n \\\"\\\"\\\"\\n\\n version = doc.attrib.get('version')\\n wpsrequest.check_and_set_version(version)\\n\\n language = doc.attrib.get('language')\\n wpsrequest.check_and_set_language(language)\\n\\n wpsrequest.operation = 'describeprocess'\\n wpsrequest.identifiers = [identifier_el.text for identifier_el in\\n xpath_ns(doc, './ows:Identifier')]\\n\\n def parse_post_execute(doc):\\n \\\"\\\"\\\"Parse POST Execute request\\n \\\"\\\"\\\"\\n\\n version = doc.attrib.get('version')\\n wpsrequest.check_and_set_version(version)\\n\\n language = doc.attrib.get('language')\\n wpsrequest.check_and_set_language(language)\\n\\n wpsrequest.operation = 'execute'\\n\\n identifier = xpath_ns(doc, './ows:Identifier')\\n\\n if not identifier:\\n raise MissingParameterValue(\\n 'Process identifier not set', 'Identifier')\\n\\n wpsrequest.identifier = identifier[0].text\\n wpsrequest.lineage = 'false'\\n wpsrequest.store_execute = 'false'\\n wpsrequest.status = 'false'\\n wpsrequest.inputs = get_inputs_from_xml(doc)\\n wpsrequest.outputs = get_output_from_xml(doc)\\n wpsrequest.raw = False\\n if xpath_ns(doc, '/wps:Execute/wps:ResponseForm/wps:RawDataOutput'):\\n wpsrequest.raw = True\\n # executeResponse XML will not be stored\\n wpsrequest.store_execute = 'false'\\n\\n # check if response document tag has been set then retrieve\\n response_document = xpath_ns(\\n doc, './wps:ResponseForm/wps:ResponseDocument')\\n if len(response_document) > 0:\\n wpsrequest.lineage = response_document[\\n 0].attrib.get('lineage', 'false')\\n wpsrequest.store_execute = response_document[\\n 0].attrib.get('storeExecuteResponse', 'false')\\n wpsrequest.status = response_document[\\n 0].attrib.get('status', 'false')\\n\\n if tagname == WPS.GetCapabilities().tag:\\n self.operation = 'getcapabilities'\\n return parse_post_getcapabilities\\n elif tagname == WPS.DescribeProcess().tag:\\n self.operation = 'describeprocess'\\n return parse_post_describeprocess\\n elif tagname == WPS.Execute().tag:\\n self.operation = 'execute'\\n return parse_post_execute\\n else:\\n raise InvalidParameterValue(\\n 'Unknown request %r' % tagname, 'request')\",\n \"def getArbitraryManHTMLOutput(self, version, prefix=\\\"\\\"):\\n # Try to normalize the XML a little bit.\\n return dom.parseString(\\\"\\\"\\\"\\\\\\n<?xml version=\\\"1.0\\\" ?><html>\\n <head><title>Yo:MANHOLE.1</title></head>\\n <body>\\n <div class=\\\"content\\\">\\n\\n<span/>\\n\\n<h2>NAME<a name=\\\"auto0\\\"/></h2>\\n\\n<p>manhole - Connect to a Twisted Manhole service\\n</p>\\n\\n<h2>SYNOPSIS<a name=\\\"auto1\\\"/></h2>\\n\\n<p><strong>manhole</strong> </p>\\n\\n<h2>DESCRIPTION<a name=\\\"auto2\\\"/></h2>\\n\\n<p>manhole is a GTK interface to Twisted Manhole services. You can execute python\\ncode as if at an interactive Python console inside a running Twisted process\\nwith this.</p>\\n\\n</div>\\n <a href=\\\"%(prefix)sindex.html\\\">Index</a>\\n <span class=\\\"version\\\">Version: %(version)s</span>\\n </body>\\n </html>\\\"\\\"\\\" % {\\n 'prefix': prefix, 'version': version}).toxml(\\\"utf-8\\\")\",\n \"def __call__(self):\\n params, method = parse_xmlrpc_request(self.request)\\n return xmlrpc_response(getattr(self,method)(*params))\",\n \"def _fetch(self, output_type='xml'):\\n\\n # authenticate\\n self._auth()\\n\\n # get the table\\n response = self._do('GET', self.URLS['adp'])\\n\\n # load results\\n self._results = self._parse_doc(response.text)\",\n \"def make_request_txt(self):\\n #print (self.url)\\n try:\\n with closing(get(self.url, stream=True)) as resp: #returns b`txt`\\n if self.is_txt(resp):\\n return resp.content.decode(\\\"utf-8\\\")\\n else:\\n return None\\n except RequestException as e:\\n print('Error during requests to {0} : {1}'.format(url, str(e)))\\n return None\",\n \"def run(self):\\r\\n print \\\"*Ping* We've got a message!\\\"\\r\\n # Handle DNS request\\r\\n resolver = Resolver(self.caching, self.ttl)\\r\\n aliasRecords = []\\r\\n addressRecords = []\\r\\n # Read and resolve the questions one-by-one\\r\\n questions = self.request.questions\\r\\n for question in questions:\\r\\n hostname = question.qname\\r\\n (hostname, aliases, addresses) = resolver.gethostbyname(hostname)\\r\\n \\r\\n for alias in aliases:\\r\\n aliasData = dns.resource.RecordData.create(Type.CNAME, alias)\\r\\n aliasRecord = dns.resource.ResourceRecord(hostname, Type.CNAME, Class.IN, 9001, aliasData) # TODO fix ttl\\r\\n aliasRecords.append(aliasRecord)\\r\\n for address in addresses:\\r\\n addressData = dns.resource.RecordData.create(Type.A, address)\\r\\n addressRecord = dns.resource.ResourceRecord(hostname, Type.A, Class.IN, 9001, addressData)\\r\\n addressRecords.append(addressRecord)\\r\\n \\r\\n # Crafting of the response\\r\\n respHeader = self.request.header\\r\\n respHeader.qr = 1\\r\\n respHeader.qd_count = 0\\r\\n respHeader.an_count = 1\\r\\n \\r\\n respMessage = dns.message.Message(respHeader, [], addressRecords + aliasRecords, [], [])\\r\\n sock = socket.socket(socket.AF_INET, socket.SOCK_DGRAM)\\r\\n respMessageByte = respMessage.to_bytes()\\r\\n sock.sendto(respMessageByte, self.clientAddr)\\r\\n print \\\"Ended request: \\\" + hostname\\r\\n sock.close()\",\n \"def post(self):\\n xml_raw = self.request.get('xml_input').encode('utf-8')\\n root = ET.fromstring(xml_raw)\\n\\n items = root.findall(\\\"./\\\")\\n\\n for item in items:\\n self.insert_item(item)\\n\\n self.response.out.write('')\",\n \"def _parse(self):\\n pass\",\n \"def parse(self):\\n \\n r = requests.get(self.url)\\n if r:\\n self.title = fetch_title(self.url)\\n self.domain = self.fetch_domain()\\n self.favicon = self.fetch_favicon()\\n self.topics = self.classify_topics()\\n self.description = self.fetch_description()\\n return self\",\n \"def parse_data(self):\\n\\n msg = self.xml['dom'].childNodes[0]\\n self.data = xml_to_dicts(msg, False)\\n\\n # Get some metadata together\\n self.id = \\\"%s:%s\\\" % (self.data['src']['name']['#cdata'], self.data['src']['id']['#cdata'])\\n self.temp = self.data['tmpr']['#cdata']\\n self.watts = self.data['ch1']['watts']['#cdata']\\n\\n # Time - CurrentCost and local\\n self.date = {}\\n self.date['cc'] = [ int(self.data['date'][k]['#cdata']) for k in ('dsb','hr','min','sec') ]\\n self.date['now'] = localtime()\",\n \"def soap_GetSitesXml(self, ps):\\n try:\\n #this code is just for deploying on apache\\n #httpReq = kw['request']\\n rsp = WaterOneFlow.soap_GetSitesXml(self,ps)\\n request = self.request\\n #get input parameter, save it in a string list strSiteCodeList.\\n siteCodeList = request.get_element_site()\\n strSiteCodeList = map(str,siteCodeList.get_element_string())\\n #construct/renew the siteInfo_site_dictionary.\\n #currently, renew it every 14 days (subject to change)?\\n if(len(siteInfo_site_dictionary.keys())==1 or \\n datetime.now() >= siteInfo_site_dictionary[\\\"__modTime\\\"] + timedelta(days=14)):\\n #here has a possible race condition, so a lock is placed\\n semaphore = open('/home/txhis/CBIService/semaphore/semaphore.file', \\\"w\\\")\\n lock(semaphore, LOCK_EX)\\n treeIter = getIterator(centralRegUrl)\\n #save the srs information in dictionary\\n buildSiteInfo_siteDictionary(treeIter,siteInfo_site_dictionary)\\n siteInfo_site_dictionary[\\\"__modTime\\\"]=datetime.now()\\n #close semaphore, release the lock file. (otherwise deadlock will be possible)\\n semaphore.close()\\n # Generate XML String\\n #big response node\\n siteResponse = SiteInfoResponseType()\\n #set queryInfo\\n queryInfo = generateQueryInfo_string(request.get_element_site());\\n siteResponse.set_queryInfo(queryInfo)\\n #get the \\\"key\\\" part, ready to match in cached dictionary:\\n def getKeyPart(str): \\n tempstr = str.split(':')\\n if tempstr[0] == 'CBI':return tempstr[1]\\n #use map, get siteCode part of every string, saving a loop \\n strSiteCodeList = map(getKeyPart,strSiteCodeList)\\n #Eliminate the \\\"None\\\" element\\n strSiteCodeList = [i for i in strSiteCodeList if i]\\n #site List array (if multiple sites)\\n siteList = []\\n # read this logic:\\n #if input is empty, return all the Sites as the response\\n if (not siteCodeList.get_element_string() or (not siteCodeList.get_element_string()[0] \\n and len(siteCodeList.get_element_string())==1)):\\n for key in siteInfo_site_dictionary.keys():\\n if key == \\\"__modTime\\\" or key == 'srs' : continue\\n #site nodes\\n siteNode = site()\\n #siteCodeArray[1]][1][1] is an arbitrary xml node of a certain location\\n siteInfoNode = generateSiteInfo_string(siteInfo_site_dictionary[key][1][0],siteInfo_site_dictionary['srs'])\\n siteNode.set_siteInfo(siteInfoNode)\\n siteList.append(siteNode)\\n siteResponse.set_site(siteList) \\n siteResponseString = cStringIO.StringIO() \\n siteResponse.export(siteResponseString, 0, \\\\\\n namespacedef_=' '.join(['xmlns:gml=\\\"http://www.opengis.net/gml\\\"',\\n 'xmlns:xsi=\\\"http://www.w3.org/2001/XMLSchema-instance\\\"',\\n 'xmlns:xlink=\\\"http://www.w3.org/1999/xlink\\\"',\\n 'xmlns:wtr=\\\"http://www.cuahsi.org/waterML/\\\"',\\n 'xmlns:xsd=\\\"http://www.w3.org/2001/XMLSchema\\\"',\\n 'xmlns=\\\"http://www.cuahsi.org/waterML/1.0/\\\"'])) \\n rsp.set_element_GetSitesXmlResult(siteResponseString.getvalue())\\n except Exception, e:\\n import traceback\\n traceback.print_exc(file=sys.stdout)\\n if isinstance(e,Fault):\\n detail = None\\n if e.detail is not None: \\n detail = Detail()\\n detail.any = e.detail \\n rsp = FaultType(e.code, e.string, e.actor, detail)\\n return rsp\",\n \"def get_pmid_xml(api_key,idtype,searchid):\\n headers = {'X-ELS-APIKey':api_key}\\n url = \\\"http://api.elsevier.com/content/search/index:SCOPUS?query=\\\" + idtype + \\\"(\\\" + searchid + \\\")&field=doi\\\"\\n #url = 'http://api.elsevier.com/content/abstract/scopus_id:' + str(pmid)\\n print url\\n web = requests.get(url, headers=headers)\\n try:\\n doi = web.json()['search-results']['entry'][0]['prism:doi']\\n except: \\n print web.json()\\n doi = False\\n \\n try: \\n scopus_abstract = web.json()['search-results']['entry'][0]['prism:url']\\n web_scopus = requests.get(scopus_abstract, headers=headers)\\n xml_text = web_scopus.text\\n except: \\n scopus_abstract = False\\n xml_text = False\\n\\n output = {'doi':doi, 'scopus_abstract':scopus_abstract, 'xml_text':xml_text}\\n return(output)\",\n \"def parse(self):\\n p = feedparser.parse(self.xml)\\n self.p = p\\n return p\",\n \"def parse_snmp_response(response, type):\\n values = []\\n root = etree.fromstring(response)\\n body = root.findall('{%s}Body'%'http://schemas.xmlsoap.org/soap/envelope/')\\n for b in body:\\n message = b.findall('{%s}message'%'http://ggf.org/ns/nmwg/base/2.0/')\\n for m in message:\\n data = m.findall('{%s}data'%'http://ggf.org/ns/nmwg/base/2.0/')\\n for d in data:\\n datum = d.findall('{%s}datum'%'http://ggf.org/ns/nmwg/base/2.0/')\\n for d2 in datum:\\n #to check this is not an error message\\n if d2.text != '':\\n if d2.attrib['value'] != '' and d2.attrib['value'] != None and d2.attrib['value'] != 'nan':\\n v = {}\\n v['timeValue'] = datetime.fromtimestamp(float(d2.attrib['timeValue']))\\n v['value']=d2.attrib['value']\\n if type!=\\\"lamp\\\":\\n v['valueUnits'] = d2.attrib['valueUnits']\\n values.append(v)\\n\\n return values\",\n \"def _call(url, parser=None, params=None, auth=None, verify=True):\\n headers = {\\n 'User-Agent': 'rwrstats.com'\\n }\\n\\n response = requests.get(\\n url,\\n params=params,\\n auth=auth,\\n headers=headers,\\n verify=verify,\\n timeout=5\\n )\\n\\n response.raise_for_status()\\n\\n if parser == 'html':\\n return html.fromstring(response.text)\\n elif parser == 'xml':\\n return etree.fromstring(response.text)\",\n \"def _parse_response_body_from_xml_text(self, response, return_type):\\n respbody = response.body\\n\\n doc = minidom.parseString(respbody)\\n return_obj = return_type()\\n for node in self._get_child_nodes(doc, return_type.__name__):\\n self._fill_data_to_return_object(node, return_obj)\\n\\n # Note: We always explicitly assign status code to the custom return\\n # type object\\n return_obj.status = response.status\\n\\n return return_obj\",\n \"def parse_response(self, response, case):\\n request = response.request\\n parsed = {\\n 'request': {\\n 'method': request.method,\\n 'url': request.url,\\n 'body': request.body,\\n },\\n 'response': {\\n 'headers': OrderedDict(),\\n 'status_code': response.status_code,\\n 'reason': response.reason,\\n }\\n }\\n\\n # Re-assemble request line\\n url_parts = urlparse(request.url)\\n parsed['request']['request_line'] = '%s %s%s%s HTTP/1.1' % (\\n request.method, url_parts.path, '?' if url_parts.query else '',\\n url_parts.query)\\n\\n # Process request headers\\n if self.mode == 'display':\\n hostname = url_parts.hostname\\n else:\\n hostname = self.doc_hostname\\n parsed['request']['headers'] = OrderedDict((('Host', hostname),))\\n for header in sorted([h.title() for h in request.headers]):\\n raw_value = request.headers[header]\\n value = self.parse_header(header, raw_value, 'request')\\n if value:\\n parsed['request']['headers'][header.title()] = value\\n\\n # Re-assemble response line\\n parsed['response']['response_line'] = 'HTTP/1.1 %s %s' % (\\n response.status_code, response.reason)\\n\\n # Process response headers\\n for header in sorted([h.title() for h in response.headers]):\\n raw_value = response.headers[header]\\n value = self.parse_header(header, raw_value, 'response')\\n if value:\\n fixed_header = header.title().replace('Www', 'WWW')\\n parsed['response']['headers'][fixed_header] = value\\n\\n # Process response body\\n response.encoding = 'utf-8'\\n body = response.text\\n if self.standardize:\\n body = body.replace(api, self.doc_base_url)\\n for key, value in case.get('standardize', {}).items():\\n assert key in ('created', 'modified', 'date')\\n pattern = r\\\"\\\"\\\"(?x)(?s) # Be verbose, . include newlines\\n \\\"%s\\\":\\\\s\\\" # Key and quote\\n \\\\d{4}-\\\\d{2}-\\\\d{2} # Date\\n T\\\\d{2}:\\\\d{2}:\\\\d{2} # Time\\n \\\\.\\\\d{0,6}Z # Microseconds and UTC timezone\\n \\\", # End quote and comma\\n \\\"\\\"\\\" % key\\n replace = '\\\"%s\\\": \\\"%s\\\",' % (key, value)\\n body = re.sub(pattern, replace, body)\\n parsed['response']['body'] = body\\n\\n return parsed\",\n \"def get_init_response():\\n speechOutput = GET_INIT_MESSAGE \\n\\n return response(speech_response_ssml(speechOutput, False))\",\n \"def __init__(self, res):\\n self.fromResponseObj(res)\",\n \"def __init__(self, res):\\n self.fromResponseObj(res)\",\n \"def do_external_request(self, cmd, extra_payload):\\r\\n xmlstr = etree.tostring(self.xml, pretty_print=True)\\r\\n payload = {\\r\\n 'xml': xmlstr,\\r\\n 'edX_cmd': cmd,\\r\\n 'edX_tests': self.tests,\\r\\n 'processor': self.code,\\r\\n }\\r\\n payload.update(extra_payload)\\r\\n\\r\\n try:\\r\\n # call external server. TODO: synchronous call, can block for a\\r\\n # long time\\r\\n req = requests.post(self.url, data=payload)\\r\\n except Exception as err:\\r\\n msg = 'Error {0} - cannot connect to external server url={1}'.format(err, self.url)\\r\\n log.error(msg)\\r\\n raise Exception(msg)\\r\\n\\r\\n if self.capa_system.DEBUG:\\r\\n log.info('response = %s', req.text)\\r\\n\\r\\n if (not req.text) or (not req.text.strip()):\\r\\n raise Exception(\\r\\n 'Error: no response from external server url=%s' % self.url)\\r\\n\\r\\n try:\\r\\n # response is XML; parse it\\r\\n rxml = etree.fromstring(req.text)\\r\\n except Exception as err:\\r\\n msg = 'Error {0} - cannot parse response from external server req.text={1}'.format(err, req.text)\\r\\n log.error(msg)\\r\\n raise Exception(msg)\\r\\n\\r\\n return rxml\",\n \"def __connect_with_server(self,get_operatoin,server_reuest_type):\\n\\twhat_is_downloaded = server_reuest_type\\n\\tself.XML_String = None\\n\\tself.zip_string = None\\n\\ttry:\\n\\t conn = httplib.HTTPConnection(self.NAPISY24_url)\\n\\t conn.request(\\\"GET\\\", get_operatoin)\\n\\t r1 = conn.getresponse()\\n\\t print r1.status, r1.reason\\n\\t if what_is_downloaded == \\\"downloada_subtitle_list_by_film_name\\\" or what_is_downloaded == \\\"downloada_subtitle_list_by_IMDB\\\":\\n\\t\\tself.XML_String = r1.read()\\n\\t elif what_is_downloaded == \\\"download_subtilte_zip\\\":\\t\\t\\n\\t\\tself.zip_string = r1.read()\\n\\t return r1.status#, r1.reason\\n\\texcept (IOError, OSError), e:\\n\\t print >> sys.stderr, \\\"Napisy24.pl server connection error.\\\"\\n\\t time.sleep(0.5)\",\n \"def _scrape_response(self, headers, response):\\n # identify the responding server\\n server_type = None\\n server_string = headers.get(\\\"server\\\", \\\"\\\")\\n\\n if server_string and \\\"jetty\\\" in server_string.lower():\\n server_type = \\\"jetty\\\"\\n\\n if server_string and \\\"coyote\\\" in server_string.lower():\\n server_type = \\\"tomcat\\\"\\n\\n reason = None\\n full_html = \\\"\\\"\\n dom_tree = None\\n\\n # In Python3, response can be made of bytes\\n if IS_PY3 and hasattr(response, \\\"decode\\\"):\\n response = response.decode()\\n if response.startswith(\\\"<?xml\\\"):\\n # Try a strict XML parse\\n try:\\n soup = ElementTree.fromstring(response)\\n\\n reason_node = soup.find('lst[@name=\\\"error\\\"]/str[@name=\\\"msg\\\"]')\\n tb_node = soup.find('lst[@name=\\\"error\\\"]/str[@name=\\\"trace\\\"]')\\n if reason_node is not None:\\n full_html = reason = reason_node.text.strip()\\n if tb_node is not None:\\n full_html = tb_node.text.strip()\\n if reason is None:\\n reason = full_html\\n\\n # Since we had a precise match, we'll return the results now:\\n if reason and full_html:\\n return reason, full_html\\n except ElementTree.ParseError:\\n # XML parsing error, so we'll let the more liberal code handle it.\\n pass\\n\\n if server_type == \\\"tomcat\\\":\\n # Tomcat doesn't produce a valid XML response or consistent HTML:\\n m = re.search(r\\\"<(h1)[^>]*>\\\\s*(.+?)\\\\s*</\\\\1>\\\", response, re.IGNORECASE)\\n if m:\\n reason = m.group(2)\\n else:\\n full_html = \\\"%s\\\" % response\\n else:\\n # Let's assume others do produce a valid XML response\\n try:\\n dom_tree = ElementTree.fromstring(response)\\n reason_node = None\\n\\n # html page might be different for every server\\n if server_type == \\\"jetty\\\":\\n reason_node = dom_tree.find(\\\"body/pre\\\")\\n else:\\n reason_node = dom_tree.find(\\\"head/title\\\")\\n\\n if reason_node is not None:\\n reason = reason_node.text\\n\\n if reason is None:\\n full_html = ElementTree.tostring(dom_tree)\\n except SyntaxError as err:\\n LOG.warning( # NOQA: G200\\n \\\"Unable to extract error message from invalid XML: %s\\\",\\n err,\\n extra={\\\"data\\\": {\\\"response\\\": response}},\\n )\\n full_html = \\\"%s\\\" % response\\n\\n full_html = force_unicode(full_html)\\n full_html = full_html.replace(\\\"\\\\n\\\", \\\"\\\")\\n full_html = full_html.replace(\\\"\\\\r\\\", \\\"\\\")\\n full_html = full_html.replace(\\\"<br/>\\\", \\\"\\\")\\n full_html = full_html.replace(\\\"<br />\\\", \\\"\\\")\\n full_html = full_html.strip()\\n return reason, full_html\",\n \"def _get_request_parser(self, operation):\\n\\n wpsrequest = self\\n\\n def parse_get_getcapabilities(http_request):\\n \\\"\\\"\\\"Parse GET GetCapabilities request\\n \\\"\\\"\\\"\\n\\n acceptedversions = _get_get_param(http_request, 'acceptversions')\\n wpsrequest.check_accepted_versions(acceptedversions)\\n\\n def parse_get_describeprocess(http_request):\\n \\\"\\\"\\\"Parse GET DescribeProcess request\\n \\\"\\\"\\\"\\n version = _get_get_param(http_request, 'version')\\n wpsrequest.check_and_set_version(version)\\n\\n language = _get_get_param(http_request, 'language')\\n wpsrequest.check_and_set_language(language)\\n\\n wpsrequest.identifiers = _get_get_param(\\n http_request, 'identifier', aslist=True)\\n\\n def parse_get_execute(http_request):\\n \\\"\\\"\\\"Parse GET Execute request\\n \\\"\\\"\\\"\\n version = _get_get_param(http_request, 'version')\\n wpsrequest.check_and_set_version(version)\\n\\n language = _get_get_param(http_request, 'language')\\n wpsrequest.check_and_set_language(language)\\n\\n wpsrequest.identifier = _get_get_param(http_request, 'identifier')\\n wpsrequest.store_execute = _get_get_param(\\n http_request, 'storeExecuteResponse', 'false')\\n wpsrequest.status = _get_get_param(http_request, 'status', 'false')\\n wpsrequest.lineage = _get_get_param(\\n http_request, 'lineage', 'false')\\n wpsrequest.inputs = get_data_from_kvp(\\n _get_get_param(http_request, 'DataInputs'), 'DataInputs')\\n wpsrequest.outputs = {}\\n\\n # take responseDocument preferably\\n resp_outputs = get_data_from_kvp(\\n _get_get_param(http_request, 'ResponseDocument'))\\n raw_outputs = get_data_from_kvp(\\n _get_get_param(http_request, 'RawDataOutput'))\\n wpsrequest.raw = False\\n if resp_outputs:\\n wpsrequest.outputs = resp_outputs\\n elif raw_outputs:\\n wpsrequest.outputs = raw_outputs\\n wpsrequest.raw = True\\n # executeResponse XML will not be stored and no updating of\\n # status\\n wpsrequest.store_execute = 'false'\\n wpsrequest.status = 'false'\\n\\n if not operation:\\n raise MissingParameterValue('Missing request value', 'request')\\n else:\\n self.operation = operation.lower()\\n\\n if self.operation == 'getcapabilities':\\n return parse_get_getcapabilities\\n elif self.operation == 'describeprocess':\\n return parse_get_describeprocess\\n elif self.operation == 'execute':\\n return parse_get_execute\\n else:\\n raise OperationNotSupported(\\n 'Unknown request %r' % self.operation, operation)\",\n \"def __parse_response(self, response_text):\\n root = etree.fromstring(response_text)\\n namespace = re.search('{(.*)}', root.tag).group(1)\\n status_path = '{%s}Status' % namespace\\n status = int(root.findtext(status_path))\\n response = None\\n if status != 0:\\n response = Error(status, root, namespace)\\n else:\\n response = self._parse_response_body(root, namespace)\\n return response\",\n \"def parse(self, url):\\n pass\",\n \"def content_api_xml(url, request):\\n headers = {'content-type': 'application/xml'}\\n content = 'xml string'\\n return response(status_code=200,\\n content=content,\\n headers=headers,\\n request=request)\",\n \"def main():\\n\\n handler = PlanetSourceHandler()\\n\\n parser = xml.sax.make_parser()\\n parser.setFeature(xml.sax.handler.feature_namespaces, 1)\\n parser.setContentHandler(handler)\\n parser.parse(sys.stdin)\\n\\n print simplejson.JSONEncoder(indent=True).encode(handler.sources)\",\n \"def __init__(self):\\n \\n # The length of a name request in bytes\\n self.name_size = 32\\n \\n # The length of the checksum in bytes\\n self.chksum_size = 0\\n \\n # The length of the write flag element in bytes\\n self.wflag_size = 1\\n \\n # The length of the timestamp in bytes\\n self.time_size = 4\\n \\n # The length of a length request in bytes\\n self.length_size = 2\\n \\n # The leght of an ascii request in bytes\\n self.ascii_size = 128\\n \\n # boolean to keep track of command updating\\n self.no_commands = True\\n \\n # Default command list\\n self.SCPI_Data = {}\\n self.add_command('SUP:TEL? 0', '48', 'ascii')\\n self.add_command('SUP:TEL? 1', '8', 'long long')\\n self.add_command('SUP:TEL? 2', '8', 'long long')\\n self.add_command('SUP:TEL? 3', '2', 'uint')\\n self.add_command('SUP:TEL? 4', '22', 'long, long, int, int, int')\\n self.add_command('SUP:TEL? 5', '8', 'long long')\\n self.add_command('SUP:TEL? 6', '8', 'long long')\\n self.add_command('SUP:TEL? 7', '8', 'long long')\\n self.add_command('SUP:TEL? 8', '8', 'double')\\n \\n # Reset flag after initial updating\\n self.no_commands = True\\n \\n # list of errors thrown during the importing of the XML file\\n self.error_log = []\",\n \"def getxml(self, pmcid):\\n import requests\\n r = requests.get(\\n (self.xmlurl).format(pmcid=pmcid))\\n return r.content\",\n \"def process_monit_response(response):\\n for regex, replacement in xml_hacks:\\n response = re.sub(regex, replacement, response)\\n \\n if opts.debug:\\n print \\\"=\\\"*80\\n print \\\"| Monit response: \\\"\\n print \\\"=\\\"*80\\n print response\\n tree = xml.etree.ElementTree.fromstring(response)\\n for service in tree.findall('service'):\\n process_service(service)\\n for infokey in ['server/localhostname', 'server/version', \\n 'platform/name', 'platform/machine', 'platform/release', 'platform/version']:\\n infoval = tree.find(infokey)\\n if infoval is not None: system_info.append('%s'%infoval.text)\",\n \"async def text(self, encoding=\\\"utf-8\\\", errors=\\\"strict\\\"):\\n return self.response.decode(encoding, errors=errors)\",\n \"def load_xml(pmid, sleep=None):\\n link = \\\"https://eutils.ncbi.nlm.nih.gov/entrez/eutils/efetch.fcgi?db=pubmed&retmode=xml&id=%s\\\" % str(pmid)\\n page = requests.get(link)\\n tree = html.fromstring(page.content)\\n if sleep is not None:\\n time.sleep(sleep)\\n return tree\",\n \"def run(self):\\n import pxp # want to have fresh instance ???!\\n ans = {}\\n pu.mdbg.log(\\\"PXPWORKER started ------>cmd:{} cookie:{}\\\".format(self.cmd, self.cookie))\\n if (self.cmd=='tagset'):\\n ans = pxp.tagset(self.param)\\n elif (self.cmd=='tagmod'): \\n ans = pxp.tagmod(self.param)\\n elif (self.cmd=='teleset'): \\n ans = pxp.teleset(self.param)\\n elif (self.cmd=='sumset'): \\n ans = pxp.sumset(self.param)\\n elif (self.cmd=='sumget'): \\n ans = pxp.sumget(self.param)\\n elif (self.cmd=='rec_stat'):\\n self.rec_stat = {}\\n self.rec_stat = self.pxp_rec_stat()\\n self.done = True\\n ans['cookie'] = self.cookie\\n pu.mdbg.log(\\\"PXPHeler finished ------>cmd:{} param:{}\\\".format(self.cmd, self.param))\\n return\\n \\n ans['cookie'] = self.cookie\\n #resp = pu.disk.sockSendWait(\\\"AUP|\\\"+json.dumps(ans), addnewline=True, timeout=1)\\n pu.disk.sockSendWait(\\\"AUP|\\\"+json.dumps(ans), addnewline=True)\\n self.done = True\\n pu.mdbg.log(\\\"PXPHeler finished ------>cmd:{} cookie:{}\\\".format(self.cmd, self.cookie))\"\n]","isConversational":false},"negative_scores":{"kind":"list like","value":["0.592283","0.5827948","0.579195","0.5679414","0.5676833","0.5584127","0.55087835","0.54462636","0.54320216","0.5430315","0.53699476","0.53515357","0.5332319","0.53168535","0.52934587","0.52518004","0.5248539","0.52266735","0.52137244","0.52040625","0.52040625","0.5189555","0.518401","0.51805687","0.51778984","0.5160884","0.51528215","0.5135332","0.51283133","0.51184493","0.51177156","0.51099557","0.5095606","0.5095162","0.5092727","0.5088903","0.5087566","0.5073984","0.501787","0.49982917","0.49882218","0.49816078","0.49498454","0.49349907","0.4929965","0.4921399","0.4916523","0.49123165","0.4900088","0.48966917","0.48960155","0.48960155","0.48855954","0.4878196","0.4869181","0.486334","0.48614788","0.48531294","0.48512793","0.484958","0.48375636","0.48364902","0.48363653","0.4826731","0.4824518","0.48107472","0.4781905","0.47808623","0.47807145","0.4780298","0.47783986","0.47761586","0.47748068","0.47736514","0.47736478","0.47649682","0.47635716","0.47630095","0.47508192","0.47507855","0.47502777","0.47501776","0.4741996","0.47391772","0.4734851","0.47325778","0.47325778","0.47289357","0.4724157","0.47208914","0.47173145","0.47136855","0.4708109","0.47042125","0.46975267","0.46967784","0.46965924","0.46962583","0.46955046","0.46885613","0.4686194"],"string":"[\n \"0.592283\",\n \"0.5827948\",\n \"0.579195\",\n \"0.5679414\",\n \"0.5676833\",\n \"0.5584127\",\n \"0.55087835\",\n \"0.54462636\",\n \"0.54320216\",\n \"0.5430315\",\n \"0.53699476\",\n \"0.53515357\",\n \"0.5332319\",\n \"0.53168535\",\n \"0.52934587\",\n \"0.52518004\",\n \"0.5248539\",\n \"0.52266735\",\n \"0.52137244\",\n \"0.52040625\",\n \"0.52040625\",\n \"0.5189555\",\n \"0.518401\",\n \"0.51805687\",\n \"0.51778984\",\n \"0.5160884\",\n \"0.51528215\",\n \"0.5135332\",\n \"0.51283133\",\n \"0.51184493\",\n \"0.51177156\",\n \"0.51099557\",\n \"0.5095606\",\n \"0.5095162\",\n \"0.5092727\",\n \"0.5088903\",\n \"0.5087566\",\n \"0.5073984\",\n \"0.501787\",\n \"0.49982917\",\n \"0.49882218\",\n \"0.49816078\",\n \"0.49498454\",\n \"0.49349907\",\n \"0.4929965\",\n \"0.4921399\",\n \"0.4916523\",\n \"0.49123165\",\n \"0.4900088\",\n \"0.48966917\",\n \"0.48960155\",\n \"0.48960155\",\n \"0.48855954\",\n \"0.4878196\",\n \"0.4869181\",\n \"0.486334\",\n \"0.48614788\",\n \"0.48531294\",\n \"0.48512793\",\n \"0.484958\",\n \"0.48375636\",\n \"0.48364902\",\n \"0.48363653\",\n \"0.4826731\",\n \"0.4824518\",\n \"0.48107472\",\n \"0.4781905\",\n \"0.47808623\",\n \"0.47807145\",\n \"0.4780298\",\n \"0.47783986\",\n \"0.47761586\",\n \"0.47748068\",\n \"0.47736514\",\n \"0.47736478\",\n \"0.47649682\",\n \"0.47635716\",\n \"0.47630095\",\n \"0.47508192\",\n \"0.47507855\",\n \"0.47502777\",\n \"0.47501776\",\n \"0.4741996\",\n \"0.47391772\",\n \"0.4734851\",\n \"0.47325778\",\n \"0.47325778\",\n \"0.47289357\",\n \"0.4724157\",\n \"0.47208914\",\n \"0.47173145\",\n \"0.47136855\",\n \"0.4708109\",\n \"0.47042125\",\n \"0.46975267\",\n \"0.46967784\",\n \"0.46965924\",\n \"0.46962583\",\n \"0.46955046\",\n \"0.46885613\",\n \"0.4686194\"\n]","isConversational":false},"document_score":{"kind":"string","value":"0.0"},"document_rank":{"kind":"string","value":"-1"}}},{"rowIdx":10198,"cells":{"query":{"kind":"string","value":"Searching within a library section is much more powerful."},"document":{"kind":"string","value":"def search(self, query, mediatype=None):\n items = utils.listItems(self, '/search?query=%s' % quote(query))\n if mediatype:\n return [item for item in items if item.type == mediatype]\n return items"},"metadata":{"kind":"string","value":"{\n \"objective\": {\n \"self\": [],\n \"paired\": [],\n \"triplet\": [\n [\n \"query\",\n \"document\",\n \"negatives\"\n ]\n ]\n }\n}"},"negatives":{"kind":"list like","value":["def book_search(library: list) -> None:\n options = ['Author', 'Title', 'Publisher', 'Shelf', 'Category', 'Subject']\n prompt = '\\nWhat option would you like to search by?'\n choice = get_user_choice(options, prompt)\n if choice == '1':\n search_by_chosen_option(library, options[0])\n elif choice == '2':\n search_by_chosen_option(library, options[1])\n elif choice == '3':\n search_by_chosen_option(library, options[2])\n elif choice == '4':\n search_by_shelf(library)\n elif choice == '5':\n search_by_chosen_option(library, options[4])\n elif choice == '6':\n search_by_chosen_option(library, options[5])","def search():\n pass","def search(self, term):","def find_material(material):\n for libn,tdict in liblist:\n if material in tdict:\n print(libn)","def search(self, search):\n raise NotImplementedError","def find(self, egg):","def search_by_chosen_option(library: list, chosen_option: str) -> None:\n user_input = input(f'What is the name of the {chosen_option} you want to search for?')\n found_books = []\n for book in library:\n if user_input.lower() in str(getattr(book, chosen_option.lower())).lower():\n found_books.append(book)\n print(f'We found {len(found_books)} book(s) that matched this search in your library.\\n')\n for num, book in enumerate(found_books, 1):\n print(f'{num} - {book.__repr__()}')\n if len(found_books) > 0 and not return_to_main_menu():\n move_book(library, found_books)","def search_by_shelf(library: list) -> None:\n user_input = input(f'What is the number/name of the shelf you want to search for?')\n found_books = []\n for book in library:\n if user_input.lower() == str(getattr(book, 'shelf')).lower():\n found_books.append(book)\n print(f'We found {len(found_books)} book(s) that matched this search in your library.\\n')\n for num, book in enumerate(found_books, 1):\n print(f'{num} - {book.__repr__()}')\n if len(found_books) > 0 and not return_to_main_menu():\n move_book(library, found_books)","def library_searched():\n\n searched_result = []\n \n updated_books = duplicated_code()\n\n if request.method == 'POST':\n if request.form['type_search'] == 'book':\n book_title = request.form['search']\n for book in updated_books:\n if book['title'] == book_title:\n searched_result.append(book)\n return render_template(\"library_searched.html\", result = searched_result)\n elif request.form['type_search'] == 'genre':\n book_genre = request.form['search']\n for book in updated_books:\n if book['genre'] == book_genre:\n searched_result.append(book)\n return render_template(\"library_searched.html\", result = searched_result)\n elif request.form['type_search'] == 'author':\n book_author = request.form['search']\n for book in updated_books:\n if book['author_name'] == book_author:\n searched_result.append(book)\n return render_template(\"library_searched.html\", result = searched_result)\n else:\n return render_template(\"library_searched.html\")","def keywords_of_section(self, section, kwfilter):\n pcat = getToolByName(section, 'portal_catalog')\n cat = pcat._catalog\n path_idx = cat.indexes[self.path_index]\n tags_idx = cat.indexes[self.keyword_index]\n result = []\n # query all oids of path - low level\n pquery = {\n self.path_index: {\n 'query': '/'.join(section.getPhysicalPath()),\n 'depth': -1,\n }\n }\n kwfilter = safe_encode(kwfilter)\n # uses internal zcatalog specific details to quickly get the values.\n path_result, info = path_idx._apply_index(pquery)\n for tag in tags_idx.uniqueValues():\n if kwfilter and kwfilter not in safe_encode(tag):\n continue\n tquery = {self.keyword_index: tag}\n tags_result, info = tags_idx._apply_index(tquery)\n if intersection(path_result, tags_result):\n result.append(tag)\n # result should be sorted, because uniqueValues are.\n return safe_simplevocabulary_from_values(result)","def search(self, *args, **kwargs): # real signature unknown\n pass","def list(full, field):\n\n short = not full \n\n libraries = select(l for l in Library if l)[:]\n libraries = natsorted(libraries, key=lambda x : attrgetter('name')(x).lower())\n\n if len(libraries) == 0:\n logger.info(\"[!] No libraries available to list.\") \n logger.info(\" Consider run the following command:\")\n logger.info(\" $ apkg init\")\n return \n\n\n\n orderFields = [ \n #, \"library\"\n #, \"sha\"\n \"description\"\n # , \"license\"\n # , \"include\"\n # , \"depend\"\n # , \"testedWith\"\n , \"keywords\"\n # , \"installed\"\n # , \"cached\"\n # , \"fromIndex\"\n # , \"fromUrl\"\n # , \"fromGit\"\n , \"origin\"\n # , \"default\"\n ]\n\n i = 0\n if short and field == \"\":\n logger.info(\"{:<20.20} {:<15.20} {:.72}\"\n .format(\"Library name\", \"Latest version\", \"URL\"))\n logger.info(\"-\"*105)\n\n for library in libraries:\n v = library.getLatestVersion() \n if v is not None:\n if not short:\n\n logger.info(v.library.name)\n logger.info(\"=\"*len(v.library.name))\n\n info = v.info\n\n for k in orderFields: \n val = info.get(k, None)\n if val is not None or val != \"\" or len(val) > 0:\n click.echo(\"{0}: {1}\".format(k,val))\n\n vs = ','.join(str(ver) for ver in v.library.versions)\n \n if len(vs) > 0:\n print(\"Versions:\", vs)\n \n else:\n if field in listFields:\n if field == \"name\":\n print(v.library.name)\n elif field == \"version\":\n print(v.name)\n else:\n print(v.library.url)\n else:\n print(\"{:<20.20} {:<15.20} {:.72}\"\n .format(v.library.name,v.name,v.library.url))\n\n i += 1\n if not short and i < len(libraries):\n logger.info(\"\")","def search():\n import booksearch as bs\n\n opt = var.get()\n term = searchBox.get()\n term2 = dateBox.get()\n\n # Case statement (substitute) for different search areas\n # Each key is an option in the OptionMenu\n searchBy = {\n \"Title & Author\" : bs.search(term),\n \"ID\" : bs.bookID(term),\n \"Date\" : bs.dateRange(term, term2),\n }\n query = searchBy[opt] # Make & stores a query (2D list)\n\n # Repopulates table\n if term != \"\":\n populate(query)","def runSearch():\n\tglobal processLanguageOn\n\tdataToFind=getDataFromWidget(podSearchEntry)\n\t#Search through the keys otherwise data changes\n\tdataSource=podListbox.data.keys()\n\t#Store the results of the search\n\tresults=[]\n\t#Search the data source\n\tfor item in dataSource:\n\t\tif searchDataSource(dataToFind,[item],capital=True,full=False):\n\t\t\tresults.append(item)\n\n\t#Add the results to screen\n\tpodListbox.delete(0,END)\n\tfor item in results:\n\t\tpodListbox.addExisting(item)\n\n\tif processLanguageOn:\n\t\tprocessSearchLanguage(podSearchEntry)","def search_main() -> None:\n\n logger.info(\"Starting search\")\n links = run_search(grab_search_info())\n if links:\n logger.info(\"Printing links\")\n for key in links:\n print(f\"{key.upper()}: {links[key]}\")","def search(self, *args, **kwargs):","def recognize_lib(self, a, lib):\n logging.debug(\"in recognize lib\")\n self.produce(KEYWORD, lib)\n self.begin('lib')","def search(query_string):","def searchLib(self, logger):\n # Now search\n self._version_strings = []\n self._sanity_exists = False\n for bin_str in self._all_strings:\n # we have a match\n if self.VERSION_STRING in str(bin_str):\n version_string = str(bin_str)\n # valid match\n logger.debug(\"Located a version string of %s in address 0x%x\", self.NAME, bin_str.ea)\n # save the string for later\n self._version_strings.append(version_string)\n # check the sanity string\n if self.SANITY_STRING in str(bin_str):\n self._sanity_exists = True\n\n # return the result\n if self._sanity_exists and len(self._version_strings) == 0:\n return 1\n else:\n return len(self._version_strings)","def within_book_search_json(request, book_id):\n query = request.GET.get('q')\n term = query # todo: meta options?\n book = Book.objects.get(pk=book_id)\n\n if not query or len(query) < 3:\n return\n\n # todo: method on objectmanager to search by keyword\n notes = book.notes.filter(\n Q(subject__icontains=term) |\n Q(quote__icontains=term) |\n Q(comment__icontains=term)\n )\n terms = book.terms.filter(\n Q(term__text__icontains=term) |\n Q(term__definition__icontains=term) |\n Q(quote__icontains=term) |\n Q(quote__icontains=term)\n )\n sections = book.sections.filter(\n Q(title__icontains=term) |\n Q(authors__name__icontains=term) |\n Q(subtitle__icontains=term) |\n Q(summary__icontains=term)\n )\n\n results = {'notes': [], 'terms': [], 'sections': []}\n for note in notes:\n results['notes'].append({\n 'title': highlighter.highlight(note.subject, query),\n 'description': highlighter.highlight(note.quote, query, 200),\n 'price': note.get_page_display(),\n 'url': note.get_absolute_url(),\n })\n\n for term in terms:\n results['terms'].append({\n 'title': highlighter.highlight(term.term.text, query),\n 'description': highlighter.highlight(term.quote, query, 200),\n 'price': term.get_page_display(),\n 'url': term.get_absolute_url(),\n })\n\n for section in sections:\n authors = ', '.join(a.name for a in section.authors.all())\n results['sections'].append({\n 'title': highlighter.highlight(section.title, query),\n 'description': highlighter.highlight(authors, query),\n 'price': section.get_page_display(),\n 'url': section.get_absolute_url(),\n })\n\n return JsonResponse({\n 'results': {\n 'books': {\n 'name': 'Notes',\n 'results': results['notes'],\n },\n 'authors': {\n 'name': 'Terms',\n 'results': results['terms'],\n },\n 'sections': {\n 'name': 'Sections',\n 'results': results['sections'],\n },\n }\n })","def search(self, query):","def advanced_search(self, pattern):\n pass","def library():\n finder = LibraryFinder()\n p = finder.find()\n return p if p else ''","def search_for_books(main_page): # Add information to the printout if the book is rented\n\n type_of_search = 0\n\n header = \"\"\"\n Do you want to search for books by the first letter of the title\n or by the type?\n \"\"\"\n search_choices= (\n (\"To search by letter\", search_by_letter),\n (\"To search by type\", search_by_type),\n (\"To exit\",exit.exit_to_main)\n )\n\n book_search = Screen(header,search_choices,\n main_page.login, main_page.password)\n book_search.activate()","def search(collection_of_books: tuple, search_tag: str, search_keyword: str) -> list:\r\n found_books = []\r\n\r\n if search_tag == \"Shelf\" and search_keyword.isnumeric():\r\n found_books = [book for book in collection_of_books if search_keyword == book[\"Shelf\"]]\r\n\r\n else:\r\n for book in collection_of_books:\r\n if search_keyword.lower() in book[search_tag].lower():\r\n found_books.append(book)\r\n\r\n return found_books","def search_keyword(self,keyword):\n for entry in self.available_fields_list:\n for x in entry:\n if keyword in x:\n print(entry)\n break\n return","def search(self, word):","def searchRef(self, searchStr):\n filter = []\n attr = self.__listAttr()\n for name in attr:\n if searchStr.lower() in name.lower():\n doc = getattr(self, name)\n filter.append([name, doc]) \n # if in gloss, search for synonymes\n elif name in self.__glossIndex.keys():\n for altName in self.__glossIndex[name]['syn']:\n if searchStr in altName or altName in searchStr:\n doc = getattr(self, name)\n filter.append([name, doc])\n break\n \n return filter","def find(self, p):\n pass","def processSearchResult(self):","def library_search_path(self, pedantic=False):\n return []","def search_books_body(collection_of_books: tuple) -> list:\r\n search_tag, search_keyword = search_info()\r\n try:\r\n found_books = search(collection_of_books, search_tag, search_keyword)\r\n except KeyError as err:\r\n print(f\"Invalid input: {err}\\n\"\r\n f\"{err} raised KeyError. Please follow the instruction carefully.\\n\")\r\n else:\r\n print_as_ordered_list(found_books)\r\n\r\n return found_books","def lookup():","def find_book(code: str) -> Dict:\n pass","def _load_keywords(self, collection_id, path=None, libdoc=None):\n if libdoc is None and path is None:\n raise(Exception(\"You must provide either a path or libdoc argument\"))\n\n if libdoc is None:\n libdoc = LibraryDocumentation(path)\n\n if len(libdoc.keywords) > 0:\n for keyword in libdoc.keywords:\n self._add_keyword(collection_id, keyword.name, keyword.doc, keyword.args)","def search(self, key, headers=Headers()):","def has_library(self, library_id, ignore_case=False, **kwargs): # lint-amnesty, pylint: disable=unused-argument\n if not isinstance(library_id, LibraryLocator):\n return None\n\n index = self.get_course_index(library_id, ignore_case)\n if index:\n return LibraryLocator(index['org'], index['course'], library_id.branch)\n return None","def search_doc(ix, to_search):\n with ix.searcher() as searcher:\n results = searcher.more_like(None, 'code', text=return_unicode(to_search), top=DOCS_TO_FIND)\n info = []\n for res in results:\n q_id = res.fields()['question_id']\n score = res.score\n code = res.fields()['code']\n info += [(q_id, res, code)]\n return info","def search_file(path, regex, ignore_case, include_undefined, printer):\n re_flags = re.IGNORECASE if ignore_case else 0\n object_files = parse_file(path)\n results = []\n for object_file in object_files:\n for symbol in object_file.symbols:\n if not include_undefined and not symbol.is_defined:\n continue\n if re.search(regex, symbol.name, flags=re_flags):\n results.append(SearchResult(SymbolMatch(symbol, regex, ignore_case),\n ObjectFileLocation(object_file)))\n printer.print_results(results)","def search_for_books(search_criteria, product_url, headers):\n\tprint \"od api in search_for_books \"\n\tlist_of_books = []\n\tlist_book = []\n\tq = search_criteria\n\tlimit = 300\t\t# 25 by default 300 max\n\toffset = 0\t\t# number of titles to skip\n\tformats = \"\"\n\tsort = \"Author:desc\" \t\t# :desc\n\tlastupdatetime = \"\" \n\tseries = \"\" \n\tsearch_parms = \"?q=%s&limit=%s&offset=0&formats=%s&sort=%s\" % (q, limit, \n\t\t\t\t\t\t\t\t\t\t\t\t\t\t\t\t formats, \n\t\t\t\t\t\t\t\t\t\t\t\t\t\t\t\t sort)\n\tod_url=\"%s%s\" % (product_url, search_parms)\n\n\tprint \"overdrive url = \", od_url, \"\\n\"\n\tod_url = od_url.replace(' ', '%20')\n\tbook_response = requests.get(od_url, headers=headers)\n\n\tprint \"book search response == \", book_response, \"reason = \", book_response.reason, \"\\n\"\n\tif book_response.status_code == 401:\n\t print \"Patron is not authorize to use this library == \", od_url, \"\\n\"\n\telif book_response.status_code > 201:\n\t\tprint \"Get request failed == \", book_response.reason\n\telif book_response.status_code == 200 or book_response.status_code == 201:\n\t\tprint \"Get request to get the a list of books was successful\", \"\\n\"\n\n\t\tbook_response_data = json.loads(book_response.content)\n\t\tprint \"OverDrive book count == \", book_response_data['totalItems'], \"\\n\"\n\n\t\tif book_response_data['totalItems'] > 0:\n\t\t\tproducts = book_response_data['products']\n\t\t\tfor product in products:\n\t\t\t\tbook_data = {}\t\n\t\t\t\tbook_data['images'] = product['images']['thumbnail']['href']\n\t\t\t\tbook_data['title'] = product['title']\n\t\t\t\tbook_data['author'] = product['primaryCreator']['name']\n\t\t\t\tbook_data['availableToDownload'] = product['links']['availability']['href']\n\t\t\t\tbook_data['id'] = product['id']\n\t\t\t\tbook_data['metadata'] = product['links']['metadata']['href']\n\t\t\t\tbook_data['origin'] = 'ODCOM'\n\t\t\t\tlist_book = [book_data]\n\t\t\t\tlist_of_books.extend(list_book)\n\t\t\t#end for\n\t\t#end if\n\t#end if\n\n\treturn list_of_books","def search(self):\n query = self.get_request_arg(\"query\")\n if query:\n album = self.ctrl.library.search(query)\n return self.resp_from_data(album)\n return self.resp_from_data(\n {\"message\": \"No query parameters specified\"}, 400)","def find_all(self):","def shortsearch(term,location):\n results = search(term,location)['listings']\n result = []\n for business in results:\n result.append([business['id'],business['name'],\"Yellow Pages\"])\n return result","def search(words):\n\tglobal books\n\tglobal word_count\n\tglobal titles\n\n\ttry:\n\t\t#index for titles and dictionary of books\n\t\ti = 0\n\t\t#condition for word not found\n\t\tif word_count.get(words) == None:\n\t\t\tprint(\"The word {} does not appear in any books in the library.\".format(words))\n\t\t\treturn\n\n\t\tfor vals in word_count[words]:\n\t\t\t# #if book index was empty - case where url was not active - index was removed - increase index\n\t\t\t# while(books.get(j) == None):\n\t\t\t# \tj += 1\n\t\t\t#print the count\n\t\t\tif(vals == 1):\n\t\t\t\tprint(\"The word {} appears {} time in {} (link: {})\".format(words,vals,titles[i],books[i]))\n\t\t\telif(vals == 0):\n\t\t\t\tcontinue\n\t\t\telse:\n\t\t\t\tprint(\"The word {} appears {} times in {} (link: {})\".format(words,vals,titles[i],books[i]))\n\t\t\t#increase index values\n\t\t\ti += 1\n\texcept:\n\t\tprint(\"Error while searching for word.\")","def search(self, find_val):\n return False","def search(isamAppliance, realm, subsection, check_mode=False, force=False):\n logger.info(\"subsection to search under: {0} is: {1} \".format(realm, subsection))\n ret_obj = realms.get(isamAppliance, realm)\n return_obj = isamAppliance.create_return_object()\n return_obj[\"warnings\"] = ret_obj[\"warnings\"]\n\n for obj in ret_obj['data']:\n if obj['type'] == \"section\":\n if obj['name'] == subsection:\n logger.info(\"Found Kerberos realm subsection {0} id: {1}\".format(subsection, obj['id']))\n return_obj['data'] = obj\n return_obj['rc'] = 0\n break\n\n return return_obj","def search(self, searchstring):\n return {}","def search(self, value):\n pass","def test_get_foods_search(self):\n pass","def ahocorasick_test():\n tree = ahocorasick.KeywordTree()\n tree.add(\"alpha\")\n tree.add(\"alpha beta\")\n tree.add(\"gamma\")\n\n tree.make()\n\n result = tree.search(\"I went to alpha beta the other day to pick up some \\\n spam\")\n print(result)\n\n result = tree.search_long(\"I went to alpha beta the other day to pick up \\\n some spam\")\n print(result)\n\n result = tree.search(\"and also got some alphabet soup\")\n print(result)\n\n result = tree.search(\"but no waffles\")\n print(result)\n\n result = tree.search_long(\"on, gamma rays are not tasty\")\n print(result)\n\n result = tree.findall(\"I went to alpha beta to pick up alphabet soup\")\n for match in result:\n print(match)","def parSearch(self, mode=False):\r\n # research\r\n profprint()\r\n w = slicer.modules.NeedleFinderWidget\r\n l = w.logic\r\n path = [ 0 for i in range(100)]\r\n \r\n if 0:\r\n path[24] = '/Users/guillaume/Dropbox/AMIGO Gyn Data NRRD/Case 24 NRRD/Manual/2013-02-25-Scene-without-CtrPt.mrml'\r\n path[29] = '/Users/guillaume/Dropbox/AMIGO Gyn Data NRRD/Case 29 NRRD/Manual/2013-02-26-Scene-without-CtrPts.mrml'\r\n path[30] = '/Users/guillaume/Dropbox/AMIGO Gyn Data NRRD/Case 30 NRRD/Manual/2013-02-26-Scene-without-CtrPt.mrml'\r\n path[31] = '/Users/guillaume/Dropbox/AMIGO Gyn Data NRRD/Case 31 NRRD/Manual/2013-02-27-Scene-without-CtrPts.mrml'\r\n path[34] = '/Users/guillaume/Dropbox/AMIGO Gyn Data NRRD/Case 34 NRRD/Manual/2013-02-27-Scene-without-CtrPts.mrml'\r\n path[35] = '/Users/guillaume/Dropbox/AMIGO Gyn Data NRRD/Case 35 NRRD/Manual/2013-02-27-Scene-without-CtrPts.mrml'\r\n path[37] = '/Users/guillaume/Dropbox/AMIGO Gyn Data NRRD/Case 37 NRRD/Manual/2013-02-27-Scene-without-CtrPts.mrml'\r\n path[38] = '/Users/guillaume/Dropbox/AMIGO Gyn Data NRRD/Case 38 NRRD/Manual/2013-02-27-Scene-without-CtrPts.mrml'\r\n path[40] = '/Users/guillaume/Dropbox/AMIGO Gyn Data NRRD/Case 40 NRRD/Manual/2013-02-27-Scene-without-CtrPts.mrml'\r\n\r\n #Andre's file system (case copies from AMIGO share)\r\n # stripped OTHER cases\r\n if 0: path[33] = '/home/mastmeyer/Dropbox/GYN Cases/Case 033/NRRD/Auto-Eval-LB/2013-02-27-Scene.mrml'\r\n if 0:\r\n path[ 8] = '/home/mastmeyer/Dropbox/GYN Cases/Case 008/NRRD/Auto-Eval-LB/2013-05-07-Scene.mrml'\r\n path[12] = '/home/mastmeyer/Dropbox/GYN Cases/Case 012/NRRD/Auto-Eval-LB/2013-04-22-Scene.mrml'\r\n path[16] = '/home/mastmeyer/Dropbox/GYN Cases/Case 016/NRRD/Auto-Eval-LB/2013-04-21-Scene.mrml'\r\n path[21] = '/home/mastmeyer/Dropbox/GYN Cases/Case 021/NRRD/Auto-Eval-LB/2013-04-21-Scene.mrml'\r\n path[22] = '/home/mastmeyer/Dropbox/GYN Cases/Case 022/NRRD/Auto-Eval-LB/2013-04-21-Scene.mrml'\r\n path[25] = '/home/mastmeyer/Dropbox/GYN Cases/Case 025/NRRD/Auto-Eval-LB/2013-04-21-Scene.mrml'\r\n path[26] = '/home/mastmeyer/Dropbox/GYN Cases/Case 026/NRRD/Auto-Eval-LB/2013-04-17-Scene.mrml'\r\n path[27] = '/home/mastmeyer/Dropbox/GYN Cases/Case 027/NRRD/Auto-Eval-LB/2013-04-17-Scene.mrml'\r\n #stripped MICCAI13 cases (just manual seg. by LB/AM)\r\n if 1:\r\n path[24] = '/home/mastmeyer/Dropbox/GYN Cases/Case 024/NRRD/Auto-Eval-LB/2013-02-28-Scene.mrml'\r\n path[28] = '/home/mastmeyer/Dropbox/GYN Cases/Case 028/NRRD/Auto-Eval-LB/2013-02-28-Scene.mrml'\r\n path[29] = '/home/mastmeyer/Dropbox/GYN Cases/Case 029/NRRD/Auto-Eval-LB/2013-02-26-Scene.mrml'\r\n path[30] = '/home/mastmeyer/Dropbox/GYN Cases/Case 030/NRRD/Auto-Eval-LB/2013-02-26-Scene.mrml'\r\n path[31] = '/home/mastmeyer/Dropbox/GYN Cases/Case 031/NRRD/Auto-Eval-LB/2013-02-27-Scene.mrml'\r\n path[33] = '/home/mastmeyer/Dropbox/GYN Cases/Case 033/NRRD/Auto-Eval-LB/2013-02-27-Scene.mrml'\r\n path[34] = '/home/mastmeyer/Dropbox/GYN Cases/Case 034/NRRD/Auto-Eval-LB/2013-02-27-Scene.mrml'\r\n path[37] = '/home/mastmeyer/Dropbox/GYN Cases/Case 037/NRRD/Manual Alireza/2013-02-27-Scene.mrml'\r\n path[38] = '/home/mastmeyer/Dropbox/GYN Cases/Case 038/NRRD/Manual Alireza/2013-02-27-Scene.mrml'\r\n path[40] = '/home/mastmeyer/Dropbox/GYN Cases/Case 040/NRRD/Manual Alireza/2013-02-27-Scene.mrml'\r\n #show a directory selector for saving the results\r\n self.dirDialog = qt.QFileDialog(w.parent)\r\n self.dirDialog.setDirectory('/tmp')\r\n self.dirDialog.options = self.dirDialog.ShowDirsOnly\r\n self.dirDialog.acceptMode = self.dirDialog.AcceptSave\r\n #self.dirDialog.show()\r\n dir=self.dirDialog.getExistingDirectory()\r\n w.logDir=dir\r\n print \"saving results to \", dir\r\n try: shutil.copyfile('/home/amast/WualaDrive/mastmeyer/Homes/NeedleFinder/NeedleFinder/NeedleFinder.py',dir+'/NeedleFinder_ref.py')\r\n except: breakbox(\"/!\\ reference source NeedleFinder.py not found!\")\r\n if mode == 0:\r\n #save a copy of the source file as reference\r\n # simple run with current parameters/algo over several patients\r\n self.writeTableHeader(dir+'/AP-All_stats.csv')\r\n filLog=open(dir+'/allog.tsv', 'w')\r\n #filLog.write(\"case\\tman.-seg_\\tiStep\\tcrit\\treject\\tvalue\\tlimit\\n\")\r\n filLog.close()\r\n nUsers=1 #CONST\r\n for user in range(nUsers): \r\n w.userNr=user\r\n print \"simulated user (offset): \",user\r\n for id in range(100): #<o> range(100)\r\n if path[id]:\r\n w.caseNr=id\r\n print \"processing \", path[id]\r\n self.writeTableHeader(dir+'/User-'+str(user)+'_AP-' + str(id) + '.csv', 1)\r\n slicer.mrmlScene.Clear(0)\r\n slicer.util.loadScene(path[id])\r\n #TODO implement random tips in a sphere (d=2mm) from tube center \r\n l.startValidation(script=True, offset=user*50/nUsers)\r\n results, outliers = l.evaluate(script=True) # calculate HD distances\r\n for result in results:\r\n result[0:0]=[user,id]\r\n l.exportEvaluation(results, dir+'/User-'+str(user)+'_AP-' + str(id) + '.csv')\r\n #slicer.util.saveScene(dir+'/AP-' + str(id) + '.mrb') # may use lots of disk space\r\n # stats\r\n HD = np.array(results)\r\n # HD.shape = (int(len(results)/float(3)),3)\r\n maxTipHD = HD[:, 2].max()\r\n maxHD = HD[:, 3].max()\r\n avgHD = HD[:, 3].mean()\r\n stdHD = HD[:, 3].std()\r\n sl = np.sort(HD[:, 3])\r\n medHD = sl[sl.size / 2]\r\n resultsEval = [user,id,maxTipHD, maxHD, avgHD, stdHD, medHD]+[len(results)]+[len(outliers)] +[str(outliers)]+ l.valuesExperience + [id]\r\n l.exportEvaluation(resultsEval, dir+'/AP-All_stats.csv')\r\n #pause()\r\n msgbox(\"parSearch mode 0 done, results in \"+dir)\r\n elif mode == 1:\r\n id = 'Current'\r\n # simple brute force search in the dimensions (Guillaumes parameterSearch.py)\r\n self.writeTableHeader(dir+'/BF-' + str(id) + '.csv', 1)\r\n self.writeTableHeader(dir+'/BF-' + str(id) + '_stats.csv')\r\n for i in range(3, 12):\r\n # l.resetNeedleDetection(script=True) # ??? this resets the parameters to default\r\n w.numberOfPointsPerNeedle.setValue(i) # change parameter control points\r\n l.startValidation(script=True)\r\n results, outliers = l.evaluate(script=True) # calculate HD distances\r\n for result in results:\r\n result[0:0]=[user,id]\r\n l.exportEvaluation(results, dir+'/BF-' + str(id) + '.csv')\r\n slicer.util.saveScene(dir+'/BF-' + str(id) + '.mrb') # may use lots of disk space\r\n # stats\r\n HD = np.array(results)\r\n # HD.shape = (int(len(results)/float(3)),3)\r\n maxTipHD = HD[:, 2].max()\r\n maxHD = HD[:, 3].max()\r\n avgHD = HD[:, 3].mean()\r\n stdHD = HD[:, 3].std()\r\n sl = np.sort(HD[:, 3])\r\n medHD = sl[sl.size / 2]\r\n resultsEval = [user,id,maxTipHD,maxHD, avgHD, stdHD, medHD] +[len(results)]+[len(outliers)] +[str(outliers)]+ l.valuesExperience + [id]\r\n l.exportEvaluation(resultsEval, dir+'/BF-' + str(id) + '_stats.csv')\r\n #pause()\r\n msgbox(\"parSearch mode 1 done, results in \"+dir)\r\n elif mode == 2:\r\n # code piece from Guillaumes (bruteForce.py) multi patient mode search\r\n for id in range(100):\r\n if path[id]:\r\n w.caseNr=id\r\n print \"processing \", path[id]\r\n slicer.mrmlScene.Clear(0)\r\n slicer.util.loadScene(path[id])\r\n self.writeTableHeader(dir+'/RS-' + str(id) + '.csv', 1)\r\n self.writeTableHeader(dir+'/RS-' + str(id) + '_stats.csv')\r\n for i in range(1, 10000):\r\n # l.resetNeedleDetection(script=True) # ??? this resets the parameters to default\r\n w.radiusNeedleParameter.setValue(np.random.randint(1, 6))\r\n w.stepsize.setValue(np.random.randint(1, 40))\r\n w.sigmaValue.setValue(np.random.randint(1, 40)) # change parameter sigma\r\n w.gradientPonderation.setValue(np.random.randint(1, 20))\r\n w.exponent.setValue(np.random.randint(1, 20))\r\n w.numberOfPointsPerNeedle.setValue(np.random.randint(3, 11))\r\n l.startValidation(script=True)\r\n results, outliers = l.evaluate(script=True) # calculate HD distances\r\n for result in results:\r\n result[0:0]=[user,id]\r\n l.exportEvaluation(results, dir+'/RS-' + str(id) + '.csv')\r\n slicer.util.saveScene(dir+'/RS-' + str(id) + '.mrb') # may use lots of disk space\r\n # stats\r\n HD = np.array(results)\r\n maxTipHD = HD[:, 2].max()\r\n maxHD = HD[:, 3].max()\r\n avgHD = HD[:, 3].mean()\r\n stdHD = HD[:, 3].std()\r\n sl = np.sort(HD[:, 3])\r\n medHD = sl[sl.size / 2]\r\n resultsEval = [user,id,maxTipHD,maxHD, avgHD, stdHD, medHD] +[len(results)]+[len(outliers)] +[str(outliers)]+ l.valuesExperience + [id]\r\n l.exportEvaluation(resultsEval, dir+'/RS-' + str(id) + '_stats.csv')\r\n # end = time.time()\r\n # print 'processing time: ', end-start\r\n # start = time.time()\r\n #pause()\r\n msgbox(\"parSearch mode 2 done, results in \"+dir)\r\n #rof id\r\n #file mode 2\r\n slicer.mrmlScene.Clear(0) #clean up to save memory\r","def test_search_and(self):\n pkgs = [\n make_package(factory=DynamoPackage),\n make_package(\n \"somepackage\",\n version=\"1.3\",\n filename=\"mypath3\",\n summary=\"this is mypkg\",\n factory=DynamoPackage,\n ),\n make_package(\"mypkg2\", \"1.3.4\", \"my/other/path\", factory=DynamoPackage),\n make_package(\"package\", factory=DynamoPackage),\n ]\n self._save_pkgs(*pkgs)\n criteria = {\"name\": [\"my\", \"pkg\"], \"summary\": [\"this\", \"mypkg\"]}\n packages = self.db.search(criteria, \"and\")\n self.assertCountEqual(packages, pkgs[:-1])","def find_library_tab(self, tab):\n if tab in self._FIXED_TABS:\n tabloc = self._fixed_library_region()\n elif tab in self._MOVEABLE_TABS:\n tabloc = self._moveable_library_region()\n elif tab in self._EXPANDABLE_TABS:\n tabloc = self._expandable_tab_region(tab) \n else:\n print \"%s is an unrecognized library tab\" % tab\n click(Pattern(self._FIXED_LIB_TABS_IMG).similar(0.5))\n if tabloc.exists(tab, 2):\n return Region(tabloc.getLastMatch())\n else: \n type(Key.DOWN)\n tabloc.find(tab)\n return Region(tabloc.getLastMatch())","def test_index_libraries(self):\n result1 = self._create_library(slug=\"test-lib-index-1\", title=\"Title 1\", description=\"Description\")\n result2 = self._create_library(slug=\"test-lib-index-2\", title=\"Title 2\", description=\"Description\")\n\n for result in [result1, result2]:\n library_key = LibraryLocatorV2.from_string(result['id'])\n response = ContentLibraryIndexer.get_items([library_key])[0]\n\n assert response['id'] == result['id']\n assert response['title'] == result['title']\n assert response['description'] == result['description']\n assert response['uuid'] == result['bundle_uuid']\n assert response['num_blocks'] == 0\n assert response['version'] == result['version']\n assert response['last_published'] is None\n assert response['has_unpublished_changes'] is False\n assert response['has_unpublished_deletes'] is False","def test_search_and(self):\n pkgs = [\n make_package(factory=SQLPackage),\n make_package(\n \"somepackage\",\n version=\"1.3\",\n filename=\"mypath3\",\n summary=\"this is mypkg\",\n factory=SQLPackage,\n ),\n make_package(\"mypkg2\", \"1.3.4\", \"my/other/path\", factory=SQLPackage),\n make_package(\"package\", factory=SQLPackage),\n ]\n self.sql.add_all(pkgs)\n criteria = {\"name\": [\"my\", \"pkg\"], \"summary\": [\"this\", \"mypkg\"]}\n packages = self.db.search(criteria, \"and\")\n self.assertCountEqual(packages, pkgs[:-1])","def assets_search(ctx, text, pretty):\n ocean = ctx.obj['ocean']\n response = ocean.search(text, pretty)\n echo(response)","def test_autocomplete_recipe_search(self):\n pass","def search(self, pattern):\n raise NotImplementedError()","def examineLoadLibrary(lib):\n from PyJobTransformsCore.envutil import examine_library\n\n # turn module name into library name\n if not lib.startswith('lib') and not lib.endswith('.so'):\n lib = 'lib' + lib + '.so'\n print (\"Examining library \" + lib)\n diagLines = []\n errorAcronym = None\n missingSystemLibs = []\n missingOtherLibs = []\n misLibs = examine_library(lib)\n for l in misLibs:\n if systemLibsRE.search(l):\n missingSystemLibs.append(l)\n else:\n missingOtherLibs.append(l)\n if missingSystemLibs:\n if len(missingSystemLibs) == 1: libWord = 'library'\n else: libWord = 'libraries'\n diagLines.append( 'Site problem: Missing system %s: %s' % (libWord, ','.join(missingSystemLibs)) )\n if not errorAcronym: errorAcronym = \"ATH_SITE_SYSLIBS\"\n\n if missingOtherLibs:\n if len(missingOtherLibs) == 1: libWord = 'library'\n else: libWord = 'libraries'\n diagLines.append( 'Can not find %s: %s Please check software installation.' % (libWord,','.join(missingOtherLibs)) )\n if not errorAcronym: errorAcronym = \"ATH_SITE_LIBS\"\n return (errorAcronym,os.linesep.join(diagLines))","def find(self):\n raise NotImplementedError","def search_by_contains(self, tl):\n print(\"Search by string\")\n string = input(\"Please enter search string: \")\n return tl.findall_contains(string)","def search_general(abe, q):\n def process(row):\n (name, code3) = row\n return { 'name': name + ' (' + code3 + ')',\n 'uri': 'chain/' + str(name) }\n ret = map(process, abe.store.selectall(\"\"\"\n SELECT chain_name, chain_code3\n FROM chain\n WHERE UPPER(chain_name) LIKE '%' || ? || '%'\n OR UPPER(chain_code3) LIKE '%' || ? || '%'\n \"\"\", (q.upper(), q.upper())))\n return ret","def search(self, text, location=\"\"):\n return [\n obj.name[len(location) + 1 : -3] for obj in self._file_model.search(text) if obj.name.startswith(location)\n ]","def book_search(search_point: str, info: str, data: list) -> list:\n result = []\n for i in range(len(data)):\n if search_point == \"shelf\":\n try:\n if int(info) == int(data[i][search_point]):\n result.append(data[i])\n except ValueError:\n if info in data[i][search_point].lower():\n result.append(data[i])\n else:\n if info in data[i][search_point].lower():\n result.append(data[i])\n return result","def rescan_library(self):\n self.scan_dir(self.libpath)","def do_search(self, line):\n\t\t# if isinstance(self.cl, Book):\n\t\t# \tst = time()\n\t\t# \tprint(\"\\nSearch results for: \",str(line))\n\t\t# \tfor i in self.cl.search_contact(str(line)):\n\t\t# \t\tprint(i)\n\t\t# \tprint('Time elapsed: {:10f}'.format(time()-st))\n\t\t# else:\n\t\t# \tprint(\"To search contacts you need to open or create a book.\")\n\t\tif isinstance(self.cl, Book):\n\t\t\tst = time()\n\t\t\tprint(\"\\nSearch results for: \",str(line))\n\t\t\tw = []\n\t\t\tfor i in range(0,len(self.cl.data),10000):\n\t\t\t\tw.append(self.cl.data[i:i+10000])\n\t\t\tworkers = []\n\t\t\tfor i in w:\n\t\t\t\tworkers.append(Process(target=self.cl.search_contact, args=(i, str(line))))\n\t\t\tfor worker in workers:\n\t\t\t\tworker.start()\n\t\t\tfor worker in workers:\n\t\t\t\tworker.join()\n\t\t\tprint('Time elapsed: {:10f}'.format(time()-st))\n\t\telse:\n\t\t\tprint(\"To search contacts you need to open or create a book.\")","def search_multiple_words(words):\n # YOUR CODE HERE #\n pass # delete this when you write your code","def getSearch(self, authenticationToken, guid):\r\n pass","def object_search(self, ostring, caller=None,\n global_search=False, \n attribute_name=None, location=None):\n #ostring = str(ostring).strip()\n\n if not ostring:\n return [] \n\n # Easiest case - dbref matching (always exact) \n dbref = self.dbref(ostring)\n if dbref:\n dbref_match = self.dbref_search(dbref)\n if dbref_match:\n return [dbref_match]\n\n if not location and caller and hasattr(caller, \"location\"):\n location = caller.location\n\n # Test some common self-references\n\n if location and ostring == 'here':\n return [location] \n if caller and ostring in ['me', 'self']:\n return [caller]\n if caller and ostring in ['*me', '*self']: \n return [caller] \n \n # Test if we are looking for an object controlled by a\n # specific player\n\n if utils.to_unicode(ostring).startswith(\"*\"):\n # Player search - try to find obj by its player's name\n player_match = self.get_object_with_player(ostring)\n if player_match is not None:\n return [player_match]\n \n # Search for keys, aliases or other attributes\n \n search_locations = [None] # this means a global search\n if not global_search and location:\n # Test if we are referring to the current room\n if location and (ostring.lower() == location.key.lower() \n or ostring.lower() in [alias.lower() for alias in location.aliases]):\n return [location]\n # otherwise, setup the locations to search in \n search_locations = [location]\n if caller:\n search_locations.append(caller)\n \n def local_and_global_search(ostring, exact=False):\n \"Helper method for searching objects\" \n matches = [] \n for location in search_locations: \n if attribute_name:\n # Attribute/property search. First, search for db_<attrname> matches on the model\n matches.extend(self.get_objs_with_db_property_match(attribute_name, ostring, location, exact))\n if not matches:\n # Next, try Attribute matches\n matches.extend(self.get_objs_with_attr_match(attribute_name, ostring, location, exact))\n else:\n # No attribute/property named. Do a normal key/alias-search \n matches.extend(self.get_objs_with_key_or_alias(ostring, location, exact))\n return matches\n\n # Search through all possibilities.\n\n match_number = None\n matches = local_and_global_search(ostring, exact=True) \n if not matches:\n # if we have no match, check if we are dealing with an \"N-keyword\" query - if so, strip it.\n match_number, ostring = AT_MULTIMATCH_INPUT(ostring)\n if match_number != None and ostring:\n # Run search again, without match number:\n matches = local_and_global_search(ostring, exact=True)\n if ostring and (len(matches) > 1 or not matches):\n # Already multimatch or no matches. Run a fuzzy matching.\n matches = local_and_global_search(ostring, exact=False)\n elif len(matches) > 1:\n # multiple matches already. Run a fuzzy search. This catches partial matches (suggestions)\n matches = local_and_global_search(ostring, exact=False)\n \n # deal with the result\n if len(matches) > 1 and match_number != None:\n # We have multiple matches, but a N-type match number is available to separate them.\n try:\n matches = [matches[match_number]]\n except IndexError:\n pass\n # This is always a list.\n return matches","def LibThread(q):\n os.nice(1)\n time.sleep(0)\n library = cmus.library()\n cache = cmus.Cache()\n liblist = {}\n # BUG: newly added tracks don't appear in the listing as they aren't recorded\n # neither in the cache nor in the library.pl\n # TODO: report progress values, maybe even return partial results?\n for track in cache:\n # allow other thread to jump in\n time.sleep(0)\n try:\n q.get_nowait()\n q.task_done()\n return False\n except Queue.Empty:\n pass\n\n try:\n del library[library.index(track['file'])]\n except ValueError:\n # file is in cache but not in library\n continue\n\n # use dummy values if no value given\n artist = track['albumartist'] if track.has_key('albumartist') and track['albumartist'] != '' \\\n else track['artist'] if track.has_key('artist') and track['artist'] != '' \\\n else '[unknown]'\n\n album = track['album'] if track.has_key('album') and track['album'] != '' \\\n else '[unknown]'\n\n title = track['title'] if track.has_key('title') and track['title'] != '' \\\n else os.path.basename(track['file']).rsplit('.', 1)[0]\n\n if not liblist.has_key(artist):\n liblist[artist] = {}\n if not liblist[artist].has_key(album):\n liblist[artist][album] = {}\n liblist[artist][album][title] = track\n\n # TODO: get files not in cache manually\n # (hint: library contains their paths now)\n\n def sorter(x):\n ref = liblist[artist][album][x]\n if ref.has_key('tracknumber') and ref['tracknumber'] != 0:\n return ref['tracknumber']\n elif ref.has_key('title') and ref['title'] != '':\n return ref['title']\n else:\n return 0\n\n for artist in liblist.keys():\n for album in liblist[artist].keys():\n # sort by tracknumber if existant, title else\n liblist[artist][album]['__keys__'] = \\\n sorted(liblist[artist][album].keys(), key=sorter)\n liblist[artist]['__keys__'] = sorted(liblist[artist].keys(), key=str.lower)\n liblist['__keys__'] = sorted(liblist.keys(), key=str.lower)\n q.put(liblist)","def add_library(self):\n library = self.new_section('The Library')\n books = self.wiki('the-library')._soup(class_='boxbook')\n template = (\n '<div class=\"book-title\">{}</div>'\n '<div class=\"book-description\">{}</div>')\n for b in books:\n title = b.find(class_='booktitle').string\n description = b.find(class_='boxleft')('div')[0].text.strip()\n excerpts = [self.wiki.site + a['href']\n for a in b.find(class_='boxright')('a')]\n if title == 'The Journal of Aframos Longjourney':\n links = self.wiki(excerpts[1])._soup.select('#page-content a')\n links = [\n 'http://wanderers-library.wikidot.com/' +\n l['href'].split('/')[-1] for l in links]\n excerpts = [excerpts[0]] + links\n book = self.add_page(\n title, template.format(title, description), library)\n for url in excerpts:\n self.add_url(url, book)","def book_search(self, term):\n\n try:\n cur = self._db.cursor()\n search = f'%{term.upper()}%'\n cur.execute('SELECT rowid, * FROM books WHERE UPPER(title) like ? OR UPPER(author) like ?', (search, search))\n return self._cursor_to_booklist(cur)\n except sqlite3.Error as e:\n raise BookError(f'Error searching for books with search term {term}') from e","def test_search_and(self):\n pkgs = [\n make_package(factory=SQLPackage),\n make_package(\n \"somepackage\",\n version=\"1.3\",\n filename=\"mypath3\",\n summary=\"this is mypkg\",\n factory=SQLPackage,\n ),\n make_package(\"mypkg2\", \"1.3.4\", \"my/other/path\", factory=SQLPackage),\n make_package(\"package\", factory=SQLPackage),\n ]\n for pkg in pkgs:\n self.db.save(pkg)\n criteria = {\"name\": [\"my\", \"pkg\"], \"summary\": [\"this\", \"mypkg\"]}\n packages = self.db.search(criteria, \"and\")\n self.assertCountEqual(packages, pkgs[:-1])","def test_search(self):\n pass","def test_search(self):\n pass","def test_search(self):\n pass","def main():\n domain_list = []\n base_url = \"http://localhost:9200/latest-tor/_search?pretty&size=9000&_source=title,domain\"\n keywords_list = ['preteen', 'loli', 'lolita', 'jailbait', 'pthc', 'best cp',\n '\"child porn\"', '\"kid porn\"', '\"child sex\"', '\"cp video\"',\n '\"nude children\"', '\"cp porn\"', '\"free child porn\"', 'kinderporn',\n '\"child rape\"', '\"toddler porn\"', '\"kids videos\"', '\"cp videos\"',\n 'lolilust', '\"pedo porno\"', '\"pedo content\"', 'underage', '\"cp pack\"',\n 'loliporn', 'pedofamily', '\"cp database\"', '\"pedo webcams\"', 'lolitacity']\n '\"xxx child\"', '\"xxx underage\"', '\"young forbidden\"']\n search_terms = []\n for index, term in enumerate(keywords_list):\n search_terms.append(term)\n if len(search_terms) >= 10 or index + 1 == len(keywords_list):\n url = base_url + \"&q=(\" + \" OR \".join(search_terms).replace(\" \", \"%20\") + \")\"\n search(url, domain_list)\n search_terms = []","def myhtable_index_search(files, index, terms):\n res_file = []\n count = 0\n if len(terms) == 0:\n print('empty terms')\n return\n for term in terms:\n term = term.lower()\n count += 1\n if count == 1:\n s = htable_get(index, term)\n if s == None:\n s = {-1}\n else:\n s = s.intersection(htable_get(index, term))\n for id in s:\n if id != -1:\n res_file.append(files[id])\n return res_file","def scan_section(name, o):\n\n for n in dir(o):\n scan(name + n, getattr(o, n))","def do_multi_search(self, line):\n\t\tif isinstance(self.cl, Book):\n\t\t\tprint(\"\\nSearch results for: \",str(line))\n\t\t\tt = time()\n\t\t\tself.cl.pool_str = str(line)\n\t\t\tpool = Pool(4)\n\t\t\tpool.imap_unordered(self.cl.multi_search_contact, self.cl.data, chunksize=50000)\n\t\t\tpool.close()\n\t\t\tpool.join()\n\t\t\tprint(\"time elapsed: {:10f}\".format(time()- t))\n\t\telse:\n\t\t\tprint(\"To search contacts you need to open or create a book.\")","def test_analyze_a_recipe_search_query(self):\n pass","def lookup(index, keyword):\n for item in index:\n if item[0] == keyword:\n return item[1]\n return []","def section():\n # type: () -> None\n idx = get_arg(\"idx\", False)\n href = get_arg(\"href\", False)\n category = get_arg(\"category\")\n offset = get_arg(\"offset\", 0)\n if idx:\n # Section menu\n url = locs.get_search_url(idx, page=offset)\n data = locs.get_json(url)\n paginate(data.get(\"pagination\"), category, idx)\n for data in data.get(\"facets\", [{}])[0].get(\"filters\"):\n title = data.get(\"title\").title()\n count = data.get(\"count\")\n add_menu_item(section,\n \"{} [{} items]\".format(title, count),\n {\"href\": data.get(\"on\"), \"category\": title})\n if href:\n # Playable items\n data = locs.get_json(href)\n parse_search_results(data, category)\n xbmcplugin.setContent(plugin.handle, \"videos\")\n xbmcplugin.setPluginCategory(plugin.handle, category)\n xbmcplugin.endOfDirectory(plugin.handle)","def search_book(self, data):\n query = f\"\"\"SELECT * from {TABLE} where \"{data['type']}\" LIKE \"%{data['text']}%\";\"\"\"\n\n self.cursor.execute(query)\n res = self.cursor.fetchall()\n\n return res","def _FindBibEntries(self):\n bibs = \" \".join(glob.glob(\"*.bib\"))\n cat_process = subprocess.Popen(shlex.split(\"cat %s\" % bibs),\n stdout=subprocess.PIPE)\n grep_process = subprocess.Popen(shlex.split(\"grep ^@\"),\n stdin=cat_process.stdout,\n stdout=subprocess.PIPE)\n cat_process.stdout.close()\n grep2_process = subprocess.Popen(shlex.split(\"grep -vi @string\"),\n stdin=grep_process.stdout,\n stdout=subprocess.PIPE)\n grep_process.stdout.close()\n\n lines = grep2_process.communicate()[0]\n\n ret = []\n for l in lines.split(\"\\n\"):\n ret.append(responses.BuildCompletionData(\n re.sub(r\"@([A-Za-z]*)\\s*{\\s*([^,]*),.*\", r\"\\2\", l)\n )\n )\n return ret","def search_book():\n\n title = request.form.get(\"search\")\n books = book_search_results(GR_KEY, title)\n acct = get_current_account(session['acct'])\n search = True\n\n return render_template(\"index.html\", books=books, acct=acct, search=search)","def __init__(self, lib, search_val):\n self.__dict__['__lib__'] = lib\n self.__dict__['__con__'] = lib.get_con()\n\n res = self.__con__.search_s(\n self.__ldap_group_ou__,\n ldap.SCOPE_SUBTREE,\n \"(cn=%s)\" % search_val,\n ['cn'])\n\n if res:\n self.__dict__['__dn__'] = res[0][0]\n else:\n raise KeyError(\"Invalid Search Name\")","def _linesearch(self):\n pass","def keyword_search(keywords):\n try:\n return itunespy.search(keywords)[0]\n except LookupError:\n return None","def search(snippet_portion, filename):\n\tlogging.info(\"Searching for {} in {}\".format(snippet_portion, filename))\n\tlogging.debug(\"Opening file\")\n\twith open(filename, \"r+\") as f:\n\t\treader = csv.reader(f)\n\t\tlogging.debug(\"Searching for\")\n\t\tin_file = False\n\t\tfor row in reader:\n\t\t\tif str(row[1]) == snippet_portion:\n\t\t\t\tin_file = True\n\t\t\t\tprint row\n\t\tif in_file == False:\n\t\t\tprint \"That's not in this file\"\n\tlogging.debug(\"Search complete\")\n\treturn snippet_portion, filename","def get_library_summaries(self, **kwargs):\n branch = 'library'\n libraries_summaries = []\n for entry, structure_info in self._get_courselike_blocks_for_branch(branch, **kwargs):\n library_locator = self._create_library_locator(structure_info, branch=None)\n library_block = [\n block_data\n for block_key, block_data in entry['blocks'].items()\n if block_key.type == \"library\"\n ]\n if not library_block:\n raise ItemNotFoundError\n\n if len(library_block) > 1:\n raise MultipleLibraryBlocksFound(\n \"Expected 1 library block, but found {}\".format(len(library_block))\n )\n\n library_block_fields = library_block[0].fields\n display_name = ''\n\n if 'display_name' in library_block_fields:\n display_name = library_block_fields['display_name']\n\n libraries_summaries.append(\n LibrarySummary(library_locator, display_name)\n )\n\n return libraries_summaries","def _add_search_patch():\n # Create extra cookbook dir\n lib_path = os.path.join(\n node_work_path, cookbook_paths[0], 'chef_solo_search_lib', 'libraries')\n with hide('running', 'stdout'):\n sudo('mkdir -p {0}'.format(lib_path))\n # Add search and environment patch to the node's cookbooks\n for filename in ('search.rb', 'parser.rb', 'environment.rb'):\n put(os.path.join(basedir, filename),\n os.path.join(lib_path, filename), use_sudo=True)","def search_sd(terms):\n\n print('-- Search ScienceDirect:', len(terms), 'terms.')\n\n books = defaultdict(set)\n for result in pool.imap(search_sd_helper, chunks(terms, 200)):\n for book in result:\n books[book] |= result[book]\n\n return books","def searchDiscover(self, query, limit=30, libtype=None):\n libtypes = {'movie': 'movies', 'show': 'tv'}\n libtype = libtypes.get(libtype, 'movies,tv')\n\n headers = {\n 'Accept': 'application/json'\n }\n params = {\n 'query': query,\n 'limit': limit,\n 'searchTypes': libtype,\n 'includeMetadata': 1\n }\n\n data = self.query(f'{self.METADATA}/library/search', headers=headers, params=params)\n searchResults = data['MediaContainer'].get('SearchResults', [])\n searchResult = next((s.get('SearchResult', []) for s in searchResults if s.get('id') == 'external'), [])\n\n results = []\n for result in searchResult:\n metadata = result['Metadata']\n type = metadata['type']\n if type == 'movie':\n tag = 'Video'\n elif type == 'show':\n tag = 'Directory'\n else:\n continue\n attrs = ''.join(f'{k}=\"{html.escape(str(v))}\" ' for k, v in metadata.items())\n xml = f'<{tag} {attrs}/>'\n results.append(self._manuallyLoadXML(xml))\n\n return self._toOnlineMetadata(results)","def full_search(pw, *arg, **kw):\n return pw.search(*arg, **kw)","def main():\n\tdescription = \"Utility to search for spotify by song, artist or song ID and to create playlists based off of song ID's\"\n\tusage = \"search.py [-h] [-s SONG | -a ARTIST | -i ID] [-p PLAYLIST & -u USERNAME & -i ID & -d DESCRIPTION]\"\n\tparser = argparse.ArgumentParser(description=description, usage=usage)\n\tgroup = parser.add_mutually_exclusive_group()\n\tgroup.add_argument(\"-s\", \"--song\", nargs=1, required='--argument' in sys.argv, help=\"Search for a song by name\")\n\tgroup.add_argument(\"-a\", \"--artist\", nargs=1, required='--argument' in sys.argv,\n\t\t\t\t\t help=\"Search for songs from an Artist\\n\")\n\tgroup.add_argument(\"-i\", \"--id\", nargs=1, required='--argument' in sys.argv,\n\t\t\t\t\t help=\"Search for song based on ID or create playlist based off of song ID\")\n\tparser.add_argument(\"-p\", \"--playlist\", nargs=1, required='--id' in sys.argv,\n\t\t\t\t\t\thelp=\"Name of the playlist to be created. MUST be used with -i/--id\")\n\tparser.add_argument(\"-d\", \"--description\", nargs=1, required='--argument' in sys.argv,\n\t\t\t\t\t\thelp=\"Playlist Description. Must be used with -p,-i and -u\")\n\tparser.add_argument(\"-u\", \"--username\", nargs=1, required='--argumnet' in sys.argv,\n\t\t\t\t\t\thelp=\"Spotify Username. Must be used with -p, -i and -d\")\n\targs = parser.parse_args()\n\t# print(args)\n\n\tsolr = Solr_Query()\n\n\tresponse = None\n\n\tif args.song:\n\t\tprint(\"Searching for song:\", args.song[0].strip())\n\t\tsong_name = args.song[0].strip()\n\t\tsolr.set_search_type(\"songs\")\n\t\tquery = solr.set_query(song_name)\n\t\tresponse = solr.exec_query(query)\n\t\tsolr.print_search_results(response)\n\n\tif args.artist:\n\t\tprint(\"Searching for songs by artist: \", args.artist[0].strip())\n\t\tartist = args.artist[0].strip()\n\t\tsolr.set_search_type(\"artists\")\n\t\tquery = solr.set_query(artist)\n\t\tresponse = solr.exec_query(query)\n\t\tsolr.print_search_results(response)\n\n\t# Still trying to figure this one out. The getmorelike this funcionality is harder than we thought\n\tif args.playlist and args.id and args.description and args.username:\n\t\tprint(\"Creating a playlist based off of song ID:\", args.id[0].strip())\n\t\tid = args.id[0].strip()\n\t\tdescription = args.description[0].strip()\n\t\tplaylist = args.playlist[0].strip()\n\t\tusername = args.username[0].strip()\n\n\t\tsolr.set_search_type(\"id\")\n\t\tquery = solr.set_query(id)\n\t\tresponse = solr.exec_query(query)\n\n\t\t# Create a playlist create object to find similar songs and create the playlist\n\t\tcreator = Playlist_Create(username, playlist, description)\n\t\tcreator.authenticate() # authenticate using the username passed in\n\t\tresponse = creator.get_similar_songs(response)\n\t\tsongs = creator.get_song_ids(response)\n\t\tplaylist_id = creator.create_playlist()\n\t\tcreator.add_songs(playlist_id, songs)\n\n\n\n\telif args.playlist and not args.id:\n\t\tparser.error(\"Must input a song ID to create a playlist with!\")\n\telif args.playlist and not args.description:\n\t\tparser.error(\"Must input a playlist description\")\n\telif args.playlist and not args.username:\n\t\tparser.error(\"Need your username to create the playlist\")\n\n\tif args.id:\n\t\tprint(\"Searching for song with ID:\", args.id[0].strip())\n\t\tid = args.id[0].strip()\n\t\tsolr.set_search_type(\"id\")\n\t\tquery = solr.set_query(id)\n\t\tresponse = solr.exec_query(query)\n\t\tsolr.print_search_results(response)\n\n\tprint(\"\\nDone!\")","def test_search_or(self):\n pkgs = [\n make_package(factory=DynamoPackage),\n make_package(\n \"somepackage\",\n version=\"1.3\",\n filename=\"mypath3\",\n summary=\"this is mypkg\",\n factory=DynamoPackage,\n ),\n make_package(\"mypkg2\", \"1.3.4\", \"my/other/path\", factory=DynamoPackage),\n make_package(\"package\", factory=DynamoPackage),\n ]\n self._save_pkgs(*pkgs)\n criteria = {\"name\": [\"mypkg\"], \"summary\": [\"mypkg\"]}\n packages = self.db.search(criteria, \"or\")\n self.assertCountEqual(packages, pkgs[:-1])","def search(pac, man='all'):\n if man == 'all':\n print \"Searching all package managers\"\n if pacman['fink'] != 'None':\n search_fink(pac)\n if pacman['brew'] != 'None':\n search_brew(pac)\n if pacman['port'] != 'None':\n search_port(pac)\n if pacman['pip'] != 'None':\n search_pip(pac)\n if pacman['gem'] != 'None':\n search_gem(pac)\n if pacman['cpan'] != 'None':\n search_cpan(pac)\n search_whohas(pac)\n else:\n nofunzone = {'fink': search_fink, 'brew': search_brew, 'port': search_port, 'pip': search_pip, 'gem': search_gem, 'cpan': search_cpan} \n #print nofunzone\n try:\n f = nofunzone[man]\n print \"trying to run a search on %s for %s\" % (man, pac)\n f(pac)\n except KeyError:\n print \"Please use search like this: haberdashery.py search package manager: \\nhaberdashery.py search %s %s\" % (man, pac)\n # locals()['search_%s(pac)' % man]","def index_search(files, index, terms):\n\n\n termlist = set()\n\n for i in range(len(terms)):\n for j in range(len(terms[i].split(\" \"))):\n\n termlist.add(terms[i].split(\" \")[j])\n\n indexlist = [index[w] for w in termlist]\n\n intersect = list(set.intersection(*indexlist))\n\n return [files[x] for x in intersect]","def findItems(self, QString, Qt_MatchFlags): # real signature unknown; restored from __doc__\r\n pass","def search():\n\tif not request.vars.search_term:\n\t\tredirect(URL('index'))\n\tterm = request.vars.search_term\n\torigterm = term\n\tterm = term.replace(' ','|')\n\tartists = db.executesql(\"select distinct(m1.id), m1.art_name, m1.artist_type, m1.country, m1.b_year,m1.b_month,m1.b_date,m1.e_year,m1.e_month,m1.e_day,ts_rank(to_tsvector(m1.art_name),to_tsquery('\"+term+\"')) rank from art_info m1 where to_tsvector('english',m1.art_name) @@ to_tsquery('\"+term+\"') order by rank desc limit 20;\")\n\talbums = db.executesql(\"select distinct(m1.id),m2.name,m1.art_id,m1.art_name,m1.rel_type,m1.count,ts_rank(to_tsvector(m2.name),to_tsquery('\"+term+\"')) rank from rel_art m1, release_name m2, release_group m3 where m3.name = m2.id and m3.id = m1.id and to_tsvector('english',m2.name) @@ to_tsquery('\"+term+\"') order by rank desc limit 20;\")\n\tsongs = db.executesql(\"select m2.id, m1.name, m3.art_id, m3.art_name, m3.rel_id, m3.rel_name from track_name m1, recording m2, rec_rel_art m3 where m1.id = m2.name and m2.id = m3.rec_id and lower(m1.name) LIKE lower('%%\"+origterm+\"%%') limit 20;\")\n\treturn dict(songs=songs, albums=albums, artists=artists)"],"string":"[\n \"def book_search(library: list) -> None:\\n options = ['Author', 'Title', 'Publisher', 'Shelf', 'Category', 'Subject']\\n prompt = '\\\\nWhat option would you like to search by?'\\n choice = get_user_choice(options, prompt)\\n if choice == '1':\\n search_by_chosen_option(library, options[0])\\n elif choice == '2':\\n search_by_chosen_option(library, options[1])\\n elif choice == '3':\\n search_by_chosen_option(library, options[2])\\n elif choice == '4':\\n search_by_shelf(library)\\n elif choice == '5':\\n search_by_chosen_option(library, options[4])\\n elif choice == '6':\\n search_by_chosen_option(library, options[5])\",\n \"def search():\\n pass\",\n \"def search(self, term):\",\n \"def find_material(material):\\n for libn,tdict in liblist:\\n if material in tdict:\\n print(libn)\",\n \"def search(self, search):\\n raise NotImplementedError\",\n \"def find(self, egg):\",\n \"def search_by_chosen_option(library: list, chosen_option: str) -> None:\\n user_input = input(f'What is the name of the {chosen_option} you want to search for?')\\n found_books = []\\n for book in library:\\n if user_input.lower() in str(getattr(book, chosen_option.lower())).lower():\\n found_books.append(book)\\n print(f'We found {len(found_books)} book(s) that matched this search in your library.\\\\n')\\n for num, book in enumerate(found_books, 1):\\n print(f'{num} - {book.__repr__()}')\\n if len(found_books) > 0 and not return_to_main_menu():\\n move_book(library, found_books)\",\n \"def search_by_shelf(library: list) -> None:\\n user_input = input(f'What is the number/name of the shelf you want to search for?')\\n found_books = []\\n for book in library:\\n if user_input.lower() == str(getattr(book, 'shelf')).lower():\\n found_books.append(book)\\n print(f'We found {len(found_books)} book(s) that matched this search in your library.\\\\n')\\n for num, book in enumerate(found_books, 1):\\n print(f'{num} - {book.__repr__()}')\\n if len(found_books) > 0 and not return_to_main_menu():\\n move_book(library, found_books)\",\n \"def library_searched():\\n\\n searched_result = []\\n \\n updated_books = duplicated_code()\\n\\n if request.method == 'POST':\\n if request.form['type_search'] == 'book':\\n book_title = request.form['search']\\n for book in updated_books:\\n if book['title'] == book_title:\\n searched_result.append(book)\\n return render_template(\\\"library_searched.html\\\", result = searched_result)\\n elif request.form['type_search'] == 'genre':\\n book_genre = request.form['search']\\n for book in updated_books:\\n if book['genre'] == book_genre:\\n searched_result.append(book)\\n return render_template(\\\"library_searched.html\\\", result = searched_result)\\n elif request.form['type_search'] == 'author':\\n book_author = request.form['search']\\n for book in updated_books:\\n if book['author_name'] == book_author:\\n searched_result.append(book)\\n return render_template(\\\"library_searched.html\\\", result = searched_result)\\n else:\\n return render_template(\\\"library_searched.html\\\")\",\n \"def keywords_of_section(self, section, kwfilter):\\n pcat = getToolByName(section, 'portal_catalog')\\n cat = pcat._catalog\\n path_idx = cat.indexes[self.path_index]\\n tags_idx = cat.indexes[self.keyword_index]\\n result = []\\n # query all oids of path - low level\\n pquery = {\\n self.path_index: {\\n 'query': '/'.join(section.getPhysicalPath()),\\n 'depth': -1,\\n }\\n }\\n kwfilter = safe_encode(kwfilter)\\n # uses internal zcatalog specific details to quickly get the values.\\n path_result, info = path_idx._apply_index(pquery)\\n for tag in tags_idx.uniqueValues():\\n if kwfilter and kwfilter not in safe_encode(tag):\\n continue\\n tquery = {self.keyword_index: tag}\\n tags_result, info = tags_idx._apply_index(tquery)\\n if intersection(path_result, tags_result):\\n result.append(tag)\\n # result should be sorted, because uniqueValues are.\\n return safe_simplevocabulary_from_values(result)\",\n \"def search(self, *args, **kwargs): # real signature unknown\\n pass\",\n \"def list(full, field):\\n\\n short = not full \\n\\n libraries = select(l for l in Library if l)[:]\\n libraries = natsorted(libraries, key=lambda x : attrgetter('name')(x).lower())\\n\\n if len(libraries) == 0:\\n logger.info(\\\"[!] No libraries available to list.\\\") \\n logger.info(\\\" Consider run the following command:\\\")\\n logger.info(\\\" $ apkg init\\\")\\n return \\n\\n\\n\\n orderFields = [ \\n #, \\\"library\\\"\\n #, \\\"sha\\\"\\n \\\"description\\\"\\n # , \\\"license\\\"\\n # , \\\"include\\\"\\n # , \\\"depend\\\"\\n # , \\\"testedWith\\\"\\n , \\\"keywords\\\"\\n # , \\\"installed\\\"\\n # , \\\"cached\\\"\\n # , \\\"fromIndex\\\"\\n # , \\\"fromUrl\\\"\\n # , \\\"fromGit\\\"\\n , \\\"origin\\\"\\n # , \\\"default\\\"\\n ]\\n\\n i = 0\\n if short and field == \\\"\\\":\\n logger.info(\\\"{:<20.20} {:<15.20} {:.72}\\\"\\n .format(\\\"Library name\\\", \\\"Latest version\\\", \\\"URL\\\"))\\n logger.info(\\\"-\\\"*105)\\n\\n for library in libraries:\\n v = library.getLatestVersion() \\n if v is not None:\\n if not short:\\n\\n logger.info(v.library.name)\\n logger.info(\\\"=\\\"*len(v.library.name))\\n\\n info = v.info\\n\\n for k in orderFields: \\n val = info.get(k, None)\\n if val is not None or val != \\\"\\\" or len(val) > 0:\\n click.echo(\\\"{0}: {1}\\\".format(k,val))\\n\\n vs = ','.join(str(ver) for ver in v.library.versions)\\n \\n if len(vs) > 0:\\n print(\\\"Versions:\\\", vs)\\n \\n else:\\n if field in listFields:\\n if field == \\\"name\\\":\\n print(v.library.name)\\n elif field == \\\"version\\\":\\n print(v.name)\\n else:\\n print(v.library.url)\\n else:\\n print(\\\"{:<20.20} {:<15.20} {:.72}\\\"\\n .format(v.library.name,v.name,v.library.url))\\n\\n i += 1\\n if not short and i < len(libraries):\\n logger.info(\\\"\\\")\",\n \"def search():\\n import booksearch as bs\\n\\n opt = var.get()\\n term = searchBox.get()\\n term2 = dateBox.get()\\n\\n # Case statement (substitute) for different search areas\\n # Each key is an option in the OptionMenu\\n searchBy = {\\n \\\"Title & Author\\\" : bs.search(term),\\n \\\"ID\\\" : bs.bookID(term),\\n \\\"Date\\\" : bs.dateRange(term, term2),\\n }\\n query = searchBy[opt] # Make & stores a query (2D list)\\n\\n # Repopulates table\\n if term != \\\"\\\":\\n populate(query)\",\n \"def runSearch():\\n\\tglobal processLanguageOn\\n\\tdataToFind=getDataFromWidget(podSearchEntry)\\n\\t#Search through the keys otherwise data changes\\n\\tdataSource=podListbox.data.keys()\\n\\t#Store the results of the search\\n\\tresults=[]\\n\\t#Search the data source\\n\\tfor item in dataSource:\\n\\t\\tif searchDataSource(dataToFind,[item],capital=True,full=False):\\n\\t\\t\\tresults.append(item)\\n\\n\\t#Add the results to screen\\n\\tpodListbox.delete(0,END)\\n\\tfor item in results:\\n\\t\\tpodListbox.addExisting(item)\\n\\n\\tif processLanguageOn:\\n\\t\\tprocessSearchLanguage(podSearchEntry)\",\n \"def search_main() -> None:\\n\\n logger.info(\\\"Starting search\\\")\\n links = run_search(grab_search_info())\\n if links:\\n logger.info(\\\"Printing links\\\")\\n for key in links:\\n print(f\\\"{key.upper()}: {links[key]}\\\")\",\n \"def search(self, *args, **kwargs):\",\n \"def recognize_lib(self, a, lib):\\n logging.debug(\\\"in recognize lib\\\")\\n self.produce(KEYWORD, lib)\\n self.begin('lib')\",\n \"def search(query_string):\",\n \"def searchLib(self, logger):\\n # Now search\\n self._version_strings = []\\n self._sanity_exists = False\\n for bin_str in self._all_strings:\\n # we have a match\\n if self.VERSION_STRING in str(bin_str):\\n version_string = str(bin_str)\\n # valid match\\n logger.debug(\\\"Located a version string of %s in address 0x%x\\\", self.NAME, bin_str.ea)\\n # save the string for later\\n self._version_strings.append(version_string)\\n # check the sanity string\\n if self.SANITY_STRING in str(bin_str):\\n self._sanity_exists = True\\n\\n # return the result\\n if self._sanity_exists and len(self._version_strings) == 0:\\n return 1\\n else:\\n return len(self._version_strings)\",\n \"def within_book_search_json(request, book_id):\\n query = request.GET.get('q')\\n term = query # todo: meta options?\\n book = Book.objects.get(pk=book_id)\\n\\n if not query or len(query) < 3:\\n return\\n\\n # todo: method on objectmanager to search by keyword\\n notes = book.notes.filter(\\n Q(subject__icontains=term) |\\n Q(quote__icontains=term) |\\n Q(comment__icontains=term)\\n )\\n terms = book.terms.filter(\\n Q(term__text__icontains=term) |\\n Q(term__definition__icontains=term) |\\n Q(quote__icontains=term) |\\n Q(quote__icontains=term)\\n )\\n sections = book.sections.filter(\\n Q(title__icontains=term) |\\n Q(authors__name__icontains=term) |\\n Q(subtitle__icontains=term) |\\n Q(summary__icontains=term)\\n )\\n\\n results = {'notes': [], 'terms': [], 'sections': []}\\n for note in notes:\\n results['notes'].append({\\n 'title': highlighter.highlight(note.subject, query),\\n 'description': highlighter.highlight(note.quote, query, 200),\\n 'price': note.get_page_display(),\\n 'url': note.get_absolute_url(),\\n })\\n\\n for term in terms:\\n results['terms'].append({\\n 'title': highlighter.highlight(term.term.text, query),\\n 'description': highlighter.highlight(term.quote, query, 200),\\n 'price': term.get_page_display(),\\n 'url': term.get_absolute_url(),\\n })\\n\\n for section in sections:\\n authors = ', '.join(a.name for a in section.authors.all())\\n results['sections'].append({\\n 'title': highlighter.highlight(section.title, query),\\n 'description': highlighter.highlight(authors, query),\\n 'price': section.get_page_display(),\\n 'url': section.get_absolute_url(),\\n })\\n\\n return JsonResponse({\\n 'results': {\\n 'books': {\\n 'name': 'Notes',\\n 'results': results['notes'],\\n },\\n 'authors': {\\n 'name': 'Terms',\\n 'results': results['terms'],\\n },\\n 'sections': {\\n 'name': 'Sections',\\n 'results': results['sections'],\\n },\\n }\\n })\",\n \"def search(self, query):\",\n \"def advanced_search(self, pattern):\\n pass\",\n \"def library():\\n finder = LibraryFinder()\\n p = finder.find()\\n return p if p else ''\",\n \"def search_for_books(main_page): # Add information to the printout if the book is rented\\n\\n type_of_search = 0\\n\\n header = \\\"\\\"\\\"\\n Do you want to search for books by the first letter of the title\\n or by the type?\\n \\\"\\\"\\\"\\n search_choices= (\\n (\\\"To search by letter\\\", search_by_letter),\\n (\\\"To search by type\\\", search_by_type),\\n (\\\"To exit\\\",exit.exit_to_main)\\n )\\n\\n book_search = Screen(header,search_choices,\\n main_page.login, main_page.password)\\n book_search.activate()\",\n \"def search(collection_of_books: tuple, search_tag: str, search_keyword: str) -> list:\\r\\n found_books = []\\r\\n\\r\\n if search_tag == \\\"Shelf\\\" and search_keyword.isnumeric():\\r\\n found_books = [book for book in collection_of_books if search_keyword == book[\\\"Shelf\\\"]]\\r\\n\\r\\n else:\\r\\n for book in collection_of_books:\\r\\n if search_keyword.lower() in book[search_tag].lower():\\r\\n found_books.append(book)\\r\\n\\r\\n return found_books\",\n \"def search_keyword(self,keyword):\\n for entry in self.available_fields_list:\\n for x in entry:\\n if keyword in x:\\n print(entry)\\n break\\n return\",\n \"def search(self, word):\",\n \"def searchRef(self, searchStr):\\n filter = []\\n attr = self.__listAttr()\\n for name in attr:\\n if searchStr.lower() in name.lower():\\n doc = getattr(self, name)\\n filter.append([name, doc]) \\n # if in gloss, search for synonymes\\n elif name in self.__glossIndex.keys():\\n for altName in self.__glossIndex[name]['syn']:\\n if searchStr in altName or altName in searchStr:\\n doc = getattr(self, name)\\n filter.append([name, doc])\\n break\\n \\n return filter\",\n \"def find(self, p):\\n pass\",\n \"def processSearchResult(self):\",\n \"def library_search_path(self, pedantic=False):\\n return []\",\n \"def search_books_body(collection_of_books: tuple) -> list:\\r\\n search_tag, search_keyword = search_info()\\r\\n try:\\r\\n found_books = search(collection_of_books, search_tag, search_keyword)\\r\\n except KeyError as err:\\r\\n print(f\\\"Invalid input: {err}\\\\n\\\"\\r\\n f\\\"{err} raised KeyError. Please follow the instruction carefully.\\\\n\\\")\\r\\n else:\\r\\n print_as_ordered_list(found_books)\\r\\n\\r\\n return found_books\",\n \"def lookup():\",\n \"def find_book(code: str) -> Dict:\\n pass\",\n \"def _load_keywords(self, collection_id, path=None, libdoc=None):\\n if libdoc is None and path is None:\\n raise(Exception(\\\"You must provide either a path or libdoc argument\\\"))\\n\\n if libdoc is None:\\n libdoc = LibraryDocumentation(path)\\n\\n if len(libdoc.keywords) > 0:\\n for keyword in libdoc.keywords:\\n self._add_keyword(collection_id, keyword.name, keyword.doc, keyword.args)\",\n \"def search(self, key, headers=Headers()):\",\n \"def has_library(self, library_id, ignore_case=False, **kwargs): # lint-amnesty, pylint: disable=unused-argument\\n if not isinstance(library_id, LibraryLocator):\\n return None\\n\\n index = self.get_course_index(library_id, ignore_case)\\n if index:\\n return LibraryLocator(index['org'], index['course'], library_id.branch)\\n return None\",\n \"def search_doc(ix, to_search):\\n with ix.searcher() as searcher:\\n results = searcher.more_like(None, 'code', text=return_unicode(to_search), top=DOCS_TO_FIND)\\n info = []\\n for res in results:\\n q_id = res.fields()['question_id']\\n score = res.score\\n code = res.fields()['code']\\n info += [(q_id, res, code)]\\n return info\",\n \"def search_file(path, regex, ignore_case, include_undefined, printer):\\n re_flags = re.IGNORECASE if ignore_case else 0\\n object_files = parse_file(path)\\n results = []\\n for object_file in object_files:\\n for symbol in object_file.symbols:\\n if not include_undefined and not symbol.is_defined:\\n continue\\n if re.search(regex, symbol.name, flags=re_flags):\\n results.append(SearchResult(SymbolMatch(symbol, regex, ignore_case),\\n ObjectFileLocation(object_file)))\\n printer.print_results(results)\",\n \"def search_for_books(search_criteria, product_url, headers):\\n\\tprint \\\"od api in search_for_books \\\"\\n\\tlist_of_books = []\\n\\tlist_book = []\\n\\tq = search_criteria\\n\\tlimit = 300\\t\\t# 25 by default 300 max\\n\\toffset = 0\\t\\t# number of titles to skip\\n\\tformats = \\\"\\\"\\n\\tsort = \\\"Author:desc\\\" \\t\\t# :desc\\n\\tlastupdatetime = \\\"\\\" \\n\\tseries = \\\"\\\" \\n\\tsearch_parms = \\\"?q=%s&limit=%s&offset=0&formats=%s&sort=%s\\\" % (q, limit, \\n\\t\\t\\t\\t\\t\\t\\t\\t\\t\\t\\t\\t\\t\\t\\t\\t formats, \\n\\t\\t\\t\\t\\t\\t\\t\\t\\t\\t\\t\\t\\t\\t\\t\\t sort)\\n\\tod_url=\\\"%s%s\\\" % (product_url, search_parms)\\n\\n\\tprint \\\"overdrive url = \\\", od_url, \\\"\\\\n\\\"\\n\\tod_url = od_url.replace(' ', '%20')\\n\\tbook_response = requests.get(od_url, headers=headers)\\n\\n\\tprint \\\"book search response == \\\", book_response, \\\"reason = \\\", book_response.reason, \\\"\\\\n\\\"\\n\\tif book_response.status_code == 401:\\n\\t print \\\"Patron is not authorize to use this library == \\\", od_url, \\\"\\\\n\\\"\\n\\telif book_response.status_code > 201:\\n\\t\\tprint \\\"Get request failed == \\\", book_response.reason\\n\\telif book_response.status_code == 200 or book_response.status_code == 201:\\n\\t\\tprint \\\"Get request to get the a list of books was successful\\\", \\\"\\\\n\\\"\\n\\n\\t\\tbook_response_data = json.loads(book_response.content)\\n\\t\\tprint \\\"OverDrive book count == \\\", book_response_data['totalItems'], \\\"\\\\n\\\"\\n\\n\\t\\tif book_response_data['totalItems'] > 0:\\n\\t\\t\\tproducts = book_response_data['products']\\n\\t\\t\\tfor product in products:\\n\\t\\t\\t\\tbook_data = {}\\t\\n\\t\\t\\t\\tbook_data['images'] = product['images']['thumbnail']['href']\\n\\t\\t\\t\\tbook_data['title'] = product['title']\\n\\t\\t\\t\\tbook_data['author'] = product['primaryCreator']['name']\\n\\t\\t\\t\\tbook_data['availableToDownload'] = product['links']['availability']['href']\\n\\t\\t\\t\\tbook_data['id'] = product['id']\\n\\t\\t\\t\\tbook_data['metadata'] = product['links']['metadata']['href']\\n\\t\\t\\t\\tbook_data['origin'] = 'ODCOM'\\n\\t\\t\\t\\tlist_book = [book_data]\\n\\t\\t\\t\\tlist_of_books.extend(list_book)\\n\\t\\t\\t#end for\\n\\t\\t#end if\\n\\t#end if\\n\\n\\treturn list_of_books\",\n \"def search(self):\\n query = self.get_request_arg(\\\"query\\\")\\n if query:\\n album = self.ctrl.library.search(query)\\n return self.resp_from_data(album)\\n return self.resp_from_data(\\n {\\\"message\\\": \\\"No query parameters specified\\\"}, 400)\",\n \"def find_all(self):\",\n \"def shortsearch(term,location):\\n results = search(term,location)['listings']\\n result = []\\n for business in results:\\n result.append([business['id'],business['name'],\\\"Yellow Pages\\\"])\\n return result\",\n \"def search(words):\\n\\tglobal books\\n\\tglobal word_count\\n\\tglobal titles\\n\\n\\ttry:\\n\\t\\t#index for titles and dictionary of books\\n\\t\\ti = 0\\n\\t\\t#condition for word not found\\n\\t\\tif word_count.get(words) == None:\\n\\t\\t\\tprint(\\\"The word {} does not appear in any books in the library.\\\".format(words))\\n\\t\\t\\treturn\\n\\n\\t\\tfor vals in word_count[words]:\\n\\t\\t\\t# #if book index was empty - case where url was not active - index was removed - increase index\\n\\t\\t\\t# while(books.get(j) == None):\\n\\t\\t\\t# \\tj += 1\\n\\t\\t\\t#print the count\\n\\t\\t\\tif(vals == 1):\\n\\t\\t\\t\\tprint(\\\"The word {} appears {} time in {} (link: {})\\\".format(words,vals,titles[i],books[i]))\\n\\t\\t\\telif(vals == 0):\\n\\t\\t\\t\\tcontinue\\n\\t\\t\\telse:\\n\\t\\t\\t\\tprint(\\\"The word {} appears {} times in {} (link: {})\\\".format(words,vals,titles[i],books[i]))\\n\\t\\t\\t#increase index values\\n\\t\\t\\ti += 1\\n\\texcept:\\n\\t\\tprint(\\\"Error while searching for word.\\\")\",\n \"def search(self, find_val):\\n return False\",\n \"def search(isamAppliance, realm, subsection, check_mode=False, force=False):\\n logger.info(\\\"subsection to search under: {0} is: {1} \\\".format(realm, subsection))\\n ret_obj = realms.get(isamAppliance, realm)\\n return_obj = isamAppliance.create_return_object()\\n return_obj[\\\"warnings\\\"] = ret_obj[\\\"warnings\\\"]\\n\\n for obj in ret_obj['data']:\\n if obj['type'] == \\\"section\\\":\\n if obj['name'] == subsection:\\n logger.info(\\\"Found Kerberos realm subsection {0} id: {1}\\\".format(subsection, obj['id']))\\n return_obj['data'] = obj\\n return_obj['rc'] = 0\\n break\\n\\n return return_obj\",\n \"def search(self, searchstring):\\n return {}\",\n \"def search(self, value):\\n pass\",\n \"def test_get_foods_search(self):\\n pass\",\n \"def ahocorasick_test():\\n tree = ahocorasick.KeywordTree()\\n tree.add(\\\"alpha\\\")\\n tree.add(\\\"alpha beta\\\")\\n tree.add(\\\"gamma\\\")\\n\\n tree.make()\\n\\n result = tree.search(\\\"I went to alpha beta the other day to pick up some \\\\\\n spam\\\")\\n print(result)\\n\\n result = tree.search_long(\\\"I went to alpha beta the other day to pick up \\\\\\n some spam\\\")\\n print(result)\\n\\n result = tree.search(\\\"and also got some alphabet soup\\\")\\n print(result)\\n\\n result = tree.search(\\\"but no waffles\\\")\\n print(result)\\n\\n result = tree.search_long(\\\"on, gamma rays are not tasty\\\")\\n print(result)\\n\\n result = tree.findall(\\\"I went to alpha beta to pick up alphabet soup\\\")\\n for match in result:\\n print(match)\",\n \"def parSearch(self, mode=False):\\r\\n # research\\r\\n profprint()\\r\\n w = slicer.modules.NeedleFinderWidget\\r\\n l = w.logic\\r\\n path = [ 0 for i in range(100)]\\r\\n \\r\\n if 0:\\r\\n path[24] = '/Users/guillaume/Dropbox/AMIGO Gyn Data NRRD/Case 24 NRRD/Manual/2013-02-25-Scene-without-CtrPt.mrml'\\r\\n path[29] = '/Users/guillaume/Dropbox/AMIGO Gyn Data NRRD/Case 29 NRRD/Manual/2013-02-26-Scene-without-CtrPts.mrml'\\r\\n path[30] = '/Users/guillaume/Dropbox/AMIGO Gyn Data NRRD/Case 30 NRRD/Manual/2013-02-26-Scene-without-CtrPt.mrml'\\r\\n path[31] = '/Users/guillaume/Dropbox/AMIGO Gyn Data NRRD/Case 31 NRRD/Manual/2013-02-27-Scene-without-CtrPts.mrml'\\r\\n path[34] = '/Users/guillaume/Dropbox/AMIGO Gyn Data NRRD/Case 34 NRRD/Manual/2013-02-27-Scene-without-CtrPts.mrml'\\r\\n path[35] = '/Users/guillaume/Dropbox/AMIGO Gyn Data NRRD/Case 35 NRRD/Manual/2013-02-27-Scene-without-CtrPts.mrml'\\r\\n path[37] = '/Users/guillaume/Dropbox/AMIGO Gyn Data NRRD/Case 37 NRRD/Manual/2013-02-27-Scene-without-CtrPts.mrml'\\r\\n path[38] = '/Users/guillaume/Dropbox/AMIGO Gyn Data NRRD/Case 38 NRRD/Manual/2013-02-27-Scene-without-CtrPts.mrml'\\r\\n path[40] = '/Users/guillaume/Dropbox/AMIGO Gyn Data NRRD/Case 40 NRRD/Manual/2013-02-27-Scene-without-CtrPts.mrml'\\r\\n\\r\\n #Andre's file system (case copies from AMIGO share)\\r\\n # stripped OTHER cases\\r\\n if 0: path[33] = '/home/mastmeyer/Dropbox/GYN Cases/Case 033/NRRD/Auto-Eval-LB/2013-02-27-Scene.mrml'\\r\\n if 0:\\r\\n path[ 8] = '/home/mastmeyer/Dropbox/GYN Cases/Case 008/NRRD/Auto-Eval-LB/2013-05-07-Scene.mrml'\\r\\n path[12] = '/home/mastmeyer/Dropbox/GYN Cases/Case 012/NRRD/Auto-Eval-LB/2013-04-22-Scene.mrml'\\r\\n path[16] = '/home/mastmeyer/Dropbox/GYN Cases/Case 016/NRRD/Auto-Eval-LB/2013-04-21-Scene.mrml'\\r\\n path[21] = '/home/mastmeyer/Dropbox/GYN Cases/Case 021/NRRD/Auto-Eval-LB/2013-04-21-Scene.mrml'\\r\\n path[22] = '/home/mastmeyer/Dropbox/GYN Cases/Case 022/NRRD/Auto-Eval-LB/2013-04-21-Scene.mrml'\\r\\n path[25] = '/home/mastmeyer/Dropbox/GYN Cases/Case 025/NRRD/Auto-Eval-LB/2013-04-21-Scene.mrml'\\r\\n path[26] = '/home/mastmeyer/Dropbox/GYN Cases/Case 026/NRRD/Auto-Eval-LB/2013-04-17-Scene.mrml'\\r\\n path[27] = '/home/mastmeyer/Dropbox/GYN Cases/Case 027/NRRD/Auto-Eval-LB/2013-04-17-Scene.mrml'\\r\\n #stripped MICCAI13 cases (just manual seg. by LB/AM)\\r\\n if 1:\\r\\n path[24] = '/home/mastmeyer/Dropbox/GYN Cases/Case 024/NRRD/Auto-Eval-LB/2013-02-28-Scene.mrml'\\r\\n path[28] = '/home/mastmeyer/Dropbox/GYN Cases/Case 028/NRRD/Auto-Eval-LB/2013-02-28-Scene.mrml'\\r\\n path[29] = '/home/mastmeyer/Dropbox/GYN Cases/Case 029/NRRD/Auto-Eval-LB/2013-02-26-Scene.mrml'\\r\\n path[30] = '/home/mastmeyer/Dropbox/GYN Cases/Case 030/NRRD/Auto-Eval-LB/2013-02-26-Scene.mrml'\\r\\n path[31] = '/home/mastmeyer/Dropbox/GYN Cases/Case 031/NRRD/Auto-Eval-LB/2013-02-27-Scene.mrml'\\r\\n path[33] = '/home/mastmeyer/Dropbox/GYN Cases/Case 033/NRRD/Auto-Eval-LB/2013-02-27-Scene.mrml'\\r\\n path[34] = '/home/mastmeyer/Dropbox/GYN Cases/Case 034/NRRD/Auto-Eval-LB/2013-02-27-Scene.mrml'\\r\\n path[37] = '/home/mastmeyer/Dropbox/GYN Cases/Case 037/NRRD/Manual Alireza/2013-02-27-Scene.mrml'\\r\\n path[38] = '/home/mastmeyer/Dropbox/GYN Cases/Case 038/NRRD/Manual Alireza/2013-02-27-Scene.mrml'\\r\\n path[40] = '/home/mastmeyer/Dropbox/GYN Cases/Case 040/NRRD/Manual Alireza/2013-02-27-Scene.mrml'\\r\\n #show a directory selector for saving the results\\r\\n self.dirDialog = qt.QFileDialog(w.parent)\\r\\n self.dirDialog.setDirectory('/tmp')\\r\\n self.dirDialog.options = self.dirDialog.ShowDirsOnly\\r\\n self.dirDialog.acceptMode = self.dirDialog.AcceptSave\\r\\n #self.dirDialog.show()\\r\\n dir=self.dirDialog.getExistingDirectory()\\r\\n w.logDir=dir\\r\\n print \\\"saving results to \\\", dir\\r\\n try: shutil.copyfile('/home/amast/WualaDrive/mastmeyer/Homes/NeedleFinder/NeedleFinder/NeedleFinder.py',dir+'/NeedleFinder_ref.py')\\r\\n except: breakbox(\\\"/!\\\\ reference source NeedleFinder.py not found!\\\")\\r\\n if mode == 0:\\r\\n #save a copy of the source file as reference\\r\\n # simple run with current parameters/algo over several patients\\r\\n self.writeTableHeader(dir+'/AP-All_stats.csv')\\r\\n filLog=open(dir+'/allog.tsv', 'w')\\r\\n #filLog.write(\\\"case\\\\tman.-seg_\\\\tiStep\\\\tcrit\\\\treject\\\\tvalue\\\\tlimit\\\\n\\\")\\r\\n filLog.close()\\r\\n nUsers=1 #CONST\\r\\n for user in range(nUsers): \\r\\n w.userNr=user\\r\\n print \\\"simulated user (offset): \\\",user\\r\\n for id in range(100): #<o> range(100)\\r\\n if path[id]:\\r\\n w.caseNr=id\\r\\n print \\\"processing \\\", path[id]\\r\\n self.writeTableHeader(dir+'/User-'+str(user)+'_AP-' + str(id) + '.csv', 1)\\r\\n slicer.mrmlScene.Clear(0)\\r\\n slicer.util.loadScene(path[id])\\r\\n #TODO implement random tips in a sphere (d=2mm) from tube center \\r\\n l.startValidation(script=True, offset=user*50/nUsers)\\r\\n results, outliers = l.evaluate(script=True) # calculate HD distances\\r\\n for result in results:\\r\\n result[0:0]=[user,id]\\r\\n l.exportEvaluation(results, dir+'/User-'+str(user)+'_AP-' + str(id) + '.csv')\\r\\n #slicer.util.saveScene(dir+'/AP-' + str(id) + '.mrb') # may use lots of disk space\\r\\n # stats\\r\\n HD = np.array(results)\\r\\n # HD.shape = (int(len(results)/float(3)),3)\\r\\n maxTipHD = HD[:, 2].max()\\r\\n maxHD = HD[:, 3].max()\\r\\n avgHD = HD[:, 3].mean()\\r\\n stdHD = HD[:, 3].std()\\r\\n sl = np.sort(HD[:, 3])\\r\\n medHD = sl[sl.size / 2]\\r\\n resultsEval = [user,id,maxTipHD, maxHD, avgHD, stdHD, medHD]+[len(results)]+[len(outliers)] +[str(outliers)]+ l.valuesExperience + [id]\\r\\n l.exportEvaluation(resultsEval, dir+'/AP-All_stats.csv')\\r\\n #pause()\\r\\n msgbox(\\\"parSearch mode 0 done, results in \\\"+dir)\\r\\n elif mode == 1:\\r\\n id = 'Current'\\r\\n # simple brute force search in the dimensions (Guillaumes parameterSearch.py)\\r\\n self.writeTableHeader(dir+'/BF-' + str(id) + '.csv', 1)\\r\\n self.writeTableHeader(dir+'/BF-' + str(id) + '_stats.csv')\\r\\n for i in range(3, 12):\\r\\n # l.resetNeedleDetection(script=True) # ??? this resets the parameters to default\\r\\n w.numberOfPointsPerNeedle.setValue(i) # change parameter control points\\r\\n l.startValidation(script=True)\\r\\n results, outliers = l.evaluate(script=True) # calculate HD distances\\r\\n for result in results:\\r\\n result[0:0]=[user,id]\\r\\n l.exportEvaluation(results, dir+'/BF-' + str(id) + '.csv')\\r\\n slicer.util.saveScene(dir+'/BF-' + str(id) + '.mrb') # may use lots of disk space\\r\\n # stats\\r\\n HD = np.array(results)\\r\\n # HD.shape = (int(len(results)/float(3)),3)\\r\\n maxTipHD = HD[:, 2].max()\\r\\n maxHD = HD[:, 3].max()\\r\\n avgHD = HD[:, 3].mean()\\r\\n stdHD = HD[:, 3].std()\\r\\n sl = np.sort(HD[:, 3])\\r\\n medHD = sl[sl.size / 2]\\r\\n resultsEval = [user,id,maxTipHD,maxHD, avgHD, stdHD, medHD] +[len(results)]+[len(outliers)] +[str(outliers)]+ l.valuesExperience + [id]\\r\\n l.exportEvaluation(resultsEval, dir+'/BF-' + str(id) + '_stats.csv')\\r\\n #pause()\\r\\n msgbox(\\\"parSearch mode 1 done, results in \\\"+dir)\\r\\n elif mode == 2:\\r\\n # code piece from Guillaumes (bruteForce.py) multi patient mode search\\r\\n for id in range(100):\\r\\n if path[id]:\\r\\n w.caseNr=id\\r\\n print \\\"processing \\\", path[id]\\r\\n slicer.mrmlScene.Clear(0)\\r\\n slicer.util.loadScene(path[id])\\r\\n self.writeTableHeader(dir+'/RS-' + str(id) + '.csv', 1)\\r\\n self.writeTableHeader(dir+'/RS-' + str(id) + '_stats.csv')\\r\\n for i in range(1, 10000):\\r\\n # l.resetNeedleDetection(script=True) # ??? this resets the parameters to default\\r\\n w.radiusNeedleParameter.setValue(np.random.randint(1, 6))\\r\\n w.stepsize.setValue(np.random.randint(1, 40))\\r\\n w.sigmaValue.setValue(np.random.randint(1, 40)) # change parameter sigma\\r\\n w.gradientPonderation.setValue(np.random.randint(1, 20))\\r\\n w.exponent.setValue(np.random.randint(1, 20))\\r\\n w.numberOfPointsPerNeedle.setValue(np.random.randint(3, 11))\\r\\n l.startValidation(script=True)\\r\\n results, outliers = l.evaluate(script=True) # calculate HD distances\\r\\n for result in results:\\r\\n result[0:0]=[user,id]\\r\\n l.exportEvaluation(results, dir+'/RS-' + str(id) + '.csv')\\r\\n slicer.util.saveScene(dir+'/RS-' + str(id) + '.mrb') # may use lots of disk space\\r\\n # stats\\r\\n HD = np.array(results)\\r\\n maxTipHD = HD[:, 2].max()\\r\\n maxHD = HD[:, 3].max()\\r\\n avgHD = HD[:, 3].mean()\\r\\n stdHD = HD[:, 3].std()\\r\\n sl = np.sort(HD[:, 3])\\r\\n medHD = sl[sl.size / 2]\\r\\n resultsEval = [user,id,maxTipHD,maxHD, avgHD, stdHD, medHD] +[len(results)]+[len(outliers)] +[str(outliers)]+ l.valuesExperience + [id]\\r\\n l.exportEvaluation(resultsEval, dir+'/RS-' + str(id) + '_stats.csv')\\r\\n # end = time.time()\\r\\n # print 'processing time: ', end-start\\r\\n # start = time.time()\\r\\n #pause()\\r\\n msgbox(\\\"parSearch mode 2 done, results in \\\"+dir)\\r\\n #rof id\\r\\n #file mode 2\\r\\n slicer.mrmlScene.Clear(0) #clean up to save memory\\r\",\n \"def test_search_and(self):\\n pkgs = [\\n make_package(factory=DynamoPackage),\\n make_package(\\n \\\"somepackage\\\",\\n version=\\\"1.3\\\",\\n filename=\\\"mypath3\\\",\\n summary=\\\"this is mypkg\\\",\\n factory=DynamoPackage,\\n ),\\n make_package(\\\"mypkg2\\\", \\\"1.3.4\\\", \\\"my/other/path\\\", factory=DynamoPackage),\\n make_package(\\\"package\\\", factory=DynamoPackage),\\n ]\\n self._save_pkgs(*pkgs)\\n criteria = {\\\"name\\\": [\\\"my\\\", \\\"pkg\\\"], \\\"summary\\\": [\\\"this\\\", \\\"mypkg\\\"]}\\n packages = self.db.search(criteria, \\\"and\\\")\\n self.assertCountEqual(packages, pkgs[:-1])\",\n \"def find_library_tab(self, tab):\\n if tab in self._FIXED_TABS:\\n tabloc = self._fixed_library_region()\\n elif tab in self._MOVEABLE_TABS:\\n tabloc = self._moveable_library_region()\\n elif tab in self._EXPANDABLE_TABS:\\n tabloc = self._expandable_tab_region(tab) \\n else:\\n print \\\"%s is an unrecognized library tab\\\" % tab\\n click(Pattern(self._FIXED_LIB_TABS_IMG).similar(0.5))\\n if tabloc.exists(tab, 2):\\n return Region(tabloc.getLastMatch())\\n else: \\n type(Key.DOWN)\\n tabloc.find(tab)\\n return Region(tabloc.getLastMatch())\",\n \"def test_index_libraries(self):\\n result1 = self._create_library(slug=\\\"test-lib-index-1\\\", title=\\\"Title 1\\\", description=\\\"Description\\\")\\n result2 = self._create_library(slug=\\\"test-lib-index-2\\\", title=\\\"Title 2\\\", description=\\\"Description\\\")\\n\\n for result in [result1, result2]:\\n library_key = LibraryLocatorV2.from_string(result['id'])\\n response = ContentLibraryIndexer.get_items([library_key])[0]\\n\\n assert response['id'] == result['id']\\n assert response['title'] == result['title']\\n assert response['description'] == result['description']\\n assert response['uuid'] == result['bundle_uuid']\\n assert response['num_blocks'] == 0\\n assert response['version'] == result['version']\\n assert response['last_published'] is None\\n assert response['has_unpublished_changes'] is False\\n assert response['has_unpublished_deletes'] is False\",\n \"def test_search_and(self):\\n pkgs = [\\n make_package(factory=SQLPackage),\\n make_package(\\n \\\"somepackage\\\",\\n version=\\\"1.3\\\",\\n filename=\\\"mypath3\\\",\\n summary=\\\"this is mypkg\\\",\\n factory=SQLPackage,\\n ),\\n make_package(\\\"mypkg2\\\", \\\"1.3.4\\\", \\\"my/other/path\\\", factory=SQLPackage),\\n make_package(\\\"package\\\", factory=SQLPackage),\\n ]\\n self.sql.add_all(pkgs)\\n criteria = {\\\"name\\\": [\\\"my\\\", \\\"pkg\\\"], \\\"summary\\\": [\\\"this\\\", \\\"mypkg\\\"]}\\n packages = self.db.search(criteria, \\\"and\\\")\\n self.assertCountEqual(packages, pkgs[:-1])\",\n \"def assets_search(ctx, text, pretty):\\n ocean = ctx.obj['ocean']\\n response = ocean.search(text, pretty)\\n echo(response)\",\n \"def test_autocomplete_recipe_search(self):\\n pass\",\n \"def search(self, pattern):\\n raise NotImplementedError()\",\n \"def examineLoadLibrary(lib):\\n from PyJobTransformsCore.envutil import examine_library\\n\\n # turn module name into library name\\n if not lib.startswith('lib') and not lib.endswith('.so'):\\n lib = 'lib' + lib + '.so'\\n print (\\\"Examining library \\\" + lib)\\n diagLines = []\\n errorAcronym = None\\n missingSystemLibs = []\\n missingOtherLibs = []\\n misLibs = examine_library(lib)\\n for l in misLibs:\\n if systemLibsRE.search(l):\\n missingSystemLibs.append(l)\\n else:\\n missingOtherLibs.append(l)\\n if missingSystemLibs:\\n if len(missingSystemLibs) == 1: libWord = 'library'\\n else: libWord = 'libraries'\\n diagLines.append( 'Site problem: Missing system %s: %s' % (libWord, ','.join(missingSystemLibs)) )\\n if not errorAcronym: errorAcronym = \\\"ATH_SITE_SYSLIBS\\\"\\n\\n if missingOtherLibs:\\n if len(missingOtherLibs) == 1: libWord = 'library'\\n else: libWord = 'libraries'\\n diagLines.append( 'Can not find %s: %s Please check software installation.' % (libWord,','.join(missingOtherLibs)) )\\n if not errorAcronym: errorAcronym = \\\"ATH_SITE_LIBS\\\"\\n return (errorAcronym,os.linesep.join(diagLines))\",\n \"def find(self):\\n raise NotImplementedError\",\n \"def search_by_contains(self, tl):\\n print(\\\"Search by string\\\")\\n string = input(\\\"Please enter search string: \\\")\\n return tl.findall_contains(string)\",\n \"def search_general(abe, q):\\n def process(row):\\n (name, code3) = row\\n return { 'name': name + ' (' + code3 + ')',\\n 'uri': 'chain/' + str(name) }\\n ret = map(process, abe.store.selectall(\\\"\\\"\\\"\\n SELECT chain_name, chain_code3\\n FROM chain\\n WHERE UPPER(chain_name) LIKE '%' || ? || '%'\\n OR UPPER(chain_code3) LIKE '%' || ? || '%'\\n \\\"\\\"\\\", (q.upper(), q.upper())))\\n return ret\",\n \"def search(self, text, location=\\\"\\\"):\\n return [\\n obj.name[len(location) + 1 : -3] for obj in self._file_model.search(text) if obj.name.startswith(location)\\n ]\",\n \"def book_search(search_point: str, info: str, data: list) -> list:\\n result = []\\n for i in range(len(data)):\\n if search_point == \\\"shelf\\\":\\n try:\\n if int(info) == int(data[i][search_point]):\\n result.append(data[i])\\n except ValueError:\\n if info in data[i][search_point].lower():\\n result.append(data[i])\\n else:\\n if info in data[i][search_point].lower():\\n result.append(data[i])\\n return result\",\n \"def rescan_library(self):\\n self.scan_dir(self.libpath)\",\n \"def do_search(self, line):\\n\\t\\t# if isinstance(self.cl, Book):\\n\\t\\t# \\tst = time()\\n\\t\\t# \\tprint(\\\"\\\\nSearch results for: \\\",str(line))\\n\\t\\t# \\tfor i in self.cl.search_contact(str(line)):\\n\\t\\t# \\t\\tprint(i)\\n\\t\\t# \\tprint('Time elapsed: {:10f}'.format(time()-st))\\n\\t\\t# else:\\n\\t\\t# \\tprint(\\\"To search contacts you need to open or create a book.\\\")\\n\\t\\tif isinstance(self.cl, Book):\\n\\t\\t\\tst = time()\\n\\t\\t\\tprint(\\\"\\\\nSearch results for: \\\",str(line))\\n\\t\\t\\tw = []\\n\\t\\t\\tfor i in range(0,len(self.cl.data),10000):\\n\\t\\t\\t\\tw.append(self.cl.data[i:i+10000])\\n\\t\\t\\tworkers = []\\n\\t\\t\\tfor i in w:\\n\\t\\t\\t\\tworkers.append(Process(target=self.cl.search_contact, args=(i, str(line))))\\n\\t\\t\\tfor worker in workers:\\n\\t\\t\\t\\tworker.start()\\n\\t\\t\\tfor worker in workers:\\n\\t\\t\\t\\tworker.join()\\n\\t\\t\\tprint('Time elapsed: {:10f}'.format(time()-st))\\n\\t\\telse:\\n\\t\\t\\tprint(\\\"To search contacts you need to open or create a book.\\\")\",\n \"def search_multiple_words(words):\\n # YOUR CODE HERE #\\n pass # delete this when you write your code\",\n \"def getSearch(self, authenticationToken, guid):\\r\\n pass\",\n \"def object_search(self, ostring, caller=None,\\n global_search=False, \\n attribute_name=None, location=None):\\n #ostring = str(ostring).strip()\\n\\n if not ostring:\\n return [] \\n\\n # Easiest case - dbref matching (always exact) \\n dbref = self.dbref(ostring)\\n if dbref:\\n dbref_match = self.dbref_search(dbref)\\n if dbref_match:\\n return [dbref_match]\\n\\n if not location and caller and hasattr(caller, \\\"location\\\"):\\n location = caller.location\\n\\n # Test some common self-references\\n\\n if location and ostring == 'here':\\n return [location] \\n if caller and ostring in ['me', 'self']:\\n return [caller]\\n if caller and ostring in ['*me', '*self']: \\n return [caller] \\n \\n # Test if we are looking for an object controlled by a\\n # specific player\\n\\n if utils.to_unicode(ostring).startswith(\\\"*\\\"):\\n # Player search - try to find obj by its player's name\\n player_match = self.get_object_with_player(ostring)\\n if player_match is not None:\\n return [player_match]\\n \\n # Search for keys, aliases or other attributes\\n \\n search_locations = [None] # this means a global search\\n if not global_search and location:\\n # Test if we are referring to the current room\\n if location and (ostring.lower() == location.key.lower() \\n or ostring.lower() in [alias.lower() for alias in location.aliases]):\\n return [location]\\n # otherwise, setup the locations to search in \\n search_locations = [location]\\n if caller:\\n search_locations.append(caller)\\n \\n def local_and_global_search(ostring, exact=False):\\n \\\"Helper method for searching objects\\\" \\n matches = [] \\n for location in search_locations: \\n if attribute_name:\\n # Attribute/property search. First, search for db_<attrname> matches on the model\\n matches.extend(self.get_objs_with_db_property_match(attribute_name, ostring, location, exact))\\n if not matches:\\n # Next, try Attribute matches\\n matches.extend(self.get_objs_with_attr_match(attribute_name, ostring, location, exact))\\n else:\\n # No attribute/property named. Do a normal key/alias-search \\n matches.extend(self.get_objs_with_key_or_alias(ostring, location, exact))\\n return matches\\n\\n # Search through all possibilities.\\n\\n match_number = None\\n matches = local_and_global_search(ostring, exact=True) \\n if not matches:\\n # if we have no match, check if we are dealing with an \\\"N-keyword\\\" query - if so, strip it.\\n match_number, ostring = AT_MULTIMATCH_INPUT(ostring)\\n if match_number != None and ostring:\\n # Run search again, without match number:\\n matches = local_and_global_search(ostring, exact=True)\\n if ostring and (len(matches) > 1 or not matches):\\n # Already multimatch or no matches. Run a fuzzy matching.\\n matches = local_and_global_search(ostring, exact=False)\\n elif len(matches) > 1:\\n # multiple matches already. Run a fuzzy search. This catches partial matches (suggestions)\\n matches = local_and_global_search(ostring, exact=False)\\n \\n # deal with the result\\n if len(matches) > 1 and match_number != None:\\n # We have multiple matches, but a N-type match number is available to separate them.\\n try:\\n matches = [matches[match_number]]\\n except IndexError:\\n pass\\n # This is always a list.\\n return matches\",\n \"def LibThread(q):\\n os.nice(1)\\n time.sleep(0)\\n library = cmus.library()\\n cache = cmus.Cache()\\n liblist = {}\\n # BUG: newly added tracks don't appear in the listing as they aren't recorded\\n # neither in the cache nor in the library.pl\\n # TODO: report progress values, maybe even return partial results?\\n for track in cache:\\n # allow other thread to jump in\\n time.sleep(0)\\n try:\\n q.get_nowait()\\n q.task_done()\\n return False\\n except Queue.Empty:\\n pass\\n\\n try:\\n del library[library.index(track['file'])]\\n except ValueError:\\n # file is in cache but not in library\\n continue\\n\\n # use dummy values if no value given\\n artist = track['albumartist'] if track.has_key('albumartist') and track['albumartist'] != '' \\\\\\n else track['artist'] if track.has_key('artist') and track['artist'] != '' \\\\\\n else '[unknown]'\\n\\n album = track['album'] if track.has_key('album') and track['album'] != '' \\\\\\n else '[unknown]'\\n\\n title = track['title'] if track.has_key('title') and track['title'] != '' \\\\\\n else os.path.basename(track['file']).rsplit('.', 1)[0]\\n\\n if not liblist.has_key(artist):\\n liblist[artist] = {}\\n if not liblist[artist].has_key(album):\\n liblist[artist][album] = {}\\n liblist[artist][album][title] = track\\n\\n # TODO: get files not in cache manually\\n # (hint: library contains their paths now)\\n\\n def sorter(x):\\n ref = liblist[artist][album][x]\\n if ref.has_key('tracknumber') and ref['tracknumber'] != 0:\\n return ref['tracknumber']\\n elif ref.has_key('title') and ref['title'] != '':\\n return ref['title']\\n else:\\n return 0\\n\\n for artist in liblist.keys():\\n for album in liblist[artist].keys():\\n # sort by tracknumber if existant, title else\\n liblist[artist][album]['__keys__'] = \\\\\\n sorted(liblist[artist][album].keys(), key=sorter)\\n liblist[artist]['__keys__'] = sorted(liblist[artist].keys(), key=str.lower)\\n liblist['__keys__'] = sorted(liblist.keys(), key=str.lower)\\n q.put(liblist)\",\n \"def add_library(self):\\n library = self.new_section('The Library')\\n books = self.wiki('the-library')._soup(class_='boxbook')\\n template = (\\n '<div class=\\\"book-title\\\">{}</div>'\\n '<div class=\\\"book-description\\\">{}</div>')\\n for b in books:\\n title = b.find(class_='booktitle').string\\n description = b.find(class_='boxleft')('div')[0].text.strip()\\n excerpts = [self.wiki.site + a['href']\\n for a in b.find(class_='boxright')('a')]\\n if title == 'The Journal of Aframos Longjourney':\\n links = self.wiki(excerpts[1])._soup.select('#page-content a')\\n links = [\\n 'http://wanderers-library.wikidot.com/' +\\n l['href'].split('/')[-1] for l in links]\\n excerpts = [excerpts[0]] + links\\n book = self.add_page(\\n title, template.format(title, description), library)\\n for url in excerpts:\\n self.add_url(url, book)\",\n \"def book_search(self, term):\\n\\n try:\\n cur = self._db.cursor()\\n search = f'%{term.upper()}%'\\n cur.execute('SELECT rowid, * FROM books WHERE UPPER(title) like ? OR UPPER(author) like ?', (search, search))\\n return self._cursor_to_booklist(cur)\\n except sqlite3.Error as e:\\n raise BookError(f'Error searching for books with search term {term}') from e\",\n \"def test_search_and(self):\\n pkgs = [\\n make_package(factory=SQLPackage),\\n make_package(\\n \\\"somepackage\\\",\\n version=\\\"1.3\\\",\\n filename=\\\"mypath3\\\",\\n summary=\\\"this is mypkg\\\",\\n factory=SQLPackage,\\n ),\\n make_package(\\\"mypkg2\\\", \\\"1.3.4\\\", \\\"my/other/path\\\", factory=SQLPackage),\\n make_package(\\\"package\\\", factory=SQLPackage),\\n ]\\n for pkg in pkgs:\\n self.db.save(pkg)\\n criteria = {\\\"name\\\": [\\\"my\\\", \\\"pkg\\\"], \\\"summary\\\": [\\\"this\\\", \\\"mypkg\\\"]}\\n packages = self.db.search(criteria, \\\"and\\\")\\n self.assertCountEqual(packages, pkgs[:-1])\",\n \"def test_search(self):\\n pass\",\n \"def test_search(self):\\n pass\",\n \"def test_search(self):\\n pass\",\n \"def main():\\n domain_list = []\\n base_url = \\\"http://localhost:9200/latest-tor/_search?pretty&size=9000&_source=title,domain\\\"\\n keywords_list = ['preteen', 'loli', 'lolita', 'jailbait', 'pthc', 'best cp',\\n '\\\"child porn\\\"', '\\\"kid porn\\\"', '\\\"child sex\\\"', '\\\"cp video\\\"',\\n '\\\"nude children\\\"', '\\\"cp porn\\\"', '\\\"free child porn\\\"', 'kinderporn',\\n '\\\"child rape\\\"', '\\\"toddler porn\\\"', '\\\"kids videos\\\"', '\\\"cp videos\\\"',\\n 'lolilust', '\\\"pedo porno\\\"', '\\\"pedo content\\\"', 'underage', '\\\"cp pack\\\"',\\n 'loliporn', 'pedofamily', '\\\"cp database\\\"', '\\\"pedo webcams\\\"', 'lolitacity']\\n '\\\"xxx child\\\"', '\\\"xxx underage\\\"', '\\\"young forbidden\\\"']\\n search_terms = []\\n for index, term in enumerate(keywords_list):\\n search_terms.append(term)\\n if len(search_terms) >= 10 or index + 1 == len(keywords_list):\\n url = base_url + \\\"&q=(\\\" + \\\" OR \\\".join(search_terms).replace(\\\" \\\", \\\"%20\\\") + \\\")\\\"\\n search(url, domain_list)\\n search_terms = []\",\n \"def myhtable_index_search(files, index, terms):\\n res_file = []\\n count = 0\\n if len(terms) == 0:\\n print('empty terms')\\n return\\n for term in terms:\\n term = term.lower()\\n count += 1\\n if count == 1:\\n s = htable_get(index, term)\\n if s == None:\\n s = {-1}\\n else:\\n s = s.intersection(htable_get(index, term))\\n for id in s:\\n if id != -1:\\n res_file.append(files[id])\\n return res_file\",\n \"def scan_section(name, o):\\n\\n for n in dir(o):\\n scan(name + n, getattr(o, n))\",\n \"def do_multi_search(self, line):\\n\\t\\tif isinstance(self.cl, Book):\\n\\t\\t\\tprint(\\\"\\\\nSearch results for: \\\",str(line))\\n\\t\\t\\tt = time()\\n\\t\\t\\tself.cl.pool_str = str(line)\\n\\t\\t\\tpool = Pool(4)\\n\\t\\t\\tpool.imap_unordered(self.cl.multi_search_contact, self.cl.data, chunksize=50000)\\n\\t\\t\\tpool.close()\\n\\t\\t\\tpool.join()\\n\\t\\t\\tprint(\\\"time elapsed: {:10f}\\\".format(time()- t))\\n\\t\\telse:\\n\\t\\t\\tprint(\\\"To search contacts you need to open or create a book.\\\")\",\n \"def test_analyze_a_recipe_search_query(self):\\n pass\",\n \"def lookup(index, keyword):\\n for item in index:\\n if item[0] == keyword:\\n return item[1]\\n return []\",\n \"def section():\\n # type: () -> None\\n idx = get_arg(\\\"idx\\\", False)\\n href = get_arg(\\\"href\\\", False)\\n category = get_arg(\\\"category\\\")\\n offset = get_arg(\\\"offset\\\", 0)\\n if idx:\\n # Section menu\\n url = locs.get_search_url(idx, page=offset)\\n data = locs.get_json(url)\\n paginate(data.get(\\\"pagination\\\"), category, idx)\\n for data in data.get(\\\"facets\\\", [{}])[0].get(\\\"filters\\\"):\\n title = data.get(\\\"title\\\").title()\\n count = data.get(\\\"count\\\")\\n add_menu_item(section,\\n \\\"{} [{} items]\\\".format(title, count),\\n {\\\"href\\\": data.get(\\\"on\\\"), \\\"category\\\": title})\\n if href:\\n # Playable items\\n data = locs.get_json(href)\\n parse_search_results(data, category)\\n xbmcplugin.setContent(plugin.handle, \\\"videos\\\")\\n xbmcplugin.setPluginCategory(plugin.handle, category)\\n xbmcplugin.endOfDirectory(plugin.handle)\",\n \"def search_book(self, data):\\n query = f\\\"\\\"\\\"SELECT * from {TABLE} where \\\"{data['type']}\\\" LIKE \\\"%{data['text']}%\\\";\\\"\\\"\\\"\\n\\n self.cursor.execute(query)\\n res = self.cursor.fetchall()\\n\\n return res\",\n \"def _FindBibEntries(self):\\n bibs = \\\" \\\".join(glob.glob(\\\"*.bib\\\"))\\n cat_process = subprocess.Popen(shlex.split(\\\"cat %s\\\" % bibs),\\n stdout=subprocess.PIPE)\\n grep_process = subprocess.Popen(shlex.split(\\\"grep ^@\\\"),\\n stdin=cat_process.stdout,\\n stdout=subprocess.PIPE)\\n cat_process.stdout.close()\\n grep2_process = subprocess.Popen(shlex.split(\\\"grep -vi @string\\\"),\\n stdin=grep_process.stdout,\\n stdout=subprocess.PIPE)\\n grep_process.stdout.close()\\n\\n lines = grep2_process.communicate()[0]\\n\\n ret = []\\n for l in lines.split(\\\"\\\\n\\\"):\\n ret.append(responses.BuildCompletionData(\\n re.sub(r\\\"@([A-Za-z]*)\\\\s*{\\\\s*([^,]*),.*\\\", r\\\"\\\\2\\\", l)\\n )\\n )\\n return ret\",\n \"def search_book():\\n\\n title = request.form.get(\\\"search\\\")\\n books = book_search_results(GR_KEY, title)\\n acct = get_current_account(session['acct'])\\n search = True\\n\\n return render_template(\\\"index.html\\\", books=books, acct=acct, search=search)\",\n \"def __init__(self, lib, search_val):\\n self.__dict__['__lib__'] = lib\\n self.__dict__['__con__'] = lib.get_con()\\n\\n res = self.__con__.search_s(\\n self.__ldap_group_ou__,\\n ldap.SCOPE_SUBTREE,\\n \\\"(cn=%s)\\\" % search_val,\\n ['cn'])\\n\\n if res:\\n self.__dict__['__dn__'] = res[0][0]\\n else:\\n raise KeyError(\\\"Invalid Search Name\\\")\",\n \"def _linesearch(self):\\n pass\",\n \"def keyword_search(keywords):\\n try:\\n return itunespy.search(keywords)[0]\\n except LookupError:\\n return None\",\n \"def search(snippet_portion, filename):\\n\\tlogging.info(\\\"Searching for {} in {}\\\".format(snippet_portion, filename))\\n\\tlogging.debug(\\\"Opening file\\\")\\n\\twith open(filename, \\\"r+\\\") as f:\\n\\t\\treader = csv.reader(f)\\n\\t\\tlogging.debug(\\\"Searching for\\\")\\n\\t\\tin_file = False\\n\\t\\tfor row in reader:\\n\\t\\t\\tif str(row[1]) == snippet_portion:\\n\\t\\t\\t\\tin_file = True\\n\\t\\t\\t\\tprint row\\n\\t\\tif in_file == False:\\n\\t\\t\\tprint \\\"That's not in this file\\\"\\n\\tlogging.debug(\\\"Search complete\\\")\\n\\treturn snippet_portion, filename\",\n \"def get_library_summaries(self, **kwargs):\\n branch = 'library'\\n libraries_summaries = []\\n for entry, structure_info in self._get_courselike_blocks_for_branch(branch, **kwargs):\\n library_locator = self._create_library_locator(structure_info, branch=None)\\n library_block = [\\n block_data\\n for block_key, block_data in entry['blocks'].items()\\n if block_key.type == \\\"library\\\"\\n ]\\n if not library_block:\\n raise ItemNotFoundError\\n\\n if len(library_block) > 1:\\n raise MultipleLibraryBlocksFound(\\n \\\"Expected 1 library block, but found {}\\\".format(len(library_block))\\n )\\n\\n library_block_fields = library_block[0].fields\\n display_name = ''\\n\\n if 'display_name' in library_block_fields:\\n display_name = library_block_fields['display_name']\\n\\n libraries_summaries.append(\\n LibrarySummary(library_locator, display_name)\\n )\\n\\n return libraries_summaries\",\n \"def _add_search_patch():\\n # Create extra cookbook dir\\n lib_path = os.path.join(\\n node_work_path, cookbook_paths[0], 'chef_solo_search_lib', 'libraries')\\n with hide('running', 'stdout'):\\n sudo('mkdir -p {0}'.format(lib_path))\\n # Add search and environment patch to the node's cookbooks\\n for filename in ('search.rb', 'parser.rb', 'environment.rb'):\\n put(os.path.join(basedir, filename),\\n os.path.join(lib_path, filename), use_sudo=True)\",\n \"def search_sd(terms):\\n\\n print('-- Search ScienceDirect:', len(terms), 'terms.')\\n\\n books = defaultdict(set)\\n for result in pool.imap(search_sd_helper, chunks(terms, 200)):\\n for book in result:\\n books[book] |= result[book]\\n\\n return books\",\n \"def searchDiscover(self, query, limit=30, libtype=None):\\n libtypes = {'movie': 'movies', 'show': 'tv'}\\n libtype = libtypes.get(libtype, 'movies,tv')\\n\\n headers = {\\n 'Accept': 'application/json'\\n }\\n params = {\\n 'query': query,\\n 'limit': limit,\\n 'searchTypes': libtype,\\n 'includeMetadata': 1\\n }\\n\\n data = self.query(f'{self.METADATA}/library/search', headers=headers, params=params)\\n searchResults = data['MediaContainer'].get('SearchResults', [])\\n searchResult = next((s.get('SearchResult', []) for s in searchResults if s.get('id') == 'external'), [])\\n\\n results = []\\n for result in searchResult:\\n metadata = result['Metadata']\\n type = metadata['type']\\n if type == 'movie':\\n tag = 'Video'\\n elif type == 'show':\\n tag = 'Directory'\\n else:\\n continue\\n attrs = ''.join(f'{k}=\\\"{html.escape(str(v))}\\\" ' for k, v in metadata.items())\\n xml = f'<{tag} {attrs}/>'\\n results.append(self._manuallyLoadXML(xml))\\n\\n return self._toOnlineMetadata(results)\",\n \"def full_search(pw, *arg, **kw):\\n return pw.search(*arg, **kw)\",\n \"def main():\\n\\tdescription = \\\"Utility to search for spotify by song, artist or song ID and to create playlists based off of song ID's\\\"\\n\\tusage = \\\"search.py [-h] [-s SONG | -a ARTIST | -i ID] [-p PLAYLIST & -u USERNAME & -i ID & -d DESCRIPTION]\\\"\\n\\tparser = argparse.ArgumentParser(description=description, usage=usage)\\n\\tgroup = parser.add_mutually_exclusive_group()\\n\\tgroup.add_argument(\\\"-s\\\", \\\"--song\\\", nargs=1, required='--argument' in sys.argv, help=\\\"Search for a song by name\\\")\\n\\tgroup.add_argument(\\\"-a\\\", \\\"--artist\\\", nargs=1, required='--argument' in sys.argv,\\n\\t\\t\\t\\t\\t help=\\\"Search for songs from an Artist\\\\n\\\")\\n\\tgroup.add_argument(\\\"-i\\\", \\\"--id\\\", nargs=1, required='--argument' in sys.argv,\\n\\t\\t\\t\\t\\t help=\\\"Search for song based on ID or create playlist based off of song ID\\\")\\n\\tparser.add_argument(\\\"-p\\\", \\\"--playlist\\\", nargs=1, required='--id' in sys.argv,\\n\\t\\t\\t\\t\\t\\thelp=\\\"Name of the playlist to be created. MUST be used with -i/--id\\\")\\n\\tparser.add_argument(\\\"-d\\\", \\\"--description\\\", nargs=1, required='--argument' in sys.argv,\\n\\t\\t\\t\\t\\t\\thelp=\\\"Playlist Description. Must be used with -p,-i and -u\\\")\\n\\tparser.add_argument(\\\"-u\\\", \\\"--username\\\", nargs=1, required='--argumnet' in sys.argv,\\n\\t\\t\\t\\t\\t\\thelp=\\\"Spotify Username. Must be used with -p, -i and -d\\\")\\n\\targs = parser.parse_args()\\n\\t# print(args)\\n\\n\\tsolr = Solr_Query()\\n\\n\\tresponse = None\\n\\n\\tif args.song:\\n\\t\\tprint(\\\"Searching for song:\\\", args.song[0].strip())\\n\\t\\tsong_name = args.song[0].strip()\\n\\t\\tsolr.set_search_type(\\\"songs\\\")\\n\\t\\tquery = solr.set_query(song_name)\\n\\t\\tresponse = solr.exec_query(query)\\n\\t\\tsolr.print_search_results(response)\\n\\n\\tif args.artist:\\n\\t\\tprint(\\\"Searching for songs by artist: \\\", args.artist[0].strip())\\n\\t\\tartist = args.artist[0].strip()\\n\\t\\tsolr.set_search_type(\\\"artists\\\")\\n\\t\\tquery = solr.set_query(artist)\\n\\t\\tresponse = solr.exec_query(query)\\n\\t\\tsolr.print_search_results(response)\\n\\n\\t# Still trying to figure this one out. The getmorelike this funcionality is harder than we thought\\n\\tif args.playlist and args.id and args.description and args.username:\\n\\t\\tprint(\\\"Creating a playlist based off of song ID:\\\", args.id[0].strip())\\n\\t\\tid = args.id[0].strip()\\n\\t\\tdescription = args.description[0].strip()\\n\\t\\tplaylist = args.playlist[0].strip()\\n\\t\\tusername = args.username[0].strip()\\n\\n\\t\\tsolr.set_search_type(\\\"id\\\")\\n\\t\\tquery = solr.set_query(id)\\n\\t\\tresponse = solr.exec_query(query)\\n\\n\\t\\t# Create a playlist create object to find similar songs and create the playlist\\n\\t\\tcreator = Playlist_Create(username, playlist, description)\\n\\t\\tcreator.authenticate() # authenticate using the username passed in\\n\\t\\tresponse = creator.get_similar_songs(response)\\n\\t\\tsongs = creator.get_song_ids(response)\\n\\t\\tplaylist_id = creator.create_playlist()\\n\\t\\tcreator.add_songs(playlist_id, songs)\\n\\n\\n\\n\\telif args.playlist and not args.id:\\n\\t\\tparser.error(\\\"Must input a song ID to create a playlist with!\\\")\\n\\telif args.playlist and not args.description:\\n\\t\\tparser.error(\\\"Must input a playlist description\\\")\\n\\telif args.playlist and not args.username:\\n\\t\\tparser.error(\\\"Need your username to create the playlist\\\")\\n\\n\\tif args.id:\\n\\t\\tprint(\\\"Searching for song with ID:\\\", args.id[0].strip())\\n\\t\\tid = args.id[0].strip()\\n\\t\\tsolr.set_search_type(\\\"id\\\")\\n\\t\\tquery = solr.set_query(id)\\n\\t\\tresponse = solr.exec_query(query)\\n\\t\\tsolr.print_search_results(response)\\n\\n\\tprint(\\\"\\\\nDone!\\\")\",\n \"def test_search_or(self):\\n pkgs = [\\n make_package(factory=DynamoPackage),\\n make_package(\\n \\\"somepackage\\\",\\n version=\\\"1.3\\\",\\n filename=\\\"mypath3\\\",\\n summary=\\\"this is mypkg\\\",\\n factory=DynamoPackage,\\n ),\\n make_package(\\\"mypkg2\\\", \\\"1.3.4\\\", \\\"my/other/path\\\", factory=DynamoPackage),\\n make_package(\\\"package\\\", factory=DynamoPackage),\\n ]\\n self._save_pkgs(*pkgs)\\n criteria = {\\\"name\\\": [\\\"mypkg\\\"], \\\"summary\\\": [\\\"mypkg\\\"]}\\n packages = self.db.search(criteria, \\\"or\\\")\\n self.assertCountEqual(packages, pkgs[:-1])\",\n \"def search(pac, man='all'):\\n if man == 'all':\\n print \\\"Searching all package managers\\\"\\n if pacman['fink'] != 'None':\\n search_fink(pac)\\n if pacman['brew'] != 'None':\\n search_brew(pac)\\n if pacman['port'] != 'None':\\n search_port(pac)\\n if pacman['pip'] != 'None':\\n search_pip(pac)\\n if pacman['gem'] != 'None':\\n search_gem(pac)\\n if pacman['cpan'] != 'None':\\n search_cpan(pac)\\n search_whohas(pac)\\n else:\\n nofunzone = {'fink': search_fink, 'brew': search_brew, 'port': search_port, 'pip': search_pip, 'gem': search_gem, 'cpan': search_cpan} \\n #print nofunzone\\n try:\\n f = nofunzone[man]\\n print \\\"trying to run a search on %s for %s\\\" % (man, pac)\\n f(pac)\\n except KeyError:\\n print \\\"Please use search like this: haberdashery.py search package manager: \\\\nhaberdashery.py search %s %s\\\" % (man, pac)\\n # locals()['search_%s(pac)' % man]\",\n \"def index_search(files, index, terms):\\n\\n\\n termlist = set()\\n\\n for i in range(len(terms)):\\n for j in range(len(terms[i].split(\\\" \\\"))):\\n\\n termlist.add(terms[i].split(\\\" \\\")[j])\\n\\n indexlist = [index[w] for w in termlist]\\n\\n intersect = list(set.intersection(*indexlist))\\n\\n return [files[x] for x in intersect]\",\n \"def findItems(self, QString, Qt_MatchFlags): # real signature unknown; restored from __doc__\\r\\n pass\",\n \"def search():\\n\\tif not request.vars.search_term:\\n\\t\\tredirect(URL('index'))\\n\\tterm = request.vars.search_term\\n\\torigterm = term\\n\\tterm = term.replace(' ','|')\\n\\tartists = db.executesql(\\\"select distinct(m1.id), m1.art_name, m1.artist_type, m1.country, m1.b_year,m1.b_month,m1.b_date,m1.e_year,m1.e_month,m1.e_day,ts_rank(to_tsvector(m1.art_name),to_tsquery('\\\"+term+\\\"')) rank from art_info m1 where to_tsvector('english',m1.art_name) @@ to_tsquery('\\\"+term+\\\"') order by rank desc limit 20;\\\")\\n\\talbums = db.executesql(\\\"select distinct(m1.id),m2.name,m1.art_id,m1.art_name,m1.rel_type,m1.count,ts_rank(to_tsvector(m2.name),to_tsquery('\\\"+term+\\\"')) rank from rel_art m1, release_name m2, release_group m3 where m3.name = m2.id and m3.id = m1.id and to_tsvector('english',m2.name) @@ to_tsquery('\\\"+term+\\\"') order by rank desc limit 20;\\\")\\n\\tsongs = db.executesql(\\\"select m2.id, m1.name, m3.art_id, m3.art_name, m3.rel_id, m3.rel_name from track_name m1, recording m2, rec_rel_art m3 where m1.id = m2.name and m2.id = m3.rec_id and lower(m1.name) LIKE lower('%%\\\"+origterm+\\\"%%') limit 20;\\\")\\n\\treturn dict(songs=songs, albums=albums, artists=artists)\"\n]","isConversational":false},"negative_scores":{"kind":"list like","value":["0.66239214","0.5919388","0.5910919","0.58785844","0.58637214","0.58380646","0.58259964","0.58247703","0.57671076","0.5762657","0.5658307","0.5657428","0.56097376","0.5589635","0.55391014","0.55387616","0.5529388","0.55221266","0.5514941","0.5492186","0.5486801","0.5474961","0.54684436","0.5460892","0.54139674","0.5405555","0.53914595","0.5370723","0.53641415","0.5359274","0.5354579","0.5322831","0.5298109","0.52961665","0.5294647","0.5277834","0.5272247","0.5257613","0.52342147","0.52260983","0.52099794","0.52029306","0.5197373","0.518323","0.51713365","0.5169415","0.51598024","0.51552546","0.51319325","0.51238096","0.511322","0.50998175","0.5099115","0.5089515","0.50880134","0.50869936","0.5076098","0.5073354","0.5061138","0.50596726","0.505875","0.5058379","0.5058272","0.5051341","0.5050559","0.5049867","0.5048768","0.5044463","0.5038022","0.5032233","0.50309926","0.5030526","0.50299877","0.50284326","0.50284326","0.50284326","0.5022985","0.50179446","0.5014738","0.50127333","0.5004979","0.5004146","0.5002634","0.5002498","0.4991503","0.49860245","0.4984802","0.49674982","0.49586925","0.49573132","0.49553415","0.49488512","0.49471527","0.49456114","0.49427864","0.49392986","0.49390686","0.49360377","0.49351972","0.49333882","0.4928357"],"string":"[\n \"0.66239214\",\n \"0.5919388\",\n \"0.5910919\",\n \"0.58785844\",\n \"0.58637214\",\n \"0.58380646\",\n \"0.58259964\",\n \"0.58247703\",\n \"0.57671076\",\n \"0.5762657\",\n \"0.5658307\",\n \"0.5657428\",\n \"0.56097376\",\n \"0.5589635\",\n \"0.55391014\",\n \"0.55387616\",\n \"0.5529388\",\n \"0.55221266\",\n \"0.5514941\",\n \"0.5492186\",\n \"0.5486801\",\n \"0.5474961\",\n \"0.54684436\",\n \"0.5460892\",\n \"0.54139674\",\n \"0.5405555\",\n \"0.53914595\",\n \"0.5370723\",\n \"0.53641415\",\n \"0.5359274\",\n \"0.5354579\",\n \"0.5322831\",\n \"0.5298109\",\n \"0.52961665\",\n \"0.5294647\",\n \"0.5277834\",\n \"0.5272247\",\n \"0.5257613\",\n \"0.52342147\",\n \"0.52260983\",\n \"0.52099794\",\n \"0.52029306\",\n \"0.5197373\",\n \"0.518323\",\n \"0.51713365\",\n \"0.5169415\",\n \"0.51598024\",\n \"0.51552546\",\n \"0.51319325\",\n \"0.51238096\",\n \"0.511322\",\n \"0.50998175\",\n \"0.5099115\",\n \"0.5089515\",\n \"0.50880134\",\n \"0.50869936\",\n \"0.5076098\",\n \"0.5073354\",\n \"0.5061138\",\n \"0.50596726\",\n \"0.505875\",\n \"0.5058379\",\n \"0.5058272\",\n \"0.5051341\",\n \"0.5050559\",\n \"0.5049867\",\n \"0.5048768\",\n \"0.5044463\",\n \"0.5038022\",\n \"0.5032233\",\n \"0.50309926\",\n \"0.5030526\",\n \"0.50299877\",\n \"0.50284326\",\n \"0.50284326\",\n \"0.50284326\",\n \"0.5022985\",\n \"0.50179446\",\n \"0.5014738\",\n \"0.50127333\",\n \"0.5004979\",\n \"0.5004146\",\n \"0.5002634\",\n \"0.5002498\",\n \"0.4991503\",\n \"0.49860245\",\n \"0.4984802\",\n \"0.49674982\",\n \"0.49586925\",\n \"0.49573132\",\n \"0.49553415\",\n \"0.49488512\",\n \"0.49471527\",\n \"0.49456114\",\n \"0.49427864\",\n \"0.49392986\",\n \"0.49390686\",\n \"0.49360377\",\n \"0.49351972\",\n \"0.49333882\",\n \"0.4928357\"\n]","isConversational":false},"document_score":{"kind":"string","value":"0.0"},"document_rank":{"kind":"string","value":"-1"}}},{"rowIdx":10199,"cells":{"query":{"kind":"string","value":"List all active sessions."},"document":{"kind":"string","value":"def sessions(self):\n return utils.listItems(self, '/status/sessions')"},"metadata":{"kind":"string","value":"{\n \"objective\": {\n \"self\": [],\n \"paired\": [],\n \"triplet\": [\n [\n \"query\",\n \"document\",\n \"negatives\"\n ]\n ]\n }\n}"},"negatives":{"kind":"list like","value":["def get_sessions(self):\n\n return self.all_sessions","def get_sessions_list():\n sessions = Session.query.all()\n result = sessions_schema.dump(sessions).data\n return jsonify({'status': 'success', 'message': None, 'data': result}), 200","def fusion_api_get_active_sessions(self):\n return self.loginsession.get_active_sessions()","def sessions(self):\n return list(Session.get_sessions(self))","def session_list(self, endpoint_name=None):\n if endpoint_name is None:\n _, body = self.request('/v1.1/endpoint/sessions', 'GET')\n else:\n _, body = self.request('/v1.1/endpoints/%s/sessions' % endpoint_name, 'GET')\n return body","def sessions(self):\n logger.debug(\"Get sessions\")\n return self._raw_api.sessions.get()","def get_sessions(self):\n return self.current_sessions","def active_sessions(self):\n skey = self.r_key('active_sessions')\n sessions_to_expire = []\n for user_id in self.r_server.smembers(skey):\n ukey = self.r_key('session', user_id)\n if self.r_server.exists(ukey):\n yield user_id, self.load_session(user_id)\n else:\n sessions_to_expire.append(user_id)\n\n # clear empty ones\n for user_ids in sessions_to_expire:\n self.r_server.srem(skey, user_id)","def list(self, status: Optional[str] = None) -> SessionList:\n filter = {\"status\": status} if status else None\n return self._list(list_cls=SessionList, resource_cls=Session, method=\"GET\", filter=filter)","def list(self, request, *args, **kwargs):\n self.check_authentication(request)\n serializer = SessionSerializer(\n context={\"request\": request, \"view\": self},\n instance=[_Session(request)],\n many=True,\n )\n return Response(serializer.data)","def sessions(self):\n return self._sessions","def list(self):\n return {str(k): v for k, v in self.rpc.call(MsfRpcMethod.SessionList).items()} # Convert int id to str","def get_all_sessions(self) -> list:\n sessions = list()\n for stream_id in self.streams.keys():\n tcpsession, session_position, network_tuple = self.streams[stream_id]\n sessions.append(tcpsession.get_session(session_position - 1))\n return sessions","def sessions(self):\n return self.rpc.compatiblesessions(self.modulename)","def print_sessions(self):\n print(\"[Printing Sessions]\")\n for key in self.sessions.keys():\n print(f\"{key}:\\n\\t{self.sessions[key]}\")","def fusion_api_get_active_user_sessions(self, param='', api=None, headers=None):\n return self.usersessions.get(api=api, headers=headers, param=param)","def list():\n rino.login.list()","def sessions(self, *args, **kwargs):\r\n return self._get('Sessions', *args, **kwargs)","def _sessions(self):\n return self.__sessions","def get_active_sessions():\n\n # The output changes based on locales, force it to be YY-MM-DD\n # for the benefit of split()\n os.environ['LANG'] = 'en_GB.utf8'\n try:\n output = subprocess.check_output(['who']).rstrip()\n except subprocess.CalledProcessError:\n print 'UNKNOWN: unable to invoke who'\n sys.exit(NAGIOS_UNKNOWN)\n\n # Nothing to process\n if not output:\n return {}\n\n sessions = {}\n for line in output.split(\"\\n\"):\n fields = line.split()\n sessions[fields[1]] = {\n 'user': fields[0],\n 'date': fields[2],\n 'time': fields[3],\n 'source': fields[4][1:-1] if len(fields) >= 5 else None,\n }\n\n return sessions","def sessions(self):\n for session_id in self.get_sessions(): \n session = Session(self.session_cache, self.sid, session_id)\n yield session","def get_current_users(self):\n active_sessions = Session.objects.filter(expire_date__gte=timezone.now())\n user_id_list = []\n for session in active_sessions:\n data = session.get_decoded()\n user_id_list.append(data.get('_auth_user_id', None))\n # Query all logged in users based on id list\n return self.filter(id__in=user_id_list)","def get_sessions(url: str, token: str) -> List[Session]:\n sessions_url = f'{url}api/sessions'\n response = requests.get(sessions_url, params={'token': token})\n assert(response.status_code == 200)\n sessions_raw = json.loads(response.text)\n sessions = []\n for session_raw in sessions_raw:\n session = Session(\n path = session_raw['path'],\n last_activity = dateutil.parser.isoparse(session_raw['kernel']['last_activity']),\n execution_state = session_raw['kernel']['execution_state']\n )\n assert(session['execution_state'] in valid_execution_states)\n sessions.append(session)\n\n sessions.sort(key=lambda session: session['last_activity'], reverse=True)\n return sessions","def list():\n cmd_output = None\n\n try:\n cmd_output = tmux_exec('ls')\n except CalledProcessError:\n return []\n\n sessions = cmd_output.strip().split('\\n')\n sessions = map(lambda session: session.split(':')[0], sessions)\n\n return sessions","def iter_sessions():\n return iter(_session_stack)","def all (self):\n sparql_results = self.query (\"\"\"\n select distinct ?rs ?session ?name ?number ?pid ?sitename\n where {\n \n ?rs rdf:type austalk:RecordedSession .\n ?rs olac:speaker ?participant .\n \n ?participant austalk:id ?pid .\n ?participant austalk:recording_site ?site .\n ?site rdfs:label ?sitename .\n \n ?rs austalk:prototype ?session .\n ?session austalk:name ?name .\n ?session austalk:id ?number .\n }\n ORDER BY ?name\"\"\")\n\n results = []\n\n for result in sparql_results[\"results\"][\"bindings\"]:\n\n results.append (Session (\n client = self.client,\n identifier = result[\"rs\"][\"value\"],\n prototype = result[\"session\"][\"value\"],\n name = result[\"name\"][\"value\"],\n number = result[\"number\"][\"value\"],\n site = result[\"sitename\"][\"value\"],\n participantId = result[\"pid\"][\"value\"]))\n\n return results","def filtered_sessions(self):\n return self.stage.filtered_sessions","def get(self):\n\n response = openvidu().list_sessions()\n\n if response.status_code == 200:\n return response.json()[\"content\"]\n abort(response)","def active():\n session = session_maker(\n app.config['MYSQL_USER'], app.config['MYSQL_PASS'], app.config['MYSQL_SERVER_PORT_3306_TCP_ADDR'],\n app.config['MYSQL_SERVER_PORT_3306_TCP_PORT'], app.config['DB'])\n\n\n print(\n tabulate(\n selection_list_active(session),\n headers=['number', 'sqlid', 'name', 'city', 'state']))","def get_users_list(self, session):\n\n users = session.query(User.chat_id).filter(User.is_admin==False).all()\n return users","def sessions(self):\n\n return File.session_choices","def filtered_session_names(self):\n return list(self.stage.filtered_sessions.keys())","def discard_all_sessions(self):\n\n url = f\"{self.server_and_port}/web_api/show-sessions\"\n headers = self.get_headers()\n payload = {\n \"limit\": 20, # This will make 20 calls to the API at most, if there are more sessions than that its trouble\n \"view-published-sessions\": False,\n }\n request = requests.post(url, json=payload, headers=headers, verify=self.ssl_verify)\n try:\n request.raise_for_status()\n except Exception as e:\n # The errors returned by this api aren't very good\n # It's a 400 with some error text.\n raise PluginException(\n cause=\"There was problem publishing to Check Point NGFW.\",\n assistance=request.text,\n data=e,\n )\n\n url_discard = f\"{self.server_and_port}/web_api/discard\"\n sessions = request.json().get(\"objects\")\n for session in sessions:\n uid = session.get(\"uid\")\n discard_payload = {\"uid\": uid}\n\n requests.post(url_discard, json=discard_payload, headers=headers, verify=self.ssl_verify)\n\n self.publish() # Yes, you have to publish that you are not publishing\n self.logout()\n\n self.get_sid()","def list_remote_access_sessions(arn=None, nextToken=None):\n pass","def _getSessionsInWishlist(self):\n user = endpoints.get_current_user()\n if not user:\n raise endpoints.UnauthorizedException('Authorization required')\n profile = self._getProfileFromUser()\n # Fetch the entities and return them\n return ndb.get_multi(profile.sessionWishlist)","def list(self, datasource_name=None, event_name=None, requested_after=None, requested_before=None, session_type=None):\n query = {\n 'dataSourceName': datasource_name,\n 'eventName': event_name,\n 'requestedBefore': requested_before,\n 'requestedAfter': requested_after,\n 'sessionType': session_type\n }\n response, _, headers = self._client.request_with_headers('GET', 'sessions', params=query)\n\n return [SessionResponse(item, headers) for item in response.get('items', [])]","def find_sessions(sfe):\n print(\"-\" * 20 + \" find_sessions started\")\n isessions = sfe.list_iscsisessions()\n json_isessions = isessions.to_json()\n return json_isessions","def get_users_list_full(self, session):\n\n users = session.query(\n User.chat_id,\n User.is_banned,\n User.username,\n User.first_name,\n User.last_name,\n User.time_registered\n ).filter(User.is_admin==False).all()\n return users","def session_start(self, ignored):\n self.get_online_users()","def dump_sessions(self):\n logger.info(\"sessions:\")\n with self._sessions_lock:\n for session_id in self.sessions:\n logger.info(session_id)\n\n # def set_session_master(self, handler):\n # \"\"\"\n # Call the setmaster() method for every session. Returns True when\n # a session having the given handler was updated.\n # \"\"\"\n # found = False\n #\n # with self._sessions_lock:\n # for session_id in self.sessions:\n # found = self.sessions[session_id].set_master(handler)\n # if found is True:\n # break\n #\n # return found","def _getSessionsBySpeaker(self, request):\n # Ensure that the speaker key is valid and that the speaker exists\n speaker = _getEntityByWebsafeKey(request.websafeSpeakerKey, 'Speaker')\n # Return all of the speaker's sessions\n return ndb.get_multi(speaker.sessions)","def dump_sessions(self, data):\n try:\n with open(\"sessions.json\", \"w\") as file:\n json.dump(data, file)\n except:\n print(\"Can not save active sessions list to disk. Check permissions.\")","def safe_session(self) -> Iterator[\"Session\"]:\n with self._lock:\n yield self.session","def sessions(self):\n return SessionManager(self)","def get_all_users(session):\n\n return session.query(User).all()","def active_sessions(request, order_number):\n account = get_object_or_404(User, username=request.user)\n order = get_object_or_404(Order, order_number=order_number)\n\n # CHECK FOR ACTIVE SESSIONS\n lineitems = OrderLineItem.objects.filter(order=order)\n session = None\n\n current_ts = datetime.datetime.now(tz=pytz.timezone('UTC'))\n\n for item in lineitems:\n seconds_until = (item.start_datetime - current_ts).total_seconds()\n # IF WITHIN 5 MIN OF SESSION START TIME, OR CURRENT TIME IS START TIME,\n # OR CURRENT TIME IS BETWEEN START AND END TIME\n if (seconds_until < 300 or current_ts == item.start_datetime or\n current_ts > item.start_datetime and current_ts < item.end_datetime):\n session = item\n if session:\n context = {\n 'account': account,\n 'order': order,\n 'session': session,\n }\n return render(request, 'active_sessions/active_sessions.html', context)\n else:\n return redirect('/profile')","def get_list(db_session: Session = Depends(get_db), current_user: models.User = Depends(get_current_admin_user)):\n return crud.get_all(db_session)","def get_conference_sessions(self, request):\n return self.session_service.get_conference_sessions(\n request.websafeConferenceKey)","def active_users(request):\n user_id = BhagirathSession.objects.all().filter(logout_timestamp=None).values('user').distinct(true_or_false=True)\n \n dict = {}\n list = []\n for i in user_id:\n k = User.objects.get(pk=i['user'])\n j = BhagirathSession.objects.all().filter(user=k,logout_timestamp=None)\n dict['username'] = k.username\n dict['login_timestamp'] = j[0].login_timestamp\n list.append(dict)\n data = {\n 'active_users_list':list,\n 'count':len(list)\n }\n return render_to_response('my_admin_tools/menu/active_users.html',data,context_instance=RequestContext(request))","def get_session_ids(self):\n with self._sessions_lock:\n session_ids = self.sessions.keys()\n\n return session_ids","def list_users(self):\n raise NotImplementedError","def GetSessions(firebase: firebase) -> None:\n\n global sessions\n obj_key_list = []\n \n result = firebase.get('/session', None)\n \n if result is None:\n print(\"no sessions found\")\n return\n \n for i in result.keys():\n obj_key_list.append(i)\n \n for i in obj_key_list:\n session = Session()\n session.setId(i)\n session.setCourseId(result[i]['courseid'])\n session.setDOW(result[i]['DOW'])\n session.setSessionNumber(result[i]['session_number'])\n session.setSessionDate(result[i]['session_date'])\n session.setSessionTimeStart(result[i]['session_time_start'])\n session.setSessionTimeEnd(result[i]['session_time_end'])\n sessions.append(session)","def listUsers(self):\n return self._client.listUsers()","def getSessionsData(self):\n export_data = self.get_api_results(\n \"/api/session/export?api_key={0}&format=json\")\n export_data = self.purge_misc_sessions(export_data)\n return export_data","def getTokens(self):\n self.__require_privilaged_access()\n with DBSession(self.__config_db) as session:\n user = self.getLoggedInUser()\n sessionTokens = session.query(Session) \\\n .filter(Session.user_name == user) \\\n .filter(Session.can_expire.is_(False)) \\\n .all()\n\n result = []\n for t in sessionTokens:\n result.append(SessionTokenData(\n t.token,\n t.description,\n str(t.last_access)))\n\n return result","def get_sessions(self, network_tuple: NetworkTuple) -> list:\n tcpsession = self.sessions[network_tuple]\n session_list = tcpsession.get_sessions_list()\n return session_list","def search_sessions(name: str, provider: Optional[str] = None) -> List[str]:\n sessions = session_list(provider=provider).sessions\n name = name.lower()\n return [s.id for s in sessions if s.id.lower().startswith(name)]","def clear_sessions():\n call_command(\"clearsessions\")","def stations():\n # Query all stations\n results = session.query(Measurement.station).group_by(Measurement.station).all()\n all_sessions = list(np.ravel(results))\n return jsonify(all_sessions)","def list(self):\n return self.connection.get(self.service)","def get_all_users():\n return jsonify(admin.get_all_users(current_app.scoped_session()))","def do_sessions(self, args):\n logger.debug(\"do_sessions() was called\")\n\t\n parser = CrispyArgumentParser(description=self.do_sessions.__doc__, prog=\"sessions\")\n parser.add_argument(\"-i\", dest=\"interact\", help=\"pop a shell on a given session\", metavar=\"<session_id>\", type=int)\n parser.add_argument(\"-k\", dest=\"kill_id\", help=\"kill the selected session\", metavar=\"<session_id>\", type=int)\n parser.add_argument(\"-l\", action=\"store_true\", dest=\"list\", help=\"list all active sessions\")\n \n try:\n pargs = parser.parse_args(shlex.split(args))\n \n if pargs is None:\n return\n else:\n if isinstance(pargs.interact, int):\n fprint.info(\"Interacting w/ session {}...\".format(pargs.interact))\n client = self.srv.get_client(pargs.interact)\n try:\n interact(client.conn)\n except Exception as e:\n fprint.error(e)\n elif isinstance(pargs.kill_id, int):\n client = self.srv.get_client(pargs.kill_id)\n \n if client:\n try:\n client.conn.exit()\n except:\n pass\n else:\n fprint.warning(\"No session with id: {}\".format(pargs.kill_id))\n elif pargs.list:\n if not self.srv.get_client_list():\n fprint.info(\"There are no active sessions.\")\n else:\n print \"\\nActive sessions:\\n===================\"\n for client in self.srv.get_client_list():\n print \"{}\".format(client.short_name())\n fprint.success(\"Done.\")\n else:\n parser.print_help()\n except MyParserException as e:\n print e","def sessions(self, path:str):\n\n if not os.path.exists(path):\n print(path + ' doesn\\'t exist!')\n return\n\n cur_session = None\n cur_time = 0\n last_time = 0\n num_entries = 0\n\n def pop_session():\n delta = last_time - cur_time\n time_str = str(datetime.timedelta(seconds=delta)).split('.')[0]\n print('Session % 3d: % 8d entries | %s elapsed' % (cur_session, num_entries, time_str))\n\n with open(path, 'r') as f:\n for line in f:\n line = line.strip()\n if len(line) > 0:\n js = json.loads(line)\n if js['type'] == 'session':\n if cur_session is not None:\n pop_session()\n cur_time = js['time']\n cur_session = js['session']\n num_entries = 0\n last_time = js['time']\n num_entries += 1\n \n pop_session()","def all():\n session = session_maker(\n app.config['MYSQL_USER'], app.config['MYSQL_PASS'], app.config['MYSQL_SERVER_PORT_3306_TCP_ADDR'],\n app.config['MYSQL_SERVER_PORT_3306_TCP_PORT'], app.config['DB'])\n\n print(\n tabulate(\n selection_list_all(session),\n headers=['number', 'sqlid', 'name', 'city', 'state']))","def get_free_sessions(self):\n return [session for session in self.sessions if not session.is_booked()]","def return_active_users():\n return json.dumps(app.active_users)","def getSessionByUsername(self, username):\n match = []\n for session in self.sessions:\n if (session.identifier[1] == username):\n match.append(session)\n return match","def display_users(cls):\n return cls.user_list","def all(self):\n list_of_objs = []\n for obj in self.__session.query(User):\n obj = obj.__dict__\n del obj[\"_sa_instance_state\"]\n list_of_objs.append(obj)\n return list_of_objs","def wishlist_sessions(self, user):\n wishlist_key = self.get_wishlist_key(user)\n session_keys = [ndb.Key(urlsafe=wsck) for wsck in\n wishlist_key.get().sessionKeys]\n sessions = ndb.get_multi(session_keys)\n return sessions","def cmd_list(self):\n rc = self.socket_command('list', False)\n return rc","def listAll(self):\n red = self.dbConnect()\n return red.keys()","def get_sessions_in_wishlist(self, request):\n user = endpoints.get_current_user()\n return self.wishlist_service.get_sessions_in_wishlist(user)","def active_users(self, *args, **kwargs):\r\n return self._get('ActiveUsers', *args, **kwargs)","def users():\n access_token = session['access_token']\n return \"%s\" % list_users(access_token)","def _getConferenceSessions(self, request):\n # Ensure that websafeConferenceKey is a valid conference key\n confKey = _raiseIfWebsafeKeyNotValid(request.websafeConferenceKey,\n 'Conference')\n # Retrieve all sessions that have a matching conference key\n sessions = Session.query(Session.conference == confKey).fetch()\n return sessions","def printsessions(update, context, sessions_file, sessions_passed_file):\n\n\tsessions_list = get_sessions_list(sessions_file)\n\tsessions_passed_list = get_sessions_list(sessions_passed_file)\n\tsessions_all_list = sessions_list + sessions_passed_list\n\n\tif (len(sessions_all_list) == 0):\n\t\tupdate.effective_message.reply_text('Session list is empty.\\n')\n\t\treturn\n\n\telse:\n\t\theaders = ('Date/Time', 'URL', 'Passed')\n\t\trows = [session.values() for session in sessions_all_list]\n\t\ttab_all_sessions_list = \"```\" + tabulate.tabulate(rows, headers, tablefmt=\"simple\", showindex=\"always\") + \"```\"\n\t\tupdate.effective_message.reply_text(tab_all_sessions_list, parse_mode=\"Markdown\")\n\n\treturn","def sessionsFull(self, nodeList) :\n\t\tsessIDlist = []\n\t\tfor i in range (len(nodeList)) :\n\t\t\tfor j in range(len(nodeList)):\n\t\t\t\tif(i != j) :\n\t\t\t\t\tsessIDlist.append((i,j, (nodeList[i].createSyncSession(nodeList[j], nodeList[j].instanceID))))\n\t\treturn sessIDlist","def get_iscsi_sessions(host_executor):\n rc, out, err = host_executor.run_cmd(config.ISCSIADM_SESSION)\n if rc:\n if \"No active sessions\" in err:\n return None\n else:\n logger.error(\n \"Unable to execute command %s\", config.ISCSIADM_SESSION\n )\n raise Exception(\n \"Error executing %s command: %s\"\n % (config.ISCSIADM_SESSION, err)\n )\n return out.rstrip().splitlines()","def get_or_create_sessions(self):\n\t\tpath = f'{self.BIKE_ENDPOINT}user/current/session?{self.secret_key}'\n\t\tresponse = requests.get(path).json()\n\t\tself.check_api_key(response)\n\n\t\treturn response","def reload_sessions(self):\n import glob \n sessions = glob.glob('*.session')\n for x in sessions:\n self._db['accounts'][x.split('.')[0]] = { 'session': x.split('.')[0] }","def any_active(self):\n for session_id in self.get_sessions():\n session = Session(self.session_cache, self.sid, session_id)\n try:\n info = session.get()\n if \"authentication\" in info and info[\"authentication\"] == \"OK\":\n return True\n except ToOld:\n pass\n \n return False","def describe_sessions(StackName=None, FleetName=None, UserId=None, NextToken=None, Limit=None, AuthenticationType=None):\n pass","def get_speaker_sessions(self, request):\n return self.session_service.get_speaker_sessions(\n request.websafeSpeakerKey)","def list_active_customer():\n active_customer = Customer.select().where(Customer.is_active).count()\n LOGGER.info('Number of active customers retrieved.')\n return active_customer","async def view_session(request: Request):\n return JSONResponse(request.session)","def SessionIndex(self):\n if self.force_auto_sync:\n self.get('SessionIndex')\n return self._SessionIndex","def get_upcoming_sessions(self):\n return [session for session in self.sessions if not session.is_complete()]","def get_all_users():\n return session.query(User).all()","def index(request):\n\n # todo implement\n # create a watchlist for a user if Logged in and the watchlist doesn't yet exist\n if request.user.is_authenticated and \"watchlist\" not in request.session:\n request.session[\"watchlist\"] = []\n \n return render(request, \"auctions/index.html\", {\"listings\": Listing.objects.filter(isActive=True)})","def get_booked_sessions(self):\n return [session for session in self.sessions if session.is_booked()]","def get_users_admins_list(self, session):\n\n users = session.query(User.chat_id).all()\n return users","def close_all_sessions() -> None:\n\n for sess in _sessions.values():\n sess.close()","def test_getallsessions_reliability(self):\n for _ in range(100):\n sessions = AudioUtilities.GetAllSessions()\n assert len(sessions) > 0","def get_sessions_by_type(self, request):\n return self.session_service.get_conference_sessions_by_type(\n request.websafeConferenceKey, request.sessionType)","def list(self):\n return self.rpc.call(MsfRpcMethod.ConsoleList)['consoles']","def list_active_customers():\n init_database()\n return Customer.select().where(Customer.active_status).count()","def list(self):\n\t\tif self.client is None:\n\t\t\traise UsageError(\"Not connected!\")\n\t\treturn self.client.list_conns()","def inactive():\n session = session_maker(\n app.config['MYSQL_USER'], app.config['MYSQL_PASS'], app.config['MYSQL_SERVER_PORT_3306_TCP_ADDR'],\n app.config['MYSQL_SERVER_PORT_3306_TCP_PORT'], app.config['DB'])\n\n print(\n tabulate(\n selection_list_inactive(session),\n headers=['number', 'sqlid', 'name', 'city', 'state']))","def list_active_customers():\n with cm.DATABASE.transaction():\n # .select() has a .where() method to specify criteria for searching\n active_customers = cm.Customer.select().where(\n cm.Customer.status == \"Active\").count()\n LOGGER.info(\"Active customers: %s\", active_customers)\n return active_customers"],"string":"[\n \"def get_sessions(self):\\n\\n return self.all_sessions\",\n \"def get_sessions_list():\\n sessions = Session.query.all()\\n result = sessions_schema.dump(sessions).data\\n return jsonify({'status': 'success', 'message': None, 'data': result}), 200\",\n \"def fusion_api_get_active_sessions(self):\\n return self.loginsession.get_active_sessions()\",\n \"def sessions(self):\\n return list(Session.get_sessions(self))\",\n \"def session_list(self, endpoint_name=None):\\n if endpoint_name is None:\\n _, body = self.request('/v1.1/endpoint/sessions', 'GET')\\n else:\\n _, body = self.request('/v1.1/endpoints/%s/sessions' % endpoint_name, 'GET')\\n return body\",\n \"def sessions(self):\\n logger.debug(\\\"Get sessions\\\")\\n return self._raw_api.sessions.get()\",\n \"def get_sessions(self):\\n return self.current_sessions\",\n \"def active_sessions(self):\\n skey = self.r_key('active_sessions')\\n sessions_to_expire = []\\n for user_id in self.r_server.smembers(skey):\\n ukey = self.r_key('session', user_id)\\n if self.r_server.exists(ukey):\\n yield user_id, self.load_session(user_id)\\n else:\\n sessions_to_expire.append(user_id)\\n\\n # clear empty ones\\n for user_ids in sessions_to_expire:\\n self.r_server.srem(skey, user_id)\",\n \"def list(self, status: Optional[str] = None) -> SessionList:\\n filter = {\\\"status\\\": status} if status else None\\n return self._list(list_cls=SessionList, resource_cls=Session, method=\\\"GET\\\", filter=filter)\",\n \"def list(self, request, *args, **kwargs):\\n self.check_authentication(request)\\n serializer = SessionSerializer(\\n context={\\\"request\\\": request, \\\"view\\\": self},\\n instance=[_Session(request)],\\n many=True,\\n )\\n return Response(serializer.data)\",\n \"def sessions(self):\\n return self._sessions\",\n \"def list(self):\\n return {str(k): v for k, v in self.rpc.call(MsfRpcMethod.SessionList).items()} # Convert int id to str\",\n \"def get_all_sessions(self) -> list:\\n sessions = list()\\n for stream_id in self.streams.keys():\\n tcpsession, session_position, network_tuple = self.streams[stream_id]\\n sessions.append(tcpsession.get_session(session_position - 1))\\n return sessions\",\n \"def sessions(self):\\n return self.rpc.compatiblesessions(self.modulename)\",\n \"def print_sessions(self):\\n print(\\\"[Printing Sessions]\\\")\\n for key in self.sessions.keys():\\n print(f\\\"{key}:\\\\n\\\\t{self.sessions[key]}\\\")\",\n \"def fusion_api_get_active_user_sessions(self, param='', api=None, headers=None):\\n return self.usersessions.get(api=api, headers=headers, param=param)\",\n \"def list():\\n rino.login.list()\",\n \"def sessions(self, *args, **kwargs):\\r\\n return self._get('Sessions', *args, **kwargs)\",\n \"def _sessions(self):\\n return self.__sessions\",\n \"def get_active_sessions():\\n\\n # The output changes based on locales, force it to be YY-MM-DD\\n # for the benefit of split()\\n os.environ['LANG'] = 'en_GB.utf8'\\n try:\\n output = subprocess.check_output(['who']).rstrip()\\n except subprocess.CalledProcessError:\\n print 'UNKNOWN: unable to invoke who'\\n sys.exit(NAGIOS_UNKNOWN)\\n\\n # Nothing to process\\n if not output:\\n return {}\\n\\n sessions = {}\\n for line in output.split(\\\"\\\\n\\\"):\\n fields = line.split()\\n sessions[fields[1]] = {\\n 'user': fields[0],\\n 'date': fields[2],\\n 'time': fields[3],\\n 'source': fields[4][1:-1] if len(fields) >= 5 else None,\\n }\\n\\n return sessions\",\n \"def sessions(self):\\n for session_id in self.get_sessions(): \\n session = Session(self.session_cache, self.sid, session_id)\\n yield session\",\n \"def get_current_users(self):\\n active_sessions = Session.objects.filter(expire_date__gte=timezone.now())\\n user_id_list = []\\n for session in active_sessions:\\n data = session.get_decoded()\\n user_id_list.append(data.get('_auth_user_id', None))\\n # Query all logged in users based on id list\\n return self.filter(id__in=user_id_list)\",\n \"def get_sessions(url: str, token: str) -> List[Session]:\\n sessions_url = f'{url}api/sessions'\\n response = requests.get(sessions_url, params={'token': token})\\n assert(response.status_code == 200)\\n sessions_raw = json.loads(response.text)\\n sessions = []\\n for session_raw in sessions_raw:\\n session = Session(\\n path = session_raw['path'],\\n last_activity = dateutil.parser.isoparse(session_raw['kernel']['last_activity']),\\n execution_state = session_raw['kernel']['execution_state']\\n )\\n assert(session['execution_state'] in valid_execution_states)\\n sessions.append(session)\\n\\n sessions.sort(key=lambda session: session['last_activity'], reverse=True)\\n return sessions\",\n \"def list():\\n cmd_output = None\\n\\n try:\\n cmd_output = tmux_exec('ls')\\n except CalledProcessError:\\n return []\\n\\n sessions = cmd_output.strip().split('\\\\n')\\n sessions = map(lambda session: session.split(':')[0], sessions)\\n\\n return sessions\",\n \"def iter_sessions():\\n return iter(_session_stack)\",\n \"def all (self):\\n sparql_results = self.query (\\\"\\\"\\\"\\n select distinct ?rs ?session ?name ?number ?pid ?sitename\\n where {\\n \\n ?rs rdf:type austalk:RecordedSession .\\n ?rs olac:speaker ?participant .\\n \\n ?participant austalk:id ?pid .\\n ?participant austalk:recording_site ?site .\\n ?site rdfs:label ?sitename .\\n \\n ?rs austalk:prototype ?session .\\n ?session austalk:name ?name .\\n ?session austalk:id ?number .\\n }\\n ORDER BY ?name\\\"\\\"\\\")\\n\\n results = []\\n\\n for result in sparql_results[\\\"results\\\"][\\\"bindings\\\"]:\\n\\n results.append (Session (\\n client = self.client,\\n identifier = result[\\\"rs\\\"][\\\"value\\\"],\\n prototype = result[\\\"session\\\"][\\\"value\\\"],\\n name = result[\\\"name\\\"][\\\"value\\\"],\\n number = result[\\\"number\\\"][\\\"value\\\"],\\n site = result[\\\"sitename\\\"][\\\"value\\\"],\\n participantId = result[\\\"pid\\\"][\\\"value\\\"]))\\n\\n return results\",\n \"def filtered_sessions(self):\\n return self.stage.filtered_sessions\",\n \"def get(self):\\n\\n response = openvidu().list_sessions()\\n\\n if response.status_code == 200:\\n return response.json()[\\\"content\\\"]\\n abort(response)\",\n \"def active():\\n session = session_maker(\\n app.config['MYSQL_USER'], app.config['MYSQL_PASS'], app.config['MYSQL_SERVER_PORT_3306_TCP_ADDR'],\\n app.config['MYSQL_SERVER_PORT_3306_TCP_PORT'], app.config['DB'])\\n\\n\\n print(\\n tabulate(\\n selection_list_active(session),\\n headers=['number', 'sqlid', 'name', 'city', 'state']))\",\n \"def get_users_list(self, session):\\n\\n users = session.query(User.chat_id).filter(User.is_admin==False).all()\\n return users\",\n \"def sessions(self):\\n\\n return File.session_choices\",\n \"def filtered_session_names(self):\\n return list(self.stage.filtered_sessions.keys())\",\n \"def discard_all_sessions(self):\\n\\n url = f\\\"{self.server_and_port}/web_api/show-sessions\\\"\\n headers = self.get_headers()\\n payload = {\\n \\\"limit\\\": 20, # This will make 20 calls to the API at most, if there are more sessions than that its trouble\\n \\\"view-published-sessions\\\": False,\\n }\\n request = requests.post(url, json=payload, headers=headers, verify=self.ssl_verify)\\n try:\\n request.raise_for_status()\\n except Exception as e:\\n # The errors returned by this api aren't very good\\n # It's a 400 with some error text.\\n raise PluginException(\\n cause=\\\"There was problem publishing to Check Point NGFW.\\\",\\n assistance=request.text,\\n data=e,\\n )\\n\\n url_discard = f\\\"{self.server_and_port}/web_api/discard\\\"\\n sessions = request.json().get(\\\"objects\\\")\\n for session in sessions:\\n uid = session.get(\\\"uid\\\")\\n discard_payload = {\\\"uid\\\": uid}\\n\\n requests.post(url_discard, json=discard_payload, headers=headers, verify=self.ssl_verify)\\n\\n self.publish() # Yes, you have to publish that you are not publishing\\n self.logout()\\n\\n self.get_sid()\",\n \"def list_remote_access_sessions(arn=None, nextToken=None):\\n pass\",\n \"def _getSessionsInWishlist(self):\\n user = endpoints.get_current_user()\\n if not user:\\n raise endpoints.UnauthorizedException('Authorization required')\\n profile = self._getProfileFromUser()\\n # Fetch the entities and return them\\n return ndb.get_multi(profile.sessionWishlist)\",\n \"def list(self, datasource_name=None, event_name=None, requested_after=None, requested_before=None, session_type=None):\\n query = {\\n 'dataSourceName': datasource_name,\\n 'eventName': event_name,\\n 'requestedBefore': requested_before,\\n 'requestedAfter': requested_after,\\n 'sessionType': session_type\\n }\\n response, _, headers = self._client.request_with_headers('GET', 'sessions', params=query)\\n\\n return [SessionResponse(item, headers) for item in response.get('items', [])]\",\n \"def find_sessions(sfe):\\n print(\\\"-\\\" * 20 + \\\" find_sessions started\\\")\\n isessions = sfe.list_iscsisessions()\\n json_isessions = isessions.to_json()\\n return json_isessions\",\n \"def get_users_list_full(self, session):\\n\\n users = session.query(\\n User.chat_id,\\n User.is_banned,\\n User.username,\\n User.first_name,\\n User.last_name,\\n User.time_registered\\n ).filter(User.is_admin==False).all()\\n return users\",\n \"def session_start(self, ignored):\\n self.get_online_users()\",\n \"def dump_sessions(self):\\n logger.info(\\\"sessions:\\\")\\n with self._sessions_lock:\\n for session_id in self.sessions:\\n logger.info(session_id)\\n\\n # def set_session_master(self, handler):\\n # \\\"\\\"\\\"\\n # Call the setmaster() method for every session. Returns True when\\n # a session having the given handler was updated.\\n # \\\"\\\"\\\"\\n # found = False\\n #\\n # with self._sessions_lock:\\n # for session_id in self.sessions:\\n # found = self.sessions[session_id].set_master(handler)\\n # if found is True:\\n # break\\n #\\n # return found\",\n \"def _getSessionsBySpeaker(self, request):\\n # Ensure that the speaker key is valid and that the speaker exists\\n speaker = _getEntityByWebsafeKey(request.websafeSpeakerKey, 'Speaker')\\n # Return all of the speaker's sessions\\n return ndb.get_multi(speaker.sessions)\",\n \"def dump_sessions(self, data):\\n try:\\n with open(\\\"sessions.json\\\", \\\"w\\\") as file:\\n json.dump(data, file)\\n except:\\n print(\\\"Can not save active sessions list to disk. Check permissions.\\\")\",\n \"def safe_session(self) -> Iterator[\\\"Session\\\"]:\\n with self._lock:\\n yield self.session\",\n \"def sessions(self):\\n return SessionManager(self)\",\n \"def get_all_users(session):\\n\\n return session.query(User).all()\",\n \"def active_sessions(request, order_number):\\n account = get_object_or_404(User, username=request.user)\\n order = get_object_or_404(Order, order_number=order_number)\\n\\n # CHECK FOR ACTIVE SESSIONS\\n lineitems = OrderLineItem.objects.filter(order=order)\\n session = None\\n\\n current_ts = datetime.datetime.now(tz=pytz.timezone('UTC'))\\n\\n for item in lineitems:\\n seconds_until = (item.start_datetime - current_ts).total_seconds()\\n # IF WITHIN 5 MIN OF SESSION START TIME, OR CURRENT TIME IS START TIME,\\n # OR CURRENT TIME IS BETWEEN START AND END TIME\\n if (seconds_until < 300 or current_ts == item.start_datetime or\\n current_ts > item.start_datetime and current_ts < item.end_datetime):\\n session = item\\n if session:\\n context = {\\n 'account': account,\\n 'order': order,\\n 'session': session,\\n }\\n return render(request, 'active_sessions/active_sessions.html', context)\\n else:\\n return redirect('/profile')\",\n \"def get_list(db_session: Session = Depends(get_db), current_user: models.User = Depends(get_current_admin_user)):\\n return crud.get_all(db_session)\",\n \"def get_conference_sessions(self, request):\\n return self.session_service.get_conference_sessions(\\n request.websafeConferenceKey)\",\n \"def active_users(request):\\n user_id = BhagirathSession.objects.all().filter(logout_timestamp=None).values('user').distinct(true_or_false=True)\\n \\n dict = {}\\n list = []\\n for i in user_id:\\n k = User.objects.get(pk=i['user'])\\n j = BhagirathSession.objects.all().filter(user=k,logout_timestamp=None)\\n dict['username'] = k.username\\n dict['login_timestamp'] = j[0].login_timestamp\\n list.append(dict)\\n data = {\\n 'active_users_list':list,\\n 'count':len(list)\\n }\\n return render_to_response('my_admin_tools/menu/active_users.html',data,context_instance=RequestContext(request))\",\n \"def get_session_ids(self):\\n with self._sessions_lock:\\n session_ids = self.sessions.keys()\\n\\n return session_ids\",\n \"def list_users(self):\\n raise NotImplementedError\",\n \"def GetSessions(firebase: firebase) -> None:\\n\\n global sessions\\n obj_key_list = []\\n \\n result = firebase.get('/session', None)\\n \\n if result is None:\\n print(\\\"no sessions found\\\")\\n return\\n \\n for i in result.keys():\\n obj_key_list.append(i)\\n \\n for i in obj_key_list:\\n session = Session()\\n session.setId(i)\\n session.setCourseId(result[i]['courseid'])\\n session.setDOW(result[i]['DOW'])\\n session.setSessionNumber(result[i]['session_number'])\\n session.setSessionDate(result[i]['session_date'])\\n session.setSessionTimeStart(result[i]['session_time_start'])\\n session.setSessionTimeEnd(result[i]['session_time_end'])\\n sessions.append(session)\",\n \"def listUsers(self):\\n return self._client.listUsers()\",\n \"def getSessionsData(self):\\n export_data = self.get_api_results(\\n \\\"/api/session/export?api_key={0}&format=json\\\")\\n export_data = self.purge_misc_sessions(export_data)\\n return export_data\",\n \"def getTokens(self):\\n self.__require_privilaged_access()\\n with DBSession(self.__config_db) as session:\\n user = self.getLoggedInUser()\\n sessionTokens = session.query(Session) \\\\\\n .filter(Session.user_name == user) \\\\\\n .filter(Session.can_expire.is_(False)) \\\\\\n .all()\\n\\n result = []\\n for t in sessionTokens:\\n result.append(SessionTokenData(\\n t.token,\\n t.description,\\n str(t.last_access)))\\n\\n return result\",\n \"def get_sessions(self, network_tuple: NetworkTuple) -> list:\\n tcpsession = self.sessions[network_tuple]\\n session_list = tcpsession.get_sessions_list()\\n return session_list\",\n \"def search_sessions(name: str, provider: Optional[str] = None) -> List[str]:\\n sessions = session_list(provider=provider).sessions\\n name = name.lower()\\n return [s.id for s in sessions if s.id.lower().startswith(name)]\",\n \"def clear_sessions():\\n call_command(\\\"clearsessions\\\")\",\n \"def stations():\\n # Query all stations\\n results = session.query(Measurement.station).group_by(Measurement.station).all()\\n all_sessions = list(np.ravel(results))\\n return jsonify(all_sessions)\",\n \"def list(self):\\n return self.connection.get(self.service)\",\n \"def get_all_users():\\n return jsonify(admin.get_all_users(current_app.scoped_session()))\",\n \"def do_sessions(self, args):\\n logger.debug(\\\"do_sessions() was called\\\")\\n\\t\\n parser = CrispyArgumentParser(description=self.do_sessions.__doc__, prog=\\\"sessions\\\")\\n parser.add_argument(\\\"-i\\\", dest=\\\"interact\\\", help=\\\"pop a shell on a given session\\\", metavar=\\\"<session_id>\\\", type=int)\\n parser.add_argument(\\\"-k\\\", dest=\\\"kill_id\\\", help=\\\"kill the selected session\\\", metavar=\\\"<session_id>\\\", type=int)\\n parser.add_argument(\\\"-l\\\", action=\\\"store_true\\\", dest=\\\"list\\\", help=\\\"list all active sessions\\\")\\n \\n try:\\n pargs = parser.parse_args(shlex.split(args))\\n \\n if pargs is None:\\n return\\n else:\\n if isinstance(pargs.interact, int):\\n fprint.info(\\\"Interacting w/ session {}...\\\".format(pargs.interact))\\n client = self.srv.get_client(pargs.interact)\\n try:\\n interact(client.conn)\\n except Exception as e:\\n fprint.error(e)\\n elif isinstance(pargs.kill_id, int):\\n client = self.srv.get_client(pargs.kill_id)\\n \\n if client:\\n try:\\n client.conn.exit()\\n except:\\n pass\\n else:\\n fprint.warning(\\\"No session with id: {}\\\".format(pargs.kill_id))\\n elif pargs.list:\\n if not self.srv.get_client_list():\\n fprint.info(\\\"There are no active sessions.\\\")\\n else:\\n print \\\"\\\\nActive sessions:\\\\n===================\\\"\\n for client in self.srv.get_client_list():\\n print \\\"{}\\\".format(client.short_name())\\n fprint.success(\\\"Done.\\\")\\n else:\\n parser.print_help()\\n except MyParserException as e:\\n print e\",\n \"def sessions(self, path:str):\\n\\n if not os.path.exists(path):\\n print(path + ' doesn\\\\'t exist!')\\n return\\n\\n cur_session = None\\n cur_time = 0\\n last_time = 0\\n num_entries = 0\\n\\n def pop_session():\\n delta = last_time - cur_time\\n time_str = str(datetime.timedelta(seconds=delta)).split('.')[0]\\n print('Session % 3d: % 8d entries | %s elapsed' % (cur_session, num_entries, time_str))\\n\\n with open(path, 'r') as f:\\n for line in f:\\n line = line.strip()\\n if len(line) > 0:\\n js = json.loads(line)\\n if js['type'] == 'session':\\n if cur_session is not None:\\n pop_session()\\n cur_time = js['time']\\n cur_session = js['session']\\n num_entries = 0\\n last_time = js['time']\\n num_entries += 1\\n \\n pop_session()\",\n \"def all():\\n session = session_maker(\\n app.config['MYSQL_USER'], app.config['MYSQL_PASS'], app.config['MYSQL_SERVER_PORT_3306_TCP_ADDR'],\\n app.config['MYSQL_SERVER_PORT_3306_TCP_PORT'], app.config['DB'])\\n\\n print(\\n tabulate(\\n selection_list_all(session),\\n headers=['number', 'sqlid', 'name', 'city', 'state']))\",\n \"def get_free_sessions(self):\\n return [session for session in self.sessions if not session.is_booked()]\",\n \"def return_active_users():\\n return json.dumps(app.active_users)\",\n \"def getSessionByUsername(self, username):\\n match = []\\n for session in self.sessions:\\n if (session.identifier[1] == username):\\n match.append(session)\\n return match\",\n \"def display_users(cls):\\n return cls.user_list\",\n \"def all(self):\\n list_of_objs = []\\n for obj in self.__session.query(User):\\n obj = obj.__dict__\\n del obj[\\\"_sa_instance_state\\\"]\\n list_of_objs.append(obj)\\n return list_of_objs\",\n \"def wishlist_sessions(self, user):\\n wishlist_key = self.get_wishlist_key(user)\\n session_keys = [ndb.Key(urlsafe=wsck) for wsck in\\n wishlist_key.get().sessionKeys]\\n sessions = ndb.get_multi(session_keys)\\n return sessions\",\n \"def cmd_list(self):\\n rc = self.socket_command('list', False)\\n return rc\",\n \"def listAll(self):\\n red = self.dbConnect()\\n return red.keys()\",\n \"def get_sessions_in_wishlist(self, request):\\n user = endpoints.get_current_user()\\n return self.wishlist_service.get_sessions_in_wishlist(user)\",\n \"def active_users(self, *args, **kwargs):\\r\\n return self._get('ActiveUsers', *args, **kwargs)\",\n \"def users():\\n access_token = session['access_token']\\n return \\\"%s\\\" % list_users(access_token)\",\n \"def _getConferenceSessions(self, request):\\n # Ensure that websafeConferenceKey is a valid conference key\\n confKey = _raiseIfWebsafeKeyNotValid(request.websafeConferenceKey,\\n 'Conference')\\n # Retrieve all sessions that have a matching conference key\\n sessions = Session.query(Session.conference == confKey).fetch()\\n return sessions\",\n \"def printsessions(update, context, sessions_file, sessions_passed_file):\\n\\n\\tsessions_list = get_sessions_list(sessions_file)\\n\\tsessions_passed_list = get_sessions_list(sessions_passed_file)\\n\\tsessions_all_list = sessions_list + sessions_passed_list\\n\\n\\tif (len(sessions_all_list) == 0):\\n\\t\\tupdate.effective_message.reply_text('Session list is empty.\\\\n')\\n\\t\\treturn\\n\\n\\telse:\\n\\t\\theaders = ('Date/Time', 'URL', 'Passed')\\n\\t\\trows = [session.values() for session in sessions_all_list]\\n\\t\\ttab_all_sessions_list = \\\"```\\\" + tabulate.tabulate(rows, headers, tablefmt=\\\"simple\\\", showindex=\\\"always\\\") + \\\"```\\\"\\n\\t\\tupdate.effective_message.reply_text(tab_all_sessions_list, parse_mode=\\\"Markdown\\\")\\n\\n\\treturn\",\n \"def sessionsFull(self, nodeList) :\\n\\t\\tsessIDlist = []\\n\\t\\tfor i in range (len(nodeList)) :\\n\\t\\t\\tfor j in range(len(nodeList)):\\n\\t\\t\\t\\tif(i != j) :\\n\\t\\t\\t\\t\\tsessIDlist.append((i,j, (nodeList[i].createSyncSession(nodeList[j], nodeList[j].instanceID))))\\n\\t\\treturn sessIDlist\",\n \"def get_iscsi_sessions(host_executor):\\n rc, out, err = host_executor.run_cmd(config.ISCSIADM_SESSION)\\n if rc:\\n if \\\"No active sessions\\\" in err:\\n return None\\n else:\\n logger.error(\\n \\\"Unable to execute command %s\\\", config.ISCSIADM_SESSION\\n )\\n raise Exception(\\n \\\"Error executing %s command: %s\\\"\\n % (config.ISCSIADM_SESSION, err)\\n )\\n return out.rstrip().splitlines()\",\n \"def get_or_create_sessions(self):\\n\\t\\tpath = f'{self.BIKE_ENDPOINT}user/current/session?{self.secret_key}'\\n\\t\\tresponse = requests.get(path).json()\\n\\t\\tself.check_api_key(response)\\n\\n\\t\\treturn response\",\n \"def reload_sessions(self):\\n import glob \\n sessions = glob.glob('*.session')\\n for x in sessions:\\n self._db['accounts'][x.split('.')[0]] = { 'session': x.split('.')[0] }\",\n \"def any_active(self):\\n for session_id in self.get_sessions():\\n session = Session(self.session_cache, self.sid, session_id)\\n try:\\n info = session.get()\\n if \\\"authentication\\\" in info and info[\\\"authentication\\\"] == \\\"OK\\\":\\n return True\\n except ToOld:\\n pass\\n \\n return False\",\n \"def describe_sessions(StackName=None, FleetName=None, UserId=None, NextToken=None, Limit=None, AuthenticationType=None):\\n pass\",\n \"def get_speaker_sessions(self, request):\\n return self.session_service.get_speaker_sessions(\\n request.websafeSpeakerKey)\",\n \"def list_active_customer():\\n active_customer = Customer.select().where(Customer.is_active).count()\\n LOGGER.info('Number of active customers retrieved.')\\n return active_customer\",\n \"async def view_session(request: Request):\\n return JSONResponse(request.session)\",\n \"def SessionIndex(self):\\n if self.force_auto_sync:\\n self.get('SessionIndex')\\n return self._SessionIndex\",\n \"def get_upcoming_sessions(self):\\n return [session for session in self.sessions if not session.is_complete()]\",\n \"def get_all_users():\\n return session.query(User).all()\",\n \"def index(request):\\n\\n # todo implement\\n # create a watchlist for a user if Logged in and the watchlist doesn't yet exist\\n if request.user.is_authenticated and \\\"watchlist\\\" not in request.session:\\n request.session[\\\"watchlist\\\"] = []\\n \\n return render(request, \\\"auctions/index.html\\\", {\\\"listings\\\": Listing.objects.filter(isActive=True)})\",\n \"def get_booked_sessions(self):\\n return [session for session in self.sessions if session.is_booked()]\",\n \"def get_users_admins_list(self, session):\\n\\n users = session.query(User.chat_id).all()\\n return users\",\n \"def close_all_sessions() -> None:\\n\\n for sess in _sessions.values():\\n sess.close()\",\n \"def test_getallsessions_reliability(self):\\n for _ in range(100):\\n sessions = AudioUtilities.GetAllSessions()\\n assert len(sessions) > 0\",\n \"def get_sessions_by_type(self, request):\\n return self.session_service.get_conference_sessions_by_type(\\n request.websafeConferenceKey, request.sessionType)\",\n \"def list(self):\\n return self.rpc.call(MsfRpcMethod.ConsoleList)['consoles']\",\n \"def list_active_customers():\\n init_database()\\n return Customer.select().where(Customer.active_status).count()\",\n \"def list(self):\\n\\t\\tif self.client is None:\\n\\t\\t\\traise UsageError(\\\"Not connected!\\\")\\n\\t\\treturn self.client.list_conns()\",\n \"def inactive():\\n session = session_maker(\\n app.config['MYSQL_USER'], app.config['MYSQL_PASS'], app.config['MYSQL_SERVER_PORT_3306_TCP_ADDR'],\\n app.config['MYSQL_SERVER_PORT_3306_TCP_PORT'], app.config['DB'])\\n\\n print(\\n tabulate(\\n selection_list_inactive(session),\\n headers=['number', 'sqlid', 'name', 'city', 'state']))\",\n \"def list_active_customers():\\n with cm.DATABASE.transaction():\\n # .select() has a .where() method to specify criteria for searching\\n active_customers = cm.Customer.select().where(\\n cm.Customer.status == \\\"Active\\\").count()\\n LOGGER.info(\\\"Active customers: %s\\\", active_customers)\\n return active_customers\"\n]","isConversational":false},"negative_scores":{"kind":"list like","value":["0.75758445","0.757478","0.7396808","0.7384779","0.73801714","0.72702295","0.71300334","0.7045607","0.7029493","0.6845006","0.679199","0.6788236","0.6770604","0.6673959","0.6615374","0.65827996","0.6541172","0.65161306","0.6476787","0.6473066","0.647231","0.6468992","0.6457664","0.64194864","0.6338903","0.6320755","0.6255221","0.6226086","0.60916793","0.6060558","0.60471594","0.5998699","0.59911186","0.5991094","0.59902966","0.59568894","0.59361565","0.591682","0.59166896","0.59069985","0.5906305","0.5900165","0.58140165","0.5812029","0.5803386","0.5778736","0.57722515","0.57503676","0.5740613","0.5740535","0.5737158","0.57307404","0.5724193","0.57190305","0.5709172","0.5686681","0.56698763","0.56697214","0.5664325","0.5661694","0.5657478","0.56561637","0.5656148","0.56418496","0.563963","0.56371903","0.5629328","0.56269944","0.5625407","0.56146276","0.56051326","0.5587467","0.558358","0.5577827","0.55628675","0.5557489","0.5556462","0.55527127","0.55512774","0.5551021","0.5544667","0.5536515","0.55321574","0.55228937","0.55180746","0.55122215","0.5508414","0.5506479","0.5495354","0.5486528","0.5479089","0.547592","0.5475364","0.5466892","0.54655117","0.54601514","0.546012","0.5456535","0.5452135","0.5451082"],"string":"[\n \"0.75758445\",\n \"0.757478\",\n \"0.7396808\",\n \"0.7384779\",\n \"0.73801714\",\n \"0.72702295\",\n \"0.71300334\",\n \"0.7045607\",\n \"0.7029493\",\n \"0.6845006\",\n \"0.679199\",\n \"0.6788236\",\n \"0.6770604\",\n \"0.6673959\",\n \"0.6615374\",\n \"0.65827996\",\n \"0.6541172\",\n \"0.65161306\",\n \"0.6476787\",\n \"0.6473066\",\n \"0.647231\",\n \"0.6468992\",\n \"0.6457664\",\n \"0.64194864\",\n \"0.6338903\",\n \"0.6320755\",\n \"0.6255221\",\n \"0.6226086\",\n \"0.60916793\",\n \"0.6060558\",\n \"0.60471594\",\n \"0.5998699\",\n \"0.59911186\",\n \"0.5991094\",\n \"0.59902966\",\n \"0.59568894\",\n \"0.59361565\",\n \"0.591682\",\n \"0.59166896\",\n \"0.59069985\",\n \"0.5906305\",\n \"0.5900165\",\n \"0.58140165\",\n \"0.5812029\",\n \"0.5803386\",\n \"0.5778736\",\n \"0.57722515\",\n \"0.57503676\",\n \"0.5740613\",\n \"0.5740535\",\n \"0.5737158\",\n \"0.57307404\",\n \"0.5724193\",\n \"0.57190305\",\n \"0.5709172\",\n \"0.5686681\",\n \"0.56698763\",\n \"0.56697214\",\n \"0.5664325\",\n \"0.5661694\",\n \"0.5657478\",\n \"0.56561637\",\n \"0.5656148\",\n \"0.56418496\",\n \"0.563963\",\n \"0.56371903\",\n \"0.5629328\",\n \"0.56269944\",\n \"0.5625407\",\n \"0.56146276\",\n \"0.56051326\",\n \"0.5587467\",\n \"0.558358\",\n \"0.5577827\",\n \"0.55628675\",\n \"0.5557489\",\n \"0.5556462\",\n \"0.55527127\",\n \"0.55512774\",\n \"0.5551021\",\n \"0.5544667\",\n \"0.5536515\",\n \"0.55321574\",\n \"0.55228937\",\n \"0.55180746\",\n \"0.55122215\",\n \"0.5508414\",\n \"0.5506479\",\n \"0.5495354\",\n \"0.5486528\",\n \"0.5479089\",\n \"0.547592\",\n \"0.5475364\",\n \"0.5466892\",\n \"0.54655117\",\n \"0.54601514\",\n \"0.546012\",\n \"0.5456535\",\n \"0.5452135\",\n \"0.5451082\"\n]","isConversational":false},"document_score":{"kind":"string","value":"0.76642567"},"document_rank":{"kind":"string","value":"0"}}}],"truncated":false,"partial":true},"paginationData":{"pageIndex":101,"numItemsPerPage":100,"numTotalItems":95772,"offset":10100,"length":100}},"jwt":"eyJhbGciOiJFZERTQSJ9.eyJyZWFkIjp0cnVlLCJwZXJtaXNzaW9ucyI6eyJyZXBvLmNvbnRlbnQucmVhZCI6dHJ1ZX0sImlhdCI6MTc3NDQwNzkzOCwic3ViIjoiL2RhdGFzZXRzL25vbWljLWFpL2Nvcm5zdGFjay1weXRob24tdjEiLCJleHAiOjE3NzQ0MTE1MzgsImlzcyI6Imh0dHBzOi8vaHVnZ2luZ2ZhY2UuY28ifQ.BNLwPkA5RXuDkOYur0sN2FZCG2CXIwnkq-YS4nxS8_va8CO8ktnX8KUQD_YCW9yMpESUO_YCVvWwLmb-89HmBg","displayUrls":true,"splitSizeSummaries":[{"config":"default","split":"train","numRows":95772,"numBytesParquet":1928375891}]},"discussionsStats":{"closed":1,"open":1,"total":2},"fullWidth":true,"hasGatedAccess":true,"hasFullAccess":true,"isEmbedded":false,"savedQueries":{"community":[],"user":[]}}">
query stringlengths 9 3.4k | document stringlengths 9 87.4k | metadata dict | negatives listlengths 4 101 | negative_scores listlengths 4 101 | document_score stringlengths 3 10 | document_rank stringclasses 102
values |
|---|---|---|---|---|---|---|
Split string by upper case letters. F.e. useful to convert camel case strings to underscore separated ones. words (list) | def camel_case_to_lower_case_underscore(string):
words = []
from_char_position = 0
for current_char_position, char in enumerate(string):
if char.isupper() and from_char_position < current_char_position:
words.append(
string[from_char_position:current_char_position].lower())
from_char_position = current_char_position
words.append(string[from_char_position:].lower())
return '_'.join(words) | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def split_uppercase(word):\r\n final_word = ''\r\n for i in word:\r\n final_word += ' %s' % i if i.isupper() else i\r\n\r\n return final_word.strip()",
"def camelCaseSplit(text):\n matches = re.finditer('.+?(?:(?<=[a-z])(?=[A-Z])|(?<=[A-Z])(?=[A-Z][a-z])|$)', text)\n return [m.group(0) for ... | [
"0.7751512",
"0.7259431",
"0.7180602",
"0.7063711",
"0.70595056",
"0.70409745",
"0.69426405",
"0.6801742",
"0.67717946",
"0.6744924",
"0.67325515",
"0.6694427",
"0.6669808",
"0.6653575",
"0.6632303",
"0.66086304",
"0.66041285",
"0.66029406",
"0.65299785",
"0.65299785",
"0.649... | 0.63527435 | 28 |
Convert string or unicode from lowercase underscore to camelcase | def lower_case_underscore_to_camel_case(string):
splitted_string = string.split('_')
# use string's class to work on the string to keep its type
class_ = string.__class__
return class_.join('', map(class_.capitalize, splitted_string)) | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def convert_underscore_to_camel_case(text):\n words = text.split('_')\n words = [word.capitalize() for word in words]\n return ''.join(words)",
"def underscore_to_camelcase(text):\n text = text.replace('_', ' ').title()\n return text.replace(' ', '')",
"def underscore_to_camelcase(underscore_str... | [
"0.82202953",
"0.8198104",
"0.81893754",
"0.7956747",
"0.79494596",
"0.787746",
"0.7843858",
"0.7833112",
"0.7820128",
"0.77906346",
"0.77414733",
"0.770459",
"0.77041924",
"0.76800525",
"0.7620144",
"0.75948817",
"0.7570997",
"0.7570997",
"0.7565195",
"0.7542623",
"0.7537749... | 0.7864236 | 6 |
Rolls a dice and returns the number | def diceRoll():
return randint(1,6) | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def roll_dice():\n return (random.randint(1, 6) + random.randint(1, 6))",
"def roll_dice():\n roll = random.randint(1, 6)\n return roll",
"def simple_roll(dice):\n return roll(dice).total",
"def roll_dice(self):\n self.roll = (random.randint(1,6), random.randint(1,6))\n return self.... | [
"0.8223234",
"0.8189671",
"0.80983704",
"0.8092796",
"0.79572994",
"0.78616965",
"0.7784601",
"0.77547574",
"0.7703866",
"0.7699241",
"0.7689161",
"0.7647644",
"0.76401645",
"0.76285684",
"0.75962",
"0.7539634",
"0.75269604",
"0.7526193",
"0.7524304",
"0.751236",
"0.75110435"... | 0.78609216 | 6 |
Rolls the double dice, checks that they equal six and returns the result | def generateNumbers(times):
two_occured = 0
got_six = 0
numbers = {}
for i in range(times):
roll_one = diceRoll()
roll_two = diceRoll()
total = roll_one + roll_two
if total == 6: # Don't care about others (for now, could use it to check how often you'd roll six I guess ?)
got_six = got_six + 1
# Add the numbers to return dict
if roll_one in numbers:
numbers[roll_one] = numbers[roll_one] + 1
else:
numbers[roll_one] = 1
if roll_two in numbers:
numbers[roll_two] = numbers[roll_two] + 1
else:
numbers[roll_two] = 1
if roll_one == 2 or roll_two == 2:
two_occured = two_occured + 1
percent = (two_occured / got_six) * 100
return (percent, numbers, got_six) | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def roll_dice(check_double=True):\n\n roll = np.random.choice(np.arange(1, 7), 2)\n\n if check_double:\n return roll.sum(), roll[0] == roll[1]\n else:\n return roll.sum()",
"def roll_dice():\n return (random.randint(1, 6) + random.randint(1, 6))",
"def roll_dice(num_rolls, dice=six_si... | [
"0.76994514",
"0.76561534",
"0.73893756",
"0.73837674",
"0.72581154",
"0.7254027",
"0.72445756",
"0.7230524",
"0.7154722",
"0.7104546",
"0.70965785",
"0.70899475",
"0.7055198",
"0.70499194",
"0.70469195",
"0.70377696",
"0.70235765",
"0.69848144",
"0.6969932",
"0.69600403",
"0... | 0.0 | -1 |
Create a new CoauthorshipEgoNetwork by specifying the id and the name of the ego. | def __init__(self, ego_name: str, ego_id: int = None, last_time: int = 0,
min_pub_date: int = None):
self.ego_name = ego_name
self.publications = {}
self.min_pub_date = min_pub_date
super(CoauthorshipNamedEgoNetwork, self).__init__(ego_id, last_time) | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def network_create(auth=None, **kwargs):\n cloud = get_operator_cloud(auth)\n kwargs = _clean_kwargs(keep_name=True, **kwargs)\n return cloud.create_network(**kwargs)",
"def Create(self):\n\n gateway = None\n netmask = None\n\n self._AcquireNetworkDetails()\n\n if self.is_vpc:\n # Creat... | [
"0.6290861",
"0.6215418",
"0.6022672",
"0.6000608",
"0.5971473",
"0.5934701",
"0.58295625",
"0.5809999",
"0.56568396",
"0.56159425",
"0.56093043",
"0.54925305",
"0.5469227",
"0.5450064",
"0.53767145",
"0.5361078",
"0.5341799",
"0.5335839",
"0.53156966",
"0.53053945",
"0.53020... | 0.5981479 | 4 |
Add a contact representing a publication coauthored by the ego to the ego network. | def add_publication(self, pub_id: int, timestamp: int, title: str, coauthors: List[str], contact_type="__all__"):
if self.min_pub_date is None or timestamp >= self.min_pub_date:
# standardize names, remove possible duplicates and wrong names, and remove ego if present
std_coauth_names = set()
for coauthor_name in coauthors:
if len(coauthor_name) > 1:
std_coauth_names.add(self.get_std_author_name(coauthor_name))
std_coauth_names.discard(self.get_std_author_name(self.ego_name))
for coauthor_name in std_coauth_names:
if self.last_time is None or timestamp > self.last_time:
self.last_time = timestamp
super(CoauthorshipNamedEgoNetwork, self).add_contact(timestamp=timestamp, alter_id=coauthor_name,
contact_type=contact_type, text=title,
num_contacted_alters=len(std_coauth_names))
self.publications[pub_id] = (title, std_coauth_names) | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def AddContact(self, contact):\n\t\tcontact.group_membership_info = [gdata.contacts.data.GroupMembershipInfo(href=self.GetFirstGroupId())]\n\t\ttry:\n\t\t\tself.client.CreateContact(contact)\n\t\texcept gdata.client.RequestError:\n\t\t\tpass",
"def add_contact(self, contact):\n\t\tclient_log.debug(f'Создание кон... | [
"0.64493227",
"0.6373825",
"0.62784225",
"0.6231083",
"0.60652024",
"0.59836507",
"0.59490603",
"0.579805",
"0.5783082",
"0.5768027",
"0.5641641",
"0.5640455",
"0.56229985",
"0.56229985",
"0.5609489",
"0.55984056",
"0.54995424",
"0.54777515",
"0.5452757",
"0.5432362",
"0.5429... | 0.6801305 | 0 |
Construct a CallCount instance. | def __init__(self, function):
self.function = function
self.count = 0 | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def count(self) -> CountRequestBuilder:\n from .count.count_request_builder import CountRequestBuilder\n\n return CountRequestBuilder(self.request_adapter, self.path_parameters)",
"def count(self) -> CountRequestBuilder:\n from .count.count_request_builder import CountRequestBuilder\n\n ... | [
"0.58695185",
"0.58695185",
"0.5629136",
"0.5570181",
"0.5538394",
"0.552469",
"0.541156",
"0.5403923",
"0.5349386",
"0.5247626",
"0.5242342",
"0.5222286",
"0.5211293",
"0.51988417",
"0.5185769",
"0.51804847",
"0.51790524",
"0.5139803",
"0.5135964",
"0.51276577",
"0.5105392",... | 0.47872669 | 47 |
Reset the function call count to zero. | def reset_count(self):
self.count = 0 | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def reset_counter(self) -> None:",
"def reset_calls(self) -> None:\n self.logger.info(\"Reset calls\")\n\n self._has_bob = False\n self._has_single = False",
"def reset (self):\n self.counter = 0",
"def reset(self):\n self.counter = 0",
"def reset(self):\n # self.c... | [
"0.7342854",
"0.7133632",
"0.7101041",
"0.7076571",
"0.6986588",
"0.6887243",
"0.68343556",
"0.6833832",
"0.6802058",
"0.6802058",
"0.68014395",
"0.68014395",
"0.68014395",
"0.6790398",
"0.67423177",
"0.6730629",
"0.6721631",
"0.6674541",
"0.6674541",
"0.6674541",
"0.6646674"... | 0.7426931 | 0 |
Compare two values by their natural ordering. | def compare(a, b):
return a - b | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def natural_sort_comparison(value1, value2):\n return cmp(_natural_sort_key(value1), _natural_sort_key(value2))",
"def natural_sort_case_insensitive_comparison(value1, value2):\n return natural_sort_comparison(value1.lower(), value2.lower())",
"def cmp ( self, object1, object2 ):\n return cmp( sel... | [
"0.8129934",
"0.713771",
"0.68130374",
"0.67042726",
"0.6640327",
"0.66176546",
"0.6604838",
"0.65097326",
"0.6501352",
"0.6492879",
"0.6490977",
"0.64719254",
"0.64077866",
"0.63938427",
"0.6344175",
"0.6319825",
"0.62944037",
"0.6267962",
"0.6250287",
"0.6224336",
"0.621590... | 0.60554993 | 32 |
Test the average execution time of a given function. | def time_function(function, runs=1, average=min):
results = [None] * runs
for i in range(runs):
t0 = time.perf_counter()
function()
t1 = time.perf_counter()
results[i] = t1 - t0
return average(results) | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def calculateRunTime(function, *args):\n startTime = time.time()\n result = function(*args)\n return time.time() - startTime, result",
"def execution_time(function: Callable, args=tuple(), kwargs=dict()):\n start_time = time.time()\n function(*args, **kwargs)\n end_time = time.time()\n retur... | [
"0.72246695",
"0.7189616",
"0.69638824",
"0.69256145",
"0.68879926",
"0.6848878",
"0.6752755",
"0.6739705",
"0.67355597",
"0.6723226",
"0.67124665",
"0.6660492",
"0.66482943",
"0.6646599",
"0.66432923",
"0.66369736",
"0.66163874",
"0.6569194",
"0.6540607",
"0.6531069",
"0.652... | 0.73044527 | 0 |
Test the total execution time of a given function. | def time_function_total(function, runs=1):
t0 = time.perf_counter()
for _ in range(runs):
function()
t1 = time.perf_counter()
return t1 - t0 | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def execution_time(function: Callable, args=tuple(), kwargs=dict()):\n start_time = time.time()\n function(*args, **kwargs)\n end_time = time.time()\n return end_time - start_time",
"def calculateRunTime(function, *args):\n startTime = time.time()\n result = function(*args)\n return time.tim... | [
"0.78346467",
"0.7678804",
"0.76649004",
"0.75340277",
"0.73253274",
"0.7304831",
"0.72743374",
"0.72719234",
"0.7266114",
"0.7256505",
"0.7253224",
"0.7231037",
"0.71410745",
"0.71373457",
"0.71289027",
"0.71013814",
"0.7084868",
"0.70669544",
"0.706348",
"0.7050488",
"0.704... | 0.7101723 | 15 |
Query if a value is in an array via iterative linear search. | def linear_search_iterative(array, value):
for elt in array:
if compare(elt, value) == 0:
return True
return False | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def linear_search_foundornot(arr: IntList, query: int) -> bool:\n position: int = 0\n found: bool = False\n while position < len(arr) and not found:\n if arr[position] == query:\n found = True\n position += 1\n return found",
"def linear_search_recursive(array, value):\n #... | [
"0.7187239",
"0.7014195",
"0.68994564",
"0.68296456",
"0.6682872",
"0.65983593",
"0.6571656",
"0.65281767",
"0.6450205",
"0.6415358",
"0.6367779",
"0.6351479",
"0.6338945",
"0.6338945",
"0.6338945",
"0.6338945",
"0.63235927",
"0.6252645",
"0.6220145",
"0.6189393",
"0.6184134"... | 0.7844321 | 0 |
Query if a value is in an array via recursive linear search. | def linear_search_recursive(array, value):
# Base case for empty list
n = len(array)
if n == 0:
return False
# Recursive case
if compare(array[0], value) == 0:
return True
else:
return linear_search_recursive(array[1:], value) | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def binary_search_recursive(array, value):\n # Base cases for empty or singular list\n n = len(array)\n if n == 0:\n return False\n elif n == 1:\n return compare(array[0], value) == 0\n\n # Recursive case\n middle = n // 2\n if compare(array[middle], value) == 0:\n return ... | [
"0.69967544",
"0.69195235",
"0.6862056",
"0.67465794",
"0.65924174",
"0.65537065",
"0.64034545",
"0.6274502",
"0.6266495",
"0.62526584",
"0.6248882",
"0.6248882",
"0.6248882",
"0.6248882",
"0.6202555",
"0.6176431",
"0.6166238",
"0.6148709",
"0.60954624",
"0.6085641",
"0.60850... | 0.7844012 | 0 |
Query if a value is in an array via recursive binary search. | def binary_search_recursive(array, value):
# Base cases for empty or singular list
n = len(array)
if n == 0:
return False
elif n == 1:
return compare(array[0], value) == 0
# Recursive case
middle = n // 2
if compare(array[middle], value) == 0:
return True
elif compare(array[middle], value) < 0:
return binary_search_recursive(array[middle + 1:], value)
else:
return binary_search_recursive(array[:middle], value) | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def linear_search_recursive(array, value):\n # Base case for empty list\n n = len(array)\n if n == 0:\n return False\n\n # Recursive case\n if compare(array[0], value) == 0:\n return True\n else:\n return linear_search_recursive(array[1:], value)",
"def Search(array, value)... | [
"0.75950164",
"0.72089994",
"0.6862112",
"0.6780811",
"0.6759658",
"0.6693581",
"0.6673692",
"0.6622626",
"0.6622626",
"0.6622626",
"0.66219646",
"0.66128653",
"0.65874904",
"0.65533173",
"0.65308404",
"0.6481852",
"0.6433637",
"0.64171046",
"0.64025944",
"0.63988364",
"0.629... | 0.7462939 | 1 |
Query if a value is in an array via iterative binary search. | def binary_search_iterative(array, value):
# Iteration terminates when (min, max) range has shrunk such that min > max
min = 0
max = len(array) - 1
while min <= max:
middle = (min + max) // 2
comparison = compare(array[middle], value)
if comparison == 0:
return True
elif comparison < 0:
min = middle + 1
else:
max = middle - 1
return False | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def linear_search_iterative(array, value):\n for elt in array:\n if compare(elt, value) == 0:\n return True\n\n return False",
"def Search(array, value):\n left = 0\n right = len(array) - 1\n while left <= right:\n mid = left + (right - left) // 2\n if array[mid] ==... | [
"0.741259",
"0.7237241",
"0.69422096",
"0.692457",
"0.682915",
"0.6787418",
"0.6777182",
"0.6744018",
"0.67439973",
"0.6704923",
"0.6696993",
"0.669297",
"0.6692132",
"0.6692132",
"0.6692132",
"0.66770345",
"0.6598662",
"0.6594714",
"0.6561431",
"0.6525377",
"0.65189373",
"... | 0.7150931 | 2 |
Sort a list via selection sort. | def selection_sort(array):
n = len(array)
result = array.copy()
for i in range(n - 1):
# Find next-smallest value
smallest = i
for j in range(i + 1, n):
if compare(result[j], result[smallest]) < 0:
smallest = j
# Swap next-smallest value into position
if i != smallest:
result[i], result[smallest] = result[smallest], result[i]
return result | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def selection_sort(lst):\n l = len(lst)\n for i in range(l - 1):\n pos = i\n for j in range(i + 1, l):\n if lst[j] < lst[pos]:\n pos = j\n\n if pos > i:\n lst[i], lst[pos] = lst[pos], lst[i]\n\n return lst",
"def selection_sort(unsorted_list):\r\... | [
"0.7748435",
"0.7590971",
"0.75599235",
"0.7533883",
"0.7526575",
"0.7514822",
"0.7492142",
"0.74519706",
"0.7430942",
"0.74007577",
"0.72966677",
"0.7260174",
"0.7220203",
"0.7211774",
"0.72063357",
"0.7201985",
"0.7201396",
"0.7140281",
"0.71077573",
"0.70871216",
"0.705984... | 0.6030952 | 84 |
Sort a list via recursive selection sort. | def selection_sort_recursive(array):
# Base case for empty or singular list
n = len(array)
if n < 2:
return array
# Find smallest value
result = array.copy()
smallest = 0
for i in range(1, n):
if compare(result[i], result[smallest]) < 0:
smallest = i
# Swap smallest into first position
if smallest != 0:
result[0], result[smallest] = result[smallest], result[0]
# Recur on remainder of array
return [result[0]] + selection_sort_recursive(result[1:]) | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def selection_sort(l):\n walk = 0\n while walk < len(l):\n i = walk\n while i < len(l):\n if l[i] < l[walk]:\n # swap i and walk\n tmp = l[walk]\n l[walk] = l[i]\n l[i] = tmp\n i += 1\n walk += 1\n retur... | [
"0.7316072",
"0.7191435",
"0.7096822",
"0.6961271",
"0.690172",
"0.6899829",
"0.689302",
"0.68900025",
"0.68848956",
"0.68338776",
"0.6833445",
"0.68095154",
"0.6795468",
"0.6794519",
"0.67531425",
"0.6728902",
"0.66321385",
"0.6614806",
"0.6598474",
"0.6597345",
"0.6581996",... | 0.681675 | 11 |
Sort a list via insertion sort. | def insertion_sort(array):
n = len(array)
result = array.copy()
# Swap each value backwards until in correct position
for i in range(1, n):
j = i
while j > 0 and compare(result[j], result[j - 1]) < 0:
result[j], result[j - 1] = result[j - 1], result[j]
j -= 1
return result | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def insertionSort(list):",
"def insertion_sort(mylist):\n for i in range(1, len(mylist)):\n x = mylist[i]\n j = i-1\n while j >= 0 and mylist[j] > x:\n mylist[j+1] = mylist[j]\n j -= 1\n mylist[j+1] = x",
"def insertion_sort(student_list):\n length = ... | [
"0.9008579",
"0.81677395",
"0.81517905",
"0.815131",
"0.8149608",
"0.8100819",
"0.806909",
"0.8044392",
"0.8003723",
"0.7992259",
"0.789808",
"0.788748",
"0.78571534",
"0.7837437",
"0.7747174",
"0.7729622",
"0.7676159",
"0.767438",
"0.7664585",
"0.7653782",
"0.7650872",
"0.... | 0.66808194 | 60 |
Sort a list via recursive insertion sort. | def insertion_sort_recursive(array):
# Base case for empty or singular list
n = len(array)
if n < 2:
return array
# Recursive case is last element to insert appended to sorted sub-list
result = insertion_sort_recursive(array[:-1]) + [array[-1]]
# Swap last value backwards until in correct position
i = n - 1
while i > 0 and compare(result[i], result[i - 1]) < 0:
result[i], result[i - 1] = result[i - 1], result[i]
i -= 1
return result | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def insertionSort(list):",
"def insertion_sort(p_list):\n if len(p_list) > 1: # list of length 0 or 1 is sorted\n marker = p_list.first()\n while marker != p_list.last():\n pivot = p_list.after(marker) # next item to place\n value = pi... | [
"0.80922496",
"0.7654057",
"0.7528426",
"0.7520646",
"0.7519581",
"0.7408556",
"0.7397398",
"0.73794985",
"0.73751813",
"0.7369835",
"0.73261505",
"0.72022533",
"0.7196902",
"0.71854836",
"0.7178526",
"0.71708345",
"0.71572083",
"0.7106301",
"0.7105172",
"0.70820385",
"0.7079... | 0.74628884 | 5 |
Merge two sorted lists into one. | def merge(a, b):
result = []
# Append smallest values to result until either list is exhausted
i = j = 0
while i < len(a) and j < len(b):
if compare(a[i], b[j]) < 0:
result.append(a[i])
i += 1
else:
result.append(b[j])
j += 1
# Append all remaining values from the unexhausted list
if i < len(a):
result.extend(a[i:])
else:
result.extend(b[j:])
return result | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def merge ( list1, list2 ):\n new_list = []\n while len(list1)>0 and len(list2)>0:\n if list1[0] < list2[0]:\n new_list.append (list1[0])\n del list1[0]\n else:\n new_list.append (list2[0])\n del list2[0]\n return new_list + list1 + list2",
"def merge(list1, list2)... | [
"0.8002001",
"0.79542124",
"0.78766847",
"0.7858217",
"0.78003126",
"0.7746179",
"0.77270013",
"0.7690721",
"0.7681128",
"0.76697636",
"0.7637869",
"0.76258785",
"0.7621432",
"0.76182973",
"0.76182604",
"0.76102555",
"0.759736",
"0.759385",
"0.7591011",
"0.7565296",
"0.755625... | 0.78277063 | 4 |
Sort a list via recursive (topdown) mergesort. | def mergesort_recursive(array):
# Base case for empty or singular list
n = len(array)
if n < 2:
return array
# Recur on two halves of array and merge results
mid = n // 2
return merge(
mergesort_recursive(array[:mid]),
mergesort_recursive(array[mid:])) | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def merge_sort(list):\n\n\tif len(list) <= 1:\n\t\treturn list\n\n\tleft_half, right_half = split(list)\n\tleft = merge_sort(left_half)\n\tright = merge_sort(right_half)\n\n\treturn merge(left, right)",
"def merge_sort(list):\r\n \r\n if len(list) <= 1:\r\n return list\r\n \r\n left_half, righ... | [
"0.7982456",
"0.7917089",
"0.78690946",
"0.7797491",
"0.7603899",
"0.7586151",
"0.75551754",
"0.7543085",
"0.74754685",
"0.74723524",
"0.74529386",
"0.7429456",
"0.73927414",
"0.7391901",
"0.7391193",
"0.7382016",
"0.73695296",
"0.73677033",
"0.73447967",
"0.7275034",
"0.7266... | 0.7005334 | 38 |
Sort a list via iterative (bottomup) mergesort. | def mergesort_iterative(array):
n = len(array)
result = array.copy()
# Merge runs of length 1, 2, 4, 8, ...
length = 1
while length < n:
# Merge each pair of runs
for i in range(0, n, 2 * length):
mid = i + length
upper = i + 2 * length
result[i:upper] = merge(result[i:mid], result[mid:upper])
length *= 2
return result | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def merge_sort(list):\n\n\tif len(list) <= 1:\n\t\treturn list\n\n\tleft_half, right_half = split(list)\n\tleft = merge_sort(left_half)\n\tright = merge_sort(right_half)\n\n\treturn merge(left, right)",
"def merge_sort(items):\r\n # TODO: Check if list is so small it's already sorted (base case)\r\n # TODO... | [
"0.74827385",
"0.7417978",
"0.74099773",
"0.73498195",
"0.73487973",
"0.7329769",
"0.72622186",
"0.72107303",
"0.71782786",
"0.71331424",
"0.712062",
"0.70827264",
"0.70669717",
"0.7044626",
"0.6979438",
"0.69784135",
"0.69016755",
"0.68788517",
"0.6875574",
"0.68659335",
"0.... | 0.6378145 | 74 |
Sort a list via hybrid recursive (topdown) mergesort. Delegates to insertion sort when n is less than or equal to some threshold. | def mergesort_recursive_hybrid(array, threshold=37):
# Base case delegates to insertion sort
n = len(array)
if n <= threshold:
return insertion_sort(array)
# Recur on two halves of array and merge results
mid = n // 2
return merge(
mergesort_recursive(array[:mid]),
mergesort_recursive(array[mid:])) | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def merge_sort(L):\n n = len(L)\n if n < 2:\n return L\n mid = n // 2\n left = L[:mid]\n right = L[mid:]\n merge_sort(left)\n merge_sort(right)\n merge(L, left, right)",
"def merge_sort(unsorted, threshold, reverse):\r\n length = len(unsorted)\r\n if length < 2:\r\n re... | [
"0.7029845",
"0.696164",
"0.68413234",
"0.68319064",
"0.6830567",
"0.6794161",
"0.6786466",
"0.6744685",
"0.66700613",
"0.66018665",
"0.65889466",
"0.6586275",
"0.6528771",
"0.65160424",
"0.65155774",
"0.6514788",
"0.650817",
"0.65026766",
"0.6501337",
"0.6469715",
"0.6448953... | 0.7173727 | 0 |
Sort a list via hybrid iterative (bottomup) mergesort. Delegates to insertion sort when n is less than or equal to some threshold. | def mergesort_iterative_hybrid(array, threshold=37):
n = len(array)
result = array.copy()
# Initial insertion sort pass
for i in range(0, n, threshold):
result[i:i+threshold] = insertion_sort(result[i:i+threshold])
# Merge runs of length threshold, 2*threshold, ...
length = threshold
while length < n:
# Merge each pair of runs
for i in range(0, n, 2 * length):
mid = i + length
upper = i + 2 * length
result[i:upper] = merge(result[i:mid], result[mid:upper])
length *= 2
return result | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def mergesort_recursive_hybrid(array, threshold=37):\n # Base case delegates to insertion sort\n n = len(array)\n if n <= threshold:\n return insertion_sort(array)\n\n # Recur on two halves of array and merge results\n mid = n // 2\n return merge(\n mergesort_recursive(array[:mid]),... | [
"0.7101632",
"0.6605162",
"0.6547044",
"0.6530211",
"0.6487875",
"0.64746773",
"0.64605856",
"0.64375854",
"0.64229447",
"0.6305018",
"0.62946403",
"0.6249969",
"0.62481827",
"0.62260824",
"0.621573",
"0.6202988",
"0.61955655",
"0.61911744",
"0.61827713",
"0.6164877",
"0.6157... | 0.70031637 | 1 |
Reorder elements in a list range such that a pivot separates them. | def partition(array, low, high, pivot):
# Boundary between lower and upper partitions
i = low
# Compare every other element against pivot
for j in range(low, high + 1):
if j != pivot and compare(array[j], array[pivot]) < 0:
# Swap into lower partition and increment boundary
array[i], array[j] = array[j], array[i]
i += 1
# Swap pivot value into final position
array[i], array[pivot] = array[pivot], array[i]
return i | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def __Partition(ulist, start, stop):\n i = start - 1\n pivot = ulist[stop]\n for j in range(start, stop):\n if ulist[j] <= pivot:\n i += 1\n ulist[i], ulist[j] = ulist[j], ulist[i]\n ulist[i+1],ulist[stop] = ulist[stop], ulist[i+1]\n return i+1",
"def test_get_pivot_in... | [
"0.6311658",
"0.6205301",
"0.60918045",
"0.6083206",
"0.6060971",
"0.5999326",
"0.59483886",
"0.5906217",
"0.58992696",
"0.58958167",
"0.58193344",
"0.57936126",
"0.57872474",
"0.5752626",
"0.5743744",
"0.5743489",
"0.57380205",
"0.5719808",
"0.5713487",
"0.5706366",
"0.56969... | 0.0 | -1 |
Sort a list inplace via quicksort. | def quicksort(array, middle=True):
def qsort(array, low, high):
while low < high:
pivot = (low + high) // 2 if middle else high
pivot = partition(array, low, high, pivot)
if pivot - low <= high - pivot:
qsort(array, low, pivot - 1)
low = pivot + 1
else:
qsort(array, pivot + 1, high)
high = pivot - 1
qsort(array, 0, len(array) - 1) | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def quick_sort(mylist):\n _inplace_quick_sort(mylist, 0, len(mylist)-1)",
"def quicksort(lst):\n n = len(lst)\n qsort(lst, 0, n - 1)",
"def quick_sort(l):\n return _quick_sort(l, 0, len(l) - 1)",
"def quick_sort(a_list):\n return quick_sort_helper(a_list, 0, len(a_list) - 1)",
"def qsort(my_... | [
"0.8566388",
"0.7811469",
"0.7666376",
"0.7665722",
"0.7628024",
"0.7595974",
"0.7590224",
"0.75602454",
"0.75491625",
"0.7488644",
"0.7474256",
"0.74595135",
"0.7425829",
"0.7419462",
"0.7412757",
"0.7373703",
"0.7277139",
"0.7268242",
"0.72630036",
"0.7221897",
"0.70804954"... | 0.0 | -1 |
Siftup the last node (end1) in the given max heap. | def sift_up(heap, start, end):
# Swap last node with parents until no longer greater.
i = end - 1
heaped = False
while i > start and not heaped:
parent = (i - 1) // 2
if compare(heap[i], heap[parent]) > 0:
heap[i], heap[parent] = heap[parent], heap[i]
i = parent
else:
heaped = True | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def sift_down(heap, start, end):\n # Swap first node with children until no longer smaller.\n i = start\n heaped = False\n while not heaped:\n left = i * 2 + 1\n right = i * 2 + 2\n largest = i\n\n # Find largest of i, left and right\n if left < end and compare(heap[l... | [
"0.71801686",
"0.7001086",
"0.6813224",
"0.65404683",
"0.6508815",
"0.6496566",
"0.6474151",
"0.63565713",
"0.63440263",
"0.6343961",
"0.6335834",
"0.63289756",
"0.63112545",
"0.6272625",
"0.62513417",
"0.6242469",
"0.6241716",
"0.61991626",
"0.6170931",
"0.6164732",
"0.61421... | 0.73906344 | 0 |
Siftdown the first node (start) in the given max heap. | def sift_down(heap, start, end):
# Swap first node with children until no longer smaller.
i = start
heaped = False
while not heaped:
left = i * 2 + 1
right = i * 2 + 2
largest = i
# Find largest of i, left and right
if left < end and compare(heap[left], heap[largest]) > 0:
largest = left
if right < end and compare(heap[right], heap[largest]) > 0:
largest = right
# If left or right is larger than i, swap and repeat
if largest == i:
heaped = True
else:
heap[i], heap[largest] = heap[largest], heap[i]
i = largest | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def __siftdown(heap, nodes, pos, stopPos = None):\n # Default stopping position to end of heap\n stopPos = stopPos if not None else len(heap) - 1\n \n # Loop until past stopping position\n while pos < stopPos:\n # Set right and left child positions\n rChildP... | [
"0.69919413",
"0.67116565",
"0.64125484",
"0.63812757",
"0.6372654",
"0.63402355",
"0.63230765",
"0.6284911",
"0.62778044",
"0.61587197",
"0.6144824",
"0.60992014",
"0.60664123",
"0.60273576",
"0.6023935",
"0.6000229",
"0.59493095",
"0.59148705",
"0.5806669",
"0.58008105",
"0... | 0.6062711 | 13 |
Reorder a given array into a max heap. | def heapify(array):
# Start by sifting down the first parent node
n = len(array)
node = (n - 2) // 2
# Sift down all nodes, finishing with the root
while node >= 0:
sift_down(array, node, n)
node -= 1 | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def heap_sort(array):\n highest_index = len(array)-1\n Heap.heapify(array, highest_index)\n for end in range(highest_index, 0, -1):\n array[end], array[0] = array[0], array[end]\n Heap.sift_down(array, 0, end-1)",
"def heapify(array, highest_index):\n first = (hi... | [
"0.7620014",
"0.7408683",
"0.7295518",
"0.7191452",
"0.7178755",
"0.71406955",
"0.7130052",
"0.70784956",
"0.70300376",
"0.6989501",
"0.69802624",
"0.6953432",
"0.6950196",
"0.6909327",
"0.69041264",
"0.68877125",
"0.68816626",
"0.6856917",
"0.6704577",
"0.66487557",
"0.66159... | 0.69547015 | 11 |
Sort a list inplace via heapsort. | def heapsort(array):
# Turn the entire array into a heap
heapify(array)
# Repeatedly extract the root from the heap into a sorted sublist
n = len(array)
while n > 1:
array[0], array[n - 1] = array[n - 1], array[0]
n -= 1
sift_down(array, 0, n) | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def heap_sort(list):\n pass",
"def heap_sort(items):\n heapq.heapify(items)\n items[:] = [heapq.heappop(items) for i in range(len(items))]",
"def heap_sort(items):\n heapq.heapify(items)\n items[:] = [heapq.heappop(items) for i in range(len(items))]",
"def sort(items):\n ... | [
"0.8531894",
"0.8091181",
"0.8091181",
"0.7828576",
"0.76227224",
"0.75424427",
"0.7507779",
"0.7426823",
"0.7360591",
"0.7360591",
"0.7310706",
"0.7231151",
"0.7190549",
"0.718873",
"0.71057963",
"0.7078807",
"0.7069645",
"0.7058231",
"0.70537895",
"0.6986497",
"0.6827635",
... | 0.6723859 | 22 |
Shuffle a list by partition into n piles. | def pile_shuffle(array, n):
result = []
for i in reversed(range(n)):
result += array[i::n]
return result | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def partition(lis: list, n: int):\n # prevent destroying the original dataset\n lis_cp = copy.deepcopy(lis)\n random.shuffle(lis_cp)\n if len(lis) > n:\n return [lis_cp[i::n] for i in range(n)]\n else:\n return [[lis_cp[i]] for i in range(len(lis))]",
"def partition(self, lst, n):\n ... | [
"0.79827976",
"0.7390744",
"0.7346892",
"0.7062788",
"0.7060552",
"0.6915428",
"0.6911047",
"0.67345446",
"0.66697764",
"0.6515333",
"0.6464317",
"0.6338885",
"0.6338718",
"0.6222252",
"0.62007576",
"0.6193716",
"0.61343354",
"0.61315876",
"0.6106556",
"0.60934514",
"0.609047... | 0.7378045 | 2 |
Shuffle a list by recursively pileshuffling each pile. | def recursive_pile_shuffle(array, n):
# Base case for empty or singular list
if len(array) < 2:
return array
# Pile-shuffle and recur on each of n piles
piles = [array[i::n] for i in reversed(range(n))]
result = []
for pile in piles:
result += recursive_pile_shuffle(pile, n)
return result | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def shuffle_list(self, tour_list, pop_size):\n x = np.array(tour_list)\n while len(self.pop_group) < self.shuffle_population:\n y = np.random.permutation(x)\n if not any((y == x).all() for x in self.pop_group):\n self.pop_group.append(y.tolist())",
"def shuffle_... | [
"0.680971",
"0.6636288",
"0.6632501",
"0.66021633",
"0.6471498",
"0.64384234",
"0.64200294",
"0.632114",
"0.630535",
"0.62996954",
"0.62684",
"0.61987203",
"0.6188611",
"0.61510146",
"0.6112788",
"0.6100381",
"0.6089439",
"0.60330445",
"0.60330445",
"0.60076684",
"0.5993398",... | 0.7225837 | 0 |
returns output of new layer | def l2_reg_create_layer(prev, n, activation, lambtha):
reg = tf.contrib.layers.l2_regularizer(lambtha)
init = tf.contrib.layers.variance_scaling_initializer(mode="FAN_AVG")
t = tf.layers.Dense(units=n, activation=activation,
kernel_initializer=init,
kernel_regularizer=reg,
)
return t(prev) | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def _add_output(self, name, input_layer):\n self.model.add_output(name=name, input=input_layer)\n self.output = name",
"def get_output(self, **kwargs):\n with tf.variable_scope(self.layer_scope):\n return self.out",
"def get_output(self, prev_layers=None, **kwargs):\n if ... | [
"0.69171226",
"0.6876133",
"0.6818037",
"0.6814047",
"0.68065774",
"0.67997515",
"0.6749717",
"0.6734782",
"0.6734782",
"0.6733793",
"0.67300725",
"0.67230237",
"0.67041695",
"0.6663061",
"0.6633519",
"0.65794",
"0.6576216",
"0.6576216",
"0.6570509",
"0.6560505",
"0.65560645"... | 0.0 | -1 |
OAuth2 compatible token login, get an access token for future requests | async def login_access_token(
form_data: OAuth2PasswordRequestForm = Depends()
):
user = await crud.user.authenticate(
username=form_data.username, password=form_data.password
)
if not user:
raise HTTPException(status_code=HTTP_404_NOT_FOUND, detail="Incorrect credentials")
elif not user.is_active:
raise HTTPException(status_code=HTTP_403_FORBIDDEN, detail="Inactive user")
elif not user.is_email_verified:
raise HTTPException(status_code=HTTP_403_FORBIDDEN, detail="Please verify your account via email")
access_token_expires = timedelta(minutes=config.ACCESS_TOKEN_EXPIRE_MINUTES)
return {
"access_token": create_access_token(
data={"user_id": user.id}, expires_delta=access_token_expires
),
"token_type": "bearer",
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def login_access_token(form_data: OAuth2PasswordRequestForm = Depends()):\n user = auth_handler.authenticate_user(\n username=form_data.username, password=form_data.password\n )\n if user is None:\n raise HTTPException(\n detail=\"Incorrect username and/or password\", status_code=... | [
"0.7499437",
"0.7365008",
"0.7298682",
"0.72800106",
"0.72585416",
"0.7221305",
"0.71564126",
"0.7155743",
"0.71516013",
"0.7135813",
"0.70970845",
"0.70884335",
"0.705156",
"0.7044395",
"0.70353854",
"0.7016695",
"0.70149344",
"0.7002961",
"0.70015967",
"0.69658285",
"0.6939... | 0.74189544 | 1 |
Create new account and send verification email with token to user. | async def register(
username: str = Form(...),
password: str = Form(...),
email: EmailStr = Form(...),
first_name: str = Form(...),
last_name: str = Form(None)
):
user = await crud.user.get_by_email(email=email)
if user:
raise HTTPException(
status_code=HTTP_409_CONFLICT,
detail="The user with this email already exists in the system",
)
user = await crud.user.get_by_username(username=username)
if user:
raise HTTPException(
status_code=HTTP_409_CONFLICT,
detail="Username already taken",
)
user = UserCreate(username=username,
password=password,
email=email,
first_name=first_name,
last_name=last_name,
is_email_verified=False
)
user_id = await crud.user.create(user)
register_token = create_register_token(data={"email": user.email})
if send_verify_account_email(
email=user.email, username=user.username, first_name=user.first_name, token=register_token
):
return {"msg": "New account email sent, check your inbox to verify your account"}
else:
await crud.user.remove(user_id)
raise HTTPException(
status_code=HTTP_500_INTERNAL_SERVER_ERROR,
detail="Error while trying to send email, please try again",
) | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def post(self, request):\n try:\n new_usr = User(username=request.data.get(\"username\"), first_name=request.data.get(\"first_name\"),\n email=request.data.get(\"email\"), password=request.data.get(\"password\"))\n serializer = RegisterUserSer(new_usr)\n ... | [
"0.7170047",
"0.70211226",
"0.69629407",
"0.6867402",
"0.6856062",
"0.6824182",
"0.67592835",
"0.6749904",
"0.67101693",
"0.67071414",
"0.6690668",
"0.66064966",
"0.66052914",
"0.66018295",
"0.65891904",
"0.6588237",
"0.6583577",
"0.6559786",
"0.6558199",
"0.6554934",
"0.6548... | 0.0 | -1 |
Verify account using token. | async def verify_account(
token: str = Form(...)
):
email = await verify_register_token(token)
if not email:
raise HTTPException(status_code=400, detail="Invalid email verify token")
record = await crud.user.get_by_email(email)
if not record:
raise HTTPException(
status_code=404,
detail="The user with this email does not exist in the system."
)
user = DBUser(**record)
if user.is_email_verified:
raise HTTPException(
status_code=HTTP_409_CONFLICT,
detail="User already verified",
)
await crud.user.update(user.id, {'is_email_verified': True})
send_new_account_email(email=user.email, username=user.username, first_name=user.first_name)
return {"msg": "Account verified"} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"async def verify(token: TextData, background_tasks: BackgroundTasks):\n token_data = token.data\n mail, subject, body = await AccountProcessor.confirm_email(token_data)\n background_tasks.add_task(Utility.validate_and_send_mail, email=mail, subject=subject, body=body)\n return {\"message\": \"Account V... | [
"0.73761034",
"0.71671677",
"0.7066079",
"0.6981067",
"0.6979663",
"0.68349594",
"0.68256533",
"0.6713865",
"0.67072505",
"0.6704424",
"0.6683784",
"0.66674215",
"0.6619582",
"0.66139793",
"0.65695435",
"0.65394056",
"0.6536171",
"0.6521967",
"0.6393953",
"0.6376964",
"0.6354... | 0.7953528 | 0 |
Returns the number of frames in the trajectory in universe u, using teq as equilibration time and tsample as sampling time | def traj_nslice (u,teq,tsample) :
# get the number of frames in the slice (http://stackoverflow.com/a/7223557)
traj_slice = u.trajectory[teq::tsample]
return sum(1 for _ in traj_slice) | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def num_tracked_samples(self, u=None):\n u = self.virtual_root if u is None else u\n return self._ll_tree.get_num_tracked_samples(u)",
"def frameTimes(self):\n sr = self.sampleRate\n offset = self.activeOffset\n stride = self.activeStride\n nf = self.numFrames\n t... | [
"0.5920934",
"0.5774861",
"0.5752458",
"0.54901206",
"0.5386585",
"0.53777325",
"0.53337634",
"0.53329504",
"0.52839094",
"0.52773035",
"0.5194862",
"0.51744634",
"0.5169164",
"0.51685876",
"0.51301676",
"0.51198584",
"0.5106076",
"0.51057935",
"0.50803345",
"0.50795835",
"0.... | 0.69339037 | 1 |
Calculate the Pearson correlation coefficient between the row sum of the given HiC matrix and the given ChIPseq profile. | def hic_chipseq_r2 (hic, chipseq) :
hic_rowsum = np.sum(hic,axis=1)/float(np.sum(hic))
return np.corrcoef(hic_rowsum,chipseq)[0,1]**2 | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def _pearsons_contingency_coefficient_compute(confmat: Tensor) ->Tensor:\n confmat = _drop_empty_rows_and_cols(confmat)\n cm_sum = confmat.sum()\n chi_squared = _compute_chi_squared(confmat, bias_correction=False)\n phi_squared = chi_squared / cm_sum\n tschuprows_t_value = torch.sqrt(phi_squared / (... | [
"0.65713036",
"0.60864913",
"0.6080404",
"0.6041075",
"0.5945653",
"0.5941",
"0.5863057",
"0.57821524",
"0.5782027",
"0.5723004",
"0.5652084",
"0.5646357",
"0.5644976",
"0.56440914",
"0.5639138",
"0.5633804",
"0.56248856",
"0.5624098",
"0.5592133",
"0.5590622",
"0.5569893",
... | 0.62098205 | 1 |
Calculate the normalized probability of contact between a monomer and all others as a function of the linear distance s. | def ps (H) :
p = np.array ([np.mean (np.diagonal (H, offset=k))
for k in range (H.shape[0])])
return p/np.sum(p) | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def compute_dist(self, s1, s2):\n return sp_linalg.norm(self.wrap(s1, s2))",
"def compute_dist(self, s1, s2):\n return sp_linalg.norm(self.wrap(s1, s2))",
"def norm_dist(numbers, x):\r\n m = np.mean(np.array(numbers))\r\n s = np.std(np.array(numbers))\r\n if s < 1e-5:\r\n s = 1e-5... | [
"0.59207755",
"0.59207755",
"0.58610827",
"0.58582896",
"0.58436716",
"0.5814182",
"0.579739",
"0.5756278",
"0.57502955",
"0.57094455",
"0.56843543",
"0.5625571",
"0.56150544",
"0.5607217",
"0.55954623",
"0.5591235",
"0.5581353",
"0.5579577",
"0.5574086",
"0.5562843",
"0.5559... | 0.0 | -1 |
Calculate the relative proportion of contacts of the tracers with binding sites compared with nonbinding sites. As usual user should supply equilibration time, sampling time, and contact threshold value. | def contacts_with (sim,polymer_text,tracers_text,bindingsites_text,teq,tsample,threshold) :
# select polymer, tracers, and binding sites
polymer = sim.u.select_atoms (polymer_text)
tracers = sim.u.select_atoms (tracers_text)
bss = sim.u.select_atoms (bindingsites_text)
# select binding site indices
bs_n = bss.n_atoms
bs_idx = bss.indices
# select non-binding site indices
polymer_idx = polymer.indices
nbs_idx = np.setdiff1d (polymer_idx,bs_idx)
nbs_n = nbs_idx.size
# evaluate contacts with binding sites and non-binding sites for each
# independent simulation snapshot
c = []
for i,ts in enumerate(sim.u.trajectory[teq::tsample]) :
d = distance_array (polymer.positions,tracers.positions,
box=ts.dimensions)
contacts = d<threshold
cB = np.sum (contacts[bs_idx]).astype('float')
cA = np.sum (contacts[nbs_idx]).astype('float')
if cA != 0 :
c.append ((cB/cA) / (float(bs_n)/nbs_n))
return np.mean(np.array(c)) | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def contact_probability(summary, results, contacts, bins, feature):\r\n\r\n # prepare sampling interval size\r\n bin_width = bins[2]\r\n n_bins = int(np.ceil(bins[1]/bin_width))\r\n # bin bounds\r\n end_bins = np.arange(bin_width,bin_width*(n_bins+1), bin_width)\r\n # prepare arrays\r\n # two ... | [
"0.596737",
"0.547867",
"0.54080415",
"0.5299857",
"0.5124064",
"0.5097309",
"0.5068922",
"0.50371313",
"0.5016846",
"0.4988263",
"0.4936729",
"0.49304453",
"0.49304453",
"0.48953757",
"0.48854768",
"0.4878589",
"0.4844149",
"0.48417434",
"0.48266906",
"0.48197976",
"0.480789... | 0.6338657 | 0 |
Perform a simple fit of the supplied timedependent MSD, using a linear regression of the logarithms of the values. User must supply the conversion factor from time to real time and from length to real length. Also, user | def fit_msd (msd,cutoff,delta_t,scale_l) :
# prepare the values to fit: exclude the first value because it is zero
t = np.arange(msd.size)*delta_t
x = np.log(t[cutoff:])
y = np.log(msd[cutoff:]*scale_l**2)
# perform fit to y = ax + b with their errors
b,a,db,da = mbt.linear_regression (x,y,0.99)
# now convert the value of b into a diffusion coefficient
D = np.exp(b)/6.0
dD = np.exp(db)/6.0
return a,da,D,dD | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def fit_model(train_ts_dis, data, init_prior = [.5,.5], bias = True, mode = \"biasmodel\"):\r\n if mode == \"biasmodel\":\r\n #Fitting Functions\r\n def bias_fitfunc(rp, tsb, df):\r\n init_prior = [.5,.5]\r\n model = BiasPredModel(train_ts_dis, init_prior, ts_bias = tsb, recu... | [
"0.6344083",
"0.59664893",
"0.5950108",
"0.58820957",
"0.57336086",
"0.5699005",
"0.56805956",
"0.5650658",
"0.5647881",
"0.5618573",
"0.5590892",
"0.55860865",
"0.5570882",
"0.556389",
"0.5562849",
"0.55571467",
"0.55424637",
"0.547708",
"0.5467977",
"0.54346925",
"0.5430097... | 0.668302 | 0 |
Calculate the mean square displacement of the particles defined by 'particles_text' in simulation sim, using sampling tsample and equilibration time teq. Returns the matrix corresponding to the mean square displacement of each particle, along with a matrix corresponding to the variance in the estimate of this quantity. | def msd_t (sim,particles_text,teq,tsample) :
u = sim.u
particles = u.select_atoms (particles_text)
nparticles = particles.n_atoms
nslice = traj_nslice (u,teq,tsample)
# initialize the matrix containing all the positions
# of the particles at all the sampling frames
particles_pos = np.zeros ((nslice,nparticles,3))
for i,ts in enumerate(u.trajectory[teq::tsample]) :
particles_pos[i,:,:] = particles.positions
# now initialize the Delta matrix, which contains the
# squared differences between the particles' positions
# at different time delays
Nt = int(nslice/2)
Delta = np.zeros((nparticles,Nt,Nt))
for delay in xrange(1,Nt+1) :
for t0 in xrange (Nt) :
t1 = t0 + delay
pos1 = particles_pos[t1,:,:]
pos0 = particles_pos[t0,:,:]
Delta[:,delay-1,t0] = np.sum((pos1-pos0)**2,axis=1)
# return the matrices of MSD and its variance
return np.mean(Delta,axis=2),np.var(Delta,axis=2) | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def msd_t(sim,particles_text,teq,tsample) :\n u = sim.u\n particles = u.select_atoms(particles_text)\n nparticles = particles.n_atoms\n nslice = traj_nslice (u,teq,tsample)\n # initialize the matrix containing all the positions\n # of the particles at all the sampling frames\n particles_pos = ... | [
"0.7488713",
"0.5663224",
"0.5223949",
"0.51519114",
"0.5096424",
"0.5066858",
"0.5066858",
"0.5045784",
"0.5026792",
"0.50021636",
"0.50003314",
"0.49920407",
"0.49362248",
"0.4934721",
"0.4924958",
"0.49151853",
"0.4903255",
"0.48586112",
"0.48389977",
"0.4803725",
"0.47902... | 0.7475914 | 1 |
Calculate the minimum distance between the atoms defined in sel1 and the atoms defined in sel2, as a function of time. Returns a matrix that contains the minimum distance for each atom defined in sel1. As usual user should supply equilibration time, sampling time, and contact threshold value. | def dmin_sel (sim,sel1_text,sel2_text,teq,tsample) :
# define atom selections
sel1 = sim.u.select_atoms (sel1_text)
sel2 = sim.u.select_atoms (sel2_text)
# get number of atoms in selection 1
natoms = sel1.n_atoms
nslice = traj_nslice (sim.u,teq,tsample)
dmin = np.zeros((natoms,nslice))
for i,ts in enumerate(sim.u.trajectory[teq::tsample]) :
d = distance_array (sel1.positions,sel2.positions,
box=ts.dimensions)
dmin[:,i] = d.min(axis=1)
return dmin | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def minimum_subset_distance(D, limits1, limits2):\n score = numpy.ones( (limits1[1]) )\n for i in xrange(limits1[1]):\n for j in xrange(limits2[1]-limits2[0]):\n score[i] = min(score[i], D[i,j+limits2[0]-1])\n #print i, j, D[i,j+limits2[0]-1], score[i], min(score[i], D[i,j+limits... | [
"0.5895745",
"0.5762979",
"0.57414365",
"0.5732029",
"0.54276377",
"0.5345767",
"0.5334685",
"0.5314768",
"0.5237118",
"0.51300615",
"0.51152414",
"0.50853014",
"0.5079385",
"0.50745434",
"0.5033808",
"0.50107294",
"0.5001764",
"0.49995542",
"0.4967053",
"0.49510542",
"0.4891... | 0.76610744 | 0 |
Get the image index of all particles in simulation, at the frame 'frame_id' | def particle_images (sim,frame_id) :
# get positions of all particles: define first the atom selection, then jump to
# the user-requested trajectory frame, get the box dimensions (currently works
# only for orthorhombic boxes, then calculate the image indices
atoms = sim.u.select_atoms ('all')
ts = sim.u.trajectory[frame_id]
L = ts.dimensions[:3]
pos = atoms.positions + L/2.
return pos//L | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def image_id_at(self, i):\n return i",
"def _get_frame_index(self, frame):\n if isinstance(frame, cf.CoordinateFrame):\n frame = frame.name\n #frame_names = [getattr(item[0], \"name\", item[0]) for item in self._pipeline]\n frame_names = [step.frame if isinstance(step.frame... | [
"0.64790046",
"0.6461773",
"0.63308996",
"0.60192746",
"0.5952561",
"0.5895804",
"0.58919054",
"0.5886345",
"0.5864442",
"0.5850456",
"0.58418465",
"0.5816864",
"0.57517457",
"0.57352793",
"0.5733944",
"0.5714067",
"0.56858724",
"0.5682771",
"0.5660249",
"0.5656632",
"0.56062... | 0.82224417 | 0 |
Calculate the matrix that represents the number of times that the tracers (defined by 'tracer_text') jump from one site to another site of the polymer (defined by 'polymer_text'). The simulation 'sim' is sampled at 'tsample', excluding the first 'teq' time frames. Contact between a tracer and the polymer is defined by the distance being smaller than 'threshold'. | def jumping_matrix (sim,polymer_text,tracer_text,teq,tsample,threshold) :
# define polymer and tracers
u = sim.u
polymer = u.select_atoms(polymer_text)
tracers = u.select_atoms(tracer_text)
n_polymer = polymer.n_atoms
n_tracers = tracers.n_atoms
# initialize jumping matrix and first distance matrix d_prev
J = np.zeros ((n_polymer,n_polymer),dtype=np.int32)
ts = u.trajectory [teq]
d_prev = distance_array (polymer.positions,tracers.positions,
box=ts.dimensions)
D_prev = d_prev<threshold
for ts in u.trajectory [teq::tsample] :
# get distance matrix at current time step
d_next = distance_array (polymer.positions,tracers.positions,
box=ts.dimensions)
D_next = d_next<threshold
# get jumps of all tracers and add it to the jumping matrix
for i in xrange (n_tracers) :
t_prev = D_prev [:,i]
t_next = D_next [:,i].reshape ((n_polymer,1))
t = t_prev * t_next
J += t
D_prev = D_next.copy()
return J | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def contacts_t (sim,polymer_text,tracer_text,teq,tsample,threshold) :\n u = sim.u\n polymer = u.select_atoms (polymer_text)\n tracers = u.select_atoms (tracer_text)\n ntracers = tracers.n_atoms\n npolymer = polymer.n_atoms\n nslice = mbt.traj_nslice(u,teq,tsample)\n C = np.zeros((ntracers,nsli... | [
"0.7618557",
"0.74560314",
"0.744143",
"0.7299032",
"0.5812742",
"0.5133513",
"0.4958529",
"0.49087512",
"0.48836043",
"0.48615563",
"0.480445",
"0.4792166",
"0.4757305",
"0.4745062",
"0.4716135",
"0.46702787",
"0.46492743",
"0.46094853",
"0.45879653",
"0.45620257",
"0.455755... | 0.7318586 | 3 |
For the simulation 'sim', calculate the matrix of binding events of the polymer and the tracers. Returns a contacts matrix of the shape (ntracers,nslice,npolymer). | def contacts_t (sim,polymer_text,tracer_text,teq,tsample,threshold) :
u = sim.u
polymer = u.select_atoms (polymer_text)
tracers = u.select_atoms (tracer_text)
ntracers = tracers.n_atoms
npolymer = polymer.n_atoms
nslice = mbt.traj_nslice(u,teq,tsample)
C = np.zeros((ntracers,nslice,npolymer),dtype=bool)
for i,ts in enumerate(u.trajectory [teq::tsample]) :
d = distance_array (tracers.positions,polymer.positions,
box=ts.dimensions)
c = d<threshold
C[:,i,:] = c
return C | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def contacts_with (sim,polymer_text,tracers_text,bindingsites_text,teq,tsample,threshold) :\n # select polymer, tracers, and binding sites\n polymer = sim.u.select_atoms (polymer_text)\n tracers = sim.u.select_atoms (tracers_text)\n bss = sim.u.select_atoms (bindingsites_text)\n # select binding sit... | [
"0.64249676",
"0.56675434",
"0.5327914",
"0.5293578",
"0.5202153",
"0.5148195",
"0.51123756",
"0.504556",
"0.5030026",
"0.50254846",
"0.49442828",
"0.48849455",
"0.48715222",
"0.47897685",
"0.47662282",
"0.472734",
"0.47106746",
"0.47045848",
"0.46944386",
"0.46944386",
"0.46... | 0.58174694 | 1 |
Calculate the matrix of average intrapolymer distances. User must supply the parameters teq, tsample and threshold. | def distance_matrix (sim,polymer_text,teq,tsample,threshold=2.5) :
u = sim.u
polymer = u.select_atoms (polymer_text)
N = polymer.n_atoms
nslice = mbt.traj_nslice (u,teq,tsample)
d = np.zeros((N,N))
for i,ts in enumerate(u.trajectory[teq::tsample]) :
this_d = distance_array(polymer.positions,
polymer.positions,
box=ts.dimensions)
d = mbt.new_average(i,d,this_d)
return d | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def calc_qavg(self, TRANGE = []):\n #put some variables in this namespace\n nebins=self.nebins\n nqbins=self.nqbins\n binenergy=self.binenergy\n binq=self.binq\n visits2d=self.visits2d\n logn_Eq=self.logn_Eq\n \n if len(TRANGE) == 0:\n NTEMP = 1... | [
"0.5694141",
"0.5119244",
"0.5017542",
"0.49339455",
"0.49261585",
"0.48504174",
"0.4848955",
"0.48481247",
"0.48393378",
"0.4766152",
"0.47565967",
"0.47392762",
"0.4727343",
"0.47033104",
"0.46980202",
"0.46610996",
"0.46503145",
"0.4611686",
"0.46015757",
"0.45886338",
"0.... | 0.66201276 | 0 |
This function does the complete analysis of the tracers in the simulation. It calculates the virtual HiC, virtual ChIPseq, KullbackLeibler divergence between the two profiles as a function of time, and coverage of the tracers. | def tracers_analysis (sim,polymer_text,tracer_text,teq,tsample,t_threshold,p_threshold) :
# define DKL(t) vector
nframes = traj_nslice(sim.u,teq,tsample)
DKL_t = np.zeros(nframes)
# define polymer and tracers
polymer = sim.u.select_atoms(polymer_text)
tracers = sim.u.select_atoms(tracer_text)
N = polymer.n_atoms
ntracers = tracers.n_atoms
# init H and C vectors
H = np.zeros((N,N),dtype=np.int32)
C = np.zeros((N,ntracers),dtype=np.int32)
# analyze all simulation frames as decided
for i,ts in enumerate(sim.u.trajectory[teq::tsample]) :
# calculate Hi-C at this time frame
d = distance_array(polymer.positions,polymer.positions,box=ts.dimensions)
H += (d<p_threshold)
Rt = H.sum(axis=1)
# calculate ChIP-seq at this time frame
c = distance_array(polymer.positions,tracers.positions,box=ts.dimensions)
C += (c<t_threshold)
Ct = C.sum(axis=1)
DKL_t[i] = mbt.KL_divergence(Ct,Rt)
# coverage analysis
C[C>1] = 1
coverage = C.sum(axis=0).astype('float')/N
return DKL_t,H,Ct.astype(np.int64),coverage | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def tracers_analysis (sim,polymer_text,tracer_text,teq,tsample,t_threshold,p_threshold) :\n # define DKL(t) vector\n nframes = traj_nslice(sim.u,teq,tsample)\n DKL_t = np.zeros(nframes)\n # define polymer and tracers\n polymer = sim.u.select_atoms(polymer_text)\n tracers = sim.u.select_atoms(trac... | [
"0.63561374",
"0.5775331",
"0.5715415",
"0.5611014",
"0.5607633",
"0.55742955",
"0.54829526",
"0.5457336",
"0.54125506",
"0.5397806",
"0.5258343",
"0.5246536",
"0.52320576",
"0.5230727",
"0.5224489",
"0.5222911",
"0.52141297",
"0.52132136",
"0.52128506",
"0.52064836",
"0.5187... | 0.6349215 | 1 |
Turns off the bot | async def poweroff(ctx):
await ctx.send("Bye")
await bot.logout() | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def turn_off(self, **kwargs):\n self._send_command(\"turn_off\")",
"def turn_off(self, **kwargs):\n self.robot.pause_cleaning()\n time.sleep(1)\n self.robot.send_to_base()",
"def turn_off(self, **kwargs):\n set_sonoff_state(self._host, \"off\")\n self._state = False",
... | [
"0.7935323",
"0.78928596",
"0.7686037",
"0.75895715",
"0.75502986",
"0.75314146",
"0.7467795",
"0.746141",
"0.7441158",
"0.7391506",
"0.7319515",
"0.731269",
"0.7301029",
"0.72807145",
"0.72749",
"0.72747",
"0.7204974",
"0.71899074",
"0.71870434",
"0.7155394",
"0.71427",
"0... | 0.6489319 | 94 |
A little help always comes handy | async def _help(ctx, *, command_name: str=None):
if command_name:
command = bot.get_command(command_name)
if not command:
return await ctx.send("No such command!")
return await ctx.send(f"```\n{ctx.prefix}{command.name} {command.signature}\n\n{command.help or 'Missing description'}```")
description = []
for name, cog in bot.cogs.items():
entries = [" - ".join([cmd.name, cmd.short_doc or "Missing description"]) for cmd in cog.get_commands() if await _can_run(cmd, ctx) and not cmd.hidden]
if entries:
description.append(f"**{name}**:")
description.append("• " + "\n• ".join(entries))
await ctx.send(embed=discord.Embed(description="\n".join(description), color=ctx.me.color)) | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def help():",
"def help():\n \n pass",
"def printhelp():",
"def help(self):",
"def help(self):",
"def sth():",
"def usage():",
"def usage():",
"def help_me():\n print(\"i'm trapped\")",
"def help():\n print \"Help comes to those who ask\"",
"def help(self):\n pass",
... | [
"0.7713086",
"0.7395725",
"0.73808426",
"0.730104",
"0.730104",
"0.71486044",
"0.7137485",
"0.7137485",
"0.70060796",
"0.69973403",
"0.68186736",
"0.68186736",
"0.6813253",
"0.6768411",
"0.6729083",
"0.6727921",
"0.65956175",
"0.6553707",
"0.65402293",
"0.65402293",
"0.654022... | 0.0 | -1 |
print results from end global state | def print_result(global_params, end_global_state, quiet_print=False):
global_state = python_funcs.GlobalState()
global_state.decode(end_global_state, global_params)
if not quiet_print:
print("Centroids: \n{}".format(global_state.centroids_aux))
print("Iterations: {}".format(global_state.iteration)) | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def print_results(self):\n pass",
"def print_out():\n pass",
"def state_print_exit(cfg, app, win):",
"def end(self):\n self.my_print(\"\\t[DONE]\", msg_types.INFO)\n self.in_progress = False",
"def flush_output():\n if len(buffered) == 1:\n code.add_lin... | [
"0.7087874",
"0.68458045",
"0.6671397",
"0.65722066",
"0.64805436",
"0.6441369",
"0.64383215",
"0.64282376",
"0.6374665",
"0.63660663",
"0.6346737",
"0.63044566",
"0.6283972",
"0.62697494",
"0.62408197",
"0.61895734",
"0.61799115",
"0.61781204",
"0.6157988",
"0.61376",
"0.612... | 0.65808356 | 3 |
Nonblocking file lock context manager | def file_lock(filed, exclusive=False):
opcode = [fcntl.LOCK_SH, fcntl.LOCK_EX][exclusive] | fcntl.LOCK_NB
try:
try:
fcntl.flock(filed, opcode)
except IOError, err:
if not (err.errno == errno.EAGAIN or err.errno == errno.EACCES):
raise
else:
yield False
else:
yield True
except:
raise
finally:
fcntl.flock(filed, fcntl.LOCK_UN) | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def lock_file_manager(file_name, mode='a+'):\n import fcntl\n with open(file_name, mode) as file_descriptor:\n try:\n fcntl.flock(file_descriptor, fcntl.LOCK_EX)\n yield file_descriptor\n finally:\n fcntl.flock(file_descriptor, fcntl.LOCK_UN)",
"def _file_lock... | [
"0.72453177",
"0.71964896",
"0.6902446",
"0.69000673",
"0.6865638",
"0.6817763",
"0.67962337",
"0.67926115",
"0.67845774",
"0.6774534",
"0.67527604",
"0.6738878",
"0.6731895",
"0.6731811",
"0.66535723",
"0.66099846",
"0.66014665",
"0.65571654",
"0.6515045",
"0.65061176",
"0.6... | 0.6644282 | 15 |
Initalize name and age attibutes. | def __init__(self, name, age):
self.name = name
self.age = age | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def __init__(self, first_name, last_name, age):\n self.first_name = first_name\n self.last_name = last_name\n self.age = age",
"def __init__(self, first_name, last_name, age):\n self.first_name = first_name\n self.last_name = last_name\n self.age = age",
"def __init__(... | [
"0.74732316",
"0.74732316",
"0.74732316",
"0.74732316",
"0.74732316",
"0.74732316",
"0.74732316",
"0.74732316",
"0.7472384",
"0.736729",
"0.7351724",
"0.7351724",
"0.7351724",
"0.7351724",
"0.72921795",
"0.7189177",
"0.7124933",
"0.711583",
"0.6997387",
"0.6881059",
"0.686831... | 0.75609356 | 1 |
sulate a caricter shotting a Shuriken in a responce to commond. | def Shuriken(self):
print(self.name.title() + " is now shotting.") | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"async def shibe(self, ctx: Message):\n\t\timage_url = requests.get(\"https://shibe.online/api/shibes?count=1\").json()[0]\n\t\tawait self.send(image_url, whisper=[ctx.author.id])",
"async def shibe(self, ctx: DogbotContext):\n async with ctx.typing():\n try:\n resp = await utils.... | [
"0.6028164",
"0.60064155",
"0.56720436",
"0.5613526",
"0.5598986",
"0.5586523",
"0.558651",
"0.55609393",
"0.5525008",
"0.5505774",
"0.55052584",
"0.5490252",
"0.5482178",
"0.5477882",
"0.54740316",
"0.5473472",
"0.5458496",
"0.5421021",
"0.53871614",
"0.5370366",
"0.5358281"... | 0.5446821 | 17 |
simulate a caricter use Deflect in a responce to command. | def Deflect(self):
print(self.name.Title() + "Deflect!") | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"async def _defacto(self, ctx: commands.Context):\n responses = ['DI FACTO', 'di facto']\n await ctx.send(random.choice(responses))",
"async def _conoscitore(self, ctx: commands.Context):\n responses = ['de facto, di facto', 'fanculizzati','Tra il lusco e il brusco,tra il serio e il profano,tra ... | [
"0.6985522",
"0.6342284",
"0.60938257",
"0.6028364",
"0.59290314",
"0.58536536",
"0.5789165",
"0.5776093",
"0.5768388",
"0.5695349",
"0.5676105",
"0.5642792",
"0.56084",
"0.5593312",
"0.559221",
"0.55562896",
"0.5551798",
"0.55446804",
"0.55304146",
"0.55226284",
"0.5518135",... | 0.0 | -1 |
simulate a caricter useing Dash in a responce to command. | def Dash(self):
print(self.name.Title() + " Dash!") | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def command():\n pass",
"def do_command(command):\n send_command(command)\n # time.sleep(0.1) # may be required on slow machines\n response = get_response()\n print(\"Rcvd: <<< \" + response)\n return response",
"def do_command(command):\n send_command(command)\n response = get_resp... | [
"0.61657566",
"0.6023819",
"0.5984443",
"0.5877229",
"0.58400345",
"0.57541966",
"0.5736261",
"0.56955343",
"0.56944484",
"0.56820494",
"0.5672572",
"0.5652428",
"0.5651466",
"0.5642728",
"0.5610112",
"0.5601906",
"0.5577275",
"0.5572056",
"0.5553276",
"0.5535632",
"0.5515353... | 0.53503895 | 43 |
simulate a caricter useing Dragon Balde in a responce to command. | def Dragon_Blade(self):
print(self.name.Title() + " Dragon blade!") | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def command():\n pass",
"def on_command(self, game) -> None:\n pass",
"def command(facade, note):\n print facade, note",
"def _sendingCommand(self): \n\n while True:\n self.tello.send_command('command') \n time.sleep(5)",
"def buzz_subroutine(self):\n... | [
"0.5954689",
"0.5898735",
"0.5884948",
"0.5832001",
"0.5795689",
"0.5784766",
"0.5779325",
"0.5699505",
"0.56711584",
"0.5627399",
"0.5624277",
"0.55758893",
"0.5572339",
"0.556279",
"0.55591536",
"0.5543098",
"0.5513337",
"0.5504965",
"0.5499147",
"0.54891926",
"0.5485525",
... | 0.0 | -1 |
Get the shape of an element x. If it is an element with a shape attribute, return it. If it is a list with more than one element, compute the shape by checking the len, and the shape of internal elements. In that case, the shape must be consistent. Finally, in other case return () as shape. | def get_shape(x):
if isinstance(x, list) and len(x) > 0:
shapes = [get_shape(subx) for subx in x]
if any([s != shapes[0] for s in shapes[1:]]):
raise ValueError('Parameter dimension not consistent: {}'.format(x))
return (len(x), ) + shapes[0]
else:
if hasattr(x, '_shape_tuple'):
return x._shape_tuple() # method to return the shape as a tuple
elif hasattr(x, 'shape'):
return tuple(x.shape)
else:
return () | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def get_shape(x):\n\n return None if jnp.isscalar(x) else x.shape",
"def shape(self):\n for component in ('x', 'y', 'z', 'r', 't'):\n arr = getattr(self, component)\n if arr is not None:\n return arr.shape\n return ()",
"def shape(self) -> Optional[tuple]:\... | [
"0.7307297",
"0.71993625",
"0.69666064",
"0.6919222",
"0.6845282",
"0.68373024",
"0.6807176",
"0.6639613",
"0.6614478",
"0.65794605",
"0.65702397",
"0.6511562",
"0.6511562",
"0.64650935",
"0.64642006",
"0.64271873",
"0.6416693",
"0.6414622",
"0.6394792",
"0.637807",
"0.637807... | 0.824383 | 0 |
Return the next state of a neuron. | def alter_state(neuron, inp):
# Refractory period (simplified)
if neuron['state'] == 1:
return 0
# Firing threshold (simplified)
elif inp >= 3:
return 1
# Random firing probability
elif random() < random_fire_prob:
return 1
else:
return 0 | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def get_next(self):\n\t\tassert(len(self.past_values) < 256**3)\n\t\twhile self.advance_state() in self.past_values:\n\t\t\tpass\n\t\tself.past_values.add(self.state)\n\t\treturn self.state",
"def getNextState(self):\n return None",
"def getNextState(self):\n if self.__mode == \"AlphaBeta\":\n ... | [
"0.77205414",
"0.7427344",
"0.74042726",
"0.7253036",
"0.72341335",
"0.708382",
"0.7024877",
"0.6923807",
"0.68663293",
"0.6793928",
"0.67842984",
"0.6780127",
"0.6723994",
"0.670868",
"0.6659324",
"0.65982187",
"0.6551091",
"0.6523753",
"0.65129405",
"0.65007645",
"0.6497944... | 0.0 | -1 |
Function that make the teacher/s reports | def get(self, request, report_type):
# Verify if the coordinator is correctly logged in.
if not request.session.get('session', False) or not request.session['type'] == 'coordinator':
return render(request, self.template_login)
template = ''
context = {}
# Depending the option given return de requested reports.
if report_type == 'teacher_report':
template, context = self.teacher_report(request)
elif report_type == 'career_teachers_report':
template, context = self.career_teachers_report(request)
elif report_type == 'career_teachers_excel':
return self.career_teachers_excel(request)
# If there is a great request render the PDF's, otheway redirect to the reports view.
if template and context:
return render_to_pdf_response(request, template, context)
return redirect('/evaluations/career_results/32/47740/#reportes') | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def generate_report():\n\n # Fetch the top 3 most viewed articles and number of views and print them\n articles_query = get_articles_query()\n popular_articles = execute_query(articles_query)\n print_top_articles(popular_articles)\n\n # Fetch the most popular authors and print them\n authors_quer... | [
"0.63246506",
"0.60513675",
"0.604514",
"0.6042579",
"0.60300845",
"0.5960875",
"0.5941385",
"0.5932449",
"0.59081924",
"0.5858987",
"0.58584124",
"0.58095837",
"0.5787153",
"0.57824606",
"0.57559067",
"0.57432735",
"0.5736098",
"0.56988525",
"0.5692161",
"0.5679412",
"0.5599... | 0.52245754 | 66 |
Render a PDF with the career signatures results with their teachers, this is the deliverable document for the teacher | def career_teachers_excel(self, request):
# Get the career to be processed their results.
career_id = request.GET.get('career_id', '')
career = EvaluationsCareer.objects.get(pk__exact=career_id)
# Get the results for each esignature of the carrer en each exam.
data = self.get_career_results(career)
# Generates the CSV with the results of the career,then return as downloadable file.
response = self.get_teacher_results_excel(data)
return response | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def generate_pdf(request):\n reg_no = request.user.username\n user = get_object_or_404(User, username=reg_no)\n user_profile = user.get_profile()\n user_application = user_profile.application\n np = user_application.np\n \n response = HttpResponse(mimetype='application/pdf')\n response['Conten... | [
"0.6895623",
"0.68033445",
"0.6658746",
"0.6571573",
"0.64920616",
"0.64909965",
"0.6466932",
"0.6379791",
"0.6377591",
"0.6316708",
"0.6281751",
"0.62604356",
"0.62534684",
"0.6239564",
"0.61678696",
"0.6143105",
"0.6135836",
"0.610623",
"0.6105945",
"0.6096823",
"0.6086271"... | 0.5371696 | 95 |
Get the signatures results of the teacher in the given career for all the active exams. | def get_teacher_career_results(self, teacher, career):
data = []
# Get the active exams of the career.
exams = EvaluationsExam.objects.filter(
type__exact=career.type, status="ACTIVE")
# Get the results for each exam.
for exam in exams:
# Get the signatures of the teacher for the career in the exam.
signatures_dtl = EvaluationsTeacherSignature.objects.filter(
fk_teacher__exact=teacher.id, fk_period__exact=exam.fk_period, status="ACTIVE").select_related('fk_signature')
signatures_results = []
for signature_dtl in signatures_dtl:
# If it raise an exception, it means that the signature isn't evaluated yet or other error.
try:
# Get the results of the signature.
signature_results = EvaluationsSignatureResult.objects.get(
group=signature_dtl.group,
fk_signature=signature_dtl.fk_signature.id,
fk_exam=exam.id,
status="ACTIVE"
)
# Get the results for each question in the exam for the signature.
questions_results = EvaluationsSignatureQuestionResult.objects.filter(
group=signature_dtl.group,
fk_signature=signature_dtl.fk_signature.id,
fk_exam=exam.id,
fk_question__optional='NO',
status="ACTIVE"
).values_list('fk_question__description', 'result')
# Get the comments of the signature/group.
comments_result = EvaluationsSignatureQuestionResult.objects.get(
group=signature_dtl.group,
fk_signature=signature_dtl.fk_signature.id,
fk_exam=exam.id,
fk_question__optional='YES',
status="ACTIVE"
).result
# Split the comments and add them to a list, only the ones that are not empty.
comments = list(filter(None, comments_result.split('|')))
# Crate a dictionary with the results of the signature and the questions.
signatures_results.append({
'teacher': teacher.name + ' ' + teacher.last_name + ' ' + teacher.last_name_2,
'signature': signature_dtl.fk_signature.description,
'group': signature_dtl.group,
'average': signature_results.average,
'comments': comments,
'total_evaluated': signature_results.total_evaluated,
'questions': questions_results
})
except Exception:
pass
# Add the results to the exam dictionary.
exam_results = {
'exam': exam.description,
'career': career.description,
'signatures_results': signatures_results,
'period': exam.fk_period.period
}
# Add the exam results to the list that will be returned at the end.
data.append(exam_results)
return data | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def career_teachers_excel(self, request):\n\n # Get the career to be processed their results.\n career_id = request.GET.get('career_id', '')\n career = EvaluationsCareer.objects.get(pk__exact=career_id)\n\n # Get the results for each esignature of the carrer en each exam.\n data ... | [
"0.59553725",
"0.5373946",
"0.5306007",
"0.5172902",
"0.5093456",
"0.4992784",
"0.49038228",
"0.49021885",
"0.48847973",
"0.48658186",
"0.4847523",
"0.4831599",
"0.48291838",
"0.4825473",
"0.47478107",
"0.4725367",
"0.47177714",
"0.4660074",
"0.46355888",
"0.46003297",
"0.459... | 0.7810591 | 0 |
Gets the count for the current tab and the count for the conversations in all 4 tabs | def get_all_conversation_type_counts(survey_id, conversation_tab, business_id, category):
logger.info(
"Retrieving count of threads for all conversation tabs",
survey_id=survey_id,
conversation_tab=conversation_tab,
business_id=business_id,
category=category,
)
response = _get_conversation_counts(business_id, conversation_tab, survey_id, category, all_conversation_types=True)
try:
response.raise_for_status()
except HTTPError:
logger.exception("Thread count failed")
raise ApiError(response)
logger.info("Count successful")
try:
totals = response.json()["totals"]
# Secure Message uses different identifiers to the tab names used in the ui, this translates the names
if "new_respondent_conversations" in totals:
totals["initial"] = totals.pop("new_respondent_conversations")
if "my_conversations" in totals:
totals["my messages"] = totals.pop("my_conversations")
totals["current"] = totals[conversation_tab]
return totals
except KeyError:
logger.exception("Response was successful but didn't contain a 'totals' key")
raise | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def _get_conversation_counts(business_id, conversation_tab, survey_id, category, all_conversation_types):\n params = _get_secure_message_threads_params(\n survey_id, business_id, conversation_tab, category, all_conversation_types\n )\n url = f'{current_app.config[\"SECURE_MESSAGE_URL\"]}/messages/c... | [
"0.70647997",
"0.5977005",
"0.58980954",
"0.5830759",
"0.58140135",
"0.5813447",
"0.57283854",
"0.5707127",
"0.56924605",
"0.56898373",
"0.5689461",
"0.56750286",
"0.5671644",
"0.5657192",
"0.56248367",
"0.56144553",
"0.5568868",
"0.5568868",
"0.5531278",
"0.55113405",
"0.547... | 0.6258583 | 1 |
Gets the count of conversations based on the params | def _get_conversation_counts(business_id, conversation_tab, survey_id, category, all_conversation_types):
params = _get_secure_message_threads_params(
survey_id, business_id, conversation_tab, category, all_conversation_types
)
url = f'{current_app.config["SECURE_MESSAGE_URL"]}/messages/count'
response = requests.get(url, headers={"Authorization": _get_jwt()}, params=params)
return response | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def getNumberOfConversations(node, catalog=None):\n if catalog is None:\n catalog = getToolByName(node, 'portal_catalog')\n return len(catalog(\n object_provides=IConversation.__identifier__,\n path='/'.join(node.getPhysicalPath())))",
"def count_chat_with(self, actor_label):\n ... | [
"0.6763089",
"0.6620903",
"0.64600253",
"0.6158435",
"0.61192197",
"0.6113174",
"0.60978407",
"0.60919636",
"0.6040849",
"0.6025221",
"0.59833664",
"0.59689814",
"0.5946903",
"0.5919529",
"0.59178835",
"0.5917685",
"0.59037703",
"0.5818629",
"0.58184177",
"0.5817921",
"0.5766... | 0.71310955 | 0 |
creates a params dictionary | def _get_secure_message_threads_params(
survey_id, business_id, conversation_tab, category, all_conversation_types=False
):
params = {
"is_closed": "true" if conversation_tab == "closed" else "false",
"my_conversations": "true" if conversation_tab == "my messages" else "false",
"new_respondent_conversations": "true" if conversation_tab == "initial" else "false",
"category": category,
"all_conversation_types": "true" if all_conversation_types else "false",
}
if business_id:
params["business_id"] = business_id
if survey_id:
params["survey"] = survey_id
return params | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def get_params(self):\n return {}",
"def __make_params(args):\n data = {}\n for i in range(len(args)):\n if i == 0: # saltando a primeira iteracao pra\n # saltar o parametro que é o nome do arquivo de execução\n continue\n if not i % 2 == 0:\n... | [
"0.7703891",
"0.7555634",
"0.7452079",
"0.738078",
"0.7275091",
"0.7236291",
"0.7231462",
"0.71239674",
"0.7104775",
"0.7098227",
"0.7097978",
"0.7076554",
"0.7066415",
"0.7065275",
"0.70578027",
"0.70404214",
"0.7035766",
"0.7032196",
"0.7031023",
"0.70140505",
"0.7013512",
... | 0.0 | -1 |
Parse the given handle of genecard data and the handle of known sequences. This will create a iterable of the entries that are in the file. | def parse(handle, known_handle) -> ty.Iterator[data.Entry]:
entries = parser.parse(CONTEXT, handle, known_handle)
return map(op.itemgetter(0), entries) | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def parse_fasta(self, filename):\n id = ''\n desc = ''\n tempseq = []\n try:\n seqfile = open(filename,'r')\n for line in seqfile:\n if line.startswith('>'):\n if not id is '':\n yield { 'id': id.strip(), 'de... | [
"0.67224",
"0.6704314",
"0.6645868",
"0.654687",
"0.64984864",
"0.6471601",
"0.6452584",
"0.64150226",
"0.64117914",
"0.63433754",
"0.62971896",
"0.6088554",
"0.6052537",
"0.59814525",
"0.5959283",
"0.5950844",
"0.5925366",
"0.59202296",
"0.5879979",
"0.58754575",
"0.58688813... | 0.5930923 | 16 |
Open tty connection to sensor | def connect(self):
if self.link is not None:
self.disconnect()
self.link = serial.Serial(self.port, 9600, bytesize=serial.EIGHTBITS, parity=serial.PARITY_NONE,
stopbits=serial.STOPBITS_ONE, dsrdtr=True, timeout=5, interCharTimeout=0.1) | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def connect(self):\n # open serial port\n try:\n #device = self.get_device_name(self.serial_number)\n device = \"/dev/ttyAMA0\"\n self.serial.port = device\n # Set RTS line to low logic level\n self.serial.rts = False\n self.serial.ope... | [
"0.6903115",
"0.68906033",
"0.6732223",
"0.65403324",
"0.64509165",
"0.6344847",
"0.6311734",
"0.6310994",
"0.61750466",
"0.6152429",
"0.6144728",
"0.6142854",
"0.6009745",
"0.59961694",
"0.59875935",
"0.59851605",
"0.59655786",
"0.59528834",
"0.59287965",
"0.59237635",
"0.59... | 0.61139464 | 12 |
Read data from sensor | def get_status(self) -> Optional[dict]:
self.link.write(self._requestSequence)
response = self.link.read(9)
if len(response) == 9:
return {
"ppa": response[2] * 0xff + response[3],
"t": response[4],
"checksum": self._validate_checksum(response),
}
return None | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def get_data(self):\n return read_sensor(bus=self.bus,\n address=self.address)",
"def read_sensor_raw(self):\n return self.read_sensor()",
"def read_sensor_raw(self):\n return self.read_sensor()",
"def read_from_serial(self):\n self.running = True\n ... | [
"0.7681717",
"0.75530523",
"0.75530523",
"0.7083415",
"0.7037263",
"0.6966631",
"0.69487876",
"0.6884216",
"0.6849923",
"0.6832559",
"0.6738604",
"0.67027956",
"0.6698821",
"0.6676869",
"0.66277635",
"0.6584875",
"0.6570664",
"0.6531048",
"0.65308553",
"0.6529524",
"0.6517791... | 0.0 | -1 |
Check if message contains correct checksum | def _validate_checksum(self, msg: bytes) -> bool:
return self._checksum(msg) == msg[8] | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def verify_checksum(message, previous_csum=0):\n if message.message_type in CHECKSUM_MSG_TYPES:\n csum = compute_checksum(\n message.checksum[0],\n message.args,\n previous_csum,\n )\n\n if csum == message.checksum[1]:\n return True\n else:... | [
"0.7705907",
"0.7587994",
"0.752931",
"0.7426855",
"0.7415338",
"0.73797804",
"0.7367894",
"0.73633546",
"0.72925925",
"0.72435987",
"0.7102735",
"0.70819044",
"0.702974",
"0.70258206",
"0.70078015",
"0.70042783",
"0.6903123",
"0.6886536",
"0.68748033",
"0.68244356",
"0.67954... | 0.81222075 | 0 |
Trigger zero calibration (0PPM for Z14, 400 PPM for Z19) | def zero_calibrationn(self):
self.link.write(self._calibrateZeroSequence) | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def calibration(self, cal: int, /) -> None:",
"async def calibrate_zero(self):\n await self.hw_device.set_signal(self.channel)",
"def _doCalibration(self):\n self._cmdCalibration(2)",
"def photometric_calibration():\n pass",
"def calibration(self) -> int:",
"def calibration(self, pul... | [
"0.6423298",
"0.631655",
"0.6298982",
"0.6260567",
"0.6258085",
"0.62078565",
"0.6157141",
"0.5990511",
"0.59166145",
"0.5912427",
"0.5871232",
"0.5840601",
"0.5815842",
"0.5784849",
"0.5768754",
"0.5756073",
"0.5748982",
"0.5732277",
"0.57183784",
"0.5714611",
"0.5675555",
... | 0.6548889 | 0 |
trigger span point calibration | def span_calibration(self, value: int):
msg = bytearray(self._calibrateSpansequence)
msg[3] = (value & 0xff00) >> 8
msg[4] = value & 0xff
self.link.write(msg) | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def calibration(self, cal: int, /) -> None:",
"def _doCalibration(self):\n self._cmdCalibration(2)",
"def calibration(self) -> int:",
"def calibrate(self, x, y) -> None:\n pass",
"def photometric_calibration():\n pass",
"def calibration(self, pulse_min: int, pulse_max: int, pulse_cen... | [
"0.6384731",
"0.63308597",
"0.62952405",
"0.6208644",
"0.61908025",
"0.61782265",
"0.5976409",
"0.5935979",
"0.58907723",
"0.58194613",
"0.57763743",
"0.57468307",
"0.57454205",
"0.56647533",
"0.56266624",
"0.5603869",
"0.5593543",
"0.5544322",
"0.55343956",
"0.55329984",
"0.... | 0.5186941 | 39 |
The function finds the possible motifs of a certain length in a list of sequences and the number of occurrences of each motif in all sequences. | def find_motifs(seqs, k):
motifs = []
motifs_count = Counter()
for seq in seqs:
motifs_count.update([seq[i:i + k] for i in range(len(seq) - k + 1)])
for num in sorted(motifs_count.keys()):
motifs.append((num, motifs_count[num]))
return sorted(motifs, key=lambda tup: tup[1], reverse=True) | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def motif_count(sequences, start_at=4, stop_at=8):\n motifs = dict()\n for motif_length in range(start_at, stop_at):\n motifs[motif_length] = dict()\n for sequence in sequences:\n for motif in possible_motifs_by_length(motif_length):\n if motif not in motifs[motif_leng... | [
"0.7417468",
"0.71107745",
"0.70423144",
"0.6438651",
"0.63714194",
"0.62245244",
"0.6186527",
"0.6118691",
"0.6084201",
"0.60029674",
"0.6000182",
"0.5995448",
"0.5979884",
"0.5935135",
"0.58749336",
"0.5838555",
"0.5807639",
"0.5802357",
"0.5797088",
"0.57872176",
"0.578279... | 0.63483924 | 5 |
The function receives the transition probability and builds the matrix. | def build_t(p, ind):
with np.errstate(divide="ignore"):
k = len(ind)
trans = pd.DataFrame(np.log(float(0)), ind, ind)
lp = np.log(p)
trans.loc['B']['B'] = np.log(1 - p)
trans.loc['B']['M1'] = lp
for i in range(1, k):
if i == k - 1:
trans.loc['M' + str(k - 1)]['B'] = np.log(float(1))
else:
trans.loc['M' + str(i)]['M' + str(i + 1)] = np.log(float(1))
return trans | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def _transitions_matrix(self):\n trans_iter = (\n self._transitions[sj].logprob(si)\n for sj in self._states\n for si in self._states\n )\n\n transitions_logprob = np.fromiter(trans_iter, dtype=np.float64)\n N = len(self._states)\n return transiti... | [
"0.7077289",
"0.7056175",
"0.6960447",
"0.67535603",
"0.66316295",
"0.65062433",
"0.65017974",
"0.6477982",
"0.6435336",
"0.64129186",
"0.63912773",
"0.6377895",
"0.63283026",
"0.62082857",
"0.6103854",
"0.607584",
"0.6042429",
"0.6036283",
"0.60078543",
"0.60078543",
"0.5971... | 0.5502166 | 67 |
The function finds the most common seeds for several lengths and calculated the emissions and transitions matrices for each seed. | def get_seeds(seqs):
k_lengths = list(range(6, 20))
final_tuples = {}
motifs_dic = {}
# find most common seeds
seeds = [find_motifs(seqs, k) for k in k_lengths]
for i in k_lengths:
motifs_dic[i] = seeds[i - 6][0:5]
# calculate emissions and transitions
global_possible_occurrences = [sum([len(seq) - k + 1 for seq in seqs]) for k in k_lengths]
for key in motifs_dic.keys():
key_tuples = []
for m in motifs_dic[key]:
seed = m[0]
emissions, ind = build_e(seed, ALPHA)
p = m[1] / global_possible_occurrences[key - 6]
transitions = build_t(p, ind)
key_tuples.append((seed, emissions, transitions))
final_tuples[key] = key_tuples
return final_tuples | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def clusterSeeds(seeds, l): \n \n # Code to complete - you are free to define other functions as you like\n \n # The function will work like this,\n # first change all the (x( y1, y2, .., yn)) tuples into (x, y) tuples.\n # then from that point make the adj matrix so that ... | [
"0.5693699",
"0.5550675",
"0.54997873",
"0.5431754",
"0.5406691",
"0.5335756",
"0.53210217",
"0.53132635",
"0.53088075",
"0.53014505",
"0.5280768",
"0.5259172",
"0.5255134",
"0.5245243",
"0.51910627",
"0.5185651",
"0.51382864",
"0.5113323",
"0.5112537",
"0.5112202",
"0.509078... | 0.66207594 | 0 |
Return if x == y, if eps is not None, return if abs(xy) <= eps | def all_equal(x, y, eps=None):
if eps:
return all([abs(i - j) <= eps
for i, j in zip(x, y)
if i is not None and j is not None])
return all([i == j for i, j in zip(x, y)]) | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def realEqual(x,y,eps=10e-10):\n return abs(x-y) < eps",
"def approx_eq(x, y, tolerance = 0.000001):\n\treturn abs(x - y) < tolerance",
"def approx_eq(x, y, tolerance=1e-15):\n return abs(x - y) < tolerance",
"def is_almost_equal(self, x ,y ,epsilon=1*10**(-8)):\n \treturn abs(x-y) <= epsilon",
"d... | [
"0.78858256",
"0.7044861",
"0.6952725",
"0.69114923",
"0.6853465",
"0.6734588",
"0.66924584",
"0.6683078",
"0.66429543",
"0.6590756",
"0.6590756",
"0.64673287",
"0.6461987",
"0.6440452",
"0.64339805",
"0.6417307",
"0.6406655",
"0.6328267",
"0.63227063",
"0.6311484",
"0.622861... | 0.7315098 | 1 |
Reduce product of x. | def product(x):
return functools.reduce(lambda x, y: x * y, x) | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def prod(x):\n return functools.reduce(lambda a, b: a * b, x, 1)",
"def prod(self, x, y):\n return self.reduce(x + y)",
"def prod(l):\n return reduce(lambda a, b: a*b, l)",
"def prod(lst):\n return reduce(mul, lst, 1)",
"def _prod(seq):\n return reduce(lambda x, y: x*y, seq, 1)",
"def ... | [
"0.8485899",
"0.75339127",
"0.71145695",
"0.70959675",
"0.7030964",
"0.70278287",
"0.70278287",
"0.70278287",
"0.7009414",
"0.69021314",
"0.6851268",
"0.6762479",
"0.6750255",
"0.67320514",
"0.6707632",
"0.66387403",
"0.6615138",
"0.6581234",
"0.6580697",
"0.65709585",
"0.656... | 0.8354631 | 1 |
Expand multiple dimensions, i.e. add 1 after or before | def nd_expand_dims(x, n=1, before=True):
if before:
axes = tuple([np.newaxis] * n + [...])
else:
axes = tuple([...] + [np.newaxis] * n)
return x[axes] | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def expand(self):\n self.vertices[-1, :] = self.expanded",
"def expand_many(x, axes):\n for ax in axes:\n x = torch.unsqueeze(x, ax)\n return x",
"def expand_dims(self, axis, direction=1):\n res = self.empty_like()\n res.shape.insert(axis, [1])\n res.qhape.insert(axis, ... | [
"0.6542548",
"0.6396454",
"0.6312606",
"0.6284453",
"0.62287766",
"0.6210935",
"0.59937435",
"0.5978778",
"0.597588",
"0.5966989",
"0.5960754",
"0.58849263",
"0.58548903",
"0.58348984",
"0.5816448",
"0.5815774",
"0.58014554",
"0.57916814",
"0.56058437",
"0.5589006",
"0.553772... | 0.55461043 | 20 |
Return a `list` of `int` that represents a range of axes. | def ranged_axes(shape):
return (-np.arange(1, len(shape) + 1)[::-1]).tolist() or -1 | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def range() -> List[int]:\n pass",
"def limits(self):\n\n\t\treturn [\n\t\t\tmin(self.xvalues),\n\t\t\tmax(self.xvalues),\n\t\t\tmin(self.yvalues),\n\t\t\tmax(self.yvalues)]",
"def range(self):\n lows, highs = [], []\n for graph in self._graphs.values():\n low, high = graph.range()\n ... | [
"0.7072757",
"0.698906",
"0.6808658",
"0.6788123",
"0.6770003",
"0.6667891",
"0.6639482",
"0.6613244",
"0.6563589",
"0.65074825",
"0.6391037",
"0.6376127",
"0.63659567",
"0.63645595",
"0.635271",
"0.6344882",
"0.63376725",
"0.6322412",
"0.6316687",
"0.630669",
"0.6293695",
... | 0.6999914 | 1 |
Partition `zipped` into `num_steps`. | def partition(zipped, num_steps, allow_overflow=True):
size = len(zipped)
parts = []
for i in range(0, size, num_steps):
end = i + num_steps
if end >= size:
parts.append(zip(*zipped[i:]))
break
elif allow_overflow:
parts.append(zip(*zipped[i:end]))
return parts | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def get_chunks(num_items, num_steps):\n chunk_sizes = np.zeros(num_steps, dtype=int)\n chunk_sizes[:] = num_items // num_steps\n chunk_sizes[:num_items % num_steps] += 1\n\n chunk_offsets = np.roll(np.cumsum(chunk_sizes), 1)\n chunk_offsets[0] = 0\n return chunk_sizes, chunk_offsets",
"def test... | [
"0.56117743",
"0.5296957",
"0.528687",
"0.52073896",
"0.5157775",
"0.51236594",
"0.51106584",
"0.5107272",
"0.5092671",
"0.5070655",
"0.5070408",
"0.5062972",
"0.5044236",
"0.5033536",
"0.50270873",
"0.50222856",
"0.5005889",
"0.5004188",
"0.49633753",
"0.48935226",
"0.487203... | 0.80619586 | 0 |
Pad or truncate a list `x` with the values `pad_value` and `maxlen`. | def list_pad_or_truncate(x, maxlen, pad_value=None):
length = len(x)
if maxlen > length:
x += [pad_value] * (maxlen - length)
elif maxlen < length:
x = x[:maxlen]
return x | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def pad_with_zero(list, max_length, pad_type):\n padded_list = pad_sequences(list, maxlen=max_length, padding=pad_type, truncating='post')\n return padded_list",
"def pad_tokens(x, max_length, pad_token_id,\n truncate_from=\"left\",\n pad_from=\"left\"):\n assert truncate_fro... | [
"0.7232516",
"0.7194974",
"0.70571303",
"0.7005884",
"0.69063616",
"0.69063616",
"0.6899334",
"0.68993306",
"0.68805975",
"0.68804926",
"0.68802965",
"0.6851657",
"0.6702354",
"0.66523",
"0.6640961",
"0.65956634",
"0.65647626",
"0.65528095",
"0.6521586",
"0.6515963",
"0.64783... | 0.8817511 | 0 |
List all available api routes | def welcome():
return (
f"Available Routes:<br/>"
f"<br/>"
f"/api/v1.0/precipitation<br/>"
f"- List of previous year rain totals from all stations<br/>"
f"<br/>"
f"/api/v1.0/stations<br/>"
f"- List of station numbers and names<br/>"
f"<br/>"
f"/api/v1.0/tobs<br/>"
f"- List of previous year temperatures from all stations<br/>"
f"<br/>"
f"/api/v1.0/start<br/>"
f"- When given the start date (YYYY-MM-DD), calculates the MIN/AVG/MAX temperature for all dates greater than and equal to start date<br/>"
f"<br/>"
f"/api/v1.0/start/end<br/>"
f"- When given the start and end date (YYYY-MM-DD), calculates the MIN/AVG/MAX temperature for dates between start and end date inclusive<br/>"
) | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def list_all_apis():\n app.logger.info('Request for api list')\n func_list = []\n for rule in app.url_map.iter_rules():\n if rule.endpoint != 'static':\n methods = ','.join(rule.methods)\n func_list.append(\n (rule.rule, methods, app.view_functions[rule.endpoint... | [
"0.73875153",
"0.73784584",
"0.7363998",
"0.73515403",
"0.72580993",
"0.7240681",
"0.70347446",
"0.6954173",
"0.6894093",
"0.689102",
"0.67917705",
"0.67899156",
"0.6766698",
"0.67644465",
"0.6707333",
"0.66938263",
"0.6681043",
"0.66805625",
"0.6680057",
"0.665492",
"0.66533... | 0.0 | -1 |
Return list of rain fall for previous year | def precipitation():
last_date = session.query(Measurement.date).order_by(Measurement.date.desc()).first()
last_year = dt.date(2017, 8, 23) - dt.timedelta(days=365)
rain = session.query(Measurement.date, Measurement.prcp).\
filter(Measurement.date > last_year).\
order_by(Measurement.date).all() | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def xbrl_years(self):\n return [year for year in self.years if year >= 2021]",
"def calculate_iron_hemoglobin_time_lag_effective_fraction(df, years):\n final = pd.DataFrame()\n data = df.reset_index()\n for i in list(range(0, len(years))):\n current = (data.loc[data.year == years[i]]\n ... | [
"0.59791404",
"0.5774895",
"0.57245696",
"0.5675499",
"0.55384594",
"0.5491503",
"0.5471699",
"0.5403219",
"0.54018354",
"0.5384144",
"0.5367263",
"0.5363518",
"0.5355815",
"0.5304118",
"0.5281944",
"0.52812725",
"0.5260535",
"0.5254466",
"0.5250503",
"0.52311355",
"0.5220862... | 0.61494935 | 0 |
Return list of temperatures for previous year | def tobs():
last_date = session.query(Measurement.date).order_by(Measurement.date.desc()).first()
last_year = dt.date(2017, 8, 23) - dt.timedelta(days=365)
temperature = session.query(Measurement.date, Measurement.tobs).\
filter(Measurement.date > last_year).\
order_by(Measurement.date).all() | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def prior_year_temp():\n\n tobs_data = session.query(Measurements.tobs).all()\n return jsonify (tobs_data)",
"def temperatures():\n\n return station_9281",
"def temperature():\n #Query for the dates and temperature observations from a year from the last data point.\n\n last_temp= session.query(M... | [
"0.66815954",
"0.6298204",
"0.6157039",
"0.5975296",
"0.5776933",
"0.5760675",
"0.57288337",
"0.5723366",
"0.5635067",
"0.5608153",
"0.56007415",
"0.55899274",
"0.55566156",
"0.55073947",
"0.5480806",
"0.54751027",
"0.5452222",
"0.5442375",
"0.54336363",
"0.54262954",
"0.5424... | 0.6097273 | 3 |
Displays a Pandas dataframe in a table. Pass in a dataframe as first argument, and optionally how many items per page to display. ```solara import solara import pandas as pd import plotly df = plotly.data.iris() .component | def DataFrame(
df,
items_per_page=20,
column_actions: List[ColumnAction] = [],
cell_actions: List[CellAction] = [],
scrollable=False,
on_column_header_hover: Optional[Callable[[Optional[str]], None]] = None,
column_header_info: Optional[solara.Element] = None,
):
return DataTable(
df,
items_per_page=items_per_page,
column_actions=column_actions,
cell_actions=cell_actions,
scrollable=scrollable,
on_column_header_hover=on_column_header_hover,
column_header_info=column_header_info,
) | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def display_df(df):\n with pd.option_context(\"display.max_rows\", 1000, \"display.max_columns\", 100):\n display(df.head(10))",
"def render(cls, df: DataFrame, *args, **kwargs):\n from labext.widgets.data_table import DataTable\n dt = DataTable(df, *args, **kwargs)\n display(dt.wi... | [
"0.7244902",
"0.68102825",
"0.6721509",
"0.6696079",
"0.66785437",
"0.65800536",
"0.6570673",
"0.6392857",
"0.63512766",
"0.6313163",
"0.62770796",
"0.6257613",
"0.61832196",
"0.6140578",
"0.6116468",
"0.609051",
"0.6064527",
"0.60438454",
"0.60423064",
"0.59957415",
"0.59046... | 0.6249933 | 12 |
default range C2E3b (or C3E4b in American English) default range in midi 4863 transpose move range + 4 notes | def get_piano_notes(transpose=12):
transpose = keep_in_range(transpose, 0, 28) # full range 0-127
bottom_note = max(0, 4 * transpose) # left bottom
last_note = min(127, bottom_note + 15) # right upper
return bottom_note, last_note | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def test_step_to_midi_04():\n # This should produce 131, above range.\n step = 'C'\n alter = -1\n octave = 10\n with pytest.raises(Exception):\n U.step_to_midi(step, octave, alter)\n # This should produce 128, 1 above range.\n step = 'G'\n alter = 1\n octave = 9\n with pytest.r... | [
"0.5746772",
"0.5704539",
"0.5549268",
"0.5514676",
"0.5505806",
"0.5377225",
"0.53318983",
"0.5308374",
"0.5286769",
"0.51863843",
"0.5114025",
"0.5084776",
"0.5020724",
"0.5007611",
"0.4982287",
"0.49782467",
"0.49545217",
"0.49246523",
"0.4916429",
"0.4910963",
"0.48535934... | 0.0 | -1 |
Create mode of given scale | def scale_to_mode(scale, transpose=0):
# find mode scheme based on original scale
l = scale[transpose:]
# create complete 16-elements list of steps
i = ceil((16 - len(l)) / 12)
l += scale * i
l = list(accumulate(l))
n = l[0]
l = list(map(lambda x: x - n, l))
return l[:16] | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def setScale(self, mode='ACC', scale=0):\r\n\t\tif mode.upper() == 'ACC':\r\n\t\t\treg = 0x1C\r\n\t\telif mode.upper() == 'GYR':\r\n\t\t\treg = 0x1B\t\t\r\n\t\telse:\r\n\t\t\treturn False\r\n\t\tcurrentVal = self.read(reg)\r\n\t\tcurrentVal = self.dec2BinList(currentVal)\r\n\t\tscale = self.dec2BinList(value=scale... | [
"0.6633015",
"0.6360772",
"0.62977636",
"0.62056977",
"0.6008764",
"0.60017097",
"0.5995628",
"0.5878364",
"0.5820572",
"0.58104134",
"0.5709557",
"0.56858575",
"0.5675628",
"0.56720704",
"0.5600536",
"0.55899876",
"0.5563008",
"0.5555391",
"0.55215645",
"0.55069333",
"0.5503... | 0.6723477 | 0 |
Create xlength step cycled scale pattern | def scale_to_16(scale, mode=0, base=0, length=16):
pattern = deque(scale)
pattern.rotate(mode)
result = deque(islice(cycle(pattern), (length - 1)))
result.appendleft(base)
res_acc = list(accumulate(result))
return res_acc | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def discrete_layer(width: float, steps: int) -> list:\n\n min_x = 0.001\n steps = steps/2\n\n def sum_function(stretch_factor):\n return width - min_x * ((1 - stretch_factor**steps)/(1 - stretch_factor))\n\n stretch = float(fsolve(sum_function, 1.3)[0])\n\n return sub_division(width, min_x, s... | [
"0.59693444",
"0.566605",
"0.5649455",
"0.5492841",
"0.5478045",
"0.5360125",
"0.53543776",
"0.53307503",
"0.5323359",
"0.5312762",
"0.5300492",
"0.5283537",
"0.52573586",
"0.5251563",
"0.52463603",
"0.52405894",
"0.52343446",
"0.51484567",
"0.5146416",
"0.5121765",
"0.510040... | 0.4679375 | 78 |
split midi 0127 values range in equal parts | def pad_intervals(parts, duration=128):
part_duration = duration / (parts + 1)
return [int((i + 1) * part_duration) for i in range(parts)] | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def clamp_midi(sequence):\r\n return sequence[:, MIN_NOTE:MAX_NOTE, :]",
"def test_step_to_midi_04():\n # This should produce 131, above range.\n step = 'C'\n alter = -1\n octave = 10\n with pytest.raises(Exception):\n U.step_to_midi(step, octave, alter)\n # This should produce 128, 1... | [
"0.633378",
"0.551024",
"0.5489791",
"0.5481086",
"0.5435663",
"0.5356096",
"0.53525054",
"0.5336537",
"0.53029305",
"0.52928007",
"0.52525324",
"0.52401626",
"0.5239775",
"0.5234048",
"0.5220844",
"0.5213896",
"0.51938474",
"0.51900053",
"0.51806563",
"0.51787907",
"0.516458... | 0.49355653 | 50 |
This function is from the latest version of SCons to support older SCons version. Configure check for a specific program. Check whether program prog_name exists in path. If it is found, returns the path for it, otherwise returns None. | def CheckProg(context, prog_name):
context.Message("Checking whether %s program exists..." % prog_name)
path = context.env.WhereIs(prog_name)
context.Result(bool(path))
return path | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def find_program(binary_name):\n pth = os.path.abspath(__file__)\n\n # Split off the name and the directory...\n pth, notused = os.path.split(pth)\n pth, notused = os.path.split(pth)\n pth = os.path.join(pth, \"programs\", binary_name)\n pth = os.path.normpath(pth)\n\n log.debug(\"Checking for... | [
"0.67661804",
"0.66921204",
"0.65894896",
"0.6528314",
"0.64908946",
"0.6469822",
"0.641857",
"0.63612264",
"0.6318409",
"0.6250026",
"0.61892205",
"0.61833847",
"0.61833847",
"0.61687654",
"0.61340445",
"0.61195254",
"0.61188084",
"0.6089571",
"0.6089144",
"0.6088777",
"0.60... | 0.7263758 | 0 |
This function is from SCons but extended with additional flags, e.g. the extra_libs. Another (more sophisticated) test for a library. Checks, if library and header is available for language (may be 'C' or 'CXX'). Call maybe be a valid expression _with_ a trailing ';'. As in CheckLib, we support library=None, to test if the call compiles without extra link flags. | def CheckLibWithHeader(context, libs, header, language,
call = None, extra_libs = None, autoadd = 1):
prog_prefix, dummy = \
SCons.SConf.createIncludesFromHeaders(header, 0)
if libs == []:
libs = [None]
if not SCons.Util.is_List(libs):
libs = [libs]
res = SCons.Conftest.CheckLib(context, libs, None, prog_prefix,
call = call, language = language, extra_libs = extra_libs,
autoadd = autoadd)
context.did_show_result = 1
return not res | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def check_library(self, **kw):\n\tself.check(\n\t\tcompile_filename = [],\n\t\tfeatures = 'link_lib_test',\n\t\tmsg = 'Checking for libraries',\n\t\t)",
"def check_libraries(env):\n # Detect OS X python installation, and attempt to correct for it.\n if os.uname()[0] == 'Darwin':\n env.Replace(SHLINK... | [
"0.70988935",
"0.6297976",
"0.60500425",
"0.56923157",
"0.55388916",
"0.5488028",
"0.53949934",
"0.5367634",
"0.532435",
"0.5322072",
"0.5235258",
"0.5161452",
"0.5156778",
"0.51427037",
"0.5137287",
"0.5064834",
"0.501241",
"0.4967916",
"0.49471545",
"0.49432126",
"0.4930325... | 0.71553355 | 0 |
Generate a normal distribution of sleep patterns based around 7 hours of sleep a day | def _get_random_sleep_series(index, mean=60 * 7, std_dev=60):
data_points_to_create = len(index)
sleep_times = np.random.normal(loc=mean, scale=std_dev, size=data_points_to_create)
sleep_series = pd.Series(sleep_times, index=index)
return sleep_series | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def generate_rand_7():\n\n while(True):\n # This generates a random number uniformly distributed between 1 and 24.\n # The first term is 5 times a rand num between 1 - 4, yielding {5, 10,\n # 15, 20}. The second is a rand num between 1 - 4.\n # Since the two numbers are *independent*... | [
"0.62330836",
"0.59178996",
"0.58577496",
"0.57935345",
"0.5758614",
"0.5758422",
"0.5744238",
"0.5741066",
"0.5537405",
"0.5528022",
"0.5510911",
"0.549863",
"0.548807",
"0.5447449",
"0.544088",
"0.54101473",
"0.53661644",
"0.5355117",
"0.53540385",
"0.53415316",
"0.53243715... | 0.5421668 | 15 |
Used for fetching the attributes for __init__. | def _connect(self):
try:
return self.query('/')
except Exception as err:
log.error('%s: %s', self.baseurl, err)
raise NotFound('No server found at: %s' % self.baseurl) | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def init_attrs(self):\n raise NotImplementedError",
"def __attrs_post_init__(self):",
"def attributes(self):\n ...",
"def attributes(self):",
"def extra_init(self):\n pass",
"def __init__():",
"def _init_attributes(self):\n self.attr = {\n 'name': None,\n ... | [
"0.7480157",
"0.72398555",
"0.7138921",
"0.71215737",
"0.66924196",
"0.66607845",
"0.6618965",
"0.65260583",
"0.65222377",
"0.6492983",
"0.6481646",
"0.63778156",
"0.6333728",
"0.6315431",
"0.6311145",
"0.6308918",
"0.6308918",
"0.6308918",
"0.6308918",
"0.6308918",
"0.630891... | 0.0 | -1 |
Library to browse or search your media. | def library(self):
if not self._library:
self._library = Library(self, self.query('/library/'))
return self._library | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"async def async_browse_media(self, media_content_type=None, media_content_id=None):\n return await media_source.async_browse_media(\n self.hass,\n media_content_id,\n content_filter=lambda item: item.media_content_type.startswith(\"audio/\"),\n )\n \n #T... | [
"0.668259",
"0.61301744",
"0.60395354",
"0.59826845",
"0.5969798",
"0.59561574",
"0.57918155",
"0.5790495",
"0.57535",
"0.57049066",
"0.56371135",
"0.55711895",
"0.55135405",
"0.54885805",
"0.54820323",
"0.5427746",
"0.54237807",
"0.5411913",
"0.54091287",
"0.5393908",
"0.538... | 0.0 | -1 |
Query PMS for all clients connected to PMS. | def clients(self):
items = []
for elem in self.query('/clients'):
baseurl = 'http://%s:%s' % (elem.attrib['address'],
elem.attrib['port'])
items.append(PlexClient(baseurl, server=self, data=elem))
return items | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def serviceQueries(self):\n #log.debug(f\"{self.name}: servicing queries for {len(self.connections)} connections.\")\n for ca, requester in self.connections.items():\n if requester.ims:\n log.info(\"Server %s received:\\n%s\\n\", self.name, requester.ims)\n re... | [
"0.6438978",
"0.615843",
"0.61226875",
"0.59365004",
"0.5798395",
"0.5786192",
"0.5703405",
"0.56942713",
"0.5646254",
"0.5593451",
"0.5584262",
"0.556786",
"0.55544364",
"0.55305445",
"0.5511454",
"0.5496943",
"0.54856825",
"0.5469359",
"0.54657024",
"0.5449885",
"0.5416547"... | 0.58461624 | 4 |
Querys PMS for all clients connected to PMS. | def client(self, name):
for elem in self.query('/clients'):
if elem.attrib.get('name').lower() == name.lower():
baseurl = 'http://%s:%s' % (
elem.attrib['address'], elem.attrib['port'])
return PlexClient(baseurl, server=self, data=elem)
raise NotFound('Unknown client name: %s' % name) | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def serviceQueries(self):\n #log.debug(f\"{self.name}: servicing queries for {len(self.connections)} connections.\")\n for ca, requester in self.connections.items():\n if requester.ims:\n log.info(\"Server %s received:\\n%s\\n\", self.name, requester.ims)\n re... | [
"0.65767473",
"0.6232553",
"0.60960466",
"0.5942476",
"0.5886892",
"0.58853275",
"0.57991374",
"0.578795",
"0.5773331",
"0.5660284",
"0.565363",
"0.56275344",
"0.55649745",
"0.556454",
"0.5544258",
"0.5528457",
"0.55071217",
"0.5499738",
"0.549224",
"0.5471458",
"0.54629916",... | 0.0 | -1 |
Headers given to PMS. | def headers(self):
headers = BASE_HEADERS
if self.token:
headers['X-Plex-Token'] = self.token
return headers | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def headers(self) -> dict:\n raise NotImplementedError # pragma: no cover",
"def get_headers(self):\r\n raise NotImplementedError",
"def getAllHeaders():",
"def headers(self):\n\n return None",
"def headers(self) -> Mapping[str, str]:\n return pulumi.get(self, \"headers\")",
... | [
"0.7567973",
"0.7393012",
"0.7389167",
"0.72775483",
"0.7240663",
"0.723666",
"0.720173",
"0.720087",
"0.71737015",
"0.71737015",
"0.7157145",
"0.7148502",
"0.7143607",
"0.7109385",
"0.7090964",
"0.7078412",
"0.70776564",
"0.70776564",
"0.70469546",
"0.70202124",
"0.70194054"... | 0.73056155 | 3 |
Returns a playlist with a given name or raise NotFound. | def playlist(self, title): # noqa
for item in self.playlists():
if item.title == title:
return item
raise NotFound('Invalid playlist title: %s' % title) | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def getPlaylist(self,name):\n playlist = self.getAllPlaylists(name)\n return playlist[0] if playlist else None",
"def find_playlist(playlist_name):\n\n playlists = spotifyObject.user_playlists(config.USERNAME)\n\n for playlist in playlists['items']:\n if playlist['name'] == playlist_na... | [
"0.7941071",
"0.7861843",
"0.78293544",
"0.7535346",
"0.69100803",
"0.6823972",
"0.6806134",
"0.6756279",
"0.67378354",
"0.6722012",
"0.6667086",
"0.66420937",
"0.65845215",
"0.65714145",
"0.6559312",
"0.65355885",
"0.65215516",
"0.6419069",
"0.63462394",
"0.63388675",
"0.629... | 0.79534113 | 0 |
Main method used to handle http connection to PMS. encodes the response to utf8 and parses the xml returned from PMS into a Element | def query(self, path, method=None, headers=None, **kwargs):
url = self.url(path)
method = method or self.session.get
log.info('%s %s', method.__name__.upper(), url)
h = self.headers().copy()
if headers:
h.update(headers)
response = method(url, headers=h, timeout=TIMEOUT, **kwargs)
if response.status_code not in [200, 201]:
codename = codes.get(response.status_code)[0]
raise BadRequest('(%s) %s' % (response.status_code, codename))
data = response.text.encode('utf8')
return ElementTree.fromstring(data) if data else None | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def parse_response(self, resp):\n p, u = self.getparser()\n\n if hasattr(resp, 'text'):\n # modern requests will do this for us\n text = resp.text # this is unicode(py2)/str(py3)\n else:\n\n encoding = requests.utils.get_encoding_from_headers(resp.headers)\n ... | [
"0.592283",
"0.5827948",
"0.579195",
"0.5679414",
"0.5676833",
"0.5584127",
"0.55087835",
"0.54462636",
"0.54320216",
"0.5430315",
"0.53699476",
"0.53515357",
"0.5332319",
"0.53168535",
"0.52934587",
"0.52518004",
"0.5248539",
"0.52266735",
"0.52137244",
"0.52040625",
"0.5204... | 0.0 | -1 |
Searching within a library section is much more powerful. | def search(self, query, mediatype=None):
items = utils.listItems(self, '/search?query=%s' % quote(query))
if mediatype:
return [item for item in items if item.type == mediatype]
return items | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def book_search(library: list) -> None:\n options = ['Author', 'Title', 'Publisher', 'Shelf', 'Category', 'Subject']\n prompt = '\\nWhat option would you like to search by?'\n choice = get_user_choice(options, prompt)\n if choice == '1':\n search_by_chosen_option(library, options[0])\n elif c... | [
"0.66239214",
"0.5919388",
"0.5910919",
"0.58785844",
"0.58637214",
"0.58380646",
"0.58259964",
"0.58247703",
"0.57671076",
"0.5762657",
"0.5658307",
"0.5657428",
"0.56097376",
"0.5589635",
"0.55391014",
"0.55387616",
"0.5529388",
"0.55221266",
"0.5514941",
"0.5492186",
"0.54... | 0.0 | -1 |
List all active sessions. | def sessions(self):
return utils.listItems(self, '/status/sessions') | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def get_sessions(self):\n\n return self.all_sessions",
"def get_sessions_list():\n sessions = Session.query.all()\n result = sessions_schema.dump(sessions).data\n return jsonify({'status': 'success', 'message': None, 'data': result}), 200",
"def fusion_api_get_active_sessions(self):\n ... | [
"0.75758445",
"0.757478",
"0.7396808",
"0.7384779",
"0.73801714",
"0.72702295",
"0.71300334",
"0.7045607",
"0.7029493",
"0.6845006",
"0.679199",
"0.6788236",
"0.6770604",
"0.6673959",
"0.6615374",
"0.65827996",
"0.6541172",
"0.65161306",
"0.6476787",
"0.6473066",
"0.647231",
... | 0.76642567 | 0 |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.